Gene Symbol | Gene ID | Gene Info |
---|---|---|
Pax7
|
ENSMUSG00000028736.7 | paired box 7 |
CRE | Gene | Distance | Association probability | Pearson corr. coef. | P-value | Plot |
---|---|---|---|---|---|---|
Pax7 | chr4_139797453_139797604 | 35479 | 0.166802 | -0.57 | 5.1e-06 | Click! |
Pax7 | chr4_139831560_139831716 | 1369 | 0.484072 | -0.37 | 4.9e-03 | Click! |
Pax7 | chr4_139833135_139833286 | 203 | 0.951911 | -0.35 | 9.7e-03 | Click! |
Pax7 | chr4_139758913_139759064 | 74019 | 0.084363 | 0.33 | 1.5e-02 | Click! |
Pax7 | chr4_139759129_139759298 | 73794 | 0.084718 | 0.32 | 1.8e-02 | Click! |
Move your cursor over a bar to see sample name and corresponding Z-value.
Cis Regulatory Element (CRE) | Target Score | Top associated gene | Gene Info | Distance of CRE to TSS | CRE/Gene association probability |
---|---|---|---|---|---|
chr6_54552680_54553127 | 7.12 |
Scrn1 |
secernin 1 |
1543 |
0.37 |
chr4_21665942_21666298 | 5.92 |
Gm11876 |
predicted gene 11876 |
4920 |
0.2 |
chr13_84751597_84751791 | 5.63 |
Gm26913 |
predicted gene, 26913 |
60753 |
0.15 |
chr13_94376190_94376445 | 5.59 |
Ap3b1 |
adaptor-related protein complex 3, beta 1 subunit |
17357 |
0.17 |
chr1_168328003_168328211 | 5.59 |
Gm37524 |
predicted gene, 37524 |
9564 |
0.24 |
chr10_91888563_91888862 | 5.40 |
Gm31592 |
predicted gene, 31592 |
117 |
0.98 |
chr13_83749857_83750036 | 5.37 |
C130071C03Rik |
RIKEN cDNA C130071C03 gene |
11083 |
0.12 |
chr6_86068961_86069117 | 5.19 |
Add2 |
adducin 2 (beta) |
9018 |
0.13 |
chr5_8116684_8116835 | 5.10 |
Adam22 |
a disintegrin and metallopeptidase domain 22 |
154 |
0.96 |
chr11_40624416_40624805 | 4.99 |
Gm12137 |
predicted gene 12137 |
11892 |
0.19 |
chr9_15450906_15451300 | 4.82 |
Gm48634 |
predicted gene, 48634 |
10632 |
0.13 |
chr9_69592688_69592984 | 4.74 |
Gm47203 |
predicted gene, 47203 |
6918 |
0.25 |
chr3_40673604_40673797 | 4.65 |
Intu |
inturned planar cell polarity protein |
1079 |
0.49 |
chr1_193647967_193648118 | 4.64 |
Mir205hg |
Mir205 host gene |
137868 |
0.04 |
chr15_66486114_66486277 | 4.59 |
Lrrc6 |
leucine rich repeat containing 6 (testis) |
14715 |
0.23 |
chr2_29385665_29385826 | 4.56 |
Med27 |
mediator complex subunit 27 |
5599 |
0.2 |
chr16_63806441_63806811 | 4.55 |
Epha3 |
Eph receptor A3 |
56787 |
0.15 |
chr13_83750227_83750397 | 4.54 |
C130071C03Rik |
RIKEN cDNA C130071C03 gene |
11449 |
0.12 |
chr8_14815208_14815364 | 4.45 |
Dlgap2 |
DLG associated protein 2 |
37513 |
0.15 |
chrX_9696032_9696343 | 4.37 |
Dynlt3 |
dynein light chain Tctex-type 3 |
33184 |
0.19 |
chr2_54265163_54265368 | 4.30 |
Gm14035 |
predicted gene 14035 |
18850 |
0.21 |
chr12_67272489_67272659 | 4.30 |
Mdga2 |
MAM domain containing glycosylphosphatidylinositol anchor 2 |
50025 |
0.15 |
chr3_72790721_72790890 | 4.29 |
Gm22451 |
predicted gene, 22451 |
52824 |
0.17 |
chr1_96346717_96347057 | 4.26 |
Gm37076 |
predicted gene, 37076 |
33645 |
0.18 |
chrX_61393166_61393371 | 4.25 |
Gm14665 |
predicted gene 14665 |
4241 |
0.3 |
chr9_120444732_120444907 | 4.20 |
Myrip |
myosin VIIA and Rab interacting protein |
17413 |
0.14 |
chr5_42509326_42509477 | 4.17 |
Gm7181 |
predicted gene 7181 |
8987 |
0.33 |
chr2_134003402_134003565 | 4.11 |
Gm25258 |
predicted gene, 25258 |
419062 |
0.01 |
chr12_7959672_7959823 | 4.10 |
Gm48633 |
predicted gene, 48633 |
9686 |
0.19 |
chr3_16819794_16819956 | 4.08 |
Gm26485 |
predicted gene, 26485 |
3437 |
0.4 |
chr1_165935347_165935547 | 4.06 |
Pou2f1 |
POU domain, class 2, transcription factor 1 |
436 |
0.79 |
chr9_66933818_66934187 | 4.04 |
Rps27l |
ribosomal protein S27-like |
12084 |
0.15 |
chr9_61093084_61093352 | 3.97 |
Gm34004 |
predicted gene, 34004 |
11267 |
0.14 |
chr2_117429451_117429602 | 3.94 |
Gm13982 |
predicted gene 13982 |
11829 |
0.27 |
chr3_9938766_9938917 | 3.92 |
Gm17877 |
predicted gene, 17877 |
33160 |
0.14 |
chr16_49319216_49319367 | 3.91 |
Gm5407 |
predicted gene 5407 |
21393 |
0.2 |
chr11_107416646_107416819 | 3.88 |
Gm11713 |
predicted gene 11713 |
6342 |
0.14 |
chr14_111996201_111996363 | 3.82 |
Gm22764 |
predicted gene, 22764 |
30234 |
0.18 |
chr15_85463386_85463550 | 3.80 |
7530416G11Rik |
RIKEN cDNA 7530416G11 gene |
39759 |
0.14 |
chr4_63389695_63390110 | 3.76 |
Aknaos |
AT-hook transcription factor, opposite strand |
8544 |
0.12 |
chr3_127652402_127652663 | 3.75 |
Neurog2 |
neurogenin 2 |
19397 |
0.11 |
chr17_11927079_11927230 | 3.72 |
Prkn |
parkin RBR E3 ubiquitin protein ligase |
81944 |
0.1 |
chr2_40982887_40983039 | 3.71 |
Gm13460 |
predicted gene 13460 |
15894 |
0.24 |
chr4_71933713_71933873 | 3.70 |
Gm11234 |
predicted gene 11234 |
46684 |
0.17 |
chr11_11014435_11014603 | 3.67 |
Vwc2 |
von Willebrand factor C domain containing 2 |
99704 |
0.08 |
chr1_92737544_92737901 | 3.67 |
Gm29483 |
predicted gene 29483 |
20520 |
0.12 |
chr12_58670274_58670654 | 3.66 |
Gm18873 |
predicted gene, 18873 |
93442 |
0.08 |
chr17_3259235_3259403 | 3.60 |
Gm34035 |
predicted gene, 34035 |
23888 |
0.14 |
chr2_21270050_21270364 | 3.59 |
Gm13378 |
predicted gene 13378 |
26102 |
0.17 |
chr2_79152361_79152739 | 3.59 |
Gm14465 |
predicted gene 14465 |
9045 |
0.26 |
chr5_4814461_4814770 | 3.56 |
Gm43112 |
predicted gene 43112 |
8012 |
0.12 |
chr14_38920859_38921010 | 3.54 |
Gm27332 |
predicted gene, 27332 |
20990 |
0.23 |
chr19_15502585_15502938 | 3.54 |
Gm24319 |
predicted gene, 24319 |
177243 |
0.03 |
chr18_54580752_54580966 | 3.53 |
9330117O12Rik |
RIKEN cDNA 9330117O12 gene |
30885 |
0.21 |
chr11_107917768_107918133 | 3.51 |
Cacng5 |
calcium channel, voltage-dependent, gamma subunit 5 |
2895 |
0.24 |
chr17_51536754_51537055 | 3.49 |
Gm31143 |
predicted gene, 31143 |
2046 |
0.39 |
chr4_21095762_21096024 | 3.49 |
Gm11871 |
predicted gene 11871 |
84953 |
0.1 |
chr13_107407739_107407917 | 3.48 |
Apoo-ps |
apolipoprotein O, pseudogene |
6901 |
0.24 |
chr1_157969609_157969781 | 3.47 |
Gm38256 |
predicted gene, 38256 |
29310 |
0.25 |
chr18_39437611_39437767 | 3.46 |
Gm15337 |
predicted gene 15337 |
48264 |
0.13 |
chr8_31895464_31895660 | 3.44 |
Nrg1 |
neuregulin 1 |
8976 |
0.25 |
chr1_14108426_14108817 | 3.44 |
Gm37400 |
predicted gene, 37400 |
4198 |
0.31 |
chr8_17621193_17621344 | 3.44 |
Csmd1 |
CUB and Sushi multiple domains 1 |
85682 |
0.11 |
chr10_33083669_33083857 | 3.42 |
Trdn |
triadin |
202 |
0.96 |
chr5_107497898_107498054 | 3.42 |
Btbd8 |
BTB (POZ) domain containing 8 |
197 |
0.9 |
chr7_144159645_144159812 | 3.40 |
Shank2 |
SH3 and multiple ankyrin repeat domains 2 |
15801 |
0.23 |
chr10_31551495_31551682 | 3.40 |
Gm47693 |
predicted gene, 47693 |
5852 |
0.19 |
chr12_92589457_92589626 | 3.38 |
Gm18500 |
predicted gene, 18500 |
115580 |
0.07 |
chrX_61823685_61823865 | 3.38 |
Gm6743 |
predicted pseudogene 6743 |
6735 |
0.25 |
chr6_5110493_5110850 | 3.37 |
Ppp1r9a |
protein phosphatase 1, regulatory subunit 9A |
12 |
0.98 |
chr5_150894457_150894771 | 3.37 |
Gm43298 |
predicted gene 43298 |
11972 |
0.2 |
chr19_59006658_59006882 | 3.37 |
Shtn1 |
shootin 1 |
31515 |
0.15 |
chr3_153456471_153456622 | 3.36 |
4930597L12Rik |
RIKEN cDNA 4930597L12 gene |
18108 |
0.18 |
chr18_64492858_64493138 | 3.36 |
Fech |
ferrochelatase |
2747 |
0.22 |
chr16_91301496_91301834 | 3.35 |
Gm15966 |
predicted gene 15966 |
24075 |
0.11 |
chr13_100874679_100874847 | 3.34 |
Gm37830 |
predicted gene, 37830 |
1983 |
0.26 |
chr9_69844583_69844734 | 3.32 |
Gm18745 |
predicted gene, 18745 |
51507 |
0.13 |
chr3_119063263_119063539 | 3.31 |
Gm43410 |
predicted gene 43410 |
195157 |
0.03 |
chr18_40059274_40059425 | 3.31 |
Gm50395 |
predicted gene, 50395 |
50384 |
0.16 |
chr1_173328507_173328658 | 3.31 |
Ackr1 |
atypical chemokine receptor 1 (Duffy blood group) |
4920 |
0.16 |
chr16_57858746_57859204 | 3.31 |
Gm24039 |
predicted gene, 24039 |
25164 |
0.15 |
chr3_80871615_80871766 | 3.30 |
Glrb |
glycine receptor, beta subunit |
14435 |
0.23 |
chr1_194630781_194630934 | 3.30 |
Plxna2 |
plexin A2 |
11032 |
0.18 |
chr8_47642536_47642697 | 3.29 |
Gm8623 |
predicted gene 8623 |
9852 |
0.12 |
chr13_40075153_40075349 | 3.28 |
Gm47316 |
predicted gene, 47316 |
190870 |
0.03 |
chr12_84532163_84533007 | 3.27 |
Lin52 |
lin-52 homolog (C. elegans) |
2541 |
0.25 |
chr16_93971277_93971428 | 3.25 |
Gm49618 |
predicted gene, 49618 |
11200 |
0.14 |
chr14_59819467_59819618 | 3.24 |
Gm19716 |
predicted gene, 19716 |
176994 |
0.03 |
chr6_5739796_5740151 | 3.24 |
Dync1i1 |
dynein cytoplasmic 1 intermediate chain 1 |
14155 |
0.3 |
chr5_82898292_82898575 | 3.24 |
Gm24129 |
predicted gene, 24129 |
94668 |
0.08 |
chr19_12143485_12143636 | 3.23 |
Olfr76 |
olfactory receptor 76 |
20357 |
0.08 |
chr10_87501180_87501623 | 3.20 |
Gm48120 |
predicted gene, 48120 |
6461 |
0.19 |
chr5_25652707_25652858 | 3.19 |
Gm43972 |
predicted gene, 43972 |
7027 |
0.15 |
chr5_26176163_26176336 | 3.19 |
Gm10220 |
predicted gene 10220 |
54828 |
0.1 |
chr7_73354299_73354479 | 3.18 |
Rgma |
repulsive guidance molecule family member A |
21120 |
0.13 |
chr3_25773512_25773703 | 3.17 |
Gm6197 |
predicted gene 6197 |
42364 |
0.19 |
chr10_64544466_64544617 | 3.16 |
Gm23854 |
predicted gene, 23854 |
239797 |
0.02 |
chr6_97938315_97938470 | 3.15 |
Mitf |
melanogenesis associated transcription factor |
2526 |
0.37 |
chr13_83739197_83739995 | 3.15 |
C130071C03Rik |
RIKEN cDNA C130071C03 gene |
733 |
0.33 |
chr16_97002225_97002647 | 3.12 |
Gm32432 |
predicted gene, 32432 |
83679 |
0.1 |
chr12_51002047_51002408 | 3.11 |
Gm40421 |
predicted gene, 40421 |
2646 |
0.28 |
chr13_114109901_114110177 | 3.11 |
Gm47479 |
predicted gene, 47479 |
10377 |
0.23 |
chr3_107066739_107066904 | 3.10 |
A930002I21Rik |
RIKEN cDNA A930002I21 gene |
24059 |
0.12 |
chr3_154817331_154817637 | 3.09 |
Gm18589 |
predicted gene, 18589 |
22123 |
0.2 |
chr18_30950333_30950492 | 3.09 |
Rit2 |
Ras-like without CAAX 2 |
262320 |
0.02 |
chr2_70127967_70128143 | 3.08 |
Myo3b |
myosin IIIB |
31757 |
0.19 |
chr17_90892371_90892658 | 3.07 |
4930480K15Rik |
RIKEN cDNA 4930480K15 gene |
31345 |
0.22 |
chr12_58619814_58620024 | 3.07 |
Gm18873 |
predicted gene, 18873 |
143987 |
0.04 |
chr15_80362829_80363158 | 3.06 |
Cacna1i |
calcium channel, voltage-dependent, alpha 1I subunit |
26335 |
0.15 |
chr5_77888510_77888967 | 3.06 |
Gm42673 |
predicted gene 42673 |
20722 |
0.27 |
chr2_162282305_162282495 | 3.05 |
Ptprtos |
protein tyrosine phosphatase, receptor type T, opposite strand |
108413 |
0.07 |
chr12_92474799_92474950 | 3.05 |
Gm18500 |
predicted gene, 18500 |
913 |
0.74 |
chr1_129644632_129644987 | 3.03 |
Thsd7b |
thrombospondin, type I, domain containing 7B |
31534 |
0.2 |
chr10_104686578_104686765 | 3.02 |
Gm25522 |
predicted gene, 25522 |
178637 |
0.03 |
chr5_18137788_18137983 | 3.02 |
Gnat3 |
guanine nucleotide binding protein, alpha transducing 3 |
175336 |
0.03 |
chr11_112501711_112502406 | 3.01 |
BC006965 |
cDNA sequence BC006965 |
167340 |
0.04 |
chr9_16345275_16345564 | 3.01 |
Fat3 |
FAT atypical cadherin 3 |
32812 |
0.23 |
chr6_103514048_103514248 | 3.00 |
Chl1 |
cell adhesion molecule L1-like |
2818 |
0.24 |
chr5_148688618_148688795 | 3.00 |
Gm36186 |
predicted gene, 36186 |
22760 |
0.16 |
chr10_91720395_91720571 | 2.99 |
Gm47091 |
predicted gene, 47091 |
79593 |
0.11 |
chr17_71976866_71977017 | 2.98 |
Gm49924 |
predicted gene, 49924 |
49911 |
0.16 |
chr15_15120134_15120285 | 2.98 |
Gm49118 |
predicted gene, 49118 |
17978 |
0.3 |
chr3_89559026_89559196 | 2.98 |
Kcnn3 |
potassium intermediate/small conductance calcium-activated channel, subfamily N, member 3 |
38947 |
0.12 |
chr13_99444397_99444879 | 2.98 |
Map1b |
microtubule-associated protein 1B |
171 |
0.95 |
chr2_43836042_43836270 | 2.97 |
Arhgap15 |
Rho GTPase activating protein 15 |
87286 |
0.1 |
chr4_24213358_24214284 | 2.97 |
Gm11892 |
predicted gene 11892 |
24279 |
0.27 |
chr15_37787189_37787357 | 2.96 |
Ncald |
neurocalcin delta |
4727 |
0.2 |
chr2_41093986_41094158 | 2.96 |
Gm13460 |
predicted gene 13460 |
95215 |
0.09 |
chr19_14777449_14777621 | 2.96 |
Gm26026 |
predicted gene, 26026 |
59055 |
0.15 |
chrX_130820134_130820324 | 2.95 |
Gm26209 |
predicted gene, 26209 |
67549 |
0.13 |
chr11_98339036_98339432 | 2.95 |
Ppp1r1b |
protein phosphatase 1, regulatory inhibitor subunit 1B |
9170 |
0.09 |
chr2_28780313_28780498 | 2.95 |
Gm13385 |
predicted gene 13385 |
13164 |
0.13 |
chr3_27059899_27060315 | 2.95 |
Gm7558 |
predicted gene 7558 |
12154 |
0.17 |
chr4_111686063_111686242 | 2.94 |
Spata6 |
spermatogenesis associated 6 |
33832 |
0.2 |
chr9_123384688_123385098 | 2.94 |
Lars2 |
leucyl-tRNA synthetase, mitochondrial |
7157 |
0.21 |
chr13_106562212_106562531 | 2.94 |
Dph3b-ps |
diphthamide biosynthesis 3, pseudogene |
15311 |
0.22 |
chr6_64274347_64275027 | 2.92 |
Gm25205 |
predicted gene, 25205 |
138961 |
0.05 |
chr14_55052295_55052661 | 2.91 |
Zfhx2os |
zinc finger homeobox 2, opposite strand |
1391 |
0.2 |
chr15_55142836_55143014 | 2.91 |
Deptor |
DEP domain containing MTOR-interacting protein |
9472 |
0.18 |
chr1_191839032_191839754 | 2.91 |
Nek2 |
NIMA (never in mitosis gene a)-related expressed kinase 2 |
12245 |
0.14 |
chr7_133224308_133224511 | 2.89 |
4930483O08Rik |
RIKEN cDNA 4930483O08 gene |
96158 |
0.06 |
chrX_11494604_11494755 | 2.88 |
Gm14515 |
predicted gene 14515 |
106675 |
0.06 |
chr12_106103355_106103539 | 2.88 |
Gm32635 |
predicted gene, 32635 |
4476 |
0.22 |
chr1_186505235_186505386 | 2.87 |
A730004F24Rik |
RIKEN cDNA A730004F24 gene |
53162 |
0.15 |
chr4_109762760_109763127 | 2.87 |
Gm12808 |
predicted gene 12808 |
8126 |
0.24 |
chr6_55484275_55484600 | 2.86 |
Adcyap1r1 |
adenylate cyclase activating polypeptide 1 receptor 1 |
24201 |
0.19 |
chr2_101107239_101107866 | 2.86 |
Gm20693 |
predicted gene 20693 |
463072 |
0.01 |
chr10_29176911_29177070 | 2.84 |
Gm49353 |
predicted gene, 49353 |
21964 |
0.13 |
chr4_124562937_124563101 | 2.84 |
4933407E24Rik |
RIKEN cDNA 4933407E24 gene |
6171 |
0.2 |
chr11_41532495_41533004 | 2.84 |
Hspd1-ps3 |
heat shock protein 1 (chaperonin), pseudogene 3 |
34012 |
0.2 |
chr15_96178501_96178674 | 2.81 |
4833422M21Rik |
RIKEN cDNA 4833422M21 gene |
63202 |
0.11 |
chr1_52079807_52079978 | 2.81 |
Gm28177 |
predicted gene 28177 |
2631 |
0.2 |
chr11_28697993_28698421 | 2.80 |
2810471M01Rik |
RIKEN cDNA 2810471M01 gene |
16643 |
0.16 |
chr13_119753907_119754230 | 2.80 |
Nim1k |
NIM1 serine/threonine protein kinase |
1814 |
0.21 |
chr6_32056516_32056667 | 2.80 |
1700012A03Rik |
RIKEN cDNA 1700012A03 gene |
1550 |
0.51 |
chr3_121009308_121009523 | 2.79 |
Gm43444 |
predicted gene 43444 |
11361 |
0.21 |
chr15_78698186_78698356 | 2.79 |
Elfn2 |
leucine rich repeat and fibronectin type III, extracellular 2 |
12508 |
0.14 |
chr7_124990908_124991076 | 2.79 |
Gm45093 |
predicted gene 45093 |
78499 |
0.09 |
chrX_93429781_93429946 | 2.78 |
Pola1 |
polymerase (DNA directed), alpha 1 |
61083 |
0.12 |
chr11_109320378_109320869 | 2.78 |
Rgs9 |
regulator of G-protein signaling 9 |
22494 |
0.13 |
chr11_118955047_118955296 | 2.78 |
Enpp7 |
ectonucleotide pyrophosphatase/phosphodiesterase 7 |
33017 |
0.13 |
chr16_6310851_6311003 | 2.77 |
Rbfox1 |
RNA binding protein, fox-1 homolog (C. elegans) 1 |
38211 |
0.24 |
chr18_56871340_56871513 | 2.77 |
Gm18087 |
predicted gene, 18087 |
44662 |
0.14 |
chr8_28252481_28252806 | 2.77 |
Gm8100 |
predicted gene 8100 |
66803 |
0.13 |
chrX_109969856_109970177 | 2.76 |
Gm4991 |
predicted gene 4991 |
59795 |
0.17 |
chr3_84938330_84938481 | 2.76 |
Fbxw7 |
F-box and WD-40 domain protein 7 |
12925 |
0.26 |
chr17_8368820_8369004 | 2.74 |
T2 |
brachyury 2 |
3484 |
0.15 |
chr5_25652364_25652515 | 2.74 |
Gm43972 |
predicted gene, 43972 |
7370 |
0.15 |
chr14_35027814_35027992 | 2.73 |
Mir346 |
microRNA 346 |
133294 |
0.05 |
chr16_97007919_97008110 | 2.73 |
Gm32432 |
predicted gene, 32432 |
89257 |
0.09 |
chr12_48284505_48284715 | 2.72 |
Gm48587 |
predicted gene, 48587 |
210609 |
0.02 |
chr13_84783651_84783837 | 2.71 |
Gm26913 |
predicted gene, 26913 |
92803 |
0.09 |
chr1_61472382_61472604 | 2.70 |
Gm25839 |
predicted gene, 25839 |
2052 |
0.25 |
chr2_41094225_41094401 | 2.70 |
Gm13460 |
predicted gene 13460 |
95456 |
0.09 |
chr16_63747767_63748162 | 2.69 |
Gm22769 |
predicted gene, 22769 |
430 |
0.91 |
chr2_151631930_151632148 | 2.68 |
Snph |
syntaphilin |
432 |
0.78 |
chr6_128070983_128071135 | 2.68 |
Gm26338 |
predicted gene, 26338 |
23967 |
0.14 |
chr3_94465598_94465829 | 2.68 |
Riiad1 |
regulatory subunit of type II PKA R-subunit (RIIa) domain containing 1 |
7209 |
0.08 |
chr14_64418028_64418284 | 2.68 |
Msra |
methionine sulfoxide reductase A |
877 |
0.71 |
chr5_45008044_45008269 | 2.67 |
Gm10205 |
predicted gene 10205 |
23914 |
0.2 |
chr3_157321647_157321798 | 2.67 |
Gm22458 |
predicted gene, 22458 |
44276 |
0.14 |
chr7_79525861_79526321 | 2.67 |
Mir9-3hg |
Mir9-3 host gene |
1759 |
0.18 |
chr8_30732987_30733174 | 2.67 |
4933433F19Rik |
RIKEN cDNA 4933433F19 gene |
164687 |
0.04 |
chr13_97008532_97008712 | 2.67 |
Gm48609 |
predicted gene, 48609 |
6677 |
0.17 |
chr16_62355588_62355739 | 2.65 |
CT010569.1 |
NADH dehydrogenase 5, mitochondrial (mt-Nd5) pseudogene |
128286 |
0.06 |
chr17_63807674_63808197 | 2.64 |
Fer |
fer (fms/fps related) protein kinase |
55127 |
0.13 |
chr5_116895407_116895611 | 2.64 |
Gm43122 |
predicted gene 43122 |
64955 |
0.1 |
chr8_86961518_86961711 | 2.64 |
Gm24781 |
predicted gene, 24781 |
4005 |
0.19 |
chr5_121142490_121142657 | 2.64 |
Ptpn11 |
protein tyrosine phosphatase, non-receptor type 11 |
1062 |
0.5 |
chr18_90094586_90094765 | 2.64 |
Gm6173 |
predicted gene 6173 |
75596 |
0.11 |
chr16_84042025_84042426 | 2.63 |
Gm41481 |
predicted gene, 41481 |
15159 |
0.29 |
chr2_93957909_93958083 | 2.63 |
Gm13889 |
predicted gene 13889 |
795 |
0.55 |
chrX_60545622_60545821 | 2.62 |
Gm715 |
predicted gene 715 |
2298 |
0.23 |
chr2_143218003_143218365 | 2.62 |
Gm14082 |
predicted gene 14082 |
66554 |
0.11 |
chr10_27103841_27103992 | 2.62 |
Lama2 |
laminin, alpha 2 |
47271 |
0.17 |
chr6_54119809_54119960 | 2.62 |
Chn2 |
chimerin 2 |
22164 |
0.18 |
chr5_17500946_17501127 | 2.61 |
Gm7047 |
predicted gene 7047 |
7813 |
0.23 |
chr6_138872837_138873028 | 2.60 |
Gm9038 |
predicted gene 9038 |
12808 |
0.29 |
chr1_41605488_41605642 | 2.59 |
Gm28634 |
predicted gene 28634 |
76022 |
0.12 |
chr7_25461846_25462025 | 2.58 |
Ceacam1 |
carcinoembryonic antigen-related cell adhesion molecule 1 |
14769 |
0.1 |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
1.1 | 3.3 | GO:0090158 | endoplasmic reticulum membrane organization(GO:0090158) |
1.0 | 5.1 | GO:0061669 | spontaneous neurotransmitter secretion(GO:0061669) spontaneous synaptic transmission(GO:0098814) |
1.0 | 3.8 | GO:2001013 | epithelial cell proliferation involved in renal tubule morphogenesis(GO:2001013) |
0.9 | 4.5 | GO:0071699 | olfactory placode formation(GO:0030910) olfactory placode development(GO:0071698) olfactory placode morphogenesis(GO:0071699) |
0.9 | 2.7 | GO:0006842 | tricarboxylic acid transport(GO:0006842) citrate transport(GO:0015746) |
0.7 | 2.9 | GO:0051612 | negative regulation of neurotransmitter uptake(GO:0051581) regulation of serotonin uptake(GO:0051611) negative regulation of serotonin uptake(GO:0051612) |
0.7 | 2.1 | GO:2001170 | negative regulation of ATP biosynthetic process(GO:2001170) |
0.6 | 1.9 | GO:0048388 | endosomal lumen acidification(GO:0048388) |
0.6 | 2.4 | GO:0030091 | protein repair(GO:0030091) |
0.6 | 2.3 | GO:0006538 | glutamate catabolic process(GO:0006538) |
0.5 | 2.6 | GO:1903887 | motile primary cilium assembly(GO:1903887) |
0.5 | 1.5 | GO:0048677 | axon extension involved in regeneration(GO:0048677) sprouting of injured axon(GO:0048682) |
0.5 | 1.5 | GO:0060125 | negative regulation of growth hormone secretion(GO:0060125) |
0.5 | 0.5 | GO:2000302 | positive regulation of synaptic vesicle exocytosis(GO:2000302) |
0.4 | 1.8 | GO:0006987 | activation of signaling protein activity involved in unfolded protein response(GO:0006987) |
0.4 | 1.3 | GO:0097118 | neuroligin clustering involved in postsynaptic membrane assembly(GO:0097118) |
0.4 | 1.1 | GO:0021530 | spinal cord oligodendrocyte cell differentiation(GO:0021529) spinal cord oligodendrocyte cell fate specification(GO:0021530) |
0.4 | 2.5 | GO:0042118 | endothelial cell activation(GO:0042118) |
0.3 | 1.0 | GO:0034395 | regulation of transcription from RNA polymerase II promoter in response to iron(GO:0034395) |
0.3 | 1.0 | GO:0006562 | proline catabolic process(GO:0006562) |
0.3 | 0.9 | GO:0046684 | response to pyrethroid(GO:0046684) |
0.3 | 0.9 | GO:0061368 | behavioral response to chemical pain(GO:0061366) behavioral response to formalin induced pain(GO:0061368) |
0.3 | 1.1 | GO:0097476 | motor neuron migration(GO:0097475) spinal cord motor neuron migration(GO:0097476) |
0.3 | 0.3 | GO:0006848 | pyruvate transport(GO:0006848) pyruvate transmembrane transport(GO:1901475) |
0.3 | 0.8 | GO:1900245 | positive regulation of MDA-5 signaling pathway(GO:1900245) |
0.3 | 0.6 | GO:0032483 | regulation of Rab protein signal transduction(GO:0032483) |
0.3 | 1.7 | GO:0042297 | vocal learning(GO:0042297) imitative learning(GO:0098596) learned vocalization behavior or vocal learning(GO:0098598) |
0.3 | 0.5 | GO:1901740 | negative regulation of myoblast fusion(GO:1901740) |
0.3 | 0.8 | GO:0033058 | directional locomotion(GO:0033058) |
0.3 | 1.3 | GO:0043987 | histone H3-S10 phosphorylation(GO:0043987) |
0.3 | 1.3 | GO:0016576 | histone dephosphorylation(GO:0016576) |
0.2 | 1.0 | GO:0048003 | antigen processing and presentation of lipid antigen via MHC class Ib(GO:0048003) antigen processing and presentation, exogenous lipid antigen via MHC class Ib(GO:0048007) |
0.2 | 1.5 | GO:0060287 | epithelial cilium movement involved in determination of left/right asymmetry(GO:0060287) |
0.2 | 1.9 | GO:0046146 | tetrahydrobiopterin metabolic process(GO:0046146) |
0.2 | 0.7 | GO:1903223 | positive regulation of oxidative stress-induced neuron death(GO:1903223) |
0.2 | 1.0 | GO:0098904 | regulation of AV node cell action potential(GO:0098904) |
0.2 | 0.7 | GO:0045423 | granulocyte macrophage colony-stimulating factor biosynthetic process(GO:0042253) regulation of granulocyte macrophage colony-stimulating factor biosynthetic process(GO:0045423) |
0.2 | 1.2 | GO:1903689 | regulation of wound healing, spreading of epidermal cells(GO:1903689) |
0.2 | 0.7 | GO:0021564 | vagus nerve development(GO:0021564) |
0.2 | 0.7 | GO:0007597 | blood coagulation, intrinsic pathway(GO:0007597) |
0.2 | 1.2 | GO:0007171 | activation of transmembrane receptor protein tyrosine kinase activity(GO:0007171) |
0.2 | 0.9 | GO:0038094 | Fc-gamma receptor signaling pathway(GO:0038094) |
0.2 | 2.4 | GO:2001224 | positive regulation of neuron migration(GO:2001224) |
0.2 | 0.7 | GO:0035609 | C-terminal protein deglutamylation(GO:0035609) |
0.2 | 0.2 | GO:0046552 | eye photoreceptor cell fate commitment(GO:0042706) photoreceptor cell fate commitment(GO:0046552) |
0.2 | 2.6 | GO:0031987 | locomotion involved in locomotory behavior(GO:0031987) |
0.2 | 0.9 | GO:0031117 | positive regulation of microtubule depolymerization(GO:0031117) |
0.2 | 1.5 | GO:2000480 | negative regulation of cAMP-dependent protein kinase activity(GO:2000480) |
0.2 | 0.6 | GO:0006556 | S-adenosylmethionine biosynthetic process(GO:0006556) |
0.2 | 1.0 | GO:0032747 | positive regulation of interleukin-23 production(GO:0032747) |
0.2 | 1.0 | GO:0006642 | triglyceride mobilization(GO:0006642) |
0.2 | 0.8 | GO:0043402 | glucocorticoid mediated signaling pathway(GO:0043402) |
0.2 | 0.4 | GO:0033026 | negative regulation of mast cell apoptotic process(GO:0033026) |
0.2 | 0.6 | GO:0038095 | Fc-epsilon receptor signaling pathway(GO:0038095) |
0.2 | 4.6 | GO:0022011 | myelination in peripheral nervous system(GO:0022011) peripheral nervous system axon ensheathment(GO:0032292) |
0.2 | 0.6 | GO:0030050 | vesicle transport along actin filament(GO:0030050) |
0.2 | 2.1 | GO:0034643 | establishment of mitochondrion localization, microtubule-mediated(GO:0034643) mitochondrion transport along microtubule(GO:0047497) |
0.2 | 0.4 | GO:0016198 | axon choice point recognition(GO:0016198) |
0.2 | 1.1 | GO:0044336 | canonical Wnt signaling pathway involved in negative regulation of apoptotic process(GO:0044336) |
0.2 | 0.2 | GO:0032763 | regulation of mast cell cytokine production(GO:0032763) |
0.2 | 0.6 | GO:0046544 | development of secondary male sexual characteristics(GO:0046544) |
0.2 | 0.9 | GO:0046984 | regulation of hemoglobin biosynthetic process(GO:0046984) |
0.2 | 1.3 | GO:1901841 | regulation of high voltage-gated calcium channel activity(GO:1901841) |
0.2 | 1.6 | GO:0021860 | pyramidal neuron development(GO:0021860) |
0.2 | 0.9 | GO:0036233 | glycine import(GO:0036233) |
0.2 | 0.7 | GO:0090666 | scaRNA localization to Cajal body(GO:0090666) |
0.2 | 0.7 | GO:0070366 | regulation of hepatocyte differentiation(GO:0070366) |
0.2 | 0.2 | GO:0034436 | glycoprotein transport(GO:0034436) |
0.2 | 0.5 | GO:0097112 | gamma-aminobutyric acid receptor clustering(GO:0097112) |
0.2 | 1.4 | GO:0061732 | mitochondrial acetyl-CoA biosynthetic process from pyruvate(GO:0061732) |
0.2 | 0.9 | GO:0007256 | activation of JNKK activity(GO:0007256) |
0.2 | 2.9 | GO:0071475 | cellular hyperosmotic salinity response(GO:0071475) |
0.2 | 0.3 | GO:0035482 | gastric motility(GO:0035482) |
0.2 | 0.7 | GO:0018317 | protein C-linked glycosylation(GO:0018103) peptidyl-tryptophan modification(GO:0018211) protein C-linked glycosylation via tryptophan(GO:0018317) protein C-linked glycosylation via 2'-alpha-mannosyl-L-tryptophan(GO:0018406) |
0.2 | 0.5 | GO:1902261 | positive regulation of delayed rectifier potassium channel activity(GO:1902261) positive regulation of voltage-gated potassium channel activity(GO:1903818) |
0.2 | 1.0 | GO:1902669 | positive regulation of axon extension involved in axon guidance(GO:0048842) positive regulation of axon guidance(GO:1902669) |
0.2 | 1.0 | GO:0016078 | tRNA catabolic process(GO:0016078) |
0.2 | 2.5 | GO:0006895 | Golgi to endosome transport(GO:0006895) |
0.2 | 0.8 | GO:0014028 | notochord formation(GO:0014028) |
0.2 | 0.5 | GO:1903525 | regulation of membrane tubulation(GO:1903525) |
0.2 | 0.6 | GO:0035627 | ceramide transport(GO:0035627) |
0.2 | 0.2 | GO:0019676 | ammonia assimilation cycle(GO:0019676) |
0.2 | 0.6 | GO:0060971 | embryonic heart tube left/right pattern formation(GO:0060971) |
0.2 | 0.3 | GO:0030997 | regulation of centriole-centriole cohesion(GO:0030997) |
0.2 | 0.8 | GO:0030578 | PML body organization(GO:0030578) |
0.2 | 0.6 | GO:2000255 | negative regulation of male germ cell proliferation(GO:2000255) |
0.2 | 0.3 | GO:0014016 | neuroblast differentiation(GO:0014016) |
0.2 | 0.5 | GO:0021524 | visceral motor neuron differentiation(GO:0021524) |
0.2 | 0.5 | GO:1904192 | cholangiocyte apoptotic process(GO:1902488) regulation of cholangiocyte apoptotic process(GO:1904192) negative regulation of cholangiocyte apoptotic process(GO:1904193) |
0.1 | 0.4 | GO:0072385 | minus-end-directed organelle transport along microtubule(GO:0072385) |
0.1 | 0.1 | GO:2000017 | positive regulation of determination of dorsal identity(GO:2000017) |
0.1 | 0.6 | GO:0000960 | mitochondrial RNA catabolic process(GO:0000957) regulation of mitochondrial RNA catabolic process(GO:0000960) |
0.1 | 0.4 | GO:0021898 | regulation of transcription from RNA polymerase II promoter involved in forebrain neuron fate commitment(GO:0021882) commitment of multipotent stem cells to neuronal lineage in forebrain(GO:0021898) |
0.1 | 0.4 | GO:0007571 | age-dependent response to oxidative stress(GO:0001306) age-dependent general metabolic decline(GO:0007571) |
0.1 | 0.6 | GO:0070126 | mitochondrial translational termination(GO:0070126) |
0.1 | 0.4 | GO:0001661 | conditioned taste aversion(GO:0001661) |
0.1 | 0.5 | GO:0006432 | phenylalanyl-tRNA aminoacylation(GO:0006432) |
0.1 | 0.1 | GO:0097466 | glycoprotein ERAD pathway(GO:0097466) response to glycoprotein(GO:1904587) |
0.1 | 0.9 | GO:0051461 | positive regulation of corticotropin secretion(GO:0051461) |
0.1 | 0.7 | GO:0045162 | clustering of voltage-gated sodium channels(GO:0045162) |
0.1 | 0.4 | GO:0036258 | multivesicular body assembly(GO:0036258) |
0.1 | 1.1 | GO:0071420 | cellular response to histamine(GO:0071420) |
0.1 | 0.5 | GO:0000707 | meiotic DNA recombinase assembly(GO:0000707) |
0.1 | 0.1 | GO:2000807 | regulation of synaptic vesicle clustering(GO:2000807) |
0.1 | 0.3 | GO:2001201 | transforming growth factor-beta secretion(GO:0038044) regulation of transforming growth factor-beta secretion(GO:2001201) |
0.1 | 0.3 | GO:0035526 | retrograde transport, plasma membrane to Golgi(GO:0035526) |
0.1 | 1.0 | GO:0061088 | sequestering of zinc ion(GO:0032119) regulation of sequestering of zinc ion(GO:0061088) |
0.1 | 0.3 | GO:0021912 | regulation of transcription from RNA polymerase II promoter involved in spinal cord motor neuron fate specification(GO:0021912) |
0.1 | 0.4 | GO:0070358 | actin polymerization-dependent cell motility(GO:0070358) |
0.1 | 1.1 | GO:0046337 | phosphatidylethanolamine metabolic process(GO:0046337) |
0.1 | 1.0 | GO:0009186 | deoxyribonucleoside diphosphate metabolic process(GO:0009186) |
0.1 | 0.4 | GO:0032289 | central nervous system myelin formation(GO:0032289) |
0.1 | 0.5 | GO:0061000 | negative regulation of dendritic spine development(GO:0061000) |
0.1 | 0.4 | GO:0007258 | JUN phosphorylation(GO:0007258) |
0.1 | 0.4 | GO:0071930 | negative regulation of transcription involved in G1/S transition of mitotic cell cycle(GO:0071930) |
0.1 | 0.4 | GO:0034421 | post-translational protein acetylation(GO:0034421) |
0.1 | 0.7 | GO:0021631 | optic nerve morphogenesis(GO:0021631) |
0.1 | 0.2 | GO:0035672 | oligopeptide transmembrane transport(GO:0035672) |
0.1 | 0.5 | GO:2001187 | positive regulation of CD8-positive, alpha-beta T cell activation(GO:2001187) |
0.1 | 0.2 | GO:0010982 | regulation of high-density lipoprotein particle clearance(GO:0010982) |
0.1 | 0.8 | GO:0032224 | positive regulation of synaptic transmission, cholinergic(GO:0032224) |
0.1 | 0.3 | GO:0060178 | regulation of exocyst localization(GO:0060178) |
0.1 | 0.2 | GO:0038026 | reelin-mediated signaling pathway(GO:0038026) |
0.1 | 0.1 | GO:0060061 | Spemann organizer formation(GO:0060061) |
0.1 | 0.6 | GO:0070345 | negative regulation of fat cell proliferation(GO:0070345) |
0.1 | 0.4 | GO:0031339 | negative regulation of vesicle fusion(GO:0031339) |
0.1 | 0.1 | GO:1900825 | regulation of membrane depolarization during cardiac muscle cell action potential(GO:1900825) |
0.1 | 0.3 | GO:1900748 | positive regulation of vascular endothelial growth factor signaling pathway(GO:1900748) |
0.1 | 0.3 | GO:0009642 | response to light intensity(GO:0009642) |
0.1 | 0.2 | GO:1900019 | regulation of protein kinase C activity(GO:1900019) positive regulation of protein kinase C activity(GO:1900020) |
0.1 | 0.5 | GO:0046618 | drug export(GO:0046618) |
0.1 | 0.4 | GO:0072378 | blood coagulation, fibrin clot formation(GO:0072378) |
0.1 | 0.8 | GO:0071732 | cellular response to nitric oxide(GO:0071732) |
0.1 | 0.7 | GO:2000009 | negative regulation of protein localization to cell surface(GO:2000009) |
0.1 | 0.6 | GO:0021785 | branchiomotor neuron axon guidance(GO:0021785) |
0.1 | 1.6 | GO:0010842 | retina layer formation(GO:0010842) |
0.1 | 0.2 | GO:2001274 | negative regulation of glucose import in response to insulin stimulus(GO:2001274) |
0.1 | 0.1 | GO:0071360 | cellular response to exogenous dsRNA(GO:0071360) |
0.1 | 0.4 | GO:0072051 | juxtaglomerular apparatus development(GO:0072051) |
0.1 | 0.4 | GO:0023041 | neuronal signal transduction(GO:0023041) |
0.1 | 0.3 | GO:0042723 | thiamine metabolic process(GO:0006772) thiamine-containing compound metabolic process(GO:0042723) |
0.1 | 0.3 | GO:0071873 | response to norepinephrine(GO:0071873) |
0.1 | 0.3 | GO:0070782 | phosphatidylserine exposure on apoptotic cell surface(GO:0070782) |
0.1 | 0.5 | GO:0038180 | nerve growth factor signaling pathway(GO:0038180) |
0.1 | 0.3 | GO:0035995 | detection of muscle stretch(GO:0035995) |
0.1 | 3.4 | GO:0003407 | neural retina development(GO:0003407) |
0.1 | 0.2 | GO:0070070 | proton-transporting V-type ATPase complex assembly(GO:0070070) |
0.1 | 0.2 | GO:0003221 | right ventricular cardiac muscle tissue morphogenesis(GO:0003221) |
0.1 | 0.2 | GO:0060167 | regulation of adenosine receptor signaling pathway(GO:0060167) |
0.1 | 0.3 | GO:1902953 | positive regulation of ER to Golgi vesicle-mediated transport(GO:1902953) |
0.1 | 0.7 | GO:0017121 | phospholipid scrambling(GO:0017121) |
0.1 | 0.3 | GO:0000101 | sulfur amino acid transport(GO:0000101) |
0.1 | 0.4 | GO:0090427 | activation of meiosis(GO:0090427) |
0.1 | 0.8 | GO:0090520 | sphingolipid mediated signaling pathway(GO:0090520) |
0.1 | 0.5 | GO:1903054 | negative regulation of extracellular matrix organization(GO:1903054) |
0.1 | 0.2 | GO:0032364 | oxygen homeostasis(GO:0032364) |
0.1 | 0.4 | GO:0031915 | positive regulation of synaptic plasticity(GO:0031915) |
0.1 | 0.3 | GO:0003331 | regulation of extracellular matrix constituent secretion(GO:0003330) positive regulation of extracellular matrix constituent secretion(GO:0003331) |
0.1 | 0.6 | GO:0051988 | regulation of attachment of spindle microtubules to kinetochore(GO:0051988) |
0.1 | 0.3 | GO:0007181 | transforming growth factor beta receptor complex assembly(GO:0007181) |
0.1 | 0.3 | GO:0048852 | diencephalon morphogenesis(GO:0048852) |
0.1 | 0.3 | GO:0044339 | canonical Wnt signaling pathway involved in osteoblast differentiation(GO:0044339) |
0.1 | 0.3 | GO:0007621 | negative regulation of female receptivity(GO:0007621) |
0.1 | 0.2 | GO:0071503 | response to heparin(GO:0071503) cellular response to heparin(GO:0071504) |
0.1 | 0.3 | GO:0070365 | hepatocyte differentiation(GO:0070365) |
0.1 | 0.3 | GO:0051919 | positive regulation of fibrinolysis(GO:0051919) |
0.1 | 0.2 | GO:0021855 | hypothalamus cell migration(GO:0021855) |
0.1 | 1.5 | GO:0051968 | positive regulation of synaptic transmission, glutamatergic(GO:0051968) |
0.1 | 0.5 | GO:0006685 | sphingomyelin catabolic process(GO:0006685) |
0.1 | 0.6 | GO:0048341 | paraxial mesoderm formation(GO:0048341) |
0.1 | 0.3 | GO:0072530 | purine nucleoside transmembrane transport(GO:0015860) purine-containing compound transmembrane transport(GO:0072530) nucleoside transmembrane transport(GO:1901642) |
0.1 | 0.3 | GO:0033563 | dorsal/ventral axon guidance(GO:0033563) |
0.1 | 0.2 | GO:0048254 | snoRNA localization(GO:0048254) |
0.1 | 0.1 | GO:0019374 | galactolipid metabolic process(GO:0019374) |
0.1 | 0.2 | GO:0032910 | transforming growth factor beta3 production(GO:0032907) regulation of transforming growth factor beta3 production(GO:0032910) |
0.1 | 0.4 | GO:0046487 | glyoxylate metabolic process(GO:0046487) |
0.1 | 0.2 | GO:0052200 | response to defenses of other organism involved in symbiotic interaction(GO:0052173) response to host defenses(GO:0052200) response to host(GO:0075136) |
0.1 | 0.3 | GO:0061577 | calcium ion transmembrane transport via high voltage-gated calcium channel(GO:0061577) |
0.1 | 0.1 | GO:1904742 | regulation of telomeric DNA binding(GO:1904742) |
0.1 | 0.2 | GO:0045074 | interleukin-10 biosynthetic process(GO:0042091) regulation of interleukin-10 biosynthetic process(GO:0045074) |
0.1 | 1.0 | GO:0045579 | positive regulation of B cell differentiation(GO:0045579) |
0.1 | 0.2 | GO:2000659 | regulation of interleukin-1-mediated signaling pathway(GO:2000659) |
0.1 | 0.6 | GO:0031848 | protection from non-homologous end joining at telomere(GO:0031848) |
0.1 | 0.2 | GO:0032097 | positive regulation of response to food(GO:0032097) positive regulation of appetite(GO:0032100) |
0.1 | 0.1 | GO:1901859 | negative regulation of mitochondrial DNA metabolic process(GO:1901859) |
0.1 | 0.5 | GO:0060134 | prepulse inhibition(GO:0060134) |
0.1 | 0.2 | GO:0009233 | menaquinone metabolic process(GO:0009233) |
0.1 | 0.4 | GO:1900028 | negative regulation of ruffle assembly(GO:1900028) |
0.1 | 0.3 | GO:0007406 | negative regulation of neuroblast proliferation(GO:0007406) |
0.1 | 0.3 | GO:1901894 | regulation of calcium-transporting ATPase activity(GO:1901894) |
0.1 | 0.3 | GO:0061743 | motor learning(GO:0061743) |
0.1 | 0.2 | GO:0002767 | immune response-inhibiting cell surface receptor signaling pathway(GO:0002767) |
0.1 | 0.1 | GO:1900736 | regulation of phospholipase C-activating G-protein coupled receptor signaling pathway(GO:1900736) |
0.1 | 0.1 | GO:0003358 | noradrenergic neuron development(GO:0003358) |
0.1 | 0.1 | GO:1905206 | positive regulation of response to reactive oxygen species(GO:1901033) positive regulation of hydrogen peroxide-mediated programmed cell death(GO:1901300) positive regulation of hydrogen peroxide-induced cell death(GO:1905206) |
0.1 | 0.2 | GO:0006269 | DNA replication, synthesis of RNA primer(GO:0006269) |
0.1 | 0.5 | GO:0045792 | negative regulation of cell size(GO:0045792) |
0.1 | 0.1 | GO:0000966 | RNA 5'-end processing(GO:0000966) |
0.1 | 0.4 | GO:0070427 | nucleotide-binding oligomerization domain containing 1 signaling pathway(GO:0070427) |
0.1 | 1.0 | GO:0021952 | central nervous system projection neuron axonogenesis(GO:0021952) |
0.1 | 0.1 | GO:0032482 | Rab protein signal transduction(GO:0032482) |
0.1 | 0.4 | GO:0090209 | negative regulation of triglyceride metabolic process(GO:0090209) |
0.1 | 0.1 | GO:0032898 | neurotrophin production(GO:0032898) |
0.1 | 0.3 | GO:0018343 | protein farnesylation(GO:0018343) |
0.1 | 0.4 | GO:0072710 | response to hydroxyurea(GO:0072710) cellular response to hydroxyurea(GO:0072711) |
0.1 | 0.5 | GO:0048304 | positive regulation of isotype switching to IgG isotypes(GO:0048304) |
0.1 | 0.4 | GO:1900113 | negative regulation of histone H3-K9 trimethylation(GO:1900113) |
0.1 | 0.2 | GO:0015888 | thiamine transport(GO:0015888) |
0.1 | 0.2 | GO:0060437 | lung growth(GO:0060437) |
0.1 | 0.1 | GO:0042414 | epinephrine metabolic process(GO:0042414) |
0.1 | 0.4 | GO:2000766 | negative regulation of cytoplasmic translation(GO:2000766) |
0.1 | 0.2 | GO:2000645 | negative regulation of receptor catabolic process(GO:2000645) |
0.1 | 0.7 | GO:0006122 | mitochondrial electron transport, ubiquinol to cytochrome c(GO:0006122) |
0.1 | 0.3 | GO:2001275 | positive regulation of glucose import in response to insulin stimulus(GO:2001275) |
0.1 | 0.5 | GO:0006000 | fructose metabolic process(GO:0006000) |
0.1 | 0.3 | GO:0080009 | mRNA methylation(GO:0080009) |
0.1 | 0.4 | GO:0035641 | locomotory exploration behavior(GO:0035641) |
0.1 | 0.1 | GO:0010996 | response to auditory stimulus(GO:0010996) |
0.1 | 0.1 | GO:1903207 | neuron death in response to hydrogen peroxide(GO:0036476) regulation of hydrogen peroxide-induced neuron death(GO:1903207) negative regulation of hydrogen peroxide-induced neuron death(GO:1903208) |
0.1 | 0.9 | GO:0010758 | regulation of macrophage chemotaxis(GO:0010758) |
0.1 | 0.3 | GO:0051661 | maintenance of centrosome location(GO:0051661) |
0.1 | 1.6 | GO:0006270 | DNA replication initiation(GO:0006270) |
0.1 | 0.2 | GO:2001271 | negative regulation of cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:2001271) |
0.1 | 0.1 | GO:0060060 | post-embryonic retina morphogenesis in camera-type eye(GO:0060060) |
0.1 | 0.2 | GO:0060830 | ciliary receptor clustering involved in smoothened signaling pathway(GO:0060830) |
0.1 | 0.6 | GO:0033089 | positive regulation of T cell differentiation in thymus(GO:0033089) positive regulation of thymocyte aggregation(GO:2000400) |
0.1 | 0.1 | GO:0071679 | commissural neuron axon guidance(GO:0071679) |
0.1 | 0.2 | GO:0052422 | modulation of catalytic activity in other organism involved in symbiotic interaction(GO:0052203) modulation by host of symbiont catalytic activity(GO:0052422) |
0.1 | 0.7 | GO:2000311 | regulation of alpha-amino-3-hydroxy-5-methyl-4-isoxazole propionate selective glutamate receptor activity(GO:2000311) |
0.1 | 0.2 | GO:0006222 | UMP biosynthetic process(GO:0006222) pyrimidine ribonucleoside monophosphate metabolic process(GO:0009173) pyrimidine ribonucleoside monophosphate biosynthetic process(GO:0009174) UMP metabolic process(GO:0046049) |
0.1 | 0.1 | GO:0001834 | trophectodermal cell proliferation(GO:0001834) |
0.1 | 0.2 | GO:1904694 | negative regulation of vascular smooth muscle contraction(GO:1904694) |
0.1 | 0.2 | GO:0071596 | ubiquitin-dependent protein catabolic process via the N-end rule pathway(GO:0071596) |
0.1 | 0.4 | GO:0060080 | inhibitory postsynaptic potential(GO:0060080) |
0.1 | 0.3 | GO:0061484 | hematopoietic stem cell homeostasis(GO:0061484) |
0.1 | 0.2 | GO:0003062 | regulation of heart rate by chemical signal(GO:0003062) |
0.1 | 0.4 | GO:0016338 | calcium-independent cell-cell adhesion via plasma membrane cell-adhesion molecules(GO:0016338) |
0.1 | 0.3 | GO:0014054 | positive regulation of gamma-aminobutyric acid secretion(GO:0014054) |
0.1 | 0.4 | GO:0015670 | carbon dioxide transport(GO:0015670) |
0.1 | 0.1 | GO:2000402 | negative regulation of lymphocyte migration(GO:2000402) |
0.1 | 0.2 | GO:0050904 | diapedesis(GO:0050904) |
0.1 | 0.2 | GO:0006189 | 'de novo' IMP biosynthetic process(GO:0006189) |
0.1 | 0.2 | GO:0035582 | sequestering of BMP in extracellular matrix(GO:0035582) |
0.1 | 0.1 | GO:0042321 | negative regulation of circadian sleep/wake cycle, sleep(GO:0042321) negative regulation of circadian sleep/wake cycle, REM sleep(GO:0042322) |
0.1 | 0.1 | GO:0048880 | sensory system development(GO:0048880) |
0.1 | 0.3 | GO:0035542 | regulation of SNARE complex assembly(GO:0035542) |
0.1 | 0.1 | GO:0051665 | membrane raft localization(GO:0051665) |
0.1 | 0.2 | GO:2000617 | positive regulation of histone H3-K9 acetylation(GO:2000617) |
0.1 | 0.2 | GO:0071492 | cellular response to UV-A(GO:0071492) |
0.1 | 0.2 | GO:0009826 | unidimensional cell growth(GO:0009826) |
0.1 | 0.2 | GO:1900452 | regulation of long term synaptic depression(GO:1900452) |
0.1 | 0.4 | GO:1902902 | negative regulation of autophagosome assembly(GO:1902902) |
0.1 | 0.5 | GO:0000244 | spliceosomal tri-snRNP complex assembly(GO:0000244) |
0.1 | 1.2 | GO:0008053 | mitochondrial fusion(GO:0008053) |
0.1 | 1.0 | GO:0035855 | megakaryocyte development(GO:0035855) |
0.1 | 0.2 | GO:0019805 | quinolinate biosynthetic process(GO:0019805) |
0.1 | 0.1 | GO:0001812 | positive regulation of type I hypersensitivity(GO:0001812) |
0.1 | 0.3 | GO:0014719 | skeletal muscle satellite cell activation(GO:0014719) |
0.1 | 0.3 | GO:0061051 | positive regulation of cell growth involved in cardiac muscle cell development(GO:0061051) |
0.1 | 0.2 | GO:0086023 | adrenergic receptor signaling pathway involved in heart process(GO:0086023) |
0.1 | 1.3 | GO:0006376 | mRNA splice site selection(GO:0006376) |
0.1 | 0.2 | GO:1903215 | negative regulation of protein targeting to mitochondrion(GO:1903215) |
0.1 | 0.9 | GO:1902668 | negative regulation of axon guidance(GO:1902668) |
0.1 | 0.2 | GO:0033227 | dsRNA transport(GO:0033227) |
0.1 | 0.2 | GO:1905098 | negative regulation of guanyl-nucleotide exchange factor activity(GO:1905098) |
0.1 | 0.2 | GO:0002924 | negative regulation of humoral immune response mediated by circulating immunoglobulin(GO:0002924) |
0.1 | 0.2 | GO:0090168 | Golgi reassembly(GO:0090168) |
0.1 | 0.5 | GO:0070269 | pyroptosis(GO:0070269) |
0.1 | 0.1 | GO:0072050 | S-shaped body morphogenesis(GO:0072050) |
0.1 | 1.3 | GO:0099518 | vesicle transport along microtubule(GO:0047496) vesicle cytoskeletal trafficking(GO:0099518) |
0.1 | 0.1 | GO:0010936 | negative regulation of macrophage cytokine production(GO:0010936) |
0.1 | 0.3 | GO:0006398 | mRNA 3'-end processing by stem-loop binding and cleavage(GO:0006398) |
0.1 | 3.2 | GO:0051963 | regulation of synapse assembly(GO:0051963) |
0.1 | 0.2 | GO:0006363 | termination of RNA polymerase I transcription(GO:0006363) |
0.1 | 0.2 | GO:0070649 | formin-nucleated actin cable assembly(GO:0070649) |
0.1 | 0.1 | GO:0046100 | hypoxanthine metabolic process(GO:0046100) hypoxanthine biosynthetic process(GO:0046101) |
0.1 | 1.3 | GO:0032728 | positive regulation of interferon-beta production(GO:0032728) |
0.1 | 0.2 | GO:0099515 | actin filament-based transport(GO:0099515) |
0.1 | 0.3 | GO:2000310 | regulation of N-methyl-D-aspartate selective glutamate receptor activity(GO:2000310) |
0.1 | 0.1 | GO:2000048 | negative regulation of cell-cell adhesion mediated by cadherin(GO:2000048) |
0.1 | 0.2 | GO:2000618 | regulation of histone H4-K16 acetylation(GO:2000618) |
0.1 | 0.1 | GO:0001998 | angiotensin mediated vasoconstriction involved in regulation of systemic arterial blood pressure(GO:0001998) |
0.1 | 0.2 | GO:0034239 | regulation of macrophage fusion(GO:0034239) |
0.1 | 0.2 | GO:0007296 | vitellogenesis(GO:0007296) |
0.1 | 0.4 | GO:0043249 | erythrocyte maturation(GO:0043249) |
0.1 | 0.3 | GO:0002476 | antigen processing and presentation of endogenous peptide antigen via MHC class Ib(GO:0002476) |
0.1 | 0.1 | GO:0010956 | negative regulation of calcidiol 1-monooxygenase activity(GO:0010956) |
0.1 | 0.2 | GO:0070164 | negative regulation of adiponectin secretion(GO:0070164) |
0.1 | 0.4 | GO:0006677 | glycosylceramide metabolic process(GO:0006677) |
0.1 | 0.1 | GO:0015712 | hexose phosphate transport(GO:0015712) glucose-6-phosphate transport(GO:0015760) |
0.1 | 1.7 | GO:0021954 | central nervous system neuron development(GO:0021954) |
0.1 | 0.2 | GO:0090148 | membrane fission(GO:0090148) |
0.1 | 0.2 | GO:0006701 | progesterone biosynthetic process(GO:0006701) |
0.1 | 0.5 | GO:0097120 | receptor localization to synapse(GO:0097120) |
0.1 | 0.3 | GO:0009052 | pentose-phosphate shunt, non-oxidative branch(GO:0009052) |
0.1 | 0.5 | GO:0060074 | synapse maturation(GO:0060074) |
0.1 | 0.1 | GO:0044034 | negative stranded viral RNA replication(GO:0039689) multi-organism biosynthetic process(GO:0044034) |
0.1 | 0.2 | GO:0001992 | regulation of systemic arterial blood pressure by vasopressin(GO:0001992) |
0.1 | 0.2 | GO:0003348 | cardiac endothelial cell differentiation(GO:0003348) |
0.1 | 0.2 | GO:0032713 | negative regulation of interleukin-4 production(GO:0032713) |
0.1 | 0.2 | GO:0070445 | oligodendrocyte progenitor proliferation(GO:0070444) regulation of oligodendrocyte progenitor proliferation(GO:0070445) |
0.1 | 0.2 | GO:0042421 | norepinephrine biosynthetic process(GO:0042421) |
0.1 | 0.1 | GO:0072198 | mesenchymal cell proliferation involved in ureter development(GO:0072198) regulation of mesenchymal cell proliferation involved in ureter development(GO:0072199) positive regulation of mesenchymal cell proliferation involved in ureter development(GO:2000729) |
0.1 | 1.7 | GO:0022904 | respiratory electron transport chain(GO:0022904) |
0.1 | 0.3 | GO:0060158 | phospholipase C-activating dopamine receptor signaling pathway(GO:0060158) |
0.1 | 0.2 | GO:0007195 | adenylate cyclase-inhibiting dopamine receptor signaling pathway(GO:0007195) |
0.1 | 0.2 | GO:0003105 | negative regulation of glomerular filtration(GO:0003105) |
0.1 | 0.2 | GO:0021937 | cerebellar Purkinje cell-granule cell precursor cell signaling involved in regulation of granule cell precursor cell proliferation(GO:0021937) |
0.1 | 1.4 | GO:0006879 | cellular iron ion homeostasis(GO:0006879) |
0.0 | 0.4 | GO:1901673 | regulation of mitotic spindle assembly(GO:1901673) |
0.0 | 0.8 | GO:0097031 | NADH dehydrogenase complex assembly(GO:0010257) mitochondrial respiratory chain complex I assembly(GO:0032981) mitochondrial respiratory chain complex I biogenesis(GO:0097031) |
0.0 | 0.4 | GO:0071435 | potassium ion export(GO:0071435) |
0.0 | 0.3 | GO:0046010 | positive regulation of circadian sleep/wake cycle, non-REM sleep(GO:0046010) |
0.0 | 0.1 | GO:0061152 | trachea submucosa development(GO:0061152) trachea gland development(GO:0061153) |
0.0 | 0.3 | GO:0070571 | negative regulation of neuron projection regeneration(GO:0070571) |
0.0 | 0.1 | GO:1900122 | positive regulation of receptor binding(GO:1900122) |
0.0 | 0.3 | GO:0010359 | regulation of anion channel activity(GO:0010359) |
0.0 | 0.4 | GO:0001964 | startle response(GO:0001964) |
0.0 | 0.4 | GO:0051481 | negative regulation of cytosolic calcium ion concentration(GO:0051481) |
0.0 | 0.4 | GO:0045217 | cell-cell junction maintenance(GO:0045217) |
0.0 | 0.0 | GO:0006533 | aspartate catabolic process(GO:0006533) |
0.0 | 0.1 | GO:1902894 | negative regulation of pri-miRNA transcription from RNA polymerase II promoter(GO:1902894) |
0.0 | 0.4 | GO:0060546 | negative regulation of necroptotic process(GO:0060546) |
0.0 | 0.0 | GO:2000275 | regulation of oxidative phosphorylation uncoupler activity(GO:2000275) |
0.0 | 0.0 | GO:0045188 | regulation of circadian sleep/wake cycle, non-REM sleep(GO:0045188) |
0.0 | 0.1 | GO:0046874 | quinolinate metabolic process(GO:0046874) |
0.0 | 0.1 | GO:1904263 | positive regulation of TORC1 signaling(GO:1904263) |
0.0 | 0.0 | GO:0071879 | positive regulation of adrenergic receptor signaling pathway(GO:0071879) |
0.0 | 0.1 | GO:0006600 | creatine metabolic process(GO:0006600) |
0.0 | 0.0 | GO:0052428 | modulation of molecular function in other organism(GO:0044359) negative regulation of molecular function in other organism(GO:0044362) negative regulation of molecular function in other organism involved in symbiotic interaction(GO:0052204) modulation of molecular function in other organism involved in symbiotic interaction(GO:0052205) negative regulation by host of symbiont molecular function(GO:0052405) modification by host of symbiont molecular function(GO:0052428) |
0.0 | 0.3 | GO:0001672 | regulation of chromatin assembly or disassembly(GO:0001672) |
0.0 | 0.1 | GO:0008228 | opsonization(GO:0008228) |
0.0 | 0.6 | GO:0032011 | ARF protein signal transduction(GO:0032011) regulation of ARF protein signal transduction(GO:0032012) |
0.0 | 0.2 | GO:0006348 | chromatin silencing at telomere(GO:0006348) |
0.0 | 0.2 | GO:1900118 | negative regulation of execution phase of apoptosis(GO:1900118) |
0.0 | 0.1 | GO:1900041 | negative regulation of interleukin-2 secretion(GO:1900041) |
0.0 | 0.3 | GO:0051103 | DNA ligation involved in DNA repair(GO:0051103) |
0.0 | 0.1 | GO:0000350 | generation of catalytic spliceosome for second transesterification step(GO:0000350) |
0.0 | 0.1 | GO:1902075 | cellular response to salt(GO:1902075) |
0.0 | 0.1 | GO:1905005 | regulation of epithelial to mesenchymal transition involved in endocardial cushion formation(GO:1905005) |
0.0 | 0.5 | GO:0007212 | dopamine receptor signaling pathway(GO:0007212) |
0.0 | 0.2 | GO:0048755 | branching morphogenesis of a nerve(GO:0048755) |
0.0 | 0.1 | GO:0035247 | peptidyl-arginine methylation, to asymmetrical-dimethyl arginine(GO:0019919) peptidyl-arginine omega-N-methylation(GO:0035247) |
0.0 | 0.2 | GO:0009249 | protein lipoylation(GO:0009249) |
0.0 | 0.3 | GO:0061003 | positive regulation of dendritic spine morphogenesis(GO:0061003) |
0.0 | 0.1 | GO:1903265 | positive regulation of tumor necrosis factor-mediated signaling pathway(GO:1903265) |
0.0 | 0.2 | GO:0051725 | protein de-ADP-ribosylation(GO:0051725) |
0.0 | 0.1 | GO:0007208 | phospholipase C-activating serotonin receptor signaling pathway(GO:0007208) |
0.0 | 0.1 | GO:1903999 | negative regulation of eating behavior(GO:1903999) |
0.0 | 0.0 | GO:2001185 | regulation of CD8-positive, alpha-beta T cell activation(GO:2001185) |
0.0 | 0.2 | GO:0001905 | activation of membrane attack complex(GO:0001905) regulation of activation of membrane attack complex(GO:0001969) |
0.0 | 0.0 | GO:0010040 | response to iron(II) ion(GO:0010040) |
0.0 | 0.1 | GO:0021902 | commitment of neuronal cell to specific neuron type in forebrain(GO:0021902) |
0.0 | 0.2 | GO:0072161 | mesenchymal cell differentiation involved in kidney development(GO:0072161) mesenchymal cell differentiation involved in renal system development(GO:2001012) |
0.0 | 0.1 | GO:0045590 | negative regulation of regulatory T cell differentiation(GO:0045590) |
0.0 | 0.1 | GO:0010288 | response to lead ion(GO:0010288) |
0.0 | 0.3 | GO:0035745 | T-helper 2 cell cytokine production(GO:0035745) |
0.0 | 0.1 | GO:0044849 | estrous cycle(GO:0044849) |
0.0 | 0.1 | GO:0006667 | sphinganine metabolic process(GO:0006667) |
0.0 | 0.9 | GO:0006491 | N-glycan processing(GO:0006491) |
0.0 | 0.1 | GO:0021914 | negative regulation of smoothened signaling pathway involved in ventral spinal cord patterning(GO:0021914) |
0.0 | 0.1 | GO:0046951 | ketone body biosynthetic process(GO:0046951) |
0.0 | 0.1 | GO:0007638 | mechanosensory behavior(GO:0007638) |
0.0 | 0.1 | GO:0002282 | microglial cell activation involved in immune response(GO:0002282) |
0.0 | 0.2 | GO:0048496 | maintenance of organ identity(GO:0048496) |
0.0 | 0.0 | GO:0019230 | proprioception(GO:0019230) |
0.0 | 0.0 | GO:2000347 | positive regulation of hepatocyte proliferation(GO:2000347) |
0.0 | 0.3 | GO:0006490 | oligosaccharide-lipid intermediate biosynthetic process(GO:0006490) |
0.0 | 0.2 | GO:0043116 | negative regulation of vascular permeability(GO:0043116) |
0.0 | 0.1 | GO:0002752 | cell surface pattern recognition receptor signaling pathway(GO:0002752) |
0.0 | 0.3 | GO:0042359 | vitamin D metabolic process(GO:0042359) |
0.0 | 0.7 | GO:0000028 | ribosomal small subunit assembly(GO:0000028) |
0.0 | 0.3 | GO:0097237 | cellular response to toxic substance(GO:0097237) |
0.0 | 0.1 | GO:0070634 | transepithelial ammonium transport(GO:0070634) |
0.0 | 1.5 | GO:0080171 | lysosome organization(GO:0007040) lytic vacuole organization(GO:0080171) |
0.0 | 0.3 | GO:0010971 | positive regulation of G2/M transition of mitotic cell cycle(GO:0010971) |
0.0 | 0.1 | GO:0010963 | regulation of L-arginine import(GO:0010963) |
0.0 | 0.1 | GO:0045875 | negative regulation of sister chromatid cohesion(GO:0045875) |
0.0 | 0.0 | GO:0036135 | Schwann cell migration(GO:0036135) regulation of Schwann cell migration(GO:1900147) |
0.0 | 0.4 | GO:0002329 | pre-B cell differentiation(GO:0002329) |
0.0 | 0.1 | GO:0010039 | response to iron ion(GO:0010039) |
0.0 | 0.1 | GO:0035754 | B cell chemotaxis(GO:0035754) |
0.0 | 0.1 | GO:0060455 | negative regulation of gastric acid secretion(GO:0060455) |
0.0 | 0.4 | GO:0050908 | detection of light stimulus involved in visual perception(GO:0050908) detection of light stimulus involved in sensory perception(GO:0050962) |
0.0 | 0.1 | GO:0072531 | pyrimidine-containing compound transmembrane transport(GO:0072531) nucleotide transmembrane transport(GO:1901679) |
0.0 | 0.2 | GO:0014075 | response to amine(GO:0014075) |
0.0 | 0.1 | GO:0036493 | positive regulation of translation in response to endoplasmic reticulum stress(GO:0036493) |
0.0 | 0.3 | GO:0007288 | sperm axoneme assembly(GO:0007288) |
0.0 | 0.0 | GO:0042660 | positive regulation of cell fate specification(GO:0042660) |
0.0 | 0.0 | GO:0060154 | cellular process regulating host cell cycle in response to virus(GO:0060154) |
0.0 | 0.0 | GO:0034154 | toll-like receptor 7 signaling pathway(GO:0034154) |
0.0 | 0.2 | GO:0097411 | hypoxia-inducible factor-1alpha signaling pathway(GO:0097411) |
0.0 | 1.3 | GO:0006418 | tRNA aminoacylation for protein translation(GO:0006418) |
0.0 | 0.2 | GO:1904321 | response to forskolin(GO:1904321) cellular response to forskolin(GO:1904322) |
0.0 | 0.1 | GO:0045900 | negative regulation of translational elongation(GO:0045900) |
0.0 | 0.1 | GO:0035360 | positive regulation of peroxisome proliferator activated receptor signaling pathway(GO:0035360) |
0.0 | 0.1 | GO:0071896 | protein localization to adherens junction(GO:0071896) |
0.0 | 0.1 | GO:0060174 | limb bud formation(GO:0060174) |
0.0 | 0.4 | GO:0007076 | mitotic chromosome condensation(GO:0007076) |
0.0 | 0.2 | GO:0031290 | retinal ganglion cell axon guidance(GO:0031290) |
0.0 | 0.1 | GO:0006868 | glutamine transport(GO:0006868) |
0.0 | 0.1 | GO:0035435 | phosphate ion transmembrane transport(GO:0035435) |
0.0 | 0.2 | GO:0090141 | positive regulation of mitochondrial fission(GO:0090141) |
0.0 | 0.3 | GO:0042795 | snRNA transcription from RNA polymerase II promoter(GO:0042795) |
0.0 | 0.1 | GO:0006517 | protein deglycosylation(GO:0006517) |
0.0 | 0.5 | GO:0007141 | male meiosis I(GO:0007141) |
0.0 | 0.1 | GO:0006083 | acetate metabolic process(GO:0006083) |
0.0 | 0.1 | GO:0015747 | urate transport(GO:0015747) |
0.0 | 0.5 | GO:0051491 | positive regulation of filopodium assembly(GO:0051491) |
0.0 | 0.2 | GO:0007000 | nucleolus organization(GO:0007000) |
0.0 | 0.3 | GO:0030517 | negative regulation of axon extension(GO:0030517) |
0.0 | 0.4 | GO:2000001 | regulation of DNA damage checkpoint(GO:2000001) |
0.0 | 0.1 | GO:0035865 | response to potassium ion(GO:0035864) cellular response to potassium ion(GO:0035865) |
0.0 | 0.2 | GO:0045040 | protein import into mitochondrial outer membrane(GO:0045040) |
0.0 | 0.1 | GO:0061418 | regulation of transcription from RNA polymerase II promoter in response to hypoxia(GO:0061418) |
0.0 | 0.1 | GO:0034093 | positive regulation of maintenance of sister chromatid cohesion(GO:0034093) positive regulation of maintenance of mitotic sister chromatid cohesion(GO:0034184) |
0.0 | 0.2 | GO:0031119 | tRNA pseudouridine synthesis(GO:0031119) |
0.0 | 0.8 | GO:0045744 | negative regulation of G-protein coupled receptor protein signaling pathway(GO:0045744) |
0.0 | 0.1 | GO:0060335 | positive regulation of response to interferon-gamma(GO:0060332) positive regulation of interferon-gamma-mediated signaling pathway(GO:0060335) |
0.0 | 0.3 | GO:0051386 | regulation of neurotrophin TRK receptor signaling pathway(GO:0051386) |
0.0 | 0.2 | GO:1900016 | negative regulation of cytokine production involved in inflammatory response(GO:1900016) |
0.0 | 1.1 | GO:0007157 | heterophilic cell-cell adhesion via plasma membrane cell adhesion molecules(GO:0007157) |
0.0 | 0.1 | GO:1903715 | regulation of aerobic respiration(GO:1903715) |
0.0 | 0.2 | GO:0043649 | dicarboxylic acid catabolic process(GO:0043649) |
0.0 | 0.1 | GO:0045086 | positive regulation of interleukin-2 biosynthetic process(GO:0045086) |
0.0 | 0.2 | GO:0035721 | intraciliary retrograde transport(GO:0035721) |
0.0 | 0.2 | GO:0007190 | activation of adenylate cyclase activity(GO:0007190) |
0.0 | 0.8 | GO:0015988 | energy coupled proton transmembrane transport, against electrochemical gradient(GO:0015988) ATP hydrolysis coupled proton transport(GO:0015991) ATP hydrolysis coupled transmembrane transport(GO:0090662) |
0.0 | 0.0 | GO:0043633 | polyadenylation-dependent RNA catabolic process(GO:0043633) |
0.0 | 0.1 | GO:0032227 | negative regulation of synaptic transmission, dopaminergic(GO:0032227) |
0.0 | 0.2 | GO:0097094 | craniofacial suture morphogenesis(GO:0097094) |
0.0 | 0.1 | GO:2000409 | positive regulation of T cell extravasation(GO:2000409) |
0.0 | 0.1 | GO:0044860 | protein localization to plasma membrane raft(GO:0044860) |
0.0 | 0.1 | GO:0043456 | regulation of pentose-phosphate shunt(GO:0043456) |
0.0 | 0.1 | GO:1900029 | positive regulation of ruffle assembly(GO:1900029) |
0.0 | 0.1 | GO:0019482 | beta-alanine metabolic process(GO:0019482) |
0.0 | 1.2 | GO:0010501 | RNA secondary structure unwinding(GO:0010501) |
0.0 | 0.1 | GO:0014826 | vein smooth muscle contraction(GO:0014826) |
0.0 | 0.2 | GO:0045838 | positive regulation of membrane potential(GO:0045838) |
0.0 | 0.2 | GO:0000055 | ribosomal large subunit export from nucleus(GO:0000055) |
0.0 | 0.1 | GO:0035735 | intraciliary transport involved in cilium morphogenesis(GO:0035735) |
0.0 | 0.1 | GO:0060296 | regulation of cilium movement involved in cell motility(GO:0060295) regulation of cilium beat frequency involved in ciliary motility(GO:0060296) regulation of cilium-dependent cell motility(GO:1902019) |
0.0 | 0.5 | GO:0051973 | positive regulation of telomerase activity(GO:0051973) |
0.0 | 0.1 | GO:0071051 | U4 snRNA 3'-end processing(GO:0034475) polyadenylation-dependent snoRNA 3'-end processing(GO:0071051) |
0.0 | 0.1 | GO:0014724 | regulation of twitch skeletal muscle contraction(GO:0014724) |
0.0 | 0.5 | GO:0042462 | eye photoreceptor cell development(GO:0042462) |
0.0 | 0.1 | GO:0046110 | xanthine catabolic process(GO:0009115) xanthine metabolic process(GO:0046110) |
0.0 | 0.1 | GO:0071257 | cellular response to electrical stimulus(GO:0071257) |
0.0 | 0.1 | GO:0035331 | negative regulation of hippo signaling(GO:0035331) |
0.0 | 0.1 | GO:0007158 | neuron cell-cell adhesion(GO:0007158) |
0.0 | 0.1 | GO:0007290 | spermatid nucleus elongation(GO:0007290) |
0.0 | 0.1 | GO:0060997 | dendritic spine morphogenesis(GO:0060997) |
0.0 | 0.7 | GO:0019933 | cAMP-mediated signaling(GO:0019933) |
0.0 | 0.2 | GO:1902715 | positive regulation of interferon-gamma secretion(GO:1902715) |
0.0 | 0.1 | GO:0043117 | positive regulation of vascular permeability(GO:0043117) |
0.0 | 0.0 | GO:1901492 | positive regulation of lymphangiogenesis(GO:1901492) |
0.0 | 0.2 | GO:0060539 | diaphragm development(GO:0060539) |
0.0 | 0.0 | GO:0032727 | positive regulation of interferon-alpha production(GO:0032727) |
0.0 | 0.1 | GO:0042997 | negative regulation of Golgi to plasma membrane protein transport(GO:0042997) |
0.0 | 0.1 | GO:0031584 | activation of phospholipase D activity(GO:0031584) |
0.0 | 0.2 | GO:0017014 | protein nitrosylation(GO:0017014) |
0.0 | 0.1 | GO:0032607 | interferon-alpha production(GO:0032607) |
0.0 | 0.1 | GO:0019086 | late viral transcription(GO:0019086) |
0.0 | 0.0 | GO:0090467 | L-arginine import(GO:0043091) arginine import(GO:0090467) L-arginine transport(GO:1902023) |
0.0 | 0.2 | GO:0051131 | chaperone-mediated protein complex assembly(GO:0051131) |
0.0 | 0.2 | GO:0006108 | malate metabolic process(GO:0006108) |
0.0 | 0.1 | GO:0051574 | positive regulation of histone H3-K9 methylation(GO:0051574) |
0.0 | 0.2 | GO:0051156 | glucose 6-phosphate metabolic process(GO:0051156) |
0.0 | 0.2 | GO:0001867 | complement activation, lectin pathway(GO:0001867) |
0.0 | 0.1 | GO:1904424 | regulation of GTP binding(GO:1904424) |
0.0 | 0.1 | GO:0002035 | brain renin-angiotensin system(GO:0002035) |
0.0 | 0.1 | GO:0010825 | positive regulation of centrosome duplication(GO:0010825) |
0.0 | 0.1 | GO:0010890 | positive regulation of sequestering of triglyceride(GO:0010890) |
0.0 | 0.1 | GO:0015015 | heparan sulfate proteoglycan biosynthetic process, enzymatic modification(GO:0015015) |
0.0 | 0.1 | GO:0007128 | meiotic prophase I(GO:0007128) prophase(GO:0051324) meiotic cell cycle phase(GO:0098762) meiosis I cell cycle phase(GO:0098764) |
0.0 | 0.2 | GO:0019240 | citrulline biosynthetic process(GO:0019240) |
0.0 | 0.0 | GO:0042362 | fat-soluble vitamin biosynthetic process(GO:0042362) |
0.0 | 0.1 | GO:0002906 | mature B cell apoptotic process(GO:0002901) regulation of mature B cell apoptotic process(GO:0002905) negative regulation of mature B cell apoptotic process(GO:0002906) |
0.0 | 0.1 | GO:0006553 | lysine metabolic process(GO:0006553) |
0.0 | 0.7 | GO:0030521 | androgen receptor signaling pathway(GO:0030521) |
0.0 | 0.2 | GO:0030149 | sphingolipid catabolic process(GO:0030149) |
0.0 | 0.0 | GO:0006930 | substrate-dependent cell migration, cell extension(GO:0006930) |
0.0 | 0.2 | GO:0090201 | negative regulation of release of cytochrome c from mitochondria(GO:0090201) |
0.0 | 0.2 | GO:0034063 | stress granule assembly(GO:0034063) |
0.0 | 0.0 | GO:2001032 | regulation of double-strand break repair via nonhomologous end joining(GO:2001032) |
0.0 | 0.3 | GO:1904376 | negative regulation of protein localization to plasma membrane(GO:1903077) negative regulation of protein localization to cell periphery(GO:1904376) |
0.0 | 0.1 | GO:0070584 | mitochondrion morphogenesis(GO:0070584) |
0.0 | 0.0 | GO:0060018 | astrocyte fate commitment(GO:0060018) |
0.0 | 0.0 | GO:0098735 | positive regulation of the force of heart contraction(GO:0098735) |
0.0 | 0.1 | GO:0060316 | positive regulation of ryanodine-sensitive calcium-release channel activity(GO:0060316) |
0.0 | 0.0 | GO:1902969 | mitotic DNA replication(GO:1902969) |
0.0 | 0.1 | GO:0061042 | vascular wound healing(GO:0061042) |
0.0 | 0.0 | GO:0006768 | biotin metabolic process(GO:0006768) |
0.0 | 0.1 | GO:0016322 | neuron remodeling(GO:0016322) |
0.0 | 0.1 | GO:0045743 | positive regulation of fibroblast growth factor receptor signaling pathway(GO:0045743) |
0.0 | 0.0 | GO:2001214 | positive regulation of vasculogenesis(GO:2001214) |
0.0 | 0.1 | GO:0036289 | peptidyl-serine autophosphorylation(GO:0036289) |
0.0 | 0.0 | GO:0002426 | immunoglobulin production in mucosal tissue(GO:0002426) |
0.0 | 0.1 | GO:0035989 | tendon development(GO:0035989) |
0.0 | 0.1 | GO:0015705 | iodide transport(GO:0015705) |
0.0 | 0.1 | GO:0045837 | negative regulation of membrane potential(GO:0045837) |
0.0 | 0.5 | GO:0051930 | regulation of sensory perception of pain(GO:0051930) regulation of sensory perception(GO:0051931) |
0.0 | 0.1 | GO:0035235 | ionotropic glutamate receptor signaling pathway(GO:0035235) |
0.0 | 0.2 | GO:0086069 | bundle of His cell to Purkinje myocyte communication(GO:0086069) |
0.0 | 0.0 | GO:0060763 | mammary duct terminal end bud growth(GO:0060763) |
0.0 | 0.0 | GO:1901097 | negative regulation of autophagosome maturation(GO:1901097) |
0.0 | 0.1 | GO:0048102 | autophagic cell death(GO:0048102) |
0.0 | 0.1 | GO:0016056 | rhodopsin mediated signaling pathway(GO:0016056) |
0.0 | 0.1 | GO:0007089 | traversing start control point of mitotic cell cycle(GO:0007089) |
0.0 | 0.1 | GO:0018916 | nitrobenzene metabolic process(GO:0018916) |
0.0 | 0.0 | GO:0060729 | intestinal epithelial structure maintenance(GO:0060729) |
0.0 | 0.0 | GO:0009313 | oligosaccharide catabolic process(GO:0009313) |
0.0 | 0.8 | GO:0070936 | protein K48-linked ubiquitination(GO:0070936) |
0.0 | 0.0 | GO:1903975 | regulation of glial cell migration(GO:1903975) |
0.0 | 0.1 | GO:0046471 | phosphatidylglycerol metabolic process(GO:0046471) |
0.0 | 0.1 | GO:0030202 | heparin metabolic process(GO:0030202) |
0.0 | 0.0 | GO:1904154 | positive regulation of retrograde protein transport, ER to cytosol(GO:1904154) |
0.0 | 0.5 | GO:0045806 | negative regulation of endocytosis(GO:0045806) |
0.0 | 0.0 | GO:0051970 | negative regulation of transmission of nerve impulse(GO:0051970) |
0.0 | 0.0 | GO:0033603 | positive regulation of dopamine secretion(GO:0033603) |
0.0 | 0.1 | GO:0060872 | semicircular canal development(GO:0060872) |
0.0 | 0.1 | GO:0000160 | phosphorelay signal transduction system(GO:0000160) |
0.0 | 0.1 | GO:0021854 | hypothalamus development(GO:0021854) |
0.0 | 0.1 | GO:0032876 | negative regulation of DNA endoreduplication(GO:0032876) |
0.0 | 0.1 | GO:0007253 | cytoplasmic sequestering of NF-kappaB(GO:0007253) |
0.0 | 0.1 | GO:0008616 | queuosine biosynthetic process(GO:0008616) queuosine metabolic process(GO:0046116) |
0.0 | 0.3 | GO:0009251 | glycogen catabolic process(GO:0005980) glucan catabolic process(GO:0009251) cellular polysaccharide catabolic process(GO:0044247) |
0.0 | 0.0 | GO:0071673 | positive regulation of smooth muscle cell chemotaxis(GO:0071673) |
0.0 | 0.1 | GO:0002408 | myeloid dendritic cell chemotaxis(GO:0002408) |
0.0 | 0.2 | GO:0018206 | peptidyl-methionine modification(GO:0018206) |
0.0 | 0.4 | GO:0006182 | cGMP biosynthetic process(GO:0006182) |
0.0 | 0.1 | GO:0045053 | protein retention in Golgi apparatus(GO:0045053) |
0.0 | 0.0 | GO:0007196 | adenylate cyclase-inhibiting G-protein coupled glutamate receptor signaling pathway(GO:0007196) |
0.0 | 0.1 | GO:0045779 | negative regulation of bone resorption(GO:0045779) |
0.0 | 0.2 | GO:0045910 | negative regulation of DNA recombination(GO:0045910) |
0.0 | 0.4 | GO:0000470 | maturation of LSU-rRNA(GO:0000470) |
0.0 | 0.0 | GO:0061365 | positive regulation of triglyceride lipase activity(GO:0061365) |
0.0 | 0.0 | GO:0042373 | vitamin K metabolic process(GO:0042373) |
0.0 | 0.4 | GO:0019228 | neuronal action potential(GO:0019228) |
0.0 | 0.0 | GO:0001994 | baroreceptor response to increased systemic arterial blood pressure(GO:0001983) norepinephrine-epinephrine vasoconstriction involved in regulation of systemic arterial blood pressure(GO:0001994) |
0.0 | 0.1 | GO:0035457 | cellular response to interferon-alpha(GO:0035457) |
0.0 | 0.1 | GO:0007252 | I-kappaB phosphorylation(GO:0007252) |
0.0 | 0.0 | GO:0016321 | female meiosis chromosome segregation(GO:0016321) |
0.0 | 0.1 | GO:0098763 | mitotic cell cycle phase(GO:0098763) |
0.0 | 0.1 | GO:2000811 | negative regulation of anoikis(GO:2000811) |
0.0 | 0.1 | GO:2001184 | positive regulation of interleukin-12 secretion(GO:2001184) |
0.0 | 0.1 | GO:0007512 | adult heart development(GO:0007512) |
0.0 | 0.1 | GO:0032485 | regulation of Ral protein signal transduction(GO:0032485) |
0.0 | 0.0 | GO:0060978 | angiogenesis involved in coronary vascular morphogenesis(GO:0060978) |
0.0 | 0.1 | GO:0070203 | regulation of establishment of protein localization to telomere(GO:0070203) |
0.0 | 0.1 | GO:0006307 | DNA dealkylation involved in DNA repair(GO:0006307) |
0.0 | 0.0 | GO:0032226 | positive regulation of synaptic transmission, dopaminergic(GO:0032226) positive regulation of neurotransmitter uptake(GO:0051582) positive regulation of dopamine uptake involved in synaptic transmission(GO:0051586) positive regulation of catecholamine uptake involved in synaptic transmission(GO:0051944) |
0.0 | 0.1 | GO:0019732 | antifungal humoral response(GO:0019732) |
0.0 | 0.0 | GO:1990169 | detoxification of copper ion(GO:0010273) stress response to copper ion(GO:1990169) |
0.0 | 0.3 | GO:0007214 | gamma-aminobutyric acid signaling pathway(GO:0007214) |
0.0 | 0.1 | GO:0031133 | regulation of axon diameter(GO:0031133) |
0.0 | 0.1 | GO:0006020 | inositol metabolic process(GO:0006020) |
0.0 | 0.1 | GO:0017183 | peptidyl-diphthamide metabolic process(GO:0017182) peptidyl-diphthamide biosynthetic process from peptidyl-histidine(GO:0017183) peptidyl-histidine modification(GO:0018202) |
0.0 | 0.3 | GO:0006308 | DNA catabolic process(GO:0006308) |
0.0 | 0.1 | GO:0046271 | phenylpropanoid catabolic process(GO:0046271) |
0.0 | 0.0 | GO:0002322 | B cell proliferation involved in immune response(GO:0002322) |
0.0 | 0.0 | GO:0043615 | astrocyte cell migration(GO:0043615) |
0.0 | 0.1 | GO:0006177 | GMP biosynthetic process(GO:0006177) |
0.0 | 0.0 | GO:0002386 | immune response in mucosal-associated lymphoid tissue(GO:0002386) |
0.0 | 0.3 | GO:0045739 | positive regulation of DNA repair(GO:0045739) |
0.0 | 0.0 | GO:2001182 | regulation of interleukin-12 secretion(GO:2001182) |
0.0 | 0.1 | GO:0050966 | detection of mechanical stimulus involved in sensory perception of pain(GO:0050966) |
0.0 | 0.0 | GO:0002291 | T cell activation via T cell receptor contact with antigen bound to MHC molecule on antigen presenting cell(GO:0002291) |
0.0 | 0.0 | GO:0044333 | Wnt signaling pathway involved in digestive tract morphogenesis(GO:0044333) |
0.0 | 0.0 | GO:1903334 | positive regulation of protein folding(GO:1903334) |
0.0 | 0.1 | GO:0090084 | negative regulation of inclusion body assembly(GO:0090084) |
0.0 | 0.0 | GO:0006362 | transcription elongation from RNA polymerase I promoter(GO:0006362) |
0.0 | 0.0 | GO:0010916 | regulation of very-low-density lipoprotein particle clearance(GO:0010915) negative regulation of very-low-density lipoprotein particle clearance(GO:0010916) |
0.0 | 0.1 | GO:0022900 | electron transport chain(GO:0022900) |
0.0 | 0.0 | GO:0046881 | positive regulation of follicle-stimulating hormone secretion(GO:0046881) |
0.0 | 0.0 | GO:0002572 | pro-T cell differentiation(GO:0002572) |
0.0 | 0.1 | GO:0034497 | protein localization to pre-autophagosomal structure(GO:0034497) |
0.0 | 0.0 | GO:0070587 | negative regulation of heterotypic cell-cell adhesion(GO:0034115) regulation of cell-cell adhesion involved in gastrulation(GO:0070587) |
0.0 | 0.1 | GO:0048280 | vesicle fusion with Golgi apparatus(GO:0048280) |
0.0 | 0.1 | GO:0002052 | positive regulation of neuroblast proliferation(GO:0002052) |
0.0 | 0.0 | GO:0003356 | regulation of cilium beat frequency(GO:0003356) |
0.0 | 0.4 | GO:0007031 | peroxisome organization(GO:0007031) |
0.0 | 0.2 | GO:1900087 | positive regulation of G1/S transition of mitotic cell cycle(GO:1900087) |
0.0 | 0.0 | GO:0010986 | positive regulation of lipoprotein particle clearance(GO:0010986) |
0.0 | 0.0 | GO:0090038 | negative regulation of protein kinase C signaling(GO:0090038) |
0.0 | 0.1 | GO:0015671 | oxygen transport(GO:0015671) |
0.0 | 0.0 | GO:0048807 | female genitalia morphogenesis(GO:0048807) |
0.0 | 0.0 | GO:0097428 | protein maturation by iron-sulfur cluster transfer(GO:0097428) |
0.0 | 0.1 | GO:0009143 | nucleoside triphosphate catabolic process(GO:0009143) |
0.0 | 0.0 | GO:0006543 | glutamine catabolic process(GO:0006543) |
0.0 | 0.1 | GO:0006610 | ribosomal protein import into nucleus(GO:0006610) |
0.0 | 0.0 | GO:1900121 | negative regulation of receptor binding(GO:1900121) |
0.0 | 0.0 | GO:0047484 | regulation of response to osmotic stress(GO:0047484) |
0.0 | 0.1 | GO:0060179 | male mating behavior(GO:0060179) |
0.0 | 0.1 | GO:0009435 | NAD biosynthetic process(GO:0009435) |
0.0 | 0.1 | GO:0055059 | asymmetric neuroblast division(GO:0055059) |
0.0 | 0.1 | GO:0000132 | establishment of mitotic spindle orientation(GO:0000132) |
0.0 | 0.1 | GO:0071380 | cellular response to prostaglandin E stimulus(GO:0071380) |
0.0 | 0.1 | GO:0072525 | pyridine-containing compound biosynthetic process(GO:0072525) |
0.0 | 0.0 | GO:1903797 | positive regulation of inorganic anion transmembrane transport(GO:1903797) |
0.0 | 0.4 | GO:0042273 | ribosomal large subunit biogenesis(GO:0042273) |
0.0 | 0.1 | GO:0043383 | negative T cell selection(GO:0043383) |
0.0 | 0.0 | GO:0060982 | coronary artery morphogenesis(GO:0060982) |
0.0 | 0.2 | GO:0052646 | alditol phosphate metabolic process(GO:0052646) |
0.0 | 0.2 | GO:0021591 | ventricular system development(GO:0021591) |
0.0 | 0.3 | GO:0048247 | lymphocyte chemotaxis(GO:0048247) |
0.0 | 0.0 | GO:2000118 | regulation of sodium-dependent phosphate transport(GO:2000118) |
0.0 | 0.1 | GO:0006370 | 7-methylguanosine mRNA capping(GO:0006370) |
0.0 | 0.0 | GO:0034146 | toll-like receptor 5 signaling pathway(GO:0034146) |
0.0 | 0.0 | GO:0042415 | norepinephrine metabolic process(GO:0042415) |
0.0 | 0.0 | GO:0009301 | snRNA transcription(GO:0009301) |
0.0 | 0.0 | GO:0061209 | cell proliferation involved in mesonephros development(GO:0061209) |
0.0 | 0.0 | GO:0090309 | positive regulation of methylation-dependent chromatin silencing(GO:0090309) |
0.0 | 0.0 | GO:0002318 | myeloid progenitor cell differentiation(GO:0002318) |
0.0 | 0.1 | GO:0071578 | zinc II ion transmembrane import(GO:0071578) |
0.0 | 0.1 | GO:0006620 | posttranslational protein targeting to membrane(GO:0006620) |
0.0 | 0.0 | GO:0015889 | cobalamin transport(GO:0015889) |
0.0 | 0.0 | GO:0014053 | negative regulation of gamma-aminobutyric acid secretion(GO:0014053) |
0.0 | 0.1 | GO:0030575 | nuclear body organization(GO:0030575) |
0.0 | 0.0 | GO:0002220 | innate immune response activating cell surface receptor signaling pathway(GO:0002220) |
0.0 | 0.0 | GO:0042376 | phylloquinone metabolic process(GO:0042374) phylloquinone catabolic process(GO:0042376) quinone catabolic process(GO:1901662) |
0.0 | 0.0 | GO:0042737 | drug catabolic process(GO:0042737) |
0.0 | 0.0 | GO:0006654 | phosphatidic acid biosynthetic process(GO:0006654) phosphatidic acid metabolic process(GO:0046473) |
0.0 | 0.1 | GO:0006590 | thyroid hormone generation(GO:0006590) |
0.0 | 0.1 | GO:0033147 | negative regulation of intracellular estrogen receptor signaling pathway(GO:0033147) |
0.0 | 0.0 | GO:0010481 | epidermal cell division(GO:0010481) regulation of epidermal cell division(GO:0010482) |
0.0 | 0.0 | GO:0010751 | negative regulation of nitric oxide mediated signal transduction(GO:0010751) |
0.0 | 0.0 | GO:0021859 | pyramidal neuron differentiation(GO:0021859) |
0.0 | 0.0 | GO:1902744 | negative regulation of lamellipodium organization(GO:1902744) |
0.0 | 0.0 | GO:2000288 | positive regulation of myoblast proliferation(GO:2000288) |
0.0 | 0.0 | GO:0051660 | establishment of centrosome localization(GO:0051660) |
0.0 | 0.1 | GO:0051646 | mitochondrion localization(GO:0051646) |
0.0 | 0.1 | GO:0030300 | regulation of intestinal cholesterol absorption(GO:0030300) |
0.0 | 0.1 | GO:0007263 | nitric oxide mediated signal transduction(GO:0007263) |
0.0 | 0.1 | GO:0080182 | histone H3-K4 trimethylation(GO:0080182) |
0.0 | 0.0 | GO:2000504 | positive regulation of blood vessel remodeling(GO:2000504) |
0.0 | 0.1 | GO:0016226 | iron-sulfur cluster assembly(GO:0016226) metallo-sulfur cluster assembly(GO:0031163) |
0.0 | 0.0 | GO:0018002 | N-terminal peptidyl-serine acetylation(GO:0017198) N-terminal peptidyl-glutamic acid acetylation(GO:0018002) peptidyl-serine acetylation(GO:0030920) |
0.0 | 0.1 | GO:0042989 | sequestering of actin monomers(GO:0042989) |
0.0 | 0.0 | GO:0043096 | purine nucleobase salvage(GO:0043096) |
0.0 | 0.0 | GO:2000615 | regulation of histone H3-K9 acetylation(GO:2000615) |
0.0 | 0.2 | GO:0050650 | chondroitin sulfate proteoglycan biosynthetic process(GO:0050650) |
0.0 | 0.0 | GO:2000152 | regulation of ubiquitin-specific protease activity(GO:2000152) |
0.0 | 0.0 | GO:2000324 | positive regulation of glucocorticoid receptor signaling pathway(GO:2000324) |
0.0 | 0.0 | GO:0009629 | response to gravity(GO:0009629) |
0.0 | 0.0 | GO:0031547 | brain-derived neurotrophic factor receptor signaling pathway(GO:0031547) |
0.0 | 0.1 | GO:1904153 | negative regulation of protein exit from endoplasmic reticulum(GO:0070862) regulation of retrograde protein transport, ER to cytosol(GO:1904152) negative regulation of retrograde protein transport, ER to cytosol(GO:1904153) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
1.5 | 4.4 | GO:1990761 | growth cone lamellipodium(GO:1990761) |
1.1 | 3.4 | GO:0014701 | junctional sarcoplasmic reticulum membrane(GO:0014701) |
0.4 | 1.2 | GO:0017133 | mitochondrial electron transfer flavoprotein complex(GO:0017133) electron transfer flavoprotein complex(GO:0045251) |
0.3 | 1.0 | GO:0032010 | phagolysosome(GO:0032010) |
0.3 | 1.0 | GO:0005971 | ribonucleoside-diphosphate reductase complex(GO:0005971) |
0.3 | 1.0 | GO:0000172 | ribonuclease MRP complex(GO:0000172) |
0.3 | 0.8 | GO:0000015 | phosphopyruvate hydratase complex(GO:0000015) |
0.3 | 1.0 | GO:0000942 | condensed nuclear chromosome outer kinetochore(GO:0000942) |
0.2 | 1.2 | GO:0032983 | kainate selective glutamate receptor complex(GO:0032983) |
0.2 | 1.3 | GO:1990454 | L-type voltage-gated calcium channel complex(GO:1990454) |
0.2 | 0.7 | GO:0005658 | alpha DNA polymerase:primase complex(GO:0005658) |
0.2 | 0.7 | GO:0097149 | centralspindlin complex(GO:0097149) |
0.2 | 1.4 | GO:0005952 | cAMP-dependent protein kinase complex(GO:0005952) |
0.2 | 0.6 | GO:0097543 | ciliary inversin compartment(GO:0097543) |
0.2 | 1.4 | GO:0098563 | integral component of synaptic vesicle membrane(GO:0030285) intrinsic component of synaptic vesicle membrane(GO:0098563) |
0.2 | 2.7 | GO:0043196 | varicosity(GO:0043196) |
0.2 | 0.5 | GO:0097441 | basilar dendrite(GO:0097441) |
0.2 | 0.6 | GO:1990696 | USH2 complex(GO:1990696) |
0.2 | 1.3 | GO:0045254 | pyruvate dehydrogenase complex(GO:0045254) |
0.2 | 2.0 | GO:0032433 | filopodium tip(GO:0032433) |
0.1 | 0.4 | GO:0030981 | cortical microtubule cytoskeleton(GO:0030981) |
0.1 | 1.7 | GO:0042581 | specific granule(GO:0042581) |
0.1 | 0.6 | GO:0034363 | intermediate-density lipoprotein particle(GO:0034363) |
0.1 | 1.9 | GO:0033178 | proton-transporting two-sector ATPase complex, catalytic domain(GO:0033178) |
0.1 | 1.2 | GO:0005883 | neurofilament(GO:0005883) |
0.1 | 0.3 | GO:0033648 | host intracellular organelle(GO:0033647) host intracellular membrane-bounded organelle(GO:0033648) |
0.1 | 0.5 | GO:0031265 | CD95 death-inducing signaling complex(GO:0031265) |
0.1 | 0.4 | GO:0031233 | intrinsic component of external side of plasma membrane(GO:0031233) |
0.1 | 0.5 | GO:0019815 | B cell receptor complex(GO:0019815) |
0.1 | 0.5 | GO:0033269 | internode region of axon(GO:0033269) |
0.1 | 0.9 | GO:0070419 | nonhomologous end joining complex(GO:0070419) |
0.1 | 0.8 | GO:0032584 | growth cone membrane(GO:0032584) |
0.1 | 0.5 | GO:0031618 | nuclear pericentric heterochromatin(GO:0031618) |
0.1 | 0.7 | GO:0016012 | sarcoglycan complex(GO:0016012) |
0.1 | 0.7 | GO:0008290 | F-actin capping protein complex(GO:0008290) |
0.1 | 0.5 | GO:0033063 | Rad51B-Rad51C-Rad51D-XRCC2 complex(GO:0033063) |
0.1 | 3.0 | GO:0032281 | AMPA glutamate receptor complex(GO:0032281) |
0.1 | 0.4 | GO:0016602 | CCAAT-binding factor complex(GO:0016602) |
0.1 | 1.2 | GO:0030123 | AP-3 adaptor complex(GO:0030123) |
0.1 | 0.7 | GO:0005577 | fibrinogen complex(GO:0005577) |
0.1 | 0.9 | GO:0051286 | cell tip(GO:0051286) |
0.1 | 0.8 | GO:0044666 | MLL3/4 complex(GO:0044666) |
0.1 | 0.4 | GO:0097169 | AIM2 inflammasome complex(GO:0097169) |
0.1 | 0.9 | GO:0005832 | chaperonin-containing T-complex(GO:0005832) |
0.1 | 0.8 | GO:0002116 | semaphorin receptor complex(GO:0002116) |
0.1 | 0.8 | GO:0043194 | axon initial segment(GO:0043194) |
0.1 | 1.6 | GO:1902711 | GABA receptor complex(GO:1902710) GABA-A receptor complex(GO:1902711) |
0.1 | 1.0 | GO:0001518 | voltage-gated sodium channel complex(GO:0001518) |
0.1 | 1.9 | GO:0097228 | sperm principal piece(GO:0097228) |
0.1 | 0.3 | GO:0032299 | ribonuclease H2 complex(GO:0032299) |
0.1 | 0.7 | GO:0005750 | mitochondrial respiratory chain complex III(GO:0005750) respiratory chain complex III(GO:0045275) |
0.1 | 0.7 | GO:0032045 | guanyl-nucleotide exchange factor complex(GO:0032045) |
0.1 | 1.0 | GO:0048786 | presynaptic active zone(GO:0048786) |
0.1 | 1.7 | GO:0031307 | integral component of mitochondrial outer membrane(GO:0031307) |
0.1 | 0.3 | GO:0045098 | type III intermediate filament(GO:0045098) |
0.1 | 1.4 | GO:0005868 | cytoplasmic dynein complex(GO:0005868) |
0.1 | 3.5 | GO:0042734 | presynaptic membrane(GO:0042734) |
0.1 | 1.1 | GO:0001891 | phagocytic cup(GO:0001891) |
0.1 | 0.5 | GO:0031931 | TORC1 complex(GO:0031931) |
0.1 | 0.7 | GO:1990124 | messenger ribonucleoprotein complex(GO:1990124) |
0.1 | 1.4 | GO:0005605 | basal lamina(GO:0005605) |
0.1 | 0.7 | GO:0000815 | ESCRT III complex(GO:0000815) |
0.1 | 0.7 | GO:0030430 | host cell cytoplasm(GO:0030430) host intracellular part(GO:0033646) host cell cytoplasm part(GO:0033655) intracellular region of host(GO:0043656) |
0.1 | 0.6 | GO:0030991 | intraciliary transport particle A(GO:0030991) |
0.1 | 0.1 | GO:1990923 | PET complex(GO:1990923) |
0.1 | 0.5 | GO:0005833 | hemoglobin complex(GO:0005833) |
0.1 | 0.3 | GO:0097433 | dense body(GO:0097433) |
0.1 | 0.3 | GO:0044300 | cerebellar mossy fiber(GO:0044300) |
0.1 | 0.3 | GO:0042406 | extrinsic component of endoplasmic reticulum membrane(GO:0042406) |
0.1 | 0.3 | GO:1990130 | Iml1 complex(GO:1990130) |
0.1 | 0.6 | GO:0042405 | nuclear inclusion body(GO:0042405) |
0.1 | 2.3 | GO:0016592 | mediator complex(GO:0016592) |
0.1 | 0.3 | GO:0005672 | transcription factor TFIIA complex(GO:0005672) |
0.1 | 0.5 | GO:0005677 | chromatin silencing complex(GO:0005677) |
0.1 | 0.2 | GO:0034673 | inhibin-betaglycan-ActRII complex(GO:0034673) |
0.1 | 0.2 | GO:0072534 | perineuronal net(GO:0072534) |
0.1 | 0.3 | GO:0033588 | Elongator holoenzyme complex(GO:0033588) |
0.1 | 0.2 | GO:1990716 | axonemal central apparatus(GO:1990716) |
0.1 | 0.6 | GO:0042622 | photoreceptor outer segment membrane(GO:0042622) |
0.1 | 0.2 | GO:0035189 | Rb-E2F complex(GO:0035189) |
0.1 | 0.4 | GO:0000127 | transcription factor TFIIIC complex(GO:0000127) |
0.1 | 0.3 | GO:0071438 | invadopodium membrane(GO:0071438) |
0.1 | 0.1 | GO:0033596 | TSC1-TSC2 complex(GO:0033596) |
0.1 | 0.1 | GO:0005663 | DNA replication factor C complex(GO:0005663) |
0.1 | 0.2 | GO:0048179 | activin receptor complex(GO:0048179) |
0.1 | 0.2 | GO:0031523 | Myb complex(GO:0031523) |
0.1 | 1.6 | GO:0005790 | smooth endoplasmic reticulum(GO:0005790) |
0.1 | 0.9 | GO:0042101 | T cell receptor complex(GO:0042101) |
0.1 | 0.3 | GO:0070761 | pre-snoRNP complex(GO:0070761) |
0.1 | 0.2 | GO:0000836 | ER ubiquitin ligase complex(GO:0000835) Hrd1p ubiquitin ligase complex(GO:0000836) |
0.1 | 0.2 | GO:1990357 | terminal web(GO:1990357) |
0.1 | 0.2 | GO:0036396 | MIS complex(GO:0036396) |
0.1 | 0.2 | GO:0044352 | pinosome(GO:0044352) macropinosome(GO:0044354) |
0.1 | 0.2 | GO:0005947 | mitochondrial alpha-ketoglutarate dehydrogenase complex(GO:0005947) |
0.1 | 0.3 | GO:0014731 | spectrin-associated cytoskeleton(GO:0014731) |
0.1 | 0.3 | GO:0008541 | proteasome regulatory particle, lid subcomplex(GO:0008541) |
0.0 | 0.1 | GO:0097413 | Lewy body(GO:0097413) |
0.0 | 0.1 | GO:0043203 | axon hillock(GO:0043203) |
0.0 | 0.5 | GO:0017119 | Golgi transport complex(GO:0017119) |
0.0 | 0.1 | GO:0034274 | Atg12-Atg5-Atg16 complex(GO:0034274) |
0.0 | 0.1 | GO:0044322 | endoplasmic reticulum quality control compartment(GO:0044322) |
0.0 | 1.8 | GO:0030964 | mitochondrial respiratory chain complex I(GO:0005747) NADH dehydrogenase complex(GO:0030964) respiratory chain complex I(GO:0045271) |
0.0 | 0.3 | GO:0035686 | sperm fibrous sheath(GO:0035686) |
0.0 | 0.1 | GO:0034666 | integrin alpha2-beta1 complex(GO:0034666) |
0.0 | 0.2 | GO:0030122 | AP-2 adaptor complex(GO:0030122) |
0.0 | 0.1 | GO:0071203 | WASH complex(GO:0071203) |
0.0 | 0.1 | GO:0036194 | muscle cell projection(GO:0036194) muscle cell projection membrane(GO:0036195) |
0.0 | 0.1 | GO:0043293 | apoptosome(GO:0043293) |
0.0 | 0.0 | GO:0044299 | C-fiber(GO:0044299) |
0.0 | 0.0 | GO:0070033 | synaptobrevin 2-SNAP-25-syntaxin-1a-complexin II complex(GO:0070033) |
0.0 | 0.4 | GO:0030867 | rough endoplasmic reticulum membrane(GO:0030867) |
0.0 | 0.2 | GO:0071598 | neuronal ribonucleoprotein granule(GO:0071598) |
0.0 | 0.2 | GO:0031258 | lamellipodium membrane(GO:0031258) |
0.0 | 0.1 | GO:0034448 | EGO complex(GO:0034448) Gtr1-Gtr2 GTPase complex(GO:1990131) |
0.0 | 0.3 | GO:0031588 | nucleotide-activated protein kinase complex(GO:0031588) |
0.0 | 0.4 | GO:0031616 | spindle pole centrosome(GO:0031616) |
0.0 | 0.2 | GO:0005915 | zonula adherens(GO:0005915) |
0.0 | 0.4 | GO:0097440 | apical dendrite(GO:0097440) |
0.0 | 0.3 | GO:0005859 | muscle myosin complex(GO:0005859) |
0.0 | 0.1 | GO:0044393 | microspike(GO:0044393) |
0.0 | 0.4 | GO:0042555 | MCM complex(GO:0042555) |
0.0 | 0.5 | GO:0071565 | nBAF complex(GO:0071565) |
0.0 | 0.1 | GO:0033186 | CAF-1 complex(GO:0033186) |
0.0 | 0.2 | GO:0031314 | extrinsic component of mitochondrial inner membrane(GO:0031314) |
0.0 | 0.3 | GO:0031045 | dense core granule(GO:0031045) |
0.0 | 0.2 | GO:0001652 | granular component(GO:0001652) |
0.0 | 0.1 | GO:0035867 | alphav-beta3 integrin-IGF-1-IGF1R complex(GO:0035867) |
0.0 | 0.4 | GO:0033276 | transcription factor TFTC complex(GO:0033276) |
0.0 | 0.0 | GO:0000938 | GARP complex(GO:0000938) |
0.0 | 0.1 | GO:0044614 | nuclear pore cytoplasmic filaments(GO:0044614) |
0.0 | 0.3 | GO:0035631 | CD40 receptor complex(GO:0035631) |
0.0 | 0.3 | GO:1990023 | mitotic spindle midzone(GO:1990023) |
0.0 | 0.3 | GO:0016010 | dystrophin-associated glycoprotein complex(GO:0016010) glycoprotein complex(GO:0090665) |
0.0 | 0.1 | GO:0000796 | condensin complex(GO:0000796) |
0.0 | 0.1 | GO:0005944 | phosphatidylinositol 3-kinase complex, class IB(GO:0005944) |
0.0 | 0.1 | GO:0071797 | LUBAC complex(GO:0071797) |
0.0 | 0.2 | GO:0034098 | VCP-NPL4-UFD1 AAA ATPase complex(GO:0034098) |
0.0 | 0.1 | GO:0071439 | clathrin complex(GO:0071439) |
0.0 | 0.1 | GO:0034663 | endoplasmic reticulum chaperone complex(GO:0034663) |
0.0 | 0.2 | GO:0032593 | insulin-responsive compartment(GO:0032593) |
0.0 | 0.1 | GO:0046696 | lipopolysaccharide receptor complex(GO:0046696) |
0.0 | 0.2 | GO:0090571 | RNA polymerase II transcription repressor complex(GO:0090571) |
0.0 | 0.1 | GO:1990745 | EARP complex(GO:1990745) |
0.0 | 0.2 | GO:0008074 | guanylate cyclase complex, soluble(GO:0008074) |
0.0 | 1.2 | GO:0005791 | rough endoplasmic reticulum(GO:0005791) |
0.0 | 0.1 | GO:0033010 | paranodal junction(GO:0033010) |
0.0 | 0.0 | GO:0072558 | NLRP1 inflammasome complex(GO:0072558) |
0.0 | 0.1 | GO:0030681 | nucleolar ribonuclease P complex(GO:0005655) ribonuclease P complex(GO:0030677) multimeric ribonuclease P complex(GO:0030681) |
0.0 | 0.2 | GO:0042589 | zymogen granule membrane(GO:0042589) |
0.0 | 0.1 | GO:0048188 | Set1C/COMPASS complex(GO:0048188) |
0.0 | 3.2 | GO:0031225 | anchored component of membrane(GO:0031225) |
0.0 | 0.1 | GO:1990635 | proximal dendrite(GO:1990635) |
0.0 | 0.3 | GO:0000800 | lateral element(GO:0000800) |
0.0 | 0.4 | GO:0005666 | DNA-directed RNA polymerase III complex(GO:0005666) |
0.0 | 0.1 | GO:0055087 | Ski complex(GO:0055087) |
0.0 | 0.9 | GO:0005793 | endoplasmic reticulum-Golgi intermediate compartment(GO:0005793) |
0.0 | 0.3 | GO:0030665 | clathrin-coated vesicle membrane(GO:0030665) |
0.0 | 0.2 | GO:0031010 | ISWI-type complex(GO:0031010) |
0.0 | 0.2 | GO:0031597 | cytosolic proteasome complex(GO:0031597) |
0.0 | 0.1 | GO:0005851 | eukaryotic translation initiation factor 2B complex(GO:0005851) |
0.0 | 0.6 | GO:0032391 | photoreceptor connecting cilium(GO:0032391) |
0.0 | 0.1 | GO:0071817 | MMXD complex(GO:0071817) |
0.0 | 0.5 | GO:0034707 | chloride channel complex(GO:0034707) |
0.0 | 0.1 | GO:0070939 | Dsl1p complex(GO:0070939) |
0.0 | 0.1 | GO:0005896 | interleukin-6 receptor complex(GO:0005896) |
0.0 | 0.0 | GO:0005828 | kinetochore microtubule(GO:0005828) |
0.0 | 0.1 | GO:0005736 | DNA-directed RNA polymerase I complex(GO:0005736) |
0.0 | 2.0 | GO:0035068 | micro-ribonucleoprotein complex(GO:0035068) |
0.0 | 0.1 | GO:0031390 | Ctf18 RFC-like complex(GO:0031390) |
0.0 | 0.0 | GO:0043657 | host(GO:0018995) host cell part(GO:0033643) host cell(GO:0043657) |
0.0 | 0.1 | GO:0045009 | melanosome membrane(GO:0033162) chitosome(GO:0045009) |
0.0 | 0.0 | GO:0070765 | gamma-secretase complex(GO:0070765) |
0.0 | 0.1 | GO:0000805 | X chromosome(GO:0000805) |
0.0 | 0.2 | GO:0045334 | clathrin-coated endocytic vesicle(GO:0045334) |
0.0 | 0.1 | GO:0072487 | MSL complex(GO:0072487) |
0.0 | 0.1 | GO:0098536 | deuterosome(GO:0098536) |
0.0 | 0.1 | GO:0005853 | eukaryotic translation elongation factor 1 complex(GO:0005853) |
0.0 | 1.4 | GO:0008021 | synaptic vesicle(GO:0008021) |
0.0 | 0.1 | GO:0071547 | piP-body(GO:0071547) |
0.0 | 0.1 | GO:0033185 | dolichol-phosphate-mannose synthase complex(GO:0033185) |
0.0 | 0.1 | GO:0005838 | proteasome regulatory particle(GO:0005838) |
0.0 | 0.1 | GO:0035032 | phosphatidylinositol 3-kinase complex, class III(GO:0035032) |
0.0 | 0.1 | GO:0005640 | nuclear outer membrane(GO:0005640) |
0.0 | 0.1 | GO:0043020 | NADPH oxidase complex(GO:0043020) |
0.0 | 0.1 | GO:0000780 | condensed nuclear chromosome, centromeric region(GO:0000780) |
0.0 | 0.1 | GO:0031232 | extrinsic component of external side of plasma membrane(GO:0031232) |
0.0 | 1.1 | GO:0043204 | perikaryon(GO:0043204) |
0.0 | 0.2 | GO:0030877 | beta-catenin destruction complex(GO:0030877) |
0.0 | 1.0 | GO:0016363 | nuclear matrix(GO:0016363) |
0.0 | 0.1 | GO:0030915 | Smc5-Smc6 complex(GO:0030915) |
0.0 | 0.0 | GO:1990393 | 3M complex(GO:1990393) |
0.0 | 0.1 | GO:0070775 | H3 histone acetyltransferase complex(GO:0070775) MOZ/MORF histone acetyltransferase complex(GO:0070776) |
0.0 | 0.1 | GO:0008385 | IkappaB kinase complex(GO:0008385) |
0.0 | 0.2 | GO:0030131 | clathrin adaptor complex(GO:0030131) |
0.0 | 0.1 | GO:0031462 | Cul2-RING ubiquitin ligase complex(GO:0031462) |
0.0 | 0.0 | GO:0044316 | cone cell pedicle(GO:0044316) |
0.0 | 0.0 | GO:1990075 | periciliary membrane compartment(GO:1990075) |
0.0 | 0.0 | GO:0034457 | Mpp10 complex(GO:0034457) |
0.0 | 0.1 | GO:0031414 | N-terminal protein acetyltransferase complex(GO:0031414) |
0.0 | 0.8 | GO:0031463 | Cul3-RING ubiquitin ligase complex(GO:0031463) |
0.0 | 0.0 | GO:1990597 | AIP1-IRE1 complex(GO:1990597) |
0.0 | 0.0 | GO:0000444 | MIS12/MIND type complex(GO:0000444) |
0.0 | 0.0 | GO:0031262 | Ndc80 complex(GO:0031262) |
0.0 | 0.0 | GO:0097629 | extrinsic component of omegasome membrane(GO:0097629) |
0.0 | 0.8 | GO:0022625 | cytosolic large ribosomal subunit(GO:0022625) |
0.0 | 0.0 | GO:0097025 | MPP7-DLG1-LIN7 complex(GO:0097025) |
0.0 | 0.2 | GO:0033017 | sarcoplasmic reticulum membrane(GO:0033017) |
0.0 | 0.1 | GO:0005683 | U7 snRNP(GO:0005683) |
0.0 | 0.1 | GO:0031209 | SCAR complex(GO:0031209) |
0.0 | 0.0 | GO:0030891 | VCB complex(GO:0030891) |
0.0 | 0.0 | GO:0009331 | glycerol-3-phosphate dehydrogenase complex(GO:0009331) |
0.0 | 0.0 | GO:0036454 | insulin-like growth factor binding protein complex(GO:0016942) growth factor complex(GO:0036454) insulin-like growth factor ternary complex(GO:0042567) |
0.0 | 0.0 | GO:0005745 | m-AAA complex(GO:0005745) |
0.0 | 0.1 | GO:0000421 | autophagosome membrane(GO:0000421) |
0.0 | 0.0 | GO:0005927 | muscle tendon junction(GO:0005927) |
0.0 | 0.0 | GO:0044530 | supraspliceosomal complex(GO:0044530) |
0.0 | 0.0 | GO:0035363 | histone locus body(GO:0035363) |
0.0 | 0.0 | GO:0000120 | RNA polymerase I transcription factor complex(GO:0000120) |
0.0 | 0.1 | GO:0033256 | I-kappaB/NF-kappaB complex(GO:0033256) |
0.0 | 0.1 | GO:1990204 | oxidoreductase complex(GO:1990204) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
1.4 | 4.2 | GO:0005519 | cytoskeletal regulatory protein binding(GO:0005519) |
0.9 | 2.7 | GO:0015137 | citrate transmembrane transporter activity(GO:0015137) tricarboxylic acid transmembrane transporter activity(GO:0015142) |
0.5 | 2.1 | GO:0043262 | adenosine-diphosphatase activity(GO:0043262) |
0.5 | 1.5 | GO:0097109 | neuroligin family protein binding(GO:0097109) |
0.5 | 1.4 | GO:0008597 | calcium-dependent protein serine/threonine phosphatase regulator activity(GO:0008597) |
0.4 | 1.3 | GO:0004739 | pyruvate dehydrogenase (acetyl-transferring) activity(GO:0004739) |
0.4 | 1.3 | GO:0008184 | glycogen phosphorylase activity(GO:0008184) |
0.4 | 2.1 | GO:0070728 | leucine binding(GO:0070728) |
0.4 | 1.6 | GO:0005030 | neurotrophin receptor activity(GO:0005030) |
0.4 | 1.2 | GO:0045503 | dynein light chain binding(GO:0045503) |
0.4 | 1.1 | GO:0004505 | phenylalanine 4-monooxygenase activity(GO:0004505) |
0.4 | 2.1 | GO:0005225 | volume-sensitive anion channel activity(GO:0005225) |
0.3 | 1.3 | GO:0004971 | AMPA glutamate receptor activity(GO:0004971) |
0.3 | 1.0 | GO:0016728 | ribonucleoside-diphosphate reductase activity, thioredoxin disulfide as acceptor(GO:0004748) oxidoreductase activity, acting on CH or CH2 groups, disulfide as acceptor(GO:0016728) ribonucleoside-diphosphate reductase activity(GO:0061731) |
0.3 | 1.0 | GO:0000171 | ribonuclease MRP activity(GO:0000171) |
0.3 | 0.9 | GO:0050816 | phosphothreonine binding(GO:0050816) |
0.3 | 1.5 | GO:0004726 | non-membrane spanning protein tyrosine phosphatase activity(GO:0004726) |
0.3 | 2.5 | GO:0001091 | RNA polymerase II basal transcription factor binding(GO:0001091) |
0.3 | 2.2 | GO:0008113 | peptide-methionine (S)-S-oxide reductase activity(GO:0008113) |
0.3 | 0.8 | GO:0031752 | D5 dopamine receptor binding(GO:0031752) |
0.3 | 0.8 | GO:0008503 | benzodiazepine receptor activity(GO:0008503) |
0.3 | 1.3 | GO:0005294 | neutral L-amino acid secondary active transmembrane transporter activity(GO:0005294) |
0.3 | 0.8 | GO:0008898 | S-adenosylmethionine-homocysteine S-methyltransferase activity(GO:0008898) |
0.2 | 0.7 | GO:0016149 | translation release factor activity, codon specific(GO:0016149) |
0.2 | 1.2 | GO:0004634 | phosphopyruvate hydratase activity(GO:0004634) |
0.2 | 0.7 | GO:0004667 | prostaglandin-D synthase activity(GO:0004667) |
0.2 | 0.9 | GO:0030911 | TPR domain binding(GO:0030911) |
0.2 | 0.7 | GO:0004999 | vasoactive intestinal polypeptide receptor activity(GO:0004999) |
0.2 | 4.3 | GO:0008157 | protein phosphatase 1 binding(GO:0008157) |
0.2 | 4.3 | GO:0080025 | phosphatidylinositol-3,5-bisphosphate binding(GO:0080025) |
0.2 | 1.1 | GO:0017034 | Rap guanyl-nucleotide exchange factor activity(GO:0017034) |
0.2 | 0.6 | GO:0030620 | U2 snRNA binding(GO:0030620) |
0.2 | 1.2 | GO:0008603 | cAMP-dependent protein kinase regulator activity(GO:0008603) |
0.2 | 0.6 | GO:0030350 | iron-responsive element binding(GO:0030350) |
0.2 | 0.8 | GO:0004305 | ethanolamine kinase activity(GO:0004305) |
0.2 | 0.6 | GO:0019166 | trans-2-enoyl-CoA reductase (NADPH) activity(GO:0019166) |
0.2 | 2.5 | GO:0008553 | hydrogen-exporting ATPase activity, phosphorylative mechanism(GO:0008553) |
0.2 | 1.6 | GO:0008093 | cytoskeletal adaptor activity(GO:0008093) |
0.2 | 0.5 | GO:0048763 | calcium-induced calcium release activity(GO:0048763) |
0.2 | 0.5 | GO:0016842 | amidine-lyase activity(GO:0016842) |
0.2 | 0.5 | GO:0016309 | 1-phosphatidylinositol-5-phosphate 4-kinase activity(GO:0016309) |
0.2 | 2.4 | GO:0016805 | dipeptidase activity(GO:0016805) |
0.2 | 0.6 | GO:0097001 | ceramide binding(GO:0097001) |
0.2 | 0.3 | GO:0070326 | very-low-density lipoprotein particle receptor binding(GO:0070326) |
0.2 | 0.5 | GO:0097200 | cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:0097200) |
0.2 | 0.6 | GO:0004332 | fructose-bisphosphate aldolase activity(GO:0004332) |
0.2 | 0.5 | GO:0033829 | O-fucosylpeptide 3-beta-N-acetylglucosaminyltransferase activity(GO:0033829) |
0.2 | 3.0 | GO:0003785 | actin monomer binding(GO:0003785) |
0.2 | 0.8 | GO:0086080 | protein binding involved in heterotypic cell-cell adhesion(GO:0086080) |
0.2 | 0.5 | GO:0008495 | 4-hydroxybenzoate octaprenyltransferase activity(GO:0008412) protoheme IX farnesyltransferase activity(GO:0008495) (S)-2,3-di-O-geranylgeranylglyceryl phosphate synthase activity(GO:0043888) cadaverine aminopropyltransferase activity(GO:0043918) agmatine aminopropyltransferase activity(GO:0043919) 1,4-dihydroxy-2-naphthoate octaprenyltransferase activity(GO:0046428) trans-pentaprenyltranstransferase activity(GO:0048045) ATP dimethylallyltransferase activity(GO:0052622) ADP dimethylallyltransferase activity(GO:0052623) |
0.1 | 1.0 | GO:0046790 | virion binding(GO:0046790) |
0.1 | 0.3 | GO:0015222 | serotonin transmembrane transporter activity(GO:0015222) |
0.1 | 0.5 | GO:0031749 | D2 dopamine receptor binding(GO:0031749) |
0.1 | 1.1 | GO:0004571 | mannosyl-oligosaccharide 1,2-alpha-mannosidase activity(GO:0004571) |
0.1 | 0.4 | GO:0035373 | chondroitin sulfate proteoglycan binding(GO:0035373) |
0.1 | 0.4 | GO:0004605 | phosphatidate cytidylyltransferase activity(GO:0004605) |
0.1 | 1.5 | GO:0008656 | cysteine-type endopeptidase activator activity involved in apoptotic process(GO:0008656) |
0.1 | 0.5 | GO:0008970 | phosphatidylcholine 1-acylhydrolase activity(GO:0008970) |
0.1 | 0.4 | GO:0050833 | pyruvate transmembrane transporter activity(GO:0050833) |
0.1 | 0.9 | GO:0004908 | interleukin-1 receptor activity(GO:0004908) |
0.1 | 0.4 | GO:0015440 | peptide-transporting ATPase activity(GO:0015440) |
0.1 | 0.7 | GO:0035473 | lipase binding(GO:0035473) |
0.1 | 0.7 | GO:0030368 | interleukin-17 receptor activity(GO:0030368) |
0.1 | 0.3 | GO:0001031 | RNA polymerase III type 1 promoter DNA binding(GO:0001030) RNA polymerase III type 2 promoter DNA binding(GO:0001031) RNA polymerase III type 3 promoter DNA binding(GO:0001032) 5S rDNA binding(GO:0080084) |
0.1 | 0.5 | GO:0004127 | cytidylate kinase activity(GO:0004127) |
0.1 | 0.3 | GO:0051425 | PTB domain binding(GO:0051425) |
0.1 | 0.7 | GO:0008121 | ubiquinol-cytochrome-c reductase activity(GO:0008121) oxidoreductase activity, acting on diphenols and related substances as donors, cytochrome as acceptor(GO:0016681) |
0.1 | 0.4 | GO:0043515 | kinetochore binding(GO:0043515) |
0.1 | 0.3 | GO:0004920 | interleukin-10 receptor activity(GO:0004920) |
0.1 | 0.6 | GO:0097322 | 7SK snRNA binding(GO:0097322) |
0.1 | 2.2 | GO:0017075 | syntaxin-1 binding(GO:0017075) |
0.1 | 0.3 | GO:0016520 | growth hormone-releasing hormone receptor activity(GO:0016520) |
0.1 | 0.5 | GO:0000014 | single-stranded DNA endodeoxyribonuclease activity(GO:0000014) |
0.1 | 0.2 | GO:0004351 | glutamate decarboxylase activity(GO:0004351) |
0.1 | 0.4 | GO:0032051 | clathrin light chain binding(GO:0032051) |
0.1 | 0.5 | GO:0004769 | steroid delta-isomerase activity(GO:0004769) |
0.1 | 0.4 | GO:0005025 | transforming growth factor beta receptor activity, type I(GO:0005025) |
0.1 | 0.4 | GO:0031433 | telethonin binding(GO:0031433) |
0.1 | 0.4 | GO:0019871 | sodium channel inhibitor activity(GO:0019871) |
0.1 | 0.3 | GO:0000403 | Y-form DNA binding(GO:0000403) |
0.1 | 0.6 | GO:0004064 | arylesterase activity(GO:0004064) |
0.1 | 0.5 | GO:0004826 | phenylalanine-tRNA ligase activity(GO:0004826) |
0.1 | 0.7 | GO:0031821 | G-protein coupled serotonin receptor binding(GO:0031821) |
0.1 | 0.3 | GO:0019961 | interferon binding(GO:0019961) |
0.1 | 0.4 | GO:0035727 | lysophosphatidic acid binding(GO:0035727) |
0.1 | 1.0 | GO:0017154 | semaphorin receptor activity(GO:0017154) |
0.1 | 0.4 | GO:0042731 | PH domain binding(GO:0042731) |
0.1 | 0.5 | GO:0004385 | guanylate kinase activity(GO:0004385) |
0.1 | 1.6 | GO:0004890 | GABA-A receptor activity(GO:0004890) |
0.1 | 0.3 | GO:0004862 | cAMP-dependent protein kinase inhibitor activity(GO:0004862) |
0.1 | 0.4 | GO:0005095 | GTPase inhibitor activity(GO:0005095) |
0.1 | 0.4 | GO:0000405 | bubble DNA binding(GO:0000405) |
0.1 | 1.6 | GO:0030215 | semaphorin receptor binding(GO:0030215) |
0.1 | 0.3 | GO:0005415 | nucleoside:sodium symporter activity(GO:0005415) |
0.1 | 0.3 | GO:0004792 | thiosulfate sulfurtransferase activity(GO:0004792) |
0.1 | 0.3 | GO:0015016 | [heparan sulfate]-glucosamine N-sulfotransferase activity(GO:0015016) |
0.1 | 1.7 | GO:0050136 | NADH dehydrogenase (ubiquinone) activity(GO:0008137) NADH dehydrogenase (quinone) activity(GO:0050136) |
0.1 | 0.3 | GO:1990932 | 5.8S rRNA binding(GO:1990932) |
0.1 | 0.2 | GO:0008240 | tripeptidyl-peptidase activity(GO:0008240) |
0.1 | 0.3 | GO:0016286 | small conductance calcium-activated potassium channel activity(GO:0016286) |
0.1 | 0.3 | GO:0005250 | A-type (transient outward) potassium channel activity(GO:0005250) |
0.1 | 0.8 | GO:0016909 | JUN kinase activity(GO:0004705) SAP kinase activity(GO:0016909) |
0.1 | 0.1 | GO:0043855 | intracellular cyclic nucleotide activated cation channel activity(GO:0005221) cyclic nucleotide-gated ion channel activity(GO:0043855) |
0.1 | 0.5 | GO:0005237 | inhibitory extracellular ligand-gated ion channel activity(GO:0005237) |
0.1 | 1.3 | GO:0017128 | phospholipid scramblase activity(GO:0017128) |
0.1 | 0.5 | GO:0004972 | NMDA glutamate receptor activity(GO:0004972) |
0.1 | 0.5 | GO:0000150 | recombinase activity(GO:0000150) |
0.1 | 0.5 | GO:0005113 | patched binding(GO:0005113) |
0.1 | 0.5 | GO:0008239 | dipeptidyl-peptidase activity(GO:0008239) |
0.1 | 0.2 | GO:0004104 | cholinesterase activity(GO:0004104) |
0.1 | 0.3 | GO:0031720 | haptoglobin binding(GO:0031720) |
0.1 | 0.2 | GO:0035175 | histone kinase activity (H3-S10 specific)(GO:0035175) |
0.1 | 0.9 | GO:0034987 | immunoglobulin receptor binding(GO:0034987) |
0.1 | 1.1 | GO:0004653 | polypeptide N-acetylgalactosaminyltransferase activity(GO:0004653) |
0.1 | 0.4 | GO:0005499 | vitamin D binding(GO:0005499) |
0.1 | 0.4 | GO:0008526 | phosphatidylinositol transporter activity(GO:0008526) |
0.1 | 0.2 | GO:0017116 | single-stranded DNA-dependent ATP-dependent DNA helicase activity(GO:0017116) |
0.1 | 0.3 | GO:0000099 | sulfur amino acid transmembrane transporter activity(GO:0000099) |
0.1 | 0.6 | GO:0004767 | sphingomyelin phosphodiesterase activity(GO:0004767) |
0.1 | 0.3 | GO:0008502 | melatonin receptor activity(GO:0008502) |
0.1 | 0.2 | GO:0051373 | FATZ binding(GO:0051373) |
0.1 | 0.9 | GO:0030296 | protein tyrosine kinase activator activity(GO:0030296) |
0.1 | 0.2 | GO:0015563 | uptake transmembrane transporter activity(GO:0015563) |
0.1 | 0.2 | GO:0004359 | glutaminase activity(GO:0004359) |
0.1 | 0.1 | GO:0001884 | pyrimidine nucleoside binding(GO:0001884) |
0.1 | 0.5 | GO:0019957 | C-C chemokine binding(GO:0019957) |
0.1 | 0.4 | GO:0004679 | AMP-activated protein kinase activity(GO:0004679) |
0.1 | 0.2 | GO:0001226 | RNA polymerase II transcription corepressor binding(GO:0001226) |
0.1 | 0.3 | GO:0004566 | beta-glucuronidase activity(GO:0004566) |
0.1 | 0.3 | GO:0004716 | receptor signaling protein tyrosine kinase activity(GO:0004716) |
0.1 | 0.3 | GO:0046912 | transferase activity, transferring acyl groups, acyl groups converted into alkyl on transfer(GO:0046912) |
0.1 | 0.3 | GO:0004839 | ubiquitin activating enzyme activity(GO:0004839) |
0.1 | 0.8 | GO:0017160 | Ral GTPase binding(GO:0017160) |
0.1 | 0.4 | GO:0005223 | intracellular cGMP activated cation channel activity(GO:0005223) |
0.1 | 0.4 | GO:0033691 | sialic acid binding(GO:0033691) |
0.1 | 0.2 | GO:0004711 | ribosomal protein S6 kinase activity(GO:0004711) |
0.1 | 0.3 | GO:0004652 | polynucleotide adenylyltransferase activity(GO:0004652) |
0.1 | 0.2 | GO:0042392 | sphingosine-1-phosphate phosphatase activity(GO:0042392) |
0.1 | 2.4 | GO:0048487 | beta-tubulin binding(GO:0048487) |
0.1 | 0.3 | GO:0005114 | type II transforming growth factor beta receptor binding(GO:0005114) |
0.1 | 0.2 | GO:0052650 | NADP-retinol dehydrogenase activity(GO:0052650) |
0.1 | 0.2 | GO:0004471 | malic enzyme activity(GO:0004470) malate dehydrogenase (decarboxylating) (NAD+) activity(GO:0004471) |
0.1 | 1.8 | GO:0005251 | delayed rectifier potassium channel activity(GO:0005251) |
0.1 | 0.2 | GO:0045340 | mercury ion binding(GO:0045340) |
0.1 | 0.2 | GO:0051032 | nucleic acid transmembrane transporter activity(GO:0051032) RNA transmembrane transporter activity(GO:0051033) |
0.1 | 0.7 | GO:0008179 | adenylate cyclase binding(GO:0008179) |
0.1 | 0.1 | GO:0001069 | regulatory region RNA binding(GO:0001069) |
0.1 | 0.1 | GO:0015183 | L-aspartate transmembrane transporter activity(GO:0015183) |
0.1 | 0.2 | GO:0019834 | phospholipase A2 inhibitor activity(GO:0019834) |
0.1 | 0.5 | GO:0005041 | low-density lipoprotein receptor activity(GO:0005041) |
0.1 | 0.2 | GO:0042030 | ATPase inhibitor activity(GO:0042030) |
0.1 | 0.3 | GO:1904264 | ubiquitin protein ligase activity involved in ERAD pathway(GO:1904264) |
0.1 | 0.5 | GO:0004438 | phosphatidylinositol-3-phosphatase activity(GO:0004438) |
0.1 | 0.2 | GO:0016882 | cyclo-ligase activity(GO:0016882) |
0.1 | 0.2 | GO:0019959 | interleukin-8 binding(GO:0019959) |
0.1 | 0.1 | GO:0043423 | 3-phosphoinositide-dependent protein kinase binding(GO:0043423) |
0.1 | 1.6 | GO:0018713 | dihydrolipoamide branched chain acyltransferase activity(GO:0004147) palmitoleoyl [acyl-carrier-protein]-dependent acyltransferase activity(GO:0008951) serine O-acyltransferase activity(GO:0016412) O-succinyltransferase activity(GO:0016750) sinapoyltransferase activity(GO:0016752) O-sinapoyltransferase activity(GO:0016753) peptidyl-lysine N6-myristoyltransferase activity(GO:0018030) peptidyl-lysine N6-palmitoyltransferase activity(GO:0018031) benzoyl acetate-CoA thiolase activity(GO:0018711) 3-hydroxybutyryl-CoA thiolase activity(GO:0018712) 3-ketopimelyl-CoA thiolase activity(GO:0018713) N-palmitoyltransferase activity(GO:0019105) acyl-CoA N-acyltransferase activity(GO:0019186) protein-cysteine S-myristoyltransferase activity(GO:0019705) glucosaminyl-phosphotidylinositol O-acyltransferase activity(GO:0032216) ergosterol O-acyltransferase activity(GO:0034737) lanosterol O-acyltransferase activity(GO:0034738) naphthyl-2-oxomethyl-succinyl-CoA succinyl transferase activity(GO:0034848) 2,4,4-trimethyl-3-oxopentanoyl-CoA 2-C-propanoyl transferase activity(GO:0034851) 2-methylhexanoyl-CoA C-acetyltransferase activity(GO:0034915) butyryl-CoA 2-C-propionyltransferase activity(GO:0034919) 2,6-dimethyl-5-methylene-3-oxo-heptanoyl-CoA C-acetyltransferase activity(GO:0034945) L-2-aminoadipate N-acetyltransferase activity(GO:0043741) keto acid formate lyase activity(GO:0043806) azetidine-2-carboxylic acid acetyltransferase activity(GO:0046941) peptidyl-lysine N-acetyltransferase activity, acting on acetyl phosphate as donor(GO:0052858) acetyl-CoA:L-lysine N6-acetyltransferase(GO:0090595) |
0.0 | 0.3 | GO:0003691 | double-stranded telomeric DNA binding(GO:0003691) |
0.0 | 0.1 | GO:0031721 | hemoglobin alpha binding(GO:0031721) |
0.0 | 0.1 | GO:0016015 | morphogen activity(GO:0016015) |
0.0 | 0.2 | GO:0031694 | alpha-2A adrenergic receptor binding(GO:0031694) |
0.0 | 0.2 | GO:0001665 | alpha-N-acetylgalactosaminide alpha-2,6-sialyltransferase activity(GO:0001665) |
0.0 | 0.3 | GO:0016443 | bidentate ribonuclease III activity(GO:0016443) |
0.0 | 0.4 | GO:0019103 | pyrimidine nucleotide binding(GO:0019103) |
0.0 | 0.4 | GO:0003993 | acid phosphatase activity(GO:0003993) |
0.0 | 0.1 | GO:0071532 | ankyrin repeat binding(GO:0071532) |
0.0 | 1.0 | GO:0005540 | hyaluronic acid binding(GO:0005540) |
0.0 | 0.7 | GO:0042800 | histone methyltransferase activity (H3-K4 specific)(GO:0042800) |
0.0 | 0.3 | GO:0018654 | 3-(3-hydroxyphenyl)propionate hydroxylase activity(GO:0008688) 4-chlorobenzaldehyde oxidase activity(GO:0018471) 3,5-xylenol methylhydroxylase activity(GO:0018630) phenylacetate hydroxylase activity(GO:0018631) 4-nitrophenol 4-monooxygenase activity(GO:0018632) dimethyl sulfide monooxygenase activity(GO:0018633) alpha-pinene monooxygenase [NADH] activity(GO:0018634) 1-hydroxy-2-naphthoate hydroxylase activity(GO:0018637) toluene 4-monooxygenase activity(GO:0018638) xylene monooxygenase activity(GO:0018639) dibenzothiophene monooxygenase activity(GO:0018640) 6-hydroxy-3-methyl-2-oxo-1,2-dihydroquinoline 6-monooxygenase activity(GO:0018641) chlorophenol 4-monooxygenase activity(GO:0018642) carbon disulfide oxygenase activity(GO:0018643) toluene 2-monooxygenase activity(GO:0018644) 1-hydroxy-2-oxolimonene 1,2-monooxygenase activity(GO:0018646) phenanthrene 1,2-monooxygenase activity(GO:0018647) tetrahydrofuran hydroxylase activity(GO:0018649) styrene monooxygenase activity(GO:0018650) toluene-4-sulfonate monooxygenase activity(GO:0018651) toluene-sulfonate methyl-monooxygenase activity(GO:0018652) 3-methyl-2-oxo-1,2-dihydroquinoline 6-monooxygenase activity(GO:0018653) 2-hydroxy-phenylacetate hydroxylase activity(GO:0018654) 2-oxo-delta3-4,5,5-trimethylcyclopentenylacetyl-CoA 1,2-monooxygenase activity(GO:0018655) phenanthrene 3,4-monooxygenase activity(GO:0018656) toluene 3-monooxygenase activity(GO:0018657) 4-hydroxyphenylacetate,NADH:oxygen oxidoreductase (3-hydroxylating) activity(GO:0018660) limonene monooxygenase activity(GO:0019113) 2-methylnaphthalene hydroxylase activity(GO:0034526) 1-methylnaphthalene hydroxylase activity(GO:0034534) bisphenol A hydroxylase A activity(GO:0034560) salicylate 5-hydroxylase activity(GO:0034785) isobutylamine N-hydroxylase activity(GO:0034791) branched-chain dodecylbenzene sulfonate monooxygenase activity(GO:0034802) 3-HSA hydroxylase activity(GO:0034819) 4-hydroxypyridine-3-hydroxylase activity(GO:0034894) 2-octaprenyl-3-methyl-6-methoxy-1,4-benzoquinol hydroxylase activity(GO:0043719) 6-hydroxynicotinate 3-monooxygenase activity(GO:0043731) thalianol hydroxylase activity(GO:0080014) |
0.0 | 0.1 | GO:0043140 | ATP-dependent 3'-5' DNA helicase activity(GO:0043140) |
0.0 | 0.1 | GO:0030292 | protein tyrosine kinase inhibitor activity(GO:0030292) |
0.0 | 1.0 | GO:0005385 | zinc ion transmembrane transporter activity(GO:0005385) |
0.0 | 0.2 | GO:0043559 | insulin binding(GO:0043559) |
0.0 | 0.3 | GO:0031730 | CCR5 chemokine receptor binding(GO:0031730) |
0.0 | 0.3 | GO:0031681 | G-protein beta-subunit binding(GO:0031681) |
0.0 | 0.8 | GO:0042813 | Wnt-activated receptor activity(GO:0042813) |
0.0 | 0.0 | GO:0043426 | MRF binding(GO:0043426) |
0.0 | 0.8 | GO:0003950 | NAD+ ADP-ribosyltransferase activity(GO:0003950) |
0.0 | 0.5 | GO:0050998 | nitric-oxide synthase binding(GO:0050998) |
0.0 | 0.1 | GO:0055100 | adiponectin binding(GO:0055100) |
0.0 | 0.3 | GO:0070008 | serine-type exopeptidase activity(GO:0070008) |
0.0 | 0.3 | GO:0005229 | intracellular calcium activated chloride channel activity(GO:0005229) |
0.0 | 0.1 | GO:0042284 | sphingolipid delta-4 desaturase activity(GO:0042284) |
0.0 | 0.2 | GO:0002162 | dystroglycan binding(GO:0002162) |
0.0 | 0.2 | GO:0005111 | type 2 fibroblast growth factor receptor binding(GO:0005111) |
0.0 | 0.6 | GO:0035198 | miRNA binding(GO:0035198) |
0.0 | 0.1 | GO:0016823 | hydrolase activity, acting on acid carbon-carbon bonds(GO:0016822) hydrolase activity, acting on acid carbon-carbon bonds, in ketonic substances(GO:0016823) |
0.0 | 0.3 | GO:0030159 | receptor signaling complex scaffold activity(GO:0030159) |
0.0 | 0.1 | GO:0004365 | glyceraldehyde-3-phosphate dehydrogenase (NAD+) (phosphorylating) activity(GO:0004365) glyceraldehyde-3-phosphate dehydrogenase (NAD(P)+) (phosphorylating) activity(GO:0043891) |
0.0 | 0.5 | GO:0070402 | NADPH binding(GO:0070402) |
0.0 | 0.2 | GO:0016624 | oxidoreductase activity, acting on the aldehyde or oxo group of donors, disulfide as acceptor(GO:0016624) |
0.0 | 0.6 | GO:0005248 | voltage-gated sodium channel activity(GO:0005248) voltage-gated ion channel activity involved in regulation of postsynaptic membrane potential(GO:1905030) |
0.0 | 0.1 | GO:0070097 | delta-catenin binding(GO:0070097) |
0.0 | 0.7 | GO:0030742 | GTP-dependent protein binding(GO:0030742) |
0.0 | 0.2 | GO:0008467 | [heparan sulfate]-glucosamine 3-sulfotransferase 1 activity(GO:0008467) |
0.0 | 0.8 | GO:0004181 | metallocarboxypeptidase activity(GO:0004181) |
0.0 | 0.3 | GO:0047372 | acylglycerol lipase activity(GO:0047372) |
0.0 | 0.5 | GO:0000146 | microfilament motor activity(GO:0000146) |
0.0 | 0.2 | GO:0070087 | chromo shadow domain binding(GO:0070087) |
0.0 | 0.4 | GO:0016500 | protein-hormone receptor activity(GO:0016500) |
0.0 | 0.2 | GO:0005000 | vasopressin receptor activity(GO:0005000) |
0.0 | 0.1 | GO:0005332 | gamma-aminobutyric acid:sodium symporter activity(GO:0005332) |
0.0 | 0.1 | GO:0098518 | polynucleotide phosphatase activity(GO:0098518) |
0.0 | 0.1 | GO:0004165 | dodecenoyl-CoA delta-isomerase activity(GO:0004165) |
0.0 | 0.6 | GO:0032266 | phosphatidylinositol-3-phosphate binding(GO:0032266) |
0.0 | 0.2 | GO:1990239 | steroid hormone binding(GO:1990239) |
0.0 | 1.3 | GO:0004812 | aminoacyl-tRNA ligase activity(GO:0004812) |
0.0 | 0.1 | GO:0015232 | heme transporter activity(GO:0015232) |
0.0 | 0.5 | GO:0031683 | G-protein beta/gamma-subunit complex binding(GO:0031683) |
0.0 | 0.1 | GO:0030976 | thiamine pyrophosphate binding(GO:0030976) |
0.0 | 0.5 | GO:0008066 | glutamate receptor activity(GO:0008066) |
0.0 | 0.5 | GO:0070064 | proline-rich region binding(GO:0070064) |
0.0 | 0.1 | GO:0031727 | CCR2 chemokine receptor binding(GO:0031727) |
0.0 | 0.3 | GO:0070273 | phosphatidylinositol-4-phosphate binding(GO:0070273) |
0.0 | 0.1 | GO:0008142 | oxysterol binding(GO:0008142) |
0.0 | 0.1 | GO:0015182 | L-asparagine transmembrane transporter activity(GO:0015182) L-glutamine transmembrane transporter activity(GO:0015186) |
0.0 | 0.1 | GO:0004703 | G-protein coupled receptor kinase activity(GO:0004703) |
0.0 | 0.1 | GO:0000386 | second spliceosomal transesterification activity(GO:0000386) |
0.0 | 0.1 | GO:0004558 | alpha-1,4-glucosidase activity(GO:0004558) |
0.0 | 0.2 | GO:0004534 | 5'-3' exoribonuclease activity(GO:0004534) |
0.0 | 0.1 | GO:0034040 | lipid-transporting ATPase activity(GO:0034040) |
0.0 | 0.1 | GO:0001075 | transcription factor activity, RNA polymerase II core promoter sequence-specific binding involved in preinitiation complex assembly(GO:0001075) |
0.0 | 0.1 | GO:0016774 | phosphotransferase activity, carboxyl group as acceptor(GO:0016774) |
0.0 | 0.4 | GO:0032183 | SUMO binding(GO:0032183) |
0.0 | 0.9 | GO:0051018 | protein kinase A binding(GO:0051018) |
0.0 | 1.0 | GO:0019894 | kinesin binding(GO:0019894) |
0.0 | 0.3 | GO:0016920 | pyroglutamyl-peptidase activity(GO:0016920) |
0.0 | 0.1 | GO:0004690 | cyclic nucleotide-dependent protein kinase activity(GO:0004690) |
0.0 | 0.2 | GO:0004031 | aldehyde oxidase activity(GO:0004031) oxidoreductase activity, acting on the aldehyde or oxo group of donors, oxygen as acceptor(GO:0016623) |
0.0 | 0.1 | GO:0048408 | epidermal growth factor binding(GO:0048408) |
0.0 | 0.1 | GO:0051880 | G-quadruplex DNA binding(GO:0051880) |
0.0 | 0.2 | GO:0001588 | dopamine neurotransmitter receptor activity, coupled via Gs(GO:0001588) |
0.0 | 0.2 | GO:0004985 | opioid receptor activity(GO:0004985) |
0.0 | 0.1 | GO:0004525 | ribonuclease III activity(GO:0004525) double-stranded RNA-specific ribonuclease activity(GO:0032296) |
0.0 | 0.2 | GO:0000900 | translation repressor activity, nucleic acid binding(GO:0000900) |
0.0 | 0.1 | GO:0003910 | DNA ligase activity(GO:0003909) DNA ligase (ATP) activity(GO:0003910) |
0.0 | 0.1 | GO:0016018 | cyclosporin A binding(GO:0016018) |
0.0 | 0.6 | GO:0005086 | ARF guanyl-nucleotide exchange factor activity(GO:0005086) |
0.0 | 0.1 | GO:0004060 | arylamine N-acetyltransferase activity(GO:0004060) |
0.0 | 0.1 | GO:0044323 | retinoic acid-responsive element binding(GO:0044323) |
0.0 | 0.1 | GO:0008294 | calcium- and calmodulin-responsive adenylate cyclase activity(GO:0008294) |
0.0 | 0.1 | GO:0070579 | methylcytosine dioxygenase activity(GO:0070579) |
0.0 | 0.1 | GO:0004523 | RNA-DNA hybrid ribonuclease activity(GO:0004523) |
0.0 | 0.1 | GO:0004346 | glucose-6-phosphatase activity(GO:0004346) sugar-terminal-phosphatase activity(GO:0050309) |
0.0 | 0.4 | GO:0004993 | G-protein coupled serotonin receptor activity(GO:0004993) serotonin receptor activity(GO:0099589) |
0.0 | 0.1 | GO:0003941 | L-serine ammonia-lyase activity(GO:0003941) |
0.0 | 0.1 | GO:0003831 | beta-N-acetylglucosaminylglycopeptide beta-1,4-galactosyltransferase activity(GO:0003831) |
0.0 | 0.3 | GO:0043422 | protein kinase B binding(GO:0043422) |
0.0 | 0.1 | GO:0034056 | estrogen response element binding(GO:0034056) |
0.0 | 0.0 | GO:0016876 | ligase activity, forming carbon-oxygen bonds(GO:0016875) ligase activity, forming aminoacyl-tRNA and related compounds(GO:0016876) |
0.0 | 1.9 | GO:0017048 | Rho GTPase binding(GO:0017048) |
0.0 | 0.1 | GO:0019784 | NEDD8-specific protease activity(GO:0019784) |
0.0 | 0.1 | GO:0004528 | phosphodiesterase I activity(GO:0004528) |
0.0 | 0.1 | GO:0005134 | interleukin-2 receptor binding(GO:0005134) |
0.0 | 0.1 | GO:0002151 | G-quadruplex RNA binding(GO:0002151) |
0.0 | 0.5 | GO:0008139 | nuclear localization sequence binding(GO:0008139) |
0.0 | 0.1 | GO:0003958 | NADPH-hemoprotein reductase activity(GO:0003958) |
0.0 | 0.3 | GO:0055106 | ubiquitin-protein transferase regulator activity(GO:0055106) |
0.0 | 0.1 | GO:0050811 | GABA receptor binding(GO:0050811) |
0.0 | 0.1 | GO:0046538 | bisphosphoglycerate mutase activity(GO:0004082) phosphoglycerate mutase activity(GO:0004619) 2,3-bisphosphoglycerate-dependent phosphoglycerate mutase activity(GO:0046538) |
0.0 | 0.1 | GO:0004308 | exo-alpha-sialidase activity(GO:0004308) alpha-sialidase activity(GO:0016997) exo-alpha-(2->3)-sialidase activity(GO:0052794) exo-alpha-(2->6)-sialidase activity(GO:0052795) exo-alpha-(2->8)-sialidase activity(GO:0052796) |
0.0 | 0.1 | GO:0070053 | thrombospondin receptor activity(GO:0070053) |
0.0 | 0.1 | GO:0003987 | acetate-CoA ligase activity(GO:0003987) |
0.0 | 0.3 | GO:0030552 | cAMP binding(GO:0030552) |
0.0 | 0.2 | GO:1990405 | protein antigen binding(GO:1990405) |
0.0 | 0.7 | GO:0001102 | RNA polymerase II activating transcription factor binding(GO:0001102) |
0.0 | 0.1 | GO:0016724 | ferroxidase activity(GO:0004322) oxidoreductase activity, oxidizing metal ions, oxygen as acceptor(GO:0016724) |
0.0 | 0.1 | GO:0034046 | poly(G) binding(GO:0034046) |
0.0 | 0.2 | GO:0004383 | guanylate cyclase activity(GO:0004383) |
0.0 | 0.2 | GO:0005522 | profilin binding(GO:0005522) |
0.0 | 0.0 | GO:0031698 | beta-2 adrenergic receptor binding(GO:0031698) |
0.0 | 0.0 | GO:0008545 | JUN kinase kinase activity(GO:0008545) |
0.0 | 0.4 | GO:0015347 | sodium-independent organic anion transmembrane transporter activity(GO:0015347) |
0.0 | 0.1 | GO:0034584 | piRNA binding(GO:0034584) |
0.0 | 0.5 | GO:0017110 | nucleoside-diphosphatase activity(GO:0017110) |
0.0 | 0.0 | GO:0032139 | dinucleotide insertion or deletion binding(GO:0032139) |
0.0 | 0.5 | GO:0005452 | inorganic anion exchanger activity(GO:0005452) |
0.0 | 0.1 | GO:0051959 | dynein light intermediate chain binding(GO:0051959) |
0.0 | 0.2 | GO:0033170 | DNA clamp loader activity(GO:0003689) protein-DNA loading ATPase activity(GO:0033170) |
0.0 | 0.1 | GO:0071209 | U7 snRNA binding(GO:0071209) |
0.0 | 0.1 | GO:0016833 | oxo-acid-lyase activity(GO:0016833) |
0.0 | 0.1 | GO:0001054 | RNA polymerase I activity(GO:0001054) |
0.0 | 0.5 | GO:0070003 | threonine-type endopeptidase activity(GO:0004298) threonine-type peptidase activity(GO:0070003) |
0.0 | 0.1 | GO:0008410 | CoA-transferase activity(GO:0008410) |
0.0 | 1.1 | GO:0004402 | histone acetyltransferase activity(GO:0004402) |
0.0 | 0.4 | GO:0003756 | protein disulfide isomerase activity(GO:0003756) intramolecular oxidoreductase activity, transposing S-S bonds(GO:0016864) |
0.0 | 0.1 | GO:0036033 | mediator complex binding(GO:0036033) |
0.0 | 0.1 | GO:0016262 | protein N-acetylglucosaminyltransferase activity(GO:0016262) |
0.0 | 0.2 | GO:0016861 | intramolecular oxidoreductase activity, interconverting aldoses and ketoses(GO:0016861) |
0.0 | 0.1 | GO:0005131 | growth hormone receptor binding(GO:0005131) |
0.0 | 0.0 | GO:0019187 | beta-1,4-mannosyltransferase activity(GO:0019187) |
0.0 | 2.2 | GO:0004222 | metalloendopeptidase activity(GO:0004222) |
0.0 | 0.4 | GO:0001056 | RNA polymerase III activity(GO:0001056) |
0.0 | 0.1 | GO:0004514 | nicotinate-nucleotide diphosphorylase (carboxylating) activity(GO:0004514) |
0.0 | 0.3 | GO:0035255 | ionotropic glutamate receptor binding(GO:0035255) |
0.0 | 0.0 | GO:0050145 | nucleoside phosphate kinase activity(GO:0050145) |
0.0 | 0.3 | GO:0042608 | T cell receptor binding(GO:0042608) |
0.0 | 0.1 | GO:0030250 | cyclase activator activity(GO:0010853) guanylate cyclase activator activity(GO:0030250) |
0.0 | 0.1 | GO:0019767 | IgE receptor activity(GO:0019767) |
0.0 | 0.6 | GO:0031369 | translation initiation factor binding(GO:0031369) |
0.0 | 0.1 | GO:0000155 | phosphorelay sensor kinase activity(GO:0000155) |
0.0 | 0.1 | GO:0008479 | queuine tRNA-ribosyltransferase activity(GO:0008479) |
0.0 | 0.1 | GO:0051787 | misfolded protein binding(GO:0051787) |
0.0 | 0.5 | GO:0008237 | metallopeptidase activity(GO:0008237) |
0.0 | 0.1 | GO:0004784 | superoxide dismutase activity(GO:0004784) oxidoreductase activity, acting on superoxide radicals as acceptor(GO:0016721) |
0.0 | 0.0 | GO:0050656 | 3'-phosphoadenosine 5'-phosphosulfate binding(GO:0050656) |
0.0 | 0.0 | GO:0048101 | calcium- and calmodulin-regulated 3',5'-cyclic-GMP phosphodiesterase activity(GO:0048101) |
0.0 | 0.6 | GO:0043914 | N-ethylmaleimide reductase activity(GO:0008748) reduced coenzyme F420 dehydrogenase activity(GO:0043738) sulfur oxygenase reductase activity(GO:0043826) malolactic enzyme activity(GO:0043883) NADPH:sulfur oxidoreductase activity(GO:0043914) epoxyqueuosine reductase activity(GO:0052693) |
0.0 | 0.1 | GO:0008504 | monoamine transmembrane transporter activity(GO:0008504) |
0.0 | 0.1 | GO:0015018 | galactosylgalactosylxylosylprotein 3-beta-glucuronosyltransferase activity(GO:0015018) |
0.0 | 0.1 | GO:0032454 | histone demethylase activity (H3-K9 specific)(GO:0032454) |
0.0 | 0.1 | GO:0035241 | protein-arginine omega-N monomethyltransferase activity(GO:0035241) |
0.0 | 0.2 | GO:0031386 | protein tag(GO:0031386) |
0.0 | 0.1 | GO:0004449 | isocitrate dehydrogenase (NAD+) activity(GO:0004449) |
0.0 | 0.1 | GO:0008900 | hydrogen:potassium-exchanging ATPase activity(GO:0008900) |
0.0 | 0.1 | GO:0052833 | inositol monophosphate 1-phosphatase activity(GO:0008934) inositol monophosphate 3-phosphatase activity(GO:0052832) inositol monophosphate 4-phosphatase activity(GO:0052833) inositol monophosphate phosphatase activity(GO:0052834) |
0.0 | 0.1 | GO:0004771 | sterol esterase activity(GO:0004771) |
0.0 | 0.1 | GO:0036435 | K48-linked polyubiquitin binding(GO:0036435) |
0.0 | 0.0 | GO:0035651 | AP-3 adaptor complex binding(GO:0035651) |
0.0 | 0.1 | GO:0008020 | G-protein coupled photoreceptor activity(GO:0008020) |
0.0 | 0.1 | GO:0019992 | diacylglycerol binding(GO:0019992) |
0.0 | 0.5 | GO:0061631 | ubiquitin conjugating enzyme activity(GO:0061631) |
0.0 | 0.2 | GO:0004568 | chitinase activity(GO:0004568) |
0.0 | 0.1 | GO:0005173 | stem cell factor receptor binding(GO:0005173) |
0.0 | 0.0 | GO:0008309 | double-stranded DNA exodeoxyribonuclease activity(GO:0008309) |
0.0 | 0.1 | GO:0015165 | pyrimidine nucleotide-sugar transmembrane transporter activity(GO:0015165) |
0.0 | 0.1 | GO:0003696 | satellite DNA binding(GO:0003696) |
0.0 | 0.2 | GO:0070513 | death domain binding(GO:0070513) |
0.0 | 0.2 | GO:0015026 | coreceptor activity(GO:0015026) |
0.0 | 0.0 | GO:0000026 | alpha-1,2-mannosyltransferase activity(GO:0000026) |
0.0 | 0.0 | GO:0031735 | CCR10 chemokine receptor binding(GO:0031735) |
0.0 | 0.2 | GO:0071889 | 14-3-3 protein binding(GO:0071889) |
0.0 | 0.2 | GO:0009982 | pseudouridine synthase activity(GO:0009982) |
0.0 | 0.1 | GO:0019211 | phosphatase activator activity(GO:0019211) |
0.0 | 0.1 | GO:0005344 | oxygen transporter activity(GO:0005344) |
0.0 | 0.2 | GO:1990841 | promoter-specific chromatin binding(GO:1990841) |
0.0 | 0.0 | GO:0016174 | NAD(P)H oxidase activity(GO:0016174) |
0.0 | 0.1 | GO:0043014 | alpha-tubulin binding(GO:0043014) |
0.0 | 0.0 | GO:0034618 | arginine binding(GO:0034618) |
0.0 | 0.0 | GO:0034739 | histone deacetylase activity (H4-K16 specific)(GO:0034739) |
0.0 | 0.0 | GO:0043125 | ErbB-3 class receptor binding(GO:0043125) |
0.0 | 0.4 | GO:0019212 | phosphatase inhibitor activity(GO:0019212) |
0.0 | 0.1 | GO:0034235 | GPI anchor binding(GO:0034235) |
0.0 | 0.0 | GO:0019153 | protein-disulfide reductase (glutathione) activity(GO:0019153) |
0.0 | 0.1 | GO:0004994 | somatostatin receptor activity(GO:0004994) |
0.0 | 0.0 | GO:0017002 | activin-activated receptor activity(GO:0017002) |
0.0 | 0.1 | GO:0015377 | cation:chloride symporter activity(GO:0015377) |
0.0 | 0.1 | GO:0004095 | carnitine O-palmitoyltransferase activity(GO:0004095) |
0.0 | 0.1 | GO:0008568 | microtubule-severing ATPase activity(GO:0008568) |
0.0 | 0.1 | GO:0042577 | lipid phosphatase activity(GO:0042577) |
0.0 | 0.3 | GO:0001106 | RNA polymerase II transcription corepressor activity(GO:0001106) |
0.0 | 0.2 | GO:0046966 | thyroid hormone receptor binding(GO:0046966) |
0.0 | 0.0 | GO:0004174 | electron-transferring-flavoprotein dehydrogenase activity(GO:0004174) oxidoreductase activity, acting on the CH-NH group of donors, quinone or similar compound as acceptor(GO:0016649) |
0.0 | 0.0 | GO:0030519 | snoRNP binding(GO:0030519) |
0.0 | 0.1 | GO:0008195 | phosphatidate phosphatase activity(GO:0008195) |
0.0 | 0.1 | GO:0008430 | selenium binding(GO:0008430) |
0.0 | 0.5 | GO:0034483 | heparan sulfate sulfotransferase activity(GO:0034483) |
0.0 | 0.1 | GO:0004176 | ATP-dependent peptidase activity(GO:0004176) |
0.0 | 0.2 | GO:0004089 | carbonate dehydratase activity(GO:0004089) |
0.0 | 0.0 | GO:0046624 | sphingolipid transporter activity(GO:0046624) |
0.0 | 0.0 | GO:0015315 | hexose phosphate transmembrane transporter activity(GO:0015119) organophosphate:inorganic phosphate antiporter activity(GO:0015315) hexose-phosphate:inorganic phosphate antiporter activity(GO:0015526) glucose 6-phosphate:inorganic phosphate antiporter activity(GO:0061513) |
0.0 | 0.0 | GO:0005157 | macrophage colony-stimulating factor receptor binding(GO:0005157) |
0.0 | 0.0 | GO:0005006 | epidermal growth factor-activated receptor activity(GO:0005006) |
0.0 | 0.1 | GO:0005068 | transmembrane receptor protein tyrosine kinase adaptor activity(GO:0005068) |
0.0 | 0.0 | GO:0004740 | pyruvate dehydrogenase (acetyl-transferring) kinase activity(GO:0004740) |
0.0 | 0.0 | GO:0008332 | low voltage-gated calcium channel activity(GO:0008332) |
0.0 | 0.1 | GO:0005092 | GDP-dissociation inhibitor activity(GO:0005092) |
0.0 | 0.0 | GO:0004367 | glycerol-3-phosphate dehydrogenase [NAD+] activity(GO:0004367) |
0.0 | 0.2 | GO:0048020 | CCR chemokine receptor binding(GO:0048020) |
0.0 | 0.3 | GO:0005212 | structural constituent of eye lens(GO:0005212) |
0.0 | 0.0 | GO:0070915 | lysophosphatidic acid receptor activity(GO:0070915) |
0.0 | 0.1 | GO:0016813 | hydrolase activity, acting on carbon-nitrogen (but not peptide) bonds, in linear amidines(GO:0016813) |
0.0 | 0.5 | GO:0042281 | dolichyl pyrophosphate Man9GlcNAc2 alpha-1,3-glucosyltransferase activity(GO:0042281) |
0.0 | 0.0 | GO:0008079 | translation release factor activity(GO:0003747) translation termination factor activity(GO:0008079) |
0.0 | 0.0 | GO:0035312 | 5'-3' exodeoxyribonuclease activity(GO:0035312) |
0.0 | 0.0 | GO:0017150 | tRNA dihydrouridine synthase activity(GO:0017150) |
0.0 | 0.1 | GO:0005328 | neurotransmitter:sodium symporter activity(GO:0005328) |
0.0 | 0.0 | GO:1901612 | cardiolipin binding(GO:1901612) |
0.0 | 0.0 | GO:0005338 | nucleotide-sugar transmembrane transporter activity(GO:0005338) |
0.0 | 0.0 | GO:1990825 | sequence-specific mRNA binding(GO:1990825) |
0.0 | 0.1 | GO:0004983 | neuropeptide Y receptor activity(GO:0004983) |
0.0 | 0.1 | GO:0004550 | nucleoside diphosphate kinase activity(GO:0004550) |
0.0 | 0.0 | GO:0001537 | N-acetylgalactosamine 4-O-sulfotransferase activity(GO:0001537) |
0.0 | 0.0 | GO:0043199 | sulfate binding(GO:0043199) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.2 | 0.2 | PID INSULIN PATHWAY | Insulin Pathway |
0.2 | 4.9 | PID TCR CALCIUM PATHWAY | Calcium signaling in the CD4+ TCR pathway |
0.2 | 1.7 | PID TCR JNK PATHWAY | JNK signaling in the CD4+ TCR pathway |
0.2 | 4.4 | PID REELIN PATHWAY | Reelin signaling pathway |
0.1 | 1.6 | PID IL5 PATHWAY | IL5-mediated signaling events |
0.1 | 0.1 | SIG CHEMOTAXIS | Genes related to chemotaxis |
0.1 | 0.9 | PID NFKAPPAB ATYPICAL PATHWAY | Atypical NF-kappaB pathway |
0.1 | 0.5 | PID S1P S1P4 PATHWAY | S1P4 pathway |
0.1 | 1.0 | PID DNA PK PATHWAY | DNA-PK pathway in nonhomologous end joining |
0.1 | 3.2 | PID HEDGEHOG GLI PATHWAY | Hedgehog signaling events mediated by Gli proteins |
0.1 | 1.2 | PID MYC PATHWAY | C-MYC pathway |
0.1 | 1.6 | PID GLYPICAN 1PATHWAY | Glypican 1 network |
0.1 | 0.1 | PID INTEGRIN A4B1 PATHWAY | Alpha4 beta1 integrin signaling events |
0.1 | 1.7 | PID FOXO PATHWAY | FoxO family signaling |
0.1 | 0.1 | PID FAS PATHWAY | FAS (CD95) signaling pathway |
0.1 | 0.9 | PID ARF6 DOWNSTREAM PATHWAY | Arf6 downstream pathway |
0.1 | 4.0 | PID BETA CATENIN NUC PATHWAY | Regulation of nuclear beta catenin signaling and target gene transcription |
0.1 | 0.1 | SA CASPASE CASCADE | Apoptosis is mediated by caspases, cysteine proteases arranged in a proteolytic cascade. |
0.0 | 0.7 | PID LYMPH ANGIOGENESIS PATHWAY | VEGFR3 signaling in lymphatic endothelium |
0.0 | 0.5 | SA PROGRAMMED CELL DEATH | Programmed cell death, or apoptosis, eliminates damaged or unneeded cells. |
0.0 | 0.3 | SA FAS SIGNALING | The TNF-type receptor Fas induces apoptosis on ligand binding. |
0.0 | 0.6 | PID CD40 PATHWAY | CD40/CD40L signaling |
0.0 | 0.9 | PID CONE PATHWAY | Visual signal transduction: Cones |
0.0 | 0.0 | PID IL8 CXCR1 PATHWAY | IL8- and CXCR1-mediated signaling events |
0.0 | 0.3 | ST TYPE I INTERFERON PATHWAY | Type I Interferon (alpha/beta IFN) Pathway |
0.0 | 1.6 | PID CDC42 PATHWAY | CDC42 signaling events |
0.0 | 0.7 | ST DIFFERENTIATION PATHWAY IN PC12 CELLS | Differentiation Pathway in PC12 Cells; this is a specific case of PAC1 Receptor Pathway. |
0.0 | 0.4 | PID PI3KCI AKT PATHWAY | Class I PI3K signaling events mediated by Akt |
0.0 | 1.0 | PID SHP2 PATHWAY | SHP2 signaling |
0.0 | 0.8 | PID INTEGRIN2 PATHWAY | Beta2 integrin cell surface interactions |
0.0 | 0.7 | PID ANGIOPOIETIN RECEPTOR PATHWAY | Angiopoietin receptor Tie2-mediated signaling |
0.0 | 0.9 | PID LKB1 PATHWAY | LKB1 signaling events |
0.0 | 0.6 | PID IL1 PATHWAY | IL1-mediated signaling events |
0.0 | 0.2 | PID CXCR4 PATHWAY | CXCR4-mediated signaling events |
0.0 | 0.5 | PID WNT NONCANONICAL PATHWAY | Noncanonical Wnt signaling pathway |
0.0 | 0.5 | PID FCER1 PATHWAY | Fc-epsilon receptor I signaling in mast cells |
0.0 | 0.4 | PID EPHB FWD PATHWAY | EPHB forward signaling |
0.0 | 0.4 | PID IL12 STAT4 PATHWAY | IL12 signaling mediated by STAT4 |
0.0 | 0.1 | PID VEGF VEGFR PATHWAY | VEGF and VEGFR signaling network |
0.0 | 0.6 | PID ARF6 TRAFFICKING PATHWAY | Arf6 trafficking events |
0.0 | 0.3 | PID IL8 CXCR2 PATHWAY | IL8- and CXCR2-mediated signaling events |
0.0 | 0.2 | PID LPA4 PATHWAY | LPA4-mediated signaling events |
0.0 | 0.2 | PID NETRIN PATHWAY | Netrin-mediated signaling events |
0.0 | 0.1 | PID PI3K PLC TRK PATHWAY | Trk receptor signaling mediated by PI3K and PLC-gamma |
0.0 | 0.2 | PID ARF 3PATHWAY | Arf1 pathway |
0.0 | 0.1 | PID TRAIL PATHWAY | TRAIL signaling pathway |
0.0 | 0.3 | PID CD8 TCR PATHWAY | TCR signaling in naïve CD8+ T cells |
0.0 | 0.2 | PID INTEGRIN3 PATHWAY | Beta3 integrin cell surface interactions |
0.0 | 0.4 | PID HNF3A PATHWAY | FOXA1 transcription factor network |
0.0 | 0.0 | PID TCPTP PATHWAY | Signaling events mediated by TCPTP |
0.0 | 0.1 | PID WNT CANONICAL PATHWAY | Canonical Wnt signaling pathway |
0.0 | 0.1 | PID RANBP2 PATHWAY | Sumoylation by RanBP2 regulates transcriptional repression |
0.0 | 0.0 | ST ADRENERGIC | Adrenergic Pathway |
0.0 | 0.0 | PID VEGFR1 PATHWAY | VEGFR1 specific signals |
0.0 | 0.0 | PID HDAC CLASSIII PATHWAY | Signaling events mediated by HDAC Class III |
0.0 | 0.1 | ST PHOSPHOINOSITIDE 3 KINASE PATHWAY | PI3K Pathway |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.2 | 2.3 | REACTOME GABA A RECEPTOR ACTIVATION | Genes involved in GABA A receptor activation |
0.2 | 2.5 | REACTOME COMMON PATHWAY | Genes involved in Common Pathway |
0.2 | 4.5 | REACTOME RNA POL III TRANSCRIPTION INITIATION FROM TYPE 3 PROMOTER | Genes involved in RNA Polymerase III Transcription Initiation From Type 3 Promoter |
0.2 | 1.0 | REACTOME PLATELET SENSITIZATION BY LDL | Genes involved in Platelet sensitization by LDL |
0.2 | 0.2 | REACTOME CLASS A1 RHODOPSIN LIKE RECEPTORS | Genes involved in Class A/1 (Rhodopsin-like receptors) |
0.2 | 0.2 | REACTOME CREB PHOSPHORYLATION THROUGH THE ACTIVATION OF CAMKII | Genes involved in CREB phosphorylation through the activation of CaMKII |
0.2 | 0.2 | REACTOME ADENYLATE CYCLASE ACTIVATING PATHWAY | Genes involved in Adenylate cyclase activating pathway |
0.1 | 2.1 | REACTOME AMINO ACID SYNTHESIS AND INTERCONVERSION TRANSAMINATION | Genes involved in Amino acid synthesis and interconversion (transamination) |
0.1 | 1.9 | REACTOME UNBLOCKING OF NMDA RECEPTOR GLUTAMATE BINDING AND ACTIVATION | Genes involved in Unblocking of NMDA receptor, glutamate binding and activation |
0.1 | 3.1 | REACTOME MYOGENESIS | Genes involved in Myogenesis |
0.1 | 0.8 | REACTOME DSCAM INTERACTIONS | Genes involved in DSCAM interactions |
0.1 | 0.2 | REACTOME CLEAVAGE OF GROWING TRANSCRIPT IN THE TERMINATION REGION | Genes involved in Cleavage of Growing Transcript in the Termination Region |
0.1 | 1.7 | REACTOME OTHER SEMAPHORIN INTERACTIONS | Genes involved in Other semaphorin interactions |
0.1 | 2.1 | REACTOME GENERATION OF SECOND MESSENGER MOLECULES | Genes involved in Generation of second messenger molecules |
0.1 | 1.1 | REACTOME GLYCOGEN BREAKDOWN GLYCOGENOLYSIS | Genes involved in Glycogen breakdown (glycogenolysis) |
0.1 | 0.1 | REACTOME PLATELET ADHESION TO EXPOSED COLLAGEN | Genes involved in Platelet Adhesion to exposed collagen |
0.1 | 1.2 | REACTOME REGULATION OF PYRUVATE DEHYDROGENASE PDH COMPLEX | Genes involved in Regulation of pyruvate dehydrogenase (PDH) complex |
0.1 | 2.0 | REACTOME MITOCHONDRIAL TRNA AMINOACYLATION | Genes involved in Mitochondrial tRNA aminoacylation |
0.1 | 2.2 | REACTOME TRANSFERRIN ENDOCYTOSIS AND RECYCLING | Genes involved in Transferrin endocytosis and recycling |
0.1 | 0.9 | REACTOME SYNTHESIS OF PE | Genes involved in Synthesis of PE |
0.1 | 1.5 | REACTOME NA CL DEPENDENT NEUROTRANSMITTER TRANSPORTERS | Genes involved in Na+/Cl- dependent neurotransmitter transporters |
0.1 | 0.9 | REACTOME CTNNB1 PHOSPHORYLATION CASCADE | Genes involved in Beta-catenin phosphorylation cascade |
0.1 | 1.0 | REACTOME IONOTROPIC ACTIVITY OF KAINATE RECEPTORS | Genes involved in Ionotropic activity of Kainate Receptors |
0.1 | 1.3 | REACTOME PKA MEDIATED PHOSPHORYLATION OF CREB | Genes involved in PKA-mediated phosphorylation of CREB |
0.1 | 0.6 | REACTOME CREATION OF C4 AND C2 ACTIVATORS | Genes involved in Creation of C4 and C2 activators |
0.1 | 0.9 | REACTOME DOWNREGULATION OF ERBB2 ERBB3 SIGNALING | Genes involved in Downregulation of ERBB2:ERBB3 signaling |
0.1 | 0.7 | REACTOME SEMA3A PAK DEPENDENT AXON REPULSION | Genes involved in Sema3A PAK dependent Axon repulsion |
0.1 | 0.3 | REACTOME SIGNAL REGULATORY PROTEIN SIRP FAMILY INTERACTIONS | Genes involved in Signal regulatory protein (SIRP) family interactions |
0.1 | 0.4 | REACTOME RNA POL III TRANSCRIPTION INITIATION FROM TYPE 2 PROMOTER | Genes involved in RNA Polymerase III Transcription Initiation From Type 2 Promoter |
0.1 | 0.3 | REACTOME DCC MEDIATED ATTRACTIVE SIGNALING | Genes involved in DCC mediated attractive signaling |
0.1 | 2.9 | REACTOME VOLTAGE GATED POTASSIUM CHANNELS | Genes involved in Voltage gated Potassium channels |
0.1 | 0.4 | REACTOME G PROTEIN ACTIVATION | Genes involved in G-protein activation |
0.1 | 0.6 | REACTOME GAP JUNCTION DEGRADATION | Genes involved in Gap junction degradation |
0.1 | 0.5 | REACTOME LIGAND GATED ION CHANNEL TRANSPORT | Genes involved in Ligand-gated ion channel transport |
0.1 | 0.6 | REACTOME HORMONE LIGAND BINDING RECEPTORS | Genes involved in Hormone ligand-binding receptors |
0.1 | 0.6 | REACTOME PROLACTIN RECEPTOR SIGNALING | Genes involved in Prolactin receptor signaling |
0.1 | 0.2 | REACTOME ADENYLATE CYCLASE INHIBITORY PATHWAY | Genes involved in Adenylate cyclase inhibitory pathway |
0.1 | 0.6 | REACTOME REGULATION OF RHEB GTPASE ACTIVITY BY AMPK | Genes involved in Regulation of Rheb GTPase activity by AMPK |
0.1 | 0.6 | REACTOME IRON UPTAKE AND TRANSPORT | Genes involved in Iron uptake and transport |
0.1 | 1.0 | REACTOME REGULATION OF SIGNALING BY CBL | Genes involved in Regulation of signaling by CBL |
0.1 | 0.4 | REACTOME TRANSPORT OF ORGANIC ANIONS | Genes involved in Transport of organic anions |
0.1 | 1.0 | REACTOME CHONDROITIN SULFATE BIOSYNTHESIS | Genes involved in Chondroitin sulfate biosynthesis |
0.1 | 1.0 | REACTOME FORMATION OF TUBULIN FOLDING INTERMEDIATES BY CCT TRIC | Genes involved in Formation of tubulin folding intermediates by CCT/TriC |
0.1 | 0.5 | REACTOME E2F ENABLED INHIBITION OF PRE REPLICATION COMPLEX FORMATION | Genes involved in E2F-enabled inhibition of pre-replication complex formation |
0.1 | 0.6 | REACTOME CELL EXTRACELLULAR MATRIX INTERACTIONS | Genes involved in Cell-extracellular matrix interactions |
0.0 | 0.6 | REACTOME METABOLISM OF PORPHYRINS | Genes involved in Metabolism of porphyrins |
0.0 | 0.8 | REACTOME SYNTHESIS SECRETION AND INACTIVATION OF GLP1 | Genes involved in Synthesis, Secretion, and Inactivation of Glucagon-like Peptide-1 (GLP-1) |
0.0 | 0.5 | REACTOME EXTRINSIC PATHWAY FOR APOPTOSIS | Genes involved in Extrinsic Pathway for Apoptosis |
0.0 | 2.9 | REACTOME RESPIRATORY ELECTRON TRANSPORT | Genes involved in Respiratory electron transport |
0.0 | 0.1 | REACTOME NGF SIGNALLING VIA TRKA FROM THE PLASMA MEMBRANE | Genes involved in NGF signalling via TRKA from the plasma membrane |
0.0 | 0.8 | REACTOME INSULIN SYNTHESIS AND PROCESSING | Genes involved in Insulin Synthesis and Processing |
0.0 | 0.5 | REACTOME INHIBITION OF REPLICATION INITIATION OF DAMAGED DNA BY RB1 E2F1 | Genes involved in Inhibition of replication initiation of damaged DNA by RB1/E2F1 |
0.0 | 1.1 | REACTOME SPHINGOLIPID DE NOVO BIOSYNTHESIS | Genes involved in Sphingolipid de novo biosynthesis |
0.0 | 0.1 | REACTOME RNA POL III TRANSCRIPTION | Genes involved in RNA Polymerase III Transcription |
0.0 | 0.7 | REACTOME ASSOCIATION OF TRIC CCT WITH TARGET PROTEINS DURING BIOSYNTHESIS | Genes involved in Association of TriC/CCT with target proteins during biosynthesis |
0.0 | 0.2 | REACTOME THROMBOXANE SIGNALLING THROUGH TP RECEPTOR | Genes involved in Thromboxane signalling through TP receptor |
0.0 | 0.4 | REACTOME SEROTONIN RECEPTORS | Genes involved in Serotonin receptors |
0.0 | 0.6 | REACTOME DOWNSTREAM TCR SIGNALING | Genes involved in Downstream TCR signaling |
0.0 | 0.8 | REACTOME BASIGIN INTERACTIONS | Genes involved in Basigin interactions |
0.0 | 0.0 | REACTOME P53 INDEPENDENT G1 S DNA DAMAGE CHECKPOINT | Genes involved in p53-Independent G1/S DNA damage checkpoint |
0.0 | 0.1 | REACTOME MRNA CAPPING | Genes involved in mRNA Capping |
0.0 | 0.1 | REACTOME GROWTH HORMONE RECEPTOR SIGNALING | Genes involved in Growth hormone receptor signaling |
0.0 | 0.0 | REACTOME NEGATIVE REGULATION OF THE PI3K AKT NETWORK | Genes involved in Negative regulation of the PI3K/AKT network |
0.0 | 0.3 | REACTOME RETROGRADE NEUROTROPHIN SIGNALLING | Genes involved in Retrograde neurotrophin signalling |
0.0 | 0.0 | REACTOME TRANSPORT OF MATURE MRNA DERIVED FROM AN INTRONLESS TRANSCRIPT | Genes involved in Transport of Mature mRNA Derived from an Intronless Transcript |
0.0 | 0.3 | REACTOME HORMONE SENSITIVE LIPASE HSL MEDIATED TRIACYLGLYCEROL HYDROLYSIS | Genes involved in Hormone-sensitive lipase (HSL)-mediated triacylglycerol hydrolysis |
0.0 | 0.1 | REACTOME TCR SIGNALING | Genes involved in TCR signaling |
0.0 | 0.4 | REACTOME CD28 DEPENDENT PI3K AKT SIGNALING | Genes involved in CD28 dependent PI3K/Akt signaling |
0.0 | 0.3 | REACTOME SYNTHESIS OF PIPS AT THE LATE ENDOSOME MEMBRANE | Genes involved in Synthesis of PIPs at the late endosome membrane |
0.0 | 0.3 | REACTOME PURINE RIBONUCLEOSIDE MONOPHOSPHATE BIOSYNTHESIS | Genes involved in Purine ribonucleoside monophosphate biosynthesis |
0.0 | 0.5 | REACTOME SYNTHESIS AND INTERCONVERSION OF NUCLEOTIDE DI AND TRIPHOSPHATES | Genes involved in Synthesis and interconversion of nucleotide di- and triphosphates |
0.0 | 0.4 | REACTOME INFLAMMASOMES | Genes involved in Inflammasomes |
0.0 | 0.1 | REACTOME CDC6 ASSOCIATION WITH THE ORC ORIGIN COMPLEX | Genes involved in CDC6 association with the ORC:origin complex |
0.0 | 0.1 | REACTOME THE ROLE OF NEF IN HIV1 REPLICATION AND DISEASE PATHOGENESIS | Genes involved in The role of Nef in HIV-1 replication and disease pathogenesis |
0.0 | 0.4 | REACTOME CLASS C 3 METABOTROPIC GLUTAMATE PHEROMONE RECEPTORS | Genes involved in Class C/3 (Metabotropic glutamate/pheromone receptors) |
0.0 | 0.1 | REACTOME ENDOSOMAL VACUOLAR PATHWAY | Genes involved in Endosomal/Vacuolar pathway |
0.0 | 0.1 | REACTOME G BETA GAMMA SIGNALLING THROUGH PI3KGAMMA | Genes involved in G beta:gamma signalling through PI3Kgamma |
0.0 | 0.1 | REACTOME SIGNALLING TO P38 VIA RIT AND RIN | Genes involved in Signalling to p38 via RIT and RIN |
0.0 | 0.4 | REACTOME GLUCAGON TYPE LIGAND RECEPTORS | Genes involved in Glucagon-type ligand receptors |
0.0 | 0.2 | REACTOME ACTIVATION OF THE AP1 FAMILY OF TRANSCRIPTION FACTORS | Genes involved in Activation of the AP-1 family of transcription factors |
0.0 | 0.1 | REACTOME CREB PHOSPHORYLATION THROUGH THE ACTIVATION OF RAS | Genes involved in CREB phosphorylation through the activation of Ras |
0.0 | 0.3 | REACTOME CALNEXIN CALRETICULIN CYCLE | Genes involved in Calnexin/calreticulin cycle |
0.0 | 0.3 | REACTOME PURINE SALVAGE | Genes involved in Purine salvage |
0.0 | 0.0 | REACTOME JNK C JUN KINASES PHOSPHORYLATION AND ACTIVATION MEDIATED BY ACTIVATED HUMAN TAK1 | Genes involved in JNK (c-Jun kinases) phosphorylation and activation mediated by activated human TAK1 |
0.0 | 1.5 | REACTOME G ALPHA1213 SIGNALLING EVENTS | Genes involved in G alpha (12/13) signalling events |
0.0 | 0.3 | REACTOME TIE2 SIGNALING | Genes involved in Tie2 Signaling |
0.0 | 0.7 | REACTOME MEIOTIC SYNAPSIS | Genes involved in Meiotic Synapsis |
0.0 | 0.1 | REACTOME SYNTHESIS SECRETION AND DEACYLATION OF GHRELIN | Genes involved in Synthesis, Secretion, and Deacylation of Ghrelin |
0.0 | 0.0 | REACTOME NEP NS2 INTERACTS WITH THE CELLULAR EXPORT MACHINERY | Genes involved in NEP/NS2 Interacts with the Cellular Export Machinery |
0.0 | 0.5 | REACTOME STEROID HORMONES | Genes involved in Steroid hormones |
0.0 | 0.2 | REACTOME CRMPS IN SEMA3A SIGNALING | Genes involved in CRMPs in Sema3A signaling |
0.0 | 0.2 | REACTOME ANTIGEN PRESENTATION FOLDING ASSEMBLY AND PEPTIDE LOADING OF CLASS I MHC | Genes involved in Antigen Presentation: Folding, assembly and peptide loading of class I MHC |
0.0 | 0.2 | REACTOME ACTIVATION OF BH3 ONLY PROTEINS | Genes involved in Activation of BH3-only proteins |
0.0 | 0.1 | REACTOME IL 6 SIGNALING | Genes involved in Interleukin-6 signaling |
0.0 | 0.0 | REACTOME APC C CDC20 MEDIATED DEGRADATION OF MITOTIC PROTEINS | Genes involved in APC/C:Cdc20 mediated degradation of mitotic proteins |
0.0 | 0.4 | REACTOME DOUBLE STRAND BREAK REPAIR | Genes involved in Double-Strand Break Repair |
0.0 | 0.6 | REACTOME SIGNALING BY SCF KIT | Genes involved in Signaling by SCF-KIT |
0.0 | 0.2 | REACTOME RAP1 SIGNALLING | Genes involved in Rap1 signalling |
0.0 | 0.1 | REACTOME ASSEMBLY OF THE PRE REPLICATIVE COMPLEX | Genes involved in Assembly of the pre-replicative complex |
0.0 | 0.8 | REACTOME ER PHAGOSOME PATHWAY | Genes involved in ER-Phagosome pathway |
0.0 | 0.2 | REACTOME PROCESSING OF INTRONLESS PRE MRNAS | Genes involved in Processing of Intronless Pre-mRNAs |
0.0 | 0.1 | REACTOME OPSINS | Genes involved in Opsins |
0.0 | 0.3 | REACTOME APC CDC20 MEDIATED DEGRADATION OF NEK2A | Genes involved in APC-Cdc20 mediated degradation of Nek2A |
0.0 | 0.2 | REACTOME ZINC TRANSPORTERS | Genes involved in Zinc transporters |
0.0 | 0.9 | REACTOME MITOTIC PROMETAPHASE | Genes involved in Mitotic Prometaphase |
0.0 | 0.1 | REACTOME PEPTIDE HORMONE BIOSYNTHESIS | Genes involved in Peptide hormone biosynthesis |
0.0 | 0.2 | REACTOME RNA POL I TRANSCRIPTION TERMINATION | Genes involved in RNA Polymerase I Transcription Termination |
0.0 | 0.3 | REACTOME CYTOCHROME P450 ARRANGED BY SUBSTRATE TYPE | Genes involved in Cytochrome P450 - arranged by substrate type |
0.0 | 0.1 | REACTOME ACTIVATED AMPK STIMULATES FATTY ACID OXIDATION IN MUSCLE | Genes involved in Activated AMPK stimulates fatty-acid oxidation in muscle |
0.0 | 0.1 | REACTOME IKK COMPLEX RECRUITMENT MEDIATED BY RIP1 | Genes involved in IKK complex recruitment mediated by RIP1 |
0.0 | 0.1 | REACTOME REGULATION OF WATER BALANCE BY RENAL AQUAPORINS | Genes involved in Regulation of Water Balance by Renal Aquaporins |
0.0 | 0.0 | REACTOME PROSTACYCLIN SIGNALLING THROUGH PROSTACYCLIN RECEPTOR | Genes involved in Prostacyclin signalling through prostacyclin receptor |
0.0 | 0.2 | REACTOME ADHERENS JUNCTIONS INTERACTIONS | Genes involved in Adherens junctions interactions |
0.0 | 0.1 | REACTOME REGULATION OF INSULIN LIKE GROWTH FACTOR IGF ACTIVITY BY INSULIN LIKE GROWTH FACTOR BINDING PROTEINS IGFBPS | Genes involved in Regulation of Insulin-like Growth Factor (IGF) Activity by Insulin-like Growth Factor Binding Proteins (IGFBPs) |