| Gene Symbol | Gene ID | Gene Info |
|---|---|---|
|
Tfcp2l1
|
ENSMUSG00000026380.9 | transcription factor CP2-like 1 |
| CRE | Gene | Distance | Association probability | Pearson corr. coef. | P-value | Plot |
|---|---|---|---|---|---|---|
| chr1_118630229_118630380 | Tfcp2l1 | 2358 | 0.234603 | 0.29 | 3.5e-02 | Click! |
| chr1_118627509_118627660 | Tfcp2l1 | 361 | 0.839177 | 0.27 | 4.5e-02 | Click! |
| chr1_118627730_118628460 | Tfcp2l1 | 149 | 0.945623 | 0.19 | 1.6e-01 | Click! |
Move your cursor over a bar to see sample name and corresponding Z-value.
| Cis Regulatory Element (CRE) | Target Score | Top associated gene | Gene Info | Distance of CRE to TSS | CRE/Gene association probability |
|---|---|---|---|---|---|
| chr9_13497767_13498071 | 10.36 |
Gm47089 |
predicted gene, 47089 |
22017 |
0.19 |
| chr14_22783774_22784005 | 8.05 |
Gm7473 |
predicted gene 7473 |
8645 |
0.31 |
| chr9_35467544_35467735 | 7.62 |
Gm25630 |
predicted gene, 25630 |
7246 |
0.14 |
| chr1_152702984_152703322 | 7.56 |
Gm15479 |
predicted gene 15479 |
15652 |
0.15 |
| chr5_149389629_149389790 | 6.98 |
Gm43152 |
predicted gene 43152 |
9781 |
0.1 |
| chr8_45658146_45658303 | 6.96 |
Sorbs2 |
sorbin and SH3 domain containing 2 |
68 |
0.98 |
| chr2_32317120_32318698 | 6.71 |
Gm23363 |
predicted gene, 23363 |
356 |
0.45 |
| chr7_27118189_27118385 | 6.69 |
Cyp2f2 |
cytochrome P450, family 2, subfamily f, polypeptide 2 |
1622 |
0.2 |
| chr11_78374245_78374445 | 6.57 |
Foxn1 |
forkhead box N1 |
12213 |
0.09 |
| chr7_74107626_74107825 | 6.57 |
Gm45004 |
predicted gene 45004 |
63987 |
0.11 |
| chr4_83831348_83831546 | 6.54 |
Gm11415 |
predicted gene 11415 |
57411 |
0.13 |
| chr2_167249888_167250039 | 6.22 |
Ptgis |
prostaglandin I2 (prostacyclin) synthase |
9359 |
0.15 |
| chr2_103144147_103144349 | 6.15 |
Gm13874 |
predicted gene 13874 |
33539 |
0.13 |
| chr5_21543298_21543619 | 6.02 |
Lrrc17 |
leucine rich repeat containing 17 |
101 |
0.97 |
| chr18_20190952_20191121 | 5.98 |
Dsg1c |
desmoglein 1 gamma |
56304 |
0.13 |
| chr5_65457056_65457473 | 5.82 |
Smim14 |
small integral membrane protein 14 |
1247 |
0.28 |
| chr17_12337258_12337429 | 5.75 |
Gm49964 |
predicted gene, 49964 |
16615 |
0.11 |
| chr10_118102987_118104071 | 5.73 |
5330439M10Rik |
RIKEN cDNA 5330439M10 gene |
8988 |
0.17 |
| chr3_85378052_85378209 | 5.72 |
Gm42813 |
predicted gene 42813 |
49998 |
0.13 |
| chr13_30782030_30782219 | 5.48 |
Gm29675 |
predicted gene, 29675 |
13102 |
0.19 |
| chr19_32974796_32975090 | 5.45 |
Gm36860 |
predicted gene, 36860 |
5120 |
0.3 |
| chr6_135364868_135365419 | 5.44 |
Emp1 |
epithelial membrane protein 1 |
2075 |
0.26 |
| chr2_167596776_167597785 | 5.38 |
Gm11475 |
predicted gene 11475 |
5885 |
0.13 |
| chr2_119236988_119237799 | 5.38 |
Spint1 |
serine protease inhibitor, Kunitz type 1 |
31 |
0.95 |
| chr12_112678481_112679637 | 5.34 |
Zbtb42 |
zinc finger and BTB domain containing 42 |
181 |
0.89 |
| chr11_20864808_20864959 | 5.25 |
Gm22807 |
predicted gene, 22807 |
17002 |
0.15 |
| chr16_5473424_5473912 | 5.19 |
n-R5s30 |
nuclear encoded rRNA 5S 30 |
149511 |
0.04 |
| chr17_26873266_26873473 | 5.12 |
Gm29819 |
predicted gene, 29819 |
7239 |
0.09 |
| chr7_139468683_139468834 | 5.09 |
Inpp5a |
inositol polyphosphate-5-phosphatase A |
12875 |
0.24 |
| chr13_113662051_113662294 | 5.06 |
Hspb3 |
heat shock protein 3 |
1504 |
0.36 |
| chr16_11365609_11365908 | 4.84 |
Snx29 |
sorting nexin 29 |
39890 |
0.14 |
| chr14_98863631_98863792 | 4.78 |
Gm49018 |
predicted gene, 49018 |
57234 |
0.12 |
| chr5_36977911_36978067 | 4.62 |
Wfs1 |
wolframin ER transmembrane glycoprotein |
1033 |
0.5 |
| chr17_24638831_24639200 | 4.60 |
Nthl1 |
nth (endonuclease III)-like 1 (E.coli) |
839 |
0.34 |
| chr4_106643954_106644119 | 4.60 |
Pars2 |
prolyl-tRNA synthetase (mitochondrial)(putative) |
7033 |
0.12 |
| chr8_84021244_84021439 | 4.53 |
Palm3 |
paralemmin 3 |
130 |
0.89 |
| chr5_52979576_52979727 | 4.49 |
Gm30301 |
predicted gene, 30301 |
2386 |
0.24 |
| chr6_135369800_135370092 | 4.48 |
Emp1 |
epithelial membrane protein 1 |
2453 |
0.24 |
| chr18_38754554_38754934 | 4.48 |
Gm8302 |
predicted gene 8302 |
17603 |
0.16 |
| chr16_95857525_95857844 | 4.43 |
1600002D24Rik |
RIKEN cDNA 1600002D24 gene |
11914 |
0.18 |
| chr10_62038051_62038202 | 4.40 |
Gm47919 |
predicted gene, 47919 |
14722 |
0.16 |
| chr16_45892999_45893237 | 4.36 |
Phldb2 |
pleckstrin homology like domain, family B, member 2 |
8849 |
0.2 |
| chr7_4464545_4465001 | 4.28 |
Eps8l1 |
EPS8-like 1 |
4 |
0.94 |
| chr12_103324974_103325864 | 4.26 |
Asb2 |
ankyrin repeat and SOCS box-containing 2 |
10165 |
0.11 |
| chr13_41510734_41510885 | 4.19 |
Nedd9 |
neural precursor cell expressed, developmentally down-regulated gene 9 |
23447 |
0.13 |
| chr2_27120258_27120646 | 4.14 |
Adamtsl2 |
ADAMTS-like 2 |
15789 |
0.11 |
| chr9_60926335_60926505 | 4.12 |
Gm47923 |
predicted gene, 47923 |
7197 |
0.21 |
| chr16_30096936_30097094 | 4.12 |
Gm20040 |
predicted gene, 20040 |
4133 |
0.18 |
| chr11_117091853_117092096 | 4.11 |
Gm11730 |
predicted gene 11730 |
5053 |
0.11 |
| chr17_48418313_48418665 | 4.08 |
Gm49893 |
predicted gene, 49893 |
1209 |
0.32 |
| chr5_35739652_35739964 | 4.07 |
Sh3tc1 |
SH3 domain and tetratricopeptide repeats 1 |
179 |
0.94 |
| chr13_37460302_37460827 | 4.06 |
Gm29458 |
predicted gene 29458 |
7356 |
0.1 |
| chr19_56915215_56915435 | 4.05 |
Afap1l2 |
actin filament associated protein 1-like 2 |
13228 |
0.2 |
| chr3_104782091_104782307 | 4.01 |
Tafa3 |
TAFA chemokine like family member 3 |
359 |
0.69 |
| chr2_168114820_168115269 | 4.00 |
AL831766.1 |
breast carcinoma amplified sequence 4 (BCAS4) pseudogene |
167 |
0.93 |
| chr10_13090919_13091310 | 3.98 |
Plagl1 |
pleiomorphic adenoma gene-like 1 |
101 |
0.97 |
| chrX_97376273_97376800 | 3.93 |
Eda2r |
ectodysplasin A2 receptor |
614 |
0.85 |
| chr13_98013763_98013984 | 3.87 |
Arhgef28 |
Rho guanine nucleotide exchange factor (GEF) 28 |
2544 |
0.38 |
| chr4_46639973_46640124 | 3.85 |
Tbc1d2 |
TBC1 domain family, member 2 |
10161 |
0.19 |
| chr6_94186528_94186924 | 3.79 |
Magi1 |
membrane associated guanylate kinase, WW and PDZ domain containing 1 |
96299 |
0.08 |
| chr17_83913691_83914083 | 3.70 |
1810073O08Rik |
RIKEN cDNA 1810073O08 gene |
4050 |
0.16 |
| chr11_54063446_54063597 | 3.70 |
Pdlim4 |
PDZ and LIM domain 4 |
1047 |
0.47 |
| chr3_27862930_27863950 | 3.69 |
Gm26040 |
predicted gene, 26040 |
4673 |
0.26 |
| chr7_98815243_98816068 | 3.65 |
Wnt11 |
wingless-type MMTV integration site family, member 11 |
19457 |
0.15 |
| chr9_24974752_24974962 | 3.62 |
E130101E03Rik |
RIKEN cDNA E130101E03 gene |
649 |
0.65 |
| chr4_141011268_141011465 | 3.61 |
Mfap2 |
microfibrillar-associated protein 2 |
722 |
0.53 |
| chr1_88526204_88526381 | 3.58 |
Glrp1 |
glutamine repeat protein 1 |
16226 |
0.16 |
| chr1_135845271_135845422 | 3.56 |
Tnnt2 |
troponin T2, cardiac |
4104 |
0.15 |
| chr19_47301970_47302721 | 3.53 |
Sh3pxd2a |
SH3 and PX domains 2A |
12406 |
0.16 |
| chr6_97929626_97929824 | 3.53 |
Mitf |
melanogenesis associated transcription factor |
74 |
0.98 |
| chr9_64114767_64114966 | 3.50 |
Lctl |
lactase-like |
2281 |
0.18 |
| chr18_61350452_61350649 | 3.46 |
Gm25301 |
predicted gene, 25301 |
47263 |
0.09 |
| chr18_60651691_60651894 | 3.45 |
Synpo |
synaptopodin |
3473 |
0.22 |
| chr5_138846748_138847084 | 3.45 |
Gm5294 |
predicted gene 5294 |
26836 |
0.17 |
| chr5_99598543_99598757 | 3.40 |
Gm16228 |
predicted gene 16228 |
12783 |
0.17 |
| chr9_63803205_63803594 | 3.37 |
Gm2553 |
predicted gene 2553 |
1602 |
0.43 |
| chr9_119010406_119010602 | 3.32 |
Mir26a-1 |
microRNA 26a-1 |
21292 |
0.13 |
| chr19_43890887_43891094 | 3.28 |
Dnmbp |
dynamin binding protein |
299 |
0.87 |
| chr10_13446842_13447237 | 3.26 |
Phactr2 |
phosphatase and actin regulator 2 |
27373 |
0.19 |
| chr15_100599610_100600576 | 3.26 |
Pou6f1 |
POU domain, class 6, transcription factor 1 |
109 |
0.48 |
| chr1_161444915_161445196 | 3.24 |
Tnfsf18 |
tumor necrosis factor (ligand) superfamily, member 18 |
49600 |
0.12 |
| chr10_39534378_39534589 | 3.22 |
Fyn |
Fyn proto-oncogene |
1213 |
0.48 |
| chr7_28943542_28943779 | 3.18 |
Gm44699 |
predicted gene 44699 |
132 |
0.92 |
| chr8_72189508_72189696 | 3.17 |
Hsh2d |
hematopoietic SH2 domain containing |
36 |
0.95 |
| chr11_96271497_96271980 | 3.14 |
Hoxb9 |
homeobox B9 |
215 |
0.83 |
| chr7_45639590_45639995 | 3.14 |
Mamstr |
MEF2 activating motif and SAP domain containing transcriptional regulator |
185 |
0.79 |
| chr5_41764546_41764740 | 3.14 |
Nkx3-2 |
NK3 homeobox 2 |
142 |
0.97 |
| chr5_90790262_90790489 | 3.11 |
Cxcl15 |
chemokine (C-X-C motif) ligand 15 |
4159 |
0.11 |
| chr12_5119812_5120189 | 3.11 |
Gm9110 |
predicted gene 9110 |
52552 |
0.14 |
| chr19_46524602_46525044 | 3.07 |
Trim8 |
tripartite motif-containing 8 |
10163 |
0.14 |
| chr1_36588880_36589458 | 3.06 |
Fam178b |
family with sequence similarity 178, member B |
148 |
0.92 |
| chr1_36492357_36492718 | 3.06 |
Gm47280 |
predicted gene, 47280 |
14025 |
0.09 |
| chr15_79261186_79261748 | 3.05 |
Baiap2l2 |
BAI1-associated protein 2-like 2 |
170 |
0.89 |
| chr7_45749542_45749693 | 3.04 |
Sult2b1 |
sulfotransferase family, cytosolic, 2B, member 1 |
6871 |
0.07 |
| chr16_36707794_36708006 | 3.01 |
Ildr1 |
immunoglobulin-like domain containing receptor 1 |
7638 |
0.14 |
| chr2_60654945_60655277 | 2.93 |
Itgb6 |
integrin beta 6 |
18582 |
0.2 |
| chr10_80175518_80176019 | 2.92 |
Fam174c |
family with sequence similarity 174, member C |
2824 |
0.11 |
| chr7_19118025_19118835 | 2.91 |
Gm4969 |
predicted gene 4969 |
62 |
0.92 |
| chr14_25185730_25185973 | 2.91 |
4930572O13Rik |
RIKEN cDNA 4930572O13 gene |
42610 |
0.14 |
| chr2_132212426_132212580 | 2.91 |
Tmem230 |
transmembrane protein 230 |
35151 |
0.11 |
| chr6_139953715_139953866 | 2.90 |
Pik3c2g |
phosphatidylinositol-4-phosphate 3-kinase catalytic subunit type 2 gamma |
35807 |
0.15 |
| chr7_112656145_112656626 | 2.90 |
Gm45473 |
predicted gene 45473 |
3603 |
0.2 |
| chr6_135364358_135364779 | 2.89 |
Emp1 |
epithelial membrane protein 1 |
1500 |
0.34 |
| chr13_32479190_32479346 | 2.89 |
Gm48073 |
predicted gene, 48073 |
57147 |
0.13 |
| chr16_15958571_15959043 | 2.89 |
n-R5s31 |
nuclear encoded rRNA 5S 31 |
52202 |
0.12 |
| chr14_73388565_73388877 | 2.87 |
Itm2b |
integral membrane protein 2B |
3432 |
0.26 |
| chr5_136863892_136864043 | 2.84 |
Gm20485 |
predicted gene 20485 |
5755 |
0.14 |
| chr1_74027469_74027800 | 2.83 |
Tns1 |
tensin 1 |
9499 |
0.23 |
| chr8_87835929_87836201 | 2.83 |
Zfp423 |
zinc finger protein 423 |
31626 |
0.22 |
| chr13_59431177_59431507 | 2.82 |
4930455M05Rik |
RIKEN cDNA 4930455M05 gene |
11945 |
0.14 |
| chr2_158127868_158128212 | 2.82 |
Gm20412 |
predicted gene 20412 |
10886 |
0.15 |
| chr17_79657901_79658058 | 2.81 |
Rmdn2 |
regulator of microtubule dynamics 2 |
14421 |
0.21 |
| chr5_103620590_103621012 | 2.81 |
Gm15844 |
predicted gene 15844 |
3670 |
0.17 |
| chr18_75330912_75331215 | 2.79 |
2010010A06Rik |
RIKEN cDNA 2010010A06 gene |
33734 |
0.15 |
| chr6_39319331_39319482 | 2.78 |
Slc37a3 |
solute carrier family 37 (glycerol-3-phosphate transporter), member 3 |
27944 |
0.14 |
| chr1_134829651_134829802 | 2.74 |
Gm37677 |
predicted gene, 37677 |
2177 |
0.21 |
| chr3_105000592_105000743 | 2.74 |
Gm40117 |
predicted gene, 40117 |
6635 |
0.17 |
| chr1_151693007_151693158 | 2.73 |
Fam129a |
family with sequence similarity 129, member A |
15915 |
0.2 |
| chr7_35372889_35373524 | 2.72 |
Rhpn2 |
rhophilin, Rho GTPase binding protein 2 |
6076 |
0.15 |
| chr17_31834021_31834172 | 2.72 |
Sik1 |
salt inducible kinase 1 |
17479 |
0.15 |
| chr11_94232330_94232481 | 2.72 |
Wfikkn2 |
WAP, follistatin/kazal, immunoglobulin, kunitz and netrin domain containing 2 |
10302 |
0.16 |
| chr12_102422188_102422387 | 2.71 |
Lgmn |
legumain |
1482 |
0.39 |
| chr11_100912548_100912699 | 2.70 |
Stat3 |
signal transducer and activator of transcription 3 |
4399 |
0.17 |
| chr11_69088145_69088599 | 2.67 |
Vamp2 |
vesicle-associated membrane protein 2 |
118 |
0.89 |
| chr8_123651617_123651768 | 2.67 |
Rhou |
ras homolog family member U |
2237 |
0.07 |
| chr3_55347530_55348320 | 2.67 |
Dclk1 |
doublecortin-like kinase 1 |
6209 |
0.18 |
| chr15_97102277_97102439 | 2.66 |
Slc38a4 |
solute carrier family 38, member 4 |
46402 |
0.16 |
| chr2_14341742_14341940 | 2.64 |
Gm37697 |
predicted gene, 37697 |
3836 |
0.22 |
| chr1_152682675_152683097 | 2.64 |
Gm15479 |
predicted gene 15479 |
4615 |
0.21 |
| chr2_167594436_167594909 | 2.62 |
Gm11475 |
predicted gene 11475 |
3277 |
0.16 |
| chr7_133569626_133569846 | 2.62 |
Tex36 |
testis expressed 36 |
32422 |
0.12 |
| chr11_75513433_75513612 | 2.61 |
Scarf1 |
scavenger receptor class F, member 1 |
18 |
0.94 |
| chr17_46104525_46104933 | 2.60 |
Mrps18a |
mitochondrial ribosomal protein S18A |
6257 |
0.12 |
| chr5_112001700_112002600 | 2.57 |
Gm42488 |
predicted gene 42488 |
57915 |
0.13 |
| chr19_55137764_55138203 | 2.57 |
Gpam |
glycerol-3-phosphate acyltransferase, mitochondrial |
10745 |
0.19 |
| chr16_19759999_19760363 | 2.57 |
B3gnt5 |
UDP-GlcNAc:betaGal beta-1,3-N-acetylglucosaminyltransferase 5 |
27 |
0.98 |
| chr4_126496313_126496508 | 2.57 |
Gm12928 |
predicted gene 12928 |
19111 |
0.09 |
| chr4_8292635_8292786 | 2.56 |
Car8 |
carbonic anhydrase 8 |
53669 |
0.14 |
| chr12_85598654_85598827 | 2.55 |
Jdp2 |
Jun dimerization protein 2 |
287 |
0.63 |
| chr2_152729475_152730247 | 2.55 |
Id1 |
inhibitor of DNA binding 1, HLH protein |
6390 |
0.11 |
| chr6_118825364_118825717 | 2.55 |
Gm25905 |
predicted gene, 25905 |
9360 |
0.26 |
| chr17_67133760_67133999 | 2.53 |
Ptprm |
protein tyrosine phosphatase, receptor type, M |
85894 |
0.09 |
| chr1_187609399_187609818 | 2.53 |
Esrrg |
estrogen-related receptor gamma |
88 |
0.98 |
| chr12_69432008_69432159 | 2.53 |
5830428M24Rik |
RIKEN cDNA 5830428M24 gene |
35309 |
0.1 |
| chr2_35563830_35564025 | 2.52 |
Gm13446 |
predicted gene 13446 |
5225 |
0.18 |
| chr5_150466046_150466511 | 2.52 |
Fry |
FRY microtubule binding protein |
5632 |
0.12 |
| chr2_71670927_71671078 | 2.52 |
Platr26 |
pluripotency associated transcript 26 |
48415 |
0.1 |
| chr3_66292669_66292865 | 2.52 |
Veph1 |
ventricular zone expressed PH domain-containing 1 |
3981 |
0.27 |
| chr3_130180512_130181363 | 2.51 |
Col25a1 |
collagen, type XXV, alpha 1 |
46 |
0.98 |
| chr12_17583991_17584375 | 2.51 |
Gm48290 |
predicted gene, 48290 |
15334 |
0.14 |
| chr11_63125832_63126062 | 2.49 |
Pmp22 |
peripheral myelin protein 22 |
3035 |
0.27 |
| chr17_29256991_29257178 | 2.49 |
Ppil1 |
peptidylprolyl isomerase (cyclophilin)-like 1 |
177 |
0.9 |
| chr1_73969044_73969527 | 2.47 |
Tns1 |
tensin 1 |
6242 |
0.25 |
| chr12_105526822_105527191 | 2.46 |
AU015791 |
expressed sequence AU015791 |
13526 |
0.15 |
| chr6_89353283_89353434 | 2.45 |
Plxna1 |
plexin A1 |
4359 |
0.19 |
| chr3_32335013_32335183 | 2.45 |
Zmat3 |
zinc finger matrin type 3 |
30362 |
0.15 |
| chr5_115435769_115435939 | 2.45 |
Msi1 |
musashi RNA-binding protein 1 |
356 |
0.61 |
| chr4_135175531_135175756 | 2.44 |
Runx3 |
runt related transcription factor 3 |
21207 |
0.15 |
| chr6_122491488_122491885 | 2.42 |
Rimklb |
ribosomal modification protein rimK-like family member B |
5181 |
0.14 |
| chr17_35058865_35059610 | 2.42 |
Ddah2 |
dimethylarginine dimethylaminohydrolase 2 |
136 |
0.83 |
| chr11_112926810_112926961 | 2.42 |
4933434M16Rik |
RIKEN cDNA 4933434M16 gene |
101706 |
0.07 |
| chr10_102512213_102512514 | 2.41 |
Rassf9 |
Ras association (RalGDS/AF-6) domain family (N-terminal) member 9 |
107 |
0.97 |
| chr7_29453052_29453769 | 2.40 |
Sipa1l3 |
signal-induced proliferation-associated 1 like 3 |
52042 |
0.1 |
| chr11_95126583_95126802 | 2.39 |
Dlx3 |
distal-less homeobox 3 |
6573 |
0.13 |
| chr15_66743639_66743928 | 2.38 |
Gm17140 |
predicted gene 17140 |
544 |
0.78 |
| chrX_38641547_38641721 | 2.38 |
C1galt1c1 |
C1GALT1-specific chaperone 1 |
6547 |
0.18 |
| chr6_43265383_43266002 | 2.38 |
Arhgef5 |
Rho guanine nucleotide exchange factor (GEF) 5 |
110 |
0.57 |
| chr8_35193799_35193996 | 2.37 |
Gm45625 |
predicted gene 45625 |
10011 |
0.14 |
| chr17_48456042_48456387 | 2.37 |
Unc5cl |
unc-5 family C-terminal like |
1313 |
0.33 |
| chr13_67728688_67729329 | 2.36 |
Zfp65 |
zinc finger protein 65 |
165 |
0.59 |
| chr10_39613896_39614231 | 2.35 |
Gm16364 |
predicted gene 16364 |
381 |
0.75 |
| chr11_60172170_60172321 | 2.34 |
Rai1 |
retinoic acid induced 1 |
3634 |
0.16 |
| chrX_99285628_99286024 | 2.33 |
Gm14809 |
predicted gene 14809 |
133069 |
0.05 |
| chr19_40726161_40726312 | 2.32 |
Entpd1 |
ectonucleoside triphosphate diphosphohydrolase 1 |
186 |
0.94 |
| chr9_120455978_120456567 | 2.31 |
Myrip |
myosin VIIA and Rab interacting protein |
28866 |
0.12 |
| chr1_34140145_34140457 | 2.31 |
Dst |
dystonin |
19051 |
0.15 |
| chr2_76406690_76407406 | 2.30 |
Osbpl6 |
oxysterol binding protein-like 6 |
487 |
0.8 |
| chr11_12291035_12291789 | 2.30 |
Gm12002 |
predicted gene 12002 |
23102 |
0.24 |
| chr11_79228944_79229163 | 2.30 |
Wsb1 |
WD repeat and SOCS box-containing 1 |
13896 |
0.16 |
| chr2_91931617_91932763 | 2.29 |
Mdk |
midkine |
107 |
0.93 |
| chr11_78247114_78247265 | 2.28 |
Supt6 |
SPT6, histone chaperone and transcription elongation factor |
1202 |
0.22 |
| chr7_16285532_16286609 | 2.28 |
Ccdc9 |
coiled-coil domain containing 9 |
45 |
0.95 |
| chr2_103144443_103144797 | 2.26 |
Gm13874 |
predicted gene 13874 |
33167 |
0.13 |
| chr2_165503533_165504277 | 2.26 |
Slc2a10 |
solute carrier family 2 (facilitated glucose transporter), member 10 |
118 |
0.96 |
| chr13_31810685_31810836 | 2.25 |
Foxc1 |
forkhead box C1 |
4127 |
0.2 |
| chr1_191435401_191435628 | 2.25 |
Gm2272 |
predicted gene 2272 |
27848 |
0.11 |
| chr5_139558008_139558219 | 2.25 |
Uncx |
UNC homeobox |
14215 |
0.17 |
| chr11_118362632_118362783 | 2.25 |
Timp2 |
tissue inhibitor of metalloproteinase 2 |
6967 |
0.15 |
| chr6_50950264_50950415 | 2.24 |
Gm44402 |
predicted gene, 44402 |
16929 |
0.2 |
| chr2_155942092_155942369 | 2.23 |
Gm15557 |
predicted gene 15557 |
1502 |
0.25 |
| chr7_83740018_83740196 | 2.23 |
Il16 |
interleukin 16 |
170 |
0.93 |
| chr18_62044092_62044268 | 2.23 |
Sh3tc2 |
SH3 domain and tetratricopeptide repeats 2 |
66221 |
0.1 |
| chr15_86036041_86036259 | 2.22 |
Celsr1 |
cadherin, EGF LAG seven-pass G-type receptor 1 |
1947 |
0.33 |
| chr13_45658444_45658595 | 2.22 |
Gm47460 |
predicted gene, 47460 |
91053 |
0.08 |
| chr1_132844199_132844367 | 2.22 |
Gm22609 |
predicted gene, 22609 |
29935 |
0.15 |
| chr19_38054215_38055320 | 2.21 |
I830134H01Rik |
RIKEN cDNA I830134H01 gene |
239 |
0.48 |
| chr10_19105042_19105201 | 2.21 |
Gm48545 |
predicted gene, 48545 |
3526 |
0.17 |
| chr1_38629243_38629578 | 2.20 |
Aff3 |
AF4/FMR2 family, member 3 |
2209 |
0.39 |
| chr16_72381958_72382109 | 2.20 |
Gm49670 |
predicted gene, 49670 |
9592 |
0.29 |
| chr8_11357901_11358379 | 2.20 |
Col4a1 |
collagen, type IV, alpha 1 |
45314 |
0.1 |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 1.4 | 4.3 | GO:0043553 | negative regulation of phosphatidylinositol 3-kinase activity(GO:0043553) |
| 1.3 | 4.0 | GO:0051902 | negative regulation of mitochondrial depolarization(GO:0051902) |
| 1.0 | 5.8 | GO:0048539 | bone marrow development(GO:0048539) |
| 0.9 | 2.6 | GO:0002337 | B-1a B cell differentiation(GO:0002337) |
| 0.8 | 3.8 | GO:1900029 | positive regulation of ruffle assembly(GO:1900029) |
| 0.7 | 2.2 | GO:2001170 | negative regulation of ATP biosynthetic process(GO:2001170) |
| 0.7 | 2.1 | GO:0003289 | atrial septum primum morphogenesis(GO:0003289) |
| 0.7 | 6.3 | GO:0051764 | actin crosslink formation(GO:0051764) |
| 0.7 | 2.1 | GO:0030421 | defecation(GO:0030421) |
| 0.6 | 1.9 | GO:0060666 | dichotomous subdivision of terminal units involved in salivary gland branching(GO:0060666) |
| 0.6 | 2.4 | GO:0043308 | eosinophil activation involved in immune response(GO:0002278) eosinophil mediated immunity(GO:0002447) eosinophil degranulation(GO:0043308) |
| 0.6 | 2.9 | GO:0008582 | regulation of synaptic growth at neuromuscular junction(GO:0008582) |
| 0.6 | 3.4 | GO:0044336 | canonical Wnt signaling pathway involved in negative regulation of apoptotic process(GO:0044336) |
| 0.6 | 3.9 | GO:0008063 | Toll signaling pathway(GO:0008063) |
| 0.5 | 1.6 | GO:1903423 | positive regulation of synaptic vesicle recycling(GO:1903423) |
| 0.5 | 1.6 | GO:0006285 | base-excision repair, AP site formation(GO:0006285) |
| 0.5 | 2.1 | GO:2000507 | positive regulation of energy homeostasis(GO:2000507) |
| 0.5 | 1.5 | GO:0060336 | negative regulation of response to interferon-gamma(GO:0060331) negative regulation of interferon-gamma-mediated signaling pathway(GO:0060336) |
| 0.5 | 2.0 | GO:0006549 | isoleucine metabolic process(GO:0006549) |
| 0.5 | 2.5 | GO:0033564 | anterior/posterior axon guidance(GO:0033564) |
| 0.5 | 1.5 | GO:2000118 | regulation of sodium-dependent phosphate transport(GO:2000118) |
| 0.5 | 1.9 | GO:1903059 | regulation of protein lipidation(GO:1903059) |
| 0.5 | 1.4 | GO:0035701 | hematopoietic stem cell migration(GO:0035701) |
| 0.5 | 0.9 | GO:0061355 | Wnt protein secretion(GO:0061355) regulation of Wnt protein secretion(GO:0061356) |
| 0.5 | 0.9 | GO:1900135 | positive regulation of renin secretion into blood stream(GO:1900135) |
| 0.4 | 5.8 | GO:0060670 | branching involved in labyrinthine layer morphogenesis(GO:0060670) |
| 0.4 | 1.8 | GO:0035633 | maintenance of blood-brain barrier(GO:0035633) |
| 0.4 | 1.8 | GO:0002408 | myeloid dendritic cell chemotaxis(GO:0002408) |
| 0.4 | 3.5 | GO:0038063 | collagen-activated tyrosine kinase receptor signaling pathway(GO:0038063) |
| 0.4 | 1.3 | GO:0097296 | activation of cysteine-type endopeptidase activity involved in apoptotic signaling pathway(GO:0097296) |
| 0.4 | 4.6 | GO:0032060 | bleb assembly(GO:0032060) |
| 0.4 | 1.3 | GO:0003162 | atrioventricular node development(GO:0003162) |
| 0.4 | 2.5 | GO:0060385 | axonogenesis involved in innervation(GO:0060385) |
| 0.4 | 2.0 | GO:0051045 | negative regulation of membrane protein ectodomain proteolysis(GO:0051045) |
| 0.4 | 0.4 | GO:0060397 | JAK-STAT cascade involved in growth hormone signaling pathway(GO:0060397) |
| 0.4 | 1.2 | GO:0010360 | negative regulation of anion channel activity(GO:0010360) |
| 0.4 | 0.8 | GO:0008050 | female courtship behavior(GO:0008050) |
| 0.4 | 0.8 | GO:0035905 | ascending aorta development(GO:0035905) ascending aorta morphogenesis(GO:0035910) |
| 0.4 | 1.1 | GO:0035887 | aortic smooth muscle cell differentiation(GO:0035887) |
| 0.4 | 2.6 | GO:2000675 | negative regulation of type B pancreatic cell apoptotic process(GO:2000675) |
| 0.4 | 1.1 | GO:0007161 | calcium-independent cell-matrix adhesion(GO:0007161) |
| 0.4 | 1.1 | GO:0032289 | central nervous system myelin formation(GO:0032289) |
| 0.4 | 1.8 | GO:0060836 | lymphatic endothelial cell differentiation(GO:0060836) |
| 0.3 | 1.4 | GO:0042271 | susceptibility to natural killer cell mediated cytotoxicity(GO:0042271) |
| 0.3 | 1.7 | GO:0060978 | angiogenesis involved in coronary vascular morphogenesis(GO:0060978) |
| 0.3 | 1.0 | GO:0071895 | odontoblast differentiation(GO:0071895) |
| 0.3 | 7.0 | GO:0003298 | physiological muscle hypertrophy(GO:0003298) physiological cardiac muscle hypertrophy(GO:0003301) cell growth involved in cardiac muscle cell development(GO:0061049) |
| 0.3 | 1.6 | GO:0042663 | regulation of endodermal cell fate specification(GO:0042663) |
| 0.3 | 0.3 | GO:0090219 | negative regulation of lipid kinase activity(GO:0090219) |
| 0.3 | 0.3 | GO:1901889 | negative regulation of focal adhesion assembly(GO:0051895) negative regulation of cell junction assembly(GO:1901889) |
| 0.3 | 1.3 | GO:0030309 | poly-N-acetyllactosamine metabolic process(GO:0030309) poly-N-acetyllactosamine biosynthetic process(GO:0030311) |
| 0.3 | 1.3 | GO:0048861 | leukemia inhibitory factor signaling pathway(GO:0048861) |
| 0.3 | 0.6 | GO:0035564 | regulation of kidney size(GO:0035564) |
| 0.3 | 1.6 | GO:0010991 | negative regulation of SMAD protein complex assembly(GO:0010991) |
| 0.3 | 0.3 | GO:0060681 | branch elongation involved in ureteric bud branching(GO:0060681) |
| 0.3 | 0.9 | GO:0052422 | modulation of catalytic activity in other organism involved in symbiotic interaction(GO:0052203) modulation by host of symbiont catalytic activity(GO:0052422) |
| 0.3 | 1.2 | GO:0046532 | regulation of photoreceptor cell differentiation(GO:0046532) |
| 0.3 | 0.9 | GO:2000525 | regulation of T cell costimulation(GO:2000523) positive regulation of T cell costimulation(GO:2000525) |
| 0.3 | 0.6 | GO:0018992 | germ-line sex determination(GO:0018992) |
| 0.3 | 0.9 | GO:0042091 | interleukin-10 biosynthetic process(GO:0042091) regulation of interleukin-10 biosynthetic process(GO:0045074) |
| 0.3 | 1.8 | GO:0030321 | transepithelial chloride transport(GO:0030321) |
| 0.3 | 0.3 | GO:0021776 | smoothened signaling pathway involved in ventral spinal cord interneuron specification(GO:0021775) smoothened signaling pathway involved in spinal cord motor neuron cell fate specification(GO:0021776) |
| 0.3 | 2.6 | GO:0048680 | positive regulation of axon regeneration(GO:0048680) |
| 0.3 | 0.6 | GO:0030538 | embryonic genitalia morphogenesis(GO:0030538) |
| 0.3 | 0.3 | GO:0061047 | foregut regionalization(GO:0060423) lung field specification(GO:0060424) lung induction(GO:0060492) positive regulation of branching involved in lung morphogenesis(GO:0061047) |
| 0.3 | 5.1 | GO:0032332 | positive regulation of chondrocyte differentiation(GO:0032332) |
| 0.3 | 0.6 | GO:0071898 | regulation of estrogen receptor binding(GO:0071898) negative regulation of estrogen receptor binding(GO:0071899) |
| 0.3 | 1.4 | GO:1902459 | positive regulation of stem cell population maintenance(GO:1902459) |
| 0.3 | 1.1 | GO:0008355 | olfactory learning(GO:0008355) |
| 0.3 | 0.8 | GO:0045448 | regulation of mitotic cell cycle, embryonic(GO:0009794) mitotic cell cycle, embryonic(GO:0045448) |
| 0.3 | 0.3 | GO:0003284 | septum primum development(GO:0003284) |
| 0.3 | 1.7 | GO:0090557 | establishment of endothelial intestinal barrier(GO:0090557) |
| 0.3 | 1.9 | GO:0042511 | positive regulation of tyrosine phosphorylation of Stat1 protein(GO:0042511) |
| 0.3 | 1.3 | GO:0030240 | skeletal muscle thin filament assembly(GO:0030240) |
| 0.3 | 1.1 | GO:0051725 | protein de-ADP-ribosylation(GO:0051725) |
| 0.3 | 0.5 | GO:0030382 | sperm mitochondrion organization(GO:0030382) |
| 0.3 | 2.4 | GO:0035428 | hexose transmembrane transport(GO:0035428) |
| 0.3 | 0.8 | GO:0060448 | dichotomous subdivision of terminal units involved in lung branching(GO:0060448) |
| 0.3 | 0.8 | GO:0033088 | negative regulation of immature T cell proliferation in thymus(GO:0033088) |
| 0.3 | 1.3 | GO:0006528 | asparagine metabolic process(GO:0006528) |
| 0.3 | 3.6 | GO:0032331 | negative regulation of chondrocyte differentiation(GO:0032331) |
| 0.3 | 0.5 | GO:0000720 | pyrimidine dimer repair by nucleotide-excision repair(GO:0000720) |
| 0.3 | 0.8 | GO:0071476 | cellular hypotonic response(GO:0071476) |
| 0.3 | 2.0 | GO:0019800 | peptide cross-linking via chondroitin 4-sulfate glycosaminoglycan(GO:0019800) |
| 0.2 | 1.2 | GO:2000618 | regulation of histone H4-K16 acetylation(GO:2000618) |
| 0.2 | 0.5 | GO:0044341 | sodium-dependent phosphate transport(GO:0044341) |
| 0.2 | 2.0 | GO:0071420 | cellular response to histamine(GO:0071420) |
| 0.2 | 0.2 | GO:1901420 | negative regulation of response to alcohol(GO:1901420) |
| 0.2 | 1.4 | GO:0060059 | embryonic retina morphogenesis in camera-type eye(GO:0060059) |
| 0.2 | 1.0 | GO:0090336 | positive regulation of brown fat cell differentiation(GO:0090336) |
| 0.2 | 2.6 | GO:0042523 | positive regulation of tyrosine phosphorylation of Stat5 protein(GO:0042523) |
| 0.2 | 0.5 | GO:0089700 | protein kinase D signaling(GO:0089700) |
| 0.2 | 0.5 | GO:1904706 | negative regulation of vascular smooth muscle cell proliferation(GO:1904706) |
| 0.2 | 0.5 | GO:0070120 | ciliary neurotrophic factor-mediated signaling pathway(GO:0070120) |
| 0.2 | 0.2 | GO:0007403 | glial cell fate determination(GO:0007403) |
| 0.2 | 0.9 | GO:0060762 | regulation of branching involved in mammary gland duct morphogenesis(GO:0060762) |
| 0.2 | 2.3 | GO:0006527 | arginine catabolic process(GO:0006527) |
| 0.2 | 1.1 | GO:0070345 | negative regulation of fat cell proliferation(GO:0070345) |
| 0.2 | 1.1 | GO:0061002 | negative regulation of dendritic spine morphogenesis(GO:0061002) |
| 0.2 | 0.7 | GO:0030208 | dermatan sulfate biosynthetic process(GO:0030208) |
| 0.2 | 1.1 | GO:0035166 | post-embryonic hemopoiesis(GO:0035166) |
| 0.2 | 0.7 | GO:0033278 | cell proliferation in midbrain(GO:0033278) |
| 0.2 | 0.7 | GO:0061086 | negative regulation of histone H3-K27 methylation(GO:0061086) |
| 0.2 | 0.4 | GO:0045110 | intermediate filament bundle assembly(GO:0045110) |
| 0.2 | 1.3 | GO:0035360 | positive regulation of peroxisome proliferator activated receptor signaling pathway(GO:0035360) |
| 0.2 | 0.6 | GO:0017187 | peptidyl-glutamic acid carboxylation(GO:0017187) |
| 0.2 | 0.6 | GO:0044333 | Wnt signaling pathway involved in digestive tract morphogenesis(GO:0044333) |
| 0.2 | 1.0 | GO:1903689 | regulation of wound healing, spreading of epidermal cells(GO:1903689) |
| 0.2 | 1.2 | GO:0002035 | brain renin-angiotensin system(GO:0002035) |
| 0.2 | 0.4 | GO:1904259 | regulation of basement membrane assembly involved in embryonic body morphogenesis(GO:1904259) positive regulation of basement membrane assembly involved in embryonic body morphogenesis(GO:1904261) basement membrane assembly involved in embryonic body morphogenesis(GO:2001197) |
| 0.2 | 2.0 | GO:0046415 | urate metabolic process(GO:0046415) |
| 0.2 | 0.6 | GO:0019254 | carnitine metabolic process, CoA-linked(GO:0019254) |
| 0.2 | 0.6 | GO:0015705 | iodide transport(GO:0015705) |
| 0.2 | 1.6 | GO:0071493 | cellular response to UV-B(GO:0071493) |
| 0.2 | 0.8 | GO:0060373 | regulation of ventricular cardiac muscle cell membrane depolarization(GO:0060373) |
| 0.2 | 1.0 | GO:0034219 | carbohydrate transmembrane transport(GO:0034219) |
| 0.2 | 0.4 | GO:0035973 | aggrephagy(GO:0035973) |
| 0.2 | 2.6 | GO:0098743 | cartilage condensation(GO:0001502) cell aggregation(GO:0098743) |
| 0.2 | 1.7 | GO:0021796 | cerebral cortex regionalization(GO:0021796) |
| 0.2 | 0.2 | GO:0072050 | S-shaped body morphogenesis(GO:0072050) |
| 0.2 | 1.1 | GO:0021707 | cerebellar granular layer formation(GO:0021684) cerebellar granule cell differentiation(GO:0021707) |
| 0.2 | 0.6 | GO:0006172 | ADP biosynthetic process(GO:0006172) |
| 0.2 | 0.5 | GO:0030050 | vesicle transport along actin filament(GO:0030050) |
| 0.2 | 1.3 | GO:0090179 | planar cell polarity pathway involved in neural tube closure(GO:0090179) |
| 0.2 | 0.4 | GO:2000721 | positive regulation of transcription from RNA polymerase II promoter involved in smooth muscle cell differentiation(GO:2000721) |
| 0.2 | 0.7 | GO:0045656 | negative regulation of monocyte differentiation(GO:0045656) |
| 0.2 | 1.9 | GO:0060732 | positive regulation of inositol phosphate biosynthetic process(GO:0060732) |
| 0.2 | 1.9 | GO:2000810 | regulation of bicellular tight junction assembly(GO:2000810) |
| 0.2 | 0.3 | GO:0010735 | positive regulation of transcription via serum response element binding(GO:0010735) |
| 0.2 | 0.3 | GO:2000836 | androgen secretion(GO:0035935) regulation of androgen secretion(GO:2000834) positive regulation of androgen secretion(GO:2000836) |
| 0.2 | 0.2 | GO:0035793 | positive regulation of metanephric mesenchymal cell migration by platelet-derived growth factor receptor-beta signaling pathway(GO:0035793) regulation of metanephric mesenchymal cell migration by platelet-derived growth factor receptor-beta signaling pathway(GO:1900238) positive regulation of metanephric mesenchymal cell migration(GO:2000591) |
| 0.2 | 1.0 | GO:0060481 | lobar bronchus epithelium development(GO:0060481) |
| 0.2 | 0.5 | GO:0003278 | apoptotic process involved in heart morphogenesis(GO:0003278) |
| 0.2 | 0.3 | GO:0071725 | response to triacyl bacterial lipopeptide(GO:0071725) cellular response to triacyl bacterial lipopeptide(GO:0071727) |
| 0.2 | 0.8 | GO:2000535 | entry of bacterium into host cell(GO:0035635) regulation of entry of bacterium into host cell(GO:2000535) |
| 0.2 | 1.3 | GO:0009437 | carnitine metabolic process(GO:0009437) |
| 0.2 | 0.3 | GO:0045630 | positive regulation of T-helper 2 cell differentiation(GO:0045630) |
| 0.2 | 3.0 | GO:0043153 | entrainment of circadian clock by photoperiod(GO:0043153) |
| 0.2 | 1.0 | GO:0090244 | Wnt signaling pathway involved in somitogenesis(GO:0090244) |
| 0.2 | 1.5 | GO:0060052 | neurofilament cytoskeleton organization(GO:0060052) |
| 0.2 | 0.3 | GO:0016560 | protein import into peroxisome matrix, docking(GO:0016560) |
| 0.2 | 0.6 | GO:0032463 | negative regulation of protein homooligomerization(GO:0032463) |
| 0.2 | 0.6 | GO:0019509 | L-methionine biosynthetic process from methylthioadenosine(GO:0019509) |
| 0.2 | 0.5 | GO:0018199 | peptidyl-glutamine modification(GO:0018199) |
| 0.2 | 0.3 | GO:0010724 | regulation of definitive erythrocyte differentiation(GO:0010724) |
| 0.2 | 1.0 | GO:0042985 | negative regulation of amyloid precursor protein biosynthetic process(GO:0042985) |
| 0.2 | 0.6 | GO:1900454 | positive regulation of long term synaptic depression(GO:1900454) |
| 0.2 | 0.8 | GO:1902373 | negative regulation of mRNA catabolic process(GO:1902373) |
| 0.2 | 0.8 | GO:0090050 | positive regulation of cell migration involved in sprouting angiogenesis(GO:0090050) |
| 0.2 | 1.6 | GO:0090129 | positive regulation of synapse maturation(GO:0090129) |
| 0.2 | 0.2 | GO:1901201 | regulation of extracellular matrix assembly(GO:1901201) |
| 0.2 | 0.8 | GO:0034616 | response to laminar fluid shear stress(GO:0034616) cellular response to laminar fluid shear stress(GO:0071499) |
| 0.2 | 0.9 | GO:0035372 | protein localization to microtubule(GO:0035372) |
| 0.2 | 0.9 | GO:1902993 | positive regulation of beta-amyloid formation(GO:1902004) positive regulation of amyloid precursor protein catabolic process(GO:1902993) |
| 0.2 | 1.1 | GO:0030388 | fructose 1,6-bisphosphate metabolic process(GO:0030388) |
| 0.2 | 0.8 | GO:0001978 | regulation of systemic arterial blood pressure by carotid sinus baroreceptor feedback(GO:0001978) |
| 0.1 | 0.6 | GO:0021631 | optic nerve morphogenesis(GO:0021631) |
| 0.1 | 0.7 | GO:0090080 | positive regulation of MAPKKK cascade by fibroblast growth factor receptor signaling pathway(GO:0090080) |
| 0.1 | 0.4 | GO:0046951 | ketone body biosynthetic process(GO:0046951) |
| 0.1 | 0.4 | GO:0072092 | ureteric bud invasion(GO:0072092) |
| 0.1 | 0.3 | GO:0032286 | central nervous system myelin maintenance(GO:0032286) |
| 0.1 | 0.1 | GO:1901668 | regulation of superoxide dismutase activity(GO:1901668) |
| 0.1 | 0.9 | GO:0007512 | adult heart development(GO:0007512) |
| 0.1 | 0.7 | GO:0009052 | pentose-phosphate shunt, non-oxidative branch(GO:0009052) |
| 0.1 | 0.4 | GO:0032687 | negative regulation of interferon-alpha production(GO:0032687) |
| 0.1 | 0.4 | GO:0060279 | positive regulation of ovulation(GO:0060279) |
| 0.1 | 0.6 | GO:0039536 | negative regulation of RIG-I signaling pathway(GO:0039536) |
| 0.1 | 0.3 | GO:0042494 | detection of bacterial lipoprotein(GO:0042494) |
| 0.1 | 0.4 | GO:0046341 | CDP-diacylglycerol metabolic process(GO:0046341) |
| 0.1 | 0.6 | GO:0046600 | negative regulation of centriole replication(GO:0046600) |
| 0.1 | 0.1 | GO:0001996 | positive regulation of heart rate by epinephrine-norepinephrine(GO:0001996) |
| 0.1 | 0.4 | GO:0002071 | glandular epithelial cell maturation(GO:0002071) |
| 0.1 | 0.3 | GO:0070949 | regulation of neutrophil mediated cytotoxicity(GO:0070948) regulation of neutrophil mediated killing of symbiont cell(GO:0070949) |
| 0.1 | 0.4 | GO:1904059 | regulation of locomotor rhythm(GO:1904059) |
| 0.1 | 0.1 | GO:0010694 | positive regulation of alkaline phosphatase activity(GO:0010694) |
| 0.1 | 0.7 | GO:0043951 | negative regulation of cAMP-mediated signaling(GO:0043951) |
| 0.1 | 1.1 | GO:0022027 | interkinetic nuclear migration(GO:0022027) |
| 0.1 | 0.3 | GO:1902075 | cellular response to salt(GO:1902075) |
| 0.1 | 2.3 | GO:0051497 | negative regulation of stress fiber assembly(GO:0051497) |
| 0.1 | 3.0 | GO:0042832 | defense response to protozoan(GO:0042832) |
| 0.1 | 0.5 | GO:0051365 | cellular response to potassium ion starvation(GO:0051365) |
| 0.1 | 1.1 | GO:0045721 | negative regulation of gluconeogenesis(GO:0045721) |
| 0.1 | 0.1 | GO:0097477 | lateral motor column neuron migration(GO:0097477) |
| 0.1 | 0.4 | GO:2000097 | regulation of smooth muscle cell-matrix adhesion(GO:2000097) |
| 0.1 | 0.4 | GO:0006624 | vacuolar protein processing(GO:0006624) |
| 0.1 | 1.5 | GO:0031065 | positive regulation of histone deacetylation(GO:0031065) |
| 0.1 | 0.8 | GO:0048703 | embryonic viscerocranium morphogenesis(GO:0048703) |
| 0.1 | 0.9 | GO:0006620 | posttranslational protein targeting to membrane(GO:0006620) |
| 0.1 | 0.3 | GO:1902548 | negative regulation of cellular response to vascular endothelial growth factor stimulus(GO:1902548) |
| 0.1 | 0.5 | GO:0072383 | plus-end-directed vesicle transport along microtubule(GO:0072383) plus-end-directed organelle transport along microtubule(GO:0072386) |
| 0.1 | 1.7 | GO:0014850 | response to muscle activity(GO:0014850) |
| 0.1 | 1.9 | GO:0036344 | platelet morphogenesis(GO:0036344) |
| 0.1 | 0.8 | GO:0014883 | transition between fast and slow fiber(GO:0014883) |
| 0.1 | 0.5 | GO:0086103 | G-protein coupled receptor signaling pathway involved in heart process(GO:0086103) |
| 0.1 | 0.9 | GO:0033234 | negative regulation of protein sumoylation(GO:0033234) |
| 0.1 | 0.5 | GO:1903862 | positive regulation of oxidative phosphorylation(GO:1903862) |
| 0.1 | 2.7 | GO:0010831 | positive regulation of myotube differentiation(GO:0010831) |
| 0.1 | 0.4 | GO:0006203 | dGTP catabolic process(GO:0006203) |
| 0.1 | 0.5 | GO:0042138 | meiotic DNA double-strand break formation(GO:0042138) |
| 0.1 | 0.1 | GO:1905005 | regulation of epithelial to mesenchymal transition involved in endocardial cushion formation(GO:1905005) |
| 0.1 | 1.0 | GO:0032462 | regulation of protein homooligomerization(GO:0032462) |
| 0.1 | 0.1 | GO:1902730 | regulation of heparan sulfate proteoglycan biosynthetic process(GO:0010908) positive regulation of heparan sulfate proteoglycan biosynthetic process(GO:0010909) positive regulation of proteoglycan biosynthetic process(GO:1902730) |
| 0.1 | 0.1 | GO:1900169 | regulation of glucocorticoid mediated signaling pathway(GO:1900169) |
| 0.1 | 0.5 | GO:0070086 | ubiquitin-dependent endocytosis(GO:0070086) |
| 0.1 | 0.5 | GO:0045713 | low-density lipoprotein particle receptor biosynthetic process(GO:0045713) |
| 0.1 | 0.2 | GO:1901187 | regulation of ephrin receptor signaling pathway(GO:1901187) |
| 0.1 | 0.1 | GO:2000211 | regulation of glutamate metabolic process(GO:2000211) |
| 0.1 | 0.2 | GO:1902564 | negative regulation of neutrophil activation(GO:1902564) |
| 0.1 | 1.1 | GO:0070307 | lens fiber cell development(GO:0070307) |
| 0.1 | 1.6 | GO:0042347 | negative regulation of NF-kappaB import into nucleus(GO:0042347) |
| 0.1 | 0.8 | GO:2000766 | negative regulation of cytoplasmic translation(GO:2000766) |
| 0.1 | 0.3 | GO:0031581 | hemidesmosome assembly(GO:0031581) |
| 0.1 | 0.9 | GO:0046069 | cGMP catabolic process(GO:0046069) |
| 0.1 | 0.1 | GO:0060737 | prostate epithelial cord elongation(GO:0060523) prostate gland morphogenetic growth(GO:0060737) |
| 0.1 | 0.5 | GO:0042693 | muscle cell fate commitment(GO:0042693) |
| 0.1 | 0.3 | GO:0010533 | regulation of activation of Janus kinase activity(GO:0010533) regulation of activation of JAK2 kinase activity(GO:0010534) |
| 0.1 | 0.6 | GO:0005981 | regulation of glycogen catabolic process(GO:0005981) |
| 0.1 | 2.6 | GO:0048384 | retinoic acid receptor signaling pathway(GO:0048384) |
| 0.1 | 0.5 | GO:0060083 | smooth muscle contraction involved in micturition(GO:0060083) |
| 0.1 | 0.4 | GO:1901386 | negative regulation of voltage-gated calcium channel activity(GO:1901386) |
| 0.1 | 0.2 | GO:1903011 | negative regulation of bone development(GO:1903011) |
| 0.1 | 1.6 | GO:0000920 | cell separation after cytokinesis(GO:0000920) |
| 0.1 | 0.2 | GO:1900242 | regulation of synaptic vesicle endocytosis(GO:1900242) |
| 0.1 | 0.6 | GO:0007016 | cytoskeletal anchoring at plasma membrane(GO:0007016) |
| 0.1 | 0.8 | GO:0035878 | nail development(GO:0035878) |
| 0.1 | 0.9 | GO:0061299 | retina vasculature morphogenesis in camera-type eye(GO:0061299) |
| 0.1 | 0.3 | GO:0070164 | negative regulation of adiponectin secretion(GO:0070164) |
| 0.1 | 0.3 | GO:0007039 | protein catabolic process in the vacuole(GO:0007039) |
| 0.1 | 0.9 | GO:0035313 | wound healing, spreading of epidermal cells(GO:0035313) |
| 0.1 | 1.0 | GO:0042359 | vitamin D metabolic process(GO:0042359) |
| 0.1 | 0.2 | GO:0061366 | behavioral response to chemical pain(GO:0061366) behavioral response to formalin induced pain(GO:0061368) |
| 0.1 | 0.4 | GO:0010626 | negative regulation of Schwann cell proliferation(GO:0010626) |
| 0.1 | 0.3 | GO:0007221 | positive regulation of transcription of Notch receptor target(GO:0007221) |
| 0.1 | 0.3 | GO:2001184 | positive regulation of interleukin-12 secretion(GO:2001184) |
| 0.1 | 0.2 | GO:0021912 | regulation of transcription from RNA polymerase II promoter involved in spinal cord motor neuron fate specification(GO:0021912) |
| 0.1 | 0.2 | GO:0003431 | growth plate cartilage chondrocyte development(GO:0003431) |
| 0.1 | 0.3 | GO:0061588 | calcium activated phospholipid scrambling(GO:0061588) calcium activated phosphatidylcholine scrambling(GO:0061590) calcium activated galactosylceramide scrambling(GO:0061591) |
| 0.1 | 0.2 | GO:0042891 | antibiotic transport(GO:0042891) |
| 0.1 | 0.4 | GO:0032077 | positive regulation of deoxyribonuclease activity(GO:0032077) |
| 0.1 | 0.4 | GO:0042256 | mature ribosome assembly(GO:0042256) |
| 0.1 | 0.1 | GO:0072191 | ureter smooth muscle development(GO:0072191) ureter smooth muscle cell differentiation(GO:0072193) |
| 0.1 | 0.3 | GO:0032474 | otolith morphogenesis(GO:0032474) |
| 0.1 | 0.2 | GO:1990036 | calcium ion import into sarcoplasmic reticulum(GO:1990036) |
| 0.1 | 0.8 | GO:2000679 | positive regulation of transcription regulatory region DNA binding(GO:2000679) |
| 0.1 | 1.2 | GO:0032967 | positive regulation of collagen biosynthetic process(GO:0032967) |
| 0.1 | 1.4 | GO:0016486 | peptide hormone processing(GO:0016486) |
| 0.1 | 1.1 | GO:0048484 | enteric nervous system development(GO:0048484) |
| 0.1 | 0.9 | GO:2000778 | positive regulation of interleukin-6 secretion(GO:2000778) |
| 0.1 | 0.3 | GO:0007181 | transforming growth factor beta receptor complex assembly(GO:0007181) |
| 0.1 | 0.1 | GO:0021827 | cerebral cortex tangential migration using cell-cell interactions(GO:0021823) postnatal olfactory bulb interneuron migration(GO:0021827) |
| 0.1 | 0.3 | GO:0038031 | non-canonical Wnt signaling pathway via JNK cascade(GO:0038031) |
| 0.1 | 0.5 | GO:0051775 | response to redox state(GO:0051775) |
| 0.1 | 0.2 | GO:0060290 | transdifferentiation(GO:0060290) |
| 0.1 | 0.2 | GO:0003383 | apical constriction(GO:0003383) |
| 0.1 | 0.4 | GO:0060316 | positive regulation of ryanodine-sensitive calcium-release channel activity(GO:0060316) |
| 0.1 | 0.3 | GO:2000048 | negative regulation of cell-cell adhesion mediated by cadherin(GO:2000048) |
| 0.1 | 0.4 | GO:0034627 | 'de novo' NAD biosynthetic process(GO:0034627) |
| 0.1 | 0.2 | GO:0048319 | axial mesoderm morphogenesis(GO:0048319) |
| 0.1 | 0.6 | GO:0001842 | neural fold formation(GO:0001842) |
| 0.1 | 0.3 | GO:0071500 | cellular response to nitrosative stress(GO:0071500) |
| 0.1 | 0.3 | GO:0033030 | negative regulation of neutrophil apoptotic process(GO:0033030) |
| 0.1 | 0.1 | GO:0072179 | nephric duct formation(GO:0072179) |
| 0.1 | 0.3 | GO:0036092 | phosphatidylinositol-3-phosphate biosynthetic process(GO:0036092) |
| 0.1 | 0.3 | GO:2001013 | epithelial cell proliferation involved in renal tubule morphogenesis(GO:2001013) |
| 0.1 | 0.3 | GO:1904742 | regulation of telomeric DNA binding(GO:1904742) |
| 0.1 | 0.2 | GO:0038065 | collagen-activated signaling pathway(GO:0038065) |
| 0.1 | 0.1 | GO:0034392 | negative regulation of smooth muscle cell apoptotic process(GO:0034392) |
| 0.1 | 0.4 | GO:0016557 | peroxisome membrane biogenesis(GO:0016557) |
| 0.1 | 0.1 | GO:1902302 | regulation of potassium ion export(GO:1902302) |
| 0.1 | 0.1 | GO:0045054 | constitutive secretory pathway(GO:0045054) |
| 0.1 | 0.4 | GO:0051152 | positive regulation of smooth muscle cell differentiation(GO:0051152) |
| 0.1 | 0.5 | GO:0042421 | norepinephrine biosynthetic process(GO:0042421) |
| 0.1 | 0.4 | GO:0001547 | antral ovarian follicle growth(GO:0001547) |
| 0.1 | 1.3 | GO:0033622 | integrin activation(GO:0033622) |
| 0.1 | 0.3 | GO:0050927 | positive regulation of positive chemotaxis(GO:0050927) |
| 0.1 | 0.4 | GO:2000504 | positive regulation of blood vessel remodeling(GO:2000504) |
| 0.1 | 0.2 | GO:0043366 | beta selection(GO:0043366) |
| 0.1 | 0.9 | GO:0034497 | protein localization to pre-autophagosomal structure(GO:0034497) |
| 0.1 | 0.1 | GO:0070900 | mitochondrial tRNA modification(GO:0070900) mitochondrial RNA modification(GO:1900864) |
| 0.1 | 0.2 | GO:0010871 | negative regulation of receptor biosynthetic process(GO:0010871) |
| 0.1 | 0.6 | GO:0031936 | negative regulation of chromatin silencing(GO:0031936) |
| 0.1 | 0.1 | GO:0061302 | smooth muscle cell-matrix adhesion(GO:0061302) |
| 0.1 | 0.2 | GO:0008065 | establishment of blood-nerve barrier(GO:0008065) |
| 0.1 | 0.4 | GO:0043654 | recognition of apoptotic cell(GO:0043654) |
| 0.1 | 0.3 | GO:0090238 | positive regulation of arachidonic acid secretion(GO:0090238) |
| 0.1 | 0.3 | GO:1900119 | positive regulation of execution phase of apoptosis(GO:1900119) |
| 0.1 | 0.3 | GO:0070294 | renal sodium ion absorption(GO:0070294) |
| 0.1 | 0.1 | GO:0032097 | positive regulation of response to food(GO:0032097) positive regulation of appetite(GO:0032100) |
| 0.1 | 0.6 | GO:0075522 | IRES-dependent viral translational initiation(GO:0075522) |
| 0.1 | 0.2 | GO:0070099 | regulation of chemokine-mediated signaling pathway(GO:0070099) |
| 0.1 | 0.2 | GO:0015755 | fructose transport(GO:0015755) |
| 0.1 | 0.7 | GO:0035855 | megakaryocyte development(GO:0035855) |
| 0.1 | 0.3 | GO:0019388 | galactose catabolic process(GO:0019388) |
| 0.1 | 0.7 | GO:0035845 | photoreceptor cell outer segment organization(GO:0035845) |
| 0.1 | 0.2 | GO:0045918 | negative regulation of cytolysis(GO:0045918) |
| 0.1 | 0.1 | GO:0097029 | mature conventional dendritic cell differentiation(GO:0097029) |
| 0.1 | 0.2 | GO:0007343 | egg activation(GO:0007343) |
| 0.1 | 0.1 | GO:0002125 | maternal aggressive behavior(GO:0002125) |
| 0.1 | 0.1 | GO:1904861 | excitatory synapse assembly(GO:1904861) |
| 0.1 | 0.7 | GO:0080111 | DNA demethylation(GO:0080111) |
| 0.1 | 0.2 | GO:0038165 | oncostatin-M-mediated signaling pathway(GO:0038165) |
| 0.1 | 0.6 | GO:0060644 | mammary gland epithelial cell differentiation(GO:0060644) |
| 0.1 | 0.1 | GO:0002840 | T cell mediated immune response to tumor cell(GO:0002424) regulation of T cell mediated immune response to tumor cell(GO:0002840) |
| 0.1 | 0.1 | GO:0003406 | retinal pigment epithelium development(GO:0003406) |
| 0.1 | 0.2 | GO:1900368 | regulation of RNA interference(GO:1900368) |
| 0.1 | 0.7 | GO:0046838 | phosphorylated carbohydrate dephosphorylation(GO:0046838) inositol phosphate dephosphorylation(GO:0046855) |
| 0.1 | 0.3 | GO:0070874 | negative regulation of glycogen biosynthetic process(GO:0045719) negative regulation of glycogen metabolic process(GO:0070874) |
| 0.1 | 0.2 | GO:0080154 | regulation of fertilization(GO:0080154) |
| 0.1 | 0.1 | GO:0071724 | response to diacyl bacterial lipopeptide(GO:0071724) cellular response to diacyl bacterial lipopeptide(GO:0071726) |
| 0.1 | 0.2 | GO:1900748 | positive regulation of vascular endothelial growth factor signaling pathway(GO:1900748) |
| 0.1 | 0.4 | GO:0032020 | ISG15-protein conjugation(GO:0032020) |
| 0.1 | 0.1 | GO:2000017 | positive regulation of determination of dorsal identity(GO:2000017) |
| 0.1 | 0.9 | GO:0014912 | negative regulation of smooth muscle cell migration(GO:0014912) |
| 0.1 | 0.7 | GO:0050930 | induction of positive chemotaxis(GO:0050930) |
| 0.1 | 0.4 | GO:0086073 | bundle of His cell-Purkinje myocyte adhesion involved in cell communication(GO:0086073) |
| 0.1 | 0.3 | GO:0061032 | visceral serous pericardium development(GO:0061032) |
| 0.1 | 0.3 | GO:0002192 | IRES-dependent translational initiation(GO:0002192) |
| 0.1 | 0.1 | GO:0061535 | glutamate secretion, neurotransmission(GO:0061535) |
| 0.1 | 1.9 | GO:0010761 | fibroblast migration(GO:0010761) |
| 0.1 | 0.1 | GO:0060160 | negative regulation of dopamine receptor signaling pathway(GO:0060160) |
| 0.1 | 0.1 | GO:0032911 | negative regulation of transforming growth factor beta1 production(GO:0032911) |
| 0.1 | 0.1 | GO:0086064 | cell communication by electrical coupling involved in cardiac conduction(GO:0086064) |
| 0.1 | 0.1 | GO:0060022 | hard palate development(GO:0060022) |
| 0.1 | 0.2 | GO:0035521 | monoubiquitinated histone deubiquitination(GO:0035521) monoubiquitinated histone H2A deubiquitination(GO:0035522) |
| 0.1 | 1.2 | GO:0010830 | regulation of myotube differentiation(GO:0010830) |
| 0.1 | 0.3 | GO:0043117 | positive regulation of vascular permeability(GO:0043117) |
| 0.1 | 0.3 | GO:0042759 | long-chain fatty acid biosynthetic process(GO:0042759) |
| 0.1 | 0.7 | GO:0070166 | enamel mineralization(GO:0070166) |
| 0.1 | 1.3 | GO:0046457 | prostaglandin biosynthetic process(GO:0001516) prostanoid biosynthetic process(GO:0046457) |
| 0.1 | 2.2 | GO:0032233 | positive regulation of actin filament bundle assembly(GO:0032233) |
| 0.1 | 1.8 | GO:0043297 | apical junction assembly(GO:0043297) |
| 0.1 | 0.3 | GO:0071692 | protein localization to extracellular region(GO:0071692) maintenance of protein location in extracellular region(GO:0071694) |
| 0.1 | 0.1 | GO:2001286 | regulation of caveolin-mediated endocytosis(GO:2001286) |
| 0.1 | 0.1 | GO:0002318 | myeloid progenitor cell differentiation(GO:0002318) |
| 0.1 | 0.4 | GO:0060267 | positive regulation of respiratory burst(GO:0060267) |
| 0.1 | 0.3 | GO:2001260 | regulation of semaphorin-plexin signaling pathway(GO:2001260) |
| 0.1 | 0.1 | GO:1900020 | regulation of protein kinase C activity(GO:1900019) positive regulation of protein kinase C activity(GO:1900020) |
| 0.1 | 0.5 | GO:0006198 | cAMP catabolic process(GO:0006198) |
| 0.1 | 2.0 | GO:0019373 | epoxygenase P450 pathway(GO:0019373) |
| 0.1 | 0.8 | GO:0090023 | positive regulation of neutrophil chemotaxis(GO:0090023) |
| 0.1 | 0.3 | GO:0048251 | elastic fiber assembly(GO:0048251) |
| 0.1 | 3.6 | GO:0035914 | skeletal muscle cell differentiation(GO:0035914) |
| 0.1 | 0.1 | GO:0021564 | vagus nerve development(GO:0021564) |
| 0.1 | 0.1 | GO:0010159 | specification of organ position(GO:0010159) |
| 0.1 | 1.0 | GO:1901385 | regulation of voltage-gated calcium channel activity(GO:1901385) |
| 0.1 | 0.2 | GO:0001562 | response to protozoan(GO:0001562) |
| 0.1 | 0.1 | GO:0030167 | proteoglycan catabolic process(GO:0030167) |
| 0.1 | 0.2 | GO:0097105 | presynaptic membrane assembly(GO:0097105) |
| 0.1 | 0.2 | GO:0070314 | G1 to G0 transition(GO:0070314) |
| 0.1 | 0.8 | GO:1990403 | embryonic brain development(GO:1990403) |
| 0.1 | 0.3 | GO:0010571 | positive regulation of nuclear cell cycle DNA replication(GO:0010571) |
| 0.1 | 0.3 | GO:0016255 | attachment of GPI anchor to protein(GO:0016255) |
| 0.1 | 0.1 | GO:0034140 | negative regulation of toll-like receptor 3 signaling pathway(GO:0034140) |
| 0.1 | 0.1 | GO:2000416 | regulation of eosinophil migration(GO:2000416) |
| 0.1 | 1.2 | GO:0060292 | long term synaptic depression(GO:0060292) |
| 0.1 | 0.1 | GO:2000855 | mineralocorticoid secretion(GO:0035931) aldosterone secretion(GO:0035932) regulation of mineralocorticoid secretion(GO:2000855) regulation of aldosterone secretion(GO:2000858) |
| 0.1 | 0.3 | GO:0090527 | actin filament reorganization(GO:0090527) |
| 0.1 | 0.1 | GO:0070831 | basement membrane assembly(GO:0070831) |
| 0.1 | 0.5 | GO:0019511 | peptidyl-proline hydroxylation(GO:0019511) |
| 0.1 | 0.2 | GO:0060297 | regulation of sarcomere organization(GO:0060297) |
| 0.1 | 0.1 | GO:0060174 | Spemann organizer formation(GO:0060061) limb bud formation(GO:0060174) |
| 0.1 | 0.2 | GO:0000379 | tRNA-type intron splice site recognition and cleavage(GO:0000379) |
| 0.1 | 0.1 | GO:0090135 | actin filament branching(GO:0090135) |
| 0.1 | 0.2 | GO:0002051 | osteoblast fate commitment(GO:0002051) |
| 0.1 | 0.1 | GO:0010728 | regulation of hydrogen peroxide biosynthetic process(GO:0010728) |
| 0.1 | 0.2 | GO:0051534 | negative regulation of NFAT protein import into nucleus(GO:0051534) |
| 0.1 | 0.3 | GO:0071985 | multivesicular body sorting pathway(GO:0071985) |
| 0.1 | 0.1 | GO:0043402 | glucocorticoid mediated signaling pathway(GO:0043402) |
| 0.1 | 0.4 | GO:0008215 | spermine metabolic process(GO:0008215) |
| 0.1 | 0.7 | GO:1900048 | positive regulation of blood coagulation(GO:0030194) positive regulation of hemostasis(GO:1900048) |
| 0.1 | 0.1 | GO:0030214 | hyaluronan catabolic process(GO:0030214) |
| 0.1 | 0.4 | GO:0030836 | positive regulation of actin filament depolymerization(GO:0030836) |
| 0.1 | 1.4 | GO:0019369 | arachidonic acid metabolic process(GO:0019369) |
| 0.1 | 0.1 | GO:0035983 | response to trichostatin A(GO:0035983) cellular response to trichostatin A(GO:0035984) |
| 0.1 | 0.3 | GO:0070131 | positive regulation of mitochondrial translation(GO:0070131) |
| 0.1 | 0.2 | GO:0032964 | collagen biosynthetic process(GO:0032964) |
| 0.1 | 0.2 | GO:0009106 | lipoate metabolic process(GO:0009106) |
| 0.1 | 0.1 | GO:0015744 | succinate transport(GO:0015744) |
| 0.1 | 0.3 | GO:0072675 | osteoclast fusion(GO:0072675) |
| 0.1 | 0.2 | GO:2000653 | regulation of genetic imprinting(GO:2000653) |
| 0.1 | 0.1 | GO:0060027 | convergent extension involved in gastrulation(GO:0060027) |
| 0.1 | 0.2 | GO:0036066 | protein O-linked fucosylation(GO:0036066) |
| 0.1 | 0.4 | GO:0060216 | definitive hemopoiesis(GO:0060216) |
| 0.1 | 0.2 | GO:0046726 | positive regulation by virus of viral protein levels in host cell(GO:0046726) |
| 0.1 | 0.1 | GO:0034146 | toll-like receptor 5 signaling pathway(GO:0034146) |
| 0.1 | 0.1 | GO:0042758 | long-chain fatty acid catabolic process(GO:0042758) |
| 0.1 | 0.1 | GO:0052200 | response to defenses of other organism involved in symbiotic interaction(GO:0052173) response to host defenses(GO:0052200) response to host(GO:0075136) |
| 0.1 | 0.5 | GO:0001975 | response to amphetamine(GO:0001975) |
| 0.1 | 0.2 | GO:0000715 | nucleotide-excision repair, DNA damage recognition(GO:0000715) |
| 0.1 | 0.2 | GO:0032000 | positive regulation of fatty acid beta-oxidation(GO:0032000) |
| 0.1 | 0.1 | GO:0043415 | positive regulation of skeletal muscle tissue regeneration(GO:0043415) |
| 0.1 | 0.1 | GO:0061146 | Peyer's patch morphogenesis(GO:0061146) |
| 0.1 | 0.1 | GO:1903553 | positive regulation of extracellular exosome assembly(GO:1903553) |
| 0.1 | 0.1 | GO:0061152 | trachea submucosa development(GO:0061152) trachea gland development(GO:0061153) |
| 0.1 | 0.1 | GO:0009180 | purine nucleoside diphosphate biosynthetic process(GO:0009136) purine ribonucleoside diphosphate biosynthetic process(GO:0009180) |
| 0.1 | 0.6 | GO:0023019 | signal transduction involved in regulation of gene expression(GO:0023019) |
| 0.1 | 0.1 | GO:0072602 | interleukin-4 secretion(GO:0072602) |
| 0.1 | 0.1 | GO:0061031 | endodermal digestive tract morphogenesis(GO:0061031) |
| 0.1 | 0.2 | GO:0070914 | UV-damage excision repair(GO:0070914) |
| 0.1 | 0.2 | GO:0042487 | regulation of odontogenesis of dentin-containing tooth(GO:0042487) |
| 0.1 | 0.8 | GO:0016082 | synaptic vesicle priming(GO:0016082) |
| 0.1 | 0.2 | GO:0042222 | interleukin-1 biosynthetic process(GO:0042222) |
| 0.1 | 1.2 | GO:0032456 | endocytic recycling(GO:0032456) |
| 0.1 | 0.1 | GO:0016264 | gap junction assembly(GO:0016264) |
| 0.1 | 0.2 | GO:0030210 | heparin biosynthetic process(GO:0030210) |
| 0.1 | 0.4 | GO:0010388 | protein deneddylation(GO:0000338) cullin deneddylation(GO:0010388) |
| 0.1 | 0.1 | GO:1900126 | negative regulation of hyaluronan biosynthetic process(GO:1900126) |
| 0.1 | 0.2 | GO:0019062 | virion attachment to host cell(GO:0019062) adhesion of symbiont to host cell(GO:0044650) |
| 0.1 | 0.4 | GO:0071578 | zinc II ion transmembrane import(GO:0071578) |
| 0.1 | 0.1 | GO:1904179 | positive regulation of adipose tissue development(GO:1904179) |
| 0.1 | 0.2 | GO:0090598 | male genitalia morphogenesis(GO:0048808) male anatomical structure morphogenesis(GO:0090598) |
| 0.1 | 0.3 | GO:0030949 | positive regulation of vascular endothelial growth factor receptor signaling pathway(GO:0030949) |
| 0.1 | 0.1 | GO:0060708 | spongiotrophoblast differentiation(GO:0060708) |
| 0.1 | 0.6 | GO:0060575 | intestinal epithelial cell differentiation(GO:0060575) |
| 0.1 | 1.3 | GO:0007528 | neuromuscular junction development(GO:0007528) |
| 0.1 | 0.1 | GO:0050955 | thermoception(GO:0050955) |
| 0.1 | 0.2 | GO:0001927 | exocyst assembly(GO:0001927) |
| 0.1 | 0.9 | GO:0007214 | gamma-aminobutyric acid signaling pathway(GO:0007214) |
| 0.1 | 0.1 | GO:0060584 | regulation of prostaglandin-endoperoxide synthase activity(GO:0060584) positive regulation of prostaglandin-endoperoxide synthase activity(GO:0060585) |
| 0.1 | 0.3 | GO:0051014 | actin filament severing(GO:0051014) |
| 0.1 | 0.1 | GO:0061101 | neuroendocrine cell differentiation(GO:0061101) |
| 0.0 | 0.1 | GO:0043201 | response to leucine(GO:0043201) cellular response to leucine(GO:0071233) |
| 0.0 | 0.2 | GO:0010606 | positive regulation of cytoplasmic mRNA processing body assembly(GO:0010606) |
| 0.0 | 0.0 | GO:0072610 | interleukin-12 secretion(GO:0072610) regulation of interleukin-12 secretion(GO:2001182) |
| 0.0 | 0.1 | GO:0000101 | sulfur amino acid transport(GO:0000101) |
| 0.0 | 0.1 | GO:0046882 | negative regulation of follicle-stimulating hormone secretion(GO:0046882) |
| 0.0 | 0.1 | GO:0036444 | calcium ion transmembrane import into mitochondrion(GO:0036444) |
| 0.0 | 0.1 | GO:0007227 | signal transduction downstream of smoothened(GO:0007227) |
| 0.0 | 0.2 | GO:0001778 | plasma membrane repair(GO:0001778) |
| 0.0 | 0.1 | GO:0002317 | plasma cell differentiation(GO:0002317) |
| 0.0 | 0.2 | GO:0060442 | branching involved in prostate gland morphogenesis(GO:0060442) |
| 0.0 | 0.8 | GO:0071353 | cellular response to interleukin-4(GO:0071353) |
| 0.0 | 0.1 | GO:0021898 | regulation of transcription from RNA polymerase II promoter involved in forebrain neuron fate commitment(GO:0021882) commitment of multipotent stem cells to neuronal lineage in forebrain(GO:0021898) |
| 0.0 | 0.2 | GO:1904382 | protein deglycosylation involved in glycoprotein catabolic process(GO:0035977) protein demannosylation(GO:0036507) protein alpha-1,2-demannosylation(GO:0036508) mannose trimming involved in glycoprotein ERAD pathway(GO:1904382) |
| 0.0 | 0.1 | GO:0045218 | zonula adherens maintenance(GO:0045218) |
| 0.0 | 0.1 | GO:0051599 | response to hydrostatic pressure(GO:0051599) |
| 0.0 | 0.1 | GO:0014733 | regulation of skeletal muscle adaptation(GO:0014733) |
| 0.0 | 0.3 | GO:0006654 | phosphatidic acid biosynthetic process(GO:0006654) |
| 0.0 | 0.1 | GO:0006842 | tricarboxylic acid transport(GO:0006842) citrate transport(GO:0015746) |
| 0.0 | 0.5 | GO:0032515 | negative regulation of phosphoprotein phosphatase activity(GO:0032515) |
| 0.0 | 0.1 | GO:0035507 | regulation of myosin-light-chain-phosphatase activity(GO:0035507) |
| 0.0 | 0.4 | GO:0031069 | hair follicle morphogenesis(GO:0031069) |
| 0.0 | 0.3 | GO:0043374 | CD8-positive, alpha-beta T cell differentiation(GO:0043374) |
| 0.0 | 0.0 | GO:0015747 | urate transport(GO:0015747) |
| 0.0 | 0.1 | GO:0071677 | positive regulation of mononuclear cell migration(GO:0071677) |
| 0.0 | 0.0 | GO:0007182 | common-partner SMAD protein phosphorylation(GO:0007182) |
| 0.0 | 0.1 | GO:0097155 | fasciculation of sensory neuron axon(GO:0097155) |
| 0.0 | 0.0 | GO:0043985 | histone H4-R3 methylation(GO:0043985) |
| 0.0 | 0.0 | GO:2000503 | positive regulation of natural killer cell chemotaxis(GO:2000503) |
| 0.0 | 0.1 | GO:0044778 | meiotic DNA integrity checkpoint(GO:0044778) |
| 0.0 | 0.2 | GO:0016139 | glycoside catabolic process(GO:0016139) |
| 0.0 | 0.1 | GO:0044027 | hypermethylation of CpG island(GO:0044027) |
| 0.0 | 0.2 | GO:0043536 | positive regulation of blood vessel endothelial cell migration(GO:0043536) |
| 0.0 | 0.2 | GO:0071675 | mononuclear cell migration(GO:0071674) regulation of mononuclear cell migration(GO:0071675) |
| 0.0 | 0.1 | GO:0006931 | substrate-dependent cell migration, cell attachment to substrate(GO:0006931) |
| 0.0 | 0.1 | GO:0036120 | response to platelet-derived growth factor(GO:0036119) cellular response to platelet-derived growth factor stimulus(GO:0036120) |
| 0.0 | 0.7 | GO:0033539 | fatty acid beta-oxidation using acyl-CoA dehydrogenase(GO:0033539) |
| 0.0 | 0.2 | GO:0042048 | olfactory behavior(GO:0042048) |
| 0.0 | 0.3 | GO:1902254 | negative regulation of intrinsic apoptotic signaling pathway by p53 class mediator(GO:1902254) |
| 0.0 | 0.1 | GO:0070305 | response to cGMP(GO:0070305) cellular response to cGMP(GO:0071321) |
| 0.0 | 0.1 | GO:0045415 | negative regulation of interleukin-8 biosynthetic process(GO:0045415) |
| 0.0 | 0.3 | GO:0071029 | polyadenylation-dependent ncRNA catabolic process(GO:0043634) nuclear ncRNA surveillance(GO:0071029) nuclear polyadenylation-dependent rRNA catabolic process(GO:0071035) nuclear polyadenylation-dependent ncRNA catabolic process(GO:0071046) |
| 0.0 | 0.1 | GO:2001032 | regulation of double-strand break repair via nonhomologous end joining(GO:2001032) |
| 0.0 | 0.2 | GO:0043353 | enucleate erythrocyte differentiation(GO:0043353) |
| 0.0 | 0.3 | GO:0060088 | auditory receptor cell stereocilium organization(GO:0060088) |
| 0.0 | 0.1 | GO:0070842 | aggresome assembly(GO:0070842) |
| 0.0 | 0.2 | GO:0097428 | protein maturation by iron-sulfur cluster transfer(GO:0097428) |
| 0.0 | 0.0 | GO:2000646 | positive regulation of receptor catabolic process(GO:2000646) |
| 0.0 | 0.4 | GO:0042104 | positive regulation of activated T cell proliferation(GO:0042104) |
| 0.0 | 0.0 | GO:0014029 | neural crest formation(GO:0014029) |
| 0.0 | 0.1 | GO:2000359 | regulation of binding of sperm to zona pellucida(GO:2000359) |
| 0.0 | 0.2 | GO:0010739 | positive regulation of protein kinase A signaling(GO:0010739) |
| 0.0 | 0.2 | GO:0002760 | positive regulation of antimicrobial humoral response(GO:0002760) |
| 0.0 | 0.1 | GO:0043653 | mitochondrial fragmentation involved in apoptotic process(GO:0043653) |
| 0.0 | 0.1 | GO:0007217 | tachykinin receptor signaling pathway(GO:0007217) |
| 0.0 | 0.1 | GO:0060231 | mesenchymal to epithelial transition(GO:0060231) |
| 0.0 | 0.1 | GO:0030576 | Cajal body organization(GO:0030576) |
| 0.0 | 0.0 | GO:1902174 | positive regulation of keratinocyte apoptotic process(GO:1902174) |
| 0.0 | 0.1 | GO:0007023 | post-chaperonin tubulin folding pathway(GO:0007023) |
| 0.0 | 0.4 | GO:0060338 | regulation of type I interferon-mediated signaling pathway(GO:0060338) |
| 0.0 | 0.2 | GO:0043983 | histone H4-K12 acetylation(GO:0043983) |
| 0.0 | 0.2 | GO:0007288 | sperm axoneme assembly(GO:0007288) |
| 0.0 | 0.0 | GO:0002254 | kinin cascade(GO:0002254) |
| 0.0 | 0.0 | GO:0043586 | tongue development(GO:0043586) |
| 0.0 | 0.0 | GO:0045347 | negative regulation of MHC class II biosynthetic process(GO:0045347) |
| 0.0 | 0.3 | GO:0035563 | positive regulation of chromatin binding(GO:0035563) |
| 0.0 | 0.2 | GO:0031119 | tRNA pseudouridine synthesis(GO:0031119) |
| 0.0 | 0.5 | GO:0032011 | ARF protein signal transduction(GO:0032011) regulation of ARF protein signal transduction(GO:0032012) |
| 0.0 | 0.2 | GO:0043615 | astrocyte cell migration(GO:0043615) |
| 0.0 | 0.0 | GO:0072076 | nephrogenic mesenchyme development(GO:0072076) |
| 0.0 | 0.3 | GO:2000480 | negative regulation of cAMP-dependent protein kinase activity(GO:2000480) |
| 0.0 | 0.2 | GO:0055064 | chloride ion homeostasis(GO:0055064) |
| 0.0 | 0.5 | GO:0060294 | cilium movement involved in cell motility(GO:0060294) |
| 0.0 | 0.0 | GO:0060112 | generation of ovulation cycle rhythm(GO:0060112) |
| 0.0 | 0.5 | GO:0048266 | behavioral response to pain(GO:0048266) |
| 0.0 | 0.1 | GO:0048859 | formation of anatomical boundary(GO:0048859) |
| 0.0 | 0.1 | GO:0070172 | positive regulation of tooth mineralization(GO:0070172) |
| 0.0 | 0.0 | GO:0097527 | necroptotic signaling pathway(GO:0097527) |
| 0.0 | 0.2 | GO:0030913 | paranodal junction assembly(GO:0030913) |
| 0.0 | 0.1 | GO:0070945 | neutrophil mediated killing of gram-negative bacterium(GO:0070945) |
| 0.0 | 0.0 | GO:0060830 | ciliary receptor clustering involved in smoothened signaling pathway(GO:0060830) |
| 0.0 | 0.2 | GO:0034472 | snRNA 3'-end processing(GO:0034472) |
| 0.0 | 0.0 | GO:0001907 | killing by symbiont of host cells(GO:0001907) disruption by symbiont of host cell(GO:0044004) |
| 0.0 | 0.1 | GO:0045655 | regulation of monocyte differentiation(GO:0045655) |
| 0.0 | 0.1 | GO:0061055 | myotome development(GO:0061055) |
| 0.0 | 0.2 | GO:0046598 | positive regulation of viral entry into host cell(GO:0046598) |
| 0.0 | 0.1 | GO:0018002 | N-terminal peptidyl-serine acetylation(GO:0017198) N-terminal peptidyl-glutamic acid acetylation(GO:0018002) peptidyl-serine acetylation(GO:0030920) |
| 0.0 | 0.2 | GO:0018065 | protein-cofactor linkage(GO:0018065) |
| 0.0 | 0.1 | GO:0002155 | regulation of thyroid hormone mediated signaling pathway(GO:0002155) |
| 0.0 | 0.0 | GO:0021913 | regulation of transcription from RNA polymerase II promoter involved in ventral spinal cord interneuron specification(GO:0021913) |
| 0.0 | 0.2 | GO:0007042 | lysosomal lumen acidification(GO:0007042) |
| 0.0 | 0.1 | GO:0072053 | renal inner medulla development(GO:0072053) |
| 0.0 | 0.1 | GO:0045647 | negative regulation of erythrocyte differentiation(GO:0045647) |
| 0.0 | 0.5 | GO:0042744 | hydrogen peroxide catabolic process(GO:0042744) |
| 0.0 | 0.1 | GO:0046985 | positive regulation of hemoglobin biosynthetic process(GO:0046985) |
| 0.0 | 0.4 | GO:0035162 | embryonic hemopoiesis(GO:0035162) |
| 0.0 | 0.1 | GO:0090071 | negative regulation of ribosome biogenesis(GO:0090071) |
| 0.0 | 0.0 | GO:1902534 | single-organism membrane invagination(GO:1902534) |
| 0.0 | 0.0 | GO:0042989 | sequestering of actin monomers(GO:0042989) |
| 0.0 | 0.1 | GO:0006551 | leucine metabolic process(GO:0006551) |
| 0.0 | 0.1 | GO:0070940 | dephosphorylation of RNA polymerase II C-terminal domain(GO:0070940) |
| 0.0 | 0.7 | GO:0006301 | postreplication repair(GO:0006301) |
| 0.0 | 0.2 | GO:1901550 | regulation of endothelial cell development(GO:1901550) regulation of establishment of endothelial barrier(GO:1903140) |
| 0.0 | 0.0 | GO:2000402 | negative regulation of lymphocyte migration(GO:2000402) |
| 0.0 | 0.3 | GO:0007520 | myoblast fusion(GO:0007520) |
| 0.0 | 0.1 | GO:0014870 | response to inactivity(GO:0014854) response to muscle inactivity(GO:0014870) response to muscle inactivity involved in regulation of muscle adaptation(GO:0014877) response to denervation involved in regulation of muscle adaptation(GO:0014894) |
| 0.0 | 0.3 | GO:0016322 | neuron remodeling(GO:0016322) |
| 0.0 | 0.7 | GO:0000266 | mitochondrial fission(GO:0000266) |
| 0.0 | 0.1 | GO:0042940 | D-amino acid transport(GO:0042940) |
| 0.0 | 0.2 | GO:0016056 | rhodopsin mediated signaling pathway(GO:0016056) |
| 0.0 | 0.1 | GO:0000255 | allantoin metabolic process(GO:0000255) |
| 0.0 | 0.0 | GO:1901725 | regulation of histone deacetylase activity(GO:1901725) |
| 0.0 | 0.0 | GO:0002540 | leukotriene production involved in inflammatory response(GO:0002540) |
| 0.0 | 0.1 | GO:1901165 | positive regulation of trophoblast cell migration(GO:1901165) |
| 0.0 | 0.1 | GO:0036289 | peptidyl-serine autophosphorylation(GO:0036289) |
| 0.0 | 0.3 | GO:0031163 | iron-sulfur cluster assembly(GO:0016226) metallo-sulfur cluster assembly(GO:0031163) |
| 0.0 | 0.2 | GO:0046037 | GMP metabolic process(GO:0046037) |
| 0.0 | 0.8 | GO:0045216 | cell-cell junction organization(GO:0045216) |
| 0.0 | 0.0 | GO:0014042 | positive regulation of neuron maturation(GO:0014042) |
| 0.0 | 0.5 | GO:0048013 | ephrin receptor signaling pathway(GO:0048013) |
| 0.0 | 0.0 | GO:0032290 | peripheral nervous system myelin formation(GO:0032290) |
| 0.0 | 0.1 | GO:0043568 | positive regulation of insulin-like growth factor receptor signaling pathway(GO:0043568) |
| 0.0 | 0.1 | GO:0030213 | hyaluronan biosynthetic process(GO:0030213) |
| 0.0 | 2.5 | GO:0043123 | positive regulation of I-kappaB kinase/NF-kappaB signaling(GO:0043123) |
| 0.0 | 0.2 | GO:0071257 | cellular response to electrical stimulus(GO:0071257) |
| 0.0 | 0.2 | GO:0002523 | leukocyte migration involved in inflammatory response(GO:0002523) |
| 0.0 | 0.3 | GO:0045725 | positive regulation of glycogen biosynthetic process(GO:0045725) |
| 0.0 | 0.1 | GO:0006987 | activation of signaling protein activity involved in unfolded protein response(GO:0006987) |
| 0.0 | 0.1 | GO:0015867 | ATP transport(GO:0015867) |
| 0.0 | 0.1 | GO:0018343 | protein farnesylation(GO:0018343) |
| 0.0 | 0.3 | GO:0034058 | endosomal vesicle fusion(GO:0034058) |
| 0.0 | 0.1 | GO:0042448 | progesterone metabolic process(GO:0042448) |
| 0.0 | 0.1 | GO:0051461 | positive regulation of corticotropin secretion(GO:0051461) |
| 0.0 | 0.2 | GO:0036089 | cleavage furrow formation(GO:0036089) |
| 0.0 | 0.0 | GO:0008354 | germ cell migration(GO:0008354) |
| 0.0 | 0.1 | GO:0051593 | response to folic acid(GO:0051593) |
| 0.0 | 0.1 | GO:0009093 | cysteine catabolic process(GO:0009093) L-cysteine catabolic process(GO:0019448) L-cysteine metabolic process(GO:0046439) |
| 0.0 | 0.4 | GO:0006110 | regulation of glycolytic process(GO:0006110) |
| 0.0 | 0.2 | GO:1902101 | positive regulation of mitotic metaphase/anaphase transition(GO:0045842) positive regulation of metaphase/anaphase transition of cell cycle(GO:1902101) |
| 0.0 | 0.1 | GO:0010944 | negative regulation of transcription by competitive promoter binding(GO:0010944) |
| 0.0 | 1.8 | GO:0034612 | response to tumor necrosis factor(GO:0034612) |
| 0.0 | 0.0 | GO:0031284 | positive regulation of guanylate cyclase activity(GO:0031284) |
| 0.0 | 0.6 | GO:0030514 | negative regulation of BMP signaling pathway(GO:0030514) |
| 0.0 | 2.0 | GO:0035023 | regulation of Rho protein signal transduction(GO:0035023) |
| 0.0 | 0.1 | GO:0002121 | inter-male aggressive behavior(GO:0002121) |
| 0.0 | 0.1 | GO:0034080 | CENP-A containing nucleosome assembly(GO:0034080) CENP-A containing chromatin organization(GO:0061641) |
| 0.0 | 0.1 | GO:1905216 | positive regulation of mRNA binding(GO:1902416) positive regulation of RNA binding(GO:1905216) |
| 0.0 | 0.0 | GO:0014744 | positive regulation of muscle adaptation(GO:0014744) |
| 0.0 | 0.8 | GO:0035690 | cellular response to drug(GO:0035690) |
| 0.0 | 0.1 | GO:0061213 | positive regulation of mesonephros development(GO:0061213) |
| 0.0 | 0.0 | GO:0001560 | regulation of cell growth by extracellular stimulus(GO:0001560) |
| 0.0 | 0.0 | GO:0061450 | trophoblast cell migration(GO:0061450) |
| 0.0 | 0.1 | GO:0006566 | threonine metabolic process(GO:0006566) |
| 0.0 | 0.0 | GO:0006701 | progesterone biosynthetic process(GO:0006701) |
| 0.0 | 0.0 | GO:0071492 | cellular response to UV-A(GO:0071492) |
| 0.0 | 0.2 | GO:0048012 | hepatocyte growth factor receptor signaling pathway(GO:0048012) |
| 0.0 | 0.1 | GO:0042732 | D-xylose metabolic process(GO:0042732) |
| 0.0 | 0.3 | GO:0000103 | sulfate assimilation(GO:0000103) |
| 0.0 | 0.1 | GO:0015888 | thiamine transport(GO:0015888) |
| 0.0 | 0.1 | GO:0007252 | I-kappaB phosphorylation(GO:0007252) |
| 0.0 | 0.0 | GO:0090315 | negative regulation of protein targeting to membrane(GO:0090315) |
| 0.0 | 0.3 | GO:0030593 | neutrophil chemotaxis(GO:0030593) |
| 0.0 | 0.1 | GO:0060696 | regulation of phospholipid catabolic process(GO:0060696) |
| 0.0 | 0.0 | GO:1901897 | regulation of relaxation of cardiac muscle(GO:1901897) |
| 0.0 | 0.1 | GO:0097500 | receptor localization to nonmotile primary cilium(GO:0097500) |
| 0.0 | 0.4 | GO:0003009 | skeletal muscle contraction(GO:0003009) |
| 0.0 | 0.1 | GO:0070681 | glutaminyl-tRNAGln biosynthesis via transamidation(GO:0070681) |
| 0.0 | 2.3 | GO:0007156 | homophilic cell adhesion via plasma membrane adhesion molecules(GO:0007156) |
| 0.0 | 0.1 | GO:0090261 | positive regulation of inclusion body assembly(GO:0090261) |
| 0.0 | 0.1 | GO:0046716 | muscle cell cellular homeostasis(GO:0046716) |
| 0.0 | 0.1 | GO:0048496 | maintenance of organ identity(GO:0048496) |
| 0.0 | 0.1 | GO:0061154 | endothelial tube morphogenesis(GO:0061154) |
| 0.0 | 0.1 | GO:0033762 | response to glucagon(GO:0033762) |
| 0.0 | 0.1 | GO:0002727 | natural killer cell cytokine production(GO:0002370) regulation of natural killer cell cytokine production(GO:0002727) |
| 0.0 | 0.1 | GO:1901030 | positive regulation of mitochondrial outer membrane permeabilization involved in apoptotic signaling pathway(GO:1901030) |
| 0.0 | 0.0 | GO:0031282 | regulation of guanylate cyclase activity(GO:0031282) |
| 0.0 | 0.1 | GO:1903543 | regulation of exosomal secretion(GO:1903541) positive regulation of exosomal secretion(GO:1903543) |
| 0.0 | 0.0 | GO:0050968 | detection of chemical stimulus involved in sensory perception of pain(GO:0050968) |
| 0.0 | 0.1 | GO:0042414 | epinephrine metabolic process(GO:0042414) |
| 0.0 | 0.2 | GO:0051481 | negative regulation of cytosolic calcium ion concentration(GO:0051481) |
| 0.0 | 0.1 | GO:0042992 | negative regulation of transcription factor import into nucleus(GO:0042992) |
| 0.0 | 0.0 | GO:0070375 | ERK5 cascade(GO:0070375) |
| 0.0 | 0.1 | GO:0090074 | negative regulation of protein homodimerization activity(GO:0090074) |
| 0.0 | 0.1 | GO:1902410 | mitotic cytokinetic process(GO:1902410) |
| 0.0 | 0.1 | GO:0090230 | regulation of centromere complex assembly(GO:0090230) |
| 0.0 | 0.0 | GO:0021773 | striatal medium spiny neuron differentiation(GO:0021773) |
| 0.0 | 0.2 | GO:0015858 | nucleoside transport(GO:0015858) |
| 0.0 | 0.2 | GO:0031053 | primary miRNA processing(GO:0031053) |
| 0.0 | 0.1 | GO:0045213 | neurotransmitter receptor metabolic process(GO:0045213) |
| 0.0 | 0.0 | GO:0051142 | regulation of NK T cell proliferation(GO:0051140) positive regulation of NK T cell proliferation(GO:0051142) |
| 0.0 | 0.1 | GO:0010310 | regulation of hydrogen peroxide metabolic process(GO:0010310) |
| 0.0 | 0.1 | GO:0060468 | prevention of polyspermy(GO:0060468) |
| 0.0 | 0.2 | GO:0017196 | N-terminal peptidyl-methionine acetylation(GO:0017196) |
| 0.0 | 0.1 | GO:0008295 | spermidine biosynthetic process(GO:0008295) |
| 0.0 | 0.1 | GO:0046010 | positive regulation of circadian sleep/wake cycle, non-REM sleep(GO:0046010) |
| 0.0 | 0.1 | GO:0090031 | positive regulation of steroid hormone biosynthetic process(GO:0090031) |
| 0.0 | 0.3 | GO:0052697 | xenobiotic glucuronidation(GO:0052697) |
| 0.0 | 0.1 | GO:0021637 | trigeminal nerve morphogenesis(GO:0021636) trigeminal nerve structural organization(GO:0021637) |
| 0.0 | 0.1 | GO:0006167 | AMP biosynthetic process(GO:0006167) |
| 0.0 | 0.2 | GO:0044804 | nucleophagy(GO:0044804) |
| 0.0 | 0.3 | GO:0043551 | regulation of phosphatidylinositol 3-kinase activity(GO:0043551) |
| 0.0 | 0.0 | GO:1901252 | regulation of intracellular transport of viral material(GO:1901252) |
| 0.0 | 0.2 | GO:0061732 | mitochondrial acetyl-CoA biosynthetic process from pyruvate(GO:0061732) |
| 0.0 | 0.1 | GO:0010528 | regulation of transposition(GO:0010528) negative regulation of transposition(GO:0010529) |
| 0.0 | 0.1 | GO:0033630 | positive regulation of cell adhesion mediated by integrin(GO:0033630) |
| 0.0 | 0.4 | GO:0006904 | vesicle docking involved in exocytosis(GO:0006904) |
| 0.0 | 0.2 | GO:0030225 | macrophage differentiation(GO:0030225) |
| 0.0 | 0.1 | GO:0009624 | response to nematode(GO:0009624) |
| 0.0 | 0.1 | GO:0090383 | phagosome acidification(GO:0090383) |
| 0.0 | 0.2 | GO:0035269 | protein O-linked mannosylation(GO:0035269) |
| 0.0 | 0.1 | GO:0032229 | negative regulation of synaptic transmission, GABAergic(GO:0032229) |
| 0.0 | 0.1 | GO:0007258 | JUN phosphorylation(GO:0007258) |
| 0.0 | 0.2 | GO:1904294 | positive regulation of ERAD pathway(GO:1904294) |
| 0.0 | 0.0 | GO:2000074 | regulation of type B pancreatic cell development(GO:2000074) |
| 0.0 | 0.2 | GO:0090166 | Golgi disassembly(GO:0090166) |
| 0.0 | 0.0 | GO:1901970 | positive regulation of mitotic sister chromatid separation(GO:1901970) |
| 0.0 | 0.1 | GO:0006930 | substrate-dependent cell migration, cell extension(GO:0006930) |
| 0.0 | 0.1 | GO:0019720 | Mo-molybdopterin cofactor biosynthetic process(GO:0006777) Mo-molybdopterin cofactor metabolic process(GO:0019720) molybdopterin cofactor biosynthetic process(GO:0032324) molybdopterin cofactor metabolic process(GO:0043545) prosthetic group metabolic process(GO:0051189) |
| 0.0 | 0.1 | GO:0033152 | immunoglobulin V(D)J recombination(GO:0033152) |
| 0.0 | 0.1 | GO:0043031 | negative regulation of macrophage activation(GO:0043031) |
| 0.0 | 0.1 | GO:0003093 | regulation of glomerular filtration(GO:0003093) |
| 0.0 | 0.1 | GO:0033483 | gas homeostasis(GO:0033483) |
| 0.0 | 0.1 | GO:1903912 | negative regulation of endoplasmic reticulum stress-induced eIF2 alpha phosphorylation(GO:1903912) |
| 0.0 | 0.1 | GO:0021569 | rhombomere 3 development(GO:0021569) |
| 0.0 | 0.1 | GO:0040031 | snRNA modification(GO:0040031) |
| 0.0 | 0.0 | GO:0021615 | glossopharyngeal nerve development(GO:0021563) glossopharyngeal nerve morphogenesis(GO:0021615) |
| 0.0 | 0.1 | GO:0033578 | protein glycosylation in Golgi(GO:0033578) |
| 0.0 | 0.2 | GO:0071361 | cellular response to ethanol(GO:0071361) |
| 0.0 | 0.1 | GO:0006600 | creatine metabolic process(GO:0006600) |
| 0.0 | 0.1 | GO:1904262 | negative regulation of TORC1 signaling(GO:1904262) |
| 0.0 | 0.1 | GO:0019478 | D-amino acid catabolic process(GO:0019478) |
| 0.0 | 0.1 | GO:0097421 | liver regeneration(GO:0097421) |
| 0.0 | 0.2 | GO:0006098 | pentose-phosphate shunt(GO:0006098) |
| 0.0 | 0.0 | GO:0044375 | regulation of peroxisome size(GO:0044375) |
| 0.0 | 0.0 | GO:0000820 | regulation of glutamine family amino acid metabolic process(GO:0000820) |
| 0.0 | 0.0 | GO:0044803 | multi-organism membrane organization(GO:0044803) |
| 0.0 | 0.1 | GO:0033314 | mitotic DNA replication checkpoint(GO:0033314) |
| 0.0 | 0.2 | GO:0001953 | negative regulation of cell-matrix adhesion(GO:0001953) |
| 0.0 | 0.3 | GO:0051016 | barbed-end actin filament capping(GO:0051016) |
| 0.0 | 0.2 | GO:0007625 | grooming behavior(GO:0007625) |
| 0.0 | 0.3 | GO:0036158 | outer dynein arm assembly(GO:0036158) |
| 0.0 | 0.1 | GO:0043517 | positive regulation of DNA damage response, signal transduction by p53 class mediator(GO:0043517) |
| 0.0 | 0.0 | GO:0045896 | regulation of transcription during mitosis(GO:0045896) positive regulation of transcription during mitosis(GO:0045897) |
| 0.0 | 0.0 | GO:2000765 | regulation of cytoplasmic translation(GO:2000765) |
| 0.0 | 0.0 | GO:1903800 | positive regulation of production of miRNAs involved in gene silencing by miRNA(GO:1903800) |
| 0.0 | 0.1 | GO:0032957 | inositol trisphosphate metabolic process(GO:0032957) |
| 0.0 | 0.1 | GO:0060850 | regulation of transcription involved in cell fate commitment(GO:0060850) |
| 0.0 | 0.1 | GO:0006438 | valyl-tRNA aminoacylation(GO:0006438) |
| 0.0 | 0.2 | GO:0007063 | regulation of sister chromatid cohesion(GO:0007063) |
| 0.0 | 0.4 | GO:0034587 | piRNA metabolic process(GO:0034587) |
| 0.0 | 0.1 | GO:0031666 | positive regulation of lipopolysaccharide-mediated signaling pathway(GO:0031666) |
| 0.0 | 0.0 | GO:0035729 | response to hepatocyte growth factor(GO:0035728) cellular response to hepatocyte growth factor stimulus(GO:0035729) |
| 0.0 | 0.1 | GO:2000353 | positive regulation of endothelial cell apoptotic process(GO:2000353) |
| 0.0 | 0.0 | GO:2000484 | positive regulation of interleukin-8 secretion(GO:2000484) |
| 0.0 | 0.1 | GO:0043162 | ubiquitin-dependent protein catabolic process via the multivesicular body sorting pathway(GO:0043162) |
| 0.0 | 0.0 | GO:0072215 | regulation of metanephros development(GO:0072215) |
| 0.0 | 0.1 | GO:0097680 | double-strand break repair via classical nonhomologous end joining(GO:0097680) |
| 0.0 | 0.4 | GO:1900087 | positive regulation of G1/S transition of mitotic cell cycle(GO:1900087) |
| 0.0 | 0.1 | GO:0002043 | blood vessel endothelial cell proliferation involved in sprouting angiogenesis(GO:0002043) |
| 0.0 | 0.1 | GO:0035609 | C-terminal protein deglutamylation(GO:0035609) |
| 0.0 | 0.0 | GO:1905214 | regulation of mRNA binding(GO:1902415) regulation of RNA binding(GO:1905214) |
| 0.0 | 0.0 | GO:0045085 | negative regulation of interleukin-2 biosynthetic process(GO:0045085) |
| 0.0 | 0.0 | GO:0060126 | somatotropin secreting cell differentiation(GO:0060126) |
| 0.0 | 0.0 | GO:0002924 | negative regulation of humoral immune response mediated by circulating immunoglobulin(GO:0002924) |
| 0.0 | 0.1 | GO:0006435 | threonyl-tRNA aminoacylation(GO:0006435) |
| 0.0 | 0.1 | GO:2001224 | positive regulation of neuron migration(GO:2001224) |
| 0.0 | 0.1 | GO:0033566 | gamma-tubulin complex localization(GO:0033566) |
| 0.0 | 0.0 | GO:0097374 | sensory neuron axon guidance(GO:0097374) |
| 0.0 | 0.2 | GO:0003081 | regulation of systemic arterial blood pressure by renin-angiotensin(GO:0003081) |
| 0.0 | 0.1 | GO:0061727 | methylglyoxal catabolic process to D-lactate via S-lactoyl-glutathione(GO:0019243) methylglyoxal catabolic process(GO:0051596) methylglyoxal catabolic process to lactate(GO:0061727) |
| 0.0 | 0.0 | GO:0039532 | negative regulation of viral-induced cytoplasmic pattern recognition receptor signaling pathway(GO:0039532) |
| 0.0 | 0.1 | GO:0042756 | drinking behavior(GO:0042756) |
| 0.0 | 0.0 | GO:1904751 | regulation of protein localization to nucleolus(GO:1904749) positive regulation of protein localization to nucleolus(GO:1904751) |
| 0.0 | 0.2 | GO:0034143 | regulation of toll-like receptor 4 signaling pathway(GO:0034143) |
| 0.0 | 0.1 | GO:0051546 | keratinocyte migration(GO:0051546) |
| 0.0 | 0.1 | GO:0048265 | response to pain(GO:0048265) |
| 0.0 | 0.2 | GO:0048671 | negative regulation of collateral sprouting(GO:0048671) |
| 0.0 | 0.1 | GO:0009125 | nucleoside monophosphate catabolic process(GO:0009125) |
| 0.0 | 0.0 | GO:0014049 | positive regulation of glutamate secretion(GO:0014049) |
| 0.0 | 0.0 | GO:0070537 | histone H2A K63-linked deubiquitination(GO:0070537) |
| 0.0 | 0.1 | GO:0032988 | ribonucleoprotein complex disassembly(GO:0032988) |
| 0.0 | 0.0 | GO:0060312 | regulation of blood vessel remodeling(GO:0060312) |
| 0.0 | 0.1 | GO:0006003 | fructose 2,6-bisphosphate metabolic process(GO:0006003) |
| 0.0 | 0.0 | GO:0046084 | adenine metabolic process(GO:0046083) adenine biosynthetic process(GO:0046084) |
| 0.0 | 0.5 | GO:0045600 | positive regulation of fat cell differentiation(GO:0045600) |
| 0.0 | 0.1 | GO:1902237 | positive regulation of endoplasmic reticulum stress-induced intrinsic apoptotic signaling pathway(GO:1902237) |
| 0.0 | 0.2 | GO:0036065 | fucosylation(GO:0036065) |
| 0.0 | 0.0 | GO:0060414 | aorta smooth muscle tissue morphogenesis(GO:0060414) |
| 0.0 | 0.4 | GO:0043616 | keratinocyte proliferation(GO:0043616) |
| 0.0 | 0.0 | GO:0014719 | regulation of satellite cell activation involved in skeletal muscle regeneration(GO:0014717) skeletal muscle satellite cell activation(GO:0014719) satellite cell activation involved in skeletal muscle regeneration(GO:0014901) |
| 0.0 | 1.3 | GO:0007160 | cell-matrix adhesion(GO:0007160) |
| 0.0 | 0.0 | GO:0007171 | activation of transmembrane receptor protein tyrosine kinase activity(GO:0007171) |
| 0.0 | 0.1 | GO:0071243 | cellular response to arsenic-containing substance(GO:0071243) |
| 0.0 | 0.0 | GO:0045345 | MHC class I biosynthetic process(GO:0045341) regulation of MHC class I biosynthetic process(GO:0045343) positive regulation of MHC class I biosynthetic process(GO:0045345) |
| 0.0 | 0.0 | GO:1904948 | midbrain dopaminergic neuron differentiation(GO:1904948) |
| 0.0 | 0.1 | GO:0070125 | mitochondrial translational elongation(GO:0070125) |
| 0.0 | 0.1 | GO:0061084 | negative regulation of protein refolding(GO:0061084) |
| 0.0 | 0.0 | GO:0003085 | negative regulation of systemic arterial blood pressure(GO:0003085) |
| 0.0 | 0.1 | GO:0006663 | platelet activating factor biosynthetic process(GO:0006663) platelet activating factor metabolic process(GO:0046469) |
| 0.0 | 0.1 | GO:0048935 | peripheral nervous system neuron differentiation(GO:0048934) peripheral nervous system neuron development(GO:0048935) |
| 0.0 | 0.1 | GO:0006086 | acetyl-CoA biosynthetic process from pyruvate(GO:0006086) |
| 0.0 | 0.1 | GO:0009083 | branched-chain amino acid catabolic process(GO:0009083) |
| 0.0 | 0.1 | GO:0046784 | viral mRNA export from host cell nucleus(GO:0046784) |
| 0.0 | 0.1 | GO:0070544 | histone H3-K36 demethylation(GO:0070544) |
| 0.0 | 0.3 | GO:0043968 | histone H2A acetylation(GO:0043968) |
| 0.0 | 0.3 | GO:0035094 | response to nicotine(GO:0035094) |
| 0.0 | 0.1 | GO:0048304 | positive regulation of isotype switching to IgG isotypes(GO:0048304) |
| 0.0 | 0.0 | GO:0034441 | plasma lipoprotein particle oxidation(GO:0034441) |
| 0.0 | 0.0 | GO:0035405 | histone-threonine phosphorylation(GO:0035405) |
| 0.0 | 0.0 | GO:0071883 | activation of MAPK activity by adrenergic receptor signaling pathway(GO:0071883) |
| 0.0 | 0.2 | GO:1901070 | GTP biosynthetic process(GO:0006183) guanosine-containing compound biosynthetic process(GO:1901070) |
| 0.0 | 0.0 | GO:0086028 | bundle of His cell to Purkinje myocyte signaling(GO:0086028) bundle of His cell action potential(GO:0086043) |
| 0.0 | 0.1 | GO:0045039 | protein import into mitochondrial inner membrane(GO:0045039) |
| 0.0 | 0.7 | GO:0045727 | positive regulation of translation(GO:0045727) |
| 0.0 | 0.0 | GO:0002426 | immunoglobulin production in mucosal tissue(GO:0002426) |
| 0.0 | 0.1 | GO:0035948 | positive regulation of gluconeogenesis by positive regulation of transcription from RNA polymerase II promoter(GO:0035948) |
| 0.0 | 0.1 | GO:1902187 | negative regulation of viral release from host cell(GO:1902187) |
| 0.0 | 0.0 | GO:0086011 | membrane repolarization during action potential(GO:0086011) membrane repolarization during cardiac muscle cell action potential(GO:0086013) |
| 0.0 | 0.0 | GO:0006004 | fucose metabolic process(GO:0006004) |
| 0.0 | 0.1 | GO:0005980 | glycogen catabolic process(GO:0005980) glucan catabolic process(GO:0009251) cellular polysaccharide catabolic process(GO:0044247) |
| 0.0 | 0.0 | GO:0048291 | isotype switching to IgG isotypes(GO:0048291) |
| 0.0 | 0.0 | GO:2000382 | positive regulation of mesoderm development(GO:2000382) |
| 0.0 | 0.0 | GO:0035934 | corticosterone secretion(GO:0035934) regulation of corticosterone secretion(GO:2000852) |
| 0.0 | 0.0 | GO:0071294 | cellular response to zinc ion(GO:0071294) |
| 0.0 | 0.2 | GO:0042246 | tissue regeneration(GO:0042246) |
| 0.0 | 0.0 | GO:0046643 | regulation of gamma-delta T cell differentiation(GO:0045586) regulation of gamma-delta T cell activation(GO:0046643) |
| 0.0 | 0.1 | GO:0016576 | histone dephosphorylation(GO:0016576) |
| 0.0 | 0.1 | GO:0016926 | protein desumoylation(GO:0016926) |
| 0.0 | 0.0 | GO:0021571 | rhombomere 5 development(GO:0021571) |
| 0.0 | 0.1 | GO:1900194 | negative regulation of oocyte development(GO:0060283) negative regulation of oocyte maturation(GO:1900194) |
| 0.0 | 0.0 | GO:2001206 | positive regulation of osteoclast development(GO:2001206) |
| 0.0 | 0.0 | GO:0007195 | adenylate cyclase-inhibiting dopamine receptor signaling pathway(GO:0007195) |
| 0.0 | 0.1 | GO:0046831 | regulation of RNA export from nucleus(GO:0046831) |
| 0.0 | 0.5 | GO:0006406 | mRNA export from nucleus(GO:0006406) mRNA-containing ribonucleoprotein complex export from nucleus(GO:0071427) |
| 0.0 | 0.1 | GO:0014904 | myotube cell development(GO:0014904) |
| 0.0 | 0.1 | GO:0015809 | arginine transport(GO:0015809) |
| 0.0 | 0.1 | GO:0051574 | positive regulation of histone H3-K9 methylation(GO:0051574) |
| 0.0 | 0.1 | GO:0036230 | granulocyte activation(GO:0036230) |
| 0.0 | 0.0 | GO:0040038 | polar body extrusion after meiotic divisions(GO:0040038) |
| 0.0 | 0.1 | GO:0006685 | sphingomyelin catabolic process(GO:0006685) |
| 0.0 | 0.1 | GO:0003203 | endocardial cushion morphogenesis(GO:0003203) |
| 0.0 | 0.0 | GO:0060618 | nipple development(GO:0060618) |
| 0.0 | 0.1 | GO:0010155 | regulation of proton transport(GO:0010155) |
| 0.0 | 0.1 | GO:0032785 | negative regulation of DNA-templated transcription, elongation(GO:0032785) |
| 0.0 | 0.1 | GO:0002361 | CD4-positive, CD25-positive, alpha-beta regulatory T cell differentiation(GO:0002361) |
| 0.0 | 0.1 | GO:0019471 | 4-hydroxyproline metabolic process(GO:0019471) |
| 0.0 | 0.1 | GO:0014041 | regulation of neuron maturation(GO:0014041) |
| 0.0 | 0.0 | GO:1900107 | regulation of nodal signaling pathway(GO:1900107) negative regulation of nodal signaling pathway(GO:1900108) |
| 0.0 | 0.0 | GO:0015874 | norepinephrine transport(GO:0015874) |
| 0.0 | 0.2 | GO:0051127 | positive regulation of actin nucleation(GO:0051127) |
| 0.0 | 0.1 | GO:0097186 | amelogenesis(GO:0097186) |
| 0.0 | 0.0 | GO:0014055 | acetylcholine secretion, neurotransmission(GO:0014055) regulation of acetylcholine secretion, neurotransmission(GO:0014056) |
| 0.0 | 0.1 | GO:1902047 | polyamine transport(GO:0015846) polyamine transmembrane transport(GO:1902047) regulation of polyamine transmembrane transport(GO:1902267) |
| 0.0 | 0.1 | GO:0039531 | regulation of viral-induced cytoplasmic pattern recognition receptor signaling pathway(GO:0039531) |
| 0.0 | 0.1 | GO:0045945 | positive regulation of transcription from RNA polymerase III promoter(GO:0045945) |
| 0.0 | 0.1 | GO:0051974 | negative regulation of telomerase activity(GO:0051974) |
| 0.0 | 0.2 | GO:0042572 | retinol metabolic process(GO:0042572) |
| 0.0 | 0.0 | GO:0048368 | lateral mesoderm development(GO:0048368) |
| 0.0 | 0.0 | GO:0032202 | telomere assembly(GO:0032202) |
| 0.0 | 0.4 | GO:0042446 | hormone biosynthetic process(GO:0042446) |
| 0.0 | 0.0 | GO:0070947 | neutrophil mediated killing of fungus(GO:0070947) |
| 0.0 | 0.1 | GO:0044146 | negative regulation of growth of symbiont in host(GO:0044130) negative regulation of growth of symbiont involved in interaction with host(GO:0044146) |
| 0.0 | 0.0 | GO:2000650 | negative regulation of sodium ion transmembrane transporter activity(GO:2000650) |
| 0.0 | 0.1 | GO:0000160 | phosphorelay signal transduction system(GO:0000160) |
| 0.0 | 0.0 | GO:0015712 | hexose phosphate transport(GO:0015712) glucose-6-phosphate transport(GO:0015760) |
| 0.0 | 0.0 | GO:0022615 | protein to membrane docking(GO:0022615) |
| 0.0 | 0.1 | GO:0002097 | tRNA wobble base modification(GO:0002097) |
| 0.0 | 0.1 | GO:0002710 | negative regulation of T cell mediated immunity(GO:0002710) |
| 0.0 | 0.0 | GO:0035461 | vitamin transmembrane transport(GO:0035461) |
| 0.0 | 0.0 | GO:0006420 | arginyl-tRNA aminoacylation(GO:0006420) |
| 0.0 | 0.1 | GO:0051281 | positive regulation of release of sequestered calcium ion into cytosol(GO:0051281) |
| 0.0 | 0.2 | GO:0071539 | protein localization to centrosome(GO:0071539) |
| 0.0 | 0.0 | GO:0009214 | cyclic nucleotide catabolic process(GO:0009214) |
| 0.0 | 0.0 | GO:0006543 | glutamine catabolic process(GO:0006543) |
| 0.0 | 0.1 | GO:0009250 | glycogen biosynthetic process(GO:0005978) glucan biosynthetic process(GO:0009250) |
| 0.0 | 0.1 | GO:0072526 | pyridine-containing compound catabolic process(GO:0072526) |
| 0.0 | 0.0 | GO:0042866 | pyruvate biosynthetic process(GO:0042866) |
| 0.0 | 0.0 | GO:0051970 | negative regulation of transmission of nerve impulse(GO:0051970) |
| 0.0 | 0.3 | GO:0003333 | amino acid transmembrane transport(GO:0003333) |
| 0.0 | 0.4 | GO:0035773 | insulin secretion involved in cellular response to glucose stimulus(GO:0035773) |
| 0.0 | 0.1 | GO:0002026 | regulation of the force of heart contraction(GO:0002026) |
| 0.0 | 0.0 | GO:0010614 | negative regulation of cardiac muscle hypertrophy(GO:0010614) |
| 0.0 | 0.1 | GO:0070327 | thyroid hormone transport(GO:0070327) |
| 0.0 | 0.0 | GO:0045409 | negative regulation of interleukin-6 biosynthetic process(GO:0045409) |
| 0.0 | 0.0 | GO:0032287 | peripheral nervous system myelin maintenance(GO:0032287) |
| 0.0 | 0.0 | GO:0019230 | proprioception(GO:0019230) |
| 0.0 | 0.0 | GO:0036016 | response to interleukin-3(GO:0036015) cellular response to interleukin-3(GO:0036016) |
| 0.0 | 0.1 | GO:0045739 | positive regulation of DNA repair(GO:0045739) |
| 0.0 | 0.0 | GO:0015889 | cobalamin transport(GO:0015889) |
| 0.0 | 0.0 | GO:0032196 | transposition(GO:0032196) |
| 0.0 | 0.1 | GO:0070050 | neuron cellular homeostasis(GO:0070050) |
| 0.0 | 0.1 | GO:0043046 | DNA methylation involved in gamete generation(GO:0043046) |
| 0.0 | 0.0 | GO:0006419 | alanyl-tRNA aminoacylation(GO:0006419) |
| 0.0 | 0.1 | GO:0035881 | amacrine cell differentiation(GO:0035881) |
| 0.0 | 0.0 | GO:0043569 | negative regulation of insulin-like growth factor receptor signaling pathway(GO:0043569) |
| 0.0 | 0.0 | GO:0043152 | induction of bacterial agglutination(GO:0043152) |
| 0.0 | 0.0 | GO:0070317 | negative regulation of G0 to G1 transition(GO:0070317) |
| 0.0 | 0.0 | GO:0055098 | response to low-density lipoprotein particle(GO:0055098) |
| 0.0 | 0.0 | GO:1903012 | positive regulation of bone development(GO:1903012) |
| 0.0 | 0.0 | GO:0075525 | viral translational termination-reinitiation(GO:0075525) |
| 0.0 | 0.0 | GO:0051388 | positive regulation of neurotrophin TRK receptor signaling pathway(GO:0051388) |
| 0.0 | 0.0 | GO:0006382 | adenosine to inosine editing(GO:0006382) |
| 0.0 | 0.0 | GO:0045792 | negative regulation of cell size(GO:0045792) |
| 0.0 | 0.0 | GO:0071545 | inositol phosphate catabolic process(GO:0071545) |
| 0.0 | 0.0 | GO:0060573 | ventral spinal cord interneuron specification(GO:0021521) cell fate specification involved in pattern specification(GO:0060573) |
| 0.0 | 0.0 | GO:1902445 | regulation of mitochondrial membrane permeability involved in programmed necrotic cell death(GO:1902445) |
| 0.0 | 0.2 | GO:0001779 | natural killer cell differentiation(GO:0001779) |
| 0.0 | 0.1 | GO:0032366 | intracellular sterol transport(GO:0032366) |
| 0.0 | 0.1 | GO:0001867 | complement activation, lectin pathway(GO:0001867) |
| 0.0 | 0.1 | GO:0033299 | secretion of lysosomal enzymes(GO:0033299) |
| 0.0 | 0.3 | GO:0035082 | axoneme assembly(GO:0035082) |
| 0.0 | 0.0 | GO:1902430 | negative regulation of beta-amyloid formation(GO:1902430) |
| 0.0 | 0.0 | GO:0042518 | negative regulation of tyrosine phosphorylation of Stat3 protein(GO:0042518) |
| 0.0 | 0.0 | GO:0051917 | regulation of fibrinolysis(GO:0051917) |
| 0.0 | 0.0 | GO:0032815 | negative regulation of natural killer cell activation(GO:0032815) |
| 0.0 | 0.1 | GO:0007144 | female meiosis I(GO:0007144) |
| 0.0 | 0.0 | GO:1903333 | negative regulation of protein folding(GO:1903333) |
| 0.0 | 0.0 | GO:0009233 | menaquinone metabolic process(GO:0009233) |
| 0.0 | 0.1 | GO:0060712 | spongiotrophoblast layer development(GO:0060712) |
| 0.0 | 0.0 | GO:1901029 | negative regulation of mitochondrial outer membrane permeabilization involved in apoptotic signaling pathway(GO:1901029) |
| 0.0 | 0.0 | GO:0090206 | negative regulation of cholesterol biosynthetic process(GO:0045541) negative regulation of cholesterol metabolic process(GO:0090206) |
| 0.0 | 0.1 | GO:0033561 | regulation of water loss via skin(GO:0033561) |
| 0.0 | 0.1 | GO:0010890 | positive regulation of sequestering of triglyceride(GO:0010890) |
| 0.0 | 0.0 | GO:0015879 | carnitine transport(GO:0015879) |
| 0.0 | 0.0 | GO:0006681 | galactosylceramide metabolic process(GO:0006681) |
| 0.0 | 0.0 | GO:0036481 | intrinsic apoptotic signaling pathway in response to hydrogen peroxide(GO:0036481) |
| 0.0 | 0.0 | GO:0035510 | DNA dealkylation(GO:0035510) |
| 0.0 | 0.1 | GO:0003016 | respiratory system process(GO:0003016) |
| 0.0 | 0.0 | GO:2000483 | negative regulation of interleukin-8 secretion(GO:2000483) |
| 0.0 | 0.0 | GO:1990144 | regulation of hypoxia-induced intrinsic apoptotic signaling pathway(GO:1903297) negative regulation of hypoxia-induced intrinsic apoptotic signaling pathway(GO:1903298) intrinsic apoptotic signaling pathway in response to hypoxia(GO:1990144) |
| 0.0 | 0.0 | GO:0035434 | copper ion transmembrane transport(GO:0035434) |
| 0.0 | 0.0 | GO:1904491 | protein localization to ciliary transition zone(GO:1904491) |
| 0.0 | 0.0 | GO:0035815 | positive regulation of renal sodium excretion(GO:0035815) |
| 0.0 | 0.0 | GO:0090210 | regulation of establishment of blood-brain barrier(GO:0090210) |
| 0.0 | 0.1 | GO:0061298 | retina vasculature development in camera-type eye(GO:0061298) |
| 0.0 | 0.3 | GO:0002181 | cytoplasmic translation(GO:0002181) |
| 0.0 | 0.0 | GO:0048739 | cardiac muscle fiber development(GO:0048739) |
| 0.0 | 0.3 | GO:0014020 | primary neural tube formation(GO:0014020) |
| 0.0 | 0.2 | GO:0046427 | positive regulation of JAK-STAT cascade(GO:0046427) positive regulation of STAT cascade(GO:1904894) |
| 0.0 | 0.0 | GO:0016561 | protein import into peroxisome matrix, translocation(GO:0016561) |
| 0.0 | 0.0 | GO:0000707 | meiotic DNA recombinase assembly(GO:0000707) |
| 0.0 | 0.2 | GO:0006635 | fatty acid beta-oxidation(GO:0006635) |
| 0.0 | 0.0 | GO:1903361 | protein localization to basolateral plasma membrane(GO:1903361) |
| 0.0 | 0.0 | GO:1903963 | arachidonic acid secretion(GO:0050482) arachidonate transport(GO:1903963) |
| 0.0 | 0.0 | GO:0006498 | N-terminal protein lipidation(GO:0006498) |
| 0.0 | 0.0 | GO:2000210 | positive regulation of anoikis(GO:2000210) |
| 0.0 | 0.2 | GO:0010324 | membrane invagination(GO:0010324) |
| 0.0 | 0.0 | GO:0051890 | regulation of cardioblast differentiation(GO:0051890) |
| 0.0 | 0.0 | GO:0031915 | positive regulation of synaptic plasticity(GO:0031915) |
| 0.0 | 0.0 | GO:0014012 | peripheral nervous system axon regeneration(GO:0014012) |
| 0.0 | 0.0 | GO:0045636 | positive regulation of melanocyte differentiation(GO:0045636) positive regulation of developmental pigmentation(GO:0048087) positive regulation of pigment cell differentiation(GO:0050942) |
| 0.0 | 0.0 | GO:0032747 | positive regulation of interleukin-23 production(GO:0032747) |
| 0.0 | 0.3 | GO:0032091 | negative regulation of protein binding(GO:0032091) |
| 0.0 | 0.1 | GO:0002251 | organ or tissue specific immune response(GO:0002251) mucosal immune response(GO:0002385) |
| 0.0 | 0.1 | GO:0036342 | post-anal tail morphogenesis(GO:0036342) |
| 0.0 | 0.0 | GO:1902473 | regulation of protein localization to synapse(GO:1902473) |
| 0.0 | 0.1 | GO:0060736 | prostate gland growth(GO:0060736) |
| 0.0 | 0.0 | GO:0060087 | relaxation of vascular smooth muscle(GO:0060087) |
| 0.0 | 0.1 | GO:0032007 | negative regulation of TOR signaling(GO:0032007) |
| 0.0 | 0.0 | GO:0070535 | histone H2A K63-linked ubiquitination(GO:0070535) |
| 0.0 | 0.0 | GO:0046070 | dGTP metabolic process(GO:0046070) |
| 0.0 | 0.1 | GO:0002089 | lens morphogenesis in camera-type eye(GO:0002089) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 1.3 | 4.0 | GO:1990597 | AIP1-IRE1 complex(GO:1990597) |
| 0.6 | 2.4 | GO:0070032 | synaptobrevin 2-SNAP-25-syntaxin-1a-complexin I complex(GO:0070032) |
| 0.5 | 2.8 | GO:0098645 | collagen type IV trimer(GO:0005587) network-forming collagen trimer(GO:0098642) collagen network(GO:0098645) basement membrane collagen trimer(GO:0098651) |
| 0.5 | 1.4 | GO:0097513 | myosin II filament(GO:0097513) |
| 0.4 | 1.3 | GO:0043293 | apoptosome(GO:0043293) |
| 0.3 | 1.3 | GO:0071141 | SMAD protein complex(GO:0071141) |
| 0.3 | 0.9 | GO:0002193 | MAML1-RBP-Jkappa- ICN1 complex(GO:0002193) |
| 0.3 | 2.7 | GO:0071439 | clathrin complex(GO:0071439) |
| 0.3 | 2.5 | GO:0012510 | trans-Golgi network transport vesicle membrane(GO:0012510) |
| 0.3 | 1.3 | GO:0045098 | type III intermediate filament(GO:0045098) |
| 0.2 | 2.0 | GO:0005861 | troponin complex(GO:0005861) |
| 0.2 | 2.2 | GO:0097539 | ciliary transition fiber(GO:0097539) |
| 0.2 | 2.6 | GO:0001527 | microfibril(GO:0001527) |
| 0.2 | 0.9 | GO:0035189 | Rb-E2F complex(GO:0035189) |
| 0.2 | 1.1 | GO:0005927 | muscle tendon junction(GO:0005927) |
| 0.2 | 0.6 | GO:0005945 | 6-phosphofructokinase complex(GO:0005945) |
| 0.2 | 0.4 | GO:0034679 | integrin alpha9-beta1 complex(GO:0034679) |
| 0.2 | 1.7 | GO:0032045 | guanyl-nucleotide exchange factor complex(GO:0032045) |
| 0.2 | 0.2 | GO:0071664 | catenin-TCF7L2 complex(GO:0071664) |
| 0.2 | 0.5 | GO:0005899 | insulin receptor complex(GO:0005899) |
| 0.2 | 0.2 | GO:0097149 | centralspindlin complex(GO:0097149) |
| 0.2 | 2.6 | GO:0097038 | perinuclear endoplasmic reticulum(GO:0097038) |
| 0.2 | 1.9 | GO:0005641 | nuclear envelope lumen(GO:0005641) |
| 0.2 | 0.5 | GO:0070110 | ciliary neurotrophic factor receptor complex(GO:0070110) |
| 0.2 | 0.5 | GO:0016342 | catenin complex(GO:0016342) |
| 0.1 | 0.6 | GO:0097651 | phosphatidylinositol 3-kinase complex, class I(GO:0097651) |
| 0.1 | 0.6 | GO:1990851 | Wnt-Frizzled-LRP5/6 complex(GO:1990851) |
| 0.1 | 2.9 | GO:0005605 | basal lamina(GO:0005605) |
| 0.1 | 1.6 | GO:0035102 | PRC1 complex(GO:0035102) |
| 0.1 | 2.5 | GO:0016327 | apicolateral plasma membrane(GO:0016327) |
| 0.1 | 1.8 | GO:0032433 | filopodium tip(GO:0032433) |
| 0.1 | 0.8 | GO:0043219 | lateral loop(GO:0043219) |
| 0.1 | 2.1 | GO:0000159 | protein phosphatase type 2A complex(GO:0000159) |
| 0.1 | 0.4 | GO:0035867 | alphav-beta3 integrin-IGF-1-IGF1R complex(GO:0035867) |
| 0.1 | 0.3 | GO:0031523 | Myb complex(GO:0031523) |
| 0.1 | 0.8 | GO:0030056 | hemidesmosome(GO:0030056) |
| 0.1 | 0.4 | GO:0034274 | Atg12-Atg5-Atg16 complex(GO:0034274) |
| 0.1 | 0.9 | GO:0000788 | nuclear nucleosome(GO:0000788) |
| 0.1 | 2.0 | GO:0005614 | interstitial matrix(GO:0005614) |
| 0.1 | 0.5 | GO:1990696 | USH2 complex(GO:1990696) |
| 0.1 | 0.5 | GO:0030127 | COPII vesicle coat(GO:0030127) |
| 0.1 | 0.4 | GO:0071953 | elastic fiber(GO:0071953) |
| 0.1 | 0.7 | GO:0001917 | photoreceptor inner segment(GO:0001917) |
| 0.1 | 0.3 | GO:0031088 | platelet dense granule membrane(GO:0031088) |
| 0.1 | 0.8 | GO:0045180 | basal cortex(GO:0045180) |
| 0.1 | 0.1 | GO:0060053 | neurofilament cytoskeleton(GO:0060053) |
| 0.1 | 0.3 | GO:0097648 | G-protein coupled receptor dimeric complex(GO:0038037) G-protein coupled receptor complex(GO:0097648) |
| 0.1 | 1.0 | GO:0000813 | ESCRT I complex(GO:0000813) |
| 0.1 | 0.3 | GO:0048179 | activin receptor complex(GO:0048179) |
| 0.1 | 1.3 | GO:0098643 | fibrillar collagen trimer(GO:0005583) banded collagen fibril(GO:0098643) |
| 0.1 | 0.5 | GO:0097255 | R2TP complex(GO:0097255) |
| 0.1 | 6.6 | GO:0005581 | collagen trimer(GO:0005581) |
| 0.1 | 1.6 | GO:0043196 | varicosity(GO:0043196) |
| 0.1 | 1.9 | GO:1902710 | GABA receptor complex(GO:1902710) GABA-A receptor complex(GO:1902711) |
| 0.1 | 0.4 | GO:0016602 | CCAAT-binding factor complex(GO:0016602) |
| 0.1 | 0.3 | GO:0042585 | germinal vesicle(GO:0042585) |
| 0.1 | 6.2 | GO:0042641 | actomyosin(GO:0042641) |
| 0.1 | 1.2 | GO:0071564 | npBAF complex(GO:0071564) |
| 0.1 | 5.1 | GO:0005604 | basement membrane(GO:0005604) |
| 0.1 | 0.3 | GO:1990423 | RZZ complex(GO:1990423) |
| 0.1 | 0.5 | GO:0016012 | dystroglycan complex(GO:0016011) sarcoglycan complex(GO:0016012) |
| 0.1 | 1.1 | GO:0030877 | beta-catenin destruction complex(GO:0030877) |
| 0.1 | 0.3 | GO:1990357 | terminal web(GO:1990357) |
| 0.1 | 0.3 | GO:0017071 | intracellular cyclic nucleotide activated cation channel complex(GO:0017071) |
| 0.1 | 1.1 | GO:0043034 | costamere(GO:0043034) |
| 0.1 | 1.1 | GO:0034706 | sodium channel complex(GO:0034706) |
| 0.1 | 0.2 | GO:0033596 | TSC1-TSC2 complex(GO:0033596) |
| 0.1 | 1.5 | GO:0005922 | connexon complex(GO:0005922) |
| 0.1 | 0.6 | GO:0045254 | pyruvate dehydrogenase complex(GO:0045254) |
| 0.1 | 1.7 | GO:0000407 | pre-autophagosomal structure(GO:0000407) |
| 0.1 | 0.3 | GO:0005638 | lamin filament(GO:0005638) |
| 0.1 | 0.3 | GO:0045009 | melanosome membrane(GO:0033162) chitosome(GO:0045009) |
| 0.1 | 12.4 | GO:0099572 | postsynaptic density(GO:0014069) postsynaptic specialization(GO:0099572) |
| 0.1 | 0.5 | GO:1904115 | axon cytoplasm(GO:1904115) |
| 0.1 | 0.6 | GO:0031371 | ubiquitin conjugating enzyme complex(GO:0031371) |
| 0.1 | 0.2 | GO:0005863 | striated muscle myosin thick filament(GO:0005863) |
| 0.1 | 0.3 | GO:0042765 | GPI-anchor transamidase complex(GO:0042765) |
| 0.1 | 1.2 | GO:0032590 | dendrite membrane(GO:0032590) |
| 0.1 | 0.4 | GO:0097470 | ribbon synapse(GO:0097470) |
| 0.1 | 0.3 | GO:0008290 | F-actin capping protein complex(GO:0008290) |
| 0.1 | 0.5 | GO:0020005 | symbiont-containing vacuole membrane(GO:0020005) |
| 0.1 | 2.6 | GO:0016459 | myosin complex(GO:0016459) |
| 0.1 | 0.2 | GO:0033185 | dolichol-phosphate-mannose synthase complex(GO:0033185) |
| 0.1 | 0.4 | GO:0046696 | lipopolysaccharide receptor complex(GO:0046696) |
| 0.1 | 0.7 | GO:0043240 | Fanconi anaemia nuclear complex(GO:0043240) |
| 0.1 | 0.3 | GO:0045179 | apical cortex(GO:0045179) |
| 0.1 | 0.5 | GO:0005869 | dynactin complex(GO:0005869) |
| 0.1 | 0.4 | GO:0042587 | glycogen granule(GO:0042587) |
| 0.1 | 0.5 | GO:0000815 | ESCRT III complex(GO:0000815) |
| 0.1 | 0.5 | GO:0008250 | oligosaccharyltransferase complex(GO:0008250) |
| 0.1 | 0.2 | GO:0044233 | ER-mitochondrion membrane contact site(GO:0044233) |
| 0.1 | 0.6 | GO:0031588 | nucleotide-activated protein kinase complex(GO:0031588) |
| 0.1 | 0.2 | GO:0031258 | lamellipodium membrane(GO:0031258) |
| 0.1 | 1.0 | GO:0016581 | NuRD complex(GO:0016581) CHD-type complex(GO:0090545) |
| 0.1 | 0.2 | GO:0031465 | Cul4B-RING E3 ubiquitin ligase complex(GO:0031465) |
| 0.1 | 0.7 | GO:0036038 | MKS complex(GO:0036038) |
| 0.1 | 4.4 | GO:0090575 | RNA polymerase II transcription factor complex(GO:0090575) |
| 0.1 | 0.2 | GO:0071942 | XPC complex(GO:0071942) |
| 0.1 | 0.2 | GO:0042583 | chromaffin granule(GO:0042583) |
| 0.1 | 0.2 | GO:0031315 | extrinsic component of mitochondrial outer membrane(GO:0031315) |
| 0.1 | 0.5 | GO:0008074 | guanylate cyclase complex, soluble(GO:0008074) |
| 0.0 | 0.3 | GO:0032593 | insulin-responsive compartment(GO:0032593) |
| 0.0 | 3.1 | GO:0031526 | brush border membrane(GO:0031526) |
| 0.0 | 0.3 | GO:0005916 | fascia adherens(GO:0005916) |
| 0.0 | 0.0 | GO:0044294 | dendritic growth cone(GO:0044294) |
| 0.0 | 0.1 | GO:0034673 | inhibin-betaglycan-ActRII complex(GO:0034673) |
| 0.0 | 0.1 | GO:0061689 | tricellular tight junction(GO:0061689) |
| 0.0 | 1.5 | GO:0042734 | presynaptic membrane(GO:0042734) |
| 0.0 | 0.2 | GO:0016281 | eukaryotic translation initiation factor 4F complex(GO:0016281) |
| 0.0 | 0.7 | GO:0000786 | nucleosome(GO:0000786) |
| 0.0 | 0.6 | GO:0035869 | ciliary transition zone(GO:0035869) |
| 0.0 | 0.7 | GO:0035327 | transcriptionally active chromatin(GO:0035327) |
| 0.0 | 0.3 | GO:0042629 | mast cell granule(GO:0042629) |
| 0.0 | 0.6 | GO:0031231 | intrinsic component of peroxisomal membrane(GO:0031231) |
| 0.0 | 0.1 | GO:0005971 | ribonucleoside-diphosphate reductase complex(GO:0005971) |
| 0.0 | 0.2 | GO:0000214 | tRNA-intron endonuclease complex(GO:0000214) |
| 0.0 | 1.5 | GO:0032587 | ruffle membrane(GO:0032587) |
| 0.0 | 0.3 | GO:0036157 | outer dynein arm(GO:0036157) |
| 0.0 | 1.1 | GO:0008180 | COP9 signalosome(GO:0008180) |
| 0.0 | 0.3 | GO:0043218 | compact myelin(GO:0043218) |
| 0.0 | 0.8 | GO:0097610 | cleavage furrow(GO:0032154) cell surface furrow(GO:0097610) |
| 0.0 | 2.5 | GO:0022625 | cytosolic large ribosomal subunit(GO:0022625) |
| 0.0 | 6.4 | GO:0005578 | proteinaceous extracellular matrix(GO:0005578) |
| 0.0 | 0.4 | GO:0031932 | TORC2 complex(GO:0031932) |
| 0.0 | 0.7 | GO:0030057 | desmosome(GO:0030057) |
| 0.0 | 0.1 | GO:1990393 | 3M complex(GO:1990393) |
| 0.0 | 0.1 | GO:0031313 | extrinsic component of vacuolar membrane(GO:0000306) extrinsic component of endosome membrane(GO:0031313) |
| 0.0 | 0.4 | GO:0005942 | phosphatidylinositol 3-kinase complex(GO:0005942) |
| 0.0 | 1.3 | GO:0045095 | keratin filament(GO:0045095) |
| 0.0 | 0.1 | GO:0043511 | inhibin complex(GO:0043511) |
| 0.0 | 0.1 | GO:0005958 | DNA-dependent protein kinase-DNA ligase 4 complex(GO:0005958) |
| 0.0 | 0.1 | GO:0036195 | muscle cell projection(GO:0036194) muscle cell projection membrane(GO:0036195) |
| 0.0 | 0.5 | GO:0000145 | exocyst(GO:0000145) |
| 0.0 | 0.1 | GO:0008274 | gamma-tubulin large complex(GO:0000931) gamma-tubulin ring complex(GO:0008274) |
| 0.0 | 0.0 | GO:0034666 | integrin alpha2-beta1 complex(GO:0034666) |
| 0.0 | 0.2 | GO:0001940 | male pronucleus(GO:0001940) |
| 0.0 | 0.2 | GO:0071546 | pi-body(GO:0071546) |
| 0.0 | 0.5 | GO:0005797 | Golgi medial cisterna(GO:0005797) |
| 0.0 | 0.5 | GO:0005892 | acetylcholine-gated channel complex(GO:0005892) |
| 0.0 | 0.9 | GO:0005637 | nuclear inner membrane(GO:0005637) |
| 0.0 | 0.2 | GO:0005885 | Arp2/3 protein complex(GO:0005885) |
| 0.0 | 1.0 | GO:0046658 | anchored component of plasma membrane(GO:0046658) |
| 0.0 | 0.1 | GO:0030956 | glutamyl-tRNA(Gln) amidotransferase complex(GO:0030956) |
| 0.0 | 0.4 | GO:0032580 | Golgi cisterna membrane(GO:0032580) |
| 0.0 | 0.0 | GO:0033010 | paranodal junction(GO:0033010) |
| 0.0 | 0.3 | GO:0031414 | N-terminal protein acetyltransferase complex(GO:0031414) |
| 0.0 | 0.7 | GO:0031901 | early endosome membrane(GO:0031901) |
| 0.0 | 0.3 | GO:0042575 | DNA polymerase complex(GO:0042575) |
| 0.0 | 0.3 | GO:0010369 | chromocenter(GO:0010369) |
| 0.0 | 0.1 | GO:0036449 | microtubule minus-end(GO:0036449) |
| 0.0 | 0.1 | GO:0097441 | basilar dendrite(GO:0097441) |
| 0.0 | 0.1 | GO:0071598 | neuronal ribonucleoprotein granule(GO:0071598) |
| 0.0 | 0.4 | GO:0005782 | peroxisomal matrix(GO:0005782) microbody lumen(GO:0031907) |
| 0.0 | 0.1 | GO:0034388 | Pwp2p-containing subcomplex of 90S preribosome(GO:0034388) |
| 0.0 | 1.4 | GO:0005882 | intermediate filament(GO:0005882) |
| 0.0 | 0.5 | GO:0008305 | integrin complex(GO:0008305) |
| 0.0 | 0.2 | GO:0033061 | DNA recombinase mediator complex(GO:0033061) |
| 0.0 | 0.1 | GO:0000109 | nucleotide-excision repair complex(GO:0000109) |
| 0.0 | 0.4 | GO:0042588 | zymogen granule(GO:0042588) |
| 0.0 | 0.1 | GO:0031262 | Ndc80 complex(GO:0031262) |
| 0.0 | 0.6 | GO:0032391 | photoreceptor connecting cilium(GO:0032391) |
| 0.0 | 0.2 | GO:0071006 | U2-type catalytic step 1 spliceosome(GO:0071006) |
| 0.0 | 0.2 | GO:0030061 | mitochondrial crista(GO:0030061) |
| 0.0 | 0.2 | GO:0043020 | NADPH oxidase complex(GO:0043020) |
| 0.0 | 0.4 | GO:0005685 | U1 snRNP(GO:0005685) |
| 0.0 | 0.2 | GO:1990023 | mitotic spindle midzone(GO:1990023) |
| 0.0 | 1.0 | GO:0032993 | protein-DNA complex(GO:0032993) |
| 0.0 | 0.2 | GO:0031235 | intrinsic component of the cytoplasmic side of the plasma membrane(GO:0031235) |
| 0.0 | 0.0 | GO:1990923 | PET complex(GO:1990923) |
| 0.0 | 0.1 | GO:0030896 | checkpoint clamp complex(GO:0030896) |
| 0.0 | 0.2 | GO:0070652 | HAUS complex(GO:0070652) |
| 0.0 | 0.1 | GO:0071547 | piP-body(GO:0071547) |
| 0.0 | 0.1 | GO:0001891 | phagocytic cup(GO:0001891) |
| 0.0 | 0.0 | GO:0032133 | chromosome passenger complex(GO:0032133) |
| 0.0 | 0.0 | GO:0009279 | cell outer membrane(GO:0009279) cell envelope(GO:0030313) external encapsulating structure part(GO:0044462) |
| 0.0 | 0.1 | GO:0097542 | ciliary tip(GO:0097542) |
| 0.0 | 0.1 | GO:0071817 | MMXD complex(GO:0071817) |
| 0.0 | 0.1 | GO:0089701 | U2AF(GO:0089701) |
| 0.0 | 0.1 | GO:0070531 | BRCA1-A complex(GO:0070531) |
| 0.0 | 0.1 | GO:1990130 | Iml1 complex(GO:1990130) |
| 0.0 | 0.1 | GO:0030140 | trans-Golgi network transport vesicle(GO:0030140) |
| 0.0 | 0.1 | GO:0061617 | MICOS complex(GO:0061617) |
| 0.0 | 0.1 | GO:0048476 | Holliday junction resolvase complex(GO:0048476) |
| 0.0 | 0.1 | GO:0048237 | rough endoplasmic reticulum lumen(GO:0048237) |
| 0.0 | 0.2 | GO:0055038 | recycling endosome membrane(GO:0055038) |
| 0.0 | 0.1 | GO:0090661 | box H/ACA telomerase RNP complex(GO:0090661) |
| 0.0 | 0.1 | GO:0000445 | THO complex(GO:0000347) THO complex part of transcription export complex(GO:0000445) |
| 0.0 | 0.2 | GO:0060076 | excitatory synapse(GO:0060076) |
| 0.0 | 2.0 | GO:0005769 | early endosome(GO:0005769) |
| 0.0 | 0.1 | GO:0048786 | presynaptic active zone(GO:0048786) |
| 0.0 | 0.1 | GO:0017146 | NMDA selective glutamate receptor complex(GO:0017146) |
| 0.0 | 0.0 | GO:0035748 | myelin sheath abaxonal region(GO:0035748) |
| 0.0 | 2.5 | GO:0043235 | receptor complex(GO:0043235) |
| 0.0 | 0.1 | GO:0000974 | Prp19 complex(GO:0000974) |
| 0.0 | 0.1 | GO:0034709 | methylosome(GO:0034709) |
| 0.0 | 0.1 | GO:0005663 | DNA replication factor C complex(GO:0005663) |
| 0.0 | 0.1 | GO:0036057 | filtration diaphragm(GO:0036056) slit diaphragm(GO:0036057) |
| 0.0 | 0.0 | GO:0000243 | commitment complex(GO:0000243) |
| 0.0 | 0.0 | GO:0000125 | PCAF complex(GO:0000125) |
| 0.0 | 0.1 | GO:0032541 | cortical endoplasmic reticulum(GO:0032541) |
| 0.0 | 0.6 | GO:0001750 | photoreceptor outer segment(GO:0001750) |
| 0.0 | 0.4 | GO:0005913 | cell-cell adherens junction(GO:0005913) |
| 0.0 | 0.0 | GO:0031074 | nucleocytoplasmic shuttling complex(GO:0031074) |
| 0.0 | 0.0 | GO:0032280 | symmetric synapse(GO:0032280) |
| 0.0 | 0.0 | GO:0005785 | signal recognition particle receptor complex(GO:0005785) |
| 0.0 | 0.1 | GO:0070852 | cell body fiber(GO:0070852) |
| 0.0 | 0.0 | GO:0044611 | nuclear pore inner ring(GO:0044611) |
| 0.0 | 0.2 | GO:0030992 | intraciliary transport particle B(GO:0030992) |
| 0.0 | 0.1 | GO:0044215 | other organism(GO:0044215) other organism cell(GO:0044216) other organism part(GO:0044217) |
| 0.0 | 0.0 | GO:0045298 | tubulin complex(GO:0045298) |
| 0.0 | 0.1 | GO:0001520 | outer dense fiber(GO:0001520) |
| 0.0 | 0.0 | GO:0030870 | Mre11 complex(GO:0030870) |
| 0.0 | 0.5 | GO:0045271 | mitochondrial respiratory chain complex I(GO:0005747) NADH dehydrogenase complex(GO:0030964) respiratory chain complex I(GO:0045271) |
| 0.0 | 0.1 | GO:0030914 | STAGA complex(GO:0030914) |
| 0.0 | 0.1 | GO:0000127 | transcription factor TFIIIC complex(GO:0000127) |
| 0.0 | 0.0 | GO:0097209 | epidermal lamellar body(GO:0097209) |
| 0.0 | 0.0 | GO:0001674 | female germ cell nucleus(GO:0001674) |
| 0.0 | 0.0 | GO:1990604 | IRE1-TRAF2-ASK1 complex(GO:1990604) |
| 0.0 | 0.1 | GO:0036379 | myofilament(GO:0036379) |
| 0.0 | 0.0 | GO:0070033 | synaptobrevin 2-SNAP-25-syntaxin-1a-complexin II complex(GO:0070033) |
| 0.0 | 0.0 | GO:1990246 | uniplex complex(GO:1990246) |
| 0.0 | 0.1 | GO:0000812 | Swr1 complex(GO:0000812) |
| 0.0 | 0.0 | GO:0071001 | U4/U6 snRNP(GO:0071001) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.8 | 4.1 | GO:0035662 | Toll-like receptor 4 binding(GO:0035662) |
| 0.7 | 3.5 | GO:0044323 | retinoic acid-responsive element binding(GO:0044323) |
| 0.6 | 2.4 | GO:0005025 | transforming growth factor beta receptor activity, type I(GO:0005025) |
| 0.6 | 1.8 | GO:0071553 | uridine nucleotide receptor activity(GO:0015065) G-protein coupled pyrimidinergic nucleotide receptor activity(GO:0071553) |
| 0.6 | 1.8 | GO:0050220 | prostaglandin-E synthase activity(GO:0050220) |
| 0.6 | 2.3 | GO:0001224 | RNA polymerase II transcription cofactor binding(GO:0001224) |
| 0.5 | 2.2 | GO:0043262 | adenosine-diphosphatase activity(GO:0043262) |
| 0.5 | 2.6 | GO:0003708 | retinoic acid receptor activity(GO:0003708) |
| 0.5 | 1.5 | GO:0045503 | dynein light chain binding(GO:0045503) |
| 0.5 | 1.4 | GO:0097493 | structural molecule activity conferring elasticity(GO:0097493) |
| 0.4 | 1.3 | GO:0004924 | oncostatin-M receptor activity(GO:0004924) |
| 0.4 | 1.2 | GO:0004720 | protein-lysine 6-oxidase activity(GO:0004720) |
| 0.4 | 1.6 | GO:0042731 | PH domain binding(GO:0042731) |
| 0.4 | 1.2 | GO:0030172 | troponin C binding(GO:0030172) |
| 0.4 | 2.0 | GO:0042609 | CD4 receptor binding(GO:0042609) |
| 0.4 | 1.2 | GO:0004800 | thyroxine 5'-deiodinase activity(GO:0004800) |
| 0.4 | 1.6 | GO:0072542 | protein phosphatase activator activity(GO:0072542) |
| 0.4 | 2.2 | GO:0005072 | transforming growth factor beta receptor, cytoplasmic mediator activity(GO:0005072) |
| 0.4 | 1.9 | GO:0070051 | fibrinogen binding(GO:0070051) |
| 0.4 | 2.9 | GO:0051371 | muscle alpha-actinin binding(GO:0051371) |
| 0.3 | 1.6 | GO:0038132 | neuregulin binding(GO:0038132) |
| 0.3 | 0.9 | GO:0016262 | protein N-acetylglucosaminyltransferase activity(GO:0016262) |
| 0.3 | 1.4 | GO:0003847 | 1-alkyl-2-acetylglycerophosphocholine esterase activity(GO:0003847) |
| 0.3 | 0.9 | GO:0005146 | leukemia inhibitory factor receptor binding(GO:0005146) |
| 0.3 | 0.6 | GO:0001069 | regulatory region RNA binding(GO:0001069) |
| 0.3 | 1.1 | GO:1990715 | mRNA CDS binding(GO:1990715) |
| 0.3 | 0.8 | GO:0004096 | catalase activity(GO:0004096) |
| 0.3 | 0.8 | GO:0004699 | calcium-independent protein kinase C activity(GO:0004699) |
| 0.3 | 1.6 | GO:0016151 | nickel cation binding(GO:0016151) |
| 0.3 | 1.1 | GO:0043723 | N-cyclopropylmelamine deaminase activity(GO:0034547) N-cyclopropylammeline deaminase activity(GO:0034548) N-cyclopropylammelide alkylamino hydrolase activity(GO:0034549) 2,5-diamino-6-ribitylamino-4(3H)-pyrimidinone 5'-phosphate deaminase activity(GO:0043723) tRNA-specific adenosine-37 deaminase activity(GO:0043829) archaeal-specific GTP cyclohydrolase activity(GO:0044682) tRNA-specific adenosine-34 deaminase activity(GO:0052717) |
| 0.3 | 2.1 | GO:0070410 | co-SMAD binding(GO:0070410) |
| 0.3 | 1.5 | GO:0050544 | arachidonic acid binding(GO:0050544) |
| 0.3 | 3.3 | GO:0042608 | T cell receptor binding(GO:0042608) |
| 0.3 | 1.8 | GO:0050291 | sphingosine N-acyltransferase activity(GO:0050291) |
| 0.2 | 1.2 | GO:0004111 | creatine kinase activity(GO:0004111) |
| 0.2 | 2.4 | GO:0031702 | type 1 angiotensin receptor binding(GO:0031702) |
| 0.2 | 0.9 | GO:0031694 | alpha-2A adrenergic receptor binding(GO:0031694) |
| 0.2 | 0.5 | GO:0004897 | ciliary neurotrophic factor receptor activity(GO:0004897) |
| 0.2 | 0.7 | GO:0008321 | Ral guanyl-nucleotide exchange factor activity(GO:0008321) |
| 0.2 | 1.3 | GO:0003680 | AT DNA binding(GO:0003680) |
| 0.2 | 0.6 | GO:0003872 | 6-phosphofructokinase activity(GO:0003872) |
| 0.2 | 0.6 | GO:0045340 | mercury ion binding(GO:0045340) |
| 0.2 | 0.4 | GO:0015928 | fucosidase activity(GO:0015928) |
| 0.2 | 1.5 | GO:0043912 | D-lysine oxidase activity(GO:0043912) |
| 0.2 | 0.4 | GO:0019959 | interleukin-8 binding(GO:0019959) |
| 0.2 | 0.8 | GO:0038064 | collagen receptor activity(GO:0038064) |
| 0.2 | 0.6 | GO:0031802 | type 5 metabotropic glutamate receptor binding(GO:0031802) |
| 0.2 | 0.8 | GO:0008486 | diphosphoinositol-polyphosphate diphosphatase activity(GO:0008486) |
| 0.2 | 0.6 | GO:0004366 | glycerol-3-phosphate O-acyltransferase activity(GO:0004366) |
| 0.2 | 0.9 | GO:1990254 | keratin filament binding(GO:1990254) |
| 0.2 | 1.7 | GO:0016857 | racemase and epimerase activity, acting on carbohydrates and derivatives(GO:0016857) |
| 0.2 | 2.2 | GO:0048407 | platelet-derived growth factor binding(GO:0048407) |
| 0.2 | 0.5 | GO:0043120 | tumor necrosis factor binding(GO:0043120) |
| 0.2 | 0.7 | GO:0005030 | neurotrophin receptor activity(GO:0005030) |
| 0.2 | 0.7 | GO:0015220 | choline transmembrane transporter activity(GO:0015220) |
| 0.2 | 1.4 | GO:0005237 | inhibitory extracellular ligand-gated ion channel activity(GO:0005237) |
| 0.2 | 0.5 | GO:0004937 | alpha1-adrenergic receptor activity(GO:0004937) |
| 0.2 | 0.7 | GO:0004095 | carnitine O-palmitoyltransferase activity(GO:0004095) |
| 0.2 | 0.7 | GO:0015016 | [heparan sulfate]-glucosamine N-sulfotransferase activity(GO:0015016) |
| 0.2 | 2.5 | GO:0030169 | low-density lipoprotein particle binding(GO:0030169) |
| 0.2 | 0.8 | GO:0004945 | angiotensin type II receptor activity(GO:0004945) |
| 0.2 | 0.3 | GO:0004687 | myosin light chain kinase activity(GO:0004687) |
| 0.2 | 1.8 | GO:0016813 | hydrolase activity, acting on carbon-nitrogen (but not peptide) bonds, in linear amidines(GO:0016813) |
| 0.2 | 0.8 | GO:0008294 | calcium- and calmodulin-responsive adenylate cyclase activity(GO:0008294) |
| 0.2 | 0.7 | GO:0004566 | beta-glucuronidase activity(GO:0004566) |
| 0.2 | 2.1 | GO:0008191 | metalloendopeptidase inhibitor activity(GO:0008191) |
| 0.2 | 0.6 | GO:0004035 | alkaline phosphatase activity(GO:0004035) |
| 0.2 | 3.5 | GO:0005070 | SH3/SH2 adaptor activity(GO:0005070) |
| 0.2 | 1.0 | GO:0097027 | ubiquitin-protein transferase activator activity(GO:0097027) |
| 0.2 | 1.0 | GO:0003997 | acyl-CoA oxidase activity(GO:0003997) |
| 0.2 | 0.5 | GO:0004605 | phosphatidate cytidylyltransferase activity(GO:0004605) |
| 0.2 | 0.8 | GO:0004716 | receptor signaling protein tyrosine kinase activity(GO:0004716) |
| 0.2 | 0.9 | GO:0001849 | complement component C1q binding(GO:0001849) |
| 0.2 | 0.5 | GO:0016312 | inositol bisphosphate phosphatase activity(GO:0016312) |
| 0.2 | 0.9 | GO:0030368 | interleukin-17 receptor activity(GO:0030368) |
| 0.1 | 0.6 | GO:0015226 | amino-acid betaine transmembrane transporter activity(GO:0015199) carnitine transmembrane transporter activity(GO:0015226) |
| 0.1 | 2.1 | GO:0005351 | sugar:proton symporter activity(GO:0005351) |
| 0.1 | 1.6 | GO:0030898 | actin-dependent ATPase activity(GO:0030898) |
| 0.1 | 0.7 | GO:0016176 | superoxide-generating NADPH oxidase activator activity(GO:0016176) |
| 0.1 | 0.5 | GO:0016833 | oxo-acid-lyase activity(GO:0016833) |
| 0.1 | 0.4 | GO:0034988 | Fc-gamma receptor I complex binding(GO:0034988) |
| 0.1 | 0.5 | GO:0102345 | 3-hydroxy-behenoyl-CoA dehydratase activity(GO:0102344) 3-hydroxy-lignoceroyl-CoA dehydratase activity(GO:0102345) |
| 0.1 | 0.4 | GO:0034617 | tetrahydrobiopterin binding(GO:0034617) |
| 0.1 | 0.4 | GO:0070548 | L-glutamine aminotransferase activity(GO:0070548) |
| 0.1 | 0.7 | GO:0005095 | GTPase inhibitor activity(GO:0005095) |
| 0.1 | 0.5 | GO:0004332 | fructose-bisphosphate aldolase activity(GO:0004332) |
| 0.1 | 0.6 | GO:0005005 | transmembrane-ephrin receptor activity(GO:0005005) |
| 0.1 | 0.1 | GO:0004887 | thyroid hormone receptor activity(GO:0004887) |
| 0.1 | 1.5 | GO:0000701 | purine-specific mismatch base pair DNA N-glycosylase activity(GO:0000701) |
| 0.1 | 1.0 | GO:0016175 | superoxide-generating NADPH oxidase activity(GO:0016175) |
| 0.1 | 3.8 | GO:0001540 | beta-amyloid binding(GO:0001540) |
| 0.1 | 0.6 | GO:0046935 | 1-phosphatidylinositol-3-kinase regulator activity(GO:0046935) |
| 0.1 | 2.5 | GO:0035591 | signaling adaptor activity(GO:0035591) |
| 0.1 | 0.7 | GO:0032027 | myosin light chain binding(GO:0032027) |
| 0.1 | 2.6 | GO:0042805 | actinin binding(GO:0042805) |
| 0.1 | 0.7 | GO:0070324 | thyroid hormone binding(GO:0070324) |
| 0.1 | 0.1 | GO:0015142 | citrate transmembrane transporter activity(GO:0015137) tricarboxylic acid transmembrane transporter activity(GO:0015142) |
| 0.1 | 0.3 | GO:0003726 | double-stranded RNA adenosine deaminase activity(GO:0003726) |
| 0.1 | 0.3 | GO:0016509 | long-chain-3-hydroxyacyl-CoA dehydrogenase activity(GO:0016509) |
| 0.1 | 0.3 | GO:0017153 | sodium:dicarboxylate symporter activity(GO:0017153) |
| 0.1 | 2.1 | GO:0080025 | phosphatidylinositol-3,5-bisphosphate binding(GO:0080025) |
| 0.1 | 0.3 | GO:0004965 | G-protein coupled GABA receptor activity(GO:0004965) |
| 0.1 | 0.7 | GO:0004630 | phospholipase D activity(GO:0004630) |
| 0.1 | 0.2 | GO:0015232 | heme transporter activity(GO:0015232) |
| 0.1 | 6.1 | GO:0033613 | activating transcription factor binding(GO:0033613) |
| 0.1 | 0.4 | GO:0005042 | netrin receptor activity(GO:0005042) |
| 0.1 | 0.3 | GO:0004995 | tachykinin receptor activity(GO:0004995) |
| 0.1 | 0.8 | GO:0015280 | ligand-gated sodium channel activity(GO:0015280) |
| 0.1 | 0.3 | GO:0005220 | inositol 1,4,5-trisphosphate-sensitive calcium-release channel activity(GO:0005220) |
| 0.1 | 0.2 | GO:0042895 | antibiotic transporter activity(GO:0042895) |
| 0.1 | 0.5 | GO:0022820 | potassium:chloride symporter activity(GO:0015379) potassium ion symporter activity(GO:0022820) |
| 0.1 | 3.0 | GO:0017147 | Wnt-protein binding(GO:0017147) |
| 0.1 | 6.6 | GO:0005089 | Rho guanyl-nucleotide exchange factor activity(GO:0005089) |
| 0.1 | 0.7 | GO:0035005 | 1-phosphatidylinositol-4-phosphate 3-kinase activity(GO:0035005) |
| 0.1 | 0.4 | GO:0035033 | histone deacetylase regulator activity(GO:0035033) |
| 0.1 | 1.2 | GO:0047555 | 3',5'-cyclic-GMP phosphodiesterase activity(GO:0047555) |
| 0.1 | 0.8 | GO:0004862 | cAMP-dependent protein kinase inhibitor activity(GO:0004862) |
| 0.1 | 0.4 | GO:0000146 | microfilament motor activity(GO:0000146) |
| 0.1 | 1.7 | GO:0019825 | oxygen binding(GO:0019825) |
| 0.1 | 0.3 | GO:0097200 | cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:0097200) |
| 0.1 | 0.3 | GO:0042296 | ISG15 transferase activity(GO:0042296) |
| 0.1 | 0.3 | GO:0050510 | N-acetylgalactosaminyl-proteoglycan 3-beta-glucuronosyltransferase activity(GO:0050510) |
| 0.1 | 0.5 | GO:0070891 | lipoteichoic acid binding(GO:0070891) |
| 0.1 | 0.7 | GO:0031957 | very long-chain fatty acid-CoA ligase activity(GO:0031957) |
| 0.1 | 0.3 | GO:0097109 | neuroligin family protein binding(GO:0097109) |
| 0.1 | 1.9 | GO:0042169 | SH2 domain binding(GO:0042169) |
| 0.1 | 0.4 | GO:0030375 | thyroid hormone receptor coactivator activity(GO:0030375) |
| 0.1 | 1.0 | GO:0015643 | toxic substance binding(GO:0015643) |
| 0.1 | 1.1 | GO:0070016 | armadillo repeat domain binding(GO:0070016) |
| 0.1 | 0.2 | GO:0016635 | oxidoreductase activity, acting on the CH-CH group of donors, quinone or related compound as acceptor(GO:0016635) |
| 0.1 | 0.3 | GO:0005415 | nucleoside:sodium symporter activity(GO:0005415) |
| 0.1 | 0.1 | GO:0019187 | beta-1,4-mannosyltransferase activity(GO:0019187) |
| 0.1 | 1.7 | GO:0004707 | MAP kinase activity(GO:0004707) |
| 0.1 | 0.3 | GO:0030228 | lipoprotein particle receptor activity(GO:0030228) |
| 0.1 | 0.3 | GO:0008532 | N-acetyllactosaminide beta-1,3-N-acetylglucosaminyltransferase activity(GO:0008532) |
| 0.1 | 1.1 | GO:0016799 | hydrolase activity, hydrolyzing N-glycosyl compounds(GO:0016799) |
| 0.1 | 0.2 | GO:0031127 | galactoside 2-alpha-L-fucosyltransferase activity(GO:0008107) alpha-(1,2)-fucosyltransferase activity(GO:0031127) |
| 0.1 | 0.3 | GO:0033592 | RNA strand annealing activity(GO:0033592) |
| 0.1 | 1.6 | GO:0030215 | semaphorin receptor binding(GO:0030215) |
| 0.1 | 1.2 | GO:0008266 | poly(U) RNA binding(GO:0008266) |
| 0.1 | 4.1 | GO:0017022 | myosin binding(GO:0017022) |
| 0.1 | 0.8 | GO:0031005 | filamin binding(GO:0031005) |
| 0.1 | 1.2 | GO:0019789 | SUMO transferase activity(GO:0019789) |
| 0.1 | 0.2 | GO:0005001 | transmembrane receptor protein tyrosine phosphatase activity(GO:0005001) |
| 0.1 | 0.3 | GO:0016715 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, reduced ascorbate as one donor, and incorporation of one atom of oxygen(GO:0016715) |
| 0.1 | 0.4 | GO:0008140 | cAMP response element binding protein binding(GO:0008140) |
| 0.1 | 0.3 | GO:0019871 | sodium channel inhibitor activity(GO:0019871) |
| 0.1 | 1.0 | GO:0043274 | phospholipase binding(GO:0043274) |
| 0.1 | 0.2 | GO:0004711 | ribosomal protein S6 kinase activity(GO:0004711) |
| 0.1 | 0.1 | GO:0051373 | FATZ binding(GO:0051373) |
| 0.1 | 0.5 | GO:0034603 | pyruvate dehydrogenase activity(GO:0004738) pyruvate dehydrogenase [NAD(P)+] activity(GO:0034603) pyruvate dehydrogenase (NAD+) activity(GO:0034604) |
| 0.1 | 0.4 | GO:0044213 | intronic transcription regulatory region DNA binding(GO:0044213) |
| 0.1 | 1.0 | GO:0017128 | phospholipid scramblase activity(GO:0017128) |
| 0.1 | 0.4 | GO:0031749 | D2 dopamine receptor binding(GO:0031749) |
| 0.1 | 0.3 | GO:0005114 | type II transforming growth factor beta receptor binding(GO:0005114) |
| 0.1 | 0.1 | GO:0038191 | neuropilin binding(GO:0038191) |
| 0.1 | 0.6 | GO:0001784 | phosphotyrosine binding(GO:0001784) |
| 0.1 | 0.1 | GO:0038181 | bile acid receptor activity(GO:0038181) |
| 0.1 | 2.2 | GO:0005251 | delayed rectifier potassium channel activity(GO:0005251) |
| 0.1 | 0.9 | GO:0045236 | CXCR chemokine receptor binding(GO:0045236) |
| 0.1 | 0.5 | GO:0004579 | dolichyl-diphosphooligosaccharide-protein glycotransferase activity(GO:0004579) |
| 0.1 | 0.6 | GO:0005003 | ephrin receptor activity(GO:0005003) |
| 0.1 | 0.6 | GO:0008889 | glycerophosphodiester phosphodiesterase activity(GO:0008889) |
| 0.1 | 0.2 | GO:0042392 | sphingosine-1-phosphate phosphatase activity(GO:0042392) |
| 0.1 | 0.2 | GO:0000309 | nicotinamide-nucleotide adenylyltransferase activity(GO:0000309) nicotinate-nucleotide adenylyltransferase activity(GO:0004515) |
| 0.1 | 0.1 | GO:0003941 | L-serine ammonia-lyase activity(GO:0003941) |
| 0.1 | 0.1 | GO:0070644 | vitamin D response element binding(GO:0070644) |
| 0.1 | 1.1 | GO:0030552 | cAMP binding(GO:0030552) |
| 0.1 | 0.6 | GO:0070569 | uridylyltransferase activity(GO:0070569) |
| 0.1 | 0.6 | GO:0004017 | adenylate kinase activity(GO:0004017) |
| 0.1 | 2.7 | GO:0003730 | mRNA 3'-UTR binding(GO:0003730) |
| 0.1 | 0.3 | GO:0003958 | NADPH-hemoprotein reductase activity(GO:0003958) |
| 0.1 | 0.3 | GO:0031432 | titin binding(GO:0031432) |
| 0.1 | 0.3 | GO:0086006 | voltage-gated sodium channel activity involved in cardiac muscle cell action potential(GO:0086006) |
| 0.1 | 0.4 | GO:0016936 | galactoside binding(GO:0016936) |
| 0.1 | 0.4 | GO:0048531 | beta-1,3-galactosyltransferase activity(GO:0048531) |
| 0.1 | 0.2 | GO:0016716 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, another compound as one donor, and incorporation of one atom of oxygen(GO:0016716) |
| 0.1 | 0.3 | GO:0000268 | peroxisome targeting sequence binding(GO:0000268) |
| 0.1 | 1.0 | GO:0003785 | actin monomer binding(GO:0003785) |
| 0.1 | 1.0 | GO:0005520 | insulin-like growth factor binding(GO:0005520) |
| 0.1 | 0.7 | GO:0004954 | prostanoid receptor activity(GO:0004954) |
| 0.1 | 0.3 | GO:0010997 | anaphase-promoting complex binding(GO:0010997) |
| 0.1 | 0.2 | GO:0000213 | tRNA-intron endonuclease activity(GO:0000213) |
| 0.1 | 0.2 | GO:0004126 | cytidine deaminase activity(GO:0004126) |
| 0.1 | 0.1 | GO:0015141 | succinate transmembrane transporter activity(GO:0015141) |
| 0.1 | 0.3 | GO:0005021 | vascular endothelial growth factor-activated receptor activity(GO:0005021) |
| 0.1 | 0.5 | GO:0015321 | sodium-dependent phosphate transmembrane transporter activity(GO:0015321) |
| 0.1 | 0.3 | GO:0004016 | adenylate cyclase activity(GO:0004016) |
| 0.1 | 0.2 | GO:0000774 | adenyl-nucleotide exchange factor activity(GO:0000774) |
| 0.1 | 0.2 | GO:0031014 | troponin T binding(GO:0031014) |
| 0.1 | 0.2 | GO:0045134 | uridine-diphosphatase activity(GO:0045134) |
| 0.1 | 0.1 | GO:0033677 | DNA/RNA helicase activity(GO:0033677) |
| 0.1 | 0.5 | GO:0003810 | protein-glutamine gamma-glutamyltransferase activity(GO:0003810) |
| 0.1 | 0.4 | GO:0004383 | guanylate cyclase activity(GO:0004383) |
| 0.1 | 0.2 | GO:0030144 | alpha-1,6-mannosylglycoprotein 6-beta-N-acetylglucosaminyltransferase activity(GO:0030144) |
| 0.1 | 0.2 | GO:0003696 | satellite DNA binding(GO:0003696) |
| 0.1 | 1.3 | GO:0005104 | fibroblast growth factor receptor binding(GO:0005104) |
| 0.1 | 1.1 | GO:0017080 | sodium channel regulator activity(GO:0017080) |
| 0.1 | 0.6 | GO:0015026 | coreceptor activity(GO:0015026) |
| 0.1 | 0.4 | GO:0001094 | TFIID-class transcription factor binding(GO:0001094) |
| 0.1 | 0.3 | GO:0046912 | transferase activity, transferring acyl groups, acyl groups converted into alkyl on transfer(GO:0046912) |
| 0.1 | 0.1 | GO:0043125 | ErbB-3 class receptor binding(GO:0043125) |
| 0.1 | 1.8 | GO:0005201 | extracellular matrix structural constituent(GO:0005201) |
| 0.1 | 0.9 | GO:0032794 | GTPase activating protein binding(GO:0032794) |
| 0.1 | 0.2 | GO:0035514 | DNA demethylase activity(GO:0035514) |
| 0.1 | 0.3 | GO:0071253 | connexin binding(GO:0071253) |
| 0.1 | 0.2 | GO:0005094 | Rho GDP-dissociation inhibitor activity(GO:0005094) |
| 0.1 | 4.4 | GO:0001078 | transcriptional repressor activity, RNA polymerase II core promoter proximal region sequence-specific binding(GO:0001078) |
| 0.1 | 0.1 | GO:1901702 | urate transmembrane transporter activity(GO:0015143) salt transmembrane transporter activity(GO:1901702) |
| 0.1 | 0.3 | GO:0090482 | vitamin transmembrane transporter activity(GO:0090482) |
| 0.1 | 0.5 | GO:0048038 | quinone binding(GO:0048038) |
| 0.1 | 0.1 | GO:0008046 | axon guidance receptor activity(GO:0008046) |
| 0.0 | 0.1 | GO:0048018 | receptor agonist activity(GO:0048018) |
| 0.0 | 0.1 | GO:0034711 | inhibin binding(GO:0034711) |
| 0.0 | 0.1 | GO:0016361 | activin receptor activity, type I(GO:0016361) |
| 0.0 | 0.6 | GO:0070412 | R-SMAD binding(GO:0070412) |
| 0.0 | 0.1 | GO:0035612 | AP-2 adaptor complex binding(GO:0035612) |
| 0.0 | 0.4 | GO:0045295 | gamma-catenin binding(GO:0045295) |
| 0.0 | 0.2 | GO:0005007 | fibroblast growth factor-activated receptor activity(GO:0005007) |
| 0.0 | 0.3 | GO:0043023 | ribosomal large subunit binding(GO:0043023) |
| 0.0 | 0.3 | GO:0043121 | neurotrophin binding(GO:0043121) |
| 0.0 | 0.2 | GO:0055131 | C3HC4-type RING finger domain binding(GO:0055131) |
| 0.0 | 2.1 | GO:0008392 | arachidonic acid monooxygenase activity(GO:0008391) arachidonic acid epoxygenase activity(GO:0008392) |
| 0.0 | 0.2 | GO:0004582 | dolichyl-phosphate beta-D-mannosyltransferase activity(GO:0004582) |
| 0.0 | 14.3 | GO:0001228 | transcriptional activator activity, RNA polymerase II transcription regulatory region sequence-specific binding(GO:0001228) |
| 0.0 | 0.1 | GO:0004703 | G-protein coupled receptor kinase activity(GO:0004703) |
| 0.0 | 0.1 | GO:0031750 | D3 dopamine receptor binding(GO:0031750) |
| 0.0 | 0.3 | GO:0032050 | clathrin heavy chain binding(GO:0032050) |
| 0.0 | 0.2 | GO:1904288 | BAT3 complex binding(GO:1904288) |
| 0.0 | 0.1 | GO:0050998 | nitric-oxide synthase binding(GO:0050998) |
| 0.0 | 0.7 | GO:0001968 | fibronectin binding(GO:0001968) |
| 0.0 | 0.5 | GO:0004697 | protein kinase C activity(GO:0004697) |
| 0.0 | 0.0 | GO:0071535 | RING-like zinc finger domain binding(GO:0071535) |
| 0.0 | 0.2 | GO:0019784 | NEDD8-specific protease activity(GO:0019784) |
| 0.0 | 0.3 | GO:0008440 | inositol-1,4,5-trisphosphate 3-kinase activity(GO:0008440) |
| 0.0 | 0.6 | GO:0008253 | 5'-nucleotidase activity(GO:0008253) |
| 0.0 | 0.8 | GO:0005086 | ARF guanyl-nucleotide exchange factor activity(GO:0005086) |
| 0.0 | 0.1 | GO:0042289 | MHC class II protein binding(GO:0042289) |
| 0.0 | 0.1 | GO:0098639 | collagen binding involved in cell-matrix adhesion(GO:0098639) |
| 0.0 | 0.2 | GO:0047498 | calcium-dependent phospholipase A2 activity(GO:0047498) |
| 0.0 | 0.1 | GO:0005329 | dopamine transmembrane transporter activity(GO:0005329) |
| 0.0 | 0.1 | GO:0004748 | ribonucleoside-diphosphate reductase activity, thioredoxin disulfide as acceptor(GO:0004748) oxidoreductase activity, acting on CH or CH2 groups, disulfide as acceptor(GO:0016728) ribonucleoside-diphosphate reductase activity(GO:0061731) |
| 0.0 | 1.4 | GO:0017046 | peptide hormone binding(GO:0017046) |
| 0.0 | 0.2 | GO:0010521 | telomerase inhibitor activity(GO:0010521) |
| 0.0 | 0.8 | GO:0001786 | phosphatidylserine binding(GO:0001786) |
| 0.0 | 0.1 | GO:0008158 | hedgehog receptor activity(GO:0008158) |
| 0.0 | 0.1 | GO:0005176 | ErbB-2 class receptor binding(GO:0005176) |
| 0.0 | 0.4 | GO:0016783 | sulfurtransferase activity(GO:0016783) |
| 0.0 | 0.1 | GO:0047276 | N-acetyllactosaminide 3-alpha-galactosyltransferase activity(GO:0047276) |
| 0.0 | 0.1 | GO:0061513 | hexose phosphate transmembrane transporter activity(GO:0015119) organophosphate:inorganic phosphate antiporter activity(GO:0015315) hexose-phosphate:inorganic phosphate antiporter activity(GO:0015526) glucose 6-phosphate:inorganic phosphate antiporter activity(GO:0061513) |
| 0.0 | 0.8 | GO:0008422 | beta-glucosidase activity(GO:0008422) |
| 0.0 | 0.4 | GO:0008641 | small protein activating enzyme activity(GO:0008641) |
| 0.0 | 0.2 | GO:0036122 | BMP binding(GO:0036122) |
| 0.0 | 0.1 | GO:1990189 | peptide-serine-N-acetyltransferase activity(GO:1990189) peptide-glutamate-N-acetyltransferase activity(GO:1990190) |
| 0.0 | 0.3 | GO:0016861 | intramolecular oxidoreductase activity, interconverting aldoses and ketoses(GO:0016861) |
| 0.0 | 0.4 | GO:0008601 | protein phosphatase type 2A regulator activity(GO:0008601) |
| 0.0 | 0.3 | GO:0034784 | pivalyl-CoA mutase activity(GO:0034784) o-hydroxylaminobenzoate mutase activity(GO:0034951) lupeol synthase activity(GO:0042299) beta-amyrin synthase activity(GO:0042300) baruol synthase activity(GO:0080011) |
| 0.0 | 0.1 | GO:0051032 | nucleic acid transmembrane transporter activity(GO:0051032) RNA transmembrane transporter activity(GO:0051033) |
| 0.0 | 0.1 | GO:0035651 | AP-3 adaptor complex binding(GO:0035651) |
| 0.0 | 0.2 | GO:0008097 | 5S rRNA binding(GO:0008097) |
| 0.0 | 0.3 | GO:0019869 | chloride channel inhibitor activity(GO:0019869) |
| 0.0 | 2.2 | GO:0020037 | heme binding(GO:0020037) |
| 0.0 | 0.1 | GO:0004345 | glucose-6-phosphate dehydrogenase activity(GO:0004345) |
| 0.0 | 0.2 | GO:0004331 | fructose-2,6-bisphosphate 2-phosphatase activity(GO:0004331) |
| 0.0 | 0.1 | GO:0019166 | trans-2-enoyl-CoA reductase (NADPH) activity(GO:0019166) |
| 0.0 | 0.1 | GO:0032051 | clathrin light chain binding(GO:0032051) |
| 0.0 | 0.2 | GO:0035613 | RNA stem-loop binding(GO:0035613) |
| 0.0 | 0.6 | GO:0004709 | MAP kinase kinase kinase activity(GO:0004709) |
| 0.0 | 0.4 | GO:0005243 | gap junction channel activity(GO:0005243) |
| 0.0 | 1.0 | GO:0005044 | scavenger receptor activity(GO:0005044) |
| 0.0 | 0.1 | GO:0008184 | glycogen phosphorylase activity(GO:0008184) |
| 0.0 | 0.1 | GO:0070052 | collagen V binding(GO:0070052) |
| 0.0 | 0.3 | GO:0045294 | alpha-catenin binding(GO:0045294) |
| 0.0 | 0.1 | GO:0071532 | ankyrin repeat binding(GO:0071532) |
| 0.0 | 0.4 | GO:0005123 | death receptor binding(GO:0005123) |
| 0.0 | 0.1 | GO:0030943 | mitochondrion targeting sequence binding(GO:0030943) |
| 0.0 | 0.1 | GO:0052629 | phosphatidylinositol-3,5-bisphosphate 3-phosphatase activity(GO:0052629) |
| 0.0 | 0.2 | GO:0003796 | lysozyme activity(GO:0003796) |
| 0.0 | 0.1 | GO:0004677 | DNA-dependent protein kinase activity(GO:0004677) |
| 0.0 | 0.3 | GO:0008307 | structural constituent of muscle(GO:0008307) |
| 0.0 | 0.2 | GO:0030546 | receptor activator activity(GO:0030546) |
| 0.0 | 0.1 | GO:0004985 | opioid receptor activity(GO:0004985) |
| 0.0 | 0.1 | GO:0017098 | sulfonylurea receptor binding(GO:0017098) |
| 0.0 | 0.2 | GO:0008420 | CTD phosphatase activity(GO:0008420) |
| 0.0 | 0.3 | GO:0008093 | cytoskeletal adaptor activity(GO:0008093) |
| 0.0 | 0.1 | GO:0004514 | nicotinate-nucleotide diphosphorylase (carboxylating) activity(GO:0004514) |
| 0.0 | 0.0 | GO:0031705 | bombesin receptor binding(GO:0031705) |
| 0.0 | 0.1 | GO:0034452 | dynactin binding(GO:0034452) |
| 0.0 | 0.1 | GO:0086008 | voltage-gated potassium channel activity involved in cardiac muscle cell action potential repolarization(GO:0086008) |
| 0.0 | 0.1 | GO:0005173 | stem cell factor receptor binding(GO:0005173) |
| 0.0 | 0.1 | GO:0004558 | alpha-1,4-glucosidase activity(GO:0004558) |
| 0.0 | 0.1 | GO:0005499 | vitamin D binding(GO:0005499) |
| 0.0 | 0.3 | GO:0097602 | cullin family protein binding(GO:0097602) |
| 0.0 | 0.1 | GO:0047023 | androsterone dehydrogenase activity(GO:0047023) |
| 0.0 | 0.5 | GO:0042166 | acetylcholine binding(GO:0042166) |
| 0.0 | 0.0 | GO:0004967 | glucagon receptor activity(GO:0004967) |
| 0.0 | 0.2 | GO:0038036 | sphingosine-1-phosphate receptor activity(GO:0038036) |
| 0.0 | 0.3 | GO:0051019 | mitogen-activated protein kinase binding(GO:0051019) |
| 0.0 | 0.1 | GO:0050567 | glutaminyl-tRNA synthase (glutamine-hydrolyzing) activity(GO:0050567) |
| 0.0 | 0.1 | GO:0004971 | AMPA glutamate receptor activity(GO:0004971) |
| 0.0 | 0.2 | GO:0070700 | BMP receptor binding(GO:0070700) |
| 0.0 | 0.1 | GO:0034739 | histone deacetylase activity (H4-K16 specific)(GO:0034739) |
| 0.0 | 0.5 | GO:0005537 | mannose binding(GO:0005537) |
| 0.0 | 0.2 | GO:0008656 | cysteine-type endopeptidase activator activity involved in apoptotic process(GO:0008656) |
| 0.0 | 0.1 | GO:0004052 | arachidonate 12-lipoxygenase activity(GO:0004052) |
| 0.0 | 0.5 | GO:0046875 | ephrin receptor binding(GO:0046875) |
| 0.0 | 0.3 | GO:0008331 | high voltage-gated calcium channel activity(GO:0008331) |
| 0.0 | 0.2 | GO:0004415 | hyalurononglucosaminidase activity(GO:0004415) |
| 0.0 | 0.1 | GO:0005148 | prolactin receptor binding(GO:0005148) |
| 0.0 | 1.7 | GO:0008378 | galactosyltransferase activity(GO:0008378) |
| 0.0 | 0.1 | GO:0016004 | phospholipase activator activity(GO:0016004) |
| 0.0 | 0.1 | GO:0033142 | progesterone receptor binding(GO:0033142) |
| 0.0 | 0.3 | GO:0017134 | fibroblast growth factor binding(GO:0017134) |
| 0.0 | 0.1 | GO:0005134 | interleukin-2 receptor binding(GO:0005134) |
| 0.0 | 0.1 | GO:0048273 | mitogen-activated protein kinase p38 binding(GO:0048273) |
| 0.0 | 2.5 | GO:0003774 | motor activity(GO:0003774) |
| 0.0 | 0.1 | GO:0001031 | RNA polymerase III type 1 promoter DNA binding(GO:0001030) RNA polymerase III type 2 promoter DNA binding(GO:0001031) RNA polymerase III type 3 promoter DNA binding(GO:0001032) 5S rDNA binding(GO:0080084) |
| 0.0 | 0.2 | GO:0022858 | L-alanine transmembrane transporter activity(GO:0015180) alanine transmembrane transporter activity(GO:0022858) |
| 0.0 | 0.7 | GO:0019838 | growth factor binding(GO:0019838) |
| 0.0 | 0.1 | GO:0004974 | leukotriene receptor activity(GO:0004974) |
| 0.0 | 0.1 | GO:0004949 | cannabinoid receptor activity(GO:0004949) |
| 0.0 | 0.2 | GO:0030551 | cyclic nucleotide binding(GO:0030551) |
| 0.0 | 1.2 | GO:0008083 | growth factor activity(GO:0008083) |
| 0.0 | 0.1 | GO:0030911 | TPR domain binding(GO:0030911) |
| 0.0 | 0.4 | GO:0015095 | magnesium ion transmembrane transporter activity(GO:0015095) |
| 0.0 | 0.7 | GO:0008009 | chemokine activity(GO:0008009) |
| 0.0 | 0.1 | GO:0034513 | box H/ACA snoRNA binding(GO:0034513) |
| 0.0 | 2.4 | GO:0004222 | metalloendopeptidase activity(GO:0004222) |
| 0.0 | 0.0 | GO:0005157 | macrophage colony-stimulating factor receptor binding(GO:0005157) |
| 0.0 | 1.4 | GO:0005178 | integrin binding(GO:0005178) |
| 0.0 | 0.2 | GO:0033743 | peptide-methionine (R)-S-oxide reductase activity(GO:0033743) |
| 0.0 | 0.1 | GO:0070815 | peptidyl-lysine 5-dioxygenase activity(GO:0070815) |
| 0.0 | 2.7 | GO:0004867 | serine-type endopeptidase inhibitor activity(GO:0004867) |
| 0.0 | 0.6 | GO:0005546 | phosphatidylinositol-4,5-bisphosphate binding(GO:0005546) |
| 0.0 | 0.1 | GO:0004791 | thioredoxin-disulfide reductase activity(GO:0004791) |
| 0.0 | 0.1 | GO:0004416 | hydroxyacylglutathione hydrolase activity(GO:0004416) |
| 0.0 | 0.4 | GO:0005035 | tumor necrosis factor-activated receptor activity(GO:0005031) death receptor activity(GO:0005035) |
| 0.0 | 0.3 | GO:0098531 | RNA polymerase II transcription factor activity, ligand-activated sequence-specific DNA binding(GO:0004879) transcription factor activity, direct ligand regulated sequence-specific DNA binding(GO:0098531) |
| 0.0 | 0.0 | GO:0004427 | inorganic diphosphatase activity(GO:0004427) |
| 0.0 | 0.4 | GO:0016917 | GABA receptor activity(GO:0016917) |
| 0.0 | 0.2 | GO:0004596 | peptide alpha-N-acetyltransferase activity(GO:0004596) |
| 0.0 | 0.1 | GO:0004832 | valine-tRNA ligase activity(GO:0004832) |
| 0.0 | 0.1 | GO:0004616 | phosphogluconate dehydrogenase (decarboxylating) activity(GO:0004616) |
| 0.0 | 0.1 | GO:0051431 | corticotropin-releasing hormone receptor 2 binding(GO:0051431) |
| 0.0 | 0.2 | GO:0071837 | HMG box domain binding(GO:0071837) |
| 0.0 | 3.3 | GO:0005125 | cytokine activity(GO:0005125) |
| 0.0 | 0.3 | GO:0005234 | extracellular-glutamate-gated ion channel activity(GO:0005234) |
| 0.0 | 0.1 | GO:0008449 | N-acetylglucosamine-6-sulfatase activity(GO:0008449) |
| 0.0 | 0.2 | GO:0039706 | co-receptor binding(GO:0039706) |
| 0.0 | 0.1 | GO:0004488 | methylenetetrahydrofolate dehydrogenase (NADP+) activity(GO:0004488) |
| 0.0 | 0.3 | GO:0051879 | Hsp90 protein binding(GO:0051879) |
| 0.0 | 0.1 | GO:0030550 | acetylcholine receptor inhibitor activity(GO:0030550) |
| 0.0 | 0.4 | GO:0004198 | calcium-dependent cysteine-type endopeptidase activity(GO:0004198) |
| 0.0 | 0.1 | GO:0005047 | signal recognition particle binding(GO:0005047) |
| 0.0 | 0.1 | GO:0004829 | threonine-tRNA ligase activity(GO:0004829) |
| 0.0 | 0.1 | GO:0098631 | protein binding involved in cell adhesion(GO:0098631) |
| 0.0 | 0.1 | GO:0042134 | rRNA primary transcript binding(GO:0042134) |
| 0.0 | 0.5 | GO:0004181 | metallocarboxypeptidase activity(GO:0004181) |
| 0.0 | 0.0 | GO:0016849 | phosphorus-oxygen lyase activity(GO:0016849) |
| 0.0 | 0.3 | GO:0051721 | protein phosphatase 2A binding(GO:0051721) |
| 0.0 | 0.1 | GO:0001846 | opsonin binding(GO:0001846) |
| 0.0 | 0.1 | GO:0043495 | protein anchor(GO:0043495) |
| 0.0 | 0.1 | GO:0008504 | monoamine transmembrane transporter activity(GO:0008504) |
| 0.0 | 0.1 | GO:0000155 | phosphorelay sensor kinase activity(GO:0000155) |
| 0.0 | 0.1 | GO:0005502 | 11-cis retinal binding(GO:0005502) |
| 0.0 | 0.1 | GO:0047760 | butyrate-CoA ligase activity(GO:0047760) |
| 0.0 | 0.2 | GO:0043539 | protein serine/threonine kinase activator activity(GO:0043539) |
| 0.0 | 0.1 | GO:0034450 | ubiquitin-ubiquitin ligase activity(GO:0034450) |
| 0.0 | 0.4 | GO:0098811 | transcriptional activator activity, RNA polymerase II transcription factor binding(GO:0001190) transcriptional repressor activity, RNA polymerase II activating transcription factor binding(GO:0098811) |
| 0.0 | 0.1 | GO:0002046 | opsin binding(GO:0002046) |
| 0.0 | 0.0 | GO:0005128 | erythropoietin receptor binding(GO:0005128) |
| 0.0 | 0.1 | GO:0004740 | pyruvate dehydrogenase (acetyl-transferring) kinase activity(GO:0004740) |
| 0.0 | 0.1 | GO:0004045 | aminoacyl-tRNA hydrolase activity(GO:0004045) |
| 0.0 | 0.1 | GO:0019002 | GMP binding(GO:0019002) |
| 0.0 | 0.2 | GO:0005522 | profilin binding(GO:0005522) |
| 0.0 | 0.1 | GO:0004735 | pyrroline-5-carboxylate reductase activity(GO:0004735) |
| 0.0 | 0.1 | GO:0046975 | histone methyltransferase activity (H3-K36 specific)(GO:0046975) |
| 0.0 | 0.1 | GO:0004679 | AMP-activated protein kinase activity(GO:0004679) |
| 0.0 | 0.1 | GO:0033130 | acetylcholine receptor binding(GO:0033130) |
| 0.0 | 0.0 | GO:0015252 | hydrogen ion channel activity(GO:0015252) |
| 0.0 | 0.1 | GO:0046923 | ER retention sequence binding(GO:0046923) |
| 0.0 | 0.1 | GO:0000099 | sulfur amino acid transmembrane transporter activity(GO:0000099) |
| 0.0 | 0.1 | GO:0045545 | syndecan binding(GO:0045545) |
| 0.0 | 0.1 | GO:0008900 | hydrogen:potassium-exchanging ATPase activity(GO:0008900) |
| 0.0 | 0.2 | GO:0004714 | transmembrane receptor protein tyrosine kinase activity(GO:0004714) |
| 0.0 | 0.5 | GO:0004715 | non-membrane spanning protein tyrosine kinase activity(GO:0004715) |
| 0.0 | 0.2 | GO:0005149 | interleukin-1 receptor binding(GO:0005149) |
| 0.0 | 0.2 | GO:0004535 | poly(A)-specific ribonuclease activity(GO:0004535) |
| 0.0 | 0.1 | GO:0052834 | inositol monophosphate 1-phosphatase activity(GO:0008934) inositol monophosphate 3-phosphatase activity(GO:0052832) inositol monophosphate 4-phosphatase activity(GO:0052833) inositol monophosphate phosphatase activity(GO:0052834) |
| 0.0 | 0.1 | GO:0005534 | galactose binding(GO:0005534) |
| 0.0 | 0.1 | GO:0042834 | peptidoglycan binding(GO:0042834) |
| 0.0 | 0.2 | GO:0016929 | SUMO-specific protease activity(GO:0016929) |
| 0.0 | 0.1 | GO:0015349 | thyroid hormone transmembrane transporter activity(GO:0015349) |
| 0.0 | 7.2 | GO:0005509 | calcium ion binding(GO:0005509) |
| 0.0 | 0.2 | GO:0030371 | translation repressor activity(GO:0030371) |
| 0.0 | 1.7 | GO:0005179 | hormone activity(GO:0005179) |
| 0.0 | 0.0 | GO:0008252 | nucleotidase activity(GO:0008252) |
| 0.0 | 0.0 | GO:0035727 | lysophosphatidic acid binding(GO:0035727) |
| 0.0 | 0.1 | GO:0003988 | acetyl-CoA C-acyltransferase activity(GO:0003988) |
| 0.0 | 0.2 | GO:0030332 | cyclin binding(GO:0030332) |
| 0.0 | 0.3 | GO:0005242 | inward rectifier potassium channel activity(GO:0005242) |
| 0.0 | 0.1 | GO:0042577 | lipid phosphatase activity(GO:0042577) |
| 0.0 | 0.3 | GO:0005109 | frizzled binding(GO:0005109) |
| 0.0 | 0.0 | GO:0017166 | vinculin binding(GO:0017166) |
| 0.0 | 0.0 | GO:0019870 | potassium channel inhibitor activity(GO:0019870) |
| 0.0 | 0.1 | GO:0042979 | ornithine decarboxylase regulator activity(GO:0042979) |
| 0.0 | 0.1 | GO:0009881 | photoreceptor activity(GO:0009881) |
| 0.0 | 0.0 | GO:0070840 | dynein complex binding(GO:0070840) |
| 0.0 | 0.0 | GO:0000014 | single-stranded DNA endodeoxyribonuclease activity(GO:0000014) |
| 0.0 | 0.2 | GO:0005246 | calcium channel regulator activity(GO:0005246) |
| 0.0 | 0.0 | GO:0032052 | bile acid binding(GO:0032052) |
| 0.0 | 0.8 | GO:0001076 | transcription factor activity, RNA polymerase II transcription factor binding(GO:0001076) |
| 0.0 | 0.0 | GO:0004814 | arginine-tRNA ligase activity(GO:0004814) |
| 0.0 | 0.1 | GO:0001972 | retinoic acid binding(GO:0001972) |
| 0.0 | 0.3 | GO:0015485 | cholesterol binding(GO:0015485) |
| 0.0 | 0.0 | GO:0003986 | acetyl-CoA hydrolase activity(GO:0003986) |
| 0.0 | 0.1 | GO:0044466 | 2-oxoglutaryl-CoA thioesterase activity(GO:0034843) 2,4,4-trimethyl-3-oxopentanoyl-CoA thioesterase activity(GO:0034869) 3-isopropylbut-3-enoyl-CoA thioesterase activity(GO:0034946) glutaryl-CoA hydrolase activity(GO:0044466) |
| 0.0 | 0.0 | GO:0042281 | dolichyl pyrophosphate Man9GlcNAc2 alpha-1,3-glucosyltransferase activity(GO:0042281) |
| 0.0 | 0.1 | GO:0005049 | nuclear export signal receptor activity(GO:0005049) |
| 0.0 | 0.0 | GO:0030280 | structural constituent of epidermis(GO:0030280) |
| 0.0 | 0.1 | GO:0050072 | m7G(5')pppN diphosphatase activity(GO:0050072) |
| 0.0 | 0.1 | GO:0031849 | olfactory receptor binding(GO:0031849) |
| 0.0 | 0.0 | GO:0004813 | alanine-tRNA ligase activity(GO:0004813) |
| 0.0 | 0.1 | GO:0003840 | gamma-glutamyltransferase activity(GO:0003840) glutathione hydrolase activity(GO:0036374) |
| 0.0 | 0.1 | GO:0055106 | ubiquitin-protein transferase regulator activity(GO:0055106) |
| 0.0 | 0.0 | GO:0043184 | vascular endothelial growth factor receptor 2 binding(GO:0043184) |
| 0.0 | 0.1 | GO:0015181 | arginine transmembrane transporter activity(GO:0015181) L-lysine transmembrane transporter activity(GO:0015189) |
| 0.0 | 0.0 | GO:0032356 | oxidized DNA binding(GO:0032356) oxidized purine DNA binding(GO:0032357) |
| 0.0 | 0.0 | GO:0016494 | C-X-C chemokine receptor activity(GO:0016494) |
| 0.0 | 0.1 | GO:0071558 | histone demethylase activity (H3-K27 specific)(GO:0071558) |
| 0.0 | 0.0 | GO:0016838 | carbon-oxygen lyase activity, acting on phosphates(GO:0016838) |
| 0.0 | 0.1 | GO:0000175 | 3'-5'-exoribonuclease activity(GO:0000175) exoribonuclease activity, producing 5'-phosphomonoesters(GO:0016896) |
| 0.0 | 0.3 | GO:0019894 | kinesin binding(GO:0019894) |
| 0.0 | 0.5 | GO:0004722 | protein serine/threonine phosphatase activity(GO:0004722) |
| 0.0 | 0.1 | GO:0047499 | calcium-independent phospholipase A2 activity(GO:0047499) |
| 0.0 | 0.0 | GO:0016775 | phosphotransferase activity, nitrogenous group as acceptor(GO:0016775) |
| 0.0 | 0.4 | GO:0097472 | cyclin-dependent protein serine/threonine kinase activity(GO:0004693) cyclin-dependent protein kinase activity(GO:0097472) |
| 0.0 | 0.2 | GO:0017110 | nucleoside-diphosphatase activity(GO:0017110) |
| 0.0 | 0.0 | GO:0008796 | bis(5'-nucleosyl)-tetraphosphatase activity(GO:0008796) |
| 0.0 | 0.0 | GO:0004652 | polynucleotide adenylyltransferase activity(GO:0004652) |
| 0.0 | 0.1 | GO:0005092 | GDP-dissociation inhibitor activity(GO:0005092) |
| 0.0 | 0.0 | GO:0008502 | melatonin receptor activity(GO:0008502) |
| 0.0 | 0.1 | GO:0004861 | cyclin-dependent protein serine/threonine kinase inhibitor activity(GO:0004861) |
| 0.0 | 0.0 | GO:0019136 | deoxynucleoside kinase activity(GO:0019136) |
| 0.0 | 0.0 | GO:0008200 | ion channel inhibitor activity(GO:0008200) |
| 0.0 | 0.2 | GO:0005385 | zinc ion transmembrane transporter activity(GO:0005385) |
| 0.0 | 0.0 | GO:0048156 | tau protein binding(GO:0048156) |
| 0.0 | 0.0 | GO:1990829 | C-rich single-stranded DNA binding(GO:1990829) |
| 0.0 | 0.4 | GO:0008138 | protein tyrosine/serine/threonine phosphatase activity(GO:0008138) |
| 0.0 | 0.4 | GO:0060090 | binding, bridging(GO:0060090) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.2 | 2.2 | ST STAT3 PATHWAY | STAT3 Pathway |
| 0.2 | 0.5 | PID INTEGRIN4 PATHWAY | Alpha6 beta4 integrin-ligand interactions |
| 0.2 | 9.4 | NABA COLLAGENS | Genes encoding collagen proteins |
| 0.2 | 5.0 | NABA BASEMENT MEMBRANES | Genes encoding structural components of basement membranes |
| 0.2 | 5.1 | PID EPHRINB REV PATHWAY | Ephrin B reverse signaling |
| 0.2 | 3.5 | PID RXR VDR PATHWAY | RXR and RAR heterodimerization with other nuclear receptor |
| 0.2 | 5.2 | PID INTEGRIN1 PATHWAY | Beta1 integrin cell surface interactions |
| 0.2 | 0.2 | PID IL8 CXCR1 PATHWAY | IL8- and CXCR1-mediated signaling events |
| 0.2 | 4.7 | PID RAS PATHWAY | Regulation of Ras family activation |
| 0.1 | 0.1 | PID IFNG PATHWAY | IFN-gamma pathway |
| 0.1 | 5.8 | PID KIT PATHWAY | Signaling events mediated by Stem cell factor receptor (c-Kit) |
| 0.1 | 2.7 | PID PRL SIGNALING EVENTS PATHWAY | Signaling events mediated by PRL |
| 0.1 | 1.1 | PID A6B1 A6B4 INTEGRIN PATHWAY | a6b1 and a6b4 Integrin signaling |
| 0.1 | 3.2 | PID ALK1 PATHWAY | ALK1 signaling events |
| 0.1 | 0.7 | PID INTEGRIN5 PATHWAY | Beta5 beta6 beta7 and beta8 integrin cell surface interactions |
| 0.1 | 5.6 | PID HES HEY PATHWAY | Notch-mediated HES/HEY network |
| 0.1 | 2.0 | PID ERBB NETWORK PATHWAY | ErbB receptor signaling network |
| 0.1 | 1.9 | PID INTEGRIN3 PATHWAY | Beta3 integrin cell surface interactions |
| 0.1 | 1.7 | PID LPA4 PATHWAY | LPA4-mediated signaling events |
| 0.1 | 1.8 | PID CIRCADIAN PATHWAY | Circadian rhythm pathway |
| 0.1 | 2.3 | PID INSULIN GLUCOSE PATHWAY | Insulin-mediated glucose transport |
| 0.1 | 2.4 | ST MYOCYTE AD PATHWAY | Myocyte Adrenergic Pathway is a specific case of the generalized Adrenergic Pathway. |
| 0.1 | 0.1 | PID ARF6 DOWNSTREAM PATHWAY | Arf6 downstream pathway |
| 0.1 | 2.3 | SIG BCR SIGNALING PATHWAY | Members of the BCR signaling pathway |
| 0.1 | 0.3 | SA PTEN PATHWAY | PTEN is a tumor suppressor that dephosphorylates the lipid messenger phosphatidylinositol triphosphate. |
| 0.1 | 1.1 | PID P38 MK2 PATHWAY | p38 signaling mediated by MAPKAP kinases |
| 0.1 | 0.5 | PID IGF1 PATHWAY | IGF1 pathway |
| 0.1 | 0.4 | PID NECTIN PATHWAY | Nectin adhesion pathway |
| 0.1 | 1.0 | PID INTEGRIN A9B1 PATHWAY | Alpha9 beta1 integrin signaling events |
| 0.1 | 1.8 | PID CDC42 REG PATHWAY | Regulation of CDC42 activity |
| 0.1 | 1.5 | ST ERK1 ERK2 MAPK PATHWAY | ERK1/ERK2 MAPK Pathway |
| 0.1 | 1.1 | PID SMAD2 3PATHWAY | Regulation of cytoplasmic and nuclear SMAD2/3 signaling |
| 0.1 | 3.2 | PID RHOA REG PATHWAY | Regulation of RhoA activity |
| 0.1 | 0.2 | ST GRANULE CELL SURVIVAL PATHWAY | Granule Cell Survival Pathway is a specific case of more general PAC1 Receptor Pathway. |
| 0.1 | 0.9 | SIG PIP3 SIGNALING IN CARDIAC MYOCTES | Genes related to PIP3 signaling in cardiac myocytes |
| 0.1 | 0.8 | PID GLYPICAN 1PATHWAY | Glypican 1 network |
| 0.1 | 0.3 | PID WNT NONCANONICAL PATHWAY | Noncanonical Wnt signaling pathway |
| 0.1 | 1.6 | PID SHP2 PATHWAY | SHP2 signaling |
| 0.1 | 2.3 | PID AR TF PATHWAY | Regulation of Androgen receptor activity |
| 0.1 | 1.2 | PID EPHA FWDPATHWAY | EPHA forward signaling |
| 0.1 | 2.7 | PID MET PATHWAY | Signaling events mediated by Hepatocyte Growth Factor Receptor (c-Met) |
| 0.1 | 0.4 | PID GMCSF PATHWAY | GMCSF-mediated signaling events |
| 0.1 | 1.0 | ST GA13 PATHWAY | G alpha 13 Pathway |
| 0.1 | 0.7 | PID NEPHRIN NEPH1 PATHWAY | Nephrin/Neph1 signaling in the kidney podocyte |
| 0.1 | 0.6 | SA MMP CYTOKINE CONNECTION | Cytokines can induce activation of matrix metalloproteinases, which degrade extracellular matrix. |
| 0.1 | 0.3 | ST G ALPHA I PATHWAY | G alpha i Pathway |
| 0.1 | 0.1 | PID INTEGRIN A4B1 PATHWAY | Alpha4 beta1 integrin signaling events |
| 0.1 | 0.6 | PID IL6 7 PATHWAY | IL6-mediated signaling events |
| 0.1 | 0.2 | PID ANTHRAX PATHWAY | Cellular roles of Anthrax toxin |
| 0.1 | 1.4 | PID WNT SIGNALING PATHWAY | Wnt signaling network |
| 0.1 | 1.0 | PID TRKR PATHWAY | Neurotrophic factor-mediated Trk receptor signaling |
| 0.0 | 0.3 | PID ECADHERIN KERATINOCYTE PATHWAY | E-cadherin signaling in keratinocytes |
| 0.0 | 0.1 | PID AR NONGENOMIC PATHWAY | Nongenotropic Androgen signaling |
| 0.0 | 6.4 | NABA ECM GLYCOPROTEINS | Genes encoding structural ECM glycoproteins |
| 0.0 | 0.7 | SIG CD40PATHWAYMAP | Genes related to CD40 signaling |
| 0.0 | 2.6 | WNT SIGNALING | Genes related to Wnt-mediated signal transduction |
| 0.0 | 0.3 | PID VEGFR1 2 PATHWAY | Signaling events mediated by VEGFR1 and VEGFR2 |
| 0.0 | 0.6 | PID IL1 PATHWAY | IL1-mediated signaling events |
| 0.0 | 0.2 | SA G2 AND M PHASES | Cdc25 activates the cdc2/cyclin B complex to induce the G2/M transition. |
| 0.0 | 0.7 | PID HEDGEHOG 2PATHWAY | Signaling events mediated by the Hedgehog family |
| 0.0 | 0.1 | ST JAK STAT PATHWAY | Jak-STAT Pathway |
| 0.0 | 0.3 | PID RHODOPSIN PATHWAY | Visual signal transduction: Rods |
| 0.0 | 0.1 | ST G ALPHA S PATHWAY | G alpha s Pathway |
| 0.0 | 0.8 | PID CONE PATHWAY | Visual signal transduction: Cones |
| 0.0 | 8.8 | NABA SECRETED FACTORS | Genes encoding secreted soluble factors |
| 0.0 | 0.1 | PID S1P S1P3 PATHWAY | S1P3 pathway |
| 0.0 | 0.2 | PID THROMBIN PAR4 PATHWAY | PAR4-mediated thrombin signaling events |
| 0.0 | 0.3 | ST DIFFERENTIATION PATHWAY IN PC12 CELLS | Differentiation Pathway in PC12 Cells; this is a specific case of PAC1 Receptor Pathway. |
| 0.0 | 0.9 | PID ATF2 PATHWAY | ATF-2 transcription factor network |
| 0.0 | 0.1 | PID S1P S1P2 PATHWAY | S1P2 pathway |
| 0.0 | 0.1 | PID S1P META PATHWAY | Sphingosine 1-phosphate (S1P) pathway |
| 0.0 | 0.3 | PID WNT CANONICAL PATHWAY | Canonical Wnt signaling pathway |
| 0.0 | 1.0 | PID PDGFRB PATHWAY | PDGFR-beta signaling pathway |
| 0.0 | 0.0 | SA B CELL RECEPTOR COMPLEXES | Antigen binding to B cell receptors activates protein tyrosine kinases, such as the Src family, which ultimate activate MAP kinases. |
| 0.0 | 0.6 | PID ENDOTHELIN PATHWAY | Endothelins |
| 0.0 | 0.2 | PID S1P S1P4 PATHWAY | S1P4 pathway |
| 0.0 | 0.1 | PID PDGFRA PATHWAY | PDGFR-alpha signaling pathway |
| 0.0 | 0.3 | PID HIF1A PATHWAY | Hypoxic and oxygen homeostasis regulation of HIF-1-alpha |
| 0.0 | 0.2 | PID ATM PATHWAY | ATM pathway |
| 0.0 | 0.1 | PID RETINOIC ACID PATHWAY | Retinoic acid receptors-mediated signaling |
| 0.0 | 0.5 | ST JNK MAPK PATHWAY | JNK MAPK Pathway |
| 0.0 | 0.1 | PID P38 ALPHA BETA PATHWAY | Regulation of p38-alpha and p38-beta |
| 0.0 | 0.6 | PID MYC REPRESS PATHWAY | Validated targets of C-MYC transcriptional repression |
| 0.0 | 0.0 | PID TCPTP PATHWAY | Signaling events mediated by TCPTP |
| 0.0 | 0.2 | PID SYNDECAN 4 PATHWAY | Syndecan-4-mediated signaling events |
| 0.0 | 0.0 | PID LYMPH ANGIOGENESIS PATHWAY | VEGFR3 signaling in lymphatic endothelium |
| 0.0 | 0.3 | PID P38 ALPHA BETA DOWNSTREAM PATHWAY | Signaling mediated by p38-alpha and p38-beta |
| 0.0 | 2.5 | NABA ECM AFFILIATED | Genes encoding proteins affiliated structurally or functionally to extracellular matrix proteins |
| 0.0 | 0.3 | PID AP1 PATHWAY | AP-1 transcription factor network |
| 0.0 | 3.7 | NABA MATRISOME ASSOCIATED | Ensemble of genes encoding ECM-associated proteins including ECM-affilaited proteins, ECM regulators and secreted factors |
| 0.0 | 0.4 | PID IL4 2PATHWAY | IL4-mediated signaling events |
| 0.0 | 0.3 | PID HEDGEHOG GLI PATHWAY | Hedgehog signaling events mediated by Gli proteins |
| 0.0 | 0.4 | PID LKB1 PATHWAY | LKB1 signaling events |
| 0.0 | 0.1 | ST INTEGRIN SIGNALING PATHWAY | Integrin Signaling Pathway |
| 0.0 | 0.1 | PID AJDISS 2PATHWAY | Posttranslational regulation of adherens junction stability and dissassembly |
| 0.0 | 0.1 | PID LYSOPHOSPHOLIPID PATHWAY | LPA receptor mediated events |
| 0.0 | 0.1 | PID EPHB FWD PATHWAY | EPHB forward signaling |
| 0.0 | 0.4 | PID HDAC CLASSI PATHWAY | Signaling events mediated by HDAC Class I |
| 0.0 | 0.0 | PID P38 GAMMA DELTA PATHWAY | Signaling mediated by p38-gamma and p38-delta |
| 0.0 | 0.0 | PID ERBB1 RECEPTOR PROXIMAL PATHWAY | EGF receptor (ErbB1) signaling pathway |
| 0.0 | 0.1 | PID UPA UPAR PATHWAY | Urokinase-type plasminogen activator (uPA) and uPAR-mediated signaling |
| 0.0 | 0.3 | PID TCR PATHWAY | TCR signaling in naïve CD4+ T cells |
| 0.0 | 0.1 | PID FAK PATHWAY | Signaling events mediated by focal adhesion kinase |
| 0.0 | 0.1 | PID PI3KCI AKT PATHWAY | Class I PI3K signaling events mediated by Akt |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.3 | 2.7 | REACTOME PECAM1 INTERACTIONS | Genes involved in PECAM1 interactions |
| 0.3 | 2.1 | REACTOME ROLE OF SECOND MESSENGERS IN NETRIN1 SIGNALING | Genes involved in Role of second messengers in netrin-1 signaling |
| 0.2 | 0.9 | REACTOME BINDING AND ENTRY OF HIV VIRION | Genes involved in Binding and entry of HIV virion |
| 0.2 | 1.4 | REACTOME SIGNALING BY TGF BETA RECEPTOR COMPLEX | Genes involved in Signaling by TGF-beta Receptor Complex |
| 0.2 | 2.2 | REACTOME FACILITATIVE NA INDEPENDENT GLUCOSE TRANSPORTERS | Genes involved in Facilitative Na+-independent glucose transporters |
| 0.2 | 2.0 | REACTOME ACETYLCHOLINE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Acetylcholine Neurotransmitter Release Cycle |
| 0.2 | 0.4 | REACTOME REGULATION OF INSULIN SECRETION BY ACETYLCHOLINE | Genes involved in Regulation of Insulin Secretion by Acetylcholine |
| 0.2 | 0.5 | REACTOME OLFACTORY SIGNALING PATHWAY | Genes involved in Olfactory Signaling Pathway |
| 0.2 | 8.1 | REACTOME NUCLEAR RECEPTOR TRANSCRIPTION PATHWAY | Genes involved in Nuclear Receptor transcription pathway |
| 0.2 | 1.9 | REACTOME P2Y RECEPTORS | Genes involved in P2Y receptors |
| 0.2 | 1.7 | REACTOME PROLACTIN RECEPTOR SIGNALING | Genes involved in Prolactin receptor signaling |
| 0.2 | 8.7 | REACTOME COLLAGEN FORMATION | Genes involved in Collagen formation |
| 0.2 | 0.2 | REACTOME TRANSLOCATION OF ZAP 70 TO IMMUNOLOGICAL SYNAPSE | Genes involved in Translocation of ZAP-70 to Immunological synapse |
| 0.2 | 0.2 | REACTOME THE ROLE OF NEF IN HIV1 REPLICATION AND DISEASE PATHOGENESIS | Genes involved in The role of Nef in HIV-1 replication and disease pathogenesis |
| 0.2 | 1.9 | REACTOME GABA A RECEPTOR ACTIVATION | Genes involved in GABA A receptor activation |
| 0.1 | 1.5 | REACTOME BASE FREE SUGAR PHOSPHATE REMOVAL VIA THE SINGLE NUCLEOTIDE REPLACEMENT PATHWAY | Genes involved in Base-free sugar-phosphate removal via the single-nucleotide replacement pathway |
| 0.1 | 4.0 | REACTOME STRIATED MUSCLE CONTRACTION | Genes involved in Striated Muscle Contraction |
| 0.1 | 1.3 | REACTOME MEMBRANE BINDING AND TARGETTING OF GAG PROTEINS | Genes involved in Membrane binding and targetting of GAG proteins |
| 0.1 | 0.4 | REACTOME PHOSPHORYLATION OF CD3 AND TCR ZETA CHAINS | Genes involved in Phosphorylation of CD3 and TCR zeta chains |
| 0.1 | 1.0 | REACTOME RORA ACTIVATES CIRCADIAN EXPRESSION | Genes involved in RORA Activates Circadian Expression |
| 0.1 | 0.1 | REACTOME SIGNALING BY ERBB2 | Genes involved in Signaling by ERBB2 |
| 0.1 | 1.7 | REACTOME SYNTHESIS SECRETION AND INACTIVATION OF GIP | Genes involved in Synthesis, Secretion, and Inactivation of Glucose-dependent Insulinotropic Polypeptide (GIP) |
| 0.1 | 1.2 | REACTOME APOPTOTIC CLEAVAGE OF CELL ADHESION PROTEINS | Genes involved in Apoptotic cleavage of cell adhesion proteins |
| 0.1 | 1.9 | REACTOME ACTIVATION OF BH3 ONLY PROTEINS | Genes involved in Activation of BH3-only proteins |
| 0.1 | 1.1 | REACTOME ADENYLATE CYCLASE ACTIVATING PATHWAY | Genes involved in Adenylate cyclase activating pathway |
| 0.1 | 1.5 | REACTOME FGFR2C LIGAND BINDING AND ACTIVATION | Genes involved in FGFR2c ligand binding and activation |
| 0.1 | 0.1 | REACTOME FGFR4 LIGAND BINDING AND ACTIVATION | Genes involved in FGFR4 ligand binding and activation |
| 0.1 | 0.4 | REACTOME SHC MEDIATED SIGNALLING | Genes involved in SHC-mediated signalling |
| 0.1 | 1.8 | REACTOME AMINE DERIVED HORMONES | Genes involved in Amine-derived hormones |
| 0.1 | 1.7 | REACTOME OTHER SEMAPHORIN INTERACTIONS | Genes involved in Other semaphorin interactions |
| 0.1 | 4.3 | REACTOME INTERFERON GAMMA SIGNALING | Genes involved in Interferon gamma signaling |
| 0.1 | 1.3 | REACTOME ERKS ARE INACTIVATED | Genes involved in ERKs are inactivated |
| 0.1 | 0.5 | REACTOME IL 6 SIGNALING | Genes involved in Interleukin-6 signaling |
| 0.1 | 1.0 | REACTOME CASPASE MEDIATED CLEAVAGE OF CYTOSKELETAL PROTEINS | Genes involved in Caspase-mediated cleavage of cytoskeletal proteins |
| 0.1 | 1.9 | REACTOME GRB2 EVENTS IN ERBB2 SIGNALING | Genes involved in GRB2 events in ERBB2 signaling |
| 0.1 | 1.8 | REACTOME SIGNALING BY NODAL | Genes involved in Signaling by NODAL |
| 0.1 | 0.6 | REACTOME SYNTHESIS SECRETION AND INACTIVATION OF GLP1 | Genes involved in Synthesis, Secretion, and Inactivation of Glucagon-like Peptide-1 (GLP-1) |
| 0.1 | 1.5 | REACTOME GAP JUNCTION ASSEMBLY | Genes involved in Gap junction assembly |
| 0.1 | 0.1 | REACTOME THROMBIN SIGNALLING THROUGH PROTEINASE ACTIVATED RECEPTORS PARS | Genes involved in Thrombin signalling through proteinase activated receptors (PARs) |
| 0.1 | 1.7 | REACTOME CGMP EFFECTS | Genes involved in cGMP effects |
| 0.1 | 0.7 | REACTOME SHC MEDIATED CASCADE | Genes involved in SHC-mediated cascade |
| 0.1 | 0.1 | REACTOME ORC1 REMOVAL FROM CHROMATIN | Genes involved in Orc1 removal from chromatin |
| 0.1 | 0.2 | REACTOME CYCLIN A B1 ASSOCIATED EVENTS DURING G2 M TRANSITION | Genes involved in Cyclin A/B1 associated events during G2/M transition |
| 0.1 | 0.8 | REACTOME REGULATION OF RHEB GTPASE ACTIVITY BY AMPK | Genes involved in Regulation of Rheb GTPase activity by AMPK |
| 0.1 | 2.3 | REACTOME CYTOCHROME P450 ARRANGED BY SUBSTRATE TYPE | Genes involved in Cytochrome P450 - arranged by substrate type |
| 0.1 | 0.6 | REACTOME PROSTANOID LIGAND RECEPTORS | Genes involved in Prostanoid ligand receptors |
| 0.1 | 0.7 | REACTOME CTNNB1 PHOSPHORYLATION CASCADE | Genes involved in Beta-catenin phosphorylation cascade |
| 0.1 | 1.6 | REACTOME CIRCADIAN CLOCK | Genes involved in Circadian Clock |
| 0.1 | 2.6 | REACTOME IMMUNOREGULATORY INTERACTIONS BETWEEN A LYMPHOID AND A NON LYMPHOID CELL | Genes involved in Immunoregulatory interactions between a Lymphoid and a non-Lymphoid cell |
| 0.1 | 0.1 | REACTOME ANTIGEN PROCESSING CROSS PRESENTATION | Genes involved in Antigen processing-Cross presentation |
| 0.1 | 1.4 | REACTOME PRE NOTCH TRANSCRIPTION AND TRANSLATION | Genes involved in Pre-NOTCH Transcription and Translation |
| 0.1 | 0.4 | REACTOME ADP SIGNALLING THROUGH P2RY12 | Genes involved in ADP signalling through P2Y purinoceptor 12 |
| 0.1 | 0.8 | REACTOME ORGANIC CATION ANION ZWITTERION TRANSPORT | Genes involved in Organic cation/anion/zwitterion transport |
| 0.1 | 1.1 | REACTOME YAP1 AND WWTR1 TAZ STIMULATED GENE EXPRESSION | Genes involved in YAP1- and WWTR1 (TAZ)-stimulated gene expression |
| 0.1 | 0.5 | REACTOME GAP JUNCTION DEGRADATION | Genes involved in Gap junction degradation |
| 0.1 | 0.3 | REACTOME SIGNALING BY CONSTITUTIVELY ACTIVE EGFR | Genes involved in Signaling by constitutively active EGFR |
| 0.1 | 0.7 | REACTOME BILE SALT AND ORGANIC ANION SLC TRANSPORTERS | Genes involved in Bile salt and organic anion SLC transporters |
| 0.1 | 0.7 | REACTOME CRMPS IN SEMA3A SIGNALING | Genes involved in CRMPs in Sema3A signaling |
| 0.1 | 2.3 | REACTOME ACTIVATION OF CHAPERONE GENES BY XBP1S | Genes involved in Activation of Chaperone Genes by XBP1(S) |
| 0.1 | 0.3 | REACTOME DCC MEDIATED ATTRACTIVE SIGNALING | Genes involved in DCC mediated attractive signaling |
| 0.1 | 1.1 | REACTOME PEROXISOMAL LIPID METABOLISM | Genes involved in Peroxisomal lipid metabolism |
| 0.1 | 0.6 | REACTOME EXTRINSIC PATHWAY FOR APOPTOSIS | Genes involved in Extrinsic Pathway for Apoptosis |
| 0.1 | 1.0 | REACTOME AMYLOIDS | Genes involved in Amyloids |
| 0.1 | 0.4 | REACTOME OXYGEN DEPENDENT PROLINE HYDROXYLATION OF HYPOXIA INDUCIBLE FACTOR ALPHA | Genes involved in Oxygen-dependent Proline Hydroxylation of Hypoxia-inducible Factor Alpha |
| 0.1 | 0.1 | REACTOME FORMATION OF THE HIV1 EARLY ELONGATION COMPLEX | Genes involved in Formation of the HIV-1 Early Elongation Complex |
| 0.1 | 0.7 | REACTOME ACETYLCHOLINE BINDING AND DOWNSTREAM EVENTS | Genes involved in Acetylcholine Binding And Downstream Events |
| 0.0 | 0.6 | REACTOME REGULATION OF PYRUVATE DEHYDROGENASE PDH COMPLEX | Genes involved in Regulation of pyruvate dehydrogenase (PDH) complex |
| 0.0 | 0.2 | REACTOME REGULATION OF HYPOXIA INDUCIBLE FACTOR HIF BY OXYGEN | Genes involved in Regulation of Hypoxia-inducible Factor (HIF) by Oxygen |
| 0.0 | 0.4 | REACTOME SEROTONIN RECEPTORS | Genes involved in Serotonin receptors |
| 0.0 | 1.1 | REACTOME EXTRACELLULAR MATRIX ORGANIZATION | Genes involved in Extracellular matrix organization |
| 0.0 | 1.2 | REACTOME SYNTHESIS OF PIPS AT THE PLASMA MEMBRANE | Genes involved in Synthesis of PIPs at the plasma membrane |
| 0.0 | 0.1 | REACTOME DESTABILIZATION OF MRNA BY AUF1 HNRNP D0 | Genes involved in Destabilization of mRNA by AUF1 (hnRNP D0) |
| 0.0 | 0.8 | REACTOME SIGNALING BY BMP | Genes involved in Signaling by BMP |
| 0.0 | 0.5 | REACTOME COMMON PATHWAY | Genes involved in Common Pathway |
| 0.0 | 0.2 | REACTOME INHIBITION OF REPLICATION INITIATION OF DAMAGED DNA BY RB1 E2F1 | Genes involved in Inhibition of replication initiation of damaged DNA by RB1/E2F1 |
| 0.0 | 1.8 | REACTOME VOLTAGE GATED POTASSIUM CHANNELS | Genes involved in Voltage gated Potassium channels |
| 0.0 | 0.4 | REACTOME P38MAPK EVENTS | Genes involved in p38MAPK events |
| 0.0 | 0.4 | REACTOME MTORC1 MEDIATED SIGNALLING | Genes involved in mTORC1-mediated signalling |
| 0.0 | 1.2 | REACTOME INTERFERON ALPHA BETA SIGNALING | Genes involved in Interferon alpha/beta signaling |
| 0.0 | 0.3 | REACTOME DOWNSTREAM SIGNAL TRANSDUCTION | Genes involved in Downstream signal transduction |
| 0.0 | 0.0 | REACTOME MRNA DECAY BY 3 TO 5 EXORIBONUCLEASE | Genes involved in mRNA Decay by 3' to 5' Exoribonuclease |
| 0.0 | 0.8 | REACTOME GLYCOLYSIS | Genes involved in Glycolysis |
| 0.0 | 0.1 | REACTOME RETROGRADE NEUROTROPHIN SIGNALLING | Genes involved in Retrograde neurotrophin signalling |
| 0.0 | 0.2 | REACTOME NITRIC OXIDE STIMULATES GUANYLATE CYCLASE | Genes involved in Nitric oxide stimulates guanylate cyclase |
| 0.0 | 1.1 | REACTOME TIGHT JUNCTION INTERACTIONS | Genes involved in Tight junction interactions |
| 0.0 | 0.3 | REACTOME POL SWITCHING | Genes involved in Polymerase switching |
| 0.0 | 0.1 | REACTOME SEMA3A PAK DEPENDENT AXON REPULSION | Genes involved in Sema3A PAK dependent Axon repulsion |
| 0.0 | 0.0 | REACTOME THROMBOXANE SIGNALLING THROUGH TP RECEPTOR | Genes involved in Thromboxane signalling through TP receptor |
| 0.0 | 0.0 | REACTOME PHOSPHORYLATION OF THE APC C | Genes involved in Phosphorylation of the APC/C |
| 0.0 | 0.2 | REACTOME ABACAVIR TRANSPORT AND METABOLISM | Genes involved in Abacavir transport and metabolism |
| 0.0 | 0.5 | REACTOME SYNTHESIS OF SUBSTRATES IN N GLYCAN BIOSYTHESIS | Genes involved in Synthesis of substrates in N-glycan biosythesis |
| 0.0 | 1.4 | REACTOME INTEGRIN CELL SURFACE INTERACTIONS | Genes involved in Integrin cell surface interactions |
| 0.0 | 0.5 | REACTOME INSULIN SYNTHESIS AND PROCESSING | Genes involved in Insulin Synthesis and Processing |
| 0.0 | 0.1 | REACTOME EICOSANOID LIGAND BINDING RECEPTORS | Genes involved in Eicosanoid ligand-binding receptors |
| 0.0 | 0.6 | REACTOME EFFECTS OF PIP2 HYDROLYSIS | Genes involved in Effects of PIP2 hydrolysis |
| 0.0 | 1.5 | REACTOME DIABETES PATHWAYS | Genes involved in Diabetes pathways |
| 0.0 | 0.0 | REACTOME ACYL CHAIN REMODELLING OF PC | Genes involved in Acyl chain remodelling of PC |
| 0.0 | 0.5 | REACTOME HS GAG DEGRADATION | Genes involved in HS-GAG degradation |
| 0.0 | 0.2 | REACTOME TGF BETA RECEPTOR SIGNALING IN EMT EPITHELIAL TO MESENCHYMAL TRANSITION | Genes involved in TGF-beta receptor signaling in EMT (epithelial to mesenchymal transition) |
| 0.0 | 0.1 | REACTOME SEMA3A PLEXIN REPULSION SIGNALING BY INHIBITING INTEGRIN ADHESION | Genes involved in SEMA3A-Plexin repulsion signaling by inhibiting Integrin adhesion |
| 0.0 | 0.1 | REACTOME CD28 DEPENDENT VAV1 PATHWAY | Genes involved in CD28 dependent Vav1 pathway |
| 0.0 | 0.0 | REACTOME SEMA4D IN SEMAPHORIN SIGNALING | Genes involved in Sema4D in semaphorin signaling |
| 0.0 | 0.2 | REACTOME HORMONE SENSITIVE LIPASE HSL MEDIATED TRIACYLGLYCEROL HYDROLYSIS | Genes involved in Hormone-sensitive lipase (HSL)-mediated triacylglycerol hydrolysis |
| 0.0 | 0.5 | REACTOME SEMA4D INDUCED CELL MIGRATION AND GROWTH CONE COLLAPSE | Genes involved in Sema4D induced cell migration and growth-cone collapse |
| 0.0 | 0.5 | REACTOME INHIBITION OF VOLTAGE GATED CA2 CHANNELS VIA GBETA GAMMA SUBUNITS | Genes involved in Inhibition of voltage gated Ca2+ channels via Gbeta/gamma subunits |
| 0.0 | 0.4 | REACTOME SYNTHESIS AND INTERCONVERSION OF NUCLEOTIDE DI AND TRIPHOSPHATES | Genes involved in Synthesis and interconversion of nucleotide di- and triphosphates |
| 0.0 | 0.2 | REACTOME TRYPTOPHAN CATABOLISM | Genes involved in Tryptophan catabolism |
| 0.0 | 0.2 | REACTOME TRAFFICKING OF GLUR2 CONTAINING AMPA RECEPTORS | Genes involved in Trafficking of GluR2-containing AMPA receptors |
| 0.0 | 0.3 | REACTOME EXTENSION OF TELOMERES | Genes involved in Extension of Telomeres |
| 0.0 | 0.2 | REACTOME P75NTR RECRUITS SIGNALLING COMPLEXES | Genes involved in p75NTR recruits signalling complexes |
| 0.0 | 0.3 | REACTOME ZINC TRANSPORTERS | Genes involved in Zinc transporters |
| 0.0 | 0.1 | REACTOME GASTRIN CREB SIGNALLING PATHWAY VIA PKC AND MAPK | Genes involved in Gastrin-CREB signalling pathway via PKC and MAPK |
| 0.0 | 0.2 | REACTOME ACTIVATION OF IRF3 IRF7 MEDIATED BY TBK1 IKK EPSILON | Genes involved in Activation of IRF3/IRF7 mediated by TBK1/IKK epsilon |
| 0.0 | 0.1 | REACTOME INTEGRATION OF ENERGY METABOLISM | Genes involved in Integration of energy metabolism |
| 0.0 | 0.1 | REACTOME CD28 DEPENDENT PI3K AKT SIGNALING | Genes involved in CD28 dependent PI3K/Akt signaling |
| 0.0 | 0.1 | REACTOME INTEGRATION OF PROVIRUS | Genes involved in Integration of provirus |
| 0.0 | 0.3 | REACTOME ACYL CHAIN REMODELLING OF PS | Genes involved in Acyl chain remodelling of PS |
| 0.0 | 1.8 | REACTOME G ALPHA Q SIGNALLING EVENTS | Genes involved in G alpha (q) signalling events |
| 0.0 | 0.1 | REACTOME ACTIVATION OF NF KAPPAB IN B CELLS | Genes involved in Activation of NF-kappaB in B Cells |
| 0.0 | 0.1 | REACTOME NEF MEDIATED DOWNREGULATION OF MHC CLASS I COMPLEX CELL SURFACE EXPRESSION | Genes involved in Nef mediated downregulation of MHC class I complex cell surface expression |
| 0.0 | 0.1 | REACTOME PEPTIDE HORMONE BIOSYNTHESIS | Genes involved in Peptide hormone biosynthesis |
| 0.0 | 0.9 | REACTOME CLASS B 2 SECRETIN FAMILY RECEPTORS | Genes involved in Class B/2 (Secretin family receptors) |
| 0.0 | 0.0 | REACTOME ERK MAPK TARGETS | Genes involved in ERK/MAPK targets |
| 0.0 | 0.5 | REACTOME CHONDROITIN SULFATE DERMATAN SULFATE METABOLISM | Genes involved in Chondroitin sulfate/dermatan sulfate metabolism |
| 0.0 | 0.1 | REACTOME TRAFFICKING OF AMPA RECEPTORS | Genes involved in Trafficking of AMPA receptors |
| 0.0 | 0.1 | REACTOME KERATAN SULFATE DEGRADATION | Genes involved in Keratan sulfate degradation |
| 0.0 | 0.1 | REACTOME SIGNALING BY ROBO RECEPTOR | Genes involved in Signaling by Robo receptor |
| 0.0 | 0.0 | REACTOME SIGNAL ATTENUATION | Genes involved in Signal attenuation |
| 0.0 | 0.2 | REACTOME GLYCOGEN BREAKDOWN GLYCOGENOLYSIS | Genes involved in Glycogen breakdown (glycogenolysis) |
| 0.0 | 0.1 | REACTOME CREATION OF C4 AND C2 ACTIVATORS | Genes involved in Creation of C4 and C2 activators |
| 0.0 | 0.2 | REACTOME SIGNALING BY HIPPO | Genes involved in Signaling by Hippo |
| 0.0 | 0.3 | REACTOME MITOCHONDRIAL TRNA AMINOACYLATION | Genes involved in Mitochondrial tRNA aminoacylation |
| 0.0 | 0.0 | REACTOME INITIAL TRIGGERING OF COMPLEMENT | Genes involved in Initial triggering of complement |
| 0.0 | 0.0 | REACTOME IRAK1 RECRUITS IKK COMPLEX | Genes involved in IRAK1 recruits IKK complex |
| 0.0 | 0.1 | REACTOME SIGNAL TRANSDUCTION BY L1 | Genes involved in Signal transduction by L1 |
| 0.0 | 0.1 | REACTOME CYTOSOLIC SULFONATION OF SMALL MOLECULES | Genes involved in Cytosolic sulfonation of small molecules |
| 0.0 | 0.0 | REACTOME JNK C JUN KINASES PHOSPHORYLATION AND ACTIVATION MEDIATED BY ACTIVATED HUMAN TAK1 | Genes involved in JNK (c-Jun kinases) phosphorylation and activation mediated by activated human TAK1 |
| 0.0 | 0.0 | REACTOME DESTABILIZATION OF MRNA BY BRF1 | Genes involved in Destabilization of mRNA by Butyrate Response Factor 1 (BRF1) |
| 0.0 | 0.8 | REACTOME RESPIRATORY ELECTRON TRANSPORT ATP SYNTHESIS BY CHEMIOSMOTIC COUPLING AND HEAT PRODUCTION BY UNCOUPLING PROTEINS | Genes involved in Respiratory electron transport, ATP synthesis by chemiosmotic coupling, and heat production by uncoupling proteins. |
| 0.0 | 0.0 | REACTOME DOPAMINE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Dopamine Neurotransmitter Release Cycle |
| 0.0 | 0.1 | REACTOME ADVANCED GLYCOSYLATION ENDPRODUCT RECEPTOR SIGNALING | Genes involved in Advanced glycosylation endproduct receptor signaling |