Gene Symbol | Gene ID | Gene Info |
---|---|---|
Hoxb8
|
ENSMUSG00000056648.4 | homeobox B8 |
Pdx1
|
ENSMUSG00000029644.6 | pancreatic and duodenal homeobox 1 |
CRE | Gene | Distance | Association probability | Pearson corr. coef. | P-value | Plot |
---|---|---|---|---|---|---|
Hoxb8 | chr11_96284381_96284532 | 1731 | 0.139922 | 0.68 | 1.1e-08 | Click! |
Hoxb8 | chr11_96282097_96282248 | 267 | 0.771747 | 0.58 | 3.9e-06 | Click! |
Hoxb8 | chr11_96278896_96279052 | 2931 | 0.096877 | 0.54 | 1.8e-05 | Click! |
Hoxb8 | chr11_96284544_96284698 | 1896 | 0.126605 | 0.54 | 2.0e-05 | Click! |
Pdx1 | chr5_147270185_147270336 | 301 | 0.710511 | 0.50 | 1.0e-04 | Click! |
Pdx1 | chr5_147236002_147236153 | 33882 | 0.089134 | 0.42 | 1.5e-03 | Click! |
Pdx1 | chr5_147235527_147235684 | 34354 | 0.088561 | 0.36 | 7.7e-03 | Click! |
Pdx1 | chr5_147269974_147270160 | 108 | 0.906406 | 0.35 | 9.7e-03 | Click! |
Pdx1 | chr5_147235790_147235941 | 34094 | 0.088877 | 0.33 | 1.5e-02 | Click! |
Move your cursor over a bar to see sample name and corresponding Z-value.
Cis Regulatory Element (CRE) | Target Score | Top associated gene | Gene Info | Distance of CRE to TSS | CRE/Gene association probability |
---|---|---|---|---|---|
chr11_96351824_96352086 | 9.91 |
Hoxb2 |
homeobox B2 |
324 |
0.74 |
chr6_52163698_52164573 | 9.06 |
Hoxa2 |
homeobox A2 |
696 |
0.33 |
chr5_67572619_67572866 | 8.49 |
1700025A08Rik |
RIKEN cDNA 1700025A08 gene |
35084 |
0.11 |
chr1_178677184_178677552 | 8.48 |
Gm24405 |
predicted gene, 24405 |
40463 |
0.18 |
chr16_44672098_44672717 | 8.48 |
Nepro |
nucleolus and neural progenitor protein |
51894 |
0.11 |
chr7_6727792_6729098 | 7.95 |
Peg3 |
paternally expressed 3 |
1974 |
0.16 |
chr1_9988530_9988916 | 7.20 |
Ppp1r42 |
protein phosphatase 1, regulatory subunit 42 |
3031 |
0.14 |
chr11_96341091_96341294 | 7.09 |
Hoxb3 |
homeobox B3 |
247 |
0.75 |
chr17_81270447_81270598 | 7.08 |
Gm50042 |
predicted gene, 50042 |
23784 |
0.2 |
chr8_102596538_102596950 | 6.22 |
Cdh11 |
cadherin 11 |
40575 |
0.15 |
chr2_64172372_64172844 | 5.83 |
Fign |
fidgetin |
74570 |
0.13 |
chr15_103065623_103065992 | 5.65 |
5730585A16Rik |
RIKEN cDNA 5730585A16 gene |
6501 |
0.1 |
chr18_84073507_84073839 | 5.61 |
Tshz1 |
teashirt zinc finger family member 1 |
11402 |
0.16 |
chr5_67572898_67573066 | 5.48 |
1700025A08Rik |
RIKEN cDNA 1700025A08 gene |
34844 |
0.11 |
chr14_22168765_22168930 | 5.42 |
Gm7480 |
predicted gene 7480 |
132744 |
0.04 |
chr7_70796274_70796499 | 5.40 |
Gm24880 |
predicted gene, 24880 |
43970 |
0.16 |
chr18_84070299_84070882 | 5.35 |
Tshz1 |
teashirt zinc finger family member 1 |
14485 |
0.16 |
chr15_20837074_20837310 | 5.17 |
Gm25711 |
predicted gene, 25711 |
71680 |
0.11 |
chr6_52161197_52161390 | 5.16 |
Hotairm1 |
Hoxa transcript antisense RNA, myeloid-specific 1 |
2769 |
0.08 |
chr17_90382604_90382824 | 5.15 |
Nrxn1 |
neurexin I |
33354 |
0.21 |
chr1_59315083_59315445 | 5.14 |
Cdk15 |
cyclin-dependent kinase 15 |
16328 |
0.19 |
chr2_83681865_83682039 | 5.12 |
Gm13686 |
predicted gene 13686 |
19164 |
0.15 |
chr5_89147272_89147624 | 5.06 |
Slc4a4 |
solute carrier family 4 (anion exchanger), member 4 |
119356 |
0.06 |
chr5_117651634_117651798 | 5.05 |
Nos1 |
nitric oxide synthase 1, neuronal |
129316 |
0.05 |
chr11_96333479_96333781 | 5.04 |
Hoxb3 |
homeobox B3 |
5568 |
0.08 |
chr14_21903554_21904173 | 5.03 |
4931407E12Rik |
RIKEN cDNA 4931407E12 gene |
14097 |
0.14 |
chr11_96270905_96271430 | 4.96 |
Hoxb9 |
homeobox B9 |
290 |
0.76 |
chr16_23307666_23307877 | 4.93 |
St6gal1 |
beta galactoside alpha 2,6 sialyltransferase 1 |
17301 |
0.17 |
chr2_74681996_74682462 | 4.91 |
Hoxd11 |
homeobox D11 |
94 |
0.87 |
chr6_103675242_103675393 | 4.90 |
Chl1 |
cell adhesion molecule L1-like |
22433 |
0.19 |
chr1_78198054_78198266 | 4.79 |
Pax3 |
paired box 3 |
1026 |
0.59 |
chr14_21891851_21892045 | 4.77 |
4931407E12Rik |
RIKEN cDNA 4931407E12 gene |
2182 |
0.25 |
chr6_39373597_39373878 | 4.76 |
Slc37a3 |
solute carrier family 37 (glycerol-3-phosphate transporter), member 3 |
807 |
0.55 |
chr4_62659292_62659611 | 4.75 |
Rgs3 |
regulator of G-protein signaling 3 |
4171 |
0.2 |
chr1_162037946_162038745 | 4.70 |
2810442N19Rik |
RIKEN cDNA 2810442N19 gene |
33173 |
0.12 |
chr3_127874309_127874632 | 4.66 |
Gm43652 |
predicted gene 43652 |
10612 |
0.11 |
chr14_16901849_16902015 | 4.61 |
Tpi-rs9 |
triosephosphate isomerase related sequence 9 |
44727 |
0.16 |
chr13_72727296_72727551 | 4.60 |
Gm47890 |
predicted gene, 47890 |
24574 |
0.19 |
chr13_32080651_32080802 | 4.59 |
Gm48885 |
predicted gene, 48885 |
18449 |
0.25 |
chr2_22096712_22096917 | 4.59 |
Gm13337 |
predicted gene 13337 |
28988 |
0.25 |
chr16_30244126_30244284 | 4.56 |
Gm49645 |
predicted gene, 49645 |
10947 |
0.14 |
chr9_89496663_89497009 | 4.53 |
Gm47403 |
predicted gene, 47403 |
63548 |
0.11 |
chr16_44629994_44630289 | 4.52 |
Boc |
biregional cell adhesion molecule-related/down-regulated by oncogenes (Cdon) binding protein |
71244 |
0.09 |
chr1_14570538_14570748 | 4.50 |
Gm9947 |
predicted gene 9947 |
182294 |
0.03 |
chr17_85748614_85749073 | 4.49 |
CJ186046Rik |
Riken cDNA CJ186046 gene |
55214 |
0.11 |
chr4_95278814_95279018 | 4.47 |
Gm12708 |
predicted gene 12708 |
85554 |
0.08 |
chr4_151310204_151310390 | 4.41 |
4930589P08Rik |
RIKEN cDNA 4930589P08 gene |
66173 |
0.13 |
chr16_73530240_73530441 | 4.40 |
Gm49680 |
predicted gene, 49680 |
45483 |
0.16 |
chr6_111781759_111781959 | 4.36 |
Gm22093 |
predicted gene, 22093 |
178607 |
0.03 |
chr2_6506058_6506719 | 4.34 |
Gm38386 |
predicted gene, 38386 |
26698 |
0.17 |
chr14_31564746_31565181 | 4.26 |
Colq |
collagen-like tail subunit (single strand of homotrimer) of asymmetric acetylcholinesterase |
6823 |
0.16 |
chr5_74905641_74905990 | 4.21 |
Gm17906 |
predicted gene, 17906 |
22480 |
0.17 |
chr2_95232148_95232706 | 4.17 |
Gm13794 |
predicted gene 13794 |
161815 |
0.04 |
chr10_83957548_83957699 | 4.17 |
C230099D08Rik |
RIKEN cDNA C230099D08 gene |
47237 |
0.14 |
chr2_113674689_113675355 | 4.15 |
Fmn1 |
formin 1 |
10068 |
0.22 |
chr5_46572933_46573088 | 4.15 |
Gm43093 |
predicted gene 43093 |
70881 |
0.13 |
chr1_168967432_168967588 | 4.12 |
Mir6354 |
microRNA 6354 |
51579 |
0.19 |
chr9_52650469_52650629 | 4.11 |
AI593442 |
expressed sequence AI593442 |
28880 |
0.18 |
chr7_71023737_71023888 | 4.10 |
Gm39033 |
predicted gene, 39033 |
73235 |
0.1 |
chr18_83185182_83185655 | 4.10 |
1700095A13Rik |
RIKEN cDNA 1700095A13 gene |
77528 |
0.09 |
chr6_52225788_52226610 | 4.06 |
Hoxa9 |
homeobox A9 |
10 |
0.91 |
chr7_16172223_16172580 | 4.03 |
Meis3 |
Meis homeobox 3 |
2689 |
0.17 |
chr2_106822641_106822960 | 4.03 |
Gm22813 |
predicted gene, 22813 |
13464 |
0.23 |
chr11_19737297_19737455 | 4.03 |
Gm12028 |
predicted gene 12028 |
12690 |
0.18 |
chr5_136051573_136051966 | 4.02 |
Upk3bl |
uroplakin 3B-like |
2723 |
0.15 |
chr2_74753059_74753213 | 4.02 |
Haglr |
Hoxd antisense growth associated long non-coding RNA |
311 |
0.51 |
chr9_77782294_77782445 | 4.01 |
Gclc |
glutamate-cysteine ligase, catalytic subunit |
16227 |
0.13 |
chr11_18874433_18875057 | 4.00 |
8430419K02Rik |
RIKEN cDNA 8430419K02 gene |
436 |
0.81 |
chr5_46083575_46083759 | 3.98 |
4930405L22Rik |
RIKEN cDNA 4930405L22 gene |
151258 |
0.04 |
chr7_111282340_111282663 | 3.95 |
5430402P08Rik |
RIKEN cDNA 5430402P08 gene |
83797 |
0.09 |
chr10_84967811_84967962 | 3.95 |
Ric8b |
RIC8 guanine nucleotide exchange factor B |
30493 |
0.2 |
chr10_99229387_99229562 | 3.94 |
Gm34574 |
predicted gene, 34574 |
568 |
0.62 |
chr2_171734745_171734896 | 3.93 |
1700028P15Rik |
RIKEN cDNA 1700028P15 gene |
227311 |
0.02 |
chr8_26974090_26974312 | 3.92 |
Zfp703 |
zinc finger protein 703 |
3124 |
0.14 |
chr18_61729198_61729413 | 3.91 |
1500015A07Rik |
RIKEN cDNA 1500015A07 gene |
2872 |
0.16 |
chr12_13444793_13444944 | 3.90 |
Gm35638 |
predicted gene, 35638 |
7770 |
0.14 |
chr15_11529915_11530332 | 3.90 |
Gm49107 |
predicted gene, 49107 |
100606 |
0.07 |
chr9_117172643_117172794 | 3.88 |
Rbms3 |
RNA binding motif, single stranded interacting protein |
78879 |
0.1 |
chr6_52165009_52165376 | 3.85 |
Hoxa2 |
homeobox A2 |
361 |
0.46 |
chr6_36890255_36890607 | 3.83 |
1700111E14Rik |
RIKEN cDNA 1700111E14 gene |
46617 |
0.15 |
chr5_67539883_67540078 | 3.82 |
1700025A08Rik |
RIKEN cDNA 1700025A08 gene |
67846 |
0.07 |
chr9_54752314_54752559 | 3.81 |
Crabp1 |
cellular retinoic acid binding protein I |
12312 |
0.14 |
chr11_95926084_95926244 | 3.80 |
Gm24725 |
predicted gene, 24725 |
5062 |
0.12 |
chr10_51554222_51554373 | 3.79 |
Gm48787 |
predicted gene, 48787 |
2850 |
0.15 |
chr16_37964073_37964255 | 3.77 |
Gm25140 |
predicted gene, 25140 |
15923 |
0.18 |
chr5_121981639_121982165 | 3.76 |
Cux2 |
cut-like homeobox 2 |
20442 |
0.15 |
chr15_56858164_56858547 | 3.74 |
Gm5673 |
predicted gene 5673 |
74927 |
0.11 |
chr17_69062485_69062643 | 3.73 |
Epb41l3 |
erythrocyte membrane protein band 4.1 like 3 |
13119 |
0.28 |
chr3_81369858_81370009 | 3.73 |
Gm37300 |
predicted gene, 37300 |
35639 |
0.23 |
chr6_138379656_138379846 | 3.72 |
Lmo3 |
LIM domain only 3 |
41701 |
0.16 |
chr11_35971439_35971781 | 3.70 |
Wwc1 |
WW, C2 and coiled-coil domain containing 1 |
8917 |
0.23 |
chr13_104634831_104634982 | 3.69 |
2610204G07Rik |
RIKEN cDNA 2610204G07 gene |
50025 |
0.17 |
chr7_16173141_16173498 | 3.69 |
Meis3 |
Meis homeobox 3 |
1771 |
0.24 |
chr18_68794524_68795000 | 3.68 |
Gm50260 |
predicted gene, 50260 |
10596 |
0.25 |
chr18_4137618_4137847 | 3.67 |
Lyzl1 |
lysozyme-like 1 |
28100 |
0.19 |
chr11_55681310_55681474 | 3.67 |
Glra1 |
glycine receptor, alpha 1 subunit |
73194 |
0.1 |
chr5_148152885_148153053 | 3.66 |
Gm10167 |
predicted pseudogene 10167 |
31408 |
0.18 |
chr10_55624833_55625008 | 3.64 |
Gm29794 |
predicted gene, 29794 |
477083 |
0.01 |
chr2_115631313_115631464 | 3.64 |
Mir1951 |
microRNA 1951 |
7337 |
0.24 |
chr1_36273210_36273670 | 3.62 |
Neurl3 |
neuralized E3 ubiquitin protein ligase 3 |
5 |
0.97 |
chr5_66337123_66338408 | 3.61 |
Apbb2 |
amyloid beta (A4) precursor protein-binding, family B, member 2 |
83 |
0.96 |
chr3_134243548_134243719 | 3.60 |
Gm26691 |
predicted gene, 26691 |
2992 |
0.16 |
chr15_37323926_37324086 | 3.60 |
Grhl2 |
grainyhead like transcription factor 2 |
5603 |
0.16 |
chr13_70311837_70312012 | 3.59 |
4930520P13Rik |
RIKEN cDNA 4930520P13 gene |
79102 |
0.09 |
chr1_78203643_78204022 | 3.59 |
Pax3 |
paired box 3 |
6698 |
0.23 |
chr1_20428787_20428938 | 3.59 |
Gm15795 |
predicted gene 15795 |
15948 |
0.17 |
chr10_52271386_52271694 | 3.59 |
Dcbld1 |
discoidin, CUB and LCCL domain containing 1 |
37903 |
0.12 |
chr3_37906780_37907292 | 3.58 |
Gm20755 |
predicted gene, 20755 |
8223 |
0.18 |
chr18_13221854_13222283 | 3.56 |
Gm22251 |
predicted gene, 22251 |
12260 |
0.23 |
chr6_112495320_112495494 | 3.55 |
Oxtr |
oxytocin receptor |
5464 |
0.18 |
chr8_26770434_26770629 | 3.53 |
Gm45647 |
predicted gene 45647 |
9784 |
0.17 |
chr12_104736273_104736457 | 3.53 |
Dicer1 |
dicer 1, ribonuclease type III |
2472 |
0.33 |
chr7_58736928_58737203 | 3.52 |
Gm44937 |
predicted gene 44937 |
16866 |
0.18 |
chr1_166282380_166283234 | 3.50 |
5330438I03Rik |
RIKEN cDNA 5330438I03 gene |
26778 |
0.14 |
chr8_90254492_90254988 | 3.49 |
Tox3 |
TOX high mobility group box family member 3 |
93386 |
0.09 |
chr8_10962065_10962287 | 3.49 |
Gm44956 |
predicted gene 44956 |
8638 |
0.11 |
chr14_119582119_119582270 | 3.47 |
Gm6212 |
predicted gene 6212 |
61818 |
0.14 |
chr9_111535536_111535702 | 3.47 |
Gm42523 |
predicted gene 42523 |
13321 |
0.19 |
chr2_12019497_12019827 | 3.46 |
Gm13310 |
predicted gene 13310 |
64330 |
0.11 |
chr3_141498784_141498951 | 3.42 |
Unc5c |
unc-5 netrin receptor C |
33196 |
0.19 |
chr6_91963518_91963669 | 3.42 |
Fgd5 |
FYVE, RhoGEF and PH domain containing 5 |
15285 |
0.13 |
chr12_102731058_102731664 | 3.40 |
Gm28373 |
predicted gene 28373 |
4028 |
0.1 |
chr12_10179432_10179754 | 3.39 |
Gm48791 |
predicted gene, 48791 |
2450 |
0.31 |
chr18_58455394_58455793 | 3.39 |
Slc27a6 |
solute carrier family 27 (fatty acid transporter), member 6 |
100664 |
0.08 |
chr10_115572554_115572722 | 3.39 |
A930009A15Rik |
RIKEN cDNA A930009A15 gene |
2652 |
0.27 |
chr7_80347735_80347891 | 3.38 |
Unc45a |
unc-45 myosin chaperone A |
180 |
0.89 |
chr13_71270446_71270667 | 3.38 |
Mir466f-4 |
microRNA 466f-4 |
163467 |
0.04 |
chr8_26622757_26623107 | 3.37 |
Gm32050 |
predicted gene, 32050 |
4548 |
0.19 |
chr14_22783336_22783559 | 3.36 |
Gm7473 |
predicted gene 7473 |
8203 |
0.31 |
chr6_143260631_143261181 | 3.35 |
D6Ertd474e |
DNA segment, Chr 6, ERATO Doi 474, expressed |
15013 |
0.2 |
chr1_35528071_35528323 | 3.35 |
Gm37068 |
predicted gene, 37068 |
123100 |
0.06 |
chr6_52175357_52175664 | 3.34 |
Hoxaas3 |
Hoxa cluster antisense RNA 3 |
275 |
0.7 |
chr16_16561093_16561486 | 3.34 |
Fgd4 |
FYVE, RhoGEF and PH domain containing 4 |
1070 |
0.53 |
chr8_8994520_8995243 | 3.33 |
Gm44515 |
predicted gene 44515 |
62182 |
0.12 |
chr9_71241633_71241928 | 3.32 |
Aldh1a2 |
aldehyde dehydrogenase family 1, subfamily A2 |
25991 |
0.17 |
chr15_27259054_27259330 | 3.31 |
Gm19111 |
predicted gene, 19111 |
108747 |
0.07 |
chr4_148651072_148651361 | 3.30 |
Gm572 |
predicted gene 572 |
7899 |
0.14 |
chr9_17745693_17745850 | 3.29 |
Gm4977 |
predicted gene 4977 |
13101 |
0.21 |
chr6_52208691_52208985 | 3.29 |
Hoxa6 |
homeobox A6 |
116 |
0.86 |
chr1_72454742_72455180 | 3.29 |
Gm15843 |
predicted gene 15843 |
4538 |
0.27 |
chr1_164897199_164897632 | 3.29 |
Gm32569 |
predicted gene, 32569 |
2176 |
0.26 |
chr6_6697724_6697891 | 3.28 |
Gm20618 |
predicted gene 20618 |
6286 |
0.21 |
chr5_125264626_125264993 | 3.27 |
Gm32585 |
predicted gene, 32585 |
8006 |
0.18 |
chr6_107012941_107013282 | 3.27 |
Gm22418 |
predicted gene, 22418 |
11659 |
0.28 |
chr9_23041547_23042363 | 3.24 |
Bmper |
BMP-binding endothelial regulator |
181121 |
0.03 |
chr12_96749310_96749465 | 3.24 |
Gm47396 |
predicted gene, 47396 |
87073 |
0.1 |
chr8_8328417_8328625 | 3.23 |
A630009H07Rik |
RIKEN cDNA A630009H07 gene |
6556 |
0.2 |
chr14_19738470_19738798 | 3.23 |
Nid2 |
nidogen 2 |
12631 |
0.15 |
chr13_63305623_63305823 | 3.23 |
Mir3074-1 |
microRNA 3074-1 |
4440 |
0.09 |
chr11_30210200_30210515 | 3.23 |
Sptbn1 |
spectrin beta, non-erythrocytic 1 |
9415 |
0.25 |
chr6_52164761_52164938 | 3.22 |
Hoxa2 |
homeobox A2 |
18 |
0.89 |
chr6_122590057_122590215 | 3.22 |
Apobec1 |
apolipoprotein B mRNA editing enzyme, catalytic polypeptide 1 |
9991 |
0.1 |
chr1_85251281_85252082 | 3.19 |
C130026I21Rik |
RIKEN cDNA C130026I21 gene |
2867 |
0.17 |
chr9_29523209_29523462 | 3.19 |
Gm15521 |
predicted gene 15521 |
69175 |
0.13 |
chr2_146834171_146835145 | 3.18 |
Gm14114 |
predicted gene 14114 |
5074 |
0.25 |
chr16_86888571_86888722 | 3.17 |
Gm25715 |
predicted gene, 25715 |
43176 |
0.16 |
chr8_74871793_74871960 | 3.17 |
Isx |
intestine specific homeobox |
1297 |
0.52 |
chr16_77173296_77173604 | 3.17 |
Mir99ahg |
Mir99a and Mirlet7c-1 host gene (non-protein coding) |
62867 |
0.12 |
chr11_49931901_49932367 | 3.16 |
Rasgef1c |
RasGEF domain family, member 1C |
29973 |
0.14 |
chr14_21989580_21989988 | 3.16 |
Zfp503 |
zinc finger protein 503 |
183 |
0.92 |
chr3_30018246_30018397 | 3.16 |
Mecomos |
MDS1 and EVI1 complex locus, opposite strand |
793 |
0.66 |
chr10_98695143_98695427 | 3.16 |
Gm5427 |
predicted gene 5427 |
4425 |
0.34 |
chr2_128364053_128364204 | 3.16 |
Morrbid |
myeloid RNA regulator of BCL2L11 induced cell death |
30260 |
0.17 |
chr13_95999496_95999647 | 3.16 |
Sv2c |
synaptic vesicle glycoprotein 2c |
9345 |
0.22 |
chr2_85172390_85172701 | 3.15 |
Gm13713 |
predicted gene 13713 |
11767 |
0.11 |
chr13_20550099_20550250 | 3.14 |
Gm47657 |
predicted gene, 47657 |
45379 |
0.13 |
chr11_8781304_8781710 | 3.13 |
Gm11990 |
predicted gene 11990 |
25341 |
0.22 |
chr15_50666100_50666318 | 3.13 |
Trps1 |
transcriptional repressor GATA binding 1 |
161312 |
0.04 |
chr1_42472959_42473146 | 3.13 |
Gm37047 |
predicted gene, 37047 |
18761 |
0.24 |
chr6_142867302_142867453 | 3.13 |
St8sia1 |
ST8 alpha-N-acetyl-neuraminide alpha-2,8-sialyltransferase 1 |
15663 |
0.18 |
chr10_19531186_19531576 | 3.12 |
Gm48563 |
predicted gene, 48563 |
8731 |
0.2 |
chr9_102649978_102650461 | 3.10 |
Anapc13 |
anaphase promoting complex subunit 13 |
21707 |
0.11 |
chr1_137636933_137637223 | 3.10 |
Gm22727 |
predicted gene, 22727 |
97240 |
0.07 |
chr3_55336962_55337323 | 3.09 |
Gm19817 |
predicted gene, 19817 |
6301 |
0.18 |
chr9_78282534_78282801 | 3.09 |
Gm10639 |
predicted gene 10639 |
7256 |
0.09 |
chr10_125785483_125786054 | 3.09 |
Lrig3 |
leucine-rich repeats and immunoglobulin-like domains 3 |
180400 |
0.03 |
chr13_80514917_80515172 | 3.09 |
Gm46388 |
predicted gene, 46388 |
22035 |
0.27 |
chr15_103032811_103032985 | 3.09 |
Hoxc4 |
homeobox C4 |
1497 |
0.22 |
chr2_136108035_136108369 | 3.08 |
Gm14218 |
predicted gene 14218 |
28804 |
0.19 |
chr16_32484408_32484643 | 3.08 |
Slc51a |
solute carrier family 51, alpha subunit |
3178 |
0.16 |
chr12_37142164_37142324 | 3.08 |
Meox2 |
mesenchyme homeobox 2 |
33704 |
0.16 |
chr15_7625219_7625370 | 3.08 |
Gm37743 |
predicted gene, 37743 |
45046 |
0.15 |
chr2_128159114_128159265 | 3.07 |
Gm14009 |
predicted gene 14009 |
30798 |
0.16 |
chr14_22090754_22091218 | 3.06 |
Gm7480 |
predicted gene 7480 |
54883 |
0.11 |
chr7_136058784_136059216 | 3.06 |
Gm9341 |
predicted gene 9341 |
106202 |
0.06 |
chr8_50321472_50321623 | 3.05 |
Gm2516 |
predicted gene 2516 |
46565 |
0.17 |
chr8_26594087_26594265 | 3.05 |
Gm39149 |
predicted gene, 39149 |
14374 |
0.17 |
chr13_63117485_63117672 | 3.05 |
Aopep |
aminopeptidase O |
10056 |
0.15 |
chr2_130851881_130852032 | 3.04 |
4930402H24Rik |
RIKEN cDNA 4930402H24 gene |
11811 |
0.15 |
chr9_45507634_45507785 | 3.04 |
4833428L15Rik |
RIKEN cDNA 4833428L15 gene |
75979 |
0.07 |
chr1_137141965_137142142 | 3.03 |
Gm25609 |
predicted gene, 25609 |
73594 |
0.1 |
chr15_12517471_12517622 | 3.03 |
Pdzd2 |
PDZ domain containing 2 |
23987 |
0.18 |
chr8_26833351_26833567 | 3.03 |
2310008N11Rik |
RIKEN cDNA 2310008N11 gene |
8540 |
0.2 |
chr19_35151229_35151382 | 3.02 |
Gm50140 |
predicted gene, 50140 |
21777 |
0.2 |
chr13_73070260_73070539 | 3.00 |
Rpl31-ps2 |
ribosomal protein L31, pseudogene 2 |
162996 |
0.03 |
chr3_54406626_54406913 | 2.98 |
Postn |
periostin, osteoblast specific factor |
17880 |
0.25 |
chr14_14351950_14353283 | 2.98 |
Il3ra |
interleukin 3 receptor, alpha chain |
2995 |
0.15 |
chr5_54158308_54158653 | 2.96 |
Stim2 |
stromal interaction molecule 2 |
42623 |
0.18 |
chr11_88280628_88280864 | 2.95 |
Ccdc182 |
coiled-coil domain containing 182 |
13312 |
0.16 |
chr17_14231305_14231456 | 2.95 |
Gm34567 |
predicted gene, 34567 |
18471 |
0.15 |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
5.0 | 20.0 | GO:0021569 | rhombomere 3 development(GO:0021569) |
2.5 | 2.5 | GO:0021570 | rhombomere 4 development(GO:0021570) |
2.1 | 8.4 | GO:0021615 | glossopharyngeal nerve morphogenesis(GO:0021615) |
1.2 | 6.2 | GO:0014029 | neural crest formation(GO:0014029) |
1.0 | 2.9 | GO:0035860 | glial cell-derived neurotrophic factor receptor signaling pathway(GO:0035860) |
0.9 | 2.8 | GO:0072092 | ureteric bud invasion(GO:0072092) |
0.9 | 2.8 | GO:0050923 | regulation of negative chemotaxis(GO:0050923) |
0.9 | 4.6 | GO:0007494 | midgut development(GO:0007494) |
0.8 | 4.9 | GO:0070314 | G1 to G0 transition(GO:0070314) |
0.8 | 1.5 | GO:0072309 | mesenchymal stem cell maintenance involved in metanephric nephron morphogenesis(GO:0072309) |
0.7 | 2.1 | GO:1904479 | negative regulation of intestinal absorption(GO:1904479) |
0.7 | 0.7 | GO:1900200 | mesenchymal cell apoptotic process involved in metanephros development(GO:1900200) regulation of mesenchymal cell apoptotic process involved in metanephros development(GO:1900211) negative regulation of mesenchymal cell apoptotic process involved in metanephros development(GO:1900212) |
0.7 | 2.7 | GO:0030035 | microspike assembly(GO:0030035) |
0.6 | 1.9 | GO:0060435 | bronchiole development(GO:0060435) |
0.6 | 1.9 | GO:0003289 | atrial septum primum morphogenesis(GO:0003289) |
0.6 | 1.2 | GO:0035799 | ureter maturation(GO:0035799) |
0.6 | 0.6 | GO:0021563 | glossopharyngeal nerve development(GO:0021563) |
0.6 | 1.1 | GO:0072038 | mesenchymal stem cell maintenance involved in nephron morphogenesis(GO:0072038) |
0.5 | 1.1 | GO:0035993 | deltoid tuberosity development(GO:0035993) |
0.5 | 2.1 | GO:0009786 | regulation of asymmetric cell division(GO:0009786) |
0.5 | 1.5 | GO:0061030 | epithelial cell differentiation involved in mammary gland alveolus development(GO:0061030) |
0.5 | 0.5 | GO:0072069 | distal convoluted tubule development(GO:0072025) DCT cell differentiation(GO:0072069) metanephric distal convoluted tubule development(GO:0072221) metanephric distal tubule development(GO:0072235) metanephric DCT cell differentiation(GO:0072240) |
0.5 | 2.0 | GO:0098902 | regulation of membrane depolarization during action potential(GO:0098902) |
0.5 | 1.0 | GO:0021938 | smoothened signaling pathway involved in regulation of cerebellar granule cell precursor cell proliferation(GO:0021938) |
0.5 | 6.3 | GO:0060272 | embryonic skeletal joint morphogenesis(GO:0060272) |
0.5 | 1.4 | GO:0070366 | regulation of hepatocyte differentiation(GO:0070366) |
0.5 | 1.0 | GO:0035262 | gonad morphogenesis(GO:0035262) |
0.5 | 1.4 | GO:0015889 | cobalamin transport(GO:0015889) |
0.5 | 1.4 | GO:0042706 | eye photoreceptor cell fate commitment(GO:0042706) photoreceptor cell fate commitment(GO:0046552) |
0.5 | 1.4 | GO:1901509 | regulation of endothelial tube morphogenesis(GO:1901509) |
0.5 | 1.4 | GO:0016554 | cytidine to uridine editing(GO:0016554) |
0.5 | 2.3 | GO:0033564 | anterior/posterior axon guidance(GO:0033564) |
0.5 | 1.4 | GO:0035995 | detection of muscle stretch(GO:0035995) |
0.5 | 1.4 | GO:1904059 | regulation of locomotor rhythm(GO:1904059) |
0.5 | 1.4 | GO:0097503 | sialylation(GO:0097503) |
0.4 | 1.8 | GO:0035021 | negative regulation of Rac protein signal transduction(GO:0035021) |
0.4 | 3.1 | GO:0048387 | negative regulation of retinoic acid receptor signaling pathway(GO:0048387) |
0.4 | 2.6 | GO:0042118 | endothelial cell activation(GO:0042118) |
0.4 | 2.2 | GO:0060414 | aorta smooth muscle tissue morphogenesis(GO:0060414) |
0.4 | 1.3 | GO:0030423 | targeting of mRNA for destruction involved in RNA interference(GO:0030423) |
0.4 | 0.8 | GO:0072194 | kidney smooth muscle tissue development(GO:0072194) |
0.4 | 1.2 | GO:1902564 | negative regulation of neutrophil activation(GO:1902564) |
0.4 | 0.8 | GO:0048371 | lateral mesoderm morphogenesis(GO:0048369) lateral mesoderm formation(GO:0048370) lateral mesodermal cell differentiation(GO:0048371) |
0.4 | 1.2 | GO:0045218 | zonula adherens maintenance(GO:0045218) |
0.4 | 2.4 | GO:0090336 | positive regulation of brown fat cell differentiation(GO:0090336) |
0.4 | 1.2 | GO:0097623 | potassium ion export across plasma membrane(GO:0097623) |
0.4 | 1.2 | GO:0006068 | ethanol catabolic process(GO:0006068) |
0.4 | 1.2 | GO:0038044 | transforming growth factor-beta secretion(GO:0038044) regulation of transforming growth factor-beta secretion(GO:2001201) |
0.4 | 2.0 | GO:0060023 | soft palate development(GO:0060023) |
0.4 | 1.6 | GO:0002175 | protein localization to paranode region of axon(GO:0002175) |
0.4 | 2.4 | GO:1904424 | regulation of GTP binding(GO:1904424) |
0.4 | 3.1 | GO:0038063 | collagen-activated tyrosine kinase receptor signaling pathway(GO:0038063) |
0.4 | 1.5 | GO:0014734 | skeletal muscle hypertrophy(GO:0014734) |
0.4 | 1.5 | GO:0002023 | reduction of food intake in response to dietary excess(GO:0002023) |
0.4 | 2.3 | GO:0071447 | cellular response to hydroperoxide(GO:0071447) |
0.4 | 1.1 | GO:1904180 | negative regulation of mitochondrial depolarization(GO:0051902) negative regulation of membrane depolarization(GO:1904180) |
0.4 | 0.7 | GO:0010909 | regulation of heparan sulfate proteoglycan biosynthetic process(GO:0010908) positive regulation of heparan sulfate proteoglycan biosynthetic process(GO:0010909) positive regulation of proteoglycan biosynthetic process(GO:1902730) |
0.4 | 1.1 | GO:1903265 | positive regulation of tumor necrosis factor-mediated signaling pathway(GO:1903265) |
0.4 | 0.7 | GO:0070100 | negative regulation of chemokine-mediated signaling pathway(GO:0070100) |
0.4 | 1.1 | GO:0018242 | protein O-linked glycosylation via serine(GO:0018242) |
0.4 | 1.1 | GO:0003228 | atrial cardiac muscle tissue development(GO:0003228) atrial cardiac muscle tissue morphogenesis(GO:0055009) |
0.4 | 1.1 | GO:1990123 | L-glutamate(1-) import into cell(GO:1903802) L-glutamate import into cell(GO:1990123) |
0.4 | 1.1 | GO:0071673 | positive regulation of smooth muscle cell chemotaxis(GO:0071673) |
0.4 | 1.1 | GO:1902338 | negative regulation of apoptotic process involved in morphogenesis(GO:1902338) |
0.4 | 0.7 | GO:0045608 | negative regulation of auditory receptor cell differentiation(GO:0045608) |
0.3 | 1.0 | GO:0042427 | serotonin biosynthetic process(GO:0042427) primary amino compound biosynthetic process(GO:1901162) |
0.3 | 1.0 | GO:2000327 | regulation of ligand-dependent nuclear receptor transcription coactivator activity(GO:2000325) positive regulation of ligand-dependent nuclear receptor transcription coactivator activity(GO:2000327) |
0.3 | 0.3 | GO:0098910 | regulation of atrial cardiac muscle cell action potential(GO:0098910) |
0.3 | 1.7 | GO:0060373 | regulation of ventricular cardiac muscle cell membrane depolarization(GO:0060373) |
0.3 | 2.4 | GO:0090557 | establishment of endothelial intestinal barrier(GO:0090557) |
0.3 | 0.7 | GO:2000317 | negative regulation of T-helper 17 type immune response(GO:2000317) negative regulation of T-helper 17 cell differentiation(GO:2000320) |
0.3 | 0.3 | GO:0021847 | ventricular zone neuroblast division(GO:0021847) |
0.3 | 1.0 | GO:0031296 | B cell costimulation(GO:0031296) |
0.3 | 1.0 | GO:0042222 | interleukin-1 biosynthetic process(GO:0042222) |
0.3 | 0.3 | GO:0035283 | central nervous system segmentation(GO:0035283) brain segmentation(GO:0035284) |
0.3 | 0.9 | GO:0001757 | somite specification(GO:0001757) |
0.3 | 0.9 | GO:0097118 | neuroligin clustering involved in postsynaptic membrane assembly(GO:0097118) |
0.3 | 1.2 | GO:0042997 | negative regulation of Golgi to plasma membrane protein transport(GO:0042997) |
0.3 | 0.6 | GO:0010735 | positive regulation of transcription via serum response element binding(GO:0010735) |
0.3 | 0.3 | GO:0072282 | metanephric nephron tubule morphogenesis(GO:0072282) |
0.3 | 1.8 | GO:0015884 | folic acid transport(GO:0015884) |
0.3 | 1.2 | GO:0001920 | negative regulation of receptor recycling(GO:0001920) |
0.3 | 1.2 | GO:0090403 | oxidative stress-induced premature senescence(GO:0090403) |
0.3 | 0.9 | GO:0070858 | negative regulation of bile acid biosynthetic process(GO:0070858) negative regulation of bile acid metabolic process(GO:1904252) |
0.3 | 0.9 | GO:0006868 | glutamine transport(GO:0006868) |
0.3 | 0.9 | GO:0070358 | actin polymerization-dependent cell motility(GO:0070358) |
0.3 | 0.9 | GO:0098904 | regulation of AV node cell action potential(GO:0098904) |
0.3 | 1.4 | GO:0060666 | dichotomous subdivision of terminal units involved in salivary gland branching(GO:0060666) |
0.3 | 0.3 | GO:0003195 | tricuspid valve morphogenesis(GO:0003186) tricuspid valve formation(GO:0003195) |
0.3 | 1.1 | GO:0071638 | negative regulation of monocyte chemotactic protein-1 production(GO:0071638) |
0.3 | 0.3 | GO:0070343 | white fat cell proliferation(GO:0070343) regulation of white fat cell proliferation(GO:0070350) |
0.3 | 0.8 | GO:2000987 | positive regulation of fear response(GO:1903367) positive regulation of behavioral fear response(GO:2000987) |
0.3 | 1.6 | GO:0061002 | negative regulation of dendritic spine morphogenesis(GO:0061002) |
0.3 | 0.8 | GO:0090283 | regulation of protein glycosylation in Golgi(GO:0090283) |
0.3 | 1.1 | GO:0061309 | cardiac neural crest cell development involved in outflow tract morphogenesis(GO:0061309) |
0.3 | 1.3 | GO:0006776 | vitamin A metabolic process(GO:0006776) |
0.3 | 0.8 | GO:2000721 | positive regulation of transcription from RNA polymerase II promoter involved in smooth muscle cell differentiation(GO:2000721) |
0.3 | 1.1 | GO:2000143 | negative regulation of transcription initiation from RNA polymerase II promoter(GO:0060633) negative regulation of DNA-templated transcription, initiation(GO:2000143) |
0.3 | 0.8 | GO:0060737 | prostate gland morphogenetic growth(GO:0060737) |
0.3 | 1.1 | GO:0071415 | cellular response to caffeine(GO:0071313) cellular response to purine-containing compound(GO:0071415) |
0.3 | 0.5 | GO:0090038 | negative regulation of protein kinase C signaling(GO:0090038) |
0.3 | 1.1 | GO:0048386 | positive regulation of retinoic acid receptor signaling pathway(GO:0048386) |
0.3 | 1.8 | GO:0048681 | negative regulation of axon regeneration(GO:0048681) |
0.3 | 0.8 | GO:0035633 | maintenance of blood-brain barrier(GO:0035633) |
0.3 | 2.6 | GO:0060013 | righting reflex(GO:0060013) |
0.3 | 1.3 | GO:0032962 | positive regulation of inositol trisphosphate biosynthetic process(GO:0032962) |
0.3 | 0.8 | GO:2000412 | thymocyte migration(GO:0072679) regulation of thymocyte migration(GO:2000410) positive regulation of thymocyte migration(GO:2000412) |
0.2 | 0.7 | GO:0034653 | diterpenoid catabolic process(GO:0016103) retinoic acid catabolic process(GO:0034653) |
0.2 | 1.5 | GO:0051639 | actin filament network formation(GO:0051639) |
0.2 | 0.2 | GO:0060847 | endothelial cell fate specification(GO:0060847) |
0.2 | 0.7 | GO:0098735 | positive regulation of the force of heart contraction(GO:0098735) |
0.2 | 0.7 | GO:0009233 | menaquinone metabolic process(GO:0009233) |
0.2 | 1.2 | GO:0035331 | negative regulation of hippo signaling(GO:0035331) |
0.2 | 1.2 | GO:1904970 | brush border assembly(GO:1904970) |
0.2 | 0.5 | GO:0090310 | negative regulation of methylation-dependent chromatin silencing(GO:0090310) |
0.2 | 1.4 | GO:0051895 | negative regulation of focal adhesion assembly(GO:0051895) |
0.2 | 1.2 | GO:0030205 | dermatan sulfate metabolic process(GO:0030205) |
0.2 | 2.1 | GO:0045605 | negative regulation of epidermal cell differentiation(GO:0045605) |
0.2 | 0.9 | GO:0007171 | activation of transmembrane receptor protein tyrosine kinase activity(GO:0007171) |
0.2 | 0.7 | GO:1902988 | neurofibrillary tangle assembly(GO:1902988) regulation of neurofibrillary tangle assembly(GO:1902996) |
0.2 | 0.7 | GO:0052203 | modulation of catalytic activity in other organism involved in symbiotic interaction(GO:0052203) modulation by host of symbiont catalytic activity(GO:0052422) |
0.2 | 0.5 | GO:0032730 | positive regulation of interleukin-1 alpha production(GO:0032730) |
0.2 | 0.2 | GO:0003221 | right ventricular cardiac muscle tissue morphogenesis(GO:0003221) |
0.2 | 0.7 | GO:0007223 | Wnt signaling pathway, calcium modulating pathway(GO:0007223) |
0.2 | 0.9 | GO:0003344 | pericardium morphogenesis(GO:0003344) |
0.2 | 0.2 | GO:1901187 | regulation of ephrin receptor signaling pathway(GO:1901187) |
0.2 | 0.9 | GO:0046013 | regulation of T cell homeostatic proliferation(GO:0046013) |
0.2 | 1.1 | GO:1900042 | positive regulation of interleukin-2 secretion(GO:1900042) |
0.2 | 1.6 | GO:0060644 | mammary gland epithelial cell differentiation(GO:0060644) |
0.2 | 0.7 | GO:0071286 | cellular response to magnesium ion(GO:0071286) |
0.2 | 0.9 | GO:2001260 | regulation of semaphorin-plexin signaling pathway(GO:2001260) |
0.2 | 1.1 | GO:0060050 | positive regulation of protein glycosylation(GO:0060050) |
0.2 | 0.7 | GO:0008582 | regulation of synaptic growth at neuromuscular junction(GO:0008582) |
0.2 | 0.7 | GO:0032474 | otolith morphogenesis(GO:0032474) |
0.2 | 0.7 | GO:0072061 | inner medullary collecting duct development(GO:0072061) |
0.2 | 0.7 | GO:1901097 | negative regulation of autophagosome maturation(GO:1901097) |
0.2 | 0.2 | GO:1904706 | negative regulation of vascular smooth muscle cell proliferation(GO:1904706) |
0.2 | 0.4 | GO:0060221 | retinal rod cell differentiation(GO:0060221) |
0.2 | 0.6 | GO:0014826 | vein smooth muscle contraction(GO:0014826) |
0.2 | 1.5 | GO:0019852 | L-ascorbic acid metabolic process(GO:0019852) |
0.2 | 0.6 | GO:0071763 | nuclear membrane organization(GO:0071763) |
0.2 | 0.2 | GO:0071847 | TNFSF11-mediated signaling pathway(GO:0071847) |
0.2 | 0.4 | GO:2000828 | regulation of parathyroid hormone secretion(GO:2000828) |
0.2 | 0.6 | GO:0060154 | cellular process regulating host cell cycle in response to virus(GO:0060154) |
0.2 | 1.0 | GO:1902894 | negative regulation of pri-miRNA transcription from RNA polymerase II promoter(GO:1902894) |
0.2 | 1.7 | GO:0070131 | positive regulation of mitochondrial translation(GO:0070131) |
0.2 | 0.6 | GO:0060160 | negative regulation of dopamine receptor signaling pathway(GO:0060160) |
0.2 | 0.8 | GO:0019478 | D-amino acid catabolic process(GO:0019478) |
0.2 | 0.4 | GO:0060741 | prostate gland stromal morphogenesis(GO:0060741) |
0.2 | 0.4 | GO:0021986 | epithalamus development(GO:0021538) habenula development(GO:0021986) |
0.2 | 1.2 | GO:0099515 | actin filament-based transport(GO:0099515) |
0.2 | 0.6 | GO:1902498 | regulation of protein autoubiquitination(GO:1902498) |
0.2 | 0.4 | GO:2001054 | negative regulation of mesenchymal cell apoptotic process(GO:2001054) |
0.2 | 0.4 | GO:0042668 | auditory receptor cell fate determination(GO:0042668) |
0.2 | 0.4 | GO:0007403 | glial cell fate determination(GO:0007403) |
0.2 | 0.6 | GO:0060167 | regulation of adenosine receptor signaling pathway(GO:0060167) |
0.2 | 1.0 | GO:1903224 | regulation of endodermal cell differentiation(GO:1903224) |
0.2 | 1.4 | GO:0021957 | corticospinal tract morphogenesis(GO:0021957) |
0.2 | 1.0 | GO:0048505 | regulation of timing of cell differentiation(GO:0048505) |
0.2 | 0.8 | GO:2000574 | regulation of microtubule motor activity(GO:2000574) |
0.2 | 1.2 | GO:0042491 | auditory receptor cell differentiation(GO:0042491) |
0.2 | 0.4 | GO:1900020 | regulation of protein kinase C activity(GO:1900019) positive regulation of protein kinase C activity(GO:1900020) |
0.2 | 0.6 | GO:0061368 | behavioral response to chemical pain(GO:0061366) behavioral response to formalin induced pain(GO:0061368) |
0.2 | 0.4 | GO:0046684 | response to pyrethroid(GO:0046684) |
0.2 | 0.8 | GO:0045657 | positive regulation of monocyte differentiation(GO:0045657) |
0.2 | 0.4 | GO:0008065 | establishment of blood-nerve barrier(GO:0008065) |
0.2 | 0.8 | GO:2000255 | negative regulation of male germ cell proliferation(GO:2000255) |
0.2 | 1.9 | GO:0003148 | outflow tract septum morphogenesis(GO:0003148) |
0.2 | 0.4 | GO:0034146 | toll-like receptor 5 signaling pathway(GO:0034146) |
0.2 | 0.4 | GO:0036091 | positive regulation of transcription from RNA polymerase II promoter in response to oxidative stress(GO:0036091) |
0.2 | 0.4 | GO:0035330 | regulation of hippo signaling(GO:0035330) |
0.2 | 0.6 | GO:0046469 | platelet activating factor biosynthetic process(GO:0006663) platelet activating factor metabolic process(GO:0046469) |
0.2 | 0.4 | GO:0021912 | regulation of transcription from RNA polymerase II promoter involved in spinal cord motor neuron fate specification(GO:0021912) |
0.2 | 1.5 | GO:1900025 | negative regulation of substrate adhesion-dependent cell spreading(GO:1900025) |
0.2 | 0.2 | GO:0072106 | regulation of ureteric bud formation(GO:0072106) positive regulation of ureteric bud formation(GO:0072107) |
0.2 | 0.6 | GO:0090258 | negative regulation of mitochondrial fission(GO:0090258) |
0.2 | 1.6 | GO:0032060 | bleb assembly(GO:0032060) |
0.2 | 0.7 | GO:0016560 | protein import into peroxisome matrix, docking(GO:0016560) |
0.2 | 0.4 | GO:0061205 | paramesonephric duct development(GO:0061205) |
0.2 | 0.5 | GO:0046655 | folic acid metabolic process(GO:0046655) |
0.2 | 0.4 | GO:1901874 | regulation of post-translational protein modification(GO:1901873) negative regulation of post-translational protein modification(GO:1901874) |
0.2 | 0.4 | GO:0038128 | ERBB2 signaling pathway(GO:0038128) |
0.2 | 0.5 | GO:1903416 | response to glycoside(GO:1903416) |
0.2 | 0.4 | GO:0051660 | establishment of centrosome localization(GO:0051660) |
0.2 | 0.7 | GO:0060480 | lung goblet cell differentiation(GO:0060480) |
0.2 | 0.2 | GO:0060084 | synaptic transmission involved in micturition(GO:0060084) |
0.2 | 0.5 | GO:0007412 | axon target recognition(GO:0007412) |
0.2 | 0.7 | GO:0021914 | negative regulation of smoothened signaling pathway involved in ventral spinal cord patterning(GO:0021914) |
0.2 | 0.5 | GO:0048549 | positive regulation of pinocytosis(GO:0048549) |
0.2 | 0.5 | GO:0002121 | inter-male aggressive behavior(GO:0002121) |
0.2 | 0.3 | GO:0002314 | germinal center B cell differentiation(GO:0002314) |
0.2 | 0.7 | GO:1902548 | negative regulation of cellular response to vascular endothelial growth factor stimulus(GO:1902548) |
0.2 | 0.3 | GO:0014707 | branchiomeric skeletal muscle development(GO:0014707) |
0.2 | 1.0 | GO:0030917 | midbrain-hindbrain boundary development(GO:0030917) |
0.2 | 0.2 | GO:0060916 | mesenchymal cell proliferation involved in lung development(GO:0060916) |
0.2 | 0.7 | GO:0003433 | chondrocyte development involved in endochondral bone morphogenesis(GO:0003433) |
0.2 | 0.7 | GO:2000623 | regulation of nuclear-transcribed mRNA catabolic process, nonsense-mediated decay(GO:2000622) negative regulation of nuclear-transcribed mRNA catabolic process, nonsense-mediated decay(GO:2000623) |
0.2 | 0.5 | GO:0034729 | histone H3-K79 methylation(GO:0034729) |
0.2 | 0.2 | GO:0035790 | platelet-derived growth factor receptor-alpha signaling pathway(GO:0035790) |
0.2 | 15.1 | GO:0048706 | embryonic skeletal system development(GO:0048706) |
0.2 | 1.0 | GO:0090527 | actin filament reorganization(GO:0090527) |
0.2 | 0.7 | GO:0021873 | forebrain neuroblast division(GO:0021873) |
0.2 | 0.5 | GO:0030327 | prenylated protein catabolic process(GO:0030327) |
0.2 | 1.2 | GO:0019800 | peptide cross-linking via chondroitin 4-sulfate glycosaminoglycan(GO:0019800) |
0.2 | 1.3 | GO:0002091 | negative regulation of receptor internalization(GO:0002091) |
0.2 | 0.2 | GO:0021540 | corpus callosum morphogenesis(GO:0021540) |
0.2 | 0.7 | GO:1990035 | calcium ion import into cell(GO:1990035) |
0.2 | 0.3 | GO:1904430 | negative regulation of t-circle formation(GO:1904430) |
0.2 | 0.5 | GO:0038031 | non-canonical Wnt signaling pathway via MAPK cascade(GO:0038030) non-canonical Wnt signaling pathway via JNK cascade(GO:0038031) |
0.2 | 0.3 | GO:0046103 | inosine biosynthetic process(GO:0046103) |
0.2 | 0.2 | GO:0010248 | establishment or maintenance of transmembrane electrochemical gradient(GO:0010248) |
0.2 | 0.5 | GO:0015803 | branched-chain amino acid transport(GO:0015803) leucine transport(GO:0015820) |
0.2 | 0.3 | GO:0031034 | myosin filament assembly(GO:0031034) |
0.2 | 2.1 | GO:0003334 | keratinocyte development(GO:0003334) |
0.2 | 0.3 | GO:0002331 | pre-B cell allelic exclusion(GO:0002331) |
0.2 | 1.9 | GO:0014912 | negative regulation of smooth muscle cell migration(GO:0014912) |
0.2 | 0.8 | GO:0061154 | endothelial tube morphogenesis(GO:0061154) |
0.2 | 1.4 | GO:0048245 | eosinophil chemotaxis(GO:0048245) |
0.2 | 0.3 | GO:0051890 | regulation of cardioblast differentiation(GO:0051890) |
0.2 | 0.3 | GO:2000807 | regulation of synaptic vesicle clustering(GO:2000807) |
0.2 | 0.3 | GO:0033686 | positive regulation of luteinizing hormone secretion(GO:0033686) |
0.2 | 0.2 | GO:2000321 | positive regulation of T-helper 17 cell differentiation(GO:2000321) |
0.2 | 0.9 | GO:0045634 | regulation of melanocyte differentiation(GO:0045634) |
0.2 | 0.5 | GO:2000048 | negative regulation of cell-cell adhesion mediated by cadherin(GO:2000048) |
0.2 | 0.2 | GO:1901896 | positive regulation of calcium-transporting ATPase activity(GO:1901896) |
0.2 | 0.5 | GO:2000686 | regulation of rubidium ion transmembrane transporter activity(GO:2000686) |
0.2 | 0.6 | GO:1903894 | regulation of IRE1-mediated unfolded protein response(GO:1903894) |
0.1 | 0.7 | GO:0097151 | positive regulation of inhibitory postsynaptic potential(GO:0097151) |
0.1 | 0.9 | GO:0097084 | vascular smooth muscle cell development(GO:0097084) |
0.1 | 0.3 | GO:0061643 | chemorepulsion of axon(GO:0061643) |
0.1 | 0.4 | GO:0060684 | epithelial-mesenchymal cell signaling(GO:0060684) |
0.1 | 0.3 | GO:0051562 | negative regulation of mitochondrial calcium ion concentration(GO:0051562) |
0.1 | 0.9 | GO:0060405 | regulation of penile erection(GO:0060405) |
0.1 | 0.4 | GO:0014722 | regulation of skeletal muscle contraction by calcium ion signaling(GO:0014722) |
0.1 | 0.7 | GO:0060083 | smooth muscle contraction involved in micturition(GO:0060083) |
0.1 | 0.3 | GO:0035992 | tendon development(GO:0035989) tendon cell differentiation(GO:0035990) tendon formation(GO:0035992) |
0.1 | 0.4 | GO:0006768 | biotin metabolic process(GO:0006768) |
0.1 | 0.7 | GO:0006104 | succinyl-CoA metabolic process(GO:0006104) |
0.1 | 0.1 | GO:0061550 | cerebral cortex tangential migration using cell-axon interactions(GO:0021824) gonadotrophin-releasing hormone neuronal migration to the hypothalamus(GO:0021828) hypothalamic tangential migration using cell-axon interactions(GO:0021856) cranial ganglion development(GO:0061550) trigeminal ganglion development(GO:0061551) facioacoustic ganglion development(GO:1903375) dorsal root ganglion development(GO:1990791) |
0.1 | 0.3 | GO:2000598 | regulation of cyclin catabolic process(GO:2000598) negative regulation of cyclin catabolic process(GO:2000599) |
0.1 | 0.4 | GO:0072338 | creatinine metabolic process(GO:0046449) cellular lactam metabolic process(GO:0072338) |
0.1 | 1.0 | GO:0043586 | tongue development(GO:0043586) |
0.1 | 0.1 | GO:0060687 | regulation of branching involved in prostate gland morphogenesis(GO:0060687) |
0.1 | 1.3 | GO:0035726 | common myeloid progenitor cell proliferation(GO:0035726) |
0.1 | 0.1 | GO:1903279 | regulation of calcium:sodium antiporter activity(GO:1903279) |
0.1 | 0.6 | GO:0046813 | receptor-mediated virion attachment to host cell(GO:0046813) |
0.1 | 0.1 | GO:0035907 | dorsal aorta development(GO:0035907) dorsal aorta morphogenesis(GO:0035912) |
0.1 | 0.7 | GO:1904354 | negative regulation of telomere capping(GO:1904354) |
0.1 | 0.3 | GO:1901492 | positive regulation of lymphangiogenesis(GO:1901492) |
0.1 | 0.6 | GO:0060347 | heart trabecula formation(GO:0060347) |
0.1 | 0.1 | GO:0002840 | T cell mediated immune response to tumor cell(GO:0002424) regulation of T cell mediated immune response to tumor cell(GO:0002840) |
0.1 | 0.4 | GO:0021698 | cerebellar cortex structural organization(GO:0021698) |
0.1 | 1.7 | GO:0016339 | calcium-dependent cell-cell adhesion via plasma membrane cell adhesion molecules(GO:0016339) |
0.1 | 0.3 | GO:0071376 | response to corticotropin-releasing hormone(GO:0043435) cellular response to corticotropin-releasing hormone stimulus(GO:0071376) |
0.1 | 0.8 | GO:0018401 | peptidyl-proline hydroxylation to 4-hydroxy-L-proline(GO:0018401) |
0.1 | 0.5 | GO:0034351 | negative regulation of glial cell apoptotic process(GO:0034351) |
0.1 | 1.1 | GO:0071625 | vocalization behavior(GO:0071625) |
0.1 | 0.1 | GO:0060842 | arterial endothelial cell differentiation(GO:0060842) |
0.1 | 0.5 | GO:0060279 | positive regulation of ovulation(GO:0060279) |
0.1 | 0.3 | GO:0090394 | negative regulation of excitatory postsynaptic potential(GO:0090394) |
0.1 | 0.9 | GO:0060346 | bone trabecula formation(GO:0060346) |
0.1 | 0.5 | GO:0010528 | regulation of transposition(GO:0010528) negative regulation of transposition(GO:0010529) |
0.1 | 0.4 | GO:0060290 | transdifferentiation(GO:0060290) |
0.1 | 0.4 | GO:0010046 | response to mycotoxin(GO:0010046) |
0.1 | 0.4 | GO:0061370 | testosterone biosynthetic process(GO:0061370) |
0.1 | 0.1 | GO:2000698 | positive regulation of epithelial cell differentiation involved in kidney development(GO:2000698) |
0.1 | 0.5 | GO:1903779 | regulation of cardiac conduction(GO:1903779) |
0.1 | 0.9 | GO:0035745 | T-helper 2 cell cytokine production(GO:0035745) |
0.1 | 0.1 | GO:0061622 | glycolytic process through glucose-1-phosphate(GO:0061622) |
0.1 | 0.4 | GO:0050955 | thermoception(GO:0050955) |
0.1 | 0.1 | GO:0007195 | adenylate cyclase-inhibiting dopamine receptor signaling pathway(GO:0007195) |
0.1 | 0.1 | GO:0003330 | regulation of extracellular matrix constituent secretion(GO:0003330) positive regulation of extracellular matrix constituent secretion(GO:0003331) |
0.1 | 0.5 | GO:0021520 | spinal cord motor neuron cell fate specification(GO:0021520) |
0.1 | 0.9 | GO:0021796 | cerebral cortex regionalization(GO:0021796) |
0.1 | 2.0 | GO:0031116 | positive regulation of microtubule polymerization(GO:0031116) |
0.1 | 0.1 | GO:0001844 | protein insertion into mitochondrial membrane involved in apoptotic signaling pathway(GO:0001844) |
0.1 | 0.3 | GO:0000720 | pyrimidine dimer repair by nucleotide-excision repair(GO:0000720) |
0.1 | 0.5 | GO:0071681 | response to indole-3-methanol(GO:0071680) cellular response to indole-3-methanol(GO:0071681) |
0.1 | 1.6 | GO:0090083 | regulation of inclusion body assembly(GO:0090083) |
0.1 | 1.1 | GO:0045738 | negative regulation of DNA repair(GO:0045738) |
0.1 | 0.1 | GO:0097688 | AMPA glutamate receptor clustering(GO:0097113) glutamate receptor clustering(GO:0097688) |
0.1 | 0.2 | GO:0042519 | tyrosine phosphorylation of Stat4 protein(GO:0042504) regulation of tyrosine phosphorylation of Stat4 protein(GO:0042519) |
0.1 | 0.2 | GO:2001025 | positive regulation of response to drug(GO:2001025) |
0.1 | 0.6 | GO:0035469 | determination of pancreatic left/right asymmetry(GO:0035469) |
0.1 | 0.4 | GO:0046952 | ketone body catabolic process(GO:0046952) |
0.1 | 0.4 | GO:0060385 | axonogenesis involved in innervation(GO:0060385) |
0.1 | 0.5 | GO:0031937 | positive regulation of chromatin silencing(GO:0031937) |
0.1 | 0.2 | GO:0046122 | purine deoxyribonucleoside metabolic process(GO:0046122) |
0.1 | 0.2 | GO:0044800 | fusion of virus membrane with host plasma membrane(GO:0019064) membrane fusion involved in viral entry into host cell(GO:0039663) multi-organism membrane fusion(GO:0044800) |
0.1 | 0.1 | GO:0006667 | sphinganine metabolic process(GO:0006667) |
0.1 | 0.4 | GO:0097070 | ductus arteriosus closure(GO:0097070) |
0.1 | 0.7 | GO:0086036 | regulation of cardiac muscle cell membrane potential(GO:0086036) |
0.1 | 0.6 | GO:0006686 | sphingomyelin biosynthetic process(GO:0006686) |
0.1 | 0.7 | GO:0014807 | regulation of somitogenesis(GO:0014807) |
0.1 | 0.2 | GO:0060762 | regulation of branching involved in mammary gland duct morphogenesis(GO:0060762) |
0.1 | 1.0 | GO:0021952 | central nervous system projection neuron axonogenesis(GO:0021952) |
0.1 | 0.2 | GO:0032349 | positive regulation of aldosterone metabolic process(GO:0032346) positive regulation of aldosterone biosynthetic process(GO:0032349) |
0.1 | 0.1 | GO:2000402 | negative regulation of lymphocyte migration(GO:2000402) |
0.1 | 0.5 | GO:0090435 | protein localization to nuclear envelope(GO:0090435) |
0.1 | 0.1 | GO:0021776 | smoothened signaling pathway involved in ventral spinal cord interneuron specification(GO:0021775) smoothened signaling pathway involved in spinal cord motor neuron cell fate specification(GO:0021776) |
0.1 | 0.6 | GO:0003171 | atrioventricular valve development(GO:0003171) |
0.1 | 0.3 | GO:0010887 | negative regulation of cholesterol storage(GO:0010887) |
0.1 | 0.3 | GO:0035507 | regulation of myosin-light-chain-phosphatase activity(GO:0035507) |
0.1 | 0.5 | GO:0043031 | negative regulation of macrophage activation(GO:0043031) |
0.1 | 0.1 | GO:0097119 | postsynaptic density protein 95 clustering(GO:0097119) |
0.1 | 0.2 | GO:0060371 | regulation of atrial cardiac muscle cell membrane depolarization(GO:0060371) |
0.1 | 0.7 | GO:1900113 | negative regulation of histone H3-K9 trimethylation(GO:1900113) |
0.1 | 1.0 | GO:0019321 | pentose metabolic process(GO:0019321) |
0.1 | 0.8 | GO:0001778 | plasma membrane repair(GO:0001778) |
0.1 | 0.9 | GO:0046069 | cGMP catabolic process(GO:0046069) |
0.1 | 0.2 | GO:0002309 | T cell proliferation involved in immune response(GO:0002309) |
0.1 | 0.3 | GO:0010724 | regulation of definitive erythrocyte differentiation(GO:0010724) |
0.1 | 0.1 | GO:0021913 | regulation of transcription from RNA polymerase II promoter involved in ventral spinal cord interneuron specification(GO:0021913) |
0.1 | 0.1 | GO:0060433 | bronchus development(GO:0060433) |
0.1 | 0.4 | GO:0060573 | ventral spinal cord interneuron specification(GO:0021521) cell fate specification involved in pattern specification(GO:0060573) |
0.1 | 0.1 | GO:0060174 | limb bud formation(GO:0060174) |
0.1 | 0.3 | GO:0043415 | positive regulation of skeletal muscle tissue regeneration(GO:0043415) |
0.1 | 0.4 | GO:0007023 | post-chaperonin tubulin folding pathway(GO:0007023) |
0.1 | 0.1 | GO:0035542 | regulation of SNARE complex assembly(GO:0035542) |
0.1 | 1.0 | GO:1903140 | regulation of endothelial cell development(GO:1901550) regulation of establishment of endothelial barrier(GO:1903140) |
0.1 | 0.2 | GO:0043988 | histone H3-S28 phosphorylation(GO:0043988) |
0.1 | 0.2 | GO:0098911 | regulation of ventricular cardiac muscle cell action potential(GO:0098911) |
0.1 | 0.3 | GO:0021523 | somatic motor neuron differentiation(GO:0021523) |
0.1 | 0.5 | GO:0030638 | polyketide metabolic process(GO:0030638) aminoglycoside antibiotic metabolic process(GO:0030647) daunorubicin metabolic process(GO:0044597) doxorubicin metabolic process(GO:0044598) |
0.1 | 0.1 | GO:0048320 | axial mesoderm formation(GO:0048320) |
0.1 | 0.6 | GO:0050916 | sensory perception of sweet taste(GO:0050916) |
0.1 | 0.5 | GO:0021670 | lateral ventricle development(GO:0021670) |
0.1 | 0.3 | GO:0002930 | trabecular meshwork development(GO:0002930) |
0.1 | 0.3 | GO:0060988 | lipid tube assembly(GO:0060988) |
0.1 | 2.1 | GO:0045747 | positive regulation of Notch signaling pathway(GO:0045747) |
0.1 | 0.3 | GO:0046959 | habituation(GO:0046959) |
0.1 | 0.4 | GO:0045415 | negative regulation of interleukin-8 biosynthetic process(GO:0045415) |
0.1 | 0.2 | GO:0048669 | collateral sprouting in absence of injury(GO:0048669) |
0.1 | 0.3 | GO:0007258 | JUN phosphorylation(GO:0007258) |
0.1 | 0.1 | GO:1901979 | regulation of inward rectifier potassium channel activity(GO:1901979) |
0.1 | 0.3 | GO:1901164 | negative regulation of trophoblast cell migration(GO:1901164) |
0.1 | 0.1 | GO:0048880 | sensory system development(GO:0048880) |
0.1 | 0.4 | GO:0034627 | 'de novo' NAD biosynthetic process(GO:0034627) |
0.1 | 0.2 | GO:0038026 | reelin-mediated signaling pathway(GO:0038026) |
0.1 | 0.2 | GO:0089700 | protein kinase D signaling(GO:0089700) |
0.1 | 0.3 | GO:0019626 | short-chain fatty acid catabolic process(GO:0019626) |
0.1 | 0.1 | GO:0052490 | negative regulation by symbiont of host apoptotic process(GO:0033668) negative regulation by symbiont of host programmed cell death(GO:0052041) negative regulation by organism of programmed cell death in other organism involved in symbiotic interaction(GO:0052490) |
0.1 | 0.3 | GO:1902268 | negative regulation of polyamine transmembrane transport(GO:1902268) |
0.1 | 0.2 | GO:2000821 | regulation of grooming behavior(GO:2000821) |
0.1 | 0.4 | GO:0034080 | CENP-A containing nucleosome assembly(GO:0034080) CENP-A containing chromatin organization(GO:0061641) |
0.1 | 0.2 | GO:0042693 | muscle cell fate commitment(GO:0042693) |
0.1 | 0.4 | GO:0070164 | negative regulation of adiponectin secretion(GO:0070164) |
0.1 | 0.2 | GO:0072201 | negative regulation of mesenchymal cell proliferation(GO:0072201) |
0.1 | 1.2 | GO:0019184 | nonribosomal peptide biosynthetic process(GO:0019184) |
0.1 | 1.6 | GO:0001833 | inner cell mass cell proliferation(GO:0001833) |
0.1 | 0.2 | GO:0090325 | regulation of locomotion involved in locomotory behavior(GO:0090325) |
0.1 | 0.6 | GO:0032725 | positive regulation of granulocyte macrophage colony-stimulating factor production(GO:0032725) |
0.1 | 0.2 | GO:0048319 | axial mesoderm morphogenesis(GO:0048319) |
0.1 | 0.3 | GO:1904694 | negative regulation of vascular smooth muscle contraction(GO:1904694) |
0.1 | 0.3 | GO:0007084 | mitotic nuclear envelope reassembly(GO:0007084) |
0.1 | 0.7 | GO:0032464 | positive regulation of protein homooligomerization(GO:0032464) |
0.1 | 0.3 | GO:0006295 | nucleotide-excision repair, DNA incision, 3'-to lesion(GO:0006295) |
0.1 | 0.3 | GO:2000382 | positive regulation of mesoderm development(GO:2000382) |
0.1 | 0.1 | GO:0018243 | protein O-linked glycosylation via threonine(GO:0018243) |
0.1 | 0.2 | GO:0070094 | positive regulation of glucagon secretion(GO:0070094) |
0.1 | 0.3 | GO:0060426 | lung vasculature development(GO:0060426) |
0.1 | 0.3 | GO:0002386 | immune response in mucosal-associated lymphoid tissue(GO:0002386) |
0.1 | 0.5 | GO:1901026 | ripoptosome assembly(GO:0097343) ripoptosome assembly involved in necroptotic process(GO:1901026) |
0.1 | 0.3 | GO:0035521 | monoubiquitinated histone deubiquitination(GO:0035521) monoubiquitinated histone H2A deubiquitination(GO:0035522) |
0.1 | 0.3 | GO:0014878 | response to electrical stimulus involved in regulation of muscle adaptation(GO:0014878) |
0.1 | 0.3 | GO:0021513 | spinal cord dorsal/ventral patterning(GO:0021513) |
0.1 | 0.2 | GO:1900127 | positive regulation of hyaluronan biosynthetic process(GO:1900127) |
0.1 | 0.2 | GO:0043366 | beta selection(GO:0043366) |
0.1 | 0.2 | GO:1902065 | response to L-glutamate(GO:1902065) |
0.1 | 0.2 | GO:2000047 | regulation of cell-cell adhesion mediated by cadherin(GO:2000047) |
0.1 | 0.1 | GO:0098915 | membrane repolarization during ventricular cardiac muscle cell action potential(GO:0098915) |
0.1 | 0.2 | GO:1903984 | positive regulation of TRAIL-activated apoptotic signaling pathway(GO:1903984) |
0.1 | 0.5 | GO:0043116 | negative regulation of vascular permeability(GO:0043116) |
0.1 | 0.8 | GO:0080111 | DNA demethylation(GO:0080111) |
0.1 | 0.1 | GO:0003149 | membranous septum morphogenesis(GO:0003149) |
0.1 | 0.3 | GO:1904995 | negative regulation of leukocyte adhesion to vascular endothelial cell(GO:1904995) |
0.1 | 0.3 | GO:0032430 | positive regulation of phospholipase A2 activity(GO:0032430) |
0.1 | 0.3 | GO:0034287 | detection of carbohydrate stimulus(GO:0009730) detection of hexose stimulus(GO:0009732) detection of monosaccharide stimulus(GO:0034287) detection of glucose(GO:0051594) |
0.1 | 0.4 | GO:0045586 | regulation of gamma-delta T cell differentiation(GO:0045586) regulation of gamma-delta T cell activation(GO:0046643) |
0.1 | 0.8 | GO:0000103 | sulfate assimilation(GO:0000103) |
0.1 | 0.2 | GO:0002051 | osteoblast fate commitment(GO:0002051) |
0.1 | 0.2 | GO:0048294 | negative regulation of isotype switching to IgE isotypes(GO:0048294) |
0.1 | 0.3 | GO:0046909 | intermembrane transport(GO:0046909) |
0.1 | 0.3 | GO:0000727 | double-strand break repair via break-induced replication(GO:0000727) |
0.1 | 0.2 | GO:1901386 | negative regulation of voltage-gated calcium channel activity(GO:1901386) |
0.1 | 0.1 | GO:2000020 | positive regulation of male gonad development(GO:2000020) |
0.1 | 0.1 | GO:0045627 | positive regulation of T-helper 1 cell differentiation(GO:0045627) |
0.1 | 0.3 | GO:1903026 | negative regulation of RNA polymerase II regulatory region sequence-specific DNA binding(GO:1903026) |
0.1 | 0.1 | GO:0090027 | negative regulation of monocyte chemotaxis(GO:0090027) |
0.1 | 0.1 | GO:0061153 | trachea submucosa development(GO:0061152) trachea gland development(GO:0061153) |
0.1 | 0.2 | GO:0031642 | negative regulation of myelination(GO:0031642) |
0.1 | 0.1 | GO:0016539 | intein-mediated protein splicing(GO:0016539) protein splicing(GO:0030908) |
0.1 | 0.3 | GO:1905216 | positive regulation of mRNA binding(GO:1902416) positive regulation of RNA binding(GO:1905216) |
0.1 | 0.3 | GO:0030432 | peristalsis(GO:0030432) |
0.1 | 0.3 | GO:0051387 | negative regulation of neurotrophin TRK receptor signaling pathway(GO:0051387) |
0.1 | 0.3 | GO:2000394 | positive regulation of lamellipodium morphogenesis(GO:2000394) |
0.1 | 0.2 | GO:0051045 | negative regulation of membrane protein ectodomain proteolysis(GO:0051045) |
0.1 | 0.5 | GO:0048665 | neuron fate specification(GO:0048665) |
0.1 | 0.2 | GO:0070782 | phosphatidylserine exposure on apoptotic cell surface(GO:0070782) |
0.1 | 0.3 | GO:0019244 | lactate biosynthetic process from pyruvate(GO:0019244) lactate biosynthetic process(GO:0019249) |
0.1 | 0.2 | GO:0006537 | glutamate biosynthetic process(GO:0006537) |
0.1 | 0.2 | GO:0014719 | skeletal muscle satellite cell activation(GO:0014719) |
0.1 | 0.1 | GO:0010255 | carbohydrate mediated signaling(GO:0009756) hexose mediated signaling(GO:0009757) sugar mediated signaling pathway(GO:0010182) glucose mediated signaling pathway(GO:0010255) |
0.1 | 0.5 | GO:0006646 | phosphatidylethanolamine biosynthetic process(GO:0006646) |
0.1 | 0.1 | GO:0007181 | transforming growth factor beta receptor complex assembly(GO:0007181) |
0.1 | 0.2 | GO:0006543 | glutamine catabolic process(GO:0006543) |
0.1 | 0.5 | GO:0035878 | nail development(GO:0035878) |
0.1 | 1.0 | GO:0030325 | adrenal gland development(GO:0030325) |
0.1 | 0.2 | GO:0072675 | osteoclast fusion(GO:0072675) |
0.1 | 0.2 | GO:0031581 | hemidesmosome assembly(GO:0031581) |
0.1 | 0.3 | GO:1902004 | positive regulation of beta-amyloid formation(GO:1902004) positive regulation of amyloid precursor protein catabolic process(GO:1902993) |
0.1 | 0.4 | GO:0030540 | female genitalia development(GO:0030540) |
0.1 | 0.2 | GO:0061428 | negative regulation of transcription from RNA polymerase II promoter in response to hypoxia(GO:0061428) |
0.1 | 0.5 | GO:0097062 | dendritic spine maintenance(GO:0097062) |
0.1 | 0.4 | GO:0030579 | ubiquitin-dependent SMAD protein catabolic process(GO:0030579) |
0.1 | 1.7 | GO:0090022 | regulation of neutrophil chemotaxis(GO:0090022) |
0.1 | 0.2 | GO:0033504 | floor plate development(GO:0033504) |
0.1 | 0.6 | GO:0033299 | secretion of lysosomal enzymes(GO:0033299) |
0.1 | 0.1 | GO:0086028 | bundle of His cell to Purkinje myocyte signaling(GO:0086028) bundle of His cell action potential(GO:0086043) |
0.1 | 0.3 | GO:0000711 | meiotic DNA repair synthesis(GO:0000711) |
0.1 | 0.4 | GO:0080154 | regulation of fertilization(GO:0080154) |
0.1 | 0.2 | GO:0048808 | male genitalia morphogenesis(GO:0048808) male anatomical structure morphogenesis(GO:0090598) |
0.1 | 0.3 | GO:0008298 | intracellular mRNA localization(GO:0008298) |
0.1 | 0.2 | GO:0003310 | pancreatic A cell differentiation(GO:0003310) |
0.1 | 0.4 | GO:0051798 | positive regulation of hair follicle development(GO:0051798) |
0.1 | 0.6 | GO:0060742 | epithelial cell differentiation involved in prostate gland development(GO:0060742) |
0.1 | 0.2 | GO:0061304 | retinal blood vessel morphogenesis(GO:0061304) |
0.1 | 0.1 | GO:0072177 | mesonephric duct development(GO:0072177) mesonephric duct morphogenesis(GO:0072180) |
0.1 | 0.1 | GO:0032429 | regulation of phospholipase A2 activity(GO:0032429) |
0.1 | 1.5 | GO:0030865 | cortical cytoskeleton organization(GO:0030865) |
0.1 | 0.2 | GO:0072318 | clathrin coat disassembly(GO:0072318) |
0.1 | 0.1 | GO:0071677 | positive regulation of mononuclear cell migration(GO:0071677) |
0.1 | 0.3 | GO:0019388 | galactose catabolic process(GO:0019388) |
0.1 | 0.3 | GO:0008090 | retrograde axonal transport(GO:0008090) |
0.1 | 0.2 | GO:1900095 | regulation of dosage compensation by inactivation of X chromosome(GO:1900095) |
0.1 | 0.1 | GO:0061314 | Notch signaling involved in heart development(GO:0061314) |
0.1 | 0.6 | GO:0070307 | lens fiber cell development(GO:0070307) |
0.1 | 0.2 | GO:0061589 | calcium activated phosphatidylserine scrambling(GO:0061589) |
0.1 | 0.5 | GO:0009954 | proximal/distal pattern formation(GO:0009954) |
0.1 | 0.1 | GO:0034085 | establishment of sister chromatid cohesion(GO:0034085) cohesin loading(GO:0071921) regulation of cohesin loading(GO:0071922) |
0.1 | 0.5 | GO:0043206 | extracellular fibril organization(GO:0043206) |
0.1 | 0.6 | GO:0031536 | positive regulation of exit from mitosis(GO:0031536) |
0.1 | 0.4 | GO:0030259 | lipid glycosylation(GO:0030259) |
0.1 | 0.1 | GO:0045163 | clustering of voltage-gated potassium channels(GO:0045163) |
0.1 | 0.1 | GO:0070587 | negative regulation of heterotypic cell-cell adhesion(GO:0034115) regulation of cell-cell adhesion involved in gastrulation(GO:0070587) |
0.1 | 0.4 | GO:0016139 | glycoside metabolic process(GO:0016137) glycoside catabolic process(GO:0016139) |
0.1 | 0.1 | GO:0070086 | ubiquitin-dependent endocytosis(GO:0070086) |
0.1 | 1.0 | GO:0010569 | regulation of double-strand break repair via homologous recombination(GO:0010569) |
0.1 | 0.2 | GO:0071947 | protein deubiquitination involved in ubiquitin-dependent protein catabolic process(GO:0071947) |
0.1 | 0.3 | GO:0010759 | positive regulation of macrophage chemotaxis(GO:0010759) |
0.1 | 0.1 | GO:0060839 | endothelial cell fate commitment(GO:0060839) |
0.1 | 0.3 | GO:0071034 | CUT catabolic process(GO:0071034) CUT metabolic process(GO:0071043) |
0.1 | 0.3 | GO:0042637 | catagen(GO:0042637) |
0.1 | 0.1 | GO:0006069 | ethanol metabolic process(GO:0006067) ethanol oxidation(GO:0006069) |
0.1 | 0.2 | GO:0072386 | plus-end-directed vesicle transport along microtubule(GO:0072383) plus-end-directed organelle transport along microtubule(GO:0072386) |
0.1 | 2.3 | GO:0033141 | positive regulation of peptidyl-serine phosphorylation of STAT protein(GO:0033141) |
0.1 | 0.4 | GO:0033762 | response to glucagon(GO:0033762) |
0.1 | 0.4 | GO:0042737 | drug catabolic process(GO:0042737) |
0.1 | 0.3 | GO:0033690 | positive regulation of osteoblast proliferation(GO:0033690) |
0.1 | 0.2 | GO:0045110 | intermediate filament bundle assembly(GO:0045110) |
0.1 | 0.1 | GO:2000054 | negative regulation of Wnt signaling pathway involved in dorsal/ventral axis specification(GO:2000054) |
0.1 | 0.2 | GO:0090206 | negative regulation of cholesterol biosynthetic process(GO:0045541) negative regulation of cholesterol metabolic process(GO:0090206) |
0.1 | 0.2 | GO:0003338 | metanephros morphogenesis(GO:0003338) |
0.1 | 0.3 | GO:0006742 | NADP catabolic process(GO:0006742) |
0.1 | 0.1 | GO:2000543 | positive regulation of gastrulation(GO:2000543) |
0.1 | 0.2 | GO:0010944 | negative regulation of transcription by competitive promoter binding(GO:0010944) |
0.1 | 0.1 | GO:1902455 | negative regulation of stem cell population maintenance(GO:1902455) |
0.1 | 2.7 | GO:0061077 | chaperone-mediated protein folding(GO:0061077) |
0.1 | 0.1 | GO:1901420 | negative regulation of response to alcohol(GO:1901420) |
0.1 | 0.4 | GO:0061614 | pri-miRNA transcription from RNA polymerase II promoter(GO:0061614) |
0.1 | 0.2 | GO:1900227 | positive regulation of NLRP3 inflammasome complex assembly(GO:1900227) |
0.1 | 0.3 | GO:0035313 | wound healing, spreading of epidermal cells(GO:0035313) |
0.1 | 0.2 | GO:0097090 | presynaptic membrane organization(GO:0097090) |
0.1 | 0.8 | GO:2001258 | negative regulation of cation channel activity(GO:2001258) |
0.1 | 0.2 | GO:0071169 | establishment of protein localization to chromatin(GO:0071169) |
0.1 | 0.4 | GO:0060052 | neurofilament cytoskeleton organization(GO:0060052) |
0.1 | 0.5 | GO:0060056 | mammary gland involution(GO:0060056) |
0.1 | 0.3 | GO:0032836 | glomerular basement membrane development(GO:0032836) |
0.1 | 3.3 | GO:0051965 | positive regulation of synapse assembly(GO:0051965) |
0.1 | 0.2 | GO:0045759 | negative regulation of action potential(GO:0045759) |
0.1 | 0.3 | GO:0060391 | positive regulation of SMAD protein import into nucleus(GO:0060391) |
0.1 | 0.1 | GO:0060623 | regulation of chromosome condensation(GO:0060623) |
0.1 | 0.1 | GO:2000491 | positive regulation of hepatic stellate cell activation(GO:2000491) |
0.1 | 0.2 | GO:0002756 | MyD88-independent toll-like receptor signaling pathway(GO:0002756) |
0.1 | 0.2 | GO:0016198 | axon choice point recognition(GO:0016198) |
0.1 | 0.2 | GO:0048312 | intracellular distribution of mitochondria(GO:0048312) |
0.1 | 0.1 | GO:0035483 | gastric emptying(GO:0035483) |
0.1 | 0.2 | GO:0060468 | prevention of polyspermy(GO:0060468) |
0.1 | 0.2 | GO:0070427 | nucleotide-binding oligomerization domain containing 1 signaling pathway(GO:0070427) |
0.1 | 0.2 | GO:0006012 | galactose metabolic process(GO:0006012) |
0.1 | 0.7 | GO:0045880 | positive regulation of smoothened signaling pathway(GO:0045880) |
0.1 | 0.1 | GO:0001705 | ectoderm formation(GO:0001705) |
0.1 | 0.1 | GO:0042360 | vitamin E metabolic process(GO:0042360) |
0.1 | 0.1 | GO:2000611 | positive regulation of thyroid hormone generation(GO:2000611) |
0.1 | 0.1 | GO:1903011 | negative regulation of bone development(GO:1903011) |
0.1 | 0.1 | GO:0072075 | metanephric mesenchyme development(GO:0072075) |
0.1 | 0.4 | GO:0070995 | NADPH oxidation(GO:0070995) |
0.1 | 0.3 | GO:0060253 | negative regulation of glial cell proliferation(GO:0060253) |
0.1 | 0.1 | GO:0021562 | vestibulocochlear nerve development(GO:0021562) |
0.1 | 0.1 | GO:0008354 | germ cell migration(GO:0008354) |
0.1 | 0.1 | GO:0022009 | central nervous system vasculogenesis(GO:0022009) |
0.1 | 0.2 | GO:0033566 | gamma-tubulin complex localization(GO:0033566) |
0.1 | 0.2 | GO:0030539 | male genitalia development(GO:0030539) |
0.1 | 0.1 | GO:0035740 | CD8-positive, alpha-beta T cell proliferation(GO:0035740) |
0.1 | 0.1 | GO:0014012 | peripheral nervous system axon regeneration(GO:0014012) |
0.1 | 0.3 | GO:0097011 | cellular response to granulocyte macrophage colony-stimulating factor stimulus(GO:0097011) |
0.1 | 0.1 | GO:1902969 | mitotic DNA replication(GO:1902969) |
0.1 | 0.7 | GO:0030574 | collagen catabolic process(GO:0030574) |
0.1 | 0.4 | GO:0010388 | cullin deneddylation(GO:0010388) |
0.1 | 0.1 | GO:0045900 | negative regulation of translational elongation(GO:0045900) |
0.1 | 0.2 | GO:0010520 | regulation of reciprocal meiotic recombination(GO:0010520) |
0.1 | 0.1 | GO:0035902 | response to immobilization stress(GO:0035902) |
0.1 | 0.2 | GO:0032485 | regulation of Ral protein signal transduction(GO:0032485) |
0.1 | 0.1 | GO:0060316 | positive regulation of ryanodine-sensitive calcium-release channel activity(GO:0060316) |
0.1 | 0.4 | GO:0019673 | GDP-mannose metabolic process(GO:0019673) |
0.1 | 0.2 | GO:0035526 | retrograde transport, plasma membrane to Golgi(GO:0035526) |
0.1 | 0.3 | GO:0071569 | protein ufmylation(GO:0071569) |
0.1 | 0.2 | GO:0015770 | disaccharide transport(GO:0015766) sucrose transport(GO:0015770) oligosaccharide transport(GO:0015772) |
0.1 | 0.2 | GO:0006573 | valine metabolic process(GO:0006573) |
0.1 | 0.1 | GO:0022038 | corpus callosum development(GO:0022038) |
0.1 | 0.1 | GO:0010560 | positive regulation of glycoprotein biosynthetic process(GO:0010560) |
0.1 | 0.1 | GO:0046958 | nonassociative learning(GO:0046958) |
0.1 | 0.1 | GO:1904948 | midbrain dopaminergic neuron differentiation(GO:1904948) |
0.1 | 0.1 | GO:0033122 | negative regulation of purine nucleotide catabolic process(GO:0033122) |
0.1 | 0.2 | GO:2001206 | positive regulation of osteoclast development(GO:2001206) |
0.1 | 0.3 | GO:0032237 | activation of store-operated calcium channel activity(GO:0032237) |
0.1 | 0.2 | GO:0014063 | negative regulation of serotonin secretion(GO:0014063) |
0.1 | 0.1 | GO:0060332 | positive regulation of response to interferon-gamma(GO:0060332) positive regulation of interferon-gamma-mediated signaling pathway(GO:0060335) |
0.1 | 0.4 | GO:0016056 | rhodopsin mediated signaling pathway(GO:0016056) |
0.1 | 0.2 | GO:0060478 | acrosomal vesicle exocytosis(GO:0060478) |
0.1 | 0.1 | GO:0035106 | operant conditioning(GO:0035106) |
0.1 | 0.2 | GO:2000467 | positive regulation of glycogen (starch) synthase activity(GO:2000467) |
0.1 | 0.1 | GO:0032347 | regulation of aldosterone biosynthetic process(GO:0032347) |
0.1 | 0.1 | GO:0001998 | angiotensin mediated vasoconstriction involved in regulation of systemic arterial blood pressure(GO:0001998) |
0.1 | 0.1 | GO:0016264 | gap junction assembly(GO:0016264) |
0.1 | 0.1 | GO:1902261 | positive regulation of delayed rectifier potassium channel activity(GO:1902261) positive regulation of voltage-gated potassium channel activity(GO:1903818) |
0.1 | 0.2 | GO:0036444 | calcium ion transmembrane import into mitochondrion(GO:0036444) |
0.1 | 2.3 | GO:0002066 | columnar/cuboidal epithelial cell development(GO:0002066) |
0.1 | 0.1 | GO:0071351 | cellular response to interleukin-18(GO:0071351) |
0.1 | 0.2 | GO:0006420 | arginyl-tRNA aminoacylation(GO:0006420) |
0.1 | 0.3 | GO:0070934 | CRD-mediated mRNA stabilization(GO:0070934) |
0.1 | 0.2 | GO:0021559 | trigeminal nerve development(GO:0021559) |
0.1 | 0.1 | GO:0048070 | regulation of developmental pigmentation(GO:0048070) |
0.1 | 0.2 | GO:0035964 | COPI-coated vesicle budding(GO:0035964) |
0.1 | 0.2 | GO:0045162 | clustering of voltage-gated sodium channels(GO:0045162) |
0.1 | 0.3 | GO:0006002 | fructose 6-phosphate metabolic process(GO:0006002) |
0.1 | 0.3 | GO:0015871 | choline transport(GO:0015871) |
0.1 | 0.8 | GO:0070208 | protein heterotrimerization(GO:0070208) |
0.1 | 0.1 | GO:0072017 | renal sodium ion transport(GO:0003096) renal sodium ion absorption(GO:0070294) distal tubule development(GO:0072017) |
0.1 | 0.2 | GO:0007096 | regulation of exit from mitosis(GO:0007096) |
0.1 | 3.7 | GO:1903749 | positive regulation of establishment of protein localization to mitochondrion(GO:1903749) |
0.1 | 0.1 | GO:0042998 | positive regulation of Golgi to plasma membrane protein transport(GO:0042998) |
0.1 | 0.6 | GO:0060712 | spongiotrophoblast layer development(GO:0060712) |
0.1 | 0.6 | GO:0046325 | negative regulation of glucose import(GO:0046325) |
0.1 | 1.8 | GO:0008542 | visual learning(GO:0008542) |
0.1 | 0.1 | GO:0036072 | intramembranous ossification(GO:0001957) direct ossification(GO:0036072) |
0.1 | 0.3 | GO:0042474 | middle ear morphogenesis(GO:0042474) |
0.1 | 0.1 | GO:0034139 | regulation of toll-like receptor 3 signaling pathway(GO:0034139) positive regulation of toll-like receptor 3 signaling pathway(GO:0034141) |
0.1 | 0.1 | GO:0097476 | motor neuron migration(GO:0097475) spinal cord motor neuron migration(GO:0097476) lateral motor column neuron migration(GO:0097477) |
0.1 | 0.2 | GO:0006391 | transcription initiation from mitochondrial promoter(GO:0006391) |
0.1 | 0.3 | GO:0051694 | pointed-end actin filament capping(GO:0051694) |
0.1 | 0.1 | GO:0034239 | regulation of macrophage fusion(GO:0034239) |
0.1 | 0.3 | GO:0051546 | keratinocyte migration(GO:0051546) |
0.1 | 0.2 | GO:2000647 | negative regulation of stem cell proliferation(GO:2000647) |
0.1 | 0.1 | GO:0014873 | response to muscle activity involved in regulation of muscle adaptation(GO:0014873) |
0.1 | 0.1 | GO:0051987 | positive regulation of attachment of spindle microtubules to kinetochore(GO:0051987) |
0.1 | 0.2 | GO:0031508 | pericentric heterochromatin assembly(GO:0031508) |
0.1 | 0.4 | GO:0032461 | positive regulation of protein oligomerization(GO:0032461) |
0.1 | 0.2 | GO:0007638 | mechanosensory behavior(GO:0007638) |
0.1 | 0.4 | GO:0050687 | negative regulation of defense response to virus(GO:0050687) |
0.1 | 0.2 | GO:1903361 | protein localization to basolateral plasma membrane(GO:1903361) |
0.1 | 0.1 | GO:0051025 | negative regulation of immunoglobulin secretion(GO:0051025) |
0.1 | 0.1 | GO:0002326 | B cell lineage commitment(GO:0002326) |
0.1 | 0.2 | GO:1900245 | positive regulation of MDA-5 signaling pathway(GO:1900245) |
0.1 | 0.1 | GO:0061029 | eyelid development in camera-type eye(GO:0061029) |
0.1 | 0.1 | GO:2001180 | negative regulation of interleukin-10 secretion(GO:2001180) |
0.1 | 0.5 | GO:0032506 | cytokinetic process(GO:0032506) |
0.0 | 0.2 | GO:0016576 | histone dephosphorylation(GO:0016576) |
0.0 | 0.1 | GO:0038180 | nerve growth factor signaling pathway(GO:0038180) |
0.0 | 0.3 | GO:0006044 | N-acetylglucosamine metabolic process(GO:0006044) |
0.0 | 0.2 | GO:0008295 | spermidine biosynthetic process(GO:0008295) |
0.0 | 0.2 | GO:0071985 | multivesicular body sorting pathway(GO:0071985) |
0.0 | 0.0 | GO:0006680 | glucosylceramide catabolic process(GO:0006680) |
0.0 | 0.2 | GO:0030206 | chondroitin sulfate biosynthetic process(GO:0030206) |
0.0 | 0.0 | GO:1901017 | negative regulation of potassium ion transmembrane transporter activity(GO:1901017) |
0.0 | 0.1 | GO:0007089 | traversing start control point of mitotic cell cycle(GO:0007089) |
0.0 | 0.3 | GO:1904262 | negative regulation of TORC1 signaling(GO:1904262) |
0.0 | 0.1 | GO:2000651 | positive regulation of sodium ion transmembrane transporter activity(GO:2000651) |
0.0 | 0.1 | GO:0018094 | protein polyglycylation(GO:0018094) |
0.0 | 0.1 | GO:0002408 | myeloid dendritic cell chemotaxis(GO:0002408) |
0.0 | 0.1 | GO:2000587 | regulation of platelet-derived growth factor receptor-beta signaling pathway(GO:2000586) negative regulation of platelet-derived growth factor receptor-beta signaling pathway(GO:2000587) |
0.0 | 0.2 | GO:0070841 | inclusion body assembly(GO:0070841) |
0.0 | 0.1 | GO:2000254 | regulation of male germ cell proliferation(GO:2000254) |
0.0 | 0.1 | GO:0032462 | regulation of protein homooligomerization(GO:0032462) |
0.0 | 0.2 | GO:2000637 | positive regulation of gene silencing by miRNA(GO:2000637) |
0.0 | 0.0 | GO:0009826 | unidimensional cell growth(GO:0009826) |
0.0 | 0.1 | GO:0014050 | negative regulation of glutamate secretion(GO:0014050) |
0.0 | 0.1 | GO:0071233 | response to leucine(GO:0043201) cellular response to leucine(GO:0071233) |
0.0 | 4.6 | GO:0030198 | extracellular matrix organization(GO:0030198) |
0.0 | 0.1 | GO:0060300 | regulation of cytokine activity(GO:0060300) |
0.0 | 0.2 | GO:0071493 | cellular response to UV-B(GO:0071493) |
0.0 | 0.1 | GO:0000379 | tRNA-type intron splice site recognition and cleavage(GO:0000379) |
0.0 | 0.0 | GO:0060343 | trabecula formation(GO:0060343) |
0.0 | 0.5 | GO:0097150 | neuronal stem cell population maintenance(GO:0097150) |
0.0 | 0.1 | GO:0090230 | regulation of centromere complex assembly(GO:0090230) |
0.0 | 0.1 | GO:1902035 | positive regulation of hematopoietic stem cell proliferation(GO:1902035) |
0.0 | 0.1 | GO:0060484 | lung-associated mesenchyme development(GO:0060484) |
0.0 | 0.3 | GO:0035721 | intraciliary retrograde transport(GO:0035721) |
0.0 | 0.0 | GO:0048548 | regulation of pinocytosis(GO:0048548) |
0.0 | 0.2 | GO:0098535 | de novo centriole assembly(GO:0098535) |
0.0 | 0.3 | GO:0043374 | CD8-positive, alpha-beta T cell differentiation(GO:0043374) |
0.0 | 0.4 | GO:0042572 | retinol metabolic process(GO:0042572) |
0.0 | 0.1 | GO:1902953 | positive regulation of ER to Golgi vesicle-mediated transport(GO:1902953) |
0.0 | 0.1 | GO:0060011 | Sertoli cell proliferation(GO:0060011) |
0.0 | 0.1 | GO:0035609 | C-terminal protein deglutamylation(GO:0035609) |
0.0 | 0.1 | GO:0051775 | response to redox state(GO:0051775) |
0.0 | 0.0 | GO:0070431 | nucleotide-binding oligomerization domain containing signaling pathway(GO:0070423) nucleotide-binding oligomerization domain containing 2 signaling pathway(GO:0070431) |
0.0 | 0.1 | GO:0060800 | regulation of cell differentiation involved in embryonic placenta development(GO:0060800) |
0.0 | 0.2 | GO:0034975 | protein folding in endoplasmic reticulum(GO:0034975) |
0.0 | 0.2 | GO:0032224 | positive regulation of synaptic transmission, cholinergic(GO:0032224) |
0.0 | 0.0 | GO:1902897 | regulation of postsynaptic density protein 95 clustering(GO:1902897) |
0.0 | 0.2 | GO:0061299 | retina vasculature morphogenesis in camera-type eye(GO:0061299) |
0.0 | 0.0 | GO:0046416 | D-amino acid metabolic process(GO:0046416) |
0.0 | 0.6 | GO:0007616 | long-term memory(GO:0007616) |
0.0 | 0.0 | GO:1990034 | calcium ion export from cell(GO:1990034) |
0.0 | 0.0 | GO:0002043 | blood vessel endothelial cell proliferation involved in sprouting angiogenesis(GO:0002043) |
0.0 | 0.1 | GO:0090308 | regulation of methylation-dependent chromatin silencing(GO:0090308) |
0.0 | 0.5 | GO:0006968 | cellular defense response(GO:0006968) |
0.0 | 0.1 | GO:0030242 | pexophagy(GO:0030242) |
0.0 | 0.0 | GO:0034140 | negative regulation of toll-like receptor 3 signaling pathway(GO:0034140) |
0.0 | 0.1 | GO:0046340 | diacylglycerol catabolic process(GO:0046340) |
0.0 | 0.2 | GO:1902510 | regulation of apoptotic DNA fragmentation(GO:1902510) regulation of DNA catabolic process(GO:1903624) |
0.0 | 0.0 | GO:0032276 | regulation of gonadotropin secretion(GO:0032276) |
0.0 | 0.2 | GO:0031339 | negative regulation of vesicle fusion(GO:0031339) |
0.0 | 0.3 | GO:0035235 | ionotropic glutamate receptor signaling pathway(GO:0035235) |
0.0 | 0.3 | GO:0051481 | negative regulation of cytosolic calcium ion concentration(GO:0051481) |
0.0 | 0.1 | GO:1902445 | regulation of mitochondrial membrane permeability involved in programmed necrotic cell death(GO:1902445) |
0.0 | 0.1 | GO:1902309 | negative regulation of peptidyl-serine dephosphorylation(GO:1902309) |
0.0 | 0.1 | GO:0015842 | aminergic neurotransmitter loading into synaptic vesicle(GO:0015842) neurotransmitter loading into synaptic vesicle(GO:0098700) |
0.0 | 0.2 | GO:0019262 | N-acetylneuraminate catabolic process(GO:0019262) |
0.0 | 0.2 | GO:0016338 | calcium-independent cell-cell adhesion via plasma membrane cell-adhesion molecules(GO:0016338) |
0.0 | 0.2 | GO:0030204 | chondroitin sulfate metabolic process(GO:0030204) |
0.0 | 0.5 | GO:0032688 | negative regulation of interferon-beta production(GO:0032688) |
0.0 | 0.6 | GO:0051898 | negative regulation of protein kinase B signaling(GO:0051898) |
0.0 | 0.1 | GO:0060662 | tube lumen cavitation(GO:0060605) salivary gland cavitation(GO:0060662) |
0.0 | 0.1 | GO:0045080 | positive regulation of chemokine biosynthetic process(GO:0045080) |
0.0 | 0.2 | GO:0051764 | actin crosslink formation(GO:0051764) |
0.0 | 0.0 | GO:2000015 | regulation of determination of dorsal identity(GO:2000015) |
0.0 | 0.2 | GO:0001696 | gastric acid secretion(GO:0001696) |
0.0 | 0.1 | GO:0010606 | positive regulation of cytoplasmic mRNA processing body assembly(GO:0010606) |
0.0 | 0.1 | GO:2000483 | negative regulation of interleukin-8 secretion(GO:2000483) |
0.0 | 0.2 | GO:0046607 | positive regulation of centrosome cycle(GO:0046607) |
0.0 | 0.0 | GO:0043951 | negative regulation of cAMP-mediated signaling(GO:0043951) |
0.0 | 0.3 | GO:0030318 | melanocyte differentiation(GO:0030318) |
0.0 | 0.2 | GO:2001199 | negative regulation of dendritic cell differentiation(GO:2001199) |
0.0 | 0.1 | GO:0019732 | antifungal humoral response(GO:0019732) |
0.0 | 0.3 | GO:0010718 | positive regulation of epithelial to mesenchymal transition(GO:0010718) |
0.0 | 0.1 | GO:0048617 | embryonic foregut morphogenesis(GO:0048617) |
0.0 | 0.3 | GO:0034776 | response to histamine(GO:0034776) |
0.0 | 0.9 | GO:0042073 | intraciliary transport(GO:0042073) |
0.0 | 0.0 | GO:0060973 | cell migration involved in heart development(GO:0060973) |
0.0 | 0.2 | GO:0007379 | segment specification(GO:0007379) |
0.0 | 0.4 | GO:0000042 | protein targeting to Golgi(GO:0000042) |
0.0 | 0.1 | GO:0034214 | protein hexamerization(GO:0034214) |
0.0 | 0.1 | GO:0036092 | phosphatidylinositol-3-phosphate biosynthetic process(GO:0036092) |
0.0 | 0.1 | GO:0051665 | membrane raft localization(GO:0051665) |
0.0 | 0.2 | GO:0042989 | sequestering of actin monomers(GO:0042989) |
0.0 | 0.5 | GO:0042755 | eating behavior(GO:0042755) |
0.0 | 0.0 | GO:0060331 | negative regulation of response to interferon-gamma(GO:0060331) negative regulation of interferon-gamma-mediated signaling pathway(GO:0060336) |
0.0 | 0.2 | GO:1901029 | negative regulation of mitochondrial outer membrane permeabilization involved in apoptotic signaling pathway(GO:1901029) |
0.0 | 0.1 | GO:0008300 | isoprenoid catabolic process(GO:0008300) |
0.0 | 0.1 | GO:0035810 | positive regulation of urine volume(GO:0035810) |
0.0 | 0.2 | GO:0035845 | photoreceptor cell outer segment organization(GO:0035845) |
0.0 | 0.1 | GO:0019230 | proprioception(GO:0019230) |
0.0 | 0.0 | GO:0006344 | maintenance of chromatin silencing(GO:0006344) |
0.0 | 0.1 | GO:0051454 | pH elevation(GO:0045852) intracellular pH elevation(GO:0051454) |
0.0 | 0.0 | GO:0051204 | protein insertion into mitochondrial membrane(GO:0051204) |
0.0 | 0.0 | GO:0030997 | regulation of centriole-centriole cohesion(GO:0030997) |
0.0 | 0.1 | GO:0001555 | oocyte growth(GO:0001555) |
0.0 | 0.1 | GO:0035020 | regulation of Rac protein signal transduction(GO:0035020) |
0.0 | 0.0 | GO:0002074 | extraocular skeletal muscle development(GO:0002074) |
0.0 | 0.1 | GO:0046884 | follicle-stimulating hormone secretion(GO:0046884) |
0.0 | 2.1 | GO:0007156 | homophilic cell adhesion via plasma membrane adhesion molecules(GO:0007156) |
0.0 | 0.2 | GO:0070886 | positive regulation of calcineurin-NFAT signaling cascade(GO:0070886) |
0.0 | 0.1 | GO:0007341 | penetration of zona pellucida(GO:0007341) |
0.0 | 0.3 | GO:0046519 | sphingoid metabolic process(GO:0046519) |
0.0 | 0.1 | GO:0042940 | D-amino acid transport(GO:0042940) |
0.0 | 0.1 | GO:0008105 | asymmetric protein localization(GO:0008105) |
0.0 | 0.0 | GO:0000101 | sulfur amino acid transport(GO:0000101) |
0.0 | 0.2 | GO:0051044 | positive regulation of membrane protein ectodomain proteolysis(GO:0051044) |
0.0 | 0.1 | GO:0009182 | purine deoxyribonucleoside diphosphate metabolic process(GO:0009182) dGDP metabolic process(GO:0046066) |
0.0 | 0.4 | GO:0061462 | protein localization to lysosome(GO:0061462) |
0.0 | 0.3 | GO:0050434 | positive regulation of viral transcription(GO:0050434) |
0.0 | 0.1 | GO:0042249 | establishment of planar polarity of embryonic epithelium(GO:0042249) |
0.0 | 0.1 | GO:0045113 | integrin biosynthetic process(GO:0045112) regulation of integrin biosynthetic process(GO:0045113) |
0.0 | 0.1 | GO:0009629 | response to gravity(GO:0009629) |
0.0 | 0.0 | GO:0036438 | maintenance of lens transparency(GO:0036438) |
0.0 | 0.1 | GO:0071895 | odontoblast differentiation(GO:0071895) |
0.0 | 0.0 | GO:0035413 | positive regulation of catenin import into nucleus(GO:0035413) |
0.0 | 0.6 | GO:0007026 | negative regulation of microtubule depolymerization(GO:0007026) |
0.0 | 0.1 | GO:0046341 | CDP-diacylglycerol metabolic process(GO:0046341) |
0.0 | 0.2 | GO:0071392 | cellular response to estradiol stimulus(GO:0071392) |
0.0 | 0.2 | GO:0046598 | positive regulation of viral entry into host cell(GO:0046598) |
0.0 | 0.1 | GO:0032375 | negative regulation of sterol transport(GO:0032372) negative regulation of cholesterol transport(GO:0032375) |
0.0 | 0.0 | GO:0045161 | neuronal ion channel clustering(GO:0045161) |
0.0 | 0.1 | GO:0060600 | dichotomous subdivision of an epithelial terminal unit(GO:0060600) |
0.0 | 0.0 | GO:0007161 | calcium-independent cell-matrix adhesion(GO:0007161) |
0.0 | 0.0 | GO:0034395 | regulation of transcription from RNA polymerase II promoter in response to iron(GO:0034395) |
0.0 | 0.0 | GO:0045200 | establishment or maintenance of neuroblast polarity(GO:0045196) establishment of neuroblast polarity(GO:0045200) |
0.0 | 0.1 | GO:1901252 | regulation of intracellular transport of viral material(GO:1901252) |
0.0 | 0.1 | GO:0018364 | peptidyl-glutamine methylation(GO:0018364) |
0.0 | 0.0 | GO:0009146 | purine nucleoside triphosphate catabolic process(GO:0009146) |
0.0 | 0.0 | GO:0090526 | regulation of gluconeogenesis involved in cellular glucose homeostasis(GO:0090526) |
0.0 | 0.1 | GO:0090244 | Wnt signaling pathway involved in somitogenesis(GO:0090244) |
0.0 | 0.1 | GO:0032754 | positive regulation of interleukin-5 production(GO:0032754) |
0.0 | 0.2 | GO:1900273 | positive regulation of long-term synaptic potentiation(GO:1900273) |
0.0 | 0.2 | GO:0022027 | interkinetic nuclear migration(GO:0022027) |
0.0 | 0.2 | GO:0043312 | neutrophil degranulation(GO:0043312) |
0.0 | 0.1 | GO:0022615 | protein to membrane docking(GO:0022615) |
0.0 | 0.1 | GO:0090385 | phagosome-lysosome fusion(GO:0090385) |
0.0 | 0.0 | GO:0072051 | juxtaglomerular apparatus development(GO:0072051) |
0.0 | 0.5 | GO:0030488 | tRNA methylation(GO:0030488) |
0.0 | 0.1 | GO:1903799 | negative regulation of production of miRNAs involved in gene silencing by miRNA(GO:1903799) |
0.0 | 0.1 | GO:0051295 | establishment of meiotic spindle localization(GO:0051295) |
0.0 | 0.0 | GO:0003162 | atrioventricular node development(GO:0003162) |
0.0 | 0.1 | GO:0008635 | activation of cysteine-type endopeptidase activity involved in apoptotic process by cytochrome c(GO:0008635) |
0.0 | 0.2 | GO:0045324 | late endosome to vacuole transport(GO:0045324) |
0.0 | 0.2 | GO:0042159 | lipoprotein catabolic process(GO:0042159) |
0.0 | 0.1 | GO:0035973 | aggrephagy(GO:0035973) |
0.0 | 0.1 | GO:0036035 | osteoclast development(GO:0036035) |
0.0 | 0.1 | GO:0035116 | embryonic hindlimb morphogenesis(GO:0035116) |
0.0 | 0.1 | GO:0043162 | ubiquitin-dependent protein catabolic process via the multivesicular body sorting pathway(GO:0043162) |
0.0 | 0.0 | GO:1901727 | positive regulation of histone deacetylase activity(GO:1901727) |
0.0 | 0.0 | GO:0043553 | negative regulation of phosphatidylinositol 3-kinase activity(GO:0043553) |
0.0 | 0.0 | GO:1990086 | lens fiber cell apoptotic process(GO:1990086) |
0.0 | 0.1 | GO:0021683 | cerebellar granular layer morphogenesis(GO:0021683) |
0.0 | 0.0 | GO:2000301 | negative regulation of synaptic vesicle exocytosis(GO:2000301) |
0.0 | 0.1 | GO:0002913 | positive regulation of T cell anergy(GO:0002669) positive regulation of lymphocyte anergy(GO:0002913) |
0.0 | 0.1 | GO:0009838 | abscission(GO:0009838) |
0.0 | 0.0 | GO:0032252 | secretory granule localization(GO:0032252) |
0.0 | 0.1 | GO:0033314 | mitotic DNA replication checkpoint(GO:0033314) |
0.0 | 0.1 | GO:0061113 | pancreas morphogenesis(GO:0061113) |
0.0 | 0.1 | GO:0000019 | regulation of mitotic recombination(GO:0000019) negative regulation of mitotic recombination(GO:0045950) |
0.0 | 0.1 | GO:0030174 | regulation of DNA-dependent DNA replication initiation(GO:0030174) |
0.0 | 0.1 | GO:0003417 | growth plate cartilage development(GO:0003417) |
0.0 | 0.1 | GO:0023019 | signal transduction involved in regulation of gene expression(GO:0023019) |
0.0 | 0.0 | GO:0035524 | proline transmembrane transport(GO:0035524) |
0.0 | 0.1 | GO:0070175 | positive regulation of enamel mineralization(GO:0070175) |
0.0 | 0.2 | GO:0060438 | trachea development(GO:0060438) |
0.0 | 0.0 | GO:1900377 | negative regulation of melanin biosynthetic process(GO:0048022) negative regulation of secondary metabolite biosynthetic process(GO:1900377) |
0.0 | 0.1 | GO:0030916 | otic vesicle formation(GO:0030916) |
0.0 | 0.1 | GO:0033615 | mitochondrial proton-transporting ATP synthase complex assembly(GO:0033615) |
0.0 | 0.7 | GO:0008333 | endosome to lysosome transport(GO:0008333) |
0.0 | 0.1 | GO:0090292 | nuclear matrix organization(GO:0043578) nuclear matrix anchoring at nuclear membrane(GO:0090292) |
0.0 | 0.1 | GO:1990928 | response to amino acid starvation(GO:1990928) |
0.0 | 0.1 | GO:0035315 | hair cell differentiation(GO:0035315) |
0.0 | 0.3 | GO:0030225 | macrophage differentiation(GO:0030225) |
0.0 | 0.1 | GO:0060763 | mammary duct terminal end bud growth(GO:0060763) |
0.0 | 0.4 | GO:0035094 | response to nicotine(GO:0035094) |
0.0 | 0.1 | GO:0002215 | defense response to nematode(GO:0002215) |
0.0 | 0.1 | GO:0097680 | double-strand break repair via classical nonhomologous end joining(GO:0097680) |
0.0 | 0.0 | GO:0042033 | chemokine biosynthetic process(GO:0042033) regulation of chemokine biosynthetic process(GO:0045073) negative regulation of chemokine biosynthetic process(GO:0045079) |
0.0 | 0.3 | GO:0034587 | piRNA metabolic process(GO:0034587) |
0.0 | 0.1 | GO:0032682 | negative regulation of chemokine production(GO:0032682) |
0.0 | 0.1 | GO:1901223 | negative regulation of NIK/NF-kappaB signaling(GO:1901223) |
0.0 | 0.1 | GO:0070458 | detoxification of nitrogen compound(GO:0051410) cellular detoxification of nitrogen compound(GO:0070458) |
0.0 | 0.1 | GO:0033169 | histone H3-K9 demethylation(GO:0033169) |
0.0 | 0.0 | GO:0060748 | tertiary branching involved in mammary gland duct morphogenesis(GO:0060748) |
0.0 | 0.1 | GO:0006566 | threonine metabolic process(GO:0006566) |
0.0 | 0.1 | GO:0002934 | desmosome organization(GO:0002934) |
0.0 | 0.2 | GO:0048384 | retinoic acid receptor signaling pathway(GO:0048384) |
0.0 | 0.0 | GO:0035359 | negative regulation of peroxisome proliferator activated receptor signaling pathway(GO:0035359) |
0.0 | 0.2 | GO:0043153 | entrainment of circadian clock by photoperiod(GO:0043153) |
0.0 | 0.4 | GO:0032467 | positive regulation of cytokinesis(GO:0032467) |
0.0 | 0.2 | GO:0090382 | phagosome maturation(GO:0090382) |
0.0 | 0.1 | GO:0006177 | GMP biosynthetic process(GO:0006177) |
0.0 | 0.0 | GO:0001951 | intestinal D-glucose absorption(GO:0001951) |
0.0 | 0.0 | GO:1902744 | negative regulation of lamellipodium organization(GO:1902744) |
0.0 | 0.1 | GO:0007016 | cytoskeletal anchoring at plasma membrane(GO:0007016) |
0.0 | 0.1 | GO:0000012 | single strand break repair(GO:0000012) |
0.0 | 0.0 | GO:0002337 | B-1a B cell differentiation(GO:0002337) |
0.0 | 0.1 | GO:0033353 | S-adenosylmethionine cycle(GO:0033353) |
0.0 | 0.1 | GO:0030091 | protein repair(GO:0030091) |
0.0 | 0.1 | GO:0000389 | mRNA 3'-splice site recognition(GO:0000389) |
0.0 | 0.0 | GO:0033087 | negative regulation of immature T cell proliferation(GO:0033087) |
0.0 | 0.0 | GO:1903525 | regulation of membrane tubulation(GO:1903525) |
0.0 | 0.0 | GO:0030382 | sperm mitochondrion organization(GO:0030382) |
0.0 | 0.0 | GO:0032911 | negative regulation of transforming growth factor beta1 production(GO:0032911) |
0.0 | 0.0 | GO:0045341 | MHC class I biosynthetic process(GO:0045341) regulation of MHC class I biosynthetic process(GO:0045343) positive regulation of MHC class I biosynthetic process(GO:0045345) |
0.0 | 0.8 | GO:0051897 | positive regulation of protein kinase B signaling(GO:0051897) |
0.0 | 0.1 | GO:0045416 | positive regulation of interleukin-8 biosynthetic process(GO:0045416) |
0.0 | 0.4 | GO:0060976 | coronary vasculature development(GO:0060976) |
0.0 | 0.0 | GO:0010940 | positive regulation of necrotic cell death(GO:0010940) |
0.0 | 0.6 | GO:0009994 | oocyte differentiation(GO:0009994) |
0.0 | 0.1 | GO:0002525 | acute inflammatory response to non-antigenic stimulus(GO:0002525) |
0.0 | 0.2 | GO:0060340 | positive regulation of type I interferon-mediated signaling pathway(GO:0060340) |
0.0 | 0.4 | GO:0031146 | SCF-dependent proteasomal ubiquitin-dependent protein catabolic process(GO:0031146) |
0.0 | 0.1 | GO:0030718 | germ-line stem cell population maintenance(GO:0030718) |
0.0 | 0.1 | GO:0034227 | tRNA thio-modification(GO:0034227) |
0.0 | 0.0 | GO:0016080 | synaptic vesicle targeting(GO:0016080) |
0.0 | 0.1 | GO:0005981 | regulation of glycogen catabolic process(GO:0005981) |
0.0 | 0.1 | GO:0030224 | monocyte differentiation(GO:0030224) |
0.0 | 0.1 | GO:0050930 | induction of positive chemotaxis(GO:0050930) |
0.0 | 0.2 | GO:0009081 | branched-chain amino acid metabolic process(GO:0009081) |
0.0 | 0.1 | GO:0060075 | regulation of resting membrane potential(GO:0060075) |
0.0 | 0.0 | GO:0002063 | chondrocyte development(GO:0002063) |
0.0 | 0.2 | GO:0007288 | sperm axoneme assembly(GO:0007288) |
0.0 | 0.0 | GO:0090187 | positive regulation of pancreatic juice secretion(GO:0090187) |
0.0 | 0.0 | GO:0097152 | mesenchymal cell apoptotic process(GO:0097152) |
0.0 | 0.1 | GO:0009204 | deoxyribonucleoside triphosphate catabolic process(GO:0009204) |
0.0 | 0.4 | GO:0019228 | neuronal action potential(GO:0019228) |
0.0 | 0.3 | GO:0009948 | anterior/posterior axis specification(GO:0009948) |
0.0 | 0.1 | GO:0002523 | leukocyte migration involved in inflammatory response(GO:0002523) |
0.0 | 0.1 | GO:0050884 | neuromuscular process controlling posture(GO:0050884) |
0.0 | 0.1 | GO:1903421 | regulation of synaptic vesicle recycling(GO:1903421) |
0.0 | 0.2 | GO:0035329 | hippo signaling(GO:0035329) |
0.0 | 0.4 | GO:1904893 | negative regulation of JAK-STAT cascade(GO:0046426) negative regulation of STAT cascade(GO:1904893) |
0.0 | 0.2 | GO:0015816 | glycine transport(GO:0015816) |
0.0 | 0.1 | GO:0045217 | cell-cell junction maintenance(GO:0045217) |
0.0 | 0.1 | GO:0051451 | myoblast migration(GO:0051451) |
0.0 | 0.0 | GO:0070973 | protein localization to endoplasmic reticulum exit site(GO:0070973) |
0.0 | 0.1 | GO:0031118 | rRNA pseudouridine synthesis(GO:0031118) |
0.0 | 0.3 | GO:0048565 | digestive tract development(GO:0048565) |
0.0 | 0.1 | GO:0015755 | fructose transport(GO:0015755) |
0.0 | 0.1 | GO:1902775 | mitochondrial ribosome assembly(GO:0061668) mitochondrial large ribosomal subunit assembly(GO:1902775) |
0.0 | 0.1 | GO:2000348 | regulation of CD40 signaling pathway(GO:2000348) |
0.0 | 0.1 | GO:0035987 | endodermal cell differentiation(GO:0035987) |
0.0 | 0.1 | GO:0046037 | GMP metabolic process(GO:0046037) |
0.0 | 0.1 | GO:0018344 | protein geranylgeranylation(GO:0018344) |
0.0 | 0.1 | GO:0035641 | locomotory exploration behavior(GO:0035641) |
0.0 | 0.0 | GO:1990314 | cellular response to insulin-like growth factor stimulus(GO:1990314) |
0.0 | 0.1 | GO:0098532 | histone H3-K27 trimethylation(GO:0098532) |
0.0 | 0.2 | GO:0090169 | regulation of spindle assembly(GO:0090169) |
0.0 | 0.1 | GO:0006290 | pyrimidine dimer repair(GO:0006290) |
0.0 | 0.1 | GO:2000676 | positive regulation of type B pancreatic cell apoptotic process(GO:2000676) |
0.0 | 0.0 | GO:0002067 | glandular epithelial cell differentiation(GO:0002067) |
0.0 | 0.0 | GO:0000710 | meiotic mismatch repair(GO:0000710) |
0.0 | 0.0 | GO:0042747 | regulation of circadian sleep/wake cycle, REM sleep(GO:0042320) circadian sleep/wake cycle, REM sleep(GO:0042747) |
0.0 | 0.2 | GO:1901407 | regulation of phosphorylation of RNA polymerase II C-terminal domain(GO:1901407) positive regulation of phosphorylation of RNA polymerase II C-terminal domain(GO:1901409) |
0.0 | 0.2 | GO:0042104 | positive regulation of activated T cell proliferation(GO:0042104) |
0.0 | 0.1 | GO:0050861 | positive regulation of B cell receptor signaling pathway(GO:0050861) |
0.0 | 0.1 | GO:0070269 | pyroptosis(GO:0070269) |
0.0 | 0.2 | GO:0043616 | keratinocyte proliferation(GO:0043616) |
0.0 | 0.4 | GO:0006890 | retrograde vesicle-mediated transport, Golgi to ER(GO:0006890) |
0.0 | 0.0 | GO:0007060 | male meiosis chromosome segregation(GO:0007060) |
0.0 | 0.1 | GO:0018231 | peptidyl-L-cysteine S-palmitoylation(GO:0018230) peptidyl-S-diacylglycerol-L-cysteine biosynthetic process from peptidyl-cysteine(GO:0018231) |
0.0 | 0.0 | GO:0000255 | allantoin metabolic process(GO:0000255) |
0.0 | 0.3 | GO:0017144 | drug metabolic process(GO:0017144) |
0.0 | 0.0 | GO:0071799 | response to prostaglandin D(GO:0071798) cellular response to prostaglandin D stimulus(GO:0071799) |
0.0 | 0.0 | GO:0097195 | pilomotor reflex(GO:0097195) |
0.0 | 0.1 | GO:0010758 | regulation of macrophage chemotaxis(GO:0010758) |
0.0 | 0.0 | GO:0042271 | susceptibility to natural killer cell mediated cytotoxicity(GO:0042271) |
0.0 | 0.0 | GO:0051365 | cellular response to potassium ion starvation(GO:0051365) |
0.0 | 0.0 | GO:0006624 | vacuolar protein processing(GO:0006624) |
0.0 | 0.1 | GO:0002923 | regulation of humoral immune response mediated by circulating immunoglobulin(GO:0002923) |
0.0 | 0.0 | GO:0021586 | pons maturation(GO:0021586) |
0.0 | 0.0 | GO:0045760 | positive regulation of action potential(GO:0045760) |
0.0 | 0.1 | GO:0016446 | somatic hypermutation of immunoglobulin genes(GO:0016446) |
0.0 | 0.7 | GO:0001824 | blastocyst development(GO:0001824) |
0.0 | 0.1 | GO:0045879 | negative regulation of smoothened signaling pathway(GO:0045879) |
0.0 | 0.0 | GO:0014067 | negative regulation of phosphatidylinositol 3-kinase signaling(GO:0014067) |
0.0 | 0.1 | GO:0043504 | mitochondrial DNA repair(GO:0043504) |
0.0 | 0.0 | GO:0098763 | mitotic cell cycle phase(GO:0098763) |
0.0 | 0.0 | GO:0070601 | centromeric sister chromatid cohesion(GO:0070601) |
0.0 | 0.0 | GO:0039692 | single stranded viral RNA replication via double stranded DNA intermediate(GO:0039692) regulation of single stranded viral RNA replication via double stranded DNA intermediate(GO:0045091) |
0.0 | 0.1 | GO:0046548 | retinal rod cell development(GO:0046548) |
0.0 | 0.4 | GO:0050853 | B cell receptor signaling pathway(GO:0050853) |
0.0 | 0.0 | GO:2000973 | regulation of pro-B cell differentiation(GO:2000973) |
0.0 | 0.3 | GO:0045739 | positive regulation of DNA repair(GO:0045739) |
0.0 | 0.1 | GO:0048712 | negative regulation of astrocyte differentiation(GO:0048712) |
0.0 | 0.0 | GO:0043568 | positive regulation of insulin-like growth factor receptor signaling pathway(GO:0043568) |
0.0 | 0.0 | GO:0006651 | diacylglycerol biosynthetic process(GO:0006651) |
0.0 | 0.1 | GO:0006122 | mitochondrial electron transport, ubiquinol to cytochrome c(GO:0006122) |
0.0 | 0.1 | GO:0070125 | mitochondrial translational elongation(GO:0070125) |
0.0 | 0.1 | GO:0035999 | tetrahydrofolate interconversion(GO:0035999) |
0.0 | 0.0 | GO:0036342 | post-anal tail morphogenesis(GO:0036342) |
0.0 | 0.2 | GO:1900017 | positive regulation of cytokine production involved in inflammatory response(GO:1900017) |
0.0 | 0.0 | GO:0060148 | positive regulation of posttranscriptional gene silencing(GO:0060148) |
0.0 | 0.0 | GO:0031999 | negative regulation of fatty acid beta-oxidation(GO:0031999) |
0.0 | 0.1 | GO:0018027 | peptidyl-lysine dimethylation(GO:0018027) |
0.0 | 0.1 | GO:0045662 | negative regulation of myoblast differentiation(GO:0045662) |
0.0 | 0.1 | GO:0006654 | phosphatidic acid biosynthetic process(GO:0006654) |
0.0 | 0.0 | GO:1905154 | negative regulation of membrane invagination(GO:1905154) |
0.0 | 0.1 | GO:0060038 | cardiac muscle cell proliferation(GO:0060038) |
0.0 | 0.1 | GO:0019363 | pyridine nucleotide biosynthetic process(GO:0019363) |
0.0 | 0.0 | GO:0008054 | negative regulation of cyclin-dependent protein serine/threonine kinase by cyclin degradation(GO:0008054) |
0.0 | 0.1 | GO:2000010 | positive regulation of protein localization to cell surface(GO:2000010) |
0.0 | 0.2 | GO:0018345 | protein palmitoylation(GO:0018345) |
0.0 | 0.0 | GO:0033227 | dsRNA transport(GO:0033227) |
0.0 | 0.0 | GO:0035754 | B cell chemotaxis(GO:0035754) |
0.0 | 0.0 | GO:0060125 | negative regulation of growth hormone secretion(GO:0060125) |
0.0 | 0.0 | GO:0015817 | histidine transport(GO:0015817) |
0.0 | 0.1 | GO:0010890 | positive regulation of sequestering of triglyceride(GO:0010890) |
0.0 | 0.0 | GO:0071622 | regulation of granulocyte chemotaxis(GO:0071622) |
0.0 | 0.0 | GO:0070544 | histone H3-K36 demethylation(GO:0070544) |
0.0 | 0.1 | GO:0030007 | cellular potassium ion homeostasis(GO:0030007) |
0.0 | 0.1 | GO:1900119 | positive regulation of execution phase of apoptosis(GO:1900119) |
0.0 | 0.1 | GO:0042428 | serotonin metabolic process(GO:0042428) |
0.0 | 0.1 | GO:0071044 | histone mRNA catabolic process(GO:0071044) |
0.0 | 0.0 | GO:0015744 | succinate transport(GO:0015744) |
0.0 | 0.0 | GO:0060157 | urinary bladder development(GO:0060157) |
0.0 | 0.0 | GO:0045602 | negative regulation of endothelial cell differentiation(GO:0045602) |
0.0 | 0.2 | GO:0007588 | excretion(GO:0007588) |
0.0 | 0.0 | GO:0009051 | pentose-phosphate shunt, oxidative branch(GO:0009051) |
0.0 | 0.0 | GO:0000212 | meiotic spindle organization(GO:0000212) |
0.0 | 0.0 | GO:0003100 | regulation of systemic arterial blood pressure by endothelin(GO:0003100) |
0.0 | 0.0 | GO:0061502 | early endosome to recycling endosome transport(GO:0061502) |
0.0 | 0.0 | GO:0048850 | hypophysis morphogenesis(GO:0048850) |
0.0 | 0.0 | GO:0030222 | eosinophil differentiation(GO:0030222) |
0.0 | 0.0 | GO:0003406 | retinal pigment epithelium development(GO:0003406) |
0.0 | 0.1 | GO:0000083 | regulation of transcription involved in G1/S transition of mitotic cell cycle(GO:0000083) |
0.0 | 0.1 | GO:2001015 | negative regulation of skeletal muscle cell differentiation(GO:2001015) |
0.0 | 0.1 | GO:0006817 | phosphate ion transport(GO:0006817) |
0.0 | 0.0 | GO:0009957 | epidermal cell fate specification(GO:0009957) |
0.0 | 0.1 | GO:0000413 | protein peptidyl-prolyl isomerization(GO:0000413) |
0.0 | 0.0 | GO:0050650 | chondroitin sulfate proteoglycan biosynthetic process(GO:0050650) |
0.0 | 0.0 | GO:0035092 | sperm chromatin condensation(GO:0035092) |
0.0 | 0.0 | GO:0046167 | glycerol-3-phosphate biosynthetic process(GO:0046167) |
0.0 | 0.0 | GO:0033687 | osteoblast proliferation(GO:0033687) |
0.0 | 0.0 | GO:0042713 | sperm ejaculation(GO:0042713) |
0.0 | 0.1 | GO:0060706 | cell differentiation involved in embryonic placenta development(GO:0060706) |
0.0 | 0.1 | GO:0006689 | ganglioside catabolic process(GO:0006689) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.6 | 2.5 | GO:1990851 | Wnt-Frizzled-LRP5/6 complex(GO:1990851) |
0.5 | 1.5 | GO:0005863 | striated muscle myosin thick filament(GO:0005863) |
0.4 | 2.3 | GO:0030670 | phagocytic vesicle membrane(GO:0030670) |
0.4 | 2.1 | GO:0031258 | lamellipodium membrane(GO:0031258) |
0.4 | 1.1 | GO:0030313 | cell outer membrane(GO:0009279) cell envelope(GO:0030313) external encapsulating structure part(GO:0044462) |
0.3 | 1.4 | GO:0005593 | FACIT collagen trimer(GO:0005593) |
0.3 | 1.0 | GO:0034673 | inhibin-betaglycan-ActRII complex(GO:0034673) |
0.3 | 0.9 | GO:0032280 | symmetric synapse(GO:0032280) |
0.3 | 1.6 | GO:0005915 | zonula adherens(GO:0005915) |
0.3 | 3.4 | GO:0033270 | paranode region of axon(GO:0033270) |
0.2 | 1.0 | GO:0032437 | cuticular plate(GO:0032437) |
0.2 | 0.7 | GO:0016939 | kinesin II complex(GO:0016939) |
0.2 | 2.6 | GO:0005583 | fibrillar collagen trimer(GO:0005583) banded collagen fibril(GO:0098643) |
0.2 | 0.7 | GO:0055087 | Ski complex(GO:0055087) |
0.2 | 1.7 | GO:0005861 | troponin complex(GO:0005861) |
0.2 | 0.6 | GO:0070552 | BRISC complex(GO:0070552) |
0.2 | 0.8 | GO:0016942 | insulin-like growth factor binding protein complex(GO:0016942) growth factor complex(GO:0036454) insulin-like growth factor ternary complex(GO:0042567) |
0.2 | 0.6 | GO:0005606 | laminin-1 complex(GO:0005606) |
0.2 | 1.6 | GO:0005890 | sodium:potassium-exchanging ATPase complex(GO:0005890) |
0.2 | 2.2 | GO:0001518 | voltage-gated sodium channel complex(GO:0001518) |
0.2 | 0.6 | GO:0097427 | microtubule bundle(GO:0097427) |
0.2 | 0.2 | GO:0043259 | laminin-10 complex(GO:0043259) |
0.2 | 1.1 | GO:0005587 | collagen type IV trimer(GO:0005587) network-forming collagen trimer(GO:0098642) collagen network(GO:0098645) basement membrane collagen trimer(GO:0098651) |
0.2 | 0.7 | GO:0071953 | elastic fiber(GO:0071953) |
0.2 | 0.5 | GO:0034706 | sodium channel complex(GO:0034706) |
0.2 | 0.3 | GO:0031618 | nuclear pericentric heterochromatin(GO:0031618) |
0.2 | 0.5 | GO:0005610 | laminin-5 complex(GO:0005610) |
0.2 | 0.5 | GO:0005945 | 6-phosphofructokinase complex(GO:0005945) |
0.2 | 1.8 | GO:0097449 | astrocyte projection(GO:0097449) |
0.2 | 1.6 | GO:0017146 | NMDA selective glutamate receptor complex(GO:0017146) |
0.2 | 0.9 | GO:0002177 | manchette(GO:0002177) |
0.2 | 0.6 | GO:0017071 | intracellular cyclic nucleotide activated cation channel complex(GO:0017071) |
0.1 | 2.3 | GO:0005614 | interstitial matrix(GO:0005614) |
0.1 | 0.3 | GO:0002193 | MAML1-RBP-Jkappa- ICN1 complex(GO:0002193) |
0.1 | 1.1 | GO:0036157 | outer dynein arm(GO:0036157) |
0.1 | 2.2 | GO:0016327 | apicolateral plasma membrane(GO:0016327) |
0.1 | 0.6 | GO:0043202 | lysosomal lumen(GO:0043202) |
0.1 | 1.0 | GO:0033256 | I-kappaB/NF-kappaB complex(GO:0033256) |
0.1 | 1.0 | GO:0097470 | ribbon synapse(GO:0097470) |
0.1 | 0.3 | GO:0090533 | cation-transporting ATPase complex(GO:0090533) |
0.1 | 1.1 | GO:0043083 | synaptic cleft(GO:0043083) |
0.1 | 1.1 | GO:0032045 | guanyl-nucleotide exchange factor complex(GO:0032045) |
0.1 | 0.5 | GO:0030478 | actin cap(GO:0030478) |
0.1 | 2.2 | GO:0032588 | trans-Golgi network membrane(GO:0032588) |
0.1 | 12.1 | GO:0043296 | apical junction complex(GO:0043296) |
0.1 | 0.7 | GO:0000138 | Golgi trans cisterna(GO:0000138) |
0.1 | 0.5 | GO:0034363 | intermediate-density lipoprotein particle(GO:0034363) |
0.1 | 0.5 | GO:0044354 | pinosome(GO:0044352) macropinosome(GO:0044354) |
0.1 | 1.3 | GO:0031512 | motile primary cilium(GO:0031512) |
0.1 | 0.5 | GO:0097136 | Bcl-2 family protein complex(GO:0097136) |
0.1 | 0.3 | GO:0070939 | Dsl1p complex(GO:0070939) |
0.1 | 1.3 | GO:0031430 | M band(GO:0031430) |
0.1 | 2.7 | GO:0044295 | axonal growth cone(GO:0044295) |
0.1 | 1.0 | GO:0001527 | microfibril(GO:0001527) |
0.1 | 1.8 | GO:0031233 | intrinsic component of external side of plasma membrane(GO:0031233) |
0.1 | 0.5 | GO:0005859 | muscle myosin complex(GO:0005859) |
0.1 | 0.5 | GO:0045098 | type III intermediate filament(GO:0045098) |
0.1 | 0.3 | GO:1990635 | proximal dendrite(GO:1990635) |
0.1 | 0.7 | GO:0043194 | axon initial segment(GO:0043194) |
0.1 | 0.2 | GO:1990423 | RZZ complex(GO:1990423) |
0.1 | 0.7 | GO:0098563 | integral component of synaptic vesicle membrane(GO:0030285) intrinsic component of synaptic vesicle membrane(GO:0098563) |
0.1 | 0.6 | GO:0044300 | cerebellar mossy fiber(GO:0044300) |
0.1 | 0.6 | GO:0001940 | male pronucleus(GO:0001940) |
0.1 | 0.8 | GO:0031595 | nuclear proteasome complex(GO:0031595) |
0.1 | 0.3 | GO:0000802 | transverse filament(GO:0000802) |
0.1 | 0.5 | GO:0030485 | smooth muscle contractile fiber(GO:0030485) |
0.1 | 0.2 | GO:0098533 | ATPase dependent transmembrane transport complex(GO:0098533) |
0.1 | 0.3 | GO:0000110 | nucleotide-excision repair factor 1 complex(GO:0000110) |
0.1 | 0.1 | GO:0072534 | perineuronal net(GO:0072534) |
0.1 | 0.3 | GO:0060053 | neurofilament cytoskeleton(GO:0060053) |
0.1 | 0.2 | GO:0008282 | ATP-sensitive potassium channel complex(GO:0008282) |
0.1 | 0.3 | GO:0005952 | cAMP-dependent protein kinase complex(GO:0005952) |
0.1 | 0.4 | GO:0070938 | contractile ring(GO:0070938) |
0.1 | 0.7 | GO:0031932 | TORC2 complex(GO:0031932) |
0.1 | 0.4 | GO:0048787 | presynaptic active zone membrane(GO:0048787) |
0.1 | 0.4 | GO:0071204 | histone pre-mRNA 3'end processing complex(GO:0071204) |
0.1 | 2.8 | GO:0042734 | presynaptic membrane(GO:0042734) |
0.1 | 0.5 | GO:0030062 | mitochondrial tricarboxylic acid cycle enzyme complex(GO:0030062) |
0.1 | 0.1 | GO:0032983 | kainate selective glutamate receptor complex(GO:0032983) |
0.1 | 0.7 | GO:0005916 | fascia adherens(GO:0005916) |
0.1 | 1.0 | GO:0046930 | pore complex(GO:0046930) |
0.1 | 1.3 | GO:0030673 | axolemma(GO:0030673) |
0.1 | 0.4 | GO:0071547 | piP-body(GO:0071547) |
0.1 | 0.7 | GO:0042581 | specific granule(GO:0042581) |
0.1 | 0.6 | GO:0042587 | glycogen granule(GO:0042587) |
0.1 | 0.3 | GO:0032585 | multivesicular body membrane(GO:0032585) |
0.1 | 1.2 | GO:0010369 | chromocenter(GO:0010369) |
0.1 | 2.0 | GO:0031941 | filamentous actin(GO:0031941) |
0.1 | 0.8 | GO:0005641 | nuclear envelope lumen(GO:0005641) |
0.1 | 0.6 | GO:0030314 | junctional membrane complex(GO:0030314) |
0.1 | 5.0 | GO:0005604 | basement membrane(GO:0005604) |
0.1 | 0.5 | GO:0001520 | outer dense fiber(GO:0001520) |
0.1 | 1.8 | GO:0046658 | anchored component of plasma membrane(GO:0046658) |
0.1 | 0.3 | GO:0098553 | integral component of cytoplasmic side of endoplasmic reticulum membrane(GO:0071458) integral component of lumenal side of endoplasmic reticulum membrane(GO:0071556) lumenal side of endoplasmic reticulum membrane(GO:0098553) |
0.1 | 0.2 | GO:0030289 | protein phosphatase 4 complex(GO:0030289) |
0.1 | 0.3 | GO:0005638 | lamin filament(GO:0005638) |
0.1 | 0.6 | GO:0032426 | stereocilium tip(GO:0032426) |
0.1 | 0.4 | GO:0097197 | tetraspanin-enriched microdomain(GO:0097197) |
0.1 | 0.1 | GO:0070765 | gamma-secretase complex(GO:0070765) |
0.1 | 0.2 | GO:0034274 | Atg12-Atg5-Atg16 complex(GO:0034274) |
0.1 | 0.1 | GO:0033268 | node of Ranvier(GO:0033268) |
0.1 | 1.9 | GO:0005581 | collagen trimer(GO:0005581) |
0.1 | 1.6 | GO:0016328 | lateral plasma membrane(GO:0016328) |
0.1 | 0.3 | GO:0072588 | box H/ACA snoRNP complex(GO:0031429) box H/ACA RNP complex(GO:0072588) |
0.1 | 3.2 | GO:0030175 | filopodium(GO:0030175) |
0.1 | 0.7 | GO:0060077 | inhibitory synapse(GO:0060077) |
0.1 | 0.2 | GO:0071203 | WASH complex(GO:0071203) |
0.1 | 3.1 | GO:0019005 | SCF ubiquitin ligase complex(GO:0019005) |
0.1 | 0.3 | GO:0016281 | eukaryotic translation initiation factor 4F complex(GO:0016281) |
0.1 | 1.3 | GO:0042470 | melanosome(GO:0042470) pigment granule(GO:0048770) |
0.1 | 0.7 | GO:0031045 | dense core granule(GO:0031045) |
0.1 | 0.9 | GO:1902711 | GABA receptor complex(GO:1902710) GABA-A receptor complex(GO:1902711) |
0.1 | 0.2 | GO:0000814 | ESCRT II complex(GO:0000814) |
0.1 | 0.5 | GO:1990124 | messenger ribonucleoprotein complex(GO:1990124) |
0.1 | 0.2 | GO:0009331 | glycerol-3-phosphate dehydrogenase complex(GO:0009331) |
0.1 | 0.2 | GO:0097543 | ciliary inversin compartment(GO:0097543) |
0.1 | 0.3 | GO:0030870 | Mre11 complex(GO:0030870) |
0.1 | 0.6 | GO:0043240 | Fanconi anaemia nuclear complex(GO:0043240) |
0.1 | 1.5 | GO:0016235 | aggresome(GO:0016235) |
0.1 | 0.2 | GO:0000235 | astral microtubule(GO:0000235) |
0.1 | 0.4 | GO:0005883 | neurofilament(GO:0005883) |
0.1 | 0.2 | GO:0000015 | phosphopyruvate hydratase complex(GO:0000015) |
0.1 | 0.2 | GO:0046696 | lipopolysaccharide receptor complex(GO:0046696) |
0.0 | 0.2 | GO:0032009 | early phagosome(GO:0032009) |
0.0 | 0.7 | GO:0097038 | perinuclear endoplasmic reticulum(GO:0097038) |
0.0 | 0.2 | GO:0030128 | clathrin coat of endocytic vesicle(GO:0030128) |
0.0 | 0.2 | GO:0002081 | outer acrosomal membrane(GO:0002081) |
0.0 | 1.8 | GO:0032432 | actin filament bundle(GO:0032432) |
0.0 | 0.2 | GO:1990246 | uniplex complex(GO:1990246) |
0.0 | 0.0 | GO:0044393 | microspike(GO:0044393) |
0.0 | 0.1 | GO:0005712 | chiasma(GO:0005712) |
0.0 | 0.6 | GO:0036038 | MKS complex(GO:0036038) |
0.0 | 0.3 | GO:0072669 | tRNA-splicing ligase complex(GO:0072669) |
0.0 | 0.2 | GO:0000942 | condensed nuclear chromosome outer kinetochore(GO:0000942) |
0.0 | 0.7 | GO:0005892 | acetylcholine-gated channel complex(GO:0005892) |
0.0 | 0.4 | GO:0033391 | chromatoid body(GO:0033391) |
0.0 | 0.4 | GO:0002102 | podosome(GO:0002102) |
0.0 | 0.2 | GO:0045179 | apical cortex(GO:0045179) |
0.0 | 0.1 | GO:0097542 | ciliary tip(GO:0097542) |
0.0 | 0.5 | GO:0035371 | microtubule plus-end(GO:0035371) |
0.0 | 0.2 | GO:0000798 | nuclear cohesin complex(GO:0000798) |
0.0 | 0.3 | GO:0033116 | endoplasmic reticulum-Golgi intermediate compartment membrane(GO:0033116) |
0.0 | 0.3 | GO:0005858 | axonemal dynein complex(GO:0005858) |
0.0 | 0.0 | GO:0005927 | muscle tendon junction(GO:0005927) |
0.0 | 0.1 | GO:0031313 | extrinsic component of endosome membrane(GO:0031313) |
0.0 | 1.2 | GO:0031594 | neuromuscular junction(GO:0031594) |
0.0 | 0.2 | GO:0032593 | insulin-responsive compartment(GO:0032593) |
0.0 | 0.1 | GO:0032591 | dendritic spine membrane(GO:0032591) |
0.0 | 0.1 | GO:0070937 | CRD-mediated mRNA stability complex(GO:0070937) |
0.0 | 0.2 | GO:0071986 | Ragulator complex(GO:0071986) |
0.0 | 1.7 | GO:0017053 | transcriptional repressor complex(GO:0017053) |
0.0 | 0.5 | GO:0005665 | DNA-directed RNA polymerase II, core complex(GO:0005665) |
0.0 | 0.1 | GO:0005968 | Rab-protein geranylgeranyltransferase complex(GO:0005968) |
0.0 | 0.2 | GO:0045252 | dihydrolipoyl dehydrogenase complex(GO:0045240) oxoglutarate dehydrogenase complex(GO:0045252) |
0.0 | 0.2 | GO:0090543 | Flemming body(GO:0090543) |
0.0 | 2.6 | GO:0031225 | anchored component of membrane(GO:0031225) |
0.0 | 0.3 | GO:0097546 | ciliary base(GO:0097546) |
0.0 | 0.5 | GO:0033017 | sarcoplasmic reticulum membrane(GO:0033017) |
0.0 | 0.2 | GO:0032982 | myosin filament(GO:0032982) |
0.0 | 0.1 | GO:0000214 | tRNA-intron endonuclease complex(GO:0000214) |
0.0 | 0.0 | GO:0044316 | cone cell pedicle(GO:0044316) |
0.0 | 0.1 | GO:0071438 | invadopodium membrane(GO:0071438) |
0.0 | 2.6 | GO:0005882 | intermediate filament(GO:0005882) |
0.0 | 0.1 | GO:0097149 | centralspindlin complex(GO:0097149) |
0.0 | 0.1 | GO:0000805 | X chromosome(GO:0000805) |
0.0 | 0.1 | GO:0019907 | cyclin-dependent protein kinase activating kinase holoenzyme complex(GO:0019907) |
0.0 | 0.6 | GO:0016459 | myosin complex(GO:0016459) |
0.0 | 0.2 | GO:0005721 | pericentric heterochromatin(GO:0005721) |
0.0 | 0.1 | GO:0016589 | NURF complex(GO:0016589) |
0.0 | 0.6 | GO:0008328 | ionotropic glutamate receptor complex(GO:0008328) neurotransmitter receptor complex(GO:0098878) |
0.0 | 0.5 | GO:0030992 | intraciliary transport particle B(GO:0030992) |
0.0 | 0.1 | GO:0008275 | gamma-tubulin small complex(GO:0008275) |
0.0 | 0.1 | GO:0044214 | spanning component of plasma membrane(GO:0044214) spanning component of membrane(GO:0089717) |
0.0 | 0.1 | GO:0048237 | rough endoplasmic reticulum lumen(GO:0048237) |
0.0 | 0.0 | GO:0071546 | pi-body(GO:0071546) |
0.0 | 0.1 | GO:0071817 | MMXD complex(GO:0071817) |
0.0 | 0.1 | GO:0010009 | cytoplasmic side of endosome membrane(GO:0010009) |
0.0 | 0.1 | GO:0030915 | Smc5-Smc6 complex(GO:0030915) |
0.0 | 0.1 | GO:0043527 | tRNA methyltransferase complex(GO:0043527) |
0.0 | 0.6 | GO:0034707 | chloride channel complex(GO:0034707) |
0.0 | 0.3 | GO:0030014 | CCR4-NOT complex(GO:0030014) |
0.0 | 1.1 | GO:0001750 | photoreceptor outer segment(GO:0001750) |
0.0 | 0.2 | GO:0000506 | glycosylphosphatidylinositol-N-acetylglucosaminyltransferase (GPI-GnT) complex(GO:0000506) |
0.0 | 0.1 | GO:0030990 | intraciliary transport particle(GO:0030990) |
0.0 | 0.3 | GO:0005697 | telomerase holoenzyme complex(GO:0005697) |
0.0 | 0.0 | GO:0031074 | nucleocytoplasmic shuttling complex(GO:0031074) |
0.0 | 0.3 | GO:0035098 | ESC/E(Z) complex(GO:0035098) |
0.0 | 0.1 | GO:0000137 | Golgi cis cisterna(GO:0000137) |
0.0 | 7.1 | GO:0005667 | transcription factor complex(GO:0005667) |
0.0 | 0.5 | GO:0000307 | cyclin-dependent protein kinase holoenzyme complex(GO:0000307) |
0.0 | 0.2 | GO:0031211 | serine C-palmitoyltransferase complex(GO:0017059) endoplasmic reticulum palmitoyltransferase complex(GO:0031211) |
0.0 | 0.0 | GO:0043219 | lateral loop(GO:0043219) |
0.0 | 0.2 | GO:0005750 | mitochondrial respiratory chain complex III(GO:0005750) respiratory chain complex III(GO:0045275) |
0.0 | 0.0 | GO:0035749 | myelin sheath adaxonal region(GO:0035749) |
0.0 | 0.1 | GO:0072557 | IPAF inflammasome complex(GO:0072557) |
0.0 | 0.1 | GO:0070044 | synaptobrevin 2-SNAP-25-syntaxin-1a complex(GO:0070044) |
0.0 | 0.6 | GO:0005834 | heterotrimeric G-protein complex(GO:0005834) |
0.0 | 0.1 | GO:0000172 | ribonuclease MRP complex(GO:0000172) |
0.0 | 0.1 | GO:0070187 | telosome(GO:0070187) |
0.0 | 0.2 | GO:0035686 | sperm fibrous sheath(GO:0035686) |
0.0 | 0.0 | GO:0016533 | cyclin-dependent protein kinase 5 holoenzyme complex(GO:0016533) |
0.0 | 0.0 | GO:0043625 | delta DNA polymerase complex(GO:0043625) |
0.0 | 0.1 | GO:0042589 | zymogen granule membrane(GO:0042589) |
0.0 | 0.9 | GO:0008076 | voltage-gated potassium channel complex(GO:0008076) |
0.0 | 0.1 | GO:0042613 | MHC class II protein complex(GO:0042613) |
0.0 | 0.2 | GO:0033643 | host(GO:0018995) host cell part(GO:0033643) host cell(GO:0043657) |
0.0 | 0.0 | GO:0035061 | interchromatin granule(GO:0035061) |
0.0 | 0.2 | GO:0035327 | transcriptionally active chromatin(GO:0035327) |
0.0 | 0.1 | GO:0034388 | Pwp2p-containing subcomplex of 90S preribosome(GO:0034388) |
0.0 | 0.0 | GO:1990393 | 3M complex(GO:1990393) |
0.0 | 0.0 | GO:0098554 | cytoplasmic side of endoplasmic reticulum membrane(GO:0098554) |
0.0 | 0.1 | GO:0070775 | H3 histone acetyltransferase complex(GO:0070775) MOZ/MORF histone acetyltransferase complex(GO:0070776) |
0.0 | 0.0 | GO:0031933 | telomeric heterochromatin(GO:0031933) |
0.0 | 0.0 | GO:0034457 | Mpp10 complex(GO:0034457) |
0.0 | 0.0 | GO:0071001 | U4/U6 snRNP(GO:0071001) |
0.0 | 0.1 | GO:0031428 | box C/D snoRNP complex(GO:0031428) |
0.0 | 0.4 | GO:0005763 | organellar small ribosomal subunit(GO:0000314) mitochondrial small ribosomal subunit(GO:0005763) |
0.0 | 0.1 | GO:0097431 | mitotic spindle pole(GO:0097431) |
0.0 | 0.0 | GO:0048179 | activin receptor complex(GO:0048179) |
0.0 | 0.0 | GO:0005956 | protein kinase CK2 complex(GO:0005956) |
0.0 | 0.1 | GO:1990716 | axonemal central apparatus(GO:1990716) |
0.0 | 0.1 | GO:0000220 | vacuolar proton-transporting V-type ATPase, V0 domain(GO:0000220) |
0.0 | 0.5 | GO:0031012 | extracellular matrix(GO:0031012) |
0.0 | 0.1 | GO:0071014 | post-mRNA release spliceosomal complex(GO:0071014) |
0.0 | 2.0 | GO:0005578 | proteinaceous extracellular matrix(GO:0005578) |
0.0 | 0.0 | GO:0045180 | basal cortex(GO:0045180) |
0.0 | 0.0 | GO:0008622 | epsilon DNA polymerase complex(GO:0008622) |
0.0 | 0.4 | GO:0005881 | cytoplasmic microtubule(GO:0005881) |
0.0 | 0.2 | GO:0005719 | nuclear euchromatin(GO:0005719) |
0.0 | 0.0 | GO:0036396 | MIS complex(GO:0036396) |
0.0 | 0.0 | GO:0044326 | dendritic spine neck(GO:0044326) |
0.0 | 0.1 | GO:0071006 | U2-type catalytic step 1 spliceosome(GO:0071006) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.7 | 2.9 | GO:0004065 | arylsulfatase activity(GO:0004065) |
0.6 | 0.6 | GO:0001025 | RNA polymerase III transcription factor binding(GO:0001025) |
0.6 | 2.8 | GO:0044323 | retinoic acid-responsive element binding(GO:0044323) |
0.6 | 2.2 | GO:0038064 | collagen receptor activity(GO:0038064) |
0.6 | 2.2 | GO:0005042 | netrin receptor activity(GO:0005042) |
0.5 | 1.5 | GO:1990430 | extracellular matrix protein binding(GO:1990430) |
0.5 | 1.4 | GO:0000702 | oxidized base lesion DNA N-glycosylase activity(GO:0000702) |
0.4 | 1.3 | GO:0070915 | lysophosphatidic acid receptor activity(GO:0070915) |
0.4 | 1.3 | GO:0097109 | neuroligin family protein binding(GO:0097109) |
0.4 | 1.3 | GO:1902282 | voltage-gated potassium channel activity involved in ventricular cardiac muscle cell action potential repolarization(GO:1902282) |
0.4 | 0.4 | GO:0004699 | calcium-independent protein kinase C activity(GO:0004699) |
0.4 | 1.5 | GO:0031433 | telethonin binding(GO:0031433) |
0.4 | 1.9 | GO:0051525 | NFAT protein binding(GO:0051525) |
0.4 | 1.1 | GO:0004024 | alcohol dehydrogenase activity, zinc-dependent(GO:0004024) |
0.4 | 6.1 | GO:0015026 | coreceptor activity(GO:0015026) |
0.3 | 1.7 | GO:0070883 | pre-miRNA binding(GO:0070883) |
0.3 | 0.7 | GO:0035373 | chondroitin sulfate proteoglycan binding(GO:0035373) |
0.3 | 1.7 | GO:0086006 | voltage-gated sodium channel activity involved in cardiac muscle cell action potential(GO:0086006) |
0.3 | 1.0 | GO:0030172 | troponin C binding(GO:0030172) |
0.3 | 1.3 | GO:0070051 | fibrinogen binding(GO:0070051) |
0.3 | 1.8 | GO:0048495 | Roundabout binding(GO:0048495) |
0.3 | 1.5 | GO:0071253 | connexin binding(GO:0071253) |
0.3 | 1.8 | GO:0008517 | folic acid transporter activity(GO:0008517) |
0.3 | 1.1 | GO:0015272 | ATP-activated inward rectifier potassium channel activity(GO:0015272) |
0.3 | 1.4 | GO:0038132 | neuregulin binding(GO:0038132) |
0.3 | 3.7 | GO:0016918 | retinal binding(GO:0016918) |
0.3 | 6.7 | GO:0045499 | chemorepellent activity(GO:0045499) |
0.3 | 0.6 | GO:0031697 | beta-1 adrenergic receptor binding(GO:0031697) |
0.3 | 0.8 | GO:0004667 | prostaglandin-D synthase activity(GO:0004667) |
0.3 | 6.2 | GO:0071837 | HMG box domain binding(GO:0071837) |
0.3 | 1.9 | GO:0008046 | axon guidance receptor activity(GO:0008046) |
0.3 | 0.8 | GO:0031802 | type 5 metabotropic glutamate receptor binding(GO:0031802) |
0.3 | 0.3 | GO:0034056 | estrogen response element binding(GO:0034056) |
0.3 | 1.0 | GO:0015016 | [heparan sulfate]-glucosamine N-sulfotransferase activity(GO:0015016) |
0.3 | 1.3 | GO:0001515 | opioid peptide activity(GO:0001515) |
0.3 | 1.5 | GO:0031419 | cobalamin binding(GO:0031419) |
0.2 | 0.7 | GO:0008321 | Ral guanyl-nucleotide exchange factor activity(GO:0008321) |
0.2 | 0.7 | GO:0098821 | BMP receptor activity(GO:0098821) |
0.2 | 1.0 | GO:0004095 | carnitine O-palmitoyltransferase activity(GO:0004095) |
0.2 | 0.7 | GO:0047276 | N-acetyllactosaminide 3-alpha-galactosyltransferase activity(GO:0047276) |
0.2 | 7.0 | GO:0001540 | beta-amyloid binding(GO:0001540) |
0.2 | 1.3 | GO:0016933 | extracellular-glycine-gated ion channel activity(GO:0016933) extracellular-glycine-gated chloride channel activity(GO:0016934) |
0.2 | 0.7 | GO:0004971 | AMPA glutamate receptor activity(GO:0004971) |
0.2 | 0.2 | GO:0035175 | histone kinase activity (H3-S10 specific)(GO:0035175) |
0.2 | 0.7 | GO:0005157 | macrophage colony-stimulating factor receptor binding(GO:0005157) |
0.2 | 1.1 | GO:0003708 | retinoic acid receptor activity(GO:0003708) |
0.2 | 1.1 | GO:0003680 | AT DNA binding(GO:0003680) |
0.2 | 0.6 | GO:0031708 | endothelin B receptor binding(GO:0031708) |
0.2 | 1.5 | GO:0070181 | small ribosomal subunit rRNA binding(GO:0070181) |
0.2 | 0.4 | GO:0035727 | lysophosphatidic acid binding(GO:0035727) |
0.2 | 0.2 | GO:0015187 | glycine transmembrane transporter activity(GO:0015187) |
0.2 | 0.6 | GO:0048045 | 4-hydroxybenzoate octaprenyltransferase activity(GO:0008412) protoheme IX farnesyltransferase activity(GO:0008495) (S)-2,3-di-O-geranylgeranylglyceryl phosphate synthase activity(GO:0043888) cadaverine aminopropyltransferase activity(GO:0043918) agmatine aminopropyltransferase activity(GO:0043919) 1,4-dihydroxy-2-naphthoate octaprenyltransferase activity(GO:0046428) trans-pentaprenyltranstransferase activity(GO:0048045) ATP dimethylallyltransferase activity(GO:0052622) ADP dimethylallyltransferase activity(GO:0052623) |
0.2 | 0.6 | GO:0035939 | microsatellite binding(GO:0035939) |
0.2 | 0.8 | GO:0015038 | glutathione disulfide oxidoreductase activity(GO:0015038) |
0.2 | 0.8 | GO:0031698 | beta-2 adrenergic receptor binding(GO:0031698) |
0.2 | 0.8 | GO:0016286 | small conductance calcium-activated potassium channel activity(GO:0016286) |
0.2 | 0.6 | GO:0052650 | NADP-retinol dehydrogenase activity(GO:0052650) |
0.2 | 0.4 | GO:0015037 | peptide disulfide oxidoreductase activity(GO:0015037) |
0.2 | 0.4 | GO:0004948 | calcitonin receptor activity(GO:0004948) |
0.2 | 0.6 | GO:0030160 | GKAP/Homer scaffold activity(GO:0030160) |
0.2 | 2.3 | GO:0048407 | platelet-derived growth factor binding(GO:0048407) |
0.2 | 1.6 | GO:0004499 | N,N-dimethylaniline monooxygenase activity(GO:0004499) |
0.2 | 0.5 | GO:0015319 | sodium:inorganic phosphate symporter activity(GO:0015319) |
0.2 | 0.5 | GO:0019770 | IgG receptor activity(GO:0019770) |
0.2 | 1.6 | GO:0016857 | racemase and epimerase activity, acting on carbohydrates and derivatives(GO:0016857) |
0.2 | 0.3 | GO:0031826 | type 2A serotonin receptor binding(GO:0031826) |
0.2 | 1.7 | GO:0032036 | myosin heavy chain binding(GO:0032036) |
0.2 | 0.8 | GO:0004887 | thyroid hormone receptor activity(GO:0004887) |
0.2 | 0.5 | GO:0005005 | transmembrane-ephrin receptor activity(GO:0005005) |
0.2 | 0.5 | GO:0003872 | 6-phosphofructokinase activity(GO:0003872) |
0.2 | 0.5 | GO:0035650 | AP-1 adaptor complex binding(GO:0035650) |
0.2 | 1.3 | GO:0070097 | delta-catenin binding(GO:0070097) |
0.2 | 0.5 | GO:0097108 | hedgehog family protein binding(GO:0097108) |
0.2 | 2.9 | GO:0042813 | Wnt-activated receptor activity(GO:0042813) |
0.2 | 0.5 | GO:0004731 | purine-nucleoside phosphorylase activity(GO:0004731) |
0.2 | 1.9 | GO:0036312 | phosphatidylinositol 3-kinase regulatory subunit binding(GO:0036312) |
0.2 | 0.5 | GO:0016882 | cyclo-ligase activity(GO:0016882) |
0.2 | 0.5 | GO:0005146 | leukemia inhibitory factor receptor binding(GO:0005146) |
0.2 | 0.8 | GO:0003958 | NADPH-hemoprotein reductase activity(GO:0003958) |
0.2 | 0.2 | GO:0034617 | tetrahydrobiopterin binding(GO:0034617) |
0.2 | 2.0 | GO:0045236 | CXCR chemokine receptor binding(GO:0045236) |
0.2 | 0.5 | GO:0043120 | tumor necrosis factor binding(GO:0043120) |
0.2 | 0.5 | GO:0050692 | DBD domain binding(GO:0050692) |
0.1 | 0.6 | GO:0004126 | cytidine deaminase activity(GO:0004126) |
0.1 | 1.3 | GO:0031702 | type 1 angiotensin receptor binding(GO:0031702) |
0.1 | 2.2 | GO:0004653 | polypeptide N-acetylgalactosaminyltransferase activity(GO:0004653) |
0.1 | 2.0 | GO:1900750 | glutathione binding(GO:0043295) oligopeptide binding(GO:1900750) |
0.1 | 0.4 | GO:0004345 | glucose-6-phosphate dehydrogenase activity(GO:0004345) |
0.1 | 0.1 | GO:0005176 | ErbB-2 class receptor binding(GO:0005176) |
0.1 | 0.6 | GO:0017162 | aryl hydrocarbon receptor binding(GO:0017162) |
0.1 | 0.7 | GO:0017169 | CDP-alcohol phosphatidyltransferase activity(GO:0017169) |
0.1 | 0.4 | GO:0086056 | voltage-gated calcium channel activity involved in AV node cell action potential(GO:0086056) |
0.1 | 0.9 | GO:0001849 | complement component C1q binding(GO:0001849) |
0.1 | 1.0 | GO:0016175 | superoxide-generating NADPH oxidase activity(GO:0016175) |
0.1 | 0.3 | GO:0097493 | structural molecule activity conferring elasticity(GO:0097493) |
0.1 | 0.4 | GO:0004942 | anaphylatoxin receptor activity(GO:0004942) |
0.1 | 0.8 | GO:0032027 | myosin light chain binding(GO:0032027) |
0.1 | 0.5 | GO:0015368 | calcium:sodium antiporter activity(GO:0005432) calcium:cation antiporter activity(GO:0015368) |
0.1 | 0.8 | GO:0015288 | porin activity(GO:0015288) |
0.1 | 13.7 | GO:0001078 | transcriptional repressor activity, RNA polymerase II core promoter proximal region sequence-specific binding(GO:0001078) |
0.1 | 0.6 | GO:1990254 | keratin filament binding(GO:1990254) |
0.1 | 6.6 | GO:0000979 | RNA polymerase II core promoter sequence-specific DNA binding(GO:0000979) |
0.1 | 0.4 | GO:0008260 | 3-oxoacid CoA-transferase activity(GO:0008260) |
0.1 | 0.7 | GO:0097371 | MDM2/MDM4 family protein binding(GO:0097371) |
0.1 | 1.4 | GO:0010314 | phosphatidylinositol-5-phosphate binding(GO:0010314) |
0.1 | 0.5 | GO:0086080 | protein binding involved in heterotypic cell-cell adhesion(GO:0086080) |
0.1 | 0.5 | GO:0004558 | alpha-1,4-glucosidase activity(GO:0004558) |
0.1 | 0.2 | GO:0071532 | ankyrin repeat binding(GO:0071532) |
0.1 | 0.5 | GO:0004305 | ethanolamine kinase activity(GO:0004305) |
0.1 | 0.2 | GO:0070698 | type I activin receptor binding(GO:0070698) |
0.1 | 1.8 | GO:0016805 | dipeptidase activity(GO:0016805) |
0.1 | 1.4 | GO:0004535 | poly(A)-specific ribonuclease activity(GO:0004535) |
0.1 | 0.2 | GO:0098632 | protein binding involved in cell-cell adhesion(GO:0098632) |
0.1 | 0.2 | GO:0008073 | ornithine decarboxylase inhibitor activity(GO:0008073) |
0.1 | 1.8 | GO:0004435 | phosphatidylinositol phospholipase C activity(GO:0004435) |
0.1 | 0.5 | GO:0016670 | oxidoreductase activity, acting on a sulfur group of donors, oxygen as acceptor(GO:0016670) |
0.1 | 0.3 | GO:0031013 | troponin I binding(GO:0031013) |
0.1 | 0.3 | GO:0004995 | tachykinin receptor activity(GO:0004995) |
0.1 | 0.3 | GO:0005095 | GTPase inhibitor activity(GO:0005095) |
0.1 | 0.3 | GO:0008131 | primary amine oxidase activity(GO:0008131) |
0.1 | 1.6 | GO:0031402 | sodium ion binding(GO:0031402) |
0.1 | 0.9 | GO:0031545 | peptidyl-proline 4-dioxygenase activity(GO:0031545) |
0.1 | 1.5 | GO:0050811 | GABA receptor binding(GO:0050811) |
0.1 | 0.1 | GO:0005001 | transmembrane receptor protein tyrosine phosphatase activity(GO:0005001) |
0.1 | 1.0 | GO:0003796 | lysozyme activity(GO:0003796) |
0.1 | 0.2 | GO:0043546 | molybdopterin cofactor binding(GO:0043546) |
0.1 | 0.3 | GO:0004949 | cannabinoid receptor activity(GO:0004949) |
0.1 | 0.2 | GO:0016909 | JUN kinase activity(GO:0004705) SAP kinase activity(GO:0016909) |
0.1 | 0.3 | GO:0051373 | FATZ binding(GO:0051373) |
0.1 | 0.4 | GO:0017176 | phosphatidylinositol N-acetylglucosaminyltransferase activity(GO:0017176) |
0.1 | 0.3 | GO:0015186 | L-asparagine transmembrane transporter activity(GO:0015182) L-glutamine transmembrane transporter activity(GO:0015186) |
0.1 | 0.4 | GO:0046870 | cadmium ion binding(GO:0046870) |
0.1 | 0.1 | GO:0070644 | vitamin D response element binding(GO:0070644) |
0.1 | 1.2 | GO:0042056 | chemoattractant activity(GO:0042056) |
0.1 | 1.6 | GO:0005112 | Notch binding(GO:0005112) |
0.1 | 0.3 | GO:0004471 | malic enzyme activity(GO:0004470) malate dehydrogenase (decarboxylating) (NAD+) activity(GO:0004471) |
0.1 | 7.1 | GO:0005089 | Rho guanyl-nucleotide exchange factor activity(GO:0005089) |
0.1 | 0.3 | GO:1990829 | C-rich single-stranded DNA binding(GO:1990829) |
0.1 | 0.4 | GO:0030572 | cardiolipin synthase activity(GO:0008808) phosphatidyltransferase activity(GO:0030572) |
0.1 | 0.3 | GO:0050816 | phosphothreonine binding(GO:0050816) |
0.1 | 0.5 | GO:0004957 | prostaglandin E receptor activity(GO:0004957) |
0.1 | 0.5 | GO:0000268 | peroxisome targeting sequence binding(GO:0000268) |
0.1 | 1.2 | GO:0044548 | S100 protein binding(GO:0044548) |
0.1 | 0.2 | GO:0080084 | RNA polymerase III type 1 promoter DNA binding(GO:0001030) RNA polymerase III type 2 promoter DNA binding(GO:0001031) RNA polymerase III type 3 promoter DNA binding(GO:0001032) 5S rDNA binding(GO:0080084) |
0.1 | 1.7 | GO:0003756 | protein disulfide isomerase activity(GO:0003756) intramolecular oxidoreductase activity, transposing S-S bonds(GO:0016864) |
0.1 | 0.6 | GO:0030368 | interleukin-17 receptor activity(GO:0030368) |
0.1 | 0.3 | GO:0004515 | nicotinamide-nucleotide adenylyltransferase activity(GO:0000309) nicotinate-nucleotide adenylyltransferase activity(GO:0004515) |
0.1 | 0.4 | GO:0031750 | D3 dopamine receptor binding(GO:0031750) |
0.1 | 0.6 | GO:0045545 | syndecan binding(GO:0045545) |
0.1 | 0.1 | GO:0061629 | RNA polymerase II sequence-specific DNA binding transcription factor binding(GO:0061629) |
0.1 | 0.5 | GO:0033265 | choline binding(GO:0033265) |
0.1 | 0.3 | GO:0004359 | glutaminase activity(GO:0004359) |
0.1 | 0.3 | GO:0047045 | testosterone 17-beta-dehydrogenase (NADP+) activity(GO:0047045) |
0.1 | 0.4 | GO:0048403 | brain-derived neurotrophic factor binding(GO:0048403) |
0.1 | 0.3 | GO:0030158 | protein xylosyltransferase activity(GO:0030158) |
0.1 | 0.5 | GO:0004994 | somatostatin receptor activity(GO:0004994) |
0.1 | 0.7 | GO:0070411 | I-SMAD binding(GO:0070411) |
0.1 | 0.1 | GO:0019788 | NEDD8 transferase activity(GO:0019788) |
0.1 | 0.2 | GO:0004616 | phosphogluconate dehydrogenase (decarboxylating) activity(GO:0004616) |
0.1 | 0.4 | GO:0046923 | ER retention sequence binding(GO:0046923) |
0.1 | 0.7 | GO:0031995 | insulin-like growth factor II binding(GO:0031995) |
0.1 | 0.3 | GO:0018600 | mono-butyltin dioxygenase activity(GO:0018586) tri-n-butyltin dioxygenase activity(GO:0018588) di-n-butyltin dioxygenase activity(GO:0018589) methylsilanetriol hydroxylase activity(GO:0018590) methyl tertiary butyl ether 3-monooxygenase activity(GO:0018591) 4-nitrocatechol 4-monooxygenase activity(GO:0018592) 4-chlorophenoxyacetate monooxygenase activity(GO:0018593) tert-butanol 2-monooxygenase activity(GO:0018594) alpha-pinene monooxygenase activity(GO:0018595) dimethylsilanediol hydroxylase activity(GO:0018596) ammonia monooxygenase activity(GO:0018597) hydroxymethylsilanetriol oxidase activity(GO:0018598) 2-hydroxyisobutyrate 3-monooxygenase activity(GO:0018599) alpha-pinene dehydrogenase activity(GO:0018600) bisphenol A hydroxylase B activity(GO:0034559) 2,2-bis(4-hydroxyphenyl)-1-propanol hydroxylase activity(GO:0034562) 9-fluorenone-3,4-dioxygenase activity(GO:0034786) anthracene 9,10-dioxygenase activity(GO:0034816) 2-(methylthio)benzothiazole monooxygenase activity(GO:0034857) 2-hydroxybenzothiazole monooxygenase activity(GO:0034858) benzothiazole monooxygenase activity(GO:0034859) 2,6-dihydroxybenzothiazole monooxygenase activity(GO:0034862) pinacolone 5-monooxygenase activity(GO:0034870) thioacetamide S-oxygenase activity(GO:0034873) thioacetamide S-oxide S-oxygenase activity(GO:0034874) endosulfan monooxygenase I activity(GO:0034888) N-nitrodimethylamine hydroxylase activity(GO:0034893) 4-(1-ethyl-1,4-dimethyl-pentyl)phenol monoxygenase activity(GO:0034897) endosulfan ether monooxygenase activity(GO:0034903) pyrene 4,5-monooxygenase activity(GO:0034925) pyrene 1,2-monooxygenase activity(GO:0034927) 1-hydroxypyrene 6,7-monooxygenase activity(GO:0034928) 1-hydroxypyrene 7,8-monooxygenase activity(GO:0034929) phenylboronic acid monooxygenase activity(GO:0034950) spheroidene monooxygenase activity(GO:0043823) |
0.1 | 1.0 | GO:0017166 | vinculin binding(GO:0017166) |
0.1 | 1.0 | GO:0031005 | filamin binding(GO:0031005) |
0.1 | 0.4 | GO:0031957 | very long-chain fatty acid-CoA ligase activity(GO:0031957) |
0.1 | 2.9 | GO:0005201 | extracellular matrix structural constituent(GO:0005201) |
0.1 | 0.7 | GO:0008889 | glycerophosphodiester phosphodiesterase activity(GO:0008889) |
0.1 | 0.3 | GO:0016743 | carboxyl- or carbamoyltransferase activity(GO:0016743) |
0.1 | 0.5 | GO:0032454 | histone demethylase activity (H3-K9 specific)(GO:0032454) |
0.1 | 3.4 | GO:0005044 | scavenger receptor activity(GO:0005044) |
0.1 | 0.3 | GO:0015220 | choline transmembrane transporter activity(GO:0015220) |
0.1 | 0.5 | GO:0051371 | muscle alpha-actinin binding(GO:0051371) |
0.1 | 2.6 | GO:0051879 | Hsp90 protein binding(GO:0051879) |
0.1 | 0.3 | GO:0051864 | histone demethylase activity (H3-K36 specific)(GO:0051864) |
0.1 | 0.9 | GO:0030898 | actin-dependent ATPase activity(GO:0030898) |
0.1 | 0.2 | GO:0005094 | Rho GDP-dissociation inhibitor activity(GO:0005094) |
0.1 | 2.0 | GO:0001205 | transcriptional activator activity, RNA polymerase II distal enhancer sequence-specific binding(GO:0001205) |
0.1 | 0.6 | GO:0003884 | D-amino-acid oxidase activity(GO:0003884) |
0.1 | 0.2 | GO:0035514 | DNA demethylase activity(GO:0035514) |
0.1 | 0.5 | GO:0005384 | manganese ion transmembrane transporter activity(GO:0005384) |
0.1 | 0.2 | GO:0046935 | 1-phosphatidylinositol-3-kinase regulator activity(GO:0046935) |
0.1 | 0.4 | GO:0005007 | fibroblast growth factor-activated receptor activity(GO:0005007) |
0.1 | 0.5 | GO:0047555 | 3',5'-cyclic-GMP phosphodiesterase activity(GO:0047555) |
0.1 | 1.3 | GO:0030553 | cGMP binding(GO:0030553) |
0.1 | 0.3 | GO:0016833 | oxo-acid-lyase activity(GO:0016833) |
0.1 | 0.2 | GO:0004300 | enoyl-CoA hydratase activity(GO:0004300) |
0.1 | 0.4 | GO:0000774 | adenyl-nucleotide exchange factor activity(GO:0000774) |
0.1 | 0.2 | GO:0050656 | 3'-phosphoadenosine 5'-phosphosulfate binding(GO:0050656) |
0.1 | 0.2 | GO:0015111 | iodide transmembrane transporter activity(GO:0015111) |
0.1 | 0.5 | GO:0050291 | sphingosine N-acyltransferase activity(GO:0050291) |
0.1 | 0.2 | GO:0030274 | LIM domain binding(GO:0030274) |
0.1 | 2.2 | GO:0043914 | NADPH:sulfur oxidoreductase activity(GO:0043914) |
0.1 | 0.3 | GO:0070579 | methylcytosine dioxygenase activity(GO:0070579) |
0.1 | 0.2 | GO:0070137 | ubiquitin-like protein-specific endopeptidase activity(GO:0070137) SUMO-specific endopeptidase activity(GO:0070139) |
0.1 | 0.2 | GO:1990715 | mRNA CDS binding(GO:1990715) |
0.1 | 1.8 | GO:0005246 | calcium channel regulator activity(GO:0005246) |
0.1 | 2.3 | GO:0005132 | type I interferon receptor binding(GO:0005132) |
0.1 | 0.4 | GO:0005166 | neurotrophin p75 receptor binding(GO:0005166) |
0.1 | 54.4 | GO:0043565 | sequence-specific DNA binding(GO:0043565) |
0.1 | 0.3 | GO:0004459 | L-lactate dehydrogenase activity(GO:0004459) |
0.1 | 0.3 | GO:0004128 | cytochrome-b5 reductase activity, acting on NAD(P)H(GO:0004128) |
0.1 | 0.5 | GO:0103116 | alpha-D-galactofuranose transporter activity(GO:0103116) |
0.1 | 0.2 | GO:0004771 | sterol esterase activity(GO:0004771) |
0.1 | 0.2 | GO:0071209 | U7 snRNA binding(GO:0071209) |
0.1 | 0.2 | GO:0005219 | ryanodine-sensitive calcium-release channel activity(GO:0005219) |
0.1 | 0.4 | GO:0008179 | adenylate cyclase binding(GO:0008179) |
0.1 | 0.1 | GO:1990239 | steroid hormone binding(GO:1990239) |
0.1 | 0.4 | GO:0003828 | alpha-N-acetylneuraminate alpha-2,8-sialyltransferase activity(GO:0003828) |
0.1 | 0.2 | GO:0003976 | UDP-N-acetylglucosamine-lysosomal-enzyme N-acetylglucosaminephosphotransferase activity(GO:0003976) |
0.1 | 0.1 | GO:0004022 | alcohol dehydrogenase (NAD) activity(GO:0004022) |
0.1 | 0.3 | GO:0045294 | alpha-catenin binding(GO:0045294) |
0.1 | 0.3 | GO:0034549 | N-cyclopropylmelamine deaminase activity(GO:0034547) N-cyclopropylammeline deaminase activity(GO:0034548) N-cyclopropylammelide alkylamino hydrolase activity(GO:0034549) 2,5-diamino-6-ribitylamino-4(3H)-pyrimidinone 5'-phosphate deaminase activity(GO:0043723) tRNA-specific adenosine-37 deaminase activity(GO:0043829) archaeal-specific GTP cyclohydrolase activity(GO:0044682) tRNA-specific adenosine-34 deaminase activity(GO:0052717) |
0.1 | 0.2 | GO:0019166 | trans-2-enoyl-CoA reductase (NADPH) activity(GO:0019166) |
0.1 | 0.3 | GO:0070191 | methionine-R-sulfoxide reductase activity(GO:0070191) |
0.1 | 0.2 | GO:0097016 | L27 domain binding(GO:0097016) |
0.1 | 0.3 | GO:0004969 | histamine receptor activity(GO:0004969) |
0.1 | 0.2 | GO:0019776 | Atg8 ligase activity(GO:0019776) |
0.1 | 0.6 | GO:0042043 | neurexin family protein binding(GO:0042043) |
0.1 | 0.1 | GO:0046976 | histone methyltransferase activity (H3-K27 specific)(GO:0046976) |
0.1 | 0.3 | GO:0031694 | alpha-2A adrenergic receptor binding(GO:0031694) |
0.1 | 0.2 | GO:0004980 | melanocyte-stimulating hormone receptor activity(GO:0004980) |
0.1 | 0.6 | GO:0017147 | Wnt-protein binding(GO:0017147) |
0.1 | 0.2 | GO:0004793 | threonine aldolase activity(GO:0004793) L-allo-threonine aldolase activity(GO:0008732) |
0.1 | 0.4 | GO:0048185 | activin binding(GO:0048185) |
0.1 | 0.2 | GO:0050145 | nucleoside phosphate kinase activity(GO:0050145) |
0.1 | 0.3 | GO:0004758 | serine C-palmitoyltransferase activity(GO:0004758) |
0.1 | 0.9 | GO:0070008 | serine-type exopeptidase activity(GO:0070008) |
0.1 | 0.1 | GO:0005072 | transforming growth factor beta receptor, cytoplasmic mediator activity(GO:0005072) |
0.1 | 0.3 | GO:0042015 | interleukin-20 binding(GO:0042015) |
0.1 | 0.3 | GO:0036122 | BMP binding(GO:0036122) |
0.1 | 0.2 | GO:0015018 | galactosylgalactosylxylosylprotein 3-beta-glucuronosyltransferase activity(GO:0015018) |
0.1 | 1.5 | GO:0008009 | chemokine activity(GO:0008009) |
0.1 | 0.2 | GO:0008515 | sucrose:proton symporter activity(GO:0008506) sucrose transmembrane transporter activity(GO:0008515) disaccharide transmembrane transporter activity(GO:0015154) oligosaccharide transmembrane transporter activity(GO:0015157) |
0.1 | 0.2 | GO:0047631 | ADP-ribose diphosphatase activity(GO:0047631) |
0.1 | 0.8 | GO:0046703 | natural killer cell lectin-like receptor binding(GO:0046703) |
0.1 | 0.2 | GO:0001846 | opsonin binding(GO:0001846) |
0.1 | 1.0 | GO:0030332 | cyclin binding(GO:0030332) |
0.1 | 0.2 | GO:0001227 | transcriptional repressor activity, RNA polymerase II transcription regulatory region sequence-specific binding(GO:0001227) |
0.1 | 0.2 | GO:0004814 | arginine-tRNA ligase activity(GO:0004814) |
0.1 | 0.2 | GO:0019002 | GMP binding(GO:0019002) |
0.1 | 1.3 | GO:0052831 | phosphohistidine phosphatase activity(GO:0008969) inositol-1,3,4-trisphosphate 4-phosphatase activity(GO:0017161) NADP phosphatase activity(GO:0019178) 5-amino-6-(5-phosphoribitylamino)uracil phosphatase activity(GO:0043726) phosphatidylinositol-3,5-bisphosphate 5-phosphatase activity(GO:0043813) inositol-1,3,4,5,6-pentakisphosphate 1-phosphatase activity(GO:0052825) inositol-3,4-bisphosphate 4-phosphatase activity(GO:0052828) inositol-1,3,4-trisphosphate 1-phosphatase activity(GO:0052829) inositol-1,3,4,6-tetrakisphosphate 6-phosphatase activity(GO:0052830) inositol-1,3,4,6-tetrakisphosphate 1-phosphatase activity(GO:0052831) phosphatidylinositol-1,4,5-trisphosphate 5-phosphatase activity(GO:0052867) IDP phosphatase activity(GO:1990003) |
0.1 | 0.2 | GO:0031432 | titin binding(GO:0031432) |
0.1 | 0.5 | GO:0016004 | phospholipase activator activity(GO:0016004) |
0.1 | 0.2 | GO:0050510 | N-acetylgalactosaminyl-proteoglycan 3-beta-glucuronosyltransferase activity(GO:0050510) |
0.1 | 1.2 | GO:0017080 | sodium channel regulator activity(GO:0017080) |
0.1 | 0.2 | GO:0004367 | glycerol-3-phosphate dehydrogenase [NAD+] activity(GO:0004367) |
0.1 | 1.5 | GO:0042169 | SH2 domain binding(GO:0042169) |
0.1 | 0.3 | GO:0019966 | interleukin-1 binding(GO:0019966) |
0.1 | 0.5 | GO:0005520 | insulin-like growth factor binding(GO:0005520) |
0.1 | 0.4 | GO:0043023 | ribosomal large subunit binding(GO:0043023) |
0.1 | 0.1 | GO:0004772 | sterol O-acyltransferase activity(GO:0004772) |
0.1 | 0.1 | GO:0070840 | dynein complex binding(GO:0070840) |
0.1 | 0.1 | GO:0001134 | transcription factor activity, transcription factor recruiting(GO:0001134) |
0.1 | 0.1 | GO:0004457 | lactate dehydrogenase activity(GO:0004457) |
0.1 | 0.3 | GO:0015269 | calcium-activated potassium channel activity(GO:0015269) |
0.1 | 1.1 | GO:0001786 | phosphatidylserine binding(GO:0001786) |
0.1 | 0.1 | GO:0032137 | guanine/thymine mispair binding(GO:0032137) |
0.1 | 0.3 | GO:0003847 | 1-alkyl-2-acetylglycerophosphocholine esterase activity(GO:0003847) |
0.1 | 0.3 | GO:0030250 | cyclase activator activity(GO:0010853) guanylate cyclase activator activity(GO:0030250) |
0.1 | 0.3 | GO:0004630 | phospholipase D activity(GO:0004630) |
0.1 | 0.6 | GO:0034237 | protein kinase A regulatory subunit binding(GO:0034237) |
0.1 | 0.8 | GO:0017128 | phospholipid scramblase activity(GO:0017128) |
0.1 | 0.7 | GO:0005234 | extracellular-glutamate-gated ion channel activity(GO:0005234) |
0.1 | 0.4 | GO:0015280 | ligand-gated sodium channel activity(GO:0015280) |
0.1 | 0.2 | GO:0004741 | [pyruvate dehydrogenase (lipoamide)] phosphatase activity(GO:0004741) |
0.1 | 0.1 | GO:0035033 | histone deacetylase regulator activity(GO:0035033) |
0.1 | 0.3 | GO:0016780 | phosphotransferase activity, for other substituted phosphate groups(GO:0016780) |
0.0 | 0.2 | GO:0000213 | tRNA-intron endonuclease activity(GO:0000213) |
0.0 | 0.1 | GO:0005483 | soluble NSF attachment protein activity(GO:0005483) |
0.0 | 0.2 | GO:0036374 | gamma-glutamyltransferase activity(GO:0003840) glutathione hydrolase activity(GO:0036374) |
0.0 | 0.0 | GO:0004859 | phospholipase inhibitor activity(GO:0004859) |
0.0 | 0.4 | GO:0042577 | lipid phosphatase activity(GO:0042577) |
0.0 | 0.1 | GO:0004385 | guanylate kinase activity(GO:0004385) |
0.0 | 0.3 | GO:0070182 | DNA polymerase binding(GO:0070182) |
0.0 | 0.4 | GO:0034783 | 3-oxo-2-(2'-pentenyl)cyclopentane-1-octanoic acid CoA ligase activity(GO:0010435) 3-isopropenyl-6-oxoheptanoyl-CoA synthetase activity(GO:0018854) 2-oxo-delta3-4,5,5-trimethylcyclopentenylacetyl-CoA synthetase activity(GO:0018855) benzoyl acetate-CoA ligase activity(GO:0018856) 2,4-dichlorobenzoate-CoA ligase activity(GO:0018857) pivalate-CoA ligase activity(GO:0034783) cyclopropanecarboxylate-CoA ligase activity(GO:0034793) adipate-CoA ligase activity(GO:0034796) citronellyl-CoA ligase activity(GO:0034823) mentha-1,3-dione-CoA ligase activity(GO:0034841) thiophene-2-carboxylate-CoA ligase activity(GO:0034842) 2,4,4-trimethylpentanoate-CoA ligase activity(GO:0034865) cis-2-methyl-5-isopropylhexa-2,5-dienoate-CoA ligase activity(GO:0034942) trans-2-methyl-5-isopropylhexa-2,5-dienoate-CoA ligase activity(GO:0034943) branched-chain acyl-CoA synthetase (ADP-forming) activity(GO:0043759) aryl-CoA synthetase (ADP-forming) activity(GO:0043762) 3-hydroxypropionyl-CoA synthetase activity(GO:0043955) perillic acid:CoA ligase (ADP-forming) activity(GO:0052685) perillic acid:CoA ligase (AMP-forming) activity(GO:0052686) (3R)-3-isopropenyl-6-oxoheptanoate:CoA ligase (ADP-forming) activity(GO:0052687) (3R)-3-isopropenyl-6-oxoheptanoate:CoA ligase (AMP-forming) activity(GO:0052688) pristanate-CoA ligase activity(GO:0070251) malonyl-CoA synthetase activity(GO:0090409) |
0.0 | 0.1 | GO:0031800 | type 3 metabotropic glutamate receptor binding(GO:0031800) |
0.0 | 0.1 | GO:0019862 | IgA binding(GO:0019862) |
0.0 | 0.7 | GO:0005109 | frizzled binding(GO:0005109) |
0.0 | 0.1 | GO:0051380 | norepinephrine binding(GO:0051380) |
0.0 | 0.2 | GO:0005161 | platelet-derived growth factor receptor binding(GO:0005161) |
0.0 | 0.1 | GO:0070548 | L-glutamine aminotransferase activity(GO:0070548) |
0.0 | 0.2 | GO:0043522 | leucine zipper domain binding(GO:0043522) |
0.0 | 1.3 | GO:0015459 | potassium channel regulator activity(GO:0015459) |
0.0 | 0.2 | GO:0032052 | bile acid binding(GO:0032052) |
0.0 | 0.1 | GO:0004862 | cAMP-dependent protein kinase inhibitor activity(GO:0004862) |
0.0 | 0.2 | GO:0030229 | very-low-density lipoprotein particle receptor activity(GO:0030229) |
0.0 | 0.5 | GO:0015643 | toxic substance binding(GO:0015643) |
0.0 | 0.2 | GO:0061133 | endopeptidase activator activity(GO:0061133) |
0.0 | 0.0 | GO:0031752 | D5 dopamine receptor binding(GO:0031752) |
0.0 | 0.9 | GO:0051990 | (R)-2-hydroxyglutarate dehydrogenase activity(GO:0051990) |
0.0 | 1.6 | GO:0050840 | extracellular matrix binding(GO:0050840) |
0.0 | 0.2 | GO:0004176 | ATP-dependent peptidase activity(GO:0004176) |
0.0 | 0.4 | GO:0008568 | microtubule-severing ATPase activity(GO:0008568) |
0.0 | 0.7 | GO:0004889 | acetylcholine-activated cation-selective channel activity(GO:0004889) |
0.0 | 0.3 | GO:0005227 | calcium activated cation channel activity(GO:0005227) |
0.0 | 0.4 | GO:0004143 | diacylglycerol kinase activity(GO:0004143) |
0.0 | 0.1 | GO:0016018 | cyclosporin A binding(GO:0016018) |
0.0 | 0.7 | GO:0004012 | phospholipid-translocating ATPase activity(GO:0004012) |
0.0 | 0.2 | GO:0016671 | oxidoreductase activity, acting on a sulfur group of donors, disulfide as acceptor(GO:0016671) |
0.0 | 0.1 | GO:0030144 | alpha-1,6-mannosylglycoprotein 6-beta-N-acetylglucosaminyltransferase activity(GO:0030144) |
0.0 | 0.3 | GO:0001618 | virus receptor activity(GO:0001618) |
0.0 | 0.6 | GO:0051019 | mitogen-activated protein kinase binding(GO:0051019) |
0.0 | 0.0 | GO:0004720 | protein-lysine 6-oxidase activity(GO:0004720) |
0.0 | 0.0 | GO:0034191 | apolipoprotein A-I receptor binding(GO:0034191) |
0.0 | 0.3 | GO:0070700 | BMP receptor binding(GO:0070700) |
0.0 | 0.3 | GO:0008432 | JUN kinase binding(GO:0008432) |
0.0 | 1.4 | GO:0017022 | myosin binding(GO:0017022) |
0.0 | 0.2 | GO:0004565 | beta-galactosidase activity(GO:0004565) |
0.0 | 0.1 | GO:0005329 | dopamine transmembrane transporter activity(GO:0005329) |
0.0 | 0.3 | GO:0070990 | snRNP binding(GO:0070990) |
0.0 | 0.2 | GO:0017040 | ceramidase activity(GO:0017040) |
0.0 | 0.2 | GO:0036402 | proteasome-activating ATPase activity(GO:0036402) |
0.0 | 0.6 | GO:0004180 | carboxypeptidase activity(GO:0004180) |
0.0 | 0.1 | GO:0005220 | inositol 1,4,5-trisphosphate-sensitive calcium-release channel activity(GO:0005220) |
0.0 | 1.3 | GO:0004715 | non-membrane spanning protein tyrosine kinase activity(GO:0004715) |
0.0 | 0.1 | GO:0003953 | NAD+ nucleosidase activity(GO:0003953) |
0.0 | 0.5 | GO:0051428 | peptide hormone receptor binding(GO:0051428) |
0.0 | 0.1 | GO:0047961 | glycine N-acyltransferase activity(GO:0047961) |
0.0 | 0.1 | GO:0016262 | protein N-acetylglucosaminyltransferase activity(GO:0016262) |
0.0 | 0.1 | GO:0045504 | dynein heavy chain binding(GO:0045504) |
0.0 | 0.1 | GO:0015252 | hydrogen ion channel activity(GO:0015252) |
0.0 | 0.4 | GO:0043771 | cobinamide kinase activity(GO:0008819) phytol kinase activity(GO:0010276) phenol kinase activity(GO:0018720) cyclin-dependent protein kinase activating kinase regulator activity(GO:0019914) inositol tetrakisphosphate 2-kinase activity(GO:0032942) heptose 7-phosphate kinase activity(GO:0033785) aminoglycoside phosphotransferase activity(GO:0034071) eukaryotic elongation factor-2 kinase regulator activity(GO:0042556) eukaryotic elongation factor-2 kinase activator activity(GO:0042557) LPPG:FO 2-phospho-L-lactate transferase activity(GO:0043743) cytidine kinase activity(GO:0043771) glycerate 2-kinase activity(GO:0043798) (S)-lactate 2-kinase activity(GO:0043841) phosphoserine:homoserine phosphotransferase activity(GO:0043899) L-seryl-tRNA(Sec) kinase activity(GO:0043915) phosphocholine transferase activity(GO:0044605) GTP-dependent polynucleotide kinase activity(GO:0051735) farnesol kinase activity(GO:0052668) CTP:2-trans,-6-trans-farnesol kinase activity(GO:0052669) geraniol kinase activity(GO:0052670) geranylgeraniol kinase activity(GO:0052671) CTP:geranylgeraniol kinase activity(GO:0052672) prenol kinase activity(GO:0052673) 1-phosphatidylinositol-5-kinase activity(GO:0052810) 1-phosphatidylinositol-3-phosphate 4-kinase activity(GO:0052811) phosphatidylinositol-3,4-bisphosphate 5-kinase activity(GO:0052812) inositol-3,4,6-trisphosphate 1-kinase activity(GO:0052835) inositol 5-diphosphate pentakisphosphate 5-kinase activity(GO:0052836) inositol diphosphate tetrakisphosphate kinase activity(GO:0052839) |
0.0 | 0.1 | GO:0034739 | histone deacetylase activity (H4-K16 specific)(GO:0034739) |
0.0 | 0.2 | GO:0050051 | leukotriene-B4 20-monooxygenase activity(GO:0050051) |
0.0 | 0.1 | GO:0004614 | phosphoglucomutase activity(GO:0004614) |
0.0 | 0.0 | GO:0004337 | geranyltranstransferase activity(GO:0004337) |
0.0 | 0.2 | GO:0050750 | low-density lipoprotein particle receptor binding(GO:0050750) |
0.0 | 0.0 | GO:0070878 | primary miRNA binding(GO:0070878) |
0.0 | 0.1 | GO:0019834 | phospholipase A2 inhibitor activity(GO:0019834) |
0.0 | 0.1 | GO:0042285 | UDP-xylosyltransferase activity(GO:0035252) xylosyltransferase activity(GO:0042285) |
0.0 | 0.1 | GO:0050998 | nitric-oxide synthase binding(GO:0050998) |
0.0 | 0.1 | GO:0018479 | benzaldehyde dehydrogenase (NAD+) activity(GO:0018479) |
0.0 | 0.2 | GO:0048018 | receptor agonist activity(GO:0048018) |
0.0 | 0.1 | GO:0005006 | epidermal growth factor-activated receptor activity(GO:0005006) |
0.0 | 0.5 | GO:0051018 | protein kinase A binding(GO:0051018) |
0.0 | 0.1 | GO:1990932 | 5.8S rRNA binding(GO:1990932) |
0.0 | 0.1 | GO:0005280 | hydrogen:amino acid symporter activity(GO:0005280) |
0.0 | 0.2 | GO:0004415 | hyalurononglucosaminidase activity(GO:0004415) |
0.0 | 2.9 | GO:0004222 | metalloendopeptidase activity(GO:0004222) |
0.0 | 0.1 | GO:0061513 | hexose phosphate transmembrane transporter activity(GO:0015119) organophosphate:inorganic phosphate antiporter activity(GO:0015315) hexose-phosphate:inorganic phosphate antiporter activity(GO:0015526) glucose 6-phosphate:inorganic phosphate antiporter activity(GO:0061513) |
0.0 | 0.9 | GO:0005164 | tumor necrosis factor receptor binding(GO:0005164) |
0.0 | 0.1 | GO:0033691 | sialic acid binding(GO:0033691) |
0.0 | 0.1 | GO:0047751 | 3-oxo-5-alpha-steroid 4-dehydrogenase activity(GO:0003865) cholestenone 5-alpha-reductase activity(GO:0047751) |
0.0 | 0.1 | GO:0030297 | transmembrane receptor protein tyrosine kinase activator activity(GO:0030297) |
0.0 | 0.1 | GO:0097603 | temperature-gated ion channel activity(GO:0097603) |
0.0 | 0.1 | GO:0043495 | protein anchor(GO:0043495) |
0.0 | 0.1 | GO:0004908 | interleukin-1 receptor activity(GO:0004908) |
0.0 | 0.0 | GO:0016653 | oxidoreductase activity, acting on NAD(P)H, heme protein as acceptor(GO:0016653) |
0.0 | 0.1 | GO:0031492 | nucleosomal DNA binding(GO:0031492) |
0.0 | 0.3 | GO:0022840 | leak channel activity(GO:0022840) narrow pore channel activity(GO:0022842) |
0.0 | 0.0 | GO:0003933 | GTP cyclohydrolase activity(GO:0003933) |
0.0 | 0.1 | GO:0030346 | protein phosphatase 2B binding(GO:0030346) |
0.0 | 0.1 | GO:0003857 | 3-hydroxyacyl-CoA dehydrogenase activity(GO:0003857) |
0.0 | 0.2 | GO:1904264 | ubiquitin protein ligase activity involved in ERAD pathway(GO:1904264) |
0.0 | 0.3 | GO:0015125 | bile acid transmembrane transporter activity(GO:0015125) |
0.0 | 0.2 | GO:0050431 | transforming growth factor beta binding(GO:0050431) |
0.0 | 0.1 | GO:0046974 | histone methyltransferase activity (H3-K9 specific)(GO:0046974) |
0.0 | 0.1 | GO:0032190 | acrosin binding(GO:0032190) |
0.0 | 0.1 | GO:0016941 | natriuretic peptide receptor activity(GO:0016941) |
0.0 | 0.1 | GO:0016615 | malate dehydrogenase activity(GO:0016615) |
0.0 | 0.2 | GO:0001609 | G-protein coupled adenosine receptor activity(GO:0001609) |
0.0 | 0.1 | GO:0030955 | potassium ion binding(GO:0030955) |
0.0 | 0.1 | GO:0001221 | transcription cofactor binding(GO:0001221) |
0.0 | 0.1 | GO:0005148 | prolactin receptor binding(GO:0005148) |
0.0 | 0.1 | GO:0035254 | glutamate receptor binding(GO:0035254) |
0.0 | 0.1 | GO:0004111 | creatine kinase activity(GO:0004111) |
0.0 | 0.0 | GO:0004967 | glucagon receptor activity(GO:0004967) |
0.0 | 0.1 | GO:0003705 | transcription factor activity, RNA polymerase II distal enhancer sequence-specific binding(GO:0003705) |
0.0 | 0.0 | GO:0004966 | galanin receptor activity(GO:0004966) |
0.0 | 0.1 | GO:0016802 | adenosylhomocysteinase activity(GO:0004013) trialkylsulfonium hydrolase activity(GO:0016802) |
0.0 | 0.1 | GO:0016892 | endoribonuclease activity, producing 3'-phosphomonoesters(GO:0016892) |
0.0 | 0.1 | GO:0046975 | histone methyltransferase activity (H3-K36 specific)(GO:0046975) |
0.0 | 0.1 | GO:0033592 | RNA strand annealing activity(GO:0033592) |
0.0 | 0.6 | GO:0032947 | protein complex scaffold(GO:0032947) |
0.0 | 0.1 | GO:1990226 | histone methyltransferase binding(GO:1990226) |
0.0 | 0.0 | GO:0008970 | phosphatidylcholine 1-acylhydrolase activity(GO:0008970) |
0.0 | 0.0 | GO:0031014 | troponin T binding(GO:0031014) |
0.0 | 0.2 | GO:0070016 | armadillo repeat domain binding(GO:0070016) |
0.0 | 0.1 | GO:0016309 | 1-phosphatidylinositol-5-phosphate 4-kinase activity(GO:0016309) |
0.0 | 0.1 | GO:0016508 | long-chain-enoyl-CoA hydratase activity(GO:0016508) |
0.0 | 0.0 | GO:0034483 | heparan sulfate sulfotransferase activity(GO:0034483) |
0.0 | 0.1 | GO:0030306 | ADP-ribosylation factor binding(GO:0030306) |
0.0 | 0.1 | GO:0030280 | structural constituent of epidermis(GO:0030280) |
0.0 | 0.2 | GO:0004312 | fatty acid synthase activity(GO:0004312) |
0.0 | 0.1 | GO:0008430 | selenium binding(GO:0008430) |
0.0 | 0.1 | GO:0031821 | G-protein coupled serotonin receptor binding(GO:0031821) |
0.0 | 0.7 | GO:0015296 | anion:cation symporter activity(GO:0015296) |
0.0 | 0.1 | GO:0016716 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, another compound as one donor, and incorporation of one atom of oxygen(GO:0016716) |
0.0 | 0.2 | GO:0005092 | GDP-dissociation inhibitor activity(GO:0005092) |
0.0 | 0.1 | GO:0034235 | GPI anchor binding(GO:0034235) |
0.0 | 0.0 | GO:0004528 | phosphodiesterase I activity(GO:0004528) |
0.0 | 0.1 | GO:0004661 | protein geranylgeranyltransferase activity(GO:0004661) |
0.0 | 0.1 | GO:0034513 | box H/ACA snoRNA binding(GO:0034513) |
0.0 | 0.1 | GO:0016838 | carbon-oxygen lyase activity, acting on phosphates(GO:0016838) |
0.0 | 0.3 | GO:0031491 | nucleosome binding(GO:0031491) |
0.0 | 0.8 | GO:0008013 | beta-catenin binding(GO:0008013) |
0.0 | 0.0 | GO:0050693 | LBD domain binding(GO:0050693) |
0.0 | 0.0 | GO:0019959 | interleukin-8 binding(GO:0019959) |
0.0 | 0.1 | GO:0070815 | peptidyl-lysine 5-dioxygenase activity(GO:0070815) |
0.0 | 0.1 | GO:0000155 | phosphorelay sensor kinase activity(GO:0000155) |
0.0 | 0.0 | GO:0016901 | oxidoreductase activity, acting on the CH-OH group of donors, quinone or similar compound as acceptor(GO:0016901) |
0.0 | 0.0 | GO:0004687 | myosin light chain kinase activity(GO:0004687) |
0.0 | 0.1 | GO:0000171 | ribonuclease MRP activity(GO:0000171) |
0.0 | 0.1 | GO:0032407 | MutSalpha complex binding(GO:0032407) |
0.0 | 0.1 | GO:0004634 | phosphopyruvate hydratase activity(GO:0004634) |
0.0 | 0.1 | GO:0008140 | cAMP response element binding protein binding(GO:0008140) |
0.0 | 0.9 | GO:0005200 | structural constituent of cytoskeleton(GO:0005200) |
0.0 | 0.1 | GO:0030546 | receptor activator activity(GO:0030546) |
0.0 | 0.7 | GO:0008527 | taste receptor activity(GO:0008527) |
0.0 | 0.3 | GO:0004697 | protein kinase C activity(GO:0004697) |
0.0 | 0.8 | GO:0050694 | galactose 3-O-sulfotransferase activity(GO:0050694) |
0.0 | 0.2 | GO:0051400 | BH domain binding(GO:0051400) |
0.0 | 0.3 | GO:0008143 | poly(A) binding(GO:0008143) |
0.0 | 0.1 | GO:0005143 | interleukin-12 receptor binding(GO:0005143) |
0.0 | 0.1 | GO:0003917 | DNA topoisomerase type I activity(GO:0003917) |
0.0 | 0.1 | GO:0004945 | angiotensin type II receptor activity(GO:0004945) |
0.0 | 0.3 | GO:0050699 | WW domain binding(GO:0050699) |
0.0 | 0.1 | GO:0070991 | medium-chain-acyl-CoA dehydrogenase activity(GO:0070991) |
0.0 | 1.4 | GO:0008201 | heparin binding(GO:0008201) |
0.0 | 0.0 | GO:0004937 | alpha1-adrenergic receptor activity(GO:0004937) |
0.0 | 0.1 | GO:0016724 | ferroxidase activity(GO:0004322) oxidoreductase activity, oxidizing metal ions, oxygen as acceptor(GO:0016724) |
0.0 | 0.0 | GO:0042289 | MHC class II protein binding(GO:0042289) |
0.0 | 0.0 | GO:0035410 | dihydrotestosterone 17-beta-dehydrogenase activity(GO:0035410) |
0.0 | 0.0 | GO:0008158 | hedgehog receptor activity(GO:0008158) |
0.0 | 0.1 | GO:0005231 | excitatory extracellular ligand-gated ion channel activity(GO:0005231) |
0.0 | 0.0 | GO:0001875 | lipopolysaccharide receptor activity(GO:0001875) |
0.0 | 0.0 | GO:0035256 | G-protein coupled glutamate receptor binding(GO:0035256) |
0.0 | 0.2 | GO:0005328 | neurotransmitter:sodium symporter activity(GO:0005328) |
0.0 | 0.1 | GO:0004526 | ribonuclease P activity(GO:0004526) |
0.0 | 0.0 | GO:0005290 | L-histidine transmembrane transporter activity(GO:0005290) |
0.0 | 2.8 | GO:0070739 | protein-glutamic acid ligase activity(GO:0070739) |
0.0 | 0.1 | GO:0004707 | MAP kinase activity(GO:0004707) |
0.0 | 0.8 | GO:0030165 | PDZ domain binding(GO:0030165) |
0.0 | 0.0 | GO:0019107 | myristoyltransferase activity(GO:0019107) |
0.0 | 0.2 | GO:0003785 | actin monomer binding(GO:0003785) |
0.0 | 0.2 | GO:0005149 | interleukin-1 receptor binding(GO:0005149) |
0.0 | 0.1 | GO:0005225 | volume-sensitive anion channel activity(GO:0005225) |
0.0 | 0.1 | GO:0001588 | dopamine neurotransmitter receptor activity, coupled via Gs(GO:0001588) |
0.0 | 0.1 | GO:0031386 | protein tag(GO:0031386) |
0.0 | 0.1 | GO:0004983 | neuropeptide Y receptor activity(GO:0004983) |
0.0 | 0.0 | GO:0004833 | tryptophan 2,3-dioxygenase activity(GO:0004833) |
0.0 | 0.0 | GO:0017099 | very-long-chain-acyl-CoA dehydrogenase activity(GO:0017099) |
0.0 | 0.0 | GO:0050501 | hyaluronan synthase activity(GO:0050501) |
0.0 | 0.0 | GO:1990825 | sequence-specific mRNA binding(GO:1990825) |
0.0 | 0.4 | GO:0016748 | succinyltransferase activity(GO:0016748) |
0.0 | 0.0 | GO:0008142 | oxysterol binding(GO:0008142) |
0.0 | 0.1 | GO:0051766 | inositol trisphosphate kinase activity(GO:0051766) |
0.0 | 0.4 | GO:0017046 | peptide hormone binding(GO:0017046) |
0.0 | 0.0 | GO:0047023 | androsterone dehydrogenase activity(GO:0047023) |
0.0 | 0.2 | GO:0035255 | ionotropic glutamate receptor binding(GO:0035255) |
0.0 | 0.1 | GO:0019911 | structural constituent of myelin sheath(GO:0019911) |
0.0 | 0.0 | GO:0004591 | oxoglutarate dehydrogenase (succinyl-transferring) activity(GO:0004591) |
0.0 | 0.4 | GO:0048306 | calcium-dependent protein binding(GO:0048306) |
0.0 | 0.1 | GO:0004534 | 5'-3' exoribonuclease activity(GO:0004534) |
0.0 | 0.0 | GO:0038100 | nodal binding(GO:0038100) |
0.0 | 0.0 | GO:0071614 | linoleic acid epoxygenase activity(GO:0071614) |
0.0 | 0.0 | GO:0005131 | growth hormone receptor binding(GO:0005131) |
0.0 | 0.0 | GO:0051870 | methotrexate binding(GO:0051870) |
0.0 | 0.2 | GO:0005031 | tumor necrosis factor-activated receptor activity(GO:0005031) death receptor activity(GO:0005035) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.2 | 3.6 | PID EPHRINB REV PATHWAY | Ephrin B reverse signaling |
0.2 | 0.2 | PID IGF1 PATHWAY | IGF1 pathway |
0.2 | 1.9 | PID INTEGRIN4 PATHWAY | Alpha6 beta4 integrin-ligand interactions |
0.1 | 0.1 | SA FAS SIGNALING | The TNF-type receptor Fas induces apoptosis on ligand binding. |
0.1 | 6.1 | NABA COLLAGENS | Genes encoding collagen proteins |
0.1 | 1.8 | PID NFKAPPAB ATYPICAL PATHWAY | Atypical NF-kappaB pathway |
0.1 | 2.1 | NABA BASEMENT MEMBRANES | Genes encoding structural components of basement membranes |
0.1 | 2.0 | PID CDC42 REG PATHWAY | Regulation of CDC42 activity |
0.1 | 1.9 | PID INTEGRIN5 PATHWAY | Beta5 beta6 beta7 and beta8 integrin cell surface interactions |
0.1 | 2.4 | PID HEDGEHOG 2PATHWAY | Signaling events mediated by the Hedgehog family |
0.1 | 0.4 | PID CDC42 PATHWAY | CDC42 signaling events |
0.1 | 3.0 | PID WNT SIGNALING PATHWAY | Wnt signaling network |
0.1 | 4.0 | PID RAC1 REG PATHWAY | Regulation of RAC1 activity |
0.1 | 2.3 | PID ECADHERIN STABILIZATION PATHWAY | Stabilization and expansion of the E-cadherin adherens junction |
0.1 | 1.3 | PID HIF1A PATHWAY | Hypoxic and oxygen homeostasis regulation of HIF-1-alpha |
0.1 | 0.6 | PID NECTIN PATHWAY | Nectin adhesion pathway |
0.1 | 1.5 | PID ERBB NETWORK PATHWAY | ErbB receptor signaling network |
0.1 | 2.4 | PID NCADHERIN PATHWAY | N-cadherin signaling events |
0.1 | 0.7 | PID ECADHERIN KERATINOCYTE PATHWAY | E-cadherin signaling in keratinocytes |
0.1 | 0.2 | PID IL12 STAT4 PATHWAY | IL12 signaling mediated by STAT4 |
0.1 | 2.0 | ST MYOCYTE AD PATHWAY | Myocyte Adrenergic Pathway is a specific case of the generalized Adrenergic Pathway. |
0.1 | 0.1 | ST JAK STAT PATHWAY | Jak-STAT Pathway |
0.1 | 0.5 | PID ECADHERIN NASCENT AJ PATHWAY | E-cadherin signaling in the nascent adherens junction |
0.1 | 11.1 | NABA ECM GLYCOPROTEINS | Genes encoding structural ECM glycoproteins |
0.1 | 1.9 | PID AMB2 NEUTROPHILS PATHWAY | amb2 Integrin signaling |
0.1 | 2.3 | PID AJDISS 2PATHWAY | Posttranslational regulation of adherens junction stability and dissassembly |
0.1 | 0.3 | ST PHOSPHOINOSITIDE 3 KINASE PATHWAY | PI3K Pathway |
0.1 | 0.1 | PID LYMPH ANGIOGENESIS PATHWAY | VEGFR3 signaling in lymphatic endothelium |
0.1 | 0.2 | SA B CELL RECEPTOR COMPLEXES | Antigen binding to B cell receptors activates protein tyrosine kinases, such as the Src family, which ultimate activate MAP kinases. |
0.1 | 0.9 | PID EPHA FWDPATHWAY | EPHA forward signaling |
0.1 | 1.1 | PID NETRIN PATHWAY | Netrin-mediated signaling events |
0.1 | 1.1 | PID INTEGRIN A9B1 PATHWAY | Alpha9 beta1 integrin signaling events |
0.1 | 0.1 | PID NFKAPPAB CANONICAL PATHWAY | Canonical NF-kappaB pathway |
0.1 | 0.4 | ST INTERFERON GAMMA PATHWAY | Interferon gamma pathway. |
0.1 | 0.1 | PID IL5 PATHWAY | IL5-mediated signaling events |
0.1 | 3.1 | PID RB 1PATHWAY | Regulation of retinoblastoma protein |
0.1 | 0.1 | SA PROGRAMMED CELL DEATH | Programmed cell death, or apoptosis, eliminates damaged or unneeded cells. |
0.1 | 12.7 | NABA SECRETED FACTORS | Genes encoding secreted soluble factors |
0.0 | 0.7 | PID SYNDECAN 4 PATHWAY | Syndecan-4-mediated signaling events |
0.0 | 2.3 | PID AP1 PATHWAY | AP-1 transcription factor network |
0.0 | 0.7 | PID REELIN PATHWAY | Reelin signaling pathway |
0.0 | 0.6 | PID FGF PATHWAY | FGF signaling pathway |
0.0 | 0.8 | PID ALK1 PATHWAY | ALK1 signaling events |
0.0 | 0.1 | PID SYNDECAN 3 PATHWAY | Syndecan-3-mediated signaling events |
0.0 | 0.7 | PID CIRCADIAN PATHWAY | Circadian rhythm pathway |
0.0 | 0.1 | PID GLYPICAN 1PATHWAY | Glypican 1 network |
0.0 | 0.7 | PID HDAC CLASSIII PATHWAY | Signaling events mediated by HDAC Class III |
0.0 | 1.2 | PID ARF6 TRAFFICKING PATHWAY | Arf6 trafficking events |
0.0 | 1.0 | PID BMP PATHWAY | BMP receptor signaling |
0.0 | 0.2 | PID HIV NEF PATHWAY | HIV-1 Nef: Negative effector of Fas and TNF-alpha |
0.0 | 1.1 | PID DELTA NP63 PATHWAY | Validated transcriptional targets of deltaNp63 isoforms |
0.0 | 0.2 | PID S1P S1P2 PATHWAY | S1P2 pathway |
0.0 | 0.3 | SA MMP CYTOKINE CONNECTION | Cytokines can induce activation of matrix metalloproteinases, which degrade extracellular matrix. |
0.0 | 1.0 | PID RHOA REG PATHWAY | Regulation of RhoA activity |
0.0 | 0.2 | PID AVB3 OPN PATHWAY | Osteopontin-mediated events |
0.0 | 0.7 | ST WNT BETA CATENIN PATHWAY | Wnt/beta-catenin Pathway |
0.0 | 4.4 | NABA ECM AFFILIATED | Genes encoding proteins affiliated structurally or functionally to extracellular matrix proteins |
0.0 | 0.5 | PID PI3KCI AKT PATHWAY | Class I PI3K signaling events mediated by Akt |
0.0 | 0.7 | PID TGFBR PATHWAY | TGF-beta receptor signaling |
0.0 | 1.0 | PID TAP63 PATHWAY | Validated transcriptional targets of TAp63 isoforms |
0.0 | 0.2 | PID ERBB1 DOWNSTREAM PATHWAY | ErbB1 downstream signaling |
0.0 | 0.1 | PID IL8 CXCR2 PATHWAY | IL8- and CXCR2-mediated signaling events |
0.0 | 0.1 | ST G ALPHA S PATHWAY | G alpha s Pathway |
0.0 | 0.6 | PID BARD1 PATHWAY | BARD1 signaling events |
0.0 | 0.1 | ST JNK MAPK PATHWAY | JNK MAPK Pathway |
0.0 | 0.0 | PID TCR RAS PATHWAY | Ras signaling in the CD4+ TCR pathway |
0.0 | 0.1 | ST G ALPHA I PATHWAY | G alpha i Pathway |
0.0 | 0.4 | PID RXR VDR PATHWAY | RXR and RAR heterodimerization with other nuclear receptor |
0.0 | 0.1 | PID P38 GAMMA DELTA PATHWAY | Signaling mediated by p38-gamma and p38-delta |
0.0 | 0.2 | PID RET PATHWAY | Signaling events regulated by Ret tyrosine kinase |
0.0 | 0.2 | ST WNT CA2 CYCLIC GMP PATHWAY | Wnt/Ca2+/cyclic GMP signaling. |
0.0 | 0.3 | PID TRKR PATHWAY | Neurotrophic factor-mediated Trk receptor signaling |
0.0 | 0.5 | PID HES HEY PATHWAY | Notch-mediated HES/HEY network |
0.0 | 0.2 | PID IL23 PATHWAY | IL23-mediated signaling events |
0.0 | 0.2 | PID LYSOPHOSPHOLIPID PATHWAY | LPA receptor mediated events |
0.0 | 0.1 | PID CXCR4 PATHWAY | CXCR4-mediated signaling events |
0.0 | 0.1 | PID MAPK TRK PATHWAY | Trk receptor signaling mediated by the MAPK pathway |
0.0 | 0.1 | PID EPHB FWD PATHWAY | EPHB forward signaling |
0.0 | 0.0 | ST B CELL ANTIGEN RECEPTOR | B Cell Antigen Receptor |
0.0 | 0.2 | PID RAS PATHWAY | Regulation of Ras family activation |
0.0 | 0.4 | ST FAS SIGNALING PATHWAY | Fas Signaling Pathway |
0.0 | 0.0 | PID THROMBIN PAR4 PATHWAY | PAR4-mediated thrombin signaling events |
0.0 | 0.1 | PID VEGFR1 PATHWAY | VEGFR1 specific signals |
0.0 | 0.0 | PID IL8 CXCR1 PATHWAY | IL8- and CXCR1-mediated signaling events |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.3 | 0.3 | REACTOME CELL CELL COMMUNICATION | Genes involved in Cell-Cell communication |
0.2 | 8.7 | REACTOME NETRIN1 SIGNALING | Genes involved in Netrin-1 signaling |
0.2 | 4.6 | REACTOME GLUTATHIONE CONJUGATION | Genes involved in Glutathione conjugation |
0.2 | 5.5 | REACTOME STRIATED MUSCLE CONTRACTION | Genes involved in Striated Muscle Contraction |
0.2 | 3.9 | REACTOME ADHERENS JUNCTIONS INTERACTIONS | Genes involved in Adherens junctions interactions |
0.2 | 3.5 | REACTOME INCRETIN SYNTHESIS SECRETION AND INACTIVATION | Genes involved in Incretin Synthesis, Secretion, and Inactivation |
0.2 | 0.2 | REACTOME ARMS MEDIATED ACTIVATION | Genes involved in ARMS-mediated activation |
0.2 | 3.1 | REACTOME SIGNALING BY HIPPO | Genes involved in Signaling by Hippo |
0.1 | 1.4 | REACTOME BASE FREE SUGAR PHOSPHATE REMOVAL VIA THE SINGLE NUCLEOTIDE REPLACEMENT PATHWAY | Genes involved in Base-free sugar-phosphate removal via the single-nucleotide replacement pathway |
0.1 | 2.4 | REACTOME SYNTHESIS OF GLYCOSYLPHOSPHATIDYLINOSITOL GPI | Genes involved in Synthesis of glycosylphosphatidylinositol (GPI) |
0.1 | 3.0 | REACTOME SIGNALING BY BMP | Genes involved in Signaling by BMP |
0.1 | 0.2 | REACTOME PI3K EVENTS IN ERBB2 SIGNALING | Genes involved in PI3K events in ERBB2 signaling |
0.1 | 0.8 | REACTOME PECAM1 INTERACTIONS | Genes involved in PECAM1 interactions |
0.1 | 1.2 | REACTOME CASPASE MEDIATED CLEAVAGE OF CYTOSKELETAL PROTEINS | Genes involved in Caspase-mediated cleavage of cytoskeletal proteins |
0.1 | 3.2 | REACTOME CELL CELL JUNCTION ORGANIZATION | Genes involved in Cell-cell junction organization |
0.1 | 0.5 | REACTOME BILE ACID AND BILE SALT METABOLISM | Genes involved in Bile acid and bile salt metabolism |
0.1 | 5.5 | REACTOME COLLAGEN FORMATION | Genes involved in Collagen formation |
0.1 | 2.1 | REACTOME INTERACTION BETWEEN L1 AND ANKYRINS | Genes involved in Interaction between L1 and Ankyrins |
0.1 | 0.4 | REACTOME DIGESTION OF DIETARY CARBOHYDRATE | Genes involved in Digestion of dietary carbohydrate |
0.1 | 1.7 | REACTOME DEADENYLATION OF MRNA | Genes involved in Deadenylation of mRNA |
0.1 | 1.1 | REACTOME SIGNALING BY ACTIVATED POINT MUTANTS OF FGFR1 | Genes involved in Signaling by activated point mutants of FGFR1 |
0.1 | 10.1 | REACTOME SIGNALING BY RHO GTPASES | Genes involved in Signaling by Rho GTPases |
0.1 | 1.8 | REACTOME CGMP EFFECTS | Genes involved in cGMP effects |
0.1 | 1.0 | REACTOME GPCR LIGAND BINDING | Genes involved in GPCR ligand binding |
0.1 | 1.0 | REACTOME EICOSANOID LIGAND BINDING RECEPTORS | Genes involved in Eicosanoid ligand-binding receptors |
0.1 | 1.1 | REACTOME INFLAMMASOMES | Genes involved in Inflammasomes |
0.1 | 0.1 | REACTOME SIGNALING BY FGFR3 MUTANTS | Genes involved in Signaling by FGFR3 mutants |
0.1 | 0.6 | REACTOME PLATELET CALCIUM HOMEOSTASIS | Genes involved in Platelet calcium homeostasis |
0.1 | 0.2 | REACTOME FGFR2C LIGAND BINDING AND ACTIVATION | Genes involved in FGFR2c ligand binding and activation |
0.1 | 0.3 | REACTOME SPRY REGULATION OF FGF SIGNALING | Genes involved in Spry regulation of FGF signaling |
0.1 | 0.7 | REACTOME SYNTHESIS OF PIPS AT THE LATE ENDOSOME MEMBRANE | Genes involved in Synthesis of PIPs at the late endosome membrane |
0.1 | 0.6 | REACTOME GAP JUNCTION DEGRADATION | Genes involved in Gap junction degradation |
0.1 | 0.1 | REACTOME APC C CDC20 MEDIATED DEGRADATION OF MITOTIC PROTEINS | Genes involved in APC/C:Cdc20 mediated degradation of mitotic proteins |
0.1 | 1.0 | REACTOME AMINE DERIVED HORMONES | Genes involved in Amine-derived hormones |
0.1 | 0.1 | REACTOME TGF BETA RECEPTOR SIGNALING IN EMT EPITHELIAL TO MESENCHYMAL TRANSITION | Genes involved in TGF-beta receptor signaling in EMT (epithelial to mesenchymal transition) |
0.1 | 0.9 | REACTOME REGULATION OF INSULIN LIKE GROWTH FACTOR IGF ACTIVITY BY INSULIN LIKE GROWTH FACTOR BINDING PROTEINS IGFBPS | Genes involved in Regulation of Insulin-like Growth Factor (IGF) Activity by Insulin-like Growth Factor Binding Proteins (IGFBPs) |
0.1 | 0.3 | REACTOME NEGATIVE REGULATION OF THE PI3K AKT NETWORK | Genes involved in Negative regulation of the PI3K/AKT network |
0.1 | 0.9 | REACTOME N GLYCAN ANTENNAE ELONGATION | Genes involved in N-Glycan antennae elongation |
0.1 | 0.8 | REACTOME ACTIVATION OF BH3 ONLY PROTEINS | Genes involved in Activation of BH3-only proteins |
0.1 | 0.3 | REACTOME SYNTHESIS SECRETION AND DEACYLATION OF GHRELIN | Genes involved in Synthesis, Secretion, and Deacylation of Ghrelin |
0.1 | 0.3 | REACTOME PLATELET ADHESION TO EXPOSED COLLAGEN | Genes involved in Platelet Adhesion to exposed collagen |
0.1 | 1.1 | REACTOME MICRORNA MIRNA BIOGENESIS | Genes involved in MicroRNA (miRNA) Biogenesis |
0.1 | 0.3 | REACTOME NITRIC OXIDE STIMULATES GUANYLATE CYCLASE | Genes involved in Nitric oxide stimulates guanylate cyclase |
0.1 | 2.0 | REACTOME ION TRANSPORT BY P TYPE ATPASES | Genes involved in Ion transport by P-type ATPases |
0.1 | 1.2 | REACTOME ION CHANNEL TRANSPORT | Genes involved in Ion channel transport |
0.1 | 1.0 | REACTOME PROSTACYCLIN SIGNALLING THROUGH PROSTACYCLIN RECEPTOR | Genes involved in Prostacyclin signalling through prostacyclin receptor |
0.1 | 2.8 | REACTOME NUCLEAR RECEPTOR TRANSCRIPTION PATHWAY | Genes involved in Nuclear Receptor transcription pathway |
0.1 | 0.1 | REACTOME CELL DEATH SIGNALLING VIA NRAGE NRIF AND NADE | Genes involved in Cell death signalling via NRAGE, NRIF and NADE |
0.1 | 0.8 | REACTOME UNBLOCKING OF NMDA RECEPTOR GLUTAMATE BINDING AND ACTIVATION | Genes involved in Unblocking of NMDA receptor, glutamate binding and activation |
0.1 | 3.3 | REACTOME CLASS B 2 SECRETIN FAMILY RECEPTORS | Genes involved in Class B/2 (Secretin family receptors) |
0.1 | 0.2 | REACTOME PLATELET SENSITIZATION BY LDL | Genes involved in Platelet sensitization by LDL |
0.1 | 0.2 | REACTOME YAP1 AND WWTR1 TAZ STIMULATED GENE EXPRESSION | Genes involved in YAP1- and WWTR1 (TAZ)-stimulated gene expression |
0.0 | 0.6 | REACTOME PRESYNAPTIC NICOTINIC ACETYLCHOLINE RECEPTORS | Genes involved in Presynaptic nicotinic acetylcholine receptors |
0.0 | 0.4 | REACTOME OXYGEN DEPENDENT PROLINE HYDROXYLATION OF HYPOXIA INDUCIBLE FACTOR ALPHA | Genes involved in Oxygen-dependent Proline Hydroxylation of Hypoxia-inducible Factor Alpha |
0.0 | 0.3 | REACTOME HORMONE LIGAND BINDING RECEPTORS | Genes involved in Hormone ligand-binding receptors |
0.0 | 0.5 | REACTOME DOWNREGULATION OF ERBB2 ERBB3 SIGNALING | Genes involved in Downregulation of ERBB2:ERBB3 signaling |
0.0 | 0.1 | REACTOME CROSS PRESENTATION OF SOLUBLE EXOGENOUS ANTIGENS ENDOSOMES | Genes involved in Cross-presentation of soluble exogenous antigens (endosomes) |
0.0 | 0.2 | REACTOME THROMBOXANE SIGNALLING THROUGH TP RECEPTOR | Genes involved in Thromboxane signalling through TP receptor |
0.0 | 7.1 | REACTOME PEPTIDE LIGAND BINDING RECEPTORS | Genes involved in Peptide ligand-binding receptors |
0.0 | 0.3 | REACTOME ACTIVATION OF NF KAPPAB IN B CELLS | Genes involved in Activation of NF-kappaB in B Cells |
0.0 | 0.3 | REACTOME GABA SYNTHESIS RELEASE REUPTAKE AND DEGRADATION | Genes involved in GABA synthesis, release, reuptake and degradation |
0.0 | 0.0 | REACTOME REMOVAL OF THE FLAP INTERMEDIATE FROM THE C STRAND | Genes involved in Removal of the Flap Intermediate from the C-strand |
0.0 | 0.1 | REACTOME ACTIVATION OF RAC | Genes involved in Activation of Rac |
0.0 | 0.1 | REACTOME DOPAMINE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Dopamine Neurotransmitter Release Cycle |
0.0 | 0.2 | REACTOME ANDROGEN BIOSYNTHESIS | Genes involved in Androgen biosynthesis |
0.0 | 0.5 | REACTOME RIP MEDIATED NFKB ACTIVATION VIA DAI | Genes involved in RIP-mediated NFkB activation via DAI |
0.0 | 0.2 | REACTOME REGULATION OF HYPOXIA INDUCIBLE FACTOR HIF BY OXYGEN | Genes involved in Regulation of Hypoxia-inducible Factor (HIF) by Oxygen |
0.0 | 0.4 | REACTOME IONOTROPIC ACTIVITY OF KAINATE RECEPTORS | Genes involved in Ionotropic activity of Kainate Receptors |
0.0 | 0.2 | REACTOME NFKB ACTIVATION THROUGH FADD RIP1 PATHWAY MEDIATED BY CASPASE 8 AND10 | Genes involved in NF-kB activation through FADD/RIP-1 pathway mediated by caspase-8 and -10 |
0.0 | 0.2 | REACTOME REGULATION OF ORNITHINE DECARBOXYLASE ODC | Genes involved in Regulation of ornithine decarboxylase (ODC) |
0.0 | 0.3 | REACTOME RECEPTOR LIGAND BINDING INITIATES THE SECOND PROTEOLYTIC CLEAVAGE OF NOTCH RECEPTOR | Genes involved in Receptor-ligand binding initiates the second proteolytic cleavage of Notch receptor |
0.0 | 0.1 | REACTOME N GLYCAN ANTENNAE ELONGATION IN THE MEDIAL TRANS GOLGI | Genes involved in N-glycan antennae elongation in the medial/trans-Golgi |
0.0 | 0.3 | REACTOME OTHER SEMAPHORIN INTERACTIONS | Genes involved in Other semaphorin interactions |
0.0 | 1.2 | REACTOME NOTCH1 INTRACELLULAR DOMAIN REGULATES TRANSCRIPTION | Genes involved in NOTCH1 Intracellular Domain Regulates Transcription |
0.0 | 0.3 | REACTOME ACETYLCHOLINE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Acetylcholine Neurotransmitter Release Cycle |
0.0 | 0.2 | REACTOME OPSINS | Genes involved in Opsins |
0.0 | 0.4 | REACTOME TRANSPORT TO THE GOLGI AND SUBSEQUENT MODIFICATION | Genes involved in Transport to the Golgi and subsequent modification |
0.0 | 0.3 | REACTOME CDC6 ASSOCIATION WITH THE ORC ORIGIN COMPLEX | Genes involved in CDC6 association with the ORC:origin complex |
0.0 | 0.5 | REACTOME REGULATION OF BETA CELL DEVELOPMENT | Genes involved in Regulation of beta-cell development |
0.0 | 0.0 | REACTOME GASTRIN CREB SIGNALLING PATHWAY VIA PKC AND MAPK | Genes involved in Gastrin-CREB signalling pathway via PKC and MAPK |
0.0 | 0.1 | REACTOME DESTABILIZATION OF MRNA BY AUF1 HNRNP D0 | Genes involved in Destabilization of mRNA by AUF1 (hnRNP D0) |
0.0 | 0.2 | REACTOME SYNTHESIS OF BILE ACIDS AND BILE SALTS VIA 24 HYDROXYCHOLESTEROL | Genes involved in Synthesis of bile acids and bile salts via 24-hydroxycholesterol |
0.0 | 0.9 | REACTOME IMMUNOREGULATORY INTERACTIONS BETWEEN A LYMPHOID AND A NON LYMPHOID CELL | Genes involved in Immunoregulatory interactions between a Lymphoid and a non-Lymphoid cell |
0.0 | 0.1 | REACTOME RETROGRADE NEUROTROPHIN SIGNALLING | Genes involved in Retrograde neurotrophin signalling |
0.0 | 0.4 | REACTOME RNA POL III TRANSCRIPTION TERMINATION | Genes involved in RNA Polymerase III Transcription Termination |
0.0 | 0.1 | REACTOME INTERACTIONS OF VPR WITH HOST CELLULAR PROTEINS | Genes involved in Interactions of Vpr with host cellular proteins |
0.0 | 0.2 | REACTOME POST TRANSLATIONAL MODIFICATION SYNTHESIS OF GPI ANCHORED PROTEINS | Genes involved in Post-translational modification: synthesis of GPI-anchored proteins |
0.0 | 0.2 | REACTOME REPAIR SYNTHESIS FOR GAP FILLING BY DNA POL IN TC NER | Genes involved in Repair synthesis for gap-filling by DNA polymerase in TC-NER |
0.0 | 0.6 | REACTOME SIGNAL TRANSDUCTION BY L1 | Genes involved in Signal transduction by L1 |
0.0 | 0.2 | REACTOME CYTOSOLIC SULFONATION OF SMALL MOLECULES | Genes involved in Cytosolic sulfonation of small molecules |
0.0 | 0.3 | REACTOME CELL JUNCTION ORGANIZATION | Genes involved in Cell junction organization |
0.0 | 0.1 | REACTOME IKK COMPLEX RECRUITMENT MEDIATED BY RIP1 | Genes involved in IKK complex recruitment mediated by RIP1 |
0.0 | 0.1 | REACTOME SIGNALING BY EGFR IN CANCER | Genes involved in Signaling by EGFR in Cancer |
0.0 | 0.0 | REACTOME GROWTH HORMONE RECEPTOR SIGNALING | Genes involved in Growth hormone receptor signaling |
0.0 | 0.3 | REACTOME NA CL DEPENDENT NEUROTRANSMITTER TRANSPORTERS | Genes involved in Na+/Cl- dependent neurotransmitter transporters |
0.0 | 0.4 | REACTOME DOUBLE STRAND BREAK REPAIR | Genes involved in Double-Strand Break Repair |
0.0 | 1.3 | REACTOME CLASS A1 RHODOPSIN LIKE RECEPTORS | Genes involved in Class A/1 (Rhodopsin-like receptors) |
0.0 | 0.2 | REACTOME CS DS DEGRADATION | Genes involved in CS/DS degradation |
0.0 | 0.0 | REACTOME RESOLUTION OF AP SITES VIA THE SINGLE NUCLEOTIDE REPLACEMENT PATHWAY | Genes involved in Resolution of AP sites via the single-nucleotide replacement pathway |
0.0 | 0.1 | REACTOME GPVI MEDIATED ACTIVATION CASCADE | Genes involved in GPVI-mediated activation cascade |
0.0 | 0.3 | REACTOME BRANCHED CHAIN AMINO ACID CATABOLISM | Genes involved in Branched-chain amino acid catabolism |
0.0 | 0.3 | REACTOME REGULATION OF IFNA SIGNALING | Genes involved in Regulation of IFNA signaling |
0.0 | 0.7 | REACTOME O LINKED GLYCOSYLATION OF MUCINS | Genes involved in O-linked glycosylation of mucins |
0.0 | 0.4 | REACTOME MEIOTIC SYNAPSIS | Genes involved in Meiotic Synapsis |
0.0 | 0.0 | REACTOME GAMMA CARBOXYLATION TRANSPORT AND AMINO TERMINAL CLEAVAGE OF PROTEINS | Genes involved in Gamma-carboxylation, transport, and amino-terminal cleavage of proteins |
0.0 | 0.2 | REACTOME GAP JUNCTION ASSEMBLY | Genes involved in Gap junction assembly |
0.0 | 0.0 | REACTOME BINDING AND ENTRY OF HIV VIRION | Genes involved in Binding and entry of HIV virion |
0.0 | 0.0 | REACTOME PHOSPHORYLATION OF THE APC C | Genes involved in Phosphorylation of the APC/C |
0.0 | 0.5 | REACTOME CHONDROITIN SULFATE DERMATAN SULFATE METABOLISM | Genes involved in Chondroitin sulfate/dermatan sulfate metabolism |
0.0 | 0.0 | REACTOME HIGHLY CALCIUM PERMEABLE POSTSYNAPTIC NICOTINIC ACETYLCHOLINE RECEPTORS | Genes involved in Highly calcium permeable postsynaptic nicotinic acetylcholine receptors |
0.0 | 0.0 | REACTOME INHIBITION OF THE PROTEOLYTIC ACTIVITY OF APC C REQUIRED FOR THE ONSET OF ANAPHASE BY MITOTIC SPINDLE CHECKPOINT COMPONENTS | Genes involved in Inhibition of the proteolytic activity of APC/C required for the onset of anaphase by mitotic spindle checkpoint components |
0.0 | 0.2 | REACTOME TRANSCRIPTIONAL REGULATION OF WHITE ADIPOCYTE DIFFERENTIATION | Genes involved in Transcriptional Regulation of White Adipocyte Differentiation |
0.0 | 0.0 | REACTOME NOREPINEPHRINE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Norepinephrine Neurotransmitter Release Cycle |
0.0 | 0.3 | REACTOME DEGRADATION OF THE EXTRACELLULAR MATRIX | Genes involved in Degradation of the extracellular matrix |
0.0 | 0.1 | REACTOME IRAK1 RECRUITS IKK COMPLEX | Genes involved in IRAK1 recruits IKK complex |
0.0 | 0.1 | REACTOME RNA POL III TRANSCRIPTION INITIATION FROM TYPE 2 PROMOTER | Genes involved in RNA Polymerase III Transcription Initiation From Type 2 Promoter |
0.0 | 0.2 | REACTOME TGF BETA RECEPTOR SIGNALING ACTIVATES SMADS | Genes involved in TGF-beta receptor signaling activates SMADs |
0.0 | 0.5 | REACTOME VOLTAGE GATED POTASSIUM CHANNELS | Genes involved in Voltage gated Potassium channels |
0.0 | 0.2 | REACTOME G0 AND EARLY G1 | Genes involved in G0 and Early G1 |
0.0 | 0.0 | REACTOME INTEGRATION OF ENERGY METABOLISM | Genes involved in Integration of energy metabolism |
0.0 | 0.1 | REACTOME RECRUITMENT OF NUMA TO MITOTIC CENTROSOMES | Genes involved in Recruitment of NuMA to mitotic centrosomes |
0.0 | 0.2 | REACTOME EFFECTS OF PIP2 HYDROLYSIS | Genes involved in Effects of PIP2 hydrolysis |