Gene Symbol | Gene ID | Gene Info |
---|---|---|
Neurog2
|
ENSMUSG00000027967.7 | neurogenin 2 |
CRE | Gene | Distance | Association probability | Pearson corr. coef. | P-value | Plot |
---|---|---|---|---|---|---|
Neurog2 | chr3_127652402_127652663 | 19397 | 0.107669 | 0.45 | 6.4e-04 | Click! |
Neurog2 | chr3_127652160_127652345 | 19117 | 0.108119 | 0.40 | 2.8e-03 | Click! |
Neurog2 | chr3_127651845_127652045 | 18810 | 0.108610 | 0.37 | 6.1e-03 | Click! |
Neurog2 | chr3_127646099_127646733 | 13281 | 0.117027 | 0.34 | 1.1e-02 | Click! |
Neurog2 | chr3_127627265_127627453 | 5776 | 0.130650 | 0.31 | 2.3e-02 | Click! |
Move your cursor over a bar to see sample name and corresponding Z-value.
Cis Regulatory Element (CRE) | Target Score | Top associated gene | Gene Info | Distance of CRE to TSS | CRE/Gene association probability |
---|---|---|---|---|---|
chr4_111866796_111866947 | 12.34 |
Slc5a9 |
solute carrier family 5 (sodium/glucose cotransporter), member 9 |
13756 |
0.18 |
chr14_14983885_14984321 | 11.72 |
Nek10 |
NIMA (never in mitosis gene a)- related kinase 10 |
53528 |
0.11 |
chr6_146282139_146282319 | 9.36 |
Gm44086 |
predicted gene, 44086 |
11249 |
0.21 |
chr9_73258155_73258537 | 8.57 |
Gm27211 |
predicted gene 27211 |
65863 |
0.09 |
chr6_85218363_85218514 | 8.52 |
Emx1 |
empty spiracles homeobox 1 |
24919 |
0.12 |
chr4_87928972_87929158 | 7.75 |
Mllt3 |
myeloid/lymphoid or mixed-lineage leukemia; translocated to, 3 |
54523 |
0.14 |
chr2_126735451_126735631 | 7.16 |
Gm10774 |
predicted pseudogene 10774 |
25984 |
0.12 |
chr12_67009324_67009475 | 6.87 |
Gm47989 |
predicted gene, 47989 |
66988 |
0.13 |
chr15_43940257_43940713 | 6.80 |
Tmem74 |
transmembrane protein 74 |
70449 |
0.13 |
chr4_63374024_63374199 | 6.74 |
Akna |
AT-hook transcription factor |
7092 |
0.11 |
chr15_69575938_69576149 | 6.30 |
Gm23987 |
predicted gene, 23987 |
109663 |
0.07 |
chr3_51096175_51096378 | 6.29 |
Gm38246 |
predicted gene, 38246 |
7384 |
0.2 |
chr3_13725513_13725805 | 6.21 |
Gm2474 |
predicted gene 2474 |
24295 |
0.2 |
chr8_89468925_89469219 | 6.19 |
Gm26331 |
predicted gene, 26331 |
120469 |
0.06 |
chr10_7268395_7268800 | 6.08 |
Cnksr3 |
Cnksr family member 3 |
56360 |
0.14 |
chr15_95216740_95217275 | 6.00 |
1700129L04Rik |
RIKEN cDNA 1700129L04 gene |
54613 |
0.17 |
chr13_77295666_77295844 | 5.93 |
2210408I21Rik |
RIKEN cDNA 2210408I21 gene |
102721 |
0.07 |
chr18_81251894_81252538 | 5.73 |
Gm30192 |
predicted gene, 30192 |
12475 |
0.22 |
chr2_139311595_139311791 | 5.65 |
Gm14071 |
predicted gene 14071 |
72647 |
0.12 |
chr6_32702464_32702615 | 5.57 |
BC049739 |
cDNA sequence BC049739 |
49749 |
0.15 |
chr17_87745290_87745662 | 5.54 |
Msh2 |
mutS homolog 2 |
48935 |
0.12 |
chr2_96763491_96763847 | 5.52 |
Gm17075 |
predicted gene 17075 |
235955 |
0.02 |
chr9_27091470_27091656 | 5.49 |
Gm48796 |
predicted gene, 48796 |
6988 |
0.16 |
chr17_89090010_89090391 | 5.45 |
Fshr |
follicle stimulating hormone receptor |
110475 |
0.07 |
chr2_125031910_125032078 | 5.44 |
Slc24a5 |
solute carrier family 24, member 5 |
36130 |
0.16 |
chr5_70024646_70024993 | 5.30 |
Gm43139 |
predicted gene 43139 |
93011 |
0.08 |
chr2_137694036_137694202 | 5.28 |
Gm14064 |
predicted gene 14064 |
30684 |
0.26 |
chr14_93182695_93182874 | 5.25 |
Gm9247 |
predicted gene 9247 |
12912 |
0.21 |
chr2_43097974_43098138 | 5.24 |
Gm24350 |
predicted gene, 24350 |
289021 |
0.01 |
chr8_12126666_12127044 | 5.22 |
A230072I06Rik |
RIKEN cDNA A230072I06 gene |
151964 |
0.03 |
chr13_59041258_59041434 | 5.19 |
Gm34245 |
predicted gene, 34245 |
36950 |
0.14 |
chr2_51753056_51753280 | 5.18 |
Gm13490 |
predicted gene 13490 |
21159 |
0.21 |
chr13_105411932_105412271 | 5.18 |
Htr1a |
5-hydroxytryptamine (serotonin) receptor 1A |
31538 |
0.23 |
chr12_47164923_47165105 | 5.17 |
Gm36971 |
predicted gene, 36971 |
28 |
0.99 |
chr1_61111831_61111982 | 5.15 |
Gm11590 |
predicted gene 11590 |
12098 |
0.2 |
chr7_51784299_51784690 | 5.11 |
Gm29296 |
predicted gene 29296 |
11768 |
0.17 |
chr11_60294613_60294876 | 5.07 |
Gm27711 |
predicted gene, 27711 |
8080 |
0.14 |
chr3_32067002_32067680 | 5.07 |
Kcnmb2 |
potassium large conductance calcium-activated channel, subfamily M, beta member 2 |
88773 |
0.09 |
chr6_140946871_140947164 | 5.05 |
Gm30524 |
predicted gene, 30524 |
8592 |
0.26 |
chr11_44977922_44978106 | 4.99 |
Ebf1 |
early B cell factor 1 |
65876 |
0.13 |
chr16_27925838_27926060 | 4.99 |
Gm49765 |
predicted gene, 49765 |
44396 |
0.17 |
chr3_137561157_137561395 | 4.97 |
Gm4861 |
predicted gene 4861 |
8654 |
0.2 |
chr19_19306553_19306736 | 4.96 |
Gm41815 |
predicted gene, 41815 |
30173 |
0.17 |
chr9_106145659_106145968 | 4.91 |
D030055H07Rik |
RIKEN cDNA D030055H07 gene |
2874 |
0.12 |
chr3_50044774_50044968 | 4.90 |
Gm37826 |
predicted gene, 37826 |
15202 |
0.23 |
chr8_23078396_23078728 | 4.90 |
Ank1 |
ankyrin 1, erythroid |
17539 |
0.13 |
chr14_98810236_98810397 | 4.88 |
Gm27034 |
predicted gene, 27034 |
95503 |
0.07 |
chr4_70810746_70810927 | 4.87 |
Gm11227 |
predicted gene 11227 |
261837 |
0.02 |
chr12_26936808_26937007 | 4.86 |
4933409F18Rik |
RIKEN cDNA 4933409F18 gene |
102034 |
0.08 |
chr15_19667510_19667673 | 4.84 |
Gm49166 |
predicted gene, 49166 |
10641 |
0.27 |
chr16_73108130_73108317 | 4.83 |
4930500H12Rik |
RIKEN cDNA 4930500H12 gene |
9235 |
0.31 |
chr8_32959326_32959711 | 4.81 |
Gm3985 |
predicted gene 3985 |
9492 |
0.28 |
chr6_144367916_144368122 | 4.79 |
Sox5os2 |
SRY (sex determining region Y)-box 5, opposite strand 2 |
113206 |
0.07 |
chr6_93849326_93849529 | 4.73 |
Gm22840 |
predicted gene, 22840 |
41188 |
0.16 |
chr14_48608694_48608905 | 4.72 |
Gm49120 |
predicted gene, 49120 |
18200 |
0.1 |
chr2_4436351_4436936 | 4.72 |
Gm13175 |
predicted gene 13175 |
30027 |
0.16 |
chr15_85991573_85992022 | 4.69 |
Celsr1 |
cadherin, EGF LAG seven-pass G-type receptor 1 |
13067 |
0.2 |
chr1_81076306_81076601 | 4.68 |
Nyap2 |
neuronal tyrosine-phophorylated phosphoinositide 3-kinase adaptor 2 |
497 |
0.88 |
chr13_103803868_103804019 | 4.66 |
Srek1 |
splicing regulatory glutamine/lysine-rich protein 1 |
29335 |
0.2 |
chr6_88490737_88490899 | 4.65 |
Gm44170 |
predicted gene, 44170 |
12787 |
0.13 |
chr18_67483796_67483986 | 4.64 |
Prelid3a |
PRELI domain containing 3A |
11019 |
0.14 |
chr9_16345275_16345564 | 4.61 |
Fat3 |
FAT atypical cadherin 3 |
32812 |
0.23 |
chr16_5766788_5767000 | 4.59 |
Rbfox1 |
RNA binding protein, fox-1 homolog (C. elegans) 1 |
118461 |
0.06 |
chr13_110094450_110094601 | 4.57 |
Pde4d |
phosphodiesterase 4D, cAMP specific |
159213 |
0.04 |
chr1_132569720_132569871 | 4.55 |
Nfasc |
neurofascin |
17345 |
0.16 |
chr13_103806232_103806601 | 4.51 |
Srek1 |
splicing regulatory glutamine/lysine-rich protein 1 |
31808 |
0.2 |
chr5_110611527_110611728 | 4.51 |
Galnt9 |
polypeptide N-acetylgalactosaminyltransferase 9 |
8105 |
0.13 |
chr2_135541067_135541625 | 4.49 |
9630028H03Rik |
RIKEN cDNA 9630028H03 gene |
41950 |
0.18 |
chr1_176994684_176995057 | 4.49 |
Sdccag8 |
serologically defined colon cancer antigen 8 |
3139 |
0.19 |
chr10_108585184_108585335 | 4.49 |
Syt1 |
synaptotagmin I |
51705 |
0.15 |
chr8_14740887_14741222 | 4.47 |
Dlgap2 |
DLG associated protein 2 |
1699 |
0.41 |
chr1_70856053_70856213 | 4.46 |
Vwc2l |
von Willebrand factor C domain-containing protein 2-like |
130210 |
0.05 |
chr15_103518626_103518966 | 4.44 |
Pde1b |
phosphodiesterase 1B, Ca2+-calmodulin dependent |
3876 |
0.17 |
chr6_144452255_144452421 | 4.43 |
Sox5os2 |
SRY (sex determining region Y)-box 5, opposite strand 2 |
28887 |
0.24 |
chr3_5210842_5211599 | 4.41 |
Gm10748 |
predicted gene 10748 |
1618 |
0.38 |
chr10_64544466_64544617 | 4.39 |
Gm23854 |
predicted gene, 23854 |
239797 |
0.02 |
chr9_13699411_13699759 | 4.39 |
Gm47105 |
predicted gene, 47105 |
27857 |
0.15 |
chr17_69769280_69769433 | 4.38 |
Gm49895 |
predicted gene, 49895 |
6656 |
0.3 |
chr16_91099499_91099688 | 4.38 |
4932438H23Rik |
RIKEN cDNA 4932438H23 gene |
4471 |
0.13 |
chr2_170903003_170903178 | 4.37 |
Gm14263 |
predicted gene 14263 |
51734 |
0.17 |
chrX_10268865_10269016 | 4.36 |
Otc |
ornithine transcarbamylase |
16573 |
0.24 |
chr2_146290850_146291227 | 4.35 |
Gm14117 |
predicted gene 14117 |
14509 |
0.18 |
chr13_13463979_13464303 | 4.33 |
Gm48682 |
predicted gene, 48682 |
18264 |
0.12 |
chr1_16653322_16653502 | 4.31 |
Eloc |
elongin C |
3213 |
0.15 |
chr9_84090790_84090948 | 4.29 |
Bckdhb |
branched chain ketoacid dehydrogenase E1, beta polypeptide |
16638 |
0.22 |
chr17_43820987_43821190 | 4.26 |
Rcan2 |
regulator of calcineurin 2 |
17085 |
0.24 |
chr18_88785266_88785620 | 4.26 |
Socs6 |
suppressor of cytokine signaling 6 |
26952 |
0.17 |
chr4_79310443_79310594 | 4.26 |
Gm11263 |
predicted gene 11263 |
17190 |
0.27 |
chrX_14274069_14274220 | 4.25 |
Gm14867 |
predicted gene 14867 |
15595 |
0.23 |
chr18_72949026_72949703 | 4.22 |
Gm31908 |
predicted gene, 31908 |
28274 |
0.23 |
chr3_126810458_126810619 | 4.22 |
Camk2d |
calcium/calmodulin-dependent protein kinase II, delta |
3376 |
0.25 |
chr10_89827033_89827184 | 4.21 |
Gm26180 |
predicted gene, 26180 |
5662 |
0.22 |
chr17_93312930_93313224 | 4.21 |
Gm9665 |
predicted gene 9665 |
4184 |
0.24 |
chr19_47211762_47211929 | 4.21 |
Gm36693 |
predicted gene, 36693 |
9813 |
0.11 |
chr13_95774985_95775175 | 4.18 |
Iqgap2 |
IQ motif containing GTPase activating protein 2 |
10683 |
0.19 |
chr1_129180535_129180703 | 4.18 |
Thsd7b |
thrombospondin, type I, domain containing 7B |
92683 |
0.09 |
chr1_60035140_60035316 | 4.18 |
Ica1l |
islet cell autoantigen 1-like |
6999 |
0.18 |
chr6_135092918_135093069 | 4.17 |
Gprc5d |
G protein-coupled receptor, family C, group 5, member D |
25253 |
0.11 |
chr18_84414557_84414907 | 4.14 |
Zfp407 |
zinc finger protein 407 |
2312 |
0.36 |
chr5_66393812_66393963 | 4.13 |
Gm16273 |
predicted gene 16273 |
36969 |
0.1 |
chr17_77930455_77930666 | 4.12 |
Gm50029 |
predicted gene, 50029 |
178448 |
0.03 |
chr2_106454665_106455019 | 4.11 |
Gm14015 |
predicted gene 14015 |
68261 |
0.11 |
chr15_32003550_32003801 | 4.11 |
Gm49285 |
predicted gene, 49285 |
46276 |
0.18 |
chr12_49758504_49758666 | 4.11 |
Gm7476 |
predicted gene 7476 |
18190 |
0.26 |
chr16_45999549_45999806 | 4.09 |
Plcxd2 |
phosphatidylinositol-specific phospholipase C, X domain containing 2 |
10541 |
0.16 |
chr2_65930049_65930249 | 4.09 |
Csrnp3 |
cysteine-serine-rich nuclear protein 3 |
12 |
0.98 |
chr2_78718744_78718973 | 4.08 |
Gm14463 |
predicted gene 14463 |
61429 |
0.13 |
chr2_14132895_14133287 | 4.08 |
Stam |
signal transducing adaptor molecule (SH3 domain and ITAM motif) 1 |
1031 |
0.47 |
chr16_26827135_26827286 | 4.06 |
Gm20319 |
predicted gene, 20319 |
71708 |
0.12 |
chr10_13150551_13150725 | 4.05 |
Zc2hc1b |
zinc finger, C2HC-type containing 1B |
27385 |
0.15 |
chr4_65610954_65611238 | 4.04 |
Trim32 |
tripartite motif-containing 32 |
5847 |
0.35 |
chr13_71138869_71139020 | 4.03 |
Mir466f-4 |
microRNA 466f-4 |
31855 |
0.22 |
chr14_110047924_110048075 | 4.03 |
Gm24369 |
predicted gene, 24369 |
96600 |
0.08 |
chr2_158588848_158589178 | 4.01 |
Gm14204 |
predicted gene 14204 |
21577 |
0.11 |
chr2_178141291_178141933 | 4.01 |
Phactr3 |
phosphatase and actin regulator 3 |
321 |
0.92 |
chr3_17793443_17793892 | 4.00 |
Mir124-2hg |
Mir124-2 host gene (non-protein coding) |
253 |
0.9 |
chr11_118792739_118792890 | 3.99 |
Gm11750 |
predicted gene 11750 |
1442 |
0.44 |
chr13_99754621_99755001 | 3.99 |
Gm24471 |
predicted gene, 24471 |
62282 |
0.12 |
chr2_12777005_12777156 | 3.98 |
Gm37565 |
predicted gene, 37565 |
79663 |
0.1 |
chr2_95136751_95136931 | 3.98 |
Gm13794 |
predicted gene 13794 |
257401 |
0.02 |
chr4_91589820_91589971 | 3.98 |
Gm12668 |
predicted gene 12668 |
36694 |
0.18 |
chr8_86438259_86438704 | 3.98 |
Abcc12 |
ATP-binding cassette, sub-family C (CFTR/MRP), member 12 |
96266 |
0.07 |
chr12_33336631_33336802 | 3.98 |
Atxn7l1 |
ataxin 7-like 1 |
8589 |
0.2 |
chr13_114131052_114131240 | 3.97 |
Gm47479 |
predicted gene, 47479 |
10730 |
0.21 |
chr3_42892344_42892576 | 3.96 |
Gm38044 |
predicted gene, 38044 |
306861 |
0.01 |
chr3_18081478_18081714 | 3.96 |
Gm23726 |
predicted gene, 23726 |
12270 |
0.2 |
chr10_32052677_32052828 | 3.96 |
Gm18189 |
predicted gene, 18189 |
79083 |
0.11 |
chr7_91208624_91208818 | 3.95 |
Gm24552 |
predicted gene, 24552 |
34274 |
0.14 |
chr16_85887623_85888246 | 3.94 |
Adamts5 |
a disintegrin-like and metallopeptidase (reprolysin type) with thrombospondin type 1 motif, 5 (aggrecanase-2) |
13894 |
0.25 |
chr8_54991954_54992136 | 3.93 |
Gm45265 |
predicted gene 45265 |
13240 |
0.14 |
chr2_145724460_145724649 | 3.93 |
Gm11763 |
predicted gene 11763 |
22829 |
0.19 |
chr1_25229305_25229684 | 3.93 |
Adgrb3 |
adhesion G protein-coupled receptor B3 |
394 |
0.81 |
chr3_81025915_81026237 | 3.92 |
Gm42476 |
predicted gene 42476 |
6878 |
0.16 |
chr16_97002225_97002647 | 3.91 |
Gm32432 |
predicted gene, 32432 |
83679 |
0.1 |
chr1_143200289_143200505 | 3.90 |
Gm5835 |
predicted gene 5835 |
105781 |
0.08 |
chr1_9300669_9300959 | 3.90 |
Sntg1 |
syntrophin, gamma 1 |
936 |
0.56 |
chr17_67011980_67012161 | 3.90 |
Gm9984 |
predicted gene 9984 |
1585 |
0.39 |
chr6_36926604_36926923 | 3.89 |
1700111E14Rik |
RIKEN cDNA 1700111E14 gene |
10285 |
0.24 |
chr2_94122868_94123073 | 3.88 |
Hsd17b12 |
hydroxysteroid (17-beta) dehydrogenase 12 |
34923 |
0.14 |
chr11_71675778_71675956 | 3.87 |
Gm12324 |
predicted gene 12324 |
17390 |
0.15 |
chr1_79212604_79212783 | 3.87 |
Gm29536 |
predicted gene 29536 |
11818 |
0.3 |
chr1_25166550_25166701 | 3.82 |
Adgrb3 |
adhesion G protein-coupled receptor B3 |
38098 |
0.14 |
chr2_53437450_53438022 | 3.82 |
Gm13501 |
predicted gene 13501 |
39249 |
0.2 |
chr4_107823697_107823884 | 3.82 |
Lrp8 |
low density lipoprotein receptor-related protein 8, apolipoprotein e receptor |
629 |
0.42 |
chr4_63383069_63383259 | 3.80 |
Aknaos |
AT-hook transcription factor, opposite strand |
1806 |
0.21 |
chr8_127118543_127118714 | 3.79 |
Pard3 |
par-3 family cell polarity regulator |
45388 |
0.15 |
chr16_23518054_23518230 | 3.79 |
Gm45338 |
predicted gene 45338 |
2068 |
0.2 |
chr14_79905756_79905979 | 3.78 |
Gm49542 |
predicted gene, 49542 |
7400 |
0.17 |
chr16_72772461_72772624 | 3.78 |
Robo1 |
roundabout guidance receptor 1 |
109338 |
0.08 |
chr2_8467913_8468106 | 3.77 |
Gm13255 |
predicted gene 13255 |
165928 |
0.04 |
chr9_96260282_96260433 | 3.77 |
Tfdp2 |
transcription factor Dp 2 |
1072 |
0.49 |
chr10_40762804_40762992 | 3.75 |
Mettl24 |
methyltransferase like 24 |
79616 |
0.08 |
chr1_114862898_114863053 | 3.75 |
Gm4854 |
predicted gene 4854 |
356788 |
0.01 |
chr15_44331817_44332109 | 3.75 |
Gm19235 |
predicted gene, 19235 |
8851 |
0.17 |
chr1_126153911_126154172 | 3.74 |
Gm37936 |
predicted gene, 37936 |
82580 |
0.1 |
chr18_15391754_15391905 | 3.73 |
Aqp4 |
aquaporin 4 |
8173 |
0.2 |
chr5_76762265_76762416 | 3.73 |
C530008M17Rik |
RIKEN cDNA C530008M17 gene |
9972 |
0.2 |
chr13_110114248_110114399 | 3.73 |
Rab3c |
RAB3C, member RAS oncogene family |
165827 |
0.03 |
chr13_57671425_57671587 | 3.72 |
Spock1 |
sparc/osteonectin, cwcv and kazal-like domains proteoglycan 1 |
236081 |
0.02 |
chr3_107065578_107066003 | 3.72 |
A930002I21Rik |
RIKEN cDNA A930002I21 gene |
25090 |
0.12 |
chr3_10892120_10892293 | 3.72 |
Gm22795 |
predicted gene, 22795 |
83380 |
0.09 |
chr11_102898442_102898637 | 3.72 |
Gfap |
glial fibrillary acidic protein |
1339 |
0.27 |
chr5_97289441_97289719 | 3.72 |
Gm5560 |
predicted pseudogene 5560 |
24752 |
0.17 |
chr3_65125115_65125266 | 3.72 |
Kcnab1 |
potassium voltage-gated channel, shaker-related subfamily, beta member 1 |
15806 |
0.26 |
chr5_133156480_133156656 | 3.71 |
Gm42625 |
predicted gene 42625 |
286774 |
0.01 |
chrX_137806587_137806760 | 3.71 |
Il1rapl2 |
interleukin 1 receptor accessory protein-like 2 |
154953 |
0.04 |
chr14_24578363_24578849 | 3.70 |
4930542C16Rik |
RIKEN cDNA 4930542C16 gene |
38698 |
0.14 |
chr10_63839136_63839287 | 3.69 |
Ctnna3 |
catenin (cadherin associated protein), alpha 3 |
18156 |
0.27 |
chr16_96945757_96945908 | 3.69 |
Gm32432 |
predicted gene, 32432 |
27075 |
0.25 |
chr18_25678184_25678915 | 3.69 |
0710001A04Rik |
RIKEN cDNA 0710001A04 gene |
35221 |
0.19 |
chr5_91801698_91801849 | 3.68 |
Gm5558 |
predicted gene 5558 |
5300 |
0.14 |
chr6_6696153_6696335 | 3.67 |
Gm20618 |
predicted gene 20618 |
4723 |
0.23 |
chr14_13651648_13651848 | 3.67 |
Sntn |
sentan, cilia apical structure protein |
19128 |
0.24 |
chr13_18495548_18495699 | 3.67 |
Pou6f2 |
POU domain, class 6, transcription factor 2 |
97937 |
0.08 |
chr2_79456556_79457006 | 3.67 |
Cerkl |
ceramide kinase-like |
4 |
0.51 |
chr8_115154128_115154356 | 3.66 |
Gm22556 |
predicted gene, 22556 |
101329 |
0.09 |
chr12_36793777_36793975 | 3.66 |
Mir5099 |
microRNA 5099 |
22329 |
0.23 |
chr17_86266136_86266331 | 3.66 |
2010106C02Rik |
RIKEN cDNA 2010106C02 gene |
20945 |
0.23 |
chr17_64548433_64548833 | 3.66 |
AU016765 |
expressed sequence AU016765 |
6870 |
0.27 |
chr14_11428936_11429087 | 3.64 |
Gm48594 |
predicted gene, 48594 |
31348 |
0.14 |
chr5_85346095_85346568 | 3.63 |
Gm43567 |
predicted gene 43567 |
374443 |
0.01 |
chr16_67611348_67611518 | 3.62 |
Cadm2 |
cell adhesion molecule 2 |
9060 |
0.25 |
chr18_69579537_69579708 | 3.61 |
Tcf4 |
transcription factor 4 |
13366 |
0.24 |
chr14_113431343_113431494 | 3.60 |
Gm4487 |
predicted gene 4487 |
59242 |
0.16 |
chr7_137253886_137254145 | 3.59 |
Ebf3 |
early B cell factor 3 |
13523 |
0.18 |
chr4_150339045_150339230 | 3.59 |
Gm23209 |
predicted gene, 23209 |
17944 |
0.17 |
chr12_66889371_66889522 | 3.58 |
Gm18940 |
predicted gene, 18940 |
43856 |
0.16 |
chr2_48099294_48099480 | 3.57 |
Gm13471 |
predicted gene 13471 |
40759 |
0.22 |
chr12_84752353_84752677 | 3.57 |
Npc2 |
NPC intracellular cholesterol transporter 2 |
10025 |
0.15 |
chr9_27174095_27174444 | 3.57 |
Jam3 |
junction adhesion molecule 3 |
18848 |
0.17 |
chr13_110260754_110260905 | 3.57 |
Rab3c |
RAB3C, member RAS oncogene family |
19321 |
0.23 |
chr19_30107491_30107648 | 3.57 |
Uhrf2 |
ubiquitin-like, containing PHD and RING finger domains 2 |
15608 |
0.19 |
chr17_77889225_77889376 | 3.57 |
Gm4711 |
predicted gene 4711 |
201951 |
0.02 |
chr8_39021820_39022004 | 3.55 |
Tusc3 |
tumor suppressor candidate 3 |
16002 |
0.23 |
chr7_45872639_45873973 | 3.54 |
Kdelr1 |
KDEL (Lys-Asp-Glu-Leu) endoplasmic reticulum protein retention receptor 1 |
179 |
0.85 |
chr4_110229355_110229520 | 3.54 |
Elavl4 |
ELAV like RNA binding protein 4 |
6289 |
0.32 |
chr9_41149387_41149616 | 3.54 |
Ubash3b |
ubiquitin associated and SH3 domain containing, B |
8001 |
0.14 |
chr8_14748830_14749275 | 3.54 |
C030037F17Rik |
RIKEN cDNA C030037F17 gene |
1625 |
0.42 |
chr5_149503538_149503696 | 3.54 |
Gm2566 |
predicted gene 2566 |
565 |
0.68 |
chr12_24581110_24581274 | 3.52 |
Grhl1 |
grainyhead like transcription factor 1 |
443 |
0.82 |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
1.4 | 8.3 | GO:0045213 | neurotransmitter receptor metabolic process(GO:0045213) |
1.3 | 4.0 | GO:0099558 | maintenance of synapse structure(GO:0099558) |
1.3 | 3.9 | GO:0097118 | neuroligin clustering involved in postsynaptic membrane assembly(GO:0097118) |
1.1 | 3.4 | GO:0030421 | defecation(GO:0030421) |
1.0 | 5.2 | GO:0021780 | oligodendrocyte cell fate specification(GO:0021778) oligodendrocyte cell fate commitment(GO:0021779) glial cell fate specification(GO:0021780) |
1.0 | 1.0 | GO:0086073 | bundle of His cell-Purkinje myocyte adhesion involved in cell communication(GO:0086073) |
0.9 | 2.7 | GO:0015014 | heparan sulfate proteoglycan biosynthetic process, polysaccharide chain biosynthetic process(GO:0015014) |
0.9 | 2.7 | GO:1901078 | negative regulation of relaxation of muscle(GO:1901078) |
0.8 | 2.4 | GO:0060448 | dichotomous subdivision of terminal units involved in lung branching(GO:0060448) |
0.8 | 3.2 | GO:0007412 | axon target recognition(GO:0007412) |
0.7 | 2.2 | GO:1901843 | positive regulation of high voltage-gated calcium channel activity(GO:1901843) |
0.7 | 5.7 | GO:0021796 | cerebral cortex regionalization(GO:0021796) |
0.7 | 2.1 | GO:1900825 | regulation of membrane depolarization during cardiac muscle cell action potential(GO:1900825) |
0.7 | 2.7 | GO:0051581 | negative regulation of neurotransmitter uptake(GO:0051581) regulation of serotonin uptake(GO:0051611) negative regulation of serotonin uptake(GO:0051612) |
0.6 | 2.6 | GO:0038026 | reelin-mediated signaling pathway(GO:0038026) |
0.6 | 0.6 | GO:0021631 | optic nerve morphogenesis(GO:0021631) |
0.6 | 2.6 | GO:0071205 | protein localization to juxtaparanode region of axon(GO:0071205) |
0.6 | 3.1 | GO:0016199 | axon midline choice point recognition(GO:0016199) |
0.6 | 1.9 | GO:0034184 | positive regulation of maintenance of sister chromatid cohesion(GO:0034093) positive regulation of maintenance of mitotic sister chromatid cohesion(GO:0034184) |
0.6 | 2.5 | GO:0045404 | positive regulation of interleukin-4 biosynthetic process(GO:0045404) |
0.6 | 1.8 | GO:0071930 | negative regulation of transcription involved in G1/S transition of mitotic cell cycle(GO:0071930) |
0.6 | 1.7 | GO:2000474 | regulation of opioid receptor signaling pathway(GO:2000474) |
0.6 | 1.7 | GO:0060178 | regulation of exocyst localization(GO:0060178) |
0.5 | 2.2 | GO:0007023 | post-chaperonin tubulin folding pathway(GO:0007023) |
0.5 | 1.6 | GO:1902683 | regulation of receptor localization to synapse(GO:1902683) |
0.5 | 1.6 | GO:1903265 | positive regulation of tumor necrosis factor-mediated signaling pathway(GO:1903265) |
0.5 | 2.1 | GO:1901897 | regulation of relaxation of cardiac muscle(GO:1901897) |
0.5 | 2.0 | GO:0031117 | positive regulation of microtubule depolymerization(GO:0031117) |
0.5 | 1.0 | GO:1904714 | regulation of chaperone-mediated autophagy(GO:1904714) |
0.5 | 2.5 | GO:0060729 | intestinal epithelial structure maintenance(GO:0060729) |
0.5 | 2.9 | GO:0006621 | protein retention in ER lumen(GO:0006621) |
0.5 | 1.4 | GO:0015746 | tricarboxylic acid transport(GO:0006842) citrate transport(GO:0015746) |
0.5 | 1.9 | GO:0030035 | microspike assembly(GO:0030035) |
0.5 | 3.7 | GO:0097120 | receptor localization to synapse(GO:0097120) |
0.5 | 1.8 | GO:0007171 | activation of transmembrane receptor protein tyrosine kinase activity(GO:0007171) |
0.4 | 1.7 | GO:2001013 | epithelial cell proliferation involved in renal tubule morphogenesis(GO:2001013) |
0.4 | 2.1 | GO:0061588 | calcium activated phospholipid scrambling(GO:0061588) calcium activated phosphatidylcholine scrambling(GO:0061590) calcium activated galactosylceramide scrambling(GO:0061591) |
0.4 | 0.8 | GO:0070094 | positive regulation of glucagon secretion(GO:0070094) |
0.4 | 1.3 | GO:1904016 | response to Thyroglobulin triiodothyronine(GO:1904016) cellular response to Thyroglobulin triiodothyronine(GO:1904017) |
0.4 | 2.4 | GO:0031915 | positive regulation of synaptic plasticity(GO:0031915) |
0.4 | 2.8 | GO:0042760 | very long-chain fatty acid catabolic process(GO:0042760) |
0.4 | 3.1 | GO:0000083 | regulation of transcription involved in G1/S transition of mitotic cell cycle(GO:0000083) |
0.4 | 1.2 | GO:0070649 | formin-nucleated actin cable assembly(GO:0070649) |
0.4 | 1.2 | GO:0043490 | malate-aspartate shuttle(GO:0043490) |
0.4 | 3.8 | GO:0042448 | progesterone metabolic process(GO:0042448) |
0.4 | 0.7 | GO:0003358 | noradrenergic neuron development(GO:0003358) |
0.4 | 0.7 | GO:0090258 | negative regulation of mitochondrial fission(GO:0090258) |
0.4 | 1.8 | GO:0031339 | negative regulation of vesicle fusion(GO:0031339) |
0.4 | 3.2 | GO:0031536 | positive regulation of exit from mitosis(GO:0031536) |
0.4 | 1.1 | GO:0006597 | spermine biosynthetic process(GO:0006597) |
0.3 | 2.8 | GO:0021860 | pyramidal neuron development(GO:0021860) |
0.3 | 1.4 | GO:0036135 | Schwann cell migration(GO:0036135) regulation of Schwann cell migration(GO:1900147) |
0.3 | 1.0 | GO:0030070 | insulin processing(GO:0030070) |
0.3 | 1.0 | GO:0018002 | N-terminal peptidyl-serine acetylation(GO:0017198) N-terminal peptidyl-glutamic acid acetylation(GO:0018002) peptidyl-serine acetylation(GO:0030920) |
0.3 | 1.6 | GO:0000160 | phosphorelay signal transduction system(GO:0000160) |
0.3 | 1.6 | GO:0098598 | vocal learning(GO:0042297) imitative learning(GO:0098596) learned vocalization behavior or vocal learning(GO:0098598) |
0.3 | 0.7 | GO:0009449 | gamma-aminobutyric acid biosynthetic process(GO:0009449) |
0.3 | 1.0 | GO:0071651 | positive regulation of chemokine (C-C motif) ligand 5 production(GO:0071651) |
0.3 | 1.3 | GO:0048496 | maintenance of organ identity(GO:0048496) |
0.3 | 2.9 | GO:0016338 | calcium-independent cell-cell adhesion via plasma membrane cell-adhesion molecules(GO:0016338) |
0.3 | 1.6 | GO:0021764 | amygdala development(GO:0021764) |
0.3 | 0.6 | GO:1900451 | positive regulation of glutamate receptor signaling pathway(GO:1900451) positive regulation of alpha-amino-3-hydroxy-5-methyl-4-isoxazole propionate selective glutamate receptor activity(GO:2000969) |
0.3 | 0.9 | GO:0051582 | positive regulation of neurotransmitter uptake(GO:0051582) positive regulation of dopamine uptake involved in synaptic transmission(GO:0051586) positive regulation of catecholamine uptake involved in synaptic transmission(GO:0051944) |
0.3 | 3.7 | GO:0006198 | cAMP catabolic process(GO:0006198) |
0.3 | 0.6 | GO:0061502 | early endosome to recycling endosome transport(GO:0061502) |
0.3 | 0.6 | GO:0018171 | peptidyl-cysteine oxidation(GO:0018171) |
0.3 | 1.8 | GO:1903551 | regulation of extracellular exosome assembly(GO:1903551) |
0.3 | 1.2 | GO:0051964 | negative regulation of synapse assembly(GO:0051964) |
0.3 | 0.9 | GO:0032483 | regulation of Rab protein signal transduction(GO:0032483) |
0.3 | 1.4 | GO:0021869 | forebrain ventricular zone progenitor cell division(GO:0021869) |
0.3 | 0.6 | GO:0050923 | regulation of negative chemotaxis(GO:0050923) |
0.3 | 0.8 | GO:0042126 | nitrate metabolic process(GO:0042126) |
0.3 | 0.8 | GO:1903061 | positive regulation of protein lipidation(GO:1903061) |
0.3 | 0.3 | GO:0003431 | growth plate cartilage chondrocyte development(GO:0003431) |
0.3 | 0.5 | GO:0007354 | zygotic determination of anterior/posterior axis, embryo(GO:0007354) |
0.3 | 1.0 | GO:2000667 | positive regulation of interleukin-5 secretion(GO:2000664) positive regulation of interleukin-13 secretion(GO:2000667) |
0.3 | 0.8 | GO:0003223 | ventricular compact myocardium morphogenesis(GO:0003223) |
0.3 | 2.6 | GO:0002934 | desmosome organization(GO:0002934) |
0.3 | 1.0 | GO:0009211 | pyrimidine deoxyribonucleoside triphosphate metabolic process(GO:0009211) |
0.3 | 0.8 | GO:1902101 | positive regulation of mitotic metaphase/anaphase transition(GO:0045842) positive regulation of metaphase/anaphase transition of cell cycle(GO:1902101) |
0.3 | 0.3 | GO:0072611 | interleukin-5 secretion(GO:0072603) interleukin-13 secretion(GO:0072611) regulation of interleukin-5 secretion(GO:2000662) regulation of interleukin-13 secretion(GO:2000665) |
0.3 | 1.8 | GO:0005513 | detection of calcium ion(GO:0005513) |
0.3 | 1.0 | GO:0038165 | oncostatin-M-mediated signaling pathway(GO:0038165) |
0.3 | 1.0 | GO:0051725 | protein de-ADP-ribosylation(GO:0051725) |
0.2 | 1.7 | GO:0021957 | corticospinal tract morphogenesis(GO:0021957) |
0.2 | 0.5 | GO:0045715 | negative regulation of low-density lipoprotein particle receptor biosynthetic process(GO:0045715) |
0.2 | 1.7 | GO:1900246 | positive regulation of RIG-I signaling pathway(GO:1900246) |
0.2 | 0.2 | GO:0030241 | skeletal muscle myosin thick filament assembly(GO:0030241) striated muscle myosin thick filament assembly(GO:0071688) |
0.2 | 1.5 | GO:0090370 | negative regulation of cholesterol efflux(GO:0090370) |
0.2 | 1.2 | GO:0060074 | synapse maturation(GO:0060074) |
0.2 | 1.0 | GO:0006432 | phenylalanyl-tRNA aminoacylation(GO:0006432) |
0.2 | 0.9 | GO:0032929 | negative regulation of superoxide anion generation(GO:0032929) |
0.2 | 0.9 | GO:0089711 | L-glutamate transmembrane transport(GO:0089711) |
0.2 | 1.4 | GO:0006930 | substrate-dependent cell migration, cell extension(GO:0006930) |
0.2 | 0.7 | GO:0072137 | condensed mesenchymal cell proliferation(GO:0072137) |
0.2 | 1.2 | GO:0010572 | positive regulation of platelet activation(GO:0010572) |
0.2 | 0.7 | GO:0018076 | N-terminal peptidyl-lysine acetylation(GO:0018076) |
0.2 | 1.6 | GO:1901660 | calcium ion export(GO:1901660) |
0.2 | 0.5 | GO:0042435 | indole-containing compound biosynthetic process(GO:0042435) |
0.2 | 0.9 | GO:0001915 | negative regulation of T cell mediated cytotoxicity(GO:0001915) |
0.2 | 1.6 | GO:1902237 | positive regulation of endoplasmic reticulum stress-induced intrinsic apoptotic signaling pathway(GO:1902237) |
0.2 | 1.1 | GO:0048852 | diencephalon morphogenesis(GO:0048852) |
0.2 | 0.9 | GO:0090043 | regulation of tubulin deacetylation(GO:0090043) |
0.2 | 0.9 | GO:0046959 | habituation(GO:0046959) |
0.2 | 0.7 | GO:0061091 | regulation of phospholipid translocation(GO:0061091) positive regulation of phospholipid translocation(GO:0061092) |
0.2 | 0.9 | GO:0060174 | limb bud formation(GO:0060174) |
0.2 | 0.4 | GO:0072050 | S-shaped body morphogenesis(GO:0072050) |
0.2 | 0.6 | GO:0046167 | glycerol-3-phosphate biosynthetic process(GO:0046167) |
0.2 | 0.4 | GO:0016198 | axon choice point recognition(GO:0016198) |
0.2 | 0.6 | GO:0007525 | somatic muscle development(GO:0007525) |
0.2 | 0.4 | GO:0070672 | response to interleukin-15(GO:0070672) |
0.2 | 0.4 | GO:2000224 | regulation of testosterone biosynthetic process(GO:2000224) |
0.2 | 0.8 | GO:1903142 | positive regulation of endothelial cell development(GO:1901552) positive regulation of establishment of endothelial barrier(GO:1903142) |
0.2 | 0.6 | GO:0030950 | establishment or maintenance of actin cytoskeleton polarity(GO:0030950) |
0.2 | 1.2 | GO:0071625 | vocalization behavior(GO:0071625) |
0.2 | 1.2 | GO:0032229 | negative regulation of synaptic transmission, GABAergic(GO:0032229) |
0.2 | 0.2 | GO:0050862 | positive regulation of T cell receptor signaling pathway(GO:0050862) |
0.2 | 0.8 | GO:1901341 | activation of store-operated calcium channel activity(GO:0032237) positive regulation of store-operated calcium channel activity(GO:1901341) |
0.2 | 0.8 | GO:0007621 | negative regulation of female receptivity(GO:0007621) |
0.2 | 0.4 | GO:0070447 | positive regulation of oligodendrocyte progenitor proliferation(GO:0070447) |
0.2 | 0.8 | GO:0090273 | regulation of somatostatin secretion(GO:0090273) |
0.2 | 0.6 | GO:0021824 | cerebral cortex tangential migration using cell-axon interactions(GO:0021824) gonadotrophin-releasing hormone neuronal migration to the hypothalamus(GO:0021828) hypothalamic tangential migration using cell-axon interactions(GO:0021856) facioacoustic ganglion development(GO:1903375) |
0.2 | 0.6 | GO:0045041 | protein import into mitochondrial intermembrane space(GO:0045041) |
0.2 | 0.6 | GO:0032914 | positive regulation of transforming growth factor beta1 production(GO:0032914) |
0.2 | 0.6 | GO:1904694 | negative regulation of vascular smooth muscle contraction(GO:1904694) |
0.2 | 0.7 | GO:0015015 | heparan sulfate proteoglycan biosynthetic process, enzymatic modification(GO:0015015) |
0.2 | 0.6 | GO:0035995 | detection of muscle stretch(GO:0035995) |
0.2 | 0.6 | GO:0001927 | exocyst assembly(GO:0001927) |
0.2 | 0.2 | GO:1903207 | neuron death in response to hydrogen peroxide(GO:0036476) regulation of hydrogen peroxide-induced neuron death(GO:1903207) negative regulation of hydrogen peroxide-induced neuron death(GO:1903208) |
0.2 | 0.2 | GO:0070885 | negative regulation of calcineurin-NFAT signaling cascade(GO:0070885) |
0.2 | 0.7 | GO:2001187 | positive regulation of CD8-positive, alpha-beta T cell activation(GO:2001187) |
0.2 | 1.8 | GO:0001504 | neurotransmitter uptake(GO:0001504) |
0.2 | 0.5 | GO:0021586 | pons maturation(GO:0021586) |
0.2 | 0.7 | GO:0046292 | formaldehyde metabolic process(GO:0046292) |
0.2 | 0.5 | GO:0014878 | response to electrical stimulus involved in regulation of muscle adaptation(GO:0014878) |
0.2 | 0.5 | GO:0015889 | cobalamin transport(GO:0015889) |
0.2 | 0.5 | GO:0001732 | formation of cytoplasmic translation initiation complex(GO:0001732) |
0.2 | 1.3 | GO:1902369 | negative regulation of RNA catabolic process(GO:1902369) |
0.2 | 0.2 | GO:0097051 | establishment of protein localization to endoplasmic reticulum membrane(GO:0097051) |
0.2 | 0.4 | GO:2000370 | positive regulation of clathrin-mediated endocytosis(GO:2000370) |
0.2 | 0.7 | GO:0002913 | positive regulation of T cell anergy(GO:0002669) positive regulation of lymphocyte anergy(GO:0002913) |
0.2 | 0.2 | GO:0021698 | cerebellar cortex structural organization(GO:0021698) |
0.2 | 0.7 | GO:0007638 | mechanosensory behavior(GO:0007638) |
0.2 | 1.8 | GO:0031987 | locomotion involved in locomotory behavior(GO:0031987) |
0.2 | 0.2 | GO:2000172 | regulation of branching morphogenesis of a nerve(GO:2000172) |
0.2 | 0.7 | GO:0034239 | regulation of macrophage fusion(GO:0034239) |
0.2 | 0.5 | GO:2001280 | positive regulation of prostaglandin biosynthetic process(GO:0031394) positive regulation of unsaturated fatty acid biosynthetic process(GO:2001280) |
0.2 | 0.5 | GO:0016584 | nucleosome positioning(GO:0016584) |
0.2 | 0.7 | GO:0006537 | glutamate biosynthetic process(GO:0006537) |
0.2 | 1.4 | GO:0002318 | myeloid progenitor cell differentiation(GO:0002318) |
0.2 | 0.7 | GO:0000733 | DNA strand renaturation(GO:0000733) |
0.2 | 0.5 | GO:1900748 | positive regulation of vascular endothelial growth factor signaling pathway(GO:1900748) |
0.2 | 1.5 | GO:0001867 | complement activation, lectin pathway(GO:0001867) |
0.2 | 0.8 | GO:2000096 | positive regulation of Wnt signaling pathway, planar cell polarity pathway(GO:2000096) |
0.2 | 2.0 | GO:0046855 | inositol phosphate dephosphorylation(GO:0046855) |
0.2 | 1.8 | GO:0021694 | cerebellar Purkinje cell layer formation(GO:0021694) |
0.2 | 0.5 | GO:0060060 | post-embryonic retina morphogenesis in camera-type eye(GO:0060060) |
0.2 | 1.0 | GO:0097067 | cellular response to thyroid hormone stimulus(GO:0097067) |
0.2 | 0.5 | GO:1901301 | regulation of cargo loading into COPII-coated vesicle(GO:1901301) |
0.2 | 0.8 | GO:0010032 | meiotic chromosome condensation(GO:0010032) |
0.2 | 0.3 | GO:0051660 | establishment of centrosome localization(GO:0051660) |
0.2 | 0.8 | GO:0045542 | positive regulation of cholesterol biosynthetic process(GO:0045542) positive regulation of cholesterol metabolic process(GO:0090205) |
0.2 | 0.8 | GO:1903715 | regulation of aerobic respiration(GO:1903715) |
0.2 | 0.5 | GO:0030240 | skeletal muscle thin filament assembly(GO:0030240) |
0.2 | 3.8 | GO:0006376 | mRNA splice site selection(GO:0006376) |
0.2 | 1.3 | GO:0071361 | cellular response to ethanol(GO:0071361) |
0.2 | 0.3 | GO:0048022 | negative regulation of melanin biosynthetic process(GO:0048022) negative regulation of secondary metabolite biosynthetic process(GO:1900377) |
0.2 | 3.1 | GO:0031114 | regulation of microtubule depolymerization(GO:0031114) |
0.2 | 1.0 | GO:0051418 | interphase microtubule nucleation by interphase microtubule organizing center(GO:0051415) microtubule nucleation by microtubule organizing center(GO:0051418) |
0.2 | 0.2 | GO:0038108 | negative regulation of appetite by leptin-mediated signaling pathway(GO:0038108) |
0.2 | 1.3 | GO:0046548 | retinal rod cell development(GO:0046548) |
0.2 | 0.8 | GO:0045162 | clustering of voltage-gated sodium channels(GO:0045162) |
0.2 | 0.3 | GO:0021564 | vagus nerve development(GO:0021564) |
0.2 | 1.3 | GO:0021542 | dentate gyrus development(GO:0021542) |
0.2 | 0.5 | GO:0032066 | nucleolus to nucleoplasm transport(GO:0032066) |
0.2 | 0.5 | GO:0032497 | detection of lipopolysaccharide(GO:0032497) |
0.2 | 0.5 | GO:0019254 | carnitine metabolic process, CoA-linked(GO:0019254) |
0.2 | 0.2 | GO:1900041 | negative regulation of interleukin-2 secretion(GO:1900041) |
0.2 | 0.6 | GO:0045631 | regulation of auditory receptor cell differentiation(GO:0045607) regulation of mechanoreceptor differentiation(GO:0045631) regulation of inner ear receptor cell differentiation(GO:2000980) |
0.2 | 0.2 | GO:0006524 | alanine catabolic process(GO:0006524) pyruvate family amino acid catabolic process(GO:0009080) |
0.2 | 0.9 | GO:0021684 | cerebellar granular layer formation(GO:0021684) cerebellar granule cell differentiation(GO:0021707) |
0.2 | 0.6 | GO:1901628 | positive regulation of postsynaptic membrane organization(GO:1901628) positive regulation of receptor clustering(GO:1903911) regulation of skeletal muscle acetylcholine-gated channel clustering(GO:1904393) positive regulation of skeletal muscle acetylcholine-gated channel clustering(GO:1904395) positive regulation of neuromuscular junction development(GO:1904398) |
0.2 | 0.5 | GO:0060126 | somatotropin secreting cell differentiation(GO:0060126) |
0.2 | 0.3 | GO:0030576 | Cajal body organization(GO:0030576) |
0.2 | 0.6 | GO:0016560 | protein import into peroxisome matrix, docking(GO:0016560) |
0.2 | 1.1 | GO:1902018 | negative regulation of cilium assembly(GO:1902018) |
0.2 | 0.3 | GO:1905049 | negative regulation of metalloendopeptidase activity(GO:1904684) negative regulation of metallopeptidase activity(GO:1905049) |
0.2 | 0.5 | GO:0071492 | cellular response to UV-A(GO:0071492) |
0.2 | 0.8 | GO:1904667 | negative regulation of ubiquitin protein ligase activity(GO:1904667) |
0.2 | 0.5 | GO:0048682 | axon extension involved in regeneration(GO:0048677) sprouting of injured axon(GO:0048682) |
0.1 | 0.4 | GO:0045658 | regulation of neutrophil differentiation(GO:0045658) |
0.1 | 0.4 | GO:1901841 | regulation of high voltage-gated calcium channel activity(GO:1901841) |
0.1 | 2.1 | GO:0072505 | divalent inorganic anion homeostasis(GO:0072505) |
0.1 | 2.2 | GO:0010842 | retina layer formation(GO:0010842) |
0.1 | 0.7 | GO:0016188 | synaptic vesicle maturation(GO:0016188) |
0.1 | 0.1 | GO:0089700 | protein kinase D signaling(GO:0089700) |
0.1 | 0.6 | GO:0035627 | ceramide transport(GO:0035627) |
0.1 | 0.3 | GO:0035751 | regulation of lysosomal lumen pH(GO:0035751) |
0.1 | 0.9 | GO:0048194 | Golgi vesicle budding(GO:0048194) |
0.1 | 1.3 | GO:0045292 | mRNA cis splicing, via spliceosome(GO:0045292) |
0.1 | 0.1 | GO:1903690 | negative regulation of wound healing, spreading of epidermal cells(GO:1903690) |
0.1 | 1.8 | GO:0006515 | misfolded or incompletely synthesized protein catabolic process(GO:0006515) |
0.1 | 0.4 | GO:0006203 | dGTP catabolic process(GO:0006203) |
0.1 | 0.8 | GO:0001672 | regulation of chromatin assembly or disassembly(GO:0001672) |
0.1 | 0.3 | GO:0070574 | cadmium ion transport(GO:0015691) cadmium ion transmembrane transport(GO:0070574) |
0.1 | 0.4 | GO:0006624 | vacuolar protein processing(GO:0006624) |
0.1 | 1.0 | GO:1900103 | positive regulation of endoplasmic reticulum unfolded protein response(GO:1900103) |
0.1 | 1.0 | GO:0021999 | neural plate anterior/posterior regionalization(GO:0021999) |
0.1 | 0.6 | GO:0051697 | protein delipidation(GO:0051697) |
0.1 | 0.8 | GO:0060467 | negative regulation of fertilization(GO:0060467) |
0.1 | 0.8 | GO:0007221 | positive regulation of transcription of Notch receptor target(GO:0007221) |
0.1 | 1.0 | GO:0070995 | NADPH oxidation(GO:0070995) |
0.1 | 0.7 | GO:0031293 | membrane protein intracellular domain proteolysis(GO:0031293) |
0.1 | 0.6 | GO:0060689 | cell differentiation involved in salivary gland development(GO:0060689) |
0.1 | 1.6 | GO:0021680 | cerebellar Purkinje cell layer development(GO:0021680) |
0.1 | 0.5 | GO:0044004 | killing by symbiont of host cells(GO:0001907) disruption by symbiont of host cell(GO:0044004) |
0.1 | 0.1 | GO:0033088 | negative regulation of immature T cell proliferation in thymus(GO:0033088) |
0.1 | 1.1 | GO:2000310 | regulation of N-methyl-D-aspartate selective glutamate receptor activity(GO:2000310) |
0.1 | 0.5 | GO:0010756 | positive regulation of plasminogen activation(GO:0010756) |
0.1 | 0.9 | GO:0060352 | cell adhesion molecule production(GO:0060352) |
0.1 | 0.5 | GO:0021873 | forebrain neuroblast division(GO:0021873) |
0.1 | 0.4 | GO:0006419 | alanyl-tRNA aminoacylation(GO:0006419) |
0.1 | 0.4 | GO:0006546 | glycine catabolic process(GO:0006546) glycine decarboxylation via glycine cleavage system(GO:0019464) |
0.1 | 0.4 | GO:1900108 | negative regulation of nodal signaling pathway(GO:1900108) |
0.1 | 0.4 | GO:0002322 | B cell proliferation involved in immune response(GO:0002322) |
0.1 | 1.0 | GO:0042428 | serotonin metabolic process(GO:0042428) |
0.1 | 0.1 | GO:0042699 | follicle-stimulating hormone signaling pathway(GO:0042699) |
0.1 | 1.4 | GO:0090231 | regulation of spindle checkpoint(GO:0090231) |
0.1 | 0.4 | GO:0046121 | deoxyribonucleoside catabolic process(GO:0046121) |
0.1 | 0.1 | GO:1901492 | positive regulation of lymphangiogenesis(GO:1901492) |
0.1 | 3.7 | GO:0021766 | hippocampus development(GO:0021766) |
0.1 | 1.5 | GO:0031442 | positive regulation of mRNA 3'-end processing(GO:0031442) |
0.1 | 3.1 | GO:0048821 | erythrocyte development(GO:0048821) |
0.1 | 1.0 | GO:0008090 | retrograde axonal transport(GO:0008090) |
0.1 | 0.3 | GO:1900109 | regulation of histone H3-K9 dimethylation(GO:1900109) |
0.1 | 1.4 | GO:0007216 | G-protein coupled glutamate receptor signaling pathway(GO:0007216) |
0.1 | 0.4 | GO:0000492 | small nucleolar ribonucleoprotein complex assembly(GO:0000491) box C/D snoRNP assembly(GO:0000492) |
0.1 | 0.3 | GO:2001054 | regulation of mesenchymal cell apoptotic process(GO:2001053) negative regulation of mesenchymal cell apoptotic process(GO:2001054) |
0.1 | 0.2 | GO:0061153 | trachea submucosa development(GO:0061152) trachea gland development(GO:0061153) |
0.1 | 0.4 | GO:0030382 | sperm mitochondrion organization(GO:0030382) |
0.1 | 0.5 | GO:0032252 | secretory granule localization(GO:0032252) |
0.1 | 0.2 | GO:0071883 | activation of MAPK activity by adrenergic receptor signaling pathway(GO:0071883) |
0.1 | 1.7 | GO:0006828 | manganese ion transport(GO:0006828) |
0.1 | 0.5 | GO:0019482 | beta-alanine metabolic process(GO:0019482) |
0.1 | 0.6 | GO:0008291 | acetylcholine metabolic process(GO:0008291) acetate ester metabolic process(GO:1900619) |
0.1 | 0.2 | GO:0097475 | motor neuron migration(GO:0097475) spinal cord motor neuron migration(GO:0097476) |
0.1 | 0.9 | GO:0019368 | fatty acid elongation, saturated fatty acid(GO:0019367) fatty acid elongation, unsaturated fatty acid(GO:0019368) fatty acid elongation, monounsaturated fatty acid(GO:0034625) fatty acid elongation, polyunsaturated fatty acid(GO:0034626) |
0.1 | 0.5 | GO:0048341 | paraxial mesoderm formation(GO:0048341) |
0.1 | 0.7 | GO:0006703 | estrogen biosynthetic process(GO:0006703) |
0.1 | 0.5 | GO:0070126 | mitochondrial translational termination(GO:0070126) |
0.1 | 0.4 | GO:0051684 | maintenance of Golgi location(GO:0051684) |
0.1 | 0.7 | GO:0031571 | mitotic G1 DNA damage checkpoint(GO:0031571) |
0.1 | 1.0 | GO:1903817 | negative regulation of delayed rectifier potassium channel activity(GO:1902260) negative regulation of voltage-gated potassium channel activity(GO:1903817) |
0.1 | 0.7 | GO:0071435 | potassium ion export(GO:0071435) |
0.1 | 8.5 | GO:0010923 | negative regulation of phosphatase activity(GO:0010923) |
0.1 | 0.4 | GO:0072051 | juxtaglomerular apparatus development(GO:0072051) |
0.1 | 0.2 | GO:1902261 | positive regulation of delayed rectifier potassium channel activity(GO:1902261) positive regulation of voltage-gated potassium channel activity(GO:1903818) |
0.1 | 0.7 | GO:0051574 | positive regulation of histone H3-K9 methylation(GO:0051574) |
0.1 | 0.4 | GO:0036444 | calcium ion transmembrane import into mitochondrion(GO:0036444) |
0.1 | 0.2 | GO:1900222 | negative regulation of beta-amyloid clearance(GO:1900222) |
0.1 | 0.4 | GO:0071596 | ubiquitin-dependent protein catabolic process via the N-end rule pathway(GO:0071596) |
0.1 | 0.4 | GO:0051466 | positive regulation of corticotropin-releasing hormone secretion(GO:0051466) |
0.1 | 0.1 | GO:1905005 | regulation of epithelial to mesenchymal transition involved in endocardial cushion formation(GO:1905005) |
0.1 | 0.4 | GO:0010996 | response to auditory stimulus(GO:0010996) |
0.1 | 0.1 | GO:0034136 | negative regulation of toll-like receptor 2 signaling pathway(GO:0034136) |
0.1 | 0.4 | GO:0000710 | meiotic mismatch repair(GO:0000710) |
0.1 | 0.5 | GO:0052405 | modulation of molecular function in other organism(GO:0044359) negative regulation of molecular function in other organism(GO:0044362) negative regulation of molecular function in other organism involved in symbiotic interaction(GO:0052204) modulation of molecular function in other organism involved in symbiotic interaction(GO:0052205) negative regulation by host of symbiont molecular function(GO:0052405) modification by host of symbiont molecular function(GO:0052428) |
0.1 | 0.3 | GO:1903887 | motile primary cilium assembly(GO:1903887) |
0.1 | 0.2 | GO:0045914 | negative regulation of catecholamine metabolic process(GO:0045914) negative regulation of dopamine metabolic process(GO:0045963) |
0.1 | 0.3 | GO:0006772 | thiamine metabolic process(GO:0006772) thiamine-containing compound metabolic process(GO:0042723) |
0.1 | 0.3 | GO:0007182 | common-partner SMAD protein phosphorylation(GO:0007182) |
0.1 | 0.1 | GO:0019896 | axonal transport of mitochondrion(GO:0019896) |
0.1 | 0.5 | GO:0034638 | phosphatidylcholine catabolic process(GO:0034638) |
0.1 | 0.2 | GO:0051562 | negative regulation of mitochondrial calcium ion concentration(GO:0051562) |
0.1 | 0.8 | GO:0035745 | T-helper 2 cell cytokine production(GO:0035745) |
0.1 | 0.3 | GO:0006363 | termination of RNA polymerase I transcription(GO:0006363) |
0.1 | 0.2 | GO:0097119 | postsynaptic density protein 95 clustering(GO:0097119) |
0.1 | 1.0 | GO:0060294 | cilium movement involved in cell motility(GO:0060294) |
0.1 | 0.8 | GO:0046784 | viral mRNA export from host cell nucleus(GO:0046784) |
0.1 | 0.2 | GO:0090272 | negative regulation of fibroblast growth factor production(GO:0090272) |
0.1 | 0.1 | GO:0001698 | gastrin-induced gastric acid secretion(GO:0001698) |
0.1 | 0.2 | GO:0060385 | axonogenesis involved in innervation(GO:0060385) |
0.1 | 0.7 | GO:0070544 | histone H3-K36 demethylation(GO:0070544) |
0.1 | 0.8 | GO:0006620 | posttranslational protein targeting to membrane(GO:0006620) |
0.1 | 0.4 | GO:0033133 | positive regulation of glucokinase activity(GO:0033133) |
0.1 | 1.1 | GO:0035493 | SNARE complex assembly(GO:0035493) |
0.1 | 0.5 | GO:0042985 | negative regulation of amyloid precursor protein biosynthetic process(GO:0042985) |
0.1 | 0.3 | GO:0030208 | dermatan sulfate biosynthetic process(GO:0030208) |
0.1 | 1.1 | GO:0046599 | regulation of centriole replication(GO:0046599) |
0.1 | 0.4 | GO:2001023 | regulation of response to drug(GO:2001023) |
0.1 | 0.2 | GO:0051572 | negative regulation of histone H3-K4 methylation(GO:0051572) |
0.1 | 0.9 | GO:0032509 | endosome transport via multivesicular body sorting pathway(GO:0032509) |
0.1 | 2.3 | GO:0035058 | nonmotile primary cilium assembly(GO:0035058) |
0.1 | 0.3 | GO:0018242 | protein O-linked glycosylation via serine(GO:0018242) |
0.1 | 0.1 | GO:0010424 | DNA methylation on cytosine within a CG sequence(GO:0010424) DNA methylation on cytosine(GO:0032776) |
0.1 | 0.2 | GO:0032025 | response to cobalt ion(GO:0032025) |
0.1 | 0.2 | GO:0046826 | negative regulation of protein export from nucleus(GO:0046826) |
0.1 | 0.1 | GO:0036265 | RNA (guanine-N7)-methylation(GO:0036265) |
0.1 | 0.9 | GO:0009312 | oligosaccharide biosynthetic process(GO:0009312) |
0.1 | 0.3 | GO:0007597 | blood coagulation, intrinsic pathway(GO:0007597) |
0.1 | 0.2 | GO:0070669 | response to interleukin-2(GO:0070669) |
0.1 | 0.2 | GO:0086023 | adrenergic receptor signaling pathway involved in heart process(GO:0086023) |
0.1 | 0.2 | GO:1903977 | positive regulation of glial cell migration(GO:1903977) |
0.1 | 1.1 | GO:0006957 | complement activation, alternative pathway(GO:0006957) |
0.1 | 0.7 | GO:1900016 | negative regulation of cytokine production involved in inflammatory response(GO:1900016) |
0.1 | 0.3 | GO:0048664 | neuron fate determination(GO:0048664) |
0.1 | 0.2 | GO:0006987 | activation of signaling protein activity involved in unfolded protein response(GO:0006987) |
0.1 | 0.4 | GO:0097428 | protein maturation by iron-sulfur cluster transfer(GO:0097428) |
0.1 | 0.3 | GO:0097105 | presynaptic membrane assembly(GO:0097105) |
0.1 | 0.4 | GO:0019919 | peptidyl-arginine methylation, to asymmetrical-dimethyl arginine(GO:0019919) |
0.1 | 0.3 | GO:0090403 | oxidative stress-induced premature senescence(GO:0090403) |
0.1 | 0.4 | GO:0033131 | regulation of glucokinase activity(GO:0033131) |
0.1 | 0.3 | GO:0019805 | quinolinate biosynthetic process(GO:0019805) |
0.1 | 0.1 | GO:0045759 | negative regulation of action potential(GO:0045759) |
0.1 | 0.2 | GO:0021794 | thalamus development(GO:0021794) |
0.1 | 0.9 | GO:0006490 | oligosaccharide-lipid intermediate biosynthetic process(GO:0006490) |
0.1 | 0.2 | GO:0031296 | B cell costimulation(GO:0031296) |
0.1 | 0.8 | GO:0042753 | positive regulation of circadian rhythm(GO:0042753) |
0.1 | 0.2 | GO:0010649 | regulation of cell communication by electrical coupling(GO:0010649) |
0.1 | 1.3 | GO:0051205 | protein insertion into membrane(GO:0051205) |
0.1 | 0.5 | GO:0000185 | activation of MAPKKK activity(GO:0000185) |
0.1 | 0.4 | GO:0019478 | D-amino acid catabolic process(GO:0019478) |
0.1 | 0.1 | GO:0070100 | negative regulation of chemokine-mediated signaling pathway(GO:0070100) |
0.1 | 0.5 | GO:1903054 | negative regulation of extracellular matrix organization(GO:1903054) |
0.1 | 0.1 | GO:0008594 | photoreceptor cell morphogenesis(GO:0008594) |
0.1 | 1.4 | GO:0044458 | motile cilium assembly(GO:0044458) |
0.1 | 0.1 | GO:0021773 | striatal medium spiny neuron differentiation(GO:0021773) |
0.1 | 0.7 | GO:0045199 | maintenance of epithelial cell apical/basal polarity(GO:0045199) |
0.1 | 0.4 | GO:0070535 | histone H2A K63-linked ubiquitination(GO:0070535) |
0.1 | 0.5 | GO:0046501 | protoporphyrinogen IX metabolic process(GO:0046501) |
0.1 | 1.6 | GO:1902017 | regulation of cilium assembly(GO:1902017) |
0.1 | 0.3 | GO:1904378 | maintenance of unfolded protein(GO:0036506) maintenance of unfolded protein involved in ERAD pathway(GO:1904378) |
0.1 | 0.4 | GO:0060623 | regulation of chromosome condensation(GO:0060623) |
0.1 | 0.4 | GO:1903672 | positive regulation of sprouting angiogenesis(GO:1903672) |
0.1 | 0.6 | GO:0046654 | tetrahydrofolate biosynthetic process(GO:0046654) |
0.1 | 2.1 | GO:0034198 | cellular response to amino acid starvation(GO:0034198) |
0.1 | 0.1 | GO:0015842 | aminergic neurotransmitter loading into synaptic vesicle(GO:0015842) neurotransmitter loading into synaptic vesicle(GO:0098700) |
0.1 | 0.2 | GO:0071394 | cellular response to testosterone stimulus(GO:0071394) |
0.1 | 0.7 | GO:0032099 | negative regulation of appetite(GO:0032099) |
0.1 | 0.6 | GO:1901223 | negative regulation of NIK/NF-kappaB signaling(GO:1901223) |
0.1 | 0.1 | GO:0060594 | mammary gland specification(GO:0060594) |
0.1 | 0.4 | GO:0043987 | histone H3-S10 phosphorylation(GO:0043987) |
0.1 | 0.6 | GO:0035095 | behavioral response to nicotine(GO:0035095) |
0.1 | 0.4 | GO:0048752 | semicircular canal morphogenesis(GO:0048752) |
0.1 | 0.3 | GO:0036092 | phosphatidylinositol-3-phosphate biosynthetic process(GO:0036092) |
0.1 | 0.5 | GO:2000601 | positive regulation of Arp2/3 complex-mediated actin nucleation(GO:2000601) |
0.1 | 0.5 | GO:0006528 | asparagine metabolic process(GO:0006528) |
0.1 | 0.5 | GO:0060179 | male mating behavior(GO:0060179) |
0.1 | 0.1 | GO:0042271 | susceptibility to natural killer cell mediated cytotoxicity(GO:0042271) |
0.1 | 0.4 | GO:0006548 | histidine catabolic process(GO:0006548) imidazole-containing compound catabolic process(GO:0052805) |
0.1 | 0.2 | GO:0019371 | cyclooxygenase pathway(GO:0019371) |
0.1 | 0.1 | GO:2000851 | positive regulation of cortisol secretion(GO:0051464) positive regulation of glucocorticoid secretion(GO:2000851) |
0.1 | 0.2 | GO:0000350 | generation of catalytic spliceosome for second transesterification step(GO:0000350) |
0.1 | 0.2 | GO:0061156 | pulmonary artery morphogenesis(GO:0061156) |
0.1 | 0.4 | GO:0019532 | oxalate transport(GO:0019532) |
0.1 | 0.2 | GO:1900157 | regulation of bone mineralization involved in bone maturation(GO:1900157) |
0.1 | 0.7 | GO:2000060 | positive regulation of protein ubiquitination involved in ubiquitin-dependent protein catabolic process(GO:2000060) |
0.1 | 0.3 | GO:0007021 | tubulin complex assembly(GO:0007021) |
0.1 | 0.2 | GO:1903336 | negative regulation of vacuolar transport(GO:1903336) |
0.1 | 0.3 | GO:0097527 | necroptotic signaling pathway(GO:0097527) |
0.1 | 0.1 | GO:0061642 | chemoattraction of axon(GO:0061642) |
0.1 | 0.3 | GO:0033563 | dorsal/ventral axon guidance(GO:0033563) |
0.1 | 0.1 | GO:1903059 | regulation of protein lipidation(GO:1903059) |
0.1 | 0.3 | GO:2000766 | negative regulation of cytoplasmic translation(GO:2000766) |
0.1 | 0.3 | GO:0070345 | negative regulation of fat cell proliferation(GO:0070345) |
0.1 | 0.7 | GO:0043485 | endosome to melanosome transport(GO:0035646) endosome to pigment granule transport(GO:0043485) pigment granule maturation(GO:0048757) |
0.1 | 0.2 | GO:0002426 | immunoglobulin production in mucosal tissue(GO:0002426) |
0.1 | 0.1 | GO:0072034 | renal vesicle induction(GO:0072034) |
0.1 | 0.3 | GO:2001055 | positive regulation of mesenchymal cell apoptotic process(GO:2001055) |
0.1 | 2.0 | GO:0034605 | cellular response to heat(GO:0034605) |
0.1 | 0.2 | GO:0036491 | regulation of translation in response to endoplasmic reticulum stress(GO:0036490) regulation of translation initiation in response to endoplasmic reticulum stress(GO:0036491) eiF2alpha phosphorylation in response to endoplasmic reticulum stress(GO:0036492) |
0.1 | 0.1 | GO:1990705 | cholangiocyte proliferation(GO:1990705) |
0.1 | 0.2 | GO:0050955 | thermoception(GO:0050955) |
0.1 | 0.2 | GO:2000741 | positive regulation of mesenchymal stem cell differentiation(GO:2000741) |
0.1 | 0.6 | GO:0043569 | negative regulation of insulin-like growth factor receptor signaling pathway(GO:0043569) |
0.1 | 0.3 | GO:0010961 | cellular magnesium ion homeostasis(GO:0010961) |
0.1 | 0.3 | GO:0043097 | pyrimidine-containing compound salvage(GO:0008655) pyrimidine nucleoside salvage(GO:0043097) |
0.1 | 0.2 | GO:0002949 | tRNA threonylcarbamoyladenosine modification(GO:0002949) |
0.1 | 1.1 | GO:0002092 | positive regulation of receptor internalization(GO:0002092) |
0.1 | 5.8 | GO:0007156 | homophilic cell adhesion via plasma membrane adhesion molecules(GO:0007156) |
0.1 | 0.9 | GO:2001258 | negative regulation of cation channel activity(GO:2001258) |
0.1 | 0.2 | GO:0019230 | proprioception(GO:0019230) |
0.1 | 0.1 | GO:0044341 | sodium-dependent phosphate transport(GO:0044341) regulation of sodium-dependent phosphate transport(GO:2000118) |
0.1 | 0.2 | GO:0060244 | negative regulation of cell proliferation involved in contact inhibition(GO:0060244) |
0.1 | 0.2 | GO:2000301 | negative regulation of synaptic vesicle exocytosis(GO:2000301) |
0.1 | 0.2 | GO:0032808 | lacrimal gland development(GO:0032808) |
0.1 | 0.2 | GO:1990086 | lens fiber cell apoptotic process(GO:1990086) |
0.1 | 1.0 | GO:0007019 | microtubule depolymerization(GO:0007019) |
0.1 | 0.3 | GO:0019276 | UDP-N-acetylgalactosamine metabolic process(GO:0019276) |
0.1 | 0.2 | GO:0061038 | uterus morphogenesis(GO:0061038) |
0.1 | 0.2 | GO:0008228 | opsonization(GO:0008228) |
0.1 | 0.1 | GO:0007290 | spermatid nucleus elongation(GO:0007290) |
0.1 | 1.9 | GO:0003407 | neural retina development(GO:0003407) |
0.1 | 0.2 | GO:0002248 | connective tissue replacement involved in inflammatory response wound healing(GO:0002248) connective tissue replacement(GO:0097709) |
0.1 | 0.4 | GO:0045741 | positive regulation of epidermal growth factor-activated receptor activity(GO:0045741) |
0.1 | 0.5 | GO:0022027 | interkinetic nuclear migration(GO:0022027) |
0.1 | 0.4 | GO:0016339 | calcium-dependent cell-cell adhesion via plasma membrane cell adhesion molecules(GO:0016339) |
0.1 | 0.2 | GO:0045578 | negative regulation of B cell differentiation(GO:0045578) |
0.1 | 2.6 | GO:0006953 | acute-phase response(GO:0006953) |
0.1 | 0.1 | GO:2000286 | receptor internalization involved in canonical Wnt signaling pathway(GO:2000286) |
0.1 | 0.2 | GO:0006435 | threonyl-tRNA aminoacylation(GO:0006435) |
0.1 | 0.2 | GO:0032532 | regulation of microvillus length(GO:0032532) |
0.1 | 0.2 | GO:0014744 | positive regulation of muscle adaptation(GO:0014744) |
0.1 | 0.3 | GO:1903966 | monounsaturated fatty acid metabolic process(GO:1903964) monounsaturated fatty acid biosynthetic process(GO:1903966) |
0.1 | 0.4 | GO:0032020 | ISG15-protein conjugation(GO:0032020) |
0.1 | 0.2 | GO:0097212 | lysosomal membrane organization(GO:0097212) |
0.1 | 0.5 | GO:0030497 | fatty acid elongation(GO:0030497) |
0.1 | 0.2 | GO:1903677 | regulation of cap-independent translational initiation(GO:1903677) positive regulation of cap-independent translational initiation(GO:1903679) regulation of cytoplasmic translational initiation(GO:1904688) positive regulation of cytoplasmic translational initiation(GO:1904690) |
0.1 | 0.3 | GO:0007042 | lysosomal lumen acidification(GO:0007042) |
0.1 | 0.2 | GO:0021902 | commitment of neuronal cell to specific neuron type in forebrain(GO:0021902) |
0.1 | 0.2 | GO:0002468 | dendritic cell antigen processing and presentation(GO:0002468) regulation of dendritic cell antigen processing and presentation(GO:0002604) positive regulation of dendritic cell antigen processing and presentation(GO:0002606) |
0.1 | 0.7 | GO:0048268 | clathrin coat assembly(GO:0048268) |
0.1 | 0.8 | GO:0048488 | synaptic vesicle endocytosis(GO:0048488) |
0.1 | 0.1 | GO:0021648 | vestibulocochlear nerve morphogenesis(GO:0021648) |
0.1 | 0.7 | GO:0042407 | cristae formation(GO:0042407) |
0.1 | 0.2 | GO:1903862 | positive regulation of oxidative phosphorylation(GO:1903862) |
0.1 | 0.1 | GO:0046684 | response to pyrethroid(GO:0046684) |
0.1 | 0.3 | GO:0032375 | negative regulation of sterol transport(GO:0032372) negative regulation of cholesterol transport(GO:0032375) |
0.1 | 0.4 | GO:0043653 | mitochondrial fragmentation involved in apoptotic process(GO:0043653) |
0.1 | 0.4 | GO:0071918 | urea transmembrane transport(GO:0071918) |
0.1 | 0.4 | GO:0006102 | isocitrate metabolic process(GO:0006102) |
0.1 | 0.4 | GO:0002756 | MyD88-independent toll-like receptor signaling pathway(GO:0002756) |
0.1 | 0.1 | GO:0048021 | regulation of melanin biosynthetic process(GO:0048021) regulation of secondary metabolite biosynthetic process(GO:1900376) |
0.1 | 0.2 | GO:0001920 | negative regulation of receptor recycling(GO:0001920) |
0.1 | 0.2 | GO:0042276 | error-prone translesion synthesis(GO:0042276) |
0.1 | 0.1 | GO:0021603 | cranial nerve formation(GO:0021603) |
0.1 | 0.4 | GO:0060767 | epithelial cell proliferation involved in prostate gland development(GO:0060767) |
0.1 | 0.2 | GO:2000676 | positive regulation of type B pancreatic cell apoptotic process(GO:2000676) |
0.1 | 0.5 | GO:0051103 | DNA ligation involved in DNA repair(GO:0051103) |
0.1 | 0.2 | GO:0001778 | plasma membrane repair(GO:0001778) |
0.1 | 0.2 | GO:0046952 | ketone body catabolic process(GO:0046952) |
0.1 | 0.1 | GO:0016344 | meiotic chromosome movement towards spindle pole(GO:0016344) |
0.1 | 0.4 | GO:0006451 | selenocysteine incorporation(GO:0001514) translational readthrough(GO:0006451) |
0.1 | 0.2 | GO:0060931 | sinoatrial node cell development(GO:0060931) |
0.1 | 0.1 | GO:0023021 | termination of signal transduction(GO:0023021) |
0.1 | 0.4 | GO:0048680 | positive regulation of axon regeneration(GO:0048680) |
0.1 | 0.4 | GO:0043117 | positive regulation of vascular permeability(GO:0043117) |
0.1 | 0.2 | GO:0001955 | blood vessel maturation(GO:0001955) |
0.1 | 0.4 | GO:1902902 | negative regulation of autophagosome assembly(GO:1902902) |
0.1 | 0.2 | GO:0021913 | regulation of transcription from RNA polymerase II promoter involved in ventral spinal cord interneuron specification(GO:0021913) |
0.1 | 0.6 | GO:2000369 | regulation of clathrin-mediated endocytosis(GO:2000369) |
0.1 | 0.1 | GO:0042414 | epinephrine metabolic process(GO:0042414) |
0.1 | 0.1 | GO:0002282 | microglial cell activation involved in immune response(GO:0002282) |
0.1 | 0.1 | GO:0070842 | aggresome assembly(GO:0070842) |
0.1 | 0.2 | GO:0032484 | Ral protein signal transduction(GO:0032484) |
0.1 | 0.2 | GO:0001827 | inner cell mass cell fate commitment(GO:0001827) |
0.1 | 0.1 | GO:0042136 | neurotransmitter biosynthetic process(GO:0042136) |
0.1 | 0.5 | GO:0031507 | heterochromatin assembly(GO:0031507) |
0.1 | 0.1 | GO:0035630 | bone mineralization involved in bone maturation(GO:0035630) |
0.1 | 0.2 | GO:0035284 | central nervous system segmentation(GO:0035283) brain segmentation(GO:0035284) |
0.1 | 0.1 | GO:0046340 | diacylglycerol catabolic process(GO:0046340) |
0.1 | 0.2 | GO:0042713 | sperm ejaculation(GO:0042713) |
0.1 | 0.2 | GO:0015959 | diadenosine polyphosphate metabolic process(GO:0015959) |
0.1 | 0.4 | GO:0033603 | positive regulation of dopamine secretion(GO:0033603) |
0.1 | 0.1 | GO:0051461 | regulation of corticotropin secretion(GO:0051459) positive regulation of corticotropin secretion(GO:0051461) |
0.1 | 0.5 | GO:0010155 | regulation of proton transport(GO:0010155) |
0.1 | 0.1 | GO:1901894 | regulation of calcium-transporting ATPase activity(GO:1901894) |
0.1 | 0.3 | GO:0010499 | proteasomal ubiquitin-independent protein catabolic process(GO:0010499) |
0.1 | 0.2 | GO:0006983 | ER overload response(GO:0006983) |
0.1 | 0.1 | GO:0060363 | cranial suture morphogenesis(GO:0060363) |
0.1 | 0.1 | GO:0010360 | negative regulation of anion channel activity(GO:0010360) |
0.1 | 0.9 | GO:0007094 | mitotic spindle assembly checkpoint(GO:0007094) spindle assembly checkpoint(GO:0071173) |
0.1 | 0.1 | GO:1901387 | positive regulation of voltage-gated calcium channel activity(GO:1901387) |
0.1 | 0.2 | GO:0034770 | histone H4-K20 methylation(GO:0034770) histone H4-K20 trimethylation(GO:0034773) |
0.1 | 0.2 | GO:1902455 | negative regulation of stem cell population maintenance(GO:1902455) |
0.1 | 0.2 | GO:0070827 | chromatin maintenance(GO:0070827) |
0.1 | 0.3 | GO:0015813 | L-glutamate transport(GO:0015813) |
0.1 | 0.4 | GO:0007210 | serotonin receptor signaling pathway(GO:0007210) |
0.1 | 0.5 | GO:0021884 | forebrain neuron development(GO:0021884) |
0.1 | 0.1 | GO:0007158 | neuron cell-cell adhesion(GO:0007158) |
0.1 | 0.2 | GO:0033860 | regulation of NAD(P)H oxidase activity(GO:0033860) |
0.1 | 0.8 | GO:0031297 | replication fork processing(GO:0031297) |
0.1 | 0.1 | GO:1902512 | positive regulation of apoptotic DNA fragmentation(GO:1902512) positive regulation of DNA catabolic process(GO:1903626) |
0.1 | 0.1 | GO:0023041 | neuronal signal transduction(GO:0023041) |
0.1 | 0.1 | GO:0060399 | positive regulation of growth hormone receptor signaling pathway(GO:0060399) |
0.1 | 0.3 | GO:0003025 | regulation of systemic arterial blood pressure by baroreceptor feedback(GO:0003025) |
0.1 | 0.2 | GO:2000018 | regulation of male gonad development(GO:2000018) |
0.1 | 0.5 | GO:0030836 | positive regulation of actin filament depolymerization(GO:0030836) |
0.1 | 0.2 | GO:0006269 | DNA replication, synthesis of RNA primer(GO:0006269) |
0.1 | 0.1 | GO:0014029 | neural crest formation(GO:0014029) |
0.1 | 0.3 | GO:0034227 | tRNA thio-modification(GO:0034227) |
0.1 | 0.4 | GO:0021952 | central nervous system projection neuron axonogenesis(GO:0021952) |
0.1 | 0.1 | GO:2000052 | positive regulation of non-canonical Wnt signaling pathway(GO:2000052) |
0.1 | 0.1 | GO:0010796 | regulation of multivesicular body size(GO:0010796) |
0.1 | 0.1 | GO:0035405 | histone-threonine phosphorylation(GO:0035405) |
0.1 | 0.2 | GO:0071257 | cellular response to electrical stimulus(GO:0071257) |
0.1 | 0.1 | GO:0014722 | regulation of skeletal muscle contraction by calcium ion signaling(GO:0014722) |
0.1 | 0.3 | GO:0021854 | hypothalamus development(GO:0021854) |
0.1 | 0.2 | GO:1902626 | assembly of large subunit precursor of preribosome(GO:1902626) |
0.1 | 0.2 | GO:0007220 | Notch receptor processing(GO:0007220) |
0.1 | 0.5 | GO:0070269 | pyroptosis(GO:0070269) |
0.1 | 0.1 | GO:1904430 | negative regulation of t-circle formation(GO:1904430) |
0.1 | 0.2 | GO:0034421 | post-translational protein acetylation(GO:0034421) |
0.1 | 0.1 | GO:0048208 | vesicle targeting, rough ER to cis-Golgi(GO:0048207) COPII vesicle coating(GO:0048208) |
0.1 | 0.3 | GO:0075522 | IRES-dependent viral translational initiation(GO:0075522) |
0.1 | 1.0 | GO:0007214 | gamma-aminobutyric acid signaling pathway(GO:0007214) |
0.1 | 0.3 | GO:0007256 | activation of JNKK activity(GO:0007256) |
0.1 | 0.1 | GO:1902445 | regulation of mitochondrial membrane permeability involved in programmed necrotic cell death(GO:1902445) |
0.1 | 0.7 | GO:0046685 | response to arsenic-containing substance(GO:0046685) |
0.1 | 0.2 | GO:2001245 | regulation of phosphatidylcholine biosynthetic process(GO:2001245) |
0.1 | 0.3 | GO:0018119 | peptidyl-cysteine S-nitrosylation(GO:0018119) |
0.1 | 0.3 | GO:0032222 | regulation of synaptic transmission, cholinergic(GO:0032222) |
0.1 | 0.1 | GO:1903288 | regulation of potassium ion import(GO:1903286) positive regulation of potassium ion import(GO:1903288) |
0.1 | 0.1 | GO:0061043 | regulation of vascular wound healing(GO:0061043) |
0.1 | 0.2 | GO:0045332 | phospholipid translocation(GO:0045332) |
0.1 | 0.2 | GO:0002457 | T cell antigen processing and presentation(GO:0002457) |
0.1 | 0.1 | GO:0021798 | forebrain dorsal/ventral pattern formation(GO:0021798) |
0.1 | 0.7 | GO:0097352 | autophagosome maturation(GO:0097352) |
0.1 | 0.6 | GO:0031290 | retinal ganglion cell axon guidance(GO:0031290) |
0.1 | 0.3 | GO:0015886 | heme transport(GO:0015886) |
0.1 | 0.6 | GO:0015816 | glycine transport(GO:0015816) |
0.1 | 0.4 | GO:1901976 | regulation of cell cycle checkpoint(GO:1901976) |
0.1 | 0.2 | GO:0070682 | proteasome regulatory particle assembly(GO:0070682) |
0.1 | 0.2 | GO:0021830 | interneuron migration from the subpallium to the cortex(GO:0021830) |
0.1 | 0.2 | GO:2000680 | regulation of rubidium ion transport(GO:2000680) regulation of rubidium ion transmembrane transporter activity(GO:2000686) |
0.1 | 2.1 | GO:0006400 | tRNA modification(GO:0006400) |
0.1 | 0.3 | GO:0032196 | transposition(GO:0032196) |
0.1 | 0.3 | GO:0016255 | attachment of GPI anchor to protein(GO:0016255) |
0.1 | 0.5 | GO:2000311 | regulation of alpha-amino-3-hydroxy-5-methyl-4-isoxazole propionate selective glutamate receptor activity(GO:2000311) |
0.1 | 0.3 | GO:0006271 | DNA strand elongation involved in DNA replication(GO:0006271) |
0.1 | 0.5 | GO:0043649 | dicarboxylic acid catabolic process(GO:0043649) |
0.1 | 0.3 | GO:2000651 | positive regulation of sodium ion transmembrane transporter activity(GO:2000651) |
0.1 | 0.1 | GO:0090148 | membrane fission(GO:0090148) |
0.1 | 0.1 | GO:0050711 | negative regulation of interleukin-1 secretion(GO:0050711) |
0.1 | 0.4 | GO:0006032 | chitin metabolic process(GO:0006030) chitin catabolic process(GO:0006032) |
0.1 | 0.2 | GO:0071907 | determination of digestive tract left/right asymmetry(GO:0071907) |
0.1 | 0.6 | GO:0090083 | regulation of inclusion body assembly(GO:0090083) |
0.1 | 0.1 | GO:0003253 | cardiac neural crest cell migration involved in outflow tract morphogenesis(GO:0003253) |
0.1 | 0.2 | GO:2000418 | positive regulation of eosinophil migration(GO:2000418) |
0.1 | 0.1 | GO:0010881 | regulation of cardiac muscle contraction by regulation of the release of sequestered calcium ion(GO:0010881) |
0.1 | 0.2 | GO:0070365 | hepatocyte differentiation(GO:0070365) |
0.1 | 0.3 | GO:0045743 | positive regulation of fibroblast growth factor receptor signaling pathway(GO:0045743) |
0.1 | 0.1 | GO:0098903 | regulation of membrane repolarization during action potential(GO:0098903) |
0.1 | 0.4 | GO:0070307 | lens fiber cell development(GO:0070307) |
0.1 | 0.6 | GO:0060008 | Sertoli cell differentiation(GO:0060008) |
0.1 | 0.4 | GO:0035518 | histone H2A monoubiquitination(GO:0035518) |
0.1 | 0.1 | GO:2001137 | positive regulation of endocytic recycling(GO:2001137) |
0.1 | 0.1 | GO:0034214 | protein hexamerization(GO:0034214) |
0.1 | 0.2 | GO:0022417 | protein maturation by protein folding(GO:0022417) |
0.1 | 0.1 | GO:0035609 | C-terminal protein deglutamylation(GO:0035609) |
0.1 | 0.1 | GO:1904587 | glycoprotein ERAD pathway(GO:0097466) response to glycoprotein(GO:1904587) |
0.1 | 0.3 | GO:0006977 | DNA damage response, signal transduction by p53 class mediator resulting in cell cycle arrest(GO:0006977) |
0.1 | 0.2 | GO:0000056 | ribosomal small subunit export from nucleus(GO:0000056) |
0.1 | 2.3 | GO:1900006 | positive regulation of dendrite development(GO:1900006) |
0.1 | 0.2 | GO:0002317 | plasma cell differentiation(GO:0002317) |
0.1 | 0.4 | GO:0034063 | stress granule assembly(GO:0034063) |
0.1 | 0.4 | GO:0051382 | kinetochore assembly(GO:0051382) kinetochore organization(GO:0051383) |
0.1 | 0.4 | GO:0019732 | antifungal humoral response(GO:0019732) |
0.0 | 0.1 | GO:1903624 | regulation of apoptotic DNA fragmentation(GO:1902510) regulation of DNA catabolic process(GO:1903624) |
0.0 | 0.3 | GO:0042438 | melanin biosynthetic process(GO:0042438) |
0.0 | 0.3 | GO:0060539 | diaphragm development(GO:0060539) |
0.0 | 0.2 | GO:1902475 | L-alpha-amino acid transmembrane transport(GO:1902475) |
0.0 | 0.2 | GO:0002043 | blood vessel endothelial cell proliferation involved in sprouting angiogenesis(GO:0002043) |
0.0 | 0.5 | GO:0061037 | negative regulation of cartilage development(GO:0061037) |
0.0 | 0.3 | GO:0021535 | cell migration in hindbrain(GO:0021535) |
0.0 | 1.0 | GO:1901099 | negative regulation of signal transduction in absence of ligand(GO:1901099) negative regulation of extrinsic apoptotic signaling pathway in absence of ligand(GO:2001240) |
0.0 | 1.1 | GO:0006182 | cGMP biosynthetic process(GO:0006182) |
0.0 | 0.3 | GO:0043922 | negative regulation by host of viral transcription(GO:0043922) |
0.0 | 0.1 | GO:0002727 | natural killer cell cytokine production(GO:0002370) regulation of natural killer cell cytokine production(GO:0002727) |
0.0 | 0.1 | GO:0036123 | histone H3-K9 dimethylation(GO:0036123) |
0.0 | 0.2 | GO:0006104 | succinyl-CoA metabolic process(GO:0006104) |
0.0 | 0.1 | GO:0042938 | dipeptide transport(GO:0042938) |
0.0 | 0.7 | GO:0010257 | NADH dehydrogenase complex assembly(GO:0010257) mitochondrial respiratory chain complex I assembly(GO:0032981) mitochondrial respiratory chain complex I biogenesis(GO:0097031) |
0.0 | 0.1 | GO:0003402 | planar cell polarity pathway involved in axis elongation(GO:0003402) |
0.0 | 0.1 | GO:1903071 | positive regulation of ER-associated ubiquitin-dependent protein catabolic process(GO:1903071) |
0.0 | 0.1 | GO:0035701 | hematopoietic stem cell migration(GO:0035701) |
0.0 | 0.3 | GO:0070234 | positive regulation of T cell apoptotic process(GO:0070234) |
0.0 | 0.0 | GO:1902992 | negative regulation of amyloid precursor protein catabolic process(GO:1902992) |
0.0 | 0.1 | GO:0001560 | regulation of cell growth by extracellular stimulus(GO:0001560) |
0.0 | 1.9 | GO:0045454 | cell redox homeostasis(GO:0045454) |
0.0 | 0.5 | GO:0003351 | epithelial cilium movement(GO:0003351) |
0.0 | 0.1 | GO:0010751 | negative regulation of nitric oxide mediated signal transduction(GO:0010751) |
0.0 | 0.1 | GO:0002860 | positive regulation of natural killer cell mediated immune response to tumor cell(GO:0002857) positive regulation of natural killer cell mediated cytotoxicity directed against tumor cell target(GO:0002860) |
0.0 | 0.0 | GO:0006582 | melanin metabolic process(GO:0006582) |
0.0 | 0.3 | GO:0001696 | gastric acid secretion(GO:0001696) |
0.0 | 0.1 | GO:0038028 | insulin receptor signaling pathway via phosphatidylinositol 3-kinase(GO:0038028) |
0.0 | 0.0 | GO:0070460 | thyroid-stimulating hormone secretion(GO:0070460) |
0.0 | 0.4 | GO:0035970 | peptidyl-threonine dephosphorylation(GO:0035970) |
0.0 | 0.4 | GO:0001919 | regulation of receptor recycling(GO:0001919) |
0.0 | 0.3 | GO:2000270 | negative regulation of fibroblast apoptotic process(GO:2000270) |
0.0 | 0.1 | GO:0007089 | traversing start control point of mitotic cell cycle(GO:0007089) |
0.0 | 0.0 | GO:2000503 | positive regulation of natural killer cell chemotaxis(GO:2000503) |
0.0 | 1.3 | GO:0051965 | positive regulation of synapse assembly(GO:0051965) |
0.0 | 0.0 | GO:1903660 | regulation of complement-dependent cytotoxicity(GO:1903659) negative regulation of complement-dependent cytotoxicity(GO:1903660) |
0.0 | 0.2 | GO:0051694 | pointed-end actin filament capping(GO:0051694) |
0.0 | 0.1 | GO:0021781 | glial cell fate commitment(GO:0021781) |
0.0 | 0.2 | GO:2000288 | positive regulation of myoblast proliferation(GO:2000288) |
0.0 | 0.1 | GO:0018879 | biphenyl metabolic process(GO:0018879) |
0.0 | 0.0 | GO:0072008 | glomerular mesangial cell differentiation(GO:0072008) glomerular mesangial cell development(GO:0072144) |
0.0 | 0.4 | GO:0035094 | response to nicotine(GO:0035094) |
0.0 | 0.0 | GO:0048007 | antigen processing and presentation of lipid antigen via MHC class Ib(GO:0048003) antigen processing and presentation, exogenous lipid antigen via MHC class Ib(GO:0048007) |
0.0 | 0.1 | GO:0002074 | extraocular skeletal muscle development(GO:0002074) |
0.0 | 0.1 | GO:0046439 | cysteine catabolic process(GO:0009093) L-cysteine catabolic process(GO:0019448) L-cysteine metabolic process(GO:0046439) |
0.0 | 0.5 | GO:0070816 | phosphorylation of RNA polymerase II C-terminal domain(GO:0070816) |
0.0 | 0.3 | GO:0042795 | snRNA transcription from RNA polymerase II promoter(GO:0042795) |
0.0 | 0.3 | GO:0008105 | asymmetric protein localization(GO:0008105) |
0.0 | 0.1 | GO:0031034 | myosin filament assembly(GO:0031034) |
0.0 | 0.0 | GO:0072076 | nephrogenic mesenchyme development(GO:0072076) |
0.0 | 0.2 | GO:0060042 | retina morphogenesis in camera-type eye(GO:0060042) |
0.0 | 0.1 | GO:0001973 | adenosine receptor signaling pathway(GO:0001973) |
0.0 | 0.5 | GO:0006744 | ubiquinone biosynthetic process(GO:0006744) |
0.0 | 0.0 | GO:0006982 | response to lipid hydroperoxide(GO:0006982) |
0.0 | 0.9 | GO:0000381 | regulation of alternative mRNA splicing, via spliceosome(GO:0000381) |
0.0 | 0.4 | GO:0021954 | central nervous system neuron development(GO:0021954) |
0.0 | 0.1 | GO:0007386 | compartment pattern specification(GO:0007386) |
0.0 | 0.1 | GO:0006651 | diacylglycerol biosynthetic process(GO:0006651) |
0.0 | 0.4 | GO:0006622 | protein targeting to lysosome(GO:0006622) |
0.0 | 0.0 | GO:2000002 | negative regulation of DNA damage checkpoint(GO:2000002) |
0.0 | 1.3 | GO:0033141 | regulation of peptidyl-serine phosphorylation of STAT protein(GO:0033139) positive regulation of peptidyl-serine phosphorylation of STAT protein(GO:0033141) |
0.0 | 0.2 | GO:2000400 | positive regulation of T cell differentiation in thymus(GO:0033089) positive regulation of thymocyte aggregation(GO:2000400) |
0.0 | 0.2 | GO:0048672 | positive regulation of collateral sprouting(GO:0048672) |
0.0 | 0.1 | GO:0006499 | N-terminal protein lipidation(GO:0006498) N-terminal protein myristoylation(GO:0006499) |
0.0 | 0.1 | GO:0032687 | negative regulation of interferon-alpha production(GO:0032687) |
0.0 | 0.1 | GO:0060896 | neural plate pattern specification(GO:0060896) |
0.0 | 0.7 | GO:0071474 | cellular hyperosmotic response(GO:0071474) |
0.0 | 0.3 | GO:0048172 | regulation of short-term neuronal synaptic plasticity(GO:0048172) |
0.0 | 0.1 | GO:0010993 | regulation of ubiquitin homeostasis(GO:0010993) free ubiquitin chain polymerization(GO:0010994) |
0.0 | 0.7 | GO:0045747 | positive regulation of Notch signaling pathway(GO:0045747) |
0.0 | 0.2 | GO:0006348 | chromatin silencing at telomere(GO:0006348) |
0.0 | 0.1 | GO:2000510 | positive regulation of dendritic cell chemotaxis(GO:2000510) |
0.0 | 0.1 | GO:2000821 | regulation of grooming behavior(GO:2000821) |
0.0 | 0.1 | GO:0060231 | mesenchymal to epithelial transition(GO:0060231) |
0.0 | 0.1 | GO:0032430 | positive regulation of phospholipase A2 activity(GO:0032430) |
0.0 | 0.3 | GO:0045779 | negative regulation of bone resorption(GO:0045779) |
0.0 | 0.0 | GO:0045079 | negative regulation of chemokine biosynthetic process(GO:0045079) |
0.0 | 0.2 | GO:1900165 | negative regulation of interleukin-6 secretion(GO:1900165) |
0.0 | 0.4 | GO:0051770 | positive regulation of nitric-oxide synthase biosynthetic process(GO:0051770) |
0.0 | 0.5 | GO:0032012 | ARF protein signal transduction(GO:0032011) regulation of ARF protein signal transduction(GO:0032012) |
0.0 | 0.0 | GO:0071850 | mitotic cell cycle arrest(GO:0071850) |
0.0 | 0.0 | GO:2000110 | negative regulation of macrophage apoptotic process(GO:2000110) |
0.0 | 0.1 | GO:0007066 | female meiosis sister chromatid cohesion(GO:0007066) |
0.0 | 0.1 | GO:0060447 | bud outgrowth involved in lung branching(GO:0060447) |
0.0 | 0.2 | GO:0006398 | mRNA 3'-end processing by stem-loop binding and cleavage(GO:0006398) |
0.0 | 0.0 | GO:0010918 | positive regulation of mitochondrial membrane potential(GO:0010918) |
0.0 | 0.2 | GO:0016139 | glycoside catabolic process(GO:0016139) |
0.0 | 0.1 | GO:0060618 | nipple development(GO:0060618) |
0.0 | 0.0 | GO:0035262 | gonad morphogenesis(GO:0035262) |
0.0 | 0.1 | GO:0051013 | microtubule severing(GO:0051013) |
0.0 | 0.1 | GO:0019374 | galactolipid metabolic process(GO:0019374) |
0.0 | 0.3 | GO:0032367 | intracellular cholesterol transport(GO:0032367) |
0.0 | 0.0 | GO:0010966 | regulation of phosphate transport(GO:0010966) |
0.0 | 0.0 | GO:0097278 | complement-dependent cytotoxicity(GO:0097278) |
0.0 | 0.5 | GO:0006308 | DNA catabolic process(GO:0006308) |
0.0 | 0.1 | GO:0019346 | homoserine metabolic process(GO:0009092) transsulfuration(GO:0019346) |
0.0 | 0.0 | GO:0043985 | histone H4-R3 methylation(GO:0043985) |
0.0 | 0.3 | GO:0043983 | histone H4-K12 acetylation(GO:0043983) |
0.0 | 0.3 | GO:0000245 | spliceosomal complex assembly(GO:0000245) |
0.0 | 0.1 | GO:0002540 | leukotriene production involved in inflammatory response(GO:0002540) |
0.0 | 0.0 | GO:0000320 | re-entry into mitotic cell cycle(GO:0000320) |
0.0 | 0.1 | GO:2001274 | negative regulation of glucose import in response to insulin stimulus(GO:2001274) |
0.0 | 0.1 | GO:0048245 | eosinophil chemotaxis(GO:0048245) |
0.0 | 0.1 | GO:1903751 | regulation of intrinsic apoptotic signaling pathway in response to hydrogen peroxide(GO:1903750) negative regulation of intrinsic apoptotic signaling pathway in response to hydrogen peroxide(GO:1903751) |
0.0 | 0.1 | GO:0051533 | positive regulation of NFAT protein import into nucleus(GO:0051533) |
0.0 | 0.1 | GO:2000015 | regulation of determination of dorsal identity(GO:2000015) |
0.0 | 0.1 | GO:0002536 | respiratory burst involved in inflammatory response(GO:0002536) regulation of respiratory burst involved in inflammatory response(GO:0060264) negative regulation of respiratory burst involved in inflammatory response(GO:0060266) |
0.0 | 0.2 | GO:2000628 | regulation of miRNA metabolic process(GO:2000628) |
0.0 | 0.1 | GO:2000609 | regulation of thyroid hormone generation(GO:2000609) |
0.0 | 0.2 | GO:0015671 | oxygen transport(GO:0015671) |
0.0 | 0.2 | GO:0046146 | tetrahydrobiopterin metabolic process(GO:0046146) |
0.0 | 0.2 | GO:0043517 | positive regulation of DNA damage response, signal transduction by p53 class mediator(GO:0043517) |
0.0 | 0.2 | GO:0006307 | DNA dealkylation involved in DNA repair(GO:0006307) |
0.0 | 0.2 | GO:2000480 | negative regulation of cAMP-dependent protein kinase activity(GO:2000480) |
0.0 | 0.1 | GO:0042256 | mature ribosome assembly(GO:0042256) |
0.0 | 0.1 | GO:0051095 | regulation of helicase activity(GO:0051095) positive regulation of helicase activity(GO:0051096) |
0.0 | 0.3 | GO:0016486 | peptide hormone processing(GO:0016486) |
0.0 | 0.1 | GO:0006393 | termination of mitochondrial transcription(GO:0006393) |
0.0 | 0.2 | GO:0016242 | negative regulation of macroautophagy(GO:0016242) |
0.0 | 0.1 | GO:0030091 | protein repair(GO:0030091) |
0.0 | 0.1 | GO:0010025 | wax biosynthetic process(GO:0010025) wax metabolic process(GO:0010166) |
0.0 | 0.1 | GO:1903998 | regulation of eating behavior(GO:1903998) |
0.0 | 0.3 | GO:0045839 | negative regulation of mitotic nuclear division(GO:0045839) |
0.0 | 0.1 | GO:0033387 | putrescine biosynthetic process from ornithine(GO:0033387) |
0.0 | 0.1 | GO:0072395 | signal transduction involved in cell cycle checkpoint(GO:0072395) signal transduction involved in DNA integrity checkpoint(GO:0072401) signal transduction involved in DNA damage checkpoint(GO:0072422) |
0.0 | 0.3 | GO:0006474 | N-terminal protein amino acid acetylation(GO:0006474) |
0.0 | 0.1 | GO:0007406 | negative regulation of neuroblast proliferation(GO:0007406) |
0.0 | 0.1 | GO:0099601 | regulation of neurotransmitter receptor activity(GO:0099601) |
0.0 | 0.2 | GO:0018202 | peptidyl-histidine modification(GO:0018202) |
0.0 | 0.2 | GO:0006120 | mitochondrial electron transport, NADH to ubiquinone(GO:0006120) |
0.0 | 0.6 | GO:0045070 | positive regulation of viral genome replication(GO:0045070) |
0.0 | 0.0 | GO:0046874 | quinolinate metabolic process(GO:0046874) |
0.0 | 1.0 | GO:0001541 | ovarian follicle development(GO:0001541) |
0.0 | 0.1 | GO:2000269 | regulation of fibroblast apoptotic process(GO:2000269) |
0.0 | 0.0 | GO:1902513 | regulation of organelle transport along microtubule(GO:1902513) |
0.0 | 0.1 | GO:0070525 | tRNA threonylcarbamoyladenosine metabolic process(GO:0070525) |
0.0 | 0.1 | GO:2000773 | negative regulation of cellular senescence(GO:2000773) |
0.0 | 0.3 | GO:0016082 | synaptic vesicle priming(GO:0016082) |
0.0 | 0.1 | GO:0042253 | granulocyte macrophage colony-stimulating factor biosynthetic process(GO:0042253) regulation of granulocyte macrophage colony-stimulating factor biosynthetic process(GO:0045423) |
0.0 | 0.2 | GO:0008340 | determination of adult lifespan(GO:0008340) |
0.0 | 0.8 | GO:0006446 | regulation of translational initiation(GO:0006446) |
0.0 | 0.1 | GO:0021670 | lateral ventricle development(GO:0021670) |
0.0 | 0.1 | GO:0071732 | cellular response to nitric oxide(GO:0071732) |
0.0 | 0.0 | GO:0006391 | transcription initiation from mitochondrial promoter(GO:0006391) |
0.0 | 0.1 | GO:1903748 | negative regulation of protein targeting to mitochondrion(GO:1903215) negative regulation of establishment of protein localization to mitochondrion(GO:1903748) |
0.0 | 0.2 | GO:0010216 | maintenance of DNA methylation(GO:0010216) |
0.0 | 0.3 | GO:0043268 | positive regulation of potassium ion transport(GO:0043268) |
0.0 | 0.1 | GO:0034729 | histone H3-K79 methylation(GO:0034729) |
0.0 | 0.1 | GO:1900425 | negative regulation of defense response to bacterium(GO:1900425) |
0.0 | 0.1 | GO:0035694 | mitochondrial protein catabolic process(GO:0035694) |
0.0 | 0.1 | GO:0000189 | MAPK import into nucleus(GO:0000189) |
0.0 | 0.0 | GO:0072319 | vesicle uncoating(GO:0072319) |
0.0 | 0.1 | GO:0010446 | response to alkaline pH(GO:0010446) |
0.0 | 0.0 | GO:0006382 | adenosine to inosine editing(GO:0006382) |
0.0 | 0.1 | GO:0048014 | Tie signaling pathway(GO:0048014) |
0.0 | 0.1 | GO:0015791 | polyol transport(GO:0015791) |
0.0 | 0.3 | GO:0000463 | maturation of LSU-rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000463) |
0.0 | 0.3 | GO:0009083 | branched-chain amino acid catabolic process(GO:0009083) |
0.0 | 0.2 | GO:0043102 | amino acid salvage(GO:0043102) L-methionine biosynthetic process(GO:0071265) L-methionine salvage(GO:0071267) |
0.0 | 0.2 | GO:0046007 | negative regulation of activated T cell proliferation(GO:0046007) |
0.0 | 0.4 | GO:0010569 | regulation of double-strand break repair via homologous recombination(GO:0010569) |
0.0 | 0.1 | GO:0002281 | macrophage activation involved in immune response(GO:0002281) |
0.0 | 0.5 | GO:0071108 | protein K48-linked deubiquitination(GO:0071108) |
0.0 | 0.1 | GO:0048102 | autophagic cell death(GO:0048102) |
0.0 | 0.3 | GO:0034497 | protein localization to pre-autophagosomal structure(GO:0034497) |
0.0 | 0.2 | GO:0015812 | gamma-aminobutyric acid transport(GO:0015812) |
0.0 | 0.0 | GO:0035743 | CD4-positive, alpha-beta T cell cytokine production(GO:0035743) |
0.0 | 0.8 | GO:0000387 | spliceosomal snRNP assembly(GO:0000387) |
0.0 | 0.0 | GO:0039534 | negative regulation of MDA-5 signaling pathway(GO:0039534) |
0.0 | 0.1 | GO:0070914 | UV-damage excision repair(GO:0070914) |
0.0 | 0.2 | GO:0045075 | interleukin-12 biosynthetic process(GO:0042090) regulation of interleukin-12 biosynthetic process(GO:0045075) |
0.0 | 0.1 | GO:2000786 | positive regulation of autophagosome assembly(GO:2000786) |
0.0 | 0.0 | GO:0048696 | regulation of collateral sprouting in absence of injury(GO:0048696) |
0.0 | 0.1 | GO:0072015 | glomerular visceral epithelial cell development(GO:0072015) glomerular epithelial cell development(GO:0072310) |
0.0 | 0.0 | GO:0002741 | positive regulation of cytokine secretion involved in immune response(GO:0002741) |
0.0 | 0.1 | GO:0060166 | olfactory pit development(GO:0060166) |
0.0 | 0.2 | GO:0016926 | protein desumoylation(GO:0016926) |
0.0 | 0.2 | GO:0006054 | N-acetylneuraminate metabolic process(GO:0006054) |
0.0 | 0.1 | GO:0034370 | triglyceride-rich lipoprotein particle remodeling(GO:0034370) |
0.0 | 0.1 | GO:0000972 | transcription-dependent tethering of RNA polymerase II gene DNA at nuclear periphery(GO:0000972) |
0.0 | 0.0 | GO:0043476 | pigment accumulation(GO:0043476) |
0.0 | 0.1 | GO:0044034 | negative stranded viral RNA replication(GO:0039689) multi-organism biosynthetic process(GO:0044034) |
0.0 | 0.1 | GO:0002855 | natural killer cell mediated cytotoxicity directed against tumor cell target(GO:0002420) natural killer cell mediated immune response to tumor cell(GO:0002423) negative regulation of response to tumor cell(GO:0002835) negative regulation of immune response to tumor cell(GO:0002838) regulation of natural killer cell mediated immune response to tumor cell(GO:0002855) regulation of natural killer cell mediated cytotoxicity directed against tumor cell target(GO:0002858) |
0.0 | 0.0 | GO:0003418 | growth plate cartilage chondrocyte differentiation(GO:0003418) |
0.0 | 0.2 | GO:0032119 | sequestering of zinc ion(GO:0032119) regulation of sequestering of zinc ion(GO:0061088) |
0.0 | 0.0 | GO:0044340 | canonical Wnt signaling pathway involved in regulation of cell proliferation(GO:0044340) |
0.0 | 0.2 | GO:0002566 | somatic diversification of immune receptors via somatic mutation(GO:0002566) somatic hypermutation of immunoglobulin genes(GO:0016446) |
0.0 | 0.1 | GO:0006978 | DNA damage response, signal transduction by p53 class mediator resulting in transcription of p21 class mediator(GO:0006978) DNA damage response, signal transduction resulting in transcription(GO:0042772) |
0.0 | 0.9 | GO:0007270 | neuron-neuron synaptic transmission(GO:0007270) |
0.0 | 0.1 | GO:0070986 | left/right axis specification(GO:0070986) |
0.0 | 0.1 | GO:0070571 | negative regulation of neuron projection regeneration(GO:0070571) |
0.0 | 0.0 | GO:2000520 | regulation of immunological synapse formation(GO:2000520) |
0.0 | 0.3 | GO:0045116 | protein neddylation(GO:0045116) |
0.0 | 0.2 | GO:0061365 | positive regulation of triglyceride lipase activity(GO:0061365) |
0.0 | 0.1 | GO:1901673 | regulation of mitotic spindle assembly(GO:1901673) |
0.0 | 0.0 | GO:0036438 | maintenance of lens transparency(GO:0036438) |
0.0 | 0.1 | GO:0009992 | cellular water homeostasis(GO:0009992) |
0.0 | 0.1 | GO:0043247 | protection from non-homologous end joining at telomere(GO:0031848) telomere maintenance in response to DNA damage(GO:0043247) |
0.0 | 0.1 | GO:0009052 | pentose-phosphate shunt, non-oxidative branch(GO:0009052) |
0.0 | 0.0 | GO:0035513 | oxidative RNA demethylation(GO:0035513) oxidative single-stranded RNA demethylation(GO:0035553) |
0.0 | 0.1 | GO:0035589 | G-protein coupled purinergic nucleotide receptor signaling pathway(GO:0035589) |
0.0 | 0.0 | GO:0009301 | snRNA transcription(GO:0009301) |
0.0 | 0.0 | GO:0035610 | protein side chain deglutamylation(GO:0035610) |
0.0 | 0.0 | GO:0016479 | negative regulation of transcription from RNA polymerase I promoter(GO:0016479) |
0.0 | 0.0 | GO:0010936 | negative regulation of macrophage cytokine production(GO:0010936) |
0.0 | 0.0 | GO:1901490 | regulation of lymphangiogenesis(GO:1901490) |
0.0 | 0.0 | GO:0039530 | MDA-5 signaling pathway(GO:0039530) |
0.0 | 0.1 | GO:0070197 | telomere tethering at nuclear periphery(GO:0034398) meiotic telomere tethering at nuclear periphery(GO:0044821) meiotic attachment of telomere to nuclear envelope(GO:0070197) chromosome attachment to the nuclear envelope(GO:0097240) |
0.0 | 0.0 | GO:0090245 | axis elongation involved in somitogenesis(GO:0090245) |
0.0 | 0.0 | GO:0006743 | ubiquinone metabolic process(GO:0006743) |
0.0 | 0.0 | GO:0031652 | positive regulation of heat generation(GO:0031652) |
0.0 | 0.0 | GO:0009138 | pyrimidine nucleoside diphosphate metabolic process(GO:0009138) |
0.0 | 0.1 | GO:0050930 | induction of positive chemotaxis(GO:0050930) |
0.0 | 0.1 | GO:1902259 | regulation of delayed rectifier potassium channel activity(GO:1902259) |
0.0 | 0.6 | GO:0031124 | mRNA 3'-end processing(GO:0031124) |
0.0 | 0.1 | GO:0032202 | telomere assembly(GO:0032202) |
0.0 | 0.1 | GO:0061635 | regulation of protein complex stability(GO:0061635) |
0.0 | 0.0 | GO:0048842 | positive regulation of axon extension involved in axon guidance(GO:0048842) positive regulation of axon guidance(GO:1902669) |
0.0 | 0.1 | GO:0070164 | negative regulation of adiponectin secretion(GO:0070164) |
0.0 | 0.1 | GO:0006677 | glycosylceramide metabolic process(GO:0006677) |
0.0 | 0.0 | GO:0048550 | negative regulation of pinocytosis(GO:0048550) |
0.0 | 0.0 | GO:1901421 | positive regulation of response to alcohol(GO:1901421) |
0.0 | 0.0 | GO:0070973 | protein localization to endoplasmic reticulum exit site(GO:0070973) |
0.0 | 0.0 | GO:1902116 | negative regulation of organelle assembly(GO:1902116) |
0.0 | 0.1 | GO:0035385 | Roundabout signaling pathway(GO:0035385) |
0.0 | 0.1 | GO:0042635 | positive regulation of hair cycle(GO:0042635) positive regulation of hair follicle development(GO:0051798) |
0.0 | 0.1 | GO:0010310 | regulation of hydrogen peroxide metabolic process(GO:0010310) |
0.0 | 0.2 | GO:0051703 | social behavior(GO:0035176) intraspecies interaction between organisms(GO:0051703) |
0.0 | 0.0 | GO:0072602 | interleukin-4 secretion(GO:0072602) |
0.0 | 0.0 | GO:0010880 | regulation of release of sequestered calcium ion into cytosol by sarcoplasmic reticulum(GO:0010880) |
0.0 | 0.2 | GO:0032786 | positive regulation of DNA-templated transcription, elongation(GO:0032786) |
0.0 | 0.1 | GO:0046415 | urate metabolic process(GO:0046415) |
0.0 | 0.0 | GO:0090493 | catecholamine uptake(GO:0090493) dopamine uptake(GO:0090494) |
0.0 | 0.0 | GO:0003344 | pericardium morphogenesis(GO:0003344) |
0.0 | 0.1 | GO:0034498 | early endosome to Golgi transport(GO:0034498) |
0.0 | 0.0 | GO:0042987 | amyloid precursor protein catabolic process(GO:0042987) |
0.0 | 0.2 | GO:0035855 | megakaryocyte development(GO:0035855) |
0.0 | 0.0 | GO:0072553 | terminal button organization(GO:0072553) |
0.0 | 0.1 | GO:0061318 | renal filtration cell differentiation(GO:0061318) glomerular epithelium development(GO:0072010) glomerular visceral epithelial cell differentiation(GO:0072112) glomerular epithelial cell differentiation(GO:0072311) |
0.0 | 0.0 | GO:0070572 | positive regulation of neuron projection regeneration(GO:0070572) |
0.0 | 0.1 | GO:2000346 | negative regulation of hepatocyte proliferation(GO:2000346) |
0.0 | 0.1 | GO:0002517 | T cell tolerance induction(GO:0002517) |
0.0 | 0.0 | GO:1901385 | regulation of voltage-gated calcium channel activity(GO:1901385) |
0.0 | 0.0 | GO:0051956 | negative regulation of amino acid transport(GO:0051956) |
0.0 | 0.0 | GO:0016539 | intein-mediated protein splicing(GO:0016539) protein splicing(GO:0030908) |
0.0 | 0.0 | GO:0021937 | cerebellar Purkinje cell-granule cell precursor cell signaling involved in regulation of granule cell precursor cell proliferation(GO:0021937) |
0.0 | 0.0 | GO:0007258 | JUN phosphorylation(GO:0007258) |
0.0 | 0.1 | GO:0031167 | rRNA methylation(GO:0031167) |
0.0 | 0.0 | GO:0018364 | peptidyl-glutamine methylation(GO:0018364) |
0.0 | 0.0 | GO:0048254 | snoRNA localization(GO:0048254) |
0.0 | 0.0 | GO:0035993 | deltoid tuberosity development(GO:0035993) |
0.0 | 0.0 | GO:0035359 | negative regulation of peroxisome proliferator activated receptor signaling pathway(GO:0035359) |
0.0 | 0.2 | GO:1902808 | positive regulation of cell cycle G1/S phase transition(GO:1902808) |
0.0 | 0.1 | GO:0048671 | negative regulation of collateral sprouting(GO:0048671) |
0.0 | 0.1 | GO:0031365 | N-terminal protein amino acid modification(GO:0031365) |
0.0 | 0.5 | GO:0001783 | B cell apoptotic process(GO:0001783) |
0.0 | 0.0 | GO:0032696 | negative regulation of interleukin-13 production(GO:0032696) |
0.0 | 0.1 | GO:1902043 | positive regulation of extrinsic apoptotic signaling pathway via death domain receptors(GO:1902043) |
0.0 | 0.0 | GO:1902071 | regulation of hypoxia-inducible factor-1alpha signaling pathway(GO:1902071) |
0.0 | 0.2 | GO:0007271 | synaptic transmission, cholinergic(GO:0007271) |
0.0 | 0.0 | GO:0006543 | glutamine catabolic process(GO:0006543) |
0.0 | 0.1 | GO:0016322 | neuron remodeling(GO:0016322) |
0.0 | 0.0 | GO:0090283 | regulation of protein glycosylation in Golgi(GO:0090283) |
0.0 | 0.1 | GO:0021889 | olfactory bulb interneuron differentiation(GO:0021889) |
0.0 | 0.0 | GO:0006598 | polyamine catabolic process(GO:0006598) |
0.0 | 0.1 | GO:1903358 | regulation of Golgi organization(GO:1903358) |
0.0 | 0.2 | GO:1902571 | regulation of serine-type endopeptidase activity(GO:1900003) negative regulation of serine-type endopeptidase activity(GO:1900004) regulation of serine-type peptidase activity(GO:1902571) negative regulation of serine-type peptidase activity(GO:1902572) |
0.0 | 0.0 | GO:1903232 | melanosome assembly(GO:1903232) |
0.0 | 0.0 | GO:0006287 | base-excision repair, gap-filling(GO:0006287) |
0.0 | 0.1 | GO:0000380 | alternative mRNA splicing, via spliceosome(GO:0000380) |
0.0 | 0.0 | GO:0051409 | response to nitrosative stress(GO:0051409) |
0.0 | 0.1 | GO:0006878 | cellular copper ion homeostasis(GO:0006878) |
0.0 | 0.0 | GO:0045918 | negative regulation of cytolysis(GO:0045918) |
0.0 | 0.0 | GO:2000074 | regulation of type B pancreatic cell development(GO:2000074) |
0.0 | 0.1 | GO:0043567 | regulation of insulin-like growth factor receptor signaling pathway(GO:0043567) |
0.0 | 0.6 | GO:0001580 | detection of chemical stimulus involved in sensory perception of bitter taste(GO:0001580) |
0.0 | 0.1 | GO:0051451 | myoblast migration(GO:0051451) |
0.0 | 0.5 | GO:0010501 | RNA secondary structure unwinding(GO:0010501) |
0.0 | 0.0 | GO:0010764 | negative regulation of fibroblast migration(GO:0010764) |
0.0 | 0.1 | GO:0044036 | cell wall macromolecule metabolic process(GO:0044036) cell wall organization or biogenesis(GO:0071554) |
0.0 | 0.0 | GO:0001922 | B-1 B cell homeostasis(GO:0001922) |
0.0 | 0.0 | GO:0006106 | fumarate metabolic process(GO:0006106) |
0.0 | 0.0 | GO:0042048 | olfactory behavior(GO:0042048) |
0.0 | 0.0 | GO:0043353 | enucleate erythrocyte differentiation(GO:0043353) |
0.0 | 0.0 | GO:0060763 | mammary duct terminal end bud growth(GO:0060763) |
0.0 | 0.1 | GO:0060292 | long term synaptic depression(GO:0060292) |
0.0 | 0.0 | GO:0070424 | regulation of nucleotide-binding oligomerization domain containing signaling pathway(GO:0070424) regulation of nucleotide-binding oligomerization domain containing 1 signaling pathway(GO:0070428) regulation of nucleotide-binding oligomerization domain containing 2 signaling pathway(GO:0070432) |
0.0 | 0.0 | GO:0030167 | proteoglycan catabolic process(GO:0030167) |
0.0 | 0.1 | GO:0035418 | protein localization to synapse(GO:0035418) |
0.0 | 0.1 | GO:0050435 | beta-amyloid metabolic process(GO:0050435) |
0.0 | 0.0 | GO:0051315 | attachment of mitotic spindle microtubules to kinetochore(GO:0051315) |
0.0 | 0.0 | GO:0009804 | coumarin metabolic process(GO:0009804) |
0.0 | 0.4 | GO:0050853 | B cell receptor signaling pathway(GO:0050853) |
0.0 | 0.0 | GO:0007060 | male meiosis chromosome segregation(GO:0007060) |
0.0 | 0.2 | GO:0006491 | N-glycan processing(GO:0006491) |
0.0 | 0.1 | GO:0045187 | regulation of circadian sleep/wake cycle, sleep(GO:0045187) |
0.0 | 0.0 | GO:0075509 | receptor-mediated endocytosis of virus by host cell(GO:0019065) endocytosis involved in viral entry into host cell(GO:0075509) |
0.0 | 0.0 | GO:0033058 | directional locomotion(GO:0033058) |
0.0 | 0.1 | GO:0030206 | chondroitin sulfate biosynthetic process(GO:0030206) |
0.0 | 0.1 | GO:0030238 | male sex determination(GO:0030238) |
0.0 | 0.1 | GO:0018344 | protein geranylgeranylation(GO:0018344) |
0.0 | 0.1 | GO:0008215 | spermine metabolic process(GO:0008215) |
0.0 | 0.0 | GO:0044387 | negative regulation of protein kinase activity by regulation of protein phosphorylation(GO:0044387) |
0.0 | 0.0 | GO:1900738 | positive regulation of phospholipase C-activating G-protein coupled receptor signaling pathway(GO:1900738) |
0.0 | 0.0 | GO:0021819 | layer formation in cerebral cortex(GO:0021819) |
0.0 | 0.0 | GO:0033693 | neurofilament bundle assembly(GO:0033693) |
0.0 | 0.0 | GO:0002374 | cytokine secretion involved in immune response(GO:0002374) |
0.0 | 0.0 | GO:0051602 | response to electrical stimulus(GO:0051602) |
0.0 | 0.1 | GO:0007000 | nucleolus organization(GO:0007000) |
0.0 | 0.0 | GO:2000254 | regulation of male germ cell proliferation(GO:2000254) |
0.0 | 0.0 | GO:2000402 | negative regulation of lymphocyte migration(GO:2000402) |
0.0 | 0.0 | GO:0001302 | replicative cell aging(GO:0001302) |
0.0 | 0.1 | GO:0006517 | protein deglycosylation(GO:0006517) |
0.0 | 0.0 | GO:0061355 | Wnt protein secretion(GO:0061355) regulation of Wnt protein secretion(GO:0061356) |
0.0 | 0.0 | GO:0001951 | intestinal D-glucose absorption(GO:0001951) |
0.0 | 0.2 | GO:0006284 | base-excision repair(GO:0006284) |
0.0 | 0.0 | GO:1902775 | mitochondrial large ribosomal subunit assembly(GO:1902775) |
0.0 | 0.0 | GO:0070934 | CRD-mediated mRNA stabilization(GO:0070934) |
0.0 | 0.1 | GO:0050807 | regulation of synapse organization(GO:0050807) |
0.0 | 0.0 | GO:0042376 | phylloquinone metabolic process(GO:0042374) phylloquinone catabolic process(GO:0042376) quinone catabolic process(GO:1901662) |
0.0 | 0.1 | GO:0042359 | vitamin D metabolic process(GO:0042359) |
0.0 | 0.0 | GO:0042891 | antibiotic transport(GO:0042891) |
0.0 | 0.0 | GO:0051799 | negative regulation of hair follicle development(GO:0051799) |
0.0 | 0.1 | GO:0007099 | centriole replication(GO:0007099) |
0.0 | 0.1 | GO:0006817 | phosphate ion transport(GO:0006817) |
0.0 | 0.0 | GO:0001834 | trophectodermal cell proliferation(GO:0001834) |
0.0 | 0.0 | GO:2000259 | positive regulation of complement activation(GO:0045917) positive regulation of protein activation cascade(GO:2000259) |
0.0 | 0.0 | GO:0031017 | exocrine pancreas development(GO:0031017) |
0.0 | 0.0 | GO:0061158 | 3'-UTR-mediated mRNA destabilization(GO:0061158) |
0.0 | 0.0 | GO:0042167 | heme catabolic process(GO:0042167) pigment catabolic process(GO:0046149) |
0.0 | 0.1 | GO:0071051 | polyadenylation-dependent snoRNA 3'-end processing(GO:0071051) |
0.0 | 0.0 | GO:0042908 | xenobiotic transport(GO:0042908) |
0.0 | 0.0 | GO:1901252 | regulation of intracellular transport of viral material(GO:1901252) |
0.0 | 0.0 | GO:0006362 | transcription elongation from RNA polymerase I promoter(GO:0006362) |
0.0 | 0.0 | GO:0097049 | motor neuron apoptotic process(GO:0097049) |
0.0 | 0.1 | GO:2000484 | positive regulation of interleukin-8 secretion(GO:2000484) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
1.2 | 8.7 | GO:0098563 | integral component of synaptic vesicle membrane(GO:0030285) intrinsic component of synaptic vesicle membrane(GO:0098563) |
0.7 | 2.6 | GO:1990130 | Iml1 complex(GO:1990130) |
0.6 | 1.8 | GO:0097441 | basilar dendrite(GO:0097441) |
0.6 | 4.6 | GO:0043083 | synaptic cleft(GO:0043083) |
0.5 | 5.8 | GO:0043194 | axon initial segment(GO:0043194) |
0.5 | 4.7 | GO:0044224 | juxtaparanode region of axon(GO:0044224) |
0.5 | 1.4 | GO:0005863 | striated muscle myosin thick filament(GO:0005863) |
0.5 | 1.8 | GO:0002142 | stereocilia ankle link complex(GO:0002142) |
0.4 | 0.9 | GO:0097648 | G-protein coupled receptor dimeric complex(GO:0038037) G-protein coupled receptor complex(GO:0097648) |
0.4 | 1.7 | GO:0031313 | extrinsic component of endosome membrane(GO:0031313) |
0.4 | 1.6 | GO:0031618 | nuclear pericentric heterochromatin(GO:0031618) |
0.4 | 2.0 | GO:0031838 | haptoglobin-hemoglobin complex(GO:0031838) |
0.4 | 4.3 | GO:0031527 | filopodium membrane(GO:0031527) |
0.4 | 1.5 | GO:0033269 | internode region of axon(GO:0033269) |
0.4 | 3.0 | GO:0042788 | polysomal ribosome(GO:0042788) |
0.4 | 1.8 | GO:0097433 | dense body(GO:0097433) |
0.4 | 6.1 | GO:0030673 | axolemma(GO:0030673) |
0.3 | 1.7 | GO:0034388 | Pwp2p-containing subcomplex of 90S preribosome(GO:0034388) |
0.3 | 0.9 | GO:0032437 | cuticular plate(GO:0032437) |
0.3 | 1.8 | GO:0031258 | lamellipodium membrane(GO:0031258) |
0.3 | 1.8 | GO:0016012 | sarcoglycan complex(GO:0016012) |
0.3 | 3.3 | GO:0030061 | mitochondrial crista(GO:0030061) |
0.3 | 0.9 | GO:0033010 | paranodal junction(GO:0033010) |
0.3 | 0.8 | GO:0097450 | astrocyte end-foot(GO:0097450) |
0.3 | 0.8 | GO:0014701 | junctional sarcoplasmic reticulum membrane(GO:0014701) |
0.3 | 0.5 | GO:0030868 | smooth endoplasmic reticulum membrane(GO:0030868) smooth endoplasmic reticulum part(GO:0097425) |
0.3 | 0.8 | GO:0005833 | hemoglobin complex(GO:0005833) |
0.3 | 1.0 | GO:0019815 | B cell receptor complex(GO:0019815) |
0.3 | 0.8 | GO:0097513 | myosin II filament(GO:0097513) |
0.3 | 0.8 | GO:0005944 | phosphatidylinositol 3-kinase complex, class IB(GO:0005944) |
0.3 | 0.8 | GO:0031092 | platelet alpha granule membrane(GO:0031092) |
0.2 | 0.7 | GO:0005955 | calcineurin complex(GO:0005955) |
0.2 | 0.9 | GO:0008274 | gamma-tubulin large complex(GO:0000931) gamma-tubulin ring complex(GO:0008274) |
0.2 | 1.9 | GO:0005883 | neurofilament(GO:0005883) |
0.2 | 1.2 | GO:0005579 | membrane attack complex(GO:0005579) |
0.2 | 1.1 | GO:0043203 | axon hillock(GO:0043203) |
0.2 | 0.9 | GO:0035189 | Rb-E2F complex(GO:0035189) |
0.2 | 1.5 | GO:0071437 | invadopodium(GO:0071437) |
0.2 | 1.3 | GO:0035748 | myelin sheath abaxonal region(GO:0035748) |
0.2 | 1.1 | GO:0045098 | type III intermediate filament(GO:0045098) |
0.2 | 4.3 | GO:0033017 | sarcoplasmic reticulum membrane(GO:0033017) |
0.2 | 0.8 | GO:0070033 | synaptobrevin 2-SNAP-25-syntaxin-1a-complexin II complex(GO:0070033) |
0.2 | 0.6 | GO:0030121 | AP-1 adaptor complex(GO:0030121) |
0.2 | 1.8 | GO:0008250 | oligosaccharyltransferase complex(GO:0008250) |
0.2 | 0.6 | GO:0034457 | Mpp10 complex(GO:0034457) |
0.2 | 0.6 | GO:0060053 | neurofilament cytoskeleton(GO:0060053) |
0.2 | 0.6 | GO:0097543 | ciliary inversin compartment(GO:0097543) |
0.2 | 1.0 | GO:0061617 | MICOS complex(GO:0061617) |
0.2 | 2.9 | GO:0031045 | dense core granule(GO:0031045) |
0.2 | 0.7 | GO:0005947 | mitochondrial alpha-ketoglutarate dehydrogenase complex(GO:0005947) |
0.2 | 1.1 | GO:0031415 | NatA complex(GO:0031415) |
0.2 | 2.0 | GO:0042405 | nuclear inclusion body(GO:0042405) |
0.2 | 4.6 | GO:0044295 | axonal growth cone(GO:0044295) |
0.2 | 0.7 | GO:0032777 | Piccolo NuA4 histone acetyltransferase complex(GO:0032777) |
0.2 | 0.2 | GO:0032591 | dendritic spine membrane(GO:0032591) |
0.2 | 0.9 | GO:1990454 | L-type voltage-gated calcium channel complex(GO:1990454) |
0.2 | 0.7 | GO:0017071 | intracellular cyclic nucleotide activated cation channel complex(GO:0017071) |
0.2 | 0.2 | GO:1990761 | growth cone lamellipodium(GO:1990761) |
0.2 | 0.8 | GO:0005964 | phosphorylase kinase complex(GO:0005964) |
0.2 | 1.0 | GO:0048786 | presynaptic active zone(GO:0048786) |
0.2 | 1.4 | GO:0008074 | guanylate cyclase complex, soluble(GO:0008074) |
0.2 | 0.6 | GO:0030127 | COPII vesicle coat(GO:0030127) |
0.2 | 1.1 | GO:0034518 | mRNA cap binding complex(GO:0005845) RNA cap binding complex(GO:0034518) |
0.2 | 1.4 | GO:0043220 | Schmidt-Lanterman incisure(GO:0043220) |
0.1 | 5.6 | GO:0034704 | calcium channel complex(GO:0034704) |
0.1 | 0.6 | GO:0097209 | epidermal lamellar body(GO:0097209) |
0.1 | 1.3 | GO:0032045 | guanyl-nucleotide exchange factor complex(GO:0032045) |
0.1 | 0.1 | GO:0044294 | dendritic growth cone(GO:0044294) |
0.1 | 0.4 | GO:0005745 | m-AAA complex(GO:0005745) |
0.1 | 1.0 | GO:0016593 | Cdc73/Paf1 complex(GO:0016593) |
0.1 | 1.7 | GO:0032433 | filopodium tip(GO:0032433) |
0.1 | 0.4 | GO:0005658 | alpha DNA polymerase:primase complex(GO:0005658) |
0.1 | 0.1 | GO:0043219 | lateral loop(GO:0043219) |
0.1 | 1.1 | GO:0005677 | chromatin silencing complex(GO:0005677) |
0.1 | 0.5 | GO:0070876 | SOSS complex(GO:0070876) |
0.1 | 0.4 | GO:0072534 | perineuronal net(GO:0072534) |
0.1 | 0.8 | GO:0000445 | THO complex(GO:0000347) THO complex part of transcription export complex(GO:0000445) |
0.1 | 0.5 | GO:0044322 | endoplasmic reticulum quality control compartment(GO:0044322) |
0.1 | 0.5 | GO:0032389 | MutLalpha complex(GO:0032389) |
0.1 | 0.3 | GO:0002139 | stereocilia coupling link(GO:0002139) |
0.1 | 1.0 | GO:0060091 | kinocilium(GO:0060091) |
0.1 | 0.2 | GO:0036195 | muscle cell projection(GO:0036194) muscle cell projection membrane(GO:0036195) |
0.1 | 0.8 | GO:0000276 | mitochondrial proton-transporting ATP synthase complex, coupling factor F(o)(GO:0000276) |
0.1 | 1.6 | GO:0032809 | neuronal cell body membrane(GO:0032809) |
0.1 | 0.2 | GO:0012507 | ER to Golgi transport vesicle membrane(GO:0012507) |
0.1 | 2.1 | GO:0060077 | inhibitory synapse(GO:0060077) |
0.1 | 0.2 | GO:0070044 | synaptobrevin 2-SNAP-25-syntaxin-1a complex(GO:0070044) |
0.1 | 0.3 | GO:0017133 | mitochondrial electron transfer flavoprotein complex(GO:0017133) electron transfer flavoprotein complex(GO:0045251) |
0.1 | 0.1 | GO:0042585 | germinal vesicle(GO:0042585) |
0.1 | 0.7 | GO:0000812 | Swr1 complex(GO:0000812) |
0.1 | 6.7 | GO:0031463 | Cul3-RING ubiquitin ligase complex(GO:0031463) |
0.1 | 1.4 | GO:0005736 | DNA-directed RNA polymerase I complex(GO:0005736) |
0.1 | 0.9 | GO:0036513 | Derlin-1 retrotranslocation complex(GO:0036513) |
0.1 | 0.2 | GO:0035867 | alphav-beta3 integrin-IGF-1-IGF1R complex(GO:0035867) |
0.1 | 0.4 | GO:0016602 | CCAAT-binding factor complex(GO:0016602) |
0.1 | 0.4 | GO:0097169 | AIM2 inflammasome complex(GO:0097169) |
0.1 | 0.5 | GO:0000235 | astral microtubule(GO:0000235) aster(GO:0005818) |
0.1 | 0.4 | GO:0030689 | Noc complex(GO:0030689) |
0.1 | 1.0 | GO:0032797 | SMN complex(GO:0032797) |
0.1 | 1.4 | GO:1902711 | GABA receptor complex(GO:1902710) GABA-A receptor complex(GO:1902711) |
0.1 | 0.4 | GO:0005784 | Sec61 translocon complex(GO:0005784) translocon complex(GO:0071256) |
0.1 | 0.5 | GO:0034464 | BBSome(GO:0034464) |
0.1 | 0.2 | GO:0032279 | asymmetric synapse(GO:0032279) |
0.1 | 0.5 | GO:0070847 | core mediator complex(GO:0070847) |
0.1 | 0.3 | GO:0097452 | GAIT complex(GO:0097452) |
0.1 | 0.3 | GO:0030891 | VCB complex(GO:0030891) |
0.1 | 1.2 | GO:0097440 | apical dendrite(GO:0097440) |
0.1 | 0.4 | GO:0089701 | U2AF(GO:0089701) |
0.1 | 0.2 | GO:0020016 | ciliary pocket(GO:0020016) ciliary pocket membrane(GO:0020018) |
0.1 | 1.3 | GO:0005892 | acetylcholine-gated channel complex(GO:0005892) |
0.1 | 0.3 | GO:0097524 | sperm plasma membrane(GO:0097524) |
0.1 | 0.3 | GO:0042583 | chromaffin granule(GO:0042583) |
0.1 | 0.5 | GO:0033116 | endoplasmic reticulum-Golgi intermediate compartment membrane(GO:0033116) |
0.1 | 0.5 | GO:0036057 | filtration diaphragm(GO:0036056) slit diaphragm(GO:0036057) |
0.1 | 0.8 | GO:0000930 | gamma-tubulin complex(GO:0000930) |
0.1 | 0.8 | GO:0042555 | MCM complex(GO:0042555) |
0.1 | 0.4 | GO:0046696 | lipopolysaccharide receptor complex(GO:0046696) |
0.1 | 0.3 | GO:0051286 | cell tip(GO:0051286) |
0.1 | 0.2 | GO:0032444 | activin responsive factor complex(GO:0032444) |
0.1 | 0.2 | GO:0045009 | melanosome membrane(GO:0033162) chitosome(GO:0045009) |
0.1 | 0.7 | GO:0031080 | nuclear pore outer ring(GO:0031080) |
0.1 | 0.1 | GO:0033185 | dolichol-phosphate-mannose synthase complex(GO:0033185) |
0.1 | 0.2 | GO:0000015 | phosphopyruvate hydratase complex(GO:0000015) |
0.1 | 0.5 | GO:0005655 | nucleolar ribonuclease P complex(GO:0005655) ribonuclease P complex(GO:0030677) multimeric ribonuclease P complex(GO:0030681) |
0.1 | 0.3 | GO:0000408 | EKC/KEOPS complex(GO:0000408) |
0.1 | 0.7 | GO:0032039 | integrator complex(GO:0032039) |
0.1 | 0.2 | GO:0005958 | DNA-dependent protein kinase-DNA ligase 4 complex(GO:0005958) |
0.1 | 0.1 | GO:0032010 | phagolysosome(GO:0032010) |
0.1 | 1.7 | GO:0032281 | AMPA glutamate receptor complex(GO:0032281) |
0.1 | 0.3 | GO:0031414 | N-terminal protein acetyltransferase complex(GO:0031414) |
0.1 | 0.7 | GO:0031235 | intrinsic component of the cytoplasmic side of the plasma membrane(GO:0031235) |
0.1 | 0.6 | GO:0097539 | ciliary transition fiber(GO:0097539) |
0.1 | 0.9 | GO:0031082 | BLOC complex(GO:0031082) |
0.1 | 2.1 | GO:0043198 | dendritic shaft(GO:0043198) |
0.1 | 0.6 | GO:0005640 | nuclear outer membrane(GO:0005640) |
0.1 | 5.4 | GO:0070382 | exocytic vesicle(GO:0070382) |
0.1 | 0.3 | GO:0002079 | inner acrosomal membrane(GO:0002079) |
0.1 | 1.9 | GO:0030660 | Golgi-associated vesicle membrane(GO:0030660) |
0.1 | 0.4 | GO:0070761 | pre-snoRNP complex(GO:0070761) |
0.1 | 2.7 | GO:0043195 | terminal bouton(GO:0043195) |
0.1 | 0.5 | GO:0005662 | DNA replication factor A complex(GO:0005662) |
0.1 | 2.2 | GO:0042734 | presynaptic membrane(GO:0042734) |
0.1 | 0.6 | GO:0071006 | U2-type catalytic step 1 spliceosome(GO:0071006) |
0.1 | 0.1 | GO:0033270 | paranode region of axon(GO:0033270) |
0.1 | 0.5 | GO:0035253 | ciliary rootlet(GO:0035253) |
0.1 | 1.7 | GO:0099501 | synaptic vesicle membrane(GO:0030672) exocytic vesicle membrane(GO:0099501) |
0.1 | 0.4 | GO:1990124 | messenger ribonucleoprotein complex(GO:1990124) |
0.1 | 0.4 | GO:0071014 | post-mRNA release spliceosomal complex(GO:0071014) |
0.1 | 0.2 | GO:0044300 | cerebellar mossy fiber(GO:0044300) |
0.1 | 1.1 | GO:0005680 | anaphase-promoting complex(GO:0005680) |
0.1 | 0.1 | GO:0034715 | pICln-Sm protein complex(GO:0034715) |
0.1 | 0.4 | GO:0005885 | Arp2/3 protein complex(GO:0005885) |
0.1 | 0.3 | GO:0042765 | GPI-anchor transamidase complex(GO:0042765) |
0.1 | 0.2 | GO:1990316 | ATG1/ULK1 kinase complex(GO:1990316) |
0.1 | 0.2 | GO:0032009 | early phagosome(GO:0032009) |
0.1 | 0.2 | GO:0030289 | protein phosphatase 4 complex(GO:0030289) |
0.1 | 0.1 | GO:0044614 | nuclear pore cytoplasmic filaments(GO:0044614) |
0.1 | 0.2 | GO:0005594 | collagen type IX trimer(GO:0005594) |
0.1 | 0.2 | GO:0072357 | PTW/PP1 phosphatase complex(GO:0072357) |
0.1 | 0.2 | GO:0005853 | eukaryotic translation elongation factor 1 complex(GO:0005853) |
0.1 | 0.4 | GO:0033180 | proton-transporting V-type ATPase, V1 domain(GO:0033180) |
0.1 | 0.3 | GO:0017101 | aminoacyl-tRNA synthetase multienzyme complex(GO:0017101) |
0.1 | 0.4 | GO:0008385 | IkappaB kinase complex(GO:0008385) |
0.1 | 3.9 | GO:0030427 | site of polarized growth(GO:0030427) |
0.1 | 0.3 | GO:0000805 | X chromosome(GO:0000805) |
0.0 | 0.1 | GO:0000125 | PCAF complex(GO:0000125) |
0.0 | 0.5 | GO:0030914 | STAGA complex(GO:0030914) |
0.0 | 0.2 | GO:1990851 | Wnt-Frizzled-LRP5/6 complex(GO:1990851) |
0.0 | 0.2 | GO:0045293 | mRNA editing complex(GO:0045293) |
0.0 | 0.4 | GO:0098793 | presynapse(GO:0098793) |
0.0 | 0.0 | GO:0044615 | nuclear pore nuclear basket(GO:0044615) |
0.0 | 0.2 | GO:0002189 | ribose phosphate diphosphokinase complex(GO:0002189) |
0.0 | 5.0 | GO:0045211 | postsynaptic membrane(GO:0045211) |
0.0 | 0.3 | GO:0031209 | SCAR complex(GO:0031209) |
0.0 | 0.9 | GO:0034451 | centriolar satellite(GO:0034451) |
0.0 | 0.0 | GO:0005767 | secondary lysosome(GO:0005767) |
0.0 | 0.1 | GO:0005945 | 6-phosphofructokinase complex(GO:0005945) |
0.0 | 1.2 | GO:0005801 | cis-Golgi network(GO:0005801) |
0.0 | 0.1 | GO:0097512 | cardiac myofibril(GO:0097512) |
0.0 | 0.2 | GO:0031501 | mannosyltransferase complex(GO:0031501) |
0.0 | 0.2 | GO:0000974 | Prp19 complex(GO:0000974) |
0.0 | 0.2 | GO:0005744 | mitochondrial inner membrane presequence translocase complex(GO:0005744) |
0.0 | 1.2 | GO:0000307 | cyclin-dependent protein kinase holoenzyme complex(GO:0000307) |
0.0 | 0.0 | GO:0031428 | box C/D snoRNP complex(GO:0031428) |
0.0 | 0.5 | GO:0035686 | sperm fibrous sheath(GO:0035686) |
0.0 | 0.2 | GO:0005968 | Rab-protein geranylgeranyltransferase complex(GO:0005968) |
0.0 | 0.1 | GO:0042567 | insulin-like growth factor binding protein complex(GO:0016942) growth factor complex(GO:0036454) insulin-like growth factor ternary complex(GO:0042567) |
0.0 | 0.2 | GO:0033063 | Rad51B-Rad51C-Rad51D-XRCC2 complex(GO:0033063) |
0.0 | 0.1 | GO:0001674 | female germ cell nucleus(GO:0001674) |
0.0 | 0.2 | GO:0034366 | spherical high-density lipoprotein particle(GO:0034366) |
0.0 | 0.1 | GO:1990075 | periciliary membrane compartment(GO:1990075) |
0.0 | 0.9 | GO:0010494 | cytoplasmic stress granule(GO:0010494) |
0.0 | 0.0 | GO:1990726 | Lsm1-7-Pat1 complex(GO:1990726) |
0.0 | 0.1 | GO:0071797 | LUBAC complex(GO:0071797) |
0.0 | 0.3 | GO:0005675 | holo TFIIH complex(GO:0005675) |
0.0 | 0.9 | GO:0015030 | Cajal body(GO:0015030) |
0.0 | 0.3 | GO:0005916 | fascia adherens(GO:0005916) |
0.0 | 0.1 | GO:0097255 | R2TP complex(GO:0097255) |
0.0 | 0.1 | GO:0035061 | interchromatin granule(GO:0035061) |
0.0 | 0.6 | GO:0005686 | U2 snRNP(GO:0005686) |
0.0 | 0.1 | GO:0030137 | COPI-coated vesicle(GO:0030137) |
0.0 | 0.3 | GO:0005671 | Ada2/Gcn5/Ada3 transcription activator complex(GO:0005671) |
0.0 | 0.2 | GO:0000137 | Golgi cis cisterna(GO:0000137) |
0.0 | 1.2 | GO:0045271 | mitochondrial respiratory chain complex I(GO:0005747) NADH dehydrogenase complex(GO:0030964) respiratory chain complex I(GO:0045271) |
0.0 | 0.6 | GO:0034707 | chloride channel complex(GO:0034707) |
0.0 | 0.1 | GO:0097422 | tubular endosome(GO:0097422) |
0.0 | 2.0 | GO:0014069 | postsynaptic density(GO:0014069) postsynaptic specialization(GO:0099572) |
0.0 | 0.1 | GO:0034663 | endoplasmic reticulum chaperone complex(GO:0034663) |
0.0 | 0.1 | GO:0097449 | astrocyte projection(GO:0097449) |
0.0 | 0.3 | GO:0008278 | cohesin complex(GO:0008278) |
0.0 | 0.2 | GO:0000242 | pericentriolar material(GO:0000242) |
0.0 | 0.1 | GO:0032300 | mismatch repair complex(GO:0032300) |
0.0 | 0.3 | GO:0005666 | DNA-directed RNA polymerase III complex(GO:0005666) |
0.0 | 0.6 | GO:0030315 | T-tubule(GO:0030315) |
0.0 | 0.2 | GO:0032580 | Golgi cisterna membrane(GO:0032580) |
0.0 | 0.3 | GO:0000164 | protein phosphatase type 1 complex(GO:0000164) |
0.0 | 0.2 | GO:0042589 | zymogen granule membrane(GO:0042589) |
0.0 | 0.1 | GO:0000811 | GINS complex(GO:0000811) |
0.0 | 0.3 | GO:0005790 | smooth endoplasmic reticulum(GO:0005790) |
0.0 | 1.7 | GO:0000502 | proteasome complex(GO:0000502) |
0.0 | 0.1 | GO:0031315 | extrinsic component of mitochondrial outer membrane(GO:0031315) |
0.0 | 0.0 | GO:0071598 | neuronal ribonucleoprotein granule(GO:0071598) |
0.0 | 0.0 | GO:1990712 | HFE-transferrin receptor complex(GO:1990712) |
0.0 | 0.8 | GO:0016328 | lateral plasma membrane(GO:0016328) |
0.0 | 0.4 | GO:0032040 | small-subunit processome(GO:0032040) |
0.0 | 0.1 | GO:0070939 | Dsl1p complex(GO:0070939) |
0.0 | 0.1 | GO:0044292 | dendrite terminus(GO:0044292) |
0.0 | 0.3 | GO:0070822 | Sin3-type complex(GO:0070822) |
0.0 | 2.1 | GO:0031227 | intrinsic component of endoplasmic reticulum membrane(GO:0031227) |
0.0 | 0.1 | GO:0000796 | condensin complex(GO:0000796) |
0.0 | 0.2 | GO:0098533 | ATPase dependent transmembrane transport complex(GO:0098533) |
0.0 | 0.1 | GO:0034098 | VCP-NPL4-UFD1 AAA ATPase complex(GO:0034098) |
0.0 | 0.2 | GO:0000801 | central element(GO:0000801) |
0.0 | 0.0 | GO:0044393 | microspike(GO:0044393) |
0.0 | 0.1 | GO:0048237 | rough endoplasmic reticulum lumen(GO:0048237) |
0.0 | 0.2 | GO:0033391 | chromatoid body(GO:0033391) |
0.0 | 0.1 | GO:0042612 | MHC class I protein complex(GO:0042612) |
0.0 | 0.7 | GO:0045171 | intercellular bridge(GO:0045171) |
0.0 | 0.1 | GO:0043293 | apoptosome(GO:0043293) |
0.0 | 0.1 | GO:0072557 | IPAF inflammasome complex(GO:0072557) |
0.0 | 0.1 | GO:0034673 | inhibin-betaglycan-ActRII complex(GO:0034673) |
0.0 | 0.0 | GO:0072558 | NLRP1 inflammasome complex(GO:0072558) |
0.0 | 0.9 | GO:0005791 | rough endoplasmic reticulum(GO:0005791) |
0.0 | 0.2 | GO:0002116 | semaphorin receptor complex(GO:0002116) |
0.0 | 0.0 | GO:0005683 | U7 snRNP(GO:0005683) |
0.0 | 0.1 | GO:0070531 | BRCA1-A complex(GO:0070531) |
0.0 | 0.1 | GO:0033588 | Elongator holoenzyme complex(GO:0033588) |
0.0 | 0.7 | GO:0071013 | catalytic step 2 spliceosome(GO:0071013) |
0.0 | 0.4 | GO:0005763 | organellar small ribosomal subunit(GO:0000314) mitochondrial small ribosomal subunit(GO:0005763) |
0.0 | 0.1 | GO:0000808 | origin recognition complex(GO:0000808) nuclear origin of replication recognition complex(GO:0005664) |
0.0 | 0.1 | GO:0031464 | Cul4A-RING E3 ubiquitin ligase complex(GO:0031464) |
0.0 | 0.0 | GO:0071001 | U4/U6 snRNP(GO:0071001) |
0.0 | 0.6 | GO:0008076 | voltage-gated potassium channel complex(GO:0008076) |
0.0 | 0.1 | GO:0005672 | transcription factor TFIIA complex(GO:0005672) |
0.0 | 0.1 | GO:0031362 | anchored component of external side of plasma membrane(GO:0031362) |
0.0 | 0.2 | GO:0005797 | Golgi medial cisterna(GO:0005797) |
0.0 | 0.2 | GO:0005922 | connexon complex(GO:0005922) |
0.0 | 0.0 | GO:0005688 | U6 snRNP(GO:0005688) |
0.0 | 0.0 | GO:0031261 | DNA replication preinitiation complex(GO:0031261) |
0.0 | 0.0 | GO:0090498 | extrinsic component of Golgi membrane(GO:0090498) |
0.0 | 0.1 | GO:0000815 | ESCRT III complex(GO:0000815) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
1.2 | 3.6 | GO:0097109 | neuroligin family protein binding(GO:0097109) |
1.1 | 3.3 | GO:0048101 | calcium- and calmodulin-regulated 3',5'-cyclic-GMP phosphodiesterase activity(GO:0048101) |
1.0 | 2.9 | GO:0042030 | ATPase inhibitor activity(GO:0042030) |
0.9 | 2.7 | GO:0050508 | glucuronosyl-N-acetylglucosaminyl-proteoglycan 4-alpha-N-acetylglucosaminyltransferase activity(GO:0050508) |
0.7 | 2.9 | GO:0046923 | ER retention sequence binding(GO:0046923) |
0.7 | 2.6 | GO:0015016 | [heparan sulfate]-glucosamine N-sulfotransferase activity(GO:0015016) |
0.6 | 1.8 | GO:0005176 | ErbB-2 class receptor binding(GO:0005176) |
0.6 | 4.8 | GO:0008599 | protein phosphatase type 1 regulator activity(GO:0008599) |
0.6 | 2.4 | GO:0004566 | beta-glucuronidase activity(GO:0004566) |
0.6 | 2.2 | GO:0030229 | very-low-density lipoprotein particle receptor activity(GO:0030229) |
0.5 | 0.5 | GO:0004376 | glycolipid mannosyltransferase activity(GO:0004376) |
0.5 | 1.9 | GO:0031720 | haptoglobin binding(GO:0031720) |
0.5 | 3.4 | GO:0003680 | AT DNA binding(GO:0003680) |
0.5 | 1.9 | GO:0046870 | cadmium ion binding(GO:0046870) |
0.5 | 1.4 | GO:0015137 | citrate transmembrane transporter activity(GO:0015137) tricarboxylic acid transmembrane transporter activity(GO:0015142) |
0.5 | 2.3 | GO:0015185 | gamma-aminobutyric acid transmembrane transporter activity(GO:0015185) |
0.5 | 2.3 | GO:0086080 | protein binding involved in heterotypic cell-cell adhesion(GO:0086080) |
0.5 | 3.7 | GO:0005167 | neurotrophin TRK receptor binding(GO:0005167) |
0.5 | 3.2 | GO:0005000 | vasopressin receptor activity(GO:0005000) |
0.4 | 2.2 | GO:0071723 | lipopeptide binding(GO:0071723) |
0.4 | 1.3 | GO:0008597 | calcium-dependent protein serine/threonine phosphatase regulator activity(GO:0008597) |
0.4 | 1.6 | GO:0042731 | PH domain binding(GO:0042731) |
0.4 | 4.8 | GO:0015172 | L-glutamate transmembrane transporter activity(GO:0005313) acidic amino acid transmembrane transporter activity(GO:0015172) |
0.4 | 3.1 | GO:0002162 | dystroglycan binding(GO:0002162) |
0.4 | 1.5 | GO:0015265 | urea channel activity(GO:0015265) |
0.4 | 4.0 | GO:0070679 | inositol 1,4,5 trisphosphate binding(GO:0070679) |
0.3 | 1.0 | GO:0016743 | carboxyl- or carbamoyltransferase activity(GO:0016743) |
0.3 | 2.1 | GO:0005225 | volume-sensitive anion channel activity(GO:0005225) |
0.3 | 1.0 | GO:0046573 | lactonohydrolase activity(GO:0046573) acyl-L-homoserine-lactone lactonohydrolase activity(GO:0102007) |
0.3 | 0.7 | GO:0005519 | cytoskeletal regulatory protein binding(GO:0005519) |
0.3 | 2.0 | GO:0004385 | guanylate kinase activity(GO:0004385) |
0.3 | 1.0 | GO:0086056 | voltage-gated calcium channel activity involved in AV node cell action potential(GO:0086056) |
0.3 | 1.0 | GO:1990190 | peptide-serine-N-acetyltransferase activity(GO:1990189) peptide-glutamate-N-acetyltransferase activity(GO:1990190) |
0.3 | 1.6 | GO:0000155 | phosphorelay sensor kinase activity(GO:0000155) |
0.3 | 1.0 | GO:0004924 | oncostatin-M receptor activity(GO:0004924) |
0.3 | 1.2 | GO:0008273 | calcium, potassium:sodium antiporter activity(GO:0008273) |
0.3 | 0.9 | GO:0016842 | amidine-lyase activity(GO:0016842) |
0.3 | 1.5 | GO:0004111 | creatine kinase activity(GO:0004111) |
0.3 | 2.7 | GO:0008093 | cytoskeletal adaptor activity(GO:0008093) |
0.3 | 0.3 | GO:0000026 | alpha-1,2-mannosyltransferase activity(GO:0000026) |
0.3 | 0.3 | GO:0003896 | DNA primase activity(GO:0003896) |
0.3 | 1.1 | GO:0033142 | progesterone receptor binding(GO:0033142) |
0.3 | 1.4 | GO:0031849 | olfactory receptor binding(GO:0031849) |
0.3 | 2.5 | GO:0001206 | transcriptional repressor activity, RNA polymerase II distal enhancer sequence-specific binding(GO:0001206) |
0.3 | 1.1 | GO:0071074 | eukaryotic initiation factor eIF2 binding(GO:0071074) |
0.3 | 0.8 | GO:0004351 | glutamate decarboxylase activity(GO:0004351) |
0.3 | 1.6 | GO:0032027 | myosin light chain binding(GO:0032027) |
0.2 | 1.2 | GO:0030292 | protein tyrosine kinase inhibitor activity(GO:0030292) |
0.2 | 1.0 | GO:0005432 | calcium:sodium antiporter activity(GO:0005432) |
0.2 | 1.2 | GO:0008499 | UDP-galactose:beta-N-acetylglucosamine beta-1,3-galactosyltransferase activity(GO:0008499) |
0.2 | 1.9 | GO:0008046 | axon guidance receptor activity(GO:0008046) |
0.2 | 0.7 | GO:1990430 | extracellular matrix protein binding(GO:1990430) |
0.2 | 1.4 | GO:0046974 | histone methyltransferase activity (H3-K9 specific)(GO:0046974) |
0.2 | 0.7 | GO:0001069 | regulatory region RNA binding(GO:0001069) |
0.2 | 4.4 | GO:0017075 | syntaxin-1 binding(GO:0017075) |
0.2 | 0.2 | GO:0009374 | biotin binding(GO:0009374) |
0.2 | 0.6 | GO:0043423 | 3-phosphoinositide-dependent protein kinase binding(GO:0043423) |
0.2 | 1.0 | GO:1990254 | keratin filament binding(GO:1990254) |
0.2 | 0.6 | GO:0016909 | JUN kinase activity(GO:0004705) SAP kinase activity(GO:0016909) |
0.2 | 0.6 | GO:0009041 | uridylate kinase activity(GO:0009041) |
0.2 | 0.4 | GO:1901702 | urate transmembrane transporter activity(GO:0015143) salt transmembrane transporter activity(GO:1901702) |
0.2 | 0.4 | GO:0030899 | calcium-dependent ATPase activity(GO:0030899) |
0.2 | 0.6 | GO:0031802 | type 5 metabotropic glutamate receptor binding(GO:0031802) |
0.2 | 0.8 | GO:0004839 | ubiquitin activating enzyme activity(GO:0004839) |
0.2 | 0.2 | GO:0008796 | bis(5'-nucleosyl)-tetraphosphatase activity(GO:0008796) |
0.2 | 1.0 | GO:0004826 | phenylalanine-tRNA ligase activity(GO:0004826) |
0.2 | 0.6 | GO:0070699 | type II activin receptor binding(GO:0070699) |
0.2 | 1.9 | GO:0004176 | ATP-dependent peptidase activity(GO:0004176) |
0.2 | 1.9 | GO:0008239 | dipeptidyl-peptidase activity(GO:0008239) |
0.2 | 0.6 | GO:0016509 | long-chain-3-hydroxyacyl-CoA dehydrogenase activity(GO:0016509) |
0.2 | 0.7 | GO:0033192 | calmodulin-dependent protein phosphatase activity(GO:0033192) |
0.2 | 3.4 | GO:0005452 | inorganic anion exchanger activity(GO:0005452) |
0.2 | 0.5 | GO:0034191 | apolipoprotein A-I receptor binding(GO:0034191) |
0.2 | 0.7 | GO:0004370 | glycerol kinase activity(GO:0004370) |
0.2 | 0.5 | GO:0034190 | apolipoprotein receptor binding(GO:0034190) |
0.2 | 1.4 | GO:0004571 | mannosyl-oligosaccharide 1,2-alpha-mannosidase activity(GO:0004571) |
0.2 | 0.7 | GO:0032138 | single base insertion or deletion binding(GO:0032138) |
0.2 | 2.0 | GO:0015271 | outward rectifier potassium channel activity(GO:0015271) |
0.2 | 1.7 | GO:0051378 | serotonin binding(GO:0051378) |
0.2 | 1.5 | GO:0001091 | RNA polymerase II basal transcription factor binding(GO:0001091) |
0.2 | 0.7 | GO:0004060 | arylamine N-acetyltransferase activity(GO:0004060) |
0.2 | 2.3 | GO:0045295 | gamma-catenin binding(GO:0045295) |
0.2 | 0.5 | GO:0004359 | glutaminase activity(GO:0004359) |
0.2 | 0.3 | GO:0048408 | epidermal growth factor binding(GO:0048408) |
0.2 | 0.8 | GO:0004652 | polynucleotide adenylyltransferase activity(GO:0004652) |
0.2 | 0.8 | GO:0004689 | phosphorylase kinase activity(GO:0004689) |
0.2 | 1.4 | GO:0016624 | oxidoreductase activity, acting on the aldehyde or oxo group of donors, disulfide as acceptor(GO:0016624) |
0.2 | 0.5 | GO:0030976 | thiamine pyrophosphate binding(GO:0030976) |
0.2 | 0.5 | GO:0030160 | GKAP/Homer scaffold activity(GO:0030160) |
0.2 | 0.5 | GO:0043891 | glyceraldehyde-3-phosphate dehydrogenase (NAD+) (phosphorylating) activity(GO:0004365) glyceraldehyde-3-phosphate dehydrogenase (NAD(P)+) (phosphorylating) activity(GO:0043891) |
0.2 | 1.4 | GO:0004383 | guanylate cyclase activity(GO:0004383) |
0.2 | 0.5 | GO:0008240 | tripeptidyl-peptidase activity(GO:0008240) |
0.2 | 1.2 | GO:0051011 | microtubule minus-end binding(GO:0051011) |
0.1 | 4.6 | GO:0070888 | E-box binding(GO:0070888) |
0.1 | 0.6 | GO:0071987 | WD40-repeat domain binding(GO:0071987) |
0.1 | 0.7 | GO:0044323 | retinoic acid-responsive element binding(GO:0044323) |
0.1 | 0.6 | GO:1904288 | BAT3 complex binding(GO:1904288) |
0.1 | 0.1 | GO:0005237 | inhibitory extracellular ligand-gated ion channel activity(GO:0005237) extracellular-glycine-gated ion channel activity(GO:0016933) extracellular-glycine-gated chloride channel activity(GO:0016934) |
0.1 | 0.3 | GO:0031721 | hemoglobin alpha binding(GO:0031721) |
0.1 | 0.7 | GO:0003958 | NADPH-hemoprotein reductase activity(GO:0003958) |
0.1 | 1.0 | GO:0033691 | sialic acid binding(GO:0033691) |
0.1 | 0.6 | GO:0004528 | phosphodiesterase I activity(GO:0004528) |
0.1 | 2.0 | GO:0000146 | microfilament motor activity(GO:0000146) |
0.1 | 0.3 | GO:0061629 | RNA polymerase II sequence-specific DNA binding transcription factor binding(GO:0061629) |
0.1 | 0.8 | GO:0043495 | protein anchor(GO:0043495) |
0.1 | 0.4 | GO:0072542 | protein phosphatase activator activity(GO:0072542) |
0.1 | 1.9 | GO:0008413 | 8-oxo-7,8-dihydroguanosine triphosphate pyrophosphatase activity(GO:0008413) |
0.1 | 0.7 | GO:0070883 | pre-miRNA binding(GO:0070883) |
0.1 | 0.3 | GO:0015222 | serotonin transmembrane transporter activity(GO:0015222) |
0.1 | 0.4 | GO:0004999 | vasoactive intestinal polypeptide receptor activity(GO:0004999) |
0.1 | 1.6 | GO:0017160 | Ral GTPase binding(GO:0017160) |
0.1 | 0.4 | GO:0004813 | alanine-tRNA ligase activity(GO:0004813) |
0.1 | 2.3 | GO:0005229 | intracellular calcium activated chloride channel activity(GO:0005229) |
0.1 | 0.4 | GO:0004791 | thioredoxin-disulfide reductase activity(GO:0004791) |
0.1 | 0.7 | GO:0004075 | biotin carboxylase activity(GO:0004075) |
0.1 | 0.4 | GO:0030492 | hemoglobin binding(GO:0030492) |
0.1 | 2.1 | GO:0004708 | MAP kinase kinase activity(GO:0004708) |
0.1 | 0.9 | GO:1990381 | ubiquitin-specific protease binding(GO:1990381) |
0.1 | 2.5 | GO:0015035 | protein disulfide oxidoreductase activity(GO:0015035) |
0.1 | 0.4 | GO:0016520 | growth hormone-releasing hormone receptor activity(GO:0016520) |
0.1 | 0.9 | GO:0102338 | fatty acid elongase activity(GO:0009922) 3-oxo-arachidoyl-CoA synthase activity(GO:0102336) 3-oxo-cerotoyl-CoA synthase activity(GO:0102337) 3-oxo-lignoceronyl-CoA synthase activity(GO:0102338) |
0.1 | 0.4 | GO:0035175 | histone kinase activity (H3-S10 specific)(GO:0035175) |
0.1 | 0.4 | GO:0019166 | trans-2-enoyl-CoA reductase (NADPH) activity(GO:0019166) |
0.1 | 1.5 | GO:0001054 | RNA polymerase I activity(GO:0001054) |
0.1 | 1.1 | GO:0031432 | titin binding(GO:0031432) |
0.1 | 0.4 | GO:0070326 | very-low-density lipoprotein particle receptor binding(GO:0070326) |
0.1 | 0.4 | GO:0003829 | beta-1,3-galactosyl-O-glycosyl-glycoprotein beta-1,6-N-acetylglucosaminyltransferase activity(GO:0003829) |
0.1 | 2.4 | GO:0008198 | ferrous iron binding(GO:0008198) |
0.1 | 0.7 | GO:0005049 | nuclear export signal receptor activity(GO:0005049) |
0.1 | 0.8 | GO:0032454 | histone demethylase activity (H3-K9 specific)(GO:0032454) |
0.1 | 1.3 | GO:0008061 | chitin binding(GO:0008061) |
0.1 | 0.5 | GO:0015562 | efflux transmembrane transporter activity(GO:0015562) |
0.1 | 0.1 | GO:0008308 | voltage-gated anion channel activity(GO:0008308) |
0.1 | 0.8 | GO:0035005 | 1-phosphatidylinositol-4-phosphate 3-kinase activity(GO:0035005) |
0.1 | 0.2 | GO:0034416 | bisphosphoglycerate phosphatase activity(GO:0034416) |
0.1 | 0.5 | GO:0008379 | thioredoxin peroxidase activity(GO:0008379) |
0.1 | 0.6 | GO:0004716 | receptor signaling protein tyrosine kinase activity(GO:0004716) |
0.1 | 1.2 | GO:0004143 | diacylglycerol kinase activity(GO:0004143) |
0.1 | 2.1 | GO:0042166 | acetylcholine binding(GO:0042166) |
0.1 | 0.3 | GO:0035650 | AP-1 adaptor complex binding(GO:0035650) |
0.1 | 0.4 | GO:0035197 | siRNA binding(GO:0035197) |
0.1 | 0.7 | GO:0030957 | Tat protein binding(GO:0030957) |
0.1 | 0.9 | GO:0005068 | transmembrane receptor protein tyrosine kinase adaptor activity(GO:0005068) |
0.1 | 0.3 | GO:0030144 | alpha-1,6-mannosylglycoprotein 6-beta-N-acetylglucosaminyltransferase activity(GO:0030144) |
0.1 | 1.2 | GO:0097602 | cullin family protein binding(GO:0097602) |
0.1 | 0.4 | GO:0030911 | TPR domain binding(GO:0030911) |
0.1 | 0.5 | GO:0038085 | vascular endothelial growth factor binding(GO:0038085) |
0.1 | 0.5 | GO:0003828 | alpha-N-acetylneuraminate alpha-2,8-sialyltransferase activity(GO:0003828) |
0.1 | 1.2 | GO:0004865 | protein serine/threonine phosphatase inhibitor activity(GO:0004865) |
0.1 | 0.2 | GO:0034040 | lipid-transporting ATPase activity(GO:0034040) |
0.1 | 2.2 | GO:0008137 | NADH dehydrogenase (ubiquinone) activity(GO:0008137) NADH dehydrogenase (quinone) activity(GO:0050136) |
0.1 | 0.4 | GO:0004488 | methylenetetrahydrofolate dehydrogenase (NADP+) activity(GO:0004488) |
0.1 | 1.3 | GO:0070567 | cytidylyltransferase activity(GO:0070567) |
0.1 | 0.5 | GO:1990226 | histone methyltransferase binding(GO:1990226) |
0.1 | 0.3 | GO:0008309 | double-stranded DNA exodeoxyribonuclease activity(GO:0008309) |
0.1 | 0.7 | GO:0031730 | CCR5 chemokine receptor binding(GO:0031730) |
0.1 | 0.9 | GO:0034842 | 3-oxo-2-(2'-pentenyl)cyclopentane-1-octanoic acid CoA ligase activity(GO:0010435) 3-isopropenyl-6-oxoheptanoyl-CoA synthetase activity(GO:0018854) 2-oxo-delta3-4,5,5-trimethylcyclopentenylacetyl-CoA synthetase activity(GO:0018855) benzoyl acetate-CoA ligase activity(GO:0018856) 2,4-dichlorobenzoate-CoA ligase activity(GO:0018857) pivalate-CoA ligase activity(GO:0034783) cyclopropanecarboxylate-CoA ligase activity(GO:0034793) adipate-CoA ligase activity(GO:0034796) citronellyl-CoA ligase activity(GO:0034823) mentha-1,3-dione-CoA ligase activity(GO:0034841) thiophene-2-carboxylate-CoA ligase activity(GO:0034842) 2,4,4-trimethylpentanoate-CoA ligase activity(GO:0034865) cis-2-methyl-5-isopropylhexa-2,5-dienoate-CoA ligase activity(GO:0034942) trans-2-methyl-5-isopropylhexa-2,5-dienoate-CoA ligase activity(GO:0034943) branched-chain acyl-CoA synthetase (ADP-forming) activity(GO:0043759) aryl-CoA synthetase (ADP-forming) activity(GO:0043762) 3-hydroxypropionyl-CoA synthetase activity(GO:0043955) perillic acid:CoA ligase (ADP-forming) activity(GO:0052685) perillic acid:CoA ligase (AMP-forming) activity(GO:0052686) (3R)-3-isopropenyl-6-oxoheptanoate:CoA ligase (ADP-forming) activity(GO:0052687) (3R)-3-isopropenyl-6-oxoheptanoate:CoA ligase (AMP-forming) activity(GO:0052688) pristanate-CoA ligase activity(GO:0070251) malonyl-CoA synthetase activity(GO:0090409) |
0.1 | 4.7 | GO:0003730 | mRNA 3'-UTR binding(GO:0003730) |
0.1 | 0.5 | GO:0048406 | nerve growth factor binding(GO:0048406) |
0.1 | 0.6 | GO:0030368 | interleukin-17 receptor activity(GO:0030368) |
0.1 | 0.3 | GO:0004965 | G-protein coupled GABA receptor activity(GO:0004965) |
0.1 | 0.1 | GO:0045340 | mercury ion binding(GO:0045340) |
0.1 | 0.3 | GO:0019961 | interferon binding(GO:0019961) |
0.1 | 0.4 | GO:0047238 | glucuronosyl-N-acetylgalactosaminyl-proteoglycan 4-beta-N-acetylgalactosaminyltransferase activity(GO:0047238) |
0.1 | 0.8 | GO:0005247 | voltage-gated chloride channel activity(GO:0005247) |
0.1 | 0.4 | GO:0005030 | neurotrophin receptor activity(GO:0005030) |
0.1 | 0.7 | GO:0004972 | NMDA glutamate receptor activity(GO:0004972) |
0.1 | 0.6 | GO:0070991 | medium-chain-acyl-CoA dehydrogenase activity(GO:0070991) |
0.1 | 0.4 | GO:0005344 | oxygen transporter activity(GO:0005344) |
0.1 | 0.3 | GO:0008898 | S-adenosylmethionine-homocysteine S-methyltransferase activity(GO:0008898) |
0.1 | 0.4 | GO:0047429 | nucleoside-triphosphate diphosphatase activity(GO:0047429) |
0.1 | 0.6 | GO:0050700 | CARD domain binding(GO:0050700) |
0.1 | 0.6 | GO:0019957 | C-C chemokine binding(GO:0019957) |
0.1 | 0.6 | GO:0001849 | complement component C1q binding(GO:0001849) |
0.1 | 0.4 | GO:0035241 | protein-arginine omega-N monomethyltransferase activity(GO:0035241) |
0.1 | 0.5 | GO:0004468 | lysine N-acetyltransferase activity, acting on acetyl phosphate as donor(GO:0004468) |
0.1 | 1.2 | GO:0042608 | T cell receptor binding(GO:0042608) |
0.1 | 0.3 | GO:0008142 | oxysterol binding(GO:0008142) |
0.1 | 1.1 | GO:0005221 | intracellular cyclic nucleotide activated cation channel activity(GO:0005221) cyclic nucleotide-gated ion channel activity(GO:0043855) |
0.1 | 0.4 | GO:0016841 | ammonia-lyase activity(GO:0016841) |
0.1 | 0.5 | GO:0016778 | diphosphotransferase activity(GO:0016778) |
0.1 | 0.9 | GO:0070742 | C2H2 zinc finger domain binding(GO:0070742) |
0.1 | 0.4 | GO:0016286 | small conductance calcium-activated potassium channel activity(GO:0016286) |
0.1 | 0.5 | GO:0008603 | cAMP-dependent protein kinase regulator activity(GO:0008603) |
0.1 | 0.4 | GO:0035612 | AP-2 adaptor complex binding(GO:0035612) |
0.1 | 1.4 | GO:0015095 | magnesium ion transmembrane transporter activity(GO:0015095) |
0.1 | 1.9 | GO:0030332 | cyclin binding(GO:0030332) |
0.1 | 1.7 | GO:0016917 | GABA receptor activity(GO:0016917) |
0.1 | 0.8 | GO:0008331 | high voltage-gated calcium channel activity(GO:0008331) |
0.1 | 0.3 | GO:0030375 | thyroid hormone receptor coactivator activity(GO:0030375) |
0.1 | 0.6 | GO:0005315 | inorganic phosphate transmembrane transporter activity(GO:0005315) |
0.1 | 0.3 | GO:0035727 | lysophosphatidic acid binding(GO:0035727) |
0.1 | 0.5 | GO:0003909 | DNA ligase activity(GO:0003909) DNA ligase (ATP) activity(GO:0003910) |
0.1 | 0.9 | GO:0042043 | neurexin family protein binding(GO:0042043) |
0.1 | 3.8 | GO:0032947 | protein complex scaffold(GO:0032947) |
0.1 | 0.3 | GO:0016149 | translation release factor activity, codon specific(GO:0016149) |
0.1 | 0.2 | GO:0033829 | O-fucosylpeptide 3-beta-N-acetylglucosaminyltransferase activity(GO:0033829) |
0.1 | 0.3 | GO:0004849 | uridine kinase activity(GO:0004849) |
0.1 | 0.5 | GO:0070324 | thyroid hormone binding(GO:0070324) |
0.1 | 0.2 | GO:0042296 | ISG15 transferase activity(GO:0042296) |
0.1 | 0.7 | GO:0098988 | G-protein coupled glutamate receptor activity(GO:0098988) |
0.1 | 0.5 | GO:0015288 | porin activity(GO:0015288) |
0.1 | 0.2 | GO:0048763 | calcium-induced calcium release activity(GO:0048763) |
0.1 | 0.4 | GO:0052724 | inositol hexakisphosphate kinase activity(GO:0000828) inositol hexakisphosphate 5-kinase activity(GO:0000832) inositol hexakisphosphate 1-kinase activity(GO:0052723) inositol hexakisphosphate 3-kinase activity(GO:0052724) |
0.1 | 0.1 | GO:0070915 | lysophosphatidic acid receptor activity(GO:0070915) |
0.1 | 0.2 | GO:0043140 | ATP-dependent 3'-5' DNA helicase activity(GO:0043140) |
0.1 | 0.5 | GO:0004768 | stearoyl-CoA 9-desaturase activity(GO:0004768) |
0.1 | 0.2 | GO:0030350 | iron-responsive element binding(GO:0030350) |
0.1 | 0.9 | GO:0008574 | ATP-dependent microtubule motor activity, plus-end-directed(GO:0008574) |
0.1 | 0.2 | GO:0051425 | PTB domain binding(GO:0051425) |
0.1 | 0.9 | GO:0043733 | alkylbase DNA N-glycosylase activity(GO:0003905) DNA-3-methylbase glycosylase activity(GO:0043733) |
0.1 | 0.2 | GO:0004829 | threonine-tRNA ligase activity(GO:0004829) |
0.1 | 1.7 | GO:0005212 | structural constituent of eye lens(GO:0005212) |
0.1 | 1.7 | GO:0043015 | gamma-tubulin binding(GO:0043015) |
0.1 | 0.6 | GO:0036310 | annealing helicase activity(GO:0036310) |
0.1 | 0.3 | GO:0004035 | alkaline phosphatase activity(GO:0004035) |
0.1 | 0.1 | GO:0030620 | U2 snRNA binding(GO:0030620) |
0.1 | 2.0 | GO:0031369 | translation initiation factor binding(GO:0031369) |
0.1 | 4.1 | GO:0000033 | alpha-1,3-mannosyltransferase activity(GO:0000033) |
0.1 | 0.2 | GO:0008260 | 3-oxoacid CoA-transferase activity(GO:0008260) |
0.1 | 0.4 | GO:0047035 | testosterone dehydrogenase (NAD+) activity(GO:0047035) |
0.1 | 0.2 | GO:0016716 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, another compound as one donor, and incorporation of one atom of oxygen(GO:0016716) |
0.1 | 0.2 | GO:0030297 | transmembrane receptor protein tyrosine kinase activator activity(GO:0030297) |
0.1 | 0.3 | GO:0070095 | fructose-6-phosphate binding(GO:0070095) |
0.1 | 0.3 | GO:0032184 | SUMO polymer binding(GO:0032184) |
0.1 | 0.6 | GO:0004438 | phosphatidylinositol-3-phosphatase activity(GO:0004438) |
0.1 | 0.8 | GO:0070402 | NADPH binding(GO:0070402) |
0.1 | 0.2 | GO:0005483 | soluble NSF attachment protein activity(GO:0005483) |
0.1 | 0.2 | GO:0004980 | melanocyte-stimulating hormone receptor activity(GO:0004980) |
0.1 | 0.8 | GO:0001848 | complement binding(GO:0001848) |
0.1 | 0.3 | GO:0001665 | alpha-N-acetylgalactosaminide alpha-2,6-sialyltransferase activity(GO:0001665) |
0.1 | 0.1 | GO:0004942 | anaphylatoxin receptor activity(GO:0004942) |
0.1 | 1.2 | GO:0004864 | protein phosphatase inhibitor activity(GO:0004864) |
0.1 | 0.8 | GO:0004622 | lysophospholipase activity(GO:0004622) |
0.1 | 0.1 | GO:0008905 | mannose-phosphate guanylyltransferase activity(GO:0008905) |
0.1 | 0.3 | GO:0035368 | selenocysteine insertion sequence binding(GO:0035368) |
0.1 | 0.1 | GO:0032139 | DNA insertion or deletion binding(GO:0032135) dinucleotide insertion or deletion binding(GO:0032139) |
0.1 | 1.1 | GO:0030515 | snoRNA binding(GO:0030515) |
0.1 | 0.2 | GO:0097157 | pre-mRNA intronic binding(GO:0097157) |
0.1 | 0.5 | GO:0008432 | JUN kinase binding(GO:0008432) |
0.1 | 0.3 | GO:0004634 | phosphopyruvate hydratase activity(GO:0004634) |
0.1 | 0.6 | GO:0004526 | ribonuclease P activity(GO:0004526) |
0.1 | 0.3 | GO:0019911 | structural constituent of myelin sheath(GO:0019911) |
0.1 | 0.2 | GO:0004731 | purine-nucleoside phosphorylase activity(GO:0004731) |
0.1 | 0.7 | GO:0008601 | protein phosphatase type 2A regulator activity(GO:0008601) |
0.1 | 0.1 | GO:0008310 | single-stranded DNA 3'-5' exodeoxyribonuclease activity(GO:0008310) |
0.1 | 0.9 | GO:0015925 | galactosidase activity(GO:0015925) |
0.1 | 0.1 | GO:0033677 | DNA/RNA helicase activity(GO:0033677) |
0.1 | 1.4 | GO:0005104 | fibroblast growth factor receptor binding(GO:0005104) |
0.1 | 0.1 | GO:0015111 | iodide transmembrane transporter activity(GO:0015111) |
0.1 | 0.2 | GO:0060230 | lipoprotein lipase activator activity(GO:0060230) |
0.1 | 0.6 | GO:0000400 | four-way junction DNA binding(GO:0000400) |
0.1 | 0.4 | GO:0019888 | protein phosphatase regulator activity(GO:0019888) |
0.1 | 0.1 | GO:0001224 | RNA polymerase II transcription cofactor binding(GO:0001224) |
0.1 | 0.2 | GO:1901612 | cardiolipin binding(GO:1901612) |
0.1 | 0.2 | GO:0004505 | phenylalanine 4-monooxygenase activity(GO:0004505) |
0.1 | 0.4 | GO:0045309 | protein phosphorylated amino acid binding(GO:0045309) |
0.1 | 0.3 | GO:0050733 | RS domain binding(GO:0050733) |
0.1 | 0.2 | GO:0008970 | phosphatidylcholine 1-acylhydrolase activity(GO:0008970) |
0.0 | 0.1 | GO:0000386 | second spliceosomal transesterification activity(GO:0000386) |
0.0 | 0.2 | GO:0004969 | histamine receptor activity(GO:0004969) |
0.0 | 0.0 | GO:0051880 | G-quadruplex DNA binding(GO:0051880) |
0.0 | 0.3 | GO:0047372 | acylglycerol lipase activity(GO:0047372) |
0.0 | 0.2 | GO:0004769 | steroid delta-isomerase activity(GO:0004769) |
0.0 | 1.5 | GO:0005132 | type I interferon receptor binding(GO:0005132) |
0.0 | 0.1 | GO:0004663 | Rab geranylgeranyltransferase activity(GO:0004663) |
0.0 | 1.6 | GO:0048487 | beta-tubulin binding(GO:0048487) |
0.0 | 0.2 | GO:0070891 | lipoteichoic acid binding(GO:0070891) |
0.0 | 0.1 | GO:0005157 | macrophage colony-stimulating factor receptor binding(GO:0005157) |
0.0 | 0.6 | GO:0008143 | poly(A) binding(GO:0008143) |
0.0 | 0.0 | GO:0046934 | phosphatidylinositol-4,5-bisphosphate 3-kinase activity(GO:0046934) |
0.0 | 0.0 | GO:0070573 | metallodipeptidase activity(GO:0070573) |
0.0 | 0.6 | GO:0043539 | protein serine/threonine kinase activator activity(GO:0043539) |
0.0 | 0.8 | GO:0043395 | heparan sulfate proteoglycan binding(GO:0043395) |
0.0 | 0.6 | GO:0001784 | phosphotyrosine binding(GO:0001784) |
0.0 | 0.2 | GO:0019238 | cyclohydrolase activity(GO:0019238) |
0.0 | 0.1 | GO:0043141 | ATP-dependent 5'-3' DNA helicase activity(GO:0043141) |
0.0 | 0.2 | GO:0031419 | cobalamin binding(GO:0031419) |
0.0 | 0.9 | GO:0005086 | ARF guanyl-nucleotide exchange factor activity(GO:0005086) |
0.0 | 0.3 | GO:0034046 | poly(G) binding(GO:0034046) |
0.0 | 0.1 | GO:0008454 | alpha-1,3-mannosylglycoprotein 4-beta-N-acetylglucosaminyltransferase activity(GO:0008454) |
0.0 | 0.1 | GO:0030572 | cardiolipin synthase activity(GO:0008808) phosphatidyltransferase activity(GO:0030572) |
0.0 | 0.2 | GO:0017040 | ceramidase activity(GO:0017040) |
0.0 | 0.0 | GO:0002134 | UTP binding(GO:0002134) pyrimidine ribonucleoside binding(GO:0032551) |
0.0 | 0.5 | GO:0016929 | SUMO-specific protease activity(GO:0016929) |
0.0 | 0.2 | GO:0004594 | pantothenate kinase activity(GO:0004594) |
0.0 | 0.1 | GO:0035497 | cAMP response element binding(GO:0035497) |
0.0 | 0.3 | GO:0004579 | dolichyl-diphosphooligosaccharide-protein glycotransferase activity(GO:0004579) |
0.0 | 0.2 | GO:0005143 | interleukin-12 receptor binding(GO:0005143) |
0.0 | 0.6 | GO:0004435 | phosphatidylinositol phospholipase C activity(GO:0004435) |
0.0 | 0.4 | GO:0017154 | semaphorin receptor activity(GO:0017154) |
0.0 | 0.2 | GO:0030983 | mismatched DNA binding(GO:0030983) |
0.0 | 0.3 | GO:0016888 | endodeoxyribonuclease activity, producing 5'-phosphomonoesters(GO:0016888) |
0.0 | 0.3 | GO:0030553 | cGMP binding(GO:0030553) |
0.0 | 0.4 | GO:0016868 | intramolecular transferase activity, phosphotransferases(GO:0016868) |
0.0 | 0.3 | GO:0008656 | cysteine-type endopeptidase activator activity involved in apoptotic process(GO:0008656) |
0.0 | 2.8 | GO:0016782 | transferase activity, transferring sulfur-containing groups(GO:0016782) |
0.0 | 0.2 | GO:0004144 | diacylglycerol O-acyltransferase activity(GO:0004144) |
0.0 | 0.1 | GO:0004833 | tryptophan 2,3-dioxygenase activity(GO:0004833) |
0.0 | 0.1 | GO:0036435 | K48-linked polyubiquitin binding(GO:0036435) |
0.0 | 0.2 | GO:0000217 | DNA secondary structure binding(GO:0000217) |
0.0 | 1.1 | GO:0005154 | epidermal growth factor receptor binding(GO:0005154) |
0.0 | 0.1 | GO:0043176 | amine binding(GO:0043176) |
0.0 | 0.2 | GO:0008301 | DNA binding, bending(GO:0008301) |
0.0 | 0.2 | GO:0008390 | testosterone 16-alpha-hydroxylase activity(GO:0008390) |
0.0 | 0.1 | GO:0019211 | phosphatase activator activity(GO:0019211) |
0.0 | 0.0 | GO:0008532 | N-acetyllactosaminide beta-1,3-N-acetylglucosaminyltransferase activity(GO:0008532) |
0.0 | 0.2 | GO:0001601 | peptide YY receptor activity(GO:0001601) |
0.0 | 0.1 | GO:0004514 | nicotinate-nucleotide diphosphorylase (carboxylating) activity(GO:0004514) |
0.0 | 0.1 | GO:0004667 | prostaglandin-D synthase activity(GO:0004667) |
0.0 | 0.0 | GO:0071532 | ankyrin repeat binding(GO:0071532) |
0.0 | 0.1 | GO:0046935 | 1-phosphatidylinositol-3-kinase regulator activity(GO:0046935) |
0.0 | 0.0 | GO:0016508 | long-chain-enoyl-CoA hydratase activity(GO:0016508) |
0.0 | 0.1 | GO:0016015 | morphogen activity(GO:0016015) |
0.0 | 1.6 | GO:0030276 | clathrin binding(GO:0030276) |
0.0 | 0.1 | GO:0031694 | alpha-2A adrenergic receptor binding(GO:0031694) |
0.0 | 0.8 | GO:0019706 | protein-cysteine S-palmitoyltransferase activity(GO:0019706) |
0.0 | 0.5 | GO:0008252 | nucleotidase activity(GO:0008252) |
0.0 | 0.3 | GO:0004596 | peptide alpha-N-acetyltransferase activity(GO:0004596) |
0.0 | 0.2 | GO:0008526 | phosphatidylinositol transporter activity(GO:0008526) |
0.0 | 0.2 | GO:0000064 | L-ornithine transmembrane transporter activity(GO:0000064) |
0.0 | 0.2 | GO:0001609 | G-protein coupled adenosine receptor activity(GO:0001609) |
0.0 | 0.1 | GO:2001070 | starch binding(GO:2001070) |
0.0 | 0.1 | GO:0008113 | peptide-methionine (S)-S-oxide reductase activity(GO:0008113) |
0.0 | 0.2 | GO:0043138 | 3'-5' DNA helicase activity(GO:0043138) |
0.0 | 0.1 | GO:0031493 | nucleosomal histone binding(GO:0031493) |
0.0 | 0.5 | GO:0008327 | methyl-CpG binding(GO:0008327) |
0.0 | 0.1 | GO:0097322 | 7SK snRNA binding(GO:0097322) |
0.0 | 1.7 | GO:0003697 | single-stranded DNA binding(GO:0003697) |
0.0 | 0.1 | GO:0016671 | oxidoreductase activity, acting on a sulfur group of donors, disulfide as acceptor(GO:0016671) |
0.0 | 0.1 | GO:0051377 | mannose-ethanolamine phosphotransferase activity(GO:0051377) |
0.0 | 0.2 | GO:0019784 | NEDD8-specific protease activity(GO:0019784) |
0.0 | 0.7 | GO:0004693 | cyclin-dependent protein serine/threonine kinase activity(GO:0004693) cyclin-dependent protein kinase activity(GO:0097472) |
0.0 | 0.2 | GO:0061505 | DNA topoisomerase type II (ATP-hydrolyzing) activity(GO:0003918) DNA topoisomerase II activity(GO:0061505) |
0.0 | 0.1 | GO:0016886 | ligase activity, forming phosphoric ester bonds(GO:0016886) |
0.0 | 0.0 | GO:0017099 | very-long-chain-acyl-CoA dehydrogenase activity(GO:0017099) |
0.0 | 0.1 | GO:0102345 | 3-hydroxyacyl-CoA dehydratase activity(GO:0018812) 3-hydroxy-behenoyl-CoA dehydratase activity(GO:0102344) 3-hydroxy-lignoceroyl-CoA dehydratase activity(GO:0102345) |
0.0 | 0.7 | GO:0001540 | beta-amyloid binding(GO:0001540) |
0.0 | 1.2 | GO:0044824 | integrase activity(GO:0008907) T/G mismatch-specific endonuclease activity(GO:0043765) retroviral integrase activity(GO:0044823) retroviral 3' processing activity(GO:0044824) |
0.0 | 0.1 | GO:0070569 | uridylyltransferase activity(GO:0070569) |
0.0 | 0.1 | GO:0005275 | amine transmembrane transporter activity(GO:0005275) |
0.0 | 0.1 | GO:0004031 | aldehyde oxidase activity(GO:0004031) oxidoreductase activity, acting on the aldehyde or oxo group of donors, oxygen as acceptor(GO:0016623) |
0.0 | 0.2 | GO:0016308 | 1-phosphatidylinositol-4-phosphate 5-kinase activity(GO:0016308) |
0.0 | 0.1 | GO:0016532 | superoxide dismutase copper chaperone activity(GO:0016532) |
0.0 | 0.0 | GO:0004741 | [pyruvate dehydrogenase (lipoamide)] phosphatase activity(GO:0004741) |
0.0 | 0.0 | GO:0032422 | purine-rich negative regulatory element binding(GO:0032422) |
0.0 | 0.1 | GO:0001075 | transcription factor activity, RNA polymerase II core promoter sequence-specific binding involved in preinitiation complex assembly(GO:0001075) |
0.0 | 0.1 | GO:2001069 | glycogen binding(GO:2001069) |
0.0 | 0.1 | GO:0051959 | dynein light intermediate chain binding(GO:0051959) |
0.0 | 0.2 | GO:1990841 | promoter-specific chromatin binding(GO:1990841) |
0.0 | 0.1 | GO:0004703 | G-protein coupled receptor kinase activity(GO:0004703) |
0.0 | 0.2 | GO:0000182 | rDNA binding(GO:0000182) |
0.0 | 0.1 | GO:0016421 | CoA carboxylase activity(GO:0016421) |
0.0 | 0.0 | GO:0001884 | pyrimidine nucleoside binding(GO:0001884) |
0.0 | 0.4 | GO:0071837 | HMG box domain binding(GO:0071837) |
0.0 | 0.1 | GO:0015057 | thrombin receptor activity(GO:0015057) |
0.0 | 0.3 | GO:0001056 | RNA polymerase III activity(GO:0001056) |
0.0 | 0.2 | GO:0022889 | L-serine transmembrane transporter activity(GO:0015194) serine transmembrane transporter activity(GO:0022889) |
0.0 | 0.2 | GO:0018449 | pinocarveol dehydrogenase activity(GO:0018446) chloral hydrate dehydrogenase activity(GO:0018447) hydroxymethylmethylsilanediol oxidase activity(GO:0018448) 1-phenylethanol dehydrogenase activity(GO:0018449) myrtenol dehydrogenase activity(GO:0018450) cis-1,2-dihydroxy-1,2-dihydro-8-carboxynaphthalene dehydrogenase activity(GO:0034522) 3-hydroxy-4-methyloctanoyl-CoA dehydrogenase activity(GO:0034582) 2-hydroxy-4-isopropenylcyclohexane-1-carboxyl-CoA dehydrogenase activity(GO:0034778) cis-9,10-dihydroanthracene-9,10-diol dehydrogenase activity(GO:0034817) citronellol dehydrogenase activity(GO:0034821) naphthyl-2-hydroxymethyl-succinyl-CoA dehydrogenase activity(GO:0034847) 2,4,4-trimethyl-1-pentanol dehydrogenase activity(GO:0034863) 2,4,4-trimethyl-3-hydroxypentanoyl-CoA dehydrogenase activity(GO:0034868) 1-hydroxy-4,4-dimethylpentan-3-one dehydrogenase activity(GO:0034871) endosulfan diol dehydrogenase activity(GO:0034891) endosulfan hydroxyether dehydrogenase activity(GO:0034901) 3-hydroxy-2-methylhexanoyl-CoA dehydrogenase activity(GO:0034918) 3-hydroxy-2,6-dimethyl-5-methylene-heptanoyl-CoA dehydrogenase activity(GO:0034944) versicolorin reductase activity(GO:0042469) ketoreductase activity(GO:0045703) |
0.0 | 0.1 | GO:0004949 | cannabinoid receptor activity(GO:0004949) |
0.0 | 0.1 | GO:0004977 | melanocortin receptor activity(GO:0004977) |
0.0 | 0.4 | GO:0004012 | phospholipid-translocating ATPase activity(GO:0004012) |
0.0 | 0.8 | GO:0031490 | chromatin DNA binding(GO:0031490) |
0.0 | 0.1 | GO:0015450 | P-P-bond-hydrolysis-driven protein transmembrane transporter activity(GO:0015450) |
0.0 | 0.0 | GO:0071535 | RING-like zinc finger domain binding(GO:0071535) |
0.0 | 0.2 | GO:0031386 | protein tag(GO:0031386) |
0.0 | 0.0 | GO:0004694 | eukaryotic translation initiation factor 2alpha kinase activity(GO:0004694) |
0.0 | 0.2 | GO:0000980 | RNA polymerase II distal enhancer sequence-specific DNA binding(GO:0000980) |
0.0 | 0.0 | GO:0004887 | thyroid hormone receptor activity(GO:0004887) |
0.0 | 0.0 | GO:0070840 | dynein complex binding(GO:0070840) |
0.0 | 0.2 | GO:0022821 | potassium ion antiporter activity(GO:0022821) |
0.0 | 0.0 | GO:0052658 | inositol-1,4,5-trisphosphate 5-phosphatase activity(GO:0052658) |
0.0 | 1.1 | GO:0004722 | protein serine/threonine phosphatase activity(GO:0004722) |
0.0 | 0.6 | GO:0031491 | nucleosome binding(GO:0031491) |
0.0 | 0.1 | GO:0008353 | RNA polymerase II carboxy-terminal domain kinase activity(GO:0008353) |
0.0 | 0.2 | GO:0070403 | NAD+ binding(GO:0070403) |
0.0 | 0.0 | GO:0035515 | oxidative RNA demethylase activity(GO:0035515) |
0.0 | 0.2 | GO:0016594 | glycine binding(GO:0016594) |
0.0 | 0.4 | GO:0005149 | interleukin-1 receptor binding(GO:0005149) |
0.0 | 0.1 | GO:0038100 | nodal binding(GO:0038100) |
0.0 | 0.2 | GO:0016805 | dipeptidase activity(GO:0016805) |
0.0 | 0.1 | GO:0016714 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, reduced pteridine as one donor, and incorporation of one atom of oxygen(GO:0016714) |
0.0 | 0.1 | GO:0031727 | CCR2 chemokine receptor binding(GO:0031727) |
0.0 | 0.6 | GO:0061631 | ubiquitin conjugating enzyme activity(GO:0061631) |
0.0 | 0.7 | GO:0033038 | bitter taste receptor activity(GO:0033038) |
0.0 | 0.0 | GO:0070878 | primary miRNA binding(GO:0070878) |
0.0 | 0.1 | GO:0031078 | histone deacetylase activity (H3-K14 specific)(GO:0031078) NAD-dependent histone deacetylase activity (H3-K14 specific)(GO:0032041) |
0.0 | 0.1 | GO:0004937 | alpha1-adrenergic receptor activity(GO:0004937) |
0.0 | 0.1 | GO:0019960 | C-X3-C chemokine binding(GO:0019960) |
0.0 | 0.1 | GO:0035184 | histone threonine kinase activity(GO:0035184) |
0.0 | 0.5 | GO:0001102 | RNA polymerase II activating transcription factor binding(GO:0001102) |
0.0 | 0.4 | GO:0022839 | ion gated channel activity(GO:0022839) |
0.0 | 0.1 | GO:0008900 | hydrogen:potassium-exchanging ATPase activity(GO:0008900) |
0.0 | 0.1 | GO:0004719 | protein-L-isoaspartate (D-aspartate) O-methyltransferase activity(GO:0004719) |
0.0 | 0.1 | GO:0102391 | decanoate--CoA ligase activity(GO:0102391) |
0.0 | 0.1 | GO:0008853 | exodeoxyribonuclease III activity(GO:0008853) |
0.0 | 0.3 | GO:0004629 | phospholipase C activity(GO:0004629) |
0.0 | 0.0 | GO:0004064 | arylesterase activity(GO:0004064) |
0.0 | 0.0 | GO:0004886 | 9-cis retinoic acid receptor activity(GO:0004886) |
0.0 | 0.6 | GO:0004402 | histone acetyltransferase activity(GO:0004402) |
0.0 | 0.3 | GO:0042056 | chemoattractant activity(GO:0042056) |
0.0 | 0.1 | GO:0042015 | interleukin-20 binding(GO:0042015) |
0.0 | 0.0 | GO:0004300 | enoyl-CoA hydratase activity(GO:0004300) |
0.0 | 0.0 | GO:0004720 | protein-lysine 6-oxidase activity(GO:0004720) |
0.0 | 0.1 | GO:0042979 | ornithine decarboxylase regulator activity(GO:0042979) |
0.0 | 0.1 | GO:0004645 | phosphorylase activity(GO:0004645) |
0.0 | 0.0 | GO:0003986 | acetyl-CoA hydrolase activity(GO:0003986) |
0.0 | 0.0 | GO:0043515 | kinetochore binding(GO:0043515) |
0.0 | 0.1 | GO:0016646 | oxidoreductase activity, acting on the CH-NH group of donors, NAD or NADP as acceptor(GO:0016646) |
0.0 | 0.0 | GO:0004551 | nucleotide diphosphatase activity(GO:0004551) |
0.0 | 0.1 | GO:0055056 | D-glucose transmembrane transporter activity(GO:0055056) |
0.0 | 0.1 | GO:0005375 | copper ion transmembrane transporter activity(GO:0005375) |
0.0 | 0.2 | GO:0003746 | translation elongation factor activity(GO:0003746) |
0.0 | 0.1 | GO:0017151 | DEAD/H-box RNA helicase binding(GO:0017151) |
0.0 | 0.1 | GO:0016861 | intramolecular oxidoreductase activity, interconverting aldoses and ketoses(GO:0016861) |
0.0 | 0.1 | GO:0003688 | DNA replication origin binding(GO:0003688) |
0.0 | 0.1 | GO:0033695 | oxidoreductase activity, acting on CH or CH2 groups, quinone or similar compound as acceptor(GO:0033695) caffeine oxidase activity(GO:0034875) |
0.0 | 0.1 | GO:0080014 | 3-(3-hydroxyphenyl)propionate hydroxylase activity(GO:0008688) 4-chlorobenzaldehyde oxidase activity(GO:0018471) 3,5-xylenol methylhydroxylase activity(GO:0018630) phenylacetate hydroxylase activity(GO:0018631) 4-nitrophenol 4-monooxygenase activity(GO:0018632) dimethyl sulfide monooxygenase activity(GO:0018633) alpha-pinene monooxygenase [NADH] activity(GO:0018634) 1-hydroxy-2-naphthoate hydroxylase activity(GO:0018637) toluene 4-monooxygenase activity(GO:0018638) xylene monooxygenase activity(GO:0018639) dibenzothiophene monooxygenase activity(GO:0018640) 6-hydroxy-3-methyl-2-oxo-1,2-dihydroquinoline 6-monooxygenase activity(GO:0018641) chlorophenol 4-monooxygenase activity(GO:0018642) carbon disulfide oxygenase activity(GO:0018643) toluene 2-monooxygenase activity(GO:0018644) 1-hydroxy-2-oxolimonene 1,2-monooxygenase activity(GO:0018646) phenanthrene 1,2-monooxygenase activity(GO:0018647) tetrahydrofuran hydroxylase activity(GO:0018649) styrene monooxygenase activity(GO:0018650) toluene-4-sulfonate monooxygenase activity(GO:0018651) toluene-sulfonate methyl-monooxygenase activity(GO:0018652) 3-methyl-2-oxo-1,2-dihydroquinoline 6-monooxygenase activity(GO:0018653) 2-hydroxy-phenylacetate hydroxylase activity(GO:0018654) 2-oxo-delta3-4,5,5-trimethylcyclopentenylacetyl-CoA 1,2-monooxygenase activity(GO:0018655) phenanthrene 3,4-monooxygenase activity(GO:0018656) toluene 3-monooxygenase activity(GO:0018657) 4-hydroxyphenylacetate,NADH:oxygen oxidoreductase (3-hydroxylating) activity(GO:0018660) limonene monooxygenase activity(GO:0019113) 2-methylnaphthalene hydroxylase activity(GO:0034526) 1-methylnaphthalene hydroxylase activity(GO:0034534) bisphenol A hydroxylase A activity(GO:0034560) salicylate 5-hydroxylase activity(GO:0034785) isobutylamine N-hydroxylase activity(GO:0034791) branched-chain dodecylbenzene sulfonate monooxygenase activity(GO:0034802) 3-HSA hydroxylase activity(GO:0034819) 4-hydroxypyridine-3-hydroxylase activity(GO:0034894) 2-octaprenyl-3-methyl-6-methoxy-1,4-benzoquinol hydroxylase activity(GO:0043719) 6-hydroxynicotinate 3-monooxygenase activity(GO:0043731) thalianol hydroxylase activity(GO:0080014) |
0.0 | 0.0 | GO:0034186 | apolipoprotein A-I binding(GO:0034186) |
0.0 | 0.0 | GO:0051733 | ATP-dependent polydeoxyribonucleotide 5'-hydroxyl-kinase activity(GO:0046404) polydeoxyribonucleotide kinase activity(GO:0051733) |
0.0 | 0.0 | GO:0097001 | ceramide binding(GO:0097001) |
0.0 | 0.1 | GO:0015279 | store-operated calcium channel activity(GO:0015279) |
0.0 | 0.0 | GO:0008889 | glycerophosphodiester phosphodiesterase activity(GO:0008889) |
0.0 | 0.0 | GO:0036033 | mediator complex binding(GO:0036033) |
0.0 | 3.2 | GO:0001228 | transcriptional activator activity, RNA polymerase II transcription regulatory region sequence-specific binding(GO:0001228) |
0.0 | 0.1 | GO:0003854 | 3-beta-hydroxy-delta5-steroid dehydrogenase activity(GO:0003854) |
0.0 | 0.0 | GO:0010861 | thyroid hormone receptor activator activity(GO:0010861) |
0.0 | 0.0 | GO:0032407 | MutSalpha complex binding(GO:0032407) |
0.0 | 0.0 | GO:0004563 | beta-N-acetylhexosaminidase activity(GO:0004563) |
0.0 | 0.2 | GO:0015020 | glucuronosyltransferase activity(GO:0015020) |
0.0 | 0.1 | GO:0016493 | C-C chemokine receptor activity(GO:0016493) |
0.0 | 0.0 | GO:0019788 | NEDD8 transferase activity(GO:0019788) |
0.0 | 0.1 | GO:0070034 | telomerase RNA binding(GO:0070034) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.2 | 0.5 | PID AVB3 OPN PATHWAY | Osteopontin-mediated events |
0.2 | 3.7 | PID ERBB NETWORK PATHWAY | ErbB receptor signaling network |
0.2 | 4.1 | PID ARF 3PATHWAY | Arf1 pathway |
0.2 | 3.1 | PID SYNDECAN 3 PATHWAY | Syndecan-3-mediated signaling events |
0.2 | 1.7 | ST TYPE I INTERFERON PATHWAY | Type I Interferon (alpha/beta IFN) Pathway |
0.2 | 0.2 | PID EPHA2 FWD PATHWAY | EPHA2 forward signaling |
0.1 | 0.1 | PID IGF1 PATHWAY | IGF1 pathway |
0.1 | 3.9 | PID REELIN PATHWAY | Reelin signaling pathway |
0.1 | 0.5 | PID IL6 7 PATHWAY | IL6-mediated signaling events |
0.1 | 0.2 | PID TCR RAS PATHWAY | Ras signaling in the CD4+ TCR pathway |
0.1 | 0.1 | PID BETA CATENIN DEG PATHWAY | Degradation of beta catenin |
0.1 | 4.3 | PID AJDISS 2PATHWAY | Posttranslational regulation of adherens junction stability and dissassembly |
0.1 | 0.2 | PID INTEGRIN1 PATHWAY | Beta1 integrin cell surface interactions |
0.1 | 3.0 | PID HDAC CLASSII PATHWAY | Signaling events mediated by HDAC Class II |
0.1 | 0.2 | PID SYNDECAN 1 PATHWAY | Syndecan-1-mediated signaling events |
0.1 | 2.7 | PID ERBB1 INTERNALIZATION PATHWAY | Internalization of ErbB1 |
0.1 | 1.0 | PID TCR JNK PATHWAY | JNK signaling in the CD4+ TCR pathway |
0.1 | 4.5 | SIG PIP3 SIGNALING IN CARDIAC MYOCTES | Genes related to PIP3 signaling in cardiac myocytes |
0.1 | 0.2 | PID WNT NONCANONICAL PATHWAY | Noncanonical Wnt signaling pathway |
0.1 | 0.8 | SA REG CASCADE OF CYCLIN EXPR | Expression of cyclins regulates progression through the cell cycle by activating cyclin-dependent kinases. |
0.1 | 0.7 | PID EPHA FWDPATHWAY | EPHA forward signaling |
0.1 | 0.4 | PID ECADHERIN KERATINOCYTE PATHWAY | E-cadherin signaling in keratinocytes |
0.1 | 0.6 | PID P38 GAMMA DELTA PATHWAY | Signaling mediated by p38-gamma and p38-delta |
0.1 | 0.3 | PID IL5 PATHWAY | IL5-mediated signaling events |
0.1 | 1.3 | PID MYC PATHWAY | C-MYC pathway |
0.1 | 0.6 | PID S1P S1P4 PATHWAY | S1P4 pathway |
0.1 | 0.2 | PID RETINOIC ACID PATHWAY | Retinoic acid receptors-mediated signaling |
0.1 | 0.8 | PID ERB GENOMIC PATHWAY | Validated nuclear estrogen receptor beta network |
0.1 | 0.6 | PID PDGFRA PATHWAY | PDGFR-alpha signaling pathway |
0.1 | 0.2 | PID VEGFR1 PATHWAY | VEGFR1 specific signals |
0.1 | 0.6 | PID INSULIN GLUCOSE PATHWAY | Insulin-mediated glucose transport |
0.0 | 0.9 | PID TOLL ENDOGENOUS PATHWAY | Endogenous TLR signaling |
0.0 | 0.4 | PID ALPHA SYNUCLEIN PATHWAY | Alpha-synuclein signaling |
0.0 | 2.1 | PID E2F PATHWAY | E2F transcription factor network |
0.0 | 0.4 | ST G ALPHA S PATHWAY | G alpha s Pathway |
0.0 | 0.1 | ST GA13 PATHWAY | G alpha 13 Pathway |
0.0 | 0.3 | PID SHP2 PATHWAY | SHP2 signaling |
0.0 | 0.4 | PID P38 ALPHA BETA PATHWAY | Regulation of p38-alpha and p38-beta |
0.0 | 0.1 | PID NECTIN PATHWAY | Nectin adhesion pathway |
0.0 | 0.3 | PID NEPHRIN NEPH1 PATHWAY | Nephrin/Neph1 signaling in the kidney podocyte |
0.0 | 0.6 | PID TCR CALCIUM PATHWAY | Calcium signaling in the CD4+ TCR pathway |
0.0 | 0.2 | PID IL2 1PATHWAY | IL2-mediated signaling events |
0.0 | 0.4 | ST P38 MAPK PATHWAY | p38 MAPK Pathway |
0.0 | 0.7 | PID HNF3A PATHWAY | FOXA1 transcription factor network |
0.0 | 0.4 | PID IL27 PATHWAY | IL27-mediated signaling events |
0.0 | 0.5 | SIG BCR SIGNALING PATHWAY | Members of the BCR signaling pathway |
0.0 | 0.7 | PID ATR PATHWAY | ATR signaling pathway |
0.0 | 0.2 | PID AR NONGENOMIC PATHWAY | Nongenotropic Androgen signaling |
0.0 | 2.0 | PID P53 DOWNSTREAM PATHWAY | Direct p53 effectors |
0.0 | 0.0 | PID S1P S1P2 PATHWAY | S1P2 pathway |
0.0 | 0.2 | PID VEGF VEGFR PATHWAY | VEGF and VEGFR signaling network |
0.0 | 0.1 | PID MET PATHWAY | Signaling events mediated by Hepatocyte Growth Factor Receptor (c-Met) |
0.0 | 0.0 | PID ARF6 DOWNSTREAM PATHWAY | Arf6 downstream pathway |
0.0 | 0.4 | PID VEGFR1 2 PATHWAY | Signaling events mediated by VEGFR1 and VEGFR2 |
0.0 | 0.3 | PID PI3KCI PATHWAY | Class I PI3K signaling events |
0.0 | 0.1 | PID PI3KCI AKT PATHWAY | Class I PI3K signaling events mediated by Akt |
0.0 | 0.1 | PID HIF2PATHWAY | HIF-2-alpha transcription factor network |
0.0 | 0.3 | PID GLYPICAN 1PATHWAY | Glypican 1 network |
0.0 | 0.0 | PID S1P S1P3 PATHWAY | S1P3 pathway |
0.0 | 0.1 | ST PHOSPHOINOSITIDE 3 KINASE PATHWAY | PI3K Pathway |
0.0 | 0.1 | PID IL2 PI3K PATHWAY | IL2 signaling events mediated by PI3K |
0.0 | 0.0 | ST G ALPHA I PATHWAY | G alpha i Pathway |
0.0 | 0.1 | PID IL2 STAT5 PATHWAY | IL2 signaling events mediated by STAT5 |
0.0 | 0.1 | SA PTEN PATHWAY | PTEN is a tumor suppressor that dephosphorylates the lipid messenger phosphatidylinositol triphosphate. |
0.0 | 0.3 | PID NFAT TFPATHWAY | Calcineurin-regulated NFAT-dependent transcription in lymphocytes |
0.0 | 0.0 | PID BARD1 PATHWAY | BARD1 signaling events |
0.0 | 0.0 | PID AVB3 INTEGRIN PATHWAY | Integrins in angiogenesis |
0.0 | 0.1 | ST DIFFERENTIATION PATHWAY IN PC12 CELLS | Differentiation Pathway in PC12 Cells; this is a specific case of PAC1 Receptor Pathway. |
0.0 | 0.1 | SA CASPASE CASCADE | Apoptosis is mediated by caspases, cysteine proteases arranged in a proteolytic cascade. |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.5 | 1.0 | REACTOME SOS MEDIATED SIGNALLING | Genes involved in SOS-mediated signalling |
0.5 | 0.5 | REACTOME REGULATION OF INSULIN SECRETION | Genes involved in Regulation of Insulin Secretion |
0.4 | 5.1 | REACTOME CRMPS IN SEMA3A SIGNALING | Genes involved in CRMPs in Sema3A signaling |
0.4 | 8.2 | REACTOME ADHERENS JUNCTIONS INTERACTIONS | Genes involved in Adherens junctions interactions |
0.3 | 3.8 | REACTOME DSCAM INTERACTIONS | Genes involved in DSCAM interactions |
0.3 | 9.5 | REACTOME HS GAG BIOSYNTHESIS | Genes involved in HS-GAG biosynthesis |
0.3 | 2.5 | REACTOME ELEVATION OF CYTOSOLIC CA2 LEVELS | Genes involved in Elevation of cytosolic Ca2+ levels |
0.3 | 2.6 | REACTOME ACTIVATION OF RAC | Genes involved in Activation of Rac |
0.2 | 1.0 | REACTOME ROLE OF SECOND MESSENGERS IN NETRIN1 SIGNALING | Genes involved in Role of second messengers in netrin-1 signaling |
0.2 | 0.5 | REACTOME PECAM1 INTERACTIONS | Genes involved in PECAM1 interactions |
0.2 | 3.6 | REACTOME SYNTHESIS SECRETION AND INACTIVATION OF GLP1 | Genes involved in Synthesis, Secretion, and Inactivation of Glucagon-like Peptide-1 (GLP-1) |
0.2 | 0.6 | REACTOME ACETYLCHOLINE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Acetylcholine Neurotransmitter Release Cycle |
0.2 | 3.6 | REACTOME GABA SYNTHESIS RELEASE REUPTAKE AND DEGRADATION | Genes involved in GABA synthesis, release, reuptake and degradation |
0.2 | 2.3 | REACTOME INHIBITION OF REPLICATION INITIATION OF DAMAGED DNA BY RB1 E2F1 | Genes involved in Inhibition of replication initiation of damaged DNA by RB1/E2F1 |
0.2 | 1.5 | REACTOME CREATION OF C4 AND C2 ACTIVATORS | Genes involved in Creation of C4 and C2 activators |
0.2 | 3.6 | REACTOME DARPP 32 EVENTS | Genes involved in DARPP-32 events |
0.2 | 3.1 | REACTOME ABCA TRANSPORTERS IN LIPID HOMEOSTASIS | Genes involved in ABCA transporters in lipid homeostasis |
0.2 | 4.2 | REACTOME NITRIC OXIDE STIMULATES GUANYLATE CYCLASE | Genes involved in Nitric oxide stimulates guanylate cyclase |
0.2 | 3.5 | REACTOME INTERACTION BETWEEN L1 AND ANKYRINS | Genes involved in Interaction between L1 and Ankyrins |
0.2 | 3.5 | REACTOME GRB2 EVENTS IN ERBB2 SIGNALING | Genes involved in GRB2 events in ERBB2 signaling |
0.2 | 0.8 | REACTOME DOWNREGULATION OF ERBB2 ERBB3 SIGNALING | Genes involved in Downregulation of ERBB2:ERBB3 signaling |
0.2 | 0.3 | REACTOME THE ROLE OF NEF IN HIV1 REPLICATION AND DISEASE PATHOGENESIS | Genes involved in The role of Nef in HIV-1 replication and disease pathogenesis |
0.2 | 2.4 | REACTOME INSULIN SYNTHESIS AND PROCESSING | Genes involved in Insulin Synthesis and Processing |
0.2 | 0.3 | REACTOME SPRY REGULATION OF FGF SIGNALING | Genes involved in Spry regulation of FGF signaling |
0.1 | 1.2 | REACTOME PLATELET CALCIUM HOMEOSTASIS | Genes involved in Platelet calcium homeostasis |
0.1 | 1.2 | REACTOME VEGF LIGAND RECEPTOR INTERACTIONS | Genes involved in VEGF ligand-receptor interactions |
0.1 | 2.5 | REACTOME ANTIGEN ACTIVATES B CELL RECEPTOR LEADING TO GENERATION OF SECOND MESSENGERS | Genes involved in Antigen Activates B Cell Receptor Leading to Generation of Second Messengers |
0.1 | 1.6 | REACTOME GABA A RECEPTOR ACTIVATION | Genes involved in GABA A receptor activation |
0.1 | 0.4 | REACTOME ACTIVATION OF KAINATE RECEPTORS UPON GLUTAMATE BINDING | Genes involved in Activation of Kainate Receptors upon glutamate binding |
0.1 | 1.5 | REACTOME NOTCH HLH TRANSCRIPTION PATHWAY | Genes involved in Notch-HLH transcription pathway |
0.1 | 1.7 | REACTOME JNK C JUN KINASES PHOSPHORYLATION AND ACTIVATION MEDIATED BY ACTIVATED HUMAN TAK1 | Genes involved in JNK (c-Jun kinases) phosphorylation and activation mediated by activated human TAK1 |
0.1 | 1.9 | REACTOME SYNTHESIS OF PC | Genes involved in Synthesis of PC |
0.1 | 0.1 | REACTOME REGULATION OF INSULIN SECRETION BY ACETYLCHOLINE | Genes involved in Regulation of Insulin Secretion by Acetylcholine |
0.1 | 0.4 | REACTOME ACTIVATED TAK1 MEDIATES P38 MAPK ACTIVATION | Genes involved in activated TAK1 mediates p38 MAPK activation |
0.1 | 0.2 | REACTOME PHOSPHORYLATION OF CD3 AND TCR ZETA CHAINS | Genes involved in Phosphorylation of CD3 and TCR zeta chains |
0.1 | 1.5 | REACTOME ACETYLCHOLINE BINDING AND DOWNSTREAM EVENTS | Genes involved in Acetylcholine Binding And Downstream Events |
0.1 | 0.3 | REACTOME ENDOSOMAL VACUOLAR PATHWAY | Genes involved in Endosomal/Vacuolar pathway |
0.1 | 2.5 | REACTOME INHIBITION OF VOLTAGE GATED CA2 CHANNELS VIA GBETA GAMMA SUBUNITS | Genes involved in Inhibition of voltage gated Ca2+ channels via Gbeta/gamma subunits |
0.1 | 3.8 | REACTOME NRAGE SIGNALS DEATH THROUGH JNK | Genes involved in NRAGE signals death through JNK |
0.1 | 0.9 | REACTOME RECRUITMENT OF NUMA TO MITOTIC CENTROSOMES | Genes involved in Recruitment of NuMA to mitotic centrosomes |
0.1 | 0.9 | REACTOME ACTIVATION OF CHAPERONE GENES BY ATF6 ALPHA | Genes involved in Activation of Chaperone Genes by ATF6-alpha |
0.1 | 1.1 | REACTOME SEROTONIN RECEPTORS | Genes involved in Serotonin receptors |
0.1 | 0.3 | REACTOME TRANSMISSION ACROSS CHEMICAL SYNAPSES | Genes involved in Transmission across Chemical Synapses |
0.1 | 1.1 | REACTOME TGF BETA RECEPTOR SIGNALING IN EMT EPITHELIAL TO MESENCHYMAL TRANSITION | Genes involved in TGF-beta receptor signaling in EMT (epithelial to mesenchymal transition) |
0.1 | 1.7 | REACTOME REGULATION OF GENE EXPRESSION IN BETA CELLS | Genes involved in Regulation of gene expression in beta cells |
0.1 | 1.5 | REACTOME SIGNALING BY ROBO RECEPTOR | Genes involved in Signaling by Robo receptor |
0.1 | 1.3 | REACTOME SIGNALING BY FGFR1 FUSION MUTANTS | Genes involved in Signaling by FGFR1 fusion mutants |
0.1 | 1.2 | REACTOME SYNTHESIS OF VERY LONG CHAIN FATTY ACYL COAS | Genes involved in Synthesis of very long-chain fatty acyl-CoAs |
0.1 | 0.8 | REACTOME PLATELET SENSITIZATION BY LDL | Genes involved in Platelet sensitization by LDL |
0.1 | 3.3 | REACTOME VOLTAGE GATED POTASSIUM CHANNELS | Genes involved in Voltage gated Potassium channels |
0.1 | 1.0 | REACTOME AMINE COMPOUND SLC TRANSPORTERS | Genes involved in Amine compound SLC transporters |
0.1 | 0.2 | REACTOME SCF BETA TRCP MEDIATED DEGRADATION OF EMI1 | Genes involved in SCF-beta-TrCP mediated degradation of Emi1 |
0.1 | 0.3 | REACTOME PD1 SIGNALING | Genes involved in PD-1 signaling |
0.1 | 0.2 | REACTOME IL 6 SIGNALING | Genes involved in Interleukin-6 signaling |
0.1 | 1.3 | REACTOME COMPLEMENT CASCADE | Genes involved in Complement cascade |
0.1 | 0.6 | REACTOME IL 7 SIGNALING | Genes involved in Interleukin-7 signaling |
0.1 | 0.6 | REACTOME NRIF SIGNALS CELL DEATH FROM THE NUCLEUS | Genes involved in NRIF signals cell death from the nucleus |
0.1 | 0.6 | REACTOME GLUTAMATE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Glutamate Neurotransmitter Release Cycle |
0.1 | 0.4 | REACTOME TETRAHYDROBIOPTERIN BH4 SYNTHESIS RECYCLING SALVAGE AND REGULATION | Genes involved in Tetrahydrobiopterin (BH4) synthesis, recycling, salvage and regulation |
0.1 | 3.1 | REACTOME LOSS OF NLP FROM MITOTIC CENTROSOMES | Genes involved in Loss of Nlp from mitotic centrosomes |
0.1 | 1.0 | REACTOME METABOLISM OF POLYAMINES | Genes involved in Metabolism of polyamines |
0.1 | 0.5 | REACTOME ROLE OF DCC IN REGULATING APOPTOSIS | Genes involved in Role of DCC in regulating apoptosis |
0.1 | 0.5 | REACTOME REGULATION OF KIT SIGNALING | Genes involved in Regulation of KIT signaling |
0.1 | 1.7 | REACTOME SYNTHESIS OF PIPS AT THE PLASMA MEMBRANE | Genes involved in Synthesis of PIPs at the plasma membrane |
0.1 | 0.9 | REACTOME MITOCHONDRIAL FATTY ACID BETA OXIDATION | Genes involved in Mitochondrial Fatty Acid Beta-Oxidation |
0.1 | 5.2 | REACTOME TRANSPORT OF INORGANIC CATIONS ANIONS AND AMINO ACIDS OLIGOPEPTIDES | Genes involved in Transport of inorganic cations/anions and amino acids/oligopeptides |
0.1 | 0.4 | REACTOME ARMS MEDIATED ACTIVATION | Genes involved in ARMS-mediated activation |
0.1 | 1.1 | REACTOME DEPOSITION OF NEW CENPA CONTAINING NUCLEOSOMES AT THE CENTROMERE | Genes involved in Deposition of New CENPA-containing Nucleosomes at the Centromere |
0.1 | 0.6 | REACTOME GLYCOGEN BREAKDOWN GLYCOGENOLYSIS | Genes involved in Glycogen breakdown (glycogenolysis) |
0.1 | 0.1 | REACTOME ACTIVATION OF CHAPERONES BY ATF6 ALPHA | Genes involved in Activation of Chaperones by ATF6-alpha |
0.1 | 0.1 | REACTOME OLFACTORY SIGNALING PATHWAY | Genes involved in Olfactory Signaling Pathway |
0.1 | 0.6 | REACTOME PROCESSIVE SYNTHESIS ON THE LAGGING STRAND | Genes involved in Processive synthesis on the lagging strand |
0.1 | 0.6 | REACTOME CALNEXIN CALRETICULIN CYCLE | Genes involved in Calnexin/calreticulin cycle |
0.1 | 0.4 | REACTOME IONOTROPIC ACTIVITY OF KAINATE RECEPTORS | Genes involved in Ionotropic activity of Kainate Receptors |
0.1 | 0.2 | REACTOME RNA POL I PROMOTER OPENING | Genes involved in RNA Polymerase I Promoter Opening |
0.1 | 0.6 | REACTOME CYCLIN A B1 ASSOCIATED EVENTS DURING G2 M TRANSITION | Genes involved in Cyclin A/B1 associated events during G2/M transition |
0.0 | 0.4 | REACTOME HORMONE LIGAND BINDING RECEPTORS | Genes involved in Hormone ligand-binding receptors |
0.0 | 0.7 | REACTOME MYOGENESIS | Genes involved in Myogenesis |
0.0 | 0.5 | REACTOME CDC6 ASSOCIATION WITH THE ORC ORIGIN COMPLEX | Genes involved in CDC6 association with the ORC:origin complex |
0.0 | 0.1 | REACTOME TRANSPORT OF MATURE MRNA DERIVED FROM AN INTRONLESS TRANSCRIPT | Genes involved in Transport of Mature mRNA Derived from an Intronless Transcript |
0.0 | 0.0 | REACTOME MEMBRANE BINDING AND TARGETTING OF GAG PROTEINS | Genes involved in Membrane binding and targetting of GAG proteins |
0.0 | 1.2 | REACTOME ASSOCIATION OF TRIC CCT WITH TARGET PROTEINS DURING BIOSYNTHESIS | Genes involved in Association of TriC/CCT with target proteins during biosynthesis |
0.0 | 0.1 | REACTOME DOPAMINE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Dopamine Neurotransmitter Release Cycle |
0.0 | 0.1 | REACTOME APOBEC3G MEDIATED RESISTANCE TO HIV1 INFECTION | Genes involved in APOBEC3G mediated resistance to HIV-1 infection |
0.0 | 1.0 | REACTOME ENDOSOMAL SORTING COMPLEX REQUIRED FOR TRANSPORT ESCRT | Genes involved in Endosomal Sorting Complex Required For Transport (ESCRT) |
0.0 | 1.1 | REACTOME STEROID HORMONES | Genes involved in Steroid hormones |
0.0 | 0.8 | REACTOME RNA POL III TRANSCRIPTION TERMINATION | Genes involved in RNA Polymerase III Transcription Termination |
0.0 | 0.3 | REACTOME E2F MEDIATED REGULATION OF DNA REPLICATION | Genes involved in E2F mediated regulation of DNA replication |
0.0 | 0.3 | REACTOME APOPTOSIS INDUCED DNA FRAGMENTATION | Genes involved in Apoptosis induced DNA fragmentation |
0.0 | 0.3 | REACTOME TIE2 SIGNALING | Genes involved in Tie2 Signaling |
0.0 | 0.2 | REACTOME SIGNALING BY NOTCH3 | Genes involved in Signaling by NOTCH3 |
0.0 | 0.6 | REACTOME AXON GUIDANCE | Genes involved in Axon guidance |
0.0 | 0.2 | REACTOME INHIBITION OF INSULIN SECRETION BY ADRENALINE NORADRENALINE | Genes involved in Inhibition of Insulin Secretion by Adrenaline/Noradrenaline |
0.0 | 0.0 | REACTOME RECEPTOR LIGAND BINDING INITIATES THE SECOND PROTEOLYTIC CLEAVAGE OF NOTCH RECEPTOR | Genes involved in Receptor-ligand binding initiates the second proteolytic cleavage of Notch receptor |
0.0 | 0.2 | REACTOME RNA POL III TRANSCRIPTION INITIATION FROM TYPE 2 PROMOTER | Genes involved in RNA Polymerase III Transcription Initiation From Type 2 Promoter |
0.0 | 0.4 | REACTOME PYRIMIDINE CATABOLISM | Genes involved in Pyrimidine catabolism |
0.0 | 0.9 | REACTOME STRIATED MUSCLE CONTRACTION | Genes involved in Striated Muscle Contraction |
0.0 | 0.4 | REACTOME ABORTIVE ELONGATION OF HIV1 TRANSCRIPT IN THE ABSENCE OF TAT | Genes involved in Abortive elongation of HIV-1 transcript in the absence of Tat |
0.0 | 0.0 | REACTOME ASSOCIATION OF LICENSING FACTORS WITH THE PRE REPLICATIVE COMPLEX | Genes involved in Association of licensing factors with the pre-replicative complex |
0.0 | 0.2 | REACTOME REGULATION OF ORNITHINE DECARBOXYLASE ODC | Genes involved in Regulation of ornithine decarboxylase (ODC) |
0.0 | 0.1 | REACTOME BINDING AND ENTRY OF HIV VIRION | Genes involved in Binding and entry of HIV virion |
0.0 | 0.4 | REACTOME CLASS C 3 METABOTROPIC GLUTAMATE PHEROMONE RECEPTORS | Genes involved in Class C/3 (Metabotropic glutamate/pheromone receptors) |
0.0 | 0.5 | REACTOME ENERGY DEPENDENT REGULATION OF MTOR BY LKB1 AMPK | Genes involved in Energy dependent regulation of mTOR by LKB1-AMPK |
0.0 | 0.6 | REACTOME RNA POL II TRANSCRIPTION PRE INITIATION AND PROMOTER OPENING | Genes involved in RNA Polymerase II Transcription Pre-Initiation And Promoter Opening |
0.0 | 0.3 | REACTOME AMINE DERIVED HORMONES | Genes involved in Amine-derived hormones |
0.0 | 0.0 | REACTOME TAK1 ACTIVATES NFKB BY PHOSPHORYLATION AND ACTIVATION OF IKKS COMPLEX | Genes involved in TAK1 activates NFkB by phosphorylation and activation of IKKs complex |
0.0 | 0.1 | REACTOME EGFR DOWNREGULATION | Genes involved in EGFR downregulation |
0.0 | 0.2 | REACTOME LIGAND GATED ION CHANNEL TRANSPORT | Genes involved in Ligand-gated ion channel transport |
0.0 | 0.2 | REACTOME GLUCURONIDATION | Genes involved in Glucuronidation |
0.0 | 0.2 | REACTOME IKK COMPLEX RECRUITMENT MEDIATED BY RIP1 | Genes involved in IKK complex recruitment mediated by RIP1 |
0.0 | 0.4 | REACTOME SULFUR AMINO ACID METABOLISM | Genes involved in Sulfur amino acid metabolism |
0.0 | 0.2 | REACTOME REGULATION OF IFNG SIGNALING | Genes involved in Regulation of IFNG signaling |
0.0 | 0.7 | REACTOME ION CHANNEL TRANSPORT | Genes involved in Ion channel transport |
0.0 | 0.5 | REACTOME MRNA SPLICING MINOR PATHWAY | Genes involved in mRNA Splicing - Minor Pathway |
0.0 | 0.0 | REACTOME TRAF6 MEDIATED IRF7 ACTIVATION IN TLR7 8 OR 9 SIGNALING | Genes involved in TRAF6 mediated IRF7 activation in TLR7/8 or 9 signaling |
0.0 | 0.2 | REACTOME ENDOGENOUS STEROLS | Genes involved in Endogenous sterols |
0.0 | 0.2 | REACTOME FORMATION OF TRANSCRIPTION COUPLED NER TC NER REPAIR COMPLEX | Genes involved in Formation of transcription-coupled NER (TC-NER) repair complex |
0.0 | 0.1 | REACTOME P53 INDEPENDENT G1 S DNA DAMAGE CHECKPOINT | Genes involved in p53-Independent G1/S DNA damage checkpoint |
0.0 | 0.7 | REACTOME MRNA 3 END PROCESSING | Genes involved in mRNA 3'-end processing |
0.0 | 0.2 | REACTOME ANTIGEN PRESENTATION FOLDING ASSEMBLY AND PEPTIDE LOADING OF CLASS I MHC | Genes involved in Antigen Presentation: Folding, assembly and peptide loading of class I MHC |
0.0 | 0.2 | REACTOME TRYPTOPHAN CATABOLISM | Genes involved in Tryptophan catabolism |
0.0 | 0.4 | REACTOME P75 NTR RECEPTOR MEDIATED SIGNALLING | Genes involved in p75 NTR receptor-mediated signalling |
0.0 | 0.1 | REACTOME ACYL CHAIN REMODELLING OF PI | Genes involved in Acyl chain remodelling of PI |
0.0 | 0.1 | REACTOME NEF MEDIATED DOWNREGULATION OF MHC CLASS I COMPLEX CELL SURFACE EXPRESSION | Genes involved in Nef mediated downregulation of MHC class I complex cell surface expression |
0.0 | 0.3 | REACTOME GENERATION OF SECOND MESSENGER MOLECULES | Genes involved in Generation of second messenger molecules |
0.0 | 1.0 | REACTOME ER PHAGOSOME PATHWAY | Genes involved in ER-Phagosome pathway |
0.0 | 0.1 | REACTOME FORMATION OF INCISION COMPLEX IN GG NER | Genes involved in Formation of incision complex in GG-NER |
0.0 | 0.3 | REACTOME MHC CLASS II ANTIGEN PRESENTATION | Genes involved in MHC class II antigen presentation |
0.0 | 0.5 | REACTOME GLUCONEOGENESIS | Genes involved in Gluconeogenesis |
0.0 | 0.1 | REACTOME CTLA4 INHIBITORY SIGNALING | Genes involved in CTLA4 inhibitory signaling |
0.0 | 0.1 | REACTOME SHC RELATED EVENTS | Genes involved in SHC-related events |
0.0 | 0.3 | REACTOME BRANCHED CHAIN AMINO ACID CATABOLISM | Genes involved in Branched-chain amino acid catabolism |
0.0 | 0.0 | REACTOME REGULATION OF SIGNALING BY CBL | Genes involved in Regulation of signaling by CBL |
0.0 | 0.2 | REACTOME REGULATION OF INSULIN LIKE GROWTH FACTOR IGF ACTIVITY BY INSULIN LIKE GROWTH FACTOR BINDING PROTEINS IGFBPS | Genes involved in Regulation of Insulin-like Growth Factor (IGF) Activity by Insulin-like Growth Factor Binding Proteins (IGFBPs) |
0.0 | 0.0 | REACTOME FGFR4 LIGAND BINDING AND ACTIVATION | Genes involved in FGFR4 ligand binding and activation |
0.0 | 0.1 | REACTOME PYRIMIDINE METABOLISM | Genes involved in Pyrimidine metabolism |
0.0 | 0.2 | REACTOME GAP JUNCTION ASSEMBLY | Genes involved in Gap junction assembly |
0.0 | 0.1 | REACTOME UNWINDING OF DNA | Genes involved in Unwinding of DNA |
0.0 | 0.3 | REACTOME TRANSFERRIN ENDOCYTOSIS AND RECYCLING | Genes involved in Transferrin endocytosis and recycling |
0.0 | 0.2 | REACTOME MITOCHONDRIAL TRNA AMINOACYLATION | Genes involved in Mitochondrial tRNA aminoacylation |
0.0 | 0.1 | REACTOME SCFSKP2 MEDIATED DEGRADATION OF P27 P21 | Genes involved in SCF(Skp2)-mediated degradation of p27/p21 |
0.0 | 0.7 | REACTOME RESPIRATORY ELECTRON TRANSPORT | Genes involved in Respiratory electron transport |
0.0 | 0.0 | REACTOME APC CDC20 MEDIATED DEGRADATION OF NEK2A | Genes involved in APC-Cdc20 mediated degradation of Nek2A |