| Gene Symbol | Gene ID | Gene Info |
|---|---|---|
|
T
|
ENSMUSG00000062327.4 | brachyury, T-box transcription factor T |
| CRE | Gene | Distance | Association probability | Pearson corr. coef. | P-value | Plot |
|---|---|---|---|---|---|---|
| chr17_8463605_8463767 | T | 28275 | 0.147084 | -0.72 | 4.4e-10 | Click! |
| chr17_8457153_8457304 | T | 21817 | 0.158728 | -0.63 | 2.9e-07 | Click! |
| chr17_8468848_8468999 | T | 33512 | 0.136537 | -0.55 | 1.3e-05 | Click! |
| chr17_8416984_8417161 | T | 17351 | 0.135497 | 0.21 | 1.2e-01 | Click! |
| chr17_8416818_8416969 | T | 17530 | 0.135023 | 0.06 | 6.8e-01 | Click! |
Move your cursor over a bar to see sample name and corresponding Z-value.
| Cis Regulatory Element (CRE) | Target Score | Top associated gene | Gene Info | Distance of CRE to TSS | CRE/Gene association probability |
|---|---|---|---|---|---|
| chr14_14351950_14353283 | 26.49 |
Il3ra |
interleukin 3 receptor, alpha chain |
2995 |
0.15 |
| chr11_109555645_109556032 | 16.14 |
Arsg |
arylsulfatase G |
12084 |
0.16 |
| chr5_138076362_138076513 | 11.69 |
Zkscan1 |
zinc finger with KRAB and SCAN domains 1 |
8647 |
0.09 |
| chr7_142025987_142026319 | 10.20 |
Mob2 |
MOB kinase activator 2 |
78 |
0.95 |
| chr11_115899580_115900578 | 10.17 |
Smim5 |
small integral membrane protein 5 |
99 |
0.93 |
| chr14_25687410_25687792 | 10.02 |
Ppif |
peptidylprolyl isomerase F (cyclophilin F) |
6553 |
0.14 |
| chr11_98904631_98904915 | 9.76 |
Cdc6 |
cell division cycle 6 |
3028 |
0.15 |
| chr1_181335118_181335287 | 9.60 |
Cnih3 |
cornichon family AMPA receptor auxiliary protein 3 |
17426 |
0.15 |
| chr12_111353338_111354089 | 9.60 |
Cdc42bpb |
CDC42 binding protein kinase beta |
23906 |
0.13 |
| chr1_23335409_23335710 | 9.23 |
Gm20954 |
predicted gene, 20954 |
11040 |
0.15 |
| chr18_62176881_62177064 | 9.12 |
Adrb2 |
adrenergic receptor, beta 2 |
2987 |
0.24 |
| chr2_93455310_93455482 | 8.65 |
Gm10804 |
predicted gene 10804 |
2575 |
0.23 |
| chr1_188973613_188973764 | 8.42 |
Kctd3 |
potassium channel tetramerisation domain containing 3 |
51 |
0.98 |
| chr3_89147017_89147649 | 8.38 |
Hcn3 |
hyperpolarization-activated, cyclic nucleotide-gated K+ 3 |
3881 |
0.08 |
| chr12_30943684_30943877 | 8.35 |
Sh3yl1 |
Sh3 domain YSC-like 1 |
31593 |
0.13 |
| chr1_185472844_185473015 | 8.29 |
5033404E19Rik |
RIKEN cDNA 5033404E19 gene |
14365 |
0.12 |
| chr12_106027461_106027735 | 8.15 |
Vrk1 |
vaccinia related kinase 1 |
1791 |
0.4 |
| chr16_91441869_91442151 | 8.14 |
Gm46562 |
predicted gene, 46562 |
16411 |
0.09 |
| chr19_5726991_5727271 | 8.12 |
Gm16538 |
predicted gene 16538 |
75 |
0.87 |
| chr4_135898801_135898969 | 8.04 |
Cnr2 |
cannabinoid receptor 2 (macrophage) |
3491 |
0.13 |
| chr7_143986580_143986731 | 8.00 |
Shank2 |
SH3 and multiple ankyrin repeat domains 2 |
15273 |
0.17 |
| chr11_44512747_44512998 | 7.87 |
Rnf145 |
ring finger protein 145 |
6092 |
0.18 |
| chr7_75830784_75831144 | 7.72 |
Klhl25 |
kelch-like 25 |
17346 |
0.18 |
| chr2_28601758_28601945 | 7.67 |
Gm22824 |
predicted gene, 22824 |
6344 |
0.11 |
| chr19_45790364_45790530 | 7.60 |
Kcnip2 |
Kv channel-interacting protein 2 |
3852 |
0.17 |
| chr4_12087867_12088383 | 7.57 |
Tmem67 |
transmembrane protein 67 |
118 |
0.93 |
| chr16_76341613_76341764 | 7.51 |
Nrip1 |
nuclear receptor interacting protein 1 |
18030 |
0.21 |
| chr7_16781038_16782438 | 7.45 |
Slc1a5 |
solute carrier family 1 (neutral amino acid transporter), member 5 |
370 |
0.78 |
| chr5_143976810_143976975 | 7.41 |
Gm17135 |
predicted gene 17135 |
4099 |
0.13 |
| chr12_103827736_103827948 | 7.26 |
Serpina1b |
serine (or cysteine) preptidase inhibitor, clade A, member 1B |
2531 |
0.15 |
| chr3_103171228_103172264 | 7.25 |
Bcas2 |
breast carcinoma amplified sequence 2 |
3 |
0.97 |
| chr3_153852379_153852554 | 7.23 |
Asb17os |
ankyrin repeat and SOCS box-containing 17, opposite strand |
42 |
0.95 |
| chr10_115818034_115818185 | 7.19 |
Tspan8 |
tetraspanin 8 |
825 |
0.72 |
| chr4_129339534_129339685 | 7.18 |
Zbtb8os |
zinc finger and BTB domain containing 8 opposite strand |
3562 |
0.14 |
| chr4_135985229_135985393 | 7.16 |
Pithd1 |
PITH (C-terminal proteasome-interacting domain of thioredoxin-like) domain containing 1 |
627 |
0.51 |
| chr5_113977372_113977757 | 7.14 |
Ssh1 |
slingshot protein phosphatase 1 |
10808 |
0.13 |
| chr10_42533925_42534363 | 7.13 |
Snx3 |
sorting nexin 3 |
31854 |
0.14 |
| chr7_98176524_98176700 | 7.07 |
Gm16938 |
predicted gene, 16938 |
582 |
0.63 |
| chr12_103737920_103738559 | 6.93 |
Serpina1b |
serine (or cysteine) preptidase inhibitor, clade A, member 1B |
81 |
0.95 |
| chr13_111816217_111816368 | 6.90 |
Gm15327 |
predicted gene 15327 |
5824 |
0.15 |
| chr8_119432166_119432317 | 6.84 |
Osgin1 |
oxidative stress induced growth inhibitor 1 |
1883 |
0.28 |
| chr9_111211500_111211665 | 6.73 |
Lrrfip2 |
leucine rich repeat (in FLII) interacting protein 2 |
2611 |
0.26 |
| chr2_135700777_135701082 | 6.67 |
Gm14211 |
predicted gene 14211 |
7775 |
0.2 |
| chr6_40795540_40795691 | 6.62 |
Mgam2-ps |
maltase-glucoamylase 2, pseudogene |
8674 |
0.18 |
| chr12_103863072_103863984 | 6.53 |
Serpina1a |
serine (or cysteine) peptidase inhibitor, clade A, member 1A |
23 |
0.95 |
| chr15_89396857_89397343 | 6.49 |
Klhdc7b |
kelch domain containing 7B |
10209 |
0.07 |
| chr19_24514771_24514953 | 6.44 |
Fam122a |
family with sequence similarity 122, member A |
37506 |
0.14 |
| chr7_35116915_35117352 | 6.38 |
Cebpa |
CCAAT/enhancer binding protein (C/EBP), alpha |
2160 |
0.15 |
| chr10_59800856_59801208 | 6.37 |
Gm17059 |
predicted gene 17059 |
778 |
0.56 |
| chr14_31644829_31645148 | 6.34 |
Hacl1 |
2-hydroxyacyl-CoA lyase 1 |
3702 |
0.17 |
| chr8_22434254_22434804 | 6.34 |
Mrps31 |
mitochondrial ribosomal protein S31 |
23131 |
0.09 |
| chr3_79580298_79580474 | 6.33 |
Gm35067 |
predicted gene, 35067 |
2202 |
0.19 |
| chr11_86581948_86582099 | 6.32 |
Mir21a |
microRNA 21a |
2135 |
0.24 |
| chr12_103773311_103773475 | 6.31 |
Serpina1d |
serine (or cysteine) peptidase inhibitor, clade A, member 1D |
199 |
0.9 |
| chr2_164438281_164438523 | 6.31 |
Sdc4 |
syndecan 4 |
4784 |
0.1 |
| chr8_69654078_69655164 | 6.26 |
Zfp964 |
zinc finger protein 964 |
129 |
0.95 |
| chr9_111119010_111119184 | 6.26 |
Lrrfip2 |
leucine rich repeat (in FLII) interacting protein 2 |
332 |
0.86 |
| chr6_146220158_146220350 | 6.18 |
Itpr2 |
inositol 1,4,5-triphosphate receptor 2 |
7289 |
0.26 |
| chr19_10203179_10203536 | 6.17 |
Fen1 |
flap structure specific endonuclease 1 |
537 |
0.44 |
| chr4_62383795_62384159 | 6.16 |
Slc31a1 |
solute carrier family 31, member 1 |
1524 |
0.29 |
| chr7_122132401_122133528 | 6.16 |
Palb2 |
partner and localizer of BRCA2 |
18 |
0.54 |
| chr1_171452961_171453272 | 6.12 |
F11r |
F11 receptor |
9734 |
0.09 |
| chr19_4858811_4858966 | 6.10 |
Ctsf |
cathepsin F |
405 |
0.67 |
| chr7_90063338_90063489 | 6.07 |
Gm44861 |
predicted gene 44861 |
20716 |
0.11 |
| chr7_101064633_101064988 | 6.06 |
Gm5735 |
predicted gene 5735 |
3335 |
0.2 |
| chr3_89280469_89281651 | 6.05 |
Efna1 |
ephrin A1 |
82 |
0.91 |
| chr7_132772149_132772433 | 6.05 |
Fam53b |
family with sequence similarity 53, member B |
4625 |
0.23 |
| chr2_22777785_22778079 | 6.02 |
Apbb1ip |
amyloid beta (A4) precursor protein-binding, family B, member 1 interacting protein |
3487 |
0.19 |
| chr5_139738871_139739112 | 6.02 |
Micall2 |
MICAL-like 2 |
2655 |
0.2 |
| chr12_80813962_80814126 | 6.00 |
Susd6 |
sushi domain containing 6 |
23485 |
0.12 |
| chr11_51415145_51415316 | 5.97 |
Col23a1 |
collagen, type XXIII, alpha 1 |
125310 |
0.04 |
| chr4_119051049_119051260 | 5.91 |
Gm12866 |
predicted gene 12866 |
17957 |
0.1 |
| chr7_25274067_25274289 | 5.89 |
Cic |
capicua transcriptional repressor |
4244 |
0.1 |
| chr2_15164151_15164466 | 5.86 |
Gm13313 |
predicted gene 13313 |
36708 |
0.16 |
| chr7_119251734_119252076 | 5.85 |
Gm4083 |
predicted gene 4083 |
49802 |
0.12 |
| chr19_3322601_3322897 | 5.85 |
Cpt1a |
carnitine palmitoyltransferase 1a, liver |
415 |
0.75 |
| chr11_87749251_87749406 | 5.85 |
Mir142hg |
Mir142 host gene (non-protein coding) |
6249 |
0.09 |
| chr10_127204001_127204174 | 5.84 |
Pip4k2c |
phosphatidylinositol-5-phosphate 4-kinase, type II, gamma |
7468 |
0.08 |
| chr11_3403164_3403338 | 5.82 |
Limk2 |
LIM motif-containing protein kinase 2 |
5923 |
0.13 |
| chr2_52571524_52571970 | 5.80 |
Cacnb4 |
calcium channel, voltage-dependent, beta 4 subunit |
13180 |
0.19 |
| chr10_21254680_21254976 | 5.80 |
Gm33728 |
predicted gene, 33728 |
2714 |
0.22 |
| chr11_106486190_106486357 | 5.80 |
Ern1 |
endoplasmic reticulum (ER) to nucleus signalling 1 |
1523 |
0.33 |
| chr12_103956494_103956864 | 5.76 |
Serpina1e |
serine (or cysteine) peptidase inhibitor, clade A, member 1E |
219 |
0.88 |
| chr9_72408867_72409024 | 5.76 |
Gm27255 |
predicted gene 27255 |
323 |
0.68 |
| chr6_113691177_113691368 | 5.66 |
Irak2 |
interleukin-1 receptor-associated kinase 2 |
527 |
0.5 |
| chr4_129377050_129377794 | 5.65 |
Zbtb8a |
zinc finger and BTB domain containing 8a |
694 |
0.53 |
| chr1_24614276_24614427 | 5.64 |
Gm10925 |
predicted gene 10925 |
300 |
0.46 |
| chr2_30463478_30464399 | 5.61 |
Ier5l |
immediate early response 5-like |
10281 |
0.13 |
| chr2_129232906_129233132 | 5.60 |
9830144P21Rik |
RIKEN cDNA 9830144P21 gene |
2440 |
0.15 |
| chr8_8238163_8238376 | 5.57 |
A630009H07Rik |
RIKEN cDNA A630009H07 gene |
96808 |
0.07 |
| chr2_153153382_153153546 | 5.51 |
Gm25643 |
predicted gene, 25643 |
1549 |
0.32 |
| chr9_3199707_3199988 | 5.48 |
Gm31138 |
predicted gene, 31138 |
47 |
0.49 |
| chr1_130734157_130734345 | 5.46 |
AA986860 |
expressed sequence AA986860 |
2141 |
0.16 |
| chr15_79322163_79322314 | 5.45 |
Pla2g6 |
phospholipase A2, group VI |
1328 |
0.28 |
| chr11_96925582_96925775 | 5.45 |
Prr15l |
proline rich 15-like |
2426 |
0.13 |
| chr17_47909349_47909983 | 5.44 |
Gm15556 |
predicted gene 15556 |
12712 |
0.13 |
| chr17_86753909_86754216 | 5.43 |
Epas1 |
endothelial PAS domain protein 1 |
362 |
0.87 |
| chr7_100502343_100502561 | 5.42 |
Ucp2 |
uncoupling protein 2 (mitochondrial, proton carrier) |
4106 |
0.11 |
| chr14_57084344_57084685 | 5.38 |
Gjb2 |
gap junction protein, beta 2 |
20188 |
0.13 |
| chr15_82407139_82407298 | 5.37 |
Cyp2d10 |
cytochrome P450, family 2, subfamily d, polypeptide 10 |
23 |
0.51 |
| chr4_43605155_43605320 | 5.36 |
Gm12472 |
predicted gene 12472 |
17165 |
0.06 |
| chr4_35096772_35096992 | 5.36 |
Ifnk |
interferon kappa |
55174 |
0.11 |
| chr13_21919061_21919443 | 5.32 |
Gm44456 |
predicted gene, 44456 |
5764 |
0.07 |
| chr6_88758260_88758436 | 5.32 |
Gm43999 |
predicted gene, 43999 |
15621 |
0.11 |
| chr2_103958706_103958880 | 5.30 |
Lmo2 |
LIM domain only 2 |
798 |
0.56 |
| chr5_57782194_57782347 | 5.29 |
Gm42481 |
predicted gene 42481 |
3397 |
0.17 |
| chr8_105313093_105313575 | 5.26 |
Mir328 |
microRNA 328 |
4874 |
0.06 |
| chr11_87729488_87729866 | 5.26 |
Rnf43 |
ring finger protein 43 |
303 |
0.8 |
| chr2_136148933_136149455 | 5.22 |
Gm14218 |
predicted gene 14218 |
12188 |
0.26 |
| chr13_41017782_41018219 | 5.21 |
Tmem14c |
transmembrane protein 14C |
1708 |
0.25 |
| chr6_88189509_88190427 | 5.18 |
Gm38708 |
predicted gene, 38708 |
713 |
0.56 |
| chr14_76532356_76532788 | 5.14 |
E130202H07Rik |
RIKEN cDNA E130202H07 gene |
5956 |
0.21 |
| chr19_24794396_24794754 | 5.14 |
Pgm5 |
phosphoglucomutase 5 |
31497 |
0.16 |
| chr3_9581691_9581938 | 5.12 |
Zfp704 |
zinc finger protein 704 |
16515 |
0.23 |
| chr2_119566179_119566455 | 5.12 |
Chp1 |
calcineurin-like EF hand protein 1 |
288 |
0.85 |
| chr6_94203631_94203874 | 5.10 |
Magi1 |
membrane associated guanylate kinase, WW and PDZ domain containing 1 |
79273 |
0.1 |
| chr18_73829817_73829968 | 5.08 |
Me2 |
malic enzyme 2, NAD(+)-dependent, mitochondrial |
14443 |
0.19 |
| chr11_100938783_100940230 | 5.03 |
Stat3 |
signal transducer and activator of transcription 3 |
27 |
0.97 |
| chr16_11567709_11567882 | 5.01 |
Gm15897 |
predicted gene 15897 |
71489 |
0.11 |
| chr7_24450572_24450723 | 5.01 |
Irgc1 |
immunity-related GTPase family, cinema 1 |
1524 |
0.2 |
| chr8_105802064_105802332 | 5.01 |
Ranbp10 |
RAN binding protein 10 |
25007 |
0.08 |
| chr11_121549044_121549219 | 4.98 |
Tbcd |
tubulin-specific chaperone d |
980 |
0.57 |
| chr5_135013108_135013523 | 4.96 |
Abhd11os |
abhydrolase domain containing 11, opposite strand |
62 |
0.92 |
| chr8_94974142_94974748 | 4.93 |
Adgrg1 |
adhesion G protein-coupled receptor G1 |
306 |
0.84 |
| chr8_117548099_117548250 | 4.91 |
Gm27361 |
predicted gene, 27361 |
1148 |
0.52 |
| chr8_122285201_122285360 | 4.90 |
Zfpm1 |
zinc finger protein, multitype 1 |
3139 |
0.2 |
| chr5_142920434_142920596 | 4.90 |
Actb |
actin, beta |
13761 |
0.14 |
| chr1_86479174_86479713 | 4.89 |
Rpl30-ps6 |
ribosomal protein L30, pseudogene 6 |
5784 |
0.15 |
| chr17_56826728_56827077 | 4.88 |
Rfx2 |
regulatory factor X, 2 (influences HLA class II expression) |
4037 |
0.15 |
| chr14_76531135_76531299 | 4.87 |
E130202H07Rik |
RIKEN cDNA E130202H07 gene |
4601 |
0.22 |
| chr9_44719978_44720480 | 4.86 |
Phldb1 |
pleckstrin homology like domain, family B, member 1 |
1158 |
0.26 |
| chr9_44341195_44341350 | 4.85 |
Hmbs |
hydroxymethylbilane synthase |
39 |
0.91 |
| chr8_11476606_11477276 | 4.84 |
E230013L22Rik |
RIKEN cDNA E230013L22 gene |
988 |
0.37 |
| chr10_24947969_24948164 | 4.82 |
Gm36172 |
predicted gene, 36172 |
20447 |
0.13 |
| chr19_24794066_24794366 | 4.82 |
Pgm5 |
phosphoglucomutase 5 |
31138 |
0.16 |
| chr10_8037913_8038845 | 4.81 |
Gm48614 |
predicted gene, 48614 |
17087 |
0.23 |
| chr15_31570184_31570491 | 4.80 |
Cmbl |
carboxymethylenebutenolidase-like (Pseudomonas) |
1539 |
0.3 |
| chr6_88049109_88049327 | 4.80 |
Rab7 |
RAB7, member RAS oncogene family |
3948 |
0.14 |
| chr8_11056777_11056930 | 4.77 |
9530052E02Rik |
RIKEN cDNA 9530052E02 gene |
7275 |
0.15 |
| chr15_80531833_80531991 | 4.76 |
Enthd1 |
ENTH domain containing 1 |
28558 |
0.13 |
| chr9_35106138_35106542 | 4.76 |
St3gal4 |
ST3 beta-galactoside alpha-2,3-sialyltransferase 4 |
327 |
0.86 |
| chr12_80113547_80113987 | 4.75 |
Zfp36l1 |
zinc finger protein 36, C3H type-like 1 |
754 |
0.51 |
| chr5_138980706_138980884 | 4.74 |
Pdgfa |
platelet derived growth factor, alpha |
13486 |
0.17 |
| chr10_94098138_94098431 | 4.74 |
Gm18391 |
predicted gene, 18391 |
144 |
0.94 |
| chr19_6102561_6102728 | 4.74 |
Naaladl1 |
N-acetylated alpha-linked acidic dipeptidase-like 1 |
3138 |
0.07 |
| chr12_25098272_25099055 | 4.73 |
Id2 |
inhibitor of DNA binding 2 |
1523 |
0.35 |
| chr5_139792850_139793006 | 4.72 |
Mafk |
v-maf musculoaponeurotic fibrosarcoma oncogene family, protein K (avian) |
1394 |
0.3 |
| chr8_116921881_116922253 | 4.69 |
Cenpn |
centromere protein N |
260 |
0.75 |
| chr2_119166896_119167867 | 4.69 |
Gchfr |
GTP cyclohydrolase I feedback regulator |
392 |
0.73 |
| chr1_180148615_180148897 | 4.68 |
Gm38331 |
predicted gene, 38331 |
605 |
0.7 |
| chr11_116098784_116098935 | 4.68 |
Trim47 |
tripartite motif-containing 47 |
8224 |
0.1 |
| chr13_99019515_99019689 | 4.68 |
A930014D07Rik |
RIKEN cDNA A930014D07 gene |
12503 |
0.12 |
| chr19_55860061_55860336 | 4.68 |
Ppnr |
per-pentamer repeat gene |
18526 |
0.23 |
| chr7_127111564_127111723 | 4.67 |
Qprt |
quinolinate phosphoribosyltransferase |
10375 |
0.07 |
| chr9_22131307_22131532 | 4.65 |
Acp5 |
acid phosphatase 5, tartrate resistant |
234 |
0.81 |
| chr16_24090532_24090683 | 4.63 |
Gm31583 |
predicted gene, 31583 |
518 |
0.77 |
| chr3_135843797_135843956 | 4.62 |
4933401H06Rik |
RIKEN cDNA 4933401H06 gene |
3607 |
0.18 |
| chr19_55927014_55927165 | 4.61 |
Tcf7l2 |
transcription factor 7 like 2, T cell specific, HMG box |
28780 |
0.21 |
| chr11_97441477_97441827 | 4.60 |
Arhgap23 |
Rho GTPase activating protein 23 |
5367 |
0.18 |
| chr10_127662435_127663215 | 4.60 |
Gm16229 |
predicted gene 16229 |
1014 |
0.29 |
| chr19_53185920_53186082 | 4.58 |
Add3 |
adducin 3 (gamma) |
4405 |
0.18 |
| chr12_102787968_102788326 | 4.57 |
Gm47042 |
predicted gene, 47042 |
23435 |
0.08 |
| chr6_90712861_90713488 | 4.57 |
Iqsec1 |
IQ motif and Sec7 domain 1 |
3355 |
0.21 |
| chr8_94962299_94962469 | 4.57 |
Gm10286 |
predicted gene 10286 |
7370 |
0.12 |
| chr11_117783178_117784002 | 4.56 |
Tmc8 |
transmembrane channel-like gene family 8 |
932 |
0.28 |
| chr2_168072526_168073106 | 4.55 |
Gm24327 |
predicted gene, 24327 |
7919 |
0.14 |
| chr13_61803863_61804026 | 4.54 |
Gm23739 |
predicted gene, 23739 |
304 |
0.47 |
| chr19_53809266_53809417 | 4.53 |
Gm16299 |
predicted gene 16299 |
15787 |
0.16 |
| chr8_88298055_88298249 | 4.52 |
Adcy7 |
adenylate cyclase 7 |
2227 |
0.3 |
| chr7_133698808_133698973 | 4.52 |
Uros |
uroporphyrinogen III synthase |
810 |
0.49 |
| chr13_92847494_92847645 | 4.50 |
Mtx3 |
metaxin 3 |
2371 |
0.33 |
| chr4_141162052_141162216 | 4.49 |
Fbxo42 |
F-box protein 42 |
14212 |
0.11 |
| chr13_73474192_73474464 | 4.48 |
Lpcat1 |
lysophosphatidylcholine acyltransferase 1 |
2577 |
0.32 |
| chr1_167383765_167383916 | 4.48 |
Mgst3 |
microsomal glutathione S-transferase 3 |
10001 |
0.14 |
| chr19_3589950_3590137 | 4.47 |
Ppp6r3 |
protein phosphatase 6, regulatory subunit 3 |
14294 |
0.15 |
| chr9_31254711_31255028 | 4.46 |
Gm7244 |
predicted gene 7244 |
19952 |
0.14 |
| chr14_25451921_25452103 | 4.44 |
Zmiz1os1 |
Zmiz1 opposite strand 1 |
5786 |
0.14 |
| chrX_75115730_75115912 | 4.42 |
Mpp1 |
membrane protein, palmitoylated |
2027 |
0.19 |
| chr7_25273837_25274017 | 4.42 |
Cic |
capicua transcriptional repressor |
4495 |
0.1 |
| chr14_14012273_14013624 | 4.42 |
Atxn7 |
ataxin 7 |
196 |
0.95 |
| chr5_118984857_118985048 | 4.41 |
Gm43784 |
predicted gene 43784 |
12044 |
0.2 |
| chr4_136450380_136450531 | 4.40 |
6030445D17Rik |
RIKEN cDNA 6030445D17 gene |
11795 |
0.15 |
| chr17_46159767_46159994 | 4.40 |
Gtpbp2 |
GTP binding protein 2 |
1152 |
0.32 |
| chr16_21825593_21825853 | 4.40 |
Map3k13 |
mitogen-activated protein kinase kinase kinase 13 |
219 |
0.89 |
| chr4_49549194_49549345 | 4.40 |
Aldob |
aldolase B, fructose-bisphosphate |
277 |
0.88 |
| chr11_54025887_54026038 | 4.39 |
Slc22a4 |
solute carrier family 22 (organic cation transporter), member 4 |
1990 |
0.27 |
| chr13_92533624_92533775 | 4.38 |
Zfyve16 |
zinc finger, FYVE domain containing 16 |
2831 |
0.27 |
| chr6_115852875_115853903 | 4.34 |
Mbd4 |
methyl-CpG binding domain protein 4 |
18 |
0.55 |
| chr3_107968879_107969033 | 4.34 |
Gstm3 |
glutathione S-transferase, mu 3 |
327 |
0.72 |
| chr11_22843321_22843496 | 4.34 |
Gm23772 |
predicted gene, 23772 |
3460 |
0.15 |
| chr12_30897102_30897356 | 4.33 |
Acp1 |
acid phosphatase 1, soluble |
890 |
0.57 |
| chr5_36711866_36712139 | 4.31 |
D5Ertd579e |
DNA segment, Chr 5, ERATO Doi 579, expressed |
15978 |
0.12 |
| chr14_41007337_41007980 | 4.30 |
Prxl2a |
peroxiredoxin like 2A |
608 |
0.7 |
| chr9_66606222_66606434 | 4.30 |
Usp3 |
ubiquitin specific peptidase 3 |
13186 |
0.19 |
| chr13_73445205_73445466 | 4.30 |
Lpcat1 |
lysophosphatidylcholine acyltransferase 1 |
21862 |
0.19 |
| chr8_36668721_36669167 | 4.29 |
Dlc1 |
deleted in liver cancer 1 |
55001 |
0.16 |
| chr5_88627644_88627813 | 4.28 |
Rufy3 |
RUN and FYVE domain containing 3 |
18963 |
0.16 |
| chr9_31302330_31302481 | 4.27 |
Prdm10 |
PR domain containing 10 |
11148 |
0.16 |
| chr13_9057349_9057545 | 4.25 |
Gm36264 |
predicted gene, 36264 |
19004 |
0.13 |
| chr13_114914696_114914848 | 4.24 |
Itga2 |
integrin alpha 2 |
12829 |
0.21 |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 3.0 | 3.0 | GO:0052490 | negative regulation by symbiont of host apoptotic process(GO:0033668) negative regulation by symbiont of host programmed cell death(GO:0052041) negative regulation by organism of programmed cell death in other organism involved in symbiotic interaction(GO:0052490) |
| 1.9 | 7.6 | GO:1904469 | positive regulation of tumor necrosis factor secretion(GO:1904469) |
| 1.8 | 7.2 | GO:0048625 | myoblast fate commitment(GO:0048625) |
| 1.8 | 5.3 | GO:0060154 | cellular process regulating host cell cycle in response to virus(GO:0060154) |
| 1.7 | 6.7 | GO:0060397 | JAK-STAT cascade involved in growth hormone signaling pathway(GO:0060397) |
| 1.6 | 4.8 | GO:0061624 | fructose catabolic process(GO:0006001) fructose catabolic process to hydroxyacetone phosphate and glyceraldehyde-3-phosphate(GO:0061624) glycolytic process through fructose-1-phosphate(GO:0061625) |
| 1.6 | 7.9 | GO:0003199 | endocardial cushion to mesenchymal transition involved in heart valve formation(GO:0003199) |
| 1.5 | 8.8 | GO:0002154 | thyroid hormone mediated signaling pathway(GO:0002154) |
| 1.4 | 4.1 | GO:0002025 | vasodilation by norepinephrine-epinephrine involved in regulation of systemic arterial blood pressure(GO:0002025) |
| 1.3 | 2.6 | GO:0060375 | regulation of mast cell differentiation(GO:0060375) |
| 1.2 | 5.0 | GO:2000483 | negative regulation of interleukin-8 secretion(GO:2000483) |
| 1.2 | 4.9 | GO:0007023 | post-chaperonin tubulin folding pathway(GO:0007023) |
| 1.2 | 4.7 | GO:0071072 | negative regulation of phospholipid biosynthetic process(GO:0071072) |
| 1.2 | 3.5 | GO:0014873 | response to muscle activity involved in regulation of muscle adaptation(GO:0014873) |
| 1.1 | 8.0 | GO:0042905 | 9-cis-retinoic acid biosynthetic process(GO:0042904) 9-cis-retinoic acid metabolic process(GO:0042905) |
| 1.1 | 5.7 | GO:0072656 | maintenance of protein location in mitochondrion(GO:0072656) |
| 1.1 | 3.4 | GO:0042938 | dipeptide transport(GO:0042938) |
| 1.1 | 3.2 | GO:0035405 | histone-threonine phosphorylation(GO:0035405) |
| 1.1 | 1.1 | GO:1903377 | negative regulation of oxidative stress-induced neuron intrinsic apoptotic signaling pathway(GO:1903377) |
| 1.1 | 7.5 | GO:0015825 | L-serine transport(GO:0015825) |
| 1.1 | 4.3 | GO:0032417 | positive regulation of sodium:proton antiporter activity(GO:0032417) |
| 1.0 | 3.1 | GO:0000087 | mitotic M phase(GO:0000087) |
| 1.0 | 4.2 | GO:0033634 | positive regulation of cell-cell adhesion mediated by integrin(GO:0033634) |
| 1.0 | 5.2 | GO:2000561 | regulation of CD4-positive, alpha-beta T cell proliferation(GO:2000561) |
| 1.0 | 3.1 | GO:0003166 | bundle of His development(GO:0003166) |
| 1.0 | 11.2 | GO:0009437 | carnitine metabolic process(GO:0009437) |
| 1.0 | 3.0 | GO:0043152 | induction of bacterial agglutination(GO:0043152) |
| 1.0 | 4.0 | GO:0070966 | nuclear-transcribed mRNA catabolic process, no-go decay(GO:0070966) |
| 1.0 | 2.0 | GO:0072718 | response to cisplatin(GO:0072718) |
| 1.0 | 1.9 | GO:1902956 | regulation of mitochondrial electron transport, NADH to ubiquinone(GO:1902956) |
| 1.0 | 3.8 | GO:0032929 | negative regulation of superoxide anion generation(GO:0032929) |
| 0.9 | 2.8 | GO:0048769 | sarcomerogenesis(GO:0048769) |
| 0.9 | 3.6 | GO:0014053 | negative regulation of gamma-aminobutyric acid secretion(GO:0014053) |
| 0.9 | 3.6 | GO:0002159 | desmosome assembly(GO:0002159) |
| 0.9 | 3.6 | GO:0097039 | protein linear polyubiquitination(GO:0097039) |
| 0.9 | 2.7 | GO:0071879 | positive regulation of adrenergic receptor signaling pathway(GO:0071879) |
| 0.9 | 2.6 | GO:0032474 | otolith morphogenesis(GO:0032474) |
| 0.9 | 2.6 | GO:0034395 | regulation of transcription from RNA polymerase II promoter in response to iron(GO:0034395) |
| 0.8 | 4.2 | GO:0060971 | embryonic heart tube left/right pattern formation(GO:0060971) |
| 0.8 | 2.5 | GO:1903336 | negative regulation of vacuolar transport(GO:1903336) |
| 0.8 | 3.3 | GO:0043137 | DNA replication, removal of RNA primer(GO:0043137) |
| 0.8 | 3.3 | GO:0035564 | regulation of kidney size(GO:0035564) |
| 0.8 | 0.8 | GO:0035995 | detection of muscle stretch(GO:0035995) |
| 0.8 | 2.5 | GO:0034197 | acylglycerol transport(GO:0034196) triglyceride transport(GO:0034197) |
| 0.8 | 4.1 | GO:0060696 | regulation of phospholipid catabolic process(GO:0060696) |
| 0.8 | 4.0 | GO:2001269 | positive regulation of cysteine-type endopeptidase activity involved in apoptotic signaling pathway(GO:2001269) |
| 0.8 | 14.5 | GO:0001574 | ganglioside biosynthetic process(GO:0001574) |
| 0.8 | 4.0 | GO:0031049 | programmed DNA elimination(GO:0031049) chromosome breakage(GO:0031052) |
| 0.8 | 2.4 | GO:0061144 | alveolar secondary septum development(GO:0061144) |
| 0.8 | 5.5 | GO:0018065 | protein-cofactor linkage(GO:0018065) |
| 0.8 | 1.6 | GO:2000504 | positive regulation of blood vessel remodeling(GO:2000504) |
| 0.8 | 1.6 | GO:0001543 | ovarian follicle rupture(GO:0001543) |
| 0.8 | 0.8 | GO:0061724 | lipophagy(GO:0061724) |
| 0.8 | 1.6 | GO:1902445 | regulation of mitochondrial membrane permeability involved in programmed necrotic cell death(GO:1902445) |
| 0.8 | 1.5 | GO:1990169 | detoxification of copper ion(GO:0010273) stress response to copper ion(GO:1990169) |
| 0.8 | 2.3 | GO:0045658 | regulation of neutrophil differentiation(GO:0045658) |
| 0.8 | 6.8 | GO:0046606 | negative regulation of centrosome duplication(GO:0010826) negative regulation of centrosome cycle(GO:0046606) |
| 0.8 | 3.8 | GO:0015760 | hexose phosphate transport(GO:0015712) glucose-6-phosphate transport(GO:0015760) |
| 0.7 | 2.2 | GO:0006481 | C-terminal protein methylation(GO:0006481) |
| 0.7 | 3.7 | GO:2000189 | positive regulation of cholesterol homeostasis(GO:2000189) |
| 0.7 | 2.2 | GO:0071314 | cellular response to cocaine(GO:0071314) |
| 0.7 | 2.9 | GO:0019346 | homoserine metabolic process(GO:0009092) transsulfuration(GO:0019346) |
| 0.7 | 2.2 | GO:0006532 | aspartate biosynthetic process(GO:0006532) |
| 0.7 | 1.4 | GO:2001180 | negative regulation of interleukin-10 secretion(GO:2001180) |
| 0.7 | 2.8 | GO:0010529 | regulation of transposition(GO:0010528) negative regulation of transposition(GO:0010529) |
| 0.7 | 2.1 | GO:0042222 | interleukin-1 biosynthetic process(GO:0042222) |
| 0.7 | 3.5 | GO:0015722 | canalicular bile acid transport(GO:0015722) |
| 0.7 | 2.1 | GO:0019184 | glutathione biosynthetic process(GO:0006750) nonribosomal peptide biosynthetic process(GO:0019184) |
| 0.7 | 2.1 | GO:0038161 | prolactin signaling pathway(GO:0038161) |
| 0.7 | 4.0 | GO:1900103 | positive regulation of endoplasmic reticulum unfolded protein response(GO:1900103) |
| 0.7 | 2.0 | GO:0002291 | T cell activation via T cell receptor contact with antigen bound to MHC molecule on antigen presenting cell(GO:0002291) |
| 0.7 | 3.3 | GO:0002457 | T cell antigen processing and presentation(GO:0002457) |
| 0.7 | 7.2 | GO:0006107 | oxaloacetate metabolic process(GO:0006107) |
| 0.6 | 2.6 | GO:1900194 | negative regulation of oocyte maturation(GO:1900194) |
| 0.6 | 4.5 | GO:0001842 | neural fold formation(GO:0001842) |
| 0.6 | 1.9 | GO:1904694 | negative regulation of vascular smooth muscle contraction(GO:1904694) |
| 0.6 | 2.5 | GO:2000574 | regulation of microtubule motor activity(GO:2000574) |
| 0.6 | 3.8 | GO:0034242 | negative regulation of syncytium formation by plasma membrane fusion(GO:0034242) |
| 0.6 | 3.1 | GO:0048386 | positive regulation of retinoic acid receptor signaling pathway(GO:0048386) |
| 0.6 | 1.9 | GO:0040031 | snRNA modification(GO:0040031) |
| 0.6 | 2.5 | GO:0097460 | ferrous iron import into cell(GO:0097460) |
| 0.6 | 1.2 | GO:0035973 | aggrephagy(GO:0035973) |
| 0.6 | 3.6 | GO:0060903 | positive regulation of meiosis I(GO:0060903) |
| 0.6 | 1.8 | GO:0018992 | germ-line sex determination(GO:0018992) |
| 0.6 | 5.4 | GO:0043569 | negative regulation of insulin-like growth factor receptor signaling pathway(GO:0043569) |
| 0.6 | 0.6 | GO:0003330 | regulation of extracellular matrix constituent secretion(GO:0003330) positive regulation of extracellular matrix constituent secretion(GO:0003331) |
| 0.6 | 1.8 | GO:0071816 | protein insertion into ER membrane(GO:0045048) tail-anchored membrane protein insertion into ER membrane(GO:0071816) |
| 0.6 | 4.7 | GO:0010881 | regulation of cardiac muscle contraction by regulation of the release of sequestered calcium ion(GO:0010881) |
| 0.6 | 0.6 | GO:0035771 | interleukin-4-mediated signaling pathway(GO:0035771) |
| 0.6 | 1.7 | GO:0032261 | purine nucleotide salvage(GO:0032261) IMP salvage(GO:0032264) |
| 0.6 | 1.7 | GO:0036066 | protein O-linked fucosylation(GO:0036066) |
| 0.6 | 2.9 | GO:0048633 | positive regulation of skeletal muscle tissue growth(GO:0048633) |
| 0.6 | 1.7 | GO:0048022 | negative regulation of melanin biosynthetic process(GO:0048022) negative regulation of secondary metabolite biosynthetic process(GO:1900377) |
| 0.6 | 4.0 | GO:0034379 | very-low-density lipoprotein particle assembly(GO:0034379) |
| 0.6 | 1.7 | GO:0071865 | apoptotic process in bone marrow(GO:0071839) regulation of apoptotic process in bone marrow(GO:0071865) negative regulation of apoptotic process in bone marrow(GO:0071866) |
| 0.6 | 1.1 | GO:0090154 | positive regulation of sphingolipid biosynthetic process(GO:0090154) positive regulation of ceramide biosynthetic process(GO:2000304) |
| 0.6 | 3.9 | GO:0007000 | nucleolus organization(GO:0007000) |
| 0.6 | 1.7 | GO:0006407 | rRNA export from nucleus(GO:0006407) |
| 0.6 | 1.7 | GO:0010982 | regulation of high-density lipoprotein particle clearance(GO:0010982) |
| 0.5 | 3.3 | GO:0042373 | vitamin K metabolic process(GO:0042373) |
| 0.5 | 1.1 | GO:0070782 | phosphatidylserine exposure on apoptotic cell surface(GO:0070782) |
| 0.5 | 2.1 | GO:0051541 | elastin metabolic process(GO:0051541) |
| 0.5 | 2.1 | GO:0007296 | vitellogenesis(GO:0007296) |
| 0.5 | 1.1 | GO:0035754 | B cell chemotaxis(GO:0035754) |
| 0.5 | 1.6 | GO:0038028 | insulin receptor signaling pathway via phosphatidylinositol 3-kinase(GO:0038028) |
| 0.5 | 1.6 | GO:0051182 | coenzyme transport(GO:0051182) |
| 0.5 | 1.1 | GO:0044027 | hypermethylation of CpG island(GO:0044027) |
| 0.5 | 2.6 | GO:0070836 | caveola assembly(GO:0070836) |
| 0.5 | 1.0 | GO:1902262 | apoptotic process involved in patterning of blood vessels(GO:1902262) |
| 0.5 | 2.6 | GO:0006685 | sphingomyelin catabolic process(GO:0006685) |
| 0.5 | 0.5 | GO:0006667 | sphinganine metabolic process(GO:0006667) |
| 0.5 | 2.6 | GO:0042985 | negative regulation of amyloid precursor protein biosynthetic process(GO:0042985) |
| 0.5 | 2.0 | GO:1903278 | positive regulation of sodium ion export(GO:1903275) positive regulation of sodium ion export from cell(GO:1903278) |
| 0.5 | 1.5 | GO:0010360 | negative regulation of anion channel activity(GO:0010360) |
| 0.5 | 1.5 | GO:0010912 | regulation of isomerase activity(GO:0010911) positive regulation of isomerase activity(GO:0010912) |
| 0.5 | 1.5 | GO:0070889 | platelet alpha granule organization(GO:0070889) |
| 0.5 | 2.0 | GO:1903553 | positive regulation of extracellular exosome assembly(GO:1903553) |
| 0.5 | 1.5 | GO:0019805 | quinolinate biosynthetic process(GO:0019805) |
| 0.5 | 3.0 | GO:0061072 | iris morphogenesis(GO:0061072) |
| 0.5 | 2.0 | GO:0090241 | negative regulation of histone H4 acetylation(GO:0090241) |
| 0.5 | 2.9 | GO:0014051 | gamma-aminobutyric acid secretion(GO:0014051) |
| 0.5 | 1.0 | GO:0006551 | leucine metabolic process(GO:0006551) |
| 0.5 | 1.5 | GO:0060454 | positive regulation of gastric acid secretion(GO:0060454) |
| 0.5 | 1.9 | GO:0070574 | cadmium ion transport(GO:0015691) cadmium ion transmembrane transport(GO:0070574) |
| 0.5 | 1.4 | GO:0043096 | purine nucleobase salvage(GO:0043096) |
| 0.5 | 0.5 | GO:0071394 | cellular response to testosterone stimulus(GO:0071394) |
| 0.5 | 1.4 | GO:0035522 | monoubiquitinated histone deubiquitination(GO:0035521) monoubiquitinated histone H2A deubiquitination(GO:0035522) |
| 0.5 | 1.4 | GO:0008228 | opsonization(GO:0008228) |
| 0.5 | 1.0 | GO:0009786 | regulation of asymmetric cell division(GO:0009786) |
| 0.5 | 1.0 | GO:0052203 | modulation of catalytic activity in other organism involved in symbiotic interaction(GO:0052203) modulation by host of symbiont catalytic activity(GO:0052422) |
| 0.5 | 1.4 | GO:0018125 | peptidyl-cysteine methylation(GO:0018125) |
| 0.5 | 2.9 | GO:0006526 | arginine biosynthetic process(GO:0006526) |
| 0.5 | 1.9 | GO:0030223 | neutrophil differentiation(GO:0030223) |
| 0.5 | 1.9 | GO:0002913 | positive regulation of T cell anergy(GO:0002669) positive regulation of lymphocyte anergy(GO:0002913) |
| 0.5 | 0.5 | GO:0046487 | glyoxylate metabolic process(GO:0046487) |
| 0.5 | 0.9 | GO:0006990 | positive regulation of transcription from RNA polymerase II promoter involved in unfolded protein response(GO:0006990) |
| 0.5 | 1.4 | GO:0007039 | protein catabolic process in the vacuole(GO:0007039) |
| 0.5 | 1.4 | GO:0002017 | regulation of blood volume by renal aldosterone(GO:0002017) |
| 0.5 | 1.4 | GO:0006068 | ethanol catabolic process(GO:0006068) |
| 0.5 | 1.8 | GO:0000050 | urea cycle(GO:0000050) |
| 0.5 | 2.7 | GO:0051001 | negative regulation of nitric-oxide synthase activity(GO:0051001) |
| 0.5 | 1.8 | GO:1990086 | lens fiber cell apoptotic process(GO:1990086) |
| 0.4 | 0.9 | GO:0008343 | adult feeding behavior(GO:0008343) |
| 0.4 | 1.8 | GO:0001951 | intestinal D-glucose absorption(GO:0001951) |
| 0.4 | 5.7 | GO:0021819 | layer formation in cerebral cortex(GO:0021819) |
| 0.4 | 0.9 | GO:0061511 | centriole elongation(GO:0061511) |
| 0.4 | 4.8 | GO:0034497 | protein localization to pre-autophagosomal structure(GO:0034497) |
| 0.4 | 0.9 | GO:0071288 | cellular response to mercury ion(GO:0071288) |
| 0.4 | 2.2 | GO:0044539 | long-chain fatty acid import(GO:0044539) |
| 0.4 | 1.3 | GO:0006393 | termination of mitochondrial transcription(GO:0006393) |
| 0.4 | 4.3 | GO:0006335 | DNA replication-dependent nucleosome assembly(GO:0006335) DNA replication-dependent nucleosome organization(GO:0034723) |
| 0.4 | 2.5 | GO:0060710 | chorio-allantoic fusion(GO:0060710) |
| 0.4 | 0.4 | GO:0019627 | urea metabolic process(GO:0019627) |
| 0.4 | 1.3 | GO:1903599 | positive regulation of mitophagy(GO:1903599) |
| 0.4 | 2.5 | GO:1902993 | positive regulation of beta-amyloid formation(GO:1902004) positive regulation of amyloid precursor protein catabolic process(GO:1902993) |
| 0.4 | 1.3 | GO:0045218 | zonula adherens maintenance(GO:0045218) |
| 0.4 | 2.9 | GO:0000185 | activation of MAPKKK activity(GO:0000185) |
| 0.4 | 1.2 | GO:0060335 | positive regulation of response to interferon-gamma(GO:0060332) positive regulation of interferon-gamma-mediated signaling pathway(GO:0060335) |
| 0.4 | 1.2 | GO:2000049 | positive regulation of cell-cell adhesion mediated by cadherin(GO:2000049) |
| 0.4 | 2.4 | GO:0045647 | negative regulation of erythrocyte differentiation(GO:0045647) |
| 0.4 | 0.4 | GO:0071681 | response to indole-3-methanol(GO:0071680) cellular response to indole-3-methanol(GO:0071681) |
| 0.4 | 1.2 | GO:0031999 | negative regulation of fatty acid beta-oxidation(GO:0031999) |
| 0.4 | 2.8 | GO:0048387 | negative regulation of retinoic acid receptor signaling pathway(GO:0048387) |
| 0.4 | 1.6 | GO:0030050 | vesicle transport along actin filament(GO:0030050) |
| 0.4 | 0.8 | GO:0043173 | nucleotide salvage(GO:0043173) |
| 0.4 | 1.6 | GO:0000960 | mitochondrial RNA catabolic process(GO:0000957) regulation of mitochondrial RNA catabolic process(GO:0000960) |
| 0.4 | 1.2 | GO:0061623 | galactose catabolic process via UDP-galactose(GO:0033499) glycolytic process from galactose(GO:0061623) |
| 0.4 | 14.0 | GO:0006953 | acute-phase response(GO:0006953) |
| 0.4 | 0.4 | GO:0070814 | hydrogen sulfide biosynthetic process(GO:0070814) |
| 0.4 | 1.2 | GO:1900126 | negative regulation of hyaluronan biosynthetic process(GO:1900126) |
| 0.4 | 1.5 | GO:1905206 | positive regulation of hydrogen peroxide-mediated programmed cell death(GO:1901300) positive regulation of hydrogen peroxide-induced cell death(GO:1905206) |
| 0.4 | 0.4 | GO:0051795 | positive regulation of catagen(GO:0051795) |
| 0.4 | 1.1 | GO:0016539 | intein-mediated protein splicing(GO:0016539) protein splicing(GO:0030908) |
| 0.4 | 6.0 | GO:0006783 | heme biosynthetic process(GO:0006783) |
| 0.4 | 1.1 | GO:0048619 | embryonic hindgut morphogenesis(GO:0048619) |
| 0.4 | 1.5 | GO:0032971 | regulation of muscle filament sliding(GO:0032971) |
| 0.4 | 1.5 | GO:0060534 | trachea cartilage development(GO:0060534) |
| 0.4 | 1.8 | GO:0000212 | meiotic spindle organization(GO:0000212) |
| 0.4 | 1.1 | GO:0045896 | regulation of transcription during mitosis(GO:0045896) positive regulation of transcription during mitosis(GO:0045897) |
| 0.4 | 0.7 | GO:0010535 | positive regulation of activation of JAK2 kinase activity(GO:0010535) |
| 0.4 | 1.5 | GO:0035087 | siRNA loading onto RISC involved in RNA interference(GO:0035087) |
| 0.4 | 0.7 | GO:2000909 | regulation of cholesterol import(GO:0060620) regulation of sterol import(GO:2000909) |
| 0.4 | 1.1 | GO:0015772 | disaccharide transport(GO:0015766) sucrose transport(GO:0015770) oligosaccharide transport(GO:0015772) |
| 0.4 | 1.1 | GO:0098700 | aminergic neurotransmitter loading into synaptic vesicle(GO:0015842) neurotransmitter loading into synaptic vesicle(GO:0098700) |
| 0.4 | 2.5 | GO:0006525 | arginine metabolic process(GO:0006525) |
| 0.4 | 1.8 | GO:0051574 | positive regulation of histone H3-K9 methylation(GO:0051574) |
| 0.4 | 1.1 | GO:0001555 | oocyte growth(GO:0001555) |
| 0.4 | 2.8 | GO:0071803 | positive regulation of podosome assembly(GO:0071803) |
| 0.4 | 0.7 | GO:1904177 | regulation of adipose tissue development(GO:1904177) |
| 0.4 | 2.1 | GO:0006971 | hypotonic response(GO:0006971) |
| 0.4 | 1.4 | GO:0032827 | natural killer cell differentiation involved in immune response(GO:0002325) negative regulation of natural killer cell differentiation(GO:0032824) regulation of natural killer cell differentiation involved in immune response(GO:0032826) negative regulation of natural killer cell differentiation involved in immune response(GO:0032827) |
| 0.4 | 1.8 | GO:0006686 | sphingomyelin biosynthetic process(GO:0006686) |
| 0.4 | 0.4 | GO:0061314 | Notch signaling involved in heart development(GO:0061314) |
| 0.3 | 1.4 | GO:0031581 | hemidesmosome assembly(GO:0031581) |
| 0.3 | 1.0 | GO:0034116 | positive regulation of heterotypic cell-cell adhesion(GO:0034116) |
| 0.3 | 1.7 | GO:0016255 | attachment of GPI anchor to protein(GO:0016255) |
| 0.3 | 1.0 | GO:0014043 | negative regulation of neuron maturation(GO:0014043) |
| 0.3 | 1.7 | GO:0051122 | hepoxilin metabolic process(GO:0051121) hepoxilin biosynthetic process(GO:0051122) |
| 0.3 | 4.5 | GO:0045116 | protein neddylation(GO:0045116) |
| 0.3 | 0.3 | GO:0046874 | quinolinate metabolic process(GO:0046874) |
| 0.3 | 1.0 | GO:0032788 | saturated monocarboxylic acid metabolic process(GO:0032788) unsaturated monocarboxylic acid metabolic process(GO:0032789) |
| 0.3 | 3.8 | GO:0090161 | Golgi ribbon formation(GO:0090161) |
| 0.3 | 1.7 | GO:0030263 | apoptotic chromosome condensation(GO:0030263) |
| 0.3 | 1.0 | GO:0035523 | protein K29-linked deubiquitination(GO:0035523) protein K33-linked deubiquitination(GO:1990168) |
| 0.3 | 0.3 | GO:0034372 | very-low-density lipoprotein particle remodeling(GO:0034372) |
| 0.3 | 1.3 | GO:0000707 | meiotic DNA recombinase assembly(GO:0000707) |
| 0.3 | 1.3 | GO:0016584 | nucleosome positioning(GO:0016584) |
| 0.3 | 0.3 | GO:0046340 | diacylglycerol catabolic process(GO:0046340) |
| 0.3 | 0.3 | GO:0043308 | eosinophil activation involved in immune response(GO:0002278) eosinophil mediated immunity(GO:0002447) eosinophil degranulation(GO:0043308) |
| 0.3 | 2.3 | GO:0006689 | ganglioside catabolic process(GO:0006689) |
| 0.3 | 1.6 | GO:0052805 | histidine catabolic process(GO:0006548) imidazole-containing compound catabolic process(GO:0052805) |
| 0.3 | 0.6 | GO:0097212 | lysosomal membrane organization(GO:0097212) |
| 0.3 | 4.2 | GO:0046686 | response to cadmium ion(GO:0046686) |
| 0.3 | 1.3 | GO:0032460 | negative regulation of protein oligomerization(GO:0032460) |
| 0.3 | 1.0 | GO:0002121 | inter-male aggressive behavior(GO:0002121) |
| 0.3 | 0.3 | GO:0010958 | regulation of amino acid import(GO:0010958) |
| 0.3 | 1.9 | GO:0060056 | mammary gland involution(GO:0060056) |
| 0.3 | 1.0 | GO:1900740 | regulation of protein insertion into mitochondrial membrane involved in apoptotic signaling pathway(GO:1900739) positive regulation of protein insertion into mitochondrial membrane involved in apoptotic signaling pathway(GO:1900740) |
| 0.3 | 4.4 | GO:0032801 | receptor catabolic process(GO:0032801) |
| 0.3 | 0.6 | GO:0070317 | negative regulation of G0 to G1 transition(GO:0070317) |
| 0.3 | 0.3 | GO:1902606 | regulation of large conductance calcium-activated potassium channel activity(GO:1902606) positive regulation of large conductance calcium-activated potassium channel activity(GO:1902608) |
| 0.3 | 0.9 | GO:0010989 | negative regulation of low-density lipoprotein particle clearance(GO:0010989) |
| 0.3 | 0.6 | GO:0010735 | positive regulation of transcription via serum response element binding(GO:0010735) |
| 0.3 | 0.6 | GO:0035622 | intrahepatic bile duct development(GO:0035622) |
| 0.3 | 2.2 | GO:0048537 | mucosal-associated lymphoid tissue development(GO:0048537) Peyer's patch development(GO:0048541) |
| 0.3 | 1.3 | GO:0010587 | miRNA catabolic process(GO:0010587) |
| 0.3 | 0.9 | GO:0090219 | negative regulation of lipid kinase activity(GO:0090219) |
| 0.3 | 1.6 | GO:0031507 | heterochromatin assembly(GO:0031507) |
| 0.3 | 0.6 | GO:0002254 | kinin cascade(GO:0002254) |
| 0.3 | 0.3 | GO:2000973 | regulation of pro-B cell differentiation(GO:2000973) |
| 0.3 | 0.9 | GO:0018094 | protein polyglycylation(GO:0018094) |
| 0.3 | 0.9 | GO:2000346 | negative regulation of hepatocyte proliferation(GO:2000346) |
| 0.3 | 0.6 | GO:1901844 | regulation of cell communication by electrical coupling involved in cardiac conduction(GO:1901844) |
| 0.3 | 0.6 | GO:1900169 | regulation of glucocorticoid mediated signaling pathway(GO:1900169) |
| 0.3 | 0.9 | GO:0032439 | endosome localization(GO:0032439) |
| 0.3 | 0.3 | GO:0044337 | canonical Wnt signaling pathway involved in positive regulation of apoptotic process(GO:0044337) |
| 0.3 | 2.8 | GO:0071361 | cellular response to ethanol(GO:0071361) |
| 0.3 | 0.9 | GO:0071447 | cellular response to hydroperoxide(GO:0071447) |
| 0.3 | 0.9 | GO:0061073 | ciliary body morphogenesis(GO:0061073) |
| 0.3 | 1.2 | GO:0006004 | fucose metabolic process(GO:0006004) |
| 0.3 | 1.2 | GO:0046512 | diol biosynthetic process(GO:0034312) sphingosine biosynthetic process(GO:0046512) |
| 0.3 | 0.3 | GO:2000409 | positive regulation of T cell extravasation(GO:2000409) |
| 0.3 | 0.9 | GO:0003223 | ventricular compact myocardium morphogenesis(GO:0003223) |
| 0.3 | 0.6 | GO:0032227 | negative regulation of synaptic transmission, dopaminergic(GO:0032227) |
| 0.3 | 0.6 | GO:0006116 | NADH oxidation(GO:0006116) |
| 0.3 | 0.3 | GO:0006624 | vacuolar protein processing(GO:0006624) |
| 0.3 | 0.6 | GO:2000271 | positive regulation of fibroblast apoptotic process(GO:2000271) |
| 0.3 | 0.9 | GO:0006768 | biotin metabolic process(GO:0006768) |
| 0.3 | 0.6 | GO:0010387 | COP9 signalosome assembly(GO:0010387) |
| 0.3 | 0.3 | GO:0042660 | positive regulation of cell fate specification(GO:0042660) |
| 0.3 | 0.6 | GO:0006824 | cobalt ion transport(GO:0006824) |
| 0.3 | 1.2 | GO:0010499 | proteasomal ubiquitin-independent protein catabolic process(GO:0010499) |
| 0.3 | 0.9 | GO:2000097 | regulation of smooth muscle cell-matrix adhesion(GO:2000097) |
| 0.3 | 1.5 | GO:0090527 | actin filament reorganization(GO:0090527) |
| 0.3 | 0.6 | GO:0010994 | regulation of ubiquitin homeostasis(GO:0010993) free ubiquitin chain polymerization(GO:0010994) |
| 0.3 | 1.5 | GO:0006776 | vitamin A metabolic process(GO:0006776) |
| 0.3 | 0.6 | GO:0071930 | negative regulation of transcription involved in G1/S transition of mitotic cell cycle(GO:0071930) |
| 0.3 | 0.6 | GO:0002019 | regulation of renal output by angiotensin(GO:0002019) |
| 0.3 | 1.2 | GO:0039536 | negative regulation of RIG-I signaling pathway(GO:0039536) |
| 0.3 | 0.6 | GO:0032058 | positive regulation of translational initiation in response to stress(GO:0032058) |
| 0.3 | 0.9 | GO:1905038 | regulation of sphingolipid biosynthetic process(GO:0090153) regulation of membrane lipid metabolic process(GO:1905038) regulation of ceramide biosynthetic process(GO:2000303) |
| 0.3 | 1.7 | GO:0050862 | positive regulation of T cell receptor signaling pathway(GO:0050862) |
| 0.3 | 1.4 | GO:0048539 | bone marrow development(GO:0048539) |
| 0.3 | 0.6 | GO:0043490 | malate-aspartate shuttle(GO:0043490) |
| 0.3 | 4.0 | GO:0035313 | wound healing, spreading of epidermal cells(GO:0035313) |
| 0.3 | 1.1 | GO:0060948 | cardiac vascular smooth muscle cell development(GO:0060948) |
| 0.3 | 0.6 | GO:0001807 | regulation of type IV hypersensitivity(GO:0001807) |
| 0.3 | 1.1 | GO:0045541 | negative regulation of cholesterol biosynthetic process(GO:0045541) negative regulation of cholesterol metabolic process(GO:0090206) |
| 0.3 | 0.6 | GO:0060128 | corticotropin hormone secreting cell differentiation(GO:0060128) |
| 0.3 | 0.3 | GO:0001844 | protein insertion into mitochondrial membrane involved in apoptotic signaling pathway(GO:0001844) |
| 0.3 | 2.0 | GO:0019673 | GDP-mannose metabolic process(GO:0019673) |
| 0.3 | 0.6 | GO:0090292 | nuclear matrix organization(GO:0043578) nuclear matrix anchoring at nuclear membrane(GO:0090292) |
| 0.3 | 0.8 | GO:0090230 | regulation of centromere complex assembly(GO:0090230) |
| 0.3 | 3.4 | GO:0007250 | activation of NF-kappaB-inducing kinase activity(GO:0007250) |
| 0.3 | 1.7 | GO:1902031 | regulation of NADP metabolic process(GO:1902031) |
| 0.3 | 1.4 | GO:0030854 | positive regulation of granulocyte differentiation(GO:0030854) |
| 0.3 | 0.8 | GO:0090343 | positive regulation of cell aging(GO:0090343) |
| 0.3 | 1.7 | GO:0060767 | epithelial cell proliferation involved in prostate gland development(GO:0060767) regulation of epithelial cell proliferation involved in prostate gland development(GO:0060768) negative regulation of epithelial cell proliferation involved in prostate gland development(GO:0060770) |
| 0.3 | 4.4 | GO:0061099 | negative regulation of protein tyrosine kinase activity(GO:0061099) |
| 0.3 | 0.6 | GO:0002439 | chronic inflammatory response to antigenic stimulus(GO:0002439) |
| 0.3 | 2.5 | GO:0034377 | plasma lipoprotein particle assembly(GO:0034377) |
| 0.3 | 3.3 | GO:2001241 | positive regulation of extrinsic apoptotic signaling pathway in absence of ligand(GO:2001241) |
| 0.3 | 1.6 | GO:0044068 | modulation by symbiont of host cellular process(GO:0044068) |
| 0.3 | 0.3 | GO:0000076 | DNA replication checkpoint(GO:0000076) |
| 0.3 | 0.8 | GO:0019464 | glycine catabolic process(GO:0006546) glycine decarboxylation via glycine cleavage system(GO:0019464) |
| 0.3 | 0.5 | GO:2000587 | regulation of platelet-derived growth factor receptor-beta signaling pathway(GO:2000586) negative regulation of platelet-derived growth factor receptor-beta signaling pathway(GO:2000587) |
| 0.3 | 0.5 | GO:0060385 | axonogenesis involved in innervation(GO:0060385) |
| 0.3 | 0.8 | GO:1903301 | positive regulation of glucokinase activity(GO:0033133) positive regulation of hexokinase activity(GO:1903301) |
| 0.3 | 1.9 | GO:0032308 | positive regulation of prostaglandin secretion(GO:0032308) |
| 0.3 | 0.3 | GO:0071332 | cellular response to fructose stimulus(GO:0071332) |
| 0.3 | 3.5 | GO:0001833 | inner cell mass cell proliferation(GO:0001833) |
| 0.3 | 0.8 | GO:0016554 | cytidine to uridine editing(GO:0016554) |
| 0.3 | 1.6 | GO:0042953 | lipoprotein transport(GO:0042953) lipoprotein localization(GO:0044872) |
| 0.3 | 2.1 | GO:0090051 | negative regulation of cell migration involved in sprouting angiogenesis(GO:0090051) |
| 0.3 | 1.1 | GO:0016321 | female meiosis chromosome segregation(GO:0016321) |
| 0.3 | 0.5 | GO:0016095 | polyprenol catabolic process(GO:0016095) |
| 0.3 | 0.8 | GO:0070212 | protein poly-ADP-ribosylation(GO:0070212) |
| 0.3 | 1.6 | GO:0002002 | regulation of angiotensin levels in blood(GO:0002002) |
| 0.3 | 0.8 | GO:0071286 | cellular response to magnesium ion(GO:0071286) |
| 0.3 | 0.8 | GO:0033566 | gamma-tubulin complex localization(GO:0033566) |
| 0.3 | 0.5 | GO:0003419 | growth plate cartilage chondrocyte proliferation(GO:0003419) |
| 0.3 | 1.3 | GO:0031659 | positive regulation of cyclin-dependent protein serine/threonine kinase activity involved in G1/S transition of mitotic cell cycle(GO:0031659) |
| 0.3 | 2.1 | GO:0042795 | snRNA transcription from RNA polymerase II promoter(GO:0042795) |
| 0.3 | 0.5 | GO:0006659 | phosphatidylserine biosynthetic process(GO:0006659) |
| 0.3 | 1.0 | GO:1901524 | regulation of macromitophagy(GO:1901524) |
| 0.3 | 0.8 | GO:2001286 | regulation of caveolin-mediated endocytosis(GO:2001286) |
| 0.3 | 1.0 | GO:1904491 | protein localization to ciliary transition zone(GO:1904491) |
| 0.3 | 0.5 | GO:0009826 | unidimensional cell growth(GO:0009826) |
| 0.3 | 0.5 | GO:0097051 | establishment of protein localization to endoplasmic reticulum membrane(GO:0097051) |
| 0.3 | 0.8 | GO:0046951 | ketone body biosynthetic process(GO:0046951) |
| 0.3 | 1.6 | GO:0070544 | histone H3-K36 demethylation(GO:0070544) |
| 0.3 | 0.8 | GO:0016480 | negative regulation of transcription from RNA polymerase III promoter(GO:0016480) |
| 0.3 | 1.3 | GO:0048680 | positive regulation of axon regeneration(GO:0048680) |
| 0.3 | 2.5 | GO:0006957 | complement activation, alternative pathway(GO:0006957) |
| 0.3 | 0.5 | GO:0034983 | peptidyl-lysine deacetylation(GO:0034983) |
| 0.3 | 1.0 | GO:0015838 | amino-acid betaine transport(GO:0015838) |
| 0.3 | 0.5 | GO:0046391 | 5-phosphoribose 1-diphosphate biosynthetic process(GO:0006015) 5-phosphoribose 1-diphosphate metabolic process(GO:0046391) |
| 0.3 | 3.3 | GO:2000251 | positive regulation of actin cytoskeleton reorganization(GO:2000251) |
| 0.3 | 1.0 | GO:0038094 | Fc-gamma receptor signaling pathway(GO:0038094) |
| 0.2 | 0.7 | GO:0038171 | cannabinoid signaling pathway(GO:0038171) endocannabinoid signaling pathway(GO:0071926) |
| 0.2 | 1.2 | GO:0015677 | copper ion import(GO:0015677) |
| 0.2 | 0.7 | GO:0006177 | GMP biosynthetic process(GO:0006177) |
| 0.2 | 1.2 | GO:0016264 | gap junction assembly(GO:0016264) |
| 0.2 | 2.0 | GO:0006388 | tRNA splicing, via endonucleolytic cleavage and ligation(GO:0006388) |
| 0.2 | 2.5 | GO:0006907 | pinocytosis(GO:0006907) |
| 0.2 | 0.2 | GO:0051890 | regulation of cardioblast differentiation(GO:0051890) |
| 0.2 | 0.5 | GO:0006600 | creatine metabolic process(GO:0006600) |
| 0.2 | 2.2 | GO:1903025 | regulation of RNA polymerase II regulatory region sequence-specific DNA binding(GO:1903025) |
| 0.2 | 10.1 | GO:0006661 | phosphatidylinositol biosynthetic process(GO:0006661) |
| 0.2 | 1.5 | GO:0035608 | protein deglutamylation(GO:0035608) |
| 0.2 | 0.7 | GO:0035526 | retrograde transport, plasma membrane to Golgi(GO:0035526) |
| 0.2 | 0.5 | GO:0021570 | rhombomere 4 development(GO:0021570) |
| 0.2 | 0.5 | GO:0036258 | multivesicular body assembly(GO:0036258) |
| 0.2 | 1.7 | GO:0002923 | regulation of humoral immune response mediated by circulating immunoglobulin(GO:0002923) |
| 0.2 | 0.2 | GO:1990705 | cholangiocyte proliferation(GO:1990705) |
| 0.2 | 1.2 | GO:0006627 | protein processing involved in protein targeting to mitochondrion(GO:0006627) |
| 0.2 | 1.4 | GO:0006621 | protein retention in ER lumen(GO:0006621) |
| 0.2 | 1.0 | GO:1903333 | negative regulation of protein folding(GO:1903333) |
| 0.2 | 0.7 | GO:0009957 | epidermal cell fate specification(GO:0009957) |
| 0.2 | 0.5 | GO:1901165 | positive regulation of trophoblast cell migration(GO:1901165) |
| 0.2 | 2.2 | GO:2000778 | positive regulation of interleukin-6 secretion(GO:2000778) |
| 0.2 | 3.3 | GO:0034389 | lipid particle organization(GO:0034389) |
| 0.2 | 0.7 | GO:0000727 | double-strand break repair via break-induced replication(GO:0000727) |
| 0.2 | 0.2 | GO:0071336 | regulation of hair follicle cell proliferation(GO:0071336) |
| 0.2 | 1.7 | GO:0001921 | positive regulation of receptor recycling(GO:0001921) |
| 0.2 | 0.9 | GO:0010886 | positive regulation of cholesterol storage(GO:0010886) |
| 0.2 | 1.2 | GO:1900165 | negative regulation of interleukin-6 secretion(GO:1900165) |
| 0.2 | 0.5 | GO:0061113 | pancreas morphogenesis(GO:0061113) |
| 0.2 | 0.2 | GO:0060437 | lung growth(GO:0060437) |
| 0.2 | 5.1 | GO:0030195 | negative regulation of blood coagulation(GO:0030195) negative regulation of hemostasis(GO:1900047) |
| 0.2 | 0.2 | GO:0008050 | female courtship behavior(GO:0008050) |
| 0.2 | 4.0 | GO:0034508 | centromere complex assembly(GO:0034508) |
| 0.2 | 0.7 | GO:0048861 | leukemia inhibitory factor signaling pathway(GO:0048861) |
| 0.2 | 3.5 | GO:0007095 | mitotic G2 DNA damage checkpoint(GO:0007095) |
| 0.2 | 1.4 | GO:0048312 | intracellular distribution of mitochondria(GO:0048312) |
| 0.2 | 0.5 | GO:0060596 | mammary placode formation(GO:0060596) |
| 0.2 | 0.5 | GO:0071895 | odontoblast differentiation(GO:0071895) |
| 0.2 | 1.4 | GO:0070493 | thrombin receptor signaling pathway(GO:0070493) |
| 0.2 | 0.5 | GO:0015889 | cobalamin transport(GO:0015889) |
| 0.2 | 1.2 | GO:0010971 | positive regulation of G2/M transition of mitotic cell cycle(GO:0010971) |
| 0.2 | 1.8 | GO:0051451 | myoblast migration(GO:0051451) |
| 0.2 | 0.9 | GO:1903715 | regulation of aerobic respiration(GO:1903715) |
| 0.2 | 1.6 | GO:0046598 | positive regulation of viral entry into host cell(GO:0046598) |
| 0.2 | 2.1 | GO:0060391 | positive regulation of SMAD protein import into nucleus(GO:0060391) |
| 0.2 | 1.4 | GO:0031665 | negative regulation of lipopolysaccharide-mediated signaling pathway(GO:0031665) |
| 0.2 | 0.7 | GO:0042738 | exogenous drug catabolic process(GO:0042738) |
| 0.2 | 0.2 | GO:0044004 | killing by symbiont of host cells(GO:0001907) disruption by symbiont of host cell(GO:0044004) |
| 0.2 | 0.7 | GO:0035701 | hematopoietic stem cell migration(GO:0035701) |
| 0.2 | 0.7 | GO:0007084 | mitotic nuclear envelope reassembly(GO:0007084) |
| 0.2 | 0.2 | GO:1903273 | regulation of sodium ion export(GO:1903273) regulation of sodium ion export from cell(GO:1903276) |
| 0.2 | 3.6 | GO:0016578 | histone deubiquitination(GO:0016578) |
| 0.2 | 1.1 | GO:0033014 | porphyrin-containing compound biosynthetic process(GO:0006779) tetrapyrrole biosynthetic process(GO:0033014) |
| 0.2 | 0.5 | GO:0051599 | response to hydrostatic pressure(GO:0051599) |
| 0.2 | 0.7 | GO:1903912 | negative regulation of endoplasmic reticulum stress-induced eIF2 alpha phosphorylation(GO:1903912) |
| 0.2 | 1.1 | GO:0010746 | regulation of plasma membrane long-chain fatty acid transport(GO:0010746) |
| 0.2 | 1.3 | GO:0055089 | fatty acid homeostasis(GO:0055089) |
| 0.2 | 2.5 | GO:0035873 | lactate transport(GO:0015727) lactate transmembrane transport(GO:0035873) plasma membrane lactate transport(GO:0035879) |
| 0.2 | 0.2 | GO:0061010 | gall bladder development(GO:0061010) |
| 0.2 | 0.9 | GO:0014827 | intestine smooth muscle contraction(GO:0014827) |
| 0.2 | 1.6 | GO:0007097 | nuclear migration(GO:0007097) |
| 0.2 | 2.7 | GO:0046597 | negative regulation of viral entry into host cell(GO:0046597) |
| 0.2 | 0.9 | GO:0031547 | brain-derived neurotrophic factor receptor signaling pathway(GO:0031547) |
| 0.2 | 0.2 | GO:0014735 | regulation of muscle atrophy(GO:0014735) negative regulation of muscle adaptation(GO:0014745) |
| 0.2 | 0.9 | GO:2000188 | regulation of cholesterol homeostasis(GO:2000188) |
| 0.2 | 0.2 | GO:0002442 | serotonin production involved in inflammatory response(GO:0002351) serotonin secretion involved in inflammatory response(GO:0002442) serotonin secretion by platelet(GO:0002554) |
| 0.2 | 0.7 | GO:0065005 | protein-lipid complex assembly(GO:0065005) |
| 0.2 | 0.2 | GO:0006933 | negative regulation of cell adhesion involved in substrate-bound cell migration(GO:0006933) |
| 0.2 | 1.1 | GO:0042699 | follicle-stimulating hormone signaling pathway(GO:0042699) |
| 0.2 | 0.7 | GO:0060319 | primitive erythrocyte differentiation(GO:0060319) |
| 0.2 | 1.3 | GO:0048096 | chromatin-mediated maintenance of transcription(GO:0048096) |
| 0.2 | 0.4 | GO:0002430 | complement receptor mediated signaling pathway(GO:0002430) |
| 0.2 | 1.3 | GO:0042866 | pyruvate biosynthetic process(GO:0042866) |
| 0.2 | 1.3 | GO:0006384 | transcription initiation from RNA polymerase III promoter(GO:0006384) |
| 0.2 | 1.9 | GO:0046835 | carbohydrate phosphorylation(GO:0046835) |
| 0.2 | 0.4 | GO:0061462 | protein localization to lysosome(GO:0061462) |
| 0.2 | 1.3 | GO:0032534 | regulation of microvillus assembly(GO:0032534) |
| 0.2 | 1.3 | GO:1901621 | negative regulation of smoothened signaling pathway involved in dorsal/ventral neural tube patterning(GO:1901621) |
| 0.2 | 0.6 | GO:1900748 | positive regulation of vascular endothelial growth factor signaling pathway(GO:1900748) |
| 0.2 | 0.4 | GO:0007386 | compartment pattern specification(GO:0007386) |
| 0.2 | 1.1 | GO:0045719 | negative regulation of glycogen biosynthetic process(GO:0045719) |
| 0.2 | 1.1 | GO:0080009 | mRNA methylation(GO:0080009) |
| 0.2 | 0.6 | GO:0008611 | ether lipid biosynthetic process(GO:0008611) glycerol ether biosynthetic process(GO:0046504) cellular lipid biosynthetic process(GO:0097384) ether biosynthetic process(GO:1901503) |
| 0.2 | 0.6 | GO:1904354 | negative regulation of telomere capping(GO:1904354) |
| 0.2 | 1.5 | GO:0061179 | negative regulation of insulin secretion involved in cellular response to glucose stimulus(GO:0061179) |
| 0.2 | 0.4 | GO:0002035 | brain renin-angiotensin system(GO:0002035) |
| 0.2 | 1.3 | GO:0030149 | sphingolipid catabolic process(GO:0030149) |
| 0.2 | 1.3 | GO:0032594 | protein transport within lipid bilayer(GO:0032594) |
| 0.2 | 1.2 | GO:0070995 | NADPH oxidation(GO:0070995) |
| 0.2 | 0.8 | GO:1901838 | positive regulation of transcription of nuclear large rRNA transcript from RNA polymerase I promoter(GO:1901838) |
| 0.2 | 0.2 | GO:0043691 | reverse cholesterol transport(GO:0043691) |
| 0.2 | 0.6 | GO:0009972 | cytidine catabolic process(GO:0006216) cytidine deamination(GO:0009972) cytidine metabolic process(GO:0046087) |
| 0.2 | 0.2 | GO:0051794 | regulation of catagen(GO:0051794) |
| 0.2 | 1.6 | GO:0035970 | peptidyl-threonine dephosphorylation(GO:0035970) |
| 0.2 | 1.0 | GO:0060501 | positive regulation of epithelial cell proliferation involved in lung morphogenesis(GO:0060501) |
| 0.2 | 2.3 | GO:0072673 | lamellipodium morphogenesis(GO:0072673) |
| 0.2 | 0.4 | GO:0039692 | single stranded viral RNA replication via double stranded DNA intermediate(GO:0039692) |
| 0.2 | 1.0 | GO:0033194 | response to hydroperoxide(GO:0033194) |
| 0.2 | 0.8 | GO:0017182 | peptidyl-diphthamide metabolic process(GO:0017182) peptidyl-diphthamide biosynthetic process from peptidyl-histidine(GO:0017183) |
| 0.2 | 0.2 | GO:0090336 | positive regulation of brown fat cell differentiation(GO:0090336) |
| 0.2 | 0.6 | GO:0002432 | granuloma formation(GO:0002432) |
| 0.2 | 0.6 | GO:0043328 | late endosome to vacuole transport via multivesicular body sorting pathway(GO:0032511) protein targeting to vacuole involved in ubiquitin-dependent protein catabolic process via the multivesicular body sorting pathway(GO:0043328) |
| 0.2 | 2.0 | GO:0006544 | glycine metabolic process(GO:0006544) |
| 0.2 | 1.0 | GO:1904970 | brush border assembly(GO:1904970) |
| 0.2 | 1.6 | GO:0042756 | drinking behavior(GO:0042756) |
| 0.2 | 0.8 | GO:0018101 | protein citrullination(GO:0018101) |
| 0.2 | 1.0 | GO:0002183 | cytoplasmic translational initiation(GO:0002183) |
| 0.2 | 0.2 | GO:0001692 | histamine metabolic process(GO:0001692) |
| 0.2 | 1.8 | GO:0050860 | negative regulation of T cell receptor signaling pathway(GO:0050860) |
| 0.2 | 0.6 | GO:1901374 | acetylcholine transport(GO:0015870) acetate ester transport(GO:1901374) |
| 0.2 | 0.6 | GO:0006670 | sphingosine metabolic process(GO:0006670) |
| 0.2 | 2.0 | GO:0055064 | chloride ion homeostasis(GO:0055064) |
| 0.2 | 0.8 | GO:0006528 | asparagine metabolic process(GO:0006528) |
| 0.2 | 0.2 | GO:0021847 | ventricular zone neuroblast division(GO:0021847) |
| 0.2 | 0.8 | GO:0032287 | peripheral nervous system myelin maintenance(GO:0032287) |
| 0.2 | 0.2 | GO:0032988 | ribonucleoprotein complex disassembly(GO:0032988) |
| 0.2 | 0.8 | GO:0071712 | ER-associated misfolded protein catabolic process(GO:0071712) |
| 0.2 | 1.7 | GO:0030575 | nuclear body organization(GO:0030575) |
| 0.2 | 0.6 | GO:0032020 | ISG15-protein conjugation(GO:0032020) |
| 0.2 | 0.6 | GO:1902683 | regulation of receptor localization to synapse(GO:1902683) |
| 0.2 | 2.7 | GO:0043968 | histone H2A acetylation(GO:0043968) |
| 0.2 | 1.0 | GO:0048702 | embryonic neurocranium morphogenesis(GO:0048702) |
| 0.2 | 0.8 | GO:2000418 | positive regulation of eosinophil migration(GO:2000418) |
| 0.2 | 0.6 | GO:0033227 | dsRNA transport(GO:0033227) |
| 0.2 | 0.4 | GO:0019896 | axonal transport of mitochondrion(GO:0019896) |
| 0.2 | 0.4 | GO:0009182 | purine deoxyribonucleoside diphosphate metabolic process(GO:0009182) dGDP metabolic process(GO:0046066) |
| 0.2 | 0.9 | GO:0090049 | regulation of cell migration involved in sprouting angiogenesis(GO:0090049) |
| 0.2 | 0.9 | GO:0051026 | chiasma assembly(GO:0051026) |
| 0.2 | 0.7 | GO:0090383 | phagosome acidification(GO:0090383) |
| 0.2 | 0.4 | GO:0010693 | negative regulation of alkaline phosphatase activity(GO:0010693) |
| 0.2 | 0.6 | GO:0071442 | positive regulation of histone H3-K14 acetylation(GO:0071442) |
| 0.2 | 0.4 | GO:0097680 | double-strand break repair via classical nonhomologous end joining(GO:0097680) |
| 0.2 | 0.4 | GO:1902187 | negative regulation of viral release from host cell(GO:1902187) |
| 0.2 | 0.6 | GO:0046037 | GMP metabolic process(GO:0046037) |
| 0.2 | 0.6 | GO:0046838 | phosphorylated carbohydrate dephosphorylation(GO:0046838) |
| 0.2 | 4.4 | GO:0043001 | Golgi to plasma membrane protein transport(GO:0043001) |
| 0.2 | 0.6 | GO:0021797 | forebrain anterior/posterior pattern specification(GO:0021797) |
| 0.2 | 2.2 | GO:0060716 | labyrinthine layer blood vessel development(GO:0060716) |
| 0.2 | 0.6 | GO:0032286 | central nervous system myelin maintenance(GO:0032286) |
| 0.2 | 1.5 | GO:0001771 | immunological synapse formation(GO:0001771) |
| 0.2 | 1.3 | GO:0097062 | dendritic spine maintenance(GO:0097062) |
| 0.2 | 1.8 | GO:0009143 | nucleoside triphosphate catabolic process(GO:0009143) |
| 0.2 | 0.9 | GO:0032875 | regulation of DNA endoreduplication(GO:0032875) |
| 0.2 | 1.3 | GO:0022027 | interkinetic nuclear migration(GO:0022027) |
| 0.2 | 0.4 | GO:0097237 | cellular response to toxic substance(GO:0097237) |
| 0.2 | 0.5 | GO:0001825 | blastocyst formation(GO:0001825) |
| 0.2 | 0.4 | GO:0042701 | progesterone secretion(GO:0042701) |
| 0.2 | 0.4 | GO:0031954 | positive regulation of protein autophosphorylation(GO:0031954) |
| 0.2 | 3.0 | GO:0010800 | positive regulation of peptidyl-threonine phosphorylation(GO:0010800) |
| 0.2 | 1.1 | GO:0060340 | positive regulation of type I interferon-mediated signaling pathway(GO:0060340) |
| 0.2 | 1.2 | GO:0001867 | complement activation, lectin pathway(GO:0001867) |
| 0.2 | 0.7 | GO:0042420 | dopamine catabolic process(GO:0042420) |
| 0.2 | 1.6 | GO:0000103 | sulfate assimilation(GO:0000103) |
| 0.2 | 0.4 | GO:1900242 | regulation of synaptic vesicle endocytosis(GO:1900242) |
| 0.2 | 0.4 | GO:1903279 | regulation of calcium:sodium antiporter activity(GO:1903279) |
| 0.2 | 0.5 | GO:0021590 | cerebellum maturation(GO:0021590) cerebellar cortex maturation(GO:0021699) |
| 0.2 | 0.7 | GO:0002051 | osteoblast fate commitment(GO:0002051) |
| 0.2 | 1.8 | GO:0043011 | myeloid dendritic cell differentiation(GO:0043011) |
| 0.2 | 0.9 | GO:0006559 | L-phenylalanine catabolic process(GO:0006559) erythrose 4-phosphate/phosphoenolpyruvate family amino acid catabolic process(GO:1902222) |
| 0.2 | 0.7 | GO:0001561 | fatty acid alpha-oxidation(GO:0001561) |
| 0.2 | 1.4 | GO:0006656 | phosphatidylcholine biosynthetic process(GO:0006656) |
| 0.2 | 1.9 | GO:0001675 | acrosome assembly(GO:0001675) |
| 0.2 | 0.2 | GO:2000389 | regulation of neutrophil extravasation(GO:2000389) positive regulation of neutrophil extravasation(GO:2000391) |
| 0.2 | 0.7 | GO:0070837 | dehydroascorbic acid transport(GO:0070837) |
| 0.2 | 2.6 | GO:0001522 | pseudouridine synthesis(GO:0001522) |
| 0.2 | 0.2 | GO:0050904 | diapedesis(GO:0050904) |
| 0.2 | 0.7 | GO:1903071 | positive regulation of ER-associated ubiquitin-dependent protein catabolic process(GO:1903071) |
| 0.2 | 1.6 | GO:0006828 | manganese ion transport(GO:0006828) |
| 0.2 | 1.4 | GO:0034244 | negative regulation of transcription elongation from RNA polymerase II promoter(GO:0034244) |
| 0.2 | 0.7 | GO:0033689 | negative regulation of osteoblast proliferation(GO:0033689) |
| 0.2 | 1.2 | GO:0046007 | negative regulation of activated T cell proliferation(GO:0046007) |
| 0.2 | 0.2 | GO:0019388 | galactose catabolic process(GO:0019388) |
| 0.2 | 1.0 | GO:0031274 | positive regulation of pseudopodium assembly(GO:0031274) |
| 0.2 | 2.9 | GO:0008053 | mitochondrial fusion(GO:0008053) |
| 0.2 | 0.2 | GO:0033088 | negative regulation of immature T cell proliferation in thymus(GO:0033088) |
| 0.2 | 0.3 | GO:0048819 | regulation of hair follicle maturation(GO:0048819) |
| 0.2 | 2.7 | GO:0033962 | cytoplasmic mRNA processing body assembly(GO:0033962) |
| 0.2 | 0.2 | GO:1901874 | regulation of post-translational protein modification(GO:1901873) negative regulation of post-translational protein modification(GO:1901874) |
| 0.2 | 0.7 | GO:0072675 | osteoclast fusion(GO:0072675) |
| 0.2 | 1.0 | GO:0090009 | primitive streak formation(GO:0090009) |
| 0.2 | 0.8 | GO:0006449 | regulation of translational termination(GO:0006449) |
| 0.2 | 0.3 | GO:0051383 | kinetochore organization(GO:0051383) |
| 0.2 | 0.3 | GO:0090272 | negative regulation of fibroblast growth factor production(GO:0090272) |
| 0.2 | 0.7 | GO:0035815 | positive regulation of renal sodium excretion(GO:0035815) |
| 0.2 | 0.2 | GO:0019042 | viral latency(GO:0019042) |
| 0.2 | 0.7 | GO:1900029 | positive regulation of ruffle assembly(GO:1900029) |
| 0.2 | 0.3 | GO:0032570 | response to progesterone(GO:0032570) |
| 0.2 | 0.2 | GO:0051461 | regulation of corticotropin secretion(GO:0051459) positive regulation of corticotropin secretion(GO:0051461) |
| 0.2 | 0.5 | GO:0045792 | negative regulation of cell size(GO:0045792) |
| 0.2 | 0.2 | GO:0099515 | actin filament-based transport(GO:0099515) |
| 0.2 | 0.5 | GO:0071139 | resolution of recombination intermediates(GO:0071139) |
| 0.2 | 0.7 | GO:0090435 | protein localization to nuclear envelope(GO:0090435) |
| 0.2 | 0.3 | GO:0045085 | negative regulation of interleukin-2 biosynthetic process(GO:0045085) |
| 0.2 | 0.6 | GO:0014067 | negative regulation of phosphatidylinositol 3-kinase signaling(GO:0014067) |
| 0.2 | 0.5 | GO:0006285 | base-excision repair, AP site formation(GO:0006285) |
| 0.2 | 0.5 | GO:0090136 | epithelial cell-cell adhesion(GO:0090136) |
| 0.2 | 0.5 | GO:2000467 | positive regulation of glycogen (starch) synthase activity(GO:2000467) |
| 0.2 | 0.2 | GO:0046122 | dGTP metabolic process(GO:0046070) purine deoxyribonucleoside metabolic process(GO:0046122) |
| 0.2 | 0.3 | GO:1904742 | regulation of telomeric DNA binding(GO:1904742) |
| 0.2 | 0.5 | GO:2001268 | negative regulation of cysteine-type endopeptidase activity involved in apoptotic signaling pathway(GO:2001268) |
| 0.2 | 0.8 | GO:0030718 | germ-line stem cell population maintenance(GO:0030718) |
| 0.2 | 1.3 | GO:0046415 | urate metabolic process(GO:0046415) |
| 0.2 | 1.8 | GO:0031163 | iron-sulfur cluster assembly(GO:0016226) metallo-sulfur cluster assembly(GO:0031163) |
| 0.2 | 0.8 | GO:0035457 | cellular response to interferon-alpha(GO:0035457) |
| 0.2 | 1.4 | GO:0039702 | viral budding via host ESCRT complex(GO:0039702) |
| 0.2 | 0.3 | GO:0070427 | nucleotide-binding oligomerization domain containing 1 signaling pathway(GO:0070427) |
| 0.2 | 0.2 | GO:0045345 | MHC class I biosynthetic process(GO:0045341) regulation of MHC class I biosynthetic process(GO:0045343) positive regulation of MHC class I biosynthetic process(GO:0045345) |
| 0.2 | 0.2 | GO:0016259 | selenocysteine metabolic process(GO:0016259) |
| 0.2 | 0.3 | GO:0006003 | fructose 2,6-bisphosphate metabolic process(GO:0006003) |
| 0.2 | 1.6 | GO:0042659 | regulation of cell fate specification(GO:0042659) |
| 0.2 | 0.8 | GO:0030174 | regulation of DNA-dependent DNA replication initiation(GO:0030174) |
| 0.2 | 0.2 | GO:0035093 | spermatogenesis, exchange of chromosomal proteins(GO:0035093) |
| 0.2 | 0.2 | GO:0045955 | negative regulation of calcium ion-dependent exocytosis(GO:0045955) |
| 0.2 | 0.6 | GO:1901341 | activation of store-operated calcium channel activity(GO:0032237) positive regulation of store-operated calcium channel activity(GO:1901341) |
| 0.2 | 0.3 | GO:0060155 | platelet dense granule organization(GO:0060155) |
| 0.2 | 1.7 | GO:0050779 | RNA destabilization(GO:0050779) |
| 0.2 | 0.5 | GO:0060024 | rhythmic synaptic transmission(GO:0060024) |
| 0.2 | 0.2 | GO:0070278 | extracellular matrix constituent secretion(GO:0070278) |
| 0.2 | 0.9 | GO:0000083 | regulation of transcription involved in G1/S transition of mitotic cell cycle(GO:0000083) |
| 0.2 | 0.3 | GO:0051464 | positive regulation of cortisol secretion(GO:0051464) |
| 0.2 | 0.2 | GO:0035434 | copper ion transmembrane transport(GO:0035434) |
| 0.2 | 0.5 | GO:0006207 | 'de novo' pyrimidine nucleobase biosynthetic process(GO:0006207) pyrimidine nucleobase biosynthetic process(GO:0019856) |
| 0.2 | 0.9 | GO:0050995 | negative regulation of lipid catabolic process(GO:0050995) |
| 0.2 | 0.2 | GO:0032345 | negative regulation of aldosterone metabolic process(GO:0032345) negative regulation of aldosterone biosynthetic process(GO:0032348) negative regulation of cortisol biosynthetic process(GO:2000065) |
| 0.2 | 0.2 | GO:0006505 | GPI anchor metabolic process(GO:0006505) |
| 0.2 | 0.3 | GO:0042977 | regulation of activation of JAK2 kinase activity(GO:0010534) activation of JAK2 kinase activity(GO:0042977) |
| 0.2 | 0.5 | GO:0060050 | positive regulation of protein glycosylation(GO:0060050) |
| 0.2 | 0.5 | GO:0001732 | formation of cytoplasmic translation initiation complex(GO:0001732) |
| 0.2 | 1.1 | GO:0034058 | endosomal vesicle fusion(GO:0034058) |
| 0.2 | 0.3 | GO:1901097 | negative regulation of autophagosome maturation(GO:1901097) |
| 0.2 | 1.1 | GO:0044090 | positive regulation of vacuole organization(GO:0044090) |
| 0.2 | 0.3 | GO:0008582 | regulation of synaptic growth at neuromuscular junction(GO:0008582) |
| 0.2 | 0.5 | GO:0070873 | regulation of glycogen metabolic process(GO:0070873) |
| 0.2 | 1.1 | GO:1903427 | negative regulation of reactive oxygen species biosynthetic process(GO:1903427) |
| 0.2 | 0.5 | GO:0070163 | adiponectin secretion(GO:0070162) regulation of adiponectin secretion(GO:0070163) |
| 0.2 | 0.3 | GO:0018214 | protein carboxylation(GO:0018214) |
| 0.2 | 0.2 | GO:0051132 | NK T cell activation(GO:0051132) |
| 0.2 | 0.3 | GO:0090361 | platelet-derived growth factor production(GO:0090360) regulation of platelet-derived growth factor production(GO:0090361) |
| 0.2 | 0.3 | GO:0010875 | positive regulation of cholesterol efflux(GO:0010875) |
| 0.2 | 1.8 | GO:0033235 | positive regulation of protein sumoylation(GO:0033235) |
| 0.2 | 0.8 | GO:0090557 | establishment of endothelial intestinal barrier(GO:0090557) |
| 0.2 | 0.2 | GO:1901857 | positive regulation of cellular respiration(GO:1901857) |
| 0.2 | 0.3 | GO:1903121 | regulation of TRAIL-activated apoptotic signaling pathway(GO:1903121) |
| 0.1 | 0.9 | GO:0006488 | dolichol-linked oligosaccharide biosynthetic process(GO:0006488) |
| 0.1 | 0.7 | GO:0033601 | positive regulation of mammary gland epithelial cell proliferation(GO:0033601) |
| 0.1 | 0.4 | GO:0035740 | CD8-positive, alpha-beta T cell proliferation(GO:0035740) |
| 0.1 | 0.7 | GO:0046184 | aldehyde biosynthetic process(GO:0046184) |
| 0.1 | 0.1 | GO:0016114 | terpenoid biosynthetic process(GO:0016114) |
| 0.1 | 0.9 | GO:0060213 | regulation of nuclear-transcribed mRNA poly(A) tail shortening(GO:0060211) positive regulation of nuclear-transcribed mRNA poly(A) tail shortening(GO:0060213) |
| 0.1 | 3.6 | GO:0032467 | positive regulation of cytokinesis(GO:0032467) |
| 0.1 | 0.1 | GO:2001185 | regulation of CD8-positive, alpha-beta T cell activation(GO:2001185) |
| 0.1 | 1.2 | GO:0032897 | negative regulation of viral transcription(GO:0032897) |
| 0.1 | 0.9 | GO:0008298 | intracellular mRNA localization(GO:0008298) |
| 0.1 | 1.3 | GO:0001759 | organ induction(GO:0001759) |
| 0.1 | 0.4 | GO:0061635 | regulation of protein complex stability(GO:0061635) |
| 0.1 | 0.7 | GO:0070933 | histone H4 deacetylation(GO:0070933) |
| 0.1 | 0.3 | GO:0014878 | response to electrical stimulus involved in regulation of muscle adaptation(GO:0014878) |
| 0.1 | 0.6 | GO:2000210 | positive regulation of anoikis(GO:2000210) |
| 0.1 | 1.6 | GO:0001829 | trophectodermal cell differentiation(GO:0001829) |
| 0.1 | 1.2 | GO:1904851 | positive regulation of establishment of protein localization to telomere(GO:1904851) |
| 0.1 | 0.4 | GO:0018904 | ether metabolic process(GO:0018904) |
| 0.1 | 0.3 | GO:0002426 | immunoglobulin production in mucosal tissue(GO:0002426) |
| 0.1 | 1.4 | GO:0006744 | ubiquinone metabolic process(GO:0006743) ubiquinone biosynthetic process(GO:0006744) |
| 0.1 | 1.9 | GO:0051806 | entry into host cell(GO:0030260) entry into host(GO:0044409) entry into cell of other organism involved in symbiotic interaction(GO:0051806) entry into other organism involved in symbiotic interaction(GO:0051828) |
| 0.1 | 0.4 | GO:0070932 | histone H3 deacetylation(GO:0070932) |
| 0.1 | 0.3 | GO:0042891 | antibiotic transport(GO:0042891) |
| 0.1 | 3.9 | GO:0046580 | negative regulation of Ras protein signal transduction(GO:0046580) |
| 0.1 | 0.4 | GO:0015817 | histidine transport(GO:0015817) |
| 0.1 | 0.7 | GO:0015671 | oxygen transport(GO:0015671) |
| 0.1 | 0.1 | GO:0014854 | response to inactivity(GO:0014854) response to muscle inactivity(GO:0014870) response to muscle inactivity involved in regulation of muscle adaptation(GO:0014877) response to denervation involved in regulation of muscle adaptation(GO:0014894) |
| 0.1 | 0.1 | GO:0034755 | iron ion transmembrane transport(GO:0034755) |
| 0.1 | 0.3 | GO:1902166 | negative regulation of intrinsic apoptotic signaling pathway in response to DNA damage by p53 class mediator(GO:1902166) |
| 0.1 | 0.3 | GO:0034434 | steroid esterification(GO:0034433) sterol esterification(GO:0034434) cholesterol esterification(GO:0034435) |
| 0.1 | 0.1 | GO:0048631 | regulation of skeletal muscle tissue growth(GO:0048631) |
| 0.1 | 0.3 | GO:1901536 | regulation of DNA demethylation(GO:1901535) negative regulation of DNA demethylation(GO:1901536) |
| 0.1 | 0.6 | GO:0044597 | polyketide metabolic process(GO:0030638) aminoglycoside antibiotic metabolic process(GO:0030647) daunorubicin metabolic process(GO:0044597) doxorubicin metabolic process(GO:0044598) |
| 0.1 | 0.4 | GO:0015744 | succinate transport(GO:0015744) |
| 0.1 | 1.0 | GO:0051292 | nuclear pore complex assembly(GO:0051292) |
| 0.1 | 0.3 | GO:0002036 | regulation of L-glutamate transport(GO:0002036) |
| 0.1 | 0.4 | GO:1901679 | nucleotide transmembrane transport(GO:1901679) |
| 0.1 | 0.4 | GO:0006362 | transcription elongation from RNA polymerase I promoter(GO:0006362) |
| 0.1 | 0.3 | GO:0045794 | negative regulation of cell volume(GO:0045794) |
| 0.1 | 1.2 | GO:0006032 | chitin metabolic process(GO:0006030) chitin catabolic process(GO:0006032) |
| 0.1 | 0.1 | GO:0072584 | caveolin-mediated endocytosis(GO:0072584) |
| 0.1 | 0.3 | GO:0032513 | negative regulation of protein phosphatase type 2B activity(GO:0032513) |
| 0.1 | 0.1 | GO:0043652 | engulfment of apoptotic cell(GO:0043652) |
| 0.1 | 0.1 | GO:0006361 | transcription initiation from RNA polymerase I promoter(GO:0006361) |
| 0.1 | 2.5 | GO:0060706 | cell differentiation involved in embryonic placenta development(GO:0060706) |
| 0.1 | 1.5 | GO:0044342 | type B pancreatic cell proliferation(GO:0044342) |
| 0.1 | 1.4 | GO:0016558 | protein import into peroxisome matrix(GO:0016558) |
| 0.1 | 0.4 | GO:0021546 | rhombomere development(GO:0021546) |
| 0.1 | 0.5 | GO:0006477 | protein sulfation(GO:0006477) |
| 0.1 | 0.3 | GO:0098535 | de novo centriole assembly(GO:0098535) |
| 0.1 | 0.8 | GO:0032780 | negative regulation of ATPase activity(GO:0032780) |
| 0.1 | 1.2 | GO:0044130 | negative regulation of growth of symbiont in host(GO:0044130) negative regulation of growth of symbiont involved in interaction with host(GO:0044146) |
| 0.1 | 0.3 | GO:0046271 | phenylpropanoid catabolic process(GO:0046271) |
| 0.1 | 0.5 | GO:0051005 | negative regulation of lipoprotein lipase activity(GO:0051005) |
| 0.1 | 0.7 | GO:0005981 | regulation of glycogen catabolic process(GO:0005981) |
| 0.1 | 0.7 | GO:0045110 | intermediate filament bundle assembly(GO:0045110) |
| 0.1 | 0.1 | GO:0006067 | ethanol metabolic process(GO:0006067) ethanol oxidation(GO:0006069) |
| 0.1 | 4.9 | GO:2000134 | negative regulation of G1/S transition of mitotic cell cycle(GO:2000134) |
| 0.1 | 1.8 | GO:0071467 | cellular response to pH(GO:0071467) |
| 0.1 | 0.8 | GO:0010388 | cullin deneddylation(GO:0010388) |
| 0.1 | 0.4 | GO:0006348 | chromatin silencing at telomere(GO:0006348) |
| 0.1 | 0.4 | GO:0035511 | oxidative DNA demethylation(GO:0035511) |
| 0.1 | 2.0 | GO:0090022 | regulation of neutrophil chemotaxis(GO:0090022) |
| 0.1 | 0.5 | GO:0000972 | transcription-dependent tethering of RNA polymerase II gene DNA at nuclear periphery(GO:0000972) |
| 0.1 | 0.7 | GO:0048227 | plasma membrane to endosome transport(GO:0048227) |
| 0.1 | 0.3 | GO:1900084 | regulation of peptidyl-tyrosine autophosphorylation(GO:1900084) positive regulation of peptidyl-tyrosine autophosphorylation(GO:1900086) |
| 0.1 | 0.7 | GO:0007176 | regulation of epidermal growth factor-activated receptor activity(GO:0007176) |
| 0.1 | 0.7 | GO:0017014 | protein nitrosylation(GO:0017014) |
| 0.1 | 0.4 | GO:0036233 | glycine import(GO:0036233) |
| 0.1 | 0.3 | GO:0001866 | NK T cell proliferation(GO:0001866) |
| 0.1 | 0.5 | GO:0097240 | telomere tethering at nuclear periphery(GO:0034398) meiotic telomere tethering at nuclear periphery(GO:0044821) meiotic attachment of telomere to nuclear envelope(GO:0070197) chromosome attachment to the nuclear envelope(GO:0097240) |
| 0.1 | 0.3 | GO:0034139 | regulation of toll-like receptor 3 signaling pathway(GO:0034139) |
| 0.1 | 0.1 | GO:1903587 | regulation of blood vessel endothelial cell proliferation involved in sprouting angiogenesis(GO:1903587) |
| 0.1 | 0.3 | GO:1904263 | positive regulation of TORC1 signaling(GO:1904263) |
| 0.1 | 0.3 | GO:0002215 | defense response to nematode(GO:0002215) |
| 0.1 | 1.5 | GO:0061436 | regulation of water loss via skin(GO:0033561) establishment of skin barrier(GO:0061436) |
| 0.1 | 1.5 | GO:0046856 | phosphatidylinositol dephosphorylation(GO:0046856) |
| 0.1 | 0.3 | GO:0046016 | positive regulation of transcription by glucose(GO:0046016) |
| 0.1 | 0.8 | GO:0045648 | positive regulation of erythrocyte differentiation(GO:0045648) |
| 0.1 | 0.1 | GO:0046501 | protoporphyrinogen IX metabolic process(GO:0046501) |
| 0.1 | 0.1 | GO:0042045 | epithelial fluid transport(GO:0042045) |
| 0.1 | 0.4 | GO:0043461 | proton-transporting ATP synthase complex assembly(GO:0043461) proton-transporting ATP synthase complex biogenesis(GO:0070272) |
| 0.1 | 0.3 | GO:0060836 | lymphatic endothelial cell differentiation(GO:0060836) |
| 0.1 | 0.4 | GO:0060296 | regulation of cilium movement involved in cell motility(GO:0060295) regulation of cilium beat frequency involved in ciliary motility(GO:0060296) regulation of cilium-dependent cell motility(GO:1902019) |
| 0.1 | 0.4 | GO:0002414 | immunoglobulin transcytosis in epithelial cells(GO:0002414) |
| 0.1 | 0.4 | GO:0006167 | AMP biosynthetic process(GO:0006167) |
| 0.1 | 0.1 | GO:1901620 | regulation of smoothened signaling pathway involved in dorsal/ventral neural tube patterning(GO:1901620) |
| 0.1 | 0.5 | GO:0051315 | attachment of mitotic spindle microtubules to kinetochore(GO:0051315) |
| 0.1 | 0.3 | GO:0001880 | Mullerian duct regression(GO:0001880) |
| 0.1 | 0.1 | GO:0060921 | sinoatrial node cell differentiation(GO:0060921) |
| 0.1 | 0.1 | GO:1902930 | regulation of alcohol biosynthetic process(GO:1902930) |
| 0.1 | 0.6 | GO:0098734 | protein depalmitoylation(GO:0002084) macromolecule depalmitoylation(GO:0098734) |
| 0.1 | 0.2 | GO:1903237 | negative regulation of leukocyte tethering or rolling(GO:1903237) negative regulation of leukocyte adhesion to vascular endothelial cell(GO:1904995) |
| 0.1 | 0.2 | GO:1904479 | negative regulation of intestinal absorption(GO:1904479) |
| 0.1 | 0.1 | GO:0032290 | peripheral nervous system myelin formation(GO:0032290) |
| 0.1 | 0.4 | GO:0060075 | regulation of resting membrane potential(GO:0060075) |
| 0.1 | 0.4 | GO:0044829 | positive regulation by host of viral genome replication(GO:0044829) |
| 0.1 | 0.4 | GO:0043353 | enucleate erythrocyte differentiation(GO:0043353) |
| 0.1 | 0.2 | GO:0043162 | ubiquitin-dependent protein catabolic process via the multivesicular body sorting pathway(GO:0043162) |
| 0.1 | 1.2 | GO:0035690 | cellular response to drug(GO:0035690) |
| 0.1 | 0.2 | GO:1904417 | regulation of xenophagy(GO:1904415) positive regulation of xenophagy(GO:1904417) |
| 0.1 | 0.1 | GO:0071224 | cellular response to peptidoglycan(GO:0071224) |
| 0.1 | 0.4 | GO:0007217 | tachykinin receptor signaling pathway(GO:0007217) |
| 0.1 | 0.4 | GO:0045060 | negative thymic T cell selection(GO:0045060) |
| 0.1 | 1.0 | GO:0031100 | organ regeneration(GO:0031100) |
| 0.1 | 0.4 | GO:0032717 | negative regulation of interleukin-8 production(GO:0032717) |
| 0.1 | 0.2 | GO:0010838 | positive regulation of keratinocyte proliferation(GO:0010838) |
| 0.1 | 0.4 | GO:0032808 | lacrimal gland development(GO:0032808) |
| 0.1 | 0.4 | GO:0006244 | pyrimidine nucleotide catabolic process(GO:0006244) |
| 0.1 | 0.6 | GO:0006561 | proline biosynthetic process(GO:0006561) |
| 0.1 | 0.6 | GO:1990845 | diet induced thermogenesis(GO:0002024) adaptive thermogenesis(GO:1990845) |
| 0.1 | 0.4 | GO:0030202 | heparin metabolic process(GO:0030202) |
| 0.1 | 1.8 | GO:0006446 | regulation of translational initiation(GO:0006446) |
| 0.1 | 0.4 | GO:0046174 | polyol catabolic process(GO:0046174) |
| 0.1 | 0.4 | GO:0034134 | toll-like receptor 2 signaling pathway(GO:0034134) |
| 0.1 | 0.5 | GO:0071557 | histone H3-K27 demethylation(GO:0071557) |
| 0.1 | 1.2 | GO:0008207 | C21-steroid hormone metabolic process(GO:0008207) |
| 0.1 | 0.8 | GO:0032968 | positive regulation of transcription elongation from RNA polymerase II promoter(GO:0032968) |
| 0.1 | 0.8 | GO:0090026 | positive regulation of monocyte chemotaxis(GO:0090026) |
| 0.1 | 0.1 | GO:1904058 | positive regulation of sensory perception of pain(GO:1904058) |
| 0.1 | 0.2 | GO:0090073 | positive regulation of protein homodimerization activity(GO:0090073) |
| 0.1 | 0.2 | GO:1905214 | regulation of mRNA binding(GO:1902415) regulation of RNA binding(GO:1905214) |
| 0.1 | 0.6 | GO:0045760 | positive regulation of action potential(GO:0045760) |
| 0.1 | 0.1 | GO:0035898 | parathyroid hormone secretion(GO:0035898) |
| 0.1 | 0.4 | GO:0030917 | midbrain-hindbrain boundary development(GO:0030917) |
| 0.1 | 0.1 | GO:1901856 | negative regulation of cellular respiration(GO:1901856) |
| 0.1 | 1.8 | GO:2000311 | regulation of alpha-amino-3-hydroxy-5-methyl-4-isoxazole propionate selective glutamate receptor activity(GO:2000311) |
| 0.1 | 1.4 | GO:0030212 | hyaluronan metabolic process(GO:0030212) |
| 0.1 | 0.2 | GO:0033184 | positive regulation of histone ubiquitination(GO:0033184) regulation of histone H2B ubiquitination(GO:2001166) positive regulation of histone H2B ubiquitination(GO:2001168) |
| 0.1 | 0.9 | GO:0042534 | tumor necrosis factor biosynthetic process(GO:0042533) regulation of tumor necrosis factor biosynthetic process(GO:0042534) |
| 0.1 | 1.7 | GO:0060441 | epithelial tube branching involved in lung morphogenesis(GO:0060441) |
| 0.1 | 0.5 | GO:0061299 | retina vasculature morphogenesis in camera-type eye(GO:0061299) |
| 0.1 | 2.2 | GO:0006509 | membrane protein ectodomain proteolysis(GO:0006509) |
| 0.1 | 0.5 | GO:0090286 | cytoskeletal anchoring at nuclear membrane(GO:0090286) |
| 0.1 | 0.2 | GO:0009253 | peptidoglycan metabolic process(GO:0000270) peptidoglycan catabolic process(GO:0009253) |
| 0.1 | 0.1 | GO:0050883 | musculoskeletal movement, spinal reflex action(GO:0050883) |
| 0.1 | 4.4 | GO:2001243 | negative regulation of intrinsic apoptotic signaling pathway(GO:2001243) |
| 0.1 | 0.3 | GO:0071051 | polyadenylation-dependent snoRNA 3'-end processing(GO:0071051) |
| 0.1 | 0.2 | GO:2000051 | negative regulation of non-canonical Wnt signaling pathway(GO:2000051) |
| 0.1 | 0.2 | GO:0046292 | formaldehyde metabolic process(GO:0046292) |
| 0.1 | 0.6 | GO:0046488 | phosphatidylinositol metabolic process(GO:0046488) |
| 0.1 | 0.1 | GO:0060631 | regulation of meiosis I(GO:0060631) |
| 0.1 | 0.6 | GO:0002031 | G-protein coupled receptor internalization(GO:0002031) |
| 0.1 | 0.3 | GO:0033387 | putrescine biosynthetic process from ornithine(GO:0033387) |
| 0.1 | 0.1 | GO:0070813 | hydrogen sulfide metabolic process(GO:0070813) |
| 0.1 | 0.7 | GO:0033344 | cholesterol efflux(GO:0033344) |
| 0.1 | 3.6 | GO:0006414 | translational elongation(GO:0006414) |
| 0.1 | 0.8 | GO:2000253 | positive regulation of feeding behavior(GO:2000253) |
| 0.1 | 2.5 | GO:0014823 | response to activity(GO:0014823) |
| 0.1 | 0.2 | GO:2000321 | positive regulation of T-helper 17 cell differentiation(GO:2000321) |
| 0.1 | 1.7 | GO:0070527 | platelet aggregation(GO:0070527) |
| 0.1 | 0.7 | GO:0046470 | phosphatidylcholine metabolic process(GO:0046470) |
| 0.1 | 0.3 | GO:0033234 | negative regulation of protein sumoylation(GO:0033234) |
| 0.1 | 0.7 | GO:2000369 | regulation of clathrin-mediated endocytosis(GO:2000369) |
| 0.1 | 0.3 | GO:0009838 | abscission(GO:0009838) |
| 0.1 | 0.2 | GO:0030886 | negative regulation of myeloid dendritic cell activation(GO:0030886) |
| 0.1 | 0.2 | GO:0000350 | generation of catalytic spliceosome for second transesterification step(GO:0000350) |
| 0.1 | 0.1 | GO:0010572 | positive regulation of platelet activation(GO:0010572) |
| 0.1 | 0.4 | GO:1903205 | regulation of hydrogen peroxide-induced cell death(GO:1903205) |
| 0.1 | 1.2 | GO:0009303 | rRNA transcription(GO:0009303) |
| 0.1 | 0.3 | GO:0015812 | gamma-aminobutyric acid transport(GO:0015812) |
| 0.1 | 0.4 | GO:0033169 | histone H3-K9 demethylation(GO:0033169) |
| 0.1 | 0.1 | GO:1902809 | regulation of skeletal muscle fiber differentiation(GO:1902809) |
| 0.1 | 0.1 | GO:0042541 | hemoglobin biosynthetic process(GO:0042541) |
| 0.1 | 2.4 | GO:0048843 | negative regulation of axon extension involved in axon guidance(GO:0048843) |
| 0.1 | 0.4 | GO:0046688 | response to copper ion(GO:0046688) |
| 0.1 | 0.2 | GO:0007028 | cytoplasm organization(GO:0007028) |
| 0.1 | 0.4 | GO:1904262 | negative regulation of TORC1 signaling(GO:1904262) |
| 0.1 | 0.3 | GO:0031133 | regulation of axon diameter(GO:0031133) |
| 0.1 | 0.1 | GO:0045650 | negative regulation of macrophage differentiation(GO:0045650) |
| 0.1 | 0.3 | GO:0003376 | sphingosine-1-phosphate signaling pathway(GO:0003376) |
| 0.1 | 1.2 | GO:0050710 | negative regulation of cytokine secretion(GO:0050710) |
| 0.1 | 0.6 | GO:0071318 | cellular response to ATP(GO:0071318) |
| 0.1 | 0.2 | GO:2000659 | regulation of interleukin-1-mediated signaling pathway(GO:2000659) |
| 0.1 | 0.1 | GO:1902931 | negative regulation of alcohol biosynthetic process(GO:1902931) |
| 0.1 | 0.2 | GO:1990928 | response to amino acid starvation(GO:1990928) |
| 0.1 | 1.4 | GO:0006607 | NLS-bearing protein import into nucleus(GO:0006607) |
| 0.1 | 0.1 | GO:0048320 | axial mesoderm morphogenesis(GO:0048319) axial mesoderm formation(GO:0048320) |
| 0.1 | 0.2 | GO:2000425 | regulation of apoptotic cell clearance(GO:2000425) |
| 0.1 | 0.1 | GO:0032329 | serine transport(GO:0032329) |
| 0.1 | 0.3 | GO:0071285 | cellular response to lithium ion(GO:0071285) |
| 0.1 | 0.4 | GO:0015074 | DNA integration(GO:0015074) |
| 0.1 | 0.3 | GO:2000353 | positive regulation of endothelial cell apoptotic process(GO:2000353) |
| 0.1 | 0.2 | GO:0018171 | peptidyl-cysteine oxidation(GO:0018171) |
| 0.1 | 0.8 | GO:2000114 | regulation of establishment of cell polarity(GO:2000114) |
| 0.1 | 1.1 | GO:0032042 | mitochondrial DNA metabolic process(GO:0032042) |
| 0.1 | 0.4 | GO:0006002 | fructose 6-phosphate metabolic process(GO:0006002) |
| 0.1 | 0.4 | GO:0006102 | isocitrate metabolic process(GO:0006102) |
| 0.1 | 0.5 | GO:0031145 | anaphase-promoting complex-dependent catabolic process(GO:0031145) |
| 0.1 | 0.3 | GO:0071260 | cellular response to mechanical stimulus(GO:0071260) |
| 0.1 | 0.1 | GO:0072386 | plus-end-directed vesicle transport along microtubule(GO:0072383) plus-end-directed organelle transport along microtubule(GO:0072386) |
| 0.1 | 1.4 | GO:0031648 | protein destabilization(GO:0031648) |
| 0.1 | 0.5 | GO:0001893 | maternal placenta development(GO:0001893) |
| 0.1 | 0.3 | GO:0008063 | Toll signaling pathway(GO:0008063) |
| 0.1 | 0.4 | GO:0006688 | glycosphingolipid biosynthetic process(GO:0006688) |
| 0.1 | 0.1 | GO:0071374 | cellular response to parathyroid hormone stimulus(GO:0071374) |
| 0.1 | 0.1 | GO:0035437 | maintenance of protein localization in endoplasmic reticulum(GO:0035437) |
| 0.1 | 0.5 | GO:0016556 | mRNA modification(GO:0016556) |
| 0.1 | 0.3 | GO:0006543 | glutamine catabolic process(GO:0006543) |
| 0.1 | 1.1 | GO:0045947 | negative regulation of translational initiation(GO:0045947) |
| 0.1 | 4.7 | GO:0051092 | positive regulation of NF-kappaB transcription factor activity(GO:0051092) |
| 0.1 | 0.3 | GO:2001256 | regulation of store-operated calcium entry(GO:2001256) |
| 0.1 | 0.2 | GO:0043321 | regulation of natural killer cell degranulation(GO:0043321) |
| 0.1 | 1.1 | GO:0008340 | determination of adult lifespan(GO:0008340) |
| 0.1 | 0.6 | GO:0017196 | N-terminal peptidyl-methionine acetylation(GO:0017196) |
| 0.1 | 0.1 | GO:0050747 | positive regulation of lipoprotein metabolic process(GO:0050747) |
| 0.1 | 1.5 | GO:0046329 | negative regulation of JNK cascade(GO:0046329) |
| 0.1 | 0.3 | GO:0030167 | proteoglycan catabolic process(GO:0030167) |
| 0.1 | 1.1 | GO:0060765 | regulation of androgen receptor signaling pathway(GO:0060765) |
| 0.1 | 0.2 | GO:0097084 | vascular smooth muscle cell development(GO:0097084) |
| 0.1 | 0.1 | GO:0031860 | telomeric 3' overhang formation(GO:0031860) |
| 0.1 | 0.2 | GO:1900747 | negative regulation of vascular endothelial growth factor signaling pathway(GO:1900747) |
| 0.1 | 0.4 | GO:0030321 | transepithelial chloride transport(GO:0030321) |
| 0.1 | 2.0 | GO:1901998 | toxin transport(GO:1901998) |
| 0.1 | 1.8 | GO:0035825 | reciprocal meiotic recombination(GO:0007131) reciprocal DNA recombination(GO:0035825) |
| 0.1 | 0.7 | GO:0051457 | maintenance of protein location in nucleus(GO:0051457) |
| 0.1 | 0.6 | GO:0048280 | vesicle fusion with Golgi apparatus(GO:0048280) |
| 0.1 | 0.2 | GO:0006499 | N-terminal protein myristoylation(GO:0006499) |
| 0.1 | 0.3 | GO:0009445 | putrescine metabolic process(GO:0009445) |
| 0.1 | 1.2 | GO:0051016 | barbed-end actin filament capping(GO:0051016) |
| 0.1 | 1.4 | GO:0046677 | response to antibiotic(GO:0046677) |
| 0.1 | 0.5 | GO:0097320 | membrane tubulation(GO:0097320) |
| 0.1 | 0.6 | GO:0006879 | cellular iron ion homeostasis(GO:0006879) |
| 0.1 | 0.1 | GO:0051775 | response to redox state(GO:0051775) |
| 0.1 | 0.5 | GO:0002467 | germinal center formation(GO:0002467) |
| 0.1 | 3.1 | GO:0061077 | chaperone-mediated protein folding(GO:0061077) |
| 0.1 | 0.5 | GO:2001260 | regulation of semaphorin-plexin signaling pathway(GO:2001260) |
| 0.1 | 0.5 | GO:0051013 | microtubule severing(GO:0051013) |
| 0.1 | 0.3 | GO:0044314 | protein K27-linked ubiquitination(GO:0044314) |
| 0.1 | 0.2 | GO:0035627 | ceramide transport(GO:0035627) |
| 0.1 | 0.1 | GO:2000138 | positive regulation of cell proliferation involved in heart morphogenesis(GO:2000138) |
| 0.1 | 0.1 | GO:0033483 | gas homeostasis(GO:0033483) |
| 0.1 | 0.3 | GO:0045743 | positive regulation of fibroblast growth factor receptor signaling pathway(GO:0045743) |
| 0.1 | 0.8 | GO:0060539 | diaphragm development(GO:0060539) |
| 0.1 | 0.2 | GO:0019230 | proprioception(GO:0019230) |
| 0.1 | 0.3 | GO:0071763 | nuclear membrane organization(GO:0071763) |
| 0.1 | 1.3 | GO:0071880 | adenylate cyclase-activating adrenergic receptor signaling pathway(GO:0071880) |
| 0.1 | 0.3 | GO:0071494 | cellular response to UV-C(GO:0071494) |
| 0.1 | 0.6 | GO:0016446 | somatic hypermutation of immunoglobulin genes(GO:0016446) |
| 0.1 | 0.3 | GO:0045616 | regulation of keratinocyte differentiation(GO:0045616) |
| 0.1 | 0.3 | GO:0015819 | lysine transport(GO:0015819) |
| 0.1 | 0.2 | GO:2001032 | regulation of double-strand break repair via nonhomologous end joining(GO:2001032) |
| 0.1 | 0.2 | GO:0048850 | hypophysis morphogenesis(GO:0048850) |
| 0.1 | 0.6 | GO:0006228 | GTP biosynthetic process(GO:0006183) UTP biosynthetic process(GO:0006228) |
| 0.1 | 0.2 | GO:0014041 | regulation of neuron maturation(GO:0014041) |
| 0.1 | 0.2 | GO:0044034 | negative stranded viral RNA replication(GO:0039689) multi-organism biosynthetic process(GO:0044034) |
| 0.1 | 0.1 | GO:2000503 | positive regulation of natural killer cell chemotaxis(GO:2000503) |
| 0.1 | 0.3 | GO:0031268 | pseudopodium organization(GO:0031268) |
| 0.1 | 0.7 | GO:0035767 | endothelial cell chemotaxis(GO:0035767) |
| 0.1 | 0.3 | GO:0046322 | negative regulation of fatty acid oxidation(GO:0046322) |
| 0.1 | 0.4 | GO:0000380 | alternative mRNA splicing, via spliceosome(GO:0000380) |
| 0.1 | 0.3 | GO:0008291 | acetylcholine metabolic process(GO:0008291) acetate ester metabolic process(GO:1900619) |
| 0.1 | 3.3 | GO:0034446 | substrate adhesion-dependent cell spreading(GO:0034446) |
| 0.1 | 0.2 | GO:0090267 | positive regulation of mitotic cell cycle spindle assembly checkpoint(GO:0090267) positive regulation of cell cycle checkpoint(GO:1901978) |
| 0.1 | 0.3 | GO:0034629 | cellular protein complex localization(GO:0034629) |
| 0.1 | 0.6 | GO:0006152 | purine nucleoside catabolic process(GO:0006152) purine ribonucleoside catabolic process(GO:0046130) |
| 0.1 | 0.1 | GO:0046449 | creatinine metabolic process(GO:0046449) cellular lactam metabolic process(GO:0072338) |
| 0.1 | 0.5 | GO:0051189 | Mo-molybdopterin cofactor biosynthetic process(GO:0006777) Mo-molybdopterin cofactor metabolic process(GO:0019720) molybdopterin cofactor biosynthetic process(GO:0032324) molybdopterin cofactor metabolic process(GO:0043545) prosthetic group metabolic process(GO:0051189) |
| 0.1 | 0.4 | GO:0061668 | mitochondrial ribosome assembly(GO:0061668) |
| 0.1 | 0.4 | GO:0042181 | ketone biosynthetic process(GO:0042181) |
| 0.1 | 0.4 | GO:0000012 | single strand break repair(GO:0000012) |
| 0.1 | 0.6 | GO:0060294 | cilium movement involved in cell motility(GO:0060294) |
| 0.1 | 0.4 | GO:0034393 | positive regulation of smooth muscle cell apoptotic process(GO:0034393) |
| 0.1 | 0.2 | GO:0032792 | negative regulation of CREB transcription factor activity(GO:0032792) |
| 0.1 | 2.3 | GO:0031424 | keratinization(GO:0031424) |
| 0.1 | 0.2 | GO:0031914 | negative regulation of synaptic plasticity(GO:0031914) |
| 0.1 | 0.3 | GO:0061154 | endothelial tube morphogenesis(GO:0061154) |
| 0.1 | 0.2 | GO:0051798 | positive regulation of hair follicle development(GO:0051798) |
| 0.1 | 0.1 | GO:0032494 | response to peptidoglycan(GO:0032494) |
| 0.1 | 0.2 | GO:0015886 | heme transport(GO:0015886) |
| 0.1 | 1.7 | GO:0007029 | endoplasmic reticulum organization(GO:0007029) |
| 0.1 | 0.7 | GO:0032402 | melanosome transport(GO:0032402) |
| 0.1 | 0.1 | GO:0090031 | positive regulation of steroid hormone biosynthetic process(GO:0090031) |
| 0.1 | 0.3 | GO:0045717 | negative regulation of fatty acid biosynthetic process(GO:0045717) |
| 0.1 | 0.4 | GO:0060586 | multicellular organismal iron ion homeostasis(GO:0060586) |
| 0.1 | 0.2 | GO:0002295 | T-helper cell lineage commitment(GO:0002295) CD4-positive, alpha-beta T cell lineage commitment(GO:0043373) |
| 0.1 | 0.3 | GO:1900151 | regulation of nuclear-transcribed mRNA catabolic process, deadenylation-dependent decay(GO:1900151) positive regulation of nuclear-transcribed mRNA catabolic process, deadenylation-dependent decay(GO:1900153) |
| 0.1 | 0.4 | GO:0046475 | glycerophospholipid catabolic process(GO:0046475) |
| 0.1 | 0.1 | GO:0007354 | zygotic determination of anterior/posterior axis, embryo(GO:0007354) |
| 0.1 | 1.2 | GO:0007257 | activation of JUN kinase activity(GO:0007257) |
| 0.1 | 0.2 | GO:0051025 | negative regulation of immunoglobulin secretion(GO:0051025) |
| 0.1 | 1.0 | GO:0043248 | proteasome assembly(GO:0043248) |
| 0.1 | 0.1 | GO:0090025 | regulation of monocyte chemotaxis(GO:0090025) |
| 0.1 | 1.0 | GO:0006896 | Golgi to vacuole transport(GO:0006896) |
| 0.1 | 0.2 | GO:1902036 | regulation of hematopoietic stem cell differentiation(GO:1902036) |
| 0.1 | 1.0 | GO:0045662 | negative regulation of myoblast differentiation(GO:0045662) |
| 0.1 | 0.3 | GO:0060613 | fat pad development(GO:0060613) |
| 0.1 | 0.5 | GO:0042492 | gamma-delta T cell differentiation(GO:0042492) |
| 0.1 | 11.5 | GO:0010466 | negative regulation of peptidase activity(GO:0010466) |
| 0.1 | 0.3 | GO:0075525 | viral translational termination-reinitiation(GO:0075525) |
| 0.1 | 0.8 | GO:0008299 | isoprenoid biosynthetic process(GO:0008299) |
| 0.1 | 0.9 | GO:0031529 | ruffle organization(GO:0031529) |
| 0.1 | 0.2 | GO:0039703 | viral RNA genome replication(GO:0039694) RNA replication(GO:0039703) |
| 0.1 | 0.1 | GO:1904994 | regulation of leukocyte tethering or rolling(GO:1903236) regulation of leukocyte adhesion to vascular endothelial cell(GO:1904994) |
| 0.1 | 0.3 | GO:0031282 | regulation of guanylate cyclase activity(GO:0031282) |
| 0.1 | 0.4 | GO:0060148 | positive regulation of posttranscriptional gene silencing(GO:0060148) |
| 0.1 | 0.1 | GO:0042510 | regulation of tyrosine phosphorylation of Stat1 protein(GO:0042510) |
| 0.1 | 0.7 | GO:0006123 | mitochondrial electron transport, cytochrome c to oxygen(GO:0006123) |
| 0.1 | 0.1 | GO:0010992 | ubiquitin homeostasis(GO:0010992) |
| 0.1 | 0.3 | GO:1902916 | positive regulation of protein polyubiquitination(GO:1902916) |
| 0.1 | 0.1 | GO:0043415 | positive regulation of skeletal muscle tissue regeneration(GO:0043415) |
| 0.1 | 1.4 | GO:0030488 | tRNA methylation(GO:0030488) |
| 0.1 | 0.8 | GO:0072666 | establishment of protein localization to vacuole(GO:0072666) |
| 0.1 | 0.3 | GO:0046040 | IMP metabolic process(GO:0046040) |
| 0.1 | 0.1 | GO:0042374 | phylloquinone metabolic process(GO:0042374) phylloquinone catabolic process(GO:0042376) quinone catabolic process(GO:1901662) |
| 0.1 | 0.2 | GO:0060693 | regulation of branching involved in salivary gland morphogenesis(GO:0060693) |
| 0.1 | 0.2 | GO:1903660 | complement-dependent cytotoxicity(GO:0097278) regulation of complement-dependent cytotoxicity(GO:1903659) negative regulation of complement-dependent cytotoxicity(GO:1903660) |
| 0.1 | 0.7 | GO:0000303 | response to superoxide(GO:0000303) |
| 0.1 | 0.3 | GO:0008355 | olfactory learning(GO:0008355) |
| 0.1 | 0.1 | GO:0002378 | immunoglobulin biosynthetic process(GO:0002378) |
| 0.1 | 0.3 | GO:0031584 | activation of phospholipase D activity(GO:0031584) |
| 0.1 | 0.4 | GO:0060628 | regulation of ER to Golgi vesicle-mediated transport(GO:0060628) |
| 0.1 | 0.1 | GO:0036089 | cleavage furrow formation(GO:0036089) |
| 0.1 | 0.2 | GO:0070828 | heterochromatin organization(GO:0070828) |
| 0.1 | 0.2 | GO:0060762 | regulation of branching involved in mammary gland duct morphogenesis(GO:0060762) |
| 0.1 | 0.1 | GO:0090201 | negative regulation of release of cytochrome c from mitochondria(GO:0090201) |
| 0.1 | 0.1 | GO:0032466 | negative regulation of cytokinesis(GO:0032466) |
| 0.1 | 0.2 | GO:0034122 | negative regulation of toll-like receptor signaling pathway(GO:0034122) |
| 0.1 | 0.1 | GO:0070236 | negative regulation of activation-induced cell death of T cells(GO:0070236) |
| 0.1 | 1.0 | GO:0043046 | DNA methylation involved in gamete generation(GO:0043046) |
| 0.1 | 0.2 | GO:0048245 | eosinophil chemotaxis(GO:0048245) |
| 0.1 | 0.5 | GO:0050732 | negative regulation of peptidyl-tyrosine phosphorylation(GO:0050732) |
| 0.1 | 0.4 | GO:0032986 | nucleosome disassembly(GO:0006337) protein-DNA complex disassembly(GO:0032986) |
| 0.1 | 0.3 | GO:0032957 | inositol trisphosphate metabolic process(GO:0032957) |
| 0.1 | 0.1 | GO:0019401 | glycerol biosynthetic process(GO:0006114) alditol biosynthetic process(GO:0019401) |
| 0.1 | 0.7 | GO:0050832 | defense response to fungus(GO:0050832) |
| 0.1 | 1.1 | GO:0045292 | mRNA cis splicing, via spliceosome(GO:0045292) |
| 0.1 | 0.6 | GO:0018026 | peptidyl-lysine monomethylation(GO:0018026) |
| 0.1 | 0.2 | GO:0051454 | pH elevation(GO:0045852) intracellular pH elevation(GO:0051454) |
| 0.1 | 0.1 | GO:0009794 | regulation of mitotic cell cycle, embryonic(GO:0009794) mitotic cell cycle, embryonic(GO:0045448) |
| 0.1 | 0.7 | GO:0097034 | mitochondrial respiratory chain complex IV assembly(GO:0033617) mitochondrial respiratory chain complex IV biogenesis(GO:0097034) |
| 0.1 | 0.2 | GO:0098915 | membrane repolarization during ventricular cardiac muscle cell action potential(GO:0098915) |
| 0.1 | 1.3 | GO:0070979 | protein K11-linked ubiquitination(GO:0070979) |
| 0.1 | 0.2 | GO:0046125 | pyrimidine deoxyribonucleoside metabolic process(GO:0046125) |
| 0.1 | 0.6 | GO:0035428 | hexose transmembrane transport(GO:0035428) |
| 0.1 | 0.3 | GO:0001302 | replicative cell aging(GO:0001302) |
| 0.1 | 0.4 | GO:0000447 | endonucleolytic cleavage in ITS1 to separate SSU-rRNA from 5.8S rRNA and LSU-rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000447) |
| 0.1 | 0.1 | GO:0060164 | regulation of timing of neuron differentiation(GO:0060164) |
| 0.1 | 0.3 | GO:0046831 | regulation of mRNA export from nucleus(GO:0010793) regulation of nucleobase-containing compound transport(GO:0032239) regulation of RNA export from nucleus(GO:0046831) regulation of ribonucleoprotein complex localization(GO:2000197) |
| 0.1 | 0.2 | GO:0035269 | protein O-linked mannosylation(GO:0035269) |
| 0.1 | 0.7 | GO:0030206 | chondroitin sulfate biosynthetic process(GO:0030206) |
| 0.1 | 0.6 | GO:1902042 | negative regulation of extrinsic apoptotic signaling pathway via death domain receptors(GO:1902042) |
| 0.1 | 0.1 | GO:0001887 | selenium compound metabolic process(GO:0001887) |
| 0.1 | 0.2 | GO:0050820 | positive regulation of coagulation(GO:0050820) |
| 0.1 | 0.2 | GO:1903393 | positive regulation of adherens junction organization(GO:1903393) |
| 0.1 | 0.1 | GO:0046098 | guanine metabolic process(GO:0046098) |
| 0.1 | 0.8 | GO:2000738 | positive regulation of stem cell differentiation(GO:2000738) |
| 0.1 | 0.8 | GO:0006047 | UDP-N-acetylglucosamine metabolic process(GO:0006047) |
| 0.1 | 0.1 | GO:0006924 | activation-induced cell death of T cells(GO:0006924) |
| 0.1 | 0.2 | GO:0033688 | regulation of osteoblast proliferation(GO:0033688) |
| 0.1 | 0.1 | GO:0090594 | wound healing involved in inflammatory response(GO:0002246) inflammatory response to wounding(GO:0090594) |
| 0.1 | 0.9 | GO:0045747 | positive regulation of Notch signaling pathway(GO:0045747) |
| 0.1 | 0.7 | GO:0001731 | formation of translation preinitiation complex(GO:0001731) |
| 0.1 | 0.3 | GO:0051683 | establishment of Golgi localization(GO:0051683) |
| 0.1 | 0.2 | GO:0042732 | D-xylose metabolic process(GO:0042732) |
| 0.1 | 0.6 | GO:0036159 | inner dynein arm assembly(GO:0036159) |
| 0.1 | 0.7 | GO:0002920 | regulation of humoral immune response(GO:0002920) |
| 0.1 | 0.3 | GO:0042780 | tRNA 3'-end processing(GO:0042780) |
| 0.1 | 0.9 | GO:0015693 | magnesium ion transport(GO:0015693) |
| 0.1 | 1.7 | GO:0006749 | glutathione metabolic process(GO:0006749) |
| 0.1 | 0.2 | GO:0042590 | antigen processing and presentation of exogenous peptide antigen via MHC class I(GO:0042590) |
| 0.1 | 0.1 | GO:0071071 | regulation of phospholipid biosynthetic process(GO:0071071) |
| 0.1 | 0.1 | GO:0043402 | glucocorticoid mediated signaling pathway(GO:0043402) |
| 0.1 | 0.2 | GO:1990035 | calcium ion import into cell(GO:1990035) |
| 0.1 | 0.2 | GO:0050975 | sensory perception of touch(GO:0050975) |
| 0.1 | 0.1 | GO:0043951 | negative regulation of cAMP-mediated signaling(GO:0043951) |
| 0.1 | 0.6 | GO:0090140 | regulation of mitochondrial fission(GO:0090140) |
| 0.1 | 0.7 | GO:0006817 | phosphate ion transport(GO:0006817) |
| 0.1 | 0.1 | GO:0048385 | regulation of retinoic acid receptor signaling pathway(GO:0048385) |
| 0.1 | 0.7 | GO:0030947 | regulation of vascular endothelial growth factor receptor signaling pathway(GO:0030947) |
| 0.1 | 0.1 | GO:0072610 | interleukin-12 secretion(GO:0072610) |
| 0.1 | 0.1 | GO:0071027 | nuclear RNA surveillance(GO:0071027) nuclear mRNA surveillance(GO:0071028) |
| 0.1 | 0.1 | GO:0030240 | skeletal muscle thin filament assembly(GO:0030240) |
| 0.1 | 0.1 | GO:0036314 | response to sterol(GO:0036314) |
| 0.1 | 0.4 | GO:0046006 | regulation of activated T cell proliferation(GO:0046006) |
| 0.1 | 0.1 | GO:0043247 | telomere maintenance in response to DNA damage(GO:0043247) |
| 0.1 | 0.3 | GO:0000056 | ribosomal small subunit export from nucleus(GO:0000056) |
| 0.1 | 0.5 | GO:0090199 | regulation of release of cytochrome c from mitochondria(GO:0090199) |
| 0.1 | 0.2 | GO:1900118 | negative regulation of execution phase of apoptosis(GO:1900118) |
| 0.1 | 0.1 | GO:0032309 | icosanoid secretion(GO:0032309) |
| 0.1 | 0.1 | GO:1903966 | monounsaturated fatty acid metabolic process(GO:1903964) monounsaturated fatty acid biosynthetic process(GO:1903966) |
| 0.1 | 0.1 | GO:0044340 | canonical Wnt signaling pathway involved in regulation of cell proliferation(GO:0044340) |
| 0.1 | 0.1 | GO:0045346 | regulation of MHC class II biosynthetic process(GO:0045346) |
| 0.1 | 0.2 | GO:0060618 | nipple development(GO:0060618) |
| 0.1 | 0.2 | GO:0006057 | cell wall mannoprotein biosynthetic process(GO:0000032) mannoprotein metabolic process(GO:0006056) mannoprotein biosynthetic process(GO:0006057) cell wall glycoprotein biosynthetic process(GO:0031506) cell wall biogenesis(GO:0042546) cell wall macromolecule metabolic process(GO:0044036) cell wall macromolecule biosynthetic process(GO:0044038) chain elongation of O-linked mannose residue(GO:0044845) cellular component macromolecule biosynthetic process(GO:0070589) cell wall organization or biogenesis(GO:0071554) |
| 0.1 | 0.1 | GO:0002572 | pro-T cell differentiation(GO:0002572) |
| 0.1 | 0.6 | GO:0070166 | enamel mineralization(GO:0070166) |
| 0.1 | 0.6 | GO:0030150 | protein import into mitochondrial matrix(GO:0030150) |
| 0.1 | 0.2 | GO:0018343 | protein farnesylation(GO:0018343) |
| 0.1 | 2.6 | GO:0007030 | Golgi organization(GO:0007030) |
| 0.1 | 1.7 | GO:0000184 | nuclear-transcribed mRNA catabolic process, nonsense-mediated decay(GO:0000184) |
| 0.1 | 0.1 | GO:0007066 | female meiosis sister chromatid cohesion(GO:0007066) |
| 0.1 | 0.1 | GO:0070586 | cell-cell adhesion involved in gastrulation(GO:0070586) |
| 0.1 | 0.9 | GO:0032233 | positive regulation of actin filament bundle assembly(GO:0032233) |
| 0.1 | 0.1 | GO:0000389 | mRNA 3'-splice site recognition(GO:0000389) |
| 0.1 | 0.5 | GO:0002385 | mucosal immune response(GO:0002385) |
| 0.1 | 0.3 | GO:0006368 | transcription elongation from RNA polymerase II promoter(GO:0006368) |
| 0.1 | 0.1 | GO:0009650 | UV protection(GO:0009650) |
| 0.1 | 0.5 | GO:0000244 | spliceosomal tri-snRNP complex assembly(GO:0000244) |
| 0.1 | 0.1 | GO:0043988 | histone H3-S28 phosphorylation(GO:0043988) |
| 0.1 | 0.1 | GO:0010796 | regulation of multivesicular body size(GO:0010796) |
| 0.1 | 0.2 | GO:0010626 | negative regulation of Schwann cell proliferation(GO:0010626) |
| 0.1 | 0.3 | GO:0044458 | motile cilium assembly(GO:0044458) |
| 0.1 | 0.2 | GO:0070344 | fat cell proliferation(GO:0070341) regulation of fat cell proliferation(GO:0070344) negative regulation of fat cell proliferation(GO:0070345) |
| 0.1 | 0.1 | GO:0036438 | maintenance of lens transparency(GO:0036438) |
| 0.1 | 0.1 | GO:0090114 | COPII-coated vesicle budding(GO:0090114) |
| 0.1 | 0.1 | GO:1903670 | regulation of sprouting angiogenesis(GO:1903670) |
| 0.1 | 0.4 | GO:0006013 | mannose metabolic process(GO:0006013) |
| 0.1 | 0.1 | GO:0000966 | RNA 5'-end processing(GO:0000966) |
| 0.1 | 0.1 | GO:0033004 | negative regulation of mast cell activation(GO:0033004) |
| 0.1 | 0.1 | GO:0043654 | recognition of apoptotic cell(GO:0043654) |
| 0.1 | 0.2 | GO:0032471 | negative regulation of endoplasmic reticulum calcium ion concentration(GO:0032471) |
| 0.1 | 0.2 | GO:0048875 | chemical homeostasis within a tissue(GO:0048875) |
| 0.1 | 0.1 | GO:1901673 | regulation of spindle assembly(GO:0090169) regulation of mitotic spindle assembly(GO:1901673) |
| 0.1 | 0.1 | GO:0043117 | positive regulation of vascular permeability(GO:0043117) |
| 0.1 | 0.2 | GO:0098795 | mRNA cleavage involved in gene silencing by miRNA(GO:0035279) mRNA cleavage involved in gene silencing(GO:0098795) |
| 0.1 | 0.1 | GO:0033026 | negative regulation of mast cell apoptotic process(GO:0033026) |
| 0.1 | 0.4 | GO:0031125 | exonucleolytic trimming involved in rRNA processing(GO:0000459) exonucleolytic trimming to generate mature 3'-end of 5.8S rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000467) rRNA 3'-end processing(GO:0031125) |
| 0.1 | 0.1 | GO:0035509 | negative regulation of myosin-light-chain-phosphatase activity(GO:0035509) |
| 0.1 | 0.1 | GO:0000291 | nuclear-transcribed mRNA catabolic process, exonucleolytic(GO:0000291) |
| 0.1 | 0.3 | GO:0000466 | maturation of 5.8S rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000466) |
| 0.1 | 0.1 | GO:0046628 | positive regulation of insulin receptor signaling pathway(GO:0046628) |
| 0.1 | 0.1 | GO:0097067 | cellular response to thyroid hormone stimulus(GO:0097067) |
| 0.1 | 0.4 | GO:0050917 | sensory perception of umami taste(GO:0050917) |
| 0.1 | 0.1 | GO:0030859 | polarized epithelial cell differentiation(GO:0030859) |
| 0.1 | 0.2 | GO:0006553 | lysine metabolic process(GO:0006553) |
| 0.1 | 0.8 | GO:0002902 | regulation of B cell apoptotic process(GO:0002902) negative regulation of B cell apoptotic process(GO:0002903) |
| 0.1 | 0.3 | GO:0032008 | positive regulation of TOR signaling(GO:0032008) |
| 0.1 | 0.2 | GO:0060390 | regulation of SMAD protein import into nucleus(GO:0060390) |
| 0.1 | 0.1 | GO:0042769 | DNA damage response, detection of DNA damage(GO:0042769) |
| 0.1 | 0.1 | GO:0071501 | response to sterol depletion(GO:0006991) SREBP signaling pathway(GO:0032933) cellular response to sterol depletion(GO:0071501) |
| 0.1 | 0.1 | GO:0000715 | nucleotide-excision repair, DNA damage recognition(GO:0000715) |
| 0.1 | 1.1 | GO:0030261 | chromosome condensation(GO:0030261) |
| 0.1 | 0.1 | GO:0010819 | regulation of T cell chemotaxis(GO:0010819) |
| 0.1 | 0.1 | GO:0034695 | response to prostaglandin E(GO:0034695) |
| 0.1 | 0.2 | GO:0035729 | response to hepatocyte growth factor(GO:0035728) cellular response to hepatocyte growth factor stimulus(GO:0035729) |
| 0.1 | 0.4 | GO:0034453 | microtubule anchoring(GO:0034453) |
| 0.1 | 0.1 | GO:0061304 | retinal blood vessel morphogenesis(GO:0061304) |
| 0.1 | 0.4 | GO:0061036 | positive regulation of cartilage development(GO:0061036) |
| 0.1 | 0.9 | GO:0032011 | ARF protein signal transduction(GO:0032011) regulation of ARF protein signal transduction(GO:0032012) |
| 0.1 | 0.5 | GO:0070584 | mitochondrion morphogenesis(GO:0070584) |
| 0.1 | 0.1 | GO:0038003 | opioid receptor signaling pathway(GO:0038003) |
| 0.1 | 0.2 | GO:0030311 | poly-N-acetyllactosamine metabolic process(GO:0030309) poly-N-acetyllactosamine biosynthetic process(GO:0030311) |
| 0.1 | 0.7 | GO:1903146 | regulation of mitophagy(GO:1903146) |
| 0.1 | 0.4 | GO:0046627 | negative regulation of insulin receptor signaling pathway(GO:0046627) |
| 0.1 | 0.2 | GO:0051386 | regulation of neurotrophin TRK receptor signaling pathway(GO:0051386) |
| 0.1 | 0.2 | GO:0030836 | positive regulation of actin filament depolymerization(GO:0030836) |
| 0.1 | 0.2 | GO:2000255 | negative regulation of male germ cell proliferation(GO:2000255) |
| 0.1 | 0.1 | GO:0031642 | negative regulation of myelination(GO:0031642) |
| 0.1 | 0.9 | GO:0043407 | negative regulation of MAP kinase activity(GO:0043407) |
| 0.1 | 0.1 | GO:1990036 | calcium ion import into sarcoplasmic reticulum(GO:1990036) |
| 0.1 | 0.5 | GO:0016926 | protein desumoylation(GO:0016926) |
| 0.1 | 0.1 | GO:0060087 | relaxation of vascular smooth muscle(GO:0060087) |
| 0.1 | 0.2 | GO:0051031 | tRNA transport(GO:0051031) |
| 0.1 | 1.8 | GO:0010501 | RNA secondary structure unwinding(GO:0010501) |
| 0.1 | 0.1 | GO:0033685 | negative regulation of luteinizing hormone secretion(GO:0033685) |
| 0.1 | 0.6 | GO:0014733 | regulation of skeletal muscle adaptation(GO:0014733) |
| 0.1 | 0.4 | GO:0005978 | glycogen biosynthetic process(GO:0005978) glucan biosynthetic process(GO:0009250) |
| 0.1 | 0.1 | GO:2000741 | regulation of mesenchymal stem cell differentiation(GO:2000739) positive regulation of mesenchymal stem cell differentiation(GO:2000741) |
| 0.1 | 0.4 | GO:0051181 | cofactor transport(GO:0051181) |
| 0.1 | 0.2 | GO:0050765 | negative regulation of phagocytosis(GO:0050765) |
| 0.1 | 0.2 | GO:0008295 | spermidine biosynthetic process(GO:0008295) |
| 0.1 | 0.8 | GO:0042542 | response to hydrogen peroxide(GO:0042542) |
| 0.1 | 0.3 | GO:0000956 | nuclear-transcribed mRNA catabolic process(GO:0000956) |
| 0.1 | 0.1 | GO:1900157 | regulation of bone mineralization involved in bone maturation(GO:1900157) |
| 0.1 | 0.1 | GO:0051014 | actin filament severing(GO:0051014) |
| 0.1 | 0.1 | GO:0000255 | allantoin metabolic process(GO:0000255) |
| 0.1 | 0.1 | GO:1904431 | positive regulation of t-circle formation(GO:1904431) |
| 0.1 | 0.1 | GO:0006573 | valine metabolic process(GO:0006573) |
| 0.1 | 0.2 | GO:0060394 | negative regulation of pathway-restricted SMAD protein phosphorylation(GO:0060394) |
| 0.1 | 1.2 | GO:0043487 | regulation of RNA stability(GO:0043487) |
| 0.1 | 0.2 | GO:0034063 | stress granule assembly(GO:0034063) |
| 0.1 | 0.8 | GO:0007026 | negative regulation of microtubule depolymerization(GO:0007026) |
| 0.1 | 0.1 | GO:0006419 | alanyl-tRNA aminoacylation(GO:0006419) |
| 0.1 | 0.4 | GO:0071480 | cellular response to gamma radiation(GO:0071480) |
| 0.1 | 0.6 | GO:0032456 | endocytic recycling(GO:0032456) |
| 0.1 | 0.1 | GO:0035092 | sperm chromatin condensation(GO:0035092) |
| 0.1 | 0.1 | GO:1904017 | response to Thyroglobulin triiodothyronine(GO:1904016) cellular response to Thyroglobulin triiodothyronine(GO:1904017) |
| 0.1 | 0.6 | GO:0002548 | monocyte chemotaxis(GO:0002548) |
| 0.1 | 0.1 | GO:0060684 | epithelial-mesenchymal cell signaling(GO:0060684) |
| 0.1 | 0.2 | GO:0006438 | valyl-tRNA aminoacylation(GO:0006438) |
| 0.1 | 3.7 | GO:0043484 | regulation of RNA splicing(GO:0043484) |
| 0.1 | 0.5 | GO:0019432 | triglyceride biosynthetic process(GO:0019432) |
| 0.1 | 0.2 | GO:0038166 | angiotensin-activated signaling pathway(GO:0038166) |
| 0.1 | 0.5 | GO:0031297 | replication fork processing(GO:0031297) |
| 0.1 | 0.1 | GO:0036295 | cellular response to increased oxygen levels(GO:0036295) cellular response to hyperoxia(GO:0071455) |
| 0.1 | 0.1 | GO:0045590 | negative regulation of regulatory T cell differentiation(GO:0045590) |
| 0.1 | 0.1 | GO:0051084 | 'de novo' protein folding(GO:0006458) 'de novo' posttranslational protein folding(GO:0051084) |
| 0.1 | 0.1 | GO:0006538 | glutamate catabolic process(GO:0006538) |
| 0.1 | 1.1 | GO:0006956 | complement activation(GO:0006956) |
| 0.1 | 0.3 | GO:0006206 | pyrimidine nucleobase metabolic process(GO:0006206) |
| 0.1 | 0.1 | GO:0007320 | insemination(GO:0007320) |
| 0.1 | 0.2 | GO:1900095 | regulation of dosage compensation by inactivation of X chromosome(GO:1900095) |
| 0.1 | 0.8 | GO:0030888 | regulation of B cell proliferation(GO:0030888) |
| 0.1 | 0.1 | GO:1902170 | cellular response to reactive nitrogen species(GO:1902170) |
| 0.1 | 0.2 | GO:0034587 | piRNA metabolic process(GO:0034587) |
| 0.1 | 0.2 | GO:0021523 | somatic motor neuron differentiation(GO:0021523) |
| 0.1 | 1.3 | GO:0045668 | negative regulation of osteoblast differentiation(GO:0045668) |
| 0.1 | 0.4 | GO:0033866 | coenzyme A biosynthetic process(GO:0015937) nucleoside bisphosphate biosynthetic process(GO:0033866) ribonucleoside bisphosphate biosynthetic process(GO:0034030) purine nucleoside bisphosphate biosynthetic process(GO:0034033) |
| 0.1 | 0.1 | GO:0042554 | superoxide anion generation(GO:0042554) |
| 0.1 | 0.4 | GO:0044804 | nucleophagy(GO:0044804) |
| 0.1 | 0.4 | GO:0030330 | DNA damage response, signal transduction by p53 class mediator(GO:0030330) |
| 0.1 | 0.1 | GO:0043084 | penile erection(GO:0043084) |
| 0.1 | 0.1 | GO:0042226 | interleukin-6 biosynthetic process(GO:0042226) |
| 0.1 | 0.1 | GO:0009624 | response to nematode(GO:0009624) |
| 0.1 | 0.2 | GO:0046836 | glycolipid transport(GO:0046836) |
| 0.1 | 0.1 | GO:1900078 | positive regulation of cellular response to insulin stimulus(GO:1900078) |
| 0.1 | 0.1 | GO:0045144 | meiotic sister chromatid segregation(GO:0045144) meiotic sister chromatid cohesion(GO:0051177) |
| 0.1 | 0.1 | GO:0060263 | regulation of respiratory burst(GO:0060263) |
| 0.1 | 0.1 | GO:0070172 | positive regulation of tooth mineralization(GO:0070172) |
| 0.1 | 0.1 | GO:0010701 | positive regulation of norepinephrine secretion(GO:0010701) |
| 0.1 | 0.1 | GO:0072672 | neutrophil extravasation(GO:0072672) |
| 0.1 | 0.2 | GO:0006369 | termination of RNA polymerase II transcription(GO:0006369) |
| 0.1 | 0.1 | GO:1903299 | regulation of glucokinase activity(GO:0033131) regulation of hexokinase activity(GO:1903299) |
| 0.1 | 0.6 | GO:0055092 | cholesterol homeostasis(GO:0042632) sterol homeostasis(GO:0055092) |
| 0.1 | 0.4 | GO:0030225 | macrophage differentiation(GO:0030225) |
| 0.1 | 0.1 | GO:1904181 | positive regulation of membrane depolarization(GO:1904181) |
| 0.1 | 0.3 | GO:0006515 | misfolded or incompletely synthesized protein catabolic process(GO:0006515) |
| 0.1 | 0.1 | GO:1901896 | positive regulation of calcium-transporting ATPase activity(GO:1901896) |
| 0.1 | 0.1 | GO:0003415 | chondrocyte hypertrophy(GO:0003415) |
| 0.1 | 0.5 | GO:0048741 | skeletal muscle fiber development(GO:0048741) |
| 0.1 | 0.5 | GO:0010569 | regulation of double-strand break repair via homologous recombination(GO:0010569) |
| 0.1 | 0.4 | GO:0051220 | cytoplasmic sequestering of protein(GO:0051220) |
| 0.1 | 2.0 | GO:0006665 | sphingolipid metabolic process(GO:0006665) |
| 0.1 | 0.1 | GO:0007290 | spermatid nucleus elongation(GO:0007290) |
| 0.1 | 0.2 | GO:0032790 | ribosome disassembly(GO:0032790) |
| 0.1 | 0.1 | GO:2001013 | epithelial cell proliferation involved in renal tubule morphogenesis(GO:2001013) |
| 0.1 | 0.4 | GO:0070207 | protein homotrimerization(GO:0070207) |
| 0.1 | 2.0 | GO:0031338 | regulation of vesicle fusion(GO:0031338) |
| 0.1 | 0.1 | GO:0071462 | cellular response to water stimulus(GO:0071462) |
| 0.1 | 0.1 | GO:0044253 | positive regulation of collagen metabolic process(GO:0010714) positive regulation of multicellular organismal metabolic process(GO:0044253) |
| 0.1 | 0.1 | GO:0006547 | histidine metabolic process(GO:0006547) |
| 0.1 | 0.3 | GO:0045604 | regulation of epidermal cell differentiation(GO:0045604) |
| 0.0 | 0.6 | GO:0045197 | establishment or maintenance of epithelial cell apical/basal polarity(GO:0045197) |
| 0.0 | 0.0 | GO:1903265 | positive regulation of tumor necrosis factor-mediated signaling pathway(GO:1903265) |
| 0.0 | 0.0 | GO:0072076 | nephrogenic mesenchyme development(GO:0072076) |
| 0.0 | 0.1 | GO:0042270 | protection from natural killer cell mediated cytotoxicity(GO:0042270) |
| 0.0 | 0.6 | GO:0000154 | rRNA modification(GO:0000154) |
| 0.0 | 4.7 | GO:0000398 | RNA splicing, via transesterification reactions with bulged adenosine as nucleophile(GO:0000377) mRNA splicing, via spliceosome(GO:0000398) |
| 0.0 | 0.2 | GO:0043249 | erythrocyte maturation(GO:0043249) |
| 0.0 | 0.5 | GO:0051601 | exocyst localization(GO:0051601) |
| 0.0 | 0.3 | GO:1900262 | regulation of DNA-directed DNA polymerase activity(GO:1900262) positive regulation of DNA-directed DNA polymerase activity(GO:1900264) |
| 0.0 | 0.0 | GO:0050994 | regulation of lipid catabolic process(GO:0050994) |
| 0.0 | 1.2 | GO:0045576 | mast cell activation(GO:0045576) |
| 0.0 | 0.4 | GO:1990403 | embryonic brain development(GO:1990403) |
| 0.0 | 0.0 | GO:1901072 | glucosamine-containing compound catabolic process(GO:1901072) |
| 0.0 | 0.2 | GO:0061298 | retina vasculature development in camera-type eye(GO:0061298) |
| 0.0 | 0.1 | GO:0043687 | post-translational protein modification(GO:0043687) |
| 0.0 | 0.1 | GO:0051546 | keratinocyte migration(GO:0051546) |
| 0.0 | 0.1 | GO:0009074 | aromatic amino acid family catabolic process(GO:0009074) |
| 0.0 | 0.2 | GO:0006072 | glycerol-3-phosphate metabolic process(GO:0006072) |
| 0.0 | 0.0 | GO:0034035 | purine ribonucleoside bisphosphate metabolic process(GO:0034035) |
| 0.0 | 2.2 | GO:0006959 | humoral immune response(GO:0006959) |
| 0.0 | 0.3 | GO:0019985 | translesion synthesis(GO:0019985) |
| 0.0 | 0.0 | GO:0009313 | oligosaccharide catabolic process(GO:0009313) |
| 0.0 | 0.1 | GO:0030579 | ubiquitin-dependent SMAD protein catabolic process(GO:0030579) |
| 0.0 | 0.0 | GO:0033033 | negative regulation of myeloid cell apoptotic process(GO:0033033) |
| 0.0 | 0.0 | GO:0034729 | histone H3-K79 methylation(GO:0034729) |
| 0.0 | 0.2 | GO:0043649 | dicarboxylic acid catabolic process(GO:0043649) |
| 0.0 | 0.1 | GO:0015871 | choline transport(GO:0015871) |
| 0.0 | 0.1 | GO:0009186 | deoxyribonucleoside diphosphate metabolic process(GO:0009186) |
| 0.0 | 0.1 | GO:0009051 | pentose-phosphate shunt, oxidative branch(GO:0009051) |
| 0.0 | 0.1 | GO:0060347 | heart trabecula formation(GO:0060347) |
| 0.0 | 0.0 | GO:0040009 | regulation of growth rate(GO:0040009) |
| 0.0 | 0.3 | GO:0046827 | positive regulation of protein export from nucleus(GO:0046827) |
| 0.0 | 0.2 | GO:0048251 | elastic fiber assembly(GO:0048251) |
| 0.0 | 0.2 | GO:0032211 | negative regulation of telomere maintenance via telomerase(GO:0032211) |
| 0.0 | 0.0 | GO:0036297 | interstrand cross-link repair(GO:0036297) |
| 0.0 | 0.1 | GO:0003383 | apical constriction(GO:0003383) |
| 0.0 | 0.3 | GO:0030224 | monocyte differentiation(GO:0030224) |
| 0.0 | 0.1 | GO:0019626 | short-chain fatty acid catabolic process(GO:0019626) |
| 0.0 | 0.1 | GO:0009048 | dosage compensation(GO:0007549) dosage compensation by inactivation of X chromosome(GO:0009048) |
| 0.0 | 0.1 | GO:0033152 | immunoglobulin V(D)J recombination(GO:0033152) |
| 0.0 | 0.3 | GO:0050926 | regulation of positive chemotaxis(GO:0050926) |
| 0.0 | 0.1 | GO:0045297 | mating plug formation(GO:0042628) single-organism reproductive behavior(GO:0044704) post-mating behavior(GO:0045297) |
| 0.0 | 0.1 | GO:0006968 | cellular defense response(GO:0006968) |
| 0.0 | 0.0 | GO:1902175 | regulation of oxidative stress-induced intrinsic apoptotic signaling pathway(GO:1902175) |
| 0.0 | 1.9 | GO:0042274 | ribosomal small subunit biogenesis(GO:0042274) |
| 0.0 | 0.4 | GO:0051897 | positive regulation of protein kinase B signaling(GO:0051897) |
| 0.0 | 0.0 | GO:0045624 | positive regulation of T-helper cell differentiation(GO:0045624) |
| 0.0 | 0.3 | GO:0048147 | negative regulation of fibroblast proliferation(GO:0048147) |
| 0.0 | 0.1 | GO:0070417 | cellular response to cold(GO:0070417) |
| 0.0 | 0.0 | GO:0010159 | specification of organ position(GO:0010159) |
| 0.0 | 0.2 | GO:0046085 | adenosine metabolic process(GO:0046085) |
| 0.0 | 0.0 | GO:0045005 | DNA-dependent DNA replication maintenance of fidelity(GO:0045005) |
| 0.0 | 0.0 | GO:0032776 | DNA methylation on cytosine within a CG sequence(GO:0010424) DNA methylation on cytosine(GO:0032776) |
| 0.0 | 0.1 | GO:2000325 | regulation of ligand-dependent nuclear receptor transcription coactivator activity(GO:2000325) positive regulation of ligand-dependent nuclear receptor transcription coactivator activity(GO:2000327) |
| 0.0 | 0.0 | GO:0072053 | renal inner medulla development(GO:0072053) |
| 0.0 | 0.1 | GO:0060028 | convergent extension involved in axis elongation(GO:0060028) |
| 0.0 | 0.4 | GO:0046854 | phosphatidylinositol phosphorylation(GO:0046854) |
| 0.0 | 0.3 | GO:0048536 | spleen development(GO:0048536) |
| 0.0 | 0.3 | GO:0006103 | 2-oxoglutarate metabolic process(GO:0006103) |
| 0.0 | 0.1 | GO:0046464 | neutral lipid catabolic process(GO:0046461) acylglycerol catabolic process(GO:0046464) |
| 0.0 | 0.2 | GO:0032781 | positive regulation of ATPase activity(GO:0032781) |
| 0.0 | 0.0 | GO:0046469 | platelet activating factor biosynthetic process(GO:0006663) platelet activating factor metabolic process(GO:0046469) |
| 0.0 | 0.0 | GO:0007060 | male meiosis chromosome segregation(GO:0007060) |
| 0.0 | 0.0 | GO:0045064 | T-helper 2 cell differentiation(GO:0045064) |
| 0.0 | 0.2 | GO:2000653 | regulation of genetic imprinting(GO:2000653) |
| 0.0 | 0.0 | GO:0036515 | serotonergic neuron axon guidance(GO:0036515) |
| 0.0 | 0.9 | GO:0035904 | aorta development(GO:0035904) |
| 0.0 | 0.2 | GO:0009235 | cobalamin metabolic process(GO:0009235) |
| 0.0 | 0.4 | GO:0008272 | sulfate transport(GO:0008272) |
| 0.0 | 0.0 | GO:0098763 | mitotic cell cycle phase(GO:0098763) |
| 0.0 | 0.0 | GO:2000272 | negative regulation of receptor activity(GO:2000272) |
| 0.0 | 0.2 | GO:0010447 | response to acidic pH(GO:0010447) |
| 0.0 | 0.1 | GO:0030432 | peristalsis(GO:0030432) |
| 0.0 | 0.3 | GO:0000060 | protein import into nucleus, translocation(GO:0000060) |
| 0.0 | 0.2 | GO:0010640 | regulation of platelet-derived growth factor receptor signaling pathway(GO:0010640) |
| 0.0 | 0.3 | GO:0001706 | endoderm formation(GO:0001706) |
| 0.0 | 0.2 | GO:0006903 | vesicle targeting(GO:0006903) |
| 0.0 | 0.2 | GO:0036260 | 7-methylguanosine RNA capping(GO:0009452) RNA capping(GO:0036260) |
| 0.0 | 0.2 | GO:0006298 | mismatch repair(GO:0006298) |
| 0.0 | 0.8 | GO:0042035 | regulation of cytokine biosynthetic process(GO:0042035) |
| 0.0 | 0.8 | GO:0007602 | phototransduction(GO:0007602) |
| 0.0 | 0.2 | GO:0006693 | prostanoid metabolic process(GO:0006692) prostaglandin metabolic process(GO:0006693) |
| 0.0 | 0.1 | GO:0000055 | ribosomal large subunit export from nucleus(GO:0000055) |
| 0.0 | 0.2 | GO:0009404 | toxin metabolic process(GO:0009404) |
| 0.0 | 0.1 | GO:0033262 | regulation of nuclear cell cycle DNA replication(GO:0033262) |
| 0.0 | 0.1 | GO:0006027 | glycosaminoglycan catabolic process(GO:0006027) |
| 0.0 | 0.1 | GO:0001773 | myeloid dendritic cell activation(GO:0001773) |
| 0.0 | 0.2 | GO:0080182 | histone H3-K4 trimethylation(GO:0080182) |
| 0.0 | 0.1 | GO:0019695 | choline metabolic process(GO:0019695) |
| 0.0 | 0.1 | GO:0047497 | establishment of mitochondrion localization, microtubule-mediated(GO:0034643) mitochondrion transport along microtubule(GO:0047497) |
| 0.0 | 0.1 | GO:0036444 | calcium ion transmembrane import into mitochondrion(GO:0036444) |
| 0.0 | 0.1 | GO:0001779 | natural killer cell differentiation(GO:0001779) |
| 0.0 | 0.1 | GO:2001044 | regulation of integrin-mediated signaling pathway(GO:2001044) |
| 0.0 | 0.1 | GO:0038128 | ERBB2 signaling pathway(GO:0038128) |
| 0.0 | 0.0 | GO:0060235 | lens induction in camera-type eye(GO:0060235) |
| 0.0 | 0.1 | GO:0045540 | regulation of cholesterol biosynthetic process(GO:0045540) |
| 0.0 | 0.1 | GO:0009191 | nucleoside diphosphate catabolic process(GO:0009134) ribonucleoside diphosphate catabolic process(GO:0009191) |
| 0.0 | 0.2 | GO:1901071 | glucosamine-containing compound metabolic process(GO:1901071) |
| 0.0 | 0.0 | GO:0072643 | interferon-gamma secretion(GO:0072643) |
| 0.0 | 2.2 | GO:0006310 | DNA recombination(GO:0006310) |
| 0.0 | 0.0 | GO:0042508 | tyrosine phosphorylation of Stat1 protein(GO:0042508) |
| 0.0 | 0.5 | GO:0048730 | epidermis morphogenesis(GO:0048730) |
| 0.0 | 0.0 | GO:1902309 | negative regulation of peptidyl-serine dephosphorylation(GO:1902309) |
| 0.0 | 0.1 | GO:1903313 | positive regulation of mRNA metabolic process(GO:1903313) |
| 0.0 | 0.2 | GO:0033603 | positive regulation of dopamine secretion(GO:0033603) |
| 0.0 | 0.2 | GO:0051125 | regulation of actin nucleation(GO:0051125) |
| 0.0 | 0.3 | GO:0090004 | positive regulation of establishment of protein localization to plasma membrane(GO:0090004) |
| 0.0 | 0.1 | GO:0061589 | calcium activated phosphatidylserine scrambling(GO:0061589) |
| 0.0 | 0.1 | GO:0061086 | negative regulation of histone H3-K27 methylation(GO:0061086) |
| 0.0 | 0.6 | GO:0035456 | response to interferon-beta(GO:0035456) |
| 0.0 | 0.0 | GO:0035360 | regulation of peroxisome proliferator activated receptor signaling pathway(GO:0035358) positive regulation of peroxisome proliferator activated receptor signaling pathway(GO:0035360) |
| 0.0 | 0.0 | GO:0043615 | astrocyte cell migration(GO:0043615) |
| 0.0 | 0.2 | GO:0072676 | lymphocyte migration(GO:0072676) |
| 0.0 | 0.7 | GO:0006611 | protein export from nucleus(GO:0006611) |
| 0.0 | 0.1 | GO:0015808 | L-alanine transport(GO:0015808) |
| 0.0 | 0.0 | GO:0048808 | male genitalia morphogenesis(GO:0048808) male anatomical structure morphogenesis(GO:0090598) |
| 0.0 | 0.0 | GO:0046884 | follicle-stimulating hormone secretion(GO:0046884) |
| 0.0 | 0.1 | GO:0034724 | DNA replication-independent nucleosome assembly(GO:0006336) DNA replication-independent nucleosome organization(GO:0034724) |
| 0.0 | 0.0 | GO:2000698 | positive regulation of epithelial cell differentiation involved in kidney development(GO:2000698) |
| 0.0 | 1.5 | GO:0019369 | arachidonic acid metabolic process(GO:0019369) |
| 0.0 | 0.0 | GO:0030916 | otic vesicle formation(GO:0030916) |
| 0.0 | 0.1 | GO:0008211 | glucocorticoid metabolic process(GO:0008211) |
| 0.0 | 0.0 | GO:0032786 | positive regulation of DNA-templated transcription, elongation(GO:0032786) |
| 0.0 | 0.0 | GO:0070189 | kynurenine metabolic process(GO:0070189) |
| 0.0 | 0.3 | GO:0052697 | xenobiotic glucuronidation(GO:0052697) |
| 0.0 | 0.0 | GO:0060920 | cardiac pacemaker cell differentiation(GO:0060920) |
| 0.0 | 0.3 | GO:0032515 | negative regulation of phosphoprotein phosphatase activity(GO:0032515) |
| 0.0 | 0.1 | GO:0032074 | negative regulation of nuclease activity(GO:0032074) |
| 0.0 | 0.1 | GO:0060337 | type I interferon signaling pathway(GO:0060337) |
| 0.0 | 0.0 | GO:0014010 | regulation of Schwann cell proliferation(GO:0010624) Schwann cell proliferation(GO:0014010) |
| 0.0 | 0.1 | GO:0045793 | positive regulation of cell size(GO:0045793) |
| 0.0 | 0.1 | GO:0033058 | directional locomotion(GO:0033058) |
| 0.0 | 0.1 | GO:1902035 | regulation of hematopoietic stem cell proliferation(GO:1902033) positive regulation of hematopoietic stem cell proliferation(GO:1902035) |
| 0.0 | 0.0 | GO:2000060 | positive regulation of protein ubiquitination involved in ubiquitin-dependent protein catabolic process(GO:2000060) |
| 0.0 | 0.1 | GO:0071157 | negative regulation of cell cycle arrest(GO:0071157) |
| 0.0 | 0.1 | GO:0042414 | epinephrine metabolic process(GO:0042414) |
| 0.0 | 0.0 | GO:0009642 | response to light intensity(GO:0009642) |
| 0.0 | 0.1 | GO:0006269 | DNA replication, synthesis of RNA primer(GO:0006269) |
| 0.0 | 1.6 | GO:0016042 | lipid catabolic process(GO:0016042) |
| 0.0 | 0.0 | GO:2000359 | regulation of binding of sperm to zona pellucida(GO:2000359) |
| 0.0 | 0.0 | GO:0007143 | female meiotic division(GO:0007143) |
| 0.0 | 0.0 | GO:0035493 | SNARE complex assembly(GO:0035493) |
| 0.0 | 0.1 | GO:0098543 | detection of bacterium(GO:0016045) detection of other organism(GO:0098543) |
| 0.0 | 0.0 | GO:0046005 | positive regulation of circadian sleep/wake cycle, REM sleep(GO:0046005) |
| 0.0 | 0.4 | GO:1903364 | positive regulation of cellular protein catabolic process(GO:1903364) |
| 0.0 | 0.0 | GO:0000731 | DNA synthesis involved in DNA repair(GO:0000731) |
| 0.0 | 0.2 | GO:0099500 | synaptic vesicle fusion to presynaptic active zone membrane(GO:0031629) vesicle fusion to plasma membrane(GO:0099500) |
| 0.0 | 0.0 | GO:0043587 | tongue morphogenesis(GO:0043587) |
| 0.0 | 0.1 | GO:0002949 | tRNA threonylcarbamoyladenosine modification(GO:0002949) |
| 0.0 | 0.1 | GO:0071479 | cellular response to ionizing radiation(GO:0071479) |
| 0.0 | 0.0 | GO:0042637 | catagen(GO:0042637) |
| 0.0 | 0.1 | GO:0097011 | cellular response to granulocyte macrophage colony-stimulating factor stimulus(GO:0097011) |
| 0.0 | 0.2 | GO:0045745 | positive regulation of G-protein coupled receptor protein signaling pathway(GO:0045745) |
| 0.0 | 0.0 | GO:0070391 | response to lipoteichoic acid(GO:0070391) cellular response to lipoteichoic acid(GO:0071223) |
| 0.0 | 0.3 | GO:0032088 | negative regulation of NF-kappaB transcription factor activity(GO:0032088) |
| 0.0 | 0.2 | GO:1901799 | negative regulation of proteasomal protein catabolic process(GO:1901799) |
| 0.0 | 0.0 | GO:0048842 | positive regulation of axon extension involved in axon guidance(GO:0048842) positive regulation of axon guidance(GO:1902669) |
| 0.0 | 0.0 | GO:0000729 | DNA double-strand break processing(GO:0000729) |
| 0.0 | 0.2 | GO:0048246 | macrophage chemotaxis(GO:0048246) |
| 0.0 | 0.1 | GO:0006071 | glycerol metabolic process(GO:0006071) |
| 0.0 | 0.1 | GO:0071578 | zinc II ion transmembrane import(GO:0071578) |
| 0.0 | 0.4 | GO:0007584 | response to nutrient(GO:0007584) |
| 0.0 | 0.3 | GO:0071539 | protein localization to centrosome(GO:0071539) |
| 0.0 | 0.1 | GO:0070681 | glutaminyl-tRNAGln biosynthesis via transamidation(GO:0070681) |
| 0.0 | 0.0 | GO:0006999 | nuclear pore organization(GO:0006999) |
| 0.0 | 0.0 | GO:0061684 | chaperone-mediated autophagy(GO:0061684) regulation of chaperone-mediated autophagy(GO:1904714) |
| 0.0 | 0.1 | GO:0008334 | mRNA 3'-end processing by stem-loop binding and cleavage(GO:0006398) histone mRNA metabolic process(GO:0008334) |
| 0.0 | 0.1 | GO:0051534 | negative regulation of NFAT protein import into nucleus(GO:0051534) |
| 0.0 | 0.1 | GO:0071425 | hematopoietic stem cell proliferation(GO:0071425) |
| 0.0 | 0.2 | GO:0006122 | mitochondrial electron transport, ubiquinol to cytochrome c(GO:0006122) |
| 0.0 | 0.2 | GO:0051533 | positive regulation of NFAT protein import into nucleus(GO:0051533) |
| 0.0 | 0.6 | GO:0006730 | one-carbon metabolic process(GO:0006730) |
| 0.0 | 0.3 | GO:0043981 | histone H4-K5 acetylation(GO:0043981) histone H4-K8 acetylation(GO:0043982) |
| 0.0 | 0.1 | GO:0035278 | miRNA mediated inhibition of translation(GO:0035278) |
| 0.0 | 0.0 | GO:0030242 | pexophagy(GO:0030242) |
| 0.0 | 0.3 | GO:0007062 | sister chromatid cohesion(GO:0007062) |
| 0.0 | 0.1 | GO:0002690 | positive regulation of leukocyte chemotaxis(GO:0002690) |
| 0.0 | 0.1 | GO:0043562 | cellular response to nitrogen starvation(GO:0006995) cellular response to nitrogen levels(GO:0043562) |
| 0.0 | 0.0 | GO:0060956 | endocardial cell differentiation(GO:0060956) |
| 0.0 | 0.1 | GO:1902750 | negative regulation of cell cycle G2/M phase transition(GO:1902750) |
| 0.0 | 0.1 | GO:0030091 | protein repair(GO:0030091) |
| 0.0 | 0.1 | GO:0030828 | positive regulation of cGMP biosynthetic process(GO:0030828) |
| 0.0 | 0.0 | GO:0030388 | fructose 1,6-bisphosphate metabolic process(GO:0030388) |
| 0.0 | 0.2 | GO:0030521 | androgen receptor signaling pathway(GO:0030521) |
| 0.0 | 0.0 | GO:2000484 | positive regulation of interleukin-8 secretion(GO:2000484) |
| 0.0 | 0.0 | GO:0032878 | regulation of establishment or maintenance of cell polarity(GO:0032878) |
| 0.0 | 0.0 | GO:0051882 | mitochondrial depolarization(GO:0051882) |
| 0.0 | 0.0 | GO:0030259 | lipid glycosylation(GO:0030259) |
| 0.0 | 0.3 | GO:0019835 | cytolysis(GO:0019835) |
| 0.0 | 0.0 | GO:0098781 | ncRNA transcription(GO:0098781) |
| 0.0 | 0.0 | GO:0007262 | STAT protein import into nucleus(GO:0007262) |
| 0.0 | 0.0 | GO:0007161 | calcium-independent cell-matrix adhesion(GO:0007161) |
| 0.0 | 0.1 | GO:0030046 | parallel actin filament bundle assembly(GO:0030046) |
| 0.0 | 0.0 | GO:0045646 | regulation of erythrocyte differentiation(GO:0045646) |
| 0.0 | 1.0 | GO:0050909 | sensory perception of taste(GO:0050909) |
| 0.0 | 0.0 | GO:0006563 | L-serine metabolic process(GO:0006563) |
| 0.0 | 0.0 | GO:0015959 | diadenosine polyphosphate metabolic process(GO:0015959) |
| 0.0 | 0.0 | GO:0070086 | ubiquitin-dependent endocytosis(GO:0070086) |
| 0.0 | 0.2 | GO:2001022 | positive regulation of response to DNA damage stimulus(GO:2001022) |
| 0.0 | 0.1 | GO:0042574 | retinal metabolic process(GO:0042574) |
| 0.0 | 0.0 | GO:0002517 | T cell tolerance induction(GO:0002517) |
| 0.0 | 0.0 | GO:0022007 | neural plate elongation(GO:0014022) convergent extension involved in neural plate elongation(GO:0022007) |
| 0.0 | 0.1 | GO:0045824 | negative regulation of innate immune response(GO:0045824) |
| 0.0 | 0.1 | GO:0070131 | positive regulation of mitochondrial translation(GO:0070131) |
| 0.0 | 0.1 | GO:0060712 | spongiotrophoblast layer development(GO:0060712) |
| 0.0 | 0.0 | GO:0072061 | inner medullary collecting duct development(GO:0072061) |
| 0.0 | 0.0 | GO:0052646 | alditol phosphate metabolic process(GO:0052646) |
| 0.0 | 0.0 | GO:0048194 | Golgi vesicle budding(GO:0048194) |
| 0.0 | 0.1 | GO:0007341 | penetration of zona pellucida(GO:0007341) |
| 0.0 | 0.1 | GO:0042447 | hormone catabolic process(GO:0042447) |
| 0.0 | 0.0 | GO:0048242 | epinephrine secretion(GO:0048242) |
| 0.0 | 0.0 | GO:0070242 | thymocyte apoptotic process(GO:0070242) |
| 0.0 | 0.1 | GO:0016344 | meiotic chromosome movement towards spindle pole(GO:0016344) chromosome movement towards spindle pole(GO:0051305) |
| 0.0 | 0.0 | GO:0051447 | negative regulation of meiotic cell cycle(GO:0051447) |
| 0.0 | 0.0 | GO:0060839 | endothelial cell fate commitment(GO:0060839) |
| 0.0 | 0.1 | GO:0046950 | cellular ketone body metabolic process(GO:0046950) |
| 0.0 | 0.0 | GO:1901224 | positive regulation of NIK/NF-kappaB signaling(GO:1901224) |
| 0.0 | 0.1 | GO:0045806 | negative regulation of endocytosis(GO:0045806) |
| 0.0 | 0.0 | GO:0072310 | glomerular visceral epithelial cell development(GO:0072015) glomerular epithelial cell development(GO:0072310) |
| 0.0 | 0.0 | GO:0032815 | negative regulation of natural killer cell activation(GO:0032815) |
| 0.0 | 0.0 | GO:0034316 | negative regulation of Arp2/3 complex-mediated actin nucleation(GO:0034316) |
| 0.0 | 0.0 | GO:0010961 | cellular magnesium ion homeostasis(GO:0010961) |
| 0.0 | 0.0 | GO:0072602 | interleukin-4 secretion(GO:0072602) |
| 0.0 | 0.0 | GO:0060060 | post-embryonic retina morphogenesis in camera-type eye(GO:0060060) |
| 0.0 | 0.1 | GO:0070072 | vacuolar proton-transporting V-type ATPase complex assembly(GO:0070072) |
| 0.0 | 0.0 | GO:2000074 | regulation of type B pancreatic cell development(GO:2000074) |
| 0.0 | 0.0 | GO:0045213 | neurotransmitter receptor metabolic process(GO:0045213) |
| 0.0 | 0.0 | GO:0034421 | post-translational protein acetylation(GO:0034421) |
| 0.0 | 0.0 | GO:0048859 | formation of anatomical boundary(GO:0048859) |
| 0.0 | 0.0 | GO:0045925 | positive regulation of female receptivity(GO:0045925) |
| 0.0 | 0.1 | GO:0070269 | pyroptosis(GO:0070269) |
| 0.0 | 0.0 | GO:0034472 | snRNA 3'-end processing(GO:0034472) |
| 0.0 | 0.1 | GO:1904293 | negative regulation of ERAD pathway(GO:1904293) |
| 0.0 | 0.0 | GO:0060743 | epithelial cell maturation involved in prostate gland development(GO:0060743) |
| 0.0 | 0.1 | GO:0006474 | N-terminal protein amino acid acetylation(GO:0006474) |
| 0.0 | 0.0 | GO:0031937 | positive regulation of chromatin silencing(GO:0031937) |
| 0.0 | 0.0 | GO:0001836 | release of cytochrome c from mitochondria(GO:0001836) |
| 0.0 | 0.1 | GO:0010324 | membrane invagination(GO:0010324) |
| 0.0 | 0.0 | GO:0035810 | positive regulation of urine volume(GO:0035810) |
| 0.0 | 0.4 | GO:0007093 | mitotic cell cycle checkpoint(GO:0007093) |
| 0.0 | 0.0 | GO:0009415 | response to water(GO:0009415) |
| 0.0 | 1.4 | GO:0071216 | cellular response to biotic stimulus(GO:0071216) |
| 0.0 | 0.0 | GO:0045622 | regulation of T-helper cell differentiation(GO:0045622) |
| 0.0 | 0.0 | GO:0001542 | ovulation from ovarian follicle(GO:0001542) |
| 0.0 | 1.0 | GO:0006457 | protein folding(GO:0006457) |
| 0.0 | 0.1 | GO:0002578 | negative regulation of antigen processing and presentation(GO:0002578) negative regulation of antigen processing and presentation of peptide antigen(GO:0002584) |
| 0.0 | 0.0 | GO:0050482 | arachidonic acid secretion(GO:0050482) arachidonate transport(GO:1903963) |
| 0.0 | 0.0 | GO:0080111 | DNA demethylation(GO:0080111) |
| 0.0 | 0.0 | GO:0099558 | maintenance of synapse structure(GO:0099558) |
| 0.0 | 0.0 | GO:0030539 | male genitalia development(GO:0030539) |
| 0.0 | 0.0 | GO:0061101 | neuroendocrine cell differentiation(GO:0061101) |
| 0.0 | 0.0 | GO:0060837 | blood vessel endothelial cell differentiation(GO:0060837) |
| 0.0 | 0.0 | GO:0010804 | negative regulation of tumor necrosis factor-mediated signaling pathway(GO:0010804) |
| 0.0 | 0.0 | GO:0090269 | fibroblast growth factor production(GO:0090269) regulation of fibroblast growth factor production(GO:0090270) |
| 0.0 | 0.2 | GO:0033539 | fatty acid beta-oxidation using acyl-CoA dehydrogenase(GO:0033539) |
| 0.0 | 0.0 | GO:0010936 | negative regulation of macrophage cytokine production(GO:0010936) |
| 0.0 | 1.6 | GO:0006631 | fatty acid metabolic process(GO:0006631) |
| 0.0 | 0.1 | GO:0000920 | cell separation after cytokinesis(GO:0000920) |
| 0.0 | 0.1 | GO:0070940 | dephosphorylation of RNA polymerase II C-terminal domain(GO:0070940) |
| 0.0 | 0.1 | GO:0090043 | regulation of tubulin deacetylation(GO:0090043) |
| 0.0 | 0.1 | GO:0098787 | mRNA cleavage involved in mRNA processing(GO:0098787) |
| 0.0 | 0.0 | GO:0072553 | terminal button organization(GO:0072553) |
| 0.0 | 0.3 | GO:0006493 | protein O-linked glycosylation(GO:0006493) |
| 0.0 | 0.1 | GO:2000344 | positive regulation of acrosome reaction(GO:2000344) |
| 0.0 | 0.1 | GO:0006349 | regulation of gene expression by genetic imprinting(GO:0006349) |
| 0.0 | 0.0 | GO:0035994 | response to muscle stretch(GO:0035994) |
| 0.0 | 0.0 | GO:0000711 | meiotic DNA repair synthesis(GO:0000711) |
| 0.0 | 0.0 | GO:0035088 | establishment or maintenance of apical/basal cell polarity(GO:0035088) establishment or maintenance of bipolar cell polarity(GO:0061245) |
| 0.0 | 0.6 | GO:0006352 | DNA-templated transcription, initiation(GO:0006352) |
| 0.0 | 0.1 | GO:0043030 | regulation of macrophage activation(GO:0043030) |
| 0.0 | 0.0 | GO:0070303 | negative regulation of stress-activated MAPK cascade(GO:0032873) negative regulation of stress-activated protein kinase signaling cascade(GO:0070303) |
| 0.0 | 3.1 | GO:0007283 | spermatogenesis(GO:0007283) |
| 0.0 | 1.3 | GO:0071230 | cellular response to amino acid stimulus(GO:0071230) |
| 0.0 | 0.0 | GO:0043457 | regulation of cellular respiration(GO:0043457) |
| 0.0 | 0.9 | GO:0000209 | protein polyubiquitination(GO:0000209) |
| 0.0 | 0.1 | GO:0006379 | mRNA cleavage(GO:0006379) |
| 0.0 | 0.0 | GO:0002361 | CD4-positive, CD25-positive, alpha-beta regulatory T cell differentiation(GO:0002361) |
| 0.0 | 0.0 | GO:0090220 | chromosome localization to nuclear envelope involved in homologous chromosome segregation(GO:0090220) |
| 0.0 | 0.2 | GO:0000470 | maturation of LSU-rRNA(GO:0000470) |
| 0.0 | 1.6 | GO:0019236 | response to pheromone(GO:0019236) |
| 0.0 | 0.0 | GO:0006297 | nucleotide-excision repair, DNA gap filling(GO:0006297) |
| 0.0 | 0.0 | GO:0045061 | thymic T cell selection(GO:0045061) |
| 0.0 | 0.2 | GO:0052696 | flavonoid biosynthetic process(GO:0009813) flavonoid glucuronidation(GO:0052696) |
| 0.0 | 0.0 | GO:0052695 | cellular glucuronidation(GO:0052695) |
| 0.0 | 0.0 | GO:0070989 | oxidative demethylation(GO:0070989) |
| 0.0 | 0.0 | GO:0039535 | regulation of RIG-I signaling pathway(GO:0039535) |
| 0.0 | 0.0 | GO:2000834 | androgen secretion(GO:0035935) regulation of androgen secretion(GO:2000834) positive regulation of androgen secretion(GO:2000836) |
| 0.0 | 0.1 | GO:0032525 | somite rostral/caudal axis specification(GO:0032525) |
| 0.0 | 0.0 | GO:0070129 | regulation of mitochondrial translation(GO:0070129) |
| 0.0 | 0.0 | GO:0046685 | response to arsenic-containing substance(GO:0046685) |
| 0.0 | 0.0 | GO:0045023 | G0 to G1 transition(GO:0045023) regulation of G0 to G1 transition(GO:0070316) |
| 0.0 | 0.1 | GO:0036065 | fucosylation(GO:0036065) |
| 0.0 | 0.2 | GO:0016126 | sterol biosynthetic process(GO:0016126) |
| 0.0 | 0.0 | GO:0007621 | negative regulation of female receptivity(GO:0007621) |
| 0.0 | 0.1 | GO:0060314 | regulation of ryanodine-sensitive calcium-release channel activity(GO:0060314) |
| 0.0 | 0.0 | GO:0080154 | regulation of fertilization(GO:0080154) |
| 0.0 | 0.1 | GO:0006721 | terpenoid metabolic process(GO:0006721) |
| 0.0 | 0.0 | GO:0006287 | base-excision repair, gap-filling(GO:0006287) |
| 0.0 | 0.0 | GO:0035811 | negative regulation of urine volume(GO:0035811) |
| 0.0 | 0.0 | GO:0030656 | regulation of vitamin metabolic process(GO:0030656) |
| 0.0 | 0.0 | GO:0035845 | photoreceptor cell outer segment organization(GO:0035845) |
| 0.0 | 0.0 | GO:0007128 | meiotic prophase I(GO:0007128) prophase(GO:0051324) meiotic cell cycle phase(GO:0098762) meiosis I cell cycle phase(GO:0098764) |
| 0.0 | 0.0 | GO:0060017 | parathyroid gland development(GO:0060017) |
| 0.0 | 0.0 | GO:0060029 | convergent extension involved in organogenesis(GO:0060029) |
| 0.0 | 0.1 | GO:0006390 | transcription from mitochondrial promoter(GO:0006390) |
| 0.0 | 0.1 | GO:0032098 | regulation of appetite(GO:0032098) |
| 0.0 | 0.1 | GO:0050901 | leukocyte tethering or rolling(GO:0050901) |
| 0.0 | 0.0 | GO:1901491 | negative regulation of lymphangiogenesis(GO:1901491) |
| 0.0 | 0.0 | GO:0042102 | positive regulation of T cell proliferation(GO:0042102) |
| 0.0 | 0.0 | GO:0033260 | nuclear DNA replication(GO:0033260) |
| 0.0 | 0.0 | GO:1903054 | negative regulation of extracellular matrix organization(GO:1903054) |
| 0.0 | 0.0 | GO:0033574 | response to testosterone(GO:0033574) |
| 0.0 | 0.0 | GO:0048388 | endosomal lumen acidification(GO:0048388) |
| 0.0 | 0.0 | GO:0061590 | calcium activated phospholipid scrambling(GO:0061588) calcium activated phosphatidylcholine scrambling(GO:0061590) calcium activated galactosylceramide scrambling(GO:0061591) |
| 0.0 | 0.0 | GO:2001025 | positive regulation of response to drug(GO:2001025) |
| 0.0 | 0.0 | GO:0006772 | thiamine metabolic process(GO:0006772) thiamine-containing compound metabolic process(GO:0042723) |
| 0.0 | 0.0 | GO:0070358 | actin polymerization-dependent cell motility(GO:0070358) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 1.9 | 5.8 | GO:0097451 | glial limiting end-foot(GO:0097451) |
| 1.9 | 5.6 | GO:0071664 | catenin-TCF7L2 complex(GO:0071664) |
| 1.6 | 6.2 | GO:0097425 | smooth endoplasmic reticulum membrane(GO:0030868) smooth endoplasmic reticulum part(GO:0097425) |
| 1.1 | 4.3 | GO:0097136 | Bcl-2 family protein complex(GO:0097136) |
| 0.8 | 2.4 | GO:1990597 | AIP1-IRE1 complex(GO:1990597) |
| 0.8 | 2.4 | GO:0097418 | neurofibrillary tangle(GO:0097418) |
| 0.8 | 3.2 | GO:1990357 | terminal web(GO:1990357) |
| 0.8 | 4.0 | GO:0033588 | Elongator holoenzyme complex(GO:0033588) |
| 0.7 | 9.7 | GO:0000974 | Prp19 complex(GO:0000974) |
| 0.7 | 4.1 | GO:0070937 | CRD-mediated mRNA stability complex(GO:0070937) |
| 0.6 | 1.9 | GO:0034363 | intermediate-density lipoprotein particle(GO:0034363) |
| 0.6 | 1.9 | GO:0005914 | spot adherens junction(GO:0005914) |
| 0.6 | 0.6 | GO:0016342 | catenin complex(GO:0016342) |
| 0.6 | 7.9 | GO:0036038 | MKS complex(GO:0036038) |
| 0.6 | 5.5 | GO:0008385 | IkappaB kinase complex(GO:0008385) |
| 0.6 | 1.8 | GO:0090661 | box H/ACA telomerase RNP complex(GO:0090661) |
| 0.6 | 1.8 | GO:0071818 | BAT3 complex(GO:0071818) ER membrane insertion complex(GO:0072379) |
| 0.6 | 1.8 | GO:0033596 | TSC1-TSC2 complex(GO:0033596) |
| 0.6 | 4.0 | GO:0031232 | extrinsic component of external side of plasma membrane(GO:0031232) |
| 0.5 | 4.4 | GO:0000506 | glycosylphosphatidylinositol-N-acetylglucosaminyltransferase (GPI-GnT) complex(GO:0000506) |
| 0.5 | 6.0 | GO:0031588 | nucleotide-activated protein kinase complex(GO:0031588) |
| 0.5 | 0.5 | GO:0016514 | SWI/SNF complex(GO:0016514) |
| 0.5 | 3.6 | GO:0033180 | proton-transporting V-type ATPase, V1 domain(GO:0033180) |
| 0.5 | 1.5 | GO:0097452 | GAIT complex(GO:0097452) |
| 0.5 | 2.4 | GO:0070603 | SWI/SNF superfamily-type complex(GO:0070603) |
| 0.5 | 1.4 | GO:0036488 | CHOP-C/EBP complex(GO:0036488) |
| 0.4 | 1.8 | GO:0005927 | muscle tendon junction(GO:0005927) |
| 0.4 | 1.8 | GO:0072487 | MSL complex(GO:0072487) |
| 0.4 | 19.1 | GO:0030173 | integral component of Golgi membrane(GO:0030173) |
| 0.4 | 1.3 | GO:0033186 | CAF-1 complex(GO:0033186) |
| 0.4 | 1.2 | GO:0032127 | dense core granule membrane(GO:0032127) |
| 0.4 | 1.6 | GO:0032389 | MutLalpha complex(GO:0032389) |
| 0.4 | 2.4 | GO:0072357 | PTW/PP1 phosphatase complex(GO:0072357) |
| 0.4 | 2.0 | GO:0005579 | membrane attack complex(GO:0005579) |
| 0.4 | 4.0 | GO:0001931 | uropod(GO:0001931) cell trailing edge(GO:0031254) |
| 0.4 | 3.6 | GO:0005869 | dynactin complex(GO:0005869) |
| 0.4 | 0.8 | GO:0097413 | Lewy body(GO:0097413) |
| 0.4 | 6.5 | GO:0043034 | costamere(GO:0043034) |
| 0.4 | 1.2 | GO:0034666 | integrin alpha2-beta1 complex(GO:0034666) |
| 0.4 | 2.6 | GO:0005577 | fibrinogen complex(GO:0005577) |
| 0.4 | 1.5 | GO:0032591 | dendritic spine membrane(GO:0032591) |
| 0.4 | 1.1 | GO:0031233 | intrinsic component of external side of plasma membrane(GO:0031233) |
| 0.4 | 1.4 | GO:0032777 | Piccolo NuA4 histone acetyltransferase complex(GO:0032777) |
| 0.4 | 7.4 | GO:0031307 | integral component of mitochondrial outer membrane(GO:0031307) |
| 0.3 | 4.5 | GO:0031528 | microvillus membrane(GO:0031528) |
| 0.3 | 4.9 | GO:0030914 | STAGA complex(GO:0030914) |
| 0.3 | 1.7 | GO:0042765 | GPI-anchor transamidase complex(GO:0042765) |
| 0.3 | 2.4 | GO:0042382 | paraspeckles(GO:0042382) |
| 0.3 | 1.4 | GO:0033269 | internode region of axon(GO:0033269) |
| 0.3 | 2.7 | GO:0005861 | troponin complex(GO:0005861) |
| 0.3 | 9.4 | GO:0055038 | recycling endosome membrane(GO:0055038) |
| 0.3 | 2.3 | GO:0009925 | basal plasma membrane(GO:0009925) |
| 0.3 | 1.3 | GO:0000214 | tRNA-intron endonuclease complex(GO:0000214) |
| 0.3 | 2.3 | GO:0000243 | commitment complex(GO:0000243) |
| 0.3 | 2.2 | GO:0072669 | tRNA-splicing ligase complex(GO:0072669) |
| 0.3 | 1.3 | GO:0005915 | zonula adherens(GO:0005915) |
| 0.3 | 1.9 | GO:0032009 | early phagosome(GO:0032009) |
| 0.3 | 0.3 | GO:0031838 | haptoglobin-hemoglobin complex(GO:0031838) |
| 0.3 | 0.9 | GO:0043656 | host cell cytoplasm(GO:0030430) host intracellular part(GO:0033646) host cell cytoplasm part(GO:0033655) intracellular region of host(GO:0043656) |
| 0.3 | 1.5 | GO:0031315 | extrinsic component of mitochondrial outer membrane(GO:0031315) |
| 0.3 | 2.0 | GO:0046930 | pore complex(GO:0046930) |
| 0.3 | 0.3 | GO:0097149 | centralspindlin complex(GO:0097149) |
| 0.3 | 2.8 | GO:0031143 | pseudopodium(GO:0031143) |
| 0.3 | 3.6 | GO:0031430 | M band(GO:0031430) |
| 0.3 | 1.7 | GO:0042587 | glycogen granule(GO:0042587) |
| 0.3 | 1.4 | GO:0033063 | Rad51B-Rad51C-Rad51D-XRCC2 complex(GO:0033063) |
| 0.3 | 5.7 | GO:0034451 | centriolar satellite(GO:0034451) |
| 0.3 | 0.8 | GO:0035985 | senescence-associated heterochromatin focus(GO:0035985) |
| 0.3 | 0.8 | GO:0009331 | glycerol-3-phosphate dehydrogenase complex(GO:0009331) |
| 0.3 | 1.3 | GO:0000120 | RNA polymerase I transcription factor complex(GO:0000120) |
| 0.3 | 18.5 | GO:0017053 | transcriptional repressor complex(GO:0017053) |
| 0.3 | 1.0 | GO:0044294 | dendritic growth cone(GO:0044294) |
| 0.3 | 0.8 | GO:0031074 | nucleocytoplasmic shuttling complex(GO:0031074) |
| 0.3 | 1.3 | GO:0016281 | eukaryotic translation initiation factor 4F complex(GO:0016281) |
| 0.3 | 3.5 | GO:0001891 | phagocytic cup(GO:0001891) |
| 0.2 | 3.0 | GO:0034045 | pre-autophagosomal structure membrane(GO:0034045) |
| 0.2 | 1.0 | GO:0044530 | supraspliceosomal complex(GO:0044530) |
| 0.2 | 1.0 | GO:0005610 | laminin-5 complex(GO:0005610) |
| 0.2 | 0.5 | GO:0045259 | proton-transporting ATP synthase complex(GO:0045259) |
| 0.2 | 1.4 | GO:0005818 | aster(GO:0005818) |
| 0.2 | 3.3 | GO:0000407 | pre-autophagosomal structure(GO:0000407) |
| 0.2 | 1.2 | GO:0033093 | Weibel-Palade body(GO:0033093) |
| 0.2 | 1.9 | GO:0044666 | MLL3/4 complex(GO:0044666) |
| 0.2 | 1.4 | GO:0097197 | tetraspanin-enriched microdomain(GO:0097197) |
| 0.2 | 1.8 | GO:0016600 | flotillin complex(GO:0016600) |
| 0.2 | 0.9 | GO:0030015 | CCR4-NOT core complex(GO:0030015) |
| 0.2 | 1.1 | GO:0005638 | lamin filament(GO:0005638) |
| 0.2 | 0.7 | GO:0038037 | G-protein coupled receptor dimeric complex(GO:0038037) G-protein coupled receptor complex(GO:0097648) |
| 0.2 | 0.5 | GO:0030313 | cell outer membrane(GO:0009279) cell envelope(GO:0030313) external encapsulating structure part(GO:0044462) |
| 0.2 | 1.1 | GO:0001651 | dense fibrillar component(GO:0001651) |
| 0.2 | 0.2 | GO:0044455 | mitochondrial membrane part(GO:0044455) |
| 0.2 | 0.7 | GO:0043625 | delta DNA polymerase complex(GO:0043625) |
| 0.2 | 6.3 | GO:0010494 | cytoplasmic stress granule(GO:0010494) |
| 0.2 | 3.1 | GO:0005665 | DNA-directed RNA polymerase II, core complex(GO:0005665) |
| 0.2 | 0.2 | GO:0000439 | core TFIIH complex(GO:0000439) |
| 0.2 | 0.4 | GO:0070765 | gamma-secretase complex(GO:0070765) |
| 0.2 | 0.6 | GO:0005853 | eukaryotic translation elongation factor 1 complex(GO:0005853) |
| 0.2 | 1.9 | GO:0036513 | Derlin-1 retrotranslocation complex(GO:0036513) |
| 0.2 | 0.8 | GO:0035339 | SPOTS complex(GO:0035339) |
| 0.2 | 4.0 | GO:0097228 | sperm principal piece(GO:0097228) |
| 0.2 | 0.6 | GO:0016461 | unconventional myosin complex(GO:0016461) |
| 0.2 | 0.8 | GO:0044316 | cone cell pedicle(GO:0044316) |
| 0.2 | 1.2 | GO:0098553 | integral component of cytoplasmic side of endoplasmic reticulum membrane(GO:0071458) integral component of lumenal side of endoplasmic reticulum membrane(GO:0071556) lumenal side of endoplasmic reticulum membrane(GO:0098553) |
| 0.2 | 2.0 | GO:0045111 | intermediate filament cytoskeleton(GO:0045111) |
| 0.2 | 0.6 | GO:0031523 | Myb complex(GO:0031523) |
| 0.2 | 6.5 | GO:0005801 | cis-Golgi network(GO:0005801) |
| 0.2 | 0.2 | GO:0005642 | annulate lamellae(GO:0005642) |
| 0.2 | 1.4 | GO:0071437 | invadopodium(GO:0071437) |
| 0.2 | 4.3 | GO:0000786 | nucleosome(GO:0000786) |
| 0.2 | 1.0 | GO:0033503 | HULC complex(GO:0033503) |
| 0.2 | 0.2 | GO:0048787 | presynaptic active zone membrane(GO:0048787) |
| 0.2 | 0.8 | GO:0042583 | chromaffin granule(GO:0042583) |
| 0.2 | 0.8 | GO:0071817 | MMXD complex(GO:0071817) |
| 0.2 | 2.8 | GO:0030125 | clathrin vesicle coat(GO:0030125) |
| 0.2 | 0.9 | GO:0008541 | proteasome regulatory particle, lid subcomplex(GO:0008541) |
| 0.2 | 2.6 | GO:0097225 | sperm midpiece(GO:0097225) |
| 0.2 | 1.1 | GO:0000127 | transcription factor TFIIIC complex(GO:0000127) |
| 0.2 | 1.3 | GO:0005833 | hemoglobin complex(GO:0005833) |
| 0.2 | 0.7 | GO:0031262 | Ndc80 complex(GO:0031262) |
| 0.2 | 0.9 | GO:0016589 | NURF complex(GO:0016589) |
| 0.2 | 9.5 | GO:0005811 | lipid particle(GO:0005811) |
| 0.2 | 1.5 | GO:0030314 | junctional membrane complex(GO:0030314) |
| 0.2 | 4.3 | GO:0097610 | cleavage furrow(GO:0032154) cell surface furrow(GO:0097610) |
| 0.2 | 8.1 | GO:0005778 | peroxisomal membrane(GO:0005778) microbody membrane(GO:0031903) |
| 0.2 | 1.6 | GO:0042588 | zymogen granule(GO:0042588) |
| 0.2 | 0.4 | GO:0005742 | mitochondrial outer membrane translocase complex(GO:0005742) |
| 0.2 | 0.5 | GO:0030312 | external encapsulating structure(GO:0030312) |
| 0.2 | 1.1 | GO:0034464 | BBSome(GO:0034464) |
| 0.2 | 0.4 | GO:0097513 | myosin II filament(GO:0097513) |
| 0.2 | 2.1 | GO:0042589 | zymogen granule membrane(GO:0042589) |
| 0.2 | 0.5 | GO:0016939 | kinesin II complex(GO:0016939) |
| 0.2 | 1.0 | GO:0016011 | dystroglycan complex(GO:0016011) sarcoglycan complex(GO:0016012) |
| 0.2 | 0.9 | GO:0070688 | MLL5-L complex(GO:0070688) |
| 0.2 | 0.9 | GO:0044613 | nuclear pore central transport channel(GO:0044613) |
| 0.2 | 1.7 | GO:0031080 | nuclear pore outer ring(GO:0031080) |
| 0.2 | 0.5 | GO:0071001 | U4/U6 snRNP(GO:0071001) |
| 0.2 | 0.7 | GO:0031010 | ISWI-type complex(GO:0031010) |
| 0.2 | 0.5 | GO:1990423 | RZZ complex(GO:1990423) |
| 0.2 | 1.7 | GO:0065010 | extracellular membrane-bounded organelle(GO:0065010) |
| 0.2 | 3.1 | GO:0001772 | immunological synapse(GO:0001772) |
| 0.2 | 2.0 | GO:0031901 | early endosome membrane(GO:0031901) |
| 0.2 | 1.1 | GO:0008290 | F-actin capping protein complex(GO:0008290) |
| 0.2 | 0.5 | GO:0097524 | sperm plasma membrane(GO:0097524) |
| 0.2 | 1.9 | GO:0043198 | dendritic shaft(GO:0043198) |
| 0.2 | 1.3 | GO:0097208 | alveolar lamellar body(GO:0097208) |
| 0.2 | 0.5 | GO:0005827 | polar microtubule(GO:0005827) |
| 0.2 | 0.5 | GO:0000172 | ribonuclease MRP complex(GO:0000172) |
| 0.2 | 5.4 | GO:0016592 | mediator complex(GO:0016592) |
| 0.2 | 5.9 | GO:0000776 | kinetochore(GO:0000776) |
| 0.2 | 2.0 | GO:0002199 | zona pellucida receptor complex(GO:0002199) |
| 0.2 | 0.2 | GO:0000178 | exosome (RNase complex)(GO:0000178) |
| 0.2 | 0.5 | GO:0035061 | interchromatin granule(GO:0035061) |
| 0.2 | 0.2 | GO:0097512 | cardiac myofibril(GO:0097512) |
| 0.2 | 3.6 | GO:0016235 | aggresome(GO:0016235) |
| 0.2 | 1.1 | GO:0034992 | microtubule organizing center attachment site(GO:0034992) LINC complex(GO:0034993) |
| 0.1 | 1.2 | GO:0043020 | NADPH oxidase complex(GO:0043020) |
| 0.1 | 0.6 | GO:0035363 | histone locus body(GO:0035363) |
| 0.1 | 1.0 | GO:0042582 | primary lysosome(GO:0005766) azurophil granule(GO:0042582) |
| 0.1 | 2.4 | GO:0033017 | sarcoplasmic reticulum membrane(GO:0033017) |
| 0.1 | 2.4 | GO:0042101 | T cell receptor complex(GO:0042101) |
| 0.1 | 1.3 | GO:0008250 | oligosaccharyltransferase complex(GO:0008250) |
| 0.1 | 0.4 | GO:0016602 | CCAAT-binding factor complex(GO:0016602) |
| 0.1 | 0.1 | GO:0031088 | platelet dense granule membrane(GO:0031088) |
| 0.1 | 1.4 | GO:0005868 | cytoplasmic dynein complex(GO:0005868) |
| 0.1 | 0.4 | GO:0031417 | NatC complex(GO:0031417) |
| 0.1 | 1.5 | GO:0030014 | CCR4-NOT complex(GO:0030014) |
| 0.1 | 0.4 | GO:0005958 | DNA-dependent protein kinase-DNA ligase 4 complex(GO:0005958) |
| 0.1 | 0.8 | GO:0034663 | endoplasmic reticulum chaperone complex(GO:0034663) |
| 0.1 | 3.3 | GO:0015030 | Cajal body(GO:0015030) |
| 0.1 | 1.0 | GO:0005845 | mRNA cap binding complex(GO:0005845) RNA cap binding complex(GO:0034518) |
| 0.1 | 0.1 | GO:0044308 | axonal spine(GO:0044308) |
| 0.1 | 2.7 | GO:0035145 | exon-exon junction complex(GO:0035145) |
| 0.1 | 0.4 | GO:0071439 | clathrin complex(GO:0071439) |
| 0.1 | 0.4 | GO:0005967 | mitochondrial pyruvate dehydrogenase complex(GO:0005967) |
| 0.1 | 0.4 | GO:0030891 | VCB complex(GO:0030891) |
| 0.1 | 0.4 | GO:0045098 | type III intermediate filament(GO:0045098) |
| 0.1 | 2.3 | GO:0097346 | INO80-type complex(GO:0097346) |
| 0.1 | 0.4 | GO:0097543 | ciliary inversin compartment(GO:0097543) |
| 0.1 | 1.3 | GO:0045277 | respiratory chain complex IV(GO:0045277) |
| 0.1 | 12.8 | GO:0001726 | ruffle(GO:0001726) |
| 0.1 | 1.6 | GO:0043196 | varicosity(GO:0043196) |
| 0.1 | 0.4 | GO:0097470 | ribbon synapse(GO:0097470) |
| 0.1 | 4.8 | GO:0005770 | late endosome(GO:0005770) |
| 0.1 | 5.1 | GO:0030964 | mitochondrial respiratory chain complex I(GO:0005747) NADH dehydrogenase complex(GO:0030964) respiratory chain complex I(GO:0045271) |
| 0.1 | 4.6 | GO:0016528 | sarcoplasm(GO:0016528) |
| 0.1 | 0.3 | GO:0044614 | nuclear pore cytoplasmic filaments(GO:0044614) |
| 0.1 | 0.6 | GO:0005964 | phosphorylase kinase complex(GO:0005964) |
| 0.1 | 1.3 | GO:0070852 | cell body fiber(GO:0070852) |
| 0.1 | 0.9 | GO:0032593 | insulin-responsive compartment(GO:0032593) |
| 0.1 | 0.5 | GO:0000938 | GARP complex(GO:0000938) |
| 0.1 | 0.6 | GO:0001674 | female germ cell nucleus(GO:0001674) |
| 0.1 | 0.4 | GO:0097542 | ciliary tip(GO:0097542) |
| 0.1 | 0.7 | GO:0045252 | oxoglutarate dehydrogenase complex(GO:0045252) |
| 0.1 | 0.7 | GO:0005883 | neurofilament(GO:0005883) |
| 0.1 | 0.6 | GO:0061700 | GATOR2 complex(GO:0061700) |
| 0.1 | 0.5 | GO:0030915 | Smc5-Smc6 complex(GO:0030915) |
| 0.1 | 1.0 | GO:0000813 | ESCRT I complex(GO:0000813) |
| 0.1 | 0.2 | GO:0031428 | box C/D snoRNP complex(GO:0031428) |
| 0.1 | 1.0 | GO:0071541 | eukaryotic translation initiation factor 3 complex, eIF3m(GO:0071541) |
| 0.1 | 0.8 | GO:0001939 | female pronucleus(GO:0001939) |
| 0.1 | 2.0 | GO:0005669 | transcription factor TFIID complex(GO:0005669) |
| 0.1 | 0.5 | GO:0048188 | Set1C/COMPASS complex(GO:0048188) |
| 0.1 | 3.7 | GO:0005844 | polysome(GO:0005844) |
| 0.1 | 0.9 | GO:0005614 | interstitial matrix(GO:0005614) |
| 0.1 | 0.4 | GO:1990923 | PET complex(GO:1990923) |
| 0.1 | 0.1 | GO:0043293 | apoptosome(GO:0043293) |
| 0.1 | 2.7 | GO:0008180 | COP9 signalosome(GO:0008180) |
| 0.1 | 0.6 | GO:0061617 | MICOS complex(GO:0061617) |
| 0.1 | 0.3 | GO:0005952 | cAMP-dependent protein kinase complex(GO:0005952) |
| 0.1 | 0.6 | GO:0043203 | axon hillock(GO:0043203) |
| 0.1 | 1.7 | GO:0031941 | filamentous actin(GO:0031941) |
| 0.1 | 0.3 | GO:0043527 | tRNA methyltransferase complex(GO:0043527) |
| 0.1 | 0.2 | GO:0044232 | organelle membrane contact site(GO:0044232) |
| 0.1 | 2.5 | GO:0000791 | euchromatin(GO:0000791) |
| 0.1 | 9.5 | GO:0072562 | blood microparticle(GO:0072562) |
| 0.1 | 0.5 | GO:0043219 | lateral loop(GO:0043219) |
| 0.1 | 0.1 | GO:0070522 | ERCC4-ERCC1 complex(GO:0070522) |
| 0.1 | 0.2 | GO:0042612 | MHC class I protein complex(GO:0042612) |
| 0.1 | 9.0 | GO:0000793 | condensed chromosome(GO:0000793) |
| 0.1 | 0.3 | GO:0016234 | inclusion body(GO:0016234) |
| 0.1 | 2.2 | GO:0030660 | Golgi-associated vesicle membrane(GO:0030660) |
| 0.1 | 2.0 | GO:0005776 | autophagosome(GO:0005776) |
| 0.1 | 0.1 | GO:0031092 | platelet alpha granule membrane(GO:0031092) |
| 0.1 | 1.7 | GO:0005884 | actin filament(GO:0005884) |
| 0.1 | 0.6 | GO:0036057 | filtration diaphragm(GO:0036056) slit diaphragm(GO:0036057) |
| 0.1 | 0.8 | GO:0098533 | ATPase dependent transmembrane transport complex(GO:0098533) ATPase complex(GO:1904949) |
| 0.1 | 6.2 | GO:0016605 | PML body(GO:0016605) |
| 0.1 | 0.5 | GO:0031931 | TORC1 complex(GO:0031931) |
| 0.1 | 0.2 | GO:0097443 | sorting endosome(GO:0097443) |
| 0.1 | 0.4 | GO:0005796 | Golgi lumen(GO:0005796) |
| 0.1 | 4.3 | GO:0016328 | lateral plasma membrane(GO:0016328) |
| 0.1 | 1.3 | GO:0097546 | ciliary base(GO:0097546) |
| 0.1 | 0.2 | GO:0098536 | deuterosome(GO:0098536) |
| 0.1 | 0.3 | GO:0030132 | clathrin coat of coated pit(GO:0030132) |
| 0.1 | 1.3 | GO:0044439 | microbody part(GO:0044438) peroxisomal part(GO:0044439) |
| 0.1 | 0.4 | GO:0008622 | epsilon DNA polymerase complex(GO:0008622) |
| 0.1 | 1.9 | GO:0005922 | connexon complex(GO:0005922) |
| 0.1 | 1.4 | GO:0030904 | retromer complex(GO:0030904) |
| 0.1 | 0.3 | GO:0019815 | B cell receptor complex(GO:0019815) |
| 0.1 | 0.3 | GO:0071598 | neuronal ribonucleoprotein granule(GO:0071598) |
| 0.1 | 0.3 | GO:0032444 | activin responsive factor complex(GO:0032444) |
| 0.1 | 3.8 | GO:0000932 | cytoplasmic mRNA processing body(GO:0000932) |
| 0.1 | 0.7 | GO:0017119 | Golgi transport complex(GO:0017119) |
| 0.1 | 2.6 | GO:0000118 | histone deacetylase complex(GO:0000118) |
| 0.1 | 1.4 | GO:0000177 | cytoplasmic exosome (RNase complex)(GO:0000177) |
| 0.1 | 0.2 | GO:0031502 | dolichyl-phosphate-mannose-protein mannosyltransferase complex(GO:0031502) |
| 0.1 | 0.7 | GO:0045179 | apical cortex(GO:0045179) |
| 0.1 | 0.3 | GO:0019907 | cyclin-dependent protein kinase activating kinase holoenzyme complex(GO:0019907) |
| 0.1 | 0.3 | GO:0031371 | ubiquitin conjugating enzyme complex(GO:0031371) |
| 0.1 | 0.3 | GO:0019908 | nuclear cyclin-dependent protein kinase holoenzyme complex(GO:0019908) |
| 0.1 | 0.8 | GO:0071006 | U2-type catalytic step 1 spliceosome(GO:0071006) |
| 0.1 | 0.2 | GO:0000835 | ER ubiquitin ligase complex(GO:0000835) Hrd1p ubiquitin ligase complex(GO:0000836) |
| 0.1 | 3.7 | GO:0046658 | anchored component of plasma membrane(GO:0046658) |
| 0.1 | 0.6 | GO:0031597 | cytosolic proteasome complex(GO:0031597) |
| 0.1 | 1.3 | GO:0034364 | high-density lipoprotein particle(GO:0034364) |
| 0.1 | 1.6 | GO:0030131 | clathrin adaptor complex(GO:0030131) |
| 0.1 | 0.7 | GO:0005641 | nuclear envelope lumen(GO:0005641) |
| 0.1 | 0.8 | GO:0005798 | Golgi-associated vesicle(GO:0005798) |
| 0.1 | 4.5 | GO:0030139 | endocytic vesicle(GO:0030139) |
| 0.1 | 1.0 | GO:0080008 | Cul4-RING E3 ubiquitin ligase complex(GO:0080008) |
| 0.1 | 4.0 | GO:0090575 | RNA polymerase II transcription factor complex(GO:0090575) |
| 0.1 | 7.3 | GO:0030176 | integral component of endoplasmic reticulum membrane(GO:0030176) |
| 0.1 | 0.3 | GO:0005971 | ribonucleoside-diphosphate reductase complex(GO:0005971) |
| 0.1 | 0.5 | GO:0001739 | sex chromatin(GO:0001739) |
| 0.1 | 0.9 | GO:0031083 | BLOC-1 complex(GO:0031083) |
| 0.1 | 0.1 | GO:0005850 | eukaryotic translation initiation factor 2 complex(GO:0005850) |
| 0.1 | 0.3 | GO:0030956 | glutamyl-tRNA(Gln) amidotransferase complex(GO:0030956) |
| 0.1 | 1.4 | GO:0000145 | exocyst(GO:0000145) |
| 0.1 | 0.1 | GO:0034750 | Scrib-APC-beta-catenin complex(GO:0034750) |
| 0.1 | 0.2 | GO:0005658 | alpha DNA polymerase:primase complex(GO:0005658) |
| 0.1 | 0.6 | GO:0033263 | CORVET complex(GO:0033263) |
| 0.1 | 6.0 | GO:0042579 | peroxisome(GO:0005777) microbody(GO:0042579) |
| 0.1 | 0.2 | GO:0036452 | ESCRT complex(GO:0036452) |
| 0.1 | 1.3 | GO:0005790 | smooth endoplasmic reticulum(GO:0005790) |
| 0.1 | 3.6 | GO:0030136 | clathrin-coated vesicle(GO:0030136) |
| 0.1 | 0.3 | GO:0046691 | intracellular canaliculus(GO:0046691) |
| 0.1 | 2.0 | GO:0042645 | nucleoid(GO:0009295) mitochondrial nucleoid(GO:0042645) |
| 0.1 | 0.4 | GO:0043218 | compact myelin(GO:0043218) |
| 0.1 | 1.7 | GO:0055037 | recycling endosome(GO:0055037) |
| 0.1 | 7.1 | GO:0005741 | mitochondrial outer membrane(GO:0005741) |
| 0.1 | 0.1 | GO:0034679 | integrin alpha9-beta1 complex(GO:0034679) |
| 0.1 | 0.8 | GO:0000815 | ESCRT III complex(GO:0000815) |
| 0.1 | 0.4 | GO:0005793 | endoplasmic reticulum-Golgi intermediate compartment(GO:0005793) |
| 0.1 | 1.7 | GO:0048770 | melanosome(GO:0042470) pigment granule(GO:0048770) |
| 0.1 | 0.3 | GO:0042599 | lamellar body(GO:0042599) |
| 0.1 | 0.9 | GO:0005865 | striated muscle thin filament(GO:0005865) |
| 0.1 | 9.4 | GO:0005759 | mitochondrial matrix(GO:0005759) |
| 0.1 | 0.2 | GO:0034709 | methylosome(GO:0034709) |
| 0.1 | 0.2 | GO:0097057 | TRAF2-GSTP1 complex(GO:0097057) |
| 0.1 | 43.4 | GO:0005730 | nucleolus(GO:0005730) |
| 0.1 | 0.3 | GO:0031211 | serine C-palmitoyltransferase complex(GO:0017059) endoplasmic reticulum palmitoyltransferase complex(GO:0031211) |
| 0.1 | 16.8 | GO:0005667 | transcription factor complex(GO:0005667) |
| 0.1 | 0.3 | GO:0005663 | DNA replication factor C complex(GO:0005663) |
| 0.1 | 0.9 | GO:0032039 | integrator complex(GO:0032039) |
| 0.1 | 0.2 | GO:1990716 | axonemal central apparatus(GO:1990716) |
| 0.1 | 3.1 | GO:0044309 | neuron spine(GO:0044309) |
| 0.1 | 0.2 | GO:0031932 | TORC2 complex(GO:0031932) |
| 0.1 | 0.2 | GO:0070419 | nonhomologous end joining complex(GO:0070419) |
| 0.1 | 0.1 | GO:0005879 | axonemal microtubule(GO:0005879) |
| 0.1 | 0.5 | GO:0016591 | DNA-directed RNA polymerase II, holoenzyme(GO:0016591) |
| 0.1 | 0.5 | GO:0005744 | mitochondrial inner membrane presequence translocase complex(GO:0005744) |
| 0.1 | 2.8 | GO:0045095 | keratin filament(GO:0045095) |
| 0.1 | 0.3 | GO:0044292 | dendrite terminus(GO:0044292) |
| 0.1 | 0.5 | GO:0071986 | Ragulator complex(GO:0071986) |
| 0.1 | 0.5 | GO:0035631 | CD40 receptor complex(GO:0035631) |
| 0.1 | 0.2 | GO:0048476 | Holliday junction resolvase complex(GO:0048476) |
| 0.1 | 0.1 | GO:0002079 | inner acrosomal membrane(GO:0002079) |
| 0.1 | 0.2 | GO:0070032 | synaptobrevin 2-SNAP-25-syntaxin-1a-complexin I complex(GO:0070032) |
| 0.1 | 2.2 | GO:0005788 | endoplasmic reticulum lumen(GO:0005788) |
| 0.1 | 10.3 | GO:0016324 | apical plasma membrane(GO:0016324) |
| 0.1 | 21.7 | GO:0000323 | lytic vacuole(GO:0000323) lysosome(GO:0005764) |
| 0.1 | 0.7 | GO:0008074 | guanylate cyclase complex, soluble(GO:0008074) |
| 0.1 | 0.6 | GO:0005902 | microvillus(GO:0005902) |
| 0.1 | 0.1 | GO:0090498 | extrinsic component of Golgi membrane(GO:0090498) |
| 0.1 | 0.2 | GO:0031298 | replication fork protection complex(GO:0031298) |
| 0.1 | 3.9 | GO:0005882 | intermediate filament(GO:0005882) |
| 0.1 | 0.4 | GO:0033391 | chromatoid body(GO:0033391) |
| 0.1 | 3.2 | GO:0019897 | extrinsic component of plasma membrane(GO:0019897) |
| 0.1 | 0.8 | GO:0030057 | desmosome(GO:0030057) |
| 0.1 | 0.1 | GO:0016533 | cyclin-dependent protein kinase 5 holoenzyme complex(GO:0016533) |
| 0.1 | 0.5 | GO:0097539 | ciliary transition fiber(GO:0097539) |
| 0.1 | 0.4 | GO:1990391 | DNA repair complex(GO:1990391) |
| 0.1 | 0.7 | GO:0005876 | spindle microtubule(GO:0005876) |
| 0.1 | 1.4 | GO:0008023 | transcription elongation factor complex(GO:0008023) |
| 0.1 | 0.1 | GO:1990712 | HFE-transferrin receptor complex(GO:1990712) |
| 0.1 | 0.6 | GO:0017146 | NMDA selective glutamate receptor complex(GO:0017146) |
| 0.1 | 0.1 | GO:0010009 | cytoplasmic side of endosome membrane(GO:0010009) |
| 0.1 | 3.6 | GO:0034399 | nuclear periphery(GO:0034399) |
| 0.1 | 17.9 | GO:0005743 | mitochondrial inner membrane(GO:0005743) |
| 0.1 | 0.1 | GO:0071953 | elastic fiber(GO:0071953) |
| 0.1 | 2.9 | GO:0000502 | proteasome complex(GO:0000502) |
| 0.1 | 0.1 | GO:0097255 | R2TP complex(GO:0097255) |
| 0.1 | 0.2 | GO:0031258 | lamellipodium membrane(GO:0031258) |
| 0.1 | 0.8 | GO:0031519 | PcG protein complex(GO:0031519) |
| 0.1 | 0.6 | GO:0000307 | cyclin-dependent protein kinase holoenzyme complex(GO:0000307) |
| 0.1 | 59.1 | GO:0005783 | endoplasmic reticulum(GO:0005783) |
| 0.1 | 0.2 | GO:0035861 | site of double-strand break(GO:0035861) |
| 0.1 | 0.3 | GO:0002189 | ribose phosphate diphosphokinase complex(GO:0002189) |
| 0.1 | 1.0 | GO:0036126 | sperm flagellum(GO:0036126) |
| 0.1 | 0.3 | GO:0030056 | hemidesmosome(GO:0030056) |
| 0.1 | 2.7 | GO:0015934 | large ribosomal subunit(GO:0015934) |
| 0.1 | 0.7 | GO:0005666 | DNA-directed RNA polymerase III complex(GO:0005666) |
| 0.1 | 1.2 | GO:0005891 | voltage-gated calcium channel complex(GO:0005891) |
| 0.1 | 1.0 | GO:0071013 | catalytic step 2 spliceosome(GO:0071013) |
| 0.1 | 0.6 | GO:0002116 | semaphorin receptor complex(GO:0002116) |
| 0.1 | 0.1 | GO:0070531 | BRCA1-A complex(GO:0070531) |
| 0.1 | 0.3 | GO:0042581 | specific granule(GO:0042581) |
| 0.1 | 0.1 | GO:0005688 | U6 snRNP(GO:0005688) |
| 0.1 | 1.4 | GO:0005758 | mitochondrial intermembrane space(GO:0005758) |
| 0.1 | 61.2 | GO:0005654 | nucleoplasm(GO:0005654) |
| 0.1 | 0.2 | GO:0000346 | transcription export complex(GO:0000346) |
| 0.1 | 0.3 | GO:0016272 | prefoldin complex(GO:0016272) |
| 0.1 | 0.4 | GO:0005682 | U5 snRNP(GO:0005682) |
| 0.1 | 0.3 | GO:0001741 | XY body(GO:0001741) |
| 0.1 | 0.1 | GO:0005797 | Golgi medial cisterna(GO:0005797) |
| 0.1 | 0.6 | GO:0036464 | cytoplasmic ribonucleoprotein granule(GO:0036464) |
| 0.1 | 0.1 | GO:0048500 | signal recognition particle, endoplasmic reticulum targeting(GO:0005786) signal recognition particle(GO:0048500) |
| 0.1 | 0.1 | GO:0016442 | RISC complex(GO:0016442) RNAi effector complex(GO:0031332) |
| 0.1 | 0.3 | GO:0005921 | gap junction(GO:0005921) |
| 0.1 | 0.1 | GO:0044214 | spanning component of plasma membrane(GO:0044214) spanning component of membrane(GO:0089717) |
| 0.1 | 0.1 | GO:1990075 | periciliary membrane compartment(GO:1990075) |
| 0.1 | 1.1 | GO:0000784 | nuclear chromosome, telomeric region(GO:0000784) |
| 0.1 | 2.5 | GO:0000139 | Golgi membrane(GO:0000139) |
| 0.1 | 2.3 | GO:0005923 | bicellular tight junction(GO:0005923) |
| 0.1 | 61.6 | GO:0070062 | extracellular exosome(GO:0070062) |
| 0.1 | 1.1 | GO:0030496 | midbody(GO:0030496) |
| 0.0 | 0.1 | GO:0031091 | platelet alpha granule(GO:0031091) |
| 0.0 | 0.0 | GO:0035770 | ribonucleoprotein granule(GO:0035770) |
| 0.0 | 0.1 | GO:0044611 | nuclear pore inner ring(GO:0044611) |
| 0.0 | 0.0 | GO:0042613 | MHC class II protein complex(GO:0042613) |
| 0.0 | 1.6 | GO:0005769 | early endosome(GO:0005769) |
| 0.0 | 0.3 | GO:0016459 | myosin complex(GO:0016459) |
| 0.0 | 0.2 | GO:0070652 | HAUS complex(GO:0070652) |
| 0.0 | 0.4 | GO:0060170 | ciliary membrane(GO:0060170) |
| 0.0 | 0.3 | GO:0030667 | secretory granule membrane(GO:0030667) |
| 0.0 | 0.1 | GO:0034673 | inhibin-betaglycan-ActRII complex(GO:0034673) |
| 0.0 | 0.1 | GO:0043601 | nuclear replisome(GO:0043601) |
| 0.0 | 0.0 | GO:0042175 | nuclear outer membrane-endoplasmic reticulum membrane network(GO:0042175) |
| 0.0 | 1.4 | GO:0016323 | basolateral plasma membrane(GO:0016323) |
| 0.0 | 0.2 | GO:0000781 | chromosome, telomeric region(GO:0000781) |
| 0.0 | 0.9 | GO:0031514 | motile cilium(GO:0031514) |
| 0.0 | 1.0 | GO:0031674 | I band(GO:0031674) |
| 0.0 | 3.2 | GO:0035068 | micro-ribonucleoprotein complex(GO:0035068) |
| 0.0 | 0.2 | GO:0034706 | sodium channel complex(GO:0034706) |
| 0.0 | 0.0 | GO:0005605 | basal lamina(GO:0005605) |
| 0.0 | 0.1 | GO:0030894 | replisome(GO:0030894) |
| 0.0 | 1.5 | GO:0005581 | collagen trimer(GO:0005581) |
| 0.0 | 0.6 | GO:0042383 | sarcolemma(GO:0042383) |
| 0.0 | 0.1 | GO:0089701 | U2AF(GO:0089701) |
| 0.0 | 12.6 | GO:0005739 | mitochondrion(GO:0005739) |
| 0.0 | 0.3 | GO:0043292 | contractile fiber(GO:0043292) |
| 0.0 | 0.2 | GO:0002102 | podosome(GO:0002102) |
| 0.0 | 0.1 | GO:0005657 | replication fork(GO:0005657) |
| 0.0 | 0.1 | GO:1990909 | Wnt signalosome(GO:1990909) |
| 0.0 | 0.1 | GO:0042555 | MCM complex(GO:0042555) |
| 0.0 | 2.0 | GO:0005694 | chromosome(GO:0005694) |
| 0.0 | 0.9 | GO:0030427 | site of polarized growth(GO:0030427) |
| 0.0 | 0.4 | GO:0000152 | nuclear ubiquitin ligase complex(GO:0000152) |
| 0.0 | 0.4 | GO:0005892 | acetylcholine-gated channel complex(GO:0005892) |
| 0.0 | 2.8 | GO:0009897 | external side of plasma membrane(GO:0009897) |
| 0.0 | 0.2 | GO:0032420 | stereocilium(GO:0032420) |
| 0.0 | 0.2 | GO:0061702 | inflammasome complex(GO:0061702) |
| 0.0 | 0.1 | GO:1903561 | extracellular organelle(GO:0043230) extracellular vesicle(GO:1903561) |
| 0.0 | 0.0 | GO:0030880 | RNA polymerase complex(GO:0030880) |
| 0.0 | 0.0 | GO:0097058 | CRLF-CLCF1 complex(GO:0097058) |
| 0.0 | 0.1 | GO:0002177 | manchette(GO:0002177) |
| 0.0 | 0.1 | GO:0071010 | prespliceosome(GO:0071010) |
| 0.0 | 0.1 | GO:0048786 | presynaptic active zone(GO:0048786) |
| 0.0 | 0.0 | GO:0070033 | synaptobrevin 2-SNAP-25-syntaxin-1a-complexin II complex(GO:0070033) |
| 0.0 | 0.1 | GO:0031526 | brush border membrane(GO:0031526) |
| 0.0 | 0.0 | GO:0005686 | U2 snRNP(GO:0005686) |
| 0.0 | 0.1 | GO:0031235 | intrinsic component of the cytoplasmic side of the plasma membrane(GO:0031235) |
| 0.0 | 0.0 | GO:0031264 | death-inducing signaling complex(GO:0031264) |
| 0.0 | 0.1 | GO:0071011 | precatalytic spliceosome(GO:0071011) |
| 0.0 | 1.4 | GO:0048471 | perinuclear region of cytoplasm(GO:0048471) |
| 0.0 | 0.0 | GO:0031512 | motile primary cilium(GO:0031512) |
| 0.0 | 0.1 | GO:0032982 | myosin filament(GO:0032982) |
| 0.0 | 7.8 | GO:0005615 | extracellular space(GO:0005615) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 1.7 | 6.9 | GO:0008865 | fructokinase activity(GO:0008865) mannokinase activity(GO:0019158) |
| 1.7 | 12.0 | GO:0003836 | beta-galactoside (CMP) alpha-2,3-sialyltransferase activity(GO:0003836) |
| 1.5 | 6.0 | GO:0004095 | carnitine O-palmitoyltransferase activity(GO:0004095) |
| 1.4 | 4.1 | GO:0004939 | beta-adrenergic receptor activity(GO:0004939) |
| 1.2 | 5.0 | GO:0004332 | fructose-bisphosphate aldolase activity(GO:0004332) |
| 1.2 | 4.8 | GO:0009374 | biotin binding(GO:0009374) |
| 1.2 | 4.7 | GO:0050693 | LBD domain binding(GO:0050693) |
| 1.1 | 3.4 | GO:0061513 | hexose phosphate transmembrane transporter activity(GO:0015119) organophosphate:inorganic phosphate antiporter activity(GO:0015315) hexose-phosphate:inorganic phosphate antiporter activity(GO:0015526) glucose 6-phosphate:inorganic phosphate antiporter activity(GO:0061513) |
| 1.1 | 3.4 | GO:0018479 | benzaldehyde dehydrogenase (NAD+) activity(GO:0018479) |
| 1.1 | 3.3 | GO:0035175 | histone kinase activity (H3-S10 specific)(GO:0035175) |
| 1.1 | 4.4 | GO:0008381 | mechanically-gated ion channel activity(GO:0008381) mechanically gated channel activity(GO:0022833) |
| 1.1 | 3.2 | GO:0047192 | 1-alkylglycerophosphocholine O-acetyltransferase activity(GO:0047192) |
| 1.0 | 4.8 | GO:0004022 | alcohol dehydrogenase (NAD) activity(GO:0004022) |
| 0.9 | 3.8 | GO:0070053 | thrombospondin receptor activity(GO:0070053) |
| 0.9 | 8.3 | GO:0015194 | L-serine transmembrane transporter activity(GO:0015194) serine transmembrane transporter activity(GO:0022889) |
| 0.9 | 2.7 | GO:0015205 | purine nucleobase transmembrane transporter activity(GO:0005345) pyrimidine nucleobase transmembrane transporter activity(GO:0005350) nucleobase transmembrane transporter activity(GO:0015205) |
| 0.8 | 0.8 | GO:0031726 | CCR1 chemokine receptor binding(GO:0031726) |
| 0.8 | 7.8 | GO:0003993 | acid phosphatase activity(GO:0003993) |
| 0.8 | 2.3 | GO:0071535 | RING-like zinc finger domain binding(GO:0071535) |
| 0.8 | 5.3 | GO:0031730 | CCR5 chemokine receptor binding(GO:0031730) |
| 0.8 | 3.0 | GO:0034548 | N-cyclopropylmelamine deaminase activity(GO:0034547) N-cyclopropylammeline deaminase activity(GO:0034548) N-cyclopropylammelide alkylamino hydrolase activity(GO:0034549) 2,5-diamino-6-ribitylamino-4(3H)-pyrimidinone 5'-phosphate deaminase activity(GO:0043723) tRNA-specific adenosine-37 deaminase activity(GO:0043829) archaeal-specific GTP cyclohydrolase activity(GO:0044682) tRNA-specific adenosine-34 deaminase activity(GO:0052717) |
| 0.7 | 2.2 | GO:0034186 | apolipoprotein A-I binding(GO:0034186) |
| 0.7 | 2.2 | GO:0004069 | L-aspartate:2-oxoglutarate aminotransferase activity(GO:0004069) |
| 0.7 | 2.2 | GO:0015563 | uptake transmembrane transporter activity(GO:0015563) |
| 0.7 | 2.2 | GO:0001069 | regulatory region RNA binding(GO:0001069) |
| 0.7 | 2.2 | GO:0046976 | histone methyltransferase activity (H3-K27 specific)(GO:0046976) |
| 0.7 | 4.1 | GO:0050897 | cobalt ion binding(GO:0050897) |
| 0.7 | 2.1 | GO:0030172 | troponin C binding(GO:0030172) |
| 0.7 | 3.4 | GO:0035033 | histone deacetylase regulator activity(GO:0035033) |
| 0.7 | 2.0 | GO:0060230 | lipoprotein lipase activator activity(GO:0060230) |
| 0.7 | 4.6 | GO:0005381 | iron ion transmembrane transporter activity(GO:0005381) |
| 0.6 | 3.2 | GO:0004523 | RNA-DNA hybrid ribonuclease activity(GO:0004523) |
| 0.6 | 3.2 | GO:0005384 | manganese ion transmembrane transporter activity(GO:0005384) |
| 0.6 | 1.9 | GO:0043125 | ErbB-3 class receptor binding(GO:0043125) |
| 0.6 | 8.1 | GO:0031005 | filamin binding(GO:0031005) |
| 0.6 | 1.8 | GO:0005347 | ATP transmembrane transporter activity(GO:0005347) |
| 0.6 | 1.8 | GO:0034618 | arginine binding(GO:0034618) |
| 0.6 | 1.8 | GO:0034513 | box H/ACA snoRNA binding(GO:0034513) |
| 0.6 | 2.4 | GO:0004792 | thiosulfate sulfurtransferase activity(GO:0004792) |
| 0.6 | 3.6 | GO:0004679 | AMP-activated protein kinase activity(GO:0004679) |
| 0.6 | 1.8 | GO:0004687 | myosin light chain kinase activity(GO:0004687) |
| 0.6 | 0.6 | GO:0042296 | ISG15 transferase activity(GO:0042296) |
| 0.6 | 7.0 | GO:0043176 | amine binding(GO:0043176) |
| 0.6 | 1.7 | GO:0047623 | AMP deaminase activity(GO:0003876) adenosine-phosphate deaminase activity(GO:0047623) |
| 0.6 | 0.6 | GO:0000064 | L-ornithine transmembrane transporter activity(GO:0000064) |
| 0.6 | 0.6 | GO:0097200 | cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:0097200) |
| 0.6 | 2.3 | GO:0004090 | carbonyl reductase (NADPH) activity(GO:0004090) |
| 0.5 | 1.1 | GO:0004706 | JUN kinase kinase kinase activity(GO:0004706) |
| 0.5 | 1.6 | GO:1902282 | voltage-gated potassium channel activity involved in ventricular cardiac muscle cell action potential repolarization(GO:1902282) |
| 0.5 | 3.2 | GO:0005375 | copper ion transmembrane transporter activity(GO:0005375) |
| 0.5 | 2.1 | GO:0016018 | cyclosporin A binding(GO:0016018) |
| 0.5 | 3.2 | GO:0034889 | alkyl sulfatase activity(GO:0018741) endosulfan hemisulfate sulfatase activity(GO:0034889) endosulfan sulfate hydrolase activity(GO:0034902) |
| 0.5 | 2.1 | GO:0015199 | amino-acid betaine transmembrane transporter activity(GO:0015199) carnitine transmembrane transporter activity(GO:0015226) |
| 0.5 | 1.1 | GO:0016531 | copper chaperone activity(GO:0016531) superoxide dismutase copper chaperone activity(GO:0016532) |
| 0.5 | 3.2 | GO:0008603 | cAMP-dependent protein kinase regulator activity(GO:0008603) |
| 0.5 | 2.1 | GO:0098748 | clathrin adaptor activity(GO:0035615) endocytic adaptor activity(GO:0098748) |
| 0.5 | 2.5 | GO:0004887 | thyroid hormone receptor activity(GO:0004887) |
| 0.5 | 2.0 | GO:0004969 | histamine receptor activity(GO:0004969) |
| 0.5 | 5.5 | GO:0004711 | ribosomal protein S6 kinase activity(GO:0004711) |
| 0.5 | 2.0 | GO:0061665 | SUMO ligase activity(GO:0061665) |
| 0.5 | 1.9 | GO:0031433 | telethonin binding(GO:0031433) |
| 0.5 | 1.9 | GO:0004035 | alkaline phosphatase activity(GO:0004035) |
| 0.5 | 1.4 | GO:0015143 | urate transmembrane transporter activity(GO:0015143) salt transmembrane transporter activity(GO:1901702) |
| 0.5 | 1.0 | GO:0005128 | erythropoietin receptor binding(GO:0005128) |
| 0.5 | 0.5 | GO:0050051 | leukotriene-B4 20-monooxygenase activity(GO:0050051) |
| 0.5 | 1.9 | GO:0008970 | phosphatidylcholine 1-acylhydrolase activity(GO:0008970) |
| 0.5 | 2.3 | GO:0005007 | fibroblast growth factor-activated receptor activity(GO:0005007) |
| 0.5 | 2.3 | GO:0003847 | 1-alkyl-2-acetylglycerophosphocholine esterase activity(GO:0003847) |
| 0.5 | 1.4 | GO:0004470 | malic enzyme activity(GO:0004470) malate dehydrogenase (decarboxylating) (NAD+) activity(GO:0004471) |
| 0.5 | 2.3 | GO:0000774 | adenyl-nucleotide exchange factor activity(GO:0000774) |
| 0.5 | 1.8 | GO:0016997 | exo-alpha-sialidase activity(GO:0004308) alpha-sialidase activity(GO:0016997) exo-alpha-(2->3)-sialidase activity(GO:0052794) exo-alpha-(2->6)-sialidase activity(GO:0052795) exo-alpha-(2->8)-sialidase activity(GO:0052796) |
| 0.5 | 1.8 | GO:0004614 | phosphoglucomutase activity(GO:0004614) |
| 0.5 | 2.3 | GO:0004957 | prostaglandin E receptor activity(GO:0004957) |
| 0.5 | 1.8 | GO:0002060 | purine nucleobase binding(GO:0002060) |
| 0.4 | 2.7 | GO:0030368 | interleukin-17 receptor activity(GO:0030368) |
| 0.4 | 0.9 | GO:0050692 | DBD domain binding(GO:0050692) |
| 0.4 | 1.8 | GO:0015173 | aromatic amino acid transmembrane transporter activity(GO:0015173) |
| 0.4 | 4.0 | GO:0008093 | cytoskeletal adaptor activity(GO:0008093) |
| 0.4 | 6.5 | GO:0016290 | palmitoyl-CoA hydrolase activity(GO:0016290) |
| 0.4 | 1.3 | GO:0004942 | anaphylatoxin receptor activity(GO:0004942) |
| 0.4 | 1.7 | GO:0047499 | calcium-independent phospholipase A2 activity(GO:0047499) |
| 0.4 | 0.8 | GO:0036042 | long-chain fatty acyl-CoA binding(GO:0036042) |
| 0.4 | 1.2 | GO:0034739 | histone deacetylase activity (H4-K16 specific)(GO:0034739) |
| 0.4 | 1.2 | GO:0005220 | inositol 1,4,5-trisphosphate-sensitive calcium-release channel activity(GO:0005220) |
| 0.4 | 1.2 | GO:0004920 | interleukin-10 receptor activity(GO:0004920) |
| 0.4 | 1.6 | GO:0031721 | hemoglobin alpha binding(GO:0031721) |
| 0.4 | 1.6 | GO:0019834 | phospholipase A2 inhibitor activity(GO:0019834) |
| 0.4 | 3.2 | GO:0102391 | decanoate--CoA ligase activity(GO:0102391) |
| 0.4 | 1.2 | GO:0004949 | cannabinoid receptor activity(GO:0004949) |
| 0.4 | 3.5 | GO:0004438 | phosphatidylinositol-3-phosphatase activity(GO:0004438) |
| 0.4 | 1.2 | GO:0035529 | NADH pyrophosphatase activity(GO:0035529) |
| 0.4 | 1.2 | GO:0015319 | sodium:inorganic phosphate symporter activity(GO:0015319) |
| 0.4 | 1.9 | GO:0046912 | transferase activity, transferring acyl groups, acyl groups converted into alkyl on transfer(GO:0046912) |
| 0.4 | 1.9 | GO:0030976 | thiamine pyrophosphate binding(GO:0030976) |
| 0.4 | 2.3 | GO:0051371 | muscle alpha-actinin binding(GO:0051371) |
| 0.4 | 5.6 | GO:0008307 | structural constituent of muscle(GO:0008307) |
| 0.4 | 1.1 | GO:0004365 | glyceraldehyde-3-phosphate dehydrogenase (NAD+) (phosphorylating) activity(GO:0004365) glyceraldehyde-3-phosphate dehydrogenase (NAD(P)+) (phosphorylating) activity(GO:0043891) |
| 0.4 | 1.1 | GO:0004965 | G-protein coupled GABA receptor activity(GO:0004965) |
| 0.4 | 1.1 | GO:0005087 | Ran guanyl-nucleotide exchange factor activity(GO:0005087) |
| 0.4 | 1.1 | GO:0016151 | nickel cation binding(GO:0016151) |
| 0.4 | 0.7 | GO:0038191 | neuropilin binding(GO:0038191) |
| 0.4 | 1.1 | GO:0015154 | sucrose:proton symporter activity(GO:0008506) sucrose transmembrane transporter activity(GO:0008515) disaccharide transmembrane transporter activity(GO:0015154) oligosaccharide transmembrane transporter activity(GO:0015157) |
| 0.4 | 4.0 | GO:0015129 | lactate transmembrane transporter activity(GO:0015129) |
| 0.4 | 5.8 | GO:0008143 | poly(A) binding(GO:0008143) |
| 0.4 | 1.1 | GO:0019002 | GMP binding(GO:0019002) |
| 0.4 | 1.8 | GO:0016841 | ammonia-lyase activity(GO:0016841) |
| 0.4 | 2.5 | GO:0016308 | 1-phosphatidylinositol-4-phosphate 5-kinase activity(GO:0016308) |
| 0.4 | 1.4 | GO:0015016 | [heparan sulfate]-glucosamine N-sulfotransferase activity(GO:0015016) |
| 0.4 | 1.1 | GO:0051718 | DNA (cytosine-5-)-methyltransferase activity(GO:0003886) DNA (cytosine-5-)-methyltransferase activity, acting on CpG substrates(GO:0051718) |
| 0.4 | 1.4 | GO:0008745 | N-acetylmuramoyl-L-alanine amidase activity(GO:0008745) peptidoglycan receptor activity(GO:0016019) |
| 0.4 | 1.8 | GO:0016176 | superoxide-generating NADPH oxidase activator activity(GO:0016176) |
| 0.4 | 1.1 | GO:0016842 | amidine-lyase activity(GO:0016842) |
| 0.4 | 1.4 | GO:0015232 | heme transporter activity(GO:0015232) |
| 0.3 | 1.0 | GO:0019961 | interferon binding(GO:0019961) |
| 0.3 | 1.7 | GO:0017034 | Rap guanyl-nucleotide exchange factor activity(GO:0017034) |
| 0.3 | 2.7 | GO:0071933 | Arp2/3 complex binding(GO:0071933) |
| 0.3 | 1.0 | GO:0003829 | beta-1,3-galactosyl-O-glycosyl-glycoprotein beta-1,6-N-acetylglucosaminyltransferase activity(GO:0003829) |
| 0.3 | 14.5 | GO:0004715 | non-membrane spanning protein tyrosine kinase activity(GO:0004715) |
| 0.3 | 1.0 | GO:0051733 | ATP-dependent polydeoxyribonucleotide 5'-hydroxyl-kinase activity(GO:0046404) polydeoxyribonucleotide kinase activity(GO:0051733) |
| 0.3 | 2.7 | GO:0031702 | type 1 angiotensin receptor binding(GO:0031702) |
| 0.3 | 1.0 | GO:0033592 | RNA strand annealing activity(GO:0033592) |
| 0.3 | 3.3 | GO:0004016 | adenylate cyclase activity(GO:0004016) |
| 0.3 | 2.9 | GO:0001055 | RNA polymerase II activity(GO:0001055) |
| 0.3 | 0.6 | GO:0008545 | JUN kinase kinase activity(GO:0008545) |
| 0.3 | 2.2 | GO:0004708 | MAP kinase kinase activity(GO:0004708) |
| 0.3 | 2.9 | GO:0030983 | mismatched DNA binding(GO:0030983) |
| 0.3 | 2.2 | GO:0034046 | poly(G) binding(GO:0034046) |
| 0.3 | 0.3 | GO:0009378 | four-way junction helicase activity(GO:0009378) |
| 0.3 | 1.9 | GO:0046790 | virion binding(GO:0046790) |
| 0.3 | 2.2 | GO:1904264 | ubiquitin protein ligase activity involved in ERAD pathway(GO:1904264) |
| 0.3 | 2.2 | GO:0005113 | patched binding(GO:0005113) |
| 0.3 | 1.3 | GO:0003873 | 6-phosphofructo-2-kinase activity(GO:0003873) |
| 0.3 | 0.6 | GO:1990188 | euchromatin binding(GO:1990188) |
| 0.3 | 32.9 | GO:0002020 | protease binding(GO:0002020) |
| 0.3 | 3.1 | GO:0070410 | co-SMAD binding(GO:0070410) |
| 0.3 | 1.2 | GO:0034235 | GPI anchor binding(GO:0034235) |
| 0.3 | 0.6 | GO:1901612 | cardiolipin binding(GO:1901612) |
| 0.3 | 0.9 | GO:0004771 | sterol esterase activity(GO:0004771) |
| 0.3 | 1.8 | GO:0004064 | arylesterase activity(GO:0004064) |
| 0.3 | 1.5 | GO:0017169 | CDP-alcohol phosphatidyltransferase activity(GO:0017169) |
| 0.3 | 2.7 | GO:0001013 | RNA polymerase I regulatory region DNA binding(GO:0001013) |
| 0.3 | 0.9 | GO:0000403 | Y-form DNA binding(GO:0000403) |
| 0.3 | 9.5 | GO:0004364 | glutathione transferase activity(GO:0004364) |
| 0.3 | 8.8 | GO:0045502 | dynein binding(GO:0045502) |
| 0.3 | 0.6 | GO:0042731 | PH domain binding(GO:0042731) |
| 0.3 | 2.3 | GO:0030346 | protein phosphatase 2B binding(GO:0030346) |
| 0.3 | 1.1 | GO:0098639 | collagen binding involved in cell-matrix adhesion(GO:0098639) |
| 0.3 | 0.8 | GO:0031800 | type 3 metabotropic glutamate receptor binding(GO:0031800) |
| 0.3 | 1.1 | GO:0004488 | methylenetetrahydrofolate dehydrogenase (NADP+) activity(GO:0004488) |
| 0.3 | 2.2 | GO:0004767 | sphingomyelin phosphodiesterase activity(GO:0004767) |
| 0.3 | 2.8 | GO:0019215 | intermediate filament binding(GO:0019215) |
| 0.3 | 3.0 | GO:0016813 | hydrolase activity, acting on carbon-nitrogen (but not peptide) bonds, in linear amidines(GO:0016813) |
| 0.3 | 3.0 | GO:0045294 | alpha-catenin binding(GO:0045294) |
| 0.3 | 0.3 | GO:0004340 | glucokinase activity(GO:0004340) hexokinase activity(GO:0004396) |
| 0.3 | 1.4 | GO:0005412 | glucose:sodium symporter activity(GO:0005412) |
| 0.3 | 1.6 | GO:0016443 | bidentate ribonuclease III activity(GO:0016443) |
| 0.3 | 8.2 | GO:0015485 | cholesterol binding(GO:0015485) |
| 0.3 | 3.7 | GO:0001671 | ATPase activator activity(GO:0001671) |
| 0.3 | 0.8 | GO:0004367 | glycerol-3-phosphate dehydrogenase [NAD+] activity(GO:0004367) |
| 0.3 | 0.8 | GO:0015222 | serotonin transmembrane transporter activity(GO:0015222) |
| 0.3 | 1.9 | GO:0018633 | 3-(3-hydroxyphenyl)propionate hydroxylase activity(GO:0008688) 4-chlorobenzaldehyde oxidase activity(GO:0018471) 3,5-xylenol methylhydroxylase activity(GO:0018630) phenylacetate hydroxylase activity(GO:0018631) 4-nitrophenol 4-monooxygenase activity(GO:0018632) dimethyl sulfide monooxygenase activity(GO:0018633) alpha-pinene monooxygenase [NADH] activity(GO:0018634) 1-hydroxy-2-naphthoate hydroxylase activity(GO:0018637) toluene 4-monooxygenase activity(GO:0018638) xylene monooxygenase activity(GO:0018639) dibenzothiophene monooxygenase activity(GO:0018640) 6-hydroxy-3-methyl-2-oxo-1,2-dihydroquinoline 6-monooxygenase activity(GO:0018641) chlorophenol 4-monooxygenase activity(GO:0018642) carbon disulfide oxygenase activity(GO:0018643) toluene 2-monooxygenase activity(GO:0018644) 1-hydroxy-2-oxolimonene 1,2-monooxygenase activity(GO:0018646) phenanthrene 1,2-monooxygenase activity(GO:0018647) tetrahydrofuran hydroxylase activity(GO:0018649) styrene monooxygenase activity(GO:0018650) toluene-4-sulfonate monooxygenase activity(GO:0018651) toluene-sulfonate methyl-monooxygenase activity(GO:0018652) 3-methyl-2-oxo-1,2-dihydroquinoline 6-monooxygenase activity(GO:0018653) 2-hydroxy-phenylacetate hydroxylase activity(GO:0018654) 2-oxo-delta3-4,5,5-trimethylcyclopentenylacetyl-CoA 1,2-monooxygenase activity(GO:0018655) phenanthrene 3,4-monooxygenase activity(GO:0018656) toluene 3-monooxygenase activity(GO:0018657) 4-hydroxyphenylacetate,NADH:oxygen oxidoreductase (3-hydroxylating) activity(GO:0018660) limonene monooxygenase activity(GO:0019113) 2-methylnaphthalene hydroxylase activity(GO:0034526) 1-methylnaphthalene hydroxylase activity(GO:0034534) bisphenol A hydroxylase A activity(GO:0034560) salicylate 5-hydroxylase activity(GO:0034785) isobutylamine N-hydroxylase activity(GO:0034791) branched-chain dodecylbenzene sulfonate monooxygenase activity(GO:0034802) 3-HSA hydroxylase activity(GO:0034819) 4-hydroxypyridine-3-hydroxylase activity(GO:0034894) 2-octaprenyl-3-methyl-6-methoxy-1,4-benzoquinol hydroxylase activity(GO:0043719) 6-hydroxynicotinate 3-monooxygenase activity(GO:0043731) thalianol hydroxylase activity(GO:0080014) |
| 0.3 | 2.9 | GO:0097602 | cullin family protein binding(GO:0097602) |
| 0.3 | 0.3 | GO:0016309 | 1-phosphatidylinositol-5-phosphate 4-kinase activity(GO:0016309) |
| 0.3 | 0.3 | GO:0046979 | TAP1 binding(GO:0046978) TAP2 binding(GO:0046979) |
| 0.3 | 4.4 | GO:0005031 | tumor necrosis factor-activated receptor activity(GO:0005031) death receptor activity(GO:0005035) |
| 0.3 | 0.8 | GO:0004514 | nicotinate-nucleotide diphosphorylase (carboxylating) activity(GO:0004514) |
| 0.3 | 1.8 | GO:0018446 | pinocarveol dehydrogenase activity(GO:0018446) chloral hydrate dehydrogenase activity(GO:0018447) hydroxymethylmethylsilanediol oxidase activity(GO:0018448) 1-phenylethanol dehydrogenase activity(GO:0018449) myrtenol dehydrogenase activity(GO:0018450) cis-1,2-dihydroxy-1,2-dihydro-8-carboxynaphthalene dehydrogenase activity(GO:0034522) 3-hydroxy-4-methyloctanoyl-CoA dehydrogenase activity(GO:0034582) 2-hydroxy-4-isopropenylcyclohexane-1-carboxyl-CoA dehydrogenase activity(GO:0034778) cis-9,10-dihydroanthracene-9,10-diol dehydrogenase activity(GO:0034817) citronellol dehydrogenase activity(GO:0034821) naphthyl-2-hydroxymethyl-succinyl-CoA dehydrogenase activity(GO:0034847) 2,4,4-trimethyl-1-pentanol dehydrogenase activity(GO:0034863) 2,4,4-trimethyl-3-hydroxypentanoyl-CoA dehydrogenase activity(GO:0034868) 1-hydroxy-4,4-dimethylpentan-3-one dehydrogenase activity(GO:0034871) endosulfan diol dehydrogenase activity(GO:0034891) endosulfan hydroxyether dehydrogenase activity(GO:0034901) 3-hydroxy-2-methylhexanoyl-CoA dehydrogenase activity(GO:0034918) 3-hydroxy-2,6-dimethyl-5-methylene-heptanoyl-CoA dehydrogenase activity(GO:0034944) versicolorin reductase activity(GO:0042469) ketoreductase activity(GO:0045703) |
| 0.3 | 0.8 | GO:0004611 | phosphoenolpyruvate carboxykinase activity(GO:0004611) |
| 0.3 | 1.5 | GO:0016936 | galactoside binding(GO:0016936) |
| 0.3 | 0.8 | GO:0097493 | structural molecule activity conferring elasticity(GO:0097493) |
| 0.2 | 3.2 | GO:0008601 | protein phosphatase type 2A regulator activity(GO:0008601) |
| 0.2 | 1.2 | GO:0070097 | delta-catenin binding(GO:0070097) |
| 0.2 | 3.7 | GO:0080025 | phosphatidylinositol-3,5-bisphosphate binding(GO:0080025) |
| 0.2 | 1.0 | GO:0004966 | galanin receptor activity(GO:0004966) |
| 0.2 | 1.0 | GO:0001849 | complement component C1q binding(GO:0001849) |
| 0.2 | 1.0 | GO:0000340 | RNA 7-methylguanosine cap binding(GO:0000340) |
| 0.2 | 2.2 | GO:0042500 | aspartic endopeptidase activity, intramembrane cleaving(GO:0042500) |
| 0.2 | 2.6 | GO:0051400 | BH domain binding(GO:0051400) |
| 0.2 | 1.2 | GO:0004301 | epoxide hydrolase activity(GO:0004301) |
| 0.2 | 4.0 | GO:0003746 | translation elongation factor activity(GO:0003746) |
| 0.2 | 0.5 | GO:0038181 | bile acid receptor activity(GO:0038181) |
| 0.2 | 0.7 | GO:0004461 | lactose synthase activity(GO:0004461) |
| 0.2 | 0.9 | GO:0052650 | NADP-retinol dehydrogenase activity(GO:0052650) |
| 0.2 | 1.6 | GO:0051864 | histone demethylase activity (H3-K36 specific)(GO:0051864) |
| 0.2 | 0.9 | GO:0001846 | opsonin binding(GO:0001846) |
| 0.2 | 1.6 | GO:0008568 | microtubule-severing ATPase activity(GO:0008568) |
| 0.2 | 0.2 | GO:0004449 | isocitrate dehydrogenase (NAD+) activity(GO:0004449) |
| 0.2 | 0.9 | GO:0000293 | ferric-chelate reductase activity(GO:0000293) |
| 0.2 | 2.7 | GO:0004745 | retinol dehydrogenase activity(GO:0004745) |
| 0.2 | 0.2 | GO:0003828 | alpha-N-acetylneuraminate alpha-2,8-sialyltransferase activity(GO:0003828) |
| 0.2 | 0.9 | GO:0000900 | translation repressor activity, nucleic acid binding(GO:0000900) |
| 0.2 | 4.7 | GO:0005385 | zinc ion transmembrane transporter activity(GO:0005385) transition metal ion transmembrane transporter activity(GO:0046915) |
| 0.2 | 1.1 | GO:0035671 | enone reductase activity(GO:0035671) |
| 0.2 | 0.7 | GO:0016971 | flavin-linked sulfhydryl oxidase activity(GO:0016971) |
| 0.2 | 4.0 | GO:0005070 | SH3/SH2 adaptor activity(GO:0005070) |
| 0.2 | 3.1 | GO:0016493 | C-C chemokine receptor activity(GO:0016493) |
| 0.2 | 4.2 | GO:0030742 | GTP-dependent protein binding(GO:0030742) |
| 0.2 | 0.2 | GO:0070644 | vitamin D response element binding(GO:0070644) |
| 0.2 | 2.0 | GO:0008932 | lytic endotransglycosylase activity(GO:0008932) |
| 0.2 | 0.6 | GO:0004924 | oncostatin-M receptor activity(GO:0004924) |
| 0.2 | 1.3 | GO:0097322 | 7SK snRNA binding(GO:0097322) |
| 0.2 | 1.9 | GO:0004445 | inositol-polyphosphate 5-phosphatase activity(GO:0004445) |
| 0.2 | 0.6 | GO:0055056 | D-glucose transmembrane transporter activity(GO:0055056) |
| 0.2 | 2.1 | GO:0070300 | phosphatidic acid binding(GO:0070300) |
| 0.2 | 1.3 | GO:0042809 | vitamin D receptor binding(GO:0042809) |
| 0.2 | 1.1 | GO:1990380 | Lys48-specific deubiquitinase activity(GO:1990380) |
| 0.2 | 9.9 | GO:0005518 | collagen binding(GO:0005518) |
| 0.2 | 3.2 | GO:0004709 | MAP kinase kinase kinase activity(GO:0004709) |
| 0.2 | 2.9 | GO:0042800 | histone methyltransferase activity (H3-K4 specific)(GO:0042800) |
| 0.2 | 0.4 | GO:0002094 | polyprenyltransferase activity(GO:0002094) |
| 0.2 | 0.2 | GO:0004505 | phenylalanine 4-monooxygenase activity(GO:0004505) |
| 0.2 | 4.8 | GO:0048020 | CCR chemokine receptor binding(GO:0048020) |
| 0.2 | 1.9 | GO:0050321 | tau-protein kinase activity(GO:0050321) |
| 0.2 | 0.8 | GO:0017150 | tRNA dihydrouridine synthase activity(GO:0017150) |
| 0.2 | 2.5 | GO:0005243 | gap junction channel activity(GO:0005243) |
| 0.2 | 2.9 | GO:0015095 | magnesium ion transmembrane transporter activity(GO:0015095) |
| 0.2 | 1.5 | GO:0034185 | apolipoprotein binding(GO:0034185) |
| 0.2 | 1.4 | GO:0000150 | recombinase activity(GO:0000150) |
| 0.2 | 0.6 | GO:0051032 | nucleic acid transmembrane transporter activity(GO:0051032) RNA transmembrane transporter activity(GO:0051033) |
| 0.2 | 1.6 | GO:0045295 | gamma-catenin binding(GO:0045295) |
| 0.2 | 2.5 | GO:0045236 | CXCR chemokine receptor binding(GO:0045236) |
| 0.2 | 2.5 | GO:0009982 | pseudouridine synthase activity(GO:0009982) |
| 0.2 | 0.6 | GO:0042284 | sphingolipid delta-4 desaturase activity(GO:0042284) |
| 0.2 | 0.6 | GO:0033829 | O-fucosylpeptide 3-beta-N-acetylglucosaminyltransferase activity(GO:0033829) |
| 0.2 | 1.4 | GO:0005078 | MAP-kinase scaffold activity(GO:0005078) |
| 0.2 | 0.2 | GO:0042609 | CD4 receptor binding(GO:0042609) |
| 0.2 | 0.6 | GO:0070139 | ubiquitin-like protein-specific endopeptidase activity(GO:0070137) SUMO-specific endopeptidase activity(GO:0070139) |
| 0.2 | 0.4 | GO:0071558 | histone demethylase activity (H3-K27 specific)(GO:0071558) |
| 0.2 | 1.0 | GO:0015556 | C4-dicarboxylate transmembrane transporter activity(GO:0015556) |
| 0.2 | 0.8 | GO:0004126 | cytidine deaminase activity(GO:0004126) |
| 0.2 | 0.6 | GO:0003956 | NAD(P)+-protein-arginine ADP-ribosyltransferase activity(GO:0003956) |
| 0.2 | 1.6 | GO:0008430 | selenium binding(GO:0008430) |
| 0.2 | 0.6 | GO:0004427 | inorganic diphosphatase activity(GO:0004427) |
| 0.2 | 0.8 | GO:0051575 | 5'-deoxyribose-5-phosphate lyase activity(GO:0051575) |
| 0.2 | 0.6 | GO:0071987 | WD40-repeat domain binding(GO:0071987) |
| 0.2 | 0.8 | GO:0015375 | glycine:sodium symporter activity(GO:0015375) |
| 0.2 | 4.0 | GO:0051019 | mitogen-activated protein kinase binding(GO:0051019) |
| 0.2 | 0.6 | GO:0016941 | natriuretic peptide receptor activity(GO:0016941) |
| 0.2 | 2.3 | GO:0034573 | protein-N-terminal asparagine amidohydrolase activity(GO:0008418) UDP-3-O-[3-hydroxymyristoyl] N-acetylglucosamine deacetylase activity(GO:0008759) iprodione amidohydrolase activity(GO:0018748) (3,5-dichlorophenylurea)acetate amidohydrolase activity(GO:0018749) 4'-(2-hydroxyisopropyl)phenylurea amidohydrolase activity(GO:0034571) didemethylisoproturon amidohydrolase activity(GO:0034573) N-isopropylacetanilide amidohydrolase activity(GO:0034576) N-cyclohexylformamide amidohydrolase activity(GO:0034781) isonicotinic acid hydrazide hydrolase activity(GO:0034876) cis-aconitamide amidase activity(GO:0034882) gamma-N-formylaminovinylacetate hydrolase activity(GO:0034885) N2-acetyl-L-lysine deacetylase activity(GO:0043747) O-succinylbenzoate synthase activity(GO:0043748) indoleacetamide hydrolase activity(GO:0043864) N-acetylcitrulline deacetylase activity(GO:0043909) N-acetylgalactosamine-6-phosphate deacetylase activity(GO:0047419) diacetylchitobiose deacetylase activity(GO:0052773) chitooligosaccharide deacetylase activity(GO:0052790) |
| 0.2 | 1.3 | GO:0016494 | C-X-C chemokine receptor activity(GO:0016494) |
| 0.2 | 0.9 | GO:0070492 | oligosaccharide binding(GO:0070492) |
| 0.2 | 0.7 | GO:0016833 | oxo-acid-lyase activity(GO:0016833) |
| 0.2 | 0.9 | GO:0015379 | potassium:chloride symporter activity(GO:0015379) potassium ion symporter activity(GO:0022820) |
| 0.2 | 1.1 | GO:0005225 | volume-sensitive anion channel activity(GO:0005225) |
| 0.2 | 0.2 | GO:0051380 | norepinephrine binding(GO:0051380) |
| 0.2 | 0.7 | GO:0008532 | N-acetyllactosaminide beta-1,3-N-acetylglucosaminyltransferase activity(GO:0008532) |
| 0.2 | 1.1 | GO:0008508 | bile acid:sodium symporter activity(GO:0008508) |
| 0.2 | 0.7 | GO:0004060 | arylamine N-acetyltransferase activity(GO:0004060) |
| 0.2 | 2.2 | GO:0010181 | FMN binding(GO:0010181) |
| 0.2 | 2.0 | GO:0001222 | transcription corepressor binding(GO:0001222) |
| 0.2 | 0.7 | GO:0005534 | galactose binding(GO:0005534) |
| 0.2 | 1.6 | GO:0015149 | hexose transmembrane transporter activity(GO:0015149) |
| 0.2 | 0.5 | GO:0071553 | uridine nucleotide receptor activity(GO:0015065) G-protein coupled pyrimidinergic nucleotide receptor activity(GO:0071553) |
| 0.2 | 0.7 | GO:0030306 | ADP-ribosylation factor binding(GO:0030306) |
| 0.2 | 1.8 | GO:0019841 | retinol binding(GO:0019841) |
| 0.2 | 4.6 | GO:0016831 | carboxy-lyase activity(GO:0016831) |
| 0.2 | 0.5 | GO:0004345 | glucose-6-phosphate dehydrogenase activity(GO:0004345) |
| 0.2 | 0.5 | GO:0015377 | cation:chloride symporter activity(GO:0015377) |
| 0.2 | 1.2 | GO:0098505 | G-rich strand telomeric DNA binding(GO:0098505) |
| 0.2 | 0.9 | GO:0001758 | retinal dehydrogenase activity(GO:0001758) |
| 0.2 | 0.3 | GO:0022858 | L-alanine transmembrane transporter activity(GO:0015180) alanine transmembrane transporter activity(GO:0022858) |
| 0.2 | 1.0 | GO:0050733 | RS domain binding(GO:0050733) |
| 0.2 | 0.9 | GO:0015165 | pyrimidine nucleotide-sugar transmembrane transporter activity(GO:0015165) |
| 0.2 | 3.7 | GO:0005547 | phosphatidylinositol-3,4,5-trisphosphate binding(GO:0005547) |
| 0.2 | 1.2 | GO:0036310 | annealing helicase activity(GO:0036310) |
| 0.2 | 0.7 | GO:0000213 | tRNA-intron endonuclease activity(GO:0000213) |
| 0.2 | 0.2 | GO:0035651 | AP-3 adaptor complex binding(GO:0035651) |
| 0.2 | 0.8 | GO:0019871 | sodium channel inhibitor activity(GO:0019871) |
| 0.2 | 0.5 | GO:2001070 | starch binding(GO:2001070) |
| 0.2 | 0.5 | GO:0051431 | corticotropin-releasing hormone receptor 2 binding(GO:0051431) |
| 0.2 | 0.7 | GO:0017176 | phosphatidylinositol N-acetylglucosaminyltransferase activity(GO:0017176) |
| 0.2 | 2.9 | GO:0004198 | calcium-dependent cysteine-type endopeptidase activity(GO:0004198) |
| 0.2 | 0.7 | GO:0003696 | satellite DNA binding(GO:0003696) |
| 0.2 | 3.9 | GO:0046875 | ephrin receptor binding(GO:0046875) |
| 0.2 | 2.1 | GO:0016780 | phosphotransferase activity, for other substituted phosphate groups(GO:0016780) |
| 0.2 | 2.3 | GO:0035259 | glucocorticoid receptor binding(GO:0035259) |
| 0.2 | 1.0 | GO:0015288 | porin activity(GO:0015288) |
| 0.2 | 1.3 | GO:0008239 | dipeptidyl-peptidase activity(GO:0008239) |
| 0.2 | 0.2 | GO:0030523 | S-acetyltransferase activity(GO:0016418) dihydrolipoamide S-acyltransferase activity(GO:0030523) |
| 0.2 | 0.5 | GO:0005483 | soluble NSF attachment protein activity(GO:0005483) |
| 0.2 | 0.2 | GO:0035276 | ethanol binding(GO:0035276) |
| 0.2 | 0.3 | GO:0061676 | importin-alpha family protein binding(GO:0061676) |
| 0.2 | 2.4 | GO:0016863 | intramolecular oxidoreductase activity, transposing C=C bonds(GO:0016863) |
| 0.2 | 2.1 | GO:0043236 | laminin binding(GO:0043236) |
| 0.2 | 3.7 | GO:0003887 | DNA-directed DNA polymerase activity(GO:0003887) |
| 0.2 | 0.8 | GO:0032050 | clathrin heavy chain binding(GO:0032050) |
| 0.2 | 0.5 | GO:0000171 | ribonuclease MRP activity(GO:0000171) |
| 0.2 | 0.5 | GO:0019862 | IgA binding(GO:0019862) |
| 0.2 | 0.5 | GO:0016802 | adenosylhomocysteinase activity(GO:0004013) trialkylsulfonium hydrolase activity(GO:0016802) |
| 0.2 | 4.3 | GO:0043734 | DNA-N1-methyladenine dioxygenase activity(GO:0043734) |
| 0.2 | 1.1 | GO:0017070 | U6 snRNA binding(GO:0017070) |
| 0.2 | 0.8 | GO:0030292 | protein tyrosine kinase inhibitor activity(GO:0030292) |
| 0.2 | 0.8 | GO:0097642 | calcitonin family receptor activity(GO:0097642) |
| 0.2 | 0.8 | GO:1990239 | steroid hormone binding(GO:1990239) |
| 0.2 | 1.1 | GO:0034450 | ubiquitin-ubiquitin ligase activity(GO:0034450) |
| 0.2 | 0.5 | GO:0016744 | transferase activity, transferring aldehyde or ketonic groups(GO:0016744) |
| 0.2 | 0.5 | GO:1990715 | mRNA CDS binding(GO:1990715) |
| 0.2 | 0.5 | GO:0032452 | histone demethylase activity(GO:0032452) |
| 0.2 | 0.2 | GO:0055131 | C3HC4-type RING finger domain binding(GO:0055131) |
| 0.2 | 0.3 | GO:0031014 | troponin T binding(GO:0031014) |
| 0.2 | 0.9 | GO:0008484 | sulfuric ester hydrolase activity(GO:0008484) |
| 0.2 | 3.6 | GO:0017091 | AU-rich element binding(GO:0017091) |
| 0.2 | 0.6 | GO:0047238 | glucuronosyl-N-acetylgalactosaminyl-proteoglycan 4-beta-N-acetylgalactosaminyltransferase activity(GO:0047238) |
| 0.1 | 0.4 | GO:0019855 | calcium channel inhibitor activity(GO:0019855) |
| 0.1 | 0.4 | GO:0008321 | Ral guanyl-nucleotide exchange factor activity(GO:0008321) |
| 0.1 | 0.4 | GO:0042030 | ATPase inhibitor activity(GO:0042030) |
| 0.1 | 0.6 | GO:0005105 | type 1 fibroblast growth factor receptor binding(GO:0005105) |
| 0.1 | 0.4 | GO:0004619 | bisphosphoglycerate mutase activity(GO:0004082) phosphoglycerate mutase activity(GO:0004619) 2,3-bisphosphoglycerate-dependent phosphoglycerate mutase activity(GO:0046538) |
| 0.1 | 0.4 | GO:0015440 | peptide-transporting ATPase activity(GO:0015440) |
| 0.1 | 1.3 | GO:0015385 | sodium:proton antiporter activity(GO:0015385) potassium:proton antiporter activity(GO:0015386) |
| 0.1 | 0.4 | GO:0046923 | ER retention sequence binding(GO:0046923) |
| 0.1 | 1.3 | GO:0001618 | virus receptor activity(GO:0001618) |
| 0.1 | 6.7 | GO:0004197 | cysteine-type endopeptidase activity(GO:0004197) |
| 0.1 | 1.6 | GO:0005123 | death receptor binding(GO:0005123) |
| 0.1 | 0.7 | GO:0051920 | peroxiredoxin activity(GO:0051920) |
| 0.1 | 1.0 | GO:0047372 | acylglycerol lipase activity(GO:0047372) |
| 0.1 | 0.3 | GO:1990829 | C-rich single-stranded DNA binding(GO:1990829) |
| 0.1 | 0.4 | GO:0031432 | titin binding(GO:0031432) |
| 0.1 | 0.9 | GO:0004768 | stearoyl-CoA 9-desaturase activity(GO:0004768) |
| 0.1 | 0.3 | GO:0043426 | MRF binding(GO:0043426) |
| 0.1 | 0.4 | GO:0070034 | telomerase RNA binding(GO:0070034) |
| 0.1 | 4.1 | GO:0017112 | Rab guanyl-nucleotide exchange factor activity(GO:0017112) |
| 0.1 | 0.4 | GO:0004735 | pyrroline-5-carboxylate reductase activity(GO:0004735) |
| 0.1 | 0.6 | GO:0008349 | MAP kinase kinase kinase kinase activity(GO:0008349) |
| 0.1 | 0.4 | GO:0036435 | K48-linked polyubiquitin binding(GO:0036435) |
| 0.1 | 6.6 | GO:0048306 | calcium-dependent protein binding(GO:0048306) |
| 0.1 | 0.6 | GO:0042289 | MHC class II protein binding(GO:0042289) |
| 0.1 | 0.3 | GO:0071074 | eukaryotic initiation factor eIF2 binding(GO:0071074) |
| 0.1 | 0.3 | GO:0015216 | adenine nucleotide transmembrane transporter activity(GO:0000295) purine ribonucleotide transmembrane transporter activity(GO:0005346) purine nucleotide transmembrane transporter activity(GO:0015216) |
| 0.1 | 1.4 | GO:0005247 | voltage-gated chloride channel activity(GO:0005247) |
| 0.1 | 2.7 | GO:0030215 | semaphorin receptor binding(GO:0030215) |
| 0.1 | 0.1 | GO:0005451 | monovalent cation:proton antiporter activity(GO:0005451) |
| 0.1 | 0.3 | GO:0048018 | receptor agonist activity(GO:0048018) |
| 0.1 | 0.9 | GO:0005092 | GDP-dissociation inhibitor activity(GO:0005092) |
| 0.1 | 0.3 | GO:0046975 | histone methyltransferase activity (H3-K36 specific)(GO:0046975) |
| 0.1 | 0.5 | GO:0008526 | phosphatidylinositol transporter activity(GO:0008526) |
| 0.1 | 0.3 | GO:0034711 | inhibin binding(GO:0034711) |
| 0.1 | 0.9 | GO:0004579 | dolichyl-diphosphooligosaccharide-protein glycotransferase activity(GO:0004579) |
| 0.1 | 0.4 | GO:0030492 | hemoglobin binding(GO:0030492) |
| 0.1 | 0.9 | GO:0034071 | cobinamide kinase activity(GO:0008819) phytol kinase activity(GO:0010276) phenol kinase activity(GO:0018720) cyclin-dependent protein kinase activating kinase regulator activity(GO:0019914) inositol tetrakisphosphate 2-kinase activity(GO:0032942) heptose 7-phosphate kinase activity(GO:0033785) aminoglycoside phosphotransferase activity(GO:0034071) eukaryotic elongation factor-2 kinase regulator activity(GO:0042556) eukaryotic elongation factor-2 kinase activator activity(GO:0042557) LPPG:FO 2-phospho-L-lactate transferase activity(GO:0043743) cytidine kinase activity(GO:0043771) glycerate 2-kinase activity(GO:0043798) (S)-lactate 2-kinase activity(GO:0043841) phosphoserine:homoserine phosphotransferase activity(GO:0043899) L-seryl-tRNA(Sec) kinase activity(GO:0043915) phosphocholine transferase activity(GO:0044605) GTP-dependent polynucleotide kinase activity(GO:0051735) farnesol kinase activity(GO:0052668) CTP:2-trans,-6-trans-farnesol kinase activity(GO:0052669) geraniol kinase activity(GO:0052670) geranylgeraniol kinase activity(GO:0052671) CTP:geranylgeraniol kinase activity(GO:0052672) prenol kinase activity(GO:0052673) 1-phosphatidylinositol-5-kinase activity(GO:0052810) 1-phosphatidylinositol-3-phosphate 4-kinase activity(GO:0052811) phosphatidylinositol-3,4-bisphosphate 5-kinase activity(GO:0052812) inositol-3,4,6-trisphosphate 1-kinase activity(GO:0052835) inositol 5-diphosphate pentakisphosphate 5-kinase activity(GO:0052836) inositol diphosphate tetrakisphosphate kinase activity(GO:0052839) |
| 0.1 | 0.1 | GO:0045340 | mercury ion binding(GO:0045340) |
| 0.1 | 0.4 | GO:0050309 | glucose-6-phosphatase activity(GO:0004346) sugar-terminal-phosphatase activity(GO:0050309) |
| 0.1 | 0.4 | GO:0016868 | intramolecular transferase activity, phosphotransferases(GO:0016868) |
| 0.1 | 0.5 | GO:0004563 | beta-N-acetylhexosaminidase activity(GO:0004563) |
| 0.1 | 0.5 | GO:0052832 | inositol monophosphate 1-phosphatase activity(GO:0008934) inositol monophosphate 3-phosphatase activity(GO:0052832) inositol monophosphate 4-phosphatase activity(GO:0052833) inositol monophosphate phosphatase activity(GO:0052834) |
| 0.1 | 1.5 | GO:0015643 | toxic substance binding(GO:0015643) |
| 0.1 | 1.4 | GO:0043274 | phospholipase binding(GO:0043274) |
| 0.1 | 6.3 | GO:0000979 | RNA polymerase II core promoter sequence-specific DNA binding(GO:0000979) |
| 0.1 | 0.3 | GO:0042895 | antibiotic transporter activity(GO:0042895) |
| 0.1 | 0.1 | GO:0004694 | eukaryotic translation initiation factor 2alpha kinase activity(GO:0004694) |
| 0.1 | 1.0 | GO:0015174 | basic amino acid transmembrane transporter activity(GO:0015174) |
| 0.1 | 1.3 | GO:0070180 | large ribosomal subunit rRNA binding(GO:0070180) |
| 0.1 | 0.5 | GO:0042015 | interleukin-20 binding(GO:0042015) |
| 0.1 | 0.4 | GO:0004359 | glutaminase activity(GO:0004359) |
| 0.1 | 0.6 | GO:0008199 | ferric iron binding(GO:0008199) |
| 0.1 | 3.4 | GO:0048487 | beta-tubulin binding(GO:0048487) |
| 0.1 | 0.7 | GO:0061505 | DNA topoisomerase type II (ATP-hydrolyzing) activity(GO:0003918) DNA topoisomerase II activity(GO:0061505) |
| 0.1 | 2.3 | GO:0015301 | anion:anion antiporter activity(GO:0015301) |
| 0.1 | 0.2 | GO:0051765 | inositol tetrakisphosphate kinase activity(GO:0051765) |
| 0.1 | 0.4 | GO:0004995 | tachykinin receptor activity(GO:0004995) |
| 0.1 | 0.5 | GO:0030942 | endoplasmic reticulum signal peptide binding(GO:0030942) |
| 0.1 | 0.4 | GO:0038132 | neuregulin binding(GO:0038132) |
| 0.1 | 0.4 | GO:0035174 | histone serine kinase activity(GO:0035174) |
| 0.1 | 3.8 | GO:0016712 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, reduced flavin or flavoprotein as one donor, and incorporation of one atom of oxygen(GO:0016712) |
| 0.1 | 2.9 | GO:0051879 | Hsp90 protein binding(GO:0051879) |
| 0.1 | 0.5 | GO:0004558 | alpha-1,4-glucosidase activity(GO:0004558) |
| 0.1 | 1.2 | GO:0016713 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, reduced iron-sulfur protein as one donor, and incorporation of one atom of oxygen(GO:0016713) |
| 0.1 | 0.6 | GO:0031419 | cobalamin binding(GO:0031419) |
| 0.1 | 0.6 | GO:0070728 | leucine binding(GO:0070728) |
| 0.1 | 0.4 | GO:0004430 | 1-phosphatidylinositol 4-kinase activity(GO:0004430) |
| 0.1 | 0.1 | GO:0019912 | cyclin-dependent protein kinase activating kinase activity(GO:0019912) |
| 0.1 | 0.9 | GO:0031996 | thioesterase binding(GO:0031996) |
| 0.1 | 0.6 | GO:0060229 | phospholipase activator activity(GO:0016004) lipase activator activity(GO:0060229) |
| 0.1 | 2.7 | GO:0070888 | E-box binding(GO:0070888) |
| 0.1 | 1.2 | GO:0043539 | protein serine/threonine kinase activator activity(GO:0043539) |
| 0.1 | 0.5 | GO:0000400 | four-way junction DNA binding(GO:0000400) |
| 0.1 | 2.3 | GO:0016769 | transferase activity, transferring nitrogenous groups(GO:0016769) |
| 0.1 | 0.5 | GO:0004028 | 3-chloroallyl aldehyde dehydrogenase activity(GO:0004028) |
| 0.1 | 1.0 | GO:0019200 | carbohydrate kinase activity(GO:0019200) |
| 0.1 | 0.1 | GO:0051373 | FATZ binding(GO:0051373) |
| 0.1 | 0.4 | GO:0032184 | SUMO polymer binding(GO:0032184) |
| 0.1 | 0.7 | GO:0001727 | lipid kinase activity(GO:0001727) |
| 0.1 | 0.4 | GO:0055102 | lipase inhibitor activity(GO:0055102) |
| 0.1 | 0.3 | GO:0017151 | DEAD/H-box RNA helicase binding(GO:0017151) |
| 0.1 | 0.2 | GO:0047045 | testosterone 17-beta-dehydrogenase (NADP+) activity(GO:0047045) |
| 0.1 | 0.2 | GO:0016822 | hydrolase activity, acting on acid carbon-carbon bonds(GO:0016822) hydrolase activity, acting on acid carbon-carbon bonds, in ketonic substances(GO:0016823) |
| 0.1 | 5.3 | GO:0031490 | chromatin DNA binding(GO:0031490) |
| 0.1 | 0.3 | GO:0030280 | structural constituent of epidermis(GO:0030280) |
| 0.1 | 0.4 | GO:0019136 | deoxynucleoside kinase activity(GO:0019136) |
| 0.1 | 0.2 | GO:0016509 | long-chain-3-hydroxyacyl-CoA dehydrogenase activity(GO:0016509) |
| 0.1 | 1.3 | GO:0016641 | oxidoreductase activity, acting on the CH-NH2 group of donors, oxygen as acceptor(GO:0016641) |
| 0.1 | 0.1 | GO:0034714 | type III transforming growth factor beta receptor binding(GO:0034714) |
| 0.1 | 2.9 | GO:0050699 | WW domain binding(GO:0050699) |
| 0.1 | 1.0 | GO:0004622 | lysophospholipase activity(GO:0004622) |
| 0.1 | 0.8 | GO:0003841 | 1-acylglycerol-3-phosphate O-acyltransferase activity(GO:0003841) |
| 0.1 | 0.1 | GO:0001134 | transcription factor activity, transcription factor recruiting(GO:0001134) |
| 0.1 | 1.4 | GO:0050681 | androgen receptor binding(GO:0050681) |
| 0.1 | 0.2 | GO:0051022 | Rho GDP-dissociation inhibitor binding(GO:0051022) |
| 0.1 | 0.7 | GO:0008113 | peptide-methionine (S)-S-oxide reductase activity(GO:0008113) |
| 0.1 | 0.8 | GO:0016929 | SUMO-specific protease activity(GO:0016929) |
| 0.1 | 0.1 | GO:0010521 | telomerase inhibitor activity(GO:0010521) |
| 0.1 | 0.6 | GO:0004311 | farnesyltranstransferase activity(GO:0004311) |
| 0.1 | 0.3 | GO:0031749 | D2 dopamine receptor binding(GO:0031749) |
| 0.1 | 1.3 | GO:0017128 | phospholipid scramblase activity(GO:0017128) |
| 0.1 | 0.4 | GO:0004305 | ethanolamine kinase activity(GO:0004305) |
| 0.1 | 0.3 | GO:0045134 | uridine-diphosphatase activity(GO:0045134) |
| 0.1 | 0.4 | GO:0004062 | aryl sulfotransferase activity(GO:0004062) |
| 0.1 | 0.3 | GO:0008107 | galactoside 2-alpha-L-fucosyltransferase activity(GO:0008107) alpha-(1,2)-fucosyltransferase activity(GO:0031127) |
| 0.1 | 0.1 | GO:0050220 | prostaglandin-E synthase activity(GO:0050220) |
| 0.1 | 0.1 | GO:0015038 | glutathione disulfide oxidoreductase activity(GO:0015038) |
| 0.1 | 1.7 | GO:0008139 | nuclear localization sequence binding(GO:0008139) |
| 0.1 | 0.2 | GO:0019107 | myristoyltransferase activity(GO:0019107) |
| 0.1 | 0.9 | GO:0004568 | chitinase activity(GO:0004568) |
| 0.1 | 0.4 | GO:0016401 | palmitoyl-CoA oxidase activity(GO:0016401) |
| 0.1 | 0.3 | GO:0005095 | GTPase inhibitor activity(GO:0005095) |
| 0.1 | 1.3 | GO:0030276 | clathrin binding(GO:0030276) |
| 0.1 | 1.3 | GO:0017056 | structural constituent of nuclear pore(GO:0017056) |
| 0.1 | 0.5 | GO:0031434 | mitogen-activated protein kinase kinase binding(GO:0031434) |
| 0.1 | 0.2 | GO:0015252 | hydrogen ion channel activity(GO:0015252) |
| 0.1 | 1.1 | GO:0070577 | lysine-acetylated histone binding(GO:0070577) |
| 0.1 | 1.2 | GO:0070491 | repressing transcription factor binding(GO:0070491) |
| 0.1 | 0.2 | GO:0036033 | mediator complex binding(GO:0036033) |
| 0.1 | 1.1 | GO:0048038 | quinone binding(GO:0048038) |
| 0.1 | 0.1 | GO:0005415 | nucleoside:sodium symporter activity(GO:0005415) |
| 0.1 | 3.2 | GO:0051287 | NAD binding(GO:0051287) |
| 0.1 | 2.0 | GO:0016799 | hydrolase activity, hydrolyzing N-glycosyl compounds(GO:0016799) |
| 0.1 | 0.4 | GO:0004565 | beta-galactosidase activity(GO:0004565) |
| 0.1 | 0.4 | GO:0000983 | transcription factor activity, RNA polymerase II core promoter sequence-specific(GO:0000983) |
| 0.1 | 4.6 | GO:0003697 | single-stranded DNA binding(GO:0003697) |
| 0.1 | 0.3 | GO:0004616 | phosphogluconate dehydrogenase (decarboxylating) activity(GO:0004616) |
| 0.1 | 0.7 | GO:0016175 | superoxide-generating NADPH oxidase activity(GO:0016175) |
| 0.1 | 0.3 | GO:1990226 | histone methyltransferase binding(GO:1990226) |
| 0.1 | 0.1 | GO:0033300 | dehydroascorbic acid transporter activity(GO:0033300) |
| 0.1 | 1.2 | GO:0010485 | H4 histone acetyltransferase activity(GO:0010485) |
| 0.1 | 0.7 | GO:0019213 | deacetylase activity(GO:0019213) |
| 0.1 | 0.5 | GO:0031078 | histone deacetylase activity (H3-K14 specific)(GO:0031078) NAD-dependent histone deacetylase activity (H3-K14 specific)(GO:0032041) |
| 0.1 | 0.5 | GO:0008097 | 5S rRNA binding(GO:0008097) |
| 0.1 | 1.2 | GO:0042162 | telomeric DNA binding(GO:0042162) |
| 0.1 | 0.4 | GO:0005499 | vitamin D binding(GO:0005499) |
| 0.1 | 0.3 | GO:0070815 | procollagen-lysine 5-dioxygenase activity(GO:0008475) peptidyl-lysine 5-dioxygenase activity(GO:0070815) |
| 0.1 | 2.1 | GO:0030295 | protein kinase activator activity(GO:0030295) |
| 0.1 | 0.3 | GO:0047074 | 2,3-dihydroxy DDT 1,2-dioxygenase activity(GO:0018542) phenanthrene dioxygenase activity(GO:0018555) 2,2',3-trihydroxybiphenyl dioxygenase activity(GO:0018556) 1,2-dihydroxyfluorene 1,1-alpha-dioxygenase activity(GO:0018557) 5,6-dihydroxy-3-methyl-2-oxo-1,2-dihydroquinoline dioxygenase activity(GO:0018558) 1,1-dichloro-2-(dihydroxy-4-chlorophenyl)-(4-chlorophenyl)ethene 1,2-dioxygenase activity(GO:0018559) protocatechuate 3,4-dioxygenase type II activity(GO:0018560) 2'-aminobiphenyl-2,3-diol 1,2-dioxygenase activity(GO:0018561) 3,4-dihydroxyfluorene 4,4-alpha-dioxygenase activity(GO:0018562) 2,3-dihydroxy-ethylbenzene 1,2-dioxygenase activity(GO:0018563) carbazole 1,9a-dioxygenase activity(GO:0018564) dihydroxydibenzothiophene dioxygenase activity(GO:0018565) 1,2-dihydroxynaphthalene-6-sulfonate 1,8a-dioxygenase activity(GO:0018566) styrene dioxygenase activity(GO:0018567) 3,4-dihydroxyphenanthrene dioxygenase activity(GO:0018568) hydroquinone 1,2-dioxygenase activity(GO:0018569) p-cumate 2,3-dioxygenase activity(GO:0018570) 2,3-dihydroxy-p-cumate dioxygenase activity(GO:0018571) 3,5-dichlorocatechol 1,2-dioxygenase activity(GO:0018572) 2-aminophenol 1,6-dioxygenase activity(GO:0018573) 2,6-dichloro-p-hydroquinone 1,2-dioxygenase activity(GO:0018574) chlorocatechol 1,2-dioxygenase activity(GO:0018575) catechol dioxygenase activity(GO:0019114) dihydroxyfluorene dioxygenase activity(GO:0019117) 5-aminosalicylate dioxygenase activity(GO:0034543) 3-hydroxy-2-naphthoate 2,3-dioxygenase activity(GO:0034803) benzo(a)pyrene 11,12-dioxygenase activity(GO:0034806) benzo(a)pyrene 4,5-dioxygenase activity(GO:0034808) 4,5-dihydroxybenzo(a)pyrene dioxygenase activity(GO:0034810) benzo(a)pyrene 9,10-dioxygenase activity(GO:0034811) 9,10-dihydroxybenzo(a)pyrene dioxygenase activity(GO:0034812) benzo(a)pyrene 7,8-dioxygenase activity(GO:0034813) 7,8-dihydroxy benzo(a)pyrene dioxygenase activity(GO:0034814) 1,2-dihydroxy-5,6,7,8-tetrahydronaphthalene extradiol dioxygenase activity(GO:0034827) 2-mercaptobenzothiazole dioxygenase activity(GO:0034834) pyridine-3,4-diol dioxygenase activity(GO:0034895) pyrene dioxygenase activity(GO:0034920) 4,5-dihydroxypyrene dioxygenase activity(GO:0034922) phenanthrene-4-carboxylate dioxygenase activity(GO:0034934) tetrachlorobenzene dioxygenase activity(GO:0034935) 4,6-dichloro-3-methylcatechol 1,2-dioxygenase activity(GO:0034936) 2,3-dihydroxydiphenyl ether dioxygenase activity(GO:0034955) diphenyl ether 1,2-dioxygenase activity(GO:0034956) arachidonate 8(S)-lipoxygenase activity(GO:0036403) 4-hydroxycatechol 1,2-dioxygenase activity(GO:0047074) |
| 0.1 | 1.7 | GO:0050661 | NADP binding(GO:0050661) |
| 0.1 | 0.3 | GO:0061731 | ribonucleoside-diphosphate reductase activity, thioredoxin disulfide as acceptor(GO:0004748) oxidoreductase activity, acting on CH or CH2 groups, disulfide as acceptor(GO:0016728) ribonucleoside-diphosphate reductase activity(GO:0061731) |
| 0.1 | 0.4 | GO:0003906 | DNA-(apurinic or apyrimidinic site) lyase activity(GO:0003906) |
| 0.1 | 0.3 | GO:0042392 | sphingosine-1-phosphate phosphatase activity(GO:0042392) |
| 0.1 | 0.3 | GO:0019203 | carbohydrate phosphatase activity(GO:0019203) |
| 0.1 | 0.4 | GO:0043295 | glutathione binding(GO:0043295) oligopeptide binding(GO:1900750) |
| 0.1 | 1.2 | GO:0070008 | serine-type exopeptidase activity(GO:0070008) |
| 0.1 | 0.5 | GO:0008420 | CTD phosphatase activity(GO:0008420) |
| 0.1 | 1.0 | GO:0001730 | 2'-5'-oligoadenylate synthetase activity(GO:0001730) |
| 0.1 | 0.4 | GO:0005143 | interleukin-12 receptor binding(GO:0005143) |
| 0.1 | 2.7 | GO:0005044 | scavenger receptor activity(GO:0005044) |
| 0.1 | 1.8 | GO:0016675 | oxidoreductase activity, acting on a heme group of donors(GO:0016675) |
| 0.1 | 0.5 | GO:0035381 | extracellular ATP-gated cation channel activity(GO:0004931) ATP-gated ion channel activity(GO:0035381) |
| 0.1 | 0.3 | GO:0050567 | glutaminyl-tRNA synthase (glutamine-hydrolyzing) activity(GO:0050567) |
| 0.1 | 2.4 | GO:0004402 | histone acetyltransferase activity(GO:0004402) |
| 0.1 | 0.5 | GO:0008454 | alpha-1,3-mannosylglycoprotein 4-beta-N-acetylglucosaminyltransferase activity(GO:0008454) |
| 0.1 | 2.0 | GO:0001540 | beta-amyloid binding(GO:0001540) |
| 0.1 | 1.6 | GO:0050136 | NADH dehydrogenase (ubiquinone) activity(GO:0008137) NADH dehydrogenase (quinone) activity(GO:0050136) |
| 0.1 | 0.4 | GO:0015450 | P-P-bond-hydrolysis-driven protein transmembrane transporter activity(GO:0015450) |
| 0.1 | 0.6 | GO:0098599 | palmitoyl-(protein) hydrolase activity(GO:0008474) palmitoyl hydrolase activity(GO:0098599) |
| 0.1 | 0.4 | GO:0000182 | rDNA binding(GO:0000182) |
| 0.1 | 0.7 | GO:0034987 | immunoglobulin receptor binding(GO:0034987) |
| 0.1 | 0.3 | GO:0004385 | guanylate kinase activity(GO:0004385) |
| 0.1 | 0.3 | GO:0004967 | glucagon receptor activity(GO:0004967) |
| 0.1 | 1.2 | GO:0018024 | histone-lysine N-methyltransferase activity(GO:0018024) |
| 0.1 | 0.2 | GO:0016262 | protein N-acetylglucosaminyltransferase activity(GO:0016262) |
| 0.1 | 0.4 | GO:0031685 | adenosine receptor binding(GO:0031685) |
| 0.1 | 0.7 | GO:0019206 | nucleoside kinase activity(GO:0019206) |
| 0.1 | 0.1 | GO:0036122 | BMP binding(GO:0036122) |
| 0.1 | 0.4 | GO:0017127 | cholesterol transporter activity(GO:0017127) |
| 0.1 | 0.4 | GO:0043495 | protein anchor(GO:0043495) |
| 0.1 | 0.4 | GO:0070891 | lipoteichoic acid binding(GO:0070891) |
| 0.1 | 0.6 | GO:0008266 | poly(U) RNA binding(GO:0008266) |
| 0.1 | 0.3 | GO:0004793 | threonine aldolase activity(GO:0004793) L-allo-threonine aldolase activity(GO:0008732) |
| 0.1 | 0.2 | GO:0019788 | NEDD8 transferase activity(GO:0019788) |
| 0.1 | 0.4 | GO:0030274 | LIM domain binding(GO:0030274) |
| 0.1 | 0.7 | GO:0016886 | ligase activity, forming phosphoric ester bonds(GO:0016886) |
| 0.1 | 15.3 | GO:0003735 | structural constituent of ribosome(GO:0003735) |
| 0.1 | 0.3 | GO:0004980 | melanocyte-stimulating hormone receptor activity(GO:0004980) |
| 0.1 | 0.3 | GO:0017089 | glycolipid transporter activity(GO:0017089) |
| 0.1 | 0.9 | GO:0016500 | protein-hormone receptor activity(GO:0016500) |
| 0.1 | 1.1 | GO:1990939 | ATP-dependent microtubule motor activity(GO:1990939) |
| 0.1 | 0.2 | GO:0015037 | peptide disulfide oxidoreductase activity(GO:0015037) |
| 0.1 | 0.3 | GO:0047756 | chondroitin 4-sulfotransferase activity(GO:0047756) |
| 0.1 | 0.4 | GO:0016634 | oxidoreductase activity, acting on the CH-CH group of donors, oxygen as acceptor(GO:0016634) |
| 0.1 | 0.4 | GO:0042301 | phosphate ion binding(GO:0042301) |
| 0.1 | 0.2 | GO:0032027 | myosin light chain binding(GO:0032027) |
| 0.1 | 2.4 | GO:0017046 | peptide hormone binding(GO:0017046) |
| 0.1 | 0.3 | GO:0005332 | gamma-aminobutyric acid:sodium symporter activity(GO:0005332) |
| 0.1 | 0.3 | GO:0043024 | ribosomal small subunit binding(GO:0043024) |
| 0.1 | 0.2 | GO:0015280 | ligand-gated sodium channel activity(GO:0015280) |
| 0.1 | 0.4 | GO:0016742 | hydroxymethyl-, formyl- and related transferase activity(GO:0016742) |
| 0.1 | 1.3 | GO:0008157 | protein phosphatase 1 binding(GO:0008157) |
| 0.1 | 0.4 | GO:0016248 | channel inhibitor activity(GO:0016248) |
| 0.1 | 1.5 | GO:0016765 | transferase activity, transferring alkyl or aryl (other than methyl) groups(GO:0016765) |
| 0.1 | 0.4 | GO:0032554 | purine deoxyribonucleotide binding(GO:0032554) |
| 0.1 | 0.1 | GO:1904288 | BAT3 complex binding(GO:1904288) |
| 0.1 | 0.2 | GO:0031826 | type 2A serotonin receptor binding(GO:0031826) |
| 0.1 | 0.4 | GO:0004415 | hyalurononglucosaminidase activity(GO:0004415) |
| 0.1 | 0.1 | GO:0055100 | adiponectin binding(GO:0055100) |
| 0.1 | 0.8 | GO:0017160 | Ral GTPase binding(GO:0017160) |
| 0.1 | 0.5 | GO:0050656 | 3'-phosphoadenosine 5'-phosphosulfate binding(GO:0050656) |
| 0.1 | 0.5 | GO:0008429 | phosphatidylethanolamine binding(GO:0008429) |
| 0.1 | 0.1 | GO:0008332 | low voltage-gated calcium channel activity(GO:0008332) |
| 0.1 | 0.1 | GO:0030160 | GKAP/Homer scaffold activity(GO:0030160) |
| 0.1 | 3.5 | GO:0003743 | translation initiation factor activity(GO:0003743) |
| 0.1 | 1.3 | GO:0051537 | 2 iron, 2 sulfur cluster binding(GO:0051537) |
| 0.1 | 0.3 | GO:0046703 | natural killer cell lectin-like receptor binding(GO:0046703) |
| 0.1 | 0.1 | GO:0043423 | 3-phosphoinositide-dependent protein kinase binding(GO:0043423) |
| 0.1 | 2.5 | GO:0005109 | frizzled binding(GO:0005109) |
| 0.1 | 0.4 | GO:0008494 | translation activator activity(GO:0008494) |
| 0.1 | 0.2 | GO:0031493 | nucleosomal histone binding(GO:0031493) |
| 0.1 | 0.2 | GO:1990460 | leptin receptor binding(GO:1990460) |
| 0.1 | 0.6 | GO:0004806 | triglyceride lipase activity(GO:0004806) |
| 0.1 | 1.2 | GO:0004712 | protein serine/threonine/tyrosine kinase activity(GO:0004712) |
| 0.1 | 0.3 | GO:0015272 | ATP-activated inward rectifier potassium channel activity(GO:0015272) |
| 0.1 | 1.5 | GO:0005548 | phospholipid transporter activity(GO:0005548) |
| 0.1 | 2.0 | GO:0005507 | copper ion binding(GO:0005507) |
| 0.1 | 2.8 | GO:0051117 | ATPase binding(GO:0051117) |
| 0.1 | 0.8 | GO:0005521 | lamin binding(GO:0005521) |
| 0.1 | 0.3 | GO:0005402 | sugar:proton symporter activity(GO:0005351) cation:sugar symporter activity(GO:0005402) |
| 0.1 | 0.9 | GO:0035255 | ionotropic glutamate receptor binding(GO:0035255) |
| 0.1 | 1.1 | GO:0045309 | protein phosphorylated amino acid binding(GO:0045309) |
| 0.1 | 0.8 | GO:0004535 | poly(A)-specific ribonuclease activity(GO:0004535) |
| 0.1 | 0.1 | GO:0061629 | RNA polymerase II sequence-specific DNA binding transcription factor binding(GO:0061629) |
| 0.1 | 1.0 | GO:0005527 | macrolide binding(GO:0005527) FK506 binding(GO:0005528) |
| 0.1 | 5.7 | GO:0001078 | transcriptional repressor activity, RNA polymerase II core promoter proximal region sequence-specific binding(GO:0001078) |
| 0.1 | 0.2 | GO:0010997 | anaphase-promoting complex binding(GO:0010997) |
| 0.1 | 2.1 | GO:0005484 | SNAP receptor activity(GO:0005484) |
| 0.1 | 0.4 | GO:0019966 | interleukin-1 binding(GO:0019966) |
| 0.1 | 0.8 | GO:0016805 | dipeptidase activity(GO:0016805) |
| 0.1 | 0.6 | GO:0004596 | peptide alpha-N-acetyltransferase activity(GO:0004596) |
| 0.1 | 0.6 | GO:0023026 | MHC class II protein complex binding(GO:0023026) |
| 0.1 | 0.2 | GO:0043262 | adenosine-diphosphatase activity(GO:0043262) |
| 0.1 | 0.2 | GO:0016646 | oxidoreductase activity, acting on the CH-NH group of donors, NAD or NADP as acceptor(GO:0016646) |
| 0.1 | 0.3 | GO:0016812 | hydrolase activity, acting on carbon-nitrogen (but not peptide) bonds, in cyclic amides(GO:0016812) |
| 0.1 | 0.3 | GO:0045545 | syndecan binding(GO:0045545) |
| 0.1 | 0.1 | GO:0001665 | alpha-N-acetylgalactosaminide alpha-2,6-sialyltransferase activity(GO:0001665) |
| 0.1 | 2.0 | GO:0097110 | scaffold protein binding(GO:0097110) |
| 0.1 | 0.3 | GO:0004749 | ribose phosphate diphosphokinase activity(GO:0004749) |
| 0.1 | 0.6 | GO:0004697 | protein kinase C activity(GO:0004697) |
| 0.1 | 1.5 | GO:0004683 | calmodulin-dependent protein kinase activity(GO:0004683) |
| 0.1 | 0.1 | GO:0017116 | single-stranded DNA-dependent ATP-dependent DNA helicase activity(GO:0017116) |
| 0.1 | 0.4 | GO:0035198 | miRNA binding(GO:0035198) |
| 0.1 | 0.4 | GO:0008140 | cAMP response element binding protein binding(GO:0008140) |
| 0.1 | 0.2 | GO:0004813 | alanine-tRNA ligase activity(GO:0004813) |
| 0.1 | 0.1 | GO:0070538 | oleic acid binding(GO:0070538) |
| 0.1 | 3.6 | GO:0008565 | protein transporter activity(GO:0008565) |
| 0.1 | 0.6 | GO:0017081 | chloride channel regulator activity(GO:0017081) |
| 0.1 | 0.7 | GO:0044606 | thiamine-pyrophosphatase activity(GO:0004787) UDP-2,3-diacylglucosamine hydrolase activity(GO:0008758) dATP pyrophosphohydrolase activity(GO:0008828) dihydroneopterin monophosphate phosphatase activity(GO:0019176) dihydroneopterin triphosphate pyrophosphohydrolase activity(GO:0019177) dTTP diphosphatase activity(GO:0036218) phosphocholine hydrolase activity(GO:0044606) |
| 0.1 | 0.2 | GO:0004366 | glycerol-3-phosphate O-acyltransferase activity(GO:0004366) |
| 0.1 | 0.3 | GO:1990405 | protein antigen binding(GO:1990405) |
| 0.1 | 6.3 | GO:0004867 | serine-type endopeptidase inhibitor activity(GO:0004867) |
| 0.1 | 2.5 | GO:0019003 | GDP binding(GO:0019003) |
| 0.1 | 0.4 | GO:0016884 | carbon-nitrogen ligase activity, with glutamine as amido-N-donor(GO:0016884) |
| 0.1 | 1.1 | GO:0005537 | mannose binding(GO:0005537) |
| 0.1 | 0.2 | GO:0004740 | pyruvate dehydrogenase (acetyl-transferring) kinase activity(GO:0004740) |
| 0.1 | 0.3 | GO:0004758 | serine C-palmitoyltransferase activity(GO:0004758) |
| 0.1 | 0.6 | GO:0070990 | snRNP binding(GO:0070990) |
| 0.1 | 0.1 | GO:0071617 | lysophospholipid acyltransferase activity(GO:0071617) |
| 0.1 | 0.1 | GO:0034452 | dynactin binding(GO:0034452) |
| 0.1 | 0.1 | GO:0047105 | aminobutyraldehyde dehydrogenase activity(GO:0019145) 4-trimethylammoniobutyraldehyde dehydrogenase activity(GO:0047105) |
| 0.1 | 0.4 | GO:0035312 | 5'-3' exodeoxyribonuclease activity(GO:0035312) |
| 0.1 | 0.3 | GO:0001135 | transcription factor activity, RNA polymerase II transcription factor recruiting(GO:0001135) |
| 0.1 | 0.1 | GO:0043842 | Kdo transferase activity(GO:0043842) |
| 0.1 | 0.2 | GO:0004832 | valine-tRNA ligase activity(GO:0004832) |
| 0.1 | 0.4 | GO:0008135 | translation factor activity, RNA binding(GO:0008135) |
| 0.1 | 0.2 | GO:0098821 | BMP receptor activity(GO:0098821) |
| 0.1 | 0.7 | GO:0008327 | methyl-CpG binding(GO:0008327) |
| 0.1 | 0.2 | GO:0070513 | death domain binding(GO:0070513) |
| 0.1 | 0.3 | GO:0010853 | cyclase activator activity(GO:0010853) guanylate cyclase activator activity(GO:0030250) |
| 0.1 | 2.9 | GO:0004004 | ATP-dependent RNA helicase activity(GO:0004004) RNA-dependent ATPase activity(GO:0008186) |
| 0.1 | 0.2 | GO:0008009 | chemokine activity(GO:0008009) |
| 0.1 | 1.5 | GO:0004869 | cysteine-type endopeptidase inhibitor activity(GO:0004869) |
| 0.1 | 0.1 | GO:0008656 | cysteine-type endopeptidase activator activity involved in apoptotic process(GO:0008656) |
| 0.1 | 0.6 | GO:0016814 | hydrolase activity, acting on carbon-nitrogen (but not peptide) bonds, in cyclic amidines(GO:0016814) |
| 0.1 | 2.6 | GO:0001047 | core promoter binding(GO:0001047) |
| 0.1 | 0.2 | GO:0030144 | alpha-1,6-mannosylglycoprotein 6-beta-N-acetylglucosaminyltransferase activity(GO:0030144) |
| 0.1 | 0.1 | GO:0008142 | oxysterol binding(GO:0008142) |
| 0.1 | 0.1 | GO:0005280 | hydrogen:amino acid symporter activity(GO:0005280) gamma-aminobutyric acid transmembrane transporter activity(GO:0015185) |
| 0.1 | 0.1 | GO:0001025 | RNA polymerase III transcription factor binding(GO:0001025) |
| 0.1 | 1.1 | GO:0004298 | threonine-type endopeptidase activity(GO:0004298) threonine-type peptidase activity(GO:0070003) |
| 0.1 | 0.9 | GO:0000062 | fatty-acyl-CoA binding(GO:0000062) |
| 0.1 | 0.4 | GO:0031386 | protein tag(GO:0031386) |
| 0.1 | 3.2 | GO:0016829 | lyase activity(GO:0016829) |
| 0.1 | 0.2 | GO:0004645 | phosphorylase activity(GO:0004645) |
| 0.1 | 2.5 | GO:0061630 | ubiquitin protein ligase activity(GO:0061630) ubiquitin-like protein ligase activity(GO:0061659) |
| 0.1 | 0.1 | GO:0070883 | pre-miRNA binding(GO:0070883) |
| 0.1 | 0.1 | GO:0010861 | thyroid hormone receptor activator activity(GO:0010861) |
| 0.1 | 0.1 | GO:0032183 | SUMO binding(GO:0032183) |
| 0.1 | 0.1 | GO:0051861 | glycolipid binding(GO:0051861) |
| 0.1 | 0.2 | GO:0030021 | extracellular matrix structural constituent conferring compression resistance(GO:0030021) structural constituent of tooth enamel(GO:0030345) |
| 0.1 | 0.2 | GO:0004045 | aminoacyl-tRNA hydrolase activity(GO:0004045) |
| 0.1 | 0.5 | GO:0017154 | semaphorin receptor activity(GO:0017154) |
| 0.1 | 0.4 | GO:0008409 | 5'-3' exonuclease activity(GO:0008409) |
| 0.1 | 0.1 | GO:0001591 | dopamine neurotransmitter receptor activity, coupled via Gi/Go(GO:0001591) |
| 0.1 | 0.2 | GO:0004741 | [pyruvate dehydrogenase (lipoamide)] phosphatase activity(GO:0004741) |
| 0.1 | 0.1 | GO:0015057 | thrombin receptor activity(GO:0015057) |
| 0.1 | 0.2 | GO:0047498 | calcium-dependent phospholipase A2 activity(GO:0047498) |
| 0.0 | 0.2 | GO:0001848 | complement binding(GO:0001848) |
| 0.0 | 1.4 | GO:0061650 | ubiquitin-like protein conjugating enzyme activity(GO:0061650) |
| 0.0 | 0.2 | GO:0008821 | crossover junction endodeoxyribonuclease activity(GO:0008821) |
| 0.0 | 0.1 | GO:0016655 | oxidoreductase activity, acting on NAD(P)H, quinone or similar compound as acceptor(GO:0016655) |
| 0.0 | 0.1 | GO:0042043 | neurexin family protein binding(GO:0042043) |
| 0.0 | 0.1 | GO:0000268 | peroxisome targeting sequence binding(GO:0000268) |
| 0.0 | 0.3 | GO:0017110 | nucleoside-diphosphatase activity(GO:0017110) |
| 0.0 | 0.5 | GO:0004623 | phospholipase A2 activity(GO:0004623) |
| 0.0 | 0.5 | GO:0043531 | ADP binding(GO:0043531) |
| 0.0 | 1.5 | GO:0004722 | protein serine/threonine phosphatase activity(GO:0004722) |
| 0.0 | 0.2 | GO:0030332 | cyclin binding(GO:0030332) |
| 0.0 | 0.2 | GO:0004169 | dolichyl-phosphate-mannose-protein mannosyltransferase activity(GO:0004169) |
| 0.0 | 0.4 | GO:0046966 | thyroid hormone receptor binding(GO:0046966) |
| 0.0 | 0.1 | GO:0010314 | phosphatidylinositol-5-phosphate binding(GO:0010314) |
| 0.0 | 0.2 | GO:0070290 | N-acylphosphatidylethanolamine-specific phospholipase D activity(GO:0070290) |
| 0.0 | 0.7 | GO:0004653 | polypeptide N-acetylgalactosaminyltransferase activity(GO:0004653) |
| 0.0 | 1.7 | GO:0004843 | thiol-dependent ubiquitin-specific protease activity(GO:0004843) |
| 0.0 | 2.3 | GO:0003823 | antigen binding(GO:0003823) |
| 0.0 | 0.1 | GO:0035035 | histone acetyltransferase binding(GO:0035035) |
| 0.0 | 0.1 | GO:0043008 | ATP-dependent protein binding(GO:0043008) |
| 0.0 | 1.0 | GO:0015459 | potassium channel regulator activity(GO:0015459) |
| 0.0 | 1.8 | GO:0043130 | ubiquitin binding(GO:0043130) |
| 0.0 | 0.1 | GO:0047035 | testosterone dehydrogenase (NAD+) activity(GO:0047035) |
| 0.0 | 0.4 | GO:0042288 | MHC class I protein binding(GO:0042288) |
| 0.0 | 0.5 | GO:0016891 | endoribonuclease activity, producing 5'-phosphomonoesters(GO:0016891) |
| 0.0 | 0.0 | GO:0016899 | oxidoreductase activity, acting on the CH-OH group of donors, oxygen as acceptor(GO:0016899) |
| 0.0 | 2.8 | GO:0000149 | SNARE binding(GO:0000149) |
| 0.0 | 0.1 | GO:0032552 | deoxyribonucleotide binding(GO:0032552) |
| 0.0 | 0.4 | GO:0005222 | intracellular cAMP activated cation channel activity(GO:0005222) |
| 0.0 | 0.6 | GO:0003755 | peptidyl-prolyl cis-trans isomerase activity(GO:0003755) |
| 0.0 | 0.1 | GO:0004945 | angiotensin type II receptor activity(GO:0004945) |
| 0.0 | 2.5 | GO:0005178 | integrin binding(GO:0005178) |
| 0.0 | 2.9 | GO:0017137 | Rab GTPase binding(GO:0017137) |
| 0.0 | 5.1 | GO:0016741 | methyltransferase activity(GO:0008168) transferase activity, transferring one-carbon groups(GO:0016741) |
| 0.0 | 0.3 | GO:0070412 | R-SMAD binding(GO:0070412) |
| 0.0 | 0.2 | GO:0070742 | C2H2 zinc finger domain binding(GO:0070742) |
| 0.0 | 0.0 | GO:0004052 | arachidonate 12-lipoxygenase activity(GO:0004052) |
| 0.0 | 0.1 | GO:0019103 | pyrimidine nucleotide binding(GO:0019103) |
| 0.0 | 0.1 | GO:0005111 | type 2 fibroblast growth factor receptor binding(GO:0005111) |
| 0.0 | 1.1 | GO:0051723 | protein methylesterase activity(GO:0051723) |
| 0.0 | 0.3 | GO:0030170 | pyridoxal phosphate binding(GO:0030170) |
| 0.0 | 0.3 | GO:0043142 | single-stranded DNA-dependent ATPase activity(GO:0043142) |
| 0.0 | 0.3 | GO:0035497 | cAMP response element binding(GO:0035497) |
| 0.0 | 1.3 | GO:0005132 | type I interferon receptor binding(GO:0005132) |
| 0.0 | 0.1 | GO:0030546 | receptor activator activity(GO:0030546) |
| 0.0 | 0.1 | GO:0016803 | ether hydrolase activity(GO:0016803) |
| 0.0 | 0.1 | GO:0008147 | structural constituent of bone(GO:0008147) |
| 0.0 | 0.2 | GO:0008190 | eukaryotic initiation factor 4E binding(GO:0008190) |
| 0.0 | 0.2 | GO:0050700 | CARD domain binding(GO:0050700) |
| 0.0 | 0.1 | GO:0097001 | ceramide binding(GO:0097001) |
| 0.0 | 1.4 | GO:0008395 | steroid hydroxylase activity(GO:0008395) |
| 0.0 | 0.0 | GO:0035851 | Krueppel-associated box domain binding(GO:0035851) |
| 0.0 | 0.3 | GO:0030544 | Hsp70 protein binding(GO:0030544) |
| 0.0 | 0.3 | GO:0070628 | proteasome binding(GO:0070628) |
| 0.0 | 0.7 | GO:0001205 | transcriptional activator activity, RNA polymerase II distal enhancer sequence-specific binding(GO:0001205) |
| 0.0 | 0.1 | GO:0097371 | MDM2/MDM4 family protein binding(GO:0097371) |
| 0.0 | 0.4 | GO:0008353 | RNA polymerase II carboxy-terminal domain kinase activity(GO:0008353) |
| 0.0 | 0.1 | GO:0043560 | insulin receptor substrate binding(GO:0043560) |
| 0.0 | 3.0 | GO:0003714 | transcription corepressor activity(GO:0003714) |
| 0.0 | 0.1 | GO:0052724 | inositol hexakisphosphate kinase activity(GO:0000828) inositol hexakisphosphate 5-kinase activity(GO:0000832) inositol hexakisphosphate 1-kinase activity(GO:0052723) inositol hexakisphosphate 3-kinase activity(GO:0052724) |
| 0.0 | 0.1 | GO:0004591 | oxoglutarate dehydrogenase (succinyl-transferring) activity(GO:0004591) |
| 0.0 | 0.2 | GO:0032795 | heterotrimeric G-protein binding(GO:0032795) |
| 0.0 | 0.2 | GO:0004521 | endoribonuclease activity(GO:0004521) |
| 0.0 | 0.1 | GO:0016893 | endonuclease activity, active with either ribo- or deoxyribonucleic acids and producing 5'-phosphomonoesters(GO:0016893) |
| 0.0 | 4.0 | GO:0005125 | cytokine activity(GO:0005125) |
| 0.0 | 0.0 | GO:0048156 | tau protein binding(GO:0048156) |
| 0.0 | 0.0 | GO:0047023 | androsterone dehydrogenase activity(GO:0047023) |
| 0.0 | 0.2 | GO:0004861 | cyclin-dependent protein serine/threonine kinase inhibitor activity(GO:0004861) |
| 0.0 | 0.1 | GO:0004652 | polynucleotide adenylyltransferase activity(GO:0004652) |
| 0.0 | 0.0 | GO:1901611 | phosphatidylglycerol binding(GO:1901611) |
| 0.0 | 0.2 | GO:0005166 | neurotrophin p75 receptor binding(GO:0005166) |
| 0.0 | 0.1 | GO:0097016 | L27 domain binding(GO:0097016) |
| 0.0 | 0.2 | GO:0019763 | immunoglobulin receptor activity(GO:0019763) |
| 0.0 | 0.3 | GO:0005522 | profilin binding(GO:0005522) |
| 0.0 | 0.3 | GO:0008195 | phosphatidate phosphatase activity(GO:0008195) |
| 0.0 | 1.7 | GO:0017124 | SH3 domain binding(GO:0017124) |
| 0.0 | 0.1 | GO:0004677 | DNA-dependent protein kinase activity(GO:0004677) |
| 0.0 | 0.1 | GO:0000386 | second spliceosomal transesterification activity(GO:0000386) |
| 0.0 | 0.1 | GO:0031491 | nucleosome binding(GO:0031491) |
| 0.0 | 0.8 | GO:0016413 | O-acetyltransferase activity(GO:0016413) |
| 0.0 | 0.1 | GO:0042975 | peroxisome proliferator activated receptor binding(GO:0042975) |
| 0.0 | 0.1 | GO:0004602 | glutathione peroxidase activity(GO:0004602) |
| 0.0 | 3.1 | GO:0016791 | phosphatase activity(GO:0016791) |
| 0.0 | 0.1 | GO:0019911 | structural constituent of myelin sheath(GO:0019911) |
| 0.0 | 0.0 | GO:0016406 | carnitine O-acyltransferase activity(GO:0016406) |
| 0.0 | 0.7 | GO:0042826 | histone deacetylase binding(GO:0042826) |
| 0.0 | 0.0 | GO:0017166 | vinculin binding(GO:0017166) |
| 0.0 | 0.1 | GO:0015605 | organophosphate ester transmembrane transporter activity(GO:0015605) |
| 0.0 | 0.0 | GO:0070840 | dynein complex binding(GO:0070840) |
| 0.0 | 0.2 | GO:0016538 | cyclin-dependent protein serine/threonine kinase regulator activity(GO:0016538) |
| 0.0 | 0.1 | GO:0070051 | fibrinogen binding(GO:0070051) |
| 0.0 | 0.1 | GO:0008273 | calcium, potassium:sodium antiporter activity(GO:0008273) |
| 0.0 | 0.4 | GO:0070063 | RNA polymerase binding(GO:0070063) |
| 0.0 | 0.3 | GO:0032266 | phosphatidylinositol-3-phosphate binding(GO:0032266) |
| 0.0 | 0.1 | GO:1901677 | phosphate transmembrane transporter activity(GO:1901677) |
| 0.0 | 0.1 | GO:0001221 | transcription cofactor binding(GO:0001221) |
| 0.0 | 0.0 | GO:0003986 | acetyl-CoA hydrolase activity(GO:0003986) |
| 0.0 | 0.1 | GO:0019166 | trans-2-enoyl-CoA reductase (NADPH) activity(GO:0019166) |
| 0.0 | 0.0 | GO:0004303 | estradiol 17-beta-dehydrogenase activity(GO:0004303) |
| 0.0 | 0.4 | GO:0004889 | acetylcholine-activated cation-selective channel activity(GO:0004889) |
| 0.0 | 0.2 | GO:0008641 | small protein activating enzyme activity(GO:0008641) |
| 0.0 | 0.0 | GO:1990825 | sequence-specific mRNA binding(GO:1990825) |
| 0.0 | 0.1 | GO:0004370 | glycerol kinase activity(GO:0004370) |
| 0.0 | 0.0 | GO:0015145 | monosaccharide transmembrane transporter activity(GO:0015145) |
| 0.0 | 0.2 | GO:0009881 | photoreceptor activity(GO:0009881) |
| 0.0 | 0.1 | GO:0016653 | cytochrome-b5 reductase activity, acting on NAD(P)H(GO:0004128) oxidoreductase activity, acting on NAD(P)H, heme protein as acceptor(GO:0016653) |
| 0.0 | 0.3 | GO:0019843 | rRNA binding(GO:0019843) |
| 0.0 | 0.4 | GO:0030374 | ligand-dependent nuclear receptor transcription coactivator activity(GO:0030374) |
| 0.0 | 0.1 | GO:0016303 | 1-phosphatidylinositol-3-kinase activity(GO:0016303) |
| 0.0 | 0.1 | GO:0004046 | aminoacylase activity(GO:0004046) |
| 0.0 | 0.2 | GO:0051059 | NF-kappaB binding(GO:0051059) |
| 0.0 | 0.3 | GO:0017025 | TBP-class protein binding(GO:0017025) |
| 0.0 | 0.2 | GO:0050431 | transforming growth factor beta binding(GO:0050431) |
| 0.0 | 0.8 | GO:0008527 | taste receptor activity(GO:0008527) |
| 0.0 | 0.0 | GO:0019784 | NEDD8-specific protease activity(GO:0019784) |
| 0.0 | 0.1 | GO:0035662 | Toll-like receptor 4 binding(GO:0035662) |
| 0.0 | 0.1 | GO:0008260 | 3-oxoacid CoA-transferase activity(GO:0008260) |
| 0.0 | 0.1 | GO:0008517 | folic acid transporter activity(GO:0008517) |
| 0.0 | 0.1 | GO:0008301 | DNA binding, bending(GO:0008301) |
| 0.0 | 0.0 | GO:0030957 | Tat protein binding(GO:0030957) |
| 0.0 | 0.0 | GO:0004703 | G-protein coupled receptor kinase activity(GO:0004703) |
| 0.0 | 0.0 | GO:0004667 | prostaglandin-D synthase activity(GO:0004667) |
| 0.0 | 0.0 | GO:0016415 | octanoyltransferase activity(GO:0016415) |
| 0.0 | 0.3 | GO:0030414 | peptidase inhibitor activity(GO:0030414) |
| 0.0 | 2.8 | GO:0043774 | UDP-N-acetylmuramoylalanyl-D-glutamyl-2,6-diaminopimelate-D-alanyl-D-alanine ligase activity(GO:0008766) ribosomal S6-glutamic acid ligase activity(GO:0018169) coenzyme F420-0 gamma-glutamyl ligase activity(GO:0043773) coenzyme F420-2 alpha-glutamyl ligase activity(GO:0043774) protein-glycine ligase activity(GO:0070735) protein-glycine ligase activity, initiating(GO:0070736) protein-glycine ligase activity, elongating(GO:0070737) tubulin-glycine ligase activity(GO:0070738) |
| 0.0 | 0.0 | GO:0016615 | malate dehydrogenase activity(GO:0016615) |
| 0.0 | 0.1 | GO:0019239 | deaminase activity(GO:0019239) |
| 0.0 | 0.0 | GO:0035368 | selenocysteine insertion sequence binding(GO:0035368) |
| 0.0 | 0.1 | GO:0015467 | G-protein activated inward rectifier potassium channel activity(GO:0015467) |
| 0.0 | 0.1 | GO:0047276 | N-acetyllactosaminide 3-alpha-galactosyltransferase activity(GO:0047276) |
| 0.0 | 1.4 | GO:0004222 | metalloendopeptidase activity(GO:0004222) |
| 0.0 | 0.0 | GO:0004029 | aldehyde dehydrogenase (NAD) activity(GO:0004029) |
| 0.0 | 0.0 | GO:0002046 | opsin binding(GO:0002046) |
| 0.0 | 0.0 | GO:0004814 | arginine-tRNA ligase activity(GO:0004814) |
| 0.0 | 0.0 | GO:0016880 | acid-ammonia (or amide) ligase activity(GO:0016880) |
| 0.0 | 0.0 | GO:0086008 | voltage-gated potassium channel activity involved in cardiac muscle cell action potential repolarization(GO:0086008) |
| 0.0 | 0.0 | GO:0071208 | histone pre-mRNA DCP binding(GO:0071208) |
| 0.0 | 0.0 | GO:0051185 | coenzyme transporter activity(GO:0051185) |
| 0.0 | 0.0 | GO:1990430 | extracellular matrix protein binding(GO:1990430) |
| 0.0 | 0.0 | GO:0004549 | tRNA-specific ribonuclease activity(GO:0004549) |
| 0.0 | 0.0 | GO:0005041 | low-density lipoprotein receptor activity(GO:0005041) |
| 0.0 | 0.1 | GO:0030247 | pattern binding(GO:0001871) polysaccharide binding(GO:0030247) |
| 0.0 | 0.1 | GO:0015036 | disulfide oxidoreductase activity(GO:0015036) |
| 0.0 | 0.0 | GO:0010858 | calcium-dependent protein kinase inhibitor activity(GO:0008427) calcium-dependent protein kinase regulator activity(GO:0010858) |
| 0.0 | 0.0 | GO:0043028 | cysteine-type endopeptidase regulator activity involved in apoptotic process(GO:0043028) |
| 0.0 | 0.2 | GO:0004180 | carboxypeptidase activity(GO:0004180) |
| 0.0 | 0.0 | GO:0031435 | mitogen-activated protein kinase kinase kinase binding(GO:0031435) |
| 0.0 | 0.0 | GO:0030249 | cyclase regulator activity(GO:0010851) guanylate cyclase regulator activity(GO:0030249) |
| 0.0 | 0.0 | GO:0008486 | diphosphoinositol-polyphosphate diphosphatase activity(GO:0008486) |
| 0.0 | 0.2 | GO:0004693 | cyclin-dependent protein serine/threonine kinase activity(GO:0004693) cyclin-dependent protein kinase activity(GO:0097472) |
| 0.0 | 0.1 | GO:0038024 | cargo receptor activity(GO:0038024) |
| 0.0 | 2.6 | GO:0005198 | structural molecule activity(GO:0005198) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 1.6 | 3.2 | ST JAK STAT PATHWAY | Jak-STAT Pathway |
| 0.8 | 16.1 | PID EPHA2 FWD PATHWAY | EPHA2 forward signaling |
| 0.5 | 4.0 | ST STAT3 PATHWAY | STAT3 Pathway |
| 0.5 | 16.6 | PID ERBB4 PATHWAY | ErbB4 signaling events |
| 0.5 | 21.6 | PID HNF3B PATHWAY | FOXA2 and FOXA3 transcription factor networks |
| 0.4 | 3.3 | SA G2 AND M PHASES | Cdc25 activates the cdc2/cyclin B complex to induce the G2/M transition. |
| 0.4 | 5.8 | SA CASPASE CASCADE | Apoptosis is mediated by caspases, cysteine proteases arranged in a proteolytic cascade. |
| 0.4 | 3.1 | PID SMAD2 3PATHWAY | Regulation of cytoplasmic and nuclear SMAD2/3 signaling |
| 0.4 | 4.1 | SA PROGRAMMED CELL DEATH | Programmed cell death, or apoptosis, eliminates damaged or unneeded cells. |
| 0.4 | 19.6 | PID MYC REPRESS PATHWAY | Validated targets of C-MYC transcriptional repression |
| 0.3 | 17.2 | PID AR PATHWAY | Coregulation of Androgen receptor activity |
| 0.3 | 1.6 | PID CXCR4 PATHWAY | CXCR4-mediated signaling events |
| 0.3 | 3.9 | PID ECADHERIN KERATINOCYTE PATHWAY | E-cadherin signaling in keratinocytes |
| 0.3 | 9.5 | PID HIF2PATHWAY | HIF-2-alpha transcription factor network |
| 0.3 | 7.5 | PID INTEGRIN2 PATHWAY | Beta2 integrin cell surface interactions |
| 0.3 | 2.9 | PID AR TF PATHWAY | Regulation of Androgen receptor activity |
| 0.3 | 2.4 | SA G1 AND S PHASES | Cdk2, 4, and 6 bind cyclin D in G1, while cdk2/cyclin E promotes the G1/S transition. |
| 0.3 | 3.3 | PID ANTHRAX PATHWAY | Cellular roles of Anthrax toxin |
| 0.3 | 7.3 | PID ARF6 PATHWAY | Arf6 signaling events |
| 0.2 | 6.7 | ST PHOSPHOINOSITIDE 3 KINASE PATHWAY | PI3K Pathway |
| 0.2 | 3.4 | PID LPA4 PATHWAY | LPA4-mediated signaling events |
| 0.2 | 9.6 | PID VEGFR1 2 PATHWAY | Signaling events mediated by VEGFR1 and VEGFR2 |
| 0.2 | 12.5 | PID HDAC CLASSI PATHWAY | Signaling events mediated by HDAC Class I |
| 0.2 | 0.4 | SA FAS SIGNALING | The TNF-type receptor Fas induces apoptosis on ligand binding. |
| 0.2 | 2.0 | SA MMP CYTOKINE CONNECTION | Cytokines can induce activation of matrix metalloproteinases, which degrade extracellular matrix. |
| 0.2 | 0.2 | PID PDGFRA PATHWAY | PDGFR-alpha signaling pathway |
| 0.2 | 0.4 | ST GRANULE CELL SURVIVAL PATHWAY | Granule Cell Survival Pathway is a specific case of more general PAC1 Receptor Pathway. |
| 0.2 | 2.2 | PID TCPTP PATHWAY | Signaling events mediated by TCPTP |
| 0.2 | 2.2 | PID CIRCADIAN PATHWAY | Circadian rhythm pathway |
| 0.2 | 0.4 | SIG IL4RECEPTOR IN B LYPHOCYTES | Genes related to IL4 rceptor signaling in B lymphocytes |
| 0.2 | 1.0 | PID HIF1A PATHWAY | Hypoxic and oxygen homeostasis regulation of HIF-1-alpha |
| 0.2 | 1.0 | PID ARF6 DOWNSTREAM PATHWAY | Arf6 downstream pathway |
| 0.2 | 1.5 | PID INTEGRIN3 PATHWAY | Beta3 integrin cell surface interactions |
| 0.2 | 0.5 | PID SYNDECAN 2 PATHWAY | Syndecan-2-mediated signaling events |
| 0.2 | 2.4 | PID ECADHERIN STABILIZATION PATHWAY | Stabilization and expansion of the E-cadherin adherens junction |
| 0.2 | 2.2 | PID ARF 3PATHWAY | Arf1 pathway |
| 0.2 | 1.0 | PID TCR RAS PATHWAY | Ras signaling in the CD4+ TCR pathway |
| 0.1 | 1.5 | PID IL3 PATHWAY | IL3-mediated signaling events |
| 0.1 | 2.8 | PID TELOMERASE PATHWAY | Regulation of Telomerase |
| 0.1 | 2.6 | ST WNT CA2 CYCLIC GMP PATHWAY | Wnt/Ca2+/cyclic GMP signaling. |
| 0.1 | 3.1 | SIG PIP3 SIGNALING IN CARDIAC MYOCTES | Genes related to PIP3 signaling in cardiac myocytes |
| 0.1 | 6.1 | PID P73PATHWAY | p73 transcription factor network |
| 0.1 | 0.9 | PID P38 MK2 PATHWAY | p38 signaling mediated by MAPKAP kinases |
| 0.1 | 1.6 | PID MAPK TRK PATHWAY | Trk receptor signaling mediated by the MAPK pathway |
| 0.1 | 3.1 | PID P38 ALPHA BETA DOWNSTREAM PATHWAY | Signaling mediated by p38-alpha and p38-beta |
| 0.1 | 3.2 | PID RHOA PATHWAY | RhoA signaling pathway |
| 0.1 | 0.7 | ST TYPE I INTERFERON PATHWAY | Type I Interferon (alpha/beta IFN) Pathway |
| 0.1 | 4.7 | PID SMAD2 3NUCLEAR PATHWAY | Regulation of nuclear SMAD2/3 signaling |
| 0.1 | 0.8 | PID BCR 5PATHWAY | BCR signaling pathway |
| 0.1 | 2.1 | PID IL6 7 PATHWAY | IL6-mediated signaling events |
| 0.1 | 0.7 | PID MYC PATHWAY | C-MYC pathway |
| 0.1 | 3.9 | PID ARF6 TRAFFICKING PATHWAY | Arf6 trafficking events |
| 0.1 | 1.2 | PID ECADHERIN NASCENT AJ PATHWAY | E-cadherin signaling in the nascent adherens junction |
| 0.1 | 4.0 | PID HIF1 TFPATHWAY | HIF-1-alpha transcription factor network |
| 0.1 | 3.2 | ST JNK MAPK PATHWAY | JNK MAPK Pathway |
| 0.1 | 0.9 | PID TCR JNK PATHWAY | JNK signaling in the CD4+ TCR pathway |
| 0.1 | 1.1 | PID P38 MKK3 6PATHWAY | p38 MAPK signaling pathway |
| 0.1 | 0.6 | PID WNT CANONICAL PATHWAY | Canonical Wnt signaling pathway |
| 0.1 | 1.0 | PID ERBB2 ERBB3 PATHWAY | ErbB2/ErbB3 signaling events |
| 0.1 | 2.6 | PID FGF PATHWAY | FGF signaling pathway |
| 0.1 | 1.2 | PID PRL SIGNALING EVENTS PATHWAY | Signaling events mediated by PRL |
| 0.1 | 0.8 | NABA BASEMENT MEMBRANES | Genes encoding structural components of basement membranes |
| 0.1 | 5.9 | PID MYC ACTIV PATHWAY | Validated targets of C-MYC transcriptional activation |
| 0.1 | 1.0 | PID IL2 PI3K PATHWAY | IL2 signaling events mediated by PI3K |
| 0.1 | 1.0 | PID DNA PK PATHWAY | DNA-PK pathway in nonhomologous end joining |
| 0.1 | 0.2 | SA B CELL RECEPTOR COMPLEXES | Antigen binding to B cell receptors activates protein tyrosine kinases, such as the Src family, which ultimate activate MAP kinases. |
| 0.1 | 1.8 | PID IL23 PATHWAY | IL23-mediated signaling events |
| 0.1 | 1.4 | PID MET PATHWAY | Signaling events mediated by Hepatocyte Growth Factor Receptor (c-Met) |
| 0.1 | 0.6 | PID TRAIL PATHWAY | TRAIL signaling pathway |
| 0.1 | 0.2 | PID S1P S1P2 PATHWAY | S1P2 pathway |
| 0.1 | 0.5 | PID ALK1 PATHWAY | ALK1 signaling events |
| 0.1 | 0.3 | PID ERB GENOMIC PATHWAY | Validated nuclear estrogen receptor beta network |
| 0.1 | 12.4 | NABA ECM AFFILIATED | Genes encoding proteins affiliated structurally or functionally to extracellular matrix proteins |
| 0.1 | 3.2 | PID FANCONI PATHWAY | Fanconi anemia pathway |
| 0.1 | 1.9 | PID TGFBR PATHWAY | TGF-beta receptor signaling |
| 0.1 | 0.8 | PID PTP1B PATHWAY | Signaling events mediated by PTP1B |
| 0.1 | 0.4 | PID THROMBIN PAR4 PATHWAY | PAR4-mediated thrombin signaling events |
| 0.1 | 16.8 | NABA ECM REGULATORS | Genes encoding enzymes and their regulators involved in the remodeling of the extracellular matrix |
| 0.1 | 0.3 | PID A6B1 A6B4 INTEGRIN PATHWAY | a6b1 and a6b4 Integrin signaling |
| 0.1 | 0.4 | PID IL12 STAT4 PATHWAY | IL12 signaling mediated by STAT4 |
| 0.1 | 1.2 | PID AMB2 NEUTROPHILS PATHWAY | amb2 Integrin signaling |
| 0.1 | 1.8 | PID RAC1 PATHWAY | RAC1 signaling pathway |
| 0.1 | 1.3 | PID TAP63 PATHWAY | Validated transcriptional targets of TAp63 isoforms |
| 0.1 | 0.7 | PID IL12 2PATHWAY | IL12-mediated signaling events |
| 0.1 | 2.9 | PID ERA GENOMIC PATHWAY | Validated nuclear estrogen receptor alpha network |
| 0.1 | 0.1 | ST P38 MAPK PATHWAY | p38 MAPK Pathway |
| 0.1 | 0.9 | SIG CD40PATHWAYMAP | Genes related to CD40 signaling |
| 0.1 | 1.4 | PID FCER1 PATHWAY | Fc-epsilon receptor I signaling in mast cells |
| 0.1 | 1.3 | PID LKB1 PATHWAY | LKB1 signaling events |
| 0.1 | 1.4 | PID MTOR 4PATHWAY | mTOR signaling pathway |
| 0.1 | 1.6 | PID P53 REGULATION PATHWAY | p53 pathway |
| 0.1 | 0.8 | SIG CHEMOTAXIS | Genes related to chemotaxis |
| 0.1 | 0.4 | PID SYNDECAN 3 PATHWAY | Syndecan-3-mediated signaling events |
| 0.1 | 0.6 | PID ATR PATHWAY | ATR signaling pathway |
| 0.1 | 0.1 | PID AR NONGENOMIC PATHWAY | Nongenotropic Androgen signaling |
| 0.1 | 0.5 | PID RET PATHWAY | Signaling events regulated by Ret tyrosine kinase |
| 0.1 | 0.5 | PID ALK2 PATHWAY | ALK2 signaling events |
| 0.1 | 0.3 | PID PI3K PLC TRK PATHWAY | Trk receptor signaling mediated by PI3K and PLC-gamma |
| 0.0 | 0.2 | PID IL2 STAT5 PATHWAY | IL2 signaling events mediated by STAT5 |
| 0.0 | 0.4 | PID PI3KCI PATHWAY | Class I PI3K signaling events |
| 0.0 | 0.1 | ST G ALPHA S PATHWAY | G alpha s Pathway |
| 0.0 | 2.3 | PID P53 DOWNSTREAM PATHWAY | Direct p53 effectors |
| 0.0 | 0.2 | PID INTEGRIN A4B1 PATHWAY | Alpha4 beta1 integrin signaling events |
| 0.0 | 0.4 | SIG REGULATION OF THE ACTIN CYTOSKELETON BY RHO GTPASES | Genes related to regulation of the actin cytoskeleton |
| 0.0 | 1.4 | NABA PROTEOGLYCANS | Genes encoding proteoglycans |
| 0.0 | 0.5 | PID IL1 PATHWAY | IL1-mediated signaling events |
| 0.0 | 0.9 | PID REG GR PATHWAY | Glucocorticoid receptor regulatory network |
| 0.0 | 0.4 | PID ALPHA SYNUCLEIN PATHWAY | Alpha-synuclein signaling |
| 0.0 | 0.3 | PID THROMBIN PAR1 PATHWAY | PAR1-mediated thrombin signaling events |
| 0.0 | 0.6 | PID HES HEY PATHWAY | Notch-mediated HES/HEY network |
| 0.0 | 0.1 | PID IL5 PATHWAY | IL5-mediated signaling events |
| 0.0 | 0.5 | PID RXR VDR PATHWAY | RXR and RAR heterodimerization with other nuclear receptor |
| 0.0 | 0.1 | PID P38 ALPHA BETA PATHWAY | Regulation of p38-alpha and p38-beta |
| 0.0 | 0.5 | PID TOLL ENDOGENOUS PATHWAY | Endogenous TLR signaling |
| 0.0 | 0.6 | PID IL4 2PATHWAY | IL4-mediated signaling events |
| 0.0 | 0.6 | PID CD8 TCR DOWNSTREAM PATHWAY | Downstream signaling in naïve CD8+ T cells |
| 0.0 | 0.1 | ST GA13 PATHWAY | G alpha 13 Pathway |
| 0.0 | 0.3 | PID TRKR PATHWAY | Neurotrophic factor-mediated Trk receptor signaling |
| 0.0 | 0.1 | PID AVB3 INTEGRIN PATHWAY | Integrins in angiogenesis |
| 0.0 | 0.5 | ST WNT BETA CATENIN PATHWAY | Wnt/beta-catenin Pathway |
| 0.0 | 0.2 | SIG BCR SIGNALING PATHWAY | Members of the BCR signaling pathway |
| 0.0 | 0.0 | PID NFKAPPAB ATYPICAL PATHWAY | Atypical NF-kappaB pathway |
| 0.0 | 0.1 | PID BARD1 PATHWAY | BARD1 signaling events |
| 0.0 | 0.0 | PID IL8 CXCR1 PATHWAY | IL8- and CXCR1-mediated signaling events |
| 0.0 | 0.1 | PID INTEGRIN A9B1 PATHWAY | Alpha9 beta1 integrin signaling events |
| 0.0 | 0.1 | PID RETINOIC ACID PATHWAY | Retinoic acid receptors-mediated signaling |
| 0.0 | 0.0 | PID GMCSF PATHWAY | GMCSF-mediated signaling events |
| 0.0 | 0.0 | PID SYNDECAN 1 PATHWAY | Syndecan-1-mediated signaling events |
| 0.0 | 2.3 | NABA ECM GLYCOPROTEINS | Genes encoding structural ECM glycoproteins |
| 0.0 | 0.1 | PID WNT SIGNALING PATHWAY | Wnt signaling network |
| 0.0 | 0.1 | PID INSULIN GLUCOSE PATHWAY | Insulin-mediated glucose transport |
| 0.0 | 0.1 | PID CDC42 PATHWAY | CDC42 signaling events |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.9 | 15.5 | REACTOME ACTIVATED AMPK STIMULATES FATTY ACID OXIDATION IN MUSCLE | Genes involved in Activated AMPK stimulates fatty-acid oxidation in muscle |
| 0.7 | 2.0 | REACTOME REGULATION OF RHEB GTPASE ACTIVITY BY AMPK | Genes involved in Regulation of Rheb GTPase activity by AMPK |
| 0.6 | 3.8 | REACTOME ETHANOL OXIDATION | Genes involved in Ethanol oxidation |
| 0.6 | 8.1 | REACTOME METABOLISM OF PORPHYRINS | Genes involved in Metabolism of porphyrins |
| 0.6 | 5.7 | REACTOME PROLACTIN RECEPTOR SIGNALING | Genes involved in Prolactin receptor signaling |
| 0.6 | 3.4 | REACTOME IRAK2 MEDIATED ACTIVATION OF TAK1 COMPLEX UPON TLR7 8 OR 9 STIMULATION | Genes involved in IRAK2 mediated activation of TAK1 complex upon TLR7/8 or 9 stimulation |
| 0.5 | 0.5 | REACTOME SIGNALING BY FGFR | Genes involved in Signaling by FGFR |
| 0.5 | 8.1 | REACTOME SIGNALING BY FGFR1 FUSION MUTANTS | Genes involved in Signaling by FGFR1 fusion mutants |
| 0.5 | 3.7 | REACTOME THE ACTIVATION OF ARYLSULFATASES | Genes involved in The activation of arylsulfatases |
| 0.5 | 5.5 | REACTOME OXYGEN DEPENDENT PROLINE HYDROXYLATION OF HYPOXIA INDUCIBLE FACTOR ALPHA | Genes involved in Oxygen-dependent Proline Hydroxylation of Hypoxia-inducible Factor Alpha |
| 0.5 | 6.8 | REACTOME DOWNREGULATION OF SMAD2 3 SMAD4 TRANSCRIPTIONAL ACTIVITY | Genes involved in Downregulation of SMAD2/3:SMAD4 transcriptional activity |
| 0.4 | 4.0 | REACTOME SIGNAL REGULATORY PROTEIN SIRP FAMILY INTERACTIONS | Genes involved in Signal regulatory protein (SIRP) family interactions |
| 0.4 | 4.8 | REACTOME ASSOCIATION OF LICENSING FACTORS WITH THE PRE REPLICATIVE COMPLEX | Genes involved in Association of licensing factors with the pre-replicative complex |
| 0.4 | 6.9 | REACTOME PRE NOTCH PROCESSING IN GOLGI | Genes involved in Pre-NOTCH Processing in Golgi |
| 0.4 | 5.6 | REACTOME COMMON PATHWAY | Genes involved in Common Pathway |
| 0.4 | 5.9 | REACTOME ACTIVATION OF BH3 ONLY PROTEINS | Genes involved in Activation of BH3-only proteins |
| 0.4 | 10.2 | REACTOME GLYCOLYSIS | Genes involved in Glycolysis |
| 0.4 | 0.4 | REACTOME ALPHA LINOLENIC ACID ALA METABOLISM | Genes involved in alpha-linolenic acid (ALA) metabolism |
| 0.4 | 6.2 | REACTOME TERMINATION OF O GLYCAN BIOSYNTHESIS | Genes involved in Termination of O-glycan biosynthesis |
| 0.4 | 5.0 | REACTOME EARLY PHASE OF HIV LIFE CYCLE | Genes involved in Early Phase of HIV Life Cycle |
| 0.4 | 1.1 | REACTOME AQUAPORIN MEDIATED TRANSPORT | Genes involved in Aquaporin-mediated transport |
| 0.4 | 0.7 | REACTOME PEPTIDE CHAIN ELONGATION | Genes involved in Peptide chain elongation |
| 0.4 | 4.1 | REACTOME TETRAHYDROBIOPTERIN BH4 SYNTHESIS RECYCLING SALVAGE AND REGULATION | Genes involved in Tetrahydrobiopterin (BH4) synthesis, recycling, salvage and regulation |
| 0.4 | 4.8 | REACTOME INTRINSIC PATHWAY FOR APOPTOSIS | Genes involved in Intrinsic Pathway for Apoptosis |
| 0.4 | 5.1 | REACTOME HDL MEDIATED LIPID TRANSPORT | Genes involved in HDL-mediated lipid transport |
| 0.4 | 3.6 | REACTOME PASSIVE TRANSPORT BY AQUAPORINS | Genes involved in Passive Transport by Aquaporins |
| 0.3 | 7.6 | REACTOME METAL ION SLC TRANSPORTERS | Genes involved in Metal ion SLC transporters |
| 0.3 | 5.8 | REACTOME SYNTHESIS OF GLYCOSYLPHOSPHATIDYLINOSITOL GPI | Genes involved in Synthesis of glycosylphosphatidylinositol (GPI) |
| 0.3 | 3.4 | REACTOME MTORC1 MEDIATED SIGNALLING | Genes involved in mTORC1-mediated signalling |
| 0.3 | 1.0 | REACTOME DOWNREGULATION OF ERBB2 ERBB3 SIGNALING | Genes involved in Downregulation of ERBB2:ERBB3 signaling |
| 0.3 | 3.2 | REACTOME ADENYLATE CYCLASE ACTIVATING PATHWAY | Genes involved in Adenylate cyclase activating pathway |
| 0.3 | 2.8 | REACTOME REGULATION OF COMPLEMENT CASCADE | Genes involved in Regulation of Complement cascade |
| 0.3 | 3.3 | REACTOME FACILITATIVE NA INDEPENDENT GLUCOSE TRANSPORTERS | Genes involved in Facilitative Na+-independent glucose transporters |
| 0.3 | 0.9 | REACTOME XENOBIOTICS | Genes involved in Xenobiotics |
| 0.3 | 1.2 | REACTOME REGULATION OF IFNA SIGNALING | Genes involved in Regulation of IFNA signaling |
| 0.3 | 3.5 | REACTOME LIPOPROTEIN METABOLISM | Genes involved in Lipoprotein metabolism |
| 0.3 | 9.7 | REACTOME GLUCOSE TRANSPORT | Genes involved in Glucose transport |
| 0.3 | 8.6 | REACTOME AMINO ACID TRANSPORT ACROSS THE PLASMA MEMBRANE | Genes involved in Amino acid transport across the plasma membrane |
| 0.3 | 1.4 | REACTOME PKA MEDIATED PHOSPHORYLATION OF CREB | Genes involved in PKA-mediated phosphorylation of CREB |
| 0.3 | 3.1 | REACTOME ACTIVATED TAK1 MEDIATES P38 MAPK ACTIVATION | Genes involved in activated TAK1 mediates p38 MAPK activation |
| 0.3 | 3.3 | REACTOME PURINE SALVAGE | Genes involved in Purine salvage |
| 0.3 | 2.2 | REACTOME PROSTANOID LIGAND RECEPTORS | Genes involved in Prostanoid ligand receptors |
| 0.3 | 4.4 | REACTOME ACYL CHAIN REMODELLING OF PG | Genes involved in Acyl chain remodelling of PG |
| 0.3 | 7.4 | REACTOME SYNTHESIS OF PIPS AT THE PLASMA MEMBRANE | Genes involved in Synthesis of PIPs at the plasma membrane |
| 0.3 | 2.6 | REACTOME REGULATION OF IFNG SIGNALING | Genes involved in Regulation of IFNG signaling |
| 0.3 | 4.9 | REACTOME DEPOSITION OF NEW CENPA CONTAINING NUCLEOSOMES AT THE CENTROMERE | Genes involved in Deposition of New CENPA-containing Nucleosomes at the Centromere |
| 0.3 | 7.5 | REACTOME SEMA4D IN SEMAPHORIN SIGNALING | Genes involved in Sema4D in semaphorin signaling |
| 0.2 | 3.5 | REACTOME DESTABILIZATION OF MRNA BY BRF1 | Genes involved in Destabilization of mRNA by Butyrate Response Factor 1 (BRF1) |
| 0.2 | 1.7 | REACTOME GRB2 SOS PROVIDES LINKAGE TO MAPK SIGNALING FOR INTERGRINS | Genes involved in GRB2:SOS provides linkage to MAPK signaling for Intergrins |
| 0.2 | 6.1 | REACTOME REGULATION OF BETA CELL DEVELOPMENT | Genes involved in Regulation of beta-cell development |
| 0.2 | 2.6 | REACTOME SIGNALING BY FGFR3 MUTANTS | Genes involved in Signaling by FGFR3 mutants |
| 0.2 | 3.3 | REACTOME SYNTHESIS OF BILE ACIDS AND BILE SALTS VIA 7ALPHA HYDROXYCHOLESTEROL | Genes involved in Synthesis of bile acids and bile salts via 7alpha-hydroxycholesterol |
| 0.2 | 1.7 | REACTOME ERKS ARE INACTIVATED | Genes involved in ERKs are inactivated |
| 0.2 | 3.3 | REACTOME VIRAL MESSENGER RNA SYNTHESIS | Genes involved in Viral Messenger RNA Synthesis |
| 0.2 | 3.3 | REACTOME CYCLIN A B1 ASSOCIATED EVENTS DURING G2 M TRANSITION | Genes involved in Cyclin A/B1 associated events during G2/M transition |
| 0.2 | 3.1 | REACTOME PEROXISOMAL LIPID METABOLISM | Genes involved in Peroxisomal lipid metabolism |
| 0.2 | 0.5 | REACTOME FGFR2C LIGAND BINDING AND ACTIVATION | Genes involved in FGFR2c ligand binding and activation |
| 0.2 | 0.2 | REACTOME SIGNAL AMPLIFICATION | Genes involved in Signal amplification |
| 0.2 | 0.2 | REACTOME P130CAS LINKAGE TO MAPK SIGNALING FOR INTEGRINS | Genes involved in p130Cas linkage to MAPK signaling for integrins |
| 0.2 | 1.6 | REACTOME ACYL CHAIN REMODELLING OF PE | Genes involved in Acyl chain remodelling of PE |
| 0.2 | 2.0 | REACTOME POST TRANSLATIONAL MODIFICATION SYNTHESIS OF GPI ANCHORED PROTEINS | Genes involved in Post-translational modification: synthesis of GPI-anchored proteins |
| 0.2 | 3.0 | REACTOME TRAF3 DEPENDENT IRF ACTIVATION PATHWAY | Genes involved in TRAF3-dependent IRF activation pathway |
| 0.2 | 3.5 | REACTOME SHC1 EVENTS IN ERBB4 SIGNALING | Genes involved in SHC1 events in ERBB4 signaling |
| 0.2 | 1.9 | REACTOME TRYPTOPHAN CATABOLISM | Genes involved in Tryptophan catabolism |
| 0.2 | 5.9 | REACTOME TIGHT JUNCTION INTERACTIONS | Genes involved in Tight junction interactions |
| 0.2 | 1.5 | REACTOME ARMS MEDIATED ACTIVATION | Genes involved in ARMS-mediated activation |
| 0.2 | 0.4 | REACTOME INFLUENZA LIFE CYCLE | Genes involved in Influenza Life Cycle |
| 0.2 | 0.8 | REACTOME GAMMA CARBOXYLATION TRANSPORT AND AMINO TERMINAL CLEAVAGE OF PROTEINS | Genes involved in Gamma-carboxylation, transport, and amino-terminal cleavage of proteins |
| 0.2 | 3.3 | REACTOME TRANSCRIPTIONAL ACTIVITY OF SMAD2 SMAD3 SMAD4 HETEROTRIMER | Genes involved in Transcriptional activity of SMAD2/SMAD3:SMAD4 heterotrimer |
| 0.2 | 0.8 | REACTOME RNA POL I PROMOTER OPENING | Genes involved in RNA Polymerase I Promoter Opening |
| 0.2 | 1.4 | REACTOME APOPTOSIS INDUCED DNA FRAGMENTATION | Genes involved in Apoptosis induced DNA fragmentation |
| 0.2 | 3.2 | REACTOME POST CHAPERONIN TUBULIN FOLDING PATHWAY | Genes involved in Post-chaperonin tubulin folding pathway |
| 0.2 | 1.0 | REACTOME RNA POL III TRANSCRIPTION INITIATION FROM TYPE 2 PROMOTER | Genes involved in RNA Polymerase III Transcription Initiation From Type 2 Promoter |
| 0.2 | 3.4 | REACTOME FANCONI ANEMIA PATHWAY | Genes involved in Fanconi Anemia pathway |
| 0.2 | 2.0 | REACTOME CTNNB1 PHOSPHORYLATION CASCADE | Genes involved in Beta-catenin phosphorylation cascade |
| 0.2 | 2.7 | REACTOME DEADENYLATION OF MRNA | Genes involved in Deadenylation of mRNA |
| 0.2 | 2.4 | REACTOME INTRINSIC PATHWAY | Genes involved in Intrinsic Pathway |
| 0.2 | 2.6 | REACTOME GLYCEROPHOSPHOLIPID BIOSYNTHESIS | Genes involved in Glycerophospholipid biosynthesis |
| 0.2 | 1.1 | REACTOME AKT PHOSPHORYLATES TARGETS IN THE CYTOSOL | Genes involved in AKT phosphorylates targets in the cytosol |
| 0.2 | 2.7 | REACTOME GLUCONEOGENESIS | Genes involved in Gluconeogenesis |
| 0.2 | 1.8 | REACTOME LYSOSOME VESICLE BIOGENESIS | Genes involved in Lysosome Vesicle Biogenesis |
| 0.2 | 3.9 | REACTOME ANTIVIRAL MECHANISM BY IFN STIMULATED GENES | Genes involved in Antiviral mechanism by IFN-stimulated genes |
| 0.2 | 12.7 | REACTOME MHC CLASS II ANTIGEN PRESENTATION | Genes involved in MHC class II antigen presentation |
| 0.2 | 0.5 | REACTOME INFLUENZA VIRAL RNA TRANSCRIPTION AND REPLICATION | Genes involved in Influenza Viral RNA Transcription and Replication |
| 0.2 | 7.6 | REACTOME METABOLISM OF VITAMINS AND COFACTORS | Genes involved in Metabolism of vitamins and cofactors |
| 0.2 | 0.5 | REACTOME VIF MEDIATED DEGRADATION OF APOBEC3G | Genes involved in Vif-mediated degradation of APOBEC3G |
| 0.2 | 3.3 | REACTOME RORA ACTIVATES CIRCADIAN EXPRESSION | Genes involved in RORA Activates Circadian Expression |
| 0.2 | 7.0 | REACTOME CHEMOKINE RECEPTORS BIND CHEMOKINES | Genes involved in Chemokine receptors bind chemokines |
| 0.2 | 3.8 | REACTOME GLYCOSPHINGOLIPID METABOLISM | Genes involved in Glycosphingolipid metabolism |
| 0.2 | 0.7 | REACTOME JNK C JUN KINASES PHOSPHORYLATION AND ACTIVATION MEDIATED BY ACTIVATED HUMAN TAK1 | Genes involved in JNK (c-Jun kinases) phosphorylation and activation mediated by activated human TAK1 |
| 0.2 | 10.3 | REACTOME FACTORS INVOLVED IN MEGAKARYOCYTE DEVELOPMENT AND PLATELET PRODUCTION | Genes involved in Factors involved in megakaryocyte development and platelet production |
| 0.2 | 2.0 | REACTOME PHOSPHORYLATION OF THE APC C | Genes involved in Phosphorylation of the APC/C |
| 0.2 | 3.2 | REACTOME MEIOTIC RECOMBINATION | Genes involved in Meiotic Recombination |
| 0.2 | 1.3 | REACTOME HORMONE SENSITIVE LIPASE HSL MEDIATED TRIACYLGLYCEROL HYDROLYSIS | Genes involved in Hormone-sensitive lipase (HSL)-mediated triacylglycerol hydrolysis |
| 0.2 | 1.4 | REACTOME CASPASE MEDIATED CLEAVAGE OF CYTOSKELETAL PROTEINS | Genes involved in Caspase-mediated cleavage of cytoskeletal proteins |
| 0.1 | 2.1 | REACTOME COMPLEMENT CASCADE | Genes involved in Complement cascade |
| 0.1 | 3.4 | REACTOME TRANSPORT TO THE GOLGI AND SUBSEQUENT MODIFICATION | Genes involved in Transport to the Golgi and subsequent modification |
| 0.1 | 1.6 | REACTOME PURINE RIBONUCLEOSIDE MONOPHOSPHATE BIOSYNTHESIS | Genes involved in Purine ribonucleoside monophosphate biosynthesis |
| 0.1 | 2.1 | REACTOME BASIGIN INTERACTIONS | Genes involved in Basigin interactions |
| 0.1 | 1.8 | REACTOME SYNTHESIS OF PA | Genes involved in Synthesis of PA |
| 0.1 | 0.1 | REACTOME MRNA DECAY BY 3 TO 5 EXORIBONUCLEASE | Genes involved in mRNA Decay by 3' to 5' Exoribonuclease |
| 0.1 | 0.6 | REACTOME ELONGATION ARREST AND RECOVERY | Genes involved in Elongation arrest and recovery |
| 0.1 | 0.6 | REACTOME GPVI MEDIATED ACTIVATION CASCADE | Genes involved in GPVI-mediated activation cascade |
| 0.1 | 0.9 | REACTOME PLATELET ADHESION TO EXPOSED COLLAGEN | Genes involved in Platelet Adhesion to exposed collagen |
| 0.1 | 1.1 | REACTOME ELEVATION OF CYTOSOLIC CA2 LEVELS | Genes involved in Elevation of cytosolic Ca2+ levels |
| 0.1 | 0.6 | REACTOME DIGESTION OF DIETARY CARBOHYDRATE | Genes involved in Digestion of dietary carbohydrate |
| 0.1 | 0.3 | REACTOME DESTABILIZATION OF MRNA BY TRISTETRAPROLIN TTP | Genes involved in Destabilization of mRNA by Tristetraprolin (TTP) |
| 0.1 | 2.3 | REACTOME RNA POL I TRANSCRIPTION INITIATION | Genes involved in RNA Polymerase I Transcription Initiation |
| 0.1 | 2.5 | REACTOME RNA POL III TRANSCRIPTION INITIATION FROM TYPE 3 PROMOTER | Genes involved in RNA Polymerase III Transcription Initiation From Type 3 Promoter |
| 0.1 | 1.8 | REACTOME AMINO ACID SYNTHESIS AND INTERCONVERSION TRANSAMINATION | Genes involved in Amino acid synthesis and interconversion (transamination) |
| 0.1 | 1.1 | REACTOME TRAF6 MEDIATED NFKB ACTIVATION | Genes involved in TRAF6 mediated NF-kB activation |
| 0.1 | 4.1 | REACTOME METABOLISM OF STEROID HORMONES AND VITAMINS A AND D | Genes involved in Metabolism of steroid hormones and vitamins A and D |
| 0.1 | 0.5 | REACTOME RECYCLING OF BILE ACIDS AND SALTS | Genes involved in Recycling of bile acids and salts |
| 0.1 | 3.6 | REACTOME SIGNALING BY SCF KIT | Genes involved in Signaling by SCF-KIT |
| 0.1 | 3.5 | REACTOME SPHINGOLIPID DE NOVO BIOSYNTHESIS | Genes involved in Sphingolipid de novo biosynthesis |
| 0.1 | 1.0 | REACTOME THE ROLE OF NEF IN HIV1 REPLICATION AND DISEASE PATHOGENESIS | Genes involved in The role of Nef in HIV-1 replication and disease pathogenesis |
| 0.1 | 1.3 | REACTOME NA CL DEPENDENT NEUROTRANSMITTER TRANSPORTERS | Genes involved in Na+/Cl- dependent neurotransmitter transporters |
| 0.1 | 3.5 | REACTOME ION TRANSPORT BY P TYPE ATPASES | Genes involved in Ion transport by P-type ATPases |
| 0.1 | 4.5 | REACTOME AMINE LIGAND BINDING RECEPTORS | Genes involved in Amine ligand-binding receptors |
| 0.1 | 0.3 | REACTOME REGULATED PROTEOLYSIS OF P75NTR | Genes involved in Regulated proteolysis of p75NTR |
| 0.1 | 0.3 | REACTOME TRAF6 MEDIATED IRF7 ACTIVATION | Genes involved in TRAF6 mediated IRF7 activation |
| 0.1 | 3.0 | REACTOME BIOSYNTHESIS OF THE N GLYCAN PRECURSOR DOLICHOL LIPID LINKED OLIGOSACCHARIDE LLO AND TRANSFER TO A NASCENT PROTEIN | Genes involved in Biosynthesis of the N-glycan precursor (dolichol lipid-linked oligosaccharide, LLO) and transfer to a nascent protein |
| 0.1 | 0.9 | REACTOME MEMBRANE BINDING AND TARGETTING OF GAG PROTEINS | Genes involved in Membrane binding and targetting of GAG proteins |
| 0.1 | 0.5 | REACTOME REGULATION OF HYPOXIA INDUCIBLE FACTOR HIF BY OXYGEN | Genes involved in Regulation of Hypoxia-inducible Factor (HIF) by Oxygen |
| 0.1 | 7.0 | REACTOME TRANSPORT OF INORGANIC CATIONS ANIONS AND AMINO ACIDS OLIGOPEPTIDES | Genes involved in Transport of inorganic cations/anions and amino acids/oligopeptides |
| 0.1 | 0.9 | REACTOME NRIF SIGNALS CELL DEATH FROM THE NUCLEUS | Genes involved in NRIF signals cell death from the nucleus |
| 0.1 | 0.2 | REACTOME SPRY REGULATION OF FGF SIGNALING | Genes involved in Spry regulation of FGF signaling |
| 0.1 | 0.3 | REACTOME IRAK1 RECRUITS IKK COMPLEX | Genes involved in IRAK1 recruits IKK complex |
| 0.1 | 1.2 | REACTOME G1 PHASE | Genes involved in G1 Phase |
| 0.1 | 0.7 | REACTOME REMOVAL OF THE FLAP INTERMEDIATE FROM THE C STRAND | Genes involved in Removal of the Flap Intermediate from the C-strand |
| 0.1 | 0.2 | REACTOME DESTABILIZATION OF MRNA BY AUF1 HNRNP D0 | Genes involved in Destabilization of mRNA by AUF1 (hnRNP D0) |
| 0.1 | 1.8 | REACTOME ASPARAGINE N LINKED GLYCOSYLATION | Genes involved in Asparagine N-linked glycosylation |
| 0.1 | 0.9 | REACTOME REGULATION OF INSULIN SECRETION BY GLUCAGON LIKE PEPTIDE1 | Genes involved in Regulation of Insulin Secretion by Glucagon-like Peptide-1 |
| 0.1 | 1.1 | REACTOME BMAL1 CLOCK NPAS2 ACTIVATES CIRCADIAN EXPRESSION | Genes involved in BMAL1:CLOCK/NPAS2 Activates Circadian Expression |
| 0.1 | 1.2 | REACTOME ORGANIC CATION ANION ZWITTERION TRANSPORT | Genes involved in Organic cation/anion/zwitterion transport |
| 0.1 | 1.3 | REACTOME TGF BETA RECEPTOR SIGNALING ACTIVATES SMADS | Genes involved in TGF-beta receptor signaling activates SMADs |
| 0.1 | 10.0 | REACTOME NONSENSE MEDIATED DECAY ENHANCED BY THE EXON JUNCTION COMPLEX | Genes involved in Nonsense Mediated Decay Enhanced by the Exon Junction Complex |
| 0.1 | 1.4 | REACTOME ABCA TRANSPORTERS IN LIPID HOMEOSTASIS | Genes involved in ABCA transporters in lipid homeostasis |
| 0.1 | 2.6 | REACTOME ASSOCIATION OF TRIC CCT WITH TARGET PROTEINS DURING BIOSYNTHESIS | Genes involved in Association of TriC/CCT with target proteins during biosynthesis |
| 0.1 | 0.2 | REACTOME CDC6 ASSOCIATION WITH THE ORC ORIGIN COMPLEX | Genes involved in CDC6 association with the ORC:origin complex |
| 0.1 | 4.5 | REACTOME RESPONSE TO ELEVATED PLATELET CYTOSOLIC CA2 | Genes involved in Response to elevated platelet cytosolic Ca2+ |
| 0.1 | 2.6 | REACTOME MRNA 3 END PROCESSING | Genes involved in mRNA 3'-end processing |
| 0.1 | 0.2 | REACTOME G2 M DNA DAMAGE CHECKPOINT | Genes involved in G2/M DNA damage checkpoint |
| 0.1 | 0.3 | REACTOME CIRCADIAN CLOCK | Genes involved in Circadian Clock |
| 0.1 | 4.8 | REACTOME UNFOLDED PROTEIN RESPONSE | Genes involved in Unfolded Protein Response |
| 0.1 | 0.5 | REACTOME REGULATION OF MRNA STABILITY BY PROTEINS THAT BIND AU RICH ELEMENTS | Genes involved in Regulation of mRNA Stability by Proteins that Bind AU-rich Elements |
| 0.1 | 0.7 | REACTOME COPI MEDIATED TRANSPORT | Genes involved in COPI Mediated Transport |
| 0.1 | 1.0 | REACTOME RECYCLING PATHWAY OF L1 | Genes involved in Recycling pathway of L1 |
| 0.1 | 1.0 | REACTOME NEGATIVE REGULATORS OF RIG I MDA5 SIGNALING | Genes involved in Negative regulators of RIG-I/MDA5 signaling |
| 0.1 | 1.6 | REACTOME SYNTHESIS OF PC | Genes involved in Synthesis of PC |
| 0.1 | 0.3 | REACTOME ABACAVIR TRANSPORT AND METABOLISM | Genes involved in Abacavir transport and metabolism |
| 0.1 | 0.6 | REACTOME PD1 SIGNALING | Genes involved in PD-1 signaling |
| 0.1 | 1.4 | REACTOME ANTIGEN PROCESSING CROSS PRESENTATION | Genes involved in Antigen processing-Cross presentation |
| 0.1 | 0.2 | REACTOME SIGNALLING TO P38 VIA RIT AND RIN | Genes involved in Signalling to p38 via RIT and RIN |
| 0.1 | 5.4 | REACTOME RESPIRATORY ELECTRON TRANSPORT | Genes involved in Respiratory electron transport |
| 0.1 | 0.3 | REACTOME BETA DEFENSINS | Genes involved in Beta defensins |
| 0.1 | 1.0 | REACTOME ANTIGEN ACTIVATES B CELL RECEPTOR LEADING TO GENERATION OF SECOND MESSENGERS | Genes involved in Antigen Activates B Cell Receptor Leading to Generation of Second Messengers |
| 0.1 | 0.9 | REACTOME GLYCOGEN BREAKDOWN GLYCOGENOLYSIS | Genes involved in Glycogen breakdown (glycogenolysis) |
| 0.1 | 0.6 | REACTOME HYALURONAN UPTAKE AND DEGRADATION | Genes involved in Hyaluronan uptake and degradation |
| 0.1 | 0.4 | REACTOME HS GAG DEGRADATION | Genes involved in HS-GAG degradation |
| 0.1 | 1.0 | REACTOME PRE NOTCH EXPRESSION AND PROCESSING | Genes involved in Pre-NOTCH Expression and Processing |
| 0.1 | 0.2 | REACTOME OLFACTORY SIGNALING PATHWAY | Genes involved in Olfactory Signaling Pathway |
| 0.1 | 1.6 | REACTOME CYTOSOLIC TRNA AMINOACYLATION | Genes involved in Cytosolic tRNA aminoacylation |
| 0.1 | 3.0 | REACTOME CYCLIN E ASSOCIATED EVENTS DURING G1 S TRANSITION | Genes involved in Cyclin E associated events during G1/S transition |
| 0.1 | 0.6 | REACTOME G0 AND EARLY G1 | Genes involved in G0 and Early G1 |
| 0.1 | 1.4 | REACTOME LATE PHASE OF HIV LIFE CYCLE | Genes involved in Late Phase of HIV Life Cycle |
| 0.1 | 2.2 | REACTOME IMMUNOREGULATORY INTERACTIONS BETWEEN A LYMPHOID AND A NON LYMPHOID CELL | Genes involved in Immunoregulatory interactions between a Lymphoid and a non-Lymphoid cell |
| 0.1 | 0.5 | REACTOME PREFOLDIN MEDIATED TRANSFER OF SUBSTRATE TO CCT TRIC | Genes involved in Prefoldin mediated transfer of substrate to CCT/TriC |
| 0.1 | 0.6 | REACTOME PYRIMIDINE CATABOLISM | Genes involved in Pyrimidine catabolism |
| 0.1 | 1.4 | REACTOME CHOLESTEROL BIOSYNTHESIS | Genes involved in Cholesterol biosynthesis |
| 0.1 | 0.1 | REACTOME ACYL CHAIN REMODELLING OF PI | Genes involved in Acyl chain remodelling of PI |
| 0.1 | 1.0 | REACTOME EXTENSION OF TELOMERES | Genes involved in Extension of Telomeres |
| 0.1 | 0.7 | REACTOME GABA SYNTHESIS RELEASE REUPTAKE AND DEGRADATION | Genes involved in GABA synthesis, release, reuptake and degradation |
| 0.1 | 0.7 | REACTOME MRNA DECAY BY 5 TO 3 EXORIBONUCLEASE | Genes involved in mRNA Decay by 5' to 3' Exoribonuclease |
| 0.1 | 0.7 | REACTOME PROTEOLYTIC CLEAVAGE OF SNARE COMPLEX PROTEINS | Genes involved in Proteolytic cleavage of SNARE complex proteins |
| 0.1 | 0.1 | REACTOME SIGNALING BY TGF BETA RECEPTOR COMPLEX | Genes involved in Signaling by TGF-beta Receptor Complex |
| 0.1 | 2.3 | REACTOME TRANSLATION | Genes involved in Translation |
| 0.1 | 1.7 | REACTOME O LINKED GLYCOSYLATION OF MUCINS | Genes involved in O-linked glycosylation of mucins |
| 0.1 | 0.3 | REACTOME G1 S SPECIFIC TRANSCRIPTION | Genes involved in G1/S-Specific Transcription |
| 0.1 | 0.9 | REACTOME FATTY ACYL COA BIOSYNTHESIS | Genes involved in Fatty Acyl-CoA Biosynthesis |
| 0.1 | 1.8 | REACTOME NRAGE SIGNALS DEATH THROUGH JNK | Genes involved in NRAGE signals death through JNK |
| 0.1 | 0.1 | REACTOME ACETYLCHOLINE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Acetylcholine Neurotransmitter Release Cycle |
| 0.1 | 0.4 | REACTOME PURINE CATABOLISM | Genes involved in Purine catabolism |
| 0.1 | 0.7 | REACTOME SMOOTH MUSCLE CONTRACTION | Genes involved in Smooth Muscle Contraction |
| 0.1 | 0.2 | REACTOME SYNTHESIS OF PE | Genes involved in Synthesis of PE |
| 0.1 | 1.0 | REACTOME DEGRADATION OF THE EXTRACELLULAR MATRIX | Genes involved in Degradation of the extracellular matrix |
| 0.0 | 1.8 | REACTOME CELL JUNCTION ORGANIZATION | Genes involved in Cell junction organization |
| 0.0 | 3.1 | REACTOME SIGNALING BY RHO GTPASES | Genes involved in Signaling by Rho GTPases |
| 0.0 | 0.1 | REACTOME RIG I MDA5 MEDIATED INDUCTION OF IFN ALPHA BETA PATHWAYS | Genes involved in RIG-I/MDA5 mediated induction of IFN-alpha/beta pathways |
| 0.0 | 0.3 | REACTOME KERATAN SULFATE DEGRADATION | Genes involved in Keratan sulfate degradation |
| 0.0 | 0.0 | REACTOME P75NTR RECRUITS SIGNALLING COMPLEXES | Genes involved in p75NTR recruits signalling complexes |
| 0.0 | 0.9 | REACTOME MUSCLE CONTRACTION | Genes involved in Muscle contraction |
| 0.0 | 2.2 | REACTOME MRNA SPLICING | Genes involved in mRNA Splicing |
| 0.0 | 1.0 | REACTOME GOLGI ASSOCIATED VESICLE BIOGENESIS | Genes involved in Golgi Associated Vesicle Biogenesis |
| 0.0 | 0.7 | REACTOME TRANSPORT OF GLUCOSE AND OTHER SUGARS BILE SALTS AND ORGANIC ACIDS METAL IONS AND AMINE COMPOUNDS | Genes involved in Transport of glucose and other sugars, bile salts and organic acids, metal ions and amine compounds |
| 0.0 | 4.5 | REACTOME METABOLISM OF AMINO ACIDS AND DERIVATIVES | Genes involved in Metabolism of amino acids and derivatives |
| 0.0 | 0.0 | REACTOME SYNTHESIS OF BILE ACIDS AND BILE SALTS | Genes involved in Synthesis of bile acids and bile salts |
| 0.0 | 0.4 | REACTOME CYTOSOLIC SULFONATION OF SMALL MOLECULES | Genes involved in Cytosolic sulfonation of small molecules |
| 0.0 | 0.6 | REACTOME NUCLEOTIDE LIKE PURINERGIC RECEPTORS | Genes involved in Nucleotide-like (purinergic) receptors |
| 0.0 | 0.5 | REACTOME CLASS C 3 METABOTROPIC GLUTAMATE PHEROMONE RECEPTORS | Genes involved in Class C/3 (Metabotropic glutamate/pheromone receptors) |
| 0.0 | 0.1 | REACTOME FORMATION OF FIBRIN CLOT CLOTTING CASCADE | Genes involved in Formation of Fibrin Clot (Clotting Cascade) |
| 0.0 | 0.7 | REACTOME PHASE1 FUNCTIONALIZATION OF COMPOUNDS | Genes involved in Phase 1 - Functionalization of compounds |
| 0.0 | 0.4 | REACTOME IL 2 SIGNALING | Genes involved in Interleukin-2 signaling |
| 0.0 | 0.7 | REACTOME LATENT INFECTION OF HOMO SAPIENS WITH MYCOBACTERIUM TUBERCULOSIS | Genes involved in Latent infection of Homo sapiens with Mycobacterium tuberculosis |
| 0.0 | 0.0 | REACTOME THROMBIN SIGNALLING THROUGH PROTEINASE ACTIVATED RECEPTORS PARS | Genes involved in Thrombin signalling through proteinase activated receptors (PARs) |
| 0.0 | 0.3 | REACTOME PYRIMIDINE METABOLISM | Genes involved in Pyrimidine metabolism |
| 0.0 | 1.1 | REACTOME NUCLEAR RECEPTOR TRANSCRIPTION PATHWAY | Genes involved in Nuclear Receptor transcription pathway |
| 0.0 | 0.2 | REACTOME SIGNALING BY ERBB4 | Genes involved in Signaling by ERBB4 |
| 0.0 | 0.7 | REACTOME CHROMOSOME MAINTENANCE | Genes involved in Chromosome Maintenance |
| 0.0 | 1.0 | REACTOME EXTRACELLULAR MATRIX ORGANIZATION | Genes involved in Extracellular matrix organization |
| 0.0 | 0.0 | REACTOME CD28 DEPENDENT VAV1 PATHWAY | Genes involved in CD28 dependent Vav1 pathway |
| 0.0 | 0.4 | REACTOME ENDOSOMAL SORTING COMPLEX REQUIRED FOR TRANSPORT ESCRT | Genes involved in Endosomal Sorting Complex Required For Transport (ESCRT) |
| 0.0 | 0.1 | REACTOME FORMATION OF TRANSCRIPTION COUPLED NER TC NER REPAIR COMPLEX | Genes involved in Formation of transcription-coupled NER (TC-NER) repair complex |
| 0.0 | 0.2 | REACTOME TRAFFICKING AND PROCESSING OF ENDOSOMAL TLR | Genes involved in Trafficking and processing of endosomal TLR |
| 0.0 | 0.2 | REACTOME REGULATION OF MITOTIC CELL CYCLE | Genes involved in Regulation of mitotic cell cycle |
| 0.0 | 0.3 | REACTOME RESOLUTION OF AP SITES VIA THE SINGLE NUCLEOTIDE REPLACEMENT PATHWAY | Genes involved in Resolution of AP sites via the single-nucleotide replacement pathway |
| 0.0 | 1.8 | REACTOME FATTY ACID TRIACYLGLYCEROL AND KETONE BODY METABOLISM | Genes involved in Fatty acid, triacylglycerol, and ketone body metabolism |
| 0.0 | 0.9 | REACTOME NCAM1 INTERACTIONS | Genes involved in NCAM1 interactions |
| 0.0 | 0.1 | REACTOME CTLA4 INHIBITORY SIGNALING | Genes involved in CTLA4 inhibitory signaling |
| 0.0 | 0.0 | REACTOME CELL DEATH SIGNALLING VIA NRAGE NRIF AND NADE | Genes involved in Cell death signalling via NRAGE, NRIF and NADE |
| 0.0 | 0.1 | REACTOME KERATAN SULFATE BIOSYNTHESIS | Genes involved in Keratan sulfate biosynthesis |
| 0.0 | 0.0 | REACTOME BOTULINUM NEUROTOXICITY | Genes involved in Botulinum neurotoxicity |
| 0.0 | 0.2 | REACTOME OPSINS | Genes involved in Opsins |
| 0.0 | 0.0 | REACTOME ACTIVATION OF THE AP1 FAMILY OF TRANSCRIPTION FACTORS | Genes involved in Activation of the AP-1 family of transcription factors |
| 0.0 | 0.0 | REACTOME PROLONGED ERK ACTIVATION EVENTS | Genes involved in Prolonged ERK activation events |
| 0.0 | 0.0 | REACTOME DOWNSTREAM TCR SIGNALING | Genes involved in Downstream TCR signaling |
| 0.0 | 0.4 | REACTOME GAP JUNCTION TRAFFICKING | Genes involved in Gap junction trafficking |
| 0.0 | 2.1 | REACTOME ANTIGEN PROCESSING UBIQUITINATION PROTEASOME DEGRADATION | Genes involved in Antigen processing: Ubiquitination & Proteasome degradation |
| 0.0 | 0.1 | REACTOME EXTRINSIC PATHWAY FOR APOPTOSIS | Genes involved in Extrinsic Pathway for Apoptosis |
| 0.0 | 0.0 | REACTOME PI3K CASCADE | Genes involved in PI3K Cascade |
| 0.0 | 0.1 | REACTOME GLUCOSE METABOLISM | Genes involved in Glucose metabolism |
| 0.0 | 0.1 | REACTOME RIP MEDIATED NFKB ACTIVATION VIA DAI | Genes involved in RIP-mediated NFkB activation via DAI |
| 0.0 | 0.0 | REACTOME FGFR4 LIGAND BINDING AND ACTIVATION | Genes involved in FGFR4 ligand binding and activation |
| 0.0 | 0.0 | REACTOME G ALPHA1213 SIGNALLING EVENTS | Genes involved in G alpha (12/13) signalling events |
| 0.0 | 0.0 | REACTOME RETROGRADE NEUROTROPHIN SIGNALLING | Genes involved in Retrograde neurotrophin signalling |
| 0.0 | 0.0 | REACTOME G ALPHA S SIGNALLING EVENTS | Genes involved in G alpha (s) signalling events |
| 0.0 | 0.1 | REACTOME PRESYNAPTIC NICOTINIC ACETYLCHOLINE RECEPTORS | Genes involved in Presynaptic nicotinic acetylcholine receptors |
| 0.0 | 0.2 | REACTOME APOPTOTIC CLEAVAGE OF CELLULAR PROTEINS | Genes involved in Apoptotic cleavage of cellular proteins |
| 0.0 | 0.1 | REACTOME EGFR DOWNREGULATION | Genes involved in EGFR downregulation |
| 0.0 | 0.0 | REACTOME PKB MEDIATED EVENTS | Genes involved in PKB-mediated events |