Gene Symbol | Gene ID | Gene Info |
---|---|---|
Myb
|
ENSMUSG00000019982.8 | myeloblastosis oncogene |
CRE | Gene | Distance | Association probability | Pearson corr. coef. | P-value | Plot |
---|---|---|---|---|---|---|
Myb | chr10_21159033_21159478 | 1595 | 0.300180 | 0.24 | 7.3e-02 | Click! |
Myb | chr10_21160500_21160889 | 156 | 0.937817 | -0.18 | 2.0e-01 | Click! |
Myb | chr10_21161566_21161742 | 670 | 0.620828 | -0.17 | 2.3e-01 | Click! |
Myb | chr10_21160919_21161123 | 37 | 0.967141 | 0.11 | 4.2e-01 | Click! |
Myb | chr10_21159712_21160107 | 941 | 0.480976 | -0.10 | 4.5e-01 | Click! |
Move your cursor over a bar to see sample name and corresponding Z-value.
Cis Regulatory Element (CRE) | Target Score | Top associated gene | Gene Info | Distance of CRE to TSS | CRE/Gene association probability |
---|---|---|---|---|---|
chr3_51340298_51341882 | 9.97 |
Elf2 |
E74-like factor 2 |
427 |
0.74 |
chr17_35164786_35165560 | 9.53 |
Gm17705 |
predicted gene, 17705 |
54 |
0.72 |
chr16_30453325_30453494 | 9.45 |
Gm49679 |
predicted gene, 49679 |
821 |
0.66 |
chr2_181463028_181463619 | 8.19 |
Zbtb46 |
zinc finger and BTB domain containing 46 |
3897 |
0.13 |
chr12_82225804_82226178 | 7.71 |
Sipa1l1 |
signal-induced proliferation-associated 1 like 1 |
30594 |
0.19 |
chrX_169997850_169998483 | 7.02 |
Gm15247 |
predicted gene 15247 |
11227 |
0.14 |
chr7_103870533_103870999 | 7.01 |
Olfr66 |
olfactory receptor 66 |
11475 |
0.06 |
chr3_103914017_103915242 | 6.72 |
Rsbn1 |
rosbin, round spermatid basic protein 1 |
62 |
0.95 |
chr8_94964791_94965086 | 6.61 |
Gm10286 |
predicted gene 10286 |
4816 |
0.13 |
chr1_77298959_77299132 | 6.46 |
Epha4 |
Eph receptor A4 |
78562 |
0.11 |
chr8_94178954_94179363 | 6.46 |
Mt1 |
metallothionein 1 |
53 |
0.95 |
chrY_90771840_90772811 | 6.28 |
Gm47283 |
predicted gene, 47283 |
12413 |
0.17 |
chr6_120835077_120835250 | 6.21 |
Bcl2l13 |
BCL2-like 13 (apoptosis facilitator) |
1049 |
0.44 |
chr4_108961175_108961348 | 6.01 |
8030443G20Rik |
RIKEN cDNA 8030443G20 gene |
10816 |
0.13 |
chr17_31855866_31856073 | 5.99 |
Sik1 |
salt inducible kinase 1 |
165 |
0.94 |
chr13_119232480_119232644 | 5.82 |
Gm44488 |
predicted gene, 44488 |
37042 |
0.17 |
chr15_79690079_79691459 | 5.56 |
Gtpbp1 |
GTP binding protein 1 |
76 |
0.92 |
chr9_48340771_48341057 | 5.51 |
Nxpe2 |
neurexophilin and PC-esterase domain family, member 2 |
16 |
0.98 |
chr5_44203445_44203962 | 5.51 |
Tapt1 |
transmembrane anterior posterior transformation 1 |
640 |
0.58 |
chr5_134919074_134919381 | 5.48 |
4933439J24Rik |
RIKEN cDNA 4933439J24 gene |
561 |
0.47 |
chr11_87755415_87755594 | 5.47 |
Mir142hg |
Mir142 host gene (non-protein coding) |
73 |
0.91 |
chr18_36440342_36440531 | 5.44 |
Pfdn1 |
prefoldin 1 |
10808 |
0.18 |
chr5_140034121_140034770 | 5.43 |
Gm43702 |
predicted gene 43702 |
2269 |
0.28 |
chr15_98606348_98606519 | 5.41 |
Adcy6 |
adenylate cyclase 6 |
1200 |
0.28 |
chr3_127930366_127930648 | 5.31 |
9830132P13Rik |
RIKEN cDNA 9830132P13 gene |
14335 |
0.14 |
chr1_90289239_90289505 | 5.29 |
Gm28723 |
predicted gene 28723 |
8914 |
0.18 |
chr17_70850487_70852089 | 5.28 |
Tgif1 |
TGFB-induced factor homeobox 1 |
81 |
0.94 |
chr10_127508848_127510720 | 5.28 |
Stac3 |
SH3 and cysteine rich domain 3 |
2559 |
0.15 |
chr7_90046913_90047179 | 5.25 |
Gm44861 |
predicted gene 44861 |
4349 |
0.15 |
chr8_122329580_122330425 | 5.22 |
Zfpm1 |
zinc finger protein, multitype 1 |
3696 |
0.15 |
chr10_40149754_40150093 | 5.22 |
Slc16a10 |
solute carrier family 16 (monocarboxylic acid transporters), member 10 |
7665 |
0.13 |
chr7_16815354_16816404 | 5.18 |
Strn4 |
striatin, calmodulin binding protein 4 |
10 |
0.69 |
chr18_67436617_67436802 | 5.16 |
Afg3l2 |
AFG3-like AAA ATPase 2 |
761 |
0.59 |
chrX_143011915_143012211 | 5.01 |
Ammecr1 |
Alport syndrome, mental retardation, midface hypoplasia and elliptocytosis chromosomal region gene 1 |
45335 |
0.15 |
chrX_123721926_123722462 | 4.91 |
Rps12-ps23 |
ribosomal protein S12, pseudogene 23 |
13617 |
0.18 |
chr15_100599610_100600576 | 4.85 |
Pou6f1 |
POU domain, class 6, transcription factor 1 |
109 |
0.48 |
chr14_61098417_61098582 | 4.84 |
Gm41168 |
predicted gene, 41168 |
35072 |
0.15 |
chr11_101010467_101010728 | 4.83 |
Atp6v0a1 |
ATPase, H+ transporting, lysosomal V0 subunit A1 |
60 |
0.96 |
chr1_170622997_170623376 | 4.80 |
Gm7299 |
predicted gene 7299 |
7735 |
0.19 |
chrX_123943434_123943951 | 4.79 |
Rps12-ps20 |
ribosomal protein S12, pseudogene 20 |
13582 |
0.23 |
chr6_134526304_134526459 | 4.78 |
Lrp6 |
low density lipoprotein receptor-related protein 6 |
15333 |
0.19 |
chr10_80819008_80819174 | 4.78 |
Jsrp1 |
junctional sarcoplasmic reticulum protein 1 |
5593 |
0.07 |
chr10_41204721_41204894 | 4.75 |
Gm25526 |
predicted gene, 25526 |
11238 |
0.2 |
chr12_55051961_55052112 | 4.74 |
2700097O09Rik |
RIKEN cDNA 2700097O09 gene |
2065 |
0.2 |
chrX_123271195_123271712 | 4.74 |
Rps12-ps21 |
ribosomal protein S12, pseudogene 22 |
13591 |
0.15 |
chr9_111057150_111057866 | 4.73 |
Ccrl2 |
chemokine (C-C motif) receptor-like 2 |
11 |
0.95 |
chr18_35848127_35849279 | 4.72 |
Cxxc5 |
CXXC finger 5 |
5984 |
0.11 |
chr8_88288608_88288781 | 4.71 |
Adcy7 |
adenylate cyclase 7 |
453 |
0.83 |
chr2_127371583_127371781 | 4.71 |
Adra2b |
adrenergic receptor, alpha 2b |
8396 |
0.14 |
chr8_70201578_70201745 | 4.70 |
Slc25a42 |
solute carrier family 25, member 42 |
10595 |
0.1 |
chr4_98190095_98190255 | 4.67 |
Gm12691 |
predicted gene 12691 |
39914 |
0.15 |
chr11_97424148_97424313 | 4.66 |
Arhgap23 |
Rho GTPase activating protein 23 |
8697 |
0.16 |
chr7_90060698_90060890 | 4.66 |
Gm44861 |
predicted gene 44861 |
18097 |
0.12 |
chr18_67573555_67573723 | 4.65 |
Gm17669 |
predicted gene, 17669 |
11245 |
0.17 |
chr14_74672532_74672729 | 4.64 |
Htr2a |
5-hydroxytryptamine (serotonin) receptor 2A |
31790 |
0.17 |
chrX_123500550_123501093 | 4.63 |
Rps12-ps22 |
ribosomal protein S12, pseudogene 22 |
13606 |
0.18 |
chr2_155989219_155989379 | 4.60 |
Cep250 |
centrosomal protein 250 |
3384 |
0.13 |
chr6_72384008_72384159 | 4.45 |
Vamp5 |
vesicle-associated membrane protein 5 |
3615 |
0.12 |
chr11_87726236_87726559 | 4.44 |
Rnf43 |
ring finger protein 43 |
1029 |
0.34 |
chr11_98904631_98904915 | 4.42 |
Cdc6 |
cell division cycle 6 |
3028 |
0.15 |
chr8_107437145_107437413 | 4.36 |
Wwp2 |
WW domain containing E3 ubiquitin protein ligase 2 |
863 |
0.47 |
chr10_21196984_21197164 | 4.36 |
Gm40608 |
predicted gene, 40608 |
7892 |
0.15 |
chr2_35419345_35419505 | 4.35 |
Ggta1 |
glycoprotein galactosyltransferase alpha 1, 3 |
3902 |
0.16 |
chr13_47111196_47111529 | 4.35 |
1700026N04Rik |
RIKEN cDNA 1700026N04 gene |
4943 |
0.13 |
chr15_103258381_103258750 | 4.33 |
Nfe2 |
nuclear factor, erythroid derived 2 |
162 |
0.91 |
chr12_53832616_53832787 | 4.30 |
1700060O08Rik |
RIKEN cDNA 1700060O08 gene |
246691 |
0.02 |
chr16_93131459_93131748 | 4.30 |
Gm28003 |
predicted gene, 28003 |
58848 |
0.15 |
chr5_103737363_103737552 | 4.27 |
Aff1 |
AF4/FMR2 family, member 1 |
16705 |
0.19 |
chr14_75837044_75838069 | 4.25 |
Gm48931 |
predicted gene, 48931 |
3930 |
0.16 |
chr10_83019507_83019831 | 4.25 |
Gm10773 |
predicted gene 10773 |
12026 |
0.19 |
chr18_67244577_67244732 | 4.24 |
Mppe1 |
metallophosphoesterase 1 |
623 |
0.67 |
chr15_77773673_77773864 | 4.22 |
Myh9 |
myosin, heavy polypeptide 9, non-muscle |
3989 |
0.14 |
chr4_134868763_134868927 | 4.22 |
Rhd |
Rh blood group, D antigen |
4309 |
0.19 |
chr19_53941166_53941437 | 4.19 |
Bbip1 |
BBSome interacting protein 1 |
2879 |
0.18 |
chr3_79580298_79580474 | 4.16 |
Gm35067 |
predicted gene, 35067 |
2202 |
0.19 |
chr19_44394817_44395182 | 4.15 |
Scd1 |
stearoyl-Coenzyme A desaturase 1 |
11691 |
0.14 |
chr6_148603015_148603196 | 4.14 |
Gm6313 |
predicted gene 6313 |
6628 |
0.21 |
chr6_28261574_28261781 | 4.14 |
Zfp800 |
zinc finger protein 800 |
234 |
0.92 |
chr9_64049851_64050017 | 4.14 |
Gm25606 |
predicted gene, 25606 |
1438 |
0.31 |
chr3_121474804_121475157 | 4.13 |
Slc44a3 |
solute carrier family 44, member 3 |
14069 |
0.15 |
chr4_44004263_44004437 | 4.12 |
Clta |
clathrin, light polypeptide (Lca) |
102 |
0.96 |
chr5_143060004_143060309 | 4.12 |
Gm43380 |
predicted gene 43380 |
7497 |
0.14 |
chr10_43625165_43625386 | 4.10 |
F930017D23Rik |
RIKEN cDNA F930017D23 gene |
1528 |
0.3 |
chr2_32464470_32464843 | 4.09 |
Slc25a25 |
solute carrier family 25 (mitochondrial carrier, phosphate carrier), member 25 |
13211 |
0.1 |
chr6_5155896_5156279 | 4.08 |
Pon1 |
paraoxonase 1 |
37676 |
0.14 |
chr14_76883939_76884187 | 4.08 |
Gm48969 |
predicted gene, 48969 |
22492 |
0.19 |
chr1_9776843_9777025 | 4.06 |
1700034P13Rik |
RIKEN cDNA 1700034P13 gene |
6844 |
0.14 |
chr6_73232363_73232587 | 4.04 |
Gm40377 |
predicted gene, 40377 |
9425 |
0.17 |
chr13_97743450_97743616 | 4.03 |
5330416C01Rik |
RIKEN cDNA 5330416C01 gene |
412 |
0.81 |
chr12_111443494_111443821 | 4.03 |
Tnfaip2 |
tumor necrosis factor, alpha-induced protein 2 |
667 |
0.58 |
chr19_8928158_8928320 | 4.01 |
Rom1 |
rod outer segment membrane protein 1 |
1117 |
0.18 |
chr11_48855844_48857180 | 4.01 |
Gm16170 |
predicted gene 16170 |
3019 |
0.13 |
chr6_86130065_86130447 | 3.99 |
Gm19596 |
predicted gene, 19596 |
16896 |
0.14 |
chr5_73364240_73364406 | 3.98 |
Gm34583 |
predicted gene, 34583 |
16237 |
0.11 |
chr19_32237388_32237555 | 3.98 |
Sgms1 |
sphingomyelin synthase 1 |
1341 |
0.5 |
chr18_63708478_63709360 | 3.98 |
Txnl1 |
thioredoxin-like 1 |
118 |
0.62 |
chr3_152114756_152115116 | 3.97 |
Gipc2 |
GIPC PDZ domain containing family, member 2 |
6414 |
0.15 |
chr6_35254594_35254965 | 3.97 |
1810058I24Rik |
RIKEN cDNA 1810058I24 gene |
2047 |
0.26 |
chr11_51840799_51841003 | 3.96 |
Jade2 |
jade family PHD finger 2 |
16224 |
0.17 |
chr16_36891556_36891720 | 3.96 |
Gm49600 |
predicted gene, 49600 |
2756 |
0.14 |
chr19_11727383_11727597 | 3.95 |
Cblif |
cobalamin binding intrinsic factor |
20064 |
0.08 |
chr11_97440036_97440725 | 3.93 |
Arhgap23 |
Rho GTPase activating protein 23 |
4095 |
0.19 |
chr1_131138172_131138687 | 3.92 |
Dyrk3 |
dual-specificity tyrosine-(Y)-phosphorylation regulated kinase 3 |
89 |
0.96 |
chr13_24419481_24419859 | 3.91 |
Cmah |
cytidine monophospho-N-acetylneuraminic acid hydroxylase |
2446 |
0.22 |
chr7_142568972_142569582 | 3.90 |
H19 |
H19, imprinted maternally expressed transcript |
7261 |
0.1 |
chr14_70107012_70107367 | 3.89 |
Bin3 |
bridging integrator 3 |
7024 |
0.15 |
chr3_121460443_121460755 | 3.88 |
Slc44a3 |
solute carrier family 44, member 3 |
312 |
0.86 |
chr17_63979339_63979498 | 3.87 |
Fer |
fer (fms/fps related) protein kinase |
41446 |
0.2 |
chr9_66181597_66181823 | 3.87 |
Dapk2 |
death-associated protein kinase 2 |
23475 |
0.17 |
chr5_137530580_137532081 | 3.86 |
Gnb2 |
guanine nucleotide binding protein (G protein), beta 2 |
33 |
0.9 |
chr15_16312349_16312544 | 3.84 |
Gm6479 |
predicted gene 6479 |
104493 |
0.08 |
chr13_43480925_43481874 | 3.83 |
Ranbp9 |
RAN binding protein 9 |
117 |
0.95 |
chr13_112746381_112746563 | 3.82 |
Slc38a9 |
solute carrier family 38, member 9 |
10862 |
0.15 |
chr1_194815643_194816066 | 3.81 |
Gm19777 |
predicted gene, 19777 |
4233 |
0.18 |
chr4_88117359_88117676 | 3.81 |
Focad |
focadhesin |
3782 |
0.2 |
chr13_58523787_58523959 | 3.81 |
Gm3131 |
predicted gene 3131 |
22155 |
0.16 |
chr6_41703349_41703511 | 3.80 |
Kel |
Kell blood group |
909 |
0.46 |
chr12_55329548_55329699 | 3.79 |
Prorp |
protein only RNase P catalytic subunit |
26337 |
0.12 |
chr11_117204633_117204995 | 3.77 |
Septin9 |
septin 9 |
5153 |
0.19 |
chr5_91851285_91851489 | 3.76 |
Gm5558 |
predicted gene 5558 |
44314 |
0.1 |
chr5_129992076_129992234 | 3.76 |
Gusb |
glucuronidase, beta |
1513 |
0.26 |
chr11_115805038_115805337 | 3.76 |
Caskin2 |
CASK-interacting protein 2 |
2915 |
0.13 |
chr1_74001484_74001792 | 3.75 |
Tns1 |
tensin 1 |
71 |
0.98 |
chr11_79071382_79071575 | 3.75 |
Ksr1 |
kinase suppressor of ras 1 |
3008 |
0.28 |
chr10_86053216_86053575 | 3.74 |
Fbxo7 |
F-box protein 7 |
10943 |
0.11 |
chr17_39848426_39848686 | 3.73 |
CT010467.2 |
|
271 |
0.89 |
chr4_132391174_132391454 | 3.72 |
Phactr4 |
phosphatase and actin regulator 4 |
6885 |
0.09 |
chr15_82794220_82794587 | 3.72 |
Cyp2d26 |
cytochrome P450, family 2, subfamily d, polypeptide 26 |
109 |
0.93 |
chr1_4785042_4785900 | 3.70 |
Mrpl15 |
mitochondrial ribosomal protein L15 |
221 |
0.88 |
chr1_86228529_86228755 | 3.70 |
Armc9 |
armadillo repeat containing 9 |
15924 |
0.13 |
chr11_65649693_65649895 | 3.69 |
Gm26128 |
predicted gene, 26128 |
23400 |
0.21 |
chr7_115844532_115844833 | 3.69 |
Sox6 |
SRY (sex determining region Y)-box 6 |
1423 |
0.56 |
chr11_120951757_120951932 | 3.68 |
Slc16a3 |
solute carrier family 16 (monocarboxylic acid transporters), member 3 |
706 |
0.52 |
chr18_61278743_61279039 | 3.68 |
Pde6a |
phosphodiesterase 6A, cGMP-specific, rod, alpha |
3868 |
0.21 |
chr3_14887721_14888032 | 3.67 |
Car2 |
carbonic anhydrase 2 |
1237 |
0.47 |
chr8_120486990_120488549 | 3.67 |
Gse1 |
genetic suppressor element 1, coiled-coil protein |
678 |
0.64 |
chr19_10662035_10662222 | 3.65 |
Vwce |
von Willebrand factor C and EGF domains |
4139 |
0.11 |
chr15_79062401_79062814 | 3.64 |
Ankrd54 |
ankyrin repeat domain 54 |
15 |
0.93 |
chr3_41163722_41163879 | 3.64 |
Gm40038 |
predicted gene, 40038 |
8863 |
0.23 |
chr10_94048249_94048471 | 3.64 |
Fgd6 |
FYVE, RhoGEF and PH domain containing 6 |
12359 |
0.12 |
chr6_90624916_90625133 | 3.63 |
Slc41a3 |
solute carrier family 41, member 3 |
5877 |
0.15 |
chr17_50020049_50020209 | 3.63 |
AC133946.1 |
oxidoreductase NAD-binding domain containing 1 (OXNAD1) pseudogene |
47302 |
0.13 |
chr7_141093989_141094280 | 3.62 |
Sigirr |
single immunoglobulin and toll-interleukin 1 receptor (TIR) domain |
384 |
0.68 |
chr7_74928346_74928505 | 3.61 |
Gm44902 |
predicted gene 44902 |
42161 |
0.16 |
chr9_32400635_32401003 | 3.61 |
Kcnj1 |
potassium inwardly-rectifying channel, subfamily J, member 1 |
6834 |
0.18 |
chr3_108096711_108096990 | 3.58 |
Gnat2 |
guanine nucleotide binding protein, alpha transducing 2 |
393 |
0.71 |
chr5_103491085_103491245 | 3.58 |
Ptpn13 |
protein tyrosine phosphatase, non-receptor type 13 |
38401 |
0.14 |
chr16_32458080_32458311 | 3.58 |
2210020O09Rik |
RIKEN cDNA 2210020O09 gene |
2046 |
0.21 |
chr14_67000065_67000248 | 3.58 |
Bnip3l |
BCL2/adenovirus E1B interacting protein 3-like |
251 |
0.9 |
chr17_26011828_26012086 | 3.58 |
Rab11fip3 |
RAB11 family interacting protein 3 (class II) |
6503 |
0.1 |
chr16_92801635_92801964 | 3.58 |
Runx1 |
runt related transcription factor 1 |
23979 |
0.22 |
chr1_127756612_127756781 | 3.56 |
Acmsd |
amino carboxymuconate semialdehyde decarboxylase |
61 |
0.97 |
chr11_11884936_11885193 | 3.56 |
Ddc |
dopa decarboxylase |
4435 |
0.2 |
chr3_157732464_157732921 | 3.56 |
Gm33466 |
predicted gene, 33466 |
6284 |
0.26 |
chr11_74575091_74575467 | 3.55 |
Rap1gap2 |
RAP1 GTPase activating protein 2 |
14845 |
0.18 |
chr4_137433322_137433478 | 3.54 |
Cela3b |
chymotrypsin-like elastase family, member 3B |
2860 |
0.16 |
chr9_108079972_108080508 | 3.53 |
Mst1 |
macrophage stimulating 1 (hepatocyte growth factor-like) |
196 |
0.68 |
chr12_55054945_55055220 | 3.52 |
2700097O09Rik |
RIKEN cDNA 2700097O09 gene |
981 |
0.4 |
chr10_80857950_80858283 | 3.50 |
Sppl2b |
signal peptide peptidase like 2B |
995 |
0.29 |
chr10_95564038_95564403 | 3.50 |
Nudt4 |
nudix (nucleoside diphosphate linked moiety X)-type motif 4 |
74 |
0.96 |
chr2_93353112_93353620 | 3.50 |
Tspan18 |
tetraspanin 18 |
18861 |
0.16 |
chr10_80572548_80572876 | 3.49 |
Klf16 |
Kruppel-like factor 16 |
4609 |
0.09 |
chr6_7698045_7698383 | 3.49 |
Asns |
asparagine synthetase |
4960 |
0.24 |
chr1_82373706_82374341 | 3.48 |
Gm19552 |
predicted gene, 19552 |
21806 |
0.14 |
chr3_146376683_146376871 | 3.48 |
Gm10636 |
predicted gene 10636 |
2167 |
0.23 |
chr1_91301585_91301867 | 3.48 |
Scly |
selenocysteine lyase |
1071 |
0.36 |
chr11_75651168_75652336 | 3.48 |
Myo1c |
myosin IC |
242 |
0.88 |
chr11_115912151_115912342 | 3.48 |
Smim6 |
small integral membrane protein 6 |
229 |
0.85 |
chr11_115842218_115842650 | 3.46 |
Llgl2 |
LLGL2 scribble cell polarity complex component |
8111 |
0.1 |
chr2_172290258_172290421 | 3.46 |
Gm14275 |
predicted gene 14275 |
2206 |
0.26 |
chr15_83592607_83592775 | 3.46 |
Ttll12 |
tubulin tyrosine ligase-like family, member 12 |
2466 |
0.21 |
chr15_96275812_96275968 | 3.45 |
2610037D02Rik |
RIKEN cDNA 2610037D02 gene |
7718 |
0.19 |
chr3_41169830_41170141 | 3.44 |
Gm40038 |
predicted gene, 40038 |
2678 |
0.33 |
chr10_127202830_127202983 | 3.44 |
Dtx3 |
deltex 3, E3 ubiquitin ligase |
7178 |
0.08 |
chr11_50323890_50324212 | 3.43 |
Canx |
calnexin |
1622 |
0.26 |
chr6_31612964_31613142 | 3.42 |
Gm43154 |
predicted gene 43154 |
7764 |
0.19 |
chr2_31006530_31006963 | 3.42 |
Usp20 |
ubiquitin specific peptidase 20 |
4185 |
0.17 |
chr1_131126323_131126498 | 3.42 |
Dyrk3 |
dual-specificity tyrosine-(Y)-phosphorylation regulated kinase 3 |
11835 |
0.13 |
chr15_73180293_73180464 | 3.41 |
Ago2 |
argonaute RISC catalytic subunit 2 |
2531 |
0.29 |
chr7_73517501_73517677 | 3.41 |
C130083A15Rik |
RIKEN cDNA C130083A15 gene |
11136 |
0.11 |
chr15_58595331_58595575 | 3.41 |
Fer1l6 |
fer-1-like 6 (C. elegans) |
43052 |
0.17 |
chr11_117780269_117780842 | 3.40 |
Tmc6 |
transmembrane channel-like gene family 6 |
66 |
0.93 |
chr6_38342333_38342771 | 3.38 |
Zc3hav1 |
zinc finger CCCH type, antiviral 1 |
11721 |
0.13 |
chr4_109255748_109256041 | 3.36 |
Calr4 |
calreticulin 4 |
11312 |
0.19 |
chr8_3734184_3734482 | 3.35 |
Clec4g |
C-type lectin domain family 4, member g |
13682 |
0.09 |
chr16_32487182_32487452 | 3.35 |
Slc51a |
solute carrier family 51, alpha subunit |
386 |
0.79 |
chr4_140701770_140702866 | 3.34 |
Rcc2 |
regulator of chromosome condensation 2 |
845 |
0.47 |
chr11_48873308_48874023 | 3.34 |
Irgm1 |
immunity-related GTPase family M member 1 |
1982 |
0.19 |
chr16_11614396_11614547 | 3.34 |
Gm4279 |
predicted gene 4279 |
77386 |
0.1 |
chr9_63757305_63758776 | 3.34 |
Smad3 |
SMAD family member 3 |
46 |
0.98 |
chr10_77116511_77116903 | 3.33 |
Col18a1 |
collagen, type XVIII, alpha 1 |
2761 |
0.25 |
chr8_84197696_84198961 | 3.32 |
Gm26887 |
predicted gene, 26887 |
661 |
0.38 |
chr16_8768237_8768409 | 3.32 |
Gm25805 |
predicted gene, 25805 |
2047 |
0.29 |
chr7_105400029_105400208 | 3.32 |
Fam160a2 |
family with sequence similarity 160, member A2 |
64 |
0.67 |
chr5_43354546_43354893 | 3.32 |
Gm43020 |
predicted gene 43020 |
540 |
0.78 |
chr1_184675628_184676155 | 3.31 |
Gm38358 |
predicted gene, 38358 |
19143 |
0.14 |
chr16_93417956_93418141 | 3.30 |
1700029J03Rik |
RIKEN cDNA 1700029J03 gene |
7862 |
0.18 |
chr4_154011923_154012379 | 3.29 |
Lrrc47 |
leucine rich repeat containing 47 |
348 |
0.78 |
chr1_23417975_23418236 | 3.28 |
Ogfrl1 |
opioid growth factor receptor-like 1 |
20333 |
0.19 |
chr11_20916153_20916322 | 3.28 |
Gm23681 |
predicted gene, 23681 |
21464 |
0.18 |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
1.7 | 6.7 | GO:0050904 | diapedesis(GO:0050904) |
1.6 | 6.3 | GO:1990169 | detoxification of copper ion(GO:0010273) stress response to copper ion(GO:1990169) |
1.5 | 5.9 | GO:0032929 | negative regulation of superoxide anion generation(GO:0032929) |
1.5 | 8.8 | GO:0046874 | quinolinate metabolic process(GO:0046874) |
1.4 | 6.9 | GO:0006686 | sphingomyelin biosynthetic process(GO:0006686) |
1.3 | 3.8 | GO:1900748 | positive regulation of vascular endothelial growth factor signaling pathway(GO:1900748) |
1.2 | 3.7 | GO:0032910 | transforming growth factor beta3 production(GO:0032907) regulation of transforming growth factor beta3 production(GO:0032910) |
1.2 | 3.6 | GO:0060375 | regulation of mast cell differentiation(GO:0060375) |
1.2 | 7.1 | GO:0032792 | negative regulation of CREB transcription factor activity(GO:0032792) |
1.2 | 4.7 | GO:0006848 | pyruvate transport(GO:0006848) |
1.2 | 2.3 | GO:2000670 | positive regulation of dendritic cell apoptotic process(GO:2000670) |
1.1 | 3.3 | GO:0032485 | regulation of Ral protein signal transduction(GO:0032485) |
1.1 | 3.3 | GO:0045041 | protein import into mitochondrial intermembrane space(GO:0045041) |
1.1 | 6.5 | GO:0070072 | vacuolar proton-transporting V-type ATPase complex assembly(GO:0070072) |
1.0 | 5.2 | GO:0070836 | caveola assembly(GO:0070836) |
1.0 | 3.1 | GO:0061084 | negative regulation of protein refolding(GO:0061084) |
1.0 | 3.1 | GO:0060154 | cellular process regulating host cell cycle in response to virus(GO:0060154) |
1.0 | 3.0 | GO:0045658 | regulation of neutrophil differentiation(GO:0045658) |
1.0 | 6.0 | GO:0034242 | negative regulation of syncytium formation by plasma membrane fusion(GO:0034242) |
0.9 | 2.8 | GO:0070447 | positive regulation of oligodendrocyte progenitor proliferation(GO:0070447) |
0.9 | 2.8 | GO:1900739 | regulation of protein insertion into mitochondrial membrane involved in apoptotic signaling pathway(GO:1900739) positive regulation of protein insertion into mitochondrial membrane involved in apoptotic signaling pathway(GO:1900740) |
0.9 | 2.8 | GO:0035694 | mitochondrial protein catabolic process(GO:0035694) |
0.9 | 3.6 | GO:0044314 | protein K27-linked ubiquitination(GO:0044314) |
0.9 | 2.7 | GO:0042524 | negative regulation of tyrosine phosphorylation of Stat5 protein(GO:0042524) |
0.9 | 2.7 | GO:0043152 | induction of bacterial agglutination(GO:0043152) |
0.9 | 1.8 | GO:0035771 | interleukin-4-mediated signaling pathway(GO:0035771) |
0.9 | 2.6 | GO:0015842 | aminergic neurotransmitter loading into synaptic vesicle(GO:0015842) neurotransmitter loading into synaptic vesicle(GO:0098700) |
0.9 | 2.6 | GO:0045079 | negative regulation of chemokine biosynthetic process(GO:0045079) |
0.8 | 2.5 | GO:1903898 | negative regulation of PERK-mediated unfolded protein response(GO:1903898) |
0.8 | 2.5 | GO:0009182 | purine deoxyribonucleoside diphosphate metabolic process(GO:0009182) dGDP metabolic process(GO:0046066) |
0.8 | 8.3 | GO:0035879 | lactate transport(GO:0015727) lactate transmembrane transport(GO:0035873) plasma membrane lactate transport(GO:0035879) |
0.8 | 2.5 | GO:1900126 | negative regulation of hyaluronan biosynthetic process(GO:1900126) |
0.8 | 3.3 | GO:0034316 | negative regulation of Arp2/3 complex-mediated actin nucleation(GO:0034316) |
0.8 | 2.4 | GO:0048207 | vesicle targeting, rough ER to cis-Golgi(GO:0048207) COPII vesicle coating(GO:0048208) |
0.8 | 3.1 | GO:0035279 | mRNA cleavage involved in gene silencing by miRNA(GO:0035279) mRNA cleavage involved in gene silencing(GO:0098795) |
0.8 | 2.3 | GO:0032483 | regulation of Rab protein signal transduction(GO:0032483) |
0.8 | 2.3 | GO:0006438 | valyl-tRNA aminoacylation(GO:0006438) |
0.8 | 3.0 | GO:0009957 | epidermal cell fate specification(GO:0009957) |
0.7 | 3.0 | GO:0090168 | Golgi reassembly(GO:0090168) |
0.7 | 1.5 | GO:0001844 | protein insertion into mitochondrial membrane involved in apoptotic signaling pathway(GO:0001844) |
0.7 | 2.2 | GO:0006982 | response to lipid hydroperoxide(GO:0006982) |
0.7 | 2.2 | GO:1900169 | regulation of glucocorticoid mediated signaling pathway(GO:1900169) |
0.7 | 2.9 | GO:0035405 | histone-threonine phosphorylation(GO:0035405) |
0.7 | 2.2 | GO:0071787 | endoplasmic reticulum tubular network assembly(GO:0071787) |
0.7 | 2.9 | GO:0039536 | negative regulation of RIG-I signaling pathway(GO:0039536) |
0.7 | 5.7 | GO:0035970 | peptidyl-threonine dephosphorylation(GO:0035970) |
0.7 | 1.4 | GO:0006363 | termination of RNA polymerase I transcription(GO:0006363) |
0.7 | 6.9 | GO:0034063 | stress granule assembly(GO:0034063) |
0.7 | 2.0 | GO:0034146 | toll-like receptor 5 signaling pathway(GO:0034146) |
0.7 | 2.0 | GO:0030397 | membrane disassembly(GO:0030397) nuclear envelope disassembly(GO:0051081) |
0.7 | 2.7 | GO:0031508 | pericentric heterochromatin assembly(GO:0031508) |
0.6 | 3.2 | GO:0042699 | follicle-stimulating hormone signaling pathway(GO:0042699) |
0.6 | 1.9 | GO:0048388 | endosomal lumen acidification(GO:0048388) |
0.6 | 0.6 | GO:0034136 | negative regulation of toll-like receptor 2 signaling pathway(GO:0034136) |
0.6 | 5.0 | GO:0043983 | histone H4-K12 acetylation(GO:0043983) |
0.6 | 1.9 | GO:1903847 | regulation of aorta morphogenesis(GO:1903847) positive regulation of aorta morphogenesis(GO:1903849) |
0.6 | 2.5 | GO:0031581 | hemidesmosome assembly(GO:0031581) |
0.6 | 1.2 | GO:1902075 | cellular response to salt(GO:1902075) |
0.6 | 3.6 | GO:1901223 | negative regulation of NIK/NF-kappaB signaling(GO:1901223) |
0.6 | 1.8 | GO:0038171 | cannabinoid signaling pathway(GO:0038171) endocannabinoid signaling pathway(GO:0071926) |
0.6 | 1.8 | GO:0042938 | dipeptide transport(GO:0042938) |
0.6 | 4.7 | GO:0030853 | negative regulation of granulocyte differentiation(GO:0030853) |
0.6 | 1.8 | GO:0036091 | positive regulation of transcription from RNA polymerase II promoter in response to oxidative stress(GO:0036091) |
0.6 | 5.3 | GO:0060546 | negative regulation of necroptotic process(GO:0060546) |
0.6 | 1.2 | GO:0006901 | vesicle coating(GO:0006901) |
0.6 | 2.3 | GO:2000659 | regulation of interleukin-1-mediated signaling pathway(GO:2000659) |
0.6 | 1.7 | GO:0060931 | sinoatrial node cell development(GO:0060931) |
0.6 | 1.7 | GO:0051344 | negative regulation of cyclic-nucleotide phosphodiesterase activity(GO:0051344) |
0.6 | 1.7 | GO:2000645 | negative regulation of receptor catabolic process(GO:2000645) |
0.6 | 1.1 | GO:0042908 | xenobiotic transport(GO:0042908) |
0.6 | 6.2 | GO:0046040 | IMP metabolic process(GO:0046040) |
0.6 | 1.7 | GO:0006166 | purine ribonucleoside salvage(GO:0006166) |
0.6 | 2.2 | GO:0034454 | microtubule anchoring at centrosome(GO:0034454) |
0.5 | 1.1 | GO:0002254 | kinin cascade(GO:0002254) |
0.5 | 2.2 | GO:0010040 | response to iron(II) ion(GO:0010040) |
0.5 | 4.9 | GO:0043981 | histone H4-K5 acetylation(GO:0043981) histone H4-K8 acetylation(GO:0043982) |
0.5 | 2.2 | GO:0061113 | pancreas morphogenesis(GO:0061113) |
0.5 | 1.6 | GO:0034729 | histone H3-K79 methylation(GO:0034729) |
0.5 | 1.6 | GO:0045091 | regulation of single stranded viral RNA replication via double stranded DNA intermediate(GO:0045091) |
0.5 | 2.1 | GO:0038165 | oncostatin-M-mediated signaling pathway(GO:0038165) |
0.5 | 1.1 | GO:0036394 | amylase secretion(GO:0036394) |
0.5 | 1.1 | GO:0060397 | JAK-STAT cascade involved in growth hormone signaling pathway(GO:0060397) |
0.5 | 3.2 | GO:0071763 | nuclear membrane organization(GO:0071763) |
0.5 | 1.0 | GO:0046340 | diacylglycerol catabolic process(GO:0046340) |
0.5 | 1.6 | GO:0030997 | regulation of centriole-centriole cohesion(GO:0030997) |
0.5 | 1.6 | GO:0060398 | regulation of growth hormone receptor signaling pathway(GO:0060398) |
0.5 | 4.7 | GO:0003091 | renal water homeostasis(GO:0003091) |
0.5 | 1.5 | GO:0045472 | response to ether(GO:0045472) |
0.5 | 2.1 | GO:0043174 | pyrimidine-containing compound salvage(GO:0008655) pyrimidine nucleoside salvage(GO:0043097) nucleoside salvage(GO:0043174) |
0.5 | 4.1 | GO:0039529 | RIG-I signaling pathway(GO:0039529) |
0.5 | 4.1 | GO:0033601 | positive regulation of mammary gland epithelial cell proliferation(GO:0033601) |
0.5 | 2.6 | GO:1900619 | acetylcholine metabolic process(GO:0008291) acetate ester metabolic process(GO:1900619) |
0.5 | 3.1 | GO:0060753 | regulation of mast cell chemotaxis(GO:0060753) |
0.5 | 2.0 | GO:1990414 | replication-born double-strand break repair via sister chromatid exchange(GO:1990414) |
0.5 | 2.5 | GO:0046501 | protoporphyrinogen IX metabolic process(GO:0046501) |
0.5 | 3.5 | GO:0030718 | germ-line stem cell population maintenance(GO:0030718) |
0.5 | 0.5 | GO:0033184 | positive regulation of histone ubiquitination(GO:0033184) |
0.5 | 0.5 | GO:1904502 | regulation of lipophagy(GO:1904502) positive regulation of lipophagy(GO:1904504) |
0.5 | 1.5 | GO:0019371 | cyclooxygenase pathway(GO:0019371) |
0.5 | 0.5 | GO:0006549 | isoleucine metabolic process(GO:0006549) |
0.5 | 2.0 | GO:2000074 | regulation of type B pancreatic cell development(GO:2000074) |
0.5 | 1.5 | GO:0000350 | generation of catalytic spliceosome for second transesterification step(GO:0000350) |
0.5 | 2.4 | GO:0009642 | response to light intensity(GO:0009642) |
0.5 | 3.9 | GO:0032875 | regulation of DNA endoreduplication(GO:0032875) |
0.5 | 1.5 | GO:2000304 | positive regulation of sphingolipid biosynthetic process(GO:0090154) positive regulation of ceramide biosynthetic process(GO:2000304) |
0.5 | 1.0 | GO:1901187 | regulation of ephrin receptor signaling pathway(GO:1901187) |
0.5 | 1.9 | GO:0010991 | negative regulation of SMAD protein complex assembly(GO:0010991) |
0.5 | 4.3 | GO:0071361 | cellular response to ethanol(GO:0071361) |
0.5 | 1.4 | GO:0001560 | regulation of cell growth by extracellular stimulus(GO:0001560) |
0.5 | 3.8 | GO:0048387 | negative regulation of retinoic acid receptor signaling pathway(GO:0048387) |
0.5 | 1.9 | GO:0051919 | positive regulation of fibrinolysis(GO:0051919) |
0.5 | 0.9 | GO:0032484 | Ral protein signal transduction(GO:0032484) |
0.5 | 2.3 | GO:0018401 | peptidyl-proline hydroxylation to 4-hydroxy-L-proline(GO:0018401) |
0.5 | 1.4 | GO:0007208 | phospholipase C-activating serotonin receptor signaling pathway(GO:0007208) |
0.5 | 1.8 | GO:0006449 | regulation of translational termination(GO:0006449) |
0.5 | 0.9 | GO:0061470 | T follicular helper cell differentiation(GO:0061470) |
0.5 | 1.8 | GO:0070837 | dehydroascorbic acid transport(GO:0070837) |
0.5 | 1.4 | GO:0045900 | negative regulation of translational elongation(GO:0045900) |
0.4 | 0.9 | GO:0030908 | intein-mediated protein splicing(GO:0016539) protein splicing(GO:0030908) |
0.4 | 4.0 | GO:0046831 | regulation of RNA export from nucleus(GO:0046831) |
0.4 | 1.3 | GO:0006573 | valine metabolic process(GO:0006573) |
0.4 | 1.3 | GO:1901642 | purine nucleoside transmembrane transport(GO:0015860) purine-containing compound transmembrane transport(GO:0072530) nucleoside transmembrane transport(GO:1901642) |
0.4 | 1.8 | GO:2000504 | positive regulation of blood vessel remodeling(GO:2000504) |
0.4 | 0.9 | GO:1904706 | negative regulation of vascular smooth muscle cell proliferation(GO:1904706) |
0.4 | 1.3 | GO:0045585 | regulation of cytotoxic T cell differentiation(GO:0045583) positive regulation of cytotoxic T cell differentiation(GO:0045585) |
0.4 | 1.7 | GO:0071442 | positive regulation of histone H3-K14 acetylation(GO:0071442) |
0.4 | 0.9 | GO:0044838 | cell quiescence(GO:0044838) |
0.4 | 1.7 | GO:0038094 | Fc-gamma receptor signaling pathway(GO:0038094) |
0.4 | 1.3 | GO:0034499 | late endosome to Golgi transport(GO:0034499) |
0.4 | 1.3 | GO:0000960 | mitochondrial RNA catabolic process(GO:0000957) regulation of mitochondrial RNA catabolic process(GO:0000960) |
0.4 | 2.1 | GO:0007182 | common-partner SMAD protein phosphorylation(GO:0007182) |
0.4 | 1.3 | GO:0006578 | amino-acid betaine biosynthetic process(GO:0006578) |
0.4 | 2.1 | GO:0045647 | negative regulation of erythrocyte differentiation(GO:0045647) |
0.4 | 1.2 | GO:0051572 | negative regulation of histone H3-K4 methylation(GO:0051572) |
0.4 | 1.2 | GO:0010911 | regulation of isomerase activity(GO:0010911) positive regulation of isomerase activity(GO:0010912) |
0.4 | 1.6 | GO:0032049 | cardiolipin biosynthetic process(GO:0032049) |
0.4 | 1.2 | GO:0019676 | ammonia assimilation cycle(GO:0019676) |
0.4 | 1.6 | GO:0048478 | replication fork protection(GO:0048478) |
0.4 | 3.2 | GO:0031441 | negative regulation of mRNA 3'-end processing(GO:0031441) |
0.4 | 1.2 | GO:0046984 | regulation of hemoglobin biosynthetic process(GO:0046984) positive regulation of hemoglobin biosynthetic process(GO:0046985) |
0.4 | 2.0 | GO:0006646 | phosphatidylethanolamine biosynthetic process(GO:0006646) |
0.4 | 0.4 | GO:0075509 | receptor-mediated endocytosis of virus by host cell(GO:0019065) endocytosis involved in viral entry into host cell(GO:0075509) |
0.4 | 2.0 | GO:0071378 | growth hormone receptor signaling pathway(GO:0060396) cellular response to growth hormone stimulus(GO:0071378) |
0.4 | 1.6 | GO:0046292 | formaldehyde metabolic process(GO:0046292) |
0.4 | 0.4 | GO:0003223 | ventricular compact myocardium morphogenesis(GO:0003223) |
0.4 | 1.2 | GO:0021882 | regulation of transcription from RNA polymerase II promoter involved in forebrain neuron fate commitment(GO:0021882) |
0.4 | 0.8 | GO:0071332 | cellular response to fructose stimulus(GO:0071332) |
0.4 | 2.3 | GO:0042866 | pyruvate biosynthetic process(GO:0042866) |
0.4 | 0.8 | GO:1902809 | regulation of skeletal muscle fiber differentiation(GO:1902809) |
0.4 | 6.2 | GO:0061014 | positive regulation of mRNA catabolic process(GO:0061014) |
0.4 | 1.5 | GO:0006369 | termination of RNA polymerase II transcription(GO:0006369) |
0.4 | 1.5 | GO:0045719 | negative regulation of glycogen biosynthetic process(GO:0045719) |
0.4 | 1.5 | GO:0001887 | selenium compound metabolic process(GO:0001887) |
0.4 | 0.4 | GO:0061687 | detoxification of inorganic compound(GO:0061687) |
0.4 | 1.1 | GO:0001812 | positive regulation of type I hypersensitivity(GO:0001812) |
0.4 | 1.5 | GO:0001923 | B-1 B cell differentiation(GO:0001923) |
0.4 | 1.5 | GO:1903966 | monounsaturated fatty acid metabolic process(GO:1903964) monounsaturated fatty acid biosynthetic process(GO:1903966) |
0.4 | 3.0 | GO:0031274 | positive regulation of pseudopodium assembly(GO:0031274) |
0.4 | 1.1 | GO:1904694 | negative regulation of vascular smooth muscle contraction(GO:1904694) |
0.4 | 1.1 | GO:0003062 | regulation of heart rate by chemical signal(GO:0003062) |
0.4 | 2.2 | GO:0086073 | bundle of His cell-Purkinje myocyte adhesion involved in cell communication(GO:0086073) |
0.4 | 1.8 | GO:0033211 | adiponectin-activated signaling pathway(GO:0033211) |
0.4 | 0.7 | GO:0003213 | cardiac right atrium morphogenesis(GO:0003213) |
0.4 | 3.6 | GO:0051988 | regulation of attachment of spindle microtubules to kinetochore(GO:0051988) |
0.4 | 2.9 | GO:2000773 | negative regulation of cellular senescence(GO:2000773) |
0.4 | 1.1 | GO:0051791 | medium-chain fatty acid metabolic process(GO:0051791) |
0.4 | 1.8 | GO:0030174 | regulation of DNA-dependent DNA replication initiation(GO:0030174) |
0.4 | 2.5 | GO:0043320 | natural killer cell degranulation(GO:0043320) |
0.4 | 1.8 | GO:0031293 | membrane protein intracellular domain proteolysis(GO:0031293) |
0.3 | 1.0 | GO:0071712 | ER-associated misfolded protein catabolic process(GO:0071712) |
0.3 | 1.0 | GO:0031584 | activation of phospholipase D activity(GO:0031584) |
0.3 | 2.4 | GO:0032790 | ribosome disassembly(GO:0032790) |
0.3 | 1.0 | GO:2000561 | regulation of CD4-positive, alpha-beta T cell proliferation(GO:2000561) negative regulation of CD4-positive, alpha-beta T cell proliferation(GO:2000562) |
0.3 | 2.7 | GO:0018095 | protein polyglutamylation(GO:0018095) |
0.3 | 1.4 | GO:2000271 | positive regulation of fibroblast apoptotic process(GO:2000271) |
0.3 | 5.4 | GO:0015721 | bile acid and bile salt transport(GO:0015721) |
0.3 | 1.4 | GO:1902036 | regulation of hematopoietic stem cell differentiation(GO:1902036) |
0.3 | 1.7 | GO:0046543 | development of secondary female sexual characteristics(GO:0046543) |
0.3 | 0.3 | GO:0043096 | purine nucleobase salvage(GO:0043096) |
0.3 | 0.7 | GO:1900368 | regulation of RNA interference(GO:1900368) |
0.3 | 1.7 | GO:0080154 | regulation of fertilization(GO:0080154) |
0.3 | 1.7 | GO:0075525 | viral translational termination-reinitiation(GO:0075525) |
0.3 | 1.7 | GO:0072553 | terminal button organization(GO:0072553) |
0.3 | 1.0 | GO:0032439 | endosome localization(GO:0032439) |
0.3 | 2.3 | GO:0045916 | negative regulation of complement activation(GO:0045916) negative regulation of protein activation cascade(GO:2000258) |
0.3 | 0.7 | GO:0007403 | glial cell fate determination(GO:0007403) |
0.3 | 1.0 | GO:0060800 | regulation of cell differentiation involved in embryonic placenta development(GO:0060800) |
0.3 | 0.3 | GO:0034135 | regulation of toll-like receptor 2 signaling pathway(GO:0034135) |
0.3 | 2.3 | GO:0043653 | mitochondrial fragmentation involved in apoptotic process(GO:0043653) |
0.3 | 1.0 | GO:1901856 | negative regulation of cellular respiration(GO:1901856) |
0.3 | 1.3 | GO:0019230 | proprioception(GO:0019230) |
0.3 | 1.3 | GO:0036491 | regulation of translation in response to endoplasmic reticulum stress(GO:0036490) regulation of translation initiation in response to endoplasmic reticulum stress(GO:0036491) eiF2alpha phosphorylation in response to endoplasmic reticulum stress(GO:0036492) |
0.3 | 1.3 | GO:0072656 | maintenance of protein location in mitochondrion(GO:0072656) |
0.3 | 0.6 | GO:0003331 | regulation of extracellular matrix constituent secretion(GO:0003330) positive regulation of extracellular matrix constituent secretion(GO:0003331) |
0.3 | 1.3 | GO:0000480 | endonucleolytic cleavage in 5'-ETS of tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000480) |
0.3 | 0.6 | GO:1903525 | regulation of membrane tubulation(GO:1903525) |
0.3 | 0.6 | GO:2001286 | regulation of caveolin-mediated endocytosis(GO:2001286) |
0.3 | 0.9 | GO:0097242 | beta-amyloid clearance(GO:0097242) |
0.3 | 0.6 | GO:2000667 | positive regulation of interleukin-5 secretion(GO:2000664) positive regulation of interleukin-13 secretion(GO:2000667) |
0.3 | 0.9 | GO:0018879 | biphenyl metabolic process(GO:0018879) |
0.3 | 2.5 | GO:2000480 | negative regulation of cAMP-dependent protein kinase activity(GO:2000480) |
0.3 | 1.6 | GO:0034134 | toll-like receptor 2 signaling pathway(GO:0034134) |
0.3 | 0.9 | GO:0048633 | positive regulation of skeletal muscle tissue growth(GO:0048633) |
0.3 | 0.6 | GO:0042518 | negative regulation of tyrosine phosphorylation of Stat3 protein(GO:0042518) |
0.3 | 0.9 | GO:1903061 | positive regulation of protein lipidation(GO:1903061) |
0.3 | 0.6 | GO:0001907 | killing by symbiont of host cells(GO:0001907) disruption by symbiont of host cell(GO:0044004) |
0.3 | 0.6 | GO:0033634 | positive regulation of cell-cell adhesion mediated by integrin(GO:0033634) |
0.3 | 1.2 | GO:0033152 | immunoglobulin V(D)J recombination(GO:0033152) |
0.3 | 0.9 | GO:0006556 | S-adenosylmethionine biosynthetic process(GO:0006556) |
0.3 | 0.3 | GO:0010990 | regulation of SMAD protein complex assembly(GO:0010990) |
0.3 | 0.9 | GO:0072602 | interleukin-4 secretion(GO:0072602) |
0.3 | 4.9 | GO:0045648 | positive regulation of erythrocyte differentiation(GO:0045648) |
0.3 | 0.9 | GO:1902683 | regulation of receptor localization to synapse(GO:1902683) |
0.3 | 1.5 | GO:0010961 | cellular magnesium ion homeostasis(GO:0010961) |
0.3 | 3.0 | GO:0051601 | exocyst localization(GO:0051601) |
0.3 | 1.2 | GO:0031506 | cell wall mannoprotein biosynthetic process(GO:0000032) mannoprotein metabolic process(GO:0006056) mannoprotein biosynthetic process(GO:0006057) cell wall glycoprotein biosynthetic process(GO:0031506) cell wall biogenesis(GO:0042546) cell wall macromolecule biosynthetic process(GO:0044038) chain elongation of O-linked mannose residue(GO:0044845) cellular component macromolecule biosynthetic process(GO:0070589) |
0.3 | 0.3 | GO:0039531 | regulation of viral-induced cytoplasmic pattern recognition receptor signaling pathway(GO:0039531) |
0.3 | 3.3 | GO:0034315 | regulation of Arp2/3 complex-mediated actin nucleation(GO:0034315) |
0.3 | 2.1 | GO:1902018 | negative regulation of cilium assembly(GO:1902018) |
0.3 | 0.9 | GO:0000379 | tRNA-type intron splice site recognition and cleavage(GO:0000379) |
0.3 | 0.6 | GO:0042891 | antibiotic transport(GO:0042891) |
0.3 | 0.6 | GO:0055118 | negative regulation of cardiac muscle contraction(GO:0055118) |
0.3 | 1.8 | GO:0010746 | regulation of plasma membrane long-chain fatty acid transport(GO:0010746) |
0.3 | 0.9 | GO:2000259 | positive regulation of complement activation(GO:0045917) positive regulation of protein activation cascade(GO:2000259) |
0.3 | 2.6 | GO:0043518 | negative regulation of DNA damage response, signal transduction by p53 class mediator(GO:0043518) |
0.3 | 7.2 | GO:0000002 | mitochondrial genome maintenance(GO:0000002) |
0.3 | 0.9 | GO:0006083 | acetate metabolic process(GO:0006083) |
0.3 | 1.7 | GO:0015919 | peroxisomal membrane transport(GO:0015919) protein import into peroxisome membrane(GO:0045046) |
0.3 | 0.6 | GO:0090526 | regulation of gluconeogenesis involved in cellular glucose homeostasis(GO:0090526) |
0.3 | 0.3 | GO:0032815 | negative regulation of natural killer cell activation(GO:0032815) |
0.3 | 1.7 | GO:0031053 | primary miRNA processing(GO:0031053) |
0.3 | 1.7 | GO:0017196 | N-terminal peptidyl-methionine acetylation(GO:0017196) |
0.3 | 0.8 | GO:0010606 | positive regulation of cytoplasmic mRNA processing body assembly(GO:0010606) |
0.3 | 0.6 | GO:0032460 | negative regulation of protein oligomerization(GO:0032460) |
0.3 | 2.7 | GO:0045820 | negative regulation of glycolytic process(GO:0045820) |
0.3 | 0.3 | GO:0061724 | lipophagy(GO:0061724) |
0.3 | 1.6 | GO:0046037 | GMP metabolic process(GO:0046037) |
0.3 | 0.3 | GO:0033121 | regulation of purine nucleotide catabolic process(GO:0033121) regulation of cyclic-nucleotide phosphodiesterase activity(GO:0051342) |
0.3 | 1.1 | GO:0072383 | plus-end-directed vesicle transport along microtubule(GO:0072383) plus-end-directed organelle transport along microtubule(GO:0072386) |
0.3 | 2.4 | GO:0002082 | regulation of oxidative phosphorylation(GO:0002082) |
0.3 | 0.8 | GO:1904417 | regulation of xenophagy(GO:1904415) positive regulation of xenophagy(GO:1904417) |
0.3 | 0.5 | GO:2000346 | negative regulation of hepatocyte proliferation(GO:2000346) |
0.3 | 1.1 | GO:0006564 | L-serine biosynthetic process(GO:0006564) |
0.3 | 0.3 | GO:0002432 | granuloma formation(GO:0002432) |
0.3 | 0.8 | GO:0010994 | regulation of ubiquitin homeostasis(GO:0010993) free ubiquitin chain polymerization(GO:0010994) |
0.3 | 1.1 | GO:0060340 | positive regulation of type I interferon-mediated signaling pathway(GO:0060340) |
0.3 | 4.6 | GO:0071108 | protein K48-linked deubiquitination(GO:0071108) |
0.3 | 1.3 | GO:0006398 | mRNA 3'-end processing by stem-loop binding and cleavage(GO:0006398) |
0.3 | 0.5 | GO:0046618 | drug export(GO:0046618) |
0.3 | 0.8 | GO:0060700 | regulation of ribonuclease activity(GO:0060700) |
0.3 | 0.8 | GO:0007597 | blood coagulation, intrinsic pathway(GO:0007597) |
0.3 | 9.5 | GO:0072583 | clathrin-mediated endocytosis(GO:0072583) |
0.3 | 0.8 | GO:0000492 | small nucleolar ribonucleoprotein complex assembly(GO:0000491) box C/D snoRNP assembly(GO:0000492) |
0.3 | 0.5 | GO:0045054 | constitutive secretory pathway(GO:0045054) |
0.3 | 1.3 | GO:0006572 | tyrosine catabolic process(GO:0006572) |
0.3 | 1.0 | GO:0010510 | regulation of acetyl-CoA biosynthetic process from pyruvate(GO:0010510) regulation of acyl-CoA biosynthetic process(GO:0050812) |
0.3 | 2.6 | GO:0007076 | mitotic chromosome condensation(GO:0007076) |
0.3 | 2.3 | GO:0032367 | intracellular cholesterol transport(GO:0032367) |
0.3 | 0.3 | GO:2000468 | regulation of peroxidase activity(GO:2000468) |
0.3 | 0.3 | GO:0007290 | spermatid nucleus elongation(GO:0007290) |
0.3 | 0.8 | GO:1903984 | regulation of TRAIL-activated apoptotic signaling pathway(GO:1903121) positive regulation of TRAIL-activated apoptotic signaling pathway(GO:1903984) |
0.3 | 1.5 | GO:0070995 | NADPH oxidation(GO:0070995) |
0.3 | 0.3 | GO:1903598 | positive regulation of gap junction assembly(GO:1903598) |
0.3 | 1.0 | GO:0071922 | establishment of sister chromatid cohesion(GO:0034085) cohesin loading(GO:0071921) regulation of cohesin loading(GO:0071922) |
0.3 | 0.8 | GO:1904491 | protein localization to ciliary transition zone(GO:1904491) |
0.3 | 1.0 | GO:0072488 | ammonium transmembrane transport(GO:0072488) |
0.3 | 1.0 | GO:0032202 | telomere assembly(GO:0032202) |
0.3 | 2.8 | GO:0006465 | signal peptide processing(GO:0006465) |
0.3 | 1.3 | GO:0040016 | embryonic cleavage(GO:0040016) |
0.3 | 0.5 | GO:0031642 | negative regulation of myelination(GO:0031642) |
0.2 | 1.2 | GO:1905097 | regulation of guanyl-nucleotide exchange factor activity(GO:1905097) |
0.2 | 1.5 | GO:0035735 | intraciliary transport involved in cilium morphogenesis(GO:0035735) |
0.2 | 0.7 | GO:0045896 | regulation of transcription during mitosis(GO:0045896) positive regulation of transcription during mitosis(GO:0045897) |
0.2 | 0.5 | GO:0006344 | maintenance of chromatin silencing(GO:0006344) |
0.2 | 1.5 | GO:0015671 | oxygen transport(GO:0015671) |
0.2 | 0.7 | GO:0001543 | ovarian follicle rupture(GO:0001543) |
0.2 | 0.7 | GO:0035526 | retrograde transport, plasma membrane to Golgi(GO:0035526) |
0.2 | 1.0 | GO:0070966 | nuclear-transcribed mRNA catabolic process, no-go decay(GO:0070966) |
0.2 | 1.0 | GO:0033353 | S-adenosylmethionine cycle(GO:0033353) |
0.2 | 0.2 | GO:0060125 | negative regulation of growth hormone secretion(GO:0060125) |
0.2 | 1.5 | GO:0006000 | fructose metabolic process(GO:0006000) |
0.2 | 0.5 | GO:1905216 | positive regulation of mRNA binding(GO:1902416) positive regulation of RNA binding(GO:1905216) |
0.2 | 0.7 | GO:0090245 | axis elongation involved in somitogenesis(GO:0090245) |
0.2 | 0.2 | GO:1902445 | regulation of mitochondrial membrane permeability involved in programmed necrotic cell death(GO:1902445) |
0.2 | 0.7 | GO:0018206 | peptidyl-methionine modification(GO:0018206) |
0.2 | 1.9 | GO:0035372 | protein localization to microtubule(GO:0035372) |
0.2 | 2.4 | GO:2000060 | positive regulation of protein ubiquitination involved in ubiquitin-dependent protein catabolic process(GO:2000060) |
0.2 | 0.5 | GO:1901979 | regulation of inward rectifier potassium channel activity(GO:1901979) |
0.2 | 0.7 | GO:0048199 | vesicle targeting, to, from or within Golgi(GO:0048199) |
0.2 | 1.4 | GO:0015074 | DNA integration(GO:0015074) |
0.2 | 1.0 | GO:1903887 | motile primary cilium assembly(GO:1903887) |
0.2 | 0.7 | GO:1902268 | negative regulation of polyamine transmembrane transport(GO:1902268) |
0.2 | 1.7 | GO:0050779 | RNA destabilization(GO:0050779) |
0.2 | 0.5 | GO:1901026 | ripoptosome assembly(GO:0097343) ripoptosome assembly involved in necroptotic process(GO:1901026) |
0.2 | 1.2 | GO:0032463 | negative regulation of protein homooligomerization(GO:0032463) |
0.2 | 1.6 | GO:1901407 | regulation of phosphorylation of RNA polymerase II C-terminal domain(GO:1901407) positive regulation of phosphorylation of RNA polymerase II C-terminal domain(GO:1901409) |
0.2 | 0.2 | GO:2000515 | negative regulation of CD4-positive, alpha-beta T cell activation(GO:2000515) |
0.2 | 0.7 | GO:0032819 | positive regulation of natural killer cell proliferation(GO:0032819) |
0.2 | 0.5 | GO:0039689 | negative stranded viral RNA replication(GO:0039689) multi-organism biosynthetic process(GO:0044034) |
0.2 | 2.6 | GO:0040015 | negative regulation of multicellular organism growth(GO:0040015) |
0.2 | 0.5 | GO:0045415 | negative regulation of interleukin-8 biosynthetic process(GO:0045415) |
0.2 | 2.3 | GO:0051014 | actin filament severing(GO:0051014) |
0.2 | 0.7 | GO:0009180 | ADP biosynthetic process(GO:0006172) purine nucleoside diphosphate biosynthetic process(GO:0009136) purine ribonucleoside diphosphate biosynthetic process(GO:0009180) |
0.2 | 1.6 | GO:0051026 | chiasma assembly(GO:0051026) |
0.2 | 4.3 | GO:0046627 | negative regulation of insulin receptor signaling pathway(GO:0046627) |
0.2 | 0.2 | GO:0032911 | negative regulation of transforming growth factor beta1 production(GO:0032911) |
0.2 | 0.9 | GO:1900378 | positive regulation of melanin biosynthetic process(GO:0048023) positive regulation of secondary metabolite biosynthetic process(GO:1900378) |
0.2 | 0.5 | GO:0048320 | axial mesoderm formation(GO:0048320) |
0.2 | 0.5 | GO:0045908 | negative regulation of vasodilation(GO:0045908) |
0.2 | 1.8 | GO:0061469 | regulation of type B pancreatic cell proliferation(GO:0061469) |
0.2 | 1.4 | GO:0032287 | peripheral nervous system myelin maintenance(GO:0032287) |
0.2 | 0.9 | GO:0016576 | histone dephosphorylation(GO:0016576) |
0.2 | 1.1 | GO:2000786 | positive regulation of autophagosome assembly(GO:2000786) |
0.2 | 0.4 | GO:0043379 | memory T cell differentiation(GO:0043379) |
0.2 | 0.9 | GO:0070389 | chaperone cofactor-dependent protein refolding(GO:0070389) |
0.2 | 1.6 | GO:0043569 | negative regulation of insulin-like growth factor receptor signaling pathway(GO:0043569) |
0.2 | 1.6 | GO:0044819 | mitotic G1/S transition checkpoint(GO:0044819) |
0.2 | 1.6 | GO:0006488 | dolichol-linked oligosaccharide biosynthetic process(GO:0006488) |
0.2 | 0.2 | GO:0000320 | re-entry into mitotic cell cycle(GO:0000320) |
0.2 | 2.4 | GO:1902187 | negative regulation of viral release from host cell(GO:1902187) |
0.2 | 3.3 | GO:0072520 | seminiferous tubule development(GO:0072520) |
0.2 | 1.3 | GO:0071569 | protein ufmylation(GO:0071569) |
0.2 | 0.7 | GO:0032211 | negative regulation of telomere maintenance via telomerase(GO:0032211) |
0.2 | 1.5 | GO:0060056 | mammary gland involution(GO:0060056) |
0.2 | 1.1 | GO:0000972 | transcription-dependent tethering of RNA polymerase II gene DNA at nuclear periphery(GO:0000972) |
0.2 | 1.3 | GO:0071557 | histone H3-K27 demethylation(GO:0071557) |
0.2 | 0.4 | GO:0032482 | Rab protein signal transduction(GO:0032482) |
0.2 | 0.7 | GO:0006481 | C-terminal protein methylation(GO:0006481) |
0.2 | 1.1 | GO:0060708 | spongiotrophoblast differentiation(GO:0060708) |
0.2 | 0.4 | GO:1901679 | pyrimidine-containing compound transmembrane transport(GO:0072531) nucleotide transmembrane transport(GO:1901679) |
0.2 | 5.2 | GO:1902017 | regulation of cilium assembly(GO:1902017) |
0.2 | 0.9 | GO:0010571 | positive regulation of nuclear cell cycle DNA replication(GO:0010571) |
0.2 | 0.4 | GO:0038028 | insulin receptor signaling pathway via phosphatidylinositol 3-kinase(GO:0038028) |
0.2 | 0.2 | GO:0061083 | regulation of protein refolding(GO:0061083) |
0.2 | 1.9 | GO:0002098 | tRNA wobble uridine modification(GO:0002098) |
0.2 | 0.2 | GO:0072611 | interleukin-5 secretion(GO:0072603) interleukin-13 secretion(GO:0072611) regulation of interleukin-5 secretion(GO:2000662) regulation of interleukin-13 secretion(GO:2000665) |
0.2 | 1.3 | GO:0006384 | transcription initiation from RNA polymerase III promoter(GO:0006384) |
0.2 | 2.1 | GO:0035518 | histone H2A monoubiquitination(GO:0035518) |
0.2 | 1.9 | GO:0006978 | DNA damage response, signal transduction by p53 class mediator resulting in transcription of p21 class mediator(GO:0006978) |
0.2 | 0.2 | GO:0046122 | purine deoxyribonucleoside metabolic process(GO:0046122) |
0.2 | 0.4 | GO:0032077 | positive regulation of deoxyribonuclease activity(GO:0032077) |
0.2 | 2.1 | GO:0032801 | receptor catabolic process(GO:0032801) |
0.2 | 2.9 | GO:0010591 | regulation of lamellipodium assembly(GO:0010591) |
0.2 | 1.2 | GO:0034244 | negative regulation of transcription elongation from RNA polymerase II promoter(GO:0034244) |
0.2 | 0.4 | GO:1902751 | positive regulation of cell cycle G2/M phase transition(GO:1902751) |
0.2 | 0.4 | GO:0006046 | N-acetylglucosamine catabolic process(GO:0006046) |
0.2 | 1.4 | GO:0035751 | regulation of lysosomal lumen pH(GO:0035751) |
0.2 | 1.0 | GO:0032596 | protein transport into membrane raft(GO:0032596) |
0.2 | 0.4 | GO:1903774 | positive regulation of viral budding via host ESCRT complex(GO:1903774) |
0.2 | 0.8 | GO:0006678 | glucosylceramide metabolic process(GO:0006678) |
0.2 | 1.0 | GO:2000210 | positive regulation of anoikis(GO:2000210) |
0.2 | 0.2 | GO:0097167 | circadian regulation of translation(GO:0097167) |
0.2 | 0.6 | GO:2000766 | negative regulation of cytoplasmic translation(GO:2000766) |
0.2 | 1.2 | GO:0090043 | regulation of tubulin deacetylation(GO:0090043) |
0.2 | 0.8 | GO:0007296 | vitellogenesis(GO:0007296) |
0.2 | 1.6 | GO:0030213 | hyaluronan biosynthetic process(GO:0030213) |
0.2 | 0.6 | GO:0070236 | negative regulation of activation-induced cell death of T cells(GO:0070236) |
0.2 | 1.4 | GO:0035630 | bone mineralization involved in bone maturation(GO:0035630) |
0.2 | 0.4 | GO:0003431 | growth plate cartilage chondrocyte development(GO:0003431) |
0.2 | 0.6 | GO:0010760 | negative regulation of macrophage chemotaxis(GO:0010760) |
0.2 | 1.0 | GO:0006654 | phosphatidic acid biosynthetic process(GO:0006654) |
0.2 | 0.4 | GO:1904263 | positive regulation of TORC1 signaling(GO:1904263) |
0.2 | 0.4 | GO:1901896 | positive regulation of calcium-transporting ATPase activity(GO:1901896) |
0.2 | 0.8 | GO:0044789 | modulation by host of viral release from host cell(GO:0044789) positive regulation by host of viral release from host cell(GO:0044791) |
0.2 | 4.1 | GO:0051497 | negative regulation of stress fiber assembly(GO:0051497) |
0.2 | 0.4 | GO:1990705 | cholangiocyte proliferation(GO:1990705) |
0.2 | 2.9 | GO:0034198 | cellular response to amino acid starvation(GO:0034198) |
0.2 | 1.8 | GO:0070269 | pyroptosis(GO:0070269) |
0.2 | 0.8 | GO:2000418 | positive regulation of eosinophil migration(GO:2000418) |
0.2 | 3.5 | GO:0044380 | protein localization to cytoskeleton(GO:0044380) |
0.2 | 0.6 | GO:0006269 | DNA replication, synthesis of RNA primer(GO:0006269) |
0.2 | 10.8 | GO:0030218 | erythrocyte differentiation(GO:0030218) |
0.2 | 0.2 | GO:0002925 | positive regulation of humoral immune response mediated by circulating immunoglobulin(GO:0002925) |
0.2 | 1.0 | GO:0001561 | fatty acid alpha-oxidation(GO:0001561) |
0.2 | 1.2 | GO:0006004 | fucose metabolic process(GO:0006004) |
0.2 | 1.3 | GO:0001731 | formation of translation preinitiation complex(GO:0001731) |
0.2 | 0.6 | GO:0044827 | modulation by host of viral genome replication(GO:0044827) |
0.2 | 0.6 | GO:0018125 | peptidyl-cysteine methylation(GO:0018125) |
0.2 | 0.4 | GO:0030421 | defecation(GO:0030421) |
0.2 | 1.0 | GO:0008608 | attachment of spindle microtubules to kinetochore(GO:0008608) |
0.2 | 0.4 | GO:0071072 | negative regulation of phospholipid biosynthetic process(GO:0071072) |
0.2 | 1.7 | GO:0051044 | positive regulation of membrane protein ectodomain proteolysis(GO:0051044) |
0.2 | 1.7 | GO:0000103 | sulfate assimilation(GO:0000103) |
0.2 | 0.4 | GO:0016480 | negative regulation of transcription from RNA polymerase III promoter(GO:0016480) |
0.2 | 1.7 | GO:0060294 | cilium movement involved in cell motility(GO:0060294) |
0.2 | 0.4 | GO:0070343 | white fat cell proliferation(GO:0070343) regulation of white fat cell proliferation(GO:0070350) |
0.2 | 0.6 | GO:0002315 | marginal zone B cell differentiation(GO:0002315) |
0.2 | 1.5 | GO:0018026 | peptidyl-lysine monomethylation(GO:0018026) |
0.2 | 1.3 | GO:0032986 | nucleosome disassembly(GO:0006337) protein-DNA complex disassembly(GO:0032986) |
0.2 | 0.4 | GO:0001546 | preantral ovarian follicle growth(GO:0001546) multi-layer follicle stage(GO:0048162) |
0.2 | 0.6 | GO:0010739 | positive regulation of protein kinase A signaling(GO:0010739) |
0.2 | 0.4 | GO:0051569 | regulation of histone H3-K4 methylation(GO:0051569) |
0.2 | 0.4 | GO:1902237 | positive regulation of endoplasmic reticulum stress-induced intrinsic apoptotic signaling pathway(GO:1902237) |
0.2 | 1.5 | GO:0035269 | protein O-linked mannosylation(GO:0035269) |
0.2 | 0.9 | GO:0018101 | protein citrullination(GO:0018101) |
0.2 | 0.2 | GO:0070162 | adiponectin secretion(GO:0070162) regulation of adiponectin secretion(GO:0070163) |
0.2 | 0.2 | GO:0002554 | serotonin secretion by platelet(GO:0002554) |
0.2 | 0.6 | GO:1901097 | negative regulation of autophagosome maturation(GO:1901097) |
0.2 | 0.6 | GO:0048014 | Tie signaling pathway(GO:0048014) |
0.2 | 1.1 | GO:0071380 | cellular response to prostaglandin E stimulus(GO:0071380) |
0.2 | 0.9 | GO:0090051 | negative regulation of cell migration involved in sprouting angiogenesis(GO:0090051) |
0.2 | 0.5 | GO:2000189 | positive regulation of cholesterol homeostasis(GO:2000189) |
0.2 | 0.2 | GO:0051918 | negative regulation of fibrinolysis(GO:0051918) |
0.2 | 0.5 | GO:0018197 | peptidyl-aspartic acid modification(GO:0018197) |
0.2 | 0.4 | GO:0051541 | elastin metabolic process(GO:0051541) |
0.2 | 1.4 | GO:0035278 | miRNA mediated inhibition of translation(GO:0035278) |
0.2 | 0.7 | GO:0008090 | retrograde axonal transport(GO:0008090) |
0.2 | 0.4 | GO:0035483 | gastric motility(GO:0035482) gastric emptying(GO:0035483) |
0.2 | 1.6 | GO:1902230 | negative regulation of intrinsic apoptotic signaling pathway in response to DNA damage(GO:1902230) |
0.2 | 0.2 | GO:0090135 | actin filament branching(GO:0090135) |
0.2 | 1.4 | GO:0035563 | positive regulation of chromatin binding(GO:0035563) |
0.2 | 0.7 | GO:0030300 | regulation of intestinal cholesterol absorption(GO:0030300) |
0.2 | 0.7 | GO:0032906 | transforming growth factor beta2 production(GO:0032906) regulation of transforming growth factor beta2 production(GO:0032909) |
0.2 | 0.5 | GO:1900108 | negative regulation of nodal signaling pathway(GO:1900108) |
0.2 | 0.2 | GO:1904528 | regulation of microtubule binding(GO:1904526) positive regulation of microtubule binding(GO:1904528) |
0.2 | 0.9 | GO:0032464 | positive regulation of protein homooligomerization(GO:0032464) |
0.2 | 0.2 | GO:2000615 | regulation of histone H3-K9 acetylation(GO:2000615) |
0.2 | 0.4 | GO:0006681 | galactosylceramide metabolic process(GO:0006681) |
0.2 | 3.3 | GO:0030970 | retrograde protein transport, ER to cytosol(GO:0030970) |
0.2 | 0.5 | GO:0051725 | protein de-ADP-ribosylation(GO:0051725) |
0.2 | 0.4 | GO:2000483 | negative regulation of interleukin-8 secretion(GO:2000483) |
0.2 | 1.1 | GO:0042149 | cellular response to glucose starvation(GO:0042149) |
0.2 | 0.3 | GO:0014057 | positive regulation of acetylcholine secretion, neurotransmission(GO:0014057) |
0.2 | 1.6 | GO:0006241 | CTP biosynthetic process(GO:0006241) CTP metabolic process(GO:0046036) |
0.2 | 1.6 | GO:0070129 | regulation of mitochondrial translation(GO:0070129) |
0.2 | 0.5 | GO:0090527 | actin filament reorganization(GO:0090527) |
0.2 | 0.5 | GO:0044778 | meiotic DNA integrity checkpoint(GO:0044778) |
0.2 | 0.5 | GO:0015781 | nucleotide-sugar transport(GO:0015780) pyrimidine nucleotide-sugar transport(GO:0015781) |
0.2 | 4.0 | GO:0014823 | response to activity(GO:0014823) |
0.2 | 0.9 | GO:0060267 | positive regulation of respiratory burst(GO:0060267) |
0.2 | 0.5 | GO:0006768 | biotin metabolic process(GO:0006768) |
0.2 | 0.5 | GO:0045112 | integrin biosynthetic process(GO:0045112) |
0.2 | 0.3 | GO:0003162 | atrioventricular node development(GO:0003162) |
0.2 | 0.9 | GO:0032570 | response to progesterone(GO:0032570) |
0.2 | 0.3 | GO:0071492 | cellular response to UV-A(GO:0071492) |
0.2 | 0.7 | GO:0031937 | positive regulation of chromatin silencing(GO:0031937) |
0.2 | 0.9 | GO:2000672 | negative regulation of motor neuron apoptotic process(GO:2000672) |
0.2 | 1.7 | GO:0043248 | proteasome assembly(GO:0043248) |
0.2 | 0.2 | GO:0032466 | negative regulation of cytokinesis(GO:0032466) |
0.2 | 0.2 | GO:0061428 | negative regulation of transcription from RNA polymerase II promoter in response to hypoxia(GO:0061428) |
0.2 | 0.8 | GO:0003056 | regulation of vascular smooth muscle contraction(GO:0003056) |
0.2 | 0.5 | GO:0006114 | glycerol biosynthetic process(GO:0006114) |
0.2 | 0.3 | GO:0002741 | positive regulation of cytokine secretion involved in immune response(GO:0002741) |
0.2 | 0.2 | GO:0003166 | His-Purkinje system development(GO:0003164) bundle of His development(GO:0003166) positive regulation of cardioblast differentiation(GO:0051891) |
0.2 | 0.5 | GO:2001271 | regulation of cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:2001270) negative regulation of cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:2001271) |
0.2 | 0.8 | GO:0009249 | protein lipoylation(GO:0009249) |
0.2 | 0.2 | GO:0009138 | pyrimidine nucleoside diphosphate metabolic process(GO:0009138) |
0.2 | 1.3 | GO:2000353 | positive regulation of endothelial cell apoptotic process(GO:2000353) |
0.2 | 0.3 | GO:0060440 | trachea formation(GO:0060440) |
0.2 | 0.5 | GO:0098903 | regulation of membrane repolarization during action potential(GO:0098903) |
0.2 | 0.2 | GO:0070094 | positive regulation of glucagon secretion(GO:0070094) |
0.2 | 0.2 | GO:0000965 | mitochondrial RNA 3'-end processing(GO:0000965) |
0.2 | 1.0 | GO:0051292 | nuclear pore complex assembly(GO:0051292) |
0.2 | 0.5 | GO:0001866 | NK T cell proliferation(GO:0001866) |
0.2 | 0.8 | GO:0043951 | negative regulation of cAMP-mediated signaling(GO:0043951) |
0.2 | 0.3 | GO:2000359 | regulation of binding of sperm to zona pellucida(GO:2000359) |
0.2 | 0.5 | GO:0070164 | negative regulation of adiponectin secretion(GO:0070164) |
0.2 | 0.6 | GO:0015870 | acetylcholine transport(GO:0015870) acetate ester transport(GO:1901374) |
0.2 | 0.5 | GO:0048859 | formation of anatomical boundary(GO:0048859) |
0.2 | 0.6 | GO:0060768 | regulation of epithelial cell proliferation involved in prostate gland development(GO:0060768) |
0.2 | 0.5 | GO:1901421 | positive regulation of response to alcohol(GO:1901421) |
0.2 | 0.3 | GO:1990928 | response to amino acid starvation(GO:1990928) |
0.2 | 4.2 | GO:0006506 | GPI anchor biosynthetic process(GO:0006506) |
0.2 | 0.6 | GO:0044351 | macropinocytosis(GO:0044351) |
0.2 | 0.6 | GO:0060718 | chorionic trophoblast cell differentiation(GO:0060718) |
0.2 | 1.2 | GO:0018119 | peptidyl-cysteine S-nitrosylation(GO:0018119) |
0.2 | 0.3 | GO:0007021 | tubulin complex assembly(GO:0007021) |
0.2 | 0.9 | GO:0045721 | negative regulation of gluconeogenesis(GO:0045721) |
0.2 | 7.0 | GO:0006367 | transcription initiation from RNA polymerase II promoter(GO:0006367) |
0.2 | 3.8 | GO:0030865 | cortical cytoskeleton organization(GO:0030865) |
0.2 | 1.1 | GO:0051974 | negative regulation of telomerase activity(GO:0051974) |
0.2 | 0.3 | GO:1903867 | chorion development(GO:0060717) extraembryonic membrane development(GO:1903867) |
0.2 | 0.2 | GO:1904017 | response to Thyroglobulin triiodothyronine(GO:1904016) cellular response to Thyroglobulin triiodothyronine(GO:1904017) |
0.2 | 0.6 | GO:0071356 | cellular response to tumor necrosis factor(GO:0071356) |
0.2 | 0.6 | GO:0007023 | post-chaperonin tubulin folding pathway(GO:0007023) |
0.2 | 0.6 | GO:0071243 | cellular response to arsenic-containing substance(GO:0071243) |
0.2 | 0.3 | GO:0061635 | regulation of protein complex stability(GO:0061635) |
0.2 | 0.6 | GO:0022027 | interkinetic nuclear migration(GO:0022027) |
0.2 | 1.2 | GO:0007175 | negative regulation of epidermal growth factor-activated receptor activity(GO:0007175) |
0.2 | 7.6 | GO:0090630 | activation of GTPase activity(GO:0090630) |
0.2 | 0.8 | GO:0071318 | cellular response to ATP(GO:0071318) |
0.2 | 0.3 | GO:0048290 | isotype switching to IgA isotypes(GO:0048290) regulation of isotype switching to IgA isotypes(GO:0048296) |
0.2 | 0.5 | GO:0007084 | mitotic nuclear envelope reassembly(GO:0007084) |
0.2 | 1.1 | GO:0034498 | early endosome to Golgi transport(GO:0034498) |
0.2 | 0.5 | GO:0010727 | negative regulation of hydrogen peroxide metabolic process(GO:0010727) |
0.1 | 0.6 | GO:0000707 | meiotic DNA recombinase assembly(GO:0000707) |
0.1 | 0.6 | GO:0045792 | negative regulation of cell size(GO:0045792) |
0.1 | 0.9 | GO:0046500 | S-adenosylmethionine metabolic process(GO:0046500) |
0.1 | 1.2 | GO:0032957 | inositol trisphosphate metabolic process(GO:0032957) |
0.1 | 0.6 | GO:0034720 | histone H3-K4 demethylation(GO:0034720) |
0.1 | 0.6 | GO:0071786 | endoplasmic reticulum tubular network organization(GO:0071786) |
0.1 | 2.4 | GO:0071173 | mitotic spindle assembly checkpoint(GO:0007094) spindle assembly checkpoint(GO:0071173) |
0.1 | 0.7 | GO:0050651 | dermatan sulfate proteoglycan biosynthetic process(GO:0050651) |
0.1 | 1.5 | GO:0006614 | SRP-dependent cotranslational protein targeting to membrane(GO:0006614) |
0.1 | 2.2 | GO:0030322 | stabilization of membrane potential(GO:0030322) |
0.1 | 0.6 | GO:0006684 | sphingomyelin metabolic process(GO:0006684) |
0.1 | 0.6 | GO:0032252 | secretory granule localization(GO:0032252) |
0.1 | 0.3 | GO:1901838 | positive regulation of transcription of nuclear large rRNA transcript from RNA polymerase I promoter(GO:1901838) |
0.1 | 1.7 | GO:0051481 | negative regulation of cytosolic calcium ion concentration(GO:0051481) |
0.1 | 0.6 | GO:0061641 | CENP-A containing nucleosome assembly(GO:0034080) CENP-A containing chromatin organization(GO:0061641) |
0.1 | 1.3 | GO:0072663 | protein targeting to peroxisome(GO:0006625) peroxisomal transport(GO:0043574) protein localization to peroxisome(GO:0072662) establishment of protein localization to peroxisome(GO:0072663) |
0.1 | 0.9 | GO:0002031 | G-protein coupled receptor internalization(GO:0002031) |
0.1 | 0.3 | GO:1902309 | negative regulation of peptidyl-serine dephosphorylation(GO:1902309) |
0.1 | 0.3 | GO:0022615 | protein to membrane docking(GO:0022615) |
0.1 | 0.3 | GO:0035522 | monoubiquitinated histone deubiquitination(GO:0035521) monoubiquitinated histone H2A deubiquitination(GO:0035522) |
0.1 | 0.1 | GO:0030222 | eosinophil differentiation(GO:0030222) |
0.1 | 0.9 | GO:0060693 | regulation of branching involved in salivary gland morphogenesis(GO:0060693) |
0.1 | 1.4 | GO:0046697 | decidualization(GO:0046697) |
0.1 | 3.8 | GO:0070534 | protein K63-linked ubiquitination(GO:0070534) |
0.1 | 0.3 | GO:0016554 | cytidine to uridine editing(GO:0016554) |
0.1 | 2.8 | GO:0033119 | negative regulation of RNA splicing(GO:0033119) |
0.1 | 0.4 | GO:0032594 | protein transport within lipid bilayer(GO:0032594) |
0.1 | 1.1 | GO:0006353 | DNA-templated transcription, termination(GO:0006353) |
0.1 | 0.3 | GO:0002752 | cell surface pattern recognition receptor signaling pathway(GO:0002752) |
0.1 | 0.8 | GO:0046597 | negative regulation of viral entry into host cell(GO:0046597) |
0.1 | 0.4 | GO:0010875 | positive regulation of cholesterol efflux(GO:0010875) |
0.1 | 0.4 | GO:1901341 | activation of store-operated calcium channel activity(GO:0032237) positive regulation of store-operated calcium channel activity(GO:1901341) |
0.1 | 2.9 | GO:0043954 | cellular component maintenance(GO:0043954) |
0.1 | 0.4 | GO:0061623 | galactose catabolic process via UDP-galactose(GO:0033499) glycolytic process from galactose(GO:0061623) |
0.1 | 1.0 | GO:0080182 | histone H3-K4 trimethylation(GO:0080182) |
0.1 | 0.3 | GO:1903334 | positive regulation of protein folding(GO:1903334) |
0.1 | 1.1 | GO:1901185 | negative regulation of ERBB signaling pathway(GO:1901185) |
0.1 | 0.4 | GO:0000087 | mitotic M phase(GO:0000087) |
0.1 | 0.1 | GO:0031627 | telomeric loop formation(GO:0031627) |
0.1 | 0.5 | GO:0070493 | thrombin receptor signaling pathway(GO:0070493) |
0.1 | 0.3 | GO:0035284 | central nervous system segmentation(GO:0035283) brain segmentation(GO:0035284) |
0.1 | 0.4 | GO:1903286 | regulation of potassium ion import(GO:1903286) positive regulation of potassium ion import(GO:1903288) |
0.1 | 0.8 | GO:0046599 | regulation of centriole replication(GO:0046599) |
0.1 | 0.4 | GO:0060455 | negative regulation of gastric acid secretion(GO:0060455) |
0.1 | 0.4 | GO:0008228 | opsonization(GO:0008228) |
0.1 | 0.3 | GO:0010528 | regulation of transposition(GO:0010528) negative regulation of transposition(GO:0010529) |
0.1 | 1.8 | GO:0007141 | male meiosis I(GO:0007141) |
0.1 | 0.1 | GO:0034140 | negative regulation of toll-like receptor 3 signaling pathway(GO:0034140) |
0.1 | 0.3 | GO:0002215 | defense response to nematode(GO:0002215) |
0.1 | 1.1 | GO:0045793 | positive regulation of cell size(GO:0045793) |
0.1 | 2.8 | GO:0043171 | peptide catabolic process(GO:0043171) |
0.1 | 0.4 | GO:1904354 | negative regulation of telomere capping(GO:1904354) |
0.1 | 1.7 | GO:0032109 | positive regulation of response to extracellular stimulus(GO:0032106) positive regulation of response to nutrient levels(GO:0032109) |
0.1 | 0.1 | GO:0072378 | blood coagulation, fibrin clot formation(GO:0072378) |
0.1 | 0.3 | GO:0046125 | pyrimidine deoxyribonucleoside metabolic process(GO:0046125) |
0.1 | 0.1 | GO:1903416 | response to glycoside(GO:1903416) |
0.1 | 0.7 | GO:0045586 | regulation of gamma-delta T cell differentiation(GO:0045586) regulation of gamma-delta T cell activation(GO:0046643) |
0.1 | 0.3 | GO:0007100 | mitotic centrosome separation(GO:0007100) |
0.1 | 0.8 | GO:0006703 | estrogen biosynthetic process(GO:0006703) |
0.1 | 0.7 | GO:2001044 | regulation of integrin-mediated signaling pathway(GO:2001044) |
0.1 | 0.9 | GO:0042795 | snRNA transcription from RNA polymerase II promoter(GO:0042795) |
0.1 | 0.1 | GO:0042138 | meiotic DNA double-strand break formation(GO:0042138) |
0.1 | 0.5 | GO:1990440 | positive regulation of transcription from RNA polymerase II promoter in response to endoplasmic reticulum stress(GO:1990440) |
0.1 | 0.8 | GO:0070327 | thyroid hormone transport(GO:0070327) |
0.1 | 0.9 | GO:0006283 | transcription-coupled nucleotide-excision repair(GO:0006283) |
0.1 | 0.3 | GO:0034695 | response to prostaglandin E(GO:0034695) |
0.1 | 0.1 | GO:0010989 | negative regulation of low-density lipoprotein particle clearance(GO:0010989) |
0.1 | 0.4 | GO:0006613 | cotranslational protein targeting to membrane(GO:0006613) |
0.1 | 0.1 | GO:0010534 | serotonin production involved in inflammatory response(GO:0002351) serotonin secretion involved in inflammatory response(GO:0002442) regulation of activation of JAK2 kinase activity(GO:0010534) regulation of eosinophil migration(GO:2000416) |
0.1 | 0.3 | GO:0043101 | purine-containing compound salvage(GO:0043101) |
0.1 | 3.8 | GO:0006891 | intra-Golgi vesicle-mediated transport(GO:0006891) |
0.1 | 0.8 | GO:0042448 | progesterone metabolic process(GO:0042448) |
0.1 | 0.3 | GO:0045943 | positive regulation of transcription from RNA polymerase I promoter(GO:0045943) |
0.1 | 0.3 | GO:0030263 | apoptotic chromosome condensation(GO:0030263) |
0.1 | 2.0 | GO:0032981 | NADH dehydrogenase complex assembly(GO:0010257) mitochondrial respiratory chain complex I assembly(GO:0032981) mitochondrial respiratory chain complex I biogenesis(GO:0097031) |
0.1 | 0.5 | GO:1903352 | ornithine transport(GO:0015822) L-ornithine transmembrane transport(GO:1903352) |
0.1 | 0.4 | GO:0045019 | negative regulation of nitric oxide biosynthetic process(GO:0045019) negative regulation of nitric oxide metabolic process(GO:1904406) |
0.1 | 0.1 | GO:0035054 | embryonic heart tube anterior/posterior pattern specification(GO:0035054) |
0.1 | 0.1 | GO:0002159 | desmosome assembly(GO:0002159) |
0.1 | 0.7 | GO:0033148 | positive regulation of intracellular estrogen receptor signaling pathway(GO:0033148) |
0.1 | 0.7 | GO:0006268 | DNA unwinding involved in DNA replication(GO:0006268) |
0.1 | 0.2 | GO:0098535 | de novo centriole assembly(GO:0098535) |
0.1 | 0.4 | GO:1904707 | regulation of vascular smooth muscle cell proliferation(GO:1904705) positive regulation of vascular smooth muscle cell proliferation(GO:1904707) vascular smooth muscle cell proliferation(GO:1990874) |
0.1 | 3.3 | GO:0070373 | negative regulation of ERK1 and ERK2 cascade(GO:0070373) |
0.1 | 0.9 | GO:1900262 | regulation of DNA-directed DNA polymerase activity(GO:1900262) positive regulation of DNA-directed DNA polymerase activity(GO:1900264) |
0.1 | 0.5 | GO:0019276 | UDP-N-acetylgalactosamine metabolic process(GO:0019276) |
0.1 | 0.5 | GO:0033572 | transferrin transport(GO:0033572) |
0.1 | 0.2 | GO:0042769 | DNA damage response, detection of DNA damage(GO:0042769) |
0.1 | 0.2 | GO:0036480 | neuron intrinsic apoptotic signaling pathway in response to oxidative stress(GO:0036480) regulation of oxidative stress-induced neuron intrinsic apoptotic signaling pathway(GO:1903376) |
0.1 | 0.5 | GO:0002138 | retinoic acid biosynthetic process(GO:0002138) diterpenoid biosynthetic process(GO:0016102) |
0.1 | 0.6 | GO:1901660 | calcium ion export(GO:1901660) |
0.1 | 0.5 | GO:0034975 | protein folding in endoplasmic reticulum(GO:0034975) |
0.1 | 0.2 | GO:0033615 | mitochondrial proton-transporting ATP synthase complex assembly(GO:0033615) |
0.1 | 1.3 | GO:0006346 | methylation-dependent chromatin silencing(GO:0006346) |
0.1 | 0.1 | GO:0060948 | cardiac vascular smooth muscle cell development(GO:0060948) |
0.1 | 0.5 | GO:0045053 | protein retention in Golgi apparatus(GO:0045053) |
0.1 | 0.4 | GO:0048496 | maintenance of organ identity(GO:0048496) |
0.1 | 0.4 | GO:0008594 | photoreceptor cell morphogenesis(GO:0008594) |
0.1 | 3.8 | GO:0002437 | inflammatory response to antigenic stimulus(GO:0002437) |
0.1 | 0.1 | GO:0034983 | peptidyl-lysine deacetylation(GO:0034983) |
0.1 | 0.1 | GO:0010985 | negative regulation of lipoprotein particle clearance(GO:0010985) |
0.1 | 0.1 | GO:0051182 | coenzyme transport(GO:0051182) |
0.1 | 2.4 | GO:0042770 | signal transduction in response to DNA damage(GO:0042770) |
0.1 | 0.5 | GO:0002291 | T cell activation via T cell receptor contact with antigen bound to MHC molecule on antigen presenting cell(GO:0002291) |
0.1 | 0.3 | GO:0001915 | negative regulation of T cell mediated cytotoxicity(GO:0001915) |
0.1 | 0.1 | GO:0061198 | fungiform papilla formation(GO:0061198) |
0.1 | 4.4 | GO:0006418 | tRNA aminoacylation for protein translation(GO:0006418) |
0.1 | 0.2 | GO:0032497 | detection of lipopolysaccharide(GO:0032497) |
0.1 | 0.2 | GO:0060298 | positive regulation of sarcomere organization(GO:0060298) |
0.1 | 0.2 | GO:0023021 | termination of signal transduction(GO:0023021) |
0.1 | 0.3 | GO:0046784 | viral mRNA export from host cell nucleus(GO:0046784) |
0.1 | 0.6 | GO:0018904 | ether metabolic process(GO:0018904) |
0.1 | 0.6 | GO:0036159 | inner dynein arm assembly(GO:0036159) |
0.1 | 1.0 | GO:0002115 | store-operated calcium entry(GO:0002115) |
0.1 | 0.3 | GO:0051001 | negative regulation of nitric-oxide synthase activity(GO:0051001) |
0.1 | 0.4 | GO:0006012 | galactose metabolic process(GO:0006012) |
0.1 | 2.0 | GO:0000266 | mitochondrial fission(GO:0000266) |
0.1 | 0.3 | GO:0061668 | mitochondrial ribosome assembly(GO:0061668) mitochondrial large ribosomal subunit assembly(GO:1902775) |
0.1 | 0.7 | GO:0032392 | DNA geometric change(GO:0032392) |
0.1 | 1.1 | GO:0000463 | maturation of LSU-rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000463) |
0.1 | 0.9 | GO:0042135 | neurotransmitter catabolic process(GO:0042135) |
0.1 | 0.3 | GO:0033387 | putrescine biosynthetic process from ornithine(GO:0033387) |
0.1 | 0.1 | GO:0048850 | hypophysis morphogenesis(GO:0048850) |
0.1 | 1.7 | GO:0032967 | positive regulation of collagen biosynthetic process(GO:0032967) |
0.1 | 0.3 | GO:0030202 | heparin metabolic process(GO:0030202) |
0.1 | 0.4 | GO:0042364 | water-soluble vitamin biosynthetic process(GO:0042364) |
0.1 | 0.3 | GO:0060159 | regulation of dopamine receptor signaling pathway(GO:0060159) |
0.1 | 0.7 | GO:0035435 | phosphate ion transmembrane transport(GO:0035435) |
0.1 | 0.3 | GO:0021914 | negative regulation of smoothened signaling pathway involved in ventral spinal cord patterning(GO:0021914) |
0.1 | 0.4 | GO:0010890 | positive regulation of sequestering of triglyceride(GO:0010890) |
0.1 | 1.8 | GO:0019432 | triglyceride biosynthetic process(GO:0019432) |
0.1 | 0.5 | GO:0045945 | positive regulation of transcription from RNA polymerase III promoter(GO:0045945) |
0.1 | 1.3 | GO:0010508 | positive regulation of autophagy(GO:0010508) |
0.1 | 0.1 | GO:0046100 | hypoxanthine metabolic process(GO:0046100) hypoxanthine biosynthetic process(GO:0046101) |
0.1 | 0.1 | GO:0002924 | negative regulation of humoral immune response mediated by circulating immunoglobulin(GO:0002924) |
0.1 | 0.1 | GO:0017014 | protein nitrosylation(GO:0017014) |
0.1 | 1.1 | GO:0034497 | protein localization to pre-autophagosomal structure(GO:0034497) |
0.1 | 0.2 | GO:0006362 | transcription elongation from RNA polymerase I promoter(GO:0006362) |
0.1 | 0.2 | GO:0006391 | transcription initiation from mitochondrial promoter(GO:0006391) |
0.1 | 0.2 | GO:2000354 | regulation of ovarian follicle development(GO:2000354) |
0.1 | 0.1 | GO:1904690 | regulation of cap-independent translational initiation(GO:1903677) positive regulation of cap-independent translational initiation(GO:1903679) regulation of cytoplasmic translational initiation(GO:1904688) positive regulation of cytoplasmic translational initiation(GO:1904690) |
0.1 | 0.6 | GO:0032486 | Rap protein signal transduction(GO:0032486) |
0.1 | 0.7 | GO:0016242 | negative regulation of macroautophagy(GO:0016242) |
0.1 | 0.3 | GO:0036444 | calcium ion transmembrane import into mitochondrion(GO:0036444) |
0.1 | 0.5 | GO:0006548 | histidine catabolic process(GO:0006548) imidazole-containing compound catabolic process(GO:0052805) |
0.1 | 0.2 | GO:1902202 | regulation of hepatocyte growth factor receptor signaling pathway(GO:1902202) |
0.1 | 0.2 | GO:0031294 | lymphocyte costimulation(GO:0031294) |
0.1 | 0.3 | GO:0051574 | positive regulation of histone H3-K9 methylation(GO:0051574) |
0.1 | 0.3 | GO:0020027 | hemoglobin metabolic process(GO:0020027) |
0.1 | 0.9 | GO:0006750 | glutathione biosynthetic process(GO:0006750) |
0.1 | 0.8 | GO:0036297 | interstrand cross-link repair(GO:0036297) |
0.1 | 1.1 | GO:0071480 | cellular response to gamma radiation(GO:0071480) |
0.1 | 1.3 | GO:0060236 | regulation of mitotic spindle organization(GO:0060236) |
0.1 | 1.3 | GO:0031163 | iron-sulfur cluster assembly(GO:0016226) metallo-sulfur cluster assembly(GO:0031163) |
0.1 | 0.7 | GO:0010759 | positive regulation of macrophage chemotaxis(GO:0010759) |
0.1 | 0.6 | GO:0006102 | isocitrate metabolic process(GO:0006102) |
0.1 | 0.3 | GO:0009298 | GDP-mannose biosynthetic process(GO:0009298) |
0.1 | 1.6 | GO:0000413 | protein peptidyl-prolyl isomerization(GO:0000413) |
0.1 | 1.3 | GO:0006270 | DNA replication initiation(GO:0006270) |
0.1 | 0.3 | GO:0015888 | thiamine transport(GO:0015888) |
0.1 | 0.1 | GO:0006551 | leucine metabolic process(GO:0006551) |
0.1 | 0.4 | GO:2000628 | regulation of miRNA metabolic process(GO:2000628) |
0.1 | 0.6 | GO:0016075 | rRNA catabolic process(GO:0016075) |
0.1 | 0.3 | GO:0090435 | protein localization to nuclear envelope(GO:0090435) |
0.1 | 0.2 | GO:1990036 | calcium ion import into sarcoplasmic reticulum(GO:1990036) |
0.1 | 0.2 | GO:0042532 | negative regulation of tyrosine phosphorylation of STAT protein(GO:0042532) |
0.1 | 0.3 | GO:0043578 | nuclear matrix organization(GO:0043578) nuclear matrix anchoring at nuclear membrane(GO:0090292) |
0.1 | 0.1 | GO:0045626 | negative regulation of T-helper 1 cell differentiation(GO:0045626) |
0.1 | 0.2 | GO:0032020 | ISG15-protein conjugation(GO:0032020) |
0.1 | 0.1 | GO:0044253 | positive regulation of collagen metabolic process(GO:0010714) positive regulation of multicellular organismal metabolic process(GO:0044253) |
0.1 | 0.4 | GO:0006903 | vesicle targeting(GO:0006903) |
0.1 | 0.2 | GO:0006382 | adenosine to inosine editing(GO:0006382) |
0.1 | 0.5 | GO:0003376 | sphingosine-1-phosphate signaling pathway(GO:0003376) |
0.1 | 0.1 | GO:0032717 | negative regulation of interleukin-8 production(GO:0032717) |
0.1 | 0.2 | GO:0072678 | T cell migration(GO:0072678) |
0.1 | 0.1 | GO:2001180 | negative regulation of interleukin-10 secretion(GO:2001180) |
0.1 | 0.9 | GO:0035455 | response to interferon-alpha(GO:0035455) |
0.1 | 0.9 | GO:0006560 | proline metabolic process(GO:0006560) |
0.1 | 0.1 | GO:1900747 | negative regulation of vascular endothelial growth factor signaling pathway(GO:1900747) |
0.1 | 0.3 | GO:0001842 | neural fold formation(GO:0001842) |
0.1 | 0.3 | GO:1901727 | regulation of histone deacetylase activity(GO:1901725) positive regulation of histone deacetylase activity(GO:1901727) |
0.1 | 0.2 | GO:0032988 | ribonucleoprotein complex disassembly(GO:0032988) |
0.1 | 2.1 | GO:0018279 | protein N-linked glycosylation via asparagine(GO:0018279) |
0.1 | 1.5 | GO:1900087 | positive regulation of G1/S transition of mitotic cell cycle(GO:1900087) |
0.1 | 0.2 | GO:0042256 | mature ribosome assembly(GO:0042256) |
0.1 | 0.4 | GO:0018202 | peptidyl-histidine modification(GO:0018202) |
0.1 | 0.4 | GO:0018103 | protein C-linked glycosylation(GO:0018103) peptidyl-tryptophan modification(GO:0018211) protein C-linked glycosylation via tryptophan(GO:0018317) protein C-linked glycosylation via 2'-alpha-mannosyl-L-tryptophan(GO:0018406) |
0.1 | 0.4 | GO:0045617 | negative regulation of keratinocyte differentiation(GO:0045617) |
0.1 | 0.2 | GO:0090231 | regulation of spindle checkpoint(GO:0090231) |
0.1 | 1.3 | GO:0051310 | metaphase plate congression(GO:0051310) |
0.1 | 0.6 | GO:0010965 | regulation of mitotic sister chromatid separation(GO:0010965) |
0.1 | 0.3 | GO:2000344 | positive regulation of acrosome reaction(GO:2000344) |
0.1 | 0.1 | GO:1901165 | positive regulation of trophoblast cell migration(GO:1901165) |
0.1 | 0.1 | GO:0009838 | abscission(GO:0009838) |
0.1 | 3.3 | GO:1901800 | positive regulation of proteasomal protein catabolic process(GO:1901800) |
0.1 | 0.3 | GO:0046598 | positive regulation of viral entry into host cell(GO:0046598) |
0.1 | 0.2 | GO:0001692 | histamine metabolic process(GO:0001692) |
0.1 | 0.9 | GO:0003351 | epithelial cilium movement(GO:0003351) |
0.1 | 0.3 | GO:0035524 | proline transmembrane transport(GO:0035524) |
0.1 | 0.5 | GO:1903901 | negative regulation of viral life cycle(GO:1903901) |
0.1 | 0.1 | GO:0010248 | establishment or maintenance of transmembrane electrochemical gradient(GO:0010248) |
0.1 | 5.2 | GO:0007051 | spindle organization(GO:0007051) |
0.1 | 1.8 | GO:0070936 | protein K48-linked ubiquitination(GO:0070936) |
0.1 | 0.3 | GO:0019287 | isopentenyl diphosphate biosynthetic process(GO:0009240) isopentenyl diphosphate biosynthetic process, mevalonate pathway(GO:0019287) |
0.1 | 0.1 | GO:0060244 | negative regulation of cell proliferation involved in contact inhibition(GO:0060244) |
0.1 | 0.3 | GO:0030223 | neutrophil differentiation(GO:0030223) |
0.1 | 0.7 | GO:0016926 | protein desumoylation(GO:0016926) |
0.1 | 0.2 | GO:0033133 | positive regulation of glucokinase activity(GO:0033133) positive regulation of hexokinase activity(GO:1903301) |
0.1 | 0.3 | GO:0070934 | CRD-mediated mRNA stabilization(GO:0070934) |
0.1 | 1.5 | GO:0033120 | positive regulation of RNA splicing(GO:0033120) |
0.1 | 1.6 | GO:0007129 | synapsis(GO:0007129) |
0.1 | 0.2 | GO:0048069 | eye pigmentation(GO:0048069) |
0.1 | 1.4 | GO:1903146 | regulation of mitophagy(GO:1903146) |
0.1 | 2.9 | GO:0002323 | natural killer cell activation involved in immune response(GO:0002323) |
0.1 | 0.9 | GO:0032008 | positive regulation of TOR signaling(GO:0032008) |
0.1 | 0.2 | GO:0033262 | regulation of nuclear cell cycle DNA replication(GO:0033262) |
0.1 | 0.2 | GO:0035426 | extracellular matrix-cell signaling(GO:0035426) |
0.1 | 0.3 | GO:1901984 | negative regulation of protein acetylation(GO:1901984) |
0.1 | 0.2 | GO:0070423 | nucleotide-binding domain, leucine rich repeat containing receptor signaling pathway(GO:0035872) nucleotide-binding oligomerization domain containing signaling pathway(GO:0070423) nucleotide-binding oligomerization domain containing 2 signaling pathway(GO:0070431) |
0.1 | 0.7 | GO:0015858 | nucleoside transport(GO:0015858) |
0.1 | 0.1 | GO:0051024 | positive regulation of immunoglobulin secretion(GO:0051024) |
0.1 | 0.2 | GO:0042126 | nitrate metabolic process(GO:0042126) |
0.1 | 0.2 | GO:0034380 | high-density lipoprotein particle assembly(GO:0034380) |
0.1 | 0.3 | GO:0048096 | chromatin-mediated maintenance of transcription(GO:0048096) |
0.1 | 0.2 | GO:0032000 | positive regulation of fatty acid beta-oxidation(GO:0032000) |
0.1 | 0.2 | GO:0046013 | T cell homeostatic proliferation(GO:0001777) regulation of T cell homeostatic proliferation(GO:0046013) |
0.1 | 0.1 | GO:0018894 | dibenzo-p-dioxin metabolic process(GO:0018894) |
0.1 | 0.2 | GO:0019859 | pyrimidine nucleobase catabolic process(GO:0006208) thymine catabolic process(GO:0006210) thymine metabolic process(GO:0019859) |
0.1 | 0.1 | GO:0035795 | negative regulation of mitochondrial membrane permeability(GO:0035795) |
0.1 | 0.9 | GO:0042574 | retinal metabolic process(GO:0042574) |
0.1 | 0.4 | GO:0015695 | organic cation transport(GO:0015695) |
0.1 | 0.2 | GO:0015886 | heme transport(GO:0015886) |
0.1 | 0.5 | GO:0002335 | mature B cell differentiation(GO:0002335) |
0.1 | 0.2 | GO:0002679 | respiratory burst involved in defense response(GO:0002679) |
0.1 | 0.2 | GO:0060126 | somatotropin secreting cell differentiation(GO:0060126) |
0.1 | 0.1 | GO:0009106 | lipoate metabolic process(GO:0009106) |
0.1 | 0.2 | GO:0045578 | negative regulation of B cell differentiation(GO:0045578) |
0.1 | 0.2 | GO:0010886 | positive regulation of cholesterol storage(GO:0010886) |
0.1 | 0.2 | GO:0061314 | Notch signaling involved in heart development(GO:0061314) |
0.1 | 0.2 | GO:0072718 | response to cisplatin(GO:0072718) |
0.1 | 0.1 | GO:1902547 | regulation of cellular response to vascular endothelial growth factor stimulus(GO:1902547) |
0.1 | 0.5 | GO:0001867 | complement activation, lectin pathway(GO:0001867) |
0.1 | 0.2 | GO:0030321 | transepithelial chloride transport(GO:0030321) |
0.1 | 0.1 | GO:0007039 | protein catabolic process in the vacuole(GO:0007039) |
0.1 | 0.2 | GO:0046878 | positive regulation of saliva secretion(GO:0046878) |
0.1 | 0.4 | GO:0032933 | response to sterol depletion(GO:0006991) SREBP signaling pathway(GO:0032933) cellular response to sterol depletion(GO:0071501) |
0.1 | 1.3 | GO:0045824 | negative regulation of innate immune response(GO:0045824) |
0.1 | 0.2 | GO:0046951 | ketone body biosynthetic process(GO:0046951) |
0.1 | 0.5 | GO:0019985 | translesion synthesis(GO:0019985) |
0.1 | 0.1 | GO:0035898 | parathyroid hormone secretion(GO:0035898) |
0.1 | 0.4 | GO:0019321 | pentose metabolic process(GO:0019321) |
0.1 | 0.1 | GO:0060454 | positive regulation of gastric acid secretion(GO:0060454) |
0.1 | 1.5 | GO:0016180 | snRNA processing(GO:0016180) |
0.1 | 0.1 | GO:2000325 | regulation of ligand-dependent nuclear receptor transcription coactivator activity(GO:2000325) positive regulation of ligand-dependent nuclear receptor transcription coactivator activity(GO:2000327) |
0.1 | 3.9 | GO:0019369 | arachidonic acid metabolic process(GO:0019369) |
0.1 | 0.1 | GO:0002525 | acute inflammatory response to non-antigenic stimulus(GO:0002525) |
0.1 | 0.1 | GO:2001197 | regulation of basement membrane assembly involved in embryonic body morphogenesis(GO:1904259) positive regulation of basement membrane assembly involved in embryonic body morphogenesis(GO:1904261) basement membrane assembly involved in embryonic body morphogenesis(GO:2001197) |
0.1 | 0.2 | GO:1904948 | midbrain dopaminergic neuron differentiation(GO:1904948) |
0.1 | 0.9 | GO:0006144 | purine nucleobase metabolic process(GO:0006144) |
0.1 | 0.6 | GO:0008299 | isoprenoid biosynthetic process(GO:0008299) |
0.1 | 0.6 | GO:0007095 | mitotic G2 DNA damage checkpoint(GO:0007095) |
0.1 | 0.4 | GO:0045040 | protein import into mitochondrial outer membrane(GO:0045040) |
0.1 | 0.1 | GO:2001225 | regulation of chloride transport(GO:2001225) |
0.1 | 0.4 | GO:0090200 | positive regulation of release of cytochrome c from mitochondria(GO:0090200) |
0.1 | 0.1 | GO:1900164 | nodal signaling pathway involved in determination of left/right asymmetry(GO:0038107) regulation of transcription from RNA polymerase II promoter involved in determination of left/right symmetry(GO:1900094) nodal signaling pathway involved in determination of lateral mesoderm left/right asymmetry(GO:1900164) |
0.1 | 0.1 | GO:0002913 | positive regulation of T cell anergy(GO:0002669) positive regulation of lymphocyte anergy(GO:0002913) |
0.1 | 0.3 | GO:0015838 | amino-acid betaine transport(GO:0015838) |
0.1 | 0.4 | GO:0051639 | actin filament network formation(GO:0051639) |
0.1 | 0.1 | GO:1905065 | positive regulation of vascular smooth muscle cell differentiation(GO:1905065) |
0.1 | 0.1 | GO:1900077 | negative regulation of cellular response to insulin stimulus(GO:1900077) |
0.1 | 0.2 | GO:0032788 | saturated monocarboxylic acid metabolic process(GO:0032788) unsaturated monocarboxylic acid metabolic process(GO:0032789) |
0.1 | 0.6 | GO:1901072 | glucosamine-containing compound catabolic process(GO:1901072) |
0.1 | 0.3 | GO:0000731 | DNA synthesis involved in DNA repair(GO:0000731) |
0.1 | 0.4 | GO:0042635 | positive regulation of hair cycle(GO:0042635) positive regulation of hair follicle development(GO:0051798) |
0.1 | 0.8 | GO:0099500 | synaptic vesicle fusion to presynaptic active zone membrane(GO:0031629) vesicle fusion to plasma membrane(GO:0099500) |
0.1 | 0.4 | GO:0046415 | urate metabolic process(GO:0046415) |
0.1 | 0.4 | GO:0009048 | dosage compensation(GO:0007549) dosage compensation by inactivation of X chromosome(GO:0009048) |
0.1 | 0.1 | GO:0038095 | Fc-epsilon receptor signaling pathway(GO:0038095) |
0.1 | 0.1 | GO:0006659 | phosphatidylserine biosynthetic process(GO:0006659) |
0.1 | 0.1 | GO:0030578 | PML body organization(GO:0030578) |
0.1 | 0.2 | GO:0060689 | cell differentiation involved in salivary gland development(GO:0060689) |
0.1 | 0.1 | GO:1902608 | regulation of large conductance calcium-activated potassium channel activity(GO:1902606) positive regulation of large conductance calcium-activated potassium channel activity(GO:1902608) |
0.1 | 0.2 | GO:0043328 | late endosome to vacuole transport via multivesicular body sorting pathway(GO:0032511) protein targeting to vacuole involved in ubiquitin-dependent protein catabolic process via the multivesicular body sorting pathway(GO:0043328) |
0.1 | 1.5 | GO:0000027 | ribosomal large subunit assembly(GO:0000027) |
0.1 | 0.9 | GO:0006376 | mRNA splice site selection(GO:0006376) |
0.1 | 0.1 | GO:0048861 | leukemia inhibitory factor signaling pathway(GO:0048861) |
0.1 | 0.1 | GO:0051596 | methylglyoxal catabolic process to D-lactate via S-lactoyl-glutathione(GO:0019243) methylglyoxal catabolic process(GO:0051596) methylglyoxal catabolic process to lactate(GO:0061727) |
0.1 | 0.3 | GO:0000729 | DNA double-strand break processing(GO:0000729) |
0.1 | 0.1 | GO:0040009 | regulation of growth rate(GO:0040009) |
0.1 | 1.0 | GO:0048741 | skeletal muscle fiber development(GO:0048741) |
0.1 | 1.0 | GO:0045604 | regulation of epidermal cell differentiation(GO:0045604) |
0.1 | 0.1 | GO:0042508 | tyrosine phosphorylation of Stat1 protein(GO:0042508) |
0.1 | 1.1 | GO:0006778 | porphyrin-containing compound metabolic process(GO:0006778) |
0.1 | 0.1 | GO:0018065 | protein-cofactor linkage(GO:0018065) |
0.1 | 0.1 | GO:0051103 | DNA ligation involved in DNA repair(GO:0051103) |
0.1 | 0.1 | GO:0007217 | tachykinin receptor signaling pathway(GO:0007217) |
0.1 | 0.2 | GO:0060087 | relaxation of vascular smooth muscle(GO:0060087) |
0.1 | 0.2 | GO:0010626 | negative regulation of Schwann cell proliferation(GO:0010626) |
0.1 | 0.4 | GO:0033617 | mitochondrial respiratory chain complex IV assembly(GO:0033617) mitochondrial respiratory chain complex IV biogenesis(GO:0097034) |
0.1 | 0.1 | GO:0042374 | phylloquinone metabolic process(GO:0042374) phylloquinone catabolic process(GO:0042376) quinone catabolic process(GO:1901662) |
0.1 | 0.1 | GO:0090205 | positive regulation of cholesterol biosynthetic process(GO:0045542) positive regulation of cholesterol metabolic process(GO:0090205) |
0.1 | 0.4 | GO:0052472 | modulation by host of viral transcription(GO:0043921) modulation of transcription in other organism involved in symbiotic interaction(GO:0052312) modulation by host of symbiont transcription(GO:0052472) |
0.1 | 0.1 | GO:0043307 | eosinophil activation involved in immune response(GO:0002278) eosinophil mediated immunity(GO:0002447) eosinophil activation(GO:0043307) eosinophil degranulation(GO:0043308) |
0.1 | 0.7 | GO:0001675 | acrosome assembly(GO:0001675) |
0.1 | 0.5 | GO:0033344 | cholesterol efflux(GO:0033344) |
0.1 | 0.1 | GO:0006907 | pinocytosis(GO:0006907) |
0.1 | 1.0 | GO:2000249 | regulation of actin cytoskeleton reorganization(GO:2000249) |
0.1 | 0.4 | GO:0000338 | protein deneddylation(GO:0000338) cullin deneddylation(GO:0010388) |
0.1 | 0.2 | GO:0030327 | prenylated protein catabolic process(GO:0030327) |
0.1 | 0.1 | GO:0031914 | negative regulation of synaptic plasticity(GO:0031914) |
0.1 | 0.3 | GO:0070572 | positive regulation of axon regeneration(GO:0048680) positive regulation of neuron projection regeneration(GO:0070572) |
0.1 | 0.4 | GO:0051084 | 'de novo' protein folding(GO:0006458) 'de novo' posttranslational protein folding(GO:0051084) |
0.1 | 0.9 | GO:0070830 | bicellular tight junction assembly(GO:0070830) |
0.1 | 0.4 | GO:0070584 | mitochondrion morphogenesis(GO:0070584) |
0.1 | 0.2 | GO:2000643 | positive regulation of early endosome to late endosome transport(GO:2000643) |
0.1 | 0.7 | GO:0042771 | intrinsic apoptotic signaling pathway in response to DNA damage by p53 class mediator(GO:0042771) |
0.1 | 0.9 | GO:0006695 | cholesterol biosynthetic process(GO:0006695) secondary alcohol biosynthetic process(GO:1902653) |
0.1 | 0.1 | GO:0090084 | negative regulation of inclusion body assembly(GO:0090084) |
0.1 | 0.1 | GO:1904058 | positive regulation of sensory perception of pain(GO:1904058) |
0.1 | 0.7 | GO:1901799 | negative regulation of proteasomal protein catabolic process(GO:1901799) |
0.1 | 0.2 | GO:0015766 | disaccharide transport(GO:0015766) sucrose transport(GO:0015770) oligosaccharide transport(GO:0015772) |
0.1 | 0.4 | GO:0042516 | regulation of tyrosine phosphorylation of Stat3 protein(GO:0042516) |
0.1 | 0.1 | GO:0039694 | viral RNA genome replication(GO:0039694) RNA replication(GO:0039703) |
0.1 | 2.0 | GO:0006986 | response to unfolded protein(GO:0006986) |
0.1 | 0.4 | GO:0051382 | kinetochore assembly(GO:0051382) kinetochore organization(GO:0051383) |
0.1 | 0.1 | GO:1904180 | negative regulation of mitochondrial depolarization(GO:0051902) negative regulation of membrane depolarization(GO:1904180) |
0.1 | 0.7 | GO:0034724 | DNA replication-independent nucleosome assembly(GO:0006336) DNA replication-independent nucleosome organization(GO:0034724) |
0.1 | 0.2 | GO:2000188 | regulation of cholesterol homeostasis(GO:2000188) |
0.1 | 0.4 | GO:0006390 | transcription from mitochondrial promoter(GO:0006390) |
0.1 | 1.4 | GO:0006446 | regulation of translational initiation(GO:0006446) |
0.1 | 0.7 | GO:0006098 | pentose-phosphate shunt(GO:0006098) |
0.1 | 0.1 | GO:0008298 | intracellular mRNA localization(GO:0008298) |
0.1 | 0.1 | GO:0070318 | positive regulation of G0 to G1 transition(GO:0070318) |
0.1 | 0.4 | GO:0006744 | ubiquinone biosynthetic process(GO:0006744) |
0.1 | 0.3 | GO:0051568 | histone H3-K4 methylation(GO:0051568) |
0.1 | 0.5 | GO:0097352 | autophagosome maturation(GO:0097352) |
0.1 | 0.8 | GO:0015986 | energy coupled proton transport, down electrochemical gradient(GO:0015985) ATP synthesis coupled proton transport(GO:0015986) |
0.1 | 0.2 | GO:0098534 | centriole assembly(GO:0098534) |
0.1 | 0.2 | GO:0051013 | microtubule severing(GO:0051013) |
0.1 | 0.2 | GO:0051031 | tRNA transport(GO:0051031) |
0.1 | 0.4 | GO:0006656 | phosphatidylcholine biosynthetic process(GO:0006656) |
0.1 | 0.3 | GO:0030917 | midbrain-hindbrain boundary development(GO:0030917) |
0.1 | 0.6 | GO:0050884 | neuromuscular process controlling posture(GO:0050884) |
0.1 | 0.5 | GO:0048535 | lymph node development(GO:0048535) |
0.1 | 0.3 | GO:0051967 | negative regulation of synaptic transmission, glutamatergic(GO:0051967) |
0.1 | 0.1 | GO:0001302 | replicative cell aging(GO:0001302) |
0.1 | 0.1 | GO:1904059 | regulation of locomotor rhythm(GO:1904059) |
0.1 | 0.1 | GO:0001732 | formation of cytoplasmic translation initiation complex(GO:0001732) |
0.1 | 1.1 | GO:2001243 | negative regulation of intrinsic apoptotic signaling pathway(GO:2001243) |
0.1 | 0.1 | GO:0032897 | negative regulation of viral transcription(GO:0032897) |
0.1 | 0.8 | GO:0090162 | establishment of epithelial cell polarity(GO:0090162) |
0.1 | 0.1 | GO:0070889 | platelet alpha granule organization(GO:0070889) |
0.1 | 0.3 | GO:0061179 | negative regulation of insulin secretion involved in cellular response to glucose stimulus(GO:0061179) |
0.1 | 0.2 | GO:0007035 | vacuolar acidification(GO:0007035) |
0.1 | 0.4 | GO:0009226 | nucleotide-sugar biosynthetic process(GO:0009226) |
0.1 | 0.1 | GO:1902235 | regulation of endoplasmic reticulum stress-induced intrinsic apoptotic signaling pathway(GO:1902235) |
0.1 | 0.1 | GO:0002086 | diaphragm contraction(GO:0002086) |
0.1 | 0.1 | GO:0034395 | regulation of transcription from RNA polymerase II promoter in response to iron(GO:0034395) |
0.1 | 0.1 | GO:0071280 | cellular response to copper ion(GO:0071280) |
0.1 | 0.1 | GO:0048294 | negative regulation of isotype switching to IgE isotypes(GO:0048294) |
0.1 | 0.2 | GO:2000609 | regulation of thyroid hormone generation(GO:2000609) |
0.1 | 0.2 | GO:0050872 | white fat cell differentiation(GO:0050872) |
0.1 | 0.5 | GO:0045116 | protein neddylation(GO:0045116) |
0.1 | 0.3 | GO:0034067 | protein localization to Golgi apparatus(GO:0034067) |
0.1 | 0.4 | GO:0007213 | G-protein coupled acetylcholine receptor signaling pathway(GO:0007213) |
0.1 | 1.0 | GO:0046854 | phosphatidylinositol phosphorylation(GO:0046854) |
0.1 | 0.4 | GO:0009250 | glycogen biosynthetic process(GO:0005978) glucan biosynthetic process(GO:0009250) |
0.1 | 0.2 | GO:0043984 | histone H4-K16 acetylation(GO:0043984) |
0.1 | 0.1 | GO:0090037 | positive regulation of protein kinase C signaling(GO:0090037) |
0.1 | 0.2 | GO:0033147 | negative regulation of intracellular estrogen receptor signaling pathway(GO:0033147) |
0.1 | 0.2 | GO:0006855 | drug transmembrane transport(GO:0006855) |
0.1 | 0.1 | GO:0010700 | negative regulation of norepinephrine secretion(GO:0010700) |
0.1 | 0.2 | GO:0035966 | response to topologically incorrect protein(GO:0035966) |
0.1 | 0.1 | GO:0010944 | negative regulation of transcription by competitive promoter binding(GO:0010944) |
0.1 | 1.2 | GO:0006730 | one-carbon metabolic process(GO:0006730) |
0.1 | 0.1 | GO:0070671 | response to interleukin-12(GO:0070671) |
0.0 | 0.0 | GO:0070831 | basement membrane assembly(GO:0070831) |
0.0 | 0.2 | GO:0050915 | sensory perception of sour taste(GO:0050915) |
0.0 | 0.1 | GO:0090050 | positive regulation of cell migration involved in sprouting angiogenesis(GO:0090050) |
0.0 | 0.0 | GO:0021557 | oculomotor nerve development(GO:0021557) |
0.0 | 0.0 | GO:0044539 | long-chain fatty acid import(GO:0044539) |
0.0 | 0.0 | GO:0009188 | ribonucleoside diphosphate biosynthetic process(GO:0009188) |
0.0 | 0.3 | GO:0071353 | cellular response to interleukin-4(GO:0071353) |
0.0 | 0.4 | GO:0051973 | positive regulation of telomerase activity(GO:0051973) |
0.0 | 0.1 | GO:0070668 | mast cell proliferation(GO:0070662) regulation of mast cell proliferation(GO:0070666) positive regulation of mast cell proliferation(GO:0070668) |
0.0 | 0.0 | GO:0060363 | cranial suture morphogenesis(GO:0060363) |
0.0 | 1.0 | GO:0006378 | mRNA polyadenylation(GO:0006378) RNA polyadenylation(GO:0043631) |
0.0 | 0.1 | GO:0036233 | glycine import(GO:0036233) |
0.0 | 0.2 | GO:0051127 | positive regulation of actin nucleation(GO:0051127) |
0.0 | 0.0 | GO:0002923 | regulation of humoral immune response mediated by circulating immunoglobulin(GO:0002923) |
0.0 | 0.5 | GO:0050901 | leukocyte tethering or rolling(GO:0050901) |
0.0 | 0.5 | GO:0045475 | locomotor rhythm(GO:0045475) |
0.0 | 0.0 | GO:0039530 | MDA-5 signaling pathway(GO:0039530) |
0.0 | 0.2 | GO:2000253 | positive regulation of feeding behavior(GO:2000253) |
0.0 | 0.1 | GO:0006532 | aspartate biosynthetic process(GO:0006532) |
0.0 | 0.0 | GO:0097212 | lysosomal membrane organization(GO:0097212) |
0.0 | 0.1 | GO:0006265 | DNA topological change(GO:0006265) |
0.0 | 0.0 | GO:0043651 | linoleic acid metabolic process(GO:0043651) |
0.0 | 0.0 | GO:0051106 | regulation of DNA ligation(GO:0051105) positive regulation of DNA ligation(GO:0051106) |
0.0 | 0.0 | GO:0009186 | deoxyribonucleoside diphosphate metabolic process(GO:0009186) |
0.0 | 0.2 | GO:0000076 | DNA replication checkpoint(GO:0000076) |
0.0 | 0.1 | GO:0006301 | postreplication repair(GO:0006301) |
0.0 | 0.0 | GO:0046102 | inosine metabolic process(GO:0046102) |
0.0 | 0.0 | GO:0060335 | positive regulation of response to interferon-gamma(GO:0060332) positive regulation of interferon-gamma-mediated signaling pathway(GO:0060335) |
0.0 | 0.3 | GO:2001241 | positive regulation of extrinsic apoptotic signaling pathway in absence of ligand(GO:2001241) |
0.0 | 0.0 | GO:2000224 | regulation of testosterone biosynthetic process(GO:2000224) |
0.0 | 1.3 | GO:0010501 | RNA secondary structure unwinding(GO:0010501) |
0.0 | 0.0 | GO:0002457 | T cell antigen processing and presentation(GO:0002457) |
0.0 | 0.2 | GO:0000056 | ribosomal small subunit export from nucleus(GO:0000056) |
0.0 | 0.2 | GO:0051971 | positive regulation of transmission of nerve impulse(GO:0051971) |
0.0 | 0.5 | GO:0007093 | mitotic cell cycle checkpoint(GO:0007093) |
0.0 | 0.1 | GO:2000316 | regulation of T-helper 17 type immune response(GO:2000316) |
0.0 | 0.2 | GO:0042492 | gamma-delta T cell differentiation(GO:0042492) |
0.0 | 0.2 | GO:0036010 | protein localization to endosome(GO:0036010) |
0.0 | 0.2 | GO:0048733 | sebaceous gland development(GO:0048733) |
0.0 | 0.1 | GO:0035188 | blastocyst hatching(GO:0001835) hatching(GO:0035188) organism emergence from protective structure(GO:0071684) |
0.0 | 0.0 | GO:0048012 | hepatocyte growth factor receptor signaling pathway(GO:0048012) |
0.0 | 0.0 | GO:0015712 | hexose phosphate transport(GO:0015712) glucose-6-phosphate transport(GO:0015760) |
0.0 | 0.1 | GO:0042780 | tRNA 3'-end processing(GO:0042780) |
0.0 | 0.0 | GO:0019344 | cysteine biosynthetic process(GO:0019344) |
0.0 | 0.1 | GO:2001182 | regulation of interleukin-12 secretion(GO:2001182) |
0.0 | 0.2 | GO:0032534 | regulation of microvillus assembly(GO:0032534) |
0.0 | 0.1 | GO:1901491 | negative regulation of lymphangiogenesis(GO:1901491) |
0.0 | 0.2 | GO:0048009 | insulin-like growth factor receptor signaling pathway(GO:0048009) |
0.0 | 0.9 | GO:0043966 | histone H3 acetylation(GO:0043966) |
0.0 | 0.3 | GO:1901522 | positive regulation of transcription from RNA polymerase II promoter involved in cellular response to chemical stimulus(GO:1901522) |
0.0 | 0.3 | GO:1902042 | negative regulation of extrinsic apoptotic signaling pathway via death domain receptors(GO:1902042) |
0.0 | 0.1 | GO:0009794 | regulation of mitotic cell cycle, embryonic(GO:0009794) mitotic cell cycle, embryonic(GO:0045448) |
0.0 | 0.1 | GO:0060916 | mesenchymal cell proliferation involved in lung development(GO:0060916) |
0.0 | 0.1 | GO:0070192 | chromosome organization involved in meiotic cell cycle(GO:0070192) |
0.0 | 0.1 | GO:0006116 | NADH oxidation(GO:0006116) |
0.0 | 0.0 | GO:0071877 | regulation of adrenergic receptor signaling pathway(GO:0071877) |
0.0 | 0.1 | GO:0090074 | negative regulation of protein homodimerization activity(GO:0090074) |
0.0 | 0.8 | GO:0007569 | cell aging(GO:0007569) |
0.0 | 0.2 | GO:0016126 | sterol biosynthetic process(GO:0016126) |
0.0 | 0.1 | GO:0036486 | trunk segmentation(GO:0035290) trunk neural crest cell migration(GO:0036484) ventral trunk neural crest cell migration(GO:0036486) sympathetic neuron projection extension(GO:0097490) sympathetic neuron projection guidance(GO:0097491) |
0.0 | 0.0 | GO:0010603 | regulation of cytoplasmic mRNA processing body assembly(GO:0010603) |
0.0 | 0.0 | GO:0010159 | specification of organ position(GO:0010159) |
0.0 | 0.1 | GO:0050434 | positive regulation of viral transcription(GO:0050434) |
0.0 | 0.0 | GO:0044336 | canonical Wnt signaling pathway involved in negative regulation of apoptotic process(GO:0044336) |
0.0 | 0.0 | GO:0048677 | axon extension involved in regeneration(GO:0048677) sprouting of injured axon(GO:0048682) |
0.0 | 0.2 | GO:0070234 | positive regulation of T cell apoptotic process(GO:0070234) |
0.0 | 0.1 | GO:0036265 | RNA (guanine-N7)-methylation(GO:0036265) |
0.0 | 0.8 | GO:0042273 | ribosomal large subunit biogenesis(GO:0042273) |
0.0 | 0.1 | GO:0014072 | response to isoquinoline alkaloid(GO:0014072) response to morphine(GO:0043278) |
0.0 | 0.2 | GO:0050917 | sensory perception of umami taste(GO:0050917) |
0.0 | 0.1 | GO:0070126 | mitochondrial translational termination(GO:0070126) |
0.0 | 0.0 | GO:0071635 | negative regulation of transforming growth factor beta production(GO:0071635) |
0.0 | 0.0 | GO:0042737 | drug catabolic process(GO:0042737) |
0.0 | 0.0 | GO:0045988 | negative regulation of striated muscle contraction(GO:0045988) |
0.0 | 1.1 | GO:0032543 | mitochondrial translation(GO:0032543) |
0.0 | 0.0 | GO:0070391 | response to lipoteichoic acid(GO:0070391) cellular response to lipoteichoic acid(GO:0071223) |
0.0 | 0.1 | GO:0005984 | disaccharide metabolic process(GO:0005984) |
0.0 | 0.2 | GO:0045620 | negative regulation of lymphocyte differentiation(GO:0045620) |
0.0 | 0.3 | GO:0000244 | spliceosomal tri-snRNP complex assembly(GO:0000244) |
0.0 | 0.8 | GO:0008286 | insulin receptor signaling pathway(GO:0008286) |
0.0 | 0.0 | GO:0042226 | interleukin-6 biosynthetic process(GO:0042226) |
0.0 | 0.1 | GO:0048254 | snoRNA localization(GO:0048254) |
0.0 | 0.1 | GO:0031507 | heterochromatin assembly(GO:0031507) |
0.0 | 0.4 | GO:0006308 | DNA catabolic process(GO:0006308) |
0.0 | 0.0 | GO:0008334 | histone mRNA metabolic process(GO:0008334) |
0.0 | 0.0 | GO:0097466 | glycoprotein ERAD pathway(GO:0097466) response to glycoprotein(GO:1904587) |
0.0 | 0.1 | GO:0010804 | negative regulation of tumor necrosis factor-mediated signaling pathway(GO:0010804) |
0.0 | 0.0 | GO:0006296 | nucleotide-excision repair, DNA incision, 5'-to lesion(GO:0006296) |
0.0 | 0.0 | GO:0000730 | DNA recombinase assembly(GO:0000730) double-strand break repair via synthesis-dependent strand annealing(GO:0045003) |
0.0 | 0.2 | GO:0042036 | negative regulation of cytokine biosynthetic process(GO:0042036) |
0.0 | 0.1 | GO:1903025 | regulation of RNA polymerase II regulatory region sequence-specific DNA binding(GO:1903025) |
0.0 | 0.0 | GO:0007060 | male meiosis chromosome segregation(GO:0007060) |
0.0 | 0.1 | GO:0060050 | positive regulation of protein glycosylation(GO:0060050) |
0.0 | 0.0 | GO:0007354 | zygotic determination of anterior/posterior axis, embryo(GO:0007354) |
0.0 | 0.1 | GO:0010165 | response to X-ray(GO:0010165) |
0.0 | 0.2 | GO:0060716 | labyrinthine layer blood vessel development(GO:0060716) |
0.0 | 0.1 | GO:0090269 | fibroblast growth factor production(GO:0090269) regulation of fibroblast growth factor production(GO:0090270) |
0.0 | 0.4 | GO:0042632 | cholesterol homeostasis(GO:0042632) sterol homeostasis(GO:0055092) |
0.0 | 0.1 | GO:0070417 | cellular response to cold(GO:0070417) |
0.0 | 0.1 | GO:0002949 | tRNA threonylcarbamoyladenosine modification(GO:0002949) |
0.0 | 0.0 | GO:0034035 | purine ribonucleoside bisphosphate metabolic process(GO:0034035) |
0.0 | 0.2 | GO:0035024 | negative regulation of Rho protein signal transduction(GO:0035024) |
0.0 | 0.0 | GO:0015819 | lysine transport(GO:0015819) |
0.0 | 0.2 | GO:0033631 | cell-cell adhesion mediated by integrin(GO:0033631) |
0.0 | 0.0 | GO:0010801 | negative regulation of peptidyl-threonine phosphorylation(GO:0010801) |
0.0 | 0.1 | GO:1901678 | iron coordination entity transport(GO:1901678) |
0.0 | 0.2 | GO:0031572 | G2 DNA damage checkpoint(GO:0031572) |
0.0 | 0.0 | GO:2000382 | positive regulation of mesoderm development(GO:2000382) |
0.0 | 0.7 | GO:0010212 | response to ionizing radiation(GO:0010212) |
0.0 | 0.2 | GO:0034101 | erythrocyte homeostasis(GO:0034101) |
0.0 | 0.3 | GO:0007216 | G-protein coupled glutamate receptor signaling pathway(GO:0007216) |
0.0 | 0.1 | GO:0046884 | follicle-stimulating hormone secretion(GO:0046884) |
0.0 | 0.3 | GO:0016578 | histone deubiquitination(GO:0016578) |
0.0 | 0.1 | GO:0051457 | maintenance of protein location in nucleus(GO:0051457) |
0.0 | 0.1 | GO:0000394 | RNA splicing, via endonucleolytic cleavage and ligation(GO:0000394) |
0.0 | 0.1 | GO:0072385 | minus-end-directed organelle transport along microtubule(GO:0072385) |
0.0 | 0.0 | GO:0032494 | response to peptidoglycan(GO:0032494) |
0.0 | 1.0 | GO:0045670 | regulation of osteoclast differentiation(GO:0045670) |
0.0 | 0.0 | GO:0060300 | regulation of cytokine activity(GO:0060300) |
0.0 | 0.0 | GO:0060462 | lung lobe development(GO:0060462) lung lobe morphogenesis(GO:0060463) |
0.0 | 0.1 | GO:0045743 | positive regulation of fibroblast growth factor receptor signaling pathway(GO:0045743) |
0.0 | 0.1 | GO:0032471 | negative regulation of endoplasmic reticulum calcium ion concentration(GO:0032471) |
0.0 | 0.0 | GO:0032070 | regulation of deoxyribonuclease activity(GO:0032070) |
0.0 | 0.1 | GO:0061085 | regulation of histone H3-K27 methylation(GO:0061085) positive regulation of histone H3-K27 methylation(GO:0061087) |
0.0 | 0.1 | GO:0007567 | parturition(GO:0007567) |
0.0 | 0.1 | GO:0010225 | response to UV-C(GO:0010225) |
0.0 | 0.0 | GO:0010728 | regulation of hydrogen peroxide biosynthetic process(GO:0010728) |
0.0 | 0.1 | GO:0007000 | nucleolus organization(GO:0007000) |
0.0 | 0.1 | GO:0021569 | rhombomere 3 development(GO:0021569) |
0.0 | 0.4 | GO:0032881 | regulation of polysaccharide metabolic process(GO:0032881) |
0.0 | 0.2 | GO:0007140 | male meiosis(GO:0007140) |
0.0 | 0.1 | GO:0070316 | G0 to G1 transition(GO:0045023) regulation of G0 to G1 transition(GO:0070316) |
0.0 | 0.2 | GO:0000185 | activation of MAPKKK activity(GO:0000185) |
0.0 | 0.1 | GO:0002023 | reduction of food intake in response to dietary excess(GO:0002023) |
0.0 | 0.1 | GO:0060762 | regulation of branching involved in mammary gland duct morphogenesis(GO:0060762) |
0.0 | 0.1 | GO:0006558 | L-phenylalanine metabolic process(GO:0006558) erythrose 4-phosphate/phosphoenolpyruvate family amino acid metabolic process(GO:1902221) |
0.0 | 0.1 | GO:0070328 | acylglycerol homeostasis(GO:0055090) triglyceride homeostasis(GO:0070328) |
0.0 | 0.1 | GO:0070257 | positive regulation of mucus secretion(GO:0070257) |
0.0 | 0.1 | GO:0007199 | G-protein coupled receptor signaling pathway coupled to cGMP nucleotide second messenger(GO:0007199) |
0.0 | 0.1 | GO:0006597 | spermine biosynthetic process(GO:0006597) |
0.0 | 0.0 | GO:1903608 | protein localization to cytoplasmic stress granule(GO:1903608) |
0.0 | 0.0 | GO:0061047 | foregut regionalization(GO:0060423) lung field specification(GO:0060424) primary lung bud formation(GO:0060431) lung induction(GO:0060492) positive regulation of branching involved in lung morphogenesis(GO:0061047) |
0.0 | 0.0 | GO:0042998 | positive regulation of Golgi to plasma membrane protein transport(GO:0042998) |
0.0 | 0.3 | GO:1901739 | regulation of myoblast fusion(GO:1901739) positive regulation of myoblast fusion(GO:1901741) |
0.0 | 0.1 | GO:0035635 | entry of bacterium into host cell(GO:0035635) regulation of entry of bacterium into host cell(GO:2000535) |
0.0 | 0.6 | GO:0009812 | flavonoid metabolic process(GO:0009812) |
0.0 | 0.1 | GO:1902175 | regulation of oxidative stress-induced intrinsic apoptotic signaling pathway(GO:1902175) |
0.0 | 0.1 | GO:0045086 | positive regulation of interleukin-2 biosynthetic process(GO:0045086) |
0.0 | 0.4 | GO:0051865 | protein autoubiquitination(GO:0051865) |
0.0 | 0.1 | GO:0045347 | negative regulation of MHC class II biosynthetic process(GO:0045347) |
0.0 | 0.1 | GO:0002544 | chronic inflammatory response(GO:0002544) |
0.0 | 0.1 | GO:1905048 | regulation of metallopeptidase activity(GO:1905048) |
0.0 | 0.0 | GO:1903012 | positive regulation of bone development(GO:1903012) |
0.0 | 0.0 | GO:0006266 | DNA ligation(GO:0006266) |
0.0 | 0.0 | GO:0046655 | folic acid metabolic process(GO:0046655) |
0.0 | 0.1 | GO:0070586 | cell-cell adhesion involved in gastrulation(GO:0070586) |
0.0 | 0.2 | GO:0070979 | protein K11-linked ubiquitination(GO:0070979) |
0.0 | 0.0 | GO:0009624 | response to nematode(GO:0009624) |
0.0 | 0.1 | GO:0072423 | response to cell cycle checkpoint signaling(GO:0072396) response to DNA integrity checkpoint signaling(GO:0072402) response to DNA damage checkpoint signaling(GO:0072423) response to intra-S DNA damage checkpoint signaling(GO:0072429) |
0.0 | 0.2 | GO:0002084 | protein depalmitoylation(GO:0002084) macromolecule depalmitoylation(GO:0098734) |
0.0 | 0.1 | GO:0030889 | negative regulation of B cell proliferation(GO:0030889) |
0.0 | 0.0 | GO:1903427 | negative regulation of reactive oxygen species biosynthetic process(GO:1903427) |
0.0 | 0.0 | GO:0033159 | negative regulation of protein import into nucleus, translocation(GO:0033159) |
0.0 | 0.2 | GO:0031069 | hair follicle morphogenesis(GO:0031069) |
0.0 | 0.1 | GO:0033299 | secretion of lysosomal enzymes(GO:0033299) |
0.0 | 0.0 | GO:0002378 | immunoglobulin biosynthetic process(GO:0002378) |
0.0 | 0.1 | GO:0030579 | ubiquitin-dependent SMAD protein catabolic process(GO:0030579) |
0.0 | 0.1 | GO:0015697 | quaternary ammonium group transport(GO:0015697) |
0.0 | 0.0 | GO:0060448 | dichotomous subdivision of terminal units involved in lung branching(GO:0060448) |
0.0 | 0.2 | GO:0090022 | regulation of neutrophil chemotaxis(GO:0090022) |
0.0 | 0.1 | GO:0010459 | negative regulation of heart rate(GO:0010459) |
0.0 | 0.1 | GO:0009437 | carnitine metabolic process(GO:0009437) |
0.0 | 0.1 | GO:0032753 | positive regulation of interleukin-4 production(GO:0032753) |
0.0 | 0.2 | GO:0061436 | establishment of skin barrier(GO:0061436) |
0.0 | 0.1 | GO:0061589 | calcium activated phosphatidylserine scrambling(GO:0061589) |
0.0 | 0.1 | GO:0009992 | cellular water homeostasis(GO:0009992) |
0.0 | 0.0 | GO:0070071 | proton-transporting two-sector ATPase complex assembly(GO:0070071) |
0.0 | 0.0 | GO:0048319 | axial mesoderm morphogenesis(GO:0048319) |
0.0 | 0.1 | GO:0034340 | response to type I interferon(GO:0034340) |
0.0 | 0.0 | GO:0006003 | fructose 2,6-bisphosphate metabolic process(GO:0006003) |
0.0 | 0.0 | GO:0045579 | positive regulation of B cell differentiation(GO:0045579) |
0.0 | 0.1 | GO:0050965 | detection of temperature stimulus involved in sensory perception(GO:0050961) detection of temperature stimulus involved in sensory perception of pain(GO:0050965) |
0.0 | 0.1 | GO:0002507 | tolerance induction(GO:0002507) |
0.0 | 0.0 | GO:0045060 | negative thymic T cell selection(GO:0045060) |
0.0 | 0.2 | GO:0061099 | negative regulation of protein tyrosine kinase activity(GO:0061099) |
0.0 | 0.0 | GO:0070973 | protein localization to endoplasmic reticulum exit site(GO:0070973) |
0.0 | 0.0 | GO:0016139 | glycoside catabolic process(GO:0016139) |
0.0 | 0.2 | GO:0006044 | N-acetylglucosamine metabolic process(GO:0006044) |
0.0 | 0.1 | GO:0035845 | photoreceptor cell outer segment organization(GO:0035845) |
0.0 | 0.1 | GO:0061302 | smooth muscle cell-matrix adhesion(GO:0061302) |
0.0 | 0.0 | GO:0045717 | negative regulation of fatty acid biosynthetic process(GO:0045717) |
0.0 | 0.0 | GO:0030886 | negative regulation of myeloid dendritic cell activation(GO:0030886) |
0.0 | 0.0 | GO:0048304 | positive regulation of isotype switching to IgG isotypes(GO:0048304) |
0.0 | 0.0 | GO:0002374 | cytokine secretion involved in immune response(GO:0002374) |
0.0 | 0.2 | GO:0007342 | fusion of sperm to egg plasma membrane(GO:0007342) |
0.0 | 0.0 | GO:0006228 | UTP biosynthetic process(GO:0006228) pyrimidine ribonucleoside triphosphate biosynthetic process(GO:0009209) |
0.0 | 0.2 | GO:0033209 | tumor necrosis factor-mediated signaling pathway(GO:0033209) |
0.0 | 0.0 | GO:0048808 | male genitalia morphogenesis(GO:0048808) male anatomical structure morphogenesis(GO:0090598) |
0.0 | 0.1 | GO:0070633 | transepithelial transport(GO:0070633) |
0.0 | 0.1 | GO:0031936 | negative regulation of chromatin silencing(GO:0031936) |
0.0 | 0.2 | GO:0032467 | positive regulation of cytokinesis(GO:0032467) |
0.0 | 0.0 | GO:0097460 | ferrous iron import into cell(GO:0097460) |
0.0 | 0.2 | GO:0070233 | negative regulation of T cell apoptotic process(GO:0070233) |
0.0 | 0.0 | GO:0071895 | odontoblast differentiation(GO:0071895) |
0.0 | 0.0 | GO:0097503 | sialylation(GO:0097503) |
0.0 | 0.1 | GO:0016045 | detection of bacterium(GO:0016045) detection of other organism(GO:0098543) |
0.0 | 0.1 | GO:0002281 | macrophage activation involved in immune response(GO:0002281) |
0.0 | 0.0 | GO:0010310 | regulation of hydrogen peroxide metabolic process(GO:0010310) |
0.0 | 0.0 | GO:0032693 | negative regulation of interleukin-10 production(GO:0032693) |
0.0 | 0.1 | GO:0002227 | innate immune response in mucosa(GO:0002227) |
0.0 | 3.5 | GO:0008380 | RNA splicing(GO:0008380) |
0.0 | 0.0 | GO:0070857 | regulation of bile acid biosynthetic process(GO:0070857) |
0.0 | 0.1 | GO:0045063 | T-helper 1 cell differentiation(GO:0045063) |
0.0 | 0.0 | GO:0060452 | positive regulation of cardiac muscle contraction(GO:0060452) |
0.0 | 0.0 | GO:0048539 | bone marrow development(GO:0048539) |
0.0 | 0.0 | GO:0032290 | peripheral nervous system myelin formation(GO:0032290) |
0.0 | 0.1 | GO:0002523 | leukocyte migration involved in inflammatory response(GO:0002523) |
0.0 | 0.0 | GO:0042746 | regulation of circadian sleep/wake cycle, wakefulness(GO:0010840) positive regulation of circadian sleep/wake cycle, wakefulness(GO:0010841) circadian sleep/wake cycle, wakefulness(GO:0042746) |
0.0 | 0.0 | GO:1902031 | regulation of NADP metabolic process(GO:1902031) |
0.0 | 0.1 | GO:1901386 | negative regulation of voltage-gated calcium channel activity(GO:1901386) |
0.0 | 0.0 | GO:0014889 | muscle atrophy(GO:0014889) |
0.0 | 0.0 | GO:0002328 | pro-B cell differentiation(GO:0002328) |
0.0 | 0.1 | GO:0030206 | chondroitin sulfate biosynthetic process(GO:0030206) |
0.0 | 0.1 | GO:0016266 | O-glycan processing(GO:0016266) |
0.0 | 0.0 | GO:0010749 | regulation of nitric oxide mediated signal transduction(GO:0010749) |
0.0 | 0.1 | GO:0009137 | purine nucleoside diphosphate catabolic process(GO:0009137) purine ribonucleoside diphosphate catabolic process(GO:0009181) |
0.0 | 0.0 | GO:0055091 | phospholipid homeostasis(GO:0055091) |
0.0 | 0.1 | GO:0030259 | lipid glycosylation(GO:0030259) |
0.0 | 0.1 | GO:0010586 | miRNA metabolic process(GO:0010586) |
0.0 | 0.1 | GO:0006546 | glycine catabolic process(GO:0006546) glycine decarboxylation via glycine cleavage system(GO:0019464) |
0.0 | 0.1 | GO:0006103 | 2-oxoglutarate metabolic process(GO:0006103) |
0.0 | 0.0 | GO:0061502 | early endosome to recycling endosome transport(GO:0061502) |
0.0 | 0.0 | GO:0070314 | G1 to G0 transition(GO:0070314) |
0.0 | 0.0 | GO:0097341 | inhibition of cysteine-type endopeptidase activity(GO:0097340) zymogen inhibition(GO:0097341) inhibition of cysteine-type endopeptidase activity involved in apoptotic process(GO:1990001) |
0.0 | 0.0 | GO:0038128 | ERBB2 signaling pathway(GO:0038128) |
0.0 | 0.0 | GO:0033630 | positive regulation of cell adhesion mediated by integrin(GO:0033630) |
0.0 | 0.1 | GO:0009074 | aromatic amino acid family catabolic process(GO:0009074) |
0.0 | 0.1 | GO:0032525 | somite rostral/caudal axis specification(GO:0032525) |
0.0 | 0.1 | GO:0008343 | adult feeding behavior(GO:0008343) |
0.0 | 0.0 | GO:0042535 | positive regulation of tumor necrosis factor biosynthetic process(GO:0042535) |
0.0 | 0.3 | GO:0050829 | defense response to Gram-negative bacterium(GO:0050829) |
0.0 | 0.1 | GO:0071257 | cellular response to electrical stimulus(GO:0071257) |
0.0 | 0.1 | GO:0030311 | poly-N-acetyllactosamine metabolic process(GO:0030309) poly-N-acetyllactosamine biosynthetic process(GO:0030311) |
0.0 | 0.1 | GO:0019370 | leukotriene biosynthetic process(GO:0019370) |
0.0 | 0.0 | GO:0046185 | aldehyde catabolic process(GO:0046185) |
0.0 | 0.0 | GO:0061146 | Peyer's patch morphogenesis(GO:0061146) |
0.0 | 0.1 | GO:0043949 | regulation of cAMP-mediated signaling(GO:0043949) |
0.0 | 0.0 | GO:0032048 | cardiolipin metabolic process(GO:0032048) |
0.0 | 0.1 | GO:0046827 | positive regulation of protein export from nucleus(GO:0046827) |
0.0 | 0.0 | GO:1903336 | negative regulation of vacuolar transport(GO:1903336) |
0.0 | 0.0 | GO:1902714 | negative regulation of interferon-gamma secretion(GO:1902714) |
0.0 | 0.0 | GO:0006741 | NADP biosynthetic process(GO:0006741) |
0.0 | 0.1 | GO:0097499 | protein localization to nonmotile primary cilium(GO:0097499) |
0.0 | 0.1 | GO:0043011 | myeloid dendritic cell differentiation(GO:0043011) |
0.0 | 0.0 | GO:0009133 | nucleoside diphosphate biosynthetic process(GO:0009133) |
0.0 | 0.1 | GO:0002763 | positive regulation of myeloid leukocyte differentiation(GO:0002763) |
0.0 | 0.0 | GO:0046716 | muscle cell cellular homeostasis(GO:0046716) |
0.0 | 0.2 | GO:0030150 | protein import into mitochondrial matrix(GO:0030150) |
0.0 | 0.2 | GO:0042130 | negative regulation of T cell proliferation(GO:0042130) |
0.0 | 0.1 | GO:0007252 | I-kappaB phosphorylation(GO:0007252) |
0.0 | 0.0 | GO:0070814 | hydrogen sulfide biosynthetic process(GO:0070814) |
0.0 | 0.1 | GO:0002414 | immunoglobulin transcytosis in epithelial cells(GO:0002414) |
0.0 | 0.0 | GO:0032366 | intracellular sterol transport(GO:0032366) |
0.0 | 0.0 | GO:1903748 | negative regulation of protein targeting to mitochondrion(GO:1903215) negative regulation of establishment of protein localization to mitochondrion(GO:1903748) |
0.0 | 0.1 | GO:0010831 | positive regulation of myotube differentiation(GO:0010831) |
0.0 | 0.0 | GO:0032074 | negative regulation of nuclease activity(GO:0032074) |
0.0 | 0.0 | GO:0018343 | protein farnesylation(GO:0018343) |
0.0 | 0.0 | GO:0098532 | histone H3-K27 trimethylation(GO:0098532) |
0.0 | 0.1 | GO:0034314 | Arp2/3 complex-mediated actin nucleation(GO:0034314) |
0.0 | 0.0 | GO:0097368 | establishment of Sertoli cell barrier(GO:0097368) |
0.0 | 0.0 | GO:0021546 | rhombomere development(GO:0021546) |
0.0 | 0.0 | GO:0010796 | regulation of multivesicular body size(GO:0010796) |
0.0 | 0.0 | GO:0032634 | interleukin-5 production(GO:0032634) |
0.0 | 0.2 | GO:0002687 | positive regulation of leukocyte migration(GO:0002687) |
0.0 | 0.0 | GO:2000297 | negative regulation of synapse maturation(GO:2000297) |
0.0 | 0.1 | GO:0045292 | mRNA cis splicing, via spliceosome(GO:0045292) |
0.0 | 0.1 | GO:0018377 | protein myristoylation(GO:0018377) |
0.0 | 0.0 | GO:0006287 | base-excision repair, gap-filling(GO:0006287) |
0.0 | 0.1 | GO:0070173 | regulation of enamel mineralization(GO:0070173) |
0.0 | 1.7 | GO:0042254 | ribosome biogenesis(GO:0042254) |
0.0 | 0.0 | GO:0051132 | NK T cell activation(GO:0051132) |
0.0 | 0.0 | GO:0060136 | embryonic process involved in female pregnancy(GO:0060136) |
0.0 | 0.0 | GO:0003096 | renal sodium ion transport(GO:0003096) renal sodium ion absorption(GO:0070294) |
0.0 | 0.1 | GO:0002251 | organ or tissue specific immune response(GO:0002251) mucosal immune response(GO:0002385) |
0.0 | 0.0 | GO:0032695 | negative regulation of interleukin-12 production(GO:0032695) |
0.0 | 0.1 | GO:0034587 | piRNA metabolic process(GO:0034587) |
0.0 | 0.1 | GO:0006123 | mitochondrial electron transport, cytochrome c to oxygen(GO:0006123) |
0.0 | 0.0 | GO:0034165 | regulation of toll-like receptor 9 signaling pathway(GO:0034163) positive regulation of toll-like receptor 9 signaling pathway(GO:0034165) |
0.0 | 0.0 | GO:1900020 | regulation of protein kinase C activity(GO:1900019) positive regulation of protein kinase C activity(GO:1900020) |
0.0 | 0.3 | GO:0015991 | energy coupled proton transmembrane transport, against electrochemical gradient(GO:0015988) ATP hydrolysis coupled proton transport(GO:0015991) ATP hydrolysis coupled transmembrane transport(GO:0090662) |
0.0 | 0.0 | GO:0061622 | glycolytic process through glucose-1-phosphate(GO:0061622) |
0.0 | 0.1 | GO:0017144 | drug metabolic process(GO:0017144) |
0.0 | 0.0 | GO:0097501 | stress response to metal ion(GO:0097501) |
0.0 | 0.0 | GO:0031049 | programmed DNA elimination(GO:0031049) chromosome breakage(GO:0031052) |
0.0 | 0.4 | GO:0031424 | keratinization(GO:0031424) |
0.0 | 0.0 | GO:0048525 | negative regulation of viral process(GO:0048525) |
0.0 | 0.0 | GO:0070189 | kynurenine metabolic process(GO:0070189) |
0.0 | 0.2 | GO:0001522 | pseudouridine synthesis(GO:0001522) |
0.0 | 0.0 | GO:0032488 | Cdc42 protein signal transduction(GO:0032488) |
0.0 | 0.0 | GO:0015744 | succinate transport(GO:0015744) |
0.0 | 0.2 | GO:0042035 | regulation of cytokine biosynthetic process(GO:0042035) |
0.0 | 0.0 | GO:0001827 | inner cell mass cell fate commitment(GO:0001827) |
0.0 | 0.1 | GO:0051560 | mitochondrial calcium ion homeostasis(GO:0051560) |
0.0 | 0.0 | GO:0009650 | UV protection(GO:0009650) |
0.0 | 0.1 | GO:0061462 | protein localization to lysosome(GO:0061462) |
0.0 | 0.0 | GO:0051790 | short-chain fatty acid biosynthetic process(GO:0051790) |
0.0 | 0.0 | GO:2001273 | glucose import in response to insulin stimulus(GO:0044381) regulation of glucose import in response to insulin stimulus(GO:2001273) |
0.0 | 0.1 | GO:0071451 | cellular response to oxygen radical(GO:0071450) cellular response to superoxide(GO:0071451) |
0.0 | 0.0 | GO:0006303 | double-strand break repair via nonhomologous end joining(GO:0006303) |
0.0 | 0.1 | GO:0060046 | regulation of acrosome reaction(GO:0060046) |
0.0 | 0.0 | GO:0035509 | negative regulation of myosin-light-chain-phosphatase activity(GO:0035509) |
0.0 | 0.7 | GO:0050909 | sensory perception of taste(GO:0050909) |
0.0 | 0.1 | GO:0043508 | negative regulation of JUN kinase activity(GO:0043508) |
0.0 | 0.0 | GO:0045351 | type I interferon biosynthetic process(GO:0045351) |
0.0 | 0.0 | GO:0006577 | amino-acid betaine metabolic process(GO:0006577) |
0.0 | 0.0 | GO:0003419 | growth plate cartilage chondrocyte proliferation(GO:0003419) |
0.0 | 0.1 | GO:0010668 | ectodermal cell differentiation(GO:0010668) |
0.0 | 0.0 | GO:0034770 | histone H4-K20 methylation(GO:0034770) histone H4-K20 trimethylation(GO:0034773) |
0.0 | 0.0 | GO:0007183 | SMAD protein complex assembly(GO:0007183) |
0.0 | 0.0 | GO:0048050 | post-embryonic eye morphogenesis(GO:0048050) |
0.0 | 0.0 | GO:0015747 | urate transport(GO:0015747) |
0.0 | 0.0 | GO:0042026 | protein refolding(GO:0042026) |
0.0 | 0.0 | GO:0016073 | snRNA metabolic process(GO:0016073) |
0.0 | 0.0 | GO:0033689 | negative regulation of osteoblast proliferation(GO:0033689) |
0.0 | 0.0 | GO:0072537 | fibroblast activation(GO:0072537) |
0.0 | 0.1 | GO:0045056 | transcytosis(GO:0045056) |
0.0 | 0.0 | GO:0035093 | spermatogenesis, exchange of chromosomal proteins(GO:0035093) |
0.0 | 0.1 | GO:0002183 | cytoplasmic translational initiation(GO:0002183) |
0.0 | 0.0 | GO:0060028 | convergent extension involved in axis elongation(GO:0060028) |
0.0 | 0.0 | GO:0035336 | long-chain fatty-acyl-CoA metabolic process(GO:0035336) |
0.0 | 0.0 | GO:0045065 | cytotoxic T cell differentiation(GO:0045065) |
0.0 | 0.0 | GO:1903203 | neuron death in response to oxidative stress(GO:0036475) regulation of oxidative stress-induced neuron death(GO:1903203) |
0.0 | 0.2 | GO:0009142 | nucleoside triphosphate biosynthetic process(GO:0009142) |
0.0 | 0.0 | GO:0034756 | regulation of iron ion transport(GO:0034756) |
0.0 | 0.1 | GO:0046326 | positive regulation of glucose import(GO:0046326) |
0.0 | 0.0 | GO:0060903 | positive regulation of meiosis I(GO:0060903) |
0.0 | 0.1 | GO:0033005 | positive regulation of mast cell activation(GO:0033005) |
0.0 | 0.0 | GO:2000049 | positive regulation of cell-cell adhesion mediated by cadherin(GO:2000049) |
0.0 | 0.2 | GO:0006413 | translational initiation(GO:0006413) |
0.0 | 0.0 | GO:0044144 | regulation of growth of symbiont in host(GO:0044126) modulation of growth of symbiont involved in interaction with host(GO:0044144) |
0.0 | 0.0 | GO:1900736 | regulation of phospholipase C-activating G-protein coupled receptor signaling pathway(GO:1900736) positive regulation of phospholipase C-activating G-protein coupled receptor signaling pathway(GO:1900738) |
0.0 | 0.0 | GO:1902035 | positive regulation of hematopoietic stem cell proliferation(GO:1902035) |
0.0 | 0.0 | GO:0030885 | regulation of myeloid dendritic cell activation(GO:0030885) |
0.0 | 0.0 | GO:0010818 | T cell chemotaxis(GO:0010818) |
0.0 | 0.0 | GO:0045589 | regulation of regulatory T cell differentiation(GO:0045589) |
0.0 | 0.0 | GO:0003273 | cell migration involved in endocardial cushion formation(GO:0003273) |
0.0 | 0.0 | GO:0090156 | negative regulation of sphingolipid biosynthetic process(GO:0090155) cellular sphingolipid homeostasis(GO:0090156) negative regulation of ceramide biosynthetic process(GO:1900060) |
0.0 | 0.0 | GO:0090503 | RNA phosphodiester bond hydrolysis, exonucleolytic(GO:0090503) |
0.0 | 0.0 | GO:0002248 | connective tissue replacement involved in inflammatory response wound healing(GO:0002248) connective tissue replacement(GO:0097709) |
0.0 | 0.0 | GO:0034508 | centromere complex assembly(GO:0034508) |
0.0 | 0.1 | GO:0015825 | L-serine transport(GO:0015825) |
0.0 | 0.0 | GO:0006667 | sphinganine metabolic process(GO:0006667) |
0.0 | 0.0 | GO:0042663 | regulation of endodermal cell fate specification(GO:0042663) |
0.0 | 0.0 | GO:0060847 | endothelial cell fate specification(GO:0060847) |
0.0 | 0.1 | GO:0042129 | regulation of T cell proliferation(GO:0042129) |
0.0 | 0.0 | GO:0000733 | DNA strand renaturation(GO:0000733) |
0.0 | 0.1 | GO:0048247 | lymphocyte chemotaxis(GO:0048247) |
0.0 | 0.2 | GO:1901998 | toxin transport(GO:1901998) |
0.0 | 0.0 | GO:0033278 | cell proliferation in midbrain(GO:0033278) |
0.0 | 0.0 | GO:0018002 | N-terminal peptidyl-serine acetylation(GO:0017198) N-terminal peptidyl-glutamic acid acetylation(GO:0018002) peptidyl-serine acetylation(GO:0030920) |
0.0 | 0.0 | GO:0043173 | nucleotide salvage(GO:0043173) |
0.0 | 0.0 | GO:0090110 | cargo loading into COPII-coated vesicle(GO:0090110) |
0.0 | 0.0 | GO:0045925 | positive regulation of female receptivity(GO:0045925) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
1.2 | 3.6 | GO:0005745 | m-AAA complex(GO:0005745) |
1.1 | 9.1 | GO:0030130 | clathrin coat of trans-Golgi network vesicle(GO:0030130) |
1.1 | 6.5 | GO:0000138 | Golgi trans cisterna(GO:0000138) |
1.0 | 5.0 | GO:0000220 | vacuolar proton-transporting V-type ATPase, V0 domain(GO:0000220) |
1.0 | 3.9 | GO:0005642 | annulate lamellae(GO:0005642) |
0.9 | 2.8 | GO:0097413 | Lewy body(GO:0097413) |
0.9 | 2.7 | GO:0097427 | microtubule bundle(GO:0097427) |
0.9 | 3.4 | GO:0071141 | SMAD protein complex(GO:0071141) |
0.8 | 3.3 | GO:0097136 | Bcl-2 family protein complex(GO:0097136) |
0.8 | 3.8 | GO:0016461 | unconventional myosin complex(GO:0016461) |
0.7 | 2.2 | GO:0016222 | procollagen-proline 4-dioxygenase complex(GO:0016222) |
0.7 | 3.7 | GO:1990712 | HFE-transferrin receptor complex(GO:1990712) |
0.7 | 5.1 | GO:0031464 | Cul4A-RING E3 ubiquitin ligase complex(GO:0031464) |
0.7 | 2.7 | GO:0000125 | PCAF complex(GO:0000125) |
0.7 | 2.7 | GO:1990130 | Iml1 complex(GO:1990130) |
0.6 | 1.9 | GO:0070695 | FHF complex(GO:0070695) |
0.6 | 3.0 | GO:0016281 | eukaryotic translation initiation factor 4F complex(GO:0016281) |
0.6 | 2.4 | GO:0044354 | pinosome(GO:0044352) macropinosome(GO:0044354) |
0.6 | 2.4 | GO:0097524 | sperm plasma membrane(GO:0097524) |
0.6 | 2.3 | GO:0061689 | tricellular tight junction(GO:0061689) |
0.6 | 4.0 | GO:0070688 | MLL5-L complex(GO:0070688) |
0.6 | 4.4 | GO:0098554 | cytoplasmic side of endoplasmic reticulum membrane(GO:0098554) |
0.5 | 1.6 | GO:0097452 | GAIT complex(GO:0097452) |
0.5 | 1.6 | GO:0060053 | neurofilament cytoskeleton(GO:0060053) |
0.5 | 1.0 | GO:0031523 | Myb complex(GO:0031523) |
0.5 | 2.0 | GO:0070937 | CRD-mediated mRNA stability complex(GO:0070937) |
0.5 | 2.0 | GO:0016602 | CCAAT-binding factor complex(GO:0016602) |
0.5 | 3.4 | GO:0000788 | nuclear nucleosome(GO:0000788) |
0.5 | 4.8 | GO:0097539 | ciliary transition fiber(GO:0097539) |
0.5 | 1.0 | GO:0097451 | glial limiting end-foot(GO:0097451) |
0.5 | 1.4 | GO:0005785 | signal recognition particle receptor complex(GO:0005785) |
0.5 | 3.7 | GO:0005845 | mRNA cap binding complex(GO:0005845) RNA cap binding complex(GO:0034518) |
0.5 | 1.4 | GO:0031092 | platelet alpha granule membrane(GO:0031092) |
0.5 | 0.5 | GO:0031838 | haptoglobin-hemoglobin complex(GO:0031838) |
0.5 | 3.2 | GO:0042382 | paraspeckles(GO:0042382) |
0.4 | 3.1 | GO:0034098 | VCP-NPL4-UFD1 AAA ATPase complex(GO:0034098) |
0.4 | 1.8 | GO:0097169 | AIM2 inflammasome complex(GO:0097169) |
0.4 | 4.0 | GO:0030125 | clathrin vesicle coat(GO:0030125) |
0.4 | 1.3 | GO:0036488 | CHOP-C/EBP complex(GO:0036488) |
0.4 | 2.1 | GO:0044294 | dendritic growth cone(GO:0044294) |
0.4 | 13.2 | GO:0010494 | cytoplasmic stress granule(GO:0010494) |
0.4 | 4.7 | GO:0033276 | transcription factor TFTC complex(GO:0033276) |
0.4 | 6.2 | GO:0000177 | cytoplasmic exosome (RNase complex)(GO:0000177) |
0.4 | 3.4 | GO:0005869 | dynactin complex(GO:0005869) |
0.4 | 1.1 | GO:0097513 | myosin II filament(GO:0097513) |
0.4 | 1.1 | GO:0044611 | nuclear pore inner ring(GO:0044611) |
0.3 | 2.8 | GO:0036513 | Derlin-1 retrotranslocation complex(GO:0036513) |
0.3 | 2.4 | GO:0005833 | hemoglobin complex(GO:0005833) |
0.3 | 1.7 | GO:0008091 | spectrin(GO:0008091) |
0.3 | 1.7 | GO:0005672 | transcription factor TFIIA complex(GO:0005672) |
0.3 | 1.4 | GO:0044530 | supraspliceosomal complex(GO:0044530) |
0.3 | 2.3 | GO:0005577 | fibrinogen complex(GO:0005577) |
0.3 | 1.0 | GO:0070552 | BRISC complex(GO:0070552) |
0.3 | 2.3 | GO:0031931 | TORC1 complex(GO:0031931) |
0.3 | 1.3 | GO:0000805 | X chromosome(GO:0000805) |
0.3 | 1.3 | GO:0071204 | histone pre-mRNA 3'end processing complex(GO:0071204) |
0.3 | 4.1 | GO:0016514 | SWI/SNF complex(GO:0016514) |
0.3 | 2.2 | GO:0005952 | cAMP-dependent protein kinase complex(GO:0005952) |
0.3 | 2.2 | GO:0016272 | prefoldin complex(GO:0016272) |
0.3 | 0.9 | GO:0016939 | kinesin II complex(GO:0016939) |
0.3 | 2.4 | GO:0030665 | clathrin-coated vesicle membrane(GO:0030665) |
0.3 | 1.5 | GO:0005638 | lamin filament(GO:0005638) |
0.3 | 0.3 | GO:0097433 | dense body(GO:0097433) |
0.3 | 0.9 | GO:1990423 | RZZ complex(GO:1990423) |
0.3 | 1.2 | GO:0031502 | dolichyl-phosphate-mannose-protein mannosyltransferase complex(GO:0031502) |
0.3 | 0.9 | GO:0002193 | MAML1-RBP-Jkappa- ICN1 complex(GO:0002193) |
0.3 | 1.2 | GO:0000942 | condensed nuclear chromosome outer kinetochore(GO:0000942) |
0.3 | 1.5 | GO:0030485 | smooth muscle contractile fiber(GO:0030485) |
0.3 | 2.3 | GO:0071541 | eukaryotic translation initiation factor 3 complex, eIF3m(GO:0071541) |
0.3 | 1.8 | GO:0019907 | cyclin-dependent protein kinase activating kinase holoenzyme complex(GO:0019907) |
0.3 | 2.0 | GO:0034366 | spherical high-density lipoprotein particle(GO:0034366) |
0.3 | 1.7 | GO:0030914 | STAGA complex(GO:0030914) |
0.3 | 0.9 | GO:0097255 | R2TP complex(GO:0097255) |
0.3 | 0.9 | GO:0005658 | alpha DNA polymerase:primase complex(GO:0005658) |
0.3 | 1.1 | GO:0071256 | Sec61 translocon complex(GO:0005784) translocon complex(GO:0071256) |
0.3 | 2.8 | GO:0000783 | telomere cap complex(GO:0000782) nuclear telomere cap complex(GO:0000783) |
0.3 | 3.1 | GO:0030126 | COPI vesicle coat(GO:0030126) |
0.3 | 0.6 | GO:0005579 | membrane attack complex(GO:0005579) |
0.3 | 3.4 | GO:0034045 | pre-autophagosomal structure membrane(GO:0034045) |
0.3 | 1.4 | GO:0001651 | dense fibrillar component(GO:0001651) |
0.3 | 11.4 | GO:0005905 | clathrin-coated pit(GO:0005905) |
0.3 | 1.3 | GO:0042406 | extrinsic component of endoplasmic reticulum membrane(GO:0042406) |
0.3 | 1.6 | GO:0001739 | sex chromatin(GO:0001739) |
0.3 | 0.8 | GO:0030868 | smooth endoplasmic reticulum membrane(GO:0030868) smooth endoplasmic reticulum part(GO:0097425) |
0.3 | 4.6 | GO:0000242 | pericentriolar material(GO:0000242) |
0.3 | 1.8 | GO:0051233 | spindle midzone(GO:0051233) |
0.2 | 2.0 | GO:0090576 | RNA polymerase III transcription factor complex(GO:0090576) |
0.2 | 0.7 | GO:0031417 | NatC complex(GO:0031417) |
0.2 | 1.7 | GO:0030056 | hemidesmosome(GO:0030056) |
0.2 | 3.2 | GO:0032588 | trans-Golgi network membrane(GO:0032588) |
0.2 | 1.4 | GO:0071986 | Ragulator complex(GO:0071986) |
0.2 | 0.5 | GO:0044613 | nuclear pore central transport channel(GO:0044613) |
0.2 | 3.3 | GO:0031528 | microvillus membrane(GO:0031528) |
0.2 | 0.9 | GO:0000214 | tRNA-intron endonuclease complex(GO:0000214) |
0.2 | 1.8 | GO:0044666 | MLL3/4 complex(GO:0044666) |
0.2 | 1.1 | GO:0044233 | ER-mitochondrion membrane contact site(GO:0044233) |
0.2 | 1.1 | GO:0008024 | cyclin/CDK positive transcription elongation factor complex(GO:0008024) |
0.2 | 2.0 | GO:0097225 | sperm midpiece(GO:0097225) |
0.2 | 8.7 | GO:0017053 | transcriptional repressor complex(GO:0017053) |
0.2 | 2.6 | GO:0002080 | acrosomal membrane(GO:0002080) |
0.2 | 1.7 | GO:0070652 | HAUS complex(GO:0070652) |
0.2 | 1.3 | GO:0002177 | manchette(GO:0002177) |
0.2 | 3.9 | GO:0000307 | cyclin-dependent protein kinase holoenzyme complex(GO:0000307) |
0.2 | 1.7 | GO:0034709 | methylosome(GO:0034709) |
0.2 | 3.2 | GO:0005697 | telomerase holoenzyme complex(GO:0005697) |
0.2 | 1.9 | GO:0016471 | vacuolar proton-transporting V-type ATPase complex(GO:0016471) |
0.2 | 2.1 | GO:0042582 | primary lysosome(GO:0005766) azurophil granule(GO:0042582) |
0.2 | 2.7 | GO:0031011 | Ino80 complex(GO:0031011) |
0.2 | 1.8 | GO:0005819 | spindle(GO:0005819) |
0.2 | 1.4 | GO:0097470 | ribbon synapse(GO:0097470) |
0.2 | 1.2 | GO:0030688 | preribosome, small subunit precursor(GO:0030688) |
0.2 | 1.6 | GO:0097208 | alveolar lamellar body(GO:0097208) |
0.2 | 0.2 | GO:0034365 | discoidal high-density lipoprotein particle(GO:0034365) |
0.2 | 0.6 | GO:0044322 | endoplasmic reticulum quality control compartment(GO:0044322) |
0.2 | 10.8 | GO:0000118 | histone deacetylase complex(GO:0000118) |
0.2 | 2.2 | GO:0065010 | extracellular membrane-bounded organelle(GO:0065010) |
0.2 | 1.0 | GO:0034388 | Pwp2p-containing subcomplex of 90S preribosome(GO:0034388) |
0.2 | 0.4 | GO:0071564 | npBAF complex(GO:0071564) |
0.2 | 3.9 | GO:0005689 | U12-type spliceosomal complex(GO:0005689) |
0.2 | 2.9 | GO:0010369 | chromocenter(GO:0010369) |
0.2 | 1.2 | GO:0034464 | BBSome(GO:0034464) |
0.2 | 0.4 | GO:0031074 | nucleocytoplasmic shuttling complex(GO:0031074) |
0.2 | 2.7 | GO:0000974 | Prp19 complex(GO:0000974) |
0.2 | 0.6 | GO:0030915 | Smc5-Smc6 complex(GO:0030915) |
0.2 | 0.5 | GO:0031390 | Ctf18 RFC-like complex(GO:0031390) |
0.2 | 2.2 | GO:0043240 | Fanconi anaemia nuclear complex(GO:0043240) |
0.2 | 8.4 | GO:0031903 | peroxisomal membrane(GO:0005778) microbody membrane(GO:0031903) |
0.2 | 0.7 | GO:0045298 | tubulin complex(GO:0045298) |
0.2 | 2.0 | GO:0005682 | U5 snRNP(GO:0005682) |
0.2 | 0.7 | GO:0072487 | MSL complex(GO:0072487) |
0.2 | 7.0 | GO:0072686 | mitotic spindle(GO:0072686) |
0.2 | 0.2 | GO:0032585 | multivesicular body membrane(GO:0032585) |
0.2 | 0.2 | GO:0031232 | extrinsic component of external side of plasma membrane(GO:0031232) |
0.2 | 6.1 | GO:0045171 | intercellular bridge(GO:0045171) |
0.2 | 2.2 | GO:0000421 | autophagosome membrane(GO:0000421) |
0.2 | 0.8 | GO:0005964 | phosphorylase kinase complex(GO:0005964) |
0.2 | 1.9 | GO:0031941 | filamentous actin(GO:0031941) |
0.2 | 0.3 | GO:0008622 | epsilon DNA polymerase complex(GO:0008622) |
0.2 | 0.5 | GO:0005967 | mitochondrial pyruvate dehydrogenase complex(GO:0005967) |
0.2 | 0.7 | GO:0071797 | LUBAC complex(GO:0071797) |
0.2 | 0.5 | GO:0005828 | kinetochore microtubule(GO:0005828) |
0.2 | 0.5 | GO:0033185 | dolichol-phosphate-mannose synthase complex(GO:0033185) |
0.2 | 0.5 | GO:0020016 | ciliary pocket(GO:0020016) ciliary pocket membrane(GO:0020018) |
0.2 | 0.8 | GO:0005663 | DNA replication factor C complex(GO:0005663) |
0.2 | 2.2 | GO:0044665 | MLL1/2 complex(GO:0044665) MLL1 complex(GO:0071339) |
0.2 | 0.6 | GO:0002079 | inner acrosomal membrane(GO:0002079) |
0.2 | 1.3 | GO:0000940 | condensed chromosome outer kinetochore(GO:0000940) |
0.2 | 0.8 | GO:0044326 | dendritic spine neck(GO:0044326) |
0.2 | 0.6 | GO:0002142 | stereocilia ankle link complex(GO:0002142) |
0.2 | 0.3 | GO:0005850 | eukaryotic translation initiation factor 2 complex(GO:0005850) |
0.2 | 0.5 | GO:0097058 | CRLF-CLCF1 complex(GO:0097058) |
0.2 | 0.5 | GO:0033596 | TSC1-TSC2 complex(GO:0033596) |
0.2 | 2.4 | GO:0000145 | exocyst(GO:0000145) |
0.1 | 0.4 | GO:0032541 | cortical endoplasmic reticulum(GO:0032541) |
0.1 | 5.2 | GO:0000315 | organellar large ribosomal subunit(GO:0000315) mitochondrial large ribosomal subunit(GO:0005762) |
0.1 | 1.2 | GO:0031010 | ISWI-type complex(GO:0031010) |
0.1 | 1.3 | GO:0035631 | CD40 receptor complex(GO:0035631) |
0.1 | 1.0 | GO:0016011 | dystroglycan complex(GO:0016011) |
0.1 | 0.3 | GO:0071664 | catenin-TCF7L2 complex(GO:0071664) |
0.1 | 0.9 | GO:0048500 | signal recognition particle, endoplasmic reticulum targeting(GO:0005786) signal recognition particle(GO:0048500) |
0.1 | 0.4 | GO:0097057 | TRAF2-GSTP1 complex(GO:0097057) |
0.1 | 0.3 | GO:0044292 | dendrite terminus(GO:0044292) |
0.1 | 0.7 | GO:0033093 | Weibel-Palade body(GO:0033093) |
0.1 | 0.8 | GO:0031512 | motile primary cilium(GO:0031512) |
0.1 | 1.3 | GO:0008278 | cohesin complex(GO:0008278) |
0.1 | 3.1 | GO:0035869 | ciliary transition zone(GO:0035869) |
0.1 | 4.0 | GO:0005876 | spindle microtubule(GO:0005876) |
0.1 | 1.5 | GO:0032039 | integrator complex(GO:0032039) |
0.1 | 0.4 | GO:0031084 | BLOC-2 complex(GO:0031084) |
0.1 | 3.0 | GO:0030992 | intraciliary transport particle B(GO:0030992) |
0.1 | 0.7 | GO:0017101 | aminoacyl-tRNA synthetase multienzyme complex(GO:0017101) |
0.1 | 0.5 | GO:0072687 | meiotic spindle(GO:0072687) |
0.1 | 0.7 | GO:0033063 | Rad51B-Rad51C-Rad51D-XRCC2 complex(GO:0033063) |
0.1 | 1.8 | GO:0000159 | protein phosphatase type 2A complex(GO:0000159) |
0.1 | 1.1 | GO:0031616 | spindle pole centrosome(GO:0031616) |
0.1 | 0.4 | GO:0070531 | BRCA1-A complex(GO:0070531) |
0.1 | 0.7 | GO:0042587 | glycogen granule(GO:0042587) |
0.1 | 1.2 | GO:0034361 | very-low-density lipoprotein particle(GO:0034361) triglyceride-rich lipoprotein particle(GO:0034385) |
0.1 | 4.0 | GO:0008023 | transcription elongation factor complex(GO:0008023) |
0.1 | 2.0 | GO:0005719 | nuclear euchromatin(GO:0005719) |
0.1 | 0.4 | GO:0046691 | intracellular canaliculus(GO:0046691) |
0.1 | 0.4 | GO:0042583 | chromaffin granule(GO:0042583) |
0.1 | 0.7 | GO:0000812 | Swr1 complex(GO:0000812) |
0.1 | 0.1 | GO:0031595 | nuclear proteasome complex(GO:0031595) |
0.1 | 1.0 | GO:0031414 | N-terminal protein acetyltransferase complex(GO:0031414) |
0.1 | 0.6 | GO:0042824 | MHC class I peptide loading complex(GO:0042824) |
0.1 | 0.1 | GO:0032444 | activin responsive factor complex(GO:0032444) |
0.1 | 3.9 | GO:0005834 | heterotrimeric G-protein complex(GO:0005834) |
0.1 | 0.2 | GO:0031265 | CD95 death-inducing signaling complex(GO:0031265) |
0.1 | 2.6 | GO:0008305 | integrin complex(GO:0008305) |
0.1 | 0.2 | GO:0000931 | gamma-tubulin large complex(GO:0000931) gamma-tubulin ring complex(GO:0008274) |
0.1 | 7.2 | GO:0030496 | midbody(GO:0030496) |
0.1 | 1.0 | GO:1990909 | Wnt signalosome(GO:1990909) |
0.1 | 4.9 | GO:0009295 | nucleoid(GO:0009295) mitochondrial nucleoid(GO:0042645) |
0.1 | 0.4 | GO:0044194 | cytolytic granule(GO:0044194) |
0.1 | 0.1 | GO:0097542 | ciliary tip(GO:0097542) |
0.1 | 1.8 | GO:0005844 | polysome(GO:0005844) |
0.1 | 10.3 | GO:0072562 | blood microparticle(GO:0072562) |
0.1 | 0.1 | GO:0030870 | Mre11 complex(GO:0030870) |
0.1 | 0.7 | GO:0030062 | mitochondrial tricarboxylic acid cycle enzyme complex(GO:0030062) |
0.1 | 0.3 | GO:0097512 | cardiac myofibril(GO:0097512) |
0.1 | 0.7 | GO:0070776 | H3 histone acetyltransferase complex(GO:0070775) MOZ/MORF histone acetyltransferase complex(GO:0070776) |
0.1 | 1.3 | GO:0000164 | protein phosphatase type 1 complex(GO:0000164) |
0.1 | 0.7 | GO:0033256 | I-kappaB/NF-kappaB complex(GO:0033256) |
0.1 | 0.2 | GO:1990357 | terminal web(GO:1990357) |
0.1 | 0.3 | GO:0000306 | extrinsic component of vacuolar membrane(GO:0000306) |
0.1 | 2.9 | GO:0008180 | COP9 signalosome(GO:0008180) |
0.1 | 1.6 | GO:0032391 | photoreceptor connecting cilium(GO:0032391) |
0.1 | 13.4 | GO:0005741 | mitochondrial outer membrane(GO:0005741) |
0.1 | 1.2 | GO:0008540 | proteasome regulatory particle, base subcomplex(GO:0008540) |
0.1 | 0.5 | GO:0030896 | checkpoint clamp complex(GO:0030896) |
0.1 | 0.2 | GO:1990604 | IRE1-TRAF2-ASK1 complex(GO:1990604) |
0.1 | 2.7 | GO:0000795 | synaptonemal complex(GO:0000795) |
0.1 | 0.9 | GO:0043020 | NADPH oxidase complex(GO:0043020) |
0.1 | 0.7 | GO:0000276 | mitochondrial proton-transporting ATP synthase complex, coupling factor F(o)(GO:0000276) |
0.1 | 0.4 | GO:0072357 | PTW/PP1 phosphatase complex(GO:0072357) |
0.1 | 1.0 | GO:0002178 | palmitoyltransferase complex(GO:0002178) |
0.1 | 0.4 | GO:0019815 | B cell receptor complex(GO:0019815) |
0.1 | 0.3 | GO:0031262 | Ndc80 complex(GO:0031262) |
0.1 | 0.5 | GO:0071437 | invadopodium(GO:0071437) |
0.1 | 0.3 | GO:0097025 | MPP7-DLG1-LIN7 complex(GO:0097025) |
0.1 | 1.5 | GO:1990204 | oxidoreductase complex(GO:1990204) |
0.1 | 0.7 | GO:0098827 | endoplasmic reticulum subcompartment(GO:0098827) |
0.1 | 0.5 | GO:0031467 | Cul7-RING ubiquitin ligase complex(GO:0031467) |
0.1 | 2.4 | GO:0000922 | spindle pole(GO:0000922) |
0.1 | 2.0 | GO:0055038 | recycling endosome membrane(GO:0055038) |
0.1 | 0.4 | GO:0000322 | storage vacuole(GO:0000322) |
0.1 | 1.0 | GO:0016460 | myosin II complex(GO:0016460) |
0.1 | 0.6 | GO:0032591 | dendritic spine membrane(GO:0032591) |
0.1 | 2.4 | GO:0005776 | autophagosome(GO:0005776) |
0.1 | 0.3 | GO:0005955 | calcineurin complex(GO:0005955) |
0.1 | 2.0 | GO:0030687 | preribosome, large subunit precursor(GO:0030687) |
0.1 | 0.1 | GO:0097443 | sorting endosome(GO:0097443) |
0.1 | 0.7 | GO:0008250 | oligosaccharyltransferase complex(GO:0008250) |
0.1 | 0.6 | GO:0005671 | Ada2/Gcn5/Ada3 transcription activator complex(GO:0005671) |
0.1 | 0.1 | GO:0071817 | MMXD complex(GO:0071817) |
0.1 | 1.7 | GO:0005605 | basal lamina(GO:0005605) |
0.1 | 1.3 | GO:0030014 | CCR4-NOT complex(GO:0030014) |
0.1 | 5.2 | GO:0005795 | Golgi stack(GO:0005795) |
0.1 | 1.4 | GO:0043196 | varicosity(GO:0043196) |
0.1 | 13.7 | GO:0031965 | nuclear membrane(GO:0031965) |
0.1 | 4.0 | GO:0005758 | mitochondrial intermembrane space(GO:0005758) |
0.1 | 2.8 | GO:0016459 | myosin complex(GO:0016459) |
0.1 | 0.7 | GO:0016363 | nuclear matrix(GO:0016363) |
0.1 | 0.3 | GO:0002189 | ribose phosphate diphosphokinase complex(GO:0002189) |
0.1 | 4.8 | GO:0030863 | cortical cytoskeleton(GO:0030863) |
0.1 | 0.4 | GO:0016600 | flotillin complex(GO:0016600) |
0.1 | 0.6 | GO:0008290 | F-actin capping protein complex(GO:0008290) |
0.1 | 0.5 | GO:0005662 | DNA replication factor A complex(GO:0005662) |
0.1 | 2.5 | GO:0055037 | recycling endosome(GO:0055037) |
0.1 | 2.2 | GO:0016328 | lateral plasma membrane(GO:0016328) |
0.1 | 0.8 | GO:0005669 | transcription factor TFIID complex(GO:0005669) |
0.1 | 0.3 | GO:0000015 | phosphopyruvate hydratase complex(GO:0000015) |
0.1 | 0.7 | GO:0071012 | catalytic step 1 spliceosome(GO:0071012) |
0.1 | 0.6 | GO:0005686 | U2 snRNP(GO:0005686) |
0.1 | 0.7 | GO:0098533 | ATPase dependent transmembrane transport complex(GO:0098533) |
0.1 | 1.1 | GO:0034451 | centriolar satellite(GO:0034451) |
0.1 | 1.5 | GO:0030057 | desmosome(GO:0030057) |
0.1 | 0.2 | GO:0005899 | insulin receptor complex(GO:0005899) |
0.1 | 0.2 | GO:0097441 | basilar dendrite(GO:0097441) |
0.1 | 24.6 | GO:0005740 | mitochondrial envelope(GO:0005740) |
0.1 | 2.4 | GO:0000932 | cytoplasmic mRNA processing body(GO:0000932) |
0.1 | 0.3 | GO:0005796 | Golgi lumen(GO:0005796) |
0.1 | 0.7 | GO:0070603 | SWI/SNF superfamily-type complex(GO:0070603) |
0.1 | 0.4 | GO:0000808 | origin recognition complex(GO:0000808) nuclear origin of replication recognition complex(GO:0005664) |
0.1 | 0.7 | GO:0046581 | intercellular canaliculus(GO:0046581) |
0.1 | 1.3 | GO:0005680 | anaphase-promoting complex(GO:0005680) |
0.1 | 0.2 | GO:0000814 | ESCRT II complex(GO:0000814) |
0.1 | 0.2 | GO:0098536 | deuterosome(GO:0098536) |
0.1 | 0.7 | GO:0017119 | Golgi transport complex(GO:0017119) |
0.1 | 0.1 | GO:0030663 | COPI-coated vesicle membrane(GO:0030663) |
0.1 | 0.2 | GO:0017071 | intracellular cyclic nucleotide activated cation channel complex(GO:0017071) |
0.1 | 0.1 | GO:0031088 | platelet dense granule membrane(GO:0031088) |
0.1 | 1.7 | GO:0005657 | replication fork(GO:0005657) |
0.1 | 20.1 | GO:0005764 | lytic vacuole(GO:0000323) lysosome(GO:0005764) |
0.1 | 0.3 | GO:0070820 | tertiary granule(GO:0070820) |
0.1 | 0.4 | GO:0001650 | fibrillar center(GO:0001650) |
0.1 | 1.1 | GO:0042101 | T cell receptor complex(GO:0042101) |
0.1 | 0.4 | GO:0032433 | filopodium tip(GO:0032433) |
0.1 | 0.6 | GO:0032426 | stereocilium tip(GO:0032426) |
0.1 | 2.0 | GO:0031519 | PcG protein complex(GO:0031519) |
0.1 | 3.6 | GO:0000502 | proteasome complex(GO:0000502) |
0.1 | 0.9 | GO:0035145 | exon-exon junction complex(GO:0035145) |
0.1 | 0.6 | GO:0031371 | ubiquitin conjugating enzyme complex(GO:0031371) |
0.1 | 1.5 | GO:0031248 | protein acetyltransferase complex(GO:0031248) acetyltransferase complex(GO:1902493) |
0.1 | 0.2 | GO:0043293 | apoptosome(GO:0043293) |
0.1 | 0.3 | GO:0071547 | piP-body(GO:0071547) |
0.1 | 0.4 | GO:0000813 | ESCRT I complex(GO:0000813) |
0.1 | 0.1 | GO:0035985 | senescence-associated heterochromatin focus(GO:0035985) |
0.1 | 0.5 | GO:0000407 | pre-autophagosomal structure(GO:0000407) |
0.1 | 0.2 | GO:0071953 | elastic fiber(GO:0071953) |
0.1 | 9.7 | GO:0016604 | nuclear body(GO:0016604) |
0.1 | 0.1 | GO:0070522 | ERCC4-ERCC1 complex(GO:0070522) |
0.1 | 0.5 | GO:0031588 | nucleotide-activated protein kinase complex(GO:0031588) |
0.1 | 0.1 | GO:0005927 | muscle tendon junction(GO:0005927) |
0.1 | 0.3 | GO:0042765 | GPI-anchor transamidase complex(GO:0042765) |
0.1 | 5.0 | GO:0005681 | spliceosomal complex(GO:0005681) |
0.1 | 0.4 | GO:0031209 | SCAR complex(GO:0031209) |
0.1 | 0.5 | GO:0034663 | endoplasmic reticulum chaperone complex(GO:0034663) |
0.1 | 0.8 | GO:0045335 | phagocytic vesicle(GO:0045335) |
0.1 | 2.4 | GO:0022627 | cytosolic small ribosomal subunit(GO:0022627) |
0.1 | 0.1 | GO:0005915 | zonula adherens(GO:0005915) |
0.1 | 1.2 | GO:0005801 | cis-Golgi network(GO:0005801) |
0.1 | 0.2 | GO:0034673 | inhibin-betaglycan-ActRII complex(GO:0034673) |
0.1 | 0.4 | GO:0005916 | fascia adherens(GO:0005916) |
0.1 | 0.8 | GO:0005736 | DNA-directed RNA polymerase I complex(GO:0005736) |
0.1 | 0.2 | GO:0030891 | VCB complex(GO:0030891) |
0.1 | 2.2 | GO:0005770 | late endosome(GO:0005770) |
0.1 | 2.1 | GO:0031228 | intrinsic component of Golgi membrane(GO:0031228) |
0.1 | 0.5 | GO:0097440 | apical dendrite(GO:0097440) |
0.1 | 0.2 | GO:1990745 | EARP complex(GO:1990745) |
0.1 | 0.5 | GO:0005868 | cytoplasmic dynein complex(GO:0005868) |
0.1 | 0.2 | GO:0089717 | spanning component of plasma membrane(GO:0044214) spanning component of membrane(GO:0089717) |
0.1 | 1.2 | GO:0031901 | early endosome membrane(GO:0031901) |
0.1 | 0.7 | GO:0030131 | clathrin adaptor complex(GO:0030131) |
0.1 | 2.4 | GO:0000775 | chromosome, centromeric region(GO:0000775) |
0.1 | 53.3 | GO:0005654 | nucleoplasm(GO:0005654) |
0.1 | 0.3 | GO:0097546 | ciliary base(GO:0097546) |
0.1 | 0.1 | GO:0031264 | death-inducing signaling complex(GO:0031264) |
0.1 | 0.2 | GO:0005840 | ribosome(GO:0005840) |
0.0 | 0.2 | GO:0012507 | ER to Golgi transport vesicle membrane(GO:0012507) |
0.0 | 0.2 | GO:0030008 | TRAPP complex(GO:0030008) |
0.0 | 0.3 | GO:0031045 | dense core granule(GO:0031045) |
0.0 | 0.5 | GO:0001772 | immunological synapse(GO:0001772) |
0.0 | 0.1 | GO:0000794 | condensed nuclear chromosome(GO:0000794) |
0.0 | 0.1 | GO:0000408 | EKC/KEOPS complex(GO:0000408) |
0.0 | 0.1 | GO:0001940 | male pronucleus(GO:0001940) |
0.0 | 1.1 | GO:0005793 | endoplasmic reticulum-Golgi intermediate compartment(GO:0005793) |
0.0 | 0.3 | GO:0042622 | photoreceptor outer segment membrane(GO:0042622) |
0.0 | 5.6 | GO:0005813 | centrosome(GO:0005813) |
0.0 | 0.2 | GO:0031970 | organelle envelope lumen(GO:0031970) |
0.0 | 0.1 | GO:0044316 | cone cell pedicle(GO:0044316) |
0.0 | 0.2 | GO:0008385 | IkappaB kinase complex(GO:0008385) |
0.0 | 0.4 | GO:0031082 | BLOC complex(GO:0031082) |
0.0 | 0.2 | GO:0046696 | lipopolysaccharide receptor complex(GO:0046696) |
0.0 | 0.0 | GO:0000152 | nuclear ubiquitin ligase complex(GO:0000152) |
0.0 | 0.2 | GO:0005832 | chaperonin-containing T-complex(GO:0005832) |
0.0 | 0.1 | GO:0000796 | condensin complex(GO:0000796) |
0.0 | 0.0 | GO:0030867 | rough endoplasmic reticulum membrane(GO:0030867) |
0.0 | 29.2 | GO:0005829 | cytosol(GO:0005829) |
0.0 | 0.7 | GO:0005811 | lipid particle(GO:0005811) |
0.0 | 0.1 | GO:0045179 | apical cortex(GO:0045179) |
0.0 | 0.1 | GO:0005594 | collagen type IX trimer(GO:0005594) |
0.0 | 0.1 | GO:0044232 | organelle membrane contact site(GO:0044232) |
0.0 | 0.1 | GO:0042567 | insulin-like growth factor binding protein complex(GO:0016942) growth factor complex(GO:0036454) insulin-like growth factor ternary complex(GO:0042567) |
0.0 | 0.0 | GO:1990696 | USH2 complex(GO:1990696) |
0.0 | 0.4 | GO:0044815 | DNA packaging complex(GO:0044815) |
0.0 | 0.1 | GO:0048476 | Holliday junction resolvase complex(GO:0048476) |
0.0 | 0.1 | GO:0098642 | collagen type IV trimer(GO:0005587) network-forming collagen trimer(GO:0098642) collagen network(GO:0098645) basement membrane collagen trimer(GO:0098651) |
0.0 | 0.1 | GO:0048770 | melanosome(GO:0042470) pigment granule(GO:0048770) |
0.0 | 0.0 | GO:0043219 | lateral loop(GO:0043219) |
0.0 | 0.3 | GO:0032420 | stereocilium(GO:0032420) |
0.0 | 0.1 | GO:0000793 | condensed chromosome(GO:0000793) |
0.0 | 0.0 | GO:0044614 | nuclear pore cytoplasmic filaments(GO:0044614) |
0.0 | 0.1 | GO:1990923 | PET complex(GO:1990923) |
0.0 | 0.7 | GO:0005791 | rough endoplasmic reticulum(GO:0005791) |
0.0 | 3.0 | GO:0015629 | actin cytoskeleton(GO:0015629) |
0.0 | 0.0 | GO:0005914 | spot adherens junction(GO:0005914) |
0.0 | 0.1 | GO:0070761 | pre-snoRNP complex(GO:0070761) |
0.0 | 0.1 | GO:0070032 | synaptobrevin 2-SNAP-25-syntaxin-1a-complexin I complex(GO:0070032) |
0.0 | 0.1 | GO:0002199 | zona pellucida receptor complex(GO:0002199) |
0.0 | 0.0 | GO:0070939 | Dsl1p complex(GO:0070939) |
0.0 | 12.3 | GO:0005739 | mitochondrion(GO:0005739) |
0.0 | 0.2 | GO:0080008 | Cul4-RING E3 ubiquitin ligase complex(GO:0080008) |
0.0 | 0.2 | GO:0000506 | glycosylphosphatidylinositol-N-acetylglucosaminyltransferase (GPI-GnT) complex(GO:0000506) |
0.0 | 28.3 | GO:0070062 | extracellular exosome(GO:0070062) |
0.0 | 5.9 | GO:0005730 | nucleolus(GO:0005730) |
0.0 | 0.4 | GO:0045095 | keratin filament(GO:0045095) |
0.0 | 0.0 | GO:0046540 | U4/U6 x U5 tri-snRNP complex(GO:0046540) |
0.0 | 0.2 | GO:0031201 | SNARE complex(GO:0031201) |
0.0 | 0.0 | GO:0005968 | Rab-protein geranylgeranyltransferase complex(GO:0005968) |
0.0 | 0.0 | GO:0035749 | myelin sheath adaxonal region(GO:0035749) |
0.0 | 0.0 | GO:0005677 | chromatin silencing complex(GO:0005677) |
0.0 | 0.4 | GO:0042579 | peroxisome(GO:0005777) microbody(GO:0042579) |
0.0 | 0.1 | GO:1902555 | endoribonuclease complex(GO:1902555) |
0.0 | 0.4 | GO:0019005 | SCF ubiquitin ligase complex(GO:0019005) |
0.0 | 2.5 | GO:0042175 | nuclear outer membrane-endoplasmic reticulum membrane network(GO:0042175) |
0.0 | 0.1 | GO:0031091 | platelet alpha granule(GO:0031091) |
0.0 | 0.2 | GO:0016529 | sarcoplasmic reticulum(GO:0016529) |
0.0 | 0.2 | GO:0036064 | ciliary basal body(GO:0036064) |
0.0 | 0.1 | GO:0035253 | ciliary rootlet(GO:0035253) |
0.0 | 0.0 | GO:0030137 | COPI-coated vesicle(GO:0030137) |
0.0 | 1.3 | GO:0035068 | micro-ribonucleoprotein complex(GO:0035068) |
0.0 | 0.0 | GO:0001931 | uropod(GO:0001931) cell trailing edge(GO:0031254) |
0.0 | 0.1 | GO:0035686 | sperm fibrous sheath(GO:0035686) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
1.6 | 4.7 | GO:0046573 | lactonohydrolase activity(GO:0046573) acyl-L-homoserine-lactone lactonohydrolase activity(GO:0102007) |
1.1 | 4.6 | GO:0032564 | dATP binding(GO:0032564) |
1.0 | 3.1 | GO:0050833 | pyruvate transmembrane transporter activity(GO:0050833) |
1.0 | 1.0 | GO:0035851 | Krueppel-associated box domain binding(GO:0035851) |
1.0 | 4.1 | GO:0035615 | clathrin adaptor activity(GO:0035615) endocytic adaptor activity(GO:0098748) |
0.9 | 4.6 | GO:0019960 | C-X3-C chemokine binding(GO:0019960) |
0.9 | 7.1 | GO:0008140 | cAMP response element binding protein binding(GO:0008140) |
0.9 | 8.8 | GO:0004016 | adenylate cyclase activity(GO:0004016) |
0.9 | 3.4 | GO:0051425 | PTB domain binding(GO:0051425) |
0.9 | 8.6 | GO:0015129 | lactate transmembrane transporter activity(GO:0015129) |
0.8 | 2.5 | GO:0004104 | cholinesterase activity(GO:0004104) |
0.8 | 3.4 | GO:0008486 | diphosphoinositol-polyphosphate diphosphatase activity(GO:0008486) |
0.8 | 9.2 | GO:0070410 | co-SMAD binding(GO:0070410) |
0.8 | 2.5 | GO:0031800 | type 3 metabotropic glutamate receptor binding(GO:0031800) |
0.8 | 1.6 | GO:0043842 | Kdo transferase activity(GO:0043842) |
0.8 | 4.1 | GO:0032050 | clathrin heavy chain binding(GO:0032050) |
0.8 | 1.6 | GO:0004103 | choline kinase activity(GO:0004103) |
0.8 | 4.0 | GO:0017034 | Rap guanyl-nucleotide exchange factor activity(GO:0017034) |
0.8 | 2.4 | GO:0005119 | smoothened binding(GO:0005119) |
0.8 | 3.1 | GO:0000340 | RNA 7-methylguanosine cap binding(GO:0000340) |
0.8 | 2.3 | GO:0004832 | valine-tRNA ligase activity(GO:0004832) |
0.7 | 1.5 | GO:0008525 | phosphatidylcholine transporter activity(GO:0008525) |
0.7 | 2.1 | GO:0035175 | histone kinase activity (H3-S10 specific)(GO:0035175) |
0.7 | 2.8 | GO:0051434 | BH3 domain binding(GO:0051434) |
0.7 | 2.1 | GO:0047623 | AMP deaminase activity(GO:0003876) adenosine-phosphate deaminase activity(GO:0047623) |
0.7 | 2.1 | GO:0070137 | ubiquitin-like protein-specific endopeptidase activity(GO:0070137) SUMO-specific endopeptidase activity(GO:0070139) |
0.6 | 1.9 | GO:0050145 | nucleoside phosphate kinase activity(GO:0050145) |
0.6 | 1.9 | GO:0004064 | arylesterase activity(GO:0004064) |
0.6 | 1.7 | GO:0004345 | glucose-6-phosphate dehydrogenase activity(GO:0004345) |
0.6 | 1.7 | GO:0050692 | DBD domain binding(GO:0050692) |
0.6 | 1.7 | GO:0017116 | single-stranded DNA-dependent ATP-dependent DNA helicase activity(GO:0017116) |
0.6 | 1.7 | GO:0000339 | RNA cap binding(GO:0000339) |
0.6 | 5.7 | GO:0004176 | ATP-dependent peptidase activity(GO:0004176) |
0.6 | 3.9 | GO:0005381 | iron ion transmembrane transporter activity(GO:0005381) |
0.6 | 2.2 | GO:0004656 | procollagen-proline 4-dioxygenase activity(GO:0004656) |
0.5 | 2.7 | GO:0004826 | phenylalanine-tRNA ligase activity(GO:0004826) |
0.5 | 2.7 | GO:0008526 | phosphatidylinositol transporter activity(GO:0008526) |
0.5 | 4.9 | GO:0046972 | histone acetyltransferase activity (H4-K5 specific)(GO:0043995) histone acetyltransferase activity (H4-K8 specific)(GO:0043996) histone acetyltransferase activity (H4-K16 specific)(GO:0046972) |
0.5 | 4.3 | GO:0071933 | Arp2/3 complex binding(GO:0071933) |
0.5 | 2.1 | GO:0005047 | signal recognition particle binding(GO:0005047) |
0.5 | 1.6 | GO:0070644 | vitamin D response element binding(GO:0070644) |
0.5 | 2.1 | GO:0004849 | uridine kinase activity(GO:0004849) |
0.5 | 2.0 | GO:0071074 | eukaryotic initiation factor eIF2 binding(GO:0071074) |
0.5 | 2.0 | GO:0008808 | cardiolipin synthase activity(GO:0008808) phosphatidyltransferase activity(GO:0030572) |
0.5 | 2.0 | GO:0031721 | hemoglobin alpha binding(GO:0031721) |
0.5 | 1.5 | GO:0030519 | snoRNP binding(GO:0030519) |
0.5 | 1.8 | GO:0033300 | dehydroascorbic acid transporter activity(GO:0033300) |
0.5 | 1.4 | GO:0043533 | inositol 1,3,4,5 tetrakisphosphate binding(GO:0043533) |
0.4 | 6.3 | GO:0016780 | phosphotransferase activity, for other substituted phosphate groups(GO:0016780) |
0.4 | 3.1 | GO:0043495 | protein anchor(GO:0043495) |
0.4 | 1.7 | GO:0036435 | K48-linked polyubiquitin binding(GO:0036435) |
0.4 | 5.1 | GO:0032041 | histone deacetylase activity (H3-K14 specific)(GO:0031078) NAD-dependent histone deacetylase activity (H3-K14 specific)(GO:0032041) |
0.4 | 1.3 | GO:0035663 | Toll-like receptor 2 binding(GO:0035663) |
0.4 | 1.7 | GO:0033592 | RNA strand annealing activity(GO:0033592) |
0.4 | 1.3 | GO:0001069 | regulatory region RNA binding(GO:0001069) |
0.4 | 8.9 | GO:0031492 | nucleosomal DNA binding(GO:0031492) |
0.4 | 2.1 | GO:0031013 | troponin I binding(GO:0031013) |
0.4 | 3.4 | GO:0004862 | cAMP-dependent protein kinase inhibitor activity(GO:0004862) |
0.4 | 5.0 | GO:0070300 | phosphatidic acid binding(GO:0070300) |
0.4 | 1.3 | GO:0004616 | phosphogluconate dehydrogenase (decarboxylating) activity(GO:0004616) |
0.4 | 0.8 | GO:1990715 | mRNA CDS binding(GO:1990715) |
0.4 | 2.9 | GO:0005078 | MAP-kinase scaffold activity(GO:0005078) |
0.4 | 1.2 | GO:0004724 | magnesium-dependent protein serine/threonine phosphatase activity(GO:0004724) |
0.4 | 2.1 | GO:0035612 | AP-2 adaptor complex binding(GO:0035612) |
0.4 | 0.8 | GO:0070548 | L-glutamine aminotransferase activity(GO:0070548) |
0.4 | 3.7 | GO:0042500 | aspartic endopeptidase activity, intramembrane cleaving(GO:0042500) |
0.4 | 6.1 | GO:0005521 | lamin binding(GO:0005521) |
0.4 | 1.6 | GO:0042731 | PH domain binding(GO:0042731) |
0.4 | 1.2 | GO:0050220 | prostaglandin-E synthase activity(GO:0050220) |
0.4 | 1.2 | GO:0070653 | high-density lipoprotein particle receptor binding(GO:0070653) |
0.4 | 2.3 | GO:0045505 | dynein intermediate chain binding(GO:0045505) |
0.4 | 0.8 | GO:0051765 | inositol tetrakisphosphate kinase activity(GO:0051765) |
0.4 | 7.3 | GO:0046961 | proton-transporting ATPase activity, rotational mechanism(GO:0046961) |
0.4 | 0.4 | GO:0032453 | histone demethylase activity (H3-K4 specific)(GO:0032453) |
0.4 | 1.1 | GO:0019770 | IgG receptor activity(GO:0019770) |
0.4 | 1.5 | GO:0019834 | phospholipase A2 inhibitor activity(GO:0019834) |
0.4 | 0.4 | GO:0042054 | histone methyltransferase activity(GO:0042054) |
0.4 | 0.4 | GO:0043423 | 3-phosphoinositide-dependent protein kinase binding(GO:0043423) |
0.4 | 1.1 | GO:0016309 | 1-phosphatidylinositol-5-phosphate 4-kinase activity(GO:0016309) |
0.4 | 1.5 | GO:0032896 | palmitoyl-CoA 9-desaturase activity(GO:0032896) |
0.4 | 1.1 | GO:0047276 | N-acetyllactosaminide 3-alpha-galactosyltransferase activity(GO:0047276) |
0.4 | 1.4 | GO:0004566 | beta-glucuronidase activity(GO:0004566) |
0.4 | 0.7 | GO:0004427 | inorganic diphosphatase activity(GO:0004427) |
0.4 | 0.4 | GO:0050816 | phosphothreonine binding(GO:0050816) |
0.4 | 5.0 | GO:0016493 | C-C chemokine receptor activity(GO:0016493) |
0.4 | 3.2 | GO:0030983 | mismatched DNA binding(GO:0030983) |
0.4 | 1.1 | GO:0030350 | iron-responsive element binding(GO:0030350) |
0.4 | 2.5 | GO:0003836 | beta-galactoside (CMP) alpha-2,3-sialyltransferase activity(GO:0003836) |
0.3 | 1.4 | GO:0004090 | carbonyl reductase (NADPH) activity(GO:0004090) |
0.3 | 3.1 | GO:0008432 | JUN kinase binding(GO:0008432) |
0.3 | 2.1 | GO:0010521 | telomerase inhibitor activity(GO:0010521) |
0.3 | 1.0 | GO:0030984 | kininogen binding(GO:0030984) |
0.3 | 1.4 | GO:0055102 | lipase inhibitor activity(GO:0055102) |
0.3 | 1.0 | GO:0071535 | RING-like zinc finger domain binding(GO:0071535) |
0.3 | 2.4 | GO:0019966 | interleukin-1 binding(GO:0019966) |
0.3 | 2.7 | GO:0102391 | decanoate--CoA ligase activity(GO:0102391) |
0.3 | 1.3 | GO:0000386 | second spliceosomal transesterification activity(GO:0000386) |
0.3 | 0.7 | GO:0046933 | proton-transporting ATP synthase activity, rotational mechanism(GO:0046933) |
0.3 | 2.0 | GO:0005168 | neurotrophin TRKA receptor binding(GO:0005168) |
0.3 | 1.0 | GO:0004013 | adenosylhomocysteinase activity(GO:0004013) trialkylsulfonium hydrolase activity(GO:0016802) |
0.3 | 1.0 | GO:0016971 | flavin-linked sulfhydryl oxidase activity(GO:0016971) |
0.3 | 1.3 | GO:0017128 | phospholipid scramblase activity(GO:0017128) |
0.3 | 1.3 | GO:0004012 | phospholipid-translocating ATPase activity(GO:0004012) |
0.3 | 2.9 | GO:0016846 | carbon-sulfur lyase activity(GO:0016846) |
0.3 | 0.9 | GO:0003726 | double-stranded RNA adenosine deaminase activity(GO:0003726) |
0.3 | 0.3 | GO:0004305 | ethanolamine kinase activity(GO:0004305) |
0.3 | 2.5 | GO:0003691 | double-stranded telomeric DNA binding(GO:0003691) |
0.3 | 2.8 | GO:0034863 | pinocarveol dehydrogenase activity(GO:0018446) chloral hydrate dehydrogenase activity(GO:0018447) hydroxymethylmethylsilanediol oxidase activity(GO:0018448) 1-phenylethanol dehydrogenase activity(GO:0018449) myrtenol dehydrogenase activity(GO:0018450) cis-1,2-dihydroxy-1,2-dihydro-8-carboxynaphthalene dehydrogenase activity(GO:0034522) 3-hydroxy-4-methyloctanoyl-CoA dehydrogenase activity(GO:0034582) 2-hydroxy-4-isopropenylcyclohexane-1-carboxyl-CoA dehydrogenase activity(GO:0034778) cis-9,10-dihydroanthracene-9,10-diol dehydrogenase activity(GO:0034817) citronellol dehydrogenase activity(GO:0034821) naphthyl-2-hydroxymethyl-succinyl-CoA dehydrogenase activity(GO:0034847) 2,4,4-trimethyl-1-pentanol dehydrogenase activity(GO:0034863) 2,4,4-trimethyl-3-hydroxypentanoyl-CoA dehydrogenase activity(GO:0034868) 1-hydroxy-4,4-dimethylpentan-3-one dehydrogenase activity(GO:0034871) endosulfan diol dehydrogenase activity(GO:0034891) endosulfan hydroxyether dehydrogenase activity(GO:0034901) 3-hydroxy-2-methylhexanoyl-CoA dehydrogenase activity(GO:0034918) 3-hydroxy-2,6-dimethyl-5-methylene-heptanoyl-CoA dehydrogenase activity(GO:0034944) versicolorin reductase activity(GO:0042469) ketoreductase activity(GO:0045703) |
0.3 | 2.5 | GO:0001091 | RNA polymerase II basal transcription factor binding(GO:0001091) |
0.3 | 0.9 | GO:0030942 | endoplasmic reticulum signal peptide binding(GO:0030942) |
0.3 | 1.2 | GO:0009374 | biotin binding(GO:0009374) |
0.3 | 1.5 | GO:1990380 | Lys48-specific deubiquitinase activity(GO:1990380) |
0.3 | 1.5 | GO:0016530 | metallochaperone activity(GO:0016530) |
0.3 | 1.5 | GO:0015204 | urea transmembrane transporter activity(GO:0015204) |
0.3 | 0.9 | GO:0045503 | dynein light chain binding(GO:0045503) |
0.3 | 0.6 | GO:0019957 | C-C chemokine binding(GO:0019957) |
0.3 | 2.6 | GO:0016634 | oxidoreductase activity, acting on the CH-CH group of donors, oxygen as acceptor(GO:0016634) |
0.3 | 0.9 | GO:0016823 | hydrolase activity, acting on acid carbon-carbon bonds(GO:0016822) hydrolase activity, acting on acid carbon-carbon bonds, in ketonic substances(GO:0016823) |
0.3 | 0.9 | GO:0070573 | metallodipeptidase activity(GO:0070573) |
0.3 | 3.2 | GO:0001846 | opsonin binding(GO:0001846) |
0.3 | 3.1 | GO:0048156 | tau protein binding(GO:0048156) |
0.3 | 2.3 | GO:0001135 | transcription factor activity, RNA polymerase II transcription factor recruiting(GO:0001135) |
0.3 | 5.4 | GO:0003746 | translation elongation factor activity(GO:0003746) |
0.3 | 0.6 | GO:0015205 | purine nucleobase transmembrane transporter activity(GO:0005345) pyrimidine nucleobase transmembrane transporter activity(GO:0005350) nucleobase transmembrane transporter activity(GO:0015205) |
0.3 | 2.5 | GO:0050321 | tau-protein kinase activity(GO:0050321) |
0.3 | 1.1 | GO:0052834 | inositol monophosphate 1-phosphatase activity(GO:0008934) inositol monophosphate 3-phosphatase activity(GO:0052832) inositol monophosphate 4-phosphatase activity(GO:0052833) inositol monophosphate phosphatase activity(GO:0052834) |
0.3 | 0.8 | GO:0004771 | sterol esterase activity(GO:0004771) |
0.3 | 4.4 | GO:0008143 | poly(A) binding(GO:0008143) |
0.3 | 2.2 | GO:0016742 | hydroxymethyl-, formyl- and related transferase activity(GO:0016742) |
0.3 | 2.5 | GO:0031386 | protein tag(GO:0031386) |
0.3 | 0.8 | GO:0004719 | protein-L-isoaspartate (D-aspartate) O-methyltransferase activity(GO:0004719) |
0.3 | 0.5 | GO:0038181 | bile acid receptor activity(GO:0038181) |
0.3 | 0.8 | GO:0016716 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, another compound as one donor, and incorporation of one atom of oxygen(GO:0016716) |
0.3 | 1.6 | GO:0001727 | lipid kinase activity(GO:0001727) |
0.3 | 1.3 | GO:0070324 | thyroid hormone binding(GO:0070324) |
0.3 | 1.1 | GO:0004046 | aminoacylase activity(GO:0004046) |
0.3 | 1.6 | GO:0004169 | dolichyl-phosphate-mannose-protein mannosyltransferase activity(GO:0004169) |
0.3 | 0.5 | GO:0051864 | histone demethylase activity (H3-K36 specific)(GO:0051864) |
0.3 | 1.0 | GO:0004740 | pyruvate dehydrogenase (acetyl-transferring) kinase activity(GO:0004740) |
0.3 | 4.4 | GO:0017025 | TBP-class protein binding(GO:0017025) |
0.3 | 4.2 | GO:0019825 | oxygen binding(GO:0019825) |
0.3 | 0.8 | GO:0008430 | selenium binding(GO:0008430) |
0.3 | 1.0 | GO:0004614 | phosphoglucomutase activity(GO:0004614) |
0.3 | 2.1 | GO:0004534 | 5'-3' exoribonuclease activity(GO:0004534) |
0.3 | 1.3 | GO:0050815 | phosphoserine binding(GO:0050815) |
0.3 | 1.3 | GO:0005131 | growth hormone receptor binding(GO:0005131) |
0.3 | 2.8 | GO:0034869 | 2-oxoglutaryl-CoA thioesterase activity(GO:0034843) 2,4,4-trimethyl-3-oxopentanoyl-CoA thioesterase activity(GO:0034869) 3-isopropylbut-3-enoyl-CoA thioesterase activity(GO:0034946) glutaryl-CoA hydrolase activity(GO:0044466) |
0.3 | 1.3 | GO:0071558 | histone demethylase activity (H3-K27 specific)(GO:0071558) |
0.3 | 14.8 | GO:0000979 | RNA polymerase II core promoter sequence-specific DNA binding(GO:0000979) |
0.2 | 0.5 | GO:0004768 | stearoyl-CoA 9-desaturase activity(GO:0004768) |
0.2 | 1.5 | GO:0003918 | DNA topoisomerase type II (ATP-hydrolyzing) activity(GO:0003918) DNA topoisomerase II activity(GO:0061505) |
0.2 | 1.0 | GO:0042015 | interleukin-20 binding(GO:0042015) |
0.2 | 0.7 | GO:0036033 | mediator complex binding(GO:0036033) |
0.2 | 1.2 | GO:0034046 | poly(G) binding(GO:0034046) |
0.2 | 0.7 | GO:0035184 | histone threonine kinase activity(GO:0035184) |
0.2 | 1.0 | GO:0070053 | thrombospondin receptor activity(GO:0070053) |
0.2 | 1.2 | GO:0015165 | pyrimidine nucleotide-sugar transmembrane transporter activity(GO:0015165) |
0.2 | 1.0 | GO:0018585 | fluorene oxygenase activity(GO:0018585) |
0.2 | 2.9 | GO:0017160 | Ral GTPase binding(GO:0017160) |
0.2 | 0.7 | GO:0008073 | ornithine decarboxylase inhibitor activity(GO:0008073) |
0.2 | 0.7 | GO:0003941 | L-serine ammonia-lyase activity(GO:0003941) |
0.2 | 8.6 | GO:0004402 | histone acetyltransferase activity(GO:0004402) |
0.2 | 3.5 | GO:0034185 | apolipoprotein binding(GO:0034185) |
0.2 | 0.9 | GO:0017150 | tRNA dihydrouridine synthase activity(GO:0017150) |
0.2 | 0.7 | GO:0031826 | type 2A serotonin receptor binding(GO:0031826) |
0.2 | 0.7 | GO:0019961 | interferon binding(GO:0019961) |
0.2 | 0.2 | GO:0034739 | histone deacetylase activity (H4-K16 specific)(GO:0034739) |
0.2 | 0.7 | GO:0031545 | peptidyl-proline 4-dioxygenase activity(GO:0031545) |
0.2 | 2.0 | GO:0001222 | transcription corepressor binding(GO:0001222) |
0.2 | 2.0 | GO:0010314 | phosphatidylinositol-5-phosphate binding(GO:0010314) |
0.2 | 0.7 | GO:0033829 | O-fucosylpeptide 3-beta-N-acetylglucosaminyltransferase activity(GO:0033829) |
0.2 | 1.1 | GO:0019784 | NEDD8-specific protease activity(GO:0019784) |
0.2 | 0.4 | GO:0015116 | secondary active sulfate transmembrane transporter activity(GO:0008271) sulfate transmembrane transporter activity(GO:0015116) |
0.2 | 1.1 | GO:0022820 | potassium:chloride symporter activity(GO:0015379) potassium ion symporter activity(GO:0022820) |
0.2 | 0.7 | GO:0042895 | antibiotic transporter activity(GO:0042895) |
0.2 | 6.9 | GO:0016831 | carboxy-lyase activity(GO:0016831) |
0.2 | 1.1 | GO:0046934 | phosphatidylinositol-4,5-bisphosphate 3-kinase activity(GO:0046934) |
0.2 | 0.4 | GO:0035877 | death effector domain binding(GO:0035877) |
0.2 | 4.5 | GO:0045502 | dynein binding(GO:0045502) |
0.2 | 4.5 | GO:0016676 | cytochrome-c oxidase activity(GO:0004129) heme-copper terminal oxidase activity(GO:0015002) oxidoreductase activity, acting on a heme group of donors, oxygen as acceptor(GO:0016676) |
0.2 | 0.4 | GO:0005128 | erythropoietin receptor binding(GO:0005128) |
0.2 | 2.8 | GO:0050681 | androgen receptor binding(GO:0050681) |
0.2 | 5.7 | GO:0052635 | sulfonate dioxygenase activity(GO:0000907) 2,4-dichlorophenoxyacetate alpha-ketoglutarate dioxygenase activity(GO:0018602) hypophosphite dioxygenase activity(GO:0034792) gibberellin 2-beta-dioxygenase activity(GO:0045543) C-19 gibberellin 2-beta-dioxygenase activity(GO:0052634) C-20 gibberellin 2-beta-dioxygenase activity(GO:0052635) |
0.2 | 1.7 | GO:0004596 | peptide alpha-N-acetyltransferase activity(GO:0004596) |
0.2 | 1.5 | GO:0050700 | CARD domain binding(GO:0050700) |
0.2 | 1.0 | GO:0047499 | calcium-independent phospholipase A2 activity(GO:0047499) |
0.2 | 1.2 | GO:0019870 | potassium channel inhibitor activity(GO:0019870) |
0.2 | 0.8 | GO:0043262 | adenosine-diphosphatase activity(GO:0043262) |
0.2 | 0.4 | GO:0004886 | 9-cis retinoic acid receptor activity(GO:0004886) |
0.2 | 2.0 | GO:0004861 | cyclin-dependent protein serine/threonine kinase inhibitor activity(GO:0004861) |
0.2 | 1.2 | GO:0097371 | MDM2/MDM4 family protein binding(GO:0097371) |
0.2 | 0.4 | GO:0008142 | oxysterol binding(GO:0008142) |
0.2 | 0.6 | GO:0004366 | glycerol-3-phosphate O-acyltransferase activity(GO:0004366) |
0.2 | 1.0 | GO:0005113 | patched binding(GO:0005113) |
0.2 | 0.8 | GO:0004689 | phosphorylase kinase activity(GO:0004689) |
0.2 | 3.7 | GO:0043027 | cysteine-type endopeptidase inhibitor activity involved in apoptotic process(GO:0043027) |
0.2 | 0.6 | GO:0042809 | vitamin D receptor binding(GO:0042809) |
0.2 | 0.8 | GO:0000213 | tRNA-intron endonuclease activity(GO:0000213) |
0.2 | 0.6 | GO:0004924 | oncostatin-M receptor activity(GO:0004924) |
0.2 | 0.6 | GO:0030911 | TPR domain binding(GO:0030911) |
0.2 | 0.8 | GO:0008865 | fructokinase activity(GO:0008865) mannokinase activity(GO:0019158) |
0.2 | 1.7 | GO:0016886 | ligase activity, forming phosphoric ester bonds(GO:0016886) |
0.2 | 1.9 | GO:0050308 | sugar-phosphatase activity(GO:0050308) |
0.2 | 0.6 | GO:0004939 | beta-adrenergic receptor activity(GO:0004939) |
0.2 | 0.2 | GO:0034416 | bisphosphoglycerate phosphatase activity(GO:0034416) |
0.2 | 5.8 | GO:0061631 | ubiquitin conjugating enzyme activity(GO:0061631) |
0.2 | 0.9 | GO:0004668 | protein-arginine deiminase activity(GO:0004668) |
0.2 | 6.3 | GO:0004177 | aminopeptidase activity(GO:0004177) |
0.2 | 2.7 | GO:0017049 | GTP-Rho binding(GO:0017049) |
0.2 | 0.5 | GO:0016635 | oxidoreductase activity, acting on the CH-CH group of donors, quinone or related compound as acceptor(GO:0016635) |
0.2 | 1.4 | GO:0019206 | nucleoside kinase activity(GO:0019206) |
0.2 | 1.3 | GO:1990381 | ubiquitin-specific protease binding(GO:1990381) |
0.2 | 0.5 | GO:0043426 | MRF binding(GO:0043426) |
0.2 | 0.7 | GO:0019136 | deoxynucleoside kinase activity(GO:0019136) |
0.2 | 1.3 | GO:0018653 | 3-(3-hydroxyphenyl)propionate hydroxylase activity(GO:0008688) 4-chlorobenzaldehyde oxidase activity(GO:0018471) 3,5-xylenol methylhydroxylase activity(GO:0018630) phenylacetate hydroxylase activity(GO:0018631) 4-nitrophenol 4-monooxygenase activity(GO:0018632) dimethyl sulfide monooxygenase activity(GO:0018633) alpha-pinene monooxygenase [NADH] activity(GO:0018634) 1-hydroxy-2-naphthoate hydroxylase activity(GO:0018637) toluene 4-monooxygenase activity(GO:0018638) xylene monooxygenase activity(GO:0018639) dibenzothiophene monooxygenase activity(GO:0018640) 6-hydroxy-3-methyl-2-oxo-1,2-dihydroquinoline 6-monooxygenase activity(GO:0018641) chlorophenol 4-monooxygenase activity(GO:0018642) carbon disulfide oxygenase activity(GO:0018643) toluene 2-monooxygenase activity(GO:0018644) 1-hydroxy-2-oxolimonene 1,2-monooxygenase activity(GO:0018646) phenanthrene 1,2-monooxygenase activity(GO:0018647) tetrahydrofuran hydroxylase activity(GO:0018649) styrene monooxygenase activity(GO:0018650) toluene-4-sulfonate monooxygenase activity(GO:0018651) toluene-sulfonate methyl-monooxygenase activity(GO:0018652) 3-methyl-2-oxo-1,2-dihydroquinoline 6-monooxygenase activity(GO:0018653) 2-hydroxy-phenylacetate hydroxylase activity(GO:0018654) 2-oxo-delta3-4,5,5-trimethylcyclopentenylacetyl-CoA 1,2-monooxygenase activity(GO:0018655) phenanthrene 3,4-monooxygenase activity(GO:0018656) toluene 3-monooxygenase activity(GO:0018657) 4-hydroxyphenylacetate,NADH:oxygen oxidoreductase (3-hydroxylating) activity(GO:0018660) limonene monooxygenase activity(GO:0019113) 2-methylnaphthalene hydroxylase activity(GO:0034526) 1-methylnaphthalene hydroxylase activity(GO:0034534) bisphenol A hydroxylase A activity(GO:0034560) salicylate 5-hydroxylase activity(GO:0034785) isobutylamine N-hydroxylase activity(GO:0034791) branched-chain dodecylbenzene sulfonate monooxygenase activity(GO:0034802) 3-HSA hydroxylase activity(GO:0034819) 4-hydroxypyridine-3-hydroxylase activity(GO:0034894) 2-octaprenyl-3-methyl-6-methoxy-1,4-benzoquinol hydroxylase activity(GO:0043719) 6-hydroxynicotinate 3-monooxygenase activity(GO:0043731) thalianol hydroxylase activity(GO:0080014) |
0.2 | 0.4 | GO:0048273 | mitogen-activated protein kinase p38 binding(GO:0048273) |
0.2 | 0.5 | GO:0003829 | beta-1,3-galactosyl-O-glycosyl-glycoprotein beta-1,6-N-acetylglucosaminyltransferase activity(GO:0003829) |
0.2 | 0.5 | GO:0016721 | superoxide dismutase activity(GO:0004784) oxidoreductase activity, acting on superoxide radicals as acceptor(GO:0016721) |
0.2 | 2.6 | GO:0070412 | R-SMAD binding(GO:0070412) |
0.2 | 6.7 | GO:0005507 | copper ion binding(GO:0005507) |
0.2 | 0.3 | GO:0005087 | Ran guanyl-nucleotide exchange factor activity(GO:0005087) |
0.2 | 0.5 | GO:0004948 | calcitonin receptor activity(GO:0004948) |
0.2 | 2.9 | GO:0008307 | structural constituent of muscle(GO:0008307) |
0.2 | 0.5 | GO:0019209 | kinase activator activity(GO:0019209) |
0.2 | 2.7 | GO:0016706 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, 2-oxoglutarate as one donor, and incorporation of one atom each of oxygen into both donors(GO:0016706) |
0.2 | 5.9 | GO:0016875 | ligase activity, forming carbon-oxygen bonds(GO:0016875) ligase activity, forming aminoacyl-tRNA and related compounds(GO:0016876) |
0.2 | 0.8 | GO:0009378 | four-way junction helicase activity(GO:0009378) |
0.2 | 0.2 | GO:0051380 | norepinephrine binding(GO:0051380) |
0.2 | 0.2 | GO:0046978 | TAP1 binding(GO:0046978) TAP2 binding(GO:0046979) |
0.2 | 0.8 | GO:0043008 | ATP-dependent protein binding(GO:0043008) |
0.2 | 0.7 | GO:0016833 | oxo-acid-lyase activity(GO:0016833) |
0.2 | 0.8 | GO:0047035 | testosterone dehydrogenase (NAD+) activity(GO:0047035) |
0.2 | 0.6 | GO:0046975 | histone methyltransferase activity (H3-K36 specific)(GO:0046975) |
0.2 | 0.6 | GO:0002060 | purine nucleobase binding(GO:0002060) |
0.2 | 0.5 | GO:0045134 | uridine-diphosphatase activity(GO:0045134) |
0.2 | 0.5 | GO:0031752 | D5 dopamine receptor binding(GO:0031752) |
0.2 | 0.2 | GO:0051525 | NFAT protein binding(GO:0051525) |
0.2 | 0.6 | GO:0004703 | G-protein coupled receptor kinase activity(GO:0004703) |
0.2 | 3.0 | GO:0035035 | histone acetyltransferase binding(GO:0035035) |
0.2 | 16.8 | GO:0017137 | Rab GTPase binding(GO:0017137) |
0.2 | 1.4 | GO:0000400 | four-way junction DNA binding(GO:0000400) |
0.2 | 1.4 | GO:0003689 | DNA clamp loader activity(GO:0003689) protein-DNA loading ATPase activity(GO:0033170) |
0.2 | 0.6 | GO:0004045 | aminoacyl-tRNA hydrolase activity(GO:0004045) |
0.2 | 0.8 | GO:0031749 | D2 dopamine receptor binding(GO:0031749) |
0.2 | 0.2 | GO:0016675 | oxidoreductase activity, acting on a heme group of donors(GO:0016675) |
0.2 | 4.2 | GO:0097472 | cyclin-dependent protein serine/threonine kinase activity(GO:0004693) cyclin-dependent protein kinase activity(GO:0097472) |
0.2 | 0.9 | GO:0008297 | single-stranded DNA exodeoxyribonuclease activity(GO:0008297) |
0.2 | 0.9 | GO:0004630 | phospholipase D activity(GO:0004630) |
0.2 | 23.4 | GO:0061630 | ubiquitin protein ligase activity(GO:0061630) |
0.2 | 1.2 | GO:0019869 | chloride channel inhibitor activity(GO:0019869) |
0.1 | 0.4 | GO:0004967 | glucagon receptor activity(GO:0004967) |
0.1 | 1.9 | GO:0008253 | 5'-nucleotidase activity(GO:0008253) |
0.1 | 1.3 | GO:0005123 | death receptor binding(GO:0005123) |
0.1 | 4.8 | GO:0016712 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, reduced flavin or flavoprotein as one donor, and incorporation of one atom of oxygen(GO:0016712) |
0.1 | 0.7 | GO:0030976 | thiamine pyrophosphate binding(GO:0030976) |
0.1 | 4.3 | GO:0018024 | histone-lysine N-methyltransferase activity(GO:0018024) |
0.1 | 0.9 | GO:0008494 | translation activator activity(GO:0008494) |
0.1 | 1.9 | GO:0017056 | structural constituent of nuclear pore(GO:0017056) |
0.1 | 3.2 | GO:0046875 | ephrin receptor binding(GO:0046875) |
0.1 | 1.8 | GO:0043176 | amine binding(GO:0043176) |
0.1 | 1.2 | GO:0004017 | adenylate kinase activity(GO:0004017) |
0.1 | 1.4 | GO:0070016 | armadillo repeat domain binding(GO:0070016) |
0.1 | 1.1 | GO:0016889 | endodeoxyribonuclease activity, producing 3'-phosphomonoesters(GO:0016889) |
0.1 | 0.4 | GO:0097322 | 7SK snRNA binding(GO:0097322) |
0.1 | 1.0 | GO:0001206 | transcriptional repressor activity, RNA polymerase II distal enhancer sequence-specific binding(GO:0001206) |
0.1 | 0.1 | GO:0043140 | ATP-dependent 3'-5' DNA helicase activity(GO:0043140) |
0.1 | 0.6 | GO:0015173 | aromatic amino acid transmembrane transporter activity(GO:0015173) |
0.1 | 3.3 | GO:0001205 | transcriptional activator activity, RNA polymerase II distal enhancer sequence-specific binding(GO:0001205) |
0.1 | 0.7 | GO:1990239 | steroid hormone binding(GO:1990239) |
0.1 | 0.7 | GO:0000774 | adenyl-nucleotide exchange factor activity(GO:0000774) |
0.1 | 0.3 | GO:0004711 | ribosomal protein S6 kinase activity(GO:0004711) |
0.1 | 0.4 | GO:0017151 | DEAD/H-box RNA helicase binding(GO:0017151) |
0.1 | 1.2 | GO:0035259 | glucocorticoid receptor binding(GO:0035259) |
0.1 | 0.3 | GO:0004699 | calcium-independent protein kinase C activity(GO:0004699) |
0.1 | 0.6 | GO:0005127 | ciliary neurotrophic factor receptor binding(GO:0005127) |
0.1 | 0.4 | GO:0004995 | tachykinin receptor activity(GO:0004995) |
0.1 | 0.8 | GO:0008508 | bile acid:sodium symporter activity(GO:0008508) |
0.1 | 0.4 | GO:1990460 | leptin receptor binding(GO:1990460) |
0.1 | 1.2 | GO:0001055 | RNA polymerase II activity(GO:0001055) |
0.1 | 0.4 | GO:0055100 | adiponectin binding(GO:0055100) |
0.1 | 0.4 | GO:0030492 | hemoglobin binding(GO:0030492) |
0.1 | 0.4 | GO:0051032 | nucleic acid transmembrane transporter activity(GO:0051032) RNA transmembrane transporter activity(GO:0051033) |
0.1 | 1.7 | GO:0070567 | cytidylyltransferase activity(GO:0070567) |
0.1 | 0.1 | GO:0060230 | lipoprotein lipase activator activity(GO:0060230) |
0.1 | 1.4 | GO:0004312 | fatty acid synthase activity(GO:0004312) |
0.1 | 3.4 | GO:0005547 | phosphatidylinositol-3,4,5-trisphosphate binding(GO:0005547) |
0.1 | 0.3 | GO:0004938 | alpha2-adrenergic receptor activity(GO:0004938) |
0.1 | 3.7 | GO:0005484 | SNAP receptor activity(GO:0005484) |
0.1 | 0.4 | GO:0043891 | glyceraldehyde-3-phosphate dehydrogenase (NAD+) (phosphorylating) activity(GO:0004365) glyceraldehyde-3-phosphate dehydrogenase (NAD(P)+) (phosphorylating) activity(GO:0043891) |
0.1 | 1.1 | GO:0001848 | complement binding(GO:0001848) |
0.1 | 0.4 | GO:0016018 | cyclosporin A binding(GO:0016018) |
0.1 | 2.1 | GO:0005070 | SH3/SH2 adaptor activity(GO:0005070) |
0.1 | 0.4 | GO:1901702 | urate transmembrane transporter activity(GO:0015143) salt transmembrane transporter activity(GO:1901702) |
0.1 | 1.0 | GO:0035925 | mRNA 3'-UTR AU-rich region binding(GO:0035925) |
0.1 | 0.4 | GO:0072345 | NAADP-sensitive calcium-release channel activity(GO:0072345) |
0.1 | 0.6 | GO:0000064 | L-ornithine transmembrane transporter activity(GO:0000064) |
0.1 | 0.2 | GO:0045340 | mercury ion binding(GO:0045340) |
0.1 | 3.3 | GO:0050699 | WW domain binding(GO:0050699) |
0.1 | 0.8 | GO:0005522 | profilin binding(GO:0005522) |
0.1 | 0.1 | GO:0008309 | double-stranded DNA exodeoxyribonuclease activity(GO:0008309) |
0.1 | 1.0 | GO:1990841 | promoter-specific chromatin binding(GO:1990841) |
0.1 | 0.2 | GO:0004749 | ribose phosphate diphosphokinase activity(GO:0004749) |
0.1 | 0.5 | GO:0043237 | laminin-1 binding(GO:0043237) |
0.1 | 1.0 | GO:0051787 | misfolded protein binding(GO:0051787) |
0.1 | 0.6 | GO:1990405 | protein antigen binding(GO:1990405) |
0.1 | 0.2 | GO:0043023 | ribosomal large subunit binding(GO:0043023) |
0.1 | 5.8 | GO:0019003 | GDP binding(GO:0019003) |
0.1 | 0.7 | GO:0016004 | phospholipase activator activity(GO:0016004) |
0.1 | 0.1 | GO:0070717 | poly-purine tract binding(GO:0070717) |
0.1 | 0.7 | GO:0015288 | porin activity(GO:0015288) |
0.1 | 2.7 | GO:0019706 | protein-cysteine S-palmitoyltransferase activity(GO:0019706) |
0.1 | 2.1 | GO:0017069 | snRNA binding(GO:0017069) |
0.1 | 0.2 | GO:0031698 | beta-2 adrenergic receptor binding(GO:0031698) |
0.1 | 1.6 | GO:0042162 | telomeric DNA binding(GO:0042162) |
0.1 | 0.4 | GO:0004062 | aryl sulfotransferase activity(GO:0004062) |
0.1 | 3.4 | GO:0035064 | methylated histone binding(GO:0035064) |
0.1 | 3.2 | GO:0016684 | oxidoreductase activity, acting on peroxide as acceptor(GO:0016684) |
0.1 | 0.7 | GO:0008420 | CTD phosphatase activity(GO:0008420) |
0.1 | 0.4 | GO:0005329 | dopamine transmembrane transporter activity(GO:0005329) |
0.1 | 0.3 | GO:0047756 | chondroitin 4-sulfotransferase activity(GO:0047756) |
0.1 | 0.8 | GO:0004438 | phosphatidylinositol-3-phosphatase activity(GO:0004438) |
0.1 | 0.1 | GO:0008171 | O-methyltransferase activity(GO:0008171) |
0.1 | 0.4 | GO:0004449 | isocitrate dehydrogenase (NAD+) activity(GO:0004449) |
0.1 | 2.1 | GO:0043014 | alpha-tubulin binding(GO:0043014) |
0.1 | 0.3 | GO:0019767 | IgE receptor activity(GO:0019767) |
0.1 | 0.3 | GO:0022833 | mechanically-gated ion channel activity(GO:0008381) mechanically gated channel activity(GO:0022833) |
0.1 | 0.2 | GO:0070883 | pre-miRNA binding(GO:0070883) |
0.1 | 0.7 | GO:0004579 | dolichyl-diphosphooligosaccharide-protein glycotransferase activity(GO:0004579) |
0.1 | 0.2 | GO:0019863 | IgE binding(GO:0019863) |
0.1 | 1.2 | GO:0005388 | calcium-transporting ATPase activity(GO:0005388) |
0.1 | 0.1 | GO:0031493 | nucleosomal histone binding(GO:0031493) |
0.1 | 0.1 | GO:0004741 | [pyruvate dehydrogenase (lipoamide)] phosphatase activity(GO:0004741) |
0.1 | 1.2 | GO:0050750 | low-density lipoprotein particle receptor binding(GO:0050750) |
0.1 | 0.7 | GO:0005041 | low-density lipoprotein receptor activity(GO:0005041) |
0.1 | 1.6 | GO:0070530 | K63-linked polyubiquitin binding(GO:0070530) |
0.1 | 2.2 | GO:0050136 | NADH dehydrogenase (ubiquinone) activity(GO:0008137) NADH dehydrogenase (quinone) activity(GO:0050136) |
0.1 | 1.0 | GO:0005337 | nucleoside transmembrane transporter activity(GO:0005337) |
0.1 | 1.4 | GO:0022841 | potassium ion leak channel activity(GO:0022841) |
0.1 | 0.6 | GO:0019855 | calcium channel inhibitor activity(GO:0019855) |
0.1 | 1.4 | GO:0008157 | protein phosphatase 1 binding(GO:0008157) |
0.1 | 5.4 | GO:0008135 | translation factor activity, RNA binding(GO:0008135) |
0.1 | 1.1 | GO:0001730 | 2'-5'-oligoadenylate synthetase activity(GO:0001730) |
0.1 | 0.1 | GO:0008603 | cAMP-dependent protein kinase regulator activity(GO:0008603) |
0.1 | 0.7 | GO:0017127 | cholesterol transporter activity(GO:0017127) |
0.1 | 0.3 | GO:0043199 | sulfate binding(GO:0043199) |
0.1 | 0.7 | GO:0004571 | mannosyl-oligosaccharide 1,2-alpha-mannosidase activity(GO:0004571) |
0.1 | 4.2 | GO:0003725 | double-stranded RNA binding(GO:0003725) |
0.1 | 0.8 | GO:0003727 | single-stranded RNA binding(GO:0003727) |
0.1 | 2.2 | GO:0051087 | chaperone binding(GO:0051087) |
0.1 | 0.3 | GO:0003987 | acetate-CoA ligase activity(GO:0003987) |
0.1 | 0.5 | GO:0004030 | aldehyde dehydrogenase [NAD(P)+] activity(GO:0004030) |
0.1 | 3.0 | GO:0005132 | type I interferon receptor binding(GO:0005132) |
0.1 | 0.3 | GO:0042609 | CD4 receptor binding(GO:0042609) |
0.1 | 1.6 | GO:0008483 | transaminase activity(GO:0008483) |
0.1 | 1.4 | GO:0001594 | trace-amine receptor activity(GO:0001594) |
0.1 | 0.3 | GO:0019862 | IgA binding(GO:0019862) |
0.1 | 0.2 | GO:0000104 | succinate dehydrogenase activity(GO:0000104) |
0.1 | 3.5 | GO:0004722 | protein serine/threonine phosphatase activity(GO:0004722) |
0.1 | 0.7 | GO:0005159 | insulin-like growth factor receptor binding(GO:0005159) |
0.1 | 0.3 | GO:0038132 | neuregulin binding(GO:0038132) |
0.1 | 1.9 | GO:0070063 | RNA polymerase binding(GO:0070063) |
0.1 | 0.4 | GO:0016151 | nickel cation binding(GO:0016151) |
0.1 | 0.4 | GO:0034235 | GPI anchor binding(GO:0034235) |
0.1 | 0.1 | GO:0008240 | tripeptidyl-peptidase activity(GO:0008240) |
0.1 | 1.5 | GO:0004198 | calcium-dependent cysteine-type endopeptidase activity(GO:0004198) |
0.1 | 0.6 | GO:0001054 | RNA polymerase I activity(GO:0001054) |
0.1 | 0.4 | GO:0015168 | glycerol transmembrane transporter activity(GO:0015168) glycerol channel activity(GO:0015254) |
0.1 | 0.3 | GO:0031686 | A1 adenosine receptor binding(GO:0031686) |
0.1 | 0.3 | GO:0015215 | nucleotide transmembrane transporter activity(GO:0015215) |
0.1 | 0.3 | GO:0001875 | lipopolysaccharide receptor activity(GO:0001875) |
0.1 | 0.3 | GO:0047751 | 3-oxo-5-alpha-steroid 4-dehydrogenase activity(GO:0003865) cholestenone 5-alpha-reductase activity(GO:0047751) |
0.1 | 0.3 | GO:0000268 | peroxisome targeting sequence binding(GO:0000268) |
0.1 | 0.3 | GO:0004634 | phosphopyruvate hydratase activity(GO:0004634) |
0.1 | 0.2 | GO:0004887 | thyroid hormone receptor activity(GO:0004887) |
0.1 | 0.3 | GO:0004301 | epoxide hydrolase activity(GO:0004301) |
0.1 | 0.4 | GO:0001013 | RNA polymerase I regulatory region DNA binding(GO:0001013) |
0.1 | 1.2 | GO:0016671 | oxidoreductase activity, acting on a sulfur group of donors, disulfide as acceptor(GO:0016671) |
0.1 | 0.7 | GO:0016929 | SUMO-specific protease activity(GO:0016929) |
0.1 | 0.2 | GO:0003696 | satellite DNA binding(GO:0003696) |
0.1 | 0.2 | GO:0051021 | GDP-dissociation inhibitor binding(GO:0051021) |
0.1 | 0.2 | GO:0002094 | polyprenyltransferase activity(GO:0002094) |
0.1 | 0.2 | GO:0043120 | tumor necrosis factor binding(GO:0043120) |
0.1 | 0.1 | GO:0034988 | Fc-gamma receptor I complex binding(GO:0034988) |
0.1 | 0.2 | GO:0071987 | WD40-repeat domain binding(GO:0071987) |
0.1 | 2.6 | GO:0044824 | integrase activity(GO:0008907) T/G mismatch-specific endonuclease activity(GO:0043765) retroviral integrase activity(GO:0044823) retroviral 3' processing activity(GO:0044824) |
0.1 | 1.9 | GO:1901476 | carbohydrate transmembrane transporter activity(GO:0015144) carbohydrate transporter activity(GO:1901476) |
0.1 | 0.2 | GO:0103116 | alpha-D-galactofuranose transporter activity(GO:0103116) |
0.1 | 0.8 | GO:0005172 | vascular endothelial growth factor receptor binding(GO:0005172) |
0.1 | 0.2 | GO:0002054 | nucleobase binding(GO:0002054) |
0.1 | 0.1 | GO:0005176 | ErbB-2 class receptor binding(GO:0005176) |
0.1 | 0.4 | GO:0005534 | galactose binding(GO:0005534) |
0.1 | 0.5 | GO:0004622 | lysophospholipase activity(GO:0004622) |
0.1 | 1.0 | GO:0016594 | glycine binding(GO:0016594) |
0.1 | 0.8 | GO:0016922 | ligand-dependent nuclear receptor binding(GO:0016922) |
0.1 | 0.8 | GO:0070577 | lysine-acetylated histone binding(GO:0070577) |
0.1 | 0.3 | GO:0004735 | pyrroline-5-carboxylate reductase activity(GO:0004735) |
0.1 | 0.4 | GO:0004908 | interleukin-1 receptor activity(GO:0004908) |
0.1 | 0.2 | GO:0004461 | lactose synthase activity(GO:0004461) |
0.1 | 0.1 | GO:0032452 | histone demethylase activity(GO:0032452) |
0.1 | 3.6 | GO:0051082 | unfolded protein binding(GO:0051082) |
0.1 | 0.2 | GO:0015440 | peptide-transporting ATPase activity(GO:0015440) |
0.1 | 0.2 | GO:0047192 | 1-alkylglycerophosphocholine O-acetyltransferase activity(GO:0047192) |
0.1 | 1.3 | GO:0004623 | phospholipase A2 activity(GO:0004623) |
0.1 | 0.3 | GO:0004966 | galanin receptor activity(GO:0004966) |
0.1 | 0.5 | GO:0051400 | BH domain binding(GO:0051400) |
0.1 | 0.3 | GO:0035174 | histone serine kinase activity(GO:0035174) |
0.1 | 0.6 | GO:0051010 | microtubule plus-end binding(GO:0051010) |
0.1 | 1.1 | GO:0031683 | G-protein beta/gamma-subunit complex binding(GO:0031683) |
0.1 | 0.4 | GO:0008190 | eukaryotic initiation factor 4E binding(GO:0008190) |
0.1 | 0.2 | GO:0070569 | uridylyltransferase activity(GO:0070569) |
0.1 | 0.6 | GO:0032183 | SUMO binding(GO:0032183) |
0.1 | 0.3 | GO:0070061 | fructose binding(GO:0070061) |
0.1 | 0.3 | GO:0032027 | myosin light chain binding(GO:0032027) |
0.1 | 0.4 | GO:0016176 | superoxide-generating NADPH oxidase activator activity(GO:0016176) |
0.1 | 0.2 | GO:0042030 | ATPase inhibitor activity(GO:0042030) |
0.1 | 0.1 | GO:0034979 | NAD-dependent protein deacetylase activity(GO:0034979) |
0.1 | 0.3 | GO:0004311 | farnesyltranstransferase activity(GO:0004311) |
0.1 | 0.1 | GO:0005146 | leukemia inhibitory factor receptor binding(GO:0005146) |
0.1 | 0.3 | GO:0030515 | snoRNA binding(GO:0030515) |
0.1 | 0.4 | GO:0005166 | neurotrophin p75 receptor binding(GO:0005166) |
0.1 | 0.5 | GO:0010857 | calcium-dependent protein serine/threonine kinase activity(GO:0009931) calcium-dependent protein kinase activity(GO:0010857) |
0.1 | 0.3 | GO:0052723 | inositol hexakisphosphate kinase activity(GO:0000828) inositol hexakisphosphate 5-kinase activity(GO:0000832) inositol hexakisphosphate 1-kinase activity(GO:0052723) inositol hexakisphosphate 3-kinase activity(GO:0052724) |
0.1 | 0.7 | GO:0004535 | poly(A)-specific ribonuclease activity(GO:0004535) |
0.1 | 6.2 | GO:0000287 | magnesium ion binding(GO:0000287) |
0.1 | 0.5 | GO:0005315 | inorganic phosphate transmembrane transporter activity(GO:0005315) |
0.1 | 1.2 | GO:0048487 | beta-tubulin binding(GO:0048487) |
0.1 | 1.0 | GO:0043531 | ADP binding(GO:0043531) |
0.1 | 1.5 | GO:0015485 | cholesterol binding(GO:0015485) |
0.1 | 6.8 | GO:0003924 | GTPase activity(GO:0003924) |
0.1 | 0.4 | GO:0005225 | volume-sensitive anion channel activity(GO:0005225) |
0.1 | 0.2 | GO:0016520 | growth hormone-releasing hormone receptor activity(GO:0016520) |
0.1 | 0.3 | GO:0004060 | arylamine N-acetyltransferase activity(GO:0004060) |
0.1 | 1.6 | GO:0008536 | Ran GTPase binding(GO:0008536) |
0.1 | 3.0 | GO:0004004 | RNA helicase activity(GO:0003724) ATP-dependent RNA helicase activity(GO:0004004) RNA-dependent ATPase activity(GO:0008186) |
0.1 | 0.4 | GO:0070891 | lipoteichoic acid binding(GO:0070891) |
0.1 | 0.6 | GO:0004568 | chitinase activity(GO:0004568) |
0.1 | 0.1 | GO:0031014 | troponin T binding(GO:0031014) |
0.1 | 1.1 | GO:0005229 | intracellular calcium activated chloride channel activity(GO:0005229) |
0.1 | 0.8 | GO:0016290 | palmitoyl-CoA hydrolase activity(GO:0016290) |
0.1 | 0.6 | GO:0016538 | cyclin-dependent protein serine/threonine kinase regulator activity(GO:0016538) |
0.1 | 0.3 | GO:0019958 | C-X-C chemokine binding(GO:0019958) |
0.1 | 0.4 | GO:0050733 | RS domain binding(GO:0050733) |
0.1 | 0.1 | GO:0061676 | importin-alpha family protein binding(GO:0061676) |
0.1 | 0.5 | GO:0035497 | cAMP response element binding(GO:0035497) |
0.1 | 0.2 | GO:0002046 | opsin binding(GO:0002046) |
0.1 | 0.3 | GO:0097153 | cysteine-type endopeptidase activity involved in apoptotic process(GO:0097153) |
0.1 | 0.4 | GO:0050072 | m7G(5')pppN diphosphatase activity(GO:0050072) |
0.1 | 0.2 | GO:0038100 | nodal binding(GO:0038100) |
0.1 | 0.5 | GO:0000049 | tRNA binding(GO:0000049) |
0.1 | 0.3 | GO:0036122 | BMP binding(GO:0036122) |
0.1 | 0.3 | GO:0042910 | xenobiotic transporter activity(GO:0042910) |
0.1 | 0.5 | GO:0004767 | sphingomyelin phosphodiesterase activity(GO:0004767) |
0.1 | 0.3 | GO:0015193 | L-proline transmembrane transporter activity(GO:0015193) |
0.1 | 0.5 | GO:0034987 | immunoglobulin receptor binding(GO:0034987) |
0.1 | 0.7 | GO:0015279 | store-operated calcium channel activity(GO:0015279) |
0.1 | 43.5 | GO:0044822 | poly(A) RNA binding(GO:0044822) |
0.1 | 0.1 | GO:0008905 | mannose-phosphate guanylyltransferase activity(GO:0008905) |
0.1 | 1.3 | GO:0030507 | spectrin binding(GO:0030507) |
0.1 | 0.1 | GO:0031996 | thioesterase binding(GO:0031996) |
0.1 | 0.3 | GO:0005391 | sodium:potassium-exchanging ATPase activity(GO:0005391) |
0.1 | 0.2 | GO:0015232 | heme transporter activity(GO:0015232) |
0.1 | 0.3 | GO:0016813 | hydrolase activity, acting on carbon-nitrogen (but not peptide) bonds, in linear amidines(GO:0016813) |
0.1 | 0.1 | GO:0051575 | 5'-deoxyribose-5-phosphate lyase activity(GO:0051575) |
0.1 | 1.5 | GO:0019707 | protein-cysteine S-acyltransferase activity(GO:0019707) |
0.1 | 5.4 | GO:0003735 | structural constituent of ribosome(GO:0003735) |
0.1 | 0.9 | GO:0016755 | transferase activity, transferring amino-acyl groups(GO:0016755) |
0.1 | 3.2 | GO:0002020 | protease binding(GO:0002020) |
0.1 | 0.2 | GO:0004430 | 1-phosphatidylinositol 4-kinase activity(GO:0004430) |
0.1 | 0.1 | GO:0034452 | dynactin binding(GO:0034452) |
0.1 | 0.1 | GO:0051430 | corticotropin-releasing hormone receptor 1 binding(GO:0051430) |
0.1 | 0.4 | GO:0015266 | protein channel activity(GO:0015266) |
0.1 | 0.4 | GO:0010181 | FMN binding(GO:0010181) |
0.1 | 0.1 | GO:1990226 | histone methyltransferase binding(GO:1990226) |
0.1 | 1.7 | GO:0016651 | oxidoreductase activity, acting on NAD(P)H(GO:0016651) |
0.1 | 6.8 | GO:0005096 | GTPase activator activity(GO:0005096) |
0.1 | 0.1 | GO:0016880 | acid-ammonia (or amide) ligase activity(GO:0016880) |
0.1 | 0.3 | GO:0005499 | vitamin D binding(GO:0005499) |
0.1 | 0.2 | GO:0008332 | low voltage-gated calcium channel activity(GO:0008332) |
0.1 | 0.6 | GO:0070273 | phosphatidylinositol-4-phosphate binding(GO:0070273) |
0.1 | 0.3 | GO:0016868 | intramolecular transferase activity, phosphotransferases(GO:0016868) |
0.0 | 0.5 | GO:0043539 | protein serine/threonine kinase activator activity(GO:0043539) |
0.0 | 0.0 | GO:0016414 | O-octanoyltransferase activity(GO:0016414) |
0.0 | 0.1 | GO:0019166 | trans-2-enoyl-CoA reductase (NADPH) activity(GO:0019166) |
0.0 | 0.2 | GO:0043522 | leucine zipper domain binding(GO:0043522) |
0.0 | 0.0 | GO:0019788 | NEDD8 transferase activity(GO:0019788) |
0.0 | 0.9 | GO:0070491 | repressing transcription factor binding(GO:0070491) |
0.0 | 0.0 | GO:0042296 | ISG15 transferase activity(GO:0042296) |
0.0 | 0.1 | GO:0031433 | telethonin binding(GO:0031433) |
0.0 | 0.8 | GO:0030552 | cAMP binding(GO:0030552) |
0.0 | 0.6 | GO:0016790 | thiolester hydrolase activity(GO:0016790) |
0.0 | 0.1 | GO:0015375 | glycine:sodium symporter activity(GO:0015375) |
0.0 | 0.6 | GO:0005031 | tumor necrosis factor-activated receptor activity(GO:0005031) death receptor activity(GO:0005035) |
0.0 | 0.3 | GO:0008568 | microtubule-severing ATPase activity(GO:0008568) |
0.0 | 0.2 | GO:0032794 | GTPase activating protein binding(GO:0032794) |
0.0 | 0.0 | GO:0031726 | CCR1 chemokine receptor binding(GO:0031726) |
0.0 | 0.0 | GO:0019002 | GMP binding(GO:0019002) |
0.0 | 0.2 | GO:0008429 | phosphatidylethanolamine binding(GO:0008429) |
0.0 | 0.1 | GO:0070034 | telomerase RNA binding(GO:0070034) |
0.0 | 0.1 | GO:0031685 | adenosine receptor binding(GO:0031685) |
0.0 | 0.2 | GO:0004726 | non-membrane spanning protein tyrosine phosphatase activity(GO:0004726) |
0.0 | 0.4 | GO:0015662 | ATPase activity, coupled to transmembrane movement of ions, phosphorylative mechanism(GO:0015662) |
0.0 | 0.6 | GO:0051059 | NF-kappaB binding(GO:0051059) |
0.0 | 0.6 | GO:0015106 | bicarbonate transmembrane transporter activity(GO:0015106) |
0.0 | 0.1 | GO:0004949 | cannabinoid receptor activity(GO:0004949) |
0.0 | 0.2 | GO:0050649 | testosterone 6-beta-hydroxylase activity(GO:0050649) |
0.0 | 0.4 | GO:0030742 | GTP-dependent protein binding(GO:0030742) |
0.0 | 4.0 | GO:0003714 | transcription corepressor activity(GO:0003714) |
0.0 | 0.0 | GO:0000217 | DNA secondary structure binding(GO:0000217) |
0.0 | 0.0 | GO:0034618 | arginine binding(GO:0034618) |
0.0 | 0.3 | GO:0031559 | oxidosqualene cyclase activity(GO:0031559) |
0.0 | 0.4 | GO:0004499 | N,N-dimethylaniline monooxygenase activity(GO:0004499) |
0.0 | 0.1 | GO:0032405 | MutLalpha complex binding(GO:0032405) |
0.0 | 0.3 | GO:0008545 | JUN kinase kinase activity(GO:0008545) |
0.0 | 0.2 | GO:0031489 | myosin V binding(GO:0031489) |
0.0 | 0.1 | GO:0003831 | beta-N-acetylglucosaminylglycopeptide beta-1,4-galactosyltransferase activity(GO:0003831) |
0.0 | 0.4 | GO:0051019 | mitogen-activated protein kinase binding(GO:0051019) |
0.0 | 6.7 | GO:0004252 | serine-type endopeptidase activity(GO:0004252) |
0.0 | 0.9 | GO:0070003 | threonine-type endopeptidase activity(GO:0004298) threonine-type peptidase activity(GO:0070003) |
0.0 | 0.5 | GO:0004709 | MAP kinase kinase kinase activity(GO:0004709) |
0.0 | 0.6 | GO:0017022 | myosin binding(GO:0017022) |
0.0 | 1.4 | GO:0016765 | transferase activity, transferring alkyl or aryl (other than methyl) groups(GO:0016765) |
0.0 | 0.1 | GO:0004591 | oxoglutarate dehydrogenase (succinyl-transferring) activity(GO:0004591) |
0.0 | 0.4 | GO:0043864 | protein-N-terminal asparagine amidohydrolase activity(GO:0008418) UDP-3-O-[3-hydroxymyristoyl] N-acetylglucosamine deacetylase activity(GO:0008759) iprodione amidohydrolase activity(GO:0018748) (3,5-dichlorophenylurea)acetate amidohydrolase activity(GO:0018749) 4'-(2-hydroxyisopropyl)phenylurea amidohydrolase activity(GO:0034571) didemethylisoproturon amidohydrolase activity(GO:0034573) N-isopropylacetanilide amidohydrolase activity(GO:0034576) N-cyclohexylformamide amidohydrolase activity(GO:0034781) isonicotinic acid hydrazide hydrolase activity(GO:0034876) cis-aconitamide amidase activity(GO:0034882) gamma-N-formylaminovinylacetate hydrolase activity(GO:0034885) N2-acetyl-L-lysine deacetylase activity(GO:0043747) O-succinylbenzoate synthase activity(GO:0043748) indoleacetamide hydrolase activity(GO:0043864) N-acetylcitrulline deacetylase activity(GO:0043909) N-acetylgalactosamine-6-phosphate deacetylase activity(GO:0047419) diacetylchitobiose deacetylase activity(GO:0052773) chitooligosaccharide deacetylase activity(GO:0052790) |
0.0 | 0.3 | GO:0051879 | Hsp90 protein binding(GO:0051879) |
0.0 | 0.2 | GO:0016454 | C-palmitoyltransferase activity(GO:0016454) |
0.0 | 0.3 | GO:0005247 | voltage-gated chloride channel activity(GO:0005247) |
0.0 | 0.1 | GO:0001016 | RNA polymerase III regulatory region DNA binding(GO:0001016) RNA polymerase III type 1 promoter DNA binding(GO:0001030) RNA polymerase III type 2 promoter DNA binding(GO:0001031) RNA polymerase III type 3 promoter DNA binding(GO:0001032) 5S rDNA binding(GO:0080084) |
0.0 | 0.0 | GO:0008139 | nuclear localization sequence binding(GO:0008139) |
0.0 | 2.2 | GO:0000149 | SNARE binding(GO:0000149) |
0.0 | 0.1 | GO:0004582 | dolichyl-phosphate beta-D-mannosyltransferase activity(GO:0004582) |
0.0 | 4.1 | GO:0008234 | cysteine-type peptidase activity(GO:0008234) |
0.0 | 0.1 | GO:0008853 | exodeoxyribonuclease III activity(GO:0008853) |
0.0 | 0.2 | GO:0004994 | somatostatin receptor activity(GO:0004994) |
0.0 | 0.4 | GO:0008195 | phosphatidate phosphatase activity(GO:0008195) |
0.0 | 0.1 | GO:0008410 | CoA-transferase activity(GO:0008410) |
0.0 | 0.1 | GO:0042284 | sphingolipid delta-4 desaturase activity(GO:0042284) |
0.0 | 0.3 | GO:0042974 | retinoic acid receptor binding(GO:0042974) |
0.0 | 0.7 | GO:0005212 | structural constituent of eye lens(GO:0005212) |
0.0 | 0.3 | GO:0070064 | proline-rich region binding(GO:0070064) |
0.0 | 0.0 | GO:0004942 | anaphylatoxin receptor activity(GO:0004942) |
0.0 | 0.5 | GO:0043015 | gamma-tubulin binding(GO:0043015) |
0.0 | 0.5 | GO:0019239 | deaminase activity(GO:0019239) |
0.0 | 0.4 | GO:0001618 | virus receptor activity(GO:0001618) |
0.0 | 0.2 | GO:0031995 | insulin-like growth factor II binding(GO:0031995) |
0.0 | 0.0 | GO:0015189 | arginine transmembrane transporter activity(GO:0015181) L-lysine transmembrane transporter activity(GO:0015189) |
0.0 | 0.2 | GO:0005000 | vasopressin receptor activity(GO:0005000) |
0.0 | 0.5 | GO:0003887 | DNA-directed DNA polymerase activity(GO:0003887) |
0.0 | 0.2 | GO:0010853 | cyclase activator activity(GO:0010853) guanylate cyclase activator activity(GO:0030250) |
0.0 | 0.3 | GO:0004550 | nucleoside diphosphate kinase activity(GO:0004550) |
0.0 | 0.1 | GO:0004920 | interleukin-10 receptor activity(GO:0004920) |
0.0 | 0.1 | GO:0000293 | ferric-chelate reductase activity(GO:0000293) |
0.0 | 0.3 | GO:0043022 | ribosome binding(GO:0043022) |
0.0 | 0.3 | GO:0047555 | 3',5'-cyclic-GMP phosphodiesterase activity(GO:0047555) |
0.0 | 0.7 | GO:0003684 | damaged DNA binding(GO:0003684) |
0.0 | 0.1 | GO:0000171 | ribonuclease MRP activity(GO:0000171) |
0.0 | 0.7 | GO:0005154 | epidermal growth factor receptor binding(GO:0005154) |
0.0 | 0.2 | GO:0030368 | interleukin-17 receptor activity(GO:0030368) |
0.0 | 0.1 | GO:0016215 | acyl-CoA desaturase activity(GO:0016215) |
0.0 | 1.1 | GO:0043130 | ubiquitin binding(GO:0043130) |
0.0 | 0.1 | GO:0051870 | methotrexate binding(GO:0051870) |
0.0 | 0.3 | GO:0043425 | bHLH transcription factor binding(GO:0043425) |
0.0 | 0.9 | GO:0050840 | extracellular matrix binding(GO:0050840) |
0.0 | 0.0 | GO:0070181 | small ribosomal subunit rRNA binding(GO:0070181) |
0.0 | 0.1 | GO:0008175 | tRNA methyltransferase activity(GO:0008175) |
0.0 | 0.0 | GO:0004694 | eukaryotic translation initiation factor 2alpha kinase activity(GO:0004694) |
0.0 | 0.3 | GO:0016713 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, reduced iron-sulfur protein as one donor, and incorporation of one atom of oxygen(GO:0016713) |
0.0 | 0.1 | GO:0008273 | calcium, potassium:sodium antiporter activity(GO:0008273) |
0.0 | 0.3 | GO:0003854 | 3-beta-hydroxy-delta5-steroid dehydrogenase activity(GO:0003854) |
0.0 | 0.5 | GO:0005044 | scavenger receptor activity(GO:0005044) |
0.0 | 0.8 | GO:0043492 | ATPase activity, coupled to movement of substances(GO:0043492) |
0.0 | 0.2 | GO:0050656 | 3'-phosphoadenosine 5'-phosphosulfate binding(GO:0050656) |
0.0 | 1.1 | GO:0008565 | protein transporter activity(GO:0008565) |
0.0 | 0.2 | GO:0003796 | lysozyme activity(GO:0003796) |
0.0 | 0.1 | GO:0001075 | transcription factor activity, RNA polymerase II core promoter sequence-specific binding involved in preinitiation complex assembly(GO:0001075) |
0.0 | 2.2 | GO:0008757 | S-adenosylmethionine-dependent methyltransferase activity(GO:0008757) |
0.0 | 0.1 | GO:0052795 | exo-alpha-sialidase activity(GO:0004308) alpha-sialidase activity(GO:0016997) exo-alpha-(2->3)-sialidase activity(GO:0052794) exo-alpha-(2->6)-sialidase activity(GO:0052795) exo-alpha-(2->8)-sialidase activity(GO:0052796) |
0.0 | 0.1 | GO:0008454 | alpha-1,3-mannosylglycoprotein 4-beta-N-acetylglucosaminyltransferase activity(GO:0008454) |
0.0 | 0.1 | GO:0005432 | calcium:sodium antiporter activity(GO:0005432) calcium:cation antiporter activity(GO:0015368) |
0.0 | 0.0 | GO:0005220 | inositol 1,4,5-trisphosphate-sensitive calcium-release channel activity(GO:0005220) |
0.0 | 0.2 | GO:0033691 | sialic acid binding(GO:0033691) |
0.0 | 0.0 | GO:0004035 | alkaline phosphatase activity(GO:0004035) |
0.0 | 0.0 | GO:0051185 | coenzyme transporter activity(GO:0051185) |
0.0 | 0.1 | GO:0008408 | 3'-5' exonuclease activity(GO:0008408) |
0.0 | 0.1 | GO:0070628 | proteasome binding(GO:0070628) |
0.0 | 0.2 | GO:0042171 | lysophosphatidic acid acyltransferase activity(GO:0042171) |
0.0 | 0.1 | GO:0015226 | amino-acid betaine transmembrane transporter activity(GO:0015199) carnitine transmembrane transporter activity(GO:0015226) |
0.0 | 0.0 | GO:0047045 | testosterone 17-beta-dehydrogenase (NADP+) activity(GO:0047045) |
0.0 | 0.0 | GO:0032557 | pyrimidine ribonucleotide binding(GO:0032557) |
0.0 | 0.3 | GO:0045236 | CXCR chemokine receptor binding(GO:0045236) |
0.0 | 0.1 | GO:0038024 | cargo receptor activity(GO:0038024) |
0.0 | 0.1 | GO:0005542 | folic acid binding(GO:0005542) |
0.0 | 0.1 | GO:0005384 | manganese ion transmembrane transporter activity(GO:0005384) |
0.0 | 0.0 | GO:0008097 | 5S rRNA binding(GO:0008097) |
0.0 | 0.0 | GO:0031750 | D3 dopamine receptor binding(GO:0031750) |
0.0 | 0.2 | GO:0008191 | metalloendopeptidase inhibitor activity(GO:0008191) |
0.0 | 0.5 | GO:0042605 | peptide antigen binding(GO:0042605) |
0.0 | 0.3 | GO:0005003 | ephrin receptor activity(GO:0005003) |
0.0 | 0.1 | GO:0004052 | arachidonate 12-lipoxygenase activity(GO:0004052) |
0.0 | 1.2 | GO:0019887 | protein kinase regulator activity(GO:0019887) |
0.0 | 0.3 | GO:0004003 | ATP-dependent DNA helicase activity(GO:0004003) |
0.0 | 2.1 | GO:0005525 | GTP binding(GO:0005525) |
0.0 | 0.3 | GO:0042813 | Wnt-activated receptor activity(GO:0042813) |
0.0 | 0.0 | GO:1901611 | phosphatidylglycerol binding(GO:1901611) |
0.0 | 0.1 | GO:0016783 | sulfurtransferase activity(GO:0016783) |
0.0 | 0.1 | GO:0017176 | phosphatidylinositol N-acetylglucosaminyltransferase activity(GO:0017176) |
0.0 | 0.0 | GO:0061133 | endopeptidase activator activity(GO:0061133) |
0.0 | 0.5 | GO:0052768 | prenylcysteine methylesterase activity(GO:0010296) 1-oxa-2-oxocycloheptane lactonase activity(GO:0018731) sulfolactone hydrolase activity(GO:0018732) 3,4-dihydrocoumarin hydrolase activity(GO:0018733) butyrolactone hydrolase activity(GO:0018734) endosulfan lactone lactonase activity(GO:0034892) L-ascorbate 6-phosphate lactonase activity(GO:0035460) Ser-tRNA(Thr) hydrolase activity(GO:0043905) Ala-tRNA(Pro) hydrolase activity(GO:0043906) Cys-tRNA(Pro) hydrolase activity(GO:0043907) Ser(Gly)-tRNA(Ala) hydrolase activity(GO:0043908) all-trans-retinyl-palmitate hydrolase, all-trans-retinol forming activity(GO:0047376) retinyl-palmitate esterase activity(GO:0050253) mannosyl-oligosaccharide 1,6-alpha-mannosidase activity(GO:0052767) mannosyl-oligosaccharide 1,3-alpha-mannosidase activity(GO:0052768) methyl indole-3-acetate esterase activity(GO:0080030) methyl salicylate esterase activity(GO:0080031) methyl jasmonate esterase activity(GO:0080032) |
0.0 | 0.1 | GO:0008349 | MAP kinase kinase kinase kinase activity(GO:0008349) |
0.0 | 0.1 | GO:0043138 | 3'-5' DNA helicase activity(GO:0043138) |
0.0 | 0.0 | GO:0030371 | translation repressor activity(GO:0030371) |
0.0 | 0.0 | GO:0003916 | DNA topoisomerase activity(GO:0003916) |
0.0 | 0.2 | GO:0003785 | actin monomer binding(GO:0003785) |
0.0 | 0.3 | GO:0032813 | tumor necrosis factor receptor superfamily binding(GO:0032813) |
0.0 | 0.0 | GO:0015252 | hydrogen ion channel activity(GO:0015252) |
0.0 | 0.2 | GO:0005149 | interleukin-1 receptor binding(GO:0005149) |
0.0 | 0.0 | GO:0019107 | myristoyltransferase activity(GO:0019107) |
0.0 | 0.1 | GO:0004165 | dodecenoyl-CoA delta-isomerase activity(GO:0004165) |
0.0 | 0.0 | GO:0016899 | oxidoreductase activity, acting on the CH-OH group of donors, oxygen as acceptor(GO:0016899) |
0.0 | 0.1 | GO:0016308 | 1-phosphatidylinositol-4-phosphate 5-kinase activity(GO:0016308) |
0.0 | 0.0 | GO:0016015 | morphogen activity(GO:0016015) |
0.0 | 0.0 | GO:0030345 | extracellular matrix structural constituent conferring compression resistance(GO:0030021) structural constituent of tooth enamel(GO:0030345) |
0.0 | 0.0 | GO:0044183 | protein binding involved in protein folding(GO:0044183) |
0.0 | 0.5 | GO:0005319 | lipid transporter activity(GO:0005319) |
0.0 | 0.0 | GO:0016866 | intramolecular transferase activity(GO:0016866) |
0.0 | 0.2 | GO:0004089 | carbonate dehydratase activity(GO:0004089) |
0.0 | 0.0 | GO:0004514 | nicotinate-nucleotide diphosphorylase (carboxylating) activity(GO:0004514) |
0.0 | 0.4 | GO:0008395 | steroid hydroxylase activity(GO:0008395) |
0.0 | 0.0 | GO:0016888 | endodeoxyribonuclease activity, producing 5'-phosphomonoesters(GO:0016888) |
0.0 | 0.2 | GO:0051537 | 2 iron, 2 sulfur cluster binding(GO:0051537) |
0.0 | 0.0 | GO:0016778 | diphosphotransferase activity(GO:0016778) |
0.0 | 0.0 | GO:0045182 | translation regulator activity(GO:0045182) |
0.0 | 0.0 | GO:0030628 | pre-mRNA 3'-splice site binding(GO:0030628) |
0.0 | 0.0 | GO:0032407 | MutSalpha complex binding(GO:0032407) |
0.0 | 0.0 | GO:0016812 | hydrolase activity, acting on carbon-nitrogen (but not peptide) bonds, in cyclic amides(GO:0016812) |
0.0 | 0.1 | GO:0019865 | immunoglobulin binding(GO:0019865) |
0.0 | 0.1 | GO:0017099 | long-chain-acyl-CoA dehydrogenase activity(GO:0004466) very-long-chain-acyl-CoA dehydrogenase activity(GO:0017099) |
0.0 | 0.0 | GO:0042979 | ornithine decarboxylase regulator activity(GO:0042979) |
0.0 | 0.1 | GO:0016907 | G-protein coupled acetylcholine receptor activity(GO:0016907) |
0.0 | 0.0 | GO:0004075 | biotin carboxylase activity(GO:0004075) |
0.0 | 0.0 | GO:0001515 | opioid peptide activity(GO:0001515) |
0.0 | 0.0 | GO:0016744 | transferase activity, transferring aldehyde or ketonic groups(GO:0016744) |
0.0 | 0.1 | GO:0031849 | olfactory receptor binding(GO:0031849) |
0.0 | 0.0 | GO:0070698 | type I activin receptor binding(GO:0070698) |
0.0 | 0.0 | GO:0008061 | chitin binding(GO:0008061) |
0.0 | 0.0 | GO:0008599 | protein phosphatase type 1 regulator activity(GO:0008599) |
0.0 | 0.0 | GO:0015321 | sodium-dependent phosphate transmembrane transporter activity(GO:0015321) |
0.0 | 0.4 | GO:0008527 | taste receptor activity(GO:0008527) |
0.0 | 0.0 | GO:0031694 | alpha-2A adrenergic receptor binding(GO:0031694) |
0.0 | 0.1 | GO:0030247 | pattern binding(GO:0001871) polysaccharide binding(GO:0030247) |
0.0 | 0.0 | GO:0016814 | hydrolase activity, acting on carbon-nitrogen (but not peptide) bonds, in cyclic amidines(GO:0016814) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.5 | 13.9 | PID IL3 PATHWAY | IL3-mediated signaling events |
0.5 | 6.7 | PID LPA4 PATHWAY | LPA4-mediated signaling events |
0.5 | 12.3 | PID IL2 PI3K PATHWAY | IL2 signaling events mediated by PI3K |
0.4 | 7.3 | PID SMAD2 3PATHWAY | Regulation of cytoplasmic and nuclear SMAD2/3 signaling |
0.4 | 6.5 | SA CASPASE CASCADE | Apoptosis is mediated by caspases, cysteine proteases arranged in a proteolytic cascade. |
0.4 | 0.4 | PID ARF6 DOWNSTREAM PATHWAY | Arf6 downstream pathway |
0.4 | 20.5 | PID AR PATHWAY | Coregulation of Androgen receptor activity |
0.4 | 11.4 | PID ANGIOPOIETIN RECEPTOR PATHWAY | Angiopoietin receptor Tie2-mediated signaling |
0.4 | 5.4 | PID LYMPH ANGIOGENESIS PATHWAY | VEGFR3 signaling in lymphatic endothelium |
0.3 | 1.4 | ST INTEGRIN SIGNALING PATHWAY | Integrin Signaling Pathway |
0.3 | 4.9 | PID ARF 3PATHWAY | Arf1 pathway |
0.3 | 1.7 | PID IL8 CXCR2 PATHWAY | IL8- and CXCR2-mediated signaling events |
0.3 | 4.2 | PID FAS PATHWAY | FAS (CD95) signaling pathway |
0.3 | 6.5 | PID IL8 CXCR1 PATHWAY | IL8- and CXCR1-mediated signaling events |
0.3 | 2.4 | PID TCR RAS PATHWAY | Ras signaling in the CD4+ TCR pathway |
0.2 | 1.5 | PID P38 GAMMA DELTA PATHWAY | Signaling mediated by p38-gamma and p38-delta |
0.2 | 4.4 | PID MYC PATHWAY | C-MYC pathway |
0.2 | 3.3 | PID P38 MK2 PATHWAY | p38 signaling mediated by MAPKAP kinases |
0.2 | 1.9 | ST INTERLEUKIN 4 PATHWAY | Interleukin 4 (IL-4) Pathway |
0.2 | 0.5 | ST GAQ PATHWAY | G alpha q Pathway |
0.2 | 8.3 | PID AR TF PATHWAY | Regulation of Androgen receptor activity |
0.2 | 8.9 | PID PLK1 PATHWAY | PLK1 signaling events |
0.2 | 7.0 | PID LKB1 PATHWAY | LKB1 signaling events |
0.2 | 7.1 | PID FOXO PATHWAY | FoxO family signaling |
0.2 | 5.5 | PID IL6 7 PATHWAY | IL6-mediated signaling events |
0.2 | 2.8 | PID INSULIN GLUCOSE PATHWAY | Insulin-mediated glucose transport |
0.2 | 8.2 | PID INTEGRIN3 PATHWAY | Beta3 integrin cell surface interactions |
0.2 | 1.9 | PID TCPTP PATHWAY | Signaling events mediated by TCPTP |
0.2 | 4.0 | PID IL1 PATHWAY | IL1-mediated signaling events |
0.2 | 2.7 | PID SYNDECAN 2 PATHWAY | Syndecan-2-mediated signaling events |
0.2 | 3.7 | PID ATR PATHWAY | ATR signaling pathway |
0.2 | 4.0 | PID RHOA PATHWAY | RhoA signaling pathway |
0.2 | 15.6 | PID P53 DOWNSTREAM PATHWAY | Direct p53 effectors |
0.2 | 1.7 | PID NFKAPPAB CANONICAL PATHWAY | Canonical NF-kappaB pathway |
0.2 | 1.8 | ST G ALPHA S PATHWAY | G alpha s Pathway |
0.2 | 2.5 | PID CERAMIDE PATHWAY | Ceramide signaling pathway |
0.2 | 1.9 | PID PRL SIGNALING EVENTS PATHWAY | Signaling events mediated by PRL |
0.2 | 3.4 | PID ATM PATHWAY | ATM pathway |
0.2 | 3.6 | PID HIF2PATHWAY | HIF-2-alpha transcription factor network |
0.2 | 0.8 | PID AMB2 NEUTROPHILS PATHWAY | amb2 Integrin signaling |
0.2 | 1.2 | ST TUMOR NECROSIS FACTOR PATHWAY | Tumor Necrosis Factor Pathway. |
0.2 | 0.6 | PID BARD1 PATHWAY | BARD1 signaling events |
0.1 | 6.7 | PID HDAC CLASSI PATHWAY | Signaling events mediated by HDAC Class I |
0.1 | 1.5 | PID CIRCADIAN PATHWAY | Circadian rhythm pathway |
0.1 | 1.2 | PID IL2 1PATHWAY | IL2-mediated signaling events |
0.1 | 4.6 | PID HIF1 TFPATHWAY | HIF-1-alpha transcription factor network |
0.1 | 1.6 | PID IFNG PATHWAY | IFN-gamma pathway |
0.1 | 2.4 | PID FANCONI PATHWAY | Fanconi anemia pathway |
0.1 | 3.4 | PID DELTA NP63 PATHWAY | Validated transcriptional targets of deltaNp63 isoforms |
0.1 | 3.6 | PID REG GR PATHWAY | Glucocorticoid receptor regulatory network |
0.1 | 1.7 | PID AURORA A PATHWAY | Aurora A signaling |
0.1 | 0.7 | PID GLYPICAN 1PATHWAY | Glypican 1 network |
0.1 | 0.1 | SA FAS SIGNALING | The TNF-type receptor Fas induces apoptosis on ligand binding. |
0.1 | 0.2 | PID AR NONGENOMIC PATHWAY | Nongenotropic Androgen signaling |
0.1 | 0.9 | PID RETINOIC ACID PATHWAY | Retinoic acid receptors-mediated signaling |
0.1 | 1.3 | PID INSULIN PATHWAY | Insulin Pathway |
0.1 | 0.4 | PID HIF1A PATHWAY | Hypoxic and oxygen homeostasis regulation of HIF-1-alpha |
0.1 | 2.5 | PID TGFBR PATHWAY | TGF-beta receptor signaling |
0.1 | 2.4 | PID MTOR 4PATHWAY | mTOR signaling pathway |
0.1 | 1.4 | ST WNT CA2 CYCLIC GMP PATHWAY | Wnt/Ca2+/cyclic GMP signaling. |
0.1 | 2.2 | PID ILK PATHWAY | Integrin-linked kinase signaling |
0.1 | 0.3 | ST DIFFERENTIATION PATHWAY IN PC12 CELLS | Differentiation Pathway in PC12 Cells; this is a specific case of PAC1 Receptor Pathway. |
0.1 | 2.3 | PID BCR 5PATHWAY | BCR signaling pathway |
0.1 | 1.8 | PID CONE PATHWAY | Visual signal transduction: Cones |
0.1 | 1.0 | PID MET PATHWAY | Signaling events mediated by Hepatocyte Growth Factor Receptor (c-Met) |
0.1 | 3.1 | PID ERA GENOMIC PATHWAY | Validated nuclear estrogen receptor alpha network |
0.1 | 1.5 | PID TOLL ENDOGENOUS PATHWAY | Endogenous TLR signaling |
0.1 | 3.5 | PID MYC ACTIV PATHWAY | Validated targets of C-MYC transcriptional activation |
0.1 | 0.8 | PID EPHRINB REV PATHWAY | Ephrin B reverse signaling |
0.1 | 1.4 | PID FCER1 PATHWAY | Fc-epsilon receptor I signaling in mast cells |
0.1 | 1.1 | PID INTEGRIN2 PATHWAY | Beta2 integrin cell surface interactions |
0.1 | 0.8 | PID P38 MKK3 6PATHWAY | p38 MAPK signaling pathway |
0.1 | 1.9 | PID E2F PATHWAY | E2F transcription factor network |
0.1 | 1.1 | PID P53 REGULATION PATHWAY | p53 pathway |
0.1 | 0.7 | PID RXR VDR PATHWAY | RXR and RAR heterodimerization with other nuclear receptor |
0.1 | 0.3 | PID AVB3 INTEGRIN PATHWAY | Integrins in angiogenesis |
0.1 | 0.1 | SIG BCR SIGNALING PATHWAY | Members of the BCR signaling pathway |
0.1 | 0.7 | PID SYNDECAN 4 PATHWAY | Syndecan-4-mediated signaling events |
0.1 | 1.2 | PID ECADHERIN STABILIZATION PATHWAY | Stabilization and expansion of the E-cadherin adherens junction |
0.1 | 0.1 | PID P38 ALPHA BETA PATHWAY | Regulation of p38-alpha and p38-beta |
0.1 | 1.4 | PID P73PATHWAY | p73 transcription factor network |
0.1 | 1.2 | PID CASPASE PATHWAY | Caspase cascade in apoptosis |
0.1 | 0.6 | PID PI3KCI PATHWAY | Class I PI3K signaling events |
0.1 | 2.2 | PID CMYB PATHWAY | C-MYB transcription factor network |
0.1 | 0.9 | PID HEDGEHOG GLI PATHWAY | Hedgehog signaling events mediated by Gli proteins |
0.1 | 0.1 | PID HIV NEF PATHWAY | HIV-1 Nef: Negative effector of Fas and TNF-alpha |
0.1 | 0.8 | PID TELOMERASE PATHWAY | Regulation of Telomerase |
0.1 | 0.2 | PID NEPHRIN NEPH1 PATHWAY | Nephrin/Neph1 signaling in the kidney podocyte |
0.0 | 0.5 | PID FRA PATHWAY | Validated transcriptional targets of AP1 family members Fra1 and Fra2 |
0.0 | 0.8 | PID HES HEY PATHWAY | Notch-mediated HES/HEY network |
0.0 | 0.1 | SA G1 AND S PHASES | Cdk2, 4, and 6 bind cyclin D in G1, while cdk2/cyclin E promotes the G1/S transition. |
0.0 | 1.1 | PID CD8 TCR DOWNSTREAM PATHWAY | Downstream signaling in naïve CD8+ T cells |
0.0 | 1.0 | PID RAC1 PATHWAY | RAC1 signaling pathway |
0.0 | 1.5 | NABA PROTEOGLYCANS | Genes encoding proteoglycans |
0.0 | 0.1 | PID ERBB4 PATHWAY | ErbB4 signaling events |
0.0 | 0.4 | PID ERBB NETWORK PATHWAY | ErbB receptor signaling network |
0.0 | 0.2 | PID HDAC CLASSII PATHWAY | Signaling events mediated by HDAC Class II |
0.0 | 0.3 | PID RHODOPSIN PATHWAY | Visual signal transduction: Rods |
0.0 | 0.1 | PID TRAIL PATHWAY | TRAIL signaling pathway |
0.0 | 0.1 | PID AVB3 OPN PATHWAY | Osteopontin-mediated events |
0.0 | 0.1 | SA TRKA RECEPTOR | The TrkA receptor binds nerve growth factor to activate MAP kinase pathways and promote cell growth. |
0.0 | 0.5 | PID LIS1 PATHWAY | Lissencephaly gene (LIS1) in neuronal migration and development |
0.0 | 0.2 | PID WNT SIGNALING PATHWAY | Wnt signaling network |
0.0 | 0.9 | PID HNF3B PATHWAY | FOXA2 and FOXA3 transcription factor networks |
0.0 | 0.1 | PID S1P S1P4 PATHWAY | S1P4 pathway |
0.0 | 0.4 | PID IL12 2PATHWAY | IL12-mediated signaling events |
0.0 | 0.2 | PID CD8 TCR PATHWAY | TCR signaling in naïve CD8+ T cells |
0.0 | 0.1 | PID NFKAPPAB ATYPICAL PATHWAY | Atypical NF-kappaB pathway |
0.0 | 0.1 | ST ERK1 ERK2 MAPK PATHWAY | ERK1/ERK2 MAPK Pathway |
0.0 | 0.0 | PID INTEGRIN1 PATHWAY | Beta1 integrin cell surface interactions |
0.0 | 0.0 | PID CD40 PATHWAY | CD40/CD40L signaling |
0.0 | 0.2 | ST JNK MAPK PATHWAY | JNK MAPK Pathway |
0.0 | 0.2 | ST FAS SIGNALING PATHWAY | Fas Signaling Pathway |
0.0 | 0.2 | PID AURORA B PATHWAY | Aurora B signaling |
0.0 | 0.1 | PID PI3K PLC TRK PATHWAY | Trk receptor signaling mediated by PI3K and PLC-gamma |
0.0 | 0.1 | PID BETA CATENIN DEG PATHWAY | Degradation of beta catenin |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.9 | 2.8 | REACTOME ENDOSOMAL VACUOLAR PATHWAY | Genes involved in Endosomal/Vacuolar pathway |
0.9 | 8.2 | REACTOME TRYPTOPHAN CATABOLISM | Genes involved in Tryptophan catabolism |
0.8 | 10.2 | REACTOME RETROGRADE NEUROTROPHIN SIGNALLING | Genes involved in Retrograde neurotrophin signalling |
0.7 | 6.9 | REACTOME SYNTHESIS OF PE | Genes involved in Synthesis of PE |
0.7 | 6.7 | REACTOME ADENYLATE CYCLASE ACTIVATING PATHWAY | Genes involved in Adenylate cyclase activating pathway |
0.6 | 6.9 | REACTOME BILE SALT AND ORGANIC ANION SLC TRANSPORTERS | Genes involved in Bile salt and organic anion SLC transporters |
0.5 | 6.3 | REACTOME PURINE SALVAGE | Genes involved in Purine salvage |
0.5 | 9.7 | REACTOME DOWNREGULATION OF SMAD2 3 SMAD4 TRANSCRIPTIONAL ACTIVITY | Genes involved in Downregulation of SMAD2/3:SMAD4 transcriptional activity |
0.5 | 3.5 | REACTOME ABACAVIR TRANSPORT AND METABOLISM | Genes involved in Abacavir transport and metabolism |
0.5 | 5.2 | REACTOME MTORC1 MEDIATED SIGNALLING | Genes involved in mTORC1-mediated signalling |
0.5 | 2.3 | REACTOME PKA MEDIATED PHOSPHORYLATION OF CREB | Genes involved in PKA-mediated phosphorylation of CREB |
0.4 | 2.1 | REACTOME RNA POL I PROMOTER OPENING | Genes involved in RNA Polymerase I Promoter Opening |
0.4 | 6.3 | REACTOME GRB2 SOS PROVIDES LINKAGE TO MAPK SIGNALING FOR INTERGRINS | Genes involved in GRB2:SOS provides linkage to MAPK signaling for Intergrins |
0.4 | 4.6 | REACTOME SYNTHESIS OF PC | Genes involved in Synthesis of PC |
0.4 | 3.4 | REACTOME COPI MEDIATED TRANSPORT | Genes involved in COPI Mediated Transport |
0.4 | 4.6 | REACTOME RAP1 SIGNALLING | Genes involved in Rap1 signalling |
0.4 | 5.7 | REACTOME CHYLOMICRON MEDIATED LIPID TRANSPORT | Genes involved in Chylomicron-mediated lipid transport |
0.3 | 2.4 | REACTOME CREATION OF C4 AND C2 ACTIVATORS | Genes involved in Creation of C4 and C2 activators |
0.3 | 3.0 | REACTOME HORMONE SENSITIVE LIPASE HSL MEDIATED TRIACYLGLYCEROL HYDROLYSIS | Genes involved in Hormone-sensitive lipase (HSL)-mediated triacylglycerol hydrolysis |
0.3 | 1.0 | REACTOME NOTCH HLH TRANSCRIPTION PATHWAY | Genes involved in Notch-HLH transcription pathway |
0.3 | 0.3 | REACTOME CELL DEATH SIGNALLING VIA NRAGE NRIF AND NADE | Genes involved in Cell death signalling via NRAGE, NRIF and NADE |
0.3 | 1.6 | REACTOME PLATELET SENSITIZATION BY LDL | Genes involved in Platelet sensitization by LDL |
0.3 | 2.8 | REACTOME ACTIVATION OF CHAPERONE GENES BY ATF6 ALPHA | Genes involved in Activation of Chaperone Genes by ATF6-alpha |
0.3 | 0.9 | REACTOME ACTIVATED TAK1 MEDIATES P38 MAPK ACTIVATION | Genes involved in activated TAK1 mediates p38 MAPK activation |
0.3 | 4.1 | REACTOME GLYCOGEN BREAKDOWN GLYCOGENOLYSIS | Genes involved in Glycogen breakdown (glycogenolysis) |
0.3 | 3.9 | REACTOME TRAF3 DEPENDENT IRF ACTIVATION PATHWAY | Genes involved in TRAF3-dependent IRF activation pathway |
0.3 | 5.3 | REACTOME G0 AND EARLY G1 | Genes involved in G0 and Early G1 |
0.3 | 3.7 | REACTOME ACTIVATION OF BH3 ONLY PROTEINS | Genes involved in Activation of BH3-only proteins |
0.3 | 9.3 | REACTOME NOTCH1 INTRACELLULAR DOMAIN REGULATES TRANSCRIPTION | Genes involved in NOTCH1 Intracellular Domain Regulates Transcription |
0.2 | 3.2 | REACTOME INTRINSIC PATHWAY FOR APOPTOSIS | Genes involved in Intrinsic Pathway for Apoptosis |
0.2 | 2.0 | REACTOME PURINE CATABOLISM | Genes involved in Purine catabolism |
0.2 | 1.7 | REACTOME INTEGRIN ALPHAIIB BETA3 SIGNALING | Genes involved in Integrin alphaIIb beta3 signaling |
0.2 | 3.6 | REACTOME BOTULINUM NEUROTOXICITY | Genes involved in Botulinum neurotoxicity |
0.2 | 2.2 | REACTOME IL 6 SIGNALING | Genes involved in Interleukin-6 signaling |
0.2 | 1.9 | REACTOME LYSOSOME VESICLE BIOGENESIS | Genes involved in Lysosome Vesicle Biogenesis |
0.2 | 4.3 | REACTOME FATTY ACYL COA BIOSYNTHESIS | Genes involved in Fatty Acyl-CoA Biosynthesis |
0.2 | 2.3 | REACTOME PASSIVE TRANSPORT BY AQUAPORINS | Genes involved in Passive Transport by Aquaporins |
0.2 | 11.6 | REACTOME LOSS OF NLP FROM MITOTIC CENTROSOMES | Genes involved in Loss of Nlp from mitotic centrosomes |
0.2 | 5.1 | REACTOME CYTOSOLIC TRNA AMINOACYLATION | Genes involved in Cytosolic tRNA aminoacylation |
0.2 | 6.1 | REACTOME NOD1 2 SIGNALING PATHWAY | Genes involved in NOD1/2 Signaling Pathway |
0.2 | 4.7 | REACTOME G1 PHASE | Genes involved in G1 Phase |
0.2 | 1.7 | REACTOME ROLE OF DCC IN REGULATING APOPTOSIS | Genes involved in Role of DCC in regulating apoptosis |
0.2 | 1.5 | REACTOME PRE NOTCH TRANSCRIPTION AND TRANSLATION | Genes involved in Pre-NOTCH Transcription and Translation |
0.2 | 6.4 | REACTOME THROMBIN SIGNALLING THROUGH PROTEINASE ACTIVATED RECEPTORS PARS | Genes involved in Thrombin signalling through proteinase activated receptors (PARs) |
0.2 | 0.4 | REACTOME NFKB ACTIVATION THROUGH FADD RIP1 PATHWAY MEDIATED BY CASPASE 8 AND10 | Genes involved in NF-kB activation through FADD/RIP-1 pathway mediated by caspase-8 and -10 |
0.2 | 3.1 | REACTOME AMINE DERIVED HORMONES | Genes involved in Amine-derived hormones |
0.2 | 1.6 | REACTOME G2 M DNA DAMAGE CHECKPOINT | Genes involved in G2/M DNA damage checkpoint |
0.2 | 2.2 | REACTOME PURINE METABOLISM | Genes involved in Purine metabolism |
0.2 | 0.8 | REACTOME PLATELET AGGREGATION PLUG FORMATION | Genes involved in Platelet Aggregation (Plug Formation) |
0.2 | 1.0 | REACTOME ARMS MEDIATED ACTIVATION | Genes involved in ARMS-mediated activation |
0.2 | 2.2 | REACTOME FACILITATIVE NA INDEPENDENT GLUCOSE TRANSPORTERS | Genes involved in Facilitative Na+-independent glucose transporters |
0.2 | 0.2 | REACTOME SYNTHESIS OF BILE ACIDS AND BILE SALTS | Genes involved in Synthesis of bile acids and bile salts |
0.2 | 4.4 | REACTOME MEIOTIC RECOMBINATION | Genes involved in Meiotic Recombination |
0.2 | 4.8 | REACTOME SEMA4D INDUCED CELL MIGRATION AND GROWTH CONE COLLAPSE | Genes involved in Sema4D induced cell migration and growth-cone collapse |
0.2 | 12.6 | REACTOME MITOTIC PROMETAPHASE | Genes involved in Mitotic Prometaphase |
0.2 | 2.8 | REACTOME TIE2 SIGNALING | Genes involved in Tie2 Signaling |
0.2 | 10.4 | REACTOME ANTIVIRAL MECHANISM BY IFN STIMULATED GENES | Genes involved in Antiviral mechanism by IFN-stimulated genes |
0.2 | 0.2 | REACTOME FORMATION OF TUBULIN FOLDING INTERMEDIATES BY CCT TRIC | Genes involved in Formation of tubulin folding intermediates by CCT/TriC |
0.2 | 5.3 | REACTOME SPHINGOLIPID DE NOVO BIOSYNTHESIS | Genes involved in Sphingolipid de novo biosynthesis |
0.2 | 7.0 | REACTOME RNA POL II TRANSCRIPTION PRE INITIATION AND PROMOTER OPENING | Genes involved in RNA Polymerase II Transcription Pre-Initiation And Promoter Opening |
0.2 | 2.7 | REACTOME METABOLISM OF PORPHYRINS | Genes involved in Metabolism of porphyrins |
0.2 | 3.2 | REACTOME REGULATION OF GENE EXPRESSION IN BETA CELLS | Genes involved in Regulation of gene expression in beta cells |
0.2 | 1.3 | REACTOME OXYGEN DEPENDENT PROLINE HYDROXYLATION OF HYPOXIA INDUCIBLE FACTOR ALPHA | Genes involved in Oxygen-dependent Proline Hydroxylation of Hypoxia-inducible Factor Alpha |
0.2 | 4.0 | REACTOME PREFOLDIN MEDIATED TRANSFER OF SUBSTRATE TO CCT TRIC | Genes involved in Prefoldin mediated transfer of substrate to CCT/TriC |
0.2 | 1.6 | REACTOME CASPASE MEDIATED CLEAVAGE OF CYTOSKELETAL PROTEINS | Genes involved in Caspase-mediated cleavage of cytoskeletal proteins |
0.2 | 0.7 | REACTOME REGULATION OF HYPOXIA INDUCIBLE FACTOR HIF BY OXYGEN | Genes involved in Regulation of Hypoxia-inducible Factor (HIF) by Oxygen |
0.2 | 1.2 | REACTOME RNA POL III TRANSCRIPTION INITIATION FROM TYPE 3 PROMOTER | Genes involved in RNA Polymerase III Transcription Initiation From Type 3 Promoter |
0.2 | 3.2 | REACTOME ANTIGEN ACTIVATES B CELL RECEPTOR LEADING TO GENERATION OF SECOND MESSENGERS | Genes involved in Antigen Activates B Cell Receptor Leading to Generation of Second Messengers |
0.2 | 2.0 | REACTOME GROWTH HORMONE RECEPTOR SIGNALING | Genes involved in Growth hormone receptor signaling |
0.2 | 0.3 | REACTOME ACTIVATION OF THE PRE REPLICATIVE COMPLEX | Genes involved in Activation of the pre-replicative complex |
0.2 | 1.0 | REACTOME SIGNAL REGULATORY PROTEIN SIRP FAMILY INTERACTIONS | Genes involved in Signal regulatory protein (SIRP) family interactions |
0.2 | 12.1 | REACTOME FACTORS INVOLVED IN MEGAKARYOCYTE DEVELOPMENT AND PLATELET PRODUCTION | Genes involved in Factors involved in megakaryocyte development and platelet production |
0.2 | 1.6 | REACTOME SEMA3A PAK DEPENDENT AXON REPULSION | Genes involved in Sema3A PAK dependent Axon repulsion |
0.2 | 0.2 | REACTOME CIRCADIAN CLOCK | Genes involved in Circadian Clock |
0.2 | 3.0 | REACTOME IL1 SIGNALING | Genes involved in Interleukin-1 signaling |
0.2 | 2.3 | REACTOME AMINO ACID SYNTHESIS AND INTERCONVERSION TRANSAMINATION | Genes involved in Amino acid synthesis and interconversion (transamination) |
0.2 | 0.5 | REACTOME TRANSFERRIN ENDOCYTOSIS AND RECYCLING | Genes involved in Transferrin endocytosis and recycling |
0.2 | 1.1 | REACTOME ASSOCIATION OF LICENSING FACTORS WITH THE PRE REPLICATIVE COMPLEX | Genes involved in Association of licensing factors with the pre-replicative complex |
0.2 | 2.3 | REACTOME SIGNALING BY NODAL | Genes involved in Signaling by NODAL |
0.1 | 2.2 | REACTOME INTRINSIC PATHWAY | Genes involved in Intrinsic Pathway |
0.1 | 0.6 | REACTOME DOWNSTREAM SIGNAL TRANSDUCTION | Genes involved in Downstream signal transduction |
0.1 | 4.8 | REACTOME MHC CLASS II ANTIGEN PRESENTATION | Genes involved in MHC class II antigen presentation |
0.1 | 0.8 | REACTOME REGULATION OF IFNG SIGNALING | Genes involved in Regulation of IFNG signaling |
0.1 | 2.8 | REACTOME CHOLESTEROL BIOSYNTHESIS | Genes involved in Cholesterol biosynthesis |
0.1 | 2.3 | REACTOME RNA POL III TRANSCRIPTION INITIATION FROM TYPE 2 PROMOTER | Genes involved in RNA Polymerase III Transcription Initiation From Type 2 Promoter |
0.1 | 2.9 | REACTOME INSULIN RECEPTOR RECYCLING | Genes involved in Insulin receptor recycling |
0.1 | 4.5 | REACTOME ACTIVATION OF CHAPERONE GENES BY XBP1S | Genes involved in Activation of Chaperone Genes by XBP1(S) |
0.1 | 1.6 | REACTOME DOWNSTREAM TCR SIGNALING | Genes involved in Downstream TCR signaling |
0.1 | 0.7 | REACTOME PACKAGING OF TELOMERE ENDS | Genes involved in Packaging Of Telomere Ends |
0.1 | 1.3 | REACTOME SLBP DEPENDENT PROCESSING OF REPLICATION DEPENDENT HISTONE PRE MRNAS | Genes involved in SLBP Dependent Processing of Replication-Dependent Histone Pre-mRNAs |
0.1 | 0.5 | REACTOME INHIBITION OF REPLICATION INITIATION OF DAMAGED DNA BY RB1 E2F1 | Genes involved in Inhibition of replication initiation of damaged DNA by RB1/E2F1 |
0.1 | 3.2 | REACTOME KERATAN SULFATE BIOSYNTHESIS | Genes involved in Keratan sulfate biosynthesis |
0.1 | 0.7 | REACTOME APOPTOSIS INDUCED DNA FRAGMENTATION | Genes involved in Apoptosis induced DNA fragmentation |
0.1 | 1.7 | REACTOME AMYLOIDS | Genes involved in Amyloids |
0.1 | 0.5 | REACTOME INTERACTIONS OF VPR WITH HOST CELLULAR PROTEINS | Genes involved in Interactions of Vpr with host cellular proteins |
0.1 | 2.6 | REACTOME ACYL CHAIN REMODELLING OF PC | Genes involved in Acyl chain remodelling of PC |
0.1 | 1.3 | REACTOME HYALURONAN UPTAKE AND DEGRADATION | Genes involved in Hyaluronan uptake and degradation |
0.1 | 4.1 | REACTOME MYD88 MAL CASCADE INITIATED ON PLASMA MEMBRANE | Genes involved in MyD88:Mal cascade initiated on plasma membrane |
0.1 | 0.9 | REACTOME RECYCLING OF BILE ACIDS AND SALTS | Genes involved in Recycling of bile acids and salts |
0.1 | 1.5 | REACTOME SYNTHESIS OF PA | Genes involved in Synthesis of PA |
0.1 | 2.6 | REACTOME GLUCONEOGENESIS | Genes involved in Gluconeogenesis |
0.1 | 0.5 | REACTOME REGULATION OF KIT SIGNALING | Genes involved in Regulation of KIT signaling |
0.1 | 1.0 | REACTOME LATENT INFECTION OF HOMO SAPIENS WITH MYCOBACTERIUM TUBERCULOSIS | Genes involved in Latent infection of Homo sapiens with Mycobacterium tuberculosis |
0.1 | 0.8 | REACTOME ER PHAGOSOME PATHWAY | Genes involved in ER-Phagosome pathway |
0.1 | 0.2 | REACTOME MITOTIC M M G1 PHASES | Genes involved in Mitotic M-M/G1 phases |
0.1 | 0.8 | REACTOME MEMBRANE BINDING AND TARGETTING OF GAG PROTEINS | Genes involved in Membrane binding and targetting of GAG proteins |
0.1 | 0.7 | REACTOME REGULATION OF WATER BALANCE BY RENAL AQUAPORINS | Genes involved in Regulation of Water Balance by Renal Aquaporins |
0.1 | 1.3 | REACTOME SYNTHESIS OF PIPS AT THE EARLY ENDOSOME MEMBRANE | Genes involved in Synthesis of PIPs at the early endosome membrane |
0.1 | 0.5 | REACTOME POST CHAPERONIN TUBULIN FOLDING PATHWAY | Genes involved in Post-chaperonin tubulin folding pathway |
0.1 | 1.7 | REACTOME PTM GAMMA CARBOXYLATION HYPUSINE FORMATION AND ARYLSULFATASE ACTIVATION | Genes involved in PTM: gamma carboxylation, hypusine formation and arylsulfatase activation |
0.1 | 1.3 | REACTOME REGULATION OF INSULIN LIKE GROWTH FACTOR IGF ACTIVITY BY INSULIN LIKE GROWTH FACTOR BINDING PROTEINS IGFBPS | Genes involved in Regulation of Insulin-like Growth Factor (IGF) Activity by Insulin-like Growth Factor Binding Proteins (IGFBPs) |
0.1 | 1.7 | REACTOME BRANCHED CHAIN AMINO ACID CATABOLISM | Genes involved in Branched-chain amino acid catabolism |
0.1 | 0.8 | REACTOME GLUCOSE TRANSPORT | Genes involved in Glucose transport |
0.1 | 0.8 | REACTOME COMMON PATHWAY | Genes involved in Common Pathway |
0.1 | 0.2 | REACTOME YAP1 AND WWTR1 TAZ STIMULATED GENE EXPRESSION | Genes involved in YAP1- and WWTR1 (TAZ)-stimulated gene expression |
0.1 | 4.0 | REACTOME FORMATION OF THE TERNARY COMPLEX AND SUBSEQUENTLY THE 43S COMPLEX | Genes involved in Formation of the ternary complex, and subsequently, the 43S complex |
0.1 | 1.9 | REACTOME PYRIMIDINE METABOLISM | Genes involved in Pyrimidine metabolism |
0.1 | 0.1 | REACTOME NFKB IS ACTIVATED AND SIGNALS SURVIVAL | Genes involved in NF-kB is activated and signals survival |
0.1 | 0.3 | REACTOME DCC MEDIATED ATTRACTIVE SIGNALING | Genes involved in DCC mediated attractive signaling |
0.1 | 0.3 | REACTOME CYCLIN A B1 ASSOCIATED EVENTS DURING G2 M TRANSITION | Genes involved in Cyclin A/B1 associated events during G2/M transition |
0.1 | 1.1 | REACTOME PROCESSING OF CAPPED INTRONLESS PRE MRNA | Genes involved in Processing of Capped Intronless Pre-mRNA |
0.1 | 0.5 | REACTOME IRON UPTAKE AND TRANSPORT | Genes involved in Iron uptake and transport |
0.1 | 4.3 | REACTOME REGULATION OF ORNITHINE DECARBOXYLASE ODC | Genes involved in Regulation of ornithine decarboxylase (ODC) |
0.1 | 0.8 | REACTOME DEPOSITION OF NEW CENPA CONTAINING NUCLEOSOMES AT THE CENTROMERE | Genes involved in Deposition of New CENPA-containing Nucleosomes at the Centromere |
0.1 | 2.7 | REACTOME AMINO ACID TRANSPORT ACROSS THE PLASMA MEMBRANE | Genes involved in Amino acid transport across the plasma membrane |
0.1 | 0.8 | REACTOME PRE NOTCH PROCESSING IN GOLGI | Genes involved in Pre-NOTCH Processing in Golgi |
0.1 | 1.1 | REACTOME FANCONI ANEMIA PATHWAY | Genes involved in Fanconi Anemia pathway |
0.1 | 1.3 | REACTOME MRNA SPLICING MINOR PATHWAY | Genes involved in mRNA Splicing - Minor Pathway |
0.1 | 0.9 | REACTOME G PROTEIN ACTIVATION | Genes involved in G-protein activation |
0.1 | 1.6 | REACTOME CLEAVAGE OF GROWING TRANSCRIPT IN THE TERMINATION REGION | Genes involved in Cleavage of Growing Transcript in the Termination Region |
0.1 | 1.4 | REACTOME PERK REGULATED GENE EXPRESSION | Genes involved in PERK regulated gene expression |
0.1 | 0.7 | REACTOME FORMATION OF ATP BY CHEMIOSMOTIC COUPLING | Genes involved in Formation of ATP by chemiosmotic coupling |
0.1 | 1.6 | REACTOME ACTIVATION OF ATR IN RESPONSE TO REPLICATION STRESS | Genes involved in Activation of ATR in response to replication stress |
0.1 | 0.8 | REACTOME BMAL1 CLOCK NPAS2 ACTIVATES CIRCADIAN EXPRESSION | Genes involved in BMAL1:CLOCK/NPAS2 Activates Circadian Expression |
0.1 | 0.2 | REACTOME INFLUENZA VIRAL RNA TRANSCRIPTION AND REPLICATION | Genes involved in Influenza Viral RNA Transcription and Replication |
0.1 | 1.3 | REACTOME SYNTHESIS AND INTERCONVERSION OF NUCLEOTIDE DI AND TRIPHOSPHATES | Genes involved in Synthesis and interconversion of nucleotide di- and triphosphates |
0.1 | 1.2 | REACTOME PKB MEDIATED EVENTS | Genes involved in PKB-mediated events |
0.1 | 0.9 | REACTOME LATE PHASE OF HIV LIFE CYCLE | Genes involved in Late Phase of HIV Life Cycle |
0.1 | 0.1 | REACTOME P75NTR RECRUITS SIGNALLING COMPLEXES | Genes involved in p75NTR recruits signalling complexes |
0.1 | 0.5 | REACTOME ALPHA LINOLENIC ACID ALA METABOLISM | Genes involved in alpha-linolenic acid (ALA) metabolism |
0.1 | 3.2 | REACTOME MITOCHONDRIAL PROTEIN IMPORT | Genes involved in Mitochondrial Protein Import |
0.1 | 9.2 | REACTOME ANTIGEN PROCESSING UBIQUITINATION PROTEASOME DEGRADATION | Genes involved in Antigen processing: Ubiquitination & Proteasome degradation |
0.1 | 0.2 | REACTOME REGULATION OF SIGNALING BY CBL | Genes involved in Regulation of signaling by CBL |
0.1 | 1.8 | REACTOME ABC FAMILY PROTEINS MEDIATED TRANSPORT | Genes involved in ABC-family proteins mediated transport |
0.1 | 1.8 | REACTOME GOLGI ASSOCIATED VESICLE BIOGENESIS | Genes involved in Golgi Associated Vesicle Biogenesis |
0.1 | 1.1 | REACTOME RORA ACTIVATES CIRCADIAN EXPRESSION | Genes involved in RORA Activates Circadian Expression |
0.1 | 0.6 | REACTOME DEADENYLATION OF MRNA | Genes involved in Deadenylation of mRNA |
0.1 | 0.1 | REACTOME APC C CDH1 MEDIATED DEGRADATION OF CDC20 AND OTHER APC C CDH1 TARGETED PROTEINS IN LATE MITOSIS EARLY G1 | Genes involved in APC/C:Cdh1 mediated degradation of Cdc20 and other APC/C:Cdh1 targeted proteins in late mitosis/early G1 |
0.1 | 0.1 | REACTOME GLUCAGON SIGNALING IN METABOLIC REGULATION | Genes involved in Glucagon signaling in metabolic regulation |
0.1 | 1.7 | REACTOME BIOSYNTHESIS OF THE N GLYCAN PRECURSOR DOLICHOL LIPID LINKED OLIGOSACCHARIDE LLO AND TRANSFER TO A NASCENT PROTEIN | Genes involved in Biosynthesis of the N-glycan precursor (dolichol lipid-linked oligosaccharide, LLO) and transfer to a nascent protein |
0.1 | 0.4 | REACTOME SIGNALING BY FGFR1 FUSION MUTANTS | Genes involved in Signaling by FGFR1 fusion mutants |
0.1 | 1.6 | REACTOME TRANSPORT OF VITAMINS NUCLEOSIDES AND RELATED MOLECULES | Genes involved in Transport of vitamins, nucleosides, and related molecules |
0.1 | 0.2 | REACTOME RIP MEDIATED NFKB ACTIVATION VIA DAI | Genes involved in RIP-mediated NFkB activation via DAI |
0.1 | 0.4 | REACTOME SYNTHESIS OF PIPS AT THE GOLGI MEMBRANE | Genes involved in Synthesis of PIPs at the Golgi membrane |
0.1 | 1.0 | REACTOME TRNA AMINOACYLATION | Genes involved in tRNA Aminoacylation |
0.1 | 0.3 | REACTOME IL 7 SIGNALING | Genes involved in Interleukin-7 signaling |
0.1 | 0.2 | REACTOME XENOBIOTICS | Genes involved in Xenobiotics |
0.1 | 1.0 | REACTOME APOPTOTIC CLEAVAGE OF CELLULAR PROTEINS | Genes involved in Apoptotic cleavage of cellular proteins |
0.1 | 0.3 | REACTOME SEMA4D IN SEMAPHORIN SIGNALING | Genes involved in Sema4D in semaphorin signaling |
0.1 | 0.6 | REACTOME BASIGIN INTERACTIONS | Genes involved in Basigin interactions |
0.1 | 3.1 | REACTOME RESPIRATORY ELECTRON TRANSPORT | Genes involved in Respiratory electron transport |
0.1 | 1.1 | REACTOME GLUTATHIONE CONJUGATION | Genes involved in Glutathione conjugation |
0.1 | 0.2 | REACTOME DESTABILIZATION OF MRNA BY BRF1 | Genes involved in Destabilization of mRNA by Butyrate Response Factor 1 (BRF1) |
0.0 | 1.8 | REACTOME MRNA SPLICING | Genes involved in mRNA Splicing |
0.0 | 0.2 | REACTOME GLUCURONIDATION | Genes involved in Glucuronidation |
0.0 | 0.6 | REACTOME NONSENSE MEDIATED DECAY ENHANCED BY THE EXON JUNCTION COMPLEX | Genes involved in Nonsense Mediated Decay Enhanced by the Exon Junction Complex |
0.0 | 2.8 | REACTOME PPARA ACTIVATES GENE EXPRESSION | Genes involved in PPARA Activates Gene Expression |
0.0 | 0.9 | REACTOME PHASE II CONJUGATION | Genes involved in Phase II conjugation |
0.0 | 0.5 | REACTOME REGULATION OF PYRUVATE DEHYDROGENASE PDH COMPLEX | Genes involved in Regulation of pyruvate dehydrogenase (PDH) complex |
0.0 | 0.8 | REACTOME MYOGENESIS | Genes involved in Myogenesis |
0.0 | 0.2 | REACTOME MICRORNA MIRNA BIOGENESIS | Genes involved in MicroRNA (miRNA) Biogenesis |
0.0 | 1.4 | REACTOME IMMUNOREGULATORY INTERACTIONS BETWEEN A LYMPHOID AND A NON LYMPHOID CELL | Genes involved in Immunoregulatory interactions between a Lymphoid and a non-Lymphoid cell |
0.0 | 0.1 | REACTOME ACTIVATED TLR4 SIGNALLING | Genes involved in Activated TLR4 signalling |
0.0 | 0.0 | REACTOME ACTIVATION OF THE MRNA UPON BINDING OF THE CAP BINDING COMPLEX AND EIFS AND SUBSEQUENT BINDING TO 43S | Genes involved in Activation of the mRNA upon binding of the cap-binding complex and eIFs, and subsequent binding to 43S |
0.0 | 0.1 | REACTOME AKT PHOSPHORYLATES TARGETS IN THE CYTOSOL | Genes involved in AKT phosphorylates targets in the cytosol |
0.0 | 0.3 | REACTOME REGULATION OF MRNA STABILITY BY PROTEINS THAT BIND AU RICH ELEMENTS | Genes involved in Regulation of mRNA Stability by Proteins that Bind AU-rich Elements |
0.0 | 0.2 | REACTOME RECRUITMENT OF NUMA TO MITOTIC CENTROSOMES | Genes involved in Recruitment of NuMA to mitotic centrosomes |
0.0 | 0.1 | REACTOME PLATELET ADHESION TO EXPOSED COLLAGEN | Genes involved in Platelet Adhesion to exposed collagen |
0.0 | 0.0 | REACTOME NEF MEDIATED DOWNREGULATION OF MHC CLASS I COMPLEX CELL SURFACE EXPRESSION | Genes involved in Nef mediated downregulation of MHC class I complex cell surface expression |
0.0 | 0.3 | REACTOME ORGANIC CATION ANION ZWITTERION TRANSPORT | Genes involved in Organic cation/anion/zwitterion transport |
0.0 | 0.3 | REACTOME TGF BETA RECEPTOR SIGNALING IN EMT EPITHELIAL TO MESENCHYMAL TRANSITION | Genes involved in TGF-beta receptor signaling in EMT (epithelial to mesenchymal transition) |
0.0 | 0.1 | REACTOME ACYL CHAIN REMODELLING OF PG | Genes involved in Acyl chain remodelling of PG |
0.0 | 0.5 | REACTOME SMOOTH MUSCLE CONTRACTION | Genes involved in Smooth Muscle Contraction |
0.0 | 0.5 | REACTOME SIGNALING BY SCF KIT | Genes involved in Signaling by SCF-KIT |
0.0 | 0.7 | REACTOME INTERFERON ALPHA BETA SIGNALING | Genes involved in Interferon alpha/beta signaling |
0.0 | 1.8 | REACTOME SRP DEPENDENT COTRANSLATIONAL PROTEIN TARGETING TO MEMBRANE | Genes involved in SRP-dependent cotranslational protein targeting to membrane |
0.0 | 0.3 | REACTOME TOLL RECEPTOR CASCADES | Genes involved in Toll Receptor Cascades |
0.0 | 0.3 | REACTOME SYNTHESIS SECRETION AND INACTIVATION OF GIP | Genes involved in Synthesis, Secretion, and Inactivation of Glucose-dependent Insulinotropic Polypeptide (GIP) |
0.0 | 0.2 | REACTOME FORMATION OF TRANSCRIPTION COUPLED NER TC NER REPAIR COMPLEX | Genes involved in Formation of transcription-coupled NER (TC-NER) repair complex |
0.0 | 0.3 | REACTOME COSTIMULATION BY THE CD28 FAMILY | Genes involved in Costimulation by the CD28 family |
0.0 | 0.1 | REACTOME UNWINDING OF DNA | Genes involved in Unwinding of DNA |
0.0 | 0.1 | REACTOME SYNTHESIS OF BILE ACIDS AND BILE SALTS VIA 7ALPHA HYDROXYCHOLESTEROL | Genes involved in Synthesis of bile acids and bile salts via 7alpha-hydroxycholesterol |
0.0 | 0.2 | REACTOME RECYCLING PATHWAY OF L1 | Genes involved in Recycling pathway of L1 |
0.0 | 0.0 | REACTOME ADVANCED GLYCOSYLATION ENDPRODUCT RECEPTOR SIGNALING | Genes involved in Advanced glycosylation endproduct receptor signaling |
0.0 | 0.2 | REACTOME PEPTIDE HORMONE BIOSYNTHESIS | Genes involved in Peptide hormone biosynthesis |
0.0 | 0.0 | REACTOME DOWNREGULATION OF ERBB2 ERBB3 SIGNALING | Genes involved in Downregulation of ERBB2:ERBB3 signaling |
0.0 | 0.1 | REACTOME ELEVATION OF CYTOSOLIC CA2 LEVELS | Genes involved in Elevation of cytosolic Ca2+ levels |
0.0 | 0.3 | REACTOME TERMINATION OF O GLYCAN BIOSYNTHESIS | Genes involved in Termination of O-glycan biosynthesis |
0.0 | 0.1 | REACTOME BETA DEFENSINS | Genes involved in Beta defensins |
0.0 | 0.2 | REACTOME N GLYCAN ANTENNAE ELONGATION IN THE MEDIAL TRANS GOLGI | Genes involved in N-glycan antennae elongation in the medial/trans-Golgi |
0.0 | 0.1 | REACTOME ANDROGEN BIOSYNTHESIS | Genes involved in Androgen biosynthesis |
0.0 | 0.1 | REACTOME INTEGRATION OF PROVIRUS | Genes involved in Integration of provirus |
0.0 | 0.1 | REACTOME REGULATION OF COMPLEMENT CASCADE | Genes involved in Regulation of Complement cascade |
0.0 | 0.1 | REACTOME EXTRINSIC PATHWAY FOR APOPTOSIS | Genes involved in Extrinsic Pathway for Apoptosis |
0.0 | 0.1 | REACTOME RNA POL I TRANSCRIPTION | Genes involved in RNA Polymerase I Transcription |
0.0 | 0.1 | REACTOME ETHANOL OXIDATION | Genes involved in Ethanol oxidation |
0.0 | 0.1 | REACTOME CALNEXIN CALRETICULIN CYCLE | Genes involved in Calnexin/calreticulin cycle |
0.0 | 0.1 | REACTOME MITOCHONDRIAL FATTY ACID BETA OXIDATION | Genes involved in Mitochondrial Fatty Acid Beta-Oxidation |
0.0 | 0.2 | REACTOME GLYCEROPHOSPHOLIPID BIOSYNTHESIS | Genes involved in Glycerophospholipid biosynthesis |
0.0 | 0.0 | REACTOME INITIAL TRIGGERING OF COMPLEMENT | Genes involved in Initial triggering of complement |
0.0 | 0.0 | REACTOME FRS2 MEDIATED CASCADE | Genes involved in FRS2-mediated cascade |
0.0 | 0.0 | REACTOME HOMOLOGOUS RECOMBINATION REPAIR OF REPLICATION INDEPENDENT DOUBLE STRAND BREAKS | Genes involved in Homologous recombination repair of replication-independent double-strand breaks |
0.0 | 0.0 | REACTOME DIGESTION OF DIETARY CARBOHYDRATE | Genes involved in Digestion of dietary carbohydrate |