| Gene Symbol | Gene ID | Gene Info |
|---|---|---|
|
Lhx8
|
ENSMUSG00000096225.2 | LIM homeobox protein 8 |
| CRE | Gene | Distance | Association probability | Pearson corr. coef. | P-value | Plot |
|---|---|---|---|---|---|---|
| chr3_154328936_154329165 | Lhx8 | 416 | 0.812621 | 0.59 | 2.3e-06 | Click! |
| chr3_154327918_154328874 | Lhx8 | 230 | 0.925534 | 0.52 | 4.2e-05 | Click! |
| chr3_154329503_154329689 | Lhx8 | 463 | 0.739080 | 0.50 | 8.6e-05 | Click! |
| chr3_154298611_154298764 | Lhx8 | 26196 | 0.153655 | -0.42 | 1.4e-03 | Click! |
| chr3_154330162_154330352 | Lhx8 | 198 | 0.810273 | 0.38 | 4.4e-03 | Click! |
Move your cursor over a bar to see sample name and corresponding Z-value.
| Cis Regulatory Element (CRE) | Target Score | Top associated gene | Gene Info | Distance of CRE to TSS | CRE/Gene association probability |
|---|---|---|---|---|---|
| chr3_88205312_88205479 | 10.43 |
AI849053 |
expressed sequence AI849053 |
800 |
0.34 |
| chr8_58372581_58372772 | 10.30 |
Gm45635 |
predicted gene 45635 |
126089 |
0.06 |
| chrX_85682243_85682394 | 10.27 |
Gk |
glycerol kinase |
30157 |
0.15 |
| chr17_16089277_16089512 | 10.08 |
Gm49778 |
predicted gene, 49778 |
73757 |
0.1 |
| chr4_21932308_21932628 | 10.07 |
Faxc |
failed axon connections homolog |
1111 |
0.54 |
| chr1_94503721_94503899 | 10.04 |
Gm7895 |
predicted gene 7895 |
33923 |
0.23 |
| chr14_12388940_12389425 | 10.02 |
Cadps |
Ca2+-dependent secretion activator |
11903 |
0.13 |
| chr2_50128463_50128630 | 9.86 |
Lypd6 |
LY6/PLAUR domain containing 6 |
177 |
0.97 |
| chr3_74921305_74921457 | 9.43 |
Gm37464 |
predicted gene, 37464 |
103234 |
0.08 |
| chr14_123065129_123065306 | 9.38 |
AA536875 |
expressed sequence AA536875 |
21935 |
0.22 |
| chr7_79590405_79591230 | 9.09 |
Gm45169 |
predicted gene 45169 |
1796 |
0.2 |
| chr13_84751597_84751791 | 9.05 |
Gm26913 |
predicted gene, 26913 |
60753 |
0.15 |
| chr5_78622542_78622942 | 8.78 |
Gm43232 |
predicted gene 43232 |
82214 |
0.11 |
| chr5_44474212_44474578 | 8.77 |
Gm42981 |
predicted gene 42981 |
21026 |
0.13 |
| chr6_101921407_101921591 | 8.75 |
Gm44177 |
predicted gene, 44177 |
8226 |
0.27 |
| chr17_52569691_52569842 | 8.09 |
Gm27217 |
predicted gene 27217 |
32894 |
0.19 |
| chr5_85572073_85572255 | 8.05 |
Gm43567 |
predicted gene 43567 |
148610 |
0.05 |
| chr17_49966730_49966881 | 8.05 |
AC133946.1 |
oxidoreductase NAD-binding domain containing 1 (OXNAD1) pseudogene |
6022 |
0.22 |
| chr5_20227973_20228279 | 7.94 |
Magi2 |
membrane associated guanylate kinase, WW and PDZ domain containing 2 |
60 |
0.98 |
| chr1_97622935_97623105 | 7.88 |
AC099860.1 |
proline rich protein BstNI subfamily 4 (PRB4), pseudogene |
37811 |
0.15 |
| chr4_21932028_21932190 | 7.62 |
Faxc |
failed axon connections homolog |
752 |
0.69 |
| chr2_65930302_65930453 | 7.61 |
Csrnp3 |
cysteine-serine-rich nuclear protein 3 |
240 |
0.94 |
| chr10_72298914_72299065 | 7.60 |
Gm9923 |
predicted pseudogene 9923 |
10332 |
0.31 |
| chr1_23762182_23762730 | 7.55 |
B3gat2 |
beta-1,3-glucuronyltransferase 2 (glucuronosyltransferase S) |
445 |
0.89 |
| chr19_42817926_42818077 | 7.50 |
Hps1 |
HPS1, biogenesis of lysosomal organelles complex 3 subunit 1 |
38023 |
0.14 |
| chr3_51590575_51590969 | 7.50 |
5430433H01Rik |
RIKEN cDNA 5430433H01 gene |
8466 |
0.11 |
| chr5_69704371_69704541 | 7.38 |
Gm26044 |
predicted gene, 26044 |
48072 |
0.15 |
| chr4_12475075_12475534 | 7.31 |
Gm37985 |
predicted gene, 37985 |
122084 |
0.06 |
| chr13_110650166_110650317 | 7.31 |
Gm33045 |
predicted gene, 33045 |
22245 |
0.21 |
| chr10_32871097_32871256 | 7.24 |
Nkain2 |
Na+/K+ transporting ATPase interacting 2 |
18520 |
0.25 |
| chr1_162410707_162410867 | 7.22 |
Dnm3 |
dynamin 3 |
3452 |
0.29 |
| chr10_90259200_90259351 | 7.16 |
Gm5780 |
predicted gene 5780 |
124458 |
0.06 |
| chr12_48959723_48959914 | 7.15 |
Gm26454 |
predicted gene, 26454 |
50065 |
0.16 |
| chr6_111293807_111293981 | 7.10 |
Grm7 |
glutamate receptor, metabotropic 7 |
201821 |
0.03 |
| chr2_22620080_22620281 | 7.08 |
Gad2 |
glutamic acid decarboxylase 2 |
2025 |
0.23 |
| chr4_116911311_116911462 | 7.07 |
Gm26355 |
predicted gene, 26355 |
6749 |
0.1 |
| chr15_91056179_91056514 | 7.05 |
Kif21a |
kinesin family member 21A |
6398 |
0.21 |
| chrX_59179361_59179595 | 7.05 |
Gm26487 |
predicted gene, 26487 |
11295 |
0.18 |
| chr7_62046082_62046717 | 7.04 |
Mir344f |
microRNA Mir344f |
151 |
0.94 |
| chr5_16166576_16166763 | 7.01 |
Gm43490 |
predicted gene 43490 |
59540 |
0.14 |
| chr6_101551112_101551263 | 6.96 |
Gm44171 |
predicted gene, 44171 |
12434 |
0.22 |
| chr13_101203160_101203326 | 6.93 |
5930438M14Rik |
RIKEN cDNA 5930438M14 gene |
28884 |
0.19 |
| chr5_131794610_131795069 | 6.88 |
4930563F08Rik |
RIKEN cDNA 4930563F08 gene |
85430 |
0.06 |
| chrX_93429292_93429706 | 6.86 |
Pola1 |
polymerase (DNA directed), alpha 1 |
61447 |
0.12 |
| chr3_156904026_156904232 | 6.80 |
Gm15577 |
predicted gene 15577 |
16651 |
0.23 |
| chr15_61102770_61102921 | 6.58 |
Gm38563 |
predicted gene, 38563 |
55024 |
0.14 |
| chr5_53002859_53003010 | 6.54 |
5033403H07Rik |
RIKEN cDNA 5033403H07 gene |
8498 |
0.15 |
| chr13_77893040_77893199 | 6.53 |
Pou5f2 |
POU domain class 5, transcription factor 2 |
131783 |
0.05 |
| chr9_117870722_117870873 | 6.52 |
Rbms3 |
RNA binding motif, single stranded interacting protein |
1787 |
0.36 |
| chr7_130381917_130382084 | 6.48 |
Gm5903 |
predicted gene 5903 |
27638 |
0.17 |
| chr2_48186582_48186969 | 6.46 |
Gm13471 |
predicted gene 13471 |
46629 |
0.19 |
| chr1_39515400_39515593 | 6.43 |
Gm24826 |
predicted gene, 24826 |
4037 |
0.15 |
| chr2_106356001_106356474 | 6.43 |
Dcdc5 |
doublecortin domain containing 5 |
27450 |
0.23 |
| chr14_70659174_70659883 | 6.40 |
Npm2 |
nucleophosmin/nucleoplasmin 2 |
284 |
0.85 |
| chr3_139885937_139886924 | 6.34 |
Gm43678 |
predicted gene 43678 |
73666 |
0.11 |
| chr12_3236518_3237725 | 6.30 |
Rab10os |
RAB10, member RAS oncogene family, opposite strand |
510 |
0.74 |
| chr4_13408185_13408336 | 6.27 |
Gm11819 |
predicted gene 11819 |
36510 |
0.2 |
| chr8_32792963_32793144 | 6.26 |
Nrg1 |
neuregulin 1 |
90809 |
0.1 |
| chr7_70067925_70068444 | 6.23 |
Gm24120 |
predicted gene, 24120 |
110280 |
0.06 |
| chr2_49719024_49719250 | 6.18 |
Kif5c |
kinesin family member 5C |
3430 |
0.29 |
| chr4_125534653_125535467 | 6.16 |
Mir692-2 |
microRNA 692-2 |
30311 |
0.17 |
| chr6_22688679_22688830 | 6.15 |
Gm8927 |
predicted gene 8927 |
14682 |
0.19 |
| chr3_151334202_151334377 | 6.13 |
Gm42949 |
predicted gene 42949 |
940 |
0.66 |
| chr4_136905224_136905433 | 6.07 |
C1qa |
complement component 1, q subcomponent, alpha polypeptide |
6525 |
0.16 |
| chr2_96401290_96401481 | 6.07 |
Lrrc4c |
leucine rich repeat containing 4C |
83169 |
0.11 |
| chr12_74268672_74268993 | 5.99 |
1700086L19Rik |
RIKEN cDNA 1700086L19 gene |
15410 |
0.15 |
| chr4_86183975_86184194 | 5.98 |
Adamtsl1 |
ADAMTS-like 1 |
15233 |
0.29 |
| chr1_47278756_47278926 | 5.93 |
Gm4852 |
predicted pseudogene 4852 |
87531 |
0.09 |
| chr10_54551843_54552056 | 5.91 |
Gm47970 |
predicted gene, 47970 |
119755 |
0.06 |
| chr7_48947606_48947757 | 5.91 |
Gm18559 |
predicted gene, 18559 |
7563 |
0.16 |
| chr9_87115726_87115933 | 5.84 |
Gm8282 |
predicted gene 8282 |
11505 |
0.17 |
| chr9_80227036_80227214 | 5.78 |
Myo6 |
myosin VI |
9488 |
0.22 |
| chr5_111195506_111196004 | 5.77 |
Gm43676 |
predicted gene 43676 |
1385 |
0.43 |
| chr15_9713796_9713947 | 5.77 |
Spef2 |
sperm flagellar 2 |
34906 |
0.23 |
| chr13_109569610_109569794 | 5.70 |
Pde4d |
phosphodiesterase 4D, cAMP specific |
11703 |
0.32 |
| chr2_19455988_19456139 | 5.68 |
1810010K12Rik |
RIKEN cDNA 1810010K12 gene |
3593 |
0.16 |
| chr3_110010804_110011296 | 5.66 |
Gm12535 |
predicted gene 12535 |
103666 |
0.07 |
| chr13_84761098_84761279 | 5.66 |
Gm26913 |
predicted gene, 26913 |
70247 |
0.13 |
| chr13_28416227_28416775 | 5.65 |
Gm40841 |
predicted gene, 40841 |
3362 |
0.31 |
| chr2_49672278_49672906 | 5.63 |
Gm13525 |
predicted gene 13525 |
7907 |
0.24 |
| chr14_24875292_24875443 | 5.63 |
Gm10398 |
predicted gene 10398 |
34047 |
0.17 |
| chr7_39894298_39894563 | 5.61 |
Gm44992 |
predicted gene 44992 |
16180 |
0.18 |
| chr13_73117014_73117369 | 5.61 |
Rpl31-ps2 |
ribosomal protein L31, pseudogene 2 |
116204 |
0.06 |
| chr19_19886436_19886618 | 5.60 |
Gm50216 |
predicted gene, 50216 |
9964 |
0.3 |
| chr19_26978078_26978269 | 5.60 |
Gm50121 |
predicted gene, 50121 |
47808 |
0.16 |
| chr14_64377478_64377768 | 5.60 |
Msra |
methionine sulfoxide reductase A |
39325 |
0.19 |
| chr18_30264353_30264504 | 5.57 |
Gm49980 |
predicted gene, 49980 |
2821 |
0.31 |
| chr18_35214941_35215148 | 5.56 |
Lrrtm2 |
leucine rich repeat transmembrane neuronal 2 |
20 |
0.56 |
| chr2_61663689_61663846 | 5.55 |
Tank |
TRAF family member-associated Nf-kappa B activator |
19936 |
0.19 |
| chr14_108405231_108405393 | 5.53 |
Gm24818 |
predicted gene, 24818 |
25748 |
0.27 |
| chr7_132158684_132158869 | 5.52 |
Cpxm2 |
carboxypeptidase X 2 (M14 family) |
4037 |
0.23 |
| chr6_96631600_96631798 | 5.51 |
Gm26011 |
predicted gene, 26011 |
70835 |
0.13 |
| chr1_129208294_129208780 | 5.48 |
Thsd7b |
thrombospondin, type I, domain containing 7B |
64765 |
0.13 |
| chr8_45734198_45734373 | 5.40 |
Sorbs2 |
sorbin and SH3 domain containing 2 |
8896 |
0.2 |
| chr10_69720220_69720528 | 5.36 |
Ank3 |
ankyrin 3, epithelial |
13896 |
0.29 |
| chr1_88668916_88669101 | 5.35 |
Gm29336 |
predicted gene 29336 |
12700 |
0.16 |
| chr18_54580510_54580661 | 5.34 |
9330117O12Rik |
RIKEN cDNA 9330117O12 gene |
31159 |
0.2 |
| chr9_68792035_68792248 | 5.34 |
Rora |
RAR-related orphan receptor alpha |
136838 |
0.05 |
| chr1_106690804_106691150 | 5.30 |
Bcl2 |
B cell leukemia/lymphoma 2 |
22202 |
0.19 |
| chr3_107066554_107066723 | 5.29 |
A930002I21Rik |
RIKEN cDNA A930002I21 gene |
24242 |
0.12 |
| chr11_118793598_118794019 | 5.29 |
Gm11750 |
predicted gene 11750 |
2436 |
0.3 |
| chr2_141740473_141740682 | 5.25 |
Fau-ps1 |
Finkel-Biskis-Reilly murine sarcoma virus (FBR-MuSV) ubiquitously expressed (fox derived), pseudogene 1 |
98212 |
0.08 |
| chr12_56415474_56415625 | 5.24 |
Gm18027 |
predicted gene, 18027 |
4992 |
0.2 |
| chr9_21196197_21196830 | 5.20 |
Pde4a |
phosphodiesterase 4A, cAMP specific |
192 |
0.89 |
| chr10_115013465_115013704 | 5.19 |
Gm22070 |
predicted gene, 22070 |
22043 |
0.22 |
| chr4_22498432_22498613 | 5.19 |
Gm30731 |
predicted gene, 30731 |
7974 |
0.16 |
| chr16_50585962_50586298 | 5.19 |
4930542D17Rik |
RIKEN cDNA 4930542D17 gene |
4373 |
0.22 |
| chr11_15386340_15386549 | 5.17 |
Gm24707 |
predicted gene, 24707 |
25856 |
0.23 |
| chr6_4739643_4739794 | 5.14 |
Sgce |
sarcoglycan, epsilon |
489 |
0.77 |
| chr2_146330592_146331553 | 5.13 |
Gm14117 |
predicted gene 14117 |
25525 |
0.19 |
| chr12_5088634_5088975 | 5.13 |
Gm9110 |
predicted gene 9110 |
21356 |
0.21 |
| chr9_45434245_45434428 | 5.13 |
4833428L15Rik |
RIKEN cDNA 4833428L15 gene |
2606 |
0.19 |
| chr2_30646949_30647338 | 5.11 |
9330198N18Rik |
RIKEN cDNA 9330198N18 gene |
17488 |
0.14 |
| chr10_90576386_90576809 | 5.10 |
Anks1b |
ankyrin repeat and sterile alpha motif domain containing 1B |
15 |
0.99 |
| chr5_91909293_91909484 | 5.09 |
Gm43688 |
predicted gene 43688 |
4015 |
0.19 |
| chr3_102980219_102980386 | 5.09 |
Sike1 |
suppressor of IKBKE 1 |
15406 |
0.12 |
| chr7_141468254_141469266 | 5.09 |
Cd151 |
CD151 antigen |
62 |
0.89 |
| chr2_105792459_105792620 | 5.06 |
Elp4 |
elongator acetyltransferase complex subunit 4 |
21783 |
0.2 |
| chr10_33732537_33732688 | 5.04 |
Gm47929 |
predicted gene, 47929 |
17720 |
0.17 |
| chr15_83829339_83829510 | 5.02 |
Mpped1 |
metallophosphoesterase domain containing 1 |
6583 |
0.24 |
| chr6_138420273_138420927 | 5.00 |
Lmo3 |
LIM domain only 3 |
852 |
0.59 |
| chr6_83104181_83104351 | 4.99 |
Ccdc142 |
coiled-coil domain containing 142 |
2608 |
0.07 |
| chr4_22494478_22494788 | 4.96 |
Gm30731 |
predicted gene, 30731 |
4085 |
0.19 |
| chr10_98399985_98400143 | 4.95 |
Gm8633 |
predicted gene 8633 |
48190 |
0.16 |
| chr6_70986926_70987077 | 4.92 |
Foxi3 |
forkhead box I3 |
30395 |
0.14 |
| chr1_111660206_111660357 | 4.91 |
Gm8173 |
predicted gene 8173 |
147494 |
0.04 |
| chr4_55929179_55929426 | 4.91 |
Gm12519 |
predicted gene 12519 |
64437 |
0.14 |
| chr1_138500251_138500631 | 4.90 |
Gm28501 |
predicted gene 28501 |
15174 |
0.2 |
| chr9_91601860_91602011 | 4.88 |
Gm37987 |
predicted gene, 37987 |
156211 |
0.03 |
| chr4_15438293_15438500 | 4.87 |
Gm11856 |
predicted gene 11856 |
47970 |
0.14 |
| chr2_17703232_17703396 | 4.86 |
Nebl |
nebulette |
27729 |
0.22 |
| chr10_69465967_69466180 | 4.85 |
Gm18636 |
predicted gene, 18636 |
42325 |
0.15 |
| chr4_100596839_100596995 | 4.85 |
Gm12700 |
predicted gene 12700 |
15639 |
0.21 |
| chrX_85199515_85199666 | 4.81 |
Dmd |
dystrophin, muscular dystrophy |
21654 |
0.18 |
| chr8_58372384_58372558 | 4.80 |
Gm45635 |
predicted gene 45635 |
125884 |
0.06 |
| chr1_18191494_18191681 | 4.80 |
Defb44-ps |
defensin beta 44, pseudogene |
31977 |
0.14 |
| chr6_127701185_127701975 | 4.77 |
Gm43634 |
predicted gene 43634 |
57140 |
0.08 |
| chr13_107541201_107541459 | 4.77 |
Gm32004 |
predicted gene, 32004 |
23993 |
0.2 |
| chr12_38304417_38304568 | 4.75 |
Gm18338 |
predicted gene, 18338 |
64738 |
0.14 |
| chr6_77970651_77970830 | 4.74 |
Ctnna2 |
catenin (cadherin associated protein), alpha 2 |
8810 |
0.23 |
| chr14_64585055_64585356 | 4.74 |
Mir124a-1hg |
Mir124-1 host gene (non-protein coding) |
2126 |
0.26 |
| chr7_51339973_51340169 | 4.71 |
Gm45002 |
predicted gene 45002 |
54758 |
0.15 |
| chr10_96397978_96398195 | 4.71 |
Gm20091 |
predicted gene, 20091 |
10952 |
0.2 |
| chr9_56739265_56739423 | 4.71 |
Lingo1 |
leucine rich repeat and Ig domain containing 1 |
29779 |
0.16 |
| chr1_131351418_131351808 | 4.69 |
Srgap2 |
SLIT-ROBO Rho GTPase activating protein 2 |
7066 |
0.14 |
| chr13_36293811_36293981 | 4.69 |
Fars2 |
phenylalanine-tRNA synthetase 2 (mitochondrial) |
33062 |
0.17 |
| chr13_77892438_77892993 | 4.67 |
Pou5f2 |
POU domain class 5, transcription factor 2 |
132187 |
0.05 |
| chr3_37182494_37182883 | 4.66 |
Gm12532 |
predicted gene 12532 |
197 |
0.92 |
| chr12_50084531_50084873 | 4.65 |
Gm40418 |
predicted gene, 40418 |
35607 |
0.24 |
| chrX_93409371_93409737 | 4.64 |
Pola1 |
polymerase (DNA directed), alpha 1 |
81392 |
0.09 |
| chr12_71534462_71534613 | 4.62 |
4930404H11Rik |
RIKEN cDNA 4930404H11 gene |
6070 |
0.25 |
| chr4_96591822_96592018 | 4.58 |
Cyp2j9 |
cytochrome P450, family 2, subfamily j, polypeptide 9 |
342 |
0.9 |
| chr13_83984413_83984945 | 4.57 |
Gm4241 |
predicted gene 4241 |
3312 |
0.25 |
| chr16_41771843_41772245 | 4.56 |
Lsamp |
limbic system-associated membrane protein |
238625 |
0.02 |
| chr19_60015758_60015921 | 4.55 |
Csf1r-ps |
colony stimulating factor 1 receptor (granulocyte), pseudogene |
63593 |
0.1 |
| chr19_18873157_18873473 | 4.54 |
Trpm6 |
transient receptor potential cation channel, subfamily M, member 6 |
32678 |
0.21 |
| chr18_30611667_30612004 | 4.54 |
Gm41780 |
predicted gene, 41780 |
2945 |
0.37 |
| chr8_16965821_16965972 | 4.52 |
3110080E11Rik |
RIKEN cDNA 3110080E11 gene |
49714 |
0.18 |
| chr13_16642636_16642853 | 4.52 |
Gm7537 |
predicted gene 7537 |
3254 |
0.36 |
| chr8_85071597_85072595 | 4.51 |
Dhps |
deoxyhypusine synthase |
205 |
0.79 |
| chr3_154816198_154816562 | 4.51 |
Gm18589 |
predicted gene, 18589 |
23227 |
0.2 |
| chr16_35592451_35593042 | 4.50 |
Gm5963 |
predicted pseudogene 5963 |
19190 |
0.18 |
| chr14_106500453_106500604 | 4.49 |
1700128A07Rik |
RIKEN cDNA 1700128A07 gene |
14008 |
0.2 |
| chr10_9504200_9504351 | 4.49 |
Gm48753 |
predicted gene, 48753 |
9662 |
0.15 |
| chr10_4105634_4106127 | 4.48 |
Gm25515 |
predicted gene, 25515 |
1567 |
0.43 |
| chr10_105639226_105639454 | 4.47 |
Gm15663 |
predicted gene 15663 |
64781 |
0.1 |
| chr1_85716491_85716802 | 4.46 |
Sp100 |
nuclear antigen Sp100 |
13204 |
0.11 |
| chr9_45651665_45651844 | 4.44 |
Gm22069 |
predicted gene, 22069 |
16942 |
0.18 |
| chr1_53018840_53018991 | 4.44 |
1700019D03Rik |
RIKEN cDNA 1700019D03 gene |
1264 |
0.49 |
| chr18_33692045_33692457 | 4.43 |
Epb41l4aos |
erythrocyte membrane protein band 4.1 like 4a, opposite strand |
102641 |
0.06 |
| chr4_79532763_79532914 | 4.42 |
Gm11263 |
predicted gene 11263 |
205130 |
0.03 |
| chr4_47698547_47698776 | 4.42 |
Gm22670 |
predicted gene, 22670 |
222094 |
0.02 |
| chr3_153482133_153482290 | 4.41 |
1700015C17Rik |
RIKEN cDNA 1700015C17 gene |
4001 |
0.22 |
| chr12_90915906_90916594 | 4.41 |
Gm47688 |
predicted gene, 47688 |
22132 |
0.17 |
| chr17_15380265_15380496 | 4.40 |
Dll1 |
delta like canonical Notch ligand 1 |
3508 |
0.19 |
| chr10_27077248_27077399 | 4.40 |
Lama2 |
laminin, alpha 2 |
20678 |
0.24 |
| chr17_61302066_61302300 | 4.40 |
Obox6-ps1 |
oocyte specific homeobox 6, pseudogene 1 |
58390 |
0.15 |
| chr15_74487895_74488073 | 4.40 |
Adgrb1 |
adhesion G protein-coupled receptor B1 |
28211 |
0.16 |
| chr3_5755500_5755721 | 4.38 |
Gm8797 |
predicted pseudogene 8797 |
4804 |
0.31 |
| chr12_52700451_52700656 | 4.38 |
Akap6 |
A kinase (PRKA) anchor protein 6 |
1170 |
0.53 |
| chr2_50902821_50902972 | 4.38 |
Gm13498 |
predicted gene 13498 |
6788 |
0.32 |
| chr5_133983748_133984000 | 4.38 |
Gm2404 |
predicted gene 2404 |
63872 |
0.11 |
| chr10_109758960_109759234 | 4.37 |
Nav3 |
neuron navigator 3 |
5743 |
0.32 |
| chr5_33542626_33542846 | 4.36 |
Fam53a |
family with sequence similarity 53, member A |
86176 |
0.05 |
| chr17_50908265_50908416 | 4.36 |
Gm25177 |
predicted gene, 25177 |
8701 |
0.29 |
| chr13_29273638_29274140 | 4.33 |
Gm11364 |
predicted gene 11364 |
37269 |
0.22 |
| chr9_27346890_27347261 | 4.32 |
Igsf9b |
immunoglobulin superfamily, member 9B |
20135 |
0.17 |
| chr12_15218698_15218871 | 4.31 |
Gm48539 |
predicted gene, 48539 |
82261 |
0.09 |
| chr3_159663339_159663492 | 4.31 |
Rpe65 |
retinal pigment epithelium 65 |
64182 |
0.14 |
| chr12_49484443_49484656 | 4.28 |
1810007C17Rik |
RIKEN cDNA 1810007C17 gene |
3687 |
0.23 |
| chr1_190654477_190654640 | 4.24 |
Gm30932 |
predicted gene, 30932 |
60232 |
0.13 |
| chr14_64595318_64595919 | 4.24 |
Mir3078 |
microRNA 3078 |
4433 |
0.18 |
| chr1_41604872_41605023 | 4.23 |
Gm28634 |
predicted gene 28634 |
75404 |
0.12 |
| chr12_5764890_5765053 | 4.21 |
Gm32442 |
predicted gene, 32442 |
43224 |
0.18 |
| chr10_25199605_25199756 | 4.20 |
Akap7 |
A kinase (PRKA) anchor protein 7 |
478 |
0.83 |
| chr8_112268552_112269162 | 4.20 |
Gm3635 |
predicted gene 3635 |
31891 |
0.23 |
| chr10_13171046_13171455 | 4.18 |
Zc2hc1b |
zinc finger, C2HC-type containing 1B |
6773 |
0.19 |
| chr14_64533985_64534173 | 4.18 |
Gm47202 |
predicted gene, 47202 |
3459 |
0.25 |
| chr9_4794498_4794674 | 4.17 |
Gria4 |
glutamate receptor, ionotropic, AMPA4 (alpha 4) |
933 |
0.73 |
| chr16_77685193_77685467 | 4.17 |
Gm37694 |
predicted gene, 37694 |
53 |
0.96 |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 3.0 | 9.0 | GO:0097118 | neuroligin clustering involved in postsynaptic membrane assembly(GO:0097118) |
| 1.5 | 5.8 | GO:1903818 | positive regulation of delayed rectifier potassium channel activity(GO:1902261) positive regulation of voltage-gated potassium channel activity(GO:1903818) |
| 1.0 | 2.9 | GO:1901843 | positive regulation of high voltage-gated calcium channel activity(GO:1901843) |
| 0.9 | 3.5 | GO:0006598 | polyamine catabolic process(GO:0006598) |
| 0.9 | 3.4 | GO:0071205 | protein localization to juxtaparanode region of axon(GO:0071205) |
| 0.9 | 3.4 | GO:1900147 | Schwann cell migration(GO:0036135) regulation of Schwann cell migration(GO:1900147) |
| 0.8 | 2.5 | GO:0086045 | membrane depolarization during AV node cell action potential(GO:0086045) |
| 0.8 | 3.0 | GO:0006538 | glutamate catabolic process(GO:0006538) |
| 0.7 | 2.0 | GO:1900825 | regulation of membrane depolarization during cardiac muscle cell action potential(GO:1900825) |
| 0.6 | 7.2 | GO:0097120 | receptor localization to synapse(GO:0097120) |
| 0.6 | 5.2 | GO:0045631 | regulation of auditory receptor cell differentiation(GO:0045607) regulation of mechanoreceptor differentiation(GO:0045631) regulation of inner ear receptor cell differentiation(GO:2000980) |
| 0.6 | 7.9 | GO:0007096 | regulation of exit from mitosis(GO:0007096) |
| 0.6 | 1.7 | GO:0090038 | negative regulation of protein kinase C signaling(GO:0090038) |
| 0.5 | 4.4 | GO:0035881 | amacrine cell differentiation(GO:0035881) |
| 0.5 | 2.0 | GO:0061110 | dense core granule biogenesis(GO:0061110) |
| 0.5 | 1.0 | GO:0006808 | regulation of nitrogen utilization(GO:0006808) |
| 0.5 | 2.0 | GO:0002051 | osteoblast fate commitment(GO:0002051) |
| 0.5 | 3.4 | GO:0042118 | endothelial cell activation(GO:0042118) |
| 0.5 | 1.5 | GO:0046167 | glycerol-3-phosphate biosynthetic process(GO:0046167) |
| 0.5 | 2.4 | GO:0051096 | positive regulation of helicase activity(GO:0051096) |
| 0.5 | 2.4 | GO:0032055 | negative regulation of translation in response to stress(GO:0032055) |
| 0.5 | 2.3 | GO:0006348 | chromatin silencing at telomere(GO:0006348) |
| 0.5 | 1.4 | GO:1903690 | negative regulation of wound healing, spreading of epidermal cells(GO:1903690) |
| 0.5 | 1.4 | GO:1901475 | pyruvate transmembrane transport(GO:1901475) |
| 0.5 | 1.4 | GO:0031296 | B cell costimulation(GO:0031296) |
| 0.4 | 1.3 | GO:0046684 | response to pyrethroid(GO:0046684) |
| 0.4 | 3.0 | GO:0007406 | negative regulation of neuroblast proliferation(GO:0007406) |
| 0.4 | 3.0 | GO:0002091 | negative regulation of receptor internalization(GO:0002091) |
| 0.4 | 2.1 | GO:0061002 | negative regulation of dendritic spine morphogenesis(GO:0061002) |
| 0.4 | 1.2 | GO:1903802 | L-glutamate(1-) import into cell(GO:1903802) L-glutamate import into cell(GO:1990123) |
| 0.4 | 1.2 | GO:0042126 | nitrate metabolic process(GO:0042126) |
| 0.4 | 1.2 | GO:0070634 | transepithelial ammonium transport(GO:0070634) |
| 0.4 | 0.4 | GO:0061031 | endodermal digestive tract morphogenesis(GO:0061031) |
| 0.4 | 1.2 | GO:0036092 | phosphatidylinositol-3-phosphate biosynthetic process(GO:0036092) |
| 0.4 | 1.1 | GO:0021553 | olfactory nerve development(GO:0021553) |
| 0.4 | 2.3 | GO:0021869 | forebrain ventricular zone progenitor cell division(GO:0021869) |
| 0.4 | 0.4 | GO:0035905 | ascending aorta development(GO:0035905) ascending aorta morphogenesis(GO:0035910) |
| 0.4 | 6.3 | GO:0050650 | chondroitin sulfate proteoglycan biosynthetic process(GO:0050650) |
| 0.4 | 1.1 | GO:2000211 | regulation of glutamate metabolic process(GO:2000211) |
| 0.4 | 1.1 | GO:0045196 | establishment or maintenance of neuroblast polarity(GO:0045196) establishment of neuroblast polarity(GO:0045200) |
| 0.4 | 2.5 | GO:0002318 | myeloid progenitor cell differentiation(GO:0002318) |
| 0.4 | 2.5 | GO:0021894 | cerebral cortex GABAergic interneuron development(GO:0021894) |
| 0.3 | 3.5 | GO:0051152 | positive regulation of smooth muscle cell differentiation(GO:0051152) |
| 0.3 | 1.4 | GO:0048007 | antigen processing and presentation of lipid antigen via MHC class Ib(GO:0048003) antigen processing and presentation, exogenous lipid antigen via MHC class Ib(GO:0048007) |
| 0.3 | 2.7 | GO:0071257 | cellular response to electrical stimulus(GO:0071257) |
| 0.3 | 5.0 | GO:0050962 | detection of light stimulus involved in visual perception(GO:0050908) detection of light stimulus involved in sensory perception(GO:0050962) |
| 0.3 | 1.0 | GO:0021843 | substrate-independent telencephalic tangential migration(GO:0021826) substrate-independent telencephalic tangential interneuron migration(GO:0021843) |
| 0.3 | 0.3 | GO:0003330 | regulation of extracellular matrix constituent secretion(GO:0003330) positive regulation of extracellular matrix constituent secretion(GO:0003331) |
| 0.3 | 1.9 | GO:0021631 | optic nerve morphogenesis(GO:0021631) |
| 0.3 | 1.3 | GO:0061484 | hematopoietic stem cell homeostasis(GO:0061484) |
| 0.3 | 1.3 | GO:0030091 | protein repair(GO:0030091) |
| 0.3 | 0.9 | GO:0090526 | regulation of gluconeogenesis involved in cellular glucose homeostasis(GO:0090526) |
| 0.3 | 1.5 | GO:0000160 | phosphorelay signal transduction system(GO:0000160) |
| 0.3 | 0.9 | GO:0044805 | lysosomal microautophagy(GO:0016237) piecemeal microautophagy of nucleus(GO:0034727) late nucleophagy(GO:0044805) |
| 0.3 | 1.2 | GO:0007221 | positive regulation of transcription of Notch receptor target(GO:0007221) |
| 0.3 | 0.6 | GO:0003213 | cardiac right atrium morphogenesis(GO:0003213) |
| 0.3 | 0.9 | GO:0006549 | isoleucine metabolic process(GO:0006549) |
| 0.3 | 0.8 | GO:0014834 | skeletal muscle satellite cell maintenance involved in skeletal muscle regeneration(GO:0014834) |
| 0.3 | 1.1 | GO:0006537 | glutamate biosynthetic process(GO:0006537) |
| 0.3 | 0.6 | GO:0003419 | growth plate cartilage chondrocyte proliferation(GO:0003419) |
| 0.3 | 1.4 | GO:0097011 | cellular response to granulocyte macrophage colony-stimulating factor stimulus(GO:0097011) |
| 0.3 | 1.1 | GO:0007258 | JUN phosphorylation(GO:0007258) |
| 0.3 | 3.6 | GO:0006198 | cAMP catabolic process(GO:0006198) |
| 0.3 | 0.8 | GO:0048239 | negative regulation of DNA recombination at telomere(GO:0048239) regulation of DNA recombination at telomere(GO:0072695) |
| 0.2 | 0.7 | GO:0097155 | fasciculation of sensory neuron axon(GO:0097155) |
| 0.2 | 3.2 | GO:0010614 | negative regulation of cardiac muscle hypertrophy(GO:0010614) |
| 0.2 | 1.5 | GO:0051694 | pointed-end actin filament capping(GO:0051694) |
| 0.2 | 2.4 | GO:0045838 | positive regulation of membrane potential(GO:0045838) |
| 0.2 | 0.7 | GO:0035984 | response to trichostatin A(GO:0035983) cellular response to trichostatin A(GO:0035984) |
| 0.2 | 0.7 | GO:0097029 | mature conventional dendritic cell differentiation(GO:0097029) |
| 0.2 | 1.9 | GO:0060923 | cardiac muscle cell fate commitment(GO:0060923) |
| 0.2 | 0.5 | GO:0032696 | negative regulation of interleukin-13 production(GO:0032696) |
| 0.2 | 1.1 | GO:0060666 | dichotomous subdivision of terminal units involved in salivary gland branching(GO:0060666) |
| 0.2 | 0.7 | GO:0061010 | gall bladder development(GO:0061010) |
| 0.2 | 0.7 | GO:0010046 | response to mycotoxin(GO:0010046) |
| 0.2 | 0.4 | GO:0043490 | malate-aspartate shuttle(GO:0043490) |
| 0.2 | 1.1 | GO:0048069 | eye pigmentation(GO:0048069) |
| 0.2 | 0.6 | GO:0032289 | central nervous system myelin formation(GO:0032289) |
| 0.2 | 1.7 | GO:2000480 | negative regulation of cAMP-dependent protein kinase activity(GO:2000480) |
| 0.2 | 4.4 | GO:0007214 | gamma-aminobutyric acid signaling pathway(GO:0007214) |
| 0.2 | 0.6 | GO:1903546 | protein localization to photoreceptor outer segment(GO:1903546) |
| 0.2 | 1.7 | GO:0032224 | positive regulation of synaptic transmission, cholinergic(GO:0032224) |
| 0.2 | 0.4 | GO:1902866 | regulation of retina development in camera-type eye(GO:1902866) |
| 0.2 | 2.3 | GO:0021542 | dentate gyrus development(GO:0021542) |
| 0.2 | 0.8 | GO:0035247 | peptidyl-arginine omega-N-methylation(GO:0035247) |
| 0.2 | 1.4 | GO:0048702 | embryonic neurocranium morphogenesis(GO:0048702) |
| 0.2 | 0.6 | GO:0090292 | nuclear matrix organization(GO:0043578) nuclear matrix anchoring at nuclear membrane(GO:0090292) |
| 0.2 | 1.2 | GO:1901621 | negative regulation of smoothened signaling pathway involved in dorsal/ventral neural tube patterning(GO:1901621) |
| 0.2 | 0.8 | GO:0001994 | norepinephrine-epinephrine vasoconstriction involved in regulation of systemic arterial blood pressure(GO:0001994) |
| 0.2 | 0.4 | GO:1902630 | regulation of membrane hyperpolarization(GO:1902630) |
| 0.2 | 0.2 | GO:0009449 | gamma-aminobutyric acid biosynthetic process(GO:0009449) |
| 0.2 | 1.1 | GO:0045650 | negative regulation of macrophage differentiation(GO:0045650) |
| 0.2 | 0.8 | GO:0060244 | negative regulation of cell proliferation involved in contact inhibition(GO:0060244) |
| 0.2 | 0.4 | GO:0021564 | vagus nerve development(GO:0021564) |
| 0.2 | 0.7 | GO:0044341 | sodium-dependent phosphate transport(GO:0044341) |
| 0.2 | 1.5 | GO:0070131 | positive regulation of mitochondrial translation(GO:0070131) |
| 0.2 | 2.2 | GO:0003356 | regulation of cilium beat frequency(GO:0003356) |
| 0.2 | 3.3 | GO:0051968 | positive regulation of synaptic transmission, glutamatergic(GO:0051968) |
| 0.2 | 1.0 | GO:0060872 | semicircular canal development(GO:0060872) |
| 0.2 | 0.9 | GO:0097151 | positive regulation of inhibitory postsynaptic potential(GO:0097151) |
| 0.2 | 1.6 | GO:0016338 | calcium-independent cell-cell adhesion via plasma membrane cell-adhesion molecules(GO:0016338) |
| 0.2 | 0.3 | GO:1902837 | amino acid import into cell(GO:1902837) |
| 0.2 | 0.3 | GO:0014741 | negative regulation of muscle hypertrophy(GO:0014741) |
| 0.2 | 0.5 | GO:0021902 | commitment of neuronal cell to specific neuron type in forebrain(GO:0021902) |
| 0.2 | 1.0 | GO:0048664 | neuron fate determination(GO:0048664) |
| 0.2 | 2.0 | GO:0035235 | ionotropic glutamate receptor signaling pathway(GO:0035235) |
| 0.2 | 0.8 | GO:0019532 | oxalate transport(GO:0019532) |
| 0.2 | 0.5 | GO:0001661 | conditioned taste aversion(GO:0001661) |
| 0.2 | 0.7 | GO:0001927 | exocyst assembly(GO:0001927) |
| 0.2 | 0.8 | GO:0010825 | positive regulation of centrosome duplication(GO:0010825) |
| 0.2 | 0.5 | GO:1900095 | regulation of dosage compensation by inactivation of X chromosome(GO:1900095) |
| 0.2 | 1.1 | GO:0051823 | regulation of synapse structural plasticity(GO:0051823) |
| 0.2 | 0.5 | GO:0003358 | noradrenergic neuron development(GO:0003358) |
| 0.2 | 0.5 | GO:0042723 | thiamine metabolic process(GO:0006772) thiamine-containing compound metabolic process(GO:0042723) |
| 0.2 | 0.5 | GO:0044339 | canonical Wnt signaling pathway involved in osteoblast differentiation(GO:0044339) |
| 0.2 | 0.6 | GO:0014724 | regulation of twitch skeletal muscle contraction(GO:0014724) |
| 0.2 | 0.6 | GO:0071847 | TNFSF11-mediated signaling pathway(GO:0071847) |
| 0.2 | 1.2 | GO:0090129 | positive regulation of synapse maturation(GO:0090129) |
| 0.2 | 0.5 | GO:0019747 | regulation of isoprenoid metabolic process(GO:0019747) |
| 0.2 | 0.5 | GO:0044860 | protein localization to plasma membrane raft(GO:0044860) |
| 0.2 | 0.6 | GO:0017182 | peptidyl-diphthamide metabolic process(GO:0017182) peptidyl-diphthamide biosynthetic process from peptidyl-histidine(GO:0017183) |
| 0.1 | 0.6 | GO:0003344 | pericardium morphogenesis(GO:0003344) |
| 0.1 | 0.4 | GO:0032474 | otolith morphogenesis(GO:0032474) |
| 0.1 | 0.3 | GO:0010751 | negative regulation of nitric oxide mediated signal transduction(GO:0010751) |
| 0.1 | 0.6 | GO:0021798 | forebrain dorsal/ventral pattern formation(GO:0021798) |
| 0.1 | 0.4 | GO:0006046 | N-acetylglucosamine catabolic process(GO:0006046) |
| 0.1 | 0.8 | GO:0090244 | Wnt signaling pathway involved in somitogenesis(GO:0090244) |
| 0.1 | 0.4 | GO:0033563 | dorsal/ventral axon guidance(GO:0033563) |
| 0.1 | 0.1 | GO:1902514 | regulation of calcium ion transmembrane transport via high voltage-gated calcium channel(GO:1902514) |
| 0.1 | 0.8 | GO:0060907 | positive regulation of macrophage cytokine production(GO:0060907) |
| 0.1 | 0.4 | GO:0006663 | platelet activating factor biosynthetic process(GO:0006663) platelet activating factor metabolic process(GO:0046469) |
| 0.1 | 1.8 | GO:0016082 | synaptic vesicle priming(GO:0016082) |
| 0.1 | 0.7 | GO:0097070 | ductus arteriosus closure(GO:0097070) |
| 0.1 | 2.6 | GO:0032515 | negative regulation of phosphoprotein phosphatase activity(GO:0032515) |
| 0.1 | 0.1 | GO:0060061 | Spemann organizer formation(GO:0060061) |
| 0.1 | 0.6 | GO:1902373 | negative regulation of mRNA catabolic process(GO:1902373) |
| 0.1 | 1.0 | GO:0045217 | cell-cell junction maintenance(GO:0045217) |
| 0.1 | 2.5 | GO:0051491 | positive regulation of filopodium assembly(GO:0051491) |
| 0.1 | 0.7 | GO:0060294 | cilium movement involved in cell motility(GO:0060294) |
| 0.1 | 0.2 | GO:0035262 | gonad morphogenesis(GO:0035262) |
| 0.1 | 0.4 | GO:0010579 | regulation of adenylate cyclase activity involved in G-protein coupled receptor signaling pathway(GO:0010578) positive regulation of adenylate cyclase activity involved in G-protein coupled receptor signaling pathway(GO:0010579) |
| 0.1 | 0.5 | GO:0060285 | cilium or flagellum-dependent cell motility(GO:0001539) cilium-dependent cell motility(GO:0060285) |
| 0.1 | 1.2 | GO:0032926 | negative regulation of activin receptor signaling pathway(GO:0032926) |
| 0.1 | 1.1 | GO:0048715 | negative regulation of oligodendrocyte differentiation(GO:0048715) |
| 0.1 | 0.1 | GO:0046865 | retinol transport(GO:0034633) isoprenoid transport(GO:0046864) terpenoid transport(GO:0046865) |
| 0.1 | 0.3 | GO:0035609 | C-terminal protein deglutamylation(GO:0035609) |
| 0.1 | 0.7 | GO:0021860 | pyramidal neuron development(GO:0021860) |
| 0.1 | 1.3 | GO:0006744 | ubiquinone biosynthetic process(GO:0006744) |
| 0.1 | 0.9 | GO:0060074 | synapse maturation(GO:0060074) |
| 0.1 | 0.3 | GO:0006553 | lysine metabolic process(GO:0006553) |
| 0.1 | 0.5 | GO:0060501 | positive regulation of epithelial cell proliferation involved in lung morphogenesis(GO:0060501) |
| 0.1 | 0.4 | GO:0021785 | branchiomotor neuron axon guidance(GO:0021785) |
| 0.1 | 0.3 | GO:0032596 | protein transport into membrane raft(GO:0032596) |
| 0.1 | 0.3 | GO:0034093 | positive regulation of maintenance of sister chromatid cohesion(GO:0034093) positive regulation of maintenance of mitotic sister chromatid cohesion(GO:0034184) |
| 0.1 | 0.3 | GO:1903261 | regulation of serine phosphorylation of STAT3 protein(GO:1903261) |
| 0.1 | 1.0 | GO:0042074 | cell migration involved in gastrulation(GO:0042074) |
| 0.1 | 0.3 | GO:1902564 | negative regulation of neutrophil activation(GO:1902564) |
| 0.1 | 0.3 | GO:0060282 | positive regulation of oocyte development(GO:0060282) |
| 0.1 | 0.4 | GO:0000711 | meiotic DNA repair synthesis(GO:0000711) |
| 0.1 | 0.4 | GO:0006432 | phenylalanyl-tRNA aminoacylation(GO:0006432) |
| 0.1 | 0.3 | GO:0030421 | defecation(GO:0030421) |
| 0.1 | 0.4 | GO:0018343 | protein farnesylation(GO:0018343) |
| 0.1 | 0.3 | GO:0072697 | protein localization to cell cortex(GO:0072697) |
| 0.1 | 0.2 | GO:0038161 | prolactin signaling pathway(GO:0038161) |
| 0.1 | 0.7 | GO:0042904 | 9-cis-retinoic acid biosynthetic process(GO:0042904) 9-cis-retinoic acid metabolic process(GO:0042905) |
| 0.1 | 0.4 | GO:0051581 | negative regulation of neurotransmitter uptake(GO:0051581) regulation of serotonin uptake(GO:0051611) negative regulation of serotonin uptake(GO:0051612) |
| 0.1 | 2.1 | GO:0006376 | mRNA splice site selection(GO:0006376) |
| 0.1 | 0.3 | GO:0030050 | vesicle transport along actin filament(GO:0030050) |
| 0.1 | 0.4 | GO:0014054 | positive regulation of gamma-aminobutyric acid secretion(GO:0014054) |
| 0.1 | 0.2 | GO:0060060 | post-embryonic retina morphogenesis in camera-type eye(GO:0060060) |
| 0.1 | 1.5 | GO:0035855 | megakaryocyte development(GO:0035855) |
| 0.1 | 0.8 | GO:0007216 | G-protein coupled glutamate receptor signaling pathway(GO:0007216) |
| 0.1 | 0.3 | GO:0072385 | minus-end-directed organelle transport along microtubule(GO:0072385) |
| 0.1 | 0.3 | GO:0002930 | trabecular meshwork development(GO:0002930) |
| 0.1 | 1.2 | GO:0030497 | fatty acid elongation(GO:0030497) |
| 0.1 | 1.6 | GO:0071475 | cellular hyperosmotic salinity response(GO:0071475) |
| 0.1 | 0.1 | GO:1902988 | neurofibrillary tangle assembly(GO:1902988) regulation of neurofibrillary tangle assembly(GO:1902996) |
| 0.1 | 0.7 | GO:0000459 | exonucleolytic trimming involved in rRNA processing(GO:0000459) exonucleolytic trimming to generate mature 3'-end of 5.8S rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000467) |
| 0.1 | 0.1 | GO:0014717 | regulation of satellite cell activation involved in skeletal muscle regeneration(GO:0014717) satellite cell activation involved in skeletal muscle regeneration(GO:0014901) |
| 0.1 | 0.2 | GO:0060005 | vestibular reflex(GO:0060005) |
| 0.1 | 0.3 | GO:0060159 | regulation of dopamine receptor signaling pathway(GO:0060159) |
| 0.1 | 0.2 | GO:0097154 | GABAergic neuron differentiation(GO:0097154) |
| 0.1 | 0.2 | GO:0097680 | double-strand break repair via classical nonhomologous end joining(GO:0097680) |
| 0.1 | 0.1 | GO:1901187 | regulation of ephrin receptor signaling pathway(GO:1901187) |
| 0.1 | 0.3 | GO:0021960 | anterior commissure morphogenesis(GO:0021960) |
| 0.1 | 0.1 | GO:0086064 | cell communication by electrical coupling involved in cardiac conduction(GO:0086064) |
| 0.1 | 0.3 | GO:0015820 | branched-chain amino acid transport(GO:0015803) leucine transport(GO:0015820) |
| 0.1 | 0.5 | GO:0034551 | respiratory chain complex III assembly(GO:0017062) mitochondrial respiratory chain complex III assembly(GO:0034551) mitochondrial respiratory chain complex III biogenesis(GO:0097033) |
| 0.1 | 1.2 | GO:0016486 | peptide hormone processing(GO:0016486) |
| 0.1 | 0.1 | GO:0010248 | establishment or maintenance of transmembrane electrochemical gradient(GO:0010248) |
| 0.1 | 0.2 | GO:0001560 | regulation of cell growth by extracellular stimulus(GO:0001560) |
| 0.1 | 0.8 | GO:0006273 | lagging strand elongation(GO:0006273) |
| 0.1 | 0.3 | GO:1903215 | negative regulation of protein targeting to mitochondrion(GO:1903215) |
| 0.1 | 0.3 | GO:1901026 | ripoptosome assembly(GO:0097343) ripoptosome assembly involved in necroptotic process(GO:1901026) |
| 0.1 | 0.8 | GO:0016926 | protein desumoylation(GO:0016926) |
| 0.1 | 0.2 | GO:0008228 | opsonization(GO:0008228) |
| 0.1 | 0.7 | GO:0018026 | peptidyl-lysine monomethylation(GO:0018026) |
| 0.1 | 2.3 | GO:0071526 | semaphorin-plexin signaling pathway(GO:0071526) |
| 0.1 | 0.5 | GO:0034141 | positive regulation of toll-like receptor 3 signaling pathway(GO:0034141) |
| 0.1 | 0.6 | GO:0002035 | brain renin-angiotensin system(GO:0002035) |
| 0.1 | 0.2 | GO:0050427 | 3'-phosphoadenosine 5'-phosphosulfate metabolic process(GO:0050427) |
| 0.1 | 0.6 | GO:0035562 | negative regulation of chromatin binding(GO:0035562) |
| 0.1 | 0.9 | GO:0006857 | oligopeptide transport(GO:0006857) |
| 0.1 | 0.2 | GO:0033602 | negative regulation of dopamine secretion(GO:0033602) |
| 0.1 | 0.2 | GO:0051902 | negative regulation of mitochondrial depolarization(GO:0051902) |
| 0.1 | 0.2 | GO:1903286 | regulation of potassium ion import(GO:1903286) positive regulation of potassium ion import(GO:1903288) |
| 0.1 | 0.3 | GO:0009068 | aspartate family amino acid catabolic process(GO:0009068) |
| 0.1 | 0.5 | GO:1900016 | negative regulation of cytokine production involved in inflammatory response(GO:1900016) |
| 0.1 | 0.5 | GO:0070365 | hepatocyte differentiation(GO:0070365) |
| 0.1 | 0.2 | GO:0060166 | olfactory pit development(GO:0060166) |
| 0.1 | 0.3 | GO:0010510 | regulation of acetyl-CoA biosynthetic process from pyruvate(GO:0010510) regulation of acyl-CoA biosynthetic process(GO:0050812) |
| 0.1 | 0.1 | GO:0071895 | odontoblast differentiation(GO:0071895) |
| 0.1 | 0.1 | GO:0002036 | regulation of L-glutamate transport(GO:0002036) |
| 0.1 | 3.6 | GO:0051965 | positive regulation of synapse assembly(GO:0051965) |
| 0.1 | 1.7 | GO:0003254 | regulation of membrane depolarization(GO:0003254) |
| 0.1 | 0.1 | GO:0006743 | ubiquinone metabolic process(GO:0006743) |
| 0.1 | 0.3 | GO:0072201 | negative regulation of mesenchymal cell proliferation(GO:0072201) |
| 0.1 | 1.7 | GO:0035088 | establishment or maintenance of apical/basal cell polarity(GO:0035088) establishment or maintenance of bipolar cell polarity(GO:0061245) |
| 0.1 | 0.1 | GO:2000111 | positive regulation of macrophage apoptotic process(GO:2000111) |
| 0.1 | 0.1 | GO:1903525 | regulation of membrane tubulation(GO:1903525) |
| 0.1 | 0.1 | GO:0060686 | negative regulation of prostatic bud formation(GO:0060686) |
| 0.1 | 0.1 | GO:0001998 | angiotensin mediated vasoconstriction involved in regulation of systemic arterial blood pressure(GO:0001998) |
| 0.1 | 0.3 | GO:0070125 | mitochondrial translational elongation(GO:0070125) |
| 0.1 | 0.9 | GO:0010842 | retina layer formation(GO:0010842) |
| 0.1 | 0.8 | GO:0003334 | keratinocyte development(GO:0003334) |
| 0.1 | 0.3 | GO:0045653 | negative regulation of megakaryocyte differentiation(GO:0045653) |
| 0.1 | 0.2 | GO:0045054 | constitutive secretory pathway(GO:0045054) |
| 0.1 | 0.3 | GO:0051725 | protein de-ADP-ribosylation(GO:0051725) |
| 0.1 | 0.2 | GO:0070459 | prolactin secretion(GO:0070459) |
| 0.1 | 0.3 | GO:0006627 | protein processing involved in protein targeting to mitochondrion(GO:0006627) |
| 0.1 | 0.2 | GO:0040009 | regulation of growth rate(GO:0040009) |
| 0.1 | 0.1 | GO:1901420 | negative regulation of response to alcohol(GO:1901420) |
| 0.1 | 0.1 | GO:0060174 | limb bud formation(GO:0060174) |
| 0.1 | 0.6 | GO:0071435 | potassium ion export(GO:0071435) |
| 0.1 | 0.1 | GO:1900451 | positive regulation of glutamate receptor signaling pathway(GO:1900451) positive regulation of alpha-amino-3-hydroxy-5-methyl-4-isoxazole propionate selective glutamate receptor activity(GO:2000969) |
| 0.1 | 1.2 | GO:0046847 | filopodium assembly(GO:0046847) |
| 0.1 | 0.2 | GO:2000301 | negative regulation of synaptic vesicle exocytosis(GO:2000301) |
| 0.1 | 1.0 | GO:0008045 | motor neuron axon guidance(GO:0008045) |
| 0.1 | 0.1 | GO:0014029 | neural crest formation(GO:0014029) |
| 0.1 | 0.1 | GO:2000346 | negative regulation of hepatocyte proliferation(GO:2000346) |
| 0.1 | 0.1 | GO:0072053 | renal inner medulla development(GO:0072053) |
| 0.1 | 0.2 | GO:0046098 | guanine metabolic process(GO:0046098) |
| 0.1 | 0.3 | GO:0021999 | neural plate anterior/posterior regionalization(GO:0021999) |
| 0.1 | 0.4 | GO:0033314 | mitotic DNA replication checkpoint(GO:0033314) |
| 0.1 | 0.2 | GO:0006269 | DNA replication, synthesis of RNA primer(GO:0006269) |
| 0.1 | 0.2 | GO:0035865 | response to potassium ion(GO:0035864) cellular response to potassium ion(GO:0035865) |
| 0.1 | 0.3 | GO:0060124 | positive regulation of growth hormone secretion(GO:0060124) |
| 0.1 | 0.2 | GO:0042045 | epithelial fluid transport(GO:0042045) |
| 0.1 | 0.2 | GO:0048294 | negative regulation of isotype switching to IgE isotypes(GO:0048294) |
| 0.1 | 0.2 | GO:0090158 | endoplasmic reticulum membrane organization(GO:0090158) |
| 0.1 | 0.2 | GO:0007413 | axonal fasciculation(GO:0007413) |
| 0.1 | 0.1 | GO:0051660 | establishment of centrosome localization(GO:0051660) |
| 0.1 | 0.1 | GO:0060631 | regulation of meiosis I(GO:0060631) |
| 0.1 | 1.8 | GO:0006958 | complement activation, classical pathway(GO:0006958) |
| 0.1 | 0.1 | GO:0034047 | regulation of protein phosphatase type 2A activity(GO:0034047) |
| 0.1 | 0.1 | GO:0071787 | endoplasmic reticulum tubular network assembly(GO:0071787) |
| 0.1 | 0.4 | GO:1903779 | regulation of cardiac conduction(GO:1903779) |
| 0.1 | 0.2 | GO:0048852 | diencephalon morphogenesis(GO:0048852) |
| 0.1 | 0.9 | GO:0010758 | regulation of macrophage chemotaxis(GO:0010758) |
| 0.1 | 0.1 | GO:0010936 | negative regulation of macrophage cytokine production(GO:0010936) |
| 0.1 | 0.2 | GO:0006210 | pyrimidine nucleobase catabolic process(GO:0006208) thymine catabolic process(GO:0006210) thymine metabolic process(GO:0019859) |
| 0.1 | 0.2 | GO:0090403 | oxidative stress-induced premature senescence(GO:0090403) |
| 0.1 | 0.1 | GO:0060112 | generation of ovulation cycle rhythm(GO:0060112) |
| 0.1 | 0.1 | GO:0070460 | thyroid-stimulating hormone secretion(GO:0070460) |
| 0.1 | 0.3 | GO:1902004 | positive regulation of beta-amyloid formation(GO:1902004) positive regulation of amyloid precursor protein catabolic process(GO:1902993) |
| 0.1 | 0.2 | GO:0050904 | diapedesis(GO:0050904) |
| 0.1 | 0.2 | GO:0021707 | cerebellar granular layer formation(GO:0021684) cerebellar granule cell differentiation(GO:0021707) |
| 0.1 | 0.1 | GO:1901069 | guanosine-containing compound catabolic process(GO:1901069) |
| 0.1 | 0.2 | GO:0018002 | N-terminal peptidyl-serine acetylation(GO:0017198) N-terminal peptidyl-glutamic acid acetylation(GO:0018002) peptidyl-serine acetylation(GO:0030920) |
| 0.1 | 0.1 | GO:0090503 | RNA phosphodiester bond hydrolysis, exonucleolytic(GO:0090503) |
| 0.1 | 0.4 | GO:0070269 | pyroptosis(GO:0070269) |
| 0.1 | 0.1 | GO:0060839 | endothelial cell fate commitment(GO:0060839) |
| 0.1 | 0.3 | GO:1904262 | negative regulation of TORC1 signaling(GO:1904262) |
| 0.1 | 0.2 | GO:0010940 | positive regulation of necrotic cell death(GO:0010940) |
| 0.1 | 0.2 | GO:0061641 | CENP-A containing nucleosome assembly(GO:0034080) CENP-A containing chromatin organization(GO:0061641) |
| 0.1 | 0.5 | GO:0060081 | membrane hyperpolarization(GO:0060081) |
| 0.1 | 0.1 | GO:0019230 | proprioception(GO:0019230) |
| 0.1 | 0.2 | GO:0071803 | positive regulation of podosome assembly(GO:0071803) |
| 0.1 | 0.1 | GO:0009826 | unidimensional cell growth(GO:0009826) |
| 0.1 | 0.2 | GO:1900045 | negative regulation of protein K63-linked ubiquitination(GO:1900045) negative regulation of protein polyubiquitination(GO:1902915) |
| 0.0 | 0.1 | GO:2000172 | regulation of branching morphogenesis of a nerve(GO:2000172) |
| 0.0 | 0.2 | GO:0042997 | negative regulation of Golgi to plasma membrane protein transport(GO:0042997) |
| 0.0 | 0.2 | GO:0031133 | regulation of axon diameter(GO:0031133) |
| 0.0 | 0.3 | GO:0008616 | queuosine biosynthetic process(GO:0008616) queuosine metabolic process(GO:0046116) |
| 0.0 | 0.2 | GO:0098908 | regulation of neuronal action potential(GO:0098908) |
| 0.0 | 0.2 | GO:0060363 | cranial suture morphogenesis(GO:0060363) |
| 0.0 | 0.1 | GO:0006624 | vacuolar protein processing(GO:0006624) |
| 0.0 | 0.4 | GO:1901072 | glucosamine-containing compound catabolic process(GO:1901072) |
| 0.0 | 0.1 | GO:0071372 | cellular response to follicle-stimulating hormone stimulus(GO:0071372) |
| 0.0 | 0.2 | GO:0000301 | retrograde transport, vesicle recycling within Golgi(GO:0000301) |
| 0.0 | 0.3 | GO:0006620 | posttranslational protein targeting to membrane(GO:0006620) |
| 0.0 | 0.1 | GO:0035995 | detection of muscle stretch(GO:0035995) |
| 0.0 | 0.1 | GO:0097112 | gamma-aminobutyric acid receptor clustering(GO:0097112) |
| 0.0 | 0.2 | GO:0032308 | positive regulation of prostaglandin secretion(GO:0032308) |
| 0.0 | 0.2 | GO:0015691 | cadmium ion transport(GO:0015691) cadmium ion transmembrane transport(GO:0070574) |
| 0.0 | 0.4 | GO:0016322 | neuron remodeling(GO:0016322) |
| 0.0 | 0.0 | GO:0030222 | eosinophil differentiation(GO:0030222) |
| 0.0 | 0.1 | GO:0010520 | regulation of reciprocal meiotic recombination(GO:0010520) |
| 0.0 | 0.2 | GO:0060605 | tube lumen cavitation(GO:0060605) salivary gland cavitation(GO:0060662) |
| 0.0 | 0.4 | GO:0006283 | transcription-coupled nucleotide-excision repair(GO:0006283) |
| 0.0 | 0.3 | GO:0006020 | inositol metabolic process(GO:0006020) |
| 0.0 | 0.1 | GO:0048478 | replication fork protection(GO:0048478) |
| 0.0 | 0.5 | GO:0003298 | physiological muscle hypertrophy(GO:0003298) physiological cardiac muscle hypertrophy(GO:0003301) cell growth involved in cardiac muscle cell development(GO:0061049) |
| 0.0 | 0.3 | GO:0021527 | spinal cord association neuron differentiation(GO:0021527) |
| 0.0 | 0.3 | GO:0045793 | positive regulation of cell size(GO:0045793) |
| 0.0 | 0.2 | GO:0001920 | negative regulation of receptor recycling(GO:0001920) |
| 0.0 | 0.1 | GO:2000275 | regulation of oxidative phosphorylation uncoupler activity(GO:2000275) |
| 0.0 | 0.3 | GO:1904754 | positive regulation of vascular associated smooth muscle cell migration(GO:1904754) |
| 0.0 | 0.2 | GO:0010032 | meiotic chromosome condensation(GO:0010032) |
| 0.0 | 0.0 | GO:0086013 | membrane repolarization during cardiac muscle cell action potential(GO:0086013) |
| 0.0 | 0.2 | GO:0006048 | UDP-N-acetylglucosamine biosynthetic process(GO:0006048) |
| 0.0 | 0.1 | GO:0060468 | prevention of polyspermy(GO:0060468) |
| 0.0 | 0.2 | GO:0006686 | sphingomyelin biosynthetic process(GO:0006686) |
| 0.0 | 0.1 | GO:0046952 | ketone body catabolic process(GO:0046952) |
| 0.0 | 0.1 | GO:0071896 | protein localization to adherens junction(GO:0071896) |
| 0.0 | 0.1 | GO:0002282 | microglial cell activation involved in immune response(GO:0002282) |
| 0.0 | 0.2 | GO:0055022 | negative regulation of cardiac muscle tissue growth(GO:0055022) negative regulation of heart growth(GO:0061117) |
| 0.0 | 1.8 | GO:0006400 | tRNA modification(GO:0006400) |
| 0.0 | 0.0 | GO:1902534 | single-organism membrane invagination(GO:1902534) |
| 0.0 | 0.1 | GO:1902570 | protein localization to nucleolus(GO:1902570) |
| 0.0 | 1.0 | GO:0051496 | positive regulation of stress fiber assembly(GO:0051496) |
| 0.0 | 0.2 | GO:0051697 | protein delipidation(GO:0051697) |
| 0.0 | 0.1 | GO:0035887 | aortic smooth muscle cell differentiation(GO:0035887) |
| 0.0 | 0.0 | GO:0050882 | voluntary musculoskeletal movement(GO:0050882) |
| 0.0 | 0.2 | GO:0098789 | pre-mRNA cleavage required for polyadenylation(GO:0098789) |
| 0.0 | 0.2 | GO:0010499 | proteasomal ubiquitin-independent protein catabolic process(GO:0010499) |
| 0.0 | 0.0 | GO:0021764 | amygdala development(GO:0021764) |
| 0.0 | 0.1 | GO:0021524 | visceral motor neuron differentiation(GO:0021524) |
| 0.0 | 0.1 | GO:0045836 | positive regulation of meiotic nuclear division(GO:0045836) |
| 0.0 | 0.5 | GO:0045475 | locomotor rhythm(GO:0045475) |
| 0.0 | 0.2 | GO:0021694 | cerebellar Purkinje cell layer formation(GO:0021694) cerebellar Purkinje cell differentiation(GO:0021702) |
| 0.0 | 0.1 | GO:1901509 | regulation of endothelial tube morphogenesis(GO:1901509) |
| 0.0 | 0.5 | GO:1902043 | positive regulation of extrinsic apoptotic signaling pathway via death domain receptors(GO:1902043) |
| 0.0 | 0.1 | GO:0042276 | error-prone translesion synthesis(GO:0042276) |
| 0.0 | 0.1 | GO:0070525 | tRNA threonylcarbamoyladenosine metabolic process(GO:0070525) |
| 0.0 | 0.1 | GO:2000074 | regulation of type B pancreatic cell development(GO:2000074) |
| 0.0 | 0.1 | GO:0071476 | cellular hypotonic response(GO:0071476) |
| 0.0 | 0.0 | GO:0060454 | positive regulation of gastric acid secretion(GO:0060454) |
| 0.0 | 0.2 | GO:0060770 | regulation of epithelial cell proliferation involved in prostate gland development(GO:0060768) negative regulation of epithelial cell proliferation involved in prostate gland development(GO:0060770) |
| 0.0 | 0.1 | GO:0048014 | Tie signaling pathway(GO:0048014) |
| 0.0 | 0.2 | GO:0046037 | GMP metabolic process(GO:0046037) |
| 0.0 | 0.4 | GO:0046174 | polyol catabolic process(GO:0046174) |
| 0.0 | 0.2 | GO:0017196 | N-terminal peptidyl-methionine acetylation(GO:0017196) |
| 0.0 | 0.3 | GO:0001964 | startle response(GO:0001964) |
| 0.0 | 0.1 | GO:0001915 | negative regulation of T cell mediated cytotoxicity(GO:0001915) |
| 0.0 | 0.0 | GO:0048320 | axial mesoderm formation(GO:0048320) |
| 0.0 | 0.1 | GO:0097283 | keratinocyte apoptotic process(GO:0097283) regulation of keratinocyte apoptotic process(GO:1902172) |
| 0.0 | 0.0 | GO:0032306 | regulation of prostaglandin secretion(GO:0032306) |
| 0.0 | 0.1 | GO:0050955 | thermoception(GO:0050955) |
| 0.0 | 0.0 | GO:0046544 | development of secondary male sexual characteristics(GO:0046544) |
| 0.0 | 0.2 | GO:0032790 | ribosome disassembly(GO:0032790) |
| 0.0 | 0.0 | GO:1902965 | regulation of protein localization to early endosome(GO:1902965) positive regulation of protein localization to early endosome(GO:1902966) |
| 0.0 | 0.1 | GO:0032264 | IMP salvage(GO:0032264) |
| 0.0 | 0.1 | GO:0016557 | peroxisome membrane biogenesis(GO:0016557) |
| 0.0 | 0.1 | GO:0045415 | negative regulation of interleukin-8 biosynthetic process(GO:0045415) |
| 0.0 | 0.1 | GO:0031033 | myosin filament organization(GO:0031033) |
| 0.0 | 0.3 | GO:2000811 | negative regulation of anoikis(GO:2000811) |
| 0.0 | 0.2 | GO:0046541 | saliva secretion(GO:0046541) |
| 0.0 | 1.7 | GO:0060395 | SMAD protein signal transduction(GO:0060395) |
| 0.0 | 0.3 | GO:1901407 | regulation of phosphorylation of RNA polymerase II C-terminal domain(GO:1901407) positive regulation of phosphorylation of RNA polymerase II C-terminal domain(GO:1901409) |
| 0.0 | 0.0 | GO:0021533 | cell differentiation in hindbrain(GO:0021533) |
| 0.0 | 0.0 | GO:1902263 | apoptotic process involved in embryonic digit morphogenesis(GO:1902263) |
| 0.0 | 0.1 | GO:0045423 | granulocyte macrophage colony-stimulating factor biosynthetic process(GO:0042253) regulation of granulocyte macrophage colony-stimulating factor biosynthetic process(GO:0045423) |
| 0.0 | 0.1 | GO:0071694 | protein localization to extracellular region(GO:0071692) maintenance of protein location in extracellular region(GO:0071694) |
| 0.0 | 1.2 | GO:0050885 | neuromuscular process controlling balance(GO:0050885) |
| 0.0 | 0.1 | GO:1902036 | regulation of hematopoietic stem cell differentiation(GO:1902036) |
| 0.0 | 0.1 | GO:0030205 | dermatan sulfate metabolic process(GO:0030205) dermatan sulfate proteoglycan metabolic process(GO:0050655) |
| 0.0 | 0.1 | GO:2000520 | regulation of immunological synapse formation(GO:2000520) |
| 0.0 | 0.7 | GO:0035249 | synaptic transmission, glutamatergic(GO:0035249) |
| 0.0 | 0.1 | GO:1902308 | regulation of peptidyl-serine dephosphorylation(GO:1902308) |
| 0.0 | 0.2 | GO:0070933 | histone H4 deacetylation(GO:0070933) |
| 0.0 | 0.1 | GO:1903416 | response to glycoside(GO:1903416) |
| 0.0 | 0.1 | GO:0097210 | response to gonadotropin-releasing hormone(GO:0097210) cellular response to gonadotropin-releasing hormone(GO:0097211) |
| 0.0 | 0.0 | GO:0008078 | mesodermal cell migration(GO:0008078) |
| 0.0 | 0.1 | GO:0097503 | sialylation(GO:0097503) |
| 0.0 | 0.1 | GO:0061000 | negative regulation of dendritic spine development(GO:0061000) |
| 0.0 | 0.0 | GO:0021797 | forebrain anterior/posterior pattern specification(GO:0021797) |
| 0.0 | 0.0 | GO:2000152 | regulation of ubiquitin-specific protease activity(GO:2000152) |
| 0.0 | 0.1 | GO:0006369 | termination of RNA polymerase II transcription(GO:0006369) |
| 0.0 | 0.1 | GO:1901896 | positive regulation of calcium-transporting ATPase activity(GO:1901896) |
| 0.0 | 0.3 | GO:0006677 | glycosylceramide metabolic process(GO:0006677) |
| 0.0 | 0.2 | GO:0030854 | positive regulation of granulocyte differentiation(GO:0030854) |
| 0.0 | 0.1 | GO:0031642 | negative regulation of myelination(GO:0031642) |
| 0.0 | 0.1 | GO:0070314 | G1 to G0 transition(GO:0070314) |
| 0.0 | 0.0 | GO:2000807 | regulation of synaptic vesicle clustering(GO:2000807) |
| 0.0 | 0.2 | GO:0060052 | neurofilament cytoskeleton organization(GO:0060052) |
| 0.0 | 0.3 | GO:0046519 | sphingoid metabolic process(GO:0046519) |
| 0.0 | 0.1 | GO:0007386 | compartment pattern specification(GO:0007386) |
| 0.0 | 0.5 | GO:0048305 | immunoglobulin secretion(GO:0048305) |
| 0.0 | 0.2 | GO:0070431 | nucleotide-binding oligomerization domain containing signaling pathway(GO:0070423) nucleotide-binding oligomerization domain containing 2 signaling pathway(GO:0070431) |
| 0.0 | 0.1 | GO:0070268 | cornification(GO:0070268) |
| 0.0 | 0.1 | GO:0007208 | phospholipase C-activating serotonin receptor signaling pathway(GO:0007208) |
| 0.0 | 0.2 | GO:0090161 | Golgi ribbon formation(GO:0090161) |
| 0.0 | 0.1 | GO:0036233 | glycine import(GO:0036233) |
| 0.0 | 0.4 | GO:0007190 | activation of adenylate cyclase activity(GO:0007190) |
| 0.0 | 0.1 | GO:0090085 | regulation of protein deubiquitination(GO:0090085) |
| 0.0 | 0.1 | GO:0006407 | rRNA export from nucleus(GO:0006407) |
| 0.0 | 0.0 | GO:1903587 | regulation of blood vessel endothelial cell proliferation involved in sprouting angiogenesis(GO:1903587) |
| 0.0 | 0.1 | GO:0070445 | oligodendrocyte progenitor proliferation(GO:0070444) regulation of oligodendrocyte progenitor proliferation(GO:0070445) |
| 0.0 | 0.0 | GO:1901382 | chorionic trophoblast cell proliferation(GO:0097360) regulation of chorionic trophoblast cell proliferation(GO:1901382) |
| 0.0 | 0.2 | GO:0019240 | citrulline biosynthetic process(GO:0019240) |
| 0.0 | 0.1 | GO:0060671 | epithelial cell differentiation involved in embryonic placenta development(GO:0060671) epithelial cell morphogenesis involved in placental branching(GO:0060672) |
| 0.0 | 0.2 | GO:0032509 | endosome transport via multivesicular body sorting pathway(GO:0032509) |
| 0.0 | 0.1 | GO:0032020 | ISG15-protein conjugation(GO:0032020) |
| 0.0 | 0.0 | GO:0032489 | regulation of Cdc42 protein signal transduction(GO:0032489) |
| 0.0 | 0.1 | GO:0072051 | juxtaglomerular apparatus development(GO:0072051) |
| 0.0 | 0.1 | GO:0070458 | detoxification of nitrogen compound(GO:0051410) cellular detoxification of nitrogen compound(GO:0070458) |
| 0.0 | 0.0 | GO:0006344 | maintenance of chromatin silencing(GO:0006344) |
| 0.0 | 0.1 | GO:1901725 | regulation of histone deacetylase activity(GO:1901725) |
| 0.0 | 0.1 | GO:0048739 | cardiac muscle fiber development(GO:0048739) |
| 0.0 | 0.2 | GO:0007175 | negative regulation of epidermal growth factor-activated receptor activity(GO:0007175) |
| 0.0 | 0.1 | GO:0060300 | regulation of cytokine activity(GO:0060300) |
| 0.0 | 0.1 | GO:0046606 | negative regulation of centrosome duplication(GO:0010826) negative regulation of centrosome cycle(GO:0046606) |
| 0.0 | 0.0 | GO:0060767 | epithelial cell proliferation involved in prostate gland development(GO:0060767) |
| 0.0 | 0.1 | GO:0035524 | proline transmembrane transport(GO:0035524) |
| 0.0 | 0.0 | GO:0046066 | purine deoxyribonucleoside diphosphate metabolic process(GO:0009182) dGDP metabolic process(GO:0046066) |
| 0.0 | 0.1 | GO:0009445 | putrescine metabolic process(GO:0009445) |
| 0.0 | 0.0 | GO:2000041 | Wnt signaling pathway involved in digestive tract morphogenesis(GO:0044333) regulation of planar cell polarity pathway involved in axis elongation(GO:2000040) negative regulation of planar cell polarity pathway involved in axis elongation(GO:2000041) |
| 0.0 | 0.6 | GO:0007094 | mitotic spindle assembly checkpoint(GO:0007094) spindle assembly checkpoint(GO:0071173) |
| 0.0 | 0.0 | GO:0070094 | positive regulation of glucagon secretion(GO:0070094) |
| 0.0 | 0.0 | GO:0042525 | tyrosine phosphorylation of Stat6 protein(GO:0042505) regulation of tyrosine phosphorylation of Stat6 protein(GO:0042525) |
| 0.0 | 0.1 | GO:0060040 | retinal bipolar neuron differentiation(GO:0060040) |
| 0.0 | 0.0 | GO:0036462 | TRAIL-activated apoptotic signaling pathway(GO:0036462) |
| 0.0 | 0.1 | GO:0071863 | regulation of cell proliferation in bone marrow(GO:0071863) positive regulation of cell proliferation in bone marrow(GO:0071864) |
| 0.0 | 0.0 | GO:1902669 | positive regulation of axon extension involved in axon guidance(GO:0048842) positive regulation of axon guidance(GO:1902669) |
| 0.0 | 0.0 | GO:0003164 | His-Purkinje system development(GO:0003164) |
| 0.0 | 0.1 | GO:0010739 | positive regulation of protein kinase A signaling(GO:0010739) |
| 0.0 | 0.0 | GO:2000286 | receptor internalization involved in canonical Wnt signaling pathway(GO:2000286) |
| 0.0 | 0.1 | GO:0021554 | optic nerve development(GO:0021554) |
| 0.0 | 0.1 | GO:0048496 | maintenance of organ identity(GO:0048496) |
| 0.0 | 0.0 | GO:0035022 | positive regulation of Rac protein signal transduction(GO:0035022) |
| 0.0 | 0.1 | GO:1900107 | regulation of nodal signaling pathway(GO:1900107) |
| 0.0 | 0.2 | GO:0071800 | podosome assembly(GO:0071800) |
| 0.0 | 0.1 | GO:0043415 | positive regulation of skeletal muscle tissue regeneration(GO:0043415) |
| 0.0 | 0.3 | GO:2000114 | regulation of establishment of cell polarity(GO:2000114) |
| 0.0 | 0.0 | GO:0035898 | parathyroid hormone secretion(GO:0035898) |
| 0.0 | 0.0 | GO:0045897 | regulation of transcription during mitosis(GO:0045896) positive regulation of transcription during mitosis(GO:0045897) |
| 0.0 | 0.1 | GO:0031087 | nuclear-transcribed mRNA catabolic process, deadenylation-independent decay(GO:0031086) deadenylation-independent decapping of nuclear-transcribed mRNA(GO:0031087) |
| 0.0 | 0.1 | GO:2000665 | interleukin-5 secretion(GO:0072603) interleukin-13 secretion(GO:0072611) regulation of interleukin-5 secretion(GO:2000662) regulation of interleukin-13 secretion(GO:2000665) |
| 0.0 | 0.1 | GO:0040034 | regulation of development, heterochronic(GO:0040034) |
| 0.0 | 0.0 | GO:2000002 | negative regulation of cell cycle checkpoint(GO:1901977) negative regulation of DNA damage checkpoint(GO:2000002) |
| 0.0 | 0.1 | GO:0060023 | soft palate development(GO:0060023) |
| 0.0 | 0.0 | GO:0002386 | immune response in mucosal-associated lymphoid tissue(GO:0002386) |
| 0.0 | 0.1 | GO:0043117 | positive regulation of vascular permeability(GO:0043117) |
| 0.0 | 0.2 | GO:0048268 | clathrin coat assembly(GO:0048268) |
| 0.0 | 0.0 | GO:0021775 | smoothened signaling pathway involved in ventral spinal cord interneuron specification(GO:0021775) smoothened signaling pathway involved in spinal cord motor neuron cell fate specification(GO:0021776) |
| 0.0 | 0.0 | GO:0006566 | threonine metabolic process(GO:0006566) |
| 0.0 | 0.0 | GO:2000857 | mineralocorticoid secretion(GO:0035931) aldosterone secretion(GO:0035932) regulation of mineralocorticoid secretion(GO:2000855) positive regulation of mineralocorticoid secretion(GO:2000857) regulation of aldosterone secretion(GO:2000858) positive regulation of aldosterone secretion(GO:2000860) |
| 0.0 | 0.1 | GO:0046599 | regulation of centriole replication(GO:0046599) |
| 0.0 | 0.1 | GO:0009235 | cobalamin metabolic process(GO:0009235) |
| 0.0 | 0.1 | GO:0015816 | glycine transport(GO:0015816) |
| 0.0 | 0.0 | GO:0090290 | positive regulation of osteoclast proliferation(GO:0090290) |
| 0.0 | 0.0 | GO:0009436 | glyoxylate catabolic process(GO:0009436) |
| 0.0 | 0.1 | GO:0034755 | iron ion transmembrane transport(GO:0034755) |
| 0.0 | 0.0 | GO:0016078 | tRNA catabolic process(GO:0016078) |
| 0.0 | 0.1 | GO:0006685 | sphingomyelin catabolic process(GO:0006685) |
| 0.0 | 0.1 | GO:1900103 | positive regulation of endoplasmic reticulum unfolded protein response(GO:1900103) |
| 0.0 | 0.1 | GO:0006957 | complement activation, alternative pathway(GO:0006957) |
| 0.0 | 0.1 | GO:0051204 | protein insertion into mitochondrial membrane(GO:0051204) |
| 0.0 | 0.1 | GO:2000254 | regulation of male germ cell proliferation(GO:2000254) |
| 0.0 | 0.1 | GO:0036289 | peptidyl-serine autophosphorylation(GO:0036289) |
| 0.0 | 0.2 | GO:0046036 | CTP biosynthetic process(GO:0006241) pyrimidine ribonucleoside triphosphate biosynthetic process(GO:0009209) CTP metabolic process(GO:0046036) |
| 0.0 | 0.1 | GO:1904263 | positive regulation of TORC1 signaling(GO:1904263) |
| 0.0 | 0.0 | GO:0021859 | pyramidal neuron differentiation(GO:0021859) |
| 0.0 | 0.1 | GO:0015808 | L-alanine transport(GO:0015808) |
| 0.0 | 0.1 | GO:2000010 | positive regulation of protein localization to cell surface(GO:2000010) |
| 0.0 | 0.2 | GO:0048745 | smooth muscle tissue development(GO:0048745) |
| 0.0 | 0.1 | GO:0060339 | negative regulation of type I interferon-mediated signaling pathway(GO:0060339) |
| 0.0 | 0.2 | GO:0061001 | regulation of dendritic spine morphogenesis(GO:0061001) |
| 0.0 | 0.3 | GO:0048873 | homeostasis of number of cells within a tissue(GO:0048873) |
| 0.0 | 0.1 | GO:0031629 | synaptic vesicle fusion to presynaptic active zone membrane(GO:0031629) vesicle fusion to plasma membrane(GO:0099500) |
| 0.0 | 0.3 | GO:0070536 | protein K63-linked deubiquitination(GO:0070536) |
| 0.0 | 0.0 | GO:0055099 | response to high density lipoprotein particle(GO:0055099) |
| 0.0 | 0.0 | GO:0003195 | tricuspid valve development(GO:0003175) tricuspid valve morphogenesis(GO:0003186) tricuspid valve formation(GO:0003195) |
| 0.0 | 0.1 | GO:0051894 | positive regulation of focal adhesion assembly(GO:0051894) |
| 0.0 | 0.1 | GO:0035519 | protein K29-linked ubiquitination(GO:0035519) |
| 0.0 | 0.0 | GO:1901978 | positive regulation of cell cycle checkpoint(GO:1901978) |
| 0.0 | 0.0 | GO:1901857 | positive regulation of cellular respiration(GO:1901857) |
| 0.0 | 0.1 | GO:0045579 | positive regulation of B cell differentiation(GO:0045579) |
| 0.0 | 0.1 | GO:0060011 | Sertoli cell proliferation(GO:0060011) |
| 0.0 | 0.4 | GO:0034067 | protein localization to Golgi apparatus(GO:0034067) |
| 0.0 | 0.0 | GO:0051661 | maintenance of centrosome location(GO:0051661) |
| 0.0 | 0.1 | GO:0090241 | negative regulation of histone H4 acetylation(GO:0090241) |
| 0.0 | 0.2 | GO:0045056 | transcytosis(GO:0045056) |
| 0.0 | 0.1 | GO:0000715 | nucleotide-excision repair, DNA damage recognition(GO:0000715) |
| 0.0 | 0.6 | GO:0002028 | regulation of sodium ion transport(GO:0002028) |
| 0.0 | 0.2 | GO:0009083 | branched-chain amino acid catabolic process(GO:0009083) |
| 0.0 | 0.1 | GO:0006007 | glucose catabolic process(GO:0006007) |
| 0.0 | 0.1 | GO:0045743 | positive regulation of fibroblast growth factor receptor signaling pathway(GO:0045743) |
| 0.0 | 0.1 | GO:0048208 | vesicle targeting, rough ER to cis-Golgi(GO:0048207) COPII vesicle coating(GO:0048208) |
| 0.0 | 0.0 | GO:0033313 | meiotic cell cycle checkpoint(GO:0033313) |
| 0.0 | 0.0 | GO:0033227 | dsRNA transport(GO:0033227) |
| 0.0 | 0.0 | GO:0051589 | negative regulation of neurotransmitter transport(GO:0051589) |
| 0.0 | 0.2 | GO:0000188 | inactivation of MAPK activity(GO:0000188) |
| 0.0 | 0.0 | GO:0033087 | negative regulation of immature T cell proliferation(GO:0033087) |
| 0.0 | 0.1 | GO:0060999 | positive regulation of dendritic spine development(GO:0060999) |
| 0.0 | 0.0 | GO:0086016 | AV node cell action potential(GO:0086016) AV node cell to bundle of His cell signaling(GO:0086027) AV node cell to bundle of His cell communication(GO:0086067) |
| 0.0 | 0.3 | GO:0060046 | regulation of acrosome reaction(GO:0060046) |
| 0.0 | 0.0 | GO:1903207 | neuron death in response to hydrogen peroxide(GO:0036476) regulation of hydrogen peroxide-induced neuron death(GO:1903207) negative regulation of hydrogen peroxide-induced neuron death(GO:1903208) |
| 0.0 | 0.0 | GO:1900157 | regulation of bone mineralization involved in bone maturation(GO:1900157) |
| 0.0 | 0.1 | GO:0021546 | rhombomere development(GO:0021546) |
| 0.0 | 0.1 | GO:0015886 | heme transport(GO:0015886) |
| 0.0 | 0.1 | GO:1903608 | protein localization to cytoplasmic stress granule(GO:1903608) |
| 0.0 | 0.0 | GO:1900748 | positive regulation of vascular endothelial growth factor signaling pathway(GO:1900748) |
| 0.0 | 0.0 | GO:2000821 | regulation of grooming behavior(GO:2000821) |
| 0.0 | 0.1 | GO:0009312 | oligosaccharide biosynthetic process(GO:0009312) |
| 0.0 | 0.0 | GO:1903061 | positive regulation of protein lipidation(GO:1903061) |
| 0.0 | 0.0 | GO:0048382 | mesendoderm development(GO:0048382) |
| 0.0 | 0.0 | GO:2001245 | regulation of phosphatidylcholine biosynthetic process(GO:2001245) |
| 0.0 | 0.0 | GO:0090168 | Golgi reassembly(GO:0090168) |
| 0.0 | 0.0 | GO:0070358 | actin polymerization-dependent cell motility(GO:0070358) |
| 0.0 | 0.0 | GO:0071139 | resolution of recombination intermediates(GO:0071139) |
| 0.0 | 0.3 | GO:0009813 | flavonoid biosynthetic process(GO:0009813) flavonoid glucuronidation(GO:0052696) |
| 0.0 | 0.1 | GO:0051642 | centrosome localization(GO:0051642) |
| 0.0 | 0.0 | GO:0010458 | exit from mitosis(GO:0010458) |
| 0.0 | 0.0 | GO:0090394 | negative regulation of excitatory postsynaptic potential(GO:0090394) |
| 0.0 | 0.0 | GO:0070640 | vitamin D3 metabolic process(GO:0070640) |
| 0.0 | 0.0 | GO:1904380 | endoplasmic reticulum mannose trimming(GO:1904380) |
| 0.0 | 0.1 | GO:0060736 | prostate gland growth(GO:0060736) |
| 0.0 | 0.1 | GO:0035878 | nail development(GO:0035878) |
| 0.0 | 0.1 | GO:0048280 | vesicle fusion with Golgi apparatus(GO:0048280) |
| 0.0 | 0.0 | GO:0061642 | chemoattraction of axon(GO:0061642) |
| 0.0 | 0.0 | GO:0003149 | membranous septum morphogenesis(GO:0003149) |
| 0.0 | 0.0 | GO:0002121 | inter-male aggressive behavior(GO:0002121) |
| 0.0 | 0.1 | GO:0005981 | regulation of glycogen catabolic process(GO:0005981) |
| 0.0 | 0.1 | GO:0036123 | histone H3-K9 dimethylation(GO:0036123) |
| 0.0 | 0.1 | GO:0002441 | histamine production involved in inflammatory response(GO:0002349) histamine secretion involved in inflammatory response(GO:0002441) histamine secretion by mast cell(GO:0002553) |
| 0.0 | 0.0 | GO:0002309 | T cell proliferation involved in immune response(GO:0002309) |
| 0.0 | 0.6 | GO:0030010 | establishment of cell polarity(GO:0030010) |
| 0.0 | 0.1 | GO:0006689 | ganglioside catabolic process(GO:0006689) |
| 0.0 | 0.6 | GO:0043966 | histone H3 acetylation(GO:0043966) |
| 0.0 | 0.0 | GO:2000370 | positive regulation of clathrin-mediated endocytosis(GO:2000370) |
| 0.0 | 0.0 | GO:2000599 | regulation of cyclin catabolic process(GO:2000598) negative regulation of cyclin catabolic process(GO:2000599) |
| 0.0 | 0.0 | GO:0071930 | negative regulation of transcription involved in G1/S transition of mitotic cell cycle(GO:0071930) |
| 0.0 | 0.0 | GO:0070827 | chromatin maintenance(GO:0070827) |
| 0.0 | 0.0 | GO:0061589 | calcium activated phosphatidylserine scrambling(GO:0061589) |
| 0.0 | 0.0 | GO:0002370 | natural killer cell cytokine production(GO:0002370) regulation of natural killer cell cytokine production(GO:0002727) |
| 0.0 | 0.1 | GO:0035994 | response to muscle stretch(GO:0035994) |
| 0.0 | 0.0 | GO:0033566 | gamma-tubulin complex localization(GO:0033566) |
| 0.0 | 0.1 | GO:0070327 | thyroid hormone transport(GO:0070327) |
| 0.0 | 0.0 | GO:0042091 | interleukin-10 biosynthetic process(GO:0042091) regulation of interleukin-10 biosynthetic process(GO:0045074) |
| 0.0 | 0.0 | GO:0035627 | ceramide transport(GO:0035627) |
| 0.0 | 0.1 | GO:0071428 | rRNA-containing ribonucleoprotein complex export from nucleus(GO:0071428) |
| 0.0 | 0.0 | GO:0035469 | determination of pancreatic left/right asymmetry(GO:0035469) |
| 0.0 | 0.0 | GO:2000051 | negative regulation of non-canonical Wnt signaling pathway(GO:2000051) |
| 0.0 | 0.0 | GO:0018199 | peptidyl-glutamine modification(GO:0018199) |
| 0.0 | 0.0 | GO:0071926 | cannabinoid signaling pathway(GO:0038171) endocannabinoid signaling pathway(GO:0071926) |
| 0.0 | 0.1 | GO:0039702 | viral budding via host ESCRT complex(GO:0039702) |
| 0.0 | 0.0 | GO:0072048 | pattern specification involved in kidney development(GO:0061004) renal system pattern specification(GO:0072048) |
| 0.0 | 0.1 | GO:0046113 | nucleobase catabolic process(GO:0046113) |
| 0.0 | 0.1 | GO:0098719 | sodium ion import across plasma membrane(GO:0098719) sodium ion import into cell(GO:1990118) |
| 0.0 | 0.0 | GO:1902065 | response to L-glutamate(GO:1902065) |
| 0.0 | 0.0 | GO:0045113 | regulation of integrin biosynthetic process(GO:0045113) |
| 0.0 | 0.1 | GO:0050884 | neuromuscular process controlling posture(GO:0050884) |
| 0.0 | 0.0 | GO:1902093 | positive regulation of sperm motility(GO:1902093) |
| 0.0 | 0.0 | GO:0007567 | parturition(GO:0007567) |
| 0.0 | 0.0 | GO:0045039 | protein import into mitochondrial inner membrane(GO:0045039) |
| 0.0 | 0.0 | GO:0051105 | regulation of DNA ligation(GO:0051105) positive regulation of DNA ligation(GO:0051106) |
| 0.0 | 0.0 | GO:1901491 | negative regulation of lymphangiogenesis(GO:1901491) |
| 0.0 | 0.1 | GO:0032525 | somite rostral/caudal axis specification(GO:0032525) |
| 0.0 | 0.0 | GO:0003383 | apical constriction(GO:0003383) |
| 0.0 | 0.1 | GO:0006590 | thyroid hormone generation(GO:0006590) |
| 0.0 | 0.0 | GO:0007341 | penetration of zona pellucida(GO:0007341) |
| 0.0 | 0.0 | GO:0048296 | isotype switching to IgA isotypes(GO:0048290) regulation of isotype switching to IgA isotypes(GO:0048296) |
| 0.0 | 0.0 | GO:0010612 | regulation of cardiac muscle adaptation(GO:0010612) regulation of cardiac muscle hypertrophy in response to stress(GO:1903242) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 1.0 | 6.9 | GO:0036056 | filtration diaphragm(GO:0036056) slit diaphragm(GO:0036057) |
| 0.8 | 2.5 | GO:0014701 | junctional sarcoplasmic reticulum membrane(GO:0014701) |
| 0.8 | 4.1 | GO:0033010 | paranodal junction(GO:0033010) |
| 0.8 | 3.1 | GO:0044308 | axonal spine(GO:0044308) |
| 0.7 | 2.2 | GO:0072534 | perineuronal net(GO:0072534) |
| 0.6 | 3.8 | GO:0016012 | sarcoglycan complex(GO:0016012) |
| 0.6 | 3.2 | GO:0032983 | kainate selective glutamate receptor complex(GO:0032983) |
| 0.6 | 5.7 | GO:0044224 | juxtaparanode region of axon(GO:0044224) |
| 0.5 | 3.8 | GO:0043083 | synaptic cleft(GO:0043083) |
| 0.5 | 2.7 | GO:1990454 | L-type voltage-gated calcium channel complex(GO:1990454) |
| 0.4 | 1.3 | GO:0009331 | glycerol-3-phosphate dehydrogenase complex(GO:0009331) |
| 0.4 | 1.2 | GO:0005658 | alpha DNA polymerase:primase complex(GO:0005658) |
| 0.4 | 1.2 | GO:0030981 | cortical microtubule cytoskeleton(GO:0030981) |
| 0.4 | 2.9 | GO:0005952 | cAMP-dependent protein kinase complex(GO:0005952) |
| 0.4 | 2.2 | GO:0005915 | zonula adherens(GO:0005915) |
| 0.4 | 3.6 | GO:0035253 | ciliary rootlet(GO:0035253) |
| 0.3 | 1.4 | GO:0044530 | supraspliceosomal complex(GO:0044530) |
| 0.3 | 1.9 | GO:0044300 | cerebellar mossy fiber(GO:0044300) |
| 0.3 | 1.7 | GO:1990075 | periciliary membrane compartment(GO:1990075) |
| 0.3 | 1.1 | GO:0042583 | chromaffin granule(GO:0042583) |
| 0.3 | 2.8 | GO:0043194 | axon initial segment(GO:0043194) |
| 0.3 | 1.6 | GO:0090571 | RNA polymerase II transcription repressor complex(GO:0090571) |
| 0.2 | 0.9 | GO:1990851 | Wnt-Frizzled-LRP5/6 complex(GO:1990851) |
| 0.2 | 4.0 | GO:1902711 | GABA receptor complex(GO:1902710) GABA-A receptor complex(GO:1902711) |
| 0.2 | 1.3 | GO:0002177 | manchette(GO:0002177) |
| 0.2 | 1.1 | GO:0033588 | Elongator holoenzyme complex(GO:0033588) |
| 0.2 | 6.3 | GO:0031941 | filamentous actin(GO:0031941) |
| 0.2 | 2.0 | GO:0048188 | Set1C/COMPASS complex(GO:0048188) |
| 0.2 | 2.2 | GO:0031512 | motile primary cilium(GO:0031512) |
| 0.2 | 1.0 | GO:0008541 | proteasome regulatory particle, lid subcomplex(GO:0008541) |
| 0.2 | 1.6 | GO:0042788 | polysomal ribosome(GO:0042788) |
| 0.2 | 0.6 | GO:0042585 | germinal vesicle(GO:0042585) |
| 0.2 | 0.7 | GO:1990130 | Iml1 complex(GO:1990130) |
| 0.2 | 1.1 | GO:0070688 | MLL5-L complex(GO:0070688) |
| 0.2 | 0.5 | GO:0033596 | TSC1-TSC2 complex(GO:0033596) |
| 0.1 | 0.4 | GO:0000802 | transverse filament(GO:0000802) |
| 0.1 | 0.8 | GO:0035032 | phosphatidylinositol 3-kinase complex, class III(GO:0035032) |
| 0.1 | 1.4 | GO:0001518 | voltage-gated sodium channel complex(GO:0001518) |
| 0.1 | 2.3 | GO:0005868 | cytoplasmic dynein complex(GO:0005868) |
| 0.1 | 1.5 | GO:0000164 | protein phosphatase type 1 complex(GO:0000164) |
| 0.1 | 2.1 | GO:0060077 | inhibitory synapse(GO:0060077) |
| 0.1 | 0.3 | GO:0005879 | axonemal microtubule(GO:0005879) |
| 0.1 | 0.5 | GO:0097169 | AIM2 inflammasome complex(GO:0097169) |
| 0.1 | 0.3 | GO:0038037 | G-protein coupled receptor dimeric complex(GO:0038037) G-protein coupled receptor complex(GO:0097648) |
| 0.1 | 0.4 | GO:1990316 | ATG1/ULK1 kinase complex(GO:1990316) |
| 0.1 | 1.3 | GO:0097431 | mitotic spindle pole(GO:0097431) |
| 0.1 | 0.3 | GO:0030313 | cell outer membrane(GO:0009279) cell envelope(GO:0030313) external encapsulating structure part(GO:0044462) |
| 0.1 | 0.3 | GO:0070939 | Dsl1p complex(GO:0070939) |
| 0.1 | 0.3 | GO:0032937 | SREBP-SCAP-Insig complex(GO:0032937) |
| 0.1 | 4.6 | GO:0042734 | presynaptic membrane(GO:0042734) |
| 0.1 | 0.5 | GO:0098563 | integral component of synaptic vesicle membrane(GO:0030285) intrinsic component of synaptic vesicle membrane(GO:0098563) |
| 0.1 | 0.5 | GO:0045098 | type III intermediate filament(GO:0045098) |
| 0.1 | 1.1 | GO:0032433 | filopodium tip(GO:0032433) |
| 0.1 | 3.8 | GO:0030315 | T-tubule(GO:0030315) |
| 0.1 | 1.1 | GO:0044295 | axonal growth cone(GO:0044295) |
| 0.1 | 1.9 | GO:0032281 | AMPA glutamate receptor complex(GO:0032281) |
| 0.1 | 0.1 | GO:0097025 | MPP7-DLG1-LIN7 complex(GO:0097025) |
| 0.1 | 0.9 | GO:0030877 | beta-catenin destruction complex(GO:0030877) |
| 0.1 | 0.6 | GO:0044327 | dendritic spine head(GO:0044327) |
| 0.1 | 3.4 | GO:0005871 | kinesin complex(GO:0005871) |
| 0.1 | 0.6 | GO:0005688 | U6 snRNP(GO:0005688) |
| 0.1 | 0.8 | GO:0016010 | dystrophin-associated glycoprotein complex(GO:0016010) glycoprotein complex(GO:0090665) |
| 0.1 | 0.2 | GO:0045251 | mitochondrial electron transfer flavoprotein complex(GO:0017133) electron transfer flavoprotein complex(GO:0045251) |
| 0.1 | 3.0 | GO:0043198 | dendritic shaft(GO:0043198) |
| 0.1 | 0.2 | GO:0005594 | collagen type IX trimer(GO:0005594) |
| 0.1 | 0.5 | GO:0031232 | extrinsic component of external side of plasma membrane(GO:0031232) |
| 0.1 | 0.7 | GO:0005859 | muscle myosin complex(GO:0005859) |
| 0.1 | 0.7 | GO:0008250 | oligosaccharyltransferase complex(GO:0008250) |
| 0.1 | 0.7 | GO:0060091 | kinocilium(GO:0060091) |
| 0.1 | 0.3 | GO:0097433 | dense body(GO:0097433) |
| 0.1 | 0.6 | GO:0034993 | microtubule organizing center attachment site(GO:0034992) LINC complex(GO:0034993) |
| 0.1 | 0.4 | GO:0005672 | transcription factor TFIIA complex(GO:0005672) |
| 0.1 | 0.8 | GO:0030123 | AP-3 adaptor complex(GO:0030123) |
| 0.1 | 0.2 | GO:0061689 | tricellular tight junction(GO:0061689) |
| 0.1 | 1.7 | GO:0005763 | organellar small ribosomal subunit(GO:0000314) mitochondrial small ribosomal subunit(GO:0005763) |
| 0.1 | 0.9 | GO:0031045 | dense core granule(GO:0031045) |
| 0.1 | 0.4 | GO:0089717 | spanning component of plasma membrane(GO:0044214) spanning component of membrane(GO:0089717) |
| 0.1 | 0.2 | GO:0035355 | Toll-like receptor 2-Toll-like receptor 6 protein complex(GO:0035355) |
| 0.1 | 0.1 | GO:0044316 | cone cell pedicle(GO:0044316) |
| 0.1 | 0.6 | GO:0005671 | Ada2/Gcn5/Ada3 transcription activator complex(GO:0005671) |
| 0.1 | 0.4 | GO:0033180 | proton-transporting V-type ATPase, V1 domain(GO:0033180) |
| 0.1 | 0.2 | GO:0032279 | asymmetric synapse(GO:0032279) |
| 0.1 | 0.3 | GO:0070937 | CRD-mediated mRNA stability complex(GO:0070937) |
| 0.1 | 0.2 | GO:0071797 | LUBAC complex(GO:0071797) |
| 0.1 | 0.5 | GO:0044292 | dendrite terminus(GO:0044292) |
| 0.1 | 0.3 | GO:0031415 | NatA complex(GO:0031415) |
| 0.1 | 0.6 | GO:0042555 | MCM complex(GO:0042555) |
| 0.1 | 0.2 | GO:0005955 | calcineurin complex(GO:0005955) |
| 0.1 | 0.8 | GO:0031082 | BLOC complex(GO:0031082) |
| 0.1 | 0.4 | GO:0036157 | outer dynein arm(GO:0036157) |
| 0.0 | 1.0 | GO:0005922 | connexon complex(GO:0005922) |
| 0.0 | 0.2 | GO:0070545 | PeBoW complex(GO:0070545) |
| 0.0 | 0.9 | GO:0005605 | basal lamina(GO:0005605) |
| 0.0 | 0.1 | GO:0008622 | epsilon DNA polymerase complex(GO:0008622) |
| 0.0 | 0.6 | GO:0032839 | dendrite cytoplasm(GO:0032839) |
| 0.0 | 0.2 | GO:0071204 | histone pre-mRNA 3'end processing complex(GO:0071204) |
| 0.0 | 0.2 | GO:0005890 | sodium:potassium-exchanging ATPase complex(GO:0005890) |
| 0.0 | 0.6 | GO:0005614 | interstitial matrix(GO:0005614) |
| 0.0 | 0.2 | GO:0030478 | actin cap(GO:0030478) |
| 0.0 | 0.2 | GO:0000408 | EKC/KEOPS complex(GO:0000408) |
| 0.0 | 0.3 | GO:0002116 | semaphorin receptor complex(GO:0002116) |
| 0.0 | 0.1 | GO:0071001 | U4/U6 snRNP(GO:0071001) |
| 0.0 | 0.5 | GO:0046930 | pore complex(GO:0046930) |
| 0.0 | 0.3 | GO:0097539 | ciliary transition fiber(GO:0097539) |
| 0.0 | 0.1 | GO:0000931 | gamma-tubulin large complex(GO:0000931) gamma-tubulin ring complex(GO:0008274) |
| 0.0 | 0.1 | GO:0035985 | senescence-associated heterochromatin focus(GO:0035985) |
| 0.0 | 0.1 | GO:0032584 | growth cone membrane(GO:0032584) |
| 0.0 | 0.1 | GO:0042629 | mast cell granule(GO:0042629) |
| 0.0 | 0.3 | GO:0002102 | podosome(GO:0002102) |
| 0.0 | 0.2 | GO:0071986 | Ragulator complex(GO:0071986) |
| 0.0 | 0.1 | GO:0016602 | CCAAT-binding factor complex(GO:0016602) |
| 0.0 | 0.5 | GO:0032809 | neuronal cell body membrane(GO:0032809) |
| 0.0 | 0.1 | GO:0033093 | Weibel-Palade body(GO:0033093) |
| 0.0 | 0.2 | GO:0031254 | uropod(GO:0001931) cell trailing edge(GO:0031254) |
| 0.0 | 0.1 | GO:1990716 | axonemal central apparatus(GO:1990716) |
| 0.0 | 0.7 | GO:0035861 | site of double-strand break(GO:0035861) |
| 0.0 | 0.3 | GO:0097228 | sperm principal piece(GO:0097228) |
| 0.0 | 0.2 | GO:0005796 | Golgi lumen(GO:0005796) |
| 0.0 | 0.1 | GO:0032426 | stereocilium tip(GO:0032426) |
| 0.0 | 0.0 | GO:0030870 | Mre11 complex(GO:0030870) |
| 0.0 | 0.1 | GO:0042719 | mitochondrial intermembrane space protein transporter complex(GO:0042719) |
| 0.0 | 0.0 | GO:0016533 | cyclin-dependent protein kinase 5 holoenzyme complex(GO:0016533) |
| 0.0 | 0.1 | GO:0055087 | Ski complex(GO:0055087) |
| 0.0 | 0.1 | GO:0072687 | meiotic spindle(GO:0072687) |
| 0.0 | 0.3 | GO:0032588 | trans-Golgi network membrane(GO:0032588) |
| 0.0 | 0.1 | GO:0035748 | myelin sheath abaxonal region(GO:0035748) |
| 0.0 | 0.1 | GO:0043159 | acrosomal matrix(GO:0043159) |
| 0.0 | 0.1 | GO:0005726 | perichromatin fibrils(GO:0005726) |
| 0.0 | 0.2 | GO:0030991 | intraciliary transport particle A(GO:0030991) |
| 0.0 | 0.1 | GO:0031528 | microvillus membrane(GO:0031528) |
| 0.0 | 0.0 | GO:0005593 | FACIT collagen trimer(GO:0005593) |
| 0.0 | 0.1 | GO:0002139 | stereocilia coupling link(GO:0002139) |
| 0.0 | 0.2 | GO:0031597 | cytosolic proteasome complex(GO:0031597) |
| 0.0 | 0.0 | GO:0071942 | XPC complex(GO:0071942) |
| 0.0 | 0.9 | GO:0005930 | axoneme(GO:0005930) ciliary plasm(GO:0097014) |
| 0.0 | 0.7 | GO:0030175 | filopodium(GO:0030175) |
| 0.0 | 0.2 | GO:0048786 | presynaptic active zone(GO:0048786) |
| 0.0 | 0.1 | GO:0034457 | Mpp10 complex(GO:0034457) |
| 0.0 | 2.2 | GO:0045211 | postsynaptic membrane(GO:0045211) |
| 0.0 | 1.1 | GO:0005814 | centriole(GO:0005814) |
| 0.0 | 0.1 | GO:0071547 | piP-body(GO:0071547) |
| 0.0 | 1.8 | GO:0035068 | micro-ribonucleoprotein complex(GO:0035068) |
| 0.0 | 0.3 | GO:0030992 | intraciliary transport particle B(GO:0030992) |
| 0.0 | 0.1 | GO:0042571 | immunoglobulin complex, circulating(GO:0042571) |
| 0.0 | 0.1 | GO:0070776 | H3 histone acetyltransferase complex(GO:0070775) MOZ/MORF histone acetyltransferase complex(GO:0070776) |
| 0.0 | 0.3 | GO:0005891 | voltage-gated calcium channel complex(GO:0005891) |
| 0.0 | 0.1 | GO:0033503 | HULC complex(GO:0033503) |
| 0.0 | 0.2 | GO:0000145 | exocyst(GO:0000145) |
| 0.0 | 0.1 | GO:0000120 | RNA polymerase I transcription factor complex(GO:0000120) |
| 0.0 | 0.4 | GO:0031594 | neuromuscular junction(GO:0031594) |
| 0.0 | 0.1 | GO:0031983 | vesicle lumen(GO:0031983) |
| 0.0 | 0.1 | GO:0017071 | intracellular cyclic nucleotide activated cation channel complex(GO:0017071) |
| 0.0 | 0.2 | GO:0031011 | Ino80 complex(GO:0031011) |
| 0.0 | 0.0 | GO:0097441 | basilar dendrite(GO:0097441) |
| 0.0 | 0.1 | GO:0033256 | I-kappaB/NF-kappaB complex(GO:0033256) |
| 0.0 | 0.3 | GO:0008287 | protein serine/threonine phosphatase complex(GO:0008287) phosphatase complex(GO:1903293) |
| 0.0 | 0.0 | GO:0033185 | dolichol-phosphate-mannose synthase complex(GO:0033185) |
| 0.0 | 0.0 | GO:0005588 | collagen type V trimer(GO:0005588) |
| 0.0 | 0.0 | GO:0010009 | cytoplasmic side of endosome membrane(GO:0010009) |
| 0.0 | 0.1 | GO:0001940 | male pronucleus(GO:0001940) |
| 0.0 | 0.1 | GO:0000815 | ESCRT III complex(GO:0000815) |
| 0.0 | 0.9 | GO:0014069 | postsynaptic density(GO:0014069) postsynaptic specialization(GO:0099572) |
| 0.0 | 0.1 | GO:0031616 | spindle pole centrosome(GO:0031616) |
| 0.0 | 0.0 | GO:0071008 | U2-type post-mRNA release spliceosomal complex(GO:0071008) |
| 0.0 | 0.1 | GO:0000506 | glycosylphosphatidylinositol-N-acetylglucosaminyltransferase (GPI-GnT) complex(GO:0000506) |
| 0.0 | 0.1 | GO:0071006 | U2-type catalytic step 1 spliceosome(GO:0071006) |
| 0.0 | 0.1 | GO:0005583 | fibrillar collagen trimer(GO:0005583) banded collagen fibril(GO:0098643) |
| 0.0 | 0.0 | GO:0090543 | Flemming body(GO:0090543) |
| 0.0 | 0.0 | GO:0033553 | rDNA heterochromatin(GO:0033553) |
| 0.0 | 0.0 | GO:0098984 | neuron to neuron synapse(GO:0098984) |
| 0.0 | 0.1 | GO:0000137 | Golgi cis cisterna(GO:0000137) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 2.6 | 7.7 | GO:0070699 | type II activin receptor binding(GO:0070699) |
| 2.4 | 7.1 | GO:0015018 | galactosylgalactosylxylosylprotein 3-beta-glucuronosyltransferase activity(GO:0015018) |
| 1.6 | 6.4 | GO:0004971 | AMPA glutamate receptor activity(GO:0004971) |
| 0.8 | 2.5 | GO:0086056 | voltage-gated calcium channel activity involved in AV node cell action potential(GO:0086056) |
| 0.8 | 2.3 | GO:0005519 | cytoskeletal regulatory protein binding(GO:0005519) |
| 0.7 | 4.3 | GO:0034190 | apolipoprotein receptor binding(GO:0034190) |
| 0.7 | 2.0 | GO:0031802 | type 5 metabotropic glutamate receptor binding(GO:0031802) |
| 0.7 | 2.0 | GO:0004351 | glutamate decarboxylase activity(GO:0004351) |
| 0.6 | 2.4 | GO:0071074 | eukaryotic initiation factor eIF2 binding(GO:0071074) |
| 0.6 | 1.1 | GO:0004691 | cAMP-dependent protein kinase activity(GO:0004691) |
| 0.5 | 2.1 | GO:0070878 | primary miRNA binding(GO:0070878) |
| 0.5 | 7.5 | GO:0034237 | protein kinase A regulatory subunit binding(GO:0034237) |
| 0.5 | 1.4 | GO:0050833 | pyruvate transmembrane transporter activity(GO:0050833) |
| 0.4 | 1.3 | GO:0004367 | glycerol-3-phosphate dehydrogenase [NAD+] activity(GO:0004367) |
| 0.4 | 1.3 | GO:0097109 | neuroligin family protein binding(GO:0097109) |
| 0.4 | 0.4 | GO:0000700 | mismatch base pair DNA N-glycosylase activity(GO:0000700) |
| 0.4 | 1.2 | GO:0003726 | double-stranded RNA adenosine deaminase activity(GO:0003726) |
| 0.4 | 1.2 | GO:0019166 | trans-2-enoyl-CoA reductase (NADPH) activity(GO:0019166) |
| 0.4 | 3.3 | GO:0001091 | RNA polymerase II basal transcription factor binding(GO:0001091) |
| 0.4 | 1.5 | GO:0004370 | glycerol kinase activity(GO:0004370) |
| 0.4 | 3.9 | GO:0050811 | GABA receptor binding(GO:0050811) |
| 0.3 | 2.1 | GO:0004385 | guanylate kinase activity(GO:0004385) |
| 0.3 | 1.7 | GO:0005004 | GPI-linked ephrin receptor activity(GO:0005004) |
| 0.3 | 0.9 | GO:0005176 | ErbB-2 class receptor binding(GO:0005176) |
| 0.3 | 6.2 | GO:0030215 | semaphorin receptor binding(GO:0030215) |
| 0.3 | 1.9 | GO:0008603 | cAMP-dependent protein kinase regulator activity(GO:0008603) |
| 0.3 | 1.5 | GO:0000155 | phosphorelay sensor kinase activity(GO:0000155) |
| 0.3 | 1.2 | GO:0016661 | oxidoreductase activity, acting on other nitrogenous compounds as donors(GO:0016661) |
| 0.3 | 3.2 | GO:0042043 | neurexin family protein binding(GO:0042043) |
| 0.3 | 0.8 | GO:0016262 | protein N-acetylglucosaminyltransferase activity(GO:0016262) |
| 0.3 | 1.3 | GO:0070728 | leucine binding(GO:0070728) |
| 0.3 | 0.8 | GO:0004937 | alpha1-adrenergic receptor activity(GO:0004937) |
| 0.2 | 0.5 | GO:0048101 | calcium- and calmodulin-regulated 3',5'-cyclic-GMP phosphodiesterase activity(GO:0048101) |
| 0.2 | 0.9 | GO:0015277 | kainate selective glutamate receptor activity(GO:0015277) |
| 0.2 | 0.7 | GO:0001075 | transcription factor activity, RNA polymerase II core promoter sequence-specific binding involved in preinitiation complex assembly(GO:0001075) |
| 0.2 | 0.9 | GO:0051434 | BH3 domain binding(GO:0051434) |
| 0.2 | 2.4 | GO:0015271 | outward rectifier potassium channel activity(GO:0015271) |
| 0.2 | 1.8 | GO:0002162 | dystroglycan binding(GO:0002162) |
| 0.2 | 1.5 | GO:0030957 | Tat protein binding(GO:0030957) |
| 0.2 | 0.6 | GO:0004731 | purine-nucleoside phosphorylase activity(GO:0004731) |
| 0.2 | 1.5 | GO:0003896 | DNA primase activity(GO:0003896) |
| 0.2 | 4.2 | GO:0030552 | cAMP binding(GO:0030552) |
| 0.2 | 0.6 | GO:0008427 | calcium-dependent protein kinase inhibitor activity(GO:0008427) |
| 0.2 | 5.4 | GO:0045296 | cadherin binding(GO:0045296) |
| 0.2 | 4.8 | GO:0046875 | ephrin receptor binding(GO:0046875) |
| 0.2 | 1.1 | GO:0061133 | endopeptidase activator activity(GO:0061133) |
| 0.2 | 0.9 | GO:0005005 | transmembrane-ephrin receptor activity(GO:0005005) |
| 0.2 | 2.7 | GO:0031402 | sodium ion binding(GO:0031402) |
| 0.2 | 0.9 | GO:0003958 | NADPH-hemoprotein reductase activity(GO:0003958) |
| 0.2 | 0.2 | GO:0035650 | AP-1 adaptor complex binding(GO:0035650) |
| 0.2 | 0.5 | GO:0005220 | inositol 1,4,5-trisphosphate-sensitive calcium-release channel activity(GO:0005220) |
| 0.2 | 0.7 | GO:0086080 | protein binding involved in heterotypic cell-cell adhesion(GO:0086080) |
| 0.2 | 0.7 | GO:0036033 | mediator complex binding(GO:0036033) |
| 0.2 | 1.2 | GO:0005078 | MAP-kinase scaffold activity(GO:0005078) |
| 0.2 | 1.9 | GO:0004865 | protein serine/threonine phosphatase inhibitor activity(GO:0004865) |
| 0.2 | 0.6 | GO:0034547 | N-cyclopropylmelamine deaminase activity(GO:0034547) N-cyclopropylammeline deaminase activity(GO:0034548) N-cyclopropylammelide alkylamino hydrolase activity(GO:0034549) 2,5-diamino-6-ribitylamino-4(3H)-pyrimidinone 5'-phosphate deaminase activity(GO:0043723) tRNA-specific adenosine-37 deaminase activity(GO:0043829) archaeal-specific GTP cyclohydrolase activity(GO:0044682) tRNA-specific adenosine-34 deaminase activity(GO:0052717) |
| 0.2 | 1.7 | GO:0030898 | actin-dependent ATPase activity(GO:0030898) |
| 0.2 | 1.2 | GO:0051011 | microtubule minus-end binding(GO:0051011) |
| 0.2 | 1.2 | GO:0008113 | peptide-methionine (S)-S-oxide reductase activity(GO:0008113) |
| 0.2 | 0.6 | GO:0045499 | chemorepellent activity(GO:0045499) |
| 0.1 | 1.2 | GO:0001206 | transcriptional repressor activity, RNA polymerase II distal enhancer sequence-specific binding(GO:0001206) |
| 0.1 | 1.9 | GO:0008253 | 5'-nucleotidase activity(GO:0008253) |
| 0.1 | 3.3 | GO:0071837 | HMG box domain binding(GO:0071837) |
| 0.1 | 2.3 | GO:0042800 | histone methyltransferase activity (H3-K4 specific)(GO:0042800) |
| 0.1 | 1.8 | GO:0031005 | filamin binding(GO:0031005) |
| 0.1 | 0.7 | GO:0017151 | DEAD/H-box RNA helicase binding(GO:0017151) |
| 0.1 | 0.5 | GO:0017176 | phosphatidylinositol N-acetylglucosaminyltransferase activity(GO:0017176) |
| 0.1 | 1.2 | GO:0008331 | high voltage-gated calcium channel activity(GO:0008331) |
| 0.1 | 0.4 | GO:0004720 | protein-lysine 6-oxidase activity(GO:0004720) |
| 0.1 | 0.4 | GO:0050252 | retinol O-fatty-acyltransferase activity(GO:0050252) |
| 0.1 | 0.4 | GO:1990829 | C-rich single-stranded DNA binding(GO:1990829) |
| 0.1 | 0.5 | GO:0015016 | [heparan sulfate]-glucosamine N-sulfotransferase activity(GO:0015016) |
| 0.1 | 0.4 | GO:0070905 | serine binding(GO:0070905) |
| 0.1 | 0.3 | GO:0051765 | inositol tetrakisphosphate kinase activity(GO:0051765) |
| 0.1 | 2.8 | GO:0004181 | metallocarboxypeptidase activity(GO:0004181) |
| 0.1 | 1.3 | GO:0016303 | 1-phosphatidylinositol-3-kinase activity(GO:0016303) |
| 0.1 | 0.6 | GO:0000146 | microfilament motor activity(GO:0000146) |
| 0.1 | 0.6 | GO:0001665 | alpha-N-acetylgalactosaminide alpha-2,6-sialyltransferase activity(GO:0001665) |
| 0.1 | 0.8 | GO:0035242 | protein-arginine omega-N asymmetric methyltransferase activity(GO:0035242) |
| 0.1 | 0.4 | GO:0015183 | L-aspartate transmembrane transporter activity(GO:0015183) |
| 0.1 | 1.1 | GO:0042577 | lipid phosphatase activity(GO:0042577) |
| 0.1 | 0.3 | GO:0004965 | G-protein coupled GABA receptor activity(GO:0004965) |
| 0.1 | 0.4 | GO:0004488 | methylenetetrahydrofolate dehydrogenase (NADP+) activity(GO:0004488) |
| 0.1 | 0.4 | GO:0005332 | gamma-aminobutyric acid:sodium symporter activity(GO:0005332) |
| 0.1 | 0.5 | GO:0003828 | alpha-N-acetylneuraminate alpha-2,8-sialyltransferase activity(GO:0003828) |
| 0.1 | 0.4 | GO:0004558 | alpha-1,4-glucosidase activity(GO:0004558) |
| 0.1 | 0.5 | GO:0043426 | MRF binding(GO:0043426) |
| 0.1 | 0.3 | GO:2001069 | glycogen binding(GO:2001069) |
| 0.1 | 0.5 | GO:0071723 | lipopeptide binding(GO:0071723) |
| 0.1 | 0.2 | GO:0004779 | sulfate adenylyltransferase activity(GO:0004779) |
| 0.1 | 0.5 | GO:0017169 | CDP-alcohol phosphatidyltransferase activity(GO:0017169) |
| 0.1 | 1.1 | GO:0070182 | DNA polymerase binding(GO:0070182) |
| 0.1 | 0.6 | GO:0015198 | oligopeptide transporter activity(GO:0015198) |
| 0.1 | 0.3 | GO:0004719 | protein-L-isoaspartate (D-aspartate) O-methyltransferase activity(GO:0004719) |
| 0.1 | 2.9 | GO:0019894 | kinesin binding(GO:0019894) |
| 0.1 | 0.7 | GO:0050291 | sphingosine N-acyltransferase activity(GO:0050291) |
| 0.1 | 0.3 | GO:0016647 | oxidoreductase activity, acting on the CH-NH group of donors, oxygen as acceptor(GO:0016647) |
| 0.1 | 0.3 | GO:0051959 | dynein light intermediate chain binding(GO:0051959) |
| 0.1 | 0.5 | GO:1990254 | keratin filament binding(GO:1990254) |
| 0.1 | 0.1 | GO:0033677 | DNA/RNA helicase activity(GO:0033677) |
| 0.1 | 0.4 | GO:0031749 | D2 dopamine receptor binding(GO:0031749) |
| 0.1 | 0.4 | GO:0036435 | K48-linked polyubiquitin binding(GO:0036435) |
| 0.1 | 1.0 | GO:0008641 | small protein activating enzyme activity(GO:0008641) |
| 0.1 | 2.0 | GO:0005104 | fibroblast growth factor receptor binding(GO:0005104) |
| 0.1 | 0.1 | GO:0004690 | cyclic nucleotide-dependent protein kinase activity(GO:0004690) |
| 0.1 | 0.5 | GO:0098505 | G-rich strand telomeric DNA binding(GO:0098505) |
| 0.1 | 0.3 | GO:0004528 | phosphodiesterase I activity(GO:0004528) |
| 0.1 | 0.1 | GO:0010858 | calcium-dependent protein kinase regulator activity(GO:0010858) |
| 0.1 | 0.4 | GO:0044323 | retinoic acid-responsive element binding(GO:0044323) |
| 0.1 | 0.3 | GO:0001069 | regulatory region RNA binding(GO:0001069) |
| 0.1 | 1.1 | GO:0008607 | phosphorylase kinase regulator activity(GO:0008607) |
| 0.1 | 1.3 | GO:0030506 | ankyrin binding(GO:0030506) |
| 0.1 | 0.4 | GO:0004826 | phenylalanine-tRNA ligase activity(GO:0004826) |
| 0.1 | 2.1 | GO:0017134 | fibroblast growth factor binding(GO:0017134) |
| 0.1 | 0.7 | GO:0000983 | transcription factor activity, RNA polymerase II core promoter sequence-specific(GO:0000983) |
| 0.1 | 0.9 | GO:0030676 | Rac guanyl-nucleotide exchange factor activity(GO:0030676) |
| 0.1 | 1.3 | GO:0032794 | GTPase activating protein binding(GO:0032794) |
| 0.1 | 0.4 | GO:0031849 | olfactory receptor binding(GO:0031849) |
| 0.1 | 0.5 | GO:0030274 | LIM domain binding(GO:0030274) |
| 0.1 | 0.8 | GO:0016929 | SUMO-specific protease activity(GO:0016929) |
| 0.1 | 0.3 | GO:0004740 | pyruvate dehydrogenase (acetyl-transferring) kinase activity(GO:0004740) |
| 0.1 | 0.7 | GO:0005041 | low-density lipoprotein receptor activity(GO:0005041) |
| 0.1 | 0.2 | GO:0018479 | benzaldehyde dehydrogenase (NAD+) activity(GO:0018479) |
| 0.1 | 0.6 | GO:0016004 | phospholipase activator activity(GO:0016004) |
| 0.1 | 0.2 | GO:0017116 | single-stranded DNA-dependent ATP-dependent DNA helicase activity(GO:0017116) |
| 0.1 | 1.5 | GO:0030742 | GTP-dependent protein binding(GO:0030742) |
| 0.1 | 0.8 | GO:0019531 | oxalate transmembrane transporter activity(GO:0019531) |
| 0.1 | 0.1 | GO:0030297 | transmembrane receptor protein tyrosine kinase activator activity(GO:0030297) |
| 0.1 | 0.2 | GO:0005483 | soluble NSF attachment protein activity(GO:0005483) |
| 0.1 | 1.8 | GO:0005246 | calcium channel regulator activity(GO:0005246) |
| 0.1 | 0.3 | GO:0015181 | arginine transmembrane transporter activity(GO:0015181) L-lysine transmembrane transporter activity(GO:0015189) |
| 0.1 | 0.2 | GO:0016649 | electron-transferring-flavoprotein dehydrogenase activity(GO:0004174) oxidoreductase activity, acting on the CH-NH group of donors, quinone or similar compound as acceptor(GO:0016649) |
| 0.1 | 1.8 | GO:0052771 | coenzyme F390-A hydrolase activity(GO:0052770) coenzyme F390-G hydrolase activity(GO:0052771) |
| 0.1 | 3.8 | GO:0003777 | microtubule motor activity(GO:0003777) |
| 0.1 | 0.7 | GO:0048185 | activin binding(GO:0048185) |
| 0.1 | 0.2 | GO:0035615 | clathrin adaptor activity(GO:0035615) endocytic adaptor activity(GO:0098748) |
| 0.1 | 0.8 | GO:0043733 | alkylbase DNA N-glycosylase activity(GO:0003905) DNA-3-methylbase glycosylase activity(GO:0043733) |
| 0.1 | 0.1 | GO:0004809 | tRNA (guanine-N2-)-methyltransferase activity(GO:0004809) |
| 0.1 | 0.4 | GO:0004579 | dolichyl-diphosphooligosaccharide-protein glycotransferase activity(GO:0004579) |
| 0.1 | 1.7 | GO:0070888 | E-box binding(GO:0070888) |
| 0.1 | 0.2 | GO:0016774 | phosphotransferase activity, carboxyl group as acceptor(GO:0016774) |
| 0.1 | 0.2 | GO:0019862 | IgA binding(GO:0019862) |
| 0.1 | 0.2 | GO:0008142 | oxysterol binding(GO:0008142) |
| 0.1 | 0.2 | GO:0019959 | interleukin-8 binding(GO:0019959) |
| 0.1 | 0.1 | GO:0004698 | calcium-dependent protein kinase C activity(GO:0004698) |
| 0.1 | 0.3 | GO:0004565 | beta-galactosidase activity(GO:0004565) |
| 0.1 | 0.2 | GO:0008502 | melatonin receptor activity(GO:0008502) |
| 0.1 | 0.1 | GO:0005030 | neurotrophin receptor activity(GO:0005030) |
| 0.1 | 0.6 | GO:0048018 | receptor agonist activity(GO:0048018) |
| 0.1 | 0.1 | GO:0043120 | tumor necrosis factor binding(GO:0043120) |
| 0.1 | 0.2 | GO:1990189 | peptide-serine-N-acetyltransferase activity(GO:1990189) peptide-glutamate-N-acetyltransferase activity(GO:1990190) |
| 0.1 | 0.5 | GO:0030159 | receptor signaling complex scaffold activity(GO:0030159) |
| 0.1 | 0.2 | GO:0043184 | vascular endothelial growth factor receptor 2 binding(GO:0043184) |
| 0.1 | 0.2 | GO:0050145 | nucleoside phosphate kinase activity(GO:0050145) |
| 0.1 | 0.3 | GO:0016778 | diphosphotransferase activity(GO:0016778) |
| 0.1 | 1.2 | GO:0005251 | delayed rectifier potassium channel activity(GO:0005251) |
| 0.1 | 0.2 | GO:0004022 | alcohol dehydrogenase (NAD) activity(GO:0004022) |
| 0.1 | 0.9 | GO:0016755 | transferase activity, transferring amino-acyl groups(GO:0016755) |
| 0.0 | 0.1 | GO:0042296 | ISG15 transferase activity(GO:0042296) |
| 0.0 | 0.2 | GO:0002054 | nucleobase binding(GO:0002054) |
| 0.0 | 0.1 | GO:0035256 | G-protein coupled glutamate receptor binding(GO:0035256) |
| 0.0 | 0.9 | GO:0004029 | aldehyde dehydrogenase (NAD) activity(GO:0004029) |
| 0.0 | 0.1 | GO:0051377 | mannose-ethanolamine phosphotransferase activity(GO:0051377) |
| 0.0 | 0.4 | GO:0016861 | intramolecular oxidoreductase activity, interconverting aldoses and ketoses(GO:0016861) |
| 0.0 | 0.2 | GO:0004614 | phosphoglucomutase activity(GO:0004614) |
| 0.0 | 0.2 | GO:0070891 | lipoteichoic acid binding(GO:0070891) |
| 0.0 | 0.4 | GO:0031681 | G-protein beta-subunit binding(GO:0031681) |
| 0.0 | 0.2 | GO:0005346 | adenine nucleotide transmembrane transporter activity(GO:0000295) purine ribonucleotide transmembrane transporter activity(GO:0005346) purine nucleotide transmembrane transporter activity(GO:0015216) |
| 0.0 | 0.2 | GO:0035727 | lysophosphatidic acid binding(GO:0035727) |
| 0.0 | 2.7 | GO:0016765 | transferase activity, transferring alkyl or aryl (other than methyl) groups(GO:0016765) |
| 0.0 | 0.2 | GO:0003953 | NAD+ nucleosidase activity(GO:0003953) |
| 0.0 | 0.2 | GO:0008454 | alpha-1,3-mannosylglycoprotein 4-beta-N-acetylglucosaminyltransferase activity(GO:0008454) |
| 0.0 | 0.1 | GO:0015106 | bicarbonate transmembrane transporter activity(GO:0015106) |
| 0.0 | 0.1 | GO:0019960 | C-X3-C chemokine binding(GO:0019960) |
| 0.0 | 0.0 | GO:0008251 | tRNA-specific adenosine deaminase activity(GO:0008251) |
| 0.0 | 0.4 | GO:0004568 | chitinase activity(GO:0004568) |
| 0.0 | 0.4 | GO:0050308 | sugar-phosphatase activity(GO:0050308) |
| 0.0 | 0.1 | GO:0008260 | 3-oxoacid CoA-transferase activity(GO:0008260) |
| 0.0 | 0.4 | GO:0070180 | large ribosomal subunit rRNA binding(GO:0070180) |
| 0.0 | 0.0 | GO:0043125 | ErbB-3 class receptor binding(GO:0043125) |
| 0.0 | 0.1 | GO:0016015 | morphogen activity(GO:0016015) |
| 0.0 | 0.4 | GO:0004983 | neuropeptide Y receptor activity(GO:0004983) |
| 0.0 | 0.0 | GO:0048408 | epidermal growth factor binding(GO:0048408) |
| 0.0 | 0.1 | GO:0032422 | purine-rich negative regulatory element binding(GO:0032422) |
| 0.0 | 1.8 | GO:0008392 | arachidonic acid epoxygenase activity(GO:0008392) |
| 0.0 | 3.2 | GO:0005178 | integrin binding(GO:0005178) |
| 0.0 | 0.1 | GO:0051525 | NFAT protein binding(GO:0051525) |
| 0.0 | 0.2 | GO:0016713 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, reduced iron-sulfur protein as one donor, and incorporation of one atom of oxygen(GO:0016713) |
| 0.0 | 0.6 | GO:0019789 | SUMO transferase activity(GO:0019789) |
| 0.0 | 1.2 | GO:0003774 | motor activity(GO:0003774) |
| 0.0 | 0.1 | GO:0032051 | clathrin light chain binding(GO:0032051) |
| 0.0 | 0.1 | GO:0045504 | dynein heavy chain binding(GO:0045504) |
| 0.0 | 0.4 | GO:0070577 | lysine-acetylated histone binding(GO:0070577) |
| 0.0 | 1.0 | GO:0005154 | epidermal growth factor receptor binding(GO:0005154) |
| 0.0 | 0.2 | GO:0016907 | G-protein coupled acetylcholine receptor activity(GO:0016907) |
| 0.0 | 0.4 | GO:0070016 | armadillo repeat domain binding(GO:0070016) |
| 0.0 | 0.2 | GO:0050656 | 3'-phosphoadenosine 5'-phosphosulfate binding(GO:0050656) |
| 0.0 | 2.5 | GO:0008169 | C-methyltransferase activity(GO:0008169) 2-polyprenyl-6-methoxy-1,4-benzoquinone methyltransferase activity(GO:0008425) quinone cofactor methyltransferase activity(GO:0030580) |
| 0.0 | 0.2 | GO:0008526 | phosphatidylinositol transporter activity(GO:0008526) |
| 0.0 | 0.9 | GO:0017080 | sodium channel regulator activity(GO:0017080) |
| 0.0 | 0.1 | GO:0070569 | uridylyltransferase activity(GO:0070569) |
| 0.0 | 0.1 | GO:0048495 | Roundabout binding(GO:0048495) |
| 0.0 | 0.6 | GO:0003950 | NAD+ ADP-ribosyltransferase activity(GO:0003950) |
| 0.0 | 1.0 | GO:0043826 | N-ethylmaleimide reductase activity(GO:0008748) reduced coenzyme F420 dehydrogenase activity(GO:0043738) sulfur oxygenase reductase activity(GO:0043826) malolactic enzyme activity(GO:0043883) epoxyqueuosine reductase activity(GO:0052693) |
| 0.0 | 0.2 | GO:0004499 | N,N-dimethylaniline monooxygenase activity(GO:0004499) |
| 0.0 | 0.1 | GO:0005095 | GTPase inhibitor activity(GO:0005095) |
| 0.0 | 0.4 | GO:1990841 | promoter-specific chromatin binding(GO:1990841) |
| 0.0 | 0.2 | GO:0001849 | complement component C1q binding(GO:0001849) |
| 0.0 | 0.1 | GO:0086008 | voltage-gated potassium channel activity involved in cardiac muscle cell action potential repolarization(GO:0086008) |
| 0.0 | 0.1 | GO:0047623 | AMP deaminase activity(GO:0003876) adenosine-phosphate deaminase activity(GO:0047623) |
| 0.0 | 0.5 | GO:0016864 | protein disulfide isomerase activity(GO:0003756) intramolecular oxidoreductase activity, transposing S-S bonds(GO:0016864) |
| 0.0 | 0.3 | GO:0017154 | semaphorin receptor activity(GO:0017154) |
| 0.0 | 0.1 | GO:0005157 | macrophage colony-stimulating factor receptor binding(GO:0005157) |
| 0.0 | 0.1 | GO:0030345 | extracellular matrix structural constituent conferring compression resistance(GO:0030021) structural constituent of tooth enamel(GO:0030345) |
| 0.0 | 0.2 | GO:0016934 | extracellular-glycine-gated ion channel activity(GO:0016933) extracellular-glycine-gated chloride channel activity(GO:0016934) |
| 0.0 | 0.1 | GO:0005329 | dopamine transmembrane transporter activity(GO:0005329) |
| 0.0 | 0.1 | GO:0098821 | BMP receptor activity(GO:0098821) |
| 0.0 | 0.2 | GO:0004908 | interleukin-1 receptor activity(GO:0004908) |
| 0.0 | 0.3 | GO:0004711 | ribosomal protein S6 kinase activity(GO:0004711) |
| 0.0 | 0.6 | GO:0005031 | tumor necrosis factor-activated receptor activity(GO:0005031) death receptor activity(GO:0005035) |
| 0.0 | 0.1 | GO:0008147 | structural constituent of bone(GO:0008147) |
| 0.0 | 0.5 | GO:0051428 | peptide hormone receptor binding(GO:0051428) |
| 0.0 | 0.1 | GO:1901612 | cardiolipin binding(GO:1901612) |
| 0.0 | 0.1 | GO:0043522 | leucine zipper domain binding(GO:0043522) |
| 0.0 | 0.1 | GO:1990932 | 5.8S rRNA binding(GO:1990932) |
| 0.0 | 0.2 | GO:0004596 | peptide alpha-N-acetyltransferase activity(GO:0004596) |
| 0.0 | 0.1 | GO:0048030 | disaccharide binding(GO:0048030) |
| 0.0 | 0.2 | GO:0004708 | MAP kinase kinase activity(GO:0004708) |
| 0.0 | 0.1 | GO:0015222 | serotonin transmembrane transporter activity(GO:0015222) |
| 0.0 | 0.2 | GO:0047555 | 3',5'-cyclic-GMP phosphodiesterase activity(GO:0047555) |
| 0.0 | 0.4 | GO:0005328 | neurotransmitter:sodium symporter activity(GO:0005328) |
| 0.0 | 0.0 | GO:0035651 | AP-3 adaptor complex binding(GO:0035651) |
| 0.0 | 0.1 | GO:0004969 | histamine receptor activity(GO:0004969) |
| 0.0 | 0.1 | GO:0031750 | D3 dopamine receptor binding(GO:0031750) |
| 0.0 | 0.1 | GO:0003910 | DNA ligase activity(GO:0003909) DNA ligase (ATP) activity(GO:0003910) |
| 0.0 | 0.7 | GO:0042169 | SH2 domain binding(GO:0042169) |
| 0.0 | 0.4 | GO:0031404 | chloride ion binding(GO:0031404) |
| 0.0 | 0.6 | GO:0016709 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, NAD(P)H as one donor, and incorporation of one atom of oxygen(GO:0016709) |
| 0.0 | 0.1 | GO:0030375 | thyroid hormone receptor coactivator activity(GO:0030375) |
| 0.0 | 0.1 | GO:0015187 | glycine transmembrane transporter activity(GO:0015187) |
| 0.0 | 0.1 | GO:0005502 | 11-cis retinal binding(GO:0005502) |
| 0.0 | 0.2 | GO:0016668 | oxidoreductase activity, acting on a sulfur group of donors, NAD(P) as acceptor(GO:0016668) |
| 0.0 | 0.0 | GO:0031735 | CCR10 chemokine receptor binding(GO:0031735) |
| 0.0 | 0.3 | GO:0035255 | ionotropic glutamate receptor binding(GO:0035255) |
| 0.0 | 0.2 | GO:0008179 | adenylate cyclase binding(GO:0008179) |
| 0.0 | 0.4 | GO:0017128 | phospholipid scramblase activity(GO:0017128) |
| 0.0 | 0.1 | GO:0046974 | histone methyltransferase activity (H3-K9 specific)(GO:0046974) |
| 0.0 | 0.0 | GO:0034056 | estrogen response element binding(GO:0034056) |
| 0.0 | 0.1 | GO:0004035 | alkaline phosphatase activity(GO:0004035) |
| 0.0 | 0.1 | GO:0015349 | thyroid hormone transmembrane transporter activity(GO:0015349) |
| 0.0 | 0.0 | GO:0008271 | secondary active sulfate transmembrane transporter activity(GO:0008271) |
| 0.0 | 0.0 | GO:0015038 | glutathione disulfide oxidoreductase activity(GO:0015038) |
| 0.0 | 0.2 | GO:0002151 | G-quadruplex RNA binding(GO:0002151) |
| 0.0 | 0.4 | GO:0004712 | protein serine/threonine/tyrosine kinase activity(GO:0004712) |
| 0.0 | 0.1 | GO:0032052 | bile acid binding(GO:0032052) |
| 0.0 | 0.1 | GO:0008309 | double-stranded DNA exodeoxyribonuclease activity(GO:0008309) |
| 0.0 | 0.1 | GO:0005143 | interleukin-12 receptor binding(GO:0005143) |
| 0.0 | 0.1 | GO:0004634 | phosphopyruvate hydratase activity(GO:0004634) |
| 0.0 | 0.1 | GO:0004946 | bombesin receptor activity(GO:0004946) |
| 0.0 | 0.1 | GO:0005499 | vitamin D binding(GO:0005499) |
| 0.0 | 0.0 | GO:0016428 | tRNA (cytosine) methyltransferase activity(GO:0016427) tRNA (cytosine-5-)-methyltransferase activity(GO:0016428) |
| 0.0 | 0.1 | GO:0005000 | vasopressin receptor activity(GO:0005000) |
| 0.0 | 0.1 | GO:0008503 | benzodiazepine receptor activity(GO:0008503) |
| 0.0 | 0.3 | GO:0042813 | Wnt-activated receptor activity(GO:0042813) |
| 0.0 | 0.1 | GO:0015232 | heme transporter activity(GO:0015232) |
| 0.0 | 0.1 | GO:0052758 | 4-methyloctanoyl-CoA dehydrogenase activity(GO:0034580) naphthyl-2-methyl-succinyl-CoA dehydrogenase activity(GO:0034845) 2-methylhexanoyl-CoA dehydrogenase activity(GO:0034916) propionyl-CoA dehydrogenase activity(GO:0043820) thiol-driven fumarate reductase activity(GO:0043830) coenzyme F420-dependent 2,4,6-trinitrophenol reductase activity(GO:0052758) coenzyme F420-dependent 2,4,6-trinitrophenol hydride reductase activity(GO:0052759) coenzyme F420-dependent 2,4-dinitrophenol reductase activity(GO:0052760) |
| 0.0 | 0.1 | GO:0051400 | BH domain binding(GO:0051400) |
| 0.0 | 0.1 | GO:0008479 | queuine tRNA-ribosyltransferase activity(GO:0008479) |
| 0.0 | 0.0 | GO:0030519 | snoRNP binding(GO:0030519) |
| 0.0 | 0.1 | GO:0030943 | mitochondrion targeting sequence binding(GO:0030943) |
| 0.0 | 0.1 | GO:0004724 | magnesium-dependent protein serine/threonine phosphatase activity(GO:0004724) |
| 0.0 | 5.1 | GO:0001228 | transcriptional activator activity, RNA polymerase II transcription regulatory region sequence-specific binding(GO:0001228) |
| 0.0 | 0.5 | GO:0051539 | 4 iron, 4 sulfur cluster binding(GO:0051539) |
| 0.0 | 0.4 | GO:0034596 | phosphatidylinositol phosphate 4-phosphatase activity(GO:0034596) |
| 0.0 | 0.1 | GO:0003847 | 1-alkyl-2-acetylglycerophosphocholine esterase activity(GO:0003847) |
| 0.0 | 0.0 | GO:0070573 | metallodipeptidase activity(GO:0070573) |
| 0.0 | 0.1 | GO:0004563 | beta-N-acetylhexosaminidase activity(GO:0004563) |
| 0.0 | 0.0 | GO:0004980 | melanocyte-stimulating hormone receptor activity(GO:0004980) |
| 0.0 | 0.0 | GO:0019958 | C-X-C chemokine binding(GO:0019958) |
| 0.0 | 0.0 | GO:0015211 | purine nucleoside transmembrane transporter activity(GO:0015211) |
| 0.0 | 0.0 | GO:0019870 | potassium channel inhibitor activity(GO:0019870) |
| 0.0 | 0.5 | GO:0016859 | cis-trans isomerase activity(GO:0016859) |
| 0.0 | 0.1 | GO:0015180 | L-alanine transmembrane transporter activity(GO:0015180) alanine transmembrane transporter activity(GO:0022858) |
| 0.0 | 0.7 | GO:0043765 | integrase activity(GO:0008907) T/G mismatch-specific endonuclease activity(GO:0043765) retroviral integrase activity(GO:0044823) retroviral 3' processing activity(GO:0044824) |
| 0.0 | 0.1 | GO:0000774 | adenyl-nucleotide exchange factor activity(GO:0000774) |
| 0.0 | 0.0 | GO:0070052 | collagen V binding(GO:0070052) |
| 0.0 | 0.0 | GO:0017153 | sodium:dicarboxylate symporter activity(GO:0017153) |
| 0.0 | 0.1 | GO:0019957 | C-C chemokine binding(GO:0019957) |
| 0.0 | 0.2 | GO:0043274 | phospholipase binding(GO:0043274) |
| 0.0 | 0.1 | GO:0004046 | aminoacylase activity(GO:0004046) |
| 0.0 | 0.0 | GO:0008184 | glycogen phosphorylase activity(GO:0008184) |
| 0.0 | 0.0 | GO:0043262 | adenosine-diphosphatase activity(GO:0043262) |
| 0.0 | 0.0 | GO:1990226 | histone methyltransferase binding(GO:1990226) |
| 0.0 | 0.0 | GO:0070991 | medium-chain-acyl-CoA dehydrogenase activity(GO:0070991) |
| 0.0 | 0.0 | GO:0003986 | acetyl-CoA hydrolase activity(GO:0003986) |
| 0.0 | 0.1 | GO:0003720 | telomerase activity(GO:0003720) RNA-directed DNA polymerase activity(GO:0003964) |
| 0.0 | 0.1 | GO:0004031 | aldehyde oxidase activity(GO:0004031) oxidoreductase activity, acting on the aldehyde or oxo group of donors, oxygen as acceptor(GO:0016623) |
| 0.0 | 0.1 | GO:0052796 | exo-alpha-sialidase activity(GO:0004308) alpha-sialidase activity(GO:0016997) exo-alpha-(2->3)-sialidase activity(GO:0052794) exo-alpha-(2->6)-sialidase activity(GO:0052795) exo-alpha-(2->8)-sialidase activity(GO:0052796) |
| 0.0 | 0.0 | GO:0047023 | androsterone dehydrogenase activity(GO:0047023) |
| 0.0 | 0.1 | GO:0031432 | titin binding(GO:0031432) |
| 0.0 | 0.0 | GO:0031433 | telethonin binding(GO:0031433) |
| 0.0 | 0.4 | GO:0033038 | bitter taste receptor activity(GO:0033038) |
| 0.0 | 0.5 | GO:0005546 | phosphatidylinositol-4,5-bisphosphate binding(GO:0005546) |
| 0.0 | 0.3 | GO:0001540 | beta-amyloid binding(GO:0001540) |
| 0.0 | 0.4 | GO:0050694 | galactose 3-O-sulfotransferase activity(GO:0050694) |
| 0.0 | 0.1 | GO:0004767 | sphingomyelin phosphodiesterase activity(GO:0004767) |
| 0.0 | 0.0 | GO:0097603 | temperature-gated ion channel activity(GO:0097603) |
| 0.0 | 0.0 | GO:0019767 | IgE receptor activity(GO:0019767) |
| 0.0 | 0.0 | GO:0051033 | nucleic acid transmembrane transporter activity(GO:0051032) RNA transmembrane transporter activity(GO:0051033) |
| 0.0 | 0.0 | GO:0004667 | prostaglandin-D synthase activity(GO:0004667) |
| 0.0 | 0.0 | GO:0050816 | phosphothreonine binding(GO:0050816) |
| 0.0 | 0.0 | GO:0001640 | adenylate cyclase inhibiting G-protein coupled glutamate receptor activity(GO:0001640) |
| 0.0 | 0.0 | GO:0004065 | arylsulfatase activity(GO:0004065) |
| 0.0 | 0.0 | GO:0097493 | structural molecule activity conferring elasticity(GO:0097493) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.2 | 1.9 | PID ALK2 PATHWAY | ALK2 signaling events |
| 0.1 | 1.0 | SA FAS SIGNALING | The TNF-type receptor Fas induces apoptosis on ligand binding. |
| 0.1 | 2.4 | PID ECADHERIN KERATINOCYTE PATHWAY | E-cadherin signaling in keratinocytes |
| 0.1 | 0.5 | PID ERBB4 PATHWAY | ErbB4 signaling events |
| 0.1 | 1.9 | ST WNT CA2 CYCLIC GMP PATHWAY | Wnt/Ca2+/cyclic GMP signaling. |
| 0.1 | 0.9 | PID EPHA2 FWD PATHWAY | EPHA2 forward signaling |
| 0.1 | 3.3 | PID EPHB FWD PATHWAY | EPHB forward signaling |
| 0.1 | 2.8 | PID INTEGRIN A4B1 PATHWAY | Alpha4 beta1 integrin signaling events |
| 0.1 | 2.3 | PID INTEGRIN2 PATHWAY | Beta2 integrin cell surface interactions |
| 0.1 | 0.1 | PID IL2 STAT5 PATHWAY | IL2 signaling events mediated by STAT5 |
| 0.1 | 1.0 | PID ERBB NETWORK PATHWAY | ErbB receptor signaling network |
| 0.1 | 1.2 | ST G ALPHA I PATHWAY | G alpha i Pathway |
| 0.1 | 0.6 | PID INTEGRIN4 PATHWAY | Alpha6 beta4 integrin-ligand interactions |
| 0.1 | 2.2 | PID PS1 PATHWAY | Presenilin action in Notch and Wnt signaling |
| 0.0 | 0.1 | SA G1 AND S PHASES | Cdk2, 4, and 6 bind cyclin D in G1, while cdk2/cyclin E promotes the G1/S transition. |
| 0.0 | 2.7 | PID BETA CATENIN NUC PATHWAY | Regulation of nuclear beta catenin signaling and target gene transcription |
| 0.0 | 1.4 | PID LKB1 PATHWAY | LKB1 signaling events |
| 0.0 | 5.6 | NABA ECM AFFILIATED | Genes encoding proteins affiliated structurally or functionally to extracellular matrix proteins |
| 0.0 | 0.3 | PID RANBP2 PATHWAY | Sumoylation by RanBP2 regulates transcriptional repression |
| 0.0 | 0.8 | ST PHOSPHOINOSITIDE 3 KINASE PATHWAY | PI3K Pathway |
| 0.0 | 0.6 | ST GRANULE CELL SURVIVAL PATHWAY | Granule Cell Survival Pathway is a specific case of more general PAC1 Receptor Pathway. |
| 0.0 | 0.2 | PID KIT PATHWAY | Signaling events mediated by Stem cell factor receptor (c-Kit) |
| 0.0 | 0.2 | ST ADRENERGIC | Adrenergic Pathway |
| 0.0 | 0.7 | PID MAPK TRK PATHWAY | Trk receptor signaling mediated by the MAPK pathway |
| 0.0 | 0.1 | PID IL8 CXCR2 PATHWAY | IL8- and CXCR2-mediated signaling events |
| 0.0 | 0.5 | PID CASPASE PATHWAY | Caspase cascade in apoptosis |
| 0.0 | 0.0 | PID PI3KCI AKT PATHWAY | Class I PI3K signaling events mediated by Akt |
| 0.0 | 0.3 | PID NETRIN PATHWAY | Netrin-mediated signaling events |
| 0.0 | 0.1 | PID RETINOIC ACID PATHWAY | Retinoic acid receptors-mediated signaling |
| 0.0 | 0.2 | PID WNT CANONICAL PATHWAY | Canonical Wnt signaling pathway |
| 0.0 | 0.1 | SIG PIP3 SIGNALING IN B LYMPHOCYTES | Genes related to PIP3 signaling in B lymphocytes |
| 0.0 | 0.1 | PID TCR RAS PATHWAY | Ras signaling in the CD4+ TCR pathway |
| 0.0 | 0.0 | SA B CELL RECEPTOR COMPLEXES | Antigen binding to B cell receptors activates protein tyrosine kinases, such as the Src family, which ultimate activate MAP kinases. |
| 0.0 | 0.1 | SA PROGRAMMED CELL DEATH | Programmed cell death, or apoptosis, eliminates damaged or unneeded cells. |
| 0.0 | 0.4 | PID ILK PATHWAY | Integrin-linked kinase signaling |
| 0.0 | 0.1 | PID HIF2PATHWAY | HIF-2-alpha transcription factor network |
| 0.0 | 0.2 | PID MYC PATHWAY | C-MYC pathway |
| 0.0 | 0.1 | PID AURORA A PATHWAY | Aurora A signaling |
| 0.0 | 0.3 | PID RHODOPSIN PATHWAY | Visual signal transduction: Rods |
| 0.0 | 0.2 | PID FGF PATHWAY | FGF signaling pathway |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.5 | 8.1 | REACTOME UNBLOCKING OF NMDA RECEPTOR GLUTAMATE BINDING AND ACTIVATION | Genes involved in Unblocking of NMDA receptor, glutamate binding and activation |
| 0.4 | 2.7 | REACTOME CREATION OF C4 AND C2 ACTIVATORS | Genes involved in Creation of C4 and C2 activators |
| 0.4 | 7.0 | REACTOME NEPHRIN INTERACTIONS | Genes involved in Nephrin interactions |
| 0.3 | 7.3 | REACTOME A TETRASACCHARIDE LINKER SEQUENCE IS REQUIRED FOR GAG SYNTHESIS | Genes involved in A tetrasaccharide linker sequence is required for GAG synthesis |
| 0.3 | 3.7 | REACTOME CRMPS IN SEMA3A SIGNALING | Genes involved in CRMPs in Sema3A signaling |
| 0.3 | 7.4 | REACTOME MYOGENESIS | Genes involved in Myogenesis |
| 0.2 | 2.0 | REACTOME DSCAM INTERACTIONS | Genes involved in DSCAM interactions |
| 0.2 | 1.9 | REACTOME GAP JUNCTION DEGRADATION | Genes involved in Gap junction degradation |
| 0.2 | 3.2 | REACTOME PKA MEDIATED PHOSPHORYLATION OF CREB | Genes involved in PKA-mediated phosphorylation of CREB |
| 0.2 | 1.8 | REACTOME BASE FREE SUGAR PHOSPHATE REMOVAL VIA THE SINGLE NUCLEOTIDE REPLACEMENT PATHWAY | Genes involved in Base-free sugar-phosphate removal via the single-nucleotide replacement pathway |
| 0.1 | 0.9 | REACTOME DCC MEDIATED ATTRACTIVE SIGNALING | Genes involved in DCC mediated attractive signaling |
| 0.1 | 3.1 | REACTOME PTM GAMMA CARBOXYLATION HYPUSINE FORMATION AND ARYLSULFATASE ACTIVATION | Genes involved in PTM: gamma carboxylation, hypusine formation and arylsulfatase activation |
| 0.1 | 1.6 | REACTOME SYNTHESIS OF PIPS AT THE EARLY ENDOSOME MEMBRANE | Genes involved in Synthesis of PIPs at the early endosome membrane |
| 0.1 | 1.4 | REACTOME BILE SALT AND ORGANIC ANION SLC TRANSPORTERS | Genes involved in Bile salt and organic anion SLC transporters |
| 0.1 | 0.9 | REACTOME SIGNAL REGULATORY PROTEIN SIRP FAMILY INTERACTIONS | Genes involved in Signal regulatory protein (SIRP) family interactions |
| 0.1 | 4.8 | REACTOME VOLTAGE GATED POTASSIUM CHANNELS | Genes involved in Voltage gated Potassium channels |
| 0.1 | 1.9 | REACTOME GABA SYNTHESIS RELEASE REUPTAKE AND DEGRADATION | Genes involved in GABA synthesis, release, reuptake and degradation |
| 0.1 | 1.0 | REACTOME PROLACTIN RECEPTOR SIGNALING | Genes involved in Prolactin receptor signaling |
| 0.1 | 0.4 | REACTOME DOPAMINE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Dopamine Neurotransmitter Release Cycle |
| 0.1 | 0.3 | REACTOME DAG AND IP3 SIGNALING | Genes involved in DAG and IP3 signaling |
| 0.1 | 1.1 | REACTOME TRAF6 MEDIATED INDUCTION OF TAK1 COMPLEX | Genes involved in TRAF6 mediated induction of TAK1 complex |
| 0.1 | 1.2 | REACTOME SIGNALING BY NOTCH4 | Genes involved in Signaling by NOTCH4 |
| 0.1 | 0.9 | REACTOME RECRUITMENT OF NUMA TO MITOTIC CENTROSOMES | Genes involved in Recruitment of NuMA to mitotic centrosomes |
| 0.1 | 1.2 | REACTOME INFLAMMASOMES | Genes involved in Inflammasomes |
| 0.1 | 0.9 | REACTOME IONOTROPIC ACTIVITY OF KAINATE RECEPTORS | Genes involved in Ionotropic activity of Kainate Receptors |
| 0.1 | 0.7 | REACTOME DOWNREGULATION OF ERBB2 ERBB3 SIGNALING | Genes involved in Downregulation of ERBB2:ERBB3 signaling |
| 0.1 | 0.3 | REACTOME NEGATIVE REGULATION OF THE PI3K AKT NETWORK | Genes involved in Negative regulation of the PI3K/AKT network |
| 0.1 | 1.2 | REACTOME GAP JUNCTION ASSEMBLY | Genes involved in Gap junction assembly |
| 0.1 | 0.6 | REACTOME CA DEPENDENT EVENTS | Genes involved in Ca-dependent events |
| 0.1 | 1.4 | REACTOME REGULATION OF GENE EXPRESSION IN BETA CELLS | Genes involved in Regulation of gene expression in beta cells |
| 0.1 | 0.9 | REACTOME OTHER SEMAPHORIN INTERACTIONS | Genes involved in Other semaphorin interactions |
| 0.1 | 1.0 | REACTOME N GLYCAN ANTENNAE ELONGATION | Genes involved in N-Glycan antennae elongation |
| 0.1 | 0.1 | REACTOME SIGNALING BY FGFR3 MUTANTS | Genes involved in Signaling by FGFR3 mutants |
| 0.1 | 1.0 | REACTOME CLASS C 3 METABOTROPIC GLUTAMATE PHEROMONE RECEPTORS | Genes involved in Class C/3 (Metabotropic glutamate/pheromone receptors) |
| 0.1 | 0.3 | REACTOME SYNTHESIS OF PC | Genes involved in Synthesis of PC |
| 0.1 | 0.9 | REACTOME POL SWITCHING | Genes involved in Polymerase switching |
| 0.1 | 0.1 | REACTOME IL 7 SIGNALING | Genes involved in Interleukin-7 signaling |
| 0.1 | 0.9 | REACTOME AMINO ACID SYNTHESIS AND INTERCONVERSION TRANSAMINATION | Genes involved in Amino acid synthesis and interconversion (transamination) |
| 0.1 | 0.1 | REACTOME ANTIGEN PRESENTATION FOLDING ASSEMBLY AND PEPTIDE LOADING OF CLASS I MHC | Genes involved in Antigen Presentation: Folding, assembly and peptide loading of class I MHC |
| 0.1 | 0.5 | REACTOME E2F ENABLED INHIBITION OF PRE REPLICATION COMPLEX FORMATION | Genes involved in E2F-enabled inhibition of pre-replication complex formation |
| 0.1 | 1.1 | REACTOME ADHERENS JUNCTIONS INTERACTIONS | Genes involved in Adherens junctions interactions |
| 0.1 | 0.6 | REACTOME NOTCH HLH TRANSCRIPTION PATHWAY | Genes involved in Notch-HLH transcription pathway |
| 0.1 | 0.6 | REACTOME CASPASE MEDIATED CLEAVAGE OF CYTOSKELETAL PROTEINS | Genes involved in Caspase-mediated cleavage of cytoskeletal proteins |
| 0.0 | 1.8 | REACTOME NCAM1 INTERACTIONS | Genes involved in NCAM1 interactions |
| 0.0 | 0.4 | REACTOME REGULATION OF BETA CELL DEVELOPMENT | Genes involved in Regulation of beta-cell development |
| 0.0 | 0.5 | REACTOME CREB PHOSPHORYLATION THROUGH THE ACTIVATION OF RAS | Genes involved in CREB phosphorylation through the activation of Ras |
| 0.0 | 0.2 | REACTOME CIRCADIAN REPRESSION OF EXPRESSION BY REV ERBA | Genes involved in Circadian Repression of Expression by REV-ERBA |
| 0.0 | 2.7 | REACTOME CELL SURFACE INTERACTIONS AT THE VASCULAR WALL | Genes involved in Cell surface interactions at the vascular wall |
| 0.0 | 1.6 | REACTOME TRIGLYCERIDE BIOSYNTHESIS | Genes involved in Triglyceride Biosynthesis |
| 0.0 | 1.1 | REACTOME PERK REGULATED GENE EXPRESSION | Genes involved in PERK regulated gene expression |
| 0.0 | 1.9 | REACTOME CELL JUNCTION ORGANIZATION | Genes involved in Cell junction organization |
| 0.0 | 0.3 | REACTOME REGULATION OF INSULIN SECRETION BY GLUCAGON LIKE PEPTIDE1 | Genes involved in Regulation of Insulin Secretion by Glucagon-like Peptide-1 |
| 0.0 | 0.5 | REACTOME GLUCAGON TYPE LIGAND RECEPTORS | Genes involved in Glucagon-type ligand receptors |
| 0.0 | 0.4 | REACTOME AKT PHOSPHORYLATES TARGETS IN THE CYTOSOL | Genes involved in AKT phosphorylates targets in the cytosol |
| 0.0 | 0.6 | REACTOME INTERACTION BETWEEN L1 AND ANKYRINS | Genes involved in Interaction between L1 and Ankyrins |
| 0.0 | 0.2 | REACTOME BETA DEFENSINS | Genes involved in Beta defensins |
| 0.0 | 0.3 | REACTOME MEMBRANE BINDING AND TARGETTING OF GAG PROTEINS | Genes involved in Membrane binding and targetting of GAG proteins |
| 0.0 | 0.7 | REACTOME MITOCHONDRIAL TRNA AMINOACYLATION | Genes involved in Mitochondrial tRNA aminoacylation |
| 0.0 | 0.0 | REACTOME GLUTAMATE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Glutamate Neurotransmitter Release Cycle |
| 0.0 | 0.4 | REACTOME METABOLISM OF NON CODING RNA | Genes involved in Metabolism of non-coding RNA |
| 0.0 | 0.3 | REACTOME HORMONE LIGAND BINDING RECEPTORS | Genes involved in Hormone ligand-binding receptors |
| 0.0 | 1.0 | REACTOME AMINE LIGAND BINDING RECEPTORS | Genes involved in Amine ligand-binding receptors |
| 0.0 | 0.1 | REACTOME ADENYLATE CYCLASE INHIBITORY PATHWAY | Genes involved in Adenylate cyclase inhibitory pathway |
| 0.0 | 0.3 | REACTOME FGFR2C LIGAND BINDING AND ACTIVATION | Genes involved in FGFR2c ligand binding and activation |
| 0.0 | 0.1 | REACTOME SIGNALING BY WNT | Genes involved in Signaling by Wnt |
| 0.0 | 1.2 | REACTOME AUTODEGRADATION OF THE E3 UBIQUITIN LIGASE COP1 | Genes involved in Autodegradation of the E3 ubiquitin ligase COP1 |
| 0.0 | 0.4 | REACTOME PROCESSING OF INTRONLESS PRE MRNAS | Genes involved in Processing of Intronless Pre-mRNAs |
| 0.0 | 0.3 | REACTOME ENOS ACTIVATION AND REGULATION | Genes involved in eNOS activation and regulation |
| 0.0 | 0.0 | REACTOME SYNTHESIS OF PIPS AT THE LATE ENDOSOME MEMBRANE | Genes involved in Synthesis of PIPs at the late endosome membrane |
| 0.0 | 0.4 | REACTOME SYNTHESIS OF GLYCOSYLPHOSPHATIDYLINOSITOL GPI | Genes involved in Synthesis of glycosylphosphatidylinositol (GPI) |
| 0.0 | 0.3 | REACTOME TANDEM PORE DOMAIN POTASSIUM CHANNELS | Genes involved in Tandem pore domain potassium channels |
| 0.0 | 0.1 | REACTOME ETHANOL OXIDATION | Genes involved in Ethanol oxidation |
| 0.0 | 0.3 | REACTOME GABA A RECEPTOR ACTIVATION | Genes involved in GABA A receptor activation |
| 0.0 | 0.1 | REACTOME RECYCLING OF BILE ACIDS AND SALTS | Genes involved in Recycling of bile acids and salts |
| 0.0 | 0.2 | REACTOME ADVANCED GLYCOSYLATION ENDPRODUCT RECEPTOR SIGNALING | Genes involved in Advanced glycosylation endproduct receptor signaling |
| 0.0 | 0.3 | REACTOME MRNA DECAY BY 5 TO 3 EXORIBONUCLEASE | Genes involved in mRNA Decay by 5' to 3' Exoribonuclease |
| 0.0 | 0.1 | REACTOME N GLYCAN ANTENNAE ELONGATION IN THE MEDIAL TRANS GOLGI | Genes involved in N-glycan antennae elongation in the medial/trans-Golgi |
| 0.0 | 0.0 | REACTOME RECEPTOR LIGAND BINDING INITIATES THE SECOND PROTEOLYTIC CLEAVAGE OF NOTCH RECEPTOR | Genes involved in Receptor-ligand binding initiates the second proteolytic cleavage of Notch receptor |
| 0.0 | 0.3 | REACTOME VIRAL MESSENGER RNA SYNTHESIS | Genes involved in Viral Messenger RNA Synthesis |
| 0.0 | 0.2 | REACTOME SIGNALLING BY NGF | Genes involved in Signalling by NGF |
| 0.0 | 0.0 | REACTOME P53 INDEPENDENT G1 S DNA DAMAGE CHECKPOINT | Genes involved in p53-Independent G1/S DNA damage checkpoint |
| 0.0 | 0.2 | REACTOME CYTOSOLIC SULFONATION OF SMALL MOLECULES | Genes involved in Cytosolic sulfonation of small molecules |
| 0.0 | 0.0 | REACTOME ACTIVATION OF CHAPERONE GENES BY ATF6 ALPHA | Genes involved in Activation of Chaperone Genes by ATF6-alpha |
| 0.0 | 0.0 | REACTOME TRANSPORT OF MATURE MRNA DERIVED FROM AN INTRONLESS TRANSCRIPT | Genes involved in Transport of Mature mRNA Derived from an Intronless Transcript |
| 0.0 | 0.1 | REACTOME G PROTEIN ACTIVATION | Genes involved in G-protein activation |
| 0.0 | 0.2 | REACTOME NA CL DEPENDENT NEUROTRANSMITTER TRANSPORTERS | Genes involved in Na+/Cl- dependent neurotransmitter transporters |
| 0.0 | 0.0 | REACTOME APOBEC3G MEDIATED RESISTANCE TO HIV1 INFECTION | Genes involved in APOBEC3G mediated resistance to HIV-1 infection |
| 0.0 | 0.1 | REACTOME REGULATION OF COMPLEMENT CASCADE | Genes involved in Regulation of Complement cascade |
| 0.0 | 0.0 | REACTOME REGULATION OF INSULIN SECRETION BY ACETYLCHOLINE | Genes involved in Regulation of Insulin Secretion by Acetylcholine |
| 0.0 | 0.0 | REACTOME FGFR4 LIGAND BINDING AND ACTIVATION | Genes involved in FGFR4 ligand binding and activation |
| 0.0 | 0.1 | REACTOME RETROGRADE NEUROTROPHIN SIGNALLING | Genes involved in Retrograde neurotrophin signalling |
| 0.0 | 0.1 | REACTOME ER PHAGOSOME PATHWAY | Genes involved in ER-Phagosome pathway |
| 0.0 | 0.1 | REACTOME LIGAND GATED ION CHANNEL TRANSPORT | Genes involved in Ligand-gated ion channel transport |
| 0.0 | 0.3 | REACTOME TRAF6 MEDIATED IRF7 ACTIVATION | Genes involved in TRAF6 mediated IRF7 activation |
| 0.0 | 0.2 | REACTOME CHOLESTEROL BIOSYNTHESIS | Genes involved in Cholesterol biosynthesis |
| 0.0 | 0.1 | REACTOME HIGHLY CALCIUM PERMEABLE POSTSYNAPTIC NICOTINIC ACETYLCHOLINE RECEPTORS | Genes involved in Highly calcium permeable postsynaptic nicotinic acetylcholine receptors |
| 0.0 | 0.1 | REACTOME N GLYCAN TRIMMING IN THE ER AND CALNEXIN CALRETICULIN CYCLE | Genes involved in N-glycan trimming in the ER and Calnexin/Calreticulin cycle |
| 0.0 | 0.1 | REACTOME CS DS DEGRADATION | Genes involved in CS/DS degradation |
| 0.0 | 0.2 | REACTOME DEPOSITION OF NEW CENPA CONTAINING NUCLEOSOMES AT THE CENTROMERE | Genes involved in Deposition of New CENPA-containing Nucleosomes at the Centromere |