Gene Symbol | Gene ID | Gene Info |
---|---|---|
Hoxd11
|
ENSMUSG00000042499.12 | homeobox D11 |
Cdx1
|
ENSMUSG00000024619.8 | caudal type homeobox 1 |
Hoxc11
|
ENSMUSG00000001656.3 | homeobox C11 |
CRE | Gene | Distance | Association probability | Pearson corr. coef. | P-value | Plot |
---|---|---|---|---|---|---|
Cdx1 | chr18_61039478_61039668 | 3374 | 0.169929 | 0.79 | 4.9e-13 | Click! |
Cdx1 | chr18_61025947_61026101 | 10175 | 0.129533 | 0.77 | 7.6e-12 | Click! |
Cdx1 | chr18_61036057_61036349 | 4 | 0.967512 | 0.74 | 1.1e-10 | Click! |
Cdx1 | chr18_61035686_61035984 | 364 | 0.816680 | 0.73 | 3.1e-10 | Click! |
Cdx1 | chr18_61025614_61025796 | 10494 | 0.128916 | 0.72 | 4.8e-10 | Click! |
Hoxc11 | chr15_102959985_102960190 | 5660 | 0.083465 | 0.60 | 1.3e-06 | Click! |
Hoxc11 | chr15_102959745_102959947 | 5419 | 0.084542 | 0.43 | 9.3e-04 | Click! |
Hoxd11 | chr2_74681996_74682462 | 94 | 0.872578 | 0.34 | 1.2e-02 | Click! |
Hoxd11 | chr2_74680840_74680991 | 1358 | 0.154271 | 0.21 | 1.2e-01 | Click! |
Hoxd11 | chr2_74680443_74680598 | 963 | 0.236654 | 0.20 | 1.4e-01 | Click! |
Hoxd11 | chr2_74679540_74679713 | 69 | 0.900884 | 0.20 | 1.5e-01 | Click! |
Hoxd11 | chr2_74681594_74681905 | 574 | 0.412576 | 0.19 | 1.7e-01 | Click! |
Move your cursor over a bar to see sample name and corresponding Z-value.
Cis Regulatory Element (CRE) | Target Score | Top associated gene | Gene Info | Distance of CRE to TSS | CRE/Gene association probability |
---|---|---|---|---|---|
chr1_106586823_106587161 | 42.27 |
Gm37053 |
predicted gene, 37053 |
19878 |
0.18 |
chr8_126739857_126740205 | 39.27 |
Gm45805 |
predicted gene 45805 |
18303 |
0.23 |
chr5_98842619_98842926 | 37.80 |
Bmp3 |
bone morphogenetic protein 3 |
11643 |
0.28 |
chr5_137193579_137193852 | 36.06 |
Gm20768 |
predicted gene, 20768 |
4548 |
0.11 |
chr10_123048822_123048979 | 35.45 |
Mon2 |
MON2 homolog, regulator of endosome to Golgi trafficking |
15769 |
0.19 |
chr14_14351950_14353283 | 32.95 |
Il3ra |
interleukin 3 receptor, alpha chain |
2995 |
0.15 |
chr17_84156748_84156901 | 32.31 |
Gm19696 |
predicted gene, 19696 |
384 |
0.84 |
chr12_107695516_107696133 | 31.66 |
4930465M20Rik |
RIKEN cDNA 4930465M20 gene |
39664 |
0.18 |
chr18_51758490_51758660 | 30.87 |
Gm4950 |
predicted pseudogene 4950 |
107306 |
0.07 |
chr19_36371303_36371521 | 30.70 |
Pcgf5 |
polycomb group ring finger 5 |
7656 |
0.14 |
chr11_24473063_24473244 | 29.84 |
4933430M04Rik |
RIKEN cDNA 4933430M04 gene |
8756 |
0.23 |
chr15_77474831_77474995 | 29.15 |
Apol10a |
apolipoprotein L 10A |
2134 |
0.18 |
chr11_79229168_79229530 | 29.15 |
Wsb1 |
WD repeat and SOCS box-containing 1 |
13600 |
0.16 |
chr5_29212022_29212432 | 28.60 |
Gm7420 |
predicted gene 7420 |
5497 |
0.22 |
chr9_67119344_67119526 | 28.57 |
Gm19299 |
predicted gene, 19299 |
14125 |
0.16 |
chr1_60621219_60621384 | 28.57 |
Gm23762 |
predicted gene, 23762 |
7498 |
0.15 |
chr3_141749102_141749255 | 28.49 |
Unc5c |
unc-5 netrin receptor C |
40674 |
0.17 |
chr8_116067622_116067784 | 28.43 |
Gm45733 |
predicted gene 45733 |
95632 |
0.09 |
chr13_102065327_102065524 | 28.14 |
Gm38133 |
predicted gene, 38133 |
50610 |
0.17 |
chr6_48865163_48865392 | 28.12 |
Gm44764 |
predicted gene 44764 |
2170 |
0.14 |
chr16_91702847_91703230 | 28.03 |
Cryzl1 |
crystallin, zeta (quinone reductase)-like 1 |
3750 |
0.14 |
chr14_63261035_63261219 | 27.99 |
Gata4 |
GATA binding protein 4 |
9997 |
0.17 |
chr16_52446109_52446270 | 27.78 |
Alcam |
activated leukocyte cell adhesion molecule |
6276 |
0.33 |
chr5_77107268_77107436 | 27.47 |
Hopx |
HOP homeobox |
7769 |
0.13 |
chr2_72416526_72416747 | 27.40 |
Rpl36a-ps4 |
ribosomal protein L36A, pseudogene 4 |
56389 |
0.12 |
chr1_38146131_38146293 | 27.35 |
Gm5099 |
predicted gene 5099 |
14129 |
0.16 |
chr16_78260390_78260785 | 26.87 |
E330011O21Rik |
RIKEN cDNA E330011O21 gene |
5365 |
0.17 |
chr17_69062293_69062455 | 26.82 |
Epb41l3 |
erythrocyte membrane protein band 4.1 like 3 |
13309 |
0.28 |
chr2_163580189_163580362 | 26.59 |
Ttpal |
tocopherol (alpha) transfer protein-like |
22039 |
0.12 |
chr18_47443907_47444096 | 26.49 |
Gm50086 |
predicted gene, 50086 |
6223 |
0.17 |
chr19_11235141_11235292 | 26.46 |
Ms4a12 |
membrane-spanning 4-domains, subfamily A, member 12 |
2768 |
0.17 |
chr2_59637411_59637578 | 26.12 |
Tanc1 |
tetratricopeptide repeat, ankyrin repeat and coiled-coil containing 1 |
7431 |
0.27 |
chr16_16485604_16485955 | 26.07 |
Fgd4 |
FYVE, RhoGEF and PH domain containing 4 |
18443 |
0.18 |
chr10_88507825_88508238 | 26.02 |
Chpt1 |
choline phosphotransferase 1 |
3958 |
0.18 |
chr3_99931310_99931492 | 25.91 |
Spag17 |
sperm associated antigen 17 |
45984 |
0.16 |
chr15_93711208_93711537 | 25.89 |
Gm41386 |
predicted gene, 41386 |
1397 |
0.44 |
chr2_119240207_119240360 | 25.86 |
Spint1 |
serine protease inhibitor, Kunitz type 1 |
2730 |
0.14 |
chr6_141302920_141303209 | 25.74 |
Gm10400 |
predicted gene 10400 |
37489 |
0.16 |
chr5_119179017_119179334 | 25.49 |
Gm7538 |
predicted gene 7538 |
20843 |
0.23 |
chr14_17686979_17687259 | 25.36 |
Thrb |
thyroid hormone receptor beta |
26223 |
0.25 |
chr14_23785925_23786295 | 25.03 |
Kcnma1 |
potassium large conductance calcium-activated channel, subfamily M, alpha member 1 |
17194 |
0.27 |
chr17_90060297_90060491 | 24.94 |
Nrxn1 |
neurexin I |
27746 |
0.24 |
chr9_34984220_34984377 | 24.93 |
Gm23702 |
predicted gene, 23702 |
24279 |
0.16 |
chr10_27595792_27595948 | 24.77 |
Gm36962 |
predicted gene, 36962 |
19458 |
0.2 |
chr7_129170100_129170424 | 24.74 |
Plpp4 |
phospholipid phosphatase 4 |
86769 |
0.09 |
chr4_150687243_150687406 | 24.73 |
Gm16079 |
predicted gene 16079 |
8532 |
0.21 |
chr1_125550003_125550172 | 24.57 |
Slc35f5 |
solute carrier family 35, member F5 |
10508 |
0.27 |
chr7_65484213_65484369 | 24.57 |
Gm44792 |
predicted gene 44792 |
3070 |
0.28 |
chr3_123437733_123437899 | 24.56 |
Prss12 |
protease, serine 12 neurotrypsin (motopsin) |
9097 |
0.13 |
chr1_130681895_130682046 | 24.55 |
C4bp-ps1 |
complement component 4 binding protein, pseudogene 1 |
2101 |
0.19 |
chr16_88576405_88576568 | 24.55 |
Cldn8 |
claudin 8 |
13303 |
0.12 |
chr5_120924081_120924254 | 24.29 |
AC015535.1 |
2'-5' oligoadenylate synthetase 1A (Oas1a) pseudogene |
8006 |
0.12 |
chr1_67065626_67065815 | 24.11 |
Lancl1 |
LanC (bacterial lantibiotic synthetase component C)-like 1 |
26848 |
0.18 |
chr10_117576053_117576380 | 24.07 |
Gm9004 |
predicted gene 9004 |
13119 |
0.13 |
chr18_79024007_79024317 | 24.06 |
Setbp1 |
SET binding protein 1 |
85229 |
0.1 |
chr3_117873618_117873778 | 23.80 |
Snx7 |
sorting nexin 7 |
4762 |
0.22 |
chr6_3860311_3860462 | 23.79 |
Gm44221 |
predicted gene, 44221 |
3050 |
0.31 |
chr7_110792851_110793160 | 23.50 |
Rnf141 |
ring finger protein 141 |
8594 |
0.14 |
chr4_5494714_5495053 | 23.45 |
Gm11782 |
predicted gene 11782 |
56340 |
0.15 |
chr9_114383017_114383329 | 23.41 |
Crtap |
cartilage associated protein |
4952 |
0.16 |
chr11_61200070_61200276 | 23.39 |
Rps13-ps5 |
ribosomal protein S13, pseudogene 5 |
6002 |
0.15 |
chr5_67855125_67855281 | 23.05 |
Atp8a1 |
ATPase, aminophospholipid transporter (APLT), class I, type 8A, member 1 |
7769 |
0.12 |
chr5_144317459_144317816 | 23.04 |
Baiap2l1 |
BAI1-associated protein 2-like 1 |
28730 |
0.12 |
chr7_46048294_46048484 | 23.01 |
Nomo1 |
nodal modulator 1 |
1732 |
0.24 |
chrX_153311510_153311661 | 22.92 |
Klf8 |
Kruppel-like factor 8 |
48028 |
0.14 |
chr17_36897031_36897328 | 22.90 |
Trim31 |
tripartite motif-containing 31 |
939 |
0.33 |
chr17_3295101_3295428 | 22.59 |
Gm34035 |
predicted gene, 34035 |
11994 |
0.15 |
chr17_87625856_87626040 | 22.48 |
Epcam |
epithelial cell adhesion molecule |
10031 |
0.19 |
chr2_174660421_174660599 | 22.44 |
Zfp831 |
zinc finger protein 831 |
16976 |
0.21 |
chr10_3749661_3749835 | 22.43 |
Plekhg1 |
pleckstrin homology domain containing, family G (with RhoGef domain) member 1 |
9083 |
0.28 |
chr7_89720405_89720589 | 22.37 |
Me3 |
malic enzyme 3, NADP(+)-dependent, mitochondrial |
16234 |
0.19 |
chr8_13897516_13897863 | 22.14 |
Gm7676 |
predicted gene 7676 |
1378 |
0.28 |
chr5_146679205_146679645 | 22.07 |
4930573C15Rik |
RIKEN cDNA 4930573C15 gene |
27197 |
0.15 |
chr12_87369451_87369606 | 22.05 |
Gm48806 |
predicted gene, 48806 |
2464 |
0.15 |
chr11_108241078_108241308 | 21.93 |
Gm11655 |
predicted gene 11655 |
59343 |
0.12 |
chr3_73717713_73717876 | 21.88 |
Bche |
butyrylcholinesterase |
9379 |
0.32 |
chr10_44490967_44491315 | 21.84 |
Prdm1 |
PR domain containing 1, with ZNF domain |
32393 |
0.15 |
chr18_11828586_11828912 | 21.81 |
Cables1 |
CDK5 and Abl enzyme substrate 1 |
10471 |
0.16 |
chr11_70821826_70821987 | 21.79 |
Scimp |
SLP adaptor and CSK interacting membrane protein |
9320 |
0.11 |
chr2_146057085_146057422 | 21.77 |
Cfap61 |
cilia and flagella associated protein 61 |
10002 |
0.26 |
chr11_116753802_116753967 | 21.75 |
BC018473 |
cDNA sequence BC018473 |
921 |
0.42 |
chr5_101802762_101802944 | 21.74 |
Cds1 |
CDP-diacylglycerol synthase 1 |
3695 |
0.18 |
chr13_31326461_31326896 | 21.70 |
Gm11373 |
predicted gene 11373 |
4089 |
0.21 |
chr12_100474954_100475267 | 21.62 |
Ttc7b |
tetratricopeptide repeat domain 7B |
8812 |
0.17 |
chrX_103331241_103331407 | 21.54 |
Gm9516 |
predicted gene 9516 |
5506 |
0.1 |
chr11_94774856_94775172 | 21.53 |
Tmem92 |
transmembrane protein 92 |
7486 |
0.11 |
chr2_163506411_163506587 | 21.49 |
Hnf4a |
hepatic nuclear factor 4, alpha |
309 |
0.83 |
chr3_85758122_85758295 | 21.47 |
Fam160a1 |
family with sequence similarity 160, member A1 |
11942 |
0.22 |
chr14_72172889_72173083 | 21.24 |
Gm49290 |
predicted gene, 49290 |
22710 |
0.23 |
chr8_5105296_5105447 | 21.21 |
Slc10a2 |
solute carrier family 10, member 2 |
20 |
0.98 |
chr12_40147466_40147657 | 21.15 |
Scin |
scinderin |
13333 |
0.15 |
chr12_54463907_54464068 | 21.11 |
Gm7557 |
predicted gene 7557 |
33589 |
0.12 |
chr17_86285017_86285342 | 21.11 |
2010106C02Rik |
RIKEN cDNA 2010106C02 gene |
1999 |
0.44 |
chr3_143478314_143478475 | 21.08 |
1700001N15Rik |
RIKEN cDNA 1700001N15 gene |
68993 |
0.09 |
chr2_153249814_153250196 | 21.07 |
Pofut1 |
protein O-fucosyltransferase 1 |
7477 |
0.14 |
chr6_28464579_28464934 | 21.04 |
Gm43264 |
predicted gene 43264 |
2225 |
0.21 |
chr11_26802655_26802967 | 20.93 |
Gm12070 |
predicted gene 12070 |
16178 |
0.2 |
chr3_101784723_101785058 | 20.92 |
Gm43134 |
predicted gene 43134 |
36766 |
0.15 |
chr8_8238163_8238376 | 20.92 |
A630009H07Rik |
RIKEN cDNA A630009H07 gene |
96808 |
0.07 |
chr5_72656548_72656715 | 20.91 |
Nipal1 |
NIPA-like domain containing 1 |
8789 |
0.12 |
chr6_31164912_31165355 | 20.69 |
Lncpint |
long non-protein coding RNA, Trp53 induced transcript |
1383 |
0.34 |
chr1_105314292_105314445 | 20.59 |
Gm29014 |
predicted gene 29014 |
6753 |
0.21 |
chr9_29318648_29319159 | 20.55 |
Ntm |
neurotrimin |
92833 |
0.1 |
chr14_102552723_102552899 | 20.55 |
Gm49292 |
predicted gene, 49292 |
115788 |
0.07 |
chr2_28629762_28629913 | 20.48 |
Gfi1b |
growth factor independent 1B |
7855 |
0.12 |
chr10_88784422_88784650 | 20.47 |
Utp20 |
UTP20 small subunit processome component |
1870 |
0.3 |
chr15_102997941_102998298 | 20.46 |
Hoxc6 |
homeobox C6 |
138 |
0.9 |
chr13_114822965_114823299 | 20.33 |
Mocs2 |
molybdenum cofactor synthesis 2 |
4227 |
0.3 |
chr10_87049249_87049538 | 20.30 |
1700113H08Rik |
RIKEN cDNA 1700113H08 gene |
8652 |
0.19 |
chr16_73556996_73557158 | 20.30 |
Gm18168 |
predicted gene, 18168 |
46975 |
0.16 |
chr7_99672139_99672320 | 20.29 |
Gm15635 |
predicted gene 15635 |
7076 |
0.1 |
chr3_133211357_133211692 | 20.15 |
Arhgef38 |
Rho guanine nucleotide exchange factor (GEF) 38 |
23365 |
0.2 |
chr10_99614797_99615124 | 20.14 |
Gm20110 |
predicted gene, 20110 |
5789 |
0.19 |
chr19_27316918_27317237 | 20.11 |
Kcnv2 |
potassium channel, subfamily V, member 2 |
5511 |
0.2 |
chr5_5283894_5284052 | 20.07 |
Cdk14 |
cyclin-dependent kinase 14 |
17670 |
0.17 |
chr3_3645756_3645933 | 20.04 |
Hnf4g |
hepatocyte nuclear factor 4, gamma |
11694 |
0.27 |
chr9_119241244_119241395 | 20.02 |
Oxsr1 |
oxidative-stress responsive 1 |
2043 |
0.23 |
chr14_10569049_10569200 | 19.99 |
Gm22053 |
predicted gene, 22053 |
90450 |
0.09 |
chr10_39907400_39907573 | 19.98 |
Gm8911 |
predicted gene 8911 |
3663 |
0.13 |
chr14_121498041_121498233 | 19.97 |
Slc15a1 |
solute carrier family 15 (oligopeptide transporter), member 1 |
5668 |
0.18 |
chr1_82766345_82766504 | 19.96 |
Tm4sf20 |
transmembrane 4 L six family member 20 |
2037 |
0.17 |
chr17_43502712_43502868 | 19.90 |
Mep1a |
meprin 1 alpha |
17 |
0.98 |
chr3_131566380_131566679 | 19.88 |
Papss1 |
3'-phosphoadenosine 5'-phosphosulfate synthase 1 |
1594 |
0.46 |
chrX_139563086_139563385 | 19.85 |
Rnf128 |
ring finger protein 128 |
81 |
0.98 |
chr1_193131518_193131835 | 19.79 |
Utp25 |
UTP25 small subunit processome component |
1404 |
0.32 |
chr11_94775174_94775368 | 19.78 |
Tmem92 |
transmembrane protein 92 |
7229 |
0.11 |
chr1_61657827_61658138 | 19.78 |
Gm37205 |
predicted gene, 37205 |
3559 |
0.19 |
chr3_83266059_83266378 | 19.77 |
Gm10710 |
predicted gene 10710 |
136972 |
0.04 |
chr2_69062030_69062206 | 19.77 |
Gm38377 |
predicted gene, 38377 |
44022 |
0.11 |
chr12_40146559_40146715 | 19.64 |
Scin |
scinderin |
12409 |
0.15 |
chr15_8469049_8469212 | 19.63 |
Gm49247 |
predicted gene, 49247 |
12815 |
0.14 |
chr6_27753485_27753636 | 19.60 |
Gm26310 |
predicted gene, 26310 |
85473 |
0.1 |
chr17_24472591_24472954 | 19.59 |
Bricd5 |
BRICHOS domain containing 5 |
1112 |
0.22 |
chr15_96568727_96568889 | 19.58 |
Slc38a1 |
solute carrier family 38, member 1 |
10776 |
0.23 |
chr8_68432893_68433078 | 19.58 |
Gm15656 |
predicted gene 15656 |
24163 |
0.2 |
chr6_52200956_52201123 | 19.58 |
Hoxaas3 |
Hoxa cluster antisense RNA 3 |
85 |
0.88 |
chr3_3503597_3503773 | 19.57 |
Hnf4g |
hepatocyte nuclear factor 4, gamma |
4345 |
0.28 |
chr1_125662169_125662344 | 19.53 |
Gm18444 |
predicted gene, 18444 |
6360 |
0.24 |
chr7_45323173_45323501 | 19.52 |
Rpl14-ps1 |
ribosomal protein L14, pseudogene 1 |
1628 |
0.15 |
chr16_87934791_87934967 | 19.47 |
Grik1 |
glutamate receptor, ionotropic, kainate 1 |
11048 |
0.28 |
chr18_46226729_46227032 | 19.43 |
Trim36 |
tripartite motif-containing 36 |
14273 |
0.16 |
chr15_101181150_101181473 | 19.40 |
Acvr1b |
activin A receptor, type 1B |
7244 |
0.11 |
chr9_78085973_78086397 | 19.39 |
Fbxo9 |
f-box protein 9 |
380 |
0.78 |
chr9_115355929_115356102 | 19.31 |
Mir467h |
microRNA 467h |
25804 |
0.11 |
chr6_140466335_140466560 | 19.24 |
Plekha5 |
pleckstrin homology domain containing, family A member 5 |
33458 |
0.17 |
chr10_98593860_98594043 | 19.20 |
Gm34297 |
predicted gene, 34297 |
56469 |
0.15 |
chr8_49313875_49314103 | 19.17 |
4930555F03Rik |
RIKEN cDNA 4930555F03 gene |
56897 |
0.14 |
chr6_22258922_22259073 | 19.15 |
Gm42573 |
predicted gene 42573 |
13063 |
0.22 |
chr19_11794415_11794566 | 19.11 |
Stx3 |
syntaxin 3 |
4873 |
0.12 |
chr4_87860834_87860996 | 19.10 |
Mllt3 |
myeloid/lymphoid or mixed-lineage leukemia; translocated to, 3 |
13627 |
0.28 |
chr4_59319399_59319578 | 19.04 |
Susd1 |
sushi domain containing 1 |
3522 |
0.26 |
chr1_185308459_185308873 | 18.97 |
2010103J01Rik |
RIKEN cDNA 2010103J01 gene |
3521 |
0.11 |
chr6_33440622_33440907 | 18.97 |
Gm43168 |
predicted gene 43168 |
7756 |
0.27 |
chr5_92763677_92764030 | 18.91 |
Mir1961 |
microRNA 1961 |
24709 |
0.16 |
chr9_103899433_103899584 | 18.87 |
Gm5372 |
predicted gene 5372 |
11499 |
0.18 |
chr15_36615055_36615206 | 18.85 |
Pabpc1 |
poly(A) binding protein, cytoplasmic 1 |
5462 |
0.14 |
chr8_110987902_110988088 | 18.85 |
Ddx19a |
DEAD (Asp-Glu-Ala-Asp) box polypeptide 19a |
7361 |
0.11 |
chr1_82992059_82992350 | 18.84 |
Gm47959 |
predicted gene, 47959 |
8344 |
0.09 |
chr19_54070496_54070828 | 18.84 |
Gm50186 |
predicted gene, 50186 |
13897 |
0.18 |
chr1_137141965_137142142 | 18.82 |
Gm25609 |
predicted gene, 25609 |
73594 |
0.1 |
chr4_138670186_138670486 | 18.70 |
Vwa5b1 |
von Willebrand factor A domain containing 5B1 |
34452 |
0.13 |
chr7_141276747_141276904 | 18.68 |
Cdhr5 |
cadherin-related family member 5 |
39 |
0.93 |
chr3_101827331_101827501 | 18.67 |
Mab21l3 |
mab-21-like 3 |
8807 |
0.23 |
chr1_92145049_92145208 | 18.66 |
Hdac4 |
histone deacetylase 4 |
3265 |
0.33 |
chr3_3633907_3634261 | 18.64 |
Hnf4g |
hepatocyte nuclear factor 4, gamma |
66 |
0.98 |
chr17_73432615_73432814 | 18.50 |
Gm49875 |
predicted gene, 49875 |
14940 |
0.19 |
chr7_43634054_43634309 | 18.46 |
Ceacam18 |
carcinoembryonic antigen-related cell adhesion molecule 18 |
526 |
0.59 |
chr19_53128131_53128288 | 18.36 |
Gm30381 |
predicted gene, 30381 |
475 |
0.75 |
chr3_61315135_61315286 | 18.33 |
Gm19901 |
predicted gene, 19901 |
13983 |
0.17 |
chr4_73774316_73774478 | 18.32 |
Rasef |
RAS and EF hand domain containing |
16205 |
0.16 |
chr13_72210263_72210473 | 18.31 |
Gm4052 |
predicted gene 4052 |
139853 |
0.05 |
chr14_46567129_46567280 | 18.25 |
Rubie |
RNA upstream of Bmp4 expressed in inner ear |
8643 |
0.13 |
chr3_118601959_118602171 | 18.25 |
Dpyd |
dihydropyrimidine dehydrogenase |
39879 |
0.15 |
chr1_151280063_151280214 | 18.22 |
Gm24402 |
predicted gene, 24402 |
19224 |
0.14 |
chr9_85408597_85408774 | 18.22 |
Gm48833 |
predicted gene, 48833 |
10473 |
0.19 |
chr1_44580407_44580702 | 18.21 |
Gm37626 |
predicted gene, 37626 |
19669 |
0.19 |
chr7_143849207_143849358 | 18.21 |
Dhcr7 |
7-dehydrocholesterol reductase |
7948 |
0.14 |
chr11_3398429_3398724 | 18.19 |
Limk2 |
LIM motif-containing protein kinase 2 |
10598 |
0.12 |
chr5_118550645_118550796 | 18.16 |
Med13l |
mediator complex subunit 13-like |
9959 |
0.16 |
chr15_94593932_94594083 | 18.15 |
Twf1 |
twinfilin actin binding protein 1 |
4118 |
0.23 |
chr2_160332750_160333092 | 18.09 |
Gm826 |
predicted gene 826 |
1241 |
0.56 |
chr4_35575614_35575937 | 18.04 |
Gm12365 |
predicted gene 12365 |
139561 |
0.05 |
chr12_104882595_104882793 | 18.02 |
4930408O17Rik |
RIKEN cDNA 4930408O17 gene |
17364 |
0.16 |
chr8_106585264_106585575 | 17.99 |
1110028F18Rik |
RIKEN cDNA 1110028F18 gene |
1724 |
0.32 |
chr2_60203863_60204022 | 17.98 |
Baz2b |
bromodomain adjacent to zinc finger domain, 2B |
5217 |
0.18 |
chr17_44148541_44148707 | 17.95 |
Clic5 |
chloride intracellular channel 5 |
13856 |
0.23 |
chr11_70070138_70070289 | 17.91 |
Asgr1 |
asialoglycoprotein receptor 1 |
14332 |
0.08 |
chr15_36459080_36459448 | 17.90 |
Gm49224 |
predicted gene, 49224 |
22573 |
0.13 |
chr4_95793734_95793917 | 17.88 |
Fggy |
FGGY carbohydrate kinase domain containing |
24316 |
0.24 |
chr15_64695823_64695974 | 17.84 |
Gm30691 |
predicted gene, 30691 |
62390 |
0.14 |
chr2_15526355_15526523 | 17.84 |
Malrd1 |
MAM and LDL receptor class A domain containing 1 |
40 |
0.98 |
chr14_20128243_20128409 | 17.83 |
Saysd1 |
SAYSVFN motif domain containing 1 |
10208 |
0.16 |
chr19_55585651_55585906 | 17.82 |
Tcf7l2 |
transcription factor 7 like 2, T cell specific, HMG box |
156042 |
0.04 |
chr3_55496495_55496973 | 17.82 |
Gm42607 |
predicted gene 42607 |
12946 |
0.14 |
chr13_32053783_32053934 | 17.73 |
Gm48885 |
predicted gene, 48885 |
45317 |
0.16 |
chr14_7954033_7954557 | 17.73 |
Gm45521 |
predicted gene 45521 |
2993 |
0.24 |
chr6_101287898_101288049 | 17.71 |
9530086O07Rik |
RIKEN cDNA 9530086O07 gene |
537 |
0.77 |
chr13_4206532_4206683 | 17.71 |
Akr1c13 |
aldo-keto reductase family 1, member C13 |
12749 |
0.13 |
chr5_144314883_144315062 | 17.68 |
Baiap2l1 |
BAI1-associated protein 2-like 1 |
26065 |
0.13 |
chr11_36832942_36833149 | 17.64 |
Gm22127 |
predicted gene, 22127 |
110163 |
0.07 |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
7.1 | 28.5 | GO:0042524 | negative regulation of tyrosine phosphorylation of Stat5 protein(GO:0042524) |
6.4 | 19.1 | GO:0072092 | ureteric bud invasion(GO:0072092) |
6.0 | 17.9 | GO:0061113 | pancreas morphogenesis(GO:0061113) |
5.8 | 17.3 | GO:1902896 | terminal web assembly(GO:1902896) |
5.5 | 16.4 | GO:0090271 | positive regulation of fibroblast growth factor production(GO:0090271) |
5.4 | 21.7 | GO:0032532 | regulation of microvillus length(GO:0032532) |
5.2 | 15.5 | GO:0034633 | retinol transport(GO:0034633) isoprenoid transport(GO:0046864) terpenoid transport(GO:0046865) |
5.1 | 15.2 | GO:0061626 | pharyngeal arch artery morphogenesis(GO:0061626) |
5.0 | 20.1 | GO:0070858 | negative regulation of bile acid biosynthetic process(GO:0070858) negative regulation of bile acid metabolic process(GO:1904252) |
4.9 | 14.8 | GO:0051593 | response to folic acid(GO:0051593) |
4.3 | 13.0 | GO:1901492 | positive regulation of lymphangiogenesis(GO:1901492) |
4.3 | 12.9 | GO:0032474 | otolith morphogenesis(GO:0032474) |
3.9 | 19.6 | GO:0021563 | glossopharyngeal nerve development(GO:0021563) |
3.9 | 19.3 | GO:0015712 | hexose phosphate transport(GO:0015712) glucose-6-phosphate transport(GO:0015760) |
3.8 | 11.4 | GO:2000048 | negative regulation of cell-cell adhesion mediated by cadherin(GO:2000048) |
3.7 | 15.0 | GO:0007621 | negative regulation of female receptivity(GO:0007621) |
3.7 | 11.2 | GO:1901656 | glycoside transport(GO:1901656) |
3.7 | 11.1 | GO:0061470 | T follicular helper cell differentiation(GO:0061470) |
3.7 | 11.0 | GO:0000101 | sulfur amino acid transport(GO:0000101) |
3.7 | 11.0 | GO:0016554 | cytidine to uridine editing(GO:0016554) |
3.6 | 10.9 | GO:0002337 | B-1a B cell differentiation(GO:0002337) |
3.6 | 10.8 | GO:0050427 | 3'-phosphoadenosine 5'-phosphosulfate metabolic process(GO:0050427) |
3.6 | 10.8 | GO:2000670 | positive regulation of dendritic cell apoptotic process(GO:2000670) |
3.6 | 10.7 | GO:0002121 | inter-male aggressive behavior(GO:0002121) |
3.5 | 10.5 | GO:0003289 | atrial septum primum morphogenesis(GO:0003289) |
3.4 | 10.3 | GO:0002314 | germinal center B cell differentiation(GO:0002314) |
3.3 | 16.6 | GO:2001286 | regulation of caveolin-mediated endocytosis(GO:2001286) |
3.3 | 3.3 | GO:0038180 | nerve growth factor signaling pathway(GO:0038180) |
3.1 | 9.3 | GO:0070358 | actin polymerization-dependent cell motility(GO:0070358) |
3.0 | 17.9 | GO:1903551 | regulation of extracellular exosome assembly(GO:1903551) |
3.0 | 8.9 | GO:0033615 | mitochondrial proton-transporting ATP synthase complex assembly(GO:0033615) |
2.9 | 8.7 | GO:0019747 | regulation of isoprenoid metabolic process(GO:0019747) |
2.8 | 8.3 | GO:0060523 | prostate epithelial cord elongation(GO:0060523) |
2.7 | 11.0 | GO:0060282 | positive regulation of oocyte development(GO:0060282) |
2.6 | 7.9 | GO:0035524 | proline transmembrane transport(GO:0035524) |
2.5 | 7.5 | GO:0046618 | drug export(GO:0046618) |
2.5 | 2.5 | GO:0070384 | Harderian gland development(GO:0070384) |
2.5 | 9.9 | GO:1904304 | regulation of gastro-intestinal system smooth muscle contraction(GO:1904304) |
2.5 | 17.3 | GO:0006108 | malate metabolic process(GO:0006108) |
2.4 | 7.2 | GO:0048936 | peripheral nervous system neuron axonogenesis(GO:0048936) |
2.3 | 9.3 | GO:0060414 | aorta smooth muscle tissue morphogenesis(GO:0060414) |
2.3 | 6.9 | GO:1903690 | negative regulation of wound healing, spreading of epidermal cells(GO:1903690) |
2.3 | 11.4 | GO:0014028 | notochord formation(GO:0014028) |
2.3 | 6.8 | GO:0010908 | regulation of heparan sulfate proteoglycan biosynthetic process(GO:0010908) positive regulation of heparan sulfate proteoglycan biosynthetic process(GO:0010909) positive regulation of proteoglycan biosynthetic process(GO:1902730) |
2.2 | 15.7 | GO:0002756 | MyD88-independent toll-like receptor signaling pathway(GO:0002756) |
2.2 | 9.0 | GO:1900747 | negative regulation of vascular endothelial growth factor signaling pathway(GO:1900747) |
2.2 | 6.6 | GO:0034197 | acylglycerol transport(GO:0034196) triglyceride transport(GO:0034197) |
2.2 | 4.3 | GO:0061091 | regulation of phospholipid translocation(GO:0061091) positive regulation of phospholipid translocation(GO:0061092) |
2.2 | 4.3 | GO:0018992 | germ-line sex determination(GO:0018992) |
2.1 | 10.7 | GO:0060023 | soft palate development(GO:0060023) |
2.1 | 14.9 | GO:0042989 | sequestering of actin monomers(GO:0042989) |
2.1 | 10.5 | GO:0042078 | germ-line stem cell division(GO:0042078) male germ-line stem cell asymmetric division(GO:0048133) germline stem cell asymmetric division(GO:0098728) |
2.1 | 8.4 | GO:0097039 | protein linear polyubiquitination(GO:0097039) |
2.1 | 8.3 | GO:2000741 | positive regulation of mesenchymal stem cell differentiation(GO:2000741) |
2.0 | 8.1 | GO:0019805 | quinolinate biosynthetic process(GO:0019805) |
2.0 | 8.1 | GO:0006776 | vitamin A metabolic process(GO:0006776) |
2.0 | 6.1 | GO:2001199 | negative regulation of dendritic cell differentiation(GO:2001199) |
2.0 | 6.0 | GO:0060585 | regulation of prostaglandin-endoperoxide synthase activity(GO:0060584) positive regulation of prostaglandin-endoperoxide synthase activity(GO:0060585) |
2.0 | 6.0 | GO:0034140 | negative regulation of toll-like receptor 3 signaling pathway(GO:0034140) |
2.0 | 6.0 | GO:0042276 | error-prone translesion synthesis(GO:0042276) |
2.0 | 7.9 | GO:1903521 | apoptotic process involved in mammary gland involution(GO:0060057) positive regulation of apoptotic process involved in mammary gland involution(GO:0060058) positive regulation of apoptotic process involved in morphogenesis(GO:1902339) regulation of mammary gland involution(GO:1903519) positive regulation of mammary gland involution(GO:1903521) positive regulation of apoptotic process involved in development(GO:1904747) |
2.0 | 7.8 | GO:0030035 | microspike assembly(GO:0030035) |
2.0 | 7.8 | GO:0032430 | positive regulation of phospholipase A2 activity(GO:0032430) |
2.0 | 13.7 | GO:0086042 | cardiac muscle cell-cardiac muscle cell adhesion(GO:0086042) |
1.9 | 11.6 | GO:0032534 | regulation of microvillus assembly(GO:0032534) |
1.9 | 5.8 | GO:0006543 | glutamine catabolic process(GO:0006543) |
1.9 | 5.8 | GO:0034436 | glycoprotein transport(GO:0034436) |
1.9 | 30.5 | GO:0015721 | bile acid and bile salt transport(GO:0015721) |
1.9 | 11.4 | GO:0090557 | establishment of endothelial intestinal barrier(GO:0090557) |
1.9 | 7.5 | GO:0072039 | regulation of mesenchymal cell apoptotic process involved in nephron morphogenesis(GO:0072039) negative regulation of mesenchymal cell apoptotic process involved in nephron morphogenesis(GO:0072040) mesenchymal cell apoptotic process involved in nephron morphogenesis(GO:1901145) regulation of somatic stem cell population maintenance(GO:1904672) negative regulation of somatic stem cell population maintenance(GO:1904673) |
1.9 | 7.5 | GO:0002175 | protein localization to paranode region of axon(GO:0002175) |
1.8 | 5.5 | GO:0015889 | cobalamin transport(GO:0015889) |
1.8 | 5.5 | GO:0035793 | positive regulation of metanephric mesenchymal cell migration by platelet-derived growth factor receptor-beta signaling pathway(GO:0035793) regulation of metanephric mesenchymal cell migration by platelet-derived growth factor receptor-beta signaling pathway(GO:1900238) positive regulation of metanephric mesenchymal cell migration(GO:2000591) |
1.8 | 1.8 | GO:2000491 | positive regulation of hepatic stellate cell activation(GO:2000491) |
1.8 | 5.5 | GO:0032439 | endosome localization(GO:0032439) |
1.8 | 3.7 | GO:0061325 | cell proliferation involved in outflow tract morphogenesis(GO:0061325) |
1.8 | 5.5 | GO:0036066 | protein O-linked fucosylation(GO:0036066) |
1.8 | 10.8 | GO:0045656 | negative regulation of monocyte differentiation(GO:0045656) |
1.8 | 7.2 | GO:0000711 | meiotic DNA repair synthesis(GO:0000711) |
1.8 | 5.4 | GO:0035483 | gastric emptying(GO:0035483) |
1.8 | 3.5 | GO:0072076 | nephrogenic mesenchyme development(GO:0072076) |
1.7 | 3.5 | GO:0097112 | gamma-aminobutyric acid receptor clustering(GO:0097112) |
1.7 | 3.4 | GO:0010912 | regulation of isomerase activity(GO:0010911) positive regulation of isomerase activity(GO:0010912) |
1.7 | 12.0 | GO:0046598 | positive regulation of viral entry into host cell(GO:0046598) |
1.7 | 3.4 | GO:0046098 | guanine metabolic process(GO:0046098) |
1.7 | 5.1 | GO:0046341 | CDP-diacylglycerol metabolic process(GO:0046341) |
1.7 | 3.4 | GO:0060331 | negative regulation of response to interferon-gamma(GO:0060331) negative regulation of interferon-gamma-mediated signaling pathway(GO:0060336) |
1.7 | 5.0 | GO:0061625 | fructose catabolic process(GO:0006001) fructose catabolic process to hydroxyacetone phosphate and glyceraldehyde-3-phosphate(GO:0061624) glycolytic process through fructose-1-phosphate(GO:0061625) |
1.7 | 5.0 | GO:0006667 | sphinganine metabolic process(GO:0006667) |
1.7 | 11.7 | GO:0036289 | peptidyl-serine autophosphorylation(GO:0036289) |
1.7 | 5.0 | GO:0035283 | central nervous system segmentation(GO:0035283) brain segmentation(GO:0035284) |
1.7 | 3.3 | GO:0060916 | mesenchymal cell proliferation involved in lung development(GO:0060916) |
1.7 | 9.9 | GO:2000096 | positive regulation of Wnt signaling pathway, planar cell polarity pathway(GO:2000096) |
1.6 | 4.9 | GO:0046121 | deoxyribonucleoside catabolic process(GO:0046121) |
1.6 | 3.3 | GO:0042505 | tyrosine phosphorylation of Stat6 protein(GO:0042505) regulation of tyrosine phosphorylation of Stat6 protein(GO:0042525) |
1.6 | 4.9 | GO:0090283 | regulation of protein glycosylation in Golgi(GO:0090283) |
1.6 | 9.8 | GO:0051639 | actin filament network formation(GO:0051639) |
1.6 | 1.6 | GO:1904504 | regulation of lipophagy(GO:1904502) positive regulation of lipophagy(GO:1904504) |
1.6 | 11.2 | GO:0006012 | galactose metabolic process(GO:0006012) |
1.6 | 6.3 | GO:0001712 | ectodermal cell fate commitment(GO:0001712) |
1.6 | 4.7 | GO:0006663 | platelet activating factor biosynthetic process(GO:0006663) platelet activating factor metabolic process(GO:0046469) |
1.5 | 4.6 | GO:1903061 | positive regulation of protein lipidation(GO:1903061) |
1.5 | 4.6 | GO:1901874 | regulation of post-translational protein modification(GO:1901873) negative regulation of post-translational protein modification(GO:1901874) |
1.5 | 4.6 | GO:0006741 | NADP biosynthetic process(GO:0006741) |
1.5 | 9.1 | GO:0007341 | penetration of zona pellucida(GO:0007341) |
1.5 | 3.0 | GO:0006868 | glutamine transport(GO:0006868) |
1.5 | 4.5 | GO:1903377 | negative regulation of oxidative stress-induced neuron intrinsic apoptotic signaling pathway(GO:1903377) |
1.5 | 7.5 | GO:0006971 | hypotonic response(GO:0006971) |
1.5 | 3.0 | GO:0019087 | transformation of host cell by virus(GO:0019087) |
1.5 | 1.5 | GO:0006578 | amino-acid betaine biosynthetic process(GO:0006578) |
1.5 | 11.8 | GO:0060052 | neurofilament cytoskeleton organization(GO:0060052) |
1.5 | 2.9 | GO:0097477 | lateral motor column neuron migration(GO:0097477) |
1.4 | 8.7 | GO:0090043 | regulation of tubulin deacetylation(GO:0090043) |
1.4 | 4.3 | GO:0061502 | early endosome to recycling endosome transport(GO:0061502) |
1.4 | 5.7 | GO:0051295 | establishment of meiotic spindle localization(GO:0051295) |
1.4 | 4.3 | GO:0015755 | fructose transport(GO:0015755) |
1.4 | 8.5 | GO:0006207 | 'de novo' pyrimidine nucleobase biosynthetic process(GO:0006207) pyrimidine nucleobase biosynthetic process(GO:0019856) |
1.4 | 4.2 | GO:0021699 | cerebellar cortex maturation(GO:0021699) |
1.4 | 2.8 | GO:1901859 | negative regulation of mitochondrial DNA metabolic process(GO:1901859) |
1.4 | 2.8 | GO:0051771 | negative regulation of nitric-oxide synthase biosynthetic process(GO:0051771) |
1.4 | 4.2 | GO:0043133 | hindgut contraction(GO:0043133) regulation of hindgut contraction(GO:0043134) |
1.4 | 2.8 | GO:1902809 | regulation of skeletal muscle fiber differentiation(GO:1902809) |
1.4 | 5.5 | GO:0090403 | oxidative stress-induced premature senescence(GO:0090403) |
1.4 | 13.7 | GO:0070050 | neuron cellular homeostasis(GO:0070050) |
1.4 | 1.4 | GO:0008050 | female courtship behavior(GO:0008050) |
1.3 | 4.0 | GO:0002913 | positive regulation of T cell anergy(GO:0002669) positive regulation of lymphocyte anergy(GO:0002913) |
1.3 | 4.0 | GO:0060671 | epithelial cell differentiation involved in embryonic placenta development(GO:0060671) epithelial cell morphogenesis involved in placental branching(GO:0060672) |
1.3 | 7.9 | GO:0019720 | Mo-molybdopterin cofactor biosynthetic process(GO:0006777) Mo-molybdopterin cofactor metabolic process(GO:0019720) molybdopterin cofactor biosynthetic process(GO:0032324) molybdopterin cofactor metabolic process(GO:0043545) prosthetic group metabolic process(GO:0051189) |
1.3 | 6.6 | GO:0090336 | positive regulation of brown fat cell differentiation(GO:0090336) |
1.3 | 2.6 | GO:0033088 | negative regulation of immature T cell proliferation in thymus(GO:0033088) |
1.3 | 5.2 | GO:0006114 | glycerol biosynthetic process(GO:0006114) |
1.3 | 2.6 | GO:2000618 | regulation of histone H4-K16 acetylation(GO:2000618) |
1.3 | 3.9 | GO:0001996 | positive regulation of heart rate by epinephrine-norepinephrine(GO:0001996) |
1.3 | 3.9 | GO:0030538 | embryonic genitalia morphogenesis(GO:0030538) |
1.3 | 6.4 | GO:0033564 | anterior/posterior axon guidance(GO:0033564) |
1.3 | 5.1 | GO:0043415 | positive regulation of skeletal muscle tissue regeneration(GO:0043415) |
1.3 | 10.2 | GO:1990845 | diet induced thermogenesis(GO:0002024) adaptive thermogenesis(GO:1990845) |
1.3 | 17.8 | GO:1902895 | positive regulation of pri-miRNA transcription from RNA polymerase II promoter(GO:1902895) |
1.3 | 2.5 | GO:0097252 | oligodendrocyte apoptotic process(GO:0097252) |
1.3 | 2.5 | GO:0021569 | rhombomere 3 development(GO:0021569) |
1.3 | 5.0 | GO:1900042 | positive regulation of interleukin-2 secretion(GO:1900042) |
1.3 | 1.3 | GO:0045168 | cell-cell signaling involved in cell fate commitment(GO:0045168) |
1.2 | 5.0 | GO:0006166 | purine ribonucleoside salvage(GO:0006166) |
1.2 | 1.2 | GO:0051572 | negative regulation of histone H3-K4 methylation(GO:0051572) |
1.2 | 2.5 | GO:1901529 | positive regulation of anion channel activity(GO:1901529) |
1.2 | 4.9 | GO:1903818 | positive regulation of delayed rectifier potassium channel activity(GO:1902261) positive regulation of voltage-gated potassium channel activity(GO:1903818) |
1.2 | 3.7 | GO:0050955 | thermoception(GO:0050955) |
1.2 | 3.7 | GO:0007181 | transforming growth factor beta receptor complex assembly(GO:0007181) |
1.2 | 2.4 | GO:1904970 | brush border assembly(GO:1904970) |
1.2 | 8.5 | GO:0071635 | negative regulation of transforming growth factor beta production(GO:0071635) |
1.2 | 3.6 | GO:0071847 | TNFSF11-mediated signaling pathway(GO:0071847) |
1.2 | 1.2 | GO:0021571 | rhombomere 5 development(GO:0021571) |
1.2 | 2.4 | GO:0030997 | regulation of centriole-centriole cohesion(GO:0030997) |
1.2 | 4.8 | GO:0042780 | tRNA 3'-end processing(GO:0042780) |
1.2 | 3.5 | GO:0055009 | atrial cardiac muscle tissue development(GO:0003228) atrial cardiac muscle tissue morphogenesis(GO:0055009) |
1.2 | 3.5 | GO:1904694 | negative regulation of vascular smooth muscle contraction(GO:1904694) |
1.2 | 3.5 | GO:0033566 | gamma-tubulin complex localization(GO:0033566) |
1.2 | 2.3 | GO:0060167 | regulation of adenosine receptor signaling pathway(GO:0060167) |
1.2 | 3.5 | GO:0006562 | proline catabolic process(GO:0006562) |
1.2 | 3.5 | GO:0032261 | purine nucleotide salvage(GO:0032261) IMP salvage(GO:0032264) |
1.2 | 1.2 | GO:1903116 | positive regulation of actin filament-based movement(GO:1903116) |
1.2 | 1.2 | GO:0006808 | regulation of nitrogen utilization(GO:0006808) |
1.2 | 2.3 | GO:0035973 | aggrephagy(GO:0035973) |
1.2 | 4.6 | GO:0061074 | regulation of neural retina development(GO:0061074) |
1.2 | 3.5 | GO:0060066 | oviduct development(GO:0060066) |
1.2 | 9.2 | GO:0060670 | branching involved in labyrinthine layer morphogenesis(GO:0060670) |
1.1 | 9.1 | GO:0090286 | cytoskeletal anchoring at nuclear membrane(GO:0090286) |
1.1 | 1.1 | GO:0046855 | inositol phosphate dephosphorylation(GO:0046855) |
1.1 | 4.5 | GO:0042997 | negative regulation of Golgi to plasma membrane protein transport(GO:0042997) |
1.1 | 1.1 | GO:0010159 | specification of organ position(GO:0010159) |
1.1 | 4.4 | GO:0060480 | lung goblet cell differentiation(GO:0060480) |
1.1 | 23.3 | GO:0042036 | negative regulation of cytokine biosynthetic process(GO:0042036) |
1.1 | 3.3 | GO:0061038 | uterus morphogenesis(GO:0061038) |
1.1 | 5.4 | GO:0071280 | cellular response to copper ion(GO:0071280) |
1.1 | 5.4 | GO:0014870 | response to inactivity(GO:0014854) response to muscle inactivity(GO:0014870) response to muscle inactivity involved in regulation of muscle adaptation(GO:0014877) response to denervation involved in regulation of muscle adaptation(GO:0014894) |
1.1 | 2.1 | GO:0035754 | B cell chemotaxis(GO:0035754) |
1.1 | 3.2 | GO:0015888 | thiamine transport(GO:0015888) |
1.1 | 4.2 | GO:0051031 | tRNA transport(GO:0051031) |
1.1 | 3.2 | GO:0007468 | regulation of rhodopsin gene expression(GO:0007468) |
1.1 | 4.2 | GO:0010792 | DNA double-strand break processing involved in repair via single-strand annealing(GO:0010792) |
1.0 | 1.0 | GO:2000645 | negative regulation of receptor catabolic process(GO:2000645) |
1.0 | 3.1 | GO:1904393 | positive regulation of postsynaptic membrane organization(GO:1901628) regulation of skeletal muscle acetylcholine-gated channel clustering(GO:1904393) positive regulation of skeletal muscle acetylcholine-gated channel clustering(GO:1904395) |
1.0 | 3.1 | GO:2000346 | negative regulation of hepatocyte proliferation(GO:2000346) |
1.0 | 4.1 | GO:2000564 | regulation of CD8-positive, alpha-beta T cell proliferation(GO:2000564) |
1.0 | 1.0 | GO:0071034 | CUT catabolic process(GO:0071034) CUT metabolic process(GO:0071043) |
1.0 | 4.1 | GO:0006407 | rRNA export from nucleus(GO:0006407) |
1.0 | 3.0 | GO:0035523 | protein K29-linked deubiquitination(GO:0035523) protein K33-linked deubiquitination(GO:1990168) |
1.0 | 3.0 | GO:0060800 | regulation of cell differentiation involved in embryonic placenta development(GO:0060800) |
1.0 | 2.0 | GO:1904479 | negative regulation of intestinal absorption(GO:1904479) |
1.0 | 3.0 | GO:0045218 | zonula adherens maintenance(GO:0045218) |
1.0 | 1.0 | GO:0046084 | adenine metabolic process(GO:0046083) adenine biosynthetic process(GO:0046084) |
1.0 | 3.9 | GO:0015691 | cadmium ion transport(GO:0015691) cadmium ion transmembrane transport(GO:0070574) |
1.0 | 3.9 | GO:0060718 | chorionic trophoblast cell differentiation(GO:0060718) |
1.0 | 2.0 | GO:0033602 | negative regulation of dopamine secretion(GO:0033602) |
1.0 | 2.9 | GO:0051684 | maintenance of Golgi location(GO:0051684) |
1.0 | 10.7 | GO:1900025 | negative regulation of substrate adhesion-dependent cell spreading(GO:1900025) |
1.0 | 2.9 | GO:0030242 | pexophagy(GO:0030242) |
1.0 | 1.0 | GO:1905216 | positive regulation of mRNA binding(GO:1902416) positive regulation of RNA binding(GO:1905216) |
1.0 | 1.9 | GO:0035331 | negative regulation of hippo signaling(GO:0035331) |
1.0 | 3.9 | GO:2000504 | positive regulation of blood vessel remodeling(GO:2000504) |
1.0 | 1.0 | GO:0090240 | positive regulation of histone H4 acetylation(GO:0090240) |
1.0 | 1.9 | GO:1902445 | regulation of mitochondrial membrane permeability involved in programmed necrotic cell death(GO:1902445) |
1.0 | 7.6 | GO:0097062 | dendritic spine maintenance(GO:0097062) |
0.9 | 2.8 | GO:0015772 | disaccharide transport(GO:0015766) sucrose transport(GO:0015770) oligosaccharide transport(GO:0015772) |
0.9 | 2.8 | GO:0014873 | response to muscle activity involved in regulation of muscle adaptation(GO:0014873) |
0.9 | 2.8 | GO:0040031 | snRNA modification(GO:0040031) |
0.9 | 0.9 | GO:0072566 | chemokine (C-X-C motif) ligand 1 production(GO:0072566) regulation of chemokine (C-X-C motif) ligand 1 production(GO:2000338) |
0.9 | 5.7 | GO:0048539 | bone marrow development(GO:0048539) |
0.9 | 1.9 | GO:2000739 | regulation of mesenchymal stem cell differentiation(GO:2000739) |
0.9 | 3.7 | GO:0010499 | proteasomal ubiquitin-independent protein catabolic process(GO:0010499) |
0.9 | 1.9 | GO:0003100 | regulation of systemic arterial blood pressure by endothelin(GO:0003100) |
0.9 | 7.4 | GO:0030889 | negative regulation of B cell proliferation(GO:0030889) |
0.9 | 3.7 | GO:0019695 | choline metabolic process(GO:0019695) |
0.9 | 0.9 | GO:2000525 | regulation of T cell costimulation(GO:2000523) positive regulation of T cell costimulation(GO:2000525) |
0.9 | 2.7 | GO:0036092 | phosphatidylinositol-3-phosphate biosynthetic process(GO:0036092) |
0.9 | 2.7 | GO:0006982 | response to lipid hydroperoxide(GO:0006982) |
0.9 | 1.8 | GO:0010724 | regulation of definitive erythrocyte differentiation(GO:0010724) |
0.9 | 5.5 | GO:0006102 | isocitrate metabolic process(GO:0006102) |
0.9 | 1.8 | GO:0046340 | diacylglycerol catabolic process(GO:0046340) |
0.9 | 1.8 | GO:0035860 | glial cell-derived neurotrophic factor receptor signaling pathway(GO:0035860) |
0.9 | 0.9 | GO:0010611 | regulation of cardiac muscle hypertrophy(GO:0010611) |
0.9 | 1.8 | GO:0051599 | response to hydrostatic pressure(GO:0051599) |
0.9 | 1.8 | GO:0060160 | negative regulation of dopamine receptor signaling pathway(GO:0060160) |
0.9 | 0.9 | GO:0003415 | chondrocyte hypertrophy(GO:0003415) |
0.9 | 2.7 | GO:2000562 | negative regulation of CD4-positive, alpha-beta T cell proliferation(GO:2000562) |
0.9 | 2.6 | GO:0071638 | negative regulation of monocyte chemotactic protein-1 production(GO:0071638) |
0.9 | 2.6 | GO:0060988 | lipid tube assembly(GO:0060988) |
0.9 | 1.8 | GO:0010901 | regulation of very-low-density lipoprotein particle remodeling(GO:0010901) |
0.9 | 4.4 | GO:0051764 | actin crosslink formation(GO:0051764) |
0.9 | 2.6 | GO:0032789 | saturated monocarboxylic acid metabolic process(GO:0032788) unsaturated monocarboxylic acid metabolic process(GO:0032789) |
0.9 | 4.3 | GO:0051895 | negative regulation of focal adhesion assembly(GO:0051895) |
0.9 | 1.7 | GO:0090399 | replicative senescence(GO:0090399) |
0.9 | 2.6 | GO:0046952 | ketone body catabolic process(GO:0046952) |
0.9 | 3.5 | GO:1902916 | positive regulation of protein polyubiquitination(GO:1902916) |
0.9 | 3.4 | GO:0030091 | protein repair(GO:0030091) |
0.9 | 2.6 | GO:0018879 | biphenyl metabolic process(GO:0018879) |
0.9 | 6.8 | GO:0006857 | oligopeptide transport(GO:0006857) |
0.9 | 2.6 | GO:1901165 | positive regulation of trophoblast cell migration(GO:1901165) |
0.9 | 8.5 | GO:0006527 | arginine catabolic process(GO:0006527) |
0.8 | 0.8 | GO:1903898 | negative regulation of PERK-mediated unfolded protein response(GO:1903898) |
0.8 | 1.7 | GO:0006714 | sesquiterpenoid metabolic process(GO:0006714) |
0.8 | 0.8 | GO:1990564 | protein polyufmylation(GO:1990564) protein K69-linked ufmylation(GO:1990592) |
0.8 | 2.5 | GO:0006435 | threonyl-tRNA aminoacylation(GO:0006435) |
0.8 | 1.7 | GO:1900122 | positive regulation of receptor binding(GO:1900122) |
0.8 | 4.2 | GO:0033133 | positive regulation of glucokinase activity(GO:0033133) |
0.8 | 2.5 | GO:0046112 | nucleobase biosynthetic process(GO:0046112) |
0.8 | 3.4 | GO:0035795 | negative regulation of mitochondrial membrane permeability(GO:0035795) |
0.8 | 5.9 | GO:0046676 | negative regulation of insulin secretion(GO:0046676) |
0.8 | 2.5 | GO:0032960 | regulation of inositol trisphosphate biosynthetic process(GO:0032960) |
0.8 | 3.3 | GO:0019374 | galactolipid metabolic process(GO:0019374) |
0.8 | 0.8 | GO:0097680 | double-strand break repair via classical nonhomologous end joining(GO:0097680) |
0.8 | 7.5 | GO:0070269 | pyroptosis(GO:0070269) |
0.8 | 14.1 | GO:0046597 | negative regulation of viral entry into host cell(GO:0046597) |
0.8 | 0.8 | GO:0043553 | negative regulation of phosphatidylinositol 3-kinase activity(GO:0043553) |
0.8 | 2.5 | GO:0090038 | negative regulation of protein kinase C signaling(GO:0090038) |
0.8 | 0.8 | GO:0035740 | CD8-positive, alpha-beta T cell proliferation(GO:0035740) |
0.8 | 0.8 | GO:0006701 | progesterone biosynthetic process(GO:0006701) |
0.8 | 1.6 | GO:2000860 | positive regulation of mineralocorticoid secretion(GO:2000857) positive regulation of aldosterone secretion(GO:2000860) |
0.8 | 5.7 | GO:0030388 | fructose 1,6-bisphosphate metabolic process(GO:0030388) |
0.8 | 15.5 | GO:0046856 | phosphatidylinositol dephosphorylation(GO:0046856) |
0.8 | 1.6 | GO:1901187 | regulation of ephrin receptor signaling pathway(GO:1901187) |
0.8 | 4.1 | GO:0033600 | negative regulation of mammary gland epithelial cell proliferation(GO:0033600) |
0.8 | 0.8 | GO:0010182 | carbohydrate mediated signaling(GO:0009756) hexose mediated signaling(GO:0009757) sugar mediated signaling pathway(GO:0010182) glucose mediated signaling pathway(GO:0010255) |
0.8 | 3.2 | GO:0006566 | threonine metabolic process(GO:0006566) |
0.8 | 2.4 | GO:1901097 | negative regulation of autophagosome maturation(GO:1901097) |
0.8 | 5.6 | GO:0035507 | regulation of myosin-light-chain-phosphatase activity(GO:0035507) |
0.8 | 2.4 | GO:0070086 | ubiquitin-dependent endocytosis(GO:0070086) |
0.8 | 2.4 | GO:1903849 | regulation of aorta morphogenesis(GO:1903847) positive regulation of aorta morphogenesis(GO:1903849) |
0.8 | 1.6 | GO:0045448 | regulation of mitotic cell cycle, embryonic(GO:0009794) mitotic cell cycle, embryonic(GO:0045448) |
0.8 | 3.1 | GO:0033353 | S-adenosylmethionine cycle(GO:0033353) |
0.8 | 5.5 | GO:0048387 | negative regulation of retinoic acid receptor signaling pathway(GO:0048387) |
0.8 | 17.1 | GO:0031146 | SCF-dependent proteasomal ubiquitin-dependent protein catabolic process(GO:0031146) |
0.8 | 5.4 | GO:0003413 | chondrocyte differentiation involved in endochondral bone morphogenesis(GO:0003413) |
0.8 | 3.9 | GO:0048934 | peripheral nervous system neuron differentiation(GO:0048934) peripheral nervous system neuron development(GO:0048935) |
0.8 | 3.1 | GO:0010815 | bradykinin catabolic process(GO:0010815) |
0.8 | 5.4 | GO:0060613 | fat pad development(GO:0060613) |
0.8 | 3.1 | GO:0033184 | positive regulation of histone ubiquitination(GO:0033184) |
0.8 | 2.3 | GO:0031296 | B cell costimulation(GO:0031296) |
0.8 | 1.5 | GO:0045359 | interferon-beta biosynthetic process(GO:0045350) regulation of interferon-beta biosynthetic process(GO:0045357) positive regulation of interferon-beta biosynthetic process(GO:0045359) |
0.8 | 8.4 | GO:0031954 | positive regulation of protein autophosphorylation(GO:0031954) |
0.8 | 1.5 | GO:0016344 | meiotic chromosome movement towards spindle pole(GO:0016344) |
0.8 | 3.8 | GO:1902237 | positive regulation of endoplasmic reticulum stress-induced intrinsic apoptotic signaling pathway(GO:1902237) |
0.8 | 3.8 | GO:0006627 | protein processing involved in protein targeting to mitochondrion(GO:0006627) |
0.8 | 0.8 | GO:2000507 | positive regulation of energy homeostasis(GO:2000507) |
0.8 | 3.8 | GO:0048194 | Golgi vesicle budding(GO:0048194) |
0.8 | 4.5 | GO:0015838 | amino-acid betaine transport(GO:0015838) |
0.8 | 3.0 | GO:0090241 | negative regulation of histone H4 acetylation(GO:0090241) |
0.8 | 9.8 | GO:0003334 | keratinocyte development(GO:0003334) |
0.8 | 2.3 | GO:0006296 | nucleotide-excision repair, DNA incision, 5'-to lesion(GO:0006296) |
0.7 | 9.7 | GO:0035235 | ionotropic glutamate receptor signaling pathway(GO:0035235) |
0.7 | 0.7 | GO:2000705 | regulation of dense core granule biogenesis(GO:2000705) |
0.7 | 6.7 | GO:0030502 | negative regulation of bone mineralization(GO:0030502) |
0.7 | 4.5 | GO:0060391 | positive regulation of SMAD protein import into nucleus(GO:0060391) |
0.7 | 5.9 | GO:0019321 | pentose metabolic process(GO:0019321) |
0.7 | 6.6 | GO:0046322 | negative regulation of fatty acid oxidation(GO:0046322) |
0.7 | 2.9 | GO:0030309 | poly-N-acetyllactosamine metabolic process(GO:0030309) poly-N-acetyllactosamine biosynthetic process(GO:0030311) |
0.7 | 2.2 | GO:0045541 | negative regulation of cholesterol biosynthetic process(GO:0045541) negative regulation of cholesterol metabolic process(GO:0090206) |
0.7 | 1.5 | GO:0038108 | negative regulation of appetite by leptin-mediated signaling pathway(GO:0038108) |
0.7 | 4.4 | GO:0019673 | GDP-mannose metabolic process(GO:0019673) |
0.7 | 0.7 | GO:1905038 | regulation of sphingolipid biosynthetic process(GO:0090153) regulation of membrane lipid metabolic process(GO:1905038) |
0.7 | 1.5 | GO:0010751 | negative regulation of nitric oxide mediated signal transduction(GO:0010751) |
0.7 | 4.4 | GO:0051694 | pointed-end actin filament capping(GO:0051694) |
0.7 | 2.9 | GO:0060836 | lymphatic endothelial cell differentiation(GO:0060836) |
0.7 | 0.7 | GO:0090427 | activation of meiosis(GO:0090427) |
0.7 | 2.2 | GO:0035995 | detection of muscle stretch(GO:0035995) |
0.7 | 1.4 | GO:0002071 | glandular epithelial cell maturation(GO:0002071) |
0.7 | 2.1 | GO:2001181 | positive regulation of interleukin-10 secretion(GO:2001181) |
0.7 | 2.9 | GO:0036438 | maintenance of lens transparency(GO:0036438) |
0.7 | 2.1 | GO:0016584 | nucleosome positioning(GO:0016584) |
0.7 | 5.0 | GO:0042904 | 9-cis-retinoic acid biosynthetic process(GO:0042904) 9-cis-retinoic acid metabolic process(GO:0042905) |
0.7 | 2.9 | GO:0051387 | negative regulation of neurotrophin TRK receptor signaling pathway(GO:0051387) |
0.7 | 0.7 | GO:0014887 | muscle hypertrophy in response to stress(GO:0003299) cardiac muscle adaptation(GO:0014887) cardiac muscle hypertrophy in response to stress(GO:0014898) |
0.7 | 2.8 | GO:0001844 | protein insertion into mitochondrial membrane involved in apoptotic signaling pathway(GO:0001844) |
0.7 | 0.7 | GO:0000966 | RNA 5'-end processing(GO:0000966) |
0.7 | 1.4 | GO:1900020 | regulation of protein kinase C activity(GO:1900019) positive regulation of protein kinase C activity(GO:1900020) |
0.7 | 9.2 | GO:0008340 | determination of adult lifespan(GO:0008340) |
0.7 | 7.1 | GO:0032988 | ribonucleoprotein complex disassembly(GO:0032988) |
0.7 | 4.2 | GO:0030718 | germ-line stem cell population maintenance(GO:0030718) |
0.7 | 4.2 | GO:0015868 | purine ribonucleotide transport(GO:0015868) |
0.7 | 2.1 | GO:0071895 | odontoblast differentiation(GO:0071895) |
0.7 | 4.2 | GO:2000766 | negative regulation of cytoplasmic translation(GO:2000766) |
0.7 | 8.4 | GO:0019184 | nonribosomal peptide biosynthetic process(GO:0019184) |
0.7 | 5.6 | GO:0035878 | nail development(GO:0035878) |
0.7 | 1.4 | GO:0002606 | positive regulation of dendritic cell antigen processing and presentation(GO:0002606) |
0.7 | 1.4 | GO:0021524 | visceral motor neuron differentiation(GO:0021524) |
0.7 | 5.5 | GO:0019985 | translesion synthesis(GO:0019985) |
0.7 | 1.4 | GO:0060510 | Type II pneumocyte differentiation(GO:0060510) |
0.7 | 4.8 | GO:0090232 | positive regulation of spindle checkpoint(GO:0090232) |
0.7 | 2.7 | GO:0045053 | protein retention in Golgi apparatus(GO:0045053) |
0.7 | 2.0 | GO:0015959 | diadenosine polyphosphate metabolic process(GO:0015959) |
0.7 | 1.4 | GO:0003344 | pericardium morphogenesis(GO:0003344) |
0.7 | 2.0 | GO:0090214 | spongiotrophoblast layer developmental growth(GO:0090214) |
0.7 | 0.7 | GO:0060318 | definitive erythrocyte differentiation(GO:0060318) |
0.7 | 2.7 | GO:0090032 | negative regulation of steroid hormone biosynthetic process(GO:0090032) |
0.7 | 0.7 | GO:1900222 | negative regulation of beta-amyloid clearance(GO:1900222) |
0.7 | 0.7 | GO:0070173 | regulation of enamel mineralization(GO:0070173) |
0.7 | 1.4 | GO:0031284 | positive regulation of guanylate cyclase activity(GO:0031284) |
0.7 | 2.7 | GO:0007340 | acrosome reaction(GO:0007340) |
0.7 | 2.7 | GO:0043985 | histone H4-R3 methylation(GO:0043985) |
0.7 | 6.7 | GO:0050434 | positive regulation of viral transcription(GO:0050434) |
0.7 | 1.3 | GO:0071947 | protein deubiquitination involved in ubiquitin-dependent protein catabolic process(GO:0071947) |
0.7 | 6.0 | GO:0060065 | uterus development(GO:0060065) |
0.7 | 0.7 | GO:2001055 | positive regulation of mesenchymal cell apoptotic process(GO:2001055) |
0.7 | 1.3 | GO:0060750 | epithelial cell proliferation involved in mammary gland duct elongation(GO:0060750) branch elongation involved in mammary gland duct branching(GO:0060751) |
0.7 | 7.3 | GO:1903077 | negative regulation of protein localization to plasma membrane(GO:1903077) negative regulation of protein localization to cell periphery(GO:1904376) |
0.7 | 0.7 | GO:2000574 | regulation of microtubule motor activity(GO:2000574) |
0.7 | 2.6 | GO:1902224 | ketone body metabolic process(GO:1902224) |
0.7 | 0.7 | GO:0014858 | positive regulation of skeletal muscle cell proliferation(GO:0014858) |
0.7 | 2.6 | GO:0070125 | mitochondrial translational elongation(GO:0070125) |
0.7 | 3.3 | GO:0071340 | skeletal muscle acetylcholine-gated channel clustering(GO:0071340) |
0.7 | 2.0 | GO:2000074 | regulation of type B pancreatic cell development(GO:2000074) |
0.7 | 2.0 | GO:0051918 | negative regulation of fibrinolysis(GO:0051918) |
0.7 | 2.6 | GO:0031584 | activation of phospholipase D activity(GO:0031584) |
0.6 | 1.9 | GO:0007089 | traversing start control point of mitotic cell cycle(GO:0007089) |
0.6 | 4.5 | GO:1902369 | negative regulation of RNA catabolic process(GO:1902369) |
0.6 | 3.2 | GO:0018230 | peptidyl-L-cysteine S-palmitoylation(GO:0018230) peptidyl-S-diacylglycerol-L-cysteine biosynthetic process from peptidyl-cysteine(GO:0018231) |
0.6 | 4.5 | GO:0043353 | enucleate erythrocyte differentiation(GO:0043353) |
0.6 | 0.6 | GO:1904177 | regulation of adipose tissue development(GO:1904177) |
0.6 | 1.9 | GO:0035963 | response to interleukin-13(GO:0035962) cellular response to interleukin-13(GO:0035963) |
0.6 | 1.3 | GO:0051182 | coenzyme transport(GO:0051182) |
0.6 | 4.5 | GO:0060586 | multicellular organismal iron ion homeostasis(GO:0060586) |
0.6 | 4.5 | GO:0031274 | positive regulation of pseudopodium assembly(GO:0031274) |
0.6 | 1.9 | GO:0042045 | epithelial fluid transport(GO:0042045) |
0.6 | 1.3 | GO:1902302 | regulation of potassium ion export(GO:1902302) |
0.6 | 1.3 | GO:0034395 | regulation of transcription from RNA polymerase II promoter in response to iron(GO:0034395) |
0.6 | 8.8 | GO:0015693 | magnesium ion transport(GO:0015693) |
0.6 | 1.3 | GO:0042977 | activation of JAK2 kinase activity(GO:0042977) |
0.6 | 2.5 | GO:0098795 | mRNA cleavage involved in gene silencing by miRNA(GO:0035279) mRNA cleavage involved in gene silencing(GO:0098795) |
0.6 | 1.9 | GO:0070458 | detoxification of nitrogen compound(GO:0051410) cellular detoxification of nitrogen compound(GO:0070458) |
0.6 | 7.5 | GO:0002507 | tolerance induction(GO:0002507) |
0.6 | 3.7 | GO:0046130 | purine nucleoside catabolic process(GO:0006152) purine ribonucleoside catabolic process(GO:0046130) |
0.6 | 0.6 | GO:0002051 | osteoblast fate commitment(GO:0002051) |
0.6 | 1.9 | GO:0035356 | cellular triglyceride homeostasis(GO:0035356) |
0.6 | 2.5 | GO:1900113 | negative regulation of histone H3-K9 trimethylation(GO:1900113) |
0.6 | 6.2 | GO:0050860 | negative regulation of T cell receptor signaling pathway(GO:0050860) |
0.6 | 3.7 | GO:0070863 | positive regulation of protein exit from endoplasmic reticulum(GO:0070863) |
0.6 | 3.7 | GO:0016081 | synaptic vesicle docking(GO:0016081) |
0.6 | 0.6 | GO:0048320 | axial mesoderm formation(GO:0048320) |
0.6 | 1.8 | GO:0002414 | immunoglobulin transcytosis in epithelial cells(GO:0002414) |
0.6 | 3.6 | GO:0090073 | positive regulation of protein homodimerization activity(GO:0090073) |
0.6 | 1.8 | GO:0031581 | hemidesmosome assembly(GO:0031581) |
0.6 | 1.2 | GO:0060213 | regulation of nuclear-transcribed mRNA poly(A) tail shortening(GO:0060211) positive regulation of nuclear-transcribed mRNA poly(A) tail shortening(GO:0060213) |
0.6 | 1.8 | GO:0072531 | pyrimidine-containing compound transmembrane transport(GO:0072531) |
0.6 | 5.4 | GO:0009191 | ribonucleoside diphosphate catabolic process(GO:0009191) |
0.6 | 0.6 | GO:0010749 | regulation of nitric oxide mediated signal transduction(GO:0010749) |
0.6 | 4.2 | GO:0001778 | plasma membrane repair(GO:0001778) |
0.6 | 1.2 | GO:0030913 | paranodal junction assembly(GO:0030913) |
0.6 | 1.8 | GO:0030576 | Cajal body organization(GO:0030576) |
0.6 | 0.6 | GO:0060872 | semicircular canal development(GO:0060872) |
0.6 | 5.4 | GO:0018904 | ether metabolic process(GO:0018904) |
0.6 | 0.6 | GO:2000321 | positive regulation of T-helper 17 cell differentiation(GO:2000321) |
0.6 | 2.4 | GO:0010869 | regulation of receptor biosynthetic process(GO:0010869) |
0.6 | 4.1 | GO:0060346 | bone trabecula formation(GO:0060346) |
0.6 | 1.2 | GO:0045723 | positive regulation of fatty acid biosynthetic process(GO:0045723) positive regulation of fatty acid metabolic process(GO:0045923) |
0.6 | 1.7 | GO:0072061 | inner medullary collecting duct development(GO:0072061) |
0.6 | 0.6 | GO:1904058 | positive regulation of sensory perception of pain(GO:1904058) |
0.6 | 3.5 | GO:0006703 | estrogen biosynthetic process(GO:0006703) |
0.6 | 0.6 | GO:0061343 | cell adhesion involved in heart morphogenesis(GO:0061343) |
0.6 | 1.7 | GO:0098908 | regulation of neuronal action potential(GO:0098908) |
0.6 | 4.0 | GO:0007097 | nuclear migration(GO:0007097) |
0.6 | 1.7 | GO:0009136 | ADP biosynthetic process(GO:0006172) purine nucleoside diphosphate biosynthetic process(GO:0009136) purine ribonucleoside diphosphate biosynthetic process(GO:0009180) |
0.6 | 1.7 | GO:0033623 | regulation of integrin activation(GO:0033623) |
0.6 | 1.7 | GO:1901475 | pyruvate transmembrane transport(GO:1901475) |
0.6 | 2.9 | GO:0032957 | inositol trisphosphate metabolic process(GO:0032957) |
0.6 | 0.6 | GO:0070309 | lens fiber cell morphogenesis(GO:0070309) |
0.6 | 0.6 | GO:1902075 | cellular response to salt(GO:1902075) |
0.6 | 1.7 | GO:0043435 | response to corticotropin-releasing hormone(GO:0043435) cellular response to corticotropin-releasing hormone stimulus(GO:0071376) |
0.6 | 2.8 | GO:0032570 | response to progesterone(GO:0032570) |
0.6 | 2.8 | GO:0031053 | primary miRNA processing(GO:0031053) |
0.6 | 4.5 | GO:0006855 | drug transmembrane transport(GO:0006855) |
0.6 | 0.6 | GO:0071351 | cellular response to interleukin-18(GO:0071351) |
0.6 | 1.1 | GO:0045110 | intermediate filament bundle assembly(GO:0045110) |
0.6 | 3.3 | GO:0060333 | interferon-gamma-mediated signaling pathway(GO:0060333) |
0.6 | 1.1 | GO:0060468 | prevention of polyspermy(GO:0060468) |
0.6 | 3.9 | GO:0043517 | positive regulation of DNA damage response, signal transduction by p53 class mediator(GO:0043517) |
0.6 | 0.6 | GO:0071624 | positive regulation of granulocyte chemotaxis(GO:0071624) |
0.6 | 3.3 | GO:0048681 | negative regulation of axon regeneration(GO:0048681) |
0.6 | 1.7 | GO:0072567 | chemokine (C-X-C motif) ligand 2 production(GO:0072567) |
0.6 | 2.2 | GO:2000301 | negative regulation of synaptic vesicle exocytosis(GO:2000301) |
0.6 | 0.6 | GO:0014835 | myoblast differentiation involved in skeletal muscle regeneration(GO:0014835) |
0.5 | 3.3 | GO:0030853 | negative regulation of granulocyte differentiation(GO:0030853) |
0.5 | 2.2 | GO:0051725 | protein de-ADP-ribosylation(GO:0051725) |
0.5 | 1.6 | GO:0015860 | purine nucleoside transmembrane transport(GO:0015860) purine-containing compound transmembrane transport(GO:0072530) nucleoside transmembrane transport(GO:1901642) |
0.5 | 1.1 | GO:0030951 | establishment or maintenance of microtubule cytoskeleton polarity(GO:0030951) |
0.5 | 8.2 | GO:0030322 | stabilization of membrane potential(GO:0030322) |
0.5 | 1.1 | GO:0043366 | beta selection(GO:0043366) |
0.5 | 2.7 | GO:0006620 | posttranslational protein targeting to membrane(GO:0006620) |
0.5 | 1.6 | GO:0048743 | positive regulation of skeletal muscle fiber development(GO:0048743) |
0.5 | 0.5 | GO:0003273 | cell migration involved in endocardial cushion formation(GO:0003273) |
0.5 | 1.6 | GO:0044362 | modulation of molecular function in other organism(GO:0044359) negative regulation of molecular function in other organism(GO:0044362) negative regulation of molecular function in other organism involved in symbiotic interaction(GO:0052204) modulation of molecular function in other organism involved in symbiotic interaction(GO:0052205) |
0.5 | 1.1 | GO:0006002 | fructose 6-phosphate metabolic process(GO:0006002) |
0.5 | 1.1 | GO:0042726 | flavin-containing compound metabolic process(GO:0042726) |
0.5 | 2.6 | GO:0001780 | neutrophil homeostasis(GO:0001780) |
0.5 | 1.6 | GO:0060687 | regulation of branching involved in prostate gland morphogenesis(GO:0060687) |
0.5 | 2.6 | GO:0045064 | T-helper 2 cell differentiation(GO:0045064) |
0.5 | 1.6 | GO:0046490 | isopentenyl diphosphate biosynthetic process(GO:0009240) isopentenyl diphosphate biosynthetic process, mevalonate pathway(GO:0019287) isopentenyl diphosphate metabolic process(GO:0046490) |
0.5 | 2.6 | GO:0030205 | dermatan sulfate metabolic process(GO:0030205) |
0.5 | 6.3 | GO:0044146 | negative regulation of growth of symbiont in host(GO:0044130) negative regulation of growth of symbiont involved in interaction with host(GO:0044146) |
0.5 | 1.6 | GO:0015747 | urate transport(GO:0015747) |
0.5 | 4.7 | GO:0097034 | mitochondrial respiratory chain complex IV assembly(GO:0033617) mitochondrial respiratory chain complex IV biogenesis(GO:0097034) |
0.5 | 0.5 | GO:0035461 | vitamin transmembrane transport(GO:0035461) |
0.5 | 5.7 | GO:0051016 | barbed-end actin filament capping(GO:0051016) |
0.5 | 0.5 | GO:0055099 | response to high density lipoprotein particle(GO:0055099) |
0.5 | 1.0 | GO:0034447 | regulation of very-low-density lipoprotein particle clearance(GO:0010915) negative regulation of very-low-density lipoprotein particle clearance(GO:0010916) very-low-density lipoprotein particle clearance(GO:0034447) |
0.5 | 0.5 | GO:0051156 | glucose 6-phosphate metabolic process(GO:0051156) |
0.5 | 6.2 | GO:0006047 | UDP-N-acetylglucosamine metabolic process(GO:0006047) |
0.5 | 2.1 | GO:0006004 | fucose metabolic process(GO:0006004) |
0.5 | 3.1 | GO:0071318 | cellular response to ATP(GO:0071318) |
0.5 | 1.5 | GO:1902309 | negative regulation of peptidyl-serine dephosphorylation(GO:1902309) |
0.5 | 0.5 | GO:0036166 | phenotypic switching(GO:0036166) |
0.5 | 1.5 | GO:2000483 | negative regulation of interleukin-8 secretion(GO:2000483) |
0.5 | 1.5 | GO:0035021 | negative regulation of Rac protein signal transduction(GO:0035021) |
0.5 | 1.0 | GO:0043116 | negative regulation of vascular permeability(GO:0043116) |
0.5 | 0.5 | GO:0071608 | macrophage inflammatory protein-1 alpha production(GO:0071608) |
0.5 | 9.1 | GO:0001574 | ganglioside biosynthetic process(GO:0001574) |
0.5 | 1.5 | GO:0032730 | positive regulation of interleukin-1 alpha production(GO:0032730) |
0.5 | 2.5 | GO:0001842 | neural fold formation(GO:0001842) |
0.5 | 3.0 | GO:0006689 | ganglioside catabolic process(GO:0006689) |
0.5 | 7.0 | GO:0050779 | RNA destabilization(GO:0050779) |
0.5 | 41.7 | GO:0035023 | regulation of Rho protein signal transduction(GO:0035023) |
0.5 | 0.5 | GO:0034116 | positive regulation of heterotypic cell-cell adhesion(GO:0034116) |
0.5 | 3.5 | GO:0015893 | drug transport(GO:0015893) |
0.5 | 1.5 | GO:0016259 | selenocysteine metabolic process(GO:0016259) |
0.5 | 2.0 | GO:2000647 | negative regulation of stem cell proliferation(GO:2000647) |
0.5 | 6.4 | GO:0006825 | copper ion transport(GO:0006825) |
0.5 | 2.0 | GO:1900121 | negative regulation of receptor binding(GO:1900121) |
0.5 | 1.0 | GO:0002826 | negative regulation of T-helper 1 type immune response(GO:0002826) |
0.5 | 1.5 | GO:0032463 | negative regulation of protein homooligomerization(GO:0032463) |
0.5 | 1.5 | GO:0044339 | canonical Wnt signaling pathway involved in osteoblast differentiation(GO:0044339) |
0.5 | 3.4 | GO:0032224 | positive regulation of synaptic transmission, cholinergic(GO:0032224) |
0.5 | 1.0 | GO:0034729 | histone H3-K79 methylation(GO:0034729) |
0.5 | 0.5 | GO:0050872 | white fat cell differentiation(GO:0050872) |
0.5 | 1.0 | GO:0072201 | negative regulation of mesenchymal cell proliferation(GO:0072201) |
0.5 | 3.4 | GO:0046069 | cGMP catabolic process(GO:0046069) |
0.5 | 2.0 | GO:0006572 | tyrosine catabolic process(GO:0006572) |
0.5 | 1.5 | GO:0071670 | smooth muscle cell chemotaxis(GO:0071670) |
0.5 | 1.5 | GO:0072367 | regulation of lipid transport by regulation of transcription from RNA polymerase II promoter(GO:0072367) |
0.5 | 1.5 | GO:0010626 | negative regulation of Schwann cell proliferation(GO:0010626) |
0.5 | 0.5 | GO:1904956 | regulation of midbrain dopaminergic neuron differentiation(GO:1904956) |
0.5 | 1.0 | GO:1901252 | regulation of intracellular transport of viral material(GO:1901252) |
0.5 | 3.4 | GO:0035520 | monoubiquitinated protein deubiquitination(GO:0035520) |
0.5 | 2.9 | GO:0060340 | positive regulation of type I interferon-mediated signaling pathway(GO:0060340) |
0.5 | 1.9 | GO:2000821 | regulation of grooming behavior(GO:2000821) |
0.5 | 0.5 | GO:2000319 | regulation of T-helper 17 cell differentiation(GO:2000319) |
0.5 | 2.9 | GO:0008300 | isoprenoid catabolic process(GO:0008300) |
0.5 | 1.0 | GO:0002238 | response to molecule of fungal origin(GO:0002238) |
0.5 | 1.4 | GO:0002930 | trabecular meshwork development(GO:0002930) |
0.5 | 3.8 | GO:0010388 | cullin deneddylation(GO:0010388) |
0.5 | 1.0 | GO:0072282 | metanephric nephron tubule morphogenesis(GO:0072282) |
0.5 | 1.0 | GO:0097033 | respiratory chain complex III assembly(GO:0017062) mitochondrial respiratory chain complex III assembly(GO:0034551) mitochondrial respiratory chain complex III biogenesis(GO:0097033) |
0.5 | 1.0 | GO:0044340 | canonical Wnt signaling pathway involved in regulation of cell proliferation(GO:0044340) |
0.5 | 0.5 | GO:0010520 | regulation of reciprocal meiotic recombination(GO:0010520) |
0.5 | 1.4 | GO:0060316 | positive regulation of ryanodine-sensitive calcium-release channel activity(GO:0060316) |
0.5 | 1.4 | GO:0006624 | vacuolar protein processing(GO:0006624) |
0.5 | 0.5 | GO:0002248 | connective tissue replacement involved in inflammatory response wound healing(GO:0002248) connective tissue replacement(GO:0097709) |
0.5 | 2.8 | GO:0005981 | regulation of glycogen catabolic process(GO:0005981) |
0.5 | 2.8 | GO:0006477 | protein sulfation(GO:0006477) |
0.5 | 6.6 | GO:0008299 | isoprenoid biosynthetic process(GO:0008299) |
0.5 | 1.9 | GO:0070842 | aggresome assembly(GO:0070842) |
0.5 | 6.1 | GO:0050892 | intestinal absorption(GO:0050892) |
0.5 | 7.1 | GO:0000301 | retrograde transport, vesicle recycling within Golgi(GO:0000301) |
0.5 | 1.4 | GO:0045899 | positive regulation of RNA polymerase II transcriptional preinitiation complex assembly(GO:0045899) |
0.5 | 1.9 | GO:0006369 | termination of RNA polymerase II transcription(GO:0006369) |
0.5 | 3.3 | GO:1904262 | negative regulation of TORC1 signaling(GO:1904262) |
0.5 | 0.9 | GO:0032729 | positive regulation of interferon-gamma production(GO:0032729) |
0.5 | 1.4 | GO:0043497 | regulation of protein heterodimerization activity(GO:0043497) |
0.5 | 5.2 | GO:0034389 | lipid particle organization(GO:0034389) |
0.5 | 3.3 | GO:0019367 | fatty acid elongation, saturated fatty acid(GO:0019367) fatty acid elongation, unsaturated fatty acid(GO:0019368) fatty acid elongation, monounsaturated fatty acid(GO:0034625) fatty acid elongation, polyunsaturated fatty acid(GO:0034626) |
0.5 | 3.3 | GO:0072364 | regulation of cellular ketone metabolic process by regulation of transcription from RNA polymerase II promoter(GO:0072364) |
0.5 | 0.5 | GO:0006549 | isoleucine metabolic process(GO:0006549) |
0.5 | 1.4 | GO:1904059 | regulation of locomotor rhythm(GO:1904059) |
0.5 | 4.2 | GO:0006516 | glycoprotein catabolic process(GO:0006516) |
0.5 | 1.9 | GO:1901029 | negative regulation of mitochondrial outer membrane permeabilization involved in apoptotic signaling pathway(GO:1901029) |
0.5 | 2.3 | GO:0050746 | regulation of lipoprotein metabolic process(GO:0050746) |
0.5 | 0.5 | GO:0042695 | thelarche(GO:0042695) mammary gland branching involved in thelarche(GO:0060744) |
0.5 | 0.9 | GO:0048633 | positive regulation of skeletal muscle tissue growth(GO:0048633) |
0.5 | 2.3 | GO:0015670 | carbon dioxide transport(GO:0015670) |
0.5 | 1.4 | GO:0043402 | glucocorticoid mediated signaling pathway(GO:0043402) |
0.5 | 2.3 | GO:0070940 | dephosphorylation of RNA polymerase II C-terminal domain(GO:0070940) |
0.5 | 1.8 | GO:0031915 | positive regulation of synaptic plasticity(GO:0031915) |
0.5 | 2.7 | GO:0090136 | epithelial cell-cell adhesion(GO:0090136) |
0.5 | 0.5 | GO:0039534 | negative regulation of MDA-5 signaling pathway(GO:0039534) |
0.5 | 0.5 | GO:0001705 | ectoderm formation(GO:0001705) |
0.5 | 6.4 | GO:0072348 | sulfur compound transport(GO:0072348) |
0.5 | 0.5 | GO:0014856 | skeletal muscle satellite cell proliferation(GO:0014841) regulation of skeletal muscle satellite cell proliferation(GO:0014842) skeletal muscle cell proliferation(GO:0014856) |
0.5 | 1.8 | GO:0006167 | AMP biosynthetic process(GO:0006167) |
0.5 | 0.5 | GO:1902455 | negative regulation of stem cell population maintenance(GO:1902455) |
0.5 | 3.6 | GO:0048671 | negative regulation of collateral sprouting(GO:0048671) |
0.5 | 1.4 | GO:0006903 | vesicle targeting(GO:0006903) |
0.5 | 7.2 | GO:0003351 | epithelial cilium movement(GO:0003351) |
0.5 | 0.9 | GO:0042668 | auditory receptor cell fate determination(GO:0042668) |
0.4 | 0.9 | GO:0060379 | cardiac muscle cell myoblast differentiation(GO:0060379) |
0.4 | 2.2 | GO:0032484 | Ral protein signal transduction(GO:0032484) |
0.4 | 1.3 | GO:0035810 | positive regulation of urine volume(GO:0035810) |
0.4 | 0.9 | GO:0006216 | cytidine catabolic process(GO:0006216) cytidine deamination(GO:0009972) cytidine metabolic process(GO:0046087) |
0.4 | 0.4 | GO:0034427 | nuclear-transcribed mRNA catabolic process, exonucleolytic, 3'-5'(GO:0034427) |
0.4 | 0.4 | GO:0001555 | oocyte growth(GO:0001555) |
0.4 | 37.0 | GO:0048706 | embryonic skeletal system development(GO:0048706) |
0.4 | 3.6 | GO:2000188 | regulation of cholesterol homeostasis(GO:2000188) |
0.4 | 0.9 | GO:0048319 | axial mesoderm morphogenesis(GO:0048319) |
0.4 | 0.4 | GO:0035733 | hepatic stellate cell activation(GO:0035733) |
0.4 | 8.5 | GO:0045214 | sarcomere organization(GO:0045214) |
0.4 | 0.4 | GO:0032347 | regulation of aldosterone biosynthetic process(GO:0032347) |
0.4 | 1.3 | GO:0071816 | protein insertion into ER membrane(GO:0045048) tail-anchored membrane protein insertion into ER membrane(GO:0071816) |
0.4 | 1.3 | GO:0030210 | heparin biosynthetic process(GO:0030210) |
0.4 | 9.7 | GO:0007143 | female meiotic division(GO:0007143) |
0.4 | 0.9 | GO:0002432 | granuloma formation(GO:0002432) |
0.4 | 2.6 | GO:0007175 | negative regulation of epidermal growth factor-activated receptor activity(GO:0007175) |
0.4 | 5.3 | GO:0034340 | response to type I interferon(GO:0034340) |
0.4 | 3.5 | GO:0007252 | I-kappaB phosphorylation(GO:0007252) |
0.4 | 6.5 | GO:0099517 | anterograde synaptic vesicle transport(GO:0048490) synaptic vesicle cytoskeletal transport(GO:0099514) synaptic vesicle transport along microtubule(GO:0099517) |
0.4 | 0.9 | GO:0070278 | extracellular matrix constituent secretion(GO:0070278) |
0.4 | 0.9 | GO:0052312 | modulation by host of viral transcription(GO:0043921) negative regulation by host of viral transcription(GO:0043922) modulation of transcription in other organism involved in symbiotic interaction(GO:0052312) modulation by host of symbiont transcription(GO:0052472) |
0.4 | 2.6 | GO:0060539 | diaphragm development(GO:0060539) |
0.4 | 0.4 | GO:0044793 | negative regulation by host of viral process(GO:0044793) |
0.4 | 0.4 | GO:0034434 | steroid esterification(GO:0034433) sterol esterification(GO:0034434) cholesterol esterification(GO:0034435) |
0.4 | 0.9 | GO:0034499 | late endosome to Golgi transport(GO:0034499) |
0.4 | 3.5 | GO:0071380 | cellular response to prostaglandin E stimulus(GO:0071380) |
0.4 | 0.9 | GO:0010712 | regulation of collagen metabolic process(GO:0010712) |
0.4 | 4.8 | GO:0097009 | energy homeostasis(GO:0097009) |
0.4 | 3.0 | GO:0043983 | histone H4-K12 acetylation(GO:0043983) |
0.4 | 0.9 | GO:0034139 | regulation of toll-like receptor 3 signaling pathway(GO:0034139) |
0.4 | 2.6 | GO:0048251 | elastic fiber assembly(GO:0048251) |
0.4 | 1.3 | GO:1900095 | regulation of dosage compensation by inactivation of X chromosome(GO:1900095) |
0.4 | 2.6 | GO:0031119 | tRNA pseudouridine synthesis(GO:0031119) |
0.4 | 0.4 | GO:0036462 | TRAIL-activated apoptotic signaling pathway(GO:0036462) |
0.4 | 2.1 | GO:0090161 | Golgi ribbon formation(GO:0090161) |
0.4 | 1.3 | GO:0090435 | protein localization to nuclear envelope(GO:0090435) |
0.4 | 1.7 | GO:0021631 | optic nerve morphogenesis(GO:0021631) |
0.4 | 1.3 | GO:0051987 | positive regulation of attachment of spindle microtubules to kinetochore(GO:0051987) |
0.4 | 0.8 | GO:0019346 | homoserine metabolic process(GO:0009092) transsulfuration(GO:0019346) |
0.4 | 1.7 | GO:0009838 | abscission(GO:0009838) |
0.4 | 3.4 | GO:0030277 | maintenance of gastrointestinal epithelium(GO:0030277) |
0.4 | 1.3 | GO:0006362 | transcription elongation from RNA polymerase I promoter(GO:0006362) |
0.4 | 0.8 | GO:0010748 | negative regulation of plasma membrane long-chain fatty acid transport(GO:0010748) |
0.4 | 1.3 | GO:1903912 | negative regulation of endoplasmic reticulum stress-induced eIF2 alpha phosphorylation(GO:1903912) |
0.4 | 1.3 | GO:0034393 | positive regulation of smooth muscle cell apoptotic process(GO:0034393) |
0.4 | 3.3 | GO:0071801 | regulation of podosome assembly(GO:0071801) |
0.4 | 1.3 | GO:0033387 | putrescine biosynthetic process from ornithine(GO:0033387) |
0.4 | 1.7 | GO:0002467 | germinal center formation(GO:0002467) |
0.4 | 0.4 | GO:0040037 | negative regulation of fibroblast growth factor receptor signaling pathway(GO:0040037) |
0.4 | 4.2 | GO:0006027 | glycosaminoglycan catabolic process(GO:0006027) |
0.4 | 2.9 | GO:0071398 | cellular response to fatty acid(GO:0071398) |
0.4 | 2.5 | GO:0032060 | bleb assembly(GO:0032060) |
0.4 | 1.2 | GO:1990036 | calcium ion import into sarcoplasmic reticulum(GO:1990036) |
0.4 | 2.5 | GO:0000920 | cell separation after cytokinesis(GO:0000920) |
0.4 | 1.6 | GO:0010510 | regulation of acetyl-CoA biosynthetic process from pyruvate(GO:0010510) regulation of acyl-CoA biosynthetic process(GO:0050812) |
0.4 | 0.8 | GO:0038145 | macrophage colony-stimulating factor signaling pathway(GO:0038145) |
0.4 | 1.2 | GO:0070162 | adiponectin secretion(GO:0070162) regulation of adiponectin secretion(GO:0070163) negative regulation of adiponectin secretion(GO:0070164) |
0.4 | 0.4 | GO:0070813 | hydrogen sulfide metabolic process(GO:0070813) |
0.4 | 3.7 | GO:0090312 | positive regulation of protein deacetylation(GO:0090312) |
0.4 | 0.8 | GO:1901668 | regulation of superoxide dismutase activity(GO:1901668) |
0.4 | 0.8 | GO:0046602 | regulation of mitotic centrosome separation(GO:0046602) |
0.4 | 0.4 | GO:1903689 | regulation of wound healing, spreading of epidermal cells(GO:1903689) |
0.4 | 2.4 | GO:2000480 | negative regulation of cAMP-dependent protein kinase activity(GO:2000480) |
0.4 | 0.8 | GO:0060527 | prostate glandular acinus morphogenesis(GO:0060526) prostate epithelial cord arborization involved in prostate glandular acinus morphogenesis(GO:0060527) |
0.4 | 1.2 | GO:0072017 | distal tubule development(GO:0072017) |
0.4 | 0.8 | GO:1904354 | negative regulation of telomere capping(GO:1904354) |
0.4 | 1.6 | GO:0032020 | ISG15-protein conjugation(GO:0032020) |
0.4 | 0.4 | GO:1900029 | positive regulation of ruffle assembly(GO:1900029) |
0.4 | 2.8 | GO:0032693 | negative regulation of interleukin-10 production(GO:0032693) |
0.4 | 0.4 | GO:0035898 | parathyroid hormone secretion(GO:0035898) |
0.4 | 0.8 | GO:0008588 | release of cytoplasmic sequestered NF-kappaB(GO:0008588) |
0.4 | 1.2 | GO:0010917 | negative regulation of mitochondrial membrane potential(GO:0010917) |
0.4 | 1.6 | GO:0097500 | receptor localization to nonmotile primary cilium(GO:0097500) |
0.4 | 3.2 | GO:0097120 | receptor localization to synapse(GO:0097120) |
0.4 | 0.4 | GO:0060618 | nipple development(GO:0060618) |
0.4 | 0.8 | GO:0060693 | regulation of branching involved in salivary gland morphogenesis(GO:0060693) |
0.4 | 4.4 | GO:0050994 | regulation of lipid catabolic process(GO:0050994) |
0.4 | 0.8 | GO:0009106 | lipoate metabolic process(GO:0009106) |
0.4 | 2.0 | GO:0044341 | sodium-dependent phosphate transport(GO:0044341) |
0.4 | 6.3 | GO:0006182 | cGMP biosynthetic process(GO:0006182) |
0.4 | 6.7 | GO:0033209 | tumor necrosis factor-mediated signaling pathway(GO:0033209) |
0.4 | 9.0 | GO:0048286 | lung alveolus development(GO:0048286) |
0.4 | 0.8 | GO:0014827 | intestine smooth muscle contraction(GO:0014827) |
0.4 | 0.8 | GO:0010838 | positive regulation of keratinocyte proliferation(GO:0010838) |
0.4 | 3.5 | GO:0000244 | spliceosomal tri-snRNP complex assembly(GO:0000244) |
0.4 | 0.4 | GO:0046874 | quinolinate metabolic process(GO:0046874) |
0.4 | 0.8 | GO:0002225 | positive regulation of antimicrobial peptide production(GO:0002225) positive regulation of antibacterial peptide production(GO:0002803) |
0.4 | 1.9 | GO:0051693 | actin filament capping(GO:0051693) |
0.4 | 9.3 | GO:0006911 | phagocytosis, engulfment(GO:0006911) |
0.4 | 0.8 | GO:0048386 | positive regulation of retinoic acid receptor signaling pathway(GO:0048386) |
0.4 | 0.4 | GO:0034454 | microtubule anchoring at centrosome(GO:0034454) |
0.4 | 1.5 | GO:0070102 | interleukin-6-mediated signaling pathway(GO:0070102) |
0.4 | 1.2 | GO:0035469 | determination of pancreatic left/right asymmetry(GO:0035469) determination of liver left/right asymmetry(GO:0071910) |
0.4 | 1.2 | GO:0038028 | insulin receptor signaling pathway via phosphatidylinositol 3-kinase(GO:0038028) |
0.4 | 1.9 | GO:0051549 | regulation of keratinocyte migration(GO:0051547) positive regulation of keratinocyte migration(GO:0051549) |
0.4 | 1.1 | GO:0098902 | regulation of membrane depolarization during action potential(GO:0098902) |
0.4 | 1.1 | GO:0006481 | C-terminal protein methylation(GO:0006481) |
0.4 | 1.1 | GO:0048199 | vesicle targeting, to, from or within Golgi(GO:0048199) |
0.4 | 0.8 | GO:0070127 | tRNA aminoacylation for mitochondrial protein translation(GO:0070127) |
0.4 | 1.1 | GO:1903288 | regulation of potassium ion import(GO:1903286) positive regulation of potassium ion import(GO:1903288) |
0.4 | 3.0 | GO:0006301 | postreplication repair(GO:0006301) |
0.4 | 1.1 | GO:0045651 | positive regulation of macrophage differentiation(GO:0045651) |
0.4 | 2.2 | GO:0042796 | snRNA transcription from RNA polymerase III promoter(GO:0042796) |
0.4 | 1.1 | GO:0033326 | cerebrospinal fluid secretion(GO:0033326) |
0.4 | 2.6 | GO:0060561 | apoptotic process involved in morphogenesis(GO:0060561) |
0.4 | 0.7 | GO:0070571 | negative regulation of neuron projection regeneration(GO:0070571) |
0.4 | 1.1 | GO:0019934 | cGMP-mediated signaling(GO:0019934) |
0.4 | 1.8 | GO:0003338 | metanephros morphogenesis(GO:0003338) |
0.4 | 1.1 | GO:0042488 | positive regulation of odontogenesis of dentin-containing tooth(GO:0042488) positive regulation of enamel mineralization(GO:0070175) |
0.4 | 0.4 | GO:2000302 | positive regulation of synaptic vesicle exocytosis(GO:2000302) |
0.4 | 3.3 | GO:0031294 | lymphocyte costimulation(GO:0031294) T cell costimulation(GO:0031295) |
0.4 | 1.5 | GO:0019509 | L-methionine biosynthetic process from methylthioadenosine(GO:0019509) |
0.4 | 2.5 | GO:0002076 | osteoblast development(GO:0002076) |
0.4 | 1.4 | GO:0043031 | negative regulation of macrophage activation(GO:0043031) |
0.4 | 3.2 | GO:0034377 | plasma lipoprotein particle assembly(GO:0034377) |
0.4 | 0.7 | GO:0001920 | negative regulation of receptor recycling(GO:0001920) |
0.4 | 1.4 | GO:2000810 | regulation of bicellular tight junction assembly(GO:2000810) |
0.4 | 0.4 | GO:1902430 | negative regulation of beta-amyloid formation(GO:1902430) |
0.4 | 1.8 | GO:0002082 | regulation of oxidative phosphorylation(GO:0002082) |
0.4 | 1.4 | GO:0001561 | fatty acid alpha-oxidation(GO:0001561) |
0.4 | 1.1 | GO:0002023 | reduction of food intake in response to dietary excess(GO:0002023) |
0.4 | 0.4 | GO:0070417 | cellular response to cold(GO:0070417) |
0.4 | 4.3 | GO:0006883 | cellular sodium ion homeostasis(GO:0006883) |
0.4 | 0.4 | GO:0034146 | toll-like receptor 5 signaling pathway(GO:0034146) |
0.4 | 0.4 | GO:0060426 | lung vasculature development(GO:0060426) |
0.4 | 0.7 | GO:0090051 | negative regulation of cell migration involved in sprouting angiogenesis(GO:0090051) |
0.4 | 1.1 | GO:0045063 | T-helper 1 cell differentiation(GO:0045063) |
0.4 | 1.4 | GO:0031508 | pericentric heterochromatin assembly(GO:0031508) |
0.4 | 0.7 | GO:0046321 | positive regulation of fatty acid oxidation(GO:0046321) |
0.4 | 2.8 | GO:0002862 | negative regulation of inflammatory response to antigenic stimulus(GO:0002862) |
0.4 | 1.8 | GO:1902231 | positive regulation of intrinsic apoptotic signaling pathway in response to DNA damage(GO:1902231) |
0.4 | 3.2 | GO:0035116 | embryonic hindlimb morphogenesis(GO:0035116) |
0.3 | 1.0 | GO:0035360 | regulation of peroxisome proliferator activated receptor signaling pathway(GO:0035358) positive regulation of peroxisome proliferator activated receptor signaling pathway(GO:0035360) |
0.3 | 0.3 | GO:0051562 | negative regulation of mitochondrial calcium ion concentration(GO:0051562) |
0.3 | 0.3 | GO:0042161 | lipoprotein modification(GO:0042160) lipoprotein oxidation(GO:0042161) |
0.3 | 2.8 | GO:0098719 | sodium ion import across plasma membrane(GO:0098719) sodium ion import into cell(GO:1990118) |
0.3 | 0.3 | GO:0072053 | renal inner medulla development(GO:0072053) |
0.3 | 1.7 | GO:0001946 | lymphangiogenesis(GO:0001946) lymph vessel morphogenesis(GO:0036303) |
0.3 | 1.0 | GO:0070681 | glutaminyl-tRNAGln biosynthesis via transamidation(GO:0070681) |
0.3 | 0.7 | GO:0001698 | gastrin-induced gastric acid secretion(GO:0001698) |
0.3 | 2.4 | GO:0035845 | photoreceptor cell outer segment organization(GO:0035845) |
0.3 | 1.4 | GO:0060394 | negative regulation of pathway-restricted SMAD protein phosphorylation(GO:0060394) |
0.3 | 0.7 | GO:0046959 | habituation(GO:0046959) |
0.3 | 2.4 | GO:2000601 | positive regulation of Arp2/3 complex-mediated actin nucleation(GO:2000601) |
0.3 | 0.3 | GO:0097167 | circadian regulation of translation(GO:0097167) |
0.3 | 3.4 | GO:0034260 | negative regulation of GTPase activity(GO:0034260) |
0.3 | 0.3 | GO:0060330 | regulation of response to interferon-gamma(GO:0060330) |
0.3 | 3.7 | GO:0046718 | viral entry into host cell(GO:0046718) |
0.3 | 1.0 | GO:0036444 | calcium ion transmembrane import into mitochondrion(GO:0036444) |
0.3 | 2.0 | GO:0061732 | mitochondrial acetyl-CoA biosynthetic process from pyruvate(GO:0061732) |
0.3 | 0.7 | GO:1903121 | regulation of TRAIL-activated apoptotic signaling pathway(GO:1903121) positive regulation of TRAIL-activated apoptotic signaling pathway(GO:1903984) |
0.3 | 1.0 | GO:0061302 | smooth muscle cell-matrix adhesion(GO:0061302) |
0.3 | 0.7 | GO:1904251 | regulation of bile acid metabolic process(GO:1904251) |
0.3 | 1.4 | GO:0001542 | ovulation from ovarian follicle(GO:0001542) |
0.3 | 3.0 | GO:0061049 | physiological muscle hypertrophy(GO:0003298) physiological cardiac muscle hypertrophy(GO:0003301) cell growth involved in cardiac muscle cell development(GO:0061049) |
0.3 | 1.4 | GO:0042663 | regulation of endodermal cell fate specification(GO:0042663) |
0.3 | 2.0 | GO:0060351 | cartilage development involved in endochondral bone morphogenesis(GO:0060351) |
0.3 | 1.0 | GO:1902036 | regulation of hematopoietic stem cell differentiation(GO:1902036) |
0.3 | 0.3 | GO:0043084 | penile erection(GO:0043084) |
0.3 | 1.3 | GO:1904181 | positive regulation of mitochondrial depolarization(GO:0051901) positive regulation of membrane depolarization(GO:1904181) |
0.3 | 2.4 | GO:0034505 | tooth mineralization(GO:0034505) |
0.3 | 1.0 | GO:0000185 | activation of MAPKKK activity(GO:0000185) |
0.3 | 1.3 | GO:0031507 | heterochromatin assembly(GO:0031507) |
0.3 | 1.0 | GO:0043152 | induction of bacterial agglutination(GO:0043152) |
0.3 | 0.3 | GO:0035771 | interleukin-4-mediated signaling pathway(GO:0035771) |
0.3 | 0.7 | GO:0021775 | smoothened signaling pathway involved in ventral spinal cord interneuron specification(GO:0021775) smoothened signaling pathway involved in spinal cord motor neuron cell fate specification(GO:0021776) |
0.3 | 5.0 | GO:0043171 | peptide catabolic process(GO:0043171) |
0.3 | 0.3 | GO:0055005 | ventricular cardiac myofibril assembly(GO:0055005) |
0.3 | 2.0 | GO:1902715 | positive regulation of interferon-gamma secretion(GO:1902715) |
0.3 | 2.7 | GO:0051570 | regulation of histone H3-K9 methylation(GO:0051570) |
0.3 | 1.0 | GO:2000249 | regulation of actin cytoskeleton reorganization(GO:2000249) |
0.3 | 0.3 | GO:2001185 | regulation of CD8-positive, alpha-beta T cell activation(GO:2001185) |
0.3 | 2.0 | GO:0006561 | proline biosynthetic process(GO:0006561) |
0.3 | 6.3 | GO:0006958 | complement activation, classical pathway(GO:0006958) |
0.3 | 0.7 | GO:0031914 | negative regulation of synaptic plasticity(GO:0031914) |
0.3 | 1.3 | GO:1903361 | protein localization to basolateral plasma membrane(GO:1903361) |
0.3 | 8.2 | GO:0019835 | cytolysis(GO:0019835) |
0.3 | 1.6 | GO:0009404 | toxin metabolic process(GO:0009404) |
0.3 | 1.6 | GO:0009235 | cobalamin metabolic process(GO:0009235) |
0.3 | 1.0 | GO:0014733 | regulation of skeletal muscle adaptation(GO:0014733) |
0.3 | 0.6 | GO:2000327 | regulation of ligand-dependent nuclear receptor transcription coactivator activity(GO:2000325) positive regulation of ligand-dependent nuclear receptor transcription coactivator activity(GO:2000327) |
0.3 | 5.8 | GO:0052696 | flavonoid biosynthetic process(GO:0009813) flavonoid glucuronidation(GO:0052696) |
0.3 | 0.6 | GO:0072606 | interleukin-8 secretion(GO:0072606) |
0.3 | 0.6 | GO:0035526 | retrograde transport, plasma membrane to Golgi(GO:0035526) |
0.3 | 3.2 | GO:0001833 | inner cell mass cell proliferation(GO:0001833) |
0.3 | 0.3 | GO:2000370 | positive regulation of clathrin-mediated endocytosis(GO:2000370) |
0.3 | 2.2 | GO:0016540 | protein autoprocessing(GO:0016540) |
0.3 | 0.3 | GO:0030948 | negative regulation of vascular endothelial growth factor receptor signaling pathway(GO:0030948) |
0.3 | 0.6 | GO:1901096 | regulation of autophagosome maturation(GO:1901096) |
0.3 | 1.3 | GO:0097105 | presynaptic membrane assembly(GO:0097105) |
0.3 | 4.8 | GO:0043046 | DNA methylation involved in gamete generation(GO:0043046) |
0.3 | 4.4 | GO:0032012 | ARF protein signal transduction(GO:0032011) regulation of ARF protein signal transduction(GO:0032012) |
0.3 | 0.6 | GO:0032286 | central nervous system myelin maintenance(GO:0032286) |
0.3 | 0.9 | GO:0090148 | membrane fission(GO:0090148) |
0.3 | 1.6 | GO:0050916 | sensory perception of sweet taste(GO:0050916) |
0.3 | 0.9 | GO:0060005 | vestibular reflex(GO:0060005) |
0.3 | 0.3 | GO:0071394 | cellular response to testosterone stimulus(GO:0071394) |
0.3 | 0.9 | GO:0006768 | biotin metabolic process(GO:0006768) |
0.3 | 0.3 | GO:0030916 | otic vesicle formation(GO:0030916) |
0.3 | 0.6 | GO:0048643 | positive regulation of skeletal muscle tissue development(GO:0048643) |
0.3 | 0.6 | GO:1903044 | protein localization to membrane raft(GO:1903044) |
0.3 | 1.3 | GO:0008089 | anterograde axonal transport(GO:0008089) |
0.3 | 23.8 | GO:0043401 | steroid hormone mediated signaling pathway(GO:0043401) |
0.3 | 0.6 | GO:0006651 | diacylglycerol biosynthetic process(GO:0006651) |
0.3 | 0.9 | GO:0019852 | L-ascorbic acid metabolic process(GO:0019852) |
0.3 | 2.8 | GO:0043011 | myeloid dendritic cell differentiation(GO:0043011) |
0.3 | 0.9 | GO:0006419 | alanyl-tRNA aminoacylation(GO:0006419) |
0.3 | 0.9 | GO:0000379 | tRNA-type intron splice site recognition and cleavage(GO:0000379) |
0.3 | 0.6 | GO:0044034 | negative stranded viral RNA replication(GO:0039689) multi-organism biosynthetic process(GO:0044034) |
0.3 | 2.2 | GO:1900745 | positive regulation of p38MAPK cascade(GO:1900745) |
0.3 | 0.3 | GO:0010155 | regulation of proton transport(GO:0010155) |
0.3 | 3.1 | GO:0045745 | positive regulation of G-protein coupled receptor protein signaling pathway(GO:0045745) |
0.3 | 1.2 | GO:0042985 | negative regulation of amyloid precursor protein biosynthetic process(GO:0042985) |
0.3 | 0.9 | GO:0006688 | glycosphingolipid biosynthetic process(GO:0006688) |
0.3 | 1.2 | GO:0071033 | nuclear retention of pre-mRNA at the site of transcription(GO:0071033) |
0.3 | 1.2 | GO:0042789 | mRNA transcription from RNA polymerase II promoter(GO:0042789) |
0.3 | 2.1 | GO:0009435 | NAD biosynthetic process(GO:0009435) |
0.3 | 0.3 | GO:0038095 | Fc-epsilon receptor signaling pathway(GO:0038095) |
0.3 | 1.5 | GO:0006699 | bile acid biosynthetic process(GO:0006699) |
0.3 | 0.3 | GO:0021586 | pons maturation(GO:0021586) |
0.3 | 0.6 | GO:0034374 | low-density lipoprotein particle remodeling(GO:0034374) |
0.3 | 0.9 | GO:0018094 | protein polyglycylation(GO:0018094) |
0.3 | 0.3 | GO:1904424 | regulation of GTP binding(GO:1904424) |
0.3 | 0.6 | GO:0048597 | post-embryonic camera-type eye morphogenesis(GO:0048597) |
0.3 | 2.7 | GO:0007288 | sperm axoneme assembly(GO:0007288) |
0.3 | 1.5 | GO:0060666 | dichotomous subdivision of terminal units involved in salivary gland branching(GO:0060666) |
0.3 | 1.2 | GO:0060406 | positive regulation of penile erection(GO:0060406) |
0.3 | 0.3 | GO:0060501 | positive regulation of epithelial cell proliferation involved in lung morphogenesis(GO:0060501) regulation of epithelial cell proliferation involved in lung morphogenesis(GO:2000794) |
0.3 | 0.6 | GO:0061511 | centriole elongation(GO:0061511) |
0.3 | 0.9 | GO:0043457 | regulation of cellular respiration(GO:0043457) |
0.3 | 0.6 | GO:0061525 | hindgut development(GO:0061525) |
0.3 | 1.5 | GO:0006346 | methylation-dependent chromatin silencing(GO:0006346) |
0.3 | 4.1 | GO:0071353 | cellular response to interleukin-4(GO:0071353) |
0.3 | 1.5 | GO:0097340 | inhibition of cysteine-type endopeptidase activity(GO:0097340) zymogen inhibition(GO:0097341) inhibition of cysteine-type endopeptidase activity involved in apoptotic process(GO:1990001) |
0.3 | 10.9 | GO:0051865 | protein autoubiquitination(GO:0051865) |
0.3 | 1.5 | GO:2000653 | regulation of genetic imprinting(GO:2000653) |
0.3 | 0.6 | GO:0060011 | Sertoli cell proliferation(GO:0060011) |
0.3 | 1.2 | GO:0060056 | mammary gland involution(GO:0060056) |
0.3 | 0.6 | GO:1903423 | positive regulation of synaptic vesicle recycling(GO:1903423) |
0.3 | 4.7 | GO:0033539 | fatty acid beta-oxidation using acyl-CoA dehydrogenase(GO:0033539) |
0.3 | 0.3 | GO:0042993 | positive regulation of transcription factor import into nucleus(GO:0042993) positive regulation of NFAT protein import into nucleus(GO:0051533) |
0.3 | 1.7 | GO:0000083 | regulation of transcription involved in G1/S transition of mitotic cell cycle(GO:0000083) |
0.3 | 3.5 | GO:0000737 | DNA catabolic process, endonucleolytic(GO:0000737) |
0.3 | 5.8 | GO:0006635 | fatty acid beta-oxidation(GO:0006635) |
0.3 | 0.3 | GO:0090239 | regulation of histone H4 acetylation(GO:0090239) |
0.3 | 0.6 | GO:0001915 | negative regulation of T cell mediated cytotoxicity(GO:0001915) |
0.3 | 0.3 | GO:0021913 | regulation of transcription from RNA polymerase II promoter involved in ventral spinal cord interneuron specification(GO:0021913) |
0.3 | 0.6 | GO:0001779 | natural killer cell differentiation(GO:0001779) |
0.3 | 0.9 | GO:0006438 | valyl-tRNA aminoacylation(GO:0006438) |
0.3 | 1.1 | GO:1901552 | positive regulation of endothelial cell development(GO:1901552) positive regulation of establishment of endothelial barrier(GO:1903142) |
0.3 | 1.4 | GO:1900119 | positive regulation of execution phase of apoptosis(GO:1900119) |
0.3 | 3.4 | GO:0043248 | proteasome assembly(GO:0043248) |
0.3 | 1.1 | GO:0043153 | entrainment of circadian clock by photoperiod(GO:0043153) |
0.3 | 0.6 | GO:0060907 | positive regulation of macrophage cytokine production(GO:0060907) |
0.3 | 0.3 | GO:0002339 | B cell selection(GO:0002339) |
0.3 | 0.8 | GO:0070314 | G1 to G0 transition(GO:0070314) |
0.3 | 0.8 | GO:0007343 | egg activation(GO:0007343) |
0.3 | 2.5 | GO:0006098 | pentose-phosphate shunt(GO:0006098) glyceraldehyde-3-phosphate metabolic process(GO:0019682) |
0.3 | 0.3 | GO:0006525 | arginine metabolic process(GO:0006525) |
0.3 | 0.8 | GO:0008594 | photoreceptor cell morphogenesis(GO:0008594) |
0.3 | 0.8 | GO:0060484 | lung-associated mesenchyme development(GO:0060484) |
0.3 | 0.8 | GO:0006420 | arginyl-tRNA aminoacylation(GO:0006420) |
0.3 | 0.6 | GO:0071727 | response to triacyl bacterial lipopeptide(GO:0071725) cellular response to triacyl bacterial lipopeptide(GO:0071727) |
0.3 | 1.4 | GO:0042535 | positive regulation of tumor necrosis factor biosynthetic process(GO:0042535) |
0.3 | 1.1 | GO:1990414 | replication-born double-strand break repair via sister chromatid exchange(GO:1990414) |
0.3 | 0.3 | GO:0071677 | positive regulation of mononuclear cell migration(GO:0071677) |
0.3 | 0.3 | GO:0060399 | positive regulation of growth hormone receptor signaling pathway(GO:0060399) |
0.3 | 7.2 | GO:0009410 | response to xenobiotic stimulus(GO:0009410) |
0.3 | 0.6 | GO:0061084 | regulation of protein refolding(GO:0061083) negative regulation of protein refolding(GO:0061084) |
0.3 | 0.3 | GO:0009988 | cell-cell recognition(GO:0009988) |
0.3 | 0.5 | GO:0042228 | interleukin-8 biosynthetic process(GO:0042228) |
0.3 | 0.5 | GO:0070212 | protein poly-ADP-ribosylation(GO:0070212) |
0.3 | 1.4 | GO:0070327 | thyroid hormone transport(GO:0070327) |
0.3 | 1.4 | GO:0033299 | secretion of lysosomal enzymes(GO:0033299) |
0.3 | 0.5 | GO:0048566 | embryonic digestive tract development(GO:0048566) |
0.3 | 0.5 | GO:0072337 | modified amino acid transport(GO:0072337) |
0.3 | 1.9 | GO:0010640 | regulation of platelet-derived growth factor receptor signaling pathway(GO:0010640) |
0.3 | 0.5 | GO:0060689 | cell differentiation involved in salivary gland development(GO:0060689) |
0.3 | 0.5 | GO:0006393 | termination of mitochondrial transcription(GO:0006393) |
0.3 | 0.5 | GO:0090244 | Wnt signaling pathway involved in somitogenesis(GO:0090244) |
0.3 | 0.8 | GO:0071447 | cellular response to hydroperoxide(GO:0071447) |
0.3 | 0.5 | GO:0002317 | plasma cell differentiation(GO:0002317) |
0.3 | 0.5 | GO:0070949 | regulation of neutrophil mediated cytotoxicity(GO:0070948) regulation of neutrophil mediated killing of symbiont cell(GO:0070949) |
0.3 | 0.8 | GO:0060760 | positive regulation of response to cytokine stimulus(GO:0060760) |
0.3 | 0.8 | GO:0034047 | regulation of protein phosphatase type 2A activity(GO:0034047) |
0.3 | 0.8 | GO:0042511 | positive regulation of tyrosine phosphorylation of Stat1 protein(GO:0042511) |
0.3 | 1.1 | GO:0034312 | diol biosynthetic process(GO:0034312) sphingosine biosynthetic process(GO:0046512) |
0.3 | 0.8 | GO:1903299 | regulation of hexokinase activity(GO:1903299) |
0.3 | 0.8 | GO:0042447 | hormone catabolic process(GO:0042447) |
0.3 | 1.6 | GO:0030878 | thyroid gland development(GO:0030878) |
0.3 | 3.2 | GO:0072661 | protein targeting to plasma membrane(GO:0072661) |
0.3 | 0.3 | GO:0032429 | regulation of phospholipase A2 activity(GO:0032429) |
0.3 | 1.3 | GO:0045540 | regulation of cholesterol biosynthetic process(GO:0045540) |
0.3 | 4.0 | GO:0035094 | response to nicotine(GO:0035094) |
0.3 | 1.3 | GO:0030033 | microvillus assembly(GO:0030033) |
0.3 | 0.3 | GO:0009111 | vitamin catabolic process(GO:0009111) fat-soluble vitamin catabolic process(GO:0042363) |
0.3 | 0.5 | GO:0038171 | cannabinoid signaling pathway(GO:0038171) endocannabinoid signaling pathway(GO:0071926) |
0.3 | 0.3 | GO:0045743 | positive regulation of fibroblast growth factor receptor signaling pathway(GO:0045743) |
0.3 | 0.3 | GO:0042473 | outer ear morphogenesis(GO:0042473) |
0.3 | 0.8 | GO:1900246 | positive regulation of RIG-I signaling pathway(GO:1900246) |
0.3 | 1.6 | GO:2000369 | regulation of clathrin-mediated endocytosis(GO:2000369) |
0.3 | 0.3 | GO:0061738 | late endosomal microautophagy(GO:0061738) |
0.3 | 1.0 | GO:0090666 | scaRNA localization to Cajal body(GO:0090666) |
0.3 | 0.5 | GO:0030239 | myofibril assembly(GO:0030239) |
0.3 | 1.6 | GO:0010324 | membrane invagination(GO:0010324) |
0.3 | 3.9 | GO:0043001 | Golgi to plasma membrane protein transport(GO:0043001) |
0.3 | 0.3 | GO:0042737 | drug catabolic process(GO:0042737) |
0.3 | 1.0 | GO:0010032 | meiotic chromosome condensation(GO:0010032) |
0.3 | 1.0 | GO:2001260 | regulation of semaphorin-plexin signaling pathway(GO:2001260) |
0.3 | 1.5 | GO:0090084 | negative regulation of inclusion body assembly(GO:0090084) |
0.3 | 2.5 | GO:0090022 | regulation of neutrophil chemotaxis(GO:0090022) |
0.3 | 0.8 | GO:0010614 | negative regulation of cardiac muscle hypertrophy(GO:0010614) |
0.3 | 0.5 | GO:2000479 | regulation of cAMP-dependent protein kinase activity(GO:2000479) |
0.3 | 0.5 | GO:2000758 | positive regulation of peptidyl-lysine acetylation(GO:2000758) |
0.3 | 1.0 | GO:0070475 | rRNA base methylation(GO:0070475) |
0.3 | 0.5 | GO:2001137 | positive regulation of endocytic recycling(GO:2001137) |
0.3 | 1.3 | GO:0032958 | inositol phosphate biosynthetic process(GO:0032958) |
0.3 | 0.8 | GO:0070827 | chromatin maintenance(GO:0070827) |
0.3 | 1.5 | GO:0043278 | response to isoquinoline alkaloid(GO:0014072) response to morphine(GO:0043278) |
0.2 | 0.5 | GO:0050703 | interleukin-1 alpha secretion(GO:0050703) |
0.2 | 0.7 | GO:0044597 | polyketide metabolic process(GO:0030638) aminoglycoside antibiotic metabolic process(GO:0030647) daunorubicin metabolic process(GO:0044597) doxorubicin metabolic process(GO:0044598) |
0.2 | 0.5 | GO:0090238 | positive regulation of arachidonic acid secretion(GO:0090238) |
0.2 | 0.5 | GO:0032290 | peripheral nervous system myelin formation(GO:0032290) |
0.2 | 0.2 | GO:0009648 | photoperiodism(GO:0009648) |
0.2 | 1.5 | GO:0036336 | dendritic cell migration(GO:0036336) |
0.2 | 0.2 | GO:0033632 | regulation of cell-cell adhesion mediated by integrin(GO:0033632) |
0.2 | 0.2 | GO:1901026 | ripoptosome assembly(GO:0097343) ripoptosome assembly involved in necroptotic process(GO:1901026) |
0.2 | 2.5 | GO:0015727 | lactate transport(GO:0015727) lactate transmembrane transport(GO:0035873) plasma membrane lactate transport(GO:0035879) |
0.2 | 3.2 | GO:0030865 | cortical cytoskeleton organization(GO:0030865) |
0.2 | 0.5 | GO:0072643 | interferon-gamma secretion(GO:0072643) |
0.2 | 4.4 | GO:0046854 | phosphatidylinositol phosphorylation(GO:0046854) |
0.2 | 0.2 | GO:2000650 | negative regulation of sodium ion transmembrane transporter activity(GO:2000650) |
0.2 | 0.2 | GO:0070375 | ERK5 cascade(GO:0070375) |
0.2 | 0.2 | GO:0051791 | medium-chain fatty acid metabolic process(GO:0051791) |
0.2 | 0.2 | GO:0003222 | ventricular trabecula myocardium morphogenesis(GO:0003222) |
0.2 | 1.5 | GO:0010718 | positive regulation of epithelial to mesenchymal transition(GO:0010718) |
0.2 | 0.7 | GO:0007158 | neuron cell-cell adhesion(GO:0007158) |
0.2 | 0.5 | GO:0045792 | negative regulation of cell size(GO:0045792) |
0.2 | 2.2 | GO:0001881 | receptor recycling(GO:0001881) |
0.2 | 0.2 | GO:0010992 | ubiquitin homeostasis(GO:0010992) |
0.2 | 0.5 | GO:0001573 | ganglioside metabolic process(GO:0001573) |
0.2 | 0.5 | GO:0034982 | mitochondrial protein processing(GO:0034982) |
0.2 | 1.0 | GO:0032459 | regulation of protein oligomerization(GO:0032459) |
0.2 | 0.7 | GO:1903964 | monounsaturated fatty acid metabolic process(GO:1903964) monounsaturated fatty acid biosynthetic process(GO:1903966) |
0.2 | 6.7 | GO:0031424 | keratinization(GO:0031424) |
0.2 | 0.2 | GO:0036065 | fucosylation(GO:0036065) |
0.2 | 2.2 | GO:0033198 | response to ATP(GO:0033198) |
0.2 | 1.2 | GO:0007016 | cytoskeletal anchoring at plasma membrane(GO:0007016) |
0.2 | 0.7 | GO:1902218 | intrinsic apoptotic signaling pathway in response to osmotic stress(GO:0008627) regulation of intrinsic apoptotic signaling pathway in response to osmotic stress(GO:1902218) negative regulation of intrinsic apoptotic signaling pathway in response to osmotic stress(GO:1902219) |
0.2 | 0.2 | GO:0001504 | neurotransmitter uptake(GO:0001504) |
0.2 | 0.7 | GO:0071712 | ER-associated misfolded protein catabolic process(GO:0071712) |
0.2 | 0.5 | GO:0051988 | regulation of attachment of spindle microtubules to kinetochore(GO:0051988) |
0.2 | 0.5 | GO:0006003 | fructose 2,6-bisphosphate metabolic process(GO:0006003) |
0.2 | 0.2 | GO:0060903 | positive regulation of meiosis I(GO:0060903) |
0.2 | 2.6 | GO:1900046 | regulation of blood coagulation(GO:0030193) regulation of hemostasis(GO:1900046) |
0.2 | 0.5 | GO:0021562 | vestibulocochlear nerve development(GO:0021562) |
0.2 | 0.5 | GO:0070307 | lens fiber cell development(GO:0070307) |
0.2 | 1.4 | GO:0006388 | tRNA splicing, via endonucleolytic cleavage and ligation(GO:0006388) |
0.2 | 0.9 | GO:0006104 | succinyl-CoA metabolic process(GO:0006104) |
0.2 | 2.4 | GO:0006122 | mitochondrial electron transport, ubiquinol to cytochrome c(GO:0006122) |
0.2 | 0.7 | GO:0009086 | methionine biosynthetic process(GO:0009086) |
0.2 | 0.2 | GO:0042226 | interleukin-6 biosynthetic process(GO:0042226) |
0.2 | 1.2 | GO:0006851 | mitochondrial calcium ion transport(GO:0006851) |
0.2 | 0.2 | GO:0032792 | negative regulation of CREB transcription factor activity(GO:0032792) |
0.2 | 3.9 | GO:0030488 | tRNA methylation(GO:0030488) |
0.2 | 0.5 | GO:1904683 | regulation of metalloendopeptidase activity(GO:1904683) |
0.2 | 0.5 | GO:0048102 | autophagic cell death(GO:0048102) |
0.2 | 7.1 | GO:0033141 | positive regulation of peptidyl-serine phosphorylation of STAT protein(GO:0033141) |
0.2 | 1.1 | GO:0042953 | lipoprotein transport(GO:0042953) lipoprotein localization(GO:0044872) |
0.2 | 0.5 | GO:0003203 | endocardial cushion morphogenesis(GO:0003203) |
0.2 | 0.9 | GO:0051461 | positive regulation of corticotropin secretion(GO:0051461) |
0.2 | 0.9 | GO:0051044 | positive regulation of membrane protein ectodomain proteolysis(GO:0051044) |
0.2 | 0.7 | GO:0043988 | histone H3-S28 phosphorylation(GO:0043988) |
0.2 | 0.2 | GO:0010940 | positive regulation of necrotic cell death(GO:0010940) |
0.2 | 0.2 | GO:1901563 | cellular response to camptothecin(GO:0072757) response to camptothecin(GO:1901563) |
0.2 | 2.9 | GO:0010842 | retina layer formation(GO:0010842) |
0.2 | 0.7 | GO:0061727 | methylglyoxal catabolic process to D-lactate via S-lactoyl-glutathione(GO:0019243) methylglyoxal catabolic process(GO:0051596) methylglyoxal catabolic process to lactate(GO:0061727) |
0.2 | 0.4 | GO:2000535 | entry of bacterium into host cell(GO:0035635) regulation of entry of bacterium into host cell(GO:2000535) |
0.2 | 0.4 | GO:0036089 | cleavage furrow formation(GO:0036089) |
0.2 | 0.4 | GO:0061146 | Peyer's patch morphogenesis(GO:0061146) |
0.2 | 1.1 | GO:0018401 | peptidyl-proline hydroxylation to 4-hydroxy-L-proline(GO:0018401) |
0.2 | 1.1 | GO:0045616 | regulation of keratinocyte differentiation(GO:0045616) |
0.2 | 0.7 | GO:0015697 | quaternary ammonium group transport(GO:0015697) |
0.2 | 4.4 | GO:0031018 | endocrine pancreas development(GO:0031018) |
0.2 | 0.7 | GO:0006116 | NADH oxidation(GO:0006116) |
0.2 | 0.4 | GO:0035022 | positive regulation of Rac protein signal transduction(GO:0035022) |
0.2 | 1.1 | GO:0003352 | regulation of cilium movement(GO:0003352) |
0.2 | 3.5 | GO:0043489 | RNA stabilization(GO:0043489) |
0.2 | 0.9 | GO:0050710 | negative regulation of cytokine secretion(GO:0050710) |
0.2 | 1.1 | GO:0006107 | oxaloacetate metabolic process(GO:0006107) |
0.2 | 0.2 | GO:0030222 | eosinophil differentiation(GO:0030222) |
0.2 | 0.9 | GO:1901660 | calcium ion export(GO:1901660) |
0.2 | 0.9 | GO:0007221 | positive regulation of transcription of Notch receptor target(GO:0007221) |
0.2 | 0.6 | GO:0060445 | branching involved in salivary gland morphogenesis(GO:0060445) |
0.2 | 1.7 | GO:0002504 | antigen processing and presentation of peptide antigen via MHC class II(GO:0002495) antigen processing and presentation of peptide or polysaccharide antigen via MHC class II(GO:0002504) |
0.2 | 1.1 | GO:0030834 | regulation of actin filament depolymerization(GO:0030834) |
0.2 | 0.2 | GO:0060449 | bud elongation involved in lung branching(GO:0060449) |
0.2 | 1.9 | GO:0097352 | autophagosome maturation(GO:0097352) |
0.2 | 0.4 | GO:0006742 | NADP catabolic process(GO:0006742) |
0.2 | 0.6 | GO:0002431 | Fc receptor mediated stimulatory signaling pathway(GO:0002431) |
0.2 | 0.2 | GO:0086046 | membrane depolarization during SA node cell action potential(GO:0086046) |
0.2 | 1.5 | GO:0031952 | regulation of protein autophosphorylation(GO:0031952) |
0.2 | 0.9 | GO:0042436 | tryptophan catabolic process(GO:0006569) tryptophan catabolic process to kynurenine(GO:0019441) indole-containing compound catabolic process(GO:0042436) indolalkylamine catabolic process(GO:0046218) |
0.2 | 0.2 | GO:1903207 | neuron death in response to hydrogen peroxide(GO:0036476) regulation of hydrogen peroxide-induced neuron death(GO:1903207) negative regulation of hydrogen peroxide-induced neuron death(GO:1903208) |
0.2 | 1.5 | GO:0042670 | retinal cone cell differentiation(GO:0042670) retinal cone cell development(GO:0046549) |
0.2 | 0.4 | GO:0060763 | mammary duct terminal end bud growth(GO:0060763) |
0.2 | 6.1 | GO:0035036 | sperm-egg recognition(GO:0035036) |
0.2 | 0.2 | GO:0009128 | purine nucleoside monophosphate catabolic process(GO:0009128) |
0.2 | 0.6 | GO:0008292 | acetylcholine biosynthetic process(GO:0008292) acetate ester biosynthetic process(GO:1900620) |
0.2 | 0.8 | GO:0009048 | dosage compensation(GO:0007549) dosage compensation by inactivation of X chromosome(GO:0009048) |
0.2 | 0.4 | GO:0070365 | hepatocyte differentiation(GO:0070365) |
0.2 | 0.2 | GO:0045719 | negative regulation of glycogen biosynthetic process(GO:0045719) |
0.2 | 3.5 | GO:0048013 | ephrin receptor signaling pathway(GO:0048013) |
0.2 | 0.2 | GO:0033687 | osteoblast proliferation(GO:0033687) |
0.2 | 0.4 | GO:0035372 | protein localization to microtubule(GO:0035372) |
0.2 | 0.4 | GO:0071442 | positive regulation of histone H3-K14 acetylation(GO:0071442) |
0.2 | 1.7 | GO:0036158 | outer dynein arm assembly(GO:0036158) |
0.2 | 0.6 | GO:0006391 | transcription initiation from mitochondrial promoter(GO:0006391) |
0.2 | 0.8 | GO:0071763 | nuclear membrane organization(GO:0071763) |
0.2 | 0.2 | GO:0031937 | positive regulation of chromatin silencing(GO:0031937) |
0.2 | 1.4 | GO:0022027 | interkinetic nuclear migration(GO:0022027) |
0.2 | 0.4 | GO:2000721 | positive regulation of transcription from RNA polymerase II promoter involved in smooth muscle cell differentiation(GO:2000721) |
0.2 | 1.2 | GO:0071468 | cellular response to acidic pH(GO:0071468) |
0.2 | 1.2 | GO:0034501 | protein localization to kinetochore(GO:0034501) |
0.2 | 0.6 | GO:0072111 | cell proliferation involved in kidney development(GO:0072111) positive regulation of cell proliferation involved in kidney development(GO:1901724) |
0.2 | 1.4 | GO:0018027 | peptidyl-lysine dimethylation(GO:0018027) |
0.2 | 1.2 | GO:0045672 | positive regulation of osteoclast differentiation(GO:0045672) |
0.2 | 2.0 | GO:0006465 | signal peptide processing(GO:0006465) |
0.2 | 0.8 | GO:0051443 | positive regulation of ubiquitin-protein transferase activity(GO:0051443) |
0.2 | 0.4 | GO:0070542 | response to fatty acid(GO:0070542) |
0.2 | 0.6 | GO:0061086 | negative regulation of histone H3-K27 methylation(GO:0061086) |
0.2 | 0.4 | GO:0032367 | intracellular cholesterol transport(GO:0032367) |
0.2 | 0.2 | GO:0033087 | negative regulation of immature T cell proliferation(GO:0033087) |
0.2 | 1.2 | GO:0002566 | somatic diversification of immune receptors via somatic mutation(GO:0002566) |
0.2 | 1.8 | GO:0060008 | Sertoli cell differentiation(GO:0060008) |
0.2 | 0.4 | GO:0021698 | cerebellar cortex structural organization(GO:0021698) |
0.2 | 1.0 | GO:0019627 | urea metabolic process(GO:0019627) |
0.2 | 0.8 | GO:0080154 | regulation of fertilization(GO:0080154) |
0.2 | 0.2 | GO:0072210 | metanephric nephron development(GO:0072210) |
0.2 | 0.8 | GO:0046541 | saliva secretion(GO:0046541) |
0.2 | 0.4 | GO:0033630 | positive regulation of cell adhesion mediated by integrin(GO:0033630) |
0.2 | 0.2 | GO:0072071 | mesangial cell differentiation(GO:0072007) kidney interstitial fibroblast differentiation(GO:0072071) renal interstitial fibroblast development(GO:0072141) mesangial cell development(GO:0072143) |
0.2 | 0.6 | GO:0038165 | oncostatin-M-mediated signaling pathway(GO:0038165) |
0.2 | 0.4 | GO:0008063 | Toll signaling pathway(GO:0008063) |
0.2 | 3.3 | GO:0006890 | retrograde vesicle-mediated transport, Golgi to ER(GO:0006890) |
0.2 | 0.4 | GO:0010758 | regulation of macrophage chemotaxis(GO:0010758) |
0.2 | 0.4 | GO:0000731 | DNA synthesis involved in DNA repair(GO:0000731) |
0.2 | 2.0 | GO:0010831 | positive regulation of myotube differentiation(GO:0010831) |
0.2 | 0.4 | GO:0032897 | negative regulation of viral transcription(GO:0032897) |
0.2 | 0.6 | GO:0007039 | protein catabolic process in the vacuole(GO:0007039) |
0.2 | 0.6 | GO:0030578 | PML body organization(GO:0030578) |
0.2 | 0.4 | GO:0060352 | cell adhesion molecule production(GO:0060352) |
0.2 | 0.6 | GO:0018199 | peptidyl-glutamine modification(GO:0018199) |
0.2 | 0.2 | GO:0097527 | necroptotic signaling pathway(GO:0097527) |
0.2 | 0.4 | GO:0032418 | lysosome localization(GO:0032418) |
0.2 | 1.2 | GO:0033262 | regulation of nuclear cell cycle DNA replication(GO:0033262) |
0.2 | 0.2 | GO:0010606 | positive regulation of cytoplasmic mRNA processing body assembly(GO:0010606) |
0.2 | 0.8 | GO:0051534 | negative regulation of NFAT protein import into nucleus(GO:0051534) |
0.2 | 0.2 | GO:1903421 | regulation of synaptic vesicle recycling(GO:1903421) |
0.2 | 1.0 | GO:0045056 | transcytosis(GO:0045056) |
0.2 | 0.6 | GO:0042359 | vitamin D metabolic process(GO:0042359) |
0.2 | 1.0 | GO:0031579 | membrane raft organization(GO:0031579) |
0.2 | 1.0 | GO:0048149 | behavioral response to ethanol(GO:0048149) |
0.2 | 6.1 | GO:0000462 | maturation of SSU-rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000462) |
0.2 | 2.3 | GO:1990403 | embryonic brain development(GO:1990403) |
0.2 | 0.2 | GO:0043589 | skin morphogenesis(GO:0043589) |
0.2 | 0.9 | GO:0045838 | positive regulation of membrane potential(GO:0045838) |
0.2 | 0.2 | GO:1901380 | negative regulation of potassium ion transmembrane transport(GO:1901380) |
0.2 | 0.4 | GO:0070741 | response to interleukin-6(GO:0070741) |
0.2 | 0.8 | GO:0071364 | cellular response to epidermal growth factor stimulus(GO:0071364) |
0.2 | 0.2 | GO:1902513 | regulation of organelle transport along microtubule(GO:1902513) |
0.2 | 0.6 | GO:0035989 | tendon development(GO:0035989) |
0.2 | 0.2 | GO:0090154 | positive regulation of sphingolipid biosynthetic process(GO:0090154) positive regulation of ceramide biosynthetic process(GO:2000304) |
0.2 | 3.6 | GO:0015914 | phospholipid transport(GO:0015914) |
0.2 | 0.7 | GO:0030539 | male genitalia development(GO:0030539) |
0.2 | 0.2 | GO:0051466 | positive regulation of corticotropin-releasing hormone secretion(GO:0051466) |
0.2 | 1.7 | GO:1901264 | carbohydrate derivative transport(GO:1901264) |
0.2 | 0.6 | GO:0035459 | cargo loading into vesicle(GO:0035459) cargo loading into COPII-coated vesicle(GO:0090110) |
0.2 | 0.7 | GO:0001867 | complement activation, lectin pathway(GO:0001867) |
0.2 | 0.6 | GO:0070474 | positive regulation of uterine smooth muscle contraction(GO:0070474) |
0.2 | 0.2 | GO:0006987 | activation of signaling protein activity involved in unfolded protein response(GO:0006987) |
0.2 | 2.4 | GO:1901998 | toxin transport(GO:1901998) |
0.2 | 3.5 | GO:0006749 | glutathione metabolic process(GO:0006749) |
0.2 | 1.1 | GO:0032272 | negative regulation of protein polymerization(GO:0032272) |
0.2 | 0.9 | GO:0042270 | protection from natural killer cell mediated cytotoxicity(GO:0042270) |
0.2 | 7.1 | GO:0051216 | cartilage development(GO:0051216) |
0.2 | 0.4 | GO:0006285 | base-excision repair, AP site formation(GO:0006285) |
0.2 | 0.4 | GO:0030886 | negative regulation of myeloid dendritic cell activation(GO:0030886) |
0.2 | 1.6 | GO:1903556 | negative regulation of tumor necrosis factor superfamily cytokine production(GO:1903556) |
0.2 | 0.5 | GO:0034643 | establishment of mitochondrion localization, microtubule-mediated(GO:0034643) mitochondrion transport along microtubule(GO:0047497) |
0.2 | 1.3 | GO:0008209 | androgen metabolic process(GO:0008209) |
0.2 | 0.9 | GO:0030220 | platelet formation(GO:0030220) |
0.2 | 0.5 | GO:0061304 | retinal blood vessel morphogenesis(GO:0061304) |
0.2 | 0.2 | GO:0032682 | negative regulation of chemokine production(GO:0032682) |
0.2 | 1.4 | GO:0006884 | cell volume homeostasis(GO:0006884) |
0.2 | 0.4 | GO:0001956 | positive regulation of neurotransmitter secretion(GO:0001956) |
0.2 | 0.7 | GO:0060767 | epithelial cell proliferation involved in prostate gland development(GO:0060767) |
0.2 | 0.2 | GO:0035865 | response to potassium ion(GO:0035864) cellular response to potassium ion(GO:0035865) |
0.2 | 0.4 | GO:0010574 | regulation of vascular endothelial growth factor production(GO:0010574) |
0.2 | 0.2 | GO:0031061 | negative regulation of histone methylation(GO:0031061) |
0.2 | 0.2 | GO:0014816 | skeletal muscle satellite cell differentiation(GO:0014816) |
0.2 | 0.2 | GO:0097283 | keratinocyte apoptotic process(GO:0097283) regulation of keratinocyte apoptotic process(GO:1902172) |
0.2 | 0.7 | GO:0021523 | somatic motor neuron differentiation(GO:0021523) |
0.2 | 0.7 | GO:0002755 | MyD88-dependent toll-like receptor signaling pathway(GO:0002755) |
0.2 | 0.9 | GO:0016255 | attachment of GPI anchor to protein(GO:0016255) |
0.2 | 0.2 | GO:0097284 | hepatocyte apoptotic process(GO:0097284) |
0.2 | 0.9 | GO:0007028 | cytoplasm organization(GO:0007028) |
0.2 | 2.6 | GO:0008631 | intrinsic apoptotic signaling pathway in response to oxidative stress(GO:0008631) |
0.2 | 0.5 | GO:0009249 | protein lipoylation(GO:0009249) |
0.2 | 0.2 | GO:0071218 | cellular response to misfolded protein(GO:0071218) |
0.2 | 0.2 | GO:0060648 | mammary gland bud morphogenesis(GO:0060648) |
0.2 | 1.2 | GO:0007266 | Rho protein signal transduction(GO:0007266) |
0.2 | 4.6 | GO:0002474 | antigen processing and presentation of peptide antigen via MHC class I(GO:0002474) |
0.2 | 0.7 | GO:2000778 | positive regulation of interleukin-6 secretion(GO:2000778) |
0.2 | 1.7 | GO:0070208 | protein heterotrimerization(GO:0070208) |
0.2 | 2.1 | GO:0009994 | oocyte differentiation(GO:0009994) |
0.2 | 0.2 | GO:0030007 | cellular potassium ion homeostasis(GO:0030007) |
0.2 | 0.2 | GO:0036091 | positive regulation of transcription from RNA polymerase II promoter in response to oxidative stress(GO:0036091) |
0.2 | 0.3 | GO:0033194 | response to hydroperoxide(GO:0033194) |
0.2 | 0.9 | GO:0006398 | mRNA 3'-end processing by stem-loop binding and cleavage(GO:0006398) |
0.2 | 0.5 | GO:0046085 | adenosine metabolic process(GO:0046085) |
0.2 | 0.8 | GO:0060350 | endochondral bone morphogenesis(GO:0060350) |
0.2 | 0.3 | GO:0008298 | intracellular mRNA localization(GO:0008298) |
0.2 | 0.2 | GO:0000320 | re-entry into mitotic cell cycle(GO:0000320) |
0.2 | 0.8 | GO:0010863 | positive regulation of phospholipase C activity(GO:0010863) |
0.2 | 0.2 | GO:0036515 | serotonergic neuron axon guidance(GO:0036515) |
0.2 | 0.7 | GO:2000210 | positive regulation of anoikis(GO:2000210) |
0.2 | 0.5 | GO:2000052 | positive regulation of non-canonical Wnt signaling pathway(GO:2000052) |
0.2 | 5.3 | GO:0072332 | intrinsic apoptotic signaling pathway by p53 class mediator(GO:0072332) |
0.2 | 1.7 | GO:0046839 | phospholipid dephosphorylation(GO:0046839) |
0.2 | 0.3 | GO:0070544 | histone H3-K36 demethylation(GO:0070544) |
0.2 | 0.3 | GO:0032460 | negative regulation of protein oligomerization(GO:0032460) |
0.2 | 0.2 | GO:0045987 | positive regulation of smooth muscle contraction(GO:0045987) |
0.2 | 0.5 | GO:0019464 | glycine catabolic process(GO:0006546) glycine decarboxylation via glycine cleavage system(GO:0019464) |
0.2 | 0.5 | GO:0010756 | positive regulation of plasminogen activation(GO:0010756) |
0.2 | 0.7 | GO:0010457 | centriole-centriole cohesion(GO:0010457) |
0.2 | 0.2 | GO:1903541 | regulation of exosomal secretion(GO:1903541) positive regulation of exosomal secretion(GO:1903543) |
0.2 | 0.2 | GO:2000643 | positive regulation of early endosome to late endosome transport(GO:2000643) |
0.2 | 0.6 | GO:2001241 | positive regulation of extrinsic apoptotic signaling pathway in absence of ligand(GO:2001241) |
0.2 | 1.3 | GO:0061462 | protein localization to lysosome(GO:0061462) |
0.2 | 0.3 | GO:0021520 | spinal cord motor neuron cell fate specification(GO:0021520) |
0.2 | 0.2 | GO:0045585 | regulation of cytotoxic T cell differentiation(GO:0045583) positive regulation of cytotoxic T cell differentiation(GO:0045585) |
0.2 | 3.5 | GO:0050830 | defense response to Gram-positive bacterium(GO:0050830) |
0.2 | 1.3 | GO:0048873 | homeostasis of number of cells within a tissue(GO:0048873) |
0.2 | 0.8 | GO:0046184 | aldehyde biosynthetic process(GO:0046184) |
0.2 | 0.5 | GO:0061028 | establishment of endothelial barrier(GO:0061028) |
0.2 | 1.1 | GO:0010543 | regulation of platelet activation(GO:0010543) |
0.2 | 0.2 | GO:0060193 | positive regulation of lipase activity(GO:0060193) |
0.2 | 0.2 | GO:0033058 | directional locomotion(GO:0033058) |
0.2 | 0.5 | GO:0043200 | response to amino acid(GO:0043200) |
0.2 | 1.7 | GO:0001963 | synaptic transmission, dopaminergic(GO:0001963) |
0.2 | 0.3 | GO:0019530 | taurine metabolic process(GO:0019530) |
0.2 | 1.3 | GO:0000059 | protein import into nucleus, docking(GO:0000059) |
0.2 | 5.3 | GO:0006959 | humoral immune response(GO:0006959) |
0.2 | 0.2 | GO:1901970 | positive regulation of mitotic sister chromatid separation(GO:1901970) |
0.2 | 0.5 | GO:0016576 | histone dephosphorylation(GO:0016576) |
0.2 | 1.4 | GO:0048172 | regulation of short-term neuronal synaptic plasticity(GO:0048172) |
0.2 | 0.2 | GO:0010452 | histone H3-K36 methylation(GO:0010452) |
0.2 | 1.7 | GO:0001954 | positive regulation of cell-matrix adhesion(GO:0001954) |
0.2 | 0.6 | GO:0060177 | regulation of angiotensin metabolic process(GO:0060177) |
0.2 | 0.2 | GO:0065001 | specification of axis polarity(GO:0065001) |
0.2 | 0.6 | GO:0046037 | GMP metabolic process(GO:0046037) |
0.2 | 0.3 | GO:0045909 | positive regulation of vasodilation(GO:0045909) |
0.2 | 0.3 | GO:0070570 | regulation of neuron projection regeneration(GO:0070570) |
0.2 | 0.5 | GO:0090385 | phagosome-lysosome fusion(GO:0090385) |
0.2 | 2.4 | GO:0048791 | calcium ion-regulated exocytosis of neurotransmitter(GO:0048791) |
0.2 | 0.2 | GO:0090400 | stress-induced premature senescence(GO:0090400) |
0.2 | 0.5 | GO:0015705 | iodide transport(GO:0015705) |
0.2 | 0.5 | GO:0002251 | organ or tissue specific immune response(GO:0002251) |
0.2 | 0.2 | GO:0030050 | vesicle transport along actin filament(GO:0030050) |
0.2 | 0.2 | GO:0022615 | protein to membrane docking(GO:0022615) |
0.1 | 0.4 | GO:0031536 | positive regulation of exit from mitosis(GO:0031536) |
0.1 | 1.2 | GO:1903859 | regulation of dendrite extension(GO:1903859) positive regulation of dendrite extension(GO:1903861) |
0.1 | 0.1 | GO:0031860 | telomeric 3' overhang formation(GO:0031860) |
0.1 | 0.6 | GO:0060742 | epithelial cell differentiation involved in prostate gland development(GO:0060742) |
0.1 | 0.3 | GO:0048859 | formation of anatomical boundary(GO:0048859) |
0.1 | 0.4 | GO:0044375 | regulation of peroxisome size(GO:0044375) |
0.1 | 0.4 | GO:0031340 | positive regulation of vesicle fusion(GO:0031340) |
0.1 | 0.4 | GO:0045721 | negative regulation of gluconeogenesis(GO:0045721) |
0.1 | 1.5 | GO:0000463 | maturation of LSU-rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000463) |
0.1 | 0.1 | GO:0000963 | mitochondrial RNA processing(GO:0000963) |
0.1 | 1.0 | GO:0071027 | nuclear RNA surveillance(GO:0071027) nuclear mRNA surveillance(GO:0071028) |
0.1 | 0.6 | GO:0060236 | regulation of mitotic spindle organization(GO:0060236) |
0.1 | 0.1 | GO:0097186 | amelogenesis(GO:0097186) |
0.1 | 0.6 | GO:0070837 | dehydroascorbic acid transport(GO:0070837) |
0.1 | 0.1 | GO:0008078 | mesodermal cell migration(GO:0008078) |
0.1 | 0.1 | GO:0046449 | creatinine metabolic process(GO:0046449) cellular lactam metabolic process(GO:0072338) |
0.1 | 0.6 | GO:0030890 | positive regulation of B cell proliferation(GO:0030890) |
0.1 | 0.1 | GO:0070562 | regulation of vitamin D receptor signaling pathway(GO:0070562) |
0.1 | 0.1 | GO:0098528 | skeletal muscle fiber differentiation(GO:0098528) |
0.1 | 0.1 | GO:1901798 | positive regulation of signal transduction by p53 class mediator(GO:1901798) |
0.1 | 0.1 | GO:0009313 | oligosaccharide catabolic process(GO:0009313) |
0.1 | 0.1 | GO:0098543 | detection of bacterium(GO:0016045) detection of other organism(GO:0098543) |
0.1 | 0.1 | GO:2000047 | regulation of cell-cell adhesion mediated by cadherin(GO:2000047) |
0.1 | 0.6 | GO:0097428 | protein maturation by iron-sulfur cluster transfer(GO:0097428) |
0.1 | 1.7 | GO:1904292 | regulation of ERAD pathway(GO:1904292) |
0.1 | 0.4 | GO:0006910 | phagocytosis, recognition(GO:0006910) |
0.1 | 2.4 | GO:0045600 | positive regulation of fat cell differentiation(GO:0045600) |
0.1 | 0.4 | GO:0060285 | cilium or flagellum-dependent cell motility(GO:0001539) cilium-dependent cell motility(GO:0060285) |
0.1 | 0.6 | GO:0051026 | chiasma assembly(GO:0051026) |
0.1 | 0.3 | GO:0046984 | regulation of hemoglobin biosynthetic process(GO:0046984) |
0.1 | 0.1 | GO:0060900 | embryonic camera-type eye formation(GO:0060900) |
0.1 | 1.3 | GO:0030199 | collagen fibril organization(GO:0030199) |
0.1 | 0.4 | GO:0003094 | glomerular filtration(GO:0003094) |
0.1 | 0.3 | GO:0033169 | histone H3-K9 demethylation(GO:0033169) |
0.1 | 0.4 | GO:0007084 | mitotic nuclear envelope reassembly(GO:0007084) |
0.1 | 0.1 | GO:0048845 | venous blood vessel morphogenesis(GO:0048845) |
0.1 | 0.1 | GO:0045065 | cytotoxic T cell differentiation(GO:0045065) |
0.1 | 0.4 | GO:0050832 | defense response to fungus(GO:0050832) |
0.1 | 0.3 | GO:0043045 | DNA methylation involved in embryo development(GO:0043045) changes to DNA methylation involved in embryo development(GO:1901538) |
0.1 | 1.2 | GO:0090200 | positive regulation of release of cytochrome c from mitochondria(GO:0090200) |
0.1 | 0.3 | GO:0001782 | B cell homeostasis(GO:0001782) |
0.1 | 1.4 | GO:0046683 | response to organophosphorus(GO:0046683) |
0.1 | 0.1 | GO:0042360 | vitamin E metabolic process(GO:0042360) |
0.1 | 0.9 | GO:0001937 | negative regulation of endothelial cell proliferation(GO:0001937) |
0.1 | 0.1 | GO:2000546 | cell chemotaxis to fibroblast growth factor(GO:0035766) endothelial cell chemotaxis to fibroblast growth factor(GO:0035768) regulation of cell chemotaxis to fibroblast growth factor(GO:1904847) positive regulation of cell chemotaxis to fibroblast growth factor(GO:1904849) regulation of endothelial cell chemotaxis to fibroblast growth factor(GO:2000544) positive regulation of endothelial cell chemotaxis to fibroblast growth factor(GO:2000546) |
0.1 | 0.4 | GO:0031055 | chromatin remodeling at centromere(GO:0031055) |
0.1 | 4.5 | GO:0042147 | retrograde transport, endosome to Golgi(GO:0042147) |
0.1 | 0.4 | GO:0030917 | midbrain-hindbrain boundary development(GO:0030917) |
0.1 | 0.1 | GO:0048318 | axial mesoderm development(GO:0048318) |
0.1 | 0.4 | GO:0008535 | respiratory chain complex IV assembly(GO:0008535) |
0.1 | 0.1 | GO:0061154 | endothelial tube morphogenesis(GO:0061154) |
0.1 | 1.2 | GO:0043551 | regulation of phosphatidylinositol 3-kinase activity(GO:0043551) |
0.1 | 0.1 | GO:2000015 | regulation of determination of dorsal identity(GO:2000015) |
0.1 | 0.4 | GO:1902459 | positive regulation of stem cell population maintenance(GO:1902459) |
0.1 | 1.6 | GO:0009268 | response to pH(GO:0009268) |
0.1 | 0.1 | GO:1903012 | positive regulation of bone development(GO:1903012) |
0.1 | 10.0 | GO:0016042 | lipid catabolic process(GO:0016042) |
0.1 | 0.7 | GO:0044458 | motile cilium assembly(GO:0044458) |
0.1 | 0.8 | GO:0043486 | histone exchange(GO:0043486) |
0.1 | 0.3 | GO:0035065 | regulation of histone acetylation(GO:0035065) |
0.1 | 0.3 | GO:0060050 | positive regulation of protein glycosylation(GO:0060050) |
0.1 | 0.8 | GO:0035269 | protein O-linked mannosylation(GO:0035269) |
0.1 | 0.3 | GO:0045297 | mating plug formation(GO:0042628) single-organism reproductive behavior(GO:0044704) post-mating behavior(GO:0045297) |
0.1 | 0.4 | GO:0099624 | regulation of atrial cardiac muscle cell membrane repolarization(GO:0060372) atrial cardiac muscle cell membrane repolarization(GO:0099624) |
0.1 | 0.1 | GO:0007135 | meiosis II(GO:0007135) |
0.1 | 0.1 | GO:2000192 | negative regulation of fatty acid transport(GO:2000192) |
0.1 | 0.1 | GO:0001773 | myeloid dendritic cell activation(GO:0001773) |
0.1 | 0.5 | GO:0046697 | decidualization(GO:0046697) |
0.1 | 0.4 | GO:0021984 | adenohypophysis development(GO:0021984) |
0.1 | 0.5 | GO:0048733 | sebaceous gland development(GO:0048733) |
0.1 | 1.0 | GO:0045475 | locomotor rhythm(GO:0045475) |
0.1 | 1.4 | GO:0090162 | establishment of epithelial cell polarity(GO:0090162) |
0.1 | 0.1 | GO:0003406 | retinal pigment epithelium development(GO:0003406) |
0.1 | 0.6 | GO:0030903 | notochord development(GO:0030903) |
0.1 | 0.2 | GO:0070131 | positive regulation of mitochondrial translation(GO:0070131) |
0.1 | 0.1 | GO:0046532 | regulation of photoreceptor cell differentiation(GO:0046532) |
0.1 | 0.1 | GO:0060398 | regulation of growth hormone receptor signaling pathway(GO:0060398) |
0.1 | 0.1 | GO:0030497 | fatty acid elongation(GO:0030497) |
0.1 | 0.1 | GO:1905097 | regulation of guanyl-nucleotide exchange factor activity(GO:1905097) |
0.1 | 0.1 | GO:0009449 | gamma-aminobutyric acid biosynthetic process(GO:0009449) |
0.1 | 0.5 | GO:0001953 | negative regulation of cell-matrix adhesion(GO:0001953) |
0.1 | 0.2 | GO:0031126 | snoRNA 3'-end processing(GO:0031126) |
0.1 | 1.1 | GO:0035510 | DNA dealkylation(GO:0035510) |
0.1 | 5.8 | GO:1903749 | positive regulation of establishment of protein localization to mitochondrion(GO:1903749) positive regulation of protein targeting to mitochondrion(GO:1903955) |
0.1 | 0.2 | GO:0030888 | regulation of B cell proliferation(GO:0030888) |
0.1 | 0.7 | GO:0045762 | positive regulation of cyclase activity(GO:0031281) positive regulation of adenylate cyclase activity(GO:0045762) |
0.1 | 1.4 | GO:0045292 | mRNA cis splicing, via spliceosome(GO:0045292) |
0.1 | 0.6 | GO:0006621 | protein retention in ER lumen(GO:0006621) |
0.1 | 0.5 | GO:0042573 | retinoic acid metabolic process(GO:0042573) |
0.1 | 0.4 | GO:2000036 | regulation of stem cell population maintenance(GO:2000036) |
0.1 | 0.2 | GO:0070120 | ciliary neurotrophic factor-mediated signaling pathway(GO:0070120) |
0.1 | 0.8 | GO:0060575 | intestinal epithelial cell differentiation(GO:0060575) |
0.1 | 0.4 | GO:0001866 | NK T cell proliferation(GO:0001866) |
0.1 | 0.1 | GO:0001945 | lymph vessel development(GO:0001945) |
0.1 | 0.1 | GO:1903215 | negative regulation of protein targeting to mitochondrion(GO:1903215) |
0.1 | 1.2 | GO:0033962 | cytoplasmic mRNA processing body assembly(GO:0033962) |
0.1 | 1.6 | GO:0070979 | protein K11-linked ubiquitination(GO:0070979) |
0.1 | 0.2 | GO:0072673 | lamellipodium morphogenesis(GO:0072673) |
0.1 | 0.2 | GO:0036120 | response to platelet-derived growth factor(GO:0036119) cellular response to platelet-derived growth factor stimulus(GO:0036120) |
0.1 | 0.2 | GO:2000105 | positive regulation of DNA-dependent DNA replication(GO:2000105) |
0.1 | 0.9 | GO:0006379 | mRNA cleavage(GO:0006379) |
0.1 | 7.3 | GO:0031047 | gene silencing by RNA(GO:0031047) |
0.1 | 2.0 | GO:0006637 | acyl-CoA metabolic process(GO:0006637) thioester metabolic process(GO:0035383) |
0.1 | 3.5 | GO:0032436 | positive regulation of proteasomal ubiquitin-dependent protein catabolic process(GO:0032436) |
0.1 | 4.1 | GO:0008360 | regulation of cell shape(GO:0008360) |
0.1 | 0.1 | GO:0002159 | desmosome assembly(GO:0002159) |
0.1 | 0.7 | GO:0030811 | regulation of nucleotide catabolic process(GO:0030811) |
0.1 | 0.3 | GO:0039532 | negative regulation of viral-induced cytoplasmic pattern recognition receptor signaling pathway(GO:0039532) |
0.1 | 1.3 | GO:0002902 | regulation of B cell apoptotic process(GO:0002902) |
0.1 | 0.3 | GO:0061000 | negative regulation of dendritic spine development(GO:0061000) |
0.1 | 0.1 | GO:0003139 | secondary heart field specification(GO:0003139) |
0.1 | 1.3 | GO:0061045 | negative regulation of wound healing(GO:0061045) |
0.1 | 0.4 | GO:0071260 | cellular response to mechanical stimulus(GO:0071260) |
0.1 | 0.2 | GO:0000087 | mitotic M phase(GO:0000087) mitotic cell cycle phase(GO:0098763) |
0.1 | 2.8 | GO:0042113 | B cell activation(GO:0042113) |
0.1 | 0.4 | GO:0017182 | peptidyl-diphthamide metabolic process(GO:0017182) peptidyl-diphthamide biosynthetic process from peptidyl-histidine(GO:0017183) |
0.1 | 0.5 | GO:0070914 | UV-damage excision repair(GO:0070914) |
0.1 | 0.2 | GO:0001845 | phagolysosome assembly(GO:0001845) |
0.1 | 0.6 | GO:0016558 | protein import into peroxisome matrix(GO:0016558) |
0.1 | 0.3 | GO:1900153 | regulation of nuclear-transcribed mRNA catabolic process, deadenylation-dependent decay(GO:1900151) positive regulation of nuclear-transcribed mRNA catabolic process, deadenylation-dependent decay(GO:1900153) |
0.1 | 0.3 | GO:0032876 | negative regulation of DNA endoreduplication(GO:0032876) |
0.1 | 8.3 | GO:0071230 | cellular response to amino acid stimulus(GO:0071230) |
0.1 | 0.7 | GO:1902259 | regulation of delayed rectifier potassium channel activity(GO:1902259) |
0.1 | 0.1 | GO:0010801 | negative regulation of peptidyl-threonine phosphorylation(GO:0010801) |
0.1 | 0.2 | GO:0030259 | lipid glycosylation(GO:0030259) |
0.1 | 0.7 | GO:0048041 | cell-substrate adherens junction assembly(GO:0007045) focal adhesion assembly(GO:0048041) |
0.1 | 0.3 | GO:0007199 | G-protein coupled receptor signaling pathway coupled to cGMP nucleotide second messenger(GO:0007199) |
0.1 | 1.2 | GO:0016180 | snRNA processing(GO:0016180) |
0.1 | 8.0 | GO:0042742 | defense response to bacterium(GO:0042742) |
0.1 | 0.5 | GO:0055092 | cholesterol homeostasis(GO:0042632) sterol homeostasis(GO:0055092) |
0.1 | 0.8 | GO:0045947 | negative regulation of translational initiation(GO:0045947) |
0.1 | 0.2 | GO:0060700 | regulation of ribonuclease activity(GO:0060700) |
0.1 | 0.5 | GO:0051131 | chaperone-mediated protein complex assembly(GO:0051131) |
0.1 | 0.2 | GO:0046068 | cGMP metabolic process(GO:0046068) |
0.1 | 1.5 | GO:0050873 | brown fat cell differentiation(GO:0050873) |
0.1 | 0.1 | GO:0071276 | cellular response to cadmium ion(GO:0071276) |
0.1 | 0.3 | GO:1903318 | negative regulation of protein processing(GO:0010955) negative regulation of protein maturation(GO:1903318) |
0.1 | 0.1 | GO:0046005 | positive regulation of circadian sleep/wake cycle, REM sleep(GO:0046005) |
0.1 | 0.1 | GO:0019585 | uronic acid metabolic process(GO:0006063) glucuronate metabolic process(GO:0019585) |
0.1 | 0.1 | GO:0006705 | mineralocorticoid biosynthetic process(GO:0006705) mineralocorticoid metabolic process(GO:0008212) |
0.1 | 0.2 | GO:0097435 | extracellular fibril organization(GO:0043206) fibril organization(GO:0097435) |
0.1 | 0.1 | GO:0035984 | response to trichostatin A(GO:0035983) cellular response to trichostatin A(GO:0035984) |
0.1 | 0.1 | GO:0070488 | neutrophil aggregation(GO:0070488) |
0.1 | 0.3 | GO:0048563 | post-embryonic organ morphogenesis(GO:0048563) |
0.1 | 0.4 | GO:0042772 | DNA damage response, signal transduction by p53 class mediator resulting in transcription of p21 class mediator(GO:0006978) DNA damage response, signal transduction resulting in transcription(GO:0042772) |
0.1 | 0.1 | GO:0001998 | angiotensin mediated vasoconstriction involved in regulation of systemic arterial blood pressure(GO:0001998) |
0.1 | 1.3 | GO:0061512 | protein localization to cilium(GO:0061512) |
0.1 | 0.1 | GO:0006687 | glycosphingolipid metabolic process(GO:0006687) |
0.1 | 0.2 | GO:0042640 | anagen(GO:0042640) |
0.1 | 0.2 | GO:0030240 | skeletal muscle thin filament assembly(GO:0030240) |
0.1 | 3.9 | GO:0006487 | protein N-linked glycosylation(GO:0006487) |
0.1 | 0.2 | GO:0032754 | positive regulation of interleukin-5 production(GO:0032754) |
0.1 | 0.1 | GO:0033081 | regulation of T cell differentiation in thymus(GO:0033081) regulation of thymocyte aggregation(GO:2000398) |
0.1 | 0.1 | GO:1904714 | regulation of chaperone-mediated autophagy(GO:1904714) |
0.1 | 0.7 | GO:1900264 | regulation of DNA-directed DNA polymerase activity(GO:1900262) positive regulation of DNA-directed DNA polymerase activity(GO:1900264) |
0.1 | 0.1 | GO:0071294 | cellular response to zinc ion(GO:0071294) |
0.1 | 1.7 | GO:0042493 | response to drug(GO:0042493) |
0.1 | 0.4 | GO:0009650 | UV protection(GO:0009650) |
0.1 | 0.1 | GO:0070828 | heterochromatin organization(GO:0070828) |
0.1 | 1.2 | GO:0008584 | male gonad development(GO:0008584) development of primary male sexual characteristics(GO:0046546) |
0.1 | 0.1 | GO:0030382 | sperm mitochondrion organization(GO:0030382) |
0.1 | 0.8 | GO:0045109 | intermediate filament organization(GO:0045109) |
0.1 | 0.2 | GO:0035357 | peroxisome proliferator activated receptor signaling pathway(GO:0035357) |
0.1 | 0.3 | GO:1990928 | response to amino acid starvation(GO:1990928) |
0.1 | 0.7 | GO:0051310 | metaphase plate congression(GO:0051310) |
0.1 | 0.2 | GO:0051127 | positive regulation of actin nucleation(GO:0051127) |
0.1 | 1.3 | GO:0016578 | histone deubiquitination(GO:0016578) |
0.1 | 0.4 | GO:0097006 | regulation of plasma lipoprotein particle levels(GO:0097006) |
0.1 | 0.4 | GO:0031670 | cellular response to nutrient(GO:0031670) |
0.1 | 0.1 | GO:0032528 | microvillus organization(GO:0032528) |
0.1 | 0.6 | GO:0017196 | N-terminal peptidyl-methionine acetylation(GO:0017196) |
0.1 | 0.3 | GO:0071684 | blastocyst hatching(GO:0001835) hatching(GO:0035188) organism emergence from protective structure(GO:0071684) |
0.1 | 0.2 | GO:0051005 | negative regulation of lipoprotein lipase activity(GO:0051005) |
0.1 | 0.1 | GO:0015809 | basic amino acid transport(GO:0015802) arginine transport(GO:0015809) |
0.1 | 0.8 | GO:0006614 | SRP-dependent cotranslational protein targeting to membrane(GO:0006614) |
0.1 | 0.4 | GO:0070986 | left/right axis specification(GO:0070986) |
0.1 | 0.1 | GO:0010578 | regulation of adenylate cyclase activity involved in G-protein coupled receptor signaling pathway(GO:0010578) positive regulation of adenylate cyclase activity involved in G-protein coupled receptor signaling pathway(GO:0010579) |
0.1 | 0.1 | GO:0006113 | fermentation(GO:0006113) glucose catabolic process to lactate(GO:0019659) glycolytic fermentation(GO:0019660) glucose catabolic process to lactate via pyruvate(GO:0019661) |
0.1 | 0.3 | GO:1904659 | glucose transmembrane transport(GO:1904659) |
0.1 | 0.1 | GO:0038202 | TORC1 signaling(GO:0038202) regulation of TORC1 signaling(GO:1903432) |
0.1 | 0.1 | GO:0061009 | common bile duct development(GO:0061009) |
0.1 | 0.2 | GO:0006363 | termination of RNA polymerase I transcription(GO:0006363) |
0.1 | 0.1 | GO:0021882 | regulation of transcription from RNA polymerase II promoter involved in forebrain neuron fate commitment(GO:0021882) |
0.1 | 0.1 | GO:0071462 | cellular response to water stimulus(GO:0071462) |
0.1 | 0.6 | GO:2000772 | regulation of cellular senescence(GO:2000772) |
0.1 | 0.5 | GO:0000055 | ribosomal large subunit export from nucleus(GO:0000055) |
0.1 | 0.1 | GO:0048880 | sensory system development(GO:0048880) |
0.1 | 0.1 | GO:0006537 | glutamate biosynthetic process(GO:0006537) |
0.1 | 0.1 | GO:1902750 | negative regulation of cell cycle G2/M phase transition(GO:1902750) |
0.1 | 0.6 | GO:0001947 | heart looping(GO:0001947) |
0.1 | 1.2 | GO:0007129 | synapsis(GO:0007129) |
0.1 | 1.9 | GO:0090307 | mitotic spindle assembly(GO:0090307) microtubule cytoskeleton organization involved in mitosis(GO:1902850) |
0.1 | 0.1 | GO:0030540 | female genitalia development(GO:0030540) |
0.1 | 0.3 | GO:0006659 | phosphatidylserine biosynthetic process(GO:0006659) |
0.1 | 0.1 | GO:0008343 | adult feeding behavior(GO:0008343) |
0.1 | 0.7 | GO:0043407 | negative regulation of MAP kinase activity(GO:0043407) |
0.1 | 1.6 | GO:0033138 | positive regulation of peptidyl-serine phosphorylation(GO:0033138) |
0.1 | 1.1 | GO:0010906 | regulation of glucose metabolic process(GO:0010906) |
0.1 | 0.1 | GO:0043321 | regulation of natural killer cell degranulation(GO:0043321) |
0.1 | 0.2 | GO:1900227 | positive regulation of NLRP3 inflammasome complex assembly(GO:1900227) |
0.1 | 0.2 | GO:0033603 | positive regulation of dopamine secretion(GO:0033603) |
0.1 | 0.8 | GO:0045116 | protein neddylation(GO:0045116) |
0.1 | 0.2 | GO:0005984 | disaccharide metabolic process(GO:0005984) |
0.1 | 0.2 | GO:0044273 | sulfur amino acid catabolic process(GO:0000098) sulfur compound catabolic process(GO:0044273) |
0.1 | 0.3 | GO:0043312 | neutrophil degranulation(GO:0043312) |
0.1 | 0.3 | GO:0044036 | cell wall macromolecule metabolic process(GO:0044036) cell wall organization or biogenesis(GO:0071554) |
0.1 | 0.8 | GO:0060259 | regulation of feeding behavior(GO:0060259) |
0.1 | 0.3 | GO:0007253 | cytoplasmic sequestering of NF-kappaB(GO:0007253) |
0.1 | 0.1 | GO:0055089 | fatty acid homeostasis(GO:0055089) |
0.1 | 0.1 | GO:0033628 | regulation of cell adhesion mediated by integrin(GO:0033628) |
0.1 | 0.1 | GO:0019230 | proprioception(GO:0019230) sensory neuron axon guidance(GO:0097374) |
0.1 | 0.2 | GO:0051024 | positive regulation of immunoglobulin secretion(GO:0051024) |
0.1 | 0.1 | GO:0045759 | negative regulation of action potential(GO:0045759) |
0.1 | 0.1 | GO:0048625 | myoblast fate commitment(GO:0048625) |
0.1 | 0.2 | GO:0018377 | protein myristoylation(GO:0018377) |
0.1 | 0.1 | GO:0002832 | negative regulation of response to biotic stimulus(GO:0002832) |
0.1 | 0.1 | GO:0060478 | acrosomal vesicle exocytosis(GO:0060478) |
0.1 | 0.2 | GO:0007512 | adult heart development(GO:0007512) |
0.1 | 0.6 | GO:0009143 | nucleoside triphosphate catabolic process(GO:0009143) |
0.1 | 0.7 | GO:0003341 | cilium movement(GO:0003341) |
0.1 | 2.0 | GO:0006418 | tRNA aminoacylation for protein translation(GO:0006418) |
0.1 | 0.3 | GO:0032328 | alanine transport(GO:0032328) |
0.1 | 0.2 | GO:0021910 | smoothened signaling pathway involved in ventral spinal cord patterning(GO:0021910) negative regulation of smoothened signaling pathway involved in ventral spinal cord patterning(GO:0021914) |
0.1 | 0.5 | GO:0071578 | zinc II ion transmembrane import(GO:0071578) |
0.1 | 0.2 | GO:0002291 | T cell activation via T cell receptor contact with antigen bound to MHC molecule on antigen presenting cell(GO:0002291) |
0.1 | 0.1 | GO:0042138 | meiotic DNA double-strand break formation(GO:0042138) |
0.1 | 0.2 | GO:0042312 | regulation of vasodilation(GO:0042312) |
0.1 | 0.5 | GO:1901224 | positive regulation of NIK/NF-kappaB signaling(GO:1901224) |
0.1 | 0.5 | GO:0006607 | NLS-bearing protein import into nucleus(GO:0006607) |
0.1 | 0.4 | GO:0019800 | peptide cross-linking via chondroitin 4-sulfate glycosaminoglycan(GO:0019800) |
0.1 | 0.2 | GO:0051029 | RNA import into mitochondrion(GO:0035927) rRNA transport(GO:0051029) |
0.1 | 0.1 | GO:0042256 | mature ribosome assembly(GO:0042256) |
0.1 | 0.3 | GO:0036010 | protein localization to endosome(GO:0036010) |
0.1 | 0.2 | GO:0045925 | positive regulation of female receptivity(GO:0045925) |
0.1 | 0.2 | GO:1903332 | regulation of protein folding(GO:1903332) positive regulation of protein folding(GO:1903334) |
0.1 | 0.7 | GO:0001522 | pseudouridine synthesis(GO:0001522) |
0.1 | 1.6 | GO:0003333 | amino acid transmembrane transport(GO:0003333) |
0.1 | 0.1 | GO:0072600 | establishment of protein localization to Golgi(GO:0072600) |
0.1 | 0.1 | GO:0009597 | detection of virus(GO:0009597) |
0.1 | 0.1 | GO:0090158 | endoplasmic reticulum membrane organization(GO:0090158) |
0.1 | 0.4 | GO:0002011 | morphogenesis of an epithelial sheet(GO:0002011) |
0.1 | 0.8 | GO:0006360 | transcription from RNA polymerase I promoter(GO:0006360) |
0.1 | 0.1 | GO:0051365 | cellular response to potassium ion starvation(GO:0051365) |
0.1 | 0.5 | GO:0015701 | bicarbonate transport(GO:0015701) |
0.1 | 0.1 | GO:0008054 | negative regulation of cyclin-dependent protein serine/threonine kinase by cyclin degradation(GO:0008054) |
0.1 | 0.2 | GO:0000729 | DNA double-strand break processing(GO:0000729) |
0.1 | 0.1 | GO:0034163 | regulation of toll-like receptor 9 signaling pathway(GO:0034163) positive regulation of toll-like receptor 9 signaling pathway(GO:0034165) |
0.1 | 0.1 | GO:0051661 | maintenance of centrosome location(GO:0051661) |
0.1 | 0.7 | GO:0051601 | exocyst localization(GO:0051601) |
0.1 | 0.4 | GO:0043651 | linoleic acid metabolic process(GO:0043651) |
0.1 | 0.2 | GO:0098535 | de novo centriole assembly(GO:0098535) |
0.1 | 0.1 | GO:0060027 | neural plate development(GO:0001840) neural plate elongation(GO:0014022) convergent extension involved in neural plate elongation(GO:0022007) convergent extension involved in gastrulation(GO:0060027) |
0.1 | 0.2 | GO:0000289 | nuclear-transcribed mRNA poly(A) tail shortening(GO:0000289) |
0.1 | 0.1 | GO:0051299 | centrosome separation(GO:0051299) |
0.1 | 0.1 | GO:1901984 | negative regulation of protein acetylation(GO:1901984) |
0.1 | 0.2 | GO:0014009 | glial cell proliferation(GO:0014009) |
0.1 | 0.1 | GO:0051835 | positive regulation of synapse structural plasticity(GO:0051835) |
0.1 | 0.1 | GO:0046826 | negative regulation of protein export from nucleus(GO:0046826) |
0.1 | 0.1 | GO:0014053 | negative regulation of gamma-aminobutyric acid secretion(GO:0014053) |
0.1 | 0.7 | GO:0030150 | protein import into mitochondrial matrix(GO:0030150) |
0.1 | 0.5 | GO:0035335 | peptidyl-tyrosine dephosphorylation(GO:0035335) |
0.1 | 0.1 | GO:0061687 | detoxification of inorganic compound(GO:0061687) |
0.1 | 0.1 | GO:0006553 | lysine metabolic process(GO:0006553) |
0.1 | 0.5 | GO:0045777 | positive regulation of blood pressure(GO:0045777) |
0.1 | 1.3 | GO:0045576 | mast cell activation(GO:0045576) |
0.1 | 0.2 | GO:0010172 | embryonic body morphogenesis(GO:0010172) |
0.1 | 0.3 | GO:0050930 | induction of positive chemotaxis(GO:0050930) |
0.1 | 0.4 | GO:0055088 | lipid homeostasis(GO:0055088) |
0.1 | 0.1 | GO:0090077 | foam cell differentiation(GO:0090077) |
0.1 | 0.4 | GO:0042220 | response to cocaine(GO:0042220) |
0.1 | 0.1 | GO:0006600 | creatine metabolic process(GO:0006600) |
0.1 | 0.1 | GO:2001225 | regulation of chloride transport(GO:2001225) |
0.1 | 0.1 | GO:0001880 | Mullerian duct regression(GO:0001880) |
0.1 | 0.5 | GO:0051875 | pigment granule localization(GO:0051875) |
0.1 | 0.1 | GO:0031076 | embryonic camera-type eye development(GO:0031076) |
0.1 | 0.8 | GO:0048525 | negative regulation of viral process(GO:0048525) |
0.1 | 0.3 | GO:0050802 | regulation of circadian sleep/wake cycle, sleep(GO:0045187) circadian sleep/wake cycle, sleep(GO:0050802) |
0.1 | 0.1 | GO:1900165 | negative regulation of interleukin-6 secretion(GO:1900165) |
0.1 | 0.1 | GO:0048048 | embryonic eye morphogenesis(GO:0048048) |
0.1 | 0.4 | GO:0044794 | positive regulation by host of viral process(GO:0044794) |
0.1 | 1.3 | GO:0043966 | histone H3 acetylation(GO:0043966) |
0.1 | 1.3 | GO:0015807 | L-amino acid transport(GO:0015807) |
0.1 | 0.3 | GO:1901678 | iron coordination entity transport(GO:1901678) |
0.1 | 0.1 | GO:0046292 | formaldehyde metabolic process(GO:0046292) |
0.1 | 0.2 | GO:0070072 | vacuolar proton-transporting V-type ATPase complex assembly(GO:0070072) |
0.1 | 0.1 | GO:0042769 | DNA damage response, detection of DNA damage(GO:0042769) |
0.1 | 0.2 | GO:0042832 | defense response to protozoan(GO:0042832) |
0.1 | 0.2 | GO:1900027 | regulation of ruffle assembly(GO:1900027) |
0.1 | 0.2 | GO:0010719 | negative regulation of epithelial to mesenchymal transition(GO:0010719) |
0.1 | 0.1 | GO:1902473 | regulation of protein localization to synapse(GO:1902473) |
0.1 | 0.1 | GO:2001273 | glucose import in response to insulin stimulus(GO:0044381) regulation of glucose import in response to insulin stimulus(GO:2001273) |
0.1 | 0.2 | GO:0043137 | DNA replication, removal of RNA primer(GO:0043137) |
0.1 | 0.1 | GO:1901800 | positive regulation of proteasomal protein catabolic process(GO:1901800) |
0.1 | 3.3 | GO:0030198 | extracellular matrix organization(GO:0030198) |
0.1 | 0.1 | GO:1903677 | regulation of cap-independent translational initiation(GO:1903677) positive regulation of cap-independent translational initiation(GO:1903679) regulation of cytoplasmic translational initiation(GO:1904688) positive regulation of cytoplasmic translational initiation(GO:1904690) |
0.1 | 0.1 | GO:0010040 | response to iron(II) ion(GO:0010040) |
0.1 | 0.4 | GO:0000076 | DNA replication checkpoint(GO:0000076) |
0.1 | 0.1 | GO:0043647 | inositol phosphate metabolic process(GO:0043647) |
0.1 | 0.1 | GO:2000870 | regulation of progesterone secretion(GO:2000870) |
0.1 | 0.1 | GO:0032066 | nucleolus to nucleoplasm transport(GO:0032066) |
0.1 | 0.1 | GO:0010727 | negative regulation of hydrogen peroxide metabolic process(GO:0010727) |
0.1 | 2.3 | GO:0043123 | positive regulation of I-kappaB kinase/NF-kappaB signaling(GO:0043123) |
0.1 | 0.3 | GO:0048678 | response to axon injury(GO:0048678) |
0.1 | 0.1 | GO:0010893 | positive regulation of steroid biosynthetic process(GO:0010893) |
0.1 | 0.1 | GO:0001696 | gastric acid secretion(GO:0001696) |
0.1 | 0.1 | GO:0070129 | regulation of mitochondrial translation(GO:0070129) |
0.1 | 0.1 | GO:0070244 | negative regulation of thymocyte apoptotic process(GO:0070244) |
0.1 | 0.7 | GO:0007026 | negative regulation of microtubule depolymerization(GO:0007026) |
0.1 | 0.1 | GO:0006083 | acetate metabolic process(GO:0006083) |
0.1 | 4.6 | GO:0007286 | spermatid development(GO:0007286) |
0.1 | 0.1 | GO:0036037 | CD8-positive, alpha-beta T cell activation(GO:0036037) |
0.1 | 0.1 | GO:0051151 | negative regulation of smooth muscle cell differentiation(GO:0051151) |
0.1 | 0.1 | GO:0046726 | positive regulation by virus of viral protein levels in host cell(GO:0046726) |
0.1 | 0.1 | GO:0010830 | regulation of myotube differentiation(GO:0010830) |
0.1 | 0.2 | GO:0002523 | leukocyte migration involved in inflammatory response(GO:0002523) |
0.1 | 0.2 | GO:0006353 | DNA-templated transcription, termination(GO:0006353) |
0.1 | 0.1 | GO:0051385 | response to mineralocorticoid(GO:0051385) |
0.1 | 0.1 | GO:0090178 | regulation of establishment of planar polarity involved in neural tube closure(GO:0090178) |
0.1 | 0.1 | GO:0048333 | mesodermal cell differentiation(GO:0048333) |
0.1 | 5.4 | GO:0010466 | negative regulation of peptidase activity(GO:0010466) |
0.1 | 0.1 | GO:0006933 | negative regulation of cell adhesion involved in substrate-bound cell migration(GO:0006933) |
0.1 | 0.1 | GO:0060830 | ciliary receptor clustering involved in smoothened signaling pathway(GO:0060830) |
0.1 | 0.1 | GO:0006586 | tryptophan metabolic process(GO:0006568) indolalkylamine metabolic process(GO:0006586) |
0.1 | 0.1 | GO:0071709 | membrane assembly(GO:0071709) |
0.1 | 0.1 | GO:1900126 | negative regulation of hyaluronan biosynthetic process(GO:1900126) |
0.1 | 0.1 | GO:0072553 | terminal button organization(GO:0072553) |
0.1 | 0.1 | GO:1901386 | negative regulation of voltage-gated calcium channel activity(GO:1901386) |
0.1 | 0.1 | GO:0009071 | serine family amino acid catabolic process(GO:0009071) |
0.1 | 0.1 | GO:1900106 | hyaluranon cable assembly(GO:0036118) regulation of hyaluranon cable assembly(GO:1900104) positive regulation of hyaluranon cable assembly(GO:1900106) |
0.1 | 0.2 | GO:0007263 | nitric oxide mediated signal transduction(GO:0007263) |
0.1 | 0.2 | GO:0010818 | T cell chemotaxis(GO:0010818) |
0.1 | 2.4 | GO:0002250 | adaptive immune response(GO:0002250) |
0.1 | 0.2 | GO:0034975 | protein folding in endoplasmic reticulum(GO:0034975) |
0.1 | 0.1 | GO:0036514 | dopaminergic neuron axon guidance(GO:0036514) planar cell polarity pathway involved in axon guidance(GO:1904938) |
0.1 | 0.1 | GO:0034035 | purine ribonucleoside bisphosphate metabolic process(GO:0034035) |
0.1 | 0.1 | GO:0015015 | heparan sulfate proteoglycan biosynthetic process, enzymatic modification(GO:0015015) |
0.1 | 0.1 | GO:0035902 | response to immobilization stress(GO:0035902) |
0.0 | 0.2 | GO:0032098 | regulation of appetite(GO:0032098) |
0.0 | 0.1 | GO:0050774 | negative regulation of dendrite morphogenesis(GO:0050774) |
0.0 | 0.1 | GO:2001224 | positive regulation of neuron migration(GO:2001224) |
0.0 | 0.3 | GO:0006384 | transcription initiation from RNA polymerase III promoter(GO:0006384) |
0.0 | 0.1 | GO:0045581 | negative regulation of T cell differentiation(GO:0045581) |
0.0 | 0.1 | GO:0060385 | axonogenesis involved in innervation(GO:0060385) |
0.0 | 0.0 | GO:0090261 | positive regulation of inclusion body assembly(GO:0090261) |
0.0 | 0.1 | GO:0042636 | negative regulation of hair cycle(GO:0042636) |
0.0 | 1.1 | GO:0007586 | digestion(GO:0007586) |
0.0 | 0.1 | GO:0060017 | parathyroid gland development(GO:0060017) |
0.0 | 0.1 | GO:0042059 | negative regulation of epidermal growth factor receptor signaling pathway(GO:0042059) |
0.0 | 0.0 | GO:0071169 | establishment of protein localization to chromatin(GO:0071169) |
0.0 | 0.0 | GO:0033762 | response to glucagon(GO:0033762) |
0.0 | 0.0 | GO:0016480 | negative regulation of transcription from RNA polymerase III promoter(GO:0016480) |
0.0 | 0.0 | GO:0046173 | polyol biosynthetic process(GO:0046173) |
0.0 | 0.3 | GO:0000188 | inactivation of MAPK activity(GO:0000188) |
0.0 | 0.2 | GO:0045103 | intermediate filament-based process(GO:0045103) |
0.0 | 0.0 | GO:0007060 | male meiosis chromosome segregation(GO:0007060) |
0.0 | 1.3 | GO:0018149 | peptide cross-linking(GO:0018149) |
0.0 | 0.2 | GO:0045471 | response to ethanol(GO:0045471) |
0.0 | 0.1 | GO:0000255 | allantoin metabolic process(GO:0000255) |
0.0 | 0.2 | GO:0050433 | regulation of catecholamine secretion(GO:0050433) |
0.0 | 0.1 | GO:0009125 | nucleoside monophosphate catabolic process(GO:0009125) |
0.0 | 0.0 | GO:0046685 | response to arsenic-containing substance(GO:0046685) |
0.0 | 0.2 | GO:0046329 | negative regulation of JNK cascade(GO:0046329) |
0.0 | 0.1 | GO:0006646 | phosphatidylethanolamine biosynthetic process(GO:0006646) |
0.0 | 0.2 | GO:0031848 | protection from non-homologous end joining at telomere(GO:0031848) |
0.0 | 0.0 | GO:0048290 | isotype switching to IgA isotypes(GO:0048290) regulation of isotype switching to IgA isotypes(GO:0048296) |
0.0 | 0.1 | GO:0050966 | detection of mechanical stimulus involved in sensory perception of pain(GO:0050966) |
0.0 | 0.1 | GO:0042537 | benzene-containing compound metabolic process(GO:0042537) |
0.0 | 0.2 | GO:0006817 | phosphate ion transport(GO:0006817) |
0.0 | 1.3 | GO:0000086 | G2/M transition of mitotic cell cycle(GO:0000086) |
0.0 | 0.3 | GO:0070525 | tRNA threonylcarbamoyladenosine metabolic process(GO:0070525) |
0.0 | 0.1 | GO:0000727 | double-strand break repair via break-induced replication(GO:0000727) |
0.0 | 0.0 | GO:0055075 | potassium ion homeostasis(GO:0055075) |
0.0 | 0.0 | GO:0002823 | negative regulation of adaptive immune response based on somatic recombination of immune receptors built from immunoglobulin superfamily domains(GO:0002823) |
0.0 | 0.0 | GO:0070601 | centromeric sister chromatid cohesion(GO:0070601) |
0.0 | 0.1 | GO:0044342 | type B pancreatic cell proliferation(GO:0044342) |
0.0 | 0.1 | GO:0070995 | NADPH oxidation(GO:0070995) |
0.0 | 0.2 | GO:0046827 | positive regulation of protein export from nucleus(GO:0046827) |
0.0 | 0.0 | GO:0032873 | negative regulation of stress-activated MAPK cascade(GO:0032873) negative regulation of stress-activated protein kinase signaling cascade(GO:0070303) |
0.0 | 0.4 | GO:0045669 | positive regulation of osteoblast differentiation(GO:0045669) |
0.0 | 0.2 | GO:0048280 | vesicle fusion with Golgi apparatus(GO:0048280) |
0.0 | 0.1 | GO:0048012 | hepatocyte growth factor receptor signaling pathway(GO:0048012) |
0.0 | 0.2 | GO:0000038 | very long-chain fatty acid metabolic process(GO:0000038) |
0.0 | 0.0 | GO:0016078 | tRNA catabolic process(GO:0016078) |
0.0 | 0.2 | GO:0001514 | selenocysteine incorporation(GO:0001514) translational readthrough(GO:0006451) |
0.0 | 0.0 | GO:0060054 | positive regulation of epithelial cell proliferation involved in wound healing(GO:0060054) |
0.0 | 0.6 | GO:0051225 | spindle assembly(GO:0051225) |
0.0 | 0.0 | GO:0051132 | NK T cell activation(GO:0051132) |
0.0 | 0.3 | GO:0000470 | maturation of LSU-rRNA(GO:0000470) |
0.0 | 0.7 | GO:0019373 | epoxygenase P450 pathway(GO:0019373) |
0.0 | 0.2 | GO:0002347 | response to tumor cell(GO:0002347) |
0.0 | 0.0 | GO:0050689 | negative regulation of defense response to virus by host(GO:0050689) |
0.0 | 0.1 | GO:0042092 | type 2 immune response(GO:0042092) |
0.0 | 0.1 | GO:0006515 | misfolded or incompletely synthesized protein catabolic process(GO:0006515) |
0.0 | 0.5 | GO:0006270 | DNA replication initiation(GO:0006270) |
0.0 | 0.1 | GO:0003010 | voluntary skeletal muscle contraction(GO:0003010) twitch skeletal muscle contraction(GO:0014721) |
0.0 | 0.1 | GO:0010832 | negative regulation of myotube differentiation(GO:0010832) |
0.0 | 0.0 | GO:0035330 | regulation of hippo signaling(GO:0035330) |
0.0 | 0.2 | GO:0003151 | outflow tract morphogenesis(GO:0003151) |
0.0 | 0.0 | GO:0099515 | actin filament-based transport(GO:0099515) |
0.0 | 0.4 | GO:0000413 | protein peptidyl-prolyl isomerization(GO:0000413) |
0.0 | 0.4 | GO:0018345 | protein palmitoylation(GO:0018345) |
0.0 | 0.2 | GO:0034244 | negative regulation of transcription elongation from RNA polymerase II promoter(GO:0034244) |
0.0 | 0.0 | GO:0097484 | dendrite extension(GO:0097484) |
0.0 | 0.1 | GO:0023041 | neuronal signal transduction(GO:0023041) |
0.0 | 0.0 | GO:0051351 | positive regulation of ligase activity(GO:0051351) |
0.0 | 0.1 | GO:0072051 | juxtaglomerular apparatus development(GO:0072051) |
0.0 | 0.1 | GO:0018026 | peptidyl-lysine monomethylation(GO:0018026) |
0.0 | 0.0 | GO:0045837 | negative regulation of membrane potential(GO:0045837) cell-cell adhesion involved in gastrulation(GO:0070586) |
0.0 | 0.0 | GO:0042182 | ketone catabolic process(GO:0042182) |
0.0 | 0.2 | GO:0070206 | protein trimerization(GO:0070206) |
0.0 | 0.0 | GO:0048241 | epinephrine transport(GO:0048241) epinephrine secretion(GO:0048242) |
0.0 | 0.1 | GO:0006089 | lactate metabolic process(GO:0006089) |
0.0 | 0.1 | GO:0010226 | response to lithium ion(GO:0010226) |
0.0 | 0.2 | GO:0045582 | positive regulation of T cell differentiation(GO:0045582) |
0.0 | 0.1 | GO:0061303 | cornea development in camera-type eye(GO:0061303) |
0.0 | 0.0 | GO:0048806 | genitalia development(GO:0048806) |
0.0 | 0.0 | GO:0018202 | peptidyl-histidine modification(GO:0018202) |
0.0 | 0.0 | GO:0060921 | sinoatrial node cell differentiation(GO:0060921) |
0.0 | 0.3 | GO:0016339 | calcium-dependent cell-cell adhesion via plasma membrane cell adhesion molecules(GO:0016339) |
0.0 | 0.2 | GO:0050709 | negative regulation of protein secretion(GO:0050709) |
0.0 | 0.1 | GO:0034063 | stress granule assembly(GO:0034063) |
0.0 | 0.0 | GO:0097501 | stress response to metal ion(GO:0097501) |
0.0 | 0.1 | GO:0090231 | regulation of spindle checkpoint(GO:0090231) |
0.0 | 0.3 | GO:0043968 | histone H2A acetylation(GO:0043968) |
0.0 | 0.1 | GO:0035871 | protein K11-linked deubiquitination(GO:0035871) |
0.0 | 0.6 | GO:0070374 | positive regulation of ERK1 and ERK2 cascade(GO:0070374) |
0.0 | 0.4 | GO:0003009 | skeletal muscle contraction(GO:0003009) |
0.0 | 0.1 | GO:1900017 | positive regulation of cytokine production involved in inflammatory response(GO:1900017) |
0.0 | 0.3 | GO:0015986 | energy coupled proton transport, down electrochemical gradient(GO:0015985) ATP synthesis coupled proton transport(GO:0015986) |
0.0 | 0.1 | GO:0045084 | positive regulation of interleukin-12 biosynthetic process(GO:0045084) |
0.0 | 0.0 | GO:0046520 | sphingoid biosynthetic process(GO:0046520) |
0.0 | 0.1 | GO:1902608 | regulation of large conductance calcium-activated potassium channel activity(GO:1902606) positive regulation of large conductance calcium-activated potassium channel activity(GO:1902608) |
0.0 | 28.5 | GO:0007608 | sensory perception of smell(GO:0007608) |
0.0 | 0.0 | GO:0090175 | regulation of establishment of planar polarity(GO:0090175) |
0.0 | 0.1 | GO:0051496 | positive regulation of stress fiber assembly(GO:0051496) |
0.0 | 0.0 | GO:2000822 | regulation of fear response(GO:1903365) positive regulation of fear response(GO:1903367) regulation of behavioral fear response(GO:2000822) positive regulation of behavioral fear response(GO:2000987) |
0.0 | 0.0 | GO:0021937 | cerebellar Purkinje cell-granule cell precursor cell signaling involved in regulation of granule cell precursor cell proliferation(GO:0021937) |
0.0 | 0.0 | GO:0086043 | bundle of His cell to Purkinje myocyte signaling(GO:0086028) bundle of His cell action potential(GO:0086043) |
0.0 | 0.1 | GO:0042159 | lipoprotein catabolic process(GO:0042159) |
0.0 | 0.0 | GO:0042723 | thiamine metabolic process(GO:0006772) thiamine-containing compound metabolic process(GO:0042723) |
0.0 | 0.1 | GO:0001731 | formation of translation preinitiation complex(GO:0001731) |
0.0 | 0.0 | GO:0070973 | protein localization to endoplasmic reticulum exit site(GO:0070973) |
0.0 | 0.0 | GO:0090027 | negative regulation of monocyte chemotaxis(GO:0090027) |
0.0 | 0.0 | GO:1903020 | positive regulation of glycoprotein metabolic process(GO:1903020) |
0.0 | 0.0 | GO:0010575 | positive regulation of vascular endothelial growth factor production(GO:0010575) |
0.0 | 0.0 | GO:0050975 | sensory perception of touch(GO:0050975) |
0.0 | 0.0 | GO:2001201 | transforming growth factor-beta secretion(GO:0038044) regulation of transforming growth factor-beta secretion(GO:2001201) |
0.0 | 0.0 | GO:0098659 | inorganic cation import into cell(GO:0098659) inorganic ion import into cell(GO:0099587) |
0.0 | 0.7 | GO:0042273 | ribosomal large subunit biogenesis(GO:0042273) |
0.0 | 0.0 | GO:0072577 | endothelial cell apoptotic process(GO:0072577) |
0.0 | 0.1 | GO:0006488 | dolichol-linked oligosaccharide biosynthetic process(GO:0006488) |
0.0 | 0.0 | GO:0070989 | oxidative demethylation(GO:0070989) |
0.0 | 0.0 | GO:0060390 | regulation of SMAD protein import into nucleus(GO:0060390) |
0.0 | 0.0 | GO:1901298 | regulation of hydrogen peroxide-mediated programmed cell death(GO:1901298) |
0.0 | 0.0 | GO:0043569 | negative regulation of insulin-like growth factor receptor signaling pathway(GO:0043569) |
0.0 | 0.0 | GO:0002254 | kinin cascade(GO:0002254) |
0.0 | 0.0 | GO:0071107 | response to parathyroid hormone(GO:0071107) |
0.0 | 0.1 | GO:0007257 | activation of JUN kinase activity(GO:0007257) |
0.0 | 0.0 | GO:2000354 | regulation of ovarian follicle development(GO:2000354) |
0.0 | 0.0 | GO:2001179 | regulation of interleukin-10 secretion(GO:2001179) |
0.0 | 0.4 | GO:0030433 | ER-associated ubiquitin-dependent protein catabolic process(GO:0030433) |
0.0 | 0.0 | GO:0051657 | maintenance of organelle location(GO:0051657) |
0.0 | 0.0 | GO:0060049 | regulation of protein glycosylation(GO:0060049) |
0.0 | 0.0 | GO:1903608 | protein localization to cytoplasmic stress granule(GO:1903608) |
0.0 | 0.0 | GO:0034154 | toll-like receptor 7 signaling pathway(GO:0034154) |
0.0 | 0.0 | GO:0046628 | positive regulation of insulin receptor signaling pathway(GO:0046628) |
0.0 | 0.1 | GO:0043984 | histone H4-K16 acetylation(GO:0043984) |
0.0 | 0.0 | GO:0050651 | dermatan sulfate proteoglycan biosynthetic process(GO:0050651) |
0.0 | 0.0 | GO:0006610 | ribosomal protein import into nucleus(GO:0006610) |
0.0 | 0.0 | GO:0034351 | negative regulation of glial cell apoptotic process(GO:0034351) |
0.0 | 0.0 | GO:0060688 | regulation of morphogenesis of a branching structure(GO:0060688) |
0.0 | 0.0 | GO:0039530 | MDA-5 signaling pathway(GO:0039530) |
0.0 | 0.1 | GO:0070301 | cellular response to hydrogen peroxide(GO:0070301) |
0.0 | 0.0 | GO:0042983 | amyloid precursor protein biosynthetic process(GO:0042983) regulation of amyloid precursor protein biosynthetic process(GO:0042984) |
0.0 | 0.0 | GO:0097070 | ductus arteriosus closure(GO:0097070) |
0.0 | 0.0 | GO:0046909 | intermembrane transport(GO:0046909) |
0.0 | 0.1 | GO:1901532 | regulation of hematopoietic progenitor cell differentiation(GO:1901532) |
0.0 | 0.0 | GO:0008355 | olfactory learning(GO:0008355) |
0.0 | 0.3 | GO:0032543 | mitochondrial translation(GO:0032543) |
0.0 | 0.0 | GO:0015810 | aspartate transport(GO:0015810) |
0.0 | 0.0 | GO:0061152 | trachea submucosa development(GO:0061152) trachea gland development(GO:0061153) |
0.0 | 0.2 | GO:0043252 | sodium-independent organic anion transport(GO:0043252) |
0.0 | 0.2 | GO:0048477 | oogenesis(GO:0048477) |
0.0 | 0.0 | GO:1900377 | negative regulation of melanin biosynthetic process(GO:0048022) negative regulation of secondary metabolite biosynthetic process(GO:1900377) |
0.0 | 0.0 | GO:0030321 | transepithelial chloride transport(GO:0030321) |
0.0 | 0.0 | GO:0033280 | response to vitamin D(GO:0033280) |
0.0 | 0.0 | GO:0072402 | response to cell cycle checkpoint signaling(GO:0072396) response to DNA integrity checkpoint signaling(GO:0072402) response to DNA damage checkpoint signaling(GO:0072423) response to intra-S DNA damage checkpoint signaling(GO:0072429) |
0.0 | 1.3 | GO:0006470 | protein dephosphorylation(GO:0006470) |
0.0 | 0.0 | GO:0097286 | iron ion import(GO:0097286) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
3.4 | 10.2 | GO:0044393 | microspike(GO:0044393) |
3.4 | 20.2 | GO:0089717 | spanning component of plasma membrane(GO:0044214) spanning component of membrane(GO:0089717) |
2.5 | 24.9 | GO:0046581 | intercellular canaliculus(GO:0046581) |
2.5 | 7.4 | GO:0097513 | myosin II filament(GO:0097513) |
2.1 | 8.4 | GO:1990357 | terminal web(GO:1990357) |
2.0 | 10.2 | GO:0048787 | presynaptic active zone membrane(GO:0048787) |
2.0 | 9.9 | GO:0072559 | NLRP3 inflammasome complex(GO:0072559) |
2.0 | 7.9 | GO:1990851 | Wnt-Frizzled-LRP5/6 complex(GO:1990851) |
1.8 | 5.5 | GO:0048179 | activin receptor complex(GO:0048179) |
1.6 | 6.4 | GO:0061689 | tricellular tight junction(GO:0061689) |
1.6 | 6.3 | GO:0030868 | smooth endoplasmic reticulum membrane(GO:0030868) smooth endoplasmic reticulum part(GO:0097425) |
1.5 | 7.6 | GO:0033093 | Weibel-Palade body(GO:0033093) |
1.5 | 4.5 | GO:0031523 | Myb complex(GO:0031523) |
1.5 | 4.4 | GO:0005945 | 6-phosphofructokinase complex(GO:0005945) |
1.5 | 10.2 | GO:0030130 | clathrin coat of trans-Golgi network vesicle(GO:0030130) |
1.3 | 10.3 | GO:0045179 | apical cortex(GO:0045179) |
1.3 | 1.3 | GO:0097441 | basilar dendrite(GO:0097441) |
1.3 | 5.1 | GO:0071203 | WASH complex(GO:0071203) |
1.2 | 6.1 | GO:0043202 | lysosomal lumen(GO:0043202) |
1.2 | 9.4 | GO:0034992 | microtubule organizing center attachment site(GO:0034992) LINC complex(GO:0034993) |
1.2 | 5.8 | GO:0008091 | spectrin(GO:0008091) |
1.1 | 6.8 | GO:0042587 | glycogen granule(GO:0042587) |
1.1 | 10.1 | GO:0008074 | guanylate cyclase complex, soluble(GO:0008074) |
1.1 | 3.3 | GO:0032444 | activin responsive factor complex(GO:0032444) |
1.1 | 125.4 | GO:0005903 | brush border(GO:0005903) |
1.1 | 2.2 | GO:0071664 | catenin-TCF7L2 complex(GO:0071664) |
1.1 | 3.2 | GO:0034666 | integrin alpha2-beta1 complex(GO:0034666) |
1.0 | 1.0 | GO:0035749 | myelin sheath adaxonal region(GO:0035749) |
1.0 | 4.0 | GO:1990716 | axonemal central apparatus(GO:1990716) |
1.0 | 1.0 | GO:0032839 | dendrite cytoplasm(GO:0032839) |
1.0 | 5.9 | GO:0072357 | PTW/PP1 phosphatase complex(GO:0072357) |
1.0 | 11.8 | GO:0005641 | nuclear envelope lumen(GO:0005641) |
1.0 | 4.8 | GO:0042406 | extrinsic component of endoplasmic reticulum membrane(GO:0042406) |
1.0 | 1.9 | GO:0005899 | insulin receptor complex(GO:0005899) |
0.9 | 2.8 | GO:0046691 | intracellular canaliculus(GO:0046691) |
0.9 | 4.6 | GO:0032983 | kainate selective glutamate receptor complex(GO:0032983) |
0.9 | 3.7 | GO:0000938 | GARP complex(GO:0000938) |
0.9 | 1.8 | GO:0034274 | Atg12-Atg5-Atg16 complex(GO:0034274) |
0.9 | 3.6 | GO:0005610 | laminin-5 complex(GO:0005610) |
0.9 | 2.6 | GO:0070765 | gamma-secretase complex(GO:0070765) |
0.9 | 14.9 | GO:0016327 | apicolateral plasma membrane(GO:0016327) |
0.9 | 5.1 | GO:0071546 | pi-body(GO:0071546) |
0.8 | 17.0 | GO:0030057 | desmosome(GO:0030057) |
0.8 | 8.4 | GO:0016600 | flotillin complex(GO:0016600) |
0.8 | 1.7 | GO:0031088 | platelet dense granule membrane(GO:0031088) |
0.8 | 4.1 | GO:0097433 | dense body(GO:0097433) |
0.8 | 2.4 | GO:0016939 | kinesin II complex(GO:0016939) |
0.8 | 12.0 | GO:0042101 | T cell receptor complex(GO:0042101) |
0.8 | 2.4 | GO:0005944 | phosphatidylinositol 3-kinase complex, class IB(GO:0005944) |
0.8 | 6.3 | GO:0031143 | pseudopodium(GO:0031143) |
0.8 | 4.8 | GO:0097470 | ribbon synapse(GO:0097470) |
0.8 | 3.1 | GO:0005915 | zonula adherens(GO:0005915) |
0.8 | 4.6 | GO:0002177 | manchette(GO:0002177) |
0.8 | 1.5 | GO:0097524 | sperm plasma membrane(GO:0097524) |
0.8 | 3.0 | GO:0031465 | Cul4B-RING E3 ubiquitin ligase complex(GO:0031465) |
0.8 | 7.5 | GO:0036513 | Derlin-1 retrotranslocation complex(GO:0036513) |
0.8 | 3.0 | GO:0000125 | PCAF complex(GO:0000125) |
0.7 | 0.7 | GO:0042583 | chromaffin granule(GO:0042583) |
0.7 | 4.5 | GO:0044233 | ER-mitochondrion membrane contact site(GO:0044233) |
0.7 | 4.3 | GO:0016589 | NURF complex(GO:0016589) |
0.7 | 2.1 | GO:0033596 | TSC1-TSC2 complex(GO:0033596) |
0.7 | 66.7 | GO:0043296 | apical junction complex(GO:0043296) |
0.7 | 4.2 | GO:0002081 | outer acrosomal membrane(GO:0002081) |
0.7 | 10.5 | GO:0031430 | M band(GO:0031430) |
0.7 | 7.0 | GO:0033270 | paranode region of axon(GO:0033270) |
0.7 | 2.8 | GO:0030313 | cell outer membrane(GO:0009279) cell envelope(GO:0030313) external encapsulating structure part(GO:0044462) |
0.7 | 4.8 | GO:0099738 | cell cortex region(GO:0099738) |
0.7 | 4.7 | GO:0044300 | cerebellar mossy fiber(GO:0044300) |
0.7 | 2.0 | GO:0036488 | CHOP-C/EBP complex(GO:0036488) |
0.7 | 2.6 | GO:0071953 | elastic fiber(GO:0071953) |
0.6 | 3.2 | GO:0031315 | extrinsic component of mitochondrial outer membrane(GO:0031315) |
0.6 | 2.6 | GO:0097452 | GAIT complex(GO:0097452) |
0.6 | 1.9 | GO:0005879 | axonemal microtubule(GO:0005879) |
0.6 | 1.9 | GO:0034673 | inhibin-betaglycan-ActRII complex(GO:0034673) |
0.6 | 3.2 | GO:0001651 | dense fibrillar component(GO:0001651) |
0.6 | 15.0 | GO:0009925 | basal plasma membrane(GO:0009925) |
0.6 | 9.3 | GO:0043034 | costamere(GO:0043034) |
0.6 | 0.6 | GO:0031258 | lamellipodium membrane(GO:0031258) |
0.6 | 1.9 | GO:0008282 | ATP-sensitive potassium channel complex(GO:0008282) |
0.6 | 1.8 | GO:0005927 | muscle tendon junction(GO:0005927) |
0.6 | 13.4 | GO:0032154 | cleavage furrow(GO:0032154) cell surface furrow(GO:0097610) |
0.6 | 4.2 | GO:1904115 | axon cytoplasm(GO:1904115) |
0.6 | 4.2 | GO:0008385 | IkappaB kinase complex(GO:0008385) |
0.6 | 5.4 | GO:0032045 | guanyl-nucleotide exchange factor complex(GO:0032045) |
0.6 | 3.0 | GO:0034098 | VCP-NPL4-UFD1 AAA ATPase complex(GO:0034098) |
0.6 | 6.5 | GO:0042627 | chylomicron(GO:0042627) |
0.6 | 4.1 | GO:0033256 | I-kappaB/NF-kappaB complex(GO:0033256) |
0.6 | 2.4 | GO:0017071 | intracellular cyclic nucleotide activated cation channel complex(GO:0017071) |
0.6 | 2.3 | GO:0000444 | MIS12/MIND type complex(GO:0000444) |
0.6 | 1.1 | GO:0005658 | alpha DNA polymerase:primase complex(GO:0005658) |
0.6 | 57.4 | GO:0005925 | focal adhesion(GO:0005925) |
0.6 | 6.2 | GO:0035102 | PRC1 complex(GO:0035102) |
0.6 | 5.6 | GO:0032279 | asymmetric synapse(GO:0032279) |
0.6 | 1.7 | GO:0005967 | mitochondrial pyruvate dehydrogenase complex(GO:0005967) |
0.6 | 9.4 | GO:0005614 | interstitial matrix(GO:0005614) |
0.6 | 7.2 | GO:0030018 | Z disc(GO:0030018) |
0.5 | 0.5 | GO:0005775 | vacuolar lumen(GO:0005775) |
0.5 | 1.1 | GO:0030123 | AP-3 adaptor complex(GO:0030123) |
0.5 | 27.5 | GO:0019005 | SCF ubiquitin ligase complex(GO:0019005) |
0.5 | 11.2 | GO:0005865 | striated muscle thin filament(GO:0005865) |
0.5 | 2.1 | GO:0031983 | vesicle lumen(GO:0031983) |
0.5 | 2.6 | GO:0001891 | phagocytic cup(GO:0001891) |
0.5 | 22.8 | GO:0009295 | nucleoid(GO:0009295) mitochondrial nucleoid(GO:0042645) |
0.5 | 2.6 | GO:0031254 | uropod(GO:0001931) cell trailing edge(GO:0031254) |
0.5 | 3.6 | GO:0030008 | TRAPP complex(GO:0030008) |
0.5 | 0.5 | GO:0072534 | perineuronal net(GO:0072534) |
0.5 | 2.0 | GO:0008622 | epsilon DNA polymerase complex(GO:0008622) |
0.5 | 1.5 | GO:0070522 | ERCC4-ERCC1 complex(GO:0070522) |
0.5 | 1.0 | GO:0065010 | extracellular membrane-bounded organelle(GO:0065010) |
0.5 | 91.3 | GO:0016324 | apical plasma membrane(GO:0016324) |
0.5 | 3.0 | GO:0005952 | cAMP-dependent protein kinase complex(GO:0005952) |
0.5 | 1.5 | GO:0000802 | transverse filament(GO:0000802) |
0.5 | 2.4 | GO:0005916 | fascia adherens(GO:0005916) |
0.5 | 6.3 | GO:0097038 | perinuclear endoplasmic reticulum(GO:0097038) |
0.5 | 3.4 | GO:0000439 | core TFIIH complex(GO:0000439) |
0.5 | 3.2 | GO:0071014 | post-mRNA release spliceosomal complex(GO:0071014) |
0.5 | 0.9 | GO:0035032 | phosphatidylinositol 3-kinase complex, class III(GO:0035032) |
0.5 | 2.3 | GO:0005577 | fibrinogen complex(GO:0005577) |
0.4 | 0.9 | GO:0070033 | synaptobrevin 2-SNAP-25-syntaxin-1a-complexin II complex(GO:0070033) |
0.4 | 7.1 | GO:0005605 | basal lamina(GO:0005605) |
0.4 | 1.3 | GO:0072379 | BAT3 complex(GO:0071818) ER membrane insertion complex(GO:0072379) |
0.4 | 2.6 | GO:0034663 | endoplasmic reticulum chaperone complex(GO:0034663) |
0.4 | 1.3 | GO:0005785 | signal recognition particle receptor complex(GO:0005785) |
0.4 | 6.4 | GO:0032587 | ruffle membrane(GO:0032587) |
0.4 | 0.4 | GO:0033010 | paranodal junction(GO:0033010) |
0.4 | 4.7 | GO:0031903 | peroxisomal membrane(GO:0005778) microbody membrane(GO:0031903) |
0.4 | 0.4 | GO:0005712 | chiasma(GO:0005712) |
0.4 | 3.4 | GO:0005640 | nuclear outer membrane(GO:0005640) |
0.4 | 1.3 | GO:0020018 | ciliary pocket(GO:0020016) ciliary pocket membrane(GO:0020018) |
0.4 | 1.7 | GO:0030670 | phagocytic vesicle membrane(GO:0030670) |
0.4 | 11.2 | GO:0016235 | aggresome(GO:0016235) |
0.4 | 2.1 | GO:0048237 | rough endoplasmic reticulum lumen(GO:0048237) |
0.4 | 1.2 | GO:0031528 | microvillus membrane(GO:0031528) |
0.4 | 3.3 | GO:0042582 | primary lysosome(GO:0005766) azurophil granule(GO:0042582) |
0.4 | 10.2 | GO:0005771 | multivesicular body(GO:0005771) |
0.4 | 1.6 | GO:0002189 | ribose phosphate diphosphokinase complex(GO:0002189) |
0.4 | 2.8 | GO:0032420 | stereocilium(GO:0032420) |
0.4 | 3.6 | GO:0000815 | ESCRT III complex(GO:0000815) |
0.4 | 3.2 | GO:0035253 | ciliary rootlet(GO:0035253) |
0.4 | 1.2 | GO:0000811 | GINS complex(GO:0000811) |
0.4 | 15.4 | GO:0042641 | actomyosin(GO:0042641) |
0.4 | 128.5 | GO:0005667 | transcription factor complex(GO:0005667) |
0.4 | 5.9 | GO:0000242 | pericentriolar material(GO:0000242) |
0.4 | 3.5 | GO:0008250 | oligosaccharyltransferase complex(GO:0008250) |
0.4 | 2.7 | GO:0032593 | insulin-responsive compartment(GO:0032593) |
0.4 | 1.1 | GO:0090498 | extrinsic component of Golgi membrane(GO:0090498) |
0.4 | 4.5 | GO:0005583 | fibrillar collagen trimer(GO:0005583) banded collagen fibril(GO:0098643) |
0.4 | 0.4 | GO:1904949 | ATPase complex(GO:1904949) |
0.4 | 0.4 | GO:0036449 | microtubule minus-end(GO:0036449) |
0.4 | 35.7 | GO:0005770 | late endosome(GO:0005770) |
0.4 | 1.1 | GO:0017133 | mitochondrial electron transfer flavoprotein complex(GO:0017133) electron transfer flavoprotein complex(GO:0045251) |
0.4 | 1.1 | GO:0033162 | melanosome membrane(GO:0033162) chitosome(GO:0045009) |
0.4 | 0.4 | GO:0071439 | clathrin complex(GO:0071439) |
0.4 | 0.4 | GO:0044295 | axonal growth cone(GO:0044295) |
0.4 | 1.1 | GO:0030289 | protein phosphatase 4 complex(GO:0030289) |
0.4 | 7.4 | GO:0034451 | centriolar satellite(GO:0034451) |
0.4 | 4.2 | GO:0046930 | pore complex(GO:0046930) |
0.4 | 2.8 | GO:0042589 | zymogen granule membrane(GO:0042589) |
0.3 | 2.8 | GO:0000124 | SAGA complex(GO:0000124) |
0.3 | 5.2 | GO:0030014 | CCR4-NOT complex(GO:0030014) |
0.3 | 1.0 | GO:0030956 | glutamyl-tRNA(Gln) amidotransferase complex(GO:0030956) |
0.3 | 1.4 | GO:1990246 | uniplex complex(GO:1990246) |
0.3 | 0.7 | GO:0030132 | clathrin coat of coated pit(GO:0030132) |
0.3 | 4.1 | GO:0036038 | MKS complex(GO:0036038) |
0.3 | 5.8 | GO:0035327 | transcriptionally active chromatin(GO:0035327) |
0.3 | 1.7 | GO:0005638 | lamin filament(GO:0005638) |
0.3 | 16.5 | GO:0005884 | actin filament(GO:0005884) |
0.3 | 3.3 | GO:0000164 | protein phosphatase type 1 complex(GO:0000164) |
0.3 | 0.3 | GO:0044306 | neuron projection terminus(GO:0044306) |
0.3 | 4.0 | GO:0030667 | secretory granule membrane(GO:0030667) |
0.3 | 2.3 | GO:1990124 | messenger ribonucleoprotein complex(GO:1990124) |
0.3 | 2.5 | GO:0017059 | serine C-palmitoyltransferase complex(GO:0017059) endoplasmic reticulum palmitoyltransferase complex(GO:0031211) |
0.3 | 1.6 | GO:0098554 | cytoplasmic side of endoplasmic reticulum membrane(GO:0098554) |
0.3 | 0.9 | GO:0031084 | BLOC-2 complex(GO:0031084) |
0.3 | 0.9 | GO:0033185 | dolichol-phosphate-mannose synthase complex(GO:0033185) |
0.3 | 5.3 | GO:0005819 | spindle(GO:0005819) |
0.3 | 6.5 | GO:0019898 | extrinsic component of membrane(GO:0019898) |
0.3 | 3.7 | GO:0016328 | lateral plasma membrane(GO:0016328) |
0.3 | 1.8 | GO:0031209 | SCAR complex(GO:0031209) |
0.3 | 2.7 | GO:0005869 | dynactin complex(GO:0005869) |
0.3 | 1.8 | GO:1990023 | mitotic spindle midzone(GO:1990023) |
0.3 | 1.2 | GO:0000214 | tRNA-intron endonuclease complex(GO:0000214) |
0.3 | 1.5 | GO:0070937 | CRD-mediated mRNA stability complex(GO:0070937) |
0.3 | 1.2 | GO:0032389 | MutLalpha complex(GO:0032389) |
0.3 | 9.4 | GO:0019867 | outer membrane(GO:0019867) |
0.3 | 1.8 | GO:0000137 | Golgi cis cisterna(GO:0000137) |
0.3 | 1.5 | GO:0045254 | pyruvate dehydrogenase complex(GO:0045254) |
0.3 | 4.1 | GO:0070971 | endoplasmic reticulum exit site(GO:0070971) |
0.3 | 1.2 | GO:0031232 | extrinsic component of external side of plasma membrane(GO:0031232) |
0.3 | 1.5 | GO:0070938 | contractile ring(GO:0070938) |
0.3 | 3.5 | GO:0000930 | gamma-tubulin complex(GO:0000930) |
0.3 | 2.0 | GO:0036157 | outer dynein arm(GO:0036157) |
0.3 | 3.2 | GO:0000421 | autophagosome membrane(GO:0000421) |
0.3 | 1.4 | GO:0045121 | membrane raft(GO:0045121) membrane microdomain(GO:0098857) |
0.3 | 0.8 | GO:0097057 | TRAF2-GSTP1 complex(GO:0097057) |
0.3 | 16.0 | GO:0016323 | basolateral plasma membrane(GO:0016323) |
0.3 | 3.6 | GO:0051233 | spindle midzone(GO:0051233) |
0.3 | 3.8 | GO:0005905 | clathrin-coated pit(GO:0005905) |
0.3 | 0.3 | GO:0042827 | platelet dense granule(GO:0042827) |
0.3 | 1.1 | GO:0032591 | dendritic spine membrane(GO:0032591) |
0.3 | 7.6 | GO:0030686 | 90S preribosome(GO:0030686) |
0.3 | 1.3 | GO:0072687 | meiotic spindle(GO:0072687) |
0.3 | 0.8 | GO:0030897 | HOPS complex(GO:0030897) |
0.3 | 15.8 | GO:0016020 | membrane(GO:0016020) |
0.3 | 8.7 | GO:0016529 | sarcoplasmic reticulum(GO:0016529) |
0.3 | 0.3 | GO:0097651 | phosphatidylinositol 3-kinase complex, class I(GO:0097651) |
0.3 | 0.3 | GO:0044316 | cone cell pedicle(GO:0044316) |
0.3 | 0.8 | GO:0036454 | insulin-like growth factor binding protein complex(GO:0016942) growth factor complex(GO:0036454) insulin-like growth factor ternary complex(GO:0042567) |
0.3 | 1.0 | GO:0032009 | early phagosome(GO:0032009) |
0.3 | 1.6 | GO:0001650 | fibrillar center(GO:0001650) |
0.3 | 9.0 | GO:0046658 | anchored component of plasma membrane(GO:0046658) |
0.3 | 1.3 | GO:0030870 | Mre11 complex(GO:0030870) |
0.3 | 3.8 | GO:0022627 | cytosolic small ribosomal subunit(GO:0022627) |
0.3 | 11.9 | GO:0005604 | basement membrane(GO:0005604) |
0.3 | 1.8 | GO:0005801 | cis-Golgi network(GO:0005801) |
0.3 | 38.0 | GO:0005911 | cell-cell junction(GO:0005911) |
0.2 | 1.0 | GO:0030485 | smooth muscle contractile fiber(GO:0030485) |
0.2 | 22.2 | GO:0030176 | integral component of endoplasmic reticulum membrane(GO:0030176) |
0.2 | 0.5 | GO:0030127 | COPII vesicle coat(GO:0030127) |
0.2 | 0.7 | GO:0005745 | m-AAA complex(GO:0005745) |
0.2 | 0.7 | GO:0002199 | zona pellucida receptor complex(GO:0002199) |
0.2 | 2.7 | GO:0033655 | host cell cytoplasm(GO:0030430) host cell cytoplasm part(GO:0033655) |
0.2 | 15.6 | GO:0005581 | collagen trimer(GO:0005581) |
0.2 | 0.2 | GO:0030478 | actin cap(GO:0030478) |
0.2 | 4.4 | GO:0071011 | precatalytic spliceosome(GO:0071011) |
0.2 | 0.2 | GO:0045298 | tubulin complex(GO:0045298) |
0.2 | 1.0 | GO:0042613 | MHC class II protein complex(GO:0042613) |
0.2 | 1.0 | GO:0000408 | EKC/KEOPS complex(GO:0000408) |
0.2 | 1.2 | GO:0033503 | HULC complex(GO:0033503) |
0.2 | 0.2 | GO:0005818 | aster(GO:0005818) |
0.2 | 3.1 | GO:0035686 | sperm fibrous sheath(GO:0035686) |
0.2 | 1.2 | GO:0034385 | very-low-density lipoprotein particle(GO:0034361) triglyceride-rich lipoprotein particle(GO:0034385) |
0.2 | 0.2 | GO:1990923 | PET complex(GO:1990923) |
0.2 | 11.5 | GO:0043679 | axon terminus(GO:0043679) |
0.2 | 3.7 | GO:0005892 | acetylcholine-gated channel complex(GO:0005892) |
0.2 | 0.9 | GO:0000275 | mitochondrial proton-transporting ATP synthase complex, catalytic core F(1)(GO:0000275) proton-transporting ATP synthase complex, catalytic core F(1)(GO:0045261) |
0.2 | 2.3 | GO:0072686 | mitotic spindle(GO:0072686) |
0.2 | 0.2 | GO:0002142 | stereocilia ankle link complex(GO:0002142) |
0.2 | 0.9 | GO:0072487 | MSL complex(GO:0072487) |
0.2 | 0.7 | GO:0035985 | senescence-associated heterochromatin focus(GO:0035985) |
0.2 | 0.9 | GO:0070852 | cell body fiber(GO:0070852) |
0.2 | 9.8 | GO:0005881 | cytoplasmic microtubule(GO:0005881) |
0.2 | 8.2 | GO:0030173 | integral component of Golgi membrane(GO:0030173) |
0.2 | 0.9 | GO:0031588 | nucleotide-activated protein kinase complex(GO:0031588) |
0.2 | 0.7 | GO:0042585 | germinal vesicle(GO:0042585) |
0.2 | 1.3 | GO:0005942 | phosphatidylinositol 3-kinase complex(GO:0005942) |
0.2 | 0.2 | GO:0000220 | vacuolar proton-transporting V-type ATPase, V0 domain(GO:0000220) |
0.2 | 2.8 | GO:0005834 | heterotrimeric G-protein complex(GO:0005834) |
0.2 | 0.2 | GO:0042588 | zymogen granule(GO:0042588) |
0.2 | 1.7 | GO:0032588 | trans-Golgi network membrane(GO:0032588) |
0.2 | 1.5 | GO:0031931 | TORC1 complex(GO:0031931) |
0.2 | 1.2 | GO:0005677 | chromatin silencing complex(GO:0005677) |
0.2 | 2.1 | GO:0000176 | nuclear exosome (RNase complex)(GO:0000176) |
0.2 | 1.0 | GO:0033588 | Elongator holoenzyme complex(GO:0033588) |
0.2 | 3.1 | GO:0031305 | integral component of mitochondrial inner membrane(GO:0031305) |
0.2 | 0.2 | GO:1990423 | RZZ complex(GO:1990423) |
0.2 | 4.3 | GO:0061695 | transferase complex, transferring phosphorus-containing groups(GO:0061695) |
0.2 | 3.3 | GO:0008180 | COP9 signalosome(GO:0008180) |
0.2 | 0.6 | GO:0044611 | nuclear pore inner ring(GO:0044611) |
0.2 | 0.2 | GO:0044327 | dendritic spine head(GO:0044327) |
0.2 | 0.2 | GO:0071001 | U4/U6 snRNP(GO:0071001) |
0.2 | 1.4 | GO:0033391 | chromatoid body(GO:0033391) |
0.2 | 1.0 | GO:0031512 | motile primary cilium(GO:0031512) |
0.2 | 1.0 | GO:0051286 | cell tip(GO:0051286) |
0.2 | 7.4 | GO:0034707 | chloride channel complex(GO:0034707) |
0.2 | 0.2 | GO:0002079 | inner acrosomal membrane(GO:0002079) |
0.2 | 0.6 | GO:0000791 | euchromatin(GO:0000791) |
0.2 | 0.6 | GO:0061574 | ASAP complex(GO:0061574) |
0.2 | 2.1 | GO:0032039 | integrator complex(GO:0032039) |
0.2 | 6.9 | GO:0045095 | keratin filament(GO:0045095) |
0.2 | 0.6 | GO:0036396 | MIS complex(GO:0036396) |
0.2 | 0.9 | GO:0000407 | pre-autophagosomal structure(GO:0000407) |
0.2 | 0.4 | GO:0033268 | node of Ranvier(GO:0033268) |
0.2 | 0.4 | GO:0008290 | F-actin capping protein complex(GO:0008290) |
0.2 | 9.6 | GO:0098852 | lysosomal membrane(GO:0005765) lytic vacuole membrane(GO:0098852) |
0.2 | 8.5 | GO:0000922 | spindle pole(GO:0000922) |
0.2 | 0.2 | GO:0005896 | interleukin-6 receptor complex(GO:0005896) |
0.2 | 17.6 | GO:0000323 | lytic vacuole(GO:0000323) lysosome(GO:0005764) |
0.2 | 18.9 | GO:0005578 | proteinaceous extracellular matrix(GO:0005578) |
0.2 | 1.8 | GO:0030496 | midbody(GO:0030496) |
0.2 | 1.5 | GO:0098636 | protein complex involved in cell adhesion(GO:0098636) |
0.2 | 2.0 | GO:0046540 | U4/U6 x U5 tri-snRNP complex(GO:0046540) |
0.2 | 0.9 | GO:0090543 | Flemming body(GO:0090543) |
0.2 | 11.0 | GO:0005882 | intermediate filament(GO:0005882) |
0.2 | 0.4 | GO:0005793 | endoplasmic reticulum-Golgi intermediate compartment(GO:0005793) |
0.2 | 0.7 | GO:0048476 | Holliday junction resolvase complex(GO:0048476) |
0.2 | 2.0 | GO:0048786 | presynaptic active zone(GO:0048786) |
0.2 | 1.4 | GO:0031229 | integral component of nuclear inner membrane(GO:0005639) intrinsic component of nuclear inner membrane(GO:0031229) |
0.2 | 8.9 | GO:0016363 | nuclear matrix(GO:0016363) |
0.2 | 0.7 | GO:0005797 | Golgi medial cisterna(GO:0005797) |
0.2 | 0.9 | GO:0042470 | melanosome(GO:0042470) pigment granule(GO:0048770) |
0.2 | 4.3 | GO:0016592 | mediator complex(GO:0016592) |
0.2 | 0.2 | GO:0031091 | platelet alpha granule(GO:0031091) |
0.2 | 0.7 | GO:0043235 | receptor complex(GO:0043235) |
0.2 | 4.8 | GO:0005844 | polysome(GO:0005844) |
0.2 | 0.5 | GO:0016533 | cyclin-dependent protein kinase 5 holoenzyme complex(GO:0016533) |
0.2 | 0.3 | GO:0033179 | proton-transporting V-type ATPase, V0 domain(GO:0033179) |
0.2 | 0.8 | GO:0042575 | DNA polymerase complex(GO:0042575) |
0.2 | 0.7 | GO:0001726 | ruffle(GO:0001726) |
0.2 | 20.4 | GO:0005768 | endosome(GO:0005768) |
0.2 | 0.3 | GO:0034362 | low-density lipoprotein particle(GO:0034362) |
0.2 | 0.2 | GO:0097208 | alveolar lamellar body(GO:0097208) |
0.2 | 2.0 | GO:0043196 | varicosity(GO:0043196) |
0.2 | 0.2 | GO:0055087 | Ski complex(GO:0055087) |
0.2 | 4.8 | GO:0030139 | endocytic vesicle(GO:0030139) |
0.2 | 0.5 | GO:0030688 | preribosome, small subunit precursor(GO:0030688) |
0.2 | 6.4 | GO:0017053 | transcriptional repressor complex(GO:0017053) |
0.2 | 2.6 | GO:0005719 | nuclear euchromatin(GO:0005719) |
0.2 | 0.3 | GO:0005774 | vacuolar membrane(GO:0005774) |
0.2 | 293.4 | GO:0043230 | extracellular organelle(GO:0043230) |
0.2 | 8.3 | GO:0005777 | peroxisome(GO:0005777) microbody(GO:0042579) |
0.2 | 1.3 | GO:0017119 | Golgi transport complex(GO:0017119) |
0.2 | 0.5 | GO:0097504 | Gemini of coiled bodies(GO:0097504) |
0.2 | 0.6 | GO:1990726 | Lsm1-7-Pat1 complex(GO:1990726) |
0.2 | 0.5 | GO:0090661 | box H/ACA snoRNP complex(GO:0031429) box H/ACA RNP complex(GO:0072588) box H/ACA telomerase RNP complex(GO:0090661) |
0.2 | 30.3 | GO:0048471 | perinuclear region of cytoplasm(GO:0048471) |
0.2 | 53.1 | GO:0009986 | cell surface(GO:0009986) |
0.2 | 0.9 | GO:0030915 | Smc5-Smc6 complex(GO:0030915) |
0.2 | 0.8 | GO:0097542 | ciliary tip(GO:0097542) |
0.2 | 2.0 | GO:0005876 | spindle microtubule(GO:0005876) |
0.2 | 1.7 | GO:0000145 | exocyst(GO:0000145) |
0.1 | 0.7 | GO:1990752 | microtubule end(GO:1990752) |
0.1 | 6.0 | GO:0035097 | histone methyltransferase complex(GO:0035097) |
0.1 | 2.1 | GO:0035145 | exon-exon junction complex(GO:0035145) |
0.1 | 0.4 | GO:0071204 | histone pre-mRNA 3'end processing complex(GO:0071204) |
0.1 | 1.2 | GO:0071010 | prespliceosome(GO:0071010) |
0.1 | 0.3 | GO:0016281 | eukaryotic translation initiation factor 4F complex(GO:0016281) |
0.1 | 0.3 | GO:0030877 | beta-catenin destruction complex(GO:0030877) |
0.1 | 3.4 | GO:0000314 | organellar small ribosomal subunit(GO:0000314) mitochondrial small ribosomal subunit(GO:0005763) |
0.1 | 0.1 | GO:0060053 | neurofilament cytoskeleton(GO:0060053) |
0.1 | 0.8 | GO:0017146 | NMDA selective glutamate receptor complex(GO:0017146) |
0.1 | 0.4 | GO:0001674 | female germ cell nucleus(GO:0001674) |
0.1 | 69.6 | GO:0005886 | plasma membrane(GO:0005886) |
0.1 | 0.1 | GO:0097440 | apical dendrite(GO:0097440) |
0.1 | 0.7 | GO:0034464 | BBSome(GO:0034464) |
0.1 | 0.2 | GO:0000172 | ribonuclease MRP complex(GO:0000172) |
0.1 | 0.5 | GO:0032021 | NELF complex(GO:0032021) |
0.1 | 0.4 | GO:0097255 | R2TP complex(GO:0097255) |
0.1 | 0.4 | GO:0030061 | mitochondrial crista(GO:0030061) |
0.1 | 0.3 | GO:0000812 | Swr1 complex(GO:0000812) |
0.1 | 0.1 | GO:0030904 | retromer complex(GO:0030904) |
0.1 | 1.9 | GO:0030660 | Golgi-associated vesicle membrane(GO:0030660) |
0.1 | 0.5 | GO:0045177 | apical part of cell(GO:0045177) |
0.1 | 113.2 | GO:0005576 | extracellular region(GO:0005576) |
0.1 | 0.9 | GO:0031235 | intrinsic component of the cytoplasmic side of the plasma membrane(GO:0031235) |
0.1 | 1.8 | GO:0000307 | cyclin-dependent protein kinase holoenzyme complex(GO:0000307) |
0.1 | 0.1 | GO:0005850 | eukaryotic translation initiation factor 2 complex(GO:0005850) |
0.1 | 0.4 | GO:0001520 | outer dense fiber(GO:0001520) |
0.1 | 1.6 | GO:0031201 | SNARE complex(GO:0031201) |
0.1 | 69.2 | GO:0005739 | mitochondrion(GO:0005739) |
0.1 | 0.2 | GO:0000178 | exosome (RNase complex)(GO:0000178) |
0.1 | 3.3 | GO:0043204 | perikaryon(GO:0043204) |
0.1 | 0.9 | GO:0005665 | DNA-directed RNA polymerase II, core complex(GO:0005665) |
0.1 | 3.3 | GO:0031514 | motile cilium(GO:0031514) |
0.1 | 1.7 | GO:0005666 | DNA-directed RNA polymerase III complex(GO:0005666) |
0.1 | 0.1 | GO:1990075 | periciliary membrane compartment(GO:1990075) |
0.1 | 3.3 | GO:0031225 | anchored component of membrane(GO:0031225) |
0.1 | 0.5 | GO:0070775 | H3 histone acetyltransferase complex(GO:0070775) MOZ/MORF histone acetyltransferase complex(GO:0070776) |
0.1 | 351.8 | GO:0016021 | integral component of membrane(GO:0016021) |
0.1 | 0.1 | GO:0016222 | procollagen-proline 4-dioxygenase complex(GO:0016222) |
0.1 | 0.5 | GO:0031390 | Ctf18 RFC-like complex(GO:0031390) |
0.1 | 9.4 | GO:0035068 | micro-ribonucleoprotein complex(GO:0035068) |
0.1 | 2.0 | GO:0000795 | synaptonemal complex(GO:0000795) |
0.1 | 0.2 | GO:0033186 | CAF-1 complex(GO:0033186) |
0.1 | 0.3 | GO:0031464 | Cul4A-RING E3 ubiquitin ligase complex(GO:0031464) |
0.1 | 0.2 | GO:0097543 | ciliary inversin compartment(GO:0097543) |
0.1 | 0.8 | GO:0030687 | preribosome, large subunit precursor(GO:0030687) |
0.1 | 288.7 | GO:0044464 | cell part(GO:0044464) |
0.1 | 0.6 | GO:0043234 | protein complex(GO:0043234) |
0.0 | 0.2 | GO:0005623 | cell(GO:0005623) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
6.4 | 19.2 | GO:0015315 | hexose phosphate transmembrane transporter activity(GO:0015119) organophosphate:inorganic phosphate antiporter activity(GO:0015315) hexose-phosphate:inorganic phosphate antiporter activity(GO:0015526) glucose 6-phosphate:inorganic phosphate antiporter activity(GO:0061513) |
4.7 | 14.1 | GO:0035673 | oligopeptide transmembrane transporter activity(GO:0035673) |
3.9 | 3.9 | GO:0003872 | 6-phosphofructokinase activity(GO:0003872) |
3.8 | 19.2 | GO:0008559 | xenobiotic-transporting ATPase activity(GO:0008559) |
3.7 | 22.4 | GO:0008508 | bile acid:sodium symporter activity(GO:0008508) |
3.3 | 16.3 | GO:0004887 | thyroid hormone receptor activity(GO:0004887) |
3.1 | 9.3 | GO:0004104 | cholinesterase activity(GO:0004104) |
2.9 | 17.3 | GO:0016615 | malate dehydrogenase activity(GO:0016615) |
2.8 | 8.4 | GO:0016743 | carboxyl- or carbamoyltransferase activity(GO:0016743) |
2.5 | 7.4 | GO:0043546 | molybdopterin cofactor binding(GO:0043546) |
2.4 | 2.4 | GO:0004311 | farnesyltranstransferase activity(GO:0004311) |
2.3 | 7.0 | GO:0004359 | glutaminase activity(GO:0004359) |
2.3 | 11.6 | GO:0016174 | NAD(P)H oxidase activity(GO:0016174) |
2.3 | 6.8 | GO:0031708 | endothelin B receptor binding(GO:0031708) |
2.2 | 4.5 | GO:0038181 | bile acid receptor activity(GO:0038181) |
2.2 | 15.6 | GO:0019870 | potassium channel inhibitor activity(GO:0019870) |
2.2 | 15.5 | GO:0098632 | protein binding involved in cell-cell adhesion(GO:0098632) |
2.2 | 8.8 | GO:0031750 | D3 dopamine receptor binding(GO:0031750) |
2.2 | 17.3 | GO:0015321 | sodium-dependent phosphate transmembrane transporter activity(GO:0015321) |
2.1 | 6.4 | GO:0004605 | phosphatidate cytidylyltransferase activity(GO:0004605) |
2.1 | 10.7 | GO:0000099 | sulfur amino acid transmembrane transporter activity(GO:0000099) |
2.1 | 10.5 | GO:0070061 | fructose binding(GO:0070061) |
2.1 | 14.4 | GO:0050700 | CARD domain binding(GO:0050700) |
2.1 | 8.2 | GO:0051525 | NFAT protein binding(GO:0051525) |
2.0 | 8.2 | GO:0015173 | aromatic amino acid transmembrane transporter activity(GO:0015173) |
2.0 | 79.1 | GO:0004879 | RNA polymerase II transcription factor activity, ligand-activated sequence-specific DNA binding(GO:0004879) transcription factor activity, direct ligand regulated sequence-specific DNA binding(GO:0098531) |
2.0 | 6.1 | GO:0004427 | inorganic diphosphatase activity(GO:0004427) |
2.0 | 6.0 | GO:0061629 | RNA polymerase II sequence-specific DNA binding transcription factor binding(GO:0061629) |
1.9 | 11.1 | GO:0016936 | galactoside binding(GO:0016936) |
1.8 | 9.2 | GO:0015277 | kainate selective glutamate receptor activity(GO:0015277) |
1.8 | 5.5 | GO:0005078 | MAP-kinase scaffold activity(GO:0005078) |
1.8 | 19.9 | GO:0030898 | actin-dependent ATPase activity(GO:0030898) |
1.7 | 6.8 | GO:1990715 | mRNA CDS binding(GO:1990715) |
1.7 | 13.5 | GO:0019534 | toxin transporter activity(GO:0019534) |
1.7 | 5.0 | GO:0031697 | beta-1 adrenergic receptor binding(GO:0031697) |
1.6 | 4.9 | GO:0003829 | beta-1,3-galactosyl-O-glycosyl-glycoprotein beta-1,6-N-acetylglucosaminyltransferase activity(GO:0003829) |
1.6 | 6.6 | GO:0016361 | activin receptor activity, type I(GO:0016361) |
1.6 | 22.8 | GO:0034237 | protein kinase A regulatory subunit binding(GO:0034237) |
1.6 | 4.9 | GO:0043423 | 3-phosphoinositide-dependent protein kinase binding(GO:0043423) |
1.6 | 4.8 | GO:0004687 | myosin light chain kinase activity(GO:0004687) |
1.6 | 6.3 | GO:0005042 | netrin receptor activity(GO:0005042) |
1.5 | 20.1 | GO:0050811 | GABA receptor binding(GO:0050811) |
1.5 | 15.5 | GO:0070700 | BMP receptor binding(GO:0070700) |
1.5 | 7.7 | GO:0017169 | CDP-alcohol phosphatidyltransferase activity(GO:0017169) |
1.5 | 4.5 | GO:0048030 | disaccharide binding(GO:0048030) |
1.5 | 3.0 | GO:0015186 | L-asparagine transmembrane transporter activity(GO:0015182) L-glutamine transmembrane transporter activity(GO:0015186) |
1.5 | 4.5 | GO:0018479 | benzaldehyde dehydrogenase (NAD+) activity(GO:0018479) |
1.5 | 12.0 | GO:0004779 | sulfate adenylyltransferase activity(GO:0004779) |
1.5 | 5.9 | GO:0035727 | lysophosphatidic acid binding(GO:0035727) |
1.5 | 5.8 | GO:0004558 | alpha-1,4-glucosidase activity(GO:0004558) |
1.4 | 4.3 | GO:0030158 | protein xylosyltransferase activity(GO:0030158) |
1.4 | 2.9 | GO:0034594 | phosphatidylinositol trisphosphate phosphatase activity(GO:0034594) |
1.4 | 1.4 | GO:0004396 | glucokinase activity(GO:0004340) hexokinase activity(GO:0004396) |
1.4 | 4.1 | GO:0070698 | type I activin receptor binding(GO:0070698) |
1.4 | 6.8 | GO:0005007 | fibroblast growth factor-activated receptor activity(GO:0005007) |
1.4 | 17.6 | GO:0051765 | inositol tetrakisphosphate kinase activity(GO:0051765) |
1.3 | 2.7 | GO:0097109 | neuroligin family protein binding(GO:0097109) |
1.3 | 3.9 | GO:0060230 | lipoprotein lipase activator activity(GO:0060230) |
1.3 | 16.8 | GO:0030676 | Rac guanyl-nucleotide exchange factor activity(GO:0030676) |
1.3 | 2.6 | GO:0016312 | inositol bisphosphate phosphatase activity(GO:0016312) |
1.3 | 14.2 | GO:0030553 | cGMP binding(GO:0030553) |
1.3 | 11.5 | GO:0016857 | racemase and epimerase activity, acting on carbohydrates and derivatives(GO:0016857) |
1.3 | 3.8 | GO:0016508 | long-chain-enoyl-CoA hydratase activity(GO:0016508) |
1.3 | 1.3 | GO:0008948 | oxaloacetate decarboxylase activity(GO:0008948) |
1.3 | 13.9 | GO:0001972 | retinoic acid binding(GO:0001972) |
1.3 | 5.0 | GO:0015057 | thrombin receptor activity(GO:0015057) |
1.2 | 5.0 | GO:1901611 | phosphatidylglycerol binding(GO:1901611) |
1.2 | 3.7 | GO:0051870 | methotrexate binding(GO:0051870) |
1.2 | 1.2 | GO:0048495 | Roundabout binding(GO:0048495) |
1.2 | 3.7 | GO:0030144 | alpha-1,6-mannosylglycoprotein 6-beta-N-acetylglucosaminyltransferase activity(GO:0030144) |
1.2 | 67.8 | GO:0005089 | Rho guanyl-nucleotide exchange factor activity(GO:0005089) |
1.2 | 5.9 | GO:0005324 | long-chain fatty acid transporter activity(GO:0005324) |
1.2 | 7.1 | GO:0004322 | ferroxidase activity(GO:0004322) oxidoreductase activity, oxidizing metal ions, oxygen as acceptor(GO:0016724) |
1.2 | 7.0 | GO:0004385 | guanylate kinase activity(GO:0004385) |
1.2 | 3.5 | GO:0047623 | AMP deaminase activity(GO:0003876) adenosine-phosphate deaminase activity(GO:0047623) |
1.2 | 8.2 | GO:0003836 | beta-galactoside (CMP) alpha-2,3-sialyltransferase activity(GO:0003836) |
1.2 | 5.8 | GO:0015193 | L-proline transmembrane transporter activity(GO:0015193) |
1.2 | 3.5 | GO:0016802 | adenosylhomocysteinase activity(GO:0004013) trialkylsulfonium hydrolase activity(GO:0016802) |
1.1 | 4.6 | GO:0008532 | N-acetyllactosaminide beta-1,3-N-acetylglucosaminyltransferase activity(GO:0008532) |
1.1 | 3.4 | GO:0046573 | lactonohydrolase activity(GO:0046573) acyl-L-homoserine-lactone lactonohydrolase activity(GO:0102007) |
1.1 | 10.1 | GO:0004383 | guanylate cyclase activity(GO:0004383) |
1.1 | 11.2 | GO:0003884 | D-amino-acid oxidase activity(GO:0003884) |
1.1 | 4.4 | GO:0008443 | phosphofructokinase activity(GO:0008443) |
1.1 | 4.4 | GO:0070878 | primary miRNA binding(GO:0070878) |
1.1 | 6.6 | GO:0032050 | clathrin heavy chain binding(GO:0032050) |
1.1 | 4.4 | GO:0017128 | phospholipid scramblase activity(GO:0017128) |
1.1 | 13.0 | GO:0048407 | platelet-derived growth factor binding(GO:0048407) |
1.1 | 4.2 | GO:0051380 | norepinephrine binding(GO:0051380) |
1.1 | 3.2 | GO:0005001 | transmembrane receptor protein tyrosine phosphatase activity(GO:0005001) |
1.0 | 3.1 | GO:0052658 | inositol-1,4,5-trisphosphate 5-phosphatase activity(GO:0052658) |
1.0 | 9.2 | GO:0008093 | cytoskeletal adaptor activity(GO:0008093) |
1.0 | 3.1 | GO:0030943 | mitochondrion targeting sequence binding(GO:0030943) |
1.0 | 5.1 | GO:0001025 | RNA polymerase III transcription factor binding(GO:0001025) |
1.0 | 3.0 | GO:0015563 | uptake transmembrane transporter activity(GO:0015563) |
1.0 | 3.0 | GO:0004611 | phosphoenolpyruvate carboxykinase activity(GO:0004611) |
1.0 | 3.0 | GO:0045504 | dynein heavy chain binding(GO:0045504) |
1.0 | 5.0 | GO:1990380 | Lys48-specific deubiquitinase activity(GO:1990380) |
1.0 | 3.0 | GO:0030345 | extracellular matrix structural constituent conferring compression resistance(GO:0030021) structural constituent of tooth enamel(GO:0030345) |
1.0 | 1.0 | GO:0018423 | protein C-terminal carboxyl O-methyltransferase activity(GO:0003880) protein C-terminal leucine carboxyl O-methyltransferase activity(GO:0018423) |
1.0 | 9.8 | GO:0003993 | acid phosphatase activity(GO:0003993) |
1.0 | 13.4 | GO:0016493 | C-C chemokine receptor activity(GO:0016493) |
0.9 | 4.7 | GO:0008467 | [heparan sulfate]-glucosamine 3-sulfotransferase 1 activity(GO:0008467) |
0.9 | 2.8 | GO:0015154 | sucrose:proton symporter activity(GO:0008506) sucrose transmembrane transporter activity(GO:0008515) disaccharide transmembrane transporter activity(GO:0015154) oligosaccharide transmembrane transporter activity(GO:0015157) |
0.9 | 11.4 | GO:0008432 | JUN kinase binding(GO:0008432) |
0.9 | 10.4 | GO:0001730 | 2'-5'-oligoadenylate synthetase activity(GO:0001730) |
0.9 | 5.5 | GO:0004445 | inositol-polyphosphate 5-phosphatase activity(GO:0004445) |
0.9 | 5.5 | GO:0031419 | cobalamin binding(GO:0031419) |
0.9 | 2.7 | GO:0098748 | clathrin adaptor activity(GO:0035615) endocytic adaptor activity(GO:0098748) |
0.9 | 3.6 | GO:0015016 | [heparan sulfate]-glucosamine N-sulfotransferase activity(GO:0015016) |
0.9 | 1.8 | GO:0002094 | polyprenyltransferase activity(GO:0002094) |
0.9 | 2.7 | GO:0031686 | A1 adenosine receptor binding(GO:0031686) |
0.9 | 14.2 | GO:1900750 | glutathione binding(GO:0043295) oligopeptide binding(GO:1900750) |
0.9 | 2.7 | GO:0008449 | N-acetylglucosamine-6-sulfatase activity(GO:0008449) |
0.9 | 3.5 | GO:0036033 | mediator complex binding(GO:0036033) |
0.9 | 2.6 | GO:0008260 | 3-oxoacid CoA-transferase activity(GO:0008260) |
0.9 | 0.9 | GO:0047555 | 3',5'-cyclic-GMP phosphodiesterase activity(GO:0047555) |
0.9 | 2.6 | GO:0017153 | sodium:dicarboxylate symporter activity(GO:0017153) |
0.8 | 2.5 | GO:0004829 | threonine-tRNA ligase activity(GO:0004829) |
0.8 | 1.7 | GO:0098519 | nucleotide phosphatase activity, acting on free nucleotides(GO:0098519) |
0.8 | 2.5 | GO:0031685 | adenosine receptor binding(GO:0031685) |
0.8 | 5.8 | GO:0070097 | delta-catenin binding(GO:0070097) |
0.8 | 4.1 | GO:0035473 | lipase binding(GO:0035473) |
0.8 | 2.4 | GO:0070653 | high-density lipoprotein particle receptor binding(GO:0070653) |
0.8 | 2.4 | GO:0004345 | glucose-6-phosphate dehydrogenase activity(GO:0004345) |
0.8 | 0.8 | GO:0036042 | long-chain fatty acyl-CoA binding(GO:0036042) |
0.8 | 0.8 | GO:1990825 | sequence-specific mRNA binding(GO:1990825) |
0.8 | 4.0 | GO:0005072 | transforming growth factor beta receptor, cytoplasmic mediator activity(GO:0005072) |
0.8 | 5.6 | GO:0033743 | peptide-methionine (R)-S-oxide reductase activity(GO:0033743) |
0.8 | 19.9 | GO:0044688 | calmodulin-dependent cyclic-nucleotide phosphodiesterase activity(GO:0004117) cGMP-stimulated cyclic-nucleotide phosphodiesterase activity(GO:0004118) cGMP-inhibited cyclic-nucleotide phosphodiesterase activity(GO:0004119) photoreceptor cyclic-nucleotide phosphodiesterase activity(GO:0004120) 7,8-dihydro-D-neopterin 2',3'-cyclic phosphate phosphodiesterase activity(GO:0044688) inositol phosphosphingolipid phospholipase activity(GO:0052712) inositol phosphorylceramide phospholipase activity(GO:0052713) mannosyl-inositol phosphorylceramide phospholipase activity(GO:0052714) mannosyl-diinositol phosphorylceramide phospholipase activity(GO:0052715) |
0.8 | 2.4 | GO:0005220 | inositol 1,4,5-trisphosphate-sensitive calcium-release channel activity(GO:0005220) |
0.8 | 1.6 | GO:0005388 | calcium-transporting ATPase activity(GO:0005388) |
0.8 | 7.1 | GO:0016783 | sulfurtransferase activity(GO:0016783) |
0.8 | 17.5 | GO:0043027 | cysteine-type endopeptidase inhibitor activity involved in apoptotic process(GO:0043027) |
0.8 | 22.9 | GO:0042805 | actinin binding(GO:0042805) |
0.8 | 12.6 | GO:0015269 | calcium-activated potassium channel activity(GO:0015269) |
0.8 | 2.4 | GO:0042284 | sphingolipid delta-4 desaturase activity(GO:0042284) |
0.8 | 4.7 | GO:0019200 | carbohydrate kinase activity(GO:0019200) |
0.8 | 15.6 | GO:0015175 | neutral amino acid transmembrane transporter activity(GO:0015175) |
0.8 | 3.1 | GO:0042609 | CD4 receptor binding(GO:0042609) |
0.8 | 3.8 | GO:0015379 | potassium:chloride symporter activity(GO:0015379) potassium ion symporter activity(GO:0022820) |
0.8 | 3.0 | GO:0038064 | collagen receptor activity(GO:0038064) |
0.7 | 8.2 | GO:0010314 | phosphatidylinositol-5-phosphate binding(GO:0010314) |
0.7 | 10.2 | GO:0043274 | phospholipase binding(GO:0043274) |
0.7 | 4.4 | GO:0008603 | cAMP-dependent protein kinase regulator activity(GO:0008603) |
0.7 | 0.7 | GO:0005499 | vitamin D binding(GO:0005499) |
0.7 | 11.6 | GO:0015095 | magnesium ion transmembrane transporter activity(GO:0015095) |
0.7 | 1.4 | GO:0031871 | proteinase activated receptor binding(GO:0031871) |
0.7 | 2.2 | GO:0035650 | AP-1 adaptor complex binding(GO:0035650) |
0.7 | 4.3 | GO:0003997 | acyl-CoA oxidase activity(GO:0003997) |
0.7 | 2.8 | GO:0047023 | androsterone dehydrogenase activity(GO:0047023) |
0.7 | 2.1 | GO:0005415 | nucleoside:sodium symporter activity(GO:0005415) |
0.7 | 5.6 | GO:0003841 | 1-acylglycerol-3-phosphate O-acyltransferase activity(GO:0003841) |
0.7 | 3.5 | GO:0004957 | prostaglandin E receptor activity(GO:0004957) |
0.7 | 18.9 | GO:0046875 | ephrin receptor binding(GO:0046875) |
0.7 | 3.5 | GO:0005024 | transforming growth factor beta-activated receptor activity(GO:0005024) |
0.7 | 4.8 | GO:0050897 | cobalt ion binding(GO:0050897) |
0.7 | 2.1 | GO:0003726 | double-stranded RNA adenosine deaminase activity(GO:0003726) |
0.7 | 2.1 | GO:0045134 | uridine-diphosphatase activity(GO:0045134) |
0.7 | 2.1 | GO:0016838 | carbon-oxygen lyase activity, acting on phosphates(GO:0016838) |
0.7 | 2.7 | GO:0052796 | exo-alpha-sialidase activity(GO:0004308) alpha-sialidase activity(GO:0016997) exo-alpha-(2->3)-sialidase activity(GO:0052794) exo-alpha-(2->6)-sialidase activity(GO:0052795) exo-alpha-(2->8)-sialidase activity(GO:0052796) |
0.7 | 7.4 | GO:0070006 | metalloaminopeptidase activity(GO:0070006) |
0.7 | 2.0 | GO:0019166 | trans-2-enoyl-CoA reductase (NADPH) activity(GO:0019166) |
0.7 | 2.0 | GO:0030274 | LIM domain binding(GO:0030274) |
0.7 | 9.4 | GO:0015106 | bicarbonate transmembrane transporter activity(GO:0015106) |
0.7 | 13.4 | GO:0004551 | nucleotide diphosphatase activity(GO:0004551) |
0.7 | 4.7 | GO:0008494 | translation activator activity(GO:0008494) |
0.7 | 4.0 | GO:0047035 | testosterone dehydrogenase (NAD+) activity(GO:0047035) |
0.7 | 6.0 | GO:0005068 | transmembrane receptor protein tyrosine kinase adaptor activity(GO:0005068) |
0.7 | 3.3 | GO:0048403 | brain-derived neurotrophic factor binding(GO:0048403) |
0.7 | 2.7 | GO:0017162 | aryl hydrocarbon receptor binding(GO:0017162) |
0.7 | 1.3 | GO:0001191 | transcriptional repressor activity, RNA polymerase II transcription factor binding(GO:0001191) |
0.7 | 2.0 | GO:0019862 | IgA binding(GO:0019862) |
0.7 | 7.2 | GO:0005523 | tropomyosin binding(GO:0005523) |
0.7 | 2.0 | GO:0004726 | non-membrane spanning protein tyrosine phosphatase activity(GO:0004726) |
0.7 | 3.3 | GO:0032407 | MutSalpha complex binding(GO:0032407) |
0.7 | 2.0 | GO:0047756 | chondroitin 4-sulfotransferase activity(GO:0047756) |
0.6 | 3.2 | GO:0004758 | serine C-palmitoyltransferase activity(GO:0004758) |
0.6 | 3.9 | GO:0038132 | neuregulin binding(GO:0038132) |
0.6 | 10.2 | GO:0030506 | ankyrin binding(GO:0030506) |
0.6 | 5.7 | GO:0043522 | leucine zipper domain binding(GO:0043522) |
0.6 | 1.3 | GO:0008384 | IkappaB kinase activity(GO:0008384) |
0.6 | 5.7 | GO:0003796 | lysozyme activity(GO:0003796) |
0.6 | 3.8 | GO:0050543 | icosatetraenoic acid binding(GO:0050543) |
0.6 | 2.4 | GO:0016899 | oxidoreductase activity, acting on the CH-OH group of donors, oxygen as acceptor(GO:0016899) |
0.6 | 7.3 | GO:0005545 | 1-phosphatidylinositol binding(GO:0005545) |
0.6 | 1.2 | GO:0042731 | PH domain binding(GO:0042731) |
0.6 | 7.9 | GO:0022841 | potassium ion leak channel activity(GO:0022841) |
0.6 | 1.2 | GO:0031013 | troponin I binding(GO:0031013) |
0.6 | 6.6 | GO:0005451 | monovalent cation:proton antiporter activity(GO:0005451) |
0.6 | 2.4 | GO:0000340 | RNA 7-methylguanosine cap binding(GO:0000340) |
0.6 | 5.3 | GO:0044548 | S100 protein binding(GO:0044548) |
0.6 | 1.8 | GO:0071535 | RING-like zinc finger domain binding(GO:0071535) |
0.6 | 3.5 | GO:0016933 | extracellular-glycine-gated ion channel activity(GO:0016933) extracellular-glycine-gated chloride channel activity(GO:0016934) |
0.6 | 1.8 | GO:0016842 | amidine-lyase activity(GO:0016842) |
0.6 | 8.2 | GO:0034185 | apolipoprotein binding(GO:0034185) |
0.6 | 1.8 | GO:0004416 | hydroxyacylglutathione hydrolase activity(GO:0004416) |
0.6 | 1.8 | GO:0000774 | adenyl-nucleotide exchange factor activity(GO:0000774) |
0.6 | 0.6 | GO:0080130 | L-phenylalanine:2-oxoglutarate aminotransferase activity(GO:0080130) |
0.6 | 2.3 | GO:0046934 | phosphatidylinositol-4,5-bisphosphate 3-kinase activity(GO:0046934) |
0.6 | 2.3 | GO:0004449 | isocitrate dehydrogenase (NAD+) activity(GO:0004449) |
0.6 | 1.7 | GO:0050833 | pyruvate transmembrane transporter activity(GO:0050833) |
0.6 | 1.7 | GO:0004999 | vasoactive intestinal polypeptide receptor activity(GO:0004999) |
0.6 | 1.1 | GO:0030911 | TPR domain binding(GO:0030911) |
0.6 | 10.8 | GO:0005031 | tumor necrosis factor-activated receptor activity(GO:0005031) death receptor activity(GO:0005035) |
0.6 | 19.8 | GO:0005044 | scavenger receptor activity(GO:0005044) |
0.6 | 3.9 | GO:0016308 | 1-phosphatidylinositol-4-phosphate 5-kinase activity(GO:0016308) |
0.6 | 0.6 | GO:0005350 | purine nucleobase transmembrane transporter activity(GO:0005345) pyrimidine nucleobase transmembrane transporter activity(GO:0005350) nucleobase transmembrane transporter activity(GO:0015205) |
0.6 | 3.9 | GO:0000014 | single-stranded DNA endodeoxyribonuclease activity(GO:0000014) |
0.6 | 3.9 | GO:0051864 | histone demethylase activity (H3-K36 specific)(GO:0051864) |
0.6 | 2.8 | GO:0035184 | histone threonine kinase activity(GO:0035184) |
0.6 | 1.7 | GO:0004920 | interleukin-10 receptor activity(GO:0004920) |
0.5 | 3.8 | GO:0004579 | dolichyl-diphosphooligosaccharide-protein glycotransferase activity(GO:0004579) |
0.5 | 1.6 | GO:0015093 | ferrous iron transmembrane transporter activity(GO:0015093) |
0.5 | 3.8 | GO:0047372 | acylglycerol lipase activity(GO:0047372) |
0.5 | 2.2 | GO:0005047 | signal recognition particle binding(GO:0005047) |
0.5 | 1.6 | GO:0005094 | Rho GDP-dissociation inhibitor activity(GO:0005094) |
0.5 | 1.6 | GO:0031493 | nucleosomal histone binding(GO:0031493) |
0.5 | 7.6 | GO:0004012 | phospholipid-translocating ATPase activity(GO:0004012) |
0.5 | 8.0 | GO:0004653 | polypeptide N-acetylgalactosaminyltransferase activity(GO:0004653) |
0.5 | 2.1 | GO:0016018 | cyclosporin A binding(GO:0016018) |
0.5 | 1.6 | GO:0048248 | CXCR3 chemokine receptor binding(GO:0048248) |
0.5 | 6.4 | GO:0070016 | armadillo repeat domain binding(GO:0070016) |
0.5 | 1.6 | GO:0042296 | ISG15 transferase activity(GO:0042296) |
0.5 | 3.7 | GO:0008140 | cAMP response element binding protein binding(GO:0008140) |
0.5 | 0.5 | GO:0071253 | connexin binding(GO:0071253) |
0.5 | 9.9 | GO:0071889 | 14-3-3 protein binding(GO:0071889) |
0.5 | 1.6 | GO:0019961 | interferon binding(GO:0019961) |
0.5 | 2.1 | GO:0017127 | cholesterol transporter activity(GO:0017127) |
0.5 | 0.5 | GO:0043812 | phosphatidylinositol-4-phosphate phosphatase activity(GO:0043812) |
0.5 | 1.0 | GO:0045505 | dynein intermediate chain binding(GO:0045505) |
0.5 | 4.6 | GO:0001784 | phosphotyrosine binding(GO:0001784) |
0.5 | 18.1 | GO:0030374 | ligand-dependent nuclear receptor transcription coactivator activity(GO:0030374) |
0.5 | 6.5 | GO:0008307 | structural constituent of muscle(GO:0008307) |
0.5 | 11.4 | GO:0005212 | structural constituent of eye lens(GO:0005212) |
0.5 | 1.5 | GO:0055056 | D-glucose transmembrane transporter activity(GO:0055056) |
0.5 | 23.8 | GO:0005200 | structural constituent of cytoskeleton(GO:0005200) |
0.5 | 1.9 | GO:0043184 | vascular endothelial growth factor receptor 2 binding(GO:0043184) |
0.5 | 2.4 | GO:0070290 | N-acylphosphatidylethanolamine-specific phospholipase D activity(GO:0070290) |
0.5 | 1.4 | GO:0008517 | folic acid transporter activity(GO:0008517) |
0.5 | 6.3 | GO:0001671 | ATPase activator activity(GO:0001671) |
0.5 | 1.4 | GO:0008321 | Ral guanyl-nucleotide exchange factor activity(GO:0008321) |
0.5 | 4.8 | GO:0031210 | phosphatidylcholine binding(GO:0031210) |
0.5 | 5.2 | GO:0004312 | fatty acid synthase activity(GO:0004312) |
0.5 | 1.4 | GO:0004300 | enoyl-CoA hydratase activity(GO:0004300) |
0.5 | 1.9 | GO:0036041 | long-chain fatty acid binding(GO:0036041) |
0.5 | 0.9 | GO:0000026 | alpha-1,2-mannosyltransferase activity(GO:0000026) |
0.5 | 1.4 | GO:0004477 | methenyltetrahydrofolate cyclohydrolase activity(GO:0004477) methylenetetrahydrofolate dehydrogenase (NAD+) activity(GO:0004487) |
0.5 | 5.1 | GO:0016813 | hydrolase activity, acting on carbon-nitrogen (but not peptide) bonds, in linear amidines(GO:0016813) |
0.5 | 1.4 | GO:0004739 | pyruvate dehydrogenase (acetyl-transferring) activity(GO:0004739) |
0.5 | 0.5 | GO:0008656 | cysteine-type endopeptidase activator activity involved in apoptotic process(GO:0008656) |
0.5 | 4.1 | GO:0048156 | tau protein binding(GO:0048156) |
0.5 | 1.4 | GO:0004948 | calcitonin receptor activity(GO:0004948) |
0.5 | 10.4 | GO:0035591 | signaling adaptor activity(GO:0035591) |
0.5 | 2.7 | GO:0019855 | calcium channel inhibitor activity(GO:0019855) |
0.4 | 1.8 | GO:0070051 | fibrinogen binding(GO:0070051) |
0.4 | 9.4 | GO:0030332 | cyclin binding(GO:0030332) |
0.4 | 3.1 | GO:0019841 | retinol binding(GO:0019841) |
0.4 | 2.2 | GO:0035033 | histone deacetylase regulator activity(GO:0035033) |
0.4 | 1.8 | GO:0015299 | solute:proton antiporter activity(GO:0015299) |
0.4 | 1.3 | GO:0051434 | BH3 domain binding(GO:0051434) |
0.4 | 0.4 | GO:0001190 | transcriptional activator activity, RNA polymerase II transcription factor binding(GO:0001190) transcriptional repressor activity, RNA polymerase II activating transcription factor binding(GO:0098811) |
0.4 | 0.9 | GO:0033142 | progesterone receptor binding(GO:0033142) |
0.4 | 1.3 | GO:0019002 | GMP binding(GO:0019002) |
0.4 | 4.4 | GO:0061650 | ubiquitin-like protein conjugating enzyme activity(GO:0061650) |
0.4 | 9.6 | GO:0004448 | isocitrate dehydrogenase activity(GO:0004448) |
0.4 | 6.1 | GO:0008143 | poly(A) binding(GO:0008143) |
0.4 | 2.6 | GO:0004466 | long-chain-acyl-CoA dehydrogenase activity(GO:0004466) |
0.4 | 1.3 | GO:0043515 | kinetochore binding(GO:0043515) |
0.4 | 2.6 | GO:1901682 | sulfur compound transmembrane transporter activity(GO:1901682) |
0.4 | 0.4 | GO:0008142 | oxysterol binding(GO:0008142) |
0.4 | 5.9 | GO:0016290 | palmitoyl-CoA hydrolase activity(GO:0016290) |
0.4 | 0.4 | GO:0004720 | protein-lysine 6-oxidase activity(GO:0004720) |
0.4 | 0.8 | GO:0015198 | oligopeptide transporter activity(GO:0015198) |
0.4 | 4.2 | GO:0033130 | acetylcholine receptor binding(GO:0033130) |
0.4 | 1.3 | GO:0017166 | vinculin binding(GO:0017166) |
0.4 | 1.7 | GO:0003945 | N-acetyllactosamine synthase activity(GO:0003945) |
0.4 | 0.8 | GO:0097642 | calcitonin family receptor activity(GO:0097642) |
0.4 | 5.8 | GO:0004745 | retinol dehydrogenase activity(GO:0004745) |
0.4 | 13.3 | GO:0044390 | ubiquitin-like protein conjugating enzyme binding(GO:0044390) |
0.4 | 1.7 | GO:0000213 | tRNA-intron endonuclease activity(GO:0000213) |
0.4 | 2.1 | GO:0042809 | vitamin D receptor binding(GO:0042809) |
0.4 | 7.5 | GO:0035255 | ionotropic glutamate receptor binding(GO:0035255) |
0.4 | 2.1 | GO:0031730 | CCR5 chemokine receptor binding(GO:0031730) |
0.4 | 0.8 | GO:0070492 | oligosaccharide binding(GO:0070492) |
0.4 | 1.6 | GO:0004740 | pyruvate dehydrogenase (acetyl-transferring) kinase activity(GO:0004740) |
0.4 | 19.3 | GO:0005518 | collagen binding(GO:0005518) |
0.4 | 2.0 | GO:0004111 | creatine kinase activity(GO:0004111) |
0.4 | 2.5 | GO:0001135 | transcription factor activity, RNA polymerase II transcription factor recruiting(GO:0001135) |
0.4 | 1.6 | GO:0004749 | ribose phosphate diphosphokinase activity(GO:0004749) |
0.4 | 1.6 | GO:0031957 | very long-chain fatty acid-CoA ligase activity(GO:0031957) |
0.4 | 1.6 | GO:0051022 | Rho GDP-dissociation inhibitor binding(GO:0051022) |
0.4 | 1.2 | GO:0004771 | sterol esterase activity(GO:0004771) |
0.4 | 2.0 | GO:0097157 | pre-mRNA intronic binding(GO:0097157) |
0.4 | 2.4 | GO:0032036 | myosin heavy chain binding(GO:0032036) |
0.4 | 0.8 | GO:0098821 | BMP receptor activity(GO:0098821) |
0.4 | 2.0 | GO:0001077 | transcriptional activator activity, RNA polymerase II core promoter proximal region sequence-specific binding(GO:0001077) |
0.4 | 18.8 | GO:0016628 | oxidoreductase activity, acting on the CH-CH group of donors, NAD or NADP as acceptor(GO:0016628) |
0.4 | 4.8 | GO:0017081 | chloride channel regulator activity(GO:0017081) |
0.4 | 1.2 | GO:0004616 | phosphogluconate dehydrogenase (decarboxylating) activity(GO:0004616) |
0.4 | 1.2 | GO:0043237 | laminin-1 binding(GO:0043237) |
0.4 | 15.0 | GO:0031593 | polyubiquitin binding(GO:0031593) |
0.4 | 1.2 | GO:0035005 | 1-phosphatidylinositol-4-phosphate 3-kinase activity(GO:0035005) |
0.4 | 2.8 | GO:0043236 | laminin binding(GO:0043236) |
0.4 | 1.9 | GO:0046975 | histone methyltransferase activity (H3-K36 specific)(GO:0046975) |
0.4 | 4.3 | GO:0023026 | MHC class II protein complex binding(GO:0023026) |
0.4 | 1.2 | GO:0005006 | epidermal growth factor-activated receptor activity(GO:0005006) |
0.4 | 1.9 | GO:0003988 | acetyl-CoA C-acyltransferase activity(GO:0003988) |
0.4 | 1.2 | GO:0030280 | structural constituent of epidermis(GO:0030280) |
0.4 | 1.9 | GO:0001609 | G-protein coupled adenosine receptor activity(GO:0001609) |
0.4 | 3.0 | GO:0032183 | SUMO binding(GO:0032183) |
0.4 | 1.1 | GO:0022833 | mechanically-gated ion channel activity(GO:0008381) mechanically gated channel activity(GO:0022833) |
0.4 | 0.8 | GO:1990381 | ubiquitin-specific protease binding(GO:1990381) |
0.4 | 1.1 | GO:0016716 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, another compound as one donor, and incorporation of one atom of oxygen(GO:0016716) |
0.4 | 3.8 | GO:0035259 | glucocorticoid receptor binding(GO:0035259) |
0.4 | 1.9 | GO:0001588 | dopamine neurotransmitter receptor activity, coupled via Gs(GO:0001588) dopamine neurotransmitter receptor activity(GO:0004952) |
0.4 | 3.7 | GO:0051010 | microtubule plus-end binding(GO:0051010) |
0.4 | 0.7 | GO:1990430 | extracellular matrix protein binding(GO:1990430) |
0.4 | 1.5 | GO:0003696 | satellite DNA binding(GO:0003696) |
0.4 | 5.1 | GO:0017049 | GTP-Rho binding(GO:0017049) |
0.4 | 7.0 | GO:0045296 | cadherin binding(GO:0045296) |
0.4 | 2.6 | GO:0034784 | pivalyl-CoA mutase activity(GO:0034784) o-hydroxylaminobenzoate mutase activity(GO:0034951) lupeol synthase activity(GO:0042299) beta-amyrin synthase activity(GO:0042300) baruol synthase activity(GO:0080011) |
0.4 | 0.7 | GO:0017089 | glycolipid transporter activity(GO:0017089) |
0.4 | 0.7 | GO:0005219 | ryanodine-sensitive calcium-release channel activity(GO:0005219) |
0.4 | 13.0 | GO:0005109 | frizzled binding(GO:0005109) |
0.4 | 0.7 | GO:0000386 | second spliceosomal transesterification activity(GO:0000386) |
0.4 | 0.7 | GO:0032558 | adenyl deoxyribonucleotide binding(GO:0032558) dATP binding(GO:0032564) |
0.4 | 0.7 | GO:0005095 | GTPase inhibitor activity(GO:0005095) |
0.4 | 2.9 | GO:0030228 | lipoprotein particle receptor activity(GO:0030228) |
0.4 | 1.1 | GO:0035663 | Toll-like receptor 2 binding(GO:0035663) |
0.4 | 3.5 | GO:0008641 | small protein activating enzyme activity(GO:0008641) |
0.3 | 0.7 | GO:0008970 | phosphatidylcholine 1-acylhydrolase activity(GO:0008970) |
0.3 | 1.7 | GO:0005159 | insulin-like growth factor receptor binding(GO:0005159) |
0.3 | 10.7 | GO:0017017 | MAP kinase tyrosine/serine/threonine phosphatase activity(GO:0017017) |
0.3 | 7.6 | GO:0016790 | thiolester hydrolase activity(GO:0016790) |
0.3 | 1.0 | GO:0050567 | glutaminyl-tRNA synthase (glutamine-hydrolyzing) activity(GO:0050567) |
0.3 | 5.2 | GO:0004089 | carbonate dehydratase activity(GO:0004089) |
0.3 | 0.7 | GO:0035175 | histone kinase activity (H3-S10 specific)(GO:0035175) |
0.3 | 0.3 | GO:2001070 | starch binding(GO:2001070) |
0.3 | 0.3 | GO:0016814 | hydrolase activity, acting on carbon-nitrogen (but not peptide) bonds, in cyclic amidines(GO:0016814) |
0.3 | 1.0 | GO:0003917 | DNA topoisomerase type I activity(GO:0003917) |
0.3 | 1.0 | GO:0004082 | bisphosphoglycerate mutase activity(GO:0004082) phosphoglycerate mutase activity(GO:0004619) 2,3-bisphosphoglycerate-dependent phosphoglycerate mutase activity(GO:0046538) |
0.3 | 1.0 | GO:0004430 | 1-phosphatidylinositol 4-kinase activity(GO:0004430) |
0.3 | 1.3 | GO:0016833 | oxo-acid-lyase activity(GO:0016833) |
0.3 | 3.0 | GO:0043759 | 3-oxo-2-(2'-pentenyl)cyclopentane-1-octanoic acid CoA ligase activity(GO:0010435) 3-isopropenyl-6-oxoheptanoyl-CoA synthetase activity(GO:0018854) 2-oxo-delta3-4,5,5-trimethylcyclopentenylacetyl-CoA synthetase activity(GO:0018855) benzoyl acetate-CoA ligase activity(GO:0018856) 2,4-dichlorobenzoate-CoA ligase activity(GO:0018857) pivalate-CoA ligase activity(GO:0034783) cyclopropanecarboxylate-CoA ligase activity(GO:0034793) adipate-CoA ligase activity(GO:0034796) citronellyl-CoA ligase activity(GO:0034823) mentha-1,3-dione-CoA ligase activity(GO:0034841) thiophene-2-carboxylate-CoA ligase activity(GO:0034842) 2,4,4-trimethylpentanoate-CoA ligase activity(GO:0034865) cis-2-methyl-5-isopropylhexa-2,5-dienoate-CoA ligase activity(GO:0034942) trans-2-methyl-5-isopropylhexa-2,5-dienoate-CoA ligase activity(GO:0034943) branched-chain acyl-CoA synthetase (ADP-forming) activity(GO:0043759) aryl-CoA synthetase (ADP-forming) activity(GO:0043762) 3-hydroxypropionyl-CoA synthetase activity(GO:0043955) perillic acid:CoA ligase (ADP-forming) activity(GO:0052685) perillic acid:CoA ligase (AMP-forming) activity(GO:0052686) (3R)-3-isopropenyl-6-oxoheptanoate:CoA ligase (ADP-forming) activity(GO:0052687) (3R)-3-isopropenyl-6-oxoheptanoate:CoA ligase (AMP-forming) activity(GO:0052688) pristanate-CoA ligase activity(GO:0070251) malonyl-CoA synthetase activity(GO:0090409) |
0.3 | 3.3 | GO:0015129 | lactate transmembrane transporter activity(GO:0015129) |
0.3 | 2.3 | GO:0051400 | BH domain binding(GO:0051400) |
0.3 | 2.3 | GO:0004661 | protein geranylgeranyltransferase activity(GO:0004661) |
0.3 | 1.0 | GO:0008107 | galactoside 2-alpha-L-fucosyltransferase activity(GO:0008107) alpha-(1,2)-fucosyltransferase activity(GO:0031127) |
0.3 | 1.0 | GO:0046923 | ER retention sequence binding(GO:0046923) |
0.3 | 2.3 | GO:0008889 | glycerophosphodiester phosphodiesterase activity(GO:0008889) |
0.3 | 3.6 | GO:0015125 | bile acid transmembrane transporter activity(GO:0015125) |
0.3 | 2.3 | GO:0015238 | drug transmembrane transporter activity(GO:0015238) |
0.3 | 0.3 | GO:0070915 | lysophosphatidic acid receptor activity(GO:0070915) |
0.3 | 31.8 | GO:0004222 | metalloendopeptidase activity(GO:0004222) |
0.3 | 0.3 | GO:0017098 | sulfonylurea receptor binding(GO:0017098) |
0.3 | 3.2 | GO:0070064 | proline-rich region binding(GO:0070064) |
0.3 | 7.4 | GO:0019239 | deaminase activity(GO:0019239) |
0.3 | 7.7 | GO:0003887 | DNA-directed DNA polymerase activity(GO:0003887) |
0.3 | 9.6 | GO:0051723 | protein methylesterase activity(GO:0051723) |
0.3 | 0.3 | GO:0004181 | metallocarboxypeptidase activity(GO:0004181) |
0.3 | 5.4 | GO:0030291 | protein serine/threonine kinase inhibitor activity(GO:0030291) |
0.3 | 0.6 | GO:0008240 | tripeptidyl-peptidase activity(GO:0008240) |
0.3 | 3.8 | GO:0004602 | glutathione peroxidase activity(GO:0004602) |
0.3 | 0.6 | GO:0097016 | L27 domain binding(GO:0097016) |
0.3 | 5.4 | GO:0005229 | intracellular calcium activated chloride channel activity(GO:0005229) |
0.3 | 8.2 | GO:0015485 | cholesterol binding(GO:0015485) |
0.3 | 10.0 | GO:0004715 | non-membrane spanning protein tyrosine kinase activity(GO:0004715) |
0.3 | 0.3 | GO:0047045 | testosterone 17-beta-dehydrogenase (NADP+) activity(GO:0047045) |
0.3 | 2.5 | GO:0015651 | quaternary ammonium group transmembrane transporter activity(GO:0015651) |
0.3 | 1.9 | GO:0050308 | sugar-phosphatase activity(GO:0050308) |
0.3 | 6.2 | GO:0051879 | Hsp90 protein binding(GO:0051879) |
0.3 | 0.9 | GO:0004813 | alanine-tRNA ligase activity(GO:0004813) |
0.3 | 2.8 | GO:0001013 | RNA polymerase I regulatory region DNA binding(GO:0001013) |
0.3 | 48.4 | GO:0061630 | ubiquitin protein ligase activity(GO:0061630) |
0.3 | 3.4 | GO:0004185 | serine-type carboxypeptidase activity(GO:0004185) |
0.3 | 5.9 | GO:0005086 | ARF guanyl-nucleotide exchange factor activity(GO:0005086) |
0.3 | 0.6 | GO:0071553 | uridine nucleotide receptor activity(GO:0015065) G-protein coupled pyrimidinergic nucleotide receptor activity(GO:0071553) |
0.3 | 1.8 | GO:0004806 | triglyceride lipase activity(GO:0004806) |
0.3 | 1.5 | GO:0004075 | biotin carboxylase activity(GO:0004075) |
0.3 | 3.4 | GO:0004865 | protein serine/threonine phosphatase inhibitor activity(GO:0004865) |
0.3 | 1.2 | GO:0036374 | gamma-glutamyltransferase activity(GO:0003840) glutathione hydrolase activity(GO:0036374) |
0.3 | 3.1 | GO:0008353 | RNA polymerase II carboxy-terminal domain kinase activity(GO:0008353) |
0.3 | 3.1 | GO:0005522 | profilin binding(GO:0005522) |
0.3 | 0.9 | GO:0090482 | vitamin transmembrane transporter activity(GO:0090482) |
0.3 | 1.5 | GO:0003906 | DNA-(apurinic or apyrimidinic site) lyase activity(GO:0003906) |
0.3 | 0.9 | GO:0017151 | DEAD/H-box RNA helicase binding(GO:0017151) |
0.3 | 0.9 | GO:0051431 | corticotropin-releasing hormone receptor 2 binding(GO:0051431) |
0.3 | 2.4 | GO:0103116 | alpha-D-galactofuranose transporter activity(GO:0103116) |
0.3 | 1.8 | GO:0030983 | mismatched DNA binding(GO:0030983) |
0.3 | 1.2 | GO:0015101 | organic cation transmembrane transporter activity(GO:0015101) |
0.3 | 2.6 | GO:0031434 | mitogen-activated protein kinase kinase binding(GO:0031434) |
0.3 | 0.9 | GO:0004833 | tryptophan 2,3-dioxygenase activity(GO:0004833) |
0.3 | 3.8 | GO:0004629 | phospholipase C activity(GO:0004629) |
0.3 | 2.9 | GO:0015026 | coreceptor activity(GO:0015026) |
0.3 | 0.3 | GO:0043141 | ATP-dependent 5'-3' DNA helicase activity(GO:0043141) |
0.3 | 2.9 | GO:0008157 | protein phosphatase 1 binding(GO:0008157) |
0.3 | 0.9 | GO:0004832 | valine-tRNA ligase activity(GO:0004832) |
0.3 | 70.3 | GO:0003779 | actin binding(GO:0003779) |
0.3 | 6.5 | GO:0019706 | protein-cysteine S-palmitoyltransferase activity(GO:0019706) |
0.3 | 3.1 | GO:0031435 | mitogen-activated protein kinase kinase kinase binding(GO:0031435) |
0.3 | 2.8 | GO:0050681 | androgen receptor binding(GO:0050681) |
0.3 | 0.8 | GO:0004985 | opioid receptor activity(GO:0004985) |
0.3 | 1.7 | GO:0015168 | glycerol transmembrane transporter activity(GO:0015168) glycerol channel activity(GO:0015254) |
0.3 | 0.8 | GO:0004814 | arginine-tRNA ligase activity(GO:0004814) |
0.3 | 0.3 | GO:0004699 | calcium-independent protein kinase C activity(GO:0004699) |
0.3 | 1.4 | GO:0015288 | porin activity(GO:0015288) |
0.3 | 0.8 | GO:0035851 | Krueppel-associated box domain binding(GO:0035851) |
0.3 | 1.4 | GO:0005005 | transmembrane-ephrin receptor activity(GO:0005005) |
0.3 | 2.2 | GO:0031545 | peptidyl-proline 4-dioxygenase activity(GO:0031545) |
0.3 | 16.8 | GO:0004896 | cytokine receptor activity(GO:0004896) |
0.3 | 1.1 | GO:0000062 | fatty-acyl-CoA binding(GO:0000062) |
0.3 | 1.9 | GO:0048027 | mRNA 5'-UTR binding(GO:0048027) |
0.3 | 1.9 | GO:0019763 | immunoglobulin receptor activity(GO:0019763) |
0.3 | 1.1 | GO:0003846 | 2-acylglycerol O-acyltransferase activity(GO:0003846) |
0.3 | 2.1 | GO:0001162 | RNA polymerase II intronic transcription regulatory region sequence-specific DNA binding(GO:0001162) |
0.3 | 0.8 | GO:0008732 | threonine aldolase activity(GO:0004793) L-allo-threonine aldolase activity(GO:0008732) |
0.3 | 1.1 | GO:0005161 | platelet-derived growth factor receptor binding(GO:0005161) |
0.3 | 0.5 | GO:0046974 | histone methyltransferase activity (H3-K9 specific)(GO:0046974) |
0.3 | 0.3 | GO:0004176 | ATP-dependent peptidase activity(GO:0004176) |
0.3 | 3.1 | GO:0070034 | telomerase RNA binding(GO:0070034) |
0.3 | 1.0 | GO:0034603 | pyruvate dehydrogenase activity(GO:0004738) pyruvate dehydrogenase [NAD(P)+] activity(GO:0034603) pyruvate dehydrogenase (NAD+) activity(GO:0034604) |
0.3 | 5.7 | GO:0070001 | aspartic-type endopeptidase activity(GO:0004190) aspartic-type peptidase activity(GO:0070001) |
0.3 | 1.0 | GO:0004035 | alkaline phosphatase activity(GO:0004035) |
0.3 | 0.8 | GO:0002060 | purine nucleobase binding(GO:0002060) |
0.3 | 11.0 | GO:0000979 | RNA polymerase II core promoter sequence-specific DNA binding(GO:0000979) |
0.3 | 1.5 | GO:0030306 | ADP-ribosylation factor binding(GO:0030306) |
0.3 | 1.0 | GO:0004090 | carbonyl reductase (NADPH) activity(GO:0004090) |
0.3 | 0.8 | GO:0000832 | inositol hexakisphosphate kinase activity(GO:0000828) inositol hexakisphosphate 5-kinase activity(GO:0000832) inositol hexakisphosphate 1-kinase activity(GO:0052723) inositol hexakisphosphate 3-kinase activity(GO:0052724) |
0.3 | 0.8 | GO:0070888 | E-box binding(GO:0070888) |
0.3 | 0.8 | GO:0072345 | NAADP-sensitive calcium-release channel activity(GO:0072345) |
0.3 | 4.3 | GO:0042166 | acetylcholine binding(GO:0042166) |
0.3 | 9.4 | GO:0030276 | clathrin binding(GO:0030276) |
0.3 | 3.8 | GO:0005520 | insulin-like growth factor binding(GO:0005520) |
0.3 | 4.3 | GO:0004364 | glutathione transferase activity(GO:0004364) |
0.2 | 0.5 | GO:1990459 | transferrin receptor binding(GO:1990459) |
0.2 | 1.2 | GO:0047631 | ADP-ribose diphosphatase activity(GO:0047631) |
0.2 | 6.4 | GO:0097110 | scaffold protein binding(GO:0097110) |
0.2 | 1.7 | GO:0097027 | ubiquitin-protein transferase activator activity(GO:0097027) |
0.2 | 0.5 | GO:0034236 | protein kinase A catalytic subunit binding(GO:0034236) |
0.2 | 6.9 | GO:0005251 | delayed rectifier potassium channel activity(GO:0005251) |
0.2 | 0.2 | GO:0042392 | sphingosine-1-phosphate phosphatase activity(GO:0042392) |
0.2 | 0.5 | GO:0046935 | 1-phosphatidylinositol-3-kinase regulator activity(GO:0046935) |
0.2 | 1.9 | GO:0004017 | adenylate kinase activity(GO:0004017) |
0.2 | 0.7 | GO:0055131 | C3HC4-type RING finger domain binding(GO:0055131) |
0.2 | 1.2 | GO:0016742 | hydroxymethyl-, formyl- and related transferase activity(GO:0016742) |
0.2 | 0.7 | GO:0033829 | O-fucosylpeptide 3-beta-N-acetylglucosaminyltransferase activity(GO:0033829) |
0.2 | 1.9 | GO:0017160 | Ral GTPase binding(GO:0017160) |
0.2 | 1.6 | GO:0016868 | intramolecular transferase activity, phosphotransferases(GO:0016868) |
0.2 | 0.5 | GO:0051011 | microtubule minus-end binding(GO:0051011) |
0.2 | 0.7 | GO:0004949 | cannabinoid receptor activity(GO:0004949) |
0.2 | 1.2 | GO:0016920 | pyroglutamyl-peptidase activity(GO:0016920) |
0.2 | 21.3 | GO:0050839 | cell adhesion molecule binding(GO:0050839) |
0.2 | 0.5 | GO:0003916 | DNA topoisomerase activity(GO:0003916) DNA topoisomerase type II (ATP-hydrolyzing) activity(GO:0003918) DNA topoisomerase II activity(GO:0061505) |
0.2 | 0.5 | GO:0086008 | voltage-gated potassium channel activity involved in cardiac muscle cell action potential repolarization(GO:0086008) |
0.2 | 0.2 | GO:0050253 | retinyl-palmitate esterase activity(GO:0050253) |
0.2 | 0.5 | GO:0034713 | type I transforming growth factor beta receptor binding(GO:0034713) |
0.2 | 0.5 | GO:0004332 | fructose-bisphosphate aldolase activity(GO:0004332) |
0.2 | 1.2 | GO:0005113 | patched binding(GO:0005113) |
0.2 | 0.5 | GO:0019784 | NEDD8-specific protease activity(GO:0019784) |
0.2 | 1.1 | GO:0004028 | 3-chloroallyl aldehyde dehydrogenase activity(GO:0004028) |
0.2 | 3.0 | GO:0005355 | glucose transmembrane transporter activity(GO:0005355) |
0.2 | 1.6 | GO:0004534 | 5'-3' exoribonuclease activity(GO:0004534) |
0.2 | 2.5 | GO:0032794 | GTPase activating protein binding(GO:0032794) |
0.2 | 1.6 | GO:0050750 | low-density lipoprotein particle receptor binding(GO:0050750) |
0.2 | 1.6 | GO:0015643 | toxic substance binding(GO:0015643) |
0.2 | 2.3 | GO:0000701 | purine-specific mismatch base pair DNA N-glycosylase activity(GO:0000701) |
0.2 | 1.8 | GO:0001786 | phosphatidylserine binding(GO:0001786) |
0.2 | 0.2 | GO:0004731 | purine-nucleoside phosphorylase activity(GO:0004731) |
0.2 | 1.3 | GO:0016620 | oxidoreductase activity, acting on the aldehyde or oxo group of donors, NAD or NADP as acceptor(GO:0016620) |
0.2 | 0.2 | GO:0051373 | FATZ binding(GO:0051373) |
0.2 | 2.0 | GO:0045236 | CXCR chemokine receptor binding(GO:0045236) |
0.2 | 0.2 | GO:0016634 | oxidoreductase activity, acting on the CH-CH group of donors, oxygen as acceptor(GO:0016634) |
0.2 | 0.9 | GO:0004594 | pantothenate kinase activity(GO:0004594) |
0.2 | 2.0 | GO:0042813 | Wnt-activated receptor activity(GO:0042813) |
0.2 | 0.4 | GO:0008429 | phosphatidylethanolamine binding(GO:0008429) |
0.2 | 8.5 | GO:0070851 | growth factor receptor binding(GO:0070851) |
0.2 | 1.5 | GO:0042165 | neurotransmitter binding(GO:0042165) |
0.2 | 0.4 | GO:0042289 | MHC class II protein binding(GO:0042289) |
0.2 | 1.1 | GO:0035925 | mRNA 3'-UTR AU-rich region binding(GO:0035925) |
0.2 | 4.1 | GO:0001104 | RNA polymerase II transcription cofactor activity(GO:0001104) |
0.2 | 0.9 | GO:0017176 | phosphatidylinositol N-acetylglucosaminyltransferase activity(GO:0017176) |
0.2 | 1.3 | GO:0050733 | RS domain binding(GO:0050733) |
0.2 | 0.4 | GO:0030169 | low-density lipoprotein particle binding(GO:0030169) |
0.2 | 6.6 | GO:0005132 | type I interferon receptor binding(GO:0005132) |
0.2 | 0.6 | GO:1990254 | keratin filament binding(GO:1990254) |
0.2 | 2.1 | GO:0030552 | cAMP binding(GO:0030552) |
0.2 | 0.6 | GO:0016744 | transferase activity, transferring aldehyde or ketonic groups(GO:0016744) |
0.2 | 0.2 | GO:0031698 | beta-2 adrenergic receptor binding(GO:0031698) |
0.2 | 0.8 | GO:0070815 | peptidyl-lysine 5-dioxygenase activity(GO:0070815) |
0.2 | 2.1 | GO:0070577 | lysine-acetylated histone binding(GO:0070577) |
0.2 | 1.0 | GO:0030275 | LRR domain binding(GO:0030275) |
0.2 | 1.9 | GO:0070742 | C2H2 zinc finger domain binding(GO:0070742) |
0.2 | 1.0 | GO:0030976 | thiamine pyrophosphate binding(GO:0030976) |
0.2 | 3.5 | GO:0001106 | RNA polymerase II transcription corepressor activity(GO:0001106) |
0.2 | 0.8 | GO:0008599 | protein phosphatase type 1 regulator activity(GO:0008599) |
0.2 | 1.4 | GO:0004029 | aldehyde dehydrogenase (NAD) activity(GO:0004029) |
0.2 | 0.8 | GO:1990841 | promoter-specific chromatin binding(GO:1990841) |
0.2 | 1.2 | GO:0003688 | DNA replication origin binding(GO:0003688) |
0.2 | 1.2 | GO:1990446 | U1 snRNP binding(GO:1990446) |
0.2 | 0.6 | GO:0003976 | UDP-N-acetylglucosamine-lysosomal-enzyme N-acetylglucosaminephosphotransferase activity(GO:0003976) |
0.2 | 0.8 | GO:0032896 | palmitoyl-CoA 9-desaturase activity(GO:0032896) |
0.2 | 0.8 | GO:0004045 | aminoacyl-tRNA hydrolase activity(GO:0004045) |
0.2 | 0.4 | GO:0004096 | catalase activity(GO:0004096) |
0.2 | 0.2 | GO:0034648 | histone demethylase activity (H3-dimethyl-K4 specific)(GO:0034648) |
0.2 | 0.4 | GO:0008427 | calcium-dependent protein kinase inhibitor activity(GO:0008427) |
0.2 | 0.2 | GO:0005030 | neurotrophin receptor activity(GO:0005030) |
0.2 | 0.8 | GO:0004582 | dolichyl-phosphate beta-D-mannosyltransferase activity(GO:0004582) |
0.2 | 3.3 | GO:0005537 | mannose binding(GO:0005537) |
0.2 | 0.6 | GO:0004069 | L-aspartate:2-oxoglutarate aminotransferase activity(GO:0004069) |
0.2 | 0.4 | GO:0004367 | glycerol-3-phosphate dehydrogenase [NAD+] activity(GO:0004367) |
0.2 | 10.8 | GO:0030165 | PDZ domain binding(GO:0030165) |
0.2 | 0.9 | GO:0035612 | AP-2 adaptor complex binding(GO:0035612) |
0.2 | 0.2 | GO:0018586 | mono-butyltin dioxygenase activity(GO:0018586) tri-n-butyltin dioxygenase activity(GO:0018588) di-n-butyltin dioxygenase activity(GO:0018589) methylsilanetriol hydroxylase activity(GO:0018590) methyl tertiary butyl ether 3-monooxygenase activity(GO:0018591) 4-nitrocatechol 4-monooxygenase activity(GO:0018592) 4-chlorophenoxyacetate monooxygenase activity(GO:0018593) tert-butanol 2-monooxygenase activity(GO:0018594) alpha-pinene monooxygenase activity(GO:0018595) dimethylsilanediol hydroxylase activity(GO:0018596) ammonia monooxygenase activity(GO:0018597) hydroxymethylsilanetriol oxidase activity(GO:0018598) 2-hydroxyisobutyrate 3-monooxygenase activity(GO:0018599) alpha-pinene dehydrogenase activity(GO:0018600) bisphenol A hydroxylase B activity(GO:0034559) 2,2-bis(4-hydroxyphenyl)-1-propanol hydroxylase activity(GO:0034562) 9-fluorenone-3,4-dioxygenase activity(GO:0034786) anthracene 9,10-dioxygenase activity(GO:0034816) 2-(methylthio)benzothiazole monooxygenase activity(GO:0034857) 2-hydroxybenzothiazole monooxygenase activity(GO:0034858) benzothiazole monooxygenase activity(GO:0034859) 2,6-dihydroxybenzothiazole monooxygenase activity(GO:0034862) pinacolone 5-monooxygenase activity(GO:0034870) thioacetamide S-oxygenase activity(GO:0034873) thioacetamide S-oxide S-oxygenase activity(GO:0034874) endosulfan monooxygenase I activity(GO:0034888) N-nitrodimethylamine hydroxylase activity(GO:0034893) 4-(1-ethyl-1,4-dimethyl-pentyl)phenol monoxygenase activity(GO:0034897) endosulfan ether monooxygenase activity(GO:0034903) pyrene 4,5-monooxygenase activity(GO:0034925) pyrene 1,2-monooxygenase activity(GO:0034927) 1-hydroxypyrene 6,7-monooxygenase activity(GO:0034928) 1-hydroxypyrene 7,8-monooxygenase activity(GO:0034929) phenylboronic acid monooxygenase activity(GO:0034950) spheroidene monooxygenase activity(GO:0043823) |
0.2 | 0.4 | GO:0035197 | siRNA binding(GO:0035197) |
0.2 | 1.7 | GO:0005003 | ephrin receptor activity(GO:0005003) |
0.2 | 0.9 | GO:0004931 | extracellular ATP-gated cation channel activity(GO:0004931) ATP-gated ion channel activity(GO:0035381) |
0.2 | 2.1 | GO:0043138 | 3'-5' DNA helicase activity(GO:0043138) |
0.2 | 1.1 | GO:0042974 | retinoic acid receptor binding(GO:0042974) |
0.2 | 0.5 | GO:0051033 | nucleic acid transmembrane transporter activity(GO:0051032) RNA transmembrane transporter activity(GO:0051033) |
0.2 | 0.5 | GO:0046404 | ATP-dependent polydeoxyribonucleotide 5'-hydroxyl-kinase activity(GO:0046404) polydeoxyribonucleotide kinase activity(GO:0051733) |
0.2 | 1.5 | GO:0043539 | protein serine/threonine kinase activator activity(GO:0043539) |
0.2 | 0.7 | GO:0050431 | transforming growth factor beta binding(GO:0050431) |
0.2 | 0.2 | GO:0004461 | lactose synthase activity(GO:0004461) |
0.2 | 5.1 | GO:0002039 | p53 binding(GO:0002039) |
0.2 | 2.5 | GO:0070491 | repressing transcription factor binding(GO:0070491) |
0.2 | 0.2 | GO:0004064 | arylesterase activity(GO:0004064) |
0.2 | 15.6 | GO:0042393 | histone binding(GO:0042393) |
0.2 | 1.1 | GO:0042169 | SH2 domain binding(GO:0042169) |
0.2 | 2.6 | GO:0005149 | interleukin-1 receptor binding(GO:0005149) |
0.2 | 0.4 | GO:0005157 | macrophage colony-stimulating factor receptor binding(GO:0005157) |
0.2 | 0.3 | GO:0004303 | estradiol 17-beta-dehydrogenase activity(GO:0004303) |
0.2 | 7.5 | GO:0051082 | unfolded protein binding(GO:0051082) |
0.2 | 3.4 | GO:0001085 | RNA polymerase II transcription factor binding(GO:0001085) |
0.2 | 0.7 | GO:0008808 | cardiolipin synthase activity(GO:0008808) phosphatidyltransferase activity(GO:0030572) |
0.2 | 0.3 | GO:0097371 | MDM2/MDM4 family protein binding(GO:0097371) |
0.2 | 1.9 | GO:0032947 | protein complex scaffold(GO:0032947) |
0.2 | 1.8 | GO:0035250 | UDP-galactosyltransferase activity(GO:0035250) |
0.2 | 2.0 | GO:0005540 | hyaluronic acid binding(GO:0005540) |
0.2 | 1.0 | GO:0035035 | histone acetyltransferase binding(GO:0035035) |
0.2 | 0.5 | GO:0002046 | opsin binding(GO:0002046) |
0.2 | 0.7 | GO:0043426 | MRF binding(GO:0043426) |
0.2 | 0.3 | GO:0051185 | coenzyme transporter activity(GO:0051185) |
0.2 | 0.7 | GO:0052851 | cupric reductase activity(GO:0008823) ferric-chelate reductase (NADPH) activity(GO:0052851) |
0.2 | 0.6 | GO:0003953 | NAD+ nucleosidase activity(GO:0003953) |
0.2 | 0.3 | GO:0019237 | centromeric DNA binding(GO:0019237) |
0.2 | 0.6 | GO:0033691 | sialic acid binding(GO:0033691) |
0.2 | 1.0 | GO:0004032 | alditol:NADP+ 1-oxidoreductase activity(GO:0004032) |
0.2 | 0.8 | GO:0043142 | single-stranded DNA-dependent ATPase activity(GO:0043142) |
0.2 | 0.2 | GO:0046848 | hydroxyapatite binding(GO:0046848) |
0.2 | 2.5 | GO:0032266 | phosphatidylinositol-3-phosphate binding(GO:0032266) |
0.2 | 3.8 | GO:0005104 | fibroblast growth factor receptor binding(GO:0005104) |
0.2 | 11.4 | GO:0005085 | guanyl-nucleotide exchange factor activity(GO:0005085) |
0.2 | 0.5 | GO:0004046 | aminoacylase activity(GO:0004046) |
0.2 | 0.5 | GO:0008310 | single-stranded DNA 3'-5' exodeoxyribonuclease activity(GO:0008310) |
0.2 | 0.3 | GO:0048273 | mitogen-activated protein kinase p38 binding(GO:0048273) |
0.2 | 0.2 | GO:0008503 | benzodiazepine receptor activity(GO:0008503) |
0.2 | 0.2 | GO:0001134 | transcription factor activity, transcription factor recruiting(GO:0001134) |
0.2 | 1.1 | GO:0050840 | extracellular matrix binding(GO:0050840) |
0.2 | 0.5 | GO:0003857 | 3-hydroxyacyl-CoA dehydrogenase activity(GO:0003857) |
0.2 | 0.3 | GO:0008900 | hydrogen:potassium-exchanging ATPase activity(GO:0008900) |
0.2 | 0.8 | GO:0015271 | outward rectifier potassium channel activity(GO:0015271) |
0.2 | 0.5 | GO:0004800 | thyroxine 5'-deiodinase activity(GO:0004800) |
0.2 | 0.5 | GO:0061676 | importin-alpha family protein binding(GO:0061676) |
0.2 | 0.3 | GO:0016892 | endoribonuclease activity, producing 3'-phosphomonoesters(GO:0016892) |
0.2 | 1.4 | GO:0033170 | DNA clamp loader activity(GO:0003689) protein-DNA loading ATPase activity(GO:0033170) |
0.2 | 0.5 | GO:0031702 | angiotensin receptor binding(GO:0031701) type 1 angiotensin receptor binding(GO:0031702) |
0.2 | 5.0 | GO:0005254 | chloride channel activity(GO:0005254) |
0.2 | 108.4 | GO:0043565 | sequence-specific DNA binding(GO:0043565) |
0.2 | 55.8 | GO:0005509 | calcium ion binding(GO:0005509) |
0.2 | 0.5 | GO:0035004 | phosphatidylinositol 3-kinase activity(GO:0035004) |
0.1 | 0.3 | GO:0005436 | sodium:phosphate symporter activity(GO:0005436) |
0.1 | 0.3 | GO:1990829 | C-rich single-stranded DNA binding(GO:1990829) |
0.1 | 2.8 | GO:0016702 | oxidoreductase activity, acting on single donors with incorporation of molecular oxygen, incorporation of two atoms of oxygen(GO:0016702) |
0.1 | 0.6 | GO:0005112 | Notch binding(GO:0005112) |
0.1 | 1.3 | GO:0005123 | death receptor binding(GO:0005123) |
0.1 | 2.9 | GO:0015002 | cytochrome-c oxidase activity(GO:0004129) heme-copper terminal oxidase activity(GO:0015002) oxidoreductase activity, acting on a heme group of donors, oxygen as acceptor(GO:0016676) |
0.1 | 1.4 | GO:0005527 | macrolide binding(GO:0005527) FK506 binding(GO:0005528) |
0.1 | 2.0 | GO:0005547 | phosphatidylinositol-3,4,5-trisphosphate binding(GO:0005547) |
0.1 | 0.8 | GO:0018450 | pinocarveol dehydrogenase activity(GO:0018446) chloral hydrate dehydrogenase activity(GO:0018447) hydroxymethylmethylsilanediol oxidase activity(GO:0018448) 1-phenylethanol dehydrogenase activity(GO:0018449) myrtenol dehydrogenase activity(GO:0018450) cis-1,2-dihydroxy-1,2-dihydro-8-carboxynaphthalene dehydrogenase activity(GO:0034522) 3-hydroxy-4-methyloctanoyl-CoA dehydrogenase activity(GO:0034582) 2-hydroxy-4-isopropenylcyclohexane-1-carboxyl-CoA dehydrogenase activity(GO:0034778) cis-9,10-dihydroanthracene-9,10-diol dehydrogenase activity(GO:0034817) citronellol dehydrogenase activity(GO:0034821) naphthyl-2-hydroxymethyl-succinyl-CoA dehydrogenase activity(GO:0034847) 2,4,4-trimethyl-1-pentanol dehydrogenase activity(GO:0034863) 2,4,4-trimethyl-3-hydroxypentanoyl-CoA dehydrogenase activity(GO:0034868) 1-hydroxy-4,4-dimethylpentan-3-one dehydrogenase activity(GO:0034871) endosulfan diol dehydrogenase activity(GO:0034891) endosulfan hydroxyether dehydrogenase activity(GO:0034901) 3-hydroxy-2-methylhexanoyl-CoA dehydrogenase activity(GO:0034918) 3-hydroxy-2,6-dimethyl-5-methylene-heptanoyl-CoA dehydrogenase activity(GO:0034944) versicolorin reductase activity(GO:0042469) ketoreductase activity(GO:0045703) |
0.1 | 0.4 | GO:0010484 | H3 histone acetyltransferase activity(GO:0010484) |
0.1 | 15.0 | GO:0004867 | serine-type endopeptidase inhibitor activity(GO:0004867) |
0.1 | 2.0 | GO:0017025 | TBP-class protein binding(GO:0017025) |
0.1 | 0.1 | GO:0005275 | amine transmembrane transporter activity(GO:0005275) |
0.1 | 1.0 | GO:0035613 | RNA stem-loop binding(GO:0035613) |
0.1 | 0.4 | GO:0070548 | L-glutamine aminotransferase activity(GO:0070548) |
0.1 | 0.1 | GO:0030151 | molybdenum ion binding(GO:0030151) |
0.1 | 0.7 | GO:0004784 | superoxide dismutase activity(GO:0004784) oxidoreductase activity, acting on superoxide radicals as acceptor(GO:0016721) |
0.1 | 0.3 | GO:0032190 | acrosin binding(GO:0032190) |
0.1 | 0.9 | GO:0046933 | proton-transporting ATP synthase activity, rotational mechanism(GO:0046933) |
0.1 | 3.7 | GO:0005496 | steroid binding(GO:0005496) |
0.1 | 0.4 | GO:0034511 | U3 snoRNA binding(GO:0034511) |
0.1 | 11.4 | GO:0005543 | phospholipid binding(GO:0005543) |
0.1 | 0.4 | GO:0008430 | selenium binding(GO:0008430) |
0.1 | 0.3 | GO:0004844 | uracil DNA N-glycosylase activity(GO:0004844) deaminated base DNA N-glycosylase activity(GO:0097506) |
0.1 | 0.4 | GO:0004514 | nicotinate-nucleotide diphosphorylase (carboxylating) activity(GO:0004514) |
0.1 | 0.1 | GO:0031559 | oxidosqualene cyclase activity(GO:0031559) |
0.1 | 0.4 | GO:0015377 | cation:chloride symporter activity(GO:0015377) |
0.1 | 0.1 | GO:0004439 | phosphatidylinositol-4,5-bisphosphate 5-phosphatase activity(GO:0004439) |
0.1 | 0.4 | GO:0001076 | transcription factor activity, RNA polymerase II transcription factor binding(GO:0001076) |
0.1 | 0.4 | GO:0008294 | calcium- and calmodulin-responsive adenylate cyclase activity(GO:0008294) |
0.1 | 0.5 | GO:0019992 | diacylglycerol binding(GO:0019992) |
0.1 | 0.1 | GO:0016649 | electron-transferring-flavoprotein dehydrogenase activity(GO:0004174) oxidoreductase activity, acting on the CH-NH group of donors, quinone or similar compound as acceptor(GO:0016649) |
0.1 | 0.4 | GO:0001222 | transcription corepressor binding(GO:0001222) |
0.1 | 0.2 | GO:0070410 | co-SMAD binding(GO:0070410) |
0.1 | 0.1 | GO:0008649 | rRNA methyltransferase activity(GO:0008649) rRNA (uridine) methyltransferase activity(GO:0016436) |
0.1 | 0.9 | GO:0017070 | U6 snRNA binding(GO:0017070) |
0.1 | 1.6 | GO:0015347 | sodium-independent organic anion transmembrane transporter activity(GO:0015347) |
0.1 | 0.4 | GO:0023029 | MHC class Ib protein binding(GO:0023029) |
0.1 | 1.8 | GO:0003746 | translation elongation factor activity(GO:0003746) |
0.1 | 0.5 | GO:0004459 | L-lactate dehydrogenase activity(GO:0004459) |
0.1 | 9.6 | GO:0008022 | protein C-terminus binding(GO:0008022) |
0.1 | 0.7 | GO:0008121 | ubiquinol-cytochrome-c reductase activity(GO:0008121) oxidoreductase activity, acting on diphenols and related substances as donors, cytochrome as acceptor(GO:0016681) |
0.1 | 0.2 | GO:0070679 | inositol 1,4,5 trisphosphate binding(GO:0070679) |
0.1 | 16.3 | GO:0004252 | serine-type endopeptidase activity(GO:0004252) |
0.1 | 1.9 | GO:0008139 | nuclear localization sequence binding(GO:0008139) |
0.1 | 0.6 | GO:0008097 | 5S rRNA binding(GO:0008097) |
0.1 | 2.9 | GO:0015020 | glucuronosyltransferase activity(GO:0015020) |
0.1 | 0.3 | GO:0070728 | leucine binding(GO:0070728) |
0.1 | 0.5 | GO:0070402 | NADPH binding(GO:0070402) |
0.1 | 0.2 | GO:0030350 | iron-responsive element binding(GO:0030350) |
0.1 | 0.6 | GO:0031402 | sodium ion binding(GO:0031402) |
0.1 | 0.2 | GO:0004735 | pyrroline-5-carboxylate reductase activity(GO:0004735) |
0.1 | 0.1 | GO:0031711 | bradykinin receptor binding(GO:0031711) |
0.1 | 0.2 | GO:0047498 | calcium-dependent phospholipase A2 activity(GO:0047498) |
0.1 | 1.1 | GO:0035257 | nuclear hormone receptor binding(GO:0035257) |
0.1 | 0.1 | GO:0004337 | geranyltranstransferase activity(GO:0004337) |
0.1 | 1.0 | GO:0005487 | nucleocytoplasmic transporter activity(GO:0005487) |
0.1 | 2.0 | GO:0043734 | DNA-N1-methyladenine dioxygenase activity(GO:0043734) |
0.1 | 0.1 | GO:0036222 | dITP diphosphatase activity(GO:0035870) XTP diphosphatase activity(GO:0036222) |
0.1 | 0.1 | GO:0004774 | succinate-CoA ligase activity(GO:0004774) |
0.1 | 1.0 | GO:0004535 | poly(A)-specific ribonuclease activity(GO:0004535) |
0.1 | 1.1 | GO:0008252 | nucleotidase activity(GO:0008252) |
0.1 | 8.4 | GO:0008175 | tRNA methyltransferase activity(GO:0008175) |
0.1 | 0.3 | GO:0070324 | thyroid hormone binding(GO:0070324) |
0.1 | 0.7 | GO:0005227 | calcium activated cation channel activity(GO:0005227) |
0.1 | 0.4 | GO:0018636 | phenanthrene 9,10-monooxygenase activity(GO:0018636) |
0.1 | 0.1 | GO:0008469 | histone-arginine N-methyltransferase activity(GO:0008469) protein-arginine omega-N monomethyltransferase activity(GO:0035241) |
0.1 | 0.4 | GO:0070569 | uridylyltransferase activity(GO:0070569) |
0.1 | 4.1 | GO:0008514 | organic anion transmembrane transporter activity(GO:0008514) |
0.1 | 4.3 | GO:0019003 | GDP binding(GO:0019003) |
0.1 | 0.5 | GO:0008190 | eukaryotic initiation factor 4E binding(GO:0008190) |
0.1 | 0.6 | GO:0008932 | lytic endotransglycosylase activity(GO:0008932) |
0.1 | 0.6 | GO:0047760 | butyrate-CoA ligase activity(GO:0047760) |
0.1 | 1.7 | GO:0001056 | RNA polymerase III activity(GO:0001056) |
0.1 | 0.1 | GO:0050220 | prostaglandin-E synthase activity(GO:0050220) |
0.1 | 0.1 | GO:0032554 | purine deoxyribonucleotide binding(GO:0032554) |
0.1 | 2.3 | GO:0016891 | endoribonuclease activity, producing 5'-phosphomonoesters(GO:0016891) |
0.1 | 0.8 | GO:0001618 | virus receptor activity(GO:0001618) |
0.1 | 1.1 | GO:0016755 | transferase activity, transferring amino-acyl groups(GO:0016755) |
0.1 | 0.2 | GO:0070840 | dynein complex binding(GO:0070840) |
0.1 | 4.2 | GO:0004843 | thiol-dependent ubiquitin-specific protease activity(GO:0004843) |
0.1 | 0.2 | GO:0016885 | CoA carboxylase activity(GO:0016421) ligase activity, forming carbon-carbon bonds(GO:0016885) |
0.1 | 0.1 | GO:0031802 | type 5 metabotropic glutamate receptor binding(GO:0031802) |
0.1 | 0.6 | GO:0008420 | CTD phosphatase activity(GO:0008420) |
0.1 | 0.1 | GO:0008905 | mannose-phosphate guanylyltransferase activity(GO:0008905) |
0.1 | 0.2 | GO:1990405 | protein antigen binding(GO:1990405) |
0.1 | 0.1 | GO:0000405 | bubble DNA binding(GO:0000405) |
0.1 | 0.4 | GO:0004521 | endoribonuclease activity(GO:0004521) |
0.1 | 0.4 | GO:0071614 | linoleic acid epoxygenase activity(GO:0071614) |
0.1 | 0.5 | GO:0016861 | intramolecular oxidoreductase activity, interconverting aldoses and ketoses(GO:0016861) |
0.1 | 0.2 | GO:0035368 | selenocysteine insertion sequence binding(GO:0035368) |
0.1 | 2.5 | GO:0009055 | electron carrier activity(GO:0009055) |
0.1 | 0.1 | GO:0016273 | arginine N-methyltransferase activity(GO:0016273) protein-arginine N-methyltransferase activity(GO:0016274) |
0.1 | 0.2 | GO:0022839 | ion gated channel activity(GO:0022839) |
0.1 | 2.3 | GO:0003713 | transcription coactivator activity(GO:0003713) |
0.1 | 0.3 | GO:0033592 | RNA strand annealing activity(GO:0033592) |
0.1 | 0.2 | GO:0004630 | phospholipase D activity(GO:0004630) |
0.1 | 0.9 | GO:0005243 | gap junction channel activity(GO:0005243) |
0.1 | 3.0 | GO:0008527 | taste receptor activity(GO:0008527) |
0.1 | 8.2 | GO:0004857 | enzyme inhibitor activity(GO:0004857) |
0.1 | 0.2 | GO:0048185 | activin binding(GO:0048185) |
0.1 | 0.1 | GO:0008193 | tRNA guanylyltransferase activity(GO:0008193) |
0.1 | 0.6 | GO:0042287 | MHC protein binding(GO:0042287) MHC class I protein binding(GO:0042288) |
0.1 | 0.8 | GO:0008601 | protein phosphatase type 2A regulator activity(GO:0008601) |
0.1 | 1.2 | GO:0032813 | tumor necrosis factor receptor superfamily binding(GO:0032813) |
0.1 | 0.3 | GO:0004169 | dolichyl-phosphate-mannose-protein mannosyltransferase activity(GO:0004169) |
0.1 | 0.2 | GO:0004967 | glucagon receptor activity(GO:0004967) |
0.1 | 0.5 | GO:0030145 | manganese ion binding(GO:0030145) |
0.1 | 0.9 | GO:0046703 | natural killer cell lectin-like receptor binding(GO:0046703) |
0.1 | 1.4 | GO:0005385 | zinc ion transmembrane transporter activity(GO:0005385) |
0.1 | 0.2 | GO:0050321 | tau-protein kinase activity(GO:0050321) |
0.1 | 10.1 | GO:0060589 | nucleoside-triphosphatase regulator activity(GO:0060589) |
0.1 | 0.1 | GO:0017046 | peptide hormone binding(GO:0017046) |
0.1 | 1.9 | GO:0016415 | octanoyltransferase activity(GO:0016415) |
0.1 | 1.2 | GO:0048306 | calcium-dependent protein binding(GO:0048306) |
0.1 | 0.3 | GO:0004955 | prostaglandin receptor activity(GO:0004955) |
0.1 | 0.1 | GO:0032557 | UTP binding(GO:0002134) pyrimidine ribonucleoside binding(GO:0032551) pyrimidine ribonucleotide binding(GO:0032557) |
0.1 | 22.7 | GO:0008270 | zinc ion binding(GO:0008270) |
0.1 | 0.1 | GO:0015197 | peptide transporter activity(GO:0015197) |
0.1 | 0.6 | GO:0070180 | large ribosomal subunit rRNA binding(GO:0070180) |
0.1 | 0.3 | GO:0001665 | alpha-N-acetylgalactosaminide alpha-2,6-sialyltransferase activity(GO:0001665) |
0.1 | 1.1 | GO:0051117 | ATPase binding(GO:0051117) |
0.1 | 2.5 | GO:0008392 | arachidonic acid epoxygenase activity(GO:0008392) |
0.1 | 0.3 | GO:0019911 | structural constituent of myelin sheath(GO:0019911) |
0.1 | 0.1 | GO:0042979 | ornithine decarboxylase regulator activity(GO:0042979) |
0.1 | 0.2 | GO:0051019 | mitogen-activated protein kinase binding(GO:0051019) |
0.1 | 0.2 | GO:0001055 | RNA polymerase II activity(GO:0001055) |
0.1 | 0.1 | GO:0035326 | enhancer binding(GO:0035326) |
0.1 | 0.2 | GO:0004095 | carnitine O-palmitoyltransferase activity(GO:0004095) |
0.1 | 0.4 | GO:0031386 | protein tag(GO:0031386) |
0.1 | 0.7 | GO:0016863 | intramolecular oxidoreductase activity, transposing C=C bonds(GO:0016863) |
0.1 | 1.1 | GO:0061733 | peptide-lysine-N-acetyltransferase activity(GO:0061733) |
0.1 | 0.4 | GO:0015928 | fucosidase activity(GO:0015928) |
0.1 | 0.1 | GO:0003831 | beta-N-acetylglucosaminylglycopeptide beta-1,4-galactosyltransferase activity(GO:0003831) |
0.1 | 0.1 | GO:0004954 | prostanoid receptor activity(GO:0004954) |
0.1 | 0.3 | GO:0015926 | glucosidase activity(GO:0015926) |
0.1 | 0.2 | GO:0004969 | histamine receptor activity(GO:0004969) |
0.1 | 1.3 | GO:0016876 | ligase activity, forming carbon-oxygen bonds(GO:0016875) ligase activity, forming aminoacyl-tRNA and related compounds(GO:0016876) |
0.1 | 0.4 | GO:0004499 | N,N-dimethylaniline monooxygenase activity(GO:0004499) |
0.0 | 0.0 | GO:0043495 | protein anchor(GO:0043495) |
0.0 | 0.1 | GO:0003941 | L-serine ammonia-lyase activity(GO:0003941) |
0.0 | 0.0 | GO:0019863 | IgE binding(GO:0019863) |
0.0 | 0.4 | GO:0008484 | sulfuric ester hydrolase activity(GO:0008484) |
0.0 | 8.1 | GO:0003735 | structural constituent of ribosome(GO:0003735) |
0.0 | 0.2 | GO:0004415 | hyalurononglucosaminidase activity(GO:0004415) |
0.0 | 1.4 | GO:0019903 | protein phosphatase binding(GO:0019903) |
0.0 | 4.7 | GO:0005179 | hormone activity(GO:0005179) |
0.0 | 0.0 | GO:0047192 | 1-alkylglycerophosphocholine O-acetyltransferase activity(GO:0047192) |
0.0 | 0.1 | GO:0004305 | ethanolamine kinase activity(GO:0004305) |
0.0 | 0.0 | GO:0018685 | alkane 1-monooxygenase activity(GO:0018685) |
0.0 | 0.3 | GO:0008821 | crossover junction endodeoxyribonuclease activity(GO:0008821) |
0.0 | 0.3 | GO:0070628 | proteasome binding(GO:0070628) |
0.0 | 0.1 | GO:0015929 | hexosaminidase activity(GO:0015929) |
0.0 | 0.0 | GO:0070326 | very-low-density lipoprotein particle receptor binding(GO:0070326) |
0.0 | 6.2 | GO:0005198 | structural molecule activity(GO:0005198) |
0.0 | 0.4 | GO:0101005 | thiol-dependent ubiquitinyl hydrolase activity(GO:0036459) ubiquitinyl hydrolase activity(GO:0101005) |
0.0 | 0.1 | GO:0004366 | glycerol-3-phosphate O-acyltransferase activity(GO:0004366) |
0.0 | 0.4 | GO:0008195 | phosphatidate phosphatase activity(GO:0008195) |
0.0 | 0.2 | GO:0035173 | histone kinase activity(GO:0035173) |
0.0 | 0.2 | GO:0034584 | piRNA binding(GO:0034584) |
0.0 | 0.4 | GO:0019902 | phosphatase binding(GO:0019902) |
0.0 | 0.3 | GO:0042608 | T cell receptor binding(GO:0042608) |
0.0 | 0.1 | GO:0004016 | adenylate cyclase activity(GO:0004016) |
0.0 | 0.0 | GO:0005534 | galactose binding(GO:0005534) |
0.0 | 0.1 | GO:0016812 | hydrolase activity, acting on carbon-nitrogen (but not peptide) bonds, in cyclic amides(GO:0016812) |
0.0 | 0.3 | GO:0034212 | peptide N-acetyltransferase activity(GO:0034212) |
0.0 | 0.0 | GO:0046976 | histone methyltransferase activity (H3-K27 specific)(GO:0046976) |
0.0 | 0.2 | GO:0048038 | quinone binding(GO:0048038) |
0.0 | 0.1 | GO:0032027 | myosin light chain binding(GO:0032027) |
0.0 | 0.9 | GO:0003697 | single-stranded DNA binding(GO:0003697) |
0.0 | 0.0 | GO:0070579 | methylcytosine dioxygenase activity(GO:0070579) |
0.0 | 0.1 | GO:0042577 | lipid phosphatase activity(GO:0042577) |
0.0 | 0.2 | GO:0008479 | queuine tRNA-ribosyltransferase activity(GO:0008479) |
0.0 | 0.0 | GO:0004565 | beta-galactosidase activity(GO:0004565) |
0.0 | 0.5 | GO:0008138 | protein tyrosine/serine/threonine phosphatase activity(GO:0008138) |
0.0 | 0.1 | GO:0070717 | poly-purine tract binding(GO:0070717) |
0.0 | 0.1 | GO:0004890 | GABA-A receptor activity(GO:0004890) |
0.0 | 1.2 | GO:0003743 | translation initiation factor activity(GO:0003743) |
0.0 | 0.0 | GO:0030792 | methylarsonite methyltransferase activity(GO:0030792) |
0.0 | 0.4 | GO:0000049 | tRNA binding(GO:0000049) |
0.0 | 0.1 | GO:0002161 | aminoacyl-tRNA editing activity(GO:0002161) |
0.0 | 0.0 | GO:0016751 | S-succinyltransferase activity(GO:0016751) |
0.0 | 0.1 | GO:0015252 | hydrogen ion channel activity(GO:0015252) |
0.0 | 0.1 | GO:0016801 | hydrolase activity, acting on ether bonds(GO:0016801) |
0.0 | 0.1 | GO:0004563 | beta-N-acetylhexosaminidase activity(GO:0004563) |
0.0 | 12.2 | GO:0004930 | G-protein coupled receptor activity(GO:0004930) |
0.0 | 0.1 | GO:0003987 | acetate-CoA ligase activity(GO:0003987) |
0.0 | 1.6 | GO:0000287 | magnesium ion binding(GO:0000287) |
0.0 | 8.0 | GO:0005549 | odorant binding(GO:0005549) |
0.0 | 0.0 | GO:0043178 | alcohol binding(GO:0043178) |
0.0 | 0.2 | GO:0003684 | damaged DNA binding(GO:0003684) |
0.0 | 0.3 | GO:0004550 | nucleoside diphosphate kinase activity(GO:0004550) |
0.0 | 0.9 | GO:0008417 | fucosyltransferase activity(GO:0008417) |
0.0 | 15.2 | GO:0004984 | olfactory receptor activity(GO:0004984) |
0.0 | 0.0 | GO:0000009 | alpha-1,6-mannosyltransferase activity(GO:0000009) |
0.0 | 0.2 | GO:0034987 | immunoglobulin receptor binding(GO:0034987) |
0.0 | 0.0 | GO:0034061 | DNA polymerase activity(GO:0034061) |
0.0 | 0.1 | GO:0001846 | opsonin binding(GO:0001846) |
0.0 | 0.0 | GO:0016778 | diphosphotransferase activity(GO:0016778) |
0.0 | 0.0 | GO:0004457 | lactate dehydrogenase activity(GO:0004457) |
0.0 | 0.1 | GO:0038191 | neuropilin binding(GO:0038191) |
0.0 | 0.3 | GO:0008276 | protein methyltransferase activity(GO:0008276) |
0.0 | 0.0 | GO:0015924 | mannosyl-oligosaccharide mannosidase activity(GO:0015924) |
0.0 | 0.0 | GO:0030621 | U4 snRNA binding(GO:0030621) |
0.0 | 0.0 | GO:0010997 | anaphase-promoting complex binding(GO:0010997) |
0.0 | 0.0 | GO:0019107 | myristoyltransferase activity(GO:0019107) |
0.0 | 0.0 | GO:0046624 | sphingolipid transporter activity(GO:0046624) |
0.0 | 0.1 | GO:0004062 | aryl sulfotransferase activity(GO:0004062) |
0.0 | 0.0 | GO:0038100 | nodal binding(GO:0038100) |
0.0 | 0.0 | GO:0047429 | 8-oxo-7,8-dihydroguanosine triphosphate pyrophosphatase activity(GO:0008413) nucleoside-triphosphate diphosphatase activity(GO:0047429) |
0.0 | 0.0 | GO:0001871 | pattern binding(GO:0001871) polysaccharide binding(GO:0030247) |
0.0 | 0.0 | GO:0031735 | CCR10 chemokine receptor binding(GO:0031735) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
1.6 | 21.9 | PID EPHA2 FWD PATHWAY | EPHA2 forward signaling |
1.4 | 1.4 | PID ER NONGENOMIC PATHWAY | Plasma membrane estrogen receptor signaling |
1.4 | 28.1 | PID ECADHERIN KERATINOCYTE PATHWAY | E-cadherin signaling in keratinocytes |
1.3 | 5.1 | PID GMCSF PATHWAY | GMCSF-mediated signaling events |
1.1 | 29.6 | PID RXR VDR PATHWAY | RXR and RAR heterodimerization with other nuclear receptor |
1.1 | 7.7 | PID FGF PATHWAY | FGF signaling pathway |
1.1 | 45.9 | PID HNF3B PATHWAY | FOXA2 and FOXA3 transcription factor networks |
1.0 | 48.9 | PID TGFBR PATHWAY | TGF-beta receptor signaling |
1.0 | 6.0 | PID ERBB2 ERBB3 PATHWAY | ErbB2/ErbB3 signaling events |
1.0 | 32.4 | PID RAC1 REG PATHWAY | Regulation of RAC1 activity |
1.0 | 14.5 | PID CDC42 REG PATHWAY | Regulation of CDC42 activity |
0.9 | 9.8 | PID INTEGRIN4 PATHWAY | Alpha6 beta4 integrin-ligand interactions |
0.9 | 2.6 | PID CD40 PATHWAY | CD40/CD40L signaling |
0.8 | 28.7 | PID RHOA PATHWAY | RhoA signaling pathway |
0.8 | 3.3 | PID VEGFR1 2 PATHWAY | Signaling events mediated by VEGFR1 and VEGFR2 |
0.8 | 8.8 | PID RANBP2 PATHWAY | Sumoylation by RanBP2 regulates transcriptional repression |
0.8 | 6.3 | PID TCR RAS PATHWAY | Ras signaling in the CD4+ TCR pathway |
0.8 | 7.1 | PID ALK2 PATHWAY | ALK2 signaling events |
0.8 | 17.3 | PID NEPHRIN NEPH1 PATHWAY | Nephrin/Neph1 signaling in the kidney podocyte |
0.8 | 10.0 | SA B CELL RECEPTOR COMPLEXES | Antigen binding to B cell receptors activates protein tyrosine kinases, such as the Src family, which ultimate activate MAP kinases. |
0.7 | 10.4 | PID BETA CATENIN DEG PATHWAY | Degradation of beta catenin |
0.7 | 8.1 | ST GA12 PATHWAY | G alpha 12 Pathway |
0.7 | 9.8 | PID EPO PATHWAY | EPO signaling pathway |
0.6 | 24.9 | PID MET PATHWAY | Signaling events mediated by Hepatocyte Growth Factor Receptor (c-Met) |
0.6 | 26.6 | PID HES HEY PATHWAY | Notch-mediated HES/HEY network |
0.6 | 13.0 | PID HIF2PATHWAY | HIF-2-alpha transcription factor network |
0.6 | 12.8 | PID BMP PATHWAY | BMP receptor signaling |
0.6 | 9.2 | ST WNT CA2 CYCLIC GMP PATHWAY | Wnt/Ca2+/cyclic GMP signaling. |
0.6 | 13.4 | PID PI3KCI PATHWAY | Class I PI3K signaling events |
0.6 | 1.1 | PID FAS PATHWAY | FAS (CD95) signaling pathway |
0.5 | 13.9 | PID AR TF PATHWAY | Regulation of Androgen receptor activity |
0.5 | 6.8 | PID TCPTP PATHWAY | Signaling events mediated by TCPTP |
0.5 | 2.1 | ST IL 13 PATHWAY | Interleukin 13 (IL-13) Pathway |
0.5 | 7.8 | PID ECADHERIN STABILIZATION PATHWAY | Stabilization and expansion of the E-cadherin adherens junction |
0.5 | 0.5 | PID AVB3 OPN PATHWAY | Osteopontin-mediated events |
0.5 | 2.9 | SA PTEN PATHWAY | PTEN is a tumor suppressor that dephosphorylates the lipid messenger phosphatidylinositol triphosphate. |
0.5 | 1.0 | PID IL5 PATHWAY | IL5-mediated signaling events |
0.5 | 4.7 | PID IL3 PATHWAY | IL3-mediated signaling events |
0.5 | 13.6 | PID CERAMIDE PATHWAY | Ceramide signaling pathway |
0.5 | 1.4 | ST JAK STAT PATHWAY | Jak-STAT Pathway |
0.5 | 3.7 | PID LYMPH ANGIOGENESIS PATHWAY | VEGFR3 signaling in lymphatic endothelium |
0.5 | 8.8 | PID IL2 1PATHWAY | IL2-mediated signaling events |
0.5 | 3.6 | SA MMP CYTOKINE CONNECTION | Cytokines can induce activation of matrix metalloproteinases, which degrade extracellular matrix. |
0.5 | 9.0 | PID RHODOPSIN PATHWAY | Visual signal transduction: Rods |
0.4 | 5.8 | PID FAK PATHWAY | Signaling events mediated by focal adhesion kinase |
0.4 | 16.6 | PID NFAT TFPATHWAY | Calcineurin-regulated NFAT-dependent transcription in lymphocytes |
0.4 | 7.5 | SIG CHEMOTAXIS | Genes related to chemotaxis |
0.4 | 5.6 | PID ERBB1 INTERNALIZATION PATHWAY | Internalization of ErbB1 |
0.4 | 11.8 | PID ATF2 PATHWAY | ATF-2 transcription factor network |
0.4 | 4.9 | PID NFKAPPAB CANONICAL PATHWAY | Canonical NF-kappaB pathway |
0.4 | 2.4 | PID HDAC CLASSIII PATHWAY | Signaling events mediated by HDAC Class III |
0.4 | 0.4 | SIG IL4RECEPTOR IN B LYPHOCYTES | Genes related to IL4 rceptor signaling in B lymphocytes |
0.4 | 6.5 | PID IL12 STAT4 PATHWAY | IL12 signaling mediated by STAT4 |
0.4 | 4.5 | PID ARF 3PATHWAY | Arf1 pathway |
0.4 | 9.6 | PID CASPASE PATHWAY | Caspase cascade in apoptosis |
0.4 | 15.5 | PID CMYB PATHWAY | C-MYB transcription factor network |
0.4 | 2.5 | PID SYNDECAN 2 PATHWAY | Syndecan-2-mediated signaling events |
0.4 | 1.4 | PID PI3K PLC TRK PATHWAY | Trk receptor signaling mediated by PI3K and PLC-gamma |
0.3 | 1.0 | ST INTERFERON GAMMA PATHWAY | Interferon gamma pathway. |
0.3 | 1.7 | PID P38 GAMMA DELTA PATHWAY | Signaling mediated by p38-gamma and p38-delta |
0.3 | 15.8 | PID ERA GENOMIC PATHWAY | Validated nuclear estrogen receptor alpha network |
0.3 | 8.0 | PID WNT SIGNALING PATHWAY | Wnt signaling network |
0.3 | 3.3 | PID HNF3A PATHWAY | FOXA1 transcription factor network |
0.3 | 2.5 | PID INTEGRIN A4B1 PATHWAY | Alpha4 beta1 integrin signaling events |
0.3 | 8.1 | PID REG GR PATHWAY | Glucocorticoid receptor regulatory network |
0.3 | 3.1 | PID IL23 PATHWAY | IL23-mediated signaling events |
0.3 | 2.4 | PID EPHB FWD PATHWAY | EPHB forward signaling |
0.3 | 1.2 | SA G2 AND M PHASES | Cdc25 activates the cdc2/cyclin B complex to induce the G2/M transition. |
0.3 | 3.8 | PID REELIN PATHWAY | Reelin signaling pathway |
0.3 | 4.1 | PID RAS PATHWAY | Regulation of Ras family activation |
0.3 | 8.9 | PID HIF1 TFPATHWAY | HIF-1-alpha transcription factor network |
0.3 | 2.9 | PID A6B1 A6B4 INTEGRIN PATHWAY | a6b1 and a6b4 Integrin signaling |
0.3 | 5.6 | PID FOXM1 PATHWAY | FOXM1 transcription factor network |
0.3 | 1.1 | PID TXA2PATHWAY | Thromboxane A2 receptor signaling |
0.3 | 1.8 | PID ARF6 TRAFFICKING PATHWAY | Arf6 trafficking events |
0.3 | 39.6 | NABA ECM GLYCOPROTEINS | Genes encoding structural ECM glycoproteins |
0.3 | 1.0 | PID IL2 STAT5 PATHWAY | IL2 signaling events mediated by STAT5 |
0.2 | 0.5 | PID THROMBIN PAR1 PATHWAY | PAR1-mediated thrombin signaling events |
0.2 | 3.2 | PID PS1 PATHWAY | Presenilin action in Notch and Wnt signaling |
0.2 | 8.3 | PID AVB3 INTEGRIN PATHWAY | Integrins in angiogenesis |
0.2 | 47.4 | NABA ECM REGULATORS | Genes encoding enzymes and their regulators involved in the remodeling of the extracellular matrix |
0.2 | 3.6 | PID ARF6 PATHWAY | Arf6 signaling events |
0.2 | 2.5 | PID CIRCADIAN PATHWAY | Circadian rhythm pathway |
0.2 | 0.4 | ST GRANULE CELL SURVIVAL PATHWAY | Granule Cell Survival Pathway is a specific case of more general PAC1 Receptor Pathway. |
0.2 | 3.5 | PID CD8 TCR DOWNSTREAM PATHWAY | Downstream signaling in naïve CD8+ T cells |
0.2 | 2.6 | PID IL12 2PATHWAY | IL12-mediated signaling events |
0.2 | 28.0 | NABA ECM AFFILIATED | Genes encoding proteins affiliated structurally or functionally to extracellular matrix proteins |
0.2 | 1.7 | PID ERBB1 DOWNSTREAM PATHWAY | ErbB1 downstream signaling |
0.2 | 0.4 | ST PAC1 RECEPTOR PATHWAY | PAC1 Receptor Pathway |
0.2 | 0.6 | PID ARF6 DOWNSTREAM PATHWAY | Arf6 downstream pathway |
0.2 | 5.1 | PID P53 REGULATION PATHWAY | p53 pathway |
0.2 | 2.0 | PID FRA PATHWAY | Validated transcriptional targets of AP1 family members Fra1 and Fra2 |
0.2 | 0.6 | SA CASPASE CASCADE | Apoptosis is mediated by caspases, cysteine proteases arranged in a proteolytic cascade. |
0.2 | 2.2 | PID AURORA A PATHWAY | Aurora A signaling |
0.2 | 0.4 | PID NFKAPPAB ATYPICAL PATHWAY | Atypical NF-kappaB pathway |
0.2 | 2.4 | PID IL4 2PATHWAY | IL4-mediated signaling events |
0.2 | 40.4 | NABA SECRETED FACTORS | Genes encoding secreted soluble factors |
0.2 | 0.7 | PID ALK1 PATHWAY | ALK1 signaling events |
0.2 | 1.5 | PID INTEGRIN2 PATHWAY | Beta2 integrin cell surface interactions |
0.2 | 10.4 | PID P53 DOWNSTREAM PATHWAY | Direct p53 effectors |
0.2 | 4.0 | PID RHOA REG PATHWAY | Regulation of RhoA activity |
0.2 | 0.7 | NABA BASEMENT MEMBRANES | Genes encoding structural components of basement membranes |
0.2 | 4.3 | PID P73PATHWAY | p73 transcription factor network |
0.2 | 2.3 | ST INTEGRIN SIGNALING PATHWAY | Integrin Signaling Pathway |
0.2 | 0.5 | PID ANTHRAX PATHWAY | Cellular roles of Anthrax toxin |
0.2 | 0.3 | PID P38 ALPHA BETA PATHWAY | Regulation of p38-alpha and p38-beta |
0.2 | 2.5 | ST FAS SIGNALING PATHWAY | Fas Signaling Pathway |
0.2 | 0.8 | ST PHOSPHOINOSITIDE 3 KINASE PATHWAY | PI3K Pathway |
0.1 | 0.1 | PID IL8 CXCR1 PATHWAY | IL8- and CXCR1-mediated signaling events |
0.1 | 0.7 | PID RETINOIC ACID PATHWAY | Retinoic acid receptors-mediated signaling |
0.1 | 0.3 | PID AR NONGENOMIC PATHWAY | Nongenotropic Androgen signaling |
0.1 | 1.5 | PID IL1 PATHWAY | IL1-mediated signaling events |
0.1 | 0.6 | PID WNT CANONICAL PATHWAY | Canonical Wnt signaling pathway |
0.1 | 1.2 | ST JNK MAPK PATHWAY | JNK MAPK Pathway |
0.1 | 0.5 | PID HIF1A PATHWAY | Hypoxic and oxygen homeostasis regulation of HIF-1-alpha |
0.1 | 0.5 | SIG PIP3 SIGNALING IN B LYMPHOCYTES | Genes related to PIP3 signaling in B lymphocytes |
0.1 | 0.9 | PID NETRIN PATHWAY | Netrin-mediated signaling events |
0.1 | 0.6 | ST P38 MAPK PATHWAY | p38 MAPK Pathway |
0.1 | 0.6 | ST G ALPHA S PATHWAY | G alpha s Pathway |
0.1 | 0.9 | PID PRL SIGNALING EVENTS PATHWAY | Signaling events mediated by PRL |
0.1 | 0.9 | SIG REGULATION OF THE ACTIN CYTOSKELETON BY RHO GTPASES | Genes related to regulation of the actin cytoskeleton |
0.1 | 0.9 | PID SHP2 PATHWAY | SHP2 signaling |
0.1 | 0.1 | PID MAPK TRK PATHWAY | Trk receptor signaling mediated by the MAPK pathway |
0.1 | 0.1 | PID IFNG PATHWAY | IFN-gamma pathway |
0.1 | 0.3 | SIG INSULIN RECEPTOR PATHWAY IN CARDIAC MYOCYTES | Genes related to the insulin receptor pathway |
0.1 | 0.3 | PID ANGIOPOIETIN RECEPTOR PATHWAY | Angiopoietin receptor Tie2-mediated signaling |
0.1 | 0.3 | PID AMB2 NEUTROPHILS PATHWAY | amb2 Integrin signaling |
0.1 | 0.1 | PID TRAIL PATHWAY | TRAIL signaling pathway |
0.1 | 1.0 | PID KIT PATHWAY | Signaling events mediated by Stem cell factor receptor (c-Kit) |
0.1 | 0.2 | SIG CD40PATHWAYMAP | Genes related to CD40 signaling |
0.1 | 1.5 | PID MYC REPRESS PATHWAY | Validated targets of C-MYC transcriptional repression |
0.1 | 2.1 | PID MYC ACTIV PATHWAY | Validated targets of C-MYC transcriptional activation |
0.1 | 0.9 | PID ATM PATHWAY | ATM pathway |
0.0 | 0.5 | PID TOLL ENDOGENOUS PATHWAY | Endogenous TLR signaling |
0.0 | 0.4 | PID BCR 5PATHWAY | BCR signaling pathway |
0.0 | 0.2 | PID ECADHERIN NASCENT AJ PATHWAY | E-cadherin signaling in the nascent adherens junction |
0.0 | 0.2 | PID TCR PATHWAY | TCR signaling in naïve CD4+ T cells |
0.0 | 0.1 | PID CONE PATHWAY | Visual signal transduction: Cones |
0.0 | 0.0 | PID IL27 PATHWAY | IL27-mediated signaling events |
0.0 | 0.2 | PID PLK1 PATHWAY | PLK1 signaling events |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
2.9 | 55.3 | REACTOME REGULATION OF GENE EXPRESSION IN BETA CELLS | Genes involved in Regulation of gene expression in beta cells |
2.9 | 22.9 | REACTOME RECYCLING OF BILE ACIDS AND SALTS | Genes involved in Recycling of bile acids and salts |
2.9 | 28.6 | REACTOME REGULATION OF BETA CELL DEVELOPMENT | Genes involved in Regulation of beta-cell development |
2.1 | 16.6 | REACTOME ABACAVIR TRANSPORT AND METABOLISM | Genes involved in Abacavir transport and metabolism |
2.0 | 20.3 | REACTOME APOPTOTIC CLEAVAGE OF CELL ADHESION PROTEINS | Genes involved in Apoptotic cleavage of cell adhesion proteins |
1.9 | 1.9 | REACTOME SYNTHESIS OF PIPS AT THE LATE ENDOSOME MEMBRANE | Genes involved in Synthesis of PIPs at the late endosome membrane |
1.9 | 5.7 | REACTOME AQUAPORIN MEDIATED TRANSPORT | Genes involved in Aquaporin-mediated transport |
1.7 | 5.2 | REACTOME GAP JUNCTION TRAFFICKING | Genes involved in Gap junction trafficking |
1.3 | 25.4 | REACTOME CGMP EFFECTS | Genes involved in cGMP effects |
1.3 | 14.4 | REACTOME IONOTROPIC ACTIVITY OF KAINATE RECEPTORS | Genes involved in Ionotropic activity of Kainate Receptors |
1.3 | 13.0 | REACTOME CYTOSOLIC SULFONATION OF SMALL MOLECULES | Genes involved in Cytosolic sulfonation of small molecules |
1.3 | 38.3 | REACTOME AMINO ACID TRANSPORT ACROSS THE PLASMA MEMBRANE | Genes involved in Amino acid transport across the plasma membrane |
1.3 | 11.5 | REACTOME PURINE CATABOLISM | Genes involved in Purine catabolism |
1.2 | 8.5 | REACTOME SYNTHESIS SECRETION AND DEACYLATION OF GHRELIN | Genes involved in Synthesis, Secretion, and Deacylation of Ghrelin |
1.2 | 10.4 | REACTOME TRYPTOPHAN CATABOLISM | Genes involved in Tryptophan catabolism |
0.9 | 3.8 | REACTOME DIGESTION OF DIETARY CARBOHYDRATE | Genes involved in Digestion of dietary carbohydrate |
0.9 | 18.8 | REACTOME SMOOTH MUSCLE CONTRACTION | Genes involved in Smooth Muscle Contraction |
0.9 | 40.3 | REACTOME NRAGE SIGNALS DEATH THROUGH JNK | Genes involved in NRAGE signals death through JNK |
0.9 | 2.7 | REACTOME P75NTR RECRUITS SIGNALLING COMPLEXES | Genes involved in p75NTR recruits signalling complexes |
0.8 | 3.4 | REACTOME G ALPHA S SIGNALLING EVENTS | Genes involved in G alpha (s) signalling events |
0.8 | 2.5 | REACTOME SHC RELATED EVENTS | Genes involved in SHC-related events |
0.8 | 22.3 | REACTOME KERATAN SULFATE KERATIN METABOLISM | Genes involved in Keratan sulfate/keratin metabolism |
0.8 | 3.2 | REACTOME DOWNSTREAM SIGNAL TRANSDUCTION | Genes involved in Downstream signal transduction |
0.8 | 2.4 | REACTOME ACYL CHAIN REMODELLING OF PS | Genes involved in Acyl chain remodelling of PS |
0.8 | 11.7 | REACTOME REGULATION OF SIGNALING BY CBL | Genes involved in Regulation of signaling by CBL |
0.8 | 0.8 | REACTOME FGFR4 LIGAND BINDING AND ACTIVATION | Genes involved in FGFR4 ligand binding and activation |
0.8 | 9.3 | REACTOME PLATELET ADHESION TO EXPOSED COLLAGEN | Genes involved in Platelet Adhesion to exposed collagen |
0.8 | 9.2 | REACTOME SYNTHESIS SECRETION AND INACTIVATION OF GIP | Genes involved in Synthesis, Secretion, and Inactivation of Glucose-dependent Insulinotropic Polypeptide (GIP) |
0.8 | 0.8 | REACTOME INTERACTIONS OF VPR WITH HOST CELLULAR PROTEINS | Genes involved in Interactions of Vpr with host cellular proteins |
0.8 | 9.8 | REACTOME HDL MEDIATED LIPID TRANSPORT | Genes involved in HDL-mediated lipid transport |
0.8 | 33.0 | REACTOME NUCLEAR RECEPTOR TRANSCRIPTION PATHWAY | Genes involved in Nuclear Receptor transcription pathway |
0.7 | 31.2 | REACTOME INTERFERON GAMMA SIGNALING | Genes involved in Interferon gamma signaling |
0.7 | 7.4 | REACTOME PURINE SALVAGE | Genes involved in Purine salvage |
0.7 | 8.1 | REACTOME BILE SALT AND ORGANIC ANION SLC TRANSPORTERS | Genes involved in Bile salt and organic anion SLC transporters |
0.7 | 8.6 | REACTOME FGFR2C LIGAND BINDING AND ACTIVATION | Genes involved in FGFR2c ligand binding and activation |
0.7 | 17.1 | REACTOME GLYCOLYSIS | Genes involved in Glycolysis |
0.7 | 6.9 | REACTOME TRAFFICKING OF GLUR2 CONTAINING AMPA RECEPTORS | Genes involved in Trafficking of GluR2-containing AMPA receptors |
0.7 | 8.1 | REACTOME SYNTHESIS OF PIPS AT THE EARLY ENDOSOME MEMBRANE | Genes involved in Synthesis of PIPs at the early endosome membrane |
0.7 | 14.7 | REACTOME SIGNALING BY BMP | Genes involved in Signaling by BMP |
0.7 | 4.6 | REACTOME TRANSPORT OF ORGANIC ANIONS | Genes involved in Transport of organic anions |
0.7 | 0.7 | REACTOME IL 2 SIGNALING | Genes involved in Interleukin-2 signaling |
0.7 | 11.9 | REACTOME AMINO ACID AND OLIGOPEPTIDE SLC TRANSPORTERS | Genes involved in Amino acid and oligopeptide SLC transporters |
0.7 | 14.5 | REACTOME EGFR DOWNREGULATION | Genes involved in EGFR downregulation |
0.7 | 2.0 | REACTOME SPRY REGULATION OF FGF SIGNALING | Genes involved in Spry regulation of FGF signaling |
0.6 | 5.8 | REACTOME OXYGEN DEPENDENT PROLINE HYDROXYLATION OF HYPOXIA INDUCIBLE FACTOR ALPHA | Genes involved in Oxygen-dependent Proline Hydroxylation of Hypoxia-inducible Factor Alpha |
0.6 | 0.6 | REACTOME SIGNALING BY FGFR IN DISEASE | Genes involved in Signaling by FGFR in disease |
0.6 | 5.6 | REACTOME ORGANIC CATION ANION ZWITTERION TRANSPORT | Genes involved in Organic cation/anion/zwitterion transport |
0.6 | 3.6 | REACTOME CD28 DEPENDENT VAV1 PATHWAY | Genes involved in CD28 dependent Vav1 pathway |
0.6 | 1.8 | REACTOME ACYL CHAIN REMODELLING OF PG | Genes involved in Acyl chain remodelling of PG |
0.6 | 12.5 | REACTOME SEMA4D IN SEMAPHORIN SIGNALING | Genes involved in Sema4D in semaphorin signaling |
0.6 | 4.1 | REACTOME SIGNALING BY CONSTITUTIVELY ACTIVE EGFR | Genes involved in Signaling by constitutively active EGFR |
0.6 | 1.8 | REACTOME TAK1 ACTIVATES NFKB BY PHOSPHORYLATION AND ACTIVATION OF IKKS COMPLEX | Genes involved in TAK1 activates NFkB by phosphorylation and activation of IKKs complex |
0.6 | 4.1 | REACTOME HYALURONAN UPTAKE AND DEGRADATION | Genes involved in Hyaluronan uptake and degradation |
0.6 | 13.3 | REACTOME G0 AND EARLY G1 | Genes involved in G0 and Early G1 |
0.6 | 5.7 | REACTOME REGULATION OF RHEB GTPASE ACTIVITY BY AMPK | Genes involved in Regulation of Rheb GTPase activity by AMPK |
0.6 | 7.3 | REACTOME AMINO ACID SYNTHESIS AND INTERCONVERSION TRANSAMINATION | Genes involved in Amino acid synthesis and interconversion (transamination) |
0.5 | 2.1 | REACTOME TRAF6 MEDIATED IRF7 ACTIVATION IN TLR7 8 OR 9 SIGNALING | Genes involved in TRAF6 mediated IRF7 activation in TLR7/8 or 9 signaling |
0.5 | 6.9 | REACTOME GLUCONEOGENESIS | Genes involved in Gluconeogenesis |
0.5 | 7.4 | REACTOME IL RECEPTOR SHC SIGNALING | Genes involved in Interleukin receptor SHC signaling |
0.5 | 16.7 | REACTOME NETRIN1 SIGNALING | Genes involved in Netrin-1 signaling |
0.5 | 4.1 | REACTOME PROSTANOID LIGAND RECEPTORS | Genes involved in Prostanoid ligand receptors |
0.5 | 3.6 | REACTOME ARMS MEDIATED ACTIVATION | Genes involved in ARMS-mediated activation |
0.5 | 2.6 | REACTOME RNA POL I PROMOTER OPENING | Genes involved in RNA Polymerase I Promoter Opening |
0.5 | 1.5 | REACTOME BETA DEFENSINS | Genes involved in Beta defensins |
0.5 | 4.0 | REACTOME REGULATED PROTEOLYSIS OF P75NTR | Genes involved in Regulated proteolysis of p75NTR |
0.5 | 0.5 | REACTOME CD28 CO STIMULATION | Genes involved in CD28 co-stimulation |
0.5 | 5.8 | REACTOME NEPHRIN INTERACTIONS | Genes involved in Nephrin interactions |
0.5 | 1.9 | REACTOME PD1 SIGNALING | Genes involved in PD-1 signaling |
0.5 | 5.2 | REACTOME DOWNREGULATION OF SMAD2 3 SMAD4 TRANSCRIPTIONAL ACTIVITY | Genes involved in Downregulation of SMAD2/3:SMAD4 transcriptional activity |
0.5 | 3.2 | REACTOME CREATION OF C4 AND C2 ACTIVATORS | Genes involved in Creation of C4 and C2 activators |
0.5 | 5.5 | REACTOME LIPOPROTEIN METABOLISM | Genes involved in Lipoprotein metabolism |
0.5 | 3.6 | REACTOME GLUCURONIDATION | Genes involved in Glucuronidation |
0.4 | 3.6 | REACTOME TRAFFICKING OF AMPA RECEPTORS | Genes involved in Trafficking of AMPA receptors |
0.4 | 8.8 | REACTOME INTRINSIC PATHWAY FOR APOPTOSIS | Genes involved in Intrinsic Pathway for Apoptosis |
0.4 | 4.4 | REACTOME CELL EXTRACELLULAR MATRIX INTERACTIONS | Genes involved in Cell-extracellular matrix interactions |
0.4 | 11.9 | REACTOME NOD1 2 SIGNALING PATHWAY | Genes involved in NOD1/2 Signaling Pathway |
0.4 | 12.3 | REACTOME MEIOTIC SYNAPSIS | Genes involved in Meiotic Synapsis |
0.4 | 8.3 | REACTOME PEROXISOMAL LIPID METABOLISM | Genes involved in Peroxisomal lipid metabolism |
0.4 | 4.3 | REACTOME ADVANCED GLYCOSYLATION ENDPRODUCT RECEPTOR SIGNALING | Genes involved in Advanced glycosylation endproduct receptor signaling |
0.4 | 5.0 | REACTOME MITOCHONDRIAL FATTY ACID BETA OXIDATION | Genes involved in Mitochondrial Fatty Acid Beta-Oxidation |
0.4 | 5.0 | REACTOME ANTIGEN ACTIVATES B CELL RECEPTOR LEADING TO GENERATION OF SECOND MESSENGERS | Genes involved in Antigen Activates B Cell Receptor Leading to Generation of Second Messengers |
0.4 | 2.9 | REACTOME GPVI MEDIATED ACTIVATION CASCADE | Genes involved in GPVI-mediated activation cascade |
0.4 | 6.6 | REACTOME SIGNALING BY HIPPO | Genes involved in Signaling by Hippo |
0.4 | 18.1 | REACTOME METABOLISM OF VITAMINS AND COFACTORS | Genes involved in Metabolism of vitamins and cofactors |
0.4 | 2.8 | REACTOME N GLYCAN ANTENNAE ELONGATION | Genes involved in N-Glycan antennae elongation |
0.4 | 6.0 | REACTOME NUCLEOTIDE LIKE PURINERGIC RECEPTORS | Genes involved in Nucleotide-like (purinergic) receptors |
0.4 | 33.4 | REACTOME FACTORS INVOLVED IN MEGAKARYOCYTE DEVELOPMENT AND PLATELET PRODUCTION | Genes involved in Factors involved in megakaryocyte development and platelet production |
0.4 | 8.7 | REACTOME GLUTATHIONE CONJUGATION | Genes involved in Glutathione conjugation |
0.4 | 3.1 | REACTOME FACILITATIVE NA INDEPENDENT GLUCOSE TRANSPORTERS | Genes involved in Facilitative Na+-independent glucose transporters |
0.4 | 2.7 | REACTOME TRAFFICKING AND PROCESSING OF ENDOSOMAL TLR | Genes involved in Trafficking and processing of endosomal TLR |
0.4 | 3.5 | REACTOME VEGF LIGAND RECEPTOR INTERACTIONS | Genes involved in VEGF ligand-receptor interactions |
0.4 | 1.9 | REACTOME RIP MEDIATED NFKB ACTIVATION VIA DAI | Genes involved in RIP-mediated NFkB activation via DAI |
0.4 | 0.4 | REACTOME THROMBOXANE SIGNALLING THROUGH TP RECEPTOR | Genes involved in Thromboxane signalling through TP receptor |
0.4 | 6.0 | REACTOME POST CHAPERONIN TUBULIN FOLDING PATHWAY | Genes involved in Post-chaperonin tubulin folding pathway |
0.4 | 6.4 | REACTOME DEADENYLATION OF MRNA | Genes involved in Deadenylation of mRNA |
0.4 | 5.8 | REACTOME EFFECTS OF PIP2 HYDROLYSIS | Genes involved in Effects of PIP2 hydrolysis |
0.4 | 2.5 | REACTOME MTORC1 MEDIATED SIGNALLING | Genes involved in mTORC1-mediated signalling |
0.4 | 6.1 | REACTOME POST NMDA RECEPTOR ACTIVATION EVENTS | Genes involved in Post NMDA receptor activation events |
0.4 | 13.7 | REACTOME O LINKED GLYCOSYLATION OF MUCINS | Genes involved in O-linked glycosylation of mucins |
0.4 | 4.0 | REACTOME PURINE RIBONUCLEOSIDE MONOPHOSPHATE BIOSYNTHESIS | Genes involved in Purine ribonucleoside monophosphate biosynthesis |
0.4 | 3.9 | REACTOME ACTIVATED AMPK STIMULATES FATTY ACID OXIDATION IN MUSCLE | Genes involved in Activated AMPK stimulates fatty-acid oxidation in muscle |
0.4 | 8.5 | REACTOME SYNTHESIS OF PA | Genes involved in Synthesis of PA |
0.3 | 5.6 | REACTOME ACTIVATED NOTCH1 TRANSMITS SIGNAL TO THE NUCLEUS | Genes involved in Activated NOTCH1 Transmits Signal to the Nucleus |
0.3 | 15.2 | REACTOME CHEMOKINE RECEPTORS BIND CHEMOKINES | Genes involved in Chemokine receptors bind chemokines |
0.3 | 7.6 | REACTOME METAL ION SLC TRANSPORTERS | Genes involved in Metal ion SLC transporters |
0.3 | 24.0 | REACTOME PPARA ACTIVATES GENE EXPRESSION | Genes involved in PPARA Activates Gene Expression |
0.3 | 5.8 | REACTOME PRE NOTCH EXPRESSION AND PROCESSING | Genes involved in Pre-NOTCH Expression and Processing |
0.3 | 8.8 | REACTOME ASSOCIATION OF TRIC CCT WITH TARGET PROTEINS DURING BIOSYNTHESIS | Genes involved in Association of TriC/CCT with target proteins during biosynthesis |
0.3 | 0.3 | REACTOME GLUTAMATE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Glutamate Neurotransmitter Release Cycle |
0.3 | 1.7 | REACTOME ERKS ARE INACTIVATED | Genes involved in ERKs are inactivated |
0.3 | 11.0 | REACTOME ION TRANSPORT BY P TYPE ATPASES | Genes involved in Ion transport by P-type ATPases |
0.3 | 6.6 | REACTOME CHOLESTEROL BIOSYNTHESIS | Genes involved in Cholesterol biosynthesis |
0.3 | 7.2 | REACTOME CYTOSOLIC TRNA AMINOACYLATION | Genes involved in Cytosolic tRNA aminoacylation |
0.3 | 5.7 | REACTOME APC CDC20 MEDIATED DEGRADATION OF NEK2A | Genes involved in APC-Cdc20 mediated degradation of Nek2A |
0.3 | 13.3 | REACTOME TRANSPORT OF INORGANIC CATIONS ANIONS AND AMINO ACIDS OLIGOPEPTIDES | Genes involved in Transport of inorganic cations/anions and amino acids/oligopeptides |
0.3 | 5.0 | REACTOME PLATELET AGGREGATION PLUG FORMATION | Genes involved in Platelet Aggregation (Plug Formation) |
0.3 | 9.3 | REACTOME NOTCH1 INTRACELLULAR DOMAIN REGULATES TRANSCRIPTION | Genes involved in NOTCH1 Intracellular Domain Regulates Transcription |
0.3 | 3.1 | REACTOME THE ROLE OF NEF IN HIV1 REPLICATION AND DISEASE PATHOGENESIS | Genes involved in The role of Nef in HIV-1 replication and disease pathogenesis |
0.3 | 7.6 | REACTOME ABC FAMILY PROTEINS MEDIATED TRANSPORT | Genes involved in ABC-family proteins mediated transport |
0.3 | 18.9 | REACTOME SIGNALING BY RHO GTPASES | Genes involved in Signaling by Rho GTPases |
0.3 | 3.6 | REACTOME GENERATION OF SECOND MESSENGER MOLECULES | Genes involved in Generation of second messenger molecules |
0.3 | 0.9 | REACTOME CROSS PRESENTATION OF SOLUBLE EXOGENOUS ANTIGENS ENDOSOMES | Genes involved in Cross-presentation of soluble exogenous antigens (endosomes) |
0.3 | 3.5 | REACTOME DOWNREGULATION OF TGF BETA RECEPTOR SIGNALING | Genes involved in Downregulation of TGF-beta receptor signaling |
0.3 | 0.6 | REACTOME IL 3 5 AND GM CSF SIGNALING | Genes involved in Interleukin-3, 5 and GM-CSF signaling |
0.3 | 5.5 | REACTOME RNA POL III TRANSCRIPTION TERMINATION | Genes involved in RNA Polymerase III Transcription Termination |
0.3 | 3.5 | REACTOME PRESYNAPTIC NICOTINIC ACETYLCHOLINE RECEPTORS | Genes involved in Presynaptic nicotinic acetylcholine receptors |
0.3 | 8.7 | REACTOME METABOLISM OF STEROID HORMONES AND VITAMINS A AND D | Genes involved in Metabolism of steroid hormones and vitamins A and D |
0.3 | 6.0 | REACTOME MEIOTIC RECOMBINATION | Genes involved in Meiotic Recombination |
0.3 | 6.3 | REACTOME INTERFERON ALPHA BETA SIGNALING | Genes involved in Interferon alpha/beta signaling |
0.3 | 5.9 | REACTOME NEGATIVE REGULATORS OF RIG I MDA5 SIGNALING | Genes involved in Negative regulators of RIG-I/MDA5 signaling |
0.3 | 1.1 | REACTOME DESTABILIZATION OF MRNA BY AUF1 HNRNP D0 | Genes involved in Destabilization of mRNA by AUF1 (hnRNP D0) |
0.3 | 3.1 | REACTOME UNWINDING OF DNA | Genes involved in Unwinding of DNA |
0.3 | 4.7 | REACTOME FORMATION OF INCISION COMPLEX IN GG NER | Genes involved in Formation of incision complex in GG-NER |
0.3 | 1.6 | REACTOME APOPTOSIS INDUCED DNA FRAGMENTATION | Genes involved in Apoptosis induced DNA fragmentation |
0.3 | 4.0 | REACTOME TRANSCRIPTIONAL REGULATION OF WHITE ADIPOCYTE DIFFERENTIATION | Genes involved in Transcriptional Regulation of White Adipocyte Differentiation |
0.3 | 0.3 | REACTOME PECAM1 INTERACTIONS | Genes involved in PECAM1 interactions |
0.3 | 3.8 | REACTOME G1 PHASE | Genes involved in G1 Phase |
0.3 | 0.8 | REACTOME IRAK1 RECRUITS IKK COMPLEX | Genes involved in IRAK1 recruits IKK complex |
0.3 | 1.0 | REACTOME LIPID DIGESTION MOBILIZATION AND TRANSPORT | Genes involved in Lipid digestion, mobilization, and transport |
0.3 | 0.8 | REACTOME HOST INTERACTIONS OF HIV FACTORS | Genes involved in Host Interactions of HIV factors |
0.2 | 1.2 | REACTOME HS GAG DEGRADATION | Genes involved in HS-GAG degradation |
0.2 | 3.2 | REACTOME AMYLOIDS | Genes involved in Amyloids |
0.2 | 2.7 | REACTOME MRNA DECAY BY 3 TO 5 EXORIBONUCLEASE | Genes involved in mRNA Decay by 3' to 5' Exoribonuclease |
0.2 | 0.5 | REACTOME PROCESSING OF CAPPED INTRON CONTAINING PRE MRNA | Genes involved in Processing of Capped Intron-Containing Pre-mRNA |
0.2 | 1.2 | REACTOME SIGNALING BY PDGF | Genes involved in Signaling by PDGF |
0.2 | 0.7 | REACTOME ACTIVATION OF RAC | Genes involved in Activation of Rac |
0.2 | 0.7 | REACTOME OLFACTORY SIGNALING PATHWAY | Genes involved in Olfactory Signaling Pathway |
0.2 | 0.9 | REACTOME ACTIVATION OF THE AP1 FAMILY OF TRANSCRIPTION FACTORS | Genes involved in Activation of the AP-1 family of transcription factors |
0.2 | 0.9 | REACTOME N GLYCAN ANTENNAE ELONGATION IN THE MEDIAL TRANS GOLGI | Genes involved in N-glycan antennae elongation in the medial/trans-Golgi |
0.2 | 0.2 | REACTOME PLATELET CALCIUM HOMEOSTASIS | Genes involved in Platelet calcium homeostasis |
0.2 | 0.7 | REACTOME NEGATIVE REGULATION OF THE PI3K AKT NETWORK | Genes involved in Negative regulation of the PI3K/AKT network |
0.2 | 6.1 | REACTOME HS GAG BIOSYNTHESIS | Genes involved in HS-GAG biosynthesis |
0.2 | 1.7 | REACTOME THE NLRP3 INFLAMMASOME | Genes involved in The NLRP3 inflammasome |
0.2 | 8.9 | REACTOME GLYCEROPHOSPHOLIPID BIOSYNTHESIS | Genes involved in Glycerophospholipid biosynthesis |
0.2 | 4.3 | REACTOME MUSCLE CONTRACTION | Genes involved in Muscle contraction |
0.2 | 5.1 | REACTOME BIOSYNTHESIS OF THE N GLYCAN PRECURSOR DOLICHOL LIPID LINKED OLIGOSACCHARIDE LLO AND TRANSFER TO A NASCENT PROTEIN | Genes involved in Biosynthesis of the N-glycan precursor (dolichol lipid-linked oligosaccharide, LLO) and transfer to a nascent protein |
0.2 | 1.9 | REACTOME BMAL1 CLOCK NPAS2 ACTIVATES CIRCADIAN EXPRESSION | Genes involved in BMAL1:CLOCK/NPAS2 Activates Circadian Expression |
0.2 | 1.9 | REACTOME PASSIVE TRANSPORT BY AQUAPORINS | Genes involved in Passive Transport by Aquaporins |
0.2 | 20.5 | REACTOME PEPTIDE LIGAND BINDING RECEPTORS | Genes involved in Peptide ligand-binding receptors |
0.2 | 0.4 | REACTOME BASIGIN INTERACTIONS | Genes involved in Basigin interactions |
0.2 | 2.6 | REACTOME APOPTOTIC EXECUTION PHASE | Genes involved in Apoptotic execution phase |
0.2 | 1.0 | REACTOME ETHANOL OXIDATION | Genes involved in Ethanol oxidation |
0.2 | 1.9 | REACTOME SIGNALING BY NODAL | Genes involved in Signaling by NODAL |
0.2 | 1.5 | REACTOME VIRAL MESSENGER RNA SYNTHESIS | Genes involved in Viral Messenger RNA Synthesis |
0.2 | 1.8 | REACTOME PHASE II CONJUGATION | Genes involved in Phase II conjugation |
0.2 | 2.2 | REACTOME SULFUR AMINO ACID METABOLISM | Genes involved in Sulfur amino acid metabolism |
0.2 | 4.6 | REACTOME IMMUNOREGULATORY INTERACTIONS BETWEEN A LYMPHOID AND A NON LYMPHOID CELL | Genes involved in Immunoregulatory interactions between a Lymphoid and a non-Lymphoid cell |
0.2 | 2.1 | REACTOME REGULATION OF INSULIN LIKE GROWTH FACTOR IGF ACTIVITY BY INSULIN LIKE GROWTH FACTOR BINDING PROTEINS IGFBPS | Genes involved in Regulation of Insulin-like Growth Factor (IGF) Activity by Insulin-like Growth Factor Binding Proteins (IGFBPs) |
0.2 | 1.5 | REACTOME NA CL DEPENDENT NEUROTRANSMITTER TRANSPORTERS | Genes involved in Na+/Cl- dependent neurotransmitter transporters |
0.2 | 1.9 | REACTOME REGULATION OF PYRUVATE DEHYDROGENASE PDH COMPLEX | Genes involved in Regulation of pyruvate dehydrogenase (PDH) complex |
0.2 | 0.5 | REACTOME FORMATION OF TRANSCRIPTION COUPLED NER TC NER REPAIR COMPLEX | Genes involved in Formation of transcription-coupled NER (TC-NER) repair complex |
0.2 | 1.0 | REACTOME INTEGRATION OF ENERGY METABOLISM | Genes involved in Integration of energy metabolism |
0.2 | 2.5 | REACTOME RNA POL II TRANSCRIPTION PRE INITIATION AND PROMOTER OPENING | Genes involved in RNA Polymerase II Transcription Pre-Initiation And Promoter Opening |
0.2 | 2.7 | REACTOME CYTOCHROME P450 ARRANGED BY SUBSTRATE TYPE | Genes involved in Cytochrome P450 - arranged by substrate type |
0.2 | 2.6 | REACTOME MITOCHONDRIAL TRNA AMINOACYLATION | Genes involved in Mitochondrial tRNA aminoacylation |
0.2 | 6.4 | REACTOME FORMATION OF THE TERNARY COMPLEX AND SUBSEQUENTLY THE 43S COMPLEX | Genes involved in Formation of the ternary complex, and subsequently, the 43S complex |
0.2 | 0.2 | REACTOME ENDOSOMAL VACUOLAR PATHWAY | Genes involved in Endosomal/Vacuolar pathway |
0.2 | 0.6 | REACTOME NITRIC OXIDE STIMULATES GUANYLATE CYCLASE | Genes involved in Nitric oxide stimulates guanylate cyclase |
0.1 | 0.1 | REACTOME PROLONGED ERK ACTIVATION EVENTS | Genes involved in Prolonged ERK activation events |
0.1 | 2.4 | REACTOME GAP JUNCTION ASSEMBLY | Genes involved in Gap junction assembly |
0.1 | 2.2 | REACTOME CITRIC ACID CYCLE TCA CYCLE | Genes involved in Citric acid cycle (TCA cycle) |
0.1 | 0.9 | REACTOME ELONGATION ARREST AND RECOVERY | Genes involved in Elongation arrest and recovery |
0.1 | 5.5 | REACTOME MITOCHONDRIAL PROTEIN IMPORT | Genes involved in Mitochondrial Protein Import |
0.1 | 0.5 | REACTOME PROLACTIN RECEPTOR SIGNALING | Genes involved in Prolactin receptor signaling |
0.1 | 19.6 | REACTOME ANTIGEN PROCESSING UBIQUITINATION PROTEASOME DEGRADATION | Genes involved in Antigen processing: Ubiquitination & Proteasome degradation |
0.1 | 1.0 | REACTOME RNA POL I TRANSCRIPTION | Genes involved in RNA Polymerase I Transcription |
0.1 | 0.1 | REACTOME CTLA4 INHIBITORY SIGNALING | Genes involved in CTLA4 inhibitory signaling |
0.1 | 4.7 | REACTOME NCAM SIGNALING FOR NEURITE OUT GROWTH | Genes involved in NCAM signaling for neurite out-growth |
0.1 | 0.7 | REACTOME REMOVAL OF THE FLAP INTERMEDIATE FROM THE C STRAND | Genes involved in Removal of the Flap Intermediate from the C-strand |
0.1 | 0.3 | REACTOME FGFR1 LIGAND BINDING AND ACTIVATION | Genes involved in FGFR1 ligand binding and activation |
0.1 | 0.7 | REACTOME DARPP 32 EVENTS | Genes involved in DARPP-32 events |
0.1 | 1.3 | REACTOME N GLYCAN TRIMMING IN THE ER AND CALNEXIN CALRETICULIN CYCLE | Genes involved in N-glycan trimming in the ER and Calnexin/Calreticulin cycle |
0.1 | 1.4 | REACTOME TRANSPORT TO THE GOLGI AND SUBSEQUENT MODIFICATION | Genes involved in Transport to the Golgi and subsequent modification |
0.1 | 0.3 | REACTOME ANTIGEN PRESENTATION FOLDING ASSEMBLY AND PEPTIDE LOADING OF CLASS I MHC | Genes involved in Antigen Presentation: Folding, assembly and peptide loading of class I MHC |
0.1 | 1.5 | REACTOME INWARDLY RECTIFYING K CHANNELS | Genes involved in Inwardly rectifying K+ channels |
0.1 | 0.4 | REACTOME DOWNSTREAM TCR SIGNALING | Genes involved in Downstream TCR signaling |
0.1 | 0.1 | REACTOME LATENT INFECTION OF HOMO SAPIENS WITH MYCOBACTERIUM TUBERCULOSIS | Genes involved in Latent infection of Homo sapiens with Mycobacterium tuberculosis |
0.1 | 2.0 | REACTOME PI METABOLISM | Genes involved in PI Metabolism |
0.1 | 0.1 | REACTOME ACTIVATION OF THE MRNA UPON BINDING OF THE CAP BINDING COMPLEX AND EIFS AND SUBSEQUENT BINDING TO 43S | Genes involved in Activation of the mRNA upon binding of the cap-binding complex and eIFs, and subsequent binding to 43S |
0.1 | 0.4 | REACTOME ACTIVATION OF IRF3 IRF7 MEDIATED BY TBK1 IKK EPSILON | Genes involved in Activation of IRF3/IRF7 mediated by TBK1/IKK epsilon |
0.1 | 3.7 | REACTOME RESPONSE TO ELEVATED PLATELET CYTOSOLIC CA2 | Genes involved in Response to elevated platelet cytosolic Ca2+ |
0.1 | 0.3 | REACTOME INFLUENZA VIRAL RNA TRANSCRIPTION AND REPLICATION | Genes involved in Influenza Viral RNA Transcription and Replication |
0.1 | 0.8 | REACTOME REGULATION OF INSULIN SECRETION BY ACETYLCHOLINE | Genes involved in Regulation of Insulin Secretion by Acetylcholine |
0.1 | 0.3 | REACTOME INCRETIN SYNTHESIS SECRETION AND INACTIVATION | Genes involved in Incretin Synthesis, Secretion, and Inactivation |
0.1 | 0.2 | REACTOME TRANSCRIPTIONAL ACTIVITY OF SMAD2 SMAD3 SMAD4 HETEROTRIMER | Genes involved in Transcriptional activity of SMAD2/SMAD3:SMAD4 heterotrimer |
0.1 | 0.1 | REACTOME NFKB ACTIVATION THROUGH FADD RIP1 PATHWAY MEDIATED BY CASPASE 8 AND10 | Genes involved in NF-kB activation through FADD/RIP-1 pathway mediated by caspase-8 and -10 |
0.1 | 0.2 | REACTOME CYCLIN E ASSOCIATED EVENTS DURING G1 S TRANSITION | Genes involved in Cyclin E associated events during G1/S transition |
0.1 | 0.1 | REACTOME HIGHLY CALCIUM PERMEABLE POSTSYNAPTIC NICOTINIC ACETYLCHOLINE RECEPTORS | Genes involved in Highly calcium permeable postsynaptic nicotinic acetylcholine receptors |
0.1 | 0.2 | REACTOME SYNTHESIS OF BILE ACIDS AND BILE SALTS | Genes involved in Synthesis of bile acids and bile salts |
0.1 | 0.1 | REACTOME NRIF SIGNALS CELL DEATH FROM THE NUCLEUS | Genes involved in NRIF signals cell death from the nucleus |
0.1 | 1.0 | REACTOME COMPLEMENT CASCADE | Genes involved in Complement cascade |
0.1 | 4.5 | REACTOME NONSENSE MEDIATED DECAY ENHANCED BY THE EXON JUNCTION COMPLEX | Genes involved in Nonsense Mediated Decay Enhanced by the Exon Junction Complex |
0.1 | 0.3 | REACTOME ACTIVATION OF CHAPERONE GENES BY ATF6 ALPHA | Genes involved in Activation of Chaperone Genes by ATF6-alpha |
0.1 | 0.1 | REACTOME AKT PHOSPHORYLATES TARGETS IN THE CYTOSOL | Genes involved in AKT phosphorylates targets in the cytosol |
0.1 | 2.0 | REACTOME ACTIVATION OF CHAPERONE GENES BY XBP1S | Genes involved in Activation of Chaperone Genes by XBP1(S) |
0.1 | 1.1 | REACTOME SIGNALING BY ILS | Genes involved in Signaling by Interleukins |
0.1 | 2.5 | REACTOME VOLTAGE GATED POTASSIUM CHANNELS | Genes involved in Voltage gated Potassium channels |
0.1 | 0.5 | REACTOME FORMATION OF ATP BY CHEMIOSMOTIC COUPLING | Genes involved in Formation of ATP by chemiosmotic coupling |
0.1 | 0.2 | REACTOME PYRUVATE METABOLISM | Genes involved in Pyruvate metabolism |
0.1 | 0.3 | REACTOME REPAIR SYNTHESIS FOR GAP FILLING BY DNA POL IN TC NER | Genes involved in Repair synthesis for gap-filling by DNA polymerase in TC-NER |
0.0 | 1.3 | REACTOME INTEGRIN CELL SURFACE INTERACTIONS | Genes involved in Integrin cell surface interactions |
0.0 | 0.2 | REACTOME RNA POL III TRANSCRIPTION INITIATION FROM TYPE 2 PROMOTER | Genes involved in RNA Polymerase III Transcription Initiation From Type 2 Promoter |
0.0 | 0.1 | REACTOME SIGNALING BY TGF BETA RECEPTOR COMPLEX | Genes involved in Signaling by TGF-beta Receptor Complex |
0.0 | 0.2 | REACTOME ASPARAGINE N LINKED GLYCOSYLATION | Genes involved in Asparagine N-linked glycosylation |
0.0 | 0.3 | REACTOME P75 NTR RECEPTOR MEDIATED SIGNALLING | Genes involved in p75 NTR receptor-mediated signalling |
0.0 | 0.2 | REACTOME CYCLIN A B1 ASSOCIATED EVENTS DURING G2 M TRANSITION | Genes involved in Cyclin A/B1 associated events during G2/M transition |
0.0 | 0.0 | REACTOME TRAF3 DEPENDENT IRF ACTIVATION PATHWAY | Genes involved in TRAF3-dependent IRF activation pathway |
0.0 | 0.4 | REACTOME TANDEM PORE DOMAIN POTASSIUM CHANNELS | Genes involved in Tandem pore domain potassium channels |
0.0 | 1.1 | REACTOME GLYCOSPHINGOLIPID METABOLISM | Genes involved in Glycosphingolipid metabolism |
0.0 | 0.3 | REACTOME EXTRINSIC PATHWAY FOR APOPTOSIS | Genes involved in Extrinsic Pathway for Apoptosis |
0.0 | 1.5 | REACTOME LOSS OF NLP FROM MITOTIC CENTROSOMES | Genes involved in Loss of Nlp from mitotic centrosomes |
0.0 | 0.2 | REACTOME MEMBRANE BINDING AND TARGETTING OF GAG PROTEINS | Genes involved in Membrane binding and targetting of GAG proteins |
0.0 | 0.2 | REACTOME REGULATORY RNA PATHWAYS | Genes involved in Regulatory RNA pathways |
0.0 | 0.4 | REACTOME CLASS C 3 METABOTROPIC GLUTAMATE PHEROMONE RECEPTORS | Genes involved in Class C/3 (Metabotropic glutamate/pheromone receptors) |
0.0 | 0.5 | REACTOME INSULIN SYNTHESIS AND PROCESSING | Genes involved in Insulin Synthesis and Processing |
0.0 | 0.1 | REACTOME DEFENSINS | Genes involved in Defensins |
0.0 | 0.2 | REACTOME ORC1 REMOVAL FROM CHROMATIN | Genes involved in Orc1 removal from chromatin |
0.0 | 0.5 | REACTOME DEPOSITION OF NEW CENPA CONTAINING NUCLEOSOMES AT THE CENTROMERE | Genes involved in Deposition of New CENPA-containing Nucleosomes at the Centromere |
0.0 | 0.1 | REACTOME G ALPHA Z SIGNALLING EVENTS | Genes involved in G alpha (z) signalling events |
0.0 | 0.0 | REACTOME ACETYLCHOLINE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Acetylcholine Neurotransmitter Release Cycle |
0.0 | 0.0 | REACTOME REGULATION OF GLUCOKINASE BY GLUCOKINASE REGULATORY PROTEIN | Genes involved in Regulation of Glucokinase by Glucokinase Regulatory Protein |
0.0 | 0.3 | REACTOME SYNTHESIS AND INTERCONVERSION OF NUCLEOTIDE DI AND TRIPHOSPHATES | Genes involved in Synthesis and interconversion of nucleotide di- and triphosphates |
0.0 | 1.9 | REACTOME METABOLISM OF AMINO ACIDS AND DERIVATIVES | Genes involved in Metabolism of amino acids and derivatives |
0.0 | 0.2 | REACTOME DIABETES PATHWAYS | Genes involved in Diabetes pathways |
0.0 | 0.1 | REACTOME EICOSANOID LIGAND BINDING RECEPTORS | Genes involved in Eicosanoid ligand-binding receptors |
0.0 | 0.1 | REACTOME ACTIVATION OF ATR IN RESPONSE TO REPLICATION STRESS | Genes involved in Activation of ATR in response to replication stress |
0.0 | 0.4 | REACTOME L1CAM INTERACTIONS | Genes involved in L1CAM interactions |
0.0 | 0.2 | REACTOME METABOLISM OF NON CODING RNA | Genes involved in Metabolism of non-coding RNA |
0.0 | 0.0 | REACTOME CELL CYCLE CHECKPOINTS | Genes involved in Cell Cycle Checkpoints |
0.0 | 0.0 | REACTOME REGULATION OF THE FANCONI ANEMIA PATHWAY | Genes involved in Regulation of the Fanconi anemia pathway |