Gene Symbol | Gene ID | Gene Info |
---|---|---|
Pbx1
|
ENSMUSG00000052534.9 | pre B cell leukemia homeobox 1 |
Pbx3
|
ENSMUSG00000038718.9 | pre B cell leukemia homeobox 3 |
CRE | Gene | Distance | Association probability | Pearson corr. coef. | P-value | Plot |
---|---|---|---|---|---|---|
Pbx1 | chr1_168169338_168169760 | 4887 | 0.335382 | 0.55 | 1.2e-05 | Click! |
Pbx1 | chr1_168241482_168241666 | 76912 | 0.105180 | 0.52 | 5.1e-05 | Click! |
Pbx1 | chr1_168240513_168240675 | 75932 | 0.107105 | 0.48 | 2.0e-04 | Click! |
Pbx1 | chr1_168417730_168417932 | 13673 | 0.239382 | 0.48 | 2.4e-04 | Click! |
Pbx1 | chr1_168241681_168241841 | 77099 | 0.104817 | 0.44 | 7.2e-04 | Click! |
Pbx3 | chr2_34359581_34359752 | 11180 | 0.195751 | 0.44 | 7.3e-04 | Click! |
Pbx3 | chr2_34363880_34364031 | 6891 | 0.205876 | 0.42 | 1.3e-03 | Click! |
Pbx3 | chr2_34359824_34360026 | 10921 | 0.196156 | 0.40 | 2.2e-03 | Click! |
Pbx3 | chr2_34360127_34360316 | 10625 | 0.196632 | 0.40 | 2.2e-03 | Click! |
Pbx3 | chr2_34355967_34356118 | 14804 | 0.190531 | 0.34 | 1.2e-02 | Click! |
Move your cursor over a bar to see sample name and corresponding Z-value.
Cis Regulatory Element (CRE) | Target Score | Top associated gene | Gene Info | Distance of CRE to TSS | CRE/Gene association probability |
---|---|---|---|---|---|
chr10_8348667_8348983 | 24.55 |
Ust |
uronyl-2-sulfotransferase |
46583 |
0.19 |
chr8_20604856_20605288 | 19.80 |
Gm21112 |
predicted gene, 21112 |
8031 |
0.17 |
chr14_14350947_14351733 | 19.71 |
Il3ra |
interleukin 3 receptor, alpha chain |
1719 |
0.23 |
chr6_31836368_31836519 | 16.50 |
Gm13849 |
predicted gene 13849 |
49768 |
0.16 |
chr12_105906684_105906965 | 13.79 |
Gm19554 |
predicted gene, 19554 |
6983 |
0.2 |
chr8_69463394_69463587 | 13.09 |
Gm45850 |
predicted gene 45850 |
6579 |
0.13 |
chr2_112761607_112761758 | 12.58 |
Ryr3 |
ryanodine receptor 3 |
105134 |
0.07 |
chr8_69533002_69533190 | 11.13 |
Rps7-ps1 |
ribosomal protein S7, pseudogene 1 |
7861 |
0.14 |
chr6_31835987_31836222 | 10.91 |
Gm13849 |
predicted gene 13849 |
49429 |
0.16 |
chr8_62576053_62576229 | 10.11 |
Gm7561 |
predicted gene 7561 |
28310 |
0.17 |
chr4_24669518_24669707 | 9.55 |
Klhl32 |
kelch-like 32 |
5815 |
0.3 |
chr4_41612407_41612596 | 9.49 |
Dnaic1 |
dynein, axonemal, intermediate chain 1 |
19143 |
0.1 |
chr8_54954036_54954355 | 9.01 |
Gpm6a |
glycoprotein m6a |
648 |
0.67 |
chr2_14535212_14535413 | 8.88 |
Gm13266 |
predicted gene 13266 |
22713 |
0.16 |
chr2_21275437_21275663 | 8.79 |
Gm13378 |
predicted gene 13378 |
31445 |
0.16 |
chr10_37666650_37666801 | 8.69 |
Gm48172 |
predicted gene, 48172 |
214045 |
0.02 |
chr1_60645316_60645507 | 8.68 |
Gm23762 |
predicted gene, 23762 |
31608 |
0.11 |
chr6_84845762_84845944 | 8.64 |
Gm7507 |
predicted gene 7507 |
33613 |
0.17 |
chr2_115132749_115132946 | 8.35 |
Gm28493 |
predicted gene 28493 |
2703 |
0.37 |
chr4_23490267_23490482 | 8.13 |
Gm11888 |
predicted gene 11888 |
5554 |
0.27 |
chr2_94764958_94765277 | 7.99 |
Gm26396 |
predicted gene, 26396 |
27219 |
0.2 |
chr17_71439550_71439702 | 7.98 |
Gm49916 |
predicted gene, 49916 |
18079 |
0.11 |
chr1_194637718_194637895 | 7.98 |
Plxna2 |
plexin A2 |
7050 |
0.18 |
chr6_127417772_127418259 | 7.93 |
Gm34091 |
predicted gene, 34091 |
6885 |
0.17 |
chr19_61225302_61226760 | 7.92 |
Csf2ra |
colony stimulating factor 2 receptor, alpha, low-affinity (granulocyte-macrophage) |
541 |
0.67 |
chr17_71439286_71439437 | 7.78 |
Gm49916 |
predicted gene, 49916 |
17814 |
0.11 |
chr1_77629553_77629708 | 7.77 |
Gm28385 |
predicted gene 28385 |
58958 |
0.14 |
chr9_28738420_28738625 | 7.71 |
Opcml |
opioid binding protein/cell adhesion molecule-like |
76893 |
0.12 |
chr17_71438929_71439168 | 7.70 |
Gm49916 |
predicted gene, 49916 |
17501 |
0.11 |
chr14_75516926_75517092 | 7.67 |
Siah3 |
siah E3 ubiquitin protein ligase family member 3 |
61027 |
0.11 |
chr11_105508467_105508712 | 7.66 |
Marchf10 |
membrane associated ring-CH-type finger 10 |
51854 |
0.12 |
chr17_69303567_69303898 | 7.63 |
Gm36487 |
predicted gene, 36487 |
12262 |
0.17 |
chr4_24248674_24248942 | 7.60 |
Gm11892 |
predicted gene 11892 |
10708 |
0.3 |
chr3_107150875_107151233 | 7.60 |
Kcna10 |
potassium voltage-gated channel, shaker-related subfamily, member 10 |
32002 |
0.12 |
chr8_12126666_12127044 | 7.54 |
A230072I06Rik |
RIKEN cDNA A230072I06 gene |
151964 |
0.03 |
chr1_132591364_132591989 | 7.50 |
Nfasc |
neurofascin |
4536 |
0.23 |
chr2_62497464_62497620 | 7.49 |
Fap |
fibroblast activation protein |
5882 |
0.19 |
chr2_21963760_21964435 | 7.49 |
Gm13337 |
predicted gene 13337 |
103729 |
0.08 |
chr11_81767736_81768040 | 7.48 |
5530401A14Rik |
RIKEN cDNA 5530401A14 gene |
92785 |
0.08 |
chr10_14179443_14179662 | 7.41 |
Gm48843 |
predicted gene, 48843 |
17463 |
0.15 |
chr19_14507172_14507352 | 7.41 |
Tle4 |
transducin-like enhancer of split 4 |
88277 |
0.1 |
chr12_98059888_98060040 | 7.34 |
Gm35412 |
predicted gene, 35412 |
40391 |
0.16 |
chr10_96480888_96481078 | 7.29 |
Gm8601 |
predicted gene 8601 |
4504 |
0.24 |
chr3_81025915_81026237 | 7.23 |
Gm42476 |
predicted gene 42476 |
6878 |
0.16 |
chr1_18307976_18308135 | 7.23 |
Defb41 |
defensin beta 41 |
42917 |
0.14 |
chr16_6964831_6964982 | 7.18 |
Rbfox1 |
RNA binding protein, fox-1 homolog (C. elegans) 1 |
104940 |
0.08 |
chr15_10655238_10655729 | 7.13 |
Gm10389 |
predicted gene 10389 |
55146 |
0.1 |
chr17_64836914_64837298 | 7.10 |
4930583I09Rik |
RIKEN cDNA 4930583I09 gene |
1035 |
0.58 |
chr1_129208294_129208780 | 7.06 |
Thsd7b |
thrombospondin, type I, domain containing 7B |
64765 |
0.13 |
chr7_70129967_70130397 | 6.95 |
Gm35325 |
predicted gene, 35325 |
77253 |
0.1 |
chr4_12799618_12799773 | 6.88 |
n-R5s182 |
nuclear encoded rRNA 5S 182 |
13011 |
0.29 |
chr12_41944423_41944588 | 6.86 |
Gm46348 |
predicted gene, 46348 |
72251 |
0.1 |
chr13_110871237_110871388 | 6.84 |
Gm30839 |
predicted gene, 30839 |
10641 |
0.16 |
chr2_38424519_38425045 | 6.80 |
Gm13589 |
predicted gene 13589 |
780 |
0.59 |
chr5_124269688_124269855 | 6.76 |
Mphosph9 |
M-phase phosphoprotein 9 |
4452 |
0.12 |
chr7_115645740_115645945 | 6.75 |
Sox6 |
SRY (sex determining region Y)-box 6 |
16523 |
0.29 |
chr9_28255359_28255596 | 6.74 |
Gm44316 |
predicted gene, 44316 |
37271 |
0.2 |
chr2_148644573_148644724 | 6.72 |
Gm25866 |
predicted gene, 25866 |
19937 |
0.15 |
chr16_62407914_62408105 | 6.67 |
CT010569.1 |
NADH dehydrogenase 5, mitochondrial (mt-Nd5) pseudogene |
75940 |
0.12 |
chr6_28878059_28878560 | 6.59 |
Snd1 |
staphylococcal nuclease and tudor domain containing 1 |
1734 |
0.4 |
chr11_34385116_34385285 | 6.57 |
Insyn2b |
inhibitory synaptic factor family member 2B |
70378 |
0.11 |
chr15_94482693_94482844 | 6.57 |
Adamts20 |
a disintegrin-like and metallopeptidase (reprolysin type) with thrombospondin type 1 motif, 20 |
17350 |
0.22 |
chr2_172338300_172338560 | 6.55 |
Fam210b |
family with sequence similarity 210, member B |
7135 |
0.14 |
chr7_96168957_96169147 | 6.54 |
Tenm4 |
teneurin transmembrane protein 4 |
2194 |
0.37 |
chr15_80460029_80460409 | 6.51 |
Gm23220 |
predicted gene, 23220 |
2045 |
0.27 |
chr4_154948181_154948553 | 6.50 |
Hes5 |
hes family bHLH transcription factor 5 |
12556 |
0.11 |
chr1_42257860_42258242 | 6.47 |
Gm28175 |
predicted gene 28175 |
3804 |
0.23 |
chr10_19277111_19277443 | 6.41 |
Gm33056 |
predicted gene, 33056 |
13712 |
0.19 |
chr13_25269971_25270172 | 6.38 |
Nrsn1 |
neurensin 1 |
11 |
0.99 |
chr9_112130902_112131109 | 6.38 |
Mir128-2 |
microRNA 128-2 |
12294 |
0.24 |
chr10_61086645_61086796 | 6.35 |
Pcbd1 |
pterin 4 alpha carbinolamine dehydratase/dimerization cofactor of hepatocyte nuclear factor 1 alpha (TCF1) 1 |
2611 |
0.2 |
chr12_51002470_51002650 | 6.35 |
Gm40421 |
predicted gene, 40421 |
2313 |
0.29 |
chr8_4677704_4678740 | 6.28 |
Gm7461 |
predicted gene 7461 |
143 |
0.62 |
chr7_98148760_98149240 | 6.28 |
Omp |
olfactory marker protein |
3498 |
0.19 |
chr11_41532495_41533004 | 6.23 |
Hspd1-ps3 |
heat shock protein 1 (chaperonin), pseudogene 3 |
34012 |
0.2 |
chr1_173331323_173331664 | 6.01 |
Ackr1 |
atypical chemokine receptor 1 (Duffy blood group) |
2009 |
0.25 |
chr4_103636454_103636762 | 5.93 |
Dab1 |
disabled 1 |
16943 |
0.19 |
chr4_47699015_47699230 | 5.90 |
Gm22670 |
predicted gene, 22670 |
221633 |
0.02 |
chr11_24350105_24350256 | 5.90 |
Gm12068 |
predicted gene 12068 |
76066 |
0.1 |
chr5_99279174_99279325 | 5.89 |
Gm35394 |
predicted gene, 35394 |
5154 |
0.26 |
chr9_21953653_21953905 | 5.88 |
Swsap1 |
SWIM type zinc finger 7 associated protein 1 |
1976 |
0.16 |
chr6_35463801_35463952 | 5.82 |
Gm23053 |
predicted gene, 23053 |
60762 |
0.12 |
chr10_81464661_81465630 | 5.77 |
Gm16105 |
predicted gene 16105 |
3986 |
0.08 |
chr13_78179260_78179727 | 5.76 |
Gm38604 |
predicted gene, 38604 |
3666 |
0.16 |
chr14_85204219_85204377 | 5.74 |
Gm9264 |
predicted gene 9264 |
274728 |
0.02 |
chr11_112826638_112826789 | 5.74 |
4933434M16Rik |
RIKEN cDNA 4933434M16 gene |
1534 |
0.42 |
chr8_55940261_55940432 | 5.71 |
Glra3 |
glycine receptor, alpha 3 subunit |
114 |
0.97 |
chr17_85620626_85620896 | 5.70 |
Six3 |
sine oculis-related homeobox 3 |
73 |
0.72 |
chr1_57040318_57040506 | 5.70 |
9130024F11Rik |
RIKEN cDNA 9130024F11 gene |
19 |
0.98 |
chr6_40023721_40024003 | 5.68 |
Gm37995 |
predicted gene, 37995 |
3032 |
0.29 |
chr13_80622863_80623368 | 5.67 |
Gm46388 |
predicted gene, 46388 |
130106 |
0.05 |
chr13_43241290_43241444 | 5.65 |
Gfod1 |
glucose-fructose oxidoreductase domain containing 1 |
62038 |
0.1 |
chr14_86937948_86938099 | 5.65 |
Gm23438 |
predicted gene, 23438 |
17312 |
0.28 |
chr2_150665566_150665718 | 5.60 |
E130215H24Rik |
RIKEN cDNA E130215H24 gene |
1852 |
0.22 |
chr4_48779881_48780261 | 5.59 |
Gm24573 |
predicted gene, 24573 |
17109 |
0.19 |
chr5_4877375_4877608 | 5.58 |
Gm43111 |
predicted gene 43111 |
7225 |
0.15 |
chrX_99455660_99455844 | 5.54 |
Gm14808 |
predicted gene 14808 |
3273 |
0.23 |
chr12_29547825_29548188 | 5.49 |
Myt1l |
myelin transcription factor 1-like |
12784 |
0.23 |
chr15_8632402_8632747 | 5.48 |
Slc1a3 |
solute carrier family 1 (glial high affinity glutamate transporter), member 3 |
10673 |
0.2 |
chr19_50441156_50441318 | 5.47 |
Sorcs1 |
sortilin-related VPS10 domain containing receptor 1 |
188559 |
0.03 |
chr9_73258155_73258537 | 5.47 |
Gm27211 |
predicted gene 27211 |
65863 |
0.09 |
chr14_93039972_93040145 | 5.47 |
Gm23509 |
predicted gene, 23509 |
98131 |
0.08 |
chr3_86745461_86745621 | 5.47 |
Gm37876 |
predicted gene, 37876 |
33112 |
0.16 |
chr10_86961941_86962146 | 5.45 |
Gm16271 |
predicted gene 16271 |
10173 |
0.15 |
chr6_144681406_144681563 | 5.45 |
Sox5os3 |
SRY (sex determining region Y)-box 5, opposite strand 3 |
1782 |
0.33 |
chr3_51590575_51590969 | 5.44 |
5430433H01Rik |
RIKEN cDNA 5430433H01 gene |
8466 |
0.11 |
chr2_123349959_123350330 | 5.38 |
Gm13988 |
predicted gene 13988 |
76220 |
0.13 |
chr1_90221883_90222114 | 5.38 |
Gm38277 |
predicted gene, 38277 |
6528 |
0.17 |
chr4_153225006_153225207 | 5.36 |
Gm13174 |
predicted gene 13174 |
6930 |
0.3 |
chr9_97638675_97638995 | 5.36 |
Gm25607 |
predicted gene, 25607 |
199208 |
0.02 |
chr4_30677164_30677315 | 5.34 |
4930556G01Rik |
RIKEN cDNA 4930556G01 gene |
12643 |
0.21 |
chr2_49620647_49620914 | 5.33 |
Kif5c |
kinesin family member 5C |
1482 |
0.5 |
chr1_7206699_7206912 | 5.32 |
Nras-ps2 |
neuroblastoma ras oncogene, pseudogene 2 |
16886 |
0.15 |
chr15_91017261_91017434 | 5.29 |
Kif21a |
kinesin family member 21A |
32471 |
0.16 |
chr18_64859337_64859560 | 5.27 |
Nedd4l |
neural precursor cell expressed, developmentally down-regulated gene 4-like |
28257 |
0.15 |
chr7_125262700_125262978 | 5.24 |
Gm21957 |
predicted gene, 21957 |
42953 |
0.14 |
chr11_80622777_80622948 | 5.22 |
C030013C21Rik |
RIKEN cDNA C030013C21 gene |
113756 |
0.05 |
chr4_63404582_63405510 | 5.22 |
Akna |
AT-hook transcription factor |
1692 |
0.27 |
chr4_23983504_23983750 | 5.20 |
Gm28448 |
predicted gene 28448 |
49673 |
0.19 |
chr6_44408861_44409116 | 5.19 |
Gm44211 |
predicted gene, 44211 |
258447 |
0.02 |
chr12_11198132_11198283 | 5.15 |
9530020I12Rik |
RIKEN cDNA 9530020I12 gene |
6174 |
0.15 |
chr8_71670876_71671939 | 5.14 |
Unc13a |
unc-13 homolog A |
329 |
0.75 |
chr18_23516482_23516843 | 5.14 |
Dtna |
dystrobrevin alpha |
16097 |
0.28 |
chr12_94031496_94031647 | 5.13 |
Gm18749 |
predicted gene, 18749 |
28130 |
0.19 |
chr8_108286094_108286381 | 5.13 |
Gm39244 |
predicted gene, 39244 |
250710 |
0.02 |
chr9_96980387_96981016 | 5.11 |
Spsb4 |
splA/ryanodine receptor domain and SOCS box containing 4 |
3494 |
0.21 |
chr7_132768027_132768213 | 5.11 |
Fam53b |
family with sequence similarity 53, member B |
8796 |
0.2 |
chr18_81589984_81590163 | 5.07 |
Gm41792 |
predicted gene, 41792 |
47586 |
0.14 |
chr5_112577448_112578314 | 5.05 |
Sez6l |
seizure related 6 homolog like |
696 |
0.62 |
chr4_140070081_140070517 | 5.02 |
Gm13027 |
predicted gene 13027 |
61578 |
0.1 |
chr8_12207665_12207816 | 5.02 |
A230072I06Rik |
RIKEN cDNA A230072I06 gene |
71079 |
0.09 |
chr14_122465438_122465889 | 5.02 |
Zic5 |
zinc finger protein of the cerebellum 5 |
14 |
0.96 |
chr5_44667490_44667641 | 5.01 |
Gm43504 |
predicted gene 43504 |
834 |
0.51 |
chr8_41053806_41053970 | 5.00 |
Gm16193 |
predicted gene 16193 |
778 |
0.43 |
chr7_7300279_7300878 | 4.95 |
Clcn4 |
chloride channel, voltage-sensitive 4 |
273 |
0.8 |
chr11_29448855_29449034 | 4.93 |
Ccdc88a |
coiled coil domain containing 88A |
7552 |
0.17 |
chr10_83211091_83211242 | 4.93 |
Gm23122 |
predicted gene, 23122 |
53039 |
0.12 |
chr4_122909636_122909824 | 4.93 |
Gm12891 |
predicted gene 12891 |
16103 |
0.14 |
chr4_32863476_32863744 | 4.93 |
Ankrd6 |
ankyrin repeat domain 6 |
2927 |
0.25 |
chr2_168248927_168249103 | 4.91 |
Gm14237 |
predicted gene 14237 |
6585 |
0.11 |
chr5_139892397_139892619 | 4.90 |
Gm42423 |
predicted gene 42423 |
3301 |
0.2 |
chr1_41891222_41891375 | 4.90 |
Gm29260 |
predicted gene 29260 |
27054 |
0.26 |
chr16_69984402_69984688 | 4.86 |
Speer2 |
spermatogenesis associated glutamate (E)-rich protein 2 |
120801 |
0.06 |
chr2_64079675_64079826 | 4.84 |
Fign |
fidgetin |
18238 |
0.3 |
chr6_22834709_22835019 | 4.83 |
Gm43629 |
predicted gene 43629 |
29535 |
0.14 |
chr5_98987214_98987365 | 4.81 |
Prkg2 |
protein kinase, cGMP-dependent, type II |
20533 |
0.22 |
chr11_81523101_81523252 | 4.79 |
1700071K01Rik |
RIKEN cDNA 1700071K01 gene |
50297 |
0.16 |
chr1_188085557_188085859 | 4.76 |
Gm38315 |
predicted gene, 38315 |
74999 |
0.1 |
chr12_12581999_12582192 | 4.75 |
AC107703.1 |
novel transcript |
87822 |
0.08 |
chr10_105402566_105402744 | 4.75 |
Gm48203 |
predicted gene, 48203 |
8369 |
0.2 |
chrY_90770355_90770677 | 4.73 |
Gm47283 |
predicted gene, 47283 |
14222 |
0.16 |
chr14_64595057_64595229 | 4.72 |
Mir3078 |
microRNA 3078 |
3958 |
0.18 |
chr9_116919464_116919823 | 4.71 |
Rbms3 |
RNA binding motif, single stranded interacting protein |
96824 |
0.08 |
chr18_66015410_66015561 | 4.69 |
Lman1 |
lectin, mannose-binding, 1 |
4293 |
0.16 |
chr3_104762286_104762711 | 4.69 |
Gm6485 |
predicted gene 6485 |
9333 |
0.09 |
chr8_4367916_4368128 | 4.68 |
Gm44869 |
predicted gene 44869 |
5368 |
0.12 |
chr5_30797575_30797865 | 4.68 |
Dpysl5 |
dihydropyrimidinase-like 5 |
4000 |
0.13 |
chr3_135887917_135888228 | 4.66 |
Slc39a8 |
solute carrier family 39 (metal ion transporter), member 8 |
3912 |
0.16 |
chr12_40905771_40905922 | 4.65 |
Gm18246 |
predicted gene, 18246 |
11442 |
0.16 |
chr2_165967796_165968119 | 4.65 |
Gm11462 |
predicted gene 11462 |
8168 |
0.13 |
chr13_114139003_114139183 | 4.64 |
A430090L17Rik |
RIKEN cDNA A430090L17 gene |
12499 |
0.2 |
chr2_158794072_158795253 | 4.63 |
Dhx35 |
DEAH (Asp-Glu-Ala-His) box polypeptide 35 |
145 |
0.96 |
chr10_61517718_61517959 | 4.61 |
Gm17829 |
predicted gene, 17829 |
7253 |
0.12 |
chr11_38193862_38194036 | 4.60 |
Gm12129 |
predicted gene 12129 |
25120 |
0.27 |
chr3_144411337_144411672 | 4.59 |
Gm5857 |
predicted gene 5857 |
16168 |
0.21 |
chr2_159235017_159235197 | 4.58 |
Gm25090 |
predicted gene, 25090 |
95746 |
0.09 |
chr10_13714527_13714874 | 4.56 |
Gm48773 |
predicted gene, 48773 |
87502 |
0.08 |
chr11_83395161_83395312 | 4.55 |
Rasl10b |
RAS-like, family 10, member B |
13901 |
0.11 |
chr13_95719750_95719950 | 4.54 |
Gm50469 |
predicted gene, 50469 |
12356 |
0.14 |
chr3_149720408_149720565 | 4.52 |
Gm31121 |
predicted gene, 31121 |
60090 |
0.16 |
chr16_32516393_32516612 | 4.51 |
Zdhhc19 |
zinc finger, DHHC domain containing 19 |
16891 |
0.12 |
chr2_142058491_142058984 | 4.51 |
Macrod2 |
mono-ADP ribosylhydrolase 2 |
117870 |
0.07 |
chr13_9738316_9738470 | 4.51 |
Zmynd11 |
zinc finger, MYND domain containing 11 |
2509 |
0.22 |
chr19_42817926_42818077 | 4.50 |
Hps1 |
HPS1, biogenesis of lysosomal organelles complex 3 subunit 1 |
38023 |
0.14 |
chr10_93695138_93695295 | 4.48 |
Gm15915 |
predicted gene 15915 |
11894 |
0.14 |
chr6_138008027_138008178 | 4.47 |
Slc15a5 |
solute carrier family 15, member 5 |
28801 |
0.22 |
chr4_14865526_14865698 | 4.46 |
Pip4p2 |
phosphatidylinositol-4,5-bisphosphate 4-phosphatase 2 |
1536 |
0.43 |
chr1_77521937_77522097 | 4.45 |
Gm28386 |
predicted gene 28386 |
6737 |
0.19 |
chr9_17485129_17485436 | 4.42 |
Gm2594 |
predicted gene 2594 |
17427 |
0.24 |
chr8_108245011_108245162 | 4.42 |
Zfhx3 |
zinc finger homeobox 3 |
250527 |
0.02 |
chr11_43336091_43336242 | 4.40 |
Gm12147 |
predicted gene 12147 |
25078 |
0.14 |
chr12_111693411_111693677 | 4.39 |
Gm36635 |
predicted gene, 36635 |
9538 |
0.09 |
chr18_21288530_21288812 | 4.39 |
Garem1 |
GRB2 associated regulator of MAPK1 subtype 1 |
11452 |
0.18 |
chr2_66173281_66173432 | 4.39 |
Gm13618 |
predicted gene 13618 |
14480 |
0.17 |
chr13_28824137_28824310 | 4.38 |
Gm17528 |
predicted gene, 17528 |
2900 |
0.27 |
chr2_26594675_26595827 | 4.38 |
Egfl7 |
EGF-like domain 7 |
3104 |
0.11 |
chr7_84586457_84586781 | 4.37 |
Gm44928 |
predicted gene 44928 |
10777 |
0.14 |
chr5_104299156_104299338 | 4.37 |
Ibsp |
integrin binding sialoprotein |
76 |
0.96 |
chr4_87928972_87929158 | 4.36 |
Mllt3 |
myeloid/lymphoid or mixed-lineage leukemia; translocated to, 3 |
54523 |
0.14 |
chr17_50007046_50007479 | 4.35 |
AC133946.1 |
oxidoreductase NAD-binding domain containing 1 (OXNAD1) pseudogene |
34435 |
0.16 |
chr4_11579083_11579250 | 4.35 |
Fsbp |
fibrinogen silencer binding protein |
499 |
0.74 |
chr15_6705285_6705696 | 4.33 |
Rictor |
RPTOR independent companion of MTOR, complex 2 |
2889 |
0.28 |
chr4_130571039_130571190 | 4.33 |
Nkain1 |
Na+/K+ transporting ATPase interacting 1 |
2852 |
0.33 |
chr3_98940920_98941331 | 4.33 |
5730437C11Rik |
RIKEN cDNA 5730437C11 gene |
131 |
0.96 |
chr1_48343097_48343248 | 4.32 |
Gm5974 |
predicted gene 5974 |
28321 |
0.25 |
chr5_19907432_19907665 | 4.32 |
Magi2 |
membrane associated guanylate kinase, WW and PDZ domain containing 2 |
30 |
0.99 |
chr4_118366779_118367198 | 4.31 |
Szt2 |
SZT2 subunit of KICSTOR complex |
1922 |
0.25 |
chr5_146572167_146572383 | 4.30 |
Gm8494 |
predicted gene 8494 |
2613 |
0.17 |
chr10_87309787_87309961 | 4.29 |
Gm10764 |
predicted gene 10764 |
19141 |
0.2 |
chr4_95185470_95186094 | 4.29 |
Gm12708 |
predicted gene 12708 |
7531 |
0.2 |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
1.9 | 5.7 | GO:0097112 | gamma-aminobutyric acid receptor clustering(GO:0097112) |
1.7 | 5.0 | GO:0097118 | neuroligin clustering involved in postsynaptic membrane assembly(GO:0097118) |
1.6 | 4.9 | GO:0070649 | formin-nucleated actin cable assembly(GO:0070649) |
1.4 | 4.2 | GO:0014016 | neuroblast differentiation(GO:0014016) |
1.0 | 4.2 | GO:0071205 | protein localization to juxtaparanode region of axon(GO:0071205) |
1.0 | 3.1 | GO:0032289 | central nervous system myelin formation(GO:0032289) |
0.9 | 2.8 | GO:0007161 | calcium-independent cell-matrix adhesion(GO:0007161) |
0.9 | 6.4 | GO:0097011 | cellular response to granulocyte macrophage colony-stimulating factor stimulus(GO:0097011) |
0.9 | 3.6 | GO:0006742 | NADP catabolic process(GO:0006742) |
0.7 | 4.2 | GO:0016081 | synaptic vesicle docking(GO:0016081) |
0.6 | 1.8 | GO:0006420 | arginyl-tRNA aminoacylation(GO:0006420) |
0.6 | 1.8 | GO:2000048 | negative regulation of cell-cell adhesion mediated by cadherin(GO:2000048) |
0.6 | 1.7 | GO:0097155 | fasciculation of sensory neuron axon(GO:0097155) |
0.6 | 1.7 | GO:0097477 | lateral motor column neuron migration(GO:0097477) |
0.6 | 3.4 | GO:0048852 | diencephalon morphogenesis(GO:0048852) |
0.6 | 1.1 | GO:2000302 | positive regulation of synaptic vesicle exocytosis(GO:2000302) |
0.5 | 1.6 | GO:0071879 | positive regulation of adrenergic receptor signaling pathway(GO:0071879) |
0.5 | 2.7 | GO:0032237 | activation of store-operated calcium channel activity(GO:0032237) |
0.5 | 1.6 | GO:0051835 | positive regulation of synapse structural plasticity(GO:0051835) |
0.5 | 2.1 | GO:1901339 | regulation of store-operated calcium channel activity(GO:1901339) |
0.5 | 2.1 | GO:0021780 | oligodendrocyte cell fate specification(GO:0021778) oligodendrocyte cell fate commitment(GO:0021779) glial cell fate specification(GO:0021780) |
0.5 | 1.5 | GO:0009449 | gamma-aminobutyric acid biosynthetic process(GO:0009449) |
0.5 | 1.0 | GO:0061341 | non-canonical Wnt signaling pathway involved in heart development(GO:0061341) planar cell polarity pathway involved in heart morphogenesis(GO:0061346) |
0.5 | 4.4 | GO:0070493 | thrombin receptor signaling pathway(GO:0070493) |
0.5 | 1.9 | GO:0002001 | renin secretion into blood stream(GO:0002001) |
0.5 | 2.4 | GO:0042297 | vocal learning(GO:0042297) imitative learning(GO:0098596) learned vocalization behavior or vocal learning(GO:0098598) |
0.5 | 1.4 | GO:0007525 | somatic muscle development(GO:0007525) |
0.5 | 2.3 | GO:1901525 | negative regulation of macromitophagy(GO:1901525) |
0.5 | 1.4 | GO:0030950 | establishment or maintenance of actin cytoskeleton polarity(GO:0030950) |
0.5 | 1.4 | GO:1902071 | regulation of hypoxia-inducible factor-1alpha signaling pathway(GO:1902071) |
0.5 | 0.9 | GO:0035910 | ascending aorta development(GO:0035905) ascending aorta morphogenesis(GO:0035910) |
0.5 | 0.5 | GO:0097476 | motor neuron migration(GO:0097475) spinal cord motor neuron migration(GO:0097476) |
0.5 | 0.5 | GO:0003213 | cardiac right atrium morphogenesis(GO:0003213) |
0.5 | 3.2 | GO:0021540 | corpus callosum morphogenesis(GO:0021540) |
0.5 | 1.4 | GO:0051684 | maintenance of Golgi location(GO:0051684) |
0.5 | 2.7 | GO:0048170 | positive regulation of long-term neuronal synaptic plasticity(GO:0048170) |
0.4 | 2.2 | GO:0021853 | cerebral cortex GABAergic interneuron migration(GO:0021853) interneuron migration(GO:1904936) |
0.4 | 1.3 | GO:0061152 | trachea submucosa development(GO:0061152) trachea gland development(GO:0061153) |
0.4 | 3.0 | GO:2000096 | positive regulation of Wnt signaling pathway, planar cell polarity pathway(GO:2000096) |
0.4 | 2.1 | GO:0035948 | positive regulation of gluconeogenesis by positive regulation of transcription from RNA polymerase II promoter(GO:0035948) |
0.4 | 1.3 | GO:0018879 | biphenyl metabolic process(GO:0018879) |
0.4 | 1.3 | GO:0060287 | epithelial cilium movement involved in determination of left/right asymmetry(GO:0060287) |
0.4 | 1.3 | GO:0000733 | DNA strand renaturation(GO:0000733) |
0.4 | 1.2 | GO:0090360 | platelet-derived growth factor production(GO:0090360) regulation of platelet-derived growth factor production(GO:0090361) |
0.4 | 2.8 | GO:0002591 | positive regulation of antigen processing and presentation of peptide antigen via MHC class I(GO:0002591) |
0.4 | 1.2 | GO:0030327 | prenylated protein catabolic process(GO:0030327) |
0.4 | 1.6 | GO:0060244 | negative regulation of cell proliferation involved in contact inhibition(GO:0060244) |
0.4 | 1.6 | GO:0045039 | protein import into mitochondrial inner membrane(GO:0045039) |
0.4 | 0.8 | GO:0045199 | maintenance of epithelial cell apical/basal polarity(GO:0045199) |
0.4 | 0.8 | GO:0018197 | peptidyl-aspartic acid modification(GO:0018197) |
0.4 | 1.2 | GO:0048682 | axon extension involved in regeneration(GO:0048677) sprouting of injured axon(GO:0048682) |
0.4 | 1.1 | GO:0009196 | dUDP biosynthetic process(GO:0006227) pyrimidine nucleoside diphosphate biosynthetic process(GO:0009139) pyrimidine deoxyribonucleoside diphosphate metabolic process(GO:0009196) pyrimidine deoxyribonucleoside diphosphate biosynthetic process(GO:0009197) dUDP metabolic process(GO:0046077) |
0.4 | 0.8 | GO:0072197 | ureter morphogenesis(GO:0072197) |
0.4 | 1.1 | GO:0072092 | ureteric bud invasion(GO:0072092) |
0.4 | 1.5 | GO:0045636 | positive regulation of melanocyte differentiation(GO:0045636) |
0.4 | 1.9 | GO:1903215 | negative regulation of protein targeting to mitochondrion(GO:1903215) |
0.4 | 1.1 | GO:0042126 | nitrate metabolic process(GO:0042126) |
0.4 | 1.1 | GO:1901843 | positive regulation of high voltage-gated calcium channel activity(GO:1901843) |
0.4 | 1.8 | GO:0031915 | positive regulation of synaptic plasticity(GO:0031915) |
0.4 | 1.1 | GO:0060618 | nipple development(GO:0060618) |
0.4 | 1.1 | GO:0050717 | positive regulation of interleukin-1 alpha secretion(GO:0050717) |
0.4 | 1.8 | GO:0035469 | determination of pancreatic left/right asymmetry(GO:0035469) |
0.4 | 0.7 | GO:2000974 | negative regulation of pro-B cell differentiation(GO:2000974) |
0.3 | 1.0 | GO:0060060 | post-embryonic retina morphogenesis in camera-type eye(GO:0060060) |
0.3 | 1.0 | GO:0032672 | regulation of interleukin-3 production(GO:0032672) |
0.3 | 3.7 | GO:0048268 | clathrin coat assembly(GO:0048268) |
0.3 | 0.7 | GO:2000969 | positive regulation of glutamate receptor signaling pathway(GO:1900451) positive regulation of alpha-amino-3-hydroxy-5-methyl-4-isoxazole propionate selective glutamate receptor activity(GO:2000969) |
0.3 | 0.3 | GO:0051964 | negative regulation of synapse assembly(GO:0051964) |
0.3 | 1.3 | GO:0007621 | negative regulation of female receptivity(GO:0007621) |
0.3 | 1.3 | GO:0051790 | short-chain fatty acid biosynthetic process(GO:0051790) |
0.3 | 0.3 | GO:1901524 | regulation of macromitophagy(GO:1901524) |
0.3 | 0.9 | GO:0035609 | C-terminal protein deglutamylation(GO:0035609) |
0.3 | 2.5 | GO:0042795 | snRNA transcription from RNA polymerase II promoter(GO:0042795) |
0.3 | 0.9 | GO:0061502 | early endosome to recycling endosome transport(GO:0061502) |
0.3 | 0.3 | GO:0031547 | brain-derived neurotrophic factor receptor signaling pathway(GO:0031547) |
0.3 | 1.2 | GO:1903361 | protein localization to basolateral plasma membrane(GO:1903361) |
0.3 | 0.6 | GO:0098814 | spontaneous neurotransmitter secretion(GO:0061669) spontaneous synaptic transmission(GO:0098814) |
0.3 | 1.7 | GO:0090527 | actin filament reorganization(GO:0090527) |
0.3 | 1.1 | GO:0038108 | negative regulation of appetite by leptin-mediated signaling pathway(GO:0038108) |
0.3 | 4.2 | GO:0090036 | regulation of protein kinase C signaling(GO:0090036) |
0.3 | 0.8 | GO:0030421 | defecation(GO:0030421) |
0.3 | 0.6 | GO:0048014 | Tie signaling pathway(GO:0048014) |
0.3 | 2.8 | GO:0070050 | neuron cellular homeostasis(GO:0070050) |
0.3 | 1.1 | GO:0042780 | tRNA 3'-end processing(GO:0042780) |
0.3 | 1.1 | GO:0071374 | cellular response to parathyroid hormone stimulus(GO:0071374) |
0.3 | 2.2 | GO:0045945 | positive regulation of transcription from RNA polymerase III promoter(GO:0045945) |
0.3 | 0.5 | GO:0060997 | dendritic spine morphogenesis(GO:0060997) |
0.3 | 1.0 | GO:0060398 | regulation of growth hormone receptor signaling pathway(GO:0060398) |
0.3 | 0.3 | GO:2000978 | negative regulation of forebrain neuron differentiation(GO:2000978) |
0.3 | 0.8 | GO:1901382 | chorionic trophoblast cell proliferation(GO:0097360) regulation of chorionic trophoblast cell proliferation(GO:1901382) |
0.3 | 1.0 | GO:0039689 | negative stranded viral RNA replication(GO:0039689) multi-organism biosynthetic process(GO:0044034) |
0.3 | 0.3 | GO:2000807 | regulation of synaptic vesicle clustering(GO:2000807) |
0.3 | 0.3 | GO:0014052 | regulation of gamma-aminobutyric acid secretion(GO:0014052) positive regulation of gamma-aminobutyric acid secretion(GO:0014054) |
0.3 | 0.5 | GO:0061092 | regulation of phospholipid translocation(GO:0061091) positive regulation of phospholipid translocation(GO:0061092) |
0.2 | 2.0 | GO:0007100 | mitotic centrosome separation(GO:0007100) |
0.2 | 0.7 | GO:0006597 | spermine biosynthetic process(GO:0006597) |
0.2 | 1.2 | GO:0044789 | modulation by host of viral release from host cell(GO:0044789) positive regulation by host of viral release from host cell(GO:0044791) |
0.2 | 1.2 | GO:0060159 | regulation of dopamine receptor signaling pathway(GO:0060159) |
0.2 | 0.7 | GO:0007386 | compartment pattern specification(GO:0007386) |
0.2 | 1.0 | GO:0030309 | poly-N-acetyllactosamine metabolic process(GO:0030309) poly-N-acetyllactosamine biosynthetic process(GO:0030311) |
0.2 | 1.0 | GO:0045607 | regulation of auditory receptor cell differentiation(GO:0045607) regulation of mechanoreceptor differentiation(GO:0045631) regulation of inner ear receptor cell differentiation(GO:2000980) |
0.2 | 0.7 | GO:0060584 | regulation of prostaglandin-endoperoxide synthase activity(GO:0060584) positive regulation of prostaglandin-endoperoxide synthase activity(GO:0060585) |
0.2 | 0.7 | GO:1903525 | regulation of membrane tubulation(GO:1903525) |
0.2 | 1.0 | GO:0008228 | opsonization(GO:0008228) |
0.2 | 0.9 | GO:0051725 | protein de-ADP-ribosylation(GO:0051725) |
0.2 | 0.7 | GO:1904431 | positive regulation of t-circle formation(GO:1904431) |
0.2 | 0.2 | GO:0014734 | skeletal muscle hypertrophy(GO:0014734) |
0.2 | 1.2 | GO:0007171 | activation of transmembrane receptor protein tyrosine kinase activity(GO:0007171) |
0.2 | 1.6 | GO:0003376 | sphingosine-1-phosphate signaling pathway(GO:0003376) |
0.2 | 0.7 | GO:0070634 | transepithelial ammonium transport(GO:0070634) |
0.2 | 0.5 | GO:0033239 | negative regulation of cellular amine metabolic process(GO:0033239) |
0.2 | 0.2 | GO:0006549 | isoleucine metabolic process(GO:0006549) |
0.2 | 0.4 | GO:0009448 | gamma-aminobutyric acid metabolic process(GO:0009448) |
0.2 | 0.7 | GO:0002741 | positive regulation of cytokine secretion involved in immune response(GO:0002741) |
0.2 | 1.1 | GO:0033762 | response to glucagon(GO:0033762) |
0.2 | 0.4 | GO:0021553 | olfactory nerve development(GO:0021553) |
0.2 | 0.9 | GO:0051204 | protein insertion into mitochondrial membrane(GO:0051204) |
0.2 | 0.6 | GO:0098700 | aminergic neurotransmitter loading into synaptic vesicle(GO:0015842) neurotransmitter loading into synaptic vesicle(GO:0098700) |
0.2 | 0.4 | GO:0051582 | positive regulation of neurotransmitter uptake(GO:0051582) positive regulation of dopamine uptake involved in synaptic transmission(GO:0051586) positive regulation of catecholamine uptake involved in synaptic transmission(GO:0051944) |
0.2 | 0.4 | GO:0035262 | gonad morphogenesis(GO:0035262) |
0.2 | 0.6 | GO:0097503 | sialylation(GO:0097503) |
0.2 | 0.2 | GO:0086064 | cell communication by electrical coupling involved in cardiac conduction(GO:0086064) |
0.2 | 0.6 | GO:0033693 | neurofilament bundle assembly(GO:0033693) |
0.2 | 1.2 | GO:0031119 | tRNA pseudouridine synthesis(GO:0031119) |
0.2 | 0.4 | GO:0070672 | response to interleukin-15(GO:0070672) |
0.2 | 3.3 | GO:0050966 | detection of mechanical stimulus involved in sensory perception of pain(GO:0050966) |
0.2 | 0.2 | GO:0045163 | clustering of voltage-gated potassium channels(GO:0045163) |
0.2 | 1.0 | GO:0043987 | histone H3-S10 phosphorylation(GO:0043987) |
0.2 | 0.4 | GO:0071918 | urea transmembrane transport(GO:0071918) |
0.2 | 1.8 | GO:0032000 | positive regulation of fatty acid beta-oxidation(GO:0032000) |
0.2 | 0.6 | GO:0048069 | eye pigmentation(GO:0048069) |
0.2 | 0.6 | GO:1900748 | positive regulation of vascular endothelial growth factor signaling pathway(GO:1900748) |
0.2 | 0.4 | GO:0060468 | prevention of polyspermy(GO:0060468) |
0.2 | 1.4 | GO:0010649 | regulation of cell communication by electrical coupling(GO:0010649) |
0.2 | 0.6 | GO:0070889 | platelet alpha granule organization(GO:0070889) |
0.2 | 1.0 | GO:0032324 | Mo-molybdopterin cofactor biosynthetic process(GO:0006777) Mo-molybdopterin cofactor metabolic process(GO:0019720) molybdopterin cofactor biosynthetic process(GO:0032324) molybdopterin cofactor metabolic process(GO:0043545) prosthetic group metabolic process(GO:0051189) |
0.2 | 1.2 | GO:0006703 | estrogen biosynthetic process(GO:0006703) |
0.2 | 0.6 | GO:0002727 | natural killer cell cytokine production(GO:0002370) regulation of natural killer cell cytokine production(GO:0002727) |
0.2 | 0.2 | GO:0097466 | glycoprotein ERAD pathway(GO:0097466) response to glycoprotein(GO:1904587) |
0.2 | 1.6 | GO:0071420 | cellular response to histamine(GO:0071420) |
0.2 | 1.5 | GO:0006983 | ER overload response(GO:0006983) |
0.2 | 0.4 | GO:0003340 | negative regulation of mesenchymal to epithelial transition involved in metanephros morphogenesis(GO:0003340) |
0.2 | 0.8 | GO:0072386 | plus-end-directed vesicle transport along microtubule(GO:0072383) plus-end-directed organelle transport along microtubule(GO:0072386) |
0.2 | 0.4 | GO:0015722 | canalicular bile acid transport(GO:0015722) |
0.2 | 0.6 | GO:1903977 | positive regulation of glial cell migration(GO:1903977) |
0.2 | 1.1 | GO:0045161 | neuronal ion channel clustering(GO:0045161) |
0.2 | 0.4 | GO:0097680 | double-strand break repair via classical nonhomologous end joining(GO:0097680) |
0.2 | 0.6 | GO:1903061 | positive regulation of protein lipidation(GO:1903061) |
0.2 | 0.7 | GO:0097119 | postsynaptic density protein 95 clustering(GO:0097119) |
0.2 | 1.3 | GO:0071257 | cellular response to electrical stimulus(GO:0071257) |
0.2 | 0.2 | GO:0003358 | noradrenergic neuron development(GO:0003358) |
0.2 | 0.7 | GO:0035701 | hematopoietic stem cell migration(GO:0035701) |
0.2 | 1.2 | GO:0021796 | cerebral cortex regionalization(GO:0021796) |
0.2 | 0.5 | GO:0070126 | mitochondrial translational termination(GO:0070126) |
0.2 | 0.7 | GO:0007638 | mechanosensory behavior(GO:0007638) |
0.2 | 0.5 | GO:0034473 | U1 snRNA 3'-end processing(GO:0034473) U5 snRNA 3'-end processing(GO:0034476) |
0.2 | 0.2 | GO:0045472 | response to ether(GO:0045472) |
0.2 | 0.3 | GO:0043497 | regulation of protein heterodimerization activity(GO:0043497) |
0.2 | 0.5 | GO:0015888 | thiamine transport(GO:0015888) |
0.2 | 4.2 | GO:0051491 | positive regulation of filopodium assembly(GO:0051491) |
0.2 | 0.7 | GO:0070574 | cadmium ion transport(GO:0015691) cadmium ion transmembrane transport(GO:0070574) |
0.2 | 0.9 | GO:0090394 | negative regulation of excitatory postsynaptic potential(GO:0090394) |
0.2 | 0.2 | GO:0021861 | forebrain radial glial cell differentiation(GO:0021861) |
0.2 | 1.4 | GO:0033601 | positive regulation of mammary gland epithelial cell proliferation(GO:0033601) |
0.2 | 0.7 | GO:0006551 | leucine metabolic process(GO:0006551) |
0.2 | 1.2 | GO:0006729 | tetrahydrobiopterin biosynthetic process(GO:0006729) |
0.2 | 0.5 | GO:0038095 | Fc-epsilon receptor signaling pathway(GO:0038095) |
0.2 | 0.8 | GO:2000271 | positive regulation of fibroblast apoptotic process(GO:2000271) |
0.2 | 2.5 | GO:0070977 | bone maturation(GO:0070977) |
0.2 | 0.5 | GO:1904526 | regulation of microtubule binding(GO:1904526) positive regulation of microtubule binding(GO:1904528) |
0.2 | 0.8 | GO:0021860 | pyramidal neuron development(GO:0021860) |
0.2 | 2.7 | GO:0045948 | positive regulation of translational initiation(GO:0045948) |
0.2 | 0.3 | GO:0003150 | muscular septum morphogenesis(GO:0003150) |
0.2 | 0.7 | GO:0032417 | positive regulation of sodium:proton antiporter activity(GO:0032417) |
0.2 | 0.8 | GO:0046501 | protoporphyrinogen IX metabolic process(GO:0046501) |
0.2 | 1.0 | GO:0006930 | substrate-dependent cell migration, cell extension(GO:0006930) |
0.2 | 0.5 | GO:1903237 | negative regulation of leukocyte tethering or rolling(GO:1903237) |
0.2 | 2.1 | GO:0009048 | dosage compensation(GO:0007549) dosage compensation by inactivation of X chromosome(GO:0009048) |
0.2 | 0.5 | GO:0014878 | response to electrical stimulus involved in regulation of muscle adaptation(GO:0014878) |
0.2 | 1.4 | GO:0046855 | inositol phosphate dephosphorylation(GO:0046855) |
0.2 | 1.9 | GO:0007252 | I-kappaB phosphorylation(GO:0007252) |
0.2 | 0.3 | GO:0022615 | protein to membrane docking(GO:0022615) |
0.2 | 0.8 | GO:0070120 | ciliary neurotrophic factor-mediated signaling pathway(GO:0070120) |
0.2 | 0.6 | GO:0090168 | Golgi reassembly(GO:0090168) |
0.2 | 0.8 | GO:0051315 | attachment of mitotic spindle microtubules to kinetochore(GO:0051315) |
0.2 | 0.3 | GO:0050705 | regulation of interleukin-1 alpha secretion(GO:0050705) |
0.2 | 0.5 | GO:1903336 | negative regulation of vacuolar transport(GO:1903336) |
0.2 | 0.6 | GO:1903333 | negative regulation of protein folding(GO:1903333) |
0.1 | 0.4 | GO:2000173 | negative regulation of branching morphogenesis of a nerve(GO:2000173) |
0.1 | 0.9 | GO:0021707 | cerebellar granular layer formation(GO:0021684) cerebellar granule cell differentiation(GO:0021707) |
0.1 | 0.4 | GO:0061156 | pulmonary artery morphogenesis(GO:0061156) |
0.1 | 0.4 | GO:0000087 | mitotic M phase(GO:0000087) |
0.1 | 1.5 | GO:0032525 | somite rostral/caudal axis specification(GO:0032525) |
0.1 | 0.4 | GO:1900108 | negative regulation of nodal signaling pathway(GO:1900108) |
0.1 | 0.7 | GO:0042118 | endothelial cell activation(GO:0042118) |
0.1 | 1.2 | GO:0044387 | negative regulation of protein kinase activity by regulation of protein phosphorylation(GO:0044387) |
0.1 | 0.4 | GO:0032290 | peripheral nervous system myelin formation(GO:0032290) |
0.1 | 0.7 | GO:0014719 | skeletal muscle satellite cell activation(GO:0014719) |
0.1 | 0.3 | GO:0060385 | axonogenesis involved in innervation(GO:0060385) |
0.1 | 0.3 | GO:0051611 | negative regulation of neurotransmitter uptake(GO:0051581) regulation of serotonin uptake(GO:0051611) negative regulation of serotonin uptake(GO:0051612) |
0.1 | 0.1 | GO:0071504 | response to heparin(GO:0071503) cellular response to heparin(GO:0071504) |
0.1 | 2.0 | GO:0031958 | corticosteroid receptor signaling pathway(GO:0031958) |
0.1 | 0.6 | GO:0072051 | juxtaglomerular apparatus development(GO:0072051) |
0.1 | 0.3 | GO:2000286 | receptor internalization involved in canonical Wnt signaling pathway(GO:2000286) |
0.1 | 0.4 | GO:0003219 | cardiac right ventricle formation(GO:0003219) |
0.1 | 0.4 | GO:0072318 | clathrin coat disassembly(GO:0072318) |
0.1 | 0.7 | GO:2000010 | positive regulation of protein localization to cell surface(GO:2000010) |
0.1 | 0.1 | GO:0045869 | negative regulation of single stranded viral RNA replication via double stranded DNA intermediate(GO:0045869) |
0.1 | 0.3 | GO:1902956 | regulation of mitochondrial electron transport, NADH to ubiquinone(GO:1902956) |
0.1 | 0.3 | GO:0060686 | negative regulation of prostatic bud formation(GO:0060686) |
0.1 | 0.4 | GO:0060024 | rhythmic synaptic transmission(GO:0060024) |
0.1 | 0.7 | GO:0048669 | collateral sprouting in absence of injury(GO:0048669) |
0.1 | 1.1 | GO:0045188 | circadian sleep/wake cycle, non-REM sleep(GO:0042748) regulation of circadian sleep/wake cycle, non-REM sleep(GO:0045188) |
0.1 | 0.5 | GO:0019482 | beta-alanine metabolic process(GO:0019482) |
0.1 | 0.1 | GO:1903715 | regulation of aerobic respiration(GO:1903715) |
0.1 | 1.4 | GO:0048814 | regulation of dendrite morphogenesis(GO:0048814) |
0.1 | 0.9 | GO:0050957 | equilibrioception(GO:0050957) |
0.1 | 0.1 | GO:0050923 | regulation of negative chemotaxis(GO:0050923) |
0.1 | 0.5 | GO:0061113 | pancreas morphogenesis(GO:0061113) |
0.1 | 0.4 | GO:0015959 | diadenosine polyphosphate metabolic process(GO:0015959) |
0.1 | 0.5 | GO:0090240 | positive regulation of histone H4 acetylation(GO:0090240) |
0.1 | 0.7 | GO:0010032 | meiotic chromosome condensation(GO:0010032) |
0.1 | 0.3 | GO:1903599 | positive regulation of mitophagy(GO:1903599) |
0.1 | 0.7 | GO:0061087 | positive regulation of histone H3-K27 methylation(GO:0061087) |
0.1 | 0.4 | GO:0060750 | epithelial cell proliferation involved in mammary gland duct elongation(GO:0060750) |
0.1 | 0.8 | GO:1901299 | negative regulation of hydrogen peroxide-mediated programmed cell death(GO:1901299) |
0.1 | 0.5 | GO:0071139 | resolution of recombination intermediates(GO:0071139) |
0.1 | 0.1 | GO:0036006 | response to macrophage colony-stimulating factor(GO:0036005) cellular response to macrophage colony-stimulating factor stimulus(GO:0036006) |
0.1 | 0.4 | GO:0034627 | nicotinamide nucleotide biosynthetic process from aspartate(GO:0019355) 'de novo' NAD biosynthetic process(GO:0034627) 'de novo' NAD biosynthetic process from aspartate(GO:0034628) |
0.1 | 1.7 | GO:1904355 | positive regulation of telomere capping(GO:1904355) |
0.1 | 0.5 | GO:0060839 | endothelial cell fate commitment(GO:0060839) |
0.1 | 0.5 | GO:0033326 | cerebrospinal fluid secretion(GO:0033326) |
0.1 | 0.4 | GO:0045897 | regulation of transcription during mitosis(GO:0045896) positive regulation of transcription during mitosis(GO:0045897) |
0.1 | 0.4 | GO:0042713 | sperm ejaculation(GO:0042713) |
0.1 | 0.1 | GO:0060763 | mammary duct terminal end bud growth(GO:0060763) |
0.1 | 0.9 | GO:0090073 | positive regulation of protein homodimerization activity(GO:0090073) |
0.1 | 0.5 | GO:1901836 | regulation of transcription of nuclear large rRNA transcript from RNA polymerase I promoter(GO:1901836) |
0.1 | 0.4 | GO:0090129 | positive regulation of synapse maturation(GO:0090129) |
0.1 | 2.3 | GO:0008053 | mitochondrial fusion(GO:0008053) |
0.1 | 0.3 | GO:0051661 | maintenance of centrosome location(GO:0051661) |
0.1 | 1.9 | GO:0045475 | locomotor rhythm(GO:0045475) |
0.1 | 0.3 | GO:0090520 | sphingolipid mediated signaling pathway(GO:0090520) |
0.1 | 0.8 | GO:0016198 | axon choice point recognition(GO:0016198) |
0.1 | 0.4 | GO:1903802 | L-glutamate(1-) import into cell(GO:1903802) L-glutamate import into cell(GO:1990123) |
0.1 | 2.8 | GO:0042417 | dopamine metabolic process(GO:0042417) |
0.1 | 0.1 | GO:0002036 | regulation of L-glutamate transport(GO:0002036) |
0.1 | 3.4 | GO:0007032 | endosome organization(GO:0007032) |
0.1 | 2.4 | GO:0048488 | synaptic vesicle endocytosis(GO:0048488) |
0.1 | 0.2 | GO:0060837 | blood vessel endothelial cell differentiation(GO:0060837) |
0.1 | 0.2 | GO:0098904 | regulation of AV node cell action potential(GO:0098904) |
0.1 | 0.5 | GO:0045002 | double-strand break repair via single-strand annealing(GO:0045002) |
0.1 | 1.0 | GO:0030643 | cellular phosphate ion homeostasis(GO:0030643) cellular trivalent inorganic anion homeostasis(GO:0072502) |
0.1 | 0.5 | GO:0022028 | tangential migration from the subventricular zone to the olfactory bulb(GO:0022028) |
0.1 | 0.6 | GO:0036289 | peptidyl-serine autophosphorylation(GO:0036289) |
0.1 | 0.6 | GO:0035331 | negative regulation of hippo signaling(GO:0035331) |
0.1 | 0.6 | GO:0035542 | regulation of SNARE complex assembly(GO:0035542) |
0.1 | 2.1 | GO:0043574 | protein targeting to peroxisome(GO:0006625) peroxisomal transport(GO:0043574) protein localization to peroxisome(GO:0072662) establishment of protein localization to peroxisome(GO:0072663) |
0.1 | 1.0 | GO:0032367 | intracellular cholesterol transport(GO:0032367) |
0.1 | 1.2 | GO:0007213 | G-protein coupled acetylcholine receptor signaling pathway(GO:0007213) |
0.1 | 1.9 | GO:0097352 | autophagosome maturation(GO:0097352) |
0.1 | 6.4 | GO:0051965 | positive regulation of synapse assembly(GO:0051965) |
0.1 | 1.8 | GO:0010758 | regulation of macrophage chemotaxis(GO:0010758) |
0.1 | 0.1 | GO:0070072 | proton-transporting V-type ATPase complex assembly(GO:0070070) vacuolar proton-transporting V-type ATPase complex assembly(GO:0070072) |
0.1 | 1.3 | GO:0021535 | cell migration in hindbrain(GO:0021535) |
0.1 | 1.0 | GO:0090141 | positive regulation of mitochondrial fission(GO:0090141) |
0.1 | 0.1 | GO:0007223 | Wnt signaling pathway, calcium modulating pathway(GO:0007223) |
0.1 | 0.3 | GO:0042138 | meiotic DNA double-strand break formation(GO:0042138) |
0.1 | 0.3 | GO:0048478 | replication fork protection(GO:0048478) |
0.1 | 0.1 | GO:0090245 | axis elongation involved in somitogenesis(GO:0090245) |
0.1 | 0.6 | GO:0032596 | protein transport into membrane raft(GO:0032596) |
0.1 | 3.7 | GO:0042462 | eye photoreceptor cell development(GO:0042462) |
0.1 | 1.0 | GO:0032988 | ribonucleoprotein complex disassembly(GO:0032988) |
0.1 | 0.2 | GO:1904058 | positive regulation of sensory perception of pain(GO:1904058) |
0.1 | 0.4 | GO:0021798 | forebrain dorsal/ventral pattern formation(GO:0021798) |
0.1 | 0.2 | GO:1902083 | negative regulation of peptidyl-cysteine S-nitrosylation(GO:1902083) |
0.1 | 0.3 | GO:0033566 | gamma-tubulin complex localization(GO:0033566) |
0.1 | 0.1 | GO:1904016 | response to Thyroglobulin triiodothyronine(GO:1904016) cellular response to Thyroglobulin triiodothyronine(GO:1904017) |
0.1 | 0.3 | GO:0031999 | negative regulation of fatty acid beta-oxidation(GO:0031999) |
0.1 | 0.3 | GO:0006269 | DNA replication, synthesis of RNA primer(GO:0006269) |
0.1 | 1.0 | GO:0036158 | outer dynein arm assembly(GO:0036158) |
0.1 | 0.5 | GO:0009052 | pentose-phosphate shunt, non-oxidative branch(GO:0009052) |
0.1 | 1.0 | GO:0097120 | receptor localization to synapse(GO:0097120) |
0.1 | 0.8 | GO:0061000 | negative regulation of dendritic spine development(GO:0061000) |
0.1 | 4.4 | GO:2000134 | negative regulation of G1/S transition of mitotic cell cycle(GO:2000134) |
0.1 | 0.3 | GO:1904380 | endoplasmic reticulum mannose trimming(GO:1904380) |
0.1 | 0.5 | GO:0010756 | positive regulation of plasminogen activation(GO:0010756) |
0.1 | 0.2 | GO:0033353 | S-adenosylmethionine cycle(GO:0033353) |
0.1 | 1.5 | GO:0032011 | ARF protein signal transduction(GO:0032011) regulation of ARF protein signal transduction(GO:0032012) |
0.1 | 1.4 | GO:0010842 | retina layer formation(GO:0010842) |
0.1 | 0.6 | GO:0086018 | SA node cell action potential(GO:0086015) SA node cell to atrial cardiac muscle cell signalling(GO:0086018) SA node cell to atrial cardiac muscle cell communication(GO:0086070) |
0.1 | 1.8 | GO:0006884 | cell volume homeostasis(GO:0006884) |
0.1 | 1.4 | GO:0006828 | manganese ion transport(GO:0006828) |
0.1 | 0.2 | GO:0060998 | regulation of dendritic spine development(GO:0060998) |
0.1 | 0.4 | GO:0018211 | protein C-linked glycosylation(GO:0018103) peptidyl-tryptophan modification(GO:0018211) protein C-linked glycosylation via tryptophan(GO:0018317) protein C-linked glycosylation via 2'-alpha-mannosyl-L-tryptophan(GO:0018406) |
0.1 | 0.4 | GO:2000615 | regulation of histone H3-K9 acetylation(GO:2000615) |
0.1 | 0.6 | GO:0033314 | mitotic DNA replication checkpoint(GO:0033314) |
0.1 | 0.6 | GO:0006104 | succinyl-CoA metabolic process(GO:0006104) |
0.1 | 1.8 | GO:0046854 | phosphatidylinositol phosphorylation(GO:0046854) |
0.1 | 0.3 | GO:0018242 | protein O-linked glycosylation via serine(GO:0018242) |
0.1 | 0.9 | GO:0033147 | negative regulation of intracellular estrogen receptor signaling pathway(GO:0033147) |
0.1 | 1.9 | GO:0006491 | N-glycan processing(GO:0006491) |
0.1 | 0.1 | GO:0044783 | G1 DNA damage checkpoint(GO:0044783) |
0.1 | 0.3 | GO:0046543 | development of secondary female sexual characteristics(GO:0046543) |
0.1 | 0.8 | GO:0071786 | endoplasmic reticulum tubular network organization(GO:0071786) |
0.1 | 1.3 | GO:0016242 | negative regulation of macroautophagy(GO:0016242) |
0.1 | 0.3 | GO:0030242 | pexophagy(GO:0030242) |
0.1 | 0.2 | GO:0042427 | serotonin biosynthetic process(GO:0042427) primary amino compound biosynthetic process(GO:1901162) |
0.1 | 0.3 | GO:0032264 | IMP salvage(GO:0032264) |
0.1 | 0.5 | GO:0048681 | negative regulation of axon regeneration(GO:0048681) |
0.1 | 0.3 | GO:0060112 | generation of ovulation cycle rhythm(GO:0060112) |
0.1 | 0.5 | GO:0045541 | negative regulation of cholesterol biosynthetic process(GO:0045541) negative regulation of cholesterol metabolic process(GO:0090206) |
0.1 | 0.1 | GO:0001555 | oocyte growth(GO:0001555) |
0.1 | 0.5 | GO:0090273 | regulation of somatostatin secretion(GO:0090273) |
0.1 | 0.5 | GO:0070842 | aggresome assembly(GO:0070842) |
0.1 | 0.3 | GO:0016576 | histone dephosphorylation(GO:0016576) |
0.1 | 0.4 | GO:1902410 | mitotic cytokinetic process(GO:1902410) |
0.1 | 0.8 | GO:0060576 | intestinal epithelial cell development(GO:0060576) |
0.1 | 0.3 | GO:0045200 | establishment or maintenance of neuroblast polarity(GO:0045196) establishment of neuroblast polarity(GO:0045200) |
0.1 | 0.4 | GO:0097428 | protein maturation by iron-sulfur cluster transfer(GO:0097428) |
0.1 | 0.3 | GO:0006772 | thiamine metabolic process(GO:0006772) thiamine-containing compound metabolic process(GO:0042723) |
0.1 | 0.5 | GO:0006572 | tyrosine catabolic process(GO:0006572) |
0.1 | 0.4 | GO:0090336 | positive regulation of brown fat cell differentiation(GO:0090336) |
0.1 | 0.7 | GO:0035235 | ionotropic glutamate receptor signaling pathway(GO:0035235) |
0.1 | 0.3 | GO:0006001 | fructose catabolic process(GO:0006001) fructose catabolic process to hydroxyacetone phosphate and glyceraldehyde-3-phosphate(GO:0061624) glycolytic process through fructose-1-phosphate(GO:0061625) |
0.1 | 0.5 | GO:0009256 | 10-formyltetrahydrofolate metabolic process(GO:0009256) |
0.1 | 0.2 | GO:0002051 | osteoblast fate commitment(GO:0002051) |
0.1 | 0.6 | GO:0042989 | sequestering of actin monomers(GO:0042989) |
0.1 | 0.3 | GO:0072393 | microtubule anchoring at microtubule organizing center(GO:0072393) |
0.1 | 0.3 | GO:0002669 | positive regulation of T cell anergy(GO:0002669) positive regulation of lymphocyte anergy(GO:0002913) |
0.1 | 0.6 | GO:0042905 | 9-cis-retinoic acid biosynthetic process(GO:0042904) 9-cis-retinoic acid metabolic process(GO:0042905) |
0.1 | 0.2 | GO:0071481 | cellular response to X-ray(GO:0071481) |
0.1 | 0.4 | GO:0006528 | asparagine metabolic process(GO:0006528) |
0.1 | 0.7 | GO:0035562 | negative regulation of chromatin binding(GO:0035562) |
0.1 | 0.3 | GO:0001732 | formation of cytoplasmic translation initiation complex(GO:0001732) |
0.1 | 0.5 | GO:0018344 | protein geranylgeranylation(GO:0018344) |
0.1 | 0.2 | GO:0033091 | positive regulation of immature T cell proliferation(GO:0033091) |
0.1 | 0.2 | GO:0018125 | peptidyl-cysteine methylation(GO:0018125) |
0.1 | 0.2 | GO:0006600 | creatine metabolic process(GO:0006600) |
0.1 | 3.1 | GO:0006493 | protein O-linked glycosylation(GO:0006493) |
0.1 | 0.3 | GO:0090666 | scaRNA localization to Cajal body(GO:0090666) |
0.1 | 0.7 | GO:0042219 | cellular modified amino acid catabolic process(GO:0042219) |
0.1 | 0.4 | GO:0045988 | negative regulation of striated muscle contraction(GO:0045988) |
0.1 | 0.1 | GO:0006558 | L-phenylalanine metabolic process(GO:0006558) erythrose 4-phosphate/phosphoenolpyruvate family amino acid metabolic process(GO:1902221) |
0.1 | 0.2 | GO:0046959 | habituation(GO:0046959) |
0.1 | 0.2 | GO:0060729 | intestinal epithelial structure maintenance(GO:0060729) |
0.1 | 0.3 | GO:0045053 | protein retention in Golgi apparatus(GO:0045053) |
0.1 | 1.3 | GO:0043046 | DNA methylation involved in gamete generation(GO:0043046) |
0.1 | 0.7 | GO:0042711 | maternal behavior(GO:0042711) |
0.1 | 0.2 | GO:0010956 | negative regulation of calcidiol 1-monooxygenase activity(GO:0010956) |
0.1 | 0.2 | GO:0018171 | peptidyl-cysteine oxidation(GO:0018171) |
0.1 | 0.3 | GO:0006553 | lysine metabolic process(GO:0006553) |
0.1 | 1.0 | GO:0042761 | very long-chain fatty acid biosynthetic process(GO:0042761) |
0.1 | 0.5 | GO:1901409 | regulation of phosphorylation of RNA polymerase II C-terminal domain(GO:1901407) positive regulation of phosphorylation of RNA polymerase II C-terminal domain(GO:1901409) |
0.1 | 0.2 | GO:1902255 | positive regulation of intrinsic apoptotic signaling pathway by p53 class mediator(GO:1902255) |
0.1 | 0.3 | GO:0007042 | lysosomal lumen acidification(GO:0007042) |
0.1 | 0.2 | GO:0010040 | response to iron(II) ion(GO:0010040) |
0.1 | 0.3 | GO:0035426 | extracellular matrix-cell signaling(GO:0035426) |
0.1 | 0.2 | GO:0043321 | regulation of natural killer cell degranulation(GO:0043321) |
0.1 | 0.2 | GO:0002074 | extraocular skeletal muscle development(GO:0002074) |
0.1 | 0.3 | GO:0006432 | phenylalanyl-tRNA aminoacylation(GO:0006432) |
0.1 | 1.4 | GO:0046839 | phospholipid dephosphorylation(GO:0046839) |
0.1 | 0.8 | GO:0046851 | negative regulation of bone remodeling(GO:0046851) |
0.1 | 0.3 | GO:0044351 | macropinocytosis(GO:0044351) |
0.1 | 0.5 | GO:0051694 | pointed-end actin filament capping(GO:0051694) |
0.1 | 0.2 | GO:0001692 | histamine metabolic process(GO:0001692) |
0.1 | 0.4 | GO:0009186 | deoxyribonucleoside diphosphate metabolic process(GO:0009186) |
0.1 | 0.1 | GO:0045354 | interferon-alpha biosynthetic process(GO:0045349) regulation of interferon-alpha biosynthetic process(GO:0045354) |
0.1 | 0.1 | GO:0009138 | pyrimidine nucleoside diphosphate metabolic process(GO:0009138) |
0.1 | 0.8 | GO:0001553 | luteinization(GO:0001553) |
0.1 | 0.1 | GO:1900104 | hyaluranon cable assembly(GO:0036118) regulation of hyaluranon cable assembly(GO:1900104) positive regulation of hyaluranon cable assembly(GO:1900106) |
0.1 | 0.5 | GO:1900246 | positive regulation of RIG-I signaling pathway(GO:1900246) |
0.1 | 0.2 | GO:1903054 | negative regulation of extracellular matrix organization(GO:1903054) |
0.1 | 0.1 | GO:2001032 | regulation of double-strand break repair via nonhomologous end joining(GO:2001032) |
0.1 | 0.2 | GO:2000259 | positive regulation of complement activation(GO:0045917) positive regulation of protein activation cascade(GO:2000259) |
0.1 | 0.2 | GO:0032847 | regulation of cellular pH reduction(GO:0032847) positive regulation of cellular pH reduction(GO:0032849) |
0.1 | 1.2 | GO:0071475 | cellular hyperosmotic salinity response(GO:0071475) |
0.1 | 0.2 | GO:0010572 | positive regulation of platelet activation(GO:0010572) |
0.1 | 0.2 | GO:0001547 | antral ovarian follicle growth(GO:0001547) |
0.1 | 0.1 | GO:0032661 | regulation of interleukin-18 production(GO:0032661) |
0.1 | 2.4 | GO:0060113 | inner ear receptor cell differentiation(GO:0060113) |
0.1 | 0.1 | GO:0002121 | inter-male aggressive behavior(GO:0002121) |
0.1 | 0.1 | GO:0042435 | indole-containing compound biosynthetic process(GO:0042435) |
0.1 | 0.1 | GO:0044341 | sodium-dependent phosphate transport(GO:0044341) regulation of sodium-dependent phosphate transport(GO:2000118) |
0.1 | 0.4 | GO:0017196 | N-terminal peptidyl-methionine acetylation(GO:0017196) |
0.1 | 0.4 | GO:0042136 | neurotransmitter biosynthetic process(GO:0042136) |
0.1 | 0.2 | GO:0001777 | T cell homeostatic proliferation(GO:0001777) regulation of T cell homeostatic proliferation(GO:0046013) |
0.1 | 0.2 | GO:0021819 | layer formation in cerebral cortex(GO:0021819) |
0.1 | 0.3 | GO:1901538 | DNA methylation involved in embryo development(GO:0043045) changes to DNA methylation involved in embryo development(GO:1901538) |
0.1 | 0.1 | GO:0033088 | negative regulation of immature T cell proliferation in thymus(GO:0033088) |
0.1 | 0.2 | GO:1901386 | negative regulation of voltage-gated calcium channel activity(GO:1901386) |
0.1 | 0.4 | GO:0043922 | negative regulation by host of viral transcription(GO:0043922) |
0.1 | 0.3 | GO:0006627 | protein processing involved in protein targeting to mitochondrion(GO:0006627) |
0.1 | 0.7 | GO:0097094 | craniofacial suture morphogenesis(GO:0097094) |
0.1 | 0.4 | GO:0008343 | adult feeding behavior(GO:0008343) |
0.1 | 0.3 | GO:0021952 | central nervous system projection neuron axonogenesis(GO:0021952) |
0.1 | 0.1 | GO:0071873 | response to norepinephrine(GO:0071873) |
0.1 | 0.5 | GO:0060573 | ventral spinal cord interneuron specification(GO:0021521) cell fate specification involved in pattern specification(GO:0060573) |
0.1 | 0.3 | GO:0006659 | phosphatidylserine biosynthetic process(GO:0006659) |
0.1 | 1.4 | GO:0046329 | negative regulation of JNK cascade(GO:0046329) |
0.1 | 0.1 | GO:2001023 | regulation of response to drug(GO:2001023) |
0.1 | 0.4 | GO:0001787 | natural killer cell proliferation(GO:0001787) |
0.1 | 0.1 | GO:0042726 | flavin-containing compound metabolic process(GO:0042726) |
0.1 | 0.1 | GO:0045359 | positive regulation of interferon-beta biosynthetic process(GO:0045359) |
0.1 | 1.3 | GO:0042481 | regulation of odontogenesis(GO:0042481) |
0.1 | 1.1 | GO:0033522 | histone H2A ubiquitination(GO:0033522) |
0.1 | 0.6 | GO:0010165 | response to X-ray(GO:0010165) |
0.1 | 0.1 | GO:0060748 | tertiary branching involved in mammary gland duct morphogenesis(GO:0060748) |
0.1 | 0.1 | GO:0003180 | aortic valve development(GO:0003176) aortic valve morphogenesis(GO:0003180) |
0.1 | 0.1 | GO:0039530 | MDA-5 signaling pathway(GO:0039530) |
0.1 | 0.1 | GO:0071472 | cellular response to salt stress(GO:0071472) |
0.1 | 0.2 | GO:0006741 | NADP biosynthetic process(GO:0006741) |
0.1 | 0.3 | GO:0051697 | protein delipidation(GO:0051697) |
0.1 | 0.4 | GO:0010359 | regulation of anion channel activity(GO:0010359) |
0.1 | 0.1 | GO:0006449 | regulation of translational termination(GO:0006449) |
0.1 | 0.1 | GO:0015014 | heparan sulfate proteoglycan biosynthetic process, polysaccharide chain biosynthetic process(GO:0015014) |
0.1 | 0.3 | GO:0048675 | axon extension(GO:0048675) |
0.1 | 0.2 | GO:0007406 | negative regulation of neuroblast proliferation(GO:0007406) |
0.1 | 0.3 | GO:0050965 | detection of temperature stimulus involved in sensory perception(GO:0050961) detection of temperature stimulus involved in sensory perception of pain(GO:0050965) |
0.1 | 0.2 | GO:0072198 | mesenchymal cell proliferation involved in ureter development(GO:0072198) regulation of mesenchymal cell proliferation involved in ureter development(GO:0072199) positive regulation of mesenchymal cell proliferation involved in ureter development(GO:2000729) |
0.1 | 0.2 | GO:1901874 | regulation of post-translational protein modification(GO:1901873) negative regulation of post-translational protein modification(GO:1901874) |
0.1 | 1.3 | GO:0070536 | protein K63-linked deubiquitination(GO:0070536) |
0.1 | 0.5 | GO:0010388 | protein deneddylation(GO:0000338) cullin deneddylation(GO:0010388) |
0.1 | 0.1 | GO:1904398 | positive regulation of neuromuscular junction development(GO:1904398) |
0.1 | 0.1 | GO:1900736 | regulation of phospholipase C-activating G-protein coupled receptor signaling pathway(GO:1900736) positive regulation of phospholipase C-activating G-protein coupled receptor signaling pathway(GO:1900738) |
0.1 | 0.1 | GO:0019230 | proprioception(GO:0019230) |
0.1 | 1.1 | GO:0008045 | motor neuron axon guidance(GO:0008045) |
0.1 | 1.3 | GO:0045879 | negative regulation of smoothened signaling pathway(GO:0045879) |
0.1 | 0.1 | GO:0042699 | follicle-stimulating hormone signaling pathway(GO:0042699) |
0.1 | 0.2 | GO:0019086 | late viral transcription(GO:0019086) |
0.1 | 0.1 | GO:0036091 | positive regulation of transcription from RNA polymerase II promoter in response to oxidative stress(GO:0036091) |
0.1 | 0.1 | GO:0032831 | regulation of CD4-positive, CD25-positive, alpha-beta regulatory T cell differentiation(GO:0032829) positive regulation of CD4-positive, CD25-positive, alpha-beta regulatory T cell differentiation(GO:0032831) |
0.1 | 0.2 | GO:0002215 | defense response to nematode(GO:0002215) |
0.1 | 0.1 | GO:0035887 | aortic smooth muscle cell differentiation(GO:0035887) |
0.1 | 0.2 | GO:0015860 | purine nucleoside transmembrane transport(GO:0015860) purine-containing compound transmembrane transport(GO:0072530) nucleoside transmembrane transport(GO:1901642) |
0.1 | 0.9 | GO:0035335 | peptidyl-tyrosine dephosphorylation(GO:0035335) |
0.1 | 0.6 | GO:0046036 | CTP biosynthetic process(GO:0006241) CTP metabolic process(GO:0046036) |
0.1 | 0.1 | GO:1901492 | positive regulation of lymphangiogenesis(GO:1901492) |
0.1 | 0.1 | GO:0061072 | iris morphogenesis(GO:0061072) |
0.1 | 0.3 | GO:0006415 | translational termination(GO:0006415) |
0.1 | 1.2 | GO:0048843 | negative regulation of axon extension involved in axon guidance(GO:0048843) |
0.1 | 0.7 | GO:0031297 | replication fork processing(GO:0031297) |
0.1 | 2.5 | GO:0070098 | chemokine-mediated signaling pathway(GO:0070098) |
0.1 | 0.1 | GO:0097212 | lysosomal membrane organization(GO:0097212) |
0.1 | 0.1 | GO:0002337 | B-1a B cell differentiation(GO:0002337) |
0.1 | 0.1 | GO:0046881 | positive regulation of gonadotropin secretion(GO:0032278) positive regulation of follicle-stimulating hormone secretion(GO:0046881) |
0.1 | 0.4 | GO:0048672 | positive regulation of collateral sprouting(GO:0048672) |
0.1 | 0.2 | GO:0008038 | neuron recognition(GO:0008038) |
0.1 | 3.5 | GO:0050770 | regulation of axonogenesis(GO:0050770) |
0.1 | 0.1 | GO:0009051 | pentose-phosphate shunt, oxidative branch(GO:0009051) |
0.1 | 0.1 | GO:0008090 | retrograde axonal transport(GO:0008090) |
0.1 | 0.3 | GO:0000459 | exonucleolytic trimming involved in rRNA processing(GO:0000459) exonucleolytic trimming to generate mature 3'-end of 5.8S rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000467) |
0.1 | 0.1 | GO:0061355 | Wnt protein secretion(GO:0061355) regulation of Wnt protein secretion(GO:0061356) |
0.1 | 0.1 | GO:0051970 | negative regulation of transmission of nerve impulse(GO:0051970) |
0.1 | 0.2 | GO:0015803 | branched-chain amino acid transport(GO:0015803) leucine transport(GO:0015820) |
0.1 | 0.4 | GO:0034650 | cortisol metabolic process(GO:0034650) |
0.1 | 0.1 | GO:0033603 | positive regulation of dopamine secretion(GO:0033603) |
0.1 | 0.4 | GO:0031115 | negative regulation of microtubule polymerization(GO:0031115) |
0.1 | 0.2 | GO:1904948 | midbrain dopaminergic neuron differentiation(GO:1904948) |
0.1 | 0.2 | GO:0060856 | establishment of blood-brain barrier(GO:0060856) |
0.1 | 0.2 | GO:2001206 | positive regulation of osteoclast development(GO:2001206) |
0.1 | 0.2 | GO:0045901 | positive regulation of translational elongation(GO:0045901) |
0.1 | 1.6 | GO:1902476 | chloride transmembrane transport(GO:1902476) |
0.1 | 0.2 | GO:0015744 | succinate transport(GO:0015744) |
0.1 | 0.1 | GO:0014042 | positive regulation of neuron maturation(GO:0014042) |
0.1 | 0.4 | GO:0007379 | segment specification(GO:0007379) |
0.1 | 0.1 | GO:0097527 | necroptotic signaling pathway(GO:0097527) |
0.1 | 4.6 | GO:0007411 | axon guidance(GO:0007411) |
0.1 | 0.2 | GO:0015015 | heparan sulfate proteoglycan biosynthetic process, enzymatic modification(GO:0015015) |
0.1 | 0.1 | GO:0010046 | response to mycotoxin(GO:0010046) |
0.1 | 0.2 | GO:0035522 | monoubiquitinated histone deubiquitination(GO:0035521) monoubiquitinated histone H2A deubiquitination(GO:0035522) |
0.1 | 0.1 | GO:0002322 | B cell proliferation involved in immune response(GO:0002322) |
0.1 | 0.1 | GO:0046668 | regulation of retinal cell programmed cell death(GO:0046668) |
0.1 | 0.2 | GO:0060012 | synaptic transmission, glycinergic(GO:0060012) |
0.1 | 0.2 | GO:2000051 | negative regulation of non-canonical Wnt signaling pathway(GO:2000051) |
0.1 | 0.5 | GO:1902043 | positive regulation of extrinsic apoptotic signaling pathway via death domain receptors(GO:1902043) |
0.1 | 0.1 | GO:0046864 | retinol transport(GO:0034633) isoprenoid transport(GO:0046864) terpenoid transport(GO:0046865) |
0.1 | 0.1 | GO:0036394 | amylase secretion(GO:0036394) |
0.1 | 0.1 | GO:0014722 | regulation of skeletal muscle contraction by calcium ion signaling(GO:0014722) |
0.1 | 0.1 | GO:0072679 | thymocyte migration(GO:0072679) regulation of thymocyte migration(GO:2000410) positive regulation of thymocyte migration(GO:2000412) |
0.1 | 0.1 | GO:0014835 | myoblast differentiation involved in skeletal muscle regeneration(GO:0014835) |
0.1 | 0.1 | GO:0014826 | vein smooth muscle contraction(GO:0014826) |
0.1 | 0.1 | GO:0001698 | gastrin-induced gastric acid secretion(GO:0001698) |
0.1 | 0.2 | GO:0007290 | spermatid nucleus elongation(GO:0007290) |
0.1 | 0.1 | GO:0086028 | bundle of His cell to Purkinje myocyte signaling(GO:0086028) bundle of His cell action potential(GO:0086043) |
0.1 | 0.3 | GO:0006995 | cellular response to nitrogen starvation(GO:0006995) cellular response to nitrogen levels(GO:0043562) |
0.1 | 0.1 | GO:0060282 | positive regulation of oocyte development(GO:0060282) |
0.1 | 0.1 | GO:0033602 | negative regulation of dopamine secretion(GO:0033602) |
0.1 | 0.3 | GO:2000018 | regulation of male gonad development(GO:2000018) |
0.1 | 0.1 | GO:0072718 | response to cisplatin(GO:0072718) |
0.1 | 0.1 | GO:0051938 | L-glutamate import(GO:0051938) |
0.1 | 0.3 | GO:0043496 | regulation of protein homodimerization activity(GO:0043496) |
0.1 | 0.1 | GO:0033084 | regulation of immature T cell proliferation in thymus(GO:0033084) |
0.1 | 0.1 | GO:1901252 | regulation of intracellular transport of viral material(GO:1901252) |
0.1 | 0.3 | GO:0071850 | mitotic cell cycle arrest(GO:0071850) |
0.1 | 0.2 | GO:0016103 | diterpenoid catabolic process(GO:0016103) retinoic acid catabolic process(GO:0034653) |
0.1 | 1.1 | GO:0019228 | neuronal action potential(GO:0019228) |
0.1 | 0.2 | GO:0018364 | peptidyl-glutamine methylation(GO:0018364) |
0.1 | 0.3 | GO:0070986 | left/right axis specification(GO:0070986) |
0.1 | 0.1 | GO:1903265 | positive regulation of tumor necrosis factor-mediated signaling pathway(GO:1903265) |
0.1 | 0.1 | GO:0042428 | serotonin metabolic process(GO:0042428) |
0.1 | 0.6 | GO:0048745 | smooth muscle tissue development(GO:0048745) |
0.0 | 0.6 | GO:0015985 | energy coupled proton transport, down electrochemical gradient(GO:0015985) ATP synthesis coupled proton transport(GO:0015986) |
0.0 | 1.2 | GO:0019835 | cytolysis(GO:0019835) |
0.0 | 1.1 | GO:0045071 | negative regulation of viral genome replication(GO:0045071) |
0.0 | 0.1 | GO:0060134 | prepulse inhibition(GO:0060134) |
0.0 | 0.1 | GO:2000402 | negative regulation of lymphocyte migration(GO:2000402) |
0.0 | 0.0 | GO:0010847 | regulation of chromatin assembly(GO:0010847) |
0.0 | 0.1 | GO:0014707 | branchiomeric skeletal muscle development(GO:0014707) |
0.0 | 0.1 | GO:2001280 | positive regulation of prostaglandin biosynthetic process(GO:0031394) positive regulation of unsaturated fatty acid biosynthetic process(GO:2001280) |
0.0 | 0.2 | GO:1900016 | negative regulation of cytokine production involved in inflammatory response(GO:1900016) |
0.0 | 0.0 | GO:0010746 | regulation of plasma membrane long-chain fatty acid transport(GO:0010746) |
0.0 | 0.0 | GO:0089700 | protein kinase D signaling(GO:0089700) |
0.0 | 0.0 | GO:0042421 | norepinephrine biosynthetic process(GO:0042421) |
0.0 | 0.2 | GO:0007221 | positive regulation of transcription of Notch receptor target(GO:0007221) |
0.0 | 0.3 | GO:2000484 | positive regulation of interleukin-8 secretion(GO:2000484) |
0.0 | 0.1 | GO:0051106 | regulation of DNA ligation(GO:0051105) positive regulation of DNA ligation(GO:0051106) |
0.0 | 0.0 | GO:1902514 | regulation of calcium ion transmembrane transport via high voltage-gated calcium channel(GO:1902514) |
0.0 | 0.3 | GO:2001241 | positive regulation of extrinsic apoptotic signaling pathway in absence of ligand(GO:2001241) |
0.0 | 0.1 | GO:0000820 | regulation of glutamine family amino acid metabolic process(GO:0000820) |
0.0 | 0.1 | GO:1901841 | regulation of high voltage-gated calcium channel activity(GO:1901841) |
0.0 | 0.4 | GO:1990118 | sodium ion import across plasma membrane(GO:0098719) sodium ion import into cell(GO:1990118) |
0.0 | 0.1 | GO:0060300 | regulation of cytokine activity(GO:0060300) |
0.0 | 0.2 | GO:0050774 | negative regulation of dendrite morphogenesis(GO:0050774) |
0.0 | 0.0 | GO:0070571 | negative regulation of neuron projection regeneration(GO:0070571) |
0.0 | 0.0 | GO:2001170 | negative regulation of ATP biosynthetic process(GO:2001170) |
0.0 | 0.2 | GO:0070125 | mitochondrial translational elongation(GO:0070125) |
0.0 | 0.0 | GO:0019388 | galactose catabolic process(GO:0019388) |
0.0 | 0.1 | GO:0032808 | lacrimal gland development(GO:0032808) |
0.0 | 0.6 | GO:0016486 | peptide hormone processing(GO:0016486) |
0.0 | 0.1 | GO:1902035 | positive regulation of hematopoietic stem cell proliferation(GO:1902035) |
0.0 | 0.1 | GO:0048208 | vesicle targeting, rough ER to cis-Golgi(GO:0048207) COPII vesicle coating(GO:0048208) |
0.0 | 0.2 | GO:0030948 | negative regulation of vascular endothelial growth factor receptor signaling pathway(GO:0030948) |
0.0 | 0.1 | GO:0006435 | threonyl-tRNA aminoacylation(GO:0006435) |
0.0 | 0.2 | GO:0031053 | primary miRNA processing(GO:0031053) |
0.0 | 0.4 | GO:1902751 | positive regulation of cell cycle G2/M phase transition(GO:1902751) |
0.0 | 0.2 | GO:0050884 | neuromuscular process controlling posture(GO:0050884) |
0.0 | 0.1 | GO:0071609 | chemokine (C-C motif) ligand 5 production(GO:0071609) |
0.0 | 0.2 | GO:0070544 | histone H3-K36 demethylation(GO:0070544) |
0.0 | 0.1 | GO:0060447 | bud outgrowth involved in lung branching(GO:0060447) |
0.0 | 0.1 | GO:0090289 | regulation of osteoclast proliferation(GO:0090289) positive regulation of osteoclast proliferation(GO:0090290) |
0.0 | 0.5 | GO:0042438 | melanin metabolic process(GO:0006582) melanin biosynthetic process(GO:0042438) |
0.0 | 0.1 | GO:0035928 | rRNA import into mitochondrion(GO:0035928) |
0.0 | 0.1 | GO:0048743 | positive regulation of skeletal muscle fiber development(GO:0048743) |
0.0 | 0.3 | GO:0051292 | nuclear pore complex assembly(GO:0051292) |
0.0 | 0.1 | GO:1904504 | lipophagy(GO:0061724) regulation of lipophagy(GO:1904502) positive regulation of lipophagy(GO:1904504) |
0.0 | 0.1 | GO:1902626 | assembly of large subunit precursor of preribosome(GO:1902626) |
0.0 | 0.0 | GO:0042231 | interleukin-13 biosynthetic process(GO:0042231) |
0.0 | 0.1 | GO:0036112 | medium-chain fatty-acyl-CoA metabolic process(GO:0036112) |
0.0 | 0.4 | GO:0001522 | pseudouridine synthesis(GO:0001522) |
0.0 | 0.1 | GO:0006419 | alanyl-tRNA aminoacylation(GO:0006419) |
0.0 | 0.1 | GO:1901475 | pyruvate transmembrane transport(GO:1901475) |
0.0 | 0.1 | GO:0015747 | urate transport(GO:0015747) |
0.0 | 0.0 | GO:1903279 | regulation of calcium:sodium antiporter activity(GO:1903279) |
0.0 | 0.1 | GO:0009233 | menaquinone metabolic process(GO:0009233) |
0.0 | 0.1 | GO:1904694 | negative regulation of vascular smooth muscle contraction(GO:1904694) |
0.0 | 0.7 | GO:0090662 | energy coupled proton transmembrane transport, against electrochemical gradient(GO:0015988) ATP hydrolysis coupled proton transport(GO:0015991) ATP hydrolysis coupled transmembrane transport(GO:0090662) |
0.0 | 0.2 | GO:0045647 | negative regulation of erythrocyte differentiation(GO:0045647) |
0.0 | 0.2 | GO:1903300 | negative regulation of glucokinase activity(GO:0033132) negative regulation of hexokinase activity(GO:1903300) |
0.0 | 0.2 | GO:0047484 | regulation of response to osmotic stress(GO:0047484) |
0.0 | 0.1 | GO:0060178 | regulation of exocyst localization(GO:0060178) |
0.0 | 0.3 | GO:1903206 | negative regulation of hydrogen peroxide-induced cell death(GO:1903206) |
0.0 | 0.2 | GO:0046512 | diol biosynthetic process(GO:0034312) sphingosine biosynthetic process(GO:0046512) |
0.0 | 0.0 | GO:0014049 | positive regulation of glutamate secretion(GO:0014049) |
0.0 | 0.3 | GO:0061615 | glycolytic process through fructose-6-phosphate(GO:0061615) |
0.0 | 0.0 | GO:0021698 | cerebellar cortex structural organization(GO:0021698) |
0.0 | 0.4 | GO:0051452 | intracellular pH reduction(GO:0051452) |
0.0 | 0.2 | GO:0021854 | hypothalamus development(GO:0021854) |
0.0 | 0.1 | GO:0045226 | extracellular polysaccharide biosynthetic process(GO:0045226) extracellular polysaccharide metabolic process(GO:0046379) |
0.0 | 0.3 | GO:0031167 | rRNA methylation(GO:0031167) |
0.0 | 0.3 | GO:0050860 | negative regulation of T cell receptor signaling pathway(GO:0050860) |
0.0 | 1.7 | GO:0000086 | G2/M transition of mitotic cell cycle(GO:0000086) |
0.0 | 0.1 | GO:0001306 | age-dependent response to oxidative stress(GO:0001306) age-dependent general metabolic decline(GO:0007571) |
0.0 | 0.2 | GO:1902916 | positive regulation of protein polyubiquitination(GO:1902916) |
0.0 | 0.0 | GO:0071415 | cellular response to caffeine(GO:0071313) cellular response to purine-containing compound(GO:0071415) |
0.0 | 0.1 | GO:0030920 | N-terminal peptidyl-serine acetylation(GO:0017198) N-terminal peptidyl-glutamic acid acetylation(GO:0018002) peptidyl-serine acetylation(GO:0030920) |
0.0 | 0.1 | GO:0016584 | nucleosome positioning(GO:0016584) |
0.0 | 0.1 | GO:0015677 | copper ion import(GO:0015677) |
0.0 | 0.1 | GO:0060762 | regulation of branching involved in mammary gland duct morphogenesis(GO:0060762) |
0.0 | 0.2 | GO:1901029 | negative regulation of mitochondrial outer membrane permeabilization involved in apoptotic signaling pathway(GO:1901029) |
0.0 | 0.1 | GO:0035627 | ceramide transport(GO:0035627) |
0.0 | 0.0 | GO:0035993 | deltoid tuberosity development(GO:0035993) |
0.0 | 0.3 | GO:0009120 | deoxyribonucleoside metabolic process(GO:0009120) |
0.0 | 0.5 | GO:0044247 | glycogen catabolic process(GO:0005980) glucan catabolic process(GO:0009251) cellular polysaccharide catabolic process(GO:0044247) |
0.0 | 0.3 | GO:0000103 | sulfate assimilation(GO:0000103) |
0.0 | 0.2 | GO:0000012 | single strand break repair(GO:0000012) |
0.0 | 0.1 | GO:0008594 | photoreceptor cell morphogenesis(GO:0008594) |
0.0 | 0.1 | GO:0060022 | hard palate development(GO:0060022) |
0.0 | 0.1 | GO:0071242 | cellular response to ammonium ion(GO:0071242) |
0.0 | 0.1 | GO:0002468 | dendritic cell antigen processing and presentation(GO:0002468) regulation of dendritic cell antigen processing and presentation(GO:0002604) |
0.0 | 0.2 | GO:1901978 | positive regulation of cell cycle checkpoint(GO:1901978) |
0.0 | 0.1 | GO:0061687 | detoxification of copper ion(GO:0010273) detoxification of inorganic compound(GO:0061687) stress response to copper ion(GO:1990169) |
0.0 | 0.0 | GO:0034146 | toll-like receptor 5 signaling pathway(GO:0034146) |
0.0 | 0.1 | GO:0007256 | activation of JNKK activity(GO:0007256) |
0.0 | 0.1 | GO:0007567 | parturition(GO:0007567) |
0.0 | 0.3 | GO:0071549 | cellular response to dexamethasone stimulus(GO:0071549) |
0.0 | 0.4 | GO:2000311 | regulation of alpha-amino-3-hydroxy-5-methyl-4-isoxazole propionate selective glutamate receptor activity(GO:2000311) |
0.0 | 0.0 | GO:0005513 | detection of calcium ion(GO:0005513) |
0.0 | 0.2 | GO:0031293 | membrane protein intracellular domain proteolysis(GO:0031293) |
0.0 | 0.1 | GO:0030916 | otic vesicle formation(GO:0030916) |
0.0 | 0.1 | GO:2000546 | positive regulation of cell chemotaxis to fibroblast growth factor(GO:1904849) positive regulation of endothelial cell chemotaxis to fibroblast growth factor(GO:2000546) |
0.0 | 0.1 | GO:1904252 | negative regulation of bile acid biosynthetic process(GO:0070858) negative regulation of bile acid metabolic process(GO:1904252) |
0.0 | 0.1 | GO:0007158 | neuron cell-cell adhesion(GO:0007158) |
0.0 | 0.1 | GO:0070458 | detoxification of nitrogen compound(GO:0051410) cellular detoxification of nitrogen compound(GO:0070458) |
0.0 | 0.2 | GO:0051770 | nitric-oxide synthase biosynthetic process(GO:0051767) regulation of nitric-oxide synthase biosynthetic process(GO:0051769) positive regulation of nitric-oxide synthase biosynthetic process(GO:0051770) |
0.0 | 0.1 | GO:0038128 | ERBB2 signaling pathway(GO:0038128) |
0.0 | 0.1 | GO:0006768 | biotin metabolic process(GO:0006768) |
0.0 | 0.1 | GO:1904667 | negative regulation of ubiquitin protein ligase activity(GO:1904667) |
0.0 | 0.4 | GO:0031111 | negative regulation of microtubule polymerization or depolymerization(GO:0031111) |
0.0 | 0.0 | GO:0002906 | mature B cell apoptotic process(GO:0002901) regulation of mature B cell apoptotic process(GO:0002905) negative regulation of mature B cell apoptotic process(GO:0002906) |
0.0 | 0.1 | GO:1903772 | regulation of viral budding via host ESCRT complex(GO:1903772) |
0.0 | 0.2 | GO:0030836 | positive regulation of actin filament depolymerization(GO:0030836) |
0.0 | 0.0 | GO:0045041 | protein import into mitochondrial intermembrane space(GO:0045041) |
0.0 | 0.1 | GO:1901421 | positive regulation of response to alcohol(GO:1901421) |
0.0 | 0.0 | GO:0046520 | sphingoid biosynthetic process(GO:0046520) |
0.0 | 0.8 | GO:1900006 | positive regulation of dendrite development(GO:1900006) |
0.0 | 0.1 | GO:0070914 | UV-damage excision repair(GO:0070914) |
0.0 | 0.3 | GO:0035176 | social behavior(GO:0035176) intraspecies interaction between organisms(GO:0051703) |
0.0 | 0.1 | GO:0045743 | positive regulation of fibroblast growth factor receptor signaling pathway(GO:0045743) |
0.0 | 0.0 | GO:2000391 | regulation of neutrophil extravasation(GO:2000389) positive regulation of neutrophil extravasation(GO:2000391) |
0.0 | 0.0 | GO:0040001 | establishment of mitotic spindle localization(GO:0040001) |
0.0 | 0.2 | GO:0070862 | negative regulation of protein exit from endoplasmic reticulum(GO:0070862) negative regulation of retrograde protein transport, ER to cytosol(GO:1904153) |
0.0 | 0.1 | GO:0032474 | otolith morphogenesis(GO:0032474) |
0.0 | 0.4 | GO:0000132 | establishment of mitotic spindle orientation(GO:0000132) |
0.0 | 0.1 | GO:1990035 | calcium ion import into cell(GO:1990035) |
0.0 | 0.1 | GO:0019478 | D-amino acid catabolic process(GO:0019478) |
0.0 | 0.1 | GO:0044838 | cell quiescence(GO:0044838) |
0.0 | 0.3 | GO:0040019 | positive regulation of embryonic development(GO:0040019) |
0.0 | 0.1 | GO:0030011 | maintenance of cell polarity(GO:0030011) |
0.0 | 0.0 | GO:0032483 | regulation of Rab protein signal transduction(GO:0032483) |
0.0 | 1.5 | GO:0008277 | regulation of G-protein coupled receptor protein signaling pathway(GO:0008277) |
0.0 | 0.3 | GO:0000290 | deadenylation-dependent decapping of nuclear-transcribed mRNA(GO:0000290) |
0.0 | 0.1 | GO:0002092 | positive regulation of receptor internalization(GO:0002092) |
0.0 | 0.0 | GO:0008626 | granzyme-mediated apoptotic signaling pathway(GO:0008626) |
0.0 | 0.0 | GO:0032347 | regulation of aldosterone biosynthetic process(GO:0032347) |
0.0 | 0.1 | GO:0090114 | COPII-coated vesicle budding(GO:0090114) |
0.0 | 0.1 | GO:0042790 | transcription of nuclear large rRNA transcript from RNA polymerase I promoter(GO:0042790) |
0.0 | 0.1 | GO:0033313 | meiotic cell cycle checkpoint(GO:0033313) |
0.0 | 0.3 | GO:0015721 | bile acid and bile salt transport(GO:0015721) |
0.0 | 0.2 | GO:0060765 | regulation of androgen receptor signaling pathway(GO:0060765) |
0.0 | 0.6 | GO:0007271 | synaptic transmission, cholinergic(GO:0007271) |
0.0 | 0.2 | GO:0070131 | positive regulation of mitochondrial translation(GO:0070131) |
0.0 | 0.0 | GO:0016557 | peroxisome membrane biogenesis(GO:0016557) |
0.0 | 0.1 | GO:0090086 | negative regulation of protein deubiquitination(GO:0090086) |
0.0 | 0.2 | GO:1902018 | negative regulation of cilium assembly(GO:1902018) |
0.0 | 0.1 | GO:0045404 | positive regulation of interleukin-4 biosynthetic process(GO:0045404) |
0.0 | 0.1 | GO:0010825 | positive regulation of centrosome duplication(GO:0010825) positive regulation of centrosome cycle(GO:0046607) |
0.0 | 0.1 | GO:0090611 | ubiquitin-independent protein catabolic process via the multivesicular body sorting pathway(GO:0090611) |
0.0 | 0.1 | GO:2000399 | negative regulation of thymocyte aggregation(GO:2000399) |
0.0 | 0.0 | GO:0040009 | regulation of growth rate(GO:0040009) |
0.0 | 0.1 | GO:0070423 | nucleotide-binding oligomerization domain containing signaling pathway(GO:0070423) nucleotide-binding oligomerization domain containing 2 signaling pathway(GO:0070431) |
0.0 | 0.1 | GO:0033504 | floor plate development(GO:0033504) |
0.0 | 0.3 | GO:0031113 | regulation of microtubule polymerization(GO:0031113) |
0.0 | 0.1 | GO:2000774 | positive regulation of cellular senescence(GO:2000774) |
0.0 | 0.1 | GO:0071492 | cellular response to UV-A(GO:0071492) |
0.0 | 0.1 | GO:0071318 | cellular response to ATP(GO:0071318) |
0.0 | 0.0 | GO:0051081 | membrane disassembly(GO:0030397) nuclear envelope disassembly(GO:0051081) |
0.0 | 0.1 | GO:0034983 | peptidyl-lysine deacetylation(GO:0034983) |
0.0 | 0.2 | GO:0090102 | cochlea development(GO:0090102) |
0.0 | 0.6 | GO:0043252 | sodium-independent organic anion transport(GO:0043252) |
0.0 | 0.0 | GO:0001831 | trophectodermal cellular morphogenesis(GO:0001831) |
0.0 | 0.0 | GO:0046834 | lipid phosphorylation(GO:0046834) |
0.0 | 0.1 | GO:0002949 | tRNA threonylcarbamoyladenosine modification(GO:0002949) |
0.0 | 0.2 | GO:0007021 | tubulin complex assembly(GO:0007021) |
0.0 | 0.0 | GO:0032439 | endosome localization(GO:0032439) |
0.0 | 0.0 | GO:0008354 | germ cell migration(GO:0008354) |
0.0 | 0.1 | GO:0019276 | UDP-N-acetylgalactosamine metabolic process(GO:0019276) |
0.0 | 0.0 | GO:0043320 | natural killer cell degranulation(GO:0043320) |
0.0 | 0.1 | GO:2000601 | positive regulation of Arp2/3 complex-mediated actin nucleation(GO:2000601) |
0.0 | 0.0 | GO:0016321 | female meiosis chromosome segregation(GO:0016321) |
0.0 | 0.2 | GO:0010039 | response to iron ion(GO:0010039) |
0.0 | 0.0 | GO:0035622 | intrahepatic bile duct development(GO:0035622) |
0.0 | 0.1 | GO:0008655 | pyrimidine-containing compound salvage(GO:0008655) pyrimidine nucleoside salvage(GO:0043097) |
0.0 | 0.0 | GO:0060018 | astrocyte fate commitment(GO:0060018) |
0.0 | 0.1 | GO:1902855 | regulation of nonmotile primary cilium assembly(GO:1902855) |
0.0 | 1.1 | GO:0006888 | ER to Golgi vesicle-mediated transport(GO:0006888) |
0.0 | 0.1 | GO:0010166 | wax biosynthetic process(GO:0010025) wax metabolic process(GO:0010166) |
0.0 | 0.4 | GO:2001014 | regulation of skeletal muscle cell differentiation(GO:2001014) |
0.0 | 0.1 | GO:0032959 | inositol trisphosphate biosynthetic process(GO:0032959) |
0.0 | 0.0 | GO:0043553 | negative regulation of phosphatidylinositol 3-kinase activity(GO:0043553) |
0.0 | 0.2 | GO:0006072 | glycerol-3-phosphate metabolic process(GO:0006072) |
0.0 | 0.2 | GO:0050908 | detection of light stimulus involved in visual perception(GO:0050908) detection of light stimulus involved in sensory perception(GO:0050962) |
0.0 | 0.0 | GO:1900041 | negative regulation of interleukin-2 secretion(GO:1900041) |
0.0 | 0.0 | GO:0035962 | response to interleukin-13(GO:0035962) cellular response to interleukin-13(GO:0035963) |
0.0 | 0.0 | GO:0060266 | negative regulation of respiratory burst involved in inflammatory response(GO:0060266) |
0.0 | 0.0 | GO:0097029 | mature conventional dendritic cell differentiation(GO:0097029) |
0.0 | 0.0 | GO:0010499 | proteasomal ubiquitin-independent protein catabolic process(GO:0010499) |
0.0 | 0.0 | GO:0032066 | nucleolus to nucleoplasm transport(GO:0032066) |
0.0 | 0.0 | GO:0001302 | replicative cell aging(GO:0001302) |
0.0 | 0.0 | GO:0007196 | adenylate cyclase-inhibiting G-protein coupled glutamate receptor signaling pathway(GO:0007196) |
0.0 | 0.1 | GO:0015879 | carnitine transport(GO:0015879) |
0.0 | 0.1 | GO:2000346 | negative regulation of hepatocyte proliferation(GO:2000346) |
0.0 | 0.1 | GO:0035608 | protein deglutamylation(GO:0035608) |
0.0 | 0.0 | GO:0048496 | maintenance of organ identity(GO:0048496) |
0.0 | 0.0 | GO:0006598 | polyamine catabolic process(GO:0006598) |
0.0 | 0.0 | GO:1902807 | negative regulation of cell cycle G1/S phase transition(GO:1902807) |
0.0 | 0.0 | GO:0072224 | metanephric glomerulus development(GO:0072224) |
0.0 | 0.0 | GO:2000344 | positive regulation of acrosome reaction(GO:2000344) |
0.0 | 0.0 | GO:0052203 | modulation by symbiont of host molecular function(GO:0052055) modulation of catalytic activity in other organism involved in symbiotic interaction(GO:0052203) modulation by host of symbiont catalytic activity(GO:0052422) |
0.0 | 0.2 | GO:0031646 | positive regulation of neurological system process(GO:0031646) |
0.0 | 0.1 | GO:0048642 | negative regulation of skeletal muscle tissue development(GO:0048642) |
0.0 | 0.2 | GO:0031507 | heterochromatin assembly(GO:0031507) |
0.0 | 0.0 | GO:0014816 | skeletal muscle satellite cell differentiation(GO:0014816) |
0.0 | 0.1 | GO:0044788 | modulation by host of viral process(GO:0044788) |
0.0 | 0.1 | GO:0034058 | endosomal vesicle fusion(GO:0034058) |
0.0 | 0.0 | GO:0042538 | hyperosmotic salinity response(GO:0042538) |
0.0 | 0.0 | GO:0043970 | histone H3-K9 acetylation(GO:0043970) |
0.0 | 0.0 | GO:0051823 | regulation of synapse structural plasticity(GO:0051823) |
0.0 | 0.0 | GO:0032914 | positive regulation of transforming growth factor beta1 production(GO:0032914) |
0.0 | 0.0 | GO:0043382 | positive regulation of memory T cell differentiation(GO:0043382) |
0.0 | 0.3 | GO:0042572 | retinol metabolic process(GO:0042572) |
0.0 | 0.1 | GO:0030644 | cellular chloride ion homeostasis(GO:0030644) |
0.0 | 0.0 | GO:0021681 | cerebellar granular layer development(GO:0021681) |
0.0 | 0.2 | GO:0051497 | negative regulation of actin filament bundle assembly(GO:0032232) negative regulation of stress fiber assembly(GO:0051497) |
0.0 | 0.0 | GO:0034727 | lysosomal microautophagy(GO:0016237) piecemeal microautophagy of nucleus(GO:0034727) late nucleophagy(GO:0044805) |
0.0 | 0.1 | GO:0044766 | multi-organism transport(GO:0044766) multi-organism localization(GO:1902579) |
0.0 | 0.0 | GO:2000343 | positive regulation of chemokine (C-X-C motif) ligand 2 production(GO:2000343) |
0.0 | 0.1 | GO:0006642 | triglyceride mobilization(GO:0006642) |
0.0 | 0.2 | GO:0060046 | regulation of acrosome reaction(GO:0060046) |
0.0 | 0.1 | GO:2000400 | positive regulation of T cell differentiation in thymus(GO:0033089) positive regulation of thymocyte aggregation(GO:2000400) |
0.0 | 0.0 | GO:0038165 | oncostatin-M-mediated signaling pathway(GO:0038165) |
0.0 | 0.0 | GO:0098739 | import across plasma membrane(GO:0098739) |
0.0 | 0.0 | GO:0018916 | nitrobenzene metabolic process(GO:0018916) |
0.0 | 0.0 | GO:1903288 | regulation of potassium ion import(GO:1903286) positive regulation of potassium ion import(GO:1903288) |
0.0 | 0.0 | GO:0042167 | heme catabolic process(GO:0042167) pigment catabolic process(GO:0046149) |
0.0 | 0.6 | GO:0007270 | neuron-neuron synaptic transmission(GO:0007270) |
0.0 | 0.1 | GO:0000059 | protein import into nucleus, docking(GO:0000059) |
0.0 | 0.0 | GO:0043243 | positive regulation of protein complex disassembly(GO:0043243) |
0.0 | 0.2 | GO:0007214 | gamma-aminobutyric acid signaling pathway(GO:0007214) |
0.0 | 0.0 | GO:0060830 | ciliary receptor clustering involved in smoothened signaling pathway(GO:0060830) |
0.0 | 0.1 | GO:1905097 | regulation of guanyl-nucleotide exchange factor activity(GO:1905097) |
0.0 | 0.1 | GO:0071971 | extracellular exosome assembly(GO:0071971) |
0.0 | 0.1 | GO:0001806 | type IV hypersensitivity(GO:0001806) |
0.0 | 0.1 | GO:0070203 | regulation of establishment of protein localization to telomere(GO:0070203) |
0.0 | 0.2 | GO:0045899 | positive regulation of RNA polymerase II transcriptional preinitiation complex assembly(GO:0045899) |
0.0 | 0.1 | GO:0071108 | protein K48-linked deubiquitination(GO:0071108) |
0.0 | 0.0 | GO:0097502 | protein mannosylation(GO:0035268) mannosylation(GO:0097502) |
0.0 | 0.1 | GO:1900113 | negative regulation of histone H3-K9 trimethylation(GO:1900113) |
0.0 | 0.0 | GO:0010455 | positive regulation of cell fate commitment(GO:0010455) |
0.0 | 0.0 | GO:0002309 | T cell proliferation involved in immune response(GO:0002309) |
0.0 | 0.0 | GO:0006987 | activation of signaling protein activity involved in unfolded protein response(GO:0006987) protein auto-ADP-ribosylation(GO:0070213) |
0.0 | 0.0 | GO:0002254 | kinin cascade(GO:0002254) |
0.0 | 0.1 | GO:0042772 | DNA damage response, signal transduction by p53 class mediator resulting in transcription of p21 class mediator(GO:0006978) DNA damage response, signal transduction resulting in transcription(GO:0042772) |
0.0 | 0.1 | GO:0006369 | termination of RNA polymerase II transcription(GO:0006369) |
0.0 | 0.0 | GO:0021830 | interneuron migration from the subpallium to the cortex(GO:0021830) |
0.0 | 0.1 | GO:1990403 | embryonic brain development(GO:1990403) |
0.0 | 0.0 | GO:0046909 | intermembrane transport(GO:0046909) |
0.0 | 0.1 | GO:0010819 | regulation of T cell chemotaxis(GO:0010819) |
0.0 | 0.1 | GO:0043137 | DNA replication, removal of RNA primer(GO:0043137) |
0.0 | 0.1 | GO:0009404 | toxin metabolic process(GO:0009404) |
0.0 | 0.1 | GO:0035092 | sperm chromatin condensation(GO:0035092) |
0.0 | 0.1 | GO:0007128 | meiotic prophase I(GO:0007128) prophase(GO:0051324) meiotic cell cycle phase(GO:0098762) meiosis I cell cycle phase(GO:0098764) |
0.0 | 0.2 | GO:0042149 | cellular response to glucose starvation(GO:0042149) |
0.0 | 0.1 | GO:0034770 | histone H4-K20 methylation(GO:0034770) histone H4-K20 trimethylation(GO:0034773) |
0.0 | 0.1 | GO:0045916 | negative regulation of complement activation(GO:0045916) negative regulation of protein activation cascade(GO:2000258) |
0.0 | 0.0 | GO:0033615 | mitochondrial proton-transporting ATP synthase complex assembly(GO:0033615) |
0.0 | 0.1 | GO:0034723 | DNA replication-dependent nucleosome assembly(GO:0006335) DNA replication-dependent nucleosome organization(GO:0034723) |
0.0 | 0.0 | GO:0021764 | amygdala development(GO:0021764) |
0.0 | 0.1 | GO:0035721 | intraciliary retrograde transport(GO:0035721) |
0.0 | 0.1 | GO:0070327 | thyroid hormone transport(GO:0070327) |
0.0 | 0.0 | GO:0030913 | paranodal junction assembly(GO:0030913) |
0.0 | 0.1 | GO:0008215 | spermine metabolic process(GO:0008215) |
0.0 | 0.0 | GO:0046952 | ketone body catabolic process(GO:0046952) |
0.0 | 0.0 | GO:0098870 | neuronal action potential propagation(GO:0019227) action potential propagation(GO:0098870) |
0.0 | 0.1 | GO:0044550 | secondary metabolite biosynthetic process(GO:0044550) |
0.0 | 0.0 | GO:0035589 | G-protein coupled purinergic nucleotide receptor signaling pathway(GO:0035589) |
0.0 | 0.0 | GO:0070459 | prolactin secretion(GO:0070459) |
0.0 | 0.0 | GO:0018206 | peptidyl-methionine modification(GO:0018206) |
0.0 | 0.0 | GO:0098535 | de novo centriole assembly(GO:0098535) |
0.0 | 0.1 | GO:0070995 | NADPH oxidation(GO:0070995) |
0.0 | 0.0 | GO:0030214 | hyaluronan catabolic process(GO:0030214) |
0.0 | 0.3 | GO:0018345 | protein palmitoylation(GO:0018345) |
0.0 | 0.0 | GO:0090148 | membrane fission(GO:0090148) |
0.0 | 0.0 | GO:0034587 | piRNA metabolic process(GO:0034587) |
0.0 | 0.0 | GO:0071474 | cellular hyperosmotic response(GO:0071474) |
0.0 | 0.0 | GO:0051140 | regulation of NK T cell proliferation(GO:0051140) positive regulation of NK T cell proliferation(GO:0051142) |
0.0 | 0.0 | GO:0045656 | negative regulation of monocyte differentiation(GO:0045656) |
0.0 | 0.1 | GO:2000781 | positive regulation of double-strand break repair(GO:2000781) |
0.0 | 0.0 | GO:0036092 | phosphatidylinositol-3-phosphate biosynthetic process(GO:0036092) |
0.0 | 0.0 | GO:0098828 | modulation of inhibitory postsynaptic potential(GO:0098828) |
0.0 | 0.0 | GO:0071494 | cellular response to UV-C(GO:0071494) |
0.0 | 0.4 | GO:0006334 | nucleosome assembly(GO:0006334) |
0.0 | 0.2 | GO:0030488 | tRNA methylation(GO:0030488) |
0.0 | 0.1 | GO:0003418 | growth plate cartilage chondrocyte differentiation(GO:0003418) |
0.0 | 0.0 | GO:0070268 | cornification(GO:0070268) |
0.0 | 0.0 | GO:0071865 | regulation of apoptotic process in bone marrow(GO:0071865) negative regulation of apoptotic process in bone marrow(GO:0071866) |
0.0 | 0.1 | GO:0061462 | protein localization to lysosome(GO:0061462) |
0.0 | 0.0 | GO:1990592 | protein polyufmylation(GO:1990564) protein K69-linked ufmylation(GO:1990592) |
0.0 | 0.1 | GO:0010804 | negative regulation of tumor necrosis factor-mediated signaling pathway(GO:0010804) |
0.0 | 0.0 | GO:0035751 | regulation of lysosomal lumen pH(GO:0035751) |
0.0 | 0.1 | GO:0019800 | peptide cross-linking via chondroitin 4-sulfate glycosaminoglycan(GO:0019800) |
0.0 | 0.0 | GO:0051901 | positive regulation of mitochondrial depolarization(GO:0051901) |
0.0 | 0.0 | GO:0006287 | base-excision repair, gap-filling(GO:0006287) |
0.0 | 0.0 | GO:0035425 | autocrine signaling(GO:0035425) |
0.0 | 0.0 | GO:0001514 | selenocysteine incorporation(GO:0001514) translational readthrough(GO:0006451) |
0.0 | 0.0 | GO:0032020 | ISG15-protein conjugation(GO:0032020) |
0.0 | 0.4 | GO:0002323 | natural killer cell activation involved in immune response(GO:0002323) |
0.0 | 0.0 | GO:0060449 | bud elongation involved in lung branching(GO:0060449) |
0.0 | 0.0 | GO:0035810 | positive regulation of urine volume(GO:0035810) |
0.0 | 0.0 | GO:0035864 | response to potassium ion(GO:0035864) cellular response to potassium ion(GO:0035865) |
0.0 | 0.0 | GO:0044339 | canonical Wnt signaling pathway involved in osteoblast differentiation(GO:0044339) |
0.0 | 0.0 | GO:0031086 | nuclear-transcribed mRNA catabolic process, deadenylation-independent decay(GO:0031086) deadenylation-independent decapping of nuclear-transcribed mRNA(GO:0031087) |
0.0 | 0.0 | GO:0000154 | rRNA modification(GO:0000154) |
0.0 | 0.0 | GO:0034035 | purine ribonucleoside bisphosphate metabolic process(GO:0034035) |
0.0 | 0.0 | GO:0060689 | cell differentiation involved in salivary gland development(GO:0060689) |
0.0 | 0.0 | GO:2000348 | regulation of CD40 signaling pathway(GO:2000348) |
0.0 | 0.1 | GO:0042346 | positive regulation of NF-kappaB import into nucleus(GO:0042346) |
0.0 | 0.0 | GO:0070934 | CRD-mediated mRNA stabilization(GO:0070934) |
0.0 | 0.0 | GO:0060971 | embryonic heart tube left/right pattern formation(GO:0060971) |
0.0 | 0.0 | GO:0045079 | negative regulation of chemokine biosynthetic process(GO:0045079) |
0.0 | 0.0 | GO:0045900 | negative regulation of translational elongation(GO:0045900) |
0.0 | 0.0 | GO:0060292 | long term synaptic depression(GO:0060292) |
0.0 | 0.0 | GO:0060478 | acrosomal vesicle exocytosis(GO:0060478) |
0.0 | 0.0 | GO:2000381 | negative regulation of mesoderm development(GO:2000381) |
0.0 | 0.0 | GO:0001696 | gastric acid secretion(GO:0001696) |
0.0 | 0.0 | GO:2001204 | regulation of osteoclast development(GO:2001204) |
0.0 | 0.0 | GO:0039702 | viral budding via host ESCRT complex(GO:0039702) |
0.0 | 0.0 | GO:1901660 | calcium ion export(GO:1901660) |
0.0 | 0.0 | GO:0060973 | cell migration involved in heart development(GO:0060973) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
1.2 | 3.5 | GO:0030289 | protein phosphatase 4 complex(GO:0030289) |
0.7 | 2.2 | GO:0034666 | integrin alpha2-beta1 complex(GO:0034666) |
0.7 | 3.4 | GO:0097433 | dense body(GO:0097433) |
0.7 | 3.3 | GO:0070695 | FHF complex(GO:0070695) |
0.6 | 1.7 | GO:0042719 | mitochondrial intermembrane space protein transporter complex(GO:0042719) |
0.6 | 4.0 | GO:0036057 | filtration diaphragm(GO:0036056) slit diaphragm(GO:0036057) |
0.5 | 1.6 | GO:0072534 | perineuronal net(GO:0072534) |
0.5 | 1.5 | GO:0097454 | Schwann cell microvillus(GO:0097454) |
0.5 | 1.4 | GO:1990812 | growth cone filopodium(GO:1990812) |
0.4 | 2.2 | GO:0000805 | X chromosome(GO:0000805) |
0.4 | 1.6 | GO:0071438 | invadopodium membrane(GO:0071438) |
0.4 | 3.3 | GO:0035253 | ciliary rootlet(GO:0035253) |
0.4 | 2.5 | GO:0008290 | F-actin capping protein complex(GO:0008290) |
0.4 | 3.5 | GO:0044224 | juxtaparanode region of axon(GO:0044224) |
0.3 | 3.0 | GO:0097449 | astrocyte projection(GO:0097449) |
0.3 | 8.6 | GO:0044295 | axonal growth cone(GO:0044295) |
0.3 | 1.2 | GO:0031262 | Ndc80 complex(GO:0031262) |
0.3 | 0.6 | GO:0097441 | basilar dendrite(GO:0097441) |
0.3 | 0.9 | GO:0038037 | G-protein coupled receptor dimeric complex(GO:0038037) G-protein coupled receptor complex(GO:0097648) |
0.3 | 1.1 | GO:0070876 | SOSS complex(GO:0070876) |
0.3 | 0.8 | GO:0042585 | germinal vesicle(GO:0042585) |
0.3 | 0.3 | GO:0070032 | synaptobrevin 2-SNAP-25-syntaxin-1a-complexin I complex(GO:0070032) |
0.3 | 0.5 | GO:0044308 | axonal spine(GO:0044308) |
0.3 | 2.8 | GO:0042555 | MCM complex(GO:0042555) |
0.3 | 1.8 | GO:0017101 | aminoacyl-tRNA synthetase multienzyme complex(GO:0017101) |
0.3 | 1.0 | GO:1990745 | EARP complex(GO:1990745) |
0.3 | 1.3 | GO:0071547 | piP-body(GO:0071547) |
0.3 | 0.8 | GO:0070033 | synaptobrevin 2-SNAP-25-syntaxin-1a-complexin II complex(GO:0070033) |
0.2 | 0.7 | GO:0070552 | BRISC complex(GO:0070552) |
0.2 | 0.9 | GO:1990851 | Wnt-Frizzled-LRP5/6 complex(GO:1990851) |
0.2 | 2.1 | GO:0008385 | IkappaB kinase complex(GO:0008385) |
0.2 | 0.4 | GO:1990246 | uniplex complex(GO:1990246) |
0.2 | 11.2 | GO:0042734 | presynaptic membrane(GO:0042734) |
0.2 | 0.7 | GO:0070110 | ciliary neurotrophic factor receptor complex(GO:0070110) |
0.2 | 1.5 | GO:0000801 | central element(GO:0000801) |
0.2 | 0.6 | GO:0005879 | axonemal microtubule(GO:0005879) |
0.2 | 0.6 | GO:0071008 | U2-type post-mRNA release spliceosomal complex(GO:0071008) |
0.2 | 1.0 | GO:0033503 | HULC complex(GO:0033503) |
0.2 | 0.6 | GO:0044300 | cerebellar mossy fiber(GO:0044300) |
0.2 | 2.0 | GO:0043194 | axon initial segment(GO:0043194) |
0.2 | 0.6 | GO:0070522 | ERCC4-ERCC1 complex(GO:0070522) |
0.2 | 0.5 | GO:0048179 | activin receptor complex(GO:0048179) |
0.2 | 1.4 | GO:0030314 | junctional membrane complex(GO:0030314) |
0.2 | 4.7 | GO:0032281 | AMPA glutamate receptor complex(GO:0032281) |
0.2 | 1.0 | GO:0032279 | asymmetric synapse(GO:0032279) |
0.2 | 0.7 | GO:1990131 | EGO complex(GO:0034448) Gtr1-Gtr2 GTPase complex(GO:1990131) |
0.2 | 0.5 | GO:0005958 | DNA-dependent protein kinase-DNA ligase 4 complex(GO:0005958) |
0.2 | 1.0 | GO:0031983 | vesicle lumen(GO:0031983) |
0.2 | 0.5 | GO:1990393 | 3M complex(GO:1990393) |
0.2 | 0.3 | GO:0070044 | synaptobrevin 2-SNAP-25-syntaxin-1a complex(GO:0070044) |
0.2 | 0.6 | GO:0000931 | gamma-tubulin large complex(GO:0000931) gamma-tubulin ring complex(GO:0008274) |
0.2 | 1.1 | GO:0031464 | Cul4A-RING E3 ubiquitin ligase complex(GO:0031464) |
0.2 | 0.8 | GO:0014731 | spectrin-associated cytoskeleton(GO:0014731) |
0.2 | 0.9 | GO:0002139 | stereocilia coupling link(GO:0002139) |
0.2 | 2.7 | GO:0030134 | ER to Golgi transport vesicle(GO:0030134) |
0.1 | 2.5 | GO:0090665 | dystrophin-associated glycoprotein complex(GO:0016010) glycoprotein complex(GO:0090665) |
0.1 | 0.4 | GO:0002193 | MAML1-RBP-Jkappa- ICN1 complex(GO:0002193) |
0.1 | 1.0 | GO:0005577 | fibrinogen complex(GO:0005577) |
0.1 | 0.7 | GO:0000796 | condensin complex(GO:0000796) |
0.1 | 0.5 | GO:0045261 | mitochondrial proton-transporting ATP synthase complex, catalytic core F(1)(GO:0000275) proton-transporting ATP synthase complex, catalytic core F(1)(GO:0045261) |
0.1 | 0.8 | GO:0031415 | NatA complex(GO:0031415) |
0.1 | 0.5 | GO:0005968 | Rab-protein geranylgeranyltransferase complex(GO:0005968) |
0.1 | 0.3 | GO:0055087 | Ski complex(GO:0055087) |
0.1 | 1.2 | GO:0071782 | endoplasmic reticulum tubular network(GO:0071782) |
0.1 | 0.2 | GO:0030673 | axolemma(GO:0030673) |
0.1 | 0.7 | GO:0098563 | integral component of synaptic vesicle membrane(GO:0030285) intrinsic component of synaptic vesicle membrane(GO:0098563) |
0.1 | 1.8 | GO:1902710 | GABA receptor complex(GO:1902710) GABA-A receptor complex(GO:1902711) |
0.1 | 0.3 | GO:0005971 | ribonucleoside-diphosphate reductase complex(GO:0005971) |
0.1 | 0.3 | GO:0043527 | tRNA methyltransferase complex(GO:0043527) |
0.1 | 3.5 | GO:0008180 | COP9 signalosome(GO:0008180) |
0.1 | 0.3 | GO:0005945 | 6-phosphofructokinase complex(GO:0005945) |
0.1 | 0.9 | GO:0035327 | transcriptionally active chromatin(GO:0035327) |
0.1 | 0.7 | GO:0070847 | core mediator complex(GO:0070847) |
0.1 | 1.0 | GO:0032045 | guanyl-nucleotide exchange factor complex(GO:0032045) |
0.1 | 0.4 | GO:0044299 | C-fiber(GO:0044299) |
0.1 | 0.9 | GO:0000815 | ESCRT III complex(GO:0000815) |
0.1 | 0.9 | GO:0031932 | TORC2 complex(GO:0031932) |
0.1 | 0.9 | GO:0060091 | kinocilium(GO:0060091) |
0.1 | 1.2 | GO:0045239 | tricarboxylic acid cycle enzyme complex(GO:0045239) |
0.1 | 0.8 | GO:0048786 | presynaptic active zone(GO:0048786) |
0.1 | 0.5 | GO:0005883 | neurofilament(GO:0005883) |
0.1 | 2.6 | GO:0071339 | MLL1/2 complex(GO:0044665) MLL1 complex(GO:0071339) |
0.1 | 0.4 | GO:0000235 | astral microtubule(GO:0000235) |
0.1 | 0.8 | GO:0002116 | semaphorin receptor complex(GO:0002116) |
0.1 | 1.5 | GO:0097228 | sperm principal piece(GO:0097228) |
0.1 | 0.4 | GO:0044530 | supraspliceosomal complex(GO:0044530) |
0.1 | 0.5 | GO:1990454 | L-type voltage-gated calcium channel complex(GO:1990454) |
0.1 | 2.6 | GO:0015030 | Cajal body(GO:0015030) |
0.1 | 0.3 | GO:1990130 | Iml1 complex(GO:1990130) |
0.1 | 0.3 | GO:0016533 | cyclin-dependent protein kinase 5 holoenzyme complex(GO:0016533) |
0.1 | 0.2 | GO:0044393 | microspike(GO:0044393) |
0.1 | 1.1 | GO:0032433 | filopodium tip(GO:0032433) |
0.1 | 9.7 | GO:0030427 | site of polarized growth(GO:0030427) |
0.1 | 0.9 | GO:0031045 | dense core granule(GO:0031045) |
0.1 | 0.2 | GO:0010009 | cytoplasmic side of endosome membrane(GO:0010009) |
0.1 | 0.9 | GO:0005640 | nuclear outer membrane(GO:0005640) |
0.1 | 4.9 | GO:0031463 | Cul3-RING ubiquitin ligase complex(GO:0031463) |
0.1 | 0.6 | GO:0034464 | BBSome(GO:0034464) |
0.1 | 1.6 | GO:0032809 | neuronal cell body membrane(GO:0032809) |
0.1 | 2.0 | GO:0030687 | preribosome, large subunit precursor(GO:0030687) |
0.1 | 1.1 | GO:0060077 | inhibitory synapse(GO:0060077) |
0.1 | 2.0 | GO:0005891 | voltage-gated calcium channel complex(GO:0005891) |
0.1 | 0.5 | GO:0070688 | MLL5-L complex(GO:0070688) |
0.1 | 0.2 | GO:0033179 | proton-transporting V-type ATPase, V0 domain(GO:0033179) |
0.1 | 2.8 | GO:0030175 | filopodium(GO:0030175) |
0.1 | 9.8 | GO:0045211 | postsynaptic membrane(GO:0045211) |
0.1 | 2.5 | GO:0008023 | transcription elongation factor complex(GO:0008023) |
0.1 | 0.1 | GO:0097487 | multivesicular body, internal vesicle(GO:0097487) |
0.1 | 0.1 | GO:0030689 | Noc complex(GO:0030689) |
0.1 | 1.1 | GO:0005868 | cytoplasmic dynein complex(GO:0005868) |
0.1 | 0.3 | GO:1990909 | Wnt signalosome(GO:1990909) |
0.1 | 3.0 | GO:0005871 | kinesin complex(GO:0005871) |
0.1 | 0.6 | GO:0036157 | outer dynein arm(GO:0036157) |
0.1 | 1.6 | GO:0097610 | cleavage furrow(GO:0032154) cell surface furrow(GO:0097610) |
0.1 | 0.6 | GO:0000124 | SAGA complex(GO:0000124) |
0.1 | 0.5 | GO:0033180 | proton-transporting V-type ATPase, V1 domain(GO:0033180) |
0.1 | 0.2 | GO:0032299 | ribonuclease H2 complex(GO:0032299) |
0.1 | 0.3 | GO:0033268 | node of Ranvier(GO:0033268) |
0.1 | 3.9 | GO:0044309 | neuron spine(GO:0044309) |
0.1 | 0.3 | GO:0072357 | PTW/PP1 phosphatase complex(GO:0072357) |
0.1 | 0.6 | GO:0030061 | mitochondrial crista(GO:0030061) |
0.1 | 0.6 | GO:0031616 | spindle pole centrosome(GO:0031616) |
0.1 | 0.2 | GO:0072687 | meiotic spindle(GO:0072687) |
0.1 | 0.2 | GO:0016222 | procollagen-proline 4-dioxygenase complex(GO:0016222) |
0.1 | 0.2 | GO:0005784 | Sec61 translocon complex(GO:0005784) translocon complex(GO:0071256) |
0.1 | 0.7 | GO:0016471 | vacuolar proton-transporting V-type ATPase complex(GO:0016471) |
0.1 | 0.7 | GO:0016580 | Sin3 complex(GO:0016580) |
0.1 | 0.3 | GO:0031838 | haptoglobin-hemoglobin complex(GO:0031838) |
0.1 | 0.6 | GO:0032839 | dendrite cytoplasm(GO:0032839) |
0.1 | 0.5 | GO:0005671 | Ada2/Gcn5/Ada3 transcription activator complex(GO:0005671) |
0.1 | 0.1 | GO:0030868 | smooth endoplasmic reticulum membrane(GO:0030868) smooth endoplasmic reticulum part(GO:0097425) |
0.1 | 1.0 | GO:0005790 | smooth endoplasmic reticulum(GO:0005790) |
0.1 | 0.6 | GO:0071006 | U2-type catalytic step 1 spliceosome(GO:0071006) |
0.1 | 0.2 | GO:0044322 | endoplasmic reticulum quality control compartment(GO:0044322) |
0.1 | 0.2 | GO:0005658 | alpha DNA polymerase:primase complex(GO:0005658) |
0.1 | 0.7 | GO:0032580 | Golgi cisterna membrane(GO:0032580) |
0.1 | 0.6 | GO:0097225 | sperm midpiece(GO:0097225) |
0.1 | 0.5 | GO:0000176 | nuclear exosome (RNase complex)(GO:0000176) |
0.1 | 0.5 | GO:0046581 | intercellular canaliculus(GO:0046581) |
0.1 | 0.4 | GO:0030991 | intraciliary transport particle A(GO:0030991) |
0.1 | 0.4 | GO:0034704 | calcium channel complex(GO:0034704) |
0.1 | 0.2 | GO:0036396 | MIS complex(GO:0036396) |
0.0 | 0.3 | GO:0042575 | DNA polymerase complex(GO:0042575) |
0.0 | 0.1 | GO:0009331 | glycerol-3-phosphate dehydrogenase complex(GO:0009331) |
0.0 | 0.3 | GO:1904115 | axon cytoplasm(GO:1904115) |
0.0 | 0.1 | GO:0044615 | nuclear pore nuclear basket(GO:0044615) |
0.0 | 0.2 | GO:0019907 | cyclin-dependent protein kinase activating kinase holoenzyme complex(GO:0019907) |
0.0 | 0.3 | GO:0005688 | U6 snRNP(GO:0005688) |
0.0 | 1.1 | GO:0032391 | photoreceptor connecting cilium(GO:0032391) |
0.0 | 0.2 | GO:0005964 | phosphorylase kinase complex(GO:0005964) |
0.0 | 0.6 | GO:0005779 | integral component of peroxisomal membrane(GO:0005779) |
0.0 | 0.5 | GO:0071564 | npBAF complex(GO:0071564) |
0.0 | 0.2 | GO:0002177 | manchette(GO:0002177) |
0.0 | 3.4 | GO:0008021 | synaptic vesicle(GO:0008021) |
0.0 | 1.0 | GO:0031305 | integral component of mitochondrial inner membrane(GO:0031305) |
0.0 | 0.1 | GO:0000811 | GINS complex(GO:0000811) |
0.0 | 0.1 | GO:0071797 | LUBAC complex(GO:0071797) |
0.0 | 0.2 | GO:0070820 | tertiary granule(GO:0070820) |
0.0 | 2.9 | GO:0099572 | postsynaptic density(GO:0014069) postsynaptic specialization(GO:0099572) |
0.0 | 0.3 | GO:0005677 | chromatin silencing complex(GO:0005677) |
0.0 | 0.2 | GO:0034715 | pICln-Sm protein complex(GO:0034715) |
0.0 | 0.1 | GO:0071817 | MMXD complex(GO:0071817) |
0.0 | 2.2 | GO:0005930 | axoneme(GO:0005930) ciliary plasm(GO:0097014) |
0.0 | 0.2 | GO:0030896 | checkpoint clamp complex(GO:0030896) |
0.0 | 1.0 | GO:0005771 | multivesicular body(GO:0005771) |
0.0 | 0.1 | GO:0045009 | melanosome membrane(GO:0033162) chitosome(GO:0045009) |
0.0 | 0.5 | GO:0001741 | XY body(GO:0001741) |
0.0 | 0.2 | GO:0032777 | Piccolo NuA4 histone acetyltransferase complex(GO:0032777) |
0.0 | 0.2 | GO:0000276 | mitochondrial proton-transporting ATP synthase complex, coupling factor F(o)(GO:0000276) |
0.0 | 0.0 | GO:0098794 | postsynapse(GO:0098794) |
0.0 | 0.3 | GO:0005832 | chaperonin-containing T-complex(GO:0005832) |
0.0 | 0.1 | GO:0097413 | Lewy body(GO:0097413) |
0.0 | 0.8 | GO:0031306 | intrinsic component of mitochondrial outer membrane(GO:0031306) |
0.0 | 0.1 | GO:0005593 | FACIT collagen trimer(GO:0005593) |
0.0 | 0.1 | GO:0031265 | CD95 death-inducing signaling complex(GO:0031265) |
0.0 | 0.3 | GO:0070852 | cell body fiber(GO:0070852) |
0.0 | 0.2 | GO:0005851 | eukaryotic translation initiation factor 2B complex(GO:0005851) |
0.0 | 0.0 | GO:0000110 | nucleotide-excision repair factor 1 complex(GO:0000110) |
0.0 | 0.9 | GO:1990391 | DNA repair complex(GO:1990391) |
0.0 | 0.1 | GO:0031258 | lamellipodium membrane(GO:0031258) |
0.0 | 0.1 | GO:0030877 | beta-catenin destruction complex(GO:0030877) |
0.0 | 0.1 | GO:0071203 | WASH complex(GO:0071203) |
0.0 | 0.4 | GO:0000145 | exocyst(GO:0000145) |
0.0 | 1.1 | GO:0005778 | peroxisomal membrane(GO:0005778) microbody membrane(GO:0031903) |
0.0 | 0.2 | GO:0000803 | sex chromosome(GO:0000803) |
0.0 | 2.1 | GO:0030027 | lamellipodium(GO:0030027) |
0.0 | 0.1 | GO:1990712 | HFE-transferrin receptor complex(GO:1990712) |
0.0 | 0.0 | GO:0031209 | SCAR complex(GO:0031209) |
0.0 | 0.1 | GO:0031428 | box C/D snoRNP complex(GO:0031428) |
0.0 | 0.1 | GO:0001652 | granular component(GO:0001652) |
0.0 | 0.1 | GO:0097524 | sperm plasma membrane(GO:0097524) |
0.0 | 0.1 | GO:0033186 | CAF-1 complex(GO:0033186) |
0.0 | 0.6 | GO:0031594 | neuromuscular junction(GO:0031594) |
0.0 | 1.2 | GO:0022627 | cytosolic small ribosomal subunit(GO:0022627) |
0.0 | 0.7 | GO:0031902 | late endosome membrane(GO:0031902) |
0.0 | 0.3 | GO:0000813 | ESCRT I complex(GO:0000813) |
0.0 | 0.1 | GO:0000408 | EKC/KEOPS complex(GO:0000408) |
0.0 | 0.1 | GO:0097209 | epidermal lamellar body(GO:0097209) |
0.0 | 0.1 | GO:0005579 | membrane attack complex(GO:0005579) |
0.0 | 0.0 | GO:0036449 | microtubule minus-end(GO:0036449) |
0.0 | 2.8 | GO:0031225 | anchored component of membrane(GO:0031225) |
0.0 | 0.4 | GO:0031233 | intrinsic component of external side of plasma membrane(GO:0031233) |
0.0 | 0.1 | GO:0045179 | apical cortex(GO:0045179) |
0.0 | 0.2 | GO:0008250 | oligosaccharyltransferase complex(GO:0008250) |
0.0 | 1.0 | GO:0008076 | voltage-gated potassium channel complex(GO:0008076) |
0.0 | 0.1 | GO:0005863 | striated muscle myosin thick filament(GO:0005863) |
0.0 | 0.1 | GO:0035355 | Toll-like receptor 2-Toll-like receptor 6 protein complex(GO:0035355) |
0.0 | 0.1 | GO:0005833 | hemoglobin complex(GO:0005833) |
0.0 | 0.1 | GO:1990316 | ATG1/ULK1 kinase complex(GO:1990316) |
0.0 | 0.3 | GO:0005849 | mRNA cleavage factor complex(GO:0005849) |
0.0 | 0.1 | GO:0043511 | inhibin complex(GO:0043511) |
0.0 | 0.1 | GO:0070822 | Sin3-type complex(GO:0070822) |
0.0 | 1.3 | GO:0071013 | catalytic step 2 spliceosome(GO:0071013) |
0.0 | 0.2 | GO:0071004 | U2-type prespliceosome(GO:0071004) |
0.0 | 0.1 | GO:0000120 | RNA polymerase I transcription factor complex(GO:0000120) |
0.0 | 2.3 | GO:0043209 | myelin sheath(GO:0043209) |
0.0 | 0.0 | GO:0033178 | proton-transporting two-sector ATPase complex, catalytic domain(GO:0033178) |
0.0 | 0.1 | GO:0033185 | dolichol-phosphate-mannose synthase complex(GO:0033185) |
0.0 | 0.1 | GO:0001650 | fibrillar center(GO:0001650) |
0.0 | 0.1 | GO:0034098 | VCP-NPL4-UFD1 AAA ATPase complex(GO:0034098) |
0.0 | 0.6 | GO:0035097 | histone methyltransferase complex(GO:0035097) |
0.0 | 0.1 | GO:0016589 | NURF complex(GO:0016589) |
0.0 | 0.1 | GO:0071204 | histone pre-mRNA 3'end processing complex(GO:0071204) |
0.0 | 0.1 | GO:0005686 | U2 snRNP(GO:0005686) |
0.0 | 0.1 | GO:0042622 | photoreceptor outer segment membrane(GO:0042622) |
0.0 | 0.7 | GO:0030173 | integral component of Golgi membrane(GO:0030173) |
0.0 | 0.0 | GO:0031523 | Myb complex(GO:0031523) |
0.0 | 0.1 | GO:0016272 | prefoldin complex(GO:0016272) |
0.0 | 0.0 | GO:0070937 | CRD-mediated mRNA stability complex(GO:0070937) |
0.0 | 0.1 | GO:0031502 | dolichyl-phosphate-mannose-protein mannosyltransferase complex(GO:0031502) |
0.0 | 0.1 | GO:0005664 | origin recognition complex(GO:0000808) nuclear origin of replication recognition complex(GO:0005664) |
0.0 | 0.1 | GO:0043198 | dendritic shaft(GO:0043198) |
0.0 | 0.0 | GO:0071001 | U4/U6 snRNP(GO:0071001) |
0.0 | 0.1 | GO:0000445 | THO complex(GO:0000347) THO complex part of transcription export complex(GO:0000445) |
0.0 | 0.2 | GO:0035371 | microtubule plus-end(GO:0035371) |
0.0 | 0.1 | GO:0008074 | guanylate cyclase complex, soluble(GO:0008074) |
0.0 | 0.0 | GO:0008282 | ATP-sensitive potassium channel complex(GO:0008282) |
0.0 | 0.0 | GO:0005642 | annulate lamellae(GO:0005642) |
0.0 | 0.0 | GO:0072588 | box H/ACA snoRNP complex(GO:0031429) box H/ACA RNP complex(GO:0072588) |
0.0 | 0.0 | GO:0097422 | tubular endosome(GO:0097422) |
0.0 | 0.0 | GO:0032838 | cell projection cytoplasm(GO:0032838) |
0.0 | 0.0 | GO:0097651 | phosphatidylinositol 3-kinase complex, class I(GO:0097651) |
0.0 | 0.0 | GO:0097386 | glial cell projection(GO:0097386) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
1.4 | 4.2 | GO:0070699 | type II activin receptor binding(GO:0070699) |
1.2 | 3.7 | GO:0004980 | melanocyte-stimulating hormone receptor activity(GO:0004980) |
1.0 | 5.9 | GO:0016934 | extracellular-glycine-gated ion channel activity(GO:0016933) extracellular-glycine-gated chloride channel activity(GO:0016934) |
0.9 | 2.8 | GO:0015440 | peptide-transporting ATPase activity(GO:0015440) |
0.9 | 2.7 | GO:0008310 | single-stranded DNA 3'-5' exodeoxyribonuclease activity(GO:0008310) |
0.8 | 2.3 | GO:0008384 | IkappaB kinase activity(GO:0008384) |
0.8 | 2.3 | GO:0005128 | erythropoietin receptor binding(GO:0005128) |
0.6 | 4.4 | GO:0019992 | diacylglycerol binding(GO:0019992) |
0.6 | 2.5 | GO:0032051 | clathrin light chain binding(GO:0032051) |
0.6 | 2.5 | GO:0042731 | PH domain binding(GO:0042731) |
0.6 | 3.6 | GO:0034190 | apolipoprotein receptor binding(GO:0034190) |
0.6 | 1.8 | GO:0004814 | arginine-tRNA ligase activity(GO:0004814) |
0.6 | 2.9 | GO:0044323 | retinoic acid-responsive element binding(GO:0044323) |
0.5 | 1.5 | GO:0031711 | bradykinin receptor binding(GO:0031711) |
0.5 | 1.5 | GO:0097108 | hedgehog family protein binding(GO:0097108) |
0.5 | 1.4 | GO:0004505 | phenylalanine 4-monooxygenase activity(GO:0004505) |
0.4 | 2.7 | GO:0005168 | neurotrophin TRKA receptor binding(GO:0005168) |
0.4 | 2.2 | GO:0086080 | protein binding involved in heterotypic cell-cell adhesion(GO:0086080) |
0.4 | 2.2 | GO:0098639 | collagen binding involved in cell-matrix adhesion(GO:0098639) |
0.4 | 3.0 | GO:0008494 | translation activator activity(GO:0008494) |
0.4 | 3.3 | GO:0071933 | Arp2/3 complex binding(GO:0071933) |
0.4 | 2.4 | GO:0031685 | adenosine receptor binding(GO:0031685) |
0.4 | 1.5 | GO:0004594 | pantothenate kinase activity(GO:0004594) |
0.4 | 1.1 | GO:0009041 | uridylate kinase activity(GO:0009041) |
0.4 | 1.1 | GO:0004719 | protein-L-isoaspartate (D-aspartate) O-methyltransferase activity(GO:0004719) |
0.4 | 3.9 | GO:0005247 | voltage-gated chloride channel activity(GO:0005247) |
0.3 | 1.0 | GO:0004691 | cAMP-dependent protein kinase activity(GO:0004691) |
0.3 | 1.4 | GO:0045340 | mercury ion binding(GO:0045340) |
0.3 | 2.0 | GO:0031749 | D2 dopamine receptor binding(GO:0031749) |
0.3 | 1.0 | GO:0015222 | serotonin transmembrane transporter activity(GO:0015222) |
0.3 | 0.9 | GO:0005219 | ryanodine-sensitive calcium-release channel activity(GO:0005219) |
0.3 | 0.9 | GO:0035175 | histone kinase activity (H3-S10 specific)(GO:0035175) |
0.3 | 2.5 | GO:0016175 | superoxide-generating NADPH oxidase activity(GO:0016175) |
0.3 | 0.9 | GO:0004965 | G-protein coupled GABA receptor activity(GO:0004965) |
0.3 | 1.7 | GO:0047035 | testosterone dehydrogenase (NAD+) activity(GO:0047035) |
0.3 | 0.8 | GO:0008184 | glycogen phosphorylase activity(GO:0008184) |
0.3 | 3.2 | GO:0001222 | transcription corepressor binding(GO:0001222) |
0.3 | 1.3 | GO:0003958 | NADPH-hemoprotein reductase activity(GO:0003958) |
0.3 | 1.3 | GO:0015379 | potassium:chloride symporter activity(GO:0015379) potassium ion symporter activity(GO:0022820) |
0.3 | 1.6 | GO:0001727 | lipid kinase activity(GO:0001727) |
0.3 | 0.8 | GO:0048101 | calcium- and calmodulin-regulated 3',5'-cyclic-GMP phosphodiesterase activity(GO:0048101) |
0.3 | 0.8 | GO:0097109 | neuroligin family protein binding(GO:0097109) |
0.3 | 0.8 | GO:0005519 | cytoskeletal regulatory protein binding(GO:0005519) |
0.2 | 1.7 | GO:0043140 | ATP-dependent 3'-5' DNA helicase activity(GO:0043140) |
0.2 | 1.2 | GO:0003828 | alpha-N-acetylneuraminate alpha-2,8-sialyltransferase activity(GO:0003828) |
0.2 | 1.6 | GO:0016494 | C-X-C chemokine receptor activity(GO:0016494) |
0.2 | 1.4 | GO:0038036 | sphingosine-1-phosphate receptor activity(GO:0038036) |
0.2 | 0.9 | GO:0015057 | thrombin receptor activity(GO:0015057) |
0.2 | 0.9 | GO:0071253 | connexin binding(GO:0071253) |
0.2 | 0.4 | GO:0005237 | inhibitory extracellular ligand-gated ion channel activity(GO:0005237) |
0.2 | 2.2 | GO:0042577 | lipid phosphatase activity(GO:0042577) |
0.2 | 0.6 | GO:0016842 | amidine-lyase activity(GO:0016842) |
0.2 | 1.5 | GO:0019957 | C-C chemokine binding(GO:0019957) |
0.2 | 0.4 | GO:0008240 | tripeptidyl-peptidase activity(GO:0008240) |
0.2 | 0.8 | GO:0052650 | NADP-retinol dehydrogenase activity(GO:0052650) |
0.2 | 0.6 | GO:0015563 | uptake transmembrane transporter activity(GO:0015563) |
0.2 | 0.6 | GO:0031708 | endothelin B receptor binding(GO:0031708) |
0.2 | 0.2 | GO:0016508 | long-chain-enoyl-CoA hydratase activity(GO:0016508) |
0.2 | 2.6 | GO:0016595 | glutamate binding(GO:0016595) |
0.2 | 1.6 | GO:0004571 | mannosyl-oligosaccharide 1,2-alpha-mannosidase activity(GO:0004571) |
0.2 | 0.6 | GO:0035373 | chondroitin sulfate proteoglycan binding(GO:0035373) |
0.2 | 0.6 | GO:0003976 | UDP-N-acetylglucosamine-lysosomal-enzyme N-acetylglucosaminephosphotransferase activity(GO:0003976) |
0.2 | 0.6 | GO:0016823 | hydrolase activity, acting on acid carbon-carbon bonds(GO:0016822) hydrolase activity, acting on acid carbon-carbon bonds, in ketonic substances(GO:0016823) |
0.2 | 0.8 | GO:0008532 | N-acetyllactosaminide beta-1,3-N-acetylglucosaminyltransferase activity(GO:0008532) |
0.2 | 0.8 | GO:0004897 | ciliary neurotrophic factor receptor activity(GO:0004897) |
0.2 | 0.7 | GO:0019808 | polyamine binding(GO:0019808) |
0.2 | 0.2 | GO:0004583 | dolichyl-phosphate-glucose-glycolipid alpha-glucosyltransferase activity(GO:0004583) |
0.2 | 1.1 | GO:0046974 | histone methyltransferase activity (H3-K9 specific)(GO:0046974) |
0.2 | 1.1 | GO:0016421 | CoA carboxylase activity(GO:0016421) |
0.2 | 1.2 | GO:0016670 | oxidoreductase activity, acting on a sulfur group of donors, oxygen as acceptor(GO:0016670) |
0.2 | 1.8 | GO:0008239 | dipeptidyl-peptidase activity(GO:0008239) |
0.2 | 0.7 | GO:0004792 | thiosulfate sulfurtransferase activity(GO:0004792) |
0.2 | 1.3 | GO:0035612 | AP-2 adaptor complex binding(GO:0035612) |
0.2 | 0.2 | GO:0050656 | 3'-phosphoadenosine 5'-phosphosulfate binding(GO:0050656) |
0.2 | 0.3 | GO:0005167 | neurotrophin TRK receptor binding(GO:0005167) |
0.2 | 0.5 | GO:0004663 | Rab geranylgeranyltransferase activity(GO:0004663) |
0.2 | 0.5 | GO:0071987 | WD40-repeat domain binding(GO:0071987) |
0.2 | 2.5 | GO:0005229 | intracellular calcium activated chloride channel activity(GO:0005229) |
0.2 | 0.5 | GO:0033829 | O-fucosylpeptide 3-beta-N-acetylglucosaminyltransferase activity(GO:0033829) |
0.2 | 0.3 | GO:0008545 | JUN kinase kinase activity(GO:0008545) |
0.2 | 0.8 | GO:0015349 | thyroid hormone transmembrane transporter activity(GO:0015349) |
0.2 | 0.2 | GO:0004924 | oncostatin-M receptor activity(GO:0004924) |
0.2 | 7.2 | GO:0004027 | alcohol sulfotransferase activity(GO:0004027) |
0.2 | 0.5 | GO:0031735 | CCR10 chemokine receptor binding(GO:0031735) |
0.2 | 0.8 | GO:0035174 | histone serine kinase activity(GO:0035174) |
0.2 | 0.8 | GO:0004652 | polynucleotide adenylyltransferase activity(GO:0004652) |
0.2 | 0.5 | GO:0005483 | soluble NSF attachment protein activity(GO:0005483) |
0.2 | 1.5 | GO:0004176 | ATP-dependent peptidase activity(GO:0004176) |
0.1 | 0.7 | GO:0019784 | NEDD8-specific protease activity(GO:0019784) |
0.1 | 5.6 | GO:0048487 | beta-tubulin binding(GO:0048487) |
0.1 | 0.6 | GO:0035184 | histone threonine kinase activity(GO:0035184) |
0.1 | 1.2 | GO:0001091 | RNA polymerase II basal transcription factor binding(GO:0001091) |
0.1 | 0.6 | GO:0004591 | oxoglutarate dehydrogenase (succinyl-transferring) activity(GO:0004591) |
0.1 | 0.6 | GO:0038100 | nodal binding(GO:0038100) |
0.1 | 0.4 | GO:0010484 | H3 histone acetyltransferase activity(GO:0010484) |
0.1 | 1.8 | GO:0008553 | hydrogen-exporting ATPase activity, phosphorylative mechanism(GO:0008553) |
0.1 | 0.4 | GO:0035939 | microsatellite binding(GO:0035939) |
0.1 | 4.0 | GO:0052693 | N-ethylmaleimide reductase activity(GO:0008748) reduced coenzyme F420 dehydrogenase activity(GO:0043738) sulfur oxygenase reductase activity(GO:0043826) malolactic enzyme activity(GO:0043883) epoxyqueuosine reductase activity(GO:0052693) |
0.1 | 0.4 | GO:0000309 | nicotinamide-nucleotide adenylyltransferase activity(GO:0000309) nicotinate-nucleotide adenylyltransferase activity(GO:0004515) |
0.1 | 0.4 | GO:0015173 | aromatic amino acid transmembrane transporter activity(GO:0015173) |
0.1 | 0.8 | GO:0016778 | diphosphotransferase activity(GO:0016778) |
0.1 | 1.4 | GO:0016805 | dipeptidase activity(GO:0016805) |
0.1 | 0.4 | GO:0016149 | translation release factor activity, codon specific(GO:0016149) |
0.1 | 1.3 | GO:0070679 | inositol 1,4,5 trisphosphate binding(GO:0070679) |
0.1 | 0.6 | GO:0050897 | cobalt ion binding(GO:0050897) |
0.1 | 1.0 | GO:0008568 | microtubule-severing ATPase activity(GO:0008568) |
0.1 | 1.6 | GO:0009982 | pseudouridine synthase activity(GO:0009982) |
0.1 | 0.5 | GO:0016286 | small conductance calcium-activated potassium channel activity(GO:0016286) |
0.1 | 1.5 | GO:0015271 | outward rectifier potassium channel activity(GO:0015271) |
0.1 | 0.2 | GO:0004127 | cytidylate kinase activity(GO:0004127) |
0.1 | 0.5 | GO:0016151 | nickel cation binding(GO:0016151) |
0.1 | 10.8 | GO:0005262 | calcium channel activity(GO:0005262) |
0.1 | 1.1 | GO:0001206 | transcriptional repressor activity, RNA polymerase II distal enhancer sequence-specific binding(GO:0001206) |
0.1 | 2.2 | GO:0017075 | syntaxin-1 binding(GO:0017075) |
0.1 | 0.7 | GO:0005391 | sodium:potassium-exchanging ATPase activity(GO:0005391) |
0.1 | 1.2 | GO:0036312 | phosphatidylinositol 3-kinase regulatory subunit binding(GO:0036312) |
0.1 | 0.5 | GO:0050693 | LBD domain binding(GO:0050693) |
0.1 | 0.7 | GO:0004064 | arylesterase activity(GO:0004064) |
0.1 | 0.3 | GO:0000155 | phosphorelay sensor kinase activity(GO:0000155) |
0.1 | 0.3 | GO:0008401 | retinoic acid 4-hydroxylase activity(GO:0008401) |
0.1 | 0.5 | GO:0015265 | urea channel activity(GO:0015265) |
0.1 | 0.9 | GO:0008599 | protein phosphatase type 1 regulator activity(GO:0008599) |
0.1 | 0.3 | GO:0061731 | ribonucleoside-diphosphate reductase activity, thioredoxin disulfide as acceptor(GO:0004748) oxidoreductase activity, acting on CH or CH2 groups, disulfide as acceptor(GO:0016728) ribonucleoside-diphosphate reductase activity(GO:0061731) |
0.1 | 1.7 | GO:0001594 | trace-amine receptor activity(GO:0001594) |
0.1 | 0.3 | GO:0003872 | 6-phosphofructokinase activity(GO:0003872) |
0.1 | 0.3 | GO:0004771 | sterol esterase activity(GO:0004771) |
0.1 | 0.3 | GO:0004477 | methenyltetrahydrofolate cyclohydrolase activity(GO:0004477) methylenetetrahydrofolate dehydrogenase (NAD+) activity(GO:0004487) |
0.1 | 0.3 | GO:0030158 | protein xylosyltransferase activity(GO:0030158) |
0.1 | 0.3 | GO:0030350 | iron-responsive element binding(GO:0030350) |
0.1 | 0.5 | GO:0004468 | lysine N-acetyltransferase activity, acting on acetyl phosphate as donor(GO:0004468) |
0.1 | 0.8 | GO:0008093 | cytoskeletal adaptor activity(GO:0008093) |
0.1 | 0.7 | GO:0030957 | Tat protein binding(GO:0030957) |
0.1 | 0.4 | GO:0008502 | melatonin receptor activity(GO:0008502) |
0.1 | 0.5 | GO:0035925 | mRNA 3'-UTR AU-rich region binding(GO:0035925) |
0.1 | 0.4 | GO:0005030 | neurotrophin receptor activity(GO:0005030) |
0.1 | 0.3 | GO:0003747 | translation release factor activity(GO:0003747) translation termination factor activity(GO:0008079) |
0.1 | 1.1 | GO:0070694 | single-strand selective uracil DNA N-glycosylase activity(GO:0017065) nicotinamide riboside hydrolase activity(GO:0070635) nicotinic acid riboside hydrolase activity(GO:0070636) deoxyribonucleoside 5'-monophosphate N-glycosidase activity(GO:0070694) |
0.1 | 0.3 | GO:0070137 | ubiquitin-like protein-specific endopeptidase activity(GO:0070137) SUMO-specific endopeptidase activity(GO:0070139) |
0.1 | 1.9 | GO:0030215 | semaphorin receptor binding(GO:0030215) |
0.1 | 3.2 | GO:0004364 | glutathione transferase activity(GO:0004364) |
0.1 | 0.7 | GO:0098505 | G-rich strand telomeric DNA binding(GO:0098505) |
0.1 | 1.1 | GO:0033130 | acetylcholine receptor binding(GO:0033130) |
0.1 | 0.9 | GO:0034796 | 3-oxo-2-(2'-pentenyl)cyclopentane-1-octanoic acid CoA ligase activity(GO:0010435) 3-isopropenyl-6-oxoheptanoyl-CoA synthetase activity(GO:0018854) 2-oxo-delta3-4,5,5-trimethylcyclopentenylacetyl-CoA synthetase activity(GO:0018855) benzoyl acetate-CoA ligase activity(GO:0018856) 2,4-dichlorobenzoate-CoA ligase activity(GO:0018857) pivalate-CoA ligase activity(GO:0034783) cyclopropanecarboxylate-CoA ligase activity(GO:0034793) adipate-CoA ligase activity(GO:0034796) citronellyl-CoA ligase activity(GO:0034823) mentha-1,3-dione-CoA ligase activity(GO:0034841) thiophene-2-carboxylate-CoA ligase activity(GO:0034842) 2,4,4-trimethylpentanoate-CoA ligase activity(GO:0034865) cis-2-methyl-5-isopropylhexa-2,5-dienoate-CoA ligase activity(GO:0034942) trans-2-methyl-5-isopropylhexa-2,5-dienoate-CoA ligase activity(GO:0034943) branched-chain acyl-CoA synthetase (ADP-forming) activity(GO:0043759) aryl-CoA synthetase (ADP-forming) activity(GO:0043762) 3-hydroxypropionyl-CoA synthetase activity(GO:0043955) perillic acid:CoA ligase (ADP-forming) activity(GO:0052685) perillic acid:CoA ligase (AMP-forming) activity(GO:0052686) (3R)-3-isopropenyl-6-oxoheptanoate:CoA ligase (ADP-forming) activity(GO:0052687) (3R)-3-isopropenyl-6-oxoheptanoate:CoA ligase (AMP-forming) activity(GO:0052688) pristanate-CoA ligase activity(GO:0070251) malonyl-CoA synthetase activity(GO:0090409) |
0.1 | 2.1 | GO:0030742 | GTP-dependent protein binding(GO:0030742) |
0.1 | 0.9 | GO:0103116 | alpha-D-galactofuranose transporter activity(GO:0103116) |
0.1 | 0.6 | GO:0032050 | clathrin heavy chain binding(GO:0032050) |
0.1 | 0.8 | GO:0016861 | intramolecular oxidoreductase activity, interconverting aldoses and ketoses(GO:0016861) |
0.1 | 4.6 | GO:0035064 | methylated histone binding(GO:0035064) |
0.1 | 0.3 | GO:0003876 | AMP deaminase activity(GO:0003876) adenosine-phosphate deaminase activity(GO:0047623) |
0.1 | 2.1 | GO:0005540 | hyaluronic acid binding(GO:0005540) |
0.1 | 0.8 | GO:0042043 | neurexin family protein binding(GO:0042043) |
0.1 | 0.1 | GO:0038191 | neuropilin binding(GO:0038191) |
0.1 | 1.0 | GO:0046625 | sphingolipid binding(GO:0046625) |
0.1 | 0.9 | GO:0032296 | ribonuclease III activity(GO:0004525) double-stranded RNA-specific ribonuclease activity(GO:0032296) |
0.1 | 4.0 | GO:0043022 | ribosome binding(GO:0043022) |
0.1 | 2.4 | GO:0005104 | fibroblast growth factor receptor binding(GO:0005104) |
0.1 | 0.3 | GO:0042284 | sphingolipid delta-4 desaturase activity(GO:0042284) |
0.1 | 0.5 | GO:0010997 | anaphase-promoting complex binding(GO:0010997) |
0.1 | 0.5 | GO:0004385 | guanylate kinase activity(GO:0004385) |
0.1 | 1.0 | GO:0052669 | cobinamide kinase activity(GO:0008819) phytol kinase activity(GO:0010276) phenol kinase activity(GO:0018720) cyclin-dependent protein kinase activating kinase regulator activity(GO:0019914) inositol tetrakisphosphate 2-kinase activity(GO:0032942) heptose 7-phosphate kinase activity(GO:0033785) aminoglycoside phosphotransferase activity(GO:0034071) eukaryotic elongation factor-2 kinase regulator activity(GO:0042556) eukaryotic elongation factor-2 kinase activator activity(GO:0042557) LPPG:FO 2-phospho-L-lactate transferase activity(GO:0043743) cytidine kinase activity(GO:0043771) glycerate 2-kinase activity(GO:0043798) (S)-lactate 2-kinase activity(GO:0043841) phosphoserine:homoserine phosphotransferase activity(GO:0043899) L-seryl-tRNA(Sec) kinase activity(GO:0043915) phosphocholine transferase activity(GO:0044605) GTP-dependent polynucleotide kinase activity(GO:0051735) farnesol kinase activity(GO:0052668) CTP:2-trans,-6-trans-farnesol kinase activity(GO:0052669) geraniol kinase activity(GO:0052670) geranylgeraniol kinase activity(GO:0052671) CTP:geranylgeraniol kinase activity(GO:0052672) prenol kinase activity(GO:0052673) 1-phosphatidylinositol-5-kinase activity(GO:0052810) 1-phosphatidylinositol-3-phosphate 4-kinase activity(GO:0052811) phosphatidylinositol-3,4-bisphosphate 5-kinase activity(GO:0052812) inositol-3,4,6-trisphosphate 1-kinase activity(GO:0052835) inositol 5-diphosphate pentakisphosphate 5-kinase activity(GO:0052836) inositol diphosphate tetrakisphosphate kinase activity(GO:0052839) |
0.1 | 2.0 | GO:0043395 | heparan sulfate proteoglycan binding(GO:0043395) |
0.1 | 1.5 | GO:0051428 | peptide hormone receptor binding(GO:0051428) |
0.1 | 0.5 | GO:0016907 | G-protein coupled acetylcholine receptor activity(GO:0016907) |
0.1 | 0.3 | GO:0008525 | phosphatidylcholine transporter activity(GO:0008525) |
0.1 | 0.5 | GO:0005161 | platelet-derived growth factor receptor binding(GO:0005161) |
0.1 | 0.1 | GO:0003905 | alkylbase DNA N-glycosylase activity(GO:0003905) DNA-3-methylbase glycosylase activity(GO:0043733) |
0.1 | 0.7 | GO:0043522 | leucine zipper domain binding(GO:0043522) |
0.1 | 0.8 | GO:0030371 | translation repressor activity(GO:0030371) |
0.1 | 0.2 | GO:0004566 | beta-glucuronidase activity(GO:0004566) |
0.1 | 0.4 | GO:0008308 | voltage-gated anion channel activity(GO:0008308) |
0.1 | 0.5 | GO:0004169 | dolichyl-phosphate-mannose-protein mannosyltransferase activity(GO:0004169) |
0.1 | 0.6 | GO:0004908 | interleukin-1 receptor activity(GO:0004908) |
0.1 | 0.2 | GO:0031748 | D1 dopamine receptor binding(GO:0031748) |
0.1 | 0.2 | GO:0097016 | L27 domain binding(GO:0097016) |
0.1 | 0.2 | GO:0016909 | JUN kinase activity(GO:0004705) SAP kinase activity(GO:0016909) |
0.1 | 0.2 | GO:0047961 | glycine N-acyltransferase activity(GO:0047961) |
0.1 | 0.1 | GO:0004809 | tRNA (guanine-N2-)-methyltransferase activity(GO:0004809) |
0.1 | 0.4 | GO:0015185 | gamma-aminobutyric acid transmembrane transporter activity(GO:0015185) |
0.1 | 0.1 | GO:0005119 | smoothened binding(GO:0005119) |
0.1 | 0.2 | GO:0004461 | lactose synthase activity(GO:0004461) |
0.1 | 0.3 | GO:0005384 | manganese ion transmembrane transporter activity(GO:0005384) |
0.1 | 0.5 | GO:0003680 | AT DNA binding(GO:0003680) |
0.1 | 0.1 | GO:0005087 | Ran guanyl-nucleotide exchange factor activity(GO:0005087) |
0.1 | 0.1 | GO:0042296 | ISG15 transferase activity(GO:0042296) |
0.1 | 1.3 | GO:0008266 | poly(U) RNA binding(GO:0008266) |
0.1 | 0.3 | GO:0033142 | progesterone receptor binding(GO:0033142) |
0.1 | 0.4 | GO:0004994 | somatostatin receptor activity(GO:0004994) |
0.1 | 0.3 | GO:0031720 | haptoglobin binding(GO:0031720) |
0.1 | 0.3 | GO:0031727 | CCR2 chemokine receptor binding(GO:0031727) |
0.1 | 1.4 | GO:0070064 | proline-rich region binding(GO:0070064) |
0.1 | 1.5 | GO:0042813 | Wnt-activated receptor activity(GO:0042813) |
0.1 | 0.2 | GO:0000403 | Y-form DNA binding(GO:0000403) |
0.1 | 0.3 | GO:0035727 | lysophosphatidic acid binding(GO:0035727) |
0.1 | 0.3 | GO:0008526 | phosphatidylinositol transporter activity(GO:0008526) |
0.1 | 0.3 | GO:0003917 | DNA topoisomerase type I activity(GO:0003917) |
0.1 | 0.2 | GO:0055100 | adiponectin binding(GO:0055100) |
0.1 | 0.2 | GO:0008427 | calcium-dependent protein kinase inhibitor activity(GO:0008427) |
0.1 | 0.6 | GO:0030676 | Rac guanyl-nucleotide exchange factor activity(GO:0030676) |
0.1 | 1.1 | GO:0022835 | transmitter-gated ion channel activity(GO:0022824) transmitter-gated channel activity(GO:0022835) |
0.1 | 0.2 | GO:0004995 | tachykinin receptor activity(GO:0004995) |
0.1 | 0.2 | GO:0016509 | long-chain-3-hydroxyacyl-CoA dehydrogenase activity(GO:0016509) |
0.1 | 0.6 | GO:0016889 | endodeoxyribonuclease activity, producing 3'-phosphomonoesters(GO:0016889) |
0.1 | 0.1 | GO:0008796 | bis(5'-nucleosyl)-tetraphosphatase activity(GO:0008796) |
0.1 | 0.3 | GO:0043237 | laminin-1 binding(GO:0043237) |
0.1 | 1.2 | GO:0003756 | protein disulfide isomerase activity(GO:0003756) intramolecular oxidoreductase activity, transposing S-S bonds(GO:0016864) |
0.1 | 0.2 | GO:0061629 | RNA polymerase II sequence-specific DNA binding transcription factor binding(GO:0061629) |
0.1 | 0.3 | GO:0004826 | phenylalanine-tRNA ligase activity(GO:0004826) |
0.1 | 0.7 | GO:0004690 | cyclic nucleotide-dependent protein kinase activity(GO:0004690) |
0.1 | 0.4 | GO:0005283 | sodium:amino acid symporter activity(GO:0005283) |
0.1 | 0.3 | GO:0004957 | prostaglandin E receptor activity(GO:0004957) |
0.1 | 0.3 | GO:0008066 | glutamate receptor activity(GO:0008066) |
0.1 | 0.3 | GO:0000268 | peroxisome targeting sequence binding(GO:0000268) |
0.1 | 0.1 | GO:0004673 | protein histidine kinase activity(GO:0004673) |
0.1 | 0.6 | GO:0005172 | vascular endothelial growth factor receptor binding(GO:0005172) |
0.1 | 0.7 | GO:0017154 | semaphorin receptor activity(GO:0017154) |
0.1 | 0.1 | GO:0000293 | ferric-chelate reductase activity(GO:0000293) |
0.1 | 1.0 | GO:0016917 | GABA receptor activity(GO:0016917) |
0.1 | 4.0 | GO:0019208 | phosphatase regulator activity(GO:0019208) |
0.1 | 0.1 | GO:0009374 | biotin binding(GO:0009374) |
0.1 | 0.3 | GO:0004689 | phosphorylase kinase activity(GO:0004689) |
0.1 | 0.2 | GO:0001075 | transcription factor activity, RNA polymerase II core promoter sequence-specific binding involved in preinitiation complex assembly(GO:0001075) |
0.1 | 0.2 | GO:0035529 | NADH pyrophosphatase activity(GO:0035529) |
0.1 | 0.2 | GO:0004656 | procollagen-proline 4-dioxygenase activity(GO:0004656) |
0.1 | 0.2 | GO:0005173 | stem cell factor receptor binding(GO:0005173) |
0.1 | 1.1 | GO:0005537 | mannose binding(GO:0005537) |
0.1 | 0.2 | GO:0031544 | peptidyl-proline 3-dioxygenase activity(GO:0031544) |
0.1 | 0.2 | GO:0015141 | succinate transmembrane transporter activity(GO:0015141) |
0.1 | 0.2 | GO:0015368 | calcium:cation antiporter activity(GO:0015368) |
0.1 | 0.2 | GO:0016744 | transferase activity, transferring aldehyde or ketonic groups(GO:0016744) |
0.1 | 1.6 | GO:0005251 | delayed rectifier potassium channel activity(GO:0005251) |
0.1 | 0.3 | GO:0004653 | polypeptide N-acetylgalactosaminyltransferase activity(GO:0004653) |
0.1 | 0.2 | GO:0070061 | fructose binding(GO:0070061) |
0.1 | 1.4 | GO:0043548 | phosphatidylinositol 3-kinase binding(GO:0043548) |
0.1 | 0.2 | GO:0071532 | ankyrin repeat binding(GO:0071532) |
0.1 | 1.1 | GO:0005246 | calcium channel regulator activity(GO:0005246) |
0.1 | 0.2 | GO:0004035 | alkaline phosphatase activity(GO:0004035) |
0.1 | 0.1 | GO:0000033 | alpha-1,3-mannosyltransferase activity(GO:0000033) |
0.1 | 0.5 | GO:0008179 | adenylate cyclase binding(GO:0008179) |
0.1 | 3.5 | GO:0004896 | cytokine receptor activity(GO:0004896) |
0.1 | 0.3 | GO:1990381 | ubiquitin-specific protease binding(GO:1990381) |
0.1 | 0.3 | GO:0017040 | ceramidase activity(GO:0017040) |
0.1 | 0.7 | GO:0001618 | virus receptor activity(GO:0001618) |
0.1 | 0.2 | GO:0017162 | aryl hydrocarbon receptor binding(GO:0017162) |
0.1 | 1.4 | GO:0019706 | protein-cysteine S-palmitoyltransferase activity(GO:0019706) |
0.1 | 0.2 | GO:0003985 | acetyl-CoA C-acetyltransferase activity(GO:0003985) C-acetyltransferase activity(GO:0016453) |
0.1 | 0.3 | GO:0004111 | creatine kinase activity(GO:0004111) |
0.1 | 1.0 | GO:1905030 | voltage-gated sodium channel activity(GO:0005248) voltage-gated ion channel activity involved in regulation of postsynaptic membrane potential(GO:1905030) |
0.1 | 0.7 | GO:0008191 | metalloendopeptidase inhibitor activity(GO:0008191) |
0.1 | 0.4 | GO:0050291 | sphingosine N-acyltransferase activity(GO:0050291) |
0.1 | 0.1 | GO:0003988 | acetyl-CoA C-acyltransferase activity(GO:0003988) |
0.1 | 0.2 | GO:0008379 | thioredoxin peroxidase activity(GO:0008379) |
0.1 | 0.1 | GO:0004969 | histamine receptor activity(GO:0004969) |
0.1 | 0.3 | GO:0030492 | hemoglobin binding(GO:0030492) |
0.1 | 0.2 | GO:0070087 | chromo shadow domain binding(GO:0070087) |
0.1 | 0.5 | GO:0050321 | tau-protein kinase activity(GO:0050321) |
0.1 | 0.1 | GO:0004886 | 9-cis retinoic acid receptor activity(GO:0004886) |
0.1 | 0.2 | GO:0015272 | ATP-activated inward rectifier potassium channel activity(GO:0015272) |
0.1 | 0.2 | GO:0016802 | adenosylhomocysteinase activity(GO:0004013) trialkylsulfonium hydrolase activity(GO:0016802) |
0.1 | 0.1 | GO:1990189 | peptide-serine-N-acetyltransferase activity(GO:1990189) peptide-glutamate-N-acetyltransferase activity(GO:1990190) |
0.1 | 0.2 | GO:0005347 | ATP transmembrane transporter activity(GO:0005347) |
0.1 | 0.1 | GO:0047023 | androsterone dehydrogenase activity(GO:0047023) |
0.1 | 2.2 | GO:0005546 | phosphatidylinositol-4,5-bisphosphate binding(GO:0005546) |
0.1 | 0.2 | GO:0001884 | pyrimidine nucleoside binding(GO:0001884) |
0.0 | 0.5 | GO:0016713 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, reduced iron-sulfur protein as one donor, and incorporation of one atom of oxygen(GO:0016713) |
0.0 | 0.1 | GO:0004367 | glycerol-3-phosphate dehydrogenase [NAD+] activity(GO:0004367) |
0.0 | 0.6 | GO:0050998 | nitric-oxide synthase binding(GO:0050998) |
0.0 | 0.2 | GO:0032052 | bile acid binding(GO:0032052) |
0.0 | 0.1 | GO:0004645 | phosphorylase activity(GO:0004645) |
0.0 | 0.1 | GO:0005095 | GTPase inhibitor activity(GO:0005095) |
0.0 | 7.3 | GO:0008017 | microtubule binding(GO:0008017) |
0.0 | 0.1 | GO:0030550 | acetylcholine receptor regulator activity(GO:0030548) acetylcholine receptor inhibitor activity(GO:0030550) neurotransmitter receptor regulator activity(GO:0099602) |
0.0 | 0.1 | GO:0070095 | fructose-6-phosphate binding(GO:0070095) |
0.0 | 0.6 | GO:0004622 | lysophospholipase activity(GO:0004622) |
0.0 | 0.1 | GO:0051765 | inositol tetrakisphosphate kinase activity(GO:0051765) |
0.0 | 0.1 | GO:0051021 | GDP-dissociation inhibitor binding(GO:0051021) |
0.0 | 0.3 | GO:0005315 | inorganic phosphate transmembrane transporter activity(GO:0005315) |
0.0 | 0.5 | GO:0010485 | H4 histone acetyltransferase activity(GO:0010485) |
0.0 | 0.1 | GO:0034046 | poly(G) binding(GO:0034046) |
0.0 | 3.2 | GO:0016429 | tRNA (adenine) methyltransferase activity(GO:0016426) tRNA (adenine-N1-)-methyltransferase activity(GO:0016429) |
0.0 | 0.2 | GO:0016423 | tRNA (guanine) methyltransferase activity(GO:0016423) |
0.0 | 0.0 | GO:0031493 | nucleosomal histone binding(GO:0031493) |
0.0 | 0.9 | GO:0008139 | nuclear localization sequence binding(GO:0008139) |
0.0 | 0.1 | GO:0004829 | threonine-tRNA ligase activity(GO:0004829) |
0.0 | 0.0 | GO:0019960 | C-X3-C chemokine binding(GO:0019960) |
0.0 | 0.2 | GO:0004523 | RNA-DNA hybrid ribonuclease activity(GO:0004523) |
0.0 | 0.0 | GO:0003996 | acyl-CoA ligase activity(GO:0003996) |
0.0 | 0.6 | GO:0042608 | T cell receptor binding(GO:0042608) |
0.0 | 0.1 | GO:0004720 | protein-lysine 6-oxidase activity(GO:0004720) |
0.0 | 0.2 | GO:0016714 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, reduced pteridine as one donor, and incorporation of one atom of oxygen(GO:0016714) |
0.0 | 0.1 | GO:0019153 | protein-disulfide reductase (glutathione) activity(GO:0019153) |
0.0 | 0.2 | GO:0008195 | phosphatidate phosphatase activity(GO:0008195) |
0.0 | 0.9 | GO:0001965 | G-protein alpha-subunit binding(GO:0001965) |
0.0 | 0.4 | GO:0016215 | acyl-CoA desaturase activity(GO:0016215) |
0.0 | 1.1 | GO:0052771 | coenzyme F390-A hydrolase activity(GO:0052770) coenzyme F390-G hydrolase activity(GO:0052771) |
0.0 | 0.2 | GO:0019238 | cyclohydrolase activity(GO:0019238) |
0.0 | 0.5 | GO:0015643 | toxic substance binding(GO:0015643) |
0.0 | 0.5 | GO:0032183 | SUMO binding(GO:0032183) |
0.0 | 1.3 | GO:0070888 | E-box binding(GO:0070888) |
0.0 | 0.6 | GO:0005149 | interleukin-1 receptor binding(GO:0005149) |
0.0 | 0.2 | GO:0031681 | G-protein beta-subunit binding(GO:0031681) |
0.0 | 0.1 | GO:0002151 | G-quadruplex RNA binding(GO:0002151) |
0.0 | 0.1 | GO:0004813 | alanine-tRNA ligase activity(GO:0004813) |
0.0 | 0.1 | GO:0050833 | pyruvate transmembrane transporter activity(GO:0050833) |
0.0 | 0.2 | GO:0001972 | retinoic acid binding(GO:0001972) |
0.0 | 0.1 | GO:0016647 | oxidoreductase activity, acting on the CH-NH group of donors, oxygen as acceptor(GO:0016647) |
0.0 | 0.1 | GO:1901612 | cardiolipin binding(GO:1901612) |
0.0 | 1.0 | GO:0016628 | oxidoreductase activity, acting on the CH-CH group of donors, NAD or NADP as acceptor(GO:0016628) |
0.0 | 0.1 | GO:0001537 | N-acetylgalactosamine 4-O-sulfotransferase activity(GO:0001537) |
0.0 | 0.1 | GO:0050501 | hyaluronan synthase activity(GO:0050501) |
0.0 | 1.1 | GO:0005164 | tumor necrosis factor receptor binding(GO:0005164) |
0.0 | 2.2 | GO:0051087 | chaperone binding(GO:0051087) |
0.0 | 0.1 | GO:0030628 | pre-mRNA 3'-splice site binding(GO:0030628) |
0.0 | 0.1 | GO:0004677 | DNA-dependent protein kinase activity(GO:0004677) |
0.0 | 0.1 | GO:0070052 | collagen V binding(GO:0070052) |
0.0 | 0.1 | GO:0004945 | angiotensin type II receptor activity(GO:0004945) |
0.0 | 0.5 | GO:0043015 | gamma-tubulin binding(GO:0043015) |
0.0 | 0.1 | GO:0043199 | sulfate binding(GO:0043199) |
0.0 | 0.6 | GO:0031492 | nucleosomal DNA binding(GO:0031492) |
0.0 | 0.8 | GO:0004181 | metallocarboxypeptidase activity(GO:0004181) |
0.0 | 0.4 | GO:0015386 | sodium:proton antiporter activity(GO:0015385) potassium:proton antiporter activity(GO:0015386) |
0.0 | 0.1 | GO:0036042 | long-chain fatty acyl-CoA binding(GO:0036042) |
0.0 | 0.2 | GO:0035381 | extracellular ATP-gated cation channel activity(GO:0004931) ATP-gated ion channel activity(GO:0035381) |
0.0 | 0.2 | GO:0102337 | fatty acid elongase activity(GO:0009922) 3-oxo-arachidoyl-CoA synthase activity(GO:0102336) 3-oxo-cerotoyl-CoA synthase activity(GO:0102337) 3-oxo-lignoceronyl-CoA synthase activity(GO:0102338) |
0.0 | 0.1 | GO:0016661 | oxidoreductase activity, acting on other nitrogenous compounds as donors(GO:0016661) |
0.0 | 0.1 | GO:0019145 | aminobutyraldehyde dehydrogenase activity(GO:0019145) 4-trimethylammoniobutyraldehyde dehydrogenase activity(GO:0047105) |
0.0 | 0.2 | GO:0001135 | transcription factor activity, RNA polymerase II transcription factor recruiting(GO:0001135) |
0.0 | 0.1 | GO:0005094 | Rho GDP-dissociation inhibitor activity(GO:0005094) |
0.0 | 0.1 | GO:0008948 | malic enzyme activity(GO:0004470) malate dehydrogenase (decarboxylating) (NAD+) activity(GO:0004471) oxaloacetate decarboxylase activity(GO:0008948) |
0.0 | 0.2 | GO:0008190 | eukaryotic initiation factor 4E binding(GO:0008190) |
0.0 | 0.1 | GO:0008199 | ferric iron binding(GO:0008199) |
0.0 | 0.3 | GO:0031690 | adrenergic receptor binding(GO:0031690) |
0.0 | 0.0 | GO:0043823 | mono-butyltin dioxygenase activity(GO:0018586) tri-n-butyltin dioxygenase activity(GO:0018588) di-n-butyltin dioxygenase activity(GO:0018589) methylsilanetriol hydroxylase activity(GO:0018590) methyl tertiary butyl ether 3-monooxygenase activity(GO:0018591) 4-nitrocatechol 4-monooxygenase activity(GO:0018592) 4-chlorophenoxyacetate monooxygenase activity(GO:0018593) tert-butanol 2-monooxygenase activity(GO:0018594) alpha-pinene monooxygenase activity(GO:0018595) dimethylsilanediol hydroxylase activity(GO:0018596) ammonia monooxygenase activity(GO:0018597) hydroxymethylsilanetriol oxidase activity(GO:0018598) 2-hydroxyisobutyrate 3-monooxygenase activity(GO:0018599) alpha-pinene dehydrogenase activity(GO:0018600) bisphenol A hydroxylase B activity(GO:0034559) 2,2-bis(4-hydroxyphenyl)-1-propanol hydroxylase activity(GO:0034562) 9-fluorenone-3,4-dioxygenase activity(GO:0034786) anthracene 9,10-dioxygenase activity(GO:0034816) 2-(methylthio)benzothiazole monooxygenase activity(GO:0034857) 2-hydroxybenzothiazole monooxygenase activity(GO:0034858) benzothiazole monooxygenase activity(GO:0034859) 2,6-dihydroxybenzothiazole monooxygenase activity(GO:0034862) pinacolone 5-monooxygenase activity(GO:0034870) thioacetamide S-oxygenase activity(GO:0034873) thioacetamide S-oxide S-oxygenase activity(GO:0034874) endosulfan monooxygenase I activity(GO:0034888) N-nitrodimethylamine hydroxylase activity(GO:0034893) 4-(1-ethyl-1,4-dimethyl-pentyl)phenol monoxygenase activity(GO:0034897) endosulfan ether monooxygenase activity(GO:0034903) pyrene 4,5-monooxygenase activity(GO:0034925) pyrene 1,2-monooxygenase activity(GO:0034927) 1-hydroxypyrene 6,7-monooxygenase activity(GO:0034928) 1-hydroxypyrene 7,8-monooxygenase activity(GO:0034929) phenylboronic acid monooxygenase activity(GO:0034950) spheroidene monooxygenase activity(GO:0043823) |
0.0 | 0.1 | GO:0005157 | macrophage colony-stimulating factor receptor binding(GO:0005157) |
0.0 | 0.2 | GO:0035368 | selenocysteine insertion sequence binding(GO:0035368) |
0.0 | 0.0 | GO:1901611 | phosphatidylglycerol binding(GO:1901611) |
0.0 | 0.7 | GO:0005385 | zinc ion transmembrane transporter activity(GO:0005385) |
0.0 | 0.1 | GO:0048273 | mitogen-activated protein kinase p38 binding(GO:0048273) |
0.0 | 0.2 | GO:0004565 | beta-galactosidase activity(GO:0004565) |
0.0 | 0.1 | GO:0071723 | lipopeptide binding(GO:0071723) |
0.0 | 0.1 | GO:0004849 | uridine kinase activity(GO:0004849) |
0.0 | 0.0 | GO:0030620 | U2 snRNA binding(GO:0030620) |
0.0 | 0.2 | GO:0097157 | pre-mRNA intronic binding(GO:0097157) |
0.0 | 0.0 | GO:0004517 | nitric-oxide synthase activity(GO:0004517) |
0.0 | 0.1 | GO:0015250 | water channel activity(GO:0015250) |
0.0 | 0.1 | GO:0043919 | 4-hydroxybenzoate octaprenyltransferase activity(GO:0008412) protoheme IX farnesyltransferase activity(GO:0008495) (S)-2,3-di-O-geranylgeranylglyceryl phosphate synthase activity(GO:0043888) cadaverine aminopropyltransferase activity(GO:0043918) agmatine aminopropyltransferase activity(GO:0043919) 1,4-dihydroxy-2-naphthoate octaprenyltransferase activity(GO:0046428) trans-pentaprenyltranstransferase activity(GO:0048045) ATP dimethylallyltransferase activity(GO:0052622) ADP dimethylallyltransferase activity(GO:0052623) |
0.0 | 0.7 | GO:0001105 | RNA polymerase II transcription coactivator activity(GO:0001105) |
0.0 | 0.3 | GO:0035255 | ionotropic glutamate receptor binding(GO:0035255) |
0.0 | 0.1 | GO:0016888 | endodeoxyribonuclease activity, producing 5'-phosphomonoesters(GO:0016888) |
0.0 | 0.3 | GO:0008641 | small protein activating enzyme activity(GO:0008641) |
0.0 | 0.1 | GO:0019767 | IgE receptor activity(GO:0019767) |
0.0 | 0.2 | GO:0102391 | decanoate--CoA ligase activity(GO:0102391) |
0.0 | 0.4 | GO:0001106 | RNA polymerase II transcription corepressor activity(GO:0001106) |
0.0 | 0.1 | GO:0051959 | dynein light intermediate chain binding(GO:0051959) |
0.0 | 0.4 | GO:0005547 | phosphatidylinositol-3,4,5-trisphosphate binding(GO:0005547) |
0.0 | 0.1 | GO:0035673 | oligopeptide transmembrane transporter activity(GO:0035673) |
0.0 | 0.7 | GO:0061631 | ubiquitin conjugating enzyme activity(GO:0061631) |
0.0 | 0.0 | GO:0005001 | transmembrane receptor protein tyrosine phosphatase activity(GO:0005001) |
0.0 | 0.2 | GO:0016303 | 1-phosphatidylinositol-3-kinase activity(GO:0016303) |
0.0 | 1.3 | GO:0004376 | glycolipid mannosyltransferase activity(GO:0004376) |
0.0 | 1.1 | GO:0002039 | p53 binding(GO:0002039) |
0.0 | 0.1 | GO:0034056 | estrogen response element binding(GO:0034056) |
0.0 | 0.7 | GO:0015020 | glucuronosyltransferase activity(GO:0015020) |
0.0 | 0.5 | GO:0070001 | aspartic-type endopeptidase activity(GO:0004190) aspartic-type peptidase activity(GO:0070001) |
0.0 | 0.1 | GO:0046404 | ATP-dependent polydeoxyribonucleotide 5'-hydroxyl-kinase activity(GO:0046404) polydeoxyribonucleotide kinase activity(GO:0051733) |
0.0 | 0.8 | GO:0031593 | polyubiquitin binding(GO:0031593) |
0.0 | 0.0 | GO:0008425 | C-methyltransferase activity(GO:0008169) 2-polyprenyl-6-methoxy-1,4-benzoquinone methyltransferase activity(GO:0008425) quinone cofactor methyltransferase activity(GO:0030580) |
0.0 | 0.9 | GO:0008276 | protein methyltransferase activity(GO:0008276) |
0.0 | 0.2 | GO:0035254 | glutamate receptor binding(GO:0035254) |
0.0 | 0.1 | GO:0008853 | exodeoxyribonuclease III activity(GO:0008853) |
0.0 | 0.1 | GO:0004967 | glucagon receptor activity(GO:0004967) |
0.0 | 0.1 | GO:1904264 | ubiquitin protein ligase activity involved in ERAD pathway(GO:1904264) |
0.0 | 0.1 | GO:0015467 | G-protein activated inward rectifier potassium channel activity(GO:0015467) |
0.0 | 0.0 | GO:0031750 | D3 dopamine receptor binding(GO:0031750) |
0.0 | 0.0 | GO:0004174 | electron-transferring-flavoprotein dehydrogenase activity(GO:0004174) oxidoreductase activity, acting on the CH-NH group of donors, quinone or similar compound as acceptor(GO:0016649) |
0.0 | 0.1 | GO:0032027 | myosin light chain binding(GO:0032027) |
0.0 | 0.1 | GO:0003906 | DNA-(apurinic or apyrimidinic site) lyase activity(GO:0003906) |
0.0 | 0.1 | GO:0003708 | retinoic acid receptor activity(GO:0003708) |
0.0 | 0.0 | GO:0032422 | purine-rich negative regulatory element binding(GO:0032422) |
0.0 | 0.1 | GO:0050309 | glucose-6-phosphatase activity(GO:0004346) sugar-terminal-phosphatase activity(GO:0050309) |
0.0 | 0.2 | GO:0008474 | palmitoyl-(protein) hydrolase activity(GO:0008474) palmitoyl hydrolase activity(GO:0098599) |
0.0 | 0.1 | GO:0004758 | serine C-palmitoyltransferase activity(GO:0004758) |
0.0 | 0.1 | GO:0052834 | inositol monophosphate 1-phosphatase activity(GO:0008934) inositol monophosphate 3-phosphatase activity(GO:0052832) inositol monophosphate 4-phosphatase activity(GO:0052833) inositol monophosphate phosphatase activity(GO:0052834) |
0.0 | 0.1 | GO:0000828 | inositol hexakisphosphate kinase activity(GO:0000828) inositol hexakisphosphate 5-kinase activity(GO:0000832) inositol hexakisphosphate 1-kinase activity(GO:0052723) inositol hexakisphosphate 3-kinase activity(GO:0052724) |
0.0 | 0.2 | GO:0070402 | NADPH binding(GO:0070402) |
0.0 | 0.1 | GO:0016174 | NAD(P)H oxidase activity(GO:0016174) |
0.0 | 0.1 | GO:0051185 | coenzyme transporter activity(GO:0051185) |
0.0 | 0.6 | GO:0005132 | type I interferon receptor binding(GO:0005132) |
0.0 | 0.1 | GO:0047760 | butyrate-CoA ligase activity(GO:0047760) |
0.0 | 0.1 | GO:0008321 | Ral guanyl-nucleotide exchange factor activity(GO:0008321) |
0.0 | 0.0 | GO:0035651 | AP-3 adaptor complex binding(GO:0035651) |
0.0 | 0.1 | GO:0004449 | isocitrate dehydrogenase (NAD+) activity(GO:0004449) |
0.0 | 0.2 | GO:0070628 | proteasome binding(GO:0070628) |
0.0 | 0.1 | GO:1990932 | 5.8S rRNA binding(GO:1990932) |
0.0 | 0.1 | GO:0004165 | dodecenoyl-CoA delta-isomerase activity(GO:0004165) |
0.0 | 0.1 | GO:0000339 | RNA cap binding(GO:0000339) |
0.0 | 0.1 | GO:0004982 | N-formyl peptide receptor activity(GO:0004982) |
0.0 | 0.3 | GO:0008198 | ferrous iron binding(GO:0008198) |
0.0 | 0.0 | GO:0015204 | urea transmembrane transporter activity(GO:0015204) |
0.0 | 0.0 | GO:0035662 | Toll-like receptor 4 binding(GO:0035662) |
0.0 | 0.6 | GO:0051082 | unfolded protein binding(GO:0051082) |
0.0 | 0.0 | GO:0019862 | IgA binding(GO:0019862) |
0.0 | 0.0 | GO:0004312 | fatty acid synthase activity(GO:0004312) |
0.0 | 0.1 | GO:0004383 | guanylate cyclase activity(GO:0004383) |
0.0 | 0.0 | GO:0045545 | syndecan binding(GO:0045545) |
0.0 | 0.0 | GO:0008142 | oxysterol binding(GO:0008142) |
0.0 | 0.0 | GO:0019863 | IgE binding(GO:0019863) |
0.0 | 0.3 | GO:0017110 | nucleoside-diphosphatase activity(GO:0017110) |
0.0 | 0.0 | GO:0047192 | 1-alkylglycerophosphocholine O-acetyltransferase activity(GO:0047192) |
0.0 | 0.0 | GO:0046935 | 1-phosphatidylinositol-3-kinase regulator activity(GO:0046935) |
0.0 | 0.1 | GO:0035198 | miRNA binding(GO:0035198) |
0.0 | 0.0 | GO:0015450 | P-P-bond-hydrolysis-driven protein transmembrane transporter activity(GO:0015450) |
0.0 | 0.1 | GO:0004634 | phosphopyruvate hydratase activity(GO:0004634) |
0.0 | 0.0 | GO:0043515 | kinetochore binding(GO:0043515) |
0.0 | 0.1 | GO:0005000 | vasopressin receptor activity(GO:0005000) |
0.0 | 0.0 | GO:0001602 | pancreatic polypeptide receptor activity(GO:0001602) |
0.0 | 0.3 | GO:0005086 | ARF guanyl-nucleotide exchange factor activity(GO:0005086) |
0.0 | 0.1 | GO:0042910 | xenobiotic transporter activity(GO:0042910) |
0.0 | 0.0 | GO:1990247 | N6-methyladenosine-containing RNA binding(GO:1990247) |
0.0 | 0.0 | GO:0038085 | vascular endothelial growth factor binding(GO:0038085) |
0.0 | 0.0 | GO:0004977 | melanocortin receptor activity(GO:0004977) |
0.0 | 0.7 | GO:0016820 | hydrolase activity, acting on acid anhydrides, catalyzing transmembrane movement of substances(GO:0016820) |
0.0 | 0.3 | GO:0033038 | bitter taste receptor activity(GO:0033038) |
0.0 | 0.2 | GO:0016782 | transferase activity, transferring sulfur-containing groups(GO:0016782) |
0.0 | 0.0 | GO:0001025 | RNA polymerase III transcription factor binding(GO:0001025) |
0.0 | 0.1 | GO:0015166 | polyol transmembrane transporter activity(GO:0015166) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.6 | 0.6 | PID REELIN PATHWAY | Reelin signaling pathway |
0.3 | 1.0 | SA G1 AND S PHASES | Cdk2, 4, and 6 bind cyclin D in G1, while cdk2/cyclin E promotes the G1/S transition. |
0.2 | 0.4 | PID WNT NONCANONICAL PATHWAY | Noncanonical Wnt signaling pathway |
0.2 | 2.8 | PID S1P S1P4 PATHWAY | S1P4 pathway |
0.2 | 2.0 | PID INTEGRIN A4B1 PATHWAY | Alpha4 beta1 integrin signaling events |
0.1 | 3.4 | PID INTEGRIN A9B1 PATHWAY | Alpha9 beta1 integrin signaling events |
0.1 | 0.6 | PID RHOA PATHWAY | RhoA signaling pathway |
0.1 | 3.1 | PID TOLL ENDOGENOUS PATHWAY | Endogenous TLR signaling |
0.1 | 0.1 | PID PDGFRA PATHWAY | PDGFR-alpha signaling pathway |
0.1 | 1.0 | SA G2 AND M PHASES | Cdc25 activates the cdc2/cyclin B complex to induce the G2/M transition. |
0.1 | 0.2 | PID THROMBIN PAR1 PATHWAY | PAR1-mediated thrombin signaling events |
0.1 | 2.2 | PID LIS1 PATHWAY | Lissencephaly gene (LIS1) in neuronal migration and development |
0.1 | 0.6 | PID FOXO PATHWAY | FoxO family signaling |
0.1 | 2.9 | PID EPHRINB REV PATHWAY | Ephrin B reverse signaling |
0.1 | 2.9 | PID INTEGRIN3 PATHWAY | Beta3 integrin cell surface interactions |
0.1 | 0.2 | PID MET PATHWAY | Signaling events mediated by Hepatocyte Growth Factor Receptor (c-Met) |
0.1 | 1.9 | PID RAC1 PATHWAY | RAC1 signaling pathway |
0.1 | 1.5 | PID AURORA A PATHWAY | Aurora A signaling |
0.1 | 0.1 | PID LPA4 PATHWAY | LPA4-mediated signaling events |
0.1 | 0.3 | PID IL5 PATHWAY | IL5-mediated signaling events |
0.1 | 0.4 | PID ECADHERIN KERATINOCYTE PATHWAY | E-cadherin signaling in keratinocytes |
0.1 | 1.9 | ST WNT BETA CATENIN PATHWAY | Wnt/beta-catenin Pathway |
0.1 | 1.6 | PID ARF6 PATHWAY | Arf6 signaling events |
0.0 | 0.0 | SA PROGRAMMED CELL DEATH | Programmed cell death, or apoptosis, eliminates damaged or unneeded cells. |
0.0 | 0.6 | PID SYNDECAN 3 PATHWAY | Syndecan-3-mediated signaling events |
0.0 | 0.2 | PID IL2 PI3K PATHWAY | IL2 signaling events mediated by PI3K |
0.0 | 0.1 | PID NECTIN PATHWAY | Nectin adhesion pathway |
0.0 | 1.5 | PID PLK1 PATHWAY | PLK1 signaling events |
0.0 | 0.8 | PID IL8 CXCR2 PATHWAY | IL8- and CXCR2-mediated signaling events |
0.0 | 1.1 | PID ERBB4 PATHWAY | ErbB4 signaling events |
0.0 | 1.4 | PID ARF6 TRAFFICKING PATHWAY | Arf6 trafficking events |
0.0 | 0.2 | PID P38 GAMMA DELTA PATHWAY | Signaling mediated by p38-gamma and p38-delta |
0.0 | 0.7 | PID ERBB1 INTERNALIZATION PATHWAY | Internalization of ErbB1 |
0.0 | 0.9 | SIG CD40PATHWAYMAP | Genes related to CD40 signaling |
0.0 | 0.4 | PID HDAC CLASSIII PATHWAY | Signaling events mediated by HDAC Class III |
0.0 | 0.8 | PID FOXM1 PATHWAY | FOXM1 transcription factor network |
0.0 | 0.5 | PID DNA PK PATHWAY | DNA-PK pathway in nonhomologous end joining |
0.0 | 0.8 | PID CXCR3 PATHWAY | CXCR3-mediated signaling events |
0.0 | 0.1 | ST GRANULE CELL SURVIVAL PATHWAY | Granule Cell Survival Pathway is a specific case of more general PAC1 Receptor Pathway. |
0.0 | 0.4 | PID PS1 PATHWAY | Presenilin action in Notch and Wnt signaling |
0.0 | 0.5 | PID PI3K PLC TRK PATHWAY | Trk receptor signaling mediated by PI3K and PLC-gamma |
0.0 | 0.5 | PID HEDGEHOG 2PATHWAY | Signaling events mediated by the Hedgehog family |
0.0 | 0.5 | ST P38 MAPK PATHWAY | p38 MAPK Pathway |
0.0 | 1.0 | PID TAP63 PATHWAY | Validated transcriptional targets of TAp63 isoforms |
0.0 | 0.4 | PID ERB GENOMIC PATHWAY | Validated nuclear estrogen receptor beta network |
0.0 | 0.1 | PID AR NONGENOMIC PATHWAY | Nongenotropic Androgen signaling |
0.0 | 0.2 | PID ANGIOPOIETIN RECEPTOR PATHWAY | Angiopoietin receptor Tie2-mediated signaling |
0.0 | 0.3 | ST GA12 PATHWAY | G alpha 12 Pathway |
0.0 | 0.2 | ST JAK STAT PATHWAY | Jak-STAT Pathway |
0.0 | 5.1 | NABA SECRETED FACTORS | Genes encoding secreted soluble factors |
0.0 | 0.1 | PID UPA UPAR PATHWAY | Urokinase-type plasminogen activator (uPA) and uPAR-mediated signaling |
0.0 | 2.4 | NABA ECM AFFILIATED | Genes encoding proteins affiliated structurally or functionally to extracellular matrix proteins |
0.0 | 0.1 | ST IL 13 PATHWAY | Interleukin 13 (IL-13) Pathway |
0.0 | 0.3 | ST MYOCYTE AD PATHWAY | Myocyte Adrenergic Pathway is a specific case of the generalized Adrenergic Pathway. |
0.0 | 0.9 | PID CMYB PATHWAY | C-MYB transcription factor network |
0.0 | 0.1 | SA PTEN PATHWAY | PTEN is a tumor suppressor that dephosphorylates the lipid messenger phosphatidylinositol triphosphate. |
0.0 | 0.6 | PID ERA GENOMIC PATHWAY | Validated nuclear estrogen receptor alpha network |
0.0 | 0.4 | PID CDC42 REG PATHWAY | Regulation of CDC42 activity |
0.0 | 0.1 | PID WNT SIGNALING PATHWAY | Wnt signaling network |
0.0 | 0.0 | PID WNT CANONICAL PATHWAY | Canonical Wnt signaling pathway |
0.0 | 0.0 | PID IL2 STAT5 PATHWAY | IL2 signaling events mediated by STAT5 |
0.0 | 0.0 | ST T CELL SIGNAL TRANSDUCTION | T Cell Signal Transduction |
0.0 | 0.1 | PID GLYPICAN 1PATHWAY | Glypican 1 network |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.5 | 4.3 | REACTOME ROLE OF SECOND MESSENGERS IN NETRIN1 SIGNALING | Genes involved in Role of second messengers in netrin-1 signaling |
0.4 | 7.8 | REACTOME LIGAND GATED ION CHANNEL TRANSPORT | Genes involved in Ligand-gated ion channel transport |
0.2 | 2.4 | REACTOME CYTOSOLIC SULFONATION OF SMALL MOLECULES | Genes involved in Cytosolic sulfonation of small molecules |
0.2 | 2.2 | REACTOME IRAK1 RECRUITS IKK COMPLEX | Genes involved in IRAK1 recruits IKK complex |
0.2 | 3.3 | REACTOME NEPHRIN INTERACTIONS | Genes involved in Nephrin interactions |
0.2 | 2.3 | REACTOME DOWNREGULATION OF ERBB2 ERBB3 SIGNALING | Genes involved in Downregulation of ERBB2:ERBB3 signaling |
0.2 | 2.8 | REACTOME CREB PHOSPHORYLATION THROUGH THE ACTIVATION OF CAMKII | Genes involved in CREB phosphorylation through the activation of CaMKII |
0.2 | 0.8 | REACTOME BINDING AND ENTRY OF HIV VIRION | Genes involved in Binding and entry of HIV virion |
0.2 | 5.3 | REACTOME IL RECEPTOR SHC SIGNALING | Genes involved in Interleukin receptor SHC signaling |
0.2 | 0.2 | REACTOME PRE NOTCH TRANSCRIPTION AND TRANSLATION | Genes involved in Pre-NOTCH Transcription and Translation |
0.2 | 2.2 | REACTOME CELL EXTRACELLULAR MATRIX INTERACTIONS | Genes involved in Cell-extracellular matrix interactions |
0.2 | 0.5 | REACTOME TRANSFERRIN ENDOCYTOSIS AND RECYCLING | Genes involved in Transferrin endocytosis and recycling |
0.2 | 0.2 | REACTOME DNA REPLICATION | Genes involved in DNA Replication |
0.2 | 1.3 | REACTOME SIGNAL REGULATORY PROTEIN SIRP FAMILY INTERACTIONS | Genes involved in Signal regulatory protein (SIRP) family interactions |
0.2 | 1.7 | REACTOME SIGNALING BY FGFR3 MUTANTS | Genes involved in Signaling by FGFR3 mutants |
0.2 | 2.0 | REACTOME CRMPS IN SEMA3A SIGNALING | Genes involved in CRMPs in Sema3A signaling |
0.2 | 0.8 | REACTOME IL 7 SIGNALING | Genes involved in Interleukin-7 signaling |
0.1 | 6.8 | REACTOME CHONDROITIN SULFATE DERMATAN SULFATE METABOLISM | Genes involved in Chondroitin sulfate/dermatan sulfate metabolism |
0.1 | 1.6 | REACTOME SYNTHESIS OF PIPS AT THE EARLY ENDOSOME MEMBRANE | Genes involved in Synthesis of PIPs at the early endosome membrane |
0.1 | 1.2 | REACTOME DSCAM INTERACTIONS | Genes involved in DSCAM interactions |
0.1 | 1.0 | REACTOME VEGF LIGAND RECEPTOR INTERACTIONS | Genes involved in VEGF ligand-receptor interactions |
0.1 | 3.8 | REACTOME LATENT INFECTION OF HOMO SAPIENS WITH MYCOBACTERIUM TUBERCULOSIS | Genes involved in Latent infection of Homo sapiens with Mycobacterium tuberculosis |
0.1 | 0.8 | REACTOME ETHANOL OXIDATION | Genes involved in Ethanol oxidation |
0.1 | 1.6 | REACTOME PROCESSING OF INTRONLESS PRE MRNAS | Genes involved in Processing of Intronless Pre-mRNAs |
0.1 | 2.0 | REACTOME SYNTHESIS SECRETION AND INACTIVATION OF GLP1 | Genes involved in Synthesis, Secretion, and Inactivation of Glucagon-like Peptide-1 (GLP-1) |
0.1 | 2.5 | REACTOME MYOGENESIS | Genes involved in Myogenesis |
0.1 | 0.6 | REACTOME TRAF6 MEDIATED IRF7 ACTIVATION IN TLR7 8 OR 9 SIGNALING | Genes involved in TRAF6 mediated IRF7 activation in TLR7/8 or 9 signaling |
0.1 | 1.7 | REACTOME ABCA TRANSPORTERS IN LIPID HOMEOSTASIS | Genes involved in ABCA transporters in lipid homeostasis |
0.1 | 0.7 | REACTOME TETRAHYDROBIOPTERIN BH4 SYNTHESIS RECYCLING SALVAGE AND REGULATION | Genes involved in Tetrahydrobiopterin (BH4) synthesis, recycling, salvage and regulation |
0.1 | 1.4 | REACTOME SYNTHESIS OF VERY LONG CHAIN FATTY ACYL COAS | Genes involved in Synthesis of very long-chain fatty acyl-CoAs |
0.1 | 0.9 | REACTOME GABA SYNTHESIS RELEASE REUPTAKE AND DEGRADATION | Genes involved in GABA synthesis, release, reuptake and degradation |
0.1 | 4.3 | REACTOME VOLTAGE GATED POTASSIUM CHANNELS | Genes involved in Voltage gated Potassium channels |
0.1 | 1.1 | REACTOME GLYCOGEN BREAKDOWN GLYCOGENOLYSIS | Genes involved in Glycogen breakdown (glycogenolysis) |
0.1 | 1.6 | REACTOME SYNTHESIS AND INTERCONVERSION OF NUCLEOTIDE DI AND TRIPHOSPHATES | Genes involved in Synthesis and interconversion of nucleotide di- and triphosphates |
0.1 | 0.3 | REACTOME PLATELET SENSITIZATION BY LDL | Genes involved in Platelet sensitization by LDL |
0.1 | 0.1 | REACTOME CONVERSION FROM APC C CDC20 TO APC C CDH1 IN LATE ANAPHASE | Genes involved in Conversion from APC/C:Cdc20 to APC/C:Cdh1 in late anaphase |
0.1 | 0.2 | REACTOME PLATELET AGGREGATION PLUG FORMATION | Genes involved in Platelet Aggregation (Plug Formation) |
0.1 | 0.4 | REACTOME ER PHAGOSOME PATHWAY | Genes involved in ER-Phagosome pathway |
0.1 | 1.1 | REACTOME CD28 DEPENDENT PI3K AKT SIGNALING | Genes involved in CD28 dependent PI3K/Akt signaling |
0.1 | 0.7 | REACTOME RECYCLING OF BILE ACIDS AND SALTS | Genes involved in Recycling of bile acids and salts |
0.1 | 0.7 | REACTOME IONOTROPIC ACTIVITY OF KAINATE RECEPTORS | Genes involved in Ionotropic activity of Kainate Receptors |
0.1 | 0.3 | REACTOME OPIOID SIGNALLING | Genes involved in Opioid Signalling |
0.1 | 1.5 | REACTOME DEPOSITION OF NEW CENPA CONTAINING NUCLEOSOMES AT THE CENTROMERE | Genes involved in Deposition of New CENPA-containing Nucleosomes at the Centromere |
0.1 | 0.2 | REACTOME VIRAL MESSENGER RNA SYNTHESIS | Genes involved in Viral Messenger RNA Synthesis |
0.1 | 0.8 | REACTOME DOPAMINE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Dopamine Neurotransmitter Release Cycle |
0.1 | 0.8 | REACTOME CYCLIN A B1 ASSOCIATED EVENTS DURING G2 M TRANSITION | Genes involved in Cyclin A/B1 associated events during G2/M transition |
0.1 | 1.2 | REACTOME INTERACTION BETWEEN L1 AND ANKYRINS | Genes involved in Interaction between L1 and Ankyrins |
0.1 | 0.9 | REACTOME MITOCHONDRIAL FATTY ACID BETA OXIDATION | Genes involved in Mitochondrial Fatty Acid Beta-Oxidation |
0.1 | 0.5 | REACTOME PROLACTIN RECEPTOR SIGNALING | Genes involved in Prolactin receptor signaling |
0.1 | 0.5 | REACTOME COSTIMULATION BY THE CD28 FAMILY | Genes involved in Costimulation by the CD28 family |
0.1 | 0.5 | REACTOME RECRUITMENT OF NUMA TO MITOTIC CENTROSOMES | Genes involved in Recruitment of NuMA to mitotic centrosomes |
0.1 | 0.7 | REACTOME CASPASE MEDIATED CLEAVAGE OF CYTOSKELETAL PROTEINS | Genes involved in Caspase-mediated cleavage of cytoskeletal proteins |
0.1 | 1.3 | REACTOME LYSOSOME VESICLE BIOGENESIS | Genes involved in Lysosome Vesicle Biogenesis |
0.1 | 0.7 | REACTOME HORMONE SENSITIVE LIPASE HSL MEDIATED TRIACYLGLYCEROL HYDROLYSIS | Genes involved in Hormone-sensitive lipase (HSL)-mediated triacylglycerol hydrolysis |
0.1 | 0.4 | REACTOME INTEGRATION OF PROVIRUS | Genes involved in Integration of provirus |
0.1 | 0.6 | REACTOME G2 M DNA DAMAGE CHECKPOINT | Genes involved in G2/M DNA damage checkpoint |
0.1 | 1.4 | REACTOME PREFOLDIN MEDIATED TRANSFER OF SUBSTRATE TO CCT TRIC | Genes involved in Prefoldin mediated transfer of substrate to CCT/TriC |
0.1 | 0.6 | REACTOME FORMATION OF ATP BY CHEMIOSMOTIC COUPLING | Genes involved in Formation of ATP by chemiosmotic coupling |
0.1 | 0.9 | REACTOME DESTABILIZATION OF MRNA BY TRISTETRAPROLIN TTP | Genes involved in Destabilization of mRNA by Tristetraprolin (TTP) |
0.1 | 0.7 | REACTOME CLASS C 3 METABOTROPIC GLUTAMATE PHEROMONE RECEPTORS | Genes involved in Class C/3 (Metabotropic glutamate/pheromone receptors) |
0.1 | 0.8 | REACTOME INSULIN SYNTHESIS AND PROCESSING | Genes involved in Insulin Synthesis and Processing |
0.0 | 0.9 | REACTOME KERATAN SULFATE BIOSYNTHESIS | Genes involved in Keratan sulfate biosynthesis |
0.0 | 1.3 | REACTOME STEROID HORMONES | Genes involved in Steroid hormones |
0.0 | 1.6 | REACTOME TRANSPORT TO THE GOLGI AND SUBSEQUENT MODIFICATION | Genes involved in Transport to the Golgi and subsequent modification |
0.0 | 0.4 | REACTOME TIE2 SIGNALING | Genes involved in Tie2 Signaling |
0.0 | 0.7 | REACTOME ASSOCIATION OF TRIC CCT WITH TARGET PROTEINS DURING BIOSYNTHESIS | Genes involved in Association of TriC/CCT with target proteins during biosynthesis |
0.0 | 0.5 | REACTOME CALNEXIN CALRETICULIN CYCLE | Genes involved in Calnexin/calreticulin cycle |
0.0 | 0.4 | REACTOME ROLE OF DCC IN REGULATING APOPTOSIS | Genes involved in Role of DCC in regulating apoptosis |
0.0 | 0.7 | REACTOME METABOLISM OF PORPHYRINS | Genes involved in Metabolism of porphyrins |
0.0 | 0.8 | REACTOME SIGNALING BY HIPPO | Genes involved in Signaling by Hippo |
0.0 | 0.6 | REACTOME THE ROLE OF NEF IN HIV1 REPLICATION AND DISEASE PATHOGENESIS | Genes involved in The role of Nef in HIV-1 replication and disease pathogenesis |
0.0 | 0.2 | REACTOME IRON UPTAKE AND TRANSPORT | Genes involved in Iron uptake and transport |
0.0 | 0.1 | REACTOME REGULATION OF GLUCOKINASE BY GLUCOKINASE REGULATORY PROTEIN | Genes involved in Regulation of Glucokinase by Glucokinase Regulatory Protein |
0.0 | 0.3 | REACTOME PRE NOTCH PROCESSING IN GOLGI | Genes involved in Pre-NOTCH Processing in Golgi |
0.0 | 0.0 | REACTOME KERATAN SULFATE KERATIN METABOLISM | Genes involved in Keratan sulfate/keratin metabolism |
0.0 | 0.1 | REACTOME ADVANCED GLYCOSYLATION ENDPRODUCT RECEPTOR SIGNALING | Genes involved in Advanced glycosylation endproduct receptor signaling |
0.0 | 0.8 | REACTOME TRAFFICKING OF AMPA RECEPTORS | Genes involved in Trafficking of AMPA receptors |
0.0 | 0.5 | REACTOME HIGHLY CALCIUM PERMEABLE POSTSYNAPTIC NICOTINIC ACETYLCHOLINE RECEPTORS | Genes involved in Highly calcium permeable postsynaptic nicotinic acetylcholine receptors |
0.0 | 1.9 | REACTOME METABOLISM OF VITAMINS AND COFACTORS | Genes involved in Metabolism of vitamins and cofactors |
0.0 | 0.8 | REACTOME KINESINS | Genes involved in Kinesins |
0.0 | 0.7 | REACTOME BRANCHED CHAIN AMINO ACID CATABOLISM | Genes involved in Branched-chain amino acid catabolism |
0.0 | 0.2 | REACTOME CD28 CO STIMULATION | Genes involved in CD28 co-stimulation |
0.0 | 5.5 | REACTOME PEPTIDE LIGAND BINDING RECEPTORS | Genes involved in Peptide ligand-binding receptors |
0.0 | 0.2 | REACTOME PEPTIDE HORMONE BIOSYNTHESIS | Genes involved in Peptide hormone biosynthesis |
0.0 | 1.0 | REACTOME SPHINGOLIPID DE NOVO BIOSYNTHESIS | Genes involved in Sphingolipid de novo biosynthesis |
0.0 | 0.5 | REACTOME PLATELET CALCIUM HOMEOSTASIS | Genes involved in Platelet calcium homeostasis |
0.0 | 0.8 | REACTOME ENDOSOMAL SORTING COMPLEX REQUIRED FOR TRANSPORT ESCRT | Genes involved in Endosomal Sorting Complex Required For Transport (ESCRT) |
0.0 | 0.4 | REACTOME JNK C JUN KINASES PHOSPHORYLATION AND ACTIVATION MEDIATED BY ACTIVATED HUMAN TAK1 | Genes involved in JNK (c-Jun kinases) phosphorylation and activation mediated by activated human TAK1 |
0.0 | 0.4 | REACTOME HYALURONAN METABOLISM | Genes involved in Hyaluronan metabolism |
0.0 | 0.3 | REACTOME PROSTANOID LIGAND RECEPTORS | Genes involved in Prostanoid ligand receptors |
0.0 | 0.1 | REACTOME SYNTHESIS OF PC | Genes involved in Synthesis of PC |
0.0 | 0.4 | REACTOME ZINC TRANSPORTERS | Genes involved in Zinc transporters |
0.0 | 0.1 | REACTOME SIGNALING BY ACTIVATED POINT MUTANTS OF FGFR1 | Genes involved in Signaling by activated point mutants of FGFR1 |
0.0 | 0.4 | REACTOME PYRIMIDINE CATABOLISM | Genes involved in Pyrimidine catabolism |
0.0 | 0.4 | REACTOME RNA POL III CHAIN ELONGATION | Genes involved in RNA Polymerase III Chain Elongation |
0.0 | 0.0 | REACTOME MRNA DECAY BY 3 TO 5 EXORIBONUCLEASE | Genes involved in mRNA Decay by 3' to 5' Exoribonuclease |
0.0 | 0.4 | REACTOME GAP JUNCTION ASSEMBLY | Genes involved in Gap junction assembly |
0.0 | 0.3 | REACTOME MRNA DECAY BY 5 TO 3 EXORIBONUCLEASE | Genes involved in mRNA Decay by 5' to 3' Exoribonuclease |
0.0 | 0.3 | REACTOME UNWINDING OF DNA | Genes involved in Unwinding of DNA |
0.0 | 0.2 | REACTOME METAL ION SLC TRANSPORTERS | Genes involved in Metal ion SLC transporters |
0.0 | 0.5 | REACTOME SIGNALING BY ROBO RECEPTOR | Genes involved in Signaling by Robo receptor |
0.0 | 0.3 | REACTOME RESOLUTION OF AP SITES VIA THE SINGLE NUCLEOTIDE REPLACEMENT PATHWAY | Genes involved in Resolution of AP sites via the single-nucleotide replacement pathway |
0.0 | 0.7 | REACTOME ION TRANSPORT BY P TYPE ATPASES | Genes involved in Ion transport by P-type ATPases |
0.0 | 0.3 | REACTOME ANTIGEN ACTIVATES B CELL RECEPTOR LEADING TO GENERATION OF SECOND MESSENGERS | Genes involved in Antigen Activates B Cell Receptor Leading to Generation of Second Messengers |
0.0 | 0.3 | REACTOME FORMATION OF TRANSCRIPTION COUPLED NER TC NER REPAIR COMPLEX | Genes involved in Formation of transcription-coupled NER (TC-NER) repair complex |
0.0 | 0.3 | REACTOME NOTCH HLH TRANSCRIPTION PATHWAY | Genes involved in Notch-HLH transcription pathway |
0.0 | 0.4 | REACTOME MICRORNA MIRNA BIOGENESIS | Genes involved in MicroRNA (miRNA) Biogenesis |
0.0 | 0.1 | REACTOME RNA POL I PROMOTER OPENING | Genes involved in RNA Polymerase I Promoter Opening |
0.0 | 0.6 | REACTOME AMINE LIGAND BINDING RECEPTORS | Genes involved in Amine ligand-binding receptors |
0.0 | 0.3 | REACTOME G ALPHA S SIGNALLING EVENTS | Genes involved in G alpha (s) signalling events |
0.0 | 0.1 | REACTOME HORMONE LIGAND BINDING RECEPTORS | Genes involved in Hormone ligand-binding receptors |
0.0 | 0.0 | REACTOME BETA DEFENSINS | Genes involved in Beta defensins |
0.0 | 0.2 | REACTOME METABOLISM OF POLYAMINES | Genes involved in Metabolism of polyamines |
0.0 | 0.2 | REACTOME REGULATION OF HYPOXIA INDUCIBLE FACTOR HIF BY OXYGEN | Genes involved in Regulation of Hypoxia-inducible Factor (HIF) by Oxygen |
0.0 | 0.2 | REACTOME ACTIVATION OF IRF3 IRF7 MEDIATED BY TBK1 IKK EPSILON | Genes involved in Activation of IRF3/IRF7 mediated by TBK1/IKK epsilon |
0.0 | 0.2 | REACTOME TANDEM PORE DOMAIN POTASSIUM CHANNELS | Genes involved in Tandem pore domain potassium channels |
0.0 | 0.3 | REACTOME CHOLESTEROL BIOSYNTHESIS | Genes involved in Cholesterol biosynthesis |
0.0 | 0.3 | REACTOME IMMUNOREGULATORY INTERACTIONS BETWEEN A LYMPHOID AND A NON LYMPHOID CELL | Genes involved in Immunoregulatory interactions between a Lymphoid and a non-Lymphoid cell |
0.0 | 0.6 | REACTOME INTERFERON ALPHA BETA SIGNALING | Genes involved in Interferon alpha/beta signaling |
0.0 | 0.9 | REACTOME INTEGRIN CELL SURFACE INTERACTIONS | Genes involved in Integrin cell surface interactions |
0.0 | 0.1 | REACTOME REGULATION OF KIT SIGNALING | Genes involved in Regulation of KIT signaling |
0.0 | 0.0 | REACTOME G ALPHA Z SIGNALLING EVENTS | Genes involved in G alpha (z) signalling events |
0.0 | 0.0 | REACTOME REGULATORY RNA PATHWAYS | Genes involved in Regulatory RNA pathways |
0.0 | 0.0 | REACTOME SYNTHESIS SECRETION AND INACTIVATION OF GIP | Genes involved in Synthesis, Secretion, and Inactivation of Glucose-dependent Insulinotropic Polypeptide (GIP) |
0.0 | 0.1 | REACTOME POST CHAPERONIN TUBULIN FOLDING PATHWAY | Genes involved in Post-chaperonin tubulin folding pathway |
0.0 | 0.0 | REACTOME IKK COMPLEX RECRUITMENT MEDIATED BY RIP1 | Genes involved in IKK complex recruitment mediated by RIP1 |