| Gene Symbol | Gene ID | Gene Info |
|---|---|---|
|
Nr0b1
|
ENSMUSG00000025056.4 | nuclear receptor subfamily 0, group B, member 1 |
| CRE | Gene | Distance | Association probability | Pearson corr. coef. | P-value | Plot |
|---|---|---|---|---|---|---|
| chrX_86191880_86192031 | Nr0b1 | 191 | 0.953071 | 0.19 | 1.6e-01 | Click! |
| chrX_86192180_86192413 | Nr0b1 | 532 | 0.804936 | 0.14 | 3.1e-01 | Click! |
Move your cursor over a bar to see sample name and corresponding Z-value.
| Cis Regulatory Element (CRE) | Target Score | Top associated gene | Gene Info | Distance of CRE to TSS | CRE/Gene association probability |
|---|---|---|---|---|---|
| chr2_160507758_160508228 | 1.58 |
Gm14222 |
predicted gene 14222 |
75364 |
0.09 |
| chr1_158193106_158193497 | 1.02 |
Brinp2 |
bone morphogenic protein/retinoic acid inducible neural-specific 2 |
103163 |
0.07 |
| chr8_89659306_89659471 | 1.00 |
Gm24212 |
predicted gene, 24212 |
7916 |
0.3 |
| chr9_77461750_77461912 | 0.96 |
Lrrc1 |
leucine rich repeat containing 1 |
19340 |
0.18 |
| chr2_24413807_24414039 | 0.87 |
Psd4 |
pleckstrin and Sec7 domain containing 4 |
8294 |
0.14 |
| chr5_150772538_150772689 | 0.86 |
Pds5b |
PDS5 cohesin associated factor B |
13249 |
0.15 |
| chr11_96285319_96285686 | 0.83 |
Hoxb7 |
homeobox B7 |
1121 |
0.23 |
| chr4_114843260_114843721 | 0.82 |
Gm23230 |
predicted gene, 23230 |
1627 |
0.35 |
| chr14_99641991_99642142 | 0.80 |
Gm9298 |
predicted gene 9298 |
11400 |
0.21 |
| chr5_139568114_139568282 | 0.77 |
Uncx |
UNC homeobox |
24300 |
0.16 |
| chr15_101941988_101942139 | 0.75 |
Krt79 |
keratin 79 |
1739 |
0.21 |
| chr3_121588840_121589464 | 0.75 |
A730020M07Rik |
RIKEN cDNA A730020M07 gene |
54215 |
0.09 |
| chr10_72383409_72383643 | 0.71 |
Gm9923 |
predicted pseudogene 9923 |
74205 |
0.12 |
| chr12_44836242_44836433 | 0.70 |
Gm15901 |
predicted gene 15901 |
86843 |
0.09 |
| chr16_15253127_15253318 | 0.69 |
Gm5404 |
predicted gene 5404 |
34378 |
0.16 |
| chr14_67969837_67970001 | 0.69 |
Dock5 |
dedicator of cytokinesis 5 |
36477 |
0.17 |
| chr16_90421246_90421497 | 0.68 |
Hunk |
hormonally upregulated Neu-associated kinase |
20827 |
0.17 |
| chr19_53437277_53437844 | 0.68 |
Mirt1 |
myocardial infarction associated transcript 1 |
13931 |
0.13 |
| chrX_161723359_161723510 | 0.67 |
Rai2 |
retinoic acid induced 2 |
5807 |
0.31 |
| chr19_24242240_24242409 | 0.66 |
Tjp2 |
tight junction protein 2 |
17294 |
0.17 |
| chr6_22000174_22000336 | 0.65 |
Cped1 |
cadherin-like and PC-esterase domain containing 1 |
13363 |
0.24 |
| chr10_55546796_55546947 | 0.65 |
Gm46190 |
predicted gene, 46190 |
422509 |
0.01 |
| chr16_27523889_27524083 | 0.65 |
Ccdc50 |
coiled-coil domain containing 50 |
134018 |
0.05 |
| chr5_125264626_125264993 | 0.65 |
Gm32585 |
predicted gene, 32585 |
8006 |
0.18 |
| chr19_44312061_44312212 | 0.64 |
Gm50334 |
predicted gene, 50334 |
1636 |
0.25 |
| chr11_31555146_31555358 | 0.63 |
Bod1 |
biorientation of chromosomes in cell division 1 |
116475 |
0.06 |
| chr2_115860910_115861061 | 0.62 |
Meis2 |
Meis homeobox 2 |
7882 |
0.31 |
| chr4_55015191_55015349 | 0.61 |
Zfp462 |
zinc finger protein 462 |
3790 |
0.31 |
| chr11_88588635_88589214 | 0.61 |
Msi2 |
musashi RNA-binding protein 2 |
1223 |
0.57 |
| chr12_69437182_69437482 | 0.61 |
5830428M24Rik |
RIKEN cDNA 5830428M24 gene |
30060 |
0.12 |
| chr1_13787016_13787370 | 0.61 |
Gm5523 |
predicted pseudogene 5523 |
314 |
0.9 |
| chr1_52388259_52388410 | 0.60 |
Gm23460 |
predicted gene, 23460 |
56210 |
0.11 |
| chr8_126919247_126919416 | 0.60 |
Gm31718 |
predicted gene, 31718 |
11116 |
0.16 |
| chr4_142267317_142267565 | 0.59 |
Kazn |
kazrin, periplakin interacting protein |
28040 |
0.2 |
| chr6_30460451_30461539 | 0.59 |
1700012C14Rik |
RIKEN cDNA 1700012C14 gene |
10 |
0.97 |
| chr7_117472179_117472382 | 0.58 |
Xylt1 |
xylosyltransferase 1 |
3212 |
0.37 |
| chr1_135788781_135788943 | 0.58 |
Tnni1 |
troponin I, skeletal, slow 1 |
5797 |
0.15 |
| chr6_52165009_52165376 | 0.57 |
Hoxa2 |
homeobox A2 |
361 |
0.46 |
| chr15_100706437_100706588 | 0.57 |
Galnt6os |
polypeptide N-acetylgalactosaminyltransferase 6, opposite strand |
10732 |
0.1 |
| chr10_22813643_22813922 | 0.56 |
Gm10824 |
predicted gene 10824 |
1967 |
0.28 |
| chr11_60036621_60036772 | 0.56 |
Pemt |
phosphatidylethanolamine N-methyltransferase |
210 |
0.93 |
| chr2_74749875_74750381 | 0.56 |
Haglr |
Hoxd antisense growth associated long non-coding RNA |
378 |
0.64 |
| chr17_72022399_72022550 | 0.55 |
Gm49924 |
predicted gene, 49924 |
95444 |
0.08 |
| chr9_37460487_37460965 | 0.55 |
Gm47945 |
predicted gene, 47945 |
17917 |
0.1 |
| chr19_44677410_44677566 | 0.53 |
Gm26644 |
predicted gene, 26644 |
17787 |
0.16 |
| chr5_112565224_112565379 | 0.53 |
Sez6l |
seizure related 6 homolog like |
11567 |
0.15 |
| chr1_135793419_135794215 | 0.52 |
Tnni1 |
troponin I, skeletal, slow 1 |
5585 |
0.15 |
| chr2_74681594_74681905 | 0.52 |
Hoxd11 |
homeobox D11 |
574 |
0.41 |
| chr14_100462395_100462546 | 0.52 |
6330576A10Rik |
RIKEN cDNA 6330576A10 gene |
3047 |
0.27 |
| chr10_80627738_80628084 | 0.51 |
Csnk1g2 |
casein kinase 1, gamma 2 |
1745 |
0.16 |
| chr17_85737512_85737677 | 0.51 |
CJ186046Rik |
Riken cDNA CJ186046 gene |
43965 |
0.14 |
| chr9_21852119_21853097 | 0.51 |
Dock6 |
dedicator of cytokinesis 6 |
8 |
0.96 |
| chr14_14803913_14804489 | 0.50 |
Nek10 |
NIMA (never in mitosis gene a)- related kinase 10 |
786 |
0.69 |
| chr12_110381177_110381629 | 0.50 |
Gm47195 |
predicted gene, 47195 |
56018 |
0.08 |
| chr11_36873121_36873272 | 0.50 |
Tenm2 |
teneurin transmembrane protein 2 |
70970 |
0.14 |
| chr2_69585992_69586445 | 0.49 |
Lrp2 |
low density lipoprotein receptor-related protein 2 |
153 |
0.96 |
| chr2_145787427_145787839 | 0.49 |
Rin2 |
Ras and Rab interactor 2 |
1471 |
0.48 |
| chr4_144941168_144941355 | 0.48 |
Gm38074 |
predicted gene, 38074 |
17587 |
0.18 |
| chr4_151367052_151367207 | 0.48 |
4930589P08Rik |
RIKEN cDNA 4930589P08 gene |
9341 |
0.3 |
| chr13_37966733_37966984 | 0.48 |
Rreb1 |
ras responsive element binding protein 1 |
19842 |
0.16 |
| chr18_11239663_11239862 | 0.48 |
Gata6 |
GATA binding protein 6 |
180715 |
0.03 |
| chr13_38290533_38290684 | 0.48 |
Gm47978 |
predicted gene, 47978 |
19999 |
0.15 |
| chr3_9173889_9174631 | 0.47 |
Zbtb10 |
zinc finger and BTB domain containing 10 |
76342 |
0.09 |
| chr5_66000675_66000934 | 0.47 |
9130230L23Rik |
RIKEN cDNA 9130230L23 gene |
529 |
0.67 |
| chr14_74359714_74359865 | 0.47 |
4933402J15Rik |
RIKEN cDNA 4933402J15 gene |
4262 |
0.28 |
| chr18_53692268_53692425 | 0.47 |
Gm19466 |
predicted gene, 19466 |
44195 |
0.17 |
| chr4_137277102_137277596 | 0.46 |
Wnt4 |
wingless-type MMTV integration site family, member 4 |
140 |
0.95 |
| chr2_94273064_94274137 | 0.46 |
Mir670hg |
MIR670 host gene (non-protein coding) |
8682 |
0.15 |
| chr5_50033873_50034024 | 0.46 |
Adgra3 |
adhesion G protein-coupled receptor A3 |
19431 |
0.2 |
| chr8_48843323_48843872 | 0.45 |
Gm19744 |
predicted gene, 19744 |
68 |
0.83 |
| chr5_64623783_64623974 | 0.45 |
Gm42565 |
predicted gene 42565 |
11962 |
0.12 |
| chr18_35930397_35930931 | 0.45 |
Gm50405 |
predicted gene, 50405 |
7369 |
0.12 |
| chr7_24499836_24500017 | 0.45 |
Cadm4 |
cell adhesion molecule 4 |
35 |
0.94 |
| chr16_4641918_4642720 | 0.44 |
Dnaja3 |
DnaJ heat shock protein family (Hsp40) member A3 |
2330 |
0.17 |
| chr15_61770939_61771188 | 0.44 |
D030024E09Rik |
RIKEN cDNA D030024E09 gene |
3388 |
0.34 |
| chr6_63257322_63257806 | 0.44 |
9330118I20Rik |
RIKEN cDNA 9330118I20 gene |
61 |
0.93 |
| chr19_36789834_36790425 | 0.44 |
Gm50112 |
predicted gene, 50112 |
28519 |
0.16 |
| chr2_33605150_33605418 | 0.44 |
Gm38011 |
predicted gene, 38011 |
9114 |
0.17 |
| chrX_99172415_99172601 | 0.44 |
Efnb1 |
ephrin B1 |
34377 |
0.2 |
| chr12_102722552_102722730 | 0.44 |
Gm21971 |
predicted gene 21971 |
4681 |
0.1 |
| chr18_77564959_77566098 | 0.44 |
Rnf165 |
ring finger protein 165 |
367 |
0.89 |
| chr11_118534751_118534902 | 0.43 |
Rbfox3 |
RNA binding protein, fox-1 homolog (C. elegans) 3 |
27473 |
0.15 |
| chr18_61653267_61653989 | 0.43 |
Mir143 |
microRNA 143 |
4370 |
0.12 |
| chr11_96333479_96333781 | 0.43 |
Hoxb3 |
homeobox B3 |
5568 |
0.08 |
| chr3_9347475_9347898 | 0.42 |
C030034L19Rik |
RIKEN cDNA C030034L19 gene |
55378 |
0.14 |
| chr2_168440902_168441073 | 0.42 |
Gm14234 |
predicted gene 14234 |
22413 |
0.2 |
| chr16_91056426_91056805 | 0.41 |
4931406G06Rik |
RIKEN cDNA 4931406G06 gene |
11959 |
0.1 |
| chr4_139967588_139967819 | 0.41 |
Mir2139 |
microRNA 2139 |
83 |
0.79 |
| chr10_77165545_77165750 | 0.41 |
Col18a1 |
collagen, type XVIII, alpha 1 |
901 |
0.59 |
| chr3_63899936_63900620 | 0.40 |
Plch1 |
phospholipase C, eta 1 |
806 |
0.55 |
| chr17_65642831_65642982 | 0.40 |
Txndc2 |
thioredoxin domain containing 2 (spermatozoa) |
738 |
0.63 |
| chr11_121510660_121510811 | 0.40 |
Zfp750 |
zinc finger protein 750 |
8598 |
0.17 |
| chr16_26049836_26049987 | 0.40 |
AU015336 |
expressed sequence AU015336 |
8643 |
0.25 |
| chr18_59062665_59063371 | 0.40 |
Minar2 |
membrane integral NOTCH2 associated receptor 2 |
507 |
0.87 |
| chr4_22393242_22393393 | 0.40 |
Gm24607 |
predicted gene, 24607 |
3253 |
0.24 |
| chr11_98709033_98709497 | 0.40 |
Med24 |
mediator complex subunit 24 |
1262 |
0.24 |
| chrX_48193816_48193967 | 0.40 |
Zdhhc9 |
zinc finger, DHHC domain containing 9 |
14437 |
0.16 |
| chr3_90537217_90537409 | 0.40 |
S100a16 |
S100 calcium binding protein A16 |
2 |
0.94 |
| chr5_141380812_141381047 | 0.40 |
Gm16035 |
predicted gene 16035 |
3 |
0.98 |
| chr15_99096778_99097375 | 0.40 |
Dnajc22 |
DnaJ heat shock protein family (Hsp40) member C22 |
2336 |
0.14 |
| chr8_34392545_34392896 | 0.39 |
Gm33831 |
predicted gene, 33831 |
6892 |
0.17 |
| chr14_65266098_65266731 | 0.39 |
Fbxo16 |
F-box protein 16 |
204 |
0.93 |
| chr5_36945032_36945744 | 0.39 |
Ppp2r2c |
protein phosphatase 2, regulatory subunit B, gamma |
5958 |
0.18 |
| chr4_6222763_6222917 | 0.39 |
Ubxn2b |
UBX domain protein 2B |
31742 |
0.16 |
| chr18_77487881_77488049 | 0.39 |
Rnf165 |
ring finger protein 165 |
17153 |
0.19 |
| chr5_74315928_74316086 | 0.39 |
Gm15981 |
predicted gene 15981 |
1027 |
0.5 |
| chr14_60913290_60913441 | 0.39 |
Tnfrsf19 |
tumor necrosis factor receptor superfamily, member 19 |
62520 |
0.12 |
| chr1_185969251_185969582 | 0.39 |
Gm9722 |
predicted gene 9722 |
90531 |
0.08 |
| chr2_137098401_137098624 | 0.38 |
Jag1 |
jagged 1 |
12563 |
0.27 |
| chr14_28058554_28058730 | 0.38 |
Erc2 |
ELKS/RAB6-interacting/CAST family member 2 |
12214 |
0.3 |
| chr4_28298862_28299161 | 0.38 |
Gm11907 |
predicted gene 11907 |
54772 |
0.15 |
| chr12_105512184_105512567 | 0.38 |
AU015791 |
expressed sequence AU015791 |
1105 |
0.48 |
| chr17_15993469_15994300 | 0.38 |
Eif3s6-ps3 |
eukaryotic translation initiation factor 3, subunit 6, pseudogene 3 |
148604 |
0.04 |
| chr8_54780454_54780686 | 0.38 |
Wdr17 |
WD repeat domain 17 |
56066 |
0.12 |
| chr2_83739879_83740030 | 0.37 |
Dnmt3l-ps1 |
DNA methyltransferase 3-like, pseudogene 1 |
5782 |
0.16 |
| chr7_144762962_144763113 | 0.37 |
Gm10152 |
predicted gene 10152 |
102 |
0.94 |
| chr5_64298395_64298660 | 0.37 |
Tbc1d1 |
TBC1 domain family, member 1 |
3 |
0.97 |
| chr16_24282164_24282718 | 0.37 |
AC169509.1 |
BMP2 inducible kinase (Bmp2k) pseudogene |
7395 |
0.21 |
| chr16_40891355_40891873 | 0.37 |
Gm26381 |
predicted gene, 26381 |
326131 |
0.01 |
| chr4_123239382_123240167 | 0.37 |
Heyl |
hairy/enhancer-of-split related with YRPW motif-like |
17 |
0.96 |
| chr9_31688233_31688384 | 0.37 |
Gm47436 |
predicted gene, 47436 |
10282 |
0.21 |
| chr1_128471971_128472514 | 0.36 |
Gm23902 |
predicted gene, 23902 |
17798 |
0.13 |
| chr5_136467645_136467981 | 0.36 |
Gm38082 |
predicted gene, 38082 |
68664 |
0.09 |
| chr14_54577785_54578159 | 0.36 |
Ajuba |
ajuba LIM protein |
414 |
0.66 |
| chr1_85934173_85934375 | 0.36 |
Gm28884 |
predicted gene 28884 |
3058 |
0.16 |
| chr7_70331281_70331985 | 0.36 |
Gm29683 |
predicted gene, 29683 |
6189 |
0.14 |
| chr19_37026547_37026698 | 0.36 |
Btaf1 |
B-TFIID TATA-box binding protein associated factor 1 |
65307 |
0.1 |
| chr3_104352851_104353013 | 0.36 |
Gm5546 |
predicted gene 5546 |
13681 |
0.16 |
| chr10_78787742_78788305 | 0.36 |
Slc1a6 |
solute carrier family 1 (high affinity aspartate/glutamate transporter), member 6 |
7321 |
0.14 |
| chr2_18031988_18032457 | 0.36 |
Gm13330 |
predicted gene 13330 |
311 |
0.81 |
| chr4_134098701_134098852 | 0.35 |
Cd52 |
CD52 antigen |
3694 |
0.12 |
| chr7_68264707_68264858 | 0.35 |
Pgpep1l |
pyroglutamyl-peptidase I-like |
549 |
0.7 |
| chr2_4717789_4718511 | 0.35 |
Bend7 |
BEN domain containing 7 |
5 |
0.98 |
| chr1_12692125_12692347 | 0.35 |
Sulf1 |
sulfatase 1 |
41 |
0.98 |
| chr9_96786211_96786362 | 0.35 |
C430002N11Rik |
RIKEN cDNA C430002N11 gene |
20685 |
0.13 |
| chr10_117625499_117625695 | 0.35 |
Cpm |
carboxypeptidase M |
3903 |
0.16 |
| chr11_59012500_59012651 | 0.35 |
Gm10435 |
predicted gene 10435 |
9665 |
0.09 |
| chr4_133084081_133084901 | 0.35 |
Ahdc1 |
AT hook, DNA binding motif, containing 1 |
18242 |
0.17 |
| chr6_87937321_87937742 | 0.35 |
Hmces |
5-hydroxymethylcytosine (hmC) binding, ES cell specific |
4538 |
0.1 |
| chr6_90661294_90661504 | 0.35 |
Iqsec1 |
IQ motif and Sec7 domain 1 |
889 |
0.52 |
| chr3_123690346_123691118 | 0.35 |
Ndst3 |
N-deacetylase/N-sulfotransferase (heparan glucosaminyl) 3 |
121 |
0.96 |
| chr5_52975553_52975747 | 0.34 |
Gm30301 |
predicted gene, 30301 |
6387 |
0.16 |
| chr2_178610359_178610510 | 0.34 |
Cdh26 |
cadherin-like 26 |
149804 |
0.04 |
| chr7_70330793_70331031 | 0.34 |
Gm29683 |
predicted gene, 29683 |
6910 |
0.14 |
| chr3_88563593_88563744 | 0.34 |
Ubqln4 |
ubiquilin 4 |
239 |
0.81 |
| chr5_135488643_135489936 | 0.34 |
Hip1 |
huntingtin interacting protein 1 |
31 |
0.97 |
| chr13_73263734_73263998 | 0.34 |
Irx4 |
Iroquois homeobox 4 |
3369 |
0.2 |
| chr6_117552214_117552390 | 0.34 |
Gm9946 |
predicted gene 9946 |
7395 |
0.22 |
| chr8_105461526_105461678 | 0.34 |
Tppp3 |
tubulin polymerization-promoting protein family member 3 |
7060 |
0.1 |
| chr8_22475514_22475708 | 0.34 |
Slc20a2 |
solute carrier family 20, member 2 |
1177 |
0.29 |
| chr3_108225914_108226065 | 0.33 |
Sypl2 |
synaptophysin-like 2 |
654 |
0.36 |
| chr7_142542689_142542861 | 0.33 |
Mrpl23 |
mitochondrial ribosomal protein L23 |
6671 |
0.11 |
| chr11_101269713_101269991 | 0.33 |
Gm11615 |
predicted gene 11615 |
3549 |
0.08 |
| chr17_25374164_25374315 | 0.33 |
Tpsg1 |
tryptase gamma 1 |
1230 |
0.27 |
| chr3_65857996_65858503 | 0.33 |
Gm37131 |
predicted gene, 37131 |
6580 |
0.17 |
| chr15_4079762_4080117 | 0.33 |
Gm15632 |
predicted gene 15632 |
7907 |
0.19 |
| chr1_34011806_34012218 | 0.33 |
Dst |
dystonin |
187 |
0.93 |
| chr8_88604116_88604818 | 0.33 |
Nkd1 |
naked cuticle 1 |
21662 |
0.15 |
| chr3_93597159_93597878 | 0.33 |
Gm5541 |
predicted gene 5541 |
32234 |
0.09 |
| chr4_110351157_110352032 | 0.33 |
Elavl4 |
ELAV like RNA binding protein 4 |
315 |
0.93 |
| chr6_71149597_71149803 | 0.32 |
Thnsl2 |
threonine synthase-like 2 (bacterial) |
5261 |
0.14 |
| chr14_105483037_105483250 | 0.32 |
4930449E01Rik |
RIKEN cDNA 4930449E01 gene |
15645 |
0.19 |
| chr7_30291145_30292058 | 0.32 |
Clip3 |
CAP-GLY domain containing linker protein 3 |
127 |
0.89 |
| chrX_142698232_142698408 | 0.32 |
Tmem164 |
transmembrane protein 164 |
15432 |
0.19 |
| chr2_105127208_105127384 | 0.32 |
Wt1 |
Wilms tumor 1 homolog |
86 |
0.93 |
| chr8_122430799_122430950 | 0.32 |
Cyba |
cytochrome b-245, alpha polypeptide |
2031 |
0.15 |
| chr7_39655676_39656025 | 0.32 |
Gm2021 |
predicted gene 2021 |
7159 |
0.17 |
| chr15_79741326_79742933 | 0.32 |
Sun2 |
Sad1 and UNC84 domain containing 2 |
14 |
0.89 |
| chr4_149813946_149814101 | 0.32 |
Gm13064 |
predicted gene 13064 |
1199 |
0.3 |
| chr10_103367406_103367811 | 0.32 |
Slc6a15 |
solute carrier family 6 (neurotransmitter transporter), member 15 |
175 |
0.96 |
| chr18_65739933_65740110 | 0.31 |
Oacyl |
O-acyltransferase like |
8993 |
0.15 |
| chr19_11818404_11818833 | 0.31 |
Stx3 |
syntaxin 3 |
103 |
0.94 |
| chr2_33919949_33920348 | 0.31 |
Gm13403 |
predicted gene 13403 |
21965 |
0.18 |
| chrX_169997358_169997792 | 0.31 |
Gm15247 |
predicted gene 15247 |
10636 |
0.15 |
| chr2_50694913_50695121 | 0.31 |
Gm13484 |
predicted gene 13484 |
36950 |
0.21 |
| chr11_103355388_103355579 | 0.31 |
Arhgap27os2 |
Rho GTPase activating protein 27, opposite strand 2 |
218 |
0.83 |
| chr11_100395108_100395582 | 0.31 |
Jup |
junction plakoglobin |
2404 |
0.12 |
| chr6_108448067_108448376 | 0.31 |
Itpr1 |
inositol 1,4,5-trisphosphate receptor 1 |
10482 |
0.19 |
| chr19_52647066_52647670 | 0.30 |
AA387883 |
expressed sequence AA387883 |
275813 |
0.01 |
| chr15_25940377_25941010 | 0.30 |
Retreg1 |
reticulophagy regulator 1 |
9 |
0.98 |
| chr9_69712806_69712957 | 0.30 |
B230323A14Rik |
RIKEN cDNA B230323A14 gene |
45859 |
0.14 |
| chr4_101585127_101585353 | 0.30 |
Dnajc6 |
DnaJ heat shock protein family (Hsp40) member C6 |
34646 |
0.17 |
| chr7_70361365_70362023 | 0.30 |
Nr2f2 |
nuclear receptor subfamily 2, group F, member 2 |
1101 |
0.37 |
| chr16_90619588_90619750 | 0.30 |
Gm23406 |
predicted gene, 23406 |
17173 |
0.14 |
| chr16_93615032_93615511 | 0.30 |
Cbr1 |
carbonyl reductase 1 |
7382 |
0.12 |
| chr3_132084022_132084369 | 0.30 |
Dkk2 |
dickkopf WNT signaling pathway inhibitor 2 |
1097 |
0.5 |
| chr16_43800505_43800843 | 0.30 |
Gm25996 |
predicted gene, 25996 |
3257 |
0.21 |
| chr14_47766475_47766644 | 0.30 |
4930538L07Rik |
RIKEN cDNA 4930538L07 gene |
9061 |
0.15 |
| chr18_46311791_46312285 | 0.30 |
Ccdc112 |
coiled-coil domain containing 112 |
110 |
0.96 |
| chr16_44559074_44559234 | 0.30 |
Boc |
biregional cell adhesion molecule-related/down-regulated by oncogenes (Cdon) binding protein |
257 |
0.86 |
| chr2_35508565_35508933 | 0.30 |
Gm35202 |
predicted gene, 35202 |
5218 |
0.15 |
| chr5_63649286_63649509 | 0.30 |
Nwd2 |
NACHT and WD repeat domain containing 2 |
64 |
0.95 |
| chr17_45805881_45806117 | 0.30 |
Gm35692 |
predicted gene, 35692 |
16324 |
0.15 |
| chr6_52191848_52192469 | 0.30 |
Hoxa4 |
homeobox A4 |
405 |
0.56 |
| chr5_122950982_122952145 | 0.29 |
Kdm2b |
lysine (K)-specific demethylase 2B |
427 |
0.77 |
| chr14_75540763_75541352 | 0.29 |
Cby2 |
chibby family member 2 |
50892 |
0.13 |
| chr2_153436314_153437355 | 0.29 |
Nol4l |
nucleolar protein 4-like |
7645 |
0.17 |
| chr4_154480275_154480463 | 0.29 |
Prdm16 |
PR domain containing 16 |
48396 |
0.13 |
| chr14_76533528_76533831 | 0.29 |
E130202H07Rik |
RIKEN cDNA E130202H07 gene |
7063 |
0.2 |
| chr16_13357793_13358521 | 0.29 |
Mrtfb |
myocardin related transcription factor B |
264 |
0.93 |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.2 | 0.2 | GO:0072039 | regulation of mesenchymal cell apoptotic process involved in nephron morphogenesis(GO:0072039) negative regulation of mesenchymal cell apoptotic process involved in nephron morphogenesis(GO:0072040) mesenchymal cell apoptotic process involved in nephron morphogenesis(GO:1901145) regulation of somatic stem cell population maintenance(GO:1904672) negative regulation of somatic stem cell population maintenance(GO:1904673) |
| 0.2 | 0.5 | GO:0072162 | metanephric mesenchymal cell differentiation(GO:0072162) |
| 0.2 | 0.7 | GO:1900211 | mesenchymal cell apoptotic process involved in metanephros development(GO:1900200) regulation of mesenchymal cell apoptotic process involved in metanephros development(GO:1900211) negative regulation of mesenchymal cell apoptotic process involved in metanephros development(GO:1900212) |
| 0.1 | 0.4 | GO:0035284 | central nervous system segmentation(GO:0035283) brain segmentation(GO:0035284) |
| 0.1 | 0.5 | GO:0003219 | cardiac right ventricle formation(GO:0003219) |
| 0.1 | 0.5 | GO:0050747 | positive regulation of lipoprotein metabolic process(GO:0050747) |
| 0.1 | 0.1 | GO:1903689 | regulation of wound healing, spreading of epidermal cells(GO:1903689) |
| 0.1 | 0.4 | GO:0035860 | glial cell-derived neurotrophic factor receptor signaling pathway(GO:0035860) |
| 0.1 | 0.3 | GO:0035022 | positive regulation of Rac protein signal transduction(GO:0035022) |
| 0.1 | 0.3 | GO:2000823 | regulation of androgen receptor activity(GO:2000823) |
| 0.1 | 0.3 | GO:0070094 | positive regulation of glucagon secretion(GO:0070094) |
| 0.1 | 0.3 | GO:0061368 | behavioral response to chemical pain(GO:0061366) behavioral response to formalin induced pain(GO:0061368) |
| 0.1 | 0.3 | GO:0015820 | branched-chain amino acid transport(GO:0015803) leucine transport(GO:0015820) |
| 0.1 | 0.3 | GO:0090292 | nuclear matrix organization(GO:0043578) nuclear matrix anchoring at nuclear membrane(GO:0090292) |
| 0.1 | 0.3 | GO:0016554 | cytidine to uridine editing(GO:0016554) |
| 0.1 | 0.2 | GO:0002930 | trabecular meshwork development(GO:0002930) |
| 0.1 | 0.2 | GO:0046552 | eye photoreceptor cell fate commitment(GO:0042706) photoreceptor cell fate commitment(GO:0046552) |
| 0.1 | 0.2 | GO:0097118 | neuroligin clustering involved in postsynaptic membrane assembly(GO:0097118) |
| 0.1 | 0.6 | GO:0090557 | establishment of endothelial intestinal barrier(GO:0090557) |
| 0.1 | 0.2 | GO:0000101 | sulfur amino acid transport(GO:0000101) |
| 0.1 | 0.1 | GO:1903059 | regulation of protein lipidation(GO:1903059) |
| 0.1 | 0.2 | GO:1902730 | regulation of heparan sulfate proteoglycan biosynthetic process(GO:0010908) positive regulation of heparan sulfate proteoglycan biosynthetic process(GO:0010909) positive regulation of proteoglycan biosynthetic process(GO:1902730) |
| 0.1 | 0.2 | GO:1901078 | negative regulation of relaxation of muscle(GO:1901078) |
| 0.1 | 0.3 | GO:0021555 | midbrain-hindbrain boundary morphogenesis(GO:0021555) |
| 0.1 | 0.2 | GO:0048382 | mesendoderm development(GO:0048382) |
| 0.1 | 0.3 | GO:0018231 | peptidyl-L-cysteine S-palmitoylation(GO:0018230) peptidyl-S-diacylglycerol-L-cysteine biosynthetic process from peptidyl-cysteine(GO:0018231) |
| 0.1 | 0.1 | GO:2000974 | negative regulation of pro-B cell differentiation(GO:2000974) |
| 0.1 | 0.2 | GO:1901420 | negative regulation of response to alcohol(GO:1901420) |
| 0.1 | 0.3 | GO:0072310 | glomerular visceral epithelial cell development(GO:0072015) glomerular epithelial cell development(GO:0072310) |
| 0.1 | 0.1 | GO:0072309 | mesenchymal stem cell maintenance involved in metanephric nephron morphogenesis(GO:0072309) |
| 0.1 | 0.2 | GO:0003223 | ventricular compact myocardium morphogenesis(GO:0003223) |
| 0.1 | 0.3 | GO:0010693 | negative regulation of alkaline phosphatase activity(GO:0010693) |
| 0.1 | 0.3 | GO:0051639 | actin filament network formation(GO:0051639) |
| 0.1 | 0.2 | GO:2000680 | regulation of rubidium ion transport(GO:2000680) |
| 0.1 | 0.2 | GO:0010749 | regulation of nitric oxide mediated signal transduction(GO:0010749) |
| 0.1 | 0.4 | GO:0046069 | cGMP catabolic process(GO:0046069) |
| 0.1 | 0.2 | GO:0034436 | glycoprotein transport(GO:0034436) |
| 0.1 | 0.1 | GO:0007354 | zygotic determination of anterior/posterior axis, embryo(GO:0007354) |
| 0.1 | 0.2 | GO:2000297 | negative regulation of synapse maturation(GO:2000297) |
| 0.1 | 0.2 | GO:0071139 | resolution of recombination intermediates(GO:0071139) |
| 0.1 | 0.2 | GO:0060584 | regulation of prostaglandin-endoperoxide synthase activity(GO:0060584) positive regulation of prostaglandin-endoperoxide synthase activity(GO:0060585) |
| 0.1 | 0.3 | GO:0035331 | negative regulation of hippo signaling(GO:0035331) |
| 0.1 | 0.1 | GO:0010735 | positive regulation of transcription via serum response element binding(GO:0010735) |
| 0.1 | 0.2 | GO:1903797 | positive regulation of inorganic anion transmembrane transport(GO:1903797) |
| 0.0 | 0.2 | GO:0021563 | glossopharyngeal nerve development(GO:0021563) |
| 0.0 | 0.3 | GO:0022027 | interkinetic nuclear migration(GO:0022027) |
| 0.0 | 0.1 | GO:0002337 | B-1a B cell differentiation(GO:0002337) |
| 0.0 | 0.2 | GO:0019249 | lactate biosynthetic process from pyruvate(GO:0019244) lactate biosynthetic process(GO:0019249) |
| 0.0 | 0.1 | GO:0071895 | odontoblast differentiation(GO:0071895) |
| 0.0 | 0.2 | GO:0046882 | negative regulation of follicle-stimulating hormone secretion(GO:0046882) |
| 0.0 | 0.1 | GO:0045200 | establishment or maintenance of neuroblast polarity(GO:0045196) establishment of neuroblast polarity(GO:0045200) |
| 0.0 | 0.1 | GO:0065001 | specification of axis polarity(GO:0065001) |
| 0.0 | 0.2 | GO:0090273 | regulation of somatostatin secretion(GO:0090273) |
| 0.0 | 0.2 | GO:0097240 | meiotic telomere tethering at nuclear periphery(GO:0044821) meiotic attachment of telomere to nuclear envelope(GO:0070197) chromosome attachment to the nuclear envelope(GO:0097240) |
| 0.0 | 0.1 | GO:0060336 | negative regulation of response to interferon-gamma(GO:0060331) negative regulation of interferon-gamma-mediated signaling pathway(GO:0060336) |
| 0.0 | 0.1 | GO:0014873 | response to muscle activity involved in regulation of muscle adaptation(GO:0014873) |
| 0.0 | 0.1 | GO:0035910 | ascending aorta development(GO:0035905) ascending aorta morphogenesis(GO:0035910) |
| 0.0 | 0.1 | GO:0006667 | sphinganine metabolic process(GO:0006667) |
| 0.0 | 0.2 | GO:0016081 | synaptic vesicle docking(GO:0016081) |
| 0.0 | 0.1 | GO:0015014 | heparan sulfate proteoglycan biosynthetic process, polysaccharide chain biosynthetic process(GO:0015014) |
| 0.0 | 0.1 | GO:0043134 | hindgut contraction(GO:0043133) regulation of hindgut contraction(GO:0043134) |
| 0.0 | 0.2 | GO:0010815 | bradykinin catabolic process(GO:0010815) |
| 0.0 | 0.2 | GO:0046959 | habituation(GO:0046959) |
| 0.0 | 0.1 | GO:0002175 | protein localization to paranode region of axon(GO:0002175) |
| 0.0 | 0.1 | GO:0033092 | positive regulation of immature T cell proliferation in thymus(GO:0033092) |
| 0.0 | 0.6 | GO:0043586 | tongue development(GO:0043586) |
| 0.0 | 0.3 | GO:0000103 | sulfate assimilation(GO:0000103) |
| 0.0 | 0.2 | GO:0070444 | oligodendrocyte progenitor proliferation(GO:0070444) regulation of oligodendrocyte progenitor proliferation(GO:0070445) |
| 0.0 | 0.5 | GO:0045056 | transcytosis(GO:0045056) |
| 0.0 | 0.2 | GO:0051204 | protein insertion into mitochondrial membrane(GO:0051204) |
| 0.0 | 0.2 | GO:2000543 | positive regulation of gastrulation(GO:2000543) |
| 0.0 | 0.1 | GO:0061642 | chemoattraction of axon(GO:0061642) |
| 0.0 | 0.1 | GO:0061343 | cell adhesion involved in heart morphogenesis(GO:0061343) |
| 0.0 | 0.1 | GO:0021570 | rhombomere 4 development(GO:0021570) |
| 0.0 | 0.1 | GO:1903261 | regulation of serine phosphorylation of STAT3 protein(GO:1903261) |
| 0.0 | 0.1 | GO:0060385 | axonogenesis involved in innervation(GO:0060385) |
| 0.0 | 0.1 | GO:1901097 | negative regulation of autophagosome maturation(GO:1901097) |
| 0.0 | 1.0 | GO:0008045 | motor neuron axon guidance(GO:0008045) |
| 0.0 | 0.1 | GO:0052422 | modulation of catalytic activity in other organism involved in symbiotic interaction(GO:0052203) modulation by host of symbiont catalytic activity(GO:0052422) |
| 0.0 | 0.1 | GO:0050975 | sensory perception of touch(GO:0050975) |
| 0.0 | 0.2 | GO:0010701 | positive regulation of norepinephrine secretion(GO:0010701) |
| 0.0 | 0.1 | GO:0035461 | vitamin transmembrane transport(GO:0035461) |
| 0.0 | 0.1 | GO:0019042 | viral latency(GO:0019042) |
| 0.0 | 0.1 | GO:0099558 | maintenance of synapse structure(GO:0099558) |
| 0.0 | 0.1 | GO:1900019 | regulation of protein kinase C activity(GO:1900019) positive regulation of protein kinase C activity(GO:1900020) |
| 0.0 | 0.1 | GO:0060066 | oviduct development(GO:0060066) |
| 0.0 | 0.2 | GO:0086073 | bundle of His cell-Purkinje myocyte adhesion involved in cell communication(GO:0086073) |
| 0.0 | 0.2 | GO:0045162 | clustering of voltage-gated sodium channels(GO:0045162) |
| 0.0 | 0.3 | GO:0003056 | regulation of vascular smooth muscle contraction(GO:0003056) |
| 0.0 | 0.1 | GO:0072602 | interleukin-4 secretion(GO:0072602) |
| 0.0 | 0.1 | GO:0032971 | regulation of muscle filament sliding(GO:0032971) |
| 0.0 | 0.1 | GO:1902174 | positive regulation of keratinocyte apoptotic process(GO:1902174) |
| 0.0 | 0.1 | GO:0045897 | regulation of transcription during mitosis(GO:0045896) positive regulation of transcription during mitosis(GO:0045897) |
| 0.0 | 0.1 | GO:0051964 | negative regulation of synapse assembly(GO:0051964) |
| 0.0 | 0.1 | GO:0086046 | membrane depolarization during SA node cell action potential(GO:0086046) |
| 0.0 | 0.1 | GO:0008065 | establishment of blood-nerve barrier(GO:0008065) |
| 0.0 | 0.2 | GO:0034626 | fatty acid elongation, saturated fatty acid(GO:0019367) fatty acid elongation, unsaturated fatty acid(GO:0019368) fatty acid elongation, monounsaturated fatty acid(GO:0034625) fatty acid elongation, polyunsaturated fatty acid(GO:0034626) |
| 0.0 | 0.5 | GO:0032332 | positive regulation of chondrocyte differentiation(GO:0032332) |
| 0.0 | 0.6 | GO:1902668 | negative regulation of axon extension involved in axon guidance(GO:0048843) negative regulation of axon guidance(GO:1902668) |
| 0.0 | 0.1 | GO:0072038 | mesenchymal stem cell maintenance involved in nephron morphogenesis(GO:0072038) |
| 0.0 | 0.1 | GO:0089700 | protein kinase D signaling(GO:0089700) |
| 0.0 | 0.2 | GO:0010891 | negative regulation of sequestering of triglyceride(GO:0010891) |
| 0.0 | 0.1 | GO:0033353 | S-adenosylmethionine cycle(GO:0033353) |
| 0.0 | 0.3 | GO:0035726 | common myeloid progenitor cell proliferation(GO:0035726) |
| 0.0 | 0.2 | GO:0007199 | G-protein coupled receptor signaling pathway coupled to cGMP nucleotide second messenger(GO:0007199) |
| 0.0 | 0.4 | GO:0032011 | ARF protein signal transduction(GO:0032011) regulation of ARF protein signal transduction(GO:0032012) |
| 0.0 | 0.0 | GO:2000118 | regulation of sodium-dependent phosphate transport(GO:2000118) |
| 0.0 | 0.1 | GO:0043308 | eosinophil activation involved in immune response(GO:0002278) eosinophil mediated immunity(GO:0002447) eosinophil degranulation(GO:0043308) |
| 0.0 | 0.1 | GO:1900029 | positive regulation of ruffle assembly(GO:1900029) |
| 0.0 | 0.1 | GO:1903232 | melanosome assembly(GO:1903232) |
| 0.0 | 0.1 | GO:0030167 | proteoglycan catabolic process(GO:0030167) |
| 0.0 | 0.1 | GO:0006106 | fumarate metabolic process(GO:0006106) |
| 0.0 | 0.2 | GO:0008090 | retrograde axonal transport(GO:0008090) |
| 0.0 | 0.1 | GO:0070294 | renal sodium ion absorption(GO:0070294) |
| 0.0 | 0.1 | GO:0051387 | negative regulation of neurotrophin TRK receptor signaling pathway(GO:0051387) |
| 0.0 | 0.1 | GO:1904219 | regulation of CDP-diacylglycerol-serine O-phosphatidyltransferase activity(GO:1904217) positive regulation of CDP-diacylglycerol-serine O-phosphatidyltransferase activity(GO:1904219) regulation of serine C-palmitoyltransferase activity(GO:1904220) positive regulation of serine C-palmitoyltransferase activity(GO:1904222) |
| 0.0 | 0.1 | GO:0021586 | pons maturation(GO:0021586) |
| 0.0 | 0.1 | GO:0070375 | ERK5 cascade(GO:0070375) |
| 0.0 | 0.1 | GO:0019230 | proprioception(GO:0019230) |
| 0.0 | 0.1 | GO:0071679 | commissural neuron axon guidance(GO:0071679) |
| 0.0 | 0.2 | GO:0016338 | calcium-independent cell-cell adhesion via plasma membrane cell-adhesion molecules(GO:0016338) |
| 0.0 | 0.1 | GO:0009597 | detection of virus(GO:0009597) |
| 0.0 | 1.1 | GO:0007157 | heterophilic cell-cell adhesion via plasma membrane cell adhesion molecules(GO:0007157) |
| 0.0 | 0.2 | GO:0014883 | transition between fast and slow fiber(GO:0014883) |
| 0.0 | 0.1 | GO:0001661 | conditioned taste aversion(GO:0001661) |
| 0.0 | 0.1 | GO:2000589 | cell migration involved in metanephros development(GO:0035788) metanephric mesenchymal cell migration(GO:0035789) regulation of metanephric mesenchymal cell migration(GO:2000589) |
| 0.0 | 0.1 | GO:0071692 | protein localization to extracellular region(GO:0071692) maintenance of protein location in extracellular region(GO:0071694) |
| 0.0 | 0.2 | GO:0048387 | negative regulation of retinoic acid receptor signaling pathway(GO:0048387) |
| 0.0 | 0.3 | GO:0048268 | clathrin coat assembly(GO:0048268) |
| 0.0 | 0.1 | GO:0097029 | mature conventional dendritic cell differentiation(GO:0097029) |
| 0.0 | 0.1 | GO:2000324 | positive regulation of glucocorticoid receptor signaling pathway(GO:2000324) |
| 0.0 | 0.0 | GO:0036118 | hyaluranon cable assembly(GO:0036118) regulation of hyaluranon cable assembly(GO:1900104) positive regulation of hyaluranon cable assembly(GO:1900106) |
| 0.0 | 0.1 | GO:0098795 | mRNA cleavage involved in gene silencing by miRNA(GO:0035279) mRNA cleavage involved in gene silencing(GO:0098795) |
| 0.0 | 0.1 | GO:0060480 | lung goblet cell differentiation(GO:0060480) |
| 0.0 | 0.1 | GO:0021902 | commitment of neuronal cell to specific neuron type in forebrain(GO:0021902) |
| 0.0 | 0.1 | GO:0060836 | lymphatic endothelial cell differentiation(GO:0060836) |
| 0.0 | 0.1 | GO:0032227 | negative regulation of synaptic transmission, dopaminergic(GO:0032227) |
| 0.0 | 0.2 | GO:0048715 | negative regulation of oligodendrocyte differentiation(GO:0048715) |
| 0.0 | 0.3 | GO:0048712 | negative regulation of astrocyte differentiation(GO:0048712) |
| 0.0 | 0.1 | GO:1904261 | regulation of basement membrane assembly involved in embryonic body morphogenesis(GO:1904259) positive regulation of basement membrane assembly involved in embryonic body morphogenesis(GO:1904261) basement membrane assembly involved in embryonic body morphogenesis(GO:2001197) |
| 0.0 | 0.0 | GO:0051599 | response to hydrostatic pressure(GO:0051599) |
| 0.0 | 0.1 | GO:1900368 | regulation of RNA interference(GO:1900368) |
| 0.0 | 0.1 | GO:1903361 | protein localization to basolateral plasma membrane(GO:1903361) |
| 0.0 | 0.2 | GO:0048681 | negative regulation of axon regeneration(GO:0048681) |
| 0.0 | 0.0 | GO:1902302 | regulation of potassium ion export(GO:1902302) |
| 0.0 | 0.1 | GO:0034729 | histone H3-K79 methylation(GO:0034729) |
| 0.0 | 0.1 | GO:0060414 | aorta smooth muscle tissue morphogenesis(GO:0060414) |
| 0.0 | 0.1 | GO:0019344 | cysteine biosynthetic process(GO:0019344) |
| 0.0 | 0.1 | GO:0035624 | receptor transactivation(GO:0035624) epidermal growth factor-activated receptor transactivation by G-protein coupled receptor signaling pathway(GO:0035625) |
| 0.0 | 0.0 | GO:0003278 | apoptotic process involved in heart morphogenesis(GO:0003278) |
| 0.0 | 0.0 | GO:0061073 | ciliary body morphogenesis(GO:0061073) |
| 0.0 | 0.2 | GO:0071420 | cellular response to histamine(GO:0071420) |
| 0.0 | 0.0 | GO:0031585 | regulation of inositol 1,4,5-trisphosphate-sensitive calcium-release channel activity(GO:0031585) |
| 0.0 | 0.0 | GO:2000017 | positive regulation of determination of dorsal identity(GO:2000017) |
| 0.0 | 0.2 | GO:0009312 | oligosaccharide biosynthetic process(GO:0009312) |
| 0.0 | 0.0 | GO:0034137 | positive regulation of toll-like receptor 2 signaling pathway(GO:0034137) |
| 0.0 | 0.1 | GO:0045636 | positive regulation of melanocyte differentiation(GO:0045636) |
| 0.0 | 0.0 | GO:1902083 | negative regulation of peptidyl-cysteine S-nitrosylation(GO:1902083) |
| 0.0 | 0.2 | GO:0090331 | negative regulation of platelet aggregation(GO:0090331) |
| 0.0 | 0.2 | GO:1904322 | response to forskolin(GO:1904321) cellular response to forskolin(GO:1904322) |
| 0.0 | 0.1 | GO:0060700 | regulation of ribonuclease activity(GO:0060700) |
| 0.0 | 0.1 | GO:0007258 | JUN phosphorylation(GO:0007258) |
| 0.0 | 0.0 | GO:0061205 | paramesonephric duct development(GO:0061205) |
| 0.0 | 0.0 | GO:1904754 | positive regulation of vascular associated smooth muscle cell migration(GO:1904754) |
| 0.0 | 0.2 | GO:0098719 | sodium ion import across plasma membrane(GO:0098719) sodium ion import into cell(GO:1990118) |
| 0.0 | 0.1 | GO:0090135 | actin filament branching(GO:0090135) |
| 0.0 | 0.1 | GO:0033326 | cerebrospinal fluid secretion(GO:0033326) |
| 0.0 | 0.1 | GO:0042045 | epithelial fluid transport(GO:0042045) |
| 0.0 | 0.3 | GO:0060081 | membrane hyperpolarization(GO:0060081) |
| 0.0 | 0.4 | GO:0032330 | regulation of chondrocyte differentiation(GO:0032330) |
| 0.0 | 0.1 | GO:0042737 | drug catabolic process(GO:0042737) |
| 0.0 | 0.1 | GO:0021891 | olfactory bulb interneuron development(GO:0021891) |
| 0.0 | 0.1 | GO:0035795 | negative regulation of mitochondrial membrane permeability(GO:0035795) |
| 0.0 | 0.0 | GO:0009946 | proximal/distal axis specification(GO:0009946) |
| 0.0 | 0.1 | GO:0048739 | cardiac muscle fiber development(GO:0048739) |
| 0.0 | 0.4 | GO:0010107 | potassium ion import(GO:0010107) |
| 0.0 | 0.1 | GO:0019934 | cGMP-mediated signaling(GO:0019934) |
| 0.0 | 0.1 | GO:0097503 | sialylation(GO:0097503) |
| 0.0 | 0.2 | GO:0035235 | ionotropic glutamate receptor signaling pathway(GO:0035235) |
| 0.0 | 0.1 | GO:0051031 | tRNA transport(GO:0051031) |
| 0.0 | 0.2 | GO:0035810 | positive regulation of urine volume(GO:0035810) |
| 0.0 | 0.1 | GO:0036289 | peptidyl-serine autophosphorylation(GO:0036289) |
| 0.0 | 0.0 | GO:0060684 | epithelial-mesenchymal cell signaling(GO:0060684) |
| 0.0 | 0.0 | GO:0032079 | positive regulation of endodeoxyribonuclease activity(GO:0032079) |
| 0.0 | 0.3 | GO:0006817 | phosphate ion transport(GO:0006817) |
| 0.0 | 0.0 | GO:1901201 | regulation of extracellular matrix assembly(GO:1901201) |
| 0.0 | 0.0 | GO:1903984 | regulation of TRAIL-activated apoptotic signaling pathway(GO:1903121) positive regulation of TRAIL-activated apoptotic signaling pathway(GO:1903984) |
| 0.0 | 0.0 | GO:0021775 | smoothened signaling pathway involved in ventral spinal cord interneuron specification(GO:0021775) smoothened signaling pathway involved in spinal cord motor neuron cell fate specification(GO:0021776) |
| 0.0 | 0.2 | GO:0035278 | miRNA mediated inhibition of translation(GO:0035278) |
| 0.0 | 0.1 | GO:1902231 | positive regulation of intrinsic apoptotic signaling pathway in response to DNA damage(GO:1902231) |
| 0.0 | 0.1 | GO:0007084 | mitotic nuclear envelope reassembly(GO:0007084) |
| 0.0 | 0.1 | GO:0045218 | zonula adherens maintenance(GO:0045218) |
| 0.0 | 0.2 | GO:0042711 | maternal behavior(GO:0042711) |
| 0.0 | 0.1 | GO:0007217 | tachykinin receptor signaling pathway(GO:0007217) |
| 0.0 | 0.1 | GO:0019732 | antifungal humoral response(GO:0019732) |
| 0.0 | 0.0 | GO:0042373 | vitamin K metabolic process(GO:0042373) |
| 0.0 | 0.0 | GO:0016480 | negative regulation of transcription from RNA polymerase III promoter(GO:0016480) |
| 0.0 | 0.1 | GO:0006654 | phosphatidic acid biosynthetic process(GO:0006654) |
| 0.0 | 0.1 | GO:0010801 | negative regulation of peptidyl-threonine phosphorylation(GO:0010801) |
| 0.0 | 0.1 | GO:1903818 | positive regulation of delayed rectifier potassium channel activity(GO:1902261) positive regulation of voltage-gated potassium channel activity(GO:1903818) |
| 0.0 | 0.0 | GO:0090210 | regulation of establishment of blood-brain barrier(GO:0090210) |
| 0.0 | 0.1 | GO:0090261 | positive regulation of inclusion body assembly(GO:0090261) |
| 0.0 | 0.0 | GO:1902775 | mitochondrial large ribosomal subunit assembly(GO:1902775) |
| 0.0 | 0.2 | GO:0050965 | detection of temperature stimulus involved in sensory perception(GO:0050961) detection of temperature stimulus involved in sensory perception of pain(GO:0050965) |
| 0.0 | 0.3 | GO:1903861 | regulation of dendrite extension(GO:1903859) positive regulation of dendrite extension(GO:1903861) |
| 0.0 | 0.0 | GO:0072051 | juxtaglomerular apparatus development(GO:0072051) |
| 0.0 | 0.0 | GO:0007412 | axon target recognition(GO:0007412) |
| 0.0 | 0.1 | GO:2000786 | positive regulation of autophagosome assembly(GO:2000786) |
| 0.0 | 0.1 | GO:0045110 | intermediate filament bundle assembly(GO:0045110) |
| 0.0 | 0.0 | GO:0070831 | basement membrane assembly(GO:0070831) |
| 0.0 | 0.0 | GO:0045715 | negative regulation of low-density lipoprotein particle receptor biosynthetic process(GO:0045715) |
| 0.0 | 0.0 | GO:0006532 | aspartate biosynthetic process(GO:0006532) |
| 0.0 | 0.1 | GO:0043923 | positive regulation by host of viral transcription(GO:0043923) |
| 0.0 | 0.0 | GO:0035973 | aggrephagy(GO:0035973) |
| 0.0 | 0.1 | GO:0036303 | lymphangiogenesis(GO:0001946) lymph vessel morphogenesis(GO:0036303) |
| 0.0 | 0.0 | GO:0072526 | pyridine-containing compound catabolic process(GO:0072526) |
| 0.0 | 0.0 | GO:0046952 | ketone body catabolic process(GO:0046952) |
| 0.0 | 0.1 | GO:0006627 | protein processing involved in protein targeting to mitochondrion(GO:0006627) |
| 0.0 | 0.1 | GO:0002329 | pre-B cell differentiation(GO:0002329) |
| 0.0 | 0.1 | GO:0097340 | inhibition of cysteine-type endopeptidase activity(GO:0097340) zymogen inhibition(GO:0097341) inhibition of cysteine-type endopeptidase activity involved in apoptotic process(GO:1990001) |
| 0.0 | 0.0 | GO:0010182 | carbohydrate mediated signaling(GO:0009756) hexose mediated signaling(GO:0009757) sugar mediated signaling pathway(GO:0010182) glucose mediated signaling pathway(GO:0010255) |
| 0.0 | 0.0 | GO:0021747 | cochlear nucleus development(GO:0021747) |
| 0.0 | 0.1 | GO:0097264 | self proteolysis(GO:0097264) |
| 0.0 | 0.1 | GO:0042483 | negative regulation of odontogenesis(GO:0042483) |
| 0.0 | 0.2 | GO:0060261 | positive regulation of transcription initiation from RNA polymerase II promoter(GO:0060261) |
| 0.0 | 0.0 | GO:1903977 | positive regulation of glial cell migration(GO:1903977) |
| 0.0 | 0.1 | GO:0090136 | epithelial cell-cell adhesion(GO:0090136) |
| 0.0 | 0.1 | GO:0007221 | positive regulation of transcription of Notch receptor target(GO:0007221) |
| 0.0 | 0.0 | GO:0060594 | mammary gland specification(GO:0060594) |
| 0.0 | 0.1 | GO:0038030 | non-canonical Wnt signaling pathway via MAPK cascade(GO:0038030) |
| 0.0 | 0.1 | GO:0070544 | histone H3-K36 demethylation(GO:0070544) |
| 0.0 | 0.1 | GO:0031115 | negative regulation of microtubule polymerization(GO:0031115) |
| 0.0 | 0.0 | GO:0048625 | myoblast fate commitment(GO:0048625) |
| 0.0 | 0.1 | GO:0035459 | cargo loading into vesicle(GO:0035459) |
| 0.0 | 0.1 | GO:0006335 | DNA replication-dependent nucleosome assembly(GO:0006335) DNA replication-dependent nucleosome organization(GO:0034723) |
| 0.0 | 0.1 | GO:0019511 | peptidyl-proline hydroxylation(GO:0019511) |
| 0.0 | 0.1 | GO:0061302 | smooth muscle cell-matrix adhesion(GO:0061302) |
| 0.0 | 0.0 | GO:0010572 | positive regulation of platelet activation(GO:0010572) |
| 0.0 | 0.3 | GO:0045880 | positive regulation of smoothened signaling pathway(GO:0045880) |
| 0.0 | 0.0 | GO:0000389 | mRNA 3'-splice site recognition(GO:0000389) |
| 0.0 | 0.0 | GO:0019254 | carnitine metabolic process, CoA-linked(GO:0019254) |
| 0.0 | 0.0 | GO:0030208 | dermatan sulfate biosynthetic process(GO:0030208) |
| 0.0 | 0.0 | GO:0046813 | receptor-mediated virion attachment to host cell(GO:0046813) |
| 0.0 | 0.0 | GO:0017187 | peptidyl-glutamic acid carboxylation(GO:0017187) |
| 0.0 | 0.0 | GO:2000645 | negative regulation of receptor catabolic process(GO:2000645) |
| 0.0 | 0.1 | GO:0051775 | response to redox state(GO:0051775) |
| 0.0 | 0.0 | GO:0019626 | short-chain fatty acid catabolic process(GO:0019626) |
| 0.0 | 0.0 | GO:2000048 | negative regulation of cell-cell adhesion mediated by cadherin(GO:2000048) |
| 0.0 | 0.0 | GO:0051790 | short-chain fatty acid biosynthetic process(GO:0051790) |
| 0.0 | 0.0 | GO:1904752 | vascular associated smooth muscle cell migration(GO:1904738) regulation of vascular associated smooth muscle cell migration(GO:1904752) |
| 0.0 | 0.1 | GO:0042670 | retinal cone cell differentiation(GO:0042670) |
| 0.0 | 0.3 | GO:0046839 | phospholipid dephosphorylation(GO:0046839) |
| 0.0 | 0.2 | GO:0070584 | mitochondrion morphogenesis(GO:0070584) |
| 0.0 | 0.1 | GO:0045836 | positive regulation of meiotic nuclear division(GO:0045836) |
| 0.0 | 0.1 | GO:0051315 | attachment of mitotic spindle microtubules to kinetochore(GO:0051315) |
| 0.0 | 0.2 | GO:0009109 | coenzyme catabolic process(GO:0009109) |
| 0.0 | 0.1 | GO:0048935 | peripheral nervous system neuron differentiation(GO:0048934) peripheral nervous system neuron development(GO:0048935) |
| 0.0 | 0.1 | GO:2000060 | positive regulation of protein ubiquitination involved in ubiquitin-dependent protein catabolic process(GO:2000060) |
| 0.0 | 0.0 | GO:0032911 | negative regulation of transforming growth factor beta1 production(GO:0032911) |
| 0.0 | 0.0 | GO:0097252 | oligodendrocyte apoptotic process(GO:0097252) |
| 0.0 | 0.0 | GO:0045113 | regulation of integrin biosynthetic process(GO:0045113) |
| 0.0 | 0.1 | GO:0045475 | locomotor rhythm(GO:0045475) |
| 0.0 | 0.0 | GO:1903862 | positive regulation of oxidative phosphorylation(GO:1903862) |
| 0.0 | 0.1 | GO:0006108 | malate metabolic process(GO:0006108) |
| 0.0 | 0.1 | GO:0060314 | regulation of ryanodine-sensitive calcium-release channel activity(GO:0060314) |
| 0.0 | 0.0 | GO:0098903 | regulation of membrane repolarization during action potential(GO:0098903) |
| 0.0 | 0.1 | GO:2000696 | regulation of epithelial cell differentiation involved in kidney development(GO:2000696) |
| 0.0 | 0.1 | GO:0042989 | sequestering of actin monomers(GO:0042989) |
| 0.0 | 0.1 | GO:0003334 | keratinocyte development(GO:0003334) |
| 0.0 | 0.0 | GO:2000659 | regulation of interleukin-1-mediated signaling pathway(GO:2000659) |
| 0.0 | 0.1 | GO:0021860 | pyramidal neuron development(GO:0021860) |
| 0.0 | 0.1 | GO:0015727 | lactate transport(GO:0015727) lactate transmembrane transport(GO:0035873) plasma membrane lactate transport(GO:0035879) |
| 0.0 | 0.0 | GO:0070100 | negative regulation of chemokine-mediated signaling pathway(GO:0070100) |
| 0.0 | 0.0 | GO:0048808 | male genitalia morphogenesis(GO:0048808) male anatomical structure morphogenesis(GO:0090598) |
| 0.0 | 0.0 | GO:0021869 | forebrain ventricular zone progenitor cell division(GO:0021869) |
| 0.0 | 0.1 | GO:0033564 | anterior/posterior axon guidance(GO:0033564) |
| 0.0 | 0.1 | GO:0006707 | cholesterol catabolic process(GO:0006707) sterol catabolic process(GO:0016127) |
| 0.0 | 0.0 | GO:0032876 | negative regulation of DNA endoreduplication(GO:0032876) |
| 0.0 | 0.0 | GO:0006438 | valyl-tRNA aminoacylation(GO:0006438) |
| 0.0 | 0.0 | GO:0051295 | establishment of meiotic spindle localization(GO:0051295) |
| 0.0 | 0.0 | GO:0003289 | atrial septum primum morphogenesis(GO:0003289) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.1 | 0.3 | GO:0005899 | insulin receptor complex(GO:0005899) |
| 0.1 | 0.3 | GO:0060053 | neurofilament cytoskeleton(GO:0060053) |
| 0.1 | 0.3 | GO:0002193 | MAML1-RBP-Jkappa- ICN1 complex(GO:0002193) |
| 0.1 | 0.2 | GO:0097513 | myosin II filament(GO:0097513) |
| 0.1 | 0.2 | GO:0034673 | inhibin-betaglycan-ActRII complex(GO:0034673) |
| 0.1 | 0.5 | GO:0001520 | outer dense fiber(GO:0001520) |
| 0.1 | 0.1 | GO:0071664 | catenin-TCF7L2 complex(GO:0071664) |
| 0.1 | 0.4 | GO:0036056 | filtration diaphragm(GO:0036056) slit diaphragm(GO:0036057) |
| 0.0 | 0.2 | GO:0008091 | spectrin(GO:0008091) |
| 0.0 | 0.1 | GO:0035061 | interchromatin granule(GO:0035061) |
| 0.0 | 0.2 | GO:0032585 | multivesicular body membrane(GO:0032585) |
| 0.0 | 0.2 | GO:1990357 | terminal web(GO:1990357) |
| 0.0 | 0.5 | GO:0043194 | axon initial segment(GO:0043194) |
| 0.0 | 0.2 | GO:0045298 | tubulin complex(GO:0045298) |
| 0.0 | 0.1 | GO:1990907 | beta-catenin-TCF complex(GO:1990907) |
| 0.0 | 0.3 | GO:0005861 | troponin complex(GO:0005861) |
| 0.0 | 0.1 | GO:0008282 | ATP-sensitive potassium channel complex(GO:0008282) |
| 0.0 | 0.3 | GO:0030314 | junctional membrane complex(GO:0030314) |
| 0.0 | 0.3 | GO:0042788 | polysomal ribosome(GO:0042788) |
| 0.0 | 0.3 | GO:0031209 | SCAR complex(GO:0031209) |
| 0.0 | 0.1 | GO:0072534 | perineuronal net(GO:0072534) |
| 0.0 | 0.4 | GO:0031597 | cytosolic proteasome complex(GO:0031597) |
| 0.0 | 0.2 | GO:0034992 | microtubule organizing center attachment site(GO:0034992) LINC complex(GO:0034993) |
| 0.0 | 0.1 | GO:0031088 | platelet dense granule membrane(GO:0031088) |
| 0.0 | 0.4 | GO:0042589 | zymogen granule membrane(GO:0042589) |
| 0.0 | 0.2 | GO:0070187 | telosome(GO:0070187) |
| 0.0 | 0.1 | GO:0016533 | cyclin-dependent protein kinase 5 holoenzyme complex(GO:0016533) |
| 0.0 | 0.1 | GO:0045098 | type III intermediate filament(GO:0045098) |
| 0.0 | 0.2 | GO:0060091 | kinocilium(GO:0060091) |
| 0.0 | 0.1 | GO:0032777 | Piccolo NuA4 histone acetyltransferase complex(GO:0032777) |
| 0.0 | 0.3 | GO:0005916 | fascia adherens(GO:0005916) |
| 0.0 | 0.2 | GO:0044233 | ER-mitochondrion membrane contact site(GO:0044233) |
| 0.0 | 0.3 | GO:0097038 | perinuclear endoplasmic reticulum(GO:0097038) |
| 0.0 | 0.4 | GO:0032588 | trans-Golgi network membrane(GO:0032588) |
| 0.0 | 0.3 | GO:0031430 | M band(GO:0031430) |
| 0.0 | 0.1 | GO:0030485 | smooth muscle contractile fiber(GO:0030485) |
| 0.0 | 0.1 | GO:0031528 | microvillus membrane(GO:0031528) |
| 0.0 | 0.2 | GO:0042587 | glycogen granule(GO:0042587) |
| 0.0 | 0.2 | GO:0032279 | asymmetric synapse(GO:0032279) |
| 0.0 | 0.3 | GO:0016327 | apicolateral plasma membrane(GO:0016327) |
| 0.0 | 0.1 | GO:0033063 | Rad51B-Rad51C-Rad51D-XRCC2 complex(GO:0033063) |
| 0.0 | 0.3 | GO:0030673 | axolemma(GO:0030673) |
| 0.0 | 0.2 | GO:0017146 | NMDA selective glutamate receptor complex(GO:0017146) |
| 0.0 | 0.1 | GO:0016222 | procollagen-proline 4-dioxygenase complex(GO:0016222) |
| 0.0 | 0.1 | GO:0044530 | supraspliceosomal complex(GO:0044530) |
| 0.0 | 0.1 | GO:0098563 | integral component of synaptic vesicle membrane(GO:0030285) intrinsic component of synaptic vesicle membrane(GO:0098563) |
| 0.0 | 0.0 | GO:0034679 | integrin alpha9-beta1 complex(GO:0034679) |
| 0.0 | 0.1 | GO:0035253 | ciliary rootlet(GO:0035253) |
| 0.0 | 0.4 | GO:0048786 | presynaptic active zone(GO:0048786) |
| 0.0 | 0.2 | GO:0032426 | stereocilium tip(GO:0032426) |
| 0.0 | 1.0 | GO:0031526 | brush border membrane(GO:0031526) |
| 0.0 | 0.2 | GO:0071565 | nBAF complex(GO:0071565) |
| 0.0 | 0.3 | GO:0030057 | desmosome(GO:0030057) |
| 0.0 | 0.3 | GO:0044295 | axonal growth cone(GO:0044295) |
| 0.0 | 0.1 | GO:0044354 | pinosome(GO:0044352) macropinosome(GO:0044354) |
| 0.0 | 0.1 | GO:0045180 | basal cortex(GO:0045180) |
| 0.0 | 0.1 | GO:1990454 | L-type voltage-gated calcium channel complex(GO:1990454) |
| 0.0 | 0.1 | GO:0043083 | synaptic cleft(GO:0043083) |
| 0.0 | 0.1 | GO:0016342 | catenin complex(GO:0016342) |
| 0.0 | 0.5 | GO:0045095 | keratin filament(GO:0045095) |
| 0.0 | 0.1 | GO:0070695 | FHF complex(GO:0070695) |
| 0.0 | 0.1 | GO:0005915 | zonula adherens(GO:0005915) |
| 0.0 | 0.1 | GO:0016593 | Cdc73/Paf1 complex(GO:0016593) |
| 0.0 | 0.2 | GO:0005671 | Ada2/Gcn5/Ada3 transcription activator complex(GO:0005671) |
| 0.0 | 0.2 | GO:0008305 | integrin complex(GO:0008305) |
| 0.0 | 0.0 | GO:0000814 | ESCRT II complex(GO:0000814) |
| 0.0 | 0.4 | GO:0098878 | ionotropic glutamate receptor complex(GO:0008328) neurotransmitter receptor complex(GO:0098878) |
| 0.0 | 0.0 | GO:0033596 | TSC1-TSC2 complex(GO:0033596) |
| 0.0 | 0.0 | GO:1990462 | omegasome(GO:1990462) |
| 0.0 | 0.5 | GO:0030175 | filopodium(GO:0030175) |
| 0.0 | 0.1 | GO:0005577 | fibrinogen complex(GO:0005577) |
| 0.0 | 0.3 | GO:0005921 | gap junction(GO:0005921) |
| 0.0 | 0.1 | GO:0031314 | extrinsic component of mitochondrial inner membrane(GO:0031314) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.1 | 0.4 | GO:0008449 | N-acetylglucosamine-6-sulfatase activity(GO:0008449) |
| 0.1 | 0.3 | GO:0035939 | microsatellite binding(GO:0035939) |
| 0.1 | 0.3 | GO:0031697 | beta-1 adrenergic receptor binding(GO:0031697) |
| 0.1 | 0.2 | GO:0030158 | protein xylosyltransferase activity(GO:0030158) |
| 0.1 | 0.3 | GO:0097001 | ceramide binding(GO:0097001) |
| 0.1 | 0.5 | GO:0008429 | phosphatidylethanolamine binding(GO:0008429) |
| 0.1 | 0.4 | GO:0030492 | hemoglobin binding(GO:0030492) |
| 0.1 | 0.3 | GO:0019871 | sodium channel inhibitor activity(GO:0019871) |
| 0.1 | 0.5 | GO:0039706 | co-receptor binding(GO:0039706) |
| 0.1 | 0.2 | GO:0005250 | A-type (transient outward) potassium channel activity(GO:0005250) |
| 0.1 | 0.2 | GO:0030172 | troponin C binding(GO:0030172) |
| 0.1 | 0.3 | GO:0034190 | apolipoprotein receptor binding(GO:0034190) |
| 0.1 | 0.3 | GO:0004791 | thioredoxin-disulfide reductase activity(GO:0004791) |
| 0.0 | 0.2 | GO:0004459 | L-lactate dehydrogenase activity(GO:0004459) |
| 0.0 | 0.4 | GO:0003841 | 1-acylglycerol-3-phosphate O-acyltransferase activity(GO:0003841) |
| 0.0 | 0.2 | GO:0000099 | sulfur amino acid transmembrane transporter activity(GO:0000099) |
| 0.0 | 0.1 | GO:0015319 | sodium:inorganic phosphate symporter activity(GO:0015319) |
| 0.0 | 0.1 | GO:0047623 | AMP deaminase activity(GO:0003876) adenosine-phosphate deaminase activity(GO:0047623) |
| 0.0 | 0.2 | GO:0015016 | [heparan sulfate]-glucosamine N-sulfotransferase activity(GO:0015016) |
| 0.0 | 0.2 | GO:0004971 | AMPA glutamate receptor activity(GO:0004971) |
| 0.0 | 0.2 | GO:0098821 | BMP receptor activity(GO:0098821) |
| 0.0 | 0.1 | GO:0050508 | glucuronosyl-N-acetylglucosaminyl-proteoglycan 4-alpha-N-acetylglucosaminyltransferase activity(GO:0050508) |
| 0.0 | 0.3 | GO:0051864 | histone demethylase activity (H3-K36 specific)(GO:0051864) |
| 0.0 | 0.1 | GO:0042284 | sphingolipid delta-4 desaturase activity(GO:0042284) |
| 0.0 | 0.2 | GO:0004969 | histamine receptor activity(GO:0004969) |
| 0.0 | 0.1 | GO:0035373 | chondroitin sulfate proteoglycan binding(GO:0035373) |
| 0.0 | 0.1 | GO:0031708 | endothelin B receptor binding(GO:0031708) |
| 0.0 | 0.1 | GO:0003986 | acetyl-CoA hydrolase activity(GO:0003986) |
| 0.0 | 0.3 | GO:0001640 | adenylate cyclase inhibiting G-protein coupled glutamate receptor activity(GO:0001640) |
| 0.0 | 0.3 | GO:0015193 | L-proline transmembrane transporter activity(GO:0015193) |
| 0.0 | 0.5 | GO:0070742 | C2H2 zinc finger domain binding(GO:0070742) |
| 0.0 | 0.7 | GO:0030215 | semaphorin receptor binding(GO:0030215) |
| 0.0 | 0.3 | GO:0050544 | arachidonic acid binding(GO:0050544) |
| 0.0 | 0.3 | GO:0031821 | G-protein coupled serotonin receptor binding(GO:0031821) |
| 0.0 | 0.1 | GO:0003726 | double-stranded RNA adenosine deaminase activity(GO:0003726) |
| 0.0 | 0.2 | GO:0086080 | protein binding involved in heterotypic cell-cell adhesion(GO:0086080) |
| 0.0 | 0.5 | GO:0030553 | cGMP binding(GO:0030553) |
| 0.0 | 0.3 | GO:0042577 | lipid phosphatase activity(GO:0042577) |
| 0.0 | 0.2 | GO:0005005 | transmembrane-ephrin receptor activity(GO:0005005) |
| 0.0 | 0.1 | GO:0071532 | ankyrin repeat binding(GO:0071532) |
| 0.0 | 0.1 | GO:0047192 | 1-alkylglycerophosphocholine O-acetyltransferase activity(GO:0047192) |
| 0.0 | 0.1 | GO:0034186 | apolipoprotein A-I binding(GO:0034186) |
| 0.0 | 0.1 | GO:0004069 | L-aspartate:2-oxoglutarate aminotransferase activity(GO:0004069) |
| 0.0 | 0.1 | GO:0005219 | ryanodine-sensitive calcium-release channel activity(GO:0005219) |
| 0.0 | 0.3 | GO:0045294 | alpha-catenin binding(GO:0045294) |
| 0.0 | 0.2 | GO:0070700 | BMP receptor binding(GO:0070700) |
| 0.0 | 0.2 | GO:0009922 | fatty acid elongase activity(GO:0009922) 3-oxo-arachidoyl-CoA synthase activity(GO:0102336) 3-oxo-cerotoyl-CoA synthase activity(GO:0102337) 3-oxo-lignoceronyl-CoA synthase activity(GO:0102338) |
| 0.0 | 0.2 | GO:0008499 | UDP-galactose:beta-N-acetylglucosamine beta-1,3-galactosyltransferase activity(GO:0008499) |
| 0.0 | 0.2 | GO:0016907 | G-protein coupled acetylcholine receptor activity(GO:0016907) |
| 0.0 | 0.1 | GO:0016309 | 1-phosphatidylinositol-5-phosphate 4-kinase activity(GO:0016309) |
| 0.0 | 0.1 | GO:0000832 | inositol hexakisphosphate kinase activity(GO:0000828) inositol hexakisphosphate 5-kinase activity(GO:0000832) inositol hexakisphosphate 1-kinase activity(GO:0052723) inositol hexakisphosphate 3-kinase activity(GO:0052724) |
| 0.0 | 0.0 | GO:0046976 | histone methyltransferase activity (H3-K27 specific)(GO:0046976) |
| 0.0 | 0.1 | GO:0005030 | neurotrophin receptor activity(GO:0005030) |
| 0.0 | 0.1 | GO:0051525 | NFAT protein binding(GO:0051525) |
| 0.0 | 0.1 | GO:0035651 | AP-3 adaptor complex binding(GO:0035651) |
| 0.0 | 0.1 | GO:0070052 | collagen V binding(GO:0070052) |
| 0.0 | 0.1 | GO:0005220 | inositol 1,4,5-trisphosphate-sensitive calcium-release channel activity(GO:0005220) |
| 0.0 | 0.1 | GO:0097603 | temperature-gated ion channel activity(GO:0097603) |
| 0.0 | 0.3 | GO:0005068 | transmembrane receptor protein tyrosine kinase adaptor activity(GO:0005068) |
| 0.0 | 0.2 | GO:0016920 | pyroglutamyl-peptidase activity(GO:0016920) |
| 0.0 | 0.1 | GO:0008502 | melatonin receptor activity(GO:0008502) |
| 0.0 | 0.3 | GO:0008432 | JUN kinase binding(GO:0008432) |
| 0.0 | 0.1 | GO:0004470 | malic enzyme activity(GO:0004470) malate dehydrogenase (decarboxylating) (NAD+) activity(GO:0004471) |
| 0.0 | 0.1 | GO:0004938 | alpha2-adrenergic receptor activity(GO:0004938) |
| 0.0 | 0.1 | GO:0030943 | mitochondrion targeting sequence binding(GO:0030943) |
| 0.0 | 0.3 | GO:0030898 | actin-dependent ATPase activity(GO:0030898) |
| 0.0 | 0.2 | GO:0031702 | type 1 angiotensin receptor binding(GO:0031702) |
| 0.0 | 0.1 | GO:0003958 | NADPH-hemoprotein reductase activity(GO:0003958) |
| 0.0 | 0.1 | GO:0005134 | interleukin-2 receptor binding(GO:0005134) |
| 0.0 | 0.0 | GO:0070905 | serine binding(GO:0070905) |
| 0.0 | 0.1 | GO:0003828 | alpha-N-acetylneuraminate alpha-2,8-sialyltransferase activity(GO:0003828) |
| 0.0 | 0.3 | GO:0004185 | serine-type carboxypeptidase activity(GO:0004185) |
| 0.0 | 0.1 | GO:0019797 | procollagen-proline 3-dioxygenase activity(GO:0019797) |
| 0.0 | 0.4 | GO:0005242 | inward rectifier potassium channel activity(GO:0005242) |
| 0.0 | 0.0 | GO:0017002 | activin-activated receptor activity(GO:0017002) |
| 0.0 | 0.1 | GO:0004691 | cAMP-dependent protein kinase activity(GO:0004691) |
| 0.0 | 0.5 | GO:0005086 | ARF guanyl-nucleotide exchange factor activity(GO:0005086) |
| 0.0 | 0.7 | GO:0005251 | delayed rectifier potassium channel activity(GO:0005251) |
| 0.0 | 0.1 | GO:0004312 | fatty acid synthase activity(GO:0004312) |
| 0.0 | 0.2 | GO:0003993 | acid phosphatase activity(GO:0003993) |
| 0.0 | 0.1 | GO:0004514 | nicotinate-nucleotide diphosphorylase (carboxylating) activity(GO:0004514) |
| 0.0 | 0.1 | GO:0034711 | inhibin binding(GO:0034711) |
| 0.0 | 0.3 | GO:0005112 | Notch binding(GO:0005112) |
| 0.0 | 0.2 | GO:0005522 | profilin binding(GO:0005522) |
| 0.0 | 0.3 | GO:0030676 | Rac guanyl-nucleotide exchange factor activity(GO:0030676) |
| 0.0 | 0.2 | GO:0070679 | inositol 1,4,5 trisphosphate binding(GO:0070679) |
| 0.0 | 0.1 | GO:0008142 | oxysterol binding(GO:0008142) |
| 0.0 | 0.1 | GO:0034056 | estrogen response element binding(GO:0034056) |
| 0.0 | 0.0 | GO:0097109 | neuroligin family protein binding(GO:0097109) |
| 0.0 | 0.3 | GO:0008266 | poly(U) RNA binding(GO:0008266) |
| 0.0 | 0.1 | GO:0032422 | purine-rich negative regulatory element binding(GO:0032422) |
| 0.0 | 0.1 | GO:0046923 | ER retention sequence binding(GO:0046923) |
| 0.0 | 0.2 | GO:0031996 | thioesterase binding(GO:0031996) |
| 0.0 | 0.1 | GO:0033691 | sialic acid binding(GO:0033691) |
| 0.0 | 0.3 | GO:0004435 | phosphatidylinositol phospholipase C activity(GO:0004435) |
| 0.0 | 0.2 | GO:0015386 | sodium:proton antiporter activity(GO:0015385) potassium:proton antiporter activity(GO:0015386) |
| 0.0 | 0.1 | GO:0001849 | complement component C1q binding(GO:0001849) |
| 0.0 | 0.5 | GO:0017080 | sodium channel regulator activity(GO:0017080) |
| 0.0 | 0.1 | GO:0038064 | collagen receptor activity(GO:0038064) |
| 0.0 | 0.2 | GO:0001206 | transcriptional repressor activity, RNA polymerase II distal enhancer sequence-specific binding(GO:0001206) |
| 0.0 | 0.1 | GO:0016530 | metallochaperone activity(GO:0016530) |
| 0.0 | 0.6 | GO:0005109 | frizzled binding(GO:0005109) |
| 0.0 | 0.1 | GO:0043426 | MRF binding(GO:0043426) |
| 0.0 | 0.3 | GO:0030371 | translation repressor activity(GO:0030371) |
| 0.0 | 0.2 | GO:0032794 | GTPase activating protein binding(GO:0032794) |
| 0.0 | 0.1 | GO:0008508 | bile acid:sodium symporter activity(GO:0008508) |
| 0.0 | 0.1 | GO:0008821 | crossover junction endodeoxyribonuclease activity(GO:0008821) |
| 0.0 | 0.1 | GO:0052650 | NADP-retinol dehydrogenase activity(GO:0052650) |
| 0.0 | 0.1 | GO:0016494 | C-X-C chemokine receptor activity(GO:0016494) |
| 0.0 | 0.1 | GO:0015280 | ligand-gated sodium channel activity(GO:0015280) |
| 0.0 | 0.8 | GO:0005089 | Rho guanyl-nucleotide exchange factor activity(GO:0005089) |
| 0.0 | 0.1 | GO:0036402 | proteasome-activating ATPase activity(GO:0036402) |
| 0.0 | 0.1 | GO:0070097 | delta-catenin binding(GO:0070097) |
| 0.0 | 0.2 | GO:0005234 | extracellular-glutamate-gated ion channel activity(GO:0005234) |
| 0.0 | 0.1 | GO:0019784 | NEDD8-specific protease activity(GO:0019784) |
| 0.0 | 0.1 | GO:0070008 | serine-type exopeptidase activity(GO:0070008) |
| 0.0 | 0.0 | GO:0008260 | 3-oxoacid CoA-transferase activity(GO:0008260) |
| 0.0 | 0.1 | GO:0008140 | cAMP response element binding protein binding(GO:0008140) |
| 0.0 | 0.0 | GO:0016509 | long-chain-3-hydroxyacyl-CoA dehydrogenase activity(GO:0016509) |
| 0.0 | 0.1 | GO:0004908 | interleukin-1 receptor activity(GO:0004908) |
| 0.0 | 0.2 | GO:0050431 | transforming growth factor beta binding(GO:0050431) |
| 0.0 | 0.1 | GO:0031995 | insulin-like growth factor II binding(GO:0031995) |
| 0.0 | 0.2 | GO:0001972 | retinoic acid binding(GO:0001972) |
| 0.0 | 0.1 | GO:0004499 | N,N-dimethylaniline monooxygenase activity(GO:0004499) |
| 0.0 | 0.2 | GO:0005521 | lamin binding(GO:0005521) |
| 0.0 | 0.0 | GO:0004949 | cannabinoid receptor activity(GO:0004949) |
| 0.0 | 0.2 | GO:0005243 | gap junction channel activity(GO:0005243) |
| 0.0 | 0.1 | GO:0086007 | voltage-gated calcium channel activity involved in cardiac muscle cell action potential(GO:0086007) |
| 0.0 | 0.0 | GO:0019776 | Atg8 ligase activity(GO:0019776) |
| 0.0 | 0.1 | GO:0005042 | netrin receptor activity(GO:0005042) |
| 0.0 | 0.1 | GO:0004656 | procollagen-proline 4-dioxygenase activity(GO:0004656) |
| 0.0 | 0.0 | GO:0000386 | second spliceosomal transesterification activity(GO:0000386) |
| 0.0 | 0.0 | GO:0050501 | hyaluronan synthase activity(GO:0050501) |
| 0.0 | 0.0 | GO:0004771 | sterol esterase activity(GO:0004771) |
| 0.0 | 0.2 | GO:0004653 | polypeptide N-acetylgalactosaminyltransferase activity(GO:0004653) |
| 0.0 | 0.0 | GO:0048185 | activin binding(GO:0048185) |
| 0.0 | 0.2 | GO:0022841 | leak channel activity(GO:0022840) potassium ion leak channel activity(GO:0022841) narrow pore channel activity(GO:0022842) |
| 0.0 | 0.1 | GO:0010314 | phosphatidylinositol-5-phosphate binding(GO:0010314) |
| 0.0 | 0.1 | GO:0015194 | L-serine transmembrane transporter activity(GO:0015194) serine transmembrane transporter activity(GO:0022889) |
| 0.0 | 0.1 | GO:0048019 | receptor antagonist activity(GO:0048019) |
| 0.0 | 0.2 | GO:0052713 | calmodulin-dependent cyclic-nucleotide phosphodiesterase activity(GO:0004117) cGMP-stimulated cyclic-nucleotide phosphodiesterase activity(GO:0004118) cGMP-inhibited cyclic-nucleotide phosphodiesterase activity(GO:0004119) photoreceptor cyclic-nucleotide phosphodiesterase activity(GO:0004120) 7,8-dihydro-D-neopterin 2',3'-cyclic phosphate phosphodiesterase activity(GO:0044688) inositol phosphosphingolipid phospholipase activity(GO:0052712) inositol phosphorylceramide phospholipase activity(GO:0052713) mannosyl-inositol phosphorylceramide phospholipase activity(GO:0052714) mannosyl-diinositol phosphorylceramide phospholipase activity(GO:0052715) |
| 0.0 | 0.0 | GO:0004090 | carbonyl reductase (NADPH) activity(GO:0004090) |
| 0.0 | 0.0 | GO:0051765 | inositol tetrakisphosphate kinase activity(GO:0051765) |
| 0.0 | 0.1 | GO:0030296 | protein tyrosine kinase activator activity(GO:0030296) |
| 0.0 | 0.0 | GO:0038191 | neuropilin binding(GO:0038191) |
| 0.0 | 0.1 | GO:0070728 | leucine binding(GO:0070728) |
| 0.0 | 0.0 | GO:0005157 | macrophage colony-stimulating factor receptor binding(GO:0005157) |
| 0.0 | 0.0 | GO:0052658 | inositol-1,4,5-trisphosphate 5-phosphatase activity(GO:0052658) |
| 0.0 | 0.1 | GO:0030957 | Tat protein binding(GO:0030957) |
| 0.0 | 0.1 | GO:0038132 | neuregulin binding(GO:0038132) |
| 0.0 | 0.0 | GO:0001591 | dopamine neurotransmitter receptor activity, coupled via Gi/Go(GO:0001591) |
| 0.0 | 0.1 | GO:0005520 | insulin-like growth factor binding(GO:0005520) |
| 0.0 | 0.1 | GO:0016662 | oxidoreductase activity, acting on other nitrogenous compounds as donors, cytochrome as acceptor(GO:0016662) |
| 0.0 | 0.1 | GO:0003988 | acetyl-CoA C-acyltransferase activity(GO:0003988) |
| 0.0 | 0.0 | GO:0004832 | valine-tRNA ligase activity(GO:0004832) |
| 0.0 | 0.1 | GO:0061133 | endopeptidase activator activity(GO:0061133) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.0 | 0.8 | PID HEDGEHOG 2PATHWAY | Signaling events mediated by the Hedgehog family |
| 0.0 | 0.4 | PID ARF6 DOWNSTREAM PATHWAY | Arf6 downstream pathway |
| 0.0 | 0.1 | PID TCR RAS PATHWAY | Ras signaling in the CD4+ TCR pathway |
| 0.0 | 0.4 | ST GA12 PATHWAY | G alpha 12 Pathway |
| 0.0 | 0.5 | PID S1P S1P2 PATHWAY | S1P2 pathway |
| 0.0 | 0.1 | PID ALK1 PATHWAY | ALK1 signaling events |
| 0.0 | 0.3 | PID INTEGRIN5 PATHWAY | Beta5 beta6 beta7 and beta8 integrin cell surface interactions |
| 0.0 | 0.7 | PID RHOA REG PATHWAY | Regulation of RhoA activity |
| 0.0 | 1.0 | PID TAP63 PATHWAY | Validated transcriptional targets of TAp63 isoforms |
| 0.0 | 0.5 | PID CDC42 REG PATHWAY | Regulation of CDC42 activity |
| 0.0 | 0.2 | PID ERBB NETWORK PATHWAY | ErbB receptor signaling network |
| 0.0 | 0.6 | PID AJDISS 2PATHWAY | Posttranslational regulation of adherens junction stability and dissassembly |
| 0.0 | 0.3 | PID AURORA A PATHWAY | Aurora A signaling |
| 0.0 | 0.3 | ST WNT CA2 CYCLIC GMP PATHWAY | Wnt/Ca2+/cyclic GMP signaling. |
| 0.0 | 0.5 | PID PS1 PATHWAY | Presenilin action in Notch and Wnt signaling |
| 0.0 | 0.2 | PID NCADHERIN PATHWAY | N-cadherin signaling events |
| 0.0 | 0.3 | PID INTEGRIN2 PATHWAY | Beta2 integrin cell surface interactions |
| 0.0 | 0.0 | PID S1P S1P1 PATHWAY | S1P1 pathway |
| 0.0 | 0.3 | PID SYNDECAN 4 PATHWAY | Syndecan-4-mediated signaling events |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.1 | 0.1 | REACTOME SIGNALING BY ERBB2 | Genes involved in Signaling by ERBB2 |
| 0.1 | 0.6 | REACTOME APOPTOTIC CLEAVAGE OF CELL ADHESION PROTEINS | Genes involved in Apoptotic cleavage of cell adhesion proteins |
| 0.1 | 0.1 | REACTOME APC C CDC20 MEDIATED DEGRADATION OF MITOTIC PROTEINS | Genes involved in APC/C:Cdc20 mediated degradation of mitotic proteins |
| 0.0 | 0.6 | REACTOME UNBLOCKING OF NMDA RECEPTOR GLUTAMATE BINDING AND ACTIVATION | Genes involved in Unblocking of NMDA receptor, glutamate binding and activation |
| 0.0 | 0.1 | REACTOME BINDING AND ENTRY OF HIV VIRION | Genes involved in Binding and entry of HIV virion |
| 0.0 | 0.5 | REACTOME CGMP EFFECTS | Genes involved in cGMP effects |
| 0.0 | 0.0 | REACTOME SEMA3A PLEXIN REPULSION SIGNALING BY INHIBITING INTEGRIN ADHESION | Genes involved in SEMA3A-Plexin repulsion signaling by inhibiting Integrin adhesion |
| 0.0 | 0.5 | REACTOME INTERACTION BETWEEN L1 AND ANKYRINS | Genes involved in Interaction between L1 and Ankyrins |
| 0.0 | 0.3 | REACTOME SIGNAL ATTENUATION | Genes involved in Signal attenuation |
| 0.0 | 0.3 | REACTOME OTHER SEMAPHORIN INTERACTIONS | Genes involved in Other semaphorin interactions |
| 0.0 | 0.2 | REACTOME DCC MEDIATED ATTRACTIVE SIGNALING | Genes involved in DCC mediated attractive signaling |
| 0.0 | 0.3 | REACTOME ADENYLATE CYCLASE INHIBITORY PATHWAY | Genes involved in Adenylate cyclase inhibitory pathway |
| 0.0 | 0.9 | REACTOME VOLTAGE GATED POTASSIUM CHANNELS | Genes involved in Voltage gated Potassium channels |
| 0.0 | 0.2 | REACTOME TANDEM PORE DOMAIN POTASSIUM CHANNELS | Genes involved in Tandem pore domain potassium channels |
| 0.0 | 0.1 | REACTOME ENDOGENOUS STEROLS | Genes involved in Endogenous sterols |
| 0.0 | 0.2 | REACTOME GLYCOPROTEIN HORMONES | Genes involved in Glycoprotein hormones |
| 0.0 | 0.2 | REACTOME TRANSCRIPTIONAL REGULATION OF WHITE ADIPOCYTE DIFFERENTIATION | Genes involved in Transcriptional Regulation of White Adipocyte Differentiation |
| 0.0 | 0.2 | REACTOME ALPHA LINOLENIC ACID ALA METABOLISM | Genes involved in alpha-linolenic acid (ALA) metabolism |
| 0.0 | 0.0 | REACTOME CONVERSION FROM APC C CDC20 TO APC C CDH1 IN LATE ANAPHASE | Genes involved in Conversion from APC/C:Cdc20 to APC/C:Cdh1 in late anaphase |
| 0.0 | 0.5 | REACTOME STEROID HORMONES | Genes involved in Steroid hormones |
| 0.0 | 0.2 | REACTOME ROLE OF SECOND MESSENGERS IN NETRIN1 SIGNALING | Genes involved in Role of second messengers in netrin-1 signaling |
| 0.0 | 0.3 | REACTOME SYNTHESIS OF PC | Genes involved in Synthesis of PC |
| 0.0 | 0.5 | REACTOME SYNTHESIS OF PA | Genes involved in Synthesis of PA |
| 0.0 | 0.4 | REACTOME SEMA4D INDUCED CELL MIGRATION AND GROWTH CONE COLLAPSE | Genes involved in Sema4D induced cell migration and growth-cone collapse |
| 0.0 | 0.1 | REACTOME RECYCLING OF BILE ACIDS AND SALTS | Genes involved in Recycling of bile acids and salts |
| 0.0 | 0.2 | REACTOME PROTEOLYTIC CLEAVAGE OF SNARE COMPLEX PROTEINS | Genes involved in Proteolytic cleavage of SNARE complex proteins |
| 0.0 | 0.1 | REACTOME RECEPTOR LIGAND BINDING INITIATES THE SECOND PROTEOLYTIC CLEAVAGE OF NOTCH RECEPTOR | Genes involved in Receptor-ligand binding initiates the second proteolytic cleavage of Notch receptor |
| 0.0 | 0.6 | REACTOME NRAGE SIGNALS DEATH THROUGH JNK | Genes involved in NRAGE signals death through JNK |
| 0.0 | 0.3 | REACTOME ADHERENS JUNCTIONS INTERACTIONS | Genes involved in Adherens junctions interactions |
| 0.0 | 0.3 | REACTOME MYOGENESIS | Genes involved in Myogenesis |
| 0.0 | 0.0 | REACTOME TRAF6 MEDIATED IRF7 ACTIVATION IN TLR7 8 OR 9 SIGNALING | Genes involved in TRAF6 mediated IRF7 activation in TLR7/8 or 9 signaling |
| 0.0 | 0.1 | REACTOME ERK MAPK TARGETS | Genes involved in ERK/MAPK targets |
| 0.0 | 0.2 | REACTOME CLASS C 3 METABOTROPIC GLUTAMATE PHEROMONE RECEPTORS | Genes involved in Class C/3 (Metabotropic glutamate/pheromone receptors) |
| 0.0 | 0.0 | REACTOME TRAF6 MEDIATED NFKB ACTIVATION | Genes involved in TRAF6 mediated NF-kB activation |
| 0.0 | 0.1 | REACTOME FACILITATIVE NA INDEPENDENT GLUCOSE TRANSPORTERS | Genes involved in Facilitative Na+-independent glucose transporters |
| 0.0 | 0.2 | REACTOME NA CL DEPENDENT NEUROTRANSMITTER TRANSPORTERS | Genes involved in Na+/Cl- dependent neurotransmitter transporters |
| 0.0 | 0.1 | REACTOME DOPAMINE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Dopamine Neurotransmitter Release Cycle |
| 0.0 | 0.3 | REACTOME STRIATED MUSCLE CONTRACTION | Genes involved in Striated Muscle Contraction |
| 0.0 | 0.1 | REACTOME ABACAVIR TRANSPORT AND METABOLISM | Genes involved in Abacavir transport and metabolism |
| 0.0 | 0.0 | REACTOME G ALPHA Z SIGNALLING EVENTS | Genes involved in G alpha (z) signalling events |
| 0.0 | 0.2 | REACTOME MUSCLE CONTRACTION | Genes involved in Muscle contraction |
| 0.0 | 0.3 | REACTOME INWARDLY RECTIFYING K CHANNELS | Genes involved in Inwardly rectifying K+ channels |
| 0.0 | 0.2 | REACTOME GAP JUNCTION ASSEMBLY | Genes involved in Gap junction assembly |
| 0.0 | 0.4 | REACTOME AMINE LIGAND BINDING RECEPTORS | Genes involved in Amine ligand-binding receptors |
| 0.0 | 0.2 | REACTOME NOTCH1 INTRACELLULAR DOMAIN REGULATES TRANSCRIPTION | Genes involved in NOTCH1 Intracellular Domain Regulates Transcription |
| 0.0 | 0.1 | REACTOME CELL EXTRACELLULAR MATRIX INTERACTIONS | Genes involved in Cell-extracellular matrix interactions |
| 0.0 | 0.0 | REACTOME DESTABILIZATION OF MRNA BY BRF1 | Genes involved in Destabilization of mRNA by Butyrate Response Factor 1 (BRF1) |
| 0.0 | 0.2 | REACTOME BASIGIN INTERACTIONS | Genes involved in Basigin interactions |