| Gene Symbol | Gene ID | Gene Info |
|---|---|---|
|
Smad3
|
ENSMUSG00000032402.6 | SMAD family member 3 |
| CRE | Gene | Distance | Association probability | Pearson corr. coef. | P-value | Plot |
|---|---|---|---|---|---|---|
| chr9_63665119_63665366 | Smad3 | 1305 | 0.477105 | 0.57 | 5.9e-06 | Click! |
| chr9_63712984_63713135 | Smad3 | 1090 | 0.583819 | 0.49 | 1.6e-04 | Click! |
| chr9_63667144_63667306 | Smad3 | 678 | 0.725183 | 0.48 | 2.0e-04 | Click! |
| chr9_63665478_63665629 | Smad3 | 994 | 0.579986 | 0.48 | 2.4e-04 | Click! |
| chr9_63702535_63702941 | Smad3 | 9231 | 0.230546 | 0.44 | 8.0e-04 | Click! |
Move your cursor over a bar to see sample name and corresponding Z-value.
| Cis Regulatory Element (CRE) | Target Score | Top associated gene | Gene Info | Distance of CRE to TSS | CRE/Gene association probability |
|---|---|---|---|---|---|
| chr16_33563259_33564001 | 5.08 |
Slc12a8 |
solute carrier family 12 (potassium/chloride transporters), member 8 |
32932 |
0.21 |
| chr7_34570196_34571084 | 3.05 |
Gm12784 |
predicted gene 12784 |
23434 |
0.15 |
| chr1_36017054_36017488 | 2.66 |
4930535G08Rik |
RIKEN cDNA 4930535G08 gene |
6199 |
0.14 |
| chr5_111770196_111770736 | 2.62 |
E130006D01Rik |
RIKEN cDNA E130006D01 gene |
8741 |
0.18 |
| chrX_18461302_18461622 | 2.52 |
Dipk2b |
divergent protein kinase domain 2B |
65 |
0.99 |
| chr12_90946204_90946419 | 2.45 |
Gm47688 |
predicted gene, 47688 |
7929 |
0.18 |
| chr4_118123073_118123998 | 2.45 |
St3gal3 |
ST3 beta-galactoside alpha-2,3-sialyltransferase 3 |
11347 |
0.16 |
| chr13_95743006_95743392 | 2.44 |
Gm32880 |
predicted gene, 32880 |
6616 |
0.17 |
| chr10_27916561_27916712 | 2.40 |
Gm10145 |
predicted gene 10145 |
19728 |
0.21 |
| chr10_60814402_60815129 | 2.37 |
Gm19972 |
predicted gene, 19972 |
442 |
0.82 |
| chr5_29826796_29827181 | 2.37 |
Gm1969 |
predicted gene 1969 |
6319 |
0.16 |
| chr7_58788607_58788797 | 2.19 |
Gm6226 |
predicted gene 6226 |
49236 |
0.11 |
| chr5_130623231_130623604 | 2.17 |
Gm43418 |
predicted gene 43418 |
4866 |
0.31 |
| chr6_37415105_37415455 | 2.17 |
Creb3l2 |
cAMP responsive element binding protein 3-like 2 |
26866 |
0.23 |
| chr4_32936855_32937006 | 2.17 |
Ankrd6 |
ankyrin repeat domain 6 |
13425 |
0.15 |
| chr15_77037711_77038357 | 2.15 |
Apol6 |
apolipoprotein L 6 |
6695 |
0.11 |
| chr16_26185747_26186199 | 2.14 |
P3h2 |
prolyl 3-hydroxylase 2 |
80189 |
0.11 |
| chr11_89839999_89840269 | 2.14 |
Ankfn1 |
ankyrin-repeat and fibronectin type III domain containing 1 |
1132 |
0.65 |
| chr2_4587704_4588084 | 2.13 |
Gm13179 |
predicted gene 13179 |
607 |
0.75 |
| chr5_118841243_118841410 | 2.10 |
Gm43782 |
predicted gene 43782 |
36139 |
0.16 |
| chr3_37556911_37557062 | 2.09 |
Gm12564 |
predicted gene 12564 |
483 |
0.74 |
| chr12_73476435_73476590 | 2.09 |
Gm48656 |
predicted gene, 48656 |
19605 |
0.14 |
| chr6_145796283_145796465 | 2.08 |
Rassf8 |
Ras association (RalGDS/AF-6) domain family (N-terminal) member 8 |
12009 |
0.2 |
| chr14_24253616_24253813 | 2.08 |
Dlg5 |
discs large MAGUK scaffold protein 5 |
7794 |
0.12 |
| chr3_30105594_30105754 | 2.07 |
Mecom |
MDS1 and EVI1 complex locus |
34749 |
0.17 |
| chr4_81536815_81537138 | 2.06 |
Gm11765 |
predicted gene 11765 |
75244 |
0.11 |
| chr4_54470200_54470449 | 2.06 |
Tpt1-ps2 |
tumor protein, translationally-controlled, pseudogene 2 |
94299 |
0.08 |
| chr7_98734976_98735159 | 2.00 |
Gm44934 |
predicted gene 44934 |
14 |
0.97 |
| chr13_3673662_3673861 | 1.99 |
Gm23084 |
predicted gene, 23084 |
25224 |
0.14 |
| chr4_64346751_64346902 | 1.99 |
Gm11217 |
predicted gene 11217 |
70223 |
0.12 |
| chr4_64142366_64142523 | 1.98 |
8030451A03Rik |
RIKEN cDNA 8030451A03 gene |
6109 |
0.27 |
| chr5_119651194_119652007 | 1.98 |
Gm16064 |
predicted gene 16064 |
5466 |
0.15 |
| chr3_152293671_152294039 | 1.97 |
Miga1 |
mitoguardin 1 |
3775 |
0.17 |
| chr7_34745966_34746493 | 1.97 |
Chst8 |
carbohydrate sulfotransferase 8 |
7583 |
0.21 |
| chr18_52528784_52530095 | 1.96 |
Lox |
lysyl oxidase |
235 |
0.83 |
| chr9_49989763_49990274 | 1.96 |
Gm47543 |
predicted gene, 47543 |
35140 |
0.21 |
| chrX_157697914_157698065 | 1.95 |
Smpx |
small muscle protein, X-linked |
921 |
0.5 |
| chr10_91241133_91241544 | 1.93 |
Gm47081 |
predicted gene, 47081 |
13152 |
0.15 |
| chr4_154224325_154224664 | 1.93 |
Gm13132 |
predicted gene 13132 |
3953 |
0.18 |
| chr11_46069532_46070017 | 1.93 |
Adam19 |
a disintegrin and metallopeptidase domain 19 (meltrin beta) |
13716 |
0.13 |
| chr1_43154599_43154789 | 1.93 |
Fhl2 |
four and a half LIM domains 2 |
9267 |
0.17 |
| chr3_97039910_97040067 | 1.93 |
Gja5 |
gap junction protein, alpha 5 |
7572 |
0.17 |
| chr18_33510187_33510545 | 1.91 |
Gm10549 |
predicted gene 10549 |
44161 |
0.15 |
| chr14_105377776_105377984 | 1.91 |
5430440P10Rik |
RIKEN cDNA 5430440P10 gene |
49679 |
0.12 |
| chr10_121386336_121386636 | 1.90 |
Gns |
glucosamine (N-acetyl)-6-sulfatase |
3371 |
0.17 |
| chr14_70179651_70180062 | 1.87 |
Pdlim2 |
PDZ and LIM domain 2 |
2175 |
0.2 |
| chr13_97577465_97577649 | 1.87 |
Gm5086 |
predicted gene 5086 |
17531 |
0.15 |
| chr7_25707425_25707989 | 1.87 |
Ccdc97 |
coiled-coil domain containing 97 |
8399 |
0.09 |
| chr18_80330476_80330634 | 1.87 |
Gm26676 |
predicted gene, 26676 |
7220 |
0.14 |
| chr7_112656145_112656626 | 1.87 |
Gm45473 |
predicted gene 45473 |
3603 |
0.2 |
| chr18_7502471_7502674 | 1.86 |
Mpp7 |
membrane protein, palmitoylated 7 (MAGUK p55 subfamily member 7) |
36399 |
0.17 |
| chr4_123247264_123247454 | 1.83 |
Heyl |
hairy/enhancer-of-split related with YRPW motif-like |
7602 |
0.11 |
| chr4_75329554_75329789 | 1.82 |
Gm11255 |
predicted gene 11255 |
5170 |
0.24 |
| chr11_94928772_94929260 | 1.82 |
Col1a1 |
collagen, type I, alpha 1 |
7208 |
0.12 |
| chr3_121577007_121577572 | 1.82 |
Slc44a3 |
solute carrier family 44, member 3 |
44885 |
0.11 |
| chr7_112144830_112145060 | 1.81 |
Dkk3 |
dickkopf WNT signaling pathway inhibitor 3 |
14112 |
0.24 |
| chr4_88950526_88950917 | 1.80 |
Gm49890 |
predicted gene, 49890 |
12200 |
0.12 |
| chr13_56575708_56576109 | 1.80 |
2010203P06Rik |
RIKEN cDNA 2010203P06 gene |
19629 |
0.15 |
| chr14_76810961_76811412 | 1.78 |
Gm48968 |
predicted gene, 48968 |
21635 |
0.16 |
| chr5_72501531_72501682 | 1.77 |
Corin |
corin, serine peptidase |
2602 |
0.19 |
| chr7_144569553_144569764 | 1.76 |
Faddos |
Fas (TNFRSF6)-associated via death domain, opposite strand |
2303 |
0.24 |
| chr8_77711737_77712181 | 1.76 |
4933431K23Rik |
RIKEN cDNA 4933431K23 gene |
11625 |
0.17 |
| chr9_13645162_13645510 | 1.76 |
Maml2 |
mastermind like transcriptional coactivator 2 |
17124 |
0.19 |
| chr8_77351539_77351810 | 1.75 |
Gm45285 |
predicted gene 45285 |
19704 |
0.16 |
| chr4_83831550_83831799 | 1.75 |
Gm11415 |
predicted gene 11415 |
57184 |
0.13 |
| chr10_53181299_53181450 | 1.73 |
Gm40649 |
predicted gene, 40649 |
194 |
0.94 |
| chr3_19426322_19426577 | 1.73 |
Dnajc5b |
DnaJ heat shock protein family (Hsp40) member C5 beta |
82146 |
0.09 |
| chr11_109927007_109927334 | 1.72 |
Gm11697 |
predicted gene 11697 |
9146 |
0.22 |
| chr9_117394284_117394469 | 1.72 |
Gm20396 |
predicted gene 20396 |
8603 |
0.31 |
| chr15_32257872_32258155 | 1.72 |
Sema5a |
sema domain, seven thrombospondin repeats (type 1 and type 1-like), transmembrane domain (TM) and short cytoplasmic domain, (semaphorin) 5A |
12910 |
0.16 |
| chr6_4994771_4994952 | 1.71 |
Gm26556 |
predicted gene, 26556 |
35878 |
0.14 |
| chr14_79180443_79180610 | 1.70 |
Gm4632 |
predicted gene 4632 |
18664 |
0.14 |
| chr14_76681663_76681956 | 1.70 |
1700108F19Rik |
RIKEN cDNA 1700108F19 gene |
55 |
0.98 |
| chr10_122911730_122912075 | 1.70 |
Ppm1h |
protein phosphatase 1H (PP2C domain containing) |
16534 |
0.2 |
| chr9_49976151_49976668 | 1.69 |
Gm47543 |
predicted gene, 47543 |
21531 |
0.25 |
| chr4_114501189_114501352 | 1.67 |
Trabd2b |
TraB domain containing 2B |
94546 |
0.08 |
| chr3_104790339_104791400 | 1.67 |
Rhoc |
ras homolog family member C |
1114 |
0.3 |
| chr6_16764867_16765018 | 1.67 |
Gm36669 |
predicted gene, 36669 |
12582 |
0.27 |
| chr6_4489804_4490272 | 1.67 |
Gm37883 |
predicted gene, 37883 |
5840 |
0.16 |
| chr7_99356524_99357152 | 1.66 |
Serpinh1 |
serine (or cysteine) peptidase inhibitor, clade H, member 1 |
3599 |
0.18 |
| chr4_20777672_20778960 | 1.66 |
Nkain3 |
Na+/K+ transporting ATPase interacting 3 |
251 |
0.96 |
| chr15_85610328_85611290 | 1.66 |
Wnt7b |
wingless-type MMTV integration site family, member 7B |
28336 |
0.12 |
| chr4_82304607_82304811 | 1.66 |
n-R5s188 |
nuclear encoded rRNA 5S 188 |
134701 |
0.05 |
| chr1_135858973_135859124 | 1.66 |
Tnnt2 |
troponin T2, cardiac |
9598 |
0.12 |
| chr9_33858691_33858998 | 1.66 |
Gm47784 |
predicted gene, 47784 |
2359 |
0.32 |
| chr2_4621016_4621388 | 1.66 |
Prpf18 |
pre-mRNA processing factor 18 |
30879 |
0.15 |
| chr16_24494651_24494847 | 1.65 |
Morf4l1-ps1 |
mortality factor 4 like 1, pseudogene 1 |
34645 |
0.17 |
| chr4_155283001_155283234 | 1.65 |
Prkcz |
protein kinase C, zeta |
10075 |
0.16 |
| chr9_29025762_29025914 | 1.65 |
Ntm |
neurotrimin |
11579 |
0.24 |
| chr3_83783812_83783963 | 1.65 |
Gm26771 |
predicted gene, 26771 |
6069 |
0.18 |
| chr13_60226549_60226831 | 1.64 |
Gm5084 |
predicted gene 5084 |
14757 |
0.17 |
| chr19_22905041_22905207 | 1.64 |
Trpm3 |
transient receptor potential cation channel, subfamily M, member 3 |
138490 |
0.04 |
| chr8_124643518_124643825 | 1.63 |
2310022B05Rik |
RIKEN cDNA 2310022B05 gene |
19698 |
0.14 |
| chr15_23452243_23452457 | 1.63 |
Gm6533 |
predicted gene 6533 |
37541 |
0.18 |
| chr1_62579119_62579270 | 1.63 |
Gm29084 |
predicted gene 29084 |
43252 |
0.14 |
| chr14_61258487_61258648 | 1.63 |
Sgcg |
sarcoglycan, gamma (dystrophin-associated glycoprotein) |
77 |
0.96 |
| chr18_36069348_36069579 | 1.62 |
Nrg2 |
neuregulin 2 |
838 |
0.62 |
| chr9_7545568_7545862 | 1.62 |
Mmp8 |
matrix metallopeptidase 8 |
12741 |
0.15 |
| chr9_14631736_14631902 | 1.61 |
Amotl1 |
angiomotin-like 1 |
11710 |
0.11 |
| chr15_98149135_98149340 | 1.61 |
Asb8 |
ankyrin repeat and SOCS box-containing 8 |
3531 |
0.15 |
| chr9_16988235_16988386 | 1.60 |
Gm5611 |
predicted gene 5611 |
41735 |
0.22 |
| chr8_44801663_44802086 | 1.60 |
Gm9908 |
predicted gene 9908 |
133285 |
0.05 |
| chr15_82983151_82983317 | 1.60 |
Gm29019 |
predicted gene 29019 |
4478 |
0.15 |
| chr16_21370010_21370180 | 1.60 |
Magef1 |
melanoma antigen family F, 1 |
36739 |
0.15 |
| chr5_116301148_116301299 | 1.60 |
Gm13839 |
predicted gene 13839 |
77 |
0.95 |
| chr13_73887462_73887897 | 1.59 |
Trip13 |
thyroid hormone receptor interactor 13 |
33535 |
0.1 |
| chr13_51408491_51409234 | 1.58 |
S1pr3 |
sphingosine-1-phosphate receptor 3 |
223 |
0.94 |
| chr9_42187917_42188126 | 1.58 |
4930546K05Rik |
RIKEN cDNA 4930546K05 gene |
21192 |
0.17 |
| chr11_101830206_101830433 | 1.57 |
Etv4 |
ets variant 4 |
44948 |
0.09 |
| chr16_29734899_29735426 | 1.57 |
Gm49636 |
predicted gene, 49636 |
19150 |
0.22 |
| chr2_152544681_152545047 | 1.57 |
Defb29 |
defensin beta 29 |
4766 |
0.08 |
| chr9_40268412_40269319 | 1.56 |
Scn3b |
sodium channel, voltage-gated, type III, beta |
352 |
0.82 |
| chr14_21707021_21707750 | 1.56 |
Dupd1 |
dual specificity phosphatase and pro isomerase domain containing 1 |
4283 |
0.19 |
| chr16_21402126_21402344 | 1.56 |
Vps8 |
VPS8 CORVET complex subunit |
20883 |
0.21 |
| chr10_21695311_21695479 | 1.56 |
Gm5420 |
predicted gene 5420 |
4550 |
0.25 |
| chr13_63522824_63523127 | 1.55 |
Ptch1 |
patched 1 |
10946 |
0.15 |
| chr3_79628270_79629417 | 1.55 |
Etfdh |
electron transferring flavoprotein, dehydrogenase |
20 |
0.75 |
| chr1_54597751_54597902 | 1.55 |
Gm19637 |
predicted gene, 19637 |
31123 |
0.14 |
| chr3_101395397_101395703 | 1.55 |
Gm42939 |
predicted gene 42939 |
12243 |
0.14 |
| chrX_48418227_48418600 | 1.54 |
Elf4 |
E74-like factor 4 (ets domain transcription factor) |
35756 |
0.14 |
| chr13_63170230_63170678 | 1.54 |
Aopep |
aminopeptidase O |
18950 |
0.12 |
| chr14_48207165_48207469 | 1.54 |
Peli2 |
pellino 2 |
8601 |
0.15 |
| chr12_112491755_112491906 | 1.54 |
A530016L24Rik |
RIKEN cDNA A530016L24 gene |
2356 |
0.25 |
| chr16_45810774_45811256 | 1.53 |
Phldb2 |
pleckstrin homology like domain, family B, member 2 |
9444 |
0.2 |
| chr15_77018898_77019231 | 1.53 |
Mb |
myoglobin |
2899 |
0.15 |
| chr4_98223390_98223614 | 1.53 |
Gm12692 |
predicted gene 12692 |
11788 |
0.21 |
| chr13_93855099_93855270 | 1.52 |
Mir5624 |
microRNA 5624 |
64407 |
0.08 |
| chr2_4334159_4334601 | 1.51 |
Frmd4a |
FERM domain containing 4A |
1914 |
0.3 |
| chr18_8328424_8328744 | 1.51 |
Gm5500 |
predicted pseudogene 5500 |
86545 |
0.09 |
| chr18_39302833_39303052 | 1.50 |
Gm15336 |
predicted gene 15336 |
252 |
0.92 |
| chr3_53674367_53674518 | 1.50 |
Gm6073 |
predicted gene 6073 |
7114 |
0.15 |
| chr9_110762827_110762988 | 1.50 |
Myl3 |
myosin, light polypeptide 3 |
739 |
0.52 |
| chrX_102003725_102004324 | 1.50 |
Nhsl2 |
NHS-like 2 |
1020 |
0.5 |
| chr15_74923838_74924037 | 1.49 |
Gm6610 |
predicted gene 6610 |
507 |
0.62 |
| chr9_56868158_56868636 | 1.49 |
Cspg4 |
chondroitin sulfate proteoglycan 4 |
3364 |
0.16 |
| chr14_101494013_101494504 | 1.49 |
Tbc1d4 |
TBC1 domain family, member 4 |
6850 |
0.27 |
| chr11_63025453_63025799 | 1.49 |
Cdrt4os1 |
CMT1A duplicated region transcript 4, opposite strand 1 |
21492 |
0.15 |
| chr17_45279348_45279645 | 1.48 |
Gm24979 |
predicted gene, 24979 |
69530 |
0.1 |
| chr7_143112469_143112660 | 1.48 |
Kcnq1 |
potassium voltage-gated channel, subfamily Q, member 1 |
3370 |
0.14 |
| chr3_94565320_94565471 | 1.48 |
Snx27 |
sorting nexin family member 27 |
3363 |
0.12 |
| chr8_24626724_24627273 | 1.47 |
Adam18 |
a disintegrin and metallopeptidase domain 18 |
1256 |
0.43 |
| chr6_136898297_136898670 | 1.47 |
Mgp |
matrix Gla protein |
22660 |
0.09 |
| chr6_32179761_32179969 | 1.47 |
Plxna4 |
plexin A4 |
45334 |
0.16 |
| chr1_51996934_51997549 | 1.46 |
Stat4 |
signal transducer and activator of transcription 4 |
10093 |
0.17 |
| chr12_103353531_103353924 | 1.46 |
Asb2 |
ankyrin repeat and SOCS box-containing 2 |
2274 |
0.17 |
| chr12_9901890_9902353 | 1.46 |
Gm22845 |
predicted gene, 22845 |
36671 |
0.21 |
| chr16_19759999_19760363 | 1.45 |
B3gnt5 |
UDP-GlcNAc:betaGal beta-1,3-N-acetylglucosaminyltransferase 5 |
27 |
0.98 |
| chr12_73794134_73794630 | 1.45 |
Gm8075 |
predicted gene 8075 |
894 |
0.62 |
| chr1_62577268_62577547 | 1.45 |
Gm29084 |
predicted gene 29084 |
41465 |
0.15 |
| chr14_23494440_23494671 | 1.44 |
5430425E15Rik |
RIKEN cDNA 5430425E15 gene |
25107 |
0.21 |
| chr1_138905524_138905688 | 1.44 |
Gm3933 |
predicted gene 3933 |
10437 |
0.12 |
| chr8_61697842_61697993 | 1.44 |
Palld |
palladin, cytoskeletal associated protein |
62172 |
0.13 |
| chr8_124182207_124182690 | 1.44 |
Gm3889 |
predicted gene 3889 |
22375 |
0.16 |
| chr11_4309138_4309322 | 1.44 |
Gm24803 |
predicted gene, 24803 |
15025 |
0.12 |
| chr9_120455978_120456567 | 1.43 |
Myrip |
myosin VIIA and Rab interacting protein |
28866 |
0.12 |
| chr16_55378800_55378951 | 1.43 |
Zpld1 |
zona pellucida like domain containing 1 |
80889 |
0.1 |
| chr14_25196881_25197203 | 1.43 |
4930572O13Rik |
RIKEN cDNA 4930572O13 gene |
53801 |
0.12 |
| chr10_122912730_122913440 | 1.43 |
Ppm1h |
protein phosphatase 1H (PP2C domain containing) |
17717 |
0.2 |
| chr2_22895114_22896094 | 1.43 |
Pdss1 |
prenyl (solanesyl) diphosphate synthase, subunit 1 |
9 |
0.63 |
| chr11_61485173_61485597 | 1.42 |
Mfap4 |
microfibrillar-associated protein 4 |
46 |
0.96 |
| chr14_76461290_76461465 | 1.41 |
Tsc22d1 |
TSC22 domain family, member 1 |
15540 |
0.23 |
| chr2_32063819_32064175 | 1.41 |
Gm16534 |
predicted gene 16534 |
167 |
0.91 |
| chr18_25645604_25645941 | 1.40 |
Gm3227 |
predicted gene 3227 |
48282 |
0.16 |
| chr5_52051760_52052000 | 1.40 |
Gm43174 |
predicted gene 43174 |
30452 |
0.15 |
| chr10_66935669_66936029 | 1.40 |
Gm26576 |
predicted gene, 26576 |
15547 |
0.15 |
| chr7_30610166_30610340 | 1.40 |
Upk1a |
uroplakin 1A |
2594 |
0.09 |
| chr6_100732315_100732977 | 1.40 |
Gm15576 |
predicted gene 15576 |
6412 |
0.18 |
| chr6_91389110_91389432 | 1.40 |
Wnt7a |
wingless-type MMTV integration site family, member 7A |
22092 |
0.11 |
| chr1_37512098_37512383 | 1.39 |
Mgat4a |
mannoside acetylglucosaminyltransferase 4, isoenzyme A |
13402 |
0.15 |
| chr1_90716753_90716904 | 1.39 |
Gm9991 |
predicted gene 9991 |
41667 |
0.15 |
| chr16_17798400_17798898 | 1.39 |
Scarf2 |
scavenger receptor class F, member 2 |
1299 |
0.27 |
| chr13_42346503_42346841 | 1.39 |
Gm47118 |
predicted gene, 47118 |
41681 |
0.16 |
| chr13_56601292_56601536 | 1.39 |
2010203P06Rik |
RIKEN cDNA 2010203P06 gene |
5877 |
0.19 |
| chr4_154480751_154480923 | 1.39 |
Prdm16 |
PR domain containing 16 |
47928 |
0.13 |
| chr8_71379428_71380688 | 1.39 |
Nr2f6 |
nuclear receptor subfamily 2, group F, member 6 |
851 |
0.4 |
| chr6_148404507_148404886 | 1.38 |
Gm44022 |
predicted gene, 44022 |
13367 |
0.16 |
| chr19_44907851_44908353 | 1.38 |
Slf2 |
SMC5-SMC6 complex localization factor 2 |
23049 |
0.12 |
| chr4_107962144_107962358 | 1.38 |
Slc1a7 |
solute carrier family 1 (glutamate transporter), member 7 |
6081 |
0.14 |
| chr12_27187507_27187842 | 1.38 |
Gm9866 |
predicted gene 9866 |
27041 |
0.24 |
| chr9_21196197_21196830 | 1.38 |
Pde4a |
phosphodiesterase 4A, cAMP specific |
192 |
0.89 |
| chr7_45460493_45461322 | 1.37 |
Ftl1 |
ferritin light polypeptide 1 |
1023 |
0.19 |
| chr1_40139776_40140190 | 1.37 |
Gm37347 |
predicted gene, 37347 |
51472 |
0.1 |
| chr1_156760718_156761135 | 1.37 |
Gm15428 |
predicted pseudogene 15428 |
32586 |
0.12 |
| chr12_3364588_3366025 | 1.37 |
Kif3c |
kinesin family member 3C |
116 |
0.94 |
| chr18_41985739_41985890 | 1.37 |
Grxcr2 |
glutaredoxin, cysteine rich 2 |
13235 |
0.2 |
| chr4_63600871_63601048 | 1.37 |
Gm11213 |
predicted gene 11213 |
195 |
0.9 |
| chr4_89433459_89434002 | 1.37 |
Gm12608 |
predicted gene 12608 |
10914 |
0.19 |
| chr16_57479862_57480018 | 1.37 |
Filip1l |
filamin A interacting protein 1-like |
69302 |
0.11 |
| chrX_12996527_12996722 | 1.37 |
5730405O15Rik |
RIKEN cDNA 5730405O15 gene |
45391 |
0.11 |
| chr8_11362521_11362713 | 1.36 |
Col4a2 |
collagen, type IV, alpha 2 |
42291 |
0.11 |
| chr16_57765666_57765830 | 1.36 |
Gm5674 |
predicted gene 5674 |
3500 |
0.19 |
| chr14_99381978_99382324 | 1.36 |
Gm49219 |
predicted gene, 49219 |
5288 |
0.16 |
| chr2_4517469_4518023 | 1.36 |
Frmd4a |
FERM domain containing 4A |
42008 |
0.14 |
| chr19_37795640_37795791 | 1.36 |
Gm9067 |
predicted gene 9067 |
11449 |
0.21 |
| chr8_121315980_121316412 | 1.35 |
Gm26815 |
predicted gene, 26815 |
40640 |
0.15 |
| chr2_166148776_166148978 | 1.35 |
Sulf2 |
sulfatase 2 |
5546 |
0.19 |
| chr9_58295835_58296041 | 1.35 |
Loxl1 |
lysyl oxidase-like 1 |
17248 |
0.13 |
| chr11_45838507_45838961 | 1.34 |
Gm22751 |
predicted gene, 22751 |
8955 |
0.14 |
| chr3_126660735_126660952 | 1.34 |
Gm43005 |
predicted gene 43005 |
1536 |
0.27 |
| chr11_35120866_35121257 | 1.34 |
Slit3 |
slit guidance ligand 3 |
163 |
0.97 |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.7 | 2.2 | GO:0086046 | membrane depolarization during SA node cell action potential(GO:0086046) |
| 0.7 | 1.4 | GO:0086045 | membrane depolarization during AV node cell action potential(GO:0086045) |
| 0.6 | 1.9 | GO:0035860 | glial cell-derived neurotrophic factor receptor signaling pathway(GO:0035860) |
| 0.5 | 1.5 | GO:1904956 | regulation of midbrain dopaminergic neuron differentiation(GO:1904956) |
| 0.5 | 1.5 | GO:1902564 | negative regulation of neutrophil activation(GO:1902564) |
| 0.5 | 1.5 | GO:0097623 | potassium ion export across plasma membrane(GO:0097623) |
| 0.5 | 2.4 | GO:0003228 | atrial cardiac muscle tissue development(GO:0003228) atrial cardiac muscle tissue morphogenesis(GO:0055009) |
| 0.5 | 1.4 | GO:0060584 | regulation of prostaglandin-endoperoxide synthase activity(GO:0060584) positive regulation of prostaglandin-endoperoxide synthase activity(GO:0060585) |
| 0.4 | 1.3 | GO:0097168 | mesenchymal stem cell proliferation(GO:0097168) |
| 0.4 | 0.4 | GO:0061047 | positive regulation of branching involved in lung morphogenesis(GO:0061047) |
| 0.4 | 1.2 | GO:1902268 | negative regulation of polyamine transmembrane transport(GO:1902268) |
| 0.4 | 1.2 | GO:0021564 | vagus nerve development(GO:0021564) |
| 0.4 | 1.6 | GO:0060221 | retinal rod cell differentiation(GO:0060221) |
| 0.4 | 2.3 | GO:0060371 | regulation of atrial cardiac muscle cell membrane depolarization(GO:0060371) |
| 0.4 | 1.1 | GO:0071492 | cellular response to UV-A(GO:0071492) |
| 0.4 | 2.5 | GO:0048251 | elastic fiber assembly(GO:0048251) |
| 0.4 | 1.1 | GO:0018242 | protein O-linked glycosylation via serine(GO:0018242) |
| 0.4 | 1.4 | GO:0014012 | peripheral nervous system axon regeneration(GO:0014012) |
| 0.3 | 2.4 | GO:0060482 | lobar bronchus development(GO:0060482) |
| 0.3 | 1.4 | GO:0070100 | negative regulation of chemokine-mediated signaling pathway(GO:0070100) |
| 0.3 | 0.3 | GO:0021823 | cerebral cortex tangential migration using cell-cell interactions(GO:0021823) postnatal olfactory bulb interneuron migration(GO:0021827) |
| 0.3 | 2.0 | GO:1900028 | negative regulation of ruffle assembly(GO:1900028) |
| 0.3 | 1.0 | GO:0032289 | central nervous system myelin formation(GO:0032289) |
| 0.3 | 1.0 | GO:1900238 | positive regulation of metanephric mesenchymal cell migration by platelet-derived growth factor receptor-beta signaling pathway(GO:0035793) regulation of metanephric mesenchymal cell migration by platelet-derived growth factor receptor-beta signaling pathway(GO:1900238) positive regulation of metanephric mesenchymal cell migration(GO:2000591) |
| 0.3 | 1.3 | GO:0060486 | Clara cell differentiation(GO:0060486) |
| 0.3 | 1.0 | GO:0007525 | somatic muscle development(GO:0007525) |
| 0.3 | 0.9 | GO:2000721 | positive regulation of transcription from RNA polymerase II promoter involved in smooth muscle cell differentiation(GO:2000721) |
| 0.3 | 0.9 | GO:0061368 | behavioral response to chemical pain(GO:0061366) behavioral response to formalin induced pain(GO:0061368) |
| 0.3 | 1.3 | GO:0001957 | intramembranous ossification(GO:0001957) direct ossification(GO:0036072) |
| 0.3 | 0.9 | GO:0010735 | positive regulation of transcription via serum response element binding(GO:0010735) |
| 0.3 | 0.9 | GO:2000297 | negative regulation of synapse maturation(GO:2000297) |
| 0.3 | 0.9 | GO:0060591 | chondroblast differentiation(GO:0060591) |
| 0.3 | 0.8 | GO:0014707 | branchiomeric skeletal muscle development(GO:0014707) |
| 0.3 | 0.3 | GO:0061031 | endodermal digestive tract morphogenesis(GO:0061031) |
| 0.3 | 2.6 | GO:0014883 | transition between fast and slow fiber(GO:0014883) |
| 0.3 | 0.8 | GO:0009233 | menaquinone metabolic process(GO:0009233) |
| 0.3 | 0.8 | GO:0021773 | striatal medium spiny neuron differentiation(GO:0021773) |
| 0.3 | 0.8 | GO:0042427 | serotonin biosynthetic process(GO:0042427) primary amino compound biosynthetic process(GO:1901162) |
| 0.3 | 6.1 | GO:0060351 | cartilage development involved in endochondral bone morphogenesis(GO:0060351) |
| 0.2 | 0.2 | GO:0007403 | glial cell fate determination(GO:0007403) |
| 0.2 | 0.5 | GO:0044333 | Wnt signaling pathway involved in digestive tract morphogenesis(GO:0044333) |
| 0.2 | 0.2 | GO:0010643 | cell communication by chemical coupling(GO:0010643) |
| 0.2 | 0.7 | GO:0010908 | regulation of heparan sulfate proteoglycan biosynthetic process(GO:0010908) positive regulation of heparan sulfate proteoglycan biosynthetic process(GO:0010909) positive regulation of proteoglycan biosynthetic process(GO:1902730) |
| 0.2 | 1.0 | GO:0060414 | aorta smooth muscle tissue morphogenesis(GO:0060414) |
| 0.2 | 0.5 | GO:1902809 | regulation of skeletal muscle fiber differentiation(GO:1902809) |
| 0.2 | 1.7 | GO:0007442 | hindgut morphogenesis(GO:0007442) |
| 0.2 | 1.0 | GO:0048865 | stem cell fate commitment(GO:0048865) |
| 0.2 | 1.2 | GO:0021631 | optic nerve morphogenesis(GO:0021631) |
| 0.2 | 0.7 | GO:0007223 | Wnt signaling pathway, calcium modulating pathway(GO:0007223) |
| 0.2 | 1.6 | GO:1902669 | positive regulation of axon extension involved in axon guidance(GO:0048842) positive regulation of axon guidance(GO:1902669) |
| 0.2 | 1.6 | GO:0045602 | negative regulation of endothelial cell differentiation(GO:0045602) |
| 0.2 | 0.9 | GO:1903011 | negative regulation of bone development(GO:1903011) |
| 0.2 | 0.9 | GO:0051791 | medium-chain fatty acid metabolic process(GO:0051791) |
| 0.2 | 2.0 | GO:0050957 | equilibrioception(GO:0050957) |
| 0.2 | 1.6 | GO:2000653 | regulation of genetic imprinting(GO:2000653) |
| 0.2 | 0.7 | GO:0035609 | C-terminal protein deglutamylation(GO:0035609) |
| 0.2 | 0.7 | GO:1904378 | maintenance of unfolded protein(GO:0036506) maintenance of unfolded protein involved in ERAD pathway(GO:1904378) |
| 0.2 | 0.7 | GO:0010979 | regulation of vitamin D 24-hydroxylase activity(GO:0010979) positive regulation of vitamin D 24-hydroxylase activity(GO:0010980) |
| 0.2 | 0.9 | GO:0051725 | protein de-ADP-ribosylation(GO:0051725) |
| 0.2 | 0.6 | GO:0003289 | atrial septum primum morphogenesis(GO:0003289) |
| 0.2 | 0.4 | GO:0072205 | metanephric collecting duct development(GO:0072205) |
| 0.2 | 0.2 | GO:0050705 | regulation of interleukin-1 alpha secretion(GO:0050705) |
| 0.2 | 0.2 | GO:0051890 | regulation of cardioblast differentiation(GO:0051890) |
| 0.2 | 0.2 | GO:0046684 | response to pyrethroid(GO:0046684) |
| 0.2 | 0.4 | GO:2000110 | negative regulation of macrophage apoptotic process(GO:2000110) |
| 0.2 | 0.8 | GO:0032808 | lacrimal gland development(GO:0032808) |
| 0.2 | 0.6 | GO:0051410 | detoxification of nitrogen compound(GO:0051410) cellular detoxification of nitrogen compound(GO:0070458) |
| 0.2 | 1.2 | GO:0086073 | bundle of His cell-Purkinje myocyte adhesion involved in cell communication(GO:0086073) |
| 0.2 | 0.8 | GO:0003176 | aortic valve development(GO:0003176) aortic valve morphogenesis(GO:0003180) |
| 0.2 | 0.4 | GO:1990123 | L-glutamate(1-) import into cell(GO:1903802) L-glutamate import into cell(GO:1990123) |
| 0.2 | 0.2 | GO:0086043 | bundle of His cell to Purkinje myocyte signaling(GO:0086028) bundle of His cell action potential(GO:0086043) |
| 0.2 | 1.2 | GO:0015671 | oxygen transport(GO:0015671) |
| 0.2 | 0.8 | GO:0048549 | positive regulation of pinocytosis(GO:0048549) |
| 0.2 | 0.8 | GO:0014877 | response to inactivity(GO:0014854) response to muscle inactivity(GO:0014870) response to muscle inactivity involved in regulation of muscle adaptation(GO:0014877) response to denervation involved in regulation of muscle adaptation(GO:0014894) |
| 0.2 | 0.8 | GO:0061304 | retinal blood vessel morphogenesis(GO:0061304) |
| 0.2 | 0.2 | GO:0046865 | retinol transport(GO:0034633) isoprenoid transport(GO:0046864) terpenoid transport(GO:0046865) |
| 0.2 | 0.4 | GO:0051891 | positive regulation of cardioblast differentiation(GO:0051891) |
| 0.2 | 0.8 | GO:0001880 | Mullerian duct regression(GO:0001880) |
| 0.2 | 1.1 | GO:1900029 | positive regulation of ruffle assembly(GO:1900029) |
| 0.2 | 0.2 | GO:0046552 | eye photoreceptor cell fate commitment(GO:0042706) photoreceptor cell fate commitment(GO:0046552) |
| 0.2 | 0.6 | GO:0060174 | limb bud formation(GO:0060174) |
| 0.2 | 0.7 | GO:1902953 | positive regulation of ER to Golgi vesicle-mediated transport(GO:1902953) |
| 0.2 | 0.2 | GO:0072106 | regulation of ureteric bud formation(GO:0072106) positive regulation of ureteric bud formation(GO:0072107) |
| 0.2 | 0.7 | GO:0090274 | positive regulation of somatostatin secretion(GO:0090274) |
| 0.2 | 0.2 | GO:2000017 | positive regulation of determination of dorsal identity(GO:2000017) |
| 0.2 | 0.7 | GO:0060083 | smooth muscle contraction involved in micturition(GO:0060083) |
| 0.2 | 0.9 | GO:0022038 | corpus callosum development(GO:0022038) |
| 0.2 | 0.5 | GO:0045218 | zonula adherens maintenance(GO:0045218) |
| 0.2 | 0.7 | GO:0030091 | protein repair(GO:0030091) |
| 0.2 | 0.4 | GO:0072193 | ureter smooth muscle development(GO:0072191) ureter smooth muscle cell differentiation(GO:0072193) |
| 0.2 | 0.4 | GO:0008588 | release of cytoplasmic sequestered NF-kappaB(GO:0008588) |
| 0.2 | 0.2 | GO:0035983 | response to trichostatin A(GO:0035983) cellular response to trichostatin A(GO:0035984) |
| 0.2 | 0.5 | GO:0051665 | membrane raft localization(GO:0051665) |
| 0.2 | 0.9 | GO:0033564 | anterior/posterior axon guidance(GO:0033564) |
| 0.2 | 0.5 | GO:0051599 | response to hydrostatic pressure(GO:0051599) |
| 0.2 | 0.3 | GO:0010159 | specification of organ position(GO:0010159) |
| 0.2 | 0.5 | GO:0002905 | mature B cell apoptotic process(GO:0002901) regulation of mature B cell apoptotic process(GO:0002905) negative regulation of mature B cell apoptotic process(GO:0002906) |
| 0.2 | 1.2 | GO:0014824 | tonic smooth muscle contraction(GO:0014820) artery smooth muscle contraction(GO:0014824) |
| 0.2 | 0.5 | GO:0038044 | transforming growth factor-beta secretion(GO:0038044) regulation of transforming growth factor-beta secretion(GO:2001201) |
| 0.2 | 0.2 | GO:0060748 | tertiary branching involved in mammary gland duct morphogenesis(GO:0060748) |
| 0.2 | 0.5 | GO:0060437 | lung growth(GO:0060437) |
| 0.2 | 1.2 | GO:2000348 | regulation of CD40 signaling pathway(GO:2000348) |
| 0.2 | 0.7 | GO:1902459 | positive regulation of stem cell population maintenance(GO:1902459) |
| 0.2 | 1.2 | GO:0034651 | cortisol biosynthetic process(GO:0034651) |
| 0.2 | 0.8 | GO:0060907 | positive regulation of macrophage cytokine production(GO:0060907) |
| 0.2 | 0.8 | GO:0097500 | receptor localization to nonmotile primary cilium(GO:0097500) |
| 0.2 | 0.8 | GO:1904261 | regulation of basement membrane assembly involved in embryonic body morphogenesis(GO:1904259) positive regulation of basement membrane assembly involved in embryonic body morphogenesis(GO:1904261) basement membrane assembly involved in embryonic body morphogenesis(GO:2001197) |
| 0.2 | 0.2 | GO:0090091 | positive regulation of extracellular matrix disassembly(GO:0090091) |
| 0.2 | 0.5 | GO:0051902 | negative regulation of mitochondrial depolarization(GO:0051902) |
| 0.2 | 0.2 | GO:0060686 | negative regulation of prostatic bud formation(GO:0060686) |
| 0.2 | 0.5 | GO:1901491 | negative regulation of lymphangiogenesis(GO:1901491) |
| 0.2 | 0.3 | GO:0089711 | L-glutamate transmembrane transport(GO:0089711) |
| 0.2 | 0.6 | GO:0045110 | intermediate filament bundle assembly(GO:0045110) |
| 0.2 | 0.5 | GO:0002314 | germinal center B cell differentiation(GO:0002314) |
| 0.2 | 0.3 | GO:0042360 | vitamin E metabolic process(GO:0042360) |
| 0.2 | 0.6 | GO:0010626 | negative regulation of Schwann cell proliferation(GO:0010626) |
| 0.2 | 1.1 | GO:0002035 | brain renin-angiotensin system(GO:0002035) |
| 0.2 | 2.8 | GO:0032232 | negative regulation of actin filament bundle assembly(GO:0032232) |
| 0.2 | 1.6 | GO:0051546 | keratinocyte migration(GO:0051546) |
| 0.2 | 0.6 | GO:0035995 | detection of muscle stretch(GO:0035995) |
| 0.2 | 0.6 | GO:2000680 | regulation of rubidium ion transport(GO:2000680) |
| 0.2 | 0.2 | GO:0003415 | chondrocyte hypertrophy(GO:0003415) |
| 0.2 | 0.3 | GO:1900245 | positive regulation of MDA-5 signaling pathway(GO:1900245) |
| 0.2 | 0.5 | GO:0042494 | detection of bacterial lipoprotein(GO:0042494) |
| 0.2 | 0.6 | GO:0070777 | D-aspartate transport(GO:0070777) D-aspartate import(GO:0070779) |
| 0.2 | 0.3 | GO:2000302 | positive regulation of synaptic vesicle exocytosis(GO:2000302) |
| 0.2 | 0.6 | GO:1902866 | regulation of retina development in camera-type eye(GO:1902866) |
| 0.2 | 0.2 | GO:1901187 | regulation of ephrin receptor signaling pathway(GO:1901187) |
| 0.2 | 0.2 | GO:0022009 | central nervous system vasculogenesis(GO:0022009) |
| 0.1 | 0.3 | GO:1901509 | regulation of endothelial tube morphogenesis(GO:1901509) |
| 0.1 | 0.4 | GO:0030167 | proteoglycan catabolic process(GO:0030167) |
| 0.1 | 1.8 | GO:0048745 | smooth muscle tissue development(GO:0048745) |
| 0.1 | 0.3 | GO:0090271 | positive regulation of fibroblast growth factor production(GO:0090271) |
| 0.1 | 0.1 | GO:0061146 | Peyer's patch morphogenesis(GO:0061146) |
| 0.1 | 1.3 | GO:0071625 | vocalization behavior(GO:0071625) |
| 0.1 | 0.4 | GO:2001170 | negative regulation of ATP biosynthetic process(GO:2001170) |
| 0.1 | 0.9 | GO:0090336 | positive regulation of brown fat cell differentiation(GO:0090336) |
| 0.1 | 0.7 | GO:1902308 | regulation of peptidyl-serine dephosphorylation(GO:1902308) |
| 0.1 | 0.4 | GO:1903423 | positive regulation of synaptic vesicle transport(GO:1902805) positive regulation of synaptic vesicle recycling(GO:1903423) |
| 0.1 | 0.6 | GO:0071205 | protein localization to juxtaparanode region of axon(GO:0071205) |
| 0.1 | 0.6 | GO:0071225 | cellular response to muramyl dipeptide(GO:0071225) |
| 0.1 | 0.4 | GO:0033088 | negative regulation of immature T cell proliferation in thymus(GO:0033088) |
| 0.1 | 0.9 | GO:0090050 | positive regulation of cell migration involved in sprouting angiogenesis(GO:0090050) |
| 0.1 | 0.1 | GO:0061209 | cell proliferation involved in mesonephros development(GO:0061209) |
| 0.1 | 2.2 | GO:0031290 | retinal ganglion cell axon guidance(GO:0031290) |
| 0.1 | 0.3 | GO:0021912 | regulation of transcription from RNA polymerase II promoter involved in spinal cord motor neuron fate specification(GO:0021912) |
| 0.1 | 0.4 | GO:0031034 | myosin filament assembly(GO:0031034) |
| 0.1 | 0.1 | GO:1990791 | dorsal root ganglion development(GO:1990791) |
| 0.1 | 0.3 | GO:0072092 | ureteric bud invasion(GO:0072092) |
| 0.1 | 0.3 | GO:0072137 | condensed mesenchymal cell proliferation(GO:0072137) |
| 0.1 | 0.1 | GO:0060594 | mammary gland specification(GO:0060594) |
| 0.1 | 0.4 | GO:0035887 | aortic smooth muscle cell differentiation(GO:0035887) |
| 0.1 | 0.8 | GO:0038063 | collagen-activated tyrosine kinase receptor signaling pathway(GO:0038063) |
| 0.1 | 0.4 | GO:0070366 | regulation of hepatocyte differentiation(GO:0070366) |
| 0.1 | 0.1 | GO:0048369 | lateral mesoderm morphogenesis(GO:0048369) lateral mesoderm formation(GO:0048370) lateral mesodermal cell differentiation(GO:0048371) |
| 0.1 | 0.4 | GO:0014722 | regulation of skeletal muscle contraction by calcium ion signaling(GO:0014722) |
| 0.1 | 1.9 | GO:0016486 | peptide hormone processing(GO:0016486) |
| 0.1 | 0.4 | GO:0060028 | convergent extension involved in axis elongation(GO:0060028) |
| 0.1 | 0.5 | GO:0070141 | response to UV-A(GO:0070141) |
| 0.1 | 0.6 | GO:0070314 | G1 to G0 transition(GO:0070314) |
| 0.1 | 0.4 | GO:0050717 | positive regulation of interleukin-1 alpha secretion(GO:0050717) |
| 0.1 | 0.4 | GO:0061743 | motor learning(GO:0061743) |
| 0.1 | 0.4 | GO:0035524 | proline transmembrane transport(GO:0035524) |
| 0.1 | 1.5 | GO:0014829 | vascular smooth muscle contraction(GO:0014829) |
| 0.1 | 0.4 | GO:0035694 | mitochondrial protein catabolic process(GO:0035694) |
| 0.1 | 0.6 | GO:0097264 | self proteolysis(GO:0097264) |
| 0.1 | 0.9 | GO:0051764 | actin crosslink formation(GO:0051764) |
| 0.1 | 0.2 | GO:0035262 | gonad morphogenesis(GO:0035262) |
| 0.1 | 0.8 | GO:0008063 | Toll signaling pathway(GO:0008063) |
| 0.1 | 0.7 | GO:0042693 | muscle cell fate commitment(GO:0042693) |
| 0.1 | 0.7 | GO:0010701 | positive regulation of norepinephrine secretion(GO:0010701) |
| 0.1 | 0.4 | GO:0002121 | inter-male aggressive behavior(GO:0002121) |
| 0.1 | 1.0 | GO:0090051 | negative regulation of cell migration involved in sprouting angiogenesis(GO:0090051) |
| 0.1 | 0.5 | GO:0014816 | skeletal muscle satellite cell differentiation(GO:0014816) |
| 0.1 | 0.1 | GO:0051344 | negative regulation of cyclic-nucleotide phosphodiesterase activity(GO:0051344) |
| 0.1 | 0.5 | GO:0042118 | endothelial cell activation(GO:0042118) |
| 0.1 | 0.4 | GO:1902498 | regulation of protein autoubiquitination(GO:1902498) |
| 0.1 | 0.5 | GO:0071692 | protein localization to extracellular region(GO:0071692) maintenance of protein location in extracellular region(GO:0071694) |
| 0.1 | 0.1 | GO:0003347 | epicardial cell to mesenchymal cell transition(GO:0003347) |
| 0.1 | 1.4 | GO:0009950 | dorsal/ventral axis specification(GO:0009950) |
| 0.1 | 0.6 | GO:0003148 | outflow tract septum morphogenesis(GO:0003148) |
| 0.1 | 0.5 | GO:0007296 | vitellogenesis(GO:0007296) |
| 0.1 | 0.5 | GO:0098903 | regulation of membrane repolarization during action potential(GO:0098903) |
| 0.1 | 0.1 | GO:1901979 | regulation of inward rectifier potassium channel activity(GO:1901979) |
| 0.1 | 0.3 | GO:0014734 | skeletal muscle hypertrophy(GO:0014734) |
| 0.1 | 0.3 | GO:0061055 | myotome development(GO:0061055) |
| 0.1 | 0.3 | GO:0048852 | diencephalon morphogenesis(GO:0048852) |
| 0.1 | 0.3 | GO:1903279 | regulation of calcium:sodium antiporter activity(GO:1903279) |
| 0.1 | 0.2 | GO:0033058 | directional locomotion(GO:0033058) |
| 0.1 | 0.3 | GO:0000350 | generation of catalytic spliceosome for second transesterification step(GO:0000350) |
| 0.1 | 0.8 | GO:0060045 | positive regulation of cardiac muscle cell proliferation(GO:0060045) |
| 0.1 | 0.6 | GO:0035331 | negative regulation of hippo signaling(GO:0035331) |
| 0.1 | 0.2 | GO:0007181 | transforming growth factor beta receptor complex assembly(GO:0007181) |
| 0.1 | 0.2 | GO:0036484 | trunk segmentation(GO:0035290) trunk neural crest cell migration(GO:0036484) ventral trunk neural crest cell migration(GO:0036486) sympathetic neuron projection extension(GO:0097490) sympathetic neuron projection guidance(GO:0097491) |
| 0.1 | 0.3 | GO:0030035 | microspike assembly(GO:0030035) |
| 0.1 | 0.1 | GO:1902913 | positive regulation of neuroepithelial cell differentiation(GO:1902913) |
| 0.1 | 0.3 | GO:0046959 | habituation(GO:0046959) |
| 0.1 | 0.3 | GO:0034499 | late endosome to Golgi transport(GO:0034499) |
| 0.1 | 0.4 | GO:1904491 | protein localization to ciliary transition zone(GO:1904491) |
| 0.1 | 0.3 | GO:0030208 | dermatan sulfate biosynthetic process(GO:0030208) |
| 0.1 | 0.1 | GO:0072174 | metanephric tubule formation(GO:0072174) |
| 0.1 | 1.0 | GO:0001771 | immunological synapse formation(GO:0001771) |
| 0.1 | 0.5 | GO:0060297 | regulation of sarcomere organization(GO:0060297) |
| 0.1 | 0.7 | GO:0086091 | regulation of heart rate by cardiac conduction(GO:0086091) |
| 0.1 | 0.3 | GO:0070836 | caveola assembly(GO:0070836) |
| 0.1 | 0.3 | GO:0032474 | otolith morphogenesis(GO:0032474) |
| 0.1 | 0.2 | GO:1904395 | regulation of skeletal muscle acetylcholine-gated channel clustering(GO:1904393) positive regulation of skeletal muscle acetylcholine-gated channel clustering(GO:1904395) |
| 0.1 | 0.2 | GO:0021593 | rhombomere morphogenesis(GO:0021593) |
| 0.1 | 0.4 | GO:0007195 | adenylate cyclase-inhibiting dopamine receptor signaling pathway(GO:0007195) |
| 0.1 | 0.1 | GO:0070427 | nucleotide-binding oligomerization domain containing 1 signaling pathway(GO:0070427) |
| 0.1 | 0.4 | GO:0008355 | olfactory learning(GO:0008355) |
| 0.1 | 0.1 | GO:1900222 | negative regulation of beta-amyloid clearance(GO:1900222) |
| 0.1 | 0.4 | GO:0015015 | heparan sulfate proteoglycan biosynthetic process, enzymatic modification(GO:0015015) |
| 0.1 | 0.3 | GO:2000664 | positive regulation of interleukin-5 secretion(GO:2000664) positive regulation of interleukin-13 secretion(GO:2000667) |
| 0.1 | 0.1 | GO:0035509 | negative regulation of myosin-light-chain-phosphatase activity(GO:0035509) |
| 0.1 | 0.4 | GO:0001996 | positive regulation of heart rate by epinephrine-norepinephrine(GO:0001996) |
| 0.1 | 0.6 | GO:0043584 | nose development(GO:0043584) |
| 0.1 | 0.5 | GO:0033623 | regulation of integrin activation(GO:0033623) |
| 0.1 | 0.7 | GO:0001778 | plasma membrane repair(GO:0001778) |
| 0.1 | 0.2 | GO:0003032 | detection of oxygen(GO:0003032) |
| 0.1 | 0.4 | GO:1903142 | positive regulation of endothelial cell development(GO:1901552) positive regulation of establishment of endothelial barrier(GO:1903142) |
| 0.1 | 0.6 | GO:0099515 | actin filament-based transport(GO:0099515) |
| 0.1 | 0.2 | GO:0060126 | somatotropin secreting cell differentiation(GO:0060126) |
| 0.1 | 0.2 | GO:0099623 | regulation of cardiac muscle cell membrane repolarization(GO:0099623) |
| 0.1 | 0.5 | GO:0051122 | hepoxilin metabolic process(GO:0051121) hepoxilin biosynthetic process(GO:0051122) |
| 0.1 | 0.8 | GO:0050930 | induction of positive chemotaxis(GO:0050930) |
| 0.1 | 0.3 | GO:0030382 | sperm mitochondrion organization(GO:0030382) |
| 0.1 | 0.2 | GO:0003010 | voluntary skeletal muscle contraction(GO:0003010) twitch skeletal muscle contraction(GO:0014721) fast-twitch skeletal muscle fiber contraction(GO:0031443) |
| 0.1 | 0.2 | GO:0002678 | positive regulation of chronic inflammatory response(GO:0002678) |
| 0.1 | 0.6 | GO:0042473 | outer ear morphogenesis(GO:0042473) |
| 0.1 | 0.3 | GO:0006667 | sphinganine metabolic process(GO:0006667) |
| 0.1 | 0.3 | GO:0048739 | cardiac muscle fiber development(GO:0048739) |
| 0.1 | 0.2 | GO:0032747 | positive regulation of interleukin-23 production(GO:0032747) |
| 0.1 | 1.0 | GO:0060043 | regulation of cardiac muscle cell proliferation(GO:0060043) |
| 0.1 | 0.5 | GO:0060509 | Type I pneumocyte differentiation(GO:0060509) |
| 0.1 | 0.3 | GO:0014042 | positive regulation of neuron maturation(GO:0014042) |
| 0.1 | 1.2 | GO:0001945 | lymph vessel development(GO:0001945) |
| 0.1 | 0.3 | GO:0045041 | protein import into mitochondrial intermembrane space(GO:0045041) |
| 0.1 | 0.3 | GO:0036092 | phosphatidylinositol-3-phosphate biosynthetic process(GO:0036092) |
| 0.1 | 0.3 | GO:0060057 | apoptotic process involved in mammary gland involution(GO:0060057) positive regulation of apoptotic process involved in mammary gland involution(GO:0060058) positive regulation of apoptotic process involved in morphogenesis(GO:1902339) regulation of mammary gland involution(GO:1903519) positive regulation of mammary gland involution(GO:1903521) positive regulation of apoptotic process involved in development(GO:1904747) |
| 0.1 | 0.1 | GO:0003104 | positive regulation of glomerular filtration(GO:0003104) |
| 0.1 | 0.4 | GO:0097084 | vascular smooth muscle cell development(GO:0097084) |
| 0.1 | 0.8 | GO:0035999 | tetrahydrofolate interconversion(GO:0035999) |
| 0.1 | 0.1 | GO:0021648 | vestibulocochlear nerve morphogenesis(GO:0021648) |
| 0.1 | 0.2 | GO:0006931 | substrate-dependent cell migration, cell attachment to substrate(GO:0006931) |
| 0.1 | 0.7 | GO:0046069 | cGMP catabolic process(GO:0046069) |
| 0.1 | 0.1 | GO:0048696 | regulation of collateral sprouting in absence of injury(GO:0048696) |
| 0.1 | 0.6 | GO:0050966 | detection of mechanical stimulus involved in sensory perception of pain(GO:0050966) |
| 0.1 | 0.3 | GO:1903261 | regulation of serine phosphorylation of STAT3 protein(GO:1903261) |
| 0.1 | 0.3 | GO:0008626 | granzyme-mediated apoptotic signaling pathway(GO:0008626) |
| 0.1 | 0.3 | GO:0090038 | negative regulation of protein kinase C signaling(GO:0090038) |
| 0.1 | 0.2 | GO:0030240 | skeletal muscle thin filament assembly(GO:0030240) |
| 0.1 | 0.3 | GO:0072051 | juxtaglomerular apparatus development(GO:0072051) |
| 0.1 | 0.5 | GO:0031987 | locomotion involved in locomotory behavior(GO:0031987) |
| 0.1 | 0.1 | GO:0098902 | regulation of membrane depolarization during action potential(GO:0098902) |
| 0.1 | 0.7 | GO:1900017 | positive regulation of cytokine production involved in inflammatory response(GO:1900017) |
| 0.1 | 0.7 | GO:0010759 | positive regulation of macrophage chemotaxis(GO:0010759) |
| 0.1 | 0.1 | GO:0008078 | mesodermal cell migration(GO:0008078) |
| 0.1 | 0.2 | GO:1901475 | pyruvate transmembrane transport(GO:1901475) |
| 0.1 | 0.7 | GO:0045725 | positive regulation of glycogen biosynthetic process(GO:0045725) |
| 0.1 | 0.3 | GO:0003184 | pulmonary valve development(GO:0003177) pulmonary valve morphogenesis(GO:0003184) |
| 0.1 | 0.2 | GO:0002730 | regulation of dendritic cell cytokine production(GO:0002730) |
| 0.1 | 0.1 | GO:1900020 | regulation of protein kinase C activity(GO:1900019) positive regulation of protein kinase C activity(GO:1900020) |
| 0.1 | 0.8 | GO:0001780 | neutrophil homeostasis(GO:0001780) |
| 0.1 | 1.4 | GO:0010738 | regulation of protein kinase A signaling(GO:0010738) |
| 0.1 | 0.2 | GO:0060666 | dichotomous subdivision of terminal units involved in salivary gland branching(GO:0060666) |
| 0.1 | 0.2 | GO:0090273 | regulation of somatostatin secretion(GO:0090273) |
| 0.1 | 0.2 | GO:2000525 | regulation of T cell costimulation(GO:2000523) positive regulation of T cell costimulation(GO:2000525) |
| 0.1 | 0.6 | GO:0090136 | epithelial cell-cell adhesion(GO:0090136) |
| 0.1 | 0.2 | GO:0046532 | regulation of photoreceptor cell differentiation(GO:0046532) |
| 0.1 | 0.2 | GO:0046167 | glycerol-3-phosphate biosynthetic process(GO:0046167) |
| 0.1 | 0.2 | GO:0046103 | inosine biosynthetic process(GO:0046103) |
| 0.1 | 0.1 | GO:0090210 | regulation of establishment of blood-brain barrier(GO:0090210) |
| 0.1 | 0.6 | GO:0035845 | photoreceptor cell outer segment organization(GO:0035845) |
| 0.1 | 0.2 | GO:1903984 | positive regulation of TRAIL-activated apoptotic signaling pathway(GO:1903984) |
| 0.1 | 0.1 | GO:0035934 | corticosterone secretion(GO:0035934) regulation of corticosterone secretion(GO:2000852) |
| 0.1 | 0.2 | GO:0043553 | negative regulation of phosphatidylinositol 3-kinase activity(GO:0043553) |
| 0.1 | 0.2 | GO:0021955 | central nervous system neuron axonogenesis(GO:0021955) |
| 0.1 | 2.3 | GO:0019228 | neuronal action potential(GO:0019228) |
| 0.1 | 0.2 | GO:1900454 | positive regulation of long term synaptic depression(GO:1900454) |
| 0.1 | 0.1 | GO:0007440 | foregut morphogenesis(GO:0007440) |
| 0.1 | 0.3 | GO:0048702 | embryonic neurocranium morphogenesis(GO:0048702) |
| 0.1 | 0.1 | GO:0072053 | renal inner medulla development(GO:0072053) |
| 0.1 | 0.1 | GO:0071873 | response to norepinephrine(GO:0071873) |
| 0.1 | 0.3 | GO:0042483 | negative regulation of odontogenesis(GO:0042483) |
| 0.1 | 0.3 | GO:0010715 | regulation of extracellular matrix disassembly(GO:0010715) |
| 0.1 | 0.4 | GO:0019852 | L-ascorbic acid metabolic process(GO:0019852) |
| 0.1 | 0.2 | GO:0007016 | cytoskeletal anchoring at plasma membrane(GO:0007016) |
| 0.1 | 0.3 | GO:1902534 | single-organism membrane invagination(GO:1902534) |
| 0.1 | 1.1 | GO:0021952 | central nervous system projection neuron axonogenesis(GO:0021952) |
| 0.1 | 0.6 | GO:0007288 | sperm axoneme assembly(GO:0007288) |
| 0.1 | 0.1 | GO:1902445 | regulation of mitochondrial membrane permeability involved in programmed necrotic cell death(GO:1902445) |
| 0.1 | 1.0 | GO:0061003 | positive regulation of dendritic spine morphogenesis(GO:0061003) |
| 0.1 | 0.4 | GO:0033234 | negative regulation of protein sumoylation(GO:0033234) |
| 0.1 | 0.1 | GO:0003344 | pericardium morphogenesis(GO:0003344) |
| 0.1 | 0.1 | GO:0032344 | regulation of aldosterone metabolic process(GO:0032344) |
| 0.1 | 0.6 | GO:0098719 | sodium ion import across plasma membrane(GO:0098719) sodium ion import into cell(GO:1990118) |
| 0.1 | 0.3 | GO:0070934 | CRD-mediated mRNA stabilization(GO:0070934) |
| 0.1 | 0.1 | GO:2000599 | regulation of cyclin catabolic process(GO:2000598) negative regulation of cyclin catabolic process(GO:2000599) |
| 0.1 | 0.2 | GO:0060672 | epithelial cell differentiation involved in embryonic placenta development(GO:0060671) epithelial cell morphogenesis involved in placental branching(GO:0060672) |
| 0.1 | 0.6 | GO:0001975 | response to amphetamine(GO:0001975) |
| 0.1 | 0.2 | GO:0060971 | embryonic heart tube left/right pattern formation(GO:0060971) |
| 0.1 | 0.1 | GO:0060084 | synaptic transmission involved in micturition(GO:0060084) |
| 0.1 | 0.1 | GO:0097477 | lateral motor column neuron migration(GO:0097477) |
| 0.1 | 0.1 | GO:0031033 | myosin filament organization(GO:0031033) |
| 0.1 | 0.1 | GO:0000101 | sulfur amino acid transport(GO:0000101) |
| 0.1 | 0.1 | GO:2001055 | positive regulation of mesenchymal cell apoptotic process(GO:2001055) |
| 0.1 | 1.1 | GO:0008038 | neuron recognition(GO:0008038) |
| 0.1 | 0.3 | GO:0034638 | phosphatidylcholine catabolic process(GO:0034638) |
| 0.1 | 0.4 | GO:1900113 | negative regulation of histone H3-K9 trimethylation(GO:1900113) |
| 0.1 | 0.1 | GO:0086069 | bundle of His cell to Purkinje myocyte communication(GO:0086069) |
| 0.1 | 0.2 | GO:0010387 | COP9 signalosome assembly(GO:0010387) |
| 0.1 | 0.5 | GO:0075522 | IRES-dependent viral translational initiation(GO:0075522) |
| 0.1 | 0.3 | GO:0070164 | negative regulation of adiponectin secretion(GO:0070164) |
| 0.1 | 0.3 | GO:2000009 | negative regulation of protein localization to cell surface(GO:2000009) |
| 0.1 | 0.2 | GO:0045897 | regulation of transcription during mitosis(GO:0045896) positive regulation of transcription during mitosis(GO:0045897) |
| 0.1 | 0.2 | GO:0007468 | regulation of rhodopsin gene expression(GO:0007468) |
| 0.1 | 0.4 | GO:0090085 | regulation of protein deubiquitination(GO:0090085) |
| 0.1 | 0.2 | GO:0021860 | pyramidal neuron development(GO:0021860) |
| 0.1 | 0.2 | GO:0071502 | cellular response to temperature stimulus(GO:0071502) |
| 0.1 | 0.1 | GO:0002086 | diaphragm contraction(GO:0002086) |
| 0.1 | 0.2 | GO:0033600 | negative regulation of mammary gland epithelial cell proliferation(GO:0033600) |
| 0.1 | 0.2 | GO:0010847 | regulation of chromatin assembly(GO:0010847) |
| 0.1 | 0.1 | GO:0045448 | regulation of mitotic cell cycle, embryonic(GO:0009794) mitotic cell cycle, embryonic(GO:0045448) |
| 0.1 | 0.1 | GO:2000097 | regulation of smooth muscle cell-matrix adhesion(GO:2000097) |
| 0.1 | 0.5 | GO:0050927 | positive regulation of positive chemotaxis(GO:0050927) |
| 0.1 | 0.2 | GO:0033566 | gamma-tubulin complex localization(GO:0033566) |
| 0.1 | 0.3 | GO:2000344 | positive regulation of acrosome reaction(GO:2000344) |
| 0.1 | 0.2 | GO:0016557 | peroxisome membrane biogenesis(GO:0016557) |
| 0.1 | 0.2 | GO:0018094 | protein polyglycylation(GO:0018094) |
| 0.1 | 0.2 | GO:0031581 | hemidesmosome assembly(GO:0031581) |
| 0.1 | 0.5 | GO:0009312 | oligosaccharide biosynthetic process(GO:0009312) |
| 0.1 | 0.2 | GO:0050689 | negative regulation of defense response to virus by host(GO:0050689) |
| 0.1 | 0.1 | GO:0001698 | gastrin-induced gastric acid secretion(GO:0001698) |
| 0.1 | 0.1 | GO:0033686 | positive regulation of luteinizing hormone secretion(GO:0033686) |
| 0.1 | 0.3 | GO:0031339 | negative regulation of vesicle fusion(GO:0031339) |
| 0.1 | 0.1 | GO:0090071 | negative regulation of ribosome biogenesis(GO:0090071) |
| 0.1 | 0.1 | GO:1900748 | positive regulation of vascular endothelial growth factor signaling pathway(GO:1900748) |
| 0.1 | 2.6 | GO:0051965 | positive regulation of synapse assembly(GO:0051965) |
| 0.1 | 0.1 | GO:0042414 | epinephrine metabolic process(GO:0042414) |
| 0.1 | 0.1 | GO:0009157 | deoxyribonucleoside monophosphate biosynthetic process(GO:0009157) pyrimidine deoxyribonucleoside monophosphate biosynthetic process(GO:0009177) |
| 0.1 | 0.5 | GO:1902902 | negative regulation of autophagosome assembly(GO:1902902) |
| 0.1 | 0.9 | GO:0043153 | entrainment of circadian clock by photoperiod(GO:0043153) |
| 0.1 | 0.1 | GO:0035022 | positive regulation of Rac protein signal transduction(GO:0035022) |
| 0.1 | 0.1 | GO:0070662 | mast cell proliferation(GO:0070662) regulation of mast cell proliferation(GO:0070666) positive regulation of mast cell proliferation(GO:0070668) |
| 0.1 | 0.2 | GO:0072697 | protein localization to cell cortex(GO:0072697) |
| 0.1 | 0.2 | GO:0097680 | double-strand break repair via classical nonhomologous end joining(GO:0097680) |
| 0.1 | 0.1 | GO:2000542 | negative regulation of gastrulation(GO:2000542) |
| 0.1 | 0.2 | GO:0014028 | notochord formation(GO:0014028) |
| 0.1 | 0.1 | GO:0071879 | positive regulation of adrenergic receptor signaling pathway(GO:0071879) |
| 0.1 | 0.1 | GO:1904706 | negative regulation of vascular smooth muscle cell proliferation(GO:1904706) |
| 0.1 | 0.1 | GO:0048597 | post-embryonic camera-type eye morphogenesis(GO:0048597) |
| 0.1 | 0.3 | GO:0051694 | pointed-end actin filament capping(GO:0051694) |
| 0.1 | 0.2 | GO:0030327 | prenylated protein catabolic process(GO:0030327) |
| 0.1 | 0.2 | GO:1904751 | regulation of protein localization to nucleolus(GO:1904749) positive regulation of protein localization to nucleolus(GO:1904751) |
| 0.1 | 0.3 | GO:0080009 | mRNA methylation(GO:0080009) |
| 0.1 | 0.1 | GO:0071888 | macrophage apoptotic process(GO:0071888) regulation of macrophage apoptotic process(GO:2000109) |
| 0.1 | 0.4 | GO:0070995 | NADPH oxidation(GO:0070995) |
| 0.1 | 0.3 | GO:0016139 | glycoside catabolic process(GO:0016139) |
| 0.1 | 0.1 | GO:1904948 | midbrain dopaminergic neuron differentiation(GO:1904948) |
| 0.1 | 0.4 | GO:0034058 | endosomal vesicle fusion(GO:0034058) |
| 0.1 | 0.1 | GO:0046884 | follicle-stimulating hormone secretion(GO:0046884) |
| 0.1 | 0.2 | GO:0015808 | L-alanine transport(GO:0015808) |
| 0.1 | 0.1 | GO:1901386 | negative regulation of voltage-gated calcium channel activity(GO:1901386) |
| 0.1 | 0.1 | GO:0043133 | hindgut contraction(GO:0043133) regulation of hindgut contraction(GO:0043134) |
| 0.1 | 0.1 | GO:1902174 | positive regulation of keratinocyte apoptotic process(GO:1902174) |
| 0.1 | 0.3 | GO:0018158 | protein oxidation(GO:0018158) |
| 0.1 | 0.3 | GO:0080154 | regulation of fertilization(GO:0080154) |
| 0.1 | 0.1 | GO:0010248 | establishment or maintenance of transmembrane electrochemical gradient(GO:0010248) |
| 0.1 | 0.2 | GO:0031296 | B cell costimulation(GO:0031296) |
| 0.0 | 0.0 | GO:0035931 | mineralocorticoid secretion(GO:0035931) aldosterone secretion(GO:0035932) regulation of mineralocorticoid secretion(GO:2000855) positive regulation of mineralocorticoid secretion(GO:2000857) regulation of aldosterone secretion(GO:2000858) positive regulation of aldosterone secretion(GO:2000860) |
| 0.0 | 0.1 | GO:0018879 | biphenyl metabolic process(GO:0018879) |
| 0.0 | 0.3 | GO:0030501 | positive regulation of bone mineralization(GO:0030501) |
| 0.0 | 0.1 | GO:0032354 | response to follicle-stimulating hormone(GO:0032354) |
| 0.0 | 0.7 | GO:0048843 | negative regulation of axon extension involved in axon guidance(GO:0048843) |
| 0.0 | 0.2 | GO:2001260 | regulation of semaphorin-plexin signaling pathway(GO:2001260) |
| 0.0 | 0.3 | GO:0002026 | regulation of the force of heart contraction(GO:0002026) |
| 0.0 | 0.5 | GO:0090314 | positive regulation of protein targeting to membrane(GO:0090314) |
| 0.0 | 0.2 | GO:0018343 | protein farnesylation(GO:0018343) |
| 0.0 | 0.1 | GO:0090310 | negative regulation of methylation-dependent chromatin silencing(GO:0090310) |
| 0.0 | 0.1 | GO:0051342 | regulation of cyclic-nucleotide phosphodiesterase activity(GO:0051342) |
| 0.0 | 0.2 | GO:0050748 | negative regulation of lipoprotein metabolic process(GO:0050748) |
| 0.0 | 0.0 | GO:1904479 | negative regulation of intestinal absorption(GO:1904479) |
| 0.0 | 0.1 | GO:1902455 | negative regulation of stem cell population maintenance(GO:1902455) |
| 0.0 | 0.1 | GO:0009957 | epidermal cell fate specification(GO:0009957) |
| 0.0 | 0.2 | GO:0001777 | T cell homeostatic proliferation(GO:0001777) regulation of T cell homeostatic proliferation(GO:0046013) |
| 0.0 | 0.1 | GO:0015705 | iodide transport(GO:0015705) |
| 0.0 | 0.2 | GO:1902475 | L-alpha-amino acid transmembrane transport(GO:1902475) |
| 0.0 | 0.1 | GO:0002322 | B cell proliferation involved in immune response(GO:0002322) |
| 0.0 | 0.2 | GO:0042989 | sequestering of actin monomers(GO:0042989) |
| 0.0 | 0.5 | GO:0021889 | olfactory bulb interneuron differentiation(GO:0021889) |
| 0.0 | 0.1 | GO:0006068 | ethanol catabolic process(GO:0006068) |
| 0.0 | 0.2 | GO:0019509 | L-methionine biosynthetic process from methylthioadenosine(GO:0019509) |
| 0.0 | 0.1 | GO:0071895 | odontoblast differentiation(GO:0071895) |
| 0.0 | 0.1 | GO:0009130 | UMP biosynthetic process(GO:0006222) pyrimidine nucleoside monophosphate biosynthetic process(GO:0009130) pyrimidine ribonucleoside monophosphate metabolic process(GO:0009173) pyrimidine ribonucleoside monophosphate biosynthetic process(GO:0009174) UMP metabolic process(GO:0046049) |
| 0.0 | 0.1 | GO:1902513 | regulation of organelle transport along microtubule(GO:1902513) |
| 0.0 | 0.1 | GO:2000402 | negative regulation of lymphocyte migration(GO:2000402) |
| 0.0 | 0.1 | GO:0034653 | diterpenoid catabolic process(GO:0016103) retinoic acid catabolic process(GO:0034653) |
| 0.0 | 0.0 | GO:0060157 | urinary bladder development(GO:0060157) |
| 0.0 | 0.0 | GO:0042663 | regulation of endodermal cell fate specification(GO:0042663) |
| 0.0 | 0.1 | GO:0038145 | macrophage colony-stimulating factor signaling pathway(GO:0038145) |
| 0.0 | 0.1 | GO:0061140 | lung secretory cell differentiation(GO:0061140) |
| 0.0 | 0.2 | GO:0006003 | fructose 2,6-bisphosphate metabolic process(GO:0006003) |
| 0.0 | 0.1 | GO:0038030 | non-canonical Wnt signaling pathway via MAPK cascade(GO:0038030) non-canonical Wnt signaling pathway via JNK cascade(GO:0038031) |
| 0.0 | 0.2 | GO:0046882 | negative regulation of follicle-stimulating hormone secretion(GO:0046882) |
| 0.0 | 0.1 | GO:0002540 | leukotriene production involved in inflammatory response(GO:0002540) |
| 0.0 | 0.2 | GO:0051151 | negative regulation of smooth muscle cell differentiation(GO:0051151) |
| 0.0 | 0.1 | GO:0045900 | negative regulation of translational elongation(GO:0045900) |
| 0.0 | 0.1 | GO:0000491 | small nucleolar ribonucleoprotein complex assembly(GO:0000491) box C/D snoRNP assembly(GO:0000492) |
| 0.0 | 0.0 | GO:0072307 | metanephric nephron tubule epithelial cell differentiation(GO:0072257) regulation of metanephric nephron tubule epithelial cell differentiation(GO:0072307) |
| 0.0 | 0.1 | GO:0006562 | proline catabolic process(GO:0006562) |
| 0.0 | 0.3 | GO:0045956 | positive regulation of calcium ion-dependent exocytosis(GO:0045956) |
| 0.0 | 0.0 | GO:0015819 | lysine transport(GO:0015819) |
| 0.0 | 0.0 | GO:0010840 | regulation of circadian sleep/wake cycle, wakefulness(GO:0010840) circadian sleep/wake cycle, wakefulness(GO:0042746) |
| 0.0 | 0.2 | GO:0001787 | natural killer cell proliferation(GO:0001787) |
| 0.0 | 0.1 | GO:0051387 | negative regulation of neurotrophin TRK receptor signaling pathway(GO:0051387) |
| 0.0 | 0.1 | GO:0050919 | negative chemotaxis(GO:0050919) |
| 0.0 | 0.9 | GO:1903078 | positive regulation of protein localization to plasma membrane(GO:1903078) positive regulation of protein localization to cell periphery(GO:1904377) |
| 0.0 | 0.4 | GO:0035563 | positive regulation of chromatin binding(GO:0035563) |
| 0.0 | 0.1 | GO:0060331 | negative regulation of response to interferon-gamma(GO:0060331) negative regulation of interferon-gamma-mediated signaling pathway(GO:0060336) |
| 0.0 | 0.1 | GO:0001927 | exocyst assembly(GO:0001927) |
| 0.0 | 0.0 | GO:0061428 | negative regulation of transcription from RNA polymerase II promoter in response to hypoxia(GO:0061428) |
| 0.0 | 0.1 | GO:0072319 | clathrin coat disassembly(GO:0072318) vesicle uncoating(GO:0072319) |
| 0.0 | 0.8 | GO:0003333 | amino acid transmembrane transport(GO:0003333) |
| 0.0 | 0.1 | GO:0097105 | presynaptic membrane assembly(GO:0097105) |
| 0.0 | 0.1 | GO:1904995 | negative regulation of leukocyte adhesion to vascular endothelial cell(GO:1904995) |
| 0.0 | 0.1 | GO:0045950 | negative regulation of mitotic recombination(GO:0045950) |
| 0.0 | 0.2 | GO:0050849 | negative regulation of calcium-mediated signaling(GO:0050849) |
| 0.0 | 0.0 | GO:0048680 | positive regulation of axon regeneration(GO:0048680) |
| 0.0 | 0.1 | GO:1904380 | endoplasmic reticulum mannose trimming(GO:1904380) |
| 0.0 | 0.2 | GO:0050861 | positive regulation of B cell receptor signaling pathway(GO:0050861) |
| 0.0 | 0.1 | GO:1902415 | regulation of mRNA binding(GO:1902415) regulation of RNA binding(GO:1905214) |
| 0.0 | 0.1 | GO:0019062 | virion attachment to host cell(GO:0019062) adhesion of symbiont to host cell(GO:0044650) |
| 0.0 | 0.0 | GO:0031914 | negative regulation of synaptic plasticity(GO:0031914) |
| 0.0 | 0.0 | GO:0003100 | regulation of systemic arterial blood pressure by endothelin(GO:0003100) |
| 0.0 | 0.3 | GO:0006450 | regulation of translational fidelity(GO:0006450) |
| 0.0 | 0.1 | GO:0042723 | thiamine metabolic process(GO:0006772) thiamine-containing compound metabolic process(GO:0042723) |
| 0.0 | 0.2 | GO:0035989 | tendon development(GO:0035989) |
| 0.0 | 0.0 | GO:0006971 | hypotonic response(GO:0006971) |
| 0.0 | 0.4 | GO:0060292 | long term synaptic depression(GO:0060292) |
| 0.0 | 0.2 | GO:0045837 | negative regulation of mitochondrial membrane potential(GO:0010917) negative regulation of membrane potential(GO:0045837) |
| 0.0 | 0.2 | GO:0032754 | positive regulation of interleukin-5 production(GO:0032754) |
| 0.0 | 0.3 | GO:0006020 | inositol metabolic process(GO:0006020) |
| 0.0 | 0.0 | GO:0071926 | cannabinoid signaling pathway(GO:0038171) endocannabinoid signaling pathway(GO:0071926) |
| 0.0 | 0.1 | GO:0097011 | cellular response to granulocyte macrophage colony-stimulating factor stimulus(GO:0097011) |
| 0.0 | 0.1 | GO:0051956 | negative regulation of amino acid transport(GO:0051956) |
| 0.0 | 0.2 | GO:0033690 | positive regulation of osteoblast proliferation(GO:0033690) |
| 0.0 | 0.0 | GO:1903899 | positive regulation of PERK-mediated unfolded protein response(GO:1903899) |
| 0.0 | 0.1 | GO:0060484 | lung-associated mesenchyme development(GO:0060484) |
| 0.0 | 0.1 | GO:0021558 | trochlear nerve development(GO:0021558) |
| 0.0 | 0.1 | GO:0003105 | negative regulation of glomerular filtration(GO:0003105) |
| 0.0 | 0.2 | GO:0035313 | wound healing, spreading of epidermal cells(GO:0035313) |
| 0.0 | 0.0 | GO:0070318 | positive regulation of G0 to G1 transition(GO:0070318) |
| 0.0 | 0.0 | GO:1902262 | apoptotic process involved in patterning of blood vessels(GO:1902262) |
| 0.0 | 0.1 | GO:0007614 | short-term memory(GO:0007614) |
| 0.0 | 0.3 | GO:0032060 | bleb assembly(GO:0032060) |
| 0.0 | 0.1 | GO:0070253 | somatostatin secretion(GO:0070253) |
| 0.0 | 0.3 | GO:0007320 | insemination(GO:0007320) |
| 0.0 | 1.0 | GO:0030865 | cortical cytoskeleton organization(GO:0030865) |
| 0.0 | 0.2 | GO:0001765 | membrane raft assembly(GO:0001765) |
| 0.0 | 0.2 | GO:0060055 | angiogenesis involved in wound healing(GO:0060055) |
| 0.0 | 0.2 | GO:0002042 | cell migration involved in sprouting angiogenesis(GO:0002042) |
| 0.0 | 0.1 | GO:0019230 | proprioception(GO:0019230) |
| 0.0 | 0.3 | GO:1990126 | retrograde transport, endosome to plasma membrane(GO:1990126) |
| 0.0 | 0.2 | GO:0060124 | positive regulation of growth hormone secretion(GO:0060124) |
| 0.0 | 0.2 | GO:2000035 | regulation of stem cell division(GO:2000035) |
| 0.0 | 0.4 | GO:0006744 | ubiquinone biosynthetic process(GO:0006744) |
| 0.0 | 0.1 | GO:0009106 | lipoate metabolic process(GO:0009106) |
| 0.0 | 0.6 | GO:0030318 | melanocyte differentiation(GO:0030318) |
| 0.0 | 0.1 | GO:2000118 | regulation of sodium-dependent phosphate transport(GO:2000118) |
| 0.0 | 0.1 | GO:0035507 | regulation of myosin-light-chain-phosphatase activity(GO:0035507) |
| 0.0 | 0.1 | GO:0046952 | ketone body catabolic process(GO:0046952) |
| 0.0 | 0.0 | GO:0031915 | positive regulation of synaptic plasticity(GO:0031915) |
| 0.0 | 0.1 | GO:0060123 | regulation of growth hormone secretion(GO:0060123) |
| 0.0 | 0.1 | GO:1990845 | diet induced thermogenesis(GO:0002024) adaptive thermogenesis(GO:1990845) |
| 0.0 | 0.3 | GO:0042487 | regulation of odontogenesis of dentin-containing tooth(GO:0042487) |
| 0.0 | 0.1 | GO:0051835 | positive regulation of synapse structural plasticity(GO:0051835) |
| 0.0 | 0.0 | GO:0038033 | positive regulation of endothelial cell chemotaxis by VEGF-activated vascular endothelial growth factor receptor signaling pathway(GO:0038033) |
| 0.0 | 0.1 | GO:0002331 | pre-B cell allelic exclusion(GO:0002331) |
| 0.0 | 0.3 | GO:0035116 | embryonic hindlimb morphogenesis(GO:0035116) |
| 0.0 | 0.2 | GO:0016322 | neuron remodeling(GO:0016322) |
| 0.0 | 0.0 | GO:0010624 | regulation of Schwann cell proliferation(GO:0010624) |
| 0.0 | 0.7 | GO:0010107 | potassium ion import(GO:0010107) |
| 0.0 | 0.1 | GO:0035747 | natural killer cell chemotaxis(GO:0035747) regulation of natural killer cell chemotaxis(GO:2000501) positive regulation of natural killer cell chemotaxis(GO:2000503) |
| 0.0 | 0.3 | GO:0019800 | peptide cross-linking via chondroitin 4-sulfate glycosaminoglycan(GO:0019800) |
| 0.0 | 0.1 | GO:0015824 | proline transport(GO:0015824) |
| 0.0 | 0.2 | GO:0060287 | epithelial cilium movement involved in determination of left/right asymmetry(GO:0060287) |
| 0.0 | 0.0 | GO:0006578 | amino-acid betaine biosynthetic process(GO:0006578) |
| 0.0 | 0.1 | GO:0070673 | response to interleukin-18(GO:0070673) cellular response to interleukin-18(GO:0071351) |
| 0.0 | 0.5 | GO:0007616 | long-term memory(GO:0007616) |
| 0.0 | 0.0 | GO:0010693 | negative regulation of alkaline phosphatase activity(GO:0010693) |
| 0.0 | 0.0 | GO:2000391 | regulation of neutrophil extravasation(GO:2000389) positive regulation of neutrophil extravasation(GO:2000391) |
| 0.0 | 0.1 | GO:0036462 | TRAIL-activated apoptotic signaling pathway(GO:0036462) |
| 0.0 | 0.9 | GO:0007520 | myoblast fusion(GO:0007520) |
| 0.0 | 0.0 | GO:0038065 | collagen-activated signaling pathway(GO:0038065) |
| 0.0 | 0.2 | GO:0071378 | growth hormone receptor signaling pathway(GO:0060396) cellular response to growth hormone stimulus(GO:0071378) |
| 0.0 | 0.1 | GO:0055022 | negative regulation of cardiac muscle tissue growth(GO:0055022) negative regulation of heart growth(GO:0061117) |
| 0.0 | 0.0 | GO:0032417 | positive regulation of sodium:proton antiporter activity(GO:0032417) |
| 0.0 | 0.1 | GO:0090206 | negative regulation of cholesterol biosynthetic process(GO:0045541) negative regulation of cholesterol metabolic process(GO:0090206) |
| 0.0 | 0.9 | GO:0006509 | membrane protein ectodomain proteolysis(GO:0006509) |
| 0.0 | 0.1 | GO:0021615 | glossopharyngeal nerve development(GO:0021563) glossopharyngeal nerve morphogenesis(GO:0021615) |
| 0.0 | 0.1 | GO:0060973 | cell migration involved in heart development(GO:0060973) |
| 0.0 | 0.8 | GO:0009268 | response to pH(GO:0009268) |
| 0.0 | 0.1 | GO:2000767 | positive regulation of cytoplasmic translation(GO:2000767) |
| 0.0 | 0.1 | GO:0006041 | glucosamine metabolic process(GO:0006041) |
| 0.0 | 0.1 | GO:0035740 | CD8-positive, alpha-beta T cell proliferation(GO:0035740) |
| 0.0 | 0.0 | GO:1902075 | cellular response to salt(GO:1902075) |
| 0.0 | 0.1 | GO:0007412 | axon target recognition(GO:0007412) |
| 0.0 | 0.2 | GO:0061732 | mitochondrial acetyl-CoA biosynthetic process from pyruvate(GO:0061732) |
| 0.0 | 0.2 | GO:0006646 | phosphatidylethanolamine biosynthetic process(GO:0006646) |
| 0.0 | 0.0 | GO:0045163 | clustering of voltage-gated potassium channels(GO:0045163) |
| 0.0 | 0.2 | GO:0051481 | negative regulation of cytosolic calcium ion concentration(GO:0051481) |
| 0.0 | 0.1 | GO:0048294 | negative regulation of isotype switching to IgE isotypes(GO:0048294) |
| 0.0 | 0.1 | GO:0000160 | phosphorelay signal transduction system(GO:0000160) |
| 0.0 | 0.0 | GO:0060947 | cardiac vascular smooth muscle cell differentiation(GO:0060947) |
| 0.0 | 0.1 | GO:1902071 | regulation of hypoxia-inducible factor-1alpha signaling pathway(GO:1902071) |
| 0.0 | 0.1 | GO:0009649 | entrainment of circadian clock(GO:0009649) |
| 0.0 | 0.1 | GO:0007084 | mitotic nuclear envelope reassembly(GO:0007084) |
| 0.0 | 0.4 | GO:0045214 | sarcomere organization(GO:0045214) |
| 0.0 | 0.2 | GO:0070863 | positive regulation of protein exit from endoplasmic reticulum(GO:0070863) |
| 0.0 | 0.1 | GO:0030311 | poly-N-acetyllactosamine metabolic process(GO:0030309) poly-N-acetyllactosamine biosynthetic process(GO:0030311) |
| 0.0 | 1.0 | GO:0033139 | regulation of peptidyl-serine phosphorylation of STAT protein(GO:0033139) |
| 0.0 | 0.1 | GO:0007197 | adenylate cyclase-inhibiting G-protein coupled acetylcholine receptor signaling pathway(GO:0007197) phospholipase C-activating G-protein coupled acetylcholine receptor signaling pathway(GO:0007207) |
| 0.0 | 0.1 | GO:1904754 | positive regulation of vascular associated smooth muscle cell migration(GO:1904754) |
| 0.0 | 0.0 | GO:0070093 | negative regulation of glucagon secretion(GO:0070093) |
| 0.0 | 0.2 | GO:0014041 | regulation of neuron maturation(GO:0014041) |
| 0.0 | 0.1 | GO:0051794 | regulation of catagen(GO:0051794) |
| 0.0 | 0.1 | GO:0031666 | positive regulation of lipopolysaccharide-mediated signaling pathway(GO:0031666) |
| 0.0 | 0.1 | GO:1901525 | negative regulation of macromitophagy(GO:1901525) |
| 0.0 | 0.7 | GO:1901379 | regulation of potassium ion transmembrane transport(GO:1901379) |
| 0.0 | 0.0 | GO:0071415 | cellular response to caffeine(GO:0071313) cellular response to purine-containing compound(GO:0071415) |
| 0.0 | 0.1 | GO:0042504 | tyrosine phosphorylation of Stat4 protein(GO:0042504) regulation of tyrosine phosphorylation of Stat4 protein(GO:0042519) |
| 0.0 | 0.1 | GO:0060789 | hair follicle placode formation(GO:0060789) |
| 0.0 | 0.0 | GO:1900104 | hyaluranon cable assembly(GO:0036118) regulation of hyaluranon cable assembly(GO:1900104) positive regulation of hyaluranon cable assembly(GO:1900106) |
| 0.0 | 0.1 | GO:0046061 | dATP catabolic process(GO:0046061) |
| 0.0 | 0.1 | GO:0033326 | cerebrospinal fluid secretion(GO:0033326) |
| 0.0 | 0.0 | GO:0000019 | regulation of mitotic recombination(GO:0000019) |
| 0.0 | 0.1 | GO:0006701 | progesterone biosynthetic process(GO:0006701) |
| 0.0 | 0.1 | GO:0030222 | eosinophil differentiation(GO:0030222) |
| 0.0 | 0.1 | GO:0070294 | renal sodium ion absorption(GO:0070294) |
| 0.0 | 0.0 | GO:0003406 | retinal pigment epithelium development(GO:0003406) |
| 0.0 | 0.1 | GO:0003416 | endochondral bone growth(GO:0003416) |
| 0.0 | 0.1 | GO:0042094 | interleukin-2 biosynthetic process(GO:0042094) regulation of interleukin-2 biosynthetic process(GO:0045076) |
| 0.0 | 0.1 | GO:0044026 | DNA hypermethylation(GO:0044026) |
| 0.0 | 0.2 | GO:0097237 | cellular response to toxic substance(GO:0097237) |
| 0.0 | 0.1 | GO:0043653 | mitochondrial fragmentation involved in apoptotic process(GO:0043653) |
| 0.0 | 0.1 | GO:0072383 | plus-end-directed vesicle transport along microtubule(GO:0072383) plus-end-directed organelle transport along microtubule(GO:0072386) |
| 0.0 | 0.0 | GO:0003307 | regulation of Wnt signaling pathway involved in heart development(GO:0003307) |
| 0.0 | 0.1 | GO:1901727 | positive regulation of histone deacetylase activity(GO:1901727) |
| 0.0 | 0.0 | GO:0006982 | response to lipid hydroperoxide(GO:0006982) |
| 0.0 | 0.1 | GO:1904354 | negative regulation of telomere capping(GO:1904354) |
| 0.0 | 0.0 | GO:0098528 | skeletal muscle fiber differentiation(GO:0098528) |
| 0.0 | 0.1 | GO:0051005 | negative regulation of lipoprotein lipase activity(GO:0051005) |
| 0.0 | 0.1 | GO:2000810 | regulation of bicellular tight junction assembly(GO:2000810) |
| 0.0 | 0.1 | GO:0090230 | regulation of centromere complex assembly(GO:0090230) |
| 0.0 | 0.0 | GO:0007512 | adult heart development(GO:0007512) |
| 0.0 | 0.1 | GO:0048550 | negative regulation of pinocytosis(GO:0048550) |
| 0.0 | 0.0 | GO:0032025 | response to cobalt ion(GO:0032025) |
| 0.0 | 0.0 | GO:0007161 | calcium-independent cell-matrix adhesion(GO:0007161) |
| 0.0 | 0.1 | GO:0072061 | inner medullary collecting duct development(GO:0072061) |
| 0.0 | 0.3 | GO:0051307 | meiotic chromosome separation(GO:0051307) |
| 0.0 | 0.1 | GO:0007158 | neuron cell-cell adhesion(GO:0007158) |
| 0.0 | 0.1 | GO:0035795 | negative regulation of mitochondrial membrane permeability(GO:0035795) |
| 0.0 | 0.1 | GO:0032237 | activation of store-operated calcium channel activity(GO:0032237) |
| 0.0 | 0.0 | GO:0007220 | Notch receptor processing(GO:0007220) |
| 0.0 | 0.1 | GO:0006048 | UDP-N-acetylglucosamine biosynthetic process(GO:0006048) |
| 0.0 | 0.1 | GO:0035021 | negative regulation of Rac protein signal transduction(GO:0035021) |
| 0.0 | 0.2 | GO:0018298 | protein-chromophore linkage(GO:0018298) |
| 0.0 | 0.0 | GO:0009756 | carbohydrate mediated signaling(GO:0009756) hexose mediated signaling(GO:0009757) sugar mediated signaling pathway(GO:0010182) glucose mediated signaling pathway(GO:0010255) |
| 0.0 | 0.1 | GO:0042523 | positive regulation of tyrosine phosphorylation of Stat5 protein(GO:0042523) |
| 0.0 | 0.1 | GO:2000253 | positive regulation of feeding behavior(GO:2000253) |
| 0.0 | 0.1 | GO:0035519 | protein K29-linked ubiquitination(GO:0035519) |
| 0.0 | 0.1 | GO:0070166 | enamel mineralization(GO:0070166) |
| 0.0 | 0.1 | GO:0015746 | tricarboxylic acid transport(GO:0006842) citrate transport(GO:0015746) |
| 0.0 | 0.0 | GO:0060316 | positive regulation of ryanodine-sensitive calcium-release channel activity(GO:0060316) |
| 0.0 | 0.1 | GO:0060335 | positive regulation of response to interferon-gamma(GO:0060332) positive regulation of interferon-gamma-mediated signaling pathway(GO:0060335) |
| 0.0 | 0.0 | GO:0071169 | establishment of protein localization to chromatin(GO:0071169) |
| 0.0 | 0.0 | GO:0072338 | creatinine metabolic process(GO:0046449) cellular lactam metabolic process(GO:0072338) |
| 0.0 | 0.2 | GO:0060074 | synapse maturation(GO:0060074) |
| 0.0 | 0.1 | GO:0060056 | mammary gland involution(GO:0060056) |
| 0.0 | 0.0 | GO:0070460 | thyroid-stimulating hormone secretion(GO:0070460) |
| 0.0 | 0.0 | GO:0045085 | negative regulation of interleukin-2 biosynthetic process(GO:0045085) |
| 0.0 | 0.0 | GO:2001025 | positive regulation of response to drug(GO:2001025) |
| 0.0 | 0.0 | GO:0001834 | trophectodermal cell proliferation(GO:0001834) |
| 0.0 | 0.0 | GO:0038026 | reelin-mediated signaling pathway(GO:0038026) |
| 0.0 | 0.0 | GO:0070587 | negative regulation of heterotypic cell-cell adhesion(GO:0034115) regulation of cell-cell adhesion involved in gastrulation(GO:0070587) |
| 0.0 | 0.1 | GO:0048149 | behavioral response to ethanol(GO:0048149) |
| 0.0 | 0.1 | GO:0035641 | locomotory exploration behavior(GO:0035641) |
| 0.0 | 0.1 | GO:0042790 | transcription of nuclear large rRNA transcript from RNA polymerase I promoter(GO:0042790) |
| 0.0 | 0.0 | GO:0060825 | fibroblast growth factor receptor signaling pathway involved in neural plate anterior/posterior pattern formation(GO:0060825) regulation of fibroblast growth factor receptor signaling pathway involved in neural plate anterior/posterior pattern formation(GO:2000313) |
| 0.0 | 0.2 | GO:0042104 | positive regulation of activated T cell proliferation(GO:0042104) |
| 0.0 | 0.0 | GO:1904424 | regulation of GTP binding(GO:1904424) |
| 0.0 | 0.4 | GO:0035019 | somatic stem cell population maintenance(GO:0035019) |
| 0.0 | 0.1 | GO:0046416 | D-amino acid metabolic process(GO:0046416) |
| 0.0 | 0.2 | GO:0021694 | cerebellar Purkinje cell layer formation(GO:0021694) |
| 0.0 | 0.2 | GO:2000251 | positive regulation of actin cytoskeleton reorganization(GO:2000251) |
| 0.0 | 0.0 | GO:0019254 | carnitine metabolic process, CoA-linked(GO:0019254) |
| 0.0 | 0.0 | GO:0035482 | gastric motility(GO:0035482) gastric emptying(GO:0035483) |
| 0.0 | 0.1 | GO:2000327 | regulation of ligand-dependent nuclear receptor transcription coactivator activity(GO:2000325) positive regulation of ligand-dependent nuclear receptor transcription coactivator activity(GO:2000327) |
| 0.0 | 0.1 | GO:0006573 | valine metabolic process(GO:0006573) |
| 0.0 | 0.1 | GO:0045404 | positive regulation of interleukin-4 biosynthetic process(GO:0045404) |
| 0.0 | 0.0 | GO:2001166 | regulation of histone H2B ubiquitination(GO:2001166) positive regulation of histone H2B ubiquitination(GO:2001168) |
| 0.0 | 0.1 | GO:0009253 | peptidoglycan metabolic process(GO:0000270) peptidoglycan catabolic process(GO:0009253) |
| 0.0 | 0.0 | GO:0021561 | facial nerve development(GO:0021561) cranial nerve structural organization(GO:0021604) facial nerve morphogenesis(GO:0021610) |
| 0.0 | 0.1 | GO:2000291 | regulation of myoblast proliferation(GO:2000291) |
| 0.0 | 0.1 | GO:2000018 | regulation of male gonad development(GO:2000018) |
| 0.0 | 0.0 | GO:0007196 | adenylate cyclase-inhibiting G-protein coupled glutamate receptor signaling pathway(GO:0007196) |
| 0.0 | 0.2 | GO:0002710 | negative regulation of T cell mediated immunity(GO:0002710) |
| 0.0 | 0.2 | GO:0032515 | negative regulation of phosphoprotein phosphatase activity(GO:0032515) |
| 0.0 | 0.4 | GO:0045746 | negative regulation of Notch signaling pathway(GO:0045746) |
| 0.0 | 0.0 | GO:0038128 | ERBB2 signaling pathway(GO:0038128) |
| 0.0 | 0.2 | GO:0010669 | epithelial structure maintenance(GO:0010669) |
| 0.0 | 0.5 | GO:0007588 | excretion(GO:0007588) |
| 0.0 | 0.2 | GO:0014051 | gamma-aminobutyric acid secretion(GO:0014051) |
| 0.0 | 0.1 | GO:2000323 | negative regulation of glucocorticoid receptor signaling pathway(GO:2000323) |
| 0.0 | 0.1 | GO:0042276 | error-prone translesion synthesis(GO:0042276) |
| 0.0 | 0.2 | GO:0006855 | drug transmembrane transport(GO:0006855) |
| 0.0 | 0.1 | GO:0060179 | male mating behavior(GO:0060179) |
| 0.0 | 0.0 | GO:0014733 | regulation of skeletal muscle adaptation(GO:0014733) |
| 0.0 | 0.1 | GO:0035166 | post-embryonic hemopoiesis(GO:0035166) |
| 0.0 | 0.0 | GO:0035898 | parathyroid hormone secretion(GO:0035898) |
| 0.0 | 0.1 | GO:0006420 | arginyl-tRNA aminoacylation(GO:0006420) |
| 0.0 | 0.1 | GO:0007210 | serotonin receptor signaling pathway(GO:0007210) |
| 0.0 | 0.1 | GO:0002414 | immunoglobulin transcytosis in epithelial cells(GO:0002414) |
| 0.0 | 0.2 | GO:0060420 | regulation of heart growth(GO:0060420) |
| 0.0 | 0.1 | GO:0090399 | replicative senescence(GO:0090399) |
| 0.0 | 0.0 | GO:0003128 | heart field specification(GO:0003128) |
| 0.0 | 0.1 | GO:0032485 | regulation of Ral protein signal transduction(GO:0032485) |
| 0.0 | 0.0 | GO:0060066 | oviduct development(GO:0060066) |
| 0.0 | 0.0 | GO:0006419 | alanyl-tRNA aminoacylation(GO:0006419) |
| 0.0 | 0.0 | GO:0010887 | negative regulation of cholesterol storage(GO:0010887) |
| 0.0 | 0.2 | GO:0060384 | innervation(GO:0060384) |
| 0.0 | 0.0 | GO:0001560 | regulation of cell growth by extracellular stimulus(GO:0001560) |
| 0.0 | 0.6 | GO:0031424 | keratinization(GO:0031424) |
| 0.0 | 0.0 | GO:0045650 | negative regulation of macrophage differentiation(GO:0045650) |
| 0.0 | 0.1 | GO:0000395 | mRNA 5'-splice site recognition(GO:0000395) |
| 0.0 | 0.0 | GO:0001951 | intestinal D-glucose absorption(GO:0001951) |
| 0.0 | 0.0 | GO:0071436 | sodium ion export(GO:0071436) |
| 0.0 | 0.1 | GO:0048539 | bone marrow development(GO:0048539) |
| 0.0 | 0.1 | GO:0046469 | platelet activating factor biosynthetic process(GO:0006663) platelet activating factor metabolic process(GO:0046469) |
| 0.0 | 0.1 | GO:0002408 | myeloid dendritic cell chemotaxis(GO:0002408) |
| 0.0 | 0.1 | GO:0031650 | regulation of heat generation(GO:0031650) |
| 0.0 | 0.0 | GO:0042939 | glutathione transport(GO:0034635) tripeptide transport(GO:0042939) |
| 0.0 | 0.0 | GO:0021797 | forebrain anterior/posterior pattern specification(GO:0021797) |
| 0.0 | 0.4 | GO:0007528 | neuromuscular junction development(GO:0007528) |
| 0.0 | 0.2 | GO:0003334 | keratinocyte development(GO:0003334) |
| 0.0 | 0.4 | GO:0007416 | synapse assembly(GO:0007416) |
| 0.0 | 0.0 | GO:0046098 | guanine metabolic process(GO:0046098) |
| 0.0 | 0.0 | GO:0010155 | regulation of proton transport(GO:0010155) |
| 0.0 | 0.0 | GO:1903116 | positive regulation of actin filament-based movement(GO:1903116) |
| 0.0 | 0.2 | GO:0045116 | protein neddylation(GO:0045116) |
| 0.0 | 0.1 | GO:0045875 | negative regulation of sister chromatid cohesion(GO:0045875) |
| 0.0 | 0.0 | GO:0032277 | regulation of gonadotropin secretion(GO:0032276) negative regulation of gonadotropin secretion(GO:0032277) |
| 0.0 | 0.1 | GO:0034755 | iron ion transmembrane transport(GO:0034755) |
| 0.0 | 0.1 | GO:0018202 | peptidyl-histidine modification(GO:0018202) |
| 0.0 | 0.2 | GO:0044458 | motile cilium assembly(GO:0044458) |
| 0.0 | 0.0 | GO:0014029 | neural crest formation(GO:0014029) |
| 0.0 | 0.1 | GO:0043985 | histone H4-R3 methylation(GO:0043985) |
| 0.0 | 0.0 | GO:0060075 | regulation of resting membrane potential(GO:0060075) |
| 0.0 | 0.1 | GO:0090331 | negative regulation of platelet aggregation(GO:0090331) |
| 0.0 | 0.1 | GO:0019530 | taurine metabolic process(GO:0019530) |
| 0.0 | 0.0 | GO:0033631 | cell-cell adhesion mediated by integrin(GO:0033631) |
| 0.0 | 0.1 | GO:0015879 | carnitine transport(GO:0015879) |
| 0.0 | 0.2 | GO:0018027 | peptidyl-lysine dimethylation(GO:0018027) |
| 0.0 | 0.0 | GO:0036301 | macrophage colony-stimulating factor production(GO:0036301) granulocyte colony-stimulating factor production(GO:0071611) regulation of granulocyte colony-stimulating factor production(GO:0071655) regulation of macrophage colony-stimulating factor production(GO:1901256) |
| 0.0 | 0.0 | GO:0070169 | positive regulation of biomineral tissue development(GO:0070169) |
| 0.0 | 0.1 | GO:0070345 | negative regulation of fat cell proliferation(GO:0070345) |
| 0.0 | 0.1 | GO:0033622 | integrin activation(GO:0033622) |
| 0.0 | 0.1 | GO:0036158 | outer dynein arm assembly(GO:0036158) |
| 0.0 | 0.1 | GO:0086010 | membrane depolarization during action potential(GO:0086010) |
| 0.0 | 0.0 | GO:0032275 | luteinizing hormone secretion(GO:0032275) |
| 0.0 | 0.1 | GO:0051697 | protein delipidation(GO:0051697) |
| 0.0 | 0.0 | GO:0032342 | aldosterone metabolic process(GO:0032341) aldosterone biosynthetic process(GO:0032342) |
| 0.0 | 0.1 | GO:0061436 | establishment of skin barrier(GO:0061436) |
| 0.0 | 0.1 | GO:0035336 | long-chain fatty-acyl-CoA metabolic process(GO:0035336) |
| 0.0 | 0.0 | GO:0042637 | catagen(GO:0042637) |
| 0.0 | 0.1 | GO:0006590 | thyroid hormone generation(GO:0006590) |
| 0.0 | 0.1 | GO:0060763 | mammary duct terminal end bud growth(GO:0060763) |
| 0.0 | 0.0 | GO:0090214 | spongiotrophoblast layer developmental growth(GO:0090214) |
| 0.0 | 0.1 | GO:2000310 | regulation of N-methyl-D-aspartate selective glutamate receptor activity(GO:2000310) |
| 0.0 | 0.0 | GO:0035963 | response to interleukin-13(GO:0035962) cellular response to interleukin-13(GO:0035963) |
| 0.0 | 0.0 | GO:0046499 | S-adenosylmethioninamine metabolic process(GO:0046499) |
| 0.0 | 0.0 | GO:0048625 | myoblast fate commitment(GO:0048625) |
| 0.0 | 0.0 | GO:0060478 | acrosomal vesicle exocytosis(GO:0060478) |
| 0.0 | 0.0 | GO:0001993 | regulation of systemic arterial blood pressure by norepinephrine-epinephrine(GO:0001993) |
| 0.0 | 0.1 | GO:0006013 | mannose metabolic process(GO:0006013) |
| 0.0 | 0.0 | GO:0072015 | glomerular visceral epithelial cell development(GO:0072015) glomerular epithelial cell development(GO:0072310) |
| 0.0 | 0.0 | GO:1901538 | DNA methylation involved in embryo development(GO:0043045) changes to DNA methylation involved in embryo development(GO:1901538) |
| 0.0 | 0.1 | GO:0035418 | protein localization to synapse(GO:0035418) |
| 0.0 | 0.0 | GO:0019695 | choline metabolic process(GO:0019695) |
| 0.0 | 0.1 | GO:0044828 | negative regulation by host of viral genome replication(GO:0044828) |
| 0.0 | 0.0 | GO:1902630 | regulation of membrane hyperpolarization(GO:1902630) |
| 0.0 | 0.0 | GO:0042940 | D-amino acid transport(GO:0042940) |
| 0.0 | 0.0 | GO:0033087 | negative regulation of immature T cell proliferation(GO:0033087) |
| 0.0 | 0.0 | GO:0060334 | regulation of interferon-gamma-mediated signaling pathway(GO:0060334) |
| 0.0 | 0.0 | GO:0019081 | viral translation(GO:0019081) |
| 0.0 | 0.1 | GO:0060340 | positive regulation of type I interferon-mediated signaling pathway(GO:0060340) |
| 0.0 | 0.2 | GO:0007271 | synaptic transmission, cholinergic(GO:0007271) |
| 0.0 | 0.0 | GO:0090160 | Golgi to lysosome transport(GO:0090160) |
| 0.0 | 0.1 | GO:0042407 | cristae formation(GO:0042407) |
| 0.0 | 0.1 | GO:0051570 | regulation of histone H3-K9 methylation(GO:0051570) |
| 0.0 | 0.0 | GO:0010002 | cardioblast differentiation(GO:0010002) |
| 0.0 | 0.0 | GO:1901725 | regulation of histone deacetylase activity(GO:1901725) |
| 0.0 | 0.0 | GO:0002677 | negative regulation of chronic inflammatory response(GO:0002677) |
| 0.0 | 0.0 | GO:0045618 | positive regulation of keratinocyte differentiation(GO:0045618) |
| 0.0 | 0.0 | GO:0070127 | tRNA aminoacylation for mitochondrial protein translation(GO:0070127) |
| 0.0 | 0.0 | GO:0002606 | dendritic cell antigen processing and presentation(GO:0002468) regulation of dendritic cell antigen processing and presentation(GO:0002604) positive regulation of dendritic cell antigen processing and presentation(GO:0002606) |
| 0.0 | 0.0 | GO:0022417 | protein maturation by protein folding(GO:0022417) |
| 0.0 | 0.0 | GO:0033387 | putrescine biosynthetic process from ornithine(GO:0033387) |
| 0.0 | 0.1 | GO:0002076 | osteoblast development(GO:0002076) |
| 0.0 | 0.0 | GO:0035633 | maintenance of blood-brain barrier(GO:0035633) |
| 0.0 | 0.1 | GO:0002227 | innate immune response in mucosa(GO:0002227) |
| 0.0 | 0.1 | GO:1902715 | positive regulation of interferon-gamma secretion(GO:1902715) |
| 0.0 | 0.3 | GO:0050853 | B cell receptor signaling pathway(GO:0050853) |
| 0.0 | 0.0 | GO:0060333 | interferon-gamma-mediated signaling pathway(GO:0060333) |
| 0.0 | 0.1 | GO:1900264 | regulation of DNA-directed DNA polymerase activity(GO:1900262) positive regulation of DNA-directed DNA polymerase activity(GO:1900264) |
| 0.0 | 0.0 | GO:0070562 | regulation of vitamin D receptor signaling pathway(GO:0070562) |
| 0.0 | 0.0 | GO:0051660 | establishment of centrosome localization(GO:0051660) |
| 0.0 | 0.0 | GO:0008065 | establishment of blood-nerve barrier(GO:0008065) |
| 0.0 | 0.0 | GO:0060060 | post-embryonic retina morphogenesis in camera-type eye(GO:0060060) |
| 0.0 | 0.0 | GO:0007060 | male meiosis chromosome segregation(GO:0007060) |
| 0.0 | 0.0 | GO:0035964 | COPI-coated vesicle budding(GO:0035964) |
| 0.0 | 0.1 | GO:0001731 | formation of translation preinitiation complex(GO:0001731) |
| 0.0 | 0.3 | GO:0050885 | neuromuscular process controlling balance(GO:0050885) |
| 0.0 | 0.0 | GO:2001204 | regulation of osteoclast development(GO:2001204) |
| 0.0 | 0.0 | GO:0002930 | trabecular meshwork development(GO:0002930) |
| 0.0 | 0.0 | GO:0072672 | neutrophil extravasation(GO:0072672) |
| 0.0 | 0.1 | GO:0006108 | malate metabolic process(GO:0006108) |
| 0.0 | 0.0 | GO:0035234 | ectopic germ cell programmed cell death(GO:0035234) |
| 0.0 | 0.0 | GO:0043518 | negative regulation of DNA damage response, signal transduction by p53 class mediator(GO:0043518) |
| 0.0 | 0.0 | GO:0042759 | long-chain fatty acid biosynthetic process(GO:0042759) |
| 0.0 | 0.1 | GO:0034625 | fatty acid elongation, saturated fatty acid(GO:0019367) fatty acid elongation, unsaturated fatty acid(GO:0019368) fatty acid elongation, monounsaturated fatty acid(GO:0034625) fatty acid elongation, polyunsaturated fatty acid(GO:0034626) |
| 0.0 | 0.0 | GO:2000381 | negative regulation of mesoderm development(GO:2000381) |
| 0.0 | 0.1 | GO:0035518 | histone H2A monoubiquitination(GO:0035518) |
| 0.0 | 0.0 | GO:0010172 | embryonic body morphogenesis(GO:0010172) |
| 0.0 | 0.3 | GO:0006505 | GPI anchor metabolic process(GO:0006505) |
| 0.0 | 0.0 | GO:0061303 | cornea development in camera-type eye(GO:0061303) |
| 0.0 | 0.2 | GO:0007130 | synaptonemal complex assembly(GO:0007130) |
| 0.0 | 0.0 | GO:0019388 | galactose catabolic process(GO:0019388) |
| 0.0 | 0.0 | GO:0031340 | positive regulation of vesicle fusion(GO:0031340) |
| 0.0 | 0.1 | GO:0051014 | actin filament severing(GO:0051014) |
| 0.0 | 0.0 | GO:1904059 | regulation of locomotor rhythm(GO:1904059) |
| 0.0 | 0.0 | GO:0002087 | regulation of respiratory gaseous exchange by neurological system process(GO:0002087) |
| 0.0 | 0.0 | GO:0021913 | regulation of transcription from RNA polymerase II promoter involved in ventral spinal cord interneuron specification(GO:0021913) |
| 0.0 | 0.0 | GO:1902177 | positive regulation of oxidative stress-induced intrinsic apoptotic signaling pathway(GO:1902177) |
| 0.0 | 0.0 | GO:0042732 | D-xylose metabolic process(GO:0042732) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.7 | 2.8 | GO:0071953 | elastic fiber(GO:0071953) |
| 0.5 | 1.5 | GO:0005594 | collagen type IX trimer(GO:0005594) |
| 0.5 | 2.7 | GO:1990454 | L-type voltage-gated calcium channel complex(GO:1990454) |
| 0.5 | 1.4 | GO:0017133 | mitochondrial electron transfer flavoprotein complex(GO:0017133) electron transfer flavoprotein complex(GO:0045251) |
| 0.3 | 2.1 | GO:0016012 | sarcoglycan complex(GO:0016012) |
| 0.3 | 1.0 | GO:0043259 | laminin-10 complex(GO:0043259) |
| 0.3 | 1.6 | GO:0030485 | smooth muscle contractile fiber(GO:0030485) |
| 0.3 | 2.3 | GO:0005861 | troponin complex(GO:0005861) |
| 0.3 | 1.1 | GO:1990357 | terminal web(GO:1990357) |
| 0.3 | 0.8 | GO:0097058 | CRLF-CLCF1 complex(GO:0097058) |
| 0.2 | 0.7 | GO:0005610 | laminin-5 complex(GO:0005610) |
| 0.2 | 0.7 | GO:0097512 | cardiac myofibril(GO:0097512) |
| 0.2 | 1.8 | GO:0005859 | muscle myosin complex(GO:0005859) |
| 0.2 | 2.6 | GO:0005583 | fibrillar collagen trimer(GO:0005583) banded collagen fibril(GO:0098643) |
| 0.2 | 0.8 | GO:0045298 | tubulin complex(GO:0045298) |
| 0.2 | 3.4 | GO:0005614 | interstitial matrix(GO:0005614) |
| 0.2 | 0.2 | GO:0071664 | catenin-TCF7L2 complex(GO:0071664) |
| 0.2 | 2.3 | GO:0001518 | voltage-gated sodium channel complex(GO:0001518) |
| 0.2 | 0.4 | GO:0016939 | kinesin II complex(GO:0016939) |
| 0.2 | 0.4 | GO:0097487 | multivesicular body, internal vesicle(GO:0097487) |
| 0.2 | 2.1 | GO:0005916 | fascia adherens(GO:0005916) |
| 0.2 | 0.5 | GO:0071001 | U4/U6 snRNP(GO:0071001) |
| 0.2 | 0.7 | GO:0031466 | Cul5-RING ubiquitin ligase complex(GO:0031466) |
| 0.2 | 0.7 | GO:1990716 | axonemal central apparatus(GO:1990716) |
| 0.2 | 1.6 | GO:0001527 | microfibril(GO:0001527) |
| 0.2 | 0.7 | GO:0044308 | axonal spine(GO:0044308) |
| 0.2 | 0.8 | GO:0005927 | muscle tendon junction(GO:0005927) |
| 0.2 | 1.8 | GO:0005641 | nuclear envelope lumen(GO:0005641) |
| 0.2 | 0.6 | GO:0070033 | synaptobrevin 2-SNAP-25-syntaxin-1a-complexin II complex(GO:0070033) |
| 0.2 | 0.9 | GO:0098651 | collagen type IV trimer(GO:0005587) network-forming collagen trimer(GO:0098642) collagen network(GO:0098645) basement membrane collagen trimer(GO:0098651) |
| 0.2 | 1.1 | GO:0045180 | basal cortex(GO:0045180) |
| 0.2 | 0.9 | GO:0031983 | vesicle lumen(GO:0031983) |
| 0.1 | 0.3 | GO:0097427 | microtubule bundle(GO:0097427) |
| 0.1 | 1.9 | GO:0042589 | zymogen granule membrane(GO:0042589) |
| 0.1 | 0.4 | GO:0002193 | MAML1-RBP-Jkappa- ICN1 complex(GO:0002193) |
| 0.1 | 0.4 | GO:0034679 | integrin alpha9-beta1 complex(GO:0034679) |
| 0.1 | 0.8 | GO:0071598 | neuronal ribonucleoprotein granule(GO:0071598) |
| 0.1 | 0.8 | GO:0005915 | zonula adherens(GO:0005915) |
| 0.1 | 0.6 | GO:0048787 | presynaptic active zone membrane(GO:0048787) |
| 0.1 | 0.7 | GO:0090665 | dystrophin-associated glycoprotein complex(GO:0016010) glycoprotein complex(GO:0090665) |
| 0.1 | 0.3 | GO:0048179 | activin receptor complex(GO:0048179) |
| 0.1 | 0.4 | GO:0030478 | actin cap(GO:0030478) |
| 0.1 | 1.1 | GO:0030877 | beta-catenin destruction complex(GO:0030877) |
| 0.1 | 0.5 | GO:0031258 | lamellipodium membrane(GO:0031258) |
| 0.1 | 0.5 | GO:0033010 | paranodal junction(GO:0033010) |
| 0.1 | 1.6 | GO:0043034 | costamere(GO:0043034) |
| 0.1 | 0.8 | GO:0043083 | synaptic cleft(GO:0043083) |
| 0.1 | 0.3 | GO:0031088 | platelet dense granule membrane(GO:0031088) |
| 0.1 | 1.6 | GO:0016327 | apicolateral plasma membrane(GO:0016327) |
| 0.1 | 0.7 | GO:0044300 | cerebellar mossy fiber(GO:0044300) |
| 0.1 | 0.4 | GO:0032541 | cortical endoplasmic reticulum(GO:0032541) |
| 0.1 | 5.2 | GO:0001725 | stress fiber(GO:0001725) contractile actin filament bundle(GO:0097517) |
| 0.1 | 0.3 | GO:0034673 | inhibin-betaglycan-ActRII complex(GO:0034673) |
| 0.1 | 0.8 | GO:0035253 | ciliary rootlet(GO:0035253) |
| 0.1 | 0.4 | GO:1990851 | Wnt-Frizzled-LRP5/6 complex(GO:1990851) |
| 0.1 | 0.7 | GO:0005883 | neurofilament(GO:0005883) |
| 0.1 | 0.3 | GO:0036396 | MIS complex(GO:0036396) |
| 0.1 | 0.4 | GO:0032983 | kainate selective glutamate receptor complex(GO:0032983) |
| 0.1 | 0.2 | GO:0044299 | C-fiber(GO:0044299) |
| 0.1 | 1.5 | GO:0005922 | connexon complex(GO:0005922) |
| 0.1 | 0.2 | GO:0031417 | NatC complex(GO:0031417) |
| 0.1 | 0.2 | GO:0034706 | sodium channel complex(GO:0034706) |
| 0.1 | 0.2 | GO:0035355 | Toll-like receptor 2-Toll-like receptor 6 protein complex(GO:0035355) |
| 0.1 | 2.0 | GO:0031672 | A band(GO:0031672) |
| 0.1 | 0.3 | GO:0071438 | invadopodium membrane(GO:0071438) |
| 0.1 | 0.6 | GO:0045179 | apical cortex(GO:0045179) |
| 0.1 | 0.3 | GO:0070545 | PeBoW complex(GO:0070545) |
| 0.1 | 0.7 | GO:0036379 | myofilament(GO:0036379) |
| 0.1 | 0.2 | GO:0043292 | contractile fiber(GO:0043292) |
| 0.1 | 1.2 | GO:0030673 | axolemma(GO:0030673) |
| 0.1 | 1.5 | GO:0008305 | integrin complex(GO:0008305) |
| 0.1 | 0.5 | GO:0030991 | intraciliary transport particle A(GO:0030991) |
| 0.1 | 0.2 | GO:0034457 | Mpp10 complex(GO:0034457) |
| 0.1 | 0.3 | GO:0048237 | rough endoplasmic reticulum lumen(GO:0048237) |
| 0.1 | 0.3 | GO:0005796 | Golgi lumen(GO:0005796) |
| 0.1 | 0.2 | GO:0032299 | ribonuclease H2 complex(GO:0032299) |
| 0.1 | 0.2 | GO:1990393 | 3M complex(GO:1990393) |
| 0.1 | 1.2 | GO:0030057 | desmosome(GO:0030057) |
| 0.1 | 0.5 | GO:0005890 | sodium:potassium-exchanging ATPase complex(GO:0005890) |
| 0.1 | 3.8 | GO:0008076 | voltage-gated potassium channel complex(GO:0008076) |
| 0.1 | 15.9 | GO:0005578 | proteinaceous extracellular matrix(GO:0005578) |
| 0.1 | 0.7 | GO:0043240 | Fanconi anaemia nuclear complex(GO:0043240) |
| 0.1 | 0.2 | GO:0005726 | perichromatin fibrils(GO:0005726) |
| 0.1 | 0.7 | GO:0097038 | perinuclear endoplasmic reticulum(GO:0097038) |
| 0.1 | 0.1 | GO:1990812 | growth cone filopodium(GO:1990812) |
| 0.1 | 0.3 | GO:0070937 | CRD-mediated mRNA stability complex(GO:0070937) |
| 0.1 | 0.2 | GO:0016533 | cyclin-dependent protein kinase 5 holoenzyme complex(GO:0016533) |
| 0.1 | 0.1 | GO:0071008 | U2-type post-mRNA release spliceosomal complex(GO:0071008) |
| 0.1 | 0.2 | GO:0071141 | SMAD protein complex(GO:0071141) |
| 0.1 | 0.2 | GO:0045098 | type III intermediate filament(GO:0045098) |
| 0.1 | 2.4 | GO:0032587 | ruffle membrane(GO:0032587) |
| 0.0 | 0.2 | GO:0042406 | extrinsic component of endoplasmic reticulum membrane(GO:0042406) |
| 0.0 | 0.1 | GO:0034991 | nuclear meiotic cohesin complex(GO:0034991) |
| 0.0 | 0.6 | GO:0032433 | filopodium tip(GO:0032433) |
| 0.0 | 0.0 | GO:0000798 | nuclear cohesin complex(GO:0000798) |
| 0.0 | 0.1 | GO:0014701 | junctional sarcoplasmic reticulum membrane(GO:0014701) |
| 0.0 | 0.5 | GO:0031512 | motile primary cilium(GO:0031512) |
| 0.0 | 0.0 | GO:0044393 | microspike(GO:0044393) |
| 0.0 | 0.3 | GO:0017146 | NMDA selective glutamate receptor complex(GO:0017146) |
| 0.0 | 0.8 | GO:0001673 | male germ cell nucleus(GO:0001673) |
| 0.0 | 0.6 | GO:0043196 | varicosity(GO:0043196) |
| 0.0 | 0.7 | GO:0031941 | filamentous actin(GO:0031941) |
| 0.0 | 0.1 | GO:0097470 | ribbon synapse(GO:0097470) |
| 0.0 | 0.5 | GO:0033017 | sarcoplasmic reticulum membrane(GO:0033017) |
| 0.0 | 0.3 | GO:0005921 | gap junction(GO:0005921) |
| 0.0 | 0.1 | GO:0043194 | axon initial segment(GO:0043194) |
| 0.0 | 1.1 | GO:0042734 | presynaptic membrane(GO:0042734) |
| 0.0 | 0.1 | GO:0000015 | phosphopyruvate hydratase complex(GO:0000015) |
| 0.0 | 0.2 | GO:0031527 | filopodium membrane(GO:0031527) |
| 0.0 | 1.2 | GO:0031594 | neuromuscular junction(GO:0031594) |
| 0.0 | 0.1 | GO:0071203 | WASH complex(GO:0071203) |
| 0.0 | 0.9 | GO:0005581 | collagen trimer(GO:0005581) |
| 0.0 | 0.1 | GO:0005958 | DNA-dependent protein kinase-DNA ligase 4 complex(GO:0005958) |
| 0.0 | 0.5 | GO:1902710 | GABA receptor complex(GO:1902710) GABA-A receptor complex(GO:1902711) |
| 0.0 | 0.3 | GO:0032426 | stereocilium tip(GO:0032426) |
| 0.0 | 0.1 | GO:0071547 | piP-body(GO:0071547) |
| 0.0 | 0.2 | GO:0031143 | pseudopodium(GO:0031143) |
| 0.0 | 0.1 | GO:0031467 | Cul7-RING ubiquitin ligase complex(GO:0031467) |
| 0.0 | 3.5 | GO:0045211 | postsynaptic membrane(GO:0045211) |
| 0.0 | 1.8 | GO:0030016 | myofibril(GO:0030016) |
| 0.0 | 0.1 | GO:0044354 | pinosome(GO:0044352) macropinosome(GO:0044354) |
| 0.0 | 0.1 | GO:0032280 | symmetric synapse(GO:0032280) |
| 0.0 | 0.1 | GO:1990131 | EGO complex(GO:0034448) Gtr1-Gtr2 GTPase complex(GO:1990131) |
| 0.0 | 0.2 | GO:0031932 | TORC2 complex(GO:0031932) |
| 0.0 | 0.1 | GO:0001652 | granular component(GO:0001652) |
| 0.0 | 0.1 | GO:0032982 | myosin filament(GO:0032982) |
| 0.0 | 0.0 | GO:0070765 | gamma-secretase complex(GO:0070765) |
| 0.0 | 0.1 | GO:0070820 | tertiary granule(GO:0070820) |
| 0.0 | 0.1 | GO:0046696 | lipopolysaccharide receptor complex(GO:0046696) |
| 0.0 | 0.1 | GO:0061617 | MICOS complex(GO:0061617) |
| 0.0 | 0.3 | GO:0005797 | Golgi medial cisterna(GO:0005797) |
| 0.0 | 0.1 | GO:0042629 | mast cell granule(GO:0042629) |
| 0.0 | 0.1 | GO:0030868 | smooth endoplasmic reticulum membrane(GO:0030868) smooth endoplasmic reticulum part(GO:0097425) |
| 0.0 | 0.0 | GO:0033268 | node of Ranvier(GO:0033268) |
| 0.0 | 0.0 | GO:0031074 | nucleocytoplasmic shuttling complex(GO:0031074) |
| 0.0 | 0.3 | GO:0032281 | AMPA glutamate receptor complex(GO:0032281) |
| 0.0 | 1.0 | GO:0043195 | terminal bouton(GO:0043195) |
| 0.0 | 0.2 | GO:0032580 | Golgi cisterna membrane(GO:0032580) |
| 0.0 | 0.7 | GO:0046658 | anchored component of plasma membrane(GO:0046658) |
| 0.0 | 0.1 | GO:0031314 | extrinsic component of mitochondrial inner membrane(GO:0031314) |
| 0.0 | 0.1 | GO:0044194 | cytolytic granule(GO:0044194) |
| 0.0 | 0.0 | GO:0005956 | protein kinase CK2 complex(GO:0005956) |
| 0.0 | 0.1 | GO:0008074 | guanylate cyclase complex, soluble(GO:0008074) |
| 0.0 | 0.1 | GO:0031209 | SCAR complex(GO:0031209) |
| 0.0 | 0.3 | GO:0030315 | T-tubule(GO:0030315) |
| 0.0 | 0.1 | GO:0070695 | FHF complex(GO:0070695) |
| 0.0 | 0.1 | GO:0008274 | gamma-tubulin large complex(GO:0000931) gamma-tubulin ring complex(GO:0008274) |
| 0.0 | 0.0 | GO:0042567 | insulin-like growth factor binding protein complex(GO:0016942) growth factor complex(GO:0036454) insulin-like growth factor ternary complex(GO:0042567) |
| 0.0 | 0.0 | GO:0030289 | protein phosphatase 4 complex(GO:0030289) |
| 0.0 | 0.1 | GO:0090571 | RNA polymerase II transcription repressor complex(GO:0090571) |
| 0.0 | 0.2 | GO:0018995 | host(GO:0018995) host cell part(GO:0033643) host cell(GO:0043657) |
| 0.0 | 0.1 | GO:0005663 | DNA replication factor C complex(GO:0005663) |
| 0.0 | 0.0 | GO:0000172 | ribonuclease MRP complex(GO:0000172) |
| 0.0 | 0.0 | GO:0005745 | m-AAA complex(GO:0005745) |
| 0.0 | 0.1 | GO:0042613 | MHC class II protein complex(GO:0042613) |
| 0.0 | 0.1 | GO:0044322 | endoplasmic reticulum quality control compartment(GO:0044322) |
| 0.0 | 0.0 | GO:0016222 | procollagen-proline 4-dioxygenase complex(GO:0016222) |
| 0.0 | 0.7 | GO:0031012 | extracellular matrix(GO:0031012) |
| 0.0 | 0.2 | GO:0032154 | cleavage furrow(GO:0032154) cell surface furrow(GO:0097610) |
| 0.0 | 0.1 | GO:0071541 | eukaryotic translation initiation factor 3 complex, eIF3m(GO:0071541) |
| 0.0 | 0.3 | GO:0000314 | organellar small ribosomal subunit(GO:0000314) mitochondrial small ribosomal subunit(GO:0005763) |
| 0.0 | 0.3 | GO:0055038 | recycling endosome membrane(GO:0055038) |
| 0.0 | 0.0 | GO:0031390 | Ctf18 RFC-like complex(GO:0031390) |
| 0.0 | 0.1 | GO:0098553 | integral component of cytoplasmic side of endoplasmic reticulum membrane(GO:0071458) integral component of lumenal side of endoplasmic reticulum membrane(GO:0071556) lumenal side of endoplasmic reticulum membrane(GO:0098553) lumenal side of membrane(GO:0098576) |
| 0.0 | 2.5 | GO:0030055 | cell-substrate junction(GO:0030055) |
| 0.0 | 0.0 | GO:0071942 | XPC complex(GO:0071942) |
| 0.0 | 0.1 | GO:0042382 | paraspeckles(GO:0042382) |
| 0.0 | 0.0 | GO:0033185 | dolichol-phosphate-mannose synthase complex(GO:0033185) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.8 | 3.1 | GO:0086007 | voltage-gated calcium channel activity involved in cardiac muscle cell action potential(GO:0086007) |
| 0.7 | 2.0 | GO:0008449 | N-acetylglucosamine-6-sulfatase activity(GO:0008449) |
| 0.6 | 1.7 | GO:0004720 | protein-lysine 6-oxidase activity(GO:0004720) |
| 0.5 | 1.5 | GO:0004096 | catalase activity(GO:0004096) |
| 0.5 | 1.5 | GO:1902282 | voltage-gated potassium channel activity involved in ventricular cardiac muscle cell action potential repolarization(GO:1902282) |
| 0.4 | 1.3 | GO:0031708 | endothelin B receptor binding(GO:0031708) |
| 0.4 | 1.3 | GO:0004174 | electron-transferring-flavoprotein dehydrogenase activity(GO:0004174) oxidoreductase activity, acting on the CH-NH group of donors, quinone or similar compound as acceptor(GO:0016649) |
| 0.4 | 2.1 | GO:0086006 | voltage-gated sodium channel activity involved in cardiac muscle cell action potential(GO:0086006) |
| 0.4 | 1.2 | GO:0008073 | ornithine decarboxylase inhibitor activity(GO:0008073) |
| 0.4 | 1.1 | GO:0005006 | epidermal growth factor-activated receptor activity(GO:0005006) |
| 0.3 | 0.7 | GO:0030899 | calcium-dependent ATPase activity(GO:0030899) |
| 0.3 | 3.9 | GO:0048407 | platelet-derived growth factor binding(GO:0048407) |
| 0.3 | 0.9 | GO:0008475 | procollagen-lysine 5-dioxygenase activity(GO:0008475) |
| 0.3 | 1.9 | GO:0005166 | neurotrophin p75 receptor binding(GO:0005166) |
| 0.3 | 0.9 | GO:0030172 | troponin C binding(GO:0030172) |
| 0.3 | 2.5 | GO:0008046 | axon guidance receptor activity(GO:0008046) |
| 0.3 | 2.9 | GO:0032036 | myosin heavy chain binding(GO:0032036) |
| 0.3 | 0.8 | GO:1990430 | extracellular matrix protein binding(GO:1990430) |
| 0.3 | 0.5 | GO:0008332 | low voltage-gated calcium channel activity(GO:0008332) |
| 0.3 | 1.0 | GO:0005095 | GTPase inhibitor activity(GO:0005095) |
| 0.2 | 3.2 | GO:0030676 | Rac guanyl-nucleotide exchange factor activity(GO:0030676) |
| 0.2 | 1.2 | GO:0086080 | protein binding involved in heterotypic cell-cell adhesion(GO:0086080) |
| 0.2 | 1.0 | GO:0005105 | type 1 fibroblast growth factor receptor binding(GO:0005105) |
| 0.2 | 0.7 | GO:0055100 | adiponectin binding(GO:0055100) |
| 0.2 | 0.7 | GO:0031802 | type 5 metabotropic glutamate receptor binding(GO:0031802) |
| 0.2 | 1.1 | GO:0004945 | angiotensin type II receptor activity(GO:0004945) |
| 0.2 | 1.3 | GO:0048495 | Roundabout binding(GO:0048495) |
| 0.2 | 0.8 | GO:0015272 | ATP-activated inward rectifier potassium channel activity(GO:0015272) |
| 0.2 | 0.4 | GO:0035373 | chondroitin sulfate proteoglycan binding(GO:0035373) |
| 0.2 | 1.0 | GO:0000774 | adenyl-nucleotide exchange factor activity(GO:0000774) |
| 0.2 | 0.6 | GO:0004427 | inorganic diphosphatase activity(GO:0004427) |
| 0.2 | 0.8 | GO:0004971 | AMPA glutamate receptor activity(GO:0004971) |
| 0.2 | 0.4 | GO:0048408 | epidermal growth factor binding(GO:0048408) |
| 0.2 | 0.2 | GO:0019912 | cyclin-dependent protein kinase activating kinase activity(GO:0019912) |
| 0.2 | 0.7 | GO:0071253 | connexin binding(GO:0071253) |
| 0.2 | 0.9 | GO:0008294 | calcium- and calmodulin-responsive adenylate cyclase activity(GO:0008294) |
| 0.2 | 0.5 | GO:0035939 | microsatellite binding(GO:0035939) |
| 0.2 | 0.5 | GO:0030160 | GKAP/Homer scaffold activity(GO:0030160) |
| 0.2 | 0.5 | GO:0035673 | oligopeptide transmembrane transporter activity(GO:0035673) |
| 0.2 | 0.8 | GO:0070051 | fibrinogen binding(GO:0070051) |
| 0.2 | 1.1 | GO:0043912 | D-lysine oxidase activity(GO:0043912) |
| 0.2 | 0.6 | GO:0046870 | cadmium ion binding(GO:0046870) |
| 0.2 | 1.5 | GO:0017166 | vinculin binding(GO:0017166) |
| 0.2 | 0.3 | GO:0005001 | transmembrane receptor protein tyrosine phosphatase activity(GO:0005001) |
| 0.1 | 0.3 | GO:0008517 | folic acid transporter activity(GO:0008517) |
| 0.1 | 0.4 | GO:0061629 | RNA polymerase II sequence-specific DNA binding transcription factor binding(GO:0061629) |
| 0.1 | 0.6 | GO:0070579 | methylcytosine dioxygenase activity(GO:0070579) |
| 0.1 | 2.4 | GO:0003785 | actin monomer binding(GO:0003785) |
| 0.1 | 0.4 | GO:0070052 | collagen V binding(GO:0070052) |
| 0.1 | 0.4 | GO:0019797 | procollagen-proline 3-dioxygenase activity(GO:0019797) |
| 0.1 | 1.1 | GO:0070097 | delta-catenin binding(GO:0070097) |
| 0.1 | 0.9 | GO:0050291 | sphingosine N-acyltransferase activity(GO:0050291) |
| 0.1 | 0.5 | GO:0016361 | activin receptor activity, type I(GO:0016361) |
| 0.1 | 0.4 | GO:0005030 | neurotrophin receptor activity(GO:0005030) |
| 0.1 | 2.7 | GO:0001968 | fibronectin binding(GO:0001968) |
| 0.1 | 2.6 | GO:0042813 | Wnt-activated receptor activity(GO:0042813) |
| 0.1 | 0.5 | GO:0097493 | structural molecule activity conferring elasticity(GO:0097493) |
| 0.1 | 0.4 | GO:0047276 | N-acetyllactosaminide 3-alpha-galactosyltransferase activity(GO:0047276) |
| 0.1 | 0.4 | GO:0045503 | dynein light chain binding(GO:0045503) |
| 0.1 | 1.0 | GO:0031432 | titin binding(GO:0031432) |
| 0.1 | 0.6 | GO:0004111 | creatine kinase activity(GO:0004111) |
| 0.1 | 2.1 | GO:0051393 | alpha-actinin binding(GO:0051393) |
| 0.1 | 0.9 | GO:0018649 | 3-(3-hydroxyphenyl)propionate hydroxylase activity(GO:0008688) 4-chlorobenzaldehyde oxidase activity(GO:0018471) 3,5-xylenol methylhydroxylase activity(GO:0018630) phenylacetate hydroxylase activity(GO:0018631) 4-nitrophenol 4-monooxygenase activity(GO:0018632) dimethyl sulfide monooxygenase activity(GO:0018633) alpha-pinene monooxygenase [NADH] activity(GO:0018634) 1-hydroxy-2-naphthoate hydroxylase activity(GO:0018637) toluene 4-monooxygenase activity(GO:0018638) xylene monooxygenase activity(GO:0018639) dibenzothiophene monooxygenase activity(GO:0018640) 6-hydroxy-3-methyl-2-oxo-1,2-dihydroquinoline 6-monooxygenase activity(GO:0018641) chlorophenol 4-monooxygenase activity(GO:0018642) carbon disulfide oxygenase activity(GO:0018643) toluene 2-monooxygenase activity(GO:0018644) 1-hydroxy-2-oxolimonene 1,2-monooxygenase activity(GO:0018646) phenanthrene 1,2-monooxygenase activity(GO:0018647) tetrahydrofuran hydroxylase activity(GO:0018649) styrene monooxygenase activity(GO:0018650) toluene-4-sulfonate monooxygenase activity(GO:0018651) toluene-sulfonate methyl-monooxygenase activity(GO:0018652) 3-methyl-2-oxo-1,2-dihydroquinoline 6-monooxygenase activity(GO:0018653) 2-hydroxy-phenylacetate hydroxylase activity(GO:0018654) 2-oxo-delta3-4,5,5-trimethylcyclopentenylacetyl-CoA 1,2-monooxygenase activity(GO:0018655) phenanthrene 3,4-monooxygenase activity(GO:0018656) toluene 3-monooxygenase activity(GO:0018657) 4-hydroxyphenylacetate,NADH:oxygen oxidoreductase (3-hydroxylating) activity(GO:0018660) limonene monooxygenase activity(GO:0019113) 2-methylnaphthalene hydroxylase activity(GO:0034526) 1-methylnaphthalene hydroxylase activity(GO:0034534) bisphenol A hydroxylase A activity(GO:0034560) salicylate 5-hydroxylase activity(GO:0034785) isobutylamine N-hydroxylase activity(GO:0034791) branched-chain dodecylbenzene sulfonate monooxygenase activity(GO:0034802) 3-HSA hydroxylase activity(GO:0034819) 4-hydroxypyridine-3-hydroxylase activity(GO:0034894) 2-octaprenyl-3-methyl-6-methoxy-1,4-benzoquinol hydroxylase activity(GO:0043719) 6-hydroxynicotinate 3-monooxygenase activity(GO:0043731) thalianol hydroxylase activity(GO:0080014) |
| 0.1 | 0.5 | GO:0016018 | cyclosporin A binding(GO:0016018) |
| 0.1 | 1.5 | GO:0031005 | filamin binding(GO:0031005) |
| 0.1 | 0.4 | GO:0031014 | troponin T binding(GO:0031014) |
| 0.1 | 1.2 | GO:0005222 | intracellular cAMP activated cation channel activity(GO:0005222) |
| 0.1 | 0.7 | GO:0070191 | methionine-R-sulfoxide reductase activity(GO:0070191) |
| 0.1 | 0.5 | GO:0015467 | G-protein activated inward rectifier potassium channel activity(GO:0015467) |
| 0.1 | 0.5 | GO:0019788 | NEDD8 transferase activity(GO:0019788) |
| 0.1 | 0.3 | GO:0005220 | inositol 1,4,5-trisphosphate-sensitive calcium-release channel activity(GO:0005220) |
| 0.1 | 0.2 | GO:0038085 | vascular endothelial growth factor binding(GO:0038085) |
| 0.1 | 0.3 | GO:0097109 | neuroligin family protein binding(GO:0097109) |
| 0.1 | 5.9 | GO:0005089 | Rho guanyl-nucleotide exchange factor activity(GO:0005089) |
| 0.1 | 0.6 | GO:0005127 | ciliary neurotrophic factor receptor binding(GO:0005127) |
| 0.1 | 0.8 | GO:0038036 | sphingosine-1-phosphate receptor activity(GO:0038036) |
| 0.1 | 0.3 | GO:1990050 | phosphatidic acid transporter activity(GO:1990050) |
| 0.1 | 0.6 | GO:0031749 | D2 dopamine receptor binding(GO:0031749) |
| 0.1 | 0.4 | GO:0005042 | netrin receptor activity(GO:0005042) |
| 0.1 | 0.4 | GO:0000386 | second spliceosomal transesterification activity(GO:0000386) |
| 0.1 | 3.2 | GO:0005201 | extracellular matrix structural constituent(GO:0005201) |
| 0.1 | 0.2 | GO:0098632 | protein binding involved in cell-cell adhesion(GO:0098632) |
| 0.1 | 1.1 | GO:0005243 | gap junction channel activity(GO:0005243) |
| 0.1 | 0.7 | GO:0000014 | single-stranded DNA endodeoxyribonuclease activity(GO:0000014) |
| 0.1 | 0.5 | GO:0036122 | BMP binding(GO:0036122) |
| 0.1 | 0.3 | GO:0070573 | metallodipeptidase activity(GO:0070573) |
| 0.1 | 0.4 | GO:0015277 | kainate selective glutamate receptor activity(GO:0015277) |
| 0.1 | 0.3 | GO:0008401 | retinoic acid 4-hydroxylase activity(GO:0008401) |
| 0.1 | 0.3 | GO:0004833 | tryptophan 2,3-dioxygenase activity(GO:0004833) |
| 0.1 | 0.2 | GO:0098821 | BMP receptor activity(GO:0098821) |
| 0.1 | 0.3 | GO:0005176 | ErbB-2 class receptor binding(GO:0005176) |
| 0.1 | 0.3 | GO:1990715 | mRNA CDS binding(GO:1990715) |
| 0.1 | 0.3 | GO:0004370 | glycerol kinase activity(GO:0004370) |
| 0.1 | 0.4 | GO:0005007 | fibroblast growth factor-activated receptor activity(GO:0005007) |
| 0.1 | 0.2 | GO:0050833 | pyruvate transmembrane transporter activity(GO:0050833) |
| 0.1 | 0.1 | GO:0070411 | I-SMAD binding(GO:0070411) |
| 0.1 | 1.0 | GO:0030955 | potassium ion binding(GO:0030955) |
| 0.1 | 0.4 | GO:0035033 | histone deacetylase regulator activity(GO:0035033) |
| 0.1 | 0.3 | GO:0050897 | cobalt ion binding(GO:0050897) |
| 0.1 | 0.6 | GO:0008331 | high voltage-gated calcium channel activity(GO:0008331) |
| 0.1 | 0.2 | GO:0004937 | alpha1-adrenergic receptor activity(GO:0004937) |
| 0.1 | 0.2 | GO:0015111 | iodide transmembrane transporter activity(GO:0015111) |
| 0.1 | 0.8 | GO:0051010 | microtubule plus-end binding(GO:0051010) |
| 0.1 | 0.2 | GO:0016520 | growth hormone-releasing hormone receptor activity(GO:0016520) |
| 0.1 | 0.2 | GO:0071553 | uridine nucleotide receptor activity(GO:0015065) G-protein coupled pyrimidinergic nucleotide receptor activity(GO:0071553) |
| 0.1 | 0.2 | GO:0051880 | G-quadruplex DNA binding(GO:0051880) |
| 0.1 | 2.3 | GO:0001540 | beta-amyloid binding(GO:0001540) |
| 0.1 | 0.3 | GO:0001224 | RNA polymerase II transcription cofactor binding(GO:0001224) |
| 0.1 | 0.2 | GO:0005021 | vascular endothelial growth factor-activated receptor activity(GO:0005021) |
| 0.1 | 0.3 | GO:0016715 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, reduced ascorbate as one donor, and incorporation of one atom of oxygen(GO:0016715) |
| 0.1 | 0.9 | GO:0004185 | serine-type carboxypeptidase activity(GO:0004185) |
| 0.1 | 1.1 | GO:0045499 | chemorepellent activity(GO:0045499) |
| 0.1 | 0.7 | GO:0005523 | tropomyosin binding(GO:0005523) |
| 0.1 | 0.7 | GO:0070700 | BMP receptor binding(GO:0070700) |
| 0.1 | 0.2 | GO:0001595 | angiotensin receptor activity(GO:0001595) |
| 0.1 | 0.1 | GO:0008525 | phosphatidylcholine transporter activity(GO:0008525) |
| 0.1 | 0.4 | GO:0005344 | oxygen transporter activity(GO:0005344) |
| 0.1 | 1.0 | GO:0050431 | transforming growth factor beta binding(GO:0050431) |
| 0.1 | 0.6 | GO:0038191 | neuropilin binding(GO:0038191) |
| 0.1 | 0.2 | GO:0036042 | long-chain fatty acyl-CoA binding(GO:0036042) |
| 0.1 | 0.3 | GO:0003828 | alpha-N-acetylneuraminate alpha-2,8-sialyltransferase activity(GO:0003828) |
| 0.1 | 1.1 | GO:0005520 | insulin-like growth factor binding(GO:0005520) |
| 0.1 | 1.0 | GO:0004653 | polypeptide N-acetylgalactosaminyltransferase activity(GO:0004653) |
| 0.1 | 0.2 | GO:0004687 | myosin light chain kinase activity(GO:0004687) |
| 0.1 | 0.1 | GO:0031013 | troponin I binding(GO:0031013) |
| 0.1 | 0.1 | GO:0031698 | beta-2 adrenergic receptor binding(GO:0031698) |
| 0.1 | 0.3 | GO:0004994 | somatostatin receptor activity(GO:0004994) |
| 0.1 | 0.5 | GO:0002151 | G-quadruplex RNA binding(GO:0002151) |
| 0.1 | 0.7 | GO:0005451 | monovalent cation:proton antiporter activity(GO:0005451) |
| 0.1 | 0.3 | GO:0038132 | neuregulin binding(GO:0038132) |
| 0.1 | 0.3 | GO:0042285 | UDP-xylosyltransferase activity(GO:0035252) xylosyltransferase activity(GO:0042285) |
| 0.1 | 0.3 | GO:0008499 | UDP-galactose:beta-N-acetylglucosamine beta-1,3-galactosyltransferase activity(GO:0008499) |
| 0.1 | 0.3 | GO:0017034 | Rap guanyl-nucleotide exchange factor activity(GO:0017034) |
| 0.1 | 0.2 | GO:0004999 | vasoactive intestinal polypeptide receptor activity(GO:0004999) |
| 0.1 | 0.5 | GO:0015193 | L-proline transmembrane transporter activity(GO:0015193) |
| 0.1 | 0.8 | GO:0070016 | armadillo repeat domain binding(GO:0070016) |
| 0.1 | 0.3 | GO:0071723 | lipopeptide binding(GO:0071723) |
| 0.1 | 0.4 | GO:0043495 | protein anchor(GO:0043495) |
| 0.1 | 1.6 | GO:0001786 | phosphatidylserine binding(GO:0001786) |
| 0.1 | 0.4 | GO:0004931 | extracellular ATP-gated cation channel activity(GO:0004931) ATP-gated ion channel activity(GO:0035381) |
| 0.1 | 5.9 | GO:0004222 | metalloendopeptidase activity(GO:0004222) |
| 0.1 | 0.8 | GO:0005542 | folic acid binding(GO:0005542) |
| 0.1 | 0.2 | GO:0004839 | ubiquitin activating enzyme activity(GO:0004839) |
| 0.1 | 0.9 | GO:0008143 | poly(A) binding(GO:0008143) |
| 0.1 | 0.2 | GO:0019834 | phospholipase A2 inhibitor activity(GO:0019834) |
| 0.1 | 3.6 | GO:0005249 | voltage-gated potassium channel activity(GO:0005249) |
| 0.1 | 0.1 | GO:0004065 | arylsulfatase activity(GO:0004065) |
| 0.1 | 0.3 | GO:0042609 | CD4 receptor binding(GO:0042609) |
| 0.1 | 1.0 | GO:0043325 | phosphatidylinositol-3,4-bisphosphate binding(GO:0043325) |
| 0.1 | 0.2 | GO:0008321 | Ral guanyl-nucleotide exchange factor activity(GO:0008321) |
| 0.1 | 0.1 | GO:0019959 | interleukin-8 binding(GO:0019959) |
| 0.1 | 0.2 | GO:0004711 | ribosomal protein S6 kinase activity(GO:0004711) |
| 0.1 | 0.7 | GO:0047555 | 3',5'-cyclic-GMP phosphodiesterase activity(GO:0047555) |
| 0.1 | 0.2 | GO:0031694 | alpha-2A adrenergic receptor binding(GO:0031694) |
| 0.1 | 0.2 | GO:0048406 | nerve growth factor binding(GO:0048406) |
| 0.1 | 0.1 | GO:0033592 | RNA strand annealing activity(GO:0033592) |
| 0.1 | 0.2 | GO:0019966 | interleukin-1 binding(GO:0019966) |
| 0.1 | 0.3 | GO:0005041 | low-density lipoprotein receptor activity(GO:0005041) |
| 0.1 | 0.3 | GO:0004723 | calcium-dependent protein serine/threonine phosphatase activity(GO:0004723) |
| 0.1 | 0.3 | GO:0008467 | [heparan sulfate]-glucosamine 3-sulfotransferase 1 activity(GO:0008467) |
| 0.1 | 0.2 | GO:0008158 | hedgehog receptor activity(GO:0008158) |
| 0.1 | 0.2 | GO:0000099 | sulfur amino acid transmembrane transporter activity(GO:0000099) |
| 0.1 | 0.1 | GO:0022858 | L-alanine transmembrane transporter activity(GO:0015180) alanine transmembrane transporter activity(GO:0022858) |
| 0.1 | 0.2 | GO:0004800 | thyroxine 5'-deiodinase activity(GO:0004800) |
| 0.1 | 0.5 | GO:0016595 | glutamate binding(GO:0016595) |
| 0.1 | 0.1 | GO:0072542 | protein phosphatase activator activity(GO:0072542) |
| 0.0 | 0.2 | GO:0031727 | CCR2 chemokine receptor binding(GO:0031727) |
| 0.0 | 0.3 | GO:0048019 | receptor antagonist activity(GO:0048019) |
| 0.0 | 0.5 | GO:0070636 | single-strand selective uracil DNA N-glycosylase activity(GO:0017065) nicotinamide riboside hydrolase activity(GO:0070635) nicotinic acid riboside hydrolase activity(GO:0070636) deoxyribonucleoside 5'-monophosphate N-glycosidase activity(GO:0070694) |
| 0.0 | 0.2 | GO:0043262 | adenosine-diphosphatase activity(GO:0043262) |
| 0.0 | 0.4 | GO:0008307 | structural constituent of muscle(GO:0008307) |
| 0.0 | 0.1 | GO:0072345 | NAADP-sensitive calcium-release channel activity(GO:0072345) |
| 0.0 | 0.2 | GO:0031402 | sodium ion binding(GO:0031402) |
| 0.0 | 0.6 | GO:0070064 | proline-rich region binding(GO:0070064) |
| 0.0 | 0.2 | GO:0015189 | arginine transmembrane transporter activity(GO:0015181) L-lysine transmembrane transporter activity(GO:0015189) |
| 0.0 | 0.2 | GO:0070883 | pre-miRNA binding(GO:0070883) |
| 0.0 | 0.3 | GO:0008140 | cAMP response element binding protein binding(GO:0008140) |
| 0.0 | 1.3 | GO:0050699 | WW domain binding(GO:0050699) |
| 0.0 | 0.4 | GO:0070679 | inositol 1,4,5 trisphosphate binding(GO:0070679) |
| 0.0 | 0.1 | GO:0043121 | neurotrophin binding(GO:0043121) |
| 0.0 | 0.1 | GO:0005502 | 11-cis retinal binding(GO:0005502) |
| 0.0 | 0.2 | GO:0016176 | superoxide-generating NADPH oxidase activator activity(GO:0016176) |
| 0.0 | 0.1 | GO:0005329 | dopamine transmembrane transporter activity(GO:0005329) |
| 0.0 | 0.4 | GO:0003796 | lysozyme activity(GO:0003796) |
| 0.0 | 0.2 | GO:0015220 | choline transmembrane transporter activity(GO:0015220) |
| 0.0 | 0.1 | GO:0097603 | temperature-gated ion channel activity(GO:0097603) |
| 0.0 | 0.2 | GO:0005072 | transforming growth factor beta receptor, cytoplasmic mediator activity(GO:0005072) |
| 0.0 | 0.1 | GO:0015198 | oligopeptide transporter activity(GO:0015198) |
| 0.0 | 0.4 | GO:0003993 | acid phosphatase activity(GO:0003993) |
| 0.0 | 0.2 | GO:0016901 | oxidoreductase activity, acting on the CH-OH group of donors, quinone or similar compound as acceptor(GO:0016901) |
| 0.0 | 0.1 | GO:0046976 | histone methyltransferase activity (H3-K27 specific)(GO:0046976) |
| 0.0 | 0.3 | GO:0070991 | medium-chain-acyl-CoA dehydrogenase activity(GO:0070991) |
| 0.0 | 1.5 | GO:0016748 | succinyltransferase activity(GO:0016748) |
| 0.0 | 0.1 | GO:0043184 | vascular endothelial growth factor receptor 2 binding(GO:0043184) |
| 0.0 | 0.3 | GO:0031957 | very long-chain fatty acid-CoA ligase activity(GO:0031957) |
| 0.0 | 0.1 | GO:0034988 | Fc-gamma receptor I complex binding(GO:0034988) |
| 0.0 | 0.5 | GO:0016500 | protein-hormone receptor activity(GO:0016500) |
| 0.0 | 0.1 | GO:0034648 | histone demethylase activity (H3-dimethyl-K4 specific)(GO:0034648) |
| 0.0 | 0.2 | GO:0050501 | hyaluronan synthase activity(GO:0050501) |
| 0.0 | 0.2 | GO:0008559 | xenobiotic-transporting ATPase activity(GO:0008559) |
| 0.0 | 0.2 | GO:0034711 | inhibin binding(GO:0034711) |
| 0.0 | 0.0 | GO:0017099 | very-long-chain-acyl-CoA dehydrogenase activity(GO:0017099) |
| 0.0 | 0.4 | GO:0005092 | GDP-dissociation inhibitor activity(GO:0005092) |
| 0.0 | 0.2 | GO:0038064 | collagen receptor activity(GO:0038064) |
| 0.0 | 0.0 | GO:0015922 | aspartate oxidase activity(GO:0015922) |
| 0.0 | 0.2 | GO:0004523 | RNA-DNA hybrid ribonuclease activity(GO:0004523) |
| 0.0 | 0.4 | GO:0048018 | receptor agonist activity(GO:0048018) |
| 0.0 | 0.2 | GO:0061665 | SUMO ligase activity(GO:0061665) |
| 0.0 | 0.3 | GO:0001972 | retinoic acid binding(GO:0001972) |
| 0.0 | 0.1 | GO:1990829 | C-rich single-stranded DNA binding(GO:1990829) |
| 0.0 | 0.6 | GO:0005112 | Notch binding(GO:0005112) |
| 0.0 | 0.1 | GO:0042289 | MHC class II protein binding(GO:0042289) |
| 0.0 | 0.2 | GO:0008532 | N-acetyllactosaminide beta-1,3-N-acetylglucosaminyltransferase activity(GO:0008532) |
| 0.0 | 0.2 | GO:0046975 | histone methyltransferase activity (H3-K36 specific)(GO:0046975) |
| 0.0 | 0.2 | GO:0004704 | NF-kappaB-inducing kinase activity(GO:0004704) |
| 0.0 | 0.2 | GO:0001727 | lipid kinase activity(GO:0001727) |
| 0.0 | 0.3 | GO:0051864 | histone demethylase activity (H3-K36 specific)(GO:0051864) |
| 0.0 | 0.1 | GO:0004656 | procollagen-proline 4-dioxygenase activity(GO:0004656) |
| 0.0 | 0.1 | GO:0008260 | 3-oxoacid CoA-transferase activity(GO:0008260) |
| 0.0 | 0.1 | GO:1990932 | 5.8S rRNA binding(GO:1990932) |
| 0.0 | 0.2 | GO:0030550 | acetylcholine receptor inhibitor activity(GO:0030550) |
| 0.0 | 0.2 | GO:0035671 | enone reductase activity(GO:0035671) |
| 0.0 | 0.1 | GO:0030144 | alpha-1,6-mannosylglycoprotein 6-beta-N-acetylglucosaminyltransferase activity(GO:0030144) |
| 0.0 | 0.2 | GO:0004415 | hyalurononglucosaminidase activity(GO:0004415) |
| 0.0 | 0.3 | GO:0070410 | co-SMAD binding(GO:0070410) |
| 0.0 | 0.3 | GO:0016857 | racemase and epimerase activity, acting on carbohydrates and derivatives(GO:0016857) |
| 0.0 | 0.4 | GO:0016805 | dipeptidase activity(GO:0016805) |
| 0.0 | 0.4 | GO:0035497 | cAMP response element binding(GO:0035497) |
| 0.0 | 0.1 | GO:0008309 | double-stranded DNA exodeoxyribonuclease activity(GO:0008309) |
| 0.0 | 0.0 | GO:0016941 | natriuretic peptide receptor activity(GO:0016941) |
| 0.0 | 0.6 | GO:0004181 | metallocarboxypeptidase activity(GO:0004181) |
| 0.0 | 1.2 | GO:0005044 | scavenger receptor activity(GO:0005044) |
| 0.0 | 0.4 | GO:0070006 | metalloaminopeptidase activity(GO:0070006) |
| 0.0 | 0.6 | GO:0004708 | MAP kinase kinase activity(GO:0004708) |
| 0.0 | 0.1 | GO:0004035 | alkaline phosphatase activity(GO:0004035) |
| 0.0 | 0.1 | GO:0030572 | cardiolipin synthase activity(GO:0008808) phosphatidyltransferase activity(GO:0030572) |
| 0.0 | 0.1 | GO:0047045 | testosterone 17-beta-dehydrogenase (NADP+) activity(GO:0047045) |
| 0.0 | 0.1 | GO:0004470 | malic enzyme activity(GO:0004470) malate dehydrogenase (decarboxylating) (NAD+) activity(GO:0004471) |
| 0.0 | 0.1 | GO:0071987 | WD40-repeat domain binding(GO:0071987) |
| 0.0 | 0.1 | GO:0070548 | L-glutamine aminotransferase activity(GO:0070548) |
| 0.0 | 0.2 | GO:0030368 | interleukin-17 receptor activity(GO:0030368) |
| 0.0 | 0.2 | GO:0004311 | farnesyltranstransferase activity(GO:0004311) |
| 0.0 | 0.4 | GO:0051400 | BH domain binding(GO:0051400) |
| 0.0 | 1.0 | GO:0004714 | transmembrane receptor protein tyrosine kinase activity(GO:0004714) |
| 0.0 | 2.5 | GO:0051015 | actin filament binding(GO:0051015) |
| 0.0 | 1.0 | GO:0005132 | type I interferon receptor binding(GO:0005132) |
| 0.0 | 0.1 | GO:0035276 | alcohol dehydrogenase activity, zinc-dependent(GO:0004024) ethanol binding(GO:0035276) |
| 0.0 | 0.1 | GO:0005094 | Rho GDP-dissociation inhibitor activity(GO:0005094) |
| 0.0 | 0.1 | GO:0016415 | octanoyltransferase activity(GO:0016415) |
| 0.0 | 0.4 | GO:0008191 | metalloendopeptidase inhibitor activity(GO:0008191) |
| 0.0 | 0.5 | GO:1900750 | glutathione binding(GO:0043295) oligopeptide binding(GO:1900750) |
| 0.0 | 0.1 | GO:0070878 | primary miRNA binding(GO:0070878) |
| 0.0 | 0.2 | GO:0016175 | superoxide-generating NADPH oxidase activity(GO:0016175) |
| 0.0 | 0.4 | GO:0004697 | protein kinase C activity(GO:0004697) |
| 0.0 | 0.7 | GO:0005109 | frizzled binding(GO:0005109) |
| 0.0 | 0.1 | GO:0030519 | snoRNP binding(GO:0030519) |
| 0.0 | 0.1 | GO:0015252 | hydrogen ion channel activity(GO:0015252) |
| 0.0 | 0.1 | GO:0047498 | calcium-dependent phospholipase A2 activity(GO:0047498) |
| 0.0 | 0.2 | GO:0008599 | protein phosphatase type 1 regulator activity(GO:0008599) |
| 0.0 | 0.1 | GO:0008239 | dipeptidyl-peptidase activity(GO:0008239) |
| 0.0 | 0.1 | GO:1901612 | cardiolipin binding(GO:1901612) |
| 0.0 | 0.7 | GO:0043015 | gamma-tubulin binding(GO:0043015) |
| 0.0 | 0.3 | GO:0001134 | transcription factor activity, transcription factor recruiting(GO:0001134) |
| 0.0 | 0.1 | GO:0008235 | metalloexopeptidase activity(GO:0008235) |
| 0.0 | 0.2 | GO:0045322 | unmethylated CpG binding(GO:0045322) |
| 0.0 | 0.5 | GO:0004890 | GABA-A receptor activity(GO:0004890) |
| 0.0 | 0.6 | GO:0071837 | HMG box domain binding(GO:0071837) |
| 0.0 | 0.2 | GO:0005237 | inhibitory extracellular ligand-gated ion channel activity(GO:0005237) extracellular-glycine-gated ion channel activity(GO:0016933) extracellular-glycine-gated chloride channel activity(GO:0016934) |
| 0.0 | 1.6 | GO:0005178 | integrin binding(GO:0005178) |
| 0.0 | 0.7 | GO:0042169 | SH2 domain binding(GO:0042169) |
| 0.0 | 0.1 | GO:0050510 | N-acetylgalactosaminyl-proteoglycan 3-beta-glucuronosyltransferase activity(GO:0050510) |
| 0.0 | 0.4 | GO:0000146 | microfilament motor activity(GO:0000146) |
| 0.0 | 0.1 | GO:0042392 | sphingosine-1-phosphate phosphatase activity(GO:0042392) |
| 0.0 | 0.3 | GO:0046703 | natural killer cell lectin-like receptor binding(GO:0046703) |
| 0.0 | 0.2 | GO:0050656 | 3'-phosphoadenosine 5'-phosphosulfate binding(GO:0050656) |
| 0.0 | 0.1 | GO:0004103 | choline kinase activity(GO:0004103) |
| 0.0 | 0.1 | GO:0008597 | calcium-dependent protein serine/threonine phosphatase regulator activity(GO:0008597) |
| 0.0 | 0.0 | GO:0047238 | glucuronosyl-N-acetylgalactosaminyl-proteoglycan 4-beta-N-acetylgalactosaminyltransferase activity(GO:0047238) |
| 0.0 | 0.1 | GO:0019107 | myristoyltransferase activity(GO:0019107) |
| 0.0 | 0.1 | GO:0005234 | extracellular-glutamate-gated ion channel activity(GO:0005234) |
| 0.0 | 0.1 | GO:0015142 | citrate transmembrane transporter activity(GO:0015137) tricarboxylic acid transmembrane transporter activity(GO:0015142) |
| 0.0 | 0.2 | GO:0008889 | glycerophosphodiester phosphodiesterase activity(GO:0008889) |
| 0.0 | 0.1 | GO:0005275 | amine transmembrane transporter activity(GO:0005275) |
| 0.0 | 0.2 | GO:0032041 | histone deacetylase activity (H3-K14 specific)(GO:0031078) NAD-dependent histone deacetylase activity (H3-K14 specific)(GO:0032041) |
| 0.0 | 0.1 | GO:0070996 | type 1 melanocortin receptor binding(GO:0070996) |
| 0.0 | 0.2 | GO:0050700 | CARD domain binding(GO:0050700) |
| 0.0 | 0.3 | GO:0008327 | methyl-CpG binding(GO:0008327) |
| 0.0 | 0.0 | GO:0098631 | protein binding involved in cell adhesion(GO:0098631) |
| 0.0 | 0.1 | GO:0016615 | malate dehydrogenase activity(GO:0016615) |
| 0.0 | 0.1 | GO:0015280 | ligand-gated sodium channel activity(GO:0015280) |
| 0.0 | 0.2 | GO:0005521 | lamin binding(GO:0005521) |
| 0.0 | 0.0 | GO:0035851 | Krueppel-associated box domain binding(GO:0035851) |
| 0.0 | 0.1 | GO:0003958 | NADPH-hemoprotein reductase activity(GO:0003958) |
| 0.0 | 0.4 | GO:0005231 | excitatory extracellular ligand-gated ion channel activity(GO:0005231) |
| 0.0 | 0.0 | GO:0034739 | histone deacetylase activity (H4-K16 specific)(GO:0034739) |
| 0.0 | 0.1 | GO:0008454 | alpha-1,3-mannosylglycoprotein 4-beta-N-acetylglucosaminyltransferase activity(GO:0008454) |
| 0.0 | 0.6 | GO:0005164 | tumor necrosis factor receptor binding(GO:0005164) |
| 0.0 | 0.1 | GO:0004758 | serine C-palmitoyltransferase activity(GO:0004758) |
| 0.0 | 0.5 | GO:0071855 | neuropeptide receptor binding(GO:0071855) |
| 0.0 | 0.1 | GO:0005131 | growth hormone receptor binding(GO:0005131) |
| 0.0 | 0.1 | GO:0031730 | CCR5 chemokine receptor binding(GO:0031730) |
| 0.0 | 0.1 | GO:0048027 | mRNA 5'-UTR binding(GO:0048027) |
| 0.0 | 0.1 | GO:0004814 | arginine-tRNA ligase activity(GO:0004814) |
| 0.0 | 0.1 | GO:0052832 | inositol monophosphate 1-phosphatase activity(GO:0008934) inositol monophosphate 3-phosphatase activity(GO:0052832) inositol monophosphate 4-phosphatase activity(GO:0052833) inositol monophosphate phosphatase activity(GO:0052834) |
| 0.0 | 0.0 | GO:0070815 | peptidyl-lysine 5-dioxygenase activity(GO:0070815) |
| 0.0 | 0.1 | GO:0015288 | porin activity(GO:0015288) |
| 0.0 | 0.3 | GO:0035035 | histone acetyltransferase binding(GO:0035035) |
| 0.0 | 0.6 | GO:0005544 | calcium-dependent phospholipid binding(GO:0005544) |
| 0.0 | 0.1 | GO:0003846 | 2-acylglycerol O-acyltransferase activity(GO:0003846) |
| 0.0 | 0.1 | GO:0044548 | S100 protein binding(GO:0044548) |
| 0.0 | 0.1 | GO:0016854 | racemase and epimerase activity(GO:0016854) |
| 0.0 | 1.6 | GO:0008201 | heparin binding(GO:0008201) |
| 0.0 | 0.5 | GO:0016709 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, NAD(P)H as one donor, and incorporation of one atom of oxygen(GO:0016709) |
| 0.0 | 0.0 | GO:0016880 | acid-ammonia (or amide) ligase activity(GO:0016880) |
| 0.0 | 0.0 | GO:0070538 | oleic acid binding(GO:0070538) |
| 0.0 | 0.1 | GO:0005148 | prolactin receptor binding(GO:0005148) |
| 0.0 | 0.1 | GO:0016421 | CoA carboxylase activity(GO:0016421) |
| 0.0 | 1.0 | GO:0003777 | microtubule motor activity(GO:0003777) |
| 0.0 | 0.1 | GO:0008420 | CTD phosphatase activity(GO:0008420) |
| 0.0 | 0.9 | GO:0050839 | cell adhesion molecule binding(GO:0050839) |
| 0.0 | 0.1 | GO:0002134 | UTP binding(GO:0002134) pyrimidine ribonucleoside binding(GO:0032551) |
| 0.0 | 0.2 | GO:0030881 | beta-2-microglobulin binding(GO:0030881) |
| 0.0 | 0.3 | GO:0051721 | protein phosphatase 2A binding(GO:0051721) |
| 0.0 | 0.1 | GO:0023026 | MHC class II protein complex binding(GO:0023026) |
| 0.0 | 0.0 | GO:0043199 | sulfate binding(GO:0043199) |
| 0.0 | 0.1 | GO:0030280 | structural constituent of epidermis(GO:0030280) |
| 0.0 | 0.0 | GO:0055131 | C3HC4-type RING finger domain binding(GO:0055131) |
| 0.0 | 0.4 | GO:0003774 | motor activity(GO:0003774) |
| 0.0 | 0.1 | GO:0004383 | guanylate cyclase activity(GO:0004383) |
| 0.0 | 0.1 | GO:0031996 | thioesterase binding(GO:0031996) |
| 0.0 | 0.1 | GO:0004908 | interleukin-1 receptor activity(GO:0004908) |
| 0.0 | 0.0 | GO:0070840 | dynein complex binding(GO:0070840) |
| 0.0 | 0.7 | GO:0008013 | beta-catenin binding(GO:0008013) |
| 0.0 | 0.1 | GO:0010997 | anaphase-promoting complex binding(GO:0010997) |
| 0.0 | 0.1 | GO:0015037 | peptide disulfide oxidoreductase activity(GO:0015037) |
| 0.0 | 0.1 | GO:0032454 | histone demethylase activity (H3-K9 specific)(GO:0032454) |
| 0.0 | 0.1 | GO:0034604 | pyruvate dehydrogenase activity(GO:0004738) pyruvate dehydrogenase [NAD(P)+] activity(GO:0034603) pyruvate dehydrogenase (NAD+) activity(GO:0034604) |
| 0.0 | 0.0 | GO:0004726 | non-membrane spanning protein tyrosine phosphatase activity(GO:0004726) |
| 0.0 | 0.1 | GO:0070513 | death domain binding(GO:0070513) |
| 0.0 | 0.0 | GO:0005415 | nucleoside:sodium symporter activity(GO:0005415) |
| 0.0 | 0.0 | GO:0031433 | telethonin binding(GO:0031433) |
| 0.0 | 2.9 | GO:0001077 | transcriptional activator activity, RNA polymerase II core promoter proximal region sequence-specific binding(GO:0001077) |
| 0.0 | 0.0 | GO:0034056 | estrogen response element binding(GO:0034056) |
| 0.0 | 0.0 | GO:0000171 | ribonuclease MRP activity(GO:0000171) |
| 0.0 | 0.0 | GO:0004046 | aminoacylase activity(GO:0004046) |
| 0.0 | 0.0 | GO:0034617 | tetrahydrobiopterin binding(GO:0034617) |
| 0.0 | 0.0 | GO:0001642 | group III metabotropic glutamate receptor activity(GO:0001642) |
| 0.0 | 0.1 | GO:0008853 | exodeoxyribonuclease III activity(GO:0008853) |
| 0.0 | 0.1 | GO:0016833 | oxo-acid-lyase activity(GO:0016833) |
| 0.0 | 0.1 | GO:0036041 | long-chain fatty acid binding(GO:0036041) |
| 0.0 | 0.1 | GO:0035256 | G-protein coupled glutamate receptor binding(GO:0035256) |
| 0.0 | 0.0 | GO:0015199 | amino-acid betaine transmembrane transporter activity(GO:0015199) carnitine transmembrane transporter activity(GO:0015226) |
| 0.0 | 0.0 | GO:0005280 | hydrogen:amino acid symporter activity(GO:0005280) |
| 0.0 | 0.0 | GO:0004829 | threonine-tRNA ligase activity(GO:0004829) |
| 0.0 | 0.1 | GO:0046974 | histone methyltransferase activity (H3-K9 specific)(GO:0046974) |
| 0.0 | 0.0 | GO:0032405 | MutLalpha complex binding(GO:0032405) |
| 0.0 | 0.0 | GO:0004466 | long-chain-acyl-CoA dehydrogenase activity(GO:0004466) |
| 0.0 | 0.0 | GO:0019958 | C-X-C chemokine binding(GO:0019958) |
| 0.0 | 0.0 | GO:1990239 | steroid hormone binding(GO:1990239) |
| 0.0 | 0.1 | GO:0070182 | DNA polymerase binding(GO:0070182) |
| 0.0 | 0.0 | GO:0045295 | gamma-catenin binding(GO:0045295) |
| 0.0 | 0.1 | GO:0097322 | 7SK snRNA binding(GO:0097322) |
| 0.0 | 0.0 | GO:0004673 | protein histidine kinase activity(GO:0004673) |
| 0.0 | 0.3 | GO:0004715 | non-membrane spanning protein tyrosine kinase activity(GO:0004715) |
| 0.0 | 0.1 | GO:0015377 | cation:chloride symporter activity(GO:0015377) |
| 0.0 | 0.0 | GO:0018560 | 2,3-dihydroxy DDT 1,2-dioxygenase activity(GO:0018542) phenanthrene dioxygenase activity(GO:0018555) 2,2',3-trihydroxybiphenyl dioxygenase activity(GO:0018556) 1,2-dihydroxyfluorene 1,1-alpha-dioxygenase activity(GO:0018557) 5,6-dihydroxy-3-methyl-2-oxo-1,2-dihydroquinoline dioxygenase activity(GO:0018558) 1,1-dichloro-2-(dihydroxy-4-chlorophenyl)-(4-chlorophenyl)ethene 1,2-dioxygenase activity(GO:0018559) protocatechuate 3,4-dioxygenase type II activity(GO:0018560) 2'-aminobiphenyl-2,3-diol 1,2-dioxygenase activity(GO:0018561) 3,4-dihydroxyfluorene 4,4-alpha-dioxygenase activity(GO:0018562) 2,3-dihydroxy-ethylbenzene 1,2-dioxygenase activity(GO:0018563) carbazole 1,9a-dioxygenase activity(GO:0018564) dihydroxydibenzothiophene dioxygenase activity(GO:0018565) 1,2-dihydroxynaphthalene-6-sulfonate 1,8a-dioxygenase activity(GO:0018566) styrene dioxygenase activity(GO:0018567) 3,4-dihydroxyphenanthrene dioxygenase activity(GO:0018568) hydroquinone 1,2-dioxygenase activity(GO:0018569) p-cumate 2,3-dioxygenase activity(GO:0018570) 2,3-dihydroxy-p-cumate dioxygenase activity(GO:0018571) 3,5-dichlorocatechol 1,2-dioxygenase activity(GO:0018572) 2-aminophenol 1,6-dioxygenase activity(GO:0018573) 2,6-dichloro-p-hydroquinone 1,2-dioxygenase activity(GO:0018574) chlorocatechol 1,2-dioxygenase activity(GO:0018575) catechol dioxygenase activity(GO:0019114) dihydroxyfluorene dioxygenase activity(GO:0019117) 5-aminosalicylate dioxygenase activity(GO:0034543) 3-hydroxy-2-naphthoate 2,3-dioxygenase activity(GO:0034803) benzo(a)pyrene 11,12-dioxygenase activity(GO:0034806) benzo(a)pyrene 4,5-dioxygenase activity(GO:0034808) 4,5-dihydroxybenzo(a)pyrene dioxygenase activity(GO:0034810) benzo(a)pyrene 9,10-dioxygenase activity(GO:0034811) 9,10-dihydroxybenzo(a)pyrene dioxygenase activity(GO:0034812) benzo(a)pyrene 7,8-dioxygenase activity(GO:0034813) 7,8-dihydroxy benzo(a)pyrene dioxygenase activity(GO:0034814) 1,2-dihydroxy-5,6,7,8-tetrahydronaphthalene extradiol dioxygenase activity(GO:0034827) 2-mercaptobenzothiazole dioxygenase activity(GO:0034834) pyridine-3,4-diol dioxygenase activity(GO:0034895) pyrene dioxygenase activity(GO:0034920) 4,5-dihydroxypyrene dioxygenase activity(GO:0034922) phenanthrene-4-carboxylate dioxygenase activity(GO:0034934) tetrachlorobenzene dioxygenase activity(GO:0034935) 4,6-dichloro-3-methylcatechol 1,2-dioxygenase activity(GO:0034936) 2,3-dihydroxydiphenyl ether dioxygenase activity(GO:0034955) diphenyl ether 1,2-dioxygenase activity(GO:0034956) arachidonate 8(S)-lipoxygenase activity(GO:0036403) 4-hydroxycatechol 1,2-dioxygenase activity(GO:0047074) |
| 0.0 | 0.1 | GO:0015026 | coreceptor activity(GO:0015026) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.3 | 0.3 | PID PS1 PATHWAY | Presenilin action in Notch and Wnt signaling |
| 0.2 | 2.0 | PID INTEGRIN5 PATHWAY | Beta5 beta6 beta7 and beta8 integrin cell surface interactions |
| 0.2 | 0.2 | PID REELIN PATHWAY | Reelin signaling pathway |
| 0.2 | 1.8 | PID INTEGRIN4 PATHWAY | Alpha6 beta4 integrin-ligand interactions |
| 0.2 | 0.3 | ST PAC1 RECEPTOR PATHWAY | PAC1 Receptor Pathway |
| 0.1 | 6.4 | NABA COLLAGENS | Genes encoding collagen proteins |
| 0.1 | 2.2 | PID ERBB NETWORK PATHWAY | ErbB receptor signaling network |
| 0.1 | 4.6 | PID INTEGRIN1 PATHWAY | Beta1 integrin cell surface interactions |
| 0.1 | 4.2 | PID RAC1 REG PATHWAY | Regulation of RAC1 activity |
| 0.1 | 2.7 | PID EPHRINB REV PATHWAY | Ephrin B reverse signaling |
| 0.1 | 1.5 | PID CDC42 REG PATHWAY | Regulation of CDC42 activity |
| 0.1 | 3.1 | SIG REGULATION OF THE ACTIN CYTOSKELETON BY RHO GTPASES | Genes related to regulation of the actin cytoskeleton |
| 0.1 | 0.4 | PID VEGF VEGFR PATHWAY | VEGF and VEGFR signaling network |
| 0.1 | 1.8 | PID S1P S1P3 PATHWAY | S1P3 pathway |
| 0.1 | 2.6 | ST WNT BETA CATENIN PATHWAY | Wnt/beta-catenin Pathway |
| 0.1 | 1.2 | NABA BASEMENT MEMBRANES | Genes encoding structural components of basement membranes |
| 0.1 | 2.4 | PID FRA PATHWAY | Validated transcriptional targets of AP1 family members Fra1 and Fra2 |
| 0.1 | 0.9 | PID ALK2 PATHWAY | ALK2 signaling events |
| 0.1 | 1.5 | ST MYOCYTE AD PATHWAY | Myocyte Adrenergic Pathway is a specific case of the generalized Adrenergic Pathway. |
| 0.1 | 1.4 | PID HEDGEHOG 2PATHWAY | Signaling events mediated by the Hedgehog family |
| 0.1 | 1.5 | PID EPHB FWD PATHWAY | EPHB forward signaling |
| 0.1 | 0.4 | PID GLYPICAN 1PATHWAY | Glypican 1 network |
| 0.1 | 0.2 | ST DIFFERENTIATION PATHWAY IN PC12 CELLS | Differentiation Pathway in PC12 Cells; this is a specific case of PAC1 Receptor Pathway. |
| 0.1 | 9.3 | NABA ECM GLYCOPROTEINS | Genes encoding structural ECM glycoproteins |
| 0.1 | 1.8 | PID WNT SIGNALING PATHWAY | Wnt signaling network |
| 0.1 | 1.0 | PID NCADHERIN PATHWAY | N-cadherin signaling events |
| 0.1 | 0.1 | PID TCR RAS PATHWAY | Ras signaling in the CD4+ TCR pathway |
| 0.1 | 2.0 | PID AJDISS 2PATHWAY | Posttranslational regulation of adherens junction stability and dissassembly |
| 0.1 | 1.7 | PID RHOA REG PATHWAY | Regulation of RhoA activity |
| 0.0 | 0.5 | PID SYNDECAN 3 PATHWAY | Syndecan-3-mediated signaling events |
| 0.0 | 1.1 | PID ECADHERIN STABILIZATION PATHWAY | Stabilization and expansion of the E-cadherin adherens junction |
| 0.0 | 0.1 | PID NECTIN PATHWAY | Nectin adhesion pathway |
| 0.0 | 1.3 | PID FGF PATHWAY | FGF signaling pathway |
| 0.0 | 0.1 | SA REG CASCADE OF CYCLIN EXPR | Expression of cyclins regulates progression through the cell cycle by activating cyclin-dependent kinases. |
| 0.0 | 0.0 | PID IL8 CXCR1 PATHWAY | IL8- and CXCR1-mediated signaling events |
| 0.0 | 0.1 | PID EPHA2 FWD PATHWAY | EPHA2 forward signaling |
| 0.0 | 0.2 | PID ANTHRAX PATHWAY | Cellular roles of Anthrax toxin |
| 0.0 | 1.8 | PID BETA CATENIN NUC PATHWAY | Regulation of nuclear beta catenin signaling and target gene transcription |
| 0.0 | 0.2 | PID IL3 PATHWAY | IL3-mediated signaling events |
| 0.0 | 7.9 | NABA ECM REGULATORS | Genes encoding enzymes and their regulators involved in the remodeling of the extracellular matrix |
| 0.0 | 1.3 | PID ENDOTHELIN PATHWAY | Endothelins |
| 0.0 | 0.1 | PID S1P META PATHWAY | Sphingosine 1-phosphate (S1P) pathway |
| 0.0 | 0.4 | PID RET PATHWAY | Signaling events regulated by Ret tyrosine kinase |
| 0.0 | 8.1 | NABA SECRETED FACTORS | Genes encoding secreted soluble factors |
| 0.0 | 0.1 | PID INTEGRIN A4B1 PATHWAY | Alpha4 beta1 integrin signaling events |
| 0.0 | 0.1 | PID MAPK TRK PATHWAY | Trk receptor signaling mediated by the MAPK pathway |
| 0.0 | 0.1 | PID BETA CATENIN DEG PATHWAY | Degradation of beta catenin |
| 0.0 | 0.5 | PID LYSOPHOSPHOLIPID PATHWAY | LPA receptor mediated events |
| 0.0 | 1.2 | PID HES HEY PATHWAY | Notch-mediated HES/HEY network |
| 0.0 | 0.1 | SA FAS SIGNALING | The TNF-type receptor Fas induces apoptosis on ligand binding. |
| 0.0 | 0.6 | PID INSULIN GLUCOSE PATHWAY | Insulin-mediated glucose transport |
| 0.0 | 0.1 | ST STAT3 PATHWAY | STAT3 Pathway |
| 0.0 | 0.1 | ST T CELL SIGNAL TRANSDUCTION | T Cell Signal Transduction |
| 0.0 | 0.4 | PID RHODOPSIN PATHWAY | Visual signal transduction: Rods |
| 0.0 | 0.1 | PID IL2 1PATHWAY | IL2-mediated signaling events |
| 0.0 | 0.1 | PID TCR JNK PATHWAY | JNK signaling in the CD4+ TCR pathway |
| 0.0 | 0.4 | PID BMP PATHWAY | BMP receptor signaling |
| 0.0 | 0.1 | PID ECADHERIN NASCENT AJ PATHWAY | E-cadherin signaling in the nascent adherens junction |
| 0.0 | 0.0 | SIG CHEMOTAXIS | Genes related to chemotaxis |
| 0.0 | 0.0 | PID THROMBIN PAR4 PATHWAY | PAR4-mediated thrombin signaling events |
| 0.0 | 0.0 | PID IL5 PATHWAY | IL5-mediated signaling events |
| 0.0 | 0.0 | PID WNT CANONICAL PATHWAY | Canonical Wnt signaling pathway |
| 0.0 | 0.0 | PID CXCR3 PATHWAY | CXCR3-mediated signaling events |
| 0.0 | 0.1 | PID IL1 PATHWAY | IL1-mediated signaling events |
| 0.0 | 0.0 | ST IL 13 PATHWAY | Interleukin 13 (IL-13) Pathway |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.3 | 0.3 | REACTOME SIGNALING BY ACTIVATED POINT MUTANTS OF FGFR1 | Genes involved in Signaling by activated point mutants of FGFR1 |
| 0.2 | 8.5 | REACTOME NCAM1 INTERACTIONS | Genes involved in NCAM1 interactions |
| 0.2 | 5.2 | REACTOME STRIATED MUSCLE CONTRACTION | Genes involved in Striated Muscle Contraction |
| 0.2 | 2.1 | REACTOME FGFR2C LIGAND BINDING AND ACTIVATION | Genes involved in FGFR2c ligand binding and activation |
| 0.2 | 1.8 | REACTOME DOWNREGULATION OF ERBB2 ERBB3 SIGNALING | Genes involved in Downregulation of ERBB2:ERBB3 signaling |
| 0.1 | 0.4 | REACTOME RAS ACTIVATION UOPN CA2 INFUX THROUGH NMDA RECEPTOR | Genes involved in Ras activation uopn Ca2+ infux through NMDA receptor |
| 0.1 | 2.1 | REACTOME GAP JUNCTION ASSEMBLY | Genes involved in Gap junction assembly |
| 0.1 | 1.6 | REACTOME DCC MEDIATED ATTRACTIVE SIGNALING | Genes involved in DCC mediated attractive signaling |
| 0.1 | 0.1 | REACTOME BILE ACID AND BILE SALT METABOLISM | Genes involved in Bile acid and bile salt metabolism |
| 0.1 | 1.7 | REACTOME UNBLOCKING OF NMDA RECEPTOR GLUTAMATE BINDING AND ACTIVATION | Genes involved in Unblocking of NMDA receptor, glutamate binding and activation |
| 0.1 | 0.1 | REACTOME SIGNALING BY ERBB2 | Genes involved in Signaling by ERBB2 |
| 0.1 | 0.3 | REACTOME CROSS PRESENTATION OF SOLUBLE EXOGENOUS ANTIGENS ENDOSOMES | Genes involved in Cross-presentation of soluble exogenous antigens (endosomes) |
| 0.1 | 2.0 | REACTOME MUSCLE CONTRACTION | Genes involved in Muscle contraction |
| 0.1 | 0.1 | REACTOME DOWNSTREAM SIGNALING EVENTS OF B CELL RECEPTOR BCR | Genes involved in Downstream Signaling Events Of B Cell Receptor (BCR) |
| 0.1 | 0.3 | REACTOME NGF SIGNALLING VIA TRKA FROM THE PLASMA MEMBRANE | Genes involved in NGF signalling via TRKA from the plasma membrane |
| 0.1 | 1.2 | REACTOME CRMPS IN SEMA3A SIGNALING | Genes involved in CRMPs in Sema3A signaling |
| 0.1 | 0.9 | REACTOME ACETYLCHOLINE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Acetylcholine Neurotransmitter Release Cycle |
| 0.1 | 0.9 | REACTOME TRAFFICKING OF GLUR2 CONTAINING AMPA RECEPTORS | Genes involved in Trafficking of GluR2-containing AMPA receptors |
| 0.1 | 1.9 | REACTOME A TETRASACCHARIDE LINKER SEQUENCE IS REQUIRED FOR GAG SYNTHESIS | Genes involved in A tetrasaccharide linker sequence is required for GAG synthesis |
| 0.1 | 0.1 | REACTOME FORMATION OF THE HIV1 EARLY ELONGATION COMPLEX | Genes involved in Formation of the HIV-1 Early Elongation Complex |
| 0.1 | 0.7 | REACTOME APOPTOTIC CLEAVAGE OF CELL ADHESION PROTEINS | Genes involved in Apoptotic cleavage of cell adhesion proteins |
| 0.1 | 1.8 | REACTOME KINESINS | Genes involved in Kinesins |
| 0.1 | 1.6 | REACTOME INTERACTION BETWEEN L1 AND ANKYRINS | Genes involved in Interaction between L1 and Ankyrins |
| 0.1 | 1.7 | REACTOME NETRIN1 SIGNALING | Genes involved in Netrin-1 signaling |
| 0.1 | 0.1 | REACTOME TGF BETA RECEPTOR SIGNALING IN EMT EPITHELIAL TO MESENCHYMAL TRANSITION | Genes involved in TGF-beta receptor signaling in EMT (epithelial to mesenchymal transition) |
| 0.1 | 3.0 | REACTOME VOLTAGE GATED POTASSIUM CHANNELS | Genes involved in Voltage gated Potassium channels |
| 0.1 | 0.9 | REACTOME OTHER SEMAPHORIN INTERACTIONS | Genes involved in Other semaphorin interactions |
| 0.1 | 0.6 | REACTOME IONOTROPIC ACTIVITY OF KAINATE RECEPTORS | Genes involved in Ionotropic activity of Kainate Receptors |
| 0.1 | 0.2 | REACTOME BETA DEFENSINS | Genes involved in Beta defensins |
| 0.1 | 0.7 | REACTOME SIGNALING BY CONSTITUTIVELY ACTIVE EGFR | Genes involved in Signaling by constitutively active EGFR |
| 0.1 | 1.0 | REACTOME AMINE DERIVED HORMONES | Genes involved in Amine-derived hormones |
| 0.1 | 0.8 | REACTOME CELL EXTRACELLULAR MATRIX INTERACTIONS | Genes involved in Cell-extracellular matrix interactions |
| 0.1 | 1.5 | REACTOME ADHERENS JUNCTIONS INTERACTIONS | Genes involved in Adherens junctions interactions |
| 0.1 | 2.3 | REACTOME NRAGE SIGNALS DEATH THROUGH JNK | Genes involved in NRAGE signals death through JNK |
| 0.1 | 0.1 | REACTOME ACYL CHAIN REMODELLING OF PC | Genes involved in Acyl chain remodelling of PC |
| 0.1 | 0.2 | REACTOME SEMA3A PAK DEPENDENT AXON REPULSION | Genes involved in Sema3A PAK dependent Axon repulsion |
| 0.1 | 0.7 | REACTOME NOTCH HLH TRANSCRIPTION PATHWAY | Genes involved in Notch-HLH transcription pathway |
| 0.1 | 0.7 | REACTOME NEPHRIN INTERACTIONS | Genes involved in Nephrin interactions |
| 0.1 | 0.3 | REACTOME DSCAM INTERACTIONS | Genes involved in DSCAM interactions |
| 0.1 | 1.3 | REACTOME NITRIC OXIDE STIMULATES GUANYLATE CYCLASE | Genes involved in Nitric oxide stimulates guanylate cyclase |
| 0.1 | 3.8 | REACTOME SIGNALING BY RHO GTPASES | Genes involved in Signaling by Rho GTPases |
| 0.1 | 0.1 | REACTOME 3 UTR MEDIATED TRANSLATIONAL REGULATION | Genes involved in 3' -UTR-mediated translational regulation |
| 0.1 | 2.0 | REACTOME COLLAGEN FORMATION | Genes involved in Collagen formation |
| 0.1 | 0.2 | REACTOME REGULATION OF INSULIN SECRETION BY GLUCAGON LIKE PEPTIDE1 | Genes involved in Regulation of Insulin Secretion by Glucagon-like Peptide-1 |
| 0.1 | 0.7 | REACTOME SYNTHESIS SECRETION AND INACTIVATION OF GIP | Genes involved in Synthesis, Secretion, and Inactivation of Glucose-dependent Insulinotropic Polypeptide (GIP) |
| 0.1 | 1.1 | REACTOME SIGNALING BY BMP | Genes involved in Signaling by BMP |
| 0.0 | 1.2 | REACTOME INHIBITION OF VOLTAGE GATED CA2 CHANNELS VIA GBETA GAMMA SUBUNITS | Genes involved in Inhibition of voltage gated Ca2+ channels via Gbeta/gamma subunits |
| 0.0 | 0.5 | REACTOME GRB2 EVENTS IN ERBB2 SIGNALING | Genes involved in GRB2 events in ERBB2 signaling |
| 0.0 | 0.6 | REACTOME RIP MEDIATED NFKB ACTIVATION VIA DAI | Genes involved in RIP-mediated NFkB activation via DAI |
| 0.0 | 0.3 | REACTOME INWARDLY RECTIFYING K CHANNELS | Genes involved in Inwardly rectifying K+ channels |
| 0.0 | 0.6 | REACTOME PLATELET CALCIUM HOMEOSTASIS | Genes involved in Platelet calcium homeostasis |
| 0.0 | 0.0 | REACTOME ACTIVATED TAK1 MEDIATES P38 MAPK ACTIVATION | Genes involved in activated TAK1 mediates p38 MAPK activation |
| 0.0 | 0.8 | REACTOME YAP1 AND WWTR1 TAZ STIMULATED GENE EXPRESSION | Genes involved in YAP1- and WWTR1 (TAZ)-stimulated gene expression |
| 0.0 | 0.7 | REACTOME DOWNREGULATION OF TGF BETA RECEPTOR SIGNALING | Genes involved in Downregulation of TGF-beta receptor signaling |
| 0.0 | 0.2 | REACTOME PROSTACYCLIN SIGNALLING THROUGH PROSTACYCLIN RECEPTOR | Genes involved in Prostacyclin signalling through prostacyclin receptor |
| 0.0 | 0.4 | REACTOME HIGHLY CALCIUM PERMEABLE POSTSYNAPTIC NICOTINIC ACETYLCHOLINE RECEPTORS | Genes involved in Highly calcium permeable postsynaptic nicotinic acetylcholine receptors |
| 0.0 | 0.1 | REACTOME TGF BETA RECEPTOR SIGNALING ACTIVATES SMADS | Genes involved in TGF-beta receptor signaling activates SMADs |
| 0.0 | 2.4 | REACTOME CLASS B 2 SECRETIN FAMILY RECEPTORS | Genes involved in Class B/2 (Secretin family receptors) |
| 0.0 | 0.6 | REACTOME SIGNALING BY ROBO RECEPTOR | Genes involved in Signaling by Robo receptor |
| 0.0 | 0.8 | REACTOME EXTRACELLULAR MATRIX ORGANIZATION | Genes involved in Extracellular matrix organization |
| 0.0 | 0.3 | REACTOME ABACAVIR TRANSPORT AND METABOLISM | Genes involved in Abacavir transport and metabolism |
| 0.0 | 0.2 | REACTOME REGULATION OF SIGNALING BY CBL | Genes involved in Regulation of signaling by CBL |
| 0.0 | 0.1 | REACTOME ACETYLCHOLINE BINDING AND DOWNSTREAM EVENTS | Genes involved in Acetylcholine Binding And Downstream Events |
| 0.0 | 0.0 | REACTOME SIGNALING BY FGFR3 MUTANTS | Genes involved in Signaling by FGFR3 mutants |
| 0.0 | 0.7 | REACTOME AMINE COMPOUND SLC TRANSPORTERS | Genes involved in Amine compound SLC transporters |
| 0.0 | 0.3 | REACTOME REGULATION OF INSULIN LIKE GROWTH FACTOR IGF ACTIVITY BY INSULIN LIKE GROWTH FACTOR BINDING PROTEINS IGFBPS | Genes involved in Regulation of Insulin-like Growth Factor (IGF) Activity by Insulin-like Growth Factor Binding Proteins (IGFBPs) |
| 0.0 | 0.1 | REACTOME SLBP DEPENDENT PROCESSING OF REPLICATION DEPENDENT HISTONE PRE MRNAS | Genes involved in SLBP Dependent Processing of Replication-Dependent Histone Pre-mRNAs |
| 0.0 | 0.1 | REACTOME P38MAPK EVENTS | Genes involved in p38MAPK events |
| 0.0 | 0.3 | REACTOME N GLYCAN ANTENNAE ELONGATION | Genes involved in N-Glycan antennae elongation |
| 0.0 | 0.2 | REACTOME MICRORNA MIRNA BIOGENESIS | Genes involved in MicroRNA (miRNA) Biogenesis |
| 0.0 | 0.1 | REACTOME SIGNALLING TO P38 VIA RIT AND RIN | Genes involved in Signalling to p38 via RIT and RIN |
| 0.0 | 0.2 | REACTOME PRE NOTCH TRANSCRIPTION AND TRANSLATION | Genes involved in Pre-NOTCH Transcription and Translation |
| 0.0 | 0.2 | REACTOME THE NLRP3 INFLAMMASOME | Genes involved in The NLRP3 inflammasome |
| 0.0 | 0.3 | REACTOME BILE SALT AND ORGANIC ANION SLC TRANSPORTERS | Genes involved in Bile salt and organic anion SLC transporters |
| 0.0 | 0.2 | REACTOME OPSINS | Genes involved in Opsins |
| 0.0 | 0.1 | REACTOME ADVANCED GLYCOSYLATION ENDPRODUCT RECEPTOR SIGNALING | Genes involved in Advanced glycosylation endproduct receptor signaling |
| 0.0 | 0.2 | REACTOME HORMONE LIGAND BINDING RECEPTORS | Genes involved in Hormone ligand-binding receptors |
| 0.0 | 0.1 | REACTOME ACTIVATION OF NF KAPPAB IN B CELLS | Genes involved in Activation of NF-kappaB in B Cells |
| 0.0 | 0.3 | REACTOME POST NMDA RECEPTOR ACTIVATION EVENTS | Genes involved in Post NMDA receptor activation events |
| 0.0 | 0.0 | REACTOME GAP JUNCTION DEGRADATION | Genes involved in Gap junction degradation |
| 0.0 | 0.0 | REACTOME OLFACTORY SIGNALING PATHWAY | Genes involved in Olfactory Signaling Pathway |
| 0.0 | 1.1 | REACTOME INTEGRIN CELL SURFACE INTERACTIONS | Genes involved in Integrin cell surface interactions |
| 0.0 | 0.3 | REACTOME DOWNSTREAM TCR SIGNALING | Genes involved in Downstream TCR signaling |
| 0.0 | 0.2 | REACTOME ENDOGENOUS STEROLS | Genes involved in Endogenous sterols |
| 0.0 | 0.1 | REACTOME ACTIVATION OF KAINATE RECEPTORS UPON GLUTAMATE BINDING | Genes involved in Activation of Kainate Receptors upon glutamate binding |
| 0.0 | 0.6 | REACTOME CELL JUNCTION ORGANIZATION | Genes involved in Cell junction organization |
| 0.0 | 0.1 | REACTOME GLUTAMATE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Glutamate Neurotransmitter Release Cycle |
| 0.0 | 0.0 | REACTOME DESTABILIZATION OF MRNA BY BRF1 | Genes involved in Destabilization of mRNA by Butyrate Response Factor 1 (BRF1) |
| 0.0 | 0.1 | REACTOME SPRY REGULATION OF FGF SIGNALING | Genes involved in Spry regulation of FGF signaling |
| 0.0 | 0.1 | REACTOME APOBEC3G MEDIATED RESISTANCE TO HIV1 INFECTION | Genes involved in APOBEC3G mediated resistance to HIV-1 infection |
| 0.0 | 0.1 | REACTOME THROMBOXANE SIGNALLING THROUGH TP RECEPTOR | Genes involved in Thromboxane signalling through TP receptor |
| 0.0 | 0.0 | REACTOME NEGATIVE REGULATION OF THE PI3K AKT NETWORK | Genes involved in Negative regulation of the PI3K/AKT network |
| 0.0 | 0.0 | REACTOME ACTIVATION OF IRF3 IRF7 MEDIATED BY TBK1 IKK EPSILON | Genes involved in Activation of IRF3/IRF7 mediated by TBK1/IKK epsilon |
| 0.0 | 0.1 | REACTOME IRAK1 RECRUITS IKK COMPLEX | Genes involved in IRAK1 recruits IKK complex |
| 0.0 | 0.0 | REACTOME THROMBIN SIGNALLING THROUGH PROTEINASE ACTIVATED RECEPTORS PARS | Genes involved in Thrombin signalling through proteinase activated receptors (PARs) |
| 0.0 | 0.2 | REACTOME LIGAND GATED ION CHANNEL TRANSPORT | Genes involved in Ligand-gated ion channel transport |
| 0.0 | 0.0 | REACTOME SIGNAL TRANSDUCTION BY L1 | Genes involved in Signal transduction by L1 |
| 0.0 | 0.1 | REACTOME GLUCURONIDATION | Genes involved in Glucuronidation |
| 0.0 | 0.2 | REACTOME IL RECEPTOR SHC SIGNALING | Genes involved in Interleukin receptor SHC signaling |