Gene Symbol | Gene ID | Gene Info |
---|---|---|
Nkx1-1
|
ENSMUSG00000029112.5 | NK1 homeobox 1 |
Nkx1-2
|
ENSMUSG00000048528.7 | NK1 homeobox 2 |
Gene | Promoter | Pearson corr. coef. | P-value | Plot |
---|---|---|---|---|
Nkx1-1 | mm10_chr5_33505778_33505947 | -0.54 | 2.2e-05 | Click! |
Nkx1-2 | mm10_chr7_132589712_132589903 | -0.33 | 1.2e-02 | Click! |
Move your cursor over a bar to see sample name and corresponding Z-value.
Cis Regulatory Element (CRE) | Target Score | Top associated gene | Gene Info | Distance of CRE to TSS | CRE/Gene association probability |
---|---|---|---|---|---|
chr8_120293961_120294320 | 5.02 |
Gse1 |
genetic suppressor element 1, coiled-coil protein |
65684 |
0.09 |
chr5_113543216_113543398 | 4.67 |
Wscd2 |
WSC domain containing 2 |
6678 |
0.23 |
chr5_77888510_77888967 | 4.58 |
Gm42673 |
predicted gene 42673 |
20722 |
0.27 |
chr12_7959672_7959823 | 4.55 |
Gm48633 |
predicted gene, 48633 |
9686 |
0.19 |
chr1_3094927_3095127 | 4.46 |
Gm26206 |
predicted gene, 26206 |
6989 |
0.25 |
chr10_38357833_38358251 | 4.41 |
Gm48197 |
predicted gene, 48197 |
44196 |
0.17 |
chr8_14815208_14815364 | 4.36 |
Dlgap2 |
DLG associated protein 2 |
37513 |
0.15 |
chr6_101938671_101938836 | 4.35 |
Gm44177 |
predicted gene, 44177 |
25480 |
0.23 |
chr13_84751597_84751791 | 4.34 |
Gm26913 |
predicted gene, 26913 |
60753 |
0.15 |
chr12_58619814_58620024 | 4.23 |
Gm18873 |
predicted gene, 18873 |
143987 |
0.04 |
chr12_67272489_67272659 | 4.21 |
Mdga2 |
MAM domain containing glycosylphosphatidylinositol anchor 2 |
50025 |
0.15 |
chr11_91098276_91098472 | 4.16 |
4930405D11Rik |
RIKEN cDNA 4930405D11 gene |
215029 |
0.02 |
chr13_105433280_105433434 | 4.10 |
Htr1a |
5-hydroxytryptamine (serotonin) receptor 1A |
10282 |
0.29 |
chr6_4748105_4748402 | 4.09 |
Peg10 |
paternally expressed 10 |
847 |
0.42 |
chr15_55142836_55143014 | 4.06 |
Deptor |
DEP domain containing MTOR-interacting protein |
9472 |
0.18 |
chr1_80460085_80460236 | 4.01 |
Gm45261 |
predicted gene 45261 |
1288 |
0.43 |
chr19_14777449_14777621 | 3.92 |
Gm26026 |
predicted gene, 26026 |
59055 |
0.15 |
chr18_30127256_30127461 | 3.89 |
Gm49980 |
predicted gene, 49980 |
139891 |
0.05 |
chr15_80460029_80460409 | 3.89 |
Gm23220 |
predicted gene, 23220 |
2045 |
0.27 |
chr3_155662413_155662577 | 3.88 |
Gm37449 |
predicted gene, 37449 |
92745 |
0.08 |
chr1_157939635_157939814 | 3.86 |
Gm38256 |
predicted gene, 38256 |
661 |
0.83 |
chr9_113177191_113177599 | 3.70 |
Gm4657 |
predicted gene 4657 |
12420 |
0.25 |
chr9_83099062_83099301 | 3.69 |
Gm38398 |
predicted gene, 38398 |
957 |
0.48 |
chr9_87883201_87883375 | 3.67 |
Gm25528 |
predicted gene, 25528 |
5299 |
0.28 |
chr3_107066739_107066904 | 3.61 |
A930002I21Rik |
RIKEN cDNA A930002I21 gene |
24059 |
0.12 |
chr15_32568897_32569303 | 3.59 |
Sema5a |
sema domain, seven thrombospondin repeats (type 1 and type 1-like), transmembrane domain (TM) and short cytoplasmic domain, (semaphorin) 5A |
32575 |
0.21 |
chr8_128534683_128534867 | 3.47 |
Gm9204 |
predicted gene 9204 |
99161 |
0.07 |
chr15_83781593_83781788 | 3.38 |
Mpped1 |
metallophosphoesterase domain containing 1 |
1667 |
0.43 |
chrX_93301651_93301845 | 3.38 |
Arx |
aristaless related homeobox |
15238 |
0.23 |
chr8_90576969_90577137 | 3.37 |
Gm45639 |
predicted gene 45639 |
97905 |
0.07 |
chr15_101191600_101191892 | 3.37 |
Mir6962 |
microRNA 6962 |
2123 |
0.18 |
chr3_70802323_70802491 | 3.37 |
Gm10780 |
predicted gene 10780 |
113315 |
0.07 |
chr1_194630781_194630934 | 3.36 |
Plxna2 |
plexin A2 |
11032 |
0.18 |
chr6_46398847_46399011 | 3.35 |
Gm43881 |
predicted gene, 43881 |
14827 |
0.24 |
chr6_86068961_86069117 | 3.28 |
Add2 |
adducin 2 (beta) |
9018 |
0.13 |
chr9_77496504_77496829 | 3.26 |
Lrrc1 |
leucine rich repeat containing 1 |
35778 |
0.13 |
chr12_77991634_77991958 | 3.22 |
Gm8219 |
predicted gene 8219 |
172214 |
0.03 |
chr14_62415985_62416195 | 3.21 |
Gucy1b2 |
guanylate cyclase 1, soluble, beta 2 |
38703 |
0.13 |
chr19_49361265_49361416 | 3.18 |
Gm50444 |
predicted gene, 50444 |
192678 |
0.03 |
chr5_53276530_53276710 | 3.17 |
Smim20 |
small integral membrane protein 20 |
498 |
0.79 |
chr4_32940073_32940241 | 3.17 |
Ankrd6 |
ankyrin repeat domain 6 |
10669 |
0.15 |
chr10_87666126_87666297 | 3.16 |
Gm48195 |
predicted gene, 48195 |
22367 |
0.23 |
chr3_141952957_141953255 | 3.15 |
Bmpr1b |
bone morphogenetic protein receptor, type 1B |
21583 |
0.27 |
chr5_125805327_125805634 | 3.08 |
Gm4868 |
predicted gene 4868 |
43260 |
0.18 |
chr18_56870554_56870904 | 3.07 |
Gm18087 |
predicted gene, 18087 |
45359 |
0.14 |
chr8_76252258_76252438 | 3.05 |
Gm22509 |
predicted gene, 22509 |
22102 |
0.19 |
chr8_28770607_28770777 | 3.05 |
Gm26795 |
predicted gene, 26795 |
177160 |
0.03 |
chr7_79511969_79512162 | 3.04 |
2900037B21Rik |
RIKEN cDNA 2900037B21 gene |
859 |
0.35 |
chr3_128149360_128149511 | 3.03 |
D030025E07Rik |
RIKEN cDNA D030025E07 gene |
16075 |
0.25 |
chr9_93778147_93778318 | 3.03 |
Gm47165 |
predicted gene, 47165 |
208658 |
0.03 |
chr16_43534330_43534490 | 3.02 |
Zbtb20 |
zinc finger and BTB domain containing 20 |
24102 |
0.21 |
chr17_3259235_3259403 | 3.01 |
Gm34035 |
predicted gene, 34035 |
23888 |
0.14 |
chr1_64779950_64780101 | 3.00 |
Fzd5 |
frizzled class receptor 5 |
42274 |
0.12 |
chr2_54265163_54265368 | 2.99 |
Gm14035 |
predicted gene 14035 |
18850 |
0.21 |
chr6_12759644_12759795 | 2.99 |
Thsd7a |
thrombospondin, type I, domain containing 7A |
10309 |
0.22 |
chr10_97009843_97009994 | 2.98 |
4930556N09Rik |
RIKEN cDNA 4930556N09 gene |
25850 |
0.2 |
chr9_29104075_29104281 | 2.98 |
Ntm |
neurotrimin |
5604 |
0.3 |
chr19_53774035_53774664 | 2.97 |
Gm16298 |
predicted gene 16298 |
6039 |
0.19 |
chr9_61468387_61468621 | 2.97 |
Gm47240 |
predicted gene, 47240 |
4482 |
0.22 |
chr5_133718570_133718754 | 2.96 |
Gm36667 |
predicted gene, 36667 |
120256 |
0.06 |
chr19_41835767_41836202 | 2.92 |
Frat1 |
frequently rearranged in advanced T cell lymphomas |
6014 |
0.15 |
chr1_157969609_157969781 | 2.90 |
Gm38256 |
predicted gene, 38256 |
29310 |
0.25 |
chr1_132425750_132425901 | 2.89 |
Dstyk |
dual serine/threonine and tyrosine protein kinase |
7448 |
0.14 |
chr9_100963446_100963618 | 2.87 |
Stag1 |
stromal antigen 1 |
7763 |
0.19 |
chr18_69608146_69608367 | 2.86 |
Tcf4 |
transcription factor 4 |
4188 |
0.32 |
chr6_103514048_103514248 | 2.85 |
Chl1 |
cell adhesion molecule L1-like |
2818 |
0.24 |
chr2_134351022_134351181 | 2.85 |
Hao1 |
hydroxyacid oxidase 1, liver |
203206 |
0.03 |
chr15_67058302_67058488 | 2.85 |
Gm31342 |
predicted gene, 31342 |
18337 |
0.21 |
chr9_105659956_105660107 | 2.83 |
Pik3r4 |
phosphoinositide-3-kinase regulatory subunit 4 |
1132 |
0.5 |
chr6_101308145_101308561 | 2.81 |
9530086O07Rik |
RIKEN cDNA 9530086O07 gene |
19843 |
0.14 |
chr13_43706605_43706756 | 2.79 |
Gm20751 |
predicted gene, 20751 |
10111 |
0.19 |
chr2_34129751_34129905 | 2.79 |
Gm38389 |
predicted gene, 38389 |
18384 |
0.2 |
chr8_49243134_49243285 | 2.75 |
Gm45832 |
predicted gene 45832 |
11240 |
0.28 |
chr9_5752747_5752938 | 2.75 |
Gm48506 |
predicted gene, 48506 |
43937 |
0.19 |
chr11_112501711_112502406 | 2.74 |
BC006965 |
cDNA sequence BC006965 |
167340 |
0.04 |
chr12_28085596_28085754 | 2.73 |
Gm25923 |
predicted gene, 25923 |
25147 |
0.23 |
chrX_73867385_73867536 | 2.73 |
L1cam |
L1 cell adhesion molecule |
2344 |
0.17 |
chr5_150894457_150894771 | 2.71 |
Gm43298 |
predicted gene 43298 |
11972 |
0.2 |
chr11_11014435_11014603 | 2.71 |
Vwc2 |
von Willebrand factor C domain containing 2 |
99704 |
0.08 |
chr8_48445697_48445848 | 2.68 |
Tenm3 |
teneurin transmembrane protein 3 |
109541 |
0.07 |
chr1_35750110_35750301 | 2.67 |
Gm25634 |
predicted gene, 25634 |
11397 |
0.23 |
chr16_40907986_40908143 | 2.65 |
Gm26381 |
predicted gene, 26381 |
309681 |
0.01 |
chr12_86220566_86221004 | 2.64 |
Gpatch2l |
G patch domain containing 2 like |
21073 |
0.18 |
chr8_6604352_6604691 | 2.64 |
Gm44844 |
predicted gene 44844 |
166777 |
0.04 |
chr4_21665942_21666298 | 2.63 |
Gm11876 |
predicted gene 11876 |
4920 |
0.2 |
chr8_86961518_86961711 | 2.63 |
Gm24781 |
predicted gene, 24781 |
4005 |
0.19 |
chr5_26176163_26176336 | 2.62 |
Gm10220 |
predicted gene 10220 |
54828 |
0.1 |
chrX_61823685_61823865 | 2.60 |
Gm6743 |
predicted pseudogene 6743 |
6735 |
0.25 |
chr3_34561729_34562051 | 2.59 |
Sox2ot |
SOX2 overlapping transcript (non-protein coding) |
1498 |
0.34 |
chr12_84532163_84533007 | 2.59 |
Lin52 |
lin-52 homolog (C. elegans) |
2541 |
0.25 |
chr13_99444397_99444879 | 2.58 |
Map1b |
microtubule-associated protein 1B |
171 |
0.95 |
chr2_58586662_58586850 | 2.57 |
Upp2 |
uridine phosphorylase 2 |
3080 |
0.29 |
chr10_97492542_97492726 | 2.57 |
Dcn |
decorin |
9297 |
0.22 |
chr5_75756350_75756507 | 2.53 |
Gm43100 |
predicted gene 43100 |
2458 |
0.25 |
chr2_103020602_103020954 | 2.53 |
Pdhx |
pyruvate dehydrogenase complex, component X |
52557 |
0.12 |
chr8_28252481_28252806 | 2.51 |
Gm8100 |
predicted gene 8100 |
66803 |
0.13 |
chr17_71290525_71291000 | 2.51 |
Emilin2 |
elastin microfibril interfacer 2 |
6485 |
0.15 |
chr2_68806583_68806798 | 2.49 |
Gm13612 |
predicted gene 13612 |
24327 |
0.15 |
chr2_173036590_173036982 | 2.48 |
Gm14453 |
predicted gene 14453 |
2206 |
0.22 |
chr8_124070398_124070813 | 2.48 |
Gm45732 |
predicted gene 45732 |
22193 |
0.12 |
chr15_96178501_96178674 | 2.48 |
4833422M21Rik |
RIKEN cDNA 4833422M21 gene |
63202 |
0.11 |
chr12_55622602_55622815 | 2.46 |
Ralgapa1 |
Ral GTPase activating protein, alpha subunit 1 |
10071 |
0.19 |
chr12_75062688_75062848 | 2.45 |
Kcnh5 |
potassium voltage-gated channel, subfamily H (eag-related), member 5 |
114564 |
0.07 |
chr17_94165601_94165754 | 2.44 |
Gm50004 |
predicted gene, 50004 |
33406 |
0.24 |
chr10_104686578_104686765 | 2.44 |
Gm25522 |
predicted gene, 25522 |
178637 |
0.03 |
chr17_90892371_90892658 | 2.43 |
4930480K15Rik |
RIKEN cDNA 4930480K15 gene |
31345 |
0.22 |
chr12_83287243_83287401 | 2.41 |
Dpf3 |
D4, zinc and double PHD fingers, family 3 |
7106 |
0.28 |
chr5_112050415_112050824 | 2.41 |
1700016B01Rik |
RIKEN cDNA 1700016B01 gene |
105618 |
0.06 |
chr17_41264618_41264789 | 2.41 |
Gm6771 |
predicted gene 6771 |
81294 |
0.1 |
chr1_185456361_185456665 | 2.40 |
Gm2061 |
predicted gene 2061 |
945 |
0.39 |
chr4_132025779_132025930 | 2.39 |
Epb41 |
erythrocyte membrane protein band 4.1 |
18416 |
0.11 |
chr6_54552680_54553127 | 2.39 |
Scrn1 |
secernin 1 |
1543 |
0.37 |
chr5_40295409_40295582 | 2.37 |
Gm2810 |
predicted pseudogene 2810 |
32943 |
0.24 |
chr5_58108764_58108934 | 2.37 |
Gm42486 |
predicted gene 42486 |
12590 |
0.18 |
chr1_178855936_178856309 | 2.37 |
Kif26b |
kinesin family member 26B |
57684 |
0.13 |
chr2_40982887_40983039 | 2.36 |
Gm13460 |
predicted gene 13460 |
15894 |
0.24 |
chr9_120444732_120444907 | 2.35 |
Myrip |
myosin VIIA and Rab interacting protein |
17413 |
0.14 |
chr8_23030960_23031226 | 2.35 |
Ank1 |
ankyrin 1, erythroid |
4006 |
0.22 |
chr17_63259623_63259792 | 2.35 |
4930405O22Rik |
RIKEN cDNA 4930405O22 gene |
53264 |
0.13 |
chr17_91657643_91657830 | 2.35 |
Gm15403 |
predicted gene 15403 |
9343 |
0.23 |
chr6_116350044_116350568 | 2.35 |
Marchf8 |
membrane associated ring-CH-type finger 8 |
79 |
0.95 |
chr6_55879618_55879874 | 2.35 |
Itprid1 |
ITPR interacting domain containing 1 |
7079 |
0.3 |
chr8_80919248_80919399 | 2.34 |
Gm4891 |
predicted gene 4891 |
14354 |
0.16 |
chr13_41231497_41231822 | 2.33 |
Rps17-ps1 |
ribosomal protein S17, pseudogene 1 |
3418 |
0.15 |
chr13_11836412_11836699 | 2.32 |
Ryr2 |
ryanodine receptor 2, cardiac |
6901 |
0.24 |
chr12_67011393_67011748 | 2.32 |
Gm47989 |
predicted gene, 47989 |
69159 |
0.12 |
chr19_59006658_59006882 | 2.31 |
Shtn1 |
shootin 1 |
31515 |
0.15 |
chr11_112140577_112140773 | 2.31 |
Gm11680 |
predicted gene 11680 |
33237 |
0.23 |
chr5_42777207_42777429 | 2.31 |
Gm5554 |
predicted gene 5554 |
187291 |
0.03 |
chr6_32056714_32056875 | 2.31 |
1700012A03Rik |
RIKEN cDNA 1700012A03 gene |
1347 |
0.55 |
chr11_107965416_107965870 | 2.31 |
Prkca |
protein kinase C, alpha |
13996 |
0.15 |
chr12_29121380_29121557 | 2.31 |
4833405L11Rik |
RIKEN cDNA 4833405L11 gene |
14618 |
0.21 |
chr3_158310492_158310686 | 2.30 |
Gm43486 |
predicted gene 43486 |
16175 |
0.22 |
chr15_80362829_80363158 | 2.29 |
Cacna1i |
calcium channel, voltage-dependent, alpha 1I subunit |
26335 |
0.15 |
chr8_26677560_26678005 | 2.28 |
Gm32098 |
predicted gene, 32098 |
9476 |
0.18 |
chr15_44705846_44706012 | 2.28 |
Sybu |
syntabulin (syntaxin-interacting) |
41859 |
0.15 |
chr17_46496590_46496814 | 2.27 |
Dnph1 |
2'-deoxynucleoside 5'-phosphate N-hydrolase 1 |
9 |
0.95 |
chrX_47124254_47124450 | 2.27 |
Gm14609 |
predicted gene 14609 |
256982 |
0.02 |
chr7_89140693_89141295 | 2.26 |
Tmem135 |
transmembrane protein 135 |
4503 |
0.3 |
chr1_97843288_97843568 | 2.25 |
Pam |
peptidylglycine alpha-amidating monooxygenase |
2547 |
0.3 |
chr13_40075153_40075349 | 2.25 |
Gm47316 |
predicted gene, 47316 |
190870 |
0.03 |
chr6_55921320_55921515 | 2.24 |
Itprid1 |
ITPR interacting domain containing 1 |
34592 |
0.21 |
chr12_37814178_37814429 | 2.24 |
Dgkb |
diacylglycerol kinase, beta |
3423 |
0.37 |
chr3_78755846_78756023 | 2.23 |
Gm18952 |
predicted gene, 18952 |
2685 |
0.38 |
chr6_32056516_32056667 | 2.22 |
1700012A03Rik |
RIKEN cDNA 1700012A03 gene |
1550 |
0.51 |
chr4_114728769_114728992 | 2.21 |
Gm12829 |
predicted gene 12829 |
48076 |
0.13 |
chr2_172289400_172289557 | 2.21 |
Gm14275 |
predicted gene 14275 |
1345 |
0.39 |
chr11_47069891_47070050 | 2.21 |
Gm12175 |
predicted gene 12175 |
195557 |
0.03 |
chr2_142335542_142335810 | 2.20 |
Macrod2 |
mono-ADP ribosylhydrolase 2 |
159069 |
0.04 |
chr9_110277488_110277639 | 2.20 |
Mir6236 |
microRNA 6236 |
3724 |
0.14 |
chr2_126016117_126016268 | 2.19 |
Fgf7 |
fibroblast growth factor 7 |
18466 |
0.23 |
chr11_43747463_43748363 | 2.19 |
Ttc1 |
tetratricopeptide repeat domain 1 |
69 |
0.98 |
chr4_24213358_24214284 | 2.18 |
Gm11892 |
predicted gene 11892 |
24279 |
0.27 |
chr14_47189091_47189610 | 2.18 |
Gch1 |
GTP cyclohydrolase 1 |
63 |
0.95 |
chr3_72790721_72790890 | 2.18 |
Gm22451 |
predicted gene, 22451 |
52824 |
0.17 |
chr12_51002047_51002408 | 2.18 |
Gm40421 |
predicted gene, 40421 |
2646 |
0.28 |
chr12_95960495_95960831 | 2.18 |
1700019M22Rik |
RIKEN cDNA 1700019M22 gene |
86457 |
0.1 |
chr19_22595334_22595586 | 2.18 |
Trpm3 |
transient receptor potential cation channel, subfamily M, member 3 |
97141 |
0.08 |
chr17_8368820_8369004 | 2.17 |
T2 |
brachyury 2 |
3484 |
0.15 |
chr4_97235906_97236408 | 2.15 |
Gm12696 |
predicted gene 12696 |
286175 |
0.01 |
chr7_76789063_76789214 | 2.15 |
Gm45210 |
predicted gene 45210 |
89421 |
0.1 |
chr9_123384688_123385098 | 2.14 |
Lars2 |
leucyl-tRNA synthetase, mitochondrial |
7157 |
0.21 |
chr10_100111276_100111504 | 2.12 |
Kitl |
kit ligand |
23334 |
0.13 |
chr1_46725886_46726037 | 2.12 |
Dnah7c |
dynein, axonemal, heavy chain 7C |
71956 |
0.11 |
chr5_49783579_49783974 | 2.12 |
Gm7988 |
predicted gene 7988 |
118526 |
0.06 |
chr8_69160881_69161314 | 2.12 |
Lzts1 |
leucine zipper, putative tumor suppressor 1 |
20144 |
0.15 |
chr9_55511545_55512716 | 2.12 |
Etfa |
electron transferring flavoprotein, alpha polypeptide |
10 |
0.97 |
chr1_132653907_132654070 | 2.12 |
Nfasc |
neurofascin |
16897 |
0.21 |
chr13_19668619_19668818 | 2.11 |
Gm47606 |
predicted gene, 47606 |
5216 |
0.18 |
chr2_147074097_147074259 | 2.11 |
Nkx2-4 |
NK2 homeobox 4 |
11267 |
0.19 |
chr9_119803504_119803845 | 2.10 |
Scn11a |
sodium channel, voltage-gated, type XI, alpha |
20186 |
0.18 |
chr9_106144221_106144589 | 2.10 |
D030055H07Rik |
RIKEN cDNA D030055H07 gene |
4282 |
0.1 |
chr5_4814461_4814770 | 2.09 |
Gm43112 |
predicted gene 43112 |
8012 |
0.12 |
chr3_123645116_123645305 | 2.08 |
Ndst3 |
N-deacetylase/N-sulfotransferase (heparan glucosaminyl) 3 |
25709 |
0.17 |
chr1_64779552_64779703 | 2.08 |
Fzd5 |
frizzled class receptor 5 |
41876 |
0.12 |
chr2_41093986_41094158 | 2.07 |
Gm13460 |
predicted gene 13460 |
95215 |
0.09 |
chr8_122804038_122804246 | 2.07 |
Gm45743 |
predicted gene 45743 |
21944 |
0.08 |
chr12_117627233_117627711 | 2.07 |
A930023M06Rik |
RIKEN cDNA A930023M06 gene |
25433 |
0.18 |
chr10_48443821_48443992 | 2.07 |
Gm23584 |
predicted gene, 23584 |
6084 |
0.25 |
chr7_89590690_89590841 | 2.07 |
Gm2546 |
predicted gene 2546 |
16941 |
0.15 |
chr6_30654676_30654871 | 2.06 |
Cep41 |
centrosomal protein 41 |
2036 |
0.22 |
chr16_62681962_62682237 | 2.06 |
Gm9816 |
predicted pseudogene 9816 |
34938 |
0.17 |
chr18_40059274_40059425 | 2.05 |
Gm50395 |
predicted gene, 50395 |
50384 |
0.16 |
chr14_48418397_48418548 | 2.05 |
Gm3534 |
predicted pseudogene 3534 |
9854 |
0.15 |
chr4_109117557_109118287 | 2.05 |
Osbpl9 |
oxysterol binding protein-like 9 |
100 |
0.97 |
chr14_16074175_16074326 | 2.05 |
1700062C10Rik |
RIKEN cDNA 1700062C10 gene |
36979 |
0.17 |
chr15_78698186_78698356 | 2.05 |
Elfn2 |
leucine rich repeat and fibronectin type III, extracellular 2 |
12508 |
0.14 |
chr18_69607136_69607287 | 2.05 |
Tcf4 |
transcription factor 4 |
5233 |
0.3 |
chr14_86729579_86730133 | 2.04 |
Diaph3 |
diaphanous related formin 3 |
18988 |
0.22 |
chr13_21749997_21750396 | 2.03 |
H4c12 |
H4 clustered histone 12 |
309 |
0.63 |
chr2_56539846_56540169 | 2.03 |
Mir195b |
microRNA 195b |
245804 |
0.02 |
chr9_83487831_83488059 | 2.03 |
Gm28552 |
predicted gene 28552 |
7913 |
0.15 |
chr13_58964694_58965094 | 2.03 |
Ntrk2 |
neurotrophic tyrosine kinase, receptor, type 2 |
93159 |
0.06 |
chr5_42509326_42509477 | 2.02 |
Gm7181 |
predicted gene 7181 |
8987 |
0.33 |
chr13_44232185_44232493 | 2.02 |
Gm47781 |
predicted gene, 47781 |
59 |
0.97 |
chrX_93299069_93299568 | 2.01 |
Arx |
aristaless related homeobox |
12808 |
0.23 |
chr16_25293836_25294037 | 2.01 |
Tprg |
transformation related protein 63 regulated |
7115 |
0.32 |
chr18_30950333_30950492 | 2.00 |
Rit2 |
Ras-like without CAAX 2 |
262320 |
0.02 |
chr14_66343930_66344374 | 1.99 |
Stmn4 |
stathmin-like 4 |
144 |
0.95 |
chr3_52766954_52767169 | 1.99 |
Gm2447 |
predicted gene 2447 |
2462 |
0.3 |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.6 | 3.9 | GO:0042118 | endothelial cell activation(GO:0042118) |
0.6 | 1.7 | GO:0090158 | endoplasmic reticulum membrane organization(GO:0090158) |
0.5 | 1.6 | GO:1901475 | pyruvate transmembrane transport(GO:1901475) |
0.5 | 1.6 | GO:0021530 | spinal cord oligodendrocyte cell differentiation(GO:0021529) spinal cord oligodendrocyte cell fate specification(GO:0021530) |
0.5 | 0.5 | GO:0048769 | sarcomerogenesis(GO:0048769) |
0.5 | 2.5 | GO:0007256 | activation of JNKK activity(GO:0007256) |
0.5 | 1.5 | GO:0030242 | pexophagy(GO:0030242) |
0.5 | 1.4 | GO:0019086 | late viral transcription(GO:0019086) |
0.4 | 1.8 | GO:0031117 | positive regulation of microtubule depolymerization(GO:0031117) |
0.4 | 2.2 | GO:0009162 | deoxyribonucleoside monophosphate metabolic process(GO:0009162) |
0.4 | 2.2 | GO:1904936 | cerebral cortex GABAergic interneuron migration(GO:0021853) interneuron migration(GO:1904936) |
0.4 | 1.1 | GO:0034395 | regulation of transcription from RNA polymerase II promoter in response to iron(GO:0034395) |
0.4 | 2.1 | GO:0046654 | tetrahydrofolate biosynthetic process(GO:0046654) |
0.4 | 1.4 | GO:0030091 | protein repair(GO:0030091) |
0.3 | 2.0 | GO:0061732 | mitochondrial acetyl-CoA biosynthetic process from pyruvate(GO:0061732) |
0.3 | 0.9 | GO:0048388 | endosomal lumen acidification(GO:0048388) |
0.3 | 0.9 | GO:0007597 | blood coagulation, intrinsic pathway(GO:0007597) |
0.3 | 2.0 | GO:0098598 | vocal learning(GO:0042297) imitative learning(GO:0098596) learned vocalization behavior or vocal learning(GO:0098598) |
0.3 | 1.1 | GO:1901896 | positive regulation of calcium-transporting ATPase activity(GO:1901896) |
0.3 | 1.9 | GO:0006930 | substrate-dependent cell migration, cell extension(GO:0006930) |
0.3 | 0.8 | GO:0030423 | targeting of mRNA for destruction involved in RNA interference(GO:0030423) |
0.3 | 0.8 | GO:0071688 | skeletal muscle myosin thick filament assembly(GO:0030241) striated muscle myosin thick filament assembly(GO:0071688) |
0.3 | 1.3 | GO:0000160 | phosphorelay signal transduction system(GO:0000160) |
0.3 | 0.5 | GO:1901740 | negative regulation of myoblast fusion(GO:1901740) |
0.2 | 1.9 | GO:0009263 | deoxyribonucleotide biosynthetic process(GO:0009263) |
0.2 | 0.7 | GO:0036151 | phosphatidylcholine acyl-chain remodeling(GO:0036151) |
0.2 | 0.5 | GO:0071205 | protein localization to juxtaparanode region of axon(GO:0071205) |
0.2 | 0.7 | GO:2000173 | negative regulation of branching morphogenesis of a nerve(GO:2000173) |
0.2 | 0.7 | GO:1904742 | regulation of telomeric DNA binding(GO:1904742) |
0.2 | 4.4 | GO:0031114 | negative regulation of microtubule depolymerization(GO:0007026) regulation of microtubule depolymerization(GO:0031114) |
0.2 | 0.7 | GO:0072092 | ureteric bud invasion(GO:0072092) |
0.2 | 0.6 | GO:0060061 | Spemann organizer formation(GO:0060061) |
0.2 | 0.6 | GO:0099558 | maintenance of synapse structure(GO:0099558) |
0.2 | 0.8 | GO:0051611 | negative regulation of neurotransmitter uptake(GO:0051581) regulation of serotonin uptake(GO:0051611) negative regulation of serotonin uptake(GO:0051612) |
0.2 | 0.6 | GO:0034421 | post-translational protein acetylation(GO:0034421) |
0.2 | 0.6 | GO:2000017 | positive regulation of determination of dorsal identity(GO:2000017) |
0.2 | 0.4 | GO:1901894 | regulation of calcium-transporting ATPase activity(GO:1901894) |
0.2 | 0.9 | GO:0006003 | fructose 2,6-bisphosphate metabolic process(GO:0006003) |
0.2 | 0.5 | GO:0008611 | ether lipid biosynthetic process(GO:0008611) glycerol ether biosynthetic process(GO:0046504) cellular lipid biosynthetic process(GO:0097384) ether biosynthetic process(GO:1901503) |
0.2 | 0.5 | GO:0006546 | glycine catabolic process(GO:0006546) glycine decarboxylation via glycine cleavage system(GO:0019464) |
0.2 | 0.7 | GO:0008228 | opsonization(GO:0008228) |
0.2 | 1.1 | GO:0006642 | triglyceride mobilization(GO:0006642) |
0.2 | 1.6 | GO:0097034 | mitochondrial respiratory chain complex IV assembly(GO:0033617) mitochondrial respiratory chain complex IV biogenesis(GO:0097034) |
0.2 | 1.0 | GO:0006703 | estrogen biosynthetic process(GO:0006703) |
0.2 | 0.8 | GO:0021764 | amygdala development(GO:0021764) |
0.2 | 0.5 | GO:0070649 | formin-nucleated actin cable assembly(GO:0070649) |
0.2 | 0.5 | GO:0021882 | regulation of transcription from RNA polymerase II promoter involved in forebrain neuron fate commitment(GO:0021882) |
0.2 | 0.7 | GO:0090091 | positive regulation of extracellular matrix disassembly(GO:0090091) |
0.2 | 0.7 | GO:0008065 | establishment of blood-nerve barrier(GO:0008065) |
0.2 | 0.5 | GO:0007258 | JUN phosphorylation(GO:0007258) |
0.2 | 0.7 | GO:0002669 | positive regulation of T cell anergy(GO:0002669) positive regulation of lymphocyte anergy(GO:0002913) |
0.2 | 0.8 | GO:0006348 | chromatin silencing at telomere(GO:0006348) |
0.2 | 0.5 | GO:0032289 | central nervous system myelin formation(GO:0032289) |
0.2 | 0.8 | GO:0072656 | maintenance of protein location in mitochondrion(GO:0072656) |
0.2 | 0.5 | GO:0019676 | ammonia assimilation cycle(GO:0019676) |
0.2 | 0.6 | GO:0033563 | dorsal/ventral axon guidance(GO:0033563) |
0.2 | 0.6 | GO:0097476 | motor neuron migration(GO:0097475) spinal cord motor neuron migration(GO:0097476) |
0.2 | 0.5 | GO:1903525 | regulation of membrane tubulation(GO:1903525) |
0.2 | 0.2 | GO:0035087 | siRNA loading onto RISC involved in RNA interference(GO:0035087) |
0.2 | 0.6 | GO:1900747 | negative regulation of vascular endothelial growth factor signaling pathway(GO:1900747) |
0.2 | 0.6 | GO:0030050 | vesicle transport along actin filament(GO:0030050) |
0.1 | 1.2 | GO:0033601 | positive regulation of mammary gland epithelial cell proliferation(GO:0033601) |
0.1 | 1.0 | GO:0035735 | intraciliary transport involved in cilium morphogenesis(GO:0035735) |
0.1 | 0.4 | GO:1902488 | cholangiocyte apoptotic process(GO:1902488) regulation of cholangiocyte apoptotic process(GO:1904192) negative regulation of cholangiocyte apoptotic process(GO:1904193) |
0.1 | 0.6 | GO:2001013 | epithelial cell proliferation involved in renal tubule morphogenesis(GO:2001013) |
0.1 | 0.4 | GO:0048207 | vesicle targeting, rough ER to cis-Golgi(GO:0048207) COPII vesicle coating(GO:0048208) |
0.1 | 0.4 | GO:2000686 | regulation of rubidium ion transmembrane transporter activity(GO:2000686) |
0.1 | 0.8 | GO:0051256 | mitotic spindle elongation(GO:0000022) mitotic spindle midzone assembly(GO:0051256) |
0.1 | 0.5 | GO:0019230 | proprioception(GO:0019230) |
0.1 | 0.8 | GO:0031848 | protection from non-homologous end joining at telomere(GO:0031848) |
0.1 | 0.4 | GO:1903223 | positive regulation of oxidative stress-induced neuron death(GO:1903223) |
0.1 | 2.0 | GO:0007019 | microtubule depolymerization(GO:0007019) |
0.1 | 0.7 | GO:0010815 | bradykinin catabolic process(GO:0010815) |
0.1 | 0.7 | GO:1900127 | positive regulation of hyaluronan biosynthetic process(GO:1900127) |
0.1 | 0.5 | GO:2000169 | regulation of peptidyl-cysteine S-nitrosylation(GO:2000169) |
0.1 | 0.3 | GO:0097114 | NMDA glutamate receptor clustering(GO:0097114) |
0.1 | 0.5 | GO:0000707 | meiotic DNA recombinase assembly(GO:0000707) |
0.1 | 0.6 | GO:0015722 | canalicular bile acid transport(GO:0015722) |
0.1 | 0.4 | GO:0001306 | age-dependent response to oxidative stress(GO:0001306) age-dependent general metabolic decline(GO:0007571) |
0.1 | 0.5 | GO:0018406 | protein C-linked glycosylation(GO:0018103) peptidyl-tryptophan modification(GO:0018211) protein C-linked glycosylation via tryptophan(GO:0018317) protein C-linked glycosylation via 2'-alpha-mannosyl-L-tryptophan(GO:0018406) |
0.1 | 1.2 | GO:0042448 | progesterone metabolic process(GO:0042448) |
0.1 | 1.4 | GO:0009226 | nucleotide-sugar biosynthetic process(GO:0009226) |
0.1 | 0.4 | GO:0006435 | threonyl-tRNA aminoacylation(GO:0006435) |
0.1 | 0.2 | GO:0010908 | regulation of heparan sulfate proteoglycan biosynthetic process(GO:0010908) positive regulation of heparan sulfate proteoglycan biosynthetic process(GO:0010909) positive regulation of proteoglycan biosynthetic process(GO:1902730) |
0.1 | 0.2 | GO:0021779 | oligodendrocyte cell fate specification(GO:0021778) oligodendrocyte cell fate commitment(GO:0021779) glial cell fate specification(GO:0021780) |
0.1 | 0.3 | GO:0046167 | glycerol-3-phosphate biosynthetic process(GO:0046167) |
0.1 | 0.2 | GO:0097118 | neuroligin clustering involved in postsynaptic membrane assembly(GO:0097118) |
0.1 | 0.3 | GO:0045658 | regulation of neutrophil differentiation(GO:0045658) |
0.1 | 0.6 | GO:0010991 | negative regulation of SMAD protein complex assembly(GO:0010991) |
0.1 | 0.3 | GO:0048199 | vesicle targeting, to, from or within Golgi(GO:0048199) |
0.1 | 0.3 | GO:0043402 | glucocorticoid mediated signaling pathway(GO:0043402) regulation of glucocorticoid mediated signaling pathway(GO:1900169) |
0.1 | 0.1 | GO:0086023 | adrenergic receptor signaling pathway involved in heart process(GO:0086023) |
0.1 | 0.6 | GO:0060059 | embryonic retina morphogenesis in camera-type eye(GO:0060059) |
0.1 | 0.4 | GO:0051725 | protein de-ADP-ribosylation(GO:0051725) |
0.1 | 0.3 | GO:0006597 | spermine biosynthetic process(GO:0006597) |
0.1 | 0.5 | GO:0031133 | regulation of axon diameter(GO:0031133) |
0.1 | 0.6 | GO:0045040 | protein import into mitochondrial outer membrane(GO:0045040) |
0.1 | 0.2 | GO:0038128 | ERBB2 signaling pathway(GO:0038128) |
0.1 | 0.2 | GO:0035526 | retrograde transport, plasma membrane to Golgi(GO:0035526) |
0.1 | 0.2 | GO:1902988 | neurofibrillary tangle assembly(GO:1902988) regulation of neurofibrillary tangle assembly(GO:1902996) |
0.1 | 0.4 | GO:0000480 | endonucleolytic cleavage in 5'-ETS of tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000480) |
0.1 | 0.4 | GO:0045743 | positive regulation of fibroblast growth factor receptor signaling pathway(GO:0045743) |
0.1 | 0.5 | GO:0045636 | positive regulation of melanocyte differentiation(GO:0045636) |
0.1 | 0.3 | GO:0006562 | proline catabolic process(GO:0006562) |
0.1 | 0.7 | GO:0009650 | UV protection(GO:0009650) |
0.1 | 0.9 | GO:0061088 | sequestering of zinc ion(GO:0032119) regulation of sequestering of zinc ion(GO:0061088) |
0.1 | 0.3 | GO:0006481 | C-terminal protein methylation(GO:0006481) |
0.1 | 0.4 | GO:0016557 | peroxisome membrane biogenesis(GO:0016557) |
0.1 | 0.2 | GO:0003330 | regulation of extracellular matrix constituent secretion(GO:0003330) positive regulation of extracellular matrix constituent secretion(GO:0003331) |
0.1 | 1.0 | GO:0031987 | locomotion involved in locomotory behavior(GO:0031987) |
0.1 | 0.2 | GO:0097155 | fasciculation of sensory neuron axon(GO:0097155) |
0.1 | 0.7 | GO:0061577 | calcium ion transmembrane transport via high voltage-gated calcium channel(GO:0061577) |
0.1 | 0.7 | GO:0090129 | positive regulation of synapse maturation(GO:0090129) |
0.1 | 0.8 | GO:0000712 | resolution of meiotic recombination intermediates(GO:0000712) |
0.1 | 0.1 | GO:0097466 | glycoprotein ERAD pathway(GO:0097466) response to glycoprotein(GO:1904587) |
0.1 | 0.4 | GO:0070922 | small RNA loading onto RISC(GO:0070922) |
0.1 | 0.5 | GO:1900122 | positive regulation of receptor binding(GO:1900122) |
0.1 | 0.3 | GO:0018002 | N-terminal peptidyl-serine acetylation(GO:0017198) N-terminal peptidyl-glutamic acid acetylation(GO:0018002) peptidyl-serine acetylation(GO:0030920) |
0.1 | 0.6 | GO:0060662 | tube lumen cavitation(GO:0060605) salivary gland cavitation(GO:0060662) |
0.1 | 0.2 | GO:1902564 | negative regulation of neutrophil activation(GO:1902564) |
0.1 | 1.6 | GO:0035855 | megakaryocyte development(GO:0035855) |
0.1 | 0.3 | GO:0061366 | behavioral response to chemical pain(GO:0061366) behavioral response to formalin induced pain(GO:0061368) |
0.1 | 0.3 | GO:0043490 | malate-aspartate shuttle(GO:0043490) |
0.1 | 0.2 | GO:0035609 | C-terminal protein deglutamylation(GO:0035609) |
0.1 | 0.4 | GO:0010994 | regulation of ubiquitin homeostasis(GO:0010993) free ubiquitin chain polymerization(GO:0010994) |
0.1 | 0.6 | GO:0006108 | malate metabolic process(GO:0006108) |
0.1 | 0.5 | GO:0046501 | protoporphyrinogen IX metabolic process(GO:0046501) |
0.1 | 0.5 | GO:0044791 | modulation by host of viral release from host cell(GO:0044789) positive regulation by host of viral release from host cell(GO:0044791) |
0.1 | 1.4 | GO:0006895 | Golgi to endosome transport(GO:0006895) |
0.1 | 1.0 | GO:1904293 | negative regulation of ERAD pathway(GO:1904293) |
0.1 | 0.4 | GO:0048133 | germ-line stem cell division(GO:0042078) male germ-line stem cell asymmetric division(GO:0048133) germline stem cell asymmetric division(GO:0098728) |
0.1 | 0.6 | GO:0045161 | neuronal ion channel clustering(GO:0045161) |
0.1 | 0.3 | GO:1901165 | positive regulation of trophoblast cell migration(GO:1901165) |
0.1 | 0.3 | GO:0034242 | negative regulation of syncytium formation by plasma membrane fusion(GO:0034242) |
0.1 | 0.2 | GO:1904706 | negative regulation of vascular smooth muscle cell proliferation(GO:1904706) |
0.1 | 0.8 | GO:0045792 | negative regulation of cell size(GO:0045792) |
0.1 | 0.2 | GO:0035482 | gastric motility(GO:0035482) |
0.1 | 0.3 | GO:0030202 | heparin metabolic process(GO:0030202) |
0.1 | 0.7 | GO:0009313 | oligosaccharide catabolic process(GO:0009313) |
0.1 | 0.3 | GO:0006842 | tricarboxylic acid transport(GO:0006842) citrate transport(GO:0015746) |
0.1 | 0.1 | GO:0032077 | positive regulation of deoxyribonuclease activity(GO:0032077) |
0.1 | 0.3 | GO:0071374 | cellular response to parathyroid hormone stimulus(GO:0071374) |
0.1 | 1.6 | GO:0045671 | negative regulation of osteoclast differentiation(GO:0045671) |
0.1 | 0.2 | GO:0006714 | sesquiterpenoid metabolic process(GO:0006714) |
0.1 | 0.2 | GO:0006553 | lysine metabolic process(GO:0006553) |
0.1 | 0.2 | GO:0016259 | selenocysteine metabolic process(GO:0016259) |
0.1 | 0.2 | GO:0001831 | trophectodermal cellular morphogenesis(GO:0001831) |
0.1 | 0.2 | GO:0009233 | menaquinone metabolic process(GO:0009233) |
0.1 | 0.3 | GO:0003383 | apical constriction(GO:0003383) |
0.1 | 0.1 | GO:0030035 | microspike assembly(GO:0030035) |
0.1 | 0.5 | GO:0021860 | pyramidal neuron development(GO:0021860) |
0.1 | 0.4 | GO:0046836 | glycolipid transport(GO:0046836) |
0.1 | 0.2 | GO:1905005 | regulation of epithelial to mesenchymal transition involved in endocardial cushion formation(GO:1905005) |
0.1 | 0.1 | GO:2000807 | regulation of synaptic vesicle clustering(GO:2000807) |
0.1 | 0.1 | GO:0030950 | establishment or maintenance of actin cytoskeleton polarity(GO:0030950) |
0.1 | 0.3 | GO:0072697 | protein localization to cell cortex(GO:0072697) |
0.1 | 0.2 | GO:2000481 | positive regulation of cAMP-dependent protein kinase activity(GO:2000481) |
0.1 | 0.2 | GO:0071673 | positive regulation of smooth muscle cell chemotaxis(GO:0071673) |
0.1 | 0.3 | GO:0045053 | protein retention in Golgi apparatus(GO:0045053) |
0.1 | 0.1 | GO:0044381 | glucose import in response to insulin stimulus(GO:0044381) regulation of glucose import in response to insulin stimulus(GO:2001273) |
0.1 | 0.4 | GO:0014063 | negative regulation of serotonin secretion(GO:0014063) |
0.1 | 0.1 | GO:1902302 | regulation of potassium ion export(GO:1902302) |
0.1 | 0.4 | GO:0046146 | tetrahydrobiopterin metabolic process(GO:0046146) |
0.1 | 0.5 | GO:0045199 | maintenance of epithelial cell apical/basal polarity(GO:0045199) |
0.1 | 0.3 | GO:0042997 | negative regulation of Golgi to plasma membrane protein transport(GO:0042997) |
0.1 | 0.4 | GO:1990564 | protein polyufmylation(GO:1990564) protein K69-linked ufmylation(GO:1990592) |
0.1 | 0.4 | GO:0060287 | epithelial cilium movement involved in determination of left/right asymmetry(GO:0060287) |
0.1 | 0.3 | GO:0014816 | skeletal muscle satellite cell differentiation(GO:0014816) |
0.1 | 0.2 | GO:0021828 | cerebral cortex tangential migration using cell-axon interactions(GO:0021824) gonadotrophin-releasing hormone neuronal migration to the hypothalamus(GO:0021828) hypothalamic tangential migration using cell-axon interactions(GO:0021856) facioacoustic ganglion development(GO:1903375) |
0.1 | 0.4 | GO:1903887 | motile primary cilium assembly(GO:1903887) |
0.1 | 0.1 | GO:0045901 | positive regulation of translational elongation(GO:0045901) |
0.1 | 0.4 | GO:0006561 | proline biosynthetic process(GO:0006561) |
0.1 | 0.4 | GO:0030388 | fructose 1,6-bisphosphate metabolic process(GO:0030388) |
0.1 | 0.1 | GO:1990035 | calcium ion import into cell(GO:1990035) |
0.1 | 0.2 | GO:0070164 | negative regulation of adiponectin secretion(GO:0070164) |
0.1 | 1.0 | GO:0010842 | retina layer formation(GO:0010842) |
0.1 | 0.6 | GO:1902855 | regulation of nonmotile primary cilium assembly(GO:1902855) |
0.1 | 0.2 | GO:2000705 | regulation of dense core granule biogenesis(GO:2000705) |
0.1 | 0.1 | GO:0005984 | disaccharide metabolic process(GO:0005984) |
0.1 | 0.2 | GO:0006269 | DNA replication, synthesis of RNA primer(GO:0006269) |
0.1 | 0.2 | GO:0046341 | CDP-diacylglycerol metabolic process(GO:0046341) |
0.1 | 0.2 | GO:0048007 | antigen processing and presentation of lipid antigen via MHC class Ib(GO:0048003) antigen processing and presentation, exogenous lipid antigen via MHC class Ib(GO:0048007) |
0.1 | 0.1 | GO:0035694 | mitochondrial protein catabolic process(GO:0035694) |
0.1 | 0.3 | GO:0019276 | UDP-N-acetylgalactosamine metabolic process(GO:0019276) |
0.1 | 0.2 | GO:2001274 | negative regulation of glucose import in response to insulin stimulus(GO:2001274) |
0.1 | 0.3 | GO:0030578 | PML body organization(GO:0030578) |
0.1 | 0.1 | GO:1900451 | positive regulation of glutamate receptor signaling pathway(GO:1900451) positive regulation of alpha-amino-3-hydroxy-5-methyl-4-isoxazole propionate selective glutamate receptor activity(GO:2000969) |
0.1 | 0.2 | GO:0032483 | regulation of Rab protein signal transduction(GO:0032483) |
0.1 | 0.3 | GO:0003241 | growth involved in heart morphogenesis(GO:0003241) |
0.1 | 0.3 | GO:1903071 | regulation of ER-associated ubiquitin-dependent protein catabolic process(GO:1903069) positive regulation of ER-associated ubiquitin-dependent protein catabolic process(GO:1903071) |
0.1 | 0.5 | GO:0021796 | cerebral cortex regionalization(GO:0021796) |
0.1 | 0.1 | GO:0021943 | formation of radial glial scaffolds(GO:0021943) |
0.1 | 0.3 | GO:0018230 | peptidyl-L-cysteine S-palmitoylation(GO:0018230) peptidyl-S-diacylglycerol-L-cysteine biosynthetic process from peptidyl-cysteine(GO:0018231) |
0.1 | 0.2 | GO:1903371 | regulation of endoplasmic reticulum tubular network organization(GO:1903371) |
0.1 | 0.1 | GO:2000729 | positive regulation of mesenchymal cell proliferation involved in ureter development(GO:2000729) |
0.1 | 0.5 | GO:0035278 | miRNA mediated inhibition of translation(GO:0035278) |
0.1 | 0.3 | GO:0061484 | hematopoietic stem cell homeostasis(GO:0061484) |
0.1 | 0.2 | GO:1902474 | positive regulation of protein localization to synapse(GO:1902474) |
0.1 | 0.2 | GO:0021914 | negative regulation of smoothened signaling pathway involved in ventral spinal cord patterning(GO:0021914) |
0.1 | 0.2 | GO:0070127 | tRNA aminoacylation for mitochondrial protein translation(GO:0070127) |
0.1 | 0.3 | GO:0032747 | positive regulation of interleukin-23 production(GO:0032747) |
0.1 | 0.6 | GO:0060213 | regulation of nuclear-transcribed mRNA poly(A) tail shortening(GO:0060211) positive regulation of nuclear-transcribed mRNA poly(A) tail shortening(GO:0060213) |
0.1 | 1.3 | GO:0000470 | maturation of LSU-rRNA(GO:0000470) |
0.1 | 0.1 | GO:0014732 | skeletal muscle atrophy(GO:0014732) |
0.1 | 0.1 | GO:0021912 | regulation of transcription from RNA polymerase II promoter involved in spinal cord motor neuron fate specification(GO:0021912) |
0.1 | 0.5 | GO:0042795 | snRNA transcription from RNA polymerase II promoter(GO:0042795) |
0.1 | 0.1 | GO:0031585 | regulation of inositol 1,4,5-trisphosphate-sensitive calcium-release channel activity(GO:0031585) |
0.1 | 0.2 | GO:0061051 | positive regulation of cell growth involved in cardiac muscle cell development(GO:0061051) |
0.1 | 0.2 | GO:0019509 | L-methionine biosynthetic process from methylthioadenosine(GO:0019509) |
0.1 | 0.3 | GO:0080009 | mRNA methylation(GO:0080009) |
0.1 | 0.2 | GO:0045345 | MHC class I biosynthetic process(GO:0045341) regulation of MHC class I biosynthetic process(GO:0045343) positive regulation of MHC class I biosynthetic process(GO:0045345) |
0.1 | 0.1 | GO:0051660 | establishment of centrosome localization(GO:0051660) |
0.1 | 0.2 | GO:0071698 | olfactory placode formation(GO:0030910) olfactory placode development(GO:0071698) olfactory placode morphogenesis(GO:0071699) |
0.1 | 0.8 | GO:0006968 | cellular defense response(GO:0006968) |
0.1 | 0.2 | GO:0060178 | regulation of exocyst localization(GO:0060178) |
0.1 | 0.3 | GO:0071763 | nuclear membrane organization(GO:0071763) |
0.1 | 0.2 | GO:0017182 | peptidyl-diphthamide metabolic process(GO:0017182) peptidyl-diphthamide biosynthetic process from peptidyl-histidine(GO:0017183) |
0.1 | 0.5 | GO:0021542 | dentate gyrus development(GO:0021542) |
0.1 | 0.3 | GO:2000618 | regulation of histone H4-K16 acetylation(GO:2000618) |
0.1 | 0.2 | GO:0014028 | notochord formation(GO:0014028) |
0.1 | 0.1 | GO:0001998 | angiotensin mediated vasoconstriction involved in regulation of systemic arterial blood pressure(GO:0001998) |
0.1 | 0.1 | GO:0050955 | thermoception(GO:0050955) |
0.1 | 0.2 | GO:0090427 | activation of meiosis(GO:0090427) |
0.1 | 0.3 | GO:0070345 | negative regulation of fat cell proliferation(GO:0070345) |
0.1 | 0.4 | GO:0046069 | cGMP catabolic process(GO:0046069) |
0.1 | 0.3 | GO:0051461 | positive regulation of corticotropin secretion(GO:0051461) |
0.1 | 0.2 | GO:0050427 | 3'-phosphoadenosine 5'-phosphosulfate metabolic process(GO:0050427) |
0.1 | 0.4 | GO:0021785 | branchiomotor neuron axon guidance(GO:0021785) |
0.1 | 0.2 | GO:2000118 | regulation of sodium-dependent phosphate transport(GO:2000118) |
0.1 | 0.1 | GO:0060523 | prostate epithelial cord elongation(GO:0060523) |
0.1 | 0.9 | GO:0006144 | purine nucleobase metabolic process(GO:0006144) |
0.1 | 0.2 | GO:0032929 | negative regulation of superoxide anion generation(GO:0032929) |
0.1 | 0.2 | GO:0019482 | beta-alanine metabolic process(GO:0019482) |
0.1 | 0.4 | GO:0035811 | negative regulation of urine volume(GO:0035811) |
0.1 | 0.2 | GO:0021999 | neural plate anterior/posterior regionalization(GO:0021999) |
0.1 | 0.2 | GO:0021869 | forebrain ventricular zone progenitor cell division(GO:0021869) |
0.1 | 0.2 | GO:0070295 | renal water absorption(GO:0070295) |
0.1 | 0.4 | GO:2000270 | negative regulation of fibroblast apoptotic process(GO:2000270) |
0.1 | 0.3 | GO:0071609 | chemokine (C-C motif) ligand 5 production(GO:0071609) |
0.1 | 0.3 | GO:0051987 | positive regulation of attachment of spindle microtubules to kinetochore(GO:0051987) |
0.1 | 0.1 | GO:0000965 | mitochondrial RNA 3'-end processing(GO:0000965) |
0.1 | 0.1 | GO:0006362 | transcription elongation from RNA polymerase I promoter(GO:0006362) |
0.1 | 0.5 | GO:0006977 | DNA damage response, signal transduction by p53 class mediator resulting in cell cycle arrest(GO:0006977) |
0.1 | 0.3 | GO:0018101 | protein citrullination(GO:0018101) |
0.1 | 0.4 | GO:0060136 | embryonic process involved in female pregnancy(GO:0060136) |
0.1 | 0.2 | GO:0070537 | histone H2A K63-linked deubiquitination(GO:0070537) |
0.1 | 0.2 | GO:0006772 | thiamine metabolic process(GO:0006772) thiamine-containing compound metabolic process(GO:0042723) |
0.1 | 0.2 | GO:0071462 | cellular response to water stimulus(GO:0071462) |
0.1 | 0.1 | GO:0000237 | leptotene(GO:0000237) |
0.1 | 0.3 | GO:0032466 | negative regulation of cytokinesis(GO:0032466) |
0.1 | 0.1 | GO:0060375 | regulation of mast cell differentiation(GO:0060375) |
0.1 | 0.2 | GO:0033326 | cerebrospinal fluid secretion(GO:0033326) |
0.1 | 0.3 | GO:0071257 | cellular response to electrical stimulus(GO:0071257) |
0.1 | 0.1 | GO:0036215 | response to stem cell factor(GO:0036215) cellular response to stem cell factor stimulus(GO:0036216) Kit signaling pathway(GO:0038109) |
0.1 | 0.3 | GO:0000056 | ribosomal small subunit export from nucleus(GO:0000056) |
0.1 | 0.1 | GO:0071680 | response to indole-3-methanol(GO:0071680) cellular response to indole-3-methanol(GO:0071681) |
0.1 | 1.1 | GO:0061001 | regulation of dendritic spine morphogenesis(GO:0061001) |
0.1 | 0.2 | GO:0070366 | regulation of hepatocyte differentiation(GO:0070366) |
0.0 | 0.2 | GO:0051031 | tRNA transport(GO:0051031) |
0.0 | 0.1 | GO:0009826 | unidimensional cell growth(GO:0009826) |
0.0 | 0.1 | GO:0051661 | maintenance of centrosome location(GO:0051661) |
0.0 | 0.1 | GO:0002314 | germinal center B cell differentiation(GO:0002314) |
0.0 | 0.1 | GO:1902075 | cellular response to salt(GO:1902075) |
0.0 | 0.1 | GO:0035093 | spermatogenesis, exchange of chromosomal proteins(GO:0035093) |
0.0 | 0.0 | GO:0072050 | S-shaped body morphogenesis(GO:0072050) |
0.0 | 0.1 | GO:2000110 | negative regulation of macrophage apoptotic process(GO:2000110) |
0.0 | 1.9 | GO:0010501 | RNA secondary structure unwinding(GO:0010501) |
0.0 | 0.1 | GO:0007406 | negative regulation of neuroblast proliferation(GO:0007406) |
0.0 | 0.6 | GO:0042748 | circadian sleep/wake cycle, non-REM sleep(GO:0042748) |
0.0 | 0.1 | GO:0035928 | RNA import into mitochondrion(GO:0035927) rRNA import into mitochondrion(GO:0035928) |
0.0 | 0.2 | GO:0060665 | regulation of branching involved in salivary gland morphogenesis by mesenchymal-epithelial signaling(GO:0060665) |
0.0 | 0.2 | GO:0051013 | microtubule severing(GO:0051013) |
0.0 | 0.2 | GO:0045724 | positive regulation of cilium assembly(GO:0045724) |
0.0 | 0.1 | GO:0070634 | transepithelial ammonium transport(GO:0070634) |
0.0 | 0.1 | GO:1900625 | regulation of monocyte aggregation(GO:1900623) positive regulation of monocyte aggregation(GO:1900625) |
0.0 | 0.1 | GO:0043366 | beta selection(GO:0043366) |
0.0 | 0.1 | GO:0002282 | microglial cell activation involved in immune response(GO:0002282) |
0.0 | 0.6 | GO:0008608 | attachment of spindle microtubules to kinetochore(GO:0008608) |
0.0 | 0.0 | GO:0006689 | ganglioside catabolic process(GO:0006689) |
0.0 | 0.1 | GO:1903753 | negative regulation of p38MAPK cascade(GO:1903753) |
0.0 | 0.3 | GO:0051103 | DNA ligation involved in DNA repair(GO:0051103) |
0.0 | 0.1 | GO:0007060 | male meiosis chromosome segregation(GO:0007060) |
0.0 | 0.2 | GO:1902369 | negative regulation of RNA catabolic process(GO:1902369) |
0.0 | 0.2 | GO:1902774 | late endosome to lysosome transport(GO:1902774) |
0.0 | 0.1 | GO:0021830 | interneuron migration from the subpallium to the cortex(GO:0021830) |
0.0 | 0.3 | GO:0000972 | transcription-dependent tethering of RNA polymerase II gene DNA at nuclear periphery(GO:0000972) |
0.0 | 0.1 | GO:0019042 | viral latency(GO:0019042) |
0.0 | 0.1 | GO:0042524 | negative regulation of tyrosine phosphorylation of Stat5 protein(GO:0042524) |
0.0 | 0.8 | GO:0018345 | protein palmitoylation(GO:0018345) |
0.0 | 0.1 | GO:0072051 | juxtaglomerular apparatus development(GO:0072051) |
0.0 | 0.1 | GO:0021938 | smoothened signaling pathway involved in regulation of cerebellar granule cell precursor cell proliferation(GO:0021938) |
0.0 | 0.1 | GO:0036066 | protein O-linked fucosylation(GO:0036066) |
0.0 | 0.1 | GO:0042126 | nitrate metabolic process(GO:0042126) |
0.0 | 0.3 | GO:0060179 | male mating behavior(GO:0060179) |
0.0 | 0.1 | GO:0048682 | axon extension involved in regeneration(GO:0048677) sprouting of injured axon(GO:0048682) |
0.0 | 0.3 | GO:2001275 | positive regulation of glucose import in response to insulin stimulus(GO:2001275) |
0.0 | 0.1 | GO:0021797 | forebrain anterior/posterior pattern specification(GO:0021797) |
0.0 | 0.1 | GO:0060159 | regulation of dopamine receptor signaling pathway(GO:0060159) |
0.0 | 0.5 | GO:0010762 | regulation of fibroblast migration(GO:0010762) |
0.0 | 0.6 | GO:0035640 | exploration behavior(GO:0035640) |
0.0 | 0.7 | GO:0071475 | cellular hyperosmotic salinity response(GO:0071475) |
0.0 | 1.1 | GO:0031110 | regulation of microtubule polymerization or depolymerization(GO:0031110) |
0.0 | 0.3 | GO:0035721 | intraciliary retrograde transport(GO:0035721) |
0.0 | 1.6 | GO:0030032 | lamellipodium assembly(GO:0030032) |
0.0 | 0.6 | GO:0007190 | activation of adenylate cyclase activity(GO:0007190) |
0.0 | 0.2 | GO:0046874 | quinolinate metabolic process(GO:0046874) |
0.0 | 0.1 | GO:0035627 | ceramide transport(GO:0035627) |
0.0 | 0.1 | GO:0052422 | modulation of catalytic activity in other organism involved in symbiotic interaction(GO:0052203) modulation by host of symbiont catalytic activity(GO:0052422) |
0.0 | 0.2 | GO:0070327 | thyroid hormone transport(GO:0070327) |
0.0 | 0.2 | GO:0044027 | hypermethylation of CpG island(GO:0044027) |
0.0 | 0.1 | GO:0042891 | antibiotic transport(GO:0042891) |
0.0 | 0.3 | GO:0051561 | positive regulation of mitochondrial calcium ion concentration(GO:0051561) |
0.0 | 0.0 | GO:0001887 | selenium compound metabolic process(GO:0001887) |
0.0 | 0.1 | GO:0039689 | negative stranded viral RNA replication(GO:0039689) multi-organism biosynthetic process(GO:0044034) |
0.0 | 0.6 | GO:0016339 | calcium-dependent cell-cell adhesion via plasma membrane cell adhesion molecules(GO:0016339) |
0.0 | 0.6 | GO:0044126 | regulation of growth of symbiont in host(GO:0044126) modulation of growth of symbiont involved in interaction with host(GO:0044144) |
0.0 | 0.3 | GO:0048304 | positive regulation of isotype switching to IgG isotypes(GO:0048304) |
0.0 | 0.2 | GO:0090148 | membrane fission(GO:0090148) |
0.0 | 0.8 | GO:0030866 | cortical actin cytoskeleton organization(GO:0030866) |
0.0 | 0.2 | GO:0035457 | cellular response to interferon-alpha(GO:0035457) |
0.0 | 0.1 | GO:0045074 | interleukin-10 biosynthetic process(GO:0042091) regulation of interleukin-10 biosynthetic process(GO:0045074) |
0.0 | 0.4 | GO:0021694 | cerebellar Purkinje cell layer formation(GO:0021694) |
0.0 | 0.1 | GO:0007158 | neuron cell-cell adhesion(GO:0007158) |
0.0 | 0.0 | GO:1901978 | positive regulation of cell cycle checkpoint(GO:1901978) |
0.0 | 0.1 | GO:0001732 | formation of cytoplasmic translation initiation complex(GO:0001732) |
0.0 | 0.2 | GO:0071361 | cellular response to ethanol(GO:0071361) |
0.0 | 0.3 | GO:0042984 | amyloid precursor protein biosynthetic process(GO:0042983) regulation of amyloid precursor protein biosynthetic process(GO:0042984) |
0.0 | 0.1 | GO:0061502 | early endosome to recycling endosome transport(GO:0061502) |
0.0 | 0.1 | GO:2000402 | negative regulation of lymphocyte migration(GO:2000402) |
0.0 | 0.0 | GO:0060664 | epithelial cell proliferation involved in salivary gland morphogenesis(GO:0060664) |
0.0 | 0.1 | GO:0046292 | formaldehyde metabolic process(GO:0046292) |
0.0 | 0.0 | GO:0052405 | negative regulation by host of symbiont molecular function(GO:0052405) modification by host of symbiont molecular function(GO:0052428) |
0.0 | 0.1 | GO:0043152 | induction of bacterial agglutination(GO:0043152) |
0.0 | 0.9 | GO:0006376 | mRNA splice site selection(GO:0006376) |
0.0 | 0.1 | GO:0045541 | negative regulation of cholesterol biosynthetic process(GO:0045541) negative regulation of cholesterol metabolic process(GO:0090206) |
0.0 | 0.1 | GO:0006105 | succinate metabolic process(GO:0006105) |
0.0 | 0.7 | GO:0033539 | fatty acid beta-oxidation using acyl-CoA dehydrogenase(GO:0033539) |
0.0 | 0.4 | GO:0033631 | cell-cell adhesion mediated by integrin(GO:0033631) |
0.0 | 0.2 | GO:1903441 | protein localization to ciliary membrane(GO:1903441) |
0.0 | 0.1 | GO:0043097 | pyrimidine-containing compound salvage(GO:0008655) pyrimidine nucleoside salvage(GO:0043097) |
0.0 | 0.2 | GO:0071850 | mitotic cell cycle arrest(GO:0071850) |
0.0 | 0.1 | GO:0032914 | positive regulation of transforming growth factor beta1 production(GO:0032914) |
0.0 | 0.1 | GO:1900157 | regulation of bone mineralization involved in bone maturation(GO:1900157) |
0.0 | 0.2 | GO:0045916 | negative regulation of complement activation(GO:0045916) negative regulation of protein activation cascade(GO:2000258) |
0.0 | 0.1 | GO:0061727 | methylglyoxal catabolic process to D-lactate via S-lactoyl-glutathione(GO:0019243) methylglyoxal catabolic process(GO:0051596) methylglyoxal catabolic process to lactate(GO:0061727) |
0.0 | 0.2 | GO:0061158 | 3'-UTR-mediated mRNA destabilization(GO:0061158) |
0.0 | 0.1 | GO:0048478 | replication fork protection(GO:0048478) |
0.0 | 0.0 | GO:0090272 | negative regulation of fibroblast growth factor production(GO:0090272) |
0.0 | 0.5 | GO:0034508 | centromere complex assembly(GO:0034508) |
0.0 | 0.8 | GO:0006491 | N-glycan processing(GO:0006491) |
0.0 | 0.2 | GO:1901678 | iron coordination entity transport(GO:1901678) |
0.0 | 0.1 | GO:0021978 | telencephalon regionalization(GO:0021978) |
0.0 | 0.3 | GO:0006122 | mitochondrial electron transport, ubiquinol to cytochrome c(GO:0006122) |
0.0 | 0.5 | GO:0097031 | NADH dehydrogenase complex assembly(GO:0010257) mitochondrial respiratory chain complex I assembly(GO:0032981) mitochondrial respiratory chain complex I biogenesis(GO:0097031) |
0.0 | 0.2 | GO:0048312 | intracellular distribution of mitochondria(GO:0048312) |
0.0 | 0.2 | GO:0032287 | peripheral nervous system myelin maintenance(GO:0032287) |
0.0 | 0.1 | GO:0072310 | glomerular visceral epithelial cell development(GO:0072015) glomerular epithelial cell development(GO:0072310) |
0.0 | 0.1 | GO:0015959 | diadenosine polyphosphate metabolic process(GO:0015959) |
0.0 | 0.6 | GO:0007031 | peroxisome organization(GO:0007031) |
0.0 | 0.3 | GO:0006241 | CTP biosynthetic process(GO:0006241) CTP metabolic process(GO:0046036) |
0.0 | 0.1 | GO:0010360 | negative regulation of anion channel activity(GO:0010360) |
0.0 | 0.1 | GO:0021773 | striatal medium spiny neuron differentiation(GO:0021773) |
0.0 | 0.1 | GO:0032066 | nucleolus to nucleoplasm transport(GO:0032066) |
0.0 | 0.1 | GO:0030327 | prenylated protein catabolic process(GO:0030327) |
0.0 | 0.2 | GO:0035581 | sequestering of extracellular ligand from receptor(GO:0035581) extracellular regulation of signal transduction(GO:1900115) extracellular negative regulation of signal transduction(GO:1900116) |
0.0 | 0.1 | GO:0018076 | N-terminal peptidyl-lysine acetylation(GO:0018076) |
0.0 | 0.3 | GO:0034497 | protein localization to pre-autophagosomal structure(GO:0034497) |
0.0 | 0.1 | GO:0006627 | protein processing involved in protein targeting to mitochondrion(GO:0006627) |
0.0 | 0.1 | GO:0002572 | pro-T cell differentiation(GO:0002572) |
0.0 | 0.4 | GO:0042982 | amyloid precursor protein metabolic process(GO:0042982) |
0.0 | 0.1 | GO:0035425 | autocrine signaling(GO:0035425) |
0.0 | 0.5 | GO:0097576 | vacuole fusion(GO:0097576) |
0.0 | 0.1 | GO:0002322 | B cell proliferation involved in immune response(GO:0002322) |
0.0 | 0.2 | GO:1904262 | negative regulation of TORC1 signaling(GO:1904262) |
0.0 | 0.2 | GO:0070269 | pyroptosis(GO:0070269) |
0.0 | 0.1 | GO:0010912 | regulation of isomerase activity(GO:0010911) positive regulation of isomerase activity(GO:0010912) |
0.0 | 0.1 | GO:0097112 | gamma-aminobutyric acid receptor clustering(GO:0097112) |
0.0 | 0.0 | GO:0002904 | positive regulation of B cell apoptotic process(GO:0002904) |
0.0 | 0.4 | GO:0051016 | barbed-end actin filament capping(GO:0051016) |
0.0 | 0.1 | GO:0021877 | forebrain neuron fate commitment(GO:0021877) |
0.0 | 0.3 | GO:1904814 | regulation of protein localization to chromosome, telomeric region(GO:1904814) positive regulation of protein localization to chromosome, telomeric region(GO:1904816) |
0.0 | 0.2 | GO:0016255 | attachment of GPI anchor to protein(GO:0016255) |
0.0 | 0.2 | GO:0070427 | nucleotide-binding oligomerization domain containing 1 signaling pathway(GO:0070427) |
0.0 | 0.7 | GO:0070979 | protein K11-linked ubiquitination(GO:0070979) |
0.0 | 0.2 | GO:0010764 | negative regulation of fibroblast migration(GO:0010764) |
0.0 | 0.3 | GO:0009404 | toxin metabolic process(GO:0009404) |
0.0 | 0.1 | GO:0007621 | negative regulation of female receptivity(GO:0007621) |
0.0 | 0.1 | GO:0060689 | cell differentiation involved in salivary gland development(GO:0060689) |
0.0 | 0.1 | GO:0006451 | selenocysteine incorporation(GO:0001514) translational readthrough(GO:0006451) |
0.0 | 0.1 | GO:0048162 | preantral ovarian follicle growth(GO:0001546) multi-layer follicle stage(GO:0048162) |
0.0 | 0.5 | GO:0030212 | hyaluronan metabolic process(GO:0030212) |
0.0 | 0.1 | GO:0061000 | negative regulation of dendritic spine development(GO:0061000) |
0.0 | 0.0 | GO:0033026 | negative regulation of mast cell apoptotic process(GO:0033026) |
0.0 | 0.2 | GO:0035584 | calcium-mediated signaling using intracellular calcium source(GO:0035584) |
0.0 | 0.1 | GO:0000350 | generation of catalytic spliceosome for second transesterification step(GO:0000350) |
0.0 | 0.1 | GO:1903238 | positive regulation of leukocyte tethering or rolling(GO:1903238) positive regulation of leukocyte adhesion to vascular endothelial cell(GO:1904996) |
0.0 | 0.1 | GO:0042726 | flavin-containing compound metabolic process(GO:0042726) |
0.0 | 0.1 | GO:0019673 | GDP-mannose metabolic process(GO:0019673) |
0.0 | 0.1 | GO:0007195 | adenylate cyclase-inhibiting dopamine receptor signaling pathway(GO:0007195) |
0.0 | 0.0 | GO:0046499 | S-adenosylmethioninamine metabolic process(GO:0046499) |
0.0 | 0.1 | GO:0050651 | dermatan sulfate proteoglycan biosynthetic process(GO:0050651) |
0.0 | 0.2 | GO:0045579 | positive regulation of B cell differentiation(GO:0045579) |
0.0 | 0.3 | GO:0042772 | DNA damage response, signal transduction resulting in transcription(GO:0042772) |
0.0 | 0.5 | GO:0042149 | cellular response to glucose starvation(GO:0042149) |
0.0 | 0.1 | GO:0006685 | sphingomyelin catabolic process(GO:0006685) |
0.0 | 0.1 | GO:0060768 | regulation of epithelial cell proliferation involved in prostate gland development(GO:0060768) negative regulation of epithelial cell proliferation involved in prostate gland development(GO:0060770) |
0.0 | 0.5 | GO:0045070 | positive regulation of viral genome replication(GO:0045070) |
0.0 | 0.3 | GO:0042415 | norepinephrine metabolic process(GO:0042415) |
0.0 | 0.1 | GO:0044321 | response to leptin(GO:0044321) |
0.0 | 0.1 | GO:0046487 | glyoxylate metabolic process(GO:0046487) |
0.0 | 0.1 | GO:0071596 | ubiquitin-dependent protein catabolic process via the N-end rule pathway(GO:0071596) |
0.0 | 0.1 | GO:0042711 | maternal behavior(GO:0042711) |
0.0 | 0.1 | GO:0050968 | detection of chemical stimulus involved in sensory perception of pain(GO:0050968) |
0.0 | 0.2 | GO:0046116 | queuosine biosynthetic process(GO:0008616) queuosine metabolic process(GO:0046116) |
0.0 | 0.0 | GO:0033087 | regulation of immature T cell proliferation(GO:0033083) negative regulation of immature T cell proliferation(GO:0033087) |
0.0 | 0.1 | GO:0006167 | AMP biosynthetic process(GO:0006167) |
0.0 | 0.1 | GO:0033058 | directional locomotion(GO:0033058) |
0.0 | 0.1 | GO:0010571 | positive regulation of nuclear cell cycle DNA replication(GO:0010571) |
0.0 | 0.5 | GO:0007214 | gamma-aminobutyric acid signaling pathway(GO:0007214) |
0.0 | 0.5 | GO:0002026 | regulation of the force of heart contraction(GO:0002026) |
0.0 | 0.1 | GO:1903300 | negative regulation of glucokinase activity(GO:0033132) negative regulation of hexokinase activity(GO:1903300) |
0.0 | 0.1 | GO:0046104 | thymidine metabolic process(GO:0046104) |
0.0 | 0.1 | GO:0015871 | choline transport(GO:0015871) |
0.0 | 0.1 | GO:0071447 | cellular response to hydroperoxide(GO:0071447) |
0.0 | 0.7 | GO:0001662 | behavioral fear response(GO:0001662) |
0.0 | 0.1 | GO:0051574 | positive regulation of histone H3-K9 methylation(GO:0051574) |
0.0 | 0.0 | GO:0071288 | cellular response to mercury ion(GO:0071288) |
0.0 | 0.1 | GO:0007208 | phospholipase C-activating serotonin receptor signaling pathway(GO:0007208) |
0.0 | 0.1 | GO:0009449 | gamma-aminobutyric acid biosynthetic process(GO:0009449) |
0.0 | 0.1 | GO:0014722 | regulation of skeletal muscle contraction by calcium ion signaling(GO:0014722) |
0.0 | 0.1 | GO:0007290 | spermatid nucleus elongation(GO:0007290) |
0.0 | 0.3 | GO:0046549 | retinal cone cell development(GO:0046549) |
0.0 | 0.6 | GO:0007029 | endoplasmic reticulum organization(GO:0007029) |
0.0 | 0.0 | GO:0061669 | spontaneous neurotransmitter secretion(GO:0061669) spontaneous synaptic transmission(GO:0098814) |
0.0 | 0.1 | GO:0033762 | response to glucagon(GO:0033762) |
0.0 | 0.2 | GO:0032292 | myelination in peripheral nervous system(GO:0022011) peripheral nervous system axon ensheathment(GO:0032292) |
0.0 | 0.1 | GO:0050705 | regulation of interleukin-1 alpha secretion(GO:0050705) |
0.0 | 0.1 | GO:0009642 | response to light intensity(GO:0009642) |
0.0 | 0.1 | GO:0045041 | protein import into mitochondrial intermembrane space(GO:0045041) |
0.0 | 0.0 | GO:0007354 | zygotic determination of anterior/posterior axis, embryo(GO:0007354) |
0.0 | 0.1 | GO:0038094 | Fc-gamma receptor signaling pathway(GO:0038094) |
0.0 | 0.0 | GO:0006382 | adenosine to inosine editing(GO:0006382) |
0.0 | 0.1 | GO:0016115 | diterpenoid catabolic process(GO:0016103) terpenoid catabolic process(GO:0016115) retinoic acid catabolic process(GO:0034653) |
0.0 | 0.3 | GO:0006734 | NADH metabolic process(GO:0006734) |
0.0 | 0.1 | GO:1903207 | neuron death in response to hydrogen peroxide(GO:0036476) regulation of hydrogen peroxide-induced neuron death(GO:1903207) negative regulation of hydrogen peroxide-induced neuron death(GO:1903208) |
0.0 | 0.2 | GO:0046130 | purine nucleoside catabolic process(GO:0006152) purine ribonucleoside catabolic process(GO:0046130) |
0.0 | 0.1 | GO:1903215 | negative regulation of protein targeting to mitochondrion(GO:1903215) |
0.0 | 0.1 | GO:0008594 | photoreceptor cell morphogenesis(GO:0008594) |
0.0 | 0.1 | GO:0010032 | meiotic chromosome condensation(GO:0010032) |
0.0 | 0.0 | GO:0051081 | membrane disassembly(GO:0030397) nuclear envelope disassembly(GO:0051081) |
0.0 | 0.0 | GO:0019249 | lactate biosynthetic process from pyruvate(GO:0019244) lactate biosynthetic process(GO:0019249) |
0.0 | 0.0 | GO:0061156 | pulmonary artery morphogenesis(GO:0061156) |
0.0 | 0.0 | GO:0034729 | histone H3-K79 methylation(GO:0034729) |
0.0 | 0.1 | GO:0032227 | negative regulation of synaptic transmission, dopaminergic(GO:0032227) |
0.0 | 0.1 | GO:0098535 | de novo centriole assembly(GO:0098535) |
0.0 | 0.2 | GO:0009083 | branched-chain amino acid catabolic process(GO:0009083) |
0.0 | 0.0 | GO:0015705 | iodide transport(GO:0015705) |
0.0 | 0.0 | GO:0051956 | negative regulation of amino acid transport(GO:0051956) |
0.0 | 0.1 | GO:2000391 | regulation of neutrophil extravasation(GO:2000389) positive regulation of neutrophil extravasation(GO:2000391) |
0.0 | 0.3 | GO:0030033 | microvillus assembly(GO:0030033) |
0.0 | 0.1 | GO:0002838 | negative regulation of response to tumor cell(GO:0002835) negative regulation of immune response to tumor cell(GO:0002838) |
0.0 | 0.0 | GO:0032687 | negative regulation of interferon-alpha production(GO:0032687) |
0.0 | 0.1 | GO:0046881 | positive regulation of follicle-stimulating hormone secretion(GO:0046881) |
0.0 | 0.1 | GO:2000104 | negative regulation of DNA-dependent DNA replication(GO:2000104) |
0.0 | 0.1 | GO:0015747 | urate transport(GO:0015747) |
0.0 | 0.0 | GO:0090309 | positive regulation of methylation-dependent chromatin silencing(GO:0090309) |
0.0 | 0.1 | GO:0070102 | interleukin-6-mediated signaling pathway(GO:0070102) |
0.0 | 0.1 | GO:0060478 | acrosomal vesicle exocytosis(GO:0060478) |
0.0 | 0.1 | GO:0006393 | termination of mitochondrial transcription(GO:0006393) |
0.0 | 0.0 | GO:0010982 | regulation of high-density lipoprotein particle clearance(GO:0010982) |
0.0 | 0.3 | GO:0097237 | cellular response to toxic substance(GO:0097237) |
0.0 | 0.2 | GO:1901673 | regulation of mitotic spindle assembly(GO:1901673) |
0.0 | 0.2 | GO:0042492 | gamma-delta T cell differentiation(GO:0042492) |
0.0 | 0.0 | GO:1902683 | regulation of protein localization to synapse(GO:1902473) regulation of receptor localization to synapse(GO:1902683) |
0.0 | 0.1 | GO:1904321 | response to forskolin(GO:1904321) cellular response to forskolin(GO:1904322) |
0.0 | 0.3 | GO:1902259 | regulation of delayed rectifier potassium channel activity(GO:1902259) |
0.0 | 0.0 | GO:0032740 | positive regulation of interleukin-17 production(GO:0032740) |
0.0 | 0.1 | GO:0016338 | calcium-independent cell-cell adhesion via plasma membrane cell-adhesion molecules(GO:0016338) |
0.0 | 0.2 | GO:0017121 | phospholipid scrambling(GO:0017121) |
0.0 | 0.0 | GO:0032482 | Rab protein signal transduction(GO:0032482) |
0.0 | 0.0 | GO:0090360 | platelet-derived growth factor production(GO:0090360) regulation of platelet-derived growth factor production(GO:0090361) |
0.0 | 0.3 | GO:0008347 | glial cell migration(GO:0008347) |
0.0 | 0.1 | GO:2001032 | regulation of double-strand break repair via nonhomologous end joining(GO:2001032) |
0.0 | 0.3 | GO:0016973 | poly(A)+ mRNA export from nucleus(GO:0016973) |
0.0 | 0.1 | GO:0097067 | cellular response to thyroid hormone stimulus(GO:0097067) |
0.0 | 0.0 | GO:0051140 | regulation of NK T cell proliferation(GO:0051140) positive regulation of NK T cell proliferation(GO:0051142) |
0.0 | 0.2 | GO:0060999 | positive regulation of dendritic spine development(GO:0060999) |
0.0 | 0.1 | GO:2000096 | positive regulation of Wnt signaling pathway, planar cell polarity pathway(GO:2000096) |
0.0 | 0.1 | GO:0034091 | regulation of maintenance of sister chromatid cohesion(GO:0034091) regulation of maintenance of mitotic sister chromatid cohesion(GO:0034182) |
0.0 | 0.1 | GO:0014043 | negative regulation of neuron maturation(GO:0014043) |
0.0 | 0.0 | GO:0060681 | branch elongation involved in ureteric bud branching(GO:0060681) |
0.0 | 0.0 | GO:0006449 | regulation of translational termination(GO:0006449) |
0.0 | 0.0 | GO:0060166 | olfactory pit development(GO:0060166) |
0.0 | 0.1 | GO:1903998 | regulation of eating behavior(GO:1903998) |
0.0 | 0.1 | GO:0071435 | potassium ion export(GO:0071435) |
0.0 | 0.1 | GO:0038180 | nerve growth factor signaling pathway(GO:0038180) |
0.0 | 0.2 | GO:0016242 | negative regulation of macroautophagy(GO:0016242) |
0.0 | 0.0 | GO:1903273 | regulation of sodium ion export(GO:1903273) regulation of sodium ion export from cell(GO:1903276) |
0.0 | 0.0 | GO:0002071 | glandular epithelial cell maturation(GO:0002071) |
0.0 | 0.1 | GO:2001214 | positive regulation of vasculogenesis(GO:2001214) |
0.0 | 0.0 | GO:0010881 | regulation of cardiac muscle contraction by regulation of the release of sequestered calcium ion(GO:0010881) |
0.0 | 0.4 | GO:0032008 | positive regulation of TOR signaling(GO:0032008) |
0.0 | 0.2 | GO:0051481 | negative regulation of cytosolic calcium ion concentration(GO:0051481) |
0.0 | 0.2 | GO:0000083 | regulation of transcription involved in G1/S transition of mitotic cell cycle(GO:0000083) |
0.0 | 0.1 | GO:0014049 | positive regulation of glutamate secretion(GO:0014049) |
0.0 | 0.1 | GO:0033211 | adiponectin-activated signaling pathway(GO:0033211) |
0.0 | 0.1 | GO:0044387 | negative regulation of protein kinase activity by regulation of protein phosphorylation(GO:0044387) |
0.0 | 0.1 | GO:0033216 | ferric iron import(GO:0033216) ferric iron import into cell(GO:0097461) |
0.0 | 0.1 | GO:0098789 | pre-mRNA cleavage required for polyadenylation(GO:0098789) |
0.0 | 0.1 | GO:0010663 | positive regulation of striated muscle cell apoptotic process(GO:0010663) positive regulation of cardiac muscle cell apoptotic process(GO:0010666) |
0.0 | 0.1 | GO:0000289 | nuclear-transcribed mRNA poly(A) tail shortening(GO:0000289) |
0.0 | 0.1 | GO:0044351 | macropinocytosis(GO:0044351) |
0.0 | 0.3 | GO:0070536 | protein K63-linked deubiquitination(GO:0070536) |
0.0 | 0.0 | GO:0071847 | TNFSF11-mediated signaling pathway(GO:0071847) |
0.0 | 0.2 | GO:0048245 | eosinophil chemotaxis(GO:0048245) |
0.0 | 0.1 | GO:0097264 | self proteolysis(GO:0097264) |
0.0 | 0.1 | GO:0006517 | protein deglycosylation(GO:0006517) |
0.0 | 0.2 | GO:0042359 | vitamin D metabolic process(GO:0042359) |
0.0 | 0.2 | GO:0014047 | glutamate secretion(GO:0014047) |
0.0 | 0.2 | GO:0034723 | DNA replication-dependent nucleosome assembly(GO:0006335) DNA replication-dependent nucleosome organization(GO:0034723) |
0.0 | 0.1 | GO:0032713 | negative regulation of interleukin-4 production(GO:0032713) |
0.0 | 0.0 | GO:0001922 | B-1 B cell homeostasis(GO:0001922) |
0.0 | 0.8 | GO:0061178 | regulation of insulin secretion involved in cellular response to glucose stimulus(GO:0061178) |
0.0 | 0.1 | GO:0031571 | mitotic G1 DNA damage checkpoint(GO:0031571) |
0.0 | 0.1 | GO:0006047 | UDP-N-acetylglucosamine metabolic process(GO:0006047) |
0.0 | 0.2 | GO:0032607 | interferon-alpha production(GO:0032607) |
0.0 | 0.0 | GO:2000172 | regulation of branching morphogenesis of a nerve(GO:2000172) |
0.0 | 0.0 | GO:0045908 | negative regulation of vasodilation(GO:0045908) |
0.0 | 1.2 | GO:0000086 | G2/M transition of mitotic cell cycle(GO:0000086) |
0.0 | 0.2 | GO:0010388 | protein deneddylation(GO:0000338) cullin deneddylation(GO:0010388) |
0.0 | 0.1 | GO:0090266 | regulation of mitotic cell cycle spindle assembly checkpoint(GO:0090266) regulation of mitotic spindle checkpoint(GO:1903504) |
0.0 | 0.2 | GO:0048742 | regulation of skeletal muscle fiber development(GO:0048742) |
0.0 | 0.1 | GO:1903961 | positive regulation of anion transmembrane transport(GO:1903961) |
0.0 | 0.1 | GO:0071051 | polyadenylation-dependent snoRNA 3'-end processing(GO:0071051) |
0.0 | 0.0 | GO:0031915 | positive regulation of synaptic plasticity(GO:0031915) |
0.0 | 0.1 | GO:0031442 | positive regulation of mRNA 3'-end processing(GO:0031442) |
0.0 | 0.1 | GO:0006646 | phosphatidylethanolamine biosynthetic process(GO:0006646) |
0.0 | 0.1 | GO:0031119 | tRNA pseudouridine synthesis(GO:0031119) |
0.0 | 0.0 | GO:0044336 | canonical Wnt signaling pathway involved in negative regulation of apoptotic process(GO:0044336) |
0.0 | 0.1 | GO:0003348 | cardiac endothelial cell differentiation(GO:0003348) |
0.0 | 0.0 | GO:1901419 | regulation of response to alcohol(GO:1901419) |
0.0 | 0.3 | GO:0097345 | mitochondrial outer membrane permeabilization(GO:0097345) |
0.0 | 0.1 | GO:0010216 | maintenance of DNA methylation(GO:0010216) |
0.0 | 0.1 | GO:0000059 | protein import into nucleus, docking(GO:0000059) |
0.0 | 0.1 | GO:0009629 | response to gravity(GO:0009629) |
0.0 | 0.0 | GO:0007228 | positive regulation of hh target transcription factor activity(GO:0007228) |
0.0 | 0.1 | GO:0072675 | osteoclast fusion(GO:0072675) |
0.0 | 0.0 | GO:0002767 | immune response-inhibiting cell surface receptor signaling pathway(GO:0002767) |
0.0 | 0.0 | GO:0006933 | negative regulation of cell adhesion involved in substrate-bound cell migration(GO:0006933) |
0.0 | 0.5 | GO:0009060 | aerobic respiration(GO:0009060) |
0.0 | 0.3 | GO:0010569 | regulation of double-strand break repair via homologous recombination(GO:0010569) |
0.0 | 0.1 | GO:0060628 | regulation of ER to Golgi vesicle-mediated transport(GO:0060628) |
0.0 | 0.1 | GO:0034501 | protein localization to kinetochore(GO:0034501) |
0.0 | 0.1 | GO:0010807 | regulation of synaptic vesicle priming(GO:0010807) |
0.0 | 0.1 | GO:0032959 | inositol trisphosphate biosynthetic process(GO:0032959) |
0.0 | 0.0 | GO:0071225 | cellular response to muramyl dipeptide(GO:0071225) |
0.0 | 0.0 | GO:0034372 | very-low-density lipoprotein particle remodeling(GO:0034372) |
0.0 | 0.1 | GO:2000773 | negative regulation of cellular senescence(GO:2000773) |
0.0 | 0.1 | GO:0043654 | recognition of apoptotic cell(GO:0043654) |
0.0 | 0.1 | GO:0060510 | Type II pneumocyte differentiation(GO:0060510) |
0.0 | 0.2 | GO:0001675 | acrosome assembly(GO:0001675) |
0.0 | 0.1 | GO:0035520 | monoubiquitinated protein deubiquitination(GO:0035520) |
0.0 | 0.1 | GO:0001672 | regulation of chromatin assembly or disassembly(GO:0001672) |
0.0 | 0.0 | GO:1902897 | regulation of postsynaptic density protein 95 clustering(GO:1902897) |
0.0 | 0.0 | GO:0032596 | protein transport into membrane raft(GO:0032596) |
0.0 | 0.0 | GO:0009186 | deoxyribonucleoside diphosphate metabolic process(GO:0009186) |
0.0 | 0.3 | GO:0006308 | DNA catabolic process(GO:0006308) |
0.0 | 0.1 | GO:0032485 | regulation of Ral protein signal transduction(GO:0032485) |
0.0 | 0.1 | GO:0006307 | DNA dealkylation involved in DNA repair(GO:0006307) |
0.0 | 0.0 | GO:0052041 | negative regulation by symbiont of host apoptotic process(GO:0033668) negative regulation by symbiont of host programmed cell death(GO:0052041) negative regulation by organism of programmed cell death in other organism involved in symbiotic interaction(GO:0052490) |
0.0 | 0.0 | GO:0051562 | negative regulation of mitochondrial calcium ion concentration(GO:0051562) |
0.0 | 0.1 | GO:0070863 | positive regulation of protein exit from endoplasmic reticulum(GO:0070863) |
0.0 | 0.1 | GO:0034434 | steroid esterification(GO:0034433) sterol esterification(GO:0034434) cholesterol esterification(GO:0034435) |
0.0 | 0.1 | GO:0002591 | positive regulation of antigen processing and presentation of peptide antigen via MHC class I(GO:0002591) |
0.0 | 0.0 | GO:0010841 | positive regulation of circadian sleep/wake cycle, wakefulness(GO:0010841) |
0.0 | 0.1 | GO:0072531 | pyrimidine-containing compound transmembrane transport(GO:0072531) |
0.0 | 0.0 | GO:0031118 | rRNA pseudouridine synthesis(GO:0031118) |
0.0 | 0.2 | GO:0051127 | positive regulation of actin nucleation(GO:0051127) |
0.0 | 0.1 | GO:0042559 | pteridine-containing compound biosynthetic process(GO:0042559) |
0.0 | 0.0 | GO:0051464 | cortisol secretion(GO:0043400) regulation of cortisol secretion(GO:0051462) positive regulation of cortisol secretion(GO:0051464) |
0.0 | 0.0 | GO:0010025 | wax biosynthetic process(GO:0010025) wax metabolic process(GO:0010166) |
0.0 | 0.1 | GO:0006516 | glycoprotein catabolic process(GO:0006516) |
0.0 | 0.0 | GO:0006515 | misfolded or incompletely synthesized protein catabolic process(GO:0006515) |
0.0 | 0.1 | GO:0001867 | complement activation, lectin pathway(GO:0001867) |
0.0 | 0.1 | GO:0034162 | toll-like receptor 9 signaling pathway(GO:0034162) |
0.0 | 0.1 | GO:0046475 | glycerophospholipid catabolic process(GO:0046475) |
0.0 | 0.0 | GO:0045829 | negative regulation of isotype switching(GO:0045829) |
0.0 | 0.0 | GO:0070445 | oligodendrocyte progenitor proliferation(GO:0070444) regulation of oligodendrocyte progenitor proliferation(GO:0070445) |
0.0 | 0.1 | GO:0045838 | positive regulation of membrane potential(GO:0045838) |
0.0 | 0.3 | GO:0007131 | reciprocal meiotic recombination(GO:0007131) reciprocal DNA recombination(GO:0035825) |
0.0 | 0.1 | GO:0006030 | chitin metabolic process(GO:0006030) chitin catabolic process(GO:0006032) |
0.0 | 0.3 | GO:0045773 | positive regulation of axon extension(GO:0045773) |
0.0 | 0.0 | GO:0035405 | histone-threonine phosphorylation(GO:0035405) |
0.0 | 0.0 | GO:0009698 | phenylpropanoid metabolic process(GO:0009698) |
0.0 | 0.0 | GO:0030070 | insulin processing(GO:0030070) |
0.0 | 0.0 | GO:0010989 | negative regulation of low-density lipoprotein particle clearance(GO:0010989) |
0.0 | 0.1 | GO:0010867 | positive regulation of triglyceride biosynthetic process(GO:0010867) |
0.0 | 0.0 | GO:0060453 | regulation of gastric acid secretion(GO:0060453) negative regulation of gastric acid secretion(GO:0060455) |
0.0 | 0.0 | GO:2000354 | regulation of ovarian follicle development(GO:2000354) |
0.0 | 0.0 | GO:0070375 | ERK5 cascade(GO:0070375) |
0.0 | 0.2 | GO:0016926 | protein desumoylation(GO:0016926) |
0.0 | 0.0 | GO:0002430 | complement receptor mediated signaling pathway(GO:0002430) |
0.0 | 0.0 | GO:1903431 | positive regulation of cell maturation(GO:1903431) |
0.0 | 0.0 | GO:0051791 | medium-chain fatty acid metabolic process(GO:0051791) |
0.0 | 0.1 | GO:0002091 | negative regulation of receptor internalization(GO:0002091) |
0.0 | 0.2 | GO:0052646 | alditol phosphate metabolic process(GO:0052646) |
0.0 | 0.0 | GO:0090611 | ubiquitin-independent protein catabolic process via the multivesicular body sorting pathway(GO:0090611) |
0.0 | 0.1 | GO:0009143 | nucleoside triphosphate catabolic process(GO:0009143) |
0.0 | 0.2 | GO:0021799 | cerebral cortex radially oriented cell migration(GO:0021799) |
0.0 | 0.0 | GO:0072677 | eosinophil migration(GO:0072677) |
0.0 | 0.0 | GO:0071033 | nuclear retention of pre-mRNA at the site of transcription(GO:0071033) |
0.0 | 0.0 | GO:0007196 | adenylate cyclase-inhibiting G-protein coupled glutamate receptor signaling pathway(GO:0007196) |
0.0 | 0.0 | GO:0046349 | amino sugar biosynthetic process(GO:0046349) |
0.0 | 0.0 | GO:0021960 | anterior commissure morphogenesis(GO:0021960) |
0.0 | 0.3 | GO:0006695 | cholesterol biosynthetic process(GO:0006695) secondary alcohol biosynthetic process(GO:1902653) |
0.0 | 0.0 | GO:0060454 | positive regulation of gastric acid secretion(GO:0060454) |
0.0 | 0.1 | GO:0031507 | heterochromatin assembly(GO:0031507) |
0.0 | 0.0 | GO:0045054 | constitutive secretory pathway(GO:0045054) |
0.0 | 0.0 | GO:0042138 | meiotic DNA double-strand break formation(GO:0042138) |
0.0 | 0.1 | GO:0007076 | mitotic chromosome condensation(GO:0007076) |
0.0 | 0.1 | GO:0016078 | tRNA catabolic process(GO:0016078) |
0.0 | 0.1 | GO:0015671 | oxygen transport(GO:0015671) |
0.0 | 0.0 | GO:0014744 | positive regulation of muscle adaptation(GO:0014744) |
0.0 | 0.1 | GO:0035773 | insulin secretion involved in cellular response to glucose stimulus(GO:0035773) |
0.0 | 0.2 | GO:0031365 | N-terminal protein amino acid modification(GO:0031365) |
0.0 | 0.2 | GO:0045880 | positive regulation of smoothened signaling pathway(GO:0045880) |
0.0 | 0.0 | GO:0006407 | rRNA export from nucleus(GO:0006407) |
0.0 | 0.1 | GO:0042094 | interleukin-2 biosynthetic process(GO:0042094) |
0.0 | 0.0 | GO:1903599 | positive regulation of mitophagy(GO:1903599) |
0.0 | 0.1 | GO:0090084 | negative regulation of inclusion body assembly(GO:0090084) |
0.0 | 0.1 | GO:0034244 | negative regulation of transcription elongation from RNA polymerase II promoter(GO:0034244) |
0.0 | 0.0 | GO:0097503 | sialylation(GO:0097503) |
0.0 | 0.0 | GO:0051582 | positive regulation of neurotransmitter uptake(GO:0051582) positive regulation of dopamine uptake involved in synaptic transmission(GO:0051586) positive regulation of catecholamine uptake involved in synaptic transmission(GO:0051944) |
0.0 | 0.0 | GO:0060060 | post-embryonic retina morphogenesis in camera-type eye(GO:0060060) |
0.0 | 0.1 | GO:0048496 | maintenance of organ identity(GO:0048496) |
0.0 | 0.1 | GO:0006995 | cellular response to nitrogen starvation(GO:0006995) cellular response to nitrogen levels(GO:0043562) |
0.0 | 0.1 | GO:0006614 | SRP-dependent cotranslational protein targeting to membrane(GO:0006614) |
0.0 | 0.1 | GO:0000244 | spliceosomal tri-snRNP complex assembly(GO:0000244) |
0.0 | 0.0 | GO:1901228 | phenotypic switching(GO:0036166) positive regulation of transcription from RNA polymerase II promoter involved in heart development(GO:1901228) |
0.0 | 0.0 | GO:0032071 | regulation of deoxyribonuclease activity(GO:0032070) regulation of endodeoxyribonuclease activity(GO:0032071) |
0.0 | 0.1 | GO:0032695 | negative regulation of interleukin-12 production(GO:0032695) |
0.0 | 0.1 | GO:0045324 | late endosome to vacuole transport(GO:0045324) |
0.0 | 0.1 | GO:0042745 | circadian sleep/wake cycle(GO:0042745) |
0.0 | 0.0 | GO:1900227 | positive regulation of NLRP3 inflammasome complex assembly(GO:1900227) |
0.0 | 0.0 | GO:0071910 | determination of liver left/right asymmetry(GO:0071910) |
0.0 | 0.1 | GO:0051451 | myoblast migration(GO:0051451) |
0.0 | 0.1 | GO:0051131 | chaperone-mediated protein complex assembly(GO:0051131) |
0.0 | 0.0 | GO:0070278 | extracellular matrix constituent secretion(GO:0070278) |
0.0 | 0.1 | GO:0030431 | sleep(GO:0030431) |
0.0 | 0.0 | GO:0007288 | sperm axoneme assembly(GO:0007288) |
0.0 | 0.0 | GO:0031339 | negative regulation of vesicle fusion(GO:0031339) |
0.0 | 0.2 | GO:1901799 | negative regulation of proteasomal protein catabolic process(GO:1901799) |
0.0 | 0.1 | GO:0050917 | sensory perception of umami taste(GO:0050917) |
0.0 | 0.1 | GO:0035337 | fatty-acyl-CoA metabolic process(GO:0035337) |
0.0 | 0.0 | GO:0019853 | L-ascorbic acid biosynthetic process(GO:0019853) |
0.0 | 0.1 | GO:0080182 | histone H3-K4 trimethylation(GO:0080182) |
0.0 | 0.0 | GO:0002220 | innate immune response activating cell surface receptor signaling pathway(GO:0002220) |
0.0 | 0.4 | GO:0051225 | spindle assembly(GO:0051225) |
0.0 | 0.1 | GO:0050966 | detection of mechanical stimulus involved in sensory perception of pain(GO:0050966) |
0.0 | 0.0 | GO:0090231 | spindle checkpoint(GO:0031577) regulation of spindle checkpoint(GO:0090231) |
0.0 | 0.0 | GO:0043116 | negative regulation of vascular permeability(GO:0043116) |
0.0 | 0.0 | GO:0070561 | vitamin D receptor signaling pathway(GO:0070561) |
0.0 | 0.0 | GO:2000195 | negative regulation of female gonad development(GO:2000195) |
0.0 | 0.0 | GO:0030311 | poly-N-acetyllactosamine metabolic process(GO:0030309) poly-N-acetyllactosamine biosynthetic process(GO:0030311) |
0.0 | 0.1 | GO:0051205 | protein insertion into membrane(GO:0051205) |
0.0 | 0.0 | GO:0001951 | intestinal D-glucose absorption(GO:0001951) |
0.0 | 0.0 | GO:0035434 | copper ion transmembrane transport(GO:0035434) |
0.0 | 0.0 | GO:0034982 | mitochondrial protein processing(GO:0034982) |
0.0 | 0.0 | GO:0071712 | ER-associated misfolded protein catabolic process(GO:0071712) |
0.0 | 0.2 | GO:0045839 | negative regulation of mitotic nuclear division(GO:0045839) |
0.0 | 0.2 | GO:0043268 | positive regulation of potassium ion transport(GO:0043268) |
0.0 | 0.4 | GO:0036503 | ERAD pathway(GO:0036503) |
0.0 | 0.0 | GO:0030263 | apoptotic chromosome condensation(GO:0030263) |
0.0 | 0.0 | GO:0014734 | skeletal muscle hypertrophy(GO:0014734) |
0.0 | 0.0 | GO:0060746 | parental behavior(GO:0060746) |
0.0 | 0.0 | GO:0010757 | negative regulation of plasminogen activation(GO:0010757) |
0.0 | 0.1 | GO:0044406 | adhesion of symbiont to host(GO:0044406) |
0.0 | 0.0 | GO:0035630 | bone mineralization involved in bone maturation(GO:0035630) |
0.0 | 0.0 | GO:0046599 | regulation of centriole replication(GO:0046599) |
0.0 | 0.2 | GO:0032784 | regulation of DNA-templated transcription, elongation(GO:0032784) |
0.0 | 0.1 | GO:0014067 | negative regulation of phosphatidylinositol 3-kinase signaling(GO:0014067) |
0.0 | 0.1 | GO:0090005 | negative regulation of establishment of protein localization to plasma membrane(GO:0090005) |
0.0 | 0.0 | GO:0061343 | cell adhesion involved in heart morphogenesis(GO:0061343) |
0.0 | 0.1 | GO:0006271 | DNA strand elongation involved in DNA replication(GO:0006271) |
0.0 | 0.0 | GO:0031086 | nuclear-transcribed mRNA catabolic process, deadenylation-independent decay(GO:0031086) deadenylation-independent decapping of nuclear-transcribed mRNA(GO:0031087) |
0.0 | 0.0 | GO:1904694 | negative regulation of vascular smooth muscle contraction(GO:1904694) |
0.0 | 0.0 | GO:0034196 | acylglycerol transport(GO:0034196) triglyceride transport(GO:0034197) |
0.0 | 0.0 | GO:0018171 | peptidyl-cysteine oxidation(GO:0018171) |
0.0 | 0.0 | GO:0021553 | olfactory nerve development(GO:0021553) |
0.0 | 0.0 | GO:0090032 | negative regulation of steroid hormone biosynthetic process(GO:0090032) |
0.0 | 0.0 | GO:1902071 | regulation of hypoxia-inducible factor-1alpha signaling pathway(GO:1902071) |
0.0 | 0.0 | GO:0045779 | negative regulation of bone resorption(GO:0045779) |
0.0 | 0.0 | GO:0071625 | vocalization behavior(GO:0071625) |
0.0 | 0.1 | GO:2000311 | regulation of alpha-amino-3-hydroxy-5-methyl-4-isoxazole propionate selective glutamate receptor activity(GO:2000311) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.7 | 2.2 | GO:0017133 | mitochondrial electron transfer flavoprotein complex(GO:0017133) electron transfer flavoprotein complex(GO:0045251) |
0.6 | 1.7 | GO:0014701 | junctional sarcoplasmic reticulum membrane(GO:0014701) |
0.3 | 1.0 | GO:0005971 | ribonucleoside-diphosphate reductase complex(GO:0005971) |
0.3 | 0.9 | GO:0032010 | phagolysosome(GO:0032010) |
0.3 | 1.7 | GO:1990454 | L-type voltage-gated calcium channel complex(GO:1990454) |
0.3 | 1.6 | GO:0035032 | phosphatidylinositol 3-kinase complex, class III(GO:0035032) |
0.3 | 0.8 | GO:0048179 | activin receptor complex(GO:0048179) |
0.2 | 0.2 | GO:0071664 | catenin-TCF7L2 complex(GO:0071664) |
0.2 | 1.8 | GO:0045254 | pyruvate dehydrogenase complex(GO:0045254) |
0.2 | 0.6 | GO:0044299 | C-fiber(GO:0044299) |
0.2 | 1.0 | GO:0045098 | type III intermediate filament(GO:0045098) |
0.2 | 1.1 | GO:0016012 | sarcoglycan complex(GO:0016012) |
0.2 | 2.7 | GO:0043196 | varicosity(GO:0043196) |
0.2 | 0.5 | GO:0030981 | cortical microtubule cytoskeleton(GO:0030981) |
0.2 | 0.7 | GO:0070545 | PeBoW complex(GO:0070545) |
0.2 | 0.7 | GO:0034363 | intermediate-density lipoprotein particle(GO:0034363) |
0.2 | 0.3 | GO:0065010 | extracellular membrane-bounded organelle(GO:0065010) |
0.2 | 0.5 | GO:0000015 | phosphopyruvate hydratase complex(GO:0000015) |
0.2 | 0.5 | GO:0097413 | Lewy body(GO:0097413) |
0.2 | 1.2 | GO:0070578 | RISC-loading complex(GO:0070578) |
0.1 | 0.6 | GO:0016602 | CCAAT-binding factor complex(GO:0016602) |
0.1 | 0.6 | GO:0033010 | paranodal junction(GO:0033010) |
0.1 | 1.1 | GO:0043203 | axon hillock(GO:0043203) |
0.1 | 1.4 | GO:0044224 | juxtaparanode region of axon(GO:0044224) |
0.1 | 0.5 | GO:0031265 | CD95 death-inducing signaling complex(GO:0031265) |
0.1 | 1.5 | GO:0000940 | condensed chromosome outer kinetochore(GO:0000940) |
0.1 | 0.9 | GO:0008290 | F-actin capping protein complex(GO:0008290) |
0.1 | 0.5 | GO:0033269 | internode region of axon(GO:0033269) |
0.1 | 0.5 | GO:0000835 | ER ubiquitin ligase complex(GO:0000835) Hrd1p ubiquitin ligase complex(GO:0000836) |
0.1 | 0.4 | GO:0005945 | 6-phosphofructokinase complex(GO:0005945) |
0.1 | 1.1 | GO:1990023 | mitotic spindle midzone(GO:1990023) |
0.1 | 0.2 | GO:0035867 | alphav-beta3 integrin-IGF-1-IGF1R complex(GO:0035867) |
0.1 | 0.3 | GO:0032299 | ribonuclease H2 complex(GO:0032299) |
0.1 | 0.5 | GO:0033063 | Rad51B-Rad51C-Rad51D-XRCC2 complex(GO:0033063) |
0.1 | 0.3 | GO:0031262 | Ndc80 complex(GO:0031262) |
0.1 | 0.7 | GO:0070419 | nonhomologous end joining complex(GO:0070419) |
0.1 | 0.5 | GO:0097433 | dense body(GO:0097433) |
0.1 | 0.6 | GO:0014731 | spectrin-associated cytoskeleton(GO:0014731) |
0.1 | 0.5 | GO:0033588 | Elongator holoenzyme complex(GO:0033588) |
0.1 | 0.4 | GO:0005947 | mitochondrial alpha-ketoglutarate dehydrogenase complex(GO:0005947) |
0.1 | 0.4 | GO:0097524 | sperm plasma membrane(GO:0097524) |
0.1 | 0.2 | GO:0060053 | neurofilament cytoskeleton(GO:0060053) |
0.1 | 0.8 | GO:0031010 | ISWI-type complex(GO:0031010) |
0.1 | 0.7 | GO:0005883 | neurofilament(GO:0005883) |
0.1 | 0.5 | GO:0030915 | Smc5-Smc6 complex(GO:0030915) |
0.1 | 0.5 | GO:0043194 | axon initial segment(GO:0043194) |
0.1 | 0.2 | GO:0055087 | Ski complex(GO:0055087) |
0.1 | 0.2 | GO:0035748 | myelin sheath abaxonal region(GO:0035748) |
0.1 | 0.6 | GO:0034362 | low-density lipoprotein particle(GO:0034362) |
0.1 | 0.6 | GO:0043083 | synaptic cleft(GO:0043083) |
0.1 | 0.3 | GO:0034448 | EGO complex(GO:0034448) Gtr1-Gtr2 GTPase complex(GO:1990131) |
0.1 | 0.8 | GO:0031045 | dense core granule(GO:0031045) |
0.1 | 0.8 | GO:0030430 | host cell cytoplasm(GO:0030430) host cell cytoplasm part(GO:0033655) |
0.1 | 0.6 | GO:0016342 | catenin complex(GO:0016342) |
0.1 | 3.2 | GO:0031903 | peroxisomal membrane(GO:0005778) microbody membrane(GO:0031903) |
0.1 | 0.3 | GO:0045252 | oxoglutarate dehydrogenase complex(GO:0045252) |
0.1 | 0.5 | GO:0030991 | intraciliary transport particle A(GO:0030991) |
0.1 | 1.4 | GO:0097228 | sperm principal piece(GO:0097228) |
0.1 | 0.3 | GO:0008541 | proteasome regulatory particle, lid subcomplex(GO:0008541) |
0.1 | 0.3 | GO:0031258 | lamellipodium membrane(GO:0031258) |
0.1 | 0.2 | GO:0043511 | inhibin complex(GO:0043511) |
0.1 | 0.2 | GO:0005593 | FACIT collagen trimer(GO:0005593) |
0.1 | 0.7 | GO:0043240 | Fanconi anaemia nuclear complex(GO:0043240) |
0.1 | 0.1 | GO:0097629 | extrinsic component of omegasome membrane(GO:0097629) |
0.1 | 0.5 | GO:0061700 | GATOR2 complex(GO:0061700) |
0.1 | 0.2 | GO:0000138 | Golgi trans cisterna(GO:0000138) |
0.1 | 0.2 | GO:0034366 | spherical high-density lipoprotein particle(GO:0034366) |
0.1 | 1.4 | GO:0034451 | centriolar satellite(GO:0034451) |
0.1 | 0.2 | GO:0097543 | ciliary inversin compartment(GO:0097543) |
0.1 | 0.4 | GO:0005677 | chromatin silencing complex(GO:0005677) |
0.1 | 0.2 | GO:1990761 | growth cone lamellipodium(GO:1990761) |
0.1 | 0.1 | GO:0034679 | integrin alpha9-beta1 complex(GO:0034679) |
0.1 | 0.2 | GO:0036396 | MIS complex(GO:0036396) |
0.1 | 0.1 | GO:0033186 | CAF-1 complex(GO:0033186) |
0.1 | 0.2 | GO:0005896 | interleukin-6 receptor complex(GO:0005896) |
0.1 | 0.3 | GO:0071598 | neuronal ribonucleoprotein granule(GO:0071598) |
0.1 | 0.6 | GO:0098799 | outer mitochondrial membrane protein complex(GO:0098799) |
0.1 | 0.3 | GO:0000805 | X chromosome(GO:0000805) |
0.1 | 0.5 | GO:0000137 | Golgi cis cisterna(GO:0000137) |
0.1 | 0.5 | GO:0031932 | TORC2 complex(GO:0031932) |
0.1 | 0.2 | GO:0005899 | insulin receptor complex(GO:0005899) |
0.0 | 0.3 | GO:0031415 | NatA complex(GO:0031415) |
0.0 | 1.4 | GO:0005790 | smooth endoplasmic reticulum(GO:0005790) |
0.0 | 0.8 | GO:0005685 | U1 snRNP(GO:0005685) |
0.0 | 0.1 | GO:0097441 | basilar dendrite(GO:0097441) |
0.0 | 0.1 | GO:0030689 | Noc complex(GO:0030689) |
0.0 | 0.2 | GO:0042406 | extrinsic component of endoplasmic reticulum membrane(GO:0042406) |
0.0 | 0.7 | GO:0070971 | endoplasmic reticulum exit site(GO:0070971) |
0.0 | 0.8 | GO:0010369 | chromocenter(GO:0010369) |
0.0 | 0.7 | GO:0005838 | proteasome regulatory particle(GO:0005838) |
0.0 | 0.1 | GO:0000110 | nucleotide-excision repair factor 1 complex(GO:0000110) |
0.0 | 0.1 | GO:0033596 | TSC1-TSC2 complex(GO:0033596) |
0.0 | 0.4 | GO:0070652 | HAUS complex(GO:0070652) |
0.0 | 0.1 | GO:0090661 | box H/ACA telomerase RNP complex(GO:0090661) |
0.0 | 1.3 | GO:0032281 | AMPA glutamate receptor complex(GO:0032281) |
0.0 | 0.6 | GO:0000176 | nuclear exosome (RNase complex)(GO:0000176) |
0.0 | 0.2 | GO:0097169 | AIM2 inflammasome complex(GO:0097169) |
0.0 | 0.3 | GO:0072687 | meiotic spindle(GO:0072687) |
0.0 | 0.4 | GO:0002116 | semaphorin receptor complex(GO:0002116) |
0.0 | 0.1 | GO:0072357 | PTW/PP1 phosphatase complex(GO:0072357) |
0.0 | 0.9 | GO:0005680 | anaphase-promoting complex(GO:0005680) |
0.0 | 0.3 | GO:0001939 | female pronucleus(GO:0001939) |
0.0 | 0.1 | GO:0005658 | alpha DNA polymerase:primase complex(GO:0005658) |
0.0 | 0.3 | GO:0033263 | CORVET complex(GO:0033263) |
0.0 | 0.1 | GO:0071203 | WASH complex(GO:0071203) |
0.0 | 0.6 | GO:0001891 | phagocytic cup(GO:0001891) |
0.0 | 0.5 | GO:0032426 | stereocilium tip(GO:0032426) |
0.0 | 0.5 | GO:0017119 | Golgi transport complex(GO:0017119) |
0.0 | 0.1 | GO:0097512 | cardiac myofibril(GO:0097512) |
0.0 | 0.3 | GO:0070688 | MLL5-L complex(GO:0070688) |
0.0 | 0.1 | GO:1990716 | axonemal central apparatus(GO:1990716) |
0.0 | 0.1 | GO:0097149 | centralspindlin complex(GO:0097149) |
0.0 | 0.6 | GO:0005697 | telomerase holoenzyme complex(GO:0005697) |
0.0 | 0.2 | GO:0005672 | transcription factor TFIIA complex(GO:0005672) |
0.0 | 0.1 | GO:0071001 | U4/U6 snRNP(GO:0071001) |
0.0 | 0.2 | GO:0033178 | proton-transporting two-sector ATPase complex, catalytic domain(GO:0033178) |
0.0 | 0.2 | GO:0070044 | synaptobrevin 2-SNAP-25-syntaxin-1a complex(GO:0070044) |
0.0 | 0.3 | GO:0045275 | mitochondrial respiratory chain complex III(GO:0005750) respiratory chain complex III(GO:0045275) |
0.0 | 0.3 | GO:0030285 | integral component of synaptic vesicle membrane(GO:0030285) intrinsic component of synaptic vesicle membrane(GO:0098563) |
0.0 | 0.3 | GO:0031390 | Ctf18 RFC-like complex(GO:0031390) |
0.0 | 0.1 | GO:0030127 | COPII vesicle coat(GO:0030127) |
0.0 | 0.1 | GO:1990246 | uniplex complex(GO:1990246) |
0.0 | 0.3 | GO:0033180 | proton-transporting V-type ATPase, V1 domain(GO:0033180) |
0.0 | 0.6 | GO:1902710 | GABA receptor complex(GO:1902710) GABA-A receptor complex(GO:1902711) |
0.0 | 0.3 | GO:0036156 | inner dynein arm(GO:0036156) |
0.0 | 1.2 | GO:0043198 | dendritic shaft(GO:0043198) |
0.0 | 0.2 | GO:0033093 | Weibel-Palade body(GO:0033093) |
0.0 | 0.1 | GO:1990316 | ATG1/ULK1 kinase complex(GO:1990316) |
0.0 | 0.2 | GO:0070531 | BRCA1-A complex(GO:0070531) |
0.0 | 0.1 | GO:0036449 | microtubule minus-end(GO:0036449) |
0.0 | 0.2 | GO:0090571 | RNA polymerase II transcription repressor complex(GO:0090571) |
0.0 | 0.1 | GO:0071817 | MMXD complex(GO:0071817) |
0.0 | 0.9 | GO:0008180 | COP9 signalosome(GO:0008180) |
0.0 | 0.8 | GO:0097610 | cleavage furrow(GO:0032154) cell surface furrow(GO:0097610) |
0.0 | 0.1 | GO:0097451 | glial limiting end-foot(GO:0097451) |
0.0 | 0.2 | GO:0042765 | GPI-anchor transamidase complex(GO:0042765) |
0.0 | 0.2 | GO:0008250 | oligosaccharyltransferase complex(GO:0008250) |
0.0 | 0.4 | GO:0097038 | perinuclear endoplasmic reticulum(GO:0097038) |
0.0 | 0.1 | GO:0034663 | endoplasmic reticulum chaperone complex(GO:0034663) |
0.0 | 0.1 | GO:0032777 | Piccolo NuA4 histone acetyltransferase complex(GO:0032777) |
0.0 | 0.2 | GO:0097539 | ciliary transition fiber(GO:0097539) |
0.0 | 1.8 | GO:1990204 | oxidoreductase complex(GO:1990204) |
0.0 | 0.2 | GO:0000796 | condensin complex(GO:0000796) |
0.0 | 0.1 | GO:0072487 | MSL complex(GO:0072487) |
0.0 | 0.1 | GO:0031466 | Cul5-RING ubiquitin ligase complex(GO:0031466) |
0.0 | 0.1 | GO:0035859 | Seh1-associated complex(GO:0035859) |
0.0 | 0.4 | GO:0000421 | autophagosome membrane(GO:0000421) |
0.0 | 0.1 | GO:0044322 | endoplasmic reticulum quality control compartment(GO:0044322) |
0.0 | 0.3 | GO:0032045 | guanyl-nucleotide exchange factor complex(GO:0032045) |
0.0 | 1.0 | GO:0005788 | endoplasmic reticulum lumen(GO:0005788) |
0.0 | 0.1 | GO:1990597 | AIP1-IRE1 complex(GO:1990597) |
0.0 | 0.1 | GO:0031332 | RISC complex(GO:0016442) RNAi effector complex(GO:0031332) |
0.0 | 0.1 | GO:0044232 | organelle membrane contact site(GO:0044232) |
0.0 | 0.0 | GO:0000235 | astral microtubule(GO:0000235) |
0.0 | 0.1 | GO:0008622 | epsilon DNA polymerase complex(GO:0008622) |
0.0 | 0.2 | GO:0036513 | Derlin-1 retrotranslocation complex(GO:0036513) |
0.0 | 0.1 | GO:0000322 | storage vacuole(GO:0000322) |
0.0 | 0.9 | GO:0016592 | mediator complex(GO:0016592) |
0.0 | 0.4 | GO:0001673 | male germ cell nucleus(GO:0001673) |
0.0 | 0.3 | GO:1990752 | microtubule end(GO:1990752) |
0.0 | 0.1 | GO:0031428 | box C/D snoRNP complex(GO:0031428) |
0.0 | 0.1 | GO:0001652 | granular component(GO:0001652) |
0.0 | 0.2 | GO:0005833 | hemoglobin complex(GO:0005833) |
0.0 | 0.1 | GO:0000800 | lateral element(GO:0000800) |
0.0 | 0.1 | GO:0008282 | ATP-sensitive potassium channel complex(GO:0008282) |
0.0 | 1.0 | GO:0005871 | kinesin complex(GO:0005871) |
0.0 | 0.4 | GO:0031305 | integral component of mitochondrial inner membrane(GO:0031305) |
0.0 | 0.2 | GO:0005652 | nuclear lamina(GO:0005652) |
0.0 | 1.8 | GO:0000776 | kinetochore(GO:0000776) |
0.0 | 1.1 | GO:0005758 | mitochondrial intermembrane space(GO:0005758) |
0.0 | 0.2 | GO:0097225 | sperm midpiece(GO:0097225) |
0.0 | 0.1 | GO:1990111 | spermatoproteasome complex(GO:1990111) |
0.0 | 0.6 | GO:0010494 | cytoplasmic stress granule(GO:0010494) |
0.0 | 0.2 | GO:0071541 | eukaryotic translation initiation factor 3 complex, eIF3m(GO:0071541) |
0.0 | 0.0 | GO:0044316 | cone cell pedicle(GO:0044316) |
0.0 | 0.2 | GO:0042589 | zymogen granule membrane(GO:0042589) |
0.0 | 0.0 | GO:0072558 | NLRP1 inflammasome complex(GO:0072558) |
0.0 | 0.1 | GO:0070776 | H3 histone acetyltransferase complex(GO:0070775) MOZ/MORF histone acetyltransferase complex(GO:0070776) |
0.0 | 0.2 | GO:0005832 | chaperonin-containing T-complex(GO:0005832) |
0.0 | 0.2 | GO:0097542 | ciliary tip(GO:0097542) |
0.0 | 0.2 | GO:0042581 | specific granule(GO:0042581) |
0.0 | 0.0 | GO:1990923 | PET complex(GO:1990923) |
0.0 | 0.1 | GO:0016272 | prefoldin complex(GO:0016272) |
0.0 | 0.7 | GO:0008023 | transcription elongation factor complex(GO:0008023) |
0.0 | 0.0 | GO:0070033 | synaptobrevin 2-SNAP-25-syntaxin-1a-complexin II complex(GO:0070033) |
0.0 | 0.1 | GO:0030123 | AP-3 adaptor complex(GO:0030123) |
0.0 | 0.1 | GO:0045239 | tricarboxylic acid cycle enzyme complex(GO:0045239) |
0.0 | 0.1 | GO:0035686 | sperm fibrous sheath(GO:0035686) |
0.0 | 0.2 | GO:0048786 | presynaptic active zone(GO:0048786) |
0.0 | 0.3 | GO:0042101 | T cell receptor complex(GO:0042101) |
0.0 | 0.1 | GO:0032983 | kainate selective glutamate receptor complex(GO:0032983) |
0.0 | 0.1 | GO:0044530 | supraspliceosomal complex(GO:0044530) |
0.0 | 0.2 | GO:0030126 | COPI vesicle coat(GO:0030126) |
0.0 | 0.3 | GO:0032592 | integral component of mitochondrial membrane(GO:0032592) |
0.0 | 0.1 | GO:0005655 | nucleolar ribonuclease P complex(GO:0005655) ribonuclease P complex(GO:0030677) multimeric ribonuclease P complex(GO:0030681) |
0.0 | 0.0 | GO:1990907 | beta-catenin-TCF complex(GO:1990907) |
0.0 | 0.0 | GO:0045009 | melanosome membrane(GO:0033162) chitosome(GO:0045009) |
0.0 | 0.4 | GO:0001917 | photoreceptor inner segment(GO:0001917) |
0.0 | 0.0 | GO:0044308 | axonal spine(GO:0044308) |
0.0 | 0.1 | GO:0098536 | deuterosome(GO:0098536) |
0.0 | 0.4 | GO:0015030 | Cajal body(GO:0015030) |
0.0 | 0.3 | GO:0030687 | preribosome, large subunit precursor(GO:0030687) |
0.0 | 0.0 | GO:0043219 | lateral loop(GO:0043219) |
0.0 | 0.0 | GO:0071942 | XPC complex(GO:0071942) |
0.0 | 0.1 | GO:0046581 | intercellular canaliculus(GO:0046581) |
0.0 | 0.4 | GO:0005776 | autophagosome(GO:0005776) |
0.0 | 0.2 | GO:0031083 | BLOC-1 complex(GO:0031083) |
0.0 | 0.6 | GO:0042734 | presynaptic membrane(GO:0042734) |
0.0 | 0.1 | GO:0005577 | fibrinogen complex(GO:0005577) |
0.0 | 0.1 | GO:0030122 | AP-2 adaptor complex(GO:0030122) |
0.0 | 0.1 | GO:0030008 | TRAPP complex(GO:0030008) |
0.0 | 1.3 | GO:0035068 | micro-ribonucleoprotein complex(GO:0035068) |
0.0 | 0.0 | GO:0035838 | growing cell tip(GO:0035838) |
0.0 | 0.1 | GO:0071547 | piP-body(GO:0071547) |
0.0 | 0.7 | GO:0000922 | spindle pole(GO:0000922) |
0.0 | 0.2 | GO:0005689 | U12-type spliceosomal complex(GO:0005689) |
0.0 | 0.0 | GO:0031597 | cytosolic proteasome complex(GO:0031597) |
0.0 | 0.0 | GO:0002199 | zona pellucida receptor complex(GO:0002199) |
0.0 | 0.0 | GO:1990604 | IRE1-TRAF2-ASK1 complex(GO:1990604) |
0.0 | 0.7 | GO:0030863 | cortical cytoskeleton(GO:0030863) |
0.0 | 0.0 | GO:0005927 | muscle tendon junction(GO:0005927) |
0.0 | 0.2 | GO:0032809 | neuronal cell body membrane(GO:0032809) |
0.0 | 0.3 | GO:0055038 | recycling endosome membrane(GO:0055038) |
0.0 | 0.1 | GO:0005736 | DNA-directed RNA polymerase I complex(GO:0005736) |
0.0 | 0.9 | GO:0072562 | blood microparticle(GO:0072562) |
0.0 | 0.0 | GO:0043657 | host(GO:0018995) host cell part(GO:0033643) host cell(GO:0043657) |
0.0 | 0.1 | GO:0045334 | clathrin-coated endocytic vesicle(GO:0045334) |
0.0 | 0.0 | GO:0071256 | Sec61 translocon complex(GO:0005784) translocon complex(GO:0071256) |
0.0 | 0.0 | GO:0035061 | interchromatin granule(GO:0035061) |
0.0 | 0.1 | GO:0019773 | proteasome core complex, alpha-subunit complex(GO:0019773) |
0.0 | 0.4 | GO:0045095 | keratin filament(GO:0045095) |
0.0 | 0.1 | GO:0000127 | transcription factor TFIIIC complex(GO:0000127) |
0.0 | 0.1 | GO:0045180 | basal cortex(GO:0045180) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
1.1 | 3.3 | GO:0005519 | cytoskeletal regulatory protein binding(GO:0005519) |
0.6 | 1.8 | GO:0004739 | pyruvate dehydrogenase (acetyl-transferring) activity(GO:0004739) |
0.5 | 1.6 | GO:0050833 | pyruvate transmembrane transporter activity(GO:0050833) |
0.5 | 1.4 | GO:0008597 | calcium-dependent protein serine/threonine phosphatase regulator activity(GO:0008597) |
0.4 | 2.1 | GO:0003933 | GTP cyclohydrolase activity(GO:0003933) |
0.4 | 1.5 | GO:0004566 | beta-glucuronidase activity(GO:0004566) |
0.4 | 1.5 | GO:0005025 | transforming growth factor beta receptor activity, type I(GO:0005025) |
0.4 | 1.1 | GO:0016842 | amidine-lyase activity(GO:0016842) |
0.4 | 3.2 | GO:0001091 | RNA polymerase II basal transcription factor binding(GO:0001091) |
0.3 | 1.0 | GO:0004748 | ribonucleoside-diphosphate reductase activity, thioredoxin disulfide as acceptor(GO:0004748) oxidoreductase activity, acting on CH or CH2 groups, disulfide as acceptor(GO:0016728) ribonucleoside-diphosphate reductase activity(GO:0061731) |
0.3 | 0.9 | GO:0004427 | inorganic diphosphatase activity(GO:0004427) |
0.3 | 0.8 | GO:0048763 | calcium-induced calcium release activity(GO:0048763) |
0.3 | 1.3 | GO:0000155 | phosphorelay sensor kinase activity(GO:0000155) |
0.3 | 0.8 | GO:0102007 | lactonohydrolase activity(GO:0046573) acyl-L-homoserine-lactone lactonohydrolase activity(GO:0102007) |
0.3 | 1.0 | GO:0086007 | voltage-gated calcium channel activity involved in cardiac muscle cell action potential(GO:0086007) |
0.2 | 2.6 | GO:0070694 | single-strand selective uracil DNA N-glycosylase activity(GO:0017065) nicotinamide riboside hydrolase activity(GO:0070635) nicotinic acid riboside hydrolase activity(GO:0070636) deoxyribonucleoside 5'-monophosphate N-glycosidase activity(GO:0070694) |
0.2 | 0.9 | GO:0030619 | U1 snRNA binding(GO:0030619) |
0.2 | 0.7 | GO:0050816 | phosphothreonine binding(GO:0050816) |
0.2 | 0.9 | GO:0042731 | PH domain binding(GO:0042731) |
0.2 | 1.0 | GO:0070095 | fructose-6-phosphate binding(GO:0070095) |
0.2 | 0.4 | GO:0008332 | low voltage-gated calcium channel activity(GO:0008332) |
0.2 | 0.6 | GO:0036042 | long-chain fatty acyl-CoA binding(GO:0036042) |
0.2 | 0.6 | GO:0097200 | cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:0097200) |
0.2 | 1.2 | GO:0005225 | volume-sensitive anion channel activity(GO:0005225) |
0.2 | 0.6 | GO:0016309 | 1-phosphatidylinositol-5-phosphate 4-kinase activity(GO:0016309) |
0.2 | 1.5 | GO:0008113 | peptide-methionine (S)-S-oxide reductase activity(GO:0008113) |
0.2 | 0.6 | GO:0045503 | dynein light chain binding(GO:0045503) |
0.2 | 0.7 | GO:0009374 | biotin binding(GO:0009374) |
0.2 | 1.6 | GO:0001206 | transcriptional repressor activity, RNA polymerase II distal enhancer sequence-specific binding(GO:0001206) |
0.2 | 0.7 | GO:0070053 | thrombospondin receptor activity(GO:0070053) |
0.2 | 1.3 | GO:0035197 | siRNA binding(GO:0035197) |
0.2 | 0.5 | GO:0004687 | myosin light chain kinase activity(GO:0004687) |
0.2 | 0.8 | GO:0015349 | thyroid hormone transmembrane transporter activity(GO:0015349) |
0.2 | 0.5 | GO:0004605 | phosphatidate cytidylyltransferase activity(GO:0004605) |
0.2 | 0.5 | GO:0005350 | purine nucleobase transmembrane transporter activity(GO:0005345) pyrimidine nucleobase transmembrane transporter activity(GO:0005350) nucleobase transmembrane transporter activity(GO:0015205) |
0.2 | 0.5 | GO:0016634 | oxidoreductase activity, acting on the CH-CH group of donors, oxygen as acceptor(GO:0016634) |
0.2 | 0.6 | GO:0043515 | kinetochore binding(GO:0043515) |
0.2 | 0.8 | GO:0004769 | steroid delta-isomerase activity(GO:0004769) |
0.1 | 1.9 | GO:0008574 | ATP-dependent microtubule motor activity, plus-end-directed(GO:0008574) |
0.1 | 0.6 | GO:0004735 | pyrroline-5-carboxylate reductase activity(GO:0004735) |
0.1 | 0.4 | GO:0004505 | phenylalanine 4-monooxygenase activity(GO:0004505) |
0.1 | 0.6 | GO:0004165 | dodecenoyl-CoA delta-isomerase activity(GO:0004165) |
0.1 | 0.7 | GO:0086080 | protein binding involved in heterotypic cell-cell adhesion(GO:0086080) |
0.1 | 0.7 | GO:0004396 | glucokinase activity(GO:0004340) hexokinase activity(GO:0004396) |
0.1 | 0.4 | GO:0004471 | malic enzyme activity(GO:0004470) malate dehydrogenase (decarboxylating) (NAD+) activity(GO:0004471) |
0.1 | 1.4 | GO:0051378 | serotonin binding(GO:0051378) |
0.1 | 0.8 | GO:0035312 | 5'-3' exodeoxyribonuclease activity(GO:0035312) |
0.1 | 0.5 | GO:0015467 | G-protein activated inward rectifier potassium channel activity(GO:0015467) |
0.1 | 0.5 | GO:0004127 | cytidylate kinase activity(GO:0004127) |
0.1 | 0.4 | GO:0031752 | D5 dopamine receptor binding(GO:0031752) |
0.1 | 0.4 | GO:0004096 | catalase activity(GO:0004096) |
0.1 | 0.5 | GO:0016885 | ligase activity, forming carbon-carbon bonds(GO:0016885) |
0.1 | 0.5 | GO:0015016 | [heparan sulfate]-glucosamine N-sulfotransferase activity(GO:0015016) |
0.1 | 0.4 | GO:0008503 | benzodiazepine receptor activity(GO:0008503) |
0.1 | 0.4 | GO:0004829 | threonine-tRNA ligase activity(GO:0004829) |
0.1 | 0.5 | GO:0017089 | glycolipid transporter activity(GO:0017089) |
0.1 | 0.5 | GO:0004308 | exo-alpha-sialidase activity(GO:0004308) alpha-sialidase activity(GO:0016997) exo-alpha-(2->3)-sialidase activity(GO:0052794) exo-alpha-(2->6)-sialidase activity(GO:0052795) exo-alpha-(2->8)-sialidase activity(GO:0052796) |
0.1 | 0.7 | GO:0008235 | metalloexopeptidase activity(GO:0008235) |
0.1 | 0.7 | GO:0016624 | oxidoreductase activity, acting on the aldehyde or oxo group of donors, disulfide as acceptor(GO:0016624) |
0.1 | 1.1 | GO:0070567 | cytidylyltransferase activity(GO:0070567) |
0.1 | 0.4 | GO:0030628 | pre-mRNA 3'-splice site binding(GO:0030628) |
0.1 | 0.8 | GO:0004571 | mannosyl-oligosaccharide 1,2-alpha-mannosidase activity(GO:0004571) |
0.1 | 0.3 | GO:0004691 | cAMP-dependent protein kinase activity(GO:0004691) |
0.1 | 0.6 | GO:0045545 | syndecan binding(GO:0045545) |
0.1 | 1.2 | GO:0015271 | outward rectifier potassium channel activity(GO:0015271) |
0.1 | 0.5 | GO:0001025 | RNA polymerase III transcription factor binding(GO:0001025) |
0.1 | 0.2 | GO:0004698 | calcium-dependent protein kinase C activity(GO:0004698) |
0.1 | 0.5 | GO:0004468 | lysine N-acetyltransferase activity, acting on acetyl phosphate as donor(GO:0004468) |
0.1 | 0.5 | GO:0004634 | phosphopyruvate hydratase activity(GO:0004634) |
0.1 | 0.3 | GO:0015183 | L-aspartate transmembrane transporter activity(GO:0015183) |
0.1 | 1.0 | GO:0005522 | profilin binding(GO:0005522) |
0.1 | 0.3 | GO:1990190 | peptide-serine-N-acetyltransferase activity(GO:1990189) peptide-glutamate-N-acetyltransferase activity(GO:1990190) |
0.1 | 2.7 | GO:0030507 | spectrin binding(GO:0030507) |
0.1 | 0.4 | GO:0051425 | PTB domain binding(GO:0051425) |
0.1 | 0.6 | GO:0035473 | lipase binding(GO:0035473) |
0.1 | 0.4 | GO:0004332 | fructose-bisphosphate aldolase activity(GO:0004332) |
0.1 | 0.3 | GO:0008412 | 4-hydroxybenzoate octaprenyltransferase activity(GO:0008412) protoheme IX farnesyltransferase activity(GO:0008495) (S)-2,3-di-O-geranylgeranylglyceryl phosphate synthase activity(GO:0043888) cadaverine aminopropyltransferase activity(GO:0043918) agmatine aminopropyltransferase activity(GO:0043919) 1,4-dihydroxy-2-naphthoate octaprenyltransferase activity(GO:0046428) trans-pentaprenyltranstransferase activity(GO:0048045) ATP dimethylallyltransferase activity(GO:0052622) ADP dimethylallyltransferase activity(GO:0052623) |
0.1 | 1.1 | GO:0035198 | miRNA binding(GO:0035198) |
0.1 | 0.2 | GO:0004351 | glutamate decarboxylase activity(GO:0004351) |
0.1 | 0.8 | GO:0005041 | low-density lipoprotein receptor activity(GO:0005041) |
0.1 | 0.3 | GO:0015137 | citrate transmembrane transporter activity(GO:0015137) tricarboxylic acid transmembrane transporter activity(GO:0015142) |
0.1 | 0.2 | GO:0045340 | mercury ion binding(GO:0045340) |
0.1 | 0.1 | GO:0000701 | purine-specific mismatch base pair DNA N-glycosylase activity(GO:0000701) |
0.1 | 0.2 | GO:0004779 | sulfate adenylyltransferase activity(GO:0004779) |
0.1 | 0.3 | GO:0015220 | choline transmembrane transporter activity(GO:0015220) |
0.1 | 0.4 | GO:0008131 | primary amine oxidase activity(GO:0008131) |
0.1 | 0.3 | GO:0005030 | neurotrophin receptor activity(GO:0005030) |
0.1 | 0.3 | GO:0019808 | polyamine binding(GO:0019808) |
0.1 | 0.4 | GO:0017034 | Rap guanyl-nucleotide exchange factor activity(GO:0017034) |
0.1 | 0.5 | GO:0000150 | recombinase activity(GO:0000150) |
0.1 | 0.7 | GO:0016920 | pyroglutamyl-peptidase activity(GO:0016920) |
0.1 | 0.5 | GO:0034819 | 3-(3-hydroxyphenyl)propionate hydroxylase activity(GO:0008688) 4-chlorobenzaldehyde oxidase activity(GO:0018471) 3,5-xylenol methylhydroxylase activity(GO:0018630) phenylacetate hydroxylase activity(GO:0018631) 4-nitrophenol 4-monooxygenase activity(GO:0018632) dimethyl sulfide monooxygenase activity(GO:0018633) alpha-pinene monooxygenase [NADH] activity(GO:0018634) 1-hydroxy-2-naphthoate hydroxylase activity(GO:0018637) toluene 4-monooxygenase activity(GO:0018638) xylene monooxygenase activity(GO:0018639) dibenzothiophene monooxygenase activity(GO:0018640) 6-hydroxy-3-methyl-2-oxo-1,2-dihydroquinoline 6-monooxygenase activity(GO:0018641) chlorophenol 4-monooxygenase activity(GO:0018642) carbon disulfide oxygenase activity(GO:0018643) toluene 2-monooxygenase activity(GO:0018644) 1-hydroxy-2-oxolimonene 1,2-monooxygenase activity(GO:0018646) phenanthrene 1,2-monooxygenase activity(GO:0018647) tetrahydrofuran hydroxylase activity(GO:0018649) styrene monooxygenase activity(GO:0018650) toluene-4-sulfonate monooxygenase activity(GO:0018651) toluene-sulfonate methyl-monooxygenase activity(GO:0018652) 3-methyl-2-oxo-1,2-dihydroquinoline 6-monooxygenase activity(GO:0018653) 2-hydroxy-phenylacetate hydroxylase activity(GO:0018654) 2-oxo-delta3-4,5,5-trimethylcyclopentenylacetyl-CoA 1,2-monooxygenase activity(GO:0018655) phenanthrene 3,4-monooxygenase activity(GO:0018656) toluene 3-monooxygenase activity(GO:0018657) 4-hydroxyphenylacetate,NADH:oxygen oxidoreductase (3-hydroxylating) activity(GO:0018660) limonene monooxygenase activity(GO:0019113) 2-methylnaphthalene hydroxylase activity(GO:0034526) 1-methylnaphthalene hydroxylase activity(GO:0034534) bisphenol A hydroxylase A activity(GO:0034560) salicylate 5-hydroxylase activity(GO:0034785) isobutylamine N-hydroxylase activity(GO:0034791) branched-chain dodecylbenzene sulfonate monooxygenase activity(GO:0034802) 3-HSA hydroxylase activity(GO:0034819) 4-hydroxypyridine-3-hydroxylase activity(GO:0034894) 2-octaprenyl-3-methyl-6-methoxy-1,4-benzoquinol hydroxylase activity(GO:0043719) 6-hydroxynicotinate 3-monooxygenase activity(GO:0043731) thalianol hydroxylase activity(GO:0080014) |
0.1 | 0.2 | GO:0005483 | soluble NSF attachment protein activity(GO:0005483) |
0.1 | 0.3 | GO:0003945 | N-acetyllactosamine synthase activity(GO:0003945) |
0.1 | 1.6 | GO:0005540 | hyaluronic acid binding(GO:0005540) |
0.1 | 0.2 | GO:0048101 | calcium- and calmodulin-regulated 3',5'-cyclic-GMP phosphodiesterase activity(GO:0048101) |
0.1 | 0.6 | GO:0008568 | microtubule-severing ATPase activity(GO:0008568) |
0.1 | 0.8 | GO:0016909 | JUN kinase activity(GO:0004705) SAP kinase activity(GO:0016909) |
0.1 | 0.1 | GO:0031698 | beta-2 adrenergic receptor binding(GO:0031698) |
0.1 | 0.6 | GO:0016215 | acyl-CoA desaturase activity(GO:0016215) |
0.1 | 0.4 | GO:0004385 | guanylate kinase activity(GO:0004385) |
0.1 | 0.3 | GO:0016899 | oxidoreductase activity, acting on the CH-OH group of donors, oxygen as acceptor(GO:0016899) |
0.1 | 0.1 | GO:0016361 | activin receptor activity, type I(GO:0016361) |
0.1 | 0.2 | GO:0004346 | glucose-6-phosphatase activity(GO:0004346) sugar-terminal-phosphatase activity(GO:0050309) |
0.1 | 0.4 | GO:0005499 | vitamin D binding(GO:0005499) |
0.1 | 0.4 | GO:0033691 | sialic acid binding(GO:0033691) |
0.1 | 0.1 | GO:0003896 | DNA primase activity(GO:0003896) |
0.1 | 1.2 | GO:0042813 | Wnt-activated receptor activity(GO:0042813) |
0.1 | 0.3 | GO:0004523 | RNA-DNA hybrid ribonuclease activity(GO:0004523) |
0.1 | 0.1 | GO:0047192 | 1-alkylglycerophosphocholine O-acetyltransferase activity(GO:0047192) |
0.1 | 0.2 | GO:0015222 | serotonin transmembrane transporter activity(GO:0015222) |
0.1 | 0.2 | GO:0030911 | TPR domain binding(GO:0030911) |
0.1 | 0.2 | GO:0015440 | peptide-transporting ATPase activity(GO:0015440) |
0.1 | 0.2 | GO:0034604 | pyruvate dehydrogenase activity(GO:0004738) pyruvate dehydrogenase [NAD(P)+] activity(GO:0034603) pyruvate dehydrogenase (NAD+) activity(GO:0034604) |
0.1 | 0.3 | GO:0016443 | bidentate ribonuclease III activity(GO:0016443) |
0.1 | 0.2 | GO:0004980 | melanocyte-stimulating hormone receptor activity(GO:0004980) |
0.1 | 0.2 | GO:0004667 | prostaglandin-D synthase activity(GO:0004667) |
0.1 | 0.2 | GO:0055056 | D-glucose transmembrane transporter activity(GO:0055056) |
0.1 | 1.8 | GO:0019894 | kinesin binding(GO:0019894) |
0.1 | 0.4 | GO:0046790 | virion binding(GO:0046790) |
0.1 | 0.5 | GO:0019206 | nucleoside kinase activity(GO:0019206) |
0.1 | 0.4 | GO:0035612 | AP-2 adaptor complex binding(GO:0035612) |
0.1 | 0.2 | GO:0008502 | melatonin receptor activity(GO:0008502) |
0.1 | 0.6 | GO:0016661 | oxidoreductase activity, acting on other nitrogenous compounds as donors(GO:0016661) |
0.1 | 0.3 | GO:0004668 | protein-arginine deiminase activity(GO:0004668) |
0.1 | 0.2 | GO:0004174 | electron-transferring-flavoprotein dehydrogenase activity(GO:0004174) oxidoreductase activity, acting on the CH-NH group of donors, quinone or similar compound as acceptor(GO:0016649) |
0.1 | 1.1 | GO:0005385 | zinc ion transmembrane transporter activity(GO:0005385) |
0.1 | 0.3 | GO:0046912 | transferase activity, transferring acyl groups, acyl groups converted into alkyl on transfer(GO:0046912) |
0.0 | 0.2 | GO:0019784 | NEDD8-specific protease activity(GO:0019784) |
0.0 | 0.1 | GO:0047276 | N-acetyllactosaminide 3-alpha-galactosyltransferase activity(GO:0047276) |
0.0 | 0.2 | GO:0052650 | NADP-retinol dehydrogenase activity(GO:0052650) |
0.0 | 0.3 | GO:0016681 | ubiquinol-cytochrome-c reductase activity(GO:0008121) oxidoreductase activity, acting on diphenols and related substances as donors, cytochrome as acceptor(GO:0016681) |
0.0 | 1.1 | GO:0004181 | metallocarboxypeptidase activity(GO:0004181) |
0.0 | 0.7 | GO:0004653 | polypeptide N-acetylgalactosaminyltransferase activity(GO:0004653) |
0.0 | 1.2 | GO:0019706 | protein-cysteine S-palmitoyltransferase activity(GO:0019706) |
0.0 | 0.2 | GO:0004652 | polynucleotide adenylyltransferase activity(GO:0004652) |
0.0 | 0.5 | GO:0008656 | cysteine-type endopeptidase activator activity involved in apoptotic process(GO:0008656) |
0.0 | 0.1 | GO:0034513 | box H/ACA snoRNA binding(GO:0034513) |
0.0 | 0.0 | GO:0023029 | MHC class Ib protein binding(GO:0023029) |
0.0 | 0.2 | GO:0070579 | methylcytosine dioxygenase activity(GO:0070579) |
0.0 | 0.5 | GO:0017154 | semaphorin receptor activity(GO:0017154) |
0.0 | 0.1 | GO:0031735 | CCR10 chemokine receptor binding(GO:0031735) |
0.0 | 0.5 | GO:0003993 | acid phosphatase activity(GO:0003993) |
0.0 | 0.3 | GO:0005168 | neurotrophin TRKA receptor binding(GO:0005168) |
0.0 | 0.4 | GO:0004534 | 5'-3' exoribonuclease activity(GO:0004534) |
0.0 | 0.4 | GO:0042171 | lysophosphatidic acid acyltransferase activity(GO:0042171) |
0.0 | 0.2 | GO:0034714 | type III transforming growth factor beta receptor binding(GO:0034714) |
0.0 | 0.1 | GO:0004703 | G-protein coupled receptor kinase activity(GO:0004703) |
0.0 | 0.1 | GO:0042030 | ATPase inhibitor activity(GO:0042030) |
0.0 | 0.2 | GO:0031749 | D2 dopamine receptor binding(GO:0031749) |
0.0 | 0.4 | GO:0004438 | phosphatidylinositol-3-phosphatase activity(GO:0004438) |
0.0 | 0.2 | GO:0050693 | LBD domain binding(GO:0050693) |
0.0 | 0.0 | GO:0010861 | thyroid hormone receptor activator activity(GO:0010861) |
0.0 | 0.2 | GO:0016453 | acetyl-CoA C-acetyltransferase activity(GO:0003985) C-acetyltransferase activity(GO:0016453) |
0.0 | 0.5 | GO:0032183 | SUMO binding(GO:0032183) |
0.0 | 0.2 | GO:0017128 | phospholipid scramblase activity(GO:0017128) |
0.0 | 0.1 | GO:0042895 | antibiotic transporter activity(GO:0042895) |
0.0 | 0.6 | GO:0016594 | glycine binding(GO:0016594) |
0.0 | 1.0 | GO:0030544 | Hsp70 protein binding(GO:0030544) |
0.0 | 0.2 | GO:0048495 | Roundabout binding(GO:0048495) |
0.0 | 0.1 | GO:0070915 | lysophosphatidic acid receptor activity(GO:0070915) |
0.0 | 0.2 | GO:0016286 | small conductance calcium-activated potassium channel activity(GO:0016286) |
0.0 | 0.5 | GO:0070006 | metalloaminopeptidase activity(GO:0070006) |
0.0 | 0.0 | GO:2001070 | starch binding(GO:2001070) |
0.0 | 0.0 | GO:0008905 | mannose-phosphate guanylyltransferase activity(GO:0008905) |
0.0 | 0.1 | GO:0051373 | FATZ binding(GO:0051373) |
0.0 | 0.1 | GO:0005176 | ErbB-2 class receptor binding(GO:0005176) |
0.0 | 0.3 | GO:0038036 | sphingosine-1-phosphate receptor activity(GO:0038036) |
0.0 | 0.1 | GO:0030976 | thiamine pyrophosphate binding(GO:0030976) |
0.0 | 0.1 | GO:0000026 | alpha-1,2-mannosyltransferase activity(GO:0000026) |
0.0 | 0.2 | GO:0043140 | ATP-dependent 3'-5' DNA helicase activity(GO:0043140) |
0.0 | 0.0 | GO:0016933 | extracellular-glycine-gated ion channel activity(GO:0016933) extracellular-glycine-gated chloride channel activity(GO:0016934) |
0.0 | 0.1 | GO:0016774 | phosphotransferase activity, carboxyl group as acceptor(GO:0016774) |
0.0 | 0.2 | GO:0004031 | aldehyde oxidase activity(GO:0004031) oxidoreductase activity, acting on the aldehyde or oxo group of donors, oxygen as acceptor(GO:0016623) |
0.0 | 0.1 | GO:0016015 | morphogen activity(GO:0016015) |
0.0 | 0.6 | GO:0032794 | GTPase activating protein binding(GO:0032794) |
0.0 | 0.1 | GO:0042281 | dolichyl pyrophosphate Man9GlcNAc2 alpha-1,3-glucosyltransferase activity(GO:0042281) |
0.0 | 1.1 | GO:0031624 | ubiquitin conjugating enzyme binding(GO:0031624) |
0.0 | 0.5 | GO:0010485 | H4 histone acetyltransferase activity(GO:0010485) |
0.0 | 0.4 | GO:0070679 | inositol 1,4,5 trisphosphate binding(GO:0070679) |
0.0 | 0.1 | GO:0070815 | peptidyl-lysine 5-dioxygenase activity(GO:0070815) |
0.0 | 0.1 | GO:0032767 | copper-dependent protein binding(GO:0032767) |
0.0 | 0.1 | GO:0002094 | polyprenyltransferase activity(GO:0002094) |
0.0 | 0.3 | GO:0004568 | chitinase activity(GO:0004568) |
0.0 | 0.2 | GO:0015185 | gamma-aminobutyric acid transmembrane transporter activity(GO:0015185) |
0.0 | 0.1 | GO:0004999 | vasoactive intestinal polypeptide receptor activity(GO:0004999) |
0.0 | 0.2 | GO:0003720 | telomerase activity(GO:0003720) RNA-directed DNA polymerase activity(GO:0003964) |
0.0 | 0.3 | GO:0050321 | tau-protein kinase activity(GO:0050321) |
0.0 | 0.1 | GO:0015199 | amino-acid betaine transmembrane transporter activity(GO:0015199) carnitine transmembrane transporter activity(GO:0015226) |
0.0 | 0.9 | GO:0016420 | S-malonyltransferase activity(GO:0016419) malonyltransferase activity(GO:0016420) |
0.0 | 0.1 | GO:0061676 | importin-alpha family protein binding(GO:0061676) |
0.0 | 0.2 | GO:0016863 | intramolecular oxidoreductase activity, transposing C=C bonds(GO:0016863) |
0.0 | 0.2 | GO:0019960 | C-X3-C chemokine binding(GO:0019960) |
0.0 | 0.1 | GO:0033142 | progesterone receptor binding(GO:0033142) |
0.0 | 0.1 | GO:2001069 | glycogen binding(GO:2001069) |
0.0 | 0.1 | GO:0036033 | mediator complex binding(GO:0036033) |
0.0 | 0.1 | GO:0004477 | methenyltetrahydrofolate cyclohydrolase activity(GO:0004477) methylenetetrahydrofolate dehydrogenase (NAD+) activity(GO:0004487) |
0.0 | 0.5 | GO:0052890 | oxidoreductase activity, acting on the CH-CH group of donors, with a flavin as acceptor(GO:0052890) |
0.0 | 0.4 | GO:0000993 | RNA polymerase II core binding(GO:0000993) |
0.0 | 0.1 | GO:0030621 | U4 snRNA binding(GO:0030621) |
0.0 | 0.1 | GO:0034988 | Fc-gamma receptor I complex binding(GO:0034988) |
0.0 | 0.5 | GO:0016805 | dipeptidase activity(GO:0016805) |
0.0 | 0.2 | GO:0000295 | adenine nucleotide transmembrane transporter activity(GO:0000295) purine ribonucleotide transmembrane transporter activity(GO:0005346) purine nucleotide transmembrane transporter activity(GO:0015216) |
0.0 | 0.7 | GO:0003954 | NADH dehydrogenase activity(GO:0003954) |
0.0 | 0.1 | GO:0097109 | neuroligin family protein binding(GO:0097109) |
0.0 | 0.1 | GO:0005078 | MAP-kinase scaffold activity(GO:0005078) |
0.0 | 0.1 | GO:0098518 | polynucleotide phosphatase activity(GO:0098518) |
0.0 | 0.1 | GO:0016882 | cyclo-ligase activity(GO:0016882) |
0.0 | 0.1 | GO:0004035 | alkaline phosphatase activity(GO:0004035) |
0.0 | 0.4 | GO:0045295 | gamma-catenin binding(GO:0045295) |
0.0 | 0.6 | GO:0003785 | actin monomer binding(GO:0003785) |
0.0 | 0.1 | GO:0008401 | retinoic acid 4-hydroxylase activity(GO:0008401) |
0.0 | 0.2 | GO:0003854 | 3-beta-hydroxy-delta5-steroid dehydrogenase activity(GO:0003854) |
0.0 | 0.2 | GO:0051787 | misfolded protein binding(GO:0051787) |
0.0 | 0.1 | GO:0000386 | second spliceosomal transesterification activity(GO:0000386) |
0.0 | 1.4 | GO:0016763 | transferase activity, transferring pentosyl groups(GO:0016763) |
0.0 | 0.1 | GO:0043175 | RNA polymerase core enzyme binding(GO:0043175) |
0.0 | 0.3 | GO:0004143 | diacylglycerol kinase activity(GO:0004143) |
0.0 | 0.1 | GO:0043559 | insulin binding(GO:0043559) |
0.0 | 0.1 | GO:0004046 | aminoacylase activity(GO:0004046) |
0.0 | 0.1 | GO:0031727 | CCR2 chemokine receptor binding(GO:0031727) |
0.0 | 0.5 | GO:0051537 | 2 iron, 2 sulfur cluster binding(GO:0051537) |
0.0 | 0.1 | GO:0042296 | ISG15 transferase activity(GO:0042296) |
0.0 | 0.1 | GO:0004060 | arylamine N-acetyltransferase activity(GO:0004060) |
0.0 | 0.1 | GO:0005138 | interleukin-6 receptor binding(GO:0005138) |
0.0 | 0.0 | GO:0005237 | inhibitory extracellular ligand-gated ion channel activity(GO:0005237) |
0.0 | 0.2 | GO:0008239 | dipeptidyl-peptidase activity(GO:0008239) |
0.0 | 0.1 | GO:0001075 | transcription factor activity, RNA polymerase II core promoter sequence-specific binding involved in preinitiation complex assembly(GO:0001075) |
0.0 | 0.2 | GO:0033170 | DNA clamp loader activity(GO:0003689) protein-DNA loading ATPase activity(GO:0033170) |
0.0 | 0.1 | GO:0033192 | calmodulin-dependent protein phosphatase activity(GO:0033192) |
0.0 | 0.1 | GO:0015198 | oligopeptide transporter activity(GO:0015198) |
0.0 | 0.2 | GO:0039706 | co-receptor binding(GO:0039706) |
0.0 | 1.6 | GO:0004004 | RNA helicase activity(GO:0003724) ATP-dependent RNA helicase activity(GO:0004004) RNA-dependent ATPase activity(GO:0008186) |
0.0 | 0.5 | GO:0034596 | phosphatidylinositol phosphate 4-phosphatase activity(GO:0034596) |
0.0 | 0.1 | GO:0004942 | anaphylatoxin receptor activity(GO:0004942) |
0.0 | 2.4 | GO:0002020 | protease binding(GO:0002020) |
0.0 | 0.1 | GO:0008467 | [heparan sulfate]-glucosamine 3-sulfotransferase 1 activity(GO:0008467) |
0.0 | 0.1 | GO:0015280 | ligand-gated sodium channel activity(GO:0015280) |
0.0 | 0.1 | GO:0019166 | trans-2-enoyl-CoA reductase (NADPH) activity(GO:0019166) |
0.0 | 0.1 | GO:0008093 | cytoskeletal adaptor activity(GO:0008093) |
0.0 | 0.1 | GO:0004305 | ethanolamine kinase activity(GO:0004305) |
0.0 | 0.0 | GO:0016262 | protein N-acetylglucosaminyltransferase activity(GO:0016262) |
0.0 | 0.1 | GO:0015232 | heme transporter activity(GO:0015232) |
0.0 | 0.1 | GO:0019961 | interferon binding(GO:0019961) |
0.0 | 0.2 | GO:0070300 | phosphatidic acid binding(GO:0070300) |
0.0 | 0.7 | GO:0061631 | ubiquitin conjugating enzyme activity(GO:0061631) |
0.0 | 0.4 | GO:0005229 | intracellular calcium activated chloride channel activity(GO:0005229) |
0.0 | 0.1 | GO:0034056 | estrogen response element binding(GO:0034056) |
0.0 | 0.1 | GO:0004972 | NMDA glutamate receptor activity(GO:0004972) |
0.0 | 0.1 | GO:0016823 | hydrolase activity, acting on acid carbon-carbon bonds(GO:0016822) hydrolase activity, acting on acid carbon-carbon bonds, in ketonic substances(GO:0016823) |
0.0 | 0.1 | GO:0030899 | calcium-dependent ATPase activity(GO:0030899) |
0.0 | 0.0 | GO:0016509 | long-chain-3-hydroxyacyl-CoA dehydrogenase activity(GO:0016509) |
0.0 | 0.4 | GO:0008157 | protein phosphatase 1 binding(GO:0008157) |
0.0 | 0.1 | GO:0099589 | G-protein coupled serotonin receptor activity(GO:0004993) serotonin receptor activity(GO:0099589) |
0.0 | 0.1 | GO:0004920 | interleukin-10 receptor activity(GO:0004920) |
0.0 | 0.0 | GO:0010314 | phosphatidylinositol-5-phosphate binding(GO:0010314) |
0.0 | 0.3 | GO:0001784 | phosphotyrosine binding(GO:0001784) |
0.0 | 0.1 | GO:0004449 | isocitrate dehydrogenase (NAD+) activity(GO:0004449) |
0.0 | 0.1 | GO:0008526 | phosphatidylinositol transporter activity(GO:0008526) |
0.0 | 0.2 | GO:0005542 | folic acid binding(GO:0005542) |
0.0 | 0.1 | GO:0034235 | GPI anchor binding(GO:0034235) |
0.0 | 0.4 | GO:0070273 | phosphatidylinositol-4-phosphate binding(GO:0070273) |
0.0 | 0.1 | GO:0070087 | chromo shadow domain binding(GO:0070087) |
0.0 | 0.1 | GO:0034711 | inhibin binding(GO:0034711) |
0.0 | 0.4 | GO:0071837 | HMG box domain binding(GO:0071837) |
0.0 | 0.1 | GO:0005432 | calcium:sodium antiporter activity(GO:0005432) |
0.0 | 0.0 | GO:0016749 | N-succinyltransferase activity(GO:0016749) |
0.0 | 0.1 | GO:0031871 | proteinase activated receptor binding(GO:0031871) |
0.0 | 0.1 | GO:0035184 | histone threonine kinase activity(GO:0035184) |
0.0 | 0.1 | GO:1901702 | urate transmembrane transporter activity(GO:0015143) salt transmembrane transporter activity(GO:1901702) |
0.0 | 0.4 | GO:0070412 | R-SMAD binding(GO:0070412) |
0.0 | 0.1 | GO:0008823 | cupric reductase activity(GO:0008823) ferric-chelate reductase (NADPH) activity(GO:0052851) |
0.0 | 0.3 | GO:0004890 | GABA-A receptor activity(GO:0004890) |
0.0 | 0.2 | GO:0015254 | glycerol transmembrane transporter activity(GO:0015168) glycerol channel activity(GO:0015254) |
0.0 | 0.0 | GO:0003905 | alkylbase DNA N-glycosylase activity(GO:0003905) DNA-3-methylbase glycosylase activity(GO:0043733) |
0.0 | 0.2 | GO:0003796 | lysozyme activity(GO:0003796) |
0.0 | 0.1 | GO:0004614 | phosphoglucomutase activity(GO:0004614) |
0.0 | 0.6 | GO:0004364 | glutathione transferase activity(GO:0004364) |
0.0 | 0.2 | GO:0016929 | SUMO-specific protease activity(GO:0016929) |
0.0 | 0.1 | GO:0036435 | K48-linked polyubiquitin binding(GO:0036435) |
0.0 | 0.2 | GO:0008195 | phosphatidate phosphatase activity(GO:0008195) |
0.0 | 0.1 | GO:0030292 | protein tyrosine kinase inhibitor activity(GO:0030292) |
0.0 | 0.1 | GO:0008390 | testosterone 16-alpha-hydroxylase activity(GO:0008390) |
0.0 | 0.1 | GO:0031720 | haptoglobin binding(GO:0031720) |
0.0 | 0.3 | GO:0005528 | macrolide binding(GO:0005527) FK506 binding(GO:0005528) |
0.0 | 0.1 | GO:0016647 | oxidoreductase activity, acting on the CH-NH group of donors, oxygen as acceptor(GO:0016647) |
0.0 | 0.1 | GO:0061133 | endopeptidase activator activity(GO:0061133) |
0.0 | 0.1 | GO:0004767 | sphingomyelin phosphodiesterase activity(GO:0004767) |
0.0 | 0.0 | GO:0017098 | sulfonylurea receptor binding(GO:0017098) |
0.0 | 0.1 | GO:0004563 | beta-N-acetylhexosaminidase activity(GO:0004563) |
0.0 | 0.1 | GO:0072349 | modified amino acid transmembrane transporter activity(GO:0072349) |
0.0 | 0.9 | GO:0008417 | fucosyltransferase activity(GO:0008417) |
0.0 | 0.0 | GO:0051733 | ATP-dependent polydeoxyribonucleotide 5'-hydroxyl-kinase activity(GO:0046404) polydeoxyribonucleotide kinase activity(GO:0051733) |
0.0 | 0.1 | GO:0004367 | glycerol-3-phosphate dehydrogenase [NAD+] activity(GO:0004367) |
0.0 | 0.4 | GO:0033558 | protein deacetylase activity(GO:0033558) |
0.0 | 0.1 | GO:0030250 | cyclase activator activity(GO:0010853) guanylate cyclase activator activity(GO:0030250) |
0.0 | 0.7 | GO:0004869 | cysteine-type endopeptidase inhibitor activity(GO:0004869) |
0.0 | 0.3 | GO:0035259 | glucocorticoid receptor binding(GO:0035259) |
0.0 | 0.0 | GO:0019238 | cyclohydrolase activity(GO:0019238) |
0.0 | 0.3 | GO:0030332 | cyclin binding(GO:0030332) |
0.0 | 0.1 | GO:0004322 | ferroxidase activity(GO:0004322) oxidoreductase activity, oxidizing metal ions, oxygen as acceptor(GO:0016724) |
0.0 | 0.1 | GO:0102391 | decanoate--CoA ligase activity(GO:0102391) |
0.0 | 0.0 | GO:0034040 | lipid-transporting ATPase activity(GO:0034040) |
0.0 | 0.0 | GO:0001098 | basal transcription machinery binding(GO:0001098) basal RNA polymerase II transcription machinery binding(GO:0001099) |
0.0 | 0.5 | GO:0019212 | phosphatase inhibitor activity(GO:0019212) |
0.0 | 0.0 | GO:0016505 | peptidase activator activity involved in apoptotic process(GO:0016505) |
0.0 | 0.0 | GO:0000182 | rDNA binding(GO:0000182) |
0.0 | 0.1 | GO:0031386 | protein tag(GO:0031386) |
0.0 | 0.1 | GO:0008331 | high voltage-gated calcium channel activity(GO:0008331) |
0.0 | 0.1 | GO:0031849 | olfactory receptor binding(GO:0031849) |
0.0 | 0.1 | GO:0017150 | tRNA dihydrouridine synthase activity(GO:0017150) |
0.0 | 0.1 | GO:0004459 | L-lactate dehydrogenase activity(GO:0004459) |
0.0 | 0.1 | GO:0000268 | peroxisome targeting sequence binding(GO:0000268) |
0.0 | 0.1 | GO:0043912 | D-lysine oxidase activity(GO:0043912) |
0.0 | 3.1 | GO:0015631 | tubulin binding(GO:0015631) |
0.0 | 0.3 | GO:0042805 | actinin binding(GO:0042805) |
0.0 | 0.3 | GO:0050699 | WW domain binding(GO:0050699) |
0.0 | 0.1 | GO:0036310 | annealing helicase activity(GO:0036310) |
0.0 | 0.0 | GO:0003910 | DNA ligase activity(GO:0003909) DNA ligase (ATP) activity(GO:0003910) |
0.0 | 0.3 | GO:0070001 | aspartic-type endopeptidase activity(GO:0004190) aspartic-type peptidase activity(GO:0070001) |
0.0 | 0.0 | GO:0016880 | acid-ammonia (or amide) ligase activity(GO:0016880) |
0.0 | 0.3 | GO:0030552 | cAMP binding(GO:0030552) |
0.0 | 0.1 | GO:0004370 | glycerol kinase activity(GO:0004370) |
0.0 | 0.2 | GO:0016755 | transferase activity, transferring amino-acyl groups(GO:0016755) |
0.0 | 0.1 | GO:0052790 | protein-N-terminal asparagine amidohydrolase activity(GO:0008418) UDP-3-O-[3-hydroxymyristoyl] N-acetylglucosamine deacetylase activity(GO:0008759) iprodione amidohydrolase activity(GO:0018748) (3,5-dichlorophenylurea)acetate amidohydrolase activity(GO:0018749) 4'-(2-hydroxyisopropyl)phenylurea amidohydrolase activity(GO:0034571) didemethylisoproturon amidohydrolase activity(GO:0034573) N-isopropylacetanilide amidohydrolase activity(GO:0034576) N-cyclohexylformamide amidohydrolase activity(GO:0034781) isonicotinic acid hydrazide hydrolase activity(GO:0034876) cis-aconitamide amidase activity(GO:0034882) gamma-N-formylaminovinylacetate hydrolase activity(GO:0034885) N2-acetyl-L-lysine deacetylase activity(GO:0043747) O-succinylbenzoate synthase activity(GO:0043748) indoleacetamide hydrolase activity(GO:0043864) N-acetylcitrulline deacetylase activity(GO:0043909) N-acetylgalactosamine-6-phosphate deacetylase activity(GO:0047419) diacetylchitobiose deacetylase activity(GO:0052773) chitooligosaccharide deacetylase activity(GO:0052790) |
0.0 | 0.1 | GO:0035014 | phosphatidylinositol 3-kinase regulator activity(GO:0035014) |
0.0 | 0.1 | GO:0005344 | oxygen transporter activity(GO:0005344) |
0.0 | 0.2 | GO:0008198 | ferrous iron binding(GO:0008198) |
0.0 | 0.0 | GO:0005134 | interleukin-2 receptor binding(GO:0005134) |
0.0 | 0.0 | GO:0004977 | melanocortin receptor activity(GO:0004977) |
0.0 | 0.0 | GO:1990825 | sequence-specific mRNA binding(GO:1990825) |
0.0 | 0.2 | GO:0017160 | Ral GTPase binding(GO:0017160) |
0.0 | 0.1 | GO:0042015 | interleukin-20 binding(GO:0042015) |
0.0 | 0.3 | GO:0005212 | structural constituent of eye lens(GO:0005212) |
0.0 | 0.1 | GO:1990405 | protein antigen binding(GO:1990405) |
0.0 | 0.1 | GO:0016670 | oxidoreductase activity, acting on a sulfur group of donors, oxygen as acceptor(GO:0016670) |
0.0 | 0.0 | GO:0008454 | alpha-1,3-mannosylglycoprotein 4-beta-N-acetylglucosaminyltransferase activity(GO:0008454) |
0.0 | 0.0 | GO:0016615 | malate dehydrogenase activity(GO:0016615) |
0.0 | 0.1 | GO:0034237 | protein kinase A regulatory subunit binding(GO:0034237) |
0.0 | 0.0 | GO:0004844 | uracil DNA N-glycosylase activity(GO:0004844) deaminated base DNA N-glycosylase activity(GO:0097506) |
0.0 | 0.3 | GO:0070003 | threonine-type endopeptidase activity(GO:0004298) threonine-type peptidase activity(GO:0070003) |
0.0 | 0.1 | GO:0047372 | acylglycerol lipase activity(GO:0047372) |
0.0 | 0.0 | GO:0010997 | anaphase-promoting complex binding(GO:0010997) |
0.0 | 0.2 | GO:0008553 | hydrogen-exporting ATPase activity, phosphorylative mechanism(GO:0008553) |
0.0 | 0.1 | GO:0080011 | pivalyl-CoA mutase activity(GO:0034784) o-hydroxylaminobenzoate mutase activity(GO:0034951) lupeol synthase activity(GO:0042299) beta-amyrin synthase activity(GO:0042300) baruol synthase activity(GO:0080011) |
0.0 | 0.3 | GO:0005251 | delayed rectifier potassium channel activity(GO:0005251) |
0.0 | 0.0 | GO:0019211 | phosphatase activator activity(GO:0019211) |
0.0 | 0.1 | GO:0004957 | prostaglandin E receptor activity(GO:0004957) |
0.0 | 0.1 | GO:0050700 | CARD domain binding(GO:0050700) |
0.0 | 0.2 | GO:0046966 | thyroid hormone receptor binding(GO:0046966) |
0.0 | 0.1 | GO:0001054 | RNA polymerase I activity(GO:0001054) |
0.0 | 0.0 | GO:0047238 | glucuronosyl-N-acetylgalactosaminyl-proteoglycan 4-beta-N-acetylgalactosaminyltransferase activity(GO:0047238) |
0.0 | 0.0 | GO:0005004 | GPI-linked ephrin receptor activity(GO:0005004) |
0.0 | 0.3 | GO:0048020 | CCR chemokine receptor binding(GO:0048020) |
0.0 | 0.0 | GO:0004813 | alanine-tRNA ligase activity(GO:0004813) |
0.0 | 0.1 | GO:0010857 | calcium-dependent protein serine/threonine kinase activity(GO:0009931) calcium-dependent protein kinase activity(GO:0010857) |
0.0 | 0.1 | GO:0030306 | ADP-ribosylation factor binding(GO:0030306) |
0.0 | 0.1 | GO:0004128 | cytochrome-b5 reductase activity, acting on NAD(P)H(GO:0004128) |
0.0 | 0.2 | GO:0017075 | syntaxin-1 binding(GO:0017075) |
0.0 | 0.1 | GO:0001515 | opioid peptide activity(GO:0001515) |
0.0 | 0.4 | GO:0004812 | aminoacyl-tRNA ligase activity(GO:0004812) |
0.0 | 0.2 | GO:0042800 | histone methyltransferase activity (H3-K4 specific)(GO:0042800) |
0.0 | 0.0 | GO:0031779 | melanocortin receptor binding(GO:0031779) type 3 melanocortin receptor binding(GO:0031781) type 4 melanocortin receptor binding(GO:0031782) |
0.0 | 0.2 | GO:0015125 | bile acid transmembrane transporter activity(GO:0015125) |
0.0 | 0.1 | GO:0000062 | fatty-acyl-CoA binding(GO:0000062) |
0.0 | 0.0 | GO:0015563 | uptake transmembrane transporter activity(GO:0015563) |
0.0 | 0.1 | GO:0050291 | sphingosine N-acyltransferase activity(GO:0050291) |
0.0 | 0.1 | GO:0016857 | racemase and epimerase activity, acting on carbohydrates and derivatives(GO:0016857) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.1 | 0.4 | PID NFAT 3PATHWAY | Role of Calcineurin-dependent NFAT signaling in lymphocytes |
0.1 | 0.6 | SA FAS SIGNALING | The TNF-type receptor Fas induces apoptosis on ligand binding. |
0.1 | 1.8 | PID LIS1 PATHWAY | Lissencephaly gene (LIS1) in neuronal migration and development |
0.1 | 0.1 | ST ADRENERGIC | Adrenergic Pathway |
0.1 | 1.7 | PID TCR CALCIUM PATHWAY | Calcium signaling in the CD4+ TCR pathway |
0.1 | 4.8 | PID BETA CATENIN NUC PATHWAY | Regulation of nuclear beta catenin signaling and target gene transcription |
0.1 | 1.0 | PID SYNDECAN 3 PATHWAY | Syndecan-3-mediated signaling events |
0.1 | 0.7 | PID BETA CATENIN DEG PATHWAY | Degradation of beta catenin |
0.1 | 1.3 | PID IL2 STAT5 PATHWAY | IL2 signaling events mediated by STAT5 |
0.1 | 0.2 | PID S1P S1P4 PATHWAY | S1P4 pathway |
0.1 | 1.3 | PID CD40 PATHWAY | CD40/CD40L signaling |
0.0 | 0.7 | PID DNA PK PATHWAY | DNA-PK pathway in nonhomologous end joining |
0.0 | 1.4 | PID TCPTP PATHWAY | Signaling events mediated by TCPTP |
0.0 | 0.6 | PID S1P S1P1 PATHWAY | S1P1 pathway |
0.0 | 0.2 | PID TCR RAS PATHWAY | Ras signaling in the CD4+ TCR pathway |
0.0 | 0.9 | PID GLYPICAN 1PATHWAY | Glypican 1 network |
0.0 | 1.4 | PID FANCONI PATHWAY | Fanconi anemia pathway |
0.0 | 0.4 | PID P38 MK2 PATHWAY | p38 signaling mediated by MAPKAP kinases |
0.0 | 0.6 | PID SYNDECAN 2 PATHWAY | Syndecan-2-mediated signaling events |
0.0 | 0.4 | ST INTERLEUKIN 4 PATHWAY | Interleukin 4 (IL-4) Pathway |
0.0 | 0.7 | PID INTEGRIN A4B1 PATHWAY | Alpha4 beta1 integrin signaling events |
0.0 | 0.2 | PID ARF6 DOWNSTREAM PATHWAY | Arf6 downstream pathway |
0.0 | 1.2 | PID ARF6 TRAFFICKING PATHWAY | Arf6 trafficking events |
0.0 | 1.0 | PID ILK PATHWAY | Integrin-linked kinase signaling |
0.0 | 0.2 | PID WNT CANONICAL PATHWAY | Canonical Wnt signaling pathway |
0.0 | 0.3 | PID TCR JNK PATHWAY | JNK signaling in the CD4+ TCR pathway |
0.0 | 0.4 | PID MYC PATHWAY | C-MYC pathway |
0.0 | 0.6 | PID SHP2 PATHWAY | SHP2 signaling |
0.0 | 0.3 | ST PHOSPHOINOSITIDE 3 KINASE PATHWAY | PI3K Pathway |
0.0 | 0.2 | PID PI3K PLC TRK PATHWAY | Trk receptor signaling mediated by PI3K and PLC-gamma |
0.0 | 0.2 | PID RANBP2 PATHWAY | Sumoylation by RanBP2 regulates transcriptional repression |
0.0 | 0.2 | PID ALK2 PATHWAY | ALK2 signaling events |
0.0 | 0.2 | SA G1 AND S PHASES | Cdk2, 4, and 6 bind cyclin D in G1, while cdk2/cyclin E promotes the G1/S transition. |
0.0 | 0.4 | PID CXCR3 PATHWAY | CXCR3-mediated signaling events |
0.0 | 0.1 | PID IL5 PATHWAY | IL5-mediated signaling events |
0.0 | 0.2 | SA PROGRAMMED CELL DEATH | Programmed cell death, or apoptosis, eliminates damaged or unneeded cells. |
0.0 | 0.8 | PID REG GR PATHWAY | Glucocorticoid receptor regulatory network |
0.0 | 0.4 | PID ERBB1 INTERNALIZATION PATHWAY | Internalization of ErbB1 |
0.0 | 0.4 | PID CONE PATHWAY | Visual signal transduction: Cones |
0.0 | 0.2 | SA CASPASE CASCADE | Apoptosis is mediated by caspases, cysteine proteases arranged in a proteolytic cascade. |
0.0 | 0.6 | NABA PROTEOGLYCANS | Genes encoding proteoglycans |
0.0 | 0.1 | PID P38 ALPHA BETA PATHWAY | Regulation of p38-alpha and p38-beta |
0.0 | 0.2 | PID ECADHERIN NASCENT AJ PATHWAY | E-cadherin signaling in the nascent adherens junction |
0.0 | 0.3 | PID FOXO PATHWAY | FoxO family signaling |
0.0 | 0.4 | PID MTOR 4PATHWAY | mTOR signaling pathway |
0.0 | 0.1 | ST TYPE I INTERFERON PATHWAY | Type I Interferon (alpha/beta IFN) Pathway |
0.0 | 0.2 | PID AMB2 NEUTROPHILS PATHWAY | amb2 Integrin signaling |
0.0 | 0.1 | PID MET PATHWAY | Signaling events mediated by Hepatocyte Growth Factor Receptor (c-Met) |
0.0 | 0.2 | PID CD8 TCR DOWNSTREAM PATHWAY | Downstream signaling in naïve CD8+ T cells |
0.0 | 0.1 | PID NFKAPPAB ATYPICAL PATHWAY | Atypical NF-kappaB pathway |
0.0 | 0.2 | PID HIF1A PATHWAY | Hypoxic and oxygen homeostasis regulation of HIF-1-alpha |
0.0 | 0.2 | PID HIV NEF PATHWAY | HIV-1 Nef: Negative effector of Fas and TNF-alpha |
0.0 | 0.3 | PID HEDGEHOG GLI PATHWAY | Hedgehog signaling events mediated by Gli proteins |
0.0 | 0.1 | PID IL2 1PATHWAY | IL2-mediated signaling events |
0.0 | 0.2 | PID PTP1B PATHWAY | Signaling events mediated by PTP1B |
0.0 | 0.6 | PID E2F PATHWAY | E2F transcription factor network |
0.0 | 0.2 | PID CXCR4 PATHWAY | CXCR4-mediated signaling events |
0.0 | 0.2 | PID TNF PATHWAY | TNF receptor signaling pathway |
0.0 | 0.3 | PID IL1 PATHWAY | IL1-mediated signaling events |
0.0 | 0.0 | SA G2 AND M PHASES | Cdc25 activates the cdc2/cyclin B complex to induce the G2/M transition. |
0.0 | 0.1 | PID ATM PATHWAY | ATM pathway |
0.0 | 0.1 | PID MAPK TRK PATHWAY | Trk receptor signaling mediated by the MAPK pathway |
0.0 | 0.1 | PID INSULIN PATHWAY | Insulin Pathway |
0.0 | 0.0 | ST TUMOR NECROSIS FACTOR PATHWAY | Tumor Necrosis Factor Pathway. |
0.0 | 0.2 | ST WNT BETA CATENIN PATHWAY | Wnt/beta-catenin Pathway |
0.0 | 0.4 | PID HIF1 TFPATHWAY | HIF-1-alpha transcription factor network |
0.0 | 0.1 | PID ERB GENOMIC PATHWAY | Validated nuclear estrogen receptor beta network |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.2 | 2.6 | REACTOME SYNTHESIS OF PIPS AT THE EARLY ENDOSOME MEMBRANE | Genes involved in Synthesis of PIPs at the early endosome membrane |
0.2 | 4.3 | REACTOME MYOGENESIS | Genes involved in Myogenesis |
0.2 | 0.3 | REACTOME RETROGRADE NEUROTROPHIN SIGNALLING | Genes involved in Retrograde neurotrophin signalling |
0.1 | 0.9 | REACTOME PLATELET SENSITIZATION BY LDL | Genes involved in Platelet sensitization by LDL |
0.1 | 1.8 | REACTOME COMMON PATHWAY | Genes involved in Common Pathway |
0.1 | 1.5 | REACTOME SEROTONIN RECEPTORS | Genes involved in Serotonin receptors |
0.1 | 1.8 | REACTOME CTNNB1 PHOSPHORYLATION CASCADE | Genes involved in Beta-catenin phosphorylation cascade |
0.1 | 0.1 | REACTOME APC C CDC20 MEDIATED DEGRADATION OF MITOTIC PROTEINS | Genes involved in APC/C:Cdc20 mediated degradation of mitotic proteins |
0.1 | 1.5 | REACTOME REGULATION OF PYRUVATE DEHYDROGENASE PDH COMPLEX | Genes involved in Regulation of pyruvate dehydrogenase (PDH) complex |
0.1 | 1.8 | REACTOME POST CHAPERONIN TUBULIN FOLDING PATHWAY | Genes involved in Post-chaperonin tubulin folding pathway |
0.1 | 1.8 | REACTOME CONVERSION FROM APC C CDC20 TO APC C CDH1 IN LATE ANAPHASE | Genes involved in Conversion from APC/C:Cdc20 to APC/C:Cdh1 in late anaphase |
0.1 | 1.3 | REACTOME CS DS DEGRADATION | Genes involved in CS/DS degradation |
0.1 | 1.3 | REACTOME PYRIMIDINE CATABOLISM | Genes involved in Pyrimidine catabolism |
0.1 | 0.1 | REACTOME ENERGY DEPENDENT REGULATION OF MTOR BY LKB1 AMPK | Genes involved in Energy dependent regulation of mTOR by LKB1-AMPK |
0.1 | 1.2 | REACTOME TETRAHYDROBIOPTERIN BH4 SYNTHESIS RECYCLING SALVAGE AND REGULATION | Genes involved in Tetrahydrobiopterin (BH4) synthesis, recycling, salvage and regulation |
0.1 | 0.9 | REACTOME PURINE SALVAGE | Genes involved in Purine salvage |
0.1 | 3.3 | REACTOME VOLTAGE GATED POTASSIUM CHANNELS | Genes involved in Voltage gated Potassium channels |
0.1 | 1.1 | REACTOME CRMPS IN SEMA3A SIGNALING | Genes involved in CRMPs in Sema3A signaling |
0.1 | 0.3 | REACTOME G ALPHA1213 SIGNALLING EVENTS | Genes involved in G alpha (12/13) signalling events |
0.1 | 2.3 | REACTOME TRANSPORT TO THE GOLGI AND SUBSEQUENT MODIFICATION | Genes involved in Transport to the Golgi and subsequent modification |
0.1 | 1.4 | REACTOME CHOLESTEROL BIOSYNTHESIS | Genes involved in Cholesterol biosynthesis |
0.1 | 0.7 | REACTOME PASSIVE TRANSPORT BY AQUAPORINS | Genes involved in Passive Transport by Aquaporins |
0.1 | 0.1 | REACTOME PHOSPHORYLATION OF THE APC C | Genes involved in Phosphorylation of the APC/C |
0.1 | 1.2 | REACTOME INSULIN SYNTHESIS AND PROCESSING | Genes involved in Insulin Synthesis and Processing |
0.1 | 0.2 | REACTOME ACTIVATED TAK1 MEDIATES P38 MAPK ACTIVATION | Genes involved in activated TAK1 mediates p38 MAPK activation |
0.1 | 0.8 | REACTOME DESTABILIZATION OF MRNA BY KSRP | Genes involved in Destabilization of mRNA by KSRP |
0.1 | 0.3 | REACTOME PURINE CATABOLISM | Genes involved in Purine catabolism |
0.1 | 1.1 | REACTOME GLYCOLYSIS | Genes involved in Glycolysis |
0.1 | 3.9 | REACTOME MITOTIC PROMETAPHASE | Genes involved in Mitotic Prometaphase |
0.1 | 0.8 | REACTOME METABOLISM OF PORPHYRINS | Genes involved in Metabolism of porphyrins |
0.1 | 1.7 | REACTOME HS GAG BIOSYNTHESIS | Genes involved in HS-GAG biosynthesis |
0.1 | 0.3 | REACTOME INHIBITION OF INSULIN SECRETION BY ADRENALINE NORADRENALINE | Genes involved in Inhibition of Insulin Secretion by Adrenaline/Noradrenaline |
0.1 | 1.1 | REACTOME MITOCHONDRIAL TRNA AMINOACYLATION | Genes involved in Mitochondrial tRNA aminoacylation |
0.1 | 1.3 | REACTOME ANTIGEN ACTIVATES B CELL RECEPTOR LEADING TO GENERATION OF SECOND MESSENGERS | Genes involved in Antigen Activates B Cell Receptor Leading to Generation of Second Messengers |
0.1 | 0.4 | REACTOME ENOS ACTIVATION AND REGULATION | Genes involved in eNOS activation and regulation |
0.1 | 3.1 | REACTOME RESPIRATORY ELECTRON TRANSPORT | Genes involved in Respiratory electron transport |
0.1 | 0.3 | REACTOME GLYCOPROTEIN HORMONES | Genes involved in Glycoprotein hormones |
0.0 | 0.5 | REACTOME EXTRINSIC PATHWAY FOR APOPTOSIS | Genes involved in Extrinsic Pathway for Apoptosis |
0.0 | 0.6 | REACTOME GABA A RECEPTOR ACTIVATION | Genes involved in GABA A receptor activation |
0.0 | 0.1 | REACTOME MRNA CAPPING | Genes involved in mRNA Capping |
0.0 | 0.7 | REACTOME SYNTHESIS AND INTERCONVERSION OF NUCLEOTIDE DI AND TRIPHOSPHATES | Genes involved in Synthesis and interconversion of nucleotide di- and triphosphates |
0.0 | 0.2 | REACTOME THE ROLE OF NEF IN HIV1 REPLICATION AND DISEASE PATHOGENESIS | Genes involved in The role of Nef in HIV-1 replication and disease pathogenesis |
0.0 | 0.1 | REACTOME DCC MEDIATED ATTRACTIVE SIGNALING | Genes involved in DCC mediated attractive signaling |
0.0 | 1.8 | REACTOME LOSS OF NLP FROM MITOTIC CENTROSOMES | Genes involved in Loss of Nlp from mitotic centrosomes |
0.0 | 2.6 | REACTOME RESPONSE TO ELEVATED PLATELET CYTOSOLIC CA2 | Genes involved in Response to elevated platelet cytosolic Ca2+ |
0.0 | 0.2 | REACTOME REGULATION OF THE FANCONI ANEMIA PATHWAY | Genes involved in Regulation of the Fanconi anemia pathway |
0.0 | 0.8 | REACTOME REGULATORY RNA PATHWAYS | Genes involved in Regulatory RNA pathways |
0.0 | 0.2 | REACTOME DSCAM INTERACTIONS | Genes involved in DSCAM interactions |
0.0 | 0.3 | REACTOME HORMONE LIGAND BINDING RECEPTORS | Genes involved in Hormone ligand-binding receptors |
0.0 | 0.4 | REACTOME ACTIVATION OF GENES BY ATF4 | Genes involved in Activation of Genes by ATF4 |
0.0 | 0.6 | REACTOME SYNTHESIS OF PC | Genes involved in Synthesis of PC |
0.0 | 0.4 | REACTOME RNA POL III CHAIN ELONGATION | Genes involved in RNA Polymerase III Chain Elongation |
0.0 | 0.1 | REACTOME REGULATION OF KIT SIGNALING | Genes involved in Regulation of KIT signaling |
0.0 | 1.5 | REACTOME SIGNALING BY WNT | Genes involved in Signaling by Wnt |
0.0 | 0.0 | REACTOME NEGATIVE REGULATION OF FGFR SIGNALING | Genes involved in Negative regulation of FGFR signaling |
0.0 | 0.2 | REACTOME THE ACTIVATION OF ARYLSULFATASES | Genes involved in The activation of arylsulfatases |
0.0 | 0.1 | REACTOME SYNTHESIS OF PE | Genes involved in Synthesis of PE |
0.0 | 0.3 | REACTOME CREB PHOSPHORYLATION THROUGH THE ACTIVATION OF CAMKII | Genes involved in CREB phosphorylation through the activation of CaMKII |
0.0 | 0.3 | REACTOME TRYPTOPHAN CATABOLISM | Genes involved in Tryptophan catabolism |
0.0 | 0.2 | REACTOME SYNTHESIS OF BILE ACIDS AND BILE SALTS VIA 7ALPHA HYDROXYCHOLESTEROL | Genes involved in Synthesis of bile acids and bile salts via 7alpha-hydroxycholesterol |
0.0 | 0.3 | REACTOME TANDEM PORE DOMAIN POTASSIUM CHANNELS | Genes involved in Tandem pore domain potassium channels |
0.0 | 0.3 | REACTOME ACTIVATION OF NF KAPPAB IN B CELLS | Genes involved in Activation of NF-kappaB in B Cells |
0.0 | 0.2 | REACTOME DESTABILIZATION OF MRNA BY AUF1 HNRNP D0 | Genes involved in Destabilization of mRNA by AUF1 (hnRNP D0) |
0.0 | 0.4 | REACTOME PREFOLDIN MEDIATED TRANSFER OF SUBSTRATE TO CCT TRIC | Genes involved in Prefoldin mediated transfer of substrate to CCT/TriC |
0.0 | 0.4 | REACTOME JNK C JUN KINASES PHOSPHORYLATION AND ACTIVATION MEDIATED BY ACTIVATED HUMAN TAK1 | Genes involved in JNK (c-Jun kinases) phosphorylation and activation mediated by activated human TAK1 |
0.0 | 0.1 | REACTOME ALPHA LINOLENIC ACID ALA METABOLISM | Genes involved in alpha-linolenic acid (ALA) metabolism |
0.0 | 0.5 | REACTOME PEROXISOMAL LIPID METABOLISM | Genes involved in Peroxisomal lipid metabolism |
0.0 | 0.2 | REACTOME P53 DEPENDENT G1 DNA DAMAGE RESPONSE | Genes involved in p53-Dependent G1 DNA Damage Response |
0.0 | 0.4 | REACTOME PROCESSING OF INTRONLESS PRE MRNAS | Genes involved in Processing of Intronless Pre-mRNAs |
0.0 | 0.3 | REACTOME INTERFERON SIGNALING | Genes involved in Interferon Signaling |
0.0 | 0.2 | REACTOME LIGAND GATED ION CHANNEL TRANSPORT | Genes involved in Ligand-gated ion channel transport |
0.0 | 0.4 | REACTOME SYNTHESIS SECRETION AND INACTIVATION OF GLP1 | Genes involved in Synthesis, Secretion, and Inactivation of Glucagon-like Peptide-1 (GLP-1) |
0.0 | 0.1 | REACTOME FORMATION OF TRANSCRIPTION COUPLED NER TC NER REPAIR COMPLEX | Genes involved in Formation of transcription-coupled NER (TC-NER) repair complex |
0.0 | 0.1 | REACTOME REGULATION OF SIGNALING BY CBL | Genes involved in Regulation of signaling by CBL |
0.0 | 0.1 | REACTOME SIGNALING BY CONSTITUTIVELY ACTIVE EGFR | Genes involved in Signaling by constitutively active EGFR |
0.0 | 0.0 | REACTOME INSULIN RECEPTOR RECYCLING | Genes involved in Insulin receptor recycling |
0.0 | 0.1 | REACTOME OLFACTORY SIGNALING PATHWAY | Genes involved in Olfactory Signaling Pathway |
0.0 | 0.1 | REACTOME G ALPHA Z SIGNALLING EVENTS | Genes involved in G alpha (z) signalling events |
0.0 | 0.4 | REACTOME CD28 DEPENDENT PI3K AKT SIGNALING | Genes involved in CD28 dependent PI3K/Akt signaling |
0.0 | 0.1 | REACTOME ACTIVATION OF CHAPERONES BY ATF6 ALPHA | Genes involved in Activation of Chaperones by ATF6-alpha |
0.0 | 0.3 | REACTOME CITRIC ACID CYCLE TCA CYCLE | Genes involved in Citric acid cycle (TCA cycle) |
0.0 | 0.4 | REACTOME METAL ION SLC TRANSPORTERS | Genes involved in Metal ion SLC transporters |
0.0 | 0.2 | REACTOME HYALURONAN METABOLISM | Genes involved in Hyaluronan metabolism |
0.0 | 0.5 | REACTOME STEROID HORMONES | Genes involved in Steroid hormones |
0.0 | 0.1 | REACTOME INHIBITION OF REPLICATION INITIATION OF DAMAGED DNA BY RB1 E2F1 | Genes involved in Inhibition of replication initiation of damaged DNA by RB1/E2F1 |
0.0 | 0.1 | REACTOME IL 7 SIGNALING | Genes involved in Interleukin-7 signaling |
0.0 | 0.1 | REACTOME NOREPINEPHRINE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Norepinephrine Neurotransmitter Release Cycle |
0.0 | 0.3 | REACTOME METABOLISM OF POLYAMINES | Genes involved in Metabolism of polyamines |
0.0 | 0.3 | REACTOME TIE2 SIGNALING | Genes involved in Tie2 Signaling |
0.0 | 0.1 | REACTOME INTEGRATION OF PROVIRUS | Genes involved in Integration of provirus |
0.0 | 0.0 | REACTOME P53 INDEPENDENT G1 S DNA DAMAGE CHECKPOINT | Genes involved in p53-Independent G1/S DNA damage checkpoint |
0.0 | 0.3 | REACTOME BRANCHED CHAIN AMINO ACID CATABOLISM | Genes involved in Branched-chain amino acid catabolism |
0.0 | 0.2 | REACTOME AMINO ACID SYNTHESIS AND INTERCONVERSION TRANSAMINATION | Genes involved in Amino acid synthesis and interconversion (transamination) |
0.0 | 0.4 | REACTOME CYTOSOLIC TRNA AMINOACYLATION | Genes involved in Cytosolic tRNA aminoacylation |
0.0 | 0.0 | REACTOME DOWNSTREAM SIGNALING EVENTS OF B CELL RECEPTOR BCR | Genes involved in Downstream Signaling Events Of B Cell Receptor (BCR) |
0.0 | 0.1 | REACTOME BETA DEFENSINS | Genes involved in Beta defensins |
0.0 | 0.3 | REACTOME G1 PHASE | Genes involved in G1 Phase |
0.0 | 0.6 | REACTOME ACTIVATION OF CHAPERONE GENES BY XBP1S | Genes involved in Activation of Chaperone Genes by XBP1(S) |
0.0 | 0.1 | REACTOME PYRUVATE METABOLISM | Genes involved in Pyruvate metabolism |
0.0 | 0.1 | REACTOME PURINE RIBONUCLEOSIDE MONOPHOSPHATE BIOSYNTHESIS | Genes involved in Purine ribonucleoside monophosphate biosynthesis |
0.0 | 0.1 | REACTOME TRANSLOCATION OF ZAP 70 TO IMMUNOLOGICAL SYNAPSE | Genes involved in Translocation of ZAP-70 to Immunological synapse |
0.0 | 0.3 | REACTOME NEGATIVE REGULATORS OF RIG I MDA5 SIGNALING | Genes involved in Negative regulators of RIG-I/MDA5 signaling |
0.0 | 0.2 | REACTOME CGMP EFFECTS | Genes involved in cGMP effects |
0.0 | 0.0 | REACTOME VIF MEDIATED DEGRADATION OF APOBEC3G | Genes involved in Vif-mediated degradation of APOBEC3G |
0.0 | 0.1 | REACTOME RNA POL III TRANSCRIPTION INITIATION FROM TYPE 2 PROMOTER | Genes involved in RNA Polymerase III Transcription Initiation From Type 2 Promoter |
0.0 | 0.0 | REACTOME SCFSKP2 MEDIATED DEGRADATION OF P27 P21 | Genes involved in SCF(Skp2)-mediated degradation of p27/p21 |
0.0 | 0.1 | REACTOME CHYLOMICRON MEDIATED LIPID TRANSPORT | Genes involved in Chylomicron-mediated lipid transport |
0.0 | 0.0 | REACTOME DOWNSTREAM TCR SIGNALING | Genes involved in Downstream TCR signaling |
0.0 | 0.1 | REACTOME IL 6 SIGNALING | Genes involved in Interleukin-6 signaling |
0.0 | 0.1 | REACTOME INTERFERON GAMMA SIGNALING | Genes involved in Interferon gamma signaling |
0.0 | 0.1 | REACTOME TRAFFICKING OF AMPA RECEPTORS | Genes involved in Trafficking of AMPA receptors |
0.0 | 0.2 | REACTOME IL1 SIGNALING | Genes involved in Interleukin-1 signaling |
0.0 | 0.0 | REACTOME TRAF6 MEDIATED IRF7 ACTIVATION IN TLR7 8 OR 9 SIGNALING | Genes involved in TRAF6 mediated IRF7 activation in TLR7/8 or 9 signaling |