| Gene Symbol | Gene ID | Gene Info |
|---|---|---|
|
Nkx6-3
|
ENSMUSG00000063672.6 | NK6 homeobox 3 |
|
Dbx2
|
ENSMUSG00000045608.6 | developing brain homeobox 2 |
|
Barx2
|
ENSMUSG00000032033.10 | BarH-like homeobox 2 |
| CRE | Gene | Distance | Association probability | Pearson corr. coef. | P-value | Plot |
|---|---|---|---|---|---|---|
| chr9_31919929_31920080 | Barx2 | 6542 | 0.158850 | -0.62 | 3.5e-07 | Click! |
| chr9_31913213_31913364 | Barx2 | 174 | 0.938213 | -0.42 | 1.2e-03 | Click! |
| chr9_31912952_31913207 | Barx2 | 383 | 0.829315 | -0.35 | 8.7e-03 | Click! |
| chr15_95667295_95667446 | Dbx2 | 11410 | 0.184123 | 0.19 | 1.6e-01 | Click! |
| chr15_95660487_95660656 | Dbx2 | 4611 | 0.220554 | 0.16 | 2.4e-01 | Click! |
| chr15_95639538_95639779 | Dbx2 | 6830 | 0.208271 | -0.14 | 3.0e-01 | Click! |
| chr15_95640522_95640729 | Dbx2 | 7797 | 0.203960 | 0.06 | 6.4e-01 | Click! |
| chr8_23166259_23166410 | Nkx6-3 | 13065 | 0.094142 | -0.55 | 1.4e-05 | Click! |
| chr8_23157427_23157620 | Nkx6-3 | 4254 | 0.114541 | -0.09 | 5.1e-01 | Click! |
| chr8_23164771_23164922 | Nkx6-3 | 11577 | 0.095480 | -0.08 | 5.6e-01 | Click! |
| chr8_23157648_23157885 | Nkx6-3 | 4497 | 0.112465 | -0.07 | 6.1e-01 | Click! |
| chr8_23158017_23158168 | Nkx6-3 | 4823 | 0.110139 | -0.07 | 6.3e-01 | Click! |
Move your cursor over a bar to see sample name and corresponding Z-value.
| Cis Regulatory Element (CRE) | Target Score | Top associated gene | Gene Info | Distance of CRE to TSS | CRE/Gene association probability |
|---|---|---|---|---|---|
| chr5_150894457_150894771 | 9.68 |
Gm43298 |
predicted gene 43298 |
11972 |
0.2 |
| chr8_31895464_31895660 | 9.13 |
Nrg1 |
neuregulin 1 |
8976 |
0.25 |
| chr18_39828001_39828152 | 6.87 |
Pabpc2 |
poly(A) binding protein, cytoplasmic 2 |
54579 |
0.14 |
| chr18_28901621_28901954 | 6.59 |
Gm33948 |
predicted gene, 33948 |
29562 |
0.26 |
| chr3_121201082_121201399 | 6.44 |
Gm5710 |
predicted gene 5710 |
20143 |
0.13 |
| chr3_141952957_141953255 | 6.35 |
Bmpr1b |
bone morphogenetic protein receptor, type 1B |
21583 |
0.27 |
| chr13_43269582_43269733 | 6.31 |
Gfod1 |
glucose-fructose oxidoreductase domain containing 1 |
33748 |
0.17 |
| chr13_43950070_43950222 | 6.29 |
Gm2233 |
predicted gene 2233 |
1267 |
0.5 |
| chr14_103613671_103614004 | 5.48 |
Slain1 |
SLAIN motif family, member 1 |
36391 |
0.16 |
| chr2_134003402_134003565 | 5.45 |
Gm25258 |
predicted gene, 25258 |
419062 |
0.01 |
| chr2_21963760_21964435 | 5.35 |
Gm13337 |
predicted gene 13337 |
103729 |
0.08 |
| chr7_73354299_73354479 | 5.20 |
Rgma |
repulsive guidance molecule family member A |
21120 |
0.13 |
| chr5_77888510_77888967 | 5.12 |
Gm42673 |
predicted gene 42673 |
20722 |
0.27 |
| chr9_67840491_67840890 | 5.10 |
Vps13c |
vacuolar protein sorting 13C |
278 |
0.91 |
| chr7_30493398_30493713 | 5.00 |
Prodh2 |
proline dehydrogenase (oxidase) 2 |
67 |
0.91 |
| chr14_22679666_22680655 | 4.99 |
Lrmda |
leucine rich melanocyte differentiation associated |
83647 |
0.09 |
| chr9_115403468_115403626 | 4.96 |
Gm9487 |
predicted gene 9487 |
1602 |
0.28 |
| chr2_79152361_79152739 | 4.93 |
Gm14465 |
predicted gene 14465 |
9045 |
0.26 |
| chr16_62686085_62686411 | 4.93 |
Gm9816 |
predicted pseudogene 9816 |
30789 |
0.18 |
| chr8_126736428_126737199 | 4.87 |
Gm45805 |
predicted gene 45805 |
21521 |
0.23 |
| chr16_63747767_63748162 | 4.86 |
Gm22769 |
predicted gene, 22769 |
430 |
0.91 |
| chr1_126391091_126391421 | 4.84 |
Nckap5 |
NCK-associated protein 5 |
57200 |
0.15 |
| chr14_48418768_48419083 | 4.74 |
Gm3534 |
predicted pseudogene 3534 |
10307 |
0.15 |
| chr9_99098586_99098851 | 4.68 |
Pik3cb |
phosphatidylinositol-4,5-bisphosphate 3-kinase catalytic subunit beta |
41207 |
0.12 |
| chr17_6978229_6979658 | 4.67 |
Rnaset2b |
ribonuclease T2B |
15 |
0.51 |
| chr1_21660699_21661216 | 4.64 |
Gm7658 |
predicted gene 7658 |
147901 |
0.04 |
| chr16_25293836_25294037 | 4.62 |
Tprg |
transformation related protein 63 regulated |
7115 |
0.32 |
| chrX_109845362_109845527 | 4.59 |
Gm4991 |
predicted gene 4991 |
64777 |
0.15 |
| chr19_56476541_56476761 | 4.49 |
Plekhs1 |
pleckstrin homology domain containing, family S member 1 |
2250 |
0.3 |
| chr12_72437630_72438246 | 4.38 |
Lrrc9 |
leucine rich repeat containing 9 |
3928 |
0.24 |
| chr17_71976866_71977017 | 4.32 |
Gm49924 |
predicted gene, 49924 |
49911 |
0.16 |
| chr1_186505235_186505386 | 4.29 |
A730004F24Rik |
RIKEN cDNA A730004F24 gene |
53162 |
0.15 |
| chr7_66120706_66121000 | 4.28 |
Gm23042 |
predicted gene, 23042 |
1450 |
0.29 |
| chr18_64492858_64493138 | 4.27 |
Fech |
ferrochelatase |
2747 |
0.22 |
| chr11_98339036_98339432 | 4.14 |
Ppp1r1b |
protein phosphatase 1, regulatory inhibitor subunit 1B |
9170 |
0.09 |
| chr9_70934534_70934685 | 4.13 |
Lipc |
lipase, hepatic |
4 |
0.98 |
| chr19_55110604_55110837 | 4.12 |
Gpam |
glycerol-3-phosphate acyltransferase, mitochondrial |
7629 |
0.21 |
| chr6_9834968_9835442 | 4.06 |
Gm5110 |
predicted gene 5110 |
337649 |
0.01 |
| chr2_63970238_63970568 | 4.04 |
Fign |
fidgetin |
127585 |
0.06 |
| chr7_19744712_19745296 | 3.97 |
Nectin2 |
nectin cell adhesion molecule 2 |
4529 |
0.08 |
| chr17_8147042_8147995 | 3.97 |
Rnaset2a |
ribonuclease T2A |
267 |
0.48 |
| chr4_71230174_71230407 | 3.93 |
Gm11229 |
predicted gene 11229 |
55652 |
0.15 |
| chr3_143078355_143078668 | 3.93 |
Gm43614 |
predicted gene 43614 |
29437 |
0.18 |
| chr6_54552680_54553127 | 3.89 |
Scrn1 |
secernin 1 |
1543 |
0.37 |
| chr18_69500148_69500331 | 3.86 |
Tcf4 |
transcription factor 4 |
431 |
0.89 |
| chr10_119761963_119762114 | 3.86 |
Grip1os2 |
glutamate receptor interacting protein 1, opposite strand 2 |
339 |
0.91 |
| chr12_41727156_41727860 | 3.83 |
Gm47369 |
predicted gene, 47369 |
43114 |
0.18 |
| chr18_69608471_69608657 | 3.83 |
Tcf4 |
transcription factor 4 |
3880 |
0.32 |
| chr2_153680788_153680939 | 3.83 |
Dnmt3b |
DNA methyltransferase 3B |
11493 |
0.15 |
| chr15_55196495_55196646 | 3.82 |
Deptor |
DEP domain containing MTOR-interacting protein |
63117 |
0.09 |
| chr9_69844842_69845170 | 3.81 |
Gm18745 |
predicted gene, 18745 |
51855 |
0.13 |
| chr2_115250082_115250233 | 3.81 |
Gm28494 |
predicted gene 28494 |
29449 |
0.21 |
| chr12_105898639_105899296 | 3.74 |
Gm19554 |
predicted gene, 19554 |
874 |
0.59 |
| chr6_16942654_16942860 | 3.73 |
Gm5721 |
predicted gene 5721 |
17526 |
0.22 |
| chr2_6618574_6618725 | 3.72 |
Celf2 |
CUGBP, Elav-like family member 2 |
2469 |
0.4 |
| chr8_124070398_124070813 | 3.66 |
Gm45732 |
predicted gene 45732 |
22193 |
0.12 |
| chr19_14301460_14301660 | 3.64 |
Gm26993 |
predicted gene, 26993 |
283189 |
0.01 |
| chr7_125112792_125113319 | 3.63 |
Glud-ps |
glutamate dehydrogenase, pseudogene |
37704 |
0.17 |
| chr12_44403738_44404185 | 3.61 |
Gm48182 |
predicted gene, 48182 |
5829 |
0.21 |
| chr7_82396135_82396286 | 3.60 |
Adamtsl3 |
ADAMTS-like 3 |
12264 |
0.23 |
| chr16_84806314_84806478 | 3.60 |
Jam2 |
junction adhesion molecule 2 |
3011 |
0.18 |
| chr2_27758377_27758794 | 3.58 |
Rxra |
retinoid X receptor alpha |
18384 |
0.24 |
| chr8_12547924_12548627 | 3.58 |
Spaca7 |
sperm acrosome associated 7 |
24754 |
0.14 |
| chr12_16008904_16009145 | 3.56 |
Gm36235 |
predicted gene, 36235 |
6521 |
0.23 |
| chr14_91582068_91582354 | 3.55 |
Gm48942 |
predicted gene, 48942 |
65628 |
0.14 |
| chr2_32606591_32606779 | 3.50 |
St6galnac6 |
ST6 (alpha-N-acetyl-neuraminyl-2,3-beta-galactosyl-1,3)-N-acetylgalactosaminide alpha-2,6-sialyltransferase 6 |
276 |
0.79 |
| chr2_97524376_97524558 | 3.50 |
Lrrc4c |
leucine rich repeat containing 4C |
56378 |
0.16 |
| chr1_41275340_41275552 | 3.48 |
4930448I06Rik |
RIKEN cDNA 4930448I06 gene |
94194 |
0.09 |
| chr8_114512201_114512378 | 3.46 |
Wwox |
WW domain-containing oxidoreductase |
64079 |
0.11 |
| chr18_90094273_90094424 | 3.41 |
Gm6173 |
predicted gene 6173 |
75269 |
0.11 |
| chr12_91551955_91552294 | 3.40 |
Tshr |
thyroid stimulating hormone receptor |
14058 |
0.16 |
| chr5_17969805_17969962 | 3.37 |
Gnat3 |
guanine nucleotide binding protein, alpha transducing 3 |
7334 |
0.31 |
| chr15_91377638_91377789 | 3.35 |
Slc2a13 |
solute carrier family 2 (facilitated glucose transporter), member 13 |
34504 |
0.2 |
| chr13_99444397_99444879 | 3.33 |
Map1b |
microtubule-associated protein 1B |
171 |
0.95 |
| chr17_89090010_89090391 | 3.32 |
Fshr |
follicle stimulating hormone receptor |
110475 |
0.07 |
| chr3_5326430_5327011 | 3.30 |
Zfhx4 |
zinc finger homeodomain 4 |
85048 |
0.09 |
| chr3_127646099_127646733 | 3.26 |
Neurog2 |
neurogenin 2 |
13281 |
0.12 |
| chr8_99414741_99415068 | 3.25 |
Cdh8 |
cadherin 8 |
1415 |
0.4 |
| chr1_189185584_189185735 | 3.24 |
2900042K21Rik |
RIKEN cDNA 2900042K21 gene |
25354 |
0.18 |
| chr5_53152094_53152248 | 3.24 |
Sel1l3 |
sel-1 suppressor of lin-12-like 3 (C. elegans) |
4509 |
0.22 |
| chr15_30285594_30286020 | 3.22 |
Ctnnd2 |
catenin (cadherin associated protein), delta 2 |
112669 |
0.06 |
| chr12_92589210_92589401 | 3.22 |
Gm18500 |
predicted gene, 18500 |
115344 |
0.07 |
| chr13_94376190_94376445 | 3.21 |
Ap3b1 |
adaptor-related protein complex 3, beta 1 subunit |
17357 |
0.17 |
| chr5_44580014_44580183 | 3.21 |
Gm43505 |
predicted gene 43505 |
4965 |
0.16 |
| chr18_56871340_56871513 | 3.20 |
Gm18087 |
predicted gene, 18087 |
44662 |
0.14 |
| chr10_125175367_125175548 | 3.20 |
Slc16a7 |
solute carrier family 16 (monocarboxylic acid transporters), member 7 |
133359 |
0.05 |
| chr18_40059274_40059425 | 3.19 |
Gm50395 |
predicted gene, 50395 |
50384 |
0.16 |
| chr13_44100199_44100380 | 3.18 |
Gm33630 |
predicted gene, 33630 |
329 |
0.89 |
| chr5_25652364_25652515 | 3.16 |
Gm43972 |
predicted gene, 43972 |
7370 |
0.15 |
| chr9_66933818_66934187 | 3.16 |
Rps27l |
ribosomal protein S27-like |
12084 |
0.15 |
| chr13_43480925_43481874 | 3.14 |
Ranbp9 |
RAN binding protein 9 |
117 |
0.95 |
| chr3_35084508_35084772 | 3.14 |
Mir6378 |
microRNA 6378 |
161989 |
0.03 |
| chr17_16493654_16493969 | 3.12 |
Gm4786 |
predicted gene 4786 |
63435 |
0.14 |
| chr18_54281977_54282154 | 3.11 |
Redrum |
Redrum, erythroid developmental long intergenic non-protein coding transcript |
140230 |
0.05 |
| chr19_59054013_59054339 | 3.08 |
Shtn1 |
shootin 1 |
15891 |
0.18 |
| chr4_132129197_132129583 | 3.07 |
Oprd1 |
opioid receptor, delta 1 |
15096 |
0.1 |
| chr1_194630781_194630934 | 3.06 |
Plxna2 |
plexin A2 |
11032 |
0.18 |
| chr10_70458638_70458831 | 3.05 |
Fam13c |
family with sequence similarity 13, member C |
17808 |
0.19 |
| chr5_85571496_85571691 | 3.03 |
Gm43567 |
predicted gene 43567 |
149181 |
0.05 |
| chr10_127355403_127355866 | 3.03 |
Inhbe |
inhibin beta-E |
1223 |
0.25 |
| chr3_127652402_127652663 | 3.02 |
Neurog2 |
neurogenin 2 |
19397 |
0.11 |
| chr13_114109901_114110177 | 2.98 |
Gm47479 |
predicted gene, 47479 |
10377 |
0.23 |
| chr15_58591493_58591931 | 2.95 |
Fer1l6 |
fer-1-like 6 (C. elegans) |
46793 |
0.16 |
| chr12_39301929_39302128 | 2.94 |
Gm18591 |
predicted gene, 18591 |
93136 |
0.08 |
| chrX_60545622_60545821 | 2.93 |
Gm715 |
predicted gene 715 |
2298 |
0.23 |
| chr3_55873681_55873832 | 2.93 |
Gm43376 |
predicted gene 43376 |
16550 |
0.19 |
| chr18_44555897_44556220 | 2.90 |
Mcc |
mutated in colorectal cancers |
36542 |
0.19 |
| chr2_103020602_103020954 | 2.90 |
Pdhx |
pyruvate dehydrogenase complex, component X |
52557 |
0.12 |
| chr13_32968268_32968438 | 2.89 |
Serpinb6b |
serine (or cysteine) peptidase inhibitor, clade B, member 6b |
2850 |
0.19 |
| chr7_70381759_70381940 | 2.89 |
B130024G19Rik |
RIKEN cDNA B130024G19 gene |
4644 |
0.14 |
| chr14_93083533_93083684 | 2.88 |
Gm23509 |
predicted gene, 23509 |
54581 |
0.15 |
| chr10_93886358_93886509 | 2.87 |
Metap2 |
methionine aminopeptidase 2 |
1053 |
0.42 |
| chr7_129392977_129393128 | 2.87 |
Gm33027 |
predicted gene, 33027 |
10038 |
0.29 |
| chr6_138424907_138425582 | 2.87 |
Lmo3 |
LIM domain only 3 |
629 |
0.69 |
| chr1_56345109_56345287 | 2.85 |
Gm28900 |
predicted gene 28900 |
106209 |
0.08 |
| chr10_33083669_33083857 | 2.84 |
Trdn |
triadin |
202 |
0.96 |
| chr3_16819794_16819956 | 2.83 |
Gm26485 |
predicted gene, 26485 |
3437 |
0.4 |
| chr17_63807674_63808197 | 2.83 |
Fer |
fer (fms/fps related) protein kinase |
55127 |
0.13 |
| chr12_75062688_75062848 | 2.83 |
Kcnh5 |
potassium voltage-gated channel, subfamily H (eag-related), member 5 |
114564 |
0.07 |
| chr6_85399869_85400020 | 2.82 |
Noto |
notochord homeobox |
23942 |
0.11 |
| chr5_145800955_145801237 | 2.82 |
Cyp3a44 |
cytochrome P450, family 3, subfamily a, polypeptide 44 |
4778 |
0.18 |
| chr1_168268952_168269254 | 2.82 |
Gm37524 |
predicted gene, 37524 |
68568 |
0.12 |
| chr7_96865260_96865776 | 2.82 |
Gm25712 |
predicted gene, 25712 |
2139 |
0.28 |
| chr9_55511545_55512716 | 2.80 |
Etfa |
electron transferring flavoprotein, alpha polypeptide |
10 |
0.97 |
| chr10_57114708_57114862 | 2.80 |
Gm40652 |
predicted gene, 40652 |
2437 |
0.37 |
| chr9_93778147_93778318 | 2.79 |
Gm47165 |
predicted gene, 47165 |
208658 |
0.03 |
| chr11_47069891_47070050 | 2.77 |
Gm12175 |
predicted gene 12175 |
195557 |
0.03 |
| chr5_53151672_53152044 | 2.76 |
Sel1l3 |
sel-1 suppressor of lin-12-like 3 (C. elegans) |
4822 |
0.21 |
| chr19_59866689_59867059 | 2.76 |
Gm17203 |
predicted gene 17203 |
34188 |
0.18 |
| chr10_13415790_13416203 | 2.74 |
Phactr2 |
phosphatase and actin regulator 2 |
27026 |
0.21 |
| chr8_64734150_64734320 | 2.74 |
Msmo1 |
methylsterol monoxygenase 1 |
443 |
0.8 |
| chr15_34513966_34514205 | 2.74 |
Pop1 |
processing of precursor 1, ribonuclease P/MRP family, (S. cerevisiae) |
85 |
0.95 |
| chr2_163658166_163658878 | 2.73 |
Pkig |
protein kinase inhibitor, gamma |
42 |
0.96 |
| chr8_29544323_29544526 | 2.72 |
Nudc-ps1 |
nuclear distribution gene C homolog (Aspergillus), pseudogene 1 |
257443 |
0.02 |
| chr2_173736867_173737587 | 2.72 |
Vapb |
vesicle-associated membrane protein, associated protein B and C |
284 |
0.88 |
| chr10_17479308_17479459 | 2.71 |
Gm47768 |
predicted gene, 47768 |
35347 |
0.16 |
| chr3_6183428_6183711 | 2.70 |
Gm6162 |
predicted gene 6162 |
15745 |
0.23 |
| chr12_51002047_51002408 | 2.69 |
Gm40421 |
predicted gene, 40421 |
2646 |
0.28 |
| chr9_43929436_43930292 | 2.68 |
Gm23326 |
predicted gene, 23326 |
23862 |
0.12 |
| chr6_58895029_58895188 | 2.67 |
Herc3 |
hect domain and RLD 3 |
5013 |
0.2 |
| chr9_69844583_69844734 | 2.67 |
Gm18745 |
predicted gene, 18745 |
51507 |
0.13 |
| chr1_24005288_24006003 | 2.66 |
Sdhaf4 |
succinate dehydrogenase complex assembly factor 4 |
11 |
0.64 |
| chr1_190220518_190220669 | 2.66 |
Prox1 |
prospero homeobox 1 |
49879 |
0.13 |
| chr6_5110493_5110850 | 2.66 |
Ppp1r9a |
protein phosphatase 1, regulatory subunit 9A |
12 |
0.98 |
| chr12_40991742_40991893 | 2.66 |
Gm18954 |
predicted gene, 18954 |
28435 |
0.15 |
| chr2_156665720_156666088 | 2.66 |
Gm14172 |
predicted gene 14172 |
32436 |
0.1 |
| chr7_114892945_114893154 | 2.63 |
Rps4l-ps |
ribosomal protein S4-like, pseudogene |
34677 |
0.13 |
| chr14_97814674_97814832 | 2.63 |
Gm9290 |
predicted gene 9290 |
148462 |
0.04 |
| chr13_78802557_78802713 | 2.62 |
Gm8345 |
predicted gene 8345 |
152157 |
0.04 |
| chr13_44232185_44232493 | 2.61 |
Gm47781 |
predicted gene, 47781 |
59 |
0.97 |
| chr5_85347012_85347163 | 2.61 |
Gm43567 |
predicted gene 43567 |
373687 |
0.01 |
| chr6_16797726_16798045 | 2.60 |
Gm36669 |
predicted gene, 36669 |
20361 |
0.22 |
| chr8_46294357_46295046 | 2.60 |
Helt |
helt bHLH transcription factor |
30 |
0.95 |
| chr11_62943625_62943776 | 2.59 |
Cdrt4os2 |
CMT1A duplicated region transcript 4, opposite strand 2 |
7379 |
0.14 |
| chr14_97396079_97396266 | 2.59 |
Gm23276 |
predicted gene, 23276 |
59540 |
0.16 |
| chr2_58174412_58174990 | 2.58 |
Gm13546 |
predicted gene 13546 |
4964 |
0.22 |
| chr2_26594675_26595827 | 2.58 |
Egfl7 |
EGF-like domain 7 |
3104 |
0.11 |
| chr13_77396463_77396675 | 2.58 |
Gm9634 |
predicted gene 9634 |
157804 |
0.04 |
| chr15_69923891_69924317 | 2.58 |
Gm19782 |
predicted gene, 19782 |
87519 |
0.1 |
| chr2_68806583_68806798 | 2.57 |
Gm13612 |
predicted gene 13612 |
24327 |
0.15 |
| chr2_114687037_114687197 | 2.57 |
Gm13975 |
predicted gene 13975 |
20995 |
0.19 |
| chr12_50121906_50122523 | 2.55 |
Gm40418 |
predicted gene, 40418 |
1905 |
0.51 |
| chr8_102538158_102538348 | 2.55 |
Gm45422 |
predicted gene 45422 |
3608 |
0.28 |
| chr15_88318097_88318435 | 2.54 |
4930445N06Rik |
RIKEN cDNA 4930445N06 gene |
2634 |
0.31 |
| chr18_66520089_66520586 | 2.53 |
Gm50157 |
predicted gene, 50157 |
2985 |
0.15 |
| chr1_118480880_118481748 | 2.52 |
Clasp1 |
CLIP associating protein 1 |
725 |
0.54 |
| chr16_22950881_22951178 | 2.52 |
Hrg |
histidine-rich glycoprotein |
43 |
0.96 |
| chr10_84286129_84286280 | 2.51 |
Gm5425 |
predicted gene 5425 |
22682 |
0.2 |
| chr10_87501180_87501623 | 2.51 |
Gm48120 |
predicted gene, 48120 |
6461 |
0.19 |
| chr2_56661596_56661747 | 2.51 |
Mir195b |
microRNA 195b |
124140 |
0.06 |
| chr2_79983261_79983608 | 2.48 |
Pde1a |
phosphodiesterase 1A, calmodulin-dependent |
55595 |
0.16 |
| chr19_40660002_40660189 | 2.48 |
Entpd1 |
ectonucleoside triphosphate diphosphohydrolase 1 |
104 |
0.96 |
| chr2_7534710_7534940 | 2.47 |
Gm28641 |
predicted gene 28641 |
4886 |
0.27 |
| chr13_85629971_85630122 | 2.47 |
Gm5666 |
predicted gene 5666 |
56468 |
0.15 |
| chr6_121039410_121039731 | 2.46 |
Mical3 |
microtubule associated monooxygenase, calponin and LIM domain containing 3 |
8810 |
0.17 |
| chr14_86729579_86730133 | 2.46 |
Diaph3 |
diaphanous related formin 3 |
18988 |
0.22 |
| chr2_17742064_17742359 | 2.46 |
Nebl |
nebulette |
10747 |
0.25 |
| chr3_97861202_97861353 | 2.45 |
Pde4dip |
phosphodiesterase 4D interacting protein (myomegalin) |
6920 |
0.19 |
| chr4_53315308_53316054 | 2.44 |
Gm12495 |
predicted gene 12495 |
7455 |
0.21 |
| chr13_78100021_78100517 | 2.44 |
C130051F05Rik |
RIKEN cDNA C130051F05 gene |
12213 |
0.15 |
| chr1_96346717_96347057 | 2.44 |
Gm37076 |
predicted gene, 37076 |
33645 |
0.18 |
| chr13_85126661_85127037 | 2.44 |
Gm4076 |
predicted gene 4076 |
665 |
0.69 |
| chr5_74994963_74995270 | 2.44 |
Gm42577 |
predicted gene 42577 |
6050 |
0.16 |
| chr7_67468944_67469359 | 2.43 |
Gm33926 |
predicted gene, 33926 |
25218 |
0.17 |
| chr7_77824667_77824826 | 2.42 |
Gm23239 |
predicted gene, 23239 |
85574 |
0.11 |
| chr5_140940935_140941441 | 2.42 |
Card11 |
caspase recruitment domain family, member 11 |
58983 |
0.12 |
| chr12_35284144_35284295 | 2.42 |
Gm44396 |
predicted gene, 44396 |
24672 |
0.22 |
| chr8_9482622_9482773 | 2.41 |
4930435N07Rik |
RIKEN cDNA 4930435N07 gene |
23605 |
0.18 |
| chr10_93282734_93282970 | 2.41 |
Elk3 |
ELK3, member of ETS oncogene family |
27959 |
0.14 |
| chr15_85463386_85463550 | 2.40 |
7530416G11Rik |
RIKEN cDNA 7530416G11 gene |
39759 |
0.14 |
| chr16_6962027_6962221 | 2.40 |
Rbfox1 |
RNA binding protein, fox-1 homolog (C. elegans) 1 |
107722 |
0.08 |
| chr10_112876780_112876938 | 2.40 |
Gm3942 |
predicted gene 3942 |
39107 |
0.13 |
| chr16_72897212_72897363 | 2.40 |
Robo1 |
roundabout guidance receptor 1 |
79062 |
0.12 |
| chr1_169066763_169066997 | 2.39 |
Mir6354 |
microRNA 6354 |
47791 |
0.2 |
| chr12_98860624_98860775 | 2.38 |
A930040O22Rik |
RIKEN cDNA A930040O22 gene |
28886 |
0.12 |
| chr16_40652871_40653153 | 2.38 |
Gm27887 |
predicted gene, 27887 |
285075 |
0.01 |
| chr4_82916400_82917026 | 2.37 |
Frem1 |
Fras1 related extracellular matrix protein 1 |
2279 |
0.34 |
| chr5_144309033_144309184 | 2.36 |
Baiap2l1 |
BAI1-associated protein 2-like 1 |
20201 |
0.13 |
| chr2_142164292_142164571 | 2.36 |
Macrod2 |
mono-ADP ribosylhydrolase 2 |
12176 |
0.32 |
| chr9_100599833_100599984 | 2.35 |
Stag1 |
stromal antigen 1 |
2110 |
0.23 |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 1.5 | 4.5 | GO:0006562 | proline catabolic process(GO:0006562) |
| 0.9 | 2.7 | GO:0090158 | endoplasmic reticulum membrane organization(GO:0090158) |
| 0.9 | 4.4 | GO:1901525 | negative regulation of macromitophagy(GO:1901525) |
| 0.8 | 2.4 | GO:0034395 | regulation of transcription from RNA polymerase II promoter in response to iron(GO:0034395) |
| 0.7 | 4.5 | GO:0034382 | chylomicron remnant clearance(GO:0034382) triglyceride-rich lipoprotein particle clearance(GO:0071830) |
| 0.7 | 3.6 | GO:0061669 | spontaneous neurotransmitter secretion(GO:0061669) spontaneous synaptic transmission(GO:0098814) |
| 0.7 | 2.1 | GO:2001170 | negative regulation of ATP biosynthetic process(GO:2001170) |
| 0.7 | 2.0 | GO:1901843 | positive regulation of high voltage-gated calcium channel activity(GO:1901843) |
| 0.7 | 4.6 | GO:0042118 | endothelial cell activation(GO:0042118) |
| 0.6 | 1.9 | GO:0050883 | musculoskeletal movement, spinal reflex action(GO:0050883) |
| 0.6 | 2.4 | GO:0006987 | activation of signaling protein activity involved in unfolded protein response(GO:0006987) |
| 0.5 | 1.6 | GO:1903690 | negative regulation of wound healing, spreading of epidermal cells(GO:1903690) |
| 0.4 | 2.2 | GO:0007171 | activation of transmembrane receptor protein tyrosine kinase activity(GO:0007171) |
| 0.4 | 1.3 | GO:0060448 | dichotomous subdivision of terminal units involved in lung branching(GO:0060448) |
| 0.4 | 2.6 | GO:0016078 | tRNA catabolic process(GO:0016078) |
| 0.4 | 1.3 | GO:1902071 | regulation of hypoxia-inducible factor-1alpha signaling pathway(GO:1902071) |
| 0.4 | 1.7 | GO:0060486 | Clara cell differentiation(GO:0060486) |
| 0.4 | 1.2 | GO:1901078 | negative regulation of relaxation of muscle(GO:1901078) |
| 0.4 | 2.0 | GO:0046836 | glycolipid transport(GO:0046836) |
| 0.4 | 0.8 | GO:1903689 | regulation of wound healing, spreading of epidermal cells(GO:1903689) |
| 0.4 | 3.0 | GO:2000480 | negative regulation of cAMP-dependent protein kinase activity(GO:2000480) |
| 0.4 | 0.7 | GO:0060125 | negative regulation of growth hormone secretion(GO:0060125) |
| 0.3 | 1.3 | GO:0010693 | negative regulation of alkaline phosphatase activity(GO:0010693) |
| 0.3 | 0.6 | GO:0032025 | response to cobalt ion(GO:0032025) |
| 0.3 | 1.0 | GO:0060178 | regulation of exocyst localization(GO:0060178) |
| 0.3 | 3.2 | GO:0009312 | oligosaccharide biosynthetic process(GO:0009312) |
| 0.3 | 1.3 | GO:0019482 | beta-alanine metabolic process(GO:0019482) |
| 0.3 | 3.2 | GO:0047497 | establishment of mitochondrion localization, microtubule-mediated(GO:0034643) mitochondrion transport along microtubule(GO:0047497) |
| 0.3 | 0.3 | GO:1901475 | pyruvate transmembrane transport(GO:1901475) |
| 0.3 | 1.1 | GO:2000741 | positive regulation of mesenchymal stem cell differentiation(GO:2000741) |
| 0.3 | 1.1 | GO:0032488 | Cdc42 protein signal transduction(GO:0032488) |
| 0.3 | 0.8 | GO:0048769 | sarcomerogenesis(GO:0048769) |
| 0.3 | 0.8 | GO:0097374 | sensory neuron axon guidance(GO:0097374) |
| 0.3 | 1.4 | GO:0006686 | sphingomyelin biosynthetic process(GO:0006686) |
| 0.3 | 2.1 | GO:0061732 | mitochondrial acetyl-CoA biosynthetic process from pyruvate(GO:0061732) |
| 0.3 | 0.5 | GO:1902996 | neurofibrillary tangle assembly(GO:1902988) regulation of neurofibrillary tangle assembly(GO:1902996) |
| 0.3 | 0.8 | GO:1901841 | regulation of high voltage-gated calcium channel activity(GO:1901841) |
| 0.3 | 0.8 | GO:0015746 | tricarboxylic acid transport(GO:0006842) citrate transport(GO:0015746) |
| 0.3 | 3.3 | GO:0097154 | GABAergic neuron differentiation(GO:0097154) |
| 0.3 | 1.8 | GO:0031848 | protection from non-homologous end joining at telomere(GO:0031848) |
| 0.3 | 1.8 | GO:0051775 | response to redox state(GO:0051775) |
| 0.2 | 0.7 | GO:0035622 | intrahepatic bile duct development(GO:0035622) |
| 0.2 | 2.0 | GO:0046146 | tetrahydrobiopterin metabolic process(GO:0046146) |
| 0.2 | 0.7 | GO:0097694 | establishment of RNA localization to telomere(GO:0097694) |
| 0.2 | 0.5 | GO:0002331 | pre-B cell allelic exclusion(GO:0002331) |
| 0.2 | 1.0 | GO:0051725 | protein de-ADP-ribosylation(GO:0051725) |
| 0.2 | 1.4 | GO:0006703 | estrogen biosynthetic process(GO:0006703) |
| 0.2 | 0.7 | GO:0032289 | central nervous system myelin formation(GO:0032289) |
| 0.2 | 0.9 | GO:0003383 | apical constriction(GO:0003383) |
| 0.2 | 1.4 | GO:0006307 | DNA dealkylation involved in DNA repair(GO:0006307) |
| 0.2 | 0.7 | GO:0006982 | response to lipid hydroperoxide(GO:0006982) |
| 0.2 | 1.2 | GO:0001561 | fatty acid alpha-oxidation(GO:0001561) |
| 0.2 | 0.2 | GO:0070235 | regulation of activation-induced cell death of T cells(GO:0070235) |
| 0.2 | 1.6 | GO:2000794 | regulation of epithelial cell proliferation involved in lung morphogenesis(GO:2000794) |
| 0.2 | 0.9 | GO:0050904 | diapedesis(GO:0050904) |
| 0.2 | 1.1 | GO:0070236 | negative regulation of activation-induced cell death of T cells(GO:0070236) |
| 0.2 | 0.7 | GO:0061368 | behavioral response to chemical pain(GO:0061366) behavioral response to formalin induced pain(GO:0061368) |
| 0.2 | 0.6 | GO:0097167 | circadian regulation of translation(GO:0097167) |
| 0.2 | 0.6 | GO:0046544 | development of secondary male sexual characteristics(GO:0046544) |
| 0.2 | 0.8 | GO:0008228 | opsonization(GO:0008228) |
| 0.2 | 1.0 | GO:0071698 | olfactory placode formation(GO:0030910) olfactory placode development(GO:0071698) olfactory placode morphogenesis(GO:0071699) |
| 0.2 | 1.0 | GO:0006348 | chromatin silencing at telomere(GO:0006348) |
| 0.2 | 1.0 | GO:1903887 | motile primary cilium assembly(GO:1903887) |
| 0.2 | 0.6 | GO:0007161 | calcium-independent cell-matrix adhesion(GO:0007161) |
| 0.2 | 1.0 | GO:0046984 | regulation of hemoglobin biosynthetic process(GO:0046984) |
| 0.2 | 1.0 | GO:0071918 | urea transmembrane transport(GO:0071918) |
| 0.2 | 4.5 | GO:0006376 | mRNA splice site selection(GO:0006376) |
| 0.2 | 1.2 | GO:0050916 | sensory perception of sweet taste(GO:0050916) |
| 0.2 | 0.6 | GO:0097155 | fasciculation of sensory neuron axon(GO:0097155) |
| 0.2 | 0.8 | GO:0060528 | secretory columnal luminar epithelial cell differentiation involved in prostate glandular acinus development(GO:0060528) |
| 0.2 | 0.8 | GO:0046499 | S-adenosylmethioninamine metabolic process(GO:0046499) |
| 0.2 | 0.6 | GO:0055005 | ventricular cardiac myofibril assembly(GO:0055005) |
| 0.2 | 1.7 | GO:0021796 | cerebral cortex regionalization(GO:0021796) |
| 0.2 | 1.7 | GO:0045161 | neuronal ion channel clustering(GO:0045161) |
| 0.2 | 0.6 | GO:0046292 | formaldehyde metabolic process(GO:0046292) |
| 0.2 | 0.4 | GO:1902953 | positive regulation of ER to Golgi vesicle-mediated transport(GO:1902953) |
| 0.2 | 0.2 | GO:0051890 | regulation of cardioblast differentiation(GO:0051890) |
| 0.2 | 0.7 | GO:0030916 | otic vesicle formation(GO:0030916) |
| 0.2 | 0.4 | GO:0038128 | ERBB2 signaling pathway(GO:0038128) |
| 0.2 | 0.4 | GO:0021855 | hypothalamus cell migration(GO:0021855) |
| 0.2 | 0.2 | GO:0071280 | cellular response to copper ion(GO:0071280) |
| 0.2 | 0.7 | GO:0090080 | positive regulation of MAPKKK cascade by fibroblast growth factor receptor signaling pathway(GO:0090080) |
| 0.2 | 0.5 | GO:0097066 | response to thyroid hormone(GO:0097066) |
| 0.2 | 0.4 | GO:0035790 | platelet-derived growth factor receptor-alpha signaling pathway(GO:0035790) |
| 0.2 | 1.2 | GO:2000096 | positive regulation of Wnt signaling pathway, planar cell polarity pathway(GO:2000096) |
| 0.2 | 0.5 | GO:0097114 | NMDA glutamate receptor clustering(GO:0097114) |
| 0.2 | 0.8 | GO:2000809 | positive regulation of synaptic vesicle clustering(GO:2000809) |
| 0.2 | 1.5 | GO:0018206 | peptidyl-methionine modification(GO:0018206) |
| 0.2 | 0.5 | GO:0071504 | response to heparin(GO:0071503) cellular response to heparin(GO:0071504) |
| 0.2 | 0.5 | GO:0007525 | somatic muscle development(GO:0007525) |
| 0.2 | 1.5 | GO:0072102 | glomerulus morphogenesis(GO:0072102) |
| 0.2 | 0.3 | GO:2000173 | negative regulation of branching morphogenesis of a nerve(GO:2000173) |
| 0.2 | 0.5 | GO:0035964 | COPI-coated vesicle budding(GO:0035964) |
| 0.2 | 1.0 | GO:1904322 | response to forskolin(GO:1904321) cellular response to forskolin(GO:1904322) |
| 0.2 | 0.5 | GO:0006768 | biotin metabolic process(GO:0006768) |
| 0.2 | 0.8 | GO:0046487 | glyoxylate metabolic process(GO:0046487) |
| 0.2 | 1.0 | GO:0072711 | response to hydroxyurea(GO:0072710) cellular response to hydroxyurea(GO:0072711) |
| 0.2 | 0.5 | GO:0070164 | negative regulation of adiponectin secretion(GO:0070164) |
| 0.2 | 0.8 | GO:0000972 | transcription-dependent tethering of RNA polymerase II gene DNA at nuclear periphery(GO:0000972) |
| 0.2 | 0.6 | GO:0030091 | protein repair(GO:0030091) |
| 0.2 | 0.6 | GO:0010724 | regulation of definitive erythrocyte differentiation(GO:0010724) |
| 0.2 | 1.1 | GO:0021860 | pyramidal neuron development(GO:0021860) |
| 0.2 | 0.5 | GO:1900245 | positive regulation of MDA-5 signaling pathway(GO:1900245) |
| 0.2 | 1.4 | GO:0031468 | nuclear envelope reassembly(GO:0031468) |
| 0.2 | 0.3 | GO:0021938 | smoothened signaling pathway involved in regulation of cerebellar granule cell precursor cell proliferation(GO:0021938) |
| 0.2 | 0.6 | GO:0021960 | anterior commissure morphogenesis(GO:0021960) |
| 0.2 | 1.2 | GO:0021785 | branchiomotor neuron axon guidance(GO:0021785) |
| 0.2 | 0.6 | GO:0070125 | mitochondrial translational elongation(GO:0070125) |
| 0.1 | 2.1 | GO:0042359 | vitamin D metabolic process(GO:0042359) |
| 0.1 | 0.6 | GO:0006538 | glutamate catabolic process(GO:0006538) |
| 0.1 | 0.6 | GO:1903215 | negative regulation of protein targeting to mitochondrion(GO:1903215) |
| 0.1 | 0.4 | GO:0030423 | targeting of mRNA for destruction involved in RNA interference(GO:0030423) |
| 0.1 | 0.6 | GO:0051919 | positive regulation of fibrinolysis(GO:0051919) |
| 0.1 | 2.0 | GO:0006895 | Golgi to endosome transport(GO:0006895) |
| 0.1 | 0.4 | GO:0003241 | growth involved in heart morphogenesis(GO:0003241) |
| 0.1 | 0.4 | GO:0035247 | peptidyl-arginine methylation, to asymmetrical-dimethyl arginine(GO:0019919) peptidyl-arginine omega-N-methylation(GO:0035247) |
| 0.1 | 0.4 | GO:0035609 | C-terminal protein deglutamylation(GO:0035609) |
| 0.1 | 0.6 | GO:0044004 | killing by symbiont of host cells(GO:0001907) disruption by symbiont of host cell(GO:0044004) |
| 0.1 | 0.1 | GO:0006106 | fumarate metabolic process(GO:0006106) |
| 0.1 | 0.6 | GO:0006627 | protein processing involved in protein targeting to mitochondrion(GO:0006627) |
| 0.1 | 0.7 | GO:1990000 | amyloid fibril formation(GO:1990000) |
| 0.1 | 0.7 | GO:0045719 | negative regulation of glycogen biosynthetic process(GO:0045719) |
| 0.1 | 0.5 | GO:0021869 | forebrain ventricular zone progenitor cell division(GO:0021869) |
| 0.1 | 0.1 | GO:0051660 | establishment of centrosome localization(GO:0051660) |
| 0.1 | 0.4 | GO:1904193 | cholangiocyte apoptotic process(GO:1902488) regulation of cholangiocyte apoptotic process(GO:1904192) negative regulation of cholangiocyte apoptotic process(GO:1904193) |
| 0.1 | 0.4 | GO:0030397 | membrane disassembly(GO:0030397) nuclear envelope disassembly(GO:0051081) |
| 0.1 | 2.4 | GO:0033539 | fatty acid beta-oxidation using acyl-CoA dehydrogenase(GO:0033539) |
| 0.1 | 0.4 | GO:0031086 | nuclear-transcribed mRNA catabolic process, deadenylation-independent decay(GO:0031086) deadenylation-independent decapping of nuclear-transcribed mRNA(GO:0031087) |
| 0.1 | 0.4 | GO:0042414 | epinephrine metabolic process(GO:0042414) |
| 0.1 | 0.5 | GO:0048003 | antigen processing and presentation of lipid antigen via MHC class Ib(GO:0048003) antigen processing and presentation, exogenous lipid antigen via MHC class Ib(GO:0048007) |
| 0.1 | 0.4 | GO:0060266 | negative regulation of respiratory burst involved in inflammatory response(GO:0060266) |
| 0.1 | 0.1 | GO:0021564 | vagus nerve development(GO:0021564) |
| 0.1 | 0.5 | GO:0018343 | protein farnesylation(GO:0018343) |
| 0.1 | 0.6 | GO:0006642 | triglyceride mobilization(GO:0006642) |
| 0.1 | 0.5 | GO:0046125 | pyrimidine deoxyribonucleoside metabolic process(GO:0046125) |
| 0.1 | 0.2 | GO:0006714 | sesquiterpenoid metabolic process(GO:0006714) |
| 0.1 | 0.2 | GO:0000957 | mitochondrial RNA catabolic process(GO:0000957) regulation of mitochondrial RNA catabolic process(GO:0000960) |
| 0.1 | 0.6 | GO:0018230 | peptidyl-L-cysteine S-palmitoylation(GO:0018230) peptidyl-S-diacylglycerol-L-cysteine biosynthetic process from peptidyl-cysteine(GO:0018231) |
| 0.1 | 0.4 | GO:0045218 | zonula adherens maintenance(GO:0045218) |
| 0.1 | 0.2 | GO:0061642 | chemoattraction of axon(GO:0061642) |
| 0.1 | 0.3 | GO:0099558 | maintenance of synapse structure(GO:0099558) |
| 0.1 | 1.7 | GO:0007190 | activation of adenylate cyclase activity(GO:0007190) |
| 0.1 | 0.2 | GO:0052041 | negative regulation by symbiont of host apoptotic process(GO:0033668) modulation of programmed cell death in other organism(GO:0044531) modulation of apoptotic process in other organism(GO:0044532) modulation by symbiont of host programmed cell death(GO:0052040) negative regulation by symbiont of host programmed cell death(GO:0052041) modulation by symbiont of host apoptotic process(GO:0052150) modulation of programmed cell death in other organism involved in symbiotic interaction(GO:0052248) modulation by organism of apoptotic process in other organism involved in symbiotic interaction(GO:0052433) negative regulation by organism of programmed cell death in other organism involved in symbiotic interaction(GO:0052490) |
| 0.1 | 0.5 | GO:0019276 | UDP-N-acetylgalactosamine metabolic process(GO:0019276) |
| 0.1 | 0.3 | GO:0035582 | sequestering of BMP in extracellular matrix(GO:0035582) |
| 0.1 | 0.2 | GO:0097195 | pilomotor reflex(GO:0097195) |
| 0.1 | 0.2 | GO:0009449 | gamma-aminobutyric acid biosynthetic process(GO:0009449) |
| 0.1 | 0.2 | GO:0072718 | response to cisplatin(GO:0072718) |
| 0.1 | 0.1 | GO:0060300 | regulation of cytokine activity(GO:0060300) |
| 0.1 | 0.1 | GO:0051891 | positive regulation of cardioblast differentiation(GO:0051891) |
| 0.1 | 0.6 | GO:0048852 | diencephalon morphogenesis(GO:0048852) |
| 0.1 | 0.6 | GO:0009115 | xanthine catabolic process(GO:0009115) |
| 0.1 | 0.2 | GO:0010535 | positive regulation of activation of JAK2 kinase activity(GO:0010535) |
| 0.1 | 0.3 | GO:0007227 | signal transduction downstream of smoothened(GO:0007227) |
| 0.1 | 0.3 | GO:0044800 | fusion of virus membrane with host plasma membrane(GO:0019064) membrane fusion involved in viral entry into host cell(GO:0039663) multi-organism membrane fusion(GO:0044800) |
| 0.1 | 0.3 | GO:0045896 | regulation of transcription during mitosis(GO:0045896) positive regulation of transcription during mitosis(GO:0045897) |
| 0.1 | 1.1 | GO:0060544 | regulation of necroptotic process(GO:0060544) negative regulation of necroptotic process(GO:0060546) |
| 0.1 | 0.2 | GO:0034447 | very-low-density lipoprotein particle clearance(GO:0034447) |
| 0.1 | 0.5 | GO:1904424 | regulation of GTP binding(GO:1904424) |
| 0.1 | 0.3 | GO:0006701 | progesterone biosynthetic process(GO:0006701) |
| 0.1 | 0.6 | GO:0015671 | oxygen transport(GO:0015671) |
| 0.1 | 0.4 | GO:0061577 | calcium ion transmembrane transport via high voltage-gated calcium channel(GO:0061577) |
| 0.1 | 1.4 | GO:0035278 | miRNA mediated inhibition of translation(GO:0035278) |
| 0.1 | 0.5 | GO:0010891 | negative regulation of sequestering of triglyceride(GO:0010891) |
| 0.1 | 0.4 | GO:0015791 | polyol transport(GO:0015791) |
| 0.1 | 0.4 | GO:0032808 | lacrimal gland development(GO:0032808) |
| 0.1 | 0.3 | GO:1903223 | positive regulation of oxidative stress-induced neuron death(GO:1903223) |
| 0.1 | 0.2 | GO:0048677 | axon extension involved in regeneration(GO:0048677) sprouting of injured axon(GO:0048682) |
| 0.1 | 0.6 | GO:0048681 | negative regulation of axon regeneration(GO:0048681) |
| 0.1 | 0.4 | GO:0006177 | GMP biosynthetic process(GO:0006177) |
| 0.1 | 0.3 | GO:0003330 | regulation of extracellular matrix constituent secretion(GO:0003330) positive regulation of extracellular matrix constituent secretion(GO:0003331) |
| 0.1 | 0.2 | GO:0002536 | respiratory burst involved in inflammatory response(GO:0002536) |
| 0.1 | 0.1 | GO:0034242 | negative regulation of syncytium formation by plasma membrane fusion(GO:0034242) |
| 0.1 | 0.4 | GO:2000052 | positive regulation of non-canonical Wnt signaling pathway(GO:2000052) |
| 0.1 | 0.7 | GO:0045086 | positive regulation of interleukin-2 biosynthetic process(GO:0045086) |
| 0.1 | 2.2 | GO:0061014 | positive regulation of mRNA catabolic process(GO:0061014) |
| 0.1 | 0.6 | GO:0045046 | peroxisomal membrane transport(GO:0015919) protein import into peroxisome membrane(GO:0045046) |
| 0.1 | 0.4 | GO:0038094 | Fc-gamma receptor signaling pathway(GO:0038094) |
| 0.1 | 0.6 | GO:0016266 | O-glycan processing(GO:0016266) |
| 0.1 | 0.3 | GO:0072602 | interleukin-4 secretion(GO:0072602) |
| 0.1 | 0.2 | GO:0002071 | glandular epithelial cell maturation(GO:0002071) |
| 0.1 | 0.4 | GO:0051031 | tRNA transport(GO:0051031) |
| 0.1 | 0.3 | GO:2001032 | regulation of double-strand break repair via nonhomologous end joining(GO:2001032) |
| 0.1 | 0.5 | GO:0045792 | negative regulation of cell size(GO:0045792) |
| 0.1 | 0.3 | GO:1900738 | positive regulation of phospholipase C-activating G-protein coupled receptor signaling pathway(GO:1900738) |
| 0.1 | 0.1 | GO:0021986 | epithalamus development(GO:0021538) habenula development(GO:0021986) |
| 0.1 | 0.4 | GO:0071681 | response to indole-3-methanol(GO:0071680) cellular response to indole-3-methanol(GO:0071681) |
| 0.1 | 1.4 | GO:0001574 | ganglioside biosynthetic process(GO:0001574) |
| 0.1 | 0.9 | GO:0061318 | renal filtration cell differentiation(GO:0061318) glomerular epithelium development(GO:0072010) glomerular visceral epithelial cell differentiation(GO:0072112) glomerular epithelial cell differentiation(GO:0072311) |
| 0.1 | 0.5 | GO:0060605 | tube lumen cavitation(GO:0060605) salivary gland cavitation(GO:0060662) |
| 0.1 | 0.2 | GO:0021943 | formation of radial glial scaffolds(GO:0021943) |
| 0.1 | 0.3 | GO:0042126 | nitrate metabolic process(GO:0042126) |
| 0.1 | 0.4 | GO:0051790 | short-chain fatty acid biosynthetic process(GO:0051790) |
| 0.1 | 0.2 | GO:0007406 | negative regulation of neuroblast proliferation(GO:0007406) |
| 0.1 | 0.7 | GO:0060136 | embryonic process involved in female pregnancy(GO:0060136) |
| 0.1 | 0.5 | GO:0006384 | transcription initiation from RNA polymerase III promoter(GO:0006384) |
| 0.1 | 1.7 | GO:0036342 | post-anal tail morphogenesis(GO:0036342) |
| 0.1 | 0.4 | GO:0060836 | lymphatic endothelial cell differentiation(GO:0060836) |
| 0.1 | 0.7 | GO:0035881 | amacrine cell differentiation(GO:0035881) |
| 0.1 | 1.6 | GO:0015985 | energy coupled proton transport, down electrochemical gradient(GO:0015985) ATP synthesis coupled proton transport(GO:0015986) |
| 0.1 | 0.7 | GO:0071420 | cellular response to histamine(GO:0071420) |
| 0.1 | 0.6 | GO:0035457 | cellular response to interferon-alpha(GO:0035457) |
| 0.1 | 0.1 | GO:0021773 | striatal medium spiny neuron differentiation(GO:0021773) |
| 0.1 | 0.3 | GO:0006432 | phenylalanyl-tRNA aminoacylation(GO:0006432) |
| 0.1 | 0.4 | GO:0060287 | epithelial cilium movement involved in determination of left/right asymmetry(GO:0060287) |
| 0.1 | 0.3 | GO:0019230 | proprioception(GO:0019230) |
| 0.1 | 0.8 | GO:0031536 | positive regulation of exit from mitosis(GO:0031536) |
| 0.1 | 0.3 | GO:2000659 | regulation of interleukin-1-mediated signaling pathway(GO:2000659) |
| 0.1 | 0.1 | GO:1901033 | positive regulation of response to reactive oxygen species(GO:1901033) |
| 0.1 | 0.3 | GO:0090148 | membrane fission(GO:0090148) |
| 0.1 | 0.5 | GO:2000270 | negative regulation of fibroblast apoptotic process(GO:2000270) |
| 0.1 | 0.4 | GO:0009235 | cobalamin metabolic process(GO:0009235) |
| 0.1 | 0.2 | GO:0034370 | triglyceride-rich lipoprotein particle remodeling(GO:0034370) |
| 0.1 | 0.2 | GO:0035526 | retrograde transport, plasma membrane to Golgi(GO:0035526) |
| 0.1 | 0.3 | GO:0010528 | regulation of transposition(GO:0010528) negative regulation of transposition(GO:0010529) |
| 0.1 | 0.2 | GO:0090074 | negative regulation of protein homodimerization activity(GO:0090074) |
| 0.1 | 0.4 | GO:0048496 | maintenance of organ identity(GO:0048496) |
| 0.1 | 0.3 | GO:0051611 | negative regulation of neurotransmitter uptake(GO:0051581) regulation of serotonin uptake(GO:0051611) negative regulation of serotonin uptake(GO:0051612) |
| 0.1 | 0.4 | GO:0042760 | very long-chain fatty acid catabolic process(GO:0042760) |
| 0.1 | 0.2 | GO:0055099 | response to high density lipoprotein particle(GO:0055099) |
| 0.1 | 0.1 | GO:0097475 | motor neuron migration(GO:0097475) spinal cord motor neuron migration(GO:0097476) |
| 0.1 | 0.2 | GO:0000965 | mitochondrial RNA 3'-end processing(GO:0000965) |
| 0.1 | 0.4 | GO:0021957 | corticospinal tract morphogenesis(GO:0021957) |
| 0.1 | 0.5 | GO:1901678 | iron coordination entity transport(GO:1901678) |
| 0.1 | 0.2 | GO:0034241 | positive regulation of macrophage fusion(GO:0034241) |
| 0.1 | 0.2 | GO:0021902 | commitment of neuronal cell to specific neuron type in forebrain(GO:0021902) |
| 0.1 | 0.8 | GO:0034063 | stress granule assembly(GO:0034063) |
| 0.1 | 0.2 | GO:0034421 | post-translational protein acetylation(GO:0034421) |
| 0.1 | 0.4 | GO:0072488 | ammonium transmembrane transport(GO:0072488) |
| 0.1 | 0.6 | GO:0006105 | succinate metabolic process(GO:0006105) |
| 0.1 | 0.6 | GO:1900037 | regulation of cellular response to hypoxia(GO:1900037) |
| 0.1 | 0.2 | GO:0045041 | protein import into mitochondrial intermembrane space(GO:0045041) |
| 0.1 | 0.1 | GO:0043633 | polyadenylation-dependent RNA catabolic process(GO:0043633) polyadenylation-dependent ncRNA catabolic process(GO:0043634) nuclear ncRNA surveillance(GO:0071029) nuclear polyadenylation-dependent rRNA catabolic process(GO:0071035) nuclear polyadenylation-dependent ncRNA catabolic process(GO:0071046) |
| 0.1 | 0.4 | GO:0047484 | regulation of response to osmotic stress(GO:0047484) |
| 0.1 | 0.7 | GO:0034204 | lipid translocation(GO:0034204) phospholipid translocation(GO:0045332) |
| 0.1 | 0.3 | GO:0045653 | negative regulation of megakaryocyte differentiation(GO:0045653) |
| 0.1 | 0.2 | GO:1904526 | regulation of microtubule binding(GO:1904526) positive regulation of microtubule binding(GO:1904528) |
| 0.1 | 0.2 | GO:0046951 | ketone body biosynthetic process(GO:0046951) |
| 0.1 | 0.2 | GO:0052405 | modulation of molecular function in other organism(GO:0044359) negative regulation of molecular function in other organism(GO:0044362) negative regulation of molecular function in other organism involved in symbiotic interaction(GO:0052204) modulation of molecular function in other organism involved in symbiotic interaction(GO:0052205) negative regulation by host of symbiont molecular function(GO:0052405) modification by host of symbiont molecular function(GO:0052428) |
| 0.1 | 0.3 | GO:0033216 | ferric iron import(GO:0033216) ferric iron import into cell(GO:0097461) |
| 0.1 | 0.2 | GO:1903715 | regulation of aerobic respiration(GO:1903715) |
| 0.1 | 0.2 | GO:0042091 | interleukin-10 biosynthetic process(GO:0042091) regulation of interleukin-10 biosynthetic process(GO:0045074) |
| 0.1 | 0.1 | GO:0060971 | embryonic heart tube left/right pattern formation(GO:0060971) |
| 0.1 | 0.7 | GO:0006622 | protein targeting to lysosome(GO:0006622) |
| 0.1 | 0.2 | GO:1902075 | cellular response to salt(GO:1902075) |
| 0.1 | 0.1 | GO:0042360 | vitamin E metabolic process(GO:0042360) |
| 0.1 | 0.6 | GO:0090331 | negative regulation of platelet aggregation(GO:0090331) |
| 0.1 | 0.3 | GO:0072383 | plus-end-directed vesicle transport along microtubule(GO:0072383) plus-end-directed organelle transport along microtubule(GO:0072386) |
| 0.1 | 0.4 | GO:0032792 | negative regulation of CREB transcription factor activity(GO:0032792) |
| 0.1 | 0.3 | GO:0070837 | dehydroascorbic acid transport(GO:0070837) |
| 0.1 | 0.2 | GO:0045964 | positive regulation of catecholamine metabolic process(GO:0045915) positive regulation of dopamine metabolic process(GO:0045964) |
| 0.1 | 0.3 | GO:0010835 | regulation of protein ADP-ribosylation(GO:0010835) |
| 0.1 | 0.3 | GO:0048341 | paraxial mesoderm formation(GO:0048341) |
| 0.1 | 0.1 | GO:2000630 | positive regulation of miRNA metabolic process(GO:2000630) |
| 0.1 | 0.1 | GO:1904706 | negative regulation of vascular smooth muscle cell proliferation(GO:1904706) |
| 0.1 | 0.1 | GO:0097503 | sialylation(GO:0097503) |
| 0.1 | 0.8 | GO:0042407 | cristae formation(GO:0042407) |
| 0.1 | 0.1 | GO:0019626 | short-chain fatty acid catabolic process(GO:0019626) |
| 0.1 | 0.3 | GO:0000707 | meiotic DNA recombinase assembly(GO:0000707) |
| 0.1 | 0.1 | GO:0042891 | antibiotic transport(GO:0042891) |
| 0.1 | 0.1 | GO:0042938 | dipeptide transport(GO:0042938) |
| 0.1 | 0.3 | GO:0007621 | negative regulation of female receptivity(GO:0007621) |
| 0.1 | 0.3 | GO:0044336 | canonical Wnt signaling pathway involved in negative regulation of apoptotic process(GO:0044336) |
| 0.1 | 0.1 | GO:0010911 | regulation of isomerase activity(GO:0010911) positive regulation of isomerase activity(GO:0010912) |
| 0.1 | 0.1 | GO:0001831 | trophectodermal cellular morphogenesis(GO:0001831) |
| 0.1 | 0.4 | GO:0038003 | opioid receptor signaling pathway(GO:0038003) |
| 0.1 | 0.2 | GO:1902287 | semaphorin-plexin signaling pathway involved in neuron projection guidance(GO:1902285) semaphorin-plexin signaling pathway involved in axon guidance(GO:1902287) |
| 0.1 | 0.3 | GO:0090073 | positive regulation of protein homodimerization activity(GO:0090073) |
| 0.1 | 0.2 | GO:1903774 | positive regulation of viral budding via host ESCRT complex(GO:1903774) |
| 0.1 | 0.3 | GO:0035948 | positive regulation of gluconeogenesis by positive regulation of transcription from RNA polymerase II promoter(GO:0035948) regulation of cellular ketone metabolic process by positive regulation of transcription from RNA polymerase II promoter(GO:0072366) |
| 0.1 | 1.1 | GO:0035855 | megakaryocyte development(GO:0035855) |
| 0.1 | 0.1 | GO:0021524 | visceral motor neuron differentiation(GO:0021524) |
| 0.1 | 0.3 | GO:0032211 | negative regulation of telomere maintenance via telomerase(GO:0032211) |
| 0.1 | 0.1 | GO:1903626 | positive regulation of apoptotic DNA fragmentation(GO:1902512) positive regulation of DNA catabolic process(GO:1903626) |
| 0.1 | 0.2 | GO:0036092 | phosphatidylinositol-3-phosphate biosynthetic process(GO:0036092) |
| 0.1 | 0.2 | GO:0045347 | negative regulation of MHC class II biosynthetic process(GO:0045347) |
| 0.1 | 0.4 | GO:0031915 | positive regulation of synaptic plasticity(GO:0031915) |
| 0.1 | 0.2 | GO:0009174 | UMP biosynthetic process(GO:0006222) pyrimidine ribonucleoside monophosphate metabolic process(GO:0009173) pyrimidine ribonucleoside monophosphate biosynthetic process(GO:0009174) UMP metabolic process(GO:0046049) |
| 0.1 | 0.3 | GO:0008090 | retrograde axonal transport(GO:0008090) |
| 0.1 | 0.1 | GO:1900740 | regulation of protein insertion into mitochondrial membrane involved in apoptotic signaling pathway(GO:1900739) positive regulation of protein insertion into mitochondrial membrane involved in apoptotic signaling pathway(GO:1900740) |
| 0.1 | 0.3 | GO:0019509 | L-methionine biosynthetic process from methylthioadenosine(GO:0019509) |
| 0.1 | 0.3 | GO:0014043 | negative regulation of neuron maturation(GO:0014043) |
| 0.1 | 0.1 | GO:0060066 | oviduct development(GO:0060066) |
| 0.1 | 0.2 | GO:0021631 | optic nerve morphogenesis(GO:0021631) |
| 0.1 | 0.4 | GO:0045084 | positive regulation of interleukin-12 biosynthetic process(GO:0045084) |
| 0.1 | 0.3 | GO:0046874 | quinolinate metabolic process(GO:0046874) |
| 0.1 | 0.2 | GO:0006435 | threonyl-tRNA aminoacylation(GO:0006435) |
| 0.1 | 0.1 | GO:0050882 | voluntary musculoskeletal movement(GO:0050882) |
| 0.1 | 0.1 | GO:0043152 | induction of bacterial agglutination(GO:0043152) |
| 0.1 | 0.1 | GO:0072198 | mesenchymal cell proliferation involved in ureter development(GO:0072198) regulation of mesenchymal cell proliferation involved in ureter development(GO:0072199) |
| 0.1 | 0.3 | GO:0070444 | oligodendrocyte progenitor proliferation(GO:0070444) regulation of oligodendrocyte progenitor proliferation(GO:0070445) |
| 0.1 | 0.2 | GO:0097384 | ether lipid biosynthetic process(GO:0008611) glycerol ether biosynthetic process(GO:0046504) cellular lipid biosynthetic process(GO:0097384) ether biosynthetic process(GO:1901503) |
| 0.1 | 0.1 | GO:1905005 | regulation of epithelial to mesenchymal transition involved in endocardial cushion formation(GO:1905005) |
| 0.1 | 0.1 | GO:0002025 | vasodilation by norepinephrine-epinephrine involved in regulation of systemic arterial blood pressure(GO:0002025) |
| 0.1 | 0.4 | GO:0071435 | potassium ion export(GO:0071435) |
| 0.1 | 0.1 | GO:0033629 | negative regulation of cell adhesion mediated by integrin(GO:0033629) |
| 0.1 | 0.1 | GO:0065001 | specification of axis polarity(GO:0065001) |
| 0.1 | 0.1 | GO:0010310 | regulation of hydrogen peroxide metabolic process(GO:0010310) |
| 0.1 | 0.1 | GO:0021914 | negative regulation of smoothened signaling pathway involved in ventral spinal cord patterning(GO:0021914) |
| 0.1 | 0.5 | GO:0097094 | craniofacial suture morphogenesis(GO:0097094) |
| 0.1 | 0.2 | GO:0030202 | heparin metabolic process(GO:0030202) |
| 0.1 | 0.4 | GO:1902031 | regulation of NADP metabolic process(GO:1902031) |
| 0.1 | 2.2 | GO:0016126 | sterol biosynthetic process(GO:0016126) |
| 0.1 | 0.5 | GO:0018095 | protein polyglutamylation(GO:0018095) |
| 0.1 | 0.1 | GO:0019086 | late viral transcription(GO:0019086) |
| 0.1 | 0.1 | GO:0006059 | hexitol metabolic process(GO:0006059) |
| 0.1 | 0.1 | GO:0034136 | negative regulation of toll-like receptor 2 signaling pathway(GO:0034136) |
| 0.1 | 0.1 | GO:0010847 | regulation of chromatin assembly(GO:0010847) |
| 0.1 | 0.3 | GO:0015781 | nucleotide-sugar transport(GO:0015780) pyrimidine nucleotide-sugar transport(GO:0015781) |
| 0.1 | 0.1 | GO:0032483 | regulation of Rab protein signal transduction(GO:0032483) |
| 0.1 | 0.1 | GO:0072092 | ureteric bud invasion(GO:0072092) metanephric renal vesicle formation(GO:0072093) |
| 0.1 | 0.1 | GO:0061043 | regulation of vascular wound healing(GO:0061043) |
| 0.1 | 0.1 | GO:0007354 | zygotic determination of anterior/posterior axis, embryo(GO:0007354) |
| 0.1 | 0.7 | GO:0060074 | synapse maturation(GO:0060074) |
| 0.1 | 0.1 | GO:0045085 | negative regulation of interleukin-2 biosynthetic process(GO:0045085) |
| 0.1 | 0.2 | GO:0007158 | neuron cell-cell adhesion(GO:0007158) |
| 0.1 | 0.2 | GO:0002282 | microglial cell activation involved in immune response(GO:0002282) |
| 0.1 | 0.2 | GO:0006189 | 'de novo' IMP biosynthetic process(GO:0006189) |
| 0.1 | 0.5 | GO:0000244 | spliceosomal tri-snRNP complex assembly(GO:0000244) |
| 0.1 | 0.1 | GO:0014734 | skeletal muscle hypertrophy(GO:0014734) |
| 0.1 | 0.2 | GO:0009092 | homoserine metabolic process(GO:0009092) transsulfuration(GO:0019346) |
| 0.1 | 0.2 | GO:0043415 | positive regulation of skeletal muscle tissue regeneration(GO:0043415) |
| 0.1 | 0.1 | GO:0051088 | PMA-inducible membrane protein ectodomain proteolysis(GO:0051088) |
| 0.1 | 0.2 | GO:0020027 | hemoglobin metabolic process(GO:0020027) |
| 0.1 | 0.5 | GO:0017121 | phospholipid scrambling(GO:0017121) |
| 0.1 | 0.2 | GO:0033603 | positive regulation of dopamine secretion(GO:0033603) |
| 0.1 | 0.4 | GO:1904153 | negative regulation of protein exit from endoplasmic reticulum(GO:0070862) negative regulation of retrograde protein transport, ER to cytosol(GO:1904153) |
| 0.1 | 0.2 | GO:1902774 | late endosome to lysosome transport(GO:1902774) |
| 0.1 | 0.1 | GO:0030035 | microspike assembly(GO:0030035) |
| 0.1 | 0.3 | GO:0036233 | glycine import(GO:0036233) |
| 0.1 | 0.1 | GO:0071947 | protein deubiquitination involved in ubiquitin-dependent protein catabolic process(GO:0071947) |
| 0.1 | 0.2 | GO:0035426 | extracellular matrix-cell signaling(GO:0035426) |
| 0.1 | 0.2 | GO:0071225 | cellular response to muramyl dipeptide(GO:0071225) |
| 0.1 | 0.2 | GO:0042362 | fat-soluble vitamin biosynthetic process(GO:0042362) |
| 0.1 | 0.3 | GO:0072378 | blood coagulation, fibrin clot formation(GO:0072378) |
| 0.1 | 0.2 | GO:1904293 | negative regulation of ERAD pathway(GO:1904293) |
| 0.1 | 0.1 | GO:0071394 | cellular response to testosterone stimulus(GO:0071394) |
| 0.1 | 0.3 | GO:0009642 | response to light intensity(GO:0009642) |
| 0.1 | 0.2 | GO:1900169 | regulation of glucocorticoid mediated signaling pathway(GO:1900169) |
| 0.1 | 0.3 | GO:0060718 | chorionic trophoblast cell differentiation(GO:0060718) |
| 0.1 | 0.1 | GO:0044026 | DNA hypermethylation(GO:0044026) hypermethylation of CpG island(GO:0044027) |
| 0.1 | 0.4 | GO:0060628 | regulation of ER to Golgi vesicle-mediated transport(GO:0060628) |
| 0.1 | 0.3 | GO:0030206 | chondroitin sulfate biosynthetic process(GO:0030206) |
| 0.1 | 0.1 | GO:0018076 | N-terminal peptidyl-lysine acetylation(GO:0018076) |
| 0.0 | 0.9 | GO:0046834 | lipid phosphorylation(GO:0046834) |
| 0.0 | 0.3 | GO:0043517 | positive regulation of DNA damage response, signal transduction by p53 class mediator(GO:0043517) |
| 0.0 | 0.1 | GO:0042541 | hemoglobin biosynthetic process(GO:0042541) |
| 0.0 | 0.3 | GO:0097264 | self proteolysis(GO:0097264) |
| 0.0 | 0.0 | GO:0046084 | adenine metabolic process(GO:0046083) adenine biosynthetic process(GO:0046084) |
| 0.0 | 0.2 | GO:0000160 | phosphorelay signal transduction system(GO:0000160) |
| 0.0 | 0.0 | GO:0060741 | prostate gland stromal morphogenesis(GO:0060741) |
| 0.0 | 0.1 | GO:0072513 | positive regulation of secondary heart field cardioblast proliferation(GO:0072513) |
| 0.0 | 0.5 | GO:0090231 | regulation of spindle checkpoint(GO:0090231) |
| 0.0 | 0.2 | GO:0060040 | retinal bipolar neuron differentiation(GO:0060040) |
| 0.0 | 0.1 | GO:1905097 | regulation of guanyl-nucleotide exchange factor activity(GO:1905097) |
| 0.0 | 0.2 | GO:0009052 | pentose-phosphate shunt, non-oxidative branch(GO:0009052) |
| 0.0 | 0.3 | GO:0006012 | galactose metabolic process(GO:0006012) |
| 0.0 | 0.1 | GO:0010387 | COP9 signalosome assembly(GO:0010387) |
| 0.0 | 0.4 | GO:0035729 | response to hepatocyte growth factor(GO:0035728) cellular response to hepatocyte growth factor stimulus(GO:0035729) |
| 0.0 | 1.7 | GO:0006418 | tRNA aminoacylation for protein translation(GO:0006418) |
| 0.0 | 0.0 | GO:2001027 | negative regulation of endothelial cell chemotaxis(GO:2001027) |
| 0.0 | 0.1 | GO:1903679 | regulation of cap-independent translational initiation(GO:1903677) positive regulation of cap-independent translational initiation(GO:1903679) regulation of cytoplasmic translational initiation(GO:1904688) positive regulation of cytoplasmic translational initiation(GO:1904690) |
| 0.0 | 0.4 | GO:0051988 | regulation of attachment of spindle microtubules to kinetochore(GO:0051988) |
| 0.0 | 0.0 | GO:0032227 | negative regulation of synaptic transmission, dopaminergic(GO:0032227) |
| 0.0 | 0.2 | GO:1900619 | acetylcholine metabolic process(GO:0008291) acetate ester metabolic process(GO:1900619) |
| 0.0 | 0.4 | GO:1904871 | protein localization to nuclear body(GO:1903405) protein localization to Cajal body(GO:1904867) regulation of protein localization to Cajal body(GO:1904869) positive regulation of protein localization to Cajal body(GO:1904871) protein localization to nucleoplasm(GO:1990173) |
| 0.0 | 0.0 | GO:0006145 | purine nucleobase catabolic process(GO:0006145) |
| 0.0 | 0.5 | GO:0010842 | retina layer formation(GO:0010842) |
| 0.0 | 0.1 | GO:0033693 | neurofilament bundle assembly(GO:0033693) |
| 0.0 | 0.1 | GO:0070681 | glutaminyl-tRNAGln biosynthesis via transamidation(GO:0070681) |
| 0.0 | 0.4 | GO:0071361 | cellular response to ethanol(GO:0071361) |
| 0.0 | 1.1 | GO:0000381 | regulation of alternative mRNA splicing, via spliceosome(GO:0000381) |
| 0.0 | 0.3 | GO:1902018 | negative regulation of cilium assembly(GO:1902018) |
| 0.0 | 0.1 | GO:0042538 | hyperosmotic salinity response(GO:0042538) |
| 0.0 | 0.1 | GO:0015770 | disaccharide transport(GO:0015766) sucrose transport(GO:0015770) oligosaccharide transport(GO:0015772) |
| 0.0 | 0.2 | GO:0051014 | actin filament severing(GO:0051014) |
| 0.0 | 0.1 | GO:0033088 | negative regulation of immature T cell proliferation in thymus(GO:0033088) |
| 0.0 | 0.1 | GO:0015819 | lysine transport(GO:0015819) |
| 0.0 | 0.1 | GO:0036438 | maintenance of lens transparency(GO:0036438) |
| 0.0 | 0.2 | GO:0072540 | T-helper 17 cell lineage commitment(GO:0072540) |
| 0.0 | 0.1 | GO:0045590 | negative regulation of regulatory T cell differentiation(GO:0045590) |
| 0.0 | 0.2 | GO:0018211 | protein C-linked glycosylation(GO:0018103) peptidyl-tryptophan modification(GO:0018211) protein C-linked glycosylation via tryptophan(GO:0018317) protein C-linked glycosylation via 2'-alpha-mannosyl-L-tryptophan(GO:0018406) |
| 0.0 | 0.4 | GO:0046069 | cGMP catabolic process(GO:0046069) |
| 0.0 | 0.0 | GO:0046098 | regulation of primitive erythrocyte differentiation(GO:0010725) guanine metabolic process(GO:0046098) |
| 0.0 | 0.2 | GO:0001905 | activation of membrane attack complex(GO:0001905) regulation of activation of membrane attack complex(GO:0001969) |
| 0.0 | 0.3 | GO:0072307 | metanephric nephron tubule epithelial cell differentiation(GO:0072257) regulation of metanephric nephron tubule epithelial cell differentiation(GO:0072307) |
| 0.0 | 0.4 | GO:0032119 | sequestering of zinc ion(GO:0032119) regulation of sequestering of zinc ion(GO:0061088) |
| 0.0 | 0.0 | GO:0009826 | unidimensional cell growth(GO:0009826) |
| 0.0 | 0.2 | GO:0033564 | anterior/posterior axon guidance(GO:0033564) |
| 0.0 | 0.7 | GO:0000028 | ribosomal small subunit assembly(GO:0000028) |
| 0.0 | 0.6 | GO:0044144 | regulation of growth of symbiont in host(GO:0044126) modulation of growth of symbiont involved in interaction with host(GO:0044144) |
| 0.0 | 0.0 | GO:0086023 | adrenergic receptor signaling pathway involved in heart process(GO:0086023) |
| 0.0 | 0.6 | GO:0010569 | regulation of double-strand break repair via homologous recombination(GO:0010569) |
| 0.0 | 0.3 | GO:0048597 | post-embryonic camera-type eye morphogenesis(GO:0048597) |
| 0.0 | 0.1 | GO:0046881 | positive regulation of follicle-stimulating hormone secretion(GO:0046881) |
| 0.0 | 0.2 | GO:0000480 | endonucleolytic cleavage in 5'-ETS of tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000480) |
| 0.0 | 0.1 | GO:1904587 | glycoprotein ERAD pathway(GO:0097466) response to glycoprotein(GO:1904587) |
| 0.0 | 0.0 | GO:0021553 | olfactory nerve development(GO:0021553) |
| 0.0 | 0.7 | GO:0071108 | protein K48-linked deubiquitination(GO:0071108) |
| 0.0 | 0.2 | GO:0017182 | peptidyl-diphthamide metabolic process(GO:0017182) peptidyl-diphthamide biosynthetic process from peptidyl-histidine(GO:0017183) |
| 0.0 | 0.3 | GO:1903441 | protein localization to ciliary membrane(GO:1903441) |
| 0.0 | 0.1 | GO:0097151 | positive regulation of inhibitory postsynaptic potential(GO:0097151) |
| 0.0 | 0.2 | GO:2000773 | negative regulation of cellular senescence(GO:2000773) |
| 0.0 | 0.1 | GO:0002322 | B cell proliferation involved in immune response(GO:0002322) |
| 0.0 | 0.1 | GO:0002765 | immune response-inhibiting signal transduction(GO:0002765) |
| 0.0 | 0.4 | GO:0010832 | negative regulation of myotube differentiation(GO:0010832) |
| 0.0 | 0.2 | GO:0001842 | neural fold formation(GO:0001842) |
| 0.0 | 0.2 | GO:0045324 | late endosome to vacuole transport(GO:0045324) |
| 0.0 | 0.2 | GO:0035455 | response to interferon-alpha(GO:0035455) |
| 0.0 | 0.2 | GO:0036010 | protein localization to endosome(GO:0036010) |
| 0.0 | 0.0 | GO:0072289 | ureter morphogenesis(GO:0072197) metanephric nephron tubule formation(GO:0072289) |
| 0.0 | 0.2 | GO:0016338 | calcium-independent cell-cell adhesion via plasma membrane cell-adhesion molecules(GO:0016338) |
| 0.0 | 0.1 | GO:1900748 | positive regulation of vascular endothelial growth factor signaling pathway(GO:1900748) |
| 0.0 | 0.1 | GO:0003140 | determination of left/right asymmetry in lateral mesoderm(GO:0003140) nodal signaling pathway involved in determination of left/right asymmetry(GO:0038107) regulation of transcription from RNA polymerase II promoter involved in determination of left/right symmetry(GO:1900094) nodal signaling pathway involved in determination of lateral mesoderm left/right asymmetry(GO:1900164) |
| 0.0 | 0.1 | GO:0090135 | actin filament branching(GO:0090135) |
| 0.0 | 0.1 | GO:0006933 | negative regulation of cell adhesion involved in substrate-bound cell migration(GO:0006933) |
| 0.0 | 0.1 | GO:0000087 | mitotic M phase(GO:0000087) |
| 0.0 | 0.1 | GO:0051562 | negative regulation of mitochondrial calcium ion concentration(GO:0051562) |
| 0.0 | 0.1 | GO:0001927 | exocyst assembly(GO:0001927) |
| 0.0 | 0.1 | GO:0019249 | lactate biosynthetic process from pyruvate(GO:0019244) lactate biosynthetic process(GO:0019249) |
| 0.0 | 0.1 | GO:0021912 | regulation of transcription from RNA polymerase II promoter involved in spinal cord motor neuron fate specification(GO:0021912) |
| 0.0 | 0.1 | GO:0006172 | ADP biosynthetic process(GO:0006172) |
| 0.0 | 0.6 | GO:0000245 | spliceosomal complex assembly(GO:0000245) |
| 0.0 | 0.1 | GO:0006391 | transcription initiation from mitochondrial promoter(GO:0006391) |
| 0.0 | 0.2 | GO:0033169 | histone H3-K9 demethylation(GO:0033169) |
| 0.0 | 0.1 | GO:0006556 | S-adenosylmethionine biosynthetic process(GO:0006556) |
| 0.0 | 0.9 | GO:0021954 | central nervous system neuron development(GO:0021954) |
| 0.0 | 0.2 | GO:0031339 | negative regulation of vesicle fusion(GO:0031339) |
| 0.0 | 0.4 | GO:0046716 | muscle cell cellular homeostasis(GO:0046716) |
| 0.0 | 0.1 | GO:0015705 | iodide transport(GO:0015705) |
| 0.0 | 0.2 | GO:0021978 | telencephalon regionalization(GO:0021978) |
| 0.0 | 0.0 | GO:0070571 | negative regulation of neuron projection regeneration(GO:0070571) |
| 0.0 | 0.3 | GO:0000712 | resolution of meiotic recombination intermediates(GO:0000712) |
| 0.0 | 0.1 | GO:0033634 | positive regulation of cell-cell adhesion mediated by integrin(GO:0033634) |
| 0.0 | 0.2 | GO:0071847 | TNFSF11-mediated signaling pathway(GO:0071847) |
| 0.0 | 0.3 | GO:0006471 | protein ADP-ribosylation(GO:0006471) |
| 0.0 | 0.2 | GO:0071850 | mitotic cell cycle arrest(GO:0071850) |
| 0.0 | 0.1 | GO:0001880 | Mullerian duct regression(GO:0001880) |
| 0.0 | 0.1 | GO:0033632 | regulation of cell-cell adhesion mediated by integrin(GO:0033632) |
| 0.0 | 0.1 | GO:0031446 | regulation of fast-twitch skeletal muscle fiber contraction(GO:0031446) positive regulation of fast-twitch skeletal muscle fiber contraction(GO:0031448) |
| 0.0 | 0.1 | GO:0085020 | protein K6-linked ubiquitination(GO:0085020) |
| 0.0 | 0.1 | GO:0035754 | B cell chemotaxis(GO:0035754) |
| 0.0 | 0.3 | GO:0048280 | vesicle fusion with Golgi apparatus(GO:0048280) |
| 0.0 | 0.4 | GO:0070816 | phosphorylation of RNA polymerase II C-terminal domain(GO:0070816) |
| 0.0 | 0.0 | GO:0040009 | regulation of growth rate(GO:0040009) |
| 0.0 | 0.2 | GO:0075522 | IRES-dependent viral translational initiation(GO:0075522) |
| 0.0 | 0.1 | GO:0072600 | establishment of protein localization to Golgi(GO:0072600) |
| 0.0 | 0.4 | GO:0080182 | histone H3-K4 trimethylation(GO:0080182) |
| 0.0 | 0.0 | GO:0060397 | JAK-STAT cascade involved in growth hormone signaling pathway(GO:0060397) |
| 0.0 | 0.6 | GO:0007214 | gamma-aminobutyric acid signaling pathway(GO:0007214) |
| 0.0 | 0.3 | GO:0014741 | negative regulation of muscle hypertrophy(GO:0014741) |
| 0.0 | 0.7 | GO:0034198 | cellular response to amino acid starvation(GO:0034198) |
| 0.0 | 0.5 | GO:0030970 | retrograde protein transport, ER to cytosol(GO:0030970) |
| 0.0 | 0.1 | GO:2000510 | regulation of dendritic cell chemotaxis(GO:2000508) positive regulation of dendritic cell chemotaxis(GO:2000510) |
| 0.0 | 0.2 | GO:0016093 | polyprenol metabolic process(GO:0016093) dolichol metabolic process(GO:0019348) |
| 0.0 | 0.1 | GO:0002432 | granuloma formation(GO:0002432) |
| 0.0 | 0.1 | GO:0007196 | adenylate cyclase-inhibiting G-protein coupled glutamate receptor signaling pathway(GO:0007196) |
| 0.0 | 0.1 | GO:0034165 | positive regulation of toll-like receptor 9 signaling pathway(GO:0034165) |
| 0.0 | 0.0 | GO:0048318 | axial mesoderm development(GO:0048318) |
| 0.0 | 0.1 | GO:0034184 | positive regulation of maintenance of sister chromatid cohesion(GO:0034093) positive regulation of maintenance of mitotic sister chromatid cohesion(GO:0034184) |
| 0.0 | 0.0 | GO:0009448 | gamma-aminobutyric acid metabolic process(GO:0009448) |
| 0.0 | 0.2 | GO:1902715 | positive regulation of interferon-gamma secretion(GO:1902715) |
| 0.0 | 0.3 | GO:0006516 | glycoprotein catabolic process(GO:0006516) |
| 0.0 | 0.3 | GO:0022038 | corpus callosum development(GO:0022038) |
| 0.0 | 0.1 | GO:0046602 | regulation of mitotic centrosome separation(GO:0046602) |
| 0.0 | 0.1 | GO:1902036 | regulation of hematopoietic stem cell differentiation(GO:1902036) |
| 0.0 | 1.6 | GO:0000079 | regulation of cyclin-dependent protein serine/threonine kinase activity(GO:0000079) |
| 0.0 | 0.7 | GO:0035329 | hippo signaling(GO:0035329) |
| 0.0 | 0.3 | GO:0051131 | chaperone-mediated protein complex assembly(GO:0051131) |
| 0.0 | 0.0 | GO:0002572 | pro-T cell differentiation(GO:0002572) |
| 0.0 | 0.0 | GO:0061355 | Wnt protein secretion(GO:0061355) regulation of Wnt protein secretion(GO:0061356) |
| 0.0 | 0.1 | GO:0045423 | granulocyte macrophage colony-stimulating factor biosynthetic process(GO:0042253) regulation of granulocyte macrophage colony-stimulating factor biosynthetic process(GO:0045423) |
| 0.0 | 0.1 | GO:1904469 | positive regulation of tumor necrosis factor secretion(GO:1904469) |
| 0.0 | 0.1 | GO:0001692 | histamine metabolic process(GO:0001692) |
| 0.0 | 0.1 | GO:0060051 | negative regulation of protein glycosylation(GO:0060051) |
| 0.0 | 0.1 | GO:0032287 | peripheral nervous system myelin maintenance(GO:0032287) |
| 0.0 | 0.0 | GO:0014866 | skeletal myofibril assembly(GO:0014866) |
| 0.0 | 0.0 | GO:1901859 | negative regulation of mitochondrial DNA metabolic process(GO:1901859) |
| 0.0 | 0.3 | GO:1902236 | negative regulation of endoplasmic reticulum stress-induced intrinsic apoptotic signaling pathway(GO:1902236) |
| 0.0 | 0.4 | GO:0051127 | positive regulation of actin nucleation(GO:0051127) |
| 0.0 | 0.1 | GO:0042421 | norepinephrine biosynthetic process(GO:0042421) |
| 0.0 | 0.1 | GO:0038165 | oncostatin-M-mediated signaling pathway(GO:0038165) |
| 0.0 | 0.1 | GO:2000051 | negative regulation of non-canonical Wnt signaling pathway(GO:2000051) |
| 0.0 | 0.1 | GO:1990874 | regulation of vascular smooth muscle cell proliferation(GO:1904705) positive regulation of vascular smooth muscle cell proliferation(GO:1904707) vascular smooth muscle cell proliferation(GO:1990874) |
| 0.0 | 0.1 | GO:0043578 | nuclear matrix organization(GO:0043578) nuclear matrix anchoring at nuclear membrane(GO:0090292) |
| 0.0 | 0.1 | GO:0090306 | spindle assembly involved in meiosis(GO:0090306) |
| 0.0 | 0.2 | GO:0071257 | cellular response to electrical stimulus(GO:0071257) |
| 0.0 | 1.3 | GO:0070373 | negative regulation of ERK1 and ERK2 cascade(GO:0070373) |
| 0.0 | 0.2 | GO:0045647 | negative regulation of erythrocyte differentiation(GO:0045647) |
| 0.0 | 0.0 | GO:0021859 | pyramidal neuron differentiation(GO:0021859) |
| 0.0 | 0.8 | GO:0021885 | forebrain cell migration(GO:0021885) |
| 0.0 | 0.7 | GO:0035458 | cellular response to interferon-beta(GO:0035458) |
| 0.0 | 0.4 | GO:0008053 | mitochondrial fusion(GO:0008053) |
| 0.0 | 0.1 | GO:0034047 | regulation of protein phosphatase type 2A activity(GO:0034047) |
| 0.0 | 0.1 | GO:0043518 | negative regulation of DNA damage response, signal transduction by p53 class mediator(GO:0043518) |
| 0.0 | 0.4 | GO:0019068 | virion assembly(GO:0019068) |
| 0.0 | 0.0 | GO:0071336 | regulation of hair follicle cell proliferation(GO:0071336) |
| 0.0 | 0.0 | GO:0019065 | receptor-mediated endocytosis of virus by host cell(GO:0019065) endocytosis involved in viral entry into host cell(GO:0075509) |
| 0.0 | 0.1 | GO:0031052 | programmed DNA elimination(GO:0031049) chromosome breakage(GO:0031052) |
| 0.0 | 0.1 | GO:0007016 | cytoskeletal anchoring at plasma membrane(GO:0007016) |
| 0.0 | 0.3 | GO:0060179 | male mating behavior(GO:0060179) |
| 0.0 | 0.2 | GO:0072502 | cellular phosphate ion homeostasis(GO:0030643) cellular trivalent inorganic anion homeostasis(GO:0072502) |
| 0.0 | 0.1 | GO:0035902 | response to immobilization stress(GO:0035902) |
| 0.0 | 0.1 | GO:0030050 | vesicle transport along actin filament(GO:0030050) |
| 0.0 | 0.3 | GO:0035721 | intraciliary retrograde transport(GO:0035721) |
| 0.0 | 0.1 | GO:0051105 | regulation of DNA ligation(GO:0051105) positive regulation of DNA ligation(GO:0051106) |
| 0.0 | 0.4 | GO:0045671 | negative regulation of osteoclast differentiation(GO:0045671) |
| 0.0 | 0.1 | GO:0070900 | mitochondrial tRNA modification(GO:0070900) mitochondrial RNA modification(GO:1900864) |
| 0.0 | 0.1 | GO:1902683 | regulation of receptor localization to synapse(GO:1902683) |
| 0.0 | 0.1 | GO:0098700 | aminergic neurotransmitter loading into synaptic vesicle(GO:0015842) neurotransmitter loading into synaptic vesicle(GO:0098700) |
| 0.0 | 0.1 | GO:0042726 | flavin-containing compound metabolic process(GO:0042726) |
| 0.0 | 0.2 | GO:0051444 | negative regulation of ubiquitin-protein transferase activity(GO:0051444) |
| 0.0 | 0.2 | GO:0009081 | branched-chain amino acid metabolic process(GO:0009081) |
| 0.0 | 0.1 | GO:0035627 | ceramide transport(GO:0035627) |
| 0.0 | 0.2 | GO:0055098 | response to low-density lipoprotein particle(GO:0055098) |
| 0.0 | 0.1 | GO:1900242 | regulation of synaptic vesicle endocytosis(GO:1900242) |
| 0.0 | 0.1 | GO:0045112 | integrin biosynthetic process(GO:0045112) |
| 0.0 | 0.1 | GO:0051970 | negative regulation of transmission of nerve impulse(GO:0051970) |
| 0.0 | 0.2 | GO:0071044 | histone mRNA catabolic process(GO:0071044) |
| 0.0 | 0.1 | GO:0035456 | response to interferon-beta(GO:0035456) |
| 0.0 | 0.1 | GO:0006564 | L-serine biosynthetic process(GO:0006564) |
| 0.0 | 0.0 | GO:0002121 | inter-male aggressive behavior(GO:0002121) |
| 0.0 | 0.2 | GO:0060158 | phospholipase C-activating dopamine receptor signaling pathway(GO:0060158) |
| 0.0 | 0.9 | GO:0045744 | negative regulation of G-protein coupled receptor protein signaling pathway(GO:0045744) |
| 0.0 | 0.1 | GO:0009110 | vitamin biosynthetic process(GO:0009110) water-soluble vitamin biosynthetic process(GO:0042364) |
| 0.0 | 0.4 | GO:0010758 | regulation of macrophage chemotaxis(GO:0010758) |
| 0.0 | 0.1 | GO:0045040 | outer mitochondrial membrane organization(GO:0007008) protein import into mitochondrial outer membrane(GO:0045040) |
| 0.0 | 0.1 | GO:0035860 | glial cell-derived neurotrophic factor receptor signaling pathway(GO:0035860) |
| 0.0 | 0.1 | GO:0090219 | negative regulation of lipid kinase activity(GO:0090219) |
| 0.0 | 0.1 | GO:0030174 | regulation of DNA-dependent DNA replication initiation(GO:0030174) |
| 0.0 | 0.1 | GO:0060753 | regulation of mast cell chemotaxis(GO:0060753) |
| 0.0 | 0.1 | GO:0090042 | tubulin deacetylation(GO:0090042) regulation of tubulin deacetylation(GO:0090043) |
| 0.0 | 0.0 | GO:0030241 | skeletal muscle myosin thick filament assembly(GO:0030241) striated muscle myosin thick filament assembly(GO:0071688) |
| 0.0 | 0.0 | GO:0032607 | interferon-alpha production(GO:0032607) |
| 0.0 | 0.0 | GO:0070200 | establishment of protein localization to telomere(GO:0070200) |
| 0.0 | 0.3 | GO:2001222 | regulation of neuron migration(GO:2001222) |
| 0.0 | 0.1 | GO:1903660 | regulation of complement-dependent cytotoxicity(GO:1903659) negative regulation of complement-dependent cytotoxicity(GO:1903660) |
| 0.0 | 0.4 | GO:0045954 | positive regulation of natural killer cell mediated cytotoxicity(GO:0045954) |
| 0.0 | 0.1 | GO:0060586 | multicellular organismal iron ion homeostasis(GO:0060586) |
| 0.0 | 0.1 | GO:0006983 | ER overload response(GO:0006983) |
| 0.0 | 0.1 | GO:0098598 | vocal learning(GO:0042297) imitative learning(GO:0098596) learned vocalization behavior or vocal learning(GO:0098598) |
| 0.0 | 0.0 | GO:0022009 | central nervous system vasculogenesis(GO:0022009) |
| 0.0 | 0.1 | GO:1901165 | positive regulation of trophoblast cell migration(GO:1901165) |
| 0.0 | 0.1 | GO:0030070 | insulin processing(GO:0030070) |
| 0.0 | 0.5 | GO:0034605 | cellular response to heat(GO:0034605) |
| 0.0 | 0.1 | GO:0071763 | nuclear membrane organization(GO:0071763) |
| 0.0 | 0.1 | GO:0060391 | positive regulation of SMAD protein import into nucleus(GO:0060391) |
| 0.0 | 0.1 | GO:0010992 | ubiquitin homeostasis(GO:0010992) |
| 0.0 | 0.1 | GO:0006370 | 7-methylguanosine mRNA capping(GO:0006370) |
| 0.0 | 0.1 | GO:0010040 | response to iron(II) ion(GO:0010040) |
| 0.0 | 0.1 | GO:2001271 | negative regulation of cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:2001271) |
| 0.0 | 0.2 | GO:0033314 | mitotic DNA replication checkpoint(GO:0033314) |
| 0.0 | 0.1 | GO:0006344 | maintenance of chromatin silencing(GO:0006344) |
| 0.0 | 0.1 | GO:0046512 | diol biosynthetic process(GO:0034312) sphingosine biosynthetic process(GO:0046512) |
| 0.0 | 0.2 | GO:0019800 | peptide cross-linking via chondroitin 4-sulfate glycosaminoglycan(GO:0019800) |
| 0.0 | 0.2 | GO:0006474 | N-terminal protein amino acid acetylation(GO:0006474) |
| 0.0 | 0.1 | GO:1904263 | positive regulation of TORC1 signaling(GO:1904263) |
| 0.0 | 0.1 | GO:0043615 | astrocyte cell migration(GO:0043615) |
| 0.0 | 0.1 | GO:1901894 | regulation of calcium-transporting ATPase activity(GO:1901894) |
| 0.0 | 0.1 | GO:0002726 | positive regulation of T cell cytokine production(GO:0002726) |
| 0.0 | 0.3 | GO:0050910 | detection of mechanical stimulus involved in sensory perception of sound(GO:0050910) |
| 0.0 | 0.1 | GO:0060385 | axonogenesis involved in innervation(GO:0060385) |
| 0.0 | 0.0 | GO:0070340 | detection of bacterial lipopeptide(GO:0070340) |
| 0.0 | 0.1 | GO:0006624 | vacuolar protein processing(GO:0006624) |
| 0.0 | 0.1 | GO:2000402 | negative regulation of lymphocyte migration(GO:2000402) |
| 0.0 | 0.2 | GO:0061299 | retina vasculature morphogenesis in camera-type eye(GO:0061299) |
| 0.0 | 0.0 | GO:0061502 | early endosome to recycling endosome transport(GO:0061502) |
| 0.0 | 0.3 | GO:0000301 | retrograde transport, vesicle recycling within Golgi(GO:0000301) |
| 0.0 | 0.5 | GO:0070897 | DNA-templated transcriptional preinitiation complex assembly(GO:0070897) |
| 0.0 | 0.3 | GO:0045725 | positive regulation of glycogen biosynthetic process(GO:0045725) |
| 0.0 | 0.1 | GO:0045618 | positive regulation of keratinocyte differentiation(GO:0045618) |
| 0.0 | 0.0 | GO:0031034 | myosin filament assembly(GO:0031034) |
| 0.0 | 0.2 | GO:0002183 | cytoplasmic translational initiation(GO:0002183) |
| 0.0 | 0.1 | GO:0042448 | progesterone metabolic process(GO:0042448) |
| 0.0 | 0.3 | GO:0001945 | lymph vessel development(GO:0001945) |
| 0.0 | 0.1 | GO:2000354 | regulation of ovarian follicle development(GO:2000354) |
| 0.0 | 0.2 | GO:2001241 | positive regulation of extrinsic apoptotic signaling pathway in absence of ligand(GO:2001241) |
| 0.0 | 0.1 | GO:0070093 | negative regulation of glucagon secretion(GO:0070093) |
| 0.0 | 0.1 | GO:0000289 | nuclear-transcribed mRNA poly(A) tail shortening(GO:0000289) |
| 0.0 | 0.1 | GO:1904222 | regulation of CDP-diacylglycerol-serine O-phosphatidyltransferase activity(GO:1904217) positive regulation of CDP-diacylglycerol-serine O-phosphatidyltransferase activity(GO:1904219) regulation of serine C-palmitoyltransferase activity(GO:1904220) positive regulation of serine C-palmitoyltransferase activity(GO:1904222) |
| 0.0 | 0.1 | GO:0045948 | positive regulation of translational initiation(GO:0045948) |
| 0.0 | 0.0 | GO:0051895 | negative regulation of focal adhesion assembly(GO:0051895) |
| 0.0 | 0.0 | GO:0032687 | negative regulation of interferon-alpha production(GO:0032687) |
| 0.0 | 0.0 | GO:0000727 | double-strand break repair via break-induced replication(GO:0000727) |
| 0.0 | 0.0 | GO:0089700 | protein kinase D signaling(GO:0089700) |
| 0.0 | 0.2 | GO:0006591 | ornithine metabolic process(GO:0006591) |
| 0.0 | 0.2 | GO:1902230 | negative regulation of intrinsic apoptotic signaling pathway in response to DNA damage(GO:1902230) |
| 0.0 | 0.0 | GO:2000664 | positive regulation of interleukin-5 secretion(GO:2000664) positive regulation of interleukin-13 secretion(GO:2000667) |
| 0.0 | 0.1 | GO:0002553 | histamine production involved in inflammatory response(GO:0002349) histamine secretion involved in inflammatory response(GO:0002441) histamine secretion by mast cell(GO:0002553) |
| 0.0 | 0.2 | GO:0032288 | myelin assembly(GO:0032288) |
| 0.0 | 0.0 | GO:0043974 | histone H3-K27 acetylation(GO:0043974) regulation of histone H3-K27 acetylation(GO:1901674) |
| 0.0 | 0.1 | GO:0098535 | de novo centriole assembly(GO:0098535) |
| 0.0 | 0.1 | GO:0045723 | positive regulation of fatty acid biosynthetic process(GO:0045723) |
| 0.0 | 0.1 | GO:0072539 | T-helper 17 cell differentiation(GO:0072539) |
| 0.0 | 0.1 | GO:0090083 | regulation of inclusion body assembly(GO:0090083) |
| 0.0 | 0.3 | GO:0071157 | negative regulation of cell cycle arrest(GO:0071157) |
| 0.0 | 0.1 | GO:0055003 | cardiac myofibril assembly(GO:0055003) |
| 0.0 | 0.1 | GO:0021542 | dentate gyrus development(GO:0021542) |
| 0.0 | 0.2 | GO:0090520 | sphingolipid mediated signaling pathway(GO:0090520) |
| 0.0 | 0.1 | GO:0071364 | cellular response to epidermal growth factor stimulus(GO:0071364) |
| 0.0 | 0.4 | GO:0070979 | protein K11-linked ubiquitination(GO:0070979) |
| 0.0 | 0.4 | GO:0009409 | response to cold(GO:0009409) |
| 0.0 | 0.1 | GO:0015074 | DNA integration(GO:0015074) |
| 0.0 | 0.0 | GO:0061365 | positive regulation of triglyceride lipase activity(GO:0061365) |
| 0.0 | 0.1 | GO:0060872 | semicircular canal morphogenesis(GO:0048752) semicircular canal development(GO:0060872) |
| 0.0 | 0.1 | GO:0042373 | vitamin K metabolic process(GO:0042373) |
| 0.0 | 0.2 | GO:0035562 | negative regulation of chromatin binding(GO:0035562) |
| 0.0 | 0.2 | GO:0097237 | cellular response to toxic substance(GO:0097237) |
| 0.0 | 0.1 | GO:0035584 | calcium-mediated signaling using intracellular calcium source(GO:0035584) |
| 0.0 | 0.1 | GO:0001302 | replicative cell aging(GO:0001302) |
| 0.0 | 0.1 | GO:0002538 | arachidonic acid metabolite production involved in inflammatory response(GO:0002538) |
| 0.0 | 0.2 | GO:0035162 | embryonic hemopoiesis(GO:0035162) |
| 0.0 | 0.1 | GO:0046077 | dUDP biosynthetic process(GO:0006227) pyrimidine nucleoside diphosphate biosynthetic process(GO:0009139) pyrimidine deoxyribonucleoside diphosphate metabolic process(GO:0009196) pyrimidine deoxyribonucleoside diphosphate biosynthetic process(GO:0009197) dUDP metabolic process(GO:0046077) |
| 0.0 | 0.0 | GO:0045900 | negative regulation of translational elongation(GO:0045900) |
| 0.0 | 0.0 | GO:0048312 | intracellular distribution of mitochondria(GO:0048312) |
| 0.0 | 2.0 | GO:0008360 | regulation of cell shape(GO:0008360) |
| 0.0 | 0.0 | GO:0002905 | mature B cell apoptotic process(GO:0002901) regulation of mature B cell apoptotic process(GO:0002905) negative regulation of mature B cell apoptotic process(GO:0002906) |
| 0.0 | 0.0 | GO:0036394 | amylase secretion(GO:0036394) |
| 0.0 | 0.2 | GO:0006610 | ribosomal protein import into nucleus(GO:0006610) |
| 0.0 | 0.0 | GO:0071864 | positive regulation of cell proliferation in bone marrow(GO:0071864) |
| 0.0 | 0.0 | GO:1904378 | maintenance of unfolded protein(GO:0036506) maintenance of unfolded protein involved in ERAD pathway(GO:1904378) |
| 0.0 | 0.2 | GO:0000054 | ribosomal subunit export from nucleus(GO:0000054) ribosome localization(GO:0033750) establishment of ribosome localization(GO:0033753) |
| 0.0 | 0.2 | GO:0019368 | fatty acid elongation, saturated fatty acid(GO:0019367) fatty acid elongation, unsaturated fatty acid(GO:0019368) fatty acid elongation, monounsaturated fatty acid(GO:0034625) fatty acid elongation, polyunsaturated fatty acid(GO:0034626) |
| 0.0 | 0.2 | GO:0032222 | regulation of synaptic transmission, cholinergic(GO:0032222) |
| 0.0 | 0.1 | GO:0010727 | negative regulation of hydrogen peroxide metabolic process(GO:0010727) |
| 0.0 | 0.0 | GO:0018171 | peptidyl-cysteine oxidation(GO:0018171) |
| 0.0 | 0.0 | GO:0044860 | protein localization to plasma membrane raft(GO:0044860) |
| 0.0 | 0.0 | GO:0019371 | cyclooxygenase pathway(GO:0019371) |
| 0.0 | 0.1 | GO:0033147 | negative regulation of intracellular estrogen receptor signaling pathway(GO:0033147) |
| 0.0 | 0.1 | GO:2000001 | regulation of cell cycle checkpoint(GO:1901976) regulation of DNA damage checkpoint(GO:2000001) |
| 0.0 | 0.5 | GO:0000184 | nuclear-transcribed mRNA catabolic process, nonsense-mediated decay(GO:0000184) |
| 0.0 | 0.1 | GO:0098762 | meiotic prophase I(GO:0007128) prophase(GO:0051324) meiotic cell cycle phase(GO:0098762) meiosis I cell cycle phase(GO:0098764) |
| 0.0 | 0.3 | GO:0005978 | glycogen biosynthetic process(GO:0005978) glucan biosynthetic process(GO:0009250) |
| 0.0 | 0.0 | GO:0051136 | regulation of NK T cell differentiation(GO:0051136) positive regulation of NK T cell differentiation(GO:0051138) |
| 0.0 | 0.1 | GO:1903232 | melanosome assembly(GO:1903232) |
| 0.0 | 0.0 | GO:0045627 | positive regulation of T-helper 1 cell differentiation(GO:0045627) |
| 0.0 | 0.0 | GO:0014878 | response to electrical stimulus involved in regulation of muscle adaptation(GO:0014878) |
| 0.0 | 0.0 | GO:0014724 | regulation of twitch skeletal muscle contraction(GO:0014724) |
| 0.0 | 0.2 | GO:0006828 | manganese ion transport(GO:0006828) |
| 0.0 | 0.0 | GO:0071609 | chemokine (C-C motif) ligand 5 production(GO:0071609) |
| 0.0 | 0.0 | GO:0032754 | positive regulation of interleukin-5 production(GO:0032754) |
| 0.0 | 0.0 | GO:0090309 | positive regulation of methylation-dependent chromatin silencing(GO:0090309) |
| 0.0 | 0.2 | GO:0006123 | mitochondrial electron transport, cytochrome c to oxygen(GO:0006123) |
| 0.0 | 0.0 | GO:0044341 | sodium-dependent phosphate transport(GO:0044341) regulation of sodium-dependent phosphate transport(GO:2000118) |
| 0.0 | 0.1 | GO:0060618 | nipple development(GO:0060618) |
| 0.0 | 0.0 | GO:0001827 | inner cell mass cell fate commitment(GO:0001827) |
| 0.0 | 0.2 | GO:0014850 | response to muscle activity(GO:0014850) |
| 0.0 | 0.2 | GO:0016242 | negative regulation of macroautophagy(GO:0016242) |
| 0.0 | 0.8 | GO:0051865 | protein autoubiquitination(GO:0051865) |
| 0.0 | 0.1 | GO:0046040 | IMP metabolic process(GO:0046040) |
| 0.0 | 0.2 | GO:0031167 | rRNA methylation(GO:0031167) |
| 0.0 | 0.1 | GO:0015816 | glycine transport(GO:0015816) |
| 0.0 | 0.2 | GO:0010667 | negative regulation of cardiac muscle cell apoptotic process(GO:0010667) |
| 0.0 | 0.2 | GO:0090140 | regulation of mitochondrial fission(GO:0090140) |
| 0.0 | 0.1 | GO:1904262 | TORC1 signaling(GO:0038202) regulation of TORC1 signaling(GO:1903432) negative regulation of TORC1 signaling(GO:1904262) |
| 0.0 | 0.0 | GO:1904751 | regulation of protein localization to nucleolus(GO:1904749) positive regulation of protein localization to nucleolus(GO:1904751) |
| 0.0 | 0.1 | GO:0003348 | cardiac endothelial cell differentiation(GO:0003348) |
| 0.0 | 0.2 | GO:0048488 | synaptic vesicle endocytosis(GO:0048488) |
| 0.0 | 0.0 | GO:0032898 | neurotrophin production(GO:0032898) |
| 0.0 | 0.0 | GO:0060355 | positive regulation of cell adhesion molecule production(GO:0060355) |
| 0.0 | 0.1 | GO:0019732 | antifungal humoral response(GO:0019732) |
| 0.0 | 0.2 | GO:0007635 | chemosensory behavior(GO:0007635) |
| 0.0 | 0.0 | GO:0031584 | activation of phospholipase D activity(GO:0031584) |
| 0.0 | 0.0 | GO:0043380 | memory T cell differentiation(GO:0043379) regulation of memory T cell differentiation(GO:0043380) |
| 0.0 | 0.0 | GO:0060159 | regulation of dopamine receptor signaling pathway(GO:0060159) |
| 0.0 | 0.0 | GO:0070874 | negative regulation of glycogen metabolic process(GO:0070874) |
| 0.0 | 0.0 | GO:1902309 | negative regulation of peptidyl-serine dephosphorylation(GO:1902309) |
| 0.0 | 0.0 | GO:1904996 | positive regulation of leukocyte adhesion to vascular endothelial cell(GO:1904996) |
| 0.0 | 0.0 | GO:0032202 | telomere assembly(GO:0032202) |
| 0.0 | 0.0 | GO:0071492 | cellular response to UV-A(GO:0071492) |
| 0.0 | 0.5 | GO:0032435 | negative regulation of proteasomal ubiquitin-dependent protein catabolic process(GO:0032435) |
| 0.0 | 0.0 | GO:0061081 | positive regulation of myeloid leukocyte cytokine production involved in immune response(GO:0061081) |
| 0.0 | 0.0 | GO:0043516 | regulation of DNA damage response, signal transduction by p53 class mediator(GO:0043516) |
| 0.0 | 0.5 | GO:0043252 | sodium-independent organic anion transport(GO:0043252) |
| 0.0 | 0.1 | GO:0006517 | protein deglycosylation(GO:0006517) |
| 0.0 | 0.1 | GO:0043144 | snoRNA processing(GO:0043144) |
| 0.0 | 0.5 | GO:0043631 | mRNA polyadenylation(GO:0006378) RNA polyadenylation(GO:0043631) |
| 0.0 | 0.2 | GO:0006032 | chitin metabolic process(GO:0006030) chitin catabolic process(GO:0006032) |
| 0.0 | 0.1 | GO:0019464 | glycine catabolic process(GO:0006546) glycine decarboxylation via glycine cleavage system(GO:0019464) |
| 0.0 | 0.1 | GO:0051561 | positive regulation of mitochondrial calcium ion concentration(GO:0051561) |
| 0.0 | 0.1 | GO:0097345 | mitochondrial outer membrane permeabilization(GO:0097345) |
| 0.0 | 0.1 | GO:0034315 | regulation of Arp2/3 complex-mediated actin nucleation(GO:0034315) |
| 0.0 | 0.1 | GO:0014049 | positive regulation of glutamate secretion(GO:0014049) |
| 0.0 | 0.0 | GO:0060155 | platelet dense granule organization(GO:0060155) |
| 0.0 | 0.1 | GO:0000076 | DNA replication checkpoint(GO:0000076) |
| 0.0 | 0.1 | GO:0018026 | peptidyl-lysine monomethylation(GO:0018026) |
| 0.0 | 0.2 | GO:0006491 | N-glycan processing(GO:0006491) |
| 0.0 | 1.4 | GO:0050657 | nucleic acid transport(GO:0050657) RNA transport(GO:0050658) |
| 0.0 | 0.0 | GO:0070673 | response to interleukin-18(GO:0070673) cellular response to interleukin-18(GO:0071351) |
| 0.0 | 0.1 | GO:0071548 | response to dexamethasone(GO:0071548) cellular response to dexamethasone stimulus(GO:0071549) |
| 0.0 | 0.1 | GO:0045743 | positive regulation of fibroblast growth factor receptor signaling pathway(GO:0045743) |
| 0.0 | 0.1 | GO:0000154 | rRNA modification(GO:0000154) |
| 0.0 | 0.2 | GO:0048642 | negative regulation of skeletal muscle tissue development(GO:0048642) |
| 0.0 | 0.1 | GO:0009597 | detection of virus(GO:0009597) |
| 0.0 | 0.0 | GO:0060128 | corticotropin hormone secreting cell differentiation(GO:0060128) |
| 0.0 | 0.0 | GO:0034144 | negative regulation of toll-like receptor 4 signaling pathway(GO:0034144) |
| 0.0 | 0.0 | GO:0010746 | regulation of plasma membrane long-chain fatty acid transport(GO:0010746) |
| 0.0 | 0.1 | GO:0007350 | blastoderm segmentation(GO:0007350) |
| 0.0 | 0.0 | GO:2000852 | corticosterone secretion(GO:0035934) regulation of corticosterone secretion(GO:2000852) |
| 0.0 | 0.0 | GO:0019344 | cysteine biosynthetic process(GO:0019344) |
| 0.0 | 0.0 | GO:0009730 | detection of carbohydrate stimulus(GO:0009730) detection of hexose stimulus(GO:0009732) detection of monosaccharide stimulus(GO:0034287) detection of glucose(GO:0051594) |
| 0.0 | 0.0 | GO:0070389 | chaperone cofactor-dependent protein refolding(GO:0070389) |
| 0.0 | 0.0 | GO:0051344 | negative regulation of cyclic-nucleotide phosphodiesterase activity(GO:0051344) |
| 0.0 | 0.0 | GO:1902445 | regulation of mitochondrial membrane permeability involved in programmed necrotic cell death(GO:1902445) |
| 0.0 | 0.0 | GO:0032066 | nucleolus to nucleoplasm transport(GO:0032066) |
| 0.0 | 0.1 | GO:0006266 | DNA ligation(GO:0006266) |
| 0.0 | 0.0 | GO:2000394 | positive regulation of lamellipodium morphogenesis(GO:2000394) |
| 0.0 | 0.1 | GO:0071385 | cellular response to glucocorticoid stimulus(GO:0071385) |
| 0.0 | 0.0 | GO:0031443 | fast-twitch skeletal muscle fiber contraction(GO:0031443) |
| 0.0 | 0.2 | GO:0032728 | positive regulation of interferon-beta production(GO:0032728) |
| 0.0 | 0.1 | GO:0002934 | desmosome organization(GO:0002934) |
| 0.0 | 0.0 | GO:0014719 | skeletal muscle satellite cell activation(GO:0014719) |
| 0.0 | 0.2 | GO:0047496 | vesicle transport along microtubule(GO:0047496) |
| 0.0 | 0.1 | GO:0010890 | positive regulation of sequestering of triglyceride(GO:0010890) |
| 0.0 | 0.0 | GO:0015809 | arginine transport(GO:0015809) |
| 0.0 | 0.0 | GO:1902897 | regulation of postsynaptic density protein 95 clustering(GO:1902897) |
| 0.0 | 0.0 | GO:0070427 | nucleotide-binding oligomerization domain containing 1 signaling pathway(GO:0070427) |
| 0.0 | 0.4 | GO:0000027 | ribosomal large subunit assembly(GO:0000027) |
| 0.0 | 0.0 | GO:0016074 | snoRNA metabolic process(GO:0016074) |
| 0.0 | 0.1 | GO:0034389 | lipid particle organization(GO:0034389) |
| 0.0 | 0.0 | GO:0014063 | negative regulation of serotonin secretion(GO:0014063) |
| 0.0 | 0.0 | GO:0034163 | regulation of toll-like receptor 9 signaling pathway(GO:0034163) |
| 0.0 | 0.0 | GO:0014016 | neuroblast differentiation(GO:0014016) |
| 0.0 | 0.1 | GO:0001867 | complement activation, lectin pathway(GO:0001867) |
| 0.0 | 0.2 | GO:0045773 | positive regulation of axon extension(GO:0045773) |
| 0.0 | 0.2 | GO:0060292 | long term synaptic depression(GO:0060292) |
| 0.0 | 0.4 | GO:0001938 | positive regulation of endothelial cell proliferation(GO:0001938) |
| 0.0 | 0.0 | GO:0006362 | transcription elongation from RNA polymerase I promoter(GO:0006362) |
| 0.0 | 0.2 | GO:0001504 | neurotransmitter uptake(GO:0001504) |
| 0.0 | 0.0 | GO:0046101 | hypoxanthine metabolic process(GO:0046100) hypoxanthine biosynthetic process(GO:0046101) |
| 0.0 | 0.2 | GO:0006308 | DNA catabolic process(GO:0006308) |
| 0.0 | 0.2 | GO:0032981 | NADH dehydrogenase complex assembly(GO:0010257) mitochondrial respiratory chain complex I assembly(GO:0032981) mitochondrial respiratory chain complex I biogenesis(GO:0097031) |
| 0.0 | 0.0 | GO:0006003 | fructose 2,6-bisphosphate metabolic process(GO:0006003) |
| 0.0 | 0.0 | GO:1903596 | regulation of gap junction assembly(GO:1903596) |
| 0.0 | 0.0 | GO:0039536 | negative regulation of RIG-I signaling pathway(GO:0039536) |
| 0.0 | 0.0 | GO:0042851 | L-alanine metabolic process(GO:0042851) |
| 0.0 | 0.0 | GO:0086042 | cardiac muscle cell-cardiac muscle cell adhesion(GO:0086042) |
| 0.0 | 0.1 | GO:0042737 | drug catabolic process(GO:0042737) |
| 0.0 | 0.0 | GO:0042415 | norepinephrine metabolic process(GO:0042415) |
| 0.0 | 0.0 | GO:0021877 | forebrain neuron fate commitment(GO:0021877) |
| 0.0 | 0.1 | GO:0051205 | protein insertion into membrane(GO:0051205) |
| 0.0 | 0.0 | GO:0043951 | negative regulation of cAMP-mediated signaling(GO:0043951) |
| 0.0 | 0.0 | GO:0048853 | forebrain morphogenesis(GO:0048853) |
| 0.0 | 0.0 | GO:0006924 | activation-induced cell death of T cells(GO:0006924) |
| 0.0 | 0.2 | GO:0071474 | cellular hyperosmotic response(GO:0071474) |
| 0.0 | 0.0 | GO:1900044 | regulation of protein K63-linked ubiquitination(GO:1900044) |
| 0.0 | 0.2 | GO:0000413 | protein peptidyl-prolyl isomerization(GO:0000413) |
| 0.0 | 0.0 | GO:0051461 | positive regulation of corticotropin secretion(GO:0051461) |
| 0.0 | 0.0 | GO:0070682 | proteasome regulatory particle assembly(GO:0070682) |
| 0.0 | 0.0 | GO:2001016 | positive regulation of skeletal muscle cell differentiation(GO:2001016) |
| 0.0 | 0.0 | GO:0061743 | motor learning(GO:0061743) |
| 0.0 | 0.0 | GO:0048102 | autophagic cell death(GO:0048102) |
| 0.0 | 0.0 | GO:0032713 | negative regulation of interleukin-4 production(GO:0032713) |
| 0.0 | 0.0 | GO:0046149 | heme catabolic process(GO:0042167) pigment catabolic process(GO:0046149) |
| 0.0 | 0.0 | GO:0032074 | negative regulation of nuclease activity(GO:0032074) |
| 0.0 | 0.0 | GO:0039689 | negative stranded viral RNA replication(GO:0039689) multi-organism biosynthetic process(GO:0044034) |
| 0.0 | 0.1 | GO:0071340 | skeletal muscle acetylcholine-gated channel clustering(GO:0071340) |
| 0.0 | 0.1 | GO:0006995 | cellular response to nitrogen starvation(GO:0006995) cellular response to nitrogen levels(GO:0043562) |
| 0.0 | 0.0 | GO:0001956 | positive regulation of neurotransmitter secretion(GO:0001956) |
| 0.0 | 0.0 | GO:1901029 | negative regulation of mitochondrial outer membrane permeabilization involved in apoptotic signaling pathway(GO:1901029) |
| 0.0 | 0.0 | GO:0030311 | poly-N-acetyllactosamine metabolic process(GO:0030309) poly-N-acetyllactosamine biosynthetic process(GO:0030311) |
| 0.0 | 0.0 | GO:0038180 | nerve growth factor signaling pathway(GO:0038180) |
| 0.0 | 0.1 | GO:0007549 | dosage compensation(GO:0007549) dosage compensation by inactivation of X chromosome(GO:0009048) |
| 0.0 | 0.0 | GO:0070572 | positive regulation of neuron projection regeneration(GO:0070572) |
| 0.0 | 0.0 | GO:1902686 | positive regulation of mitochondrial membrane permeability involved in apoptotic process(GO:1902110) mitochondrial outer membrane permeabilization involved in programmed cell death(GO:1902686) |
| 0.0 | 0.0 | GO:0046520 | sphingoid biosynthetic process(GO:0046520) |
| 0.0 | 0.0 | GO:0036462 | TRAIL-activated apoptotic signaling pathway(GO:0036462) |
| 0.0 | 0.0 | GO:0035795 | negative regulation of mitochondrial membrane permeability(GO:0035795) |
| 0.0 | 0.0 | GO:0033353 | S-adenosylmethionine cycle(GO:0033353) |
| 0.0 | 0.0 | GO:0007290 | spermatid nucleus elongation(GO:0007290) |
| 0.0 | 0.5 | GO:0006413 | translational initiation(GO:0006413) |
| 0.0 | 0.0 | GO:0001992 | regulation of systemic arterial blood pressure by vasopressin(GO:0001992) |
| 0.0 | 0.1 | GO:0032786 | positive regulation of DNA-templated transcription, elongation(GO:0032786) |
| 0.0 | 0.2 | GO:0003016 | respiratory system process(GO:0003016) |
| 0.0 | 0.1 | GO:0034720 | histone H3-K4 demethylation(GO:0034720) |
| 0.0 | 0.2 | GO:0000470 | maturation of LSU-rRNA(GO:0000470) |
| 0.0 | 0.0 | GO:0071877 | regulation of adrenergic receptor signaling pathway(GO:0071877) |
| 0.0 | 0.0 | GO:0051683 | establishment of Golgi localization(GO:0051683) |
| 0.0 | 0.0 | GO:0098908 | regulation of neuronal action potential(GO:0098908) |
| 0.0 | 0.0 | GO:0060689 | cell differentiation involved in salivary gland development(GO:0060689) |
| 0.0 | 0.0 | GO:0009223 | pyrimidine deoxyribonucleotide catabolic process(GO:0009223) |
| 0.0 | 0.0 | GO:0019478 | D-amino acid catabolic process(GO:0019478) |
| 0.0 | 0.1 | GO:0023035 | CD40 signaling pathway(GO:0023035) |
| 0.0 | 0.0 | GO:0015871 | choline transport(GO:0015871) |
| 0.0 | 0.0 | GO:0003221 | right ventricular cardiac muscle tissue morphogenesis(GO:0003221) |
| 0.0 | 0.1 | GO:0061099 | negative regulation of protein tyrosine kinase activity(GO:0061099) |
| 0.0 | 0.0 | GO:0010820 | positive regulation of T cell chemotaxis(GO:0010820) |
| 0.0 | 0.1 | GO:0042711 | maternal behavior(GO:0042711) |
| 0.0 | 0.0 | GO:0006273 | lagging strand elongation(GO:0006273) |
| 0.0 | 0.0 | GO:2000407 | T cell extravasation(GO:0072683) regulation of T cell extravasation(GO:2000407) positive regulation of T cell extravasation(GO:2000409) |
| 0.0 | 0.0 | GO:0061687 | detoxification of copper ion(GO:0010273) detoxification of inorganic compound(GO:0061687) stress response to metal ion(GO:0097501) stress response to copper ion(GO:1990169) |
| 0.0 | 0.0 | GO:0048050 | post-embryonic eye morphogenesis(GO:0048050) |
| 0.0 | 0.0 | GO:0071442 | positive regulation of histone H3-K14 acetylation(GO:0071442) |
| 0.0 | 0.0 | GO:0070317 | negative regulation of G0 to G1 transition(GO:0070317) |
| 0.0 | 0.0 | GO:0045076 | regulation of interleukin-2 biosynthetic process(GO:0045076) |
| 0.0 | 0.0 | GO:0051036 | regulation of endosome size(GO:0051036) |
| 0.0 | 0.1 | GO:0000188 | inactivation of MAPK activity(GO:0000188) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 1.2 | 3.7 | GO:1990761 | growth cone lamellipodium(GO:1990761) |
| 0.9 | 2.7 | GO:0045251 | mitochondrial electron transfer flavoprotein complex(GO:0017133) electron transfer flavoprotein complex(GO:0045251) |
| 0.9 | 2.6 | GO:0000172 | ribonuclease MRP complex(GO:0000172) |
| 0.8 | 2.4 | GO:0032010 | phagolysosome(GO:0032010) |
| 0.6 | 1.8 | GO:0014701 | junctional sarcoplasmic reticulum membrane(GO:0014701) |
| 0.6 | 1.7 | GO:0030981 | cortical microtubule cytoskeleton(GO:0030981) |
| 0.6 | 3.4 | GO:1990454 | L-type voltage-gated calcium channel complex(GO:1990454) |
| 0.4 | 2.2 | GO:0000138 | Golgi trans cisterna(GO:0000138) |
| 0.3 | 0.3 | GO:0034363 | intermediate-density lipoprotein particle(GO:0034363) |
| 0.3 | 0.8 | GO:0031933 | telomeric heterochromatin(GO:0031933) |
| 0.3 | 2.2 | GO:0045254 | pyruvate dehydrogenase complex(GO:0045254) |
| 0.3 | 0.8 | GO:0060053 | neurofilament cytoskeleton(GO:0060053) |
| 0.2 | 1.5 | GO:0016012 | sarcoglycan complex(GO:0016012) |
| 0.2 | 0.7 | GO:0097413 | Lewy body(GO:0097413) |
| 0.2 | 0.7 | GO:0097443 | sorting endosome(GO:0097443) |
| 0.2 | 4.5 | GO:0034364 | high-density lipoprotein particle(GO:0034364) |
| 0.2 | 1.0 | GO:0000275 | mitochondrial proton-transporting ATP synthase complex, catalytic core F(1)(GO:0000275) proton-transporting ATP synthase complex, catalytic core F(1)(GO:0045261) |
| 0.2 | 2.9 | GO:0043196 | varicosity(GO:0043196) |
| 0.2 | 0.6 | GO:0031088 | platelet dense granule membrane(GO:0031088) |
| 0.2 | 0.6 | GO:0034457 | Mpp10 complex(GO:0034457) |
| 0.2 | 1.3 | GO:0070419 | nonhomologous end joining complex(GO:0070419) |
| 0.2 | 1.2 | GO:0005833 | hemoglobin complex(GO:0005833) |
| 0.2 | 0.5 | GO:0070765 | gamma-secretase complex(GO:0070765) |
| 0.2 | 1.0 | GO:0030062 | mitochondrial tricarboxylic acid cycle enzyme complex(GO:0030062) |
| 0.2 | 1.4 | GO:0002116 | semaphorin receptor complex(GO:0002116) |
| 0.2 | 0.5 | GO:0097149 | centralspindlin complex(GO:0097149) |
| 0.2 | 2.8 | GO:0030134 | ER to Golgi transport vesicle(GO:0030134) |
| 0.2 | 1.5 | GO:0031010 | ISWI-type complex(GO:0031010) |
| 0.1 | 0.9 | GO:0044300 | cerebellar mossy fiber(GO:0044300) |
| 0.1 | 1.0 | GO:0098563 | integral component of synaptic vesicle membrane(GO:0030285) intrinsic component of synaptic vesicle membrane(GO:0098563) |
| 0.1 | 0.6 | GO:0033269 | internode region of axon(GO:0033269) |
| 0.1 | 0.4 | GO:0032299 | ribonuclease H2 complex(GO:0032299) |
| 0.1 | 3.0 | GO:0005605 | basal lamina(GO:0005605) |
| 0.1 | 0.1 | GO:0097136 | Bcl-2 family protein complex(GO:0097136) |
| 0.1 | 0.4 | GO:0005899 | insulin receptor complex(GO:0005899) |
| 0.1 | 1.1 | GO:0043083 | synaptic cleft(GO:0043083) |
| 0.1 | 0.5 | GO:0002142 | stereocilia ankle link complex(GO:0002142) |
| 0.1 | 0.7 | GO:0005915 | zonula adherens(GO:0005915) |
| 0.1 | 0.6 | GO:0061617 | MICOS complex(GO:0061617) |
| 0.1 | 1.6 | GO:0031083 | BLOC-1 complex(GO:0031083) |
| 0.1 | 0.6 | GO:0070695 | FHF complex(GO:0070695) |
| 0.1 | 0.8 | GO:0042788 | polysomal ribosome(GO:0042788) |
| 0.1 | 0.5 | GO:0097169 | AIM2 inflammasome complex(GO:0097169) |
| 0.1 | 1.7 | GO:0000177 | cytoplasmic exosome (RNase complex)(GO:0000177) |
| 0.1 | 0.1 | GO:0000125 | PCAF complex(GO:0000125) |
| 0.1 | 0.9 | GO:0070578 | RISC-loading complex(GO:0070578) |
| 0.1 | 0.7 | GO:0000276 | mitochondrial proton-transporting ATP synthase complex, coupling factor F(o)(GO:0000276) |
| 0.1 | 3.3 | GO:0010494 | cytoplasmic stress granule(GO:0010494) |
| 0.1 | 0.9 | GO:0000124 | SAGA complex(GO:0000124) |
| 0.1 | 0.5 | GO:0005672 | transcription factor TFIIA complex(GO:0005672) |
| 0.1 | 0.3 | GO:0043293 | apoptosome(GO:0043293) |
| 0.1 | 0.4 | GO:0032541 | cortical endoplasmic reticulum(GO:0032541) |
| 0.1 | 0.4 | GO:0036454 | insulin-like growth factor binding protein complex(GO:0016942) growth factor complex(GO:0036454) insulin-like growth factor ternary complex(GO:0042567) |
| 0.1 | 0.6 | GO:0034361 | very-low-density lipoprotein particle(GO:0034361) triglyceride-rich lipoprotein particle(GO:0034385) |
| 0.1 | 3.6 | GO:0034704 | calcium channel complex(GO:0034704) |
| 0.1 | 1.5 | GO:0001741 | XY body(GO:0001741) |
| 0.1 | 0.4 | GO:0005587 | collagen type IV trimer(GO:0005587) network-forming collagen trimer(GO:0098642) collagen network(GO:0098645) basement membrane collagen trimer(GO:0098651) |
| 0.1 | 0.3 | GO:0000015 | phosphopyruvate hydratase complex(GO:0000015) |
| 0.1 | 0.5 | GO:0070847 | core mediator complex(GO:0070847) |
| 0.1 | 0.3 | GO:0005944 | phosphatidylinositol 3-kinase complex, class IB(GO:0005944) |
| 0.1 | 0.6 | GO:0036057 | filtration diaphragm(GO:0036056) slit diaphragm(GO:0036057) |
| 0.1 | 0.8 | GO:0031080 | nuclear pore outer ring(GO:0031080) |
| 0.1 | 0.5 | GO:0090571 | RNA polymerase II transcription repressor complex(GO:0090571) |
| 0.1 | 3.7 | GO:0005788 | endoplasmic reticulum lumen(GO:0005788) |
| 0.1 | 0.5 | GO:0016593 | Cdc73/Paf1 complex(GO:0016593) |
| 0.1 | 0.8 | GO:0036513 | Derlin-1 retrotranslocation complex(GO:0036513) |
| 0.1 | 0.4 | GO:0005683 | U7 snRNP(GO:0005683) |
| 0.1 | 0.5 | GO:0043194 | axon initial segment(GO:0043194) |
| 0.1 | 0.5 | GO:0031931 | TORC1 complex(GO:0031931) |
| 0.1 | 0.4 | GO:0045098 | type III intermediate filament(GO:0045098) |
| 0.1 | 0.2 | GO:0031618 | nuclear pericentric heterochromatin(GO:0031618) |
| 0.1 | 0.3 | GO:0044308 | axonal spine(GO:0044308) |
| 0.1 | 1.1 | GO:0000145 | exocyst(GO:0000145) |
| 0.1 | 0.7 | GO:0042575 | DNA polymerase complex(GO:0042575) |
| 0.1 | 1.3 | GO:0031307 | integral component of mitochondrial outer membrane(GO:0031307) |
| 0.1 | 0.2 | GO:0042583 | chromaffin granule(GO:0042583) |
| 0.1 | 0.2 | GO:0034679 | integrin alpha9-beta1 complex(GO:0034679) |
| 0.1 | 0.1 | GO:0097451 | glial limiting end-foot(GO:0097451) |
| 0.1 | 0.9 | GO:0005942 | phosphatidylinositol 3-kinase complex(GO:0005942) |
| 0.1 | 0.5 | GO:0071541 | eukaryotic translation initiation factor 3 complex, eIF3m(GO:0071541) |
| 0.1 | 1.0 | GO:1902710 | GABA receptor complex(GO:1902710) GABA-A receptor complex(GO:1902711) |
| 0.1 | 1.1 | GO:0005838 | proteasome regulatory particle(GO:0005838) |
| 0.1 | 0.7 | GO:0035686 | sperm fibrous sheath(GO:0035686) |
| 0.1 | 0.3 | GO:0033063 | Rad51B-Rad51C-Rad51D-XRCC2 complex(GO:0033063) |
| 0.1 | 0.3 | GO:0005883 | neurofilament(GO:0005883) |
| 0.1 | 0.2 | GO:0034448 | EGO complex(GO:0034448) Gtr1-Gtr2 GTPase complex(GO:1990131) |
| 0.1 | 0.2 | GO:0044299 | C-fiber(GO:0044299) |
| 0.1 | 0.3 | GO:0005577 | fibrinogen complex(GO:0005577) |
| 0.1 | 0.5 | GO:0032433 | filopodium tip(GO:0032433) |
| 0.1 | 0.8 | GO:0000159 | protein phosphatase type 2A complex(GO:0000159) |
| 0.1 | 1.4 | GO:0030131 | clathrin adaptor complex(GO:0030131) |
| 0.1 | 0.1 | GO:0055087 | Ski complex(GO:0055087) |
| 0.1 | 0.3 | GO:0005638 | lamin filament(GO:0005638) |
| 0.1 | 6.1 | GO:0005741 | mitochondrial outer membrane(GO:0005741) |
| 0.1 | 0.2 | GO:0044316 | cone cell pedicle(GO:0044316) |
| 0.1 | 0.2 | GO:0005927 | muscle tendon junction(GO:0005927) |
| 0.1 | 0.4 | GO:0030991 | intraciliary transport particle A(GO:0030991) |
| 0.1 | 0.2 | GO:0030891 | VCB complex(GO:0030891) |
| 0.0 | 0.9 | GO:0005790 | smooth endoplasmic reticulum(GO:0005790) |
| 0.0 | 0.0 | GO:0031838 | haptoglobin-hemoglobin complex(GO:0031838) |
| 0.0 | 0.1 | GO:0030956 | glutamyl-tRNA(Gln) amidotransferase complex(GO:0030956) |
| 0.0 | 0.5 | GO:0045277 | respiratory chain complex IV(GO:0045277) |
| 0.0 | 0.4 | GO:0048188 | Set1C/COMPASS complex(GO:0048188) |
| 0.0 | 3.9 | GO:0072562 | blood microparticle(GO:0072562) |
| 0.0 | 0.2 | GO:0033093 | Weibel-Palade body(GO:0033093) |
| 0.0 | 0.2 | GO:0014731 | spectrin-associated cytoskeleton(GO:0014731) |
| 0.0 | 0.4 | GO:0005832 | chaperonin-containing T-complex(GO:0005832) |
| 0.0 | 0.1 | GO:0044322 | endoplasmic reticulum quality control compartment(GO:0044322) |
| 0.0 | 1.8 | GO:0031228 | intrinsic component of Golgi membrane(GO:0031228) |
| 0.0 | 1.4 | GO:0008023 | transcription elongation factor complex(GO:0008023) |
| 0.0 | 0.1 | GO:0042585 | germinal vesicle(GO:0042585) |
| 0.0 | 0.1 | GO:0030289 | protein phosphatase 4 complex(GO:0030289) |
| 0.0 | 0.2 | GO:0044232 | organelle membrane contact site(GO:0044232) |
| 0.0 | 0.2 | GO:0042629 | mast cell granule(GO:0042629) |
| 0.0 | 0.1 | GO:0097648 | G-protein coupled receptor dimeric complex(GO:0038037) G-protein coupled receptor complex(GO:0097648) |
| 0.0 | 0.1 | GO:0016602 | CCAAT-binding factor complex(GO:0016602) |
| 0.0 | 0.7 | GO:0005782 | peroxisomal matrix(GO:0005782) microbody lumen(GO:0031907) |
| 0.0 | 0.1 | GO:0097441 | basilar dendrite(GO:0097441) |
| 0.0 | 0.1 | GO:0071008 | U2-type post-mRNA release spliceosomal complex(GO:0071008) |
| 0.0 | 0.2 | GO:0030896 | checkpoint clamp complex(GO:0030896) |
| 0.0 | 0.1 | GO:0005745 | m-AAA complex(GO:0005745) |
| 0.0 | 0.4 | GO:0033276 | transcription factor TFTC complex(GO:0033276) |
| 0.0 | 0.5 | GO:0005682 | U5 snRNP(GO:0005682) |
| 0.0 | 0.1 | GO:0005588 | collagen type V trimer(GO:0005588) |
| 0.0 | 0.1 | GO:0000805 | X chromosome(GO:0000805) |
| 0.0 | 0.2 | GO:0005652 | nuclear lamina(GO:0005652) |
| 0.0 | 0.1 | GO:0036449 | microtubule minus-end(GO:0036449) |
| 0.0 | 0.1 | GO:0016533 | cyclin-dependent protein kinase 5 holoenzyme complex(GO:0016533) |
| 0.0 | 0.3 | GO:0097539 | ciliary transition fiber(GO:0097539) |
| 0.0 | 0.3 | GO:0032593 | insulin-responsive compartment(GO:0032593) |
| 0.0 | 0.3 | GO:0030877 | beta-catenin destruction complex(GO:0030877) |
| 0.0 | 0.1 | GO:0031465 | Cul4B-RING E3 ubiquitin ligase complex(GO:0031465) |
| 0.0 | 0.1 | GO:0005687 | U4 snRNP(GO:0005687) |
| 0.0 | 0.3 | GO:0035631 | CD40 receptor complex(GO:0035631) |
| 0.0 | 0.0 | GO:0005850 | eukaryotic translation initiation factor 2 complex(GO:0005850) |
| 0.0 | 0.5 | GO:0042101 | T cell receptor complex(GO:0042101) |
| 0.0 | 0.2 | GO:0070820 | tertiary granule(GO:0070820) |
| 0.0 | 0.1 | GO:0000814 | ESCRT II complex(GO:0000814) |
| 0.0 | 0.2 | GO:0089701 | U2AF(GO:0089701) |
| 0.0 | 0.2 | GO:0005671 | Ada2/Gcn5/Ada3 transcription activator complex(GO:0005671) |
| 0.0 | 0.0 | GO:0042827 | platelet dense granule(GO:0042827) |
| 0.0 | 0.1 | GO:1990604 | IRE1-TRAF2-ASK1 complex(GO:1990604) |
| 0.0 | 0.2 | GO:0005952 | cAMP-dependent protein kinase complex(GO:0005952) |
| 0.0 | 0.2 | GO:0036157 | outer dynein arm(GO:0036157) |
| 0.0 | 0.2 | GO:0031390 | Ctf18 RFC-like complex(GO:0031390) |
| 0.0 | 0.1 | GO:0031983 | vesicle lumen(GO:0031983) |
| 0.0 | 0.2 | GO:0016342 | catenin complex(GO:0016342) |
| 0.0 | 0.1 | GO:0030689 | Noc complex(GO:0030689) |
| 0.0 | 0.1 | GO:0043511 | inhibin complex(GO:0043511) |
| 0.0 | 0.4 | GO:0032809 | neuronal cell body membrane(GO:0032809) |
| 0.0 | 0.1 | GO:0016461 | unconventional myosin complex(GO:0016461) |
| 0.0 | 0.2 | GO:0005685 | U1 snRNP(GO:0005685) |
| 0.0 | 0.2 | GO:0032045 | guanyl-nucleotide exchange factor complex(GO:0032045) |
| 0.0 | 0.1 | GO:0000444 | MIS12/MIND type complex(GO:0000444) |
| 0.0 | 0.1 | GO:1990745 | EARP complex(GO:1990745) |
| 0.0 | 0.2 | GO:0020005 | symbiont-containing vacuole membrane(GO:0020005) |
| 0.0 | 0.0 | GO:0070552 | BRISC complex(GO:0070552) |
| 0.0 | 0.3 | GO:0031045 | dense core granule(GO:0031045) |
| 0.0 | 0.2 | GO:0097542 | ciliary tip(GO:0097542) |
| 0.0 | 0.1 | GO:0061700 | GATOR2 complex(GO:0061700) |
| 0.0 | 0.3 | GO:0097440 | apical dendrite(GO:0097440) |
| 0.0 | 0.1 | GO:0030015 | CCR4-NOT core complex(GO:0030015) |
| 0.0 | 0.1 | GO:0043219 | lateral loop(GO:0043219) |
| 0.0 | 0.1 | GO:0098536 | deuterosome(GO:0098536) |
| 0.0 | 0.0 | GO:0000322 | storage vacuole(GO:0000322) |
| 0.0 | 2.3 | GO:0035068 | micro-ribonucleoprotein complex(GO:0035068) |
| 0.0 | 0.1 | GO:0005658 | alpha DNA polymerase:primase complex(GO:0005658) |
| 0.0 | 0.0 | GO:0035985 | senescence-associated heterochromatin focus(GO:0035985) |
| 0.0 | 0.1 | GO:0043203 | axon hillock(GO:0043203) |
| 0.0 | 0.4 | GO:0048786 | presynaptic active zone(GO:0048786) |
| 0.0 | 0.2 | GO:0031501 | mannosyltransferase complex(GO:0031501) |
| 0.0 | 0.3 | GO:0005614 | interstitial matrix(GO:0005614) |
| 0.0 | 0.2 | GO:0019908 | nuclear cyclin-dependent protein kinase holoenzyme complex(GO:0019908) |
| 0.0 | 0.2 | GO:0000815 | ESCRT III complex(GO:0000815) |
| 0.0 | 0.3 | GO:0005697 | telomerase holoenzyme complex(GO:0005697) |
| 0.0 | 0.7 | GO:0000315 | organellar large ribosomal subunit(GO:0000315) mitochondrial large ribosomal subunit(GO:0005762) |
| 0.0 | 0.3 | GO:0005797 | Golgi medial cisterna(GO:0005797) |
| 0.0 | 0.1 | GO:0031462 | Cul2-RING ubiquitin ligase complex(GO:0031462) |
| 0.0 | 0.2 | GO:0017119 | Golgi transport complex(GO:0017119) |
| 0.0 | 0.0 | GO:0031595 | nuclear proteasome complex(GO:0031595) |
| 0.0 | 0.0 | GO:0031466 | Cul5-RING ubiquitin ligase complex(GO:0031466) |
| 0.0 | 0.0 | GO:0031597 | cytosolic proteasome complex(GO:0031597) |
| 0.0 | 0.0 | GO:0046691 | intracellular canaliculus(GO:0046691) |
| 0.0 | 0.1 | GO:0070531 | BRCA1-A complex(GO:0070531) |
| 0.0 | 0.4 | GO:0005680 | anaphase-promoting complex(GO:0005680) |
| 0.0 | 0.1 | GO:0000811 | GINS complex(GO:0000811) |
| 0.0 | 0.2 | GO:0036452 | ESCRT complex(GO:0036452) |
| 0.0 | 0.9 | GO:0005643 | nuclear pore(GO:0005643) |
| 0.0 | 0.2 | GO:0032426 | stereocilium tip(GO:0032426) |
| 0.0 | 0.1 | GO:0070688 | MLL5-L complex(GO:0070688) |
| 0.0 | 0.0 | GO:0031265 | CD95 death-inducing signaling complex(GO:0031265) |
| 0.0 | 0.0 | GO:0097427 | microtubule bundle(GO:0097427) |
| 0.0 | 0.5 | GO:0016592 | mediator complex(GO:0016592) |
| 0.0 | 0.1 | GO:0005956 | protein kinase CK2 complex(GO:0005956) |
| 0.0 | 0.0 | GO:0070033 | synaptobrevin 2-SNAP-25-syntaxin-1a-complexin II complex(GO:0070033) |
| 0.0 | 0.1 | GO:0032937 | SREBP-SCAP-Insig complex(GO:0032937) |
| 0.0 | 1.3 | GO:0000922 | spindle pole(GO:0000922) |
| 0.0 | 1.2 | GO:0008076 | voltage-gated potassium channel complex(GO:0008076) |
| 0.0 | 0.0 | GO:0002193 | MAML1-RBP-Jkappa- ICN1 complex(GO:0002193) |
| 0.0 | 0.1 | GO:0005869 | dynactin complex(GO:0005869) |
| 0.0 | 0.9 | GO:0031463 | Cul3-RING ubiquitin ligase complex(GO:0031463) |
| 0.0 | 0.1 | GO:0005828 | kinetochore microtubule(GO:0005828) |
| 0.0 | 0.2 | GO:0005686 | U2 snRNP(GO:0005686) |
| 0.0 | 0.7 | GO:0005881 | cytoplasmic microtubule(GO:0005881) |
| 0.0 | 0.3 | GO:0005666 | DNA-directed RNA polymerase III complex(GO:0005666) |
| 0.0 | 0.6 | GO:0005793 | endoplasmic reticulum-Golgi intermediate compartment(GO:0005793) |
| 0.0 | 0.1 | GO:0005736 | DNA-directed RNA polymerase I complex(GO:0005736) |
| 0.0 | 0.5 | GO:0031594 | neuromuscular junction(GO:0031594) |
| 0.0 | 0.1 | GO:0016580 | Sin3 complex(GO:0016580) |
| 0.0 | 0.1 | GO:0000940 | condensed chromosome outer kinetochore(GO:0000940) |
| 0.0 | 0.4 | GO:0008180 | COP9 signalosome(GO:0008180) |
| 0.0 | 0.3 | GO:0008287 | protein serine/threonine phosphatase complex(GO:0008287) phosphatase complex(GO:1903293) |
| 0.0 | 0.1 | GO:0097208 | alveolar lamellar body(GO:0097208) |
| 0.0 | 0.0 | GO:0031084 | BLOC-2 complex(GO:0031084) |
| 0.0 | 0.1 | GO:0070652 | HAUS complex(GO:0070652) |
| 0.0 | 0.1 | GO:0033256 | I-kappaB/NF-kappaB complex(GO:0033256) |
| 0.0 | 0.0 | GO:0031232 | extrinsic component of external side of plasma membrane(GO:0031232) |
| 0.0 | 0.0 | GO:0016600 | flotillin complex(GO:0016600) |
| 0.0 | 0.0 | GO:0005642 | annulate lamellae(GO:0005642) |
| 0.0 | 0.1 | GO:0000127 | transcription factor TFIIIC complex(GO:0000127) |
| 0.0 | 0.1 | GO:0001652 | granular component(GO:0001652) |
| 0.0 | 0.0 | GO:0000778 | condensed nuclear chromosome kinetochore(GO:0000778) |
| 0.0 | 0.0 | GO:0035859 | Seh1-associated complex(GO:0035859) |
| 0.0 | 0.2 | GO:0035145 | exon-exon junction complex(GO:0035145) |
| 0.0 | 0.1 | GO:0031415 | NatA complex(GO:0031415) |
| 0.0 | 0.0 | GO:0005712 | chiasma(GO:0005712) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 1.3 | 3.8 | GO:0005519 | cytoskeletal regulatory protein binding(GO:0005519) |
| 1.0 | 3.8 | GO:0008970 | phosphatidylcholine 1-acylhydrolase activity(GO:0008970) |
| 0.9 | 2.6 | GO:0000171 | ribonuclease MRP activity(GO:0000171) |
| 0.8 | 2.4 | GO:0086056 | voltage-gated calcium channel activity involved in AV node cell action potential(GO:0086056) |
| 0.8 | 2.3 | GO:0001069 | regulatory region RNA binding(GO:0001069) |
| 0.7 | 2.0 | GO:0004739 | pyruvate dehydrogenase (acetyl-transferring) activity(GO:0004739) |
| 0.6 | 3.2 | GO:0001665 | alpha-N-acetylgalactosaminide alpha-2,6-sialyltransferase activity(GO:0001665) |
| 0.6 | 5.3 | GO:0001091 | RNA polymerase II basal transcription factor binding(GO:0001091) |
| 0.6 | 2.2 | GO:0043262 | adenosine-diphosphatase activity(GO:0043262) |
| 0.5 | 1.6 | GO:0004505 | phenylalanine 4-monooxygenase activity(GO:0004505) |
| 0.5 | 2.0 | GO:0017089 | glycolipid transporter activity(GO:0017089) |
| 0.4 | 1.6 | GO:0005025 | transforming growth factor beta receptor activity, type I(GO:0005025) |
| 0.4 | 1.5 | GO:0043515 | kinetochore binding(GO:0043515) |
| 0.4 | 1.1 | GO:0004366 | glycerol-3-phosphate O-acyltransferase activity(GO:0004366) |
| 0.4 | 3.0 | GO:0004862 | cAMP-dependent protein kinase inhibitor activity(GO:0004862) |
| 0.4 | 2.8 | GO:0050649 | testosterone 6-beta-hydroxylase activity(GO:0050649) |
| 0.3 | 1.3 | GO:0000014 | single-stranded DNA endodeoxyribonuclease activity(GO:0000014) |
| 0.3 | 0.9 | GO:0030350 | iron-responsive element binding(GO:0030350) |
| 0.3 | 1.3 | GO:0004566 | beta-glucuronidase activity(GO:0004566) |
| 0.3 | 1.2 | GO:0070053 | thrombospondin receptor activity(GO:0070053) |
| 0.3 | 0.9 | GO:0016842 | amidine-lyase activity(GO:0016842) |
| 0.3 | 0.9 | GO:0003886 | DNA (cytosine-5-)-methyltransferase activity(GO:0003886) DNA (cytosine-5-)-methyltransferase activity, acting on CpG substrates(GO:0051718) |
| 0.3 | 0.9 | GO:0070644 | vitamin D response element binding(GO:0070644) |
| 0.3 | 0.3 | GO:0086007 | voltage-gated calcium channel activity involved in cardiac muscle cell action potential(GO:0086007) |
| 0.3 | 0.8 | GO:0070699 | type II activin receptor binding(GO:0070699) |
| 0.3 | 1.3 | GO:0005499 | vitamin D binding(GO:0005499) |
| 0.3 | 1.1 | GO:0031721 | hemoglobin alpha binding(GO:0031721) |
| 0.3 | 1.3 | GO:0030976 | thiamine pyrophosphate binding(GO:0030976) |
| 0.3 | 0.8 | GO:0005176 | ErbB-2 class receptor binding(GO:0005176) |
| 0.3 | 0.8 | GO:0015142 | citrate transmembrane transporter activity(GO:0015137) tricarboxylic acid transmembrane transporter activity(GO:0015142) |
| 0.2 | 1.2 | GO:0008294 | calcium- and calmodulin-responsive adenylate cyclase activity(GO:0008294) |
| 0.2 | 0.7 | GO:0008503 | benzodiazepine receptor activity(GO:0008503) |
| 0.2 | 0.9 | GO:0015265 | urea channel activity(GO:0015265) |
| 0.2 | 0.9 | GO:0019136 | deoxynucleoside kinase activity(GO:0019136) |
| 0.2 | 0.7 | GO:0030620 | U2 snRNA binding(GO:0030620) |
| 0.2 | 4.0 | GO:0008157 | protein phosphatase 1 binding(GO:0008157) |
| 0.2 | 2.3 | GO:0017154 | semaphorin receptor activity(GO:0017154) |
| 0.2 | 0.8 | GO:0030911 | TPR domain binding(GO:0030911) |
| 0.2 | 0.9 | GO:0019784 | NEDD8-specific protease activity(GO:0019784) |
| 0.2 | 0.6 | GO:0030519 | snoRNP binding(GO:0030519) |
| 0.2 | 0.5 | GO:0004771 | sterol esterase activity(GO:0004771) |
| 0.2 | 1.1 | GO:0043140 | ATP-dependent 3'-5' DNA helicase activity(GO:0043140) |
| 0.2 | 0.7 | GO:0009374 | biotin binding(GO:0009374) |
| 0.2 | 0.5 | GO:0004687 | myosin light chain kinase activity(GO:0004687) |
| 0.2 | 0.7 | GO:0047238 | glucuronosyl-N-acetylgalactosaminyl-proteoglycan 4-beta-N-acetylgalactosaminyltransferase activity(GO:0047238) |
| 0.2 | 0.8 | GO:0046934 | phosphatidylinositol-4,5-bisphosphate 3-kinase activity(GO:0046934) |
| 0.2 | 1.1 | GO:0003836 | beta-galactoside (CMP) alpha-2,3-sialyltransferase activity(GO:0003836) |
| 0.2 | 0.8 | GO:0070087 | chromo shadow domain binding(GO:0070087) |
| 0.2 | 0.5 | GO:0097200 | cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:0097200) |
| 0.2 | 0.8 | GO:0005111 | type 2 fibroblast growth factor receptor binding(GO:0005111) |
| 0.2 | 1.3 | GO:0008331 | high voltage-gated calcium channel activity(GO:0008331) |
| 0.2 | 0.5 | GO:0001030 | RNA polymerase III type 1 promoter DNA binding(GO:0001030) RNA polymerase III type 2 promoter DNA binding(GO:0001031) RNA polymerase III type 3 promoter DNA binding(GO:0001032) 5S rDNA binding(GO:0080084) |
| 0.2 | 0.5 | GO:0045340 | mercury ion binding(GO:0045340) |
| 0.2 | 0.8 | GO:0086080 | protein binding involved in heterotypic cell-cell adhesion(GO:0086080) |
| 0.2 | 4.2 | GO:0016645 | oxidoreductase activity, acting on the CH-NH group of donors(GO:0016645) |
| 0.2 | 0.8 | GO:0004769 | steroid delta-isomerase activity(GO:0004769) |
| 0.2 | 0.5 | GO:0048101 | calcium- and calmodulin-regulated 3',5'-cyclic-GMP phosphodiesterase activity(GO:0048101) |
| 0.1 | 0.4 | GO:0045503 | dynein light chain binding(GO:0045503) |
| 0.1 | 0.4 | GO:0048763 | calcium-induced calcium release activity(GO:0048763) |
| 0.1 | 0.4 | GO:0008898 | S-adenosylmethionine-homocysteine S-methyltransferase activity(GO:0008898) |
| 0.1 | 0.4 | GO:0071208 | histone pre-mRNA DCP binding(GO:0071208) |
| 0.1 | 2.4 | GO:0052890 | oxidoreductase activity, acting on the CH-CH group of donors, with a flavin as acceptor(GO:0052890) |
| 0.1 | 0.4 | GO:0016015 | morphogen activity(GO:0016015) |
| 0.1 | 0.7 | GO:0032407 | MutSalpha complex binding(GO:0032407) |
| 0.1 | 0.4 | GO:0031752 | D5 dopamine receptor binding(GO:0031752) |
| 0.1 | 0.9 | GO:0005004 | GPI-linked ephrin receptor activity(GO:0005004) |
| 0.1 | 0.5 | GO:0003945 | N-acetyllactosamine synthase activity(GO:0003945) |
| 0.1 | 1.5 | GO:0008195 | phosphatidate phosphatase activity(GO:0008195) |
| 0.1 | 0.4 | GO:0001226 | RNA polymerase II transcription corepressor binding(GO:0001226) |
| 0.1 | 1.4 | GO:0004861 | cyclin-dependent protein serine/threonine kinase inhibitor activity(GO:0004861) |
| 0.1 | 0.5 | GO:0070326 | very-low-density lipoprotein particle receptor binding(GO:0070326) |
| 0.1 | 0.6 | GO:0004634 | phosphopyruvate hydratase activity(GO:0004634) |
| 0.1 | 0.4 | GO:0050692 | DBD domain binding(GO:0050692) |
| 0.1 | 0.2 | GO:0004351 | glutamate decarboxylase activity(GO:0004351) |
| 0.1 | 0.5 | GO:0034549 | N-cyclopropylmelamine deaminase activity(GO:0034547) N-cyclopropylammeline deaminase activity(GO:0034548) N-cyclopropylammelide alkylamino hydrolase activity(GO:0034549) 2,5-diamino-6-ribitylamino-4(3H)-pyrimidinone 5'-phosphate deaminase activity(GO:0043723) tRNA-specific adenosine-37 deaminase activity(GO:0043829) archaeal-specific GTP cyclohydrolase activity(GO:0044682) tRNA-specific adenosine-34 deaminase activity(GO:0052717) |
| 0.1 | 0.8 | GO:1990459 | transferrin receptor binding(GO:1990459) |
| 0.1 | 0.4 | GO:0043546 | molybdopterin cofactor binding(GO:0043546) |
| 0.1 | 0.1 | GO:0042813 | Wnt-activated receptor activity(GO:0042813) |
| 0.1 | 0.8 | GO:0019855 | calcium channel inhibitor activity(GO:0019855) |
| 0.1 | 0.5 | GO:0016624 | oxidoreductase activity, acting on the aldehyde or oxo group of donors, disulfide as acceptor(GO:0016624) |
| 0.1 | 0.6 | GO:0035312 | 5'-3' exodeoxyribonuclease activity(GO:0035312) |
| 0.1 | 0.9 | GO:0046933 | proton-transporting ATP synthase activity, rotational mechanism(GO:0046933) |
| 0.1 | 1.4 | GO:0008349 | MAP kinase kinase kinase kinase activity(GO:0008349) |
| 0.1 | 0.8 | GO:0003680 | AT DNA binding(GO:0003680) |
| 0.1 | 0.6 | GO:0070728 | leucine binding(GO:0070728) |
| 0.1 | 0.6 | GO:0035473 | lipase binding(GO:0035473) |
| 0.1 | 3.5 | GO:0008536 | Ran GTPase binding(GO:0008536) |
| 0.1 | 2.2 | GO:0080025 | phosphatidylinositol-3,5-bisphosphate binding(GO:0080025) |
| 0.1 | 0.3 | GO:0003987 | acetate-CoA ligase activity(GO:0003987) |
| 0.1 | 1.2 | GO:0015271 | outward rectifier potassium channel activity(GO:0015271) |
| 0.1 | 0.6 | GO:0030274 | LIM domain binding(GO:0030274) |
| 0.1 | 0.3 | GO:0015222 | serotonin transmembrane transporter activity(GO:0015222) |
| 0.1 | 0.2 | GO:0051880 | G-quadruplex DNA binding(GO:0051880) |
| 0.1 | 0.3 | GO:0032422 | purine-rich negative regulatory element binding(GO:0032422) |
| 0.1 | 0.2 | GO:0051373 | FATZ binding(GO:0051373) |
| 0.1 | 0.2 | GO:0034040 | lipid-transporting ATPase activity(GO:0034040) |
| 0.1 | 2.3 | GO:0005070 | SH3/SH2 adaptor activity(GO:0005070) |
| 0.1 | 0.4 | GO:0070883 | pre-miRNA binding(GO:0070883) |
| 0.1 | 0.6 | GO:0008559 | xenobiotic-transporting ATPase activity(GO:0008559) |
| 0.1 | 0.1 | GO:0002151 | G-quadruplex RNA binding(GO:0002151) |
| 0.1 | 0.6 | GO:0004311 | farnesyltranstransferase activity(GO:0004311) |
| 0.1 | 0.7 | GO:0004908 | interleukin-1 receptor activity(GO:0004908) |
| 0.1 | 0.1 | GO:0008379 | thioredoxin peroxidase activity(GO:0008379) |
| 0.1 | 0.7 | GO:0008430 | selenium binding(GO:0008430) |
| 0.1 | 0.3 | GO:0031698 | beta-2 adrenergic receptor binding(GO:0031698) |
| 0.1 | 0.4 | GO:0015467 | G-protein activated inward rectifier potassium channel activity(GO:0015467) |
| 0.1 | 0.3 | GO:0035514 | DNA demethylase activity(GO:0035514) |
| 0.1 | 0.1 | GO:0003997 | acyl-CoA oxidase activity(GO:0003997) |
| 0.1 | 0.3 | GO:0016309 | 1-phosphatidylinositol-5-phosphate 4-kinase activity(GO:0016309) |
| 0.1 | 0.6 | GO:0048531 | beta-1,3-galactosyltransferase activity(GO:0048531) |
| 0.1 | 0.6 | GO:0008494 | translation activator activity(GO:0008494) |
| 0.1 | 0.3 | GO:1901612 | cardiolipin binding(GO:1901612) |
| 0.1 | 1.4 | GO:0034885 | protein-N-terminal asparagine amidohydrolase activity(GO:0008418) UDP-3-O-[3-hydroxymyristoyl] N-acetylglucosamine deacetylase activity(GO:0008759) iprodione amidohydrolase activity(GO:0018748) (3,5-dichlorophenylurea)acetate amidohydrolase activity(GO:0018749) 4'-(2-hydroxyisopropyl)phenylurea amidohydrolase activity(GO:0034571) didemethylisoproturon amidohydrolase activity(GO:0034573) N-isopropylacetanilide amidohydrolase activity(GO:0034576) N-cyclohexylformamide amidohydrolase activity(GO:0034781) isonicotinic acid hydrazide hydrolase activity(GO:0034876) cis-aconitamide amidase activity(GO:0034882) gamma-N-formylaminovinylacetate hydrolase activity(GO:0034885) N2-acetyl-L-lysine deacetylase activity(GO:0043747) O-succinylbenzoate synthase activity(GO:0043748) indoleacetamide hydrolase activity(GO:0043864) N-acetylcitrulline deacetylase activity(GO:0043909) N-acetylgalactosamine-6-phosphate deacetylase activity(GO:0047419) diacetylchitobiose deacetylase activity(GO:0052773) chitooligosaccharide deacetylase activity(GO:0052790) |
| 0.1 | 0.6 | GO:0046790 | virion binding(GO:0046790) |
| 0.1 | 0.4 | GO:0030291 | protein serine/threonine kinase inhibitor activity(GO:0030291) |
| 0.1 | 2.0 | GO:0043015 | gamma-tubulin binding(GO:0043015) |
| 0.1 | 0.7 | GO:0008568 | microtubule-severing ATPase activity(GO:0008568) |
| 0.1 | 0.2 | GO:0033829 | O-fucosylpeptide 3-beta-N-acetylglucosaminyltransferase activity(GO:0033829) |
| 0.1 | 0.9 | GO:0005388 | calcium-transporting ATPase activity(GO:0005388) |
| 0.1 | 0.6 | GO:0070181 | small ribosomal subunit rRNA binding(GO:0070181) |
| 0.1 | 1.2 | GO:0016805 | dipeptidase activity(GO:0016805) |
| 0.1 | 0.3 | GO:1990932 | 5.8S rRNA binding(GO:1990932) |
| 0.1 | 0.4 | GO:0043426 | MRF binding(GO:0043426) |
| 0.1 | 0.3 | GO:0044323 | retinoic acid-responsive element binding(GO:0044323) |
| 0.1 | 0.2 | GO:0016149 | translation release factor activity, codon specific(GO:0016149) |
| 0.1 | 0.6 | GO:0016004 | phospholipase activator activity(GO:0016004) |
| 0.1 | 0.6 | GO:0003841 | 1-acylglycerol-3-phosphate O-acyltransferase activity(GO:0003841) |
| 0.1 | 0.1 | GO:0015204 | urea transmembrane transporter activity(GO:0015204) |
| 0.1 | 0.3 | GO:0052851 | cupric reductase activity(GO:0008823) ferric-chelate reductase (NADPH) activity(GO:0052851) |
| 0.1 | 2.7 | GO:0048487 | beta-tubulin binding(GO:0048487) |
| 0.1 | 0.2 | GO:0030151 | molybdenum ion binding(GO:0030151) |
| 0.1 | 0.5 | GO:0016812 | hydrolase activity, acting on carbon-nitrogen (but not peptide) bonds, in cyclic amides(GO:0016812) |
| 0.1 | 0.6 | GO:0008113 | peptide-methionine (S)-S-oxide reductase activity(GO:0008113) |
| 0.1 | 2.1 | GO:0070888 | E-box binding(GO:0070888) |
| 0.1 | 2.2 | GO:0052771 | coenzyme F390-A hydrolase activity(GO:0052770) coenzyme F390-G hydrolase activity(GO:0052771) |
| 0.1 | 0.3 | GO:0005021 | vascular endothelial growth factor-activated receptor activity(GO:0005021) |
| 0.1 | 0.3 | GO:0016530 | metallochaperone activity(GO:0016530) |
| 0.1 | 0.3 | GO:0033300 | dehydroascorbic acid transporter activity(GO:0033300) |
| 0.1 | 0.2 | GO:0008142 | oxysterol binding(GO:0008142) |
| 0.1 | 0.1 | GO:0008309 | double-stranded DNA exodeoxyribonuclease activity(GO:0008309) |
| 0.1 | 0.3 | GO:0034714 | type III transforming growth factor beta receptor binding(GO:0034714) |
| 0.1 | 0.3 | GO:0042577 | lipid phosphatase activity(GO:0042577) |
| 0.1 | 0.2 | GO:0050816 | phosphothreonine binding(GO:0050816) |
| 0.1 | 0.4 | GO:0032184 | SUMO polymer binding(GO:0032184) |
| 0.1 | 1.0 | GO:0070273 | phosphatidylinositol-4-phosphate binding(GO:0070273) |
| 0.1 | 0.4 | GO:1990247 | N6-methyladenosine-containing RNA binding(GO:1990247) |
| 0.1 | 0.6 | GO:0001206 | transcriptional repressor activity, RNA polymerase II distal enhancer sequence-specific binding(GO:0001206) |
| 0.1 | 0.1 | GO:0019238 | cyclohydrolase activity(GO:0019238) |
| 0.1 | 0.4 | GO:0035242 | protein-arginine omega-N asymmetric methyltransferase activity(GO:0035242) |
| 0.1 | 0.3 | GO:0048273 | mitogen-activated protein kinase p38 binding(GO:0048273) |
| 0.1 | 0.3 | GO:0015375 | glycine:sodium symporter activity(GO:0015375) |
| 0.1 | 0.3 | GO:0001727 | lipid kinase activity(GO:0001727) |
| 0.1 | 0.9 | GO:0008143 | poly(A) binding(GO:0008143) |
| 0.1 | 0.2 | GO:0000293 | ferric-chelate reductase activity(GO:0000293) |
| 0.1 | 1.4 | GO:0031683 | G-protein beta/gamma-subunit complex binding(GO:0031683) |
| 0.1 | 0.1 | GO:0055100 | adiponectin binding(GO:0055100) |
| 0.1 | 0.5 | GO:0004032 | alditol:NADP+ 1-oxidoreductase activity(GO:0004032) |
| 0.1 | 1.4 | GO:0004181 | metallocarboxypeptidase activity(GO:0004181) |
| 0.1 | 0.9 | GO:0010485 | H4 histone acetyltransferase activity(GO:0010485) |
| 0.1 | 0.3 | GO:0004985 | opioid receptor activity(GO:0004985) |
| 0.1 | 0.2 | GO:0004829 | threonine-tRNA ligase activity(GO:0004829) |
| 0.1 | 0.4 | GO:0018741 | alkyl sulfatase activity(GO:0018741) endosulfan hemisulfate sulfatase activity(GO:0034889) endosulfan sulfate hydrolase activity(GO:0034902) |
| 0.1 | 1.7 | GO:0008748 | N-ethylmaleimide reductase activity(GO:0008748) reduced coenzyme F420 dehydrogenase activity(GO:0043738) sulfur oxygenase reductase activity(GO:0043826) malolactic enzyme activity(GO:0043883) epoxyqueuosine reductase activity(GO:0052693) |
| 0.1 | 1.2 | GO:0003746 | translation elongation factor activity(GO:0003746) |
| 0.1 | 1.1 | GO:0008235 | metalloexopeptidase activity(GO:0008235) |
| 0.1 | 0.4 | GO:0032454 | histone demethylase activity (H3-K9 specific)(GO:0032454) |
| 0.1 | 0.5 | GO:0051787 | misfolded protein binding(GO:0051787) |
| 0.1 | 0.2 | GO:0042731 | PH domain binding(GO:0042731) |
| 0.1 | 0.5 | GO:0001162 | RNA polymerase II intronic transcription regulatory region sequence-specific DNA binding(GO:0001162) |
| 0.1 | 0.3 | GO:0004826 | phenylalanine-tRNA ligase activity(GO:0004826) |
| 0.1 | 0.1 | GO:0002134 | UTP binding(GO:0002134) pyrimidine ribonucleoside binding(GO:0032551) |
| 0.1 | 0.3 | GO:0034711 | inhibin binding(GO:0034711) |
| 0.1 | 0.3 | GO:0004523 | RNA-DNA hybrid ribonuclease activity(GO:0004523) |
| 0.1 | 0.2 | GO:0047623 | AMP deaminase activity(GO:0003876) adenosine-phosphate deaminase activity(GO:0047623) |
| 0.1 | 1.2 | GO:0001106 | RNA polymerase II transcription corepressor activity(GO:0001106) |
| 0.1 | 0.9 | GO:0004890 | GABA-A receptor activity(GO:0004890) |
| 0.1 | 0.4 | GO:1990405 | protein antigen binding(GO:1990405) |
| 0.1 | 0.3 | GO:0031849 | olfactory receptor binding(GO:0031849) |
| 0.1 | 0.2 | GO:0050833 | pyruvate transmembrane transporter activity(GO:0050833) |
| 0.1 | 0.4 | GO:0050811 | GABA receptor binding(GO:0050811) |
| 0.1 | 0.1 | GO:0047391 | alkylglycerophosphoethanolamine phosphodiesterase activity(GO:0047391) |
| 0.1 | 0.2 | GO:0004652 | polynucleotide adenylyltransferase activity(GO:0004652) |
| 0.1 | 0.5 | GO:0043762 | 3-oxo-2-(2'-pentenyl)cyclopentane-1-octanoic acid CoA ligase activity(GO:0010435) 3-isopropenyl-6-oxoheptanoyl-CoA synthetase activity(GO:0018854) 2-oxo-delta3-4,5,5-trimethylcyclopentenylacetyl-CoA synthetase activity(GO:0018855) benzoyl acetate-CoA ligase activity(GO:0018856) 2,4-dichlorobenzoate-CoA ligase activity(GO:0018857) pivalate-CoA ligase activity(GO:0034783) cyclopropanecarboxylate-CoA ligase activity(GO:0034793) adipate-CoA ligase activity(GO:0034796) citronellyl-CoA ligase activity(GO:0034823) mentha-1,3-dione-CoA ligase activity(GO:0034841) thiophene-2-carboxylate-CoA ligase activity(GO:0034842) 2,4,4-trimethylpentanoate-CoA ligase activity(GO:0034865) cis-2-methyl-5-isopropylhexa-2,5-dienoate-CoA ligase activity(GO:0034942) trans-2-methyl-5-isopropylhexa-2,5-dienoate-CoA ligase activity(GO:0034943) branched-chain acyl-CoA synthetase (ADP-forming) activity(GO:0043759) aryl-CoA synthetase (ADP-forming) activity(GO:0043762) 3-hydroxypropionyl-CoA synthetase activity(GO:0043955) perillic acid:CoA ligase (ADP-forming) activity(GO:0052685) perillic acid:CoA ligase (AMP-forming) activity(GO:0052686) (3R)-3-isopropenyl-6-oxoheptanoate:CoA ligase (ADP-forming) activity(GO:0052687) (3R)-3-isopropenyl-6-oxoheptanoate:CoA ligase (AMP-forming) activity(GO:0052688) pristanate-CoA ligase activity(GO:0070251) malonyl-CoA synthetase activity(GO:0090409) |
| 0.1 | 0.1 | GO:0042171 | lysophosphatidic acid acyltransferase activity(GO:0042171) |
| 0.1 | 0.1 | GO:0016723 | oxidoreductase activity, oxidizing metal ions, NAD or NADP as acceptor(GO:0016723) |
| 0.1 | 0.2 | GO:0030229 | very-low-density lipoprotein particle receptor activity(GO:0030229) |
| 0.1 | 0.7 | GO:0005351 | sugar:proton symporter activity(GO:0005351) |
| 0.1 | 0.1 | GO:0051425 | PTB domain binding(GO:0051425) |
| 0.1 | 1.8 | GO:0016875 | ligase activity, forming carbon-oxygen bonds(GO:0016875) ligase activity, forming aminoacyl-tRNA and related compounds(GO:0016876) |
| 0.1 | 0.8 | GO:0017128 | phospholipid scramblase activity(GO:0017128) |
| 0.0 | 0.8 | GO:0019825 | oxygen binding(GO:0019825) |
| 0.0 | 0.2 | GO:0000155 | phosphorelay sensor kinase activity(GO:0000155) |
| 0.0 | 0.2 | GO:0003956 | NAD(P)+-protein-arginine ADP-ribosyltransferase activity(GO:0003956) |
| 0.0 | 0.1 | GO:0001075 | transcription factor activity, RNA polymerase II core promoter sequence-specific binding involved in preinitiation complex assembly(GO:0001075) |
| 0.0 | 0.1 | GO:0019166 | trans-2-enoyl-CoA reductase (NADPH) activity(GO:0019166) |
| 0.0 | 1.2 | GO:0005251 | delayed rectifier potassium channel activity(GO:0005251) |
| 0.0 | 0.3 | GO:0050700 | CARD domain binding(GO:0050700) |
| 0.0 | 0.0 | GO:0031893 | vasopressin receptor binding(GO:0031893) |
| 0.0 | 0.3 | GO:1904264 | ubiquitin protein ligase activity involved in ERAD pathway(GO:1904264) |
| 0.0 | 0.1 | GO:0050567 | glutaminyl-tRNA synthase (glutamine-hydrolyzing) activity(GO:0050567) |
| 0.0 | 0.2 | GO:0015165 | pyrimidine nucleotide-sugar transmembrane transporter activity(GO:0015165) |
| 0.0 | 0.1 | GO:0042895 | antibiotic transporter activity(GO:0042895) |
| 0.0 | 0.4 | GO:0038036 | sphingosine-1-phosphate receptor activity(GO:0038036) |
| 0.0 | 0.1 | GO:0015226 | amino-acid betaine transmembrane transporter activity(GO:0015199) carnitine transmembrane transporter activity(GO:0015226) |
| 0.0 | 0.1 | GO:0004471 | malic enzyme activity(GO:0004470) malate dehydrogenase (decarboxylating) (NAD+) activity(GO:0004471) |
| 0.0 | 0.9 | GO:0017075 | syntaxin-1 binding(GO:0017075) |
| 0.0 | 0.3 | GO:0004571 | mannosyl-oligosaccharide 1,2-alpha-mannosidase activity(GO:0004571) |
| 0.0 | 0.8 | GO:0070064 | proline-rich region binding(GO:0070064) |
| 0.0 | 0.2 | GO:0004165 | dodecenoyl-CoA delta-isomerase activity(GO:0004165) |
| 0.0 | 0.2 | GO:0005042 | netrin receptor activity(GO:0005042) |
| 0.0 | 2.2 | GO:0004869 | cysteine-type endopeptidase inhibitor activity(GO:0004869) |
| 0.0 | 0.3 | GO:0003810 | protein-glutamine gamma-glutamyltransferase activity(GO:0003810) |
| 0.0 | 0.2 | GO:0046974 | histone methyltransferase activity (H3-K9 specific)(GO:0046974) |
| 0.0 | 0.3 | GO:0001588 | dopamine neurotransmitter receptor activity, coupled via Gs(GO:0001588) |
| 0.0 | 0.2 | GO:0004127 | cytidylate kinase activity(GO:0004127) |
| 0.0 | 0.5 | GO:0035198 | miRNA binding(GO:0035198) |
| 0.0 | 0.2 | GO:0034604 | pyruvate dehydrogenase activity(GO:0004738) pyruvate dehydrogenase [NAD(P)+] activity(GO:0034603) pyruvate dehydrogenase (NAD+) activity(GO:0034604) |
| 0.0 | 0.2 | GO:0030550 | acetylcholine receptor inhibitor activity(GO:0030550) |
| 0.0 | 0.1 | GO:0016941 | natriuretic peptide receptor activity(GO:0016941) |
| 0.0 | 0.2 | GO:0000268 | peroxisome targeting sequence binding(GO:0000268) |
| 0.0 | 0.2 | GO:0004459 | L-lactate dehydrogenase activity(GO:0004459) |
| 0.0 | 0.2 | GO:0016833 | oxo-acid-lyase activity(GO:0016833) |
| 0.0 | 0.1 | GO:0001642 | group III metabotropic glutamate receptor activity(GO:0001642) |
| 0.0 | 0.8 | GO:0001056 | RNA polymerase III activity(GO:0001056) |
| 0.0 | 0.1 | GO:0035650 | AP-1 adaptor complex binding(GO:0035650) |
| 0.0 | 0.1 | GO:0008184 | glycogen phosphorylase activity(GO:0008184) |
| 0.0 | 0.6 | GO:0017056 | structural constituent of nuclear pore(GO:0017056) |
| 0.0 | 0.1 | GO:0072542 | protein phosphatase activator activity(GO:0072542) |
| 0.0 | 0.5 | GO:1990841 | promoter-specific chromatin binding(GO:1990841) |
| 0.0 | 0.7 | GO:0005528 | macrolide binding(GO:0005527) FK506 binding(GO:0005528) |
| 0.0 | 0.2 | GO:0034235 | GPI anchor binding(GO:0034235) |
| 0.0 | 0.1 | GO:0004703 | G-protein coupled receptor kinase activity(GO:0004703) |
| 0.0 | 0.1 | GO:0004924 | oncostatin-M receptor activity(GO:0004924) |
| 0.0 | 0.3 | GO:0016888 | endodeoxyribonuclease activity, producing 5'-phosphomonoesters(GO:0016888) |
| 0.0 | 0.2 | GO:0032050 | clathrin heavy chain binding(GO:0032050) |
| 0.0 | 0.1 | GO:0016823 | hydrolase activity, acting on acid carbon-carbon bonds(GO:0016822) hydrolase activity, acting on acid carbon-carbon bonds, in ketonic substances(GO:0016823) |
| 0.0 | 0.6 | GO:0042800 | histone methyltransferase activity (H3-K4 specific)(GO:0042800) |
| 0.0 | 0.3 | GO:0043008 | ATP-dependent protein binding(GO:0043008) |
| 0.0 | 0.2 | GO:0052833 | inositol monophosphate 1-phosphatase activity(GO:0008934) inositol monophosphate 3-phosphatase activity(GO:0052832) inositol monophosphate 4-phosphatase activity(GO:0052833) inositol monophosphate phosphatase activity(GO:0052834) |
| 0.0 | 0.1 | GO:0004016 | adenylate cyclase activity(GO:0004016) |
| 0.0 | 0.3 | GO:0004415 | hyalurononglucosaminidase activity(GO:0004415) |
| 0.0 | 0.3 | GO:0031701 | angiotensin receptor binding(GO:0031701) |
| 0.0 | 0.9 | GO:0051990 | (R)-2-hydroxyglutarate dehydrogenase activity(GO:0051990) |
| 0.0 | 0.1 | GO:0004427 | inorganic diphosphatase activity(GO:0004427) |
| 0.0 | 0.6 | GO:0051019 | mitogen-activated protein kinase binding(GO:0051019) |
| 0.0 | 0.3 | GO:0015245 | fatty acid transporter activity(GO:0015245) |
| 0.0 | 0.1 | GO:0070905 | serine binding(GO:0070905) |
| 0.0 | 0.1 | GO:0016742 | hydroxymethyl-, formyl- and related transferase activity(GO:0016742) |
| 0.0 | 0.9 | GO:0019894 | kinesin binding(GO:0019894) |
| 0.0 | 0.9 | GO:0051059 | NF-kappaB binding(GO:0051059) |
| 0.0 | 1.1 | GO:0061631 | ubiquitin conjugating enzyme activity(GO:0061631) |
| 0.0 | 0.2 | GO:0051371 | muscle alpha-actinin binding(GO:0051371) |
| 0.0 | 0.7 | GO:0070003 | threonine-type endopeptidase activity(GO:0004298) threonine-type peptidase activity(GO:0070003) |
| 0.0 | 0.4 | GO:0030676 | Rac guanyl-nucleotide exchange factor activity(GO:0030676) |
| 0.0 | 0.3 | GO:0004176 | ATP-dependent peptidase activity(GO:0004176) |
| 0.0 | 0.1 | GO:0031694 | alpha-2A adrenergic receptor binding(GO:0031694) |
| 0.0 | 0.1 | GO:1990050 | phosphatidic acid transporter activity(GO:1990050) |
| 0.0 | 0.2 | GO:0018636 | phenanthrene 9,10-monooxygenase activity(GO:0018636) |
| 0.0 | 0.0 | GO:0031852 | mu-type opioid receptor binding(GO:0031852) |
| 0.0 | 0.1 | GO:0005030 | neurotrophin receptor activity(GO:0005030) |
| 0.0 | 2.5 | GO:0004540 | ribonuclease activity(GO:0004540) |
| 0.0 | 0.1 | GO:0019153 | protein-disulfide reductase (glutathione) activity(GO:0019153) |
| 0.0 | 0.8 | GO:0005212 | structural constituent of eye lens(GO:0005212) |
| 0.0 | 0.1 | GO:0008900 | hydrogen:potassium-exchanging ATPase activity(GO:0008900) |
| 0.0 | 0.3 | GO:0005452 | inorganic anion exchanger activity(GO:0005452) |
| 0.0 | 0.1 | GO:0030621 | U4 snRNA binding(GO:0030621) |
| 0.0 | 0.1 | GO:0004060 | arylamine N-acetyltransferase activity(GO:0004060) |
| 0.0 | 0.9 | GO:0017112 | Rab guanyl-nucleotide exchange factor activity(GO:0017112) |
| 0.0 | 0.1 | GO:0098518 | polynucleotide phosphatase activity(GO:0098518) |
| 0.0 | 0.1 | GO:0008853 | exodeoxyribonuclease III activity(GO:0008853) |
| 0.0 | 0.1 | GO:0042609 | CD4 receptor binding(GO:0042609) |
| 0.0 | 0.1 | GO:0005220 | inositol 1,4,5-trisphosphate-sensitive calcium-release channel activity(GO:0005220) |
| 0.0 | 0.2 | GO:0008526 | phosphatidylinositol transporter activity(GO:0008526) |
| 0.0 | 2.8 | GO:0001078 | transcriptional repressor activity, RNA polymerase II core promoter proximal region sequence-specific binding(GO:0001078) |
| 0.0 | 0.2 | GO:0015189 | arginine transmembrane transporter activity(GO:0015181) L-lysine transmembrane transporter activity(GO:0015189) |
| 0.0 | 0.2 | GO:0000150 | recombinase activity(GO:0000150) |
| 0.0 | 0.2 | GO:0004596 | peptide alpha-N-acetyltransferase activity(GO:0004596) |
| 0.0 | 0.1 | GO:0046935 | 1-phosphatidylinositol-3-kinase regulator activity(GO:0046935) |
| 0.0 | 0.3 | GO:0043422 | protein kinase B binding(GO:0043422) |
| 0.0 | 0.1 | GO:0043559 | insulin binding(GO:0043559) |
| 0.0 | 0.1 | GO:0031749 | D2 dopamine receptor binding(GO:0031749) |
| 0.0 | 0.2 | GO:0005041 | low-density lipoprotein receptor activity(GO:0005041) |
| 0.0 | 0.1 | GO:0016889 | endodeoxyribonuclease activity, producing 3'-phosphomonoesters(GO:0016889) |
| 0.0 | 0.1 | GO:0004792 | thiosulfate sulfurtransferase activity(GO:0004792) |
| 0.0 | 0.1 | GO:0042015 | interleukin-20 binding(GO:0042015) |
| 0.0 | 0.3 | GO:0042500 | aspartic endopeptidase activity, intramembrane cleaving(GO:0042500) |
| 0.0 | 0.2 | GO:0005229 | intracellular calcium activated chloride channel activity(GO:0005229) |
| 0.0 | 0.0 | GO:0034618 | arginine binding(GO:0034618) |
| 0.0 | 0.1 | GO:0030371 | translation repressor activity(GO:0030371) |
| 0.0 | 0.1 | GO:0070051 | fibrinogen binding(GO:0070051) |
| 0.0 | 0.1 | GO:0004582 | dolichyl-phosphate beta-D-mannosyltransferase activity(GO:0004582) |
| 0.0 | 0.8 | GO:0004402 | histone acetyltransferase activity(GO:0004402) |
| 0.0 | 0.1 | GO:0008532 | N-acetyllactosaminide beta-1,3-N-acetylglucosaminyltransferase activity(GO:0008532) |
| 0.0 | 0.7 | GO:0030507 | spectrin binding(GO:0030507) |
| 0.0 | 0.8 | GO:0005484 | SNAP receptor activity(GO:0005484) |
| 0.0 | 0.1 | GO:0005128 | erythropoietin receptor binding(GO:0005128) |
| 0.0 | 0.1 | GO:0004468 | lysine N-acetyltransferase activity, acting on acetyl phosphate as donor(GO:0004468) |
| 0.0 | 0.4 | GO:0017134 | fibroblast growth factor binding(GO:0017134) |
| 0.0 | 0.1 | GO:0004994 | somatostatin receptor activity(GO:0004994) |
| 0.0 | 0.1 | GO:0031493 | nucleosomal histone binding(GO:0031493) |
| 0.0 | 0.1 | GO:0004699 | calcium-independent protein kinase C activity(GO:0004699) |
| 0.0 | 0.3 | GO:0008198 | ferrous iron binding(GO:0008198) |
| 0.0 | 0.7 | GO:0019212 | phosphatase inhibitor activity(GO:0019212) |
| 0.0 | 0.1 | GO:0070996 | type 1 melanocortin receptor binding(GO:0070996) |
| 0.0 | 0.1 | GO:0032027 | myosin light chain binding(GO:0032027) |
| 0.0 | 0.1 | GO:0046624 | sphingolipid transporter activity(GO:0046624) |
| 0.0 | 0.2 | GO:0031994 | insulin-like growth factor I binding(GO:0031994) |
| 0.0 | 0.0 | GO:0008504 | monoamine transmembrane transporter activity(GO:0008504) |
| 0.0 | 0.1 | GO:0051959 | dynein light intermediate chain binding(GO:0051959) |
| 0.0 | 0.1 | GO:0016303 | 1-phosphatidylinositol-3-kinase activity(GO:0016303) |
| 0.0 | 0.1 | GO:0004920 | interleukin-10 receptor activity(GO:0004920) |
| 0.0 | 0.0 | GO:0035651 | AP-3 adaptor complex binding(GO:0035651) |
| 0.0 | 0.4 | GO:0004089 | carbonate dehydratase activity(GO:0004089) |
| 0.0 | 0.2 | GO:0051378 | serotonin binding(GO:0051378) |
| 0.0 | 0.1 | GO:0098639 | collagen binding involved in cell-matrix adhesion(GO:0098639) |
| 0.0 | 1.5 | GO:0008565 | protein transporter activity(GO:0008565) |
| 0.0 | 0.3 | GO:0008601 | protein phosphatase type 2A regulator activity(GO:0008601) |
| 0.0 | 0.1 | GO:0097322 | 7SK snRNA binding(GO:0097322) |
| 0.0 | 0.0 | GO:0035877 | death effector domain binding(GO:0035877) |
| 0.0 | 0.2 | GO:0050321 | tau-protein kinase activity(GO:0050321) |
| 0.0 | 0.1 | GO:0016774 | phosphotransferase activity, carboxyl group as acceptor(GO:0016774) |
| 0.0 | 0.1 | GO:0032036 | myosin heavy chain binding(GO:0032036) |
| 0.0 | 0.4 | GO:0017025 | TBP-class protein binding(GO:0017025) |
| 0.0 | 1.7 | GO:0043130 | ubiquitin binding(GO:0043130) |
| 0.0 | 0.2 | GO:0017160 | Ral GTPase binding(GO:0017160) |
| 0.0 | 0.2 | GO:0034987 | immunoglobulin receptor binding(GO:0034987) |
| 0.0 | 0.2 | GO:0070513 | death domain binding(GO:0070513) |
| 0.0 | 0.0 | GO:0070052 | collagen V binding(GO:0070052) |
| 0.0 | 0.1 | GO:0016421 | CoA carboxylase activity(GO:0016421) |
| 0.0 | 0.4 | GO:0008519 | ammonium transmembrane transporter activity(GO:0008519) |
| 0.0 | 0.0 | GO:0050693 | LBD domain binding(GO:0050693) |
| 0.0 | 0.3 | GO:0008307 | structural constituent of muscle(GO:0008307) |
| 0.0 | 0.2 | GO:0009922 | fatty acid elongase activity(GO:0009922) 3-oxo-arachidoyl-CoA synthase activity(GO:0102336) 3-oxo-cerotoyl-CoA synthase activity(GO:0102337) 3-oxo-lignoceronyl-CoA synthase activity(GO:0102338) |
| 0.0 | 0.1 | GO:0004849 | uridine kinase activity(GO:0004849) |
| 0.0 | 0.6 | GO:0016709 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, NAD(P)H as one donor, and incorporation of one atom of oxygen(GO:0016709) |
| 0.0 | 0.0 | GO:0019961 | interferon binding(GO:0019961) |
| 0.0 | 0.1 | GO:0005007 | fibroblast growth factor-activated receptor activity(GO:0005007) |
| 0.0 | 0.1 | GO:0001640 | adenylate cyclase inhibiting G-protein coupled glutamate receptor activity(GO:0001640) |
| 0.0 | 0.6 | GO:0031369 | translation initiation factor binding(GO:0031369) |
| 0.0 | 0.2 | GO:0070180 | large ribosomal subunit rRNA binding(GO:0070180) |
| 0.0 | 0.1 | GO:0048038 | quinone binding(GO:0048038) |
| 0.0 | 0.1 | GO:0005168 | neurotrophin TRKA receptor binding(GO:0005168) |
| 0.0 | 0.5 | GO:0015347 | sodium-independent organic anion transmembrane transporter activity(GO:0015347) |
| 0.0 | 0.1 | GO:0003976 | UDP-N-acetylglucosamine-lysosomal-enzyme N-acetylglucosaminephosphotransferase activity(GO:0003976) |
| 0.0 | 0.0 | GO:0016262 | protein N-acetylglucosaminyltransferase activity(GO:0016262) |
| 0.0 | 0.1 | GO:0016176 | superoxide-generating NADPH oxidase activator activity(GO:0016176) |
| 0.0 | 0.0 | GO:0071617 | lysophospholipid acyltransferase activity(GO:0071617) |
| 0.0 | 0.2 | GO:0048018 | receptor agonist activity(GO:0048018) |
| 0.0 | 0.1 | GO:0004614 | phosphoglucomutase activity(GO:0004614) |
| 0.0 | 0.2 | GO:0051428 | peptide hormone receptor binding(GO:0051428) |
| 0.0 | 0.0 | GO:0051920 | peroxiredoxin activity(GO:0051920) |
| 0.0 | 0.1 | GO:0010997 | anaphase-promoting complex binding(GO:0010997) |
| 0.0 | 0.1 | GO:0016494 | C-X-C chemokine receptor activity(GO:0016494) |
| 0.0 | 0.3 | GO:0017049 | GTP-Rho binding(GO:0017049) |
| 0.0 | 0.2 | GO:0005313 | L-glutamate transmembrane transporter activity(GO:0005313) |
| 0.0 | 0.1 | GO:0000774 | adenyl-nucleotide exchange factor activity(GO:0000774) |
| 0.0 | 0.3 | GO:0016500 | protein-hormone receptor activity(GO:0016500) |
| 0.0 | 0.2 | GO:0043142 | single-stranded DNA-dependent ATPase activity(GO:0043142) |
| 0.0 | 0.0 | GO:0004939 | beta-adrenergic receptor activity(GO:0004939) |
| 0.0 | 0.1 | GO:0002162 | dystroglycan binding(GO:0002162) |
| 0.0 | 0.2 | GO:0004568 | chitinase activity(GO:0004568) |
| 0.0 | 0.1 | GO:0017040 | ceramidase activity(GO:0017040) |
| 0.0 | 0.1 | GO:0005134 | interleukin-2 receptor binding(GO:0005134) |
| 0.0 | 0.1 | GO:0008381 | mechanically-gated ion channel activity(GO:0008381) mechanically gated channel activity(GO:0022833) |
| 0.0 | 0.1 | GO:0070402 | NADPH binding(GO:0070402) |
| 0.0 | 0.2 | GO:0004143 | diacylglycerol kinase activity(GO:0004143) |
| 0.0 | 0.1 | GO:0016886 | ligase activity, forming phosphoric ester bonds(GO:0016886) |
| 0.0 | 0.3 | GO:0070063 | RNA polymerase binding(GO:0070063) |
| 0.0 | 0.0 | GO:0008139 | nuclear localization sequence binding(GO:0008139) |
| 0.0 | 0.0 | GO:0004673 | protein histidine kinase activity(GO:0004673) |
| 0.0 | 0.0 | GO:0035939 | microsatellite binding(GO:0035939) |
| 0.0 | 0.1 | GO:0030942 | endoplasmic reticulum signal peptide binding(GO:0030942) |
| 0.0 | 0.2 | GO:0051537 | 2 iron, 2 sulfur cluster binding(GO:0051537) |
| 0.0 | 0.1 | GO:0001054 | RNA polymerase I activity(GO:0001054) |
| 0.0 | 0.5 | GO:0017147 | Wnt-protein binding(GO:0017147) |
| 0.0 | 0.0 | GO:0061665 | SUMO ligase activity(GO:0061665) |
| 0.0 | 0.1 | GO:0003840 | gamma-glutamyltransferase activity(GO:0003840) glutathione hydrolase activity(GO:0036374) |
| 0.0 | 0.3 | GO:0005540 | hyaluronic acid binding(GO:0005540) |
| 0.0 | 0.0 | GO:0098821 | BMP receptor activity(GO:0098821) |
| 0.0 | 0.0 | GO:0043423 | 3-phosphoinositide-dependent protein kinase binding(GO:0043423) |
| 0.0 | 0.0 | GO:0042030 | ATPase inhibitor activity(GO:0042030) |
| 0.0 | 0.1 | GO:0016783 | sulfurtransferase activity(GO:0016783) |
| 0.0 | 0.1 | GO:0004438 | phosphatidylinositol-3-phosphatase activity(GO:0004438) |
| 0.0 | 0.0 | GO:0015319 | sodium:inorganic phosphate symporter activity(GO:0015319) |
| 0.0 | 2.0 | GO:0003729 | mRNA binding(GO:0003729) |
| 0.0 | 0.0 | GO:0016635 | oxidoreductase activity, acting on the CH-CH group of donors, quinone or related compound as acceptor(GO:0016635) |
| 0.0 | 0.1 | GO:0019215 | intermediate filament binding(GO:0019215) |
| 0.0 | 0.0 | GO:0098988 | G-protein coupled glutamate receptor activity(GO:0098988) |
| 0.0 | 0.1 | GO:0004017 | adenylate kinase activity(GO:0004017) |
| 0.0 | 0.2 | GO:0030544 | Hsp70 protein binding(GO:0030544) |
| 0.0 | 0.3 | GO:0019706 | protein-cysteine S-palmitoyltransferase activity(GO:0019706) |
| 0.0 | 0.3 | GO:0008137 | NADH dehydrogenase (ubiquinone) activity(GO:0008137) NADH dehydrogenase (quinone) activity(GO:0050136) |
| 0.0 | 0.1 | GO:0036137 | kynurenine-oxoglutarate transaminase activity(GO:0016212) kynurenine aminotransferase activity(GO:0036137) |
| 0.0 | 0.0 | GO:0003954 | NADH dehydrogenase activity(GO:0003954) |
| 0.0 | 0.1 | GO:0045294 | alpha-catenin binding(GO:0045294) |
| 0.0 | 0.2 | GO:0030742 | GTP-dependent protein binding(GO:0030742) |
| 0.0 | 0.1 | GO:0005280 | hydrogen:amino acid symporter activity(GO:0005280) |
| 0.0 | 0.0 | GO:0051021 | GDP-dissociation inhibitor binding(GO:0051021) |
| 0.0 | 0.1 | GO:0008131 | primary amine oxidase activity(GO:0008131) |
| 0.0 | 0.5 | GO:0050840 | extracellular matrix binding(GO:0050840) |
| 0.0 | 0.1 | GO:0017091 | AU-rich element binding(GO:0017091) |
| 0.0 | 0.1 | GO:0036122 | BMP binding(GO:0036122) |
| 0.0 | 0.0 | GO:0004082 | bisphosphoglycerate mutase activity(GO:0004082) phosphoglycerate mutase activity(GO:0004619) 2,3-bisphosphoglycerate-dependent phosphoglycerate mutase activity(GO:0046538) |
| 0.0 | 0.2 | GO:0001784 | phosphotyrosine binding(GO:0001784) |
| 0.0 | 0.1 | GO:0070008 | serine-type exopeptidase activity(GO:0070008) |
| 0.0 | 0.0 | GO:0034584 | piRNA binding(GO:0034584) |
| 0.0 | 0.1 | GO:0051010 | microtubule plus-end binding(GO:0051010) |
| 0.0 | 0.0 | GO:0034416 | bisphosphoglycerate phosphatase activity(GO:0034416) |
| 0.0 | 0.1 | GO:0008484 | sulfuric ester hydrolase activity(GO:0008484) |
| 0.0 | 0.9 | GO:0002020 | protease binding(GO:0002020) |
| 0.0 | 0.2 | GO:0001102 | RNA polymerase II activating transcription factor binding(GO:0001102) |
| 0.0 | 0.1 | GO:0019103 | pyrimidine nucleotide binding(GO:0019103) |
| 0.0 | 0.0 | GO:0016286 | small conductance calcium-activated potassium channel activity(GO:0016286) |
| 0.0 | 0.1 | GO:0035259 | glucocorticoid receptor binding(GO:0035259) |
| 0.0 | 0.6 | GO:0035251 | UDP-glucosyltransferase activity(GO:0035251) |
| 0.0 | 0.2 | GO:0005385 | zinc ion transmembrane transporter activity(GO:0005385) |
| 0.0 | 0.0 | GO:0019797 | procollagen-proline 3-dioxygenase activity(GO:0019797) |
| 0.0 | 0.0 | GO:0032051 | clathrin light chain binding(GO:0032051) |
| 0.0 | 0.0 | GO:0000405 | bubble DNA binding(GO:0000405) |
| 0.0 | 0.1 | GO:0008318 | protein prenyltransferase activity(GO:0008318) |
| 0.0 | 0.0 | GO:0043199 | sulfate binding(GO:0043199) |
| 0.0 | 0.1 | GO:0032183 | SUMO binding(GO:0032183) |
| 0.0 | 0.0 | GO:0043176 | amine binding(GO:0043176) |
| 0.0 | 0.4 | GO:0003743 | translation initiation factor activity(GO:0003743) |
| 0.0 | 0.1 | GO:0098847 | single-stranded telomeric DNA binding(GO:0043047) G-rich strand telomeric DNA binding(GO:0098505) sequence-specific single stranded DNA binding(GO:0098847) |
| 0.0 | 0.0 | GO:0043184 | vascular endothelial growth factor receptor 2 binding(GO:0043184) |
| 0.0 | 0.0 | GO:0005143 | interleukin-12 receptor binding(GO:0005143) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.2 | 0.5 | PID SHP2 PATHWAY | SHP2 signaling |
| 0.2 | 0.2 | PID ERBB4 PATHWAY | ErbB4 signaling events |
| 0.1 | 4.0 | PID REELIN PATHWAY | Reelin signaling pathway |
| 0.1 | 0.1 | PID ARF6 DOWNSTREAM PATHWAY | Arf6 downstream pathway |
| 0.1 | 4.7 | PID HNF3A PATHWAY | FOXA1 transcription factor network |
| 0.1 | 2.9 | PID GLYPICAN 1PATHWAY | Glypican 1 network |
| 0.1 | 0.7 | PID VEGF VEGFR PATHWAY | VEGF and VEGFR signaling network |
| 0.1 | 1.5 | PID DNA PK PATHWAY | DNA-PK pathway in nonhomologous end joining |
| 0.1 | 1.4 | PID LPA4 PATHWAY | LPA4-mediated signaling events |
| 0.1 | 1.0 | PID NETRIN PATHWAY | Netrin-mediated signaling events |
| 0.1 | 1.0 | PID IL2 PI3K PATHWAY | IL2 signaling events mediated by PI3K |
| 0.1 | 0.2 | PID WNT CANONICAL PATHWAY | Canonical Wnt signaling pathway |
| 0.1 | 2.2 | PID INTEGRIN A4B1 PATHWAY | Alpha4 beta1 integrin signaling events |
| 0.1 | 0.2 | PID HDAC CLASSIII PATHWAY | Signaling events mediated by HDAC Class III |
| 0.1 | 1.2 | PID KIT PATHWAY | Signaling events mediated by Stem cell factor receptor (c-Kit) |
| 0.1 | 2.0 | ST G ALPHA I PATHWAY | G alpha i Pathway |
| 0.1 | 1.4 | PID P38 ALPHA BETA PATHWAY | Regulation of p38-alpha and p38-beta |
| 0.1 | 0.4 | PID ARF6 TRAFFICKING PATHWAY | Arf6 trafficking events |
| 0.1 | 2.2 | PID TNF PATHWAY | TNF receptor signaling pathway |
| 0.1 | 1.8 | PID INSULIN PATHWAY | Insulin Pathway |
| 0.1 | 4.0 | PID BETA CATENIN NUC PATHWAY | Regulation of nuclear beta catenin signaling and target gene transcription |
| 0.1 | 0.3 | PID IGF1 PATHWAY | IGF1 pathway |
| 0.1 | 0.3 | PID NECTIN PATHWAY | Nectin adhesion pathway |
| 0.1 | 1.4 | PID A6B1 A6B4 INTEGRIN PATHWAY | a6b1 and a6b4 Integrin signaling |
| 0.1 | 0.9 | PID TCPTP PATHWAY | Signaling events mediated by TCPTP |
| 0.1 | 0.8 | PID IL1 PATHWAY | IL1-mediated signaling events |
| 0.1 | 0.5 | PID BETA CATENIN DEG PATHWAY | Degradation of beta catenin |
| 0.1 | 1.6 | PID ILK PATHWAY | Integrin-linked kinase signaling |
| 0.0 | 0.4 | PID IL5 PATHWAY | IL5-mediated signaling events |
| 0.0 | 1.6 | PID MET PATHWAY | Signaling events mediated by Hepatocyte Growth Factor Receptor (c-Met) |
| 0.0 | 2.1 | PID HIF1 TFPATHWAY | HIF-1-alpha transcription factor network |
| 0.0 | 0.3 | SA PROGRAMMED CELL DEATH | Programmed cell death, or apoptosis, eliminates damaged or unneeded cells. |
| 0.0 | 1.4 | PID BMP PATHWAY | BMP receptor signaling |
| 0.0 | 0.0 | ST GRANULE CELL SURVIVAL PATHWAY | Granule Cell Survival Pathway is a specific case of more general PAC1 Receptor Pathway. |
| 0.0 | 0.6 | PID EPHB FWD PATHWAY | EPHB forward signaling |
| 0.0 | 0.4 | PID MAPK TRK PATHWAY | Trk receptor signaling mediated by the MAPK pathway |
| 0.0 | 1.0 | PID CD8 TCR PATHWAY | TCR signaling in naïve CD8+ T cells |
| 0.0 | 0.6 | ST P38 MAPK PATHWAY | p38 MAPK Pathway |
| 0.0 | 1.0 | PID HEDGEHOG GLI PATHWAY | Hedgehog signaling events mediated by Gli proteins |
| 0.0 | 1.2 | PID DELTA NP63 PATHWAY | Validated transcriptional targets of deltaNp63 isoforms |
| 0.0 | 0.4 | SIG INSULIN RECEPTOR PATHWAY IN CARDIAC MYOCYTES | Genes related to the insulin receptor pathway |
| 0.0 | 0.3 | PID ALK1 PATHWAY | ALK1 signaling events |
| 0.0 | 0.1 | SA B CELL RECEPTOR COMPLEXES | Antigen binding to B cell receptors activates protein tyrosine kinases, such as the Src family, which ultimate activate MAP kinases. |
| 0.0 | 1.5 | WNT SIGNALING | Genes related to Wnt-mediated signal transduction |
| 0.0 | 0.4 | PID NFAT TFPATHWAY | Calcineurin-regulated NFAT-dependent transcription in lymphocytes |
| 0.0 | 0.2 | PID HIF1A PATHWAY | Hypoxic and oxygen homeostasis regulation of HIF-1-alpha |
| 0.0 | 0.1 | PID NFKAPPAB ATYPICAL PATHWAY | Atypical NF-kappaB pathway |
| 0.0 | 0.6 | PID RAC1 REG PATHWAY | Regulation of RAC1 activity |
| 0.0 | 0.4 | PID AURORA A PATHWAY | Aurora A signaling |
| 0.0 | 0.4 | PID FCER1 PATHWAY | Fc-epsilon receptor I signaling in mast cells |
| 0.0 | 0.7 | PID INTEGRIN3 PATHWAY | Beta3 integrin cell surface interactions |
| 0.0 | 0.0 | SA CASPASE CASCADE | Apoptosis is mediated by caspases, cysteine proteases arranged in a proteolytic cascade. |
| 0.0 | 0.3 | PID ECADHERIN NASCENT AJ PATHWAY | E-cadherin signaling in the nascent adherens junction |
| 0.0 | 0.2 | PID INTEGRIN A9B1 PATHWAY | Alpha9 beta1 integrin signaling events |
| 0.0 | 0.2 | PID SYNDECAN 4 PATHWAY | Syndecan-4-mediated signaling events |
| 0.0 | 0.1 | PID INSULIN GLUCOSE PATHWAY | Insulin-mediated glucose transport |
| 0.0 | 0.0 | PID SMAD2 3PATHWAY | Regulation of cytoplasmic and nuclear SMAD2/3 signaling |
| 0.0 | 0.1 | PID EPHA2 FWD PATHWAY | EPHA2 forward signaling |
| 0.0 | 0.2 | ST DIFFERENTIATION PATHWAY IN PC12 CELLS | Differentiation Pathway in PC12 Cells; this is a specific case of PAC1 Receptor Pathway. |
| 0.0 | 0.1 | PID HDAC CLASSII PATHWAY | Signaling events mediated by HDAC Class II |
| 0.0 | 0.3 | PID EPHA FWDPATHWAY | EPHA forward signaling |
| 0.0 | 0.1 | PID IL12 STAT4 PATHWAY | IL12 signaling mediated by STAT4 |
| 0.0 | 0.2 | PID ATM PATHWAY | ATM pathway |
| 0.0 | 0.4 | PID IL12 2PATHWAY | IL12-mediated signaling events |
| 0.0 | 0.1 | PID ERB GENOMIC PATHWAY | Validated nuclear estrogen receptor beta network |
| 0.0 | 0.4 | PID P53 REGULATION PATHWAY | p53 pathway |
| 0.0 | 0.2 | PID ARF6 PATHWAY | Arf6 signaling events |
| 0.0 | 0.1 | ST ADRENERGIC | Adrenergic Pathway |
| 0.0 | 0.1 | PID ALPHA SYNUCLEIN PATHWAY | Alpha-synuclein signaling |
| 0.0 | 0.3 | PID LKB1 PATHWAY | LKB1 signaling events |
| 0.0 | 2.2 | NABA ECM REGULATORS | Genes encoding enzymes and their regulators involved in the remodeling of the extracellular matrix |
| 0.0 | 0.0 | PID EPHRINB REV PATHWAY | Ephrin B reverse signaling |
| 0.0 | 0.0 | PID PI3K PLC TRK PATHWAY | Trk receptor signaling mediated by PI3K and PLC-gamma |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.2 | 3.7 | REACTOME CHYLOMICRON MEDIATED LIPID TRANSPORT | Genes involved in Chylomicron-mediated lipid transport |
| 0.2 | 2.5 | REACTOME DOWNREGULATION OF ERBB2 ERBB3 SIGNALING | Genes involved in Downregulation of ERBB2:ERBB3 signaling |
| 0.2 | 1.0 | REACTOME GLYCOPROTEIN HORMONES | Genes involved in Glycoprotein hormones |
| 0.2 | 5.2 | REACTOME MYOGENESIS | Genes involved in Myogenesis |
| 0.2 | 3.4 | REACTOME SEMA4D INDUCED CELL MIGRATION AND GROWTH CONE COLLAPSE | Genes involved in Sema4D induced cell migration and growth-cone collapse |
| 0.2 | 2.0 | REACTOME SEMA3A PLEXIN REPULSION SIGNALING BY INHIBITING INTEGRIN ADHESION | Genes involved in SEMA3A-Plexin repulsion signaling by inhibiting Integrin adhesion |
| 0.2 | 1.7 | REACTOME FORMATION OF ATP BY CHEMIOSMOTIC COUPLING | Genes involved in Formation of ATP by chemiosmotic coupling |
| 0.1 | 1.5 | REACTOME ADENYLATE CYCLASE ACTIVATING PATHWAY | Genes involved in Adenylate cyclase activating pathway |
| 0.1 | 0.7 | REACTOME REGULATION OF THE FANCONI ANEMIA PATHWAY | Genes involved in Regulation of the Fanconi anemia pathway |
| 0.1 | 1.1 | REACTOME RNA POL III TRANSCRIPTION INITIATION FROM TYPE 3 PROMOTER | Genes involved in RNA Polymerase III Transcription Initiation From Type 3 Promoter |
| 0.1 | 1.2 | REACTOME HORMONE LIGAND BINDING RECEPTORS | Genes involved in Hormone ligand-binding receptors |
| 0.1 | 2.6 | REACTOME CHOLESTEROL BIOSYNTHESIS | Genes involved in Cholesterol biosynthesis |
| 0.1 | 1.5 | REACTOME GABA A RECEPTOR ACTIVATION | Genes involved in GABA A receptor activation |
| 0.1 | 3.4 | REACTOME SPHINGOLIPID DE NOVO BIOSYNTHESIS | Genes involved in Sphingolipid de novo biosynthesis |
| 0.1 | 1.1 | REACTOME CTNNB1 PHOSPHORYLATION CASCADE | Genes involved in Beta-catenin phosphorylation cascade |
| 0.1 | 1.4 | REACTOME PYRIMIDINE CATABOLISM | Genes involved in Pyrimidine catabolism |
| 0.1 | 2.2 | REACTOME RNA POL III TRANSCRIPTION TERMINATION | Genes involved in RNA Polymerase III Transcription Termination |
| 0.1 | 1.4 | REACTOME PYRIMIDINE METABOLISM | Genes involved in Pyrimidine metabolism |
| 0.1 | 1.8 | REACTOME PRE NOTCH PROCESSING IN GOLGI | Genes involved in Pre-NOTCH Processing in Golgi |
| 0.1 | 2.6 | REACTOME ASSOCIATION OF TRIC CCT WITH TARGET PROTEINS DURING BIOSYNTHESIS | Genes involved in Association of TriC/CCT with target proteins during biosynthesis |
| 0.1 | 0.6 | REACTOME P38MAPK EVENTS | Genes involved in p38MAPK events |
| 0.1 | 1.3 | REACTOME ANTIGEN PRESENTATION FOLDING ASSEMBLY AND PEPTIDE LOADING OF CLASS I MHC | Genes involved in Antigen Presentation: Folding, assembly and peptide loading of class I MHC |
| 0.1 | 1.2 | REACTOME CELL EXTRACELLULAR MATRIX INTERACTIONS | Genes involved in Cell-extracellular matrix interactions |
| 0.1 | 1.6 | REACTOME TIE2 SIGNALING | Genes involved in Tie2 Signaling |
| 0.1 | 0.9 | REACTOME PROLACTIN RECEPTOR SIGNALING | Genes involved in Prolactin receptor signaling |
| 0.1 | 2.1 | REACTOME INHIBITION OF INSULIN SECRETION BY ADRENALINE NORADRENALINE | Genes involved in Inhibition of Insulin Secretion by Adrenaline/Noradrenaline |
| 0.1 | 0.2 | REACTOME ENDOSOMAL VACUOLAR PATHWAY | Genes involved in Endosomal/Vacuolar pathway |
| 0.1 | 1.2 | REACTOME METABOLISM OF PORPHYRINS | Genes involved in Metabolism of porphyrins |
| 0.1 | 1.2 | REACTOME P130CAS LINKAGE TO MAPK SIGNALING FOR INTEGRINS | Genes involved in p130Cas linkage to MAPK signaling for integrins |
| 0.1 | 1.0 | REACTOME SYNTHESIS OF PIPS AT THE EARLY ENDOSOME MEMBRANE | Genes involved in Synthesis of PIPs at the early endosome membrane |
| 0.1 | 0.6 | REACTOME SIGNAL REGULATORY PROTEIN SIRP FAMILY INTERACTIONS | Genes involved in Signal regulatory protein (SIRP) family interactions |
| 0.1 | 1.5 | REACTOME ADHERENS JUNCTIONS INTERACTIONS | Genes involved in Adherens junctions interactions |
| 0.1 | 1.6 | REACTOME PEROXISOMAL LIPID METABOLISM | Genes involved in Peroxisomal lipid metabolism |
| 0.1 | 0.5 | REACTOME NEPHRIN INTERACTIONS | Genes involved in Nephrin interactions |
| 0.1 | 0.6 | REACTOME TRANSPORT OF ORGANIC ANIONS | Genes involved in Transport of organic anions |
| 0.1 | 0.5 | REACTOME PURINE CATABOLISM | Genes involved in Purine catabolism |
| 0.1 | 0.1 | REACTOME ABORTIVE ELONGATION OF HIV1 TRANSCRIPT IN THE ABSENCE OF TAT | Genes involved in Abortive elongation of HIV-1 transcript in the absence of Tat |
| 0.1 | 1.6 | REACTOME FGFR LIGAND BINDING AND ACTIVATION | Genes involved in FGFR ligand binding and activation |
| 0.1 | 0.6 | REACTOME COMMON PATHWAY | Genes involved in Common Pathway |
| 0.1 | 1.0 | REACTOME REGULATION OF INSULIN LIKE GROWTH FACTOR IGF ACTIVITY BY INSULIN LIKE GROWTH FACTOR BINDING PROTEINS IGFBPS | Genes involved in Regulation of Insulin-like Growth Factor (IGF) Activity by Insulin-like Growth Factor Binding Proteins (IGFBPs) |
| 0.1 | 0.8 | REACTOME CASPASE MEDIATED CLEAVAGE OF CYTOSKELETAL PROTEINS | Genes involved in Caspase-mediated cleavage of cytoskeletal proteins |
| 0.1 | 1.1 | REACTOME REGULATORY RNA PATHWAYS | Genes involved in Regulatory RNA pathways |
| 0.1 | 3.9 | REACTOME RESPONSE TO ELEVATED PLATELET CYTOSOLIC CA2 | Genes involved in Response to elevated platelet cytosolic Ca2+ |
| 0.1 | 0.7 | REACTOME PURINE RIBONUCLEOSIDE MONOPHOSPHATE BIOSYNTHESIS | Genes involved in Purine ribonucleoside monophosphate biosynthesis |
| 0.1 | 1.3 | REACTOME DARPP 32 EVENTS | Genes involved in DARPP-32 events |
| 0.1 | 1.7 | REACTOME NEP NS2 INTERACTS WITH THE CELLULAR EXPORT MACHINERY | Genes involved in NEP/NS2 Interacts with the Cellular Export Machinery |
| 0.1 | 1.4 | REACTOME SIGNALING BY BMP | Genes involved in Signaling by BMP |
| 0.1 | 0.2 | REACTOME G BETA GAMMA SIGNALLING THROUGH PI3KGAMMA | Genes involved in G beta:gamma signalling through PI3Kgamma |
| 0.1 | 0.5 | REACTOME SIGNAL ATTENUATION | Genes involved in Signal attenuation |
| 0.1 | 3.5 | REACTOME RESPIRATORY ELECTRON TRANSPORT | Genes involved in Respiratory electron transport |
| 0.1 | 1.2 | REACTOME YAP1 AND WWTR1 TAZ STIMULATED GENE EXPRESSION | Genes involved in YAP1- and WWTR1 (TAZ)-stimulated gene expression |
| 0.1 | 0.3 | REACTOME IRAK2 MEDIATED ACTIVATION OF TAK1 COMPLEX UPON TLR7 8 OR 9 STIMULATION | Genes involved in IRAK2 mediated activation of TAK1 complex upon TLR7/8 or 9 stimulation |
| 0.1 | 0.6 | REACTOME RAP1 SIGNALLING | Genes involved in Rap1 signalling |
| 0.1 | 2.3 | REACTOME VOLTAGE GATED POTASSIUM CHANNELS | Genes involved in Voltage gated Potassium channels |
| 0.1 | 0.1 | REACTOME APC CDC20 MEDIATED DEGRADATION OF NEK2A | Genes involved in APC-Cdc20 mediated degradation of Nek2A |
| 0.1 | 0.5 | REACTOME CIRCADIAN REPRESSION OF EXPRESSION BY REV ERBA | Genes involved in Circadian Repression of Expression by REV-ERBA |
| 0.1 | 1.1 | REACTOME METABOLISM OF NON CODING RNA | Genes involved in Metabolism of non-coding RNA |
| 0.0 | 0.8 | REACTOME NOD1 2 SIGNALING PATHWAY | Genes involved in NOD1/2 Signaling Pathway |
| 0.0 | 0.0 | REACTOME CONVERSION FROM APC C CDC20 TO APC C CDH1 IN LATE ANAPHASE | Genes involved in Conversion from APC/C:Cdc20 to APC/C:Cdh1 in late anaphase |
| 0.0 | 0.2 | REACTOME VEGF LIGAND RECEPTOR INTERACTIONS | Genes involved in VEGF ligand-receptor interactions |
| 0.0 | 0.4 | REACTOME THE ACTIVATION OF ARYLSULFATASES | Genes involved in The activation of arylsulfatases |
| 0.0 | 0.9 | REACTOME IL1 SIGNALING | Genes involved in Interleukin-1 signaling |
| 0.0 | 0.5 | REACTOME REGULATION OF SIGNALING BY CBL | Genes involved in Regulation of signaling by CBL |
| 0.0 | 0.3 | REACTOME G PROTEIN ACTIVATION | Genes involved in G-protein activation |
| 0.0 | 2.7 | REACTOME MITOTIC PROMETAPHASE | Genes involved in Mitotic Prometaphase |
| 0.0 | 0.6 | REACTOME REGULATION OF AMPK ACTIVITY VIA LKB1 | Genes involved in Regulation of AMPK activity via LKB1 |
| 0.0 | 0.2 | REACTOME CRMPS IN SEMA3A SIGNALING | Genes involved in CRMPs in Sema3A signaling |
| 0.0 | 0.4 | REACTOME TANDEM PORE DOMAIN POTASSIUM CHANNELS | Genes involved in Tandem pore domain potassium channels |
| 0.0 | 0.1 | REACTOME RNA POL I PROMOTER OPENING | Genes involved in RNA Polymerase I Promoter Opening |
| 0.0 | 1.9 | REACTOME DESTABILIZATION OF MRNA BY AUF1 HNRNP D0 | Genes involved in Destabilization of mRNA by AUF1 (hnRNP D0) |
| 0.0 | 0.5 | REACTOME FORMATION OF FIBRIN CLOT CLOTTING CASCADE | Genes involved in Formation of Fibrin Clot (Clotting Cascade) |
| 0.0 | 1.5 | REACTOME TRNA AMINOACYLATION | Genes involved in tRNA Aminoacylation |
| 0.0 | 0.0 | REACTOME PKA MEDIATED PHOSPHORYLATION OF CREB | Genes involved in PKA-mediated phosphorylation of CREB |
| 0.0 | 0.7 | REACTOME CHONDROITIN SULFATE BIOSYNTHESIS | Genes involved in Chondroitin sulfate biosynthesis |
| 0.0 | 0.3 | REACTOME ROLE OF SECOND MESSENGERS IN NETRIN1 SIGNALING | Genes involved in Role of second messengers in netrin-1 signaling |
| 0.0 | 0.2 | REACTOME TRAF6 MEDIATED IRF7 ACTIVATION | Genes involved in TRAF6 mediated IRF7 activation |
| 0.0 | 1.0 | REACTOME G1 PHASE | Genes involved in G1 Phase |
| 0.0 | 1.3 | REACTOME TRIGLYCERIDE BIOSYNTHESIS | Genes involved in Triglyceride Biosynthesis |
| 0.0 | 0.3 | REACTOME ABACAVIR TRANSPORT AND METABOLISM | Genes involved in Abacavir transport and metabolism |
| 0.0 | 0.7 | REACTOME INSULIN SYNTHESIS AND PROCESSING | Genes involved in Insulin Synthesis and Processing |
| 0.0 | 0.3 | REACTOME DOPAMINE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Dopamine Neurotransmitter Release Cycle |
| 0.0 | 0.5 | REACTOME SYNTHESIS SECRETION AND INACTIVATION OF GLP1 | Genes involved in Synthesis, Secretion, and Inactivation of Glucagon-like Peptide-1 (GLP-1) |
| 0.0 | 0.2 | REACTOME ETHANOL OXIDATION | Genes involved in Ethanol oxidation |
| 0.0 | 0.1 | REACTOME XENOBIOTICS | Genes involved in Xenobiotics |
| 0.0 | 0.5 | REACTOME SIGNALING BY HIPPO | Genes involved in Signaling by Hippo |
| 0.0 | 0.2 | REACTOME ENDOGENOUS STEROLS | Genes involved in Endogenous sterols |
| 0.0 | 0.3 | REACTOME ACTIVATION OF NF KAPPAB IN B CELLS | Genes involved in Activation of NF-kappaB in B Cells |
| 0.0 | 0.0 | REACTOME VIF MEDIATED DEGRADATION OF APOBEC3G | Genes involved in Vif-mediated degradation of APOBEC3G |
| 0.0 | 0.3 | REACTOME INITIAL TRIGGERING OF COMPLEMENT | Genes involved in Initial triggering of complement |
| 0.0 | 0.1 | REACTOME TRANSPORT OF MATURE MRNA DERIVED FROM AN INTRONLESS TRANSCRIPT | Genes involved in Transport of Mature mRNA Derived from an Intronless Transcript |
| 0.0 | 0.6 | REACTOME AMINE COMPOUND SLC TRANSPORTERS | Genes involved in Amine compound SLC transporters |
| 0.0 | 0.6 | REACTOME THE ROLE OF NEF IN HIV1 REPLICATION AND DISEASE PATHOGENESIS | Genes involved in The role of Nef in HIV-1 replication and disease pathogenesis |
| 0.0 | 0.4 | REACTOME AMINO ACID SYNTHESIS AND INTERCONVERSION TRANSAMINATION | Genes involved in Amino acid synthesis and interconversion (transamination) |
| 0.0 | 0.5 | REACTOME MRNA SPLICING MINOR PATHWAY | Genes involved in mRNA Splicing - Minor Pathway |
| 0.0 | 0.4 | REACTOME DESTABILIZATION OF MRNA BY TRISTETRAPROLIN TTP | Genes involved in Destabilization of mRNA by Tristetraprolin (TTP) |
| 0.0 | 0.6 | REACTOME SULFUR AMINO ACID METABOLISM | Genes involved in Sulfur amino acid metabolism |
| 0.0 | 0.7 | REACTOME STEROID HORMONES | Genes involved in Steroid hormones |
| 0.0 | 0.1 | REACTOME ELEVATION OF CYTOSOLIC CA2 LEVELS | Genes involved in Elevation of cytosolic Ca2+ levels |
| 0.0 | 0.4 | REACTOME APC C CDH1 MEDIATED DEGRADATION OF CDC20 AND OTHER APC C CDH1 TARGETED PROTEINS IN LATE MITOSIS EARLY G1 | Genes involved in APC/C:Cdh1 mediated degradation of Cdc20 and other APC/C:Cdh1 targeted proteins in late mitosis/early G1 |
| 0.0 | 0.2 | REACTOME GABA SYNTHESIS RELEASE REUPTAKE AND DEGRADATION | Genes involved in GABA synthesis, release, reuptake and degradation |
| 0.0 | 0.2 | REACTOME BMAL1 CLOCK NPAS2 ACTIVATES CIRCADIAN EXPRESSION | Genes involved in BMAL1:CLOCK/NPAS2 Activates Circadian Expression |
| 0.0 | 0.1 | REACTOME RNA POL III TRANSCRIPTION INITIATION FROM TYPE 2 PROMOTER | Genes involved in RNA Polymerase III Transcription Initiation From Type 2 Promoter |
| 0.0 | 0.2 | REACTOME PLC BETA MEDIATED EVENTS | Genes involved in PLC beta mediated events |
| 0.0 | 0.0 | REACTOME RETROGRADE NEUROTROPHIN SIGNALLING | Genes involved in Retrograde neurotrophin signalling |
| 0.0 | 0.4 | REACTOME BRANCHED CHAIN AMINO ACID CATABOLISM | Genes involved in Branched-chain amino acid catabolism |
| 0.0 | 0.2 | REACTOME PROCESSING OF INTRONLESS PRE MRNAS | Genes involved in Processing of Intronless Pre-mRNAs |
| 0.0 | 0.2 | REACTOME HIGHLY CALCIUM PERMEABLE POSTSYNAPTIC NICOTINIC ACETYLCHOLINE RECEPTORS | Genes involved in Highly calcium permeable postsynaptic nicotinic acetylcholine receptors |
| 0.0 | 0.1 | REACTOME SIGNALLING TO P38 VIA RIT AND RIN | Genes involved in Signalling to p38 via RIT and RIN |
| 0.0 | 0.2 | REACTOME GLYCOGEN BREAKDOWN GLYCOGENOLYSIS | Genes involved in Glycogen breakdown (glycogenolysis) |
| 0.0 | 0.2 | REACTOME PASSIVE TRANSPORT BY AQUAPORINS | Genes involved in Passive Transport by Aquaporins |
| 0.0 | 0.1 | REACTOME NFKB ACTIVATION THROUGH FADD RIP1 PATHWAY MEDIATED BY CASPASE 8 AND10 | Genes involved in NF-kB activation through FADD/RIP-1 pathway mediated by caspase-8 and -10 |
| 0.0 | 0.7 | REACTOME PYRUVATE METABOLISM AND CITRIC ACID TCA CYCLE | Genes involved in Pyruvate metabolism and Citric Acid (TCA) cycle |
| 0.0 | 0.0 | REACTOME E2F ENABLED INHIBITION OF PRE REPLICATION COMPLEX FORMATION | Genes involved in E2F-enabled inhibition of pre-replication complex formation |
| 0.0 | 0.2 | REACTOME OXYGEN DEPENDENT PROLINE HYDROXYLATION OF HYPOXIA INDUCIBLE FACTOR ALPHA | Genes involved in Oxygen-dependent Proline Hydroxylation of Hypoxia-inducible Factor Alpha |
| 0.0 | 0.1 | REACTOME DOWNSTREAM SIGNAL TRANSDUCTION | Genes involved in Downstream signal transduction |
| 0.0 | 0.0 | REACTOME DOWNSTREAM SIGNALING EVENTS OF B CELL RECEPTOR BCR | Genes involved in Downstream Signaling Events Of B Cell Receptor (BCR) |
| 0.0 | 0.2 | REACTOME TRYPTOPHAN CATABOLISM | Genes involved in Tryptophan catabolism |
| 0.0 | 0.1 | REACTOME PLATELET CALCIUM HOMEOSTASIS | Genes involved in Platelet calcium homeostasis |
| 0.0 | 0.0 | REACTOME PROCESSING OF CAPPED INTRONLESS PRE MRNA | Genes involved in Processing of Capped Intronless Pre-mRNA |
| 0.0 | 0.1 | REACTOME INHIBITION OF REPLICATION INITIATION OF DAMAGED DNA BY RB1 E2F1 | Genes involved in Inhibition of replication initiation of damaged DNA by RB1/E2F1 |
| 0.0 | 0.1 | REACTOME ER PHAGOSOME PATHWAY | Genes involved in ER-Phagosome pathway |
| 0.0 | 0.0 | REACTOME APOBEC3G MEDIATED RESISTANCE TO HIV1 INFECTION | Genes involved in APOBEC3G mediated resistance to HIV-1 infection |
| 0.0 | 0.3 | REACTOME NETRIN1 SIGNALING | Genes involved in Netrin-1 signaling |
| 0.0 | 0.0 | REACTOME PROLONGED ERK ACTIVATION EVENTS | Genes involved in Prolonged ERK activation events |
| 0.0 | 0.1 | REACTOME IL 6 SIGNALING | Genes involved in Interleukin-6 signaling |
| 0.0 | 0.1 | REACTOME IKK COMPLEX RECRUITMENT MEDIATED BY RIP1 | Genes involved in IKK complex recruitment mediated by RIP1 |
| 0.0 | 0.2 | REACTOME AMINE DERIVED HORMONES | Genes involved in Amine-derived hormones |
| 0.0 | 0.0 | REACTOME GROWTH HORMONE RECEPTOR SIGNALING | Genes involved in Growth hormone receptor signaling |
| 0.0 | 0.1 | REACTOME CREB PHOSPHORYLATION THROUGH THE ACTIVATION OF RAS | Genes involved in CREB phosphorylation through the activation of Ras |
| 0.0 | 0.6 | REACTOME MRNA SPLICING | Genes involved in mRNA Splicing |
| 0.0 | 0.1 | REACTOME CELL SURFACE INTERACTIONS AT THE VASCULAR WALL | Genes involved in Cell surface interactions at the vascular wall |
| 0.0 | 0.0 | REACTOME CIRCADIAN CLOCK | Genes involved in Circadian Clock |
| 0.0 | 0.0 | REACTOME ACTIVATION OF CHAPERONE GENES BY ATF6 ALPHA | Genes involved in Activation of Chaperone Genes by ATF6-alpha |
| 0.0 | 0.3 | REACTOME ION TRANSPORT BY P TYPE ATPASES | Genes involved in Ion transport by P-type ATPases |
| 0.0 | 0.3 | REACTOME INTEGRATION OF ENERGY METABOLISM | Genes involved in Integration of energy metabolism |
| 0.0 | 0.0 | REACTOME REGULATION OF KIT SIGNALING | Genes involved in Regulation of KIT signaling |
| 0.0 | 0.4 | REACTOME MITOCHONDRIAL PROTEIN IMPORT | Genes involved in Mitochondrial Protein Import |
| 0.0 | 0.0 | REACTOME UNWINDING OF DNA | Genes involved in Unwinding of DNA |