Gene Symbol | Gene ID | Gene Info |
---|---|---|
Stat6
|
ENSMUSG00000002147.12 | signal transducer and activator of transcription 6 |
CRE | Gene | Distance | Association probability | Pearson corr. coef. | P-value | Plot |
---|---|---|---|---|---|---|
Stat6 | chr10_127642723_127643080 | 85 | 0.930983 | -0.59 | 1.9e-06 | Click! |
Stat6 | chr10_127643094_127643312 | 201 | 0.865222 | -0.58 | 4.4e-06 | Click! |
Stat6 | chr10_127643321_127643504 | 410 | 0.685293 | -0.55 | 1.2e-05 | Click! |
Stat6 | chr10_127642476_127642704 | 396 | 0.697952 | -0.51 | 6.3e-05 | Click! |
Stat6 | chr10_127640032_127640310 | 2815 | 0.120998 | -0.50 | 1.1e-04 | Click! |
Move your cursor over a bar to see sample name and corresponding Z-value.
Cis Regulatory Element (CRE) | Target Score | Top associated gene | Gene Info | Distance of CRE to TSS | CRE/Gene association probability |
---|---|---|---|---|---|
chr17_13654565_13655321 | 11.75 |
2700054A10Rik |
RIKEN cDNA 2700054A10 gene |
13948 |
0.15 |
chr17_13590938_13591623 | 9.81 |
2700054A10Rik |
RIKEN cDNA 2700054A10 gene |
22416 |
0.14 |
chr10_95116795_95116987 | 8.81 |
Gm48868 |
predicted gene, 48868 |
512 |
0.77 |
chr2_25240744_25241709 | 7.37 |
Cysrt1 |
cysteine rich tail 1 |
1226 |
0.15 |
chrX_49288183_49288615 | 7.22 |
Enox2 |
ecto-NOX disulfide-thiol exchanger 2 |
140 |
0.97 |
chr3_115856630_115856858 | 5.73 |
Dph5 |
diphthamide biosynthesis 5 |
31093 |
0.11 |
chrX_161480448_161480798 | 5.68 |
Prkaca-ps1 |
protein kinase, cAMP dependent, catalytic, alpha pseudogene 1 |
5862 |
0.33 |
chr11_43548063_43548966 | 5.58 |
Ccnjl |
cyclin J-like |
19268 |
0.13 |
chr10_75166233_75166595 | 5.29 |
Bcr |
BCR activator of RhoGEF and GTPase |
6054 |
0.23 |
chr2_152049814_152050498 | 5.16 |
AA387200 |
expressed sequence AA387200 |
26652 |
0.12 |
chr4_120170416_120170874 | 5.09 |
Edn2 |
endothelin 2 |
9439 |
0.24 |
chr14_46885106_46885668 | 5.02 |
2810457G06Rik |
RIKEN cDNA 2810457G06 gene |
323 |
0.74 |
chr4_22479124_22479682 | 4.84 |
Pou3f2 |
POU domain, class 3, transcription factor 2 |
8963 |
0.17 |
chr7_64450872_64451023 | 4.81 |
Apba2 |
amyloid beta (A4) precursor protein-binding, family A, member 2 |
50759 |
0.1 |
chr13_32411666_32411834 | 4.76 |
Gm11381 |
predicted gene 11381 |
28062 |
0.2 |
chr6_54554355_54554906 | 4.72 |
Scrn1 |
secernin 1 |
175 |
0.95 |
chr2_152048577_152049360 | 4.71 |
AA387200 |
expressed sequence AA387200 |
27840 |
0.11 |
chr1_38629243_38629578 | 4.58 |
Aff3 |
AF4/FMR2 family, member 3 |
2209 |
0.39 |
chr7_51662439_51662822 | 4.55 |
Gm45072 |
predicted gene 45072 |
30905 |
0.14 |
chr3_135733189_135733344 | 4.54 |
Nfkb1 |
nuclear factor of kappa light polypeptide gene enhancer in B cells 1, p105 |
41719 |
0.14 |
chr3_40070102_40070729 | 4.52 |
Gm42785 |
predicted gene 42785 |
246838 |
0.02 |
chr1_89183290_89183867 | 4.49 |
Gm5259 |
predicted gene 5259 |
73403 |
0.09 |
chr7_113249560_113249756 | 4.44 |
Arntl |
aryl hydrocarbon receptor nuclear translocator-like |
9904 |
0.2 |
chr6_48537480_48537711 | 4.40 |
Atp6v0e2 |
ATPase, H+ transporting, lysosomal V0 subunit E2 |
20 |
0.59 |
chr15_78876224_78876768 | 4.40 |
Gga1 |
golgi associated, gamma adaptin ear containing, ARF binding protein 1 |
694 |
0.44 |
chr3_110303290_110303472 | 4.39 |
Gm43405 |
predicted gene 43405 |
25909 |
0.17 |
chr9_18473066_18474201 | 4.32 |
Zfp558 |
zinc finger protein 558 |
74 |
0.95 |
chr8_55104196_55104391 | 4.31 |
Gm8734 |
predicted gene 8734 |
22578 |
0.16 |
chr14_121494258_121494578 | 4.22 |
Slc15a1 |
solute carrier family 15 (oligopeptide transporter), member 1 |
1949 |
0.3 |
chr8_54956011_54956178 | 4.19 |
Gpm6a |
glycoprotein m6a |
1251 |
0.4 |
chr13_84448589_84449243 | 4.18 |
Gm26927 |
predicted gene, 26927 |
108803 |
0.07 |
chr9_56868158_56868636 | 4.13 |
Cspg4 |
chondroitin sulfate proteoglycan 4 |
3364 |
0.16 |
chr1_52524166_52524337 | 4.13 |
Gm553 |
predicted gene 553 |
1349 |
0.3 |
chr1_59340991_59341195 | 4.06 |
Gm29016 |
predicted gene 29016 |
37837 |
0.13 |
chr11_81860576_81860948 | 4.06 |
5530401A14Rik |
RIKEN cDNA 5530401A14 gene |
83 |
0.98 |
chr1_55666109_55666282 | 4.05 |
Plcl1 |
phospholipase C-like 1 |
35830 |
0.2 |
chr14_18263253_18263404 | 4.00 |
Rpl15 |
ribosomal protein L15 |
6791 |
0.15 |
chr16_7146478_7146815 | 3.99 |
Rbfox1 |
RNA binding protein, fox-1 homolog (C. elegans) 1 |
47101 |
0.21 |
chr12_13217502_13218046 | 3.96 |
Ddx1 |
DEAD (Asp-Glu-Ala-Asp) box polypeptide 1 |
11605 |
0.18 |
chr8_87836611_87837241 | 3.96 |
Zfp423 |
zinc finger protein 423 |
32487 |
0.22 |
chr5_151054101_151054280 | 3.95 |
Stard13 |
StAR-related lipid transfer (START) domain containing 13 |
35072 |
0.17 |
chr18_64013723_64014176 | 3.94 |
Gm6974 |
predicted gene 6974 |
67471 |
0.1 |
chr10_118102987_118104071 | 3.94 |
5330439M10Rik |
RIKEN cDNA 5330439M10 gene |
8988 |
0.17 |
chr18_4518124_4518281 | 3.93 |
Gm7411 |
predicted gene 7411 |
33733 |
0.17 |
chr8_23360756_23361303 | 3.91 |
Sfrp1 |
secreted frizzled-related protein 1 |
50473 |
0.12 |
chr6_65310862_65311037 | 3.91 |
Gm8479 |
predicted gene 8479 |
17156 |
0.14 |
chr14_34140118_34140279 | 3.89 |
Gm7778 |
predicted gene 7778 |
750 |
0.45 |
chr2_161265509_161265695 | 3.85 |
Gm5270 |
predicted gene 5270 |
10145 |
0.19 |
chr1_128590793_128591469 | 3.81 |
Cxcr4 |
chemokine (C-X-C motif) receptor 4 |
1159 |
0.52 |
chr3_124320769_124321666 | 3.77 |
Tram1l1 |
translocation associated membrane protein 1-like 1 |
362 |
0.85 |
chr3_26003308_26003504 | 3.69 |
Nlgn1 |
neuroligin 1 |
130328 |
0.06 |
chr13_60045576_60045727 | 3.67 |
Gm48396 |
predicted gene, 48396 |
11974 |
0.16 |
chr15_56774773_56774943 | 3.66 |
Gm5673 |
predicted gene 5673 |
8570 |
0.23 |
chr13_63779469_63779647 | 3.64 |
Gm47418 |
predicted gene, 47418 |
14548 |
0.14 |
chr8_4206127_4207837 | 3.63 |
4932443L11Rik |
RIKEN cDNA 4932443L11 gene |
100 |
0.88 |
chr5_133311271_133311422 | 3.63 |
Gm42625 |
predicted gene 42625 |
131996 |
0.05 |
chr2_6464182_6464349 | 3.62 |
Gm13391 |
predicted gene 13391 |
7735 |
0.18 |
chr18_60065037_60065286 | 3.62 |
Gm23576 |
predicted gene, 23576 |
109156 |
0.06 |
chr3_108858669_108858832 | 3.58 |
Fndc7 |
fibronectin type III domain containing 7 |
137 |
0.95 |
chr1_41605098_41605443 | 3.58 |
Gm28634 |
predicted gene 28634 |
75727 |
0.12 |
chr9_101862892_101863076 | 3.56 |
Gm29521 |
predicted gene 29521 |
495 |
0.68 |
chr6_37171236_37171387 | 3.56 |
Dgki |
diacylglycerol kinase, iota |
106801 |
0.07 |
chr13_95443458_95443716 | 3.54 |
Crhbp |
corticotropin releasing hormone binding protein |
1244 |
0.41 |
chrX_143543266_143543620 | 3.52 |
Pak3 |
p21 (RAC1) activated kinase 3 |
24745 |
0.25 |
chr5_3404815_3405018 | 3.51 |
Cdk6 |
cyclin-dependent kinase 6 |
60604 |
0.09 |
chr1_125911939_125912615 | 3.50 |
Lypd1 |
Ly6/Plaur domain containing 1 |
63 |
0.98 |
chr3_57534504_57534655 | 3.50 |
Gm16016 |
predicted gene 16016 |
6347 |
0.2 |
chr15_75553015_75553166 | 3.48 |
Ly6h |
lymphocyte antigen 6 complex, locus H |
13542 |
0.12 |
chrX_21089458_21089641 | 3.47 |
Zfp300 |
zinc finger protein 300 |
22 |
0.97 |
chr12_37774409_37774621 | 3.47 |
Dgkb |
diacylglycerol kinase, beta |
43211 |
0.2 |
chr15_25774329_25774534 | 3.46 |
Myo10 |
myosin X |
444 |
0.86 |
chr9_120869974_120870286 | 3.45 |
Gm34425 |
predicted gene, 34425 |
184 |
0.83 |
chr11_16832168_16832493 | 3.45 |
Egfros |
epidermal growth factor receptor, opposite strand |
1628 |
0.42 |
chr9_81863521_81864338 | 3.45 |
Mei4 |
meiotic double-stranded break formation protein 4 |
220 |
0.95 |
chr7_34745966_34746493 | 3.41 |
Chst8 |
carbohydrate sulfotransferase 8 |
7583 |
0.21 |
chr6_58596059_58596417 | 3.39 |
Abcg2 |
ATP binding cassette subfamily G member 2 (Junior blood group) |
263 |
0.92 |
chr19_22447980_22448195 | 3.38 |
Gm27151 |
predicted gene 27151 |
55 |
0.55 |
chr11_48605314_48605525 | 3.38 |
Gm12181 |
predicted gene 12181 |
10140 |
0.18 |
chr1_24226131_24226533 | 3.37 |
Col9a1 |
collagen, type IX, alpha 1 |
3185 |
0.33 |
chr10_71398564_71398715 | 3.35 |
Ipmk |
inositol polyphosphate multikinase |
10724 |
0.17 |
chr5_52990687_52991202 | 3.35 |
5033403H07Rik |
RIKEN cDNA 5033403H07 gene |
1348 |
0.37 |
chr3_55284304_55284525 | 3.35 |
Gm25132 |
predicted gene, 25132 |
20903 |
0.16 |
chr7_18950757_18950953 | 3.35 |
Nova2 |
NOVA alternative splicing regulator 2 |
24967 |
0.07 |
chr12_29871996_29872873 | 3.32 |
Myt1l |
myelin transcription factor 1-like |
20886 |
0.24 |
chr8_20372500_20373383 | 3.32 |
Gm7807 |
predicted gene 7807 |
8140 |
0.18 |
chr19_27599750_27599901 | 3.32 |
Gm50101 |
predicted gene, 50101 |
87317 |
0.09 |
chr18_13397132_13397486 | 3.31 |
Gm50093 |
predicted gene, 50093 |
25220 |
0.24 |
chr13_84758337_84758535 | 3.31 |
Gm26913 |
predicted gene, 26913 |
67495 |
0.14 |
chr10_81232562_81232915 | 3.31 |
Zfr2 |
zinc finger RNA binding protein 2 |
417 |
0.59 |
chr6_82939285_82939948 | 3.31 |
Sema4f |
sema domain, immunoglobulin domain (Ig), TM domain, and short cytoplasmic domain |
71 |
0.94 |
chr1_119051998_119052305 | 3.30 |
Gli2 |
GLI-Kruppel family member GLI2 |
1188 |
0.51 |
chr9_41345484_41345635 | 3.30 |
Gm25401 |
predicted gene, 25401 |
6018 |
0.19 |
chr7_141946026_141946417 | 3.30 |
Gm20501 |
predicted gene 20501 |
108 |
0.95 |
chr16_49951259_49951422 | 3.29 |
Cd47 |
CD47 antigen (Rh-related antigen, integrin-associated signal transducer) |
84507 |
0.1 |
chr7_79194576_79194761 | 3.29 |
Mfge8 |
milk fat globule-EGF factor 8 protein |
45608 |
0.11 |
chr13_41343914_41344090 | 3.28 |
Nedd9 |
neural precursor cell expressed, developmentally down-regulated gene 9 |
15245 |
0.13 |
chr2_79665603_79665781 | 3.28 |
Itprid2 |
ITPR interacting domain containing 2 |
26510 |
0.21 |
chr9_50723442_50723597 | 3.27 |
Dixdc1 |
DIX domain containing 1 |
4419 |
0.13 |
chr1_6767165_6767446 | 3.27 |
St18 |
suppression of tumorigenicity 18 |
29730 |
0.21 |
chr1_59516219_59516601 | 3.26 |
Gm973 |
predicted gene 973 |
146 |
0.94 |
chr16_55421487_55421638 | 3.25 |
Mir5118 |
microRNA 5118 |
73169 |
0.12 |
chr18_52677516_52677667 | 3.25 |
Gykl1 |
glycerol kinase-like 1 |
16099 |
0.19 |
chr3_55242068_55243398 | 3.24 |
Dclk1 |
doublecortin-like kinase 1 |
207 |
0.94 |
chr6_73949443_73949657 | 3.23 |
Gm44225 |
predicted gene, 44225 |
63701 |
0.15 |
chr16_69469408_69469596 | 3.22 |
4930428D20Rik |
RIKEN cDNA 4930428D20 gene |
330879 |
0.01 |
chr2_149831744_149832073 | 3.22 |
C530025M09Rik |
RIKEN cDNA C530025M09 gene |
266 |
0.85 |
chr2_142731762_142732107 | 3.21 |
Kif16b |
kinesin family member 16B |
29263 |
0.21 |
chr3_86845696_86845862 | 3.18 |
Gm37025 |
predicted gene, 37025 |
18713 |
0.17 |
chr9_41935988_41936244 | 3.17 |
Sorl1 |
sortilin-related receptor, LDLR class A repeats-containing |
38471 |
0.13 |
chr13_34149237_34149640 | 3.17 |
Psmg4 |
proteasome (prosome, macropain) assembly chaperone 4 |
13526 |
0.11 |
chr2_103390180_103390364 | 3.16 |
BC016548 |
cDNA sequence BC016548 |
1228 |
0.41 |
chr4_34993070_34993464 | 3.15 |
Gm12364 |
predicted gene 12364 |
31047 |
0.15 |
chr10_71426856_71427027 | 3.15 |
Ipmk |
inositol polyphosphate multikinase |
17578 |
0.16 |
chr2_6585129_6585315 | 3.14 |
Celf2 |
CUGBP, Elav-like family member 2 |
7578 |
0.27 |
chr15_24567016_24567356 | 3.13 |
Gm48920 |
predicted gene, 48920 |
38292 |
0.19 |
chrX_7428926_7429336 | 3.13 |
2010204K13Rik |
RIKEN cDNA 2010204K13 gene |
6143 |
0.16 |
chr6_94755630_94755803 | 3.13 |
Gm43997 |
predicted gene, 43997 |
43716 |
0.12 |
chr12_79911112_79911786 | 3.12 |
9430078K24Rik |
RIKEN cDNA 9430078K24 gene |
13284 |
0.2 |
chr13_80615097_80615248 | 3.12 |
Gm46388 |
predicted gene, 46388 |
122163 |
0.06 |
chr1_85917187_85917621 | 3.12 |
4933407L21Rik |
RIKEN cDNA 4933407L21 gene |
11079 |
0.12 |
chr16_77417793_77417970 | 3.12 |
Gm38071 |
predicted gene, 38071 |
1257 |
0.31 |
chr10_106609605_106610022 | 3.10 |
4930532I03Rik |
RIKEN cDNA 4930532I03 gene |
7333 |
0.29 |
chr8_14970018_14970593 | 3.08 |
Gm16350 |
predicted gene 16350 |
8719 |
0.14 |
chr12_29882839_29883206 | 3.07 |
Myt1l |
myelin transcription factor 1-like |
12092 |
0.26 |
chr18_4523365_4523518 | 3.06 |
Gm7411 |
predicted gene 7411 |
38972 |
0.16 |
chr3_17791455_17791660 | 3.06 |
Mir124-2hg |
Mir124-2 host gene (non-protein coding) |
1600 |
0.36 |
chr3_98381976_98382962 | 3.06 |
Zfp697 |
zinc finger protein 697 |
8 |
0.98 |
chr1_73363237_73363388 | 3.05 |
D530049I02Rik |
RIKEN cDNA D530049I02 gene |
35656 |
0.15 |
chr6_15639488_15639689 | 3.05 |
Gm44039 |
predicted gene, 44039 |
3464 |
0.35 |
chr2_10374243_10374943 | 3.05 |
Gm13261 |
predicted gene 13261 |
552 |
0.39 |
chr10_128322148_128323090 | 3.05 |
Cnpy2 |
canopy FGF signaling regulator 2 |
74 |
0.92 |
chr13_31374148_31374299 | 3.04 |
G630018N14Rik |
RIKEN cDNA G630018N14 gene |
6535 |
0.16 |
chr16_45724098_45724715 | 3.03 |
Tagln3 |
transgelin 3 |
202 |
0.92 |
chr5_24423517_24424454 | 3.03 |
Slc4a2 |
solute carrier family 4 (anion exchanger), member 2 |
126 |
0.78 |
chr3_35340507_35340879 | 3.03 |
Gm25442 |
predicted gene, 25442 |
15079 |
0.23 |
chr13_112100671_112101178 | 3.03 |
Gm31104 |
predicted gene, 31104 |
37192 |
0.15 |
chr8_4212633_4214018 | 3.02 |
Prr36 |
proline rich 36 |
3587 |
0.11 |
chr5_63579498_63579649 | 3.02 |
Nwd2 |
NACHT and WD repeat domain containing 2 |
69529 |
0.11 |
chr19_15803250_15803445 | 3.02 |
Gm50348 |
predicted gene, 50348 |
289 |
0.94 |
chr10_43174897_43175169 | 3.02 |
9030612E09Rik |
RIKEN cDNA 9030612E09 gene |
329 |
0.6 |
chr15_11745094_11745248 | 3.00 |
Gm41271 |
predicted gene, 41271 |
41468 |
0.17 |
chr7_79507353_79507621 | 3.00 |
Mir9-3 |
microRNA 9-3 |
2223 |
0.14 |
chr9_25377882_25378402 | 3.00 |
Gm18891 |
predicted gene, 18891 |
28644 |
0.17 |
chr12_49381565_49382180 | 2.97 |
Gm34304 |
predicted gene, 34304 |
13 |
0.93 |
chr18_65532600_65532751 | 2.97 |
Gm30018 |
predicted gene, 30018 |
874 |
0.48 |
chr12_92292877_92293078 | 2.97 |
Gm6841 |
predicted gene 6841 |
73600 |
0.12 |
chr4_109983777_109984377 | 2.96 |
Dmrta2 |
doublesex and mab-3 related transcription factor like family A2 |
6024 |
0.24 |
chr2_6464457_6464814 | 2.96 |
Gm13391 |
predicted gene 13391 |
7365 |
0.18 |
chr8_10006169_10006494 | 2.95 |
Tnfsf13b |
tumor necrosis factor (ligand) superfamily, member 13b |
136 |
0.95 |
chr10_95044243_95044401 | 2.95 |
Gm48867 |
predicted gene, 48867 |
44880 |
0.13 |
chr6_37253966_37254145 | 2.95 |
Dgki |
diacylglycerol kinase, iota |
45582 |
0.18 |
chr6_100732315_100732977 | 2.94 |
Gm15576 |
predicted gene 15576 |
6412 |
0.18 |
chr6_39871998_39872940 | 2.93 |
Gm26833 |
predicted gene, 26833 |
498 |
0.51 |
chr2_26594675_26595827 | 2.93 |
Egfl7 |
EGF-like domain 7 |
3104 |
0.11 |
chr16_43577534_43577717 | 2.93 |
Mir568 |
microRNA 568 |
63030 |
0.1 |
chr15_8781117_8781524 | 2.93 |
Slc1a3 |
solute carrier family 1 (glial high affinity glutamate transporter), member 3 |
70556 |
0.11 |
chr11_104106366_104106692 | 2.92 |
Crhr1 |
corticotropin releasing hormone receptor 1 |
26326 |
0.19 |
chr14_6756349_6757421 | 2.92 |
Gm3636 |
predicted gene 3636 |
14553 |
0.14 |
chr1_15683722_15683873 | 2.92 |
Gm25227 |
predicted gene, 25227 |
2249 |
0.35 |
chr8_42183439_42183600 | 2.91 |
Gm6180 |
predicted pseudogene 6180 |
63392 |
0.14 |
chr9_49798665_49798816 | 2.90 |
Ncam1 |
neural cell adhesion molecule 1 |
18 |
0.98 |
chr6_100503301_100503752 | 2.90 |
Gm44107 |
predicted gene, 44107 |
5011 |
0.19 |
chr14_24793475_24794060 | 2.90 |
Gm47906 |
predicted gene, 47906 |
39868 |
0.18 |
chr1_88261034_88262277 | 2.90 |
Mroh2a |
maestro heat-like repeat family member 2A |
3897 |
0.12 |
chr5_89943312_89943487 | 2.89 |
Adamts3 |
a disintegrin-like and metallopeptidase (reprolysin type) with thrombospondin type 1 motif, 3 |
60065 |
0.14 |
chr10_106585822_106585996 | 2.89 |
4930532I03Rik |
RIKEN cDNA 4930532I03 gene |
15151 |
0.25 |
chr7_44429975_44430189 | 2.87 |
Lrrc4b |
leucine rich repeat containing 4B |
1064 |
0.28 |
chr2_115950765_115950916 | 2.87 |
Meis2 |
Meis homeobox 2 |
77878 |
0.1 |
chr6_109153685_109153951 | 2.87 |
Gm29781 |
predicted gene, 29781 |
28133 |
0.22 |
chr15_58538240_58538435 | 2.87 |
Fer1l6 |
fer-1-like 6 (C. elegans) |
28289 |
0.21 |
chr5_84417882_84418061 | 2.87 |
Epha5 |
Eph receptor A5 |
589 |
0.81 |
chr9_41918970_41919408 | 2.86 |
Gm40513 |
predicted gene, 40513 |
28585 |
0.14 |
chr4_59629532_59629743 | 2.85 |
E130308A19Rik |
RIKEN cDNA E130308A19 gene |
3394 |
0.25 |
chr7_117462258_117462492 | 2.84 |
Xylt1 |
xylosyltransferase 1 |
13117 |
0.28 |
chr19_18888764_18889099 | 2.83 |
Trpm6 |
transient receptor potential cation channel, subfamily M, member 6 |
48294 |
0.16 |
chr14_54577785_54578159 | 2.83 |
Ajuba |
ajuba LIM protein |
414 |
0.66 |
chr6_28980299_28980450 | 2.83 |
Gm3294 |
predicted gene 3294 |
1260 |
0.48 |
chr18_81153562_81153860 | 2.83 |
Gm50423 |
predicted gene, 50423 |
70647 |
0.09 |
chr4_148327377_148327851 | 2.82 |
Gm13206 |
predicted gene 13206 |
20761 |
0.14 |
chr2_70168731_70168924 | 2.82 |
Myo3b |
myosin IIIB |
72529 |
0.11 |
chr11_47304661_47305086 | 2.81 |
Sgcd |
sarcoglycan, delta (dystrophin-associated glycoprotein) |
74649 |
0.13 |
chr12_52289670_52289821 | 2.80 |
Nubpl |
nucleotide binding protein-like |
113658 |
0.06 |
chr16_46769591_46769779 | 2.80 |
Gm17900 |
predicted gene, 17900 |
231850 |
0.02 |
chr18_4008502_4008856 | 2.80 |
Gm7378 |
predicted gene 7378 |
1577 |
0.47 |
chr12_52774500_52774651 | 2.80 |
Akap6 |
A kinase (PRKA) anchor protein 6 |
21261 |
0.2 |
chr3_45377049_45377409 | 2.79 |
2610316D01Rik |
RIKEN cDNA 2610316D01 gene |
976 |
0.4 |
chr6_108472798_108472949 | 2.79 |
Gm44101 |
predicted gene, 44101 |
298 |
0.89 |
chr3_35405107_35405293 | 2.79 |
Gm43078 |
predicted gene 43078 |
8633 |
0.26 |
chr5_69340326_69341842 | 2.78 |
Gm24368 |
predicted gene, 24368 |
301 |
0.69 |
chr3_24938514_24938665 | 2.78 |
Gm42774 |
predicted gene 42774 |
69116 |
0.13 |
chr15_7194818_7195373 | 2.78 |
Egflam |
EGF-like, fibronectin type III and laminin G domains |
27974 |
0.21 |
chr6_28864735_28865082 | 2.78 |
Snd1 |
staphylococcal nuclease and tudor domain containing 1 |
15135 |
0.19 |
chr17_6445889_6446624 | 2.78 |
Tmem181b-ps |
transmembrane protein 181B, pseudogene |
2839 |
0.21 |
chr1_89136370_89136521 | 2.78 |
Gm38312 |
predicted gene, 38312 |
39372 |
0.16 |
chr5_112276495_112277340 | 2.78 |
Tpst2 |
protein-tyrosine sulfotransferase 2 |
210 |
0.9 |
chr7_96474512_96474810 | 2.77 |
Rps11-ps5 |
ribosomal protein S11, pseudogene 5 |
38644 |
0.17 |
chr10_3417310_3417750 | 2.77 |
Gm24482 |
predicted gene, 24482 |
7493 |
0.25 |
chr17_31919307_31919684 | 2.76 |
Gm30571 |
predicted gene, 30571 |
6829 |
0.14 |
chr13_59859701_59859852 | 2.76 |
Gm48384 |
predicted gene, 48384 |
13866 |
0.12 |
chr12_117344591_117345571 | 2.75 |
Gm5441 |
predicted gene 5441 |
8059 |
0.29 |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
1.3 | 3.8 | GO:0021912 | regulation of transcription from RNA polymerase II promoter involved in spinal cord motor neuron fate specification(GO:0021912) |
1.0 | 3.1 | GO:2000686 | regulation of rubidium ion transmembrane transporter activity(GO:2000686) |
1.0 | 4.9 | GO:0021764 | amygdala development(GO:0021764) |
0.9 | 2.8 | GO:0097118 | neuroligin clustering involved in postsynaptic membrane assembly(GO:0097118) |
0.9 | 2.7 | GO:0031296 | B cell costimulation(GO:0031296) |
0.9 | 2.7 | GO:1903279 | regulation of calcium:sodium antiporter activity(GO:1903279) |
0.9 | 3.5 | GO:0098735 | positive regulation of the force of heart contraction(GO:0098735) |
0.8 | 3.4 | GO:0010288 | response to lead ion(GO:0010288) |
0.8 | 3.2 | GO:0042138 | meiotic DNA double-strand break formation(GO:0042138) |
0.8 | 2.4 | GO:0019065 | receptor-mediated endocytosis of virus by host cell(GO:0019065) endocytosis involved in viral entry into host cell(GO:0075509) |
0.8 | 2.4 | GO:0060585 | regulation of prostaglandin-endoperoxide synthase activity(GO:0060584) positive regulation of prostaglandin-endoperoxide synthase activity(GO:0060585) |
0.8 | 2.3 | GO:0035021 | negative regulation of Rac protein signal transduction(GO:0035021) |
0.8 | 2.3 | GO:2000173 | negative regulation of branching morphogenesis of a nerve(GO:2000173) |
0.8 | 2.3 | GO:0071873 | response to norepinephrine(GO:0071873) |
0.7 | 2.2 | GO:0021824 | cerebral cortex tangential migration using cell-axon interactions(GO:0021824) gonadotrophin-releasing hormone neuronal migration to the hypothalamus(GO:0021828) hypothalamic tangential migration using cell-axon interactions(GO:0021856) facioacoustic ganglion development(GO:1903375) |
0.7 | 2.2 | GO:1902564 | negative regulation of neutrophil activation(GO:1902564) |
0.7 | 2.2 | GO:0033505 | floor plate morphogenesis(GO:0033505) |
0.7 | 2.1 | GO:0048880 | sensory system development(GO:0048880) |
0.7 | 2.1 | GO:0098903 | regulation of membrane repolarization during action potential(GO:0098903) |
0.7 | 1.4 | GO:1901529 | positive regulation of anion channel activity(GO:1901529) |
0.7 | 3.4 | GO:0035331 | negative regulation of hippo signaling(GO:0035331) |
0.6 | 1.8 | GO:1902071 | regulation of hypoxia-inducible factor-1alpha signaling pathway(GO:1902071) |
0.6 | 1.8 | GO:0060468 | prevention of polyspermy(GO:0060468) |
0.6 | 1.7 | GO:0002125 | maternal aggressive behavior(GO:0002125) |
0.5 | 2.2 | GO:0001880 | Mullerian duct regression(GO:0001880) |
0.5 | 2.2 | GO:2001184 | positive regulation of interleukin-12 secretion(GO:2001184) |
0.5 | 1.1 | GO:0009449 | gamma-aminobutyric acid biosynthetic process(GO:0009449) |
0.5 | 1.0 | GO:0060847 | endothelial cell fate specification(GO:0060847) |
0.5 | 3.1 | GO:0070314 | G1 to G0 transition(GO:0070314) |
0.5 | 2.5 | GO:0046618 | drug export(GO:0046618) |
0.5 | 1.0 | GO:0061551 | trigeminal ganglion development(GO:0061551) |
0.5 | 2.0 | GO:0030091 | protein repair(GO:0030091) |
0.5 | 1.0 | GO:0051794 | regulation of catagen(GO:0051794) |
0.5 | 1.5 | GO:0055099 | response to high density lipoprotein particle(GO:0055099) |
0.5 | 2.4 | GO:0007171 | activation of transmembrane receptor protein tyrosine kinase activity(GO:0007171) |
0.5 | 3.8 | GO:0019800 | peptide cross-linking via chondroitin 4-sulfate glycosaminoglycan(GO:0019800) |
0.5 | 0.9 | GO:0060137 | maternal process involved in parturition(GO:0060137) |
0.5 | 2.8 | GO:0007158 | neuron cell-cell adhesion(GO:0007158) |
0.4 | 4.4 | GO:0071625 | vocalization behavior(GO:0071625) |
0.4 | 0.9 | GO:0090259 | regulation of retinal ganglion cell axon guidance(GO:0090259) |
0.4 | 1.3 | GO:0002930 | trabecular meshwork development(GO:0002930) |
0.4 | 2.6 | GO:0046958 | nonassociative learning(GO:0046958) |
0.4 | 0.4 | GO:1903797 | positive regulation of inorganic anion transmembrane transport(GO:1903797) |
0.4 | 0.9 | GO:0070777 | D-aspartate transport(GO:0070777) D-aspartate import(GO:0070779) |
0.4 | 3.4 | GO:0097151 | positive regulation of inhibitory postsynaptic potential(GO:0097151) |
0.4 | 0.8 | GO:0035434 | copper ion transmembrane transport(GO:0035434) |
0.4 | 1.2 | GO:0034729 | histone H3-K79 methylation(GO:0034729) |
0.4 | 0.4 | GO:0035793 | cell migration involved in kidney development(GO:0035787) cell migration involved in metanephros development(GO:0035788) metanephric mesenchymal cell migration(GO:0035789) positive regulation of metanephric mesenchymal cell migration by platelet-derived growth factor receptor-beta signaling pathway(GO:0035793) regulation of metanephric mesenchymal cell migration by platelet-derived growth factor receptor-beta signaling pathway(GO:1900238) regulation of metanephric mesenchymal cell migration(GO:2000589) positive regulation of metanephric mesenchymal cell migration(GO:2000591) |
0.4 | 1.2 | GO:0046103 | inosine biosynthetic process(GO:0046103) |
0.4 | 1.2 | GO:2000721 | positive regulation of transcription from RNA polymerase II promoter involved in smooth muscle cell differentiation(GO:2000721) |
0.4 | 1.2 | GO:2000860 | positive regulation of mineralocorticoid secretion(GO:2000857) positive regulation of aldosterone secretion(GO:2000860) |
0.4 | 3.1 | GO:0071420 | cellular response to histamine(GO:0071420) |
0.4 | 1.9 | GO:0035701 | hematopoietic stem cell migration(GO:0035701) |
0.4 | 2.3 | GO:0045714 | regulation of low-density lipoprotein particle receptor biosynthetic process(GO:0045714) |
0.4 | 2.3 | GO:1904424 | regulation of GTP binding(GO:1904424) |
0.4 | 1.1 | GO:0010963 | regulation of L-arginine import(GO:0010963) |
0.4 | 1.5 | GO:0045113 | regulation of integrin biosynthetic process(GO:0045113) |
0.4 | 0.7 | GO:0045869 | negative regulation of single stranded viral RNA replication via double stranded DNA intermediate(GO:0045869) |
0.4 | 1.1 | GO:0090310 | negative regulation of methylation-dependent chromatin silencing(GO:0090310) |
0.4 | 1.1 | GO:0016080 | synaptic vesicle targeting(GO:0016080) |
0.4 | 2.2 | GO:0042985 | negative regulation of amyloid precursor protein biosynthetic process(GO:0042985) |
0.4 | 1.1 | GO:0044339 | canonical Wnt signaling pathway involved in osteoblast differentiation(GO:0044339) |
0.4 | 1.1 | GO:0097168 | mesenchymal stem cell proliferation(GO:0097168) |
0.4 | 1.1 | GO:2001055 | positive regulation of mesenchymal cell apoptotic process(GO:2001055) |
0.4 | 1.1 | GO:0014734 | skeletal muscle hypertrophy(GO:0014734) |
0.4 | 1.1 | GO:0060486 | Clara cell differentiation(GO:0060486) |
0.4 | 1.4 | GO:0019276 | UDP-N-acetylgalactosamine metabolic process(GO:0019276) |
0.4 | 0.7 | GO:0035359 | negative regulation of peroxisome proliferator activated receptor signaling pathway(GO:0035359) |
0.3 | 2.4 | GO:1904322 | response to forskolin(GO:1904321) cellular response to forskolin(GO:1904322) |
0.3 | 0.3 | GO:1903909 | regulation of receptor clustering(GO:1903909) |
0.3 | 5.4 | GO:0031290 | retinal ganglion cell axon guidance(GO:0031290) |
0.3 | 2.3 | GO:0021796 | cerebral cortex regionalization(GO:0021796) |
0.3 | 6.4 | GO:0021952 | central nervous system projection neuron axonogenesis(GO:0021952) |
0.3 | 1.0 | GO:0030421 | defecation(GO:0030421) |
0.3 | 1.0 | GO:0015746 | tricarboxylic acid transport(GO:0006842) citrate transport(GO:0015746) |
0.3 | 2.6 | GO:0021860 | pyramidal neuron development(GO:0021860) |
0.3 | 1.0 | GO:1902498 | regulation of protein autoubiquitination(GO:1902498) |
0.3 | 0.7 | GO:1903261 | regulation of serine phosphorylation of STAT3 protein(GO:1903261) |
0.3 | 1.0 | GO:1904956 | regulation of midbrain dopaminergic neuron differentiation(GO:1904956) |
0.3 | 1.6 | GO:0043654 | recognition of apoptotic cell(GO:0043654) |
0.3 | 0.9 | GO:0014053 | negative regulation of gamma-aminobutyric acid secretion(GO:0014053) |
0.3 | 0.9 | GO:0035984 | response to trichostatin A(GO:0035983) cellular response to trichostatin A(GO:0035984) |
0.3 | 1.2 | GO:0035521 | monoubiquitinated histone deubiquitination(GO:0035521) monoubiquitinated histone H2A deubiquitination(GO:0035522) |
0.3 | 1.2 | GO:2000622 | regulation of nuclear-transcribed mRNA catabolic process, nonsense-mediated decay(GO:2000622) negative regulation of nuclear-transcribed mRNA catabolic process, nonsense-mediated decay(GO:2000623) |
0.3 | 0.9 | GO:1902261 | positive regulation of delayed rectifier potassium channel activity(GO:1902261) positive regulation of voltage-gated potassium channel activity(GO:1903818) |
0.3 | 1.2 | GO:0050975 | sensory perception of touch(GO:0050975) |
0.3 | 2.1 | GO:1902018 | negative regulation of cilium assembly(GO:1902018) |
0.3 | 2.1 | GO:0090557 | establishment of endothelial intestinal barrier(GO:0090557) |
0.3 | 0.6 | GO:0048677 | axon extension involved in regeneration(GO:0048677) sprouting of injured axon(GO:0048682) |
0.3 | 0.6 | GO:1900020 | regulation of protein kinase C activity(GO:1900019) positive regulation of protein kinase C activity(GO:1900020) |
0.3 | 1.8 | GO:0048251 | elastic fiber assembly(GO:0048251) |
0.3 | 0.6 | GO:2000852 | corticosterone secretion(GO:0035934) regulation of corticosterone secretion(GO:2000852) |
0.3 | 1.5 | GO:0014052 | regulation of gamma-aminobutyric acid secretion(GO:0014052) |
0.3 | 3.9 | GO:0034389 | lipid particle organization(GO:0034389) |
0.3 | 0.6 | GO:0035905 | ascending aorta development(GO:0035905) ascending aorta morphogenesis(GO:0035910) |
0.3 | 0.8 | GO:0032289 | central nervous system myelin formation(GO:0032289) |
0.3 | 0.8 | GO:0014707 | branchiomeric skeletal muscle development(GO:0014707) |
0.3 | 1.4 | GO:1902913 | positive regulation of neuroepithelial cell differentiation(GO:1902913) |
0.3 | 1.3 | GO:0021869 | forebrain ventricular zone progenitor cell division(GO:0021869) |
0.3 | 0.8 | GO:0072051 | juxtaglomerular apparatus development(GO:0072051) |
0.3 | 1.3 | GO:0048852 | diencephalon morphogenesis(GO:0048852) |
0.3 | 0.5 | GO:0072198 | mesenchymal cell proliferation involved in ureter development(GO:0072198) regulation of mesenchymal cell proliferation involved in ureter development(GO:0072199) |
0.3 | 1.6 | GO:0090308 | regulation of methylation-dependent chromatin silencing(GO:0090308) |
0.3 | 0.5 | GO:0097155 | fasciculation of sensory neuron axon(GO:0097155) |
0.3 | 1.3 | GO:1900122 | positive regulation of receptor binding(GO:1900122) |
0.3 | 1.3 | GO:0000160 | phosphorelay signal transduction system(GO:0000160) |
0.3 | 1.3 | GO:1901525 | negative regulation of macromitophagy(GO:1901525) |
0.3 | 0.5 | GO:0097105 | presynaptic membrane assembly(GO:0097105) |
0.2 | 1.2 | GO:0014028 | notochord formation(GO:0014028) |
0.2 | 0.7 | GO:0070634 | transepithelial ammonium transport(GO:0070634) |
0.2 | 0.7 | GO:0046167 | glycerol-3-phosphate biosynthetic process(GO:0046167) |
0.2 | 0.7 | GO:0061356 | Wnt protein secretion(GO:0061355) regulation of Wnt protein secretion(GO:0061356) |
0.2 | 1.7 | GO:2000310 | regulation of N-methyl-D-aspartate selective glutamate receptor activity(GO:2000310) |
0.2 | 0.2 | GO:0060523 | prostate epithelial cord elongation(GO:0060523) |
0.2 | 0.7 | GO:0048143 | astrocyte activation(GO:0048143) |
0.2 | 6.7 | GO:0007616 | long-term memory(GO:0007616) |
0.2 | 0.5 | GO:1901843 | positive regulation of high voltage-gated calcium channel activity(GO:1901843) |
0.2 | 1.1 | GO:0010739 | positive regulation of protein kinase A signaling(GO:0010739) |
0.2 | 0.5 | GO:0070366 | regulation of hepatocyte differentiation(GO:0070366) |
0.2 | 0.7 | GO:0038026 | reelin-mediated signaling pathway(GO:0038026) |
0.2 | 0.4 | GO:0097119 | postsynaptic density protein 95 clustering(GO:0097119) |
0.2 | 0.2 | GO:1902373 | negative regulation of mRNA catabolic process(GO:1902373) |
0.2 | 2.2 | GO:0071803 | positive regulation of podosome assembly(GO:0071803) |
0.2 | 0.9 | GO:0017183 | peptidyl-diphthamide metabolic process(GO:0017182) peptidyl-diphthamide biosynthetic process from peptidyl-histidine(GO:0017183) |
0.2 | 0.8 | GO:0070213 | protein auto-ADP-ribosylation(GO:0070213) |
0.2 | 0.8 | GO:0051387 | negative regulation of neurotrophin TRK receptor signaling pathway(GO:0051387) |
0.2 | 0.6 | GO:0060128 | corticotropin hormone secreting cell differentiation(GO:0060128) |
0.2 | 0.6 | GO:0061502 | early endosome to recycling endosome transport(GO:0061502) |
0.2 | 0.6 | GO:0035860 | glial cell-derived neurotrophic factor receptor signaling pathway(GO:0035860) |
0.2 | 0.6 | GO:2000574 | regulation of microtubule motor activity(GO:2000574) |
0.2 | 0.8 | GO:1900194 | negative regulation of oocyte maturation(GO:1900194) |
0.2 | 0.6 | GO:0006714 | sesquiterpenoid metabolic process(GO:0006714) |
0.2 | 1.0 | GO:0030222 | eosinophil differentiation(GO:0030222) |
0.2 | 1.0 | GO:0090336 | positive regulation of brown fat cell differentiation(GO:0090336) |
0.2 | 1.2 | GO:0072307 | metanephric nephron tubule epithelial cell differentiation(GO:0072257) regulation of metanephric nephron tubule epithelial cell differentiation(GO:0072307) |
0.2 | 0.6 | GO:0060066 | oviduct development(GO:0060066) |
0.2 | 0.8 | GO:0060075 | regulation of resting membrane potential(GO:0060075) |
0.2 | 0.6 | GO:0098904 | regulation of AV node cell action potential(GO:0098904) |
0.2 | 0.8 | GO:0090500 | endocardial cushion to mesenchymal transition(GO:0090500) |
0.2 | 0.6 | GO:0046882 | negative regulation of follicle-stimulating hormone secretion(GO:0046882) |
0.2 | 0.4 | GO:0003104 | positive regulation of glomerular filtration(GO:0003104) |
0.2 | 0.2 | GO:0006549 | isoleucine metabolic process(GO:0006549) |
0.2 | 0.6 | GO:0061086 | negative regulation of histone H3-K27 methylation(GO:0061086) |
0.2 | 0.7 | GO:0007412 | axon target recognition(GO:0007412) |
0.2 | 2.0 | GO:0061154 | endothelial tube morphogenesis(GO:0061154) |
0.2 | 1.1 | GO:0010917 | negative regulation of mitochondrial membrane potential(GO:0010917) |
0.2 | 0.5 | GO:0071673 | positive regulation of smooth muscle cell chemotaxis(GO:0071673) |
0.2 | 0.2 | GO:0043091 | L-arginine import(GO:0043091) arginine import(GO:0090467) L-arginine transport(GO:1902023) |
0.2 | 0.7 | GO:0097428 | protein maturation by iron-sulfur cluster transfer(GO:0097428) |
0.2 | 2.5 | GO:1900119 | positive regulation of execution phase of apoptosis(GO:1900119) |
0.2 | 1.3 | GO:0042760 | very long-chain fatty acid catabolic process(GO:0042760) |
0.2 | 0.9 | GO:1901341 | activation of store-operated calcium channel activity(GO:0032237) positive regulation of store-operated calcium channel activity(GO:1901341) |
0.2 | 0.7 | GO:0060355 | positive regulation of cell adhesion molecule production(GO:0060355) |
0.2 | 0.3 | GO:0097091 | synaptic vesicle clustering(GO:0097091) |
0.2 | 0.3 | GO:0060448 | dichotomous subdivision of terminal units involved in lung branching(GO:0060448) |
0.2 | 0.9 | GO:0090244 | Wnt signaling pathway involved in somitogenesis(GO:0090244) |
0.2 | 0.3 | GO:0099558 | maintenance of synapse structure(GO:0099558) |
0.2 | 0.3 | GO:0021564 | vagus nerve development(GO:0021564) |
0.2 | 0.7 | GO:0010890 | positive regulation of sequestering of triglyceride(GO:0010890) |
0.2 | 0.5 | GO:0090296 | regulation of mitochondrial DNA replication(GO:0090296) |
0.2 | 0.5 | GO:0071896 | protein localization to adherens junction(GO:0071896) |
0.2 | 0.7 | GO:1904393 | regulation of skeletal muscle acetylcholine-gated channel clustering(GO:1904393) positive regulation of skeletal muscle acetylcholine-gated channel clustering(GO:1904395) |
0.2 | 0.7 | GO:0002606 | positive regulation of dendritic cell antigen processing and presentation(GO:0002606) |
0.2 | 0.7 | GO:1903799 | negative regulation of production of miRNAs involved in gene silencing by miRNA(GO:1903799) |
0.2 | 1.6 | GO:0006105 | succinate metabolic process(GO:0006105) |
0.2 | 1.0 | GO:0043589 | skin morphogenesis(GO:0043589) |
0.2 | 0.6 | GO:0031223 | auditory behavior(GO:0031223) |
0.2 | 1.0 | GO:0032367 | intracellular cholesterol transport(GO:0032367) |
0.2 | 0.3 | GO:0050883 | musculoskeletal movement, spinal reflex action(GO:0050883) |
0.2 | 0.5 | GO:0048842 | positive regulation of axon extension involved in axon guidance(GO:0048842) positive regulation of axon guidance(GO:1902669) |
0.2 | 0.9 | GO:0097084 | vascular smooth muscle cell development(GO:0097084) |
0.2 | 0.5 | GO:0061304 | retinal blood vessel morphogenesis(GO:0061304) |
0.2 | 0.5 | GO:0070093 | negative regulation of glucagon secretion(GO:0070093) |
0.2 | 1.1 | GO:0018344 | protein geranylgeranylation(GO:0018344) |
0.2 | 0.3 | GO:0035865 | response to potassium ion(GO:0035864) cellular response to potassium ion(GO:0035865) |
0.2 | 0.3 | GO:0060907 | positive regulation of macrophage cytokine production(GO:0060907) |
0.2 | 0.5 | GO:0032687 | negative regulation of interferon-alpha production(GO:0032687) |
0.2 | 0.2 | GO:0061743 | motor learning(GO:0061743) |
0.2 | 0.8 | GO:1903772 | regulation of viral budding via host ESCRT complex(GO:1903772) |
0.2 | 1.1 | GO:1903608 | protein localization to cytoplasmic stress granule(GO:1903608) |
0.2 | 0.3 | GO:0035964 | COPI-coated vesicle budding(GO:0035964) |
0.2 | 0.3 | GO:0090071 | negative regulation of ribosome biogenesis(GO:0090071) |
0.1 | 0.4 | GO:0010482 | epidermal cell division(GO:0010481) regulation of epidermal cell division(GO:0010482) |
0.1 | 0.3 | GO:0090271 | positive regulation of fibroblast growth factor production(GO:0090271) |
0.1 | 0.6 | GO:0022038 | corpus callosum development(GO:0022038) |
0.1 | 0.4 | GO:0010728 | regulation of hydrogen peroxide biosynthetic process(GO:0010728) |
0.1 | 0.3 | GO:0001831 | trophectodermal cellular morphogenesis(GO:0001831) |
0.1 | 0.4 | GO:0001712 | ectodermal cell fate commitment(GO:0001712) |
0.1 | 0.4 | GO:0046341 | CDP-diacylglycerol metabolic process(GO:0046341) |
0.1 | 0.6 | GO:0019919 | peptidyl-arginine methylation, to asymmetrical-dimethyl arginine(GO:0019919) |
0.1 | 0.1 | GO:0036022 | limb joint morphogenesis(GO:0036022) embryonic skeletal limb joint morphogenesis(GO:0036023) |
0.1 | 0.4 | GO:0015755 | fructose transport(GO:0015755) |
0.1 | 1.0 | GO:0060947 | cardiac vascular smooth muscle cell differentiation(GO:0060947) |
0.1 | 0.6 | GO:0019478 | D-amino acid catabolic process(GO:0019478) |
0.1 | 0.3 | GO:0089711 | L-glutamate transmembrane transport(GO:0089711) |
0.1 | 0.8 | GO:0060923 | cardiac muscle cell fate commitment(GO:0060923) |
0.1 | 2.4 | GO:0008045 | motor neuron axon guidance(GO:0008045) |
0.1 | 0.7 | GO:0032906 | transforming growth factor beta2 production(GO:0032906) regulation of transforming growth factor beta2 production(GO:0032909) |
0.1 | 0.3 | GO:0021631 | optic nerve morphogenesis(GO:0021631) |
0.1 | 4.4 | GO:0007271 | synaptic transmission, cholinergic(GO:0007271) |
0.1 | 0.5 | GO:0021520 | spinal cord motor neuron cell fate specification(GO:0021520) |
0.1 | 0.8 | GO:0051045 | negative regulation of membrane protein ectodomain proteolysis(GO:0051045) |
0.1 | 0.7 | GO:0007256 | activation of JNKK activity(GO:0007256) |
0.1 | 0.4 | GO:0006564 | L-serine biosynthetic process(GO:0006564) |
0.1 | 1.8 | GO:0016486 | peptide hormone processing(GO:0016486) |
0.1 | 0.4 | GO:0035526 | retrograde transport, plasma membrane to Golgi(GO:0035526) |
0.1 | 0.4 | GO:2000394 | positive regulation of lamellipodium morphogenesis(GO:2000394) |
0.1 | 0.1 | GO:0001998 | angiotensin mediated vasoconstriction involved in regulation of systemic arterial blood pressure(GO:0001998) |
0.1 | 0.4 | GO:0048861 | leukemia inhibitory factor signaling pathway(GO:0048861) |
0.1 | 0.5 | GO:0071692 | protein localization to extracellular region(GO:0071692) maintenance of protein location in extracellular region(GO:0071694) |
0.1 | 0.4 | GO:0015889 | cobalamin transport(GO:0015889) |
0.1 | 0.7 | GO:0048681 | negative regulation of axon regeneration(GO:0048681) |
0.1 | 0.5 | GO:0060762 | regulation of branching involved in mammary gland duct morphogenesis(GO:0060762) |
0.1 | 0.4 | GO:1904479 | negative regulation of intestinal absorption(GO:1904479) |
0.1 | 0.1 | GO:0032570 | response to progesterone(GO:0032570) |
0.1 | 0.4 | GO:0060666 | dichotomous subdivision of terminal units involved in salivary gland branching(GO:0060666) |
0.1 | 0.3 | GO:0014042 | positive regulation of neuron maturation(GO:0014042) |
0.1 | 0.8 | GO:0019262 | N-acetylneuraminate catabolic process(GO:0019262) |
0.1 | 2.3 | GO:0003416 | endochondral bone growth(GO:0003416) |
0.1 | 0.4 | GO:0006566 | threonine metabolic process(GO:0006566) |
0.1 | 0.5 | GO:0060830 | ciliary receptor clustering involved in smoothened signaling pathway(GO:0060830) |
0.1 | 0.4 | GO:0070444 | oligodendrocyte progenitor proliferation(GO:0070444) regulation of oligodendrocyte progenitor proliferation(GO:0070445) |
0.1 | 0.1 | GO:0060594 | mammary gland specification(GO:0060594) |
0.1 | 2.7 | GO:0030574 | collagen catabolic process(GO:0030574) |
0.1 | 0.2 | GO:1902514 | regulation of calcium ion transmembrane transport via high voltage-gated calcium channel(GO:1902514) |
0.1 | 4.1 | GO:0051489 | regulation of filopodium assembly(GO:0051489) |
0.1 | 4.1 | GO:0010761 | fibroblast migration(GO:0010761) |
0.1 | 0.2 | GO:1902414 | protein localization to cell junction(GO:1902414) |
0.1 | 0.5 | GO:0046543 | development of secondary female sexual characteristics(GO:0046543) |
0.1 | 0.2 | GO:0051964 | negative regulation of synapse assembly(GO:0051964) |
0.1 | 0.5 | GO:0044341 | sodium-dependent phosphate transport(GO:0044341) |
0.1 | 0.2 | GO:2000304 | positive regulation of sphingolipid biosynthetic process(GO:0090154) positive regulation of ceramide biosynthetic process(GO:2000304) |
0.1 | 1.8 | GO:0007214 | gamma-aminobutyric acid signaling pathway(GO:0007214) |
0.1 | 0.5 | GO:1901621 | negative regulation of smoothened signaling pathway involved in dorsal/ventral neural tube patterning(GO:1901621) |
0.1 | 1.5 | GO:0035116 | embryonic hindlimb morphogenesis(GO:0035116) |
0.1 | 1.2 | GO:0060384 | innervation(GO:0060384) |
0.1 | 0.5 | GO:0031339 | negative regulation of vesicle fusion(GO:0031339) |
0.1 | 0.4 | GO:0002282 | microglial cell activation involved in immune response(GO:0002282) |
0.1 | 0.2 | GO:0003256 | regulation of transcription from RNA polymerase II promoter involved in myocardial precursor cell differentiation(GO:0003256) |
0.1 | 0.8 | GO:0070050 | neuron cellular homeostasis(GO:0070050) |
0.1 | 0.6 | GO:0036120 | cellular response to platelet-derived growth factor stimulus(GO:0036120) |
0.1 | 0.2 | GO:0060054 | positive regulation of epithelial cell proliferation involved in wound healing(GO:0060054) |
0.1 | 0.4 | GO:2000696 | regulation of epithelial cell differentiation involved in kidney development(GO:2000696) |
0.1 | 1.2 | GO:0060052 | neurofilament cytoskeleton organization(GO:0060052) |
0.1 | 0.1 | GO:0009233 | menaquinone metabolic process(GO:0009233) |
0.1 | 1.0 | GO:0071380 | cellular response to prostaglandin E stimulus(GO:0071380) |
0.1 | 0.5 | GO:0030007 | cellular potassium ion homeostasis(GO:0030007) |
0.1 | 0.3 | GO:0009957 | epidermal cell fate specification(GO:0009957) |
0.1 | 1.0 | GO:0031643 | positive regulation of myelination(GO:0031643) |
0.1 | 0.1 | GO:0060763 | mammary duct terminal end bud growth(GO:0060763) |
0.1 | 0.2 | GO:0002386 | immune response in mucosal-associated lymphoid tissue(GO:0002386) |
0.1 | 0.3 | GO:1904694 | negative regulation of vascular smooth muscle contraction(GO:1904694) |
0.1 | 0.8 | GO:0032060 | bleb assembly(GO:0032060) |
0.1 | 3.2 | GO:0015988 | energy coupled proton transmembrane transport, against electrochemical gradient(GO:0015988) ATP hydrolysis coupled proton transport(GO:0015991) ATP hydrolysis coupled transmembrane transport(GO:0090662) |
0.1 | 0.7 | GO:0060124 | positive regulation of growth hormone secretion(GO:0060124) |
0.1 | 0.1 | GO:0086029 | Purkinje myocyte to ventricular cardiac muscle cell signaling(GO:0086029) Purkinje myocyte to ventricular cardiac muscle cell communication(GO:0086068) |
0.1 | 2.6 | GO:0043268 | positive regulation of potassium ion transport(GO:0043268) |
0.1 | 0.1 | GO:0010966 | regulation of phosphate transport(GO:0010966) |
0.1 | 0.4 | GO:0043987 | histone H3-S10 phosphorylation(GO:0043987) |
0.1 | 0.3 | GO:0007638 | mechanosensory behavior(GO:0007638) |
0.1 | 0.2 | GO:0021794 | thalamus development(GO:0021794) |
0.1 | 0.4 | GO:0010835 | regulation of protein ADP-ribosylation(GO:0010835) |
0.1 | 0.2 | GO:1990035 | calcium ion import into cell(GO:1990035) |
0.1 | 0.3 | GO:0071801 | regulation of podosome assembly(GO:0071801) |
0.1 | 0.4 | GO:0031117 | positive regulation of microtubule depolymerization(GO:0031117) |
0.1 | 0.5 | GO:0001842 | neural fold formation(GO:0001842) |
0.1 | 0.2 | GO:0003383 | apical constriction(GO:0003383) |
0.1 | 1.0 | GO:0061339 | establishment of monopolar cell polarity(GO:0061162) establishment or maintenance of monopolar cell polarity(GO:0061339) |
0.1 | 0.4 | GO:0044838 | cell quiescence(GO:0044838) |
0.1 | 0.1 | GO:0003099 | positive regulation of the force of heart contraction by epinephrine-norepinephrine(GO:0001997) positive regulation of the force of heart contraction by chemical signal(GO:0003099) |
0.1 | 0.2 | GO:0021523 | somatic motor neuron differentiation(GO:0021523) |
0.1 | 1.8 | GO:0048642 | negative regulation of skeletal muscle tissue development(GO:0048642) |
0.1 | 0.3 | GO:0050882 | voluntary musculoskeletal movement(GO:0050882) |
0.1 | 0.6 | GO:2000601 | positive regulation of Arp2/3 complex-mediated actin nucleation(GO:2000601) |
0.1 | 0.3 | GO:0000710 | meiotic mismatch repair(GO:0000710) |
0.1 | 0.2 | GO:2000096 | positive regulation of Wnt signaling pathway, planar cell polarity pathway(GO:2000096) |
0.1 | 0.7 | GO:0033601 | positive regulation of mammary gland epithelial cell proliferation(GO:0033601) |
0.1 | 0.4 | GO:0035405 | histone-threonine phosphorylation(GO:0035405) |
0.1 | 0.7 | GO:1990126 | retrograde transport, endosome to plasma membrane(GO:1990126) |
0.1 | 0.5 | GO:0045657 | positive regulation of monocyte differentiation(GO:0045657) |
0.1 | 0.3 | GO:2000483 | negative regulation of interleukin-8 secretion(GO:2000483) |
0.1 | 0.1 | GO:0032417 | positive regulation of sodium:proton antiporter activity(GO:0032417) |
0.1 | 0.3 | GO:0001827 | inner cell mass cell fate commitment(GO:0001827) |
0.1 | 0.4 | GO:0010815 | bradykinin catabolic process(GO:0010815) |
0.1 | 0.3 | GO:0036476 | neuron death in response to hydrogen peroxide(GO:0036476) regulation of hydrogen peroxide-induced neuron death(GO:1903207) negative regulation of hydrogen peroxide-induced neuron death(GO:1903208) |
0.1 | 0.4 | GO:0050955 | thermoception(GO:0050955) |
0.1 | 0.5 | GO:0097500 | receptor localization to nonmotile primary cilium(GO:0097500) |
0.1 | 0.3 | GO:0036092 | phosphatidylinositol-3-phosphate biosynthetic process(GO:0036092) |
0.1 | 0.6 | GO:0032790 | ribosome disassembly(GO:0032790) |
0.1 | 0.2 | GO:0006600 | creatine metabolic process(GO:0006600) |
0.1 | 0.3 | GO:0070100 | negative regulation of chemokine-mediated signaling pathway(GO:0070100) |
0.1 | 0.2 | GO:0045629 | negative regulation of T-helper 2 cell differentiation(GO:0045629) |
0.1 | 0.2 | GO:0060480 | lung goblet cell differentiation(GO:0060480) |
0.1 | 0.4 | GO:0032808 | lacrimal gland development(GO:0032808) |
0.1 | 0.3 | GO:0031936 | negative regulation of chromatin silencing(GO:0031936) |
0.1 | 0.2 | GO:0019230 | proprioception(GO:0019230) |
0.1 | 0.5 | GO:0035878 | nail development(GO:0035878) |
0.1 | 0.2 | GO:0009826 | unidimensional cell growth(GO:0009826) |
0.1 | 0.3 | GO:0035973 | aggrephagy(GO:0035973) |
0.1 | 0.1 | GO:0061511 | centriole elongation(GO:0061511) |
0.1 | 0.3 | GO:0005513 | detection of calcium ion(GO:0005513) |
0.1 | 0.2 | GO:0002434 | immune complex clearance(GO:0002434) |
0.1 | 0.1 | GO:1902809 | regulation of skeletal muscle fiber differentiation(GO:1902809) |
0.1 | 0.2 | GO:0032988 | ribonucleoprotein complex disassembly(GO:0032988) |
0.1 | 0.3 | GO:0001992 | regulation of systemic arterial blood pressure by vasopressin(GO:0001992) |
0.1 | 0.2 | GO:0060028 | convergent extension involved in axis elongation(GO:0060028) |
0.1 | 0.5 | GO:2001014 | regulation of skeletal muscle cell differentiation(GO:2001014) |
0.1 | 0.3 | GO:0090135 | actin filament branching(GO:0090135) |
0.1 | 0.8 | GO:0007342 | fusion of sperm to egg plasma membrane(GO:0007342) |
0.1 | 0.1 | GO:0072053 | renal inner medulla development(GO:0072053) |
0.1 | 0.4 | GO:0009202 | deoxyribonucleoside triphosphate biosynthetic process(GO:0009202) |
0.1 | 0.6 | GO:1902902 | negative regulation of autophagosome assembly(GO:1902902) |
0.1 | 0.2 | GO:0042376 | phylloquinone metabolic process(GO:0042374) phylloquinone catabolic process(GO:0042376) quinone catabolic process(GO:1901662) |
0.1 | 0.6 | GO:0006689 | ganglioside catabolic process(GO:0006689) |
0.1 | 0.2 | GO:1903223 | positive regulation of oxidative stress-induced neuron death(GO:1903223) |
0.1 | 0.2 | GO:0072176 | nephric duct development(GO:0072176) nephric duct morphogenesis(GO:0072178) |
0.1 | 0.1 | GO:0008065 | establishment of blood-nerve barrier(GO:0008065) |
0.1 | 0.2 | GO:0060371 | regulation of atrial cardiac muscle cell membrane depolarization(GO:0060371) |
0.1 | 0.5 | GO:0071557 | histone H3-K27 demethylation(GO:0071557) |
0.1 | 0.1 | GO:0003413 | chondrocyte differentiation involved in endochondral bone morphogenesis(GO:0003413) |
0.1 | 0.2 | GO:0090210 | regulation of establishment of blood-brain barrier(GO:0090210) |
0.1 | 0.4 | GO:0035414 | negative regulation of catenin import into nucleus(GO:0035414) |
0.1 | 0.2 | GO:0061092 | regulation of phospholipid translocation(GO:0061091) positive regulation of phospholipid translocation(GO:0061092) |
0.1 | 0.2 | GO:0000255 | allantoin metabolic process(GO:0000255) |
0.1 | 0.2 | GO:0060363 | cranial suture morphogenesis(GO:0060363) |
0.1 | 0.2 | GO:0070488 | neutrophil aggregation(GO:0070488) |
0.1 | 0.5 | GO:0001778 | plasma membrane repair(GO:0001778) |
0.1 | 0.4 | GO:0002035 | brain renin-angiotensin system(GO:0002035) |
0.1 | 0.1 | GO:0090403 | oxidative stress-induced premature senescence(GO:0090403) |
0.1 | 0.4 | GO:0060856 | establishment of blood-brain barrier(GO:0060856) |
0.1 | 0.7 | GO:2000671 | regulation of motor neuron apoptotic process(GO:2000671) |
0.1 | 0.7 | GO:0060576 | intestinal epithelial cell development(GO:0060576) |
0.1 | 0.4 | GO:0038063 | collagen-activated tyrosine kinase receptor signaling pathway(GO:0038063) |
0.1 | 0.4 | GO:0035235 | ionotropic glutamate receptor signaling pathway(GO:0035235) |
0.1 | 0.4 | GO:0016266 | O-glycan processing(GO:0016266) |
0.1 | 0.7 | GO:0060081 | membrane hyperpolarization(GO:0060081) |
0.1 | 0.1 | GO:0090361 | platelet-derived growth factor production(GO:0090360) regulation of platelet-derived growth factor production(GO:0090361) |
0.1 | 0.5 | GO:0008300 | isoprenoid catabolic process(GO:0008300) |
0.1 | 0.2 | GO:0060729 | intestinal epithelial structure maintenance(GO:0060729) |
0.1 | 0.1 | GO:0060971 | embryonic heart tube left/right pattern formation(GO:0060971) |
0.1 | 0.4 | GO:0009642 | response to light intensity(GO:0009642) |
0.1 | 0.4 | GO:0000270 | peptidoglycan metabolic process(GO:0000270) peptidoglycan catabolic process(GO:0009253) |
0.1 | 0.2 | GO:0030382 | sperm mitochondrion organization(GO:0030382) |
0.1 | 0.1 | GO:1902866 | regulation of retina development in camera-type eye(GO:1902866) |
0.1 | 0.6 | GO:0006590 | thyroid hormone generation(GO:0006590) |
0.1 | 0.3 | GO:0061668 | mitochondrial ribosome assembly(GO:0061668) |
0.1 | 0.4 | GO:0007175 | negative regulation of epidermal growth factor-activated receptor activity(GO:0007175) |
0.1 | 0.3 | GO:0090080 | positive regulation of MAPKKK cascade by fibroblast growth factor receptor signaling pathway(GO:0090080) |
0.1 | 0.5 | GO:2000463 | positive regulation of excitatory postsynaptic potential(GO:2000463) |
0.1 | 0.1 | GO:0046684 | response to pyrethroid(GO:0046684) |
0.1 | 0.1 | GO:0043380 | regulation of memory T cell differentiation(GO:0043380) |
0.1 | 0.3 | GO:2001198 | regulation of dendritic cell differentiation(GO:2001198) negative regulation of dendritic cell differentiation(GO:2001199) |
0.1 | 0.8 | GO:0035640 | exploration behavior(GO:0035640) |
0.1 | 0.3 | GO:0003025 | regulation of systemic arterial blood pressure by baroreceptor feedback(GO:0003025) |
0.1 | 0.3 | GO:0072675 | osteoclast fusion(GO:0072675) |
0.1 | 0.2 | GO:0097283 | keratinocyte apoptotic process(GO:0097283) regulation of keratinocyte apoptotic process(GO:1902172) |
0.1 | 0.1 | GO:0035694 | mitochondrial protein catabolic process(GO:0035694) |
0.1 | 0.1 | GO:0090238 | positive regulation of arachidonic acid secretion(GO:0090238) |
0.1 | 0.1 | GO:0070350 | white fat cell proliferation(GO:0070343) regulation of white fat cell proliferation(GO:0070350) |
0.1 | 0.4 | GO:2001224 | positive regulation of neuron migration(GO:2001224) |
0.1 | 1.0 | GO:0050927 | positive regulation of positive chemotaxis(GO:0050927) |
0.1 | 0.1 | GO:0002339 | B cell selection(GO:0002339) |
0.1 | 0.3 | GO:0071918 | urea transmembrane transport(GO:0071918) |
0.1 | 0.1 | GO:2001023 | regulation of response to drug(GO:2001023) |
0.1 | 0.3 | GO:0060134 | prepulse inhibition(GO:0060134) |
0.1 | 0.3 | GO:0032792 | negative regulation of CREB transcription factor activity(GO:0032792) |
0.1 | 0.2 | GO:1901873 | regulation of post-translational protein modification(GO:1901873) negative regulation of post-translational protein modification(GO:1901874) |
0.1 | 0.1 | GO:0010693 | negative regulation of alkaline phosphatase activity(GO:0010693) |
0.1 | 0.3 | GO:0048539 | bone marrow development(GO:0048539) |
0.1 | 0.1 | GO:2000680 | regulation of rubidium ion transport(GO:2000680) |
0.1 | 0.1 | GO:0033058 | directional locomotion(GO:0033058) |
0.1 | 0.1 | GO:0046379 | extracellular polysaccharide biosynthetic process(GO:0045226) extracellular polysaccharide metabolic process(GO:0046379) |
0.1 | 0.7 | GO:0010842 | retina layer formation(GO:0010842) |
0.1 | 0.5 | GO:0071578 | zinc II ion transmembrane import(GO:0071578) |
0.1 | 0.1 | GO:0036091 | positive regulation of transcription from RNA polymerase II promoter in response to oxidative stress(GO:0036091) |
0.1 | 0.7 | GO:0046549 | retinal cone cell development(GO:0046549) |
0.1 | 0.1 | GO:0060449 | bud elongation involved in lung branching(GO:0060449) |
0.1 | 0.1 | GO:0071638 | negative regulation of monocyte chemotactic protein-1 production(GO:0071638) |
0.1 | 0.2 | GO:0002097 | tRNA wobble base modification(GO:0002097) |
0.1 | 0.1 | GO:0021913 | regulation of transcription from RNA polymerase II promoter involved in ventral spinal cord interneuron specification(GO:0021913) |
0.1 | 0.2 | GO:0021798 | forebrain dorsal/ventral pattern formation(GO:0021798) |
0.1 | 0.1 | GO:2000097 | regulation of smooth muscle cell-matrix adhesion(GO:2000097) |
0.1 | 0.6 | GO:0045197 | establishment or maintenance of epithelial cell apical/basal polarity(GO:0045197) |
0.1 | 2.0 | GO:1901998 | toxin transport(GO:1901998) |
0.1 | 0.1 | GO:0048669 | collateral sprouting in absence of injury(GO:0048669) |
0.1 | 0.3 | GO:0044829 | positive regulation by host of viral genome replication(GO:0044829) |
0.1 | 0.2 | GO:0097094 | craniofacial suture morphogenesis(GO:0097094) |
0.1 | 0.2 | GO:0034628 | nicotinamide nucleotide biosynthetic process from aspartate(GO:0019355) 'de novo' NAD biosynthetic process from aspartate(GO:0034628) |
0.1 | 0.2 | GO:0006203 | dGTP catabolic process(GO:0006203) |
0.1 | 0.1 | GO:0001661 | conditioned taste aversion(GO:0001661) |
0.1 | 0.9 | GO:0046627 | negative regulation of insulin receptor signaling pathway(GO:0046627) |
0.1 | 0.1 | GO:0060837 | blood vessel endothelial cell differentiation(GO:0060837) |
0.1 | 0.2 | GO:0042276 | error-prone translesion synthesis(GO:0042276) |
0.1 | 0.1 | GO:0033210 | leptin-mediated signaling pathway(GO:0033210) |
0.1 | 0.2 | GO:0035740 | CD8-positive, alpha-beta T cell proliferation(GO:0035740) |
0.1 | 0.1 | GO:0061626 | pharyngeal arch artery morphogenesis(GO:0061626) |
0.1 | 0.2 | GO:0035963 | response to interleukin-13(GO:0035962) cellular response to interleukin-13(GO:0035963) |
0.1 | 0.2 | GO:0051152 | positive regulation of smooth muscle cell differentiation(GO:0051152) |
0.1 | 0.1 | GO:0014826 | vein smooth muscle contraction(GO:0014826) |
0.1 | 0.2 | GO:0050957 | equilibrioception(GO:0050957) |
0.1 | 0.5 | GO:0001964 | startle response(GO:0001964) |
0.1 | 0.5 | GO:1902590 | viral budding(GO:0046755) multi-organism organelle organization(GO:1902590) multi-organism membrane budding(GO:1902592) |
0.1 | 0.3 | GO:1900273 | positive regulation of long-term synaptic potentiation(GO:1900273) |
0.1 | 0.3 | GO:0015074 | DNA integration(GO:0015074) |
0.1 | 0.9 | GO:0071475 | cellular hyperosmotic salinity response(GO:0071475) |
0.1 | 0.2 | GO:1903894 | regulation of IRE1-mediated unfolded protein response(GO:1903894) |
0.1 | 0.1 | GO:0061438 | renal system vasculature morphogenesis(GO:0061438) kidney vasculature morphogenesis(GO:0061439) glomerulus vasculature morphogenesis(GO:0072103) glomerular capillary formation(GO:0072104) metanephric glomerulus vasculature development(GO:0072239) metanephric glomerulus morphogenesis(GO:0072275) metanephric glomerulus vasculature morphogenesis(GO:0072276) metanephric glomerular capillary formation(GO:0072277) |
0.1 | 0.1 | GO:0006681 | galactosylceramide metabolic process(GO:0006681) |
0.1 | 0.5 | GO:0001780 | neutrophil homeostasis(GO:0001780) |
0.1 | 0.2 | GO:0007196 | adenylate cyclase-inhibiting G-protein coupled glutamate receptor signaling pathway(GO:0007196) |
0.1 | 0.7 | GO:1901385 | regulation of voltage-gated calcium channel activity(GO:1901385) |
0.1 | 0.3 | GO:1902715 | positive regulation of interferon-gamma secretion(GO:1902715) |
0.1 | 0.5 | GO:2000311 | regulation of alpha-amino-3-hydroxy-5-methyl-4-isoxazole propionate selective glutamate receptor activity(GO:2000311) |
0.1 | 0.3 | GO:0048743 | positive regulation of skeletal muscle fiber development(GO:0048743) |
0.1 | 0.3 | GO:0006477 | protein sulfation(GO:0006477) |
0.1 | 0.6 | GO:0007202 | activation of phospholipase C activity(GO:0007202) |
0.1 | 0.2 | GO:0034154 | toll-like receptor 7 signaling pathway(GO:0034154) |
0.1 | 0.1 | GO:0045354 | interferon-alpha biosynthetic process(GO:0045349) regulation of interferon-alpha biosynthetic process(GO:0045354) positive regulation of interferon-alpha biosynthetic process(GO:0045356) |
0.1 | 0.1 | GO:1902410 | mitotic cytokinetic process(GO:1902410) |
0.1 | 0.2 | GO:0048014 | Tie signaling pathway(GO:0048014) |
0.1 | 0.2 | GO:0006391 | transcription initiation from mitochondrial promoter(GO:0006391) |
0.1 | 0.1 | GO:0060459 | left lung development(GO:0060459) left lung morphogenesis(GO:0060460) |
0.1 | 0.2 | GO:0032261 | purine nucleotide salvage(GO:0032261) IMP salvage(GO:0032264) |
0.1 | 0.1 | GO:0035887 | aortic smooth muscle cell differentiation(GO:0035887) |
0.1 | 0.4 | GO:0006610 | ribosomal protein import into nucleus(GO:0006610) |
0.1 | 0.5 | GO:0034472 | snRNA 3'-end processing(GO:0034472) |
0.1 | 0.6 | GO:0042104 | positive regulation of activated T cell proliferation(GO:0042104) |
0.1 | 0.1 | GO:0071699 | olfactory placode formation(GO:0030910) olfactory placode development(GO:0071698) olfactory placode morphogenesis(GO:0071699) |
0.1 | 0.2 | GO:0018364 | peptidyl-glutamine methylation(GO:0018364) |
0.1 | 0.1 | GO:0060161 | positive regulation of dopamine receptor signaling pathway(GO:0060161) |
0.1 | 0.2 | GO:0031915 | positive regulation of synaptic plasticity(GO:0031915) |
0.1 | 1.0 | GO:0021954 | central nervous system neuron development(GO:0021954) |
0.1 | 0.1 | GO:0071205 | protein localization to juxtaparanode region of axon(GO:0071205) |
0.1 | 0.2 | GO:2000211 | regulation of glutamate metabolic process(GO:2000211) |
0.1 | 0.8 | GO:2001222 | regulation of neuron migration(GO:2001222) |
0.1 | 0.2 | GO:0002051 | osteoblast fate commitment(GO:0002051) |
0.1 | 0.2 | GO:0007042 | lysosomal lumen acidification(GO:0007042) |
0.0 | 0.1 | GO:0010626 | negative regulation of Schwann cell proliferation(GO:0010626) |
0.0 | 0.7 | GO:0009954 | proximal/distal pattern formation(GO:0009954) |
0.0 | 0.1 | GO:0042520 | positive regulation of tyrosine phosphorylation of Stat4 protein(GO:0042520) |
0.0 | 0.3 | GO:1901223 | negative regulation of NIK/NF-kappaB signaling(GO:1901223) |
0.0 | 1.3 | GO:0003333 | amino acid transmembrane transport(GO:0003333) |
0.0 | 0.5 | GO:1903861 | regulation of dendrite extension(GO:1903859) positive regulation of dendrite extension(GO:1903861) |
0.0 | 0.2 | GO:2000676 | positive regulation of type B pancreatic cell apoptotic process(GO:2000676) |
0.0 | 0.4 | GO:0045793 | positive regulation of cell size(GO:0045793) |
0.0 | 0.1 | GO:0070141 | response to UV-A(GO:0070141) |
0.0 | 0.2 | GO:0051967 | negative regulation of synaptic transmission, glutamatergic(GO:0051967) |
0.0 | 0.4 | GO:0002063 | chondrocyte development(GO:0002063) |
0.0 | 0.2 | GO:0045617 | negative regulation of keratinocyte differentiation(GO:0045617) |
0.0 | 0.1 | GO:0014900 | regulation of muscle hyperplasia(GO:0014738) muscle hyperplasia(GO:0014900) |
0.0 | 0.1 | GO:0036444 | calcium ion transmembrane import into mitochondrion(GO:0036444) |
0.0 | 0.2 | GO:0045404 | positive regulation of interleukin-4 biosynthetic process(GO:0045404) |
0.0 | 0.1 | GO:0043928 | exonucleolytic nuclear-transcribed mRNA catabolic process involved in deadenylation-dependent decay(GO:0043928) |
0.0 | 0.2 | GO:0016139 | glycoside catabolic process(GO:0016139) |
0.0 | 0.7 | GO:0021795 | cerebral cortex cell migration(GO:0021795) |
0.0 | 0.3 | GO:0050655 | dermatan sulfate proteoglycan metabolic process(GO:0050655) |
0.0 | 0.0 | GO:0002730 | regulation of dendritic cell cytokine production(GO:0002730) |
0.0 | 0.1 | GO:0099625 | regulation of ventricular cardiac muscle cell membrane repolarization(GO:0060307) ventricular cardiac muscle cell membrane repolarization(GO:0099625) |
0.0 | 2.0 | GO:0030042 | actin filament depolymerization(GO:0030042) |
0.0 | 0.1 | GO:0003222 | ventricular trabecula myocardium morphogenesis(GO:0003222) |
0.0 | 0.2 | GO:0050847 | progesterone receptor signaling pathway(GO:0050847) |
0.0 | 0.2 | GO:0002158 | osteoclast proliferation(GO:0002158) |
0.0 | 0.1 | GO:0060741 | prostate gland stromal morphogenesis(GO:0060741) |
0.0 | 0.2 | GO:1903301 | positive regulation of glucokinase activity(GO:0033133) positive regulation of hexokinase activity(GO:1903301) |
0.0 | 1.0 | GO:0001755 | neural crest cell migration(GO:0001755) |
0.0 | 0.2 | GO:0032596 | protein transport into membrane raft(GO:0032596) |
0.0 | 0.1 | GO:0060743 | epithelial cell maturation involved in prostate gland development(GO:0060743) |
0.0 | 0.0 | GO:0070094 | positive regulation of glucagon secretion(GO:0070094) |
0.0 | 0.0 | GO:0060426 | lung vasculature development(GO:0060426) |
0.0 | 0.3 | GO:0046218 | tryptophan catabolic process(GO:0006569) tryptophan catabolic process to kynurenine(GO:0019441) indole-containing compound catabolic process(GO:0042436) indolalkylamine catabolic process(GO:0046218) |
0.0 | 0.0 | GO:0061156 | pulmonary artery morphogenesis(GO:0061156) |
0.0 | 0.1 | GO:0060405 | regulation of penile erection(GO:0060405) positive regulation of penile erection(GO:0060406) |
0.0 | 0.1 | GO:1900116 | sequestering of extracellular ligand from receptor(GO:0035581) extracellular regulation of signal transduction(GO:1900115) extracellular negative regulation of signal transduction(GO:1900116) |
0.0 | 0.0 | GO:0072309 | mesenchymal stem cell maintenance involved in metanephric nephron morphogenesis(GO:0072309) |
0.0 | 0.3 | GO:0043508 | negative regulation of JUN kinase activity(GO:0043508) |
0.0 | 0.3 | GO:0032957 | inositol trisphosphate metabolic process(GO:0032957) |
0.0 | 0.7 | GO:0061462 | protein localization to lysosome(GO:0061462) |
0.0 | 0.0 | GO:0032077 | positive regulation of deoxyribonuclease activity(GO:0032077) |
0.0 | 0.3 | GO:0008038 | neuron recognition(GO:0008038) |
0.0 | 0.2 | GO:0098908 | regulation of neuronal action potential(GO:0098908) |
0.0 | 0.3 | GO:0060050 | positive regulation of protein glycosylation(GO:0060050) |
0.0 | 0.2 | GO:0030311 | poly-N-acetyllactosamine metabolic process(GO:0030309) poly-N-acetyllactosamine biosynthetic process(GO:0030311) |
0.0 | 0.0 | GO:0071481 | cellular response to X-ray(GO:0071481) |
0.0 | 0.1 | GO:0032483 | regulation of Rab protein signal transduction(GO:0032483) |
0.0 | 0.3 | GO:0016322 | neuron remodeling(GO:0016322) |
0.0 | 0.2 | GO:0033564 | anterior/posterior axon guidance(GO:0033564) |
0.0 | 0.1 | GO:1903587 | regulation of blood vessel endothelial cell proliferation involved in sprouting angiogenesis(GO:1903587) |
0.0 | 0.1 | GO:1904995 | negative regulation of leukocyte adhesion to vascular endothelial cell(GO:1904995) |
0.0 | 0.5 | GO:1902236 | negative regulation of endoplasmic reticulum stress-induced intrinsic apoptotic signaling pathway(GO:1902236) |
0.0 | 0.0 | GO:0001543 | ovarian follicle rupture(GO:0001543) |
0.0 | 0.1 | GO:0000715 | nucleotide-excision repair, DNA damage recognition(GO:0000715) |
0.0 | 0.1 | GO:0010587 | miRNA catabolic process(GO:0010587) |
0.0 | 0.0 | GO:1904380 | endoplasmic reticulum mannose trimming(GO:1904380) |
0.0 | 0.2 | GO:0015879 | carnitine transport(GO:0015879) |
0.0 | 0.1 | GO:0043084 | penile erection(GO:0043084) |
0.0 | 0.3 | GO:2000480 | negative regulation of cAMP-dependent protein kinase activity(GO:2000480) |
0.0 | 0.1 | GO:0090037 | positive regulation of protein kinase C signaling(GO:0090037) |
0.0 | 0.1 | GO:0015747 | urate transport(GO:0015747) |
0.0 | 0.1 | GO:0009313 | oligosaccharide catabolic process(GO:0009313) |
0.0 | 0.2 | GO:1902895 | positive regulation of pri-miRNA transcription from RNA polymerase II promoter(GO:1902895) |
0.0 | 0.0 | GO:1904430 | negative regulation of t-circle formation(GO:1904430) |
0.0 | 0.4 | GO:0018298 | protein-chromophore linkage(GO:0018298) |
0.0 | 0.1 | GO:1901491 | negative regulation of lymphangiogenesis(GO:1901491) |
0.0 | 0.1 | GO:0000389 | mRNA 3'-splice site recognition(GO:0000389) |
0.0 | 0.1 | GO:0060509 | Type I pneumocyte differentiation(GO:0060509) |
0.0 | 0.1 | GO:1903392 | negative regulation of adherens junction organization(GO:1903392) |
0.0 | 0.2 | GO:0018158 | protein oxidation(GO:0018158) |
0.0 | 0.2 | GO:0070262 | peptidyl-serine dephosphorylation(GO:0070262) |
0.0 | 0.2 | GO:0033326 | cerebrospinal fluid secretion(GO:0033326) |
0.0 | 0.5 | GO:0045956 | positive regulation of calcium ion-dependent exocytosis(GO:0045956) |
0.0 | 0.1 | GO:0070682 | proteasome regulatory particle assembly(GO:0070682) |
0.0 | 0.1 | GO:0060005 | vestibular reflex(GO:0060005) |
0.0 | 0.9 | GO:0046839 | phospholipid dephosphorylation(GO:0046839) |
0.0 | 0.1 | GO:0042253 | granulocyte macrophage colony-stimulating factor biosynthetic process(GO:0042253) regulation of granulocyte macrophage colony-stimulating factor biosynthetic process(GO:0045423) |
0.0 | 0.1 | GO:0060166 | olfactory pit development(GO:0060166) |
0.0 | 0.1 | GO:0035928 | rRNA import into mitochondrion(GO:0035928) |
0.0 | 0.0 | GO:0009211 | pyrimidine deoxyribonucleoside triphosphate metabolic process(GO:0009211) |
0.0 | 0.4 | GO:0032695 | negative regulation of interleukin-12 production(GO:0032695) |
0.0 | 0.1 | GO:0097503 | sialylation(GO:0097503) |
0.0 | 0.1 | GO:0035747 | natural killer cell chemotaxis(GO:0035747) regulation of natural killer cell chemotaxis(GO:2000501) |
0.0 | 0.2 | GO:0097062 | dendritic spine maintenance(GO:0097062) |
0.0 | 0.1 | GO:0006768 | biotin metabolic process(GO:0006768) |
0.0 | 0.0 | GO:0045163 | clustering of voltage-gated potassium channels(GO:0045163) |
0.0 | 0.1 | GO:0000733 | DNA strand renaturation(GO:0000733) |
0.0 | 0.1 | GO:0034047 | regulation of protein phosphatase type 2A activity(GO:0034047) |
0.0 | 0.2 | GO:1900113 | negative regulation of histone H3-K9 trimethylation(GO:1900113) |
0.0 | 0.1 | GO:0016264 | gap junction assembly(GO:0016264) |
0.0 | 0.1 | GO:0002023 | reduction of food intake in response to dietary excess(GO:0002023) |
0.0 | 0.1 | GO:0032066 | nucleolus to nucleoplasm transport(GO:0032066) |
0.0 | 0.1 | GO:0071596 | ubiquitin-dependent protein catabolic process via the N-end rule pathway(GO:0071596) |
0.0 | 0.3 | GO:0030857 | negative regulation of epithelial cell differentiation(GO:0030857) |
0.0 | 0.1 | GO:0002017 | regulation of blood volume by renal aldosterone(GO:0002017) |
0.0 | 0.3 | GO:0002755 | MyD88-dependent toll-like receptor signaling pathway(GO:0002755) |
0.0 | 0.4 | GO:0090382 | phagosome maturation(GO:0090382) |
0.0 | 0.1 | GO:0000727 | double-strand break repair via break-induced replication(GO:0000727) |
0.0 | 0.1 | GO:0060244 | negative regulation of cell proliferation involved in contact inhibition(GO:0060244) |
0.0 | 0.1 | GO:0061084 | negative regulation of protein refolding(GO:0061084) |
0.0 | 0.3 | GO:0032119 | sequestering of zinc ion(GO:0032119) regulation of sequestering of zinc ion(GO:0061088) |
0.0 | 0.1 | GO:1902369 | negative regulation of RNA catabolic process(GO:1902369) |
0.0 | 0.1 | GO:0002581 | negative regulation of antigen processing and presentation of peptide or polysaccharide antigen via MHC class II(GO:0002581) |
0.0 | 0.6 | GO:0046854 | phosphatidylinositol phosphorylation(GO:0046854) |
0.0 | 0.1 | GO:0002069 | columnar/cuboidal epithelial cell maturation(GO:0002069) |
0.0 | 0.1 | GO:0010991 | negative regulation of SMAD protein complex assembly(GO:0010991) |
0.0 | 0.0 | GO:1900377 | negative regulation of melanin biosynthetic process(GO:0048022) negative regulation of secondary metabolite biosynthetic process(GO:1900377) |
0.0 | 0.1 | GO:0070162 | adiponectin secretion(GO:0070162) regulation of adiponectin secretion(GO:0070163) |
0.0 | 0.1 | GO:0031536 | positive regulation of exit from mitosis(GO:0031536) |
0.0 | 0.3 | GO:0035176 | social behavior(GO:0035176) intraspecies interaction between organisms(GO:0051703) |
0.0 | 0.2 | GO:0048671 | negative regulation of collateral sprouting(GO:0048671) |
0.0 | 0.2 | GO:0046110 | xanthine metabolic process(GO:0046110) |
0.0 | 0.3 | GO:0006002 | fructose 6-phosphate metabolic process(GO:0006002) |
0.0 | 0.1 | GO:0002756 | MyD88-independent toll-like receptor signaling pathway(GO:0002756) |
0.0 | 0.2 | GO:2000009 | negative regulation of protein localization to cell surface(GO:2000009) |
0.0 | 0.2 | GO:0046146 | tetrahydrobiopterin metabolic process(GO:0046146) |
0.0 | 0.3 | GO:0043248 | proteasome assembly(GO:0043248) |
0.0 | 0.0 | GO:0048532 | anatomical structure arrangement(GO:0048532) |
0.0 | 0.1 | GO:0021854 | hypothalamus development(GO:0021854) |
0.0 | 0.1 | GO:1900042 | positive regulation of interleukin-2 secretion(GO:1900042) |
0.0 | 0.0 | GO:0045112 | integrin biosynthetic process(GO:0045112) |
0.0 | 0.1 | GO:0070203 | regulation of establishment of protein localization to telomere(GO:0070203) |
0.0 | 0.0 | GO:2000491 | positive regulation of hepatic stellate cell activation(GO:2000491) |
0.0 | 0.1 | GO:0051593 | response to folic acid(GO:0051593) |
0.0 | 0.6 | GO:0042755 | eating behavior(GO:0042755) |
0.0 | 0.1 | GO:0018916 | nitrobenzene metabolic process(GO:0018916) |
0.0 | 2.0 | GO:0007156 | homophilic cell adhesion via plasma membrane adhesion molecules(GO:0007156) |
0.0 | 0.2 | GO:0051418 | interphase microtubule nucleation by interphase microtubule organizing center(GO:0051415) microtubule nucleation by microtubule organizing center(GO:0051418) |
0.0 | 0.3 | GO:0009312 | oligosaccharide biosynthetic process(GO:0009312) |
0.0 | 0.1 | GO:2000051 | negative regulation of non-canonical Wnt signaling pathway(GO:2000051) |
0.0 | 0.1 | GO:0017198 | N-terminal peptidyl-serine acetylation(GO:0017198) N-terminal peptidyl-glutamic acid acetylation(GO:0018002) peptidyl-serine acetylation(GO:0030920) |
0.0 | 0.3 | GO:0006910 | phagocytosis, recognition(GO:0006910) |
0.0 | 0.0 | GO:0043497 | regulation of protein heterodimerization activity(GO:0043497) |
0.0 | 0.2 | GO:0061099 | negative regulation of protein tyrosine kinase activity(GO:0061099) |
0.0 | 0.1 | GO:0006432 | phenylalanyl-tRNA aminoacylation(GO:0006432) |
0.0 | 0.0 | GO:0060391 | positive regulation of SMAD protein import into nucleus(GO:0060391) |
0.0 | 0.2 | GO:0090177 | establishment of planar polarity involved in neural tube closure(GO:0090177) |
0.0 | 0.4 | GO:0043171 | peptide catabolic process(GO:0043171) |
0.0 | 0.3 | GO:0045762 | positive regulation of adenylate cyclase activity(GO:0045762) |
0.0 | 0.1 | GO:0042359 | vitamin D metabolic process(GO:0042359) |
0.0 | 0.1 | GO:0006524 | alanine catabolic process(GO:0006524) pyruvate family amino acid catabolic process(GO:0009080) |
0.0 | 0.1 | GO:0034227 | tRNA thio-modification(GO:0034227) |
0.0 | 0.1 | GO:2000773 | negative regulation of cellular senescence(GO:2000773) |
0.0 | 1.3 | GO:0001764 | neuron migration(GO:0001764) |
0.0 | 0.1 | GO:0097112 | gamma-aminobutyric acid receptor clustering(GO:0097112) |
0.0 | 0.1 | GO:0045348 | positive regulation of MHC class II biosynthetic process(GO:0045348) |
0.0 | 0.1 | GO:0046391 | 5-phosphoribose 1-diphosphate biosynthetic process(GO:0006015) 5-phosphoribose 1-diphosphate metabolic process(GO:0046391) |
0.0 | 0.1 | GO:0034421 | post-translational protein acetylation(GO:0034421) |
0.0 | 0.1 | GO:0006646 | phosphatidylethanolamine biosynthetic process(GO:0006646) |
0.0 | 0.3 | GO:0021987 | cerebral cortex development(GO:0021987) |
0.0 | 0.1 | GO:0051014 | actin filament severing(GO:0051014) |
0.0 | 0.0 | GO:1902774 | late endosome to lysosome transport(GO:1902774) |
0.0 | 0.2 | GO:0010738 | regulation of protein kinase A signaling(GO:0010738) |
0.0 | 0.0 | GO:0048936 | peripheral nervous system neuron axonogenesis(GO:0048936) |
0.0 | 0.1 | GO:0018377 | protein myristoylation(GO:0018377) |
0.0 | 0.2 | GO:0035337 | fatty-acyl-CoA metabolic process(GO:0035337) |
0.0 | 0.2 | GO:0016082 | synaptic vesicle priming(GO:0016082) |
0.0 | 0.2 | GO:0008616 | queuosine biosynthetic process(GO:0008616) queuosine metabolic process(GO:0046116) |
0.0 | 0.2 | GO:0043536 | positive regulation of blood vessel endothelial cell migration(GO:0043536) |
0.0 | 0.0 | GO:0003032 | detection of oxygen(GO:0003032) |
0.0 | 0.1 | GO:0060831 | smoothened signaling pathway involved in dorsal/ventral neural tube patterning(GO:0060831) |
0.0 | 0.0 | GO:0060398 | regulation of growth hormone receptor signaling pathway(GO:0060398) positive regulation of growth hormone receptor signaling pathway(GO:0060399) |
0.0 | 0.2 | GO:0046322 | negative regulation of fatty acid oxidation(GO:0046322) |
0.0 | 0.0 | GO:0071169 | establishment of protein localization to chromatin(GO:0071169) |
0.0 | 0.0 | GO:0015888 | thiamine transport(GO:0015888) |
0.0 | 0.1 | GO:0032020 | ISG15-protein conjugation(GO:0032020) |
0.0 | 0.0 | GO:0010446 | response to alkaline pH(GO:0010446) |
0.0 | 0.5 | GO:0047496 | vesicle transport along microtubule(GO:0047496) |
0.0 | 0.1 | GO:0033136 | serine phosphorylation of STAT3 protein(GO:0033136) |
0.0 | 0.1 | GO:0097264 | self proteolysis(GO:0097264) |
0.0 | 0.0 | GO:0061004 | pattern specification involved in kidney development(GO:0061004) renal system pattern specification(GO:0072048) |
0.0 | 0.1 | GO:0032196 | transposition(GO:0032196) |
0.0 | 0.1 | GO:0035970 | peptidyl-threonine dephosphorylation(GO:0035970) |
0.0 | 0.5 | GO:0048286 | lung alveolus development(GO:0048286) |
0.0 | 0.0 | GO:1904016 | response to Thyroglobulin triiodothyronine(GO:1904016) cellular response to Thyroglobulin triiodothyronine(GO:1904017) |
0.0 | 0.1 | GO:0071930 | negative regulation of transcription involved in G1/S transition of mitotic cell cycle(GO:0071930) |
0.0 | 0.0 | GO:1900227 | positive regulation of NLRP3 inflammasome complex assembly(GO:1900227) |
0.0 | 0.1 | GO:0035507 | regulation of myosin-light-chain-phosphatase activity(GO:0035507) |
0.0 | 0.1 | GO:0006435 | threonyl-tRNA aminoacylation(GO:0006435) |
0.0 | 0.1 | GO:0097411 | hypoxia-inducible factor-1alpha signaling pathway(GO:0097411) |
0.0 | 0.0 | GO:2000551 | regulation of T-helper 2 cell cytokine production(GO:2000551) |
0.0 | 0.2 | GO:0060547 | negative regulation of necroptotic process(GO:0060546) negative regulation of necrotic cell death(GO:0060547) |
0.0 | 0.0 | GO:0010996 | response to auditory stimulus(GO:0010996) |
0.0 | 0.2 | GO:0006264 | mitochondrial DNA replication(GO:0006264) |
0.0 | 0.0 | GO:1902202 | regulation of hepatocyte growth factor receptor signaling pathway(GO:1902202) |
0.0 | 0.0 | GO:0001757 | somite specification(GO:0001757) |
0.0 | 0.2 | GO:0070525 | tRNA threonylcarbamoyladenosine metabolic process(GO:0070525) |
0.0 | 0.1 | GO:1903025 | regulation of RNA polymerase II regulatory region sequence-specific DNA binding(GO:1903025) |
0.0 | 0.0 | GO:0090331 | negative regulation of platelet aggregation(GO:0090331) |
0.0 | 0.1 | GO:2001212 | regulation of vasculogenesis(GO:2001212) |
0.0 | 0.0 | GO:0002538 | arachidonic acid metabolite production involved in inflammatory response(GO:0002538) leukotriene production involved in inflammatory response(GO:0002540) |
0.0 | 0.0 | GO:0046834 | lipid phosphorylation(GO:0046834) |
0.0 | 0.1 | GO:0030837 | negative regulation of actin filament polymerization(GO:0030837) |
0.0 | 0.1 | GO:1990845 | diet induced thermogenesis(GO:0002024) adaptive thermogenesis(GO:1990845) |
0.0 | 0.2 | GO:0001967 | suckling behavior(GO:0001967) |
0.0 | 0.1 | GO:1900028 | negative regulation of ruffle assembly(GO:1900028) |
0.0 | 0.0 | GO:0060433 | bronchus development(GO:0060433) lobar bronchus epithelium development(GO:0060481) lobar bronchus development(GO:0060482) |
0.0 | 0.0 | GO:1900425 | negative regulation of defense response to bacterium(GO:1900425) |
0.0 | 0.1 | GO:0051150 | regulation of smooth muscle cell differentiation(GO:0051150) negative regulation of smooth muscle cell differentiation(GO:0051151) |
0.0 | 0.0 | GO:0032929 | negative regulation of superoxide anion generation(GO:0032929) |
0.0 | 0.1 | GO:0010606 | positive regulation of cytoplasmic mRNA processing body assembly(GO:0010606) |
0.0 | 0.0 | GO:0036462 | TRAIL-activated apoptotic signaling pathway(GO:0036462) |
0.0 | 0.5 | GO:0070979 | protein K11-linked ubiquitination(GO:0070979) |
0.0 | 0.1 | GO:0016584 | nucleosome positioning(GO:0016584) |
0.0 | 0.1 | GO:0015808 | L-alanine transport(GO:0015808) |
0.0 | 0.2 | GO:0010765 | positive regulation of sodium ion transport(GO:0010765) |
0.0 | 0.0 | GO:0061002 | negative regulation of dendritic spine morphogenesis(GO:0061002) |
0.0 | 0.2 | GO:0015985 | energy coupled proton transport, down electrochemical gradient(GO:0015985) ATP synthesis coupled proton transport(GO:0015986) |
0.0 | 0.0 | GO:0035441 | cell migration involved in vasculogenesis(GO:0035441) |
0.0 | 0.1 | GO:0043518 | negative regulation of DNA damage response, signal transduction by p53 class mediator(GO:0043518) |
0.0 | 0.1 | GO:0072643 | interferon-gamma secretion(GO:0072643) |
0.0 | 0.2 | GO:0050434 | positive regulation of viral transcription(GO:0050434) |
0.0 | 0.2 | GO:0010586 | miRNA metabolic process(GO:0010586) |
0.0 | 0.1 | GO:0042473 | outer ear morphogenesis(GO:0042473) |
0.0 | 0.1 | GO:0034205 | beta-amyloid formation(GO:0034205) |
0.0 | 0.0 | GO:0042523 | positive regulation of tyrosine phosphorylation of Stat5 protein(GO:0042523) |
0.0 | 0.0 | GO:0051466 | corticotropin-releasing hormone secretion(GO:0043396) regulation of corticotropin-releasing hormone secretion(GO:0043397) positive regulation of corticotropin-releasing hormone secretion(GO:0051466) |
0.0 | 0.0 | GO:0060633 | negative regulation of transcription initiation from RNA polymerase II promoter(GO:0060633) negative regulation of DNA-templated transcription, initiation(GO:2000143) |
0.0 | 0.0 | GO:0060665 | regulation of branching involved in salivary gland morphogenesis by mesenchymal-epithelial signaling(GO:0060665) |
0.0 | 0.1 | GO:0072540 | T-helper 17 cell lineage commitment(GO:0072540) |
0.0 | 0.0 | GO:1900193 | regulation of oocyte maturation(GO:1900193) |
0.0 | 0.0 | GO:0035927 | RNA import into mitochondrion(GO:0035927) |
0.0 | 0.0 | GO:1990086 | lens fiber cell apoptotic process(GO:1990086) |
0.0 | 0.0 | GO:0007191 | adenylate cyclase-activating dopamine receptor signaling pathway(GO:0007191) |
0.0 | 0.1 | GO:0006559 | L-phenylalanine catabolic process(GO:0006559) tyrosine catabolic process(GO:0006572) erythrose 4-phosphate/phosphoenolpyruvate family amino acid catabolic process(GO:1902222) |
0.0 | 0.0 | GO:0051562 | negative regulation of mitochondrial calcium ion concentration(GO:0051562) |
0.0 | 0.3 | GO:0042348 | regulation of NF-kappaB import into nucleus(GO:0042345) NF-kappaB import into nucleus(GO:0042348) |
0.0 | 0.0 | GO:0032277 | negative regulation of gonadotropin secretion(GO:0032277) |
0.0 | 0.1 | GO:0045161 | neuronal ion channel clustering(GO:0045161) |
0.0 | 0.1 | GO:0072538 | T-helper 17 type immune response(GO:0072538) |
0.0 | 0.1 | GO:0015884 | folic acid transport(GO:0015884) |
0.0 | 0.0 | GO:0035425 | autocrine signaling(GO:0035425) |
0.0 | 0.8 | GO:0071346 | cellular response to interferon-gamma(GO:0071346) |
0.0 | 0.0 | GO:0048294 | negative regulation of isotype switching to IgE isotypes(GO:0048294) |
0.0 | 0.0 | GO:2000646 | positive regulation of receptor catabolic process(GO:2000646) |
0.0 | 0.2 | GO:0000289 | nuclear-transcribed mRNA poly(A) tail shortening(GO:0000289) |
0.0 | 0.0 | GO:0071440 | regulation of histone H3-K14 acetylation(GO:0071440) positive regulation of histone H3-K14 acetylation(GO:0071442) |
0.0 | 0.1 | GO:0016127 | cholesterol catabolic process(GO:0006707) sterol catabolic process(GO:0016127) |
0.0 | 0.0 | GO:0014717 | regulation of satellite cell activation involved in skeletal muscle regeneration(GO:0014717) skeletal muscle satellite cell activation(GO:0014719) satellite cell activation involved in skeletal muscle regeneration(GO:0014901) |
0.0 | 0.0 | GO:0061000 | negative regulation of dendritic spine development(GO:0061000) |
0.0 | 0.1 | GO:0021563 | glossopharyngeal nerve development(GO:0021563) glossopharyngeal nerve morphogenesis(GO:0021615) |
0.0 | 0.1 | GO:0045586 | regulation of gamma-delta T cell differentiation(GO:0045586) regulation of gamma-delta T cell activation(GO:0046643) |
0.0 | 0.1 | GO:0048069 | eye pigmentation(GO:0048069) |
0.0 | 0.2 | GO:1902043 | positive regulation of extrinsic apoptotic signaling pathway via death domain receptors(GO:1902043) |
0.0 | 0.0 | GO:0038128 | ERBB2 signaling pathway(GO:0038128) |
0.0 | 0.1 | GO:2000465 | regulation of glycogen (starch) synthase activity(GO:2000465) |
0.0 | 0.0 | GO:0044034 | negative stranded viral RNA replication(GO:0039689) multi-organism biosynthetic process(GO:0044034) |
0.0 | 0.1 | GO:0019348 | dolichol metabolic process(GO:0019348) |
0.0 | 0.0 | GO:0007468 | regulation of rhodopsin gene expression(GO:0007468) |
0.0 | 0.1 | GO:0097152 | mesenchymal cell apoptotic process(GO:0097152) |
0.0 | 0.1 | GO:0006490 | oligosaccharide-lipid intermediate biosynthetic process(GO:0006490) |
0.0 | 0.0 | GO:0051095 | regulation of helicase activity(GO:0051095) positive regulation of helicase activity(GO:0051096) |
0.0 | 0.0 | GO:0043504 | mitochondrial DNA repair(GO:0043504) |
0.0 | 0.0 | GO:0035246 | peptidyl-arginine N-methylation(GO:0035246) |
0.0 | 0.1 | GO:0000395 | mRNA 5'-splice site recognition(GO:0000395) |
0.0 | 0.0 | GO:0002326 | B cell lineage commitment(GO:0002326) |
0.0 | 0.1 | GO:0031666 | positive regulation of lipopolysaccharide-mediated signaling pathway(GO:0031666) |
0.0 | 0.1 | GO:0090166 | Golgi disassembly(GO:0090166) |
0.0 | 0.0 | GO:0033152 | immunoglobulin V(D)J recombination(GO:0033152) |
0.0 | 0.0 | GO:0070601 | centromeric sister chromatid cohesion(GO:0070601) |
0.0 | 0.0 | GO:0014889 | muscle atrophy(GO:0014889) |
0.0 | 0.1 | GO:0010839 | negative regulation of keratinocyte proliferation(GO:0010839) |
0.0 | 0.0 | GO:0014820 | tonic smooth muscle contraction(GO:0014820) |
0.0 | 0.1 | GO:0045056 | transcytosis(GO:0045056) |
0.0 | 0.0 | GO:0030167 | proteoglycan catabolic process(GO:0030167) |
0.0 | 0.0 | GO:0048254 | snoRNA localization(GO:0048254) |
0.0 | 0.0 | GO:1904754 | positive regulation of vascular associated smooth muscle cell migration(GO:1904754) |
0.0 | 0.0 | GO:0002767 | immune response-inhibiting cell surface receptor signaling pathway(GO:0002767) |
0.0 | 0.0 | GO:0051126 | negative regulation of actin nucleation(GO:0051126) |
0.0 | 0.0 | GO:0003214 | cardiac left ventricle morphogenesis(GO:0003214) |
0.0 | 0.1 | GO:0000711 | meiotic DNA repair synthesis(GO:0000711) |
0.0 | 0.0 | GO:0050968 | detection of chemical stimulus involved in sensory perception of pain(GO:0050968) |
0.0 | 0.0 | GO:0009155 | purine deoxyribonucleotide catabolic process(GO:0009155) |
0.0 | 0.0 | GO:0006570 | tyrosine metabolic process(GO:0006570) |
0.0 | 0.0 | GO:0032366 | intracellular sterol transport(GO:0032366) |
0.0 | 0.1 | GO:0046629 | gamma-delta T cell activation(GO:0046629) |
0.0 | 0.1 | GO:0030259 | lipid glycosylation(GO:0030259) |
0.0 | 0.2 | GO:0045601 | regulation of endothelial cell differentiation(GO:0045601) |
0.0 | 0.1 | GO:0008063 | Toll signaling pathway(GO:0008063) |
0.0 | 0.0 | GO:0021570 | rhombomere 4 development(GO:0021570) |
0.0 | 0.1 | GO:0045039 | protein import into mitochondrial inner membrane(GO:0045039) |
0.0 | 0.2 | GO:1900026 | positive regulation of substrate adhesion-dependent cell spreading(GO:1900026) |
0.0 | 0.0 | GO:0071379 | cellular response to prostaglandin stimulus(GO:0071379) |
0.0 | 0.2 | GO:0042462 | eye photoreceptor cell development(GO:0042462) |
0.0 | 0.0 | GO:1900245 | positive regulation of MDA-5 signaling pathway(GO:1900245) |
0.0 | 0.0 | GO:1902101 | positive regulation of mitotic metaphase/anaphase transition(GO:0045842) positive regulation of metaphase/anaphase transition of cell cycle(GO:1902101) |
0.0 | 0.0 | GO:0000492 | small nucleolar ribonucleoprotein complex assembly(GO:0000491) box C/D snoRNP assembly(GO:0000492) |
0.0 | 0.0 | GO:0046013 | T cell homeostatic proliferation(GO:0001777) regulation of T cell homeostatic proliferation(GO:0046013) |
0.0 | 0.0 | GO:0048070 | regulation of developmental pigmentation(GO:0048070) |
0.0 | 0.1 | GO:0030517 | negative regulation of axon extension(GO:0030517) |
0.0 | 0.1 | GO:0061370 | testosterone biosynthetic process(GO:0061370) |
0.0 | 0.0 | GO:0032512 | regulation of protein phosphatase type 2B activity(GO:0032512) |
0.0 | 0.0 | GO:0060638 | mesenchymal-epithelial cell signaling(GO:0060638) |
0.0 | 0.1 | GO:0034144 | negative regulation of toll-like receptor 4 signaling pathway(GO:0034144) |
0.0 | 0.1 | GO:0051647 | nucleus localization(GO:0051647) |
0.0 | 0.0 | GO:0009757 | carbohydrate mediated signaling(GO:0009756) hexose mediated signaling(GO:0009757) sugar mediated signaling pathway(GO:0010182) glucose mediated signaling pathway(GO:0010255) |
0.0 | 0.0 | GO:0098528 | skeletal muscle fiber differentiation(GO:0098528) |
0.0 | 0.4 | GO:0034620 | cellular response to unfolded protein(GO:0034620) |
0.0 | 0.0 | GO:0070375 | ERK5 cascade(GO:0070375) |
0.0 | 0.0 | GO:0060602 | branch elongation of an epithelium(GO:0060602) |
0.0 | 0.1 | GO:0007008 | outer mitochondrial membrane organization(GO:0007008) |
0.0 | 0.0 | GO:0001306 | age-dependent response to oxidative stress(GO:0001306) age-dependent general metabolic decline(GO:0007571) |
0.0 | 0.1 | GO:0051533 | positive regulation of NFAT protein import into nucleus(GO:0051533) |
0.0 | 0.3 | GO:0001895 | retina homeostasis(GO:0001895) |
0.0 | 0.1 | GO:0034755 | iron ion transmembrane transport(GO:0034755) |
0.0 | 0.1 | GO:0033299 | secretion of lysosomal enzymes(GO:0033299) |
0.0 | 0.0 | GO:0042984 | amyloid precursor protein biosynthetic process(GO:0042983) regulation of amyloid precursor protein biosynthetic process(GO:0042984) |
0.0 | 0.0 | GO:0002052 | positive regulation of neuroblast proliferation(GO:0002052) |
0.0 | 0.1 | GO:0008214 | protein demethylation(GO:0006482) protein dealkylation(GO:0008214) |
0.0 | 0.0 | GO:0071800 | podosome assembly(GO:0071800) |
0.0 | 0.0 | GO:0042048 | olfactory behavior(GO:0042048) |
0.0 | 0.0 | GO:1904139 | microglial cell migration(GO:1904124) regulation of microglial cell migration(GO:1904139) |
0.0 | 0.0 | GO:0038145 | macrophage colony-stimulating factor signaling pathway(GO:0038145) |
0.0 | 0.0 | GO:0042756 | drinking behavior(GO:0042756) |
0.0 | 0.0 | GO:0006627 | protein processing involved in protein targeting to mitochondrion(GO:0006627) |
0.0 | 0.1 | GO:2000516 | positive regulation of CD4-positive, alpha-beta T cell activation(GO:2000516) |
0.0 | 0.0 | GO:0048853 | forebrain morphogenesis(GO:0048853) |
0.0 | 0.0 | GO:0003203 | endocardial cushion morphogenesis(GO:0003203) |
0.0 | 0.0 | GO:0090611 | ubiquitin-independent protein catabolic process via the multivesicular body sorting pathway(GO:0090611) |
0.0 | 0.0 | GO:0030578 | PML body organization(GO:0030578) |
0.0 | 0.0 | GO:0007494 | midgut development(GO:0007494) |
0.0 | 0.0 | GO:0033689 | negative regulation of osteoblast proliferation(GO:0033689) |
0.0 | 0.0 | GO:0071545 | inositol phosphate catabolic process(GO:0071545) |
0.0 | 0.0 | GO:0035589 | G-protein coupled purinergic nucleotide receptor signaling pathway(GO:0035589) |
0.0 | 0.0 | GO:1901674 | histone H3-K27 acetylation(GO:0043974) regulation of histone H3-K27 acetylation(GO:1901674) |
0.0 | 0.0 | GO:0000957 | mitochondrial RNA catabolic process(GO:0000957) regulation of mitochondrial RNA catabolic process(GO:0000960) |
0.0 | 0.0 | GO:0006651 | diacylglycerol biosynthetic process(GO:0006651) |
0.0 | 0.0 | GO:0002645 | positive regulation of tolerance induction(GO:0002645) positive regulation of T cell tolerance induction(GO:0002666) positive regulation of T cell anergy(GO:0002669) positive regulation of lymphocyte anergy(GO:0002913) |
0.0 | 0.0 | GO:1904154 | positive regulation of retrograde protein transport, ER to cytosol(GO:1904154) |
0.0 | 0.0 | GO:0021902 | commitment of neuronal cell to specific neuron type in forebrain(GO:0021902) |
0.0 | 0.1 | GO:0032373 | positive regulation of sterol transport(GO:0032373) positive regulation of cholesterol transport(GO:0032376) |
0.0 | 0.0 | GO:0071670 | smooth muscle cell chemotaxis(GO:0071670) |
0.0 | 0.0 | GO:0072385 | minus-end-directed organelle transport along microtubule(GO:0072385) |
0.0 | 0.3 | GO:0071391 | cellular response to estrogen stimulus(GO:0071391) |
0.0 | 0.0 | GO:0010847 | regulation of chromatin assembly(GO:0010847) |
0.0 | 0.0 | GO:0002043 | blood vessel endothelial cell proliferation involved in sprouting angiogenesis(GO:0002043) |
0.0 | 0.0 | GO:1902855 | regulation of nonmotile primary cilium assembly(GO:1902855) |
0.0 | 0.0 | GO:1901301 | regulation of cargo loading into COPII-coated vesicle(GO:1901301) |
0.0 | 0.0 | GO:0015840 | urea transport(GO:0015840) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.8 | 3.2 | GO:0044316 | cone cell pedicle(GO:0044316) |
0.8 | 2.3 | GO:1990761 | growth cone lamellipodium(GO:1990761) |
0.5 | 1.6 | GO:0030289 | protein phosphatase 4 complex(GO:0030289) |
0.4 | 3.0 | GO:0030285 | integral component of synaptic vesicle membrane(GO:0030285) intrinsic component of synaptic vesicle membrane(GO:0098563) |
0.4 | 2.4 | GO:0016012 | sarcoglycan complex(GO:0016012) |
0.4 | 1.2 | GO:0070939 | Dsl1p complex(GO:0070939) |
0.4 | 1.5 | GO:0071953 | elastic fiber(GO:0071953) |
0.4 | 1.1 | GO:0097451 | glial limiting end-foot(GO:0097451) |
0.4 | 3.2 | GO:0033179 | proton-transporting V-type ATPase, V0 domain(GO:0033179) |
0.4 | 2.1 | GO:0030673 | axolemma(GO:0030673) |
0.3 | 1.0 | GO:0014701 | junctional sarcoplasmic reticulum membrane(GO:0014701) |
0.3 | 2.7 | GO:0005890 | sodium:potassium-exchanging ATPase complex(GO:0005890) |
0.3 | 2.3 | GO:0044300 | cerebellar mossy fiber(GO:0044300) |
0.3 | 1.0 | GO:0005594 | collagen type IX trimer(GO:0005594) |
0.3 | 3.1 | GO:0043194 | axon initial segment(GO:0043194) |
0.3 | 1.0 | GO:0005968 | Rab-protein geranylgeranyltransferase complex(GO:0005968) |
0.3 | 6.3 | GO:0048786 | presynaptic active zone(GO:0048786) |
0.2 | 0.2 | GO:0005593 | FACIT collagen trimer(GO:0005593) |
0.2 | 2.1 | GO:0097542 | ciliary tip(GO:0097542) |
0.2 | 0.9 | GO:0030478 | actin cap(GO:0030478) |
0.2 | 0.9 | GO:1990357 | terminal web(GO:1990357) |
0.2 | 0.7 | GO:0016533 | cyclin-dependent protein kinase 5 holoenzyme complex(GO:0016533) |
0.2 | 1.3 | GO:0031258 | lamellipodium membrane(GO:0031258) |
0.2 | 0.6 | GO:0097025 | MPP7-DLG1-LIN7 complex(GO:0097025) |
0.2 | 0.6 | GO:0097427 | microtubule bundle(GO:0097427) |
0.2 | 0.6 | GO:0034457 | Mpp10 complex(GO:0034457) |
0.2 | 1.6 | GO:0001520 | outer dense fiber(GO:0001520) |
0.2 | 1.4 | GO:0008290 | F-actin capping protein complex(GO:0008290) |
0.2 | 1.4 | GO:0030008 | TRAPP complex(GO:0030008) |
0.2 | 0.6 | GO:0045251 | mitochondrial electron transfer flavoprotein complex(GO:0017133) electron transfer flavoprotein complex(GO:0045251) |
0.2 | 0.4 | GO:0098533 | ATPase dependent transmembrane transport complex(GO:0098533) |
0.2 | 0.6 | GO:0097513 | myosin II filament(GO:0097513) |
0.2 | 0.9 | GO:1990454 | L-type voltage-gated calcium channel complex(GO:1990454) |
0.2 | 1.7 | GO:0044224 | juxtaparanode region of axon(GO:0044224) |
0.2 | 1.3 | GO:0005952 | cAMP-dependent protein kinase complex(GO:0005952) |
0.2 | 1.3 | GO:0036056 | filtration diaphragm(GO:0036056) slit diaphragm(GO:0036057) |
0.2 | 0.5 | GO:0072534 | perineuronal net(GO:0072534) |
0.2 | 1.7 | GO:0001527 | microfibril(GO:0001527) |
0.2 | 0.5 | GO:0043511 | inhibin complex(GO:0043511) |
0.2 | 0.7 | GO:1990696 | USH2 complex(GO:1990696) |
0.2 | 1.2 | GO:0043083 | synaptic cleft(GO:0043083) |
0.2 | 2.2 | GO:0043196 | varicosity(GO:0043196) |
0.2 | 5.9 | GO:0042734 | presynaptic membrane(GO:0042734) |
0.2 | 1.2 | GO:0005775 | vacuolar lumen(GO:0005775) |
0.2 | 2.5 | GO:1902711 | GABA receptor complex(GO:1902710) GABA-A receptor complex(GO:1902711) |
0.2 | 4.4 | GO:0030672 | synaptic vesicle membrane(GO:0030672) exocytic vesicle membrane(GO:0099501) |
0.2 | 1.1 | GO:0032591 | dendritic spine membrane(GO:0032591) |
0.2 | 1.1 | GO:0034098 | VCP-NPL4-UFD1 AAA ATPase complex(GO:0034098) |
0.1 | 1.2 | GO:0030122 | AP-2 adaptor complex(GO:0030122) |
0.1 | 0.4 | GO:0070552 | BRISC complex(GO:0070552) |
0.1 | 0.3 | GO:0030121 | AP-1 adaptor complex(GO:0030121) |
0.1 | 1.3 | GO:0046581 | intercellular canaliculus(GO:0046581) |
0.1 | 0.5 | GO:0032541 | cortical endoplasmic reticulum(GO:0032541) |
0.1 | 0.6 | GO:0043219 | lateral loop(GO:0043219) |
0.1 | 0.4 | GO:0043293 | apoptosome(GO:0043293) |
0.1 | 0.4 | GO:0044294 | dendritic growth cone(GO:0044294) |
0.1 | 0.4 | GO:1990716 | axonemal central apparatus(GO:1990716) |
0.1 | 0.3 | GO:0060053 | neurofilament cytoskeleton(GO:0060053) |
0.1 | 0.2 | GO:0034679 | integrin alpha9-beta1 complex(GO:0034679) |
0.1 | 0.3 | GO:0005606 | laminin-1 complex(GO:0005606) |
0.1 | 0.8 | GO:0019773 | proteasome core complex, alpha-subunit complex(GO:0019773) |
0.1 | 1.1 | GO:0030061 | mitochondrial crista(GO:0030061) |
0.1 | 1.2 | GO:0098643 | fibrillar collagen trimer(GO:0005583) banded collagen fibril(GO:0098643) |
0.1 | 0.6 | GO:0032839 | dendrite cytoplasm(GO:0032839) |
0.1 | 0.3 | GO:0035061 | interchromatin granule(GO:0035061) |
0.1 | 0.4 | GO:0000408 | EKC/KEOPS complex(GO:0000408) |
0.1 | 0.3 | GO:0031417 | NatC complex(GO:0031417) |
0.1 | 0.4 | GO:0016342 | catenin complex(GO:0016342) |
0.1 | 1.5 | GO:0005614 | interstitial matrix(GO:0005614) |
0.1 | 0.3 | GO:0034274 | Atg12-Atg5-Atg16 complex(GO:0034274) |
0.1 | 0.5 | GO:0071782 | endoplasmic reticulum tubular network(GO:0071782) |
0.1 | 0.3 | GO:0005956 | protein kinase CK2 complex(GO:0005956) |
0.1 | 0.8 | GO:0031235 | intrinsic component of the cytoplasmic side of the plasma membrane(GO:0031235) |
0.1 | 0.3 | GO:0005955 | calcineurin complex(GO:0005955) |
0.1 | 0.4 | GO:0032279 | asymmetric synapse(GO:0032279) |
0.1 | 11.1 | GO:0099572 | postsynaptic density(GO:0014069) postsynaptic specialization(GO:0099572) |
0.1 | 1.7 | GO:0044295 | axonal growth cone(GO:0044295) |
0.1 | 0.1 | GO:0033596 | TSC1-TSC2 complex(GO:0033596) |
0.1 | 0.7 | GO:0033177 | proton-transporting two-sector ATPase complex, proton-transporting domain(GO:0033177) proton-transporting ATP synthase complex, coupling factor F(o)(GO:0045263) |
0.1 | 1.1 | GO:0033391 | chromatoid body(GO:0033391) |
0.1 | 0.5 | GO:0090571 | RNA polymerase II transcription repressor complex(GO:0090571) |
0.1 | 0.5 | GO:0098651 | collagen type IV trimer(GO:0005587) network-forming collagen trimer(GO:0098642) collagen network(GO:0098645) basement membrane collagen trimer(GO:0098651) |
0.1 | 0.2 | GO:0071942 | XPC complex(GO:0071942) |
0.1 | 0.4 | GO:0002177 | manchette(GO:0002177) |
0.1 | 0.3 | GO:0031313 | extrinsic component of endosome membrane(GO:0031313) |
0.1 | 1.3 | GO:0005942 | phosphatidylinositol 3-kinase complex(GO:0005942) |
0.1 | 0.2 | GO:0000811 | GINS complex(GO:0000811) |
0.1 | 0.2 | GO:0035748 | myelin sheath abaxonal region(GO:0035748) |
0.1 | 1.0 | GO:0016327 | apicolateral plasma membrane(GO:0016327) |
0.1 | 0.4 | GO:0030062 | mitochondrial tricarboxylic acid cycle enzyme complex(GO:0030062) |
0.1 | 0.9 | GO:0000800 | lateral element(GO:0000800) |
0.1 | 0.3 | GO:0097449 | astrocyte projection(GO:0097449) |
0.1 | 5.2 | GO:0043204 | perikaryon(GO:0043204) |
0.1 | 8.8 | GO:0031225 | anchored component of membrane(GO:0031225) |
0.1 | 0.3 | GO:0031618 | nuclear pericentric heterochromatin(GO:0031618) |
0.1 | 0.4 | GO:0000137 | Golgi cis cisterna(GO:0000137) |
0.1 | 0.2 | GO:0070876 | SOSS complex(GO:0070876) |
0.1 | 1.0 | GO:0033017 | sarcoplasmic reticulum membrane(GO:0033017) |
0.1 | 0.2 | GO:0071001 | U4/U6 snRNP(GO:0071001) |
0.1 | 0.3 | GO:0000138 | Golgi trans cisterna(GO:0000138) |
0.1 | 0.3 | GO:0070847 | core mediator complex(GO:0070847) |
0.1 | 0.3 | GO:0032433 | filopodium tip(GO:0032433) |
0.1 | 0.4 | GO:0031209 | SCAR complex(GO:0031209) |
0.1 | 0.2 | GO:0005853 | eukaryotic translation elongation factor 1 complex(GO:0005853) |
0.1 | 0.3 | GO:0030877 | beta-catenin destruction complex(GO:0030877) |
0.1 | 0.1 | GO:0035838 | growing cell tip(GO:0035838) |
0.0 | 0.0 | GO:0070033 | synaptobrevin 2-SNAP-25-syntaxin-1a-complexin II complex(GO:0070033) |
0.0 | 1.5 | GO:0005921 | gap junction(GO:0005921) |
0.0 | 0.2 | GO:0008274 | gamma-tubulin large complex(GO:0000931) gamma-tubulin ring complex(GO:0008274) |
0.0 | 0.1 | GO:0071547 | piP-body(GO:0071547) |
0.0 | 0.7 | GO:0030665 | clathrin-coated vesicle membrane(GO:0030665) |
0.0 | 0.4 | GO:0032590 | dendrite membrane(GO:0032590) |
0.0 | 0.2 | GO:0033270 | paranode region of axon(GO:0033270) |
0.0 | 0.1 | GO:0032937 | SREBP-SCAP-Insig complex(GO:0032937) |
0.0 | 0.4 | GO:0031501 | mannosyltransferase complex(GO:0031501) |
0.0 | 0.1 | GO:0030891 | VCB complex(GO:0030891) |
0.0 | 0.2 | GO:1990246 | uniplex complex(GO:1990246) |
0.0 | 0.5 | GO:0060076 | excitatory synapse(GO:0060076) |
0.0 | 0.2 | GO:0031428 | box C/D snoRNP complex(GO:0031428) |
0.0 | 0.1 | GO:0002193 | MAML1-RBP-Jkappa- ICN1 complex(GO:0002193) |
0.0 | 0.1 | GO:0005863 | striated muscle myosin thick filament(GO:0005863) |
0.0 | 0.0 | GO:0000938 | GARP complex(GO:0000938) |
0.0 | 0.7 | GO:0032588 | trans-Golgi network membrane(GO:0032588) |
0.0 | 0.1 | GO:0016222 | procollagen-proline 4-dioxygenase complex(GO:0016222) |
0.0 | 0.4 | GO:0000813 | ESCRT I complex(GO:0000813) |
0.0 | 1.5 | GO:0005913 | cell-cell adherens junction(GO:0005913) |
0.0 | 0.4 | GO:0000164 | protein phosphatase type 1 complex(GO:0000164) |
0.0 | 0.2 | GO:0097197 | tetraspanin-enriched microdomain(GO:0097197) |
0.0 | 0.4 | GO:0043034 | costamere(GO:0043034) |
0.0 | 3.1 | GO:0055037 | recycling endosome(GO:0055037) |
0.0 | 0.2 | GO:0001891 | phagocytic cup(GO:0001891) |
0.0 | 0.2 | GO:0071204 | histone pre-mRNA 3'end processing complex(GO:0071204) |
0.0 | 0.1 | GO:0036396 | MIS complex(GO:0036396) |
0.0 | 2.1 | GO:0031463 | Cul3-RING ubiquitin ligase complex(GO:0031463) |
0.0 | 0.7 | GO:0030057 | desmosome(GO:0030057) |
0.0 | 0.1 | GO:0032021 | NELF complex(GO:0032021) |
0.0 | 0.5 | GO:0005892 | acetylcholine-gated channel complex(GO:0005892) |
0.0 | 0.2 | GO:0005672 | transcription factor TFIIA complex(GO:0005672) |
0.0 | 0.1 | GO:0005927 | muscle tendon junction(GO:0005927) |
0.0 | 0.1 | GO:0032133 | chromosome passenger complex(GO:0032133) |
0.0 | 0.1 | GO:0043527 | tRNA methyltransferase complex(GO:0043527) |
0.0 | 0.1 | GO:0002079 | inner acrosomal membrane(GO:0002079) |
0.0 | 0.1 | GO:1990851 | Wnt-Frizzled-LRP5/6 complex(GO:1990851) |
0.0 | 0.1 | GO:0008541 | proteasome regulatory particle, lid subcomplex(GO:0008541) |
0.0 | 0.1 | GO:0000836 | ER ubiquitin ligase complex(GO:0000835) Hrd1p ubiquitin ligase complex(GO:0000836) |
0.0 | 0.1 | GO:1903349 | omegasome membrane(GO:1903349) |
0.0 | 0.2 | GO:0071541 | eukaryotic translation initiation factor 3 complex, eIF3m(GO:0071541) |
0.0 | 0.1 | GO:0030015 | CCR4-NOT core complex(GO:0030015) |
0.0 | 0.2 | GO:0002116 | semaphorin receptor complex(GO:0002116) |
0.0 | 0.3 | GO:0034706 | sodium channel complex(GO:0034706) |
0.0 | 0.2 | GO:0036157 | outer dynein arm(GO:0036157) |
0.0 | 1.5 | GO:0005581 | collagen trimer(GO:0005581) |
0.0 | 0.1 | GO:0019907 | cyclin-dependent protein kinase activating kinase holoenzyme complex(GO:0019907) |
0.0 | 0.1 | GO:0042587 | glycogen granule(GO:0042587) |
0.0 | 0.0 | GO:0035985 | senescence-associated heterochromatin focus(GO:0035985) |
0.0 | 0.1 | GO:0044233 | ER-mitochondrion membrane contact site(GO:0044233) |
0.0 | 0.4 | GO:0030137 | COPI-coated vesicle(GO:0030137) |
0.0 | 0.8 | GO:0005834 | heterotrimeric G-protein complex(GO:0005834) |
0.0 | 0.1 | GO:0005967 | mitochondrial pyruvate dehydrogenase complex(GO:0005967) |
0.0 | 0.1 | GO:0034388 | Pwp2p-containing subcomplex of 90S preribosome(GO:0034388) |
0.0 | 0.2 | GO:1990023 | mitotic spindle midzone(GO:1990023) |
0.0 | 0.2 | GO:0005852 | eukaryotic translation initiation factor 3 complex(GO:0005852) |
0.0 | 0.3 | GO:0010369 | chromocenter(GO:0010369) |
0.0 | 0.1 | GO:0005945 | 6-phosphofructokinase complex(GO:0005945) |
0.0 | 0.1 | GO:0090543 | Flemming body(GO:0090543) |
0.0 | 0.0 | GO:0031074 | nucleocytoplasmic shuttling complex(GO:0031074) |
0.0 | 0.1 | GO:0005658 | alpha DNA polymerase:primase complex(GO:0005658) |
0.0 | 1.0 | GO:0005901 | caveola(GO:0005901) |
0.0 | 0.6 | GO:0000791 | euchromatin(GO:0000791) |
0.0 | 0.1 | GO:0032777 | Piccolo NuA4 histone acetyltransferase complex(GO:0032777) |
0.0 | 1.0 | GO:0001533 | cornified envelope(GO:0001533) |
0.0 | 0.2 | GO:0008250 | oligosaccharyltransferase complex(GO:0008250) |
0.0 | 0.1 | GO:0005958 | DNA-dependent protein kinase-DNA ligase 4 complex(GO:0005958) |
0.0 | 0.0 | GO:0034673 | inhibin-betaglycan-ActRII complex(GO:0034673) |
0.0 | 0.1 | GO:0031415 | NatA complex(GO:0031415) |
0.0 | 0.1 | GO:0009331 | glycerol-3-phosphate dehydrogenase complex(GO:0009331) |
0.0 | 0.2 | GO:0008385 | IkappaB kinase complex(GO:0008385) |
0.0 | 0.1 | GO:0033180 | proton-transporting V-type ATPase, V1 domain(GO:0033180) |
0.0 | 0.1 | GO:0044322 | endoplasmic reticulum quality control compartment(GO:0044322) |
0.0 | 0.1 | GO:0005712 | chiasma(GO:0005712) |
0.0 | 0.1 | GO:0032009 | early phagosome(GO:0032009) |
0.0 | 0.1 | GO:0005964 | phosphorylase kinase complex(GO:0005964) |
0.0 | 0.1 | GO:0000506 | glycosylphosphatidylinositol-N-acetylglucosaminyltransferase (GPI-GnT) complex(GO:0000506) |
0.0 | 4.4 | GO:0005912 | adherens junction(GO:0005912) |
0.0 | 0.0 | GO:0000015 | phosphopyruvate hydratase complex(GO:0000015) |
0.0 | 0.2 | GO:0005838 | proteasome regulatory particle(GO:0005838) |
0.0 | 0.0 | GO:0031467 | Cul7-RING ubiquitin ligase complex(GO:0031467) |
0.0 | 0.1 | GO:0042622 | photoreceptor outer segment membrane(GO:0042622) |
0.0 | 0.6 | GO:0045271 | mitochondrial respiratory chain complex I(GO:0005747) NADH dehydrogenase complex(GO:0030964) respiratory chain complex I(GO:0045271) |
0.0 | 0.4 | GO:0030687 | preribosome, large subunit precursor(GO:0030687) |
0.0 | 0.0 | GO:0045180 | basal cortex(GO:0045180) |
0.0 | 0.0 | GO:0034991 | nuclear meiotic cohesin complex(GO:0034991) |
0.0 | 0.1 | GO:0005664 | origin recognition complex(GO:0000808) nuclear origin of replication recognition complex(GO:0005664) |
0.0 | 0.1 | GO:0036156 | inner dynein arm(GO:0036156) |
0.0 | 0.1 | GO:0043159 | acrosomal matrix(GO:0043159) |
0.0 | 1.0 | GO:0045211 | postsynaptic membrane(GO:0045211) |
0.0 | 0.1 | GO:0061617 | MICOS complex(GO:0061617) |
0.0 | 1.1 | GO:0030027 | lamellipodium(GO:0030027) |
0.0 | 0.1 | GO:0070187 | telosome(GO:0070187) |
0.0 | 0.1 | GO:0071006 | U2-type catalytic step 1 spliceosome(GO:0071006) |
0.0 | 0.1 | GO:0033263 | CORVET complex(GO:0033263) |
0.0 | 0.1 | GO:0005851 | eukaryotic translation initiation factor 2B complex(GO:0005851) |
0.0 | 0.0 | GO:0097209 | epidermal lamellar body(GO:0097209) |
0.0 | 0.0 | GO:0048179 | activin receptor complex(GO:0048179) |
0.0 | 0.1 | GO:0042555 | MCM complex(GO:0042555) |
0.0 | 0.4 | GO:0005871 | kinesin complex(GO:0005871) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
1.1 | 3.2 | GO:0005519 | cytoskeletal regulatory protein binding(GO:0005519) |
0.9 | 2.6 | GO:0005176 | ErbB-2 class receptor binding(GO:0005176) |
0.9 | 4.3 | GO:0044323 | retinoic acid-responsive element binding(GO:0044323) |
0.8 | 2.4 | GO:0031708 | endothelin B receptor binding(GO:0031708) |
0.8 | 3.8 | GO:0030550 | acetylcholine receptor inhibitor activity(GO:0030550) |
0.7 | 2.2 | GO:0005219 | ryanodine-sensitive calcium-release channel activity(GO:0005219) |
0.7 | 2.1 | GO:0008503 | benzodiazepine receptor activity(GO:0008503) |
0.7 | 1.3 | GO:0097109 | neuroligin family protein binding(GO:0097109) |
0.6 | 1.3 | GO:0045503 | dynein light chain binding(GO:0045503) |
0.6 | 4.5 | GO:0003680 | AT DNA binding(GO:0003680) |
0.6 | 1.8 | GO:0051425 | PTB domain binding(GO:0051425) |
0.6 | 1.7 | GO:0043423 | 3-phosphoinositide-dependent protein kinase binding(GO:0043423) |
0.5 | 1.1 | GO:0035673 | oligopeptide transmembrane transporter activity(GO:0035673) |
0.5 | 3.3 | GO:0008559 | xenobiotic-transporting ATPase activity(GO:0008559) |
0.5 | 1.1 | GO:0004698 | calcium-dependent protein kinase C activity(GO:0004698) |
0.5 | 1.6 | GO:0034186 | apolipoprotein A-I binding(GO:0034186) |
0.5 | 1.0 | GO:0034040 | lipid-transporting ATPase activity(GO:0034040) |
0.5 | 3.5 | GO:0005004 | GPI-linked ephrin receptor activity(GO:0005004) |
0.5 | 1.5 | GO:0008449 | N-acetylglucosamine-6-sulfatase activity(GO:0008449) |
0.5 | 1.5 | GO:0035373 | chondroitin sulfate proteoglycan binding(GO:0035373) |
0.5 | 2.0 | GO:0008113 | peptide-methionine (S)-S-oxide reductase activity(GO:0008113) |
0.5 | 1.4 | GO:0031697 | beta-1 adrenergic receptor binding(GO:0031697) |
0.5 | 1.4 | GO:0004351 | glutamate decarboxylase activity(GO:0004351) |
0.4 | 1.3 | GO:0016842 | amidine-lyase activity(GO:0016842) |
0.4 | 3.7 | GO:0038191 | neuropilin binding(GO:0038191) |
0.4 | 2.0 | GO:1990239 | steroid hormone binding(GO:1990239) |
0.4 | 2.8 | GO:0030306 | ADP-ribosylation factor binding(GO:0030306) |
0.4 | 1.2 | GO:0055100 | adiponectin binding(GO:0055100) |
0.4 | 1.5 | GO:0005025 | transforming growth factor beta receptor activity, type I(GO:0005025) |
0.4 | 2.1 | GO:0032027 | myosin light chain binding(GO:0032027) |
0.3 | 7.0 | GO:0015035 | protein disulfide oxidoreductase activity(GO:0015035) |
0.3 | 2.4 | GO:0005237 | inhibitory extracellular ligand-gated ion channel activity(GO:0005237) |
0.3 | 1.3 | GO:0005332 | gamma-aminobutyric acid:sodium symporter activity(GO:0005332) |
0.3 | 1.0 | GO:0015142 | citrate transmembrane transporter activity(GO:0015137) tricarboxylic acid transmembrane transporter activity(GO:0015142) |
0.3 | 1.3 | GO:0070579 | methylcytosine dioxygenase activity(GO:0070579) |
0.3 | 1.2 | GO:0004704 | NF-kappaB-inducing kinase activity(GO:0004704) |
0.3 | 0.9 | GO:0004691 | cAMP-dependent protein kinase activity(GO:0004691) |
0.3 | 2.0 | GO:0034819 | 3-(3-hydroxyphenyl)propionate hydroxylase activity(GO:0008688) 4-chlorobenzaldehyde oxidase activity(GO:0018471) 3,5-xylenol methylhydroxylase activity(GO:0018630) phenylacetate hydroxylase activity(GO:0018631) 4-nitrophenol 4-monooxygenase activity(GO:0018632) dimethyl sulfide monooxygenase activity(GO:0018633) alpha-pinene monooxygenase [NADH] activity(GO:0018634) 1-hydroxy-2-naphthoate hydroxylase activity(GO:0018637) toluene 4-monooxygenase activity(GO:0018638) xylene monooxygenase activity(GO:0018639) dibenzothiophene monooxygenase activity(GO:0018640) 6-hydroxy-3-methyl-2-oxo-1,2-dihydroquinoline 6-monooxygenase activity(GO:0018641) chlorophenol 4-monooxygenase activity(GO:0018642) carbon disulfide oxygenase activity(GO:0018643) toluene 2-monooxygenase activity(GO:0018644) 1-hydroxy-2-oxolimonene 1,2-monooxygenase activity(GO:0018646) phenanthrene 1,2-monooxygenase activity(GO:0018647) tetrahydrofuran hydroxylase activity(GO:0018649) styrene monooxygenase activity(GO:0018650) toluene-4-sulfonate monooxygenase activity(GO:0018651) toluene-sulfonate methyl-monooxygenase activity(GO:0018652) 3-methyl-2-oxo-1,2-dihydroquinoline 6-monooxygenase activity(GO:0018653) 2-hydroxy-phenylacetate hydroxylase activity(GO:0018654) 2-oxo-delta3-4,5,5-trimethylcyclopentenylacetyl-CoA 1,2-monooxygenase activity(GO:0018655) phenanthrene 3,4-monooxygenase activity(GO:0018656) toluene 3-monooxygenase activity(GO:0018657) 4-hydroxyphenylacetate,NADH:oxygen oxidoreductase (3-hydroxylating) activity(GO:0018660) limonene monooxygenase activity(GO:0019113) 2-methylnaphthalene hydroxylase activity(GO:0034526) 1-methylnaphthalene hydroxylase activity(GO:0034534) bisphenol A hydroxylase A activity(GO:0034560) salicylate 5-hydroxylase activity(GO:0034785) isobutylamine N-hydroxylase activity(GO:0034791) branched-chain dodecylbenzene sulfonate monooxygenase activity(GO:0034802) 3-HSA hydroxylase activity(GO:0034819) 4-hydroxypyridine-3-hydroxylase activity(GO:0034894) 2-octaprenyl-3-methyl-6-methoxy-1,4-benzoquinol hydroxylase activity(GO:0043719) 6-hydroxynicotinate 3-monooxygenase activity(GO:0043731) thalianol hydroxylase activity(GO:0080014) |
0.3 | 2.0 | GO:0050897 | cobalt ion binding(GO:0050897) |
0.3 | 4.1 | GO:0016805 | dipeptidase activity(GO:0016805) |
0.3 | 0.8 | GO:0005006 | epidermal growth factor-activated receptor activity(GO:0005006) |
0.3 | 0.8 | GO:0031802 | type 5 metabotropic glutamate receptor binding(GO:0031802) |
0.3 | 1.0 | GO:0017162 | aryl hydrocarbon receptor binding(GO:0017162) |
0.3 | 1.3 | GO:0008467 | [heparan sulfate]-glucosamine 3-sulfotransferase 1 activity(GO:0008467) |
0.3 | 1.3 | GO:0000155 | phosphorelay sensor kinase activity(GO:0000155) |
0.2 | 1.2 | GO:0005432 | calcium:sodium antiporter activity(GO:0005432) |
0.2 | 0.7 | GO:0030144 | alpha-1,6-mannosylglycoprotein 6-beta-N-acetylglucosaminyltransferase activity(GO:0030144) |
0.2 | 2.5 | GO:0045294 | alpha-catenin binding(GO:0045294) |
0.2 | 0.9 | GO:0031852 | mu-type opioid receptor binding(GO:0031852) |
0.2 | 1.3 | GO:0005499 | vitamin D binding(GO:0005499) |
0.2 | 0.9 | GO:0046934 | phosphatidylinositol-4,5-bisphosphate 3-kinase activity(GO:0046934) |
0.2 | 1.1 | GO:0035252 | UDP-xylosyltransferase activity(GO:0035252) xylosyltransferase activity(GO:0042285) |
0.2 | 2.3 | GO:0030215 | semaphorin receptor binding(GO:0030215) |
0.2 | 1.0 | GO:0005095 | GTPase inhibitor activity(GO:0005095) |
0.2 | 1.0 | GO:0070051 | fibrinogen binding(GO:0070051) |
0.2 | 1.0 | GO:0000099 | sulfur amino acid transmembrane transporter activity(GO:0000099) |
0.2 | 2.0 | GO:0042577 | lipid phosphatase activity(GO:0042577) |
0.2 | 2.5 | GO:0008179 | adenylate cyclase binding(GO:0008179) |
0.2 | 2.3 | GO:0048407 | platelet-derived growth factor binding(GO:0048407) |
0.2 | 0.8 | GO:0004528 | phosphodiesterase I activity(GO:0004528) |
0.2 | 1.0 | GO:0086080 | protein binding involved in heterotypic cell-cell adhesion(GO:0086080) |
0.2 | 1.4 | GO:0035014 | phosphatidylinositol 3-kinase regulator activity(GO:0035014) |
0.2 | 2.8 | GO:0030275 | LRR domain binding(GO:0030275) |
0.2 | 0.6 | GO:0035939 | microsatellite binding(GO:0035939) |
0.2 | 1.3 | GO:0019870 | potassium channel inhibitor activity(GO:0019870) |
0.2 | 2.4 | GO:0008191 | metalloendopeptidase inhibitor activity(GO:0008191) |
0.2 | 0.7 | GO:0004370 | glycerol kinase activity(GO:0004370) |
0.2 | 1.9 | GO:0001730 | 2'-5'-oligoadenylate synthetase activity(GO:0001730) |
0.2 | 1.6 | GO:0016920 | pyroglutamyl-peptidase activity(GO:0016920) |
0.2 | 0.2 | GO:0030297 | transmembrane receptor protein tyrosine kinase activator activity(GO:0030297) |
0.2 | 1.4 | GO:0033677 | DNA/RNA helicase activity(GO:0033677) |
0.2 | 1.0 | GO:0034190 | apolipoprotein receptor binding(GO:0034190) |
0.2 | 1.2 | GO:0070300 | phosphatidic acid binding(GO:0070300) |
0.2 | 0.5 | GO:1990829 | C-rich single-stranded DNA binding(GO:1990829) |
0.2 | 2.8 | GO:0005112 | Notch binding(GO:0005112) |
0.2 | 0.6 | GO:0043184 | vascular endothelial growth factor receptor 2 binding(GO:0043184) |
0.2 | 1.9 | GO:0051400 | BH domain binding(GO:0051400) |
0.2 | 2.9 | GO:0046961 | proton-transporting ATPase activity, rotational mechanism(GO:0046961) |
0.2 | 0.5 | GO:0019797 | procollagen-proline 3-dioxygenase activity(GO:0019797) |
0.2 | 1.7 | GO:0001222 | transcription corepressor binding(GO:0001222) |
0.2 | 0.3 | GO:0004687 | myosin light chain kinase activity(GO:0004687) |
0.2 | 4.2 | GO:0001540 | beta-amyloid binding(GO:0001540) |
0.2 | 3.3 | GO:0030332 | cyclin binding(GO:0030332) |
0.2 | 0.6 | GO:0004969 | histamine receptor activity(GO:0004969) |
0.1 | 1.5 | GO:0031994 | insulin-like growth factor I binding(GO:0031994) |
0.1 | 0.6 | GO:0035241 | protein-arginine omega-N monomethyltransferase activity(GO:0035241) |
0.1 | 0.4 | GO:0098748 | clathrin adaptor activity(GO:0035615) endocytic adaptor activity(GO:0098748) |
0.1 | 0.7 | GO:0003958 | NADPH-hemoprotein reductase activity(GO:0003958) |
0.1 | 0.4 | GO:0004605 | phosphatidate cytidylyltransferase activity(GO:0004605) |
0.1 | 2.8 | GO:0080025 | phosphatidylinositol-3,5-bisphosphate binding(GO:0080025) |
0.1 | 0.1 | GO:0086056 | voltage-gated calcium channel activity involved in AV node cell action potential(GO:0086056) |
0.1 | 2.5 | GO:0008266 | poly(U) RNA binding(GO:0008266) |
0.1 | 0.4 | GO:0004924 | oncostatin-M receptor activity(GO:0004924) |
0.1 | 1.7 | GO:0055106 | ubiquitin-protein transferase regulator activity(GO:0055106) |
0.1 | 0.3 | GO:0046933 | proton-transporting ATP synthase activity, rotational mechanism(GO:0046933) |
0.1 | 0.4 | GO:0019166 | trans-2-enoyl-CoA reductase (NADPH) activity(GO:0019166) |
0.1 | 0.3 | GO:0031893 | vasopressin receptor binding(GO:0031893) |
0.1 | 0.4 | GO:0051380 | norepinephrine binding(GO:0051380) |
0.1 | 0.6 | GO:0005007 | fibroblast growth factor-activated receptor activity(GO:0005007) |
0.1 | 3.6 | GO:0017147 | Wnt-protein binding(GO:0017147) |
0.1 | 0.4 | GO:0004949 | cannabinoid receptor activity(GO:0004949) |
0.1 | 1.0 | GO:0008889 | glycerophosphodiester phosphodiesterase activity(GO:0008889) |
0.1 | 0.2 | GO:0008413 | 8-oxo-7,8-dihydroguanosine triphosphate pyrophosphatase activity(GO:0008413) |
0.1 | 0.1 | GO:0051373 | FATZ binding(GO:0051373) |
0.1 | 1.1 | GO:0001206 | transcriptional repressor activity, RNA polymerase II distal enhancer sequence-specific binding(GO:0001206) |
0.1 | 0.6 | GO:0004563 | beta-N-acetylhexosaminidase activity(GO:0004563) |
0.1 | 0.2 | GO:0004999 | vasoactive intestinal polypeptide receptor activity(GO:0004999) |
0.1 | 0.5 | GO:0046923 | ER retention sequence binding(GO:0046923) |
0.1 | 0.2 | GO:0008545 | JUN kinase kinase activity(GO:0008545) |
0.1 | 0.2 | GO:0030519 | snoRNP binding(GO:0030519) |
0.1 | 0.4 | GO:0042609 | CD4 receptor binding(GO:0042609) |
0.1 | 1.4 | GO:0005092 | GDP-dissociation inhibitor activity(GO:0005092) |
0.1 | 0.2 | GO:0008035 | high-density lipoprotein particle binding(GO:0008035) |
0.1 | 1.0 | GO:0016595 | glutamate binding(GO:0016595) |
0.1 | 1.5 | GO:0005234 | extracellular-glutamate-gated ion channel activity(GO:0005234) |
0.1 | 0.3 | GO:0071253 | connexin binding(GO:0071253) |
0.1 | 0.3 | GO:0032139 | dinucleotide insertion or deletion binding(GO:0032139) |
0.1 | 0.5 | GO:0005324 | long-chain fatty acid transporter activity(GO:0005324) |
0.1 | 0.3 | GO:0004711 | ribosomal protein S6 kinase activity(GO:0004711) |
0.1 | 0.6 | GO:0046974 | histone methyltransferase activity (H3-K9 specific)(GO:0046974) |
0.1 | 2.6 | GO:0005251 | delayed rectifier potassium channel activity(GO:0005251) |
0.1 | 0.2 | GO:0035175 | histone kinase activity (H3-S10 specific)(GO:0035175) |
0.1 | 0.5 | GO:0048495 | Roundabout binding(GO:0048495) |
0.1 | 2.9 | GO:0015459 | potassium channel regulator activity(GO:0015459) |
0.1 | 0.5 | GO:0004957 | prostaglandin E receptor activity(GO:0004957) |
0.1 | 0.5 | GO:0032052 | bile acid binding(GO:0032052) |
0.1 | 0.6 | GO:0008603 | cAMP-dependent protein kinase regulator activity(GO:0008603) |
0.1 | 0.5 | GO:0071558 | histone demethylase activity (H3-K27 specific)(GO:0071558) |
0.1 | 0.3 | GO:0030284 | estrogen receptor activity(GO:0030284) |
0.1 | 0.6 | GO:1990247 | N6-methyladenosine-containing RNA binding(GO:1990247) |
0.1 | 1.1 | GO:0004865 | protein serine/threonine phosphatase inhibitor activity(GO:0004865) |
0.1 | 0.2 | GO:0089720 | caspase binding(GO:0089720) |
0.1 | 0.5 | GO:0003828 | alpha-N-acetylneuraminate alpha-2,8-sialyltransferase activity(GO:0003828) |
0.1 | 0.3 | GO:0004833 | tryptophan 2,3-dioxygenase activity(GO:0004833) |
0.1 | 0.2 | GO:0008131 | primary amine oxidase activity(GO:0008131) |
0.1 | 0.3 | GO:0035005 | 1-phosphatidylinositol-4-phosphate 3-kinase activity(GO:0035005) |
0.1 | 3.0 | GO:0001105 | RNA polymerase II transcription coactivator activity(GO:0001105) |
0.1 | 0.4 | GO:0004887 | thyroid hormone receptor activity(GO:0004887) |
0.1 | 0.2 | GO:0042281 | dolichyl pyrophosphate Man9GlcNAc2 alpha-1,3-glucosyltransferase activity(GO:0042281) |
0.1 | 0.4 | GO:0015093 | ferrous iron transmembrane transporter activity(GO:0015093) |
0.1 | 0.3 | GO:0048101 | calcium- and calmodulin-regulated 3',5'-cyclic-GMP phosphodiesterase activity(GO:0048101) |
0.1 | 0.3 | GO:0000253 | 3-keto sterol reductase activity(GO:0000253) |
0.1 | 0.4 | GO:0018812 | 3-hydroxyacyl-CoA dehydratase activity(GO:0018812) |
0.1 | 1.1 | GO:0031005 | filamin binding(GO:0031005) |
0.1 | 0.3 | GO:0016907 | G-protein coupled acetylcholine receptor activity(GO:0016907) |
0.1 | 0.6 | GO:0034711 | inhibin binding(GO:0034711) |
0.1 | 1.9 | GO:0004707 | MAP kinase activity(GO:0004707) |
0.1 | 0.3 | GO:0031727 | CCR2 chemokine receptor binding(GO:0031727) |
0.1 | 0.6 | GO:0015280 | ligand-gated sodium channel activity(GO:0015280) |
0.1 | 0.3 | GO:0035184 | histone threonine kinase activity(GO:0035184) |
0.1 | 2.4 | GO:0042169 | SH2 domain binding(GO:0042169) |
0.1 | 0.3 | GO:0019788 | NEDD8 transferase activity(GO:0019788) |
0.1 | 0.3 | GO:0015265 | urea channel activity(GO:0015265) |
0.1 | 0.4 | GO:0005412 | glucose:sodium symporter activity(GO:0005412) |
0.1 | 0.2 | GO:0004791 | thioredoxin-disulfide reductase activity(GO:0004791) |
0.1 | 0.2 | GO:0045134 | uridine-diphosphatase activity(GO:0045134) |
0.1 | 1.3 | GO:0004435 | phosphatidylinositol phospholipase C activity(GO:0004435) |
0.1 | 0.8 | GO:0009881 | photoreceptor activity(GO:0009881) |
0.1 | 1.7 | GO:0001106 | RNA polymerase II transcription corepressor activity(GO:0001106) |
0.1 | 0.5 | GO:0004708 | MAP kinase kinase activity(GO:0004708) |
0.1 | 5.4 | GO:0005089 | Rho guanyl-nucleotide exchange factor activity(GO:0005089) |
0.1 | 0.7 | GO:0003796 | lysozyme activity(GO:0003796) |
0.1 | 0.2 | GO:0097016 | L27 domain binding(GO:0097016) |
0.1 | 0.5 | GO:0035173 | histone kinase activity(GO:0035173) |
0.1 | 0.5 | GO:0005049 | nuclear export signal receptor activity(GO:0005049) |
0.1 | 0.2 | GO:0001591 | dopamine neurotransmitter receptor activity, coupled via Gi/Go(GO:0001591) |
0.1 | 0.3 | GO:0008502 | melatonin receptor activity(GO:0008502) |
0.1 | 0.3 | GO:0004839 | ubiquitin activating enzyme activity(GO:0004839) |
0.1 | 0.1 | GO:0005030 | neurotrophin receptor activity(GO:0005030) |
0.1 | 0.1 | GO:0001224 | RNA polymerase II transcription cofactor binding(GO:0001224) |
0.1 | 0.4 | GO:0031821 | G-protein coupled serotonin receptor binding(GO:0031821) |
0.1 | 0.8 | GO:0038187 | signaling pattern recognition receptor activity(GO:0008329) pattern recognition receptor activity(GO:0038187) |
0.1 | 0.3 | GO:0050501 | hyaluronan synthase activity(GO:0050501) |
0.1 | 0.6 | GO:0030159 | receptor signaling complex scaffold activity(GO:0030159) |
0.1 | 0.9 | GO:0015269 | calcium-activated potassium channel activity(GO:0015269) |
0.1 | 0.3 | GO:0004652 | polynucleotide adenylyltransferase activity(GO:0004652) |
0.1 | 0.1 | GO:0097108 | hedgehog family protein binding(GO:0097108) |
0.1 | 0.2 | GO:0030943 | mitochondrion targeting sequence binding(GO:0030943) |
0.1 | 0.2 | GO:0052658 | inositol-1,4,5-trisphosphate 5-phosphatase activity(GO:0052658) |
0.1 | 1.4 | GO:0016896 | 3'-5'-exoribonuclease activity(GO:0000175) exoribonuclease activity, producing 5'-phosphomonoesters(GO:0016896) |
0.1 | 0.5 | GO:0008429 | phosphatidylethanolamine binding(GO:0008429) |
0.1 | 0.6 | GO:0031681 | G-protein beta-subunit binding(GO:0031681) |
0.1 | 0.2 | GO:0019871 | sodium channel inhibitor activity(GO:0019871) |
0.1 | 2.1 | GO:0032947 | protein complex scaffold(GO:0032947) |
0.1 | 0.3 | GO:0003831 | beta-N-acetylglucosaminylglycopeptide beta-1,4-galactosyltransferase activity(GO:0003831) |
0.1 | 2.2 | GO:0005201 | extracellular matrix structural constituent(GO:0005201) |
0.1 | 0.7 | GO:0017154 | semaphorin receptor activity(GO:0017154) |
0.1 | 1.4 | GO:0004181 | metallocarboxypeptidase activity(GO:0004181) |
0.1 | 0.2 | GO:0004720 | protein-lysine 6-oxidase activity(GO:0004720) |
0.1 | 0.1 | GO:0097493 | structural molecule activity conferring elasticity(GO:0097493) |
0.1 | 0.2 | GO:0047756 | chondroitin 4-sulfotransferase activity(GO:0047756) |
0.1 | 0.2 | GO:0032405 | MutLalpha complex binding(GO:0032405) |
0.1 | 1.0 | GO:0035255 | ionotropic glutamate receptor binding(GO:0035255) |
0.1 | 0.1 | GO:0031544 | peptidyl-proline 3-dioxygenase activity(GO:0031544) |
0.1 | 0.7 | GO:0016813 | hydrolase activity, acting on carbon-nitrogen (but not peptide) bonds, in linear amidines(GO:0016813) |
0.1 | 0.2 | GO:0000309 | nicotinamide-nucleotide adenylyltransferase activity(GO:0000309) nicotinate-nucleotide adenylyltransferase activity(GO:0004515) |
0.1 | 0.8 | GO:0043422 | protein kinase B binding(GO:0043422) |
0.1 | 0.2 | GO:0005275 | amine transmembrane transporter activity(GO:0005275) |
0.1 | 0.2 | GO:0016901 | oxidoreductase activity, acting on the CH-OH group of donors, quinone or similar compound as acceptor(GO:0016901) |
0.1 | 0.2 | GO:0051870 | methotrexate binding(GO:0051870) |
0.1 | 0.2 | GO:0005143 | interleukin-12 receptor binding(GO:0005143) |
0.1 | 0.4 | GO:0050700 | CARD domain binding(GO:0050700) |
0.1 | 0.2 | GO:0001602 | pancreatic polypeptide receptor activity(GO:0001602) |
0.1 | 0.2 | GO:0047045 | testosterone 17-beta-dehydrogenase (NADP+) activity(GO:0047045) |
0.1 | 0.1 | GO:0070326 | very-low-density lipoprotein particle receptor binding(GO:0070326) |
0.1 | 0.2 | GO:0043546 | molybdopterin cofactor binding(GO:0043546) |
0.1 | 0.5 | GO:0004017 | adenylate kinase activity(GO:0004017) |
0.1 | 0.2 | GO:0016015 | morphogen activity(GO:0016015) |
0.1 | 0.6 | GO:0070180 | large ribosomal subunit rRNA binding(GO:0070180) |
0.1 | 0.2 | GO:0033142 | progesterone receptor binding(GO:0033142) |
0.1 | 0.2 | GO:0001642 | group III metabotropic glutamate receptor activity(GO:0001642) |
0.1 | 0.8 | GO:0008376 | acetylgalactosaminyltransferase activity(GO:0008376) |
0.1 | 0.2 | GO:0045504 | dynein heavy chain binding(GO:0045504) |
0.1 | 0.2 | GO:0086006 | voltage-gated sodium channel activity involved in cardiac muscle cell action potential(GO:0086006) |
0.1 | 0.1 | GO:0098821 | BMP receptor activity(GO:0098821) |
0.1 | 0.1 | GO:0005502 | 11-cis retinal binding(GO:0005502) |
0.1 | 0.2 | GO:0004656 | procollagen-proline 4-dioxygenase activity(GO:0004656) |
0.1 | 0.2 | GO:0003876 | AMP deaminase activity(GO:0003876) adenosine-phosphate deaminase activity(GO:0047623) |
0.1 | 0.4 | GO:0005068 | transmembrane receptor protein tyrosine kinase adaptor activity(GO:0005068) |
0.1 | 0.2 | GO:0070815 | peptidyl-lysine 5-dioxygenase activity(GO:0070815) |
0.1 | 0.1 | GO:0044020 | histone methyltransferase activity (H4-R3 specific)(GO:0044020) |
0.1 | 0.2 | GO:0016838 | carbon-oxygen lyase activity, acting on phosphates(GO:0016838) |
0.1 | 0.5 | GO:0005003 | ephrin receptor activity(GO:0005003) |
0.1 | 0.2 | GO:0102007 | lactonohydrolase activity(GO:0046573) acyl-L-homoserine-lactone lactonohydrolase activity(GO:0102007) |
0.1 | 0.1 | GO:0005001 | transmembrane receptor protein tyrosine phosphatase activity(GO:0005001) |
0.1 | 0.3 | GO:0103116 | alpha-D-galactofuranose transporter activity(GO:0103116) |
0.0 | 0.9 | GO:0005272 | sodium channel activity(GO:0005272) |
0.0 | 1.4 | GO:0030507 | spectrin binding(GO:0030507) |
0.0 | 0.1 | GO:0042392 | sphingosine-1-phosphate phosphatase activity(GO:0042392) |
0.0 | 1.5 | GO:0008188 | neuropeptide receptor activity(GO:0008188) |
0.0 | 0.4 | GO:0015377 | cation:chloride symporter activity(GO:0015377) |
0.0 | 0.2 | GO:0005000 | vasopressin receptor activity(GO:0005000) |
0.0 | 0.1 | GO:0071553 | uridine nucleotide receptor activity(GO:0015065) G-protein coupled pyrimidinergic nucleotide receptor activity(GO:0071553) |
0.0 | 0.1 | GO:0042296 | ISG15 transferase activity(GO:0042296) |
0.0 | 0.1 | GO:0070569 | uridylyltransferase activity(GO:0070569) |
0.0 | 0.9 | GO:0005452 | inorganic anion exchanger activity(GO:0005452) |
0.0 | 0.1 | GO:0031735 | CCR10 chemokine receptor binding(GO:0031735) |
0.0 | 0.1 | GO:0031749 | D2 dopamine receptor binding(GO:0031749) |
0.0 | 0.3 | GO:0008420 | CTD phosphatase activity(GO:0008420) |
0.0 | 0.9 | GO:0001786 | phosphatidylserine binding(GO:0001786) |
0.0 | 0.2 | GO:0035033 | histone deacetylase regulator activity(GO:0035033) |
0.0 | 0.7 | GO:0017134 | fibroblast growth factor binding(GO:0017134) |
0.0 | 0.2 | GO:0071723 | lipopeptide binding(GO:0071723) |
0.0 | 0.5 | GO:0050431 | transforming growth factor beta binding(GO:0050431) |
0.0 | 0.1 | GO:0030628 | pre-mRNA 3'-splice site binding(GO:0030628) |
0.0 | 0.1 | GO:0019959 | interleukin-8 binding(GO:0019959) |
0.0 | 0.4 | GO:0018855 | 3-oxo-2-(2'-pentenyl)cyclopentane-1-octanoic acid CoA ligase activity(GO:0010435) 3-isopropenyl-6-oxoheptanoyl-CoA synthetase activity(GO:0018854) 2-oxo-delta3-4,5,5-trimethylcyclopentenylacetyl-CoA synthetase activity(GO:0018855) benzoyl acetate-CoA ligase activity(GO:0018856) 2,4-dichlorobenzoate-CoA ligase activity(GO:0018857) pivalate-CoA ligase activity(GO:0034783) cyclopropanecarboxylate-CoA ligase activity(GO:0034793) adipate-CoA ligase activity(GO:0034796) citronellyl-CoA ligase activity(GO:0034823) mentha-1,3-dione-CoA ligase activity(GO:0034841) thiophene-2-carboxylate-CoA ligase activity(GO:0034842) 2,4,4-trimethylpentanoate-CoA ligase activity(GO:0034865) cis-2-methyl-5-isopropylhexa-2,5-dienoate-CoA ligase activity(GO:0034942) trans-2-methyl-5-isopropylhexa-2,5-dienoate-CoA ligase activity(GO:0034943) branched-chain acyl-CoA synthetase (ADP-forming) activity(GO:0043759) aryl-CoA synthetase (ADP-forming) activity(GO:0043762) 3-hydroxypropionyl-CoA synthetase activity(GO:0043955) perillic acid:CoA ligase (ADP-forming) activity(GO:0052685) perillic acid:CoA ligase (AMP-forming) activity(GO:0052686) (3R)-3-isopropenyl-6-oxoheptanoate:CoA ligase (ADP-forming) activity(GO:0052687) (3R)-3-isopropenyl-6-oxoheptanoate:CoA ligase (AMP-forming) activity(GO:0052688) pristanate-CoA ligase activity(GO:0070251) malonyl-CoA synthetase activity(GO:0090409) |
0.0 | 1.0 | GO:0005246 | calcium channel regulator activity(GO:0005246) |
0.0 | 0.5 | GO:0035497 | cAMP response element binding(GO:0035497) |
0.0 | 0.3 | GO:0004767 | sphingomyelin phosphodiesterase activity(GO:0004767) |
0.0 | 0.1 | GO:0047276 | N-acetyllactosaminide 3-alpha-galactosyltransferase activity(GO:0047276) |
0.0 | 0.2 | GO:0019211 | phosphatase activator activity(GO:0019211) |
0.0 | 0.9 | GO:0071855 | neuropeptide receptor binding(GO:0071855) |
0.0 | 0.2 | GO:0070324 | thyroid hormone binding(GO:0070324) |
0.0 | 0.2 | GO:0032454 | histone demethylase activity (H3-K9 specific)(GO:0032454) |
0.0 | 0.4 | GO:0043539 | protein serine/threonine kinase activator activity(GO:0043539) |
0.0 | 0.1 | GO:0016971 | flavin-linked sulfhydryl oxidase activity(GO:0016971) |
0.0 | 0.8 | GO:0042056 | chemoattractant activity(GO:0042056) |
0.0 | 0.1 | GO:0004724 | magnesium-dependent protein serine/threonine phosphatase activity(GO:0004724) |
0.0 | 0.4 | GO:0051378 | serotonin binding(GO:0051378) |
0.0 | 0.2 | GO:0005042 | netrin receptor activity(GO:0005042) |
0.0 | 0.3 | GO:0008331 | high voltage-gated calcium channel activity(GO:0008331) |
0.0 | 0.1 | GO:0001032 | RNA polymerase III type 1 promoter DNA binding(GO:0001030) RNA polymerase III type 2 promoter DNA binding(GO:0001031) RNA polymerase III type 3 promoter DNA binding(GO:0001032) 5S rDNA binding(GO:0080084) |
0.0 | 2.5 | GO:0044325 | ion channel binding(GO:0044325) |
0.0 | 0.2 | GO:0015467 | G-protein activated inward rectifier potassium channel activity(GO:0015467) |
0.0 | 0.4 | GO:0032794 | GTPase activating protein binding(GO:0032794) |
0.0 | 0.2 | GO:0015193 | L-proline transmembrane transporter activity(GO:0015193) |
0.0 | 0.0 | GO:0004517 | nitric-oxide synthase activity(GO:0004517) |
0.0 | 0.1 | GO:0008532 | N-acetyllactosaminide beta-1,3-N-acetylglucosaminyltransferase activity(GO:0008532) |
0.0 | 0.1 | GO:0008349 | MAP kinase kinase kinase kinase activity(GO:0008349) |
0.0 | 0.4 | GO:0045236 | CXCR chemokine receptor binding(GO:0045236) |
0.0 | 0.1 | GO:0043842 | Kdo transferase activity(GO:0043842) |
0.0 | 0.1 | GO:0097603 | temperature-gated ion channel activity(GO:0097603) |
0.0 | 0.2 | GO:0016724 | ferroxidase activity(GO:0004322) oxidoreductase activity, oxidizing metal ions, oxygen as acceptor(GO:0016724) |
0.0 | 0.2 | GO:0050786 | RAGE receptor binding(GO:0050786) |
0.0 | 0.0 | GO:0008158 | hedgehog receptor activity(GO:0008158) |
0.0 | 0.1 | GO:0019237 | centromeric DNA binding(GO:0019237) |
0.0 | 0.2 | GO:0005283 | sodium:amino acid symporter activity(GO:0005283) |
0.0 | 0.0 | GO:0008525 | phosphatidylcholine transporter activity(GO:0008525) |
0.0 | 0.1 | GO:0004427 | inorganic diphosphatase activity(GO:0004427) |
0.0 | 0.0 | GO:0031711 | bradykinin receptor binding(GO:0031711) |
0.0 | 0.1 | GO:0005146 | leukemia inhibitory factor receptor binding(GO:0005146) |
0.0 | 0.1 | GO:0017176 | phosphatidylinositol N-acetylglucosaminyltransferase activity(GO:0017176) |
0.0 | 0.1 | GO:0004103 | choline kinase activity(GO:0004103) |
0.0 | 0.0 | GO:0070700 | BMP receptor binding(GO:0070700) |
0.0 | 0.1 | GO:0016880 | acid-ammonia (or amide) ligase activity(GO:0016880) |
0.0 | 0.4 | GO:0001671 | ATPase activator activity(GO:0001671) |
0.0 | 0.1 | GO:0005157 | macrophage colony-stimulating factor receptor binding(GO:0005157) |
0.0 | 0.1 | GO:0071208 | histone pre-mRNA DCP binding(GO:0071208) |
0.0 | 0.0 | GO:0004690 | cyclic nucleotide-dependent protein kinase activity(GO:0004690) |
0.0 | 0.1 | GO:0038100 | nodal binding(GO:0038100) |
0.0 | 0.0 | GO:0032557 | UTP binding(GO:0002134) pyrimidine ribonucleoside binding(GO:0032551) pyrimidine ribonucleotide binding(GO:0032557) |
0.0 | 0.3 | GO:0070006 | metalloaminopeptidase activity(GO:0070006) |
0.0 | 0.2 | GO:0002094 | polyprenyltransferase activity(GO:0002094) |
0.0 | 0.1 | GO:0098632 | protein binding involved in cell-cell adhesion(GO:0098632) |
0.0 | 0.2 | GO:0016861 | intramolecular oxidoreductase activity, interconverting aldoses and ketoses(GO:0016861) |
0.0 | 0.9 | GO:0005164 | tumor necrosis factor receptor binding(GO:0005164) |
0.0 | 0.1 | GO:1990254 | keratin filament binding(GO:1990254) |
0.0 | 0.1 | GO:1990190 | peptide-serine-N-acetyltransferase activity(GO:1990189) peptide-glutamate-N-acetyltransferase activity(GO:1990190) |
0.0 | 0.1 | GO:0000403 | Y-form DNA binding(GO:0000403) |
0.0 | 0.6 | GO:0070003 | threonine-type endopeptidase activity(GO:0004298) threonine-type peptidase activity(GO:0070003) |
0.0 | 0.2 | GO:0019763 | immunoglobulin receptor activity(GO:0019763) |
0.0 | 2.9 | GO:0008083 | growth factor activity(GO:0008083) |
0.0 | 1.0 | GO:0017046 | peptide hormone binding(GO:0017046) |
0.0 | 0.0 | GO:0004673 | protein histidine kinase activity(GO:0004673) |
0.0 | 0.3 | GO:0016783 | sulfurtransferase activity(GO:0016783) |
0.0 | 0.1 | GO:0000774 | adenyl-nucleotide exchange factor activity(GO:0000774) |
0.0 | 0.1 | GO:0031694 | alpha-2A adrenergic receptor binding(GO:0031694) |
0.0 | 2.2 | GO:0043130 | ubiquitin binding(GO:0043130) |
0.0 | 0.1 | GO:1990226 | histone methyltransferase binding(GO:1990226) |
0.0 | 0.3 | GO:0048038 | quinone binding(GO:0048038) |
0.0 | 0.0 | GO:0004967 | glucagon receptor activity(GO:0004967) |
0.0 | 0.1 | GO:0035612 | AP-2 adaptor complex binding(GO:0035612) |
0.0 | 0.1 | GO:1904288 | BAT3 complex binding(GO:1904288) |
0.0 | 0.0 | GO:0036122 | BMP binding(GO:0036122) |
0.0 | 0.1 | GO:0008479 | queuine tRNA-ribosyltransferase activity(GO:0008479) |
0.0 | 0.2 | GO:0042043 | neurexin family protein binding(GO:0042043) |
0.0 | 0.1 | GO:0016668 | oxidoreductase activity, acting on a sulfur group of donors, NAD(P) as acceptor(GO:0016668) |
0.0 | 1.5 | GO:0035250 | UDP-galactosyltransferase activity(GO:0035250) |
0.0 | 0.1 | GO:0032795 | heterotrimeric G-protein binding(GO:0032795) |
0.0 | 0.1 | GO:0004505 | phenylalanine 4-monooxygenase activity(GO:0004505) |
0.0 | 0.1 | GO:0015220 | choline transmembrane transporter activity(GO:0015220) |
0.0 | 0.2 | GO:0005375 | copper ion transmembrane transporter activity(GO:0005375) |
0.0 | 0.1 | GO:0004300 | enoyl-CoA hydratase activity(GO:0004300) |
0.0 | 0.0 | GO:0022858 | L-alanine transmembrane transporter activity(GO:0015180) alanine transmembrane transporter activity(GO:0022858) |
0.0 | 0.0 | GO:0035473 | lipase binding(GO:0035473) |
0.0 | 0.2 | GO:0004576 | oligosaccharyl transferase activity(GO:0004576) |
0.0 | 0.1 | GO:0032051 | clathrin light chain binding(GO:0032051) |
0.0 | 0.1 | GO:0042284 | sphingolipid delta-4 desaturase activity(GO:0042284) |
0.0 | 0.0 | GO:0004980 | melanocyte-stimulating hormone receptor activity(GO:0004980) |
0.0 | 0.5 | GO:0005385 | zinc ion transmembrane transporter activity(GO:0005385) |
0.0 | 0.1 | GO:0004826 | phenylalanine-tRNA ligase activity(GO:0004826) |
0.0 | 0.1 | GO:0034452 | dynactin binding(GO:0034452) |
0.0 | 0.1 | GO:0051864 | histone demethylase activity (H3-K36 specific)(GO:0051864) |
0.0 | 0.4 | GO:0042166 | acetylcholine binding(GO:0042166) |
0.0 | 0.2 | GO:0050750 | low-density lipoprotein particle receptor binding(GO:0050750) |
0.0 | 0.1 | GO:0008486 | diphosphoinositol-polyphosphate diphosphatase activity(GO:0008486) |
0.0 | 0.0 | GO:0061629 | RNA polymerase II sequence-specific DNA binding transcription factor binding(GO:0061629) |
0.0 | 0.1 | GO:0004829 | threonine-tRNA ligase activity(GO:0004829) |
0.0 | 0.1 | GO:0003872 | 6-phosphofructokinase activity(GO:0003872) |
0.0 | 0.1 | GO:0004095 | carnitine O-palmitoyltransferase activity(GO:0004095) |
0.0 | 0.1 | GO:0043426 | MRF binding(GO:0043426) |
0.0 | 0.1 | GO:0016714 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, reduced pteridine as one donor, and incorporation of one atom of oxygen(GO:0016714) |
0.0 | 1.2 | GO:0016782 | transferase activity, transferring sulfur-containing groups(GO:0016782) |
0.0 | 0.2 | GO:0015248 | sterol transporter activity(GO:0015248) |
0.0 | 0.1 | GO:0061665 | SUMO ligase activity(GO:0061665) |
0.0 | 0.1 | GO:0004740 | pyruvate dehydrogenase (acetyl-transferring) kinase activity(GO:0004740) |
0.0 | 0.1 | GO:0008599 | protein phosphatase type 1 regulator activity(GO:0008599) |
0.0 | 0.1 | GO:0035251 | UDP-glucosyltransferase activity(GO:0035251) |
0.0 | 0.3 | GO:0004551 | nucleotide diphosphatase activity(GO:0004551) |
0.0 | 0.1 | GO:0070087 | chromo shadow domain binding(GO:0070087) |
0.0 | 0.0 | GO:1990430 | extracellular matrix protein binding(GO:1990430) |
0.0 | 0.1 | GO:0070728 | leucine binding(GO:0070728) |
0.0 | 0.1 | GO:0004046 | aminoacylase activity(GO:0004046) |
0.0 | 0.1 | GO:0004689 | phosphorylase kinase activity(GO:0004689) |
0.0 | 0.1 | GO:0015111 | iodide transmembrane transporter activity(GO:0015111) |
0.0 | 0.0 | GO:0046921 | alpha-(1->6)-fucosyltransferase activity(GO:0046921) |
0.0 | 0.1 | GO:0070548 | L-glutamine aminotransferase activity(GO:0070548) |
0.0 | 0.1 | GO:0031419 | cobalamin binding(GO:0031419) |
0.0 | 0.1 | GO:0000064 | L-ornithine transmembrane transporter activity(GO:0000064) |
0.0 | 0.1 | GO:0046538 | bisphosphoglycerate mutase activity(GO:0004082) phosphoglycerate mutase activity(GO:0004619) 2,3-bisphosphoglycerate-dependent phosphoglycerate mutase activity(GO:0046538) |
0.0 | 0.0 | GO:0015562 | efflux transmembrane transporter activity(GO:0015562) |
0.0 | 0.0 | GO:0071987 | WD40-repeat domain binding(GO:0071987) |
0.0 | 0.0 | GO:0047961 | glycine N-acyltransferase activity(GO:0047961) |
0.0 | 0.1 | GO:0052833 | inositol monophosphate 1-phosphatase activity(GO:0008934) inositol monophosphate 3-phosphatase activity(GO:0052832) inositol monophosphate 4-phosphatase activity(GO:0052833) inositol monophosphate phosphatase activity(GO:0052834) |
0.0 | 0.1 | GO:0034235 | GPI anchor binding(GO:0034235) |
0.0 | 0.0 | GO:0032422 | purine-rich negative regulatory element binding(GO:0032422) |
0.0 | 0.0 | GO:2001069 | glycogen binding(GO:2001069) |
0.0 | 0.0 | GO:0016649 | electron-transferring-flavoprotein dehydrogenase activity(GO:0004174) oxidoreductase activity, acting on the CH-NH group of donors, quinone or similar compound as acceptor(GO:0016649) |
0.0 | 0.2 | GO:0031683 | G-protein beta/gamma-subunit complex binding(GO:0031683) |
0.0 | 0.1 | GO:0033130 | acetylcholine receptor binding(GO:0033130) |
0.0 | 0.1 | GO:0051920 | peroxiredoxin activity(GO:0051920) |
0.0 | 0.0 | GO:0015563 | uptake transmembrane transporter activity(GO:0015563) |
0.0 | 0.1 | GO:0043141 | ATP-dependent 5'-3' DNA helicase activity(GO:0043141) |
0.0 | 0.0 | GO:0038181 | bile acid receptor activity(GO:0038181) |
0.0 | 0.3 | GO:0034596 | phosphatidylinositol phosphate 4-phosphatase activity(GO:0034596) |
0.0 | 0.0 | GO:0019187 | beta-1,4-mannosyltransferase activity(GO:0019187) |
0.0 | 0.1 | GO:0015321 | sodium-dependent phosphate transmembrane transporter activity(GO:0015321) |
0.0 | 0.1 | GO:0016841 | ammonia-lyase activity(GO:0016841) |
0.0 | 0.5 | GO:0003707 | steroid hormone receptor activity(GO:0003707) |
0.0 | 0.0 | GO:0035276 | ethanol binding(GO:0035276) |
0.0 | 0.0 | GO:0004985 | opioid receptor activity(GO:0004985) |
0.0 | 0.2 | GO:0004890 | GABA-A receptor activity(GO:0004890) |
0.0 | 0.1 | GO:0034824 | enoyl-[acyl-carrier-protein] reductase activity(GO:0016631) 2,3-dihydroxy-2,3-dihydro-phenylpropionate dehydrogenase activity(GO:0018498) cis-2,3-dihydrodiol DDT dehydrogenase activity(GO:0018499) trans-9R,10R-dihydrodiolphenanthrene dehydrogenase activity(GO:0018500) cis-chlorobenzene dihydrodiol dehydrogenase activity(GO:0018501) 2,5-dichloro-2,5-cyclohexadiene-1,4-diol dehydrogenase activity(GO:0018502) trans-1,2-dihydrodiolphenanthrene dehydrogenase activity(GO:0018503) 3,4-dihydroxy-3,4-dihydrofluorene dehydrogenase activity(GO:0034790) benzo(a)pyrene-trans-11,12-dihydrodiol dehydrogenase activity(GO:0034805) benzo(a)pyrene-cis-4,5-dihydrodiol dehydrogenase activity(GO:0034809) citronellyl-CoA dehydrogenase activity(GO:0034824) menthone dehydrogenase activity(GO:0034838) phthalate 3,4-cis-dihydrodiol dehydrogenase activity(GO:0034912) cinnamate reductase activity(GO:0043786) NADPH-dependent curcumin reductase activity(GO:0052849) NADPH-dependent dihydrocurcumin reductase activity(GO:0052850) |
0.0 | 0.0 | GO:0070699 | type II activin receptor binding(GO:0070699) |
0.0 | 0.0 | GO:0019103 | pyrimidine nucleotide binding(GO:0019103) |
0.0 | 0.1 | GO:0008242 | omega peptidase activity(GO:0008242) |
0.0 | 0.0 | GO:0034584 | piRNA binding(GO:0034584) |
0.0 | 0.1 | GO:0004556 | alpha-amylase activity(GO:0004556) |
0.0 | 0.0 | GO:0015018 | galactosylgalactosylxylosylprotein 3-beta-glucuronosyltransferase activity(GO:0015018) |
0.0 | 0.0 | GO:0097200 | cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:0097200) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.5 | 1.0 | PID P38 ALPHA BETA PATHWAY | Regulation of p38-alpha and p38-beta |
0.3 | 9.1 | PID NETRIN PATHWAY | Netrin-mediated signaling events |
0.2 | 0.5 | PID INTEGRIN4 PATHWAY | Alpha6 beta4 integrin-ligand interactions |
0.2 | 4.7 | PID GLYPICAN 1PATHWAY | Glypican 1 network |
0.2 | 5.1 | PID EPHRINB REV PATHWAY | Ephrin B reverse signaling |
0.2 | 2.0 | PID ALK2 PATHWAY | ALK2 signaling events |
0.2 | 1.8 | SA B CELL RECEPTOR COMPLEXES | Antigen binding to B cell receptors activates protein tyrosine kinases, such as the Src family, which ultimate activate MAP kinases. |
0.1 | 2.6 | PID HEDGEHOG 2PATHWAY | Signaling events mediated by the Hedgehog family |
0.1 | 0.9 | PID NEPHRIN NEPH1 PATHWAY | Nephrin/Neph1 signaling in the kidney podocyte |
0.1 | 4.0 | PID RAS PATHWAY | Regulation of Ras family activation |
0.1 | 2.9 | PID EPHA FWDPATHWAY | EPHA forward signaling |
0.1 | 2.0 | PID LYMPH ANGIOGENESIS PATHWAY | VEGFR3 signaling in lymphatic endothelium |
0.1 | 0.6 | PID VEGFR1 2 PATHWAY | Signaling events mediated by VEGFR1 and VEGFR2 |
0.1 | 0.8 | SA TRKA RECEPTOR | The TrkA receptor binds nerve growth factor to activate MAP kinase pathways and promote cell growth. |
0.1 | 1.2 | PID ALK1 PATHWAY | ALK1 signaling events |
0.1 | 0.1 | PID GMCSF PATHWAY | GMCSF-mediated signaling events |
0.1 | 0.6 | PID TCR JNK PATHWAY | JNK signaling in the CD4+ TCR pathway |
0.1 | 3.5 | PID FGF PATHWAY | FGF signaling pathway |
0.1 | 0.4 | PID ERBB NETWORK PATHWAY | ErbB receptor signaling network |
0.1 | 1.0 | PID S1P S1P1 PATHWAY | S1P1 pathway |
0.1 | 0.4 | PID VEGF VEGFR PATHWAY | VEGF and VEGFR signaling network |
0.1 | 1.7 | PID RAC1 REG PATHWAY | Regulation of RAC1 activity |
0.1 | 1.4 | PID INTEGRIN A4B1 PATHWAY | Alpha4 beta1 integrin signaling events |
0.1 | 0.2 | PID EPHB FWD PATHWAY | EPHB forward signaling |
0.1 | 1.2 | ST GRANULE CELL SURVIVAL PATHWAY | Granule Cell Survival Pathway is a specific case of more general PAC1 Receptor Pathway. |
0.1 | 10.3 | NABA ECM GLYCOPROTEINS | Genes encoding structural ECM glycoproteins |
0.1 | 2.2 | PID SYNDECAN 1 PATHWAY | Syndecan-1-mediated signaling events |
0.1 | 1.2 | PID NCADHERIN PATHWAY | N-cadherin signaling events |
0.1 | 0.4 | PID A6B1 A6B4 INTEGRIN PATHWAY | a6b1 and a6b4 Integrin signaling |
0.1 | 1.5 | PID WNT SIGNALING PATHWAY | Wnt signaling network |
0.1 | 1.9 | NABA PROTEOGLYCANS | Genes encoding proteoglycans |
0.0 | 0.7 | PID MAPK TRK PATHWAY | Trk receptor signaling mediated by the MAPK pathway |
0.0 | 1.1 | PID ANGIOPOIETIN RECEPTOR PATHWAY | Angiopoietin receptor Tie2-mediated signaling |
0.0 | 0.2 | ST G ALPHA S PATHWAY | G alpha s Pathway |
0.0 | 11.2 | NABA SECRETED FACTORS | Genes encoding secreted soluble factors |
0.0 | 0.1 | PID VEGFR1 PATHWAY | VEGFR1 specific signals |
0.0 | 0.2 | PID MET PATHWAY | Signaling events mediated by Hepatocyte Growth Factor Receptor (c-Met) |
0.0 | 0.0 | ST ADRENERGIC | Adrenergic Pathway |
0.0 | 0.2 | ST MYOCYTE AD PATHWAY | Myocyte Adrenergic Pathway is a specific case of the generalized Adrenergic Pathway. |
0.0 | 0.2 | PID FRA PATHWAY | Validated transcriptional targets of AP1 family members Fra1 and Fra2 |
0.0 | 0.2 | PID ER NONGENOMIC PATHWAY | Plasma membrane estrogen receptor signaling |
0.0 | 0.4 | PID CDC42 REG PATHWAY | Regulation of CDC42 activity |
0.0 | 0.2 | PID IL2 STAT5 PATHWAY | IL2 signaling events mediated by STAT5 |
0.0 | 1.0 | PID ARF6 TRAFFICKING PATHWAY | Arf6 trafficking events |
0.0 | 0.1 | PID IL2 1PATHWAY | IL2-mediated signaling events |
0.0 | 0.3 | SA REG CASCADE OF CYCLIN EXPR | Expression of cyclins regulates progression through the cell cycle by activating cyclin-dependent kinases. |
0.0 | 0.8 | PID HES HEY PATHWAY | Notch-mediated HES/HEY network |
0.0 | 0.2 | ST JAK STAT PATHWAY | Jak-STAT Pathway |
0.0 | 3.9 | NABA ECM AFFILIATED | Genes encoding proteins affiliated structurally or functionally to extracellular matrix proteins |
0.0 | 0.3 | PID ERBB4 PATHWAY | ErbB4 signaling events |
0.0 | 0.1 | PID HIF1A PATHWAY | Hypoxic and oxygen homeostasis regulation of HIF-1-alpha |
0.0 | 0.1 | PID HIV NEF PATHWAY | HIV-1 Nef: Negative effector of Fas and TNF-alpha |
0.0 | 0.1 | PID ANTHRAX PATHWAY | Cellular roles of Anthrax toxin |
0.0 | 0.1 | PID FAS PATHWAY | FAS (CD95) signaling pathway |
0.0 | 0.3 | PID LPA4 PATHWAY | LPA4-mediated signaling events |
0.0 | 0.2 | PID PI3KCI AKT PATHWAY | Class I PI3K signaling events mediated by Akt |
0.0 | 0.2 | PID IL8 CXCR1 PATHWAY | IL8- and CXCR1-mediated signaling events |
0.0 | 0.3 | PID ERB GENOMIC PATHWAY | Validated nuclear estrogen receptor beta network |
0.0 | 0.4 | ST GA13 PATHWAY | G alpha 13 Pathway |
0.0 | 0.1 | SIG INSULIN RECEPTOR PATHWAY IN CARDIAC MYOCYTES | Genes related to the insulin receptor pathway |
0.0 | 0.3 | PID TCR PATHWAY | TCR signaling in naïve CD4+ T cells |
0.0 | 0.0 | PID ECADHERIN NASCENT AJ PATHWAY | E-cadherin signaling in the nascent adherens junction |
0.0 | 0.1 | PID NECTIN PATHWAY | Nectin adhesion pathway |
0.0 | 0.0 | PID SYNDECAN 3 PATHWAY | Syndecan-3-mediated signaling events |
0.0 | 0.2 | PID SHP2 PATHWAY | SHP2 signaling |
0.0 | 0.4 | PID FOXO PATHWAY | FoxO family signaling |
0.0 | 0.2 | PID IL12 STAT4 PATHWAY | IL12 signaling mediated by STAT4 |
0.0 | 0.2 | PID BMP PATHWAY | BMP receptor signaling |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.7 | 0.7 | REACTOME REGULATION OF INSULIN SECRETION BY GLUCAGON LIKE PEPTIDE1 | Genes involved in Regulation of Insulin Secretion by Glucagon-like Peptide-1 |
0.5 | 1.9 | REACTOME BINDING AND ENTRY OF HIV VIRION | Genes involved in Binding and entry of HIV virion |
0.4 | 4.9 | REACTOME GABA A RECEPTOR ACTIVATION | Genes involved in GABA A receptor activation |
0.4 | 5.0 | REACTOME SYNTHESIS SECRETION AND INACTIVATION OF GIP | Genes involved in Synthesis, Secretion, and Inactivation of Glucose-dependent Insulinotropic Polypeptide (GIP) |
0.3 | 4.4 | REACTOME DCC MEDIATED ATTRACTIVE SIGNALING | Genes involved in DCC mediated attractive signaling |
0.3 | 4.0 | REACTOME CRMPS IN SEMA3A SIGNALING | Genes involved in CRMPs in Sema3A signaling |
0.3 | 0.3 | REACTOME SYNTHESIS OF PIPS AT THE LATE ENDOSOME MEMBRANE | Genes involved in Synthesis of PIPs at the late endosome membrane |
0.3 | 2.8 | REACTOME ACTIVATION OF THE AP1 FAMILY OF TRANSCRIPTION FACTORS | Genes involved in Activation of the AP-1 family of transcription factors |
0.3 | 0.3 | REACTOME INHIBITION OF INSULIN SECRETION BY ADRENALINE NORADRENALINE | Genes involved in Inhibition of Insulin Secretion by Adrenaline/Noradrenaline |
0.3 | 0.3 | REACTOME SIGNALING BY ACTIVATED POINT MUTANTS OF FGFR1 | Genes involved in Signaling by activated point mutants of FGFR1 |
0.2 | 9.4 | REACTOME NCAM1 INTERACTIONS | Genes involved in NCAM1 interactions |
0.2 | 2.5 | REACTOME DOWNREGULATION OF ERBB2 ERBB3 SIGNALING | Genes involved in Downregulation of ERBB2:ERBB3 signaling |
0.2 | 4.1 | REACTOME SIGNALING BY HIPPO | Genes involved in Signaling by Hippo |
0.2 | 4.4 | REACTOME SIGNALING BY BMP | Genes involved in Signaling by BMP |
0.2 | 1.9 | REACTOME THE NLRP3 INFLAMMASOME | Genes involved in The NLRP3 inflammasome |
0.2 | 1.2 | REACTOME G ALPHA Z SIGNALLING EVENTS | Genes involved in G alpha (z) signalling events |
0.2 | 3.9 | REACTOME ADHERENS JUNCTIONS INTERACTIONS | Genes involved in Adherens junctions interactions |
0.2 | 1.7 | REACTOME GABA SYNTHESIS RELEASE REUPTAKE AND DEGRADATION | Genes involved in GABA synthesis, release, reuptake and degradation |
0.2 | 2.6 | REACTOME ABCA TRANSPORTERS IN LIPID HOMEOSTASIS | Genes involved in ABCA transporters in lipid homeostasis |
0.2 | 1.3 | REACTOME DOPAMINE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Dopamine Neurotransmitter Release Cycle |
0.2 | 2.6 | REACTOME RAS ACTIVATION UOPN CA2 INFUX THROUGH NMDA RECEPTOR | Genes involved in Ras activation uopn Ca2+ infux through NMDA receptor |
0.1 | 0.7 | REACTOME SYNTHESIS OF BILE ACIDS AND BILE SALTS VIA 24 HYDROXYCHOLESTEROL | Genes involved in Synthesis of bile acids and bile salts via 24-hydroxycholesterol |
0.1 | 1.5 | REACTOME KERATAN SULFATE DEGRADATION | Genes involved in Keratan sulfate degradation |
0.1 | 2.2 | REACTOME FORMATION OF TUBULIN FOLDING INTERMEDIATES BY CCT TRIC | Genes involved in Formation of tubulin folding intermediates by CCT/TriC |
0.1 | 0.5 | REACTOME AMINE COMPOUND SLC TRANSPORTERS | Genes involved in Amine compound SLC transporters |
0.1 | 0.6 | REACTOME SHC MEDIATED SIGNALLING | Genes involved in SHC-mediated signalling |
0.1 | 0.6 | REACTOME SIGNALING BY CONSTITUTIVELY ACTIVE EGFR | Genes involved in Signaling by constitutively active EGFR |
0.1 | 1.9 | REACTOME INSULIN SYNTHESIS AND PROCESSING | Genes involved in Insulin Synthesis and Processing |
0.1 | 1.3 | REACTOME JNK C JUN KINASES PHOSPHORYLATION AND ACTIVATION MEDIATED BY ACTIVATED HUMAN TAK1 | Genes involved in JNK (c-Jun kinases) phosphorylation and activation mediated by activated human TAK1 |
0.1 | 1.3 | REACTOME ENDOGENOUS STEROLS | Genes involved in Endogenous sterols |
0.1 | 1.2 | REACTOME HDL MEDIATED LIPID TRANSPORT | Genes involved in HDL-mediated lipid transport |
0.1 | 0.8 | REACTOME OPSINS | Genes involved in Opsins |
0.1 | 2.2 | REACTOME CA DEPENDENT EVENTS | Genes involved in Ca-dependent events |
0.1 | 0.9 | REACTOME CS DS DEGRADATION | Genes involved in CS/DS degradation |
0.1 | 0.6 | REACTOME SPRY REGULATION OF FGF SIGNALING | Genes involved in Spry regulation of FGF signaling |
0.1 | 0.7 | REACTOME VEGF LIGAND RECEPTOR INTERACTIONS | Genes involved in VEGF ligand-receptor interactions |
0.1 | 3.9 | REACTOME VOLTAGE GATED POTASSIUM CHANNELS | Genes involved in Voltage gated Potassium channels |
0.1 | 1.1 | REACTOME SYNTHESIS OF PIPS AT THE EARLY ENDOSOME MEMBRANE | Genes involved in Synthesis of PIPs at the early endosome membrane |
0.1 | 0.7 | REACTOME GAP JUNCTION DEGRADATION | Genes involved in Gap junction degradation |
0.1 | 0.1 | REACTOME CELL CELL COMMUNICATION | Genes involved in Cell-Cell communication |
0.1 | 1.5 | REACTOME MYOGENESIS | Genes involved in Myogenesis |
0.1 | 0.7 | REACTOME IONOTROPIC ACTIVITY OF KAINATE RECEPTORS | Genes involved in Ionotropic activity of Kainate Receptors |
0.1 | 0.7 | REACTOME NEPHRIN INTERACTIONS | Genes involved in Nephrin interactions |
0.1 | 1.1 | REACTOME ENOS ACTIVATION AND REGULATION | Genes involved in eNOS activation and regulation |
0.1 | 0.9 | REACTOME FGFR2C LIGAND BINDING AND ACTIVATION | Genes involved in FGFR2c ligand binding and activation |
0.1 | 0.6 | REACTOME GLYCOPROTEIN HORMONES | Genes involved in Glycoprotein hormones |
0.1 | 0.2 | REACTOME TRAFFICKING OF GLUR2 CONTAINING AMPA RECEPTORS | Genes involved in Trafficking of GluR2-containing AMPA receptors |
0.1 | 2.3 | REACTOME COLLAGEN FORMATION | Genes involved in Collagen formation |
0.1 | 0.3 | REACTOME ADENYLATE CYCLASE INHIBITORY PATHWAY | Genes involved in Adenylate cyclase inhibitory pathway |
0.1 | 1.0 | REACTOME TIE2 SIGNALING | Genes involved in Tie2 Signaling |
0.1 | 0.2 | REACTOME G BETA GAMMA SIGNALLING THROUGH PI3KGAMMA | Genes involved in G beta:gamma signalling through PI3Kgamma |
0.1 | 0.7 | REACTOME ABC FAMILY PROTEINS MEDIATED TRANSPORT | Genes involved in ABC-family proteins mediated transport |
0.1 | 0.6 | REACTOME RAP1 SIGNALLING | Genes involved in Rap1 signalling |
0.1 | 0.6 | REACTOME TANDEM PORE DOMAIN POTASSIUM CHANNELS | Genes involved in Tandem pore domain potassium channels |
0.1 | 0.4 | REACTOME NCAM SIGNALING FOR NEURITE OUT GROWTH | Genes involved in NCAM signaling for neurite out-growth |
0.1 | 0.1 | REACTOME ABORTIVE ELONGATION OF HIV1 TRANSCRIPT IN THE ABSENCE OF TAT | Genes involved in Abortive elongation of HIV-1 transcript in the absence of Tat |
0.0 | 2.2 | REACTOME CROSS PRESENTATION OF SOLUBLE EXOGENOUS ANTIGENS ENDOSOMES | Genes involved in Cross-presentation of soluble exogenous antigens (endosomes) |
0.0 | 0.2 | REACTOME UNBLOCKING OF NMDA RECEPTOR GLUTAMATE BINDING AND ACTIVATION | Genes involved in Unblocking of NMDA receptor, glutamate binding and activation |
0.0 | 0.5 | REACTOME UNWINDING OF DNA | Genes involved in Unwinding of DNA |
0.0 | 0.3 | REACTOME INCRETIN SYNTHESIS SECRETION AND INACTIVATION | Genes involved in Incretin Synthesis, Secretion, and Inactivation |
0.0 | 0.2 | REACTOME G PROTEIN ACTIVATION | Genes involved in G-protein activation |
0.0 | 0.8 | REACTOME APC C CDC20 MEDIATED DEGRADATION OF MITOTIC PROTEINS | Genes involved in APC/C:Cdc20 mediated degradation of mitotic proteins |
0.0 | 1.4 | REACTOME AMINE LIGAND BINDING RECEPTORS | Genes involved in Amine ligand-binding receptors |
0.0 | 0.3 | REACTOME PROSTANOID LIGAND RECEPTORS | Genes involved in Prostanoid ligand receptors |
0.0 | 0.3 | REACTOME GLUTAMATE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Glutamate Neurotransmitter Release Cycle |
0.0 | 0.5 | REACTOME SIGNALING BY FGFR1 FUSION MUTANTS | Genes involved in Signaling by FGFR1 fusion mutants |
0.0 | 0.4 | REACTOME HIGHLY CALCIUM PERMEABLE POSTSYNAPTIC NICOTINIC ACETYLCHOLINE RECEPTORS | Genes involved in Highly calcium permeable postsynaptic nicotinic acetylcholine receptors |
0.0 | 0.1 | REACTOME SIGNALLING BY NGF | Genes involved in Signalling by NGF |
0.0 | 2.6 | REACTOME CLASS B 2 SECRETIN FAMILY RECEPTORS | Genes involved in Class B/2 (Secretin family receptors) |
0.0 | 0.3 | REACTOME SIGNAL TRANSDUCTION BY L1 | Genes involved in Signal transduction by L1 |
0.0 | 0.5 | REACTOME CLASS C 3 METABOTROPIC GLUTAMATE PHEROMONE RECEPTORS | Genes involved in Class C/3 (Metabotropic glutamate/pheromone receptors) |
0.0 | 0.5 | REACTOME BRANCHED CHAIN AMINO ACID CATABOLISM | Genes involved in Branched-chain amino acid catabolism |
0.0 | 0.2 | REACTOME NEUROTRANSMITTER RECEPTOR BINDING AND DOWNSTREAM TRANSMISSION IN THE POSTSYNAPTIC CELL | Genes involved in Neurotransmitter Receptor Binding And Downstream Transmission In The Postsynaptic Cell |
0.0 | 1.0 | REACTOME ION TRANSPORT BY P TYPE ATPASES | Genes involved in Ion transport by P-type ATPases |
0.0 | 0.8 | REACTOME DEGRADATION OF THE EXTRACELLULAR MATRIX | Genes involved in Degradation of the extracellular matrix |
0.0 | 0.4 | REACTOME N GLYCAN ANTENNAE ELONGATION | Genes involved in N-Glycan antennae elongation |
0.0 | 0.4 | REACTOME DESTABILIZATION OF MRNA BY KSRP | Genes involved in Destabilization of mRNA by KSRP |
0.0 | 0.1 | REACTOME DIGESTION OF DIETARY CARBOHYDRATE | Genes involved in Digestion of dietary carbohydrate |
0.0 | 0.3 | REACTOME TGF BETA RECEPTOR SIGNALING IN EMT EPITHELIAL TO MESENCHYMAL TRANSITION | Genes involved in TGF-beta receptor signaling in EMT (epithelial to mesenchymal transition) |
0.0 | 0.2 | REACTOME HYALURONAN METABOLISM | Genes involved in Hyaluronan metabolism |
0.0 | 0.2 | REACTOME P75 NTR RECEPTOR MEDIATED SIGNALLING | Genes involved in p75 NTR receptor-mediated signalling |
0.0 | 0.4 | REACTOME GAP JUNCTION TRAFFICKING | Genes involved in Gap junction trafficking |
0.0 | 0.3 | REACTOME BILE ACID AND BILE SALT METABOLISM | Genes involved in Bile acid and bile salt metabolism |
0.0 | 0.4 | REACTOME SYNTHESIS AND INTERCONVERSION OF NUCLEOTIDE DI AND TRIPHOSPHATES | Genes involved in Synthesis and interconversion of nucleotide di- and triphosphates |
0.0 | 0.0 | REACTOME SIGNALING BY ERBB2 | Genes involved in Signaling by ERBB2 |
0.0 | 0.3 | REACTOME CITRIC ACID CYCLE TCA CYCLE | Genes involved in Citric acid cycle (TCA cycle) |
0.0 | 0.0 | REACTOME ACYL CHAIN REMODELLING OF PI | Genes involved in Acyl chain remodelling of PI |
0.0 | 0.2 | REACTOME NOTCH HLH TRANSCRIPTION PATHWAY | Genes involved in Notch-HLH transcription pathway |
0.0 | 0.0 | REACTOME SIGNALING BY THE B CELL RECEPTOR BCR | Genes involved in Signaling by the B Cell Receptor (BCR) |
0.0 | 0.2 | REACTOME AMINE DERIVED HORMONES | Genes involved in Amine-derived hormones |
0.0 | 0.1 | REACTOME APOBEC3G MEDIATED RESISTANCE TO HIV1 INFECTION | Genes involved in APOBEC3G mediated resistance to HIV-1 infection |
0.0 | 0.1 | REACTOME RECRUITMENT OF NUMA TO MITOTIC CENTROSOMES | Genes involved in Recruitment of NuMA to mitotic centrosomes |
0.0 | 0.1 | REACTOME TRANSPORT OF ORGANIC ANIONS | Genes involved in Transport of organic anions |
0.0 | 0.2 | REACTOME NUCLEOTIDE LIKE PURINERGIC RECEPTORS | Genes involved in Nucleotide-like (purinergic) receptors |
0.0 | 0.2 | REACTOME REGULATION OF AMPK ACTIVITY VIA LKB1 | Genes involved in Regulation of AMPK activity via LKB1 |
0.0 | 0.7 | REACTOME NUCLEAR RECEPTOR TRANSCRIPTION PATHWAY | Genes involved in Nuclear Receptor transcription pathway |
0.0 | 0.0 | REACTOME BETA DEFENSINS | Genes involved in Beta defensins |
0.0 | 0.0 | REACTOME SIGNALING BY FGFR3 MUTANTS | Genes involved in Signaling by FGFR3 mutants |
0.0 | 0.0 | REACTOME TRANSPORT OF MATURE TRANSCRIPT TO CYTOPLASM | Genes involved in Transport of Mature Transcript to Cytoplasm |
0.0 | 0.1 | REACTOME SIGNALLING TO P38 VIA RIT AND RIN | Genes involved in Signalling to p38 via RIT and RIN |
0.0 | 0.1 | REACTOME HORMONE LIGAND BINDING RECEPTORS | Genes involved in Hormone ligand-binding receptors |
0.0 | 0.0 | REACTOME NEP NS2 INTERACTS WITH THE CELLULAR EXPORT MACHINERY | Genes involved in NEP/NS2 Interacts with the Cellular Export Machinery |
0.0 | 0.5 | REACTOME CHEMOKINE RECEPTORS BIND CHEMOKINES | Genes involved in Chemokine receptors bind chemokines |
0.0 | 0.1 | REACTOME BASE FREE SUGAR PHOSPHATE REMOVAL VIA THE SINGLE NUCLEOTIDE REPLACEMENT PATHWAY | Genes involved in Base-free sugar-phosphate removal via the single-nucleotide replacement pathway |
0.0 | 0.1 | REACTOME ORGANIC CATION ANION ZWITTERION TRANSPORT | Genes involved in Organic cation/anion/zwitterion transport |
0.0 | 0.1 | REACTOME ACTIVATED AMPK STIMULATES FATTY ACID OXIDATION IN MUSCLE | Genes involved in Activated AMPK stimulates fatty-acid oxidation in muscle |
0.0 | 0.1 | REACTOME ANDROGEN BIOSYNTHESIS | Genes involved in Androgen biosynthesis |
0.0 | 0.4 | REACTOME HEPARAN SULFATE HEPARIN HS GAG METABOLISM | Genes involved in Heparan sulfate/heparin (HS-GAG) metabolism |