Gene Symbol | Gene ID | Gene Info |
---|---|---|
Rfx5
|
ENSMUSG00000005774.6 | regulatory factor X, 5 (influences HLA class II expression) |
CRE | Gene | Distance | Association probability | Pearson corr. coef. | P-value | Plot |
---|---|---|---|---|---|---|
Rfx5 | chr3_94954194_94954833 | 14 | 0.946788 | 0.61 | 8.0e-07 | Click! |
Rfx5 | chr3_94943809_94943985 | 10178 | 0.085732 | -0.58 | 3.3e-06 | Click! |
Rfx5 | chr3_94952904_94953094 | 1076 | 0.302379 | 0.29 | 3.2e-02 | Click! |
Rfx5 | chr3_94953605_94954192 | 177 | 0.883434 | 0.28 | 4.0e-02 | Click! |
Move your cursor over a bar to see sample name and corresponding Z-value.
Cis Regulatory Element (CRE) | Target Score | Top associated gene | Gene Info | Distance of CRE to TSS | CRE/Gene association probability |
---|---|---|---|---|---|
chr5_26991582_26992107 | 10.88 |
Gm16057 |
predicted gene 16057 |
15777 |
0.25 |
chr17_34398184_34398665 | 10.19 |
Gm15320 |
predicted gene 15320 |
262 |
0.58 |
chr19_61225302_61226760 | 8.65 |
Csf2ra |
colony stimulating factor 2 receptor, alpha, low-affinity (granulocyte-macrophage) |
541 |
0.67 |
chr11_81860576_81860948 | 8.50 |
5530401A14Rik |
RIKEN cDNA 5530401A14 gene |
83 |
0.98 |
chr4_56001339_56001502 | 8.29 |
Gm12519 |
predicted gene 12519 |
7681 |
0.31 |
chr1_25033779_25033975 | 8.03 |
Gm29414 |
predicted gene 29414 |
6645 |
0.21 |
chr12_108333504_108334768 | 7.77 |
Cyp46a1 |
cytochrome P450, family 46, subfamily a, polypeptide 1 |
245 |
0.91 |
chr7_16869301_16869754 | 7.67 |
Prkd2 |
protein kinase D2 |
275 |
0.8 |
chr11_25854231_25854525 | 7.42 |
5730522E02Rik |
RIKEN cDNA 5730522E02 gene |
85237 |
0.11 |
chr10_75684046_75684480 | 7.41 |
Cabin1 |
calcineurin binding protein 1 |
16112 |
0.12 |
chr1_160351863_160352201 | 7.06 |
Rabgap1l |
RAB GTPase activating protein 1-like |
461 |
0.79 |
chr17_34296139_34296313 | 6.91 |
H2-Aa |
histocompatibility 2, class II antigen A, alpha |
8403 |
0.08 |
chr6_99971402_99971775 | 6.89 |
Gm33201 |
predicted gene, 33201 |
19627 |
0.18 |
chr9_22049819_22050263 | 6.70 |
Elavl3 |
ELAV like RNA binding protein 3 |
1969 |
0.15 |
chr6_36691584_36691805 | 6.44 |
Gm25111 |
predicted gene, 25111 |
7703 |
0.26 |
chr11_32161571_32162227 | 6.37 |
Gm12109 |
predicted gene 12109 |
23106 |
0.12 |
chr16_37938714_37939016 | 6.30 |
Gpr156 |
G protein-coupled receptor 156 |
22369 |
0.15 |
chr15_8659416_8659937 | 6.30 |
Gm37310 |
predicted gene, 37310 |
4603 |
0.23 |
chr13_42346503_42346841 | 6.28 |
Gm47118 |
predicted gene, 47118 |
41681 |
0.16 |
chr10_70652107_70652258 | 6.27 |
Phyhipl |
phytanoyl-CoA hydroxylase interacting protein-like |
257 |
0.94 |
chr13_28811226_28811377 | 6.21 |
Gm17528 |
predicted gene, 17528 |
15822 |
0.19 |
chr13_29415973_29416331 | 6.18 |
Cdkal1 |
CDK5 regulatory subunit associated protein 1-like 1 |
58455 |
0.16 |
chr9_41011522_41012361 | 6.04 |
Crtam |
cytotoxic and regulatory T cell molecule |
7313 |
0.19 |
chr3_119588944_119589097 | 5.91 |
Gm23432 |
predicted gene, 23432 |
49854 |
0.16 |
chr15_12700486_12700660 | 5.90 |
Gm24302 |
predicted gene, 24302 |
5449 |
0.19 |
chr17_34398691_34398900 | 5.77 |
BC051142 |
cDNA sequence BC051142 |
25 |
0.9 |
chr6_63256767_63257230 | 5.73 |
Grid2 |
glutamate receptor, ionotropic, delta 2 |
172 |
0.85 |
chr2_116045176_116045344 | 5.70 |
Meis2 |
Meis homeobox 2 |
3214 |
0.24 |
chr3_63349002_63349153 | 5.45 |
Mme |
membrane metallo endopeptidase |
48917 |
0.15 |
chr9_36933872_36934074 | 5.44 |
Pknox2 |
Pbx/knotted 1 homeobox 2 |
53299 |
0.1 |
chr17_34305709_34305889 | 5.43 |
H2-Eb1 |
histocompatibility 2, class II antigen E beta |
68 |
0.5 |
chr6_49977825_49978107 | 5.40 |
Gm3455 |
predicted gene 3455 |
73220 |
0.11 |
chr6_36723290_36723453 | 5.32 |
Gm25111 |
predicted gene, 25111 |
23974 |
0.22 |
chr6_72714254_72714642 | 5.20 |
Gm15402 |
predicted gene 15402 |
15234 |
0.13 |
chr17_34079704_34079994 | 5.19 |
H2-Pb |
histocompatibility 2, P region beta locus |
3682 |
0.06 |
chr12_97360740_97360912 | 5.16 |
Gm23558 |
predicted gene, 23558 |
10287 |
0.27 |
chr9_96865503_96865676 | 5.11 |
Pxylp1 |
2-phosphoxylose phosphatase 1 |
2607 |
0.23 |
chr13_51290015_51290166 | 5.09 |
Gm6056 |
predicted gene 6056 |
48831 |
0.11 |
chr12_13706665_13706816 | 5.04 |
Gm35890 |
predicted gene, 35890 |
37887 |
0.13 |
chr4_11950956_11951115 | 5.02 |
Gm25002 |
predicted gene, 25002 |
2148 |
0.26 |
chr13_15802527_15802680 | 4.93 |
4933412O06Rik |
RIKEN cDNA 4933412O06 gene |
27 |
0.97 |
chr5_102110070_102110343 | 4.86 |
Gm29707 |
predicted gene, 29707 |
39356 |
0.12 |
chr10_19471691_19471921 | 4.85 |
Gm33104 |
predicted gene, 33104 |
14909 |
0.21 |
chr13_60045576_60045727 | 4.77 |
Gm48396 |
predicted gene, 48396 |
11974 |
0.16 |
chr18_42898547_42898728 | 4.71 |
Ppp2r2b |
protein phosphatase 2, regulatory subunit B, beta |
178 |
0.96 |
chr3_62917028_62917179 | 4.71 |
Gm9701 |
predicted gene 9701 |
7130 |
0.32 |
chr12_53566774_53566994 | 4.69 |
1700030L22Rik |
RIKEN cDNA 1700030L22 gene |
257038 |
0.02 |
chr7_40901199_40901451 | 4.65 |
A230077H06Rik |
RIKEN cDNA A230077H06 gene |
388 |
0.72 |
chr9_57862547_57862737 | 4.62 |
Arid3b |
AT rich interactive domain 3B (BRIGHT-like) |
25849 |
0.13 |
chr8_120679743_120680004 | 4.59 |
Gm33142 |
predicted gene, 33142 |
5526 |
0.11 |
chr7_78887311_78887614 | 4.56 |
Mir7-2 |
microRNA 7-2 |
815 |
0.49 |
chr13_51568764_51569283 | 4.54 |
Shc3 |
src homology 2 domain-containing transforming protein C3 |
396 |
0.88 |
chr13_91825280_91825431 | 4.50 |
Zcchc9 |
zinc finger, CCHC domain containing 9 |
17650 |
0.16 |
chr1_51650752_51650944 | 4.46 |
Gm28055 |
predicted gene 28055 |
47052 |
0.14 |
chr7_44405823_44406585 | 4.46 |
Gm45124 |
predicted gene 45124 |
19804 |
0.06 |
chr2_112210078_112210560 | 4.44 |
Lpcat4 |
lysophosphatidylcholine acyltransferase 4 |
29149 |
0.09 |
chr11_34113081_34113268 | 4.39 |
4930469K13Rik |
RIKEN cDNA 4930469K13 gene |
14620 |
0.18 |
chr9_46350452_46350942 | 4.38 |
Gm31374 |
predicted gene, 31374 |
7922 |
0.12 |
chr8_12947304_12948554 | 4.31 |
Mcf2l |
mcf.2 transforming sequence-like |
10 |
0.49 |
chr7_92234788_92235188 | 4.27 |
Dlg2 |
discs large MAGUK scaffold protein 2 |
8 |
0.99 |
chr4_130973559_130973822 | 4.19 |
Gm12973 |
predicted gene 12973 |
1100 |
0.48 |
chr4_53253649_53254014 | 4.18 |
4930522O17Rik |
RIKEN cDNA 4930522O17 gene |
7635 |
0.18 |
chr13_23488799_23488985 | 4.15 |
Btn2a2 |
butyrophilin, subfamily 2, member A2 |
35 |
0.93 |
chr10_34316810_34317259 | 4.11 |
Nt5dc1 |
5'-nucleotidase domain containing 1 |
3351 |
0.16 |
chr9_37028261_37028476 | 4.09 |
n-R5s82 |
nuclear encoded rRNA 5S 82 |
1969 |
0.29 |
chr2_3420278_3420597 | 4.08 |
Meig1 |
meiosis expressed gene 1 |
1308 |
0.32 |
chr7_99275240_99275391 | 4.06 |
Map6 |
microtubule-associated protein 6 |
6183 |
0.13 |
chr5_103854136_103854512 | 4.06 |
Klhl8 |
kelch-like 8 |
20045 |
0.15 |
chr4_65888333_65888871 | 4.03 |
Trim32 |
tripartite motif-containing 32 |
283353 |
0.01 |
chr7_67444473_67444899 | 4.03 |
Gm33926 |
predicted gene, 33926 |
753 |
0.69 |
chr1_155146761_155146939 | 4.02 |
Mr1 |
major histocompatibility complex, class I-related |
36 |
0.97 |
chr17_34304879_34305042 | 4.00 |
Gm20513 |
predicted gene 20513 |
760 |
0.33 |
chr12_85497898_85498120 | 4.00 |
Fos |
FBJ osteosarcoma oncogene |
23098 |
0.14 |
chr10_53006603_53006754 | 4.00 |
Gm47622 |
predicted gene, 47622 |
95865 |
0.07 |
chr12_98573417_98573836 | 3.96 |
Kcnk10 |
potassium channel, subfamily K, member 10 |
1086 |
0.43 |
chrX_103287350_103287719 | 3.94 |
4930519F16Rik |
RIKEN cDNA 4930519F16 gene |
544 |
0.57 |
chr4_139759129_139759298 | 3.93 |
Pax7 |
paired box 7 |
73794 |
0.08 |
chr7_54835902_54836140 | 3.93 |
Luzp2 |
leucine zipper protein 2 |
406 |
0.87 |
chr18_5835159_5835564 | 3.91 |
Zeb1 |
zinc finger E-box binding homeobox 1 |
104280 |
0.07 |
chr4_13773720_13773935 | 3.89 |
Runx1t1 |
RUNX1 translocation partner 1 |
2450 |
0.42 |
chr17_8702538_8702721 | 3.88 |
Pde10a |
phosphodiesterase 10A |
54389 |
0.13 |
chr1_5018013_5019021 | 3.88 |
Rgs20 |
regulator of G-protein signaling 20 |
218 |
0.93 |
chr5_66757535_66757731 | 3.88 |
Limch1 |
LIM and calponin homology domains 1 |
11744 |
0.18 |
chr5_50034922_50035128 | 3.87 |
Adgra3 |
adhesion G protein-coupled receptor A3 |
18354 |
0.2 |
chr17_34263060_34263271 | 3.84 |
H2-Ab1 |
histocompatibility 2, class II antigen A, beta 1 |
44 |
0.94 |
chr11_90485359_90485520 | 3.83 |
Gm11511 |
predicted gene 11511 |
31877 |
0.17 |
chr2_94772273_94772424 | 3.82 |
Gm26396 |
predicted gene, 26396 |
19988 |
0.23 |
chr17_34605293_34605954 | 3.79 |
Agpat1 |
1-acylglycerol-3-phosphate O-acyltransferase 1 (lysophosphatidic acid acyltransferase, alpha) |
238 |
0.74 |
chr12_31255314_31255465 | 3.74 |
Gm32899 |
predicted gene, 32899 |
3468 |
0.14 |
chr9_21901498_21901879 | 3.73 |
Rab3d |
RAB3D, member RAS oncogene family |
16401 |
0.09 |
chr12_32927272_32927563 | 3.73 |
Gm19056 |
predicted gene, 19056 |
2530 |
0.17 |
chr11_81897668_81897837 | 3.72 |
5530401A14Rik |
RIKEN cDNA 5530401A14 gene |
37073 |
0.16 |
chr13_15759168_15760299 | 3.71 |
Gm48408 |
predicted gene, 48408 |
10387 |
0.18 |
chr16_11825004_11825155 | 3.66 |
4833415N18Rik |
RIKEN cDNA 4833415N18 gene |
46650 |
0.15 |
chr4_82890665_82890867 | 3.65 |
Cer1 |
cerberus 1, DAN family BMP antagonist |
5618 |
0.22 |
chr4_104270276_104270441 | 3.64 |
Dab1 |
disabled 1 |
96755 |
0.09 |
chr8_70120713_70121043 | 3.63 |
Ncan |
neurocan |
5 |
0.94 |
chr9_85856622_85856773 | 3.62 |
9330154J02Rik |
RIKEN cDNA 9330154J02 gene |
12374 |
0.17 |
chr1_93100941_93101460 | 3.62 |
Kif1a |
kinesin family member 1A |
622 |
0.65 |
chr3_89547062_89547213 | 3.62 |
Kcnn3 |
potassium intermediate/small conductance calcium-activated channel, subfamily N, member 3 |
26973 |
0.14 |
chr6_88937928_88938520 | 3.62 |
4933427D06Rik |
RIKEN cDNA 4933427D06 gene |
12459 |
0.13 |
chr1_186705807_186706361 | 3.60 |
Tgfb2 |
transforming growth factor, beta 2 |
95 |
0.82 |
chr9_60817583_60817875 | 3.59 |
Gm9869 |
predicted gene 9869 |
20470 |
0.16 |
chr17_70402018_70402178 | 3.58 |
Dlgap1 |
DLG associated protein 1 |
22696 |
0.27 |
chr16_25016242_25016817 | 3.57 |
A230028O05Rik |
RIKEN cDNA A230028O05 gene |
43110 |
0.19 |
chr13_112204941_112205092 | 3.55 |
Gm37427 |
predicted gene, 37427 |
14177 |
0.18 |
chr1_158489494_158490042 | 3.54 |
Mir488 |
microRNA 488 |
15857 |
0.17 |
chr11_12415334_12415643 | 3.54 |
Cobl |
cordon-bleu WH2 repeat |
3344 |
0.36 |
chr11_16941428_16941706 | 3.53 |
Eldr |
Egfr long non-coding downstream RNA |
9475 |
0.16 |
chr7_73208614_73208848 | 3.52 |
Gm20083 |
predicted gene, 20083 |
22928 |
0.14 |
chr4_42946778_42947086 | 3.52 |
Dnajb5 |
DnaJ heat shock protein family (Hsp40) member B5 |
2882 |
0.16 |
chr9_44457408_44457744 | 3.51 |
Upk2 |
uroplakin 2 |
2600 |
0.09 |
chr7_143740226_143740603 | 3.51 |
Osbpl5 |
oxysterol binding protein-like 5 |
73 |
0.96 |
chr10_116756314_116756465 | 3.49 |
4930579P08Rik |
RIKEN cDNA 4930579P08 gene |
27136 |
0.15 |
chr5_30712274_30713396 | 3.47 |
Dpysl5 |
dihydropyrimidinase-like 5 |
934 |
0.49 |
chr12_12680284_12680715 | 3.46 |
Gm27952 |
predicted gene, 27952 |
2119 |
0.28 |
chr18_33850642_33850793 | 3.46 |
Epb41l4a |
erythrocyte membrane protein band 4.1 like 4a |
17923 |
0.21 |
chr8_14968124_14968275 | 3.44 |
Gm16350 |
predicted gene 16350 |
6613 |
0.15 |
chr18_82798664_82799035 | 3.44 |
2210420H20Rik |
RIKEN cDNA 2210420H20 gene |
39808 |
0.09 |
chr1_135588621_135588772 | 3.39 |
Nav1 |
neuron navigator 1 |
2991 |
0.23 |
chr1_85279771_85280739 | 3.38 |
Gm16026 |
predicted pseudogene 16026 |
5148 |
0.14 |
chr13_97239617_97239965 | 3.37 |
Enc1 |
ectodermal-neural cortex 1 |
1314 |
0.4 |
chr11_79002458_79002963 | 3.33 |
Ksr1 |
kinase suppressor of ras 1 |
17700 |
0.15 |
chr1_85931248_85931399 | 3.32 |
4933407L21Rik |
RIKEN cDNA 4933407L21 gene |
2437 |
0.19 |
chr2_74450496_74450730 | 3.32 |
Lnpk |
lunapark, ER junction formation factor |
82493 |
0.07 |
chr14_45602118_45602269 | 3.31 |
Ddhd1 |
DDHD domain containing 1 |
534 |
0.63 |
chr1_20477828_20478016 | 3.31 |
Gm24162 |
predicted gene, 24162 |
33010 |
0.16 |
chr13_90722692_90722897 | 3.30 |
Gm44338 |
predicted gene, 44338 |
37318 |
0.17 |
chr16_31766825_31767002 | 3.30 |
Gm49705 |
predicted gene, 49705 |
5947 |
0.15 |
chr16_31935346_31935573 | 3.30 |
Pigz |
phosphatidylinositol glycan anchor biosynthesis, class Z |
1477 |
0.19 |
chr9_83146500_83146823 | 3.29 |
Hmgn3 |
high mobility group nucleosomal binding domain 3 |
24 |
0.93 |
chr13_57595153_57595304 | 3.29 |
Spock1 |
sparc/osteonectin, cwcv and kazal-like domains proteoglycan 1 |
312359 |
0.01 |
chr2_27321720_27321871 | 3.29 |
AA645442 |
expressed sequence AA645442 |
4909 |
0.19 |
chr17_34291688_34291854 | 3.26 |
H2-Aa |
histocompatibility 2, class II antigen A, alpha |
3948 |
0.1 |
chr19_10041145_10042475 | 3.25 |
Fads3 |
fatty acid desaturase 3 |
78 |
0.96 |
chr12_47117714_47117865 | 3.24 |
Gm36971 |
predicted gene, 36971 |
47253 |
0.18 |
chr1_191292489_191292694 | 3.23 |
Gm37168 |
predicted gene, 37168 |
25413 |
0.11 |
chr9_70181794_70181945 | 3.20 |
Myo1e |
myosin IE |
25481 |
0.15 |
chr2_4099553_4099756 | 3.20 |
Gm38085 |
predicted gene, 38085 |
4223 |
0.14 |
chr6_145120787_145121084 | 3.18 |
Lrmp |
lymphoid-restricted membrane protein |
804 |
0.55 |
chr11_102445369_102445776 | 3.18 |
Fam171a2 |
family with sequence similarity 171, member A2 |
2022 |
0.18 |
chr4_46668649_46668800 | 3.16 |
Tbc1d2 |
TBC1 domain family, member 2 |
18515 |
0.18 |
chr8_109464714_109464884 | 3.15 |
Pmfbp1 |
polyamine modulated factor 1 binding protein 1 |
29228 |
0.16 |
chr12_4020516_4020716 | 3.14 |
Efr3b |
EFR3 homolog B |
18175 |
0.15 |
chr4_89433459_89434002 | 3.14 |
Gm12608 |
predicted gene 12608 |
10914 |
0.19 |
chr17_37270117_37270700 | 3.13 |
H2-M3 |
histocompatibility 2, M region locus 3 |
188 |
0.82 |
chr8_104023095_104023520 | 3.13 |
Gm8748 |
predicted gene 8748 |
47842 |
0.12 |
chr11_117523037_117523563 | 3.13 |
Gm11734 |
predicted gene 11734 |
303 |
0.89 |
chr11_75273505_75273702 | 3.11 |
Gm47300 |
predicted gene, 47300 |
45005 |
0.09 |
chr18_12527288_12527452 | 3.11 |
Gm29200 |
predicted gene 29200 |
22944 |
0.13 |
chr9_21196197_21196830 | 3.09 |
Pde4a |
phosphodiesterase 4A, cAMP specific |
192 |
0.89 |
chr7_45638679_45639029 | 3.08 |
A030001D20Rik |
RIKEN cDNA A030001D20 gene |
89 |
0.88 |
chr16_85899316_85900502 | 3.08 |
Adamts5 |
a disintegrin-like and metallopeptidase (reprolysin type) with thrombospondin type 1 motif, 5 (aggrecanase-2) |
1919 |
0.44 |
chr5_63817087_63817379 | 3.08 |
0610040J01Rik |
RIKEN cDNA 0610040J01 gene |
4713 |
0.23 |
chr1_72739743_72739906 | 3.07 |
Rpl37a |
ribosomal protein L37a |
28043 |
0.13 |
chr3_36481744_36482207 | 3.07 |
1810062G17Rik |
RIKEN cDNA 1810062G17 gene |
6038 |
0.12 |
chr7_57508956_57510254 | 3.06 |
Gabra5 |
gamma-aminobutyric acid (GABA) A receptor, subunit alpha 5 |
234 |
0.95 |
chr8_92721661_92721843 | 3.05 |
Gapdh-ps16 |
glyceraldehyde-3-phosphate dehydrogenase, pseudogene 16 |
4777 |
0.22 |
chr14_25135480_25135631 | 3.02 |
4930572O13Rik |
RIKEN cDNA 4930572O13 gene |
7686 |
0.16 |
chr14_24763089_24763301 | 3.02 |
Gm47906 |
predicted gene, 47906 |
70440 |
0.11 |
chr9_58111813_58111965 | 3.01 |
Ccdc33 |
coiled-coil domain containing 33 |
2471 |
0.2 |
chr7_29303741_29304910 | 3.01 |
Dpf1 |
D4, zinc and double PHD fingers family 1 |
349 |
0.78 |
chr13_93855099_93855270 | 2.99 |
Mir5624 |
microRNA 5624 |
64407 |
0.08 |
chr6_25686769_25687229 | 2.97 |
Gpr37 |
G protein-coupled receptor 37 |
2793 |
0.38 |
chr3_30012351_30012502 | 2.96 |
Mecomos |
MDS1 and EVI1 complex locus, opposite strand |
47 |
0.93 |
chr10_13966884_13967143 | 2.96 |
Hivep2 |
human immunodeficiency virus type I enhancer binding protein 2 |
11 |
0.98 |
chr16_33922216_33922721 | 2.95 |
Itgb5 |
integrin beta 5 |
18 |
0.98 |
chr5_24351958_24352969 | 2.95 |
Kcnh2 |
potassium voltage-gated channel, subfamily H (eag-related), member 2 |
859 |
0.41 |
chr3_18081478_18081714 | 2.95 |
Gm23726 |
predicted gene, 23726 |
12270 |
0.2 |
chr18_80811134_80811574 | 2.93 |
Gm47272 |
predicted gene, 47272 |
10893 |
0.19 |
chr16_91962945_91963627 | 2.92 |
Gm27773 |
predicted gene, 27773 |
19138 |
0.1 |
chrX_158923095_158923580 | 2.91 |
Gm5764 |
predicted gene 5764 |
89902 |
0.09 |
chr14_57724617_57724826 | 2.87 |
Lats2 |
large tumor suppressor 2 |
9579 |
0.13 |
chr14_12189722_12190070 | 2.87 |
Ptprg |
protein tyrosine phosphatase, receptor type, G |
47 |
0.98 |
chr2_67565538_67565743 | 2.86 |
B3galt1 |
UDP-Gal:betaGlcNAc beta 1,3-galactosyltransferase, polypeptide 1 |
231 |
0.94 |
chr14_54936393_54936558 | 2.84 |
Cmtm5 |
CKLF-like MARVEL transmembrane domain containing 5 |
22 |
0.92 |
chr4_65958951_65959102 | 2.84 |
Trim32 |
tripartite motif-containing 32 |
353777 |
0.01 |
chr1_177640581_177640770 | 2.84 |
2310043L19Rik |
RIKEN cDNA 2310043L19 gene |
2268 |
0.27 |
chr12_100982252_100982605 | 2.81 |
Ccdc88c |
coiled-coil domain containing 88C |
71 |
0.96 |
chr10_87494268_87494649 | 2.78 |
Ascl1 |
achaete-scute family bHLH transcription factor 1 |
798 |
0.64 |
chr9_61259453_61259822 | 2.78 |
B930092H01Rik |
RIKEN cDNA B930092H01 gene |
34172 |
0.16 |
chr1_37666566_37667022 | 2.78 |
4930470B04Rik |
RIKEN cDNA 4930470B04 gene |
6072 |
0.19 |
chr6_142112069_142112353 | 2.78 |
Gm18159 |
predicted gene, 18159 |
1755 |
0.36 |
chr12_107547975_107548170 | 2.77 |
3110018I06Rik |
RIKEN cDNA 3110018I06 gene |
59440 |
0.12 |
chr9_14867195_14867346 | 2.77 |
Gpr83 |
G protein-coupled receptor 83 |
1930 |
0.22 |
chr9_73094640_73094822 | 2.75 |
Rab27a |
RAB27A, member RAS oncogene family |
102 |
0.93 |
chr1_73944516_73944690 | 2.73 |
Tns1 |
tensin 1 |
3589 |
0.28 |
chrX_7416515_7416860 | 2.73 |
2010204K13Rik |
RIKEN cDNA 2010204K13 gene |
3862 |
0.18 |
chr4_32074569_32074921 | 2.72 |
Gm11927 |
predicted gene 11927 |
23007 |
0.19 |
chr1_82189722_82189873 | 2.72 |
Gm9747 |
predicted gene 9747 |
43315 |
0.14 |
chr8_87938327_87939174 | 2.70 |
Zfp423 |
zinc finger protein 423 |
5302 |
0.29 |
chr17_29282271_29282539 | 2.68 |
BC004004 |
cDNA sequence BC004004 |
5723 |
0.11 |
chr5_73647229_73648112 | 2.67 |
Gm43799 |
predicted gene 43799 |
79 |
0.55 |
chr12_61522794_61523620 | 2.67 |
Lrfn5 |
leucine rich repeat and fibronectin type III domain containing 5 |
40 |
0.97 |
chr10_74987698_74988113 | 2.65 |
Gnaz |
guanine nucleotide binding protein, alpha z subunit |
2936 |
0.25 |
chr9_45678055_45678271 | 2.65 |
Dscaml1 |
DS cell adhesion molecule like 1 |
5326 |
0.21 |
chr13_59040994_59041159 | 2.63 |
Gm34245 |
predicted gene, 34245 |
37220 |
0.14 |
chr18_12527592_12527743 | 2.63 |
Gm29200 |
predicted gene 29200 |
23241 |
0.13 |
chr9_71579308_71579459 | 2.62 |
Myzap |
myocardial zonula adherens protein |
502 |
0.81 |
chr11_38861997_38862148 | 2.62 |
Gm23520 |
predicted gene, 23520 |
63795 |
0.16 |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
1.8 | 5.5 | GO:0089700 | protein kinase D signaling(GO:0089700) |
1.4 | 4.3 | GO:0002339 | B cell selection(GO:0002339) |
1.0 | 2.9 | GO:0045726 | positive regulation of integrin biosynthetic process(GO:0045726) |
1.0 | 4.8 | GO:0034047 | regulation of protein phosphatase type 2A activity(GO:0034047) |
0.8 | 2.5 | GO:0002767 | immune response-inhibiting cell surface receptor signaling pathway(GO:0002767) |
0.8 | 2.5 | GO:0045054 | constitutive secretory pathway(GO:0045054) |
0.8 | 7.3 | GO:0006707 | cholesterol catabolic process(GO:0006707) sterol catabolic process(GO:0016127) |
0.8 | 2.4 | GO:0021529 | spinal cord oligodendrocyte cell differentiation(GO:0021529) spinal cord oligodendrocyte cell fate specification(GO:0021530) |
0.8 | 5.5 | GO:0097011 | cellular response to granulocyte macrophage colony-stimulating factor stimulus(GO:0097011) |
0.8 | 2.3 | GO:0070094 | positive regulation of glucagon secretion(GO:0070094) |
0.7 | 2.2 | GO:0030382 | sperm mitochondrion organization(GO:0030382) |
0.7 | 1.4 | GO:0097688 | AMPA glutamate receptor clustering(GO:0097113) glutamate receptor clustering(GO:0097688) |
0.7 | 2.1 | GO:1903237 | negative regulation of leukocyte tethering or rolling(GO:1903237) |
0.7 | 2.0 | GO:0060178 | regulation of exocyst localization(GO:0060178) |
0.7 | 2.0 | GO:1900825 | regulation of membrane depolarization during cardiac muscle cell action potential(GO:1900825) |
0.6 | 1.9 | GO:0097118 | neuroligin clustering involved in postsynaptic membrane assembly(GO:0097118) |
0.6 | 5.0 | GO:0021707 | cerebellar granular layer formation(GO:0021684) cerebellar granule cell differentiation(GO:0021707) |
0.6 | 1.9 | GO:0007208 | phospholipase C-activating serotonin receptor signaling pathway(GO:0007208) |
0.6 | 2.3 | GO:1903278 | positive regulation of sodium ion export(GO:1903275) positive regulation of sodium ion export from cell(GO:1903278) |
0.5 | 6.3 | GO:0097120 | receptor localization to synapse(GO:0097120) |
0.5 | 1.6 | GO:0032100 | positive regulation of response to food(GO:0032097) positive regulation of appetite(GO:0032100) |
0.5 | 3.5 | GO:0001778 | plasma membrane repair(GO:0001778) |
0.5 | 1.5 | GO:0003221 | right ventricular cardiac muscle tissue morphogenesis(GO:0003221) |
0.5 | 1.5 | GO:2000686 | regulation of rubidium ion transmembrane transporter activity(GO:2000686) |
0.5 | 1.4 | GO:0033693 | neurofilament bundle assembly(GO:0033693) |
0.5 | 3.7 | GO:0090244 | Wnt signaling pathway involved in somitogenesis(GO:0090244) |
0.5 | 1.4 | GO:1900738 | positive regulation of phospholipase C-activating G-protein coupled receptor signaling pathway(GO:1900738) |
0.4 | 1.3 | GO:0043490 | malate-aspartate shuttle(GO:0043490) |
0.4 | 5.4 | GO:0019886 | antigen processing and presentation of exogenous peptide antigen via MHC class II(GO:0019886) |
0.4 | 3.3 | GO:0051823 | regulation of synapse structural plasticity(GO:0051823) |
0.4 | 1.6 | GO:0033563 | dorsal/ventral axon guidance(GO:0033563) |
0.4 | 1.2 | GO:0060585 | regulation of prostaglandin-endoperoxide synthase activity(GO:0060584) positive regulation of prostaglandin-endoperoxide synthase activity(GO:0060585) |
0.4 | 1.2 | GO:0097623 | potassium ion export across plasma membrane(GO:0097623) |
0.4 | 1.9 | GO:0048669 | collateral sprouting in absence of injury(GO:0048669) |
0.4 | 1.1 | GO:0035582 | sequestering of BMP in extracellular matrix(GO:0035582) |
0.4 | 1.5 | GO:0098814 | spontaneous neurotransmitter secretion(GO:0061669) spontaneous synaptic transmission(GO:0098814) |
0.4 | 3.0 | GO:0045591 | positive regulation of regulatory T cell differentiation(GO:0045591) |
0.4 | 2.5 | GO:0006654 | phosphatidic acid biosynthetic process(GO:0006654) |
0.3 | 1.4 | GO:1904393 | positive regulation of postsynaptic membrane organization(GO:1901628) positive regulation of receptor clustering(GO:1903911) regulation of skeletal muscle acetylcholine-gated channel clustering(GO:1904393) positive regulation of skeletal muscle acetylcholine-gated channel clustering(GO:1904395) |
0.3 | 0.7 | GO:0021553 | olfactory nerve development(GO:0021553) |
0.3 | 0.3 | GO:0055005 | ventricular cardiac myofibril assembly(GO:0055005) |
0.3 | 1.5 | GO:0060355 | positive regulation of cell adhesion molecule production(GO:0060355) |
0.3 | 0.9 | GO:2000297 | negative regulation of synapse maturation(GO:2000297) |
0.3 | 0.3 | GO:0090027 | negative regulation of monocyte chemotaxis(GO:0090027) |
0.3 | 0.9 | GO:0090258 | negative regulation of mitochondrial fission(GO:0090258) |
0.3 | 0.9 | GO:0071673 | positive regulation of smooth muscle cell chemotaxis(GO:0071673) |
0.3 | 0.3 | GO:0072069 | distal convoluted tubule development(GO:0072025) DCT cell differentiation(GO:0072069) metanephric distal convoluted tubule development(GO:0072221) metanephric distal tubule development(GO:0072235) metanephric DCT cell differentiation(GO:0072240) |
0.3 | 0.9 | GO:0046449 | creatinine metabolic process(GO:0046449) cellular lactam metabolic process(GO:0072338) |
0.3 | 0.9 | GO:0048682 | axon extension involved in regeneration(GO:0048677) sprouting of injured axon(GO:0048682) |
0.3 | 1.1 | GO:0021698 | cerebellar cortex structural organization(GO:0021698) |
0.3 | 2.8 | GO:0009312 | oligosaccharide biosynthetic process(GO:0009312) |
0.3 | 0.8 | GO:0030208 | dermatan sulfate biosynthetic process(GO:0030208) |
0.3 | 0.8 | GO:0060478 | acrosomal vesicle exocytosis(GO:0060478) |
0.3 | 0.5 | GO:0002581 | negative regulation of antigen processing and presentation of peptide or polysaccharide antigen via MHC class II(GO:0002581) |
0.3 | 2.4 | GO:0050957 | equilibrioception(GO:0050957) |
0.3 | 0.8 | GO:1902897 | regulation of postsynaptic density protein 95 clustering(GO:1902897) |
0.3 | 1.1 | GO:0010499 | proteasomal ubiquitin-independent protein catabolic process(GO:0010499) |
0.3 | 3.1 | GO:0090136 | epithelial cell-cell adhesion(GO:0090136) |
0.3 | 1.0 | GO:2000483 | negative regulation of interleukin-8 secretion(GO:2000483) |
0.3 | 0.8 | GO:0061368 | behavioral response to chemical pain(GO:0061366) behavioral response to formalin induced pain(GO:0061368) |
0.2 | 2.2 | GO:0002485 | antigen processing and presentation of endogenous peptide antigen via MHC class I via ER pathway(GO:0002484) antigen processing and presentation of endogenous peptide antigen via MHC class I via ER pathway, TAP-dependent(GO:0002485) |
0.2 | 0.7 | GO:1903984 | positive regulation of TRAIL-activated apoptotic signaling pathway(GO:1903984) |
0.2 | 0.9 | GO:0098598 | vocal learning(GO:0042297) imitative learning(GO:0098596) learned vocalization behavior or vocal learning(GO:0098598) |
0.2 | 0.7 | GO:0090310 | negative regulation of methylation-dependent chromatin silencing(GO:0090310) |
0.2 | 0.7 | GO:0009786 | regulation of asymmetric cell division(GO:0009786) |
0.2 | 5.3 | GO:0007214 | gamma-aminobutyric acid signaling pathway(GO:0007214) |
0.2 | 0.7 | GO:1902730 | regulation of heparan sulfate proteoglycan biosynthetic process(GO:0010908) positive regulation of heparan sulfate proteoglycan biosynthetic process(GO:0010909) positive regulation of proteoglycan biosynthetic process(GO:1902730) |
0.2 | 0.7 | GO:0035973 | aggrephagy(GO:0035973) |
0.2 | 0.9 | GO:0060282 | positive regulation of oocyte development(GO:0060282) |
0.2 | 1.1 | GO:0070842 | aggresome assembly(GO:0070842) |
0.2 | 1.3 | GO:0002860 | positive regulation of natural killer cell mediated immune response to tumor cell(GO:0002857) positive regulation of natural killer cell mediated cytotoxicity directed against tumor cell target(GO:0002860) |
0.2 | 0.4 | GO:0060830 | ciliary receptor clustering involved in smoothened signaling pathway(GO:0060830) |
0.2 | 4.3 | GO:0010738 | regulation of protein kinase A signaling(GO:0010738) |
0.2 | 3.4 | GO:0035855 | megakaryocyte development(GO:0035855) |
0.2 | 0.6 | GO:0035860 | glial cell-derived neurotrophic factor receptor signaling pathway(GO:0035860) |
0.2 | 0.4 | GO:0097477 | lateral motor column neuron migration(GO:0097477) |
0.2 | 1.0 | GO:0060339 | negative regulation of type I interferon-mediated signaling pathway(GO:0060339) |
0.2 | 0.8 | GO:0072038 | mesenchymal stem cell maintenance involved in nephron morphogenesis(GO:0072038) |
0.2 | 0.6 | GO:0001828 | inner cell mass cellular morphogenesis(GO:0001828) |
0.2 | 0.8 | GO:0046909 | intermembrane transport(GO:0046909) |
0.2 | 0.8 | GO:0070366 | regulation of hepatocyte differentiation(GO:0070366) |
0.2 | 0.8 | GO:2001137 | positive regulation of endocytic recycling(GO:2001137) |
0.2 | 1.0 | GO:2000210 | positive regulation of anoikis(GO:2000210) |
0.2 | 0.2 | GO:1901727 | positive regulation of histone deacetylase activity(GO:1901727) |
0.2 | 0.6 | GO:0070649 | formin-nucleated actin cable assembly(GO:0070649) |
0.2 | 1.2 | GO:0021631 | optic nerve morphogenesis(GO:0021631) |
0.2 | 0.6 | GO:0048619 | embryonic hindgut morphogenesis(GO:0048619) |
0.2 | 3.2 | GO:1903206 | negative regulation of hydrogen peroxide-induced cell death(GO:1903206) |
0.2 | 0.6 | GO:0071677 | positive regulation of mononuclear cell migration(GO:0071677) |
0.2 | 1.9 | GO:0035721 | intraciliary retrograde transport(GO:0035721) |
0.2 | 0.4 | GO:0021775 | smoothened signaling pathway involved in ventral spinal cord interneuron specification(GO:0021775) smoothened signaling pathway involved in spinal cord motor neuron cell fate specification(GO:0021776) |
0.2 | 0.6 | GO:0060300 | regulation of cytokine activity(GO:0060300) |
0.2 | 0.7 | GO:0033326 | cerebrospinal fluid secretion(GO:0033326) |
0.2 | 3.8 | GO:0032620 | interleukin-17 production(GO:0032620) |
0.2 | 2.5 | GO:0061003 | positive regulation of dendritic spine morphogenesis(GO:0061003) |
0.2 | 0.5 | GO:0036135 | Schwann cell migration(GO:0036135) regulation of Schwann cell migration(GO:1900147) |
0.2 | 0.5 | GO:0086046 | membrane depolarization during SA node cell action potential(GO:0086046) |
0.2 | 0.5 | GO:0033566 | gamma-tubulin complex localization(GO:0033566) |
0.2 | 0.7 | GO:0021554 | optic nerve development(GO:0021554) |
0.2 | 0.5 | GO:0006842 | tricarboxylic acid transport(GO:0006842) citrate transport(GO:0015746) |
0.2 | 0.2 | GO:0097490 | trunk segmentation(GO:0035290) trunk neural crest cell migration(GO:0036484) ventral trunk neural crest cell migration(GO:0036486) sympathetic neuron projection extension(GO:0097490) sympathetic neuron projection guidance(GO:0097491) |
0.2 | 0.7 | GO:0001712 | ectodermal cell fate commitment(GO:0001712) |
0.2 | 0.2 | GO:0097476 | motor neuron migration(GO:0097475) spinal cord motor neuron migration(GO:0097476) |
0.2 | 0.5 | GO:0072310 | glomerular visceral epithelial cell development(GO:0072015) glomerular epithelial cell development(GO:0072310) |
0.2 | 1.8 | GO:0006750 | glutathione biosynthetic process(GO:0006750) |
0.2 | 0.6 | GO:1901491 | negative regulation of lymphangiogenesis(GO:1901491) |
0.2 | 0.8 | GO:1903887 | motile primary cilium assembly(GO:1903887) |
0.2 | 0.9 | GO:0021873 | forebrain neuroblast division(GO:0021873) |
0.2 | 0.5 | GO:0045896 | regulation of transcription during mitosis(GO:0045896) positive regulation of transcription during mitosis(GO:0045897) |
0.2 | 0.3 | GO:0032489 | regulation of Cdc42 protein signal transduction(GO:0032489) |
0.2 | 0.5 | GO:0050427 | 3'-phosphoadenosine 5'-phosphosulfate metabolic process(GO:0050427) |
0.2 | 0.5 | GO:1900454 | positive regulation of long term synaptic depression(GO:1900454) |
0.2 | 0.5 | GO:0042851 | L-alanine metabolic process(GO:0042851) |
0.2 | 0.8 | GO:0071985 | multivesicular body sorting pathway(GO:0071985) |
0.2 | 0.6 | GO:0046069 | cGMP catabolic process(GO:0046069) |
0.2 | 0.6 | GO:0006566 | threonine metabolic process(GO:0006566) |
0.2 | 1.2 | GO:0071257 | cellular response to electrical stimulus(GO:0071257) |
0.1 | 2.7 | GO:0010954 | positive regulation of protein processing(GO:0010954) |
0.1 | 0.4 | GO:2000304 | positive regulation of sphingolipid biosynthetic process(GO:0090154) positive regulation of ceramide biosynthetic process(GO:2000304) |
0.1 | 0.6 | GO:0045053 | protein retention in Golgi apparatus(GO:0045053) |
0.1 | 0.9 | GO:1903961 | positive regulation of anion transmembrane transport(GO:1903961) |
0.1 | 1.6 | GO:0080111 | DNA demethylation(GO:0080111) |
0.1 | 0.1 | GO:0071694 | protein localization to extracellular region(GO:0071692) maintenance of protein location in extracellular region(GO:0071694) |
0.1 | 0.4 | GO:1902430 | negative regulation of beta-amyloid formation(GO:1902430) |
0.1 | 0.4 | GO:1902512 | positive regulation of apoptotic DNA fragmentation(GO:1902512) positive regulation of DNA catabolic process(GO:1903626) |
0.1 | 1.4 | GO:0007288 | sperm axoneme assembly(GO:0007288) |
0.1 | 1.0 | GO:0046784 | viral mRNA export from host cell nucleus(GO:0046784) |
0.1 | 1.0 | GO:0051775 | response to redox state(GO:0051775) |
0.1 | 0.5 | GO:0038165 | oncostatin-M-mediated signaling pathway(GO:0038165) |
0.1 | 0.4 | GO:0035021 | negative regulation of Rac protein signal transduction(GO:0035021) |
0.1 | 0.9 | GO:0097264 | self proteolysis(GO:0097264) |
0.1 | 0.4 | GO:2000546 | positive regulation of cell chemotaxis to fibroblast growth factor(GO:1904849) positive regulation of endothelial cell chemotaxis to fibroblast growth factor(GO:2000546) |
0.1 | 0.8 | GO:1900042 | positive regulation of interleukin-2 secretion(GO:1900042) |
0.1 | 0.4 | GO:0035826 | rubidium ion transport(GO:0035826) |
0.1 | 1.9 | GO:0030322 | stabilization of membrane potential(GO:0030322) |
0.1 | 1.7 | GO:1902043 | positive regulation of extrinsic apoptotic signaling pathway via death domain receptors(GO:1902043) |
0.1 | 0.3 | GO:0018076 | N-terminal peptidyl-lysine acetylation(GO:0018076) |
0.1 | 0.2 | GO:0007412 | axon target recognition(GO:0007412) |
0.1 | 0.5 | GO:0031999 | negative regulation of fatty acid beta-oxidation(GO:0031999) |
0.1 | 0.4 | GO:0018125 | peptidyl-cysteine methylation(GO:0018125) |
0.1 | 0.7 | GO:0003310 | pancreatic A cell differentiation(GO:0003310) |
0.1 | 0.6 | GO:1902993 | positive regulation of beta-amyloid formation(GO:1902004) positive regulation of amyloid precursor protein catabolic process(GO:1902993) |
0.1 | 0.5 | GO:0010793 | regulation of mRNA export from nucleus(GO:0010793) regulation of ribonucleoprotein complex localization(GO:2000197) |
0.1 | 0.5 | GO:0044821 | meiotic telomere tethering at nuclear periphery(GO:0044821) meiotic attachment of telomere to nuclear envelope(GO:0070197) chromosome attachment to the nuclear envelope(GO:0097240) |
0.1 | 0.6 | GO:0007158 | neuron cell-cell adhesion(GO:0007158) |
0.1 | 0.2 | GO:0090038 | negative regulation of protein kinase C signaling(GO:0090038) |
0.1 | 0.3 | GO:0014707 | branchiomeric skeletal muscle development(GO:0014707) |
0.1 | 0.3 | GO:1902744 | negative regulation of lamellipodium organization(GO:1902744) |
0.1 | 0.8 | GO:0043615 | astrocyte cell migration(GO:0043615) |
0.1 | 5.8 | GO:0051965 | positive regulation of synapse assembly(GO:0051965) |
0.1 | 1.2 | GO:0031290 | retinal ganglion cell axon guidance(GO:0031290) |
0.1 | 0.7 | GO:0070327 | thyroid hormone transport(GO:0070327) |
0.1 | 0.3 | GO:0006382 | adenosine to inosine editing(GO:0006382) |
0.1 | 0.2 | GO:0014900 | regulation of muscle hyperplasia(GO:0014738) muscle hyperplasia(GO:0014900) |
0.1 | 0.8 | GO:0006370 | 7-methylguanosine mRNA capping(GO:0006370) |
0.1 | 0.2 | GO:0002254 | kinin cascade(GO:0002254) |
0.1 | 0.3 | GO:0007354 | zygotic determination of anterior/posterior axis, embryo(GO:0007354) |
0.1 | 5.5 | GO:0061178 | regulation of insulin secretion involved in cellular response to glucose stimulus(GO:0061178) |
0.1 | 1.2 | GO:0060670 | branching involved in labyrinthine layer morphogenesis(GO:0060670) |
0.1 | 0.2 | GO:0072300 | regulation of metanephric glomerulus development(GO:0072298) positive regulation of metanephric glomerulus development(GO:0072300) |
0.1 | 0.1 | GO:0002434 | immune complex clearance(GO:0002434) |
0.1 | 0.3 | GO:0015705 | iodide transport(GO:0015705) |
0.1 | 0.8 | GO:0010832 | negative regulation of myotube differentiation(GO:0010832) |
0.1 | 0.6 | GO:0016198 | axon choice point recognition(GO:0016198) |
0.1 | 0.4 | GO:0046959 | habituation(GO:0046959) |
0.1 | 0.3 | GO:0035022 | positive regulation of Rac protein signal transduction(GO:0035022) |
0.1 | 0.5 | GO:0071038 | nuclear polyadenylation-dependent tRNA catabolic process(GO:0071038) |
0.1 | 0.1 | GO:1901032 | negative regulation of response to reactive oxygen species(GO:1901032) |
0.1 | 0.5 | GO:0018231 | peptidyl-L-cysteine S-palmitoylation(GO:0018230) peptidyl-S-diacylglycerol-L-cysteine biosynthetic process from peptidyl-cysteine(GO:0018231) |
0.1 | 2.4 | GO:0045662 | negative regulation of myoblast differentiation(GO:0045662) |
0.1 | 0.3 | GO:0002949 | tRNA threonylcarbamoyladenosine modification(GO:0002949) |
0.1 | 0.4 | GO:0034983 | peptidyl-lysine deacetylation(GO:0034983) |
0.1 | 0.5 | GO:1902774 | late endosome to lysosome transport(GO:1902774) |
0.1 | 0.5 | GO:0003433 | chondrocyte development involved in endochondral bone morphogenesis(GO:0003433) |
0.1 | 0.8 | GO:0060040 | retinal bipolar neuron differentiation(GO:0060040) |
0.1 | 0.4 | GO:0006651 | diacylglycerol biosynthetic process(GO:0006651) |
0.1 | 0.5 | GO:0015760 | hexose phosphate transport(GO:0015712) glucose-6-phosphate transport(GO:0015760) |
0.1 | 0.4 | GO:1901026 | ripoptosome assembly(GO:0097343) ripoptosome assembly involved in necroptotic process(GO:1901026) |
0.1 | 0.3 | GO:0097070 | ductus arteriosus closure(GO:0097070) |
0.1 | 0.2 | GO:0008582 | regulation of synaptic growth at neuromuscular junction(GO:0008582) synaptic growth at neuromuscular junction(GO:0051124) |
0.1 | 0.2 | GO:0033030 | negative regulation of neutrophil apoptotic process(GO:0033030) |
0.1 | 1.7 | GO:0045187 | regulation of circadian sleep/wake cycle(GO:0042749) regulation of circadian sleep/wake cycle, sleep(GO:0045187) |
0.1 | 0.3 | GO:0035887 | aortic smooth muscle cell differentiation(GO:0035887) |
0.1 | 0.4 | GO:0098908 | regulation of neuronal action potential(GO:0098908) |
0.1 | 0.2 | GO:0010901 | regulation of very-low-density lipoprotein particle remodeling(GO:0010901) |
0.1 | 0.3 | GO:0072051 | juxtaglomerular apparatus development(GO:0072051) |
0.1 | 2.8 | GO:0061245 | establishment or maintenance of apical/basal cell polarity(GO:0035088) establishment or maintenance of bipolar cell polarity(GO:0061245) |
0.1 | 0.2 | GO:0061002 | negative regulation of dendritic spine morphogenesis(GO:0061002) |
0.1 | 1.4 | GO:1903831 | acetylcholine receptor signaling pathway(GO:0095500) postsynaptic signal transduction(GO:0098926) signal transduction involved in cellular response to ammonium ion(GO:1903831) response to acetylcholine(GO:1905144) cellular response to acetylcholine(GO:1905145) |
0.1 | 0.3 | GO:0090214 | spongiotrophoblast layer developmental growth(GO:0090214) |
0.1 | 1.3 | GO:0045956 | positive regulation of calcium ion-dependent exocytosis(GO:0045956) |
0.1 | 2.4 | GO:0010765 | positive regulation of sodium ion transport(GO:0010765) |
0.1 | 0.2 | GO:0002554 | serotonin secretion by platelet(GO:0002554) |
0.1 | 0.6 | GO:1901678 | iron coordination entity transport(GO:1901678) |
0.1 | 0.9 | GO:0021854 | hypothalamus development(GO:0021854) |
0.1 | 0.1 | GO:1900451 | positive regulation of glutamate receptor signaling pathway(GO:1900451) positive regulation of alpha-amino-3-hydroxy-5-methyl-4-isoxazole propionate selective glutamate receptor activity(GO:2000969) |
0.1 | 0.4 | GO:1904321 | response to forskolin(GO:1904321) cellular response to forskolin(GO:1904322) |
0.1 | 0.3 | GO:0021764 | amygdala development(GO:0021764) |
0.1 | 0.3 | GO:0010918 | positive regulation of mitochondrial membrane potential(GO:0010918) |
0.1 | 0.9 | GO:0016973 | poly(A)+ mRNA export from nucleus(GO:0016973) |
0.1 | 0.1 | GO:0061325 | cell proliferation involved in outflow tract morphogenesis(GO:0061325) |
0.1 | 0.4 | GO:0032227 | negative regulation of synaptic transmission, dopaminergic(GO:0032227) |
0.1 | 0.3 | GO:0032202 | telomere assembly(GO:0032202) |
0.1 | 0.2 | GO:0015014 | heparan sulfate proteoglycan biosynthetic process, polysaccharide chain biosynthetic process(GO:0015014) |
0.1 | 0.4 | GO:0046602 | regulation of mitotic centrosome separation(GO:0046602) |
0.1 | 0.7 | GO:0051382 | kinetochore assembly(GO:0051382) |
0.1 | 0.2 | GO:2001054 | negative regulation of mesenchymal cell apoptotic process(GO:2001054) |
0.1 | 3.9 | GO:0035249 | synaptic transmission, glutamatergic(GO:0035249) |
0.1 | 0.5 | GO:0035418 | protein localization to synapse(GO:0035418) |
0.1 | 0.2 | GO:0031118 | rRNA pseudouridine synthesis(GO:0031118) |
0.1 | 0.2 | GO:0002692 | negative regulation of cellular extravasation(GO:0002692) |
0.1 | 1.3 | GO:0060216 | definitive hemopoiesis(GO:0060216) |
0.1 | 0.3 | GO:0006642 | triglyceride mobilization(GO:0006642) |
0.1 | 0.2 | GO:2001016 | positive regulation of skeletal muscle cell differentiation(GO:2001016) |
0.1 | 0.5 | GO:0042118 | endothelial cell activation(GO:0042118) |
0.1 | 0.3 | GO:0060023 | soft palate development(GO:0060023) |
0.1 | 0.1 | GO:2000721 | positive regulation of transcription from RNA polymerase II promoter involved in smooth muscle cell differentiation(GO:2000721) |
0.1 | 0.5 | GO:0090073 | positive regulation of protein homodimerization activity(GO:0090073) |
0.1 | 0.4 | GO:0008063 | Toll signaling pathway(GO:0008063) |
0.1 | 0.1 | GO:1900157 | regulation of bone mineralization involved in bone maturation(GO:1900157) |
0.1 | 0.1 | GO:0003219 | cardiac right ventricle formation(GO:0003219) |
0.1 | 0.2 | GO:0019747 | regulation of isoprenoid metabolic process(GO:0019747) |
0.1 | 0.3 | GO:0033564 | anterior/posterior axon guidance(GO:0033564) |
0.1 | 0.1 | GO:0090325 | regulation of locomotion involved in locomotory behavior(GO:0090325) |
0.1 | 0.1 | GO:2000821 | regulation of grooming behavior(GO:2000821) |
0.1 | 0.1 | GO:0086045 | membrane depolarization during AV node cell action potential(GO:0086045) |
0.1 | 0.2 | GO:0015747 | urate transport(GO:0015747) |
0.1 | 0.2 | GO:0018242 | protein O-linked glycosylation via serine(GO:0018242) |
0.1 | 0.2 | GO:0002043 | blood vessel endothelial cell proliferation involved in sprouting angiogenesis(GO:0002043) |
0.1 | 0.1 | GO:0007571 | age-dependent response to oxidative stress(GO:0001306) age-dependent general metabolic decline(GO:0007571) |
0.1 | 0.1 | GO:2000449 | regulation of CD8-positive, alpha-beta T cell extravasation(GO:2000449) |
0.1 | 0.1 | GO:0010360 | negative regulation of anion channel activity(GO:0010360) |
0.1 | 0.2 | GO:0021902 | commitment of neuronal cell to specific neuron type in forebrain(GO:0021902) |
0.1 | 0.5 | GO:0098719 | sodium ion import across plasma membrane(GO:0098719) sodium ion import into cell(GO:1990118) |
0.1 | 0.2 | GO:1902606 | regulation of large conductance calcium-activated potassium channel activity(GO:1902606) positive regulation of large conductance calcium-activated potassium channel activity(GO:1902608) |
0.1 | 0.1 | GO:0072076 | nephrogenic mesenchyme development(GO:0072076) |
0.1 | 0.1 | GO:2000035 | regulation of stem cell division(GO:2000035) |
0.1 | 0.1 | GO:2000111 | positive regulation of macrophage apoptotic process(GO:2000111) |
0.1 | 0.1 | GO:0035441 | cell migration involved in vasculogenesis(GO:0035441) |
0.1 | 0.3 | GO:0042985 | negative regulation of amyloid precursor protein biosynthetic process(GO:0042985) |
0.1 | 0.5 | GO:1902902 | negative regulation of autophagosome assembly(GO:1902902) |
0.1 | 0.4 | GO:1901317 | regulation of sperm motility(GO:1901317) |
0.1 | 0.1 | GO:1903265 | positive regulation of tumor necrosis factor-mediated signaling pathway(GO:1903265) |
0.1 | 0.3 | GO:0001955 | blood vessel maturation(GO:0001955) |
0.1 | 2.3 | GO:0010633 | negative regulation of epithelial cell migration(GO:0010633) |
0.1 | 0.3 | GO:0071684 | blastocyst hatching(GO:0001835) hatching(GO:0035188) organism emergence from protective structure(GO:0071684) |
0.1 | 0.1 | GO:0006210 | pyrimidine nucleobase catabolic process(GO:0006208) thymine catabolic process(GO:0006210) thymine metabolic process(GO:0019859) |
0.1 | 0.1 | GO:0061010 | gall bladder development(GO:0061010) |
0.1 | 0.2 | GO:0003348 | cardiac endothelial cell differentiation(GO:0003348) |
0.1 | 0.2 | GO:0070970 | interleukin-2 secretion(GO:0070970) |
0.1 | 0.2 | GO:0035934 | corticosterone secretion(GO:0035934) regulation of corticosterone secretion(GO:2000852) |
0.1 | 0.2 | GO:0038031 | non-canonical Wnt signaling pathway via JNK cascade(GO:0038031) |
0.1 | 0.2 | GO:0032474 | otolith morphogenesis(GO:0032474) |
0.1 | 0.2 | GO:0061081 | positive regulation of macrophage cytokine production(GO:0060907) positive regulation of myeloid leukocyte cytokine production involved in immune response(GO:0061081) |
0.1 | 1.3 | GO:0014823 | response to activity(GO:0014823) |
0.1 | 0.1 | GO:0043380 | regulation of memory T cell differentiation(GO:0043380) |
0.1 | 0.1 | GO:0030222 | eosinophil differentiation(GO:0030222) |
0.1 | 0.1 | GO:0006808 | regulation of nitrogen utilization(GO:0006808) |
0.1 | 0.3 | GO:0009052 | pentose-phosphate shunt, non-oxidative branch(GO:0009052) |
0.1 | 0.3 | GO:0051639 | actin filament network formation(GO:0051639) |
0.1 | 0.1 | GO:1902459 | positive regulation of stem cell population maintenance(GO:1902459) |
0.1 | 0.2 | GO:0001922 | B-1 B cell homeostasis(GO:0001922) |
0.1 | 0.2 | GO:1990034 | calcium ion export from cell(GO:1990034) |
0.1 | 0.1 | GO:0002322 | B cell proliferation involved in immune response(GO:0002322) |
0.1 | 0.1 | GO:2000664 | positive regulation of interleukin-5 secretion(GO:2000664) positive regulation of interleukin-13 secretion(GO:2000667) |
0.1 | 0.5 | GO:0022038 | corpus callosum development(GO:0022038) |
0.1 | 0.5 | GO:0042074 | cell migration involved in gastrulation(GO:0042074) |
0.1 | 0.6 | GO:0071786 | endoplasmic reticulum tubular network organization(GO:0071786) |
0.1 | 0.1 | GO:0060486 | Clara cell differentiation(GO:0060486) |
0.1 | 0.6 | GO:0007202 | activation of phospholipase C activity(GO:0007202) |
0.1 | 0.5 | GO:0014883 | transition between fast and slow fiber(GO:0014883) |
0.1 | 0.1 | GO:0014744 | positive regulation of muscle adaptation(GO:0014744) |
0.1 | 0.2 | GO:0042126 | nitrate metabolic process(GO:0042126) |
0.1 | 0.9 | GO:0030513 | positive regulation of BMP signaling pathway(GO:0030513) |
0.1 | 0.2 | GO:1903849 | regulation of aorta morphogenesis(GO:1903847) positive regulation of aorta morphogenesis(GO:1903849) |
0.1 | 0.1 | GO:0021747 | cochlear nucleus development(GO:0021747) |
0.1 | 0.1 | GO:0071224 | cellular response to peptidoglycan(GO:0071224) |
0.1 | 0.3 | GO:0060573 | ventral spinal cord interneuron specification(GO:0021521) cell fate specification involved in pattern specification(GO:0060573) |
0.1 | 0.2 | GO:0019478 | D-amino acid catabolic process(GO:0019478) |
0.1 | 0.2 | GO:0045760 | positive regulation of action potential(GO:0045760) |
0.1 | 0.3 | GO:0097084 | vascular smooth muscle cell development(GO:0097084) |
0.1 | 0.1 | GO:0014734 | skeletal muscle hypertrophy(GO:0014734) |
0.1 | 0.2 | GO:0018094 | protein polyglycylation(GO:0018094) |
0.1 | 0.6 | GO:0045823 | positive regulation of heart contraction(GO:0045823) |
0.1 | 0.2 | GO:0060052 | neurofilament cytoskeleton organization(GO:0060052) |
0.1 | 0.2 | GO:0071712 | ER-associated misfolded protein catabolic process(GO:0071712) |
0.1 | 0.1 | GO:0097105 | presynaptic membrane assembly(GO:0097105) |
0.1 | 0.2 | GO:0090611 | ubiquitin-independent protein catabolic process via the multivesicular body sorting pathway(GO:0090611) |
0.1 | 0.1 | GO:0030950 | establishment or maintenance of actin cytoskeleton polarity(GO:0030950) |
0.1 | 0.1 | GO:0042726 | flavin-containing compound metabolic process(GO:0042726) |
0.1 | 0.3 | GO:0040016 | embryonic cleavage(GO:0040016) |
0.1 | 0.1 | GO:1901097 | negative regulation of autophagosome maturation(GO:1901097) |
0.1 | 0.1 | GO:0003415 | chondrocyte hypertrophy(GO:0003415) |
0.1 | 0.1 | GO:0003228 | atrial cardiac muscle tissue development(GO:0003228) atrial cardiac muscle tissue morphogenesis(GO:0055009) |
0.1 | 0.1 | GO:1902065 | response to L-glutamate(GO:1902065) |
0.1 | 0.2 | GO:1902268 | negative regulation of polyamine transmembrane transport(GO:1902268) |
0.0 | 1.6 | GO:0008542 | visual learning(GO:0008542) |
0.0 | 0.0 | GO:0060837 | blood vessel endothelial cell differentiation(GO:0060837) |
0.0 | 0.4 | GO:0006268 | DNA unwinding involved in DNA replication(GO:0006268) |
0.0 | 0.1 | GO:0014028 | notochord formation(GO:0014028) |
0.0 | 0.2 | GO:0014054 | positive regulation of gamma-aminobutyric acid secretion(GO:0014054) |
0.0 | 0.1 | GO:0032929 | negative regulation of superoxide anion generation(GO:0032929) |
0.0 | 0.3 | GO:2000288 | positive regulation of myoblast proliferation(GO:2000288) |
0.0 | 0.3 | GO:0007168 | receptor guanylyl cyclase signaling pathway(GO:0007168) |
0.0 | 0.4 | GO:0035878 | nail development(GO:0035878) |
0.0 | 0.3 | GO:0035745 | T-helper 2 cell cytokine production(GO:0035745) |
0.0 | 0.1 | GO:1903011 | negative regulation of bone development(GO:1903011) |
0.0 | 0.2 | GO:0021670 | lateral ventricle development(GO:0021670) |
0.0 | 0.2 | GO:0042473 | outer ear morphogenesis(GO:0042473) |
0.0 | 1.8 | GO:0015914 | phospholipid transport(GO:0015914) |
0.0 | 0.2 | GO:2000785 | regulation of autophagosome assembly(GO:2000785) |
0.0 | 0.2 | GO:0030578 | PML body organization(GO:0030578) |
0.0 | 0.1 | GO:0046104 | thymidine metabolic process(GO:0046104) |
0.0 | 0.2 | GO:0007221 | positive regulation of transcription of Notch receptor target(GO:0007221) |
0.0 | 0.0 | GO:0042421 | norepinephrine biosynthetic process(GO:0042421) |
0.0 | 0.1 | GO:0019276 | UDP-N-acetylgalactosamine metabolic process(GO:0019276) |
0.0 | 0.2 | GO:0035235 | ionotropic glutamate receptor signaling pathway(GO:0035235) |
0.0 | 0.1 | GO:0090370 | negative regulation of cholesterol efflux(GO:0090370) |
0.0 | 0.1 | GO:1902896 | terminal web assembly(GO:1902896) |
0.0 | 1.0 | GO:0019228 | neuronal action potential(GO:0019228) |
0.0 | 0.5 | GO:0045475 | locomotor rhythm(GO:0045475) |
0.0 | 0.0 | GO:0061055 | myotome development(GO:0061055) |
0.0 | 0.2 | GO:0019732 | antifungal humoral response(GO:0019732) |
0.0 | 1.3 | GO:0050885 | neuromuscular process controlling balance(GO:0050885) |
0.0 | 0.2 | GO:0060394 | negative regulation of pathway-restricted SMAD protein phosphorylation(GO:0060394) |
0.0 | 0.3 | GO:0071803 | positive regulation of podosome assembly(GO:0071803) |
0.0 | 0.9 | GO:0010107 | potassium ion import(GO:0010107) |
0.0 | 0.2 | GO:0072307 | metanephric nephron tubule epithelial cell differentiation(GO:0072257) regulation of metanephric nephron tubule epithelial cell differentiation(GO:0072307) |
0.0 | 0.0 | GO:2000224 | regulation of testosterone biosynthetic process(GO:2000224) |
0.0 | 0.7 | GO:1902668 | negative regulation of axon extension involved in axon guidance(GO:0048843) negative regulation of axon guidance(GO:1902668) |
0.0 | 0.3 | GO:0050930 | induction of positive chemotaxis(GO:0050930) |
0.0 | 0.2 | GO:0045217 | cell-cell junction maintenance(GO:0045217) |
0.0 | 0.1 | GO:0010579 | regulation of adenylate cyclase activity involved in G-protein coupled receptor signaling pathway(GO:0010578) positive regulation of adenylate cyclase activity involved in G-protein coupled receptor signaling pathway(GO:0010579) |
0.0 | 0.2 | GO:0006742 | NADP catabolic process(GO:0006742) |
0.0 | 0.1 | GO:1904354 | negative regulation of telomere capping(GO:1904354) |
0.0 | 0.0 | GO:0031914 | negative regulation of synaptic plasticity(GO:0031914) |
0.0 | 0.1 | GO:1901096 | regulation of autophagosome maturation(GO:1901096) |
0.0 | 0.7 | GO:0051646 | mitochondrion localization(GO:0051646) |
0.0 | 0.1 | GO:1903431 | positive regulation of cell maturation(GO:1903431) |
0.0 | 0.2 | GO:0046322 | negative regulation of fatty acid oxidation(GO:0046322) |
0.0 | 0.0 | GO:1905005 | regulation of epithelial to mesenchymal transition involved in endocardial cushion formation(GO:1905005) |
0.0 | 0.1 | GO:0070634 | transepithelial ammonium transport(GO:0070634) |
0.0 | 0.3 | GO:0014041 | regulation of neuron maturation(GO:0014041) |
0.0 | 0.1 | GO:1902775 | mitochondrial large ribosomal subunit assembly(GO:1902775) |
0.0 | 0.3 | GO:0030854 | positive regulation of granulocyte differentiation(GO:0030854) |
0.0 | 0.1 | GO:2000650 | negative regulation of sodium ion transmembrane transporter activity(GO:2000650) |
0.0 | 0.1 | GO:0046049 | UMP biosynthetic process(GO:0006222) pyrimidine ribonucleoside monophosphate metabolic process(GO:0009173) pyrimidine ribonucleoside monophosphate biosynthetic process(GO:0009174) UMP metabolic process(GO:0046049) |
0.0 | 0.2 | GO:0090166 | Golgi disassembly(GO:0090166) |
0.0 | 0.1 | GO:0015888 | thiamine transport(GO:0015888) |
0.0 | 0.4 | GO:0060317 | cardiac epithelial to mesenchymal transition(GO:0060317) |
0.0 | 0.1 | GO:1901420 | negative regulation of response to alcohol(GO:1901420) |
0.0 | 0.0 | GO:0032225 | regulation of synaptic transmission, dopaminergic(GO:0032225) |
0.0 | 0.1 | GO:2001274 | negative regulation of glucose import in response to insulin stimulus(GO:2001274) |
0.0 | 0.1 | GO:0043951 | negative regulation of cAMP-mediated signaling(GO:0043951) |
0.0 | 0.3 | GO:0019800 | peptide cross-linking via chondroitin 4-sulfate glycosaminoglycan(GO:0019800) |
0.0 | 0.1 | GO:1902866 | regulation of retina development in camera-type eye(GO:1902866) |
0.0 | 0.5 | GO:0045671 | negative regulation of osteoclast differentiation(GO:0045671) |
0.0 | 0.5 | GO:0046854 | phosphatidylinositol phosphorylation(GO:0046854) |
0.0 | 0.1 | GO:2000255 | negative regulation of male germ cell proliferation(GO:2000255) |
0.0 | 0.0 | GO:0051572 | negative regulation of histone H3-K4 methylation(GO:0051572) |
0.0 | 0.3 | GO:0060999 | positive regulation of dendritic spine development(GO:0060999) |
0.0 | 0.1 | GO:0010046 | response to mycotoxin(GO:0010046) |
0.0 | 0.1 | GO:0015817 | histidine transport(GO:0015817) |
0.0 | 0.1 | GO:0006741 | NADP biosynthetic process(GO:0006741) |
0.0 | 0.1 | GO:0050968 | detection of chemical stimulus involved in sensory perception of pain(GO:0050968) |
0.0 | 0.2 | GO:0060278 | regulation of ovulation(GO:0060278) |
0.0 | 0.6 | GO:0006336 | DNA replication-independent nucleosome assembly(GO:0006336) DNA replication-independent nucleosome organization(GO:0034724) |
0.0 | 0.1 | GO:0061153 | trachea submucosa development(GO:0061152) trachea gland development(GO:0061153) |
0.0 | 0.3 | GO:0042474 | middle ear morphogenesis(GO:0042474) |
0.0 | 0.1 | GO:0098904 | regulation of AV node cell action potential(GO:0098904) |
0.0 | 0.2 | GO:0000712 | resolution of meiotic recombination intermediates(GO:0000712) |
0.0 | 0.3 | GO:0071260 | cellular response to mechanical stimulus(GO:0071260) |
0.0 | 0.1 | GO:0018343 | protein farnesylation(GO:0018343) |
0.0 | 0.3 | GO:0097094 | craniofacial suture morphogenesis(GO:0097094) |
0.0 | 0.1 | GO:2000726 | negative regulation of cardiac muscle cell differentiation(GO:2000726) |
0.0 | 0.1 | GO:0046098 | guanine metabolic process(GO:0046098) |
0.0 | 0.1 | GO:0071873 | response to norepinephrine(GO:0071873) |
0.0 | 0.2 | GO:0050916 | sensory perception of sweet taste(GO:0050916) |
0.0 | 0.1 | GO:0001927 | exocyst assembly(GO:0001927) |
0.0 | 0.1 | GO:0046292 | formaldehyde metabolic process(GO:0046292) |
0.0 | 0.0 | GO:0019885 | antigen processing and presentation of endogenous peptide antigen via MHC class I(GO:0019885) |
0.0 | 0.1 | GO:0036112 | medium-chain fatty-acyl-CoA metabolic process(GO:0036112) |
0.0 | 0.1 | GO:0070427 | nucleotide-binding oligomerization domain containing 1 signaling pathway(GO:0070427) |
0.0 | 1.9 | GO:0001578 | microtubule bundle formation(GO:0001578) |
0.0 | 0.2 | GO:0036123 | histone H3-K9 dimethylation(GO:0036123) |
0.0 | 0.1 | GO:0042427 | serotonin biosynthetic process(GO:0042427) primary amino compound biosynthetic process(GO:1901162) |
0.0 | 0.1 | GO:0043353 | enucleate erythrocyte differentiation(GO:0043353) |
0.0 | 0.1 | GO:0001920 | negative regulation of receptor recycling(GO:0001920) |
0.0 | 0.1 | GO:0017183 | peptidyl-diphthamide metabolic process(GO:0017182) peptidyl-diphthamide biosynthetic process from peptidyl-histidine(GO:0017183) |
0.0 | 0.1 | GO:0034650 | cortisol metabolic process(GO:0034650) |
0.0 | 0.1 | GO:0006977 | DNA damage response, signal transduction by p53 class mediator resulting in cell cycle arrest(GO:0006977) |
0.0 | 0.0 | GO:0090230 | regulation of centromere complex assembly(GO:0090230) |
0.0 | 0.3 | GO:0051150 | regulation of smooth muscle cell differentiation(GO:0051150) |
0.0 | 0.1 | GO:0035726 | common myeloid progenitor cell proliferation(GO:0035726) |
0.0 | 0.0 | GO:0034146 | toll-like receptor 5 signaling pathway(GO:0034146) |
0.0 | 0.7 | GO:0045773 | positive regulation of axon extension(GO:0045773) |
0.0 | 0.1 | GO:0051006 | positive regulation of lipoprotein lipase activity(GO:0051006) |
0.0 | 0.0 | GO:0006903 | vesicle targeting(GO:0006903) |
0.0 | 0.0 | GO:0006059 | hexitol metabolic process(GO:0006059) |
0.0 | 0.1 | GO:0021797 | forebrain anterior/posterior pattern specification(GO:0021797) |
0.0 | 0.1 | GO:0021520 | spinal cord motor neuron cell fate specification(GO:0021520) |
0.0 | 0.0 | GO:0071394 | cellular response to testosterone stimulus(GO:0071394) |
0.0 | 0.1 | GO:0090598 | male genitalia morphogenesis(GO:0048808) male anatomical structure morphogenesis(GO:0090598) |
0.0 | 0.1 | GO:2000009 | negative regulation of protein localization to cell surface(GO:2000009) |
0.0 | 0.3 | GO:0031468 | nuclear envelope reassembly(GO:0031468) |
0.0 | 0.6 | GO:0006308 | DNA catabolic process(GO:0006308) |
0.0 | 0.0 | GO:0060157 | urinary bladder development(GO:0060157) |
0.0 | 0.1 | GO:0002318 | myeloid progenitor cell differentiation(GO:0002318) |
0.0 | 0.1 | GO:0032808 | lacrimal gland development(GO:0032808) |
0.0 | 0.1 | GO:0072531 | pyrimidine-containing compound transmembrane transport(GO:0072531) |
0.0 | 0.6 | GO:0018345 | protein palmitoylation(GO:0018345) |
0.0 | 0.0 | GO:0050717 | positive regulation of interleukin-1 alpha secretion(GO:0050717) |
0.0 | 0.1 | GO:0007089 | traversing start control point of mitotic cell cycle(GO:0007089) |
0.0 | 0.1 | GO:0034727 | lysosomal microautophagy(GO:0016237) piecemeal microautophagy of nucleus(GO:0034727) late nucleophagy(GO:0044805) |
0.0 | 0.1 | GO:0032230 | positive regulation of synaptic transmission, GABAergic(GO:0032230) |
0.0 | 0.1 | GO:0050915 | sensory perception of sour taste(GO:0050915) |
0.0 | 0.1 | GO:0007016 | cytoskeletal anchoring at plasma membrane(GO:0007016) |
0.0 | 0.1 | GO:0050965 | detection of temperature stimulus involved in sensory perception(GO:0050961) detection of temperature stimulus involved in sensory perception of pain(GO:0050965) |
0.0 | 0.2 | GO:0033299 | secretion of lysosomal enzymes(GO:0033299) |
0.0 | 0.0 | GO:1900084 | regulation of peptidyl-tyrosine autophosphorylation(GO:1900084) |
0.0 | 0.1 | GO:0007638 | mechanosensory behavior(GO:0007638) |
0.0 | 0.1 | GO:0046543 | development of secondary female sexual characteristics(GO:0046543) |
0.0 | 0.0 | GO:0002091 | negative regulation of receptor internalization(GO:0002091) |
0.0 | 0.1 | GO:0090037 | positive regulation of protein kinase C signaling(GO:0090037) |
0.0 | 0.1 | GO:0046826 | negative regulation of protein export from nucleus(GO:0046826) |
0.0 | 0.0 | GO:0080154 | regulation of fertilization(GO:0080154) |
0.0 | 0.1 | GO:0035964 | COPI-coated vesicle budding(GO:0035964) |
0.0 | 0.1 | GO:0010863 | positive regulation of phospholipase C activity(GO:0010863) |
0.0 | 0.1 | GO:0014075 | response to amphetamine(GO:0001975) response to amine(GO:0014075) |
0.0 | 0.6 | GO:0071300 | cellular response to retinoic acid(GO:0071300) |
0.0 | 0.0 | GO:1901166 | neural crest cell migration involved in autonomic nervous system development(GO:1901166) |
0.0 | 0.1 | GO:0009130 | pyrimidine nucleoside monophosphate biosynthetic process(GO:0009130) |
0.0 | 0.3 | GO:0033147 | negative regulation of intracellular estrogen receptor signaling pathway(GO:0033147) |
0.0 | 0.1 | GO:0009106 | lipoate metabolic process(GO:0009106) |
0.0 | 0.0 | GO:0034350 | regulation of glial cell apoptotic process(GO:0034350) |
0.0 | 0.1 | GO:0050962 | detection of light stimulus involved in visual perception(GO:0050908) detection of light stimulus involved in sensory perception(GO:0050962) |
0.0 | 0.1 | GO:0021563 | glossopharyngeal nerve development(GO:0021563) |
0.0 | 0.1 | GO:0051771 | negative regulation of nitric-oxide synthase biosynthetic process(GO:0051771) |
0.0 | 0.1 | GO:0010032 | meiotic chromosome condensation(GO:0010032) |
0.0 | 0.1 | GO:0051541 | elastin metabolic process(GO:0051541) |
0.0 | 0.0 | GO:2000729 | mesenchymal cell proliferation involved in ureter development(GO:0072198) regulation of mesenchymal cell proliferation involved in ureter development(GO:0072199) positive regulation of mesenchymal cell proliferation involved in ureter development(GO:2000729) |
0.0 | 0.1 | GO:1904690 | regulation of cap-independent translational initiation(GO:1903677) positive regulation of cap-independent translational initiation(GO:1903679) regulation of cytoplasmic translational initiation(GO:1904688) positive regulation of cytoplasmic translational initiation(GO:1904690) |
0.0 | 0.1 | GO:0070673 | response to interleukin-18(GO:0070673) cellular response to interleukin-18(GO:0071351) |
0.0 | 0.1 | GO:0034058 | endosomal vesicle fusion(GO:0034058) |
0.0 | 0.3 | GO:0035116 | embryonic hindlimb morphogenesis(GO:0035116) |
0.0 | 0.5 | GO:0043171 | peptide catabolic process(GO:0043171) |
0.0 | 0.0 | GO:2000504 | positive regulation of blood vessel remodeling(GO:2000504) |
0.0 | 0.0 | GO:0042661 | regulation of mesodermal cell fate specification(GO:0042661) |
0.0 | 0.0 | GO:0007195 | adenylate cyclase-inhibiting dopamine receptor signaling pathway(GO:0007195) |
0.0 | 0.1 | GO:0002017 | regulation of blood volume by renal aldosterone(GO:0002017) |
0.0 | 0.1 | GO:0006573 | valine metabolic process(GO:0006573) |
0.0 | 0.3 | GO:0000188 | inactivation of MAPK activity(GO:0000188) |
0.0 | 0.2 | GO:0046146 | tetrahydrobiopterin metabolic process(GO:0046146) |
0.0 | 0.1 | GO:0035810 | positive regulation of urine volume(GO:0035810) |
0.0 | 0.3 | GO:0001967 | suckling behavior(GO:0001967) |
0.0 | 0.1 | GO:0036151 | phosphatidylcholine acyl-chain remodeling(GO:0036151) |
0.0 | 0.1 | GO:0043091 | L-arginine import(GO:0043091) arginine import(GO:0090467) L-arginine transport(GO:1902023) |
0.0 | 0.1 | GO:0060763 | mammary duct terminal end bud growth(GO:0060763) |
0.0 | 0.1 | GO:0009092 | homoserine metabolic process(GO:0009092) transsulfuration(GO:0019346) |
0.0 | 0.3 | GO:0060441 | epithelial tube branching involved in lung morphogenesis(GO:0060441) |
0.0 | 0.1 | GO:0002317 | plasma cell differentiation(GO:0002317) |
0.0 | 0.1 | GO:0035414 | negative regulation of catenin import into nucleus(GO:0035414) |
0.0 | 0.1 | GO:0035627 | ceramide transport(GO:0035627) |
0.0 | 0.1 | GO:0048739 | cardiac muscle fiber development(GO:0048739) |
0.0 | 0.1 | GO:0006680 | glucosylceramide catabolic process(GO:0006680) |
0.0 | 0.0 | GO:0046865 | retinol transport(GO:0034633) isoprenoid transport(GO:0046864) terpenoid transport(GO:0046865) |
0.0 | 0.1 | GO:0008295 | spermidine biosynthetic process(GO:0008295) |
0.0 | 0.1 | GO:0061050 | regulation of cell growth involved in cardiac muscle cell development(GO:0061050) |
0.0 | 0.0 | GO:0061047 | positive regulation of branching involved in lung morphogenesis(GO:0061047) |
0.0 | 0.2 | GO:0010829 | negative regulation of glucose transport(GO:0010829) |
0.0 | 0.0 | GO:0045091 | regulation of single stranded viral RNA replication via double stranded DNA intermediate(GO:0045091) |
0.0 | 0.6 | GO:0046839 | phospholipid dephosphorylation(GO:0046839) |
0.0 | 0.1 | GO:0015074 | DNA integration(GO:0015074) |
0.0 | 1.0 | GO:0007566 | embryo implantation(GO:0007566) |
0.0 | 0.1 | GO:0014049 | positive regulation of glutamate secretion(GO:0014049) |
0.0 | 0.1 | GO:0035935 | androgen secretion(GO:0035935) regulation of androgen secretion(GO:2000834) positive regulation of androgen secretion(GO:2000836) |
0.0 | 0.1 | GO:0060347 | heart trabecula formation(GO:0060347) |
0.0 | 1.3 | GO:0090630 | activation of GTPase activity(GO:0090630) |
0.0 | 0.0 | GO:0048715 | negative regulation of oligodendrocyte differentiation(GO:0048715) |
0.0 | 0.2 | GO:0001504 | neurotransmitter uptake(GO:0001504) |
0.0 | 0.2 | GO:0051044 | positive regulation of membrane protein ectodomain proteolysis(GO:0051044) |
0.0 | 0.0 | GO:0010989 | negative regulation of low-density lipoprotein particle clearance(GO:0010989) |
0.0 | 0.1 | GO:0030828 | positive regulation of cGMP biosynthetic process(GO:0030828) |
0.0 | 0.0 | GO:0008354 | germ cell migration(GO:0008354) |
0.0 | 0.1 | GO:0034239 | regulation of macrophage fusion(GO:0034239) |
0.0 | 0.0 | GO:1904016 | response to Thyroglobulin triiodothyronine(GO:1904016) cellular response to Thyroglobulin triiodothyronine(GO:1904017) |
0.0 | 0.1 | GO:1902410 | mitotic cytokinetic process(GO:1902410) |
0.0 | 0.1 | GO:1901029 | negative regulation of mitochondrial outer membrane permeabilization involved in apoptotic signaling pathway(GO:1901029) |
0.0 | 1.1 | GO:0048704 | embryonic skeletal system morphogenesis(GO:0048704) |
0.0 | 0.0 | GO:0072540 | T-helper 17 cell lineage commitment(GO:0072540) |
0.0 | 0.1 | GO:0043589 | skin morphogenesis(GO:0043589) |
0.0 | 0.1 | GO:0060346 | bone trabecula formation(GO:0060346) |
0.0 | 0.4 | GO:0043001 | Golgi to plasma membrane protein transport(GO:0043001) |
0.0 | 0.2 | GO:1903140 | regulation of endothelial cell development(GO:1901550) regulation of establishment of endothelial barrier(GO:1903140) |
0.0 | 0.1 | GO:0097411 | hypoxia-inducible factor-1alpha signaling pathway(GO:0097411) |
0.0 | 0.0 | GO:0006901 | vesicle coating(GO:0006901) vesicle targeting, rough ER to cis-Golgi(GO:0048207) COPII vesicle coating(GO:0048208) |
0.0 | 0.1 | GO:0035524 | proline transmembrane transport(GO:0035524) |
0.0 | 0.9 | GO:0003073 | regulation of systemic arterial blood pressure(GO:0003073) |
0.0 | 0.0 | GO:0032079 | positive regulation of endodeoxyribonuclease activity(GO:0032079) |
0.0 | 0.1 | GO:0000733 | DNA strand renaturation(GO:0000733) |
0.0 | 0.0 | GO:0002074 | extraocular skeletal muscle development(GO:0002074) |
0.0 | 0.3 | GO:0005980 | glycogen catabolic process(GO:0005980) glucan catabolic process(GO:0009251) cellular polysaccharide catabolic process(GO:0044247) |
0.0 | 0.0 | GO:0038095 | Fc-epsilon receptor signaling pathway(GO:0038095) |
0.0 | 0.0 | GO:0021546 | rhombomere development(GO:0021546) |
0.0 | 0.0 | GO:0061000 | negative regulation of dendritic spine development(GO:0061000) |
0.0 | 0.6 | GO:0006892 | post-Golgi vesicle-mediated transport(GO:0006892) |
0.0 | 0.0 | GO:0034134 | toll-like receptor 2 signaling pathway(GO:0034134) |
0.0 | 0.1 | GO:0031848 | protection from non-homologous end joining at telomere(GO:0031848) |
0.0 | 0.0 | GO:0007199 | G-protein coupled receptor signaling pathway coupled to cGMP nucleotide second messenger(GO:0007199) |
0.0 | 0.2 | GO:2000311 | regulation of alpha-amino-3-hydroxy-5-methyl-4-isoxazole propionate selective glutamate receptor activity(GO:2000311) |
0.0 | 0.1 | GO:0018002 | N-terminal peptidyl-serine acetylation(GO:0017198) N-terminal peptidyl-glutamic acid acetylation(GO:0018002) peptidyl-serine acetylation(GO:0030920) |
0.0 | 0.1 | GO:0000972 | transcription-dependent tethering of RNA polymerase II gene DNA at nuclear periphery(GO:0000972) |
0.0 | 0.0 | GO:0060766 | negative regulation of androgen receptor signaling pathway(GO:0060766) |
0.0 | 0.0 | GO:0003149 | membranous septum morphogenesis(GO:0003149) |
0.0 | 0.1 | GO:0060012 | synaptic transmission, glycinergic(GO:0060012) |
0.0 | 0.6 | GO:0042462 | eye photoreceptor cell development(GO:0042462) |
0.0 | 0.1 | GO:0030575 | nuclear body organization(GO:0030575) |
0.0 | 0.1 | GO:0002426 | immunoglobulin production in mucosal tissue(GO:0002426) |
0.0 | 0.1 | GO:0034776 | response to histamine(GO:0034776) cellular response to histamine(GO:0071420) |
0.0 | 0.0 | GO:1902403 | signal transduction involved in mitotic cell cycle checkpoint(GO:0072413) signal transduction involved in mitotic DNA damage checkpoint(GO:1902402) signal transduction involved in mitotic DNA integrity checkpoint(GO:1902403) |
0.0 | 0.2 | GO:0045672 | positive regulation of osteoclast differentiation(GO:0045672) |
0.0 | 0.1 | GO:0030647 | polyketide metabolic process(GO:0030638) aminoglycoside antibiotic metabolic process(GO:0030647) daunorubicin metabolic process(GO:0044597) doxorubicin metabolic process(GO:0044598) |
0.0 | 0.0 | GO:0072395 | signal transduction involved in cell cycle checkpoint(GO:0072395) signal transduction involved in DNA integrity checkpoint(GO:0072401) signal transduction involved in DNA damage checkpoint(GO:0072422) |
0.0 | 0.0 | GO:0046100 | hypoxanthine metabolic process(GO:0046100) hypoxanthine biosynthetic process(GO:0046101) |
0.0 | 0.1 | GO:0000042 | protein targeting to Golgi(GO:0000042) |
0.0 | 0.3 | GO:0035329 | hippo signaling(GO:0035329) |
0.0 | 0.0 | GO:0018894 | dibenzo-p-dioxin metabolic process(GO:0018894) |
0.0 | 0.0 | GO:0010536 | positive regulation of activation of Janus kinase activity(GO:0010536) |
0.0 | 0.1 | GO:0071169 | establishment of protein localization to chromatin(GO:0071169) |
0.0 | 0.1 | GO:1902969 | mitotic DNA replication(GO:1902969) |
0.0 | 0.0 | GO:0019230 | proprioception(GO:0019230) |
0.0 | 0.1 | GO:0072718 | response to cisplatin(GO:0072718) |
0.0 | 0.1 | GO:0032049 | cardiolipin biosynthetic process(GO:0032049) |
0.0 | 0.2 | GO:0043552 | positive regulation of phosphatidylinositol 3-kinase activity(GO:0043552) |
0.0 | 0.0 | GO:0006534 | cysteine metabolic process(GO:0006534) |
0.0 | 0.0 | GO:2000598 | regulation of cyclin catabolic process(GO:2000598) negative regulation of cyclin catabolic process(GO:2000599) |
0.0 | 0.1 | GO:1904154 | positive regulation of retrograde protein transport, ER to cytosol(GO:1904154) |
0.0 | 0.5 | GO:0043252 | sodium-independent organic anion transport(GO:0043252) |
0.0 | 0.1 | GO:1901407 | regulation of phosphorylation of RNA polymerase II C-terminal domain(GO:1901407) positive regulation of phosphorylation of RNA polymerase II C-terminal domain(GO:1901409) |
0.0 | 0.0 | GO:1900038 | negative regulation of cellular response to hypoxia(GO:1900038) |
0.0 | 0.1 | GO:0022010 | central nervous system myelination(GO:0022010) axon ensheathment in central nervous system(GO:0032291) |
0.0 | 0.0 | GO:0031860 | telomeric 3' overhang formation(GO:0031860) |
0.0 | 0.1 | GO:0016255 | attachment of GPI anchor to protein(GO:0016255) |
0.0 | 0.2 | GO:0097576 | vacuole fusion(GO:0097576) |
0.0 | 0.1 | GO:0046686 | response to cadmium ion(GO:0046686) |
0.0 | 0.0 | GO:0002315 | marginal zone B cell differentiation(GO:0002315) |
0.0 | 0.0 | GO:0009436 | glyoxylate catabolic process(GO:0009436) |
0.0 | 0.2 | GO:0070935 | 3'-UTR-mediated mRNA stabilization(GO:0070935) |
0.0 | 0.1 | GO:0033169 | histone H3-K9 demethylation(GO:0033169) |
0.0 | 0.1 | GO:0060743 | epithelial cell maturation involved in prostate gland development(GO:0060743) |
0.0 | 0.1 | GO:0030327 | prenylated protein catabolic process(GO:0030327) |
0.0 | 0.0 | GO:0007191 | adenylate cyclase-activating dopamine receptor signaling pathway(GO:0007191) |
0.0 | 0.0 | GO:0021940 | positive regulation of cerebellar granule cell precursor proliferation(GO:0021940) |
0.0 | 0.0 | GO:0002314 | germinal center B cell differentiation(GO:0002314) |
0.0 | 0.4 | GO:0045599 | negative regulation of fat cell differentiation(GO:0045599) |
0.0 | 0.0 | GO:0045110 | intermediate filament bundle assembly(GO:0045110) |
0.0 | 0.0 | GO:0006990 | positive regulation of transcription from RNA polymerase II promoter involved in unfolded protein response(GO:0006990) |
0.0 | 0.0 | GO:0007223 | Wnt signaling pathway, calcium modulating pathway(GO:0007223) |
0.0 | 0.1 | GO:0030167 | proteoglycan catabolic process(GO:0030167) |
0.0 | 0.0 | GO:0036120 | cellular response to platelet-derived growth factor stimulus(GO:0036120) |
0.0 | 0.0 | GO:0006624 | vacuolar protein processing(GO:0006624) |
0.0 | 0.1 | GO:2000676 | positive regulation of type B pancreatic cell apoptotic process(GO:2000676) |
0.0 | 0.1 | GO:0045654 | positive regulation of megakaryocyte differentiation(GO:0045654) |
0.0 | 0.4 | GO:0048286 | lung alveolus development(GO:0048286) |
0.0 | 0.1 | GO:0043508 | negative regulation of JUN kinase activity(GO:0043508) |
0.0 | 0.1 | GO:0009128 | purine nucleoside monophosphate catabolic process(GO:0009128) |
0.0 | 0.1 | GO:0006177 | GMP biosynthetic process(GO:0006177) |
0.0 | 0.1 | GO:0048671 | negative regulation of collateral sprouting(GO:0048671) |
0.0 | 0.1 | GO:0071139 | resolution of recombination intermediates(GO:0071139) |
0.0 | 0.0 | GO:0003340 | negative regulation of mesenchymal to epithelial transition involved in metanephros morphogenesis(GO:0003340) |
0.0 | 1.3 | GO:0006836 | neurotransmitter transport(GO:0006836) |
0.0 | 0.0 | GO:2000310 | regulation of N-methyl-D-aspartate selective glutamate receptor activity(GO:2000310) |
0.0 | 1.0 | GO:0019882 | antigen processing and presentation(GO:0019882) |
0.0 | 0.1 | GO:0033132 | negative regulation of glucokinase activity(GO:0033132) negative regulation of hexokinase activity(GO:1903300) |
0.0 | 0.0 | GO:0007525 | somatic muscle development(GO:0007525) |
0.0 | 0.0 | GO:0045852 | pH elevation(GO:0045852) intracellular pH elevation(GO:0051454) |
0.0 | 0.1 | GO:0061589 | calcium activated phosphatidylserine scrambling(GO:0061589) |
0.0 | 0.0 | GO:0035633 | maintenance of blood-brain barrier(GO:0035633) |
0.0 | 0.1 | GO:0060081 | membrane hyperpolarization(GO:0060081) |
0.0 | 0.1 | GO:0014047 | glutamate secretion(GO:0014047) |
0.0 | 0.1 | GO:2000786 | positive regulation of autophagosome assembly(GO:2000786) |
0.0 | 0.0 | GO:2001185 | regulation of CD8-positive, alpha-beta T cell activation(GO:2001185) |
0.0 | 0.1 | GO:0060033 | anatomical structure regression(GO:0060033) |
0.0 | 0.0 | GO:0090091 | positive regulation of extracellular matrix disassembly(GO:0090091) |
0.0 | 0.3 | GO:0031648 | protein destabilization(GO:0031648) |
0.0 | 0.1 | GO:0001561 | fatty acid alpha-oxidation(GO:0001561) |
0.0 | 0.1 | GO:0006501 | C-terminal protein lipidation(GO:0006501) |
0.0 | 0.0 | GO:0060751 | branch elongation involved in mammary gland duct branching(GO:0060751) |
0.0 | 0.0 | GO:0060266 | negative regulation of respiratory burst involved in inflammatory response(GO:0060266) |
0.0 | 0.0 | GO:0072053 | renal inner medulla development(GO:0072053) |
0.0 | 0.0 | GO:1903012 | positive regulation of bone development(GO:1903012) |
0.0 | 0.1 | GO:0042989 | sequestering of actin monomers(GO:0042989) |
0.0 | 1.0 | GO:0030705 | cytoskeleton-dependent intracellular transport(GO:0030705) |
0.0 | 0.1 | GO:1903859 | regulation of dendrite extension(GO:1903859) positive regulation of dendrite extension(GO:1903861) |
0.0 | 0.0 | GO:0097029 | mature conventional dendritic cell differentiation(GO:0097029) |
0.0 | 0.1 | GO:0016486 | peptide hormone processing(GO:0016486) |
0.0 | 0.0 | GO:0060011 | Sertoli cell proliferation(GO:0060011) |
0.0 | 0.0 | GO:0000715 | nucleotide-excision repair, DNA damage recognition(GO:0000715) |
0.0 | 0.0 | GO:0031296 | B cell costimulation(GO:0031296) |
0.0 | 0.6 | GO:0030317 | sperm motility(GO:0030317) |
0.0 | 0.0 | GO:0030241 | skeletal muscle myosin thick filament assembly(GO:0030241) striated muscle myosin thick filament assembly(GO:0071688) |
0.0 | 0.0 | GO:0014807 | regulation of somitogenesis(GO:0014807) |
0.0 | 0.0 | GO:2001028 | positive regulation of endothelial cell chemotaxis(GO:2001028) |
0.0 | 0.0 | GO:0034638 | phosphatidylcholine catabolic process(GO:0034638) |
0.0 | 0.0 | GO:0046607 | positive regulation of centrosome cycle(GO:0046607) |
0.0 | 0.0 | GO:0006776 | vitamin A metabolic process(GO:0006776) |
0.0 | 0.0 | GO:0008212 | mineralocorticoid metabolic process(GO:0008212) |
0.0 | 0.0 | GO:0007290 | spermatid nucleus elongation(GO:0007290) |
0.0 | 0.1 | GO:0010718 | positive regulation of epithelial to mesenchymal transition(GO:0010718) |
0.0 | 0.0 | GO:0002036 | regulation of L-glutamate transport(GO:0002036) |
0.0 | 0.0 | GO:2000810 | regulation of bicellular tight junction assembly(GO:2000810) |
0.0 | 0.0 | GO:0042091 | interleukin-10 biosynthetic process(GO:0042091) regulation of interleukin-10 biosynthetic process(GO:0045074) |
0.0 | 0.1 | GO:0090161 | Golgi ribbon formation(GO:0090161) |
0.0 | 0.0 | GO:0051665 | membrane raft localization(GO:0051665) |
0.0 | 0.1 | GO:0006122 | mitochondrial electron transport, ubiquinol to cytochrome c(GO:0006122) |
0.0 | 0.1 | GO:0035357 | peroxisome proliferator activated receptor signaling pathway(GO:0035357) |
0.0 | 0.0 | GO:0036462 | TRAIL-activated apoptotic signaling pathway(GO:0036462) |
0.0 | 0.0 | GO:0031936 | negative regulation of chromatin silencing(GO:0031936) |
0.0 | 0.0 | GO:0014866 | skeletal myofibril assembly(GO:0014866) |
0.0 | 0.0 | GO:0010566 | regulation of ketone biosynthetic process(GO:0010566) |
0.0 | 0.0 | GO:0048069 | eye pigmentation(GO:0048069) |
0.0 | 0.1 | GO:0006020 | inositol metabolic process(GO:0006020) |
0.0 | 0.1 | GO:0007253 | cytoplasmic sequestering of NF-kappaB(GO:0007253) |
0.0 | 0.0 | GO:0002331 | pre-B cell allelic exclusion(GO:0002331) |
0.0 | 0.1 | GO:0010592 | positive regulation of lamellipodium assembly(GO:0010592) |
0.0 | 0.1 | GO:0051444 | negative regulation of ubiquitin-protein transferase activity(GO:0051444) |
0.0 | 0.0 | GO:0050884 | neuromuscular process controlling posture(GO:0050884) |
0.0 | 0.1 | GO:0044065 | regulation of respiratory system process(GO:0044065) |
0.0 | 0.1 | GO:0030206 | chondroitin sulfate biosynthetic process(GO:0030206) |
0.0 | 0.0 | GO:0031087 | nuclear-transcribed mRNA catabolic process, deadenylation-independent decay(GO:0031086) deadenylation-independent decapping of nuclear-transcribed mRNA(GO:0031087) |
0.0 | 0.1 | GO:0021511 | spinal cord patterning(GO:0021511) |
0.0 | 0.0 | GO:1903546 | protein localization to photoreceptor outer segment(GO:1903546) |
0.0 | 0.0 | GO:0051182 | coenzyme transport(GO:0051182) |
0.0 | 0.0 | GO:0033690 | positive regulation of osteoblast proliferation(GO:0033690) |
0.0 | 0.0 | GO:2000427 | positive regulation of apoptotic cell clearance(GO:2000427) |
0.0 | 0.7 | GO:0048015 | phosphatidylinositol-mediated signaling(GO:0048015) |
0.0 | 0.1 | GO:0007144 | female meiosis I(GO:0007144) |
0.0 | 0.0 | GO:0072061 | inner medullary collecting duct development(GO:0072061) |
0.0 | 0.4 | GO:0032091 | negative regulation of protein binding(GO:0032091) |
0.0 | 0.0 | GO:2001170 | negative regulation of ATP biosynthetic process(GO:2001170) |
0.0 | 0.0 | GO:0045415 | negative regulation of interleukin-8 biosynthetic process(GO:0045415) |
0.0 | 0.0 | GO:0046167 | glycerol-3-phosphate biosynthetic process(GO:0046167) |
0.0 | 0.4 | GO:0042147 | retrograde transport, endosome to Golgi(GO:0042147) |
0.0 | 0.0 | GO:2000095 | regulation of Wnt signaling pathway, planar cell polarity pathway(GO:2000095) |
0.0 | 0.1 | GO:1904659 | glucose transmembrane transport(GO:1904659) |
0.0 | 0.0 | GO:0002765 | immune response-inhibiting signal transduction(GO:0002765) |
0.0 | 0.0 | GO:0045113 | regulation of integrin biosynthetic process(GO:0045113) |
0.0 | 0.1 | GO:0048305 | immunoglobulin secretion(GO:0048305) |
0.0 | 0.0 | GO:0055003 | cardiac myofibril assembly(GO:0055003) |
0.0 | 0.0 | GO:0044337 | canonical Wnt signaling pathway involved in positive regulation of apoptotic process(GO:0044337) |
0.0 | 0.0 | GO:0042222 | interleukin-1 biosynthetic process(GO:0042222) |
0.0 | 0.0 | GO:0072530 | purine nucleoside transmembrane transport(GO:0015860) purine-containing compound transmembrane transport(GO:0072530) nucleoside transmembrane transport(GO:1901642) |
0.0 | 0.0 | GO:0090135 | actin filament branching(GO:0090135) |
0.0 | 0.2 | GO:0048714 | positive regulation of oligodendrocyte differentiation(GO:0048714) |
0.0 | 0.0 | GO:0002678 | positive regulation of chronic inflammatory response(GO:0002678) |
0.0 | 0.0 | GO:0002063 | chondrocyte development(GO:0002063) |
0.0 | 0.0 | GO:0090071 | negative regulation of ribosome biogenesis(GO:0090071) |
0.0 | 0.0 | GO:0048670 | regulation of collateral sprouting(GO:0048670) |
0.0 | 0.0 | GO:0032196 | transposition(GO:0032196) |
0.0 | 0.0 | GO:0003416 | endochondral bone growth(GO:0003416) |
0.0 | 0.0 | GO:1900020 | regulation of protein kinase C activity(GO:1900019) positive regulation of protein kinase C activity(GO:1900020) |
0.0 | 0.1 | GO:0001964 | startle response(GO:0001964) |
0.0 | 0.1 | GO:0031954 | positive regulation of protein autophosphorylation(GO:0031954) |
0.0 | 0.1 | GO:0031119 | tRNA pseudouridine synthesis(GO:0031119) |
0.0 | 0.1 | GO:0042572 | retinol metabolic process(GO:0042572) |
0.0 | 0.3 | GO:0007612 | learning(GO:0007612) |
0.0 | 0.1 | GO:0009081 | branched-chain amino acid metabolic process(GO:0009081) |
0.0 | 0.0 | GO:0045875 | negative regulation of sister chromatid cohesion(GO:0045875) |
0.0 | 0.0 | GO:0071638 | negative regulation of monocyte chemotactic protein-1 production(GO:0071638) |
0.0 | 0.1 | GO:0001755 | neural crest cell migration(GO:0001755) |
0.0 | 0.1 | GO:0048662 | negative regulation of smooth muscle cell proliferation(GO:0048662) |
0.0 | 0.0 | GO:0050861 | positive regulation of B cell receptor signaling pathway(GO:0050861) |
0.0 | 0.1 | GO:1900017 | positive regulation of cytokine production involved in inflammatory response(GO:1900017) |
0.0 | 0.0 | GO:1903975 | regulation of glial cell migration(GO:1903975) |
0.0 | 0.0 | GO:0071435 | potassium ion export(GO:0071435) |
0.0 | 0.0 | GO:0016584 | nucleosome positioning(GO:0016584) |
0.0 | 0.0 | GO:0070278 | extracellular matrix constituent secretion(GO:0070278) |
0.0 | 0.0 | GO:0071731 | response to nitric oxide(GO:0071731) |
0.0 | 0.0 | GO:0001714 | endodermal cell fate specification(GO:0001714) |
0.0 | 0.1 | GO:0048240 | sperm capacitation(GO:0048240) |
0.0 | 0.0 | GO:0006772 | thiamine metabolic process(GO:0006772) thiamine-containing compound metabolic process(GO:0042723) |
0.0 | 0.0 | GO:0032483 | regulation of Rab protein signal transduction(GO:0032483) |
0.0 | 0.0 | GO:0035434 | copper ion transmembrane transport(GO:0035434) |
0.0 | 0.0 | GO:0070268 | cornification(GO:0070268) |
0.0 | 0.0 | GO:0070100 | regulation of chemokine-mediated signaling pathway(GO:0070099) negative regulation of chemokine-mediated signaling pathway(GO:0070100) |
0.0 | 0.1 | GO:0045589 | regulation of regulatory T cell differentiation(GO:0045589) |
0.0 | 0.0 | GO:0021891 | olfactory bulb interneuron development(GO:0021891) |
0.0 | 0.0 | GO:0035262 | gonad morphogenesis(GO:0035262) |
0.0 | 0.1 | GO:0051601 | exocyst localization(GO:0051601) |
0.0 | 0.2 | GO:0043046 | DNA methylation involved in gamete generation(GO:0043046) |
0.0 | 0.1 | GO:0003016 | respiratory system process(GO:0003016) |
0.0 | 0.1 | GO:0034244 | negative regulation of transcription elongation from RNA polymerase II promoter(GO:0034244) |
0.0 | 0.1 | GO:0043567 | regulation of insulin-like growth factor receptor signaling pathway(GO:0043567) |
0.0 | 0.0 | GO:1902445 | regulation of mitochondrial membrane permeability involved in programmed necrotic cell death(GO:1902445) |
0.0 | 0.0 | GO:0002374 | cytokine secretion involved in immune response(GO:0002374) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
1.2 | 10.7 | GO:0042613 | MHC class II protein complex(GO:0042613) |
0.8 | 5.6 | GO:0032584 | growth cone membrane(GO:0032584) |
0.7 | 3.5 | GO:0033093 | Weibel-Palade body(GO:0033093) |
0.6 | 8.3 | GO:0042611 | MHC protein complex(GO:0042611) |
0.4 | 2.2 | GO:1990111 | spermatoproteasome complex(GO:1990111) |
0.4 | 1.3 | GO:1990357 | terminal web(GO:1990357) |
0.4 | 1.7 | GO:1990716 | axonemal central apparatus(GO:1990716) |
0.4 | 4.1 | GO:0044224 | juxtaparanode region of axon(GO:0044224) |
0.4 | 1.1 | GO:0031074 | nucleocytoplasmic shuttling complex(GO:0031074) |
0.3 | 4.4 | GO:0030877 | beta-catenin destruction complex(GO:0030877) |
0.3 | 1.0 | GO:0005608 | laminin-3 complex(GO:0005608) |
0.3 | 2.2 | GO:0030991 | intraciliary transport particle A(GO:0030991) |
0.3 | 5.0 | GO:1902711 | GABA receptor complex(GO:1902710) GABA-A receptor complex(GO:1902711) |
0.3 | 1.1 | GO:0042583 | chromaffin granule(GO:0042583) |
0.3 | 2.9 | GO:0000346 | transcription export complex(GO:0000346) |
0.2 | 0.7 | GO:0034274 | Atg12-Atg5-Atg16 complex(GO:0034274) |
0.2 | 0.7 | GO:0072534 | perineuronal net(GO:0072534) |
0.2 | 1.9 | GO:0070852 | cell body fiber(GO:0070852) |
0.2 | 3.2 | GO:0000159 | protein phosphatase type 2A complex(GO:0000159) |
0.2 | 0.6 | GO:0043293 | apoptosome(GO:0043293) |
0.2 | 1.1 | GO:0016012 | sarcoglycan complex(GO:0016012) |
0.2 | 9.0 | GO:0098878 | ionotropic glutamate receptor complex(GO:0008328) neurotransmitter receptor complex(GO:0098878) |
0.2 | 0.6 | GO:0097648 | G-protein coupled receptor dimeric complex(GO:0038037) G-protein coupled receptor complex(GO:0097648) |
0.2 | 0.7 | GO:0042825 | TAP complex(GO:0042825) |
0.2 | 0.7 | GO:0045298 | tubulin complex(GO:0045298) |
0.2 | 2.0 | GO:0043194 | axon initial segment(GO:0043194) |
0.2 | 1.5 | GO:0005641 | nuclear envelope lumen(GO:0005641) |
0.1 | 1.0 | GO:0070971 | endoplasmic reticulum exit site(GO:0070971) |
0.1 | 0.6 | GO:0016942 | insulin-like growth factor binding protein complex(GO:0016942) growth factor complex(GO:0036454) insulin-like growth factor ternary complex(GO:0042567) |
0.1 | 0.7 | GO:0043083 | synaptic cleft(GO:0043083) |
0.1 | 1.9 | GO:0071565 | nBAF complex(GO:0071565) |
0.1 | 0.9 | GO:0005883 | neurofilament(GO:0005883) |
0.1 | 1.8 | GO:0043205 | fibril(GO:0043205) |
0.1 | 0.6 | GO:0045098 | type III intermediate filament(GO:0045098) |
0.1 | 2.5 | GO:0031594 | neuromuscular junction(GO:0031594) |
0.1 | 1.0 | GO:0035253 | ciliary rootlet(GO:0035253) |
0.1 | 0.3 | GO:0008275 | gamma-tubulin small complex(GO:0008275) |
0.1 | 5.7 | GO:0030315 | T-tubule(GO:0030315) |
0.1 | 0.1 | GO:0031092 | platelet alpha granule membrane(GO:0031092) |
0.1 | 0.4 | GO:0044316 | cone cell pedicle(GO:0044316) |
0.1 | 1.0 | GO:0032045 | guanyl-nucleotide exchange factor complex(GO:0032045) |
0.1 | 1.9 | GO:0045334 | clathrin-coated endocytic vesicle(GO:0045334) |
0.1 | 0.3 | GO:1990393 | 3M complex(GO:1990393) |
0.1 | 1.0 | GO:0032433 | filopodium tip(GO:0032433) |
0.1 | 0.8 | GO:0030061 | mitochondrial crista(GO:0030061) |
0.1 | 0.2 | GO:0090661 | box H/ACA telomerase RNP complex(GO:0090661) |
0.1 | 0.3 | GO:0044300 | cerebellar mossy fiber(GO:0044300) |
0.1 | 1.1 | GO:0043034 | costamere(GO:0043034) |
0.1 | 0.3 | GO:0033268 | node of Ranvier(GO:0033268) |
0.1 | 0.6 | GO:0000808 | origin recognition complex(GO:0000808) nuclear origin of replication recognition complex(GO:0005664) |
0.1 | 2.2 | GO:0008305 | integrin complex(GO:0008305) |
0.1 | 0.2 | GO:0097487 | multivesicular body, internal vesicle(GO:0097487) |
0.1 | 0.3 | GO:0034363 | intermediate-density lipoprotein particle(GO:0034363) |
0.1 | 0.2 | GO:0070939 | Dsl1p complex(GO:0070939) |
0.1 | 0.4 | GO:0098563 | integral component of synaptic vesicle membrane(GO:0030285) intrinsic component of synaptic vesicle membrane(GO:0098563) |
0.1 | 3.2 | GO:0005871 | kinesin complex(GO:0005871) |
0.1 | 1.2 | GO:0032588 | trans-Golgi network membrane(GO:0032588) |
0.1 | 0.2 | GO:0044308 | axonal spine(GO:0044308) |
0.1 | 0.4 | GO:0033263 | CORVET complex(GO:0033263) |
0.1 | 0.4 | GO:0070419 | nonhomologous end joining complex(GO:0070419) |
0.1 | 0.2 | GO:1990851 | Wnt-Frizzled-LRP5/6 complex(GO:1990851) |
0.1 | 1.3 | GO:0048786 | presynaptic active zone(GO:0048786) |
0.1 | 0.4 | GO:0070187 | telosome(GO:0070187) |
0.1 | 0.3 | GO:0005890 | sodium:potassium-exchanging ATPase complex(GO:0005890) |
0.1 | 1.5 | GO:0099501 | synaptic vesicle membrane(GO:0030672) exocytic vesicle membrane(GO:0099501) |
0.1 | 0.4 | GO:0042627 | chylomicron(GO:0042627) |
0.1 | 0.2 | GO:0042585 | germinal vesicle(GO:0042585) |
0.1 | 0.3 | GO:0019907 | cyclin-dependent protein kinase activating kinase holoenzyme complex(GO:0019907) |
0.1 | 0.2 | GO:0005956 | protein kinase CK2 complex(GO:0005956) |
0.1 | 0.3 | GO:0000439 | core TFIIH complex(GO:0000439) |
0.1 | 0.4 | GO:0072669 | tRNA-splicing ligase complex(GO:0072669) |
0.1 | 0.2 | GO:0043527 | tRNA methyltransferase complex(GO:0043527) |
0.1 | 0.8 | GO:0005614 | interstitial matrix(GO:0005614) |
0.0 | 2.9 | GO:0042383 | sarcolemma(GO:0042383) |
0.0 | 0.0 | GO:0032133 | chromosome passenger complex(GO:0032133) |
0.0 | 0.1 | GO:0070110 | ciliary neurotrophic factor receptor complex(GO:0070110) |
0.0 | 0.9 | GO:0005868 | cytoplasmic dynein complex(GO:0005868) |
0.0 | 2.9 | GO:0008076 | voltage-gated potassium channel complex(GO:0008076) |
0.0 | 0.4 | GO:0016600 | flotillin complex(GO:0016600) |
0.0 | 1.1 | GO:0005865 | striated muscle thin filament(GO:0005865) |
0.0 | 0.4 | GO:0044298 | cell body membrane(GO:0044298) |
0.0 | 0.0 | GO:0090533 | cation-transporting ATPase complex(GO:0090533) |
0.0 | 0.5 | GO:0005583 | fibrillar collagen trimer(GO:0005583) banded collagen fibril(GO:0098643) |
0.0 | 0.1 | GO:0016342 | catenin complex(GO:0016342) |
0.0 | 0.1 | GO:0071942 | XPC complex(GO:0071942) |
0.0 | 0.4 | GO:0072546 | ER membrane protein complex(GO:0072546) |
0.0 | 5.4 | GO:0031225 | anchored component of membrane(GO:0031225) |
0.0 | 0.5 | GO:0097038 | perinuclear endoplasmic reticulum(GO:0097038) |
0.0 | 0.2 | GO:0072687 | meiotic spindle(GO:0072687) |
0.0 | 0.1 | GO:0005712 | chiasma(GO:0005712) |
0.0 | 0.2 | GO:0042629 | mast cell granule(GO:0042629) |
0.0 | 0.6 | GO:0016327 | apicolateral plasma membrane(GO:0016327) |
0.0 | 0.1 | GO:0033185 | dolichol-phosphate-mannose synthase complex(GO:0033185) |
0.0 | 0.1 | GO:0008091 | spectrin(GO:0008091) |
0.0 | 5.1 | GO:0045211 | postsynaptic membrane(GO:0045211) |
0.0 | 0.2 | GO:0005851 | eukaryotic translation initiation factor 2B complex(GO:0005851) |
0.0 | 0.2 | GO:0071547 | piP-body(GO:0071547) |
0.0 | 0.9 | GO:0008180 | COP9 signalosome(GO:0008180) |
0.0 | 0.2 | GO:0036057 | filtration diaphragm(GO:0036056) slit diaphragm(GO:0036057) |
0.0 | 0.4 | GO:0035631 | CD40 receptor complex(GO:0035631) |
0.0 | 0.1 | GO:0005945 | 6-phosphofructokinase complex(GO:0005945) |
0.0 | 0.2 | GO:0016461 | unconventional myosin complex(GO:0016461) |
0.0 | 1.3 | GO:0005913 | cell-cell adherens junction(GO:0005913) |
0.0 | 0.2 | GO:0031501 | mannosyltransferase complex(GO:0031501) |
0.0 | 0.3 | GO:0031512 | motile primary cilium(GO:0031512) |
0.0 | 0.2 | GO:0090571 | RNA polymerase II transcription repressor complex(GO:0090571) |
0.0 | 0.5 | GO:0042734 | presynaptic membrane(GO:0042734) |
0.0 | 0.1 | GO:0044299 | C-fiber(GO:0044299) |
0.0 | 0.2 | GO:0045252 | oxoglutarate dehydrogenase complex(GO:0045252) |
0.0 | 0.0 | GO:0005896 | interleukin-6 receptor complex(GO:0005896) |
0.0 | 0.9 | GO:0005581 | collagen trimer(GO:0005581) |
0.0 | 0.1 | GO:0031262 | Ndc80 complex(GO:0031262) |
0.0 | 0.1 | GO:0005863 | striated muscle myosin thick filament(GO:0005863) |
0.0 | 0.1 | GO:0005859 | muscle myosin complex(GO:0005859) |
0.0 | 0.1 | GO:0019815 | B cell receptor complex(GO:0019815) |
0.0 | 0.2 | GO:0000124 | SAGA complex(GO:0000124) |
0.0 | 0.1 | GO:0032777 | Piccolo NuA4 histone acetyltransferase complex(GO:0032777) |
0.0 | 1.5 | GO:0001750 | photoreceptor outer segment(GO:0001750) |
0.0 | 0.2 | GO:0031588 | nucleotide-activated protein kinase complex(GO:0031588) |
0.0 | 2.1 | GO:0031234 | extrinsic component of cytoplasmic side of plasma membrane(GO:0031234) |
0.0 | 0.2 | GO:0000815 | ESCRT III complex(GO:0000815) |
0.0 | 0.2 | GO:0031616 | spindle pole centrosome(GO:0031616) |
0.0 | 0.1 | GO:0090543 | Flemming body(GO:0090543) |
0.0 | 0.3 | GO:0000176 | nuclear exosome (RNase complex)(GO:0000176) |
0.0 | 0.1 | GO:0000408 | EKC/KEOPS complex(GO:0000408) |
0.0 | 1.3 | GO:0031463 | Cul3-RING ubiquitin ligase complex(GO:0031463) |
0.0 | 0.1 | GO:0071001 | U4/U6 snRNP(GO:0071001) |
0.0 | 0.1 | GO:0008622 | epsilon DNA polymerase complex(GO:0008622) |
0.0 | 0.2 | GO:0097431 | mitotic spindle pole(GO:0097431) |
0.0 | 0.1 | GO:0000811 | GINS complex(GO:0000811) |
0.0 | 0.2 | GO:0000778 | condensed nuclear chromosome kinetochore(GO:0000778) |
0.0 | 0.1 | GO:0001674 | female germ cell nucleus(GO:0001674) |
0.0 | 0.0 | GO:0070033 | synaptobrevin 2-SNAP-25-syntaxin-1a-complexin II complex(GO:0070033) |
0.0 | 0.1 | GO:0034715 | pICln-Sm protein complex(GO:0034715) |
0.0 | 0.0 | GO:0033010 | paranodal junction(GO:0033010) |
0.0 | 0.1 | GO:0042765 | GPI-anchor transamidase complex(GO:0042765) |
0.0 | 0.1 | GO:0031045 | dense core granule(GO:0031045) |
0.0 | 0.2 | GO:0032426 | stereocilium tip(GO:0032426) |
0.0 | 0.2 | GO:0030140 | trans-Golgi network transport vesicle(GO:0030140) |
0.0 | 0.2 | GO:0008250 | oligosaccharyltransferase complex(GO:0008250) |
0.0 | 0.1 | GO:0061574 | ASAP complex(GO:0061574) |
0.0 | 0.1 | GO:0031209 | SCAR complex(GO:0031209) |
0.0 | 4.8 | GO:0031012 | extracellular matrix(GO:0031012) |
0.0 | 0.1 | GO:0005796 | Golgi lumen(GO:0005796) |
0.0 | 0.0 | GO:0030121 | AP-1 adaptor complex(GO:0030121) |
0.0 | 0.0 | GO:0036449 | microtubule minus-end(GO:0036449) |
0.0 | 0.0 | GO:0031618 | nuclear pericentric heterochromatin(GO:0031618) |
0.0 | 0.4 | GO:0005763 | organellar small ribosomal subunit(GO:0000314) mitochondrial small ribosomal subunit(GO:0005763) |
0.0 | 0.3 | GO:0097228 | sperm principal piece(GO:0097228) |
0.0 | 0.1 | GO:0032593 | insulin-responsive compartment(GO:0032593) |
0.0 | 0.6 | GO:0005788 | endoplasmic reticulum lumen(GO:0005788) |
0.0 | 0.1 | GO:0019773 | proteasome core complex, alpha-subunit complex(GO:0019773) |
0.0 | 0.5 | GO:0045171 | intercellular bridge(GO:0045171) |
0.0 | 0.0 | GO:0000931 | gamma-tubulin large complex(GO:0000931) gamma-tubulin ring complex(GO:0008274) |
0.0 | 0.1 | GO:0030681 | nucleolar ribonuclease P complex(GO:0005655) ribonuclease P complex(GO:0030677) multimeric ribonuclease P complex(GO:0030681) |
0.0 | 0.0 | GO:0031258 | lamellipodium membrane(GO:0031258) |
0.0 | 0.2 | GO:0033276 | transcription factor TFTC complex(GO:0033276) |
0.0 | 0.2 | GO:0005697 | telomerase holoenzyme complex(GO:0005697) |
0.0 | 0.1 | GO:0042406 | extrinsic component of endoplasmic reticulum membrane(GO:0042406) |
0.0 | 0.2 | GO:0060170 | ciliary membrane(GO:0060170) |
0.0 | 1.5 | GO:0016323 | basolateral plasma membrane(GO:0016323) |
0.0 | 0.0 | GO:0002189 | ribose phosphate diphosphokinase complex(GO:0002189) |
0.0 | 0.1 | GO:0001739 | sex chromatin(GO:0001739) |
0.0 | 0.1 | GO:0030665 | clathrin-coated vesicle membrane(GO:0030665) |
0.0 | 0.1 | GO:0000276 | mitochondrial proton-transporting ATP synthase complex, coupling factor F(o)(GO:0000276) |
0.0 | 0.1 | GO:0000788 | nuclear nucleosome(GO:0000788) |
0.0 | 0.0 | GO:0030015 | CCR4-NOT core complex(GO:0030015) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.7 | 4.9 | GO:0004385 | guanylate kinase activity(GO:0004385) |
0.7 | 1.4 | GO:0097109 | neuroligin family protein binding(GO:0097109) |
0.6 | 2.8 | GO:0008499 | UDP-galactose:beta-N-acetylglucosamine beta-1,3-galactosyltransferase activity(GO:0008499) |
0.5 | 1.6 | GO:0004965 | G-protein coupled GABA receptor activity(GO:0004965) |
0.5 | 4.1 | GO:1990405 | protein antigen binding(GO:1990405) |
0.5 | 1.9 | GO:0034714 | type III transforming growth factor beta receptor binding(GO:0034714) |
0.5 | 1.4 | GO:0045503 | dynein light chain binding(GO:0045503) |
0.5 | 1.8 | GO:0005042 | netrin receptor activity(GO:0005042) |
0.5 | 1.8 | GO:0015467 | G-protein activated inward rectifier potassium channel activity(GO:0015467) |
0.4 | 1.3 | GO:0008309 | double-stranded DNA exodeoxyribonuclease activity(GO:0008309) |
0.4 | 1.7 | GO:0036374 | gamma-glutamyltransferase activity(GO:0003840) glutathione hydrolase activity(GO:0036374) |
0.4 | 1.1 | GO:1902282 | voltage-gated potassium channel activity involved in ventricular cardiac muscle cell action potential repolarization(GO:1902282) |
0.4 | 1.1 | GO:0031708 | endothelin B receptor binding(GO:0031708) |
0.4 | 1.1 | GO:0035373 | chondroitin sulfate proteoglycan binding(GO:0035373) |
0.4 | 4.4 | GO:0050811 | GABA receptor binding(GO:0050811) |
0.4 | 4.6 | GO:0008601 | protein phosphatase type 2A regulator activity(GO:0008601) |
0.3 | 0.7 | GO:0023029 | MHC class Ib protein binding(GO:0023029) |
0.3 | 0.3 | GO:0051425 | PTB domain binding(GO:0051425) |
0.3 | 0.9 | GO:0005006 | epidermal growth factor-activated receptor activity(GO:0005006) |
0.3 | 1.5 | GO:0004985 | opioid receptor activity(GO:0004985) |
0.3 | 5.6 | GO:0005234 | extracellular-glutamate-gated ion channel activity(GO:0005234) |
0.3 | 1.5 | GO:0030550 | acetylcholine receptor inhibitor activity(GO:0030550) |
0.3 | 9.0 | GO:0042605 | peptide antigen binding(GO:0042605) |
0.3 | 1.1 | GO:0016286 | small conductance calcium-activated potassium channel activity(GO:0016286) |
0.3 | 2.5 | GO:0016215 | acyl-CoA desaturase activity(GO:0016215) |
0.3 | 6.2 | GO:0004697 | protein kinase C activity(GO:0004697) |
0.3 | 1.9 | GO:0003680 | AT DNA binding(GO:0003680) |
0.3 | 0.3 | GO:0038191 | neuropilin binding(GO:0038191) |
0.2 | 0.7 | GO:0051373 | FATZ binding(GO:0051373) |
0.2 | 4.6 | GO:0003785 | actin monomer binding(GO:0003785) |
0.2 | 0.7 | GO:0016015 | morphogen activity(GO:0016015) |
0.2 | 1.8 | GO:0003841 | 1-acylglycerol-3-phosphate O-acyltransferase activity(GO:0003841) |
0.2 | 5.2 | GO:0030552 | cAMP binding(GO:0030552) |
0.2 | 0.7 | GO:0052658 | inositol-1,4,5-trisphosphate 5-phosphatase activity(GO:0052658) |
0.2 | 0.6 | GO:0034988 | Fc-gamma receptor I complex binding(GO:0034988) |
0.2 | 1.9 | GO:0003857 | 3-hydroxyacyl-CoA dehydrogenase activity(GO:0003857) |
0.2 | 2.7 | GO:0008574 | ATP-dependent microtubule motor activity, plus-end-directed(GO:0008574) |
0.2 | 0.6 | GO:0008449 | N-acetylglucosamine-6-sulfatase activity(GO:0008449) |
0.2 | 1.5 | GO:0008046 | axon guidance receptor activity(GO:0008046) |
0.2 | 0.8 | GO:0005173 | stem cell factor receptor binding(GO:0005173) |
0.2 | 0.6 | GO:0004724 | magnesium-dependent protein serine/threonine phosphatase activity(GO:0004724) |
0.2 | 1.8 | GO:0008093 | cytoskeletal adaptor activity(GO:0008093) |
0.2 | 1.0 | GO:0070883 | pre-miRNA binding(GO:0070883) |
0.2 | 0.4 | GO:0047192 | 1-alkylglycerophosphocholine O-acetyltransferase activity(GO:0047192) |
0.2 | 0.6 | GO:0008321 | Ral guanyl-nucleotide exchange factor activity(GO:0008321) |
0.2 | 0.7 | GO:0086007 | voltage-gated calcium channel activity involved in cardiac muscle cell action potential(GO:0086007) |
0.2 | 1.8 | GO:0051378 | serotonin binding(GO:0051378) |
0.2 | 0.9 | GO:0031849 | olfactory receptor binding(GO:0031849) |
0.2 | 0.5 | GO:0004924 | oncostatin-M receptor activity(GO:0004924) |
0.2 | 0.2 | GO:0004716 | receptor signaling protein tyrosine kinase activity(GO:0004716) |
0.2 | 0.7 | GO:0004839 | ubiquitin activating enzyme activity(GO:0004839) |
0.2 | 0.5 | GO:0017153 | sodium:dicarboxylate symporter activity(GO:0017153) |
0.2 | 1.6 | GO:0004708 | MAP kinase kinase activity(GO:0004708) |
0.2 | 0.7 | GO:0070579 | methylcytosine dioxygenase activity(GO:0070579) |
0.2 | 0.7 | GO:0009374 | biotin binding(GO:0009374) |
0.2 | 3.4 | GO:0070273 | phosphatidylinositol-4-phosphate binding(GO:0070273) |
0.2 | 2.8 | GO:0031489 | myosin V binding(GO:0031489) |
0.2 | 3.6 | GO:0005540 | hyaluronic acid binding(GO:0005540) |
0.2 | 1.2 | GO:0016595 | glutamate binding(GO:0016595) |
0.2 | 0.5 | GO:0003726 | double-stranded RNA adenosine deaminase activity(GO:0003726) |
0.2 | 0.5 | GO:0031802 | type 5 metabotropic glutamate receptor binding(GO:0031802) |
0.1 | 1.3 | GO:0001206 | transcriptional repressor activity, RNA polymerase II distal enhancer sequence-specific binding(GO:0001206) |
0.1 | 0.7 | GO:0004111 | creatine kinase activity(GO:0004111) |
0.1 | 0.4 | GO:0015119 | hexose phosphate transmembrane transporter activity(GO:0015119) organophosphate:inorganic phosphate antiporter activity(GO:0015315) hexose-phosphate:inorganic phosphate antiporter activity(GO:0015526) glucose 6-phosphate:inorganic phosphate antiporter activity(GO:0061513) |
0.1 | 5.4 | GO:0016709 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, NAD(P)H as one donor, and incorporation of one atom of oxygen(GO:0016709) |
0.1 | 1.7 | GO:0031005 | filamin binding(GO:0031005) |
0.1 | 1.8 | GO:0070016 | armadillo repeat domain binding(GO:0070016) |
0.1 | 0.7 | GO:0017151 | DEAD/H-box RNA helicase binding(GO:0017151) |
0.1 | 0.4 | GO:0008310 | single-stranded DNA 3'-5' exodeoxyribonuclease activity(GO:0008310) |
0.1 | 1.2 | GO:0016857 | racemase and epimerase activity, acting on carbohydrates and derivatives(GO:0016857) |
0.1 | 1.0 | GO:0008599 | protein phosphatase type 1 regulator activity(GO:0008599) |
0.1 | 2.1 | GO:0022841 | potassium ion leak channel activity(GO:0022841) |
0.1 | 0.7 | GO:0086080 | protein binding involved in heterotypic cell-cell adhesion(GO:0086080) |
0.1 | 0.4 | GO:0072542 | protein phosphatase activator activity(GO:0072542) |
0.1 | 0.6 | GO:0003831 | beta-N-acetylglucosaminylglycopeptide beta-1,4-galactosyltransferase activity(GO:0003831) |
0.1 | 0.9 | GO:0031821 | G-protein coupled serotonin receptor binding(GO:0031821) |
0.1 | 0.6 | GO:0015349 | thyroid hormone transmembrane transporter activity(GO:0015349) |
0.1 | 1.4 | GO:0015643 | toxic substance binding(GO:0015643) |
0.1 | 0.9 | GO:0005167 | neurotrophin TRK receptor binding(GO:0005167) |
0.1 | 0.1 | GO:0070653 | high-density lipoprotein particle receptor binding(GO:0070653) |
0.1 | 0.1 | GO:0019912 | cyclin-dependent protein kinase activating kinase activity(GO:0019912) |
0.1 | 0.3 | GO:0070699 | type II activin receptor binding(GO:0070699) |
0.1 | 1.6 | GO:0008329 | signaling pattern recognition receptor activity(GO:0008329) pattern recognition receptor activity(GO:0038187) |
0.1 | 0.8 | GO:0030346 | protein phosphatase 2B binding(GO:0030346) |
0.1 | 0.4 | GO:0003846 | 2-acylglycerol O-acyltransferase activity(GO:0003846) |
0.1 | 0.3 | GO:0070915 | lysophosphatidic acid receptor activity(GO:0070915) |
0.1 | 0.5 | GO:1990254 | keratin filament binding(GO:1990254) |
0.1 | 0.5 | GO:0060228 | phosphatidylcholine-sterol O-acyltransferase activator activity(GO:0060228) |
0.1 | 1.3 | GO:0019176 | thiamine-pyrophosphatase activity(GO:0004787) UDP-2,3-diacylglucosamine hydrolase activity(GO:0008758) dATP pyrophosphohydrolase activity(GO:0008828) dihydroneopterin monophosphate phosphatase activity(GO:0019176) dihydroneopterin triphosphate pyrophosphohydrolase activity(GO:0019177) dTTP diphosphatase activity(GO:0036218) phosphocholine hydrolase activity(GO:0044606) |
0.1 | 0.6 | GO:0043426 | MRF binding(GO:0043426) |
0.1 | 2.3 | GO:0046875 | ephrin receptor binding(GO:0046875) |
0.1 | 0.3 | GO:0008240 | tripeptidyl-peptidase activity(GO:0008240) |
0.1 | 2.3 | GO:0031492 | nucleosomal DNA binding(GO:0031492) |
0.1 | 0.3 | GO:0030297 | transmembrane receptor protein tyrosine kinase activator activity(GO:0030297) |
0.1 | 0.3 | GO:0030899 | calcium-dependent ATPase activity(GO:0030899) |
0.1 | 0.1 | GO:0005025 | transforming growth factor beta receptor activity, type I(GO:0005025) |
0.1 | 4.5 | GO:0030971 | receptor tyrosine kinase binding(GO:0030971) |
0.1 | 0.8 | GO:0102391 | decanoate--CoA ligase activity(GO:0102391) |
0.1 | 0.3 | GO:0050508 | glucuronosyl-N-acetylglucosaminyl-proteoglycan 4-alpha-N-acetylglucosaminyltransferase activity(GO:0050508) |
0.1 | 0.2 | GO:0004065 | arylsulfatase activity(GO:0004065) |
0.1 | 0.4 | GO:0047499 | calcium-independent phospholipase A2 activity(GO:0047499) |
0.1 | 0.3 | GO:0030160 | GKAP/Homer scaffold activity(GO:0030160) |
0.1 | 0.2 | GO:0001226 | RNA polymerase II transcription corepressor binding(GO:0001226) |
0.1 | 0.6 | GO:0003688 | DNA replication origin binding(GO:0003688) |
0.1 | 1.2 | GO:0004435 | phosphatidylinositol phospholipase C activity(GO:0004435) |
0.1 | 0.5 | GO:0005522 | profilin binding(GO:0005522) |
0.1 | 0.3 | GO:0019959 | interleukin-8 binding(GO:0019959) |
0.1 | 0.7 | GO:0004779 | sulfate adenylyltransferase activity(GO:0004779) |
0.1 | 0.2 | GO:0034513 | box H/ACA snoRNA binding(GO:0034513) |
0.1 | 0.6 | GO:0000014 | single-stranded DNA endodeoxyribonuclease activity(GO:0000014) |
0.1 | 0.6 | GO:0005161 | platelet-derived growth factor receptor binding(GO:0005161) |
0.1 | 0.8 | GO:0003993 | acid phosphatase activity(GO:0003993) |
0.1 | 1.1 | GO:0005545 | 1-phosphatidylinositol binding(GO:0005545) |
0.1 | 0.7 | GO:0002162 | dystroglycan binding(GO:0002162) |
0.1 | 0.2 | GO:0015143 | urate transmembrane transporter activity(GO:0015143) salt transmembrane transporter activity(GO:1901702) |
0.1 | 0.9 | GO:0008191 | metalloendopeptidase inhibitor activity(GO:0008191) |
0.1 | 0.2 | GO:0008260 | 3-oxoacid CoA-transferase activity(GO:0008260) |
0.1 | 0.1 | GO:0016717 | oxidoreductase activity, acting on paired donors, with oxidation of a pair of donors resulting in the reduction of molecular oxygen to two molecules of water(GO:0016717) |
0.1 | 0.1 | GO:0010314 | phosphatidylinositol-5-phosphate binding(GO:0010314) |
0.1 | 0.3 | GO:0030159 | receptor signaling complex scaffold activity(GO:0030159) |
0.1 | 2.3 | GO:0017080 | sodium channel regulator activity(GO:0017080) |
0.1 | 0.4 | GO:0048406 | nerve growth factor binding(GO:0048406) |
0.1 | 0.3 | GO:0017162 | aryl hydrocarbon receptor binding(GO:0017162) |
0.1 | 0.2 | GO:0004505 | phenylalanine 4-monooxygenase activity(GO:0004505) |
0.1 | 1.0 | GO:0030742 | GTP-dependent protein binding(GO:0030742) |
0.1 | 0.3 | GO:0005332 | gamma-aminobutyric acid:sodium symporter activity(GO:0005332) |
0.1 | 0.3 | GO:1904288 | BAT3 complex binding(GO:1904288) |
0.1 | 0.3 | GO:0070051 | fibrinogen binding(GO:0070051) |
0.1 | 0.3 | GO:0031727 | CCR2 chemokine receptor binding(GO:0031727) |
0.1 | 0.7 | GO:0071814 | lipoprotein particle binding(GO:0071813) protein-lipid complex binding(GO:0071814) |
0.1 | 0.3 | GO:0034481 | chondroitin sulfotransferase activity(GO:0034481) |
0.1 | 0.4 | GO:0005000 | vasopressin receptor activity(GO:0005000) |
0.1 | 0.4 | GO:0010851 | cyclase regulator activity(GO:0010851) |
0.1 | 4.6 | GO:0019955 | cytokine binding(GO:0019955) |
0.1 | 0.4 | GO:0038132 | neuregulin binding(GO:0038132) |
0.1 | 0.2 | GO:0031694 | alpha-2A adrenergic receptor binding(GO:0031694) |
0.1 | 0.5 | GO:0015385 | sodium:proton antiporter activity(GO:0015385) potassium:proton antiporter activity(GO:0015386) |
0.1 | 6.4 | GO:0017137 | Rab GTPase binding(GO:0017137) |
0.1 | 0.1 | GO:0030492 | hemoglobin binding(GO:0030492) |
0.1 | 0.9 | GO:0004653 | polypeptide N-acetylgalactosaminyltransferase activity(GO:0004653) |
0.1 | 0.2 | GO:0070996 | type 1 melanocortin receptor binding(GO:0070996) |
0.1 | 0.2 | GO:0016520 | growth hormone-releasing hormone receptor activity(GO:0016520) |
0.1 | 0.8 | GO:1990841 | promoter-specific chromatin binding(GO:1990841) |
0.1 | 2.1 | GO:0005544 | calcium-dependent phospholipid binding(GO:0005544) |
0.1 | 5.6 | GO:0004222 | metalloendopeptidase activity(GO:0004222) |
0.1 | 0.1 | GO:0003945 | N-acetyllactosamine synthase activity(GO:0003945) |
0.1 | 0.3 | GO:0003828 | alpha-N-acetylneuraminate alpha-2,8-sialyltransferase activity(GO:0003828) |
0.1 | 0.1 | GO:0031871 | proteinase activated receptor binding(GO:0031871) |
0.1 | 0.3 | GO:0004957 | prostaglandin E receptor activity(GO:0004957) |
0.1 | 0.7 | GO:0016805 | dipeptidase activity(GO:0016805) |
0.1 | 0.2 | GO:0097493 | structural molecule activity conferring elasticity(GO:0097493) |
0.1 | 0.2 | GO:0008184 | glycogen phosphorylase activity(GO:0008184) |
0.1 | 0.5 | GO:0047555 | 3',5'-cyclic-GMP phosphodiesterase activity(GO:0047555) |
0.1 | 0.1 | GO:0035727 | lysophosphatidic acid binding(GO:0035727) |
0.1 | 0.2 | GO:0008073 | ornithine decarboxylase inhibitor activity(GO:0008073) |
0.0 | 0.1 | GO:0015222 | serotonin transmembrane transporter activity(GO:0015222) |
0.0 | 0.1 | GO:0008401 | retinoic acid 4-hydroxylase activity(GO:0008401) |
0.0 | 0.2 | GO:0015379 | potassium:chloride symporter activity(GO:0015379) potassium ion symporter activity(GO:0022820) |
0.0 | 0.0 | GO:0004833 | tryptophan 2,3-dioxygenase activity(GO:0004833) |
0.0 | 0.3 | GO:0001091 | RNA polymerase II basal transcription factor binding(GO:0001091) |
0.0 | 0.2 | GO:0004969 | histamine receptor activity(GO:0004969) |
0.0 | 1.6 | GO:0019894 | kinesin binding(GO:0019894) |
0.0 | 0.4 | GO:0008331 | high voltage-gated calcium channel activity(GO:0008331) |
0.0 | 0.0 | GO:0044548 | S100 protein binding(GO:0044548) |
0.0 | 0.1 | GO:0051377 | mannose-ethanolamine phosphotransferase activity(GO:0051377) |
0.0 | 0.1 | GO:0035184 | histone threonine kinase activity(GO:0035184) |
0.0 | 0.2 | GO:0016907 | G-protein coupled acetylcholine receptor activity(GO:0016907) |
0.0 | 0.1 | GO:0015563 | uptake transmembrane transporter activity(GO:0015563) |
0.0 | 0.2 | GO:0032052 | bile acid binding(GO:0032052) |
0.0 | 1.8 | GO:0008188 | neuropeptide receptor activity(GO:0008188) |
0.0 | 0.4 | GO:0042577 | lipid phosphatase activity(GO:0042577) |
0.0 | 0.8 | GO:0030215 | semaphorin receptor binding(GO:0030215) |
0.0 | 0.6 | GO:0070064 | proline-rich region binding(GO:0070064) |
0.0 | 0.1 | GO:0048185 | activin binding(GO:0048185) |
0.0 | 0.2 | GO:0042608 | T cell receptor binding(GO:0042608) |
0.0 | 0.7 | GO:0071837 | HMG box domain binding(GO:0071837) |
0.0 | 0.9 | GO:0001540 | beta-amyloid binding(GO:0001540) |
0.0 | 0.8 | GO:0001106 | RNA polymerase II transcription corepressor activity(GO:0001106) |
0.0 | 0.1 | GO:0004999 | vasoactive intestinal polypeptide receptor activity(GO:0004999) |
0.0 | 0.4 | GO:0005003 | ephrin receptor activity(GO:0005003) |
0.0 | 0.8 | GO:0043395 | heparan sulfate proteoglycan binding(GO:0043395) |
0.0 | 0.5 | GO:0000983 | transcription factor activity, RNA polymerase II core promoter sequence-specific(GO:0000983) |
0.0 | 0.6 | GO:0016671 | oxidoreductase activity, acting on a sulfur group of donors, disulfide as acceptor(GO:0016671) |
0.0 | 0.2 | GO:0004690 | cyclic nucleotide-dependent protein kinase activity(GO:0004690) |
0.0 | 0.9 | GO:0035035 | histone acetyltransferase binding(GO:0035035) |
0.0 | 0.5 | GO:0070006 | metalloaminopeptidase activity(GO:0070006) |
0.0 | 0.1 | GO:0004096 | catalase activity(GO:0004096) |
0.0 | 0.5 | GO:0001968 | fibronectin binding(GO:0001968) |
0.0 | 0.2 | GO:0005499 | vitamin D binding(GO:0005499) |
0.0 | 0.1 | GO:0050815 | phosphoserine binding(GO:0050815) |
0.0 | 0.2 | GO:0016936 | galactoside binding(GO:0016936) |
0.0 | 0.3 | GO:0070700 | BMP receptor binding(GO:0070700) |
0.0 | 0.2 | GO:0004064 | arylesterase activity(GO:0004064) |
0.0 | 0.2 | GO:0003958 | NADPH-hemoprotein reductase activity(GO:0003958) |
0.0 | 0.4 | GO:0008253 | 5'-nucleotidase activity(GO:0008253) |
0.0 | 0.7 | GO:0042813 | Wnt-activated receptor activity(GO:0042813) |
0.0 | 0.1 | GO:0032422 | purine-rich negative regulatory element binding(GO:0032422) |
0.0 | 1.0 | GO:0001205 | transcriptional activator activity, RNA polymerase II distal enhancer sequence-specific binding(GO:0001205) |
0.0 | 0.3 | GO:0004534 | 5'-3' exoribonuclease activity(GO:0004534) |
0.0 | 0.0 | GO:0038181 | bile acid receptor activity(GO:0038181) |
0.0 | 0.1 | GO:0032051 | clathrin light chain binding(GO:0032051) |
0.0 | 0.0 | GO:0046978 | TAP1 binding(GO:0046978) TAP2 binding(GO:0046979) |
0.0 | 0.1 | GO:0004060 | arylamine N-acetyltransferase activity(GO:0004060) |
0.0 | 0.2 | GO:0098634 | protein binding involved in cell-matrix adhesion(GO:0098634) |
0.0 | 0.2 | GO:0048018 | receptor agonist activity(GO:0048018) |
0.0 | 0.7 | GO:0004298 | threonine-type endopeptidase activity(GO:0004298) threonine-type peptidase activity(GO:0070003) |
0.0 | 0.2 | GO:0046974 | histone methyltransferase activity (H3-K9 specific)(GO:0046974) |
0.0 | 0.1 | GO:0003872 | 6-phosphofructokinase activity(GO:0003872) |
0.0 | 0.3 | GO:0031996 | thioesterase binding(GO:0031996) |
0.0 | 0.1 | GO:0005095 | GTPase inhibitor activity(GO:0005095) |
0.0 | 0.1 | GO:0030621 | U4 snRNA binding(GO:0030621) |
0.0 | 0.1 | GO:0016635 | oxidoreductase activity, acting on the CH-CH group of donors, quinone or related compound as acceptor(GO:0016635) |
0.0 | 0.3 | GO:0039706 | co-receptor binding(GO:0039706) |
0.0 | 0.5 | GO:0019104 | DNA N-glycosylase activity(GO:0019104) |
0.0 | 0.3 | GO:0034236 | protein kinase A catalytic subunit binding(GO:0034236) |
0.0 | 0.2 | GO:0033691 | sialic acid binding(GO:0033691) |
0.0 | 0.0 | GO:0022842 | leak channel activity(GO:0022840) narrow pore channel activity(GO:0022842) |
0.0 | 0.2 | GO:0070097 | delta-catenin binding(GO:0070097) |
0.0 | 0.3 | GO:0005248 | voltage-gated sodium channel activity(GO:0005248) voltage-gated ion channel activity involved in regulation of postsynaptic membrane potential(GO:1905030) |
0.0 | 0.7 | GO:0005251 | delayed rectifier potassium channel activity(GO:0005251) |
0.0 | 0.2 | GO:0016901 | oxidoreductase activity, acting on the CH-OH group of donors, quinone or similar compound as acceptor(GO:0016901) |
0.0 | 0.1 | GO:0015111 | iodide transmembrane transporter activity(GO:0015111) |
0.0 | 0.2 | GO:0046625 | sphingolipid binding(GO:0046625) |
0.0 | 0.1 | GO:0043199 | sulfate binding(GO:0043199) |
0.0 | 0.8 | GO:0015459 | potassium channel regulator activity(GO:0015459) |
0.0 | 0.1 | GO:0004949 | cannabinoid receptor activity(GO:0004949) |
0.0 | 0.5 | GO:0019825 | oxygen binding(GO:0019825) |
0.0 | 0.2 | GO:0004679 | AMP-activated protein kinase activity(GO:0004679) |
0.0 | 0.1 | GO:0004582 | dolichyl-phosphate beta-D-mannosyltransferase activity(GO:0004582) |
0.0 | 0.2 | GO:0003997 | acyl-CoA oxidase activity(GO:0003997) |
0.0 | 0.1 | GO:0005290 | L-histidine transmembrane transporter activity(GO:0005290) |
0.0 | 0.1 | GO:0044323 | retinoic acid-responsive element binding(GO:0044323) |
0.0 | 0.1 | GO:0005502 | 11-cis retinal binding(GO:0005502) |
0.0 | 0.4 | GO:0023026 | MHC class II protein complex binding(GO:0023026) |
0.0 | 0.6 | GO:0017091 | AU-rich element binding(GO:0017091) |
0.0 | 0.1 | GO:0042834 | peptidoglycan binding(GO:0042834) |
0.0 | 0.1 | GO:0035514 | DNA demethylase activity(GO:0035514) |
0.0 | 0.1 | GO:0004300 | enoyl-CoA hydratase activity(GO:0004300) |
0.0 | 0.6 | GO:0005201 | extracellular matrix structural constituent(GO:0005201) |
0.0 | 0.0 | GO:0098821 | BMP receptor activity(GO:0098821) |
0.0 | 0.1 | GO:0005007 | fibroblast growth factor-activated receptor activity(GO:0005007) |
0.0 | 0.1 | GO:0030144 | alpha-1,6-mannosylglycoprotein 6-beta-N-acetylglucosaminyltransferase activity(GO:0030144) |
0.0 | 1.1 | GO:0019187 | beta-1,4-mannosyltransferase activity(GO:0019187) |
0.0 | 0.9 | GO:0051539 | 4 iron, 4 sulfur cluster binding(GO:0051539) |
0.0 | 0.1 | GO:0004955 | prostaglandin receptor activity(GO:0004955) |
0.0 | 0.1 | GO:0042281 | dolichyl pyrophosphate Man9GlcNAc2 alpha-1,3-glucosyltransferase activity(GO:0042281) |
0.0 | 1.5 | GO:0019838 | growth factor binding(GO:0019838) |
0.0 | 0.2 | GO:0045295 | gamma-catenin binding(GO:0045295) |
0.0 | 0.3 | GO:0043274 | phospholipase binding(GO:0043274) |
0.0 | 0.1 | GO:0005041 | low-density lipoprotein receptor activity(GO:0005041) |
0.0 | 0.1 | GO:0004661 | protein geranylgeranyltransferase activity(GO:0004661) |
0.0 | 0.1 | GO:0004719 | protein-L-isoaspartate (D-aspartate) O-methyltransferase activity(GO:0004719) |
0.0 | 0.1 | GO:0018812 | 3-hydroxyacyl-CoA dehydratase activity(GO:0018812) |
0.0 | 0.5 | GO:0042974 | retinoic acid receptor binding(GO:0042974) |
0.0 | 0.1 | GO:0004487 | methenyltetrahydrofolate cyclohydrolase activity(GO:0004477) methylenetetrahydrofolate dehydrogenase (NAD+) activity(GO:0004487) |
0.0 | 2.3 | GO:0003774 | motor activity(GO:0003774) |
0.0 | 0.2 | GO:0070742 | C2H2 zinc finger domain binding(GO:0070742) |
0.0 | 0.1 | GO:0008179 | adenylate cyclase binding(GO:0008179) |
0.0 | 0.3 | GO:0004185 | serine-type carboxypeptidase activity(GO:0004185) |
0.0 | 0.1 | GO:0016933 | extracellular-glycine-gated ion channel activity(GO:0016933) extracellular-glycine-gated chloride channel activity(GO:0016934) |
0.0 | 0.2 | GO:0008889 | glycerophosphodiester phosphodiesterase activity(GO:0008889) |
0.0 | 0.1 | GO:0016714 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, reduced pteridine as one donor, and incorporation of one atom of oxygen(GO:0016714) |
0.0 | 0.0 | GO:0050816 | phosphothreonine binding(GO:0050816) |
0.0 | 0.1 | GO:0051371 | muscle alpha-actinin binding(GO:0051371) |
0.0 | 1.9 | GO:0017124 | SH3 domain binding(GO:0017124) |
0.0 | 0.1 | GO:0005049 | nuclear export signal receptor activity(GO:0005049) |
0.0 | 0.2 | GO:0008932 | lytic endotransglycosylase activity(GO:0008932) |
0.0 | 0.1 | GO:0004974 | leukotriene receptor activity(GO:0004974) |
0.0 | 0.1 | GO:0017040 | ceramidase activity(GO:0017040) |
0.0 | 0.1 | GO:0070087 | chromo shadow domain binding(GO:0070087) |
0.0 | 0.2 | GO:0005452 | inorganic anion exchanger activity(GO:0005452) |
0.0 | 0.1 | GO:1990189 | peptide-serine-N-acetyltransferase activity(GO:1990189) peptide-glutamate-N-acetyltransferase activity(GO:1990190) |
0.0 | 0.1 | GO:0004416 | hydroxyacylglutathione hydrolase activity(GO:0004416) |
0.0 | 0.5 | GO:0019706 | protein-cysteine S-palmitoyltransferase activity(GO:0019706) |
0.0 | 0.0 | GO:0033677 | DNA/RNA helicase activity(GO:0033677) |
0.0 | 0.1 | GO:0004579 | dolichyl-diphosphooligosaccharide-protein glycotransferase activity(GO:0004579) |
0.0 | 0.1 | GO:0019136 | deoxynucleoside kinase activity(GO:0019136) |
0.0 | 0.1 | GO:0043262 | adenosine-diphosphatase activity(GO:0043262) |
0.0 | 0.1 | GO:0071208 | histone pre-mRNA DCP binding(GO:0071208) |
0.0 | 0.1 | GO:0050510 | N-acetylgalactosaminyl-proteoglycan 3-beta-glucuronosyltransferase activity(GO:0050510) |
0.0 | 0.0 | GO:0060230 | lipoprotein lipase activator activity(GO:0060230) |
0.0 | 0.1 | GO:0035612 | AP-2 adaptor complex binding(GO:0035612) |
0.0 | 0.1 | GO:0032454 | histone demethylase activity (H3-K9 specific)(GO:0032454) |
0.0 | 0.1 | GO:0051185 | coenzyme transporter activity(GO:0051185) |
0.0 | 0.0 | GO:0031735 | CCR10 chemokine receptor binding(GO:0031735) |
0.0 | 0.1 | GO:0045545 | syndecan binding(GO:0045545) |
0.0 | 0.2 | GO:0043425 | bHLH transcription factor binding(GO:0043425) |
0.0 | 0.1 | GO:0004652 | polynucleotide adenylyltransferase activity(GO:0004652) |
0.0 | 0.1 | GO:0019808 | polyamine binding(GO:0019808) |
0.0 | 0.3 | GO:0001594 | trace-amine receptor activity(GO:0001594) |
0.0 | 0.1 | GO:0004738 | pyruvate dehydrogenase activity(GO:0004738) pyruvate dehydrogenase [NAD(P)+] activity(GO:0034603) pyruvate dehydrogenase (NAD+) activity(GO:0034604) |
0.0 | 0.1 | GO:0032190 | acrosin binding(GO:0032190) |
0.0 | 0.2 | GO:0031435 | mitogen-activated protein kinase kinase kinase binding(GO:0031435) |
0.0 | 0.1 | GO:0030942 | endoplasmic reticulum signal peptide binding(GO:0030942) |
0.0 | 0.2 | GO:0015026 | coreceptor activity(GO:0015026) |
0.0 | 0.2 | GO:0008553 | hydrogen-exporting ATPase activity, phosphorylative mechanism(GO:0008553) |
0.0 | 0.0 | GO:0004528 | phosphodiesterase I activity(GO:0004528) |
0.0 | 3.0 | GO:0005125 | cytokine activity(GO:0005125) |
0.0 | 0.4 | GO:0071855 | neuropeptide receptor binding(GO:0071855) |
0.0 | 0.2 | GO:0005247 | voltage-gated chloride channel activity(GO:0005247) |
0.0 | 1.6 | GO:0050839 | cell adhesion molecule binding(GO:0050839) |
0.0 | 0.1 | GO:0008294 | calcium- and calmodulin-responsive adenylate cyclase activity(GO:0008294) |
0.0 | 0.1 | GO:0004704 | NF-kappaB-inducing kinase activity(GO:0004704) |
0.0 | 0.0 | GO:0030172 | troponin C binding(GO:0030172) |
0.0 | 1.0 | GO:0008083 | growth factor activity(GO:0008083) |
0.0 | 0.1 | GO:0017150 | tRNA dihydrouridine synthase activity(GO:0017150) |
0.0 | 0.1 | GO:0005315 | inorganic phosphate transmembrane transporter activity(GO:0005315) |
0.0 | 0.0 | GO:0008796 | bis(5'-nucleosyl)-tetraphosphatase activity(GO:0008796) |
0.0 | 0.1 | GO:0019215 | intermediate filament binding(GO:0019215) |
0.0 | 0.0 | GO:0061665 | SUMO ligase activity(GO:0061665) |
0.0 | 0.1 | GO:0070008 | serine-type exopeptidase activity(GO:0070008) |
0.0 | 0.1 | GO:0042923 | neuropeptide binding(GO:0042923) |
0.0 | 0.1 | GO:0005104 | fibroblast growth factor receptor binding(GO:0005104) |
0.0 | 0.2 | GO:0016755 | transferase activity, transferring amino-acyl groups(GO:0016755) |
0.0 | 0.0 | GO:2001070 | starch binding(GO:2001070) |
0.0 | 0.1 | GO:0019784 | NEDD8-specific protease activity(GO:0019784) |
0.0 | 0.0 | GO:0004337 | geranyltranstransferase activity(GO:0004337) |
0.0 | 0.0 | GO:0070878 | primary miRNA binding(GO:0070878) |
0.0 | 0.0 | GO:0000009 | alpha-1,6-mannosyltransferase activity(GO:0000009) |
0.0 | 0.1 | GO:0005313 | L-glutamate transmembrane transporter activity(GO:0005313) acidic amino acid transmembrane transporter activity(GO:0015172) |
0.0 | 0.1 | GO:0016715 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, reduced ascorbate as one donor, and incorporation of one atom of oxygen(GO:0016715) |
0.0 | 0.2 | GO:0004865 | protein serine/threonine phosphatase inhibitor activity(GO:0004865) |
0.0 | 0.2 | GO:0030247 | pattern binding(GO:0001871) polysaccharide binding(GO:0030247) |
0.0 | 0.0 | GO:0035651 | AP-3 adaptor complex binding(GO:0035651) |
0.0 | 0.1 | GO:0050786 | RAGE receptor binding(GO:0050786) |
0.0 | 0.1 | GO:0043539 | protein serine/threonine kinase activator activity(GO:0043539) |
0.0 | 0.2 | GO:0005035 | tumor necrosis factor-activated receptor activity(GO:0005031) death receptor activity(GO:0005035) |
0.0 | 0.0 | GO:0019002 | GMP binding(GO:0019002) |
0.0 | 0.1 | GO:0003918 | DNA topoisomerase type II (ATP-hydrolyzing) activity(GO:0003918) DNA topoisomerase II activity(GO:0061505) |
0.0 | 0.1 | GO:0046975 | histone methyltransferase activity (H3-K36 specific)(GO:0046975) |
0.0 | 0.0 | GO:0042030 | ATPase inhibitor activity(GO:0042030) |
0.0 | 0.1 | GO:0004526 | ribonuclease P activity(GO:0004526) |
0.0 | 0.0 | GO:0005138 | interleukin-6 receptor binding(GO:0005138) |
0.0 | 0.1 | GO:0000403 | Y-form DNA binding(GO:0000403) |
0.0 | 0.0 | GO:0004953 | icosanoid receptor activity(GO:0004953) |
0.0 | 0.2 | GO:0030276 | clathrin binding(GO:0030276) |
0.0 | 0.0 | GO:0031750 | D3 dopamine receptor binding(GO:0031750) |
0.0 | 0.5 | GO:0008907 | integrase activity(GO:0008907) T/G mismatch-specific endonuclease activity(GO:0043765) retroviral integrase activity(GO:0044823) retroviral 3' processing activity(GO:0044824) |
0.0 | 0.0 | GO:0034618 | arginine binding(GO:0034618) |
0.0 | 0.0 | GO:0015220 | choline transmembrane transporter activity(GO:0015220) |
0.0 | 0.1 | GO:0050733 | RS domain binding(GO:0050733) |
0.0 | 0.1 | GO:0030976 | thiamine pyrophosphate binding(GO:0030976) |
0.0 | 0.0 | GO:0001642 | group III metabotropic glutamate receptor activity(GO:0001642) |
0.0 | 0.4 | GO:0048306 | calcium-dependent protein binding(GO:0048306) |
0.0 | 0.0 | GO:0005250 | A-type (transient outward) potassium channel activity(GO:0005250) |
0.0 | 0.0 | GO:0004749 | ribose phosphate diphosphokinase activity(GO:0004749) |
0.0 | 0.0 | GO:1990715 | mRNA CDS binding(GO:1990715) |
0.0 | 0.1 | GO:0017128 | phospholipid scramblase activity(GO:0017128) |
0.0 | 0.0 | GO:0005483 | soluble NSF attachment protein activity(GO:0005483) |
0.0 | 0.3 | GO:0015347 | sodium-independent organic anion transmembrane transporter activity(GO:0015347) |
0.0 | 0.1 | GO:0016892 | endoribonuclease activity, producing 3'-phosphomonoesters(GO:0016892) |
0.0 | 0.2 | GO:0042975 | peroxisome proliferator activated receptor binding(GO:0042975) |
0.0 | 0.0 | GO:0031726 | CCR1 chemokine receptor binding(GO:0031726) |
0.0 | 0.2 | GO:0030544 | Hsp70 protein binding(GO:0030544) |
0.0 | 0.0 | GO:0004616 | phosphogluconate dehydrogenase (decarboxylating) activity(GO:0004616) |
0.0 | 0.1 | GO:0019992 | diacylglycerol binding(GO:0019992) |
0.0 | 0.0 | GO:0019211 | phosphatase activator activity(GO:0019211) |
0.0 | 0.0 | GO:0016941 | natriuretic peptide receptor activity(GO:0016941) |
0.0 | 0.0 | GO:0003933 | GTP cyclohydrolase activity(GO:0003933) |
0.0 | 0.1 | GO:0001530 | lipopolysaccharide binding(GO:0001530) |
0.0 | 0.0 | GO:0046624 | sphingolipid transporter activity(GO:0046624) |
0.0 | 0.0 | GO:0003941 | L-serine ammonia-lyase activity(GO:0003941) |
0.0 | 0.0 | GO:0004370 | glycerol kinase activity(GO:0004370) |
0.0 | 0.2 | GO:0019212 | phosphatase inhibitor activity(GO:0019212) |
0.0 | 0.1 | GO:0035497 | cAMP response element binding(GO:0035497) |
0.0 | 0.1 | GO:0016670 | oxidoreductase activity, acting on a sulfur group of donors, oxygen as acceptor(GO:0016670) |
0.0 | 0.0 | GO:0016212 | kynurenine-oxoglutarate transaminase activity(GO:0016212) kynurenine aminotransferase activity(GO:0036137) |
0.0 | 0.1 | GO:0016681 | ubiquinol-cytochrome-c reductase activity(GO:0008121) oxidoreductase activity, acting on diphenols and related substances as donors(GO:0016679) oxidoreductase activity, acting on diphenols and related substances as donors, cytochrome as acceptor(GO:0016681) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.3 | 4.5 | PID SYNDECAN 3 PATHWAY | Syndecan-3-mediated signaling events |
0.2 | 3.3 | PID INTEGRIN5 PATHWAY | Beta5 beta6 beta7 and beta8 integrin cell surface interactions |
0.2 | 5.4 | PID INTEGRIN A9B1 PATHWAY | Alpha9 beta1 integrin signaling events |
0.2 | 4.3 | ST G ALPHA I PATHWAY | G alpha i Pathway |
0.2 | 1.8 | PID EPHB FWD PATHWAY | EPHB forward signaling |
0.2 | 2.0 | SA MMP CYTOKINE CONNECTION | Cytokines can induce activation of matrix metalloproteinases, which degrade extracellular matrix. |
0.1 | 0.1 | SA TRKA RECEPTOR | The TrkA receptor binds nerve growth factor to activate MAP kinase pathways and promote cell growth. |
0.1 | 2.4 | PID EPHRINB REV PATHWAY | Ephrin B reverse signaling |
0.1 | 1.6 | PID P38 ALPHA BETA PATHWAY | Regulation of p38-alpha and p38-beta |
0.1 | 0.3 | ST PAC1 RECEPTOR PATHWAY | PAC1 Receptor Pathway |
0.1 | 1.6 | SA B CELL RECEPTOR COMPLEXES | Antigen binding to B cell receptors activates protein tyrosine kinases, such as the Src family, which ultimate activate MAP kinases. |
0.1 | 0.9 | PID INTEGRIN4 PATHWAY | Alpha6 beta4 integrin-ligand interactions |
0.1 | 0.1 | SIG IL4RECEPTOR IN B LYPHOCYTES | Genes related to IL4 rceptor signaling in B lymphocytes |
0.1 | 2.0 | PID NETRIN PATHWAY | Netrin-mediated signaling events |
0.1 | 1.0 | PID ERBB NETWORK PATHWAY | ErbB receptor signaling network |
0.1 | 0.5 | ST G ALPHA S PATHWAY | G alpha s Pathway |
0.1 | 0.8 | PID ERBB2 ERBB3 PATHWAY | ErbB2/ErbB3 signaling events |
0.1 | 2.4 | PID CDC42 PATHWAY | CDC42 signaling events |
0.1 | 0.1 | PID ERBB1 RECEPTOR PROXIMAL PATHWAY | EGF receptor (ErbB1) signaling pathway |
0.1 | 0.5 | PID WNT NONCANONICAL PATHWAY | Noncanonical Wnt signaling pathway |
0.1 | 0.5 | PID P38 GAMMA DELTA PATHWAY | Signaling mediated by p38-gamma and p38-delta |
0.1 | 0.3 | PID S1P S1P3 PATHWAY | S1P3 pathway |
0.1 | 0.1 | PID IL8 CXCR2 PATHWAY | IL8- and CXCR2-mediated signaling events |
0.1 | 0.4 | PID TCR JNK PATHWAY | JNK signaling in the CD4+ TCR pathway |
0.1 | 0.7 | PID TCR CALCIUM PATHWAY | Calcium signaling in the CD4+ TCR pathway |
0.1 | 1.2 | PID ERBB1 INTERNALIZATION PATHWAY | Internalization of ErbB1 |
0.1 | 2.0 | PID ECADHERIN STABILIZATION PATHWAY | Stabilization and expansion of the E-cadherin adherens junction |
0.1 | 2.0 | ST WNT BETA CATENIN PATHWAY | Wnt/beta-catenin Pathway |
0.1 | 2.5 | PID TRKR PATHWAY | Neurotrophic factor-mediated Trk receptor signaling |
0.1 | 2.2 | PID ATR PATHWAY | ATR signaling pathway |
0.1 | 0.4 | PID VEGF VEGFR PATHWAY | VEGF and VEGFR signaling network |
0.1 | 1.9 | PID TCR PATHWAY | TCR signaling in naïve CD4+ T cells |
0.0 | 0.1 | SA PROGRAMMED CELL DEATH | Programmed cell death, or apoptosis, eliminates damaged or unneeded cells. |
0.0 | 0.1 | PID IL8 CXCR1 PATHWAY | IL8- and CXCR1-mediated signaling events |
0.0 | 0.3 | PID RXR VDR PATHWAY | RXR and RAR heterodimerization with other nuclear receptor |
0.0 | 0.5 | PID S1P S1P2 PATHWAY | S1P2 pathway |
0.0 | 0.0 | PID NFKAPPAB CANONICAL PATHWAY | Canonical NF-kappaB pathway |
0.0 | 0.4 | PID ALK2 PATHWAY | ALK2 signaling events |
0.0 | 0.5 | PID UPA UPAR PATHWAY | Urokinase-type plasminogen activator (uPA) and uPAR-mediated signaling |
0.0 | 0.1 | PID FOXO PATHWAY | FoxO family signaling |
0.0 | 0.8 | PID HIF2PATHWAY | HIF-2-alpha transcription factor network |
0.0 | 0.2 | PID ATM PATHWAY | ATM pathway |
0.0 | 0.3 | PID FANCONI PATHWAY | Fanconi anemia pathway |
0.0 | 0.2 | PID TXA2PATHWAY | Thromboxane A2 receptor signaling |
0.0 | 1.2 | PID AP1 PATHWAY | AP-1 transcription factor network |
0.0 | 0.1 | PID AVB3 OPN PATHWAY | Osteopontin-mediated events |
0.0 | 0.1 | ST GRANULE CELL SURVIVAL PATHWAY | Granule Cell Survival Pathway is a specific case of more general PAC1 Receptor Pathway. |
0.0 | 0.3 | PID INSULIN GLUCOSE PATHWAY | Insulin-mediated glucose transport |
0.0 | 0.3 | PID RB 1PATHWAY | Regulation of retinoblastoma protein |
0.0 | 0.3 | PID GLYPICAN 1PATHWAY | Glypican 1 network |
0.0 | 0.2 | PID NFKAPPAB ATYPICAL PATHWAY | Atypical NF-kappaB pathway |
0.0 | 0.3 | SIG CD40PATHWAYMAP | Genes related to CD40 signaling |
0.0 | 0.2 | PID CIRCADIAN PATHWAY | Circadian rhythm pathway |
0.0 | 0.1 | PID PI3K PLC TRK PATHWAY | Trk receptor signaling mediated by PI3K and PLC-gamma |
0.0 | 0.1 | PID CERAMIDE PATHWAY | Ceramide signaling pathway |
0.0 | 0.2 | PID NCADHERIN PATHWAY | N-cadherin signaling events |
0.0 | 0.5 | PID LKB1 PATHWAY | LKB1 signaling events |
0.0 | 0.0 | PID RANBP2 PATHWAY | Sumoylation by RanBP2 regulates transcriptional repression |
0.0 | 0.0 | SIG PIP3 SIGNALING IN B LYMPHOCYTES | Genes related to PIP3 signaling in B lymphocytes |
0.0 | 0.0 | PID TCR RAS PATHWAY | Ras signaling in the CD4+ TCR pathway |
0.0 | 0.0 | PID MAPK TRK PATHWAY | Trk receptor signaling mediated by the MAPK pathway |
0.0 | 0.3 | PID IL23 PATHWAY | IL23-mediated signaling events |
0.0 | 0.2 | PID FRA PATHWAY | Validated transcriptional targets of AP1 family members Fra1 and Fra2 |
0.0 | 0.5 | PID HES HEY PATHWAY | Notch-mediated HES/HEY network |
0.0 | 0.1 | ST MYOCYTE AD PATHWAY | Myocyte Adrenergic Pathway is a specific case of the generalized Adrenergic Pathway. |
0.0 | 0.2 | PID ERB GENOMIC PATHWAY | Validated nuclear estrogen receptor beta network |
0.0 | 0.1 | PID SYNDECAN 4 PATHWAY | Syndecan-4-mediated signaling events |
0.0 | 0.1 | PID SYNDECAN 2 PATHWAY | Syndecan-2-mediated signaling events |
0.0 | 0.2 | PID TOLL ENDOGENOUS PATHWAY | Endogenous TLR signaling |
0.0 | 0.3 | PID ARF6 TRAFFICKING PATHWAY | Arf6 trafficking events |
0.0 | 0.0 | PID IGF1 PATHWAY | IGF1 pathway |
0.0 | 1.9 | NABA ECM REGULATORS | Genes encoding enzymes and their regulators involved in the remodeling of the extracellular matrix |
0.0 | 0.6 | WNT SIGNALING | Genes related to Wnt-mediated signal transduction |
0.0 | 0.1 | PID REELIN PATHWAY | Reelin signaling pathway |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.8 | 7.1 | REACTOME SYNTHESIS OF BILE ACIDS AND BILE SALTS VIA 24 HYDROXYCHOLESTEROL | Genes involved in Synthesis of bile acids and bile salts via 24-hydroxycholesterol |
0.4 | 4.3 | REACTOME SIGNAL ATTENUATION | Genes involved in Signal attenuation |
0.3 | 3.7 | REACTOME CS DS DEGRADATION | Genes involved in CS/DS degradation |
0.2 | 2.9 | REACTOME GABA A RECEPTOR ACTIVATION | Genes involved in GABA A receptor activation |
0.2 | 2.7 | REACTOME DCC MEDIATED ATTRACTIVE SIGNALING | Genes involved in DCC mediated attractive signaling |
0.2 | 2.1 | REACTOME BASE FREE SUGAR PHOSPHATE REMOVAL VIA THE SINGLE NUCLEOTIDE REPLACEMENT PATHWAY | Genes involved in Base-free sugar-phosphate removal via the single-nucleotide replacement pathway |
0.2 | 4.7 | REACTOME IL RECEPTOR SHC SIGNALING | Genes involved in Interleukin receptor SHC signaling |
0.2 | 1.9 | REACTOME TANDEM PORE DOMAIN POTASSIUM CHANNELS | Genes involved in Tandem pore domain potassium channels |
0.2 | 0.5 | REACTOME ACTIVATION OF THE AP1 FAMILY OF TRANSCRIPTION FACTORS | Genes involved in Activation of the AP-1 family of transcription factors |
0.2 | 1.8 | REACTOME SEROTONIN RECEPTORS | Genes involved in Serotonin receptors |
0.2 | 2.0 | REACTOME SYNTHESIS SECRETION AND INACTIVATION OF GIP | Genes involved in Synthesis, Secretion, and Inactivation of Glucose-dependent Insulinotropic Polypeptide (GIP) |
0.2 | 1.7 | REACTOME ADVANCED GLYCOSYLATION ENDPRODUCT RECEPTOR SIGNALING | Genes involved in Advanced glycosylation endproduct receptor signaling |
0.2 | 0.5 | REACTOME G BETA GAMMA SIGNALLING THROUGH PLC BETA | Genes involved in G beta:gamma signalling through PLC beta |
0.2 | 2.7 | REACTOME INSULIN SYNTHESIS AND PROCESSING | Genes involved in Insulin Synthesis and Processing |
0.1 | 2.0 | REACTOME G PROTEIN ACTIVATION | Genes involved in G-protein activation |
0.1 | 1.1 | REACTOME IONOTROPIC ACTIVITY OF KAINATE RECEPTORS | Genes involved in Ionotropic activity of Kainate Receptors |
0.1 | 3.0 | REACTOME SMOOTH MUSCLE CONTRACTION | Genes involved in Smooth Muscle Contraction |
0.1 | 1.0 | REACTOME DOPAMINE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Dopamine Neurotransmitter Release Cycle |
0.1 | 1.2 | REACTOME GAP JUNCTION DEGRADATION | Genes involved in Gap junction degradation |
0.1 | 1.3 | REACTOME CREB PHOSPHORYLATION THROUGH THE ACTIVATION OF CAMKII | Genes involved in CREB phosphorylation through the activation of CaMKII |
0.1 | 0.1 | REACTOME SIGNALING BY NOTCH4 | Genes involved in Signaling by NOTCH4 |
0.1 | 2.2 | REACTOME KINESINS | Genes involved in Kinesins |
0.1 | 1.9 | REACTOME EGFR DOWNREGULATION | Genes involved in EGFR downregulation |
0.1 | 2.3 | REACTOME INHIBITION OF VOLTAGE GATED CA2 CHANNELS VIA GBETA GAMMA SUBUNITS | Genes involved in Inhibition of voltage gated Ca2+ channels via Gbeta/gamma subunits |
0.1 | 1.1 | REACTOME MITOCHONDRIAL FATTY ACID BETA OXIDATION | Genes involved in Mitochondrial Fatty Acid Beta-Oxidation |
0.1 | 1.9 | REACTOME ADHERENS JUNCTIONS INTERACTIONS | Genes involved in Adherens junctions interactions |
0.1 | 1.7 | REACTOME INTERACTION BETWEEN L1 AND ANKYRINS | Genes involved in Interaction between L1 and Ankyrins |
0.1 | 0.1 | REACTOME MEMBRANE BINDING AND TARGETTING OF GAG PROTEINS | Genes involved in Membrane binding and targetting of GAG proteins |
0.1 | 0.1 | REACTOME GLUTAMATE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Glutamate Neurotransmitter Release Cycle |
0.1 | 1.7 | REACTOME ACTIVATED NOTCH1 TRANSMITS SIGNAL TO THE NUCLEUS | Genes involved in Activated NOTCH1 Transmits Signal to the Nucleus |
0.1 | 0.1 | REACTOME PROSTACYCLIN SIGNALLING THROUGH PROSTACYCLIN RECEPTOR | Genes involved in Prostacyclin signalling through prostacyclin receptor |
0.1 | 1.6 | REACTOME DEGRADATION OF THE EXTRACELLULAR MATRIX | Genes involved in Degradation of the extracellular matrix |
0.1 | 0.4 | REACTOME IRAK2 MEDIATED ACTIVATION OF TAK1 COMPLEX UPON TLR7 8 OR 9 STIMULATION | Genes involved in IRAK2 mediated activation of TAK1 complex upon TLR7/8 or 9 stimulation |
0.1 | 1.0 | REACTOME REGULATION OF INSULIN LIKE GROWTH FACTOR IGF ACTIVITY BY INSULIN LIKE GROWTH FACTOR BINDING PROTEINS IGFBPS | Genes involved in Regulation of Insulin-like Growth Factor (IGF) Activity by Insulin-like Growth Factor Binding Proteins (IGFBPs) |
0.1 | 0.2 | REACTOME NEGATIVE REGULATION OF THE PI3K AKT NETWORK | Genes involved in Negative regulation of the PI3K/AKT network |
0.1 | 1.2 | REACTOME FATTY ACYL COA BIOSYNTHESIS | Genes involved in Fatty Acyl-CoA Biosynthesis |
0.1 | 1.5 | REACTOME NITRIC OXIDE STIMULATES GUANYLATE CYCLASE | Genes involved in Nitric oxide stimulates guanylate cyclase |
0.1 | 0.8 | REACTOME REGULATION OF PYRUVATE DEHYDROGENASE PDH COMPLEX | Genes involved in Regulation of pyruvate dehydrogenase (PDH) complex |
0.1 | 0.7 | REACTOME CASPASE MEDIATED CLEAVAGE OF CYTOSKELETAL PROTEINS | Genes involved in Caspase-mediated cleavage of cytoskeletal proteins |
0.1 | 0.3 | REACTOME UNBLOCKING OF NMDA RECEPTOR GLUTAMATE BINDING AND ACTIVATION | Genes involved in Unblocking of NMDA receptor, glutamate binding and activation |
0.1 | 1.2 | REACTOME SIGNALING BY HIPPO | Genes involved in Signaling by Hippo |
0.1 | 1.4 | REACTOME G ALPHA Z SIGNALLING EVENTS | Genes involved in G alpha (z) signalling events |
0.1 | 0.6 | REACTOME UNWINDING OF DNA | Genes involved in Unwinding of DNA |
0.1 | 0.1 | REACTOME IL 6 SIGNALING | Genes involved in Interleukin-6 signaling |
0.1 | 3.2 | REACTOME POTASSIUM CHANNELS | Genes involved in Potassium Channels |
0.1 | 0.1 | REACTOME NEF MEDIATED DOWNREGULATION OF MHC CLASS I COMPLEX CELL SURFACE EXPRESSION | Genes involved in Nef mediated downregulation of MHC class I complex cell surface expression |
0.1 | 0.5 | REACTOME SLBP DEPENDENT PROCESSING OF REPLICATION DEPENDENT HISTONE PRE MRNAS | Genes involved in SLBP Dependent Processing of Replication-Dependent Histone Pre-mRNAs |
0.0 | 0.3 | REACTOME DOWNREGULATION OF TGF BETA RECEPTOR SIGNALING | Genes involved in Downregulation of TGF-beta receptor signaling |
0.0 | 1.1 | REACTOME CHONDROITIN SULFATE DERMATAN SULFATE METABOLISM | Genes involved in Chondroitin sulfate/dermatan sulfate metabolism |
0.0 | 0.4 | REACTOME ACTIVATION OF IRF3 IRF7 MEDIATED BY TBK1 IKK EPSILON | Genes involved in Activation of IRF3/IRF7 mediated by TBK1/IKK epsilon |
0.0 | 0.3 | REACTOME SIGNALING BY FGFR IN DISEASE | Genes involved in Signaling by FGFR in disease |
0.0 | 0.5 | REACTOME BILE SALT AND ORGANIC ANION SLC TRANSPORTERS | Genes involved in Bile salt and organic anion SLC transporters |
0.0 | 0.4 | REACTOME SCFSKP2 MEDIATED DEGRADATION OF P27 P21 | Genes involved in SCF(Skp2)-mediated degradation of p27/p21 |
0.0 | 0.4 | REACTOME ENOS ACTIVATION AND REGULATION | Genes involved in eNOS activation and regulation |
0.0 | 0.9 | REACTOME NETRIN1 SIGNALING | Genes involved in Netrin-1 signaling |
0.0 | 0.4 | REACTOME NA CL DEPENDENT NEUROTRANSMITTER TRANSPORTERS | Genes involved in Na+/Cl- dependent neurotransmitter transporters |
0.0 | 0.9 | REACTOME STRIATED MUSCLE CONTRACTION | Genes involved in Striated Muscle Contraction |
0.0 | 0.6 | REACTOME ANTIGEN PRESENTATION FOLDING ASSEMBLY AND PEPTIDE LOADING OF CLASS I MHC | Genes involved in Antigen Presentation: Folding, assembly and peptide loading of class I MHC |
0.0 | 0.0 | REACTOME APC C CDC20 MEDIATED DEGRADATION OF MITOTIC PROTEINS | Genes involved in APC/C:Cdc20 mediated degradation of mitotic proteins |
0.0 | 1.8 | REACTOME INTERFERON ALPHA BETA SIGNALING | Genes involved in Interferon alpha/beta signaling |
0.0 | 0.1 | REACTOME SIGNALING BY SCF KIT | Genes involved in Signaling by SCF-KIT |
0.0 | 1.4 | REACTOME IMMUNOREGULATORY INTERACTIONS BETWEEN A LYMPHOID AND A NON LYMPHOID CELL | Genes involved in Immunoregulatory interactions between a Lymphoid and a non-Lymphoid cell |
0.0 | 0.4 | REACTOME REGULATION OF AMPK ACTIVITY VIA LKB1 | Genes involved in Regulation of AMPK activity via LKB1 |
0.0 | 0.0 | REACTOME PROCESSIVE SYNTHESIS ON THE LAGGING STRAND | Genes involved in Processive synthesis on the lagging strand |
0.0 | 0.1 | REACTOME IL 7 SIGNALING | Genes involved in Interleukin-7 signaling |
0.0 | 0.1 | REACTOME SIGNALLING TO RAS | Genes involved in Signalling to RAS |
0.0 | 0.3 | REACTOME REGULATION OF SIGNALING BY CBL | Genes involved in Regulation of signaling by CBL |
0.0 | 0.1 | REACTOME SIGNALLING BY NGF | Genes involved in Signalling by NGF |
0.0 | 0.3 | REACTOME GRB2 SOS PROVIDES LINKAGE TO MAPK SIGNALING FOR INTERGRINS | Genes involved in GRB2:SOS provides linkage to MAPK signaling for Intergrins |
0.0 | 0.0 | REACTOME DOWNSTREAM SIGNALING EVENTS OF B CELL RECEPTOR BCR | Genes involved in Downstream Signaling Events Of B Cell Receptor (BCR) |
0.0 | 0.1 | REACTOME TRAFFICKING OF GLUR2 CONTAINING AMPA RECEPTORS | Genes involved in Trafficking of GluR2-containing AMPA receptors |
0.0 | 4.1 | REACTOME G ALPHA Q SIGNALLING EVENTS | Genes involved in G alpha (q) signalling events |
0.0 | 1.3 | REACTOME INTEGRATION OF ENERGY METABOLISM | Genes involved in Integration of energy metabolism |
0.0 | 0.1 | REACTOME ACYL CHAIN REMODELLING OF PG | Genes involved in Acyl chain remodelling of PG |
0.0 | 0.5 | REACTOME DESTABILIZATION OF MRNA BY TRISTETRAPROLIN TTP | Genes involved in Destabilization of mRNA by Tristetraprolin (TTP) |
0.0 | 0.3 | REACTOME G2 M DNA DAMAGE CHECKPOINT | Genes involved in G2/M DNA damage checkpoint |
0.0 | 0.0 | REACTOME NEF MEDIATES DOWN MODULATION OF CELL SURFACE RECEPTORS BY RECRUITING THEM TO CLATHRIN ADAPTERS | Genes involved in Nef-mediates down modulation of cell surface receptors by recruiting them to clathrin adapters |
0.0 | 0.8 | REACTOME HS GAG BIOSYNTHESIS | Genes involved in HS-GAG biosynthesis |
0.0 | 0.3 | REACTOME INTRINSIC PATHWAY | Genes involved in Intrinsic Pathway |
0.0 | 0.6 | REACTOME GLUTATHIONE CONJUGATION | Genes involved in Glutathione conjugation |
0.0 | 0.1 | REACTOME IRAK1 RECRUITS IKK COMPLEX | Genes involved in IRAK1 recruits IKK complex |
0.0 | 0.3 | REACTOME PYRIMIDINE CATABOLISM | Genes involved in Pyrimidine catabolism |
0.0 | 0.6 | REACTOME NUCLEAR SIGNALING BY ERBB4 | Genes involved in Nuclear signaling by ERBB4 |
0.0 | 0.4 | REACTOME AMINE LIGAND BINDING RECEPTORS | Genes involved in Amine ligand-binding receptors |
0.0 | 0.0 | REACTOME G ALPHA1213 SIGNALLING EVENTS | Genes involved in G alpha (12/13) signalling events |
0.0 | 0.0 | REACTOME PLATELET SENSITIZATION BY LDL | Genes involved in Platelet sensitization by LDL |
0.0 | 0.1 | REACTOME PYRUVATE METABOLISM | Genes involved in Pyruvate metabolism |
0.0 | 0.3 | REACTOME SIGNALING BY NODAL | Genes involved in Signaling by NODAL |
0.0 | 0.2 | REACTOME PLATELET CALCIUM HOMEOSTASIS | Genes involved in Platelet calcium homeostasis |
0.0 | 0.1 | REACTOME REGULATION OF KIT SIGNALING | Genes involved in Regulation of KIT signaling |
0.0 | 0.4 | REACTOME SYNTHESIS OF PIPS AT THE PLASMA MEMBRANE | Genes involved in Synthesis of PIPs at the plasma membrane |
0.0 | 0.2 | REACTOME PROCESSING OF INTRONLESS PRE MRNAS | Genes involved in Processing of Intronless Pre-mRNAs |
0.0 | 0.3 | REACTOME INHIBITION OF THE PROTEOLYTIC ACTIVITY OF APC C REQUIRED FOR THE ONSET OF ANAPHASE BY MITOTIC SPINDLE CHECKPOINT COMPONENTS | Genes involved in Inhibition of the proteolytic activity of APC/C required for the onset of anaphase by mitotic spindle checkpoint components |
0.0 | 0.2 | REACTOME TAK1 ACTIVATES NFKB BY PHOSPHORYLATION AND ACTIVATION OF IKKS COMPLEX | Genes involved in TAK1 activates NFkB by phosphorylation and activation of IKKs complex |
0.0 | 0.9 | REACTOME SEMAPHORIN INTERACTIONS | Genes involved in Semaphorin interactions |
0.0 | 0.5 | REACTOME TRANSPORT OF MATURE MRNA DERIVED FROM AN INTRONLESS TRANSCRIPT | Genes involved in Transport of Mature mRNA Derived from an Intronless Transcript |
0.0 | 0.1 | REACTOME CD28 CO STIMULATION | Genes involved in CD28 co-stimulation |
0.0 | 0.2 | REACTOME CLASS C 3 METABOTROPIC GLUTAMATE PHEROMONE RECEPTORS | Genes involved in Class C/3 (Metabotropic glutamate/pheromone receptors) |
0.0 | 0.0 | REACTOME TGF BETA RECEPTOR SIGNALING IN EMT EPITHELIAL TO MESENCHYMAL TRANSITION | Genes involved in TGF-beta receptor signaling in EMT (epithelial to mesenchymal transition) |
0.0 | 0.0 | REACTOME PHOSPHORYLATION OF CD3 AND TCR ZETA CHAINS | Genes involved in Phosphorylation of CD3 and TCR zeta chains |
0.0 | 0.1 | REACTOME NEPHRIN INTERACTIONS | Genes involved in Nephrin interactions |
0.0 | 0.2 | REACTOME AMYLOIDS | Genes involved in Amyloids |
0.0 | 0.2 | REACTOME N GLYCAN ANTENNAE ELONGATION | Genes involved in N-Glycan antennae elongation |
0.0 | 0.0 | REACTOME ABORTIVE ELONGATION OF HIV1 TRANSCRIPT IN THE ABSENCE OF TAT | Genes involved in Abortive elongation of HIV-1 transcript in the absence of Tat |
0.0 | 0.0 | REACTOME NUCLEOTIDE LIKE PURINERGIC RECEPTORS | Genes involved in Nucleotide-like (purinergic) receptors |
0.0 | 0.1 | REACTOME VEGF LIGAND RECEPTOR INTERACTIONS | Genes involved in VEGF ligand-receptor interactions |
0.0 | 0.1 | REACTOME TRYPTOPHAN CATABOLISM | Genes involved in Tryptophan catabolism |
0.0 | 0.0 | REACTOME ARMS MEDIATED ACTIVATION | Genes involved in ARMS-mediated activation |
0.0 | 0.1 | REACTOME GLUCAGON TYPE LIGAND RECEPTORS | Genes involved in Glucagon-type ligand receptors |
0.0 | 0.0 | REACTOME APC C CDH1 MEDIATED DEGRADATION OF CDC20 AND OTHER APC C CDH1 TARGETED PROTEINS IN LATE MITOSIS EARLY G1 | Genes involved in APC/C:Cdh1 mediated degradation of Cdc20 and other APC/C:Cdh1 targeted proteins in late mitosis/early G1 |
0.0 | 0.4 | REACTOME NCAM1 INTERACTIONS | Genes involved in NCAM1 interactions |
0.0 | 0.2 | REACTOME AMINO ACID SYNTHESIS AND INTERCONVERSION TRANSAMINATION | Genes involved in Amino acid synthesis and interconversion (transamination) |
0.0 | 0.1 | REACTOME LIGAND GATED ION CHANNEL TRANSPORT | Genes involved in Ligand-gated ion channel transport |
0.0 | 0.2 | REACTOME MITOCHONDRIAL TRNA AMINOACYLATION | Genes involved in Mitochondrial tRNA aminoacylation |