| Gene Symbol | Gene ID | Gene Info |
|---|---|---|
|
Ovol1
|
ENSMUSG00000024922.1 | ovo like zinc finger 1 |
| CRE | Gene | Distance | Association probability | Pearson corr. coef. | P-value | Plot |
|---|---|---|---|---|---|---|
| chr19_5554281_5554456 | Ovol1 | 5035 | 0.077681 | 0.27 | 4.6e-02 | Click! |
| chr19_5561484_5561761 | Ovol1 | 976 | 0.259635 | 0.24 | 7.7e-02 | Click! |
| chr19_5553843_5554168 | Ovol1 | 5398 | 0.076187 | 0.24 | 8.1e-02 | Click! |
| chr19_5561236_5561387 | Ovol1 | 665 | 0.377560 | 0.20 | 1.5e-01 | Click! |
| chr19_5559286_5559449 | Ovol1 | 36 | 0.908546 | 0.15 | 2.8e-01 | Click! |
Move your cursor over a bar to see sample name and corresponding Z-value.
| Cis Regulatory Element (CRE) | Target Score | Top associated gene | Gene Info | Distance of CRE to TSS | CRE/Gene association probability |
|---|---|---|---|---|---|
| chr7_103810340_103810581 | 8.87 |
Hbb-bt |
hemoglobin, beta adult t chain |
3536 |
0.08 |
| chr1_23335409_23335710 | 7.76 |
Gm20954 |
predicted gene, 20954 |
11040 |
0.15 |
| chr6_91163602_91163937 | 7.70 |
Hdac11 |
histone deacetylase 11 |
1882 |
0.24 |
| chr17_64616836_64616987 | 7.32 |
Man2a1 |
mannosidase 2, alpha 1 |
16175 |
0.24 |
| chr9_98314165_98314344 | 6.53 |
Gm28530 |
predicted gene 28530 |
12604 |
0.2 |
| chr10_63277539_63277690 | 6.44 |
Herc4 |
hect domain and RLD 4 |
789 |
0.5 |
| chr1_129956953_129957282 | 6.44 |
Gm37278 |
predicted gene, 37278 |
13955 |
0.22 |
| chr8_13122974_13123380 | 5.99 |
Cul4a |
cullin 4A |
348 |
0.77 |
| chr15_16566243_16566682 | 5.96 |
Gm2611 |
predicted gene 2611 |
34100 |
0.19 |
| chr7_140208282_140208490 | 5.94 |
Olfr524 |
olfactory receptor 524 |
2422 |
0.16 |
| chr8_11444309_11444526 | 5.85 |
Col4a2 |
collagen, type IV, alpha 2 |
3308 |
0.16 |
| chr4_119028467_119028820 | 5.84 |
Gm12862 |
predicted gene 12862 |
28158 |
0.08 |
| chr9_113969738_113969932 | 5.78 |
Ubp1 |
upstream binding protein 1 |
610 |
0.61 |
| chr11_78072843_78073236 | 5.69 |
Mir144 |
microRNA 144 |
34 |
0.49 |
| chr15_62151864_62152042 | 5.49 |
Pvt1 |
Pvt1 oncogene |
26222 |
0.23 |
| chr2_93456201_93456461 | 5.42 |
Gm10804 |
predicted gene 10804 |
3510 |
0.2 |
| chr3_153851856_153852016 | 5.42 |
Asb17os |
ankyrin repeat and SOCS box-containing 17, opposite strand |
465 |
0.67 |
| chr13_3659603_3659762 | 5.38 |
Gm23084 |
predicted gene, 23084 |
11145 |
0.16 |
| chr5_143059474_143059645 | 5.31 |
Gm43380 |
predicted gene 43380 |
8094 |
0.14 |
| chr3_105808565_105808856 | 5.26 |
Gm5547 |
predicted gene 5547 |
6830 |
0.11 |
| chr5_142920749_142921092 | 5.26 |
Actb |
actin, beta |
14166 |
0.14 |
| chr16_87713119_87713319 | 5.24 |
Bach1 |
BTB and CNC homology 1, basic leucine zipper transcription factor 1 |
14215 |
0.2 |
| chr5_118481476_118481635 | 5.19 |
Gm15754 |
predicted gene 15754 |
5412 |
0.22 |
| chr5_73355501_73355893 | 5.16 |
Ociad2 |
OCIA domain containing 2 |
14669 |
0.11 |
| chr4_45521990_45522265 | 5.14 |
Shb |
src homology 2 domain-containing transforming protein B |
8203 |
0.15 |
| chr1_4775546_4775860 | 4.78 |
Gm37144 |
predicted gene, 37144 |
3509 |
0.14 |
| chr19_24513560_24513763 | 4.78 |
Fam122a |
family with sequence similarity 122, member A |
36305 |
0.14 |
| chr8_47708286_47708438 | 4.73 |
E030037K01Rik |
RIKEN cDNA E030037K01 gene |
4904 |
0.12 |
| chr10_54042474_54042667 | 4.70 |
Gm47917 |
predicted gene, 47917 |
21241 |
0.18 |
| chr12_4252989_4253140 | 4.68 |
Ncoa1 |
nuclear receptor coactivator 1 |
10514 |
0.1 |
| chr5_135115423_135115665 | 4.67 |
Gm43500 |
predicted gene 43500 |
7749 |
0.1 |
| chr14_14354416_14355184 | 4.60 |
Il3ra |
interleukin 3 receptor, alpha chain |
5179 |
0.12 |
| chr8_122546722_122547355 | 4.53 |
Piezo1 |
piezo-type mechanosensitive ion channel component 1 |
4291 |
0.11 |
| chr11_87748528_87748688 | 4.52 |
Mir142hg |
Mir142 host gene (non-protein coding) |
6969 |
0.09 |
| chr9_20804366_20804599 | 4.51 |
Col5a3 |
collagen, type V, alpha 3 |
10585 |
0.11 |
| chr11_69916265_69916545 | 4.44 |
Gps2 |
G protein pathway suppressor 2 |
364 |
0.61 |
| chr15_32964823_32965125 | 4.41 |
Sdc2 |
syndecan 2 |
44251 |
0.18 |
| chr6_84882979_84883154 | 4.40 |
Exoc6b |
exocyst complex component 6B |
10922 |
0.21 |
| chr2_173978535_173978753 | 4.38 |
Atp5k-ps2 |
ATP synthase, H+ transporting, mitochondrial F1F0 complex, subunit E, pseudogene 2 |
6047 |
0.22 |
| chr14_75138316_75138467 | 4.38 |
Gm15628 |
predicted gene 15628 |
1479 |
0.31 |
| chr6_35303400_35303752 | 4.32 |
Slc13a4 |
solute carrier family 13 (sodium/sulfate symporters), member 4 |
4553 |
0.18 |
| chr17_6804856_6805157 | 4.31 |
4933426B08Rik |
RIKEN cDNA 4933426B08 gene |
3503 |
0.19 |
| chr9_66503782_66503991 | 4.27 |
Herc1 |
HECT and RLD domain containing E3 ubiquitin protein ligase family member 1 |
3632 |
0.2 |
| chr13_45903681_45904215 | 4.18 |
Atxn1 |
ataxin 1 |
31660 |
0.17 |
| chr3_66494840_66495006 | 4.13 |
Gm17952 |
predicted gene, 17952 |
68628 |
0.12 |
| chr12_28510322_28510473 | 4.12 |
Dcdc2c |
doublecortin domain containing 2C |
6317 |
0.2 |
| chr1_64087943_64089121 | 4.08 |
Gm13748 |
predicted gene 13748 |
9878 |
0.19 |
| chr1_45876860_45877011 | 4.03 |
Gm5269 |
predicted gene 5269 |
13143 |
0.12 |
| chr8_4837818_4838009 | 4.00 |
Gm44961 |
predicted gene 44961 |
16683 |
0.13 |
| chr11_82847751_82847915 | 3.96 |
Rffl |
ring finger and FYVE like domain containing protein |
1741 |
0.23 |
| chr13_112745764_112745944 | 3.92 |
Slc38a9 |
solute carrier family 38, member 9 |
10244 |
0.15 |
| chr13_73443093_73443461 | 3.90 |
Lpcat1 |
lysophosphatidylcholine acyltransferase 1 |
23920 |
0.19 |
| chr11_83562559_83562715 | 3.89 |
Ccl9 |
chemokine (C-C motif) ligand 9 |
14505 |
0.09 |
| chr18_63727962_63728274 | 3.86 |
Wdr7 |
WD repeat domain 7 |
10946 |
0.16 |
| chr4_75042000_75042152 | 3.84 |
Gm11253 |
predicted gene 11253 |
39624 |
0.19 |
| chr1_179844917_179845212 | 3.82 |
Ahctf1 |
AT hook containing transcription factor 1 |
41384 |
0.14 |
| chr4_148204076_148204384 | 3.81 |
Fbxo2 |
F-box protein 2 |
43609 |
0.08 |
| chr17_12746346_12746497 | 3.81 |
Igf2r |
insulin-like growth factor 2 receptor |
4379 |
0.15 |
| chr7_100571433_100571603 | 3.81 |
Gm44648 |
predicted gene 44648 |
404 |
0.7 |
| chr7_132738834_132739104 | 3.80 |
Fam53b |
family with sequence similarity 53, member B |
37947 |
0.14 |
| chr11_108424530_108425250 | 3.80 |
Cep112 |
centrosomal protein 112 |
302 |
0.86 |
| chr10_11323594_11323775 | 3.79 |
Gm48666 |
predicted gene, 48666 |
6731 |
0.15 |
| chr17_84922055_84922228 | 3.77 |
Gm49982 |
predicted gene, 49982 |
19572 |
0.15 |
| chr13_96966536_96966697 | 3.77 |
Gm48597 |
predicted gene, 48597 |
15702 |
0.15 |
| chr1_130798147_130798366 | 3.77 |
Fcamr |
Fc receptor, IgA, IgM, high affinity |
2646 |
0.17 |
| chr11_4998878_4999033 | 3.71 |
Ap1b1 |
adaptor protein complex AP-1, beta 1 subunit |
10519 |
0.13 |
| chr6_143152229_143152730 | 3.70 |
Gm31108 |
predicted gene, 31108 |
1452 |
0.33 |
| chr1_39068024_39068183 | 3.69 |
Gm37821 |
predicted gene, 37821 |
10466 |
0.18 |
| chr3_52617525_52617678 | 3.69 |
Gm10293 |
predicted pseudogene 10293 |
4766 |
0.28 |
| chr1_192745227_192745396 | 3.67 |
Gm22265 |
predicted gene, 22265 |
260 |
0.92 |
| chr9_3328190_3328384 | 3.66 |
Alkbh8 |
alkB homolog 8, tRNA methyltransferase |
6853 |
0.19 |
| chr17_53566897_53568169 | 3.65 |
Kat2b |
K(lysine) acetyltransferase 2B |
562 |
0.71 |
| chr14_67000065_67000248 | 3.65 |
Bnip3l |
BCL2/adenovirus E1B interacting protein 3-like |
251 |
0.9 |
| chr8_122321449_122321633 | 3.63 |
Zfpm1 |
zinc finger protein, multitype 1 |
12157 |
0.12 |
| chr13_47250640_47250987 | 3.60 |
Rnf144b |
ring finger protein 144B |
56988 |
0.11 |
| chr7_141672342_141672493 | 3.59 |
Muc6 |
mucin 6, gastric |
17098 |
0.13 |
| chr15_10399752_10400222 | 3.58 |
Agxt2 |
alanine-glyoxylate aminotransferase 2 |
41408 |
0.13 |
| chr18_61626788_61626940 | 3.56 |
Bvht |
braveheart long non-coding RNA |
12678 |
0.11 |
| chr7_142575507_142575834 | 3.56 |
H19 |
H19, imprinted maternally expressed transcript |
868 |
0.38 |
| chr8_25192686_25192898 | 3.56 |
Tacc1 |
transforming, acidic coiled-coil containing protein 1 |
7751 |
0.19 |
| chr15_73175933_73176086 | 3.53 |
Ago2 |
argonaute RISC catalytic subunit 2 |
1838 |
0.36 |
| chr15_78923627_78923929 | 3.51 |
Lgals1 |
lectin, galactose binding, soluble 1 |
2947 |
0.1 |
| chr9_35106138_35106542 | 3.51 |
St3gal4 |
ST3 beta-galactoside alpha-2,3-sialyltransferase 4 |
327 |
0.86 |
| chr15_97205921_97206072 | 3.49 |
Gm32885 |
predicted gene, 32885 |
38752 |
0.14 |
| chr2_4561282_4561631 | 3.49 |
Frmd4a |
FERM domain containing 4A |
1681 |
0.39 |
| chr5_73313719_73313877 | 3.47 |
Gm42732 |
predicted gene 42732 |
2434 |
0.16 |
| chr11_45809942_45810106 | 3.45 |
F630206G17Rik |
RIKEN cDNA F630206G17 gene |
1937 |
0.25 |
| chr7_46732556_46732707 | 3.41 |
Saa4 |
serum amyloid A 4 |
28 |
0.94 |
| chr12_109437323_109437525 | 3.40 |
Dlk1 |
delta like non-canonical Notch ligand 1 |
15399 |
0.1 |
| chr15_3247489_3247792 | 3.38 |
Selenop |
selenoprotein P |
20907 |
0.18 |
| chr8_47706545_47706853 | 3.37 |
E030037K01Rik |
RIKEN cDNA E030037K01 gene |
6567 |
0.11 |
| chr10_40124756_40124956 | 3.35 |
Gm25613 |
predicted gene, 25613 |
15394 |
0.13 |
| chr9_108079972_108080508 | 3.32 |
Mst1 |
macrophage stimulating 1 (hepatocyte growth factor-like) |
196 |
0.68 |
| chr2_130897933_130898182 | 3.30 |
A730017L22Rik |
RIKEN cDNA A730017L22 gene |
8299 |
0.13 |
| chr16_76002443_76002713 | 3.29 |
Gm15555 |
predicted gene 15555 |
1794 |
0.4 |
| chr2_140772877_140773180 | 3.25 |
Flrt3 |
fibronectin leucine rich transmembrane protein 3 |
101559 |
0.08 |
| chr6_67047042_67047225 | 3.23 |
Gadd45a |
growth arrest and DNA-damage-inducible 45 alpha |
9676 |
0.12 |
| chr6_30307301_30307482 | 3.22 |
1700095J07Rik |
RIKEN cDNA 1700095J07 gene |
2770 |
0.2 |
| chr7_80719251_80719402 | 3.21 |
Iqgap1 |
IQ motif containing GTPase activating protein 1 |
10922 |
0.16 |
| chr11_79961869_79962916 | 3.20 |
Utp6 |
UTP6 small subunit processome component |
2 |
0.97 |
| chr15_100747663_100747846 | 3.15 |
Slc4a8 |
solute carrier family 4 (anion exchanger), member 8 |
13993 |
0.12 |
| chr7_109191268_109192295 | 3.12 |
Lmo1 |
LIM domain only 1 |
16574 |
0.17 |
| chr3_84456098_84456534 | 3.11 |
Fhdc1 |
FH2 domain containing 1 |
2553 |
0.34 |
| chr7_68115483_68115651 | 3.10 |
Igf1r |
insulin-like growth factor I receptor |
33023 |
0.19 |
| chr5_65348659_65348810 | 3.09 |
Klb |
klotho beta |
326 |
0.82 |
| chr3_96268834_96269397 | 3.08 |
H3c13 |
H3 clustered histone 13 |
461 |
0.29 |
| chr7_126780693_126781427 | 3.08 |
Tbx6 |
T-box 6 |
423 |
0.55 |
| chr4_109446065_109446238 | 3.08 |
Ttc39a |
tetratricopeptide repeat domain 39A |
25209 |
0.14 |
| chr10_19526486_19526649 | 3.06 |
Gm48563 |
predicted gene, 48563 |
3917 |
0.24 |
| chr13_20131849_20132023 | 3.04 |
Elmo1 |
engulfment and cell motility 1 |
20424 |
0.26 |
| chr13_93381331_93381617 | 3.04 |
Gm47155 |
predicted gene, 47155 |
29309 |
0.13 |
| chr15_89396857_89397343 | 3.04 |
Klhdc7b |
kelch domain containing 7B |
10209 |
0.07 |
| chr12_81189673_81190004 | 3.04 |
Mir3067 |
microRNA 3067 |
23687 |
0.18 |
| chr1_167387061_167387264 | 3.02 |
Mgst3 |
microsomal glutathione S-transferase 3 |
6679 |
0.16 |
| chr16_91865276_91865445 | 3.02 |
Itsn1 |
intersectin 1 (SH3 domain protein 1A) |
3334 |
0.21 |
| chr15_102017591_102018334 | 3.02 |
Krt18 |
keratin 18 |
10218 |
0.11 |
| chr9_122188851_122189055 | 3.01 |
Ano10 |
anoctamin 10 |
1334 |
0.36 |
| chr10_121796126_121796297 | 3.00 |
Srgap1 |
SLIT-ROBO Rho GTPase activating protein 1 |
10893 |
0.19 |
| chr13_97066791_97066955 | 3.00 |
Fam169a |
family with sequence similarity 169, member A |
413 |
0.81 |
| chr3_69469886_69470406 | 2.99 |
Ppm1l |
protein phosphatase 1 (formerly 2C)-like |
27067 |
0.17 |
| chr1_40167587_40167753 | 2.98 |
Il1r1 |
interleukin 1 receptor, type I |
57410 |
0.1 |
| chr17_28824984_28825202 | 2.97 |
Brpf3 |
bromodomain and PHD finger containing, 3 |
1067 |
0.33 |
| chr8_14068118_14068269 | 2.97 |
Gm45520 |
predicted gene 45520 |
375 |
0.82 |
| chr11_30210200_30210515 | 2.96 |
Sptbn1 |
spectrin beta, non-erythrocytic 1 |
9415 |
0.25 |
| chr18_34783488_34783662 | 2.96 |
Kdm3b |
KDM3B lysine (K)-specific demethylase 3B |
6470 |
0.13 |
| chr11_116309682_116309845 | 2.96 |
Exoc7 |
exocyst complex component 7 |
2530 |
0.15 |
| chr8_122294191_122294759 | 2.95 |
Zfpm1 |
zinc finger protein, multitype 1 |
12334 |
0.14 |
| chr6_145344710_145344864 | 2.95 |
Gm23498 |
predicted gene, 23498 |
22071 |
0.11 |
| chr6_87659008_87659173 | 2.95 |
Gm44097 |
predicted gene, 44097 |
1336 |
0.3 |
| chr6_34866057_34866275 | 2.94 |
Tmem140 |
transmembrane protein 140 |
854 |
0.47 |
| chr2_32074486_32074637 | 2.94 |
Fam78a |
family with sequence similarity 78, member A |
4791 |
0.12 |
| chr3_122206724_122206942 | 2.94 |
Gm43158 |
predicted gene 43158 |
20537 |
0.09 |
| chr8_24396807_24396958 | 2.94 |
Gm30692 |
predicted gene, 30692 |
15297 |
0.15 |
| chr12_100955912_100956083 | 2.91 |
Ccdc88c |
coiled-coil domain containing 88C |
10824 |
0.12 |
| chr5_76828559_76829372 | 2.90 |
C530008M17Rik |
RIKEN cDNA C530008M17 gene |
11634 |
0.19 |
| chr3_86109250_86109437 | 2.90 |
Gm25188 |
predicted gene, 25188 |
8809 |
0.11 |
| chr10_70127259_70127423 | 2.89 |
Ccdc6 |
coiled-coil domain containing 6 |
30220 |
0.2 |
| chr12_105008741_105009157 | 2.86 |
Syne3 |
spectrin repeat containing, nuclear envelope family member 3 |
860 |
0.44 |
| chr6_87873042_87873340 | 2.86 |
Copg1 |
coatomer protein complex, subunit gamma 1 |
14623 |
0.08 |
| chr19_46905504_46905664 | 2.85 |
Nt5c2 |
5'-nucleotidase, cytosolic II |
3991 |
0.2 |
| chr11_8510326_8510660 | 2.84 |
Tns3 |
tensin 3 |
34858 |
0.23 |
| chr8_84901775_84902039 | 2.82 |
Klf1 |
Kruppel-like factor 1 (erythroid) |
21 |
0.93 |
| chr7_28960336_28960574 | 2.82 |
Actn4 |
actinin alpha 4 |
1768 |
0.21 |
| chr7_142574309_142575453 | 2.81 |
H19 |
H19, imprinted maternally expressed transcript |
1657 |
0.21 |
| chr2_25137896_25138199 | 2.81 |
Gm13387 |
predicted gene 13387 |
7276 |
0.08 |
| chr5_148716758_148716935 | 2.81 |
Gm36186 |
predicted gene, 36186 |
5380 |
0.18 |
| chr18_61437922_61438073 | 2.78 |
Gm8755 |
predicted gene 8755 |
3796 |
0.16 |
| chr7_135816621_135817118 | 2.78 |
6330420H09Rik |
RIKEN cDNA 6330420H09 gene |
36813 |
0.12 |
| chr3_94783418_94783615 | 2.77 |
Cgn |
cingulin |
2935 |
0.17 |
| chr3_60574415_60574644 | 2.76 |
Mbnl1 |
muscleblind like splicing factor 1 |
21112 |
0.18 |
| chr3_52648966_52649117 | 2.76 |
Gm10293 |
predicted pseudogene 10293 |
36206 |
0.17 |
| chr8_122636567_122636791 | 2.75 |
Cbfa2t3 |
CBFA2/RUNX1 translocation partner 3 |
9787 |
0.09 |
| chr11_117779411_117780006 | 2.74 |
Tmc6 |
transmembrane channel-like gene family 6 |
58 |
0.94 |
| chr3_10075905_10076056 | 2.73 |
Gm9833 |
predicted gene 9833 |
12130 |
0.15 |
| chr9_85551941_85552115 | 2.73 |
Gm48834 |
predicted gene, 48834 |
1737 |
0.43 |
| chr11_16977011_16977361 | 2.72 |
Fbxo48 |
F-box protein 48 |
25776 |
0.13 |
| chr2_24345160_24345327 | 2.71 |
Il1rn |
interleukin 1 receptor antagonist |
45 |
0.97 |
| chr3_79721203_79721372 | 2.71 |
Rxfp1 |
relaxin/insulin-like family peptide receptor 1 |
16507 |
0.17 |
| chr2_125615804_125616138 | 2.71 |
Cep152 |
centrosomal protein 152 |
9142 |
0.22 |
| chr7_26981979_26982241 | 2.70 |
Cyp2a22 |
cytochrome P450, family 2, subfamily a, polypeptide 22 |
42726 |
0.09 |
| chr7_122955445_122955694 | 2.70 |
Rbbp6 |
retinoblastoma binding protein 6, ubiquitin ligase |
10117 |
0.16 |
| chr12_4679914_4680233 | 2.69 |
Gm17541 |
predicted gene, 17541 |
9853 |
0.12 |
| chr4_154911160_154911660 | 2.69 |
Prxl2b |
peroxiredoxin like 2B |
12275 |
0.11 |
| chr9_32696120_32696626 | 2.67 |
Ets1 |
E26 avian leukemia oncogene 1, 5' domain |
11 |
0.98 |
| chr12_84161892_84162091 | 2.67 |
Elmsan1 |
ELM2 and Myb/SANT-like domain containing 1 |
1853 |
0.2 |
| chr9_64792798_64792980 | 2.66 |
Dennd4a |
DENN/MADD domain containing 4A |
18451 |
0.18 |
| chr6_17568755_17568934 | 2.64 |
Met |
met proto-oncogene |
21871 |
0.2 |
| chrX_104544037_104544198 | 2.64 |
Uprt |
uracil phosphoribosyltransferase |
61299 |
0.11 |
| chr18_70572566_70572855 | 2.64 |
Mbd2 |
methyl-CpG binding domain protein 2 |
4376 |
0.22 |
| chr1_36070391_36070994 | 2.63 |
Hs6st1 |
heparan sulfate 6-O-sulfotransferase 1 |
2292 |
0.23 |
| chr1_91420287_91420438 | 2.63 |
Hes6 |
hairy and enhancer of split 6 |
6324 |
0.12 |
| chr5_50128978_50129261 | 2.63 |
4930448I18Rik |
RIKEN cDNA 4930448I18 gene |
22214 |
0.2 |
| chr15_9474328_9474611 | 2.63 |
Gm50456 |
predicted gene, 50456 |
1033 |
0.57 |
| chr17_5510598_5510763 | 2.62 |
Zdhhc14 |
zinc finger, DHHC domain containing 14 |
18123 |
0.18 |
| chr16_93823001_93823152 | 2.62 |
Morc3 |
microrchidia 3 |
9045 |
0.13 |
| chr3_9648001_9648152 | 2.61 |
Gm17806 |
predicted gene, 17806 |
8444 |
0.22 |
| chr4_120953116_120953406 | 2.60 |
Zfp69 |
zinc finger protein 69 |
1562 |
0.27 |
| chr5_117366289_117366451 | 2.59 |
Wsb2 |
WD repeat and SOCS box-containing 2 |
2848 |
0.15 |
| chr4_141161724_141161914 | 2.59 |
Fbxo42 |
F-box protein 42 |
13897 |
0.11 |
| chr11_60942016_60942250 | 2.59 |
Map2k3 |
mitogen-activated protein kinase kinase 3 |
253 |
0.89 |
| chr11_48869816_48870010 | 2.58 |
Irgm1 |
immunity-related GTPase family M member 1 |
1461 |
0.24 |
| chr4_147421334_147422151 | 2.57 |
Gm13161 |
predicted gene 13161 |
21729 |
0.12 |
| chr7_96778030_96778199 | 2.57 |
Tenm4 |
teneurin transmembrane protein 4 |
180 |
0.94 |
| chr18_68062408_68062559 | 2.55 |
Gm41764 |
predicted gene, 41764 |
55891 |
0.13 |
| chr4_139336903_139337100 | 2.55 |
AL807811.1 |
aldo-keto reductase family 7 member A2 (AKR7A2) pseudogene |
179 |
0.83 |
| chr7_141132187_141132543 | 2.54 |
Ptdss2 |
phosphatidylserine synthase 2 |
73 |
0.93 |
| chr9_115473967_115474125 | 2.54 |
Gm5921 |
predicted gene 5921 |
35465 |
0.14 |
| chr15_16312094_16312258 | 2.54 |
Gm6479 |
predicted gene 6479 |
104223 |
0.08 |
| chr1_130798687_130798848 | 2.54 |
Fcamr |
Fc receptor, IgA, IgM, high affinity |
2135 |
0.19 |
| chr10_82962062_82962373 | 2.54 |
Gm4799 |
predicted gene 4799 |
7873 |
0.18 |
| chr7_118259898_118260049 | 2.53 |
Gm45155 |
predicted gene 45155 |
15390 |
0.12 |
| chr6_112303119_112303295 | 2.52 |
Gm44193 |
predicted gene, 44193 |
9976 |
0.16 |
| chr8_46485316_46485467 | 2.52 |
Acsl1 |
acyl-CoA synthetase long-chain family member 1 |
5575 |
0.17 |
| chr5_5284129_5284282 | 2.51 |
Cdk14 |
cyclin-dependent kinase 14 |
17902 |
0.17 |
| chr15_96802479_96802683 | 2.51 |
Gm8888 |
predicted gene 8888 |
35503 |
0.18 |
| chr7_142561215_142561756 | 2.51 |
Nctc1 |
non-coding transcript 1 |
2889 |
0.14 |
| chr12_105824762_105825098 | 2.51 |
Papola |
poly (A) polymerase alpha |
4137 |
0.21 |
| chr5_96938787_96938949 | 2.51 |
Gm43144 |
predicted gene 43144 |
1429 |
0.24 |
| chr7_83898027_83898178 | 2.50 |
Mesd |
mesoderm development LRP chaperone |
3049 |
0.15 |
| chr7_110891747_110891926 | 2.49 |
Gm16336 |
predicted gene 16336 |
13149 |
0.15 |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 1.2 | 3.5 | GO:0035694 | mitochondrial protein catabolic process(GO:0035694) |
| 0.8 | 3.4 | GO:2000659 | regulation of interleukin-1-mediated signaling pathway(GO:2000659) |
| 0.7 | 2.2 | GO:0034499 | late endosome to Golgi transport(GO:0034499) |
| 0.7 | 2.7 | GO:0010835 | regulation of protein ADP-ribosylation(GO:0010835) |
| 0.7 | 2.0 | GO:0003331 | regulation of extracellular matrix constituent secretion(GO:0003330) positive regulation of extracellular matrix constituent secretion(GO:0003331) |
| 0.6 | 1.9 | GO:0032289 | central nervous system myelin formation(GO:0032289) |
| 0.6 | 1.9 | GO:0051599 | response to hydrostatic pressure(GO:0051599) |
| 0.6 | 2.4 | GO:0006659 | phosphatidylserine biosynthetic process(GO:0006659) |
| 0.6 | 1.8 | GO:1903416 | response to glycoside(GO:1903416) |
| 0.6 | 2.4 | GO:1903377 | negative regulation of oxidative stress-induced neuron intrinsic apoptotic signaling pathway(GO:1903377) |
| 0.6 | 1.8 | GO:0000379 | tRNA-type intron splice site recognition and cleavage(GO:0000379) |
| 0.6 | 2.9 | GO:0030578 | PML body organization(GO:0030578) |
| 0.6 | 1.7 | GO:0060331 | negative regulation of response to interferon-gamma(GO:0060331) negative regulation of interferon-gamma-mediated signaling pathway(GO:0060336) |
| 0.5 | 1.6 | GO:0043382 | positive regulation of memory T cell differentiation(GO:0043382) |
| 0.5 | 2.2 | GO:0035087 | siRNA loading onto RISC involved in RNA interference(GO:0035087) |
| 0.5 | 0.5 | GO:0043380 | regulation of memory T cell differentiation(GO:0043380) |
| 0.5 | 1.6 | GO:0035964 | COPI-coated vesicle budding(GO:0035964) |
| 0.5 | 2.1 | GO:0070814 | hydrogen sulfide biosynthetic process(GO:0070814) |
| 0.5 | 2.1 | GO:0010897 | negative regulation of triglyceride catabolic process(GO:0010897) |
| 0.5 | 2.5 | GO:0045794 | negative regulation of cell volume(GO:0045794) |
| 0.5 | 2.0 | GO:2000562 | negative regulation of CD4-positive, alpha-beta T cell proliferation(GO:2000562) |
| 0.5 | 4.8 | GO:0030853 | negative regulation of granulocyte differentiation(GO:0030853) |
| 0.5 | 1.4 | GO:0009223 | pyrimidine deoxyribonucleotide catabolic process(GO:0009223) |
| 0.4 | 1.3 | GO:2000611 | positive regulation of thyroid hormone generation(GO:2000611) |
| 0.4 | 2.6 | GO:0090080 | positive regulation of MAPKKK cascade by fibroblast growth factor receptor signaling pathway(GO:0090080) |
| 0.4 | 0.8 | GO:0035973 | aggrephagy(GO:0035973) |
| 0.4 | 1.3 | GO:0021699 | cerebellar cortex maturation(GO:0021699) |
| 0.4 | 1.2 | GO:0019355 | nicotinamide nucleotide biosynthetic process from aspartate(GO:0019355) 'de novo' NAD biosynthetic process from aspartate(GO:0034628) |
| 0.4 | 1.6 | GO:0033634 | positive regulation of cell-cell adhesion mediated by integrin(GO:0033634) |
| 0.4 | 1.2 | GO:0038161 | prolactin signaling pathway(GO:0038161) |
| 0.4 | 3.5 | GO:0070269 | pyroptosis(GO:0070269) |
| 0.4 | 1.2 | GO:0046951 | ketone body biosynthetic process(GO:0046951) |
| 0.4 | 1.1 | GO:0060375 | regulation of mast cell differentiation(GO:0060375) |
| 0.4 | 1.5 | GO:0014834 | skeletal muscle satellite cell maintenance involved in skeletal muscle regeneration(GO:0014834) |
| 0.4 | 1.1 | GO:0051593 | response to folic acid(GO:0051593) |
| 0.4 | 1.5 | GO:0010918 | positive regulation of mitochondrial membrane potential(GO:0010918) |
| 0.4 | 1.1 | GO:0038028 | insulin receptor signaling pathway via phosphatidylinositol 3-kinase(GO:0038028) |
| 0.4 | 0.7 | GO:1904192 | cholangiocyte apoptotic process(GO:1902488) regulation of cholangiocyte apoptotic process(GO:1904192) negative regulation of cholangiocyte apoptotic process(GO:1904193) |
| 0.4 | 2.5 | GO:0075522 | IRES-dependent viral translational initiation(GO:0075522) |
| 0.4 | 1.4 | GO:0000429 | carbon catabolite regulation of transcription from RNA polymerase II promoter(GO:0000429) carbon catabolite activation of transcription from RNA polymerase II promoter(GO:0000436) |
| 0.3 | 1.7 | GO:0014043 | negative regulation of neuron maturation(GO:0014043) |
| 0.3 | 1.4 | GO:0044034 | negative stranded viral RNA replication(GO:0039689) multi-organism biosynthetic process(GO:0044034) |
| 0.3 | 2.4 | GO:2000653 | regulation of genetic imprinting(GO:2000653) |
| 0.3 | 1.4 | GO:0010792 | DNA double-strand break processing involved in repair via single-strand annealing(GO:0010792) |
| 0.3 | 1.0 | GO:2001271 | negative regulation of cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:2001271) |
| 0.3 | 0.7 | GO:0045764 | positive regulation of cellular amino acid metabolic process(GO:0045764) |
| 0.3 | 1.0 | GO:0072531 | pyrimidine-containing compound transmembrane transport(GO:0072531) |
| 0.3 | 0.3 | GO:0001796 | type IIa hypersensitivity(GO:0001794) regulation of type IIa hypersensitivity(GO:0001796) positive regulation of type IIa hypersensitivity(GO:0001798) type II hypersensitivity(GO:0002445) regulation of type II hypersensitivity(GO:0002892) positive regulation of type II hypersensitivity(GO:0002894) |
| 0.3 | 1.0 | GO:0034184 | positive regulation of maintenance of sister chromatid cohesion(GO:0034093) positive regulation of maintenance of mitotic sister chromatid cohesion(GO:0034184) |
| 0.3 | 1.3 | GO:0033211 | adiponectin-activated signaling pathway(GO:0033211) |
| 0.3 | 2.9 | GO:0043249 | erythrocyte maturation(GO:0043249) |
| 0.3 | 1.0 | GO:0002386 | immune response in mucosal-associated lymphoid tissue(GO:0002386) |
| 0.3 | 1.6 | GO:0046485 | ether lipid metabolic process(GO:0046485) |
| 0.3 | 2.2 | GO:2000096 | positive regulation of Wnt signaling pathway, planar cell polarity pathway(GO:2000096) |
| 0.3 | 0.6 | GO:0061511 | centriole elongation(GO:0061511) |
| 0.3 | 0.9 | GO:0071879 | positive regulation of adrenergic receptor signaling pathway(GO:0071879) |
| 0.3 | 1.2 | GO:0009078 | alanine metabolic process(GO:0006522) pyruvate family amino acid metabolic process(GO:0009078) |
| 0.3 | 1.2 | GO:0001805 | type III hypersensitivity(GO:0001802) regulation of type III hypersensitivity(GO:0001803) positive regulation of type III hypersensitivity(GO:0001805) |
| 0.3 | 0.9 | GO:1990086 | lens fiber cell apoptotic process(GO:1990086) |
| 0.3 | 0.8 | GO:0046340 | diacylglycerol catabolic process(GO:0046340) |
| 0.3 | 0.8 | GO:0006772 | thiamine metabolic process(GO:0006772) thiamine-containing compound metabolic process(GO:0042723) |
| 0.3 | 0.8 | GO:0003431 | growth plate cartilage chondrocyte development(GO:0003431) |
| 0.3 | 0.8 | GO:0001712 | ectodermal cell fate commitment(GO:0001712) |
| 0.3 | 0.8 | GO:0003062 | regulation of heart rate by chemical signal(GO:0003062) |
| 0.3 | 0.8 | GO:0042590 | antigen processing and presentation of exogenous peptide antigen via MHC class I(GO:0042590) |
| 0.3 | 1.6 | GO:0006621 | protein retention in ER lumen(GO:0006621) |
| 0.3 | 1.8 | GO:0060763 | mammary duct terminal end bud growth(GO:0060763) |
| 0.3 | 1.0 | GO:0006499 | N-terminal protein myristoylation(GO:0006499) |
| 0.3 | 0.8 | GO:0061030 | epithelial cell differentiation involved in mammary gland alveolus development(GO:0061030) |
| 0.3 | 1.8 | GO:0090557 | establishment of endothelial intestinal barrier(GO:0090557) |
| 0.3 | 1.5 | GO:0010572 | positive regulation of platelet activation(GO:0010572) |
| 0.2 | 2.0 | GO:0006013 | mannose metabolic process(GO:0006013) |
| 0.2 | 1.2 | GO:0047484 | regulation of response to osmotic stress(GO:0047484) |
| 0.2 | 0.7 | GO:0006543 | glutamine catabolic process(GO:0006543) |
| 0.2 | 2.5 | GO:0051292 | nuclear pore complex assembly(GO:0051292) |
| 0.2 | 0.7 | GO:0071072 | negative regulation of phospholipid biosynthetic process(GO:0071072) |
| 0.2 | 0.2 | GO:0043321 | regulation of natural killer cell degranulation(GO:0043321) |
| 0.2 | 2.9 | GO:0097120 | receptor localization to synapse(GO:0097120) |
| 0.2 | 6.5 | GO:0055090 | acylglycerol homeostasis(GO:0055090) triglyceride homeostasis(GO:0070328) |
| 0.2 | 0.9 | GO:0051919 | positive regulation of fibrinolysis(GO:0051919) |
| 0.2 | 0.9 | GO:0019276 | UDP-N-acetylgalactosamine metabolic process(GO:0019276) |
| 0.2 | 0.7 | GO:0006481 | C-terminal protein methylation(GO:0006481) |
| 0.2 | 0.7 | GO:0042908 | xenobiotic transport(GO:0042908) |
| 0.2 | 0.7 | GO:0036258 | multivesicular body assembly(GO:0036258) |
| 0.2 | 0.9 | GO:0036438 | maintenance of lens transparency(GO:0036438) |
| 0.2 | 1.1 | GO:0006686 | sphingomyelin biosynthetic process(GO:0006686) |
| 0.2 | 0.6 | GO:2000978 | negative regulation of forebrain neuron differentiation(GO:2000978) |
| 0.2 | 1.3 | GO:0060708 | spongiotrophoblast differentiation(GO:0060708) |
| 0.2 | 0.6 | GO:0015888 | thiamine transport(GO:0015888) |
| 0.2 | 1.6 | GO:0070970 | interleukin-2 secretion(GO:0070970) |
| 0.2 | 0.6 | GO:0046049 | UMP biosynthetic process(GO:0006222) pyrimidine ribonucleoside monophosphate metabolic process(GO:0009173) pyrimidine ribonucleoside monophosphate biosynthetic process(GO:0009174) UMP metabolic process(GO:0046049) |
| 0.2 | 0.6 | GO:0046013 | regulation of T cell homeostatic proliferation(GO:0046013) |
| 0.2 | 0.6 | GO:0033133 | positive regulation of glucokinase activity(GO:0033133) |
| 0.2 | 0.8 | GO:0070885 | negative regulation of calcineurin-NFAT signaling cascade(GO:0070885) |
| 0.2 | 3.6 | GO:0001574 | ganglioside biosynthetic process(GO:0001574) |
| 0.2 | 1.4 | GO:1900262 | regulation of DNA-directed DNA polymerase activity(GO:1900262) positive regulation of DNA-directed DNA polymerase activity(GO:1900264) |
| 0.2 | 1.0 | GO:0061302 | smooth muscle cell-matrix adhesion(GO:0061302) |
| 0.2 | 0.6 | GO:0060618 | nipple development(GO:0060618) |
| 0.2 | 0.4 | GO:0072718 | response to cisplatin(GO:0072718) |
| 0.2 | 1.9 | GO:0000083 | regulation of transcription involved in G1/S transition of mitotic cell cycle(GO:0000083) |
| 0.2 | 1.1 | GO:0006477 | protein sulfation(GO:0006477) |
| 0.2 | 1.1 | GO:0006307 | DNA dealkylation involved in DNA repair(GO:0006307) |
| 0.2 | 1.9 | GO:0048757 | endosome to melanosome transport(GO:0035646) endosome to pigment granule transport(GO:0043485) pigment granule maturation(GO:0048757) |
| 0.2 | 0.6 | GO:0071316 | cellular response to nicotine(GO:0071316) |
| 0.2 | 0.6 | GO:1901421 | positive regulation of response to alcohol(GO:1901421) |
| 0.2 | 0.9 | GO:0032020 | ISG15-protein conjugation(GO:0032020) |
| 0.2 | 0.6 | GO:0002121 | inter-male aggressive behavior(GO:0002121) |
| 0.2 | 0.6 | GO:0046084 | adenine metabolic process(GO:0046083) adenine biosynthetic process(GO:0046084) |
| 0.2 | 0.6 | GO:1990169 | detoxification of copper ion(GO:0010273) stress response to copper ion(GO:1990169) |
| 0.2 | 0.7 | GO:0090435 | protein localization to nuclear envelope(GO:0090435) |
| 0.2 | 0.5 | GO:0034395 | regulation of transcription from RNA polymerase II promoter in response to iron(GO:0034395) |
| 0.2 | 0.4 | GO:0042726 | flavin-containing compound metabolic process(GO:0042726) |
| 0.2 | 0.5 | GO:0015015 | heparan sulfate proteoglycan biosynthetic process, enzymatic modification(GO:0015015) |
| 0.2 | 0.5 | GO:0060665 | regulation of branching involved in salivary gland morphogenesis by mesenchymal-epithelial signaling(GO:0060665) |
| 0.2 | 0.4 | GO:2000383 | regulation of ectoderm development(GO:2000383) negative regulation of ectoderm development(GO:2000384) |
| 0.2 | 1.2 | GO:0038063 | collagen-activated tyrosine kinase receptor signaling pathway(GO:0038063) |
| 0.2 | 1.4 | GO:0090286 | cytoskeletal anchoring at nuclear membrane(GO:0090286) |
| 0.2 | 0.2 | GO:0045658 | regulation of neutrophil differentiation(GO:0045658) |
| 0.2 | 0.2 | GO:0045876 | positive regulation of sister chromatid cohesion(GO:0045876) |
| 0.2 | 0.3 | GO:1903715 | regulation of aerobic respiration(GO:1903715) |
| 0.2 | 0.5 | GO:1904479 | negative regulation of intestinal absorption(GO:1904479) |
| 0.2 | 1.4 | GO:0071493 | cellular response to UV-B(GO:0071493) |
| 0.2 | 1.2 | GO:0006729 | tetrahydrobiopterin biosynthetic process(GO:0006729) |
| 0.2 | 0.8 | GO:0071494 | cellular response to UV-C(GO:0071494) |
| 0.2 | 0.2 | GO:1900019 | regulation of protein kinase C activity(GO:1900019) positive regulation of protein kinase C activity(GO:1900020) |
| 0.2 | 0.5 | GO:0048861 | leukemia inhibitory factor signaling pathway(GO:0048861) |
| 0.2 | 0.5 | GO:0006646 | phosphatidylethanolamine biosynthetic process(GO:0006646) |
| 0.2 | 0.7 | GO:0030050 | vesicle transport along actin filament(GO:0030050) |
| 0.2 | 0.8 | GO:0015671 | oxygen transport(GO:0015671) |
| 0.2 | 1.8 | GO:0006656 | phosphatidylcholine biosynthetic process(GO:0006656) |
| 0.2 | 0.6 | GO:1901727 | positive regulation of histone deacetylase activity(GO:1901727) |
| 0.2 | 1.1 | GO:0043983 | histone H4-K12 acetylation(GO:0043983) |
| 0.2 | 0.2 | GO:0033184 | positive regulation of histone ubiquitination(GO:0033184) |
| 0.2 | 1.0 | GO:0032667 | interleukin-23 production(GO:0032627) regulation of interleukin-23 production(GO:0032667) |
| 0.2 | 0.3 | GO:1904338 | regulation of dopaminergic neuron differentiation(GO:1904338) |
| 0.2 | 1.9 | GO:0048875 | chemical homeostasis within a tissue(GO:0048875) |
| 0.2 | 0.2 | GO:0046386 | deoxyribose phosphate catabolic process(GO:0046386) |
| 0.2 | 0.5 | GO:0034137 | positive regulation of toll-like receptor 2 signaling pathway(GO:0034137) |
| 0.2 | 0.6 | GO:0003383 | apical constriction(GO:0003383) |
| 0.2 | 0.3 | GO:0072361 | regulation of glycolytic process by regulation of transcription from RNA polymerase II promoter(GO:0072361) |
| 0.2 | 0.6 | GO:0098535 | de novo centriole assembly(GO:0098535) |
| 0.2 | 0.5 | GO:0010957 | negative regulation of vitamin D biosynthetic process(GO:0010957) |
| 0.2 | 0.9 | GO:0048199 | vesicle targeting, to, from or within Golgi(GO:0048199) |
| 0.2 | 0.5 | GO:0034135 | regulation of toll-like receptor 2 signaling pathway(GO:0034135) negative regulation of toll-like receptor 2 signaling pathway(GO:0034136) |
| 0.1 | 1.2 | GO:0032782 | bile acid secretion(GO:0032782) |
| 0.1 | 0.6 | GO:1900086 | positive regulation of peptidyl-tyrosine autophosphorylation(GO:1900086) |
| 0.1 | 0.6 | GO:0000480 | endonucleolytic cleavage in 5'-ETS of tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000480) |
| 0.1 | 1.2 | GO:0035330 | regulation of hippo signaling(GO:0035330) |
| 0.1 | 0.3 | GO:0009051 | pentose-phosphate shunt, oxidative branch(GO:0009051) |
| 0.1 | 0.1 | GO:0032814 | regulation of natural killer cell activation(GO:0032814) |
| 0.1 | 0.3 | GO:1904059 | regulation of locomotor rhythm(GO:1904059) |
| 0.1 | 0.7 | GO:0060510 | Type II pneumocyte differentiation(GO:0060510) |
| 0.1 | 0.4 | GO:0043152 | induction of bacterial agglutination(GO:0043152) |
| 0.1 | 0.6 | GO:1903797 | positive regulation of inorganic anion transmembrane transport(GO:1903797) |
| 0.1 | 0.4 | GO:0019464 | glycine catabolic process(GO:0006546) glycine decarboxylation via glycine cleavage system(GO:0019464) |
| 0.1 | 0.3 | GO:0001907 | killing by symbiont of host cells(GO:0001907) disruption by symbiont of host cell(GO:0044004) |
| 0.1 | 0.3 | GO:0060397 | JAK-STAT cascade involved in growth hormone signaling pathway(GO:0060397) |
| 0.1 | 0.4 | GO:0031999 | negative regulation of fatty acid beta-oxidation(GO:0031999) |
| 0.1 | 0.4 | GO:1904469 | positive regulation of tumor necrosis factor secretion(GO:1904469) |
| 0.1 | 4.3 | GO:0000462 | maturation of SSU-rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000462) |
| 0.1 | 0.4 | GO:1903121 | regulation of TRAIL-activated apoptotic signaling pathway(GO:1903121) |
| 0.1 | 0.4 | GO:2000729 | positive regulation of mesenchymal cell proliferation involved in ureter development(GO:2000729) |
| 0.1 | 0.4 | GO:0045347 | negative regulation of MHC class II biosynthetic process(GO:0045347) |
| 0.1 | 0.4 | GO:1990036 | calcium ion import into sarcoplasmic reticulum(GO:1990036) |
| 0.1 | 0.3 | GO:0006335 | DNA replication-dependent nucleosome assembly(GO:0006335) DNA replication-dependent nucleosome organization(GO:0034723) |
| 0.1 | 1.1 | GO:0033262 | regulation of nuclear cell cycle DNA replication(GO:0033262) |
| 0.1 | 0.6 | GO:2000301 | negative regulation of synaptic vesicle exocytosis(GO:2000301) |
| 0.1 | 1.2 | GO:0051923 | sulfation(GO:0051923) |
| 0.1 | 1.4 | GO:0031269 | pseudopodium assembly(GO:0031269) |
| 0.1 | 0.1 | GO:0006578 | amino-acid betaine biosynthetic process(GO:0006578) |
| 0.1 | 0.1 | GO:0010980 | regulation of vitamin D 24-hydroxylase activity(GO:0010979) positive regulation of vitamin D 24-hydroxylase activity(GO:0010980) |
| 0.1 | 1.4 | GO:0006054 | N-acetylneuraminate metabolic process(GO:0006054) |
| 0.1 | 0.3 | GO:0008228 | opsonization(GO:0008228) |
| 0.1 | 0.3 | GO:0010873 | positive regulation of cholesterol esterification(GO:0010873) |
| 0.1 | 0.5 | GO:0032430 | positive regulation of phospholipase A2 activity(GO:0032430) |
| 0.1 | 0.7 | GO:0098728 | germ-line stem cell division(GO:0042078) male germ-line stem cell asymmetric division(GO:0048133) germline stem cell asymmetric division(GO:0098728) |
| 0.1 | 0.4 | GO:1900108 | negative regulation of nodal signaling pathway(GO:1900108) |
| 0.1 | 0.5 | GO:0061113 | pancreas morphogenesis(GO:0061113) |
| 0.1 | 0.9 | GO:1901386 | negative regulation of voltage-gated calcium channel activity(GO:1901386) |
| 0.1 | 0.4 | GO:0090154 | positive regulation of sphingolipid biosynthetic process(GO:0090154) positive regulation of ceramide biosynthetic process(GO:2000304) |
| 0.1 | 0.4 | GO:2000051 | negative regulation of non-canonical Wnt signaling pathway(GO:2000051) |
| 0.1 | 4.6 | GO:0006953 | acute-phase response(GO:0006953) |
| 0.1 | 0.5 | GO:0009756 | carbohydrate mediated signaling(GO:0009756) hexose mediated signaling(GO:0009757) sugar mediated signaling pathway(GO:0010182) glucose mediated signaling pathway(GO:0010255) |
| 0.1 | 0.3 | GO:0045917 | positive regulation of complement activation(GO:0045917) positive regulation of protein activation cascade(GO:2000259) |
| 0.1 | 1.0 | GO:0010225 | response to UV-C(GO:0010225) |
| 0.1 | 1.4 | GO:0009437 | carnitine metabolic process(GO:0009437) |
| 0.1 | 0.5 | GO:0071034 | CUT catabolic process(GO:0071034) CUT metabolic process(GO:0071043) |
| 0.1 | 0.8 | GO:1901621 | negative regulation of smoothened signaling pathway involved in dorsal/ventral neural tube patterning(GO:1901621) |
| 0.1 | 1.0 | GO:0034498 | early endosome to Golgi transport(GO:0034498) |
| 0.1 | 0.4 | GO:2000002 | negative regulation of DNA damage checkpoint(GO:2000002) |
| 0.1 | 0.1 | GO:0021553 | olfactory nerve development(GO:0021553) |
| 0.1 | 0.3 | GO:0002071 | glandular epithelial cell maturation(GO:0002071) |
| 0.1 | 1.3 | GO:0071803 | positive regulation of podosome assembly(GO:0071803) |
| 0.1 | 0.1 | GO:0009946 | proximal/distal axis specification(GO:0009946) |
| 0.1 | 0.5 | GO:0019482 | beta-alanine metabolic process(GO:0019482) |
| 0.1 | 1.4 | GO:0009143 | nucleoside triphosphate catabolic process(GO:0009143) |
| 0.1 | 0.3 | GO:0042117 | monocyte activation(GO:0042117) |
| 0.1 | 0.4 | GO:2000169 | regulation of peptidyl-cysteine S-nitrosylation(GO:2000169) |
| 0.1 | 0.4 | GO:0008588 | release of cytoplasmic sequestered NF-kappaB(GO:0008588) |
| 0.1 | 2.5 | GO:0006783 | heme biosynthetic process(GO:0006783) |
| 0.1 | 0.2 | GO:0002426 | immunoglobulin production in mucosal tissue(GO:0002426) |
| 0.1 | 0.1 | GO:0002752 | innate immune response activating cell surface receptor signaling pathway(GO:0002220) cell surface pattern recognition receptor signaling pathway(GO:0002752) |
| 0.1 | 0.5 | GO:0042997 | negative regulation of Golgi to plasma membrane protein transport(GO:0042997) |
| 0.1 | 1.0 | GO:0043101 | purine-containing compound salvage(GO:0043101) |
| 0.1 | 0.9 | GO:0033572 | transferrin transport(GO:0033572) |
| 0.1 | 0.2 | GO:0006295 | nucleotide-excision repair, DNA incision, 3'-to lesion(GO:0006295) |
| 0.1 | 0.4 | GO:1990168 | protein K29-linked deubiquitination(GO:0035523) protein K33-linked deubiquitination(GO:1990168) |
| 0.1 | 0.2 | GO:0010735 | positive regulation of transcription via serum response element binding(GO:0010735) |
| 0.1 | 0.6 | GO:0071910 | determination of pancreatic left/right asymmetry(GO:0035469) determination of liver left/right asymmetry(GO:0071910) |
| 0.1 | 0.1 | GO:0048295 | positive regulation of isotype switching to IgE isotypes(GO:0048295) |
| 0.1 | 1.3 | GO:0090026 | positive regulation of monocyte chemotaxis(GO:0090026) |
| 0.1 | 0.2 | GO:0002725 | negative regulation of T cell cytokine production(GO:0002725) |
| 0.1 | 0.5 | GO:0045901 | positive regulation of translational elongation(GO:0045901) |
| 0.1 | 0.2 | GO:0070447 | positive regulation of oligodendrocyte progenitor proliferation(GO:0070447) |
| 0.1 | 0.1 | GO:0015677 | copper ion import(GO:0015677) |
| 0.1 | 0.5 | GO:1900113 | negative regulation of histone H3-K9 trimethylation(GO:1900113) |
| 0.1 | 0.2 | GO:1902513 | regulation of organelle transport along microtubule(GO:1902513) |
| 0.1 | 0.2 | GO:0002840 | T cell mediated immune response to tumor cell(GO:0002424) regulation of T cell mediated immune response to tumor cell(GO:0002840) |
| 0.1 | 0.7 | GO:0051409 | response to nitrosative stress(GO:0051409) |
| 0.1 | 1.0 | GO:0015721 | bile acid and bile salt transport(GO:0015721) |
| 0.1 | 0.4 | GO:0048143 | astrocyte activation(GO:0048143) |
| 0.1 | 0.4 | GO:0060988 | lipid tube assembly(GO:0060988) |
| 0.1 | 0.4 | GO:0035166 | post-embryonic hemopoiesis(GO:0035166) |
| 0.1 | 0.2 | GO:0007529 | establishment of synaptic specificity at neuromuscular junction(GO:0007529) |
| 0.1 | 0.3 | GO:0046499 | S-adenosylmethioninamine metabolic process(GO:0046499) |
| 0.1 | 0.1 | GO:0043379 | memory T cell differentiation(GO:0043379) |
| 0.1 | 0.2 | GO:2000271 | positive regulation of fibroblast apoptotic process(GO:2000271) |
| 0.1 | 0.9 | GO:0035563 | positive regulation of chromatin binding(GO:0035563) |
| 0.1 | 0.3 | GO:0070682 | proteasome regulatory particle assembly(GO:0070682) |
| 0.1 | 0.2 | GO:2000048 | negative regulation of cell-cell adhesion mediated by cadherin(GO:2000048) |
| 0.1 | 0.7 | GO:0071318 | cellular response to ATP(GO:0071318) |
| 0.1 | 0.1 | GO:0009826 | unidimensional cell growth(GO:0009826) |
| 0.1 | 0.1 | GO:0035630 | bone mineralization involved in bone maturation(GO:0035630) |
| 0.1 | 0.3 | GO:0046271 | phenylpropanoid catabolic process(GO:0046271) |
| 0.1 | 0.3 | GO:0034214 | protein hexamerization(GO:0034214) |
| 0.1 | 0.7 | GO:0033299 | secretion of lysosomal enzymes(GO:0033299) |
| 0.1 | 0.4 | GO:0034720 | histone H3-K4 demethylation(GO:0034720) |
| 0.1 | 0.8 | GO:0046085 | adenosine metabolic process(GO:0046085) |
| 0.1 | 0.2 | GO:2001032 | regulation of double-strand break repair via nonhomologous end joining(GO:2001032) |
| 0.1 | 0.2 | GO:0006407 | rRNA export from nucleus(GO:0006407) |
| 0.1 | 0.2 | GO:0042998 | positive regulation of Golgi to plasma membrane protein transport(GO:0042998) |
| 0.1 | 0.4 | GO:0002741 | positive regulation of cytokine secretion involved in immune response(GO:0002741) |
| 0.1 | 0.2 | GO:0097680 | double-strand break repair via classical nonhomologous end joining(GO:0097680) |
| 0.1 | 0.2 | GO:1901740 | negative regulation of myoblast fusion(GO:1901740) |
| 0.1 | 0.3 | GO:0002337 | B-1a B cell differentiation(GO:0002337) |
| 0.1 | 0.2 | GO:0052173 | response to defenses of other organism involved in symbiotic interaction(GO:0052173) response to host defenses(GO:0052200) response to host(GO:0075136) |
| 0.1 | 1.8 | GO:0051016 | barbed-end actin filament capping(GO:0051016) |
| 0.1 | 0.1 | GO:1990705 | cholangiocyte proliferation(GO:1990705) |
| 0.1 | 0.4 | GO:0060830 | ciliary receptor clustering involved in smoothened signaling pathway(GO:0060830) |
| 0.1 | 0.1 | GO:0051660 | establishment of centrosome localization(GO:0051660) |
| 0.1 | 0.8 | GO:0010457 | centriole-centriole cohesion(GO:0010457) |
| 0.1 | 0.3 | GO:0051964 | negative regulation of synapse assembly(GO:0051964) |
| 0.1 | 0.2 | GO:0001543 | ovarian follicle rupture(GO:0001543) |
| 0.1 | 0.5 | GO:1904261 | regulation of basement membrane assembly involved in embryonic body morphogenesis(GO:1904259) positive regulation of basement membrane assembly involved in embryonic body morphogenesis(GO:1904261) basement membrane assembly involved in embryonic body morphogenesis(GO:2001197) |
| 0.1 | 0.4 | GO:0098763 | mitotic cell cycle phase(GO:0098763) |
| 0.1 | 0.3 | GO:0000255 | allantoin metabolic process(GO:0000255) |
| 0.1 | 0.5 | GO:0010759 | positive regulation of macrophage chemotaxis(GO:0010759) |
| 0.1 | 0.2 | GO:0060696 | regulation of phospholipid catabolic process(GO:0060696) |
| 0.1 | 0.1 | GO:0003157 | endocardium development(GO:0003157) |
| 0.1 | 0.3 | GO:0031627 | telomeric loop formation(GO:0031627) |
| 0.1 | 0.3 | GO:0006742 | NADP catabolic process(GO:0006742) |
| 0.1 | 0.9 | GO:0015697 | quaternary ammonium group transport(GO:0015697) |
| 0.1 | 0.6 | GO:0019852 | L-ascorbic acid metabolic process(GO:0019852) |
| 0.1 | 1.4 | GO:0002360 | T cell lineage commitment(GO:0002360) |
| 0.1 | 0.9 | GO:0002098 | tRNA wobble uridine modification(GO:0002098) |
| 0.1 | 0.7 | GO:0000185 | activation of MAPKKK activity(GO:0000185) |
| 0.1 | 0.3 | GO:0010756 | positive regulation of plasminogen activation(GO:0010756) |
| 0.1 | 0.3 | GO:0036066 | protein O-linked fucosylation(GO:0036066) |
| 0.1 | 0.3 | GO:0072710 | response to hydroxyurea(GO:0072710) cellular response to hydroxyurea(GO:0072711) |
| 0.1 | 0.2 | GO:0019676 | ammonia assimilation cycle(GO:0019676) |
| 0.1 | 0.2 | GO:0060689 | cell differentiation involved in salivary gland development(GO:0060689) |
| 0.1 | 0.1 | GO:0010748 | negative regulation of plasma membrane long-chain fatty acid transport(GO:0010748) |
| 0.1 | 0.5 | GO:2000774 | positive regulation of cellular senescence(GO:2000774) |
| 0.1 | 0.7 | GO:0048387 | negative regulation of retinoic acid receptor signaling pathway(GO:0048387) |
| 0.1 | 0.5 | GO:0006532 | aspartate biosynthetic process(GO:0006532) |
| 0.1 | 1.3 | GO:0006144 | purine nucleobase metabolic process(GO:0006144) |
| 0.1 | 0.2 | GO:0042222 | interleukin-1 biosynthetic process(GO:0042222) |
| 0.1 | 1.0 | GO:0021702 | cerebellar Purkinje cell differentiation(GO:0021702) |
| 0.1 | 0.1 | GO:1900377 | negative regulation of melanin biosynthetic process(GO:0048022) negative regulation of secondary metabolite biosynthetic process(GO:1900377) |
| 0.1 | 0.9 | GO:0071257 | cellular response to electrical stimulus(GO:0071257) |
| 0.1 | 3.2 | GO:0033141 | positive regulation of peptidyl-serine phosphorylation of STAT protein(GO:0033141) |
| 0.1 | 0.9 | GO:0070050 | neuron cellular homeostasis(GO:0070050) |
| 0.1 | 0.3 | GO:0001920 | negative regulation of receptor recycling(GO:0001920) |
| 0.1 | 0.3 | GO:0048619 | embryonic hindgut morphogenesis(GO:0048619) |
| 0.1 | 0.6 | GO:1903069 | regulation of ER-associated ubiquitin-dependent protein catabolic process(GO:1903069) |
| 0.1 | 1.3 | GO:0070830 | bicellular tight junction assembly(GO:0070830) |
| 0.1 | 0.6 | GO:0071763 | nuclear membrane organization(GO:0071763) |
| 0.1 | 0.3 | GO:1904263 | positive regulation of TORC1 signaling(GO:1904263) |
| 0.1 | 0.3 | GO:0070102 | interleukin-6-mediated signaling pathway(GO:0070102) |
| 0.1 | 0.4 | GO:0002317 | plasma cell differentiation(GO:0002317) |
| 0.1 | 0.2 | GO:0051194 | positive regulation of cofactor metabolic process(GO:0051194) positive regulation of coenzyme metabolic process(GO:0051197) |
| 0.1 | 0.4 | GO:0072378 | blood coagulation, fibrin clot formation(GO:0072378) |
| 0.1 | 0.5 | GO:1900103 | positive regulation of endoplasmic reticulum unfolded protein response(GO:1900103) |
| 0.1 | 1.3 | GO:0006706 | steroid catabolic process(GO:0006706) |
| 0.1 | 0.8 | GO:0000103 | sulfate assimilation(GO:0000103) |
| 0.1 | 0.3 | GO:0051105 | regulation of DNA ligation(GO:0051105) positive regulation of DNA ligation(GO:0051106) |
| 0.1 | 0.2 | GO:0009169 | ribonucleoside monophosphate catabolic process(GO:0009158) purine ribonucleoside monophosphate catabolic process(GO:0009169) |
| 0.1 | 0.1 | GO:0070100 | negative regulation of chemokine-mediated signaling pathway(GO:0070100) |
| 0.1 | 1.5 | GO:0042036 | negative regulation of cytokine biosynthetic process(GO:0042036) |
| 0.1 | 0.4 | GO:1903361 | protein localization to basolateral plasma membrane(GO:1903361) |
| 0.1 | 0.1 | GO:1903301 | positive regulation of hexokinase activity(GO:1903301) |
| 0.1 | 0.3 | GO:2001013 | epithelial cell proliferation involved in renal tubule morphogenesis(GO:2001013) |
| 0.1 | 0.3 | GO:0018197 | peptidyl-aspartic acid modification(GO:0018197) |
| 0.1 | 0.2 | GO:0090296 | regulation of mitochondrial DNA replication(GO:0090296) |
| 0.1 | 0.4 | GO:0060283 | negative regulation of oocyte development(GO:0060283) negative regulation of oocyte maturation(GO:1900194) |
| 0.1 | 0.2 | GO:0002322 | B cell proliferation involved in immune response(GO:0002322) |
| 0.1 | 0.2 | GO:0048320 | axial mesoderm formation(GO:0048320) |
| 0.1 | 0.5 | GO:0032324 | Mo-molybdopterin cofactor biosynthetic process(GO:0006777) Mo-molybdopterin cofactor metabolic process(GO:0019720) molybdopterin cofactor biosynthetic process(GO:0032324) molybdopterin cofactor metabolic process(GO:0043545) prosthetic group metabolic process(GO:0051189) |
| 0.1 | 0.5 | GO:0010961 | cellular magnesium ion homeostasis(GO:0010961) |
| 0.1 | 0.3 | GO:1902606 | regulation of large conductance calcium-activated potassium channel activity(GO:1902606) positive regulation of large conductance calcium-activated potassium channel activity(GO:1902608) |
| 0.1 | 0.4 | GO:0010387 | COP9 signalosome assembly(GO:0010387) |
| 0.1 | 0.5 | GO:0006776 | vitamin A metabolic process(GO:0006776) |
| 0.1 | 0.3 | GO:0061086 | negative regulation of histone H3-K27 methylation(GO:0061086) |
| 0.1 | 0.2 | GO:0032286 | central nervous system myelin maintenance(GO:0032286) |
| 0.1 | 0.1 | GO:0042226 | interleukin-6 biosynthetic process(GO:0042226) |
| 0.1 | 0.8 | GO:2000001 | regulation of DNA damage checkpoint(GO:2000001) |
| 0.1 | 0.4 | GO:0035622 | intrahepatic bile duct development(GO:0035622) |
| 0.1 | 0.4 | GO:0018101 | protein citrullination(GO:0018101) |
| 0.1 | 1.0 | GO:0031958 | corticosteroid receptor signaling pathway(GO:0031958) |
| 0.1 | 0.3 | GO:0008355 | olfactory learning(GO:0008355) |
| 0.1 | 0.2 | GO:1902262 | apoptotic process involved in patterning of blood vessels(GO:1902262) |
| 0.1 | 0.7 | GO:1903392 | negative regulation of focal adhesion assembly(GO:0051895) negative regulation of adherens junction organization(GO:1903392) |
| 0.1 | 0.2 | GO:0061144 | alveolar secondary septum development(GO:0061144) |
| 0.1 | 0.2 | GO:0000972 | transcription-dependent tethering of RNA polymerase II gene DNA at nuclear periphery(GO:0000972) |
| 0.1 | 0.4 | GO:0034047 | regulation of protein phosphatase type 2A activity(GO:0034047) |
| 0.1 | 0.3 | GO:0061470 | T follicular helper cell differentiation(GO:0061470) |
| 0.1 | 0.7 | GO:0018026 | peptidyl-lysine monomethylation(GO:0018026) |
| 0.1 | 0.3 | GO:0031284 | positive regulation of guanylate cyclase activity(GO:0031284) |
| 0.1 | 0.3 | GO:0001887 | selenium compound metabolic process(GO:0001887) |
| 0.1 | 0.3 | GO:0032485 | regulation of Ral protein signal transduction(GO:0032485) |
| 0.1 | 0.3 | GO:0046552 | eye photoreceptor cell fate commitment(GO:0042706) photoreceptor cell fate commitment(GO:0046552) |
| 0.1 | 0.3 | GO:0032898 | neurotrophin production(GO:0032898) |
| 0.1 | 2.0 | GO:0006972 | hyperosmotic response(GO:0006972) |
| 0.1 | 0.7 | GO:0035337 | fatty-acyl-CoA metabolic process(GO:0035337) |
| 0.1 | 0.3 | GO:0097155 | fasciculation of sensory neuron axon(GO:0097155) |
| 0.1 | 0.5 | GO:0007221 | positive regulation of transcription of Notch receptor target(GO:0007221) |
| 0.1 | 0.3 | GO:2000074 | regulation of type B pancreatic cell development(GO:2000074) |
| 0.1 | 0.4 | GO:0030575 | nuclear body organization(GO:0030575) |
| 0.1 | 0.7 | GO:0070365 | hepatocyte differentiation(GO:0070365) |
| 0.1 | 0.1 | GO:1901620 | regulation of smoothened signaling pathway involved in dorsal/ventral neural tube patterning(GO:1901620) |
| 0.1 | 0.7 | GO:0006012 | galactose metabolic process(GO:0006012) |
| 0.1 | 0.3 | GO:0060087 | relaxation of vascular smooth muscle(GO:0060087) |
| 0.1 | 0.2 | GO:0002025 | vasodilation by norepinephrine-epinephrine involved in regulation of systemic arterial blood pressure(GO:0002025) |
| 0.1 | 0.7 | GO:0034244 | negative regulation of transcription elongation from RNA polymerase II promoter(GO:0034244) |
| 0.1 | 0.2 | GO:2001268 | negative regulation of cysteine-type endopeptidase activity involved in apoptotic signaling pathway(GO:2001268) |
| 0.1 | 2.2 | GO:0046329 | negative regulation of JNK cascade(GO:0046329) |
| 0.1 | 0.3 | GO:0090383 | phagosome acidification(GO:0090383) |
| 0.1 | 0.2 | GO:1903774 | positive regulation of viral budding via host ESCRT complex(GO:1903774) |
| 0.1 | 0.6 | GO:0046599 | regulation of centriole replication(GO:0046599) |
| 0.1 | 0.5 | GO:0050861 | positive regulation of B cell receptor signaling pathway(GO:0050861) |
| 0.1 | 0.4 | GO:1902031 | regulation of NADP metabolic process(GO:1902031) |
| 0.1 | 0.3 | GO:0006526 | arginine biosynthetic process(GO:0006526) |
| 0.1 | 0.9 | GO:0001675 | acrosome assembly(GO:0001675) |
| 0.1 | 0.3 | GO:0010694 | positive regulation of alkaline phosphatase activity(GO:0010694) |
| 0.1 | 0.2 | GO:1903596 | regulation of gap junction assembly(GO:1903596) positive regulation of gap junction assembly(GO:1903598) |
| 0.1 | 0.1 | GO:0019660 | fermentation(GO:0006113) glucose catabolic process to lactate(GO:0019659) glycolytic fermentation(GO:0019660) glucose catabolic process to lactate via pyruvate(GO:0019661) |
| 0.1 | 0.2 | GO:0075525 | viral translational termination-reinitiation(GO:0075525) |
| 0.1 | 0.2 | GO:0034756 | regulation of iron ion transport(GO:0034756) |
| 0.1 | 0.3 | GO:0051596 | methylglyoxal catabolic process to D-lactate via S-lactoyl-glutathione(GO:0019243) methylglyoxal catabolic process(GO:0051596) methylglyoxal catabolic process to lactate(GO:0061727) |
| 0.1 | 0.5 | GO:0034551 | respiratory chain complex III assembly(GO:0017062) mitochondrial respiratory chain complex III assembly(GO:0034551) mitochondrial respiratory chain complex III biogenesis(GO:0097033) |
| 0.1 | 0.1 | GO:0098543 | detection of bacterium(GO:0016045) detection of other organism(GO:0098543) |
| 0.1 | 0.1 | GO:0033210 | leptin-mediated signaling pathway(GO:0033210) |
| 0.1 | 0.2 | GO:0002679 | respiratory burst involved in defense response(GO:0002679) |
| 0.1 | 0.2 | GO:0042420 | dopamine catabolic process(GO:0042420) |
| 0.1 | 0.2 | GO:0042737 | drug catabolic process(GO:0042737) |
| 0.1 | 0.5 | GO:0060136 | embryonic process involved in female pregnancy(GO:0060136) |
| 0.1 | 0.2 | GO:0006651 | diacylglycerol biosynthetic process(GO:0006651) |
| 0.1 | 0.6 | GO:0018206 | peptidyl-methionine modification(GO:0018206) |
| 0.1 | 0.4 | GO:0043923 | positive regulation by host of viral transcription(GO:0043923) |
| 0.1 | 0.2 | GO:0030223 | neutrophil differentiation(GO:0030223) |
| 0.1 | 0.1 | GO:0043173 | nucleotide salvage(GO:0043173) |
| 0.1 | 0.1 | GO:0019240 | citrulline biosynthetic process(GO:0019240) |
| 0.1 | 0.2 | GO:1901300 | positive regulation of hydrogen peroxide-mediated programmed cell death(GO:1901300) positive regulation of hydrogen peroxide-induced cell death(GO:1905206) |
| 0.1 | 0.3 | GO:0019673 | GDP-mannose metabolic process(GO:0019673) |
| 0.1 | 0.3 | GO:0034379 | very-low-density lipoprotein particle assembly(GO:0034379) |
| 0.1 | 0.8 | GO:0007213 | G-protein coupled acetylcholine receptor signaling pathway(GO:0007213) |
| 0.1 | 0.7 | GO:0045292 | mRNA cis splicing, via spliceosome(GO:0045292) |
| 0.1 | 0.1 | GO:1901668 | regulation of superoxide dismutase activity(GO:1901668) |
| 0.1 | 0.2 | GO:0070827 | chromatin maintenance(GO:0070827) |
| 0.1 | 0.3 | GO:1904659 | glucose transmembrane transport(GO:1904659) |
| 0.1 | 1.3 | GO:0045954 | positive regulation of natural killer cell mediated cytotoxicity(GO:0045954) |
| 0.1 | 0.1 | GO:0033860 | regulation of NAD(P)H oxidase activity(GO:0033860) |
| 0.1 | 0.1 | GO:0017187 | peptidyl-glutamic acid carboxylation(GO:0017187) |
| 0.1 | 0.3 | GO:0045719 | negative regulation of glycogen biosynthetic process(GO:0045719) |
| 0.1 | 0.2 | GO:1903223 | positive regulation of oxidative stress-induced neuron death(GO:1903223) |
| 0.1 | 0.1 | GO:0006714 | sesquiterpenoid metabolic process(GO:0006714) |
| 0.1 | 0.4 | GO:1902369 | negative regulation of RNA catabolic process(GO:1902369) |
| 0.1 | 0.2 | GO:0090219 | negative regulation of lipid kinase activity(GO:0090219) |
| 0.1 | 0.3 | GO:0010960 | magnesium ion homeostasis(GO:0010960) |
| 0.1 | 0.3 | GO:0001661 | conditioned taste aversion(GO:0001661) |
| 0.1 | 0.2 | GO:0035740 | CD8-positive, alpha-beta T cell proliferation(GO:0035740) |
| 0.1 | 0.2 | GO:0015884 | folic acid transport(GO:0015884) |
| 0.1 | 0.1 | GO:0070141 | response to UV-A(GO:0070141) cellular response to UV-A(GO:0071492) |
| 0.1 | 0.1 | GO:1901844 | regulation of cell communication by electrical coupling involved in cardiac conduction(GO:1901844) |
| 0.1 | 0.1 | GO:0090245 | axis elongation involved in somitogenesis(GO:0090245) |
| 0.1 | 0.2 | GO:1901525 | negative regulation of macromitophagy(GO:1901525) |
| 0.1 | 0.1 | GO:0090210 | regulation of establishment of blood-brain barrier(GO:0090210) |
| 0.1 | 0.1 | GO:0075509 | receptor-mediated endocytosis of virus by host cell(GO:0019065) endocytosis involved in viral entry into host cell(GO:0075509) |
| 0.1 | 0.1 | GO:0051684 | maintenance of Golgi location(GO:0051684) |
| 0.1 | 0.4 | GO:0060710 | chorio-allantoic fusion(GO:0060710) |
| 0.1 | 0.1 | GO:0050747 | positive regulation of lipoprotein metabolic process(GO:0050747) positive regulation of protein lipidation(GO:1903061) regulation of endoplasmic reticulum tubular network organization(GO:1903371) |
| 0.1 | 0.2 | GO:0006285 | base-excision repair, AP site formation(GO:0006285) |
| 0.1 | 0.2 | GO:0051547 | regulation of keratinocyte migration(GO:0051547) positive regulation of keratinocyte migration(GO:0051549) |
| 0.1 | 2.7 | GO:0061515 | myeloid cell development(GO:0061515) |
| 0.1 | 0.1 | GO:0070358 | actin polymerization-dependent cell motility(GO:0070358) |
| 0.1 | 1.1 | GO:0017144 | drug metabolic process(GO:0017144) |
| 0.1 | 0.1 | GO:0019344 | cysteine biosynthetic process(GO:0019344) |
| 0.1 | 0.3 | GO:0006116 | NADH oxidation(GO:0006116) |
| 0.1 | 0.2 | GO:2000773 | negative regulation of cellular senescence(GO:2000773) |
| 0.1 | 0.1 | GO:0061615 | glycolytic process through fructose-6-phosphate(GO:0061615) |
| 0.1 | 0.1 | GO:0010692 | regulation of alkaline phosphatase activity(GO:0010692) |
| 0.1 | 0.3 | GO:0070966 | nuclear-transcribed mRNA catabolic process, no-go decay(GO:0070966) |
| 0.1 | 0.7 | GO:0051570 | regulation of histone H3-K9 methylation(GO:0051570) |
| 0.1 | 0.4 | GO:0097459 | iron ion import into cell(GO:0097459) |
| 0.1 | 0.5 | GO:0005513 | detection of calcium ion(GO:0005513) |
| 0.1 | 0.2 | GO:0034310 | primary alcohol catabolic process(GO:0034310) |
| 0.1 | 0.1 | GO:1902896 | terminal web assembly(GO:1902896) |
| 0.1 | 0.8 | GO:0001886 | endothelial cell morphogenesis(GO:0001886) |
| 0.1 | 0.5 | GO:0035269 | protein O-linked mannosylation(GO:0035269) |
| 0.1 | 0.6 | GO:0001867 | complement activation, lectin pathway(GO:0001867) |
| 0.1 | 0.4 | GO:1902230 | negative regulation of intrinsic apoptotic signaling pathway in response to DNA damage(GO:1902230) |
| 0.1 | 0.3 | GO:0070314 | G1 to G0 transition(GO:0070314) |
| 0.1 | 0.1 | GO:2001275 | positive regulation of glucose import in response to insulin stimulus(GO:2001275) |
| 0.1 | 1.2 | GO:0046856 | phosphatidylinositol dephosphorylation(GO:0046856) |
| 0.1 | 0.2 | GO:0006624 | vacuolar protein processing(GO:0006624) |
| 0.1 | 0.1 | GO:0010728 | regulation of hydrogen peroxide biosynthetic process(GO:0010728) |
| 0.1 | 0.5 | GO:0008343 | adult feeding behavior(GO:0008343) |
| 0.1 | 0.8 | GO:0030212 | hyaluronan metabolic process(GO:0030212) |
| 0.1 | 2.6 | GO:0000245 | spliceosomal complex assembly(GO:0000245) |
| 0.1 | 0.2 | GO:2000418 | positive regulation of eosinophil migration(GO:2000418) |
| 0.1 | 1.2 | GO:0070979 | protein K11-linked ubiquitination(GO:0070979) |
| 0.1 | 0.5 | GO:0030224 | monocyte differentiation(GO:0030224) |
| 0.1 | 0.5 | GO:0036297 | interstrand cross-link repair(GO:0036297) |
| 0.1 | 0.5 | GO:0035845 | photoreceptor cell outer segment organization(GO:0035845) |
| 0.1 | 0.5 | GO:0055064 | chloride ion homeostasis(GO:0055064) |
| 0.1 | 0.2 | GO:0046339 | diacylglycerol metabolic process(GO:0046339) |
| 0.1 | 0.3 | GO:1900153 | regulation of nuclear-transcribed mRNA catabolic process, deadenylation-dependent decay(GO:1900151) positive regulation of nuclear-transcribed mRNA catabolic process, deadenylation-dependent decay(GO:1900153) |
| 0.1 | 0.3 | GO:0048385 | regulation of retinoic acid receptor signaling pathway(GO:0048385) |
| 0.1 | 0.5 | GO:0048703 | embryonic viscerocranium morphogenesis(GO:0048703) |
| 0.1 | 0.4 | GO:0097421 | liver regeneration(GO:0097421) |
| 0.1 | 0.5 | GO:0007097 | nuclear migration(GO:0007097) |
| 0.1 | 0.4 | GO:0014041 | regulation of neuron maturation(GO:0014041) |
| 0.1 | 0.4 | GO:0032287 | peripheral nervous system myelin maintenance(GO:0032287) |
| 0.1 | 0.5 | GO:0050995 | negative regulation of lipid catabolic process(GO:0050995) |
| 0.1 | 0.1 | GO:0002554 | serotonin secretion by platelet(GO:0002554) |
| 0.1 | 0.2 | GO:0035526 | retrograde transport, plasma membrane to Golgi(GO:0035526) |
| 0.1 | 0.3 | GO:0002441 | histamine production involved in inflammatory response(GO:0002349) histamine secretion involved in inflammatory response(GO:0002441) histamine secretion by mast cell(GO:0002553) |
| 0.1 | 0.5 | GO:0031145 | anaphase-promoting complex-dependent catabolic process(GO:0031145) |
| 0.1 | 0.8 | GO:0045116 | protein neddylation(GO:0045116) |
| 0.1 | 0.4 | GO:0051764 | actin crosslink formation(GO:0051764) |
| 0.1 | 0.1 | GO:0038089 | positive regulation of cell migration by vascular endothelial growth factor signaling pathway(GO:0038089) |
| 0.1 | 0.3 | GO:0006370 | 7-methylguanosine mRNA capping(GO:0006370) |
| 0.1 | 0.2 | GO:0010040 | response to iron(II) ion(GO:0010040) |
| 0.1 | 2.5 | GO:0051865 | protein autoubiquitination(GO:0051865) |
| 0.1 | 0.4 | GO:0000042 | protein targeting to Golgi(GO:0000042) |
| 0.1 | 0.7 | GO:0097320 | membrane tubulation(GO:0097320) |
| 0.1 | 0.3 | GO:0008295 | spermidine biosynthetic process(GO:0008295) |
| 0.1 | 0.9 | GO:0034724 | DNA replication-independent nucleosome assembly(GO:0006336) DNA replication-independent nucleosome organization(GO:0034724) |
| 0.1 | 0.4 | GO:0033603 | positive regulation of dopamine secretion(GO:0033603) |
| 0.1 | 0.1 | GO:0002215 | defense response to nematode(GO:0002215) |
| 0.1 | 0.4 | GO:0008616 | queuosine biosynthetic process(GO:0008616) queuosine metabolic process(GO:0046116) |
| 0.1 | 0.8 | GO:0006465 | signal peptide processing(GO:0006465) |
| 0.1 | 1.1 | GO:0043552 | positive regulation of phosphatidylinositol 3-kinase activity(GO:0043552) |
| 0.1 | 0.4 | GO:0097341 | inhibition of cysteine-type endopeptidase activity(GO:0097340) zymogen inhibition(GO:0097341) inhibition of cysteine-type endopeptidase activity involved in apoptotic process(GO:1990001) |
| 0.1 | 0.2 | GO:0046341 | CDP-diacylglycerol metabolic process(GO:0046341) |
| 0.1 | 0.9 | GO:0034508 | centromere complex assembly(GO:0034508) |
| 0.1 | 0.7 | GO:0060972 | left/right pattern formation(GO:0060972) |
| 0.1 | 0.1 | GO:0035627 | ceramide transport(GO:0035627) |
| 0.1 | 0.2 | GO:0001560 | regulation of cell growth by extracellular stimulus(GO:0001560) |
| 0.1 | 0.7 | GO:0042407 | cristae formation(GO:0042407) |
| 0.1 | 0.2 | GO:1902093 | positive regulation of sperm motility(GO:1902093) |
| 0.1 | 1.2 | GO:1900047 | negative regulation of blood coagulation(GO:0030195) negative regulation of hemostasis(GO:1900047) |
| 0.1 | 0.3 | GO:0006027 | glycosaminoglycan catabolic process(GO:0006027) |
| 0.1 | 0.2 | GO:0046322 | negative regulation of fatty acid oxidation(GO:0046322) |
| 0.1 | 2.6 | GO:0042035 | regulation of cytokine biosynthetic process(GO:0042035) |
| 0.1 | 0.2 | GO:1903966 | monounsaturated fatty acid metabolic process(GO:1903964) monounsaturated fatty acid biosynthetic process(GO:1903966) |
| 0.1 | 0.4 | GO:0061179 | negative regulation of insulin secretion involved in cellular response to glucose stimulus(GO:0061179) |
| 0.1 | 0.2 | GO:0051697 | protein delipidation(GO:0051697) |
| 0.1 | 1.4 | GO:0035458 | cellular response to interferon-beta(GO:0035458) |
| 0.1 | 0.2 | GO:0019287 | isopentenyl diphosphate biosynthetic process(GO:0009240) isopentenyl diphosphate biosynthetic process, mevalonate pathway(GO:0019287) |
| 0.1 | 0.6 | GO:0042572 | retinol metabolic process(GO:0042572) |
| 0.1 | 0.2 | GO:2000973 | regulation of pro-B cell differentiation(GO:2000973) |
| 0.1 | 0.3 | GO:0070934 | CRD-mediated mRNA stabilization(GO:0070934) |
| 0.1 | 0.2 | GO:0033623 | regulation of integrin activation(GO:0033623) |
| 0.1 | 1.1 | GO:0031440 | regulation of mRNA 3'-end processing(GO:0031440) |
| 0.1 | 0.5 | GO:0032801 | receptor catabolic process(GO:0032801) |
| 0.1 | 0.1 | GO:1903236 | regulation of leukocyte tethering or rolling(GO:1903236) |
| 0.1 | 0.2 | GO:0010832 | negative regulation of myotube differentiation(GO:0010832) |
| 0.1 | 0.5 | GO:0097284 | hepatocyte apoptotic process(GO:0097284) |
| 0.1 | 0.5 | GO:0042448 | progesterone metabolic process(GO:0042448) |
| 0.1 | 0.2 | GO:0006348 | chromatin silencing at telomere(GO:0006348) |
| 0.1 | 0.2 | GO:0031340 | positive regulation of vesicle fusion(GO:0031340) |
| 0.1 | 0.1 | GO:0015819 | lysine transport(GO:0015819) |
| 0.1 | 0.3 | GO:0060613 | fat pad development(GO:0060613) |
| 0.1 | 0.2 | GO:0045629 | negative regulation of T-helper 2 cell differentiation(GO:0045629) |
| 0.1 | 0.1 | GO:0006382 | adenosine to inosine editing(GO:0006382) |
| 0.1 | 0.1 | GO:0072053 | renal inner medulla development(GO:0072053) |
| 0.1 | 0.3 | GO:0035507 | regulation of myosin-light-chain-phosphatase activity(GO:0035507) |
| 0.1 | 0.2 | GO:0001915 | negative regulation of T cell mediated cytotoxicity(GO:0001915) |
| 0.1 | 0.7 | GO:0003351 | epithelial cilium movement(GO:0003351) |
| 0.1 | 0.1 | GO:0032489 | regulation of Cdc42 protein signal transduction(GO:0032489) |
| 0.1 | 0.1 | GO:0010796 | regulation of multivesicular body size(GO:0010796) |
| 0.1 | 0.2 | GO:0060028 | convergent extension involved in axis elongation(GO:0060028) |
| 0.1 | 0.2 | GO:0080009 | mRNA methylation(GO:0080009) |
| 0.1 | 0.1 | GO:0035983 | response to trichostatin A(GO:0035983) cellular response to trichostatin A(GO:0035984) |
| 0.1 | 0.5 | GO:0030277 | maintenance of gastrointestinal epithelium(GO:0030277) |
| 0.1 | 0.1 | GO:0007262 | STAT protein import into nucleus(GO:0007262) |
| 0.1 | 0.1 | GO:0060050 | positive regulation of protein glycosylation(GO:0060050) |
| 0.1 | 0.1 | GO:0010891 | negative regulation of sequestering of triglyceride(GO:0010891) |
| 0.1 | 0.2 | GO:0009597 | detection of virus(GO:0009597) |
| 0.1 | 0.4 | GO:0043569 | negative regulation of insulin-like growth factor receptor signaling pathway(GO:0043569) |
| 0.1 | 0.1 | GO:0046112 | nucleobase biosynthetic process(GO:0046112) |
| 0.1 | 0.2 | GO:0035582 | sequestering of BMP in extracellular matrix(GO:0035582) |
| 0.1 | 0.4 | GO:0016540 | protein autoprocessing(GO:0016540) |
| 0.1 | 0.3 | GO:0086013 | membrane repolarization during cardiac muscle cell action potential(GO:0086013) |
| 0.1 | 0.1 | GO:0051775 | response to redox state(GO:0051775) |
| 0.1 | 0.2 | GO:1990845 | diet induced thermogenesis(GO:0002024) adaptive thermogenesis(GO:1990845) |
| 0.1 | 0.2 | GO:0035864 | response to potassium ion(GO:0035864) cellular response to potassium ion(GO:0035865) |
| 0.1 | 0.1 | GO:0070245 | positive regulation of thymocyte apoptotic process(GO:0070245) |
| 0.1 | 0.4 | GO:1902018 | negative regulation of cilium assembly(GO:1902018) |
| 0.1 | 0.1 | GO:0035522 | monoubiquitinated histone deubiquitination(GO:0035521) monoubiquitinated histone H2A deubiquitination(GO:0035522) |
| 0.1 | 0.1 | GO:0002906 | mature B cell apoptotic process(GO:0002901) regulation of mature B cell apoptotic process(GO:0002905) negative regulation of mature B cell apoptotic process(GO:0002906) |
| 0.1 | 0.4 | GO:0006670 | sphingosine metabolic process(GO:0006670) |
| 0.1 | 0.8 | GO:0016578 | histone deubiquitination(GO:0016578) |
| 0.1 | 0.1 | GO:0021558 | trochlear nerve development(GO:0021558) |
| 0.1 | 0.2 | GO:0043137 | DNA replication, removal of RNA primer(GO:0043137) |
| 0.1 | 0.2 | GO:2001181 | positive regulation of interleukin-10 secretion(GO:2001181) |
| 0.1 | 0.1 | GO:2000503 | positive regulation of natural killer cell chemotaxis(GO:2000503) |
| 0.1 | 0.3 | GO:0051639 | actin filament network formation(GO:0051639) |
| 0.1 | 0.2 | GO:0015705 | iodide transport(GO:0015705) |
| 0.1 | 0.3 | GO:1904587 | glycoprotein ERAD pathway(GO:0097466) response to glycoprotein(GO:1904587) |
| 0.1 | 0.1 | GO:0060525 | prostate glandular acinus development(GO:0060525) secretory columnal luminar epithelial cell differentiation involved in prostate glandular acinus development(GO:0060528) |
| 0.1 | 0.4 | GO:0009081 | branched-chain amino acid metabolic process(GO:0009081) |
| 0.1 | 0.2 | GO:0051683 | establishment of Golgi localization(GO:0051683) |
| 0.1 | 0.2 | GO:0003176 | aortic valve development(GO:0003176) aortic valve morphogenesis(GO:0003180) |
| 0.1 | 0.2 | GO:0044828 | negative regulation by host of viral genome replication(GO:0044828) |
| 0.1 | 0.2 | GO:0018199 | peptidyl-glutamine modification(GO:0018199) |
| 0.1 | 0.1 | GO:0010898 | positive regulation of triglyceride catabolic process(GO:0010898) |
| 0.1 | 0.2 | GO:1901165 | positive regulation of trophoblast cell migration(GO:1901165) |
| 0.1 | 0.2 | GO:0097264 | self proteolysis(GO:0097264) |
| 0.1 | 0.2 | GO:0061087 | positive regulation of histone H3-K27 methylation(GO:0061087) |
| 0.1 | 0.1 | GO:1990928 | response to amino acid starvation(GO:1990928) |
| 0.1 | 0.2 | GO:0033136 | serine phosphorylation of STAT3 protein(GO:0033136) |
| 0.1 | 0.2 | GO:0044090 | positive regulation of vacuole organization(GO:0044090) |
| 0.1 | 0.1 | GO:0048711 | positive regulation of astrocyte differentiation(GO:0048711) |
| 0.1 | 0.1 | GO:1900368 | regulation of RNA interference(GO:1900368) |
| 0.1 | 0.1 | GO:0018171 | peptidyl-cysteine oxidation(GO:0018171) |
| 0.1 | 0.1 | GO:0071899 | regulation of estrogen receptor binding(GO:0071898) negative regulation of estrogen receptor binding(GO:0071899) |
| 0.1 | 0.3 | GO:0035735 | intraciliary transport involved in cilium morphogenesis(GO:0035735) |
| 0.1 | 0.1 | GO:0042362 | fat-soluble vitamin biosynthetic process(GO:0042362) |
| 0.1 | 0.1 | GO:0046628 | positive regulation of insulin receptor signaling pathway(GO:0046628) |
| 0.1 | 0.2 | GO:0097067 | cellular response to thyroid hormone stimulus(GO:0097067) |
| 0.1 | 0.1 | GO:0071787 | endoplasmic reticulum tubular network assembly(GO:0071787) |
| 0.1 | 1.9 | GO:0006661 | phosphatidylinositol biosynthetic process(GO:0006661) |
| 0.1 | 1.0 | GO:0048247 | lymphocyte chemotaxis(GO:0048247) |
| 0.1 | 0.1 | GO:0010310 | regulation of hydrogen peroxide metabolic process(GO:0010310) |
| 0.1 | 0.5 | GO:0019511 | peptidyl-proline hydroxylation(GO:0019511) |
| 0.1 | 0.3 | GO:0016266 | O-glycan processing(GO:0016266) |
| 0.1 | 0.5 | GO:0050930 | induction of positive chemotaxis(GO:0050930) |
| 0.1 | 0.4 | GO:0032026 | response to magnesium ion(GO:0032026) |
| 0.1 | 0.3 | GO:0070828 | heterochromatin organization(GO:0070828) |
| 0.1 | 0.2 | GO:0006564 | L-serine biosynthetic process(GO:0006564) |
| 0.1 | 1.5 | GO:0043407 | negative regulation of MAP kinase activity(GO:0043407) |
| 0.0 | 0.2 | GO:0010499 | proteasomal ubiquitin-independent protein catabolic process(GO:0010499) |
| 0.0 | 0.0 | GO:0060684 | epithelial-mesenchymal cell signaling(GO:0060684) |
| 0.0 | 0.4 | GO:0002031 | G-protein coupled receptor internalization(GO:0002031) |
| 0.0 | 0.2 | GO:0051387 | negative regulation of neurotrophin TRK receptor signaling pathway(GO:0051387) |
| 0.0 | 0.7 | GO:0006613 | cotranslational protein targeting to membrane(GO:0006613) |
| 0.0 | 0.3 | GO:0034501 | protein localization to kinetochore(GO:0034501) |
| 0.0 | 0.2 | GO:0070493 | thrombin receptor signaling pathway(GO:0070493) |
| 0.0 | 0.3 | GO:1902254 | negative regulation of intrinsic apoptotic signaling pathway by p53 class mediator(GO:1902254) |
| 0.0 | 0.1 | GO:0010481 | epidermal cell division(GO:0010481) regulation of epidermal cell division(GO:0010482) |
| 0.0 | 0.0 | GO:0045990 | carbon catabolite regulation of transcription(GO:0045990) |
| 0.0 | 0.1 | GO:0009629 | response to gravity(GO:0009629) |
| 0.0 | 0.2 | GO:1903553 | positive regulation of extracellular exosome assembly(GO:1903553) |
| 0.0 | 0.3 | GO:0016559 | peroxisome fission(GO:0016559) |
| 0.0 | 0.2 | GO:0009112 | nucleobase metabolic process(GO:0009112) |
| 0.0 | 0.3 | GO:0032988 | ribonucleoprotein complex disassembly(GO:0032988) |
| 0.0 | 0.2 | GO:0051790 | short-chain fatty acid biosynthetic process(GO:0051790) |
| 0.0 | 0.9 | GO:1900087 | positive regulation of G1/S transition of mitotic cell cycle(GO:1900087) |
| 0.0 | 0.0 | GO:2000721 | positive regulation of transcription from RNA polymerase II promoter involved in smooth muscle cell differentiation(GO:2000721) |
| 0.0 | 0.0 | GO:0042994 | cytoplasmic sequestering of transcription factor(GO:0042994) |
| 0.0 | 0.6 | GO:0048488 | synaptic vesicle endocytosis(GO:0048488) |
| 0.0 | 0.1 | GO:1990035 | calcium ion import into cell(GO:1990035) |
| 0.0 | 0.2 | GO:0042270 | protection from natural killer cell mediated cytotoxicity(GO:0042270) |
| 0.0 | 0.2 | GO:0001992 | regulation of systemic arterial blood pressure by vasopressin(GO:0001992) |
| 0.0 | 0.1 | GO:0042663 | regulation of endodermal cell fate specification(GO:0042663) |
| 0.0 | 0.1 | GO:1902415 | regulation of mRNA binding(GO:1902415) regulation of RNA binding(GO:1905214) |
| 0.0 | 0.0 | GO:0060594 | mammary gland specification(GO:0060594) |
| 0.0 | 0.1 | GO:0060267 | positive regulation of respiratory burst(GO:0060267) |
| 0.0 | 0.2 | GO:0033129 | positive regulation of histone phosphorylation(GO:0033129) |
| 0.0 | 0.0 | GO:0071276 | cellular response to cadmium ion(GO:0071276) |
| 0.0 | 0.1 | GO:0032202 | telomere assembly(GO:0032202) |
| 0.0 | 0.9 | GO:0046854 | phosphatidylinositol phosphorylation(GO:0046854) |
| 0.0 | 0.3 | GO:0006689 | ganglioside catabolic process(GO:0006689) |
| 0.0 | 0.4 | GO:0051457 | maintenance of protein location in nucleus(GO:0051457) |
| 0.0 | 0.2 | GO:0050860 | negative regulation of T cell receptor signaling pathway(GO:0050860) |
| 0.0 | 1.1 | GO:0006829 | zinc II ion transport(GO:0006829) |
| 0.0 | 0.5 | GO:0090140 | regulation of mitochondrial fission(GO:0090140) |
| 0.0 | 0.1 | GO:0006868 | glutamine transport(GO:0006868) |
| 0.0 | 0.2 | GO:0048023 | regulation of secondary metabolic process(GO:0043455) regulation of melanin biosynthetic process(GO:0048021) positive regulation of melanin biosynthetic process(GO:0048023) regulation of secondary metabolite biosynthetic process(GO:1900376) positive regulation of secondary metabolite biosynthetic process(GO:1900378) |
| 0.0 | 0.0 | GO:0032703 | negative regulation of interleukin-2 production(GO:0032703) |
| 0.0 | 0.1 | GO:0010760 | negative regulation of macrophage chemotaxis(GO:0010760) |
| 0.0 | 0.8 | GO:0014003 | oligodendrocyte development(GO:0014003) |
| 0.0 | 0.1 | GO:0048318 | axial mesoderm development(GO:0048318) |
| 0.0 | 0.1 | GO:0006848 | pyruvate transport(GO:0006848) pyruvate transmembrane transport(GO:1901475) |
| 0.0 | 0.3 | GO:0006590 | thyroid hormone generation(GO:0006590) |
| 0.0 | 0.1 | GO:0060623 | regulation of chromosome condensation(GO:0060623) |
| 0.0 | 0.0 | GO:0070120 | ciliary neurotrophic factor-mediated signaling pathway(GO:0070120) |
| 0.0 | 0.0 | GO:1904058 | positive regulation of sensory perception of pain(GO:1904058) |
| 0.0 | 0.1 | GO:0014048 | regulation of glutamate secretion(GO:0014048) |
| 0.0 | 0.2 | GO:0007023 | post-chaperonin tubulin folding pathway(GO:0007023) |
| 0.0 | 0.2 | GO:0032308 | positive regulation of prostaglandin secretion(GO:0032308) |
| 0.0 | 0.1 | GO:0002291 | T cell activation via T cell receptor contact with antigen bound to MHC molecule on antigen presenting cell(GO:0002291) |
| 0.0 | 0.7 | GO:0000002 | mitochondrial genome maintenance(GO:0000002) |
| 0.0 | 0.0 | GO:1903012 | positive regulation of bone development(GO:1903012) |
| 0.0 | 0.1 | GO:0071545 | inositol phosphate catabolic process(GO:0071545) |
| 0.0 | 0.4 | GO:0060670 | branching involved in labyrinthine layer morphogenesis(GO:0060670) |
| 0.0 | 0.1 | GO:1904354 | negative regulation of telomere capping(GO:1904354) |
| 0.0 | 0.1 | GO:0060059 | embryonic retina morphogenesis in camera-type eye(GO:0060059) |
| 0.0 | 0.2 | GO:0046836 | glycolipid transport(GO:0046836) |
| 0.0 | 0.1 | GO:0032788 | saturated monocarboxylic acid metabolic process(GO:0032788) unsaturated monocarboxylic acid metabolic process(GO:0032789) |
| 0.0 | 0.2 | GO:0070475 | rRNA base methylation(GO:0070475) |
| 0.0 | 0.1 | GO:0070459 | prolactin secretion(GO:0070459) |
| 0.0 | 0.3 | GO:0030049 | muscle filament sliding(GO:0030049) |
| 0.0 | 0.0 | GO:0006577 | amino-acid betaine metabolic process(GO:0006577) |
| 0.0 | 0.0 | GO:0018904 | ether metabolic process(GO:0018904) |
| 0.0 | 0.1 | GO:0018094 | protein polyglycylation(GO:0018094) |
| 0.0 | 0.0 | GO:0007567 | parturition(GO:0007567) |
| 0.0 | 0.1 | GO:0046060 | dATP metabolic process(GO:0046060) |
| 0.0 | 0.0 | GO:0045585 | regulation of cytotoxic T cell differentiation(GO:0045583) positive regulation of cytotoxic T cell differentiation(GO:0045585) |
| 0.0 | 0.2 | GO:0034975 | protein folding in endoplasmic reticulum(GO:0034975) |
| 0.0 | 0.2 | GO:0033313 | meiotic cell cycle checkpoint(GO:0033313) |
| 0.0 | 0.1 | GO:0006563 | L-serine metabolic process(GO:0006563) |
| 0.0 | 0.1 | GO:0032066 | nucleolus to nucleoplasm transport(GO:0032066) |
| 0.0 | 0.0 | GO:0046501 | protoporphyrinogen IX metabolic process(GO:0046501) |
| 0.0 | 0.3 | GO:0046464 | neutral lipid catabolic process(GO:0046461) acylglycerol catabolic process(GO:0046464) |
| 0.0 | 0.4 | GO:0006390 | transcription from mitochondrial promoter(GO:0006390) |
| 0.0 | 0.2 | GO:0046686 | response to cadmium ion(GO:0046686) |
| 0.0 | 0.3 | GO:0032402 | melanosome transport(GO:0032402) |
| 0.0 | 0.6 | GO:0046326 | positive regulation of glucose import(GO:0046326) |
| 0.0 | 0.2 | GO:0032482 | Rab protein signal transduction(GO:0032482) |
| 0.0 | 0.2 | GO:0046007 | negative regulation of activated T cell proliferation(GO:0046007) |
| 0.0 | 0.3 | GO:0034033 | nucleoside bisphosphate biosynthetic process(GO:0033866) ribonucleoside bisphosphate biosynthetic process(GO:0034030) purine nucleoside bisphosphate biosynthetic process(GO:0034033) |
| 0.0 | 0.0 | GO:0034442 | regulation of lipoprotein oxidation(GO:0034442) |
| 0.0 | 0.5 | GO:0002820 | negative regulation of adaptive immune response(GO:0002820) |
| 0.0 | 0.0 | GO:0051036 | regulation of endosome size(GO:0051036) |
| 0.0 | 0.2 | GO:0006228 | UTP biosynthetic process(GO:0006228) |
| 0.0 | 0.1 | GO:0010626 | negative regulation of Schwann cell proliferation(GO:0010626) |
| 0.0 | 0.2 | GO:0014866 | skeletal myofibril assembly(GO:0014866) |
| 0.0 | 0.1 | GO:0038095 | Fc-epsilon receptor signaling pathway(GO:0038095) |
| 0.0 | 0.0 | GO:0006933 | negative regulation of cell adhesion involved in substrate-bound cell migration(GO:0006933) |
| 0.0 | 0.0 | GO:0071672 | negative regulation of smooth muscle cell chemotaxis(GO:0071672) |
| 0.0 | 0.0 | GO:0002874 | regulation of chronic inflammatory response to antigenic stimulus(GO:0002874) |
| 0.0 | 0.2 | GO:1900016 | negative regulation of cytokine production involved in inflammatory response(GO:1900016) |
| 0.0 | 0.5 | GO:0006491 | N-glycan processing(GO:0006491) |
| 0.0 | 0.2 | GO:0060052 | neurofilament cytoskeleton organization(GO:0060052) |
| 0.0 | 0.0 | GO:0045630 | positive regulation of T-helper 2 cell differentiation(GO:0045630) |
| 0.0 | 0.1 | GO:0014052 | regulation of gamma-aminobutyric acid secretion(GO:0014052) positive regulation of gamma-aminobutyric acid secretion(GO:0014054) |
| 0.0 | 0.2 | GO:0007512 | adult heart development(GO:0007512) |
| 0.0 | 0.0 | GO:1901843 | positive regulation of high voltage-gated calcium channel activity(GO:1901843) |
| 0.0 | 0.1 | GO:0072656 | maintenance of protein location in mitochondrion(GO:0072656) |
| 0.0 | 0.8 | GO:0038083 | peptidyl-tyrosine autophosphorylation(GO:0038083) |
| 0.0 | 0.0 | GO:0006667 | sphinganine metabolic process(GO:0006667) |
| 0.0 | 0.0 | GO:0006002 | fructose 6-phosphate metabolic process(GO:0006002) |
| 0.0 | 0.1 | GO:0035791 | platelet-derived growth factor receptor-beta signaling pathway(GO:0035791) |
| 0.0 | 0.6 | GO:0050710 | negative regulation of cytokine secretion(GO:0050710) |
| 0.0 | 0.2 | GO:0031584 | activation of phospholipase D activity(GO:0031584) |
| 0.0 | 0.2 | GO:2000601 | positive regulation of Arp2/3 complex-mediated actin nucleation(GO:2000601) |
| 0.0 | 0.2 | GO:0030202 | heparin metabolic process(GO:0030202) |
| 0.0 | 0.1 | GO:0071360 | cellular response to exogenous dsRNA(GO:0071360) |
| 0.0 | 0.1 | GO:0002347 | response to tumor cell(GO:0002347) |
| 0.0 | 0.0 | GO:0035284 | central nervous system segmentation(GO:0035283) brain segmentation(GO:0035284) |
| 0.0 | 0.4 | GO:0070816 | phosphorylation of RNA polymerase II C-terminal domain(GO:0070816) |
| 0.0 | 0.3 | GO:0070584 | mitochondrion morphogenesis(GO:0070584) |
| 0.0 | 0.2 | GO:0090666 | scaRNA localization to Cajal body(GO:0090666) |
| 0.0 | 0.2 | GO:0060294 | cilium movement involved in cell motility(GO:0060294) |
| 0.0 | 0.1 | GO:0072600 | establishment of protein localization to Golgi(GO:0072600) |
| 0.0 | 0.2 | GO:0006572 | tyrosine catabolic process(GO:0006572) |
| 0.0 | 0.0 | GO:1901420 | negative regulation of response to alcohol(GO:1901420) |
| 0.0 | 1.2 | GO:0043966 | histone H3 acetylation(GO:0043966) |
| 0.0 | 0.2 | GO:0000056 | ribosomal small subunit export from nucleus(GO:0000056) |
| 0.0 | 0.1 | GO:0002949 | tRNA threonylcarbamoyladenosine modification(GO:0002949) |
| 0.0 | 0.4 | GO:0010718 | positive regulation of epithelial to mesenchymal transition(GO:0010718) |
| 0.0 | 0.2 | GO:0005981 | regulation of glycogen catabolic process(GO:0005981) |
| 0.0 | 0.2 | GO:0046697 | decidualization(GO:0046697) |
| 0.0 | 0.4 | GO:0097094 | craniofacial suture morphogenesis(GO:0097094) |
| 0.0 | 0.1 | GO:0098795 | mRNA cleavage involved in gene silencing by miRNA(GO:0035279) mRNA cleavage involved in gene silencing(GO:0098795) |
| 0.0 | 0.1 | GO:0042628 | mating plug formation(GO:0042628) post-mating behavior(GO:0045297) |
| 0.0 | 0.1 | GO:1903846 | positive regulation of transforming growth factor beta receptor signaling pathway(GO:0030511) positive regulation of cellular response to transforming growth factor beta stimulus(GO:1903846) |
| 0.0 | 0.3 | GO:0018344 | protein geranylgeranylation(GO:0018344) |
| 0.0 | 0.1 | GO:0048680 | positive regulation of axon regeneration(GO:0048680) |
| 0.0 | 0.2 | GO:0050872 | white fat cell differentiation(GO:0050872) |
| 0.0 | 0.1 | GO:1904180 | negative regulation of mitochondrial depolarization(GO:0051902) negative regulation of membrane depolarization(GO:1904180) |
| 0.0 | 0.0 | GO:0000469 | cleavage involved in rRNA processing(GO:0000469) |
| 0.0 | 0.0 | GO:0032911 | negative regulation of transforming growth factor beta1 production(GO:0032911) |
| 0.0 | 0.1 | GO:0090244 | Wnt signaling pathway involved in somitogenesis(GO:0090244) |
| 0.0 | 0.3 | GO:0003356 | regulation of cilium beat frequency(GO:0003356) |
| 0.0 | 0.4 | GO:0008053 | mitochondrial fusion(GO:0008053) |
| 0.0 | 0.0 | GO:1902075 | cellular response to salt(GO:1902075) |
| 0.0 | 0.1 | GO:0019896 | axonal transport of mitochondrion(GO:0019896) |
| 0.0 | 0.0 | GO:0010668 | ectodermal cell differentiation(GO:0010668) |
| 0.0 | 0.4 | GO:0000463 | maturation of LSU-rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000463) |
| 0.0 | 0.1 | GO:0070170 | regulation of tooth mineralization(GO:0070170) |
| 0.0 | 1.2 | GO:0098661 | inorganic anion transmembrane transport(GO:0098661) |
| 0.0 | 0.2 | GO:1901978 | positive regulation of spindle checkpoint(GO:0090232) positive regulation of cell cycle checkpoint(GO:1901978) |
| 0.0 | 0.1 | GO:0006663 | platelet activating factor biosynthetic process(GO:0006663) platelet activating factor metabolic process(GO:0046469) |
| 0.0 | 0.1 | GO:0016584 | nucleosome positioning(GO:0016584) |
| 0.0 | 0.2 | GO:0045793 | positive regulation of cell size(GO:0045793) |
| 0.0 | 0.1 | GO:0042511 | positive regulation of tyrosine phosphorylation of Stat1 protein(GO:0042511) |
| 0.0 | 0.2 | GO:0031665 | negative regulation of lipopolysaccharide-mediated signaling pathway(GO:0031665) |
| 0.0 | 0.1 | GO:0070162 | adiponectin secretion(GO:0070162) regulation of adiponectin secretion(GO:0070163) negative regulation of adiponectin secretion(GO:0070164) |
| 0.0 | 0.2 | GO:0060307 | regulation of ventricular cardiac muscle cell membrane repolarization(GO:0060307) ventricular cardiac muscle cell membrane repolarization(GO:0099625) |
| 0.0 | 0.2 | GO:0048096 | chromatin-mediated maintenance of transcription(GO:0048096) |
| 0.0 | 0.0 | GO:0010578 | regulation of adenylate cyclase activity involved in G-protein coupled receptor signaling pathway(GO:0010578) positive regulation of adenylate cyclase activity involved in G-protein coupled receptor signaling pathway(GO:0010579) |
| 0.0 | 0.2 | GO:0016556 | mRNA modification(GO:0016556) |
| 0.0 | 0.1 | GO:1904714 | regulation of chaperone-mediated autophagy(GO:1904714) |
| 0.0 | 0.0 | GO:0003415 | chondrocyte hypertrophy(GO:0003415) |
| 0.0 | 0.9 | GO:0001889 | liver development(GO:0001889) |
| 0.0 | 0.7 | GO:0032648 | regulation of interferon-beta production(GO:0032648) |
| 0.0 | 0.1 | GO:0046174 | polyol catabolic process(GO:0046174) |
| 0.0 | 0.0 | GO:0072611 | interleukin-5 secretion(GO:0072603) interleukin-13 secretion(GO:0072611) regulation of interleukin-5 secretion(GO:2000662) regulation of interleukin-13 secretion(GO:2000665) |
| 0.0 | 0.1 | GO:0060527 | prostate glandular acinus morphogenesis(GO:0060526) prostate epithelial cord arborization involved in prostate glandular acinus morphogenesis(GO:0060527) |
| 0.0 | 0.6 | GO:0031146 | SCF-dependent proteasomal ubiquitin-dependent protein catabolic process(GO:0031146) |
| 0.0 | 0.0 | GO:0030259 | lipid glycosylation(GO:0030259) |
| 0.0 | 0.7 | GO:0018345 | protein palmitoylation(GO:0018345) |
| 0.0 | 1.6 | GO:0007368 | determination of left/right symmetry(GO:0007368) |
| 0.0 | 0.1 | GO:0071941 | nitrogen cycle metabolic process(GO:0071941) |
| 0.0 | 0.5 | GO:0015985 | energy coupled proton transport, down electrochemical gradient(GO:0015985) ATP synthesis coupled proton transport(GO:0015986) |
| 0.0 | 0.1 | GO:1901662 | phylloquinone metabolic process(GO:0042374) phylloquinone catabolic process(GO:0042376) quinone catabolic process(GO:1901662) |
| 0.0 | 0.4 | GO:0030968 | endoplasmic reticulum unfolded protein response(GO:0030968) |
| 0.0 | 0.1 | GO:0070309 | lens fiber cell morphogenesis(GO:0070309) |
| 0.0 | 0.9 | GO:1903038 | negative regulation of T cell activation(GO:0050868) negative regulation of leukocyte cell-cell adhesion(GO:1903038) |
| 0.0 | 0.1 | GO:0007621 | negative regulation of female receptivity(GO:0007621) |
| 0.0 | 0.2 | GO:0051956 | negative regulation of amino acid transport(GO:0051956) |
| 0.0 | 0.0 | GO:0052055 | modulation by symbiont of host molecular function(GO:0052055) |
| 0.0 | 0.5 | GO:0097031 | NADH dehydrogenase complex assembly(GO:0010257) mitochondrial respiratory chain complex I assembly(GO:0032981) mitochondrial respiratory chain complex I biogenesis(GO:0097031) |
| 0.0 | 0.3 | GO:0045943 | positive regulation of transcription from RNA polymerase I promoter(GO:0045943) |
| 0.0 | 0.3 | GO:0043248 | proteasome assembly(GO:0043248) |
| 0.0 | 0.1 | GO:0031639 | plasminogen activation(GO:0031639) |
| 0.0 | 0.0 | GO:0001911 | negative regulation of leukocyte mediated cytotoxicity(GO:0001911) |
| 0.0 | 0.1 | GO:1904528 | regulation of microtubule binding(GO:1904526) positive regulation of microtubule binding(GO:1904528) |
| 0.0 | 0.7 | GO:0061512 | protein localization to cilium(GO:0061512) |
| 0.0 | 0.0 | GO:2000035 | regulation of stem cell division(GO:2000035) |
| 0.0 | 0.1 | GO:0006398 | mRNA 3'-end processing by stem-loop binding and cleavage(GO:0006398) |
| 0.0 | 0.1 | GO:0090385 | phagosome-lysosome fusion(GO:0090385) |
| 0.0 | 0.0 | GO:0090043 | regulation of tubulin deacetylation(GO:0090043) |
| 0.0 | 0.1 | GO:1902237 | positive regulation of endoplasmic reticulum stress-induced intrinsic apoptotic signaling pathway(GO:1902237) |
| 0.0 | 0.1 | GO:0071670 | smooth muscle cell chemotaxis(GO:0071670) |
| 0.0 | 0.1 | GO:0007398 | ectoderm development(GO:0007398) |
| 0.0 | 0.1 | GO:0034638 | phosphatidylcholine catabolic process(GO:0034638) |
| 0.0 | 0.0 | GO:0046292 | formaldehyde metabolic process(GO:0046292) |
| 0.0 | 0.0 | GO:0021578 | hindbrain maturation(GO:0021578) central nervous system maturation(GO:0021626) |
| 0.0 | 0.0 | GO:0043309 | regulation of eosinophil degranulation(GO:0043309) |
| 0.0 | 0.0 | GO:1990441 | negative regulation of transcription from RNA polymerase II promoter in response to endoplasmic reticulum stress(GO:1990441) |
| 0.0 | 0.0 | GO:0009624 | response to nematode(GO:0009624) |
| 0.0 | 0.1 | GO:0045743 | positive regulation of fibroblast growth factor receptor signaling pathway(GO:0045743) |
| 0.0 | 0.2 | GO:0007064 | mitotic sister chromatid cohesion(GO:0007064) |
| 0.0 | 0.0 | GO:0097694 | establishment of RNA localization to telomere(GO:0097694) |
| 0.0 | 0.2 | GO:0001562 | response to protozoan(GO:0001562) |
| 0.0 | 0.1 | GO:0046039 | GTP metabolic process(GO:0046039) |
| 0.0 | 0.1 | GO:0006048 | UDP-N-acetylglucosamine biosynthetic process(GO:0006048) |
| 0.0 | 0.2 | GO:0051984 | positive regulation of chromosome segregation(GO:0051984) |
| 0.0 | 0.2 | GO:0001921 | positive regulation of receptor recycling(GO:0001921) |
| 0.0 | 0.2 | GO:0043094 | cellular metabolic compound salvage(GO:0043094) |
| 0.0 | 0.1 | GO:0060931 | sinoatrial node development(GO:0003163) cardiac pacemaker cell differentiation(GO:0060920) sinoatrial node cell differentiation(GO:0060921) sinoatrial node cell development(GO:0060931) |
| 0.0 | 0.1 | GO:0051031 | tRNA transport(GO:0051031) |
| 0.0 | 0.1 | GO:0001514 | selenocysteine incorporation(GO:0001514) translational readthrough(GO:0006451) |
| 0.0 | 0.1 | GO:0042780 | tRNA 3'-end processing(GO:0042780) |
| 0.0 | 0.1 | GO:0015886 | heme transport(GO:0015886) |
| 0.0 | 0.1 | GO:0006047 | UDP-N-acetylglucosamine metabolic process(GO:0006047) |
| 0.0 | 0.1 | GO:0032000 | positive regulation of fatty acid beta-oxidation(GO:0032000) |
| 0.0 | 0.1 | GO:0060744 | thelarche(GO:0042695) mammary gland branching involved in thelarche(GO:0060744) |
| 0.0 | 0.1 | GO:0006089 | lactate metabolic process(GO:0006089) |
| 0.0 | 0.0 | GO:1900078 | positive regulation of cellular response to insulin stimulus(GO:1900078) |
| 0.0 | 0.1 | GO:0046415 | urate metabolic process(GO:0046415) |
| 0.0 | 0.3 | GO:0045948 | positive regulation of translational initiation(GO:0045948) |
| 0.0 | 1.2 | GO:0006418 | tRNA aminoacylation for protein translation(GO:0006418) |
| 0.0 | 0.1 | GO:0039702 | viral budding via host ESCRT complex(GO:0039702) |
| 0.0 | 0.0 | GO:0071504 | response to heparin(GO:0071503) cellular response to heparin(GO:0071504) |
| 0.0 | 0.0 | GO:2000630 | positive regulation of miRNA metabolic process(GO:2000630) |
| 0.0 | 0.1 | GO:0015808 | L-alanine transport(GO:0015808) |
| 0.0 | 0.1 | GO:0090214 | spongiotrophoblast layer developmental growth(GO:0090214) |
| 0.0 | 0.2 | GO:0048305 | immunoglobulin secretion(GO:0048305) |
| 0.0 | 0.1 | GO:0018343 | protein farnesylation(GO:0018343) |
| 0.0 | 0.2 | GO:0042347 | negative regulation of NF-kappaB import into nucleus(GO:0042347) |
| 0.0 | 0.1 | GO:0033387 | putrescine biosynthetic process from ornithine(GO:0033387) |
| 0.0 | 0.1 | GO:0000101 | sulfur amino acid transport(GO:0000101) |
| 0.0 | 0.0 | GO:0090074 | negative regulation of protein homodimerization activity(GO:0090074) |
| 0.0 | 0.1 | GO:0006004 | fucose metabolic process(GO:0006004) |
| 0.0 | 1.1 | GO:0045454 | cell redox homeostasis(GO:0045454) |
| 0.0 | 0.1 | GO:0009106 | lipoate metabolic process(GO:0009106) |
| 0.0 | 1.6 | GO:1903955 | positive regulation of protein targeting to mitochondrion(GO:1903955) |
| 0.0 | 0.8 | GO:0006611 | protein export from nucleus(GO:0006611) |
| 0.0 | 0.0 | GO:0048625 | myoblast fate commitment(GO:0048625) |
| 0.0 | 0.3 | GO:0033209 | tumor necrosis factor-mediated signaling pathway(GO:0033209) |
| 0.0 | 0.0 | GO:0006059 | hexitol metabolic process(GO:0006059) inner medullary collecting duct development(GO:0072061) |
| 0.0 | 0.1 | GO:0014051 | gamma-aminobutyric acid secretion(GO:0014051) |
| 0.0 | 0.0 | GO:0051344 | negative regulation of cyclic-nucleotide phosphodiesterase activity(GO:0051344) |
| 0.0 | 0.0 | GO:0048769 | sarcomerogenesis(GO:0048769) positive regulation of sarcomere organization(GO:0060298) |
| 0.0 | 0.0 | GO:0007252 | I-kappaB phosphorylation(GO:0007252) |
| 0.0 | 0.0 | GO:0060355 | positive regulation of cell adhesion molecule production(GO:0060355) |
| 0.0 | 0.1 | GO:0033630 | positive regulation of cell adhesion mediated by integrin(GO:0033630) |
| 0.0 | 0.0 | GO:0071502 | cellular response to temperature stimulus(GO:0071502) |
| 0.0 | 0.1 | GO:2000766 | negative regulation of cytoplasmic translation(GO:2000766) |
| 0.0 | 0.1 | GO:0045908 | negative regulation of vasodilation(GO:0045908) |
| 0.0 | 0.1 | GO:0072604 | interleukin-6 secretion(GO:0072604) |
| 0.0 | 1.5 | GO:0098656 | anion transmembrane transport(GO:0098656) |
| 0.0 | 0.1 | GO:0030263 | apoptotic chromosome condensation(GO:0030263) |
| 0.0 | 0.1 | GO:0060681 | branch elongation involved in ureteric bud branching(GO:0060681) |
| 0.0 | 0.9 | GO:0071391 | cellular response to estrogen stimulus(GO:0071391) |
| 0.0 | 0.1 | GO:0048696 | regulation of collateral sprouting in absence of injury(GO:0048696) |
| 0.0 | 0.1 | GO:0043117 | positive regulation of vascular permeability(GO:0043117) |
| 0.0 | 0.0 | GO:0051541 | elastin metabolic process(GO:0051541) |
| 0.0 | 0.4 | GO:1900046 | regulation of blood coagulation(GO:0030193) regulation of hemostasis(GO:1900046) |
| 0.0 | 0.1 | GO:0060126 | somatotropin secreting cell differentiation(GO:0060126) |
| 0.0 | 0.1 | GO:0043302 | positive regulation of leukocyte degranulation(GO:0043302) |
| 0.0 | 0.1 | GO:2000359 | regulation of binding of sperm to zona pellucida(GO:2000359) |
| 0.0 | 0.4 | GO:0006493 | protein O-linked glycosylation(GO:0006493) |
| 0.0 | 0.1 | GO:0030327 | prenylated protein catabolic process(GO:0030327) |
| 0.0 | 0.1 | GO:0050955 | thermoception(GO:0050955) |
| 0.0 | 0.1 | GO:2000643 | positive regulation of early endosome to late endosome transport(GO:2000643) |
| 0.0 | 0.0 | GO:0001732 | formation of cytoplasmic translation initiation complex(GO:0001732) |
| 0.0 | 0.0 | GO:0010446 | response to alkaline pH(GO:0010446) |
| 0.0 | 0.3 | GO:0043968 | histone H2A acetylation(GO:0043968) |
| 0.0 | 0.0 | GO:0032682 | negative regulation of chemokine production(GO:0032682) |
| 0.0 | 0.2 | GO:0000467 | exonucleolytic trimming involved in rRNA processing(GO:0000459) exonucleolytic trimming to generate mature 3'-end of 5.8S rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000467) |
| 0.0 | 0.5 | GO:0006446 | regulation of translational initiation(GO:0006446) |
| 0.0 | 0.3 | GO:0000470 | maturation of LSU-rRNA(GO:0000470) |
| 0.0 | 0.1 | GO:0070863 | positive regulation of protein exit from endoplasmic reticulum(GO:0070863) |
| 0.0 | 0.0 | GO:0046490 | isopentenyl diphosphate metabolic process(GO:0046490) |
| 0.0 | 0.1 | GO:2001012 | mesenchymal cell differentiation involved in kidney development(GO:0072161) mesenchymal cell differentiation involved in renal system development(GO:2001012) |
| 0.0 | 0.1 | GO:0071295 | cellular response to vitamin(GO:0071295) |
| 0.0 | 0.0 | GO:0034983 | peptidyl-lysine deacetylation(GO:0034983) |
| 0.0 | 0.6 | GO:0019373 | epoxygenase P450 pathway(GO:0019373) |
| 0.0 | 0.1 | GO:1902894 | negative regulation of pri-miRNA transcription from RNA polymerase II promoter(GO:1902894) |
| 0.0 | 0.1 | GO:0008594 | photoreceptor cell morphogenesis(GO:0008594) |
| 0.0 | 0.2 | GO:0032515 | negative regulation of phosphoprotein phosphatase activity(GO:0032515) |
| 0.0 | 0.1 | GO:0044339 | canonical Wnt signaling pathway involved in osteoblast differentiation(GO:0044339) |
| 0.0 | 0.3 | GO:0010591 | regulation of lamellipodium assembly(GO:0010591) |
| 0.0 | 0.0 | GO:0044340 | canonical Wnt signaling pathway involved in regulation of cell proliferation(GO:0044340) |
| 0.0 | 0.0 | GO:0002677 | negative regulation of chronic inflammatory response(GO:0002677) |
| 0.0 | 0.0 | GO:0001714 | endodermal cell fate specification(GO:0001714) |
| 0.0 | 0.0 | GO:0046716 | muscle cell cellular homeostasis(GO:0046716) |
| 0.0 | 0.7 | GO:0048635 | negative regulation of muscle organ development(GO:0048635) |
| 0.0 | 0.1 | GO:1902036 | regulation of hematopoietic stem cell differentiation(GO:1902036) |
| 0.0 | 0.0 | GO:0002827 | regulation of T-helper 1 type immune response(GO:0002825) positive regulation of T-helper 1 type immune response(GO:0002827) |
| 0.0 | 0.5 | GO:0000027 | ribosomal large subunit assembly(GO:0000027) |
| 0.0 | 0.2 | GO:0006826 | iron ion transport(GO:0006826) |
| 0.0 | 0.1 | GO:0006528 | asparagine metabolic process(GO:0006528) |
| 0.0 | 0.1 | GO:0016553 | base conversion or substitution editing(GO:0016553) |
| 0.0 | 0.0 | GO:2000138 | positive regulation of cell proliferation involved in heart morphogenesis(GO:2000138) |
| 0.0 | 0.3 | GO:0015909 | long-chain fatty acid transport(GO:0015909) |
| 0.0 | 0.0 | GO:0097368 | establishment of Sertoli cell barrier(GO:0097368) |
| 0.0 | 0.1 | GO:0006000 | fructose metabolic process(GO:0006000) |
| 0.0 | 0.1 | GO:0051974 | negative regulation of telomerase activity(GO:0051974) |
| 0.0 | 0.2 | GO:0001881 | receptor recycling(GO:0001881) |
| 0.0 | 0.0 | GO:0006978 | DNA damage response, signal transduction by p53 class mediator resulting in transcription of p21 class mediator(GO:0006978) |
| 0.0 | 0.2 | GO:0035999 | tetrahydrofolate interconversion(GO:0035999) |
| 0.0 | 0.0 | GO:1903541 | regulation of exosomal secretion(GO:1903541) positive regulation of exosomal secretion(GO:1903543) |
| 0.0 | 0.2 | GO:0005980 | glycogen catabolic process(GO:0005980) glucan catabolic process(GO:0009251) cellular polysaccharide catabolic process(GO:0044247) |
| 0.0 | 0.0 | GO:1901678 | iron coordination entity transport(GO:1901678) |
| 0.0 | 0.5 | GO:0006383 | transcription from RNA polymerase III promoter(GO:0006383) |
| 0.0 | 0.4 | GO:0046513 | ceramide biosynthetic process(GO:0046513) |
| 0.0 | 2.0 | GO:0042787 | protein ubiquitination involved in ubiquitin-dependent protein catabolic process(GO:0042787) |
| 0.0 | 0.5 | GO:0019369 | arachidonic acid metabolic process(GO:0019369) |
| 0.0 | 0.0 | GO:0097168 | mesenchymal stem cell proliferation(GO:0097168) |
| 0.0 | 0.5 | GO:0032233 | positive regulation of actin filament bundle assembly(GO:0032233) |
| 0.0 | 0.5 | GO:0050830 | defense response to Gram-positive bacterium(GO:0050830) |
| 0.0 | 0.1 | GO:2000651 | positive regulation of sodium ion transmembrane transporter activity(GO:2000651) |
| 0.0 | 0.1 | GO:0006817 | phosphate ion transport(GO:0006817) |
| 0.0 | 0.1 | GO:0035933 | glucocorticoid secretion(GO:0035933) regulation of glucocorticoid secretion(GO:2000849) |
| 0.0 | 0.6 | GO:0045668 | negative regulation of osteoblast differentiation(GO:0045668) |
| 0.0 | 0.0 | GO:0002238 | response to molecule of fungal origin(GO:0002238) |
| 0.0 | 0.1 | GO:0046643 | regulation of gamma-delta T cell differentiation(GO:0045586) regulation of gamma-delta T cell activation(GO:0046643) |
| 0.0 | 0.0 | GO:0001698 | gastrin-induced gastric acid secretion(GO:0001698) |
| 0.0 | 0.0 | GO:0070837 | dehydroascorbic acid transport(GO:0070837) |
| 0.0 | 0.4 | GO:0006513 | protein monoubiquitination(GO:0006513) |
| 0.0 | 0.0 | GO:0001302 | replicative cell aging(GO:0001302) |
| 0.0 | 0.0 | GO:0035963 | response to interleukin-13(GO:0035962) cellular response to interleukin-13(GO:0035963) |
| 0.0 | 0.1 | GO:0090073 | positive regulation of protein homodimerization activity(GO:0090073) |
| 0.0 | 0.7 | GO:0002181 | cytoplasmic translation(GO:0002181) |
| 0.0 | 0.0 | GO:1904431 | positive regulation of t-circle formation(GO:1904431) |
| 0.0 | 0.2 | GO:1902042 | negative regulation of extrinsic apoptotic signaling pathway via death domain receptors(GO:1902042) |
| 0.0 | 0.4 | GO:0015914 | phospholipid transport(GO:0015914) |
| 0.0 | 0.3 | GO:0030835 | negative regulation of actin filament depolymerization(GO:0030835) |
| 0.0 | 0.0 | GO:0033029 | regulation of neutrophil apoptotic process(GO:0033029) |
| 0.0 | 0.0 | GO:0010988 | regulation of low-density lipoprotein particle clearance(GO:0010988) |
| 0.0 | 0.1 | GO:0009404 | toxin metabolic process(GO:0009404) |
| 0.0 | 0.0 | GO:0070086 | ubiquitin-dependent endocytosis(GO:0070086) |
| 0.0 | 0.1 | GO:0032463 | negative regulation of protein homooligomerization(GO:0032463) |
| 0.0 | 0.0 | GO:0070236 | negative regulation of activation-induced cell death of T cells(GO:0070236) |
| 0.0 | 0.0 | GO:0048162 | preantral ovarian follicle growth(GO:0001546) multi-layer follicle stage(GO:0048162) |
| 0.0 | 0.0 | GO:0051142 | regulation of NK T cell proliferation(GO:0051140) positive regulation of NK T cell proliferation(GO:0051142) |
| 0.0 | 0.0 | GO:0001912 | positive regulation of leukocyte mediated cytotoxicity(GO:0001912) |
| 0.0 | 0.9 | GO:0031570 | DNA integrity checkpoint(GO:0031570) |
| 0.0 | 0.1 | GO:0090527 | actin filament reorganization(GO:0090527) |
| 0.0 | 0.1 | GO:0070166 | enamel mineralization(GO:0070166) |
| 0.0 | 0.1 | GO:0036465 | synaptic vesicle recycling(GO:0036465) |
| 0.0 | 0.0 | GO:0035437 | maintenance of protein localization in endoplasmic reticulum(GO:0035437) |
| 0.0 | 0.1 | GO:0006968 | cellular defense response(GO:0006968) |
| 0.0 | 0.0 | GO:0060453 | regulation of gastric acid secretion(GO:0060453) |
| 0.0 | 0.0 | GO:0090209 | negative regulation of triglyceride metabolic process(GO:0090209) |
| 0.0 | 0.0 | GO:0002314 | germinal center B cell differentiation(GO:0002314) |
| 0.0 | 0.1 | GO:0035278 | miRNA mediated inhibition of translation(GO:0035278) |
| 0.0 | 0.0 | GO:1901857 | positive regulation of cellular respiration(GO:1901857) |
| 0.0 | 0.1 | GO:0000460 | maturation of 5.8S rRNA(GO:0000460) |
| 0.0 | 0.4 | GO:0006890 | retrograde vesicle-mediated transport, Golgi to ER(GO:0006890) |
| 0.0 | 0.1 | GO:2000427 | positive regulation of apoptotic cell clearance(GO:2000427) |
| 0.0 | 0.0 | GO:0043928 | exonucleolytic nuclear-transcribed mRNA catabolic process involved in deadenylation-dependent decay(GO:0043928) |
| 0.0 | 0.4 | GO:0090662 | energy coupled proton transmembrane transport, against electrochemical gradient(GO:0015988) ATP hydrolysis coupled proton transport(GO:0015991) ATP hydrolysis coupled transmembrane transport(GO:0090662) |
| 0.0 | 0.2 | GO:0006541 | glutamine metabolic process(GO:0006541) |
| 0.0 | 0.1 | GO:0009620 | response to fungus(GO:0009620) defense response to fungus(GO:0050832) |
| 0.0 | 0.2 | GO:0010800 | positive regulation of peptidyl-threonine phosphorylation(GO:0010800) |
| 0.0 | 0.0 | GO:0097475 | motor neuron migration(GO:0097475) spinal cord motor neuron migration(GO:0097476) |
| 0.0 | 0.0 | GO:0060027 | neural plate elongation(GO:0014022) convergent extension involved in neural plate elongation(GO:0022007) convergent extension involved in gastrulation(GO:0060027) |
| 0.0 | 0.0 | GO:0006655 | phosphatidylglycerol biosynthetic process(GO:0006655) |
| 0.0 | 0.0 | GO:0042760 | very long-chain fatty acid catabolic process(GO:0042760) |
| 0.0 | 0.0 | GO:0098532 | histone H3-K27 trimethylation(GO:0098532) |
| 0.0 | 0.0 | GO:0051988 | regulation of attachment of spindle microtubules to kinetochore(GO:0051988) |
| 0.0 | 0.0 | GO:0030656 | regulation of vitamin metabolic process(GO:0030656) |
| 0.0 | 0.0 | GO:0090188 | negative regulation of pancreatic juice secretion(GO:0090188) |
| 0.0 | 0.1 | GO:0006297 | nucleotide-excision repair, DNA gap filling(GO:0006297) |
| 0.0 | 0.1 | GO:0006561 | proline biosynthetic process(GO:0006561) |
| 0.0 | 0.2 | GO:0034340 | response to type I interferon(GO:0034340) |
| 0.0 | 0.1 | GO:0050994 | regulation of lipid catabolic process(GO:0050994) |
| 0.0 | 0.0 | GO:2000508 | regulation of dendritic cell chemotaxis(GO:2000508) positive regulation of dendritic cell chemotaxis(GO:2000510) |
| 0.0 | 0.0 | GO:0070673 | response to interleukin-18(GO:0070673) |
| 0.0 | 0.1 | GO:0061045 | negative regulation of wound healing(GO:0061045) |
| 0.0 | 0.2 | GO:0098659 | inorganic cation import into cell(GO:0098659) inorganic ion import into cell(GO:0099587) |
| 0.0 | 0.3 | GO:0003009 | skeletal muscle contraction(GO:0003009) |
| 0.0 | 0.3 | GO:0002437 | inflammatory response to antigenic stimulus(GO:0002437) |
| 0.0 | 0.2 | GO:0045777 | positive regulation of blood pressure(GO:0045777) |
| 0.0 | 0.1 | GO:0017182 | peptidyl-diphthamide metabolic process(GO:0017182) peptidyl-diphthamide biosynthetic process from peptidyl-histidine(GO:0017183) |
| 0.0 | 0.0 | GO:0002281 | macrophage activation involved in immune response(GO:0002281) |
| 0.0 | 0.1 | GO:0000244 | spliceosomal tri-snRNP complex assembly(GO:0000244) |
| 0.0 | 0.2 | GO:0008211 | glucocorticoid metabolic process(GO:0008211) |
| 0.0 | 0.2 | GO:0045737 | positive regulation of cyclin-dependent protein serine/threonine kinase activity(GO:0045737) |
| 0.0 | 0.0 | GO:1904357 | negative regulation of telomere maintenance via telomere lengthening(GO:1904357) |
| 0.0 | 0.1 | GO:0046541 | saliva secretion(GO:0046541) |
| 0.0 | 0.1 | GO:0034643 | establishment of mitochondrion localization, microtubule-mediated(GO:0034643) mitochondrion transport along microtubule(GO:0047497) |
| 0.0 | 0.2 | GO:0071173 | mitotic spindle assembly checkpoint(GO:0007094) spindle assembly checkpoint(GO:0071173) |
| 0.0 | 0.0 | GO:0006505 | GPI anchor metabolic process(GO:0006505) |
| 0.0 | 1.1 | GO:0043123 | positive regulation of I-kappaB kinase/NF-kappaB signaling(GO:0043123) |
| 0.0 | 0.0 | GO:0032692 | negative regulation of interleukin-1 production(GO:0032692) |
| 0.0 | 0.1 | GO:0015820 | branched-chain amino acid transport(GO:0015803) leucine transport(GO:0015820) |
| 0.0 | 0.0 | GO:0061668 | mitochondrial ribosome assembly(GO:0061668) |
| 0.0 | 0.0 | GO:0007217 | tachykinin receptor signaling pathway(GO:0007217) |
| 0.0 | 0.0 | GO:0061589 | calcium activated phosphatidylserine scrambling(GO:0061589) |
| 0.0 | 0.1 | GO:1905145 | acetylcholine receptor signaling pathway(GO:0095500) postsynaptic signal transduction(GO:0098926) signal transduction involved in cellular response to ammonium ion(GO:1903831) response to acetylcholine(GO:1905144) cellular response to acetylcholine(GO:1905145) |
| 0.0 | 0.1 | GO:0060561 | apoptotic process involved in morphogenesis(GO:0060561) |
| 0.0 | 0.1 | GO:0006556 | S-adenosylmethionine biosynthetic process(GO:0006556) |
| 0.0 | 0.0 | GO:0002432 | granuloma formation(GO:0002432) |
| 0.0 | 0.1 | GO:0021670 | lateral ventricle development(GO:0021670) |
| 0.0 | 0.1 | GO:0071470 | cellular response to osmotic stress(GO:0071470) |
| 0.0 | 0.1 | GO:0008291 | acetylcholine metabolic process(GO:0008291) acetate ester metabolic process(GO:1900619) |
| 0.0 | 0.0 | GO:0002719 | negative regulation of cytokine production involved in immune response(GO:0002719) |
| 0.0 | 0.1 | GO:0060148 | positive regulation of posttranscriptional gene silencing(GO:0060148) |
| 0.0 | 0.0 | GO:0001957 | intramembranous ossification(GO:0001957) direct ossification(GO:0036072) |
| 0.0 | 0.0 | GO:0045060 | negative thymic T cell selection(GO:0045060) |
| 0.0 | 0.1 | GO:0042732 | D-xylose metabolic process(GO:0042732) |
| 0.0 | 0.0 | GO:0034035 | purine ribonucleoside bisphosphate metabolic process(GO:0034035) |
| 0.0 | 0.1 | GO:0071918 | urea transmembrane transport(GO:0071918) |
| 0.0 | 0.0 | GO:0000052 | citrulline metabolic process(GO:0000052) |
| 0.0 | 0.0 | GO:0032099 | negative regulation of appetite(GO:0032099) |
| 0.0 | 0.0 | GO:0002538 | arachidonic acid metabolite production involved in inflammatory response(GO:0002538) leukotriene production involved in inflammatory response(GO:0002540) |
| 0.0 | 0.0 | GO:0009957 | epidermal cell fate specification(GO:0009957) |
| 0.0 | 0.6 | GO:0030433 | ER-associated ubiquitin-dependent protein catabolic process(GO:0030433) |
| 0.0 | 0.0 | GO:0030300 | regulation of intestinal cholesterol absorption(GO:0030300) |
| 0.0 | 0.2 | GO:0033344 | cholesterol efflux(GO:0033344) |
| 0.0 | 0.2 | GO:0070207 | protein homotrimerization(GO:0070207) |
| 0.0 | 0.0 | GO:2000354 | regulation of ovarian follicle development(GO:2000354) |
| 0.0 | 0.0 | GO:0051151 | negative regulation of smooth muscle cell differentiation(GO:0051151) |
| 0.0 | 0.1 | GO:0007614 | short-term memory(GO:0007614) |
| 0.0 | 0.0 | GO:0019230 | proprioception(GO:0019230) |
| 0.0 | 0.0 | GO:0033615 | mitochondrial proton-transporting ATP synthase complex assembly(GO:0033615) |
| 0.0 | 0.2 | GO:0044705 | mating behavior(GO:0007617) multi-organism reproductive behavior(GO:0044705) |
| 0.0 | 0.0 | GO:0019401 | alditol biosynthetic process(GO:0019401) |
| 0.0 | 0.1 | GO:0071415 | cellular response to caffeine(GO:0071313) cellular response to purine-containing compound(GO:0071415) |
| 0.0 | 0.0 | GO:0035988 | chondrocyte proliferation(GO:0035988) |
| 0.0 | 0.1 | GO:0048934 | peripheral nervous system neuron differentiation(GO:0048934) peripheral nervous system neuron development(GO:0048935) |
| 0.0 | 0.0 | GO:0035928 | rRNA import into mitochondrion(GO:0035928) |
| 0.0 | 0.0 | GO:0043654 | recognition of apoptotic cell(GO:0043654) |
| 0.0 | 0.1 | GO:0035811 | negative regulation of urine volume(GO:0035811) |
| 0.0 | 0.1 | GO:2000480 | negative regulation of cAMP-dependent protein kinase activity(GO:2000480) |
| 0.0 | 0.2 | GO:0017004 | cytochrome complex assembly(GO:0017004) |
| 0.0 | 0.1 | GO:0060352 | cell adhesion molecule production(GO:0060352) |
| 0.0 | 0.0 | GO:0070268 | cornification(GO:0070268) |
| 0.0 | 0.1 | GO:0006895 | Golgi to endosome transport(GO:0006895) |
| 0.0 | 0.0 | GO:0060060 | post-embryonic retina morphogenesis in camera-type eye(GO:0060060) |
| 0.0 | 0.0 | GO:0070741 | response to interleukin-6(GO:0070741) |
| 0.0 | 0.2 | GO:0051123 | RNA polymerase II transcriptional preinitiation complex assembly(GO:0051123) |
| 0.0 | 0.0 | GO:0090208 | positive regulation of triglyceride metabolic process(GO:0090208) |
| 0.0 | 0.2 | GO:0006040 | amino sugar metabolic process(GO:0006040) |
| 0.0 | 0.1 | GO:0036344 | platelet morphogenesis(GO:0036344) |
| 0.0 | 0.1 | GO:0051131 | chaperone-mediated protein complex assembly(GO:0051131) |
| 0.0 | 0.1 | GO:0072321 | chaperone-mediated protein transport(GO:0072321) |
| 0.0 | 0.3 | GO:0032467 | positive regulation of cytokinesis(GO:0032467) |
| 0.0 | 0.0 | GO:0030730 | sequestering of triglyceride(GO:0030730) |
| 0.0 | 0.1 | GO:0016056 | rhodopsin mediated signaling pathway(GO:0016056) |
| 0.0 | 0.2 | GO:0000731 | DNA synthesis involved in DNA repair(GO:0000731) |
| 0.0 | 0.1 | GO:0033003 | regulation of mast cell activation(GO:0033003) |
| 0.0 | 0.1 | GO:0001842 | neural fold formation(GO:0001842) |
| 0.0 | 0.1 | GO:0043457 | regulation of cellular respiration(GO:0043457) |
| 0.0 | 0.1 | GO:0043567 | regulation of insulin-like growth factor receptor signaling pathway(GO:0043567) |
| 0.0 | 0.0 | GO:0071376 | response to corticotropin-releasing hormone(GO:0043435) cellular response to corticotropin-releasing hormone stimulus(GO:0071376) |
| 0.0 | 0.0 | GO:0000291 | nuclear-transcribed mRNA catabolic process, exonucleolytic(GO:0000291) |
| 0.0 | 0.0 | GO:2000191 | regulation of fatty acid transport(GO:2000191) |
| 0.0 | 0.1 | GO:0006349 | regulation of gene expression by genetic imprinting(GO:0006349) |
| 0.0 | 0.0 | GO:0045792 | negative regulation of cell size(GO:0045792) |
| 0.0 | 0.0 | GO:0090166 | Golgi disassembly(GO:0090166) |
| 0.0 | 0.0 | GO:0071816 | protein insertion into ER membrane(GO:0045048) tail-anchored membrane protein insertion into ER membrane(GO:0071816) |
| 0.0 | 0.1 | GO:0030947 | regulation of vascular endothelial growth factor receptor signaling pathway(GO:0030947) |
| 0.0 | 0.1 | GO:0006104 | succinyl-CoA metabolic process(GO:0006104) |
| 0.0 | 0.0 | GO:0030002 | cellular anion homeostasis(GO:0030002) cellular monovalent inorganic anion homeostasis(GO:0030320) |
| 0.0 | 0.0 | GO:0051798 | positive regulation of hair follicle development(GO:0051798) |
| 0.0 | 0.0 | GO:1900186 | negative regulation of clathrin-mediated endocytosis(GO:1900186) |
| 0.0 | 0.0 | GO:0045741 | positive regulation of epidermal growth factor-activated receptor activity(GO:0045741) |
| 0.0 | 0.0 | GO:0046929 | negative regulation of neurotransmitter secretion(GO:0046929) |
| 0.0 | 0.0 | GO:2000353 | positive regulation of endothelial cell apoptotic process(GO:2000353) |
| 0.0 | 0.6 | GO:0010501 | RNA secondary structure unwinding(GO:0010501) |
| 0.0 | 0.0 | GO:1902857 | positive regulation of nonmotile primary cilium assembly(GO:1902857) |
| 0.0 | 0.0 | GO:0034393 | positive regulation of smooth muscle cell apoptotic process(GO:0034393) |
| 0.0 | 0.0 | GO:0035815 | positive regulation of renal sodium excretion(GO:0035815) |
| 0.0 | 0.1 | GO:0071539 | protein localization to centrosome(GO:0071539) |
| 0.0 | 0.0 | GO:0070782 | phosphatidylserine exposure on apoptotic cell surface(GO:0070782) |
| 0.0 | 0.2 | GO:0042073 | intraciliary transport(GO:0042073) |
| 0.0 | 0.2 | GO:0045599 | negative regulation of fat cell differentiation(GO:0045599) |
| 0.0 | 0.1 | GO:0071353 | cellular response to interleukin-4(GO:0071353) |
| 0.0 | 0.0 | GO:0046598 | positive regulation of viral entry into host cell(GO:0046598) |
| 0.0 | 0.0 | GO:0044819 | mitotic G1/S transition checkpoint(GO:0044819) |
| 0.0 | 0.0 | GO:0001561 | fatty acid alpha-oxidation(GO:0001561) |
| 0.0 | 0.0 | GO:0051026 | chiasma assembly(GO:0051026) |
| 0.0 | 0.1 | GO:0033622 | integrin activation(GO:0033622) |
| 0.0 | 0.0 | GO:0007135 | meiosis II(GO:0007135) |
| 0.0 | 0.0 | GO:2000525 | regulation of T cell costimulation(GO:2000523) positive regulation of T cell costimulation(GO:2000525) |
| 0.0 | 0.0 | GO:1900029 | positive regulation of ruffle assembly(GO:1900029) |
| 0.0 | 0.1 | GO:0001779 | natural killer cell differentiation(GO:0001779) |
| 0.0 | 0.2 | GO:0042632 | cholesterol homeostasis(GO:0042632) sterol homeostasis(GO:0055092) |
| 0.0 | 0.2 | GO:0042255 | ribosome assembly(GO:0042255) |
| 0.0 | 0.0 | GO:0060669 | embryonic placenta morphogenesis(GO:0060669) |
| 0.0 | 0.0 | GO:2000108 | positive regulation of leukocyte apoptotic process(GO:2000108) |
| 0.0 | 0.2 | GO:0070193 | synaptonemal complex organization(GO:0070193) |
| 0.0 | 0.0 | GO:0072366 | regulation of cellular ketone metabolic process by positive regulation of transcription from RNA polymerase II promoter(GO:0072366) |
| 0.0 | 0.1 | GO:0007060 | male meiosis chromosome segregation(GO:0007060) |
| 0.0 | 0.2 | GO:0007271 | synaptic transmission, cholinergic(GO:0007271) |
| 0.0 | 0.2 | GO:0030261 | chromosome condensation(GO:0030261) |
| 0.0 | 0.0 | GO:1901317 | regulation of sperm motility(GO:1901317) |
| 0.0 | 0.1 | GO:1990126 | retrograde transport, endosome to plasma membrane(GO:1990126) |
| 0.0 | 0.0 | GO:2000672 | negative regulation of motor neuron apoptotic process(GO:2000672) |
| 0.0 | 0.0 | GO:0006356 | regulation of transcription from RNA polymerase I promoter(GO:0006356) |
| 0.0 | 0.1 | GO:0097428 | protein maturation by iron-sulfur cluster transfer(GO:0097428) |
| 0.0 | 0.1 | GO:0070198 | protein localization to chromosome, telomeric region(GO:0070198) |
| 0.0 | 0.2 | GO:0006730 | one-carbon metabolic process(GO:0006730) |
| 0.0 | 0.1 | GO:0070935 | 3'-UTR-mediated mRNA stabilization(GO:0070935) |
| 0.0 | 0.0 | GO:2000628 | regulation of miRNA metabolic process(GO:2000628) |
| 0.0 | 0.0 | GO:0000722 | telomere maintenance via recombination(GO:0000722) |
| 0.0 | 0.1 | GO:0001773 | myeloid dendritic cell activation(GO:0001773) |
| 0.0 | 0.0 | GO:0032927 | positive regulation of activin receptor signaling pathway(GO:0032927) |
| 0.0 | 0.1 | GO:0031297 | replication fork processing(GO:0031297) |
| 0.0 | 0.0 | GO:0090360 | platelet-derived growth factor production(GO:0090360) regulation of platelet-derived growth factor production(GO:0090361) |
| 0.0 | 0.1 | GO:2000272 | negative regulation of receptor activity(GO:2000272) |
| 0.0 | 0.0 | GO:0030388 | fructose 1,6-bisphosphate metabolic process(GO:0030388) |
| 0.0 | 0.2 | GO:0014850 | response to muscle activity(GO:0014850) |
| 0.0 | 0.7 | GO:0016579 | protein deubiquitination(GO:0016579) |
| 0.0 | 0.0 | GO:0001768 | establishment of lymphocyte polarity(GO:0001767) establishment of T cell polarity(GO:0001768) |
| 0.0 | 0.5 | GO:0032543 | mitochondrial translation(GO:0032543) |
| 0.0 | 0.0 | GO:1901724 | positive regulation of cell proliferation involved in kidney development(GO:1901724) |
| 0.0 | 0.6 | GO:0009636 | response to toxic substance(GO:0009636) |
| 0.0 | 0.1 | GO:0032793 | positive regulation of CREB transcription factor activity(GO:0032793) |
| 0.0 | 0.0 | GO:0086028 | bundle of His cell to Purkinje myocyte signaling(GO:0086028) bundle of His cell action potential(GO:0086043) |
| 0.0 | 0.0 | GO:1902410 | mitotic cytokinetic process(GO:1902410) |
| 0.0 | 0.0 | GO:0035822 | meiotic gene conversion(GO:0006311) gene conversion(GO:0035822) |
| 0.0 | 0.0 | GO:0042795 | snRNA transcription from RNA polymerase II promoter(GO:0042795) |
| 0.0 | 0.0 | GO:0046185 | aldehyde catabolic process(GO:0046185) |
| 0.0 | 0.1 | GO:0042274 | ribosomal small subunit biogenesis(GO:0042274) |
| 0.0 | 0.1 | GO:0052697 | xenobiotic glucuronidation(GO:0052697) |
| 0.0 | 0.0 | GO:0010847 | regulation of chromatin assembly(GO:0010847) |
| 0.0 | 0.0 | GO:0045838 | positive regulation of membrane potential(GO:0045838) |
| 0.0 | 0.1 | GO:0007168 | receptor guanylyl cyclase signaling pathway(GO:0007168) |
| 0.0 | 0.0 | GO:0016572 | histone phosphorylation(GO:0016572) |
| 0.0 | 0.0 | GO:0045779 | negative regulation of bone resorption(GO:0045779) |
| 0.0 | 0.0 | GO:0071378 | growth hormone receptor signaling pathway(GO:0060396) cellular response to growth hormone stimulus(GO:0071378) |
| 0.0 | 0.0 | GO:0007196 | adenylate cyclase-inhibiting G-protein coupled glutamate receptor signaling pathway(GO:0007196) |
| 0.0 | 0.2 | GO:0001522 | pseudouridine synthesis(GO:0001522) |
| 0.0 | 0.0 | GO:0006688 | glycosphingolipid biosynthetic process(GO:0006688) |
| 0.0 | 0.0 | GO:0006924 | activation-induced cell death of T cells(GO:0006924) |
| 0.0 | 0.1 | GO:0045576 | mast cell activation(GO:0045576) |
| 0.0 | 0.1 | GO:0006855 | drug transmembrane transport(GO:0006855) |
| 0.0 | 0.0 | GO:2000535 | entry of bacterium into host cell(GO:0035635) regulation of entry of bacterium into host cell(GO:2000535) |
| 0.0 | 0.0 | GO:0033058 | directional locomotion(GO:0033058) |
| 0.0 | 0.0 | GO:0072429 | response to intra-S DNA damage checkpoint signaling(GO:0072429) |
| 0.0 | 0.0 | GO:0016080 | synaptic vesicle targeting(GO:0016080) |
| 0.0 | 0.1 | GO:0043489 | RNA stabilization(GO:0043489) |
| 0.0 | 0.9 | GO:0098779 | mitophagy in response to mitochondrial depolarization(GO:0098779) response to mitochondrial depolarisation(GO:0098780) |
| 0.0 | 0.0 | GO:0048262 | determination of dorsal/ventral asymmetry(GO:0048262) determination of dorsal identity(GO:0048263) |
| 0.0 | 0.0 | GO:0016576 | histone dephosphorylation(GO:0016576) |
| 0.0 | 0.0 | GO:0032460 | negative regulation of protein oligomerization(GO:0032460) |
| 0.0 | 0.0 | GO:0032230 | positive regulation of synaptic transmission, GABAergic(GO:0032230) |
| 0.0 | 0.0 | GO:0071600 | otic vesicle formation(GO:0030916) otic vesicle morphogenesis(GO:0071600) |
| 0.0 | 0.0 | GO:0061073 | ciliary body morphogenesis(GO:0061073) |
| 0.0 | 0.0 | GO:0070900 | mitochondrial tRNA modification(GO:0070900) mitochondrial RNA modification(GO:1900864) |
| 0.0 | 0.4 | GO:0005976 | polysaccharide metabolic process(GO:0005976) |
| 0.0 | 0.0 | GO:2000105 | regulation of DNA-dependent DNA replication initiation(GO:0030174) positive regulation of DNA-dependent DNA replication(GO:2000105) |
| 0.0 | 0.0 | GO:0002923 | regulation of humoral immune response mediated by circulating immunoglobulin(GO:0002923) |
| 0.0 | 0.0 | GO:0048312 | intracellular distribution of mitochondria(GO:0048312) |
| 0.0 | 0.2 | GO:0032011 | ARF protein signal transduction(GO:0032011) regulation of ARF protein signal transduction(GO:0032012) |
| 0.0 | 0.0 | GO:0007084 | mitotic nuclear envelope reassembly(GO:0007084) |
| 0.0 | 0.0 | GO:0061046 | foregut regionalization(GO:0060423) lung field specification(GO:0060424) lung induction(GO:0060492) regulation of branching involved in lung morphogenesis(GO:0061046) positive regulation of branching involved in lung morphogenesis(GO:0061047) |
| 0.0 | 0.1 | GO:0007093 | mitotic cell cycle checkpoint(GO:0007093) |
| 0.0 | 0.0 | GO:0000733 | DNA strand renaturation(GO:0000733) |
| 0.0 | 0.0 | GO:0032525 | somite rostral/caudal axis specification(GO:0032525) |
| 0.0 | 0.0 | GO:0050869 | negative regulation of B cell activation(GO:0050869) |
| 0.0 | 0.0 | GO:0010866 | regulation of triglyceride biosynthetic process(GO:0010866) |
| 0.0 | 0.0 | GO:0060161 | positive regulation of dopamine receptor signaling pathway(GO:0060161) |
| 0.0 | 0.0 | GO:0006692 | prostanoid metabolic process(GO:0006692) prostaglandin metabolic process(GO:0006693) |
| 0.0 | 0.1 | GO:0044458 | motile cilium assembly(GO:0044458) |
| 0.0 | 0.0 | GO:0015809 | arginine transport(GO:0015809) |
| 0.0 | 0.0 | GO:1901976 | regulation of cell cycle checkpoint(GO:1901976) |
| 0.0 | 0.0 | GO:0050968 | detection of chemical stimulus involved in sensory perception of pain(GO:0050968) |
| 0.0 | 0.0 | GO:1903624 | regulation of DNA catabolic process(GO:1903624) |
| 0.0 | 0.0 | GO:0046520 | sphingoid biosynthetic process(GO:0046520) |
| 0.0 | 0.1 | GO:1904029 | regulation of cyclin-dependent protein kinase activity(GO:1904029) |
| 0.0 | 0.0 | GO:0009313 | oligosaccharide catabolic process(GO:0009313) |
| 0.0 | 0.0 | GO:0031282 | regulation of guanylate cyclase activity(GO:0031282) |
| 0.0 | 0.0 | GO:0046325 | negative regulation of glucose import(GO:0046325) |
| 0.0 | 0.0 | GO:0070920 | regulation of production of small RNA involved in gene silencing by RNA(GO:0070920) |
| 0.0 | 0.0 | GO:0007000 | nucleolus organization(GO:0007000) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.7 | 3.5 | GO:0034388 | Pwp2p-containing subcomplex of 90S preribosome(GO:0034388) |
| 0.7 | 4.7 | GO:0031464 | Cul4A-RING E3 ubiquitin ligase complex(GO:0031464) |
| 0.6 | 2.6 | GO:0000214 | tRNA-intron endonuclease complex(GO:0000214) |
| 0.6 | 3.5 | GO:0072557 | IPAF inflammasome complex(GO:0072557) |
| 0.5 | 1.5 | GO:0005944 | phosphatidylinositol 3-kinase complex, class IB(GO:0005944) |
| 0.4 | 2.2 | GO:0089701 | U2AF(GO:0089701) |
| 0.4 | 2.9 | GO:0033256 | I-kappaB/NF-kappaB complex(GO:0033256) |
| 0.4 | 6.3 | GO:0070971 | endoplasmic reticulum exit site(GO:0070971) |
| 0.4 | 1.6 | GO:0002079 | inner acrosomal membrane(GO:0002079) |
| 0.4 | 2.7 | GO:0005833 | hemoglobin complex(GO:0005833) |
| 0.3 | 2.3 | GO:0042382 | paraspeckles(GO:0042382) |
| 0.3 | 1.0 | GO:0097543 | ciliary inversin compartment(GO:0097543) |
| 0.3 | 0.6 | GO:0097418 | neurofibrillary tangle(GO:0097418) |
| 0.3 | 2.5 | GO:0071541 | eukaryotic translation initiation factor 3 complex, eIF3m(GO:0071541) |
| 0.3 | 0.6 | GO:0035867 | alphav-beta3 integrin-IGF-1-IGF1R complex(GO:0035867) |
| 0.3 | 0.9 | GO:0035061 | interchromatin granule(GO:0035061) |
| 0.3 | 0.8 | GO:0032010 | phagolysosome(GO:0032010) |
| 0.3 | 1.4 | GO:0005663 | DNA replication factor C complex(GO:0005663) |
| 0.2 | 0.7 | GO:0046691 | intracellular canaliculus(GO:0046691) |
| 0.2 | 1.7 | GO:0008290 | F-actin capping protein complex(GO:0008290) |
| 0.2 | 0.7 | GO:0097629 | extrinsic component of omegasome membrane(GO:0097629) |
| 0.2 | 3.3 | GO:0001891 | phagocytic cup(GO:0001891) |
| 0.2 | 5.2 | GO:0034364 | high-density lipoprotein particle(GO:0034364) |
| 0.2 | 1.4 | GO:0098645 | collagen type IV trimer(GO:0005587) network-forming collagen trimer(GO:0098642) collagen network(GO:0098645) basement membrane collagen trimer(GO:0098651) |
| 0.2 | 0.7 | GO:0000125 | PCAF complex(GO:0000125) |
| 0.2 | 0.9 | GO:0048787 | presynaptic active zone membrane(GO:0048787) |
| 0.2 | 0.6 | GO:0070522 | ERCC4-ERCC1 complex(GO:0070522) |
| 0.2 | 2.4 | GO:0005671 | Ada2/Gcn5/Ada3 transcription activator complex(GO:0005671) |
| 0.2 | 0.8 | GO:0032437 | cuticular plate(GO:0032437) |
| 0.2 | 1.2 | GO:0001652 | granular component(GO:0001652) |
| 0.2 | 1.0 | GO:0070688 | MLL5-L complex(GO:0070688) |
| 0.2 | 0.8 | GO:0042825 | TAP complex(GO:0042825) |
| 0.2 | 1.1 | GO:0005796 | Golgi lumen(GO:0005796) |
| 0.2 | 1.5 | GO:0042587 | glycogen granule(GO:0042587) |
| 0.2 | 1.5 | GO:0070578 | RISC-loading complex(GO:0070578) |
| 0.2 | 0.9 | GO:1990712 | HFE-transferrin receptor complex(GO:1990712) |
| 0.2 | 1.4 | GO:0034992 | microtubule organizing center attachment site(GO:0034992) LINC complex(GO:0034993) |
| 0.2 | 1.0 | GO:0070775 | H3 histone acetyltransferase complex(GO:0070775) MOZ/MORF histone acetyltransferase complex(GO:0070776) |
| 0.2 | 1.7 | GO:0031254 | uropod(GO:0001931) cell trailing edge(GO:0031254) |
| 0.2 | 0.7 | GO:0033269 | internode region of axon(GO:0033269) |
| 0.2 | 0.3 | GO:0097487 | multivesicular body, internal vesicle(GO:0097487) |
| 0.2 | 0.6 | GO:0042627 | chylomicron(GO:0042627) |
| 0.2 | 0.5 | GO:0031417 | NatC complex(GO:0031417) |
| 0.2 | 0.6 | GO:0098536 | deuterosome(GO:0098536) |
| 0.2 | 6.8 | GO:0030173 | integral component of Golgi membrane(GO:0030173) |
| 0.1 | 1.5 | GO:0031080 | nuclear pore outer ring(GO:0031080) |
| 0.1 | 2.3 | GO:0000159 | protein phosphatase type 2A complex(GO:0000159) |
| 0.1 | 0.9 | GO:0016589 | NURF complex(GO:0016589) |
| 0.1 | 0.3 | GO:0033186 | CAF-1 complex(GO:0033186) |
| 0.1 | 0.4 | GO:0045180 | basal cortex(GO:0045180) |
| 0.1 | 5.6 | GO:0008023 | transcription elongation factor complex(GO:0008023) |
| 0.1 | 1.7 | GO:0035098 | ESC/E(Z) complex(GO:0035098) |
| 0.1 | 1.2 | GO:1990909 | Wnt signalosome(GO:1990909) |
| 0.1 | 1.0 | GO:0097208 | alveolar lamellar body(GO:0097208) |
| 0.1 | 0.4 | GO:0071141 | SMAD protein complex(GO:0071141) |
| 0.1 | 1.9 | GO:0000421 | autophagosome membrane(GO:0000421) |
| 0.1 | 1.5 | GO:0098533 | ATPase dependent transmembrane transport complex(GO:0098533) |
| 0.1 | 0.4 | GO:0097504 | Gemini of coiled bodies(GO:0097504) |
| 0.1 | 0.5 | GO:0005947 | mitochondrial alpha-ketoglutarate dehydrogenase complex(GO:0005947) |
| 0.1 | 0.6 | GO:0016281 | eukaryotic translation initiation factor 4F complex(GO:0016281) |
| 0.1 | 0.9 | GO:0044327 | dendritic spine head(GO:0044327) |
| 0.1 | 1.4 | GO:0043240 | Fanconi anaemia nuclear complex(GO:0043240) |
| 0.1 | 0.6 | GO:0051233 | spindle midzone(GO:0051233) |
| 0.1 | 0.3 | GO:0005899 | insulin receptor complex(GO:0005899) |
| 0.1 | 1.3 | GO:0042581 | specific granule(GO:0042581) |
| 0.1 | 0.5 | GO:0061617 | MICOS complex(GO:0061617) |
| 0.1 | 0.4 | GO:0045298 | tubulin complex(GO:0045298) |
| 0.1 | 0.8 | GO:0044232 | organelle membrane contact site(GO:0044232) |
| 0.1 | 0.4 | GO:0070937 | CRD-mediated mRNA stability complex(GO:0070937) |
| 0.1 | 3.2 | GO:0010494 | cytoplasmic stress granule(GO:0010494) |
| 0.1 | 0.1 | GO:0005832 | chaperonin-containing T-complex(GO:0005832) |
| 0.1 | 0.6 | GO:0071986 | Ragulator complex(GO:0071986) |
| 0.1 | 0.4 | GO:0016602 | CCAAT-binding factor complex(GO:0016602) |
| 0.1 | 0.3 | GO:0005588 | collagen type V trimer(GO:0005588) |
| 0.1 | 0.5 | GO:0033093 | Weibel-Palade body(GO:0033093) |
| 0.1 | 0.3 | GO:0044611 | nuclear pore inner ring(GO:0044611) |
| 0.1 | 0.4 | GO:0032541 | cortical endoplasmic reticulum(GO:0032541) |
| 0.1 | 1.0 | GO:0044292 | dendrite terminus(GO:0044292) |
| 0.1 | 2.7 | GO:0005801 | cis-Golgi network(GO:0005801) |
| 0.1 | 0.1 | GO:0002142 | stereocilia ankle link complex(GO:0002142) |
| 0.1 | 0.3 | GO:0031466 | Cul5-RING ubiquitin ligase complex(GO:0031466) |
| 0.1 | 1.9 | GO:0005719 | nuclear euchromatin(GO:0005719) |
| 0.1 | 0.7 | GO:0033276 | transcription factor TFTC complex(GO:0033276) |
| 0.1 | 0.3 | GO:1990130 | Iml1 complex(GO:1990130) |
| 0.1 | 0.5 | GO:0030008 | TRAPP complex(GO:0030008) |
| 0.1 | 0.2 | GO:0030689 | Noc complex(GO:0030689) |
| 0.1 | 2.2 | GO:0001772 | immunological synapse(GO:0001772) |
| 0.1 | 0.9 | GO:0031616 | spindle pole centrosome(GO:0031616) |
| 0.1 | 3.3 | GO:0017053 | transcriptional repressor complex(GO:0017053) |
| 0.1 | 0.4 | GO:0031232 | extrinsic component of external side of plasma membrane(GO:0031232) |
| 0.1 | 0.8 | GO:0042405 | nuclear inclusion body(GO:0042405) |
| 0.1 | 0.6 | GO:0032584 | growth cone membrane(GO:0032584) |
| 0.1 | 0.2 | GO:0043219 | lateral loop(GO:0043219) |
| 0.1 | 0.2 | GO:1990907 | beta-catenin-TCF complex(GO:1990907) |
| 0.1 | 1.8 | GO:0000307 | cyclin-dependent protein kinase holoenzyme complex(GO:0000307) |
| 0.1 | 0.4 | GO:0045261 | mitochondrial proton-transporting ATP synthase complex, catalytic core F(1)(GO:0000275) proton-transporting ATP synthase complex, catalytic core F(1)(GO:0045261) |
| 0.1 | 0.3 | GO:0005968 | Rab-protein geranylgeranyltransferase complex(GO:0005968) |
| 0.1 | 0.4 | GO:0031094 | platelet dense tubular network(GO:0031094) |
| 0.1 | 0.1 | GO:0032127 | dense core granule membrane(GO:0032127) |
| 0.1 | 2.0 | GO:0016235 | aggresome(GO:0016235) |
| 0.1 | 0.1 | GO:1903349 | omegasome membrane(GO:1903349) |
| 0.1 | 0.6 | GO:0005861 | troponin complex(GO:0005861) |
| 0.1 | 0.4 | GO:0005828 | kinetochore microtubule(GO:0005828) |
| 0.1 | 0.9 | GO:0031528 | microvillus membrane(GO:0031528) |
| 0.1 | 0.5 | GO:0005577 | fibrinogen complex(GO:0005577) |
| 0.1 | 0.2 | GO:0031010 | ISWI-type complex(GO:0031010) |
| 0.1 | 0.3 | GO:0030478 | actin cap(GO:0030478) |
| 0.1 | 0.1 | GO:0043625 | delta DNA polymerase complex(GO:0043625) |
| 0.1 | 2.4 | GO:0000315 | organellar large ribosomal subunit(GO:0000315) mitochondrial large ribosomal subunit(GO:0005762) |
| 0.1 | 0.3 | GO:0097524 | sperm plasma membrane(GO:0097524) |
| 0.1 | 0.4 | GO:0090543 | Flemming body(GO:0090543) |
| 0.1 | 0.2 | GO:0005642 | annulate lamellae(GO:0005642) |
| 0.1 | 0.3 | GO:0032389 | MutLalpha complex(GO:0032389) |
| 0.1 | 0.1 | GO:0030313 | cell outer membrane(GO:0009279) cell envelope(GO:0030313) external encapsulating structure part(GO:0044462) |
| 0.1 | 0.1 | GO:0097427 | microtubule bundle(GO:0097427) |
| 0.1 | 3.5 | GO:0000118 | histone deacetylase complex(GO:0000118) |
| 0.1 | 0.1 | GO:0097513 | myosin II filament(GO:0097513) |
| 0.1 | 1.7 | GO:0030863 | cortical cytoskeleton(GO:0030863) |
| 0.1 | 0.4 | GO:0005852 | eukaryotic translation initiation factor 3 complex(GO:0005852) |
| 0.1 | 0.2 | GO:0030870 | Mre11 complex(GO:0030870) |
| 0.1 | 0.2 | GO:0072357 | PTW/PP1 phosphatase complex(GO:0072357) |
| 0.1 | 0.2 | GO:0034361 | very-low-density lipoprotein particle(GO:0034361) triglyceride-rich lipoprotein particle(GO:0034385) |
| 0.1 | 0.2 | GO:0016222 | procollagen-proline 4-dioxygenase complex(GO:0016222) |
| 0.1 | 2.1 | GO:0005844 | polysome(GO:0005844) |
| 0.1 | 2.4 | GO:0045095 | keratin filament(GO:0045095) |
| 0.1 | 0.3 | GO:0031315 | extrinsic component of mitochondrial outer membrane(GO:0031315) |
| 0.1 | 0.4 | GO:0042575 | DNA polymerase complex(GO:0042575) |
| 0.1 | 5.6 | GO:0031234 | extrinsic component of cytoplasmic side of plasma membrane(GO:0031234) |
| 0.1 | 0.3 | GO:0005766 | primary lysosome(GO:0005766) azurophil granule(GO:0042582) |
| 0.1 | 0.5 | GO:0045275 | mitochondrial respiratory chain complex III(GO:0005750) respiratory chain complex III(GO:0045275) |
| 0.1 | 0.3 | GO:0030688 | preribosome, small subunit precursor(GO:0030688) |
| 0.1 | 0.2 | GO:0036396 | MIS complex(GO:0036396) |
| 0.1 | 5.6 | GO:0035068 | micro-ribonucleoprotein complex(GO:0035068) |
| 0.1 | 0.8 | GO:0005721 | pericentric heterochromatin(GO:0005721) |
| 0.1 | 2.3 | GO:0042645 | nucleoid(GO:0009295) mitochondrial nucleoid(GO:0042645) |
| 0.1 | 0.5 | GO:0036157 | outer dynein arm(GO:0036157) |
| 0.1 | 1.3 | GO:0055038 | recycling endosome membrane(GO:0055038) |
| 0.1 | 0.4 | GO:0031931 | TORC1 complex(GO:0031931) |
| 0.1 | 0.3 | GO:0030896 | checkpoint clamp complex(GO:0030896) |
| 0.1 | 0.3 | GO:0005845 | mRNA cap binding complex(GO:0005845) RNA cap binding complex(GO:0034518) |
| 0.1 | 0.2 | GO:0005672 | transcription factor TFIIA complex(GO:0005672) |
| 0.1 | 1.2 | GO:0032040 | small-subunit processome(GO:0032040) |
| 0.1 | 0.1 | GO:0005785 | signal recognition particle receptor complex(GO:0005785) |
| 0.1 | 0.3 | GO:0097197 | tetraspanin-enriched microdomain(GO:0097197) |
| 0.1 | 0.8 | GO:0043196 | varicosity(GO:0043196) |
| 0.1 | 0.3 | GO:0001939 | female pronucleus(GO:0001939) |
| 0.1 | 0.1 | GO:0031332 | RISC complex(GO:0016442) RNAi effector complex(GO:0031332) |
| 0.1 | 0.5 | GO:0032593 | insulin-responsive compartment(GO:0032593) |
| 0.0 | 0.2 | GO:0070044 | synaptobrevin 2-SNAP-25-syntaxin-1a complex(GO:0070044) |
| 0.0 | 6.3 | GO:0005741 | mitochondrial outer membrane(GO:0005741) |
| 0.0 | 0.2 | GO:0048188 | Set1C/COMPASS complex(GO:0048188) |
| 0.0 | 0.5 | GO:0035327 | transcriptionally active chromatin(GO:0035327) |
| 0.0 | 0.2 | GO:0072487 | MSL complex(GO:0072487) |
| 0.0 | 1.5 | GO:0045335 | phagocytic vesicle(GO:0045335) |
| 0.0 | 0.2 | GO:0044613 | nuclear pore central transport channel(GO:0044613) |
| 0.0 | 0.1 | GO:0005745 | m-AAA complex(GO:0005745) |
| 0.0 | 0.1 | GO:0030062 | mitochondrial tricarboxylic acid cycle enzyme complex(GO:0030062) |
| 0.0 | 0.7 | GO:0030014 | CCR4-NOT complex(GO:0030014) |
| 0.0 | 0.6 | GO:0000242 | pericentriolar material(GO:0000242) |
| 0.0 | 0.4 | GO:0000791 | euchromatin(GO:0000791) |
| 0.0 | 2.2 | GO:0005881 | cytoplasmic microtubule(GO:0005881) |
| 0.0 | 1.6 | GO:0045171 | intercellular bridge(GO:0045171) |
| 0.0 | 0.6 | GO:0005665 | DNA-directed RNA polymerase II, core complex(GO:0005665) |
| 0.0 | 0.0 | GO:0034679 | integrin alpha9-beta1 complex(GO:0034679) |
| 0.0 | 0.3 | GO:1990454 | L-type voltage-gated calcium channel complex(GO:1990454) |
| 0.0 | 0.8 | GO:0032592 | integral component of mitochondrial membrane(GO:0032592) |
| 0.0 | 0.5 | GO:0032580 | Golgi cisterna membrane(GO:0032580) |
| 0.0 | 0.1 | GO:0036488 | CHOP-C/EBP complex(GO:0036488) |
| 0.0 | 0.4 | GO:0031143 | pseudopodium(GO:0031143) |
| 0.0 | 3.5 | GO:0000776 | kinetochore(GO:0000776) |
| 0.0 | 0.2 | GO:0042406 | extrinsic component of endoplasmic reticulum membrane(GO:0042406) |
| 0.0 | 0.0 | GO:0034666 | integrin alpha2-beta1 complex(GO:0034666) |
| 0.0 | 0.6 | GO:0034451 | centriolar satellite(GO:0034451) |
| 0.0 | 0.0 | GO:0035985 | senescence-associated heterochromatin focus(GO:0035985) |
| 0.0 | 0.4 | GO:0017119 | Golgi transport complex(GO:0017119) |
| 0.0 | 0.2 | GO:1990124 | messenger ribonucleoprotein complex(GO:1990124) |
| 0.0 | 0.3 | GO:0000813 | ESCRT I complex(GO:0000813) |
| 0.0 | 0.1 | GO:0070110 | ciliary neurotrophic factor receptor complex(GO:0070110) |
| 0.0 | 0.8 | GO:0005680 | anaphase-promoting complex(GO:0005680) |
| 0.0 | 0.3 | GO:0043220 | Schmidt-Lanterman incisure(GO:0043220) |
| 0.0 | 0.1 | GO:0031390 | Ctf18 RFC-like complex(GO:0031390) |
| 0.0 | 0.2 | GO:0000812 | Swr1 complex(GO:0000812) |
| 0.0 | 0.4 | GO:0033178 | proton-transporting two-sector ATPase complex, catalytic domain(GO:0033178) |
| 0.0 | 0.5 | GO:0080008 | Cul4-RING E3 ubiquitin ligase complex(GO:0080008) |
| 0.0 | 0.2 | GO:0008541 | proteasome regulatory particle, lid subcomplex(GO:0008541) |
| 0.0 | 0.1 | GO:0097058 | CRLF-CLCF1 complex(GO:0097058) |
| 0.0 | 0.1 | GO:0097512 | cardiac myofibril(GO:0097512) |
| 0.0 | 0.2 | GO:0033063 | Rad51B-Rad51C-Rad51D-XRCC2 complex(GO:0033063) |
| 0.0 | 0.3 | GO:0005753 | mitochondrial proton-transporting ATP synthase complex(GO:0005753) |
| 0.0 | 0.0 | GO:0005712 | chiasma(GO:0005712) |
| 0.0 | 0.1 | GO:0048179 | activin receptor complex(GO:0048179) |
| 0.0 | 0.1 | GO:0097452 | GAIT complex(GO:0097452) |
| 0.0 | 0.0 | GO:0044614 | nuclear pore cytoplasmic filaments(GO:0044614) |
| 0.0 | 0.1 | GO:0072559 | NLRP3 inflammasome complex(GO:0072559) |
| 0.0 | 0.3 | GO:0048500 | signal recognition particle, endoplasmic reticulum targeting(GO:0005786) signal recognition particle(GO:0048500) |
| 0.0 | 0.2 | GO:0000801 | central element(GO:0000801) |
| 0.0 | 0.7 | GO:0030140 | trans-Golgi network transport vesicle(GO:0030140) |
| 0.0 | 0.4 | GO:0008540 | proteasome regulatory particle, base subcomplex(GO:0008540) |
| 0.0 | 0.1 | GO:0030312 | external encapsulating structure(GO:0030312) |
| 0.0 | 0.2 | GO:0016461 | unconventional myosin complex(GO:0016461) |
| 0.0 | 0.1 | GO:0005955 | calcineurin complex(GO:0005955) |
| 0.0 | 0.0 | GO:0000938 | GARP complex(GO:0000938) |
| 0.0 | 0.1 | GO:1990357 | terminal web(GO:1990357) |
| 0.0 | 0.2 | GO:0005883 | neurofilament(GO:0005883) |
| 0.0 | 0.2 | GO:0000127 | transcription factor TFIIIC complex(GO:0000127) |
| 0.0 | 0.2 | GO:0005964 | phosphorylase kinase complex(GO:0005964) |
| 0.0 | 0.4 | GO:0009925 | basal plasma membrane(GO:0009925) |
| 0.0 | 0.1 | GO:0034098 | VCP-NPL4-UFD1 AAA ATPase complex(GO:0034098) |
| 0.0 | 0.1 | GO:0036449 | microtubule minus-end(GO:0036449) |
| 0.0 | 0.2 | GO:0097470 | ribbon synapse(GO:0097470) |
| 0.0 | 0.1 | GO:0033596 | TSC1-TSC2 complex(GO:0033596) |
| 0.0 | 1.6 | GO:0005811 | lipid particle(GO:0005811) |
| 0.0 | 0.3 | GO:0043020 | NADPH oxidase complex(GO:0043020) |
| 0.0 | 0.1 | GO:0031467 | Cul7-RING ubiquitin ligase complex(GO:0031467) |
| 0.0 | 0.1 | GO:0033061 | DNA recombinase mediator complex(GO:0033061) |
| 0.0 | 0.4 | GO:0036038 | MKS complex(GO:0036038) |
| 0.0 | 0.0 | GO:0020016 | ciliary pocket(GO:0020016) ciliary pocket membrane(GO:0020018) |
| 0.0 | 0.2 | GO:0033503 | HULC complex(GO:0033503) |
| 0.0 | 0.2 | GO:0071546 | pi-body(GO:0071546) |
| 0.0 | 0.1 | GO:0000220 | vacuolar proton-transporting V-type ATPase, V0 domain(GO:0000220) |
| 0.0 | 1.0 | GO:0000123 | histone acetyltransferase complex(GO:0000123) |
| 0.0 | 0.3 | GO:0035869 | ciliary transition zone(GO:0035869) |
| 0.0 | 0.1 | GO:0034663 | endoplasmic reticulum chaperone complex(GO:0034663) |
| 0.0 | 0.3 | GO:0005868 | cytoplasmic dynein complex(GO:0005868) |
| 0.0 | 0.6 | GO:0005771 | multivesicular body(GO:0005771) |
| 0.0 | 0.3 | GO:0030663 | COPI-coated vesicle membrane(GO:0030663) |
| 0.0 | 0.3 | GO:0031588 | nucleotide-activated protein kinase complex(GO:0031588) |
| 0.0 | 0.3 | GO:0036156 | inner dynein arm(GO:0036156) |
| 0.0 | 0.3 | GO:0035102 | PRC1 complex(GO:0035102) |
| 0.0 | 0.5 | GO:0005892 | acetylcholine-gated channel complex(GO:0005892) |
| 0.0 | 0.2 | GO:0031415 | NatA complex(GO:0031415) |
| 0.0 | 0.1 | GO:0005683 | U7 snRNP(GO:0005683) |
| 0.0 | 1.6 | GO:0031463 | Cul3-RING ubiquitin ligase complex(GO:0031463) |
| 0.0 | 0.1 | GO:0000408 | EKC/KEOPS complex(GO:0000408) |
| 0.0 | 3.1 | GO:0005802 | trans-Golgi network(GO:0005802) |
| 0.0 | 0.3 | GO:0000974 | Prp19 complex(GO:0000974) |
| 0.0 | 0.3 | GO:0002199 | zona pellucida receptor complex(GO:0002199) |
| 0.0 | 0.5 | GO:0016328 | lateral plasma membrane(GO:0016328) |
| 0.0 | 0.0 | GO:0030485 | smooth muscle contractile fiber(GO:0030485) |
| 0.0 | 1.2 | GO:0019005 | SCF ubiquitin ligase complex(GO:0019005) |
| 0.0 | 0.9 | GO:0016592 | mediator complex(GO:0016592) |
| 0.0 | 0.1 | GO:0036128 | CatSper complex(GO:0036128) |
| 0.0 | 0.1 | GO:0005853 | eukaryotic translation elongation factor 1 complex(GO:0005853) |
| 0.0 | 1.5 | GO:1990204 | oxidoreductase complex(GO:1990204) |
| 0.0 | 1.2 | GO:0031526 | brush border membrane(GO:0031526) |
| 0.0 | 0.1 | GO:0030289 | protein phosphatase 4 complex(GO:0030289) |
| 0.0 | 0.2 | GO:0000782 | telomere cap complex(GO:0000782) nuclear telomere cap complex(GO:0000783) |
| 0.0 | 0.6 | GO:0000795 | synaptonemal complex(GO:0000795) |
| 0.0 | 3.0 | GO:0005759 | mitochondrial matrix(GO:0005759) |
| 0.0 | 0.5 | GO:0032391 | photoreceptor connecting cilium(GO:0032391) |
| 0.0 | 0.2 | GO:0097539 | ciliary transition fiber(GO:0097539) |
| 0.0 | 1.1 | GO:0034707 | chloride channel complex(GO:0034707) |
| 0.0 | 0.1 | GO:0000120 | RNA polymerase I transcription factor complex(GO:0000120) |
| 0.0 | 0.0 | GO:0097025 | MPP7-DLG1-LIN7 complex(GO:0097025) |
| 0.0 | 0.9 | GO:0005643 | nuclear pore(GO:0005643) |
| 0.0 | 1.2 | GO:0005814 | centriole(GO:0005814) |
| 0.0 | 0.2 | GO:0031011 | Ino80 complex(GO:0031011) INO80-type complex(GO:0097346) |
| 0.0 | 0.1 | GO:1990316 | ATG1/ULK1 kinase complex(GO:1990316) |
| 0.0 | 0.7 | GO:0015935 | small ribosomal subunit(GO:0015935) cytosolic small ribosomal subunit(GO:0022627) |
| 0.0 | 0.4 | GO:0005793 | endoplasmic reticulum-Golgi intermediate compartment(GO:0005793) |
| 0.0 | 0.1 | GO:0030915 | Smc5-Smc6 complex(GO:0030915) |
| 0.0 | 0.3 | GO:0030496 | midbody(GO:0030496) |
| 0.0 | 0.2 | GO:0016471 | vacuolar proton-transporting V-type ATPase complex(GO:0016471) |
| 0.0 | 0.0 | GO:0033588 | Elongator holoenzyme complex(GO:0033588) |
| 0.0 | 0.0 | GO:0005952 | cAMP-dependent protein kinase complex(GO:0005952) |
| 0.0 | 0.1 | GO:0070695 | FHF complex(GO:0070695) |
| 0.0 | 3.7 | GO:0005764 | lytic vacuole(GO:0000323) lysosome(GO:0005764) |
| 0.0 | 0.2 | GO:0000506 | glycosylphosphatidylinositol-N-acetylglucosaminyltransferase (GPI-GnT) complex(GO:0000506) |
| 0.0 | 0.6 | GO:0032587 | ruffle membrane(GO:0032587) |
| 0.0 | 0.1 | GO:0044299 | C-fiber(GO:0044299) |
| 0.0 | 0.2 | GO:0008305 | integrin complex(GO:0008305) |
| 0.0 | 0.0 | GO:1990923 | PET complex(GO:1990923) |
| 0.0 | 1.3 | GO:0022625 | cytosolic large ribosomal subunit(GO:0022625) |
| 0.0 | 0.1 | GO:0005914 | spot adherens junction(GO:0005914) |
| 0.0 | 0.0 | GO:0044354 | pinosome(GO:0044352) macropinosome(GO:0044354) |
| 0.0 | 0.1 | GO:0017071 | intracellular cyclic nucleotide activated cation channel complex(GO:0017071) |
| 0.0 | 4.3 | GO:0005743 | mitochondrial inner membrane(GO:0005743) |
| 0.0 | 0.2 | GO:0005583 | fibrillar collagen trimer(GO:0005583) banded collagen fibril(GO:0098643) |
| 0.0 | 0.2 | GO:0035631 | CD40 receptor complex(GO:0035631) |
| 0.0 | 0.0 | GO:0016939 | kinesin II complex(GO:0016939) |
| 0.0 | 0.1 | GO:0031091 | platelet alpha granule(GO:0031091) |
| 0.0 | 0.1 | GO:0005638 | lamin filament(GO:0005638) |
| 0.0 | 1.0 | GO:0036126 | sperm flagellum(GO:0036126) |
| 0.0 | 0.3 | GO:0030687 | preribosome, large subunit precursor(GO:0030687) |
| 0.0 | 0.0 | GO:0071437 | invadopodium(GO:0071437) |
| 0.0 | 0.1 | GO:0071439 | clathrin complex(GO:0071439) |
| 0.0 | 0.1 | GO:0036513 | Derlin-1 retrotranslocation complex(GO:0036513) |
| 0.0 | 0.0 | GO:0097443 | sorting endosome(GO:0097443) |
| 0.0 | 0.6 | GO:0036064 | ciliary basal body(GO:0036064) |
| 0.0 | 0.1 | GO:0070652 | HAUS complex(GO:0070652) |
| 0.0 | 0.1 | GO:0097342 | ripoptosome(GO:0097342) |
| 0.0 | 0.4 | GO:0005913 | cell-cell adherens junction(GO:0005913) |
| 0.0 | 0.1 | GO:0005669 | transcription factor TFIID complex(GO:0005669) |
| 0.0 | 0.1 | GO:0097431 | mitotic spindle pole(GO:0097431) |
| 0.0 | 0.0 | GO:0033162 | melanosome membrane(GO:0033162) chitosome(GO:0045009) |
| 0.0 | 0.0 | GO:0022626 | cytosolic ribosome(GO:0022626) |
| 0.0 | 0.1 | GO:0008385 | IkappaB kinase complex(GO:0008385) |
| 0.0 | 0.1 | GO:0070852 | cell body fiber(GO:0070852) |
| 0.0 | 0.4 | GO:0005788 | endoplasmic reticulum lumen(GO:0005788) |
| 0.0 | 0.0 | GO:0031074 | nucleocytoplasmic shuttling complex(GO:0031074) |
| 0.0 | 0.0 | GO:0072379 | BAT3 complex(GO:0071818) ER membrane insertion complex(GO:0072379) |
| 0.0 | 0.2 | GO:0044453 | integral component of nuclear inner membrane(GO:0005639) intrinsic component of nuclear inner membrane(GO:0031229) nuclear membrane part(GO:0044453) |
| 0.0 | 0.6 | GO:0016605 | PML body(GO:0016605) |
| 0.0 | 0.0 | GO:0016533 | cyclin-dependent protein kinase 5 holoenzyme complex(GO:0016533) |
| 0.0 | 0.2 | GO:0008287 | protein serine/threonine phosphatase complex(GO:0008287) phosphatase complex(GO:1903293) |
| 0.0 | 0.0 | GO:0097057 | TRAF2-GSTP1 complex(GO:0097057) |
| 0.0 | 0.1 | GO:0031502 | dolichyl-phosphate-mannose-protein mannosyltransferase complex(GO:0031502) |
| 0.0 | 0.1 | GO:0005641 | nuclear envelope lumen(GO:0005641) |
| 0.0 | 0.0 | GO:0031092 | platelet alpha granule membrane(GO:0031092) |
| 0.0 | 0.1 | GO:0035253 | ciliary rootlet(GO:0035253) |
| 0.0 | 0.3 | GO:0005839 | proteasome core complex(GO:0005839) |
| 0.0 | 0.0 | GO:0005652 | nuclear lamina(GO:0005652) |
| 0.0 | 2.4 | GO:0009897 | external side of plasma membrane(GO:0009897) |
| 0.0 | 0.0 | GO:0030891 | VCB complex(GO:0030891) |
| 0.0 | 1.1 | GO:0010008 | endosome membrane(GO:0010008) |
| 0.0 | 0.0 | GO:0090576 | RNA polymerase III transcription factor complex(GO:0090576) |
| 0.0 | 0.0 | GO:0033185 | dolichol-phosphate-mannose synthase complex(GO:0033185) |
| 0.0 | 0.1 | GO:0008074 | guanylate cyclase complex, soluble(GO:0008074) |
| 0.0 | 1.5 | GO:0030141 | secretory granule(GO:0030141) |
| 0.0 | 0.0 | GO:0019815 | B cell receptor complex(GO:0019815) |
| 0.0 | 0.4 | GO:0005791 | rough endoplasmic reticulum(GO:0005791) |
| 0.0 | 0.6 | GO:0005903 | brush border(GO:0005903) |
| 0.0 | 1.2 | GO:0030176 | integral component of endoplasmic reticulum membrane(GO:0030176) |
| 0.0 | 0.1 | GO:0030660 | Golgi-associated vesicle membrane(GO:0030660) |
| 0.0 | 0.2 | GO:0031966 | mitochondrial membrane(GO:0031966) |
| 0.0 | 0.1 | GO:0032983 | kainate selective glutamate receptor complex(GO:0032983) |
| 0.0 | 0.3 | GO:0000793 | condensed chromosome(GO:0000793) |
| 0.0 | 0.3 | GO:0015030 | Cajal body(GO:0015030) |
| 0.0 | 0.1 | GO:0065010 | extracellular membrane-bounded organelle(GO:0065010) |
| 0.0 | 0.4 | GO:0016591 | DNA-directed RNA polymerase II, holoenzyme(GO:0016591) |
| 0.0 | 24.1 | GO:1903561 | extracellular vesicle(GO:1903561) |
| 0.0 | 0.1 | GO:0016327 | apicolateral plasma membrane(GO:0016327) |
| 0.0 | 0.1 | GO:0031301 | integral component of organelle membrane(GO:0031301) |
| 0.0 | 0.0 | GO:0070938 | contractile ring(GO:0070938) |
| 0.0 | 0.0 | GO:0048476 | Holliday junction resolvase complex(GO:0048476) |
| 0.0 | 0.1 | GO:0005688 | U6 snRNP(GO:0005688) |
| 0.0 | 0.0 | GO:0042589 | zymogen granule membrane(GO:0042589) |
| 0.0 | 0.0 | GO:0031501 | mannosyltransferase complex(GO:0031501) |
| 0.0 | 0.1 | GO:0000176 | nuclear exosome (RNase complex)(GO:0000176) |
| 0.0 | 0.0 | GO:0044300 | cerebellar mossy fiber(GO:0044300) |
| 0.0 | 0.1 | GO:0005859 | muscle myosin complex(GO:0005859) |
| 0.0 | 0.8 | GO:0005777 | peroxisome(GO:0005777) microbody(GO:0042579) |
| 0.0 | 0.0 | GO:0034464 | BBSome(GO:0034464) |
| 0.0 | 0.0 | GO:0000322 | storage vacuole(GO:0000322) |
| 0.0 | 0.0 | GO:0045120 | pronucleus(GO:0045120) |
| 0.0 | 0.0 | GO:0042583 | chromaffin granule(GO:0042583) |
| 0.0 | 0.0 | GO:0045259 | proton-transporting ATP synthase complex(GO:0045259) |
| 0.0 | 6.6 | GO:0005829 | cytosol(GO:0005829) |
| 0.0 | 0.0 | GO:0070939 | Dsl1p complex(GO:0070939) |
| 0.0 | 0.0 | GO:0089717 | spanning component of plasma membrane(GO:0044214) spanning component of membrane(GO:0089717) |
| 0.0 | 0.0 | GO:0097648 | G-protein coupled receptor dimeric complex(GO:0038037) G-protein coupled receptor complex(GO:0097648) |
| 0.0 | 1.5 | GO:0005813 | centrosome(GO:0005813) |
| 0.0 | 0.1 | GO:0019897 | extrinsic component of plasma membrane(GO:0019897) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.6 | 2.5 | GO:0008853 | exodeoxyribonuclease III activity(GO:0008853) |
| 0.6 | 1.9 | GO:0047045 | testosterone 17-beta-dehydrogenase (NADP+) activity(GO:0047045) |
| 0.6 | 1.9 | GO:0046573 | lactonohydrolase activity(GO:0046573) acyl-L-homoserine-lactone lactonohydrolase activity(GO:0102007) |
| 0.6 | 4.1 | GO:0003836 | beta-galactoside (CMP) alpha-2,3-sialyltransferase activity(GO:0003836) |
| 0.5 | 2.1 | GO:0031721 | hemoglobin alpha binding(GO:0031721) |
| 0.5 | 2.1 | GO:0030628 | pre-mRNA 3'-splice site binding(GO:0030628) |
| 0.5 | 2.6 | GO:0004468 | lysine N-acetyltransferase activity, acting on acetyl phosphate as donor(GO:0004468) |
| 0.5 | 2.5 | GO:0017169 | CDP-alcohol phosphatidyltransferase activity(GO:0017169) |
| 0.5 | 3.2 | GO:0019966 | interleukin-1 binding(GO:0019966) |
| 0.4 | 1.8 | GO:0000213 | tRNA-intron endonuclease activity(GO:0000213) |
| 0.4 | 1.7 | GO:0004792 | thiosulfate sulfurtransferase activity(GO:0004792) |
| 0.4 | 1.2 | GO:0000309 | nicotinamide-nucleotide adenylyltransferase activity(GO:0000309) nicotinate-nucleotide adenylyltransferase activity(GO:0004515) |
| 0.4 | 1.6 | GO:0000340 | RNA 7-methylguanosine cap binding(GO:0000340) |
| 0.4 | 1.2 | GO:0019862 | IgA binding(GO:0019862) |
| 0.3 | 1.0 | GO:0001069 | regulatory region RNA binding(GO:0001069) |
| 0.3 | 1.0 | GO:0052658 | inositol-1,4,5-trisphosphate 5-phosphatase activity(GO:0052658) |
| 0.3 | 1.0 | GO:0001075 | transcription factor activity, RNA polymerase II core promoter sequence-specific binding involved in preinitiation complex assembly(GO:0001075) |
| 0.3 | 2.3 | GO:0016714 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, reduced pteridine as one donor, and incorporation of one atom of oxygen(GO:0016714) |
| 0.3 | 1.0 | GO:0051733 | ATP-dependent polydeoxyribonucleotide 5'-hydroxyl-kinase activity(GO:0046404) polydeoxyribonucleotide kinase activity(GO:0051733) |
| 0.3 | 1.3 | GO:0004062 | aryl sulfotransferase activity(GO:0004062) |
| 0.3 | 0.9 | GO:0070653 | high-density lipoprotein particle receptor binding(GO:0070653) |
| 0.3 | 1.2 | GO:0002060 | purine nucleobase binding(GO:0002060) |
| 0.3 | 0.9 | GO:0010314 | phosphatidylinositol-5-phosphate binding(GO:0010314) |
| 0.3 | 1.5 | GO:0046934 | phosphatidylinositol-4,5-bisphosphate 3-kinase activity(GO:0046934) |
| 0.3 | 0.8 | GO:0003829 | beta-1,3-galactosyl-O-glycosyl-glycoprotein beta-1,6-N-acetylglucosaminyltransferase activity(GO:0003829) |
| 0.3 | 2.2 | GO:0030346 | protein phosphatase 2B binding(GO:0030346) |
| 0.3 | 0.8 | GO:0070573 | metallodipeptidase activity(GO:0070573) |
| 0.3 | 0.8 | GO:0038181 | bile acid receptor activity(GO:0038181) |
| 0.3 | 1.9 | GO:0032552 | deoxyribonucleotide binding(GO:0032552) |
| 0.3 | 3.6 | GO:0005521 | lamin binding(GO:0005521) |
| 0.3 | 0.8 | GO:0046979 | TAP1 binding(GO:0046978) TAP2 binding(GO:0046979) |
| 0.3 | 0.8 | GO:1901612 | cardiolipin binding(GO:1901612) |
| 0.3 | 1.8 | GO:0043140 | ATP-dependent 3'-5' DNA helicase activity(GO:0043140) |
| 0.2 | 0.5 | GO:0048030 | disaccharide binding(GO:0048030) |
| 0.2 | 0.7 | GO:0004366 | glycerol-3-phosphate O-acyltransferase activity(GO:0004366) |
| 0.2 | 0.7 | GO:0047192 | 1-alkylglycerophosphocholine O-acetyltransferase activity(GO:0047192) |
| 0.2 | 0.9 | GO:0051022 | Rho GDP-dissociation inhibitor binding(GO:0051022) |
| 0.2 | 1.4 | GO:0005225 | volume-sensitive anion channel activity(GO:0005225) |
| 0.2 | 1.4 | GO:0005381 | iron ion transmembrane transporter activity(GO:0005381) |
| 0.2 | 1.5 | GO:0016308 | 1-phosphatidylinositol-4-phosphate 5-kinase activity(GO:0016308) |
| 0.2 | 0.6 | GO:0047756 | chondroitin 4-sulfotransferase activity(GO:0047756) |
| 0.2 | 0.6 | GO:0042284 | sphingolipid delta-4 desaturase activity(GO:0042284) |
| 0.2 | 0.6 | GO:0004359 | glutaminase activity(GO:0004359) |
| 0.2 | 0.6 | GO:0015563 | uptake transmembrane transporter activity(GO:0015563) |
| 0.2 | 0.8 | GO:0022833 | mechanically-gated ion channel activity(GO:0008381) mechanically gated channel activity(GO:0022833) |
| 0.2 | 0.8 | GO:0008532 | N-acetyllactosaminide beta-1,3-N-acetylglucosaminyltransferase activity(GO:0008532) |
| 0.2 | 1.4 | GO:0005384 | manganese ion transmembrane transporter activity(GO:0005384) |
| 0.2 | 1.0 | GO:1990239 | steroid hormone binding(GO:1990239) |
| 0.2 | 1.0 | GO:0015165 | pyrimidine nucleotide-sugar transmembrane transporter activity(GO:0015165) |
| 0.2 | 1.3 | GO:0019957 | C-C chemokine binding(GO:0019957) |
| 0.2 | 0.8 | GO:0070878 | primary miRNA binding(GO:0070878) |
| 0.2 | 1.7 | GO:0003689 | DNA clamp loader activity(GO:0003689) protein-DNA loading ATPase activity(GO:0033170) |
| 0.2 | 0.7 | GO:0042731 | PH domain binding(GO:0042731) |
| 0.2 | 2.4 | GO:0008432 | JUN kinase binding(GO:0008432) |
| 0.2 | 0.2 | GO:0019912 | cyclin-dependent protein kinase activating kinase activity(GO:0019912) |
| 0.2 | 1.6 | GO:0042500 | aspartic endopeptidase activity, intramembrane cleaving(GO:0042500) |
| 0.2 | 0.5 | GO:0004427 | inorganic diphosphatase activity(GO:0004427) |
| 0.2 | 2.4 | GO:0031210 | phosphatidylcholine binding(GO:0031210) |
| 0.2 | 0.5 | GO:0031802 | type 5 metabotropic glutamate receptor binding(GO:0031802) |
| 0.2 | 1.7 | GO:0005041 | low-density lipoprotein receptor activity(GO:0005041) |
| 0.2 | 0.7 | GO:0015038 | glutathione disulfide oxidoreductase activity(GO:0015038) |
| 0.2 | 0.7 | GO:0004305 | ethanolamine kinase activity(GO:0004305) |
| 0.2 | 0.5 | GO:1990460 | leptin receptor binding(GO:1990460) |
| 0.2 | 0.5 | GO:0005087 | Ran guanyl-nucleotide exchange factor activity(GO:0005087) |
| 0.2 | 0.8 | GO:0004726 | non-membrane spanning protein tyrosine phosphatase activity(GO:0004726) |
| 0.2 | 0.6 | GO:0004095 | carnitine O-palmitoyltransferase activity(GO:0004095) |
| 0.2 | 0.6 | GO:0005329 | dopamine transmembrane transporter activity(GO:0005329) |
| 0.2 | 0.5 | GO:0004069 | L-aspartate:2-oxoglutarate aminotransferase activity(GO:0004069) |
| 0.2 | 1.1 | GO:0030957 | Tat protein binding(GO:0030957) |
| 0.2 | 0.6 | GO:0003873 | 6-phosphofructo-2-kinase activity(GO:0003873) |
| 0.2 | 1.2 | GO:0102391 | decanoate--CoA ligase activity(GO:0102391) |
| 0.2 | 0.3 | GO:1990825 | sequence-specific mRNA binding(GO:1990825) |
| 0.2 | 0.6 | GO:0004566 | beta-glucuronidase activity(GO:0004566) |
| 0.2 | 1.4 | GO:0016857 | racemase and epimerase activity, acting on carbohydrates and derivatives(GO:0016857) |
| 0.2 | 1.1 | GO:0035197 | siRNA binding(GO:0035197) |
| 0.1 | 0.6 | GO:0004849 | uridine kinase activity(GO:0004849) |
| 0.1 | 0.7 | GO:0016936 | galactoside binding(GO:0016936) |
| 0.1 | 0.4 | GO:0043533 | inositol 1,3,4,5 tetrakisphosphate binding(GO:0043533) |
| 0.1 | 0.4 | GO:0001025 | RNA polymerase III transcription factor binding(GO:0001025) |
| 0.1 | 0.6 | GO:0004090 | carbonyl reductase (NADPH) activity(GO:0004090) |
| 0.1 | 1.2 | GO:0043560 | insulin receptor substrate binding(GO:0043560) |
| 0.1 | 1.0 | GO:0019203 | carbohydrate phosphatase activity(GO:0019203) |
| 0.1 | 0.6 | GO:0033142 | progesterone receptor binding(GO:0033142) |
| 0.1 | 1.3 | GO:0043008 | ATP-dependent protein binding(GO:0043008) |
| 0.1 | 0.3 | GO:0031720 | haptoglobin binding(GO:0031720) |
| 0.1 | 0.3 | GO:0051525 | NFAT protein binding(GO:0051525) |
| 0.1 | 0.6 | GO:0004127 | cytidylate kinase activity(GO:0004127) |
| 0.1 | 1.7 | GO:0032041 | histone deacetylase activity (H3-K14 specific)(GO:0031078) NAD-dependent histone deacetylase activity (H3-K14 specific)(GO:0032041) |
| 0.1 | 0.4 | GO:0019002 | GMP binding(GO:0019002) |
| 0.1 | 1.8 | GO:0030676 | Rac guanyl-nucleotide exchange factor activity(GO:0030676) |
| 0.1 | 0.7 | GO:0008467 | [heparan sulfate]-glucosamine 3-sulfotransferase 1 activity(GO:0008467) |
| 0.1 | 2.3 | GO:0017128 | phospholipid scramblase activity(GO:0017128) |
| 0.1 | 2.1 | GO:0034571 | protein-N-terminal asparagine amidohydrolase activity(GO:0008418) UDP-3-O-[3-hydroxymyristoyl] N-acetylglucosamine deacetylase activity(GO:0008759) iprodione amidohydrolase activity(GO:0018748) (3,5-dichlorophenylurea)acetate amidohydrolase activity(GO:0018749) 4'-(2-hydroxyisopropyl)phenylurea amidohydrolase activity(GO:0034571) didemethylisoproturon amidohydrolase activity(GO:0034573) N-isopropylacetanilide amidohydrolase activity(GO:0034576) N-cyclohexylformamide amidohydrolase activity(GO:0034781) isonicotinic acid hydrazide hydrolase activity(GO:0034876) cis-aconitamide amidase activity(GO:0034882) gamma-N-formylaminovinylacetate hydrolase activity(GO:0034885) N2-acetyl-L-lysine deacetylase activity(GO:0043747) O-succinylbenzoate synthase activity(GO:0043748) indoleacetamide hydrolase activity(GO:0043864) N-acetylcitrulline deacetylase activity(GO:0043909) N-acetylgalactosamine-6-phosphate deacetylase activity(GO:0047419) diacetylchitobiose deacetylase activity(GO:0052773) chitooligosaccharide deacetylase activity(GO:0052790) |
| 0.1 | 3.5 | GO:0030515 | snoRNA binding(GO:0030515) |
| 0.1 | 0.6 | GO:0055056 | D-glucose transmembrane transporter activity(GO:0055056) |
| 0.1 | 0.6 | GO:0043842 | Kdo transferase activity(GO:0043842) |
| 0.1 | 0.7 | GO:1990380 | Lys48-specific deubiquitinase activity(GO:1990380) |
| 0.1 | 1.6 | GO:0008301 | DNA binding, bending(GO:0008301) |
| 0.1 | 0.4 | GO:0004924 | oncostatin-M receptor activity(GO:0004924) |
| 0.1 | 0.5 | GO:0019145 | aminobutyraldehyde dehydrogenase activity(GO:0019145) 4-trimethylammoniobutyraldehyde dehydrogenase activity(GO:0047105) |
| 0.1 | 0.7 | GO:0004652 | polynucleotide adenylyltransferase activity(GO:0004652) |
| 0.1 | 0.7 | GO:0016783 | sulfurtransferase activity(GO:0016783) |
| 0.1 | 0.4 | GO:0097016 | L27 domain binding(GO:0097016) |
| 0.1 | 1.6 | GO:0070016 | armadillo repeat domain binding(GO:0070016) |
| 0.1 | 0.4 | GO:0031726 | CCR1 chemokine receptor binding(GO:0031726) |
| 0.1 | 3.3 | GO:0035035 | histone acetyltransferase binding(GO:0035035) |
| 0.1 | 0.9 | GO:0003841 | 1-acylglycerol-3-phosphate O-acyltransferase activity(GO:0003841) |
| 0.1 | 0.5 | GO:0004046 | aminoacylase activity(GO:0004046) |
| 0.1 | 1.4 | GO:0043325 | phosphatidylinositol-3,4-bisphosphate binding(GO:0043325) |
| 0.1 | 0.4 | GO:0030899 | calcium-dependent ATPase activity(GO:0030899) |
| 0.1 | 0.2 | GO:0034617 | tetrahydrobiopterin binding(GO:0034617) |
| 0.1 | 2.3 | GO:0080025 | phosphatidylinositol-3,5-bisphosphate binding(GO:0080025) |
| 0.1 | 1.7 | GO:0043274 | phospholipase binding(GO:0043274) |
| 0.1 | 2.7 | GO:0005104 | fibroblast growth factor receptor binding(GO:0005104) |
| 0.1 | 0.5 | GO:0019788 | NEDD8 transferase activity(GO:0019788) |
| 0.1 | 0.7 | GO:0016778 | diphosphotransferase activity(GO:0016778) |
| 0.1 | 0.5 | GO:0004966 | galanin receptor activity(GO:0004966) |
| 0.1 | 3.5 | GO:0001205 | transcriptional activator activity, RNA polymerase II distal enhancer sequence-specific binding(GO:0001205) |
| 0.1 | 0.3 | GO:0003886 | DNA (cytosine-5-)-methyltransferase activity(GO:0003886) DNA (cytosine-5-)-methyltransferase activity, acting on CpG substrates(GO:0051718) |
| 0.1 | 2.5 | GO:0016799 | hydrolase activity, hydrolyzing N-glycosyl compounds(GO:0016799) |
| 0.1 | 0.1 | GO:0035529 | NADH pyrophosphatase activity(GO:0035529) |
| 0.1 | 2.8 | GO:0042056 | chemoattractant activity(GO:0042056) |
| 0.1 | 1.0 | GO:0016846 | carbon-sulfur lyase activity(GO:0016846) |
| 0.1 | 0.3 | GO:0070053 | thrombospondin receptor activity(GO:0070053) |
| 0.1 | 3.7 | GO:0031369 | translation initiation factor binding(GO:0031369) |
| 0.1 | 5.7 | GO:0033613 | activating transcription factor binding(GO:0033613) |
| 0.1 | 0.4 | GO:0005047 | signal recognition particle binding(GO:0005047) |
| 0.1 | 0.7 | GO:0004768 | stearoyl-CoA 9-desaturase activity(GO:0004768) |
| 0.1 | 0.4 | GO:0004645 | phosphorylase activity(GO:0004645) |
| 0.1 | 2.1 | GO:0001848 | complement binding(GO:0001848) |
| 0.1 | 0.4 | GO:0015057 | thrombin receptor activity(GO:0015057) |
| 0.1 | 1.2 | GO:0016780 | phosphotransferase activity, for other substituted phosphate groups(GO:0016780) |
| 0.1 | 0.4 | GO:0004045 | aminoacyl-tRNA hydrolase activity(GO:0004045) |
| 0.1 | 0.2 | GO:0016743 | carboxyl- or carbamoyltransferase activity(GO:0016743) |
| 0.1 | 1.0 | GO:0005161 | platelet-derived growth factor receptor binding(GO:0005161) |
| 0.1 | 0.5 | GO:0017034 | Rap guanyl-nucleotide exchange factor activity(GO:0017034) |
| 0.1 | 1.6 | GO:0008143 | poly(A) binding(GO:0008143) |
| 0.1 | 0.5 | GO:0003906 | DNA-(apurinic or apyrimidinic site) lyase activity(GO:0003906) |
| 0.1 | 0.8 | GO:0050649 | testosterone 6-beta-hydroxylase activity(GO:0050649) |
| 0.1 | 0.4 | GO:0015016 | [heparan sulfate]-glucosamine N-sulfotransferase activity(GO:0015016) |
| 0.1 | 0.5 | GO:0017108 | 5'-flap endonuclease activity(GO:0017108) |
| 0.1 | 3.2 | GO:0005132 | type I interferon receptor binding(GO:0005132) |
| 0.1 | 0.2 | GO:0001884 | pyrimidine nucleoside binding(GO:0001884) |
| 0.1 | 0.5 | GO:0004467 | long-chain fatty acid-CoA ligase activity(GO:0004467) |
| 0.1 | 0.5 | GO:0015349 | thyroid hormone transmembrane transporter activity(GO:0015349) |
| 0.1 | 0.5 | GO:0035473 | lipase binding(GO:0035473) |
| 0.1 | 0.1 | GO:0070180 | large ribosomal subunit rRNA binding(GO:0070180) |
| 0.1 | 0.4 | GO:0047238 | glucuronosyl-N-acetylgalactosaminyl-proteoglycan 4-beta-N-acetylgalactosaminyltransferase activity(GO:0047238) |
| 0.1 | 1.4 | GO:0008353 | RNA polymerase II carboxy-terminal domain kinase activity(GO:0008353) |
| 0.1 | 0.3 | GO:0055100 | adiponectin binding(GO:0055100) |
| 0.1 | 1.3 | GO:0035259 | glucocorticoid receptor binding(GO:0035259) |
| 0.1 | 0.6 | GO:0031995 | insulin-like growth factor II binding(GO:0031995) |
| 0.1 | 0.6 | GO:0019763 | immunoglobulin receptor activity(GO:0019763) |
| 0.1 | 1.4 | GO:0017049 | GTP-Rho binding(GO:0017049) |
| 0.1 | 0.8 | GO:0016886 | ligase activity, forming phosphoric ester bonds(GO:0016886) |
| 0.1 | 0.4 | GO:0004668 | protein-arginine deiminase activity(GO:0004668) |
| 0.1 | 0.4 | GO:0016899 | oxidoreductase activity, acting on the CH-OH group of donors, oxygen as acceptor(GO:0016899) |
| 0.1 | 1.6 | GO:0008483 | transaminase activity(GO:0008483) |
| 0.1 | 1.0 | GO:0001671 | ATPase activator activity(GO:0001671) |
| 0.1 | 0.3 | GO:0004470 | malic enzyme activity(GO:0004470) malate dehydrogenase (decarboxylating) (NAD+) activity(GO:0004471) |
| 0.1 | 1.3 | GO:0004708 | MAP kinase kinase activity(GO:0004708) |
| 0.1 | 0.3 | GO:0016833 | oxo-acid-lyase activity(GO:0016833) |
| 0.1 | 0.3 | GO:0098748 | clathrin adaptor activity(GO:0035615) endocytic adaptor activity(GO:0098748) |
| 0.1 | 0.6 | GO:0017127 | cholesterol transporter activity(GO:0017127) |
| 0.1 | 0.6 | GO:0016208 | AMP binding(GO:0016208) |
| 0.1 | 0.4 | GO:0032453 | histone demethylase activity (H3-K4 specific)(GO:0032453) |
| 0.1 | 0.4 | GO:0004826 | phenylalanine-tRNA ligase activity(GO:0004826) |
| 0.1 | 0.2 | GO:0004616 | phosphogluconate dehydrogenase (decarboxylating) activity(GO:0004616) |
| 0.1 | 0.1 | GO:0004731 | purine-nucleoside phosphorylase activity(GO:0004731) |
| 0.1 | 0.4 | GO:0034842 | 3-oxo-2-(2'-pentenyl)cyclopentane-1-octanoic acid CoA ligase activity(GO:0010435) 3-isopropenyl-6-oxoheptanoyl-CoA synthetase activity(GO:0018854) 2-oxo-delta3-4,5,5-trimethylcyclopentenylacetyl-CoA synthetase activity(GO:0018855) benzoyl acetate-CoA ligase activity(GO:0018856) 2,4-dichlorobenzoate-CoA ligase activity(GO:0018857) pivalate-CoA ligase activity(GO:0034783) cyclopropanecarboxylate-CoA ligase activity(GO:0034793) adipate-CoA ligase activity(GO:0034796) citronellyl-CoA ligase activity(GO:0034823) mentha-1,3-dione-CoA ligase activity(GO:0034841) thiophene-2-carboxylate-CoA ligase activity(GO:0034842) 2,4,4-trimethylpentanoate-CoA ligase activity(GO:0034865) cis-2-methyl-5-isopropylhexa-2,5-dienoate-CoA ligase activity(GO:0034942) trans-2-methyl-5-isopropylhexa-2,5-dienoate-CoA ligase activity(GO:0034943) branched-chain acyl-CoA synthetase (ADP-forming) activity(GO:0043759) aryl-CoA synthetase (ADP-forming) activity(GO:0043762) 3-hydroxypropionyl-CoA synthetase activity(GO:0043955) perillic acid:CoA ligase (ADP-forming) activity(GO:0052685) perillic acid:CoA ligase (AMP-forming) activity(GO:0052686) (3R)-3-isopropenyl-6-oxoheptanoate:CoA ligase (ADP-forming) activity(GO:0052687) (3R)-3-isopropenyl-6-oxoheptanoate:CoA ligase (AMP-forming) activity(GO:0052688) pristanate-CoA ligase activity(GO:0070251) malonyl-CoA synthetase activity(GO:0090409) |
| 0.1 | 1.4 | GO:0070008 | serine-type exopeptidase activity(GO:0070008) |
| 0.1 | 1.6 | GO:0015035 | protein disulfide oxidoreductase activity(GO:0015035) |
| 0.1 | 1.1 | GO:0043539 | protein serine/threonine kinase activator activity(GO:0043539) |
| 0.1 | 0.3 | GO:0008349 | MAP kinase kinase kinase kinase activity(GO:0008349) |
| 0.1 | 1.7 | GO:0097472 | cyclin-dependent protein serine/threonine kinase activity(GO:0004693) cyclin-dependent protein kinase activity(GO:0097472) |
| 0.1 | 0.8 | GO:0015254 | glycerol transmembrane transporter activity(GO:0015168) glycerol channel activity(GO:0015254) |
| 0.1 | 0.5 | GO:0008121 | ubiquinol-cytochrome-c reductase activity(GO:0008121) oxidoreductase activity, acting on diphenols and related substances as donors, cytochrome as acceptor(GO:0016681) |
| 0.1 | 0.6 | GO:0046977 | TAP binding(GO:0046977) |
| 0.1 | 14.5 | GO:0061630 | ubiquitin protein ligase activity(GO:0061630) |
| 0.1 | 0.2 | GO:0098518 | polynucleotide phosphatase activity(GO:0098518) |
| 0.1 | 0.5 | GO:0004716 | receptor signaling protein tyrosine kinase activity(GO:0004716) |
| 0.1 | 0.6 | GO:0005247 | voltage-gated chloride channel activity(GO:0005247) |
| 0.1 | 0.5 | GO:0016494 | C-X-C chemokine receptor activity(GO:0016494) |
| 0.1 | 0.2 | GO:0004705 | JUN kinase activity(GO:0004705) SAP kinase activity(GO:0016909) |
| 0.1 | 0.5 | GO:0008140 | cAMP response element binding protein binding(GO:0008140) |
| 0.1 | 0.2 | GO:0033592 | RNA strand annealing activity(GO:0033592) |
| 0.1 | 0.2 | GO:1900750 | glutathione binding(GO:0043295) oligopeptide binding(GO:1900750) |
| 0.1 | 0.6 | GO:0046933 | proton-transporting ATP synthase activity, rotational mechanism(GO:0046933) |
| 0.1 | 0.3 | GO:0052794 | exo-alpha-sialidase activity(GO:0004308) alpha-sialidase activity(GO:0016997) exo-alpha-(2->3)-sialidase activity(GO:0052794) exo-alpha-(2->6)-sialidase activity(GO:0052795) exo-alpha-(2->8)-sialidase activity(GO:0052796) |
| 0.1 | 0.1 | GO:0042296 | ISG15 transferase activity(GO:0042296) |
| 0.1 | 0.2 | GO:0004687 | myosin light chain kinase activity(GO:0004687) |
| 0.1 | 0.1 | GO:0030487 | inositol-4,5-bisphosphate 5-phosphatase activity(GO:0030487) |
| 0.1 | 0.4 | GO:0008526 | phosphatidylinositol transporter activity(GO:0008526) |
| 0.1 | 0.2 | GO:0004017 | adenylate kinase activity(GO:0004017) |
| 0.1 | 0.7 | GO:0017110 | nucleoside-diphosphatase activity(GO:0017110) |
| 0.1 | 0.9 | GO:0004622 | lysophospholipase activity(GO:0004622) |
| 0.1 | 0.2 | GO:0008321 | Ral guanyl-nucleotide exchange factor activity(GO:0008321) |
| 0.1 | 0.2 | GO:0070492 | oligosaccharide binding(GO:0070492) |
| 0.1 | 0.1 | GO:0070061 | fructose binding(GO:0070061) |
| 0.1 | 1.2 | GO:0030247 | pattern binding(GO:0001871) polysaccharide binding(GO:0030247) |
| 0.1 | 0.3 | GO:0016453 | acetyl-CoA C-acetyltransferase activity(GO:0003985) C-acetyltransferase activity(GO:0016453) |
| 0.1 | 1.4 | GO:0005385 | zinc ion transmembrane transporter activity(GO:0005385) |
| 0.1 | 1.3 | GO:0043027 | cysteine-type endopeptidase inhibitor activity involved in apoptotic process(GO:0043027) |
| 0.1 | 0.2 | GO:0010484 | H3 histone acetyltransferase activity(GO:0010484) |
| 0.1 | 0.7 | GO:0031701 | angiotensin receptor binding(GO:0031701) |
| 0.1 | 0.2 | GO:0035673 | oligopeptide transmembrane transporter activity(GO:0035673) |
| 0.1 | 0.3 | GO:0008273 | calcium, potassium:sodium antiporter activity(GO:0008273) |
| 0.1 | 1.6 | GO:0051059 | NF-kappaB binding(GO:0051059) |
| 0.1 | 0.2 | GO:0090482 | vitamin transmembrane transporter activity(GO:0090482) |
| 0.1 | 0.5 | GO:1990405 | protein antigen binding(GO:1990405) |
| 0.1 | 0.3 | GO:0005078 | MAP-kinase scaffold activity(GO:0005078) |
| 0.1 | 0.3 | GO:0046923 | ER retention sequence binding(GO:0046923) |
| 0.1 | 0.4 | GO:0048406 | nerve growth factor binding(GO:0048406) |
| 0.1 | 1.0 | GO:0017056 | structural constituent of nuclear pore(GO:0017056) |
| 0.1 | 0.3 | GO:0030292 | protein tyrosine kinase inhibitor activity(GO:0030292) |
| 0.1 | 0.6 | GO:0070990 | snRNP binding(GO:0070990) |
| 0.1 | 0.4 | GO:0019865 | immunoglobulin binding(GO:0019865) |
| 0.1 | 0.2 | GO:0015315 | hexose phosphate transmembrane transporter activity(GO:0015119) organophosphate:inorganic phosphate antiporter activity(GO:0015315) hexose-phosphate:inorganic phosphate antiporter activity(GO:0015526) glucose 6-phosphate:inorganic phosphate antiporter activity(GO:0061513) |
| 0.1 | 0.4 | GO:0086008 | voltage-gated potassium channel activity involved in cardiac muscle cell action potential repolarization(GO:0086008) |
| 0.1 | 0.2 | GO:0051880 | G-quadruplex DNA binding(GO:0051880) |
| 0.1 | 0.2 | GO:0034714 | type III transforming growth factor beta receptor binding(GO:0034714) |
| 0.1 | 0.8 | GO:0015643 | toxic substance binding(GO:0015643) |
| 0.1 | 0.3 | GO:1990247 | N6-methyladenosine-containing RNA binding(GO:1990247) |
| 0.1 | 0.1 | GO:0030619 | U1 snRNA binding(GO:0030619) |
| 0.1 | 0.2 | GO:0045504 | dynein heavy chain binding(GO:0045504) |
| 0.1 | 0.3 | GO:0001094 | TFIID-class transcription factor binding(GO:0001094) |
| 0.1 | 0.1 | GO:0005143 | interleukin-12 receptor binding(GO:0005143) |
| 0.1 | 0.4 | GO:0008479 | queuine tRNA-ribosyltransferase activity(GO:0008479) |
| 0.1 | 0.2 | GO:0005344 | oxygen transporter activity(GO:0005344) |
| 0.1 | 1.1 | GO:0005070 | SH3/SH2 adaptor activity(GO:0005070) |
| 0.1 | 0.2 | GO:0019797 | procollagen-proline 3-dioxygenase activity(GO:0019797) |
| 0.1 | 0.2 | GO:0030350 | iron-responsive element binding(GO:0030350) |
| 0.1 | 0.2 | GO:0042392 | sphingosine-1-phosphate phosphatase activity(GO:0042392) |
| 0.1 | 0.1 | GO:0035851 | Krueppel-associated box domain binding(GO:0035851) |
| 0.1 | 0.1 | GO:0060230 | lipoprotein lipase activator activity(GO:0060230) |
| 0.1 | 0.3 | GO:0035252 | UDP-xylosyltransferase activity(GO:0035252) xylosyltransferase activity(GO:0042285) |
| 0.1 | 0.2 | GO:0004031 | aldehyde oxidase activity(GO:0004031) oxidoreductase activity, acting on the aldehyde or oxo group of donors, oxygen as acceptor(GO:0016623) |
| 0.1 | 0.1 | GO:1990829 | C-rich single-stranded DNA binding(GO:1990829) |
| 0.1 | 0.2 | GO:0005001 | transmembrane receptor protein tyrosine phosphatase activity(GO:0005001) |
| 0.1 | 0.7 | GO:0034236 | protein kinase A catalytic subunit binding(GO:0034236) |
| 0.1 | 2.1 | GO:0000980 | RNA polymerase II distal enhancer sequence-specific DNA binding(GO:0000980) |
| 0.1 | 0.9 | GO:0015149 | hexose transmembrane transporter activity(GO:0015149) |
| 0.1 | 0.3 | GO:0008294 | calcium- and calmodulin-responsive adenylate cyclase activity(GO:0008294) |
| 0.1 | 0.1 | GO:0072542 | protein phosphatase activator activity(GO:0072542) |
| 0.1 | 0.2 | GO:0030144 | alpha-1,6-mannosylglycoprotein 6-beta-N-acetylglucosaminyltransferase activity(GO:0030144) |
| 0.1 | 0.3 | GO:0019911 | structural constituent of myelin sheath(GO:0019911) |
| 0.1 | 0.4 | GO:0047372 | acylglycerol lipase activity(GO:0047372) |
| 0.1 | 0.1 | GO:0016838 | carbon-oxygen lyase activity, acting on phosphates(GO:0016838) |
| 0.1 | 0.2 | GO:0045340 | mercury ion binding(GO:0045340) |
| 0.1 | 0.4 | GO:0004571 | mannosyl-oligosaccharide 1,2-alpha-mannosidase activity(GO:0004571) |
| 0.1 | 0.1 | GO:0031826 | type 2A serotonin receptor binding(GO:0031826) |
| 0.1 | 0.4 | GO:0016175 | superoxide-generating NADPH oxidase activity(GO:0016175) |
| 0.1 | 0.6 | GO:0001784 | phosphotyrosine binding(GO:0001784) |
| 0.1 | 1.4 | GO:0019706 | protein-cysteine S-palmitoyltransferase activity(GO:0019706) |
| 0.1 | 0.4 | GO:0051371 | muscle alpha-actinin binding(GO:0051371) |
| 0.1 | 0.7 | GO:0015026 | coreceptor activity(GO:0015026) |
| 0.1 | 1.5 | GO:0004869 | cysteine-type endopeptidase inhibitor activity(GO:0004869) |
| 0.1 | 0.2 | GO:0034604 | pyruvate dehydrogenase activity(GO:0004738) pyruvate dehydrogenase [NAD(P)+] activity(GO:0034603) pyruvate dehydrogenase (NAD+) activity(GO:0034604) |
| 0.1 | 0.1 | GO:0050816 | phosphothreonine binding(GO:0050816) |
| 0.1 | 0.3 | GO:0042015 | interleukin-20 binding(GO:0042015) |
| 0.1 | 0.3 | GO:0004022 | alcohol dehydrogenase (NAD) activity(GO:0004022) |
| 0.1 | 0.3 | GO:0017070 | U6 snRNA binding(GO:0017070) |
| 0.1 | 0.2 | GO:0031698 | beta-2 adrenergic receptor binding(GO:0031698) |
| 0.1 | 0.2 | GO:0008486 | diphosphoinositol-polyphosphate diphosphatase activity(GO:0008486) |
| 0.1 | 0.1 | GO:0004897 | ciliary neurotrophic factor receptor activity(GO:0004897) |
| 0.1 | 0.7 | GO:0008253 | 5'-nucleotidase activity(GO:0008253) |
| 0.1 | 0.2 | GO:0005432 | calcium:sodium antiporter activity(GO:0005432) calcium:cation antiporter activity(GO:0015368) |
| 0.1 | 0.2 | GO:0016215 | acyl-CoA desaturase activity(GO:0016215) |
| 0.1 | 0.9 | GO:0030331 | estrogen receptor binding(GO:0030331) |
| 0.0 | 0.3 | GO:0005229 | intracellular calcium activated chloride channel activity(GO:0005229) |
| 0.0 | 0.5 | GO:0004806 | triglyceride lipase activity(GO:0004806) |
| 0.0 | 0.7 | GO:0051879 | Hsp90 protein binding(GO:0051879) |
| 0.0 | 0.7 | GO:0004551 | nucleotide diphosphatase activity(GO:0004551) |
| 0.0 | 0.8 | GO:0008157 | protein phosphatase 1 binding(GO:0008157) |
| 0.0 | 0.3 | GO:0051864 | histone demethylase activity (H3-K36 specific)(GO:0051864) |
| 0.0 | 1.0 | GO:0001106 | RNA polymerase II transcription corepressor activity(GO:0001106) |
| 0.0 | 0.2 | GO:0043515 | kinetochore binding(GO:0043515) |
| 0.0 | 0.3 | GO:0008508 | bile acid:sodium symporter activity(GO:0008508) |
| 0.0 | 0.1 | GO:0017151 | DEAD/H-box RNA helicase binding(GO:0017151) |
| 0.0 | 0.2 | GO:0097642 | calcitonin family receptor activity(GO:0097642) |
| 0.0 | 0.3 | GO:0005049 | nuclear export signal receptor activity(GO:0005049) |
| 0.0 | 0.2 | GO:0008517 | folic acid transporter activity(GO:0008517) |
| 0.0 | 0.2 | GO:0017089 | glycolipid transporter activity(GO:0017089) |
| 0.0 | 2.2 | GO:0002039 | p53 binding(GO:0002039) |
| 0.0 | 0.1 | GO:0008240 | tripeptidyl-peptidase activity(GO:0008240) |
| 0.0 | 0.1 | GO:0035662 | Toll-like receptor 4 binding(GO:0035662) |
| 0.0 | 1.1 | GO:0004180 | carboxypeptidase activity(GO:0004180) |
| 0.0 | 0.3 | GO:0035381 | extracellular ATP-gated cation channel activity(GO:0004931) ATP-gated ion channel activity(GO:0035381) |
| 0.0 | 0.2 | GO:0004459 | L-lactate dehydrogenase activity(GO:0004459) |
| 0.0 | 0.2 | GO:0004656 | procollagen-proline 4-dioxygenase activity(GO:0004656) |
| 0.0 | 0.2 | GO:0001758 | retinal dehydrogenase activity(GO:0001758) |
| 0.0 | 0.3 | GO:0016813 | hydrolase activity, acting on carbon-nitrogen (but not peptide) bonds, in linear amidines(GO:0016813) |
| 0.0 | 7.7 | GO:0004842 | ubiquitin-protein transferase activity(GO:0004842) |
| 0.0 | 0.1 | GO:0050833 | pyruvate transmembrane transporter activity(GO:0050833) |
| 0.0 | 0.4 | GO:0019841 | retinol binding(GO:0019841) |
| 0.0 | 0.4 | GO:0035497 | cAMP response element binding(GO:0035497) |
| 0.0 | 1.6 | GO:0035064 | methylated histone binding(GO:0035064) |
| 0.0 | 0.3 | GO:0005113 | patched binding(GO:0005113) |
| 0.0 | 0.7 | GO:0004623 | phospholipase A2 activity(GO:0004623) |
| 0.0 | 0.1 | GO:0005146 | leukemia inhibitory factor receptor binding(GO:0005146) |
| 0.0 | 0.2 | GO:0031014 | troponin T binding(GO:0031014) |
| 0.0 | 0.4 | GO:0004499 | N,N-dimethylaniline monooxygenase activity(GO:0004499) |
| 0.0 | 1.1 | GO:0003887 | DNA-directed DNA polymerase activity(GO:0003887) |
| 0.0 | 0.2 | GO:0016361 | activin receptor activity, type I(GO:0016361) activin-activated receptor activity(GO:0017002) |
| 0.0 | 0.3 | GO:0042300 | pivalyl-CoA mutase activity(GO:0034784) o-hydroxylaminobenzoate mutase activity(GO:0034951) lupeol synthase activity(GO:0042299) beta-amyrin synthase activity(GO:0042300) baruol synthase activity(GO:0080011) |
| 0.0 | 2.6 | GO:0004896 | cytokine receptor activity(GO:0004896) |
| 0.0 | 0.1 | GO:0003941 | L-serine ammonia-lyase activity(GO:0003941) |
| 0.0 | 0.2 | GO:0031705 | bombesin receptor binding(GO:0031705) |
| 0.0 | 0.0 | GO:0004694 | eukaryotic translation initiation factor 2alpha kinase activity(GO:0004694) |
| 0.0 | 0.6 | GO:0032266 | phosphatidylinositol-3-phosphate binding(GO:0032266) |
| 0.0 | 0.3 | GO:0031435 | mitogen-activated protein kinase kinase kinase binding(GO:0031435) |
| 0.0 | 0.3 | GO:0004534 | 5'-3' exoribonuclease activity(GO:0004534) |
| 0.0 | 0.1 | GO:0004461 | lactose synthase activity(GO:0004461) |
| 0.0 | 0.1 | GO:0030911 | TPR domain binding(GO:0030911) |
| 0.0 | 0.0 | GO:0051021 | GDP-dissociation inhibitor binding(GO:0051021) |
| 0.0 | 2.1 | GO:0017048 | Rho GTPase binding(GO:0017048) |
| 0.0 | 0.6 | GO:0042974 | retinoic acid receptor binding(GO:0042974) |
| 0.0 | 0.4 | GO:0004596 | peptide alpha-N-acetyltransferase activity(GO:0004596) |
| 0.0 | 0.7 | GO:0004745 | retinol dehydrogenase activity(GO:0004745) |
| 0.0 | 0.3 | GO:0005487 | nucleocytoplasmic transporter activity(GO:0005487) |
| 0.0 | 1.1 | GO:0015485 | cholesterol binding(GO:0015485) |
| 0.0 | 0.9 | GO:0042162 | telomeric DNA binding(GO:0042162) |
| 0.0 | 0.2 | GO:0035368 | selenocysteine insertion sequence binding(GO:0035368) |
| 0.0 | 1.0 | GO:0045502 | dynein binding(GO:0045502) |
| 0.0 | 0.3 | GO:0097602 | cullin family protein binding(GO:0097602) |
| 0.0 | 0.1 | GO:0035033 | histone deacetylase regulator activity(GO:0035033) |
| 0.0 | 0.4 | GO:0008198 | ferrous iron binding(GO:0008198) |
| 0.0 | 0.2 | GO:0010997 | anaphase-promoting complex binding(GO:0010997) |
| 0.0 | 0.4 | GO:0003884 | D-amino-acid oxidase activity(GO:0003884) |
| 0.0 | 0.0 | GO:0008139 | nuclear localization sequence binding(GO:0008139) |
| 0.0 | 0.2 | GO:0002046 | opsin binding(GO:0002046) |
| 0.0 | 0.1 | GO:0035877 | death effector domain binding(GO:0035877) |
| 0.0 | 0.2 | GO:0004075 | biotin carboxylase activity(GO:0004075) |
| 0.0 | 0.1 | GO:0004862 | cAMP-dependent protein kinase inhibitor activity(GO:0004862) |
| 0.0 | 0.1 | GO:0005127 | ciliary neurotrophic factor receptor binding(GO:0005127) |
| 0.0 | 0.3 | GO:0043425 | bHLH transcription factor binding(GO:0043425) |
| 0.0 | 0.0 | GO:0032422 | purine-rich negative regulatory element binding(GO:0032422) |
| 0.0 | 0.1 | GO:0051033 | nucleic acid transmembrane transporter activity(GO:0051032) RNA transmembrane transporter activity(GO:0051033) |
| 0.0 | 0.3 | GO:0008093 | cytoskeletal adaptor activity(GO:0008093) |
| 0.0 | 0.2 | GO:0005000 | vasopressin receptor activity(GO:0005000) |
| 0.0 | 1.0 | GO:0043734 | DNA-N1-methyladenine dioxygenase activity(GO:0043734) |
| 0.0 | 0.2 | GO:0019870 | potassium channel inhibitor activity(GO:0019870) |
| 0.0 | 0.1 | GO:0051434 | BH3 domain binding(GO:0051434) |
| 0.0 | 0.3 | GO:0008430 | selenium binding(GO:0008430) |
| 0.0 | 0.2 | GO:0001609 | G-protein coupled adenosine receptor activity(GO:0001609) |
| 0.0 | 0.2 | GO:0004301 | epoxide hydrolase activity(GO:0004301) |
| 0.0 | 0.1 | GO:0005219 | ryanodine-sensitive calcium-release channel activity(GO:0005219) |
| 0.0 | 0.1 | GO:0035256 | G-protein coupled glutamate receptor binding(GO:0035256) |
| 0.0 | 0.1 | GO:0000900 | translation repressor activity, nucleic acid binding(GO:0000900) |
| 0.0 | 0.2 | GO:0010858 | calcium-dependent protein kinase regulator activity(GO:0010858) |
| 0.0 | 0.1 | GO:0016647 | oxidoreductase activity, acting on the CH-NH group of donors, oxygen as acceptor(GO:0016647) |
| 0.0 | 0.6 | GO:0004550 | nucleoside diphosphate kinase activity(GO:0004550) |
| 0.0 | 0.0 | GO:1904680 | peptide-transporting ATPase activity(GO:0015440) peptide transmembrane transporter activity(GO:1904680) |
| 0.0 | 1.8 | GO:0005089 | Rho guanyl-nucleotide exchange factor activity(GO:0005089) |
| 0.0 | 1.1 | GO:0030145 | manganese ion binding(GO:0030145) |
| 0.0 | 0.1 | GO:0016018 | cyclosporin A binding(GO:0016018) |
| 0.0 | 0.1 | GO:0034416 | bisphosphoglycerate phosphatase activity(GO:0034416) |
| 0.0 | 0.1 | GO:0005502 | 11-cis retinal binding(GO:0005502) |
| 0.0 | 0.1 | GO:0035650 | AP-1 adaptor complex binding(GO:0035650) |
| 0.0 | 0.7 | GO:0019843 | rRNA binding(GO:0019843) |
| 0.0 | 0.1 | GO:0016406 | carnitine O-acyltransferase activity(GO:0016406) |
| 0.0 | 0.2 | GO:0030983 | mismatched DNA binding(GO:0030983) |
| 0.0 | 0.9 | GO:0004364 | glutathione transferase activity(GO:0004364) |
| 0.0 | 0.9 | GO:0048020 | CCR chemokine receptor binding(GO:0048020) |
| 0.0 | 0.1 | GO:0016004 | phospholipase activator activity(GO:0016004) |
| 0.0 | 0.2 | GO:0004689 | phosphorylase kinase activity(GO:0004689) |
| 0.0 | 6.7 | GO:0003735 | structural constituent of ribosome(GO:0003735) |
| 0.0 | 1.2 | GO:0004812 | aminoacyl-tRNA ligase activity(GO:0004812) ligase activity, forming carbon-oxygen bonds(GO:0016875) ligase activity, forming aminoacyl-tRNA and related compounds(GO:0016876) |
| 0.0 | 0.2 | GO:0005391 | sodium:potassium-exchanging ATPase activity(GO:0005391) |
| 0.0 | 0.2 | GO:0005324 | long-chain fatty acid transporter activity(GO:0005324) |
| 0.0 | 0.1 | GO:0097001 | ceramide binding(GO:0097001) |
| 0.0 | 0.2 | GO:0018644 | 3-(3-hydroxyphenyl)propionate hydroxylase activity(GO:0008688) 4-chlorobenzaldehyde oxidase activity(GO:0018471) 3,5-xylenol methylhydroxylase activity(GO:0018630) phenylacetate hydroxylase activity(GO:0018631) 4-nitrophenol 4-monooxygenase activity(GO:0018632) dimethyl sulfide monooxygenase activity(GO:0018633) alpha-pinene monooxygenase [NADH] activity(GO:0018634) 1-hydroxy-2-naphthoate hydroxylase activity(GO:0018637) toluene 4-monooxygenase activity(GO:0018638) xylene monooxygenase activity(GO:0018639) dibenzothiophene monooxygenase activity(GO:0018640) 6-hydroxy-3-methyl-2-oxo-1,2-dihydroquinoline 6-monooxygenase activity(GO:0018641) chlorophenol 4-monooxygenase activity(GO:0018642) carbon disulfide oxygenase activity(GO:0018643) toluene 2-monooxygenase activity(GO:0018644) 1-hydroxy-2-oxolimonene 1,2-monooxygenase activity(GO:0018646) phenanthrene 1,2-monooxygenase activity(GO:0018647) tetrahydrofuran hydroxylase activity(GO:0018649) styrene monooxygenase activity(GO:0018650) toluene-4-sulfonate monooxygenase activity(GO:0018651) toluene-sulfonate methyl-monooxygenase activity(GO:0018652) 3-methyl-2-oxo-1,2-dihydroquinoline 6-monooxygenase activity(GO:0018653) 2-hydroxy-phenylacetate hydroxylase activity(GO:0018654) 2-oxo-delta3-4,5,5-trimethylcyclopentenylacetyl-CoA 1,2-monooxygenase activity(GO:0018655) phenanthrene 3,4-monooxygenase activity(GO:0018656) toluene 3-monooxygenase activity(GO:0018657) 4-hydroxyphenylacetate,NADH:oxygen oxidoreductase (3-hydroxylating) activity(GO:0018660) limonene monooxygenase activity(GO:0019113) 2-methylnaphthalene hydroxylase activity(GO:0034526) 1-methylnaphthalene hydroxylase activity(GO:0034534) bisphenol A hydroxylase A activity(GO:0034560) salicylate 5-hydroxylase activity(GO:0034785) isobutylamine N-hydroxylase activity(GO:0034791) branched-chain dodecylbenzene sulfonate monooxygenase activity(GO:0034802) 3-HSA hydroxylase activity(GO:0034819) 4-hydroxypyridine-3-hydroxylase activity(GO:0034894) 2-octaprenyl-3-methyl-6-methoxy-1,4-benzoquinol hydroxylase activity(GO:0043719) 6-hydroxynicotinate 3-monooxygenase activity(GO:0043731) thalianol hydroxylase activity(GO:0080014) |
| 0.0 | 0.2 | GO:0004111 | creatine kinase activity(GO:0004111) |
| 0.0 | 0.6 | GO:0042166 | acetylcholine binding(GO:0042166) |
| 0.0 | 0.2 | GO:0019213 | deacetylase activity(GO:0019213) |
| 0.0 | 0.1 | GO:0015182 | L-asparagine transmembrane transporter activity(GO:0015182) L-glutamine transmembrane transporter activity(GO:0015186) |
| 0.0 | 0.0 | GO:0005220 | inositol 1,4,5-trisphosphate-sensitive calcium-release channel activity(GO:0005220) |
| 0.0 | 0.4 | GO:0000993 | RNA polymerase II core binding(GO:0000993) |
| 0.0 | 0.1 | GO:0004969 | histamine receptor activity(GO:0004969) |
| 0.0 | 0.2 | GO:0048038 | quinone binding(GO:0048038) |
| 0.0 | 0.1 | GO:0003987 | acetate-CoA ligase activity(GO:0003987) |
| 0.0 | 0.2 | GO:0005315 | inorganic phosphate transmembrane transporter activity(GO:0005315) |
| 0.0 | 0.1 | GO:0016520 | growth hormone-releasing hormone receptor activity(GO:0016520) |
| 0.0 | 0.4 | GO:0070063 | RNA polymerase binding(GO:0070063) |
| 0.0 | 0.6 | GO:0005086 | ARF guanyl-nucleotide exchange factor activity(GO:0005086) |
| 0.0 | 0.8 | GO:0070491 | repressing transcription factor binding(GO:0070491) |
| 0.0 | 2.0 | GO:0042393 | histone binding(GO:0042393) |
| 0.0 | 0.0 | GO:0043812 | phosphatidylinositol-4-phosphate phosphatase activity(GO:0043812) |
| 0.0 | 0.1 | GO:0004939 | beta-adrenergic receptor activity(GO:0004939) |
| 0.0 | 0.2 | GO:0046912 | transferase activity, transferring acyl groups, acyl groups converted into alkyl on transfer(GO:0046912) |
| 0.0 | 0.2 | GO:0008440 | inositol-1,4,5-trisphosphate 3-kinase activity(GO:0008440) |
| 0.0 | 0.1 | GO:0050897 | cobalt ion binding(GO:0050897) |
| 0.0 | 0.1 | GO:0004663 | Rab geranylgeranyltransferase activity(GO:0004663) |
| 0.0 | 0.0 | GO:0032405 | MutLalpha complex binding(GO:0032405) |
| 0.0 | 0.4 | GO:0005149 | interleukin-1 receptor binding(GO:0005149) |
| 0.0 | 0.1 | GO:0015232 | heme transporter activity(GO:0015232) |
| 0.0 | 0.9 | GO:0043621 | protein self-association(GO:0043621) |
| 0.0 | 0.1 | GO:0008199 | ferric iron binding(GO:0008199) |
| 0.0 | 0.2 | GO:0047760 | butyrate-CoA ligase activity(GO:0047760) |
| 0.0 | 0.1 | GO:0004605 | phosphatidate cytidylyltransferase activity(GO:0004605) |
| 0.0 | 0.4 | GO:0003746 | translation elongation factor activity(GO:0003746) |
| 0.0 | 0.3 | GO:0044183 | protein binding involved in protein folding(GO:0044183) |
| 0.0 | 0.1 | GO:0016401 | palmitoyl-CoA oxidase activity(GO:0016401) |
| 0.0 | 0.1 | GO:0070139 | ubiquitin-like protein-specific endopeptidase activity(GO:0070137) SUMO-specific endopeptidase activity(GO:0070139) |
| 0.0 | 0.1 | GO:0016312 | inositol bisphosphate phosphatase activity(GO:0016312) |
| 0.0 | 0.1 | GO:0005159 | insulin-like growth factor receptor binding(GO:0005159) |
| 0.0 | 0.1 | GO:0015265 | urea transmembrane transporter activity(GO:0015204) urea channel activity(GO:0015265) |
| 0.0 | 0.0 | GO:0005131 | growth hormone receptor binding(GO:0005131) |
| 0.0 | 0.5 | GO:0005031 | tumor necrosis factor-activated receptor activity(GO:0005031) death receptor activity(GO:0005035) |
| 0.0 | 0.3 | GO:0015095 | magnesium ion transmembrane transporter activity(GO:0015095) |
| 0.0 | 0.9 | GO:0051723 | protein methylesterase activity(GO:0051723) |
| 0.0 | 0.1 | GO:0071987 | WD40-repeat domain binding(GO:0071987) |
| 0.0 | 0.3 | GO:0000400 | four-way junction DNA binding(GO:0000400) |
| 0.0 | 0.1 | GO:0004719 | protein-L-isoaspartate (D-aspartate) O-methyltransferase activity(GO:0004719) |
| 0.0 | 0.4 | GO:0052890 | oxidoreductase activity, acting on the CH-CH group of donors, with a flavin as acceptor(GO:0052890) |
| 0.0 | 0.7 | GO:0017017 | MAP kinase tyrosine/serine/threonine phosphatase activity(GO:0017017) |
| 0.0 | 0.0 | GO:0016751 | S-succinyltransferase activity(GO:0016751) |
| 0.0 | 0.1 | GO:0008495 | 4-hydroxybenzoate octaprenyltransferase activity(GO:0008412) protoheme IX farnesyltransferase activity(GO:0008495) (S)-2,3-di-O-geranylgeranylglyceryl phosphate synthase activity(GO:0043888) cadaverine aminopropyltransferase activity(GO:0043918) agmatine aminopropyltransferase activity(GO:0043919) 1,4-dihydroxy-2-naphthoate octaprenyltransferase activity(GO:0046428) trans-pentaprenyltranstransferase activity(GO:0048045) ATP dimethylallyltransferase activity(GO:0052622) ADP dimethylallyltransferase activity(GO:0052623) |
| 0.0 | 0.2 | GO:0038036 | sphingosine-1-phosphate receptor activity(GO:0038036) |
| 0.0 | 0.1 | GO:0004030 | aldehyde dehydrogenase [NAD(P)+] activity(GO:0004030) |
| 0.0 | 0.1 | GO:0035258 | steroid hormone receptor binding(GO:0035258) |
| 0.0 | 0.3 | GO:0008484 | sulfuric ester hydrolase activity(GO:0008484) |
| 0.0 | 0.2 | GO:0016624 | oxidoreductase activity, acting on the aldehyde or oxo group of donors, disulfide as acceptor(GO:0016624) |
| 0.0 | 0.1 | GO:0052744 | phosphatidylinositol monophosphate phosphatase activity(GO:0052744) |
| 0.0 | 0.1 | GO:0008865 | fructokinase activity(GO:0008865) mannokinase activity(GO:0019158) |
| 0.0 | 0.1 | GO:0038100 | nodal binding(GO:0038100) |
| 0.0 | 0.2 | GO:0038191 | neuropilin binding(GO:0038191) |
| 0.0 | 0.3 | GO:0008553 | hydrogen-exporting ATPase activity, phosphorylative mechanism(GO:0008553) |
| 0.0 | 0.1 | GO:0008732 | threonine aldolase activity(GO:0004793) L-allo-threonine aldolase activity(GO:0008732) |
| 0.0 | 0.1 | GO:0016802 | adenosylhomocysteinase activity(GO:0004013) trialkylsulfonium hydrolase activity(GO:0016802) |
| 0.0 | 0.5 | GO:0050136 | NADH dehydrogenase (ubiquinone) activity(GO:0008137) NADH dehydrogenase (quinone) activity(GO:0050136) |
| 0.0 | 0.1 | GO:0005068 | transmembrane receptor protein tyrosine kinase adaptor activity(GO:0005068) |
| 0.0 | 0.2 | GO:0050733 | RS domain binding(GO:0050733) |
| 0.0 | 0.6 | GO:0004879 | RNA polymerase II transcription factor activity, ligand-activated sequence-specific DNA binding(GO:0004879) transcription factor activity, direct ligand regulated sequence-specific DNA binding(GO:0098531) |
| 0.0 | 0.3 | GO:0001618 | virus receptor activity(GO:0001618) |
| 0.0 | 0.3 | GO:0015266 | protein channel activity(GO:0015266) |
| 0.0 | 0.6 | GO:0048487 | beta-tubulin binding(GO:0048487) |
| 0.0 | 0.1 | GO:0004594 | pantothenate kinase activity(GO:0004594) |
| 0.0 | 0.5 | GO:0030507 | spectrin binding(GO:0030507) |
| 0.0 | 0.3 | GO:0003924 | GTPase activity(GO:0003924) |
| 0.0 | 0.2 | GO:0016884 | carbon-nitrogen ligase activity, with glutamine as amido-N-donor(GO:0016884) |
| 0.0 | 0.1 | GO:0004735 | pyrroline-5-carboxylate reductase activity(GO:0004735) |
| 0.0 | 0.1 | GO:0003847 | 1-alkyl-2-acetylglycerophosphocholine esterase activity(GO:0003847) |
| 0.0 | 1.1 | GO:0019003 | GDP binding(GO:0019003) |
| 0.0 | 0.1 | GO:0016774 | phosphotransferase activity, carboxyl group as acceptor(GO:0016774) |
| 0.0 | 0.4 | GO:0004012 | phospholipid-translocating ATPase activity(GO:0004012) |
| 0.0 | 0.5 | GO:0008748 | N-ethylmaleimide reductase activity(GO:0008748) reduced coenzyme F420 dehydrogenase activity(GO:0043738) sulfur oxygenase reductase activity(GO:0043826) malolactic enzyme activity(GO:0043883) epoxyqueuosine reductase activity(GO:0052693) |
| 0.0 | 0.1 | GO:0004614 | phosphoglucomutase activity(GO:0004614) |
| 0.0 | 0.1 | GO:0004430 | 1-phosphatidylinositol 4-kinase activity(GO:0004430) |
| 0.0 | 0.1 | GO:0004833 | tryptophan 2,3-dioxygenase activity(GO:0004833) |
| 0.0 | 0.3 | GO:0070001 | aspartic-type endopeptidase activity(GO:0004190) aspartic-type peptidase activity(GO:0070001) |
| 0.0 | 0.0 | GO:0004677 | DNA-dependent protein kinase activity(GO:0004677) |
| 0.0 | 0.1 | GO:0047623 | AMP deaminase activity(GO:0003876) adenosine-phosphate deaminase activity(GO:0047623) |
| 0.0 | 0.7 | GO:0004715 | non-membrane spanning protein tyrosine kinase activity(GO:0004715) |
| 0.0 | 0.1 | GO:0031749 | D2 dopamine receptor binding(GO:0031749) |
| 0.0 | 0.2 | GO:0030548 | acetylcholine receptor regulator activity(GO:0030548) neurotransmitter receptor regulator activity(GO:0099602) |
| 0.0 | 0.1 | GO:0004514 | nicotinate-nucleotide diphosphorylase (carboxylating) activity(GO:0004514) |
| 0.0 | 0.2 | GO:0004003 | ATP-dependent DNA helicase activity(GO:0004003) |
| 0.0 | 0.1 | GO:0043024 | ribosomal small subunit binding(GO:0043024) |
| 0.0 | 0.2 | GO:0051010 | microtubule plus-end binding(GO:0051010) |
| 0.0 | 0.3 | GO:0015491 | cation:cation antiporter activity(GO:0015491) |
| 0.0 | 0.1 | GO:0016920 | pyroglutamyl-peptidase activity(GO:0016920) |
| 0.0 | 0.1 | GO:0008504 | monoamine transmembrane transporter activity(GO:0008504) |
| 0.0 | 0.0 | GO:0004028 | 3-chloroallyl aldehyde dehydrogenase activity(GO:0004028) |
| 0.0 | 0.1 | GO:0004679 | AMP-activated protein kinase activity(GO:0004679) |
| 0.0 | 0.1 | GO:0004967 | glucagon receptor activity(GO:0004967) |
| 0.0 | 0.1 | GO:0019825 | oxygen binding(GO:0019825) |
| 0.0 | 0.0 | GO:0005338 | nucleotide-sugar transmembrane transporter activity(GO:0005338) |
| 0.0 | 0.0 | GO:0030942 | endoplasmic reticulum signal peptide binding(GO:0030942) |
| 0.0 | 0.1 | GO:0017162 | aryl hydrocarbon receptor binding(GO:0017162) |
| 0.0 | 0.1 | GO:0034821 | pinocarveol dehydrogenase activity(GO:0018446) chloral hydrate dehydrogenase activity(GO:0018447) hydroxymethylmethylsilanediol oxidase activity(GO:0018448) 1-phenylethanol dehydrogenase activity(GO:0018449) myrtenol dehydrogenase activity(GO:0018450) cis-1,2-dihydroxy-1,2-dihydro-8-carboxynaphthalene dehydrogenase activity(GO:0034522) 3-hydroxy-4-methyloctanoyl-CoA dehydrogenase activity(GO:0034582) 2-hydroxy-4-isopropenylcyclohexane-1-carboxyl-CoA dehydrogenase activity(GO:0034778) cis-9,10-dihydroanthracene-9,10-diol dehydrogenase activity(GO:0034817) citronellol dehydrogenase activity(GO:0034821) naphthyl-2-hydroxymethyl-succinyl-CoA dehydrogenase activity(GO:0034847) 2,4,4-trimethyl-1-pentanol dehydrogenase activity(GO:0034863) 2,4,4-trimethyl-3-hydroxypentanoyl-CoA dehydrogenase activity(GO:0034868) 1-hydroxy-4,4-dimethylpentan-3-one dehydrogenase activity(GO:0034871) endosulfan diol dehydrogenase activity(GO:0034891) endosulfan hydroxyether dehydrogenase activity(GO:0034901) 3-hydroxy-2-methylhexanoyl-CoA dehydrogenase activity(GO:0034918) 3-hydroxy-2,6-dimethyl-5-methylene-heptanoyl-CoA dehydrogenase activity(GO:0034944) versicolorin reductase activity(GO:0042469) ketoreductase activity(GO:0045703) |
| 0.0 | 0.2 | GO:0001055 | RNA polymerase II activity(GO:0001055) |
| 0.0 | 0.3 | GO:0008200 | ion channel inhibitor activity(GO:0008200) channel inhibitor activity(GO:0016248) |
| 0.0 | 0.1 | GO:0003726 | double-stranded RNA adenosine deaminase activity(GO:0003726) |
| 0.0 | 0.2 | GO:0035925 | mRNA 3'-UTR AU-rich region binding(GO:0035925) |
| 0.0 | 0.3 | GO:0046703 | natural killer cell lectin-like receptor binding(GO:0046703) |
| 0.0 | 0.4 | GO:0008138 | protein tyrosine/serine/threonine phosphatase activity(GO:0008138) |
| 0.0 | 0.0 | GO:0016635 | oxidoreductase activity, acting on the CH-CH group of donors, quinone or related compound as acceptor(GO:0016635) |
| 0.0 | 0.2 | GO:0015125 | bile acid transmembrane transporter activity(GO:0015125) |
| 0.0 | 0.2 | GO:0031386 | protein tag(GO:0031386) |
| 0.0 | 2.8 | GO:0001227 | transcriptional repressor activity, RNA polymerase II transcription regulatory region sequence-specific binding(GO:0001227) |
| 0.0 | 0.3 | GO:0004089 | carbonate dehydratase activity(GO:0004089) |
| 0.0 | 0.2 | GO:0019215 | intermediate filament binding(GO:0019215) |
| 0.0 | 0.0 | GO:0052650 | NADP-retinol dehydrogenase activity(GO:0052650) |
| 0.0 | 0.5 | GO:0005044 | scavenger receptor activity(GO:0005044) |
| 0.0 | 0.0 | GO:0031821 | G-protein coupled serotonin receptor binding(GO:0031821) |
| 0.0 | 1.2 | GO:0008565 | protein transporter activity(GO:0008565) |
| 0.0 | 0.5 | GO:0019107 | myristoyltransferase activity(GO:0019107) |
| 0.0 | 0.0 | GO:0071209 | U7 snRNA binding(GO:0071209) |
| 0.0 | 0.2 | GO:0071889 | 14-3-3 protein binding(GO:0071889) |
| 0.0 | 0.0 | GO:0097200 | cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:0097200) |
| 0.0 | 3.7 | GO:0005096 | GTPase activator activity(GO:0005096) |
| 0.0 | 0.1 | GO:0070273 | phosphatidylinositol-4-phosphate binding(GO:0070273) |
| 0.0 | 0.1 | GO:0008409 | 5'-3' exonuclease activity(GO:0008409) |
| 0.0 | 0.3 | GO:0005537 | mannose binding(GO:0005537) |
| 0.0 | 0.1 | GO:0004300 | enoyl-CoA hydratase activity(GO:0004300) |
| 0.0 | 0.6 | GO:0003743 | translation initiation factor activity(GO:0003743) |
| 0.0 | 0.1 | GO:0017150 | tRNA dihydrouridine synthase activity(GO:0017150) |
| 0.0 | 0.1 | GO:0016508 | long-chain-enoyl-CoA hydratase activity(GO:0016508) |
| 0.0 | 0.8 | GO:0008527 | taste receptor activity(GO:0008527) |
| 0.0 | 2.1 | GO:0004867 | serine-type endopeptidase inhibitor activity(GO:0004867) |
| 0.0 | 0.0 | GO:1990715 | mRNA CDS binding(GO:1990715) |
| 0.0 | 4.0 | GO:0005525 | GTP binding(GO:0005525) |
| 0.0 | 0.1 | GO:0008131 | primary amine oxidase activity(GO:0008131) |
| 0.0 | 0.1 | GO:0042979 | ornithine decarboxylase regulator activity(GO:0042979) |
| 0.0 | 0.0 | GO:0015205 | purine nucleobase transmembrane transporter activity(GO:0005345) pyrimidine nucleobase transmembrane transporter activity(GO:0005350) nucleobase transmembrane transporter activity(GO:0015205) |
| 0.0 | 1.3 | GO:0036459 | thiol-dependent ubiquitinyl hydrolase activity(GO:0036459) ubiquitinyl hydrolase activity(GO:0101005) |
| 0.0 | 0.2 | GO:0050998 | nitric-oxide synthase binding(GO:0050998) |
| 0.0 | 0.5 | GO:0052770 | coenzyme F390-A hydrolase activity(GO:0052770) coenzyme F390-G hydrolase activity(GO:0052771) |
| 0.0 | 0.0 | GO:0001222 | transcription corepressor binding(GO:0001222) |
| 0.0 | 0.0 | GO:0003831 | beta-N-acetylglucosaminylglycopeptide beta-1,4-galactosyltransferase activity(GO:0003831) |
| 0.0 | 0.2 | GO:0008061 | chitin binding(GO:0008061) |
| 0.0 | 0.7 | GO:0005544 | calcium-dependent phospholipid binding(GO:0005544) |
| 0.0 | 0.2 | GO:0070530 | K63-linked polyubiquitin binding(GO:0070530) |
| 0.0 | 0.1 | GO:0004704 | NF-kappaB-inducing kinase activity(GO:0004704) |
| 0.0 | 0.0 | GO:0035870 | dITP diphosphatase activity(GO:0035870) XTP diphosphatase activity(GO:0036222) |
| 0.0 | 0.0 | GO:0000339 | RNA cap binding(GO:0000339) |
| 0.0 | 0.1 | GO:0030228 | lipoprotein particle receptor activity(GO:0030228) |
| 0.0 | 0.2 | GO:0017091 | AU-rich element binding(GO:0017091) |
| 0.0 | 0.1 | GO:0015197 | peptide transporter activity(GO:0015197) |
| 0.0 | 0.9 | GO:0016820 | hydrolase activity, acting on acid anhydrides, catalyzing transmembrane movement of substances(GO:0016820) |
| 0.0 | 1.3 | GO:0008234 | cysteine-type peptidase activity(GO:0008234) |
| 0.0 | 0.1 | GO:0001875 | lipopolysaccharide receptor activity(GO:0001875) |
| 0.0 | 0.0 | GO:0046975 | histone methyltransferase activity (H3-K36 specific)(GO:0046975) |
| 0.0 | 0.2 | GO:0005112 | Notch binding(GO:0005112) |
| 0.0 | 0.3 | GO:0070003 | threonine-type endopeptidase activity(GO:0004298) threonine-type peptidase activity(GO:0070003) |
| 0.0 | 0.0 | GO:0004365 | glyceraldehyde-3-phosphate dehydrogenase (NAD+) (phosphorylating) activity(GO:0004365) glyceraldehyde-3-phosphate dehydrogenase (NAD(P)+) (phosphorylating) activity(GO:0043891) |
| 0.0 | 0.0 | GO:0004064 | arylesterase activity(GO:0004064) |
| 0.0 | 0.1 | GO:0005223 | intracellular cGMP activated cation channel activity(GO:0005223) |
| 0.0 | 0.2 | GO:0034869 | 2-oxoglutaryl-CoA thioesterase activity(GO:0034843) 2,4,4-trimethyl-3-oxopentanoyl-CoA thioesterase activity(GO:0034869) 3-isopropylbut-3-enoyl-CoA thioesterase activity(GO:0034946) glutaryl-CoA hydrolase activity(GO:0044466) |
| 0.0 | 0.0 | GO:0004942 | anaphylatoxin receptor activity(GO:0004942) |
| 0.0 | 0.1 | GO:0031491 | nucleosome binding(GO:0031491) |
| 0.0 | 0.0 | GO:0015111 | iodide transmembrane transporter activity(GO:0015111) |
| 0.0 | 0.1 | GO:0004169 | dolichyl-phosphate-mannose-protein mannosyltransferase activity(GO:0004169) |
| 0.0 | 0.0 | GO:0003696 | satellite DNA binding(GO:0003696) |
| 0.0 | 0.2 | GO:0030506 | ankyrin binding(GO:0030506) |
| 0.0 | 0.1 | GO:0034584 | piRNA binding(GO:0034584) |
| 0.0 | 0.0 | GO:0072345 | NAADP-sensitive calcium-release channel activity(GO:0072345) |
| 0.0 | 0.0 | GO:0042171 | lysophosphatidic acid acyltransferase activity(GO:0042171) |
| 0.0 | 0.3 | GO:0004527 | exonuclease activity(GO:0004527) |
| 0.0 | 0.0 | GO:0031871 | proteinase activated receptor binding(GO:0031871) |
| 0.0 | 0.4 | GO:0003697 | single-stranded DNA binding(GO:0003697) |
| 0.0 | 0.4 | GO:0034212 | peptide N-acetyltransferase activity(GO:0034212) |
| 0.0 | 0.6 | GO:0008392 | arachidonic acid epoxygenase activity(GO:0008392) |
| 0.0 | 0.1 | GO:0008494 | translation activator activity(GO:0008494) |
| 0.0 | 0.2 | GO:0042800 | histone methyltransferase activity (H3-K4 specific)(GO:0042800) |
| 0.0 | 0.0 | GO:0097108 | hedgehog family protein binding(GO:0097108) |
| 0.0 | 0.1 | GO:0036402 | proteasome-activating ATPase activity(GO:0036402) |
| 0.0 | 0.0 | GO:0070728 | leucine binding(GO:0070728) |
| 0.0 | 0.6 | GO:0008146 | sulfotransferase activity(GO:0008146) |
| 0.0 | 0.1 | GO:0004861 | cyclin-dependent protein serine/threonine kinase inhibitor activity(GO:0004861) |
| 0.0 | 0.1 | GO:0003923 | GPI-anchor transamidase activity(GO:0003923) |
| 0.0 | 0.0 | GO:0004748 | ribonucleoside-diphosphate reductase activity, thioredoxin disulfide as acceptor(GO:0004748) oxidoreductase activity, acting on CH or CH2 groups, disulfide as acceptor(GO:0016728) ribonucleoside-diphosphate reductase activity(GO:0061731) |
| 0.0 | 0.0 | GO:0070698 | type I activin receptor binding(GO:0070698) |
| 0.0 | 0.0 | GO:0004699 | calcium-independent protein kinase C activity(GO:0004699) |
| 0.0 | 0.0 | GO:0004367 | glycerol-3-phosphate dehydrogenase [NAD+] activity(GO:0004367) |
| 0.0 | 0.0 | GO:0031748 | D1 dopamine receptor binding(GO:0031748) |
| 0.0 | 0.0 | GO:0016417 | S-acyltransferase activity(GO:0016417) |
| 0.0 | 0.0 | GO:0046935 | 1-phosphatidylinositol-3-kinase regulator activity(GO:0046935) |
| 0.0 | 0.1 | GO:0008429 | phosphatidylethanolamine binding(GO:0008429) |
| 0.0 | 0.0 | GO:0004999 | vasoactive intestinal polypeptide receptor activity(GO:0004999) |
| 0.0 | 0.0 | GO:0043028 | cysteine-type endopeptidase regulator activity involved in apoptotic process(GO:0043028) |
| 0.0 | 0.2 | GO:0016702 | oxidoreductase activity, acting on single donors with incorporation of molecular oxygen, incorporation of two atoms of oxygen(GO:0016702) |
| 0.0 | 0.1 | GO:0017069 | snRNA binding(GO:0017069) |
| 0.0 | 0.0 | GO:0097603 | temperature-gated ion channel activity(GO:0097603) |
| 0.0 | 0.0 | GO:0004698 | calcium-dependent protein kinase C activity(GO:0004698) |
| 0.0 | 0.0 | GO:0001163 | RNA polymerase I regulatory region sequence-specific DNA binding(GO:0001163) RNA polymerase I CORE element sequence-specific DNA binding(GO:0001164) |
| 0.0 | 2.1 | GO:0017171 | serine hydrolase activity(GO:0017171) |
| 0.0 | 0.0 | GO:0004416 | hydroxyacylglutathione hydrolase activity(GO:0004416) |
| 0.0 | 0.1 | GO:0050321 | tau-protein kinase activity(GO:0050321) |
| 0.0 | 0.1 | GO:0030250 | cyclase activator activity(GO:0010853) guanylate cyclase activator activity(GO:0030250) |
| 0.0 | 0.0 | GO:0008239 | dipeptidyl-peptidase activity(GO:0008239) |
| 0.0 | 0.1 | GO:0098639 | collagen binding involved in cell-matrix adhesion(GO:0098639) |
| 0.0 | 0.1 | GO:0003810 | protein-glutamine gamma-glutamyltransferase activity(GO:0003810) |
| 0.0 | 0.0 | GO:0002094 | polyprenyltransferase activity(GO:0002094) |
| 0.0 | 0.1 | GO:0016670 | oxidoreductase activity, acting on a sulfur group of donors, oxygen as acceptor(GO:0016670) |
| 0.0 | 0.0 | GO:0047023 | androsterone dehydrogenase activity(GO:0047023) |
| 0.0 | 0.0 | GO:0008948 | oxaloacetate decarboxylase activity(GO:0008948) |
| 0.0 | 0.6 | GO:0003777 | microtubule motor activity(GO:0003777) |
| 0.0 | 0.1 | GO:0015928 | fucosidase activity(GO:0015928) |
| 0.0 | 0.4 | GO:0015078 | hydrogen ion transmembrane transporter activity(GO:0015078) |
| 0.0 | 0.0 | GO:0001591 | dopamine neurotransmitter receptor activity, coupled via Gi/Go(GO:0001591) |
| 0.0 | 0.0 | GO:0099604 | calcium-release channel activity(GO:0015278) ligand-gated calcium channel activity(GO:0099604) |
| 0.0 | 0.0 | GO:0016841 | ammonia-lyase activity(GO:0016841) |
| 0.0 | 0.2 | GO:0000049 | tRNA binding(GO:0000049) |
| 0.0 | 0.8 | GO:0003714 | transcription corepressor activity(GO:0003714) |
| 0.0 | 0.0 | GO:0035175 | histone kinase activity (H3-S10 specific)(GO:0035175) |
| 0.0 | 0.2 | GO:0005452 | inorganic anion exchanger activity(GO:0005452) |
| 0.0 | 0.1 | GO:0005523 | tropomyosin binding(GO:0005523) |
| 0.0 | 0.1 | GO:0004000 | adenosine deaminase activity(GO:0004000) |
| 0.0 | 0.0 | GO:0015927 | trehalase activity(GO:0015927) |
| 0.0 | 0.0 | GO:1990050 | phosphatidic acid transporter activity(GO:1990050) |
| 0.0 | 0.0 | GO:0001642 | group III metabotropic glutamate receptor activity(GO:0001642) |
| 0.0 | 0.2 | GO:0017112 | Rab guanyl-nucleotide exchange factor activity(GO:0017112) |
| 0.0 | 0.0 | GO:0031559 | oxidosqualene cyclase activity(GO:0031559) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.3 | 0.9 | PID ECADHERIN KERATINOCYTE PATHWAY | E-cadherin signaling in keratinocytes |
| 0.3 | 2.5 | PID P38 GAMMA DELTA PATHWAY | Signaling mediated by p38-gamma and p38-delta |
| 0.2 | 0.3 | PID ERBB4 PATHWAY | ErbB4 signaling events |
| 0.2 | 3.8 | PID HDAC CLASSIII PATHWAY | Signaling events mediated by HDAC Class III |
| 0.2 | 5.4 | PID IL2 PI3K PATHWAY | IL2 signaling events mediated by PI3K |
| 0.2 | 2.3 | PID CIRCADIAN PATHWAY | Circadian rhythm pathway |
| 0.1 | 4.8 | SIG PIP3 SIGNALING IN B LYMPHOCYTES | Genes related to PIP3 signaling in B lymphocytes |
| 0.1 | 3.9 | PID HIF2PATHWAY | HIF-2-alpha transcription factor network |
| 0.1 | 2.7 | PID WNT CANONICAL PATHWAY | Canonical Wnt signaling pathway |
| 0.1 | 0.1 | PID ERBB NETWORK PATHWAY | ErbB receptor signaling network |
| 0.1 | 3.2 | PID INTEGRIN2 PATHWAY | Beta2 integrin cell surface interactions |
| 0.1 | 1.0 | PID IL2 STAT5 PATHWAY | IL2 signaling events mediated by STAT5 |
| 0.1 | 2.6 | PID RXR VDR PATHWAY | RXR and RAR heterodimerization with other nuclear receptor |
| 0.1 | 1.1 | SA G1 AND S PHASES | Cdk2, 4, and 6 bind cyclin D in G1, while cdk2/cyclin E promotes the G1/S transition. |
| 0.1 | 0.4 | PID PDGFRA PATHWAY | PDGFR-alpha signaling pathway |
| 0.1 | 2.2 | PID EPO PATHWAY | EPO signaling pathway |
| 0.1 | 4.2 | PID FANCONI PATHWAY | Fanconi anemia pathway |
| 0.1 | 0.3 | SIG IL4RECEPTOR IN B LYPHOCYTES | Genes related to IL4 rceptor signaling in B lymphocytes |
| 0.1 | 1.1 | PID EPHA2 FWD PATHWAY | EPHA2 forward signaling |
| 0.1 | 1.7 | PID CD40 PATHWAY | CD40/CD40L signaling |
| 0.1 | 3.6 | PID FGF PATHWAY | FGF signaling pathway |
| 0.1 | 2.5 | PID IL1 PATHWAY | IL1-mediated signaling events |
| 0.1 | 1.1 | PID P38 ALPHA BETA PATHWAY | Regulation of p38-alpha and p38-beta |
| 0.1 | 2.6 | PID IL8 CXCR2 PATHWAY | IL8- and CXCR2-mediated signaling events |
| 0.1 | 0.1 | PID GLYPICAN 1PATHWAY | Glypican 1 network |
| 0.1 | 2.2 | PID HDAC CLASSII PATHWAY | Signaling events mediated by HDAC Class II |
| 0.1 | 2.8 | PID HNF3A PATHWAY | FOXA1 transcription factor network |
| 0.1 | 1.4 | PID ARF 3PATHWAY | Arf1 pathway |
| 0.1 | 2.1 | PID HDAC CLASSI PATHWAY | Signaling events mediated by HDAC Class I |
| 0.1 | 0.6 | PID RETINOIC ACID PATHWAY | Retinoic acid receptors-mediated signaling |
| 0.1 | 1.2 | SIG INSULIN RECEPTOR PATHWAY IN CARDIAC MYOCYTES | Genes related to the insulin receptor pathway |
| 0.1 | 0.7 | PID TCR CALCIUM PATHWAY | Calcium signaling in the CD4+ TCR pathway |
| 0.1 | 1.6 | PID PTP1B PATHWAY | Signaling events mediated by PTP1B |
| 0.1 | 1.8 | PID CDC42 REG PATHWAY | Regulation of CDC42 activity |
| 0.1 | 0.5 | PID IGF1 PATHWAY | IGF1 pathway |
| 0.1 | 0.2 | SA G2 AND M PHASES | Cdc25 activates the cdc2/cyclin B complex to induce the G2/M transition. |
| 0.1 | 1.6 | PID AURORA A PATHWAY | Aurora A signaling |
| 0.1 | 0.4 | PID S1P S1P4 PATHWAY | S1P4 pathway |
| 0.1 | 0.1 | PID NFKAPPAB ATYPICAL PATHWAY | Atypical NF-kappaB pathway |
| 0.1 | 2.8 | PID TELOMERASE PATHWAY | Regulation of Telomerase |
| 0.1 | 1.3 | PID AMB2 NEUTROPHILS PATHWAY | amb2 Integrin signaling |
| 0.1 | 2.3 | PID MET PATHWAY | Signaling events mediated by Hepatocyte Growth Factor Receptor (c-Met) |
| 0.1 | 0.1 | PID AVB3 OPN PATHWAY | Osteopontin-mediated events |
| 0.1 | 0.3 | PID BETA CATENIN DEG PATHWAY | Degradation of beta catenin |
| 0.1 | 1.1 | PID MYC PATHWAY | C-MYC pathway |
| 0.1 | 0.1 | SA TRKA RECEPTOR | The TrkA receptor binds nerve growth factor to activate MAP kinase pathways and promote cell growth. |
| 0.1 | 1.2 | PID ECADHERIN NASCENT AJ PATHWAY | E-cadherin signaling in the nascent adherens junction |
| 0.1 | 1.1 | PID SHP2 PATHWAY | SHP2 signaling |
| 0.1 | 0.5 | PID IL3 PATHWAY | IL3-mediated signaling events |
| 0.1 | 0.4 | PID NFKAPPAB CANONICAL PATHWAY | Canonical NF-kappaB pathway |
| 0.1 | 0.4 | PID THROMBIN PAR1 PATHWAY | PAR1-mediated thrombin signaling events |
| 0.1 | 0.8 | PID CXCR4 PATHWAY | CXCR4-mediated signaling events |
| 0.1 | 4.8 | PID P53 DOWNSTREAM PATHWAY | Direct p53 effectors |
| 0.1 | 0.1 | PID ARF6 DOWNSTREAM PATHWAY | Arf6 downstream pathway |
| 0.1 | 0.2 | ST JAK STAT PATHWAY | Jak-STAT Pathway |
| 0.1 | 2.6 | PID MYC ACTIV PATHWAY | Validated targets of C-MYC transcriptional activation |
| 0.1 | 1.5 | PID NFAT TFPATHWAY | Calcineurin-regulated NFAT-dependent transcription in lymphocytes |
| 0.1 | 1.5 | PID PLK1 PATHWAY | PLK1 signaling events |
| 0.1 | 0.5 | PID FAS PATHWAY | FAS (CD95) signaling pathway |
| 0.0 | 0.5 | PID IL23 PATHWAY | IL23-mediated signaling events |
| 0.0 | 0.4 | PID SYNDECAN 1 PATHWAY | Syndecan-1-mediated signaling events |
| 0.0 | 0.1 | PID IL8 CXCR1 PATHWAY | IL8- and CXCR1-mediated signaling events |
| 0.0 | 0.3 | PID TXA2PATHWAY | Thromboxane A2 receptor signaling |
| 0.0 | 0.4 | PID PRL SIGNALING EVENTS PATHWAY | Signaling events mediated by PRL |
| 0.0 | 0.9 | PID P38 ALPHA BETA DOWNSTREAM PATHWAY | Signaling mediated by p38-alpha and p38-beta |
| 0.0 | 0.2 | PID NFAT 3PATHWAY | Role of Calcineurin-dependent NFAT signaling in lymphocytes |
| 0.0 | 0.1 | SA REG CASCADE OF CYCLIN EXPR | Expression of cyclins regulates progression through the cell cycle by activating cyclin-dependent kinases. |
| 0.0 | 0.1 | PID WNT NONCANONICAL PATHWAY | Noncanonical Wnt signaling pathway |
| 0.0 | 1.7 | NABA COLLAGENS | Genes encoding collagen proteins |
| 0.0 | 0.2 | PID ANTHRAX PATHWAY | Cellular roles of Anthrax toxin |
| 0.0 | 0.4 | PID RAC1 PATHWAY | RAC1 signaling pathway |
| 0.0 | 0.3 | PID TCPTP PATHWAY | Signaling events mediated by TCPTP |
| 0.0 | 1.0 | PID IL12 2PATHWAY | IL12-mediated signaling events |
| 0.0 | 0.2 | SIG CHEMOTAXIS | Genes related to chemotaxis |
| 0.0 | 0.4 | ST GA12 PATHWAY | G alpha 12 Pathway |
| 0.0 | 0.1 | ST IL 13 PATHWAY | Interleukin 13 (IL-13) Pathway |
| 0.0 | 0.0 | ST ADRENERGIC | Adrenergic Pathway |
| 0.0 | 1.3 | ST INTEGRIN SIGNALING PATHWAY | Integrin Signaling Pathway |
| 0.0 | 0.1 | ST INTERLEUKIN 4 PATHWAY | Interleukin 4 (IL-4) Pathway |
| 0.0 | 0.2 | SIG CD40PATHWAYMAP | Genes related to CD40 signaling |
| 0.0 | 0.1 | PID INTEGRIN A9B1 PATHWAY | Alpha9 beta1 integrin signaling events |
| 0.0 | 0.4 | PID TRKR PATHWAY | Neurotrophic factor-mediated Trk receptor signaling |
| 0.0 | 0.1 | PID A6B1 A6B4 INTEGRIN PATHWAY | a6b1 and a6b4 Integrin signaling |
| 0.0 | 0.2 | PID P38 MKK3 6PATHWAY | p38 MAPK signaling pathway |
| 0.0 | 0.1 | PID S1P S1P3 PATHWAY | S1P3 pathway |
| 0.0 | 0.1 | ST GAQ PATHWAY | G alpha q Pathway |
| 0.0 | 0.4 | PID CD8 TCR DOWNSTREAM PATHWAY | Downstream signaling in naïve CD8+ T cells |
| 0.0 | 0.3 | PID LPA4 PATHWAY | LPA4-mediated signaling events |
| 0.0 | 0.6 | PID PDGFRB PATHWAY | PDGFR-beta signaling pathway |
| 0.0 | 0.3 | PID ERBB1 INTERNALIZATION PATHWAY | Internalization of ErbB1 |
| 0.0 | 0.1 | PID ER NONGENOMIC PATHWAY | Plasma membrane estrogen receptor signaling |
| 0.0 | 0.0 | PID GMCSF PATHWAY | GMCSF-mediated signaling events |
| 0.0 | 0.0 | ST INTERFERON GAMMA PATHWAY | Interferon gamma pathway. |
| 0.0 | 0.5 | PID RHOA REG PATHWAY | Regulation of RhoA activity |
| 0.0 | 0.3 | PID ERBB1 DOWNSTREAM PATHWAY | ErbB1 downstream signaling |
| 0.0 | 0.0 | SA FAS SIGNALING | The TNF-type receptor Fas induces apoptosis on ligand binding. |
| 0.0 | 0.4 | PID AP1 PATHWAY | AP-1 transcription factor network |
| 0.0 | 0.2 | PID AVB3 INTEGRIN PATHWAY | Integrins in angiogenesis |
| 0.0 | 0.5 | PID HNF3B PATHWAY | FOXA2 and FOXA3 transcription factor networks |
| 0.0 | 0.2 | PID TOLL ENDOGENOUS PATHWAY | Endogenous TLR signaling |
| 0.0 | 0.0 | SIG PIP3 SIGNALING IN CARDIAC MYOCTES | Genes related to PIP3 signaling in cardiac myocytes |
| 0.0 | 0.1 | PID BARD1 PATHWAY | BARD1 signaling events |
| 0.0 | 0.3 | PID RHODOPSIN PATHWAY | Visual signal transduction: Rods |
| 0.0 | 0.1 | PID ERBB2 ERBB3 PATHWAY | ErbB2/ErbB3 signaling events |
| 0.0 | 0.0 | ST B CELL ANTIGEN RECEPTOR | B Cell Antigen Receptor |
| 0.0 | 0.0 | ST TUMOR NECROSIS FACTOR PATHWAY | Tumor Necrosis Factor Pathway. |
| 0.0 | 1.7 | NABA ECM AFFILIATED | Genes encoding proteins affiliated structurally or functionally to extracellular matrix proteins |
| 0.0 | 0.1 | SIG BCR SIGNALING PATHWAY | Members of the BCR signaling pathway |
| 0.0 | 0.3 | PID SMAD2 3NUCLEAR PATHWAY | Regulation of nuclear SMAD2/3 signaling |
| 0.0 | 0.1 | PID ERB GENOMIC PATHWAY | Validated nuclear estrogen receptor beta network |
| 0.0 | 0.0 | ST G ALPHA S PATHWAY | G alpha s Pathway |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.3 | 2.7 | REACTOME NEF MEDIATED DOWNREGULATION OF MHC CLASS I COMPLEX CELL SURFACE EXPRESSION | Genes involved in Nef mediated downregulation of MHC class I complex cell surface expression |
| 0.2 | 0.7 | REACTOME REGULATION OF RHEB GTPASE ACTIVITY BY AMPK | Genes involved in Regulation of Rheb GTPase activity by AMPK |
| 0.2 | 1.1 | REACTOME RNA POL I PROMOTER OPENING | Genes involved in RNA Polymerase I Promoter Opening |
| 0.2 | 3.1 | REACTOME TGF BETA RECEPTOR SIGNALING IN EMT EPITHELIAL TO MESENCHYMAL TRANSITION | Genes involved in TGF-beta receptor signaling in EMT (epithelial to mesenchymal transition) |
| 0.2 | 2.6 | REACTOME NOTCH HLH TRANSCRIPTION PATHWAY | Genes involved in Notch-HLH transcription pathway |
| 0.2 | 1.8 | REACTOME IL 6 SIGNALING | Genes involved in Interleukin-6 signaling |
| 0.2 | 1.5 | REACTOME COPI MEDIATED TRANSPORT | Genes involved in COPI Mediated Transport |
| 0.2 | 1.7 | REACTOME REGULATION OF COMPLEMENT CASCADE | Genes involved in Regulation of Complement cascade |
| 0.2 | 1.3 | REACTOME RECYCLING OF BILE ACIDS AND SALTS | Genes involved in Recycling of bile acids and salts |
| 0.2 | 2.9 | REACTOME ACTIVATED AMPK STIMULATES FATTY ACID OXIDATION IN MUSCLE | Genes involved in Activated AMPK stimulates fatty-acid oxidation in muscle |
| 0.2 | 1.7 | REACTOME PURINE SALVAGE | Genes involved in Purine salvage |
| 0.2 | 1.2 | REACTOME ABACAVIR TRANSPORT AND METABOLISM | Genes involved in Abacavir transport and metabolism |
| 0.1 | 4.3 | REACTOME GPVI MEDIATED ACTIVATION CASCADE | Genes involved in GPVI-mediated activation cascade |
| 0.1 | 1.3 | REACTOME PROLACTIN RECEPTOR SIGNALING | Genes involved in Prolactin receptor signaling |
| 0.1 | 2.2 | REACTOME GRB2 SOS PROVIDES LINKAGE TO MAPK SIGNALING FOR INTERGRINS | Genes involved in GRB2:SOS provides linkage to MAPK signaling for Intergrins |
| 0.1 | 0.5 | REACTOME NFKB IS ACTIVATED AND SIGNALS SURVIVAL | Genes involved in NF-kB is activated and signals survival |
| 0.1 | 1.4 | REACTOME CYTOSOLIC SULFONATION OF SMALL MOLECULES | Genes involved in Cytosolic sulfonation of small molecules |
| 0.1 | 1.5 | REACTOME ASSOCIATION OF LICENSING FACTORS WITH THE PRE REPLICATIVE COMPLEX | Genes involved in Association of licensing factors with the pre-replicative complex |
| 0.1 | 2.3 | REACTOME N GLYCAN ANTENNAE ELONGATION IN THE MEDIAL TRANS GOLGI | Genes involved in N-glycan antennae elongation in the medial/trans-Golgi |
| 0.1 | 2.2 | REACTOME ACTIVATED TAK1 MEDIATES P38 MAPK ACTIVATION | Genes involved in activated TAK1 mediates p38 MAPK activation |
| 0.1 | 2.0 | REACTOME AMINO ACID SYNTHESIS AND INTERCONVERSION TRANSAMINATION | Genes involved in Amino acid synthesis and interconversion (transamination) |
| 0.1 | 1.8 | REACTOME PROCESSING OF INTRONLESS PRE MRNAS | Genes involved in Processing of Intronless Pre-mRNAs |
| 0.1 | 2.2 | REACTOME TERMINATION OF O GLYCAN BIOSYNTHESIS | Genes involved in Termination of O-glycan biosynthesis |
| 0.1 | 2.8 | REACTOME IL1 SIGNALING | Genes involved in Interleukin-1 signaling |
| 0.1 | 1.4 | REACTOME HOMOLOGOUS RECOMBINATION REPAIR OF REPLICATION INDEPENDENT DOUBLE STRAND BREAKS | Genes involved in Homologous recombination repair of replication-independent double-strand breaks |
| 0.1 | 5.8 | REACTOME METABOLISM OF VITAMINS AND COFACTORS | Genes involved in Metabolism of vitamins and cofactors |
| 0.1 | 2.9 | REACTOME SYNTHESIS OF PA | Genes involved in Synthesis of PA |
| 0.1 | 1.8 | REACTOME ABCA TRANSPORTERS IN LIPID HOMEOSTASIS | Genes involved in ABCA transporters in lipid homeostasis |
| 0.1 | 2.4 | REACTOME FGFR LIGAND BINDING AND ACTIVATION | Genes involved in FGFR ligand binding and activation |
| 0.1 | 1.2 | REACTOME ERKS ARE INACTIVATED | Genes involved in ERKs are inactivated |
| 0.1 | 1.5 | REACTOME REPAIR SYNTHESIS FOR GAP FILLING BY DNA POL IN TC NER | Genes involved in Repair synthesis for gap-filling by DNA polymerase in TC-NER |
| 0.1 | 2.8 | REACTOME SPHINGOLIPID DE NOVO BIOSYNTHESIS | Genes involved in Sphingolipid de novo biosynthesis |
| 0.1 | 2.3 | REACTOME PYRIMIDINE METABOLISM | Genes involved in Pyrimidine metabolism |
| 0.1 | 0.3 | REACTOME PD1 SIGNALING | Genes involved in PD-1 signaling |
| 0.1 | 0.4 | REACTOME SHC MEDIATED CASCADE | Genes involved in SHC-mediated cascade |
| 0.1 | 2.8 | REACTOME AMINO ACID TRANSPORT ACROSS THE PLASMA MEMBRANE | Genes involved in Amino acid transport across the plasma membrane |
| 0.1 | 1.4 | REACTOME CHYLOMICRON MEDIATED LIPID TRANSPORT | Genes involved in Chylomicron-mediated lipid transport |
| 0.1 | 0.7 | REACTOME REGULATION OF KIT SIGNALING | Genes involved in Regulation of KIT signaling |
| 0.1 | 0.2 | REACTOME IL 7 SIGNALING | Genes involved in Interleukin-7 signaling |
| 0.1 | 0.4 | REACTOME ACTIVATION OF THE MRNA UPON BINDING OF THE CAP BINDING COMPLEX AND EIFS AND SUBSEQUENT BINDING TO 43S | Genes involved in Activation of the mRNA upon binding of the cap-binding complex and eIFs, and subsequent binding to 43S |
| 0.1 | 0.1 | REACTOME SIGNAL REGULATORY PROTEIN SIRP FAMILY INTERACTIONS | Genes involved in Signal regulatory protein (SIRP) family interactions |
| 0.1 | 1.2 | REACTOME FANCONI ANEMIA PATHWAY | Genes involved in Fanconi Anemia pathway |
| 0.1 | 3.6 | REACTOME FORMATION OF THE TERNARY COMPLEX AND SUBSEQUENTLY THE 43S COMPLEX | Genes involved in Formation of the ternary complex, and subsequently, the 43S complex |
| 0.1 | 0.8 | REACTOME PASSIVE TRANSPORT BY AQUAPORINS | Genes involved in Passive Transport by Aquaporins |
| 0.1 | 1.4 | REACTOME SMAD2 SMAD3 SMAD4 HETEROTRIMER REGULATES TRANSCRIPTION | Genes involved in SMAD2/SMAD3:SMAD4 heterotrimer regulates transcription |
| 0.1 | 0.1 | REACTOME THROMBOXANE SIGNALLING THROUGH TP RECEPTOR | Genes involved in Thromboxane signalling through TP receptor |
| 0.1 | 1.4 | REACTOME INHIBITION OF THE PROTEOLYTIC ACTIVITY OF APC C REQUIRED FOR THE ONSET OF ANAPHASE BY MITOTIC SPINDLE CHECKPOINT COMPONENTS | Genes involved in Inhibition of the proteolytic activity of APC/C required for the onset of anaphase by mitotic spindle checkpoint components |
| 0.1 | 0.9 | REACTOME SIGNALING BY FGFR MUTANTS | Genes involved in Signaling by FGFR mutants |
| 0.1 | 1.6 | REACTOME SMOOTH MUSCLE CONTRACTION | Genes involved in Smooth Muscle Contraction |
| 0.1 | 1.2 | REACTOME POST CHAPERONIN TUBULIN FOLDING PATHWAY | Genes involved in Post-chaperonin tubulin folding pathway |
| 0.1 | 0.7 | REACTOME LATENT INFECTION OF HOMO SAPIENS WITH MYCOBACTERIUM TUBERCULOSIS | Genes involved in Latent infection of Homo sapiens with Mycobacterium tuberculosis |
| 0.1 | 0.7 | REACTOME HYALURONAN UPTAKE AND DEGRADATION | Genes involved in Hyaluronan uptake and degradation |
| 0.1 | 3.7 | REACTOME GLYCEROPHOSPHOLIPID BIOSYNTHESIS | Genes involved in Glycerophospholipid biosynthesis |
| 0.1 | 1.0 | REACTOME PREFOLDIN MEDIATED TRANSFER OF SUBSTRATE TO CCT TRIC | Genes involved in Prefoldin mediated transfer of substrate to CCT/TriC |
| 0.1 | 0.4 | REACTOME PLATELET SENSITIZATION BY LDL | Genes involved in Platelet sensitization by LDL |
| 0.1 | 0.8 | REACTOME ABC FAMILY PROTEINS MEDIATED TRANSPORT | Genes involved in ABC-family proteins mediated transport |
| 0.1 | 0.1 | REACTOME GLUCAGON SIGNALING IN METABOLIC REGULATION | Genes involved in Glucagon signaling in metabolic regulation |
| 0.1 | 3.7 | REACTOME ANTIVIRAL MECHANISM BY IFN STIMULATED GENES | Genes involved in Antiviral mechanism by IFN-stimulated genes |
| 0.1 | 0.9 | REACTOME INTRINSIC PATHWAY | Genes involved in Intrinsic Pathway |
| 0.1 | 1.5 | REACTOME SYNTHESIS OF PIPS AT THE PLASMA MEMBRANE | Genes involved in Synthesis of PIPs at the plasma membrane |
| 0.1 | 1.9 | REACTOME HS GAG BIOSYNTHESIS | Genes involved in HS-GAG biosynthesis |
| 0.1 | 0.4 | REACTOME G2 M DNA DAMAGE CHECKPOINT | Genes involved in G2/M DNA damage checkpoint |
| 0.1 | 2.2 | REACTOME ION TRANSPORT BY P TYPE ATPASES | Genes involved in Ion transport by P-type ATPases |
| 0.1 | 0.7 | REACTOME DEADENYLATION OF MRNA | Genes involved in Deadenylation of mRNA |
| 0.1 | 1.5 | REACTOME G1 PHASE | Genes involved in G1 Phase |
| 0.1 | 1.0 | REACTOME ANTIGEN ACTIVATES B CELL RECEPTOR LEADING TO GENERATION OF SECOND MESSENGERS | Genes involved in Antigen Activates B Cell Receptor Leading to Generation of Second Messengers |
| 0.1 | 0.5 | REACTOME ALPHA LINOLENIC ACID ALA METABOLISM | Genes involved in alpha-linolenic acid (ALA) metabolism |
| 0.1 | 0.1 | REACTOME OPSINS | Genes involved in Opsins |
| 0.1 | 1.4 | REACTOME PTM GAMMA CARBOXYLATION HYPUSINE FORMATION AND ARYLSULFATASE ACTIVATION | Genes involved in PTM: gamma carboxylation, hypusine formation and arylsulfatase activation |
| 0.1 | 0.4 | REACTOME MEMBRANE BINDING AND TARGETTING OF GAG PROTEINS | Genes involved in Membrane binding and targetting of GAG proteins |
| 0.1 | 0.3 | REACTOME PACKAGING OF TELOMERE ENDS | Genes involved in Packaging Of Telomere Ends |
| 0.1 | 0.9 | REACTOME ZINC TRANSPORTERS | Genes involved in Zinc transporters |
| 0.1 | 0.2 | REACTOME SIGNALING BY CONSTITUTIVELY ACTIVE EGFR | Genes involved in Signaling by constitutively active EGFR |
| 0.1 | 1.1 | REACTOME SEMA4D IN SEMAPHORIN SIGNALING | Genes involved in Sema4D in semaphorin signaling |
| 0.1 | 0.2 | REACTOME G PROTEIN BETA GAMMA SIGNALLING | Genes involved in G-protein beta:gamma signalling |
| 0.1 | 3.0 | REACTOME RESPONSE TO ELEVATED PLATELET CYTOSOLIC CA2 | Genes involved in Response to elevated platelet cytosolic Ca2+ |
| 0.1 | 2.4 | REACTOME CHEMOKINE RECEPTORS BIND CHEMOKINES | Genes involved in Chemokine receptors bind chemokines |
| 0.1 | 0.8 | REACTOME LYSOSOME VESICLE BIOGENESIS | Genes involved in Lysosome Vesicle Biogenesis |
| 0.1 | 0.6 | REACTOME FORMATION OF ATP BY CHEMIOSMOTIC COUPLING | Genes involved in Formation of ATP by chemiosmotic coupling |
| 0.1 | 0.1 | REACTOME REMOVAL OF THE FLAP INTERMEDIATE FROM THE C STRAND | Genes involved in Removal of the Flap Intermediate from the C-strand |
| 0.1 | 0.7 | REACTOME NOD1 2 SIGNALING PATHWAY | Genes involved in NOD1/2 Signaling Pathway |
| 0.1 | 0.6 | REACTOME ENOS ACTIVATION AND REGULATION | Genes involved in eNOS activation and regulation |
| 0.1 | 0.7 | REACTOME BOTULINUM NEUROTOXICITY | Genes involved in Botulinum neurotoxicity |
| 0.1 | 0.2 | REACTOME APOPTOSIS INDUCED DNA FRAGMENTATION | Genes involved in Apoptosis induced DNA fragmentation |
| 0.1 | 0.6 | REACTOME ANTIGEN PRESENTATION FOLDING ASSEMBLY AND PEPTIDE LOADING OF CLASS I MHC | Genes involved in Antigen Presentation: Folding, assembly and peptide loading of class I MHC |
| 0.1 | 0.4 | REACTOME REGULATION OF IFNG SIGNALING | Genes involved in Regulation of IFNG signaling |
| 0.1 | 0.2 | REACTOME ROLE OF SECOND MESSENGERS IN NETRIN1 SIGNALING | Genes involved in Role of second messengers in netrin-1 signaling |
| 0.1 | 0.4 | REACTOME A TETRASACCHARIDE LINKER SEQUENCE IS REQUIRED FOR GAG SYNTHESIS | Genes involved in A tetrasaccharide linker sequence is required for GAG synthesis |
| 0.1 | 1.2 | REACTOME TRANSFERRIN ENDOCYTOSIS AND RECYCLING | Genes involved in Transferrin endocytosis and recycling |
| 0.0 | 0.8 | REACTOME BRANCHED CHAIN AMINO ACID CATABOLISM | Genes involved in Branched-chain amino acid catabolism |
| 0.0 | 0.2 | REACTOME DESTABILIZATION OF MRNA BY BRF1 | Genes involved in Destabilization of mRNA by Butyrate Response Factor 1 (BRF1) |
| 0.0 | 0.2 | REACTOME AQUAPORIN MEDIATED TRANSPORT | Genes involved in Aquaporin-mediated transport |
| 0.0 | 0.9 | REACTOME MRNA 3 END PROCESSING | Genes involved in mRNA 3'-end processing |
| 0.0 | 0.4 | REACTOME CALNEXIN CALRETICULIN CYCLE | Genes involved in Calnexin/calreticulin cycle |
| 0.0 | 0.4 | REACTOME ACTIVATION OF GENES BY ATF4 | Genes involved in Activation of Genes by ATF4 |
| 0.0 | 0.9 | REACTOME DEPOSITION OF NEW CENPA CONTAINING NUCLEOSOMES AT THE CENTROMERE | Genes involved in Deposition of New CENPA-containing Nucleosomes at the Centromere |
| 0.0 | 0.6 | REACTOME SIGNALING BY NODAL | Genes involved in Signaling by NODAL |
| 0.0 | 4.2 | REACTOME SIGNALING BY RHO GTPASES | Genes involved in Signaling by Rho GTPases |
| 0.0 | 0.5 | REACTOME IL RECEPTOR SHC SIGNALING | Genes involved in Interleukin receptor SHC signaling |
| 0.0 | 0.2 | REACTOME CASPASE MEDIATED CLEAVAGE OF CYTOSKELETAL PROTEINS | Genes involved in Caspase-mediated cleavage of cytoskeletal proteins |
| 0.0 | 2.1 | REACTOME LATE PHASE OF HIV LIFE CYCLE | Genes involved in Late Phase of HIV Life Cycle |
| 0.0 | 0.3 | REACTOME RECEPTOR LIGAND BINDING INITIATES THE SECOND PROTEOLYTIC CLEAVAGE OF NOTCH RECEPTOR | Genes involved in Receptor-ligand binding initiates the second proteolytic cleavage of Notch receptor |
| 0.0 | 0.1 | REACTOME KINESINS | Genes involved in Kinesins |
| 0.0 | 0.2 | REACTOME FORMATION OF TRANSCRIPTION COUPLED NER TC NER REPAIR COMPLEX | Genes involved in Formation of transcription-coupled NER (TC-NER) repair complex |
| 0.0 | 0.5 | REACTOME METABOLISM OF POLYAMINES | Genes involved in Metabolism of polyamines |
| 0.0 | 2.2 | REACTOME MHC CLASS II ANTIGEN PRESENTATION | Genes involved in MHC class II antigen presentation |
| 0.0 | 0.5 | REACTOME PRESYNAPTIC NICOTINIC ACETYLCHOLINE RECEPTORS | Genes involved in Presynaptic nicotinic acetylcholine receptors |
| 0.0 | 1.4 | REACTOME NCAM1 INTERACTIONS | Genes involved in NCAM1 interactions |
| 0.0 | 0.7 | REACTOME SULFUR AMINO ACID METABOLISM | Genes involved in Sulfur amino acid metabolism |
| 0.0 | 0.3 | REACTOME HORMONE SENSITIVE LIPASE HSL MEDIATED TRIACYLGLYCEROL HYDROLYSIS | Genes involved in Hormone-sensitive lipase (HSL)-mediated triacylglycerol hydrolysis |
| 0.0 | 0.0 | REACTOME NEGATIVE REGULATION OF FGFR SIGNALING | Genes involved in Negative regulation of FGFR signaling |
| 0.0 | 0.5 | REACTOME REGULATION OF IFNA SIGNALING | Genes involved in Regulation of IFNA signaling |
| 0.0 | 0.1 | REACTOME P38MAPK EVENTS | Genes involved in p38MAPK events |
| 0.0 | 0.4 | REACTOME BASE EXCISION REPAIR | Genes involved in Base Excision Repair |
| 0.0 | 0.4 | REACTOME TRANSCRIPTIONAL REGULATION OF WHITE ADIPOCYTE DIFFERENTIATION | Genes involved in Transcriptional Regulation of White Adipocyte Differentiation |
| 0.0 | 0.1 | REACTOME RNA POL III TRANSCRIPTION TERMINATION | Genes involved in RNA Polymerase III Transcription Termination |
| 0.0 | 0.4 | REACTOME GLYCOGEN BREAKDOWN GLYCOGENOLYSIS | Genes involved in Glycogen breakdown (glycogenolysis) |
| 0.0 | 0.2 | REACTOME METAL ION SLC TRANSPORTERS | Genes involved in Metal ion SLC transporters |
| 0.0 | 0.9 | REACTOME NOTCH1 INTRACELLULAR DOMAIN REGULATES TRANSCRIPTION | Genes involved in NOTCH1 Intracellular Domain Regulates Transcription |
| 0.0 | 0.2 | REACTOME MTORC1 MEDIATED SIGNALLING | Genes involved in mTORC1-mediated signalling |
| 0.0 | 2.0 | REACTOME NONSENSE MEDIATED DECAY ENHANCED BY THE EXON JUNCTION COMPLEX | Genes involved in Nonsense Mediated Decay Enhanced by the Exon Junction Complex |
| 0.0 | 2.0 | REACTOME FACTORS INVOLVED IN MEGAKARYOCYTE DEVELOPMENT AND PLATELET PRODUCTION | Genes involved in Factors involved in megakaryocyte development and platelet production |
| 0.0 | 0.4 | REACTOME NCAM SIGNALING FOR NEURITE OUT GROWTH | Genes involved in NCAM signaling for neurite out-growth |
| 0.0 | 0.5 | REACTOME METABOLISM OF PORPHYRINS | Genes involved in Metabolism of porphyrins |
| 0.0 | 0.4 | REACTOME TRAF6 MEDIATED NFKB ACTIVATION | Genes involved in TRAF6 mediated NF-kB activation |
| 0.0 | 0.7 | REACTOME CYTOSOLIC TRNA AMINOACYLATION | Genes involved in Cytosolic tRNA aminoacylation |
| 0.0 | 0.2 | REACTOME COSTIMULATION BY THE CD28 FAMILY | Genes involved in Costimulation by the CD28 family |
| 0.0 | 0.1 | REACTOME INFLUENZA VIRAL RNA TRANSCRIPTION AND REPLICATION | Genes involved in Influenza Viral RNA Transcription and Replication |
| 0.0 | 0.4 | REACTOME MRNA DECAY BY 3 TO 5 EXORIBONUCLEASE | Genes involved in mRNA Decay by 3' to 5' Exoribonuclease |
| 0.0 | 0.2 | REACTOME ACTIVATION OF THE AP1 FAMILY OF TRANSCRIPTION FACTORS | Genes involved in Activation of the AP-1 family of transcription factors |
| 0.0 | 0.3 | REACTOME PKA MEDIATED PHOSPHORYLATION OF CREB | Genes involved in PKA-mediated phosphorylation of CREB |
| 0.0 | 0.8 | REACTOME TIGHT JUNCTION INTERACTIONS | Genes involved in Tight junction interactions |
| 0.0 | 0.2 | REACTOME CREATION OF C4 AND C2 ACTIVATORS | Genes involved in Creation of C4 and C2 activators |
| 0.0 | 0.2 | REACTOME SIGNAL ATTENUATION | Genes involved in Signal attenuation |
| 0.0 | 0.2 | REACTOME PRE NOTCH TRANSCRIPTION AND TRANSLATION | Genes involved in Pre-NOTCH Transcription and Translation |
| 0.0 | 0.4 | REACTOME SYNTHESIS SECRETION AND DEACYLATION OF GHRELIN | Genes involved in Synthesis, Secretion, and Deacylation of Ghrelin |
| 0.0 | 2.3 | REACTOME METABOLISM OF AMINO ACIDS AND DERIVATIVES | Genes involved in Metabolism of amino acids and derivatives |
| 0.0 | 1.1 | REACTOME LOSS OF NLP FROM MITOTIC CENTROSOMES | Genes involved in Loss of Nlp from mitotic centrosomes |
| 0.0 | 0.3 | REACTOME MEIOTIC RECOMBINATION | Genes involved in Meiotic Recombination |
| 0.0 | 0.4 | REACTOME NUCLEOTIDE LIKE PURINERGIC RECEPTORS | Genes involved in Nucleotide-like (purinergic) receptors |
| 0.0 | 0.1 | REACTOME TRANSPORT OF MATURE TRANSCRIPT TO CYTOPLASM | Genes involved in Transport of Mature Transcript to Cytoplasm |
| 0.0 | 0.2 | REACTOME PHOSPHORYLATION OF CD3 AND TCR ZETA CHAINS | Genes involved in Phosphorylation of CD3 and TCR zeta chains |
| 0.0 | 1.3 | REACTOME NUCLEAR RECEPTOR TRANSCRIPTION PATHWAY | Genes involved in Nuclear Receptor transcription pathway |
| 0.0 | 0.6 | REACTOME CHOLESTEROL BIOSYNTHESIS | Genes involved in Cholesterol biosynthesis |
| 0.0 | 4.4 | REACTOME ANTIGEN PROCESSING UBIQUITINATION PROTEASOME DEGRADATION | Genes involved in Antigen processing: Ubiquitination & Proteasome degradation |
| 0.0 | 0.1 | REACTOME DCC MEDIATED ATTRACTIVE SIGNALING | Genes involved in DCC mediated attractive signaling |
| 0.0 | 0.5 | REACTOME MITOCHONDRIAL TRNA AMINOACYLATION | Genes involved in Mitochondrial tRNA aminoacylation |
| 0.0 | 0.0 | REACTOME CIRCADIAN REPRESSION OF EXPRESSION BY REV ERBA | Genes involved in Circadian Repression of Expression by REV-ERBA |
| 0.0 | 0.1 | REACTOME P53 DEPENDENT G1 DNA DAMAGE RESPONSE | Genes involved in p53-Dependent G1 DNA Damage Response |
| 0.0 | 0.3 | REACTOME INTEGRATION OF ENERGY METABOLISM | Genes involved in Integration of energy metabolism |
| 0.0 | 0.1 | REACTOME SCFSKP2 MEDIATED DEGRADATION OF P27 P21 | Genes involved in SCF(Skp2)-mediated degradation of p27/p21 |
| 0.0 | 0.8 | REACTOME ACTIVATION OF CHAPERONE GENES BY XBP1S | Genes involved in Activation of Chaperone Genes by XBP1(S) |
| 0.0 | 0.2 | REACTOME ACTIVATION OF BH3 ONLY PROTEINS | Genes involved in Activation of BH3-only proteins |
| 0.0 | 0.1 | REACTOME INTERACTIONS OF VPR WITH HOST CELLULAR PROTEINS | Genes involved in Interactions of Vpr with host cellular proteins |
| 0.0 | 0.2 | REACTOME HDL MEDIATED LIPID TRANSPORT | Genes involved in HDL-mediated lipid transport |
| 0.0 | 0.0 | REACTOME SIGNALLING TO RAS | Genes involved in Signalling to RAS |
| 0.0 | 0.0 | REACTOME DESTABILIZATION OF MRNA BY KSRP | Genes involved in Destabilization of mRNA by KSRP |
| 0.0 | 0.1 | REACTOME ETHANOL OXIDATION | Genes involved in Ethanol oxidation |
| 0.0 | 0.0 | REACTOME SIGNALING BY FGFR | Genes involved in Signaling by FGFR |
| 0.0 | 0.2 | REACTOME BILE SALT AND ORGANIC ANION SLC TRANSPORTERS | Genes involved in Bile salt and organic anion SLC transporters |
| 0.0 | 0.2 | REACTOME THROMBIN SIGNALLING THROUGH PROTEINASE ACTIVATED RECEPTORS PARS | Genes involved in Thrombin signalling through proteinase activated receptors (PARs) |
| 0.0 | 0.1 | REACTOME RNA POL II TRANSCRIPTION | Genes involved in RNA Polymerase II Transcription |
| 0.0 | 0.5 | REACTOME REGULATION OF INSULIN SECRETION BY GLUCAGON LIKE PEPTIDE1 | Genes involved in Regulation of Insulin Secretion by Glucagon-like Peptide-1 |
| 0.0 | 0.1 | REACTOME IRON UPTAKE AND TRANSPORT | Genes involved in Iron uptake and transport |
| 0.0 | 1.0 | REACTOME MRNA SPLICING | Genes involved in mRNA Splicing |
| 0.0 | 0.4 | REACTOME MEIOSIS | Genes involved in Meiosis |
| 0.0 | 0.1 | REACTOME GLUCURONIDATION | Genes involved in Glucuronidation |
| 0.0 | 0.0 | REACTOME NFKB ACTIVATION THROUGH FADD RIP1 PATHWAY MEDIATED BY CASPASE 8 AND10 | Genes involved in NF-kB activation through FADD/RIP-1 pathway mediated by caspase-8 and -10 |
| 0.0 | 0.2 | REACTOME MRNA DECAY BY 5 TO 3 EXORIBONUCLEASE | Genes involved in mRNA Decay by 5' to 3' Exoribonuclease |
| 0.0 | 0.0 | REACTOME PLATELET ADHESION TO EXPOSED COLLAGEN | Genes involved in Platelet Adhesion to exposed collagen |
| 0.0 | 0.4 | REACTOME TRANSPORT OF VITAMINS NUCLEOSIDES AND RELATED MOLECULES | Genes involved in Transport of vitamins, nucleosides, and related molecules |
| 0.0 | 0.2 | REACTOME APOPTOTIC CLEAVAGE OF CELL ADHESION PROTEINS | Genes involved in Apoptotic cleavage of cell adhesion proteins |
| 0.0 | 0.1 | REACTOME TRAFFICKING AND PROCESSING OF ENDOSOMAL TLR | Genes involved in Trafficking and processing of endosomal TLR |
| 0.0 | 0.3 | REACTOME ENDOSOMAL SORTING COMPLEX REQUIRED FOR TRANSPORT ESCRT | Genes involved in Endosomal Sorting Complex Required For Transport (ESCRT) |
| 0.0 | 0.3 | REACTOME GLUTATHIONE CONJUGATION | Genes involved in Glutathione conjugation |
| 0.0 | 0.2 | REACTOME PI METABOLISM | Genes involved in PI Metabolism |
| 0.0 | 0.1 | REACTOME TRAF3 DEPENDENT IRF ACTIVATION PATHWAY | Genes involved in TRAF3-dependent IRF activation pathway |
| 0.0 | 0.0 | REACTOME ACTIVATION OF CHAPERONES BY ATF6 ALPHA | Genes involved in Activation of Chaperones by ATF6-alpha |
| 0.0 | 0.0 | REACTOME DESTABILIZATION OF MRNA BY AUF1 HNRNP D0 | Genes involved in Destabilization of mRNA by AUF1 (hnRNP D0) |
| 0.0 | 0.1 | REACTOME THE NLRP3 INFLAMMASOME | Genes involved in The NLRP3 inflammasome |
| 0.0 | 0.1 | REACTOME CELL EXTRACELLULAR MATRIX INTERACTIONS | Genes involved in Cell-extracellular matrix interactions |
| 0.0 | 0.2 | REACTOME SYNTHESIS AND INTERCONVERSION OF NUCLEOTIDE DI AND TRIPHOSPHATES | Genes involved in Synthesis and interconversion of nucleotide di- and triphosphates |
| 0.0 | 0.0 | REACTOME GROWTH HORMONE RECEPTOR SIGNALING | Genes involved in Growth hormone receptor signaling |
| 0.0 | 0.0 | REACTOME REGULATION OF SIGNALING BY CBL | Genes involved in Regulation of signaling by CBL |
| 0.0 | 0.0 | REACTOME GAP JUNCTION DEGRADATION | Genes involved in Gap junction degradation |
| 0.0 | 0.0 | REACTOME CYCLIN A B1 ASSOCIATED EVENTS DURING G2 M TRANSITION | Genes involved in Cyclin A/B1 associated events during G2/M transition |
| 0.0 | 0.1 | REACTOME REGULATION OF APOPTOSIS | Genes involved in Regulation of Apoptosis |
| 0.0 | 0.1 | REACTOME RECYCLING PATHWAY OF L1 | Genes involved in Recycling pathway of L1 |