Gene Symbol | Gene ID | Gene Info |
---|---|---|
Sox4
|
ENSMUSG00000076431.4 | SRY (sex determining region Y)-box 4 |
CRE | Gene | Distance | Association probability | Pearson corr. coef. | P-value | Plot |
---|---|---|---|---|---|---|
Sox4 | chr13_28948524_28948796 | 5053 | 0.236066 | 0.86 | 8.8e-17 | Click! |
Sox4 | chr13_28947781_28947984 | 5831 | 0.228195 | 0.85 | 1.8e-16 | Click! |
Sox4 | chr13_28947522_28947673 | 6116 | 0.225895 | 0.85 | 3.7e-16 | Click! |
Sox4 | chr13_28946628_28946796 | 7001 | 0.220042 | 0.83 | 5.5e-15 | Click! |
Sox4 | chr13_28950511_28951024 | 2946 | 0.287714 | 0.82 | 1.2e-14 | Click! |
Move your cursor over a bar to see sample name and corresponding Z-value.
Cis Regulatory Element (CRE) | Target Score | Top associated gene | Gene Info | Distance of CRE to TSS | CRE/Gene association probability |
---|---|---|---|---|---|
chr6_112809545_112809826 | 10.02 |
Srgap3 |
SLIT-ROBO Rho GTPase activating protein 3 |
19774 |
0.21 |
chr16_77787854_77788233 | 9.91 |
Gm17333 |
predicted gene, 17333 |
58561 |
0.11 |
chr6_94631259_94631471 | 9.77 |
Lrig1 |
leucine-rich repeats and immunoglobulin-like domains 1 |
24160 |
0.17 |
chr9_23083566_23083915 | 9.58 |
Bmper |
BMP-binding endothelial regulator |
139336 |
0.05 |
chr3_154125282_154125505 | 8.84 |
Gm3076 |
predicted gene 3076 |
6947 |
0.2 |
chr2_142700773_142700940 | 8.47 |
Kif16b |
kinesin family member 16B |
1815 |
0.47 |
chr10_17478823_17479016 | 7.86 |
Gm47768 |
predicted gene, 47768 |
35811 |
0.16 |
chr7_97804643_97804853 | 7.37 |
Pak1 |
p21 (RAC1) activated kinase 1 |
16207 |
0.19 |
chr12_111693687_111693960 | 7.34 |
Gm36635 |
predicted gene, 36635 |
9259 |
0.09 |
chr6_54554355_54554906 | 7.31 |
Scrn1 |
secernin 1 |
175 |
0.95 |
chr12_56459593_56459744 | 7.26 |
Sfta3-ps |
surfactant associated 3, pseudogene |
33656 |
0.12 |
chr5_112239158_112239879 | 7.26 |
Miat |
myocardial infarction associated transcript (non-protein coding) |
10123 |
0.11 |
chr16_16561093_16561486 | 7.22 |
Fgd4 |
FYVE, RhoGEF and PH domain containing 4 |
1070 |
0.53 |
chr4_32530550_32530721 | 7.06 |
Bach2 |
BTB and CNC homology, basic leucine zipper transcription factor 2 |
29130 |
0.16 |
chr14_64489462_64489613 | 6.79 |
Msra |
methionine sulfoxide reductase A |
33634 |
0.16 |
chr3_6886610_6886763 | 6.69 |
Gm22074 |
predicted gene, 22074 |
90582 |
0.09 |
chr8_8258494_8258645 | 6.63 |
A630009H07Rik |
RIKEN cDNA A630009H07 gene |
76508 |
0.09 |
chr14_78204129_78204297 | 6.62 |
Gm48959 |
predicted gene, 48959 |
4840 |
0.2 |
chr13_51570216_51570367 | 6.61 |
Shc3 |
src homology 2 domain-containing transforming protein C3 |
804 |
0.69 |
chr6_141495522_141495813 | 6.42 |
Slco1c1 |
solute carrier organic anion transporter family, member 1c1 |
28701 |
0.2 |
chr10_74987698_74988113 | 6.42 |
Gnaz |
guanine nucleotide binding protein, alpha z subunit |
2936 |
0.25 |
chr1_93101519_93102308 | 6.39 |
Kif1a |
kinesin family member 1A |
38 |
0.97 |
chr12_12709151_12709302 | 6.38 |
Gm25538 |
predicted gene, 25538 |
9187 |
0.16 |
chr13_99458740_99458927 | 6.06 |
Map1b |
microtubule-associated protein 1B |
11213 |
0.18 |
chr19_36534473_36534683 | 6.06 |
Hectd2 |
HECT domain E3 ubiquitin protein ligase 2 |
20061 |
0.2 |
chr3_97888714_97888938 | 6.05 |
Pde4dip |
phosphodiesterase 4D interacting protein (myomegalin) |
119 |
0.96 |
chr7_79572141_79572757 | 6.02 |
Gm45168 |
predicted gene 45168 |
6619 |
0.1 |
chr1_47545788_47545965 | 5.80 |
Gm37196 |
predicted gene, 37196 |
60120 |
0.11 |
chr7_45460493_45461322 | 5.79 |
Ftl1 |
ferritin light polypeptide 1 |
1023 |
0.19 |
chr1_152164865_152165264 | 5.77 |
Gm8964 |
predicted gene 8964 |
36479 |
0.19 |
chr4_151107641_151107996 | 5.74 |
Camta1 |
calmodulin binding transcription activator 1 |
485 |
0.8 |
chr7_91262662_91262849 | 5.69 |
Gm24552 |
predicted gene, 24552 |
19760 |
0.18 |
chr14_117930428_117930873 | 5.55 |
Mir6239 |
microRNA 6239 |
23197 |
0.23 |
chr17_16005258_16005481 | 5.45 |
Gm49778 |
predicted gene, 49778 |
157782 |
0.03 |
chr14_108910807_108911318 | 5.36 |
Slitrk1 |
SLIT and NTRK-like family, member 1 |
3096 |
0.41 |
chr19_42409134_42409463 | 5.29 |
Gm34299 |
predicted gene, 34299 |
1096 |
0.49 |
chrX_59566062_59566696 | 5.29 |
Fgf13 |
fibroblast growth factor 13 |
1093 |
0.67 |
chr1_34665096_34665536 | 5.29 |
Arhgef4 |
Rho guanine nucleotide exchange factor (GEF) 4 |
12872 |
0.12 |
chr5_39803670_39803850 | 5.28 |
Gm7816 |
predicted pseudogene 7816 |
5546 |
0.28 |
chr3_5347364_5347521 | 5.27 |
Zfhx4 |
zinc finger homeodomain 4 |
105770 |
0.07 |
chrX_143607023_143607174 | 5.20 |
Pak3 |
p21 (RAC1) activated kinase 3 |
57192 |
0.16 |
chr17_6861590_6862083 | 5.09 |
Mir692-1 |
microRNA 692-1 |
33501 |
0.11 |
chr8_23669523_23669919 | 5.07 |
Zmat4 |
zinc finger, matrin type 4 |
47 |
0.98 |
chr12_36918386_36918551 | 5.03 |
Gm48613 |
predicted gene, 48613 |
34087 |
0.14 |
chr4_22095654_22096002 | 4.94 |
Gm11880 |
predicted gene 11880 |
21704 |
0.23 |
chr7_51775988_51776283 | 4.93 |
Gm29296 |
predicted gene 29296 |
3409 |
0.23 |
chr8_33052140_33052304 | 4.81 |
Gm45587 |
predicted gene 45587 |
3869 |
0.34 |
chr10_38553865_38554067 | 4.78 |
Gm22911 |
predicted gene, 22911 |
61515 |
0.14 |
chr8_30924597_30924808 | 4.77 |
Gm45252 |
predicted gene 45252 |
79206 |
0.1 |
chr16_35164341_35164881 | 4.75 |
Adcy5 |
adenylate cyclase 5 |
9734 |
0.23 |
chr18_49445578_49445977 | 4.74 |
1700044K03Rik |
RIKEN cDNA 1700044K03 gene |
77512 |
0.11 |
chr5_30526362_30526930 | 4.74 |
Gm42765 |
predicted gene 42765 |
2811 |
0.18 |
chr1_132660588_132660739 | 4.70 |
Nfasc |
neurofascin |
23572 |
0.19 |
chrX_166344291_166344543 | 4.67 |
Gpm6b |
glycoprotein m6b |
275 |
0.93 |
chr8_108944446_108944597 | 4.66 |
Mir3108 |
microRNA 3108 |
7661 |
0.23 |
chr17_65700141_65700311 | 4.63 |
Gm49867 |
predicted gene, 49867 |
38648 |
0.13 |
chr6_137252172_137252972 | 4.54 |
Ptpro |
protein tyrosine phosphatase, receptor type, O |
107 |
0.98 |
chr4_41611662_41611813 | 4.49 |
Dnaic1 |
dynein, axonemal, intermediate chain 1 |
19907 |
0.09 |
chr11_32161330_32161481 | 4.46 |
Gm12109 |
predicted gene 12109 |
23600 |
0.12 |
chr9_36821327_36821662 | 4.39 |
Fez1 |
fasciculation and elongation protein zeta 1 (zygin I) |
370 |
0.82 |
chr12_12681125_12681315 | 4.38 |
Gm27952 |
predicted gene, 27952 |
1398 |
0.39 |
chr16_43603831_43604250 | 4.37 |
Mir568 |
microRNA 568 |
36615 |
0.15 |
chr13_95869253_95869653 | 4.36 |
Iqgap2 |
IQ motif containing GTPase activating protein 2 |
22304 |
0.18 |
chr17_8368062_8368258 | 4.35 |
T2 |
brachyury 2 |
4236 |
0.14 |
chr13_60147640_60147842 | 4.34 |
Gm48488 |
predicted gene, 48488 |
28941 |
0.13 |
chr12_88580020_88580314 | 4.33 |
Gm19540 |
predicted gene, 19540 |
10270 |
0.16 |
chr7_79535477_79536145 | 4.33 |
Gm35040 |
predicted gene, 35040 |
232 |
0.85 |
chr14_25585435_25586044 | 4.32 |
Zmiz1 |
zinc finger, MIZ-type containing 1 |
21618 |
0.17 |
chr5_8224418_8224604 | 4.32 |
Gm23993 |
predicted gene, 23993 |
18212 |
0.17 |
chr4_45818923_45819149 | 4.28 |
Igfbpl1 |
insulin-like growth factor binding protein-like 1 |
2673 |
0.21 |
chr12_100228109_100228260 | 4.27 |
Gm40557 |
predicted gene, 40557 |
12068 |
0.14 |
chr15_73022348_73022581 | 4.26 |
Trappc9 |
trafficking protein particle complex 9 |
33346 |
0.18 |
chr3_57919413_57919598 | 4.25 |
Gm24531 |
predicted gene, 24531 |
2682 |
0.23 |
chr12_90132259_90132481 | 4.24 |
Gm48700 |
predicted gene, 48700 |
64271 |
0.14 |
chr5_135725361_135725728 | 4.24 |
Por |
P450 (cytochrome) oxidoreductase |
184 |
0.9 |
chr14_93083221_93083444 | 4.21 |
Gm23509 |
predicted gene, 23509 |
54857 |
0.15 |
chr5_116591724_116592384 | 4.19 |
Srrm4 |
serine/arginine repetitive matrix 4 |
237 |
0.93 |
chr9_47739397_47739548 | 4.18 |
Gm47198 |
predicted gene, 47198 |
31669 |
0.19 |
chr12_98577801_98578058 | 4.17 |
Kcnk10 |
potassium channel, subfamily K, member 10 |
381 |
0.81 |
chr18_16037927_16038695 | 4.14 |
Gm4835 |
predicted pseudogene 4835 |
49943 |
0.17 |
chr16_3238621_3239720 | 4.14 |
Gm23215 |
predicted gene, 23215 |
10414 |
0.18 |
chr3_47668909_47669138 | 4.14 |
Gm2229 |
predicted gene 2229 |
208685 |
0.03 |
chr11_8482133_8482284 | 4.11 |
Tns3 |
tensin 3 |
13533 |
0.29 |
chr11_25357181_25357562 | 4.10 |
4933427E13Rik |
RIKEN cDNA 4933427E13 gene |
27414 |
0.22 |
chr14_122453413_122454000 | 4.09 |
Gm5089 |
predicted gene 5089 |
2591 |
0.18 |
chr3_103641440_103641591 | 4.07 |
Atg4a-ps |
autophagy related 4A, pseudogene |
4553 |
0.16 |
chr2_78872230_78872413 | 4.01 |
Ube2e3 |
ubiquitin-conjugating enzyme E2E 3 |
2643 |
0.33 |
chr11_52086592_52086809 | 4.00 |
Ppp2ca |
protein phosphatase 2 (formerly 2A), catalytic subunit, alpha isoform |
11981 |
0.12 |
chr12_90274736_90274906 | 3.98 |
Gm2270 |
predicted gene 2270 |
89431 |
0.09 |
chr2_130283847_130284573 | 3.97 |
Idh3b |
isocitrate dehydrogenase 3 (NAD+) beta |
205 |
0.85 |
chr15_22717723_22717874 | 3.95 |
Hnrnpa1l2-ps2 |
heterogeneous nuclear ribonucleoprotein A1-like 2, pseudogene 2 |
2968 |
0.41 |
chr17_13677861_13678012 | 3.94 |
Gm24867 |
predicted gene, 24867 |
2560 |
0.21 |
chr5_61355205_61355547 | 3.94 |
Gm43382 |
predicted gene 43382 |
16643 |
0.3 |
chr10_106469114_106469265 | 3.91 |
Ppfia2 |
protein tyrosine phosphatase, receptor type, f polypeptide (PTPRF), interacting protein (liprin), alpha 2 |
1150 |
0.52 |
chr6_29263894_29264046 | 3.91 |
Hilpda |
hypoxia inducible lipid droplet associated |
8518 |
0.12 |
chr3_51544462_51544778 | 3.90 |
Setd7 |
SET domain containing (lysine methyltransferase) 7 |
6700 |
0.11 |
chr9_41697271_41698297 | 3.89 |
Gm48784 |
predicted gene, 48784 |
22730 |
0.14 |
chr16_33605736_33606716 | 3.87 |
Slc12a8 |
solute carrier family 12 (potassium/chloride transporters), member 8 |
9599 |
0.26 |
chr2_137092072_137092235 | 3.85 |
Jag1 |
jagged 1 |
6204 |
0.3 |
chr5_100120747_100121113 | 3.85 |
Tmem150c |
transmembrane protein 150C |
1866 |
0.3 |
chr15_66238948_66239591 | 3.83 |
Kcnq3 |
potassium voltage-gated channel, subfamily Q, member 3 |
46782 |
0.14 |
chr3_108409761_108410771 | 3.78 |
Celsr2 |
cadherin, EGF LAG seven-pass G-type receptor 2 |
5286 |
0.1 |
chr6_142876588_142876884 | 3.77 |
St8sia1 |
ST8 alpha-N-acetyl-neuraminide alpha-2,8-sialyltransferase 1 |
6304 |
0.21 |
chr3_101161643_101162203 | 3.76 |
Gm12486 |
predicted gene 12486 |
45476 |
0.11 |
chr17_88316231_88316387 | 3.76 |
1700116H05Rik |
RIKEN cDNA 1700116H05 gene |
9422 |
0.19 |
chr7_96672992_96673198 | 3.75 |
Tenm4 |
teneurin transmembrane protein 4 |
28923 |
0.19 |
chr10_39502247_39502653 | 3.72 |
Fyn |
Fyn proto-oncogene |
9289 |
0.21 |
chr9_56633908_56634396 | 3.70 |
Lingo1 |
leucine rich repeat and Ig domain containing 1 |
1476 |
0.42 |
chr13_97252431_97252943 | 3.67 |
Enc1 |
ectodermal-neural cortex 1 |
11582 |
0.16 |
chr13_55362078_55363351 | 3.67 |
Lman2 |
lectin, mannose-binding 2 |
69 |
0.95 |
chr14_100375280_100375638 | 3.66 |
Gm26367 |
predicted gene, 26367 |
43024 |
0.15 |
chr12_5250062_5250371 | 3.66 |
Gm48532 |
predicted gene, 48532 |
14252 |
0.23 |
chr13_102698734_102698942 | 3.65 |
Cd180 |
CD180 antigen |
5227 |
0.24 |
chr3_18941590_18941741 | 3.62 |
Gm30341 |
predicted gene, 30341 |
188588 |
0.03 |
chr16_85092305_85093056 | 3.62 |
Gm49227 |
predicted gene, 49227 |
12569 |
0.2 |
chr2_33789424_33789585 | 3.62 |
Mvb12b |
multivesicular body subunit 12B |
745 |
0.68 |
chr12_28460953_28461147 | 3.61 |
Dcdc2c |
doublecortin domain containing 2C |
55664 |
0.11 |
chr18_83656913_83657342 | 3.61 |
Gm31621 |
predicted gene, 31621 |
19042 |
0.18 |
chr1_68047124_68047492 | 3.59 |
Gm15671 |
predicted gene 15671 |
23065 |
0.22 |
chr2_109678215_109678406 | 3.57 |
Bdnf |
brain derived neurotrophic factor |
1278 |
0.37 |
chr1_158489494_158490042 | 3.56 |
Mir488 |
microRNA 488 |
15857 |
0.17 |
chr14_24827369_24827565 | 3.56 |
Gm47906 |
predicted gene, 47906 |
6168 |
0.28 |
chr8_106336439_106336863 | 3.55 |
Smpd3 |
sphingomyelin phosphodiesterase 3, neutral |
1337 |
0.45 |
chr15_37960550_37961674 | 3.53 |
Rrm2b |
ribonucleotide reductase M2 B (TP53 inducible) |
9 |
0.92 |
chrX_102071587_102071850 | 3.52 |
Rtl5 |
retrotransposon Gag like 5 |
414 |
0.72 |
chr6_47228750_47229021 | 3.51 |
Cntnap2 |
contactin associated protein-like 2 |
15502 |
0.28 |
chr13_46009246_46009397 | 3.49 |
5033430I15Rik |
RIKEN cDNA 5033430I15 gene |
43970 |
0.13 |
chr1_9208928_9209095 | 3.48 |
Gm37629 |
predicted gene, 37629 |
16895 |
0.2 |
chr5_15985978_15986202 | 3.48 |
Gm43000 |
predicted gene 43000 |
11749 |
0.19 |
chr7_49699439_49699606 | 3.48 |
Htatip2 |
HIV-1 Tat interactive protein 2 |
59593 |
0.11 |
chr17_72504724_72504888 | 3.47 |
Gm24736 |
predicted gene, 24736 |
5388 |
0.25 |
chr18_39087372_39087523 | 3.46 |
Arhgap26 |
Rho GTPase activating protein 26 |
11864 |
0.26 |
chr6_124863417_124863935 | 3.46 |
Gpr162 |
G protein-coupled receptor 162 |
36 |
0.93 |
chr3_17795896_17796083 | 3.45 |
Mir124-2hg |
Mir124-2 host gene (non-protein coding) |
245 |
0.58 |
chr11_24362449_24362611 | 3.40 |
Gm12068 |
predicted gene 12068 |
63716 |
0.12 |
chr14_48012437_48012848 | 3.39 |
Gm49305 |
predicted gene, 49305 |
18701 |
0.13 |
chr8_122284023_122284944 | 3.38 |
Zfpm1 |
zinc finger protein, multitype 1 |
2342 |
0.24 |
chr3_41408793_41409655 | 3.38 |
Gm25487 |
predicted gene, 25487 |
32243 |
0.14 |
chr11_25356934_25357152 | 3.37 |
4933427E13Rik |
RIKEN cDNA 4933427E13 gene |
27086 |
0.22 |
chr18_6513578_6513747 | 3.37 |
Epc1 |
enhancer of polycomb homolog 1 |
2446 |
0.25 |
chr8_71908248_71908670 | 3.36 |
Zfp882 |
zinc finger protein 882 |
149 |
0.52 |
chr9_107659674_107659860 | 3.35 |
Slc38a3 |
solute carrier family 38, member 3 |
239 |
0.82 |
chr5_42523495_42523716 | 3.34 |
Gm7181 |
predicted gene 7181 |
23191 |
0.28 |
chr17_15829209_15829362 | 3.31 |
Rgmb |
repulsive guidance molecule family member B |
1366 |
0.36 |
chr11_9570450_9570601 | 3.30 |
Gm36954 |
predicted gene, 36954 |
135098 |
0.05 |
chr13_28792466_28792753 | 3.29 |
Gm17528 |
predicted gene, 17528 |
34514 |
0.16 |
chr1_61302680_61303082 | 3.29 |
Gm11587 |
predicted gene 11587 |
972 |
0.58 |
chr14_34896691_34896909 | 3.29 |
Mir346 |
microRNA 346 |
2191 |
0.38 |
chr2_28908174_28908455 | 3.29 |
Barhl1 |
BarH like homeobox 1 |
4181 |
0.2 |
chr1_6761124_6761275 | 3.28 |
St18 |
suppression of tumorigenicity 18 |
23624 |
0.23 |
chr15_68101872_68102023 | 3.26 |
Zfat |
zinc finger and AT hook domain containing |
156840 |
0.04 |
chr1_81076306_81076601 | 3.25 |
Nyap2 |
neuronal tyrosine-phophorylated phosphoinositide 3-kinase adaptor 2 |
497 |
0.88 |
chr12_105453362_105453679 | 3.24 |
D430019H16Rik |
RIKEN cDNA D430019H16 gene |
336 |
0.88 |
chr16_76866459_76866678 | 3.24 |
1700041M19Rik |
RIKEN cDNA 1700041M19 gene |
22713 |
0.18 |
chr3_101513592_101514285 | 3.23 |
Atp1a1 |
ATPase, Na+/K+ transporting, alpha 1 polypeptide |
63622 |
0.09 |
chr19_10341893_10342454 | 3.23 |
Dagla |
diacylglycerol lipase, alpha |
37296 |
0.11 |
chr6_14898190_14898764 | 3.22 |
Foxp2 |
forkhead box P2 |
2872 |
0.41 |
chr11_36677713_36677995 | 3.20 |
Tenm2 |
teneurin transmembrane protein 2 |
109 |
0.98 |
chr10_69678288_69678439 | 3.19 |
Ank3 |
ankyrin 3, epithelial |
27933 |
0.24 |
chr8_100207073_100207243 | 3.19 |
Gm5742 |
predicted gene 5742 |
147042 |
0.05 |
chr2_6547214_6547414 | 3.19 |
Celf2 |
CUGBP, Elav-like family member 2 |
45486 |
0.14 |
chr5_25610065_25610220 | 3.16 |
Gm43972 |
predicted gene, 43972 |
49667 |
0.09 |
chr18_34102952_34103147 | 3.16 |
Gm24432 |
predicted gene, 24432 |
9604 |
0.16 |
chr13_83725778_83725984 | 3.16 |
C130071C03Rik |
RIKEN cDNA C130071C03 gene |
2225 |
0.21 |
chr10_116472994_116474473 | 3.16 |
Kcnmb4 |
potassium large conductance calcium-activated channel, subfamily M, beta member 4 |
145 |
0.69 |
chr8_109417176_109417525 | 3.14 |
Gm23163 |
predicted gene, 23163 |
8394 |
0.23 |
chr6_50399599_50399750 | 3.13 |
Osbpl3 |
oxysterol binding protein-like 3 |
2524 |
0.35 |
chr18_25657531_25657905 | 3.11 |
0710001A04Rik |
RIKEN cDNA 0710001A04 gene |
56052 |
0.13 |
chr8_21756761_21757023 | 3.10 |
Defa-ps11 |
defensin, alpha, pseudogene 11 |
7717 |
0.09 |
chr12_54286915_54287542 | 3.09 |
Gm47552 |
predicted gene, 47552 |
29787 |
0.13 |
chr7_79547149_79547439 | 3.09 |
Gm35040 |
predicted gene, 35040 |
11251 |
0.09 |
chr1_155212206_155212458 | 3.09 |
BC034090 |
cDNA sequence BC034090 |
1649 |
0.31 |
chr7_70789393_70789544 | 3.08 |
Gm24880 |
predicted gene, 24880 |
37052 |
0.18 |
chr15_25291827_25292014 | 3.08 |
4930445E18Rik |
RIKEN cDNA 4930445E18 gene |
40728 |
0.13 |
chr2_181764694_181764868 | 3.08 |
Myt1 |
myelin transcription factor 1 |
1449 |
0.33 |
chr11_58618484_58618706 | 3.08 |
2210407C18Rik |
RIKEN cDNA 2210407C18 gene |
2520 |
0.12 |
chr8_64205532_64206180 | 3.07 |
Tll1 |
tolloid-like |
137 |
0.97 |
chr9_92930513_92930898 | 3.07 |
Gm28054 |
predicted gene 28054 |
34873 |
0.17 |
chr5_4870138_4870289 | 3.06 |
Gm43111 |
predicted gene 43111 |
53 |
0.97 |
chr14_75566269_75566669 | 3.06 |
Cby2 |
chibby family member 2 |
25480 |
0.19 |
chr15_30457525_30457710 | 3.06 |
Ctnnd2 |
catenin (cadherin associated protein), delta 2 |
56 |
0.98 |
chr16_29714547_29714885 | 3.04 |
Gm49636 |
predicted gene, 49636 |
39596 |
0.17 |
chr12_95558872_95559049 | 3.03 |
Gm22246 |
predicted gene, 22246 |
60858 |
0.14 |
chr14_22746281_22746506 | 3.03 |
Gm7473 |
predicted gene 7473 |
28851 |
0.24 |
chr4_149445064_149445243 | 3.02 |
Rbp7 |
retinol binding protein 7, cellular |
8271 |
0.11 |
chr2_114739938_114740103 | 3.01 |
Gm13975 |
predicted gene 13975 |
31908 |
0.2 |
chr3_84732050_84732445 | 3.01 |
Tmem154 |
transmembrane protein 154 |
42024 |
0.17 |
chr11_36303038_36303189 | 3.00 |
Gm12127 |
predicted gene 12127 |
25072 |
0.26 |
chrX_167233133_167233689 | 2.99 |
Tmsb4x |
thymosin, beta 4, X chromosome |
24096 |
0.16 |
chr1_66395305_66395711 | 2.99 |
Map2 |
microtubule-associated protein 2 |
8497 |
0.21 |
chrX_22849623_22849800 | 2.98 |
Gm26131 |
predicted gene, 26131 |
12225 |
0.31 |
chr13_63272372_63273277 | 2.98 |
Aopep |
aminopeptidase O |
6 |
0.92 |
chr3_152867981_152868184 | 2.97 |
Gm16232 |
predicted gene 16232 |
8135 |
0.21 |
chr4_32860595_32860784 | 2.96 |
Ankrd6 |
ankyrin repeat domain 6 |
6 |
0.98 |
chr3_17787193_17787344 | 2.96 |
Mir124-2hg |
Mir124-2 host gene (non-protein coding) |
2653 |
0.26 |
chr4_66315204_66315357 | 2.95 |
Gm11484 |
predicted gene 11484 |
38569 |
0.21 |
chr13_20473180_20473431 | 2.94 |
Gm32036 |
predicted gene, 32036 |
185 |
0.82 |
chr17_10334625_10335288 | 2.94 |
1700110C19Rik |
RIKEN cDNA 1700110C19 gene |
10354 |
0.23 |
chr17_93203734_93203963 | 2.94 |
Adcyap1 |
adenylate cyclase activating polypeptide 1 |
1772 |
0.34 |
chr1_85916954_85917154 | 2.93 |
Itm2c |
integral membrane protein 2C |
10893 |
0.12 |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
1.3 | 3.8 | GO:0042126 | nitrate metabolic process(GO:0042126) |
1.2 | 3.6 | GO:0006868 | glutamine transport(GO:0006868) |
1.2 | 3.5 | GO:0045200 | establishment or maintenance of neuroblast polarity(GO:0045196) establishment of neuroblast polarity(GO:0045200) |
1.1 | 3.3 | GO:0097477 | lateral motor column neuron migration(GO:0097477) |
1.1 | 4.3 | GO:0051581 | negative regulation of neurotransmitter uptake(GO:0051581) regulation of serotonin uptake(GO:0051611) negative regulation of serotonin uptake(GO:0051612) |
1.0 | 4.0 | GO:0071205 | protein localization to juxtaparanode region of axon(GO:0071205) |
1.0 | 3.8 | GO:0030035 | microspike assembly(GO:0030035) |
0.9 | 2.7 | GO:0097118 | neuroligin clustering involved in postsynaptic membrane assembly(GO:0097118) |
0.8 | 2.5 | GO:0014878 | response to electrical stimulus involved in regulation of muscle adaptation(GO:0014878) |
0.8 | 2.3 | GO:0090154 | positive regulation of sphingolipid biosynthetic process(GO:0090154) positive regulation of ceramide biosynthetic process(GO:2000304) |
0.7 | 2.2 | GO:0035860 | glial cell-derived neurotrophic factor receptor signaling pathway(GO:0035860) |
0.7 | 4.4 | GO:0003105 | negative regulation of glomerular filtration(GO:0003105) |
0.7 | 5.0 | GO:0099515 | actin filament-based transport(GO:0099515) |
0.7 | 4.9 | GO:0042118 | endothelial cell activation(GO:0042118) |
0.7 | 2.0 | GO:0071873 | response to norepinephrine(GO:0071873) |
0.7 | 2.0 | GO:0090202 | transcriptional activation by promoter-enhancer looping(GO:0071733) gene looping(GO:0090202) dsDNA loop formation(GO:0090579) |
0.7 | 2.6 | GO:0031117 | positive regulation of microtubule depolymerization(GO:0031117) |
0.6 | 1.9 | GO:0032474 | otolith morphogenesis(GO:0032474) |
0.6 | 1.3 | GO:0060166 | olfactory pit development(GO:0060166) |
0.6 | 2.5 | GO:0060221 | retinal rod cell differentiation(GO:0060221) |
0.6 | 1.8 | GO:0003340 | negative regulation of mesenchymal to epithelial transition involved in metanephros morphogenesis(GO:0003340) |
0.6 | 1.2 | GO:0050883 | musculoskeletal movement, spinal reflex action(GO:0050883) |
0.6 | 4.1 | GO:0097264 | self proteolysis(GO:0097264) |
0.6 | 1.7 | GO:0044333 | Wnt signaling pathway involved in digestive tract morphogenesis(GO:0044333) |
0.6 | 2.9 | GO:0007195 | adenylate cyclase-inhibiting dopamine receptor signaling pathway(GO:0007195) |
0.6 | 1.7 | GO:2000686 | regulation of rubidium ion transmembrane transporter activity(GO:2000686) |
0.5 | 1.6 | GO:0033693 | neurofilament bundle assembly(GO:0033693) |
0.5 | 0.5 | GO:0048382 | mesendoderm development(GO:0048382) |
0.5 | 3.2 | GO:0006102 | isocitrate metabolic process(GO:0006102) |
0.5 | 1.0 | GO:0060460 | left lung morphogenesis(GO:0060460) |
0.5 | 1.5 | GO:0038095 | Fc-epsilon receptor signaling pathway(GO:0038095) |
0.5 | 3.1 | GO:0021798 | forebrain dorsal/ventral pattern formation(GO:0021798) |
0.5 | 2.5 | GO:1900042 | positive regulation of interleukin-2 secretion(GO:1900042) |
0.5 | 0.5 | GO:0097168 | mesenchymal stem cell proliferation(GO:0097168) |
0.5 | 1.5 | GO:0043490 | malate-aspartate shuttle(GO:0043490) |
0.5 | 1.5 | GO:0036112 | medium-chain fatty-acyl-CoA metabolic process(GO:0036112) |
0.5 | 5.8 | GO:0051654 | establishment of mitochondrion localization(GO:0051654) |
0.5 | 1.9 | GO:0060244 | negative regulation of cell proliferation involved in contact inhibition(GO:0060244) |
0.5 | 1.4 | GO:1902564 | negative regulation of neutrophil activation(GO:1902564) |
0.5 | 1.4 | GO:0071492 | cellular response to UV-A(GO:0071492) |
0.4 | 1.8 | GO:0033563 | dorsal/ventral axon guidance(GO:0033563) |
0.4 | 1.3 | GO:0007412 | axon target recognition(GO:0007412) |
0.4 | 1.7 | GO:0035934 | corticosterone secretion(GO:0035934) regulation of corticosterone secretion(GO:2000852) |
0.4 | 2.6 | GO:0016081 | synaptic vesicle docking(GO:0016081) |
0.4 | 3.4 | GO:0009186 | deoxyribonucleoside diphosphate metabolic process(GO:0009186) |
0.4 | 1.7 | GO:0098598 | vocal learning(GO:0042297) imitative learning(GO:0098596) learned vocalization behavior or vocal learning(GO:0098598) |
0.4 | 3.4 | GO:0071420 | response to histamine(GO:0034776) cellular response to histamine(GO:0071420) |
0.4 | 0.4 | GO:0021553 | olfactory nerve development(GO:0021553) |
0.4 | 0.8 | GO:1901642 | purine nucleoside transmembrane transport(GO:0015860) purine-containing compound transmembrane transport(GO:0072530) nucleoside transmembrane transport(GO:1901642) |
0.4 | 1.6 | GO:0019482 | beta-alanine metabolic process(GO:0019482) |
0.4 | 6.1 | GO:0030322 | stabilization of membrane potential(GO:0030322) |
0.4 | 2.0 | GO:0034047 | regulation of protein phosphatase type 2A activity(GO:0034047) |
0.4 | 3.9 | GO:0032927 | positive regulation of activin receptor signaling pathway(GO:0032927) |
0.4 | 0.8 | GO:0071504 | response to heparin(GO:0071503) cellular response to heparin(GO:0071504) |
0.4 | 1.1 | GO:0000189 | MAPK import into nucleus(GO:0000189) |
0.4 | 2.2 | GO:0097091 | synaptic vesicle clustering(GO:0097091) |
0.4 | 0.7 | GO:0035262 | gonad morphogenesis(GO:0035262) |
0.4 | 1.8 | GO:0061302 | smooth muscle cell-matrix adhesion(GO:0061302) |
0.4 | 1.4 | GO:2001013 | epithelial cell proliferation involved in renal tubule morphogenesis(GO:2001013) |
0.3 | 1.0 | GO:0071651 | positive regulation of chemokine (C-C motif) ligand 5 production(GO:0071651) |
0.3 | 0.3 | GO:0035905 | ascending aorta development(GO:0035905) ascending aorta morphogenesis(GO:0035910) |
0.3 | 3.0 | GO:0031536 | positive regulation of exit from mitosis(GO:0031536) |
0.3 | 1.0 | GO:0048696 | regulation of collateral sprouting in absence of injury(GO:0048696) |
0.3 | 1.0 | GO:0051182 | coenzyme transport(GO:0051182) |
0.3 | 2.9 | GO:2000980 | regulation of auditory receptor cell differentiation(GO:0045607) regulation of mechanoreceptor differentiation(GO:0045631) regulation of inner ear receptor cell differentiation(GO:2000980) |
0.3 | 1.6 | GO:0014028 | notochord formation(GO:0014028) |
0.3 | 1.0 | GO:0035553 | oxidative RNA demethylation(GO:0035513) oxidative single-stranded RNA demethylation(GO:0035553) |
0.3 | 1.0 | GO:1901843 | positive regulation of high voltage-gated calcium channel activity(GO:1901843) |
0.3 | 1.2 | GO:0035247 | peptidyl-arginine omega-N-methylation(GO:0035247) |
0.3 | 2.5 | GO:1904322 | response to forskolin(GO:1904321) cellular response to forskolin(GO:1904322) |
0.3 | 0.9 | GO:0072137 | condensed mesenchymal cell proliferation(GO:0072137) |
0.3 | 2.4 | GO:0019227 | neuronal action potential propagation(GO:0019227) action potential propagation(GO:0098870) |
0.3 | 2.1 | GO:0003025 | regulation of systemic arterial blood pressure by baroreceptor feedback(GO:0003025) |
0.3 | 0.9 | GO:1903261 | regulation of serine phosphorylation of STAT3 protein(GO:1903261) |
0.3 | 0.9 | GO:0007084 | mitotic nuclear envelope reassembly(GO:0007084) |
0.3 | 1.4 | GO:0016576 | histone dephosphorylation(GO:0016576) |
0.3 | 0.9 | GO:0036515 | serotonergic neuron axon guidance(GO:0036515) |
0.3 | 0.9 | GO:0014722 | regulation of skeletal muscle contraction by calcium ion signaling(GO:0014722) |
0.3 | 0.6 | GO:0048677 | axon extension involved in regeneration(GO:0048677) sprouting of injured axon(GO:0048682) |
0.3 | 2.3 | GO:0021796 | cerebral cortex regionalization(GO:0021796) |
0.3 | 1.1 | GO:0030091 | protein repair(GO:0030091) |
0.3 | 3.4 | GO:0097094 | craniofacial suture morphogenesis(GO:0097094) |
0.3 | 1.4 | GO:0000160 | phosphorelay signal transduction system(GO:0000160) |
0.3 | 0.8 | GO:0035609 | C-terminal protein deglutamylation(GO:0035609) |
0.3 | 0.8 | GO:0060585 | regulation of prostaglandin-endoperoxide synthase activity(GO:0060584) positive regulation of prostaglandin-endoperoxide synthase activity(GO:0060585) |
0.3 | 0.5 | GO:0046864 | retinol transport(GO:0034633) isoprenoid transport(GO:0046864) terpenoid transport(GO:0046865) |
0.3 | 1.1 | GO:0061156 | pulmonary artery morphogenesis(GO:0061156) |
0.3 | 0.5 | GO:0071688 | skeletal muscle myosin thick filament assembly(GO:0030241) striated muscle myosin thick filament assembly(GO:0071688) |
0.3 | 1.0 | GO:0061589 | calcium activated phosphatidylserine scrambling(GO:0061589) |
0.3 | 0.8 | GO:0007223 | Wnt signaling pathway, calcium modulating pathway(GO:0007223) |
0.3 | 0.5 | GO:2000211 | regulation of glutamate metabolic process(GO:2000211) |
0.3 | 0.8 | GO:1902915 | negative regulation of protein K63-linked ubiquitination(GO:1900045) negative regulation of protein polyubiquitination(GO:1902915) |
0.3 | 1.8 | GO:0010988 | regulation of low-density lipoprotein particle clearance(GO:0010988) |
0.3 | 0.3 | GO:0097104 | postsynaptic membrane assembly(GO:0097104) |
0.3 | 0.5 | GO:0090427 | activation of meiosis(GO:0090427) |
0.2 | 1.2 | GO:0000395 | mRNA 5'-splice site recognition(GO:0000395) |
0.2 | 1.0 | GO:0002322 | B cell proliferation involved in immune response(GO:0002322) |
0.2 | 1.2 | GO:0021631 | optic nerve morphogenesis(GO:0021631) |
0.2 | 0.7 | GO:2000313 | fibroblast growth factor receptor signaling pathway involved in neural plate anterior/posterior pattern formation(GO:0060825) regulation of fibroblast growth factor receptor signaling pathway involved in neural plate anterior/posterior pattern formation(GO:2000313) |
0.2 | 2.0 | GO:0060068 | vagina development(GO:0060068) |
0.2 | 1.0 | GO:0019478 | D-amino acid catabolic process(GO:0019478) |
0.2 | 1.7 | GO:0051764 | actin crosslink formation(GO:0051764) |
0.2 | 0.7 | GO:0070634 | transepithelial ammonium transport(GO:0070634) |
0.2 | 1.4 | GO:0071625 | vocalization behavior(GO:0071625) |
0.2 | 1.0 | GO:1903054 | negative regulation of extracellular matrix organization(GO:1903054) |
0.2 | 0.7 | GO:0038026 | reelin-mediated signaling pathway(GO:0038026) |
0.2 | 1.9 | GO:1900452 | regulation of long term synaptic depression(GO:1900452) |
0.2 | 3.0 | GO:0035025 | positive regulation of Rho protein signal transduction(GO:0035025) |
0.2 | 2.3 | GO:0006376 | mRNA splice site selection(GO:0006376) |
0.2 | 1.4 | GO:0006621 | protein retention in ER lumen(GO:0006621) |
0.2 | 0.9 | GO:0021853 | cerebral cortex GABAergic interneuron migration(GO:0021853) interneuron migration(GO:1904936) |
0.2 | 0.7 | GO:0036151 | phosphatidylcholine acyl-chain remodeling(GO:0036151) |
0.2 | 0.7 | GO:0060837 | blood vessel endothelial cell differentiation(GO:0060837) |
0.2 | 0.4 | GO:0097155 | fasciculation of sensory neuron axon(GO:0097155) |
0.2 | 0.7 | GO:0061083 | regulation of protein refolding(GO:0061083) negative regulation of protein refolding(GO:0061084) |
0.2 | 0.9 | GO:0030311 | poly-N-acetyllactosamine metabolic process(GO:0030309) poly-N-acetyllactosamine biosynthetic process(GO:0030311) |
0.2 | 1.3 | GO:0051694 | pointed-end actin filament capping(GO:0051694) |
0.2 | 0.9 | GO:0072051 | juxtaglomerular apparatus development(GO:0072051) |
0.2 | 0.6 | GO:0015889 | cobalamin transport(GO:0015889) |
0.2 | 0.4 | GO:0072092 | ureteric bud invasion(GO:0072092) |
0.2 | 3.0 | GO:0006895 | Golgi to endosome transport(GO:0006895) |
0.2 | 0.8 | GO:0007258 | JUN phosphorylation(GO:0007258) |
0.2 | 0.8 | GO:0002051 | osteoblast fate commitment(GO:0002051) |
0.2 | 1.0 | GO:0060159 | regulation of dopamine receptor signaling pathway(GO:0060159) |
0.2 | 0.6 | GO:0006046 | N-acetylglucosamine catabolic process(GO:0006046) |
0.2 | 6.0 | GO:0060997 | dendritic spine morphogenesis(GO:0060997) |
0.2 | 0.2 | GO:0042321 | negative regulation of circadian sleep/wake cycle, sleep(GO:0042321) |
0.2 | 1.6 | GO:0048715 | negative regulation of oligodendrocyte differentiation(GO:0048715) |
0.2 | 0.4 | GO:0060084 | synaptic transmission involved in micturition(GO:0060084) |
0.2 | 2.4 | GO:0048268 | clathrin coat assembly(GO:0048268) |
0.2 | 0.4 | GO:0070212 | protein poly-ADP-ribosylation(GO:0070212) |
0.2 | 0.6 | GO:0060486 | Clara cell differentiation(GO:0060486) |
0.2 | 0.2 | GO:0060478 | acrosomal vesicle exocytosis(GO:0060478) |
0.2 | 0.6 | GO:0015014 | heparan sulfate proteoglycan biosynthetic process, polysaccharide chain biosynthetic process(GO:0015014) |
0.2 | 0.6 | GO:0007158 | neuron cell-cell adhesion(GO:0007158) |
0.2 | 0.2 | GO:0014854 | response to inactivity(GO:0014854) response to muscle inactivity(GO:0014870) response to muscle inactivity involved in regulation of muscle adaptation(GO:0014877) response to denervation involved in regulation of muscle adaptation(GO:0014894) |
0.2 | 0.6 | GO:0048294 | negative regulation of isotype switching to IgE isotypes(GO:0048294) |
0.2 | 1.3 | GO:0005513 | detection of calcium ion(GO:0005513) |
0.2 | 0.6 | GO:0042160 | plasma lipoprotein particle oxidation(GO:0034441) lipoprotein modification(GO:0042160) lipoprotein oxidation(GO:0042161) |
0.2 | 0.6 | GO:2000474 | regulation of opioid receptor signaling pathway(GO:2000474) |
0.2 | 1.6 | GO:0048280 | vesicle fusion with Golgi apparatus(GO:0048280) |
0.2 | 0.4 | GO:0009826 | unidimensional cell growth(GO:0009826) |
0.2 | 1.9 | GO:0007342 | fusion of sperm to egg plasma membrane(GO:0007342) |
0.2 | 1.2 | GO:0086018 | SA node cell action potential(GO:0086015) SA node cell to atrial cardiac muscle cell signalling(GO:0086018) SA node cell to atrial cardiac muscle cell communication(GO:0086070) |
0.2 | 0.2 | GO:0061091 | regulation of phospholipid translocation(GO:0061091) positive regulation of phospholipid translocation(GO:0061092) |
0.2 | 0.5 | GO:0031585 | regulation of inositol 1,4,5-trisphosphate-sensitive calcium-release channel activity(GO:0031585) |
0.2 | 0.7 | GO:1900029 | positive regulation of ruffle assembly(GO:1900029) |
0.2 | 0.5 | GO:0042998 | positive regulation of Golgi to plasma membrane protein transport(GO:0042998) |
0.2 | 0.5 | GO:0009136 | ADP biosynthetic process(GO:0006172) purine nucleoside diphosphate biosynthetic process(GO:0009136) purine ribonucleoside diphosphate biosynthetic process(GO:0009180) ribonucleoside diphosphate biosynthetic process(GO:0009188) |
0.2 | 1.2 | GO:0031987 | locomotion involved in locomotory behavior(GO:0031987) |
0.2 | 0.5 | GO:0072697 | protein localization to cell cortex(GO:0072697) |
0.2 | 0.2 | GO:1902730 | regulation of heparan sulfate proteoglycan biosynthetic process(GO:0010908) positive regulation of heparan sulfate proteoglycan biosynthetic process(GO:0010909) positive regulation of proteoglycan biosynthetic process(GO:1902730) |
0.2 | 0.3 | GO:0021776 | smoothened signaling pathway involved in ventral spinal cord interneuron specification(GO:0021775) smoothened signaling pathway involved in spinal cord motor neuron cell fate specification(GO:0021776) |
0.2 | 0.6 | GO:0089711 | L-glutamate transmembrane transport(GO:0089711) |
0.2 | 0.2 | GO:1901420 | negative regulation of response to alcohol(GO:1901420) |
0.2 | 0.2 | GO:0070779 | D-aspartate transport(GO:0070777) D-aspartate import(GO:0070779) |
0.2 | 0.5 | GO:0006667 | sphinganine metabolic process(GO:0006667) |
0.2 | 0.6 | GO:0090074 | negative regulation of protein homodimerization activity(GO:0090074) |
0.2 | 1.9 | GO:0045838 | positive regulation of membrane potential(GO:0045838) |
0.2 | 0.5 | GO:0098903 | regulation of membrane repolarization during action potential(GO:0098903) |
0.2 | 0.6 | GO:0010760 | negative regulation of macrophage chemotaxis(GO:0010760) |
0.2 | 1.1 | GO:0060573 | ventral spinal cord interneuron specification(GO:0021521) cell fate specification involved in pattern specification(GO:0060573) |
0.2 | 0.3 | GO:0021847 | ventricular zone neuroblast division(GO:0021847) |
0.2 | 0.5 | GO:1903279 | regulation of calcium:sodium antiporter activity(GO:1903279) |
0.2 | 0.6 | GO:0003383 | apical constriction(GO:0003383) |
0.2 | 0.6 | GO:0070120 | ciliary neurotrophic factor-mediated signaling pathway(GO:0070120) |
0.2 | 0.5 | GO:0045658 | regulation of neutrophil differentiation(GO:0045658) |
0.2 | 0.5 | GO:0046532 | regulation of photoreceptor cell differentiation(GO:0046532) |
0.2 | 0.9 | GO:0035641 | locomotory exploration behavior(GO:0035641) |
0.1 | 0.4 | GO:1904017 | response to Thyroglobulin triiodothyronine(GO:1904016) cellular response to Thyroglobulin triiodothyronine(GO:1904017) |
0.1 | 1.2 | GO:0030644 | cellular chloride ion homeostasis(GO:0030644) |
0.1 | 0.9 | GO:0036006 | response to macrophage colony-stimulating factor(GO:0036005) cellular response to macrophage colony-stimulating factor stimulus(GO:0036006) |
0.1 | 0.4 | GO:0097503 | sialylation(GO:0097503) |
0.1 | 0.3 | GO:1904714 | regulation of chaperone-mediated autophagy(GO:1904714) |
0.1 | 1.0 | GO:0036119 | response to platelet-derived growth factor(GO:0036119) cellular response to platelet-derived growth factor stimulus(GO:0036120) |
0.1 | 0.7 | GO:0032229 | negative regulation of synaptic transmission, GABAergic(GO:0032229) |
0.1 | 0.3 | GO:0035425 | autocrine signaling(GO:0035425) |
0.1 | 1.3 | GO:0006977 | DNA damage response, signal transduction by p53 class mediator resulting in cell cycle arrest(GO:0006977) |
0.1 | 2.4 | GO:0071475 | cellular hyperosmotic salinity response(GO:0071475) |
0.1 | 0.3 | GO:1903899 | positive regulation of PERK-mediated unfolded protein response(GO:1903899) |
0.1 | 5.9 | GO:0050885 | neuromuscular process controlling balance(GO:0050885) |
0.1 | 0.7 | GO:0090394 | negative regulation of excitatory postsynaptic potential(GO:0090394) |
0.1 | 0.5 | GO:0046600 | negative regulation of centriole replication(GO:0046600) |
0.1 | 0.5 | GO:0042473 | outer ear morphogenesis(GO:0042473) |
0.1 | 0.4 | GO:0019086 | late viral transcription(GO:0019086) |
0.1 | 0.4 | GO:0021888 | hypothalamus gonadotrophin-releasing hormone neuron differentiation(GO:0021886) hypothalamus gonadotrophin-releasing hormone neuron development(GO:0021888) |
0.1 | 0.4 | GO:0090038 | negative regulation of protein kinase C signaling(GO:0090038) |
0.1 | 0.5 | GO:0014053 | negative regulation of gamma-aminobutyric acid secretion(GO:0014053) |
0.1 | 0.5 | GO:0090382 | phagosome maturation(GO:0090382) |
0.1 | 0.3 | GO:0006296 | nucleotide-excision repair, DNA incision, 5'-to lesion(GO:0006296) |
0.1 | 0.3 | GO:0072061 | inner medullary collecting duct development(GO:0072061) |
0.1 | 0.1 | GO:0061343 | cell adhesion involved in heart morphogenesis(GO:0061343) |
0.1 | 0.3 | GO:0051665 | membrane raft localization(GO:0051665) |
0.1 | 0.5 | GO:2000096 | positive regulation of Wnt signaling pathway, planar cell polarity pathway(GO:2000096) |
0.1 | 0.4 | GO:0060385 | axonogenesis involved in innervation(GO:0060385) |
0.1 | 1.1 | GO:0071380 | cellular response to prostaglandin E stimulus(GO:0071380) |
0.1 | 0.8 | GO:1903393 | positive regulation of focal adhesion assembly(GO:0051894) positive regulation of adherens junction organization(GO:1903393) |
0.1 | 0.1 | GO:0072602 | interleukin-4 secretion(GO:0072602) |
0.1 | 3.3 | GO:0006890 | retrograde vesicle-mediated transport, Golgi to ER(GO:0006890) |
0.1 | 0.2 | GO:0048388 | endosomal lumen acidification(GO:0048388) |
0.1 | 0.4 | GO:2000310 | regulation of N-methyl-D-aspartate selective glutamate receptor activity(GO:2000310) |
0.1 | 0.9 | GO:0048172 | regulation of short-term neuronal synaptic plasticity(GO:0048172) |
0.1 | 1.1 | GO:0042759 | long-chain fatty acid biosynthetic process(GO:0042759) |
0.1 | 3.9 | GO:0007588 | excretion(GO:0007588) |
0.1 | 1.7 | GO:0051016 | barbed-end actin filament capping(GO:0051016) |
0.1 | 0.5 | GO:0014724 | regulation of twitch skeletal muscle contraction(GO:0014724) |
0.1 | 0.3 | GO:0045896 | regulation of transcription during mitosis(GO:0045896) positive regulation of transcription during mitosis(GO:0045897) |
0.1 | 5.6 | GO:0051965 | positive regulation of synapse assembly(GO:0051965) |
0.1 | 0.8 | GO:0035414 | negative regulation of catenin import into nucleus(GO:0035414) |
0.1 | 0.2 | GO:0038001 | paracrine signaling(GO:0038001) |
0.1 | 0.3 | GO:1900222 | negative regulation of beta-amyloid clearance(GO:1900222) |
0.1 | 0.3 | GO:0010996 | response to auditory stimulus(GO:0010996) |
0.1 | 0.1 | GO:1990144 | intrinsic apoptotic signaling pathway in response to hypoxia(GO:1990144) |
0.1 | 0.3 | GO:0046340 | diacylglycerol catabolic process(GO:0046340) |
0.1 | 0.4 | GO:0038180 | nerve growth factor signaling pathway(GO:0038180) |
0.1 | 0.5 | GO:0001547 | antral ovarian follicle growth(GO:0001547) |
0.1 | 0.3 | GO:0014042 | positive regulation of neuron maturation(GO:0014042) |
0.1 | 0.4 | GO:0071225 | cellular response to muramyl dipeptide(GO:0071225) |
0.1 | 0.3 | GO:1900747 | negative regulation of vascular endothelial growth factor signaling pathway(GO:1900747) |
0.1 | 0.4 | GO:0014734 | skeletal muscle hypertrophy(GO:0014734) |
0.1 | 0.3 | GO:0070649 | formin-nucleated actin cable assembly(GO:0070649) |
0.1 | 0.1 | GO:1904861 | excitatory synapse assembly(GO:1904861) |
0.1 | 0.1 | GO:0002125 | maternal aggressive behavior(GO:0002125) |
0.1 | 0.2 | GO:2001016 | positive regulation of skeletal muscle cell differentiation(GO:2001016) |
0.1 | 0.1 | GO:0010459 | negative regulation of heart rate(GO:0010459) |
0.1 | 0.4 | GO:0045356 | positive regulation of interferon-alpha biosynthetic process(GO:0045356) |
0.1 | 0.7 | GO:1902018 | negative regulation of cilium assembly(GO:1902018) |
0.1 | 0.3 | GO:0043497 | regulation of protein heterodimerization activity(GO:0043497) |
0.1 | 0.1 | GO:0003228 | atrial cardiac muscle tissue development(GO:0003228) atrial cardiac muscle tissue morphogenesis(GO:0055009) |
0.1 | 0.2 | GO:0098735 | positive regulation of the force of heart contraction(GO:0098735) |
0.1 | 0.2 | GO:0010637 | negative regulation of mitochondrial fusion(GO:0010637) |
0.1 | 0.2 | GO:0072718 | response to cisplatin(GO:0072718) |
0.1 | 1.0 | GO:0000188 | inactivation of MAPK activity(GO:0000188) |
0.1 | 0.3 | GO:0030167 | proteoglycan catabolic process(GO:0030167) |
0.1 | 0.6 | GO:0030647 | polyketide metabolic process(GO:0030638) aminoglycoside antibiotic metabolic process(GO:0030647) daunorubicin metabolic process(GO:0044597) doxorubicin metabolic process(GO:0044598) |
0.1 | 0.1 | GO:1902896 | terminal web assembly(GO:1902896) |
0.1 | 0.4 | GO:0048003 | antigen processing and presentation of lipid antigen via MHC class Ib(GO:0048003) antigen processing and presentation, exogenous lipid antigen via MHC class Ib(GO:0048007) |
0.1 | 0.3 | GO:0010520 | regulation of reciprocal meiotic recombination(GO:0010520) |
0.1 | 1.5 | GO:1903861 | regulation of dendrite extension(GO:1903859) positive regulation of dendrite extension(GO:1903861) |
0.1 | 0.6 | GO:0035881 | amacrine cell differentiation(GO:0035881) |
0.1 | 0.4 | GO:0031339 | negative regulation of vesicle fusion(GO:0031339) |
0.1 | 0.2 | GO:2000670 | positive regulation of dendritic cell apoptotic process(GO:2000670) |
0.1 | 0.6 | GO:0048664 | neuron fate determination(GO:0048664) |
0.1 | 0.1 | GO:0060051 | negative regulation of protein glycosylation(GO:0060051) regulation of protein glycosylation in Golgi(GO:0090283) |
0.1 | 0.4 | GO:0021615 | glossopharyngeal nerve morphogenesis(GO:0021615) |
0.1 | 0.2 | GO:0070100 | negative regulation of chemokine-mediated signaling pathway(GO:0070100) |
0.1 | 0.3 | GO:2001214 | positive regulation of vasculogenesis(GO:2001214) |
0.1 | 0.5 | GO:0090273 | regulation of somatostatin secretion(GO:0090273) |
0.1 | 0.3 | GO:0002121 | inter-male aggressive behavior(GO:0002121) |
0.1 | 0.4 | GO:0051639 | actin filament network formation(GO:0051639) |
0.1 | 0.3 | GO:0071335 | hair follicle cell proliferation(GO:0071335) |
0.1 | 0.1 | GO:0045602 | negative regulation of endothelial cell differentiation(GO:0045602) |
0.1 | 0.4 | GO:2000643 | positive regulation of early endosome to late endosome transport(GO:2000643) |
0.1 | 0.2 | GO:0060480 | lung goblet cell differentiation(GO:0060480) |
0.1 | 0.3 | GO:2000574 | regulation of microtubule motor activity(GO:2000574) |
0.1 | 0.6 | GO:0042487 | regulation of odontogenesis of dentin-containing tooth(GO:0042487) |
0.1 | 0.7 | GO:0030277 | maintenance of gastrointestinal epithelium(GO:0030277) |
0.1 | 0.2 | GO:0070842 | aggresome assembly(GO:0070842) |
0.1 | 0.3 | GO:0008626 | granzyme-mediated apoptotic signaling pathway(GO:0008626) |
0.1 | 0.1 | GO:0072069 | distal convoluted tubule development(GO:0072025) DCT cell differentiation(GO:0072069) metanephric distal convoluted tubule development(GO:0072221) metanephric distal tubule development(GO:0072235) metanephric DCT cell differentiation(GO:0072240) |
0.1 | 0.3 | GO:1903026 | negative regulation of RNA polymerase II regulatory region sequence-specific DNA binding(GO:1903026) |
0.1 | 0.4 | GO:0035845 | photoreceptor cell outer segment organization(GO:0035845) |
0.1 | 0.1 | GO:1901509 | regulation of endothelial tube morphogenesis(GO:1901509) |
0.1 | 0.4 | GO:0032099 | negative regulation of appetite(GO:0032099) |
0.1 | 0.4 | GO:0006642 | triglyceride mobilization(GO:0006642) |
0.1 | 0.4 | GO:0070125 | mitochondrial translational elongation(GO:0070125) |
0.1 | 0.4 | GO:0021860 | pyramidal neuron development(GO:0021860) |
0.1 | 0.3 | GO:0010807 | regulation of synaptic vesicle priming(GO:0010807) |
0.1 | 0.3 | GO:0035694 | mitochondrial protein catabolic process(GO:0035694) |
0.1 | 0.2 | GO:0000720 | pyrimidine dimer repair by nucleotide-excision repair(GO:0000720) |
0.1 | 0.2 | GO:0033092 | positive regulation of immature T cell proliferation(GO:0033091) positive regulation of immature T cell proliferation in thymus(GO:0033092) |
0.1 | 0.2 | GO:0048865 | stem cell fate commitment(GO:0048865) |
0.1 | 2.5 | GO:0034605 | cellular response to heat(GO:0034605) |
0.1 | 0.3 | GO:0001828 | inner cell mass cellular morphogenesis(GO:0001828) |
0.1 | 0.3 | GO:0002692 | negative regulation of cellular extravasation(GO:0002692) |
0.1 | 0.1 | GO:0099558 | maintenance of synapse structure(GO:0099558) |
0.1 | 1.7 | GO:0043567 | regulation of insulin-like growth factor receptor signaling pathway(GO:0043567) |
0.1 | 0.5 | GO:0007191 | adenylate cyclase-activating dopamine receptor signaling pathway(GO:0007191) |
0.1 | 0.2 | GO:0089700 | protein kinase D signaling(GO:0089700) |
0.1 | 1.1 | GO:0018126 | protein hydroxylation(GO:0018126) |
0.1 | 0.2 | GO:0035434 | copper ion transmembrane transport(GO:0035434) |
0.1 | 0.9 | GO:0008340 | determination of adult lifespan(GO:0008340) |
0.1 | 0.2 | GO:0061502 | early endosome to recycling endosome transport(GO:0061502) |
0.1 | 0.2 | GO:0032906 | transforming growth factor beta2 production(GO:0032906) regulation of transforming growth factor beta2 production(GO:0032909) |
0.1 | 0.1 | GO:0061684 | chaperone-mediated autophagy(GO:0061684) |
0.1 | 0.2 | GO:0030202 | heparin metabolic process(GO:0030202) heparin biosynthetic process(GO:0030210) |
0.1 | 0.2 | GO:0036092 | phosphatidylinositol-3-phosphate biosynthetic process(GO:0036092) |
0.1 | 0.5 | GO:0030853 | negative regulation of granulocyte differentiation(GO:0030853) |
0.1 | 1.2 | GO:0046579 | positive regulation of Ras protein signal transduction(GO:0046579) |
0.1 | 0.2 | GO:0019676 | ammonia assimilation cycle(GO:0019676) |
0.1 | 0.3 | GO:0010744 | positive regulation of macrophage derived foam cell differentiation(GO:0010744) |
0.1 | 2.1 | GO:0043252 | sodium-independent organic anion transport(GO:0043252) |
0.1 | 0.2 | GO:2001187 | positive regulation of CD8-positive, alpha-beta T cell activation(GO:2001187) |
0.1 | 1.1 | GO:0016339 | calcium-dependent cell-cell adhesion via plasma membrane cell adhesion molecules(GO:0016339) |
0.1 | 1.1 | GO:0043968 | histone H2A acetylation(GO:0043968) |
0.1 | 0.2 | GO:1901656 | glycoside transport(GO:1901656) |
0.1 | 0.2 | GO:0010288 | response to lead ion(GO:0010288) |
0.1 | 0.3 | GO:2000020 | positive regulation of male gonad development(GO:2000020) |
0.1 | 0.3 | GO:0070092 | regulation of glucagon secretion(GO:0070092) |
0.1 | 0.1 | GO:0006363 | termination of RNA polymerase I transcription(GO:0006363) |
0.1 | 0.1 | GO:0060174 | limb bud formation(GO:0060174) |
0.1 | 0.3 | GO:0008354 | germ cell migration(GO:0008354) |
0.1 | 0.2 | GO:0061356 | Wnt protein secretion(GO:0061355) regulation of Wnt protein secretion(GO:0061356) |
0.1 | 0.1 | GO:0014745 | negative regulation of muscle adaptation(GO:0014745) |
0.1 | 0.2 | GO:0035983 | response to trichostatin A(GO:0035983) cellular response to trichostatin A(GO:0035984) |
0.1 | 0.1 | GO:0071877 | regulation of adrenergic receptor signaling pathway(GO:0071877) |
0.1 | 0.1 | GO:0070172 | positive regulation of tooth mineralization(GO:0070172) |
0.1 | 0.4 | GO:1904667 | negative regulation of ubiquitin protein ligase activity(GO:1904667) |
0.1 | 0.1 | GO:0034137 | positive regulation of toll-like receptor 2 signaling pathway(GO:0034137) |
0.1 | 0.1 | GO:1900157 | regulation of bone mineralization involved in bone maturation(GO:1900157) |
0.1 | 0.6 | GO:0090036 | regulation of protein kinase C signaling(GO:0090036) |
0.1 | 0.2 | GO:1904694 | negative regulation of vascular smooth muscle contraction(GO:1904694) |
0.1 | 0.1 | GO:0071321 | cellular response to cGMP(GO:0071321) |
0.1 | 0.1 | GO:0050955 | thermoception(GO:0050955) |
0.1 | 0.7 | GO:0006120 | mitochondrial electron transport, NADH to ubiquinone(GO:0006120) |
0.1 | 0.1 | GO:1990123 | L-glutamate(1-) import into cell(GO:1903802) L-glutamate import into cell(GO:1990123) |
0.1 | 0.1 | GO:0019230 | proprioception(GO:0019230) |
0.1 | 0.1 | GO:2000698 | positive regulation of epithelial cell differentiation involved in kidney development(GO:2000698) |
0.1 | 0.3 | GO:0006382 | adenosine to inosine editing(GO:0006382) |
0.1 | 0.1 | GO:0035526 | retrograde transport, plasma membrane to Golgi(GO:0035526) |
0.1 | 0.3 | GO:0019509 | L-methionine biosynthetic process from methylthioadenosine(GO:0019509) |
0.1 | 0.2 | GO:0036506 | maintenance of unfolded protein(GO:0036506) maintenance of unfolded protein involved in ERAD pathway(GO:1904378) |
0.1 | 0.1 | GO:0044336 | canonical Wnt signaling pathway involved in negative regulation of apoptotic process(GO:0044336) |
0.1 | 1.0 | GO:0051491 | positive regulation of filopodium assembly(GO:0051491) |
0.1 | 0.1 | GO:0060633 | negative regulation of transcription initiation from RNA polymerase II promoter(GO:0060633) negative regulation of DNA-templated transcription, initiation(GO:2000143) |
0.1 | 0.1 | GO:0003358 | noradrenergic neuron development(GO:0003358) |
0.1 | 0.1 | GO:0090526 | regulation of gluconeogenesis involved in cellular glucose homeostasis(GO:0090526) |
0.1 | 0.1 | GO:0010751 | negative regulation of nitric oxide mediated signal transduction(GO:0010751) |
0.1 | 0.1 | GO:0060638 | mesenchymal-epithelial cell signaling(GO:0060638) |
0.1 | 0.2 | GO:0010801 | negative regulation of peptidyl-threonine phosphorylation(GO:0010801) |
0.1 | 0.8 | GO:0060081 | membrane hyperpolarization(GO:0060081) |
0.1 | 0.2 | GO:0009957 | epidermal cell fate specification(GO:0009957) |
0.1 | 0.5 | GO:2000615 | regulation of histone H3-K9 acetylation(GO:2000615) |
0.1 | 0.1 | GO:0061047 | positive regulation of branching involved in lung morphogenesis(GO:0061047) |
0.1 | 0.6 | GO:1900119 | positive regulation of execution phase of apoptosis(GO:1900119) |
0.1 | 0.2 | GO:0030263 | apoptotic chromosome condensation(GO:0030263) |
0.1 | 0.1 | GO:0035090 | maintenance of apical/basal cell polarity(GO:0035090) |
0.1 | 1.2 | GO:0061098 | positive regulation of protein tyrosine kinase activity(GO:0061098) |
0.1 | 0.1 | GO:1903215 | negative regulation of protein targeting to mitochondrion(GO:1903215) negative regulation of establishment of protein localization to mitochondrion(GO:1903748) |
0.1 | 0.1 | GO:0032055 | negative regulation of translation in response to stress(GO:0032055) |
0.1 | 0.1 | GO:0032907 | transforming growth factor beta3 production(GO:0032907) regulation of transforming growth factor beta3 production(GO:0032910) |
0.1 | 0.2 | GO:0032483 | regulation of Rab protein signal transduction(GO:0032483) |
0.1 | 0.1 | GO:0071898 | regulation of estrogen receptor binding(GO:0071898) negative regulation of estrogen receptor binding(GO:0071899) |
0.1 | 0.1 | GO:0021698 | cerebellar cortex structural organization(GO:0021698) |
0.1 | 0.5 | GO:2000811 | negative regulation of anoikis(GO:2000811) |
0.1 | 0.3 | GO:0035640 | exploration behavior(GO:0035640) |
0.1 | 0.1 | GO:0046684 | response to pyrethroid(GO:0046684) |
0.1 | 0.1 | GO:0007386 | compartment pattern specification(GO:0007386) |
0.1 | 0.1 | GO:0032417 | positive regulation of sodium:proton antiporter activity(GO:0032417) |
0.1 | 0.1 | GO:1901727 | positive regulation of histone deacetylase activity(GO:1901727) |
0.1 | 0.2 | GO:0006848 | pyruvate transport(GO:0006848) pyruvate transmembrane transport(GO:1901475) |
0.1 | 0.2 | GO:0021819 | layer formation in cerebral cortex(GO:0021819) |
0.1 | 0.2 | GO:0006543 | glutamine catabolic process(GO:0006543) |
0.1 | 0.7 | GO:2000311 | regulation of alpha-amino-3-hydroxy-5-methyl-4-isoxazole propionate selective glutamate receptor activity(GO:2000311) |
0.1 | 0.7 | GO:0060576 | intestinal epithelial cell development(GO:0060576) |
0.1 | 0.1 | GO:0060509 | Type I pneumocyte differentiation(GO:0060509) |
0.1 | 0.2 | GO:0016560 | protein import into peroxisome matrix, docking(GO:0016560) |
0.1 | 0.4 | GO:1900121 | negative regulation of receptor binding(GO:1900121) |
0.1 | 0.5 | GO:0070050 | neuron cellular homeostasis(GO:0070050) |
0.1 | 0.1 | GO:1901491 | negative regulation of lymphangiogenesis(GO:1901491) |
0.1 | 0.1 | GO:0043435 | response to corticotropin-releasing hormone(GO:0043435) cellular response to corticotropin-releasing hormone stimulus(GO:0071376) |
0.1 | 0.2 | GO:1900378 | positive regulation of melanin biosynthetic process(GO:0048023) positive regulation of secondary metabolite biosynthetic process(GO:1900378) |
0.1 | 0.5 | GO:0042711 | maternal behavior(GO:0042711) |
0.1 | 0.1 | GO:0003431 | growth plate cartilage chondrocyte development(GO:0003431) |
0.1 | 0.3 | GO:2000300 | regulation of synaptic vesicle exocytosis(GO:2000300) |
0.1 | 0.1 | GO:0098904 | regulation of AV node cell action potential(GO:0098904) |
0.1 | 0.1 | GO:1903142 | positive regulation of endothelial cell development(GO:1901552) positive regulation of establishment of endothelial barrier(GO:1903142) |
0.1 | 0.2 | GO:1900037 | regulation of cellular response to hypoxia(GO:1900037) |
0.1 | 0.1 | GO:0014819 | regulation of skeletal muscle contraction(GO:0014819) |
0.1 | 0.4 | GO:0072502 | cellular phosphate ion homeostasis(GO:0030643) cellular trivalent inorganic anion homeostasis(GO:0072502) |
0.1 | 0.1 | GO:0044860 | protein localization to plasma membrane raft(GO:0044860) |
0.1 | 0.5 | GO:0048026 | positive regulation of mRNA splicing, via spliceosome(GO:0048026) |
0.1 | 0.1 | GO:2000680 | regulation of rubidium ion transport(GO:2000680) |
0.1 | 0.1 | GO:0003347 | epicardial cell to mesenchymal cell transition(GO:0003347) |
0.1 | 0.1 | GO:2000409 | positive regulation of T cell extravasation(GO:2000409) |
0.1 | 0.2 | GO:0015808 | L-alanine transport(GO:0015808) |
0.1 | 0.1 | GO:0060916 | mesenchymal cell proliferation involved in lung development(GO:0060916) |
0.1 | 0.2 | GO:0035627 | ceramide transport(GO:0035627) |
0.1 | 0.1 | GO:0050847 | progesterone receptor signaling pathway(GO:0050847) |
0.0 | 0.2 | GO:0050861 | positive regulation of B cell receptor signaling pathway(GO:0050861) |
0.0 | 0.0 | GO:0032277 | negative regulation of gonadotropin secretion(GO:0032277) |
0.0 | 0.1 | GO:1903799 | negative regulation of production of miRNAs involved in gene silencing by miRNA(GO:1903799) |
0.0 | 0.1 | GO:0048341 | paraxial mesoderm formation(GO:0048341) |
0.0 | 0.1 | GO:0002378 | immunoglobulin biosynthetic process(GO:0002378) |
0.0 | 0.8 | GO:0003254 | regulation of membrane depolarization(GO:0003254) |
0.0 | 0.1 | GO:0046208 | spermine catabolic process(GO:0046208) |
0.0 | 3.0 | GO:0007156 | homophilic cell adhesion via plasma membrane adhesion molecules(GO:0007156) |
0.0 | 0.2 | GO:0030299 | intestinal cholesterol absorption(GO:0030299) |
0.0 | 0.1 | GO:0060178 | regulation of exocyst localization(GO:0060178) |
0.0 | 3.1 | GO:0001578 | microtubule bundle formation(GO:0001578) |
0.0 | 0.2 | GO:0045603 | positive regulation of endothelial cell differentiation(GO:0045603) |
0.0 | 0.0 | GO:0045764 | positive regulation of cellular amino acid metabolic process(GO:0045764) |
0.0 | 0.5 | GO:0032988 | ribonucleoprotein complex disassembly(GO:0032988) |
0.0 | 0.9 | GO:0030488 | tRNA methylation(GO:0030488) |
0.0 | 0.1 | GO:0046010 | positive regulation of circadian sleep/wake cycle, non-REM sleep(GO:0046010) |
0.0 | 0.3 | GO:0021544 | subpallium development(GO:0021544) |
0.0 | 0.5 | GO:0098743 | cartilage condensation(GO:0001502) cell aggregation(GO:0098743) |
0.0 | 0.1 | GO:0006177 | GMP biosynthetic process(GO:0006177) |
0.0 | 0.1 | GO:0008627 | intrinsic apoptotic signaling pathway in response to osmotic stress(GO:0008627) regulation of intrinsic apoptotic signaling pathway in response to osmotic stress(GO:1902218) negative regulation of intrinsic apoptotic signaling pathway in response to osmotic stress(GO:1902219) |
0.0 | 0.2 | GO:0033314 | mitotic DNA replication checkpoint(GO:0033314) |
0.0 | 0.3 | GO:0048845 | venous blood vessel morphogenesis(GO:0048845) |
0.0 | 0.1 | GO:0010566 | regulation of ketone biosynthetic process(GO:0010566) |
0.0 | 0.1 | GO:0046098 | guanine metabolic process(GO:0046098) |
0.0 | 0.2 | GO:1900227 | positive regulation of NLRP3 inflammasome complex assembly(GO:1900227) |
0.0 | 0.1 | GO:0032808 | lacrimal gland development(GO:0032808) |
0.0 | 0.1 | GO:2000857 | positive regulation of mineralocorticoid secretion(GO:2000857) positive regulation of aldosterone secretion(GO:2000860) |
0.0 | 0.2 | GO:0042256 | mature ribosome assembly(GO:0042256) |
0.0 | 0.1 | GO:0051126 | negative regulation of Arp2/3 complex-mediated actin nucleation(GO:0034316) negative regulation of actin nucleation(GO:0051126) |
0.0 | 0.7 | GO:0014003 | oligodendrocyte development(GO:0014003) |
0.0 | 0.4 | GO:0046036 | CTP biosynthetic process(GO:0006241) CTP metabolic process(GO:0046036) |
0.0 | 0.2 | GO:2000774 | positive regulation of cellular senescence(GO:2000774) |
0.0 | 0.1 | GO:0032074 | negative regulation of nuclease activity(GO:0032074) |
0.0 | 0.2 | GO:0007196 | adenylate cyclase-inhibiting G-protein coupled glutamate receptor signaling pathway(GO:0007196) |
0.0 | 0.1 | GO:2000346 | negative regulation of hepatocyte proliferation(GO:2000346) |
0.0 | 0.1 | GO:0010578 | regulation of adenylate cyclase activity involved in G-protein coupled receptor signaling pathway(GO:0010578) positive regulation of adenylate cyclase activity involved in G-protein coupled receptor signaling pathway(GO:0010579) |
0.0 | 0.1 | GO:0046882 | negative regulation of follicle-stimulating hormone secretion(GO:0046882) |
0.0 | 0.2 | GO:0061303 | cornea development in camera-type eye(GO:0061303) |
0.0 | 3.0 | GO:0030705 | cytoskeleton-dependent intracellular transport(GO:0030705) |
0.0 | 0.3 | GO:0090114 | COPII-coated vesicle budding(GO:0090114) |
0.0 | 0.3 | GO:0032486 | Rap protein signal transduction(GO:0032486) |
0.0 | 0.1 | GO:2001201 | transforming growth factor-beta secretion(GO:0038044) regulation of transforming growth factor-beta secretion(GO:2001201) |
0.0 | 0.2 | GO:0061370 | testosterone biosynthetic process(GO:0061370) |
0.0 | 0.3 | GO:0016082 | synaptic vesicle priming(GO:0016082) |
0.0 | 0.1 | GO:0060762 | regulation of branching involved in mammary gland duct morphogenesis(GO:0060762) |
0.0 | 0.5 | GO:0042994 | cytoplasmic sequestering of transcription factor(GO:0042994) |
0.0 | 0.4 | GO:0043129 | surfactant homeostasis(GO:0043129) |
0.0 | 0.1 | GO:0001923 | B-1 B cell differentiation(GO:0001923) |
0.0 | 0.7 | GO:0048168 | regulation of neuronal synaptic plasticity(GO:0048168) |
0.0 | 0.3 | GO:0040016 | embryonic cleavage(GO:0040016) |
0.0 | 0.1 | GO:0097105 | presynaptic membrane assembly(GO:0097105) |
0.0 | 2.3 | GO:0007269 | neurotransmitter secretion(GO:0007269) signal release from synapse(GO:0099643) |
0.0 | 0.2 | GO:2000060 | positive regulation of protein ubiquitination involved in ubiquitin-dependent protein catabolic process(GO:2000060) |
0.0 | 0.1 | GO:0033615 | mitochondrial proton-transporting ATP synthase complex assembly(GO:0033615) |
0.0 | 0.5 | GO:0030318 | melanocyte differentiation(GO:0030318) |
0.0 | 0.2 | GO:0021884 | forebrain neuron development(GO:0021884) |
0.0 | 0.2 | GO:0048012 | hepatocyte growth factor receptor signaling pathway(GO:0048012) |
0.0 | 0.2 | GO:0010804 | negative regulation of tumor necrosis factor-mediated signaling pathway(GO:0010804) |
0.0 | 0.1 | GO:0034165 | positive regulation of toll-like receptor 9 signaling pathway(GO:0034165) |
0.0 | 0.1 | GO:0071921 | establishment of sister chromatid cohesion(GO:0034085) cohesin loading(GO:0071921) regulation of cohesin loading(GO:0071922) |
0.0 | 0.4 | GO:0007026 | negative regulation of microtubule depolymerization(GO:0007026) |
0.0 | 0.2 | GO:0006398 | mRNA 3'-end processing by stem-loop binding and cleavage(GO:0006398) |
0.0 | 0.2 | GO:0090042 | tubulin deacetylation(GO:0090042) |
0.0 | 0.2 | GO:0007016 | cytoskeletal anchoring at plasma membrane(GO:0007016) |
0.0 | 0.0 | GO:0045829 | negative regulation of isotype switching(GO:0045829) |
0.0 | 0.0 | GO:2000507 | positive regulation of energy homeostasis(GO:2000507) |
0.0 | 0.9 | GO:0006911 | phagocytosis, engulfment(GO:0006911) |
0.0 | 0.1 | GO:0046985 | positive regulation of hemoglobin biosynthetic process(GO:0046985) |
0.0 | 0.4 | GO:0051974 | negative regulation of telomerase activity(GO:0051974) |
0.0 | 0.3 | GO:0071392 | cellular response to estradiol stimulus(GO:0071392) |
0.0 | 0.0 | GO:0032661 | regulation of interleukin-18 production(GO:0032661) |
0.0 | 0.0 | GO:0033578 | protein glycosylation in Golgi(GO:0033578) |
0.0 | 0.1 | GO:0050705 | regulation of interleukin-1 alpha secretion(GO:0050705) |
0.0 | 0.1 | GO:1902268 | negative regulation of polyamine transmembrane transport(GO:1902268) |
0.0 | 0.2 | GO:0098789 | pre-mRNA cleavage required for polyadenylation(GO:0098789) |
0.0 | 0.0 | GO:0010980 | regulation of vitamin D 24-hydroxylase activity(GO:0010979) positive regulation of vitamin D 24-hydroxylase activity(GO:0010980) |
0.0 | 0.2 | GO:0048711 | positive regulation of astrocyte differentiation(GO:0048711) |
0.0 | 0.0 | GO:1902083 | negative regulation of peptidyl-cysteine S-nitrosylation(GO:1902083) |
0.0 | 0.3 | GO:0051703 | social behavior(GO:0035176) intraspecies interaction between organisms(GO:0051703) |
0.0 | 0.1 | GO:0061042 | vascular wound healing(GO:0061042) |
0.0 | 0.0 | GO:0009912 | auditory receptor cell fate commitment(GO:0009912) inner ear receptor cell fate commitment(GO:0060120) |
0.0 | 0.5 | GO:0032012 | ARF protein signal transduction(GO:0032011) regulation of ARF protein signal transduction(GO:0032012) |
0.0 | 0.0 | GO:0045085 | negative regulation of interleukin-2 biosynthetic process(GO:0045085) |
0.0 | 0.1 | GO:2000018 | regulation of male gonad development(GO:2000018) |
0.0 | 0.1 | GO:0035810 | positive regulation of urine volume(GO:0035810) |
0.0 | 0.3 | GO:0007168 | receptor guanylyl cyclase signaling pathway(GO:0007168) |
0.0 | 0.1 | GO:0015760 | hexose phosphate transport(GO:0015712) glucose-6-phosphate transport(GO:0015760) |
0.0 | 0.0 | GO:0035246 | peptidyl-arginine N-methylation(GO:0035246) |
0.0 | 0.1 | GO:0061052 | negative regulation of cell growth involved in cardiac muscle cell development(GO:0061052) |
0.0 | 0.5 | GO:0035196 | production of miRNAs involved in gene silencing by miRNA(GO:0035196) |
0.0 | 0.1 | GO:0046826 | negative regulation of protein export from nucleus(GO:0046826) |
0.0 | 0.3 | GO:0045721 | negative regulation of gluconeogenesis(GO:0045721) |
0.0 | 0.1 | GO:0038028 | insulin receptor signaling pathway via phosphatidylinositol 3-kinase(GO:0038028) |
0.0 | 0.1 | GO:0015015 | heparan sulfate proteoglycan biosynthetic process, enzymatic modification(GO:0015015) |
0.0 | 0.0 | GO:0086023 | adrenergic receptor signaling pathway involved in heart process(GO:0086023) G-protein coupled receptor signaling pathway involved in heart process(GO:0086103) |
0.0 | 0.2 | GO:0021854 | hypothalamus development(GO:0021854) |
0.0 | 0.2 | GO:0006116 | NADH oxidation(GO:0006116) |
0.0 | 0.0 | GO:1904398 | positive regulation of neuromuscular junction development(GO:1904398) |
0.0 | 0.1 | GO:0030908 | intein-mediated protein splicing(GO:0016539) protein splicing(GO:0030908) |
0.0 | 0.1 | GO:0021871 | forebrain regionalization(GO:0021871) |
0.0 | 0.2 | GO:1900264 | regulation of DNA-directed DNA polymerase activity(GO:1900262) positive regulation of DNA-directed DNA polymerase activity(GO:1900264) |
0.0 | 1.5 | GO:0007173 | epidermal growth factor receptor signaling pathway(GO:0007173) |
0.0 | 0.0 | GO:0044339 | canonical Wnt signaling pathway involved in osteoblast differentiation(GO:0044339) |
0.0 | 0.1 | GO:0015879 | carnitine transport(GO:0015879) |
0.0 | 0.1 | GO:0031034 | myosin filament assembly(GO:0031034) |
0.0 | 0.1 | GO:0070309 | lens fiber cell morphogenesis(GO:0070309) |
0.0 | 0.1 | GO:0010815 | bradykinin catabolic process(GO:0010815) |
0.0 | 0.4 | GO:2000479 | regulation of cAMP-dependent protein kinase activity(GO:2000479) |
0.0 | 0.1 | GO:0051790 | short-chain fatty acid biosynthetic process(GO:0051790) |
0.0 | 0.1 | GO:0051410 | detoxification of nitrogen compound(GO:0051410) cellular detoxification of nitrogen compound(GO:0070458) |
0.0 | 0.1 | GO:0045743 | positive regulation of fibroblast growth factor receptor signaling pathway(GO:0045743) |
0.0 | 0.2 | GO:0007216 | G-protein coupled glutamate receptor signaling pathway(GO:0007216) |
0.0 | 0.2 | GO:0045161 | neuronal ion channel clustering(GO:0045161) |
0.0 | 0.1 | GO:0045900 | negative regulation of translational elongation(GO:0045900) |
0.0 | 0.1 | GO:0002949 | tRNA threonylcarbamoyladenosine modification(GO:0002949) |
0.0 | 0.5 | GO:0044804 | nucleophagy(GO:0044804) |
0.0 | 0.0 | GO:1904666 | regulation of ubiquitin protein ligase activity(GO:1904666) positive regulation of ubiquitin protein ligase activity(GO:1904668) |
0.0 | 0.1 | GO:1901252 | regulation of intracellular transport of viral material(GO:1901252) |
0.0 | 0.3 | GO:0052697 | xenobiotic glucuronidation(GO:0052697) |
0.0 | 0.1 | GO:0032430 | positive regulation of phospholipase A2 activity(GO:0032430) |
0.0 | 0.3 | GO:0018298 | protein-chromophore linkage(GO:0018298) |
0.0 | 0.1 | GO:0002254 | kinin cascade(GO:0002254) |
0.0 | 0.3 | GO:0046325 | negative regulation of glucose import(GO:0046325) |
0.0 | 0.3 | GO:0036065 | fucosylation(GO:0036065) |
0.0 | 0.2 | GO:0072540 | T-helper 17 cell lineage commitment(GO:0072540) |
0.0 | 0.1 | GO:0010360 | negative regulation of anion channel activity(GO:0010360) |
0.0 | 0.1 | GO:0071985 | multivesicular body sorting pathway(GO:0071985) |
0.0 | 0.0 | GO:0039534 | negative regulation of MDA-5 signaling pathway(GO:0039534) |
0.0 | 0.1 | GO:0060011 | Sertoli cell proliferation(GO:0060011) |
0.0 | 0.0 | GO:0032971 | regulation of muscle filament sliding(GO:0032971) |
0.0 | 0.9 | GO:0007040 | lysosome organization(GO:0007040) lytic vacuole organization(GO:0080171) |
0.0 | 0.1 | GO:0070459 | prolactin secretion(GO:0070459) |
0.0 | 0.4 | GO:0032232 | negative regulation of actin filament bundle assembly(GO:0032232) |
0.0 | 0.3 | GO:0009404 | toxin metabolic process(GO:0009404) |
0.0 | 0.1 | GO:2000322 | regulation of glucocorticoid receptor signaling pathway(GO:2000322) |
0.0 | 0.1 | GO:0030910 | olfactory placode formation(GO:0030910) olfactory placode development(GO:0071698) olfactory placode morphogenesis(GO:0071699) |
0.0 | 0.1 | GO:1901857 | positive regulation of cellular respiration(GO:1901857) |
0.0 | 0.1 | GO:0034653 | diterpenoid catabolic process(GO:0016103) retinoic acid catabolic process(GO:0034653) |
0.0 | 0.3 | GO:1903319 | positive regulation of protein maturation(GO:1903319) |
0.0 | 0.1 | GO:0034093 | positive regulation of maintenance of sister chromatid cohesion(GO:0034093) positive regulation of maintenance of mitotic sister chromatid cohesion(GO:0034184) |
0.0 | 0.1 | GO:0035089 | establishment of apical/basal cell polarity(GO:0035089) |
0.0 | 0.1 | GO:1901841 | regulation of high voltage-gated calcium channel activity(GO:1901841) |
0.0 | 0.1 | GO:0044375 | regulation of peroxisome size(GO:0044375) |
0.0 | 0.0 | GO:0032792 | negative regulation of CREB transcription factor activity(GO:0032792) |
0.0 | 0.1 | GO:0060689 | cell differentiation involved in salivary gland development(GO:0060689) |
0.0 | 0.0 | GO:0070460 | thyroid-stimulating hormone secretion(GO:0070460) |
0.0 | 0.1 | GO:0070562 | regulation of vitamin D receptor signaling pathway(GO:0070562) |
0.0 | 0.0 | GO:0060856 | establishment of blood-brain barrier(GO:0060856) |
0.0 | 0.1 | GO:0046909 | intermembrane transport(GO:0046909) |
0.0 | 0.1 | GO:0036265 | RNA (guanine-N7)-methylation(GO:0036265) |
0.0 | 0.0 | GO:2000410 | thymocyte migration(GO:0072679) regulation of thymocyte migration(GO:2000410) positive regulation of thymocyte migration(GO:2000412) |
0.0 | 0.5 | GO:0060441 | epithelial tube branching involved in lung morphogenesis(GO:0060441) |
0.0 | 0.0 | GO:0072174 | metanephric tubule formation(GO:0072174) |
0.0 | 0.8 | GO:0032418 | lysosome localization(GO:0032418) |
0.0 | 0.1 | GO:0042985 | negative regulation of amyloid precursor protein biosynthetic process(GO:0042985) |
0.0 | 0.0 | GO:0097476 | motor neuron migration(GO:0097475) spinal cord motor neuron migration(GO:0097476) |
0.0 | 0.2 | GO:0010839 | negative regulation of keratinocyte proliferation(GO:0010839) |
0.0 | 0.1 | GO:0001927 | exocyst assembly(GO:0001927) |
0.0 | 0.0 | GO:0046121 | deoxyribonucleoside catabolic process(GO:0046121) |
0.0 | 0.1 | GO:2000009 | negative regulation of protein localization to cell surface(GO:2000009) |
0.0 | 0.1 | GO:0002439 | chronic inflammatory response to antigenic stimulus(GO:0002439) |
0.0 | 0.5 | GO:0070207 | protein homotrimerization(GO:0070207) |
0.0 | 0.1 | GO:0039536 | negative regulation of RIG-I signaling pathway(GO:0039536) |
0.0 | 0.2 | GO:0006264 | mitochondrial DNA replication(GO:0006264) |
0.0 | 0.7 | GO:0000381 | regulation of alternative mRNA splicing, via spliceosome(GO:0000381) |
0.0 | 0.1 | GO:0008635 | activation of cysteine-type endopeptidase activity involved in apoptotic process by cytochrome c(GO:0008635) |
0.0 | 0.1 | GO:0071379 | cellular response to prostaglandin stimulus(GO:0071379) |
0.0 | 0.1 | GO:0018230 | peptidyl-L-cysteine S-palmitoylation(GO:0018230) peptidyl-S-diacylglycerol-L-cysteine biosynthetic process from peptidyl-cysteine(GO:0018231) |
0.0 | 0.1 | GO:0016584 | nucleosome positioning(GO:0016584) |
0.0 | 0.2 | GO:0006490 | oligosaccharide-lipid intermediate biosynthetic process(GO:0006490) |
0.0 | 0.2 | GO:0051532 | regulation of NFAT protein import into nucleus(GO:0051532) |
0.0 | 0.2 | GO:0042953 | lipoprotein transport(GO:0042953) lipoprotein localization(GO:0044872) |
0.0 | 0.1 | GO:0002071 | glandular epithelial cell maturation(GO:0002071) |
0.0 | 0.1 | GO:0030576 | Cajal body organization(GO:0030576) |
0.0 | 0.1 | GO:0035331 | negative regulation of hippo signaling(GO:0035331) |
0.0 | 0.0 | GO:0031914 | negative regulation of synaptic plasticity(GO:0031914) |
0.0 | 0.1 | GO:0002756 | MyD88-independent toll-like receptor signaling pathway(GO:0002756) |
0.0 | 0.0 | GO:0045409 | negative regulation of interleukin-6 biosynthetic process(GO:0045409) |
0.0 | 0.4 | GO:0032350 | regulation of hormone metabolic process(GO:0032350) |
0.0 | 0.1 | GO:0090244 | Wnt signaling pathway involved in somitogenesis(GO:0090244) |
0.0 | 0.1 | GO:0071447 | cellular response to hydroperoxide(GO:0071447) |
0.0 | 0.1 | GO:0042048 | olfactory behavior(GO:0042048) |
0.0 | 0.3 | GO:0014044 | Schwann cell development(GO:0014044) |
0.0 | 0.2 | GO:0051601 | exocyst localization(GO:0051601) |
0.0 | 0.2 | GO:0034311 | diol metabolic process(GO:0034311) |
0.0 | 0.2 | GO:0032525 | somite rostral/caudal axis specification(GO:0032525) |
0.0 | 0.1 | GO:0000492 | small nucleolar ribonucleoprotein complex assembly(GO:0000491) box C/D snoRNP assembly(GO:0000492) |
0.0 | 0.0 | GO:0071677 | positive regulation of mononuclear cell migration(GO:0071677) |
0.0 | 0.0 | GO:0003352 | regulation of cilium movement(GO:0003352) regulation of cilium beat frequency(GO:0003356) |
0.0 | 0.2 | GO:0009312 | oligosaccharide biosynthetic process(GO:0009312) |
0.0 | 0.0 | GO:0035437 | maintenance of protein localization in endoplasmic reticulum(GO:0035437) |
0.0 | 0.1 | GO:0071712 | ER-associated misfolded protein catabolic process(GO:0071712) |
0.0 | 0.3 | GO:0007032 | endosome organization(GO:0007032) |
0.0 | 0.2 | GO:0000467 | exonucleolytic trimming involved in rRNA processing(GO:0000459) exonucleolytic trimming to generate mature 3'-end of 5.8S rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000467) |
0.0 | 0.0 | GO:0051684 | maintenance of Golgi location(GO:0051684) |
0.0 | 0.0 | GO:0046391 | 5-phosphoribose 1-diphosphate biosynthetic process(GO:0006015) 5-phosphoribose 1-diphosphate metabolic process(GO:0046391) |
0.0 | 0.0 | GO:0001757 | somite specification(GO:0001757) |
0.0 | 0.1 | GO:0003334 | keratinocyte development(GO:0003334) |
0.0 | 0.1 | GO:2001275 | positive regulation of glucose import in response to insulin stimulus(GO:2001275) |
0.0 | 0.0 | GO:1903977 | positive regulation of glial cell migration(GO:1903977) |
0.0 | 0.1 | GO:2000255 | negative regulation of male germ cell proliferation(GO:2000255) |
0.0 | 0.1 | GO:0051725 | protein de-ADP-ribosylation(GO:0051725) |
0.0 | 0.1 | GO:0070995 | NADPH oxidation(GO:0070995) |
0.0 | 0.0 | GO:0001661 | conditioned taste aversion(GO:0001661) |
0.0 | 0.7 | GO:0010501 | RNA secondary structure unwinding(GO:0010501) |
0.0 | 0.1 | GO:0006772 | thiamine metabolic process(GO:0006772) thiamine-containing compound metabolic process(GO:0042723) |
0.0 | 0.1 | GO:1902775 | mitochondrial large ribosomal subunit assembly(GO:1902775) |
0.0 | 0.1 | GO:0023021 | termination of signal transduction(GO:0023021) |
0.0 | 0.1 | GO:0097343 | ripoptosome assembly(GO:0097343) ripoptosome assembly involved in necroptotic process(GO:1901026) |
0.0 | 0.0 | GO:0007089 | traversing start control point of mitotic cell cycle(GO:0007089) |
0.0 | 0.3 | GO:0097031 | NADH dehydrogenase complex assembly(GO:0010257) mitochondrial respiratory chain complex I assembly(GO:0032981) mitochondrial respiratory chain complex I biogenesis(GO:0097031) |
0.0 | 0.1 | GO:0016266 | O-glycan processing(GO:0016266) |
0.0 | 0.1 | GO:0032594 | protein transport within lipid bilayer(GO:0032594) |
0.0 | 0.0 | GO:0060988 | lipid tube assembly(GO:0060988) |
0.0 | 0.2 | GO:0034587 | piRNA metabolic process(GO:0034587) |
0.0 | 0.1 | GO:0018095 | protein polyglutamylation(GO:0018095) |
0.0 | 0.0 | GO:0000820 | regulation of glutamine family amino acid metabolic process(GO:0000820) |
0.0 | 0.0 | GO:0043633 | polyadenylation-dependent RNA catabolic process(GO:0043633) |
0.0 | 0.0 | GO:0021570 | rhombomere 4 development(GO:0021570) |
0.0 | 0.0 | GO:0070885 | negative regulation of calcineurin-NFAT signaling cascade(GO:0070885) |
0.0 | 0.0 | GO:0009804 | coumarin metabolic process(GO:0009804) |
0.0 | 0.1 | GO:0000727 | double-strand break repair via break-induced replication(GO:0000727) |
0.0 | 0.1 | GO:0006450 | regulation of translational fidelity(GO:0006450) |
0.0 | 0.1 | GO:0009052 | pentose-phosphate shunt, non-oxidative branch(GO:0009052) |
0.0 | 0.1 | GO:0046548 | retinal rod cell development(GO:0046548) |
0.0 | 0.0 | GO:0042758 | long-chain fatty acid catabolic process(GO:0042758) |
0.0 | 0.1 | GO:0039530 | MDA-5 signaling pathway(GO:0039530) |
0.0 | 0.0 | GO:0071611 | macrophage colony-stimulating factor production(GO:0036301) granulocyte colony-stimulating factor production(GO:0071611) regulation of granulocyte colony-stimulating factor production(GO:0071655) regulation of macrophage colony-stimulating factor production(GO:1901256) |
0.0 | 0.1 | GO:0036444 | calcium ion transmembrane import into mitochondrion(GO:0036444) |
0.0 | 0.0 | GO:0014029 | neural crest formation(GO:0014029) |
0.0 | 0.1 | GO:0003203 | endocardial cushion morphogenesis(GO:0003203) |
0.0 | 0.0 | GO:0051791 | medium-chain fatty acid metabolic process(GO:0051791) |
0.0 | 0.0 | GO:2000510 | regulation of dendritic cell chemotaxis(GO:2000508) positive regulation of dendritic cell chemotaxis(GO:2000510) |
0.0 | 0.0 | GO:0070345 | negative regulation of fat cell proliferation(GO:0070345) |
0.0 | 0.2 | GO:0008053 | mitochondrial fusion(GO:0008053) |
0.0 | 0.1 | GO:0032826 | natural killer cell differentiation involved in immune response(GO:0002325) negative regulation of natural killer cell differentiation(GO:0032824) regulation of natural killer cell differentiation involved in immune response(GO:0032826) negative regulation of natural killer cell differentiation involved in immune response(GO:0032827) |
0.0 | 0.0 | GO:0042989 | sequestering of actin monomers(GO:0042989) |
0.0 | 0.0 | GO:0032224 | positive regulation of synaptic transmission, cholinergic(GO:0032224) |
0.0 | 0.1 | GO:0051593 | response to folic acid(GO:0051593) |
0.0 | 0.1 | GO:0010803 | regulation of tumor necrosis factor-mediated signaling pathway(GO:0010803) |
0.0 | 0.1 | GO:0071436 | sodium ion export from cell(GO:0036376) sodium ion export(GO:0071436) |
0.0 | 0.1 | GO:0034141 | positive regulation of toll-like receptor 3 signaling pathway(GO:0034141) |
0.0 | 0.1 | GO:0044027 | hypermethylation of CpG island(GO:0044027) |
0.0 | 0.1 | GO:1902715 | positive regulation of interferon-gamma secretion(GO:1902715) |
0.0 | 0.0 | GO:0042420 | dopamine catabolic process(GO:0042420) |
0.0 | 0.0 | GO:0032025 | response to cobalt ion(GO:0032025) |
0.0 | 1.1 | GO:1903955 | positive regulation of protein targeting to mitochondrion(GO:1903955) |
0.0 | 0.1 | GO:0046827 | positive regulation of protein export from nucleus(GO:0046827) |
0.0 | 0.0 | GO:0033683 | nucleotide-excision repair, DNA incision(GO:0033683) |
0.0 | 0.0 | GO:0018125 | peptidyl-cysteine methylation(GO:0018125) |
0.0 | 0.2 | GO:0007616 | long-term memory(GO:0007616) |
0.0 | 0.0 | GO:0060648 | mammary gland bud morphogenesis(GO:0060648) |
0.0 | 0.1 | GO:0033564 | anterior/posterior axon guidance(GO:0033564) |
0.0 | 0.0 | GO:0072217 | negative regulation of metanephros development(GO:0072217) |
0.0 | 0.1 | GO:0046015 | regulation of transcription by glucose(GO:0046015) |
0.0 | 0.0 | GO:0050689 | negative regulation of defense response to virus by host(GO:0050689) |
0.0 | 0.0 | GO:1900425 | negative regulation of defense response to bacterium(GO:1900425) |
0.0 | 0.0 | GO:0046519 | sphingoid metabolic process(GO:0046519) |
0.0 | 0.3 | GO:0001895 | retina homeostasis(GO:0001895) |
0.0 | 0.0 | GO:0070245 | positive regulation of thymocyte apoptotic process(GO:0070245) |
0.0 | 0.0 | GO:0061625 | fructose catabolic process(GO:0006001) fructose catabolic process to hydroxyacetone phosphate and glyceraldehyde-3-phosphate(GO:0061624) glycolytic process through fructose-1-phosphate(GO:0061625) |
0.0 | 0.0 | GO:0042732 | D-xylose metabolic process(GO:0042732) |
0.0 | 0.0 | GO:0016557 | peroxisome membrane biogenesis(GO:0016557) |
0.0 | 0.0 | GO:0002291 | T cell activation via T cell receptor contact with antigen bound to MHC molecule on antigen presenting cell(GO:0002291) |
0.0 | 0.0 | GO:0010936 | negative regulation of macrophage cytokine production(GO:0010936) |
0.0 | 0.0 | GO:1901162 | serotonin biosynthetic process(GO:0042427) primary amino compound biosynthetic process(GO:1901162) |
0.0 | 0.0 | GO:0070886 | positive regulation of calcineurin-NFAT signaling cascade(GO:0070886) |
0.0 | 0.0 | GO:1904526 | regulation of microtubule binding(GO:1904526) positive regulation of microtubule binding(GO:1904528) |
0.0 | 0.0 | GO:0009233 | menaquinone metabolic process(GO:0009233) |
0.0 | 0.1 | GO:0036297 | interstrand cross-link repair(GO:0036297) |
0.0 | 1.2 | GO:0019882 | antigen processing and presentation(GO:0019882) |
0.0 | 0.0 | GO:0071910 | determination of pancreatic left/right asymmetry(GO:0035469) determination of liver left/right asymmetry(GO:0071910) |
0.0 | 0.5 | GO:0006888 | ER to Golgi vesicle-mediated transport(GO:0006888) |
0.0 | 0.0 | GO:0052203 | modulation of catalytic activity in other organism involved in symbiotic interaction(GO:0052203) modulation by host of symbiont catalytic activity(GO:0052422) |
0.0 | 0.1 | GO:0043518 | negative regulation of DNA damage response, signal transduction by p53 class mediator(GO:0043518) |
0.0 | 0.0 | GO:0052405 | negative regulation by host of symbiont molecular function(GO:0052405) modification by host of symbiont molecular function(GO:0052428) |
0.0 | 0.0 | GO:0032929 | negative regulation of superoxide anion generation(GO:0032929) |
0.0 | 0.1 | GO:0001867 | complement activation, lectin pathway(GO:0001867) |
0.0 | 0.1 | GO:0051152 | positive regulation of smooth muscle cell differentiation(GO:0051152) |
0.0 | 0.1 | GO:0002643 | regulation of tolerance induction(GO:0002643) |
0.0 | 0.0 | GO:0021558 | trochlear nerve development(GO:0021558) |
0.0 | 0.0 | GO:0019262 | N-acetylneuraminate catabolic process(GO:0019262) |
0.0 | 0.0 | GO:0042997 | negative regulation of Golgi to plasma membrane protein transport(GO:0042997) |
0.0 | 0.0 | GO:0034755 | iron ion transmembrane transport(GO:0034755) |
0.0 | 0.1 | GO:0070327 | thyroid hormone transport(GO:0070327) |
0.0 | 0.0 | GO:1901679 | pyrimidine-containing compound transmembrane transport(GO:0072531) nucleotide transmembrane transport(GO:1901679) |
0.0 | 0.0 | GO:0097694 | establishment of RNA localization to telomere(GO:0097694) |
0.0 | 0.0 | GO:0071072 | negative regulation of phospholipid biosynthetic process(GO:0071072) |
0.0 | 0.1 | GO:0031145 | anaphase-promoting complex-dependent catabolic process(GO:0031145) |
0.0 | 0.0 | GO:0035933 | glucocorticoid secretion(GO:0035933) regulation of glucocorticoid secretion(GO:2000849) |
0.0 | 0.0 | GO:2000173 | negative regulation of branching morphogenesis of a nerve(GO:2000173) |
0.0 | 0.1 | GO:1902410 | mitotic cytokinetic process(GO:1902410) |
0.0 | 0.0 | GO:0050915 | sensory perception of sour taste(GO:0050915) |
0.0 | 0.1 | GO:0060012 | synaptic transmission, glycinergic(GO:0060012) |
0.0 | 0.1 | GO:0071402 | cellular response to lipoprotein particle stimulus(GO:0071402) |
0.0 | 0.0 | GO:0071930 | negative regulation of transcription involved in G1/S transition of mitotic cell cycle(GO:0071930) |
0.0 | 0.0 | GO:0006208 | pyrimidine nucleobase catabolic process(GO:0006208) thymine catabolic process(GO:0006210) thymine metabolic process(GO:0019859) |
0.0 | 0.1 | GO:0097340 | inhibition of cysteine-type endopeptidase activity(GO:0097340) zymogen inhibition(GO:0097341) inhibition of cysteine-type endopeptidase activity involved in apoptotic process(GO:1990001) |
0.0 | 0.0 | GO:2001206 | positive regulation of osteoclast development(GO:2001206) |
0.0 | 0.0 | GO:0046341 | CDP-diacylglycerol metabolic process(GO:0046341) |
0.0 | 0.1 | GO:0046415 | urate metabolic process(GO:0046415) |
0.0 | 0.0 | GO:0090071 | negative regulation of ribosome biogenesis(GO:0090071) |
0.0 | 0.1 | GO:0030205 | dermatan sulfate metabolic process(GO:0030205) |
0.0 | 0.4 | GO:0006836 | neurotransmitter transport(GO:0006836) |
0.0 | 0.0 | GO:0002517 | T cell tolerance induction(GO:0002517) |
0.0 | 0.1 | GO:0018344 | protein geranylgeranylation(GO:0018344) |
0.0 | 0.0 | GO:0002017 | regulation of blood volume by renal aldosterone(GO:0002017) |
0.0 | 0.0 | GO:0043653 | mitochondrial fragmentation involved in apoptotic process(GO:0043653) |
0.0 | 0.0 | GO:0006344 | maintenance of chromatin silencing(GO:0006344) |
0.0 | 0.0 | GO:0003413 | chondrocyte differentiation involved in endochondral bone morphogenesis(GO:0003413) |
0.0 | 0.1 | GO:0048742 | regulation of skeletal muscle fiber development(GO:0048742) |
0.0 | 0.0 | GO:0090598 | male genitalia morphogenesis(GO:0048808) male anatomical structure morphogenesis(GO:0090598) |
0.0 | 0.0 | GO:0060435 | bronchiole development(GO:0060435) |
0.0 | 0.0 | GO:0046013 | T cell homeostatic proliferation(GO:0001777) regulation of T cell homeostatic proliferation(GO:0046013) |
0.0 | 0.0 | GO:0051562 | negative regulation of mitochondrial calcium ion concentration(GO:0051562) |
0.0 | 0.0 | GO:0051481 | negative regulation of cytosolic calcium ion concentration(GO:0051481) |
0.0 | 0.1 | GO:0034315 | regulation of Arp2/3 complex-mediated actin nucleation(GO:0034315) |
0.0 | 0.0 | GO:0032077 | positive regulation of deoxyribonuclease activity(GO:0032077) |
0.0 | 0.0 | GO:0009133 | nucleoside diphosphate biosynthetic process(GO:0009133) |
0.0 | 0.0 | GO:0006742 | NADP catabolic process(GO:0006742) |
0.0 | 0.0 | GO:0001768 | establishment of lymphocyte polarity(GO:0001767) establishment of T cell polarity(GO:0001768) |
0.0 | 0.0 | GO:0043988 | histone H3-S28 phosphorylation(GO:0043988) |
0.0 | 0.0 | GO:0055075 | potassium ion homeostasis(GO:0055075) |
0.0 | 0.0 | GO:0048819 | regulation of hair follicle maturation(GO:0048819) |
0.0 | 0.0 | GO:0090187 | positive regulation of pancreatic juice secretion(GO:0090187) |
0.0 | 0.0 | GO:0032331 | negative regulation of chondrocyte differentiation(GO:0032331) |
0.0 | 0.1 | GO:0042795 | snRNA transcription from RNA polymerase II promoter(GO:0042795) |
0.0 | 0.0 | GO:0010992 | ubiquitin homeostasis(GO:0010992) |
0.0 | 0.0 | GO:0097119 | postsynaptic density protein 95 clustering(GO:0097119) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
1.1 | 3.3 | GO:0005971 | ribonucleoside-diphosphate reductase complex(GO:0005971) |
0.8 | 5.0 | GO:0031258 | lamellipodium membrane(GO:0031258) |
0.7 | 2.7 | GO:0032437 | cuticular plate(GO:0032437) |
0.6 | 1.9 | GO:0097454 | Schwann cell microvillus(GO:0097454) |
0.4 | 1.6 | GO:0044308 | axonal spine(GO:0044308) |
0.3 | 3.1 | GO:0000137 | Golgi cis cisterna(GO:0000137) |
0.3 | 1.2 | GO:0033269 | internode region of axon(GO:0033269) |
0.3 | 1.2 | GO:0070876 | SOSS complex(GO:0070876) |
0.3 | 0.6 | GO:0097443 | sorting endosome(GO:0097443) |
0.3 | 3.8 | GO:0032433 | filopodium tip(GO:0032433) |
0.3 | 0.9 | GO:0097648 | G-protein coupled receptor dimeric complex(GO:0038037) G-protein coupled receptor complex(GO:0097648) |
0.3 | 2.5 | GO:0005883 | neurofilament(GO:0005883) |
0.3 | 1.6 | GO:1990454 | L-type voltage-gated calcium channel complex(GO:1990454) |
0.3 | 0.5 | GO:1990812 | growth cone filopodium(GO:1990812) |
0.3 | 0.3 | GO:0034679 | integrin alpha9-beta1 complex(GO:0034679) |
0.3 | 0.8 | GO:0043527 | tRNA methyltransferase complex(GO:0043527) |
0.2 | 2.0 | GO:0071437 | invadopodium(GO:0071437) |
0.2 | 0.7 | GO:0034750 | Scrib-APC-beta-catenin complex(GO:0034750) |
0.2 | 0.9 | GO:0044354 | pinosome(GO:0044352) macropinosome(GO:0044354) |
0.2 | 2.3 | GO:0044224 | juxtaparanode region of axon(GO:0044224) |
0.2 | 0.7 | GO:0097427 | microtubule bundle(GO:0097427) |
0.2 | 1.6 | GO:0008290 | F-actin capping protein complex(GO:0008290) |
0.2 | 11.1 | GO:0043198 | dendritic shaft(GO:0043198) |
0.2 | 2.4 | GO:0043194 | axon initial segment(GO:0043194) |
0.2 | 0.7 | GO:0070110 | ciliary neurotrophic factor receptor complex(GO:0070110) |
0.2 | 1.3 | GO:0032584 | growth cone membrane(GO:0032584) |
0.2 | 3.4 | GO:0097038 | perinuclear endoplasmic reticulum(GO:0097038) |
0.2 | 1.5 | GO:0098563 | integral component of synaptic vesicle membrane(GO:0030285) intrinsic component of synaptic vesicle membrane(GO:0098563) |
0.2 | 0.8 | GO:0032777 | Piccolo NuA4 histone acetyltransferase complex(GO:0032777) |
0.2 | 1.8 | GO:0000813 | ESCRT I complex(GO:0000813) |
0.2 | 1.5 | GO:0000243 | commitment complex(GO:0000243) |
0.2 | 3.0 | GO:1902711 | GABA receptor complex(GO:1902710) GABA-A receptor complex(GO:1902711) |
0.2 | 0.7 | GO:0070032 | synaptobrevin 2-SNAP-25-syntaxin-1a-complexin I complex(GO:0070032) |
0.2 | 1.9 | GO:0005916 | fascia adherens(GO:0005916) |
0.2 | 0.3 | GO:0070044 | synaptobrevin 2-SNAP-25-syntaxin-1a complex(GO:0070044) |
0.2 | 0.6 | GO:0032541 | cortical endoplasmic reticulum(GO:0032541) |
0.2 | 0.6 | GO:0014731 | spectrin-associated cytoskeleton(GO:0014731) |
0.2 | 0.6 | GO:0061574 | ASAP complex(GO:0061574) |
0.2 | 0.5 | GO:0010009 | cytoplasmic side of endosome membrane(GO:0010009) |
0.2 | 0.5 | GO:0042827 | platelet dense granule(GO:0042827) |
0.1 | 1.6 | GO:0030061 | mitochondrial crista(GO:0030061) |
0.1 | 1.5 | GO:0001518 | voltage-gated sodium channel complex(GO:0001518) |
0.1 | 0.6 | GO:0044294 | dendritic growth cone(GO:0044294) |
0.1 | 0.4 | GO:0034673 | inhibin-betaglycan-ActRII complex(GO:0034673) |
0.1 | 2.9 | GO:0032281 | AMPA glutamate receptor complex(GO:0032281) |
0.1 | 0.3 | GO:0017071 | intracellular cyclic nucleotide activated cation channel complex(GO:0017071) |
0.1 | 0.4 | GO:0097450 | astrocyte end-foot(GO:0097450) |
0.1 | 0.4 | GO:0097441 | basilar dendrite(GO:0097441) |
0.1 | 1.8 | GO:0035371 | microtubule plus-end(GO:0035371) |
0.1 | 0.6 | GO:0005579 | membrane attack complex(GO:0005579) |
0.1 | 0.5 | GO:0031262 | Ndc80 complex(GO:0031262) |
0.1 | 6.1 | GO:0005793 | endoplasmic reticulum-Golgi intermediate compartment(GO:0005793) |
0.1 | 1.0 | GO:0005859 | muscle myosin complex(GO:0005859) |
0.1 | 0.2 | GO:0034719 | SMN-Sm protein complex(GO:0034719) |
0.1 | 0.9 | GO:0034464 | BBSome(GO:0034464) |
0.1 | 0.6 | GO:0044300 | cerebellar mossy fiber(GO:0044300) |
0.1 | 0.8 | GO:0031143 | pseudopodium(GO:0031143) |
0.1 | 0.9 | GO:0035253 | ciliary rootlet(GO:0035253) |
0.1 | 0.9 | GO:0001520 | outer dense fiber(GO:0001520) |
0.1 | 0.3 | GO:0071008 | U2-type post-mRNA release spliceosomal complex(GO:0071008) |
0.1 | 1.5 | GO:0043196 | varicosity(GO:0043196) |
0.1 | 0.3 | GO:0032937 | SREBP-SCAP-Insig complex(GO:0032937) |
0.1 | 3.0 | GO:0014704 | intercalated disc(GO:0014704) |
0.1 | 4.9 | GO:0031594 | neuromuscular junction(GO:0031594) |
0.1 | 0.7 | GO:0097470 | ribbon synapse(GO:0097470) |
0.1 | 0.4 | GO:0036454 | insulin-like growth factor binding protein complex(GO:0016942) growth factor complex(GO:0036454) insulin-like growth factor ternary complex(GO:0042567) |
0.1 | 2.2 | GO:0030672 | synaptic vesicle membrane(GO:0030672) exocytic vesicle membrane(GO:0099501) |
0.1 | 0.4 | GO:0043203 | axon hillock(GO:0043203) |
0.1 | 1.1 | GO:0005583 | fibrillar collagen trimer(GO:0005583) banded collagen fibril(GO:0098643) |
0.1 | 0.9 | GO:0032797 | SMN complex(GO:0032797) |
0.1 | 0.3 | GO:0090665 | dystrophin-associated glycoprotein complex(GO:0016010) glycoprotein complex(GO:0090665) |
0.1 | 2.4 | GO:0031941 | filamentous actin(GO:0031941) |
0.1 | 0.3 | GO:0033162 | melanosome membrane(GO:0033162) chitosome(GO:0045009) |
0.1 | 0.2 | GO:0033596 | TSC1-TSC2 complex(GO:0033596) |
0.1 | 1.2 | GO:0005614 | interstitial matrix(GO:0005614) |
0.1 | 3.5 | GO:0005871 | kinesin complex(GO:0005871) |
0.1 | 0.2 | GO:0048237 | rough endoplasmic reticulum lumen(GO:0048237) |
0.1 | 0.3 | GO:0031466 | Cul5-RING ubiquitin ligase complex(GO:0031466) |
0.1 | 0.1 | GO:0032279 | asymmetric synapse(GO:0032279) |
0.1 | 0.4 | GO:0032839 | dendrite cytoplasm(GO:0032839) |
0.1 | 0.1 | GO:0030893 | meiotic cohesin complex(GO:0030893) |
0.1 | 6.7 | GO:0043204 | perikaryon(GO:0043204) |
0.1 | 0.5 | GO:0016012 | sarcoglycan complex(GO:0016012) |
0.1 | 1.1 | GO:0043205 | fibril(GO:0043205) |
0.1 | 0.5 | GO:0098827 | endoplasmic reticulum subcompartment(GO:0098827) |
0.1 | 0.2 | GO:0034715 | pICln-Sm protein complex(GO:0034715) |
0.1 | 2.0 | GO:0031201 | SNARE complex(GO:0031201) |
0.1 | 0.6 | GO:0001931 | uropod(GO:0001931) cell trailing edge(GO:0031254) |
0.1 | 0.3 | GO:0000125 | PCAF complex(GO:0000125) |
0.1 | 0.3 | GO:0051286 | cell tip(GO:0051286) |
0.1 | 0.7 | GO:0031229 | integral component of nuclear inner membrane(GO:0005639) intrinsic component of nuclear inner membrane(GO:0031229) |
0.1 | 0.1 | GO:0032280 | symmetric synapse(GO:0032280) |
0.1 | 0.1 | GO:0008328 | ionotropic glutamate receptor complex(GO:0008328) neurotransmitter receptor complex(GO:0098878) |
0.1 | 3.9 | GO:0008021 | synaptic vesicle(GO:0008021) |
0.1 | 0.9 | GO:0000159 | protein phosphatase type 2A complex(GO:0000159) |
0.1 | 6.2 | GO:0098794 | postsynapse(GO:0098794) |
0.1 | 0.3 | GO:0090533 | cation-transporting ATPase complex(GO:0090533) |
0.1 | 8.2 | GO:0045211 | postsynaptic membrane(GO:0045211) |
0.1 | 0.7 | GO:0043240 | Fanconi anaemia nuclear complex(GO:0043240) |
0.1 | 0.5 | GO:0045275 | mitochondrial respiratory chain complex III(GO:0005750) respiratory chain complex III(GO:0045275) |
0.1 | 1.1 | GO:0036379 | striated muscle thin filament(GO:0005865) myofilament(GO:0036379) |
0.1 | 0.2 | GO:0071953 | elastic fiber(GO:0071953) |
0.1 | 0.2 | GO:0005785 | signal recognition particle receptor complex(GO:0005785) |
0.1 | 0.3 | GO:0060077 | inhibitory synapse(GO:0060077) |
0.1 | 0.3 | GO:0005663 | DNA replication factor C complex(GO:0005663) |
0.1 | 0.3 | GO:0071547 | piP-body(GO:0071547) |
0.1 | 0.1 | GO:0031261 | DNA replication preinitiation complex(GO:0031261) |
0.1 | 0.1 | GO:0016533 | cyclin-dependent protein kinase 5 holoenzyme complex(GO:0016533) |
0.1 | 0.3 | GO:0033588 | Elongator holoenzyme complex(GO:0033588) |
0.1 | 0.1 | GO:0043083 | synaptic cleft(GO:0043083) |
0.1 | 0.3 | GO:0046696 | lipopolysaccharide receptor complex(GO:0046696) |
0.1 | 0.2 | GO:0097449 | astrocyte projection(GO:0097449) |
0.1 | 0.1 | GO:0005879 | axonemal microtubule(GO:0005879) |
0.1 | 0.1 | GO:0016222 | procollagen-proline 4-dioxygenase complex(GO:0016222) |
0.0 | 0.5 | GO:0097440 | apical dendrite(GO:0097440) |
0.0 | 0.4 | GO:0036157 | outer dynein arm(GO:0036157) |
0.0 | 0.1 | GO:0008275 | gamma-tubulin small complex(GO:0008275) |
0.0 | 0.1 | GO:0035061 | interchromatin granule(GO:0035061) |
0.0 | 0.0 | GO:0031523 | Myb complex(GO:0031523) |
0.0 | 0.3 | GO:0000798 | nuclear cohesin complex(GO:0000798) |
0.0 | 0.1 | GO:0071256 | Sec61 translocon complex(GO:0005784) translocon complex(GO:0071256) |
0.0 | 0.1 | GO:0097487 | multivesicular body, internal vesicle(GO:0097487) |
0.0 | 0.7 | GO:0005665 | DNA-directed RNA polymerase II, core complex(GO:0005665) |
0.0 | 0.3 | GO:0000127 | transcription factor TFIIIC complex(GO:0000127) |
0.0 | 0.3 | GO:0042788 | polysomal ribosome(GO:0042788) |
0.0 | 0.1 | GO:0035985 | senescence-associated heterochromatin focus(GO:0035985) |
0.0 | 0.2 | GO:0035339 | SPOTS complex(GO:0035339) |
0.0 | 0.3 | GO:0031512 | motile primary cilium(GO:0031512) |
0.0 | 0.0 | GO:0070765 | gamma-secretase complex(GO:0070765) |
0.0 | 0.3 | GO:0070847 | core mediator complex(GO:0070847) |
0.0 | 0.3 | GO:0032045 | guanyl-nucleotide exchange factor complex(GO:0032045) |
0.0 | 0.7 | GO:0001741 | XY body(GO:0001741) |
0.0 | 0.6 | GO:0005662 | DNA replication factor A complex(GO:0005662) |
0.0 | 0.2 | GO:0098553 | integral component of cytoplasmic side of endoplasmic reticulum membrane(GO:0071458) integral component of lumenal side of endoplasmic reticulum membrane(GO:0071556) lumenal side of endoplasmic reticulum membrane(GO:0098553) lumenal side of membrane(GO:0098576) |
0.0 | 0.4 | GO:0000815 | ESCRT III complex(GO:0000815) |
0.0 | 0.1 | GO:0005658 | alpha DNA polymerase:primase complex(GO:0005658) |
0.0 | 0.1 | GO:0000811 | GINS complex(GO:0000811) |
0.0 | 0.2 | GO:0005947 | mitochondrial alpha-ketoglutarate dehydrogenase complex(GO:0005947) |
0.0 | 0.1 | GO:0005593 | FACIT collagen trimer(GO:0005593) |
0.0 | 0.1 | GO:0090576 | RNA polymerase III transcription factor complex(GO:0090576) |
0.0 | 0.1 | GO:0030289 | protein phosphatase 4 complex(GO:0030289) |
0.0 | 0.7 | GO:0008305 | integrin complex(GO:0008305) |
0.0 | 0.1 | GO:0031467 | Cul7-RING ubiquitin ligase complex(GO:0031467) |
0.0 | 0.6 | GO:0005922 | connexon complex(GO:0005922) |
0.0 | 0.2 | GO:0030008 | TRAPP complex(GO:0030008) |
0.0 | 0.1 | GO:0005687 | U4 snRNP(GO:0005687) |
0.0 | 0.1 | GO:0031313 | extrinsic component of endosome membrane(GO:0031313) |
0.0 | 0.1 | GO:0071817 | MMXD complex(GO:0071817) |
0.0 | 0.2 | GO:0000808 | origin recognition complex(GO:0000808) nuclear origin of replication recognition complex(GO:0005664) |
0.0 | 0.1 | GO:0071204 | histone pre-mRNA 3'end processing complex(GO:0071204) |
0.0 | 0.4 | GO:0043189 | NuA4 histone acetyltransferase complex(GO:0035267) H4/H2A histone acetyltransferase complex(GO:0043189) H4 histone acetyltransferase complex(GO:1902562) |
0.0 | 0.2 | GO:0019773 | proteasome core complex, alpha-subunit complex(GO:0019773) |
0.0 | 0.1 | GO:0033503 | HULC complex(GO:0033503) |
0.0 | 0.9 | GO:0043195 | terminal bouton(GO:0043195) |
0.0 | 0.1 | GO:0070531 | BRCA1-A complex(GO:0070531) |
0.0 | 0.0 | GO:0030981 | cortical microtubule cytoskeleton(GO:0030981) |
0.0 | 0.2 | GO:0002178 | palmitoyltransferase complex(GO:0002178) |
0.0 | 0.1 | GO:0070761 | pre-snoRNP complex(GO:0070761) |
0.0 | 0.2 | GO:0000124 | SAGA complex(GO:0000124) |
0.0 | 0.1 | GO:0031265 | CD95 death-inducing signaling complex(GO:0031265) |
0.0 | 0.1 | GO:0002177 | manchette(GO:0002177) |
0.0 | 0.0 | GO:0005955 | calcineurin complex(GO:0005955) |
0.0 | 0.1 | GO:0005956 | protein kinase CK2 complex(GO:0005956) |
0.0 | 2.2 | GO:0030016 | myofibril(GO:0030016) |
0.0 | 0.1 | GO:1990246 | uniplex complex(GO:1990246) |
0.0 | 0.2 | GO:0008074 | guanylate cyclase complex, soluble(GO:0008074) |
0.0 | 0.1 | GO:0031415 | NatA complex(GO:0031415) |
0.0 | 0.1 | GO:0034709 | methylosome(GO:0034709) |
0.0 | 0.1 | GO:0071797 | LUBAC complex(GO:0071797) |
0.0 | 0.0 | GO:0097513 | myosin II filament(GO:0097513) |
0.0 | 0.2 | GO:0005797 | Golgi medial cisterna(GO:0005797) |
0.0 | 0.1 | GO:0016461 | unconventional myosin complex(GO:0016461) |
0.0 | 0.1 | GO:0005796 | Golgi lumen(GO:0005796) |
0.0 | 0.1 | GO:0044666 | MLL3/4 complex(GO:0044666) |
0.0 | 0.2 | GO:0005671 | Ada2/Gcn5/Ada3 transcription activator complex(GO:0005671) |
0.0 | 0.1 | GO:0044615 | nuclear pore nuclear basket(GO:0044615) |
0.0 | 0.2 | GO:0030134 | ER to Golgi transport vesicle(GO:0030134) |
0.0 | 0.1 | GO:0032300 | mismatch repair complex(GO:0032300) |
0.0 | 0.1 | GO:0061700 | GATOR2 complex(GO:0061700) |
0.0 | 0.1 | GO:0031588 | nucleotide-activated protein kinase complex(GO:0031588) |
0.0 | 0.6 | GO:0030964 | mitochondrial respiratory chain complex I(GO:0005747) NADH dehydrogenase complex(GO:0030964) respiratory chain complex I(GO:0045271) |
0.0 | 0.1 | GO:0035363 | histone locus body(GO:0035363) |
0.0 | 0.1 | GO:0072669 | tRNA-splicing ligase complex(GO:0072669) |
0.0 | 0.1 | GO:0032039 | integrator complex(GO:0032039) |
0.0 | 0.1 | GO:0033180 | proton-transporting V-type ATPase, V1 domain(GO:0033180) |
0.0 | 0.2 | GO:0000145 | exocyst(GO:0000145) |
0.0 | 0.0 | GO:0030314 | junctional membrane complex(GO:0030314) |
0.0 | 0.0 | GO:0033553 | rDNA heterochromatin(GO:0033553) |
0.0 | 0.0 | GO:0005968 | Rab-protein geranylgeranyltransferase complex(GO:0005968) |
0.0 | 0.0 | GO:0071141 | SMAD protein complex(GO:0071141) |
0.0 | 0.1 | GO:0033017 | sarcoplasmic reticulum membrane(GO:0033017) |
0.0 | 0.0 | GO:0043293 | apoptosome(GO:0043293) |
0.0 | 0.0 | GO:0043511 | inhibin complex(GO:0043511) |
0.0 | 0.1 | GO:0035686 | sperm fibrous sheath(GO:0035686) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
1.7 | 5.0 | GO:0005519 | cytoskeletal regulatory protein binding(GO:0005519) |
1.2 | 3.5 | GO:0015186 | L-asparagine transmembrane transporter activity(GO:0015182) L-glutamine transmembrane transporter activity(GO:0015186) |
1.1 | 3.3 | GO:0061731 | ribonucleoside-diphosphate reductase activity, thioredoxin disulfide as acceptor(GO:0004748) oxidoreductase activity, acting on CH or CH2 groups, disulfide as acceptor(GO:0016728) ribonucleoside-diphosphate reductase activity(GO:0061731) |
0.9 | 3.5 | GO:0004449 | isocitrate dehydrogenase (NAD+) activity(GO:0004449) |
0.8 | 4.0 | GO:0003958 | NADPH-hemoprotein reductase activity(GO:0003958) |
0.8 | 2.3 | GO:0008449 | N-acetylglucosamine-6-sulfatase activity(GO:0008449) |
0.7 | 3.6 | GO:0003828 | alpha-N-acetylneuraminate alpha-2,8-sialyltransferase activity(GO:0003828) |
0.6 | 3.1 | GO:0086080 | protein binding involved in heterotypic cell-cell adhesion(GO:0086080) |
0.6 | 1.8 | GO:1990430 | extracellular matrix protein binding(GO:1990430) |
0.6 | 1.7 | GO:0035373 | chondroitin sulfate proteoglycan binding(GO:0035373) |
0.6 | 4.5 | GO:0008599 | protein phosphatase type 1 regulator activity(GO:0008599) |
0.5 | 1.6 | GO:0016508 | long-chain-enoyl-CoA hydratase activity(GO:0016508) |
0.5 | 2.6 | GO:0044323 | retinoic acid-responsive element binding(GO:0044323) |
0.5 | 2.3 | GO:0008294 | calcium- and calmodulin-responsive adenylate cyclase activity(GO:0008294) |
0.4 | 6.6 | GO:0016805 | dipeptidase activity(GO:0016805) |
0.4 | 1.7 | GO:0032051 | clathrin light chain binding(GO:0032051) |
0.4 | 1.6 | GO:0033192 | calmodulin-dependent protein phosphatase activity(GO:0033192) |
0.4 | 0.8 | GO:0038085 | vascular endothelial growth factor binding(GO:0038085) |
0.4 | 1.6 | GO:0031698 | beta-2 adrenergic receptor binding(GO:0031698) |
0.4 | 1.6 | GO:0031694 | alpha-2A adrenergic receptor binding(GO:0031694) |
0.4 | 6.1 | GO:0022841 | potassium ion leak channel activity(GO:0022841) |
0.4 | 1.2 | GO:0031852 | mu-type opioid receptor binding(GO:0031852) |
0.4 | 1.6 | GO:0050693 | LBD domain binding(GO:0050693) |
0.4 | 1.5 | GO:0038064 | collagen receptor activity(GO:0038064) |
0.4 | 1.1 | GO:0008475 | procollagen-lysine 5-dioxygenase activity(GO:0008475) |
0.4 | 3.3 | GO:0001091 | RNA polymerase II basal transcription factor binding(GO:0001091) |
0.3 | 4.5 | GO:0008574 | ATP-dependent microtubule motor activity, plus-end-directed(GO:0008574) |
0.3 | 1.0 | GO:0008597 | calcium-dependent protein serine/threonine phosphatase regulator activity(GO:0008597) |
0.3 | 1.3 | GO:0046923 | ER retention sequence binding(GO:0046923) |
0.3 | 1.9 | GO:0005005 | transmembrane-ephrin receptor activity(GO:0005005) |
0.3 | 6.5 | GO:0017075 | syntaxin-1 binding(GO:0017075) |
0.3 | 1.6 | GO:0015349 | thyroid hormone transmembrane transporter activity(GO:0015349) |
0.3 | 1.0 | GO:0035515 | oxidative RNA demethylase activity(GO:0035515) |
0.3 | 1.3 | GO:0005042 | netrin receptor activity(GO:0005042) |
0.3 | 0.9 | GO:0005148 | prolactin receptor binding(GO:0005148) |
0.3 | 2.4 | GO:0031995 | insulin-like growth factor II binding(GO:0031995) |
0.3 | 0.9 | GO:0004965 | G-protein coupled GABA receptor activity(GO:0004965) |
0.3 | 1.5 | GO:0004111 | creatine kinase activity(GO:0004111) |
0.3 | 1.7 | GO:0004673 | protein histidine kinase activity(GO:0004673) |
0.3 | 2.2 | GO:0004767 | sphingomyelin phosphodiesterase activity(GO:0004767) |
0.3 | 1.4 | GO:0086006 | voltage-gated sodium channel activity involved in cardiac muscle cell action potential(GO:0086006) |
0.3 | 1.4 | GO:0031628 | opioid receptor binding(GO:0031628) |
0.3 | 0.8 | GO:0005350 | purine nucleobase transmembrane transporter activity(GO:0005345) pyrimidine nucleobase transmembrane transporter activity(GO:0005350) nucleobase transmembrane transporter activity(GO:0015205) |
0.3 | 1.0 | GO:0035241 | protein-arginine omega-N monomethyltransferase activity(GO:0035241) |
0.3 | 0.8 | GO:0042392 | sphingosine-1-phosphate phosphatase activity(GO:0042392) |
0.3 | 2.0 | GO:0005237 | inhibitory extracellular ligand-gated ion channel activity(GO:0005237) |
0.2 | 2.7 | GO:0008331 | high voltage-gated calcium channel activity(GO:0008331) |
0.2 | 0.7 | GO:0070699 | type II activin receptor binding(GO:0070699) |
0.2 | 0.7 | GO:0070915 | lysophosphatidic acid receptor activity(GO:0070915) |
0.2 | 0.9 | GO:0070878 | primary miRNA binding(GO:0070878) |
0.2 | 0.7 | GO:0019797 | procollagen-proline 3-dioxygenase activity(GO:0019797) |
0.2 | 0.7 | GO:0016647 | oxidoreductase activity, acting on the CH-NH group of donors, oxygen as acceptor(GO:0016647) |
0.2 | 0.9 | GO:0030229 | very-low-density lipoprotein particle receptor activity(GO:0030229) |
0.2 | 0.2 | GO:0050816 | phosphothreonine binding(GO:0050816) |
0.2 | 0.9 | GO:0008486 | diphosphoinositol-polyphosphate diphosphatase activity(GO:0008486) |
0.2 | 0.7 | GO:0031708 | endothelin B receptor binding(GO:0031708) |
0.2 | 0.8 | GO:0008349 | MAP kinase kinase kinase kinase activity(GO:0008349) |
0.2 | 1.7 | GO:1990446 | U1 snRNP binding(GO:1990446) |
0.2 | 4.1 | GO:0005537 | mannose binding(GO:0005537) |
0.2 | 1.8 | GO:0008568 | microtubule-severing ATPase activity(GO:0008568) |
0.2 | 1.4 | GO:0005167 | neurotrophin TRK receptor binding(GO:0005167) |
0.2 | 2.8 | GO:0045295 | gamma-catenin binding(GO:0045295) |
0.2 | 0.8 | GO:0031957 | very long-chain fatty acid-CoA ligase activity(GO:0031957) |
0.2 | 1.5 | GO:0005068 | transmembrane receptor protein tyrosine kinase adaptor activity(GO:0005068) |
0.2 | 2.9 | GO:0030506 | ankyrin binding(GO:0030506) |
0.2 | 0.8 | GO:0008532 | N-acetyllactosaminide beta-1,3-N-acetylglucosaminyltransferase activity(GO:0008532) |
0.2 | 1.3 | GO:0002151 | G-quadruplex RNA binding(GO:0002151) |
0.2 | 0.9 | GO:0042609 | CD4 receptor binding(GO:0042609) |
0.2 | 0.9 | GO:0015185 | gamma-aminobutyric acid transmembrane transporter activity(GO:0015185) |
0.2 | 1.8 | GO:0031681 | G-protein beta-subunit binding(GO:0031681) |
0.2 | 4.9 | GO:0005104 | fibroblast growth factor receptor binding(GO:0005104) |
0.2 | 0.2 | GO:0042813 | Wnt-activated receptor activity(GO:0042813) |
0.2 | 0.9 | GO:0051185 | coenzyme transporter activity(GO:0051185) |
0.2 | 1.9 | GO:0005313 | L-glutamate transmembrane transporter activity(GO:0005313) |
0.2 | 0.7 | GO:0005030 | neurotrophin receptor activity(GO:0005030) |
0.2 | 0.7 | GO:0016286 | small conductance calcium-activated potassium channel activity(GO:0016286) |
0.2 | 0.5 | GO:0048101 | calcium- and calmodulin-regulated 3',5'-cyclic-GMP phosphodiesterase activity(GO:0048101) |
0.2 | 0.3 | GO:0010484 | H3 histone acetyltransferase activity(GO:0010484) |
0.2 | 0.6 | GO:0000403 | Y-form DNA binding(GO:0000403) |
0.2 | 0.5 | GO:0036042 | long-chain fatty acyl-CoA binding(GO:0036042) |
0.2 | 0.8 | GO:0004957 | prostaglandin E receptor activity(GO:0004957) |
0.2 | 0.5 | GO:0031800 | type 3 metabotropic glutamate receptor binding(GO:0031800) |
0.2 | 0.9 | GO:0046974 | histone methyltransferase activity (H3-K9 specific)(GO:0046974) |
0.2 | 0.3 | GO:0098632 | protein binding involved in cell-cell adhesion(GO:0098632) |
0.2 | 0.5 | GO:0008184 | glycogen phosphorylase activity(GO:0008184) |
0.2 | 0.6 | GO:0004897 | ciliary neurotrophic factor receptor activity(GO:0004897) |
0.1 | 0.6 | GO:0097493 | structural molecule activity conferring elasticity(GO:0097493) |
0.1 | 0.4 | GO:0008309 | double-stranded DNA exodeoxyribonuclease activity(GO:0008309) |
0.1 | 2.4 | GO:0004708 | MAP kinase kinase activity(GO:0004708) |
0.1 | 0.4 | GO:0004351 | glutamate decarboxylase activity(GO:0004351) |
0.1 | 2.2 | GO:0005248 | voltage-gated sodium channel activity(GO:0005248) voltage-gated ion channel activity involved in regulation of postsynaptic membrane potential(GO:1905030) |
0.1 | 0.4 | GO:0055100 | adiponectin binding(GO:0055100) |
0.1 | 1.7 | GO:0030159 | receptor signaling complex scaffold activity(GO:0030159) |
0.1 | 0.6 | GO:0005250 | A-type (transient outward) potassium channel activity(GO:0005250) |
0.1 | 1.3 | GO:0034865 | 3-oxo-2-(2'-pentenyl)cyclopentane-1-octanoic acid CoA ligase activity(GO:0010435) 3-isopropenyl-6-oxoheptanoyl-CoA synthetase activity(GO:0018854) 2-oxo-delta3-4,5,5-trimethylcyclopentenylacetyl-CoA synthetase activity(GO:0018855) benzoyl acetate-CoA ligase activity(GO:0018856) 2,4-dichlorobenzoate-CoA ligase activity(GO:0018857) pivalate-CoA ligase activity(GO:0034783) cyclopropanecarboxylate-CoA ligase activity(GO:0034793) adipate-CoA ligase activity(GO:0034796) citronellyl-CoA ligase activity(GO:0034823) mentha-1,3-dione-CoA ligase activity(GO:0034841) thiophene-2-carboxylate-CoA ligase activity(GO:0034842) 2,4,4-trimethylpentanoate-CoA ligase activity(GO:0034865) cis-2-methyl-5-isopropylhexa-2,5-dienoate-CoA ligase activity(GO:0034942) trans-2-methyl-5-isopropylhexa-2,5-dienoate-CoA ligase activity(GO:0034943) branched-chain acyl-CoA synthetase (ADP-forming) activity(GO:0043759) aryl-CoA synthetase (ADP-forming) activity(GO:0043762) 3-hydroxypropionyl-CoA synthetase activity(GO:0043955) perillic acid:CoA ligase (ADP-forming) activity(GO:0052685) perillic acid:CoA ligase (AMP-forming) activity(GO:0052686) (3R)-3-isopropenyl-6-oxoheptanoate:CoA ligase (ADP-forming) activity(GO:0052687) (3R)-3-isopropenyl-6-oxoheptanoate:CoA ligase (AMP-forming) activity(GO:0052688) pristanate-CoA ligase activity(GO:0070251) malonyl-CoA synthetase activity(GO:0090409) |
0.1 | 0.7 | GO:0008467 | [heparan sulfate]-glucosamine 3-sulfotransferase 1 activity(GO:0008467) |
0.1 | 2.3 | GO:0015026 | coreceptor activity(GO:0015026) |
0.1 | 2.2 | GO:0004012 | phospholipid-translocating ATPase activity(GO:0004012) |
0.1 | 0.8 | GO:0031419 | cobalamin binding(GO:0031419) |
0.1 | 0.4 | GO:0030158 | protein xylosyltransferase activity(GO:0030158) |
0.1 | 0.1 | GO:0070815 | peptidyl-lysine 5-dioxygenase activity(GO:0070815) |
0.1 | 3.3 | GO:0017147 | Wnt-protein binding(GO:0017147) |
0.1 | 0.4 | GO:0045504 | dynein heavy chain binding(GO:0045504) |
0.1 | 0.7 | GO:0048495 | Roundabout binding(GO:0048495) |
0.1 | 1.5 | GO:0043733 | alkylbase DNA N-glycosylase activity(GO:0003905) DNA-3-methylbase glycosylase activity(GO:0043733) |
0.1 | 1.5 | GO:0001223 | transcription coactivator binding(GO:0001223) |
0.1 | 0.8 | GO:0004931 | extracellular ATP-gated cation channel activity(GO:0004931) ATP-gated ion channel activity(GO:0035381) |
0.1 | 0.4 | GO:0031735 | CCR10 chemokine receptor binding(GO:0031735) |
0.1 | 0.1 | GO:0098634 | protein binding involved in cell-matrix adhesion(GO:0098634) |
0.1 | 4.6 | GO:0030971 | receptor tyrosine kinase binding(GO:0030971) |
0.1 | 1.6 | GO:0005545 | 1-phosphatidylinositol binding(GO:0005545) |
0.1 | 0.5 | GO:0030375 | thyroid hormone receptor coactivator activity(GO:0030375) |
0.1 | 0.7 | GO:0001588 | dopamine neurotransmitter receptor activity, coupled via Gs(GO:0001588) |
0.1 | 0.3 | GO:1901702 | urate transmembrane transporter activity(GO:0015143) salt transmembrane transporter activity(GO:1901702) |
0.1 | 0.8 | GO:0071933 | Arp2/3 complex binding(GO:0071933) |
0.1 | 0.7 | GO:0031821 | G-protein coupled serotonin receptor binding(GO:0031821) |
0.1 | 1.3 | GO:0015269 | calcium-activated potassium channel activity(GO:0015269) |
0.1 | 2.2 | GO:0030742 | GTP-dependent protein binding(GO:0030742) |
0.1 | 0.9 | GO:0008113 | peptide-methionine (S)-S-oxide reductase activity(GO:0008113) |
0.1 | 0.2 | GO:0042281 | dolichyl pyrophosphate Man9GlcNAc2 alpha-1,3-glucosyltransferase activity(GO:0042281) |
0.1 | 0.5 | GO:0070051 | fibrinogen binding(GO:0070051) |
0.1 | 2.1 | GO:0080025 | phosphatidylinositol-3,5-bisphosphate binding(GO:0080025) |
0.1 | 0.3 | GO:0005483 | soluble NSF attachment protein activity(GO:0005483) |
0.1 | 2.5 | GO:0071855 | neuropeptide receptor binding(GO:0071855) |
0.1 | 0.3 | GO:0016842 | amidine-lyase activity(GO:0016842) |
0.1 | 0.4 | GO:0005004 | GPI-linked ephrin receptor activity(GO:0005004) |
0.1 | 1.1 | GO:0005520 | insulin-like growth factor binding(GO:0005520) |
0.1 | 0.2 | GO:0051425 | PTB domain binding(GO:0051425) |
0.1 | 0.7 | GO:0001206 | transcriptional repressor activity, RNA polymerase II distal enhancer sequence-specific binding(GO:0001206) |
0.1 | 0.3 | GO:0047045 | testosterone 17-beta-dehydrogenase (NADP+) activity(GO:0047045) |
0.1 | 0.4 | GO:0050815 | phosphoserine binding(GO:0050815) |
0.1 | 1.7 | GO:0032266 | phosphatidylinositol-3-phosphate binding(GO:0032266) |
0.1 | 0.3 | GO:0050508 | glucuronosyl-N-acetylglucosaminyl-proteoglycan 4-alpha-N-acetylglucosaminyltransferase activity(GO:0050508) |
0.1 | 1.1 | GO:0016500 | protein-hormone receptor activity(GO:0016500) |
0.1 | 2.6 | GO:0017080 | sodium channel regulator activity(GO:0017080) |
0.1 | 0.9 | GO:0030898 | actin-dependent ATPase activity(GO:0030898) |
0.1 | 0.4 | GO:0017034 | Rap guanyl-nucleotide exchange factor activity(GO:0017034) |
0.1 | 0.3 | GO:0035242 | protein-arginine omega-N asymmetric methyltransferase activity(GO:0035242) |
0.1 | 1.7 | GO:0003785 | actin monomer binding(GO:0003785) |
0.1 | 2.3 | GO:0043015 | gamma-tubulin binding(GO:0043015) |
0.1 | 0.3 | GO:0004705 | JUN kinase activity(GO:0004705) SAP kinase activity(GO:0016909) |
0.1 | 0.3 | GO:0034562 | mono-butyltin dioxygenase activity(GO:0018586) tri-n-butyltin dioxygenase activity(GO:0018588) di-n-butyltin dioxygenase activity(GO:0018589) methylsilanetriol hydroxylase activity(GO:0018590) methyl tertiary butyl ether 3-monooxygenase activity(GO:0018591) 4-nitrocatechol 4-monooxygenase activity(GO:0018592) 4-chlorophenoxyacetate monooxygenase activity(GO:0018593) tert-butanol 2-monooxygenase activity(GO:0018594) alpha-pinene monooxygenase activity(GO:0018595) dimethylsilanediol hydroxylase activity(GO:0018596) ammonia monooxygenase activity(GO:0018597) hydroxymethylsilanetriol oxidase activity(GO:0018598) 2-hydroxyisobutyrate 3-monooxygenase activity(GO:0018599) alpha-pinene dehydrogenase activity(GO:0018600) bisphenol A hydroxylase B activity(GO:0034559) 2,2-bis(4-hydroxyphenyl)-1-propanol hydroxylase activity(GO:0034562) 9-fluorenone-3,4-dioxygenase activity(GO:0034786) anthracene 9,10-dioxygenase activity(GO:0034816) 2-(methylthio)benzothiazole monooxygenase activity(GO:0034857) 2-hydroxybenzothiazole monooxygenase activity(GO:0034858) benzothiazole monooxygenase activity(GO:0034859) 2,6-dihydroxybenzothiazole monooxygenase activity(GO:0034862) pinacolone 5-monooxygenase activity(GO:0034870) thioacetamide S-oxygenase activity(GO:0034873) thioacetamide S-oxide S-oxygenase activity(GO:0034874) endosulfan monooxygenase I activity(GO:0034888) N-nitrodimethylamine hydroxylase activity(GO:0034893) 4-(1-ethyl-1,4-dimethyl-pentyl)phenol monoxygenase activity(GO:0034897) endosulfan ether monooxygenase activity(GO:0034903) pyrene 4,5-monooxygenase activity(GO:0034925) pyrene 1,2-monooxygenase activity(GO:0034927) 1-hydroxypyrene 6,7-monooxygenase activity(GO:0034928) 1-hydroxypyrene 7,8-monooxygenase activity(GO:0034929) phenylboronic acid monooxygenase activity(GO:0034950) spheroidene monooxygenase activity(GO:0043823) |
0.1 | 0.3 | GO:0030144 | alpha-1,6-mannosylglycoprotein 6-beta-N-acetylglucosaminyltransferase activity(GO:0030144) |
0.1 | 0.2 | GO:0038132 | neuregulin binding(GO:0038132) |
0.1 | 0.3 | GO:0004505 | phenylalanine 4-monooxygenase activity(GO:0004505) |
0.1 | 0.7 | GO:0048027 | mRNA 5'-UTR binding(GO:0048027) |
0.1 | 2.2 | GO:0005245 | voltage-gated calcium channel activity(GO:0005245) |
0.1 | 0.8 | GO:0034450 | ubiquitin-ubiquitin ligase activity(GO:0034450) |
0.1 | 0.7 | GO:0050321 | tau-protein kinase activity(GO:0050321) |
0.1 | 0.2 | GO:0003726 | double-stranded RNA adenosine deaminase activity(GO:0003726) |
0.1 | 0.2 | GO:0016941 | natriuretic peptide receptor activity(GO:0016941) |
0.1 | 0.4 | GO:0035671 | enone reductase activity(GO:0035671) |
0.1 | 0.4 | GO:0015450 | P-P-bond-hydrolysis-driven protein transmembrane transporter activity(GO:0015450) |
0.1 | 0.4 | GO:0004994 | somatostatin receptor activity(GO:0004994) |
0.1 | 2.1 | GO:0043548 | phosphatidylinositol 3-kinase binding(GO:0043548) |
0.1 | 0.4 | GO:0004791 | thioredoxin-disulfide reductase activity(GO:0004791) |
0.1 | 0.4 | GO:0003857 | 3-hydroxyacyl-CoA dehydrogenase activity(GO:0003857) |
0.1 | 0.1 | GO:0044020 | histone methyltransferase activity (H4-R3 specific)(GO:0044020) |
0.1 | 0.3 | GO:1904288 | BAT3 complex binding(GO:1904288) |
0.1 | 1.0 | GO:0015643 | toxic substance binding(GO:0015643) |
0.1 | 0.4 | GO:0004690 | cyclic nucleotide-dependent protein kinase activity(GO:0004690) |
0.1 | 0.2 | GO:0015173 | aromatic amino acid transmembrane transporter activity(GO:0015173) |
0.1 | 0.7 | GO:0008093 | cytoskeletal adaptor activity(GO:0008093) |
0.1 | 0.3 | GO:0017162 | aryl hydrocarbon receptor binding(GO:0017162) |
0.1 | 0.6 | GO:0035174 | histone serine kinase activity(GO:0035174) |
0.1 | 0.5 | GO:0008239 | dipeptidyl-peptidase activity(GO:0008239) |
0.1 | 0.2 | GO:0000146 | microfilament motor activity(GO:0000146) |
0.1 | 0.9 | GO:0070006 | metalloaminopeptidase activity(GO:0070006) |
0.1 | 0.6 | GO:0017166 | vinculin binding(GO:0017166) |
0.1 | 1.5 | GO:0030507 | spectrin binding(GO:0030507) |
0.1 | 0.2 | GO:1990188 | euchromatin binding(GO:1990188) |
0.1 | 0.8 | GO:0001161 | intronic transcription regulatory region sequence-specific DNA binding(GO:0001161) |
0.1 | 2.2 | GO:0005484 | SNAP receptor activity(GO:0005484) |
0.1 | 0.8 | GO:0005523 | tropomyosin binding(GO:0005523) |
0.1 | 0.5 | GO:0103116 | alpha-D-galactofuranose transporter activity(GO:0103116) |
0.1 | 0.8 | GO:0004707 | MAP kinase activity(GO:0004707) |
0.1 | 0.3 | GO:0102344 | 3-hydroxyacyl-CoA dehydratase activity(GO:0018812) 3-hydroxy-behenoyl-CoA dehydratase activity(GO:0102344) 3-hydroxy-lignoceroyl-CoA dehydratase activity(GO:0102345) |
0.1 | 0.6 | GO:0015922 | aspartate oxidase activity(GO:0015922) |
0.1 | 0.6 | GO:0001972 | retinoic acid binding(GO:0001972) |
0.1 | 1.1 | GO:0051393 | alpha-actinin binding(GO:0051393) |
0.1 | 0.2 | GO:0005502 | 11-cis retinal binding(GO:0005502) |
0.1 | 3.7 | GO:0008013 | beta-catenin binding(GO:0008013) |
0.1 | 0.8 | GO:0055106 | ubiquitin-protein transferase regulator activity(GO:0055106) |
0.1 | 0.3 | GO:0000268 | peroxisome targeting sequence binding(GO:0000268) |
0.1 | 0.2 | GO:0042284 | sphingolipid delta-4 desaturase activity(GO:0042284) |
0.1 | 0.3 | GO:0047499 | calcium-independent phospholipase A2 activity(GO:0047499) |
0.1 | 0.2 | GO:0005173 | stem cell factor receptor binding(GO:0005173) |
0.1 | 0.2 | GO:0005119 | smoothened binding(GO:0005119) |
0.1 | 1.1 | GO:0004890 | GABA-A receptor activity(GO:0004890) GABA receptor activity(GO:0016917) |
0.1 | 0.4 | GO:1990405 | protein antigen binding(GO:1990405) |
0.1 | 0.3 | GO:0004758 | serine C-palmitoyltransferase activity(GO:0004758) |
0.1 | 0.4 | GO:0032184 | SUMO polymer binding(GO:0032184) |
0.1 | 0.8 | GO:0035198 | miRNA binding(GO:0035198) |
0.1 | 0.2 | GO:0050833 | pyruvate transmembrane transporter activity(GO:0050833) |
0.1 | 0.5 | GO:0097153 | cysteine-type endopeptidase activity involved in apoptotic process(GO:0097153) |
0.1 | 0.4 | GO:0008121 | ubiquinol-cytochrome-c reductase activity(GO:0008121) oxidoreductase activity, acting on diphenols and related substances as donors, cytochrome as acceptor(GO:0016681) |
0.1 | 2.3 | GO:0017022 | myosin binding(GO:0017022) |
0.1 | 0.2 | GO:0015526 | hexose phosphate transmembrane transporter activity(GO:0015119) organophosphate:inorganic phosphate antiporter activity(GO:0015315) hexose-phosphate:inorganic phosphate antiporter activity(GO:0015526) glucose 6-phosphate:inorganic phosphate antiporter activity(GO:0061513) |
0.1 | 1.6 | GO:0016655 | oxidoreductase activity, acting on NAD(P)H, quinone or similar compound as acceptor(GO:0016655) |
0.1 | 0.2 | GO:0001642 | group III metabotropic glutamate receptor activity(GO:0001642) |
0.1 | 0.2 | GO:1901611 | phosphatidylglycerol binding(GO:1901611) |
0.1 | 2.4 | GO:0005200 | structural constituent of cytoskeleton(GO:0005200) |
0.1 | 0.2 | GO:0004985 | opioid receptor activity(GO:0004985) |
0.1 | 0.2 | GO:0004937 | alpha1-adrenergic receptor activity(GO:0004937) |
0.1 | 2.9 | GO:0005518 | collagen binding(GO:0005518) |
0.1 | 0.7 | GO:0042608 | T cell receptor binding(GO:0042608) |
0.1 | 0.1 | GO:0046921 | alpha-(1->6)-fucosyltransferase activity(GO:0046921) |
0.1 | 0.2 | GO:0043546 | molybdopterin cofactor binding(GO:0043546) |
0.1 | 0.3 | GO:0001665 | alpha-N-acetylgalactosaminide alpha-2,6-sialyltransferase activity(GO:0001665) |
0.1 | 0.1 | GO:0004699 | calcium-independent protein kinase C activity(GO:0004699) |
0.1 | 0.2 | GO:0008310 | single-stranded DNA 3'-5' exodeoxyribonuclease activity(GO:0008310) |
0.1 | 0.5 | GO:0001055 | RNA polymerase II activity(GO:0001055) |
0.1 | 1.7 | GO:0048365 | Rac GTPase binding(GO:0048365) |
0.1 | 0.3 | GO:0015165 | pyrimidine nucleotide-sugar transmembrane transporter activity(GO:0015165) |
0.1 | 0.2 | GO:0047192 | 1-alkylglycerophosphocholine O-acetyltransferase activity(GO:0047192) |
0.1 | 0.2 | GO:0035529 | NADH pyrophosphatase activity(GO:0035529) |
0.1 | 0.2 | GO:0016018 | cyclosporin A binding(GO:0016018) |
0.0 | 0.1 | GO:0005087 | Ran guanyl-nucleotide exchange factor activity(GO:0005087) |
0.0 | 0.4 | GO:0048407 | platelet-derived growth factor binding(GO:0048407) |
0.0 | 1.3 | GO:0005109 | frizzled binding(GO:0005109) |
0.0 | 0.1 | GO:0000340 | RNA 7-methylguanosine cap binding(GO:0000340) |
0.0 | 0.6 | GO:0005243 | gap junction channel activity(GO:0005243) |
0.0 | 0.1 | GO:0004663 | Rab geranylgeranyltransferase activity(GO:0004663) |
0.0 | 0.1 | GO:0004359 | glutaminase activity(GO:0004359) |
0.0 | 0.1 | GO:0008240 | tripeptidyl-peptidase activity(GO:0008240) |
0.0 | 1.2 | GO:0005546 | phosphatidylinositol-4,5-bisphosphate binding(GO:0005546) |
0.0 | 0.1 | GO:0016774 | phosphotransferase activity, carboxyl group as acceptor(GO:0016774) |
0.0 | 0.2 | GO:0008526 | phosphatidylinositol transporter activity(GO:0008526) |
0.0 | 0.2 | GO:0061665 | SUMO ligase activity(GO:0061665) |
0.0 | 0.3 | GO:0016308 | 1-phosphatidylinositol-4-phosphate 5-kinase activity(GO:0016308) |
0.0 | 0.1 | GO:0070326 | very-low-density lipoprotein particle receptor binding(GO:0070326) |
0.0 | 0.0 | GO:0035727 | lysophosphatidic acid binding(GO:0035727) |
0.0 | 0.2 | GO:1990380 | Lys48-specific deubiquitinase activity(GO:1990380) |
0.0 | 0.2 | GO:0097001 | ceramide binding(GO:0097001) |
0.0 | 1.8 | GO:0044824 | integrase activity(GO:0008907) T/G mismatch-specific endonuclease activity(GO:0043765) retroviral integrase activity(GO:0044823) retroviral 3' processing activity(GO:0044824) |
0.0 | 0.1 | GO:0008073 | ornithine decarboxylase inhibitor activity(GO:0008073) |
0.0 | 0.3 | GO:0031545 | peptidyl-proline 4-dioxygenase activity(GO:0031545) |
0.0 | 0.3 | GO:0005452 | inorganic anion exchanger activity(GO:0005452) |
0.0 | 0.1 | GO:0003987 | acetate-CoA ligase activity(GO:0003987) |
0.0 | 0.1 | GO:0004035 | alkaline phosphatase activity(GO:0004035) |
0.0 | 0.1 | GO:0033829 | O-fucosylpeptide 3-beta-N-acetylglucosaminyltransferase activity(GO:0033829) |
0.0 | 0.3 | GO:0009881 | photoreceptor activity(GO:0009881) |
0.0 | 1.0 | GO:0005201 | extracellular matrix structural constituent(GO:0005201) |
0.0 | 0.9 | GO:0018602 | sulfonate dioxygenase activity(GO:0000907) 2,4-dichlorophenoxyacetate alpha-ketoglutarate dioxygenase activity(GO:0018602) hypophosphite dioxygenase activity(GO:0034792) gibberellin 2-beta-dioxygenase activity(GO:0045543) C-19 gibberellin 2-beta-dioxygenase activity(GO:0052634) C-20 gibberellin 2-beta-dioxygenase activity(GO:0052635) |
0.0 | 0.1 | GO:0031014 | troponin T binding(GO:0031014) |
0.0 | 0.1 | GO:0004698 | calcium-dependent protein kinase C activity(GO:0004698) |
0.0 | 0.2 | GO:0030346 | protein phosphatase 2B binding(GO:0030346) |
0.0 | 0.1 | GO:0016176 | superoxide-generating NADPH oxidase activator activity(GO:0016176) |
0.0 | 0.8 | GO:0008330 | protein tyrosine/threonine phosphatase activity(GO:0008330) |
0.0 | 0.1 | GO:0004127 | cytidylate kinase activity(GO:0004127) |
0.0 | 0.6 | GO:0005112 | Notch binding(GO:0005112) |
0.0 | 0.4 | GO:0008601 | protein phosphatase type 2A regulator activity(GO:0008601) |
0.0 | 0.0 | GO:0043208 | glycosphingolipid binding(GO:0043208) |
0.0 | 3.8 | GO:0050839 | cell adhesion molecule binding(GO:0050839) |
0.0 | 0.1 | GO:0004946 | bombesin receptor activity(GO:0004946) |
0.0 | 0.3 | GO:0031005 | filamin binding(GO:0031005) |
0.0 | 0.1 | GO:0042289 | MHC class II protein binding(GO:0042289) |
0.0 | 0.1 | GO:0005095 | GTPase inhibitor activity(GO:0005095) |
0.0 | 0.1 | GO:0031127 | galactoside 2-alpha-L-fucosyltransferase activity(GO:0008107) alpha-(1,2)-fucosyltransferase activity(GO:0031127) |
0.0 | 0.7 | GO:0005212 | structural constituent of eye lens(GO:0005212) |
0.0 | 0.1 | GO:0003917 | DNA topoisomerase type I activity(GO:0003917) |
0.0 | 0.2 | GO:0004955 | prostaglandin receptor activity(GO:0004955) |
0.0 | 0.1 | GO:0035877 | death effector domain binding(GO:0035877) |
0.0 | 0.3 | GO:0003796 | lysozyme activity(GO:0003796) |
0.0 | 0.7 | GO:0005154 | epidermal growth factor receptor binding(GO:0005154) |
0.0 | 0.5 | GO:0005086 | ARF guanyl-nucleotide exchange factor activity(GO:0005086) |
0.0 | 0.1 | GO:0034711 | inhibin binding(GO:0034711) |
0.0 | 0.1 | GO:0046573 | lactonohydrolase activity(GO:0046573) acyl-L-homoserine-lactone lactonohydrolase activity(GO:0102007) |
0.0 | 0.1 | GO:0004802 | transketolase activity(GO:0004802) |
0.0 | 0.0 | GO:0030899 | calcium-dependent ATPase activity(GO:0030899) |
0.0 | 0.1 | GO:0004300 | enoyl-CoA hydratase activity(GO:0004300) |
0.0 | 0.6 | GO:0004190 | aspartic-type endopeptidase activity(GO:0004190) aspartic-type peptidase activity(GO:0070001) |
0.0 | 0.1 | GO:0098519 | nucleotide phosphatase activity, acting on free nucleotides(GO:0098519) |
0.0 | 0.6 | GO:0015347 | sodium-independent organic anion transmembrane transporter activity(GO:0015347) |
0.0 | 0.0 | GO:0030943 | mitochondrion targeting sequence binding(GO:0030943) |
0.0 | 0.3 | GO:0031210 | phosphatidylcholine binding(GO:0031210) |
0.0 | 1.8 | GO:0035250 | UDP-galactosyltransferase activity(GO:0035250) |
0.0 | 0.2 | GO:0016615 | malate dehydrogenase activity(GO:0016615) |
0.0 | 0.3 | GO:0070742 | C2H2 zinc finger domain binding(GO:0070742) |
0.0 | 0.2 | GO:0016918 | retinal binding(GO:0016918) |
0.0 | 0.1 | GO:0070905 | serine binding(GO:0070905) |
0.0 | 0.2 | GO:0033170 | DNA clamp loader activity(GO:0003689) protein-DNA loading ATPase activity(GO:0033170) |
0.0 | 0.1 | GO:0019153 | protein-disulfide reductase (glutathione) activity(GO:0019153) |
0.0 | 0.1 | GO:0005113 | patched binding(GO:0005113) |
0.0 | 0.4 | GO:0004435 | phosphatidylinositol phospholipase C activity(GO:0004435) |
0.0 | 0.1 | GO:1990050 | phosphatidic acid transporter activity(GO:1990050) |
0.0 | 0.0 | GO:0030280 | structural constituent of epidermis(GO:0030280) |
0.0 | 0.1 | GO:0070273 | phosphatidylinositol-4-phosphate binding(GO:0070273) |
0.0 | 0.5 | GO:0071837 | HMG box domain binding(GO:0071837) |
0.0 | 0.6 | GO:0001540 | beta-amyloid binding(GO:0001540) |
0.0 | 1.4 | GO:0005089 | Rho guanyl-nucleotide exchange factor activity(GO:0005089) |
0.0 | 0.2 | GO:0016857 | racemase and epimerase activity, acting on carbohydrates and derivatives(GO:0016857) |
0.0 | 0.1 | GO:0016530 | metallochaperone activity(GO:0016530) |
0.0 | 0.1 | GO:0004558 | alpha-1,4-glucosidase activity(GO:0004558) |
0.0 | 0.0 | GO:0008417 | fucosyltransferase activity(GO:0008417) |
0.0 | 0.6 | GO:0005251 | delayed rectifier potassium channel activity(GO:0005251) |
0.0 | 0.1 | GO:1990226 | histone methyltransferase binding(GO:1990226) |
0.0 | 0.0 | GO:0004528 | phosphodiesterase I activity(GO:0004528) |
0.0 | 0.2 | GO:0004983 | neuropeptide Y receptor activity(GO:0004983) |
0.0 | 0.2 | GO:0001135 | transcription factor activity, RNA polymerase II transcription factor recruiting(GO:0001135) |
0.0 | 0.2 | GO:0016861 | intramolecular oxidoreductase activity, interconverting aldoses and ketoses(GO:0016861) |
0.0 | 0.1 | GO:0047961 | glycine N-acyltransferase activity(GO:0047961) |
0.0 | 0.0 | GO:0048408 | epidermal growth factor binding(GO:0048408) |
0.0 | 0.1 | GO:0003708 | retinoic acid receptor activity(GO:0003708) |
0.0 | 0.0 | GO:0033142 | progesterone receptor binding(GO:0033142) |
0.0 | 0.1 | GO:0015277 | kainate selective glutamate receptor activity(GO:0015277) |
0.0 | 0.1 | GO:0043515 | kinetochore binding(GO:0043515) |
0.0 | 0.1 | GO:0004982 | N-formyl peptide receptor activity(GO:0004982) |
0.0 | 0.8 | GO:0080131 | N-acetylglucosamine 6-O-sulfotransferase activity(GO:0001517) heparan sulfate 2-O-sulfotransferase activity(GO:0004394) HNK-1 sulfotransferase activity(GO:0016232) heparan sulfate 6-O-sulfotransferase activity(GO:0017095) trans-9R,10R-dihydrodiolphenanthrene sulfotransferase activity(GO:0018721) 1-phenanthrol sulfotransferase activity(GO:0018722) 3-phenanthrol sulfotransferase activity(GO:0018723) 4-phenanthrol sulfotransferase activity(GO:0018724) trans-3,4-dihydrodiolphenanthrene sulfotransferase activity(GO:0018725) 9-phenanthrol sulfotransferase activity(GO:0018726) 2-phenanthrol sulfotransferase activity(GO:0018727) phenanthrol sulfotransferase activity(GO:0019111) 1-hydroxypyrene sulfotransferase activity(GO:0034930) proteoglycan sulfotransferase activity(GO:0050698) cholesterol sulfotransferase activity(GO:0051922) hydroxyjasmonate sulfotransferase activity(GO:0080131) |
0.0 | 0.1 | GO:0005391 | sodium:potassium-exchanging ATPase activity(GO:0005391) |
0.0 | 0.2 | GO:0050750 | low-density lipoprotein particle receptor binding(GO:0050750) |
0.0 | 0.0 | GO:0033300 | dehydroascorbic acid transporter activity(GO:0033300) |
0.0 | 0.1 | GO:0071723 | lipopeptide binding(GO:0071723) |
0.0 | 0.1 | GO:0045545 | syndecan binding(GO:0045545) |
0.0 | 0.2 | GO:0001730 | 2'-5'-oligoadenylate synthetase activity(GO:0001730) |
0.0 | 0.2 | GO:0042301 | phosphate ion binding(GO:0042301) |
0.0 | 0.1 | GO:0016019 | N-acetylmuramoyl-L-alanine amidase activity(GO:0008745) peptidoglycan receptor activity(GO:0016019) |
0.0 | 0.1 | GO:0034056 | estrogen response element binding(GO:0034056) |
0.0 | 0.0 | GO:0008046 | axon guidance receptor activity(GO:0008046) |
0.0 | 0.1 | GO:0030274 | LIM domain binding(GO:0030274) |
0.0 | 0.1 | GO:0004594 | pantothenate kinase activity(GO:0004594) |
0.0 | 0.3 | GO:0015149 | glucose transmembrane transporter activity(GO:0005355) hexose transmembrane transporter activity(GO:0015149) |
0.0 | 0.1 | GO:0001075 | transcription factor activity, RNA polymerase II core promoter sequence-specific binding involved in preinitiation complex assembly(GO:0001075) |
0.0 | 0.2 | GO:0034979 | histone deacetylase activity (H3-K14 specific)(GO:0031078) NAD-dependent histone deacetylase activity (H3-K14 specific)(GO:0032041) NAD-dependent protein deacetylase activity(GO:0034979) |
0.0 | 0.1 | GO:0015467 | G-protein activated inward rectifier potassium channel activity(GO:0015467) |
0.0 | 0.1 | GO:0003906 | DNA-(apurinic or apyrimidinic site) lyase activity(GO:0003906) |
0.0 | 0.4 | GO:0001106 | RNA polymerase II transcription corepressor activity(GO:0001106) |
0.0 | 0.2 | GO:0016624 | oxidoreductase activity, acting on the aldehyde or oxo group of donors, disulfide as acceptor(GO:0016624) |
0.0 | 0.0 | GO:0035662 | Toll-like receptor 4 binding(GO:0035662) |
0.0 | 0.0 | GO:0001226 | RNA polymerase II transcription cofactor binding(GO:0001224) RNA polymerase II transcription corepressor binding(GO:0001226) |
0.0 | 0.1 | GO:0015226 | amino-acid betaine transmembrane transporter activity(GO:0015199) carnitine transmembrane transporter activity(GO:0015226) |
0.0 | 0.1 | GO:0016421 | CoA carboxylase activity(GO:0016421) |
0.0 | 0.1 | GO:0015562 | efflux transmembrane transporter activity(GO:0015562) |
0.0 | 0.2 | GO:0008195 | phosphatidate phosphatase activity(GO:0008195) |
0.0 | 0.0 | GO:0051377 | mannose-ethanolamine phosphotransferase activity(GO:0051377) |
0.0 | 0.1 | GO:0047631 | ADP-ribose diphosphatase activity(GO:0047631) |
0.0 | 0.2 | GO:0016922 | ligand-dependent nuclear receptor binding(GO:0016922) |
0.0 | 0.0 | GO:0032356 | oxidized DNA binding(GO:0032356) oxidized purine DNA binding(GO:0032357) |
0.0 | 0.1 | GO:0043008 | ATP-dependent protein binding(GO:0043008) |
0.0 | 0.1 | GO:0016854 | racemase and epimerase activity(GO:0016854) |
0.0 | 0.1 | GO:0070403 | NAD+ binding(GO:0070403) |
0.0 | 0.0 | GO:0004800 | thyroxine 5'-deiodinase activity(GO:0004800) |
0.0 | 0.1 | GO:1990254 | keratin filament binding(GO:1990254) |
0.0 | 0.1 | GO:0008420 | CTD phosphatase activity(GO:0008420) |
0.0 | 0.0 | GO:0005219 | ryanodine-sensitive calcium-release channel activity(GO:0005219) calcium-induced calcium release activity(GO:0048763) |
0.0 | 0.0 | GO:0071253 | connexin binding(GO:0071253) |
0.0 | 0.0 | GO:0005347 | ATP transmembrane transporter activity(GO:0005347) |
0.0 | 0.1 | GO:0004974 | leukotriene receptor activity(GO:0004974) |
0.0 | 0.1 | GO:0035197 | siRNA binding(GO:0035197) |
0.0 | 0.1 | GO:0004661 | protein geranylgeranyltransferase activity(GO:0004661) |
0.0 | 0.4 | GO:0015485 | cholesterol binding(GO:0015485) |
0.0 | 2.4 | GO:0015631 | tubulin binding(GO:0015631) |
0.0 | 0.1 | GO:0035497 | cAMP response element binding(GO:0035497) |
0.0 | 0.1 | GO:0004468 | lysine N-acetyltransferase activity, acting on acetyl phosphate as donor(GO:0004468) |
0.0 | 0.1 | GO:0070513 | death domain binding(GO:0070513) |
0.0 | 0.0 | GO:0004013 | adenosylhomocysteinase activity(GO:0004013) trialkylsulfonium hydrolase activity(GO:0016802) |
0.0 | 0.1 | GO:0004499 | N,N-dimethylaniline monooxygenase activity(GO:0004499) |
0.0 | 0.0 | GO:0034190 | apolipoprotein receptor binding(GO:0034190) apolipoprotein A-I receptor binding(GO:0034191) |
0.0 | 0.0 | GO:0097016 | L27 domain binding(GO:0097016) |
0.0 | 0.0 | GO:0008131 | primary amine oxidase activity(GO:0008131) |
0.0 | 0.0 | GO:0048273 | mitogen-activated protein kinase p38 binding(GO:0048273) |
0.0 | 0.0 | GO:0016833 | oxo-acid-lyase activity(GO:0016833) |
0.0 | 0.0 | GO:0070579 | methylcytosine dioxygenase activity(GO:0070579) |
0.0 | 0.0 | GO:0015145 | monosaccharide transmembrane transporter activity(GO:0015145) |
0.0 | 0.1 | GO:0043422 | protein kinase B binding(GO:0043422) |
0.0 | 0.1 | GO:0004000 | adenosine deaminase activity(GO:0004000) |
0.0 | 0.0 | GO:0035184 | histone threonine kinase activity(GO:0035184) |
0.0 | 0.0 | GO:0004366 | glycerol-3-phosphate O-acyltransferase activity(GO:0004366) |
0.0 | 0.1 | GO:0047760 | butyrate-CoA ligase activity(GO:0047760) |
0.0 | 0.1 | GO:0004865 | protein serine/threonine phosphatase inhibitor activity(GO:0004865) |
0.0 | 0.1 | GO:0008508 | bile acid:sodium symporter activity(GO:0008508) |
0.0 | 0.0 | GO:0004667 | prostaglandin-D synthase activity(GO:0004667) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.3 | 9.1 | PID REELIN PATHWAY | Reelin signaling pathway |
0.2 | 5.7 | PID NETRIN PATHWAY | Netrin-mediated signaling events |
0.2 | 2.1 | PID NEPHRIN NEPH1 PATHWAY | Nephrin/Neph1 signaling in the kidney podocyte |
0.2 | 1.3 | PID FOXO PATHWAY | FoxO family signaling |
0.2 | 0.4 | PID P38 MK2 PATHWAY | p38 signaling mediated by MAPKAP kinases |
0.2 | 2.3 | PID SYNDECAN 3 PATHWAY | Syndecan-3-mediated signaling events |
0.2 | 3.0 | PID AR NONGENOMIC PATHWAY | Nongenotropic Androgen signaling |
0.1 | 0.4 | PID WNT NONCANONICAL PATHWAY | Noncanonical Wnt signaling pathway |
0.1 | 6.4 | PID TRKR PATHWAY | Neurotrophic factor-mediated Trk receptor signaling |
0.1 | 0.7 | PID VEGF VEGFR PATHWAY | VEGF and VEGFR signaling network |
0.1 | 2.0 | PID HEDGEHOG 2PATHWAY | Signaling events mediated by the Hedgehog family |
0.1 | 1.7 | PID LPA4 PATHWAY | LPA4-mediated signaling events |
0.1 | 1.7 | PID EPHRINB REV PATHWAY | Ephrin B reverse signaling |
0.1 | 0.1 | PID INTEGRIN5 PATHWAY | Beta5 beta6 beta7 and beta8 integrin cell surface interactions |
0.1 | 3.2 | ST WNT BETA CATENIN PATHWAY | Wnt/beta-catenin Pathway |
0.1 | 0.8 | PID GLYPICAN 1PATHWAY | Glypican 1 network |
0.1 | 0.9 | ST GA12 PATHWAY | G alpha 12 Pathway |
0.1 | 0.3 | SA PROGRAMMED CELL DEATH | Programmed cell death, or apoptosis, eliminates damaged or unneeded cells. |
0.1 | 0.5 | PID RAC1 REG PATHWAY | Regulation of RAC1 activity |
0.1 | 1.3 | PID ERBB4 PATHWAY | ErbB4 signaling events |
0.1 | 2.1 | PID P38 ALPHA BETA PATHWAY | Regulation of p38-alpha and p38-beta |
0.1 | 1.9 | PID TGFBR PATHWAY | TGF-beta receptor signaling |
0.1 | 1.6 | PID KIT PATHWAY | Signaling events mediated by Stem cell factor receptor (c-Kit) |
0.1 | 4.7 | PID BETA CATENIN NUC PATHWAY | Regulation of nuclear beta catenin signaling and target gene transcription |
0.1 | 2.2 | PID LKB1 PATHWAY | LKB1 signaling events |
0.1 | 0.1 | PID NFKAPPAB CANONICAL PATHWAY | Canonical NF-kappaB pathway |
0.1 | 0.4 | SA G1 AND S PHASES | Cdk2, 4, and 6 bind cyclin D in G1, while cdk2/cyclin E promotes the G1/S transition. |
0.0 | 0.9 | PID ARF 3PATHWAY | Arf1 pathway |
0.0 | 0.5 | ST JNK MAPK PATHWAY | JNK MAPK Pathway |
0.0 | 0.4 | PID HIV NEF PATHWAY | HIV-1 Nef: Negative effector of Fas and TNF-alpha |
0.0 | 2.0 | PID NOTCH PATHWAY | Notch signaling pathway |
0.0 | 0.4 | PID EPHA FWDPATHWAY | EPHA forward signaling |
0.0 | 2.1 | PID TCR PATHWAY | TCR signaling in naïve CD4+ T cells |
0.0 | 0.1 | PID TCR RAS PATHWAY | Ras signaling in the CD4+ TCR pathway |
0.0 | 1.0 | PID PTP1B PATHWAY | Signaling events mediated by PTP1B |
0.0 | 1.6 | PID ATR PATHWAY | ATR signaling pathway |
0.0 | 0.3 | PID NFAT TFPATHWAY | Calcineurin-regulated NFAT-dependent transcription in lymphocytes |
0.0 | 0.9 | PID INTEGRIN CS PATHWAY | Integrin family cell surface interactions |
0.0 | 1.0 | PID MET PATHWAY | Signaling events mediated by Hepatocyte Growth Factor Receptor (c-Met) |
0.0 | 0.1 | PID VEGFR1 PATHWAY | VEGFR1 specific signals |
0.0 | 1.3 | PID BMP PATHWAY | BMP receptor signaling |
0.0 | 1.0 | PID NFAT 3PATHWAY | Role of Calcineurin-dependent NFAT signaling in lymphocytes |
0.0 | 0.4 | PID WNT CANONICAL PATHWAY | Canonical Wnt signaling pathway |
0.0 | 0.1 | PID AVB3 INTEGRIN PATHWAY | Integrins in angiogenesis |
0.0 | 1.5 | NABA COLLAGENS | Genes encoding collagen proteins |
0.0 | 9.0 | NABA SECRETED FACTORS | Genes encoding secreted soluble factors |
0.0 | 0.7 | PID HEDGEHOG GLI PATHWAY | Hedgehog signaling events mediated by Gli proteins |
0.0 | 0.8 | PID DELTA NP63 PATHWAY | Validated transcriptional targets of deltaNp63 isoforms |
0.0 | 0.7 | PID HIF2PATHWAY | HIF-2-alpha transcription factor network |
0.0 | 0.1 | PID S1P S1P3 PATHWAY | S1P3 pathway |
0.0 | 0.2 | PID INSULIN GLUCOSE PATHWAY | Insulin-mediated glucose transport |
0.0 | 0.2 | PID LIS1 PATHWAY | Lissencephaly gene (LIS1) in neuronal migration and development |
0.0 | 0.3 | PID TAP63 PATHWAY | Validated transcriptional targets of TAp63 isoforms |
0.0 | 0.2 | PID EPHB FWD PATHWAY | EPHB forward signaling |
0.0 | 0.4 | PID HNF3A PATHWAY | FOXA1 transcription factor network |
0.0 | 0.2 | ST G ALPHA S PATHWAY | G alpha s Pathway |
0.0 | 0.1 | ST PAC1 RECEPTOR PATHWAY | PAC1 Receptor Pathway |
0.0 | 0.2 | PID INTEGRIN1 PATHWAY | Beta1 integrin cell surface interactions |
0.0 | 0.1 | PID UPA UPAR PATHWAY | Urokinase-type plasminogen activator (uPA) and uPAR-mediated signaling |
0.0 | 0.1 | ST STAT3 PATHWAY | STAT3 Pathway |
0.0 | 0.1 | PID RANBP2 PATHWAY | Sumoylation by RanBP2 regulates transcriptional repression |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.6 | 6.3 | REACTOME TANDEM PORE DOMAIN POTASSIUM CHANNELS | Genes involved in Tandem pore domain potassium channels |
0.4 | 4.8 | REACTOME SIGNAL ATTENUATION | Genes involved in Signal attenuation |
0.3 | 4.9 | REACTOME CRMPS IN SEMA3A SIGNALING | Genes involved in CRMPs in Sema3A signaling |
0.3 | 2.2 | REACTOME TRANSPORT OF ORGANIC ANIONS | Genes involved in Transport of organic anions |
0.3 | 5.7 | REACTOME INTERACTION BETWEEN L1 AND ANKYRINS | Genes involved in Interaction between L1 and Ankyrins |
0.3 | 2.8 | REACTOME SIGNALING BY FGFR3 MUTANTS | Genes involved in Signaling by FGFR3 mutants |
0.2 | 3.0 | REACTOME GABA A RECEPTOR ACTIVATION | Genes involved in GABA A receptor activation |
0.2 | 3.7 | REACTOME SYNTHESIS AND INTERCONVERSION OF NUCLEOTIDE DI AND TRIPHOSPHATES | Genes involved in Synthesis and interconversion of nucleotide di- and triphosphates |
0.2 | 2.3 | REACTOME DSCAM INTERACTIONS | Genes involved in DSCAM interactions |
0.2 | 4.8 | REACTOME INHIBITION OF INSULIN SECRETION BY ADRENALINE NORADRENALINE | Genes involved in Inhibition of Insulin Secretion by Adrenaline/Noradrenaline |
0.2 | 2.9 | REACTOME CITRIC ACID CYCLE TCA CYCLE | Genes involved in Citric acid cycle (TCA cycle) |
0.1 | 4.3 | REACTOME NETRIN1 SIGNALING | Genes involved in Netrin-1 signaling |
0.1 | 3.3 | REACTOME MYOGENESIS | Genes involved in Myogenesis |
0.1 | 1.4 | REACTOME CYTOSOLIC SULFONATION OF SMALL MOLECULES | Genes involved in Cytosolic sulfonation of small molecules |
0.1 | 2.1 | REACTOME GLUCAGON TYPE LIGAND RECEPTORS | Genes involved in Glucagon-type ligand receptors |
0.1 | 1.0 | REACTOME PHOSPHORYLATION OF CD3 AND TCR ZETA CHAINS | Genes involved in Phosphorylation of CD3 and TCR zeta chains |
0.1 | 0.5 | REACTOME BINDING AND ENTRY OF HIV VIRION | Genes involved in Binding and entry of HIV virion |
0.1 | 2.4 | REACTOME INSULIN SYNTHESIS AND PROCESSING | Genes involved in Insulin Synthesis and Processing |
0.1 | 1.8 | REACTOME TRAFFICKING OF GLUR2 CONTAINING AMPA RECEPTORS | Genes involved in Trafficking of GluR2-containing AMPA receptors |
0.1 | 1.9 | REACTOME POST CHAPERONIN TUBULIN FOLDING PATHWAY | Genes involved in Post-chaperonin tubulin folding pathway |
0.1 | 0.4 | REACTOME G BETA GAMMA SIGNALLING THROUGH PLC BETA | Genes involved in G beta:gamma signalling through PLC beta |
0.1 | 0.3 | REACTOME PLATELET SENSITIZATION BY LDL | Genes involved in Platelet sensitization by LDL |
0.1 | 0.1 | REACTOME NEP NS2 INTERACTS WITH THE CELLULAR EXPORT MACHINERY | Genes involved in NEP/NS2 Interacts with the Cellular Export Machinery |
0.1 | 1.3 | REACTOME SIGNALING BY NOTCH2 | Genes involved in Signaling by NOTCH2 |
0.1 | 0.4 | REACTOME DOPAMINE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Dopamine Neurotransmitter Release Cycle |
0.1 | 4.1 | REACTOME NRAGE SIGNALS DEATH THROUGH JNK | Genes involved in NRAGE signals death through JNK |
0.1 | 2.0 | REACTOME RNA POL III TRANSCRIPTION TERMINATION | Genes involved in RNA Polymerase III Transcription Termination |
0.1 | 1.1 | REACTOME ALPHA LINOLENIC ACID ALA METABOLISM | Genes involved in alpha-linolenic acid (ALA) metabolism |
0.1 | 0.5 | REACTOME SYNTHESIS SECRETION AND DEACYLATION OF GHRELIN | Genes involved in Synthesis, Secretion, and Deacylation of Ghrelin |
0.1 | 1.0 | REACTOME TGF BETA RECEPTOR SIGNALING IN EMT EPITHELIAL TO MESENCHYMAL TRANSITION | Genes involved in TGF-beta receptor signaling in EMT (epithelial to mesenchymal transition) |
0.1 | 5.1 | REACTOME COLLAGEN FORMATION | Genes involved in Collagen formation |
0.1 | 1.3 | REACTOME N GLYCAN ANTENNAE ELONGATION | Genes involved in N-Glycan antennae elongation |
0.1 | 0.7 | REACTOME PROSTANOID LIGAND RECEPTORS | Genes involved in Prostanoid ligand receptors |
0.1 | 2.5 | REACTOME P75 NTR RECEPTOR MEDIATED SIGNALLING | Genes involved in p75 NTR receptor-mediated signalling |
0.1 | 0.9 | REACTOME PROTEOLYTIC CLEAVAGE OF SNARE COMPLEX PROTEINS | Genes involved in Proteolytic cleavage of SNARE complex proteins |
0.1 | 1.2 | REACTOME GABA SYNTHESIS RELEASE REUPTAKE AND DEGRADATION | Genes involved in GABA synthesis, release, reuptake and degradation |
0.1 | 2.4 | REACTOME MEIOTIC SYNAPSIS | Genes involved in Meiotic Synapsis |
0.1 | 1.0 | REACTOME TRAFFICKING OF AMPA RECEPTORS | Genes involved in Trafficking of AMPA receptors |
0.1 | 1.1 | REACTOME G ALPHA Z SIGNALLING EVENTS | Genes involved in G alpha (z) signalling events |
0.1 | 0.4 | REACTOME RNA POL III TRANSCRIPTION INITIATION FROM TYPE 2 PROMOTER | Genes involved in RNA Polymerase III Transcription Initiation From Type 2 Promoter |
0.1 | 0.1 | REACTOME MRNA DECAY BY 3 TO 5 EXORIBONUCLEASE | Genes involved in mRNA Decay by 3' to 5' Exoribonuclease |
0.1 | 0.4 | REACTOME CREATION OF C4 AND C2 ACTIVATORS | Genes involved in Creation of C4 and C2 activators |
0.1 | 1.1 | REACTOME SIGNALING BY HIPPO | Genes involved in Signaling by Hippo |
0.1 | 0.3 | REACTOME IRAK1 RECRUITS IKK COMPLEX | Genes involved in IRAK1 recruits IKK complex |
0.1 | 0.8 | REACTOME CA DEPENDENT EVENTS | Genes involved in Ca-dependent events |
0.1 | 1.1 | REACTOME AMINE COMPOUND SLC TRANSPORTERS | Genes involved in Amine compound SLC transporters |
0.1 | 0.3 | REACTOME TRAF6 MEDIATED IRF7 ACTIVATION IN TLR7 8 OR 9 SIGNALING | Genes involved in TRAF6 mediated IRF7 activation in TLR7/8 or 9 signaling |
0.1 | 1.2 | REACTOME AMINO ACID TRANSPORT ACROSS THE PLASMA MEMBRANE | Genes involved in Amino acid transport across the plasma membrane |
0.0 | 1.6 | REACTOME ION TRANSPORT BY P TYPE ATPASES | Genes involved in Ion transport by P-type ATPases |
0.0 | 3.5 | REACTOME POTASSIUM CHANNELS | Genes involved in Potassium Channels |
0.0 | 0.7 | REACTOME INCRETIN SYNTHESIS SECRETION AND INACTIVATION | Genes involved in Incretin Synthesis, Secretion, and Inactivation |
0.0 | 0.1 | REACTOME TRANSMISSION ACROSS CHEMICAL SYNAPSES | Genes involved in Transmission across Chemical Synapses |
0.0 | 0.0 | REACTOME FGFR2C LIGAND BINDING AND ACTIVATION | Genes involved in FGFR2c ligand binding and activation |
0.0 | 0.3 | REACTOME GLUTAMATE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Glutamate Neurotransmitter Release Cycle |
0.0 | 0.2 | REACTOME REGULATION OF INSULIN SECRETION | Genes involved in Regulation of Insulin Secretion |
0.0 | 0.9 | REACTOME TRANSPORT OF VITAMINS NUCLEOSIDES AND RELATED MOLECULES | Genes involved in Transport of vitamins, nucleosides, and related molecules |
0.0 | 0.6 | REACTOME REGULATION OF INSULIN LIKE GROWTH FACTOR IGF ACTIVITY BY INSULIN LIKE GROWTH FACTOR BINDING PROTEINS IGFBPS | Genes involved in Regulation of Insulin-like Growth Factor (IGF) Activity by Insulin-like Growth Factor Binding Proteins (IGFBPs) |
0.0 | 0.2 | REACTOME SIGNALLING TO RAS | Genes involved in Signalling to RAS |
0.0 | 0.8 | REACTOME SIGNALING BY BMP | Genes involved in Signaling by BMP |
0.0 | 0.3 | REACTOME SEROTONIN RECEPTORS | Genes involved in Serotonin receptors |
0.0 | 0.3 | REACTOME OPSINS | Genes involved in Opsins |
0.0 | 0.9 | REACTOME CYTOSOLIC TRNA AMINOACYLATION | Genes involved in Cytosolic tRNA aminoacylation |
0.0 | 0.1 | REACTOME RORA ACTIVATES CIRCADIAN EXPRESSION | Genes involved in RORA Activates Circadian Expression |
0.0 | 0.2 | REACTOME BETA DEFENSINS | Genes involved in Beta defensins |
0.0 | 0.9 | REACTOME EXTRACELLULAR MATRIX ORGANIZATION | Genes involved in Extracellular matrix organization |
0.0 | 0.3 | REACTOME ARMS MEDIATED ACTIVATION | Genes involved in ARMS-mediated activation |
0.0 | 0.3 | REACTOME CS DS DEGRADATION | Genes involved in CS/DS degradation |
0.0 | 0.4 | REACTOME REGULATION OF RHEB GTPASE ACTIVITY BY AMPK | Genes involved in Regulation of Rheb GTPase activity by AMPK |
0.0 | 0.4 | REACTOME RAP1 SIGNALLING | Genes involved in Rap1 signalling |
0.0 | 0.6 | REACTOME GAP JUNCTION ASSEMBLY | Genes involved in Gap junction assembly |
0.0 | 0.2 | REACTOME FGFR1 LIGAND BINDING AND ACTIVATION | Genes involved in FGFR1 ligand binding and activation |
0.0 | 0.3 | REACTOME ANDROGEN BIOSYNTHESIS | Genes involved in Androgen biosynthesis |
0.0 | 0.4 | REACTOME INHIBITION OF REPLICATION INITIATION OF DAMAGED DNA BY RB1 E2F1 | Genes involved in Inhibition of replication initiation of damaged DNA by RB1/E2F1 |
0.0 | 0.4 | REACTOME AMINO ACID AND OLIGOPEPTIDE SLC TRANSPORTERS | Genes involved in Amino acid and oligopeptide SLC transporters |
0.0 | 0.4 | REACTOME PRESYNAPTIC NICOTINIC ACETYLCHOLINE RECEPTORS | Genes involved in Presynaptic nicotinic acetylcholine receptors |
0.0 | 0.2 | REACTOME ACTIVATION OF THE AP1 FAMILY OF TRANSCRIPTION FACTORS | Genes involved in Activation of the AP-1 family of transcription factors |
0.0 | 0.4 | REACTOME UNWINDING OF DNA | Genes involved in Unwinding of DNA |
0.0 | 1.0 | REACTOME GLYCOSPHINGOLIPID METABOLISM | Genes involved in Glycosphingolipid metabolism |
0.0 | 0.1 | REACTOME CTNNB1 PHOSPHORYLATION CASCADE | Genes involved in Beta-catenin phosphorylation cascade |
0.0 | 0.1 | REACTOME SIGNALING BY SCF KIT | Genes involved in Signaling by SCF-KIT |
0.0 | 0.3 | REACTOME BASE FREE SUGAR PHOSPHATE REMOVAL VIA THE SINGLE NUCLEOTIDE REPLACEMENT PATHWAY | Genes involved in Base-free sugar-phosphate removal via the single-nucleotide replacement pathway |
0.0 | 1.1 | REACTOME NOTCH1 INTRACELLULAR DOMAIN REGULATES TRANSCRIPTION | Genes involved in NOTCH1 Intracellular Domain Regulates Transcription |
0.0 | 0.3 | REACTOME POL SWITCHING | Genes involved in Polymerase switching |
0.0 | 0.2 | REACTOME SYNTHESIS OF BILE ACIDS AND BILE SALTS VIA 24 HYDROXYCHOLESTEROL | Genes involved in Synthesis of bile acids and bile salts via 24-hydroxycholesterol |
0.0 | 0.0 | REACTOME ACTIVATED POINT MUTANTS OF FGFR2 | Genes involved in Activated point mutants of FGFR2 |
0.0 | 0.5 | REACTOME ADHERENS JUNCTIONS INTERACTIONS | Genes involved in Adherens junctions interactions |
0.0 | 0.1 | REACTOME PD1 SIGNALING | Genes involved in PD-1 signaling |
0.0 | 0.2 | REACTOME GLUCURONIDATION | Genes involved in Glucuronidation |
0.0 | 0.1 | REACTOME EICOSANOID LIGAND BINDING RECEPTORS | Genes involved in Eicosanoid ligand-binding receptors |
0.0 | 0.5 | REACTOME SIGNALING BY ROBO RECEPTOR | Genes involved in Signaling by Robo receptor |
0.0 | 0.3 | REACTOME ABORTIVE ELONGATION OF HIV1 TRANSCRIPT IN THE ABSENCE OF TAT | Genes involved in Abortive elongation of HIV-1 transcript in the absence of Tat |
0.0 | 0.1 | REACTOME MICRORNA MIRNA BIOGENESIS | Genes involved in MicroRNA (miRNA) Biogenesis |
0.0 | 0.3 | REACTOME FANCONI ANEMIA PATHWAY | Genes involved in Fanconi Anemia pathway |
0.0 | 0.2 | REACTOME RECRUITMENT OF NUMA TO MITOTIC CENTROSOMES | Genes involved in Recruitment of NuMA to mitotic centrosomes |
0.0 | 0.0 | REACTOME SHC1 EVENTS IN EGFR SIGNALING | Genes involved in SHC1 events in EGFR signaling |
0.0 | 0.0 | REACTOME NOREPINEPHRINE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Norepinephrine Neurotransmitter Release Cycle |
0.0 | 0.2 | REACTOME COPI MEDIATED TRANSPORT | Genes involved in COPI Mediated Transport |
0.0 | 0.2 | REACTOME METABOLISM OF POLYAMINES | Genes involved in Metabolism of polyamines |
0.0 | 0.2 | REACTOME SYNTHESIS OF PE | Genes involved in Synthesis of PE |
0.0 | 0.2 | REACTOME PURINE RIBONUCLEOSIDE MONOPHOSPHATE BIOSYNTHESIS | Genes involved in Purine ribonucleoside monophosphate biosynthesis |
0.0 | 0.1 | REACTOME TRAF6 MEDIATED INDUCTION OF TAK1 COMPLEX | Genes involved in TRAF6 mediated induction of TAK1 complex |
0.0 | 0.1 | REACTOME ENDOGENOUS STEROLS | Genes involved in Endogenous sterols |
0.0 | 0.3 | REACTOME NCAM SIGNALING FOR NEURITE OUT GROWTH | Genes involved in NCAM signaling for neurite out-growth |
0.0 | 0.0 | REACTOME GABA RECEPTOR ACTIVATION | Genes involved in GABA receptor activation |
0.0 | 0.1 | REACTOME GAMMA CARBOXYLATION TRANSPORT AND AMINO TERMINAL CLEAVAGE OF PROTEINS | Genes involved in Gamma-carboxylation, transport, and amino-terminal cleavage of proteins |
0.0 | 0.1 | REACTOME ORGANIC CATION ANION ZWITTERION TRANSPORT | Genes involved in Organic cation/anion/zwitterion transport |
0.0 | 0.1 | REACTOME SLBP DEPENDENT PROCESSING OF REPLICATION DEPENDENT HISTONE PRE MRNAS | Genes involved in SLBP Dependent Processing of Replication-Dependent Histone Pre-mRNAs |
0.0 | 0.6 | REACTOME RESPIRATORY ELECTRON TRANSPORT | Genes involved in Respiratory electron transport |
0.0 | 0.0 | REACTOME CTLA4 INHIBITORY SIGNALING | Genes involved in CTLA4 inhibitory signaling |
0.0 | 0.1 | REACTOME AMINE DERIVED HORMONES | Genes involved in Amine-derived hormones |
0.0 | 0.1 | REACTOME CDC6 ASSOCIATION WITH THE ORC ORIGIN COMPLEX | Genes involved in CDC6 association with the ORC:origin complex |
0.0 | 0.0 | REACTOME CIRCADIAN REPRESSION OF EXPRESSION BY REV ERBA | Genes involved in Circadian Repression of Expression by REV-ERBA |