| Gene Symbol | Gene ID | Gene Info |
|---|---|---|
|
Tcf7l1
|
ENSMUSG00000055799.7 | transcription factor 7 like 1 (T cell specific, HMG box) |
| CRE | Gene | Distance | Association probability | Pearson corr. coef. | P-value | Plot |
|---|---|---|---|---|---|---|
| chr6_72677174_72677442 | Tcf7l1 | 5904 | 0.114969 | 0.73 | 3.8e-10 | Click! |
| chr6_72789478_72789794 | Tcf7l1 | 382 | 0.848015 | 0.63 | 3.1e-07 | Click! |
| chr6_72684365_72684516 | Tcf7l1 | 13036 | 0.105849 | 0.63 | 3.2e-07 | Click! |
| chr6_72788330_72789466 | Tcf7l1 | 54 | 0.972803 | 0.61 | 8.8e-07 | Click! |
| chr6_72677516_72678155 | Tcf7l1 | 6431 | 0.113307 | 0.60 | 1.4e-06 | Click! |
Move your cursor over a bar to see sample name and corresponding Z-value.
| Cis Regulatory Element (CRE) | Target Score | Top associated gene | Gene Info | Distance of CRE to TSS | CRE/Gene association probability |
|---|---|---|---|---|---|
| chr9_64233716_64234023 | 5.16 |
Uchl4 |
ubiquitin carboxyl-terminal esterase L4 |
1332 |
0.25 |
| chr1_37666566_37667022 | 4.98 |
4930470B04Rik |
RIKEN cDNA 4930470B04 gene |
6072 |
0.19 |
| chr2_60688910_60689539 | 4.82 |
Itgb6 |
integrin beta 6 |
15470 |
0.23 |
| chr5_29212022_29212432 | 4.67 |
Gm7420 |
predicted gene 7420 |
5497 |
0.22 |
| chr10_39659287_39660442 | 4.59 |
2900078I11Rik |
RIKEN cDNA 2900078I11 gene |
1438 |
0.28 |
| chr3_63412374_63412525 | 4.26 |
Gm34240 |
predicted gene, 34240 |
26802 |
0.19 |
| chr7_72215636_72215807 | 4.00 |
Mctp2 |
multiple C2 domains, transmembrane 2 |
13639 |
0.25 |
| chr12_35824810_35824963 | 3.99 |
Gm9472 |
predicted gene 9472 |
5622 |
0.22 |
| chr13_53309706_53310161 | 3.84 |
Ror2 |
receptor tyrosine kinase-like orphan receptor 2 |
23809 |
0.2 |
| chr2_48494071_48494538 | 3.84 |
Gm13481 |
predicted gene 13481 |
37059 |
0.2 |
| chr2_152544681_152545047 | 3.81 |
Defb29 |
defensin beta 29 |
4766 |
0.08 |
| chr17_34370520_34370893 | 3.68 |
Btnl1 |
butyrophilin-like 1 |
6426 |
0.09 |
| chr11_97662287_97662616 | 3.67 |
Mllt6 |
myeloid/lymphoid or mixed-lineage leukemia; translocated to, 6 |
963 |
0.29 |
| chr9_60082413_60082595 | 3.62 |
Gm23668 |
predicted gene, 23668 |
40325 |
0.15 |
| chr5_30526130_30526325 | 3.61 |
Gm42765 |
predicted gene 42765 |
3230 |
0.17 |
| chr18_60657154_60657333 | 3.59 |
Synpo |
synaptopodin |
2899 |
0.24 |
| chr18_3616214_3616807 | 3.57 |
Gm50091 |
predicted gene, 50091 |
229 |
0.95 |
| chr17_87625601_87625768 | 3.51 |
Epcam |
epithelial cell adhesion molecule |
10295 |
0.19 |
| chr19_29835517_29835668 | 3.50 |
Ranbp6 |
RAN binding protein 6 |
22618 |
0.14 |
| chr11_96928787_96928959 | 3.48 |
Prr15l |
proline rich 15-like |
429 |
0.67 |
| chr5_119480667_119480839 | 3.36 |
Gm31314 |
predicted gene, 31314 |
47201 |
0.15 |
| chr17_71094535_71094686 | 3.33 |
Myom1 |
myomesin 1 |
8214 |
0.17 |
| chr2_70474448_70475421 | 3.30 |
Sp5 |
trans-acting transcription factor 5 |
11 |
0.97 |
| chr19_38054215_38055320 | 3.30 |
I830134H01Rik |
RIKEN cDNA I830134H01 gene |
239 |
0.48 |
| chr14_8430713_8430870 | 3.28 |
Gm8416 |
predicted gene 8416 |
21874 |
0.19 |
| chr15_41155438_41155783 | 3.23 |
4930555K19Rik |
RIKEN cDNA 4930555K19 gene |
17877 |
0.26 |
| chr6_50821735_50821970 | 3.21 |
Gm44109 |
predicted gene, 44109 |
18821 |
0.15 |
| chr2_32317120_32318698 | 3.21 |
Gm23363 |
predicted gene, 23363 |
356 |
0.45 |
| chr8_120876392_120876552 | 3.20 |
Gm26878 |
predicted gene, 26878 |
3734 |
0.28 |
| chr5_37895827_37896228 | 3.19 |
Gm20052 |
predicted gene, 20052 |
1320 |
0.5 |
| chr8_105406467_105406815 | 3.18 |
Kctd19 |
potassium channel tetramerisation domain containing 19 |
6815 |
0.1 |
| chr19_20406548_20406720 | 3.17 |
1500015L24Rik |
RIKEN cDNA 1500015L24 gene |
1323 |
0.45 |
| chr10_125896179_125896377 | 3.15 |
Lrig3 |
leucine-rich repeats and immunoglobulin-like domains 3 |
69890 |
0.13 |
| chr4_11762874_11763219 | 3.12 |
Cdh17 |
cadherin 17 |
4853 |
0.25 |
| chr7_46013301_46013656 | 3.10 |
Abcc6 |
ATP-binding cassette, sub-family C (CFTR/MRP), member 6 |
12409 |
0.11 |
| chr5_111113715_111114064 | 3.10 |
Gm43677 |
predicted gene 43677 |
44422 |
0.13 |
| chrX_6446527_6446724 | 3.08 |
Shroom4 |
shroom family member 4 |
30883 |
0.23 |
| chr4_128264499_128264831 | 3.06 |
Hmgb4os |
high-mobility group box 4, opposite strand |
3621 |
0.26 |
| chr14_27045023_27045220 | 3.04 |
Il17rd |
interleukin 17 receptor D |
5865 |
0.22 |
| chr13_72593421_72593574 | 3.02 |
Gm20554 |
predicted gene, 20554 |
35067 |
0.16 |
| chr13_53205183_53205803 | 3.00 |
Ror2 |
receptor tyrosine kinase-like orphan receptor 2 |
70165 |
0.11 |
| chr9_99032112_99032318 | 2.99 |
Gm1123 |
predicted gene 1123 |
3500 |
0.21 |
| chr17_74437779_74438075 | 2.98 |
Gm4708 |
predicted gene 4708 |
712 |
0.6 |
| chr11_96332280_96332439 | 2.97 |
Hoxb3 |
homeobox B3 |
4297 |
0.08 |
| chr14_27038788_27039646 | 2.97 |
Il17rd |
interleukin 17 receptor D |
39 |
0.98 |
| chr14_61012348_61012885 | 2.96 |
Tnfrsf19 |
tumor necrosis factor receptor superfamily, member 19 |
25275 |
0.18 |
| chr2_168532581_168532746 | 2.94 |
Nfatc2 |
nuclear factor of activated T cells, cytoplasmic, calcineurin dependent 2 |
19613 |
0.22 |
| chr13_7307078_7307229 | 2.93 |
Gm8725 |
predicted gene 8725 |
649 |
0.82 |
| chr10_95112925_95113076 | 2.92 |
Gm48868 |
predicted gene, 48868 |
3379 |
0.22 |
| chr4_9080063_9080259 | 2.88 |
Gm23423 |
predicted gene, 23423 |
129842 |
0.05 |
| chr14_80026102_80026356 | 2.86 |
Olfm4 |
olfactomedin 4 |
25927 |
0.19 |
| chr4_3082761_3083956 | 2.83 |
Vmn1r-ps2 |
vomeronasal 1 receptor, pseudogene 2 |
21234 |
0.18 |
| chr14_110728437_110728588 | 2.83 |
Gm26255 |
predicted gene, 26255 |
3524 |
0.24 |
| chr18_64189000_64189207 | 2.79 |
Gm45934 |
predicted gene, 45934 |
11424 |
0.16 |
| chr4_126149825_126150267 | 2.79 |
Eva1b |
eva-1 homolog B (C. elegans) |
1514 |
0.24 |
| chr13_68793568_68793719 | 2.77 |
Gm26929 |
predicted gene, 26929 |
16437 |
0.23 |
| chr1_153172459_153172671 | 2.76 |
Lamc2 |
laminin, gamma 2 |
13482 |
0.2 |
| chr18_83065219_83065408 | 2.75 |
1700095A13Rik |
RIKEN cDNA 1700095A13 gene |
14528 |
0.17 |
| chr8_61667080_61667345 | 2.75 |
Palld |
palladin, cytoskeletal associated protein |
76070 |
0.11 |
| chr14_61045932_61046347 | 2.75 |
Tnfrsf19 |
tumor necrosis factor receptor superfamily, member 19 |
330 |
0.9 |
| chr2_180306780_180306968 | 2.75 |
Rbbp8nl |
RBBP8 N-terminal like |
16995 |
0.11 |
| chr14_121103439_121103812 | 2.71 |
Farp1 |
FERM, RhoGEF (Arhgef) and pleckstrin domain protein 1 (chondrocyte-derived) |
1546 |
0.53 |
| chr4_56639385_56639652 | 2.69 |
Gm26144 |
predicted gene, 26144 |
39517 |
0.16 |
| chr6_114725354_114725573 | 2.69 |
Atg7 |
autophagy related 7 |
2363 |
0.25 |
| chr12_69437182_69437482 | 2.69 |
5830428M24Rik |
RIKEN cDNA 5830428M24 gene |
30060 |
0.12 |
| chr18_74539338_74539489 | 2.69 |
1700120E14Rik |
RIKEN cDNA 1700120E14 gene |
8289 |
0.25 |
| chr5_74137011_74137255 | 2.68 |
A330058E17Rik |
RIKEN cDNA A330058E17 gene |
38917 |
0.09 |
| chr6_134403760_134404081 | 2.68 |
4933406J09Rik |
RIKEN cDNA 4933406J09 gene |
505 |
0.76 |
| chr7_36133682_36133903 | 2.67 |
Rpl17-ps9 |
ribosomal protein L17, pseudogene 9 |
15518 |
0.22 |
| chr8_110040149_110040300 | 2.67 |
Chst4 |
carbohydrate sulfotransferase 4 |
484 |
0.71 |
| chr5_53196448_53196965 | 2.67 |
Sel1l3 |
sel-1 suppressor of lin-12-like 3 (C. elegans) |
16609 |
0.19 |
| chr4_100435665_100436137 | 2.65 |
Ube2u |
ubiquitin-conjugating enzyme E2U (putative) |
42948 |
0.16 |
| chr12_10128269_10128420 | 2.65 |
Gm5182 |
predicted gene 5182 |
23798 |
0.21 |
| chr16_44506996_44507670 | 2.64 |
Cfap44 |
cilia and flagella associated protein 44 |
36889 |
0.15 |
| chr3_138317262_138317413 | 2.64 |
Adh6a |
alcohol dehydrogenase 6A (class V) |
4051 |
0.14 |
| chr5_43549985_43550136 | 2.63 |
Gm15866 |
predicted gene 15866 |
7709 |
0.16 |
| chr5_119082830_119083079 | 2.62 |
1700081H04Rik |
RIKEN cDNA 1700081H04 gene |
25280 |
0.21 |
| chr12_8496248_8496772 | 2.62 |
Rhob |
ras homolog family member B |
3499 |
0.19 |
| chr17_83020661_83020861 | 2.61 |
Gm29052 |
predicted gene 29052 |
48144 |
0.14 |
| chr7_75415586_75415875 | 2.61 |
Gm44962 |
predicted gene 44962 |
5405 |
0.2 |
| chr8_88604116_88604818 | 2.60 |
Nkd1 |
naked cuticle 1 |
21662 |
0.15 |
| chr7_133933771_133933931 | 2.60 |
Gm23631 |
predicted gene, 23631 |
5890 |
0.24 |
| chr3_19513350_19513504 | 2.59 |
Dnajc5b |
DnaJ heat shock protein family (Hsp40) member C5 beta |
4812 |
0.24 |
| chr13_31327790_31327941 | 2.59 |
Gm11373 |
predicted gene 11373 |
2902 |
0.24 |
| chr15_85200642_85200968 | 2.58 |
Fbln1 |
fibulin 1 |
5144 |
0.2 |
| chr4_150003071_150003273 | 2.58 |
H6pd |
hexose-6-phosphate dehydrogenase (glucose 1-dehydrogenase) |
42 |
0.97 |
| chr5_4851971_4852249 | 2.56 |
Gm25037 |
predicted gene, 25037 |
2313 |
0.21 |
| chr10_120558195_120558387 | 2.54 |
Gm24298 |
predicted gene, 24298 |
47246 |
0.12 |
| chr2_91474779_91474930 | 2.53 |
Lrp4 |
low density lipoprotein receptor-related protein 4 |
1402 |
0.37 |
| chr9_59016181_59016332 | 2.53 |
Neo1 |
neogenin |
20169 |
0.21 |
| chr17_5770276_5770906 | 2.53 |
3300005D01Rik |
RIKEN cDNA 3300005D01 gene |
28066 |
0.15 |
| chr1_4538420_4538580 | 2.52 |
Gm38076 |
predicted gene, 38076 |
3214 |
0.17 |
| chr2_60703993_60704144 | 2.52 |
Itgb6 |
integrin beta 6 |
1510 |
0.48 |
| chr10_25387417_25387568 | 2.52 |
Epb41l2 |
erythrocyte membrane protein band 4.1 like 2 |
11167 |
0.19 |
| chr10_25333816_25333967 | 2.51 |
Epb41l2 |
erythrocyte membrane protein band 4.1 like 2 |
25907 |
0.14 |
| chr7_139310414_139310967 | 2.50 |
Gm32486 |
predicted gene, 32486 |
13825 |
0.18 |
| chr5_118978980_118979259 | 2.50 |
Gm43784 |
predicted gene 43784 |
17877 |
0.18 |
| chr14_59801992_59802186 | 2.50 |
Gm19716 |
predicted gene, 19716 |
159541 |
0.03 |
| chr17_87602799_87602995 | 2.49 |
Gm46587 |
predicted gene, 46587 |
31243 |
0.14 |
| chr15_37317843_37318026 | 2.49 |
Grhl2 |
grainyhead like transcription factor 2 |
469 |
0.77 |
| chr17_79739171_79739458 | 2.47 |
Gm33055 |
predicted gene, 33055 |
5440 |
0.18 |
| chr5_92808987_92809542 | 2.47 |
Shroom3 |
shroom family member 3 |
114 |
0.97 |
| chr3_84191595_84191840 | 2.46 |
Trim2 |
tripartite motif-containing 2 |
169 |
0.96 |
| chr16_93043047_93043198 | 2.46 |
Gm28003 |
predicted gene, 28003 |
29633 |
0.23 |
| chr3_39719006_39719170 | 2.46 |
Gm23796 |
predicted gene, 23796 |
52800 |
0.13 |
| chr11_52284356_52284524 | 2.46 |
Tcf7 |
transcription factor 7, T cell specific |
1109 |
0.43 |
| chr9_41877387_41877714 | 2.46 |
Gm48814 |
predicted gene, 48814 |
1231 |
0.33 |
| chr6_125355161_125355725 | 2.46 |
Tnfrsf1a |
tumor necrosis factor receptor superfamily, member 1a |
1928 |
0.22 |
| chr11_113052633_113053064 | 2.44 |
2610035D17Rik |
RIKEN cDNA 2610035D17 gene |
120229 |
0.06 |
| chr17_67950592_67950766 | 2.43 |
Arhgap28 |
Rho GTPase activating protein 28 |
261 |
0.95 |
| chr18_20457276_20457436 | 2.41 |
Dsg4 |
desmoglein 4 |
21181 |
0.17 |
| chr3_121864776_121864931 | 2.39 |
Gm42593 |
predicted gene 42593 |
2011 |
0.29 |
| chr1_164215252_164215410 | 2.39 |
Slc19a2 |
solute carrier family 19 (thiamine transporter), member 2 |
33715 |
0.11 |
| chr13_42346503_42346841 | 2.39 |
Gm47118 |
predicted gene, 47118 |
41681 |
0.16 |
| chr12_86091457_86091777 | 2.38 |
Ift43 |
intraflagellar transport 43 |
505 |
0.74 |
| chr6_135323608_135323833 | 2.38 |
Gm44275 |
predicted gene, 44275 |
4159 |
0.14 |
| chr5_127406373_127406552 | 2.37 |
9430087B13Rik |
RIKEN cDNA 9430087B13 gene |
97445 |
0.07 |
| chr12_75834120_75834271 | 2.36 |
Syne2 |
spectrin repeat containing, nuclear envelope 2 |
15845 |
0.24 |
| chr14_65718314_65718512 | 2.35 |
Scara5 |
scavenger receptor class A, member 5 |
41936 |
0.15 |
| chr12_112876473_112876704 | 2.33 |
1700127F24Rik |
RIKEN cDNA 1700127F24 gene |
774 |
0.45 |
| chr5_30526362_30526930 | 2.32 |
Gm42765 |
predicted gene 42765 |
2811 |
0.18 |
| chr4_95742887_95743038 | 2.31 |
Fggy |
FGGY carbohydrate kinase domain containing |
4554 |
0.32 |
| chr3_30977085_30977719 | 2.31 |
Gm2979 |
predicted gene 2979 |
2753 |
0.2 |
| chr4_65238564_65239062 | 2.30 |
Pappa |
pregnancy-associated plasma protein A |
114639 |
0.07 |
| chr13_49581589_49581747 | 2.30 |
Omd |
osteomodulin |
794 |
0.56 |
| chr17_45950538_45950689 | 2.30 |
Gm49805 |
predicted gene, 49805 |
11246 |
0.18 |
| chr15_59658827_59659108 | 2.29 |
Trib1 |
tribbles pseudokinase 1 |
10314 |
0.2 |
| chr5_128684660_128684818 | 2.29 |
Piwil1 |
piwi-like RNA-mediated gene silencing 1 |
17785 |
0.17 |
| chr18_35726685_35727007 | 2.29 |
1700066B19Rik |
RIKEN cDNA 1700066B19 gene |
143 |
0.91 |
| chr7_96746122_96746305 | 2.29 |
Tenm4 |
teneurin transmembrane protein 4 |
31721 |
0.16 |
| chr2_68193092_68193381 | 2.25 |
Stk39 |
serine/threonine kinase 39 |
30090 |
0.21 |
| chr2_52868275_52868444 | 2.25 |
Fmnl2 |
formin-like 2 |
10491 |
0.28 |
| chr16_3236385_3237472 | 2.25 |
Gm23215 |
predicted gene, 23215 |
12656 |
0.18 |
| chr12_107758502_107758741 | 2.25 |
4930465M20Rik |
RIKEN cDNA 4930465M20 gene |
23125 |
0.21 |
| chr6_5828512_5828819 | 2.24 |
Dync1i1 |
dynein cytoplasmic 1 intermediate chain 1 |
71246 |
0.13 |
| chr4_63226924_63227104 | 2.24 |
Col27a1 |
collagen, type XXVII, alpha 1 |
7272 |
0.18 |
| chr12_107695516_107696133 | 2.23 |
4930465M20Rik |
RIKEN cDNA 4930465M20 gene |
39664 |
0.18 |
| chr9_43993365_43993554 | 2.23 |
E230034D01Rik |
RIKEN cDNA E230034D01 gene |
525 |
0.63 |
| chr3_81535915_81536075 | 2.21 |
Gm4857 |
predicted gene 4857 |
20830 |
0.26 |
| chr11_85845916_85846104 | 2.21 |
Gm11444 |
predicted gene 11444 |
4323 |
0.15 |
| chr3_63413377_63413528 | 2.21 |
Gm34240 |
predicted gene, 34240 |
25799 |
0.19 |
| chr12_69502069_69502283 | 2.21 |
5830428M24Rik |
RIKEN cDNA 5830428M24 gene |
26626 |
0.14 |
| chr17_29199549_29199700 | 2.21 |
Cpne5 |
copine V |
15521 |
0.1 |
| chr4_142239299_142240110 | 2.20 |
Kazn |
kazrin, periplakin interacting protein |
303 |
0.92 |
| chr1_89191219_89191400 | 2.20 |
Gm5259 |
predicted gene 5259 |
65672 |
0.11 |
| chr10_82971574_82971860 | 2.19 |
Chst11 |
carbohydrate sulfotransferase 11 |
13781 |
0.16 |
| chr8_26673155_26673312 | 2.19 |
Gm32098 |
predicted gene, 32098 |
4927 |
0.2 |
| chr10_84481427_84481581 | 2.18 |
4930463O16Rik |
RIKEN cDNA 4930463O16 gene |
6789 |
0.13 |
| chr19_17800915_17801074 | 2.18 |
Pcsk5 |
proprotein convertase subtilisin/kexin type 5 |
36623 |
0.16 |
| chr15_85207642_85208139 | 2.18 |
Fbln1 |
fibulin 1 |
1885 |
0.34 |
| chr5_140123735_140123886 | 2.18 |
Mad1l1 |
MAD1 mitotic arrest deficient 1-like 1 |
8344 |
0.16 |
| chr11_109145223_109145374 | 2.18 |
E030025P04Rik |
RIKEN cDNA E030025P04 gene |
929 |
0.59 |
| chr5_66337123_66338408 | 2.17 |
Apbb2 |
amyloid beta (A4) precursor protein-binding, family B, member 2 |
83 |
0.96 |
| chr17_26115631_26115977 | 2.17 |
Tmem8 |
transmembrane protein 8 |
827 |
0.38 |
| chr9_63059228_63059446 | 2.16 |
Gm48193 |
predicted gene, 48193 |
23636 |
0.15 |
| chr13_44449561_44449740 | 2.16 |
Gm27007 |
predicted gene, 27007 |
5653 |
0.16 |
| chr19_38026271_38026463 | 2.15 |
Myof |
myoferlin |
16984 |
0.15 |
| chr13_91911346_91911507 | 2.14 |
Ckmt2 |
creatine kinase, mitochondrial 2 |
34541 |
0.16 |
| chr15_36855626_36855844 | 2.14 |
Gm49282 |
predicted gene, 49282 |
12919 |
0.15 |
| chr14_76681663_76681956 | 2.14 |
1700108F19Rik |
RIKEN cDNA 1700108F19 gene |
55 |
0.98 |
| chr10_125922069_125922223 | 2.14 |
Lrig3 |
leucine-rich repeats and immunoglobulin-like domains 3 |
44022 |
0.2 |
| chr12_112412078_112412242 | 2.13 |
A730018C14Rik |
RIKEN cDNA A730018C14 gene |
2767 |
0.21 |
| chr14_65091800_65092112 | 2.13 |
Extl3 |
exostosin-like glycosyltransferase 3 |
6149 |
0.22 |
| chr10_76623290_76623874 | 2.12 |
Col6a2 |
collagen, type VI, alpha 2 |
48 |
0.97 |
| chr10_70484969_70485278 | 2.12 |
Gm29783 |
predicted gene, 29783 |
20125 |
0.19 |
| chr1_14570538_14570748 | 2.11 |
Gm9947 |
predicted gene 9947 |
182294 |
0.03 |
| chr9_58113701_58113918 | 2.11 |
Ccdc33 |
coiled-coil domain containing 33 |
551 |
0.67 |
| chr5_119055609_119055760 | 2.10 |
1700081H04Rik |
RIKEN cDNA 1700081H04 gene |
52550 |
0.13 |
| chr7_75397847_75398015 | 2.09 |
Gm44962 |
predicted gene 44962 |
23204 |
0.16 |
| chr8_26833351_26833567 | 2.08 |
2310008N11Rik |
RIKEN cDNA 2310008N11 gene |
8540 |
0.2 |
| chr1_38629243_38629578 | 2.08 |
Aff3 |
AF4/FMR2 family, member 3 |
2209 |
0.39 |
| chr7_75384486_75384827 | 2.07 |
Gm10161 |
predicted pseudogene 10161 |
18601 |
0.17 |
| chr7_126759690_126760767 | 2.07 |
Mapk3 |
mitogen-activated protein kinase 3 |
369 |
0.62 |
| chr10_68354814_68355005 | 2.07 |
4930545H06Rik |
RIKEN cDNA 4930545H06 gene |
33767 |
0.17 |
| chr12_80017677_80017828 | 2.07 |
Gm8275 |
predicted gene 8275 |
37901 |
0.13 |
| chr15_67060558_67060743 | 2.07 |
Gm31342 |
predicted gene, 31342 |
20592 |
0.2 |
| chr9_37495766_37496104 | 2.05 |
Gm47963 |
predicted gene, 47963 |
1834 |
0.21 |
| chr4_8207253_8207439 | 2.04 |
Gm25355 |
predicted gene, 25355 |
28236 |
0.17 |
| chr3_131105908_131106301 | 2.03 |
Lef1 |
lymphoid enhancer binding factor 1 |
4367 |
0.19 |
| chr3_50674986_50675171 | 2.03 |
Gm37461 |
predicted gene, 37461 |
8323 |
0.21 |
| chr8_25537053_25537443 | 2.02 |
Fgfr1 |
fibroblast growth factor receptor 1 |
4967 |
0.13 |
| chr1_15926082_15926233 | 2.02 |
Sbspon |
somatomedin B and thrombospondin, type 1 domain containing |
33435 |
0.17 |
| chrX_12053674_12053836 | 2.01 |
Bcor |
BCL6 interacting corepressor |
26798 |
0.21 |
| chr19_56631485_56631636 | 2.01 |
Gm32441 |
predicted gene, 32441 |
33051 |
0.14 |
| chr10_83648138_83649089 | 2.01 |
Appl2 |
adaptor protein, phosphotyrosine interaction, PH domain and leucine zipper containing 2 |
10 |
0.98 |
| chr6_54353423_54353580 | 2.01 |
9130019P16Rik |
RIKEN cDNA 9130019P16 gene |
26160 |
0.15 |
| chr17_28846967_28847497 | 2.00 |
Pnpla1 |
patatin-like phospholipase domain containing 1 |
11179 |
0.1 |
| chr9_35342527_35342710 | 2.00 |
2610105M22Rik |
RIKEN cDNA 2610105M22 gene |
20495 |
0.13 |
| chr10_68357113_68357264 | 2.00 |
4930545H06Rik |
RIKEN cDNA 4930545H06 gene |
36046 |
0.17 |
| chr7_143389159_143390008 | 2.00 |
4933417O13Rik |
RIKEN cDNA 4933417O13 gene |
24958 |
0.12 |
| chr5_29467816_29468017 | 2.00 |
Mnx1 |
motor neuron and pancreas homeobox 1 |
10554 |
0.16 |
| chr8_70493079_70493663 | 2.00 |
Crlf1 |
cytokine receptor-like factor 1 |
10 |
0.94 |
| chr3_97076558_97076742 | 1.99 |
4930573H18Rik |
RIKEN cDNA 4930573H18 gene |
16135 |
0.15 |
| chr17_87566952_87567165 | 1.99 |
Gm46587 |
predicted gene, 46587 |
4596 |
0.2 |
| chr12_108546896_108547116 | 1.98 |
Evl |
Ena-vasodilator stimulated phosphoprotein |
7714 |
0.16 |
| chr5_91038675_91038962 | 1.98 |
Epgn |
epithelial mitogen |
11354 |
0.17 |
| chr19_24123998_24124149 | 1.98 |
Tjp2 |
tight junction protein 2 |
19009 |
0.15 |
| chr7_141278167_141278333 | 1.98 |
Sct |
secretin |
873 |
0.31 |
| chr12_82365363_82365694 | 1.98 |
Sipa1l1 |
signal-induced proliferation-associated 1 like 1 |
23261 |
0.24 |
| chr15_32192924_32193219 | 1.98 |
Tas2r119 |
taste receptor, type 2, member 119 |
15782 |
0.17 |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 1.2 | 3.6 | GO:2000054 | negative regulation of Wnt signaling pathway involved in dorsal/ventral axis specification(GO:2000054) |
| 1.1 | 4.4 | GO:0030538 | embryonic genitalia morphogenesis(GO:0030538) |
| 0.9 | 2.6 | GO:0021564 | vagus nerve development(GO:0021564) |
| 0.8 | 2.5 | GO:0010735 | positive regulation of transcription via serum response element binding(GO:0010735) |
| 0.8 | 2.3 | GO:0051902 | negative regulation of mitochondrial depolarization(GO:0051902) |
| 0.8 | 2.3 | GO:0060671 | epithelial cell differentiation involved in embryonic placenta development(GO:0060671) epithelial cell morphogenesis involved in placental branching(GO:0060672) |
| 0.6 | 1.9 | GO:0071673 | positive regulation of smooth muscle cell chemotaxis(GO:0071673) |
| 0.6 | 1.9 | GO:0044333 | Wnt signaling pathway involved in digestive tract morphogenesis(GO:0044333) |
| 0.6 | 3.0 | GO:1902894 | negative regulation of pri-miRNA transcription from RNA polymerase II promoter(GO:1902894) |
| 0.6 | 1.7 | GO:0032971 | regulation of muscle filament sliding(GO:0032971) |
| 0.5 | 2.2 | GO:2000483 | negative regulation of interleukin-8 secretion(GO:2000483) |
| 0.5 | 1.6 | GO:0010643 | cell communication by chemical coupling(GO:0010643) |
| 0.5 | 1.5 | GO:0035860 | glial cell-derived neurotrophic factor receptor signaling pathway(GO:0035860) |
| 0.5 | 1.5 | GO:0060584 | regulation of prostaglandin-endoperoxide synthase activity(GO:0060584) positive regulation of prostaglandin-endoperoxide synthase activity(GO:0060585) |
| 0.5 | 3.0 | GO:1904424 | regulation of GTP binding(GO:1904424) |
| 0.5 | 1.5 | GO:1904479 | negative regulation of intestinal absorption(GO:1904479) |
| 0.5 | 1.4 | GO:0038044 | transforming growth factor-beta secretion(GO:0038044) regulation of transforming growth factor-beta secretion(GO:2001201) |
| 0.5 | 1.9 | GO:0001712 | ectodermal cell fate commitment(GO:0001712) |
| 0.4 | 4.7 | GO:0033623 | regulation of integrin activation(GO:0033623) |
| 0.4 | 1.3 | GO:0016554 | cytidine to uridine editing(GO:0016554) |
| 0.4 | 3.0 | GO:0099515 | actin filament-based transport(GO:0099515) |
| 0.4 | 1.2 | GO:0000189 | MAPK import into nucleus(GO:0000189) |
| 0.4 | 1.9 | GO:0014028 | notochord formation(GO:0014028) |
| 0.4 | 2.3 | GO:0018401 | peptidyl-proline hydroxylation to 4-hydroxy-L-proline(GO:0018401) |
| 0.4 | 1.5 | GO:2001286 | regulation of caveolin-mediated endocytosis(GO:2001286) |
| 0.4 | 2.2 | GO:0006477 | protein sulfation(GO:0006477) |
| 0.4 | 1.1 | GO:1902564 | negative regulation of neutrophil activation(GO:1902564) |
| 0.4 | 1.4 | GO:0086064 | cell communication by electrical coupling involved in cardiac conduction(GO:0086064) |
| 0.4 | 1.4 | GO:0010288 | response to lead ion(GO:0010288) |
| 0.4 | 2.5 | GO:0051124 | synaptic growth at neuromuscular junction(GO:0051124) |
| 0.3 | 1.7 | GO:2000672 | negative regulation of motor neuron apoptotic process(GO:2000672) |
| 0.3 | 0.3 | GO:0030916 | otic vesicle formation(GO:0030916) |
| 0.3 | 1.0 | GO:0036215 | response to stem cell factor(GO:0036215) cellular response to stem cell factor stimulus(GO:0036216) Kit signaling pathway(GO:0038109) |
| 0.3 | 1.7 | GO:0071866 | regulation of apoptotic process in bone marrow(GO:0071865) negative regulation of apoptotic process in bone marrow(GO:0071866) |
| 0.3 | 2.0 | GO:1900028 | negative regulation of ruffle assembly(GO:1900028) |
| 0.3 | 0.3 | GO:0060686 | negative regulation of prostatic bud formation(GO:0060686) |
| 0.3 | 1.3 | GO:0060244 | negative regulation of cell proliferation involved in contact inhibition(GO:0060244) |
| 0.3 | 1.0 | GO:0051466 | positive regulation of corticotropin-releasing hormone secretion(GO:0051466) |
| 0.3 | 1.0 | GO:0043570 | maintenance of DNA repeat elements(GO:0043570) |
| 0.3 | 1.2 | GO:0021938 | smoothened signaling pathway involved in regulation of cerebellar granule cell precursor cell proliferation(GO:0021938) |
| 0.3 | 0.9 | GO:0003431 | growth plate cartilage chondrocyte development(GO:0003431) |
| 0.3 | 0.9 | GO:0097168 | mesenchymal stem cell proliferation(GO:0097168) |
| 0.3 | 1.2 | GO:0038031 | non-canonical Wnt signaling pathway via JNK cascade(GO:0038031) |
| 0.3 | 0.9 | GO:0061626 | pharyngeal arch artery morphogenesis(GO:0061626) |
| 0.3 | 0.9 | GO:0002337 | B-1a B cell differentiation(GO:0002337) |
| 0.3 | 1.1 | GO:0001951 | intestinal D-glucose absorption(GO:0001951) |
| 0.3 | 0.3 | GO:0010159 | specification of organ position(GO:0010159) |
| 0.3 | 1.1 | GO:0034755 | iron ion transmembrane transport(GO:0034755) |
| 0.3 | 0.8 | GO:1900169 | regulation of glucocorticoid mediated signaling pathway(GO:1900169) |
| 0.3 | 0.8 | GO:0071847 | TNFSF11-mediated signaling pathway(GO:0071847) |
| 0.3 | 0.8 | GO:0034727 | lysosomal microautophagy(GO:0016237) piecemeal microautophagy of nucleus(GO:0034727) late nucleophagy(GO:0044805) |
| 0.3 | 0.8 | GO:0010482 | epidermal cell division(GO:0010481) regulation of epidermal cell division(GO:0010482) |
| 0.3 | 0.8 | GO:0044341 | sodium-dependent phosphate transport(GO:0044341) |
| 0.3 | 1.3 | GO:0006686 | sphingomyelin biosynthetic process(GO:0006686) |
| 0.3 | 1.8 | GO:2001046 | positive regulation of integrin-mediated signaling pathway(GO:2001046) |
| 0.3 | 0.5 | GO:0060681 | branch elongation involved in ureteric bud branching(GO:0060681) |
| 0.2 | 0.7 | GO:0036092 | phosphatidylinositol-3-phosphate biosynthetic process(GO:0036092) |
| 0.2 | 0.7 | GO:0090258 | negative regulation of mitochondrial fission(GO:0090258) |
| 0.2 | 1.2 | GO:1902459 | positive regulation of stem cell population maintenance(GO:1902459) |
| 0.2 | 1.2 | GO:0010991 | negative regulation of SMAD protein complex assembly(GO:0010991) |
| 0.2 | 0.2 | GO:0061551 | trigeminal ganglion development(GO:0061551) |
| 0.2 | 2.4 | GO:0060272 | embryonic skeletal joint morphogenesis(GO:0060272) |
| 0.2 | 1.2 | GO:1902805 | positive regulation of synaptic vesicle transport(GO:1902805) |
| 0.2 | 0.5 | GO:0021847 | ventricular zone neuroblast division(GO:0021847) |
| 0.2 | 1.2 | GO:0060666 | dichotomous subdivision of terminal units involved in salivary gland branching(GO:0060666) |
| 0.2 | 0.5 | GO:0051890 | regulation of cardioblast differentiation(GO:0051890) |
| 0.2 | 0.7 | GO:0001834 | trophectodermal cell proliferation(GO:0001834) |
| 0.2 | 1.3 | GO:0060481 | lobar bronchus epithelium development(GO:0060481) |
| 0.2 | 0.7 | GO:0035283 | central nervous system segmentation(GO:0035283) brain segmentation(GO:0035284) |
| 0.2 | 0.7 | GO:1903237 | negative regulation of leukocyte tethering or rolling(GO:1903237) |
| 0.2 | 1.3 | GO:0090043 | regulation of tubulin deacetylation(GO:0090043) |
| 0.2 | 0.7 | GO:0015888 | thiamine transport(GO:0015888) |
| 0.2 | 0.7 | GO:0086046 | membrane depolarization during SA node cell action potential(GO:0086046) |
| 0.2 | 1.3 | GO:0060484 | lung-associated mesenchyme development(GO:0060484) |
| 0.2 | 2.2 | GO:0003148 | outflow tract septum morphogenesis(GO:0003148) |
| 0.2 | 0.4 | GO:0061047 | foregut regionalization(GO:0060423) lung field specification(GO:0060424) lung induction(GO:0060492) positive regulation of branching involved in lung morphogenesis(GO:0061047) |
| 0.2 | 0.6 | GO:0098915 | membrane repolarization during ventricular cardiac muscle cell action potential(GO:0098915) |
| 0.2 | 0.6 | GO:0098903 | regulation of membrane repolarization during action potential(GO:0098903) |
| 0.2 | 0.4 | GO:1902809 | regulation of skeletal muscle fiber differentiation(GO:1902809) |
| 0.2 | 1.3 | GO:0016081 | synaptic vesicle docking(GO:0016081) |
| 0.2 | 0.6 | GO:0021563 | glossopharyngeal nerve development(GO:0021563) |
| 0.2 | 0.6 | GO:1902174 | positive regulation of keratinocyte apoptotic process(GO:1902174) |
| 0.2 | 3.0 | GO:0036342 | post-anal tail morphogenesis(GO:0036342) |
| 0.2 | 1.4 | GO:0034651 | cortisol biosynthetic process(GO:0034651) |
| 0.2 | 0.8 | GO:0042997 | negative regulation of Golgi to plasma membrane protein transport(GO:0042997) |
| 0.2 | 1.0 | GO:0045053 | protein retention in Golgi apparatus(GO:0045053) |
| 0.2 | 0.6 | GO:0035898 | parathyroid hormone secretion(GO:0035898) |
| 0.2 | 0.6 | GO:0034137 | positive regulation of toll-like receptor 2 signaling pathway(GO:0034137) |
| 0.2 | 0.2 | GO:1903121 | regulation of TRAIL-activated apoptotic signaling pathway(GO:1903121) |
| 0.2 | 0.2 | GO:0061205 | paramesonephric duct development(GO:0061205) |
| 0.2 | 0.6 | GO:1904059 | regulation of locomotor rhythm(GO:1904059) |
| 0.2 | 0.6 | GO:2000680 | regulation of rubidium ion transport(GO:2000680) regulation of rubidium ion transmembrane transporter activity(GO:2000686) |
| 0.2 | 1.5 | GO:0033601 | positive regulation of mammary gland epithelial cell proliferation(GO:0033601) |
| 0.2 | 1.0 | GO:0090240 | positive regulation of histone H4 acetylation(GO:0090240) |
| 0.2 | 0.8 | GO:0014827 | intestine smooth muscle contraction(GO:0014827) |
| 0.2 | 0.2 | GO:0003104 | positive regulation of glomerular filtration(GO:0003104) |
| 0.2 | 0.6 | GO:0033211 | adiponectin-activated signaling pathway(GO:0033211) |
| 0.2 | 0.6 | GO:0001698 | gastrin-induced gastric acid secretion(GO:0001698) |
| 0.2 | 0.2 | GO:1901671 | positive regulation of superoxide dismutase activity(GO:1901671) positive regulation of removal of superoxide radicals(GO:1904833) |
| 0.2 | 0.6 | GO:0035106 | operant conditioning(GO:0035106) |
| 0.2 | 0.6 | GO:0003149 | membranous septum morphogenesis(GO:0003149) |
| 0.2 | 0.7 | GO:0060221 | retinal rod cell differentiation(GO:0060221) |
| 0.2 | 0.5 | GO:0032289 | central nervous system myelin formation(GO:0032289) |
| 0.2 | 0.7 | GO:0060982 | coronary artery morphogenesis(GO:0060982) |
| 0.2 | 0.4 | GO:1904956 | regulation of midbrain dopaminergic neuron differentiation(GO:1904956) |
| 0.2 | 0.9 | GO:1901029 | negative regulation of mitochondrial outer membrane permeabilization involved in apoptotic signaling pathway(GO:1901029) |
| 0.2 | 0.5 | GO:2000048 | negative regulation of cell-cell adhesion mediated by cadherin(GO:2000048) |
| 0.2 | 1.4 | GO:0014807 | regulation of somitogenesis(GO:0014807) |
| 0.2 | 0.5 | GO:0021570 | rhombomere 4 development(GO:0021570) |
| 0.2 | 1.9 | GO:0048268 | clathrin coat assembly(GO:0048268) |
| 0.2 | 0.2 | GO:0032907 | transforming growth factor beta3 production(GO:0032907) regulation of transforming growth factor beta3 production(GO:0032910) |
| 0.2 | 0.7 | GO:0046726 | positive regulation by virus of viral protein levels in host cell(GO:0046726) |
| 0.2 | 0.7 | GO:0042271 | susceptibility to natural killer cell mediated cytotoxicity(GO:0042271) |
| 0.2 | 1.2 | GO:1901550 | regulation of endothelial cell development(GO:1901550) regulation of establishment of endothelial barrier(GO:1903140) |
| 0.2 | 1.2 | GO:0006654 | phosphatidic acid biosynthetic process(GO:0006654) |
| 0.2 | 0.7 | GO:0001835 | blastocyst hatching(GO:0001835) hatching(GO:0035188) organism emergence from protective structure(GO:0071684) |
| 0.2 | 1.5 | GO:0030206 | chondroitin sulfate biosynthetic process(GO:0030206) |
| 0.2 | 0.6 | GO:0000414 | regulation of histone H3-K36 methylation(GO:0000414) |
| 0.2 | 0.2 | GO:0072025 | distal convoluted tubule development(GO:0072025) DCT cell differentiation(GO:0072069) metanephric distal convoluted tubule development(GO:0072221) metanephric distal tubule development(GO:0072235) metanephric DCT cell differentiation(GO:0072240) |
| 0.2 | 0.5 | GO:0001828 | inner cell mass cellular morphogenesis(GO:0001828) |
| 0.2 | 1.4 | GO:0061179 | negative regulation of insulin secretion involved in cellular response to glucose stimulus(GO:0061179) |
| 0.2 | 0.9 | GO:0051151 | negative regulation of smooth muscle cell differentiation(GO:0051151) |
| 0.2 | 0.6 | GO:0021521 | ventral spinal cord interneuron specification(GO:0021521) cell fate specification involved in pattern specification(GO:0060573) |
| 0.2 | 0.3 | GO:0090170 | regulation of Golgi inheritance(GO:0090170) |
| 0.2 | 0.5 | GO:0071225 | cellular response to muramyl dipeptide(GO:0071225) |
| 0.2 | 0.3 | GO:0048369 | lateral mesoderm morphogenesis(GO:0048369) lateral mesoderm formation(GO:0048370) lateral mesodermal cell differentiation(GO:0048371) |
| 0.1 | 0.4 | GO:0034441 | plasma lipoprotein particle oxidation(GO:0034441) |
| 0.1 | 0.3 | GO:0086045 | membrane depolarization during AV node cell action potential(GO:0086045) |
| 0.1 | 0.7 | GO:0048386 | positive regulation of retinoic acid receptor signaling pathway(GO:0048386) |
| 0.1 | 0.7 | GO:2000427 | positive regulation of apoptotic cell clearance(GO:2000427) |
| 0.1 | 1.0 | GO:0001778 | plasma membrane repair(GO:0001778) |
| 0.1 | 2.6 | GO:0070208 | protein heterotrimerization(GO:0070208) |
| 0.1 | 0.1 | GO:1902534 | single-organism membrane invagination(GO:1902534) |
| 0.1 | 2.2 | GO:0042474 | middle ear morphogenesis(GO:0042474) |
| 0.1 | 0.4 | GO:0007084 | mitotic nuclear envelope reassembly(GO:0007084) |
| 0.1 | 0.3 | GO:0030886 | negative regulation of myeloid dendritic cell activation(GO:0030886) |
| 0.1 | 0.7 | GO:0060509 | Type I pneumocyte differentiation(GO:0060509) |
| 0.1 | 2.4 | GO:1902043 | positive regulation of extrinsic apoptotic signaling pathway via death domain receptors(GO:1902043) |
| 0.1 | 0.3 | GO:0045410 | positive regulation of interleukin-6 biosynthetic process(GO:0045410) |
| 0.1 | 0.8 | GO:0060903 | positive regulation of meiosis I(GO:0060903) |
| 0.1 | 1.4 | GO:0061154 | endothelial tube morphogenesis(GO:0061154) |
| 0.1 | 1.4 | GO:0035721 | intraciliary retrograde transport(GO:0035721) |
| 0.1 | 0.7 | GO:0007171 | activation of transmembrane receptor protein tyrosine kinase activity(GO:0007171) |
| 0.1 | 0.7 | GO:0072257 | metanephric nephron tubule epithelial cell differentiation(GO:0072257) regulation of metanephric nephron tubule epithelial cell differentiation(GO:0072307) |
| 0.1 | 0.4 | GO:2000574 | regulation of microtubule motor activity(GO:2000574) |
| 0.1 | 0.7 | GO:0033564 | anterior/posterior axon guidance(GO:0033564) |
| 0.1 | 0.7 | GO:0060502 | epithelial cell proliferation involved in lung morphogenesis(GO:0060502) |
| 0.1 | 2.1 | GO:0006098 | pentose-phosphate shunt(GO:0006098) |
| 0.1 | 0.4 | GO:0034196 | acylglycerol transport(GO:0034196) triglyceride transport(GO:0034197) |
| 0.1 | 0.5 | GO:0016338 | calcium-independent cell-cell adhesion via plasma membrane cell-adhesion molecules(GO:0016338) |
| 0.1 | 0.5 | GO:0034214 | protein hexamerization(GO:0034214) |
| 0.1 | 0.3 | GO:0060744 | thelarche(GO:0042695) mammary gland branching involved in thelarche(GO:0060744) |
| 0.1 | 0.7 | GO:0033600 | negative regulation of mammary gland epithelial cell proliferation(GO:0033600) |
| 0.1 | 0.1 | GO:0022007 | neural plate elongation(GO:0014022) convergent extension involved in neural plate elongation(GO:0022007) |
| 0.1 | 0.4 | GO:1903818 | positive regulation of delayed rectifier potassium channel activity(GO:1902261) positive regulation of voltage-gated potassium channel activity(GO:1903818) |
| 0.1 | 0.4 | GO:0021586 | pons maturation(GO:0021586) |
| 0.1 | 0.1 | GO:0003164 | His-Purkinje system development(GO:0003164) |
| 0.1 | 0.3 | GO:0014826 | vein smooth muscle contraction(GO:0014826) |
| 0.1 | 0.4 | GO:0043553 | negative regulation of phosphatidylinositol 3-kinase activity(GO:0043553) |
| 0.1 | 0.4 | GO:0006068 | ethanol catabolic process(GO:0006068) |
| 0.1 | 0.4 | GO:0035622 | intrahepatic bile duct development(GO:0035622) |
| 0.1 | 0.6 | GO:0007256 | activation of JNKK activity(GO:0007256) |
| 0.1 | 0.1 | GO:0071670 | smooth muscle cell chemotaxis(GO:0071670) |
| 0.1 | 0.4 | GO:0032439 | endosome localization(GO:0032439) |
| 0.1 | 0.4 | GO:0003032 | detection of oxygen(GO:0003032) |
| 0.1 | 3.6 | GO:0030865 | cortical cytoskeleton organization(GO:0030865) |
| 0.1 | 0.4 | GO:0007182 | common-partner SMAD protein phosphorylation(GO:0007182) |
| 0.1 | 0.5 | GO:0031581 | hemidesmosome assembly(GO:0031581) |
| 0.1 | 1.3 | GO:0043129 | surfactant homeostasis(GO:0043129) |
| 0.1 | 1.3 | GO:0003334 | keratinocyte development(GO:0003334) |
| 0.1 | 0.4 | GO:1902669 | positive regulation of axon extension involved in axon guidance(GO:0048842) positive regulation of axon guidance(GO:1902669) |
| 0.1 | 0.7 | GO:0045714 | regulation of low-density lipoprotein particle receptor biosynthetic process(GO:0045714) |
| 0.1 | 0.4 | GO:0016480 | negative regulation of transcription from RNA polymerase III promoter(GO:0016480) |
| 0.1 | 0.6 | GO:0030174 | regulation of DNA-dependent DNA replication initiation(GO:0030174) |
| 0.1 | 0.1 | GO:0061002 | negative regulation of dendritic spine morphogenesis(GO:0061002) |
| 0.1 | 0.1 | GO:1903800 | positive regulation of production of miRNAs involved in gene silencing by miRNA(GO:1903800) |
| 0.1 | 0.4 | GO:0060160 | negative regulation of dopamine receptor signaling pathway(GO:0060160) |
| 0.1 | 0.5 | GO:0030091 | protein repair(GO:0030091) |
| 0.1 | 0.2 | GO:1902953 | positive regulation of ER to Golgi vesicle-mediated transport(GO:1902953) |
| 0.1 | 0.1 | GO:0055005 | ventricular cardiac myofibril assembly(GO:0055005) |
| 0.1 | 0.5 | GO:0033632 | regulation of cell-cell adhesion mediated by integrin(GO:0033632) |
| 0.1 | 0.3 | GO:0002930 | trabecular meshwork development(GO:0002930) |
| 0.1 | 0.3 | GO:0002432 | granuloma formation(GO:0002432) |
| 0.1 | 0.6 | GO:0060907 | positive regulation of macrophage cytokine production(GO:0060907) |
| 0.1 | 0.1 | GO:0015755 | fructose transport(GO:0015755) |
| 0.1 | 0.3 | GO:1903797 | positive regulation of inorganic anion transmembrane transport(GO:1903797) |
| 0.1 | 3.5 | GO:0031424 | keratinization(GO:0031424) |
| 0.1 | 0.1 | GO:0007494 | midgut development(GO:0007494) |
| 0.1 | 1.4 | GO:0098543 | detection of bacterium(GO:0016045) detection of other organism(GO:0098543) |
| 0.1 | 0.6 | GO:0048387 | negative regulation of retinoic acid receptor signaling pathway(GO:0048387) |
| 0.1 | 0.5 | GO:0071679 | commissural neuron axon guidance(GO:0071679) |
| 0.1 | 0.3 | GO:0090154 | positive regulation of sphingolipid biosynthetic process(GO:0090154) positive regulation of ceramide biosynthetic process(GO:2000304) |
| 0.1 | 0.2 | GO:0070278 | extracellular matrix constituent secretion(GO:0070278) |
| 0.1 | 0.2 | GO:0070427 | nucleotide-binding oligomerization domain containing 1 signaling pathway(GO:0070427) |
| 0.1 | 0.8 | GO:0045603 | positive regulation of endothelial cell differentiation(GO:0045603) |
| 0.1 | 0.4 | GO:2001260 | regulation of semaphorin-plexin signaling pathway(GO:2001260) |
| 0.1 | 0.7 | GO:0072178 | nephric duct development(GO:0072176) nephric duct morphogenesis(GO:0072178) |
| 0.1 | 0.3 | GO:0061084 | negative regulation of protein refolding(GO:0061084) |
| 0.1 | 0.8 | GO:0048251 | elastic fiber assembly(GO:0048251) |
| 0.1 | 0.3 | GO:0071492 | cellular response to UV-A(GO:0071492) |
| 0.1 | 0.9 | GO:0048368 | lateral mesoderm development(GO:0048368) |
| 0.1 | 0.2 | GO:0030382 | sperm mitochondrion organization(GO:0030382) |
| 0.1 | 0.1 | GO:1900740 | regulation of protein insertion into mitochondrial membrane involved in apoptotic signaling pathway(GO:1900739) positive regulation of protein insertion into mitochondrial membrane involved in apoptotic signaling pathway(GO:1900740) |
| 0.1 | 0.9 | GO:0046069 | cGMP catabolic process(GO:0046069) |
| 0.1 | 0.5 | GO:0045630 | positive regulation of T-helper 2 cell differentiation(GO:0045630) |
| 0.1 | 0.5 | GO:1904970 | brush border assembly(GO:1904970) |
| 0.1 | 0.8 | GO:0071420 | cellular response to histamine(GO:0071420) |
| 0.1 | 0.1 | GO:1901727 | positive regulation of histone deacetylase activity(GO:1901727) |
| 0.1 | 0.7 | GO:0070886 | positive regulation of calcineurin-NFAT signaling cascade(GO:0070886) |
| 0.1 | 0.3 | GO:2000535 | entry of bacterium into host cell(GO:0035635) regulation of entry of bacterium into host cell(GO:2000535) |
| 0.1 | 0.5 | GO:0090177 | establishment of planar polarity involved in neural tube closure(GO:0090177) |
| 0.1 | 1.4 | GO:2000353 | positive regulation of endothelial cell apoptotic process(GO:2000353) |
| 0.1 | 0.9 | GO:0051895 | negative regulation of focal adhesion assembly(GO:0051895) |
| 0.1 | 0.2 | GO:0009912 | auditory receptor cell fate commitment(GO:0009912) inner ear receptor cell fate commitment(GO:0060120) |
| 0.1 | 0.3 | GO:2000051 | negative regulation of non-canonical Wnt signaling pathway(GO:2000051) |
| 0.1 | 0.3 | GO:0046103 | inosine biosynthetic process(GO:0046103) |
| 0.1 | 0.3 | GO:0036289 | peptidyl-serine autophosphorylation(GO:0036289) |
| 0.1 | 0.3 | GO:0060373 | regulation of ventricular cardiac muscle cell membrane depolarization(GO:0060373) |
| 0.1 | 0.3 | GO:0002331 | pre-B cell allelic exclusion(GO:0002331) |
| 0.1 | 0.4 | GO:0045343 | MHC class I biosynthetic process(GO:0045341) regulation of MHC class I biosynthetic process(GO:0045343) positive regulation of MHC class I biosynthetic process(GO:0045345) |
| 0.1 | 0.5 | GO:0071340 | skeletal muscle acetylcholine-gated channel clustering(GO:0071340) |
| 0.1 | 0.2 | GO:1901078 | negative regulation of relaxation of muscle(GO:1901078) |
| 0.1 | 1.3 | GO:0014912 | negative regulation of smooth muscle cell migration(GO:0014912) |
| 0.1 | 0.3 | GO:0042998 | positive regulation of Golgi to plasma membrane protein transport(GO:0042998) |
| 0.1 | 0.3 | GO:0018364 | peptidyl-glutamine methylation(GO:0018364) |
| 0.1 | 0.5 | GO:0006532 | aspartate biosynthetic process(GO:0006532) |
| 0.1 | 0.4 | GO:0061303 | cornea development in camera-type eye(GO:0061303) |
| 0.1 | 0.8 | GO:0072673 | lamellipodium morphogenesis(GO:0072673) |
| 0.1 | 0.8 | GO:0051894 | positive regulation of focal adhesion assembly(GO:0051894) positive regulation of cell junction assembly(GO:1901890) |
| 0.1 | 0.5 | GO:2001182 | regulation of interleukin-12 secretion(GO:2001182) |
| 0.1 | 1.6 | GO:0030513 | positive regulation of BMP signaling pathway(GO:0030513) |
| 0.1 | 0.3 | GO:0002322 | B cell proliferation involved in immune response(GO:0002322) |
| 0.1 | 0.4 | GO:0071694 | protein localization to extracellular region(GO:0071692) maintenance of protein location in extracellular region(GO:0071694) |
| 0.1 | 0.4 | GO:0001996 | positive regulation of heart rate by epinephrine-norepinephrine(GO:0001996) |
| 0.1 | 0.3 | GO:0060178 | regulation of exocyst localization(GO:0060178) |
| 0.1 | 0.1 | GO:0046100 | hypoxanthine metabolic process(GO:0046100) hypoxanthine biosynthetic process(GO:0046101) |
| 0.1 | 0.2 | GO:0048550 | negative regulation of pinocytosis(GO:0048550) |
| 0.1 | 0.5 | GO:0045836 | positive regulation of meiotic nuclear division(GO:0045836) |
| 0.1 | 0.1 | GO:0071332 | cellular response to fructose stimulus(GO:0071332) |
| 0.1 | 0.3 | GO:0060575 | intestinal epithelial cell differentiation(GO:0060575) |
| 0.1 | 0.1 | GO:0060449 | bud elongation involved in lung branching(GO:0060449) |
| 0.1 | 0.6 | GO:0060050 | positive regulation of protein glycosylation(GO:0060050) |
| 0.1 | 0.3 | GO:0045852 | pH elevation(GO:0045852) intracellular pH elevation(GO:0051454) |
| 0.1 | 1.2 | GO:0015858 | nucleoside transport(GO:0015858) |
| 0.1 | 0.6 | GO:0048681 | negative regulation of axon regeneration(GO:0048681) |
| 0.1 | 0.3 | GO:0021562 | vestibulocochlear nerve development(GO:0021562) |
| 0.1 | 0.3 | GO:0016561 | protein import into peroxisome matrix, translocation(GO:0016561) |
| 0.1 | 0.9 | GO:0035767 | endothelial cell chemotaxis(GO:0035767) |
| 0.1 | 0.2 | GO:0021940 | positive regulation of cerebellar granule cell precursor proliferation(GO:0021940) |
| 0.1 | 1.3 | GO:0000920 | cell separation after cytokinesis(GO:0000920) |
| 0.1 | 0.2 | GO:1900377 | negative regulation of melanin biosynthetic process(GO:0048022) negative regulation of secondary metabolite biosynthetic process(GO:1900377) |
| 0.1 | 0.2 | GO:0090071 | negative regulation of ribosome biogenesis(GO:0090071) |
| 0.1 | 0.5 | GO:0014883 | transition between fast and slow fiber(GO:0014883) |
| 0.1 | 0.2 | GO:0044027 | hypermethylation of CpG island(GO:0044027) |
| 0.1 | 0.5 | GO:0033136 | serine phosphorylation of STAT3 protein(GO:0033136) |
| 0.1 | 0.3 | GO:0061511 | centriole elongation(GO:0061511) |
| 0.1 | 0.1 | GO:0010918 | positive regulation of mitochondrial membrane potential(GO:0010918) |
| 0.1 | 0.1 | GO:0086017 | Purkinje myocyte action potential(GO:0086017) |
| 0.1 | 0.4 | GO:0015879 | carnitine transport(GO:0015879) |
| 0.1 | 0.3 | GO:0001957 | intramembranous ossification(GO:0001957) direct ossification(GO:0036072) |
| 0.1 | 0.3 | GO:0009972 | cytidine catabolic process(GO:0006216) cytidine deamination(GO:0009972) cytidine metabolic process(GO:0046087) |
| 0.1 | 0.2 | GO:0003219 | cardiac right ventricle formation(GO:0003219) |
| 0.1 | 0.3 | GO:0051025 | negative regulation of immunoglobulin secretion(GO:0051025) |
| 0.1 | 0.7 | GO:0040037 | negative regulation of fibroblast growth factor receptor signaling pathway(GO:0040037) |
| 0.1 | 0.1 | GO:0048143 | astrocyte activation(GO:0048143) |
| 0.1 | 0.3 | GO:0098700 | aminergic neurotransmitter loading into synaptic vesicle(GO:0015842) neurotransmitter loading into synaptic vesicle(GO:0098700) |
| 0.1 | 0.5 | GO:0002087 | regulation of respiratory gaseous exchange by neurological system process(GO:0002087) |
| 0.1 | 0.3 | GO:0070086 | ubiquitin-dependent endocytosis(GO:0070086) |
| 0.1 | 0.3 | GO:0060426 | lung vasculature development(GO:0060426) |
| 0.1 | 0.4 | GO:2000344 | positive regulation of acrosome reaction(GO:2000344) |
| 0.1 | 0.4 | GO:0000395 | mRNA 5'-splice site recognition(GO:0000395) |
| 0.1 | 1.0 | GO:0031290 | retinal ganglion cell axon guidance(GO:0031290) |
| 0.1 | 0.1 | GO:1902730 | regulation of heparan sulfate proteoglycan biosynthetic process(GO:0010908) positive regulation of heparan sulfate proteoglycan biosynthetic process(GO:0010909) positive regulation of proteoglycan biosynthetic process(GO:1902730) |
| 0.1 | 0.2 | GO:0016198 | axon choice point recognition(GO:0016198) |
| 0.1 | 0.1 | GO:0034447 | very-low-density lipoprotein particle clearance(GO:0034447) |
| 0.1 | 0.1 | GO:0060066 | oviduct development(GO:0060066) |
| 0.1 | 0.6 | GO:0032060 | bleb assembly(GO:0032060) |
| 0.1 | 0.2 | GO:1903598 | angiotensin-mediated drinking behavior(GO:0003051) positive regulation of gap junction assembly(GO:1903598) |
| 0.1 | 0.1 | GO:0019254 | carnitine metabolic process, CoA-linked(GO:0019254) |
| 0.1 | 0.1 | GO:1901187 | regulation of ephrin receptor signaling pathway(GO:1901187) |
| 0.1 | 0.2 | GO:0061156 | pulmonary artery morphogenesis(GO:0061156) |
| 0.1 | 0.2 | GO:1903279 | regulation of calcium:sodium antiporter activity(GO:1903279) |
| 0.1 | 0.1 | GO:0060842 | arterial endothelial cell differentiation(GO:0060842) |
| 0.1 | 0.2 | GO:0060468 | prevention of polyspermy(GO:0060468) |
| 0.1 | 0.2 | GO:0070164 | negative regulation of adiponectin secretion(GO:0070164) |
| 0.1 | 0.2 | GO:0051944 | positive regulation of neurotransmitter uptake(GO:0051582) positive regulation of dopamine uptake involved in synaptic transmission(GO:0051586) positive regulation of catecholamine uptake involved in synaptic transmission(GO:0051944) |
| 0.1 | 0.3 | GO:0042483 | negative regulation of odontogenesis(GO:0042483) |
| 0.1 | 0.1 | GO:0002606 | positive regulation of dendritic cell antigen processing and presentation(GO:0002606) |
| 0.1 | 0.9 | GO:0097320 | membrane tubulation(GO:0097320) |
| 0.1 | 0.2 | GO:0045356 | positive regulation of interferon-alpha biosynthetic process(GO:0045356) |
| 0.1 | 0.1 | GO:0001923 | B-1 B cell differentiation(GO:0001923) |
| 0.1 | 0.2 | GO:0002386 | immune response in mucosal-associated lymphoid tissue(GO:0002386) |
| 0.1 | 0.2 | GO:0014878 | response to electrical stimulus involved in regulation of muscle adaptation(GO:0014878) |
| 0.1 | 0.2 | GO:0060931 | sinoatrial node cell development(GO:0060931) |
| 0.1 | 0.2 | GO:0003223 | ventricular compact myocardium morphogenesis(GO:0003223) |
| 0.1 | 0.8 | GO:0046827 | positive regulation of protein export from nucleus(GO:0046827) |
| 0.1 | 0.2 | GO:0010248 | establishment or maintenance of transmembrane electrochemical gradient(GO:0010248) |
| 0.1 | 0.3 | GO:0035269 | protein O-linked mannosylation(GO:0035269) |
| 0.1 | 0.2 | GO:0007440 | foregut morphogenesis(GO:0007440) |
| 0.1 | 0.3 | GO:0061525 | hindgut development(GO:0061525) |
| 0.1 | 0.1 | GO:0051964 | negative regulation of synapse assembly(GO:0051964) |
| 0.1 | 0.2 | GO:0061042 | vascular wound healing(GO:0061042) |
| 0.1 | 0.2 | GO:0006624 | vacuolar protein processing(GO:0006624) |
| 0.1 | 0.2 | GO:0014816 | skeletal muscle satellite cell differentiation(GO:0014816) |
| 0.1 | 0.1 | GO:0072182 | regulation of nephron tubule epithelial cell differentiation(GO:0072182) |
| 0.1 | 0.1 | GO:0033686 | positive regulation of luteinizing hormone secretion(GO:0033686) |
| 0.1 | 0.1 | GO:0010887 | negative regulation of cholesterol storage(GO:0010887) |
| 0.1 | 0.7 | GO:0001502 | cartilage condensation(GO:0001502) cell aggregation(GO:0098743) |
| 0.1 | 0.1 | GO:0060157 | urinary bladder development(GO:0060157) |
| 0.1 | 0.6 | GO:0060065 | uterus development(GO:0060065) |
| 0.1 | 0.7 | GO:0042953 | lipoprotein transport(GO:0042953) lipoprotein localization(GO:0044872) |
| 0.1 | 1.0 | GO:0035116 | embryonic hindlimb morphogenesis(GO:0035116) |
| 0.1 | 0.3 | GO:0070986 | left/right axis specification(GO:0070986) |
| 0.1 | 0.4 | GO:0060037 | pharyngeal system development(GO:0060037) |
| 0.1 | 0.3 | GO:0019230 | proprioception(GO:0019230) |
| 0.1 | 0.1 | GO:0031914 | negative regulation of synaptic plasticity(GO:0031914) |
| 0.1 | 3.3 | GO:0002066 | columnar/cuboidal epithelial cell development(GO:0002066) |
| 0.1 | 0.1 | GO:0019934 | cGMP-mediated signaling(GO:0019934) |
| 0.1 | 0.1 | GO:0050713 | negative regulation of interleukin-1 beta secretion(GO:0050713) |
| 0.1 | 0.5 | GO:0042760 | very long-chain fatty acid catabolic process(GO:0042760) |
| 0.1 | 0.1 | GO:1902262 | apoptotic process involved in patterning of blood vessels(GO:1902262) |
| 0.1 | 0.4 | GO:0051547 | regulation of keratinocyte migration(GO:0051547) positive regulation of keratinocyte migration(GO:0051549) |
| 0.1 | 0.4 | GO:0001842 | neural fold formation(GO:0001842) |
| 0.1 | 0.1 | GO:2000721 | positive regulation of transcription from RNA polymerase II promoter involved in smooth muscle cell differentiation(GO:2000721) |
| 0.1 | 0.2 | GO:1900368 | regulation of RNA interference(GO:1900368) |
| 0.1 | 0.3 | GO:0045080 | positive regulation of chemokine biosynthetic process(GO:0045080) |
| 0.1 | 0.1 | GO:0048014 | Tie signaling pathway(GO:0048014) |
| 0.1 | 0.1 | GO:0060830 | ciliary receptor clustering involved in smoothened signaling pathway(GO:0060830) |
| 0.1 | 0.4 | GO:0051152 | positive regulation of smooth muscle cell differentiation(GO:0051152) |
| 0.1 | 0.4 | GO:0045719 | negative regulation of glycogen biosynthetic process(GO:0045719) |
| 0.1 | 0.5 | GO:0006108 | malate metabolic process(GO:0006108) |
| 0.1 | 0.5 | GO:1903624 | regulation of DNA catabolic process(GO:1903624) |
| 0.1 | 0.5 | GO:0035845 | photoreceptor cell outer segment organization(GO:0035845) |
| 0.1 | 0.2 | GO:0033387 | putrescine biosynthetic process from ornithine(GO:0033387) |
| 0.1 | 0.2 | GO:0030951 | establishment or maintenance of microtubule cytoskeleton polarity(GO:0030951) |
| 0.1 | 0.3 | GO:0006681 | galactosylceramide metabolic process(GO:0006681) |
| 0.1 | 0.3 | GO:0043568 | positive regulation of insulin-like growth factor receptor signaling pathway(GO:0043568) |
| 0.1 | 0.1 | GO:0097029 | mature conventional dendritic cell differentiation(GO:0097029) |
| 0.1 | 0.1 | GO:0010693 | negative regulation of alkaline phosphatase activity(GO:0010693) |
| 0.1 | 0.2 | GO:1900747 | negative regulation of vascular endothelial growth factor signaling pathway(GO:1900747) negative regulation of cellular response to vascular endothelial growth factor stimulus(GO:1902548) |
| 0.1 | 0.1 | GO:0007468 | regulation of rhodopsin gene expression(GO:0007468) |
| 0.1 | 0.3 | GO:0006646 | phosphatidylethanolamine biosynthetic process(GO:0006646) |
| 0.1 | 0.2 | GO:0090188 | negative regulation of pancreatic juice secretion(GO:0090188) |
| 0.1 | 0.5 | GO:0043206 | extracellular fibril organization(GO:0043206) |
| 0.1 | 0.2 | GO:0032959 | inositol trisphosphate biosynthetic process(GO:0032959) |
| 0.1 | 0.1 | GO:0035262 | gonad morphogenesis(GO:0035262) |
| 0.1 | 0.9 | GO:2000463 | positive regulation of excitatory postsynaptic potential(GO:2000463) |
| 0.1 | 0.2 | GO:0046098 | guanine metabolic process(GO:0046098) |
| 0.1 | 0.3 | GO:0015884 | folic acid transport(GO:0015884) |
| 0.1 | 0.2 | GO:0060763 | mammary duct terminal end bud growth(GO:0060763) |
| 0.1 | 0.7 | GO:1901741 | positive regulation of myoblast fusion(GO:1901741) |
| 0.1 | 0.3 | GO:0019262 | N-acetylneuraminate catabolic process(GO:0019262) |
| 0.1 | 0.2 | GO:0046655 | folic acid metabolic process(GO:0046655) |
| 0.1 | 0.1 | GO:0036462 | TRAIL-activated apoptotic signaling pathway(GO:0036462) |
| 0.1 | 0.2 | GO:0010724 | regulation of definitive erythrocyte differentiation(GO:0010724) |
| 0.1 | 0.2 | GO:0007195 | adenylate cyclase-inhibiting dopamine receptor signaling pathway(GO:0007195) |
| 0.1 | 0.2 | GO:0072429 | response to cell cycle checkpoint signaling(GO:0072396) response to DNA integrity checkpoint signaling(GO:0072402) response to DNA damage checkpoint signaling(GO:0072423) response to intra-S DNA damage checkpoint signaling(GO:0072429) |
| 0.1 | 0.4 | GO:0036120 | response to platelet-derived growth factor(GO:0036119) cellular response to platelet-derived growth factor stimulus(GO:0036120) |
| 0.1 | 0.2 | GO:0030718 | germ-line stem cell population maintenance(GO:0030718) |
| 0.1 | 1.1 | GO:0035418 | protein localization to synapse(GO:0035418) |
| 0.1 | 0.1 | GO:0002315 | marginal zone B cell differentiation(GO:0002315) |
| 0.1 | 0.1 | GO:0010751 | negative regulation of nitric oxide mediated signal transduction(GO:0010751) |
| 0.1 | 0.6 | GO:0043651 | linoleic acid metabolic process(GO:0043651) |
| 0.1 | 0.1 | GO:0070100 | negative regulation of chemokine-mediated signaling pathway(GO:0070100) |
| 0.1 | 0.8 | GO:0010758 | regulation of macrophage chemotaxis(GO:0010758) |
| 0.1 | 0.2 | GO:0035795 | negative regulation of mitochondrial membrane permeability(GO:0035795) |
| 0.1 | 0.5 | GO:0021520 | spinal cord motor neuron cell fate specification(GO:0021520) |
| 0.1 | 1.1 | GO:0070528 | protein kinase C signaling(GO:0070528) |
| 0.1 | 0.4 | GO:0015871 | choline transport(GO:0015871) |
| 0.1 | 0.2 | GO:0044778 | meiotic DNA integrity checkpoint(GO:0044778) |
| 0.1 | 0.1 | GO:0009253 | peptidoglycan metabolic process(GO:0000270) peptidoglycan catabolic process(GO:0009253) |
| 0.1 | 0.1 | GO:0014012 | peripheral nervous system axon regeneration(GO:0014012) |
| 0.1 | 0.3 | GO:1904321 | response to forskolin(GO:1904321) cellular response to forskolin(GO:1904322) |
| 0.1 | 0.1 | GO:0033031 | positive regulation of neutrophil apoptotic process(GO:0033031) |
| 0.1 | 0.2 | GO:0097343 | ripoptosome assembly(GO:0097343) ripoptosome assembly involved in necroptotic process(GO:1901026) |
| 0.1 | 0.2 | GO:0070213 | protein auto-ADP-ribosylation(GO:0070213) |
| 0.1 | 0.2 | GO:0060839 | endothelial cell fate commitment(GO:0060839) |
| 0.1 | 0.1 | GO:0090500 | endocardial cushion to mesenchymal transition involved in heart valve formation(GO:0003199) endocardial cushion to mesenchymal transition(GO:0090500) |
| 0.1 | 0.2 | GO:0010387 | COP9 signalosome assembly(GO:0010387) |
| 0.1 | 0.1 | GO:0030576 | Cajal body organization(GO:0030576) |
| 0.1 | 0.1 | GO:0036151 | phosphatidylcholine acyl-chain remodeling(GO:0036151) |
| 0.1 | 0.1 | GO:0060978 | angiogenesis involved in coronary vascular morphogenesis(GO:0060978) |
| 0.1 | 0.1 | GO:0014707 | branchiomeric skeletal muscle development(GO:0014707) |
| 0.1 | 0.1 | GO:0090271 | positive regulation of fibroblast growth factor production(GO:0090271) |
| 0.1 | 0.4 | GO:0019321 | pentose metabolic process(GO:0019321) |
| 0.1 | 0.7 | GO:0018298 | protein-chromophore linkage(GO:0018298) |
| 0.1 | 0.2 | GO:0009106 | lipoate metabolic process(GO:0009106) |
| 0.1 | 0.4 | GO:0021984 | adenohypophysis development(GO:0021984) |
| 0.1 | 0.1 | GO:0002017 | regulation of blood volume by renal aldosterone(GO:0002017) |
| 0.1 | 0.1 | GO:0060290 | transdifferentiation(GO:0060290) |
| 0.1 | 0.2 | GO:0060075 | regulation of resting membrane potential(GO:0060075) |
| 0.1 | 0.2 | GO:0061370 | testosterone biosynthetic process(GO:0061370) |
| 0.1 | 0.8 | GO:0048706 | embryonic skeletal system development(GO:0048706) |
| 0.1 | 0.1 | GO:0010763 | positive regulation of fibroblast migration(GO:0010763) |
| 0.1 | 0.2 | GO:0046469 | platelet activating factor biosynthetic process(GO:0006663) platelet activating factor metabolic process(GO:0046469) |
| 0.1 | 0.2 | GO:0018317 | protein C-linked glycosylation(GO:0018103) peptidyl-tryptophan modification(GO:0018211) protein C-linked glycosylation via tryptophan(GO:0018317) protein C-linked glycosylation via 2'-alpha-mannosyl-L-tryptophan(GO:0018406) |
| 0.1 | 0.2 | GO:0007097 | nuclear migration(GO:0007097) |
| 0.1 | 0.2 | GO:0006391 | transcription initiation from mitochondrial promoter(GO:0006391) |
| 0.1 | 0.2 | GO:0006007 | glucose catabolic process(GO:0006007) |
| 0.1 | 0.1 | GO:0045618 | positive regulation of keratinocyte differentiation(GO:0045618) |
| 0.1 | 0.2 | GO:1903748 | negative regulation of protein targeting to mitochondrion(GO:1903215) negative regulation of establishment of protein localization to mitochondrion(GO:1903748) |
| 0.1 | 0.3 | GO:0060546 | negative regulation of necroptotic process(GO:0060546) |
| 0.1 | 0.1 | GO:0002339 | B cell selection(GO:0002339) |
| 0.1 | 0.2 | GO:0043985 | histone H4-R3 methylation(GO:0043985) |
| 0.1 | 0.2 | GO:2000542 | negative regulation of gastrulation(GO:2000542) |
| 0.1 | 0.2 | GO:0010446 | response to alkaline pH(GO:0010446) |
| 0.1 | 0.1 | GO:0051387 | negative regulation of neurotrophin TRK receptor signaling pathway(GO:0051387) |
| 0.1 | 0.8 | GO:0010800 | positive regulation of peptidyl-threonine phosphorylation(GO:0010800) |
| 0.1 | 0.4 | GO:0032464 | positive regulation of protein homooligomerization(GO:0032464) |
| 0.1 | 0.1 | GO:0060510 | Type II pneumocyte differentiation(GO:0060510) |
| 0.1 | 0.1 | GO:0002424 | T cell mediated immune response to tumor cell(GO:0002424) regulation of T cell mediated immune response to tumor cell(GO:0002840) |
| 0.1 | 0.1 | GO:1900222 | negative regulation of beta-amyloid clearance(GO:1900222) |
| 0.1 | 0.2 | GO:0060914 | heart formation(GO:0060914) |
| 0.1 | 2.9 | GO:0007229 | integrin-mediated signaling pathway(GO:0007229) |
| 0.1 | 0.2 | GO:0051599 | response to hydrostatic pressure(GO:0051599) |
| 0.1 | 0.5 | GO:0046697 | decidualization(GO:0046697) |
| 0.1 | 0.3 | GO:0051639 | actin filament network formation(GO:0051639) |
| 0.1 | 0.2 | GO:0048478 | replication fork protection(GO:0048478) |
| 0.1 | 0.1 | GO:0042360 | vitamin E metabolic process(GO:0042360) |
| 0.1 | 0.1 | GO:0043497 | regulation of protein heterodimerization activity(GO:0043497) |
| 0.1 | 0.4 | GO:0071257 | cellular response to electrical stimulus(GO:0071257) |
| 0.1 | 0.4 | GO:0019430 | removal of superoxide radicals(GO:0019430) |
| 0.1 | 0.2 | GO:0032304 | negative regulation of icosanoid secretion(GO:0032304) |
| 0.1 | 0.2 | GO:1903025 | regulation of RNA polymerase II regulatory region sequence-specific DNA binding(GO:1903025) |
| 0.1 | 0.2 | GO:0045617 | negative regulation of keratinocyte differentiation(GO:0045617) |
| 0.1 | 0.2 | GO:0090557 | establishment of endothelial intestinal barrier(GO:0090557) |
| 0.1 | 0.1 | GO:0045616 | regulation of keratinocyte differentiation(GO:0045616) |
| 0.1 | 0.1 | GO:0072103 | glomerulus vasculature morphogenesis(GO:0072103) glomerular capillary formation(GO:0072104) |
| 0.1 | 0.1 | GO:0033058 | directional locomotion(GO:0033058) |
| 0.1 | 0.1 | GO:0036006 | response to macrophage colony-stimulating factor(GO:0036005) cellular response to macrophage colony-stimulating factor stimulus(GO:0036006) |
| 0.1 | 0.4 | GO:0006610 | ribosomal protein import into nucleus(GO:0006610) |
| 0.1 | 0.4 | GO:0018095 | protein polyglutamylation(GO:0018095) |
| 0.1 | 0.2 | GO:0014733 | regulation of skeletal muscle adaptation(GO:0014733) |
| 0.1 | 0.1 | GO:0060973 | cell migration involved in heart development(GO:0060973) |
| 0.1 | 0.2 | GO:0048170 | positive regulation of long-term neuronal synaptic plasticity(GO:0048170) |
| 0.1 | 0.2 | GO:0034421 | post-translational protein acetylation(GO:0034421) |
| 0.1 | 0.1 | GO:0097105 | presynaptic membrane assembly(GO:0097105) |
| 0.1 | 0.1 | GO:0048294 | negative regulation of isotype switching to IgE isotypes(GO:0048294) |
| 0.1 | 1.0 | GO:0006301 | postreplication repair(GO:0006301) |
| 0.1 | 0.4 | GO:0002329 | pre-B cell differentiation(GO:0002329) |
| 0.1 | 0.6 | GO:0006817 | phosphate ion transport(GO:0006817) |
| 0.1 | 0.1 | GO:0090244 | Wnt signaling pathway involved in somitogenesis(GO:0090244) |
| 0.1 | 0.1 | GO:0046684 | response to pyrethroid(GO:0046684) |
| 0.1 | 0.1 | GO:1901166 | neural crest cell migration involved in autonomic nervous system development(GO:1901166) |
| 0.1 | 1.1 | GO:0048013 | ephrin receptor signaling pathway(GO:0048013) |
| 0.1 | 0.2 | GO:1901897 | regulation of relaxation of cardiac muscle(GO:1901897) |
| 0.1 | 0.2 | GO:1904996 | positive regulation of leukocyte adhesion to vascular endothelial cell(GO:1904996) |
| 0.1 | 0.2 | GO:0006198 | cAMP catabolic process(GO:0006198) |
| 0.1 | 0.3 | GO:0035089 | establishment of apical/basal cell polarity(GO:0035089) |
| 0.1 | 0.1 | GO:0061311 | cell surface receptor signaling pathway involved in heart development(GO:0061311) |
| 0.1 | 0.1 | GO:1903898 | negative regulation of PERK-mediated unfolded protein response(GO:1903898) |
| 0.1 | 1.8 | GO:0048704 | embryonic skeletal system morphogenesis(GO:0048704) |
| 0.1 | 0.1 | GO:2000409 | positive regulation of T cell extravasation(GO:2000409) |
| 0.1 | 0.4 | GO:0010919 | regulation of inositol phosphate biosynthetic process(GO:0010919) positive regulation of inositol phosphate biosynthetic process(GO:0060732) |
| 0.1 | 0.1 | GO:1901165 | positive regulation of trophoblast cell migration(GO:1901165) |
| 0.0 | 0.0 | GO:0044332 | Wnt signaling pathway involved in dorsal/ventral axis specification(GO:0044332) |
| 0.0 | 0.0 | GO:0035887 | aortic smooth muscle cell differentiation(GO:0035887) |
| 0.0 | 0.1 | GO:0006714 | sesquiterpenoid metabolic process(GO:0006714) |
| 0.0 | 0.2 | GO:0032713 | negative regulation of interleukin-4 production(GO:0032713) |
| 0.0 | 0.4 | GO:0043374 | CD8-positive, alpha-beta T cell differentiation(GO:0043374) |
| 0.0 | 0.5 | GO:0006750 | glutathione biosynthetic process(GO:0006750) |
| 0.0 | 0.3 | GO:0006002 | fructose 6-phosphate metabolic process(GO:0006002) |
| 0.0 | 0.1 | GO:0045653 | negative regulation of megakaryocyte differentiation(GO:0045653) |
| 0.0 | 0.2 | GO:0045741 | positive regulation of epidermal growth factor-activated receptor activity(GO:0045741) |
| 0.0 | 0.8 | GO:0001706 | endoderm formation(GO:0001706) |
| 0.0 | 0.0 | GO:0021603 | cranial nerve formation(GO:0021603) |
| 0.0 | 0.3 | GO:0045721 | negative regulation of gluconeogenesis(GO:0045721) |
| 0.0 | 0.3 | GO:0046598 | positive regulation of viral entry into host cell(GO:0046598) |
| 0.0 | 0.1 | GO:0035990 | tendon development(GO:0035989) tendon cell differentiation(GO:0035990) tendon formation(GO:0035992) |
| 0.0 | 0.2 | GO:0043615 | astrocyte cell migration(GO:0043615) |
| 0.0 | 0.0 | GO:0090230 | regulation of centromere complex assembly(GO:0090230) |
| 0.0 | 0.2 | GO:0060710 | chorio-allantoic fusion(GO:0060710) |
| 0.0 | 0.1 | GO:1901525 | negative regulation of macromitophagy(GO:1901525) |
| 0.0 | 0.7 | GO:0030574 | collagen catabolic process(GO:0030574) |
| 0.0 | 0.1 | GO:0039692 | single stranded viral RNA replication via double stranded DNA intermediate(GO:0039692) |
| 0.0 | 0.1 | GO:0003197 | endocardial cushion development(GO:0003197) |
| 0.0 | 0.3 | GO:0036010 | protein localization to endosome(GO:0036010) |
| 0.0 | 0.6 | GO:1903859 | regulation of dendrite extension(GO:1903859) positive regulation of dendrite extension(GO:1903861) |
| 0.0 | 0.1 | GO:0014056 | acetylcholine secretion, neurotransmission(GO:0014055) regulation of acetylcholine secretion, neurotransmission(GO:0014056) |
| 0.0 | 0.0 | GO:2000173 | negative regulation of branching morphogenesis of a nerve(GO:2000173) |
| 0.0 | 0.1 | GO:0036506 | maintenance of unfolded protein(GO:0036506) maintenance of unfolded protein involved in ERAD pathway(GO:1904378) |
| 0.0 | 0.2 | GO:0008090 | retrograde axonal transport(GO:0008090) |
| 0.0 | 0.3 | GO:0034058 | endosomal vesicle fusion(GO:0034058) |
| 0.0 | 0.1 | GO:0045897 | regulation of transcription during mitosis(GO:0045896) positive regulation of transcription during mitosis(GO:0045897) |
| 0.0 | 0.0 | GO:0008588 | release of cytoplasmic sequestered NF-kappaB(GO:0008588) |
| 0.0 | 0.1 | GO:0031339 | negative regulation of vesicle fusion(GO:0031339) |
| 0.0 | 0.2 | GO:0019478 | D-amino acid catabolic process(GO:0019478) |
| 0.0 | 0.2 | GO:0042256 | mature ribosome assembly(GO:0042256) |
| 0.0 | 0.3 | GO:0042347 | negative regulation of NF-kappaB import into nucleus(GO:0042347) |
| 0.0 | 0.2 | GO:0006207 | 'de novo' pyrimidine nucleobase biosynthetic process(GO:0006207) pyrimidine nucleobase biosynthetic process(GO:0019856) |
| 0.0 | 0.1 | GO:0070094 | positive regulation of glucagon secretion(GO:0070094) |
| 0.0 | 0.0 | GO:0065001 | specification of axis polarity(GO:0065001) |
| 0.0 | 0.4 | GO:0045880 | positive regulation of smoothened signaling pathway(GO:0045880) |
| 0.0 | 0.3 | GO:2001224 | positive regulation of neuron migration(GO:2001224) |
| 0.0 | 0.2 | GO:0071397 | cellular response to cholesterol(GO:0071397) |
| 0.0 | 0.1 | GO:0046878 | positive regulation of saliva secretion(GO:0046878) |
| 0.0 | 0.1 | GO:0002913 | positive regulation of T cell anergy(GO:0002669) positive regulation of lymphocyte anergy(GO:0002913) |
| 0.0 | 0.1 | GO:0097112 | gamma-aminobutyric acid receptor clustering(GO:0097112) |
| 0.0 | 0.8 | GO:0035019 | somatic stem cell population maintenance(GO:0035019) |
| 0.0 | 0.1 | GO:0060068 | vagina development(GO:0060068) |
| 0.0 | 0.2 | GO:0050901 | leukocyte tethering or rolling(GO:0050901) |
| 0.0 | 0.2 | GO:0044828 | negative regulation by host of viral genome replication(GO:0044828) |
| 0.0 | 0.3 | GO:0070995 | NADPH oxidation(GO:0070995) |
| 0.0 | 0.0 | GO:0003415 | chondrocyte hypertrophy(GO:0003415) |
| 0.0 | 0.1 | GO:0010042 | response to manganese ion(GO:0010042) |
| 0.0 | 0.3 | GO:0033327 | Leydig cell differentiation(GO:0033327) |
| 0.0 | 0.4 | GO:0010719 | negative regulation of epithelial to mesenchymal transition(GO:0010719) |
| 0.0 | 0.1 | GO:0009732 | detection of carbohydrate stimulus(GO:0009730) detection of hexose stimulus(GO:0009732) detection of monosaccharide stimulus(GO:0034287) detection of glucose(GO:0051594) |
| 0.0 | 0.1 | GO:0042940 | D-amino acid transport(GO:0042940) |
| 0.0 | 0.1 | GO:0090031 | positive regulation of steroid hormone biosynthetic process(GO:0090031) |
| 0.0 | 0.1 | GO:0051410 | detoxification of nitrogen compound(GO:0051410) cellular detoxification of nitrogen compound(GO:0070458) |
| 0.0 | 0.4 | GO:0007520 | myoblast fusion(GO:0007520) |
| 0.0 | 0.1 | GO:0031666 | positive regulation of lipopolysaccharide-mediated signaling pathway(GO:0031666) |
| 0.0 | 0.0 | GO:0019344 | cysteine biosynthetic process(GO:0019344) |
| 0.0 | 0.3 | GO:0009083 | branched-chain amino acid catabolic process(GO:0009083) |
| 0.0 | 0.3 | GO:0048566 | embryonic digestive tract development(GO:0048566) |
| 0.0 | 0.0 | GO:0033159 | negative regulation of protein import into nucleus, translocation(GO:0033159) |
| 0.0 | 1.2 | GO:0030512 | negative regulation of transforming growth factor beta receptor signaling pathway(GO:0030512) negative regulation of cellular response to transforming growth factor beta stimulus(GO:1903845) |
| 0.0 | 0.2 | GO:0050861 | positive regulation of B cell receptor signaling pathway(GO:0050861) |
| 0.0 | 0.1 | GO:0090527 | actin filament reorganization(GO:0090527) |
| 0.0 | 0.2 | GO:0045717 | negative regulation of fatty acid biosynthetic process(GO:0045717) |
| 0.0 | 0.1 | GO:1902498 | regulation of protein autoubiquitination(GO:1902498) |
| 0.0 | 0.2 | GO:0051534 | negative regulation of NFAT protein import into nucleus(GO:0051534) |
| 0.0 | 0.1 | GO:0046959 | habituation(GO:0046959) |
| 0.0 | 0.9 | GO:0006509 | membrane protein ectodomain proteolysis(GO:0006509) |
| 0.0 | 0.0 | GO:0072053 | renal inner medulla development(GO:0072053) |
| 0.0 | 0.0 | GO:0009155 | purine deoxyribonucleotide catabolic process(GO:0009155) |
| 0.0 | 0.1 | GO:0071285 | cellular response to lithium ion(GO:0071285) |
| 0.0 | 0.1 | GO:0031034 | myosin filament assembly(GO:0031034) |
| 0.0 | 0.1 | GO:0046341 | CDP-diacylglycerol metabolic process(GO:0046341) |
| 0.0 | 0.2 | GO:0060340 | positive regulation of type I interferon-mediated signaling pathway(GO:0060340) |
| 0.0 | 0.1 | GO:1990441 | negative regulation of transcription from RNA polymerase II promoter in response to endoplasmic reticulum stress(GO:1990441) |
| 0.0 | 0.1 | GO:0060060 | post-embryonic retina morphogenesis in camera-type eye(GO:0060060) |
| 0.0 | 0.4 | GO:0010761 | fibroblast migration(GO:0010761) |
| 0.0 | 0.2 | GO:0046909 | intermembrane transport(GO:0046909) |
| 0.0 | 0.2 | GO:0090232 | positive regulation of spindle checkpoint(GO:0090232) |
| 0.0 | 0.1 | GO:0034165 | positive regulation of toll-like receptor 9 signaling pathway(GO:0034165) |
| 0.0 | 0.3 | GO:0051654 | establishment of mitochondrion localization(GO:0051654) |
| 0.0 | 0.2 | GO:0060043 | regulation of cardiac muscle cell proliferation(GO:0060043) |
| 0.0 | 0.2 | GO:0019532 | oxalate transport(GO:0019532) |
| 0.0 | 0.0 | GO:0006067 | ethanol metabolic process(GO:0006067) ethanol oxidation(GO:0006069) |
| 0.0 | 0.0 | GO:2000729 | positive regulation of mesenchymal cell proliferation involved in ureter development(GO:2000729) |
| 0.0 | 0.2 | GO:0030638 | polyketide metabolic process(GO:0030638) aminoglycoside antibiotic metabolic process(GO:0030647) daunorubicin metabolic process(GO:0044597) doxorubicin metabolic process(GO:0044598) |
| 0.0 | 0.4 | GO:0060351 | cartilage development involved in endochondral bone morphogenesis(GO:0060351) |
| 0.0 | 0.7 | GO:0033539 | fatty acid beta-oxidation using acyl-CoA dehydrogenase(GO:0033539) |
| 0.0 | 0.6 | GO:0051496 | positive regulation of stress fiber assembly(GO:0051496) |
| 0.0 | 0.2 | GO:0051694 | pointed-end actin filament capping(GO:0051694) |
| 0.0 | 0.5 | GO:0015693 | magnesium ion transport(GO:0015693) |
| 0.0 | 0.2 | GO:0046512 | diol biosynthetic process(GO:0034312) sphingosine biosynthetic process(GO:0046512) |
| 0.0 | 0.5 | GO:0034587 | piRNA metabolic process(GO:0034587) |
| 0.0 | 0.1 | GO:0070305 | response to cGMP(GO:0070305) |
| 0.0 | 0.1 | GO:0033566 | gamma-tubulin complex localization(GO:0033566) |
| 0.0 | 0.0 | GO:0019747 | regulation of isoprenoid metabolic process(GO:0019747) |
| 0.0 | 0.1 | GO:0035995 | detection of muscle stretch(GO:0035995) |
| 0.0 | 0.3 | GO:0045793 | positive regulation of cell size(GO:0045793) |
| 0.0 | 0.2 | GO:0070307 | lens fiber cell development(GO:0070307) |
| 0.0 | 0.1 | GO:0002576 | platelet degranulation(GO:0002576) |
| 0.0 | 0.0 | GO:0071879 | positive regulation of adrenergic receptor signaling pathway(GO:0071879) |
| 0.0 | 0.1 | GO:0042421 | norepinephrine biosynthetic process(GO:0042421) |
| 0.0 | 0.1 | GO:0019401 | glycerol biosynthetic process(GO:0006114) alditol biosynthetic process(GO:0019401) |
| 0.0 | 0.3 | GO:0051601 | exocyst localization(GO:0051601) |
| 0.0 | 0.1 | GO:0072051 | juxtaglomerular apparatus development(GO:0072051) |
| 0.0 | 0.1 | GO:0008635 | activation of cysteine-type endopeptidase activity involved in apoptotic process by cytochrome c(GO:0008635) |
| 0.0 | 0.4 | GO:0048305 | immunoglobulin secretion(GO:0048305) |
| 0.0 | 0.1 | GO:1900102 | negative regulation of endoplasmic reticulum unfolded protein response(GO:1900102) |
| 0.0 | 0.1 | GO:0060700 | regulation of ribonuclease activity(GO:0060700) |
| 0.0 | 0.1 | GO:0018094 | protein polyglycylation(GO:0018094) |
| 0.0 | 0.0 | GO:0060527 | prostate glandular acinus morphogenesis(GO:0060526) prostate epithelial cord arborization involved in prostate glandular acinus morphogenesis(GO:0060527) |
| 0.0 | 0.4 | GO:0046621 | negative regulation of organ growth(GO:0046621) |
| 0.0 | 0.2 | GO:0009209 | pyrimidine ribonucleoside triphosphate biosynthetic process(GO:0009209) |
| 0.0 | 0.2 | GO:0007176 | regulation of epidermal growth factor-activated receptor activity(GO:0007176) |
| 0.0 | 0.3 | GO:0034063 | stress granule assembly(GO:0034063) |
| 0.0 | 0.1 | GO:0038180 | nerve growth factor signaling pathway(GO:0038180) |
| 0.0 | 0.1 | GO:0035507 | regulation of myosin-light-chain-phosphatase activity(GO:0035507) |
| 0.0 | 0.0 | GO:1905049 | negative regulation of metalloendopeptidase activity(GO:1904684) negative regulation of metallopeptidase activity(GO:1905049) |
| 0.0 | 0.0 | GO:0007161 | calcium-independent cell-matrix adhesion(GO:0007161) |
| 0.0 | 0.2 | GO:0045742 | positive regulation of epidermal growth factor receptor signaling pathway(GO:0045742) positive regulation of ERBB signaling pathway(GO:1901186) |
| 0.0 | 0.2 | GO:0071044 | histone mRNA catabolic process(GO:0071044) |
| 0.0 | 0.1 | GO:0046719 | regulation by virus of viral protein levels in host cell(GO:0046719) |
| 0.0 | 0.1 | GO:0001866 | NK T cell proliferation(GO:0001866) |
| 0.0 | 0.2 | GO:0061436 | establishment of skin barrier(GO:0061436) |
| 0.0 | 0.1 | GO:0045792 | negative regulation of cell size(GO:0045792) |
| 0.0 | 0.1 | GO:0000965 | mitochondrial RNA 3'-end processing(GO:0000965) |
| 0.0 | 0.0 | GO:0061624 | fructose catabolic process(GO:0006001) fructose catabolic process to hydroxyacetone phosphate and glyceraldehyde-3-phosphate(GO:0061624) glycolytic process through fructose-1-phosphate(GO:0061625) |
| 0.0 | 0.7 | GO:0060612 | adipose tissue development(GO:0060612) |
| 0.0 | 0.1 | GO:0046184 | aldehyde biosynthetic process(GO:0046184) |
| 0.0 | 0.1 | GO:0071139 | resolution of recombination intermediates(GO:0071139) |
| 0.0 | 0.1 | GO:0034635 | glutathione transport(GO:0034635) tripeptide transport(GO:0042939) |
| 0.0 | 0.1 | GO:1901492 | positive regulation of lymphangiogenesis(GO:1901492) |
| 0.0 | 0.1 | GO:0071763 | nuclear membrane organization(GO:0071763) |
| 0.0 | 0.1 | GO:0089711 | L-glutamate transmembrane transport(GO:0089711) |
| 0.0 | 0.1 | GO:0032466 | negative regulation of cytokinesis(GO:0032466) |
| 0.0 | 0.2 | GO:0035469 | determination of pancreatic left/right asymmetry(GO:0035469) determination of liver left/right asymmetry(GO:0071910) |
| 0.0 | 0.1 | GO:0043046 | DNA methylation involved in gamete generation(GO:0043046) |
| 0.0 | 0.4 | GO:0007289 | spermatid nucleus differentiation(GO:0007289) |
| 0.0 | 0.1 | GO:0043353 | enucleate erythrocyte differentiation(GO:0043353) |
| 0.0 | 0.1 | GO:0060385 | axonogenesis involved in innervation(GO:0060385) |
| 0.0 | 0.2 | GO:0060512 | prostate gland morphogenesis(GO:0060512) |
| 0.0 | 0.1 | GO:0045906 | negative regulation of vasoconstriction(GO:0045906) |
| 0.0 | 0.0 | GO:0016093 | polyprenol metabolic process(GO:0016093) |
| 0.0 | 0.1 | GO:0010963 | regulation of L-arginine import(GO:0010963) |
| 0.0 | 0.1 | GO:0016553 | base conversion or substitution editing(GO:0016553) |
| 0.0 | 0.3 | GO:0033137 | negative regulation of peptidyl-serine phosphorylation(GO:0033137) |
| 0.0 | 0.0 | GO:0034146 | toll-like receptor 5 signaling pathway(GO:0034146) |
| 0.0 | 0.0 | GO:1902956 | regulation of mitochondrial electron transport, NADH to ubiquinone(GO:1902956) |
| 0.0 | 0.0 | GO:0046416 | D-amino acid metabolic process(GO:0046416) |
| 0.0 | 0.1 | GO:0031284 | positive regulation of guanylate cyclase activity(GO:0031284) |
| 0.0 | 0.1 | GO:0045085 | negative regulation of interleukin-2 biosynthetic process(GO:0045085) |
| 0.0 | 0.1 | GO:0045064 | T-helper 2 cell differentiation(GO:0045064) |
| 0.0 | 0.0 | GO:0050748 | negative regulation of lipoprotein metabolic process(GO:0050748) |
| 0.0 | 0.1 | GO:0019695 | choline metabolic process(GO:0019695) |
| 0.0 | 0.7 | GO:0006482 | protein demethylation(GO:0006482) protein dealkylation(GO:0008214) |
| 0.0 | 0.2 | GO:0006104 | succinyl-CoA metabolic process(GO:0006104) |
| 0.0 | 0.1 | GO:0030421 | defecation(GO:0030421) |
| 0.0 | 0.0 | GO:0038028 | insulin receptor signaling pathway via phosphatidylinositol 3-kinase(GO:0038028) |
| 0.0 | 0.1 | GO:0048312 | intracellular distribution of mitochondria(GO:0048312) |
| 0.0 | 0.0 | GO:1904139 | microglial cell migration(GO:1904124) regulation of microglial cell migration(GO:1904139) |
| 0.0 | 0.1 | GO:0046077 | dUDP biosynthetic process(GO:0006227) pyrimidine nucleoside diphosphate biosynthetic process(GO:0009139) pyrimidine deoxyribonucleoside diphosphate metabolic process(GO:0009196) pyrimidine deoxyribonucleoside diphosphate biosynthetic process(GO:0009197) dUDP metabolic process(GO:0046077) |
| 0.0 | 1.0 | GO:0006505 | GPI anchor metabolic process(GO:0006505) |
| 0.0 | 0.1 | GO:0019227 | neuronal action potential propagation(GO:0019227) action potential propagation(GO:0098870) |
| 0.0 | 0.3 | GO:0001833 | inner cell mass cell proliferation(GO:0001833) |
| 0.0 | 0.3 | GO:0002176 | male germ cell proliferation(GO:0002176) |
| 0.0 | 0.0 | GO:0010694 | positive regulation of alkaline phosphatase activity(GO:0010694) |
| 0.0 | 0.0 | GO:0060618 | nipple development(GO:0060618) |
| 0.0 | 0.1 | GO:0034650 | cortisol metabolic process(GO:0034650) |
| 0.0 | 0.1 | GO:0045583 | regulation of cytotoxic T cell differentiation(GO:0045583) positive regulation of cytotoxic T cell differentiation(GO:0045585) |
| 0.0 | 0.2 | GO:0021889 | olfactory bulb interneuron differentiation(GO:0021889) |
| 0.0 | 0.1 | GO:0070262 | peptidyl-serine dephosphorylation(GO:0070262) |
| 0.0 | 0.1 | GO:0021698 | cerebellar cortex structural organization(GO:0021698) |
| 0.0 | 0.3 | GO:0070207 | protein homotrimerization(GO:0070207) |
| 0.0 | 0.1 | GO:0090155 | negative regulation of sphingolipid biosynthetic process(GO:0090155) cellular sphingolipid homeostasis(GO:0090156) |
| 0.0 | 0.1 | GO:0072675 | osteoclast fusion(GO:0072675) |
| 0.0 | 0.0 | GO:0010727 | negative regulation of hydrogen peroxide metabolic process(GO:0010727) |
| 0.0 | 0.1 | GO:0097211 | response to gonadotropin-releasing hormone(GO:0097210) cellular response to gonadotropin-releasing hormone(GO:0097211) |
| 0.0 | 0.0 | GO:0061450 | trophoblast cell migration(GO:0061450) |
| 0.0 | 0.0 | GO:0072061 | inner medullary collecting duct development(GO:0072061) |
| 0.0 | 0.1 | GO:0010587 | miRNA catabolic process(GO:0010587) |
| 0.0 | 0.1 | GO:0032927 | positive regulation of activin receptor signaling pathway(GO:0032927) |
| 0.0 | 0.0 | GO:0051835 | positive regulation of synapse structural plasticity(GO:0051835) |
| 0.0 | 0.1 | GO:0007571 | age-dependent response to oxidative stress(GO:0001306) age-dependent general metabolic decline(GO:0007571) |
| 0.0 | 0.1 | GO:0043490 | malate-aspartate shuttle(GO:0043490) |
| 0.0 | 0.1 | GO:0072173 | metanephric tubule morphogenesis(GO:0072173) |
| 0.0 | 0.1 | GO:0035701 | hematopoietic stem cell migration(GO:0035701) |
| 0.0 | 0.1 | GO:0009162 | deoxyribonucleoside monophosphate metabolic process(GO:0009162) |
| 0.0 | 0.2 | GO:0006490 | oligosaccharide-lipid intermediate biosynthetic process(GO:0006490) |
| 0.0 | 0.1 | GO:0035633 | maintenance of blood-brain barrier(GO:0035633) |
| 0.0 | 0.0 | GO:1900104 | hyaluranon cable assembly(GO:0036118) regulation of hyaluranon cable assembly(GO:1900104) positive regulation of hyaluranon cable assembly(GO:1900106) |
| 0.0 | 0.1 | GO:0070125 | mitochondrial translational elongation(GO:0070125) |
| 0.0 | 0.1 | GO:1903361 | protein localization to basolateral plasma membrane(GO:1903361) |
| 0.0 | 0.1 | GO:0048012 | hepatocyte growth factor receptor signaling pathway(GO:0048012) |
| 0.0 | 0.1 | GO:0060736 | prostate gland growth(GO:0060736) |
| 0.0 | 0.2 | GO:0051127 | positive regulation of actin nucleation(GO:0051127) |
| 0.0 | 0.2 | GO:0008343 | adult feeding behavior(GO:0008343) |
| 0.0 | 0.4 | GO:0051898 | negative regulation of protein kinase B signaling(GO:0051898) |
| 0.0 | 0.1 | GO:2000609 | regulation of thyroid hormone generation(GO:2000609) |
| 0.0 | 0.7 | GO:0007566 | embryo implantation(GO:0007566) |
| 0.0 | 0.1 | GO:0002581 | negative regulation of antigen processing and presentation of peptide or polysaccharide antigen via MHC class II(GO:0002581) |
| 0.0 | 0.0 | GO:0048852 | diencephalon morphogenesis(GO:0048852) |
| 0.0 | 0.1 | GO:0046826 | negative regulation of protein export from nucleus(GO:0046826) |
| 0.0 | 0.1 | GO:0090383 | phagosome acidification(GO:0090383) |
| 0.0 | 0.2 | GO:0038065 | collagen-activated signaling pathway(GO:0038065) |
| 0.0 | 0.3 | GO:0061298 | retina vasculature development in camera-type eye(GO:0061298) |
| 0.0 | 0.0 | GO:0010700 | negative regulation of norepinephrine secretion(GO:0010700) |
| 0.0 | 0.0 | GO:0010534 | regulation of activation of JAK2 kinase activity(GO:0010534) |
| 0.0 | 0.1 | GO:0048715 | negative regulation of oligodendrocyte differentiation(GO:0048715) |
| 0.0 | 0.1 | GO:0042045 | epithelial fluid transport(GO:0042045) |
| 0.0 | 0.0 | GO:0090080 | positive regulation of MAPKKK cascade by fibroblast growth factor receptor signaling pathway(GO:0090080) |
| 0.0 | 0.1 | GO:0042095 | interferon-gamma biosynthetic process(GO:0042095) |
| 0.0 | 0.1 | GO:1900119 | positive regulation of execution phase of apoptosis(GO:1900119) |
| 0.0 | 0.0 | GO:1901874 | regulation of post-translational protein modification(GO:1901873) negative regulation of post-translational protein modification(GO:1901874) |
| 0.0 | 0.0 | GO:2000275 | regulation of oxidative phosphorylation uncoupler activity(GO:2000275) |
| 0.0 | 0.0 | GO:0098528 | skeletal muscle fiber differentiation(GO:0098528) |
| 0.0 | 0.0 | GO:0006041 | glucosamine metabolic process(GO:0006041) |
| 0.0 | 0.1 | GO:0097461 | ferric iron import(GO:0033216) ferric iron import into cell(GO:0097461) |
| 0.0 | 0.1 | GO:1903020 | positive regulation of glycoprotein metabolic process(GO:1903020) |
| 0.0 | 0.2 | GO:0009143 | nucleoside triphosphate catabolic process(GO:0009143) |
| 0.0 | 0.0 | GO:0030210 | heparin biosynthetic process(GO:0030210) |
| 0.0 | 0.1 | GO:0060056 | mammary gland involution(GO:0060056) |
| 0.0 | 0.1 | GO:0002934 | desmosome organization(GO:0002934) |
| 0.0 | 0.0 | GO:0090403 | oxidative stress-induced premature senescence(GO:0090403) |
| 0.0 | 0.0 | GO:0002051 | osteoblast fate commitment(GO:0002051) |
| 0.0 | 0.0 | GO:0060684 | epithelial-mesenchymal cell signaling(GO:0060684) |
| 0.0 | 0.0 | GO:0090370 | negative regulation of cholesterol efflux(GO:0090370) |
| 0.0 | 0.1 | GO:0035608 | protein deglutamylation(GO:0035608) |
| 0.0 | 0.0 | GO:0035880 | embryonic nail plate morphogenesis(GO:0035880) |
| 0.0 | 0.0 | GO:0051541 | elastin metabolic process(GO:0051541) |
| 0.0 | 0.1 | GO:0048745 | smooth muscle tissue development(GO:0048745) |
| 0.0 | 0.1 | GO:0045110 | intermediate filament bundle assembly(GO:0045110) |
| 0.0 | 0.0 | GO:0031033 | myosin filament organization(GO:0031033) |
| 0.0 | 0.1 | GO:0002155 | thyroid hormone mediated signaling pathway(GO:0002154) regulation of thyroid hormone mediated signaling pathway(GO:0002155) |
| 0.0 | 0.4 | GO:0030166 | proteoglycan biosynthetic process(GO:0030166) |
| 0.0 | 0.0 | GO:0007386 | compartment pattern specification(GO:0007386) |
| 0.0 | 0.1 | GO:0010640 | regulation of platelet-derived growth factor receptor signaling pathway(GO:0010640) |
| 0.0 | 0.1 | GO:0032277 | negative regulation of gonadotropin secretion(GO:0032277) |
| 0.0 | 0.1 | GO:0031665 | negative regulation of lipopolysaccharide-mediated signaling pathway(GO:0031665) |
| 0.0 | 0.1 | GO:0032509 | endosome transport via multivesicular body sorting pathway(GO:0032509) |
| 0.0 | 0.0 | GO:0033314 | mitotic DNA replication checkpoint(GO:0033314) |
| 0.0 | 0.0 | GO:0030397 | membrane disassembly(GO:0030397) nuclear envelope disassembly(GO:0051081) |
| 0.0 | 0.0 | GO:0032224 | positive regulation of synaptic transmission, cholinergic(GO:0032224) |
| 0.0 | 0.1 | GO:0002023 | reduction of food intake in response to dietary excess(GO:0002023) |
| 0.0 | 0.1 | GO:0051014 | actin filament severing(GO:0051014) |
| 0.0 | 0.5 | GO:0070979 | protein K11-linked ubiquitination(GO:0070979) |
| 0.0 | 0.3 | GO:0048286 | lung alveolus development(GO:0048286) |
| 0.0 | 0.0 | GO:0090526 | regulation of gluconeogenesis involved in cellular glucose homeostasis(GO:0090526) |
| 0.0 | 0.0 | GO:0014042 | positive regulation of neuron maturation(GO:0014042) |
| 0.0 | 0.1 | GO:0006435 | threonyl-tRNA aminoacylation(GO:0006435) |
| 0.0 | 0.3 | GO:0001562 | response to protozoan(GO:0001562) |
| 0.0 | 0.1 | GO:1990126 | retrograde transport, endosome to plasma membrane(GO:1990126) |
| 0.0 | 0.0 | GO:0071502 | cellular response to temperature stimulus(GO:0071502) |
| 0.0 | 0.0 | GO:0006499 | N-terminal protein myristoylation(GO:0006499) |
| 0.0 | 0.1 | GO:0007250 | activation of NF-kappaB-inducing kinase activity(GO:0007250) |
| 0.0 | 0.2 | GO:0006335 | DNA replication-dependent nucleosome assembly(GO:0006335) DNA replication-dependent nucleosome organization(GO:0034723) |
| 0.0 | 0.0 | GO:0071233 | response to leucine(GO:0043201) cellular response to leucine(GO:0071233) |
| 0.0 | 0.1 | GO:0060134 | prepulse inhibition(GO:0060134) |
| 0.0 | 0.1 | GO:0048733 | sebaceous gland development(GO:0048733) |
| 0.0 | 0.0 | GO:0051446 | positive regulation of meiotic cell cycle(GO:0051446) |
| 0.0 | 0.0 | GO:0072205 | metanephric collecting duct development(GO:0072205) |
| 0.0 | 0.0 | GO:0060456 | positive regulation of digestive system process(GO:0060456) |
| 0.0 | 0.0 | GO:0071799 | response to prostaglandin D(GO:0071798) cellular response to prostaglandin D stimulus(GO:0071799) |
| 0.0 | 0.2 | GO:0071459 | protein localization to chromosome, centromeric region(GO:0071459) |
| 0.0 | 0.2 | GO:0060046 | regulation of acrosome reaction(GO:0060046) |
| 0.0 | 0.0 | GO:2000503 | positive regulation of natural killer cell chemotaxis(GO:2000503) |
| 0.0 | 0.0 | GO:1904714 | regulation of chaperone-mediated autophagy(GO:1904714) |
| 0.0 | 0.0 | GO:0046391 | 5-phosphoribose 1-diphosphate biosynthetic process(GO:0006015) 5-phosphoribose 1-diphosphate metabolic process(GO:0046391) |
| 0.0 | 0.1 | GO:0032780 | negative regulation of ATPase activity(GO:0032780) |
| 0.0 | 0.0 | GO:0042091 | interleukin-10 biosynthetic process(GO:0042091) regulation of interleukin-10 biosynthetic process(GO:0045074) |
| 0.0 | 0.0 | GO:0033023 | mast cell homeostasis(GO:0033023) mast cell apoptotic process(GO:0033024) regulation of mast cell apoptotic process(GO:0033025) |
| 0.0 | 0.1 | GO:0033615 | mitochondrial proton-transporting ATP synthase complex assembly(GO:0033615) |
| 0.0 | 0.0 | GO:0070092 | glucagon secretion(GO:0070091) regulation of glucagon secretion(GO:0070092) |
| 0.0 | 0.1 | GO:0048311 | mitochondrion distribution(GO:0048311) |
| 0.0 | 0.1 | GO:1902866 | regulation of retina development in camera-type eye(GO:1902866) |
| 0.0 | 0.0 | GO:0001806 | type IV hypersensitivity(GO:0001806) regulation of type IV hypersensitivity(GO:0001807) |
| 0.0 | 0.0 | GO:0001832 | blastocyst growth(GO:0001832) |
| 0.0 | 0.1 | GO:0061028 | establishment of endothelial barrier(GO:0061028) |
| 0.0 | 0.1 | GO:0031848 | protection from non-homologous end joining at telomere(GO:0031848) |
| 0.0 | 0.0 | GO:1902445 | regulation of mitochondrial membrane permeability involved in programmed necrotic cell death(GO:1902445) |
| 0.0 | 0.0 | GO:2000678 | negative regulation of transcription regulatory region DNA binding(GO:2000678) |
| 0.0 | 0.0 | GO:0000727 | double-strand break repair via break-induced replication(GO:0000727) |
| 0.0 | 0.0 | GO:0071503 | response to heparin(GO:0071503) cellular response to heparin(GO:0071504) |
| 0.0 | 0.0 | GO:0010891 | negative regulation of sequestering of triglyceride(GO:0010891) |
| 0.0 | 0.1 | GO:0042796 | snRNA transcription from RNA polymerase III promoter(GO:0042796) |
| 0.0 | 0.0 | GO:1900109 | regulation of histone H3-K9 dimethylation(GO:1900109) |
| 0.0 | 0.2 | GO:0044458 | motile cilium assembly(GO:0044458) |
| 0.0 | 0.3 | GO:0016601 | Rac protein signal transduction(GO:0016601) |
| 0.0 | 0.0 | GO:0035523 | protein K29-linked deubiquitination(GO:0035523) protein K33-linked deubiquitination(GO:1990168) |
| 0.0 | 0.1 | GO:0006195 | purine nucleotide catabolic process(GO:0006195) |
| 0.0 | 0.1 | GO:0046606 | negative regulation of centrosome duplication(GO:0010826) negative regulation of centrosome cycle(GO:0046606) |
| 0.0 | 0.1 | GO:0007340 | acrosome reaction(GO:0007340) |
| 0.0 | 0.1 | GO:0034393 | positive regulation of smooth muscle cell apoptotic process(GO:0034393) |
| 0.0 | 0.0 | GO:0010804 | negative regulation of tumor necrosis factor-mediated signaling pathway(GO:0010804) |
| 0.0 | 0.0 | GO:0045054 | constitutive secretory pathway(GO:0045054) |
| 0.0 | 0.0 | GO:0021538 | epithalamus development(GO:0021538) habenula development(GO:0021986) |
| 0.0 | 0.0 | GO:2000047 | regulation of cell-cell adhesion mediated by cadherin(GO:2000047) |
| 0.0 | 0.1 | GO:0051418 | interphase microtubule nucleation by interphase microtubule organizing center(GO:0051415) microtubule nucleation by microtubule organizing center(GO:0051418) |
| 0.0 | 0.0 | GO:0009750 | response to fructose(GO:0009750) |
| 0.0 | 0.0 | GO:0030201 | heparan sulfate proteoglycan metabolic process(GO:0030201) |
| 0.0 | 0.0 | GO:0034140 | negative regulation of toll-like receptor 3 signaling pathway(GO:0034140) |
| 0.0 | 0.1 | GO:2000653 | regulation of genetic imprinting(GO:2000653) |
| 0.0 | 0.2 | GO:2001222 | regulation of neuron migration(GO:2001222) |
| 0.0 | 0.1 | GO:0045109 | intermediate filament organization(GO:0045109) |
| 0.0 | 0.0 | GO:1901979 | regulation of inward rectifier potassium channel activity(GO:1901979) |
| 0.0 | 0.0 | GO:1990748 | cellular detoxification(GO:1990748) |
| 0.0 | 0.0 | GO:0044243 | multicellular organism catabolic process(GO:0044243) |
| 0.0 | 0.1 | GO:0043011 | myeloid dendritic cell differentiation(GO:0043011) |
| 0.0 | 0.0 | GO:0046813 | receptor-mediated virion attachment to host cell(GO:0046813) |
| 0.0 | 0.0 | GO:1900245 | positive regulation of MDA-5 signaling pathway(GO:1900245) |
| 0.0 | 0.0 | GO:0000720 | pyrimidine dimer repair by nucleotide-excision repair(GO:0000720) |
| 0.0 | 0.1 | GO:0007168 | receptor guanylyl cyclase signaling pathway(GO:0007168) |
| 0.0 | 0.0 | GO:0050968 | detection of chemical stimulus involved in sensory perception of pain(GO:0050968) |
| 0.0 | 0.0 | GO:0002645 | positive regulation of tolerance induction(GO:0002645) |
| 0.0 | 0.0 | GO:0021546 | rhombomere development(GO:0021546) |
| 0.0 | 0.0 | GO:0060033 | anatomical structure regression(GO:0060033) |
| 0.0 | 0.0 | GO:0035385 | Roundabout signaling pathway(GO:0035385) |
| 0.0 | 0.0 | GO:0035822 | meiotic gene conversion(GO:0006311) gene conversion(GO:0035822) |
| 0.0 | 0.0 | GO:0043576 | regulation of respiratory gaseous exchange(GO:0043576) |
| 0.0 | 0.0 | GO:0072385 | minus-end-directed organelle transport along microtubule(GO:0072385) |
| 0.0 | 0.0 | GO:0034163 | regulation of toll-like receptor 9 signaling pathway(GO:0034163) |
| 0.0 | 0.1 | GO:0097500 | receptor localization to nonmotile primary cilium(GO:0097500) |
| 0.0 | 0.1 | GO:0046835 | carbohydrate phosphorylation(GO:0046835) |
| 0.0 | 0.0 | GO:0050655 | dermatan sulfate proteoglycan metabolic process(GO:0050655) |
| 0.0 | 0.0 | GO:1902837 | amino acid import into cell(GO:1902837) |
| 0.0 | 0.0 | GO:0030321 | transepithelial chloride transport(GO:0030321) |
| 0.0 | 0.0 | GO:0031547 | brain-derived neurotrophic factor receptor signaling pathway(GO:0031547) |
| 0.0 | 0.0 | GO:0043950 | positive regulation of cAMP-mediated signaling(GO:0043950) |
| 0.0 | 0.0 | GO:0042758 | long-chain fatty acid catabolic process(GO:0042758) |
| 0.0 | 0.0 | GO:2000324 | positive regulation of glucocorticoid receptor signaling pathway(GO:2000324) |
| 0.0 | 0.0 | GO:0051562 | negative regulation of mitochondrial calcium ion concentration(GO:0051562) |
| 0.0 | 0.1 | GO:0043518 | negative regulation of DNA damage response, signal transduction by p53 class mediator(GO:0043518) |
| 0.0 | 0.0 | GO:0009438 | methylglyoxal metabolic process(GO:0009438) |
| 0.0 | 0.2 | GO:0071353 | cellular response to interleukin-4(GO:0071353) |
| 0.0 | 0.1 | GO:0051970 | negative regulation of transmission of nerve impulse(GO:0051970) |
| 0.0 | 0.0 | GO:0009838 | abscission(GO:0009838) |
| 0.0 | 0.1 | GO:0002553 | histamine production involved in inflammatory response(GO:0002349) histamine secretion involved in inflammatory response(GO:0002441) histamine secretion by mast cell(GO:0002553) |
| 0.0 | 0.0 | GO:0002408 | myeloid dendritic cell chemotaxis(GO:0002408) |
| 0.0 | 0.1 | GO:0043153 | entrainment of circadian clock by photoperiod(GO:0043153) |
| 0.0 | 0.0 | GO:0021559 | trigeminal nerve development(GO:0021559) |
| 0.0 | 0.1 | GO:0042737 | drug catabolic process(GO:0042737) |
| 0.0 | 0.0 | GO:0010898 | positive regulation of triglyceride catabolic process(GO:0010898) |
| 0.0 | 0.0 | GO:0071455 | cellular response to increased oxygen levels(GO:0036295) cellular response to hyperoxia(GO:0071455) |
| 0.0 | 0.0 | GO:0097151 | positive regulation of inhibitory postsynaptic potential(GO:0097151) |
| 0.0 | 0.0 | GO:0006667 | sphinganine metabolic process(GO:0006667) |
| 0.0 | 0.0 | GO:0015959 | diadenosine polyphosphate metabolic process(GO:0015959) |
| 0.0 | 0.1 | GO:0002523 | leukocyte migration involved in inflammatory response(GO:0002523) |
| 0.0 | 0.1 | GO:1902373 | negative regulation of mRNA catabolic process(GO:1902373) |
| 0.0 | 0.0 | GO:0048664 | neuron fate determination(GO:0048664) |
| 0.0 | 0.0 | GO:0006116 | NADH oxidation(GO:0006116) |
| 0.0 | 0.0 | GO:0032290 | peripheral nervous system myelin formation(GO:0032290) |
| 0.0 | 0.0 | GO:0031441 | negative regulation of mRNA 3'-end processing(GO:0031441) |
| 0.0 | 0.2 | GO:0030488 | tRNA methylation(GO:0030488) |
| 0.0 | 0.0 | GO:0035984 | response to trichostatin A(GO:0035983) cellular response to trichostatin A(GO:0035984) |
| 0.0 | 0.0 | GO:0035810 | positive regulation of urine volume(GO:0035810) |
| 0.0 | 0.0 | GO:0060766 | negative regulation of androgen receptor signaling pathway(GO:0060766) |
| 0.0 | 0.0 | GO:0009249 | protein lipoylation(GO:0009249) |
| 0.0 | 0.0 | GO:0032570 | response to progesterone(GO:0032570) |
| 0.0 | 0.0 | GO:0048385 | regulation of retinoic acid receptor signaling pathway(GO:0048385) |
| 0.0 | 0.0 | GO:0045606 | positive regulation of epidermal cell differentiation(GO:0045606) |
| 0.0 | 0.0 | GO:0007023 | post-chaperonin tubulin folding pathway(GO:0007023) |
| 0.0 | 0.1 | GO:0048384 | retinoic acid receptor signaling pathway(GO:0048384) |
| 0.0 | 0.0 | GO:0071947 | protein deubiquitination involved in ubiquitin-dependent protein catabolic process(GO:0071947) |
| 0.0 | 0.1 | GO:0009396 | folic acid-containing compound biosynthetic process(GO:0009396) |
| 0.0 | 0.0 | GO:0033762 | response to glucagon(GO:0033762) |
| 0.0 | 0.0 | GO:0009950 | dorsal/ventral axis specification(GO:0009950) |
| 0.0 | 0.0 | GO:0016584 | nucleosome positioning(GO:0016584) |
| 0.0 | 0.0 | GO:0050915 | sensory perception of sour taste(GO:0050915) |
| 0.0 | 0.0 | GO:0009642 | response to light intensity(GO:0009642) |
| 0.0 | 0.0 | GO:0070206 | protein trimerization(GO:0070206) |
| 0.0 | 0.0 | GO:0032730 | positive regulation of interleukin-1 alpha production(GO:0032730) |
| 0.0 | 0.1 | GO:0000731 | DNA synthesis involved in DNA repair(GO:0000731) |
| 0.0 | 0.0 | GO:0060352 | cell adhesion molecule production(GO:0060352) |
| 0.0 | 0.0 | GO:0060011 | Sertoli cell proliferation(GO:0060011) |
| 0.0 | 0.0 | GO:1904706 | negative regulation of vascular smooth muscle cell proliferation(GO:1904706) |
| 0.0 | 0.0 | GO:0035356 | cellular triglyceride homeostasis(GO:0035356) |
| 0.0 | 0.1 | GO:0007008 | outer mitochondrial membrane organization(GO:0007008) |
| 0.0 | 0.0 | GO:0070945 | neutrophil mediated killing of gram-negative bacterium(GO:0070945) |
| 0.0 | 0.0 | GO:0097368 | establishment of Sertoli cell barrier(GO:0097368) |
| 0.0 | 0.0 | GO:0035234 | ectopic germ cell programmed cell death(GO:0035234) |
| 0.0 | 0.0 | GO:0046337 | phosphatidylethanolamine metabolic process(GO:0046337) |
| 0.0 | 0.0 | GO:0010992 | ubiquitin homeostasis(GO:0010992) |
| 0.0 | 0.0 | GO:0019673 | GDP-mannose metabolic process(GO:0019673) |
| 0.0 | 0.2 | GO:0031146 | SCF-dependent proteasomal ubiquitin-dependent protein catabolic process(GO:0031146) |
| 0.0 | 0.2 | GO:0007130 | synaptonemal complex assembly(GO:0007130) |
| 0.0 | 0.0 | GO:0071725 | response to triacyl bacterial lipopeptide(GO:0071725) cellular response to triacyl bacterial lipopeptide(GO:0071727) |
| 0.0 | 0.0 | GO:0070601 | centromeric sister chromatid cohesion(GO:0070601) |
| 0.0 | 0.1 | GO:0070934 | CRD-mediated mRNA stabilization(GO:0070934) |
| 0.0 | 0.2 | GO:0048240 | sperm capacitation(GO:0048240) |
| 0.0 | 0.1 | GO:0042640 | anagen(GO:0042640) |
| 0.0 | 0.1 | GO:0033523 | histone H2B ubiquitination(GO:0033523) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.6 | 1.9 | GO:0097058 | CRLF-CLCF1 complex(GO:0097058) |
| 0.5 | 1.5 | GO:0016222 | procollagen-proline 4-dioxygenase complex(GO:0016222) |
| 0.5 | 1.8 | GO:0071953 | elastic fiber(GO:0071953) |
| 0.5 | 1.4 | GO:1990907 | beta-catenin-TCF complex(GO:1990907) |
| 0.4 | 2.6 | GO:0031258 | lamellipodium membrane(GO:0031258) |
| 0.3 | 2.8 | GO:0005861 | troponin complex(GO:0005861) |
| 0.3 | 1.0 | GO:0043259 | laminin-10 complex(GO:0043259) |
| 0.3 | 1.0 | GO:0016600 | flotillin complex(GO:0016600) |
| 0.2 | 0.7 | GO:0048179 | activin receptor complex(GO:0048179) |
| 0.2 | 1.8 | GO:0030991 | intraciliary transport particle A(GO:0030991) |
| 0.2 | 2.7 | GO:0005583 | fibrillar collagen trimer(GO:0005583) banded collagen fibril(GO:0098643) |
| 0.2 | 1.3 | GO:0072557 | IPAF inflammasome complex(GO:0072557) |
| 0.2 | 0.2 | GO:0045180 | basal cortex(GO:0045180) |
| 0.2 | 1.4 | GO:0044300 | cerebellar mossy fiber(GO:0044300) |
| 0.2 | 0.6 | GO:0005610 | laminin-5 complex(GO:0005610) |
| 0.2 | 0.8 | GO:0005726 | perichromatin fibrils(GO:0005726) |
| 0.2 | 2.0 | GO:0030877 | beta-catenin destruction complex(GO:0030877) |
| 0.2 | 3.1 | GO:0005614 | interstitial matrix(GO:0005614) |
| 0.2 | 0.7 | GO:0035339 | SPOTS complex(GO:0035339) |
| 0.2 | 1.8 | GO:0005641 | nuclear envelope lumen(GO:0005641) |
| 0.2 | 10.7 | GO:0032432 | actin filament bundle(GO:0032432) |
| 0.2 | 0.5 | GO:0036488 | CHOP-C/EBP complex(GO:0036488) |
| 0.2 | 1.0 | GO:0048237 | rough endoplasmic reticulum lumen(GO:0048237) |
| 0.1 | 1.2 | GO:0045179 | apical cortex(GO:0045179) |
| 0.1 | 1.3 | GO:0005916 | fascia adherens(GO:0005916) |
| 0.1 | 0.7 | GO:0044294 | dendritic growth cone(GO:0044294) |
| 0.1 | 1.4 | GO:0031143 | pseudopodium(GO:0031143) |
| 0.1 | 0.4 | GO:0016533 | cyclin-dependent protein kinase 5 holoenzyme complex(GO:0016533) |
| 0.1 | 2.5 | GO:0016327 | apicolateral plasma membrane(GO:0016327) |
| 0.1 | 1.2 | GO:0097470 | ribbon synapse(GO:0097470) |
| 0.1 | 0.1 | GO:0034365 | discoidal high-density lipoprotein particle(GO:0034365) |
| 0.1 | 0.8 | GO:1990454 | L-type voltage-gated calcium channel complex(GO:1990454) |
| 0.1 | 0.5 | GO:0030478 | actin cap(GO:0030478) |
| 0.1 | 0.5 | GO:0071203 | WASH complex(GO:0071203) |
| 0.1 | 1.2 | GO:0042613 | MHC class II protein complex(GO:0042613) |
| 0.1 | 2.6 | GO:0030057 | desmosome(GO:0030057) |
| 0.1 | 0.4 | GO:0032437 | cuticular plate(GO:0032437) |
| 0.1 | 5.2 | GO:0005913 | cell-cell adherens junction(GO:0005913) |
| 0.1 | 0.9 | GO:0032300 | mismatch repair complex(GO:0032300) |
| 0.1 | 1.4 | GO:0031528 | microvillus membrane(GO:0031528) |
| 0.1 | 3.7 | GO:0000791 | euchromatin(GO:0000791) |
| 0.1 | 0.2 | GO:0033093 | Weibel-Palade body(GO:0033093) |
| 0.1 | 0.3 | GO:1990393 | 3M complex(GO:1990393) |
| 0.1 | 0.1 | GO:0031092 | platelet alpha granule membrane(GO:0031092) |
| 0.1 | 1.1 | GO:0001527 | microfibril(GO:0001527) |
| 0.1 | 0.3 | GO:0071438 | invadopodium membrane(GO:0071438) |
| 0.1 | 0.9 | GO:0097542 | ciliary tip(GO:0097542) |
| 0.1 | 0.3 | GO:0043293 | apoptosome(GO:0043293) |
| 0.1 | 0.3 | GO:0097451 | glial limiting end-foot(GO:0097451) |
| 0.1 | 0.2 | GO:0034679 | integrin alpha9-beta1 complex(GO:0034679) |
| 0.1 | 0.1 | GO:0034363 | intermediate-density lipoprotein particle(GO:0034363) |
| 0.1 | 0.3 | GO:0031467 | Cul7-RING ubiquitin ligase complex(GO:0031467) |
| 0.1 | 1.7 | GO:0016581 | NuRD complex(GO:0016581) CHD-type complex(GO:0090545) |
| 0.1 | 0.4 | GO:0033503 | HULC complex(GO:0033503) |
| 0.1 | 0.7 | GO:1990023 | mitotic spindle midzone(GO:1990023) |
| 0.1 | 7.8 | GO:0043296 | apical junction complex(GO:0043296) |
| 0.1 | 0.2 | GO:0017133 | mitochondrial electron transfer flavoprotein complex(GO:0017133) electron transfer flavoprotein complex(GO:0045251) |
| 0.1 | 1.9 | GO:0008305 | integrin complex(GO:0008305) |
| 0.1 | 0.5 | GO:0042629 | mast cell granule(GO:0042629) |
| 0.1 | 2.5 | GO:0031901 | early endosome membrane(GO:0031901) |
| 0.1 | 0.2 | GO:0043527 | tRNA methyltransferase complex(GO:0043527) |
| 0.1 | 0.2 | GO:0009279 | cell outer membrane(GO:0009279) cell envelope(GO:0030313) external encapsulating structure part(GO:0044462) |
| 0.1 | 0.7 | GO:0097208 | alveolar lamellar body(GO:0097208) |
| 0.1 | 5.1 | GO:0005884 | actin filament(GO:0005884) |
| 0.1 | 0.4 | GO:0002081 | outer acrosomal membrane(GO:0002081) |
| 0.1 | 2.0 | GO:0008180 | COP9 signalosome(GO:0008180) |
| 0.1 | 0.3 | GO:0002189 | ribose phosphate diphosphokinase complex(GO:0002189) |
| 0.1 | 0.5 | GO:0001520 | outer dense fiber(GO:0001520) |
| 0.1 | 1.8 | GO:0005891 | voltage-gated calcium channel complex(GO:0005891) |
| 0.1 | 0.5 | GO:0000243 | commitment complex(GO:0000243) |
| 0.1 | 0.6 | GO:0044224 | juxtaparanode region of axon(GO:0044224) |
| 0.1 | 1.0 | GO:0000159 | protein phosphatase type 2A complex(GO:0000159) |
| 0.1 | 0.6 | GO:0036156 | inner dynein arm(GO:0036156) |
| 0.1 | 0.3 | GO:0071141 | SMAD protein complex(GO:0071141) |
| 0.1 | 0.1 | GO:0030056 | hemidesmosome(GO:0030056) |
| 0.1 | 0.1 | GO:0033648 | host intracellular organelle(GO:0033647) host intracellular membrane-bounded organelle(GO:0033648) |
| 0.1 | 0.4 | GO:0072669 | tRNA-splicing ligase complex(GO:0072669) |
| 0.1 | 0.4 | GO:0034991 | nuclear meiotic cohesin complex(GO:0034991) |
| 0.1 | 0.7 | GO:0032580 | Golgi cisterna membrane(GO:0032580) |
| 0.1 | 0.1 | GO:0031074 | nucleocytoplasmic shuttling complex(GO:0031074) |
| 0.1 | 0.2 | GO:0005945 | 6-phosphofructokinase complex(GO:0005945) |
| 0.1 | 0.3 | GO:0070776 | H3 histone acetyltransferase complex(GO:0070775) MOZ/MORF histone acetyltransferase complex(GO:0070776) |
| 0.1 | 0.2 | GO:0042583 | chromaffin granule(GO:0042583) |
| 0.1 | 1.1 | GO:0005680 | anaphase-promoting complex(GO:0005680) |
| 0.1 | 0.1 | GO:0030312 | external encapsulating structure(GO:0030312) |
| 0.1 | 0.3 | GO:0098645 | collagen type IV trimer(GO:0005587) network-forming collagen trimer(GO:0098642) collagen network(GO:0098645) basement membrane collagen trimer(GO:0098651) |
| 0.1 | 0.2 | GO:0043159 | acrosomal matrix(GO:0043159) |
| 0.1 | 0.8 | GO:0042101 | T cell receptor complex(GO:0042101) |
| 0.1 | 0.3 | GO:0097342 | ripoptosome(GO:0097342) |
| 0.1 | 0.3 | GO:0000137 | Golgi cis cisterna(GO:0000137) |
| 0.1 | 0.1 | GO:0098554 | cytoplasmic side of endoplasmic reticulum membrane(GO:0098554) |
| 0.1 | 0.2 | GO:1990357 | terminal web(GO:1990357) |
| 0.0 | 0.3 | GO:0070688 | MLL5-L complex(GO:0070688) |
| 0.0 | 0.1 | GO:1990423 | RZZ complex(GO:1990423) |
| 0.0 | 0.5 | GO:0098533 | ATPase dependent transmembrane transport complex(GO:0098533) |
| 0.0 | 1.0 | GO:0034451 | centriolar satellite(GO:0034451) |
| 0.0 | 0.4 | GO:0005885 | Arp2/3 protein complex(GO:0005885) |
| 0.0 | 0.2 | GO:0033263 | CORVET complex(GO:0033263) |
| 0.0 | 0.6 | GO:0031430 | M band(GO:0031430) |
| 0.0 | 1.5 | GO:0005581 | collagen trimer(GO:0005581) |
| 0.0 | 0.4 | GO:0000506 | glycosylphosphatidylinositol-N-acetylglucosaminyltransferase (GPI-GnT) complex(GO:0000506) |
| 0.0 | 0.0 | GO:0044299 | C-fiber(GO:0044299) |
| 0.0 | 0.8 | GO:0016328 | lateral plasma membrane(GO:0016328) |
| 0.0 | 0.5 | GO:0030867 | rough endoplasmic reticulum membrane(GO:0030867) |
| 0.0 | 0.2 | GO:0070032 | synaptobrevin 2-SNAP-25-syntaxin-1a-complexin I complex(GO:0070032) |
| 0.0 | 0.8 | GO:0097228 | sperm principal piece(GO:0097228) |
| 0.0 | 0.0 | GO:0005606 | laminin-1 complex(GO:0005606) |
| 0.0 | 0.2 | GO:0005593 | FACIT collagen trimer(GO:0005593) |
| 0.0 | 0.4 | GO:0030061 | mitochondrial crista(GO:0030061) |
| 0.0 | 1.0 | GO:0014704 | intercalated disc(GO:0014704) |
| 0.0 | 0.3 | GO:0019907 | cyclin-dependent protein kinase activating kinase holoenzyme complex(GO:0019907) |
| 0.0 | 1.4 | GO:0016459 | myosin complex(GO:0016459) |
| 0.0 | 0.1 | GO:0043218 | compact myelin(GO:0043218) |
| 0.0 | 0.1 | GO:0005899 | insulin receptor complex(GO:0005899) |
| 0.0 | 0.1 | GO:0009331 | glycerol-3-phosphate dehydrogenase complex(GO:0009331) |
| 0.0 | 0.0 | GO:0044393 | microspike(GO:0044393) |
| 0.0 | 0.1 | GO:0000138 | Golgi trans cisterna(GO:0000138) |
| 0.0 | 0.2 | GO:0048476 | Holliday junction resolvase complex(GO:0048476) |
| 0.0 | 0.1 | GO:0032127 | dense core granule membrane(GO:0032127) |
| 0.0 | 0.6 | GO:0030137 | COPI-coated vesicle(GO:0030137) |
| 0.0 | 0.4 | GO:0042589 | zymogen granule membrane(GO:0042589) |
| 0.0 | 0.8 | GO:0005771 | multivesicular body(GO:0005771) |
| 0.0 | 0.1 | GO:0097149 | centralspindlin complex(GO:0097149) |
| 0.0 | 1.2 | GO:0001917 | photoreceptor inner segment(GO:0001917) |
| 0.0 | 0.1 | GO:0000322 | storage vacuole(GO:0000322) |
| 0.0 | 1.3 | GO:0045095 | keratin filament(GO:0045095) |
| 0.0 | 0.1 | GO:0031371 | ubiquitin conjugating enzyme complex(GO:0031371) |
| 0.0 | 0.1 | GO:0002193 | MAML1-RBP-Jkappa- ICN1 complex(GO:0002193) |
| 0.0 | 1.0 | GO:0005763 | organellar small ribosomal subunit(GO:0000314) mitochondrial small ribosomal subunit(GO:0005763) |
| 0.0 | 0.8 | GO:0048786 | presynaptic active zone(GO:0048786) |
| 0.0 | 3.7 | GO:0045111 | intermediate filament cytoskeleton(GO:0045111) |
| 0.0 | 0.5 | GO:0051233 | spindle midzone(GO:0051233) |
| 0.0 | 0.1 | GO:0033185 | dolichol-phosphate-mannose synthase complex(GO:0033185) |
| 0.0 | 0.2 | GO:0005786 | signal recognition particle, endoplasmic reticulum targeting(GO:0005786) signal recognition particle(GO:0048500) |
| 0.0 | 0.1 | GO:0008275 | gamma-tubulin small complex(GO:0008275) |
| 0.0 | 0.3 | GO:0008250 | oligosaccharyltransferase complex(GO:0008250) |
| 0.0 | 0.1 | GO:0070160 | occluding junction(GO:0070160) |
| 0.0 | 1.5 | GO:0031526 | brush border membrane(GO:0031526) |
| 0.0 | 0.0 | GO:0005927 | muscle tendon junction(GO:0005927) |
| 0.0 | 0.2 | GO:0031298 | replication fork protection complex(GO:0031298) |
| 0.0 | 1.9 | GO:0030136 | clathrin-coated vesicle(GO:0030136) |
| 0.0 | 1.3 | GO:0005793 | endoplasmic reticulum-Golgi intermediate compartment(GO:0005793) |
| 0.0 | 0.4 | GO:0036038 | MKS complex(GO:0036038) |
| 0.0 | 2.1 | GO:0005604 | basement membrane(GO:0005604) |
| 0.0 | 0.1 | GO:0035749 | myelin sheath adaxonal region(GO:0035749) |
| 0.0 | 0.3 | GO:0032279 | asymmetric synapse(GO:0032279) |
| 0.0 | 0.2 | GO:0000778 | condensed nuclear chromosome kinetochore(GO:0000778) |
| 0.0 | 0.2 | GO:0071014 | post-mRNA release spliceosomal complex(GO:0071014) |
| 0.0 | 0.1 | GO:0030062 | mitochondrial tricarboxylic acid cycle enzyme complex(GO:0030062) |
| 0.0 | 0.2 | GO:0008024 | cyclin/CDK positive transcription elongation factor complex(GO:0008024) |
| 0.0 | 0.2 | GO:0030120 | vesicle coat(GO:0030120) |
| 0.0 | 0.2 | GO:0033061 | DNA recombinase mediator complex(GO:0033061) |
| 0.0 | 0.0 | GO:0031265 | CD95 death-inducing signaling complex(GO:0031265) |
| 0.0 | 0.1 | GO:0033180 | proton-transporting V-type ATPase, V1 domain(GO:0033180) |
| 0.0 | 0.6 | GO:0035145 | exon-exon junction complex(GO:0035145) |
| 0.0 | 0.2 | GO:0097197 | tetraspanin-enriched microdomain(GO:0097197) |
| 0.0 | 0.4 | GO:0030904 | retromer complex(GO:0030904) |
| 0.0 | 0.3 | GO:0031233 | intrinsic component of external side of plasma membrane(GO:0031233) |
| 0.0 | 0.1 | GO:0017059 | serine C-palmitoyltransferase complex(GO:0017059) endoplasmic reticulum palmitoyltransferase complex(GO:0031211) |
| 0.0 | 0.3 | GO:0000164 | protein phosphatase type 1 complex(GO:0000164) |
| 0.0 | 0.1 | GO:0042406 | extrinsic component of endoplasmic reticulum membrane(GO:0042406) |
| 0.0 | 0.1 | GO:0033588 | Elongator holoenzyme complex(GO:0033588) |
| 0.0 | 0.4 | GO:0031907 | peroxisomal matrix(GO:0005782) microbody lumen(GO:0031907) |
| 0.0 | 6.2 | GO:0031012 | extracellular matrix(GO:0031012) |
| 0.0 | 0.2 | GO:0060170 | ciliary membrane(GO:0060170) |
| 0.0 | 0.2 | GO:0034362 | low-density lipoprotein particle(GO:0034362) |
| 0.0 | 0.2 | GO:0032045 | guanyl-nucleotide exchange factor complex(GO:0032045) |
| 0.0 | 0.5 | GO:0005801 | cis-Golgi network(GO:0005801) |
| 0.0 | 5.4 | GO:0005924 | cell-substrate adherens junction(GO:0005924) |
| 0.0 | 0.1 | GO:0031501 | mannosyltransferase complex(GO:0031501) |
| 0.0 | 0.2 | GO:0036379 | myofilament(GO:0036379) |
| 0.0 | 0.1 | GO:0035061 | interchromatin granule(GO:0035061) |
| 0.0 | 0.3 | GO:0010369 | chromocenter(GO:0010369) |
| 0.0 | 1.2 | GO:0008076 | voltage-gated potassium channel complex(GO:0008076) |
| 0.0 | 0.3 | GO:0001673 | male germ cell nucleus(GO:0001673) |
| 0.0 | 0.4 | GO:1902711 | GABA receptor complex(GO:1902710) GABA-A receptor complex(GO:1902711) |
| 0.0 | 0.2 | GO:0097038 | perinuclear endoplasmic reticulum(GO:0097038) |
| 0.0 | 0.1 | GO:0005796 | Golgi lumen(GO:0005796) |
| 0.0 | 0.2 | GO:0034706 | sodium channel complex(GO:0034706) |
| 0.0 | 0.2 | GO:0030660 | Golgi-associated vesicle membrane(GO:0030660) |
| 0.0 | 0.1 | GO:0030289 | protein phosphatase 4 complex(GO:0030289) |
| 0.0 | 0.3 | GO:0030990 | intraciliary transport particle(GO:0030990) |
| 0.0 | 0.1 | GO:0005858 | axonemal dynein complex(GO:0005858) |
| 0.0 | 0.1 | GO:0046696 | lipopolysaccharide receptor complex(GO:0046696) |
| 0.0 | 0.6 | GO:0001750 | photoreceptor outer segment(GO:0001750) |
| 0.0 | 0.3 | GO:0000145 | exocyst(GO:0000145) |
| 0.0 | 0.1 | GO:0035686 | sperm fibrous sheath(GO:0035686) |
| 0.0 | 0.1 | GO:0043625 | delta DNA polymerase complex(GO:0043625) |
| 0.0 | 0.2 | GO:0031229 | integral component of nuclear inner membrane(GO:0005639) intrinsic component of nuclear inner membrane(GO:0031229) |
| 0.0 | 0.1 | GO:0030485 | smooth muscle contractile fiber(GO:0030485) |
| 0.0 | 0.0 | GO:0034673 | inhibin-betaglycan-ActRII complex(GO:0034673) |
| 0.0 | 0.1 | GO:0070820 | tertiary granule(GO:0070820) |
| 0.0 | 2.0 | GO:0098852 | lysosomal membrane(GO:0005765) lytic vacuole membrane(GO:0098852) |
| 0.0 | 1.8 | GO:0005911 | cell-cell junction(GO:0005911) |
| 0.0 | 0.4 | GO:0045178 | basal part of cell(GO:0045178) |
| 0.0 | 0.2 | GO:0000930 | gamma-tubulin complex(GO:0000930) |
| 0.0 | 0.1 | GO:0044214 | spanning component of plasma membrane(GO:0044214) spanning component of membrane(GO:0089717) |
| 0.0 | 0.0 | GO:0042825 | MHC class I peptide loading complex(GO:0042824) TAP complex(GO:0042825) |
| 0.0 | 0.0 | GO:1990635 | proximal dendrite(GO:1990635) |
| 0.0 | 0.1 | GO:0005579 | membrane attack complex(GO:0005579) |
| 0.0 | 0.1 | GO:0070545 | PeBoW complex(GO:0070545) |
| 0.0 | 0.0 | GO:0031315 | extrinsic component of mitochondrial outer membrane(GO:0031315) |
| 0.0 | 0.0 | GO:0061574 | ASAP complex(GO:0061574) |
| 0.0 | 0.1 | GO:0005677 | chromatin silencing complex(GO:0005677) |
| 0.0 | 0.0 | GO:0031313 | extrinsic component of endosome membrane(GO:0031313) |
| 0.0 | 0.1 | GO:0001939 | female pronucleus(GO:0001939) |
| 0.0 | 0.1 | GO:0034388 | Pwp2p-containing subcomplex of 90S preribosome(GO:0034388) |
| 0.0 | 0.7 | GO:0005811 | lipid particle(GO:0005811) |
| 0.0 | 0.0 | GO:0072559 | NLRP3 inflammasome complex(GO:0072559) |
| 0.0 | 0.1 | GO:0030314 | junctional membrane complex(GO:0030314) |
| 0.0 | 0.0 | GO:0070939 | Dsl1p complex(GO:0070939) |
| 0.0 | 0.0 | GO:0044614 | nuclear pore cytoplasmic filaments(GO:0044614) |
| 0.0 | 0.0 | GO:0001931 | uropod(GO:0001931) cell trailing edge(GO:0031254) |
| 0.0 | 0.1 | GO:0000938 | GARP complex(GO:0000938) |
| 0.0 | 0.1 | GO:0090543 | Flemming body(GO:0090543) |
| 0.0 | 0.1 | GO:0032009 | early phagosome(GO:0032009) |
| 0.0 | 0.1 | GO:0046930 | pore complex(GO:0046930) |
| 0.0 | 0.0 | GO:0005944 | phosphatidylinositol 3-kinase complex, class IB(GO:0005944) |
| 0.0 | 0.1 | GO:0008074 | guanylate cyclase complex, soluble(GO:0008074) |
| 0.0 | 0.1 | GO:0042599 | lamellar body(GO:0042599) |
| 0.0 | 0.0 | GO:0005826 | actomyosin contractile ring(GO:0005826) |
| 0.0 | 0.0 | GO:0030897 | HOPS complex(GO:0030897) |
| 0.0 | 0.1 | GO:0070847 | core mediator complex(GO:0070847) |
| 0.0 | 0.1 | GO:0042765 | GPI-anchor transamidase complex(GO:0042765) |
| 0.0 | 0.0 | GO:0032444 | activin responsive factor complex(GO:0032444) |
| 0.0 | 0.5 | GO:0030496 | midbody(GO:0030496) |
| 0.0 | 0.1 | GO:0043196 | varicosity(GO:0043196) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.9 | 2.6 | GO:0004345 | glucose-6-phosphate dehydrogenase activity(GO:0004345) |
| 0.7 | 2.8 | GO:0035727 | lysophosphatidic acid binding(GO:0035727) |
| 0.7 | 2.0 | GO:0030172 | troponin C binding(GO:0030172) |
| 0.6 | 3.6 | GO:0030368 | interleukin-17 receptor activity(GO:0030368) |
| 0.5 | 1.6 | GO:0001075 | transcription factor activity, RNA polymerase II core promoter sequence-specific binding involved in preinitiation complex assembly(GO:0001075) |
| 0.5 | 1.5 | GO:0008449 | N-acetylglucosamine-6-sulfatase activity(GO:0008449) |
| 0.4 | 1.3 | GO:0048030 | disaccharide binding(GO:0048030) |
| 0.4 | 1.3 | GO:0031708 | endothelin B receptor binding(GO:0031708) |
| 0.4 | 4.5 | GO:0070411 | I-SMAD binding(GO:0070411) |
| 0.4 | 1.2 | GO:0008332 | low voltage-gated calcium channel activity(GO:0008332) |
| 0.4 | 1.5 | GO:0004656 | procollagen-proline 4-dioxygenase activity(GO:0004656) |
| 0.4 | 4.5 | GO:0031005 | filamin binding(GO:0031005) |
| 0.4 | 2.6 | GO:0018630 | 3-(3-hydroxyphenyl)propionate hydroxylase activity(GO:0008688) 4-chlorobenzaldehyde oxidase activity(GO:0018471) 3,5-xylenol methylhydroxylase activity(GO:0018630) phenylacetate hydroxylase activity(GO:0018631) 4-nitrophenol 4-monooxygenase activity(GO:0018632) dimethyl sulfide monooxygenase activity(GO:0018633) alpha-pinene monooxygenase [NADH] activity(GO:0018634) 1-hydroxy-2-naphthoate hydroxylase activity(GO:0018637) toluene 4-monooxygenase activity(GO:0018638) xylene monooxygenase activity(GO:0018639) dibenzothiophene monooxygenase activity(GO:0018640) 6-hydroxy-3-methyl-2-oxo-1,2-dihydroquinoline 6-monooxygenase activity(GO:0018641) chlorophenol 4-monooxygenase activity(GO:0018642) carbon disulfide oxygenase activity(GO:0018643) toluene 2-monooxygenase activity(GO:0018644) 1-hydroxy-2-oxolimonene 1,2-monooxygenase activity(GO:0018646) phenanthrene 1,2-monooxygenase activity(GO:0018647) tetrahydrofuran hydroxylase activity(GO:0018649) styrene monooxygenase activity(GO:0018650) toluene-4-sulfonate monooxygenase activity(GO:0018651) toluene-sulfonate methyl-monooxygenase activity(GO:0018652) 3-methyl-2-oxo-1,2-dihydroquinoline 6-monooxygenase activity(GO:0018653) 2-hydroxy-phenylacetate hydroxylase activity(GO:0018654) 2-oxo-delta3-4,5,5-trimethylcyclopentenylacetyl-CoA 1,2-monooxygenase activity(GO:0018655) phenanthrene 3,4-monooxygenase activity(GO:0018656) toluene 3-monooxygenase activity(GO:0018657) 4-hydroxyphenylacetate,NADH:oxygen oxidoreductase (3-hydroxylating) activity(GO:0018660) limonene monooxygenase activity(GO:0019113) 2-methylnaphthalene hydroxylase activity(GO:0034526) 1-methylnaphthalene hydroxylase activity(GO:0034534) bisphenol A hydroxylase A activity(GO:0034560) salicylate 5-hydroxylase activity(GO:0034785) isobutylamine N-hydroxylase activity(GO:0034791) branched-chain dodecylbenzene sulfonate monooxygenase activity(GO:0034802) 3-HSA hydroxylase activity(GO:0034819) 4-hydroxypyridine-3-hydroxylase activity(GO:0034894) 2-octaprenyl-3-methyl-6-methoxy-1,4-benzoquinol hydroxylase activity(GO:0043719) 6-hydroxynicotinate 3-monooxygenase activity(GO:0043731) thalianol hydroxylase activity(GO:0080014) |
| 0.4 | 1.8 | GO:0071253 | connexin binding(GO:0071253) |
| 0.3 | 1.0 | GO:0045503 | dynein light chain binding(GO:0045503) |
| 0.3 | 1.0 | GO:0032142 | single guanine insertion binding(GO:0032142) |
| 0.3 | 0.9 | GO:0035673 | oligopeptide transmembrane transporter activity(GO:0035673) |
| 0.3 | 0.9 | GO:1990460 | leptin receptor binding(GO:1990460) |
| 0.3 | 1.3 | GO:0070051 | fibrinogen binding(GO:0070051) |
| 0.3 | 1.3 | GO:0004111 | creatine kinase activity(GO:0004111) |
| 0.3 | 1.5 | GO:0019870 | potassium channel inhibitor activity(GO:0019870) |
| 0.3 | 1.3 | GO:0034481 | chondroitin sulfotransferase activity(GO:0034481) |
| 0.3 | 0.8 | GO:0043120 | tumor necrosis factor binding(GO:0043120) |
| 0.2 | 0.7 | GO:0086007 | voltage-gated calcium channel activity involved in cardiac muscle cell action potential(GO:0086007) |
| 0.2 | 0.7 | GO:0035373 | chondroitin sulfate proteoglycan binding(GO:0035373) |
| 0.2 | 1.2 | GO:0019911 | structural constituent of myelin sheath(GO:0019911) |
| 0.2 | 1.1 | GO:0042609 | CD4 receptor binding(GO:0042609) |
| 0.2 | 0.6 | GO:0055100 | adiponectin binding(GO:0055100) |
| 0.2 | 0.6 | GO:1902282 | voltage-gated potassium channel activity involved in ventricular cardiac muscle cell action potential repolarization(GO:1902282) |
| 0.2 | 0.6 | GO:0030158 | protein xylosyltransferase activity(GO:0030158) |
| 0.2 | 1.0 | GO:0003958 | NADPH-hemoprotein reductase activity(GO:0003958) |
| 0.2 | 1.0 | GO:0030284 | estrogen receptor activity(GO:0030284) |
| 0.2 | 0.8 | GO:0016361 | activin receptor activity, type I(GO:0016361) |
| 0.2 | 2.6 | GO:0030676 | Rac guanyl-nucleotide exchange factor activity(GO:0030676) |
| 0.2 | 5.7 | GO:0042805 | actinin binding(GO:0042805) |
| 0.2 | 1.0 | GO:0005007 | fibroblast growth factor-activated receptor activity(GO:0005007) |
| 0.2 | 0.4 | GO:0005001 | transmembrane receptor protein tyrosine phosphatase activity(GO:0005001) |
| 0.2 | 1.0 | GO:0003847 | 1-alkyl-2-acetylglycerophosphocholine esterase activity(GO:0003847) |
| 0.2 | 0.4 | GO:0005072 | transforming growth factor beta receptor, cytoplasmic mediator activity(GO:0005072) |
| 0.2 | 1.1 | GO:0008046 | axon guidance receptor activity(GO:0008046) |
| 0.2 | 0.8 | GO:0031545 | peptidyl-proline 4-dioxygenase activity(GO:0031545) |
| 0.2 | 0.8 | GO:0034584 | piRNA binding(GO:0034584) |
| 0.2 | 0.9 | GO:0005095 | GTPase inhibitor activity(GO:0005095) |
| 0.2 | 5.0 | GO:0046875 | ephrin receptor binding(GO:0046875) |
| 0.2 | 1.3 | GO:0050544 | arachidonic acid binding(GO:0050544) |
| 0.2 | 2.2 | GO:0048407 | platelet-derived growth factor binding(GO:0048407) |
| 0.2 | 0.5 | GO:0015563 | uptake transmembrane transporter activity(GO:0015563) |
| 0.2 | 2.1 | GO:0001161 | intronic transcription regulatory region sequence-specific DNA binding(GO:0001161) |
| 0.2 | 1.4 | GO:0005237 | inhibitory extracellular ligand-gated ion channel activity(GO:0005237) |
| 0.2 | 0.7 | GO:0102344 | 3-hydroxy-behenoyl-CoA dehydratase activity(GO:0102344) 3-hydroxy-lignoceroyl-CoA dehydratase activity(GO:0102345) |
| 0.2 | 0.2 | GO:0034190 | apolipoprotein receptor binding(GO:0034190) |
| 0.2 | 1.5 | GO:0038191 | neuropilin binding(GO:0038191) |
| 0.2 | 1.5 | GO:0039706 | co-receptor binding(GO:0039706) |
| 0.2 | 0.5 | GO:0004069 | L-aspartate:2-oxoglutarate aminotransferase activity(GO:0004069) |
| 0.2 | 0.6 | GO:0034714 | type III transforming growth factor beta receptor binding(GO:0034714) |
| 0.2 | 1.7 | GO:0005522 | profilin binding(GO:0005522) |
| 0.2 | 0.5 | GO:0031749 | D2 dopamine receptor binding(GO:0031749) |
| 0.2 | 0.5 | GO:0031735 | CCR10 chemokine receptor binding(GO:0031735) |
| 0.2 | 3.7 | GO:0043236 | laminin binding(GO:0043236) |
| 0.2 | 0.6 | GO:0005042 | netrin receptor activity(GO:0005042) |
| 0.1 | 5.2 | GO:0005109 | frizzled binding(GO:0005109) |
| 0.1 | 0.9 | GO:0005127 | ciliary neurotrophic factor receptor binding(GO:0005127) |
| 0.1 | 0.6 | GO:0035276 | ethanol binding(GO:0035276) |
| 0.1 | 0.7 | GO:0004758 | serine C-palmitoyltransferase activity(GO:0004758) |
| 0.1 | 0.6 | GO:0017176 | phosphatidylinositol N-acetylglucosaminyltransferase activity(GO:0017176) |
| 0.1 | 1.9 | GO:0001784 | phosphotyrosine binding(GO:0001784) |
| 0.1 | 0.1 | GO:0005114 | type II transforming growth factor beta receptor binding(GO:0005114) |
| 0.1 | 1.2 | GO:0032036 | myosin heavy chain binding(GO:0032036) |
| 0.1 | 0.1 | GO:0034988 | Fc-gamma receptor I complex binding(GO:0034988) |
| 0.1 | 1.8 | GO:0008607 | phosphorylase kinase regulator activity(GO:0008607) |
| 0.1 | 0.3 | GO:0042285 | UDP-xylosyltransferase activity(GO:0035252) xylosyltransferase activity(GO:0042285) |
| 0.1 | 1.3 | GO:0050431 | transforming growth factor beta binding(GO:0050431) |
| 0.1 | 0.9 | GO:0000014 | single-stranded DNA endodeoxyribonuclease activity(GO:0000014) |
| 0.1 | 2.2 | GO:0042975 | peroxisome proliferator activated receptor binding(GO:0042975) |
| 0.1 | 0.6 | GO:0004300 | enoyl-CoA hydratase activity(GO:0004300) |
| 0.1 | 0.8 | GO:0005113 | patched binding(GO:0005113) |
| 0.1 | 0.4 | GO:0032422 | purine-rich negative regulatory element binding(GO:0032422) |
| 0.1 | 0.7 | GO:0004630 | phospholipase D activity(GO:0004630) |
| 0.1 | 0.8 | GO:0043208 | glycosphingolipid binding(GO:0043208) |
| 0.1 | 0.4 | GO:0030943 | mitochondrion targeting sequence binding(GO:0030943) |
| 0.1 | 0.2 | GO:0004699 | calcium-independent protein kinase C activity(GO:0004699) |
| 0.1 | 0.7 | GO:0047184 | 1-acylglycerophosphocholine O-acyltransferase activity(GO:0047184) |
| 0.1 | 1.4 | GO:0003785 | actin monomer binding(GO:0003785) |
| 0.1 | 0.8 | GO:0030957 | Tat protein binding(GO:0030957) |
| 0.1 | 1.3 | GO:0030215 | semaphorin receptor binding(GO:0030215) |
| 0.1 | 0.8 | GO:0051864 | histone demethylase activity (H3-K36 specific)(GO:0051864) |
| 0.1 | 0.4 | GO:0038132 | neuregulin binding(GO:0038132) |
| 0.1 | 0.3 | GO:0031014 | troponin T binding(GO:0031014) |
| 0.1 | 0.3 | GO:0003726 | double-stranded RNA adenosine deaminase activity(GO:0003726) |
| 0.1 | 0.1 | GO:0080130 | L-phenylalanine:2-oxoglutarate aminotransferase activity(GO:0080130) |
| 0.1 | 0.3 | GO:0045504 | dynein heavy chain binding(GO:0045504) |
| 0.1 | 0.4 | GO:0031750 | D3 dopamine receptor binding(GO:0031750) |
| 0.1 | 0.6 | GO:0003708 | retinoic acid receptor activity(GO:0003708) |
| 0.1 | 0.2 | GO:0048408 | epidermal growth factor binding(GO:0048408) |
| 0.1 | 0.8 | GO:0015321 | sodium-dependent phosphate transmembrane transporter activity(GO:0015321) |
| 0.1 | 0.3 | GO:0015198 | oligopeptide transporter activity(GO:0015198) |
| 0.1 | 0.5 | GO:0005092 | GDP-dissociation inhibitor activity(GO:0005092) |
| 0.1 | 0.6 | GO:0003997 | acyl-CoA oxidase activity(GO:0003997) |
| 0.1 | 0.4 | GO:0005329 | dopamine transmembrane transporter activity(GO:0005329) |
| 0.1 | 0.4 | GO:0015226 | amino-acid betaine transmembrane transporter activity(GO:0015199) carnitine transmembrane transporter activity(GO:0015226) |
| 0.1 | 0.4 | GO:0004528 | phosphodiesterase I activity(GO:0004528) |
| 0.1 | 0.4 | GO:0004971 | AMPA glutamate receptor activity(GO:0004971) |
| 0.1 | 0.4 | GO:0036374 | gamma-glutamyltransferase activity(GO:0003840) glutathione hydrolase activity(GO:0036374) |
| 0.1 | 0.4 | GO:0052650 | NADP-retinol dehydrogenase activity(GO:0052650) |
| 0.1 | 0.5 | GO:0004791 | thioredoxin-disulfide reductase activity(GO:0004791) |
| 0.1 | 2.4 | GO:0052713 | calmodulin-dependent cyclic-nucleotide phosphodiesterase activity(GO:0004117) cGMP-stimulated cyclic-nucleotide phosphodiesterase activity(GO:0004118) cGMP-inhibited cyclic-nucleotide phosphodiesterase activity(GO:0004119) photoreceptor cyclic-nucleotide phosphodiesterase activity(GO:0004120) 7,8-dihydro-D-neopterin 2',3'-cyclic phosphate phosphodiesterase activity(GO:0044688) inositol phosphosphingolipid phospholipase activity(GO:0052712) inositol phosphorylceramide phospholipase activity(GO:0052713) mannosyl-inositol phosphorylceramide phospholipase activity(GO:0052714) mannosyl-diinositol phosphorylceramide phospholipase activity(GO:0052715) |
| 0.1 | 0.3 | GO:0004605 | phosphatidate cytidylyltransferase activity(GO:0004605) |
| 0.1 | 0.3 | GO:0016262 | protein N-acetylglucosaminyltransferase activity(GO:0016262) |
| 0.1 | 1.2 | GO:0005337 | nucleoside transmembrane transporter activity(GO:0005337) |
| 0.1 | 0.3 | GO:0016743 | carboxyl- or carbamoyltransferase activity(GO:0016743) |
| 0.1 | 0.3 | GO:0004103 | choline kinase activity(GO:0004103) |
| 0.1 | 0.4 | GO:0061665 | SUMO ligase activity(GO:0061665) |
| 0.1 | 0.1 | GO:0070653 | high-density lipoprotein particle receptor binding(GO:0070653) |
| 0.1 | 0.3 | GO:0047045 | testosterone 17-beta-dehydrogenase (NADP+) activity(GO:0047045) |
| 0.1 | 0.3 | GO:0019834 | phospholipase A2 inhibitor activity(GO:0019834) |
| 0.1 | 0.3 | GO:0050694 | galactose 3-O-sulfotransferase activity(GO:0050694) |
| 0.1 | 1.3 | GO:0070064 | proline-rich region binding(GO:0070064) |
| 0.1 | 0.5 | GO:0032794 | GTPase activating protein binding(GO:0032794) |
| 0.1 | 0.3 | GO:0042731 | PH domain binding(GO:0042731) |
| 0.1 | 0.3 | GO:0018479 | benzaldehyde dehydrogenase (NAD+) activity(GO:0018479) |
| 0.1 | 0.9 | GO:0010314 | phosphatidylinositol-5-phosphate binding(GO:0010314) |
| 0.1 | 0.4 | GO:0016530 | metallochaperone activity(GO:0016530) |
| 0.1 | 0.3 | GO:0004471 | malic enzyme activity(GO:0004470) malate dehydrogenase (decarboxylating) (NAD+) activity(GO:0004471) |
| 0.1 | 0.3 | GO:0004060 | arylamine N-acetyltransferase activity(GO:0004060) |
| 0.1 | 0.3 | GO:0031800 | type 3 metabotropic glutamate receptor binding(GO:0031800) |
| 0.1 | 0.2 | GO:0004174 | electron-transferring-flavoprotein dehydrogenase activity(GO:0004174) oxidoreductase activity, acting on the CH-NH group of donors, quinone or similar compound as acceptor(GO:0016649) |
| 0.1 | 0.2 | GO:0034858 | mono-butyltin dioxygenase activity(GO:0018586) tri-n-butyltin dioxygenase activity(GO:0018588) di-n-butyltin dioxygenase activity(GO:0018589) methylsilanetriol hydroxylase activity(GO:0018590) methyl tertiary butyl ether 3-monooxygenase activity(GO:0018591) 4-nitrocatechol 4-monooxygenase activity(GO:0018592) 4-chlorophenoxyacetate monooxygenase activity(GO:0018593) tert-butanol 2-monooxygenase activity(GO:0018594) alpha-pinene monooxygenase activity(GO:0018595) dimethylsilanediol hydroxylase activity(GO:0018596) ammonia monooxygenase activity(GO:0018597) hydroxymethylsilanetriol oxidase activity(GO:0018598) 2-hydroxyisobutyrate 3-monooxygenase activity(GO:0018599) alpha-pinene dehydrogenase activity(GO:0018600) bisphenol A hydroxylase B activity(GO:0034559) 2,2-bis(4-hydroxyphenyl)-1-propanol hydroxylase activity(GO:0034562) 9-fluorenone-3,4-dioxygenase activity(GO:0034786) anthracene 9,10-dioxygenase activity(GO:0034816) 2-(methylthio)benzothiazole monooxygenase activity(GO:0034857) 2-hydroxybenzothiazole monooxygenase activity(GO:0034858) benzothiazole monooxygenase activity(GO:0034859) 2,6-dihydroxybenzothiazole monooxygenase activity(GO:0034862) pinacolone 5-monooxygenase activity(GO:0034870) thioacetamide S-oxygenase activity(GO:0034873) thioacetamide S-oxide S-oxygenase activity(GO:0034874) endosulfan monooxygenase I activity(GO:0034888) N-nitrodimethylamine hydroxylase activity(GO:0034893) 4-(1-ethyl-1,4-dimethyl-pentyl)phenol monoxygenase activity(GO:0034897) endosulfan ether monooxygenase activity(GO:0034903) pyrene 4,5-monooxygenase activity(GO:0034925) pyrene 1,2-monooxygenase activity(GO:0034927) 1-hydroxypyrene 6,7-monooxygenase activity(GO:0034928) 1-hydroxypyrene 7,8-monooxygenase activity(GO:0034929) phenylboronic acid monooxygenase activity(GO:0034950) spheroidene monooxygenase activity(GO:0043823) |
| 0.1 | 0.6 | GO:0008020 | G-protein coupled photoreceptor activity(GO:0008020) |
| 0.1 | 0.9 | GO:0044548 | S100 protein binding(GO:0044548) |
| 0.1 | 0.2 | GO:0015087 | cobalt ion transmembrane transporter activity(GO:0015087) |
| 0.1 | 0.1 | GO:0004305 | ethanolamine kinase activity(GO:0004305) |
| 0.1 | 0.3 | GO:0015016 | [heparan sulfate]-glucosamine N-sulfotransferase activity(GO:0015016) |
| 0.1 | 0.2 | GO:0016615 | malate dehydrogenase activity(GO:0016615) |
| 0.1 | 0.1 | GO:0004340 | glucokinase activity(GO:0004340) hexokinase activity(GO:0004396) fructokinase activity(GO:0008865) mannokinase activity(GO:0019158) |
| 0.1 | 0.7 | GO:0035497 | cAMP response element binding(GO:0035497) |
| 0.1 | 0.4 | GO:0000774 | adenyl-nucleotide exchange factor activity(GO:0000774) |
| 0.1 | 0.8 | GO:0008641 | small protein activating enzyme activity(GO:0008641) |
| 0.1 | 0.1 | GO:1990829 | C-rich single-stranded DNA binding(GO:1990829) |
| 0.1 | 0.1 | GO:0019912 | cyclin-dependent protein kinase activating kinase activity(GO:0019912) |
| 0.1 | 0.9 | GO:0004704 | NF-kappaB-inducing kinase activity(GO:0004704) |
| 0.1 | 1.2 | GO:0043274 | phospholipase binding(GO:0043274) |
| 0.1 | 0.3 | GO:0004749 | ribose phosphate diphosphokinase activity(GO:0004749) |
| 0.1 | 0.2 | GO:0019862 | IgA binding(GO:0019862) |
| 0.1 | 0.6 | GO:0016175 | superoxide-generating NADPH oxidase activity(GO:0016175) |
| 0.1 | 0.4 | GO:0047631 | ADP-ribose diphosphatase activity(GO:0047631) |
| 0.1 | 0.1 | GO:0031697 | beta-1 adrenergic receptor binding(GO:0031697) |
| 0.1 | 1.3 | GO:0031489 | myosin V binding(GO:0031489) |
| 0.1 | 0.4 | GO:0005412 | glucose:sodium symporter activity(GO:0005412) |
| 0.1 | 0.6 | GO:0004534 | 5'-3' exoribonuclease activity(GO:0004534) |
| 0.1 | 1.4 | GO:0071837 | HMG box domain binding(GO:0071837) |
| 0.1 | 0.3 | GO:0005105 | type 1 fibroblast growth factor receptor binding(GO:0005105) |
| 0.1 | 0.3 | GO:0051525 | NFAT protein binding(GO:0051525) |
| 0.1 | 0.3 | GO:0019966 | interleukin-1 binding(GO:0019966) |
| 0.1 | 0.3 | GO:0001016 | RNA polymerase III regulatory region DNA binding(GO:0001016) |
| 0.1 | 0.2 | GO:0033592 | RNA strand annealing activity(GO:0033592) |
| 0.1 | 0.6 | GO:0097027 | ubiquitin-protein transferase activator activity(GO:0097027) |
| 0.1 | 1.1 | GO:0001530 | lipopolysaccharide binding(GO:0001530) |
| 0.1 | 0.4 | GO:0005161 | platelet-derived growth factor receptor binding(GO:0005161) |
| 0.1 | 0.2 | GO:0004948 | calcitonin receptor activity(GO:0004948) |
| 0.1 | 0.2 | GO:0034191 | apolipoprotein A-I receptor binding(GO:0034191) |
| 0.1 | 0.3 | GO:0032557 | pyrimidine ribonucleotide binding(GO:0032557) |
| 0.1 | 1.9 | GO:0035035 | histone acetyltransferase binding(GO:0035035) |
| 0.1 | 1.4 | GO:0001786 | phosphatidylserine binding(GO:0001786) |
| 0.1 | 0.5 | GO:0035612 | AP-2 adaptor complex binding(GO:0035612) |
| 0.1 | 0.6 | GO:0031996 | thioesterase binding(GO:0031996) |
| 0.1 | 0.2 | GO:0045295 | gamma-catenin binding(GO:0045295) |
| 0.1 | 0.5 | GO:0008113 | peptide-methionine (S)-S-oxide reductase activity(GO:0008113) |
| 0.1 | 0.2 | GO:0016015 | morphogen activity(GO:0016015) |
| 0.1 | 0.2 | GO:0050510 | N-acetylgalactosaminyl-proteoglycan 3-beta-glucuronosyltransferase activity(GO:0050510) |
| 0.1 | 0.2 | GO:0070878 | primary miRNA binding(GO:0070878) |
| 0.1 | 0.8 | GO:0033130 | acetylcholine receptor binding(GO:0033130) |
| 0.1 | 0.1 | GO:0036042 | long-chain fatty acyl-CoA binding(GO:0036042) |
| 0.1 | 0.2 | GO:0015220 | choline transmembrane transporter activity(GO:0015220) |
| 0.1 | 0.2 | GO:0004359 | glutaminase activity(GO:0004359) |
| 0.1 | 0.1 | GO:0005005 | transmembrane-ephrin receptor activity(GO:0005005) |
| 0.1 | 0.4 | GO:0030306 | ADP-ribosylation factor binding(GO:0030306) |
| 0.1 | 0.2 | GO:0051033 | nucleic acid transmembrane transporter activity(GO:0051032) RNA transmembrane transporter activity(GO:0051033) |
| 0.1 | 0.3 | GO:0005167 | neurotrophin TRK receptor binding(GO:0005167) |
| 0.1 | 0.9 | GO:0016805 | dipeptidase activity(GO:0016805) |
| 0.1 | 0.4 | GO:0004385 | guanylate kinase activity(GO:0004385) |
| 0.1 | 0.2 | GO:0004126 | cytidine deaminase activity(GO:0004126) |
| 0.1 | 0.4 | GO:0004439 | phosphatidylinositol-4,5-bisphosphate 5-phosphatase activity(GO:0004439) |
| 0.1 | 0.5 | GO:0042834 | peptidoglycan binding(GO:0042834) |
| 0.1 | 0.7 | GO:0034185 | apolipoprotein binding(GO:0034185) |
| 0.1 | 0.1 | GO:0089720 | caspase binding(GO:0089720) |
| 0.1 | 0.2 | GO:0001224 | RNA polymerase II transcription cofactor binding(GO:0001224) |
| 0.1 | 0.4 | GO:0005523 | tropomyosin binding(GO:0005523) |
| 0.1 | 0.1 | GO:0005146 | leukemia inhibitory factor receptor binding(GO:0005146) |
| 0.1 | 0.5 | GO:0008307 | structural constituent of muscle(GO:0008307) |
| 0.1 | 0.2 | GO:0030144 | alpha-1,6-mannosylglycoprotein 6-beta-N-acetylglucosaminyltransferase activity(GO:0030144) |
| 0.1 | 0.1 | GO:0030375 | thyroid hormone receptor coactivator activity(GO:0030375) |
| 0.1 | 0.2 | GO:0004430 | 1-phosphatidylinositol 4-kinase activity(GO:0004430) |
| 0.1 | 0.2 | GO:0003872 | 6-phosphofructokinase activity(GO:0003872) |
| 0.1 | 0.3 | GO:0008517 | folic acid transporter activity(GO:0008517) |
| 0.1 | 1.0 | GO:0005035 | tumor necrosis factor-activated receptor activity(GO:0005031) death receptor activity(GO:0005035) |
| 0.1 | 0.2 | GO:0033192 | calmodulin-dependent protein phosphatase activity(GO:0033192) |
| 0.1 | 0.6 | GO:0023026 | MHC class II protein complex binding(GO:0023026) |
| 0.1 | 0.7 | GO:0098531 | RNA polymerase II transcription factor activity, ligand-activated sequence-specific DNA binding(GO:0004879) transcription factor activity, direct ligand regulated sequence-specific DNA binding(GO:0098531) |
| 0.1 | 0.3 | GO:0004690 | cyclic nucleotide-dependent protein kinase activity(GO:0004690) |
| 0.1 | 0.1 | GO:0032564 | dATP binding(GO:0032564) |
| 0.1 | 0.4 | GO:0008474 | palmitoyl-(protein) hydrolase activity(GO:0008474) palmitoyl hydrolase activity(GO:0098599) |
| 0.1 | 0.9 | GO:0005112 | Notch binding(GO:0005112) |
| 0.1 | 0.4 | GO:0008331 | high voltage-gated calcium channel activity(GO:0008331) |
| 0.1 | 0.2 | GO:0003917 | DNA topoisomerase type I activity(GO:0003917) |
| 0.1 | 0.3 | GO:0050897 | cobalt ion binding(GO:0050897) |
| 0.1 | 0.1 | GO:0070052 | collagen V binding(GO:0070052) |
| 0.1 | 0.1 | GO:0034211 | GTP-dependent protein kinase activity(GO:0034211) |
| 0.1 | 0.8 | GO:0016290 | palmitoyl-CoA hydrolase activity(GO:0016290) |
| 0.1 | 0.9 | GO:0031434 | mitogen-activated protein kinase kinase binding(GO:0031434) |
| 0.1 | 6.0 | GO:0008201 | heparin binding(GO:0008201) |
| 0.1 | 0.2 | GO:0032190 | acrosin binding(GO:0032190) |
| 0.1 | 0.2 | GO:0015315 | hexose phosphate transmembrane transporter activity(GO:0015119) organophosphate:inorganic phosphate antiporter activity(GO:0015315) hexose-phosphate:inorganic phosphate antiporter activity(GO:0015526) glucose 6-phosphate:inorganic phosphate antiporter activity(GO:0061513) |
| 0.1 | 0.2 | GO:0042392 | sphingosine-1-phosphate phosphatase activity(GO:0042392) |
| 0.1 | 4.8 | GO:0004222 | metalloendopeptidase activity(GO:0004222) |
| 0.1 | 1.1 | GO:0030276 | clathrin binding(GO:0030276) |
| 0.1 | 0.2 | GO:0004616 | phosphogluconate dehydrogenase (decarboxylating) activity(GO:0004616) |
| 0.1 | 0.2 | GO:0045545 | syndecan binding(GO:0045545) |
| 0.0 | 1.5 | GO:0005201 | extracellular matrix structural constituent(GO:0005201) |
| 0.0 | 0.2 | GO:0003846 | 2-acylglycerol O-acyltransferase activity(GO:0003846) |
| 0.0 | 0.1 | GO:0043546 | molybdopterin cofactor binding(GO:0043546) |
| 0.0 | 0.3 | GO:0008239 | dipeptidyl-peptidase activity(GO:0008239) |
| 0.0 | 0.1 | GO:0019153 | protein-disulfide reductase (glutathione) activity(GO:0019153) |
| 0.0 | 0.2 | GO:0000099 | sulfur amino acid transmembrane transporter activity(GO:0000099) |
| 0.0 | 2.6 | GO:0005178 | integrin binding(GO:0005178) |
| 0.0 | 0.1 | GO:0004995 | tachykinin receptor activity(GO:0004995) |
| 0.0 | 0.2 | GO:0048403 | brain-derived neurotrophic factor binding(GO:0048403) |
| 0.0 | 0.4 | GO:0004499 | N,N-dimethylaniline monooxygenase activity(GO:0004499) |
| 0.0 | 10.0 | GO:0005096 | GTPase activator activity(GO:0005096) |
| 0.0 | 1.8 | GO:0034483 | heparan sulfate sulfotransferase activity(GO:0034483) |
| 0.0 | 0.1 | GO:0071209 | U7 snRNA binding(GO:0071209) |
| 0.0 | 0.4 | GO:0015377 | cation:chloride symporter activity(GO:0015377) |
| 0.0 | 0.1 | GO:0098821 | BMP receptor activity(GO:0098821) |
| 0.0 | 1.3 | GO:0005544 | calcium-dependent phospholipid binding(GO:0005544) |
| 0.0 | 0.1 | GO:0071558 | histone demethylase activity (H3-K27 specific)(GO:0071558) |
| 0.0 | 1.4 | GO:0035591 | signaling adaptor activity(GO:0035591) |
| 0.0 | 0.0 | GO:0043125 | ErbB-3 class receptor binding(GO:0043125) |
| 0.0 | 2.5 | GO:0017137 | Rab GTPase binding(GO:0017137) |
| 0.0 | 0.2 | GO:0052717 | N-cyclopropylmelamine deaminase activity(GO:0034547) N-cyclopropylammeline deaminase activity(GO:0034548) N-cyclopropylammelide alkylamino hydrolase activity(GO:0034549) 2,5-diamino-6-ribitylamino-4(3H)-pyrimidinone 5'-phosphate deaminase activity(GO:0043723) tRNA-specific adenosine-37 deaminase activity(GO:0043829) archaeal-specific GTP cyclohydrolase activity(GO:0044682) tRNA-specific adenosine-34 deaminase activity(GO:0052717) |
| 0.0 | 0.9 | GO:0005154 | epidermal growth factor receptor binding(GO:0005154) |
| 0.0 | 0.3 | GO:0070324 | thyroid hormone binding(GO:0070324) |
| 0.0 | 1.2 | GO:0071855 | neuropeptide receptor binding(GO:0071855) |
| 0.0 | 4.6 | GO:0051015 | actin filament binding(GO:0051015) |
| 0.0 | 0.1 | GO:0090482 | vitamin transmembrane transporter activity(GO:0090482) |
| 0.0 | 0.1 | GO:0004332 | fructose-bisphosphate aldolase activity(GO:0004332) |
| 0.0 | 0.3 | GO:0008821 | crossover junction endodeoxyribonuclease activity(GO:0008821) |
| 0.0 | 0.0 | GO:0034739 | histone deacetylase activity (H4-K16 specific)(GO:0034739) |
| 0.0 | 0.2 | GO:0008499 | UDP-galactose:beta-N-acetylglucosamine beta-1,3-galactosyltransferase activity(GO:0008499) |
| 0.0 | 0.1 | GO:0016838 | carbon-oxygen lyase activity, acting on phosphates(GO:0016838) |
| 0.0 | 0.7 | GO:0004550 | nucleoside diphosphate kinase activity(GO:0004550) |
| 0.0 | 0.1 | GO:0008475 | procollagen-lysine 5-dioxygenase activity(GO:0008475) |
| 0.0 | 0.1 | GO:0019959 | interleukin-8 binding(GO:0019959) |
| 0.0 | 0.3 | GO:0019869 | chloride channel inhibitor activity(GO:0019869) |
| 0.0 | 0.0 | GO:0035256 | G-protein coupled glutamate receptor binding(GO:0035256) |
| 0.0 | 0.3 | GO:0004708 | MAP kinase kinase activity(GO:0004708) |
| 0.0 | 0.3 | GO:0004579 | dolichyl-diphosphooligosaccharide-protein glycotransferase activity(GO:0004579) |
| 0.0 | 0.2 | GO:0031821 | G-protein coupled serotonin receptor binding(GO:0031821) |
| 0.0 | 0.0 | GO:0016662 | oxidoreductase activity, acting on other nitrogenous compounds as donors, cytochrome as acceptor(GO:0016662) |
| 0.0 | 0.2 | GO:0052724 | inositol hexakisphosphate kinase activity(GO:0000828) inositol hexakisphosphate 5-kinase activity(GO:0000832) inositol hexakisphosphate 1-kinase activity(GO:0052723) inositol hexakisphosphate 3-kinase activity(GO:0052724) |
| 0.0 | 2.4 | GO:0008013 | beta-catenin binding(GO:0008013) |
| 0.0 | 0.1 | GO:0004367 | glycerol-3-phosphate dehydrogenase [NAD+] activity(GO:0004367) |
| 0.0 | 0.6 | GO:0015095 | magnesium ion transmembrane transporter activity(GO:0015095) |
| 0.0 | 0.2 | GO:0004767 | sphingomyelin phosphodiesterase activity(GO:0004767) |
| 0.0 | 0.4 | GO:0004016 | adenylate cyclase activity(GO:0004016) |
| 0.0 | 1.0 | GO:0017022 | myosin binding(GO:0017022) |
| 0.0 | 0.1 | GO:0042289 | MHC class II protein binding(GO:0042289) |
| 0.0 | 0.9 | GO:0051721 | protein phosphatase 2A binding(GO:0051721) |
| 0.0 | 0.1 | GO:0016901 | oxidoreductase activity, acting on the CH-OH group of donors, quinone or similar compound as acceptor(GO:0016901) |
| 0.0 | 0.2 | GO:0001727 | lipid kinase activity(GO:0001727) |
| 0.0 | 0.2 | GO:0003680 | AT DNA binding(GO:0003680) |
| 0.0 | 0.5 | GO:0019215 | intermediate filament binding(GO:0019215) |
| 0.0 | 1.4 | GO:0005160 | transforming growth factor beta receptor binding(GO:0005160) |
| 0.0 | 0.4 | GO:0043422 | protein kinase B binding(GO:0043422) |
| 0.0 | 0.1 | GO:0004427 | inorganic diphosphatase activity(GO:0004427) |
| 0.0 | 0.1 | GO:0005047 | signal recognition particle binding(GO:0005047) |
| 0.0 | 0.1 | GO:0051718 | DNA (cytosine-5-)-methyltransferase activity(GO:0003886) DNA (cytosine-5-)-methyltransferase activity, acting on CpG substrates(GO:0051718) |
| 0.0 | 0.1 | GO:0005275 | amine transmembrane transporter activity(GO:0005275) |
| 0.0 | 0.1 | GO:0030280 | structural constituent of epidermis(GO:0030280) |
| 0.0 | 0.3 | GO:0070888 | E-box binding(GO:0070888) |
| 0.0 | 0.1 | GO:0035939 | microsatellite binding(GO:0035939) |
| 0.0 | 0.0 | GO:0004517 | nitric-oxide synthase activity(GO:0004517) |
| 0.0 | 0.4 | GO:0070402 | NADPH binding(GO:0070402) |
| 0.0 | 0.4 | GO:0019200 | carbohydrate kinase activity(GO:0019200) |
| 0.0 | 0.3 | GO:0003796 | lysozyme activity(GO:0003796) |
| 0.0 | 0.1 | GO:0031802 | type 5 metabotropic glutamate receptor binding(GO:0031802) |
| 0.0 | 0.0 | GO:0000009 | alpha-1,6-mannosyltransferase activity(GO:0000009) |
| 0.0 | 0.1 | GO:0004741 | [pyruvate dehydrogenase (lipoamide)] phosphatase activity(GO:0004741) |
| 0.0 | 0.6 | GO:0005520 | insulin-like growth factor binding(GO:0005520) |
| 0.0 | 0.2 | GO:0008312 | 7S RNA binding(GO:0008312) |
| 0.0 | 0.2 | GO:0098632 | protein binding involved in cell-cell adhesion(GO:0098632) |
| 0.0 | 0.0 | GO:0070016 | armadillo repeat domain binding(GO:0070016) |
| 0.0 | 0.0 | GO:0008532 | N-acetyllactosaminide beta-1,3-N-acetylglucosaminyltransferase activity(GO:0008532) |
| 0.0 | 0.1 | GO:0055131 | C3HC4-type RING finger domain binding(GO:0055131) |
| 0.0 | 0.2 | GO:0034603 | pyruvate dehydrogenase activity(GO:0004738) pyruvate dehydrogenase [NAD(P)+] activity(GO:0034603) pyruvate dehydrogenase (NAD+) activity(GO:0034604) |
| 0.0 | 0.1 | GO:0008107 | galactoside 2-alpha-L-fucosyltransferase activity(GO:0008107) alpha-(1,2)-fucosyltransferase activity(GO:0031127) |
| 0.0 | 0.2 | GO:0005159 | insulin-like growth factor receptor binding(GO:0005159) |
| 0.0 | 0.2 | GO:0019855 | calcium channel inhibitor activity(GO:0019855) |
| 0.0 | 0.1 | GO:0003986 | acetyl-CoA hydrolase activity(GO:0003986) |
| 0.0 | 0.2 | GO:0047760 | butyrate-CoA ligase activity(GO:0047760) |
| 0.0 | 0.1 | GO:0019788 | NEDD8 transferase activity(GO:0019788) |
| 0.0 | 0.0 | GO:0004331 | fructose-2,6-bisphosphate 2-phosphatase activity(GO:0004331) |
| 0.0 | 0.2 | GO:0015280 | ligand-gated sodium channel activity(GO:0015280) |
| 0.0 | 0.7 | GO:0008330 | protein tyrosine/threonine phosphatase activity(GO:0008330) |
| 0.0 | 0.0 | GO:0052813 | phosphatidylinositol bisphosphate kinase activity(GO:0052813) |
| 0.0 | 0.0 | GO:0016880 | acid-ammonia (or amide) ligase activity(GO:0016880) |
| 0.0 | 0.1 | GO:0035877 | death effector domain binding(GO:0035877) |
| 0.0 | 0.1 | GO:0004468 | lysine N-acetyltransferase activity, acting on acetyl phosphate as donor(GO:0004468) |
| 0.0 | 0.9 | GO:0015485 | cholesterol binding(GO:0015485) |
| 0.0 | 0.2 | GO:0001223 | transcription coactivator binding(GO:0001223) |
| 0.0 | 0.6 | GO:0004198 | calcium-dependent cysteine-type endopeptidase activity(GO:0004198) |
| 0.0 | 0.2 | GO:0003988 | acetyl-CoA C-acyltransferase activity(GO:0003988) |
| 0.0 | 0.2 | GO:0008097 | 5S rRNA binding(GO:0008097) |
| 0.0 | 0.4 | GO:0042813 | Wnt-activated receptor activity(GO:0042813) |
| 0.0 | 0.2 | GO:0086006 | voltage-gated sodium channel activity involved in cardiac muscle cell action potential(GO:0086006) |
| 0.0 | 0.1 | GO:0016520 | growth hormone-releasing hormone receptor activity(GO:0016520) |
| 0.0 | 0.1 | GO:0043426 | MRF binding(GO:0043426) |
| 0.0 | 0.2 | GO:0030159 | receptor signaling complex scaffold activity(GO:0030159) |
| 0.0 | 0.1 | GO:0050656 | 3'-phosphoadenosine 5'-phosphosulfate binding(GO:0050656) |
| 0.0 | 0.3 | GO:0008796 | bis(5'-nucleosyl)-tetraphosphatase activity(GO:0008796) |
| 0.0 | 0.2 | GO:0005324 | long-chain fatty acid transporter activity(GO:0005324) |
| 0.0 | 1.0 | GO:0005044 | scavenger receptor activity(GO:0005044) |
| 0.0 | 0.1 | GO:0018636 | phenanthrene 9,10-monooxygenase activity(GO:0018636) |
| 0.0 | 0.1 | GO:0004800 | thyroxine 5'-deiodinase activity(GO:0004800) |
| 0.0 | 0.4 | GO:0015269 | calcium-activated potassium channel activity(GO:0015269) |
| 0.0 | 0.1 | GO:0004771 | sterol esterase activity(GO:0004771) |
| 0.0 | 1.2 | GO:0035064 | methylated histone binding(GO:0035064) |
| 0.0 | 0.1 | GO:0000983 | transcription factor activity, RNA polymerase II core promoter sequence-specific(GO:0000983) |
| 0.0 | 0.2 | GO:0016308 | 1-phosphatidylinositol-4-phosphate 5-kinase activity(GO:0016308) |
| 0.0 | 0.3 | GO:0015026 | coreceptor activity(GO:0015026) |
| 0.0 | 0.1 | GO:0019797 | procollagen-proline 3-dioxygenase activity(GO:0019797) |
| 0.0 | 0.1 | GO:0016671 | oxidoreductase activity, acting on a sulfur group of donors, disulfide as acceptor(GO:0016671) |
| 0.0 | 0.1 | GO:0035312 | 5'-3' exodeoxyribonuclease activity(GO:0035312) |
| 0.0 | 0.4 | GO:0042169 | SH2 domain binding(GO:0042169) |
| 0.0 | 0.1 | GO:0035005 | 1-phosphatidylinositol-4-phosphate 3-kinase activity(GO:0035005) |
| 0.0 | 0.1 | GO:0004703 | G-protein coupled receptor kinase activity(GO:0004703) |
| 0.0 | 0.0 | GO:0038181 | bile acid receptor activity(GO:0038181) |
| 0.0 | 0.4 | GO:0046966 | thyroid hormone receptor binding(GO:0046966) |
| 0.0 | 0.2 | GO:0031435 | mitogen-activated protein kinase kinase kinase binding(GO:0031435) |
| 0.0 | 0.0 | GO:0051373 | FATZ binding(GO:0051373) |
| 0.0 | 1.0 | GO:0000979 | RNA polymerase II core promoter sequence-specific DNA binding(GO:0000979) |
| 0.0 | 0.5 | GO:0015301 | anion:anion antiporter activity(GO:0015301) |
| 0.0 | 0.0 | GO:0061629 | RNA polymerase II sequence-specific DNA binding transcription factor binding(GO:0061629) |
| 0.0 | 0.1 | GO:0008158 | hedgehog receptor activity(GO:0008158) |
| 0.0 | 0.0 | GO:0047023 | androsterone dehydrogenase activity(GO:0047023) |
| 0.0 | 0.1 | GO:0050220 | prostaglandin-E synthase activity(GO:0050220) |
| 0.0 | 0.1 | GO:0004096 | catalase activity(GO:0004096) |
| 0.0 | 0.1 | GO:0001591 | dopamine neurotransmitter receptor activity, coupled via Gi/Go(GO:0001591) |
| 0.0 | 0.1 | GO:0003945 | N-acetyllactosamine synthase activity(GO:0003945) |
| 0.0 | 0.1 | GO:0008823 | cupric reductase activity(GO:0008823) ferric-chelate reductase (NADPH) activity(GO:0052851) |
| 0.0 | 0.0 | GO:0019237 | centromeric DNA binding(GO:0019237) |
| 0.0 | 0.2 | GO:0052685 | acyl-CoA ligase activity(GO:0003996) 3-oxo-2-(2'-pentenyl)cyclopentane-1-octanoic acid CoA ligase activity(GO:0010435) 3-isopropenyl-6-oxoheptanoyl-CoA synthetase activity(GO:0018854) 2-oxo-delta3-4,5,5-trimethylcyclopentenylacetyl-CoA synthetase activity(GO:0018855) benzoyl acetate-CoA ligase activity(GO:0018856) 2,4-dichlorobenzoate-CoA ligase activity(GO:0018857) pivalate-CoA ligase activity(GO:0034783) cyclopropanecarboxylate-CoA ligase activity(GO:0034793) adipate-CoA ligase activity(GO:0034796) citronellyl-CoA ligase activity(GO:0034823) mentha-1,3-dione-CoA ligase activity(GO:0034841) thiophene-2-carboxylate-CoA ligase activity(GO:0034842) 2,4,4-trimethylpentanoate-CoA ligase activity(GO:0034865) cis-2-methyl-5-isopropylhexa-2,5-dienoate-CoA ligase activity(GO:0034942) trans-2-methyl-5-isopropylhexa-2,5-dienoate-CoA ligase activity(GO:0034943) branched-chain acyl-CoA synthetase (ADP-forming) activity(GO:0043759) aryl-CoA synthetase (ADP-forming) activity(GO:0043762) 3-hydroxypropionyl-CoA synthetase activity(GO:0043955) perillic acid:CoA ligase (ADP-forming) activity(GO:0052685) perillic acid:CoA ligase (AMP-forming) activity(GO:0052686) (3R)-3-isopropenyl-6-oxoheptanoate:CoA ligase (ADP-forming) activity(GO:0052687) (3R)-3-isopropenyl-6-oxoheptanoate:CoA ligase (AMP-forming) activity(GO:0052688) pristanate-CoA ligase activity(GO:0070251) malonyl-CoA synthetase activity(GO:0090409) |
| 0.0 | 0.1 | GO:0015197 | peptide transporter activity(GO:0015197) |
| 0.0 | 0.1 | GO:0004833 | tryptophan 2,3-dioxygenase activity(GO:0004833) |
| 0.0 | 0.1 | GO:0070061 | fructose binding(GO:0070061) |
| 0.0 | 0.1 | GO:0005499 | vitamin D binding(GO:0005499) |
| 0.0 | 0.1 | GO:0019203 | carbohydrate phosphatase activity(GO:0019203) sugar-phosphatase activity(GO:0050308) |
| 0.0 | 0.1 | GO:0044020 | histone methyltransferase activity (H4-R3 specific)(GO:0044020) |
| 0.0 | 0.9 | GO:0033613 | activating transcription factor binding(GO:0033613) |
| 0.0 | 0.0 | GO:0034452 | dynactin binding(GO:0034452) |
| 0.0 | 0.0 | GO:0030274 | LIM domain binding(GO:0030274) |
| 0.0 | 0.2 | GO:0015279 | store-operated calcium channel activity(GO:0015279) |
| 0.0 | 0.0 | GO:0001069 | regulatory region RNA binding(GO:0001069) |
| 0.0 | 0.0 | GO:0010997 | anaphase-promoting complex binding(GO:0010997) |
| 0.0 | 0.1 | GO:0048406 | nerve growth factor binding(GO:0048406) |
| 0.0 | 0.0 | GO:0052872 | tocotrienol omega-hydroxylase activity(GO:0052872) |
| 0.0 | 0.2 | GO:0008253 | 5'-nucleotidase activity(GO:0008253) |
| 0.0 | 0.1 | GO:0031694 | alpha-2A adrenergic receptor binding(GO:0031694) |
| 0.0 | 0.0 | GO:0050664 | oxidoreductase activity, acting on NAD(P)H, oxygen as acceptor(GO:0050664) |
| 0.0 | 0.0 | GO:0004376 | glycolipid mannosyltransferase activity(GO:0004376) |
| 0.0 | 0.1 | GO:0005148 | prolactin receptor binding(GO:0005148) |
| 0.0 | 0.1 | GO:0008508 | bile acid:sodium symporter activity(GO:0008508) |
| 0.0 | 0.1 | GO:0071074 | eukaryotic initiation factor eIF2 binding(GO:0071074) |
| 0.0 | 0.1 | GO:0016018 | cyclosporin A binding(GO:0016018) |
| 0.0 | 0.1 | GO:0001968 | fibronectin binding(GO:0001968) |
| 0.0 | 0.1 | GO:0050733 | RS domain binding(GO:0050733) |
| 0.0 | 0.0 | GO:0004716 | receptor signaling protein tyrosine kinase activity(GO:0004716) |
| 0.0 | 0.2 | GO:0003707 | steroid hormone receptor activity(GO:0003707) |
| 0.0 | 0.1 | GO:0031690 | adrenergic receptor binding(GO:0031690) |
| 0.0 | 0.1 | GO:0004829 | threonine-tRNA ligase activity(GO:0004829) |
| 0.0 | 0.0 | GO:0003933 | GTP cyclohydrolase activity(GO:0003933) |
| 0.0 | 0.0 | GO:0030229 | very-low-density lipoprotein particle receptor activity(GO:0030229) |
| 0.0 | 0.3 | GO:0043014 | alpha-tubulin binding(GO:0043014) |
| 0.0 | 0.0 | GO:0032554 | purine deoxyribonucleotide binding(GO:0032554) |
| 0.0 | 0.1 | GO:0008900 | hydrogen:potassium-exchanging ATPase activity(GO:0008900) |
| 0.0 | 0.1 | GO:0097603 | temperature-gated ion channel activity(GO:0097603) |
| 0.0 | 0.1 | GO:0016882 | cyclo-ligase activity(GO:0016882) |
| 0.0 | 0.0 | GO:0016494 | C-X-C chemokine receptor activity(GO:0016494) |
| 0.0 | 0.1 | GO:0005223 | intracellular cGMP activated cation channel activity(GO:0005223) |
| 0.0 | 0.1 | GO:0019166 | trans-2-enoyl-CoA reductase (NADPH) activity(GO:0019166) |
| 0.0 | 0.1 | GO:0016716 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, another compound as one donor, and incorporation of one atom of oxygen(GO:0016716) |
| 0.0 | 0.1 | GO:2001069 | glycogen binding(GO:2001069) |
| 0.0 | 0.1 | GO:0004488 | methylenetetrahydrofolate dehydrogenase (NADP+) activity(GO:0004488) |
| 0.0 | 0.1 | GO:0008430 | selenium binding(GO:0008430) |
| 0.0 | 0.1 | GO:0070728 | leucine binding(GO:0070728) |
| 0.0 | 0.1 | GO:0051011 | microtubule minus-end binding(GO:0051011) |
| 0.0 | 0.9 | GO:0000033 | alpha-1,3-mannosyltransferase activity(GO:0000033) |
| 0.0 | 0.1 | GO:0004967 | glucagon receptor activity(GO:0004967) |
| 0.0 | 0.0 | GO:0004144 | diacylglycerol O-acyltransferase activity(GO:0004144) |
| 0.0 | 0.3 | GO:0005272 | sodium channel activity(GO:0005272) |
| 0.0 | 0.1 | GO:0008140 | cAMP response element binding protein binding(GO:0008140) |
| 0.0 | 0.0 | GO:0010861 | thyroid hormone receptor activator activity(GO:0010861) |
| 0.0 | 0.0 | GO:0046870 | cadmium ion binding(GO:0046870) |
| 0.0 | 0.1 | GO:0015266 | protein channel activity(GO:0015266) |
| 0.0 | 0.1 | GO:0047498 | calcium-dependent phospholipase A2 activity(GO:0047498) |
| 0.0 | 0.1 | GO:0043912 | D-lysine oxidase activity(GO:0043912) |
| 0.0 | 0.0 | GO:0098519 | nucleotide phosphatase activity, acting on free nucleotides(GO:0098519) |
| 0.0 | 0.1 | GO:0097322 | 7SK snRNA binding(GO:0097322) |
| 0.0 | 0.1 | GO:0050786 | RAGE receptor binding(GO:0050786) |
| 0.0 | 0.0 | GO:0004698 | calcium-dependent protein kinase C activity(GO:0004698) |
| 0.0 | 0.0 | GO:0019187 | beta-1,4-mannosyltransferase activity(GO:0019187) |
| 0.0 | 0.1 | GO:1904288 | BAT3 complex binding(GO:1904288) |
| 0.0 | 0.1 | GO:0005338 | nucleotide-sugar transmembrane transporter activity(GO:0005338) |
| 0.0 | 0.0 | GO:0070095 | fructose-6-phosphate binding(GO:0070095) |
| 0.0 | 0.0 | GO:0051022 | Rho GDP-dissociation inhibitor binding(GO:0051022) |
| 0.0 | 0.1 | GO:0015101 | organic cation transmembrane transporter activity(GO:0015101) |
| 0.0 | 0.3 | GO:0016675 | cytochrome-c oxidase activity(GO:0004129) heme-copper terminal oxidase activity(GO:0015002) oxidoreductase activity, acting on a heme group of donors(GO:0016675) oxidoreductase activity, acting on a heme group of donors, oxygen as acceptor(GO:0016676) |
| 0.0 | 0.0 | GO:0015215 | nucleotide transmembrane transporter activity(GO:0015215) organophosphate ester transmembrane transporter activity(GO:0015605) |
| 0.0 | 0.0 | GO:0048256 | flap endonuclease activity(GO:0048256) |
| 0.0 | 0.0 | GO:0051185 | coenzyme transporter activity(GO:0051185) |
| 0.0 | 0.2 | GO:0016849 | phosphorus-oxygen lyase activity(GO:0016849) |
| 0.0 | 0.0 | GO:0043560 | insulin receptor substrate binding(GO:0043560) |
| 0.0 | 0.3 | GO:0001227 | transcriptional repressor activity, RNA polymerase II transcription regulatory region sequence-specific binding(GO:0001227) |
| 0.0 | 0.5 | GO:0033038 | bitter taste receptor activity(GO:0033038) |
| 0.0 | 0.1 | GO:0050750 | low-density lipoprotein particle receptor binding(GO:0050750) |
| 0.0 | 0.1 | GO:0050291 | sphingosine N-acyltransferase activity(GO:0050291) |
| 0.0 | 0.0 | GO:0046923 | ER retention sequence binding(GO:0046923) |
| 0.0 | 0.0 | GO:0055102 | lipase inhibitor activity(GO:0055102) |
| 0.0 | 0.1 | GO:0043842 | Kdo transferase activity(GO:0043842) |
| 0.0 | 0.0 | GO:0015065 | uridine nucleotide receptor activity(GO:0015065) G-protein coupled pyrimidinergic nucleotide receptor activity(GO:0071553) |
| 0.0 | 0.1 | GO:0102391 | decanoate--CoA ligase activity(GO:0102391) |
| 0.0 | 0.0 | GO:0005134 | interleukin-2 receptor binding(GO:0005134) |
| 0.0 | 0.4 | GO:0097472 | cyclin-dependent protein serine/threonine kinase activity(GO:0004693) cyclin-dependent protein kinase activity(GO:0097472) |
| 0.0 | 0.0 | GO:0004677 | DNA-dependent protein kinase activity(GO:0004677) |
| 0.0 | 0.0 | GO:0097016 | L27 domain binding(GO:0097016) |
| 0.0 | 0.4 | GO:0004714 | transmembrane receptor protein tyrosine kinase activity(GO:0004714) |
| 0.0 | 0.1 | GO:0004045 | aminoacyl-tRNA hydrolase activity(GO:0004045) |
| 0.0 | 0.0 | GO:0008486 | diphosphoinositol-polyphosphate diphosphatase activity(GO:0008486) |
| 0.0 | 0.0 | GO:0031433 | telethonin binding(GO:0031433) |
| 0.0 | 1.9 | GO:0003779 | actin binding(GO:0003779) |
| 0.0 | 0.0 | GO:0004416 | hydroxyacylglutathione hydrolase activity(GO:0004416) |
| 0.0 | 0.0 | GO:0017166 | vinculin binding(GO:0017166) |
| 0.0 | 0.1 | GO:0042500 | aspartic endopeptidase activity, intramembrane cleaving(GO:0042500) |
| 0.0 | 0.0 | GO:0004999 | vasoactive intestinal polypeptide receptor activity(GO:0004999) |
| 0.0 | 0.0 | GO:0004022 | alcohol dehydrogenase (NAD) activity(GO:0004022) |
| 0.0 | 0.0 | GO:0032052 | bile acid binding(GO:0032052) |
| 0.0 | 0.1 | GO:0031432 | titin binding(GO:0031432) |
| 0.0 | 0.3 | GO:0008009 | chemokine activity(GO:0008009) |
| 0.0 | 0.0 | GO:0003941 | L-serine ammonia-lyase activity(GO:0003941) |
| 0.0 | 0.1 | GO:0016907 | G-protein coupled acetylcholine receptor activity(GO:0016907) |
| 0.0 | 4.4 | GO:0001012 | RNA polymerase II regulatory region DNA binding(GO:0001012) |
| 0.0 | 0.1 | GO:0015288 | porin activity(GO:0015288) |
| 0.0 | 0.4 | GO:0019003 | GDP binding(GO:0019003) |
| 0.0 | 0.2 | GO:0004181 | metallocarboxypeptidase activity(GO:0004181) |
| 0.0 | 0.0 | GO:0008349 | MAP kinase kinase kinase kinase activity(GO:0008349) |
| 0.0 | 0.0 | GO:0034056 | estrogen response element binding(GO:0034056) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.2 | 0.4 | PID ECADHERIN KERATINOCYTE PATHWAY | E-cadherin signaling in keratinocytes |
| 0.2 | 15.0 | PID BETA CATENIN NUC PATHWAY | Regulation of nuclear beta catenin signaling and target gene transcription |
| 0.2 | 7.6 | NABA COLLAGENS | Genes encoding collagen proteins |
| 0.2 | 6.9 | PID EPHB FWD PATHWAY | EPHB forward signaling |
| 0.2 | 0.2 | PID IFNG PATHWAY | IFN-gamma pathway |
| 0.2 | 1.8 | PID INTEGRIN4 PATHWAY | Alpha6 beta4 integrin-ligand interactions |
| 0.2 | 0.8 | PID ARF6 DOWNSTREAM PATHWAY | Arf6 downstream pathway |
| 0.1 | 0.4 | PID IL3 PATHWAY | IL3-mediated signaling events |
| 0.1 | 2.3 | PID INTEGRIN5 PATHWAY | Beta5 beta6 beta7 and beta8 integrin cell surface interactions |
| 0.1 | 1.5 | SA G1 AND S PHASES | Cdk2, 4, and 6 bind cyclin D in G1, while cdk2/cyclin E promotes the G1/S transition. |
| 0.1 | 5.8 | PID RHOA REG PATHWAY | Regulation of RhoA activity |
| 0.1 | 0.1 | PID NFKAPPAB ATYPICAL PATHWAY | Atypical NF-kappaB pathway |
| 0.1 | 0.2 | PID IGF1 PATHWAY | IGF1 pathway |
| 0.1 | 0.9 | PID NECTIN PATHWAY | Nectin adhesion pathway |
| 0.1 | 1.5 | SA MMP CYTOKINE CONNECTION | Cytokines can induce activation of matrix metalloproteinases, which degrade extracellular matrix. |
| 0.1 | 2.7 | PID FRA PATHWAY | Validated transcriptional targets of AP1 family members Fra1 and Fra2 |
| 0.1 | 3.0 | PID WNT SIGNALING PATHWAY | Wnt signaling network |
| 0.1 | 0.3 | PID HDAC CLASSII PATHWAY | Signaling events mediated by HDAC Class II |
| 0.1 | 1.8 | PID HEDGEHOG 2PATHWAY | Signaling events mediated by the Hedgehog family |
| 0.1 | 0.4 | PID S1P S1P2 PATHWAY | S1P2 pathway |
| 0.1 | 0.1 | PID S1P S1P3 PATHWAY | S1P3 pathway |
| 0.1 | 1.3 | PID ECADHERIN NASCENT AJ PATHWAY | E-cadherin signaling in the nascent adherens junction |
| 0.1 | 0.9 | PID VEGF VEGFR PATHWAY | VEGF and VEGFR signaling network |
| 0.1 | 1.6 | PID AVB3 INTEGRIN PATHWAY | Integrins in angiogenesis |
| 0.1 | 3.8 | PID FGF PATHWAY | FGF signaling pathway |
| 0.1 | 0.5 | PID RANBP2 PATHWAY | Sumoylation by RanBP2 regulates transcriptional repression |
| 0.1 | 1.3 | PID ERBB NETWORK PATHWAY | ErbB receptor signaling network |
| 0.1 | 1.6 | PID EPHRINB REV PATHWAY | Ephrin B reverse signaling |
| 0.1 | 0.8 | PID AVB3 OPN PATHWAY | Osteopontin-mediated events |
| 0.1 | 3.1 | PID AJDISS 2PATHWAY | Posttranslational regulation of adherens junction stability and dissassembly |
| 0.1 | 0.3 | PID S1P META PATHWAY | Sphingosine 1-phosphate (S1P) pathway |
| 0.1 | 1.9 | PID RAS PATHWAY | Regulation of Ras family activation |
| 0.1 | 0.2 | PID ALK2 PATHWAY | ALK2 signaling events |
| 0.1 | 3.4 | WNT SIGNALING | Genes related to Wnt-mediated signal transduction |
| 0.1 | 0.7 | PID GLYPICAN 1PATHWAY | Glypican 1 network |
| 0.1 | 1.5 | PID ENDOTHELIN PATHWAY | Endothelins |
| 0.1 | 2.4 | PID LYSOPHOSPHOLIPID PATHWAY | LPA receptor mediated events |
| 0.1 | 1.0 | PID INTEGRIN A9B1 PATHWAY | Alpha9 beta1 integrin signaling events |
| 0.1 | 0.1 | ST INTERLEUKIN 4 PATHWAY | Interleukin 4 (IL-4) Pathway |
| 0.1 | 1.1 | PID RAC1 REG PATHWAY | Regulation of RAC1 activity |
| 0.1 | 0.8 | PID NFKAPPAB CANONICAL PATHWAY | Canonical NF-kappaB pathway |
| 0.1 | 1.4 | PID CERAMIDE PATHWAY | Ceramide signaling pathway |
| 0.1 | 0.7 | PID SMAD2 3PATHWAY | Regulation of cytoplasmic and nuclear SMAD2/3 signaling |
| 0.1 | 0.7 | PID HIF1A PATHWAY | Hypoxic and oxygen homeostasis regulation of HIF-1-alpha |
| 0.1 | 0.2 | PID TCR RAS PATHWAY | Ras signaling in the CD4+ TCR pathway |
| 0.1 | 1.1 | PID HDAC CLASSIII PATHWAY | Signaling events mediated by HDAC Class III |
| 0.1 | 1.2 | PID RXR VDR PATHWAY | RXR and RAR heterodimerization with other nuclear receptor |
| 0.1 | 1.6 | PID TGFBR PATHWAY | TGF-beta receptor signaling |
| 0.1 | 0.1 | SA PROGRAMMED CELL DEATH | Programmed cell death, or apoptosis, eliminates damaged or unneeded cells. |
| 0.0 | 0.8 | PID EPHA FWDPATHWAY | EPHA forward signaling |
| 0.0 | 0.5 | PID ERBB2 ERBB3 PATHWAY | ErbB2/ErbB3 signaling events |
| 0.0 | 0.4 | PID INSULIN GLUCOSE PATHWAY | Insulin-mediated glucose transport |
| 0.0 | 1.1 | PID RHOA PATHWAY | RhoA signaling pathway |
| 0.0 | 0.1 | ST PAC1 RECEPTOR PATHWAY | PAC1 Receptor Pathway |
| 0.0 | 0.6 | PID ALK1 PATHWAY | ALK1 signaling events |
| 0.0 | 0.0 | SIG CHEMOTAXIS | Genes related to chemotaxis |
| 0.0 | 5.5 | NABA ECM AFFILIATED | Genes encoding proteins affiliated structurally or functionally to extracellular matrix proteins |
| 0.0 | 1.2 | PID TAP63 PATHWAY | Validated transcriptional targets of TAp63 isoforms |
| 0.0 | 0.1 | PID PDGFRA PATHWAY | PDGFR-alpha signaling pathway |
| 0.0 | 0.5 | PID ALPHA SYNUCLEIN PATHWAY | Alpha-synuclein signaling |
| 0.0 | 0.1 | ST GA12 PATHWAY | G alpha 12 Pathway |
| 0.0 | 0.0 | PID IL8 CXCR1 PATHWAY | IL8- and CXCR1-mediated signaling events |
| 0.0 | 0.3 | PID TCR PATHWAY | TCR signaling in naïve CD4+ T cells |
| 0.0 | 0.2 | PID FAK PATHWAY | Signaling events mediated by focal adhesion kinase |
| 0.0 | 0.3 | ST WNT BETA CATENIN PATHWAY | Wnt/beta-catenin Pathway |
| 0.0 | 0.2 | PID IL2 1PATHWAY | IL2-mediated signaling events |
| 0.0 | 1.0 | NABA PROTEOGLYCANS | Genes encoding proteoglycans |
| 0.0 | 0.1 | SIG INSULIN RECEPTOR PATHWAY IN CARDIAC MYOCYTES | Genes related to the insulin receptor pathway |
| 0.0 | 0.3 | PID NEPHRIN NEPH1 PATHWAY | Nephrin/Neph1 signaling in the kidney podocyte |
| 0.0 | 0.0 | PID TCR JNK PATHWAY | JNK signaling in the CD4+ TCR pathway |
| 0.0 | 0.1 | PID WNT CANONICAL PATHWAY | Canonical Wnt signaling pathway |
| 0.0 | 0.4 | PID HIF2PATHWAY | HIF-2-alpha transcription factor network |
| 0.0 | 5.9 | NABA SECRETED FACTORS | Genes encoding secreted soluble factors |
| 0.0 | 0.4 | PID BMP PATHWAY | BMP receptor signaling |
| 0.0 | 0.5 | PID RAC1 PATHWAY | RAC1 signaling pathway |
| 0.0 | 0.9 | PID MYC REPRESS PATHWAY | Validated targets of C-MYC transcriptional repression |
| 0.0 | 0.1 | PID CXCR4 PATHWAY | CXCR4-mediated signaling events |
| 0.0 | 0.4 | ST WNT CA2 CYCLIC GMP PATHWAY | Wnt/Ca2+/cyclic GMP signaling. |
| 0.0 | 0.1 | PID TNF PATHWAY | TNF receptor signaling pathway |
| 0.0 | 0.5 | SIG REGULATION OF THE ACTIN CYTOSKELETON BY RHO GTPASES | Genes related to regulation of the actin cytoskeleton |
| 0.0 | 0.2 | PID ERB GENOMIC PATHWAY | Validated nuclear estrogen receptor beta network |
| 0.0 | 0.0 | SA FAS SIGNALING | The TNF-type receptor Fas induces apoptosis on ligand binding. |
| 0.0 | 0.3 | PID PTP1B PATHWAY | Signaling events mediated by PTP1B |
| 0.0 | 0.2 | PID CDC42 REG PATHWAY | Regulation of CDC42 activity |
| 0.0 | 0.2 | PID IL6 7 PATHWAY | IL6-mediated signaling events |
| 0.0 | 0.1 | PID PI3KCI PATHWAY | Class I PI3K signaling events |
| 0.0 | 0.2 | PID IL2 PI3K PATHWAY | IL2 signaling events mediated by PI3K |
| 0.0 | 0.2 | NABA BASEMENT MEMBRANES | Genes encoding structural components of basement membranes |
| 0.0 | 0.1 | PID TXA2PATHWAY | Thromboxane A2 receptor signaling |
| 0.0 | 0.1 | PID AMB2 NEUTROPHILS PATHWAY | amb2 Integrin signaling |
| 0.0 | 0.1 | PID PI3K PLC TRK PATHWAY | Trk receptor signaling mediated by PI3K and PLC-gamma |
| 0.0 | 0.2 | PID ATM PATHWAY | ATM pathway |
| 0.0 | 0.1 | PID ILK PATHWAY | Integrin-linked kinase signaling |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.4 | 0.4 | REACTOME PI3K EVENTS IN ERBB2 SIGNALING | Genes involved in PI3K events in ERBB2 signaling |
| 0.3 | 0.3 | REACTOME SIGNALING BY ACTIVATED POINT MUTANTS OF FGFR1 | Genes involved in Signaling by activated point mutants of FGFR1 |
| 0.3 | 3.6 | REACTOME SPRY REGULATION OF FGF SIGNALING | Genes involved in Spry regulation of FGF signaling |
| 0.3 | 0.3 | REACTOME SIGNALING BY FGFR3 MUTANTS | Genes involved in Signaling by FGFR3 mutants |
| 0.2 | 2.1 | REACTOME GAP JUNCTION DEGRADATION | Genes involved in Gap junction degradation |
| 0.2 | 3.0 | REACTOME CELL EXTRACELLULAR MATRIX INTERACTIONS | Genes involved in Cell-extracellular matrix interactions |
| 0.2 | 1.4 | REACTOME RETROGRADE NEUROTROPHIN SIGNALLING | Genes involved in Retrograde neurotrophin signalling |
| 0.2 | 1.4 | REACTOME VEGF LIGAND RECEPTOR INTERACTIONS | Genes involved in VEGF ligand-receptor interactions |
| 0.2 | 6.0 | REACTOME NCAM1 INTERACTIONS | Genes involved in NCAM1 interactions |
| 0.2 | 1.5 | REACTOME APOPTOTIC CLEAVAGE OF CELL ADHESION PROTEINS | Genes involved in Apoptotic cleavage of cell adhesion proteins |
| 0.1 | 1.4 | REACTOME ADVANCED GLYCOSYLATION ENDPRODUCT RECEPTOR SIGNALING | Genes involved in Advanced glycosylation endproduct receptor signaling |
| 0.1 | 3.8 | REACTOME STRIATED MUSCLE CONTRACTION | Genes involved in Striated Muscle Contraction |
| 0.1 | 1.8 | REACTOME PROTEOLYTIC CLEAVAGE OF SNARE COMPLEX PROTEINS | Genes involved in Proteolytic cleavage of SNARE complex proteins |
| 0.1 | 2.6 | REACTOME DOWNREGULATION OF TGF BETA RECEPTOR SIGNALING | Genes involved in Downregulation of TGF-beta receptor signaling |
| 0.1 | 2.2 | REACTOME SYNTHESIS OF GLYCOSYLPHOSPHATIDYLINOSITOL GPI | Genes involved in Synthesis of glycosylphosphatidylinositol (GPI) |
| 0.1 | 2.5 | REACTOME CGMP EFFECTS | Genes involved in cGMP effects |
| 0.1 | 1.9 | REACTOME SYNTHESIS SECRETION AND INACTIVATION OF GLP1 | Genes involved in Synthesis, Secretion, and Inactivation of Glucagon-like Peptide-1 (GLP-1) |
| 0.1 | 12.1 | REACTOME SIGNALING BY RHO GTPASES | Genes involved in Signaling by Rho GTPases |
| 0.1 | 1.3 | REACTOME FGFR2C LIGAND BINDING AND ACTIVATION | Genes involved in FGFR2c ligand binding and activation |
| 0.1 | 1.7 | REACTOME SIGNALING BY HIPPO | Genes involved in Signaling by Hippo |
| 0.1 | 1.1 | REACTOME KERATAN SULFATE DEGRADATION | Genes involved in Keratan sulfate degradation |
| 0.1 | 1.9 | REACTOME GENERATION OF SECOND MESSENGER MOLECULES | Genes involved in Generation of second messenger molecules |
| 0.1 | 0.5 | REACTOME ETHANOL OXIDATION | Genes involved in Ethanol oxidation |
| 0.1 | 1.0 | REACTOME EXTRINSIC PATHWAY FOR APOPTOSIS | Genes involved in Extrinsic Pathway for Apoptosis |
| 0.1 | 0.4 | REACTOME CD28 DEPENDENT PI3K AKT SIGNALING | Genes involved in CD28 dependent PI3K/Akt signaling |
| 0.1 | 0.6 | REACTOME NOREPINEPHRINE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Norepinephrine Neurotransmitter Release Cycle |
| 0.1 | 1.5 | REACTOME CHONDROITIN SULFATE BIOSYNTHESIS | Genes involved in Chondroitin sulfate biosynthesis |
| 0.1 | 0.8 | REACTOME POST TRANSLATIONAL MODIFICATION SYNTHESIS OF GPI ANCHORED PROTEINS | Genes involved in Post-translational modification: synthesis of GPI-anchored proteins |
| 0.1 | 2.1 | REACTOME DEGRADATION OF THE EXTRACELLULAR MATRIX | Genes involved in Degradation of the extracellular matrix |
| 0.1 | 2.2 | REACTOME TRANSPORT OF VITAMINS NUCLEOSIDES AND RELATED MOLECULES | Genes involved in Transport of vitamins, nucleosides, and related molecules |
| 0.1 | 2.1 | REACTOME MEIOTIC SYNAPSIS | Genes involved in Meiotic Synapsis |
| 0.1 | 0.1 | REACTOME DESTABILIZATION OF MRNA BY AUF1 HNRNP D0 | Genes involved in Destabilization of mRNA by AUF1 (hnRNP D0) |
| 0.1 | 0.5 | REACTOME G PROTEIN ACTIVATION | Genes involved in G-protein activation |
| 0.1 | 0.6 | REACTOME OPSINS | Genes involved in Opsins |
| 0.1 | 0.1 | REACTOME SOS MEDIATED SIGNALLING | Genes involved in SOS-mediated signalling |
| 0.1 | 0.1 | REACTOME CLEAVAGE OF GROWING TRANSCRIPT IN THE TERMINATION REGION | Genes involved in Cleavage of Growing Transcript in the Termination Region |
| 0.1 | 0.4 | REACTOME INHIBITION OF INSULIN SECRETION BY ADRENALINE NORADRENALINE | Genes involved in Inhibition of Insulin Secretion by Adrenaline/Noradrenaline |
| 0.1 | 0.1 | REACTOME MRNA DECAY BY 3 TO 5 EXORIBONUCLEASE | Genes involved in mRNA Decay by 3' to 5' Exoribonuclease |
| 0.1 | 0.6 | REACTOME SIGNAL AMPLIFICATION | Genes involved in Signal amplification |
| 0.1 | 0.3 | REACTOME DOWNSTREAM TCR SIGNALING | Genes involved in Downstream TCR signaling |
| 0.1 | 1.6 | REACTOME MEIOSIS | Genes involved in Meiosis |
| 0.1 | 0.7 | REACTOME ENDOGENOUS STEROLS | Genes involved in Endogenous sterols |
| 0.1 | 0.5 | REACTOME TRAF6 MEDIATED IRF7 ACTIVATION IN TLR7 8 OR 9 SIGNALING | Genes involved in TRAF6 mediated IRF7 activation in TLR7/8 or 9 signaling |
| 0.1 | 4.8 | REACTOME CLASS B 2 SECRETIN FAMILY RECEPTORS | Genes involved in Class B/2 (Secretin family receptors) |
| 0.1 | 0.9 | REACTOME PHOSPHORYLATION OF THE APC C | Genes involved in Phosphorylation of the APC/C |
| 0.1 | 0.2 | REACTOME CROSS PRESENTATION OF SOLUBLE EXOGENOUS ANTIGENS ENDOSOMES | Genes involved in Cross-presentation of soluble exogenous antigens (endosomes) |
| 0.1 | 0.6 | REACTOME OXYGEN DEPENDENT PROLINE HYDROXYLATION OF HYPOXIA INDUCIBLE FACTOR ALPHA | Genes involved in Oxygen-dependent Proline Hydroxylation of Hypoxia-inducible Factor Alpha |
| 0.1 | 0.6 | REACTOME GABA A RECEPTOR ACTIVATION | Genes involved in GABA A receptor activation |
| 0.1 | 0.2 | REACTOME G BETA GAMMA SIGNALLING THROUGH PLC BETA | Genes involved in G beta:gamma signalling through PLC beta |
| 0.1 | 1.5 | REACTOME SPHINGOLIPID DE NOVO BIOSYNTHESIS | Genes involved in Sphingolipid de novo biosynthesis |
| 0.1 | 2.2 | REACTOME GOLGI ASSOCIATED VESICLE BIOGENESIS | Genes involved in Golgi Associated Vesicle Biogenesis |
| 0.1 | 0.9 | REACTOME SIGNALING BY BMP | Genes involved in Signaling by BMP |
| 0.1 | 0.3 | REACTOME SYNTHESIS SECRETION AND DEACYLATION OF GHRELIN | Genes involved in Synthesis, Secretion, and Deacylation of Ghrelin |
| 0.1 | 0.6 | REACTOME RIP MEDIATED NFKB ACTIVATION VIA DAI | Genes involved in RIP-mediated NFkB activation via DAI |
| 0.1 | 0.8 | REACTOME SHC1 EVENTS IN ERBB4 SIGNALING | Genes involved in SHC1 events in ERBB4 signaling |
| 0.1 | 0.3 | REACTOME THE ROLE OF NEF IN HIV1 REPLICATION AND DISEASE PATHOGENESIS | Genes involved in The role of Nef in HIV-1 replication and disease pathogenesis |
| 0.1 | 0.6 | REACTOME ORGANIC CATION ANION ZWITTERION TRANSPORT | Genes involved in Organic cation/anion/zwitterion transport |
| 0.1 | 0.3 | REACTOME APOPTOSIS INDUCED DNA FRAGMENTATION | Genes involved in Apoptosis induced DNA fragmentation |
| 0.0 | 0.5 | REACTOME SIGNALING BY NODAL | Genes involved in Signaling by NODAL |
| 0.0 | 1.8 | REACTOME EXTRACELLULAR MATRIX ORGANIZATION | Genes involved in Extracellular matrix organization |
| 0.0 | 0.1 | REACTOME SHC1 EVENTS IN EGFR SIGNALING | Genes involved in SHC1 events in EGFR signaling |
| 0.0 | 0.0 | REACTOME PRE NOTCH TRANSCRIPTION AND TRANSLATION | Genes involved in Pre-NOTCH Transcription and Translation |
| 0.0 | 0.5 | REACTOME TRAFFICKING OF GLUR2 CONTAINING AMPA RECEPTORS | Genes involved in Trafficking of GluR2-containing AMPA receptors |
| 0.0 | 0.2 | REACTOME NITRIC OXIDE STIMULATES GUANYLATE CYCLASE | Genes involved in Nitric oxide stimulates guanylate cyclase |
| 0.0 | 0.4 | REACTOME ALPHA LINOLENIC ACID ALA METABOLISM | Genes involved in alpha-linolenic acid (ALA) metabolism |
| 0.0 | 0.4 | REACTOME CIRCADIAN REPRESSION OF EXPRESSION BY REV ERBA | Genes involved in Circadian Repression of Expression by REV-ERBA |
| 0.0 | 0.8 | REACTOME YAP1 AND WWTR1 TAZ STIMULATED GENE EXPRESSION | Genes involved in YAP1- and WWTR1 (TAZ)-stimulated gene expression |
| 0.0 | 0.3 | REACTOME SIGNAL ATTENUATION | Genes involved in Signal attenuation |
| 0.0 | 0.1 | REACTOME REGULATION OF THE FANCONI ANEMIA PATHWAY | Genes involved in Regulation of the Fanconi anemia pathway |
| 0.0 | 0.2 | REACTOME SIGNALING BY SCF KIT | Genes involved in Signaling by SCF-KIT |
| 0.0 | 0.2 | REACTOME RECEPTOR LIGAND BINDING INITIATES THE SECOND PROTEOLYTIC CLEAVAGE OF NOTCH RECEPTOR | Genes involved in Receptor-ligand binding initiates the second proteolytic cleavage of Notch receptor |
| 0.0 | 0.6 | REACTOME SEMA4D INDUCED CELL MIGRATION AND GROWTH CONE COLLAPSE | Genes involved in Sema4D induced cell migration and growth-cone collapse |
| 0.0 | 0.1 | REACTOME SEMA3A PAK DEPENDENT AXON REPULSION | Genes involved in Sema3A PAK dependent Axon repulsion |
| 0.0 | 0.5 | REACTOME CRMPS IN SEMA3A SIGNALING | Genes involved in CRMPs in Sema3A signaling |
| 0.0 | 0.3 | REACTOME ACYL CHAIN REMODELLING OF PC | Genes involved in Acyl chain remodelling of PC |
| 0.0 | 0.6 | REACTOME AMYLOIDS | Genes involved in Amyloids |
| 0.0 | 0.6 | REACTOME G ALPHA Z SIGNALLING EVENTS | Genes involved in G alpha (z) signalling events |
| 0.0 | 0.1 | REACTOME BINDING AND ENTRY OF HIV VIRION | Genes involved in Binding and entry of HIV virion |
| 0.0 | 1.5 | REACTOME SIGNALING BY FGFR | Genes involved in Signaling by FGFR |
| 0.0 | 1.0 | REACTOME NETRIN1 SIGNALING | Genes involved in Netrin-1 signaling |
| 0.0 | 0.1 | REACTOME DOPAMINE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Dopamine Neurotransmitter Release Cycle |
| 0.0 | 0.3 | REACTOME NEPHRIN INTERACTIONS | Genes involved in Nephrin interactions |
| 0.0 | 0.3 | REACTOME PURINE CATABOLISM | Genes involved in Purine catabolism |
| 0.0 | 0.0 | REACTOME GASTRIN CREB SIGNALLING PATHWAY VIA PKC AND MAPK | Genes involved in Gastrin-CREB signalling pathway via PKC and MAPK |
| 0.0 | 0.4 | REACTOME REGULATION OF PYRUVATE DEHYDROGENASE PDH COMPLEX | Genes involved in Regulation of pyruvate dehydrogenase (PDH) complex |
| 0.0 | 0.3 | REACTOME IONOTROPIC ACTIVITY OF KAINATE RECEPTORS | Genes involved in Ionotropic activity of Kainate Receptors |
| 0.0 | 0.2 | REACTOME REGULATION OF KIT SIGNALING | Genes involved in Regulation of KIT signaling |
| 0.0 | 0.3 | REACTOME SEROTONIN RECEPTORS | Genes involved in Serotonin receptors |
| 0.0 | 0.1 | REACTOME CS DS DEGRADATION | Genes involved in CS/DS degradation |
| 0.0 | 0.5 | REACTOME BASIGIN INTERACTIONS | Genes involved in Basigin interactions |
| 0.0 | 0.2 | REACTOME THE NLRP3 INFLAMMASOME | Genes involved in The NLRP3 inflammasome |
| 0.0 | 0.2 | REACTOME ENOS ACTIVATION AND REGULATION | Genes involved in eNOS activation and regulation |
| 0.0 | 0.0 | REACTOME RORA ACTIVATES CIRCADIAN EXPRESSION | Genes involved in RORA Activates Circadian Expression |
| 0.0 | 0.3 | REACTOME COMMON PATHWAY | Genes involved in Common Pathway |
| 0.0 | 0.4 | REACTOME SYNTHESIS AND INTERCONVERSION OF NUCLEOTIDE DI AND TRIPHOSPHATES | Genes involved in Synthesis and interconversion of nucleotide di- and triphosphates |
| 0.0 | 0.1 | REACTOME ABACAVIR TRANSPORT AND METABOLISM | Genes involved in Abacavir transport and metabolism |
| 0.0 | 0.2 | REACTOME ACTIVATION OF BH3 ONLY PROTEINS | Genes involved in Activation of BH3-only proteins |
| 0.0 | 0.1 | REACTOME SEMA3A PLEXIN REPULSION SIGNALING BY INHIBITING INTEGRIN ADHESION | Genes involved in SEMA3A-Plexin repulsion signaling by inhibiting Integrin adhesion |
| 0.0 | 0.2 | REACTOME RECRUITMENT OF NUMA TO MITOTIC CENTROSOMES | Genes involved in Recruitment of NuMA to mitotic centrosomes |
| 0.0 | 0.1 | REACTOME ARMS MEDIATED ACTIVATION | Genes involved in ARMS-mediated activation |
| 0.0 | 0.1 | REACTOME SIGNALING BY CONSTITUTIVELY ACTIVE EGFR | Genes involved in Signaling by constitutively active EGFR |
| 0.0 | 0.2 | REACTOME TIE2 SIGNALING | Genes involved in Tie2 Signaling |
| 0.0 | 1.4 | REACTOME INTEGRIN CELL SURFACE INTERACTIONS | Genes involved in Integrin cell surface interactions |
| 0.0 | 0.3 | REACTOME PEROXISOMAL LIPID METABOLISM | Genes involved in Peroxisomal lipid metabolism |
| 0.0 | 0.4 | REACTOME G1 S SPECIFIC TRANSCRIPTION | Genes involved in G1/S-Specific Transcription |
| 0.0 | 0.0 | REACTOME PROSTACYCLIN SIGNALLING THROUGH PROSTACYCLIN RECEPTOR | Genes involved in Prostacyclin signalling through prostacyclin receptor |
| 0.0 | 0.3 | REACTOME AMINO ACID SYNTHESIS AND INTERCONVERSION TRANSAMINATION | Genes involved in Amino acid synthesis and interconversion (transamination) |
| 0.0 | 0.5 | REACTOME GLUCONEOGENESIS | Genes involved in Gluconeogenesis |
| 0.0 | 0.5 | REACTOME SYNTHESIS OF PA | Genes involved in Synthesis of PA |
| 0.0 | 0.1 | REACTOME ACTIVATION OF THE AP1 FAMILY OF TRANSCRIPTION FACTORS | Genes involved in Activation of the AP-1 family of transcription factors |
| 0.0 | 0.7 | REACTOME INTERFERON GAMMA SIGNALING | Genes involved in Interferon gamma signaling |
| 0.0 | 0.5 | REACTOME IMMUNOREGULATORY INTERACTIONS BETWEEN A LYMPHOID AND A NON LYMPHOID CELL | Genes involved in Immunoregulatory interactions between a Lymphoid and a non-Lymphoid cell |
| 0.0 | 0.2 | REACTOME TANDEM PORE DOMAIN POTASSIUM CHANNELS | Genes involved in Tandem pore domain potassium channels |
| 0.0 | 0.7 | REACTOME G ALPHA S SIGNALLING EVENTS | Genes involved in G alpha (s) signalling events |
| 0.0 | 0.0 | REACTOME ENDOSOMAL VACUOLAR PATHWAY | Genes involved in Endosomal/Vacuolar pathway |
| 0.0 | 0.1 | REACTOME PLATELET ADHESION TO EXPOSED COLLAGEN | Genes involved in Platelet Adhesion to exposed collagen |
| 0.0 | 0.1 | REACTOME REMOVAL OF THE FLAP INTERMEDIATE FROM THE C STRAND | Genes involved in Removal of the Flap Intermediate from the C-strand |
| 0.0 | 0.1 | REACTOME GPVI MEDIATED ACTIVATION CASCADE | Genes involved in GPVI-mediated activation cascade |
| 0.0 | 0.2 | REACTOME AMINE DERIVED HORMONES | Genes involved in Amine-derived hormones |
| 0.0 | 0.2 | REACTOME ANTIGEN PRESENTATION FOLDING ASSEMBLY AND PEPTIDE LOADING OF CLASS I MHC | Genes involved in Antigen Presentation: Folding, assembly and peptide loading of class I MHC |
| 0.0 | 0.2 | REACTOME N GLYCAN ANTENNAE ELONGATION | Genes involved in N-Glycan antennae elongation |
| 0.0 | 0.1 | REACTOME DIGESTION OF DIETARY CARBOHYDRATE | Genes involved in Digestion of dietary carbohydrate |
| 0.0 | 0.1 | REACTOME RAP1 SIGNALLING | Genes involved in Rap1 signalling |
| 0.0 | 0.1 | REACTOME AMINE LIGAND BINDING RECEPTORS | Genes involved in Amine ligand-binding receptors |
| 0.0 | 0.1 | REACTOME TRAFFICKING AND PROCESSING OF ENDOSOMAL TLR | Genes involved in Trafficking and processing of endosomal TLR |
| 0.0 | 0.4 | REACTOME INTERFERON ALPHA BETA SIGNALING | Genes involved in Interferon alpha/beta signaling |
| 0.0 | 0.5 | REACTOME NUCLEAR RECEPTOR TRANSCRIPTION PATHWAY | Genes involved in Nuclear Receptor transcription pathway |
| 0.0 | 0.3 | REACTOME LATENT INFECTION OF HOMO SAPIENS WITH MYCOBACTERIUM TUBERCULOSIS | Genes involved in Latent infection of Homo sapiens with Mycobacterium tuberculosis |
| 0.0 | 0.1 | REACTOME BILE ACID AND BILE SALT METABOLISM | Genes involved in Bile acid and bile salt metabolism |
| 0.0 | 0.0 | REACTOME ACTIVATION OF RAC | Genes involved in Activation of Rac |
| 0.0 | 0.2 | REACTOME FORMATION OF INCISION COMPLEX IN GG NER | Genes involved in Formation of incision complex in GG-NER |
| 0.0 | 0.1 | REACTOME SMOOTH MUSCLE CONTRACTION | Genes involved in Smooth Muscle Contraction |