Gene Symbol | Gene ID | Gene Info |
---|---|---|
Pou2f2
|
ENSMUSG00000008496.12 | POU domain, class 2, transcription factor 2 |
Pou3f1
|
ENSMUSG00000090125.2 | POU domain, class 3, transcription factor 1 |
CRE | Gene | Distance | Association probability | Pearson corr. coef. | P-value | Plot |
---|---|---|---|---|---|---|
Pou2f2 | chr7_25132999_25133993 | 984 | 0.406354 | 0.75 | 6.7e-11 | Click! |
Pou2f2 | chr7_25180086_25180248 | 441 | 0.694399 | 0.70 | 3.4e-09 | Click! |
Pou2f2 | chr7_25134491_25134642 | 2054 | 0.202896 | 0.65 | 6.8e-08 | Click! |
Pou2f2 | chr7_25179847_25180034 | 214 | 0.875012 | 0.64 | 1.3e-07 | Click! |
Pou2f2 | chr7_25179319_25179519 | 307 | 0.805933 | 0.63 | 2.4e-07 | Click! |
Pou3f1 | chr4_124615511_124615662 | 41221 | 0.092429 | 0.44 | 6.9e-04 | Click! |
Pou3f1 | chr4_124624105_124624256 | 32627 | 0.102331 | 0.39 | 3.0e-03 | Click! |
Pou3f1 | chr4_124645361_124645557 | 11348 | 0.117938 | -0.39 | 3.4e-03 | Click! |
Pou3f1 | chr4_124653178_124653350 | 3543 | 0.141840 | 0.32 | 1.8e-02 | Click! |
Pou3f1 | chr4_124645104_124645283 | 11614 | 0.117805 | -0.27 | 4.5e-02 | Click! |
Move your cursor over a bar to see sample name and corresponding Z-value.
Cis Regulatory Element (CRE) | Target Score | Top associated gene | Gene Info | Distance of CRE to TSS | CRE/Gene association probability |
---|---|---|---|---|---|
chr3_88222179_88222410 | 50.86 |
Gm3764 |
predicted gene 3764 |
370 |
0.69 |
chr4_8098087_8098399 | 35.15 |
Gm11800 |
predicted gene 11800 |
20377 |
0.24 |
chr14_119233639_119233803 | 32.33 |
Gm6087 |
predicted gene 6087 |
44703 |
0.17 |
chr5_81359614_81359973 | 32.27 |
Adgrl3 |
adhesion G protein-coupled receptor L3 |
49768 |
0.18 |
chr3_21672509_21672900 | 31.74 |
Gm17935 |
predicted gene, 17935 |
24317 |
0.19 |
chr9_103146716_103147058 | 29.60 |
Gm37166 |
predicted gene, 37166 |
26519 |
0.13 |
chr13_85067295_85067464 | 29.22 |
Gm47745 |
predicted gene, 47745 |
26956 |
0.17 |
chr13_83749525_83749738 | 28.48 |
C130071C03Rik |
RIKEN cDNA C130071C03 gene |
10768 |
0.12 |
chrX_11099508_11099676 | 27.66 |
Gm14485 |
predicted gene 14485 |
78585 |
0.09 |
chr1_194721369_194721563 | 25.41 |
2900035J10Rik |
RIKEN cDNA 2900035J10 gene |
11241 |
0.17 |
chrX_71700854_71701085 | 25.38 |
Gm14723 |
predicted gene 14723 |
26688 |
0.18 |
chr4_41470681_41471126 | 25.25 |
Nudt2 |
nudix (nucleoside diphosphate linked moiety X)-type motif 2 |
5752 |
0.12 |
chr13_84905713_84906063 | 24.63 |
Gm4059 |
predicted gene 4059 |
68429 |
0.12 |
chr8_100516007_100516194 | 24.41 |
Gm45296 |
predicted gene 45296 |
77342 |
0.12 |
chr18_23394845_23395028 | 24.27 |
Dtna |
dystrobrevin alpha |
20199 |
0.27 |
chr13_84906124_84906297 | 23.84 |
Gm4059 |
predicted gene 4059 |
68107 |
0.12 |
chr15_13455546_13455886 | 23.16 |
Gm4940 |
predicted gene 4940 |
3400 |
0.28 |
chr5_42523495_42523716 | 21.41 |
Gm7181 |
predicted gene 7181 |
23191 |
0.28 |
chr4_30855756_30855939 | 21.16 |
Gm11920 |
predicted gene 11920 |
153312 |
0.04 |
chr1_168908656_168908844 | 20.86 |
Mir6354 |
microRNA 6354 |
110339 |
0.07 |
chr1_165934961_165935308 | 20.81 |
Pou2f1 |
POU domain, class 2, transcription factor 1 |
123 |
0.95 |
chr13_85067648_85067905 | 20.52 |
Gm47745 |
predicted gene, 47745 |
26559 |
0.17 |
chr1_84961769_84962201 | 20.27 |
AC167036.1 |
novel protein |
3003 |
0.17 |
chr3_70223539_70223690 | 20.22 |
Gm23477 |
predicted gene, 23477 |
5260 |
0.31 |
chr7_73644446_73644645 | 20.12 |
Gm26176 |
predicted gene, 26176 |
1544 |
0.23 |
chr8_109252441_109252632 | 20.12 |
D030068K23Rik |
RIKEN cDNA D030068K23 gene |
2670 |
0.38 |
chr13_69260577_69260855 | 20.03 |
Gm4812 |
predicted gene 4812 |
84939 |
0.08 |
chrX_10010308_10010474 | 19.89 |
Gm5754 |
predicted gene 5754 |
1397 |
0.54 |
chr3_40070102_40070729 | 19.89 |
Gm42785 |
predicted gene 42785 |
246838 |
0.02 |
chr3_88204711_88205055 | 19.81 |
AI849053 |
expressed sequence AI849053 |
288 |
0.76 |
chr12_8620196_8620377 | 19.64 |
Slc7a15 |
solute carrier family 7 (cationic amino acid transporter, y+ system), member 15 |
21220 |
0.19 |
chr7_131465403_131465590 | 19.60 |
Gm44984 |
predicted gene 44984 |
7371 |
0.11 |
chr11_32158171_32158538 | 19.19 |
Gm12109 |
predicted gene 12109 |
26651 |
0.12 |
chr6_64175362_64175513 | 19.01 |
Gm20144 |
predicted gene, 20144 |
83298 |
0.1 |
chr5_77838512_77838806 | 19.01 |
Gm42673 |
predicted gene 42673 |
70801 |
0.12 |
chr1_159413392_159413771 | 18.12 |
Gm37757 |
predicted gene, 37757 |
15379 |
0.17 |
chr12_83194961_83195173 | 17.89 |
1700030I03Rik |
RIKEN cDNA 1700030I03 gene |
72853 |
0.09 |
chr13_109053762_109053920 | 17.79 |
Pde4d |
phosphodiesterase 4D, cAMP specific |
62395 |
0.16 |
chr14_99749385_99749857 | 17.75 |
Gm22970 |
predicted gene, 22970 |
24187 |
0.19 |
chr12_86942170_86942348 | 17.71 |
Cipc |
CLOCK interacting protein, circadian |
4784 |
0.19 |
chr1_194208308_194208510 | 17.53 |
4930503O07Rik |
RIKEN cDNA 4930503O07 gene |
14350 |
0.3 |
chr11_39899731_39899935 | 17.50 |
Gm24192 |
predicted gene, 24192 |
69177 |
0.13 |
chr5_111519459_111519777 | 17.43 |
C130026L21Rik |
RIKEN cDNA C130026L21 gene |
61804 |
0.1 |
chr7_37650684_37650835 | 17.33 |
Gm44883 |
predicted gene 44883 |
11879 |
0.21 |
chr1_89739598_89739966 | 17.20 |
Agap1 |
ArfGAP with GTPase domain, ankyrin repeat and PH domain 1 |
49381 |
0.14 |
chr3_24938514_24938665 | 17.03 |
Gm42774 |
predicted gene 42774 |
69116 |
0.13 |
chr8_78556826_78557206 | 16.89 |
Slc10a7 |
solute carrier family 10 (sodium/bile acid cotransporter family), member 7 |
20735 |
0.18 |
chr5_111724741_111725058 | 16.88 |
Gm26897 |
predicted gene, 26897 |
9025 |
0.18 |
chr5_5135037_5135401 | 16.83 |
Gm43623 |
predicted gene 43623 |
4888 |
0.21 |
chr16_69469628_69469791 | 16.44 |
4930428D20Rik |
RIKEN cDNA 4930428D20 gene |
330672 |
0.01 |
chr8_45558513_45558673 | 16.31 |
Gm45458 |
predicted gene 45458 |
18478 |
0.16 |
chr18_17612695_17613098 | 16.21 |
4930545E07Rik |
RIKEN cDNA 4930545E07 gene |
31906 |
0.22 |
chr17_56552225_56552791 | 16.20 |
Gm20219 |
predicted gene, 20219 |
1879 |
0.23 |
chr12_3371975_3372463 | 16.19 |
Gm48511 |
predicted gene, 48511 |
3790 |
0.15 |
chr6_103944408_103944702 | 16.07 |
Gm21054 |
predicted gene, 21054 |
20084 |
0.27 |
chr9_16484808_16485485 | 16.07 |
Fat3 |
FAT atypical cadherin 3 |
16139 |
0.27 |
chr11_66846140_66846315 | 16.05 |
Pirt |
phosphoinositide-interacting regulator of transient receptor potential channels |
65754 |
0.11 |
chr4_85256505_85256861 | 16.05 |
Gm12413 |
predicted gene 12413 |
10921 |
0.25 |
chr2_75246495_75246656 | 15.71 |
2600014E21Rik |
RIKEN cDNA 2600014E21 gene |
1825 |
0.34 |
chr7_101160444_101160595 | 15.62 |
Gm6341 |
predicted pseudogene 6341 |
5464 |
0.19 |
chr1_164988310_164988493 | 15.59 |
1700029M03Rik |
RIKEN cDNA 1700029M03 gene |
27478 |
0.14 |
chr18_73096635_73097020 | 15.54 |
Gm31908 |
predicted gene, 31908 |
175737 |
0.03 |
chr13_18856177_18856400 | 15.53 |
Vps41 |
VPS41 HOPS complex subunit |
11425 |
0.23 |
chr9_42383096_42383258 | 15.50 |
Gm47629 |
predicted gene, 47629 |
2685 |
0.24 |
chr18_67497634_67497785 | 15.48 |
Spire1 |
spire type actin nucleation factor 1 |
20 |
0.97 |
chr14_45643535_45643778 | 15.45 |
Ddhd1 |
DDHD domain containing 1 |
11293 |
0.11 |
chr12_50709333_50709681 | 15.44 |
Gm48779 |
predicted gene, 48779 |
43590 |
0.18 |
chr13_85066695_85066901 | 15.43 |
Gm47745 |
predicted gene, 47745 |
27537 |
0.17 |
chrX_10008023_10008174 | 15.36 |
Gm5754 |
predicted gene 5754 |
3690 |
0.32 |
chr7_30785794_30786000 | 15.36 |
Krtdap |
keratinocyte differentiation associated protein |
1999 |
0.15 |
chr3_123810123_123810442 | 15.36 |
Gm15400 |
predicted gene 15400 |
48955 |
0.14 |
chr9_28255632_28255836 | 15.30 |
Gm44316 |
predicted gene, 44316 |
37014 |
0.2 |
chr2_152050523_152051049 | 15.29 |
AA387200 |
expressed sequence AA387200 |
26022 |
0.12 |
chr8_50708554_50708823 | 15.26 |
Gm23986 |
predicted gene, 23986 |
145447 |
0.04 |
chr9_45434245_45434428 | 15.21 |
4833428L15Rik |
RIKEN cDNA 4833428L15 gene |
2606 |
0.19 |
chr5_112041311_112041693 | 15.07 |
Gm42488 |
predicted gene 42488 |
97267 |
0.07 |
chr8_73142666_73143044 | 15.05 |
Gm22532 |
predicted gene, 22532 |
32403 |
0.19 |
chr3_4798553_4798746 | 15.04 |
1110015O18Rik |
RIKEN cDNA 1110015O18 gene |
59 |
0.98 |
chr11_77925941_77926251 | 15.01 |
Gm11190 |
predicted gene 11190 |
3192 |
0.17 |
chr5_148624784_148624935 | 15.01 |
Gm29815 |
predicted gene, 29815 |
11215 |
0.2 |
chr2_161196830_161196992 | 14.99 |
Gm14242 |
predicted gene 14242 |
10369 |
0.18 |
chr15_86673544_86673695 | 14.96 |
Gm49464 |
predicted gene, 49464 |
30672 |
0.19 |
chr7_69217998_69218568 | 14.91 |
Gm5342 |
predicted gene 5342 |
8399 |
0.26 |
chr19_6426731_6426911 | 14.84 |
Nrxn2 |
neurexin II |
1102 |
0.32 |
chr17_4990901_4991063 | 14.80 |
Arid1b |
AT rich interactive domain 1B (SWI-like) |
3350 |
0.3 |
chr2_132751876_132752082 | 14.78 |
Chgb |
chromogranin B |
29299 |
0.1 |
chr4_82303507_82303658 | 14.63 |
n-R5s188 |
nuclear encoded rRNA 5S 188 |
135828 |
0.05 |
chr1_162773744_162773911 | 14.54 |
Prrc2c |
proline-rich coiled-coil 2C |
33271 |
0.14 |
chr12_106175275_106175426 | 14.46 |
Gm47646 |
predicted gene, 47646 |
29950 |
0.17 |
chr13_38879039_38879405 | 14.33 |
Gm46392 |
predicted gene, 46392 |
17492 |
0.17 |
chr4_46931761_46931912 | 14.27 |
Gabbr2 |
gamma-aminobutyric acid (GABA) B receptor, 2 |
60037 |
0.11 |
chr1_42693070_42693237 | 14.26 |
Pantr1 |
POU domain, class 3, transcription factor 3 adjacent noncoding transcript 1 |
0 |
0.96 |
chr4_28967667_28967925 | 14.25 |
Epha7 |
Eph receptor A7 |
95872 |
0.07 |
chr2_30119740_30119899 | 14.10 |
Zer1 |
zyg-11 related, cell cycle regulator |
4635 |
0.11 |
chr5_44483526_44483716 | 14.02 |
Gm42981 |
predicted gene 42981 |
11800 |
0.14 |
chr6_13921201_13921391 | 13.97 |
Gm44412 |
predicted gene, 44412 |
7848 |
0.21 |
chr7_46103268_46103704 | 13.96 |
Abcc8 |
ATP-binding cassette, sub-family C (CFTR/MRP), member 8 |
2347 |
0.15 |
chr11_96902947_96903194 | 13.88 |
Cdk5rap3 |
CDK5 regulatory subunit associated protein 3 |
5688 |
0.09 |
chr12_14927661_14927858 | 13.88 |
Gm9202 |
predicted gene 9202 |
2348 |
0.36 |
chr9_54661880_54662067 | 13.82 |
Acsbg1 |
acyl-CoA synthetase bubblegum family member 1 |
103 |
0.96 |
chr11_88582890_88583759 | 13.68 |
Msi2 |
musashi RNA-binding protein 2 |
6823 |
0.27 |
chr11_14350814_14351136 | 13.61 |
Gm12006 |
predicted gene 12006 |
136638 |
0.05 |
chr4_153929018_153929198 | 13.58 |
BC039966 |
cDNA sequence BC039966 |
21395 |
0.11 |
chr2_51038826_51038996 | 13.56 |
Rnd3 |
Rho family GTPase 3 |
110183 |
0.06 |
chr11_24096113_24096272 | 13.56 |
Bcl11a |
B cell CLL/lymphoma 11A (zinc finger protein) |
15522 |
0.13 |
chr4_153854518_153854706 | 13.50 |
Gm25880 |
predicted gene, 25880 |
21772 |
0.18 |
chr4_148122325_148122775 | 13.47 |
Mad2l2 |
MAD2 mitotic arrest deficient-like 2 |
7834 |
0.1 |
chr12_42987147_42987298 | 13.45 |
Gm33340 |
predicted gene, 33340 |
28237 |
0.27 |
chr18_21186237_21186430 | 13.38 |
Gm6378 |
predicted pseudogene 6378 |
109224 |
0.05 |
chr4_23843717_23843902 | 13.34 |
Gm28448 |
predicted gene 28448 |
90145 |
0.1 |
chr2_94264427_94264617 | 13.31 |
Mir670hg |
MIR670 host gene (non-protein coding) |
86 |
0.96 |
chr12_29095988_29096385 | 13.25 |
4833405L11Rik |
RIKEN cDNA 4833405L11 gene |
10551 |
0.23 |
chr10_63978633_63979013 | 13.20 |
Gm10118 |
predicted gene 10118 |
51389 |
0.17 |
chr15_8717381_8717567 | 13.18 |
Slc1a3 |
solute carrier family 1 (glial high affinity glutamate transporter), member 3 |
6710 |
0.26 |
chr7_16134462_16134875 | 13.16 |
Slc8a2 |
solute carrier family 8 (sodium/calcium exchanger), member 2 |
4320 |
0.14 |
chr2_82847422_82847589 | 13.16 |
Fsip2 |
fibrous sheath-interacting protein 2 |
96129 |
0.09 |
chr2_134929542_134929848 | 13.14 |
Gm14036 |
predicted gene 14036 |
125746 |
0.05 |
chr13_89413184_89413340 | 13.13 |
Hapln1 |
hyaluronan and proteoglycan link protein 1 |
126534 |
0.06 |
chr5_17582115_17582266 | 13.13 |
Sema3c |
sema domain, immunoglobulin domain (Ig), short basic domain, secreted, (semaphorin) 3C |
7291 |
0.29 |
chr18_27582564_27582905 | 13.10 |
Gm7729 |
predicted gene 7729 |
15910 |
0.29 |
chr2_142303105_142303257 | 13.06 |
Macrod2 |
mono-ADP ribosylhydrolase 2 |
126574 |
0.06 |
chr9_34712119_34712402 | 13.05 |
Gm38217 |
predicted gene, 38217 |
190505 |
0.03 |
chr14_51385717_51386130 | 13.03 |
Vmn2r-ps111 |
vomeronasal 2, receptor, pseudogene 111 |
8575 |
0.09 |
chr2_70202586_70203174 | 13.01 |
Myo3b |
myosin IIIB |
106582 |
0.06 |
chr14_74113188_74113446 | 12.98 |
Gm49170 |
predicted gene, 49170 |
139091 |
0.04 |
chr16_63806861_63807216 | 12.97 |
Epha3 |
Eph receptor A3 |
56375 |
0.15 |
chr2_146833312_146833528 | 12.95 |
Gm14114 |
predicted gene 14114 |
6312 |
0.24 |
chr9_91456581_91456763 | 12.94 |
Gm29478 |
predicted gene 29478 |
52198 |
0.11 |
chr9_11279555_11279709 | 12.84 |
Gm18934 |
predicted gene, 18934 |
1589 |
0.48 |
chr5_85772023_85772333 | 12.82 |
Gm43567 |
predicted gene 43567 |
51404 |
0.15 |
chr11_64278350_64278531 | 12.81 |
Gm12290 |
predicted gene 12290 |
113867 |
0.06 |
chr16_41771843_41772245 | 12.80 |
Lsamp |
limbic system-associated membrane protein |
238625 |
0.02 |
chr9_56830372_56830523 | 12.76 |
Odf3l1 |
outer dense fiber of sperm tails 3-like 1 |
21516 |
0.12 |
chr12_120015329_120015493 | 12.63 |
Gm27236 |
predicted gene 27236 |
14884 |
0.24 |
chr13_83734346_83734573 | 12.52 |
C130071C03Rik |
RIKEN cDNA C130071C03 gene |
1893 |
0.22 |
chr3_110131615_110131766 | 12.50 |
Ntng1 |
netrin G1 |
3778 |
0.32 |
chr1_181410967_181411145 | 12.49 |
Gm16547 |
predicted gene 16547 |
10300 |
0.16 |
chr12_46646443_46646754 | 12.49 |
Gm48535 |
predicted gene, 48535 |
19111 |
0.16 |
chr18_25582908_25583396 | 12.48 |
Gm3227 |
predicted gene 3227 |
14338 |
0.27 |
chr12_3236518_3237725 | 12.48 |
Rab10os |
RAB10, member RAS oncogene family, opposite strand |
510 |
0.74 |
chr5_109556763_109557843 | 12.47 |
Crlf2 |
cytokine receptor-like factor 2 |
830 |
0.53 |
chr4_66586260_66586411 | 12.47 |
Gm25480 |
predicted gene, 25480 |
42274 |
0.2 |
chr7_133190005_133190156 | 12.46 |
4930483O08Rik |
RIKEN cDNA 4930483O08 gene |
61829 |
0.1 |
chr7_73354299_73354479 | 12.42 |
Rgma |
repulsive guidance molecule family member A |
21120 |
0.13 |
chr6_46612981_46613160 | 12.42 |
Gm18484 |
predicted gene, 18484 |
25212 |
0.22 |
chr2_57378479_57378900 | 12.41 |
Gm13531 |
predicted gene 13531 |
47020 |
0.16 |
chrX_58445991_58446352 | 12.38 |
Gm14645 |
predicted gene 14645 |
18096 |
0.26 |
chr18_25999104_25999542 | 12.35 |
Gm33228 |
predicted gene, 33228 |
8234 |
0.31 |
chr13_83729640_83730023 | 12.33 |
Gm26803 |
predicted gene, 26803 |
249 |
0.86 |
chr4_117379821_117380196 | 12.22 |
Rnf220 |
ring finger protein 220 |
4551 |
0.2 |
chr2_136712228_136712733 | 12.22 |
Snap25 |
synaptosomal-associated protein 25 |
973 |
0.59 |
chr1_42260077_42260228 | 12.19 |
Gm28175 |
predicted gene 28175 |
1703 |
0.37 |
chr3_137784274_137785017 | 12.16 |
Mir6380 |
microRNA 6380 |
1030 |
0.46 |
chr3_105450695_105451156 | 12.10 |
Kcnd3os |
potassium voltage-gated channel, Shal-related family, member 3, opposite strand |
802 |
0.55 |
chr17_89089787_89089962 | 12.07 |
Fshr |
follicle stimulating hormone receptor |
110801 |
0.07 |
chr13_52562127_52562509 | 12.00 |
Syk |
spleen tyrosine kinase |
20855 |
0.22 |
chr13_71507395_71507881 | 11.94 |
1700112M02Rik |
RIKEN cDNA 1700112M02 gene |
20031 |
0.26 |
chr5_131463531_131463682 | 11.93 |
Auts2 |
autism susceptibility candidate 2 |
3455 |
0.28 |
chr11_44841805_44841956 | 11.92 |
Ebf1 |
early B cell factor 1 |
70258 |
0.12 |
chr16_87001124_87001306 | 11.87 |
Gm38477 |
predicted gene, 38477 |
22582 |
0.25 |
chr11_89765154_89765305 | 11.85 |
Ankfn1 |
ankyrin-repeat and fibronectin type III domain containing 1 |
12424 |
0.3 |
chr14_16200927_16201541 | 11.85 |
Rpl31-ps3 |
ribosomal protein L31, pseudogene 3 |
23789 |
0.13 |
chr8_90520305_90520511 | 11.81 |
Gm45639 |
predicted gene 45639 |
154550 |
0.04 |
chr16_91304460_91304617 | 11.76 |
Gm15966 |
predicted gene 15966 |
21202 |
0.11 |
chr9_118255533_118255948 | 11.75 |
Gm17399 |
predicted gene, 17399 |
105509 |
0.06 |
chr2_38144063_38144614 | 11.71 |
Dennd1a |
DENN/MADD domain containing 1A |
21743 |
0.18 |
chr1_173389908_173390099 | 11.70 |
Cadm3 |
cell adhesion molecule 3 |
22308 |
0.14 |
chr4_32923035_32923283 | 11.69 |
Ankrd6 |
ankyrin repeat domain 6 |
296 |
0.89 |
chr10_18469268_18469623 | 11.69 |
Nhsl1 |
NHS-like 1 |
443 |
0.87 |
chr4_55416133_55416284 | 11.59 |
Gm12505 |
predicted gene 12505 |
2634 |
0.2 |
chr2_115119957_115120136 | 11.56 |
Gm28493 |
predicted gene 28493 |
15504 |
0.25 |
chr13_80381407_80381565 | 11.55 |
Gm46388 |
predicted gene, 46388 |
111523 |
0.07 |
chr13_29370907_29371310 | 11.52 |
Cdkal1 |
CDK5 regulatory subunit associated protein 1-like 1 |
103499 |
0.08 |
chr9_94342086_94342275 | 11.46 |
Gm24200 |
predicted gene, 24200 |
57684 |
0.13 |
chr6_106916863_106917143 | 11.45 |
Gm22418 |
predicted gene, 22418 |
84449 |
0.09 |
chr3_141197376_141197568 | 11.45 |
Pdha2 |
pyruvate dehydrogenase E1 alpha 2 |
14883 |
0.29 |
chr16_77685559_77685884 | 11.40 |
Gm37694 |
predicted gene, 37694 |
444 |
0.75 |
chr8_98572746_98573106 | 11.36 |
Gm23494 |
predicted gene, 23494 |
102276 |
0.08 |
chr16_33464987_33465193 | 11.35 |
Slc12a8 |
solute carrier family 12 (potassium/chloride transporters), member 8 |
52238 |
0.13 |
chr13_104018566_104018762 | 11.31 |
Nln |
neurolysin (metallopeptidase M3 family) |
15909 |
0.18 |
chr1_97622458_97622872 | 11.28 |
AC099860.1 |
proline rich protein BstNI subfamily 4 (PRB4), pseudogene |
38166 |
0.15 |
chr7_40392207_40392501 | 11.28 |
Gm28807 |
predicted gene 28807 |
76886 |
0.1 |
chr3_145640287_145640471 | 11.21 |
Ccn1 |
cellular communication network factor 1 |
9602 |
0.18 |
chr14_21410884_21411055 | 11.19 |
Gm25864 |
predicted gene, 25864 |
39505 |
0.14 |
chr12_109085240_109085391 | 11.05 |
Mif-ps7 |
macrophage migration inhibitory factor, pseudogene 7 |
12912 |
0.16 |
chr6_91301767_91302629 | 11.01 |
Fbln2 |
fibulin 2 |
36319 |
0.13 |
chr13_71690114_71690396 | 11.01 |
Gm47812 |
predicted gene, 47812 |
65227 |
0.12 |
chr2_135306496_135306647 | 10.97 |
Plcb1 |
phospholipase C, beta 1 |
57398 |
0.15 |
chr4_155024880_155025031 | 10.95 |
Plch2 |
phospholipase C, eta 2 |
5523 |
0.14 |
chr3_138854320_138854669 | 10.93 |
Tspan5 |
tetraspanin 5 |
5999 |
0.23 |
chr6_18795843_18796148 | 10.87 |
Gm43228 |
predicted gene 43228 |
3144 |
0.23 |
chr16_67611348_67611518 | 10.84 |
Cadm2 |
cell adhesion molecule 2 |
9060 |
0.25 |
chr9_16147734_16147906 | 10.83 |
Fat3 |
FAT atypical cadherin 3 |
141070 |
0.05 |
chr3_101343657_101343852 | 10.82 |
Gm43467 |
predicted gene 43467 |
32908 |
0.11 |
chr9_58048633_58048950 | 10.82 |
Ccdc33 |
coiled-coil domain containing 33 |
6755 |
0.13 |
chr13_20404599_20404750 | 10.79 |
Elmo1 |
engulfment and cell motility 1 |
68052 |
0.1 |
chr5_106560658_106561014 | 10.79 |
Gm28050 |
predicted gene, 28050 |
13879 |
0.14 |
chr11_17352189_17352422 | 10.79 |
Gm12015 |
predicted gene 12015 |
53886 |
0.14 |
chr14_12681169_12681360 | 10.77 |
Gm18077 |
predicted gene, 18077 |
27927 |
0.2 |
chr11_24371670_24371836 | 10.77 |
Gm12068 |
predicted gene 12068 |
54493 |
0.14 |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
5.9 | 17.7 | GO:0070649 | formin-nucleated actin cable assembly(GO:0070649) |
4.7 | 23.3 | GO:0071699 | olfactory placode formation(GO:0030910) olfactory placode development(GO:0071698) olfactory placode morphogenesis(GO:0071699) |
2.8 | 19.6 | GO:0098598 | vocal learning(GO:0042297) imitative learning(GO:0098596) learned vocalization behavior or vocal learning(GO:0098598) |
2.2 | 6.5 | GO:0090158 | endoplasmic reticulum membrane organization(GO:0090158) |
1.9 | 5.8 | GO:0006553 | lysine metabolic process(GO:0006553) |
1.8 | 5.3 | GO:0015014 | heparan sulfate proteoglycan biosynthetic process, polysaccharide chain biosynthetic process(GO:0015014) |
1.6 | 4.7 | GO:0070634 | transepithelial ammonium transport(GO:0070634) |
1.5 | 4.4 | GO:2000686 | regulation of rubidium ion transmembrane transporter activity(GO:2000686) |
1.4 | 1.4 | GO:1900425 | negative regulation of defense response to bacterium(GO:1900425) |
1.4 | 4.1 | GO:0021986 | epithalamus development(GO:0021538) habenula development(GO:0021986) |
1.3 | 5.3 | GO:2000255 | negative regulation of male germ cell proliferation(GO:2000255) |
1.3 | 6.6 | GO:0007171 | activation of transmembrane receptor protein tyrosine kinase activity(GO:0007171) |
1.2 | 4.9 | GO:0070777 | D-aspartate transport(GO:0070777) D-aspartate import(GO:0070779) |
1.1 | 3.4 | GO:0003358 | noradrenergic neuron development(GO:0003358) |
1.1 | 4.6 | GO:0045900 | negative regulation of translational elongation(GO:0045900) |
1.1 | 5.7 | GO:1903215 | negative regulation of protein targeting to mitochondrion(GO:1903215) |
1.1 | 8.9 | GO:1902902 | negative regulation of autophagosome assembly(GO:1902902) |
1.1 | 2.1 | GO:0021847 | ventricular zone neuroblast division(GO:0021847) |
1.1 | 3.2 | GO:0045658 | regulation of neutrophil differentiation(GO:0045658) |
1.0 | 5.1 | GO:0034983 | peptidyl-lysine deacetylation(GO:0034983) |
1.0 | 3.1 | GO:0021823 | cerebral cortex tangential migration using cell-cell interactions(GO:0021823) postnatal olfactory bulb interneuron migration(GO:0021827) |
1.0 | 3.1 | GO:0032483 | regulation of Rab protein signal transduction(GO:0032483) |
1.0 | 5.0 | GO:0090240 | positive regulation of histone H4 acetylation(GO:0090240) |
1.0 | 3.9 | GO:1900378 | positive regulation of melanin biosynthetic process(GO:0048023) positive regulation of secondary metabolite biosynthetic process(GO:1900378) |
1.0 | 2.9 | GO:0032672 | regulation of interleukin-3 production(GO:0032672) |
0.9 | 2.8 | GO:1990034 | calcium ion export from cell(GO:1990034) |
0.9 | 2.8 | GO:2000111 | positive regulation of macrophage apoptotic process(GO:2000111) |
0.9 | 3.8 | GO:0072513 | positive regulation of secondary heart field cardioblast proliferation(GO:0072513) |
0.9 | 4.7 | GO:0042483 | negative regulation of odontogenesis(GO:0042483) |
0.9 | 2.8 | GO:0002877 | regulation of acute inflammatory response to non-antigenic stimulus(GO:0002877) |
0.9 | 2.7 | GO:0071503 | response to heparin(GO:0071503) cellular response to heparin(GO:0071504) |
0.9 | 2.7 | GO:1901844 | regulation of cell communication by electrical coupling involved in cardiac conduction(GO:1901844) |
0.9 | 3.5 | GO:0060486 | Clara cell differentiation(GO:0060486) |
0.9 | 2.6 | GO:0010649 | regulation of cell communication by electrical coupling(GO:0010649) |
0.8 | 2.5 | GO:0070672 | response to interleukin-15(GO:0070672) |
0.8 | 2.4 | GO:0015803 | branched-chain amino acid transport(GO:0015803) leucine transport(GO:0015820) |
0.8 | 4.0 | GO:1902774 | late endosome to lysosome transport(GO:1902774) |
0.8 | 2.4 | GO:0072137 | condensed mesenchymal cell proliferation(GO:0072137) |
0.8 | 3.9 | GO:0060666 | dichotomous subdivision of terminal units involved in salivary gland branching(GO:0060666) |
0.8 | 1.6 | GO:0046544 | development of secondary male sexual characteristics(GO:0046544) |
0.8 | 1.5 | GO:1904430 | negative regulation of t-circle formation(GO:1904430) |
0.7 | 4.5 | GO:0070345 | negative regulation of fat cell proliferation(GO:0070345) |
0.7 | 4.5 | GO:1902222 | L-phenylalanine catabolic process(GO:0006559) erythrose 4-phosphate/phosphoenolpyruvate family amino acid catabolic process(GO:1902222) |
0.7 | 12.6 | GO:0016082 | synaptic vesicle priming(GO:0016082) |
0.7 | 2.9 | GO:0051725 | protein de-ADP-ribosylation(GO:0051725) |
0.7 | 2.2 | GO:0032289 | central nervous system myelin formation(GO:0032289) |
0.7 | 1.4 | GO:0021773 | striatal medium spiny neuron differentiation(GO:0021773) |
0.7 | 4.1 | GO:1901621 | negative regulation of smoothened signaling pathway involved in dorsal/ventral neural tube patterning(GO:1901621) |
0.7 | 1.3 | GO:1902809 | regulation of skeletal muscle fiber differentiation(GO:1902809) |
0.7 | 3.4 | GO:0050957 | equilibrioception(GO:0050957) |
0.6 | 7.1 | GO:0031987 | locomotion involved in locomotory behavior(GO:0031987) |
0.6 | 2.5 | GO:0035754 | B cell chemotaxis(GO:0035754) |
0.6 | 1.9 | GO:0036438 | maintenance of lens transparency(GO:0036438) |
0.6 | 3.7 | GO:0010746 | regulation of plasma membrane long-chain fatty acid transport(GO:0010746) |
0.6 | 1.2 | GO:0007258 | JUN phosphorylation(GO:0007258) |
0.6 | 10.5 | GO:0071475 | cellular hyperosmotic salinity response(GO:0071475) |
0.6 | 5.5 | GO:0048671 | negative regulation of collateral sprouting(GO:0048671) |
0.6 | 11.0 | GO:0001504 | neurotransmitter uptake(GO:0001504) |
0.6 | 1.8 | GO:0048682 | axon extension involved in regeneration(GO:0048677) sprouting of injured axon(GO:0048682) |
0.6 | 1.8 | GO:2001245 | regulation of phosphatidylcholine biosynthetic process(GO:2001245) |
0.6 | 1.2 | GO:0021564 | vagus nerve development(GO:0021564) |
0.6 | 1.8 | GO:0021698 | cerebellar cortex structural organization(GO:0021698) |
0.6 | 1.7 | GO:0000491 | small nucleolar ribonucleoprotein complex assembly(GO:0000491) box C/D snoRNP assembly(GO:0000492) |
0.6 | 2.3 | GO:1903421 | regulation of synaptic vesicle recycling(GO:1903421) |
0.6 | 1.7 | GO:0097503 | sialylation(GO:0097503) |
0.6 | 1.7 | GO:0030382 | sperm mitochondrion organization(GO:0030382) |
0.6 | 2.3 | GO:0006166 | purine ribonucleoside salvage(GO:0006166) |
0.6 | 1.7 | GO:0089700 | protein kinase D signaling(GO:0089700) |
0.6 | 0.6 | GO:0097476 | motor neuron migration(GO:0097475) spinal cord motor neuron migration(GO:0097476) |
0.6 | 2.2 | GO:0015015 | heparan sulfate proteoglycan biosynthetic process, enzymatic modification(GO:0015015) |
0.5 | 2.2 | GO:0097114 | NMDA glutamate receptor clustering(GO:0097114) |
0.5 | 6.5 | GO:0070986 | left/right axis specification(GO:0070986) |
0.5 | 1.6 | GO:0060178 | regulation of exocyst localization(GO:0060178) |
0.5 | 4.8 | GO:0002043 | blood vessel endothelial cell proliferation involved in sprouting angiogenesis(GO:0002043) |
0.5 | 3.2 | GO:0071372 | cellular response to follicle-stimulating hormone stimulus(GO:0071372) |
0.5 | 1.6 | GO:2000048 | negative regulation of cell-cell adhesion mediated by cadherin(GO:2000048) |
0.5 | 1.6 | GO:0021553 | olfactory nerve development(GO:0021553) |
0.5 | 4.6 | GO:0045161 | neuronal ion channel clustering(GO:0045161) |
0.5 | 2.0 | GO:0061743 | motor learning(GO:0061743) |
0.5 | 4.9 | GO:0051152 | positive regulation of smooth muscle cell differentiation(GO:0051152) |
0.5 | 0.5 | GO:0046684 | response to pyrethroid(GO:0046684) |
0.5 | 1.5 | GO:0021557 | oculomotor nerve development(GO:0021557) |
0.5 | 0.5 | GO:1904339 | negative regulation of dopaminergic neuron differentiation(GO:1904339) |
0.5 | 1.0 | GO:0003331 | regulation of extracellular matrix constituent secretion(GO:0003330) positive regulation of extracellular matrix constituent secretion(GO:0003331) |
0.5 | 1.0 | GO:0060166 | olfactory pit development(GO:0060166) |
0.5 | 1.9 | GO:2001286 | regulation of caveolin-mediated endocytosis(GO:2001286) |
0.5 | 1.4 | GO:0033693 | neurofilament bundle assembly(GO:0033693) |
0.5 | 5.7 | GO:0071803 | positive regulation of podosome assembly(GO:0071803) |
0.5 | 0.5 | GO:0071205 | protein localization to juxtaparanode region of axon(GO:0071205) |
0.5 | 1.4 | GO:0001927 | exocyst assembly(GO:0001927) |
0.5 | 0.9 | GO:0061314 | Notch signaling involved in heart development(GO:0061314) |
0.5 | 0.5 | GO:0050923 | regulation of negative chemotaxis(GO:0050923) |
0.5 | 4.2 | GO:0048245 | eosinophil chemotaxis(GO:0048245) |
0.5 | 1.4 | GO:0034197 | acylglycerol transport(GO:0034196) triglyceride transport(GO:0034197) |
0.5 | 3.2 | GO:0010764 | negative regulation of fibroblast migration(GO:0010764) |
0.5 | 1.8 | GO:1902866 | regulation of retina development in camera-type eye(GO:1902866) |
0.5 | 2.8 | GO:0060907 | positive regulation of macrophage cytokine production(GO:0060907) |
0.5 | 38.9 | GO:0007156 | homophilic cell adhesion via plasma membrane adhesion molecules(GO:0007156) |
0.5 | 0.9 | GO:0060164 | regulation of timing of neuron differentiation(GO:0060164) |
0.5 | 2.7 | GO:0022605 | oogenesis stage(GO:0022605) |
0.4 | 0.9 | GO:1900122 | positive regulation of receptor binding(GO:1900122) |
0.4 | 3.6 | GO:2001214 | positive regulation of vasculogenesis(GO:2001214) |
0.4 | 1.8 | GO:1903818 | positive regulation of delayed rectifier potassium channel activity(GO:1902261) positive regulation of voltage-gated potassium channel activity(GO:1903818) |
0.4 | 0.4 | GO:0060448 | dichotomous subdivision of terminal units involved in lung branching(GO:0060448) |
0.4 | 3.1 | GO:0046543 | development of secondary female sexual characteristics(GO:0046543) |
0.4 | 0.9 | GO:0051385 | response to mineralocorticoid(GO:0051385) |
0.4 | 0.9 | GO:0030070 | insulin processing(GO:0030070) |
0.4 | 1.7 | GO:0051790 | short-chain fatty acid biosynthetic process(GO:0051790) |
0.4 | 1.3 | GO:0061084 | negative regulation of protein refolding(GO:0061084) |
0.4 | 3.4 | GO:0048194 | Golgi vesicle budding(GO:0048194) |
0.4 | 1.7 | GO:0007195 | adenylate cyclase-inhibiting dopamine receptor signaling pathway(GO:0007195) |
0.4 | 1.3 | GO:2001268 | negative regulation of cysteine-type endopeptidase activity involved in apoptotic signaling pathway(GO:2001268) |
0.4 | 2.9 | GO:1900246 | positive regulation of RIG-I signaling pathway(GO:1900246) |
0.4 | 2.9 | GO:0045631 | regulation of auditory receptor cell differentiation(GO:0045607) regulation of mechanoreceptor differentiation(GO:0045631) regulation of inner ear receptor cell differentiation(GO:2000980) |
0.4 | 3.3 | GO:1901407 | regulation of phosphorylation of RNA polymerase II C-terminal domain(GO:1901407) positive regulation of phosphorylation of RNA polymerase II C-terminal domain(GO:1901409) |
0.4 | 0.8 | GO:0021979 | hypothalamus cell differentiation(GO:0021979) |
0.4 | 1.2 | GO:0021898 | commitment of multipotent stem cells to neuronal lineage in forebrain(GO:0021898) |
0.4 | 3.2 | GO:0061732 | mitochondrial acetyl-CoA biosynthetic process from pyruvate(GO:0061732) |
0.4 | 11.8 | GO:0000038 | very long-chain fatty acid metabolic process(GO:0000038) |
0.4 | 5.1 | GO:0021535 | cell migration in hindbrain(GO:0021535) |
0.4 | 0.8 | GO:0060066 | oviduct development(GO:0060066) |
0.4 | 0.4 | GO:1903333 | negative regulation of protein folding(GO:1903333) |
0.4 | 3.4 | GO:0016322 | neuron remodeling(GO:0016322) |
0.4 | 0.7 | GO:0098902 | regulation of membrane depolarization during action potential(GO:0098902) |
0.4 | 0.7 | GO:0060221 | retinal rod cell differentiation(GO:0060221) |
0.4 | 0.4 | GO:0001661 | conditioned taste aversion(GO:0001661) |
0.4 | 1.5 | GO:0046881 | positive regulation of follicle-stimulating hormone secretion(GO:0046881) |
0.4 | 1.5 | GO:0022417 | protein maturation by protein folding(GO:0022417) |
0.4 | 2.2 | GO:0071569 | protein ufmylation(GO:0071569) |
0.4 | 1.4 | GO:0060244 | negative regulation of cell proliferation involved in contact inhibition(GO:0060244) |
0.4 | 3.2 | GO:0060573 | ventral spinal cord interneuron specification(GO:0021521) cell fate specification involved in pattern specification(GO:0060573) |
0.4 | 1.1 | GO:0048341 | paraxial mesoderm formation(GO:0048341) |
0.4 | 1.4 | GO:0090244 | Wnt signaling pathway involved in somitogenesis(GO:0090244) |
0.3 | 0.7 | GO:0072093 | ureteric bud invasion(GO:0072092) metanephric renal vesicle formation(GO:0072093) |
0.3 | 2.7 | GO:0060179 | male mating behavior(GO:0060179) |
0.3 | 1.3 | GO:0007221 | positive regulation of transcription of Notch receptor target(GO:0007221) |
0.3 | 1.3 | GO:0006538 | glutamate catabolic process(GO:0006538) |
0.3 | 1.3 | GO:0072051 | juxtaglomerular apparatus development(GO:0072051) |
0.3 | 1.0 | GO:0001827 | inner cell mass cell fate commitment(GO:0001827) |
0.3 | 0.7 | GO:0035880 | embryonic nail plate morphogenesis(GO:0035880) |
0.3 | 1.3 | GO:0030917 | midbrain-hindbrain boundary development(GO:0030917) |
0.3 | 2.6 | GO:0051967 | negative regulation of synaptic transmission, glutamatergic(GO:0051967) |
0.3 | 8.4 | GO:2000649 | regulation of sodium ion transmembrane transporter activity(GO:2000649) |
0.3 | 4.8 | GO:0090036 | regulation of protein kinase C signaling(GO:0090036) |
0.3 | 1.3 | GO:1904667 | negative regulation of ubiquitin protein ligase activity(GO:1904667) |
0.3 | 3.1 | GO:0038166 | angiotensin-activated signaling pathway(GO:0038166) |
0.3 | 1.3 | GO:0016198 | axon choice point recognition(GO:0016198) |
0.3 | 0.6 | GO:1902953 | positive regulation of ER to Golgi vesicle-mediated transport(GO:1902953) |
0.3 | 1.2 | GO:0048386 | positive regulation of retinoic acid receptor signaling pathway(GO:0048386) |
0.3 | 2.5 | GO:0045176 | apical protein localization(GO:0045176) |
0.3 | 1.5 | GO:0060363 | cranial suture morphogenesis(GO:0060363) |
0.3 | 5.6 | GO:0021516 | dorsal spinal cord development(GO:0021516) |
0.3 | 1.2 | GO:0032229 | negative regulation of synaptic transmission, GABAergic(GO:0032229) |
0.3 | 0.9 | GO:0006210 | pyrimidine nucleobase catabolic process(GO:0006208) thymine catabolic process(GO:0006210) thymine metabolic process(GO:0019859) |
0.3 | 0.9 | GO:0014734 | skeletal muscle hypertrophy(GO:0014734) |
0.3 | 2.7 | GO:0071435 | potassium ion export(GO:0071435) |
0.3 | 1.2 | GO:0033239 | negative regulation of cellular amine metabolic process(GO:0033239) |
0.3 | 0.3 | GO:0048880 | sensory system development(GO:0048880) |
0.3 | 1.5 | GO:0045650 | negative regulation of macrophage differentiation(GO:0045650) |
0.3 | 2.3 | GO:0021796 | cerebral cortex regionalization(GO:0021796) |
0.3 | 0.9 | GO:0034146 | toll-like receptor 5 signaling pathway(GO:0034146) |
0.3 | 1.2 | GO:1902308 | regulation of peptidyl-serine dephosphorylation(GO:1902308) |
0.3 | 3.7 | GO:0042754 | negative regulation of circadian rhythm(GO:0042754) |
0.3 | 1.1 | GO:0097460 | ferrous iron import into cell(GO:0097460) |
0.3 | 1.7 | GO:0090557 | establishment of endothelial intestinal barrier(GO:0090557) |
0.3 | 0.9 | GO:2000623 | regulation of nuclear-transcribed mRNA catabolic process, nonsense-mediated decay(GO:2000622) negative regulation of nuclear-transcribed mRNA catabolic process, nonsense-mediated decay(GO:2000623) |
0.3 | 0.6 | GO:0007386 | compartment pattern specification(GO:0007386) |
0.3 | 0.6 | GO:0043152 | induction of bacterial agglutination(GO:0043152) |
0.3 | 0.8 | GO:0036493 | positive regulation of translation in response to endoplasmic reticulum stress(GO:0036493) |
0.3 | 1.1 | GO:0036072 | intramembranous ossification(GO:0001957) direct ossification(GO:0036072) |
0.3 | 0.8 | GO:0044860 | protein localization to plasma membrane raft(GO:0044860) |
0.3 | 1.1 | GO:0048852 | diencephalon morphogenesis(GO:0048852) |
0.3 | 0.8 | GO:0007181 | transforming growth factor beta receptor complex assembly(GO:0007181) |
0.3 | 0.5 | GO:0016560 | protein import into peroxisome matrix, docking(GO:0016560) |
0.3 | 1.3 | GO:0010940 | positive regulation of necrotic cell death(GO:0010940) |
0.3 | 1.1 | GO:0018406 | protein C-linked glycosylation(GO:0018103) peptidyl-tryptophan modification(GO:0018211) protein C-linked glycosylation via tryptophan(GO:0018317) protein C-linked glycosylation via 2'-alpha-mannosyl-L-tryptophan(GO:0018406) |
0.3 | 0.3 | GO:0061091 | regulation of phospholipid translocation(GO:0061091) positive regulation of phospholipid translocation(GO:0061092) |
0.3 | 0.3 | GO:0036092 | phosphatidylinositol-3-phosphate biosynthetic process(GO:0036092) |
0.3 | 0.5 | GO:0033563 | dorsal/ventral axon guidance(GO:0033563) |
0.3 | 1.1 | GO:0042699 | follicle-stimulating hormone signaling pathway(GO:0042699) |
0.3 | 0.5 | GO:0034756 | regulation of iron ion transport(GO:0034756) |
0.3 | 0.3 | GO:0007158 | neuron cell-cell adhesion(GO:0007158) |
0.3 | 0.8 | GO:0021780 | oligodendrocyte cell fate specification(GO:0021778) oligodendrocyte cell fate commitment(GO:0021779) glial cell fate specification(GO:0021780) |
0.3 | 1.3 | GO:0021707 | cerebellar granular layer formation(GO:0021684) cerebellar granule cell differentiation(GO:0021707) |
0.3 | 0.3 | GO:0097118 | neuroligin clustering involved in postsynaptic membrane assembly(GO:0097118) |
0.3 | 0.3 | GO:0051660 | establishment of centrosome localization(GO:0051660) |
0.3 | 0.8 | GO:0019805 | quinolinate biosynthetic process(GO:0019805) |
0.3 | 1.0 | GO:0035405 | histone-threonine phosphorylation(GO:0035405) |
0.2 | 2.2 | GO:0021542 | dentate gyrus development(GO:0021542) |
0.2 | 0.7 | GO:0035434 | copper ion transmembrane transport(GO:0035434) |
0.2 | 1.7 | GO:0000712 | resolution of meiotic recombination intermediates(GO:0000712) |
0.2 | 3.2 | GO:0015701 | bicarbonate transport(GO:0015701) |
0.2 | 2.2 | GO:0097120 | receptor localization to synapse(GO:0097120) |
0.2 | 3.2 | GO:0048488 | synaptic vesicle endocytosis(GO:0048488) |
0.2 | 1.7 | GO:0051386 | regulation of neurotrophin TRK receptor signaling pathway(GO:0051386) |
0.2 | 3.9 | GO:0061049 | physiological muscle hypertrophy(GO:0003298) physiological cardiac muscle hypertrophy(GO:0003301) cell growth involved in cardiac muscle cell development(GO:0061049) |
0.2 | 0.7 | GO:0033326 | cerebrospinal fluid secretion(GO:0033326) |
0.2 | 1.0 | GO:0090273 | regulation of somatostatin secretion(GO:0090273) |
0.2 | 0.2 | GO:0071877 | regulation of adrenergic receptor signaling pathway(GO:0071877) |
0.2 | 0.7 | GO:0090394 | negative regulation of excitatory postsynaptic potential(GO:0090394) |
0.2 | 0.7 | GO:0045743 | positive regulation of fibroblast growth factor receptor signaling pathway(GO:0045743) |
0.2 | 1.2 | GO:0080009 | mRNA methylation(GO:0080009) |
0.2 | 0.5 | GO:1903142 | positive regulation of endothelial cell development(GO:1901552) positive regulation of establishment of endothelial barrier(GO:1903142) |
0.2 | 1.2 | GO:0031293 | membrane protein intracellular domain proteolysis(GO:0031293) |
0.2 | 0.7 | GO:0030050 | vesicle transport along actin filament(GO:0030050) |
0.2 | 0.2 | GO:1902306 | negative regulation of sodium ion transmembrane transport(GO:1902306) |
0.2 | 0.5 | GO:1905005 | regulation of epithelial to mesenchymal transition involved in endocardial cushion formation(GO:1905005) |
0.2 | 2.1 | GO:0070269 | pyroptosis(GO:0070269) |
0.2 | 0.7 | GO:1904694 | negative regulation of vascular smooth muscle contraction(GO:1904694) |
0.2 | 0.7 | GO:0071596 | ubiquitin-dependent protein catabolic process via the N-end rule pathway(GO:0071596) |
0.2 | 0.9 | GO:1902512 | positive regulation of apoptotic DNA fragmentation(GO:1902512) positive regulation of DNA catabolic process(GO:1903626) |
0.2 | 0.7 | GO:0040031 | snRNA modification(GO:0040031) |
0.2 | 2.4 | GO:0036158 | outer dynein arm assembly(GO:0036158) |
0.2 | 0.7 | GO:1900738 | positive regulation of phospholipase C-activating G-protein coupled receptor signaling pathway(GO:1900738) |
0.2 | 0.2 | GO:0070368 | positive regulation of hepatocyte differentiation(GO:0070368) |
0.2 | 0.2 | GO:1900020 | regulation of protein kinase C activity(GO:1900019) positive regulation of protein kinase C activity(GO:1900020) |
0.2 | 0.9 | GO:2000271 | positive regulation of fibroblast apoptotic process(GO:2000271) |
0.2 | 1.5 | GO:1902018 | negative regulation of cilium assembly(GO:1902018) |
0.2 | 0.8 | GO:1902993 | positive regulation of beta-amyloid formation(GO:1902004) positive regulation of amyloid precursor protein catabolic process(GO:1902993) |
0.2 | 0.8 | GO:0030263 | apoptotic chromosome condensation(GO:0030263) |
0.2 | 0.2 | GO:0061643 | chemorepulsion of axon(GO:0061643) |
0.2 | 0.4 | GO:0061144 | alveolar secondary septum development(GO:0061144) |
0.2 | 0.4 | GO:0072656 | maintenance of protein location in mitochondrion(GO:0072656) |
0.2 | 0.4 | GO:0051444 | negative regulation of ligase activity(GO:0051352) negative regulation of ubiquitin-protein transferase activity(GO:0051444) |
0.2 | 0.4 | GO:2000721 | positive regulation of transcription from RNA polymerase II promoter involved in smooth muscle cell differentiation(GO:2000721) |
0.2 | 0.4 | GO:0021902 | commitment of neuronal cell to specific neuron type in forebrain(GO:0021902) |
0.2 | 0.6 | GO:0061154 | endothelial tube morphogenesis(GO:0061154) |
0.2 | 0.2 | GO:2000409 | T cell extravasation(GO:0072683) regulation of T cell extravasation(GO:2000407) positive regulation of T cell extravasation(GO:2000409) |
0.2 | 0.8 | GO:0034047 | regulation of protein phosphatase type 2A activity(GO:0034047) |
0.2 | 0.4 | GO:0032747 | positive regulation of interleukin-23 production(GO:0032747) |
0.2 | 1.8 | GO:0048172 | regulation of short-term neuronal synaptic plasticity(GO:0048172) |
0.2 | 0.6 | GO:0032463 | negative regulation of protein homooligomerization(GO:0032463) |
0.2 | 0.4 | GO:2000503 | positive regulation of natural killer cell chemotaxis(GO:2000503) |
0.2 | 0.4 | GO:0032056 | positive regulation of translation in response to stress(GO:0032056) |
0.2 | 0.6 | GO:0014816 | skeletal muscle satellite cell differentiation(GO:0014816) |
0.2 | 0.2 | GO:0035905 | ascending aorta development(GO:0035905) ascending aorta morphogenesis(GO:0035910) |
0.2 | 0.4 | GO:0002378 | immunoglobulin biosynthetic process(GO:0002378) |
0.2 | 1.4 | GO:2001224 | positive regulation of neuron migration(GO:2001224) |
0.2 | 1.2 | GO:0072102 | glomerulus morphogenesis(GO:0072102) |
0.2 | 0.6 | GO:0010520 | regulation of reciprocal meiotic recombination(GO:0010520) |
0.2 | 0.2 | GO:0014042 | positive regulation of neuron maturation(GO:0014042) |
0.2 | 0.2 | GO:0002238 | response to molecule of fungal origin(GO:0002238) |
0.2 | 1.0 | GO:0051533 | positive regulation of NFAT protein import into nucleus(GO:0051533) |
0.2 | 0.8 | GO:0032252 | secretory granule localization(GO:0032252) |
0.2 | 1.3 | GO:0070189 | kynurenine metabolic process(GO:0070189) |
0.2 | 1.3 | GO:0070995 | NADPH oxidation(GO:0070995) |
0.2 | 0.4 | GO:1903265 | positive regulation of tumor necrosis factor-mediated signaling pathway(GO:1903265) |
0.2 | 3.8 | GO:0007214 | gamma-aminobutyric acid signaling pathway(GO:0007214) |
0.2 | 0.6 | GO:0033026 | negative regulation of mast cell apoptotic process(GO:0033026) |
0.2 | 0.6 | GO:0002282 | microglial cell activation involved in immune response(GO:0002282) |
0.2 | 0.2 | GO:1900157 | regulation of bone mineralization involved in bone maturation(GO:1900157) |
0.2 | 1.1 | GO:2000344 | positive regulation of acrosome reaction(GO:2000344) |
0.2 | 2.2 | GO:0048268 | clathrin coat assembly(GO:0048268) |
0.2 | 1.1 | GO:0021860 | pyramidal neuron development(GO:0021860) |
0.2 | 1.1 | GO:0006307 | DNA dealkylation involved in DNA repair(GO:0006307) |
0.2 | 0.4 | GO:0038026 | reelin-mediated signaling pathway(GO:0038026) |
0.2 | 0.5 | GO:0018197 | peptidyl-aspartic acid modification(GO:0018197) |
0.2 | 1.4 | GO:0014824 | artery smooth muscle contraction(GO:0014824) |
0.2 | 0.9 | GO:0097466 | glycoprotein ERAD pathway(GO:0097466) response to glycoprotein(GO:1904587) |
0.2 | 1.1 | GO:0048387 | negative regulation of retinoic acid receptor signaling pathway(GO:0048387) |
0.2 | 0.2 | GO:0035469 | determination of pancreatic left/right asymmetry(GO:0035469) |
0.2 | 0.9 | GO:0021631 | optic nerve morphogenesis(GO:0021631) |
0.2 | 0.2 | GO:0090191 | negative regulation of branching involved in ureteric bud morphogenesis(GO:0090191) |
0.2 | 0.9 | GO:0016266 | O-glycan processing(GO:0016266) |
0.2 | 0.5 | GO:0072061 | inner medullary collecting duct development(GO:0072061) |
0.2 | 0.9 | GO:0071670 | smooth muscle cell chemotaxis(GO:0071670) |
0.2 | 0.5 | GO:2001274 | negative regulation of glucose import in response to insulin stimulus(GO:2001274) |
0.2 | 0.4 | GO:0002727 | natural killer cell cytokine production(GO:0002370) regulation of natural killer cell cytokine production(GO:0002727) |
0.2 | 0.4 | GO:0070268 | cornification(GO:0070268) |
0.2 | 0.9 | GO:0045792 | negative regulation of cell size(GO:0045792) |
0.2 | 0.3 | GO:0014722 | regulation of skeletal muscle contraction by calcium ion signaling(GO:0014722) |
0.2 | 0.3 | GO:0038109 | response to stem cell factor(GO:0036215) cellular response to stem cell factor stimulus(GO:0036216) Kit signaling pathway(GO:0038109) |
0.2 | 0.3 | GO:0007060 | male meiosis chromosome segregation(GO:0007060) |
0.2 | 0.5 | GO:0060741 | prostate gland stromal morphogenesis(GO:0060741) |
0.2 | 2.9 | GO:0090162 | establishment of epithelial cell polarity(GO:0090162) |
0.2 | 1.5 | GO:0048280 | vesicle fusion with Golgi apparatus(GO:0048280) |
0.2 | 4.1 | GO:0006890 | retrograde vesicle-mediated transport, Golgi to ER(GO:0006890) |
0.2 | 0.2 | GO:0010513 | phospholipase C-activating serotonin receptor signaling pathway(GO:0007208) positive regulation of phosphatidylinositol biosynthetic process(GO:0010513) |
0.2 | 0.7 | GO:0008354 | germ cell migration(GO:0008354) |
0.2 | 0.5 | GO:0048294 | negative regulation of isotype switching to IgE isotypes(GO:0048294) |
0.2 | 0.3 | GO:0034633 | retinol transport(GO:0034633) isoprenoid transport(GO:0046864) terpenoid transport(GO:0046865) |
0.2 | 0.2 | GO:1904023 | regulation of fermentation(GO:0043465) regulation of NAD metabolic process(GO:1902688) regulation of glucose catabolic process to lactate via pyruvate(GO:1904023) |
0.2 | 0.6 | GO:0019532 | oxalate transport(GO:0019532) |
0.2 | 0.8 | GO:0007256 | activation of JNKK activity(GO:0007256) |
0.2 | 0.5 | GO:0044339 | canonical Wnt signaling pathway involved in osteoblast differentiation(GO:0044339) |
0.2 | 0.3 | GO:2000009 | negative regulation of protein localization to cell surface(GO:2000009) |
0.2 | 0.6 | GO:0042118 | endothelial cell activation(GO:0042118) |
0.2 | 0.8 | GO:0052805 | histidine catabolic process(GO:0006548) imidazole-containing compound catabolic process(GO:0052805) |
0.2 | 0.2 | GO:0001998 | angiotensin mediated vasoconstriction involved in regulation of systemic arterial blood pressure(GO:0001998) |
0.2 | 0.2 | GO:0060523 | prostate epithelial cord elongation(GO:0060523) |
0.2 | 0.2 | GO:0039533 | regulation of MDA-5 signaling pathway(GO:0039533) |
0.2 | 1.6 | GO:0006516 | glycoprotein catabolic process(GO:0006516) |
0.2 | 0.3 | GO:0051964 | negative regulation of synapse assembly(GO:0051964) |
0.2 | 0.5 | GO:0070827 | chromatin maintenance(GO:0070827) |
0.2 | 0.3 | GO:1903261 | regulation of serine phosphorylation of STAT3 protein(GO:1903261) |
0.2 | 0.5 | GO:0034628 | nicotinamide nucleotide biosynthetic process from aspartate(GO:0019355) 'de novo' NAD biosynthetic process from aspartate(GO:0034628) |
0.2 | 0.5 | GO:0032474 | otolith morphogenesis(GO:0032474) |
0.2 | 0.3 | GO:0089711 | L-glutamate transmembrane transport(GO:0089711) |
0.2 | 0.2 | GO:0043380 | memory T cell differentiation(GO:0043379) regulation of memory T cell differentiation(GO:0043380) positive regulation of memory T cell differentiation(GO:0043382) |
0.2 | 0.2 | GO:0021978 | telencephalon regionalization(GO:0021978) |
0.2 | 0.8 | GO:0071732 | cellular response to nitric oxide(GO:0071732) |
0.2 | 0.3 | GO:0031547 | brain-derived neurotrophic factor receptor signaling pathway(GO:0031547) |
0.1 | 0.4 | GO:0060468 | prevention of polyspermy(GO:0060468) |
0.1 | 0.3 | GO:0007571 | age-dependent response to oxidative stress(GO:0001306) age-dependent general metabolic decline(GO:0007571) |
0.1 | 3.3 | GO:0016601 | Rac protein signal transduction(GO:0016601) |
0.1 | 0.3 | GO:0010963 | regulation of L-arginine import(GO:0010963) |
0.1 | 0.6 | GO:1900025 | negative regulation of substrate adhesion-dependent cell spreading(GO:1900025) |
0.1 | 0.4 | GO:0000715 | nucleotide-excision repair, DNA damage recognition(GO:0000715) |
0.1 | 5.1 | GO:0046676 | negative regulation of insulin secretion(GO:0046676) |
0.1 | 0.6 | GO:0070126 | mitochondrial translational termination(GO:0070126) |
0.1 | 1.4 | GO:0043248 | proteasome assembly(GO:0043248) |
0.1 | 0.3 | GO:0015755 | fructose transport(GO:0015755) |
0.1 | 4.2 | GO:0051058 | negative regulation of Ras protein signal transduction(GO:0046580) negative regulation of small GTPase mediated signal transduction(GO:0051058) |
0.1 | 1.1 | GO:0034650 | cortisol metabolic process(GO:0034650) |
0.1 | 1.3 | GO:0035428 | hexose transmembrane transport(GO:0035428) |
0.1 | 0.4 | GO:0042126 | nitrate metabolic process(GO:0042126) |
0.1 | 0.4 | GO:0006678 | glucosylceramide metabolic process(GO:0006678) |
0.1 | 0.3 | GO:1903999 | negative regulation of eating behavior(GO:1903999) |
0.1 | 0.3 | GO:0072697 | protein localization to cell cortex(GO:0072697) |
0.1 | 0.3 | GO:0051684 | maintenance of Golgi location(GO:0051684) |
0.1 | 0.6 | GO:0006451 | selenocysteine incorporation(GO:0001514) translational readthrough(GO:0006451) |
0.1 | 0.5 | GO:0097428 | protein maturation by iron-sulfur cluster transfer(GO:0097428) |
0.1 | 0.4 | GO:0072378 | blood coagulation, fibrin clot formation(GO:0072378) |
0.1 | 5.3 | GO:0030032 | lamellipodium assembly(GO:0030032) |
0.1 | 0.8 | GO:0010452 | histone H3-K36 methylation(GO:0010452) |
0.1 | 8.7 | GO:0010923 | negative regulation of phosphatase activity(GO:0010923) |
0.1 | 0.3 | GO:0086046 | regulation of atrial cardiac muscle cell membrane repolarization(GO:0060372) membrane depolarization during SA node cell action potential(GO:0086046) atrial cardiac muscle cell membrane repolarization(GO:0099624) |
0.1 | 0.3 | GO:0050975 | sensory perception of touch(GO:0050975) |
0.1 | 3.1 | GO:0018345 | protein palmitoylation(GO:0018345) |
0.1 | 0.3 | GO:0002540 | leukotriene production involved in inflammatory response(GO:0002540) |
0.1 | 0.1 | GO:0001806 | type IV hypersensitivity(GO:0001806) regulation of type IV hypersensitivity(GO:0001807) |
0.1 | 0.7 | GO:0042364 | water-soluble vitamin biosynthetic process(GO:0042364) |
0.1 | 0.8 | GO:0031290 | retinal ganglion cell axon guidance(GO:0031290) |
0.1 | 4.4 | GO:0010633 | negative regulation of epithelial cell migration(GO:0010633) |
0.1 | 1.1 | GO:0090331 | negative regulation of platelet aggregation(GO:0090331) |
0.1 | 0.3 | GO:0019087 | transformation of host cell by virus(GO:0019087) |
0.1 | 0.7 | GO:0042473 | outer ear morphogenesis(GO:0042473) |
0.1 | 0.8 | GO:0090085 | regulation of protein deubiquitination(GO:0090085) |
0.1 | 0.3 | GO:0090238 | positive regulation of arachidonic acid secretion(GO:0090238) |
0.1 | 0.4 | GO:0034638 | phosphatidylcholine catabolic process(GO:0034638) |
0.1 | 0.4 | GO:0002906 | mature B cell apoptotic process(GO:0002901) regulation of mature B cell apoptotic process(GO:0002905) negative regulation of mature B cell apoptotic process(GO:0002906) |
0.1 | 2.5 | GO:0034243 | regulation of transcription elongation from RNA polymerase II promoter(GO:0034243) |
0.1 | 0.6 | GO:2000210 | positive regulation of anoikis(GO:2000210) |
0.1 | 0.8 | GO:0060406 | positive regulation of penile erection(GO:0060406) |
0.1 | 0.4 | GO:0045896 | regulation of transcription during mitosis(GO:0045896) positive regulation of transcription during mitosis(GO:0045897) |
0.1 | 0.4 | GO:2000643 | positive regulation of early endosome to late endosome transport(GO:2000643) |
0.1 | 0.4 | GO:0034241 | positive regulation of macrophage fusion(GO:0034241) |
0.1 | 0.1 | GO:0001831 | trophectodermal cellular morphogenesis(GO:0001831) |
0.1 | 0.8 | GO:0032782 | bile acid secretion(GO:0032782) |
0.1 | 2.4 | GO:0045747 | positive regulation of Notch signaling pathway(GO:0045747) |
0.1 | 0.5 | GO:0070535 | histone H2A K63-linked ubiquitination(GO:0070535) |
0.1 | 0.5 | GO:0036089 | cleavage furrow formation(GO:0036089) |
0.1 | 0.5 | GO:0042780 | tRNA 3'-end processing(GO:0042780) |
0.1 | 0.2 | GO:2001137 | positive regulation of endocytic recycling(GO:2001137) |
0.1 | 0.7 | GO:0008090 | retrograde axonal transport(GO:0008090) |
0.1 | 4.5 | GO:0003407 | neural retina development(GO:0003407) |
0.1 | 0.5 | GO:0030422 | production of siRNA involved in RNA interference(GO:0030422) |
0.1 | 1.8 | GO:0060008 | Sertoli cell differentiation(GO:0060008) |
0.1 | 2.8 | GO:0032456 | endocytic recycling(GO:0032456) |
0.1 | 0.2 | GO:1902071 | regulation of hypoxia-inducible factor-1alpha signaling pathway(GO:1902071) |
0.1 | 0.2 | GO:1903525 | regulation of membrane tubulation(GO:1903525) |
0.1 | 0.4 | GO:0050427 | 3'-phosphoadenosine 5'-phosphosulfate metabolic process(GO:0050427) |
0.1 | 0.4 | GO:0044034 | negative stranded viral RNA replication(GO:0039689) multi-organism biosynthetic process(GO:0044034) |
0.1 | 3.3 | GO:0043252 | sodium-independent organic anion transport(GO:0043252) |
0.1 | 0.2 | GO:0045080 | positive regulation of chemokine biosynthetic process(GO:0045080) |
0.1 | 0.2 | GO:0001560 | regulation of cell growth by extracellular stimulus(GO:0001560) |
0.1 | 0.7 | GO:0031848 | protection from non-homologous end joining at telomere(GO:0031848) |
0.1 | 0.2 | GO:0031339 | negative regulation of vesicle fusion(GO:0031339) |
0.1 | 0.1 | GO:0055005 | ventricular cardiac myofibril assembly(GO:0055005) |
0.1 | 0.6 | GO:0048496 | maintenance of organ identity(GO:0048496) |
0.1 | 1.3 | GO:0035176 | social behavior(GO:0035176) intraspecies interaction between organisms(GO:0051703) |
0.1 | 1.4 | GO:0010758 | regulation of macrophage chemotaxis(GO:0010758) |
0.1 | 0.6 | GO:0010032 | meiotic chromosome condensation(GO:0010032) |
0.1 | 0.2 | GO:0044336 | canonical Wnt signaling pathway involved in negative regulation of apoptotic process(GO:0044336) |
0.1 | 1.1 | GO:0035493 | SNARE complex assembly(GO:0035493) |
0.1 | 0.2 | GO:0060478 | acrosomal vesicle exocytosis(GO:0060478) |
0.1 | 0.3 | GO:0046477 | glycosylceramide catabolic process(GO:0046477) |
0.1 | 0.2 | GO:0021626 | hindbrain maturation(GO:0021578) pons maturation(GO:0021586) central nervous system maturation(GO:0021626) |
0.1 | 0.2 | GO:0060399 | positive regulation of growth hormone receptor signaling pathway(GO:0060399) |
0.1 | 0.9 | GO:1904871 | protein localization to nuclear body(GO:1903405) protein localization to Cajal body(GO:1904867) regulation of protein localization to Cajal body(GO:1904869) positive regulation of protein localization to Cajal body(GO:1904871) protein localization to nucleoplasm(GO:1990173) |
0.1 | 0.6 | GO:1902267 | polyamine transport(GO:0015846) polyamine transmembrane transport(GO:1902047) regulation of polyamine transmembrane transport(GO:1902267) |
0.1 | 0.2 | GO:0060830 | ciliary receptor clustering involved in smoothened signaling pathway(GO:0060830) |
0.1 | 0.4 | GO:0016557 | peroxisome membrane biogenesis(GO:0016557) |
0.1 | 0.3 | GO:0034421 | post-translational protein acetylation(GO:0034421) |
0.1 | 0.4 | GO:0060923 | cardiac muscle cell fate commitment(GO:0060923) |
0.1 | 0.4 | GO:0003148 | outflow tract septum morphogenesis(GO:0003148) |
0.1 | 0.9 | GO:0042428 | serotonin metabolic process(GO:0042428) |
0.1 | 0.1 | GO:0002913 | positive regulation of T cell anergy(GO:0002669) positive regulation of lymphocyte anergy(GO:0002913) |
0.1 | 0.1 | GO:1900028 | negative regulation of ruffle assembly(GO:1900028) |
0.1 | 0.3 | GO:0030920 | N-terminal peptidyl-serine acetylation(GO:0017198) N-terminal peptidyl-glutamic acid acetylation(GO:0018002) peptidyl-serine acetylation(GO:0030920) |
0.1 | 0.3 | GO:0072203 | cell proliferation involved in metanephros development(GO:0072203) |
0.1 | 0.1 | GO:1901475 | pyruvate transmembrane transport(GO:1901475) |
0.1 | 0.1 | GO:1990441 | negative regulation of transcription from RNA polymerase II promoter in response to endoplasmic reticulum stress(GO:1990441) |
0.1 | 0.1 | GO:0002538 | arachidonic acid metabolite production involved in inflammatory response(GO:0002538) |
0.1 | 0.4 | GO:1903553 | positive regulation of extracellular exosome assembly(GO:1903553) |
0.1 | 0.3 | GO:0051791 | medium-chain fatty acid metabolic process(GO:0051791) |
0.1 | 0.2 | GO:0002322 | B cell proliferation involved in immune response(GO:0002322) |
0.1 | 1.8 | GO:0048791 | calcium ion-regulated exocytosis of neurotransmitter(GO:0048791) |
0.1 | 0.2 | GO:0070103 | regulation of interleukin-6-mediated signaling pathway(GO:0070103) |
0.1 | 1.6 | GO:0006298 | mismatch repair(GO:0006298) |
0.1 | 0.4 | GO:0060613 | fat pad development(GO:0060613) |
0.1 | 0.3 | GO:0086073 | bundle of His cell-Purkinje myocyte adhesion involved in cell communication(GO:0086073) |
0.1 | 0.5 | GO:0048631 | regulation of skeletal muscle tissue growth(GO:0048631) |
0.1 | 0.4 | GO:0048672 | positive regulation of collateral sprouting(GO:0048672) |
0.1 | 0.3 | GO:0002430 | complement receptor mediated signaling pathway(GO:0002430) |
0.1 | 0.2 | GO:0060024 | rhythmic synaptic transmission(GO:0060024) |
0.1 | 0.2 | GO:2001012 | mesenchymal cell differentiation involved in kidney development(GO:0072161) mesenchymal cell differentiation involved in renal system development(GO:2001012) |
0.1 | 0.2 | GO:0002689 | negative regulation of leukocyte chemotaxis(GO:0002689) |
0.1 | 0.4 | GO:2000010 | positive regulation of protein localization to cell surface(GO:2000010) |
0.1 | 1.2 | GO:0048714 | positive regulation of oligodendrocyte differentiation(GO:0048714) |
0.1 | 4.7 | GO:0006400 | tRNA modification(GO:0006400) |
0.1 | 0.7 | GO:0006002 | fructose 6-phosphate metabolic process(GO:0006002) |
0.1 | 0.2 | GO:0002606 | dendritic cell antigen processing and presentation(GO:0002468) regulation of dendritic cell antigen processing and presentation(GO:0002604) positive regulation of dendritic cell antigen processing and presentation(GO:0002606) |
0.1 | 0.1 | GO:1903912 | negative regulation of endoplasmic reticulum stress-induced eIF2 alpha phosphorylation(GO:1903912) |
0.1 | 0.8 | GO:2000811 | negative regulation of anoikis(GO:2000811) |
0.1 | 0.5 | GO:0060736 | prostate gland growth(GO:0060736) |
0.1 | 0.7 | GO:0000103 | sulfate assimilation(GO:0000103) |
0.1 | 0.4 | GO:0042256 | mature ribosome assembly(GO:0042256) |
0.1 | 1.0 | GO:0035721 | intraciliary retrograde transport(GO:0035721) |
0.1 | 0.2 | GO:0018242 | protein O-linked glycosylation via serine(GO:0018242) |
0.1 | 0.2 | GO:2000384 | regulation of ectoderm development(GO:2000383) negative regulation of ectoderm development(GO:2000384) |
0.1 | 0.1 | GO:0006041 | glucosamine metabolic process(GO:0006041) |
0.1 | 0.3 | GO:0034139 | regulation of toll-like receptor 3 signaling pathway(GO:0034139) |
0.1 | 0.4 | GO:0098535 | de novo centriole assembly(GO:0098535) |
0.1 | 0.3 | GO:0090073 | positive regulation of protein homodimerization activity(GO:0090073) |
0.1 | 0.6 | GO:0015824 | proline transport(GO:0015824) |
0.1 | 0.3 | GO:0032066 | nucleolus to nucleoplasm transport(GO:0032066) |
0.1 | 0.4 | GO:1902459 | positive regulation of stem cell population maintenance(GO:1902459) |
0.1 | 0.1 | GO:0021603 | cranial nerve formation(GO:0021603) |
0.1 | 0.3 | GO:0038031 | non-canonical Wnt signaling pathway via MAPK cascade(GO:0038030) non-canonical Wnt signaling pathway via JNK cascade(GO:0038031) |
0.1 | 0.1 | GO:0045053 | protein retention in Golgi apparatus(GO:0045053) |
0.1 | 0.3 | GO:0086036 | regulation of cardiac muscle cell membrane potential(GO:0086036) |
0.1 | 0.4 | GO:0010499 | proteasomal ubiquitin-independent protein catabolic process(GO:0010499) |
0.1 | 0.3 | GO:0019230 | proprioception(GO:0019230) |
0.1 | 2.7 | GO:0006958 | complement activation, classical pathway(GO:0006958) |
0.1 | 1.9 | GO:0031294 | lymphocyte costimulation(GO:0031294) T cell costimulation(GO:0031295) |
0.1 | 0.9 | GO:0001867 | complement activation, lectin pathway(GO:0001867) |
0.1 | 0.2 | GO:0071651 | positive regulation of chemokine (C-C motif) ligand 5 production(GO:0071651) |
0.1 | 0.4 | GO:0044838 | cell quiescence(GO:0044838) |
0.1 | 0.3 | GO:0032196 | transposition(GO:0032196) |
0.1 | 0.4 | GO:0061042 | vascular wound healing(GO:0061042) |
0.1 | 0.1 | GO:0038128 | ERBB2 signaling pathway(GO:0038128) |
0.1 | 0.6 | GO:0031936 | negative regulation of chromatin silencing(GO:0031936) |
0.1 | 0.3 | GO:0035521 | monoubiquitinated histone deubiquitination(GO:0035521) monoubiquitinated histone H2A deubiquitination(GO:0035522) |
0.1 | 0.4 | GO:0010991 | negative regulation of SMAD protein complex assembly(GO:0010991) |
0.1 | 0.6 | GO:0032875 | regulation of DNA endoreduplication(GO:0032875) |
0.1 | 0.7 | GO:0042953 | lipoprotein transport(GO:0042953) lipoprotein localization(GO:0044872) |
0.1 | 0.4 | GO:0071494 | cellular response to UV-C(GO:0071494) |
0.1 | 0.4 | GO:0070966 | nuclear-transcribed mRNA catabolic process, no-go decay(GO:0070966) |
0.1 | 0.2 | GO:0007442 | hindgut morphogenesis(GO:0007442) embryonic hindgut morphogenesis(GO:0048619) hindgut development(GO:0061525) |
0.1 | 0.1 | GO:0021794 | thalamus development(GO:0021794) |
0.1 | 0.2 | GO:0060467 | negative regulation of fertilization(GO:0060467) |
0.1 | 0.6 | GO:0060042 | retina morphogenesis in camera-type eye(GO:0060042) |
0.1 | 0.2 | GO:0000012 | single strand break repair(GO:0000012) |
0.1 | 0.6 | GO:0043374 | CD8-positive, alpha-beta T cell differentiation(GO:0043374) |
0.1 | 0.9 | GO:0050966 | detection of mechanical stimulus involved in sensory perception of pain(GO:0050966) |
0.1 | 1.0 | GO:0000052 | citrulline metabolic process(GO:0000052) |
0.1 | 0.2 | GO:0008065 | establishment of blood-nerve barrier(GO:0008065) |
0.1 | 2.4 | GO:0021954 | central nervous system neuron development(GO:0021954) |
0.1 | 0.1 | GO:0048370 | lateral mesoderm morphogenesis(GO:0048369) lateral mesoderm formation(GO:0048370) lateral mesodermal cell differentiation(GO:0048371) |
0.1 | 0.3 | GO:0060005 | vestibular reflex(GO:0060005) |
0.1 | 0.1 | GO:0071930 | negative regulation of transcription involved in G1/S transition of mitotic cell cycle(GO:0071930) |
0.1 | 0.4 | GO:0070544 | histone H3-K36 demethylation(GO:0070544) |
0.1 | 0.6 | GO:0006610 | ribosomal protein import into nucleus(GO:0006610) |
0.1 | 0.2 | GO:0006930 | substrate-dependent cell migration, cell extension(GO:0006930) |
0.1 | 0.3 | GO:0070127 | tRNA aminoacylation for mitochondrial protein translation(GO:0070127) |
0.1 | 0.3 | GO:0035562 | negative regulation of chromatin binding(GO:0035562) |
0.1 | 0.3 | GO:0032827 | natural killer cell differentiation involved in immune response(GO:0002325) negative regulation of natural killer cell differentiation(GO:0032824) regulation of natural killer cell differentiation involved in immune response(GO:0032826) negative regulation of natural killer cell differentiation involved in immune response(GO:0032827) |
0.1 | 0.3 | GO:0044038 | cell wall mannoprotein biosynthetic process(GO:0000032) mannoprotein metabolic process(GO:0006056) mannoprotein biosynthetic process(GO:0006057) cell wall glycoprotein biosynthetic process(GO:0031506) cell wall biogenesis(GO:0042546) cell wall macromolecule biosynthetic process(GO:0044038) chain elongation of O-linked mannose residue(GO:0044845) cellular component macromolecule biosynthetic process(GO:0070589) |
0.1 | 2.6 | GO:0090307 | mitotic spindle assembly(GO:0090307) microtubule cytoskeleton organization involved in mitosis(GO:1902850) |
0.1 | 1.2 | GO:0042104 | positive regulation of activated T cell proliferation(GO:0042104) |
0.1 | 0.4 | GO:0032324 | Mo-molybdopterin cofactor biosynthetic process(GO:0006777) Mo-molybdopterin cofactor metabolic process(GO:0019720) molybdopterin cofactor biosynthetic process(GO:0032324) molybdopterin cofactor metabolic process(GO:0043545) prosthetic group metabolic process(GO:0051189) |
0.1 | 1.2 | GO:0008347 | glial cell migration(GO:0008347) |
0.1 | 0.4 | GO:0051131 | chaperone-mediated protein complex assembly(GO:0051131) |
0.1 | 0.1 | GO:0090135 | actin filament branching(GO:0090135) |
0.1 | 0.3 | GO:0048318 | axial mesoderm development(GO:0048318) |
0.1 | 1.0 | GO:0006303 | double-strand break repair via nonhomologous end joining(GO:0006303) |
0.1 | 0.5 | GO:0061032 | visceral serous pericardium development(GO:0061032) |
0.1 | 0.6 | GO:0032471 | negative regulation of endoplasmic reticulum calcium ion concentration(GO:0032471) |
0.1 | 11.4 | GO:0007018 | microtubule-based movement(GO:0007018) |
0.1 | 0.2 | GO:0090166 | Golgi disassembly(GO:0090166) |
0.1 | 0.3 | GO:0019509 | L-methionine biosynthetic process from methylthioadenosine(GO:0019509) |
0.1 | 0.2 | GO:0030576 | Cajal body organization(GO:0030576) |
0.1 | 0.1 | GO:0060161 | positive regulation of dopamine receptor signaling pathway(GO:0060161) |
0.1 | 0.2 | GO:0010911 | regulation of isomerase activity(GO:0010911) positive regulation of isomerase activity(GO:0010912) |
0.1 | 0.2 | GO:0035523 | protein K29-linked deubiquitination(GO:0035523) protein K33-linked deubiquitination(GO:1990168) |
0.1 | 0.2 | GO:1903371 | regulation of endoplasmic reticulum tubular network organization(GO:1903371) |
0.1 | 0.7 | GO:0042711 | maternal behavior(GO:0042711) |
0.1 | 4.6 | GO:1903955 | positive regulation of protein targeting to mitochondrion(GO:1903955) |
0.1 | 3.4 | GO:0001580 | detection of chemical stimulus involved in sensory perception of bitter taste(GO:0001580) |
0.1 | 0.2 | GO:0033058 | directional locomotion(GO:0033058) |
0.1 | 0.2 | GO:0048003 | antigen processing and presentation of lipid antigen via MHC class Ib(GO:0048003) antigen processing and presentation, exogenous lipid antigen via MHC class Ib(GO:0048007) |
0.1 | 1.9 | GO:0008542 | visual learning(GO:0008542) |
0.1 | 0.1 | GO:0042538 | hyperosmotic salinity response(GO:0042538) |
0.1 | 0.1 | GO:0070571 | negative regulation of neuron projection regeneration(GO:0070571) |
0.1 | 0.1 | GO:0021797 | forebrain anterior/posterior pattern specification(GO:0021797) |
0.1 | 0.1 | GO:0042360 | vitamin E metabolic process(GO:0042360) |
0.1 | 0.3 | GO:0007343 | egg activation(GO:0007343) |
0.1 | 0.1 | GO:1903753 | negative regulation of p38MAPK cascade(GO:1903753) |
0.1 | 0.3 | GO:0019919 | peptidyl-arginine methylation, to asymmetrical-dimethyl arginine(GO:0019919) |
0.1 | 0.4 | GO:0010457 | centriole-centriole cohesion(GO:0010457) |
0.1 | 0.2 | GO:0061727 | methylglyoxal catabolic process to D-lactate via S-lactoyl-glutathione(GO:0019243) methylglyoxal catabolic process(GO:0051596) methylglyoxal catabolic process to lactate(GO:0061727) |
0.1 | 0.9 | GO:0007628 | adult walking behavior(GO:0007628) walking behavior(GO:0090659) |
0.1 | 0.1 | GO:0060800 | regulation of cell differentiation involved in embryonic placenta development(GO:0060800) |
0.1 | 0.1 | GO:0086013 | membrane repolarization during cardiac muscle cell action potential(GO:0086013) |
0.1 | 0.3 | GO:0070914 | UV-damage excision repair(GO:0070914) |
0.1 | 0.1 | GO:0060762 | regulation of branching involved in mammary gland duct morphogenesis(GO:0060762) |
0.1 | 1.8 | GO:0050775 | positive regulation of dendrite morphogenesis(GO:0050775) |
0.1 | 1.7 | GO:0060113 | inner ear receptor cell differentiation(GO:0060113) |
0.1 | 0.1 | GO:0007638 | mechanosensory behavior(GO:0007638) |
0.1 | 0.1 | GO:1903911 | positive regulation of postsynaptic membrane organization(GO:1901628) positive regulation of receptor clustering(GO:1903911) regulation of skeletal muscle acetylcholine-gated channel clustering(GO:1904393) positive regulation of skeletal muscle acetylcholine-gated channel clustering(GO:1904395) |
0.1 | 0.4 | GO:0044090 | positive regulation of vacuole organization(GO:0044090) |
0.1 | 0.1 | GO:0097113 | AMPA glutamate receptor clustering(GO:0097113) glutamate receptor clustering(GO:0097688) |
0.1 | 0.5 | GO:0000467 | exonucleolytic trimming involved in rRNA processing(GO:0000459) exonucleolytic trimming to generate mature 3'-end of 5.8S rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000467) |
0.1 | 0.1 | GO:0002741 | positive regulation of cytokine secretion involved in immune response(GO:0002741) |
0.1 | 0.7 | GO:2000311 | regulation of alpha-amino-3-hydroxy-5-methyl-4-isoxazole propionate selective glutamate receptor activity(GO:2000311) |
0.1 | 0.2 | GO:0016103 | diterpenoid catabolic process(GO:0016103) retinoic acid catabolic process(GO:0034653) |
0.1 | 0.1 | GO:0048755 | branching morphogenesis of a nerve(GO:0048755) |
0.1 | 0.3 | GO:0000727 | double-strand break repair via break-induced replication(GO:0000727) |
0.1 | 1.7 | GO:0001541 | ovarian follicle development(GO:0001541) |
0.1 | 0.2 | GO:0061684 | chaperone-mediated autophagy(GO:0061684) |
0.1 | 0.1 | GO:0030497 | fatty acid elongation(GO:0030497) |
0.1 | 0.7 | GO:0021591 | ventricular system development(GO:0021591) |
0.1 | 0.7 | GO:0035879 | lactate transport(GO:0015727) lactate transmembrane transport(GO:0035873) plasma membrane lactate transport(GO:0035879) |
0.1 | 0.1 | GO:0031272 | pseudopodium assembly(GO:0031269) regulation of pseudopodium assembly(GO:0031272) |
0.1 | 0.2 | GO:0006393 | termination of mitochondrial transcription(GO:0006393) |
0.1 | 0.5 | GO:0016127 | cholesterol catabolic process(GO:0006707) sterol catabolic process(GO:0016127) |
0.1 | 0.2 | GO:2000484 | positive regulation of interleukin-8 secretion(GO:2000484) |
0.1 | 0.1 | GO:0003253 | cardiac neural crest cell migration involved in outflow tract morphogenesis(GO:0003253) |
0.1 | 0.5 | GO:0097352 | autophagosome maturation(GO:0097352) |
0.1 | 1.0 | GO:0005980 | glycogen catabolic process(GO:0005980) glucan catabolic process(GO:0009251) cellular polysaccharide catabolic process(GO:0044247) |
0.1 | 0.2 | GO:0033564 | anterior/posterior axon guidance(GO:0033564) |
0.1 | 0.2 | GO:2000675 | negative regulation of type B pancreatic cell apoptotic process(GO:2000675) |
0.1 | 0.6 | GO:0072662 | protein targeting to peroxisome(GO:0006625) peroxisomal transport(GO:0043574) protein localization to peroxisome(GO:0072662) establishment of protein localization to peroxisome(GO:0072663) |
0.1 | 0.1 | GO:2000224 | regulation of testosterone biosynthetic process(GO:2000224) |
0.1 | 0.1 | GO:0021764 | amygdala development(GO:0021764) |
0.1 | 0.3 | GO:0097094 | craniofacial suture morphogenesis(GO:0097094) |
0.1 | 0.3 | GO:0051532 | regulation of NFAT protein import into nucleus(GO:0051532) |
0.1 | 0.2 | GO:0030321 | transepithelial chloride transport(GO:0030321) |
0.1 | 0.4 | GO:0002052 | positive regulation of neuroblast proliferation(GO:0002052) |
0.1 | 1.2 | GO:0050885 | neuromuscular process controlling balance(GO:0050885) |
0.1 | 0.4 | GO:0022027 | interkinetic nuclear migration(GO:0022027) |
0.1 | 0.2 | GO:0035520 | monoubiquitinated protein deubiquitination(GO:0035520) |
0.1 | 0.2 | GO:0033182 | regulation of histone ubiquitination(GO:0033182) |
0.1 | 0.6 | GO:0042417 | dopamine metabolic process(GO:0042417) |
0.1 | 1.0 | GO:0032981 | NADH dehydrogenase complex assembly(GO:0010257) mitochondrial respiratory chain complex I assembly(GO:0032981) mitochondrial respiratory chain complex I biogenesis(GO:0097031) |
0.1 | 0.1 | GO:1904017 | response to Thyroglobulin triiodothyronine(GO:1904016) cellular response to Thyroglobulin triiodothyronine(GO:1904017) |
0.1 | 0.1 | GO:1901187 | regulation of ephrin receptor signaling pathway(GO:1901187) |
0.1 | 0.7 | GO:0008608 | attachment of spindle microtubules to kinetochore(GO:0008608) |
0.1 | 0.1 | GO:0035790 | platelet-derived growth factor receptor-alpha signaling pathway(GO:0035790) |
0.1 | 0.1 | GO:0006600 | creatine metabolic process(GO:0006600) |
0.1 | 0.9 | GO:0033539 | fatty acid beta-oxidation using acyl-CoA dehydrogenase(GO:0033539) |
0.1 | 0.4 | GO:0015074 | DNA integration(GO:0015074) |
0.1 | 0.2 | GO:0043558 | regulation of translational initiation in response to stress(GO:0043558) |
0.1 | 0.2 | GO:0006689 | ganglioside catabolic process(GO:0006689) |
0.1 | 0.1 | GO:0001923 | B-1 B cell differentiation(GO:0001923) |
0.1 | 0.1 | GO:0061418 | regulation of transcription from RNA polymerase II promoter in response to hypoxia(GO:0061418) |
0.1 | 0.1 | GO:0051095 | regulation of helicase activity(GO:0051095) positive regulation of helicase activity(GO:0051096) |
0.1 | 0.1 | GO:0061010 | gall bladder development(GO:0061010) |
0.1 | 0.1 | GO:0009111 | vitamin catabolic process(GO:0009111) fat-soluble vitamin catabolic process(GO:0042363) |
0.1 | 0.3 | GO:1903012 | positive regulation of bone development(GO:1903012) |
0.1 | 0.3 | GO:0090308 | regulation of methylation-dependent chromatin silencing(GO:0090308) |
0.1 | 0.2 | GO:0010155 | regulation of proton transport(GO:0010155) |
0.1 | 0.2 | GO:0051771 | negative regulation of nitric-oxide synthase biosynthetic process(GO:0051771) |
0.1 | 0.6 | GO:0000290 | deadenylation-dependent decapping of nuclear-transcribed mRNA(GO:0000290) |
0.1 | 0.1 | GO:0031133 | regulation of axon diameter(GO:0031133) |
0.1 | 1.0 | GO:0034198 | cellular response to amino acid starvation(GO:0034198) |
0.1 | 0.1 | GO:0045404 | positive regulation of interleukin-4 biosynthetic process(GO:0045404) |
0.1 | 0.2 | GO:0048625 | myoblast fate commitment(GO:0048625) |
0.1 | 0.1 | GO:0006407 | rRNA export from nucleus(GO:0006407) |
0.1 | 0.1 | GO:0002071 | glandular epithelial cell maturation(GO:0002071) |
0.1 | 0.8 | GO:0010569 | regulation of double-strand break repair via homologous recombination(GO:0010569) |
0.1 | 0.2 | GO:0035633 | maintenance of blood-brain barrier(GO:0035633) |
0.1 | 0.3 | GO:0010165 | response to X-ray(GO:0010165) |
0.1 | 0.1 | GO:1904707 | positive regulation of vascular smooth muscle cell proliferation(GO:1904707) |
0.1 | 0.3 | GO:1902916 | positive regulation of protein polyubiquitination(GO:1902916) |
0.1 | 0.1 | GO:0036006 | response to macrophage colony-stimulating factor(GO:0036005) cellular response to macrophage colony-stimulating factor stimulus(GO:0036006) |
0.1 | 0.1 | GO:0010897 | negative regulation of triglyceride catabolic process(GO:0010897) |
0.1 | 1.1 | GO:0006379 | mRNA cleavage(GO:0006379) |
0.1 | 0.1 | GO:0035582 | sequestering of BMP in extracellular matrix(GO:0035582) |
0.1 | 0.1 | GO:0000963 | mitochondrial RNA processing(GO:0000963) |
0.1 | 0.6 | GO:0031648 | protein destabilization(GO:0031648) |
0.1 | 0.1 | GO:0046013 | T cell homeostatic proliferation(GO:0001777) regulation of T cell homeostatic proliferation(GO:0046013) |
0.1 | 0.4 | GO:0006072 | glycerol-3-phosphate metabolic process(GO:0006072) |
0.1 | 1.0 | GO:0006376 | mRNA splice site selection(GO:0006376) |
0.1 | 0.1 | GO:0006419 | alanyl-tRNA aminoacylation(GO:0006419) |
0.1 | 0.2 | GO:0042415 | norepinephrine metabolic process(GO:0042415) |
0.1 | 0.2 | GO:0048935 | peripheral nervous system neuron differentiation(GO:0048934) peripheral nervous system neuron development(GO:0048935) |
0.1 | 0.5 | GO:0036065 | fucosylation(GO:0036065) |
0.1 | 1.1 | GO:0010524 | positive regulation of calcium ion transport into cytosol(GO:0010524) |
0.1 | 0.1 | GO:0099622 | cardiac muscle cell membrane repolarization(GO:0099622) |
0.1 | 0.8 | GO:0006378 | mRNA polyadenylation(GO:0006378) RNA polyadenylation(GO:0043631) |
0.1 | 0.1 | GO:0061073 | ciliary body morphogenesis(GO:0061073) |
0.1 | 0.1 | GO:0060394 | negative regulation of pathway-restricted SMAD protein phosphorylation(GO:0060394) |
0.1 | 0.6 | GO:2001222 | regulation of neuron migration(GO:2001222) |
0.1 | 0.3 | GO:0042737 | drug catabolic process(GO:0042737) |
0.1 | 0.1 | GO:0035887 | aortic smooth muscle cell differentiation(GO:0035887) |
0.1 | 0.2 | GO:0006667 | sphinganine metabolic process(GO:0006667) |
0.1 | 0.1 | GO:0032497 | detection of lipopolysaccharide(GO:0032497) |
0.1 | 0.3 | GO:1902231 | positive regulation of intrinsic apoptotic signaling pathway in response to DNA damage(GO:1902231) |
0.1 | 0.1 | GO:0090188 | negative regulation of pancreatic juice secretion(GO:0090188) |
0.0 | 0.4 | GO:0046325 | negative regulation of glucose import(GO:0046325) |
0.0 | 1.2 | GO:0045104 | intermediate filament cytoskeleton organization(GO:0045104) |
0.0 | 0.1 | GO:0031117 | positive regulation of microtubule depolymerization(GO:0031117) |
0.0 | 0.1 | GO:0048845 | venous blood vessel morphogenesis(GO:0048845) |
0.0 | 0.0 | GO:0098700 | aminergic neurotransmitter loading into synaptic vesicle(GO:0015842) neurotransmitter loading into synaptic vesicle(GO:0098700) |
0.0 | 0.1 | GO:0060973 | cell migration involved in heart development(GO:0060973) |
0.0 | 0.1 | GO:0090261 | positive regulation of inclusion body assembly(GO:0090261) |
0.0 | 0.0 | GO:0060591 | chondroblast differentiation(GO:0060591) |
0.0 | 0.1 | GO:0010606 | positive regulation of cytoplasmic mRNA processing body assembly(GO:0010606) |
0.0 | 0.2 | GO:2000672 | negative regulation of motor neuron apoptotic process(GO:2000672) |
0.0 | 0.1 | GO:0003203 | endocardial cushion morphogenesis(GO:0003203) |
0.0 | 0.1 | GO:0007501 | mesodermal cell fate specification(GO:0007501) |
0.0 | 0.1 | GO:0070314 | G1 to G0 transition(GO:0070314) |
0.0 | 0.2 | GO:0043970 | histone H3-K9 acetylation(GO:0043970) |
0.0 | 0.1 | GO:0007525 | somatic muscle development(GO:0007525) |
0.0 | 0.1 | GO:0045040 | protein import into mitochondrial outer membrane(GO:0045040) |
0.0 | 0.2 | GO:1903546 | protein localization to photoreceptor outer segment(GO:1903546) |
0.0 | 0.1 | GO:0006370 | 7-methylguanosine mRNA capping(GO:0006370) |
0.0 | 0.2 | GO:0032049 | cardiolipin biosynthetic process(GO:0032049) |
0.0 | 0.0 | GO:0021554 | optic nerve development(GO:0021554) |
0.0 | 0.1 | GO:0048312 | intracellular distribution of mitochondria(GO:0048312) |
0.0 | 0.0 | GO:0007161 | calcium-independent cell-matrix adhesion(GO:0007161) |
0.0 | 0.0 | GO:0061307 | cardiac neural crest cell differentiation involved in heart development(GO:0061307) |
0.0 | 0.2 | GO:0016045 | detection of bacterium(GO:0016045) detection of other organism(GO:0098543) |
0.0 | 0.4 | GO:1903205 | regulation of hydrogen peroxide-induced cell death(GO:1903205) |
0.0 | 0.6 | GO:0043968 | histone H2A acetylation(GO:0043968) |
0.0 | 0.1 | GO:0019448 | cysteine catabolic process(GO:0009093) L-cysteine catabolic process(GO:0019448) L-cysteine metabolic process(GO:0046439) |
0.0 | 0.3 | GO:1900262 | regulation of DNA-directed DNA polymerase activity(GO:1900262) positive regulation of DNA-directed DNA polymerase activity(GO:1900264) |
0.0 | 0.0 | GO:1902023 | L-arginine import(GO:0043091) arginine import(GO:0090467) L-arginine transport(GO:1902023) |
0.0 | 0.0 | GO:2000664 | positive regulation of interleukin-5 secretion(GO:2000664) positive regulation of interleukin-13 secretion(GO:2000667) |
0.0 | 0.5 | GO:0007190 | activation of adenylate cyclase activity(GO:0007190) |
0.0 | 0.3 | GO:0007197 | adenylate cyclase-inhibiting G-protein coupled acetylcholine receptor signaling pathway(GO:0007197) phospholipase C-activating G-protein coupled acetylcholine receptor signaling pathway(GO:0007207) |
0.0 | 0.2 | GO:0009146 | purine nucleoside triphosphate catabolic process(GO:0009146) |
0.0 | 0.3 | GO:0010738 | regulation of protein kinase A signaling(GO:0010738) |
0.0 | 0.5 | GO:0016486 | peptide hormone processing(GO:0016486) |
0.0 | 3.5 | GO:0008360 | regulation of cell shape(GO:0008360) |
0.0 | 0.1 | GO:0071397 | cellular response to cholesterol(GO:0071397) |
0.0 | 0.0 | GO:0014012 | peripheral nervous system axon regeneration(GO:0014012) |
0.0 | 0.4 | GO:0045948 | positive regulation of translational initiation(GO:0045948) |
0.0 | 0.2 | GO:1901341 | activation of store-operated calcium channel activity(GO:0032237) positive regulation of store-operated calcium channel activity(GO:1901341) |
0.0 | 0.0 | GO:0014045 | establishment of endothelial blood-brain barrier(GO:0014045) |
0.0 | 0.1 | GO:0032482 | Rab protein signal transduction(GO:0032482) |
0.0 | 0.0 | GO:1902262 | apoptotic process involved in patterning of blood vessels(GO:1902262) |
0.0 | 0.1 | GO:0032596 | protein transport into membrane raft(GO:0032596) |
0.0 | 0.1 | GO:0061046 | foregut regionalization(GO:0060423) lung field specification(GO:0060424) lung induction(GO:0060492) regulation of branching involved in lung morphogenesis(GO:0061046) |
0.0 | 0.0 | GO:0046098 | guanine metabolic process(GO:0046098) |
0.0 | 0.1 | GO:0039535 | regulation of RIG-I signaling pathway(GO:0039535) |
0.0 | 0.1 | GO:0006677 | glycosylceramide metabolic process(GO:0006677) |
0.0 | 0.1 | GO:0071712 | ER-associated misfolded protein catabolic process(GO:0071712) |
0.0 | 0.1 | GO:2000193 | positive regulation of fatty acid transport(GO:2000193) |
0.0 | 0.3 | GO:0032988 | ribonucleoprotein complex disassembly(GO:0032988) |
0.0 | 0.0 | GO:0010737 | protein kinase A signaling(GO:0010737) |
0.0 | 0.1 | GO:0015860 | purine nucleoside transmembrane transport(GO:0015860) purine-containing compound transmembrane transport(GO:0072530) nucleoside transmembrane transport(GO:1901642) |
0.0 | 0.0 | GO:0046607 | positive regulation of centrosome cycle(GO:0046607) |
0.0 | 0.1 | GO:0048304 | positive regulation of isotype switching to IgG isotypes(GO:0048304) |
0.0 | 0.2 | GO:0002051 | osteoblast fate commitment(GO:0002051) |
0.0 | 0.3 | GO:0002092 | positive regulation of receptor internalization(GO:0002092) |
0.0 | 0.1 | GO:0001732 | formation of cytoplasmic translation initiation complex(GO:0001732) |
0.0 | 0.0 | GO:0051665 | membrane raft localization(GO:0051665) |
0.0 | 0.2 | GO:0043476 | pigment accumulation(GO:0043476) |
0.0 | 0.2 | GO:0007202 | activation of phospholipase C activity(GO:0007202) |
0.0 | 0.2 | GO:0016242 | negative regulation of macroautophagy(GO:0016242) |
0.0 | 0.1 | GO:0006435 | threonyl-tRNA aminoacylation(GO:0006435) |
0.0 | 0.2 | GO:0019695 | choline metabolic process(GO:0019695) |
0.0 | 0.1 | GO:0045041 | protein import into mitochondrial intermembrane space(GO:0045041) |
0.0 | 0.2 | GO:0044829 | positive regulation by host of viral genome replication(GO:0044829) |
0.0 | 0.2 | GO:0034242 | negative regulation of syncytium formation by plasma membrane fusion(GO:0034242) |
0.0 | 0.0 | GO:0086042 | cardiac muscle cell-cardiac muscle cell adhesion(GO:0086042) |
0.0 | 0.1 | GO:0051105 | regulation of DNA ligation(GO:0051105) positive regulation of DNA ligation(GO:0051106) |
0.0 | 0.0 | GO:0060528 | secretory columnal luminar epithelial cell differentiation involved in prostate glandular acinus development(GO:0060528) |
0.0 | 0.1 | GO:0036233 | glycine import(GO:0036233) |
0.0 | 0.0 | GO:0032364 | oxygen homeostasis(GO:0032364) |
0.0 | 0.3 | GO:0042989 | sequestering of actin monomers(GO:0042989) |
0.0 | 0.1 | GO:0002291 | T cell activation via T cell receptor contact with antigen bound to MHC molecule on antigen presenting cell(GO:0002291) |
0.0 | 0.0 | GO:0002666 | positive regulation of T cell tolerance induction(GO:0002666) |
0.0 | 1.4 | GO:0002181 | cytoplasmic translation(GO:0002181) |
0.0 | 0.1 | GO:0030091 | protein repair(GO:0030091) |
0.0 | 0.0 | GO:0038044 | transforming growth factor-beta secretion(GO:0038044) regulation of transforming growth factor-beta secretion(GO:2001201) |
0.0 | 0.1 | GO:0070458 | detoxification of nitrogen compound(GO:0051410) cellular detoxification of nitrogen compound(GO:0070458) |
0.0 | 0.3 | GO:0050962 | detection of light stimulus involved in visual perception(GO:0050908) detection of light stimulus involved in sensory perception(GO:0050962) |
0.0 | 0.0 | GO:0010749 | regulation of nitric oxide mediated signal transduction(GO:0010749) |
0.0 | 0.5 | GO:0006308 | DNA catabolic process(GO:0006308) |
0.0 | 0.1 | GO:0030388 | fructose 1,6-bisphosphate metabolic process(GO:0030388) |
0.0 | 0.0 | GO:2000118 | sodium-dependent phosphate transport(GO:0044341) regulation of sodium-dependent phosphate transport(GO:2000118) |
0.0 | 0.1 | GO:0052405 | negative regulation by host of symbiont molecular function(GO:0052405) modification by host of symbiont molecular function(GO:0052428) |
0.0 | 0.1 | GO:1900748 | positive regulation of vascular endothelial growth factor signaling pathway(GO:1900748) |
0.0 | 0.2 | GO:0006620 | posttranslational protein targeting to membrane(GO:0006620) |
0.0 | 0.0 | GO:0046514 | ceramide catabolic process(GO:0046514) |
0.0 | 0.0 | GO:0016078 | tRNA catabolic process(GO:0016078) |
0.0 | 0.0 | GO:2000209 | regulation of anoikis(GO:2000209) |
0.0 | 0.1 | GO:0048333 | mesodermal cell differentiation(GO:0048333) |
0.0 | 0.0 | GO:0002840 | T cell mediated immune response to tumor cell(GO:0002424) regulation of T cell mediated immune response to tumor cell(GO:0002840) |
0.0 | 0.0 | GO:2000020 | positive regulation of male gonad development(GO:2000020) |
0.0 | 0.2 | GO:0060158 | phospholipase C-activating dopamine receptor signaling pathway(GO:0060158) |
0.0 | 0.1 | GO:0007220 | Notch receptor processing(GO:0007220) |
0.0 | 0.1 | GO:0046501 | protoporphyrinogen IX metabolic process(GO:0046501) |
0.0 | 0.1 | GO:0001915 | negative regulation of T cell mediated cytotoxicity(GO:0001915) |
0.0 | 0.5 | GO:0061099 | negative regulation of protein tyrosine kinase activity(GO:0061099) |
0.0 | 0.2 | GO:0050974 | detection of mechanical stimulus involved in sensory perception(GO:0050974) |
0.0 | 0.1 | GO:0044375 | regulation of peroxisome size(GO:0044375) |
0.0 | 0.1 | GO:0002408 | myeloid dendritic cell chemotaxis(GO:0002408) |
0.0 | 0.0 | GO:1902445 | regulation of mitochondrial membrane permeability involved in programmed necrotic cell death(GO:1902445) |
0.0 | 0.0 | GO:0060020 | Bergmann glial cell differentiation(GO:0060020) |
0.0 | 0.1 | GO:1902093 | positive regulation of sperm motility(GO:1902093) |
0.0 | 0.0 | GO:0048680 | positive regulation of axon regeneration(GO:0048680) positive regulation of neuron projection regeneration(GO:0070572) |
0.0 | 0.1 | GO:0090148 | membrane fission(GO:0090148) |
0.0 | 0.9 | GO:0046426 | negative regulation of JAK-STAT cascade(GO:0046426) negative regulation of STAT cascade(GO:1904893) |
0.0 | 0.1 | GO:0051150 | regulation of smooth muscle cell differentiation(GO:0051150) |
0.0 | 0.2 | GO:0050435 | beta-amyloid metabolic process(GO:0050435) |
0.0 | 0.0 | GO:0051593 | response to folic acid(GO:0051593) |
0.0 | 0.1 | GO:0071609 | chemokine (C-C motif) ligand 5 production(GO:0071609) |
0.0 | 0.1 | GO:0042276 | error-prone translesion synthesis(GO:0042276) |
0.0 | 0.0 | GO:0071692 | protein localization to extracellular region(GO:0071692) maintenance of protein location in extracellular region(GO:0071694) |
0.0 | 0.4 | GO:0032008 | positive regulation of TOR signaling(GO:0032008) |
0.0 | 1.0 | GO:0070098 | chemokine-mediated signaling pathway(GO:0070098) |
0.0 | 0.0 | GO:0043084 | penile erection(GO:0043084) |
0.0 | 0.2 | GO:0030643 | cellular phosphate ion homeostasis(GO:0030643) cellular trivalent inorganic anion homeostasis(GO:0072502) |
0.0 | 0.1 | GO:0070295 | renal water absorption(GO:0070295) |
0.0 | 0.2 | GO:0045579 | positive regulation of B cell differentiation(GO:0045579) |
0.0 | 0.0 | GO:1901856 | negative regulation of cellular respiration(GO:1901856) regulation of mitochondrial electron transport, NADH to ubiquinone(GO:1902956) |
0.0 | 0.0 | GO:0039530 | MDA-5 signaling pathway(GO:0039530) |
0.0 | 0.1 | GO:1903887 | motile primary cilium assembly(GO:1903887) |
0.0 | 0.5 | GO:0030574 | collagen catabolic process(GO:0030574) |
0.0 | 0.1 | GO:0044065 | regulation of respiratory system process(GO:0044065) |
0.0 | 0.1 | GO:0014857 | regulation of skeletal muscle cell proliferation(GO:0014857) |
0.0 | 0.0 | GO:0086065 | cell communication involved in cardiac conduction(GO:0086065) |
0.0 | 0.0 | GO:0002017 | regulation of blood volume by renal aldosterone(GO:0002017) |
0.0 | 0.1 | GO:0070940 | dephosphorylation of RNA polymerase II C-terminal domain(GO:0070940) |
0.0 | 0.0 | GO:0019934 | cGMP-mediated signaling(GO:0019934) |
0.0 | 0.1 | GO:0018202 | peptidyl-histidine modification(GO:0018202) |
0.0 | 0.1 | GO:0007210 | serotonin receptor signaling pathway(GO:0007210) |
0.0 | 0.1 | GO:0006624 | vacuolar protein processing(GO:0006624) |
0.0 | 0.0 | GO:0035898 | parathyroid hormone secretion(GO:0035898) |
0.0 | 0.1 | GO:0055022 | negative regulation of cardiac muscle tissue growth(GO:0055022) negative regulation of cardiac muscle cell proliferation(GO:0060044) negative regulation of heart growth(GO:0061117) |
0.0 | 0.1 | GO:0032486 | Rap protein signal transduction(GO:0032486) |
0.0 | 0.3 | GO:0043687 | post-translational protein modification(GO:0043687) |
0.0 | 0.0 | GO:1900041 | negative regulation of interleukin-2 secretion(GO:1900041) |
0.0 | 0.1 | GO:0000733 | DNA strand renaturation(GO:0000733) |
0.0 | 0.1 | GO:0097411 | hypoxia-inducible factor-1alpha signaling pathway(GO:0097411) |
0.0 | 0.1 | GO:0005513 | detection of calcium ion(GO:0005513) |
0.0 | 0.1 | GO:0010728 | regulation of hydrogen peroxide biosynthetic process(GO:0010728) |
0.0 | 0.1 | GO:0001561 | fatty acid alpha-oxidation(GO:0001561) |
0.0 | 0.0 | GO:0048385 | regulation of retinoic acid receptor signaling pathway(GO:0048385) |
0.0 | 0.1 | GO:0033147 | negative regulation of intracellular estrogen receptor signaling pathway(GO:0033147) |
0.0 | 0.0 | GO:0031999 | negative regulation of fatty acid beta-oxidation(GO:0031999) |
0.0 | 0.0 | GO:0003062 | regulation of heart rate by chemical signal(GO:0003062) |
0.0 | 0.1 | GO:0035315 | hair cell differentiation(GO:0035315) |
0.0 | 0.1 | GO:2000197 | regulation of mRNA export from nucleus(GO:0010793) regulation of ribonucleoprotein complex localization(GO:2000197) |
0.0 | 0.1 | GO:0097211 | response to gonadotropin-releasing hormone(GO:0097210) cellular response to gonadotropin-releasing hormone(GO:0097211) |
0.0 | 0.1 | GO:0045653 | negative regulation of megakaryocyte differentiation(GO:0045653) |
0.0 | 0.0 | GO:1901339 | regulation of store-operated calcium channel activity(GO:1901339) |
0.0 | 0.1 | GO:1904996 | positive regulation of leukocyte adhesion to vascular endothelial cell(GO:1904996) |
0.0 | 0.1 | GO:0045759 | negative regulation of action potential(GO:0045759) |
0.0 | 0.1 | GO:0070235 | regulation of activation-induced cell death of T cells(GO:0070235) |
0.0 | 0.1 | GO:0042078 | germ-line stem cell division(GO:0042078) male germ-line stem cell asymmetric division(GO:0048133) germline stem cell asymmetric division(GO:0098728) |
0.0 | 0.1 | GO:0006562 | proline catabolic process(GO:0006562) |
0.0 | 0.1 | GO:0072017 | distal tubule development(GO:0072017) |
0.0 | 0.0 | GO:0060331 | negative regulation of response to interferon-gamma(GO:0060331) negative regulation of interferon-gamma-mediated signaling pathway(GO:0060336) |
0.0 | 0.0 | GO:0007223 | Wnt signaling pathway, calcium modulating pathway(GO:0007223) embryonic genitalia morphogenesis(GO:0030538) |
0.0 | 0.1 | GO:0045910 | negative regulation of DNA recombination(GO:0045910) |
0.0 | 0.1 | GO:0002438 | acute inflammatory response to antigenic stimulus(GO:0002438) |
0.0 | 0.2 | GO:0030238 | male sex determination(GO:0030238) |
0.0 | 0.1 | GO:0016556 | mRNA modification(GO:0016556) |
0.0 | 0.5 | GO:1902476 | chloride transmembrane transport(GO:1902476) |
0.0 | 0.0 | GO:0043031 | negative regulation of macrophage activation(GO:0043031) |
0.0 | 0.1 | GO:2000609 | regulation of thyroid hormone generation(GO:2000609) |
0.0 | 0.0 | GO:1901843 | positive regulation of high voltage-gated calcium channel activity(GO:1901843) |
0.0 | 0.0 | GO:0045347 | negative regulation of MHC class II biosynthetic process(GO:0045347) |
0.0 | 0.0 | GO:1900620 | acetylcholine biosynthetic process(GO:0008292) acetate ester biosynthetic process(GO:1900620) |
0.0 | 0.0 | GO:0046104 | thymidine metabolic process(GO:0046104) |
0.0 | 0.2 | GO:0070498 | interleukin-1-mediated signaling pathway(GO:0070498) |
0.0 | 0.5 | GO:0006284 | base-excision repair(GO:0006284) |
0.0 | 0.2 | GO:0046827 | positive regulation of protein export from nucleus(GO:0046827) |
0.0 | 0.1 | GO:0060023 | soft palate development(GO:0060023) |
0.0 | 0.1 | GO:0071492 | cellular response to UV-A(GO:0071492) |
0.0 | 0.1 | GO:1904872 | regulation of telomerase RNA localization to Cajal body(GO:1904872) positive regulation of telomerase RNA localization to Cajal body(GO:1904874) |
0.0 | 0.0 | GO:0010918 | positive regulation of mitochondrial membrane potential(GO:0010918) |
0.0 | 0.0 | GO:0030214 | hyaluronan catabolic process(GO:0030214) |
0.0 | 0.1 | GO:0043117 | positive regulation of vascular permeability(GO:0043117) |
0.0 | 0.0 | GO:0006901 | vesicle coating(GO:0006901) vesicle targeting, rough ER to cis-Golgi(GO:0048207) COPII vesicle coating(GO:0048208) |
0.0 | 0.1 | GO:0000255 | allantoin metabolic process(GO:0000255) |
0.0 | 0.1 | GO:0015959 | diadenosine polyphosphate metabolic process(GO:0015959) |
0.0 | 0.0 | GO:0032914 | positive regulation of transforming growth factor beta1 production(GO:0032914) |
0.0 | 0.1 | GO:0006449 | regulation of translational termination(GO:0006449) |
0.0 | 0.0 | GO:0060416 | response to growth hormone(GO:0060416) |
0.0 | 0.0 | GO:0033030 | negative regulation of neutrophil apoptotic process(GO:0033030) |
0.0 | 0.0 | GO:0034115 | negative regulation of heterotypic cell-cell adhesion(GO:0034115) regulation of cell-cell adhesion involved in gastrulation(GO:0070587) |
0.0 | 0.2 | GO:0006743 | ubiquinone metabolic process(GO:0006743) ubiquinone biosynthetic process(GO:0006744) |
0.0 | 0.0 | GO:0070814 | hydrogen sulfide biosynthetic process(GO:0070814) |
0.0 | 0.0 | GO:0006659 | phosphatidylserine biosynthetic process(GO:0006659) |
0.0 | 0.0 | GO:0002386 | immune response in mucosal-associated lymphoid tissue(GO:0002386) |
0.0 | 0.1 | GO:0045721 | negative regulation of gluconeogenesis(GO:0045721) |
0.0 | 0.2 | GO:0007143 | female meiotic division(GO:0007143) |
0.0 | 0.0 | GO:0010455 | positive regulation of cell fate commitment(GO:0010455) |
0.0 | 0.0 | GO:0007199 | G-protein coupled receptor signaling pathway coupled to cGMP nucleotide second messenger(GO:0007199) |
0.0 | 0.0 | GO:0032227 | negative regulation of synaptic transmission, dopaminergic(GO:0032227) |
0.0 | 0.0 | GO:0048014 | Tie signaling pathway(GO:0048014) |
0.0 | 0.0 | GO:0071447 | cellular response to hydroperoxide(GO:0071447) |
0.0 | 0.1 | GO:0017196 | N-terminal peptidyl-methionine acetylation(GO:0017196) |
0.0 | 0.0 | GO:0097500 | receptor localization to nonmotile primary cilium(GO:0097500) |
0.0 | 0.0 | GO:0051683 | establishment of Golgi localization(GO:0051683) |
0.0 | 0.1 | GO:0050718 | positive regulation of interleukin-1 secretion(GO:0050716) positive regulation of interleukin-1 beta secretion(GO:0050718) |
0.0 | 0.0 | GO:0033227 | dsRNA transport(GO:0033227) |
0.0 | 0.0 | GO:0048840 | otolith development(GO:0048840) |
0.0 | 0.0 | GO:2000097 | regulation of smooth muscle cell-matrix adhesion(GO:2000097) |
0.0 | 0.1 | GO:0035589 | G-protein coupled purinergic nucleotide receptor signaling pathway(GO:0035589) |
0.0 | 0.0 | GO:0090168 | Golgi reassembly(GO:0090168) |
0.0 | 0.2 | GO:0042219 | cellular modified amino acid catabolic process(GO:0042219) |
0.0 | 0.1 | GO:0015812 | gamma-aminobutyric acid transport(GO:0015812) |
0.0 | 0.1 | GO:0051006 | positive regulation of lipoprotein lipase activity(GO:0051006) |
0.0 | 0.0 | GO:0021871 | forebrain regionalization(GO:0021871) |
0.0 | 0.0 | GO:1903336 | negative regulation of vacuolar transport(GO:1903336) |
0.0 | 0.0 | GO:0035507 | regulation of myosin-light-chain-phosphatase activity(GO:0035507) |
0.0 | 0.1 | GO:0086001 | cardiac muscle cell action potential(GO:0086001) |
0.0 | 0.1 | GO:2000270 | negative regulation of fibroblast apoptotic process(GO:2000270) |
0.0 | 0.2 | GO:0031146 | SCF-dependent proteasomal ubiquitin-dependent protein catabolic process(GO:0031146) |
0.0 | 0.1 | GO:1902101 | positive regulation of mitotic metaphase/anaphase transition(GO:0045842) positive regulation of metaphase/anaphase transition of cell cycle(GO:1902101) |
0.0 | 0.1 | GO:0000160 | phosphorelay signal transduction system(GO:0000160) |
0.0 | 0.3 | GO:0043171 | peptide catabolic process(GO:0043171) |
0.0 | 1.0 | GO:0048015 | phosphatidylinositol-mediated signaling(GO:0048015) |
0.0 | 0.0 | GO:1903059 | regulation of protein lipidation(GO:1903059) positive regulation of protein lipidation(GO:1903061) |
0.0 | 0.1 | GO:0051014 | actin filament severing(GO:0051014) |
0.0 | 0.1 | GO:0043276 | anoikis(GO:0043276) |
0.0 | 0.1 | GO:1901889 | negative regulation of cell junction assembly(GO:1901889) |
0.0 | 0.1 | GO:0097461 | ferric iron import(GO:0033216) ferric iron import into cell(GO:0097461) |
0.0 | 0.1 | GO:0032383 | regulation of intracellular lipid transport(GO:0032377) regulation of intracellular sterol transport(GO:0032380) regulation of intracellular cholesterol transport(GO:0032383) |
0.0 | 0.2 | GO:0001754 | eye photoreceptor cell differentiation(GO:0001754) |
0.0 | 0.0 | GO:0061146 | Peyer's patch morphogenesis(GO:0061146) |
0.0 | 0.1 | GO:0002283 | neutrophil activation involved in immune response(GO:0002283) |
0.0 | 0.0 | GO:0021523 | somatic motor neuron differentiation(GO:0021523) |
0.0 | 0.1 | GO:0035435 | phosphate ion transmembrane transport(GO:0035435) |
0.0 | 0.0 | GO:0033033 | negative regulation of myeloid cell apoptotic process(GO:0033033) |
0.0 | 0.1 | GO:0051023 | regulation of immunoglobulin secretion(GO:0051023) |
0.0 | 0.1 | GO:0006517 | protein deglycosylation(GO:0006517) |
0.0 | 0.1 | GO:0042635 | positive regulation of hair cycle(GO:0042635) |
0.0 | 0.0 | GO:1902035 | positive regulation of hematopoietic stem cell proliferation(GO:1902035) |
0.0 | 0.0 | GO:0001835 | blastocyst hatching(GO:0001835) hatching(GO:0035188) organism emergence from protective structure(GO:0071684) |
0.0 | 0.0 | GO:0071276 | cellular response to cadmium ion(GO:0071276) |
0.0 | 0.0 | GO:0018199 | peptidyl-glutamine modification(GO:0018199) |
0.0 | 0.1 | GO:1902176 | negative regulation of oxidative stress-induced intrinsic apoptotic signaling pathway(GO:1902176) |
0.0 | 0.1 | GO:1903146 | regulation of mitophagy(GO:1903146) |
0.0 | 0.0 | GO:0036022 | limb joint morphogenesis(GO:0036022) embryonic skeletal limb joint morphogenesis(GO:0036023) |
0.0 | 0.1 | GO:0001659 | temperature homeostasis(GO:0001659) |
0.0 | 0.0 | GO:0006651 | diacylglycerol biosynthetic process(GO:0006651) |
0.0 | 0.0 | GO:0008355 | olfactory learning(GO:0008355) |
0.0 | 0.0 | GO:0070842 | aggresome assembly(GO:0070842) |
0.0 | 0.0 | GO:0006273 | lagging strand elongation(GO:0006273) |
0.0 | 0.0 | GO:0060100 | positive regulation of phagocytosis, engulfment(GO:0060100) positive regulation of membrane invagination(GO:1905155) |
0.0 | 0.0 | GO:0006363 | termination of RNA polymerase I transcription(GO:0006363) |
0.0 | 0.1 | GO:0042985 | negative regulation of amyloid precursor protein biosynthetic process(GO:0042985) |
0.0 | 0.1 | GO:0090231 | regulation of spindle checkpoint(GO:0090231) |
0.0 | 0.1 | GO:0008209 | androgen metabolic process(GO:0008209) |
0.0 | 0.0 | GO:0002118 | aggressive behavior(GO:0002118) |
0.0 | 0.1 | GO:0035970 | peptidyl-threonine dephosphorylation(GO:0035970) |
0.0 | 0.0 | GO:0006741 | NADP biosynthetic process(GO:0006741) |
0.0 | 0.0 | GO:1903204 | negative regulation of oxidative stress-induced neuron death(GO:1903204) |
0.0 | 0.1 | GO:0006398 | mRNA 3'-end processing by stem-loop binding and cleavage(GO:0006398) |
0.0 | 0.0 | GO:0060618 | nipple development(GO:0060618) |
0.0 | 0.2 | GO:0071174 | negative regulation of mitotic metaphase/anaphase transition(GO:0045841) mitotic spindle checkpoint(GO:0071174) negative regulation of metaphase/anaphase transition of cell cycle(GO:1902100) negative regulation of mitotic sister chromatid separation(GO:2000816) |
0.0 | 0.0 | GO:0046952 | ketone body catabolic process(GO:0046952) |
0.0 | 0.0 | GO:0009629 | response to gravity(GO:0009629) |
0.0 | 0.0 | GO:0032278 | positive regulation of gonadotropin secretion(GO:0032278) |
0.0 | 0.1 | GO:0071549 | cellular response to dexamethasone stimulus(GO:0071549) |
0.0 | 0.0 | GO:0090160 | Golgi to lysosome transport(GO:0090160) |
0.0 | 0.0 | GO:0032025 | response to cobalt ion(GO:0032025) |
0.0 | 0.0 | GO:0090258 | negative regulation of mitochondrial fission(GO:0090258) |
0.0 | 0.0 | GO:0010637 | regulation of mitochondrial fusion(GO:0010635) negative regulation of mitochondrial fusion(GO:0010637) |
0.0 | 0.0 | GO:2000402 | negative regulation of lymphocyte migration(GO:2000402) |
0.0 | 0.0 | GO:0071374 | cellular response to parathyroid hormone stimulus(GO:0071374) |
0.0 | 0.1 | GO:0048854 | brain morphogenesis(GO:0048854) |
0.0 | 0.0 | GO:0007196 | adenylate cyclase-inhibiting G-protein coupled glutamate receptor signaling pathway(GO:0007196) |
0.0 | 0.1 | GO:0035357 | peroxisome proliferator activated receptor signaling pathway(GO:0035357) |
0.0 | 0.0 | GO:0045054 | constitutive secretory pathway(GO:0045054) |
0.0 | 0.0 | GO:0045085 | negative regulation of interleukin-2 biosynthetic process(GO:0045085) |
0.0 | 0.0 | GO:0001757 | somite specification(GO:0001757) |
0.0 | 0.0 | GO:0090245 | axis elongation involved in somitogenesis(GO:0090245) |
0.0 | 0.0 | GO:0003310 | pancreatic A cell differentiation(GO:0003310) |
0.0 | 0.0 | GO:0060689 | cell differentiation involved in salivary gland development(GO:0060689) |
0.0 | 0.0 | GO:2000008 | regulation of protein localization to cell surface(GO:2000008) |
0.0 | 0.1 | GO:0046415 | urate metabolic process(GO:0046415) |
0.0 | 0.1 | GO:0043249 | erythrocyte maturation(GO:0043249) |
0.0 | 0.0 | GO:1903779 | regulation of cardiac conduction(GO:1903779) |
0.0 | 0.0 | GO:0045629 | negative regulation of T-helper 2 cell differentiation(GO:0045629) |
0.0 | 0.0 | GO:0002215 | defense response to nematode(GO:0002215) |
0.0 | 0.4 | GO:0006334 | nucleosome assembly(GO:0006334) |
0.0 | 0.0 | GO:0070487 | monocyte aggregation(GO:0070487) |
0.0 | 0.1 | GO:0006120 | mitochondrial electron transport, NADH to ubiquinone(GO:0006120) |
0.0 | 0.0 | GO:0033683 | nucleotide-excision repair, DNA incision(GO:0033683) |
0.0 | 0.0 | GO:0002023 | reduction of food intake in response to dietary excess(GO:0002023) |
0.0 | 0.0 | GO:0060447 | bud outgrowth involved in lung branching(GO:0060447) |
0.0 | 0.0 | GO:0001555 | oocyte growth(GO:0001555) |
0.0 | 0.0 | GO:0010040 | response to iron(II) ion(GO:0010040) |
0.0 | 0.0 | GO:0070671 | response to interleukin-12(GO:0070671) |
0.0 | 0.1 | GO:0000055 | ribosomal large subunit export from nucleus(GO:0000055) |
0.0 | 0.0 | GO:0050884 | neuromuscular process controlling posture(GO:0050884) |
0.0 | 0.0 | GO:0039529 | RIG-I signaling pathway(GO:0039529) |
0.0 | 0.0 | GO:0008611 | ether lipid biosynthetic process(GO:0008611) glycerol ether biosynthetic process(GO:0046504) cellular lipid biosynthetic process(GO:0097384) ether biosynthetic process(GO:1901503) |
0.0 | 0.0 | GO:0051572 | negative regulation of histone H3-K4 methylation(GO:0051572) |
0.0 | 0.2 | GO:0040014 | regulation of multicellular organism growth(GO:0040014) |
0.0 | 0.0 | GO:0051204 | protein insertion into mitochondrial membrane(GO:0051204) |
0.0 | 0.0 | GO:1901421 | positive regulation of response to alcohol(GO:1901421) |
0.0 | 0.1 | GO:0007341 | penetration of zona pellucida(GO:0007341) |
0.0 | 0.0 | GO:0071799 | response to prostaglandin D(GO:0071798) cellular response to prostaglandin D stimulus(GO:0071799) |
0.0 | 0.1 | GO:0042407 | cristae formation(GO:0042407) |
0.0 | 0.0 | GO:0048842 | positive regulation of axon extension involved in axon guidance(GO:0048842) positive regulation of axon guidance(GO:1902669) |
0.0 | 0.0 | GO:0061302 | smooth muscle cell-matrix adhesion(GO:0061302) |
0.0 | 0.0 | GO:0071139 | resolution of recombination intermediates(GO:0071139) |
0.0 | 0.0 | GO:1904970 | brush border assembly(GO:1904970) |
0.0 | 0.0 | GO:0009235 | cobalamin metabolic process(GO:0009235) |
0.0 | 0.0 | GO:0090153 | regulation of sphingolipid biosynthetic process(GO:0090153) regulation of membrane lipid metabolic process(GO:1905038) regulation of ceramide biosynthetic process(GO:2000303) |
0.0 | 0.0 | GO:0032847 | regulation of cellular pH reduction(GO:0032847) positive regulation of cellular pH reduction(GO:0032849) |
0.0 | 0.1 | GO:0001522 | pseudouridine synthesis(GO:0001522) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
2.2 | 6.5 | GO:0014701 | junctional sarcoplasmic reticulum membrane(GO:0014701) |
1.8 | 9.1 | GO:0070044 | synaptobrevin 2-SNAP-25-syntaxin-1a complex(GO:0070044) |
1.8 | 7.1 | GO:0033269 | internode region of axon(GO:0033269) |
0.9 | 2.7 | GO:0005879 | axonemal microtubule(GO:0005879) |
0.8 | 3.1 | GO:0031466 | Cul5-RING ubiquitin ligase complex(GO:0031466) |
0.7 | 2.2 | GO:0038037 | G-protein coupled receptor dimeric complex(GO:0038037) G-protein coupled receptor complex(GO:0097648) |
0.7 | 2.1 | GO:0072534 | perineuronal net(GO:0072534) |
0.7 | 3.5 | GO:0000235 | astral microtubule(GO:0000235) |
0.7 | 2.7 | GO:0019815 | B cell receptor complex(GO:0019815) |
0.7 | 2.6 | GO:0097169 | AIM2 inflammasome complex(GO:0097169) |
0.7 | 11.7 | GO:0030673 | axolemma(GO:0030673) |
0.6 | 5.6 | GO:0032045 | guanyl-nucleotide exchange factor complex(GO:0032045) |
0.6 | 5.3 | GO:0002116 | semaphorin receptor complex(GO:0002116) |
0.6 | 2.9 | GO:0014731 | spectrin-associated cytoskeleton(GO:0014731) |
0.6 | 15.8 | GO:0097610 | cleavage furrow(GO:0032154) cell surface furrow(GO:0097610) |
0.6 | 9.5 | GO:0016010 | dystrophin-associated glycoprotein complex(GO:0016010) glycoprotein complex(GO:0090665) |
0.6 | 2.8 | GO:0097433 | dense body(GO:0097433) |
0.5 | 3.7 | GO:0005952 | cAMP-dependent protein kinase complex(GO:0005952) |
0.5 | 3.7 | GO:0033263 | CORVET complex(GO:0033263) |
0.5 | 8.8 | GO:0097440 | apical dendrite(GO:0097440) |
0.5 | 2.8 | GO:0019907 | cyclin-dependent protein kinase activating kinase holoenzyme complex(GO:0019907) |
0.4 | 1.3 | GO:0055087 | Ski complex(GO:0055087) |
0.4 | 4.1 | GO:0035253 | ciliary rootlet(GO:0035253) |
0.4 | 4.5 | GO:0031045 | dense core granule(GO:0031045) |
0.4 | 1.2 | GO:0036396 | MIS complex(GO:0036396) |
0.4 | 3.1 | GO:0045254 | pyruvate dehydrogenase complex(GO:0045254) |
0.4 | 2.2 | GO:0002177 | manchette(GO:0002177) |
0.4 | 1.1 | GO:0043511 | inhibin complex(GO:0043511) |
0.4 | 1.5 | GO:0042567 | insulin-like growth factor binding protein complex(GO:0016942) growth factor complex(GO:0036454) insulin-like growth factor ternary complex(GO:0042567) |
0.4 | 1.4 | GO:0044322 | endoplasmic reticulum quality control compartment(GO:0044322) |
0.3 | 2.8 | GO:0036157 | outer dynein arm(GO:0036157) |
0.3 | 1.4 | GO:0097209 | epidermal lamellar body(GO:0097209) |
0.3 | 5.8 | GO:0002102 | podosome(GO:0002102) |
0.3 | 2.4 | GO:0098563 | integral component of synaptic vesicle membrane(GO:0030285) intrinsic component of synaptic vesicle membrane(GO:0098563) |
0.3 | 1.4 | GO:0044300 | cerebellar mossy fiber(GO:0044300) |
0.3 | 10.8 | GO:0099501 | synaptic vesicle membrane(GO:0030672) exocytic vesicle membrane(GO:0099501) |
0.3 | 1.3 | GO:0044530 | supraspliceosomal complex(GO:0044530) |
0.3 | 1.0 | GO:0033596 | TSC1-TSC2 complex(GO:0033596) |
0.3 | 1.9 | GO:0070761 | pre-snoRNP complex(GO:0070761) |
0.3 | 0.6 | GO:0034673 | inhibin-betaglycan-ActRII complex(GO:0034673) |
0.3 | 4.6 | GO:0032839 | dendrite cytoplasm(GO:0032839) |
0.3 | 3.9 | GO:0016514 | SWI/SNF complex(GO:0016514) |
0.3 | 3.3 | GO:0043194 | axon initial segment(GO:0043194) |
0.3 | 1.2 | GO:1990130 | Iml1 complex(GO:1990130) |
0.3 | 3.8 | GO:0038201 | TOR complex(GO:0038201) |
0.3 | 2.3 | GO:0044224 | juxtaparanode region of axon(GO:0044224) |
0.3 | 1.4 | GO:0045098 | type III intermediate filament(GO:0045098) |
0.3 | 1.8 | GO:0005883 | neurofilament(GO:0005883) |
0.2 | 4.0 | GO:0097038 | perinuclear endoplasmic reticulum(GO:0097038) |
0.2 | 1.9 | GO:0031462 | Cul2-RING ubiquitin ligase complex(GO:0031462) |
0.2 | 0.7 | GO:0071001 | U4/U6 snRNP(GO:0071001) |
0.2 | 2.1 | GO:0000813 | ESCRT I complex(GO:0000813) |
0.2 | 3.3 | GO:0043205 | fibril(GO:0043205) |
0.2 | 0.7 | GO:0090661 | box H/ACA telomerase RNP complex(GO:0090661) |
0.2 | 0.6 | GO:0043527 | tRNA methyltransferase complex(GO:0043527) |
0.2 | 3.8 | GO:0005868 | cytoplasmic dynein complex(GO:0005868) |
0.2 | 0.8 | GO:0031618 | nuclear pericentric heterochromatin(GO:0031618) |
0.2 | 2.1 | GO:0046581 | intercellular canaliculus(GO:0046581) |
0.2 | 0.6 | GO:0071942 | XPC complex(GO:0071942) |
0.2 | 8.1 | GO:0005871 | kinesin complex(GO:0005871) |
0.2 | 1.6 | GO:1990023 | mitotic spindle midzone(GO:1990023) |
0.2 | 1.1 | GO:0000138 | Golgi trans cisterna(GO:0000138) |
0.2 | 1.5 | GO:0012507 | ER to Golgi transport vesicle membrane(GO:0012507) |
0.2 | 0.5 | GO:0042827 | platelet dense granule(GO:0042827) |
0.2 | 2.0 | GO:0031235 | intrinsic component of the cytoplasmic side of the plasma membrane(GO:0031235) |
0.2 | 3.4 | GO:0042734 | presynaptic membrane(GO:0042734) |
0.2 | 0.5 | GO:0048179 | activin receptor complex(GO:0048179) |
0.2 | 2.2 | GO:0032433 | filopodium tip(GO:0032433) |
0.2 | 1.2 | GO:0005577 | fibrinogen complex(GO:0005577) |
0.2 | 1.3 | GO:0016600 | flotillin complex(GO:0016600) |
0.2 | 1.0 | GO:0097470 | ribbon synapse(GO:0097470) |
0.2 | 0.7 | GO:0017071 | intracellular cyclic nucleotide activated cation channel complex(GO:0017071) |
0.2 | 1.8 | GO:0005641 | nuclear envelope lumen(GO:0005641) |
0.2 | 2.0 | GO:0030877 | beta-catenin destruction complex(GO:0030877) |
0.2 | 2.0 | GO:0016580 | Sin3 complex(GO:0016580) |
0.2 | 0.3 | GO:0032437 | cuticular plate(GO:0032437) |
0.2 | 0.5 | GO:0005944 | phosphatidylinositol 3-kinase complex, class IB(GO:0005944) |
0.2 | 20.9 | GO:0005777 | peroxisome(GO:0005777) microbody(GO:0042579) |
0.2 | 0.8 | GO:0033268 | node of Ranvier(GO:0033268) |
0.1 | 2.1 | GO:0043034 | costamere(GO:0043034) |
0.1 | 2.6 | GO:0032588 | trans-Golgi network membrane(GO:0032588) |
0.1 | 0.7 | GO:0016281 | eukaryotic translation initiation factor 4F complex(GO:0016281) |
0.1 | 1.7 | GO:0035686 | sperm fibrous sheath(GO:0035686) |
0.1 | 0.4 | GO:0005899 | insulin receptor complex(GO:0005899) |
0.1 | 6.7 | GO:0008076 | voltage-gated potassium channel complex(GO:0008076) |
0.1 | 0.4 | GO:0071008 | U2-type post-mRNA release spliceosomal complex(GO:0071008) |
0.1 | 0.4 | GO:0035355 | Toll-like receptor 2-Toll-like receptor 6 protein complex(GO:0035355) |
0.1 | 0.6 | GO:0002142 | stereocilia ankle link complex(GO:0002142) |
0.1 | 3.3 | GO:0030665 | clathrin-coated vesicle membrane(GO:0030665) |
0.1 | 0.5 | GO:0031262 | Ndc80 complex(GO:0031262) |
0.1 | 0.4 | GO:0010009 | cytoplasmic side of endosome membrane(GO:0010009) |
0.1 | 0.3 | GO:0031465 | Cul4B-RING E3 ubiquitin ligase complex(GO:0031465) |
0.1 | 3.7 | GO:0032281 | AMPA glutamate receptor complex(GO:0032281) |
0.1 | 0.9 | GO:0030681 | nucleolar ribonuclease P complex(GO:0005655) ribonuclease P complex(GO:0030677) multimeric ribonuclease P complex(GO:0030681) |
0.1 | 0.7 | GO:0046696 | lipopolysaccharide receptor complex(GO:0046696) |
0.1 | 5.2 | GO:0005747 | mitochondrial respiratory chain complex I(GO:0005747) NADH dehydrogenase complex(GO:0030964) respiratory chain complex I(GO:0045271) |
0.1 | 1.0 | GO:0030991 | intraciliary transport particle A(GO:0030991) |
0.1 | 0.4 | GO:0032299 | ribonuclease H2 complex(GO:0032299) |
0.1 | 1.1 | GO:0008250 | oligosaccharyltransferase complex(GO:0008250) |
0.1 | 0.3 | GO:1990907 | beta-catenin-TCF complex(GO:1990907) |
0.1 | 1.5 | GO:0042627 | chylomicron(GO:0042627) |
0.1 | 2.7 | GO:0044295 | axonal growth cone(GO:0044295) |
0.1 | 0.9 | GO:0070419 | nonhomologous end joining complex(GO:0070419) |
0.1 | 0.4 | GO:0071817 | MMXD complex(GO:0071817) |
0.1 | 1.9 | GO:0031233 | intrinsic component of external side of plasma membrane(GO:0031233) |
0.1 | 0.7 | GO:0031464 | Cul4A-RING E3 ubiquitin ligase complex(GO:0031464) |
0.1 | 0.6 | GO:0016327 | apicolateral plasma membrane(GO:0016327) |
0.1 | 0.9 | GO:0005832 | chaperonin-containing T-complex(GO:0005832) |
0.1 | 1.3 | GO:0031597 | cytosolic proteasome complex(GO:0031597) |
0.1 | 1.3 | GO:0005847 | mRNA cleavage and polyadenylation specificity factor complex(GO:0005847) |
0.1 | 1.7 | GO:0031519 | PcG protein complex(GO:0031519) |
0.1 | 0.2 | GO:0016533 | cyclin-dependent protein kinase 5 holoenzyme complex(GO:0016533) |
0.1 | 0.3 | GO:0005863 | striated muscle myosin thick filament(GO:0005863) |
0.1 | 0.3 | GO:1990131 | EGO complex(GO:0034448) Gtr1-Gtr2 GTPase complex(GO:1990131) |
0.1 | 0.8 | GO:0060077 | inhibitory synapse(GO:0060077) |
0.1 | 0.8 | GO:0097539 | ciliary transition fiber(GO:0097539) |
0.1 | 18.0 | GO:0045211 | postsynaptic membrane(GO:0045211) |
0.1 | 4.8 | GO:0034704 | calcium channel complex(GO:0034704) |
0.1 | 5.5 | GO:0042641 | actomyosin(GO:0042641) |
0.1 | 0.9 | GO:0061700 | GATOR2 complex(GO:0061700) |
0.1 | 1.9 | GO:0032809 | neuronal cell body membrane(GO:0032809) cell body membrane(GO:0044298) |
0.1 | 2.3 | GO:0030057 | desmosome(GO:0030057) |
0.1 | 0.3 | GO:0005945 | 6-phosphofructokinase complex(GO:0005945) |
0.1 | 0.2 | GO:0045298 | tubulin complex(GO:0045298) |
0.1 | 1.9 | GO:0000242 | pericentriolar material(GO:0000242) |
0.1 | 0.3 | GO:0005785 | signal recognition particle receptor complex(GO:0005785) |
0.1 | 0.3 | GO:0000444 | MIS12/MIND type complex(GO:0000444) |
0.1 | 0.4 | GO:0005955 | calcineurin complex(GO:0005955) |
0.1 | 0.3 | GO:0033270 | paranode region of axon(GO:0033270) |
0.1 | 5.9 | GO:0005791 | rough endoplasmic reticulum(GO:0005791) |
0.1 | 0.8 | GO:0031512 | motile primary cilium(GO:0031512) |
0.1 | 0.4 | GO:0032541 | cortical endoplasmic reticulum(GO:0032541) |
0.1 | 0.1 | GO:0005827 | polar microtubule(GO:0005827) |
0.1 | 6.9 | GO:0005923 | bicellular tight junction(GO:0005923) |
0.1 | 0.3 | GO:0070822 | Sin3-type complex(GO:0070822) |
0.1 | 1.2 | GO:0071011 | precatalytic spliceosome(GO:0071011) |
0.1 | 3.6 | GO:0005844 | polysome(GO:0005844) |
0.1 | 0.5 | GO:0097449 | astrocyte projection(GO:0097449) |
0.1 | 0.3 | GO:0097543 | ciliary inversin compartment(GO:0097543) |
0.1 | 0.7 | GO:0000778 | condensed nuclear chromosome kinetochore(GO:0000778) |
0.1 | 0.3 | GO:0002079 | inner acrosomal membrane(GO:0002079) |
0.1 | 0.9 | GO:0035102 | PRC1 complex(GO:0035102) |
0.1 | 0.6 | GO:0031390 | Ctf18 RFC-like complex(GO:0031390) |
0.1 | 0.2 | GO:0009331 | glycerol-3-phosphate dehydrogenase complex(GO:0009331) |
0.1 | 0.3 | GO:0031502 | dolichyl-phosphate-mannose-protein mannosyltransferase complex(GO:0031502) |
0.1 | 0.3 | GO:0016460 | myosin II complex(GO:0016460) |
0.1 | 0.5 | GO:0031314 | extrinsic component of mitochondrial inner membrane(GO:0031314) |
0.1 | 0.2 | GO:0000015 | phosphopyruvate hydratase complex(GO:0000015) |
0.1 | 5.0 | GO:0035097 | histone methyltransferase complex(GO:0035097) |
0.1 | 0.5 | GO:0097342 | ripoptosome(GO:0097342) |
0.1 | 0.9 | GO:0042575 | DNA polymerase complex(GO:0042575) |
0.1 | 0.2 | GO:0000811 | GINS complex(GO:0000811) |
0.1 | 0.1 | GO:0044462 | cell outer membrane(GO:0009279) cell envelope(GO:0030313) external encapsulating structure part(GO:0044462) |
0.1 | 0.3 | GO:0032777 | Piccolo NuA4 histone acetyltransferase complex(GO:0032777) |
0.1 | 0.4 | GO:0070578 | RISC-loading complex(GO:0070578) |
0.1 | 0.4 | GO:0005916 | fascia adherens(GO:0005916) |
0.1 | 1.7 | GO:0005689 | U12-type spliceosomal complex(GO:0005689) |
0.1 | 0.4 | GO:1990124 | messenger ribonucleoprotein complex(GO:1990124) |
0.1 | 2.4 | GO:0005834 | heterotrimeric G-protein complex(GO:0005834) |
0.1 | 0.6 | GO:0051233 | spindle midzone(GO:0051233) |
0.1 | 0.6 | GO:0098793 | presynapse(GO:0098793) |
0.1 | 1.8 | GO:0005905 | clathrin-coated pit(GO:0005905) |
0.1 | 5.1 | GO:0070382 | exocytic vesicle(GO:0070382) |
0.1 | 4.2 | GO:0043204 | perikaryon(GO:0043204) |
0.1 | 0.1 | GO:0031595 | nuclear proteasome complex(GO:0031595) |
0.1 | 0.6 | GO:0001518 | voltage-gated sodium channel complex(GO:0001518) |
0.1 | 0.3 | GO:0005851 | eukaryotic translation initiation factor 2B complex(GO:0005851) |
0.1 | 0.5 | GO:0033180 | proton-transporting V-type ATPase, V1 domain(GO:0033180) |
0.1 | 0.6 | GO:0005675 | holo TFIIH complex(GO:0005675) |
0.1 | 0.3 | GO:0043083 | synaptic cleft(GO:0043083) |
0.1 | 1.0 | GO:0042101 | T cell receptor complex(GO:0042101) |
0.1 | 5.8 | GO:0005882 | intermediate filament(GO:0005882) |
0.1 | 0.4 | GO:0031415 | NatA complex(GO:0031415) |
0.1 | 0.3 | GO:0031254 | uropod(GO:0001931) cell trailing edge(GO:0031254) |
0.1 | 0.2 | GO:0005658 | alpha DNA polymerase:primase complex(GO:0005658) |
0.1 | 0.4 | GO:0000780 | condensed nuclear chromosome, centromeric region(GO:0000780) |
0.1 | 0.1 | GO:0042585 | germinal vesicle(GO:0042585) |
0.1 | 0.1 | GO:0035838 | growing cell tip(GO:0035838) |
0.1 | 0.2 | GO:1990851 | Wnt-Frizzled-LRP5/6 complex(GO:1990851) |
0.1 | 0.5 | GO:0032300 | mismatch repair complex(GO:0032300) |
0.1 | 0.5 | GO:0008074 | guanylate cyclase complex, soluble(GO:0008074) |
0.1 | 0.2 | GO:1990316 | ATG1/ULK1 kinase complex(GO:1990316) |
0.1 | 0.3 | GO:0070847 | core mediator complex(GO:0070847) |
0.1 | 0.4 | GO:0008290 | F-actin capping protein complex(GO:0008290) |
0.1 | 0.5 | GO:0097228 | sperm principal piece(GO:0097228) |
0.1 | 0.4 | GO:0045334 | clathrin-coated endocytic vesicle(GO:0045334) |
0.1 | 0.3 | GO:0030666 | endocytic vesicle membrane(GO:0030666) |
0.1 | 0.1 | GO:0072558 | NLRP1 inflammasome complex(GO:0072558) |
0.1 | 0.6 | GO:0000159 | protein phosphatase type 2A complex(GO:0000159) |
0.1 | 0.9 | GO:0005720 | nuclear heterochromatin(GO:0005720) |
0.0 | 0.1 | GO:0031414 | N-terminal protein acetyltransferase complex(GO:0031414) |
0.0 | 0.0 | GO:0030891 | VCB complex(GO:0030891) |
0.0 | 0.5 | GO:0043189 | NuA4 histone acetyltransferase complex(GO:0035267) H4/H2A histone acetyltransferase complex(GO:0043189) H4 histone acetyltransferase complex(GO:1902562) |
0.0 | 0.5 | GO:0000164 | protein phosphatase type 1 complex(GO:0000164) |
0.0 | 0.1 | GO:0098536 | deuterosome(GO:0098536) |
0.0 | 0.1 | GO:0031094 | platelet dense tubular network(GO:0031094) |
0.0 | 0.1 | GO:0089701 | U2AF(GO:0089701) |
0.0 | 0.2 | GO:0034098 | VCP-NPL4-UFD1 AAA ATPase complex(GO:0034098) |
0.0 | 4.5 | GO:0031227 | intrinsic component of endoplasmic reticulum membrane(GO:0031227) |
0.0 | 0.2 | GO:0005672 | transcription factor TFIIA complex(GO:0005672) |
0.0 | 1.4 | GO:0005637 | nuclear inner membrane(GO:0005637) |
0.0 | 0.3 | GO:0036513 | Derlin-1 retrotranslocation complex(GO:0036513) |
0.0 | 1.1 | GO:0046658 | anchored component of plasma membrane(GO:0046658) |
0.0 | 2.5 | GO:0031463 | Cul3-RING ubiquitin ligase complex(GO:0031463) |
0.0 | 0.1 | GO:0016602 | CCAAT-binding factor complex(GO:0016602) |
0.0 | 0.5 | GO:0044447 | axoneme part(GO:0044447) |
0.0 | 5.0 | GO:0045121 | membrane raft(GO:0045121) membrane microdomain(GO:0098857) |
0.0 | 0.1 | GO:0000243 | commitment complex(GO:0000243) |
0.0 | 0.2 | GO:0071986 | Ragulator complex(GO:0071986) |
0.0 | 4.3 | GO:0045202 | synapse(GO:0045202) |
0.0 | 0.1 | GO:0070852 | cell body fiber(GO:0070852) |
0.0 | 0.1 | GO:0070765 | gamma-secretase complex(GO:0070765) |
0.0 | 3.2 | GO:0016323 | basolateral plasma membrane(GO:0016323) |
0.0 | 0.3 | GO:0031371 | ubiquitin conjugating enzyme complex(GO:0031371) |
0.0 | 0.4 | GO:0000930 | gamma-tubulin complex(GO:0000930) |
0.0 | 0.2 | GO:0001940 | male pronucleus(GO:0001940) |
0.0 | 0.2 | GO:0030915 | Smc5-Smc6 complex(GO:0030915) |
0.0 | 0.6 | GO:0032391 | photoreceptor connecting cilium(GO:0032391) |
0.0 | 0.1 | GO:0001674 | female germ cell nucleus(GO:0001674) |
0.0 | 0.1 | GO:0071204 | histone pre-mRNA 3'end processing complex(GO:0071204) |
0.0 | 16.0 | GO:0043005 | neuron projection(GO:0043005) |
0.0 | 0.2 | GO:0030134 | ER to Golgi transport vesicle(GO:0030134) |
0.0 | 0.4 | GO:0043240 | Fanconi anaemia nuclear complex(GO:0043240) |
0.0 | 0.1 | GO:0030485 | smooth muscle contractile fiber(GO:0030485) |
0.0 | 0.1 | GO:0044614 | nuclear pore cytoplasmic filaments(GO:0044614) |
0.0 | 0.7 | GO:0000307 | cyclin-dependent protein kinase holoenzyme complex(GO:0000307) |
0.0 | 0.1 | GO:0030015 | CCR4-NOT core complex(GO:0030015) |
0.0 | 0.2 | GO:0001520 | outer dense fiber(GO:0001520) |
0.0 | 0.2 | GO:0030688 | preribosome, small subunit precursor(GO:0030688) |
0.0 | 0.5 | GO:0030660 | Golgi-associated vesicle membrane(GO:0030660) |
0.0 | 0.4 | GO:0005736 | DNA-directed RNA polymerase I complex(GO:0005736) |
0.0 | 0.1 | GO:0060091 | kinocilium(GO:0060091) |
0.0 | 0.1 | GO:0016589 | NURF complex(GO:0016589) |
0.0 | 0.1 | GO:0034274 | Atg12-Atg5-Atg16 complex(GO:0034274) |
0.0 | 0.5 | GO:0016235 | aggresome(GO:0016235) |
0.0 | 0.1 | GO:0030312 | external encapsulating structure(GO:0030312) |
0.0 | 0.9 | GO:0005762 | organellar large ribosomal subunit(GO:0000315) mitochondrial large ribosomal subunit(GO:0005762) |
0.0 | 0.2 | GO:0070652 | HAUS complex(GO:0070652) |
0.0 | 0.4 | GO:0031201 | SNARE complex(GO:0031201) |
0.0 | 0.1 | GO:0044611 | nuclear pore inner ring(GO:0044611) |
0.0 | 0.2 | GO:0034663 | endoplasmic reticulum chaperone complex(GO:0034663) |
0.0 | 0.0 | GO:0097651 | phosphatidylinositol 3-kinase complex, class I(GO:0097651) |
0.0 | 0.1 | GO:0034457 | Mpp10 complex(GO:0034457) |
0.0 | 0.0 | GO:1902710 | GABA receptor complex(GO:1902710) GABA-A receptor complex(GO:1902711) |
0.0 | 0.0 | GO:0071438 | invadopodium membrane(GO:0071438) |
0.0 | 0.1 | GO:0005766 | primary lysosome(GO:0005766) azurophil granule(GO:0042582) |
0.0 | 0.0 | GO:0016222 | procollagen-proline 4-dioxygenase complex(GO:0016222) |
0.0 | 0.2 | GO:0010369 | chromocenter(GO:0010369) |
0.0 | 0.0 | GO:0031092 | platelet alpha granule membrane(GO:0031092) |
0.0 | 0.2 | GO:0070971 | endoplasmic reticulum exit site(GO:0070971) |
0.0 | 0.1 | GO:0042405 | nuclear inclusion body(GO:0042405) |
0.0 | 0.1 | GO:0071547 | piP-body(GO:0071547) |
0.0 | 0.2 | GO:0017119 | Golgi transport complex(GO:0017119) |
0.0 | 0.4 | GO:0035869 | ciliary transition zone(GO:0035869) |
0.0 | 0.0 | GO:0045009 | melanosome membrane(GO:0033162) chitosome(GO:0045009) |
0.0 | 0.2 | GO:0005732 | small nucleolar ribonucleoprotein complex(GO:0005732) |
0.0 | 0.0 | GO:0031933 | telomeric heterochromatin(GO:0031933) |
0.0 | 0.2 | GO:0042470 | melanosome(GO:0042470) pigment granule(GO:0048770) |
0.0 | 0.1 | GO:0016471 | vacuolar proton-transporting V-type ATPase complex(GO:0016471) |
0.0 | 0.5 | GO:0000314 | organellar small ribosomal subunit(GO:0000314) mitochondrial small ribosomal subunit(GO:0005763) |
0.0 | 0.2 | GO:0030014 | CCR4-NOT complex(GO:0030014) |
0.0 | 0.4 | GO:0016459 | myosin complex(GO:0016459) |
0.0 | 0.0 | GO:1990604 | IRE1-TRAF2-ASK1 complex(GO:1990604) |
0.0 | 0.2 | GO:0030131 | clathrin adaptor complex(GO:0030131) |
0.0 | 0.1 | GO:0016593 | Cdc73/Paf1 complex(GO:0016593) |
0.0 | 0.2 | GO:0030904 | retromer complex(GO:0030904) |
0.0 | 0.0 | GO:0044453 | nuclear membrane part(GO:0044453) |
0.0 | 0.8 | GO:0034399 | nuclear periphery(GO:0034399) |
0.0 | 0.1 | GO:0031616 | spindle pole centrosome(GO:0031616) |
0.0 | 0.1 | GO:0090571 | RNA polymerase II transcription repressor complex(GO:0090571) |
0.0 | 0.0 | GO:0034991 | nuclear meiotic cohesin complex(GO:0034991) |
0.0 | 0.2 | GO:0005852 | eukaryotic translation initiation factor 3 complex(GO:0005852) |
0.0 | 0.1 | GO:0019773 | proteasome core complex, alpha-subunit complex(GO:0019773) |
0.0 | 0.6 | GO:0036477 | somatodendritic compartment(GO:0036477) |
0.0 | 0.1 | GO:0042589 | zymogen granule membrane(GO:0042589) |
0.0 | 0.6 | GO:0022625 | cytosolic large ribosomal subunit(GO:0022625) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
2.3 | 6.9 | GO:0097109 | neuroligin family protein binding(GO:0097109) |
2.1 | 17.1 | GO:0102391 | decanoate--CoA ligase activity(GO:0102391) |
1.9 | 5.7 | GO:0016647 | oxidoreductase activity, acting on the CH-NH group of donors, oxygen as acceptor(GO:0016647) |
1.8 | 5.4 | GO:0004667 | prostaglandin-D synthase activity(GO:0004667) |
1.5 | 4.5 | GO:0004691 | cAMP-dependent protein kinase activity(GO:0004691) |
1.5 | 4.5 | GO:0005176 | ErbB-2 class receptor binding(GO:0005176) |
1.4 | 4.2 | GO:0050508 | glucuronosyl-N-acetylglucosaminyl-proteoglycan 4-alpha-N-acetylglucosaminyltransferase activity(GO:0050508) |
1.2 | 3.7 | GO:0004739 | pyruvate dehydrogenase (acetyl-transferring) activity(GO:0004739) |
1.1 | 4.5 | GO:0015252 | hydrogen ion channel activity(GO:0015252) |
1.0 | 4.1 | GO:0008502 | melatonin receptor activity(GO:0008502) |
1.0 | 3.0 | GO:0016822 | hydrolase activity, acting on acid carbon-carbon bonds(GO:0016822) hydrolase activity, acting on acid carbon-carbon bonds, in ketonic substances(GO:0016823) |
1.0 | 3.9 | GO:0051425 | PTB domain binding(GO:0051425) |
0.9 | 2.6 | GO:0004965 | G-protein coupled GABA receptor activity(GO:0004965) |
0.9 | 6.1 | GO:0003680 | AT DNA binding(GO:0003680) |
0.8 | 2.4 | GO:0005519 | cytoskeletal regulatory protein binding(GO:0005519) |
0.8 | 9.3 | GO:0005313 | L-glutamate transmembrane transporter activity(GO:0005313) |
0.8 | 3.1 | GO:0005025 | transforming growth factor beta receptor activity, type I(GO:0005025) |
0.8 | 3.1 | GO:0005250 | A-type (transient outward) potassium channel activity(GO:0005250) |
0.7 | 4.4 | GO:0034190 | apolipoprotein receptor binding(GO:0034190) |
0.7 | 2.2 | GO:0046976 | histone methyltransferase activity (H3-K27 specific)(GO:0046976) |
0.7 | 2.2 | GO:0005483 | soluble NSF attachment protein activity(GO:0005483) |
0.7 | 2.1 | GO:0005172 | vascular endothelial growth factor receptor binding(GO:0005172) |
0.7 | 2.1 | GO:0008309 | double-stranded DNA exodeoxyribonuclease activity(GO:0008309) |
0.7 | 3.3 | GO:0005432 | calcium:sodium antiporter activity(GO:0005432) |
0.6 | 1.9 | GO:0031826 | type 2A serotonin receptor binding(GO:0031826) |
0.6 | 3.1 | GO:0086080 | protein binding involved in heterotypic cell-cell adhesion(GO:0086080) |
0.6 | 4.7 | GO:0008599 | protein phosphatase type 1 regulator activity(GO:0008599) |
0.6 | 1.2 | GO:0043423 | 3-phosphoinositide-dependent protein kinase binding(GO:0043423) |
0.6 | 2.9 | GO:0044323 | retinoic acid-responsive element binding(GO:0044323) |
0.5 | 2.2 | GO:0032051 | clathrin light chain binding(GO:0032051) |
0.5 | 4.3 | GO:0008046 | axon guidance receptor activity(GO:0008046) |
0.5 | 1.6 | GO:0045503 | dynein light chain binding(GO:0045503) |
0.5 | 4.2 | GO:0000900 | translation repressor activity, nucleic acid binding(GO:0000900) |
0.5 | 6.2 | GO:0003905 | alkylbase DNA N-glycosylase activity(GO:0003905) DNA-3-methylbase glycosylase activity(GO:0043733) |
0.5 | 2.6 | GO:0019871 | sodium channel inhibitor activity(GO:0019871) |
0.5 | 1.0 | GO:0030274 | LIM domain binding(GO:0030274) |
0.5 | 2.0 | GO:0008532 | N-acetyllactosaminide beta-1,3-N-acetylglucosaminyltransferase activity(GO:0008532) |
0.5 | 3.3 | GO:1990459 | transferrin receptor binding(GO:1990459) |
0.5 | 1.8 | GO:0008486 | diphosphoinositol-polyphosphate diphosphatase activity(GO:0008486) |
0.5 | 1.8 | GO:0015272 | ATP-activated inward rectifier potassium channel activity(GO:0015272) |
0.4 | 1.3 | GO:0003987 | acetate-CoA ligase activity(GO:0003987) |
0.4 | 2.2 | GO:0015277 | kainate selective glutamate receptor activity(GO:0015277) |
0.4 | 4.8 | GO:0017154 | semaphorin receptor activity(GO:0017154) |
0.4 | 3.8 | GO:0005283 | sodium:amino acid symporter activity(GO:0005283) |
0.4 | 2.1 | GO:0031849 | olfactory receptor binding(GO:0031849) |
0.4 | 2.0 | GO:0005007 | fibroblast growth factor-activated receptor activity(GO:0005007) |
0.4 | 0.8 | GO:0004690 | cyclic nucleotide-dependent protein kinase activity(GO:0004690) |
0.4 | 8.0 | GO:0017075 | syntaxin-1 binding(GO:0017075) |
0.4 | 2.7 | GO:0031995 | insulin-like growth factor II binding(GO:0031995) |
0.4 | 1.2 | GO:0060230 | lipoprotein lipase activator activity(GO:0060230) |
0.4 | 2.2 | GO:0005004 | GPI-linked ephrin receptor activity(GO:0005004) |
0.4 | 8.2 | GO:0030332 | cyclin binding(GO:0030332) |
0.4 | 1.1 | GO:0004505 | phenylalanine 4-monooxygenase activity(GO:0004505) |
0.4 | 1.1 | GO:0001031 | RNA polymerase III type 1 promoter DNA binding(GO:0001030) RNA polymerase III type 2 promoter DNA binding(GO:0001031) RNA polymerase III type 3 promoter DNA binding(GO:0001032) 5S rDNA binding(GO:0080084) |
0.4 | 1.1 | GO:0035175 | histone kinase activity (H3-S10 specific)(GO:0035175) |
0.3 | 1.0 | GO:0047192 | 1-alkylglycerophosphocholine O-acetyltransferase activity(GO:0047192) |
0.3 | 0.7 | GO:0004351 | glutamate decarboxylase activity(GO:0004351) |
0.3 | 0.7 | GO:0004698 | calcium-dependent protein kinase C activity(GO:0004698) |
0.3 | 3.9 | GO:0008796 | bis(5'-nucleosyl)-tetraphosphatase activity(GO:0008796) |
0.3 | 1.0 | GO:0008503 | benzodiazepine receptor activity(GO:0008503) |
0.3 | 1.6 | GO:0008294 | calcium- and calmodulin-responsive adenylate cyclase activity(GO:0008294) |
0.3 | 0.6 | GO:0003872 | 6-phosphofructokinase activity(GO:0003872) |
0.3 | 8.9 | GO:0017080 | sodium channel regulator activity(GO:0017080) |
0.3 | 7.7 | GO:0001106 | RNA polymerase II transcription corepressor activity(GO:0001106) |
0.3 | 1.5 | GO:0005166 | neurotrophin p75 receptor binding(GO:0005166) |
0.3 | 1.8 | GO:0004716 | receptor signaling protein tyrosine kinase activity(GO:0004716) |
0.3 | 0.9 | GO:0001075 | transcription factor activity, RNA polymerase II core promoter sequence-specific binding involved in preinitiation complex assembly(GO:0001075) |
0.3 | 0.9 | GO:0008184 | glycogen phosphorylase activity(GO:0008184) |
0.3 | 0.9 | GO:0019153 | protein-disulfide reductase (glutathione) activity(GO:0019153) |
0.3 | 0.9 | GO:0017002 | activin-activated receptor activity(GO:0017002) |
0.3 | 1.2 | GO:0008174 | mRNA methyltransferase activity(GO:0008174) |
0.3 | 3.0 | GO:0031078 | histone deacetylase activity (H3-K14 specific)(GO:0031078) NAD-dependent histone deacetylase activity (H3-K14 specific)(GO:0032041) |
0.3 | 1.4 | GO:0003828 | alpha-N-acetylneuraminate alpha-2,8-sialyltransferase activity(GO:0003828) |
0.3 | 2.0 | GO:0033743 | peptide-methionine (R)-S-oxide reductase activity(GO:0033743) |
0.3 | 0.9 | GO:0070548 | L-glutamine aminotransferase activity(GO:0070548) |
0.3 | 1.4 | GO:0004634 | phosphopyruvate hydratase activity(GO:0004634) |
0.3 | 0.8 | GO:0004920 | interleukin-10 receptor activity(GO:0004920) |
0.3 | 0.5 | GO:0015222 | serotonin transmembrane transporter activity(GO:0015222) |
0.3 | 2.4 | GO:0004499 | N,N-dimethylaniline monooxygenase activity(GO:0004499) |
0.3 | 0.3 | GO:0031697 | beta-1 adrenergic receptor binding(GO:0031697) |
0.3 | 0.8 | GO:0043199 | sulfate binding(GO:0043199) |
0.3 | 1.0 | GO:0046974 | histone methyltransferase activity (H3-K9 specific)(GO:0046974) |
0.2 | 3.2 | GO:0008353 | RNA polymerase II carboxy-terminal domain kinase activity(GO:0008353) |
0.2 | 1.0 | GO:0035727 | lysophosphatidic acid binding(GO:0035727) |
0.2 | 0.7 | GO:0004365 | glyceraldehyde-3-phosphate dehydrogenase (NAD+) (phosphorylating) activity(GO:0004365) glyceraldehyde-3-phosphate dehydrogenase (NAD(P)+) (phosphorylating) activity(GO:0043891) |
0.2 | 1.2 | GO:0017034 | Rap guanyl-nucleotide exchange factor activity(GO:0017034) |
0.2 | 0.5 | GO:0004886 | 9-cis retinoic acid receptor activity(GO:0004886) |
0.2 | 0.7 | GO:0030506 | ankyrin binding(GO:0030506) |
0.2 | 0.7 | GO:0030144 | alpha-1,6-mannosylglycoprotein 6-beta-N-acetylglucosaminyltransferase activity(GO:0030144) |
0.2 | 0.7 | GO:0004942 | anaphylatoxin receptor activity(GO:0004942) |
0.2 | 1.6 | GO:0016595 | glutamate binding(GO:0016595) |
0.2 | 0.9 | GO:0051880 | G-quadruplex DNA binding(GO:0051880) |
0.2 | 1.4 | GO:0004385 | guanylate kinase activity(GO:0004385) |
0.2 | 1.8 | GO:0097157 | pre-mRNA intronic binding(GO:0097157) |
0.2 | 2.0 | GO:0008093 | cytoskeletal adaptor activity(GO:0008093) |
0.2 | 0.7 | GO:0034513 | box H/ACA snoRNA binding(GO:0034513) |
0.2 | 0.4 | GO:0035373 | chondroitin sulfate proteoglycan binding(GO:0035373) |
0.2 | 1.1 | GO:0002054 | nucleobase binding(GO:0002054) |
0.2 | 0.6 | GO:0016212 | kynurenine-oxoglutarate transaminase activity(GO:0016212) kynurenine aminotransferase activity(GO:0036137) |
0.2 | 1.3 | GO:0008479 | queuine tRNA-ribosyltransferase activity(GO:0008479) |
0.2 | 0.2 | GO:0070915 | lysophosphatidic acid receptor activity(GO:0070915) |
0.2 | 1.1 | GO:0034711 | inhibin binding(GO:0034711) |
0.2 | 0.9 | GO:0000403 | Y-form DNA binding(GO:0000403) |
0.2 | 0.8 | GO:0033192 | calmodulin-dependent protein phosphatase activity(GO:0033192) |
0.2 | 6.8 | GO:0005251 | delayed rectifier potassium channel activity(GO:0005251) |
0.2 | 0.8 | GO:0043140 | ATP-dependent 3'-5' DNA helicase activity(GO:0043140) |
0.2 | 1.0 | GO:0016901 | oxidoreductase activity, acting on the CH-OH group of donors, quinone or similar compound as acceptor(GO:0016901) |
0.2 | 0.4 | GO:0008525 | phosphatidylcholine transporter activity(GO:0008525) |
0.2 | 0.8 | GO:0004127 | cytidylate kinase activity(GO:0004127) |
0.2 | 4.3 | GO:0008519 | ammonium transmembrane transporter activity(GO:0008519) |
0.2 | 0.8 | GO:0048403 | brain-derived neurotrophic factor binding(GO:0048403) |
0.2 | 2.2 | GO:0016909 | JUN kinase activity(GO:0004705) SAP kinase activity(GO:0016909) |
0.2 | 1.2 | GO:0019958 | C-X-C chemokine binding(GO:0019958) |
0.2 | 0.8 | GO:0034056 | estrogen response element binding(GO:0034056) |
0.2 | 0.6 | GO:0035650 | AP-1 adaptor complex binding(GO:0035650) |
0.2 | 1.0 | GO:0042285 | UDP-xylosyltransferase activity(GO:0035252) xylosyltransferase activity(GO:0042285) |
0.2 | 1.8 | GO:0001206 | transcriptional repressor activity, RNA polymerase II distal enhancer sequence-specific binding(GO:0001206) |
0.2 | 0.6 | GO:0050309 | glucose-6-phosphatase activity(GO:0004346) sugar-terminal-phosphatase activity(GO:0050309) |
0.2 | 1.0 | GO:0015216 | adenine nucleotide transmembrane transporter activity(GO:0000295) purine ribonucleotide transmembrane transporter activity(GO:0005346) purine nucleotide transmembrane transporter activity(GO:0015216) |
0.2 | 0.2 | GO:0050816 | phosphothreonine binding(GO:0050816) |
0.2 | 1.0 | GO:0008526 | phosphatidylinositol transporter activity(GO:0008526) |
0.2 | 0.4 | GO:0098632 | protein binding involved in cell-cell adhesion(GO:0098632) |
0.2 | 1.7 | GO:0001091 | RNA polymerase II basal transcription factor binding(GO:0001091) |
0.2 | 3.4 | GO:0008266 | poly(U) RNA binding(GO:0008266) |
0.2 | 0.6 | GO:0019961 | interferon binding(GO:0019961) |
0.2 | 1.1 | GO:0016937 | short-branched-chain-acyl-CoA dehydrogenase activity(GO:0016937) |
0.2 | 0.6 | GO:0042979 | ornithine decarboxylase regulator activity(GO:0042979) |
0.2 | 0.7 | GO:0071074 | eukaryotic initiation factor eIF2 binding(GO:0071074) |
0.2 | 0.9 | GO:0046912 | transferase activity, transferring acyl groups, acyl groups converted into alkyl on transfer(GO:0046912) |
0.2 | 2.6 | GO:0032794 | GTPase activating protein binding(GO:0032794) |
0.2 | 0.5 | GO:0008900 | hydrogen:potassium-exchanging ATPase activity(GO:0008900) |
0.2 | 0.7 | GO:0035312 | 5'-3' exodeoxyribonuclease activity(GO:0035312) |
0.2 | 1.7 | GO:0004970 | ionotropic glutamate receptor activity(GO:0004970) |
0.2 | 0.5 | GO:0016149 | translation release factor activity, codon specific(GO:0016149) |
0.2 | 1.9 | GO:0030159 | receptor signaling complex scaffold activity(GO:0030159) |
0.2 | 0.2 | GO:0036222 | XTP diphosphatase activity(GO:0036222) |
0.2 | 0.5 | GO:0016661 | oxidoreductase activity, acting on other nitrogenous compounds as donors(GO:0016661) |
0.2 | 0.5 | GO:0030297 | transmembrane receptor protein tyrosine kinase activator activity(GO:0030297) |
0.2 | 0.2 | GO:0030350 | iron-responsive element binding(GO:0030350) |
0.2 | 1.0 | GO:0030368 | interleukin-17 receptor activity(GO:0030368) |
0.2 | 0.2 | GO:0048408 | epidermal growth factor binding(GO:0048408) |
0.2 | 0.3 | GO:0016743 | carboxyl- or carbamoyltransferase activity(GO:0016743) |
0.2 | 3.1 | GO:0080025 | phosphatidylinositol-3,5-bisphosphate binding(GO:0080025) |
0.2 | 0.3 | GO:0001875 | lipopolysaccharide receptor activity(GO:0001875) |
0.2 | 0.8 | GO:0098639 | collagen binding involved in cell-matrix adhesion(GO:0098639) |
0.2 | 1.8 | GO:0070742 | C2H2 zinc finger domain binding(GO:0070742) |
0.2 | 0.5 | GO:0008147 | structural constituent of bone(GO:0008147) |
0.2 | 0.8 | GO:0004945 | angiotensin type II receptor activity(GO:0004945) |
0.2 | 1.4 | GO:0004438 | phosphatidylinositol-3-phosphatase activity(GO:0004438) |
0.2 | 0.2 | GO:0008113 | peptide-methionine (S)-S-oxide reductase activity(GO:0008113) |
0.2 | 1.6 | GO:0004697 | protein kinase C activity(GO:0004697) |
0.2 | 5.3 | GO:0051539 | 4 iron, 4 sulfur cluster binding(GO:0051539) |
0.2 | 0.8 | GO:1990381 | ubiquitin-specific protease binding(GO:1990381) |
0.2 | 0.8 | GO:0004652 | polynucleotide adenylyltransferase activity(GO:0004652) |
0.2 | 0.5 | GO:0015065 | uridine nucleotide receptor activity(GO:0015065) G-protein coupled pyrimidinergic nucleotide receptor activity(GO:0071553) |
0.2 | 0.5 | GO:0000309 | nicotinamide-nucleotide adenylyltransferase activity(GO:0000309) nicotinate-nucleotide adenylyltransferase activity(GO:0004515) |
0.2 | 9.1 | GO:0003777 | microtubule motor activity(GO:0003777) |
0.2 | 1.8 | GO:0045295 | gamma-catenin binding(GO:0045295) |
0.2 | 2.4 | GO:0004435 | phosphatidylinositol phospholipase C activity(GO:0004435) |
0.2 | 1.2 | GO:0005041 | low-density lipoprotein receptor activity(GO:0005041) |
0.2 | 0.5 | GO:0033592 | RNA strand annealing activity(GO:0033592) |
0.1 | 0.4 | GO:0030984 | kininogen binding(GO:0030984) |
0.1 | 2.8 | GO:0051393 | alpha-actinin binding(GO:0051393) |
0.1 | 1.4 | GO:0008432 | JUN kinase binding(GO:0008432) |
0.1 | 1.6 | GO:0004312 | fatty acid synthase activity(GO:0004312) |
0.1 | 6.8 | GO:0003774 | motor activity(GO:0003774) |
0.1 | 1.0 | GO:0039706 | co-receptor binding(GO:0039706) |
0.1 | 1.9 | GO:0004993 | G-protein coupled serotonin receptor activity(GO:0004993) serotonin receptor activity(GO:0099589) |
0.1 | 3.4 | GO:0042056 | chemoattractant activity(GO:0042056) |
0.1 | 0.4 | GO:1904288 | BAT3 complex binding(GO:1904288) |
0.1 | 2.2 | GO:0035255 | ionotropic glutamate receptor binding(GO:0035255) |
0.1 | 1.0 | GO:0008568 | microtubule-severing ATPase activity(GO:0008568) |
0.1 | 0.5 | GO:0004969 | histamine receptor activity(GO:0004969) |
0.1 | 0.9 | GO:0035005 | 1-phosphatidylinositol-4-phosphate 3-kinase activity(GO:0035005) |
0.1 | 2.9 | GO:0005540 | hyaluronic acid binding(GO:0005540) |
0.1 | 1.1 | GO:0016840 | carbon-nitrogen lyase activity(GO:0016840) |
0.1 | 6.7 | GO:0017022 | myosin binding(GO:0017022) |
0.1 | 2.3 | GO:0003785 | actin monomer binding(GO:0003785) |
0.1 | 0.5 | GO:0015467 | G-protein activated inward rectifier potassium channel activity(GO:0015467) |
0.1 | 1.6 | GO:0043274 | phospholipase binding(GO:0043274) |
0.1 | 0.4 | GO:0016716 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, another compound as one donor, and incorporation of one atom of oxygen(GO:0016716) |
0.1 | 0.6 | GO:0000268 | peroxisome targeting sequence binding(GO:0000268) |
0.1 | 3.6 | GO:0008028 | monocarboxylic acid transmembrane transporter activity(GO:0008028) |
0.1 | 3.3 | GO:0015347 | sodium-independent organic anion transmembrane transporter activity(GO:0015347) |
0.1 | 0.2 | GO:0061629 | RNA polymerase II sequence-specific DNA binding transcription factor binding(GO:0061629) |
0.1 | 1.1 | GO:0051787 | misfolded protein binding(GO:0051787) |
0.1 | 0.2 | GO:0016428 | tRNA (cytosine) methyltransferase activity(GO:0016427) tRNA (cytosine-5-)-methyltransferase activity(GO:0016428) |
0.1 | 3.0 | GO:0019706 | protein-cysteine S-palmitoyltransferase activity(GO:0019706) |
0.1 | 0.8 | GO:1904264 | ubiquitin protein ligase activity involved in ERAD pathway(GO:1904264) |
0.1 | 0.6 | GO:0015193 | L-proline transmembrane transporter activity(GO:0015193) |
0.1 | 2.4 | GO:0043014 | alpha-tubulin binding(GO:0043014) |
0.1 | 5.4 | GO:0005080 | protein kinase C binding(GO:0005080) |
0.1 | 2.2 | GO:0070412 | R-SMAD binding(GO:0070412) |
0.1 | 0.4 | GO:0016309 | 1-phosphatidylinositol-5-phosphate 4-kinase activity(GO:0016309) |
0.1 | 2.2 | GO:0042813 | Wnt-activated receptor activity(GO:0042813) |
0.1 | 1.0 | GO:0016208 | AMP binding(GO:0016208) |
0.1 | 0.6 | GO:0071723 | lipopeptide binding(GO:0071723) |
0.1 | 0.8 | GO:0048018 | receptor agonist activity(GO:0048018) |
0.1 | 0.3 | GO:1990189 | peptide-serine-N-acetyltransferase activity(GO:1990189) peptide-glutamate-N-acetyltransferase activity(GO:1990190) |
0.1 | 0.3 | GO:0038085 | vascular endothelial growth factor binding(GO:0038085) |
0.1 | 0.5 | GO:0070728 | leucine binding(GO:0070728) |
0.1 | 0.3 | GO:0005167 | neurotrophin receptor binding(GO:0005165) neurotrophin TRK receptor binding(GO:0005167) |
0.1 | 1.0 | GO:0017160 | Ral GTPase binding(GO:0017160) |
0.1 | 0.4 | GO:0000340 | RNA 7-methylguanosine cap binding(GO:0000340) |
0.1 | 0.2 | GO:0034046 | poly(G) binding(GO:0034046) |
0.1 | 0.5 | GO:0042609 | CD4 receptor binding(GO:0042609) |
0.1 | 0.4 | GO:0019158 | fructokinase activity(GO:0008865) mannokinase activity(GO:0019158) |
0.1 | 0.7 | GO:0018655 | 3-(3-hydroxyphenyl)propionate hydroxylase activity(GO:0008688) 4-chlorobenzaldehyde oxidase activity(GO:0018471) 3,5-xylenol methylhydroxylase activity(GO:0018630) phenylacetate hydroxylase activity(GO:0018631) 4-nitrophenol 4-monooxygenase activity(GO:0018632) dimethyl sulfide monooxygenase activity(GO:0018633) alpha-pinene monooxygenase [NADH] activity(GO:0018634) 1-hydroxy-2-naphthoate hydroxylase activity(GO:0018637) toluene 4-monooxygenase activity(GO:0018638) xylene monooxygenase activity(GO:0018639) dibenzothiophene monooxygenase activity(GO:0018640) 6-hydroxy-3-methyl-2-oxo-1,2-dihydroquinoline 6-monooxygenase activity(GO:0018641) chlorophenol 4-monooxygenase activity(GO:0018642) carbon disulfide oxygenase activity(GO:0018643) toluene 2-monooxygenase activity(GO:0018644) 1-hydroxy-2-oxolimonene 1,2-monooxygenase activity(GO:0018646) phenanthrene 1,2-monooxygenase activity(GO:0018647) tetrahydrofuran hydroxylase activity(GO:0018649) styrene monooxygenase activity(GO:0018650) toluene-4-sulfonate monooxygenase activity(GO:0018651) toluene-sulfonate methyl-monooxygenase activity(GO:0018652) 3-methyl-2-oxo-1,2-dihydroquinoline 6-monooxygenase activity(GO:0018653) 2-hydroxy-phenylacetate hydroxylase activity(GO:0018654) 2-oxo-delta3-4,5,5-trimethylcyclopentenylacetyl-CoA 1,2-monooxygenase activity(GO:0018655) phenanthrene 3,4-monooxygenase activity(GO:0018656) toluene 3-monooxygenase activity(GO:0018657) 4-hydroxyphenylacetate,NADH:oxygen oxidoreductase (3-hydroxylating) activity(GO:0018660) limonene monooxygenase activity(GO:0019113) 2-methylnaphthalene hydroxylase activity(GO:0034526) 1-methylnaphthalene hydroxylase activity(GO:0034534) bisphenol A hydroxylase A activity(GO:0034560) salicylate 5-hydroxylase activity(GO:0034785) isobutylamine N-hydroxylase activity(GO:0034791) branched-chain dodecylbenzene sulfonate monooxygenase activity(GO:0034802) 3-HSA hydroxylase activity(GO:0034819) 4-hydroxypyridine-3-hydroxylase activity(GO:0034894) 2-octaprenyl-3-methyl-6-methoxy-1,4-benzoquinol hydroxylase activity(GO:0043719) 6-hydroxynicotinate 3-monooxygenase activity(GO:0043731) thalianol hydroxylase activity(GO:0080014) |
0.1 | 1.1 | GO:0016713 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, reduced iron-sulfur protein as one donor, and incorporation of one atom of oxygen(GO:0016713) |
0.1 | 0.9 | GO:0033130 | acetylcholine receptor binding(GO:0033130) |
0.1 | 0.4 | GO:0033142 | progesterone receptor binding(GO:0033142) |
0.1 | 1.0 | GO:0008179 | adenylate cyclase binding(GO:0008179) |
0.1 | 2.5 | GO:0005154 | epidermal growth factor receptor binding(GO:0005154) |
0.1 | 0.9 | GO:0015026 | coreceptor activity(GO:0015026) |
0.1 | 0.4 | GO:0035473 | lipase binding(GO:0035473) |
0.1 | 0.7 | GO:0005375 | copper ion transmembrane transporter activity(GO:0005375) |
0.1 | 6.0 | GO:0008186 | ATP-dependent RNA helicase activity(GO:0004004) RNA-dependent ATPase activity(GO:0008186) |
0.1 | 1.0 | GO:0004526 | ribonuclease P activity(GO:0004526) |
0.1 | 8.0 | GO:0004725 | protein tyrosine phosphatase activity(GO:0004725) |
0.1 | 0.2 | GO:0008656 | cysteine-type endopeptidase activator activity involved in apoptotic process(GO:0008656) |
0.1 | 0.3 | GO:0031493 | nucleosomal histone binding(GO:0031493) |
0.1 | 0.1 | GO:0031433 | telethonin binding(GO:0031433) |
0.1 | 0.3 | GO:0030911 | TPR domain binding(GO:0030911) |
0.1 | 0.1 | GO:0001226 | RNA polymerase II transcription corepressor binding(GO:0001226) |
0.1 | 2.6 | GO:0005484 | SNAP receptor activity(GO:0005484) |
0.1 | 0.7 | GO:0035254 | glutamate receptor binding(GO:0035254) |
0.1 | 0.4 | GO:0030572 | cardiolipin synthase activity(GO:0008808) phosphatidyltransferase activity(GO:0030572) |
0.1 | 0.4 | GO:0004740 | pyruvate dehydrogenase (acetyl-transferring) kinase activity(GO:0004740) |
0.1 | 1.3 | GO:0031402 | sodium ion binding(GO:0031402) |
0.1 | 1.3 | GO:0043422 | protein kinase B binding(GO:0043422) |
0.1 | 0.5 | GO:0004111 | creatine kinase activity(GO:0004111) |
0.1 | 0.3 | GO:1990226 | histone methyltransferase binding(GO:1990226) |
0.1 | 2.1 | GO:0005212 | structural constituent of eye lens(GO:0005212) |
0.1 | 0.3 | GO:0070326 | very-low-density lipoprotein particle receptor binding(GO:0070326) |
0.1 | 1.1 | GO:0030275 | LRR domain binding(GO:0030275) |
0.1 | 0.9 | GO:0001784 | phosphotyrosine binding(GO:0001784) |
0.1 | 2.5 | GO:0017112 | Rab guanyl-nucleotide exchange factor activity(GO:0017112) |
0.1 | 0.3 | GO:0035673 | oligopeptide transmembrane transporter activity(GO:0035673) |
0.1 | 0.5 | GO:0008131 | primary amine oxidase activity(GO:0008131) |
0.1 | 0.3 | GO:0033829 | O-fucosylpeptide 3-beta-N-acetylglucosaminyltransferase activity(GO:0033829) |
0.1 | 0.4 | GO:0052723 | inositol hexakisphosphate kinase activity(GO:0000828) inositol hexakisphosphate 5-kinase activity(GO:0000832) inositol hexakisphosphate 1-kinase activity(GO:0052723) inositol hexakisphosphate 3-kinase activity(GO:0052724) |
0.1 | 0.3 | GO:0034714 | type III transforming growth factor beta receptor binding(GO:0034714) |
0.1 | 0.8 | GO:0004407 | histone deacetylase activity(GO:0004407) |
0.1 | 0.4 | GO:0004523 | RNA-DNA hybrid ribonuclease activity(GO:0004523) |
0.1 | 1.2 | GO:0004622 | lysophospholipase activity(GO:0004622) |
0.1 | 0.3 | GO:0008745 | N-acetylmuramoyl-L-alanine amidase activity(GO:0008745) peptidoglycan receptor activity(GO:0016019) |
0.1 | 0.4 | GO:0046975 | histone methyltransferase activity (H3-K36 specific)(GO:0046975) |
0.1 | 0.2 | GO:0080130 | L-phenylalanine aminotransferase activity(GO:0070546) L-phenylalanine:2-oxoglutarate aminotransferase activity(GO:0080130) |
0.1 | 0.7 | GO:0034891 | pinocarveol dehydrogenase activity(GO:0018446) chloral hydrate dehydrogenase activity(GO:0018447) hydroxymethylmethylsilanediol oxidase activity(GO:0018448) 1-phenylethanol dehydrogenase activity(GO:0018449) myrtenol dehydrogenase activity(GO:0018450) cis-1,2-dihydroxy-1,2-dihydro-8-carboxynaphthalene dehydrogenase activity(GO:0034522) 3-hydroxy-4-methyloctanoyl-CoA dehydrogenase activity(GO:0034582) 2-hydroxy-4-isopropenylcyclohexane-1-carboxyl-CoA dehydrogenase activity(GO:0034778) cis-9,10-dihydroanthracene-9,10-diol dehydrogenase activity(GO:0034817) citronellol dehydrogenase activity(GO:0034821) naphthyl-2-hydroxymethyl-succinyl-CoA dehydrogenase activity(GO:0034847) 2,4,4-trimethyl-1-pentanol dehydrogenase activity(GO:0034863) 2,4,4-trimethyl-3-hydroxypentanoyl-CoA dehydrogenase activity(GO:0034868) 1-hydroxy-4,4-dimethylpentan-3-one dehydrogenase activity(GO:0034871) endosulfan diol dehydrogenase activity(GO:0034891) endosulfan hydroxyether dehydrogenase activity(GO:0034901) 3-hydroxy-2-methylhexanoyl-CoA dehydrogenase activity(GO:0034918) 3-hydroxy-2,6-dimethyl-5-methylene-heptanoyl-CoA dehydrogenase activity(GO:0034944) versicolorin reductase activity(GO:0042469) ketoreductase activity(GO:0045703) |
0.1 | 0.2 | GO:0008495 | 4-hydroxybenzoate octaprenyltransferase activity(GO:0008412) protoheme IX farnesyltransferase activity(GO:0008495) (S)-2,3-di-O-geranylgeranylglyceryl phosphate synthase activity(GO:0043888) cadaverine aminopropyltransferase activity(GO:0043918) agmatine aminopropyltransferase activity(GO:0043919) 1,4-dihydroxy-2-naphthoate octaprenyltransferase activity(GO:0046428) trans-pentaprenyltranstransferase activity(GO:0048045) ATP dimethylallyltransferase activity(GO:0052622) ADP dimethylallyltransferase activity(GO:0052623) |
0.1 | 3.9 | GO:0019905 | syntaxin binding(GO:0019905) |
0.1 | 0.8 | GO:0009881 | photoreceptor activity(GO:0009881) |
0.1 | 0.2 | GO:0019767 | IgE receptor activity(GO:0019767) |
0.1 | 0.2 | GO:0008889 | glycerophosphodiester phosphodiesterase activity(GO:0008889) |
0.1 | 0.9 | GO:0016813 | hydrolase activity, acting on carbon-nitrogen (but not peptide) bonds, in linear amidines(GO:0016813) |
0.1 | 0.8 | GO:1990841 | promoter-specific chromatin binding(GO:1990841) |
0.1 | 0.4 | GO:0004565 | beta-galactosidase activity(GO:0004565) |
0.1 | 0.7 | GO:0001161 | intronic transcription regulatory region sequence-specific DNA binding(GO:0001161) |
0.1 | 0.4 | GO:0043008 | ATP-dependent protein binding(GO:0043008) |
0.1 | 0.4 | GO:0030296 | protein tyrosine kinase activator activity(GO:0030296) |
0.1 | 1.0 | GO:0005351 | sugar:proton symporter activity(GO:0005351) |
0.1 | 0.4 | GO:0034902 | alkyl sulfatase activity(GO:0018741) endosulfan hemisulfate sulfatase activity(GO:0034889) endosulfan sulfate hydrolase activity(GO:0034902) |
0.1 | 0.7 | GO:0016920 | pyroglutamyl-peptidase activity(GO:0016920) |
0.1 | 0.2 | GO:0043426 | MRF binding(GO:0043426) |
0.1 | 0.4 | GO:0032184 | SUMO polymer binding(GO:0032184) |
0.1 | 0.1 | GO:0016530 | metallochaperone activity(GO:0016530) |
0.1 | 0.2 | GO:0102007 | lactonohydrolase activity(GO:0046573) acyl-L-homoserine-lactone lactonohydrolase activity(GO:0102007) |
0.1 | 0.2 | GO:0070052 | collagen V binding(GO:0070052) |
0.1 | 1.3 | GO:0005086 | ARF guanyl-nucleotide exchange factor activity(GO:0005086) |
0.1 | 7.8 | GO:0008170 | N-methyltransferase activity(GO:0008170) |
0.1 | 0.7 | GO:0005242 | inward rectifier potassium channel activity(GO:0005242) |
0.1 | 0.5 | GO:0032454 | histone demethylase activity (H3-K9 specific)(GO:0032454) |
0.1 | 2.5 | GO:0043621 | protein self-association(GO:0043621) |
0.1 | 0.2 | GO:0008427 | calcium-dependent protein kinase inhibitor activity(GO:0008427) |
0.1 | 0.7 | GO:0004143 | diacylglycerol kinase activity(GO:0004143) |
0.1 | 0.4 | GO:0036402 | proteasome-activating ATPase activity(GO:0036402) |
0.1 | 0.7 | GO:0015643 | toxic substance binding(GO:0015643) |
0.1 | 0.2 | GO:0019797 | procollagen-proline 3-dioxygenase activity(GO:0019797) |
0.1 | 0.7 | GO:0010181 | FMN binding(GO:0010181) |
0.1 | 0.3 | GO:0035251 | UDP-glucosyltransferase activity(GO:0035251) |
0.1 | 0.3 | GO:0005042 | netrin receptor activity(GO:0005042) |
0.1 | 0.1 | GO:0071933 | Arp2/3 complex binding(GO:0071933) |
0.1 | 0.6 | GO:0004176 | ATP-dependent peptidase activity(GO:0004176) |
0.1 | 0.1 | GO:0031698 | beta-2 adrenergic receptor binding(GO:0031698) |
0.1 | 0.2 | GO:0008454 | alpha-1,3-mannosylglycoprotein 4-beta-N-acetylglucosaminyltransferase activity(GO:0008454) |
0.1 | 0.6 | GO:0033170 | DNA clamp loader activity(GO:0003689) protein-DNA loading ATPase activity(GO:0033170) |
0.1 | 0.2 | GO:0016714 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, reduced pteridine as one donor, and incorporation of one atom of oxygen(GO:0016714) |
0.1 | 0.2 | GO:0010314 | phosphatidylinositol-5-phosphate binding(GO:0010314) |
0.1 | 1.2 | GO:0051183 | vitamin transporter activity(GO:0051183) |
0.1 | 0.2 | GO:0004528 | phosphodiesterase I activity(GO:0004528) |
0.1 | 0.1 | GO:2001070 | starch binding(GO:2001070) |
0.1 | 0.2 | GO:0004833 | tryptophan 2,3-dioxygenase activity(GO:0004833) |
0.1 | 0.1 | GO:0019960 | C-X3-C chemokine binding(GO:0019960) |
0.1 | 0.4 | GO:0017147 | Wnt-protein binding(GO:0017147) |
0.1 | 0.2 | GO:0004366 | glycerol-3-phosphate O-acyltransferase activity(GO:0004366) |
0.1 | 0.1 | GO:0019237 | centromeric DNA binding(GO:0019237) |
0.1 | 0.5 | GO:0004383 | guanylate cyclase activity(GO:0004383) |
0.1 | 0.2 | GO:0043138 | 3'-5' DNA helicase activity(GO:0043138) |
0.1 | 0.1 | GO:0030229 | very-low-density lipoprotein particle receptor activity(GO:0030229) |
0.1 | 0.5 | GO:0008331 | high voltage-gated calcium channel activity(GO:0008331) |
0.1 | 0.7 | GO:0051428 | peptide hormone receptor binding(GO:0051428) |
0.1 | 0.8 | GO:0015269 | calcium-activated potassium channel activity(GO:0015269) |
0.1 | 0.6 | GO:0004983 | neuropeptide Y receptor activity(GO:0004983) |
0.1 | 13.3 | GO:0003779 | actin binding(GO:0003779) |
0.1 | 0.3 | GO:0005223 | intracellular cGMP activated cation channel activity(GO:0005223) |
0.1 | 1.1 | GO:0050699 | WW domain binding(GO:0050699) |
0.1 | 0.6 | GO:0031210 | phosphatidylcholine binding(GO:0031210) |
0.1 | 0.6 | GO:0005520 | insulin-like growth factor binding(GO:0005520) |
0.1 | 0.7 | GO:0017134 | fibroblast growth factor binding(GO:0017134) |
0.1 | 0.8 | GO:0042169 | SH2 domain binding(GO:0042169) |
0.1 | 3.5 | GO:0004702 | receptor signaling protein serine/threonine kinase activity(GO:0004702) |
0.1 | 0.3 | GO:0050700 | CARD domain binding(GO:0050700) |
0.1 | 0.2 | GO:0070883 | pre-miRNA binding(GO:0070883) |
0.1 | 1.0 | GO:0005031 | tumor necrosis factor-activated receptor activity(GO:0005031) death receptor activity(GO:0005035) |
0.1 | 2.8 | GO:0000033 | alpha-1,3-mannosyltransferase activity(GO:0000033) |
0.1 | 2.0 | GO:0004722 | protein serine/threonine phosphatase activity(GO:0004722) |
0.1 | 0.9 | GO:0003954 | NADH dehydrogenase activity(GO:0003954) |
0.1 | 0.2 | GO:0031690 | adrenergic receptor binding(GO:0031690) |
0.1 | 0.3 | GO:0015288 | porin activity(GO:0015288) |
0.1 | 0.3 | GO:0035612 | AP-2 adaptor complex binding(GO:0035612) |
0.1 | 0.3 | GO:0001640 | adenylate cyclase inhibiting G-protein coupled glutamate receptor activity(GO:0001640) |
0.0 | 9.4 | GO:0005096 | GTPase activator activity(GO:0005096) |
0.0 | 0.2 | GO:1901611 | phosphatidylglycerol binding(GO:1901611) |
0.0 | 1.3 | GO:0004714 | transmembrane receptor protein tyrosine kinase activity(GO:0004714) |
0.0 | 0.2 | GO:0031681 | G-protein beta-subunit binding(GO:0031681) |
0.0 | 0.1 | GO:0032190 | acrosin binding(GO:0032190) |
0.0 | 7.8 | GO:0061630 | ubiquitin protein ligase activity(GO:0061630) |
0.0 | 0.1 | GO:1990405 | protein antigen binding(GO:1990405) |
0.0 | 0.1 | GO:1990829 | C-rich single-stranded DNA binding(GO:1990829) |
0.0 | 0.1 | GO:0015018 | galactosylgalactosylxylosylprotein 3-beta-glucuronosyltransferase activity(GO:0015018) |
0.0 | 0.2 | GO:0052796 | exo-alpha-sialidase activity(GO:0004308) alpha-sialidase activity(GO:0016997) exo-alpha-(2->3)-sialidase activity(GO:0052794) exo-alpha-(2->6)-sialidase activity(GO:0052795) exo-alpha-(2->8)-sialidase activity(GO:0052796) |
0.0 | 0.3 | GO:0035198 | miRNA binding(GO:0035198) |
0.0 | 0.2 | GO:0004994 | somatostatin receptor activity(GO:0004994) |
0.0 | 0.1 | GO:0051032 | nucleic acid transmembrane transporter activity(GO:0051032) RNA transmembrane transporter activity(GO:0051033) |
0.0 | 0.0 | GO:0016891 | endoribonuclease activity, producing 5'-phosphomonoesters(GO:0016891) |
0.0 | 0.4 | GO:0070513 | death domain binding(GO:0070513) |
0.0 | 0.5 | GO:0016709 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, NAD(P)H as one donor, and incorporation of one atom of oxygen(GO:0016709) |
0.0 | 0.3 | GO:0031730 | CCR5 chemokine receptor binding(GO:0031730) |
0.0 | 1.3 | GO:1902936 | phosphatidylinositol bisphosphate binding(GO:1902936) |
0.0 | 1.4 | GO:0033038 | bitter taste receptor activity(GO:0033038) |
0.0 | 0.4 | GO:0050750 | low-density lipoprotein particle receptor binding(GO:0050750) |
0.0 | 0.2 | GO:0004558 | alpha-1,4-glucosidase activity(GO:0004558) |
0.0 | 1.4 | GO:0016667 | oxidoreductase activity, acting on a sulfur group of donors(GO:0016667) |
0.0 | 0.5 | GO:0005057 | receptor signaling protein activity(GO:0005057) |
0.0 | 0.1 | GO:0004995 | tachykinin receptor activity(GO:0004995) |
0.0 | 0.7 | GO:0016755 | transferase activity, transferring amino-acyl groups(GO:0016755) |
0.0 | 0.1 | GO:0031893 | vasopressin receptor binding(GO:0031893) |
0.0 | 1.4 | GO:0035064 | methylated histone binding(GO:0035064) |
0.0 | 0.3 | GO:0016846 | carbon-sulfur lyase activity(GO:0016846) |
0.0 | 0.2 | GO:0070087 | chromo shadow domain binding(GO:0070087) |
0.0 | 1.6 | GO:0008907 | integrase activity(GO:0008907) T/G mismatch-specific endonuclease activity(GO:0043765) retroviral integrase activity(GO:0044823) retroviral 3' processing activity(GO:0044824) |
0.0 | 0.3 | GO:0043023 | ribosomal large subunit binding(GO:0043023) |
0.0 | 0.1 | GO:0042910 | xenobiotic transporter activity(GO:0042910) |
0.0 | 0.1 | GO:0015211 | purine nucleoside transmembrane transporter activity(GO:0015211) |
0.0 | 0.2 | GO:0033691 | sialic acid binding(GO:0033691) |
0.0 | 0.5 | GO:0036002 | pre-mRNA binding(GO:0036002) |
0.0 | 0.4 | GO:0045125 | bioactive lipid receptor activity(GO:0045125) |
0.0 | 0.1 | GO:0000155 | phosphorelay sensor kinase activity(GO:0000155) |
0.0 | 0.1 | GO:0022833 | mechanically-gated ion channel activity(GO:0008381) mechanically gated channel activity(GO:0022833) |
0.0 | 0.1 | GO:0019776 | Atg8 ligase activity(GO:0019776) |
0.0 | 0.2 | GO:0004370 | glycerol kinase activity(GO:0004370) |
0.0 | 0.7 | GO:0005104 | fibroblast growth factor receptor binding(GO:0005104) |
0.0 | 0.3 | GO:0016783 | sulfurtransferase activity(GO:0016783) |
0.0 | 0.7 | GO:0035035 | histone acetyltransferase binding(GO:0035035) |
0.0 | 0.1 | GO:0008413 | 8-oxo-7,8-dihydroguanosine triphosphate pyrophosphatase activity(GO:0008413) |
0.0 | 17.3 | GO:0004930 | G-protein coupled receptor activity(GO:0004930) |
0.0 | 0.0 | GO:0016882 | cyclo-ligase activity(GO:0016882) |
0.0 | 0.1 | GO:0050072 | m7G(5')pppN diphosphatase activity(GO:0050072) |
0.0 | 0.1 | GO:0035939 | microsatellite binding(GO:0035939) |
0.0 | 0.1 | GO:0071558 | histone demethylase activity (H3-K27 specific)(GO:0071558) |
0.0 | 0.5 | GO:0015095 | magnesium ion transmembrane transporter activity(GO:0015095) |
0.0 | 0.4 | GO:0001618 | virus receptor activity(GO:0001618) |
0.0 | 0.9 | GO:0005044 | scavenger receptor activity(GO:0005044) |
0.0 | 0.1 | GO:0034713 | type I transforming growth factor beta receptor binding(GO:0034713) |
0.0 | 0.7 | GO:0004129 | cytochrome-c oxidase activity(GO:0004129) heme-copper terminal oxidase activity(GO:0015002) oxidoreductase activity, acting on a heme group of donors(GO:0016675) oxidoreductase activity, acting on a heme group of donors, oxygen as acceptor(GO:0016676) |
0.0 | 0.3 | GO:0030169 | low-density lipoprotein particle binding(GO:0030169) |
0.0 | 0.1 | GO:0008475 | procollagen-lysine 5-dioxygenase activity(GO:0008475) |
0.0 | 1.3 | GO:0004402 | histone acetyltransferase activity(GO:0004402) |
0.0 | 0.2 | GO:0005547 | phosphatidylinositol-3,4,5-trisphosphate binding(GO:0005547) |
0.0 | 0.2 | GO:0019911 | structural constituent of myelin sheath(GO:0019911) |
0.0 | 0.1 | GO:0031685 | adenosine receptor binding(GO:0031685) |
0.0 | 0.3 | GO:0035497 | cAMP response element binding(GO:0035497) |
0.0 | 0.0 | GO:0031432 | titin binding(GO:0031432) |
0.0 | 0.1 | GO:0036435 | K48-linked polyubiquitin binding(GO:0036435) |
0.0 | 0.3 | GO:0004525 | ribonuclease III activity(GO:0004525) double-stranded RNA-specific ribonuclease activity(GO:0032296) |
0.0 | 0.1 | GO:0070053 | thrombospondin receptor activity(GO:0070053) |
0.0 | 0.1 | GO:0004514 | nicotinate-nucleotide diphosphorylase (carboxylating) activity(GO:0004514) |
0.0 | 0.1 | GO:0004415 | hyalurononglucosaminidase activity(GO:0004415) |
0.0 | 0.5 | GO:0030544 | Hsp70 protein binding(GO:0030544) |
0.0 | 0.1 | GO:0097016 | L27 domain binding(GO:0097016) |
0.0 | 0.4 | GO:0001054 | RNA polymerase I activity(GO:0001054) |
0.0 | 1.0 | GO:0042605 | peptide antigen binding(GO:0042605) |
0.0 | 1.3 | GO:0034483 | heparan sulfate sulfotransferase activity(GO:0034483) |
0.0 | 0.9 | GO:0005201 | extracellular matrix structural constituent(GO:0005201) |
0.0 | 0.1 | GO:0004301 | epoxide hydrolase activity(GO:0004301) |
0.0 | 0.2 | GO:0009975 | cyclase activity(GO:0009975) |
0.0 | 0.2 | GO:0042299 | pivalyl-CoA mutase activity(GO:0034784) o-hydroxylaminobenzoate mutase activity(GO:0034951) lupeol synthase activity(GO:0042299) beta-amyrin synthase activity(GO:0042300) baruol synthase activity(GO:0080011) |
0.0 | 1.0 | GO:0048306 | calcium-dependent protein binding(GO:0048306) |
0.0 | 0.5 | GO:0043395 | heparan sulfate proteoglycan binding(GO:0043395) |
0.0 | 1.2 | GO:0003743 | translation initiation factor activity(GO:0003743) |
0.0 | 0.3 | GO:0001972 | retinoic acid binding(GO:0001972) |
0.0 | 0.1 | GO:0004169 | dolichyl-phosphate-mannose-protein mannosyltransferase activity(GO:0004169) |
0.0 | 0.4 | GO:0031683 | G-protein beta/gamma-subunit complex binding(GO:0031683) |
0.0 | 0.1 | GO:0042805 | actinin binding(GO:0042805) |
0.0 | 0.1 | GO:0019166 | trans-2-enoyl-CoA reductase (NADPH) activity(GO:0019166) |
0.0 | 0.0 | GO:0032422 | purine-rich negative regulatory element binding(GO:0032422) |
0.0 | 0.1 | GO:0004596 | peptide alpha-N-acetyltransferase activity(GO:0004596) |
0.0 | 0.7 | GO:0003684 | damaged DNA binding(GO:0003684) |
0.0 | 0.1 | GO:0052658 | inositol-1,4,5-trisphosphate 5-phosphatase activity(GO:0052658) |
0.0 | 2.4 | GO:0004222 | metalloendopeptidase activity(GO:0004222) |
0.0 | 0.0 | GO:0051373 | FATZ binding(GO:0051373) |
0.0 | 0.6 | GO:0052771 | coenzyme F390-A hydrolase activity(GO:0052770) coenzyme F390-G hydrolase activity(GO:0052771) |
0.0 | 0.0 | GO:0089720 | caspase binding(GO:0089720) |
0.0 | 0.4 | GO:0019206 | nucleoside kinase activity(GO:0019206) |
0.0 | 0.2 | GO:0030507 | spectrin binding(GO:0030507) |
0.0 | 0.8 | GO:0008009 | chemokine activity(GO:0008009) |
0.0 | 0.1 | GO:0031005 | filamin binding(GO:0031005) |
0.0 | 0.0 | GO:0030519 | snoRNP binding(GO:0030519) |
0.0 | 0.1 | GO:0045545 | syndecan binding(GO:0045545) |
0.0 | 0.0 | GO:0003696 | satellite DNA binding(GO:0003696) |
0.0 | 0.1 | GO:0001665 | alpha-N-acetylgalactosaminide alpha-2,6-sialyltransferase activity(GO:0001665) |
0.0 | 0.1 | GO:0017153 | sodium:dicarboxylate symporter activity(GO:0017153) |
0.0 | 0.2 | GO:0031386 | protein tag(GO:0031386) |
0.0 | 0.1 | GO:0016934 | extracellular-glycine-gated ion channel activity(GO:0016933) extracellular-glycine-gated chloride channel activity(GO:0016934) |
0.0 | 0.1 | GO:0031957 | very long-chain fatty acid-CoA ligase activity(GO:0031957) |
0.0 | 0.0 | GO:0070653 | high-density lipoprotein particle receptor binding(GO:0070653) |
0.0 | 0.2 | GO:0070990 | snRNP binding(GO:0070990) |
0.0 | 0.0 | GO:0016899 | oxidoreductase activity, acting on the CH-OH group of donors, oxygen as acceptor(GO:0016899) |
0.0 | 0.1 | GO:0008140 | cAMP response element binding protein binding(GO:0008140) |
0.0 | 0.0 | GO:0070181 | small ribosomal subunit rRNA binding(GO:0070181) |
0.0 | 0.2 | GO:0004535 | poly(A)-specific ribonuclease activity(GO:0004535) |
0.0 | 0.1 | GO:0008823 | cupric reductase activity(GO:0008823) ferric-chelate reductase (NADPH) activity(GO:0052851) |
0.0 | 0.1 | GO:0004829 | threonine-tRNA ligase activity(GO:0004829) |
0.0 | 1.3 | GO:0005262 | calcium channel activity(GO:0005262) |
0.0 | 0.0 | GO:0004731 | purine-nucleoside phosphorylase activity(GO:0004731) |
0.0 | 0.0 | GO:1990430 | extracellular matrix protein binding(GO:1990430) |
0.0 | 0.1 | GO:0070182 | DNA polymerase binding(GO:0070182) |
0.0 | 0.2 | GO:0017110 | nucleoside-diphosphatase activity(GO:0017110) |
0.0 | 0.1 | GO:0051011 | microtubule minus-end binding(GO:0051011) |
0.0 | 0.1 | GO:0008440 | inositol-1,4,5-trisphosphate 3-kinase activity(GO:0008440) |
0.0 | 0.6 | GO:0005200 | structural constituent of cytoskeleton(GO:0005200) |
0.0 | 0.2 | GO:0030331 | estrogen receptor binding(GO:0030331) |
0.0 | 0.1 | GO:0004468 | lysine N-acetyltransferase activity, acting on acetyl phosphate as donor(GO:0004468) |
0.0 | 0.0 | GO:0004616 | phosphogluconate dehydrogenase (decarboxylating) activity(GO:0004616) |
0.0 | 0.5 | GO:0072341 | modified amino acid binding(GO:0072341) |
0.0 | 0.1 | GO:0030553 | cGMP binding(GO:0030553) |
0.0 | 0.6 | GO:0003730 | mRNA 3'-UTR binding(GO:0003730) |
0.0 | 0.0 | GO:0005030 | neurotrophin receptor activity(GO:0005030) |
0.0 | 0.8 | GO:0016811 | hydrolase activity, acting on carbon-nitrogen (but not peptide) bonds, in linear amides(GO:0016811) |
0.0 | 0.1 | GO:0009982 | pseudouridine synthase activity(GO:0009982) |
0.0 | 0.2 | GO:0022829 | wide pore channel activity(GO:0022829) |
0.0 | 0.2 | GO:0016805 | dipeptidase activity(GO:0016805) |
0.0 | 0.1 | GO:0004735 | pyrroline-5-carboxylate reductase activity(GO:0004735) |
0.0 | 0.0 | GO:0003958 | NADPH-hemoprotein reductase activity(GO:0003958) |
0.0 | 0.1 | GO:0016308 | 1-phosphatidylinositol-4-phosphate 5-kinase activity(GO:0016308) |
0.0 | 0.2 | GO:0031404 | chloride ion binding(GO:0031404) |
0.0 | 0.0 | GO:0004924 | oncostatin-M receptor activity(GO:0004924) |
0.0 | 0.1 | GO:0103116 | alpha-D-galactofuranose transporter activity(GO:0103116) |
0.0 | 0.2 | GO:0016717 | oxidoreductase activity, acting on paired donors, with oxidation of a pair of donors resulting in the reduction of molecular oxygen to two molecules of water(GO:0016717) |
0.0 | 0.0 | GO:0019863 | IgE binding(GO:0019863) |
0.0 | 0.1 | GO:0004459 | L-lactate dehydrogenase activity(GO:0004459) |
0.0 | 0.0 | GO:0004345 | glucose-6-phosphate dehydrogenase activity(GO:0004345) |
0.0 | 0.3 | GO:0005184 | neuropeptide hormone activity(GO:0005184) |
0.0 | 1.3 | GO:0003729 | mRNA binding(GO:0003729) |
0.0 | 0.0 | GO:0035651 | AP-3 adaptor complex binding(GO:0035651) |
0.0 | 0.1 | GO:0019855 | calcium channel inhibitor activity(GO:0019855) |
0.0 | 0.1 | GO:0035259 | glucocorticoid receptor binding(GO:0035259) |
0.0 | 0.0 | GO:0008260 | 3-oxoacid CoA-transferase activity(GO:0008260) |
0.0 | 0.0 | GO:0016715 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, reduced ascorbate as one donor, and incorporation of one atom of oxygen(GO:0016715) |
0.0 | 0.0 | GO:0070996 | type 1 melanocortin receptor binding(GO:0070996) |
0.0 | 0.0 | GO:0035514 | DNA demethylase activity(GO:0035514) |
0.0 | 0.4 | GO:0005132 | type I interferon receptor binding(GO:0005132) |
0.0 | 0.0 | GO:0016849 | phosphorus-oxygen lyase activity(GO:0016849) |
0.0 | 0.0 | GO:0017089 | glycolipid transporter activity(GO:0017089) |
0.0 | 0.0 | GO:0042284 | sphingolipid delta-4 desaturase activity(GO:0042284) |
0.0 | 0.1 | GO:0008307 | structural constituent of muscle(GO:0008307) |
0.0 | 0.1 | GO:0050431 | transforming growth factor beta binding(GO:0050431) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.8 | 22.1 | PID TCR CALCIUM PATHWAY | Calcium signaling in the CD4+ TCR pathway |
0.6 | 0.6 | SIG CHEMOTAXIS | Genes related to chemotaxis |
0.5 | 0.5 | ST DIFFERENTIATION PATHWAY IN PC12 CELLS | Differentiation Pathway in PC12 Cells; this is a specific case of PAC1 Receptor Pathway. |
0.4 | 2.0 | PID EPHRINB REV PATHWAY | Ephrin B reverse signaling |
0.4 | 0.8 | PID P38 ALPHA BETA PATHWAY | Regulation of p38-alpha and p38-beta |
0.3 | 8.9 | PID NETRIN PATHWAY | Netrin-mediated signaling events |
0.3 | 8.9 | ST WNT BETA CATENIN PATHWAY | Wnt/beta-catenin Pathway |
0.3 | 3.8 | PID ERBB NETWORK PATHWAY | ErbB receptor signaling network |
0.2 | 1.8 | PID IGF1 PATHWAY | IGF1 pathway |
0.2 | 5.7 | PID INTEGRIN A4B1 PATHWAY | Alpha4 beta1 integrin signaling events |
0.2 | 1.1 | PID PS1 PATHWAY | Presenilin action in Notch and Wnt signaling |
0.2 | 2.5 | PID TRKR PATHWAY | Neurotrophic factor-mediated Trk receptor signaling |
0.2 | 1.9 | PID HES HEY PATHWAY | Notch-mediated HES/HEY network |
0.2 | 6.4 | PID HDAC CLASSII PATHWAY | Signaling events mediated by HDAC Class II |
0.2 | 1.3 | ST PAC1 RECEPTOR PATHWAY | PAC1 Receptor Pathway |
0.2 | 0.4 | PID IL5 PATHWAY | IL5-mediated signaling events |
0.2 | 2.5 | PID NECTIN PATHWAY | Nectin adhesion pathway |
0.2 | 3.8 | PID RET PATHWAY | Signaling events regulated by Ret tyrosine kinase |
0.2 | 3.1 | PID AVB3 OPN PATHWAY | Osteopontin-mediated events |
0.2 | 6.0 | PID LKB1 PATHWAY | LKB1 signaling events |
0.2 | 3.2 | ST PHOSPHOINOSITIDE 3 KINASE PATHWAY | PI3K Pathway |
0.1 | 3.3 | PID WNT NONCANONICAL PATHWAY | Noncanonical Wnt signaling pathway |
0.1 | 4.3 | PID FGF PATHWAY | FGF signaling pathway |
0.1 | 5.1 | NABA BASEMENT MEMBRANES | Genes encoding structural components of basement membranes |
0.1 | 1.3 | PID INTEGRIN5 PATHWAY | Beta5 beta6 beta7 and beta8 integrin cell surface interactions |
0.1 | 0.8 | PID RAC1 REG PATHWAY | Regulation of RAC1 activity |
0.1 | 15.2 | NABA ECM GLYCOPROTEINS | Genes encoding structural ECM glycoproteins |
0.1 | 0.1 | SIG BCR SIGNALING PATHWAY | Members of the BCR signaling pathway |
0.1 | 1.4 | PID PI3KCI AKT PATHWAY | Class I PI3K signaling events mediated by Akt |
0.1 | 2.7 | PID ERBB1 INTERNALIZATION PATHWAY | Internalization of ErbB1 |
0.1 | 0.6 | PID FOXO PATHWAY | FoxO family signaling |
0.1 | 0.2 | PID THROMBIN PAR4 PATHWAY | PAR4-mediated thrombin signaling events |
0.1 | 2.1 | PID TOLL ENDOGENOUS PATHWAY | Endogenous TLR signaling |
0.1 | 2.6 | PID SHP2 PATHWAY | SHP2 signaling |
0.1 | 1.6 | PID WNT SIGNALING PATHWAY | Wnt signaling network |
0.1 | 0.2 | PID P38 MK2 PATHWAY | p38 signaling mediated by MAPKAP kinases |
0.1 | 0.9 | PID LYMPH ANGIOGENESIS PATHWAY | VEGFR3 signaling in lymphatic endothelium |
0.1 | 0.8 | PID INSULIN GLUCOSE PATHWAY | Insulin-mediated glucose transport |
0.1 | 1.0 | PID LPA4 PATHWAY | LPA4-mediated signaling events |
0.1 | 0.3 | PID PI3KCI PATHWAY | Class I PI3K signaling events |
0.1 | 1.0 | PID ER NONGENOMIC PATHWAY | Plasma membrane estrogen receptor signaling |
0.1 | 0.4 | PID ATF2 PATHWAY | ATF-2 transcription factor network |
0.1 | 0.4 | PID IFNG PATHWAY | IFN-gamma pathway |
0.1 | 0.5 | PID WNT CANONICAL PATHWAY | Canonical Wnt signaling pathway |
0.1 | 0.5 | SA PROGRAMMED CELL DEATH | Programmed cell death, or apoptosis, eliminates damaged or unneeded cells. |
0.1 | 0.5 | PID ARF6 PATHWAY | Arf6 signaling events |
0.1 | 0.8 | PID NCADHERIN PATHWAY | N-cadherin signaling events |
0.1 | 0.9 | PID HNF3A PATHWAY | FOXA1 transcription factor network |
0.1 | 2.1 | PID P75 NTR PATHWAY | p75(NTR)-mediated signaling |
0.1 | 0.4 | PID P38 MKK3 6PATHWAY | p38 MAPK signaling pathway |
0.1 | 0.5 | PID SYNDECAN 2 PATHWAY | Syndecan-2-mediated signaling events |
0.1 | 0.4 | PID SYNDECAN 3 PATHWAY | Syndecan-3-mediated signaling events |
0.0 | 0.1 | PID NFAT 3PATHWAY | Role of Calcineurin-dependent NFAT signaling in lymphocytes |
0.0 | 6.0 | NABA ECM AFFILIATED | Genes encoding proteins affiliated structurally or functionally to extracellular matrix proteins |
0.0 | 2.3 | PID ERA GENOMIC PATHWAY | Validated nuclear estrogen receptor alpha network |
0.0 | 0.6 | PID IL1 PATHWAY | IL1-mediated signaling events |
0.0 | 1.0 | PID TNF PATHWAY | TNF receptor signaling pathway |
0.0 | 0.4 | PID FCER1 PATHWAY | Fc-epsilon receptor I signaling in mast cells |
0.0 | 0.3 | PID NEPHRIN NEPH1 PATHWAY | Nephrin/Neph1 signaling in the kidney podocyte |
0.0 | 0.3 | PID LYSOPHOSPHOLIPID PATHWAY | LPA receptor mediated events |
0.0 | 0.1 | PID FAK PATHWAY | Signaling events mediated by focal adhesion kinase |
0.0 | 0.1 | PID PI3K PLC TRK PATHWAY | Trk receptor signaling mediated by PI3K and PLC-gamma |
0.0 | 0.1 | PID NFKAPPAB CANONICAL PATHWAY | Canonical NF-kappaB pathway |
0.0 | 0.9 | PID FOXM1 PATHWAY | FOXM1 transcription factor network |
0.0 | 1.3 | PID FANCONI PATHWAY | Fanconi anemia pathway |
0.0 | 1.1 | PID AR PATHWAY | Coregulation of Androgen receptor activity |
0.0 | 0.3 | PID MAPK TRK PATHWAY | Trk receptor signaling mediated by the MAPK pathway |
0.0 | 0.1 | PID TXA2PATHWAY | Thromboxane A2 receptor signaling |
0.0 | 0.1 | PID IL8 CXCR2 PATHWAY | IL8- and CXCR2-mediated signaling events |
0.0 | 0.1 | PID ANGIOPOIETIN RECEPTOR PATHWAY | Angiopoietin receptor Tie2-mediated signaling |
0.0 | 0.3 | PID MET PATHWAY | Signaling events mediated by Hepatocyte Growth Factor Receptor (c-Met) |
0.0 | 0.1 | PID ALK2 PATHWAY | ALK2 signaling events |
0.0 | 0.1 | PID FRA PATHWAY | Validated transcriptional targets of AP1 family members Fra1 and Fra2 |
0.0 | 0.6 | PID CD8 TCR DOWNSTREAM PATHWAY | Downstream signaling in naïve CD8+ T cells |
0.0 | 0.7 | PID PLK1 PATHWAY | PLK1 signaling events |
0.0 | 0.2 | PID IL2 1PATHWAY | IL2-mediated signaling events |
0.0 | 0.2 | PID LIS1 PATHWAY | Lissencephaly gene (LIS1) in neuronal migration and development |
0.0 | 0.1 | PID ATR PATHWAY | ATR signaling pathway |
0.0 | 0.0 | ST STAT3 PATHWAY | STAT3 Pathway |
0.0 | 0.1 | PID CD40 PATHWAY | CD40/CD40L signaling |
0.0 | 0.1 | SA MMP CYTOKINE CONNECTION | Cytokines can induce activation of matrix metalloproteinases, which degrade extracellular matrix. |
0.0 | 0.5 | PID NOTCH PATHWAY | Notch signaling pathway |
0.0 | 0.0 | PID TCR RAS PATHWAY | Ras signaling in the CD4+ TCR pathway |
0.0 | 0.2 | PID MYC PATHWAY | C-MYC pathway |
0.0 | 0.2 | PID BMP PATHWAY | BMP receptor signaling |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
1.7 | 3.4 | REACTOME RNA POL III TRANSCRIPTION TERMINATION | Genes involved in RNA Polymerase III Transcription Termination |
0.9 | 22.3 | REACTOME RNA POL III TRANSCRIPTION INITIATION FROM TYPE 3 PROMOTER | Genes involved in RNA Polymerase III Transcription Initiation From Type 3 Promoter |
0.7 | 5.0 | REACTOME CREATION OF C4 AND C2 ACTIVATORS | Genes involved in Creation of C4 and C2 activators |
0.7 | 7.0 | REACTOME NOREPINEPHRINE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Norepinephrine Neurotransmitter Release Cycle |
0.6 | 13.4 | REACTOME ADHERENS JUNCTIONS INTERACTIONS | Genes involved in Adherens junctions interactions |
0.5 | 6.6 | REACTOME DCC MEDIATED ATTRACTIVE SIGNALING | Genes involved in DCC mediated attractive signaling |
0.5 | 7.1 | REACTOME OTHER SEMAPHORIN INTERACTIONS | Genes involved in Other semaphorin interactions |
0.4 | 0.4 | REACTOME SIGNALING BY FGFR3 MUTANTS | Genes involved in Signaling by FGFR3 mutants |
0.4 | 4.2 | REACTOME DOWNREGULATION OF ERBB2 ERBB3 SIGNALING | Genes involved in Downregulation of ERBB2:ERBB3 signaling |
0.4 | 3.8 | REACTOME REGULATION OF INSULIN SECRETION BY ACETYLCHOLINE | Genes involved in Regulation of Insulin Secretion by Acetylcholine |
0.4 | 6.1 | REACTOME PKA MEDIATED PHOSPHORYLATION OF CREB | Genes involved in PKA-mediated phosphorylation of CREB |
0.4 | 0.4 | REACTOME MRNA DECAY BY 3 TO 5 EXORIBONUCLEASE | Genes involved in mRNA Decay by 3' to 5' Exoribonuclease |
0.3 | 4.4 | REACTOME SYNTHESIS SECRETION AND INACTIVATION OF GIP | Genes involved in Synthesis, Secretion, and Inactivation of Glucose-dependent Insulinotropic Polypeptide (GIP) |
0.3 | 3.0 | REACTOME HORMONE LIGAND BINDING RECEPTORS | Genes involved in Hormone ligand-binding receptors |
0.3 | 0.3 | REACTOME IKK COMPLEX RECRUITMENT MEDIATED BY RIP1 | Genes involved in IKK complex recruitment mediated by RIP1 |
0.3 | 4.4 | REACTOME NA CL DEPENDENT NEUROTRANSMITTER TRANSPORTERS | Genes involved in Na+/Cl- dependent neurotransmitter transporters |
0.3 | 4.3 | REACTOME SYNTHESIS OF VERY LONG CHAIN FATTY ACYL COAS | Genes involved in Synthesis of very long-chain fatty acyl-CoAs |
0.3 | 2.4 | REACTOME IONOTROPIC ACTIVITY OF KAINATE RECEPTORS | Genes involved in Ionotropic activity of Kainate Receptors |
0.3 | 1.1 | REACTOME ER PHAGOSOME PATHWAY | Genes involved in ER-Phagosome pathway |
0.3 | 2.0 | REACTOME ACTIVATION OF THE AP1 FAMILY OF TRANSCRIPTION FACTORS | Genes involved in Activation of the AP-1 family of transcription factors |
0.3 | 4.0 | REACTOME CREB PHOSPHORYLATION THROUGH THE ACTIVATION OF CAMKII | Genes involved in CREB phosphorylation through the activation of CaMKII |
0.3 | 2.3 | REACTOME DSCAM INTERACTIONS | Genes involved in DSCAM interactions |
0.3 | 0.6 | REACTOME VIRAL MESSENGER RNA SYNTHESIS | Genes involved in Viral Messenger RNA Synthesis |
0.3 | 5.1 | REACTOME RNA POL I TRANSCRIPTION INITIATION | Genes involved in RNA Polymerase I Transcription Initiation |
0.3 | 2.6 | REACTOME ACTIVATION OF RAC | Genes involved in Activation of Rac |
0.3 | 2.5 | REACTOME INTEGRIN ALPHAIIB BETA3 SIGNALING | Genes involved in Integrin alphaIIb beta3 signaling |
0.2 | 10.6 | REACTOME VOLTAGE GATED POTASSIUM CHANNELS | Genes involved in Voltage gated Potassium channels |
0.2 | 9.5 | REACTOME AMINO ACID AND OLIGOPEPTIDE SLC TRANSPORTERS | Genes involved in Amino acid and oligopeptide SLC transporters |
0.2 | 4.3 | REACTOME INTERACTION BETWEEN L1 AND ANKYRINS | Genes involved in Interaction between L1 and Ankyrins |
0.2 | 3.1 | REACTOME REGULATION OF INSULIN LIKE GROWTH FACTOR IGF ACTIVITY BY INSULIN LIKE GROWTH FACTOR BINDING PROTEINS IGFBPS | Genes involved in Regulation of Insulin-like Growth Factor (IGF) Activity by Insulin-like Growth Factor Binding Proteins (IGFBPs) |
0.2 | 4.9 | REACTOME THE ROLE OF NEF IN HIV1 REPLICATION AND DISEASE PATHOGENESIS | Genes involved in The role of Nef in HIV-1 replication and disease pathogenesis |
0.2 | 1.8 | REACTOME RETROGRADE NEUROTROPHIN SIGNALLING | Genes involved in Retrograde neurotrophin signalling |
0.2 | 6.4 | REACTOME HS GAG BIOSYNTHESIS | Genes involved in HS-GAG biosynthesis |
0.2 | 3.3 | REACTOME INSULIN SYNTHESIS AND PROCESSING | Genes involved in Insulin Synthesis and Processing |
0.2 | 2.5 | REACTOME FGFR2C LIGAND BINDING AND ACTIVATION | Genes involved in FGFR2c ligand binding and activation |
0.2 | 0.2 | REACTOME SIGNALING BY ACTIVATED POINT MUTANTS OF FGFR1 | Genes involved in Signaling by activated point mutants of FGFR1 |
0.2 | 2.3 | REACTOME TIE2 SIGNALING | Genes involved in Tie2 Signaling |
0.2 | 1.7 | REACTOME SIGNAL ATTENUATION | Genes involved in Signal attenuation |
0.2 | 5.8 | REACTOME INWARDLY RECTIFYING K CHANNELS | Genes involved in Inwardly rectifying K+ channels |
0.2 | 0.2 | REACTOME CONVERSION FROM APC C CDC20 TO APC C CDH1 IN LATE ANAPHASE | Genes involved in Conversion from APC/C:Cdc20 to APC/C:Cdh1 in late anaphase |
0.2 | 0.2 | REACTOME IRAK2 MEDIATED ACTIVATION OF TAK1 COMPLEX UPON TLR7 8 OR 9 STIMULATION | Genes involved in IRAK2 mediated activation of TAK1 complex upon TLR7/8 or 9 stimulation |
0.2 | 1.4 | REACTOME APOPTOSIS INDUCED DNA FRAGMENTATION | Genes involved in Apoptosis induced DNA fragmentation |
0.2 | 1.8 | REACTOME SEROTONIN RECEPTORS | Genes involved in Serotonin receptors |
0.2 | 3.0 | REACTOME SIGNALING BY FGFR1 MUTANTS | Genes involved in Signaling by FGFR1 mutants |
0.2 | 6.5 | REACTOME NOTCH1 INTRACELLULAR DOMAIN REGULATES TRANSCRIPTION | Genes involved in NOTCH1 Intracellular Domain Regulates Transcription |
0.2 | 0.5 | REACTOME PLATELET SENSITIZATION BY LDL | Genes involved in Platelet sensitization by LDL |
0.2 | 2.1 | REACTOME A TETRASACCHARIDE LINKER SEQUENCE IS REQUIRED FOR GAG SYNTHESIS | Genes involved in A tetrasaccharide linker sequence is required for GAG synthesis |
0.2 | 2.2 | REACTOME N GLYCAN ANTENNAE ELONGATION | Genes involved in N-Glycan antennae elongation |
0.1 | 1.3 | REACTOME TRYPTOPHAN CATABOLISM | Genes involved in Tryptophan catabolism |
0.1 | 2.7 | REACTOME NETRIN1 SIGNALING | Genes involved in Netrin-1 signaling |
0.1 | 1.3 | REACTOME PROTEOLYTIC CLEAVAGE OF SNARE COMPLEX PROTEINS | Genes involved in Proteolytic cleavage of SNARE complex proteins |
0.1 | 1.8 | REACTOME INFLAMMASOMES | Genes involved in Inflammasomes |
0.1 | 1.1 | REACTOME DARPP 32 EVENTS | Genes involved in DARPP-32 events |
0.1 | 1.5 | REACTOME COMMON PATHWAY | Genes involved in Common Pathway |
0.1 | 0.5 | REACTOME GAP JUNCTION DEGRADATION | Genes involved in Gap junction degradation |
0.1 | 0.1 | REACTOME RNA POL I PROMOTER OPENING | Genes involved in RNA Polymerase I Promoter Opening |
0.1 | 0.6 | REACTOME REGULATION OF ORNITHINE DECARBOXYLASE ODC | Genes involved in Regulation of ornithine decarboxylase (ODC) |
0.1 | 1.0 | REACTOME MTORC1 MEDIATED SIGNALLING | Genes involved in mTORC1-mediated signalling |
0.1 | 1.3 | REACTOME CD28 DEPENDENT PI3K AKT SIGNALING | Genes involved in CD28 dependent PI3K/Akt signaling |
0.1 | 6.2 | REACTOME MHC CLASS II ANTIGEN PRESENTATION | Genes involved in MHC class II antigen presentation |
0.1 | 1.0 | REACTOME RECEPTOR LIGAND BINDING INITIATES THE SECOND PROTEOLYTIC CLEAVAGE OF NOTCH RECEPTOR | Genes involved in Receptor-ligand binding initiates the second proteolytic cleavage of Notch receptor |
0.1 | 1.1 | REACTOME SYNTHESIS OF PIPS AT THE LATE ENDOSOME MEMBRANE | Genes involved in Synthesis of PIPs at the late endosome membrane |
0.1 | 2.1 | REACTOME FORMATION OF TUBULIN FOLDING INTERMEDIATES BY CCT TRIC | Genes involved in Formation of tubulin folding intermediates by CCT/TriC |
0.1 | 0.6 | REACTOME GABA SYNTHESIS RELEASE REUPTAKE AND DEGRADATION | Genes involved in GABA synthesis, release, reuptake and degradation |
0.1 | 1.1 | REACTOME BASE FREE SUGAR PHOSPHATE REMOVAL VIA THE SINGLE NUCLEOTIDE REPLACEMENT PATHWAY | Genes involved in Base-free sugar-phosphate removal via the single-nucleotide replacement pathway |
0.1 | 0.7 | REACTOME SYNTHESIS SECRETION AND DEACYLATION OF GHRELIN | Genes involved in Synthesis, Secretion, and Deacylation of Ghrelin |
0.1 | 0.7 | REACTOME TRANSPORT OF ORGANIC ANIONS | Genes involved in Transport of organic anions |
0.1 | 1.7 | REACTOME FANCONI ANEMIA PATHWAY | Genes involved in Fanconi Anemia pathway |
0.1 | 1.7 | REACTOME ERK MAPK TARGETS | Genes involved in ERK/MAPK targets |
0.1 | 0.7 | REACTOME RECYCLING OF BILE ACIDS AND SALTS | Genes involved in Recycling of bile acids and salts |
0.1 | 0.6 | REACTOME NEPHRIN INTERACTIONS | Genes involved in Nephrin interactions |
0.1 | 1.1 | REACTOME GABA A RECEPTOR ACTIVATION | Genes involved in GABA A receptor activation |
0.1 | 1.0 | REACTOME CELL EXTRACELLULAR MATRIX INTERACTIONS | Genes involved in Cell-extracellular matrix interactions |
0.1 | 0.1 | REACTOME PROSTACYCLIN SIGNALLING THROUGH PROSTACYCLIN RECEPTOR | Genes involved in Prostacyclin signalling through prostacyclin receptor |
0.1 | 0.4 | REACTOME RNA POL III TRANSCRIPTION INITIATION FROM TYPE 2 PROMOTER | Genes involved in RNA Polymerase III Transcription Initiation From Type 2 Promoter |
0.1 | 4.7 | REACTOME RESPIRATORY ELECTRON TRANSPORT | Genes involved in Respiratory electron transport |
0.1 | 0.2 | REACTOME SIGNALING BY CONSTITUTIVELY ACTIVE EGFR | Genes involved in Signaling by constitutively active EGFR |
0.1 | 0.8 | REACTOME TRAF6 MEDIATED INDUCTION OF TAK1 COMPLEX | Genes involved in TRAF6 mediated induction of TAK1 complex |
0.1 | 1.0 | REACTOME GLUCAGON TYPE LIGAND RECEPTORS | Genes involved in Glucagon-type ligand receptors |
0.1 | 0.4 | REACTOME BETA DEFENSINS | Genes involved in Beta defensins |
0.1 | 0.1 | REACTOME MRNA CAPPING | Genes involved in mRNA Capping |
0.1 | 0.6 | REACTOME TRAFFICKING OF GLUR2 CONTAINING AMPA RECEPTORS | Genes involved in Trafficking of GluR2-containing AMPA receptors |
0.1 | 1.3 | REACTOME CGMP EFFECTS | Genes involved in cGMP effects |
0.1 | 0.5 | REACTOME APOPTOTIC CLEAVAGE OF CELL ADHESION PROTEINS | Genes involved in Apoptotic cleavage of cell adhesion proteins |
0.1 | 0.3 | REACTOME P38MAPK EVENTS | Genes involved in p38MAPK events |
0.1 | 0.5 | REACTOME G BETA GAMMA SIGNALLING THROUGH PI3KGAMMA | Genes involved in G beta:gamma signalling through PI3Kgamma |
0.1 | 0.7 | REACTOME GLYCOGEN BREAKDOWN GLYCOGENOLYSIS | Genes involved in Glycogen breakdown (glycogenolysis) |
0.1 | 0.7 | REACTOME G ALPHA I SIGNALLING EVENTS | Genes involved in G alpha (i) signalling events |
0.1 | 2.0 | REACTOME IMMUNOREGULATORY INTERACTIONS BETWEEN A LYMPHOID AND A NON LYMPHOID CELL | Genes involved in Immunoregulatory interactions between a Lymphoid and a non-Lymphoid cell |
0.1 | 0.1 | REACTOME ENDOSOMAL VACUOLAR PATHWAY | Genes involved in Endosomal/Vacuolar pathway |
0.1 | 1.6 | REACTOME SPHINGOLIPID DE NOVO BIOSYNTHESIS | Genes involved in Sphingolipid de novo biosynthesis |
0.1 | 0.5 | REACTOME ACTIVATION OF CHAPERONES BY ATF6 ALPHA | Genes involved in Activation of Chaperones by ATF6-alpha |
0.1 | 3.6 | REACTOME METABOLISM OF AMINO ACIDS AND DERIVATIVES | Genes involved in Metabolism of amino acids and derivatives |
0.1 | 0.4 | REACTOME TRAFFICKING OF AMPA RECEPTORS | Genes involved in Trafficking of AMPA receptors |
0.1 | 0.6 | REACTOME FACILITATIVE NA INDEPENDENT GLUCOSE TRANSPORTERS | Genes involved in Facilitative Na+-independent glucose transporters |
0.1 | 0.2 | REACTOME ADP SIGNALLING THROUGH P2RY12 | Genes involved in ADP signalling through P2Y purinoceptor 12 |
0.1 | 0.6 | REACTOME P2Y RECEPTORS | Genes involved in P2Y receptors |
0.1 | 0.4 | REACTOME ACYL CHAIN REMODELLING OF PE | Genes involved in Acyl chain remodelling of PE |
0.1 | 0.6 | REACTOME FORMATION OF INCISION COMPLEX IN GG NER | Genes involved in Formation of incision complex in GG-NER |
0.1 | 0.7 | REACTOME SIGNAL TRANSDUCTION BY L1 | Genes involved in Signal transduction by L1 |
0.1 | 0.5 | REACTOME G ALPHA Z SIGNALLING EVENTS | Genes involved in G alpha (z) signalling events |
0.1 | 0.8 | REACTOME ASSOCIATION OF TRIC CCT WITH TARGET PROTEINS DURING BIOSYNTHESIS | Genes involved in Association of TriC/CCT with target proteins during biosynthesis |
0.1 | 1.9 | REACTOME ACTIVATION OF CHAPERONE GENES BY XBP1S | Genes involved in Activation of Chaperone Genes by XBP1(S) |
0.0 | 0.3 | REACTOME INHIBITION OF REPLICATION INITIATION OF DAMAGED DNA BY RB1 E2F1 | Genes involved in Inhibition of replication initiation of damaged DNA by RB1/E2F1 |
0.0 | 0.4 | REACTOME THE ACTIVATION OF ARYLSULFATASES | Genes involved in The activation of arylsulfatases |
0.0 | 0.3 | REACTOME ACTIVATED TAK1 MEDIATES P38 MAPK ACTIVATION | Genes involved in activated TAK1 mediates p38 MAPK activation |
0.0 | 0.5 | REACTOME UNWINDING OF DNA | Genes involved in Unwinding of DNA |
0.0 | 0.1 | REACTOME SPRY REGULATION OF FGF SIGNALING | Genes involved in Spry regulation of FGF signaling |
0.0 | 0.5 | REACTOME RECRUITMENT OF NUMA TO MITOTIC CENTROSOMES | Genes involved in Recruitment of NuMA to mitotic centrosomes |
0.0 | 0.5 | REACTOME EGFR DOWNREGULATION | Genes involved in EGFR downregulation |
0.0 | 0.1 | REACTOME PHOSPHORYLATION OF CD3 AND TCR ZETA CHAINS | Genes involved in Phosphorylation of CD3 and TCR zeta chains |
0.0 | 0.2 | REACTOME DIGESTION OF DIETARY CARBOHYDRATE | Genes involved in Digestion of dietary carbohydrate |
0.0 | 0.6 | REACTOME RNA POL II TRANSCRIPTION PRE INITIATION AND PROMOTER OPENING | Genes involved in RNA Polymerase II Transcription Pre-Initiation And Promoter Opening |
0.0 | 0.5 | REACTOME KERATAN SULFATE DEGRADATION | Genes involved in Keratan sulfate degradation |
0.0 | 1.0 | REACTOME STEROID HORMONES | Genes involved in Steroid hormones |
0.0 | 0.2 | REACTOME COSTIMULATION BY THE CD28 FAMILY | Genes involved in Costimulation by the CD28 family |
0.0 | 0.3 | REACTOME CTNNB1 PHOSPHORYLATION CASCADE | Genes involved in Beta-catenin phosphorylation cascade |
0.0 | 0.4 | REACTOME P75 NTR RECEPTOR MEDIATED SIGNALLING | Genes involved in p75 NTR receptor-mediated signalling |
0.0 | 0.3 | REACTOME DOWNSTREAM TCR SIGNALING | Genes involved in Downstream TCR signaling |
0.0 | 0.3 | REACTOME HYALURONAN UPTAKE AND DEGRADATION | Genes involved in Hyaluronan uptake and degradation |
0.0 | 1.9 | REACTOME RESPONSE TO ELEVATED PLATELET CYTOSOLIC CA2 | Genes involved in Response to elevated platelet cytosolic Ca2+ |
0.0 | 0.5 | REACTOME COMPLEMENT CASCADE | Genes involved in Complement cascade |
0.0 | 0.2 | REACTOME ACTIVATION OF BH3 ONLY PROTEINS | Genes involved in Activation of BH3-only proteins |
0.0 | 0.1 | REACTOME GABA RECEPTOR ACTIVATION | Genes involved in GABA receptor activation |
0.0 | 0.1 | REACTOME DESTABILIZATION OF MRNA BY AUF1 HNRNP D0 | Genes involved in Destabilization of mRNA by AUF1 (hnRNP D0) |
0.0 | 0.0 | REACTOME APC C CDC20 MEDIATED DEGRADATION OF MITOTIC PROTEINS | Genes involved in APC/C:Cdc20 mediated degradation of mitotic proteins |
0.0 | 0.6 | REACTOME SYNTHESIS OF PIPS AT THE PLASMA MEMBRANE | Genes involved in Synthesis of PIPs at the plasma membrane |
0.0 | 0.6 | REACTOME AMINE LIGAND BINDING RECEPTORS | Genes involved in Amine ligand-binding receptors |
0.0 | 0.4 | REACTOME ACYL CHAIN REMODELLING OF PG | Genes involved in Acyl chain remodelling of PG |
0.0 | 0.1 | REACTOME ABACAVIR TRANSPORT AND METABOLISM | Genes involved in Abacavir transport and metabolism |
0.0 | 0.2 | REACTOME NFKB ACTIVATION THROUGH FADD RIP1 PATHWAY MEDIATED BY CASPASE 8 AND10 | Genes involved in NF-kB activation through FADD/RIP-1 pathway mediated by caspase-8 and -10 |
0.0 | 0.2 | REACTOME REGULATION OF IFNG SIGNALING | Genes involved in Regulation of IFNG signaling |
0.0 | 0.2 | REACTOME GRB2 EVENTS IN ERBB2 SIGNALING | Genes involved in GRB2 events in ERBB2 signaling |
0.0 | 0.5 | REACTOME SPHINGOLIPID METABOLISM | Genes involved in Sphingolipid metabolism |
0.0 | 0.4 | REACTOME SYNTHESIS AND INTERCONVERSION OF NUCLEOTIDE DI AND TRIPHOSPHATES | Genes involved in Synthesis and interconversion of nucleotide di- and triphosphates |
0.0 | 0.3 | REACTOME AMINO ACID SYNTHESIS AND INTERCONVERSION TRANSAMINATION | Genes involved in Amino acid synthesis and interconversion (transamination) |
0.0 | 0.2 | REACTOME COPI MEDIATED TRANSPORT | Genes involved in COPI Mediated Transport |
0.0 | 0.2 | REACTOME REGULATION OF PYRUVATE DEHYDROGENASE PDH COMPLEX | Genes involved in Regulation of pyruvate dehydrogenase (PDH) complex |
0.0 | 0.1 | REACTOME CROSS PRESENTATION OF SOLUBLE EXOGENOUS ANTIGENS ENDOSOMES | Genes involved in Cross-presentation of soluble exogenous antigens (endosomes) |
0.0 | 0.5 | REACTOME PROCESSING OF CAPPED INTRONLESS PRE MRNA | Genes involved in Processing of Capped Intronless Pre-mRNA |
0.0 | 0.0 | REACTOME SIGNALLING TO P38 VIA RIT AND RIN | Genes involved in Signalling to p38 via RIT and RIN |
0.0 | 0.4 | REACTOME BRANCHED CHAIN AMINO ACID CATABOLISM | Genes involved in Branched-chain amino acid catabolism |
0.0 | 0.1 | REACTOME CIRCADIAN REPRESSION OF EXPRESSION BY REV ERBA | Genes involved in Circadian Repression of Expression by REV-ERBA |
0.0 | 0.1 | REACTOME LIGAND GATED ION CHANNEL TRANSPORT | Genes involved in Ligand-gated ion channel transport |
0.0 | 0.2 | REACTOME CYTOSOLIC SULFONATION OF SMALL MOLECULES | Genes involved in Cytosolic sulfonation of small molecules |
0.0 | 0.1 | REACTOME MICRORNA MIRNA BIOGENESIS | Genes involved in MicroRNA (miRNA) Biogenesis |
0.0 | 0.0 | REACTOME RESOLUTION OF AP SITES VIA THE SINGLE NUCLEOTIDE REPLACEMENT PATHWAY | Genes involved in Resolution of AP sites via the single-nucleotide replacement pathway |
0.0 | 0.0 | REACTOME DOPAMINE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Dopamine Neurotransmitter Release Cycle |
0.0 | 0.2 | REACTOME CLASS C 3 METABOTROPIC GLUTAMATE PHEROMONE RECEPTORS | Genes involved in Class C/3 (Metabotropic glutamate/pheromone receptors) |
0.0 | 0.1 | REACTOME PI METABOLISM | Genes involved in PI Metabolism |
0.0 | 0.0 | REACTOME G PROTEIN ACTIVATION | Genes involved in G-protein activation |
0.0 | 0.1 | REACTOME PLATELET AGGREGATION PLUG FORMATION | Genes involved in Platelet Aggregation (Plug Formation) |
0.0 | 0.0 | REACTOME TRIF MEDIATED TLR3 SIGNALING | Genes involved in TRIF mediated TLR3 signaling |
0.0 | 0.0 | REACTOME CD28 DEPENDENT VAV1 PATHWAY | Genes involved in CD28 dependent Vav1 pathway |
0.0 | 0.1 | REACTOME PROLACTIN RECEPTOR SIGNALING | Genes involved in Prolactin receptor signaling |
0.0 | 0.2 | REACTOME PEROXISOMAL LIPID METABOLISM | Genes involved in Peroxisomal lipid metabolism |
0.0 | 0.0 | REACTOME CA DEPENDENT EVENTS | Genes involved in Ca-dependent events |
0.0 | 0.1 | REACTOME AMINE DERIVED HORMONES | Genes involved in Amine-derived hormones |