Gene Symbol | Gene ID | Gene Info |
---|---|---|
Zfp524
|
ENSMUSG00000051184.6 | zinc finger protein 524 |
CRE | Gene | Distance | Association probability | Pearson corr. coef. | P-value | Plot |
---|---|---|---|---|---|---|
Zfp524 | chr7_5015904_5016055 | 172 | 0.700289 | 0.54 | 2.1e-05 | Click! |
Zfp524 | chr7_5014282_5014576 | 14 | 0.635568 | 0.18 | 1.8e-01 | Click! |
Zfp524 | chr7_5015658_5015858 | 49 | 0.720903 | 0.13 | 3.4e-01 | Click! |
Zfp524 | chr7_5015280_5015543 | 59 | 0.496264 | -0.08 | 5.7e-01 | Click! |
Zfp524 | chr7_5015061_5015251 | 314 | 0.356712 | 0.05 | 7.3e-01 | Click! |
Move your cursor over a bar to see sample name and corresponding Z-value.
Cis Regulatory Element (CRE) | Target Score | Top associated gene | Gene Info | Distance of CRE to TSS | CRE/Gene association probability |
---|---|---|---|---|---|
chr17_23540577_23541135 | 7.78 |
6330415G19Rik |
RIKEN cDNA 6330415G19 gene |
9943 |
0.08 |
chr17_23534984_23535361 | 5.01 |
6330415G19Rik |
RIKEN cDNA 6330415G19 gene |
15627 |
0.08 |
chr1_171079670_171080161 | 4.71 |
Gm27844 |
predicted gene, 27844 |
14 |
0.95 |
chr11_117204633_117204995 | 3.98 |
Septin9 |
septin 9 |
5153 |
0.19 |
chr2_93013668_93015442 | 3.95 |
Prdm11 |
PR domain containing 11 |
645 |
0.73 |
chr1_171072063_171072532 | 3.88 |
Gm27552 |
predicted gene, 27552 |
10 |
0.95 |
chr12_20921444_20921697 | 3.84 |
3110053B16Rik |
RIKEN cDNA 3110053B16 gene |
308 |
0.47 |
chr9_13246797_13247848 | 3.65 |
Ccdc82 |
coiled-coil domain containing 82 |
340 |
0.82 |
chr13_21234067_21234357 | 3.59 |
Trim27 |
tripartite motif-containing 27 |
44351 |
0.08 |
chr19_12488103_12488765 | 3.47 |
Dtx4 |
deltex 4, E3 ubiquitin ligase |
13020 |
0.1 |
chr2_24763086_24763581 | 3.44 |
Cacna1b |
calcium channel, voltage-dependent, N type, alpha 1B subunit |
181 |
0.95 |
chr17_23548660_23549312 | 3.38 |
6330415G19Rik |
RIKEN cDNA 6330415G19 gene |
1813 |
0.17 |
chr1_171064479_171064905 | 3.35 |
Mir6546 |
microRNA 6546 |
40 |
0.74 |
chr1_160906609_160907194 | 3.34 |
Rc3h1 |
RING CCCH (C3H) domains 1 |
483 |
0.62 |
chr19_58978781_58978960 | 3.32 |
Eno4 |
enolase 4 |
23414 |
0.16 |
chr4_46991653_46992403 | 3.28 |
Gabbr2 |
gamma-aminobutyric acid (GABA) B receptor, 2 |
155 |
0.95 |
chr8_71719267_71719714 | 3.26 |
Fcho1 |
FCH domain only 1 |
1817 |
0.18 |
chr13_21240987_21241157 | 3.23 |
Trim27 |
tripartite motif-containing 27 |
51211 |
0.07 |
chr9_124439906_124440949 | 3.16 |
Ppp2r3d |
protein phosphatase 2 (formerly 2A), regulatory subunit B'', delta |
441 |
0.79 |
chr4_11128592_11128751 | 3.13 |
Gm11829 |
predicted gene 11829 |
4656 |
0.13 |
chr1_173367143_173367780 | 3.11 |
Cadm3 |
cell adhesion molecule 3 |
172 |
0.94 |
chr9_44580129_44580422 | 3.06 |
Gm47230 |
predicted gene, 47230 |
648 |
0.47 |
chr12_111694014_111694759 | 3.05 |
Gm36635 |
predicted gene, 36635 |
8696 |
0.09 |
chr6_102563935_102564721 | 3.03 |
Cntn3 |
contactin 3 |
8773 |
0.3 |
chr9_104408538_104408856 | 3.03 |
Mir2136 |
microRNA 2136 |
17416 |
0.17 |
chr19_15340325_15340541 | 3.02 |
Gm24319 |
predicted gene, 24319 |
339571 |
0.01 |
chr13_21907970_21908124 | 2.99 |
Gm11279 |
predicted gene 11279 |
4891 |
0.08 |
chr16_76456094_76456254 | 2.96 |
Gm45030 |
predicted gene 45030 |
46735 |
0.13 |
chr8_17534538_17535388 | 2.94 |
Csmd1 |
CUB and Sushi multiple domains 1 |
318 |
0.95 |
chr13_83744885_83745867 | 2.92 |
C130071C03Rik |
RIKEN cDNA C130071C03 gene |
6513 |
0.13 |
chr8_109251249_109251531 | 2.88 |
D030068K23Rik |
RIKEN cDNA D030068K23 gene |
1524 |
0.52 |
chr11_53519330_53520879 | 2.79 |
Septin8 |
septin 8 |
177 |
0.9 |
chr13_83721535_83721983 | 2.78 |
C130071C03Rik |
RIKEN cDNA C130071C03 gene |
378 |
0.8 |
chr16_40710185_40710367 | 2.78 |
Gm27887 |
predicted gene, 27887 |
342339 |
0.01 |
chr5_140606447_140606735 | 2.77 |
Gm43703 |
predicted gene 43703 |
40 |
0.93 |
chr7_96780709_96780907 | 2.75 |
Tenm4 |
teneurin transmembrane protein 4 |
2874 |
0.24 |
chr5_109556763_109557843 | 2.74 |
Crlf2 |
cytokine receptor-like factor 2 |
830 |
0.53 |
chrX_166779633_166779805 | 2.72 |
Rpl7a-ps11 |
ribosomal protein L7A, pseudogene 11 |
74492 |
0.09 |
chr2_3512701_3513371 | 2.70 |
Cdnf |
cerebral dopamine neurotrophic factor |
6 |
0.62 |
chr11_24129398_24130415 | 2.69 |
Bcl11a |
B cell CLL/lymphoma 11A (zinc finger protein) |
12473 |
0.15 |
chr10_8088790_8088941 | 2.68 |
Gm48614 |
predicted gene, 48614 |
67573 |
0.11 |
chr6_91156450_91157707 | 2.66 |
Hdac11 |
histone deacetylase 11 |
86 |
0.95 |
chr2_172345010_172346316 | 2.65 |
Fam210b |
family with sequence similarity 210, member B |
98 |
0.95 |
chr4_41660901_41661419 | 2.63 |
Cntfr |
ciliary neurotrophic factor receptor |
2874 |
0.14 |
chr12_32060543_32061117 | 2.62 |
Prkar2b |
protein kinase, cAMP dependent regulatory, type II beta |
241 |
0.93 |
chr8_128685293_128686190 | 2.61 |
Itgb1 |
integrin beta 1 (fibronectin receptor beta) |
16 |
0.98 |
chr13_21170243_21170544 | 2.60 |
Trim27 |
tripartite motif-containing 27 |
9052 |
0.13 |
chr8_71405820_71406519 | 2.59 |
Ankle1 |
ankyrin repeat and LEM domain containing 1 |
145 |
0.9 |
chr8_84945228_84946066 | 2.59 |
Rtbdn |
retbindin |
1344 |
0.18 |
chr7_133759533_133759897 | 2.57 |
Dhx32 |
DEAH (Asp-Glu-Ala-His) box polypeptide 32 |
114 |
0.95 |
chr5_139738073_139738523 | 2.56 |
Micall2 |
MICAL-like 2 |
1962 |
0.25 |
chr13_23308928_23309095 | 2.56 |
4930557F10Rik |
RIKEN cDNA 4930557F10 gene |
4389 |
0.1 |
chr5_76657344_76657804 | 2.55 |
C530008M17Rik |
RIKEN cDNA C530008M17 gene |
109 |
0.92 |
chr10_115469021_115469459 | 2.53 |
Lgr5 |
leucine rich repeat containing G protein coupled receptor 5 |
6161 |
0.21 |
chr4_97910816_97911259 | 2.52 |
Nfia |
nuclear factor I/A |
4 |
0.99 |
chr8_3586507_3586797 | 2.50 |
Camsap3 |
calmodulin regulated spectrin-associated protein family, member 3 |
641 |
0.48 |
chr10_107271547_107272835 | 2.50 |
Lin7a |
lin-7 homolog A (C. elegans) |
203 |
0.96 |
chr11_6600404_6600609 | 2.46 |
Nacad |
NAC alpha domain containing |
568 |
0.55 |
chr14_66910808_66911486 | 2.46 |
Pnma2 |
paraneoplastic antigen MA2 |
23 |
0.97 |
chr4_22478554_22478820 | 2.45 |
Pou3f2 |
POU domain, class 3, transcription factor 2 |
9679 |
0.17 |
chr6_113891247_113892119 | 2.45 |
Atp2b2 |
ATPase, Ca++ transporting, plasma membrane 2 |
144 |
0.96 |
chr13_23397089_23397251 | 2.45 |
Gm11334 |
predicted gene 11334 |
14665 |
0.08 |
chr2_125723315_125724104 | 2.45 |
Shc4 |
SHC (Src homology 2 domain containing) family, member 4 |
322 |
0.9 |
chr16_35613873_35614640 | 2.45 |
Gm5963 |
predicted pseudogene 5963 |
40700 |
0.13 |
chr4_118427554_118428445 | 2.44 |
Elovl1 |
elongation of very long chain fatty acids (FEN1/Elo2, SUR4/Elo3, yeast)-like 1 |
94 |
0.94 |
chr2_165183986_165184214 | 2.43 |
Cdh22 |
cadherin 22 |
2641 |
0.25 |
chr9_90163003_90164118 | 2.42 |
Adamts7 |
a disintegrin-like and metallopeptidase (reprolysin type) with thrombospondin type 1 motif, 7 |
334 |
0.85 |
chr15_41861135_41861312 | 2.40 |
Abra |
actin-binding Rho activating protein |
8497 |
0.19 |
chr1_120120075_120121610 | 2.40 |
Dbi |
diazepam binding inhibitor |
95 |
0.8 |
chr3_152105117_152105411 | 2.39 |
Gm31881 |
predicted gene, 31881 |
1175 |
0.32 |
chr16_38282868_38283047 | 2.39 |
Nr1i2 |
nuclear receptor subfamily 1, group I, member 2 |
11867 |
0.14 |
chr10_59907739_59908468 | 2.37 |
Dnajb12 |
DnaJ heat shock protein family (Hsp40) member B12 |
28477 |
0.13 |
chr8_48730802_48730957 | 2.35 |
Tenm3 |
teneurin transmembrane protein 3 |
56189 |
0.15 |
chr19_41745643_41746338 | 2.35 |
Slit1 |
slit guidance ligand 1 |
2325 |
0.31 |
chr18_34860421_34860937 | 2.34 |
Egr1 |
early growth response 1 |
528 |
0.71 |
chr7_7300279_7300878 | 2.34 |
Clcn4 |
chloride channel, voltage-sensitive 4 |
273 |
0.8 |
chr6_146220158_146220350 | 2.33 |
Itpr2 |
inositol 1,4,5-triphosphate receptor 2 |
7289 |
0.26 |
chr3_145781082_145781470 | 2.29 |
Ddah1 |
dimethylarginine dimethylaminohydrolase 1 |
20528 |
0.19 |
chr15_99724323_99725930 | 2.29 |
Cox14 |
cytochrome c oxidase assembly protein 14 |
521 |
0.41 |
chr12_22906184_22906971 | 2.28 |
Gm48042 |
predicted gene, 48042 |
414 |
0.77 |
chr17_23546226_23547548 | 2.28 |
6330415G19Rik |
RIKEN cDNA 6330415G19 gene |
3912 |
0.1 |
chr15_73747622_73748946 | 2.27 |
Ptp4a3 |
protein tyrosine phosphatase 4a3 |
90 |
0.97 |
chr1_151099337_151099493 | 2.27 |
Gm19087 |
predicted gene, 19087 |
8500 |
0.13 |
chr14_20392892_20393285 | 2.25 |
Mrps16 |
mitochondrial ribosomal protein S16 |
395 |
0.73 |
chr1_171066497_171067047 | 2.25 |
Fcgr3 |
Fc receptor, IgG, low affinity III |
1837 |
0.17 |
chrX_7638426_7638824 | 2.25 |
Syp |
synaptophysin |
13 |
0.94 |
chr3_145119054_145119318 | 2.24 |
Odf2l |
outer dense fiber of sperm tails 2-like |
212 |
0.94 |
chr7_49071017_49071168 | 2.24 |
Gm45207 |
predicted gene 45207 |
8511 |
0.19 |
chr11_104158327_104158523 | 2.23 |
Crhr1 |
corticotropin releasing hormone receptor 1 |
25570 |
0.16 |
chr1_171081726_171082267 | 2.23 |
Gm27844 |
predicted gene, 27844 |
2095 |
0.17 |
chr4_9668407_9669501 | 2.23 |
Asph |
aspartate-beta-hydroxylase |
132 |
0.74 |
chr7_25279370_25280622 | 2.22 |
Cic |
capicua transcriptional repressor |
355 |
0.74 |
chr2_149830360_149831343 | 2.21 |
Syndig1 |
synapse differentiation inducing 1 |
8 |
0.86 |
chr5_111414144_111414882 | 2.21 |
Mn1 |
meningioma 1 |
2849 |
0.22 |
chr6_66962890_66963065 | 2.21 |
Gm36816 |
predicted gene, 36816 |
45436 |
0.08 |
chr9_20664804_20665024 | 2.20 |
Olfm2 |
olfactomedin 2 |
8217 |
0.12 |
chr4_41637318_41637469 | 2.20 |
Gm12406 |
predicted gene 12406 |
1985 |
0.17 |
chr7_92875448_92875613 | 2.20 |
Prcp |
prolylcarboxypeptidase (angiotensinase C) |
230 |
0.88 |
chr15_53200097_53200256 | 2.20 |
Ext1 |
exostosin glycosyltransferase 1 |
3921 |
0.37 |
chr1_93804412_93804846 | 2.19 |
Ing5 |
inhibitor of growth family, member 5 |
284 |
0.83 |
chr9_76237232_76237409 | 2.17 |
Gfral |
GDNF family receptor alpha like |
23663 |
0.21 |
chr5_113151153_113152005 | 2.16 |
Gm42161 |
predicted gene, 42161 |
6251 |
0.12 |
chr1_173333362_173333629 | 2.16 |
Ackr1 |
atypical chemokine receptor 1 (Duffy blood group) |
7 |
0.97 |
chr13_21917041_21917194 | 2.16 |
Gm44456 |
predicted gene, 44456 |
7899 |
0.07 |
chr8_120375258_120375710 | 2.16 |
Gm22715 |
predicted gene, 22715 |
68065 |
0.09 |
chr5_72167567_72168551 | 2.15 |
Commd8 |
COMM domain containing 8 |
97 |
0.97 |
chr10_128411000_128412410 | 2.14 |
Rnf41 |
ring finger protein 41 |
8 |
0.71 |
chr13_81329913_81330086 | 2.13 |
Adgrv1 |
adhesion G protein-coupled receptor V1 |
12837 |
0.26 |
chr19_12596168_12596705 | 2.13 |
A330040F15Rik |
RIKEN cDNA A330040F15 gene |
83 |
0.94 |
chr1_9847731_9848836 | 2.13 |
Sgk3 |
serum/glucocorticoid regulated kinase 3 |
11 |
0.97 |
chr12_41023736_41024977 | 2.12 |
Immp2l |
IMP2 inner mitochondrial membrane peptidase-like (S. cerevisiae) |
27 |
0.98 |
chr12_108042148_108042482 | 2.12 |
Bcl11b |
B cell leukemia/lymphoma 11B |
38713 |
0.18 |
chrX_153359977_153360149 | 2.11 |
Klf8 |
Kruppel-like factor 8 |
450 |
0.86 |
chr16_18194247_18195016 | 2.11 |
4933432I09Rik |
RIKEN cDNA 4933432I09 gene |
18902 |
0.08 |
chr7_4740270_4740635 | 2.10 |
Kmt5c |
lysine methyltransferase 5C |
267 |
0.76 |
chr19_17337368_17337645 | 2.10 |
Gcnt1 |
glucosaminyl (N-acetyl) transferase 1, core 2 |
2062 |
0.37 |
chr2_143545715_143546271 | 2.10 |
Pcsk2os1 |
proprotein convertase subtilisin/kexin type 2, opposite strand 1 |
16 |
0.67 |
chr2_63962810_63962988 | 2.09 |
Fign |
fidgetin |
135089 |
0.06 |
chr2_174049332_174050076 | 2.09 |
Vamp7-ps |
vesicle-associated membrane protein 7, pseudogene |
2431 |
0.27 |
chr18_84589690_84590078 | 2.09 |
Zfp407 |
zinc finger protein 407 |
159 |
0.95 |
chr8_89046835_89046986 | 2.09 |
Sall1 |
spalt like transcription factor 1 |
2748 |
0.32 |
chr13_21881913_21882064 | 2.09 |
Gm11278 |
predicted gene 11278 |
5759 |
0.07 |
chr17_73187011_73187191 | 2.09 |
Gm9311 |
predicted gene 9311 |
4584 |
0.2 |
chr15_36967359_36968246 | 2.08 |
Gm34590 |
predicted gene, 34590 |
28938 |
0.13 |
chr10_30802524_30803503 | 2.07 |
Ncoa7 |
nuclear receptor coactivator 7 |
94 |
0.96 |
chr13_8885468_8885636 | 2.07 |
Idi1 |
isopentenyl-diphosphate delta isomerase |
51 |
0.76 |
chr16_7293318_7293486 | 2.06 |
Rbfox1 |
RNA binding protein, fox-1 homolog (C. elegans) 1 |
59568 |
0.17 |
chrX_113185185_113185383 | 2.06 |
Chm |
choroidermia (RAB escort protein 1) |
225 |
0.95 |
chr9_75610505_75610965 | 2.06 |
Tmod2 |
tropomodulin 2 |
340 |
0.84 |
chr4_111444862_111445045 | 2.05 |
Bend5 |
BEN domain containing 5 |
11634 |
0.22 |
chr17_23533862_23534161 | 2.05 |
6330415G19Rik |
RIKEN cDNA 6330415G19 gene |
16788 |
0.08 |
chr1_172048212_172048493 | 2.05 |
Nhlh1 |
nescient helix loop helix 1 |
9221 |
0.11 |
chr2_181038768_181038919 | 2.04 |
Chrna4 |
cholinergic receptor, nicotinic, alpha polypeptide 4 |
232 |
0.9 |
chr15_38470164_38471480 | 2.04 |
G930009F23Rik |
RIKEN cDNA G930009F23 gene |
15688 |
0.13 |
chr16_43407704_43407915 | 2.03 |
Gm15713 |
predicted gene 15713 |
12387 |
0.2 |
chr13_75797565_75798292 | 2.03 |
Gm8288 |
predicted gene 8288 |
4778 |
0.16 |
chr1_171080221_171080812 | 2.03 |
Gm27844 |
predicted gene, 27844 |
615 |
0.55 |
chrX_168673064_168674616 | 2.03 |
Msl3 |
MSL complex subunit 3 |
58 |
0.98 |
chr2_52742560_52742811 | 2.02 |
Stam2 |
signal transducing adaptor molecule (SH3 domain and ITAM motif) 2 |
404 |
0.85 |
chr7_63668207_63668417 | 2.01 |
Otud7a |
OTU domain containing 7A |
17497 |
0.2 |
chr1_171064948_171065547 | 2.01 |
Fcgr3 |
Fc receptor, IgG, low affinity III |
312 |
0.63 |
chr11_62605415_62606716 | 2.00 |
Lrrc75aos2 |
leucine rich repeat containing 75A, opposite strand 2 |
298 |
0.72 |
chr9_15238712_15238977 | 1.99 |
Vstm5 |
V-set and transmembrane domain containing 5 |
201 |
0.88 |
chr13_75739611_75739769 | 1.98 |
Ell2 |
elongation factor RNA polymerase II 2 |
6661 |
0.14 |
chr13_35625670_35625833 | 1.98 |
Gm48707 |
predicted gene, 48707 |
8878 |
0.19 |
chr15_8659416_8659937 | 1.97 |
Gm37310 |
predicted gene, 37310 |
4603 |
0.23 |
chr13_51917679_51918481 | 1.97 |
Gm26651 |
predicted gene, 26651 |
55134 |
0.13 |
chr5_137290130_137290486 | 1.97 |
Ache |
acetylcholinesterase |
1061 |
0.24 |
chr1_171074149_171074549 | 1.96 |
Gm27552 |
predicted gene, 27552 |
2062 |
0.16 |
chr12_113185320_113185883 | 1.96 |
Tmem121 |
transmembrane protein 121 |
329 |
0.81 |
chr12_30910357_30910645 | 1.96 |
Acp1 |
acid phosphatase 1, soluble |
1048 |
0.38 |
chr9_74952266_74953620 | 1.95 |
Fam214a |
family with sequence similarity 214, member A |
21 |
0.98 |
chr1_55405351_55405581 | 1.95 |
Plcl1 |
phospholipase C-like 1 |
455 |
0.76 |
chr12_106026483_106026657 | 1.94 |
Vrk1 |
vaccinia related kinase 1 |
763 |
0.7 |
chr2_79255202_79255654 | 1.94 |
Itga4 |
integrin alpha 4 |
2 |
0.98 |
chr12_87266824_87267240 | 1.94 |
Gm47293 |
predicted gene, 47293 |
174 |
0.62 |
chr11_24099868_24100309 | 1.94 |
Gm12064 |
predicted gene 12064 |
15317 |
0.14 |
chr6_91115963_91116169 | 1.94 |
Nup210 |
nucleoporin 210 |
730 |
0.6 |
chr6_120581066_120581223 | 1.93 |
Gm44124 |
predicted gene, 44124 |
968 |
0.45 |
chr1_136347174_136347468 | 1.93 |
Camsap2 |
calmodulin regulated spectrin-associated protein family, member 2 |
1217 |
0.44 |
chr2_153577050_153577347 | 1.93 |
Nol4l |
nucleolar protein 4-like |
47227 |
0.11 |
chr16_44745824_44746481 | 1.92 |
Gtpbp8 |
GTP-binding protein 8 (putative) |
131 |
0.95 |
chr13_21855204_21855371 | 1.92 |
Gm11278 |
predicted gene 11278 |
20942 |
0.05 |
chr5_112229147_112229356 | 1.92 |
Miat |
myocardial infarction associated transcript (non-protein coding) |
144 |
0.93 |
chr7_19176285_19176869 | 1.92 |
Eml2 |
echinoderm microtubule associated protein like 2 |
156 |
0.88 |
chr7_127805295_127805451 | 1.92 |
9430064I24Rik |
RIKEN cDNA 9430064I24 gene |
2611 |
0.1 |
chr7_38106770_38108111 | 1.92 |
Ccne1 |
cyclin E1 |
62 |
0.97 |
chr5_105711538_105711689 | 1.92 |
Lrrc8d |
leucine rich repeat containing 8D |
10747 |
0.23 |
chr14_37134653_37135575 | 1.91 |
Ghitm |
growth hormone inducible transmembrane protein |
25 |
0.97 |
chr17_63807464_63807615 | 1.91 |
Fer |
fer (fms/fps related) protein kinase |
55523 |
0.13 |
chr19_61228253_61228788 | 1.90 |
Csf2ra |
colony stimulating factor 2 receptor, alpha, low-affinity (granulocyte-macrophage) |
91 |
0.95 |
chr15_5119681_5119856 | 1.90 |
Snord72 |
small nucleolar RNA, C/D box 72 |
1364 |
0.22 |
chr7_80192052_80192938 | 1.89 |
Sema4b |
sema domain, immunoglobulin domain (Ig), transmembrane domain (TM) and short cytoplasmic domain, (semaphorin) 4B |
5617 |
0.11 |
chr2_62807459_62807865 | 1.89 |
Gm13569 |
predicted gene 13569 |
1525 |
0.44 |
chr13_117289493_117289708 | 1.89 |
Emb |
embigin |
61574 |
0.11 |
chr12_111672080_111672432 | 1.88 |
Ckb |
creatine kinase, brain |
26 |
0.95 |
chr5_91850562_91850858 | 1.88 |
Gm5558 |
predicted gene 5558 |
43637 |
0.1 |
chr8_23562129_23562317 | 1.88 |
Zmat4 |
zinc finger, matrin type 4 |
73796 |
0.11 |
chr13_101545903_101546217 | 1.87 |
Gm47533 |
predicted gene, 47533 |
854 |
0.53 |
chr2_125624614_125624989 | 1.87 |
Cep152 |
centrosomal protein 152 |
312 |
0.91 |
chr13_84284898_84285057 | 1.86 |
Gm46432 |
predicted gene, 46432 |
3161 |
0.22 |
chr15_75648234_75648523 | 1.86 |
2810039B14Rik |
RIKEN cDNA 2810039B14 gene |
3715 |
0.13 |
chr17_43025131_43025438 | 1.86 |
Tnfrsf21 |
tumor necrosis factor receptor superfamily, member 21 |
8716 |
0.29 |
chr17_83836138_83836470 | 1.86 |
Haao |
3-hydroxyanthranilate 3,4-dioxygenase |
336 |
0.87 |
chr5_115431516_115431738 | 1.86 |
Msi1 |
musashi RNA-binding protein 1 |
1022 |
0.29 |
chr13_23463426_23463759 | 1.85 |
Btn1a1 |
butyrophilin, subfamily 1, member A1 |
1817 |
0.16 |
chr6_67035469_67035620 | 1.85 |
E230016M11Rik |
RIKEN cDNA E230016M11 gene |
1055 |
0.34 |
chr1_136347583_136347734 | 1.85 |
Camsap2 |
calmodulin regulated spectrin-associated protein family, member 2 |
1554 |
0.36 |
chr3_14862679_14863688 | 1.85 |
Car3 |
carbonic anhydrase 3 |
329 |
0.89 |
chr16_58670450_58670660 | 1.84 |
Cpox |
coproporphyrinogen oxidase |
227 |
0.9 |
chr3_5215280_5215606 | 1.84 |
Gm10748 |
predicted gene 10748 |
680 |
0.68 |
chr3_108432715_108432936 | 1.84 |
Gm22942 |
predicted gene, 22942 |
8505 |
0.09 |
chr16_48993476_48994643 | 1.84 |
Dzip3 |
DAZ interacting protein 3, zinc finger |
106 |
0.52 |
chrX_58019486_58019653 | 1.84 |
Zic3 |
zinc finger protein of the cerebellum 3 |
3131 |
0.32 |
chr13_63431377_63432072 | 1.84 |
Fancc |
Fanconi anemia, complementation group C |
0 |
0.97 |
chr12_71136134_71136733 | 1.84 |
Timm9 |
translocase of inner mitochondrial membrane 9 |
164 |
0.76 |
chr2_122738665_122739049 | 1.84 |
Bloc1s6 |
biogenesis of lysosomal organelles complex-1, subunit 6, pallidin |
298 |
0.64 |
chr10_73096867_73097076 | 1.83 |
Pcdh15 |
protocadherin 15 |
2371 |
0.32 |
chr13_84344282_84344641 | 1.83 |
Gm26927 |
predicted gene, 26927 |
4348 |
0.26 |
chr11_78072546_78072736 | 1.83 |
Mir144 |
microRNA 144 |
364 |
0.43 |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
1.6 | 4.8 | GO:0015014 | heparan sulfate proteoglycan biosynthetic process, polysaccharide chain biosynthetic process(GO:0015014) |
1.3 | 3.9 | GO:0061535 | glutamate secretion, neurotransmission(GO:0061535) |
1.2 | 4.7 | GO:0050904 | diapedesis(GO:0050904) |
1.2 | 3.5 | GO:0021538 | epithalamus development(GO:0021538) habenula development(GO:0021986) |
1.1 | 7.7 | GO:0097011 | cellular response to granulocyte macrophage colony-stimulating factor stimulus(GO:0097011) |
0.9 | 3.6 | GO:0034627 | 'de novo' NAD biosynthetic process(GO:0034627) |
0.9 | 2.6 | GO:0097118 | neuroligin clustering involved in postsynaptic membrane assembly(GO:0097118) |
0.9 | 2.6 | GO:0021553 | olfactory nerve development(GO:0021553) |
0.9 | 3.4 | GO:0001794 | type IIa hypersensitivity(GO:0001794) regulation of type IIa hypersensitivity(GO:0001796) positive regulation of type IIa hypersensitivity(GO:0001798) type II hypersensitivity(GO:0002445) regulation of type II hypersensitivity(GO:0002892) positive regulation of type II hypersensitivity(GO:0002894) |
0.8 | 2.4 | GO:0035434 | copper ion transmembrane transport(GO:0035434) |
0.8 | 1.6 | GO:0032696 | negative regulation of interleukin-13 production(GO:0032696) |
0.8 | 1.6 | GO:1990035 | calcium ion import into cell(GO:1990035) |
0.7 | 1.4 | GO:0031635 | adenylate cyclase-inhibiting opioid receptor signaling pathway(GO:0031635) |
0.7 | 0.7 | GO:0061113 | pancreas morphogenesis(GO:0061113) |
0.7 | 2.1 | GO:0032289 | central nervous system myelin formation(GO:0032289) |
0.7 | 2.1 | GO:0036151 | phosphatidylcholine acyl-chain remodeling(GO:0036151) |
0.7 | 4.9 | GO:0019367 | fatty acid elongation, saturated fatty acid(GO:0019367) fatty acid elongation, unsaturated fatty acid(GO:0019368) fatty acid elongation, monounsaturated fatty acid(GO:0034625) fatty acid elongation, polyunsaturated fatty acid(GO:0034626) |
0.7 | 2.1 | GO:0070649 | formin-nucleated actin cable assembly(GO:0070649) |
0.7 | 3.4 | GO:0046501 | protoporphyrinogen IX metabolic process(GO:0046501) |
0.7 | 2.0 | GO:0032058 | positive regulation of translational initiation in response to stress(GO:0032058) |
0.7 | 2.0 | GO:1904219 | regulation of CDP-diacylglycerol-serine O-phosphatidyltransferase activity(GO:1904217) positive regulation of CDP-diacylglycerol-serine O-phosphatidyltransferase activity(GO:1904219) regulation of serine C-palmitoyltransferase activity(GO:1904220) positive regulation of serine C-palmitoyltransferase activity(GO:1904222) |
0.7 | 2.0 | GO:0060748 | tertiary branching involved in mammary gland duct morphogenesis(GO:0060748) |
0.6 | 1.9 | GO:0051081 | membrane disassembly(GO:0030397) nuclear envelope disassembly(GO:0051081) |
0.6 | 2.6 | GO:0019087 | transformation of host cell by virus(GO:0019087) |
0.6 | 1.9 | GO:0060178 | regulation of exocyst localization(GO:0060178) |
0.6 | 0.6 | GO:0038028 | insulin receptor signaling pathway via phosphatidylinositol 3-kinase(GO:0038028) |
0.6 | 2.4 | GO:1903361 | protein localization to basolateral plasma membrane(GO:1903361) |
0.6 | 2.4 | GO:2000622 | regulation of nuclear-transcribed mRNA catabolic process, nonsense-mediated decay(GO:2000622) negative regulation of nuclear-transcribed mRNA catabolic process, nonsense-mediated decay(GO:2000623) |
0.6 | 1.8 | GO:2001274 | negative regulation of glucose import in response to insulin stimulus(GO:2001274) |
0.6 | 1.8 | GO:0018197 | peptidyl-aspartic acid modification(GO:0018197) |
0.6 | 1.8 | GO:0002254 | kinin cascade(GO:0002254) |
0.6 | 2.3 | GO:0021943 | formation of radial glial scaffolds(GO:0021943) |
0.6 | 1.1 | GO:0045213 | neurotransmitter receptor metabolic process(GO:0045213) |
0.6 | 0.6 | GO:0000720 | pyrimidine dimer repair by nucleotide-excision repair(GO:0000720) |
0.6 | 4.0 | GO:1901660 | calcium ion export(GO:1901660) |
0.6 | 0.6 | GO:1902373 | negative regulation of mRNA catabolic process(GO:1902373) |
0.6 | 1.1 | GO:0036091 | positive regulation of transcription from RNA polymerase II promoter in response to oxidative stress(GO:0036091) |
0.6 | 1.7 | GO:2000474 | regulation of opioid receptor signaling pathway(GO:2000474) |
0.5 | 1.1 | GO:0061153 | trachea submucosa development(GO:0061152) trachea gland development(GO:0061153) |
0.5 | 6.5 | GO:0097120 | receptor localization to synapse(GO:0097120) |
0.5 | 2.1 | GO:0098535 | de novo centriole assembly(GO:0098535) |
0.5 | 1.6 | GO:0090360 | platelet-derived growth factor production(GO:0090360) regulation of platelet-derived growth factor production(GO:0090361) |
0.5 | 2.7 | GO:1902410 | mitotic cytokinetic process(GO:1902410) |
0.5 | 1.6 | GO:0031118 | rRNA pseudouridine synthesis(GO:0031118) |
0.5 | 1.6 | GO:0003358 | noradrenergic neuron development(GO:0003358) |
0.5 | 1.6 | GO:1901078 | negative regulation of relaxation of muscle(GO:1901078) |
0.5 | 2.6 | GO:1900122 | positive regulation of receptor binding(GO:1900122) |
0.5 | 2.1 | GO:0021615 | glossopharyngeal nerve morphogenesis(GO:0021615) |
0.5 | 3.0 | GO:0001547 | antral ovarian follicle growth(GO:0001547) |
0.5 | 0.5 | GO:0061205 | paramesonephric duct development(GO:0061205) |
0.5 | 4.5 | GO:0001956 | positive regulation of neurotransmitter secretion(GO:0001956) |
0.5 | 2.0 | GO:0001806 | type IV hypersensitivity(GO:0001806) |
0.5 | 1.5 | GO:0050427 | 3'-phosphoadenosine 5'-phosphosulfate metabolic process(GO:0050427) |
0.5 | 2.4 | GO:0045002 | double-strand break repair via single-strand annealing(GO:0045002) |
0.5 | 1.9 | GO:0072126 | positive regulation of glomerular mesangial cell proliferation(GO:0072126) |
0.5 | 1.5 | GO:0071947 | protein deubiquitination involved in ubiquitin-dependent protein catabolic process(GO:0071947) |
0.5 | 1.4 | GO:0060800 | regulation of cell differentiation involved in embryonic placenta development(GO:0060800) |
0.5 | 1.4 | GO:1903334 | positive regulation of protein folding(GO:1903334) |
0.5 | 1.4 | GO:0034093 | positive regulation of maintenance of sister chromatid cohesion(GO:0034093) positive regulation of maintenance of mitotic sister chromatid cohesion(GO:0034184) |
0.5 | 0.9 | GO:0060375 | regulation of mast cell differentiation(GO:0060375) |
0.5 | 1.8 | GO:0035405 | histone-threonine phosphorylation(GO:0035405) |
0.4 | 1.8 | GO:0034047 | regulation of protein phosphatase type 2A activity(GO:0034047) |
0.4 | 1.8 | GO:0014834 | skeletal muscle satellite cell maintenance involved in skeletal muscle regeneration(GO:0014834) |
0.4 | 1.8 | GO:0015015 | heparan sulfate proteoglycan biosynthetic process, enzymatic modification(GO:0015015) |
0.4 | 6.5 | GO:0043968 | histone H2A acetylation(GO:0043968) |
0.4 | 1.3 | GO:0071205 | protein localization to juxtaparanode region of axon(GO:0071205) |
0.4 | 0.9 | GO:0072092 | ureteric bud invasion(GO:0072092) |
0.4 | 1.7 | GO:0006598 | polyamine catabolic process(GO:0006598) |
0.4 | 2.1 | GO:0098814 | spontaneous neurotransmitter secretion(GO:0061669) spontaneous synaptic transmission(GO:0098814) |
0.4 | 1.7 | GO:0030050 | vesicle transport along actin filament(GO:0030050) |
0.4 | 2.5 | GO:0098597 | vocal learning(GO:0042297) imitative learning(GO:0098596) observational learning(GO:0098597) learned vocalization behavior or vocal learning(GO:0098598) |
0.4 | 1.3 | GO:0010728 | regulation of hydrogen peroxide biosynthetic process(GO:0010728) |
0.4 | 1.7 | GO:0045039 | protein import into mitochondrial inner membrane(GO:0045039) |
0.4 | 1.7 | GO:0033326 | cerebrospinal fluid secretion(GO:0033326) |
0.4 | 0.4 | GO:0021550 | medulla oblongata development(GO:0021550) |
0.4 | 1.2 | GO:0006227 | dUDP biosynthetic process(GO:0006227) pyrimidine nucleoside diphosphate biosynthetic process(GO:0009139) pyrimidine deoxyribonucleoside diphosphate metabolic process(GO:0009196) pyrimidine deoxyribonucleoside diphosphate biosynthetic process(GO:0009197) dUDP metabolic process(GO:0046077) |
0.4 | 1.2 | GO:0006772 | thiamine metabolic process(GO:0006772) thiamine-containing compound metabolic process(GO:0042723) |
0.4 | 1.2 | GO:0031133 | regulation of axon diameter(GO:0031133) |
0.4 | 2.1 | GO:0006627 | protein processing involved in protein targeting to mitochondrion(GO:0006627) |
0.4 | 1.6 | GO:2001013 | epithelial cell proliferation involved in renal tubule morphogenesis(GO:2001013) |
0.4 | 2.0 | GO:0090148 | membrane fission(GO:0090148) |
0.4 | 0.8 | GO:0046449 | creatinine metabolic process(GO:0046449) cellular lactam metabolic process(GO:0072338) |
0.4 | 1.2 | GO:0021882 | regulation of transcription from RNA polymerase II promoter involved in forebrain neuron fate commitment(GO:0021882) |
0.4 | 1.6 | GO:0014053 | negative regulation of gamma-aminobutyric acid secretion(GO:0014053) |
0.4 | 1.2 | GO:0030951 | establishment or maintenance of microtubule cytoskeleton polarity(GO:0030951) |
0.4 | 3.1 | GO:0018344 | protein geranylgeranylation(GO:0018344) |
0.4 | 2.3 | GO:0051694 | pointed-end actin filament capping(GO:0051694) |
0.4 | 1.5 | GO:1903347 | negative regulation of bicellular tight junction assembly(GO:1903347) |
0.4 | 1.2 | GO:0002949 | tRNA threonylcarbamoyladenosine modification(GO:0002949) |
0.4 | 0.8 | GO:1903802 | L-glutamate(1-) import into cell(GO:1903802) L-glutamate import into cell(GO:1990123) |
0.4 | 1.2 | GO:0072235 | distal convoluted tubule development(GO:0072025) DCT cell differentiation(GO:0072069) metanephric distal convoluted tubule development(GO:0072221) metanephric distal tubule development(GO:0072235) metanephric DCT cell differentiation(GO:0072240) |
0.4 | 1.1 | GO:0051835 | positive regulation of synapse structural plasticity(GO:0051835) |
0.4 | 0.4 | GO:0045738 | negative regulation of DNA repair(GO:0045738) |
0.4 | 1.5 | GO:0052055 | modulation by symbiont of host molecular function(GO:0052055) |
0.4 | 1.9 | GO:0048069 | eye pigmentation(GO:0048069) |
0.4 | 1.5 | GO:0033563 | dorsal/ventral axon guidance(GO:0033563) |
0.4 | 1.1 | GO:0045200 | establishment or maintenance of neuroblast polarity(GO:0045196) establishment of neuroblast polarity(GO:0045200) |
0.4 | 1.1 | GO:2000048 | negative regulation of cell-cell adhesion mediated by cadherin(GO:2000048) |
0.4 | 0.4 | GO:0061502 | early endosome to recycling endosome transport(GO:0061502) |
0.4 | 1.5 | GO:0021914 | negative regulation of smoothened signaling pathway involved in ventral spinal cord patterning(GO:0021914) |
0.4 | 0.4 | GO:0097151 | positive regulation of inhibitory postsynaptic potential(GO:0097151) |
0.4 | 1.1 | GO:0045053 | protein retention in Golgi apparatus(GO:0045053) |
0.4 | 1.1 | GO:0030070 | insulin processing(GO:0030070) |
0.4 | 4.0 | GO:0000479 | endonucleolytic cleavage of tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000479) |
0.4 | 0.7 | GO:0061428 | negative regulation of transcription from RNA polymerase II promoter in response to hypoxia(GO:0061428) |
0.4 | 1.1 | GO:0051182 | coenzyme transport(GO:0051182) |
0.4 | 1.1 | GO:0001555 | oocyte growth(GO:0001555) |
0.4 | 1.1 | GO:0090230 | regulation of centromere complex assembly(GO:0090230) |
0.4 | 1.4 | GO:0051725 | protein de-ADP-ribosylation(GO:0051725) |
0.4 | 1.1 | GO:0071335 | hair follicle cell proliferation(GO:0071335) |
0.4 | 0.7 | GO:0051586 | positive regulation of neurotransmitter uptake(GO:0051582) positive regulation of dopamine uptake involved in synaptic transmission(GO:0051586) positive regulation of catecholamine uptake involved in synaptic transmission(GO:0051944) |
0.4 | 1.1 | GO:0071930 | negative regulation of transcription involved in G1/S transition of mitotic cell cycle(GO:0071930) |
0.4 | 1.1 | GO:1903984 | positive regulation of TRAIL-activated apoptotic signaling pathway(GO:1903984) |
0.4 | 1.1 | GO:0010807 | regulation of synaptic vesicle priming(GO:0010807) |
0.4 | 1.1 | GO:0046167 | glycerol-3-phosphate biosynthetic process(GO:0046167) |
0.3 | 1.0 | GO:0002017 | regulation of blood volume by renal aldosterone(GO:0002017) |
0.3 | 2.8 | GO:0002634 | regulation of germinal center formation(GO:0002634) |
0.3 | 1.0 | GO:0007084 | mitotic nuclear envelope reassembly(GO:0007084) |
0.3 | 2.4 | GO:0031936 | negative regulation of chromatin silencing(GO:0031936) |
0.3 | 2.8 | GO:0048671 | negative regulation of collateral sprouting(GO:0048671) |
0.3 | 1.0 | GO:1900041 | negative regulation of interleukin-2 secretion(GO:1900041) |
0.3 | 2.1 | GO:0000022 | mitotic spindle elongation(GO:0000022) mitotic spindle midzone assembly(GO:0051256) |
0.3 | 0.3 | GO:0048170 | positive regulation of long-term neuronal synaptic plasticity(GO:0048170) |
0.3 | 1.0 | GO:0061092 | regulation of phospholipid translocation(GO:0061091) positive regulation of phospholipid translocation(GO:0061092) |
0.3 | 1.0 | GO:0001543 | ovarian follicle rupture(GO:0001543) |
0.3 | 0.7 | GO:0002572 | pro-T cell differentiation(GO:0002572) |
0.3 | 2.7 | GO:0035881 | amacrine cell differentiation(GO:0035881) |
0.3 | 1.0 | GO:0051661 | maintenance of centrosome location(GO:0051661) |
0.3 | 1.3 | GO:0097091 | synaptic vesicle clustering(GO:0097091) |
0.3 | 6.3 | GO:0007214 | gamma-aminobutyric acid signaling pathway(GO:0007214) |
0.3 | 1.3 | GO:0006642 | triglyceride mobilization(GO:0006642) |
0.3 | 1.0 | GO:0001661 | conditioned taste aversion(GO:0001661) |
0.3 | 1.3 | GO:1901026 | ripoptosome assembly(GO:0097343) ripoptosome assembly involved in necroptotic process(GO:1901026) |
0.3 | 1.6 | GO:0090110 | cargo loading into COPII-coated vesicle(GO:0090110) |
0.3 | 1.6 | GO:0090240 | positive regulation of histone H4 acetylation(GO:0090240) |
0.3 | 3.9 | GO:0048268 | clathrin coat assembly(GO:0048268) |
0.3 | 1.0 | GO:0019464 | glycine catabolic process(GO:0006546) glycine decarboxylation via glycine cleavage system(GO:0019464) |
0.3 | 1.3 | GO:0051790 | short-chain fatty acid biosynthetic process(GO:0051790) |
0.3 | 0.6 | GO:0097460 | ferrous iron import into cell(GO:0097460) |
0.3 | 1.6 | GO:1901525 | negative regulation of macromitophagy(GO:1901525) |
0.3 | 1.0 | GO:0070827 | chromatin maintenance(GO:0070827) |
0.3 | 1.0 | GO:2000118 | regulation of sodium-dependent phosphate transport(GO:2000118) |
0.3 | 2.5 | GO:2000615 | regulation of histone H3-K9 acetylation(GO:2000615) |
0.3 | 1.6 | GO:0016199 | axon midline choice point recognition(GO:0016199) |
0.3 | 3.8 | GO:0021544 | subpallium development(GO:0021544) |
0.3 | 5.3 | GO:1905144 | acetylcholine receptor signaling pathway(GO:0095500) postsynaptic signal transduction(GO:0098926) signal transduction involved in cellular response to ammonium ion(GO:1903831) response to acetylcholine(GO:1905144) cellular response to acetylcholine(GO:1905145) |
0.3 | 0.9 | GO:0071926 | cannabinoid signaling pathway(GO:0038171) endocannabinoid signaling pathway(GO:0071926) |
0.3 | 2.5 | GO:0021796 | cerebral cortex regionalization(GO:0021796) |
0.3 | 0.9 | GO:0015746 | tricarboxylic acid transport(GO:0006842) citrate transport(GO:0015746) |
0.3 | 1.3 | GO:0070779 | D-aspartate transport(GO:0070777) D-aspartate import(GO:0070779) |
0.3 | 1.2 | GO:0019896 | axonal transport of mitochondrion(GO:0019896) |
0.3 | 2.5 | GO:0030644 | cellular chloride ion homeostasis(GO:0030644) |
0.3 | 0.9 | GO:0015705 | iodide transport(GO:0015705) |
0.3 | 2.5 | GO:2000480 | negative regulation of cAMP-dependent protein kinase activity(GO:2000480) |
0.3 | 1.5 | GO:0031547 | brain-derived neurotrophic factor receptor signaling pathway(GO:0031547) |
0.3 | 1.2 | GO:0042525 | tyrosine phosphorylation of Stat6 protein(GO:0042505) regulation of tyrosine phosphorylation of Stat6 protein(GO:0042525) |
0.3 | 0.9 | GO:0046951 | ketone body biosynthetic process(GO:0046951) |
0.3 | 0.9 | GO:0070375 | ERK5 cascade(GO:0070375) |
0.3 | 0.9 | GO:2000409 | positive regulation of T cell extravasation(GO:2000409) |
0.3 | 1.8 | GO:0010572 | positive regulation of platelet activation(GO:0010572) |
0.3 | 1.5 | GO:0000056 | ribosomal small subunit export from nucleus(GO:0000056) |
0.3 | 7.8 | GO:0001964 | startle response(GO:0001964) |
0.3 | 0.9 | GO:0046083 | adenine metabolic process(GO:0046083) adenine biosynthetic process(GO:0046084) |
0.3 | 0.3 | GO:0043217 | myelin maintenance(GO:0043217) |
0.3 | 0.6 | GO:0072318 | clathrin coat disassembly(GO:0072318) |
0.3 | 1.5 | GO:0006528 | asparagine metabolic process(GO:0006528) |
0.3 | 0.3 | GO:0097680 | double-strand break repair via classical nonhomologous end joining(GO:0097680) |
0.3 | 0.6 | GO:1904668 | positive regulation of ubiquitin protein ligase activity(GO:1904668) |
0.3 | 0.9 | GO:1901529 | positive regulation of anion channel activity(GO:1901529) |
0.3 | 2.0 | GO:0000103 | sulfate assimilation(GO:0000103) |
0.3 | 0.9 | GO:0070682 | proteasome regulatory particle assembly(GO:0070682) |
0.3 | 1.4 | GO:0032020 | ISG15-protein conjugation(GO:0032020) |
0.3 | 0.6 | GO:0048388 | endosomal lumen acidification(GO:0048388) |
0.3 | 2.0 | GO:0006658 | phosphatidylserine metabolic process(GO:0006658) |
0.3 | 2.6 | GO:0060352 | cell adhesion molecule production(GO:0060352) |
0.3 | 0.9 | GO:0009169 | ribonucleoside monophosphate catabolic process(GO:0009158) purine ribonucleoside monophosphate catabolic process(GO:0009169) |
0.3 | 0.9 | GO:0015803 | branched-chain amino acid transport(GO:0015803) leucine transport(GO:0015820) |
0.3 | 0.9 | GO:0018094 | protein polyglycylation(GO:0018094) |
0.3 | 1.1 | GO:0070127 | tRNA aminoacylation for mitochondrial protein translation(GO:0070127) |
0.3 | 0.8 | GO:0032911 | negative regulation of transforming growth factor beta1 production(GO:0032911) |
0.3 | 0.8 | GO:0002865 | negative regulation of acute inflammatory response to antigenic stimulus(GO:0002865) |
0.3 | 1.7 | GO:0035735 | intraciliary transport involved in cilium morphogenesis(GO:0035735) |
0.3 | 0.6 | GO:0042524 | negative regulation of tyrosine phosphorylation of Stat5 protein(GO:0042524) |
0.3 | 1.4 | GO:0000972 | transcription-dependent tethering of RNA polymerase II gene DNA at nuclear periphery(GO:0000972) |
0.3 | 1.1 | GO:0007158 | neuron cell-cell adhesion(GO:0007158) |
0.3 | 1.6 | GO:2000096 | positive regulation of Wnt signaling pathway, planar cell polarity pathway(GO:2000096) |
0.3 | 1.9 | GO:0031017 | exocrine pancreas development(GO:0031017) |
0.3 | 0.5 | GO:0060741 | prostate gland stromal morphogenesis(GO:0060741) |
0.3 | 1.9 | GO:0045647 | negative regulation of erythrocyte differentiation(GO:0045647) |
0.3 | 0.5 | GO:0060125 | negative regulation of growth hormone secretion(GO:0060125) |
0.3 | 0.8 | GO:0007638 | mechanosensory behavior(GO:0007638) |
0.3 | 1.1 | GO:0070345 | negative regulation of fat cell proliferation(GO:0070345) |
0.3 | 0.8 | GO:0007089 | traversing start control point of mitotic cell cycle(GO:0007089) |
0.3 | 0.8 | GO:0021631 | optic nerve morphogenesis(GO:0021631) |
0.3 | 0.5 | GO:0006600 | creatine metabolic process(GO:0006600) |
0.3 | 2.9 | GO:0031629 | synaptic vesicle fusion to presynaptic active zone membrane(GO:0031629) vesicle fusion to plasma membrane(GO:0099500) |
0.3 | 0.3 | GO:0046641 | positive regulation of alpha-beta T cell proliferation(GO:0046641) |
0.3 | 0.5 | GO:0032898 | neurotrophin production(GO:0032898) |
0.3 | 0.8 | GO:1902990 | mitotic telomere maintenance via semi-conservative replication(GO:1902990) |
0.3 | 1.6 | GO:0006621 | protein retention in ER lumen(GO:0006621) |
0.3 | 1.3 | GO:0031468 | nuclear envelope reassembly(GO:0031468) |
0.3 | 0.8 | GO:1901421 | positive regulation of response to alcohol(GO:1901421) |
0.3 | 1.6 | GO:2000672 | negative regulation of motor neuron apoptotic process(GO:2000672) |
0.3 | 0.8 | GO:0035526 | retrograde transport, plasma membrane to Golgi(GO:0035526) |
0.3 | 1.3 | GO:0006449 | regulation of translational termination(GO:0006449) |
0.3 | 0.8 | GO:0060847 | endothelial cell fate specification(GO:0060847) |
0.3 | 0.5 | GO:0038095 | Fc-epsilon receptor signaling pathway(GO:0038095) |
0.3 | 0.5 | GO:1901977 | negative regulation of cell cycle checkpoint(GO:1901977) |
0.3 | 2.0 | GO:1900452 | regulation of long term synaptic depression(GO:1900452) |
0.3 | 0.8 | GO:0071635 | negative regulation of transforming growth factor beta production(GO:0071635) |
0.3 | 1.5 | GO:0001842 | neural fold formation(GO:0001842) |
0.3 | 1.0 | GO:0048681 | negative regulation of axon regeneration(GO:0048681) |
0.2 | 1.2 | GO:0061302 | smooth muscle cell-matrix adhesion(GO:0061302) |
0.2 | 0.5 | GO:0006435 | threonyl-tRNA aminoacylation(GO:0006435) |
0.2 | 1.0 | GO:0008655 | pyrimidine-containing compound salvage(GO:0008655) pyrimidine nucleoside salvage(GO:0043097) |
0.2 | 0.7 | GO:0010897 | negative regulation of triglyceride catabolic process(GO:0010897) |
0.2 | 1.2 | GO:1900016 | negative regulation of cytokine production involved in inflammatory response(GO:1900016) |
0.2 | 1.2 | GO:0031339 | negative regulation of vesicle fusion(GO:0031339) |
0.2 | 1.7 | GO:0046784 | viral mRNA export from host cell nucleus(GO:0046784) |
0.2 | 1.5 | GO:0046929 | negative regulation of neurotransmitter secretion(GO:0046929) |
0.2 | 0.7 | GO:1990705 | cholangiocyte proliferation(GO:1990705) |
0.2 | 1.5 | GO:1901030 | positive regulation of mitochondrial outer membrane permeabilization involved in apoptotic signaling pathway(GO:1901030) |
0.2 | 0.5 | GO:0009211 | pyrimidine deoxyribonucleoside triphosphate metabolic process(GO:0009211) |
0.2 | 0.7 | GO:0070458 | detoxification of nitrogen compound(GO:0051410) cellular detoxification of nitrogen compound(GO:0070458) |
0.2 | 1.0 | GO:0098904 | regulation of AV node cell action potential(GO:0098904) |
0.2 | 0.5 | GO:0099558 | maintenance of synapse structure(GO:0099558) |
0.2 | 0.2 | GO:0021912 | regulation of transcription from RNA polymerase II promoter involved in spinal cord motor neuron fate specification(GO:0021912) |
0.2 | 1.9 | GO:0034724 | DNA replication-independent nucleosome assembly(GO:0006336) DNA replication-independent nucleosome organization(GO:0034724) |
0.2 | 0.5 | GO:0061743 | motor learning(GO:0061743) |
0.2 | 1.4 | GO:0071361 | cellular response to ethanol(GO:0071361) |
0.2 | 0.9 | GO:1903546 | protein localization to photoreceptor outer segment(GO:1903546) |
0.2 | 0.9 | GO:0033211 | adiponectin-activated signaling pathway(GO:0033211) |
0.2 | 0.7 | GO:0015842 | aminergic neurotransmitter loading into synaptic vesicle(GO:0015842) neurotransmitter loading into synaptic vesicle(GO:0098700) |
0.2 | 0.7 | GO:0008228 | opsonization(GO:0008228) |
0.2 | 0.5 | GO:0021530 | spinal cord oligodendrocyte cell differentiation(GO:0021529) spinal cord oligodendrocyte cell fate specification(GO:0021530) |
0.2 | 0.2 | GO:2000969 | positive regulation of glutamate receptor signaling pathway(GO:1900451) positive regulation of alpha-amino-3-hydroxy-5-methyl-4-isoxazole propionate selective glutamate receptor activity(GO:2000969) |
0.2 | 0.9 | GO:0019482 | beta-alanine metabolic process(GO:0019482) |
0.2 | 2.0 | GO:0031536 | positive regulation of exit from mitosis(GO:0031536) |
0.2 | 0.7 | GO:0007066 | female meiosis sister chromatid cohesion(GO:0007066) |
0.2 | 0.7 | GO:0006391 | transcription initiation from mitochondrial promoter(GO:0006391) |
0.2 | 1.1 | GO:0010587 | miRNA catabolic process(GO:0010587) |
0.2 | 0.7 | GO:0006681 | galactosylceramide metabolic process(GO:0006681) |
0.2 | 1.6 | GO:0030300 | regulation of intestinal cholesterol absorption(GO:0030300) |
0.2 | 0.7 | GO:0002765 | immune response-inhibiting signal transduction(GO:0002765) immune response-inhibiting cell surface receptor signaling pathway(GO:0002767) |
0.2 | 2.0 | GO:0006527 | arginine catabolic process(GO:0006527) |
0.2 | 0.9 | GO:0070126 | mitochondrial translational termination(GO:0070126) |
0.2 | 1.1 | GO:0051642 | centrosome localization(GO:0051642) |
0.2 | 2.4 | GO:0035879 | lactate transport(GO:0015727) lactate transmembrane transport(GO:0035873) plasma membrane lactate transport(GO:0035879) |
0.2 | 0.4 | GO:0035262 | gonad morphogenesis(GO:0035262) |
0.2 | 0.7 | GO:0033314 | mitotic DNA replication checkpoint(GO:0033314) |
0.2 | 3.2 | GO:0006613 | cotranslational protein targeting to membrane(GO:0006613) |
0.2 | 1.1 | GO:0021826 | substrate-independent telencephalic tangential migration(GO:0021826) substrate-independent telencephalic tangential interneuron migration(GO:0021843) |
0.2 | 0.6 | GO:1900095 | regulation of dosage compensation by inactivation of X chromosome(GO:1900095) |
0.2 | 2.8 | GO:0099517 | anterograde synaptic vesicle transport(GO:0048490) synaptic vesicle cytoskeletal transport(GO:0099514) synaptic vesicle transport along microtubule(GO:0099517) |
0.2 | 0.4 | GO:0016344 | meiotic chromosome movement towards spindle pole(GO:0016344) |
0.2 | 0.4 | GO:0006982 | response to lipid hydroperoxide(GO:0006982) |
0.2 | 0.4 | GO:0006419 | alanyl-tRNA aminoacylation(GO:0006419) |
0.2 | 0.4 | GO:0035672 | oligopeptide transmembrane transport(GO:0035672) |
0.2 | 0.4 | GO:0021902 | commitment of neuronal cell to specific neuron type in forebrain(GO:0021902) |
0.2 | 1.0 | GO:0015780 | nucleotide-sugar transport(GO:0015780) pyrimidine nucleotide-sugar transport(GO:0015781) |
0.2 | 0.4 | GO:0050717 | positive regulation of interleukin-1 alpha secretion(GO:0050717) |
0.2 | 0.2 | GO:0070672 | response to interleukin-15(GO:0070672) |
0.2 | 2.7 | GO:0045116 | protein neddylation(GO:0045116) |
0.2 | 0.6 | GO:0042126 | nitrate metabolic process(GO:0042126) |
0.2 | 0.8 | GO:0050882 | voluntary musculoskeletal movement(GO:0050882) |
0.2 | 0.6 | GO:0030242 | pexophagy(GO:0030242) |
0.2 | 0.6 | GO:0070634 | transepithelial ammonium transport(GO:0070634) |
0.2 | 0.4 | GO:0031508 | pericentric heterochromatin assembly(GO:0031508) |
0.2 | 0.6 | GO:0051919 | positive regulation of fibrinolysis(GO:0051919) |
0.2 | 1.2 | GO:0031145 | anaphase-promoting complex-dependent catabolic process(GO:0031145) |
0.2 | 0.8 | GO:0060623 | regulation of chromosome condensation(GO:0060623) |
0.2 | 0.6 | GO:0051791 | medium-chain fatty acid metabolic process(GO:0051791) |
0.2 | 0.6 | GO:1900045 | negative regulation of protein K63-linked ubiquitination(GO:1900045) negative regulation of protein polyubiquitination(GO:1902915) |
0.2 | 0.6 | GO:0006295 | nucleotide-excision repair, DNA incision, 3'-to lesion(GO:0006295) |
0.2 | 0.8 | GO:0098763 | mitotic cell cycle phase(GO:0098763) |
0.2 | 1.0 | GO:0010606 | positive regulation of cytoplasmic mRNA processing body assembly(GO:0010606) |
0.2 | 1.6 | GO:0035745 | T-helper 2 cell cytokine production(GO:0035745) |
0.2 | 6.0 | GO:1902476 | chloride transmembrane transport(GO:1902476) |
0.2 | 1.6 | GO:0071786 | endoplasmic reticulum tubular network organization(GO:0071786) |
0.2 | 0.4 | GO:0000055 | ribosomal large subunit export from nucleus(GO:0000055) |
0.2 | 1.6 | GO:0034498 | early endosome to Golgi transport(GO:0034498) |
0.2 | 0.6 | GO:0009106 | lipoate metabolic process(GO:0009106) |
0.2 | 0.4 | GO:0072386 | plus-end-directed vesicle transport along microtubule(GO:0072383) plus-end-directed organelle transport along microtubule(GO:0072386) |
0.2 | 0.2 | GO:0010908 | regulation of heparan sulfate proteoglycan biosynthetic process(GO:0010908) positive regulation of heparan sulfate proteoglycan biosynthetic process(GO:0010909) positive regulation of proteoglycan biosynthetic process(GO:1902730) |
0.2 | 0.8 | GO:2000255 | negative regulation of male germ cell proliferation(GO:2000255) |
0.2 | 0.2 | GO:1903659 | regulation of complement-dependent cytotoxicity(GO:1903659) negative regulation of complement-dependent cytotoxicity(GO:1903660) |
0.2 | 1.2 | GO:2000310 | regulation of N-methyl-D-aspartate selective glutamate receptor activity(GO:2000310) |
0.2 | 0.8 | GO:0032929 | negative regulation of superoxide anion generation(GO:0032929) |
0.2 | 0.8 | GO:0044845 | cell wall mannoprotein biosynthetic process(GO:0000032) mannoprotein metabolic process(GO:0006056) mannoprotein biosynthetic process(GO:0006057) cell wall glycoprotein biosynthetic process(GO:0031506) cell wall biogenesis(GO:0042546) cell wall macromolecule biosynthetic process(GO:0044038) chain elongation of O-linked mannose residue(GO:0044845) cellular component macromolecule biosynthetic process(GO:0070589) |
0.2 | 0.6 | GO:0015684 | ferrous iron transport(GO:0015684) |
0.2 | 0.4 | GO:0043988 | histone H3-S28 phosphorylation(GO:0043988) |
0.2 | 0.4 | GO:0006543 | glutamine catabolic process(GO:0006543) |
0.2 | 1.5 | GO:0060628 | regulation of ER to Golgi vesicle-mediated transport(GO:0060628) |
0.2 | 0.6 | GO:0016095 | polyprenol catabolic process(GO:0016095) |
0.2 | 0.8 | GO:0010626 | negative regulation of Schwann cell proliferation(GO:0010626) |
0.2 | 0.4 | GO:0060729 | intestinal epithelial structure maintenance(GO:0060729) |
0.2 | 1.3 | GO:0042790 | transcription of nuclear large rRNA transcript from RNA polymerase I promoter(GO:0042790) |
0.2 | 0.2 | GO:2000481 | positive regulation of cAMP-dependent protein kinase activity(GO:2000481) |
0.2 | 0.6 | GO:0048023 | positive regulation of melanin biosynthetic process(GO:0048023) positive regulation of secondary metabolite biosynthetic process(GO:1900378) |
0.2 | 0.6 | GO:1904816 | positive regulation of protein localization to chromosome, telomeric region(GO:1904816) |
0.2 | 0.6 | GO:0090160 | Golgi to lysosome transport(GO:0090160) |
0.2 | 0.4 | GO:0051684 | maintenance of Golgi location(GO:0051684) |
0.2 | 0.7 | GO:0042780 | tRNA 3'-end processing(GO:0042780) |
0.2 | 0.6 | GO:0035790 | platelet-derived growth factor receptor-alpha signaling pathway(GO:0035790) |
0.2 | 0.6 | GO:0046500 | S-adenosylmethionine metabolic process(GO:0046500) |
0.2 | 0.6 | GO:0036444 | calcium ion transmembrane import into mitochondrion(GO:0036444) |
0.2 | 1.1 | GO:0015919 | peroxisomal membrane transport(GO:0015919) protein import into peroxisome membrane(GO:0045046) |
0.2 | 1.5 | GO:0035235 | ionotropic glutamate receptor signaling pathway(GO:0035235) |
0.2 | 0.4 | GO:0046618 | drug export(GO:0046618) |
0.2 | 0.2 | GO:0032786 | positive regulation of DNA-templated transcription, elongation(GO:0032786) |
0.2 | 0.2 | GO:0070669 | response to interleukin-2(GO:0070669) |
0.2 | 0.6 | GO:0015772 | disaccharide transport(GO:0015766) sucrose transport(GO:0015770) oligosaccharide transport(GO:0015772) |
0.2 | 0.2 | GO:2000698 | positive regulation of epithelial cell differentiation involved in kidney development(GO:2000698) |
0.2 | 1.1 | GO:0033313 | meiotic cell cycle checkpoint(GO:0033313) |
0.2 | 2.4 | GO:0008535 | respiratory chain complex IV assembly(GO:0008535) |
0.2 | 0.5 | GO:0034421 | post-translational protein acetylation(GO:0034421) |
0.2 | 0.7 | GO:0050957 | equilibrioception(GO:0050957) |
0.2 | 0.2 | GO:0048880 | sensory system development(GO:0048880) |
0.2 | 0.5 | GO:0000733 | DNA strand renaturation(GO:0000733) |
0.2 | 0.5 | GO:0042908 | xenobiotic transport(GO:0042908) |
0.2 | 0.7 | GO:2000852 | corticosterone secretion(GO:0035934) regulation of corticosterone secretion(GO:2000852) |
0.2 | 0.2 | GO:0003331 | regulation of extracellular matrix constituent secretion(GO:0003330) positive regulation of extracellular matrix constituent secretion(GO:0003331) |
0.2 | 0.7 | GO:0031117 | positive regulation of microtubule depolymerization(GO:0031117) |
0.2 | 0.9 | GO:0015884 | folic acid transport(GO:0015884) |
0.2 | 0.4 | GO:2000705 | regulation of dense core granule biogenesis(GO:2000705) |
0.2 | 0.4 | GO:0046959 | habituation(GO:0046959) |
0.2 | 1.6 | GO:0051968 | positive regulation of synaptic transmission, glutamatergic(GO:0051968) |
0.2 | 0.7 | GO:0015911 | plasma membrane long-chain fatty acid transport(GO:0015911) fatty acid transmembrane transport(GO:1902001) |
0.2 | 1.3 | GO:0048304 | positive regulation of isotype switching to IgG isotypes(GO:0048304) |
0.2 | 2.3 | GO:0001833 | inner cell mass cell proliferation(GO:0001833) |
0.2 | 0.5 | GO:0035935 | androgen secretion(GO:0035935) regulation of androgen secretion(GO:2000834) positive regulation of androgen secretion(GO:2000836) |
0.2 | 1.8 | GO:0006335 | DNA replication-dependent nucleosome assembly(GO:0006335) DNA replication-dependent nucleosome organization(GO:0034723) |
0.2 | 0.7 | GO:0007171 | activation of transmembrane receptor protein tyrosine kinase activity(GO:0007171) |
0.2 | 0.4 | GO:0033668 | negative regulation by symbiont of host apoptotic process(GO:0033668) negative regulation by symbiont of host programmed cell death(GO:0052041) negative regulation by organism of programmed cell death in other organism involved in symbiotic interaction(GO:0052490) |
0.2 | 0.4 | GO:0016259 | selenocysteine metabolic process(GO:0016259) |
0.2 | 0.7 | GO:0044828 | negative regulation by host of viral genome replication(GO:0044828) |
0.2 | 1.6 | GO:0007194 | negative regulation of adenylate cyclase activity(GO:0007194) |
0.2 | 0.5 | GO:2001166 | regulation of histone H2B ubiquitination(GO:2001166) positive regulation of histone H2B ubiquitination(GO:2001168) |
0.2 | 0.7 | GO:0035279 | mRNA cleavage involved in gene silencing by miRNA(GO:0035279) mRNA cleavage involved in gene silencing(GO:0098795) |
0.2 | 1.0 | GO:0034242 | negative regulation of syncytium formation by plasma membrane fusion(GO:0034242) |
0.2 | 0.5 | GO:0038128 | ERBB2 signaling pathway(GO:0038128) |
0.2 | 0.7 | GO:1903608 | protein localization to cytoplasmic stress granule(GO:1903608) |
0.2 | 1.0 | GO:0031119 | tRNA pseudouridine synthesis(GO:0031119) |
0.2 | 0.2 | GO:0032532 | regulation of microvillus length(GO:0032532) |
0.2 | 1.2 | GO:0035751 | regulation of lysosomal lumen pH(GO:0035751) |
0.2 | 1.2 | GO:0000463 | maturation of LSU-rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000463) |
0.2 | 0.5 | GO:0035609 | C-terminal protein deglutamylation(GO:0035609) |
0.2 | 0.7 | GO:0001542 | ovulation from ovarian follicle(GO:0001542) |
0.2 | 0.3 | GO:0042538 | hyperosmotic salinity response(GO:0042538) |
0.2 | 0.8 | GO:0070050 | neuron cellular homeostasis(GO:0070050) |
0.2 | 0.5 | GO:0006432 | phenylalanyl-tRNA aminoacylation(GO:0006432) |
0.2 | 0.5 | GO:0006013 | mannose metabolic process(GO:0006013) |
0.2 | 2.5 | GO:0006607 | NLS-bearing protein import into nucleus(GO:0006607) |
0.2 | 0.5 | GO:0021698 | cerebellar cortex structural organization(GO:0021698) |
0.2 | 0.2 | GO:2000399 | negative regulation of thymocyte aggregation(GO:2000399) |
0.2 | 4.1 | GO:0090004 | positive regulation of establishment of protein localization to plasma membrane(GO:0090004) |
0.2 | 0.5 | GO:0060022 | hard palate development(GO:0060022) |
0.2 | 0.7 | GO:0010739 | positive regulation of protein kinase A signaling(GO:0010739) |
0.2 | 1.3 | GO:0035520 | monoubiquitinated protein deubiquitination(GO:0035520) |
0.2 | 0.6 | GO:0036507 | protein deglycosylation involved in glycoprotein catabolic process(GO:0035977) protein demannosylation(GO:0036507) protein alpha-1,2-demannosylation(GO:0036508) mannose trimming involved in glycoprotein ERAD pathway(GO:1904382) |
0.2 | 0.2 | GO:0090325 | regulation of locomotion involved in locomotory behavior(GO:0090325) |
0.2 | 0.3 | GO:0070295 | renal water absorption(GO:0070295) |
0.2 | 0.5 | GO:0070213 | protein auto-ADP-ribosylation(GO:0070213) |
0.2 | 1.0 | GO:0048172 | regulation of short-term neuronal synaptic plasticity(GO:0048172) |
0.2 | 1.6 | GO:0031297 | replication fork processing(GO:0031297) |
0.2 | 0.2 | GO:0070535 | histone H2A K63-linked ubiquitination(GO:0070535) |
0.2 | 0.6 | GO:0071896 | protein localization to adherens junction(GO:0071896) |
0.2 | 1.4 | GO:0010919 | regulation of inositol phosphate biosynthetic process(GO:0010919) |
0.2 | 0.8 | GO:0015677 | copper ion import(GO:0015677) |
0.2 | 1.1 | GO:1901407 | regulation of phosphorylation of RNA polymerase II C-terminal domain(GO:1901407) positive regulation of phosphorylation of RNA polymerase II C-terminal domain(GO:1901409) |
0.2 | 0.8 | GO:0002087 | regulation of respiratory gaseous exchange by neurological system process(GO:0002087) |
0.2 | 0.3 | GO:0006741 | NADP biosynthetic process(GO:0006741) |
0.2 | 0.9 | GO:0035989 | tendon development(GO:0035989) |
0.2 | 1.4 | GO:1901673 | regulation of mitotic spindle assembly(GO:1901673) |
0.2 | 0.2 | GO:0002740 | negative regulation of cytokine secretion involved in immune response(GO:0002740) |
0.2 | 0.5 | GO:2001206 | positive regulation of osteoclast development(GO:2001206) |
0.2 | 0.5 | GO:2000659 | regulation of interleukin-1-mediated signaling pathway(GO:2000659) |
0.2 | 3.7 | GO:1901099 | negative regulation of signal transduction in absence of ligand(GO:1901099) negative regulation of extrinsic apoptotic signaling pathway in absence of ligand(GO:2001240) |
0.2 | 0.2 | GO:0097212 | lysosomal membrane organization(GO:0097212) |
0.2 | 0.9 | GO:0097264 | self proteolysis(GO:0097264) |
0.2 | 0.3 | GO:0006868 | glutamine transport(GO:0006868) |
0.2 | 0.3 | GO:0032908 | transforming growth factor beta1 production(GO:0032905) regulation of transforming growth factor beta1 production(GO:0032908) |
0.2 | 0.3 | GO:2000630 | positive regulation of miRNA metabolic process(GO:2000630) |
0.2 | 2.6 | GO:0033014 | porphyrin-containing compound biosynthetic process(GO:0006779) tetrapyrrole biosynthetic process(GO:0033014) |
0.2 | 0.6 | GO:0007258 | JUN phosphorylation(GO:0007258) |
0.2 | 1.8 | GO:0031167 | rRNA methylation(GO:0031167) |
0.2 | 0.3 | GO:0010751 | negative regulation of nitric oxide mediated signal transduction(GO:0010751) |
0.2 | 0.6 | GO:0045162 | clustering of voltage-gated sodium channels(GO:0045162) |
0.2 | 1.8 | GO:0099601 | regulation of neurotransmitter receptor activity(GO:0099601) |
0.2 | 0.5 | GO:0010796 | regulation of multivesicular body size(GO:0010796) |
0.2 | 0.3 | GO:1901252 | regulation of intracellular transport of viral material(GO:1901252) |
0.2 | 0.6 | GO:0051151 | negative regulation of smooth muscle cell differentiation(GO:0051151) |
0.2 | 4.7 | GO:0006418 | tRNA aminoacylation for protein translation(GO:0006418) |
0.2 | 1.5 | GO:0019885 | antigen processing and presentation of endogenous peptide antigen via MHC class I(GO:0019885) |
0.1 | 0.4 | GO:0071596 | ubiquitin-dependent protein catabolic process via the N-end rule pathway(GO:0071596) |
0.1 | 0.4 | GO:0051388 | positive regulation of neurotrophin TRK receptor signaling pathway(GO:0051388) |
0.1 | 0.7 | GO:0003376 | sphingosine-1-phosphate signaling pathway(GO:0003376) |
0.1 | 0.4 | GO:2000491 | positive regulation of hepatic stellate cell activation(GO:2000491) |
0.1 | 0.7 | GO:0045948 | positive regulation of translational initiation(GO:0045948) |
0.1 | 1.0 | GO:0043576 | regulation of respiratory gaseous exchange(GO:0043576) |
0.1 | 0.3 | GO:0016188 | synaptic vesicle maturation(GO:0016188) |
0.1 | 0.6 | GO:0051697 | protein delipidation(GO:0051697) |
0.1 | 1.2 | GO:0046599 | regulation of centriole replication(GO:0046599) |
0.1 | 0.7 | GO:0071107 | response to parathyroid hormone(GO:0071107) |
0.1 | 0.1 | GO:0007412 | axon target recognition(GO:0007412) |
0.1 | 0.4 | GO:0043039 | amino acid activation(GO:0043038) tRNA aminoacylation(GO:0043039) |
0.1 | 0.9 | GO:1900262 | regulation of DNA-directed DNA polymerase activity(GO:1900262) positive regulation of DNA-directed DNA polymerase activity(GO:1900264) |
0.1 | 0.1 | GO:0016078 | tRNA catabolic process(GO:0016078) |
0.1 | 1.3 | GO:0009301 | snRNA transcription(GO:0009301) |
0.1 | 2.5 | GO:0007616 | long-term memory(GO:0007616) |
0.1 | 2.4 | GO:0071475 | cellular hyperosmotic salinity response(GO:0071475) |
0.1 | 0.4 | GO:1901843 | positive regulation of high voltage-gated calcium channel activity(GO:1901843) |
0.1 | 2.7 | GO:0006491 | N-glycan processing(GO:0006491) |
0.1 | 0.3 | GO:0006663 | platelet activating factor biosynthetic process(GO:0006663) platelet activating factor metabolic process(GO:0046469) |
0.1 | 0.1 | GO:0007571 | age-dependent response to oxidative stress(GO:0001306) age-dependent general metabolic decline(GO:0007571) |
0.1 | 0.7 | GO:0009052 | pentose-phosphate shunt, non-oxidative branch(GO:0009052) |
0.1 | 1.3 | GO:0000290 | deadenylation-dependent decapping of nuclear-transcribed mRNA(GO:0000290) |
0.1 | 0.7 | GO:0034501 | protein localization to kinetochore(GO:0034501) |
0.1 | 0.1 | GO:0001787 | natural killer cell proliferation(GO:0001787) |
0.1 | 1.7 | GO:0006047 | UDP-N-acetylglucosamine metabolic process(GO:0006047) |
0.1 | 0.4 | GO:1990928 | response to amino acid starvation(GO:1990928) |
0.1 | 0.3 | GO:0001998 | angiotensin mediated vasoconstriction involved in regulation of systemic arterial blood pressure(GO:0001998) |
0.1 | 1.6 | GO:0000470 | maturation of LSU-rRNA(GO:0000470) |
0.1 | 1.4 | GO:0060576 | intestinal epithelial cell development(GO:0060576) |
0.1 | 0.6 | GO:1903332 | regulation of protein folding(GO:1903332) |
0.1 | 0.1 | GO:0097466 | glycoprotein ERAD pathway(GO:0097466) response to glycoprotein(GO:1904587) |
0.1 | 1.3 | GO:0001867 | complement activation, lectin pathway(GO:0001867) |
0.1 | 0.3 | GO:0022605 | oogenesis stage(GO:0022605) |
0.1 | 0.7 | GO:0031053 | primary miRNA processing(GO:0031053) |
0.1 | 0.4 | GO:0036265 | RNA (guanine-N7)-methylation(GO:0036265) |
0.1 | 0.4 | GO:0032466 | negative regulation of cytokinesis(GO:0032466) |
0.1 | 1.0 | GO:1904153 | negative regulation of protein exit from endoplasmic reticulum(GO:0070862) negative regulation of retrograde protein transport, ER to cytosol(GO:1904153) |
0.1 | 0.3 | GO:1901300 | positive regulation of hydrogen peroxide-mediated programmed cell death(GO:1901300) positive regulation of hydrogen peroxide-induced cell death(GO:1905206) |
0.1 | 0.4 | GO:0061625 | fructose catabolic process(GO:0006001) fructose catabolic process to hydroxyacetone phosphate and glyceraldehyde-3-phosphate(GO:0061624) glycolytic process through fructose-1-phosphate(GO:0061625) |
0.1 | 0.4 | GO:0001560 | regulation of cell growth by extracellular stimulus(GO:0001560) |
0.1 | 0.7 | GO:2000786 | positive regulation of autophagosome assembly(GO:2000786) |
0.1 | 0.5 | GO:0002923 | regulation of humoral immune response mediated by circulating immunoglobulin(GO:0002923) |
0.1 | 5.2 | GO:0032543 | mitochondrial translation(GO:0032543) |
0.1 | 0.5 | GO:0006287 | base-excision repair, gap-filling(GO:0006287) |
0.1 | 0.4 | GO:0001907 | killing by symbiont of host cells(GO:0001907) disruption by symbiont of host cell(GO:0044004) |
0.1 | 0.1 | GO:0045914 | negative regulation of catecholamine metabolic process(GO:0045914) negative regulation of dopamine metabolic process(GO:0045963) |
0.1 | 0.3 | GO:1990414 | replication-born double-strand break repair via sister chromatid exchange(GO:1990414) |
0.1 | 0.4 | GO:0070120 | ciliary neurotrophic factor-mediated signaling pathway(GO:0070120) |
0.1 | 0.8 | GO:0031987 | locomotion involved in locomotory behavior(GO:0031987) |
0.1 | 1.5 | GO:0009396 | folic acid-containing compound biosynthetic process(GO:0009396) |
0.1 | 0.4 | GO:2000574 | regulation of microtubule motor activity(GO:2000574) |
0.1 | 0.1 | GO:0038027 | apolipoprotein A-I-mediated signaling pathway(GO:0038027) |
0.1 | 0.8 | GO:0051418 | interphase microtubule nucleation by interphase microtubule organizing center(GO:0051415) microtubule nucleation by microtubule organizing center(GO:0051418) |
0.1 | 0.1 | GO:0042590 | antigen processing and presentation of exogenous peptide antigen via MHC class I(GO:0042590) |
0.1 | 0.7 | GO:0060267 | positive regulation of respiratory burst(GO:0060267) |
0.1 | 0.8 | GO:2000601 | positive regulation of Arp2/3 complex-mediated actin nucleation(GO:2000601) |
0.1 | 0.7 | GO:0030205 | dermatan sulfate metabolic process(GO:0030205) |
0.1 | 0.8 | GO:0060546 | negative regulation of necroptotic process(GO:0060546) |
0.1 | 1.1 | GO:0046007 | negative regulation of activated T cell proliferation(GO:0046007) |
0.1 | 0.5 | GO:0030259 | lipid glycosylation(GO:0030259) |
0.1 | 0.3 | GO:0002669 | positive regulation of T cell anergy(GO:0002669) positive regulation of lymphocyte anergy(GO:0002913) |
0.1 | 0.3 | GO:0061054 | dermatome development(GO:0061054) regulation of dermatome development(GO:0061183) |
0.1 | 0.9 | GO:1901339 | regulation of store-operated calcium channel activity(GO:1901339) |
0.1 | 0.9 | GO:0045654 | positive regulation of megakaryocyte differentiation(GO:0045654) |
0.1 | 0.9 | GO:0042136 | neurotransmitter biosynthetic process(GO:0042136) |
0.1 | 0.5 | GO:0045656 | negative regulation of monocyte differentiation(GO:0045656) |
0.1 | 0.8 | GO:0008300 | isoprenoid catabolic process(GO:0008300) |
0.1 | 1.4 | GO:0006071 | glycerol metabolic process(GO:0006071) |
0.1 | 0.4 | GO:0070366 | regulation of hepatocyte differentiation(GO:0070366) |
0.1 | 0.5 | GO:0030432 | peristalsis(GO:0030432) |
0.1 | 0.4 | GO:0071042 | U1 snRNA 3'-end processing(GO:0034473) U5 snRNA 3'-end processing(GO:0034476) nuclear polyadenylation-dependent mRNA catabolic process(GO:0071042) polyadenylation-dependent mRNA catabolic process(GO:0071047) |
0.1 | 1.0 | GO:0045217 | cell-cell junction maintenance(GO:0045217) |
0.1 | 1.3 | GO:2000637 | positive regulation of gene silencing by miRNA(GO:2000637) |
0.1 | 1.9 | GO:0008608 | attachment of spindle microtubules to kinetochore(GO:0008608) |
0.1 | 0.6 | GO:1902916 | positive regulation of protein polyubiquitination(GO:1902916) |
0.1 | 0.1 | GO:1902804 | negative regulation of synaptic vesicle transport(GO:1902804) |
0.1 | 0.3 | GO:0060478 | acrosomal vesicle exocytosis(GO:0060478) |
0.1 | 0.3 | GO:0030950 | establishment or maintenance of actin cytoskeleton polarity(GO:0030950) establishment or maintenance of cytoskeleton polarity(GO:0030952) |
0.1 | 0.4 | GO:0000350 | generation of catalytic spliceosome for second transesterification step(GO:0000350) |
0.1 | 0.6 | GO:0033133 | positive regulation of glucokinase activity(GO:0033133) positive regulation of hexokinase activity(GO:1903301) |
0.1 | 0.6 | GO:0060235 | lens induction in camera-type eye(GO:0060235) |
0.1 | 1.4 | GO:0032525 | somite rostral/caudal axis specification(GO:0032525) |
0.1 | 0.1 | GO:0045583 | regulation of cytotoxic T cell differentiation(GO:0045583) positive regulation of cytotoxic T cell differentiation(GO:0045585) |
0.1 | 0.6 | GO:1904970 | brush border assembly(GO:1904970) |
0.1 | 1.4 | GO:0021516 | dorsal spinal cord development(GO:0021516) |
0.1 | 1.0 | GO:0090161 | Golgi ribbon formation(GO:0090161) |
0.1 | 0.9 | GO:0090084 | negative regulation of inclusion body assembly(GO:0090084) |
0.1 | 0.2 | GO:0070365 | hepatocyte differentiation(GO:0070365) |
0.1 | 0.9 | GO:0045332 | phospholipid translocation(GO:0045332) |
0.1 | 0.6 | GO:0048680 | positive regulation of axon regeneration(GO:0048680) |
0.1 | 0.2 | GO:0032056 | positive regulation of translation in response to stress(GO:0032056) |
0.1 | 0.6 | GO:0070934 | CRD-mediated mRNA stabilization(GO:0070934) |
0.1 | 0.2 | GO:0042268 | regulation of cytolysis(GO:0042268) |
0.1 | 0.7 | GO:0021546 | rhombomere development(GO:0021546) |
0.1 | 0.2 | GO:0002924 | negative regulation of humoral immune response mediated by circulating immunoglobulin(GO:0002924) |
0.1 | 0.2 | GO:0006538 | glutamate catabolic process(GO:0006538) |
0.1 | 0.1 | GO:0014054 | positive regulation of gamma-aminobutyric acid secretion(GO:0014054) |
0.1 | 0.5 | GO:0010032 | meiotic chromosome condensation(GO:0010032) |
0.1 | 0.4 | GO:0048014 | Tie signaling pathway(GO:0048014) |
0.1 | 0.4 | GO:1901856 | negative regulation of cellular respiration(GO:1901856) |
0.1 | 2.4 | GO:0014003 | oligodendrocyte development(GO:0014003) |
0.1 | 0.8 | GO:0043649 | dicarboxylic acid catabolic process(GO:0043649) |
0.1 | 0.4 | GO:0000710 | meiotic mismatch repair(GO:0000710) |
0.1 | 0.4 | GO:0043137 | DNA replication, removal of RNA primer(GO:0043137) |
0.1 | 0.2 | GO:0002175 | protein localization to paranode region of axon(GO:0002175) protein localization to axon(GO:0099612) |
0.1 | 0.2 | GO:0016554 | cytidine to uridine editing(GO:0016554) |
0.1 | 0.1 | GO:0099515 | actin filament-based transport(GO:0099515) |
0.1 | 1.2 | GO:0007020 | microtubule nucleation(GO:0007020) |
0.1 | 0.6 | GO:0007076 | mitotic chromosome condensation(GO:0007076) |
0.1 | 0.1 | GO:0000393 | spliceosomal conformational changes to generate catalytic conformation(GO:0000393) |
0.1 | 1.0 | GO:0035337 | fatty-acyl-CoA metabolic process(GO:0035337) |
0.1 | 0.6 | GO:0006451 | selenocysteine incorporation(GO:0001514) translational readthrough(GO:0006451) |
0.1 | 0.2 | GO:0043152 | induction of bacterial agglutination(GO:0043152) |
0.1 | 0.3 | GO:0010499 | proteasomal ubiquitin-independent protein catabolic process(GO:0010499) |
0.1 | 0.1 | GO:0010960 | magnesium ion homeostasis(GO:0010960) |
0.1 | 0.3 | GO:0001920 | negative regulation of receptor recycling(GO:0001920) |
0.1 | 0.6 | GO:0034244 | negative regulation of transcription elongation from RNA polymerase II promoter(GO:0034244) |
0.1 | 0.5 | GO:0010172 | embryonic body morphogenesis(GO:0010172) |
0.1 | 0.5 | GO:0019530 | taurine metabolic process(GO:0019530) |
0.1 | 0.2 | GO:0016080 | synaptic vesicle targeting(GO:0016080) |
0.1 | 0.1 | GO:1900363 | regulation of mRNA polyadenylation(GO:1900363) |
0.1 | 0.2 | GO:0002314 | germinal center B cell differentiation(GO:0002314) |
0.1 | 0.5 | GO:0018230 | peptidyl-L-cysteine S-palmitoylation(GO:0018230) peptidyl-S-diacylglycerol-L-cysteine biosynthetic process from peptidyl-cysteine(GO:0018231) |
0.1 | 0.1 | GO:0035106 | operant conditioning(GO:0035106) |
0.1 | 1.1 | GO:0035418 | protein localization to synapse(GO:0035418) |
0.1 | 0.2 | GO:0009051 | pentose-phosphate shunt, oxidative branch(GO:0009051) |
0.1 | 0.1 | GO:0071839 | apoptotic process in bone marrow(GO:0071839) regulation of apoptotic process in bone marrow(GO:0071865) negative regulation of apoptotic process in bone marrow(GO:0071866) |
0.1 | 0.1 | GO:0002378 | immunoglobulin biosynthetic process(GO:0002378) |
0.1 | 0.7 | GO:0048934 | peripheral nervous system neuron differentiation(GO:0048934) peripheral nervous system neuron development(GO:0048935) |
0.1 | 0.3 | GO:0051571 | positive regulation of histone H3-K4 methylation(GO:0051571) |
0.1 | 0.3 | GO:0019532 | oxalate transport(GO:0019532) |
0.1 | 0.3 | GO:0021797 | forebrain anterior/posterior pattern specification(GO:0021797) |
0.1 | 0.3 | GO:0016584 | nucleosome positioning(GO:0016584) |
0.1 | 0.2 | GO:0043490 | malate-aspartate shuttle(GO:0043490) |
0.1 | 3.5 | GO:0006289 | nucleotide-excision repair(GO:0006289) |
0.1 | 0.2 | GO:0051105 | regulation of DNA ligation(GO:0051105) positive regulation of DNA ligation(GO:0051106) |
0.1 | 0.4 | GO:0001672 | regulation of chromatin assembly or disassembly(GO:0001672) |
0.1 | 2.4 | GO:0006270 | DNA replication initiation(GO:0006270) |
0.1 | 0.3 | GO:0015889 | cobalamin transport(GO:0015889) |
0.1 | 0.1 | GO:0006501 | C-terminal protein lipidation(GO:0006501) |
0.1 | 0.8 | GO:0006490 | oligosaccharide-lipid intermediate biosynthetic process(GO:0006490) |
0.1 | 0.1 | GO:0021877 | forebrain neuron fate commitment(GO:0021877) |
0.1 | 0.4 | GO:0033353 | S-adenosylmethionine cycle(GO:0033353) |
0.1 | 0.3 | GO:0090394 | negative regulation of excitatory postsynaptic potential(GO:0090394) |
0.1 | 0.5 | GO:0033523 | histone H2B ubiquitination(GO:0033523) |
0.1 | 0.6 | GO:0006265 | DNA topological change(GO:0006265) |
0.1 | 0.4 | GO:0051310 | metaphase plate congression(GO:0051310) |
0.1 | 0.1 | GO:0014858 | positive regulation of skeletal muscle cell proliferation(GO:0014858) |
0.1 | 0.5 | GO:0070525 | tRNA threonylcarbamoyladenosine metabolic process(GO:0070525) |
0.1 | 0.4 | GO:0071073 | positive regulation of phospholipid biosynthetic process(GO:0071073) |
0.1 | 0.4 | GO:0033860 | regulation of NAD(P)H oxidase activity(GO:0033860) |
0.1 | 0.2 | GO:0018242 | protein O-linked glycosylation via serine(GO:0018242) |
0.1 | 0.3 | GO:1900108 | negative regulation of nodal signaling pathway(GO:1900108) |
0.1 | 0.1 | GO:0035993 | deltoid tuberosity development(GO:0035993) |
0.1 | 0.6 | GO:0042535 | positive regulation of tumor necrosis factor biosynthetic process(GO:0042535) |
0.1 | 0.9 | GO:0036065 | fucosylation(GO:0036065) |
0.1 | 0.5 | GO:0070423 | nucleotide-binding oligomerization domain containing signaling pathway(GO:0070423) nucleotide-binding oligomerization domain containing 2 signaling pathway(GO:0070431) |
0.1 | 0.3 | GO:0016082 | synaptic vesicle priming(GO:0016082) |
0.1 | 0.8 | GO:0045086 | positive regulation of interleukin-2 biosynthetic process(GO:0045086) |
0.1 | 0.1 | GO:0006362 | transcription elongation from RNA polymerase I promoter(GO:0006362) |
0.1 | 0.4 | GO:0046125 | pyrimidine deoxyribonucleoside metabolic process(GO:0046125) |
0.1 | 0.7 | GO:0033013 | tetrapyrrole metabolic process(GO:0033013) |
0.1 | 0.1 | GO:0051231 | spindle elongation(GO:0051231) |
0.1 | 1.3 | GO:0016339 | calcium-dependent cell-cell adhesion via plasma membrane cell adhesion molecules(GO:0016339) |
0.1 | 0.3 | GO:1902775 | mitochondrial large ribosomal subunit assembly(GO:1902775) |
0.1 | 0.7 | GO:0051409 | response to nitrosative stress(GO:0051409) |
0.1 | 0.7 | GO:0048280 | vesicle fusion with Golgi apparatus(GO:0048280) |
0.1 | 0.3 | GO:1904874 | RNA localization to Cajal body(GO:0090670) telomerase RNA localization to Cajal body(GO:0090671) telomerase RNA localization(GO:0090672) regulation of telomerase RNA localization to Cajal body(GO:1904872) positive regulation of telomerase RNA localization to Cajal body(GO:1904874) |
0.1 | 0.3 | GO:0071494 | cellular response to UV-C(GO:0071494) |
0.1 | 0.6 | GO:0043545 | Mo-molybdopterin cofactor biosynthetic process(GO:0006777) Mo-molybdopterin cofactor metabolic process(GO:0019720) molybdopterin cofactor biosynthetic process(GO:0032324) molybdopterin cofactor metabolic process(GO:0043545) prosthetic group metabolic process(GO:0051189) |
0.1 | 0.3 | GO:0070837 | dehydroascorbic acid transport(GO:0070837) |
0.1 | 0.1 | GO:1903599 | positive regulation of mitophagy(GO:1903599) |
0.1 | 0.2 | GO:0070100 | negative regulation of chemokine-mediated signaling pathway(GO:0070100) |
0.1 | 1.5 | GO:0032981 | NADH dehydrogenase complex assembly(GO:0010257) mitochondrial respiratory chain complex I assembly(GO:0032981) mitochondrial respiratory chain complex I biogenesis(GO:0097031) |
0.1 | 0.1 | GO:0071472 | cellular response to salt stress(GO:0071472) |
0.1 | 0.2 | GO:0015888 | thiamine transport(GO:0015888) |
0.1 | 0.5 | GO:0006703 | estrogen biosynthetic process(GO:0006703) |
0.1 | 3.7 | GO:0007157 | heterophilic cell-cell adhesion via plasma membrane cell adhesion molecules(GO:0007157) |
0.1 | 0.1 | GO:2001055 | positive regulation of mesenchymal cell apoptotic process(GO:2001055) |
0.1 | 0.2 | GO:0051036 | regulation of endosome size(GO:0051036) |
0.1 | 0.5 | GO:0042573 | retinoic acid metabolic process(GO:0042573) |
0.1 | 0.2 | GO:2000609 | regulation of thyroid hormone generation(GO:2000609) |
0.1 | 0.3 | GO:0033499 | galactose catabolic process via UDP-galactose(GO:0033499) glycolytic process from galactose(GO:0061623) |
0.1 | 0.2 | GO:0044766 | multi-organism transport(GO:0044766) multi-organism localization(GO:1902579) |
0.1 | 0.1 | GO:0001805 | type III hypersensitivity(GO:0001802) regulation of type III hypersensitivity(GO:0001803) positive regulation of type III hypersensitivity(GO:0001805) |
0.1 | 1.3 | GO:0030488 | tRNA methylation(GO:0030488) |
0.1 | 0.2 | GO:0042851 | L-alanine metabolic process(GO:0042851) |
0.1 | 0.2 | GO:1901069 | guanosine-containing compound catabolic process(GO:1901069) |
0.1 | 0.3 | GO:1904417 | regulation of xenophagy(GO:1904415) positive regulation of xenophagy(GO:1904417) |
0.1 | 0.3 | GO:0046874 | quinolinate metabolic process(GO:0046874) |
0.1 | 0.8 | GO:0001675 | acrosome assembly(GO:0001675) |
0.1 | 0.4 | GO:0018211 | protein C-linked glycosylation(GO:0018103) peptidyl-tryptophan modification(GO:0018211) protein C-linked glycosylation via tryptophan(GO:0018317) protein C-linked glycosylation via 2'-alpha-mannosyl-L-tryptophan(GO:0018406) |
0.1 | 1.3 | GO:0032012 | ARF protein signal transduction(GO:0032011) regulation of ARF protein signal transduction(GO:0032012) |
0.1 | 0.6 | GO:2000781 | positive regulation of double-strand break repair(GO:2000781) |
0.1 | 0.2 | GO:0031642 | negative regulation of myelination(GO:0031642) |
0.1 | 2.6 | GO:0021766 | hippocampus development(GO:0021766) |
0.1 | 0.1 | GO:0048254 | snoRNA localization(GO:0048254) |
0.1 | 0.3 | GO:1900060 | negative regulation of ceramide biosynthetic process(GO:1900060) |
0.1 | 0.2 | GO:0010520 | regulation of reciprocal meiotic recombination(GO:0010520) |
0.1 | 0.2 | GO:0048752 | semicircular canal morphogenesis(GO:0048752) |
0.1 | 0.3 | GO:1903265 | positive regulation of tumor necrosis factor-mediated signaling pathway(GO:1903265) |
0.1 | 0.2 | GO:0034086 | maintenance of sister chromatid cohesion(GO:0034086) maintenance of mitotic sister chromatid cohesion(GO:0034088) |
0.1 | 1.3 | GO:0048488 | synaptic vesicle endocytosis(GO:0048488) |
0.1 | 1.9 | GO:0008299 | isoprenoid biosynthetic process(GO:0008299) |
0.1 | 0.1 | GO:0002034 | regulation of blood vessel size by renin-angiotensin(GO:0002034) renal control of peripheral vascular resistance involved in regulation of systemic arterial blood pressure(GO:0003072) |
0.1 | 0.6 | GO:0045292 | mRNA cis splicing, via spliceosome(GO:0045292) |
0.1 | 0.3 | GO:0071502 | cellular response to temperature stimulus(GO:0071502) |
0.1 | 1.0 | GO:0009404 | toxin metabolic process(GO:0009404) |
0.1 | 3.2 | GO:0070098 | chemokine-mediated signaling pathway(GO:0070098) |
0.1 | 0.2 | GO:0061156 | pulmonary artery morphogenesis(GO:0061156) |
0.1 | 0.3 | GO:0045410 | positive regulation of interleukin-6 biosynthetic process(GO:0045410) |
0.1 | 0.4 | GO:0042428 | serotonin metabolic process(GO:0042428) |
0.1 | 0.4 | GO:0071043 | CUT catabolic process(GO:0071034) CUT metabolic process(GO:0071043) |
0.1 | 0.2 | GO:0009794 | regulation of mitotic cell cycle, embryonic(GO:0009794) mitotic cell cycle, embryonic(GO:0045448) |
0.1 | 0.5 | GO:0090151 | establishment of protein localization to mitochondrial membrane(GO:0090151) |
0.1 | 0.3 | GO:0051103 | DNA ligation involved in DNA repair(GO:0051103) |
0.1 | 0.3 | GO:0007196 | adenylate cyclase-inhibiting G-protein coupled glutamate receptor signaling pathway(GO:0007196) |
0.1 | 0.7 | GO:0051770 | positive regulation of nitric-oxide synthase biosynthetic process(GO:0051770) |
0.1 | 0.1 | GO:0045472 | response to ether(GO:0045472) |
0.1 | 0.4 | GO:0035542 | regulation of SNARE complex assembly(GO:0035542) |
0.1 | 0.3 | GO:1903215 | negative regulation of protein targeting to mitochondrion(GO:1903215) |
0.1 | 0.2 | GO:0098870 | neuronal action potential propagation(GO:0019227) action potential propagation(GO:0098870) |
0.1 | 0.3 | GO:0002069 | columnar/cuboidal epithelial cell maturation(GO:0002069) glandular epithelial cell maturation(GO:0002071) |
0.1 | 0.9 | GO:0034389 | lipid particle organization(GO:0034389) |
0.1 | 0.4 | GO:0031293 | membrane protein intracellular domain proteolysis(GO:0031293) |
0.1 | 0.6 | GO:0032099 | negative regulation of appetite(GO:0032099) |
0.1 | 0.3 | GO:0006398 | mRNA 3'-end processing by stem-loop binding and cleavage(GO:0006398) |
0.1 | 1.1 | GO:0097352 | autophagosome maturation(GO:0097352) |
0.1 | 3.0 | GO:0051225 | spindle assembly(GO:0051225) |
0.1 | 0.4 | GO:0051292 | nuclear pore complex assembly(GO:0051292) |
0.1 | 1.0 | GO:0048305 | immunoglobulin secretion(GO:0048305) |
0.1 | 0.1 | GO:0002074 | extraocular skeletal muscle development(GO:0002074) |
0.1 | 0.2 | GO:0046391 | 5-phosphoribose 1-diphosphate biosynthetic process(GO:0006015) 5-phosphoribose 1-diphosphate metabolic process(GO:0046391) |
0.1 | 0.1 | GO:0019747 | regulation of isoprenoid metabolic process(GO:0019747) negative regulation of intestinal absorption(GO:1904479) |
0.1 | 0.4 | GO:0045743 | positive regulation of fibroblast growth factor receptor signaling pathway(GO:0045743) |
0.1 | 0.3 | GO:0033504 | floor plate development(GO:0033504) |
0.1 | 0.3 | GO:0003150 | muscular septum morphogenesis(GO:0003150) |
0.1 | 0.1 | GO:0090166 | Golgi disassembly(GO:0090166) |
0.1 | 0.3 | GO:0035247 | peptidyl-arginine methylation, to asymmetrical-dimethyl arginine(GO:0019919) peptidyl-arginine omega-N-methylation(GO:0035247) |
0.1 | 0.2 | GO:1901536 | regulation of DNA demethylation(GO:1901535) negative regulation of DNA demethylation(GO:1901536) |
0.1 | 0.1 | GO:0009946 | proximal/distal axis specification(GO:0009946) |
0.1 | 0.7 | GO:0010388 | protein deneddylation(GO:0000338) cullin deneddylation(GO:0010388) |
0.1 | 0.2 | GO:0072161 | mesenchymal cell differentiation involved in kidney development(GO:0072161) mesenchymal cell differentiation involved in renal system development(GO:2001012) |
0.1 | 0.4 | GO:1902902 | negative regulation of autophagosome assembly(GO:1902902) |
0.1 | 0.2 | GO:0002525 | acute inflammatory response to non-antigenic stimulus(GO:0002525) |
0.1 | 0.1 | GO:0032222 | regulation of synaptic transmission, cholinergic(GO:0032222) |
0.1 | 0.2 | GO:0003419 | growth plate cartilage chondrocyte proliferation(GO:0003419) |
0.1 | 0.2 | GO:0002870 | lymphocyte anergy(GO:0002249) regulation of T cell anergy(GO:0002667) T cell anergy(GO:0002870) regulation of lymphocyte anergy(GO:0002911) |
0.1 | 1.2 | GO:0070207 | protein homotrimerization(GO:0070207) |
0.1 | 0.1 | GO:0060547 | negative regulation of necrotic cell death(GO:0060547) |
0.1 | 0.9 | GO:0030150 | protein import into mitochondrial matrix(GO:0030150) |
0.1 | 0.2 | GO:0036135 | Schwann cell migration(GO:0036135) regulation of Schwann cell migration(GO:1900147) |
0.1 | 0.2 | GO:1904666 | regulation of ubiquitin protein ligase activity(GO:1904666) |
0.1 | 0.2 | GO:1900109 | regulation of histone H3-K9 dimethylation(GO:1900109) |
0.1 | 0.1 | GO:0061209 | cell proliferation involved in mesonephros development(GO:0061209) |
0.1 | 0.9 | GO:0030033 | microvillus assembly(GO:0030033) |
0.1 | 0.2 | GO:0042940 | D-amino acid transport(GO:0042940) |
0.1 | 0.2 | GO:2001225 | regulation of chloride transport(GO:2001225) |
0.1 | 0.2 | GO:0010961 | cellular magnesium ion homeostasis(GO:0010961) |
0.1 | 0.1 | GO:0046098 | guanine metabolic process(GO:0046098) |
0.1 | 0.2 | GO:0070816 | phosphorylation of RNA polymerase II C-terminal domain(GO:0070816) |
0.1 | 0.2 | GO:0046607 | positive regulation of centrosome cycle(GO:0046607) |
0.1 | 0.2 | GO:0072385 | minus-end-directed organelle transport along microtubule(GO:0072385) |
0.1 | 0.5 | GO:0032782 | bile acid secretion(GO:0032782) |
0.1 | 0.2 | GO:0042276 | error-prone translesion synthesis(GO:0042276) |
0.1 | 0.6 | GO:0051447 | negative regulation of meiotic cell cycle(GO:0051447) |
0.1 | 0.1 | GO:1904742 | regulation of telomeric DNA binding(GO:1904742) |
0.1 | 0.6 | GO:0002281 | macrophage activation involved in immune response(GO:0002281) |
0.1 | 0.3 | GO:0034773 | histone H4-K20 trimethylation(GO:0034773) |
0.1 | 0.3 | GO:0051013 | microtubule severing(GO:0051013) |
0.1 | 0.7 | GO:0070200 | establishment of protein localization to telomere(GO:0070200) |
0.1 | 0.2 | GO:0090290 | positive regulation of osteoclast proliferation(GO:0090290) |
0.1 | 0.2 | GO:0060399 | positive regulation of growth hormone receptor signaling pathway(GO:0060399) |
0.1 | 2.9 | GO:0000070 | mitotic sister chromatid segregation(GO:0000070) |
0.1 | 0.4 | GO:0035435 | phosphate ion transmembrane transport(GO:0035435) |
0.1 | 0.2 | GO:0000712 | resolution of meiotic recombination intermediates(GO:0000712) |
0.1 | 0.2 | GO:0070253 | somatostatin secretion(GO:0070253) regulation of somatostatin secretion(GO:0090273) |
0.1 | 0.2 | GO:0006553 | lysine metabolic process(GO:0006553) |
0.1 | 0.3 | GO:0098908 | regulation of neuronal action potential(GO:0098908) |
0.1 | 0.2 | GO:0007619 | courtship behavior(GO:0007619) female courtship behavior(GO:0008050) |
0.1 | 0.1 | GO:0015755 | fructose transport(GO:0015755) |
0.1 | 0.1 | GO:2000671 | regulation of motor neuron apoptotic process(GO:2000671) |
0.1 | 0.2 | GO:0033387 | putrescine biosynthetic process from ornithine(GO:0033387) |
0.1 | 0.1 | GO:0032096 | negative regulation of response to food(GO:0032096) |
0.1 | 1.3 | GO:0006406 | mRNA export from nucleus(GO:0006406) mRNA-containing ribonucleoprotein complex export from nucleus(GO:0071427) |
0.1 | 0.1 | GO:0055099 | response to high density lipoprotein particle(GO:0055099) |
0.1 | 0.1 | GO:0046321 | positive regulation of fatty acid oxidation(GO:0046321) |
0.1 | 0.2 | GO:2000465 | regulation of glycogen (starch) synthase activity(GO:2000465) |
0.1 | 0.4 | GO:0043923 | positive regulation by host of viral transcription(GO:0043923) |
0.1 | 0.2 | GO:0070889 | platelet alpha granule organization(GO:0070889) |
0.1 | 0.1 | GO:0061032 | visceral serous pericardium development(GO:0061032) |
0.1 | 0.2 | GO:1902626 | assembly of large subunit precursor of preribosome(GO:1902626) |
0.1 | 1.4 | GO:0006376 | mRNA splice site selection(GO:0006376) |
0.1 | 0.1 | GO:0006591 | ornithine metabolic process(GO:0006591) |
0.1 | 0.9 | GO:0006379 | mRNA cleavage(GO:0006379) |
0.1 | 0.4 | GO:0046831 | regulation of nucleobase-containing compound transport(GO:0032239) regulation of RNA export from nucleus(GO:0046831) |
0.1 | 0.1 | GO:0035092 | sperm chromatin condensation(GO:0035092) |
0.1 | 0.2 | GO:0021957 | corticospinal tract morphogenesis(GO:0021957) |
0.1 | 0.1 | GO:0035822 | meiotic gene conversion(GO:0006311) gene conversion(GO:0035822) |
0.1 | 0.4 | GO:0043101 | purine-containing compound salvage(GO:0043101) |
0.1 | 0.2 | GO:0045226 | extracellular polysaccharide biosynthetic process(GO:0045226) extracellular polysaccharide metabolic process(GO:0046379) |
0.1 | 1.5 | GO:0033120 | positive regulation of RNA splicing(GO:0033120) |
0.1 | 0.1 | GO:0006933 | negative regulation of cell adhesion involved in substrate-bound cell migration(GO:0006933) |
0.1 | 0.1 | GO:0050966 | detection of mechanical stimulus involved in sensory perception of pain(GO:0050966) |
0.1 | 0.1 | GO:0050915 | sensory perception of sour taste(GO:0050915) |
0.1 | 0.1 | GO:0010579 | regulation of adenylate cyclase activity involved in G-protein coupled receptor signaling pathway(GO:0010578) positive regulation of adenylate cyclase activity involved in G-protein coupled receptor signaling pathway(GO:0010579) |
0.1 | 0.1 | GO:0061072 | iris morphogenesis(GO:0061072) |
0.1 | 0.3 | GO:0033227 | dsRNA transport(GO:0033227) |
0.1 | 0.1 | GO:0032066 | nucleolus to nucleoplasm transport(GO:0032066) |
0.1 | 0.6 | GO:0034508 | centromere complex assembly(GO:0034508) |
0.1 | 0.1 | GO:1904706 | negative regulation of vascular smooth muscle cell proliferation(GO:1904706) |
0.1 | 0.3 | GO:0043486 | histone exchange(GO:0043486) |
0.1 | 2.6 | GO:0010501 | RNA secondary structure unwinding(GO:0010501) |
0.1 | 0.5 | GO:0032926 | negative regulation of activin receptor signaling pathway(GO:0032926) |
0.1 | 0.1 | GO:0007403 | glial cell fate determination(GO:0007403) |
0.1 | 0.1 | GO:0030046 | parallel actin filament bundle assembly(GO:0030046) |
0.1 | 0.1 | GO:1904016 | response to Thyroglobulin triiodothyronine(GO:1904016) cellular response to Thyroglobulin triiodothyronine(GO:1904017) |
0.1 | 0.2 | GO:0060060 | post-embryonic retina morphogenesis in camera-type eye(GO:0060060) |
0.1 | 0.1 | GO:0014042 | positive regulation of neuron maturation(GO:0014042) positive regulation of cell maturation(GO:1903431) |
0.1 | 1.8 | GO:0006891 | intra-Golgi vesicle-mediated transport(GO:0006891) |
0.1 | 0.1 | GO:0070389 | chaperone cofactor-dependent protein refolding(GO:0070389) |
0.1 | 0.1 | GO:2001275 | positive regulation of glucose import in response to insulin stimulus(GO:2001275) |
0.1 | 0.3 | GO:0034243 | regulation of transcription elongation from RNA polymerase II promoter(GO:0034243) |
0.1 | 0.2 | GO:0010760 | negative regulation of macrophage chemotaxis(GO:0010760) |
0.1 | 0.3 | GO:0060056 | mammary gland involution(GO:0060056) |
0.1 | 0.5 | GO:0010801 | negative regulation of peptidyl-threonine phosphorylation(GO:0010801) |
0.1 | 0.7 | GO:0006896 | Golgi to vacuole transport(GO:0006896) |
0.1 | 0.2 | GO:1900112 | regulation of histone H3-K9 trimethylation(GO:1900112) negative regulation of histone H3-K9 trimethylation(GO:1900113) |
0.1 | 0.2 | GO:0016237 | lysosomal microautophagy(GO:0016237) piecemeal microautophagy of nucleus(GO:0034727) late nucleophagy(GO:0044805) |
0.1 | 0.1 | GO:0021978 | telencephalon regionalization(GO:0021978) |
0.1 | 0.3 | GO:0071321 | cellular response to cGMP(GO:0071321) |
0.1 | 0.1 | GO:0006269 | DNA replication, synthesis of RNA primer(GO:0006269) |
0.1 | 0.5 | GO:0070166 | enamel mineralization(GO:0070166) |
0.1 | 0.1 | GO:1902809 | regulation of skeletal muscle fiber differentiation(GO:1902809) |
0.1 | 0.1 | GO:0090283 | regulation of protein glycosylation in Golgi(GO:0090283) |
0.1 | 0.7 | GO:0043574 | protein targeting to peroxisome(GO:0006625) peroxisomal transport(GO:0043574) protein localization to peroxisome(GO:0072662) establishment of protein localization to peroxisome(GO:0072663) |
0.1 | 0.2 | GO:0006776 | vitamin A metabolic process(GO:0006776) |
0.1 | 0.8 | GO:0030322 | stabilization of membrane potential(GO:0030322) |
0.1 | 0.2 | GO:0045925 | positive regulation of female receptivity(GO:0045925) |
0.1 | 0.1 | GO:0071918 | urea transmembrane transport(GO:0071918) |
0.1 | 0.1 | GO:0006824 | cobalt ion transport(GO:0006824) |
0.1 | 0.2 | GO:0043482 | cellular pigment accumulation(GO:0043482) |
0.1 | 0.3 | GO:0051481 | negative regulation of cytosolic calcium ion concentration(GO:0051481) |
0.1 | 0.1 | GO:0039689 | negative stranded viral RNA replication(GO:0039689) multi-organism biosynthetic process(GO:0044034) |
0.1 | 0.1 | GO:0043173 | nucleotide salvage(GO:0043173) |
0.1 | 0.2 | GO:0046855 | inositol phosphate dephosphorylation(GO:0046855) |
0.1 | 0.2 | GO:0060179 | male mating behavior(GO:0060179) |
0.1 | 0.2 | GO:2000042 | negative regulation of double-strand break repair via homologous recombination(GO:2000042) |
0.1 | 0.2 | GO:0090435 | protein localization to nuclear envelope(GO:0090435) |
0.1 | 0.3 | GO:0090286 | cytoskeletal anchoring at nuclear membrane(GO:0090286) |
0.1 | 0.2 | GO:0060618 | nipple development(GO:0060618) |
0.1 | 0.1 | GO:2000391 | regulation of neutrophil extravasation(GO:2000389) positive regulation of neutrophil extravasation(GO:2000391) |
0.1 | 0.1 | GO:1904431 | positive regulation of t-circle formation(GO:1904431) |
0.1 | 0.3 | GO:0034720 | histone H3-K4 demethylation(GO:0034720) |
0.1 | 1.1 | GO:0060259 | regulation of feeding behavior(GO:0060259) |
0.1 | 0.3 | GO:0031998 | regulation of fatty acid beta-oxidation(GO:0031998) |
0.1 | 0.3 | GO:2000192 | negative regulation of fatty acid transport(GO:2000192) |
0.1 | 0.1 | GO:0051204 | protein insertion into mitochondrial membrane(GO:0051204) |
0.1 | 1.3 | GO:0007098 | centrosome cycle(GO:0007098) |
0.1 | 1.9 | GO:0006635 | fatty acid beta-oxidation(GO:0006635) |
0.1 | 0.1 | GO:0003051 | angiotensin-mediated drinking behavior(GO:0003051) |
0.1 | 0.1 | GO:1902455 | negative regulation of stem cell population maintenance(GO:1902455) |
0.1 | 0.1 | GO:0035907 | dorsal aorta development(GO:0035907) dorsal aorta morphogenesis(GO:0035912) |
0.1 | 0.3 | GO:0017196 | N-terminal peptidyl-methionine acetylation(GO:0017196) |
0.1 | 0.2 | GO:0007023 | post-chaperonin tubulin folding pathway(GO:0007023) |
0.1 | 0.2 | GO:1904293 | negative regulation of ERAD pathway(GO:1904293) |
0.1 | 0.2 | GO:0006562 | proline catabolic process(GO:0006562) |
0.1 | 0.7 | GO:0022011 | myelination in peripheral nervous system(GO:0022011) peripheral nervous system axon ensheathment(GO:0032292) |
0.1 | 0.8 | GO:0007130 | synaptonemal complex assembly(GO:0007130) |
0.1 | 0.6 | GO:0007190 | activation of adenylate cyclase activity(GO:0007190) |
0.1 | 0.6 | GO:0031163 | iron-sulfur cluster assembly(GO:0016226) metallo-sulfur cluster assembly(GO:0031163) |
0.1 | 0.2 | GO:0072378 | blood coagulation, fibrin clot formation(GO:0072378) |
0.1 | 0.1 | GO:0018206 | peptidyl-methionine modification(GO:0018206) |
0.1 | 0.4 | GO:0042921 | glucocorticoid receptor signaling pathway(GO:0042921) |
0.1 | 0.9 | GO:0000002 | mitochondrial genome maintenance(GO:0000002) |
0.1 | 0.7 | GO:0044458 | motile cilium assembly(GO:0044458) |
0.1 | 0.5 | GO:0097094 | craniofacial suture morphogenesis(GO:0097094) |
0.1 | 0.1 | GO:0042738 | exogenous drug catabolic process(GO:0042738) |
0.1 | 0.6 | GO:0006284 | base-excision repair(GO:0006284) |
0.1 | 0.6 | GO:0009954 | proximal/distal pattern formation(GO:0009954) |
0.1 | 0.2 | GO:0060012 | synaptic transmission, glycinergic(GO:0060012) |
0.1 | 0.1 | GO:0046016 | positive regulation of transcription by glucose(GO:0046016) |
0.1 | 0.1 | GO:0042138 | meiotic DNA double-strand break formation(GO:0042138) |
0.1 | 0.2 | GO:0006564 | L-serine biosynthetic process(GO:0006564) |
0.1 | 0.1 | GO:0008594 | photoreceptor cell morphogenesis(GO:0008594) |
0.1 | 0.3 | GO:0071907 | determination of digestive tract left/right asymmetry(GO:0071907) |
0.1 | 0.1 | GO:0048239 | negative regulation of DNA recombination at telomere(GO:0048239) regulation of DNA recombination at telomere(GO:0072695) |
0.1 | 0.2 | GO:0006686 | sphingomyelin biosynthetic process(GO:0006686) |
0.1 | 0.2 | GO:0033564 | anterior/posterior axon guidance(GO:0033564) |
0.1 | 0.2 | GO:0015812 | gamma-aminobutyric acid transport(GO:0015812) |
0.1 | 1.0 | GO:0006308 | DNA catabolic process(GO:0006308) |
0.1 | 0.5 | GO:0006103 | 2-oxoglutarate metabolic process(GO:0006103) |
0.1 | 0.3 | GO:2000348 | regulation of CD40 signaling pathway(GO:2000348) |
0.1 | 0.1 | GO:0051026 | chiasma assembly(GO:0051026) |
0.1 | 0.1 | GO:0036289 | peptidyl-serine autophosphorylation(GO:0036289) |
0.1 | 0.1 | GO:1900825 | regulation of membrane depolarization during cardiac muscle cell action potential(GO:1900825) |
0.1 | 0.2 | GO:0000154 | rRNA modification(GO:0000154) |
0.1 | 0.1 | GO:2001180 | negative regulation of interleukin-10 secretion(GO:2001180) |
0.1 | 0.1 | GO:0006525 | arginine metabolic process(GO:0006525) |
0.1 | 0.1 | GO:0001692 | histamine metabolic process(GO:0001692) |
0.0 | 0.3 | GO:0007343 | egg activation(GO:0007343) |
0.0 | 0.1 | GO:1905065 | regulation of vascular smooth muscle cell differentiation(GO:1905063) positive regulation of vascular smooth muscle cell differentiation(GO:1905065) |
0.0 | 0.4 | GO:0042572 | retinol metabolic process(GO:0042572) |
0.0 | 0.1 | GO:0071873 | response to norepinephrine(GO:0071873) |
0.0 | 0.0 | GO:1901142 | insulin metabolic process(GO:1901142) |
0.0 | 0.1 | GO:0001927 | exocyst assembly(GO:0001927) |
0.0 | 0.3 | GO:0061029 | eyelid development in camera-type eye(GO:0061029) |
0.0 | 0.4 | GO:0006241 | CTP biosynthetic process(GO:0006241) CTP metabolic process(GO:0046036) |
0.0 | 0.5 | GO:0050962 | detection of light stimulus involved in visual perception(GO:0050908) detection of light stimulus involved in sensory perception(GO:0050962) |
0.0 | 0.0 | GO:0001887 | selenium compound metabolic process(GO:0001887) |
0.0 | 0.1 | GO:2000074 | regulation of type B pancreatic cell development(GO:2000074) |
0.0 | 0.2 | GO:0018101 | protein citrullination(GO:0018101) |
0.0 | 0.4 | GO:0006390 | transcription from mitochondrial promoter(GO:0006390) |
0.0 | 0.3 | GO:0071569 | protein ufmylation(GO:0071569) |
0.0 | 0.2 | GO:0043456 | regulation of pentose-phosphate shunt(GO:0043456) |
0.0 | 0.0 | GO:0010042 | response to manganese ion(GO:0010042) |
0.0 | 0.2 | GO:0090502 | RNA phosphodiester bond hydrolysis, endonucleolytic(GO:0090502) |
0.0 | 0.2 | GO:1902093 | positive regulation of sperm motility(GO:1902093) |
0.0 | 0.1 | GO:0030382 | sperm mitochondrion organization(GO:0030382) |
0.0 | 0.3 | GO:0090344 | negative regulation of cell aging(GO:0090344) |
0.0 | 0.1 | GO:0072603 | interleukin-5 secretion(GO:0072603) interleukin-13 secretion(GO:0072611) regulation of interleukin-5 secretion(GO:2000662) regulation of interleukin-13 secretion(GO:2000665) |
0.0 | 0.1 | GO:0044829 | positive regulation by host of viral genome replication(GO:0044829) |
0.0 | 0.0 | GO:0021938 | smoothened signaling pathway involved in regulation of cerebellar granule cell precursor cell proliferation(GO:0021938) |
0.0 | 0.5 | GO:0010839 | negative regulation of keratinocyte proliferation(GO:0010839) |
0.0 | 0.1 | GO:0032430 | positive regulation of phospholipase A2 activity(GO:0032430) |
0.0 | 0.3 | GO:0006744 | ubiquinone biosynthetic process(GO:0006744) |
0.0 | 0.2 | GO:1902035 | positive regulation of hematopoietic stem cell proliferation(GO:1902035) |
0.0 | 0.1 | GO:0051177 | meiotic sister chromatid segregation(GO:0045144) meiotic sister chromatid cohesion(GO:0051177) |
0.0 | 0.2 | GO:0070863 | positive regulation of protein exit from endoplasmic reticulum(GO:0070863) |
0.0 | 0.5 | GO:0070935 | 3'-UTR-mediated mRNA stabilization(GO:0070935) |
0.0 | 0.1 | GO:0051549 | regulation of keratinocyte migration(GO:0051547) positive regulation of keratinocyte migration(GO:0051549) |
0.0 | 0.0 | GO:0014016 | neuroblast differentiation(GO:0014016) |
0.0 | 0.1 | GO:0008334 | histone mRNA metabolic process(GO:0008334) histone mRNA catabolic process(GO:0071044) |
0.0 | 0.2 | GO:0048169 | regulation of long-term neuronal synaptic plasticity(GO:0048169) |
0.0 | 0.0 | GO:0018916 | nitrobenzene metabolic process(GO:0018916) |
0.0 | 0.1 | GO:0090135 | actin filament branching(GO:0090135) |
0.0 | 0.1 | GO:0040016 | embryonic cleavage(GO:0040016) |
0.0 | 0.1 | GO:0042026 | protein refolding(GO:0042026) |
0.0 | 0.1 | GO:0060005 | vestibular reflex(GO:0060005) |
0.0 | 0.4 | GO:0006828 | manganese ion transport(GO:0006828) |
0.0 | 0.1 | GO:1903336 | negative regulation of vacuolar transport(GO:1903336) |
0.0 | 0.2 | GO:0030388 | fructose 1,6-bisphosphate metabolic process(GO:0030388) |
0.0 | 0.1 | GO:0051304 | chromosome separation(GO:0051304) |
0.0 | 0.3 | GO:0006622 | protein targeting to lysosome(GO:0006622) |
0.0 | 0.1 | GO:0010986 | positive regulation of lipoprotein particle clearance(GO:0010986) |
0.0 | 0.1 | GO:0006152 | purine nucleoside catabolic process(GO:0006152) purine ribonucleoside catabolic process(GO:0046130) |
0.0 | 0.0 | GO:0019388 | galactose catabolic process(GO:0019388) |
0.0 | 0.0 | GO:0001812 | positive regulation of type I hypersensitivity(GO:0001812) |
0.0 | 0.7 | GO:0045746 | negative regulation of Notch signaling pathway(GO:0045746) |
0.0 | 0.1 | GO:0034975 | protein folding in endoplasmic reticulum(GO:0034975) |
0.0 | 0.2 | GO:1901985 | positive regulation of protein acetylation(GO:1901985) |
0.0 | 0.1 | GO:0000291 | nuclear-transcribed mRNA catabolic process, exonucleolytic(GO:0000291) |
0.0 | 0.1 | GO:0071863 | regulation of cell proliferation in bone marrow(GO:0071863) |
0.0 | 0.2 | GO:0047484 | regulation of response to osmotic stress(GO:0047484) |
0.0 | 0.3 | GO:0051290 | protein heterotetramerization(GO:0051290) |
0.0 | 0.1 | GO:0010446 | response to alkaline pH(GO:0010446) |
0.0 | 0.3 | GO:0070269 | pyroptosis(GO:0070269) |
0.0 | 0.1 | GO:1900157 | regulation of bone mineralization involved in bone maturation(GO:1900157) |
0.0 | 0.1 | GO:0060061 | Spemann organizer formation(GO:0060061) |
0.0 | 0.2 | GO:1900165 | negative regulation of interleukin-6 secretion(GO:1900165) |
0.0 | 0.0 | GO:0051984 | positive regulation of chromosome segregation(GO:0051984) |
0.0 | 0.0 | GO:0021781 | glial cell fate commitment(GO:0021781) |
0.0 | 0.0 | GO:0009436 | glyoxylate catabolic process(GO:0009436) |
0.0 | 1.3 | GO:0000725 | double-strand break repair via homologous recombination(GO:0000724) recombinational repair(GO:0000725) |
0.0 | 1.6 | GO:0043966 | histone H3 acetylation(GO:0043966) |
0.0 | 0.1 | GO:0046881 | positive regulation of follicle-stimulating hormone secretion(GO:0046881) |
0.0 | 0.2 | GO:0035627 | ceramide transport(GO:0035627) |
0.0 | 1.4 | GO:0031338 | regulation of vesicle fusion(GO:0031338) |
0.0 | 0.5 | GO:0046856 | phosphatidylinositol dephosphorylation(GO:0046856) |
0.0 | 0.4 | GO:0060122 | inner ear receptor stereocilium organization(GO:0060122) |
0.0 | 0.1 | GO:0035426 | extracellular matrix-cell signaling(GO:0035426) |
0.0 | 0.0 | GO:0019374 | galactolipid metabolic process(GO:0019374) |
0.0 | 0.1 | GO:0010745 | negative regulation of macrophage derived foam cell differentiation(GO:0010745) |
0.0 | 1.2 | GO:0006821 | chloride transport(GO:0006821) |
0.0 | 0.4 | GO:0010842 | retina layer formation(GO:0010842) |
0.0 | 0.1 | GO:0034239 | regulation of macrophage fusion(GO:0034239) |
0.0 | 0.1 | GO:0002035 | brain renin-angiotensin system(GO:0002035) |
0.0 | 0.2 | GO:0002862 | negative regulation of inflammatory response to antigenic stimulus(GO:0002862) |
0.0 | 0.2 | GO:0001866 | NK T cell proliferation(GO:0001866) |
0.0 | 0.1 | GO:0031448 | regulation of fast-twitch skeletal muscle fiber contraction(GO:0031446) positive regulation of fast-twitch skeletal muscle fiber contraction(GO:0031448) |
0.0 | 0.3 | GO:0015986 | energy coupled proton transport, down electrochemical gradient(GO:0015985) ATP synthesis coupled proton transport(GO:0015986) |
0.0 | 0.0 | GO:0046015 | regulation of transcription by glucose(GO:0046015) |
0.0 | 0.1 | GO:0000012 | single strand break repair(GO:0000012) |
0.0 | 0.0 | GO:0032959 | inositol trisphosphate biosynthetic process(GO:0032959) |
0.0 | 0.0 | GO:0042737 | drug catabolic process(GO:0042737) |
0.0 | 0.2 | GO:0001556 | oocyte maturation(GO:0001556) |
0.0 | 0.2 | GO:0045945 | positive regulation of transcription from RNA polymerase III promoter(GO:0045945) |
0.0 | 0.2 | GO:0030497 | fatty acid elongation(GO:0030497) |
0.0 | 0.3 | GO:0043248 | proteasome assembly(GO:0043248) |
0.0 | 0.1 | GO:0070914 | UV-damage excision repair(GO:0070914) |
0.0 | 0.1 | GO:0045713 | low-density lipoprotein particle receptor biosynthetic process(GO:0045713) |
0.0 | 0.1 | GO:0043320 | natural killer cell degranulation(GO:0043320) |
0.0 | 0.1 | GO:0042891 | antibiotic transport(GO:0042891) |
0.0 | 0.2 | GO:0035871 | protein K11-linked deubiquitination(GO:0035871) |
0.0 | 0.0 | GO:2000172 | regulation of branching morphogenesis of a nerve(GO:2000172) |
0.0 | 0.1 | GO:0010727 | negative regulation of hydrogen peroxide metabolic process(GO:0010727) |
0.0 | 0.5 | GO:0030431 | sleep(GO:0030431) |
0.0 | 0.0 | GO:0019054 | modulation by virus of host process(GO:0019054) |
0.0 | 0.2 | GO:0009226 | nucleotide-sugar biosynthetic process(GO:0009226) |
0.0 | 0.0 | GO:0033210 | leptin-mediated signaling pathway(GO:0033210) |
0.0 | 0.0 | GO:0006059 | hexitol metabolic process(GO:0006059) |
0.0 | 0.2 | GO:0007141 | male meiosis I(GO:0007141) |
0.0 | 0.0 | GO:0032026 | response to magnesium ion(GO:0032026) |
0.0 | 0.1 | GO:0014835 | myoblast differentiation involved in skeletal muscle regeneration(GO:0014835) |
0.0 | 0.3 | GO:0043631 | mRNA polyadenylation(GO:0006378) RNA polyadenylation(GO:0043631) |
0.0 | 0.1 | GO:0009249 | protein lipoylation(GO:0009249) |
0.0 | 0.1 | GO:0071651 | positive regulation of chemokine (C-C motif) ligand 5 production(GO:0071651) |
0.0 | 0.0 | GO:0031049 | programmed DNA elimination(GO:0031049) chromosome breakage(GO:0031052) |
0.0 | 0.3 | GO:0015693 | magnesium ion transport(GO:0015693) |
0.0 | 0.1 | GO:2001270 | regulation of cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:2001270) |
0.0 | 0.0 | GO:0009071 | serine family amino acid catabolic process(GO:0009071) |
0.0 | 0.1 | GO:1901642 | purine nucleoside transmembrane transport(GO:0015860) purine-containing compound transmembrane transport(GO:0072530) nucleoside transmembrane transport(GO:1901642) |
0.0 | 0.1 | GO:2001053 | regulation of mesenchymal cell apoptotic process(GO:2001053) |
0.0 | 0.1 | GO:0033603 | positive regulation of dopamine secretion(GO:0033603) |
0.0 | 0.1 | GO:0045141 | meiotic telomere tethering at nuclear periphery(GO:0044821) meiotic telomere clustering(GO:0045141) meiotic attachment of telomere to nuclear envelope(GO:0070197) chromosome localization to nuclear envelope involved in homologous chromosome segregation(GO:0090220) chromosome attachment to the nuclear envelope(GO:0097240) |
0.0 | 0.1 | GO:0071557 | histone H3-K27 demethylation(GO:0071557) |
0.0 | 0.1 | GO:0061684 | chaperone-mediated autophagy(GO:0061684) |
0.0 | 0.2 | GO:0006054 | N-acetylneuraminate metabolic process(GO:0006054) |
0.0 | 0.1 | GO:0010360 | negative regulation of anion channel activity(GO:0010360) |
0.0 | 0.1 | GO:1902071 | regulation of hypoxia-inducible factor-1alpha signaling pathway(GO:1902071) |
0.0 | 0.1 | GO:0006578 | amino-acid betaine biosynthetic process(GO:0006578) |
0.0 | 0.1 | GO:0002331 | pre-B cell allelic exclusion(GO:0002331) |
0.0 | 0.1 | GO:0009786 | regulation of asymmetric cell division(GO:0009786) |
0.0 | 0.0 | GO:2000347 | positive regulation of hepatocyte proliferation(GO:2000347) |
0.0 | 0.1 | GO:0006499 | N-terminal protein myristoylation(GO:0006499) |
0.0 | 0.1 | GO:0016242 | negative regulation of macroautophagy(GO:0016242) |
0.0 | 0.4 | GO:0043567 | regulation of insulin-like growth factor receptor signaling pathway(GO:0043567) |
0.0 | 0.1 | GO:0000160 | phosphorelay signal transduction system(GO:0000160) |
0.0 | 0.1 | GO:0018002 | N-terminal peptidyl-serine acetylation(GO:0017198) N-terminal peptidyl-glutamic acid acetylation(GO:0018002) peptidyl-serine acetylation(GO:0030920) |
0.0 | 0.4 | GO:0016180 | snRNA processing(GO:0016180) |
0.0 | 0.0 | GO:0032377 | regulation of intracellular lipid transport(GO:0032377) regulation of intracellular sterol transport(GO:0032380) regulation of intracellular cholesterol transport(GO:0032383) |
0.0 | 0.2 | GO:2000400 | positive regulation of T cell differentiation in thymus(GO:0033089) positive regulation of thymocyte aggregation(GO:2000400) |
0.0 | 0.2 | GO:0006541 | glutamine metabolic process(GO:0006541) |
0.0 | 0.0 | GO:0035795 | negative regulation of mitochondrial membrane permeability(GO:0035795) |
0.0 | 0.0 | GO:0014873 | response to muscle activity involved in regulation of muscle adaptation(GO:0014873) |
0.0 | 0.0 | GO:0019230 | proprioception(GO:0019230) |
0.0 | 0.1 | GO:0038093 | Fc receptor signaling pathway(GO:0038093) |
0.0 | 0.0 | GO:1990001 | inhibition of cysteine-type endopeptidase activity(GO:0097340) zymogen inhibition(GO:0097341) inhibition of cysteine-type endopeptidase activity involved in apoptotic process(GO:1990001) |
0.0 | 0.2 | GO:0015721 | bile acid and bile salt transport(GO:0015721) |
0.0 | 0.1 | GO:0035493 | SNARE complex assembly(GO:0035493) |
0.0 | 0.3 | GO:0006730 | one-carbon metabolic process(GO:0006730) |
0.0 | 0.1 | GO:0046078 | dUMP metabolic process(GO:0046078) |
0.0 | 0.3 | GO:0034219 | carbohydrate transmembrane transport(GO:0034219) |
0.0 | 0.0 | GO:0000722 | telomere maintenance via recombination(GO:0000722) |
0.0 | 0.2 | GO:0072348 | sulfur compound transport(GO:0072348) |
0.0 | 0.0 | GO:0006975 | DNA damage induced protein phosphorylation(GO:0006975) |
0.0 | 0.1 | GO:0042574 | retinal metabolic process(GO:0042574) |
0.0 | 0.1 | GO:0017121 | phospholipid scrambling(GO:0017121) |
0.0 | 0.2 | GO:0035563 | positive regulation of chromatin binding(GO:0035563) |
0.0 | 0.0 | GO:0042517 | positive regulation of tyrosine phosphorylation of Stat3 protein(GO:0042517) |
0.0 | 0.1 | GO:0034067 | protein localization to Golgi apparatus(GO:0034067) |
0.0 | 0.1 | GO:0060586 | multicellular organismal iron ion homeostasis(GO:0060586) |
0.0 | 0.1 | GO:0070537 | histone H2A K63-linked deubiquitination(GO:0070537) |
0.0 | 0.1 | GO:0006556 | S-adenosylmethionine biosynthetic process(GO:0006556) |
0.0 | 0.2 | GO:0040019 | positive regulation of embryonic development(GO:0040019) |
0.0 | 0.1 | GO:0009235 | cobalamin metabolic process(GO:0009235) |
0.0 | 0.0 | GO:0060266 | negative regulation of respiratory burst involved in inflammatory response(GO:0060266) |
0.0 | 0.0 | GO:0071672 | negative regulation of smooth muscle cell chemotaxis(GO:0071672) |
0.0 | 0.3 | GO:0046839 | phospholipid dephosphorylation(GO:0046839) |
0.0 | 0.2 | GO:0006957 | complement activation, alternative pathway(GO:0006957) |
0.0 | 0.0 | GO:0051095 | regulation of helicase activity(GO:0051095) positive regulation of helicase activity(GO:0051096) |
0.0 | 0.0 | GO:0071286 | cellular response to magnesium ion(GO:0071286) |
0.0 | 0.0 | GO:1900186 | negative regulation of clathrin-mediated endocytosis(GO:1900186) |
0.0 | 0.0 | GO:0031848 | protection from non-homologous end joining at telomere(GO:0031848) telomere maintenance in response to DNA damage(GO:0043247) |
0.0 | 0.4 | GO:0000245 | spliceosomal complex assembly(GO:0000245) |
0.0 | 0.2 | GO:0019800 | peptide cross-linking via chondroitin 4-sulfate glycosaminoglycan(GO:0019800) |
0.0 | 0.1 | GO:0007000 | nucleolus organization(GO:0007000) |
0.0 | 0.6 | GO:0015991 | energy coupled proton transmembrane transport, against electrochemical gradient(GO:0015988) ATP hydrolysis coupled proton transport(GO:0015991) ATP hydrolysis coupled transmembrane transport(GO:0090662) |
0.0 | 0.0 | GO:2000224 | regulation of testosterone biosynthetic process(GO:2000224) |
0.0 | 0.3 | GO:0006144 | purine nucleobase metabolic process(GO:0006144) |
0.0 | 0.0 | GO:0034146 | toll-like receptor 5 signaling pathway(GO:0034146) |
0.0 | 0.0 | GO:0045079 | negative regulation of chemokine biosynthetic process(GO:0045079) |
0.0 | 0.4 | GO:0046854 | phosphatidylinositol phosphorylation(GO:0046854) |
0.0 | 0.5 | GO:0006099 | tricarboxylic acid cycle(GO:0006099) |
0.0 | 0.0 | GO:1902031 | regulation of NADP metabolic process(GO:1902031) |
0.0 | 0.1 | GO:0009414 | response to water deprivation(GO:0009414) |
0.0 | 0.2 | GO:0045954 | positive regulation of natural killer cell mediated immunity(GO:0002717) positive regulation of natural killer cell mediated cytotoxicity(GO:0045954) |
0.0 | 0.1 | GO:0071732 | cellular response to nitric oxide(GO:0071732) |
0.0 | 0.0 | GO:0000963 | mitochondrial RNA processing(GO:0000963) |
0.0 | 0.1 | GO:0032506 | cytokinetic process(GO:0032506) |
0.0 | 0.2 | GO:0006670 | sphingosine metabolic process(GO:0006670) |
0.0 | 0.3 | GO:0060712 | spongiotrophoblast layer development(GO:0060712) |
0.0 | 0.1 | GO:0015747 | urate transport(GO:0015747) |
0.0 | 0.1 | GO:0032098 | regulation of appetite(GO:0032098) |
0.0 | 0.4 | GO:2001014 | regulation of skeletal muscle cell differentiation(GO:2001014) |
0.0 | 0.0 | GO:0090238 | regulation of arachidonic acid secretion(GO:0090237) positive regulation of arachidonic acid secretion(GO:0090238) |
0.0 | 0.1 | GO:0015816 | glycine transport(GO:0015816) |
0.0 | 0.0 | GO:0044341 | sodium-dependent phosphate transport(GO:0044341) |
0.0 | 0.0 | GO:0060988 | lipid tube assembly(GO:0060988) |
0.0 | 0.4 | GO:0032465 | regulation of cytokinesis(GO:0032465) |
0.0 | 0.0 | GO:0036124 | histone H3-K9 trimethylation(GO:0036124) |
0.0 | 0.2 | GO:0006656 | phosphatidylcholine biosynthetic process(GO:0006656) |
0.0 | 0.0 | GO:0035928 | RNA import into mitochondrion(GO:0035927) rRNA import into mitochondrion(GO:0035928) |
0.0 | 0.1 | GO:0007131 | reciprocal meiotic recombination(GO:0007131) reciprocal DNA recombination(GO:0035825) |
0.0 | 0.1 | GO:0008616 | queuosine biosynthetic process(GO:0008616) queuosine metabolic process(GO:0046116) |
0.0 | 0.0 | GO:0035404 | histone-serine phosphorylation(GO:0035404) |
0.0 | 0.0 | GO:0010310 | regulation of hydrogen peroxide metabolic process(GO:0010310) |
0.0 | 0.0 | GO:0052205 | modulation of molecular function in other organism(GO:0044359) negative regulation of molecular function in other organism(GO:0044362) negative regulation of molecular function in other organism involved in symbiotic interaction(GO:0052204) modulation of molecular function in other organism involved in symbiotic interaction(GO:0052205) negative regulation by host of symbiont molecular function(GO:0052405) modification by host of symbiont molecular function(GO:0052428) |
0.0 | 0.1 | GO:0090026 | positive regulation of monocyte chemotaxis(GO:0090026) |
0.0 | 0.1 | GO:0009191 | ribonucleoside diphosphate catabolic process(GO:0009191) |
0.0 | 0.5 | GO:0000045 | autophagosome assembly(GO:0000045) |
0.0 | 0.1 | GO:0008295 | spermidine biosynthetic process(GO:0008295) |
0.0 | 0.1 | GO:0006729 | tetrahydrobiopterin biosynthetic process(GO:0006729) |
0.0 | 0.0 | GO:0021747 | cochlear nucleus development(GO:0021747) |
0.0 | 0.0 | GO:0034393 | positive regulation of smooth muscle cell apoptotic process(GO:0034393) |
0.0 | 0.0 | GO:0051956 | negative regulation of amino acid transport(GO:0051956) |
0.0 | 0.0 | GO:0009838 | abscission(GO:0009838) |
0.0 | 0.2 | GO:0032986 | nucleosome disassembly(GO:0006337) chromatin disassembly(GO:0031498) protein-DNA complex disassembly(GO:0032986) |
0.0 | 0.1 | GO:2000369 | regulation of clathrin-mediated endocytosis(GO:2000369) |
0.0 | 0.0 | GO:2000479 | regulation of cAMP-dependent protein kinase activity(GO:2000479) |
0.0 | 0.1 | GO:0006307 | DNA dealkylation involved in DNA repair(GO:0006307) |
0.0 | 0.1 | GO:0050860 | negative regulation of T cell receptor signaling pathway(GO:0050860) |
0.0 | 0.2 | GO:0016239 | positive regulation of macroautophagy(GO:0016239) |
0.0 | 0.1 | GO:0018027 | peptidyl-lysine dimethylation(GO:0018027) |
0.0 | 0.5 | GO:0051384 | response to glucocorticoid(GO:0051384) |
0.0 | 0.0 | GO:0014816 | skeletal muscle satellite cell differentiation(GO:0014816) |
0.0 | 0.2 | GO:0097345 | mitochondrial outer membrane permeabilization(GO:0097345) |
0.0 | 0.0 | GO:0034443 | plasma lipoprotein particle oxidation(GO:0034441) negative regulation of lipoprotein oxidation(GO:0034443) |
0.0 | 0.0 | GO:0048861 | leukemia inhibitory factor signaling pathway(GO:0048861) |
0.0 | 0.1 | GO:0010642 | negative regulation of platelet-derived growth factor receptor signaling pathway(GO:0010642) |
0.0 | 0.0 | GO:0048664 | neuron fate determination(GO:0048664) |
0.0 | 0.0 | GO:0021778 | oligodendrocyte cell fate specification(GO:0021778) oligodendrocyte cell fate commitment(GO:0021779) glial cell fate specification(GO:0021780) |
0.0 | 0.0 | GO:0001951 | intestinal D-glucose absorption(GO:0001951) |
0.0 | 0.0 | GO:0042253 | granulocyte macrophage colony-stimulating factor biosynthetic process(GO:0042253) regulation of granulocyte macrophage colony-stimulating factor biosynthetic process(GO:0045423) |
0.0 | 0.0 | GO:0018377 | protein myristoylation(GO:0018377) |
0.0 | 0.2 | GO:0042403 | thyroid hormone metabolic process(GO:0042403) |
0.0 | 0.1 | GO:2000258 | negative regulation of complement activation(GO:0045916) negative regulation of protein activation cascade(GO:2000258) |
0.0 | 0.1 | GO:0001992 | regulation of systemic arterial blood pressure by vasopressin(GO:0001992) |
0.0 | 0.0 | GO:0015817 | histidine transport(GO:0015817) |
0.0 | 0.0 | GO:0051967 | negative regulation of synaptic transmission, glutamatergic(GO:0051967) |
0.0 | 0.1 | GO:0033866 | coenzyme A biosynthetic process(GO:0015937) nucleoside bisphosphate biosynthetic process(GO:0033866) ribonucleoside bisphosphate biosynthetic process(GO:0034030) purine nucleoside bisphosphate biosynthetic process(GO:0034033) |
0.0 | 0.0 | GO:0042435 | indole-containing compound biosynthetic process(GO:0042435) |
0.0 | 0.0 | GO:1903894 | regulation of IRE1-mediated unfolded protein response(GO:1903894) |
0.0 | 0.0 | GO:0072656 | maintenance of protein location in mitochondrion(GO:0072656) |
0.0 | 0.0 | GO:0042270 | protection from natural killer cell mediated cytotoxicity(GO:0042270) |
0.0 | 0.0 | GO:0006901 | vesicle coating(GO:0006901) |
0.0 | 0.0 | GO:0019086 | late viral transcription(GO:0019086) |
0.0 | 0.0 | GO:2000504 | positive regulation of blood vessel remodeling(GO:2000504) |
0.0 | 0.3 | GO:0060042 | retina morphogenesis in camera-type eye(GO:0060042) |
0.0 | 0.0 | GO:0002361 | CD4-positive, CD25-positive, alpha-beta regulatory T cell differentiation(GO:0002361) |
0.0 | 0.1 | GO:0050917 | sensory perception of umami taste(GO:0050917) |
0.0 | 0.0 | GO:0006450 | regulation of translational fidelity(GO:0006450) |
0.0 | 0.1 | GO:0051457 | maintenance of protein location in nucleus(GO:0051457) |
0.0 | 0.0 | GO:0055093 | response to increased oxygen levels(GO:0036296) response to hyperoxia(GO:0055093) oxygen metabolic process(GO:0072592) |
0.0 | 0.0 | GO:0009445 | putrescine metabolic process(GO:0009445) |
0.0 | 0.0 | GO:0070070 | proton-transporting V-type ATPase complex assembly(GO:0070070) vacuolar proton-transporting V-type ATPase complex assembly(GO:0070072) |
0.0 | 0.0 | GO:0032513 | negative regulation of protein phosphatase type 2B activity(GO:0032513) |
0.0 | 0.0 | GO:0002277 | myeloid dendritic cell activation involved in immune response(GO:0002277) |
0.0 | 0.0 | GO:0046490 | isopentenyl diphosphate metabolic process(GO:0046490) |
0.0 | 0.0 | GO:0090187 | positive regulation of pancreatic juice secretion(GO:0090187) |
0.0 | 0.7 | GO:1903955 | positive regulation of establishment of protein localization to mitochondrion(GO:1903749) positive regulation of protein targeting to mitochondrion(GO:1903955) |
0.0 | 0.4 | GO:0030490 | maturation of SSU-rRNA(GO:0030490) |
0.0 | 0.0 | GO:0015936 | coenzyme A metabolic process(GO:0015936) |
0.0 | 0.0 | GO:0007406 | negative regulation of neuroblast proliferation(GO:0007406) |
0.0 | 0.1 | GO:0035385 | Roundabout signaling pathway(GO:0035385) |
0.0 | 0.1 | GO:0015813 | L-glutamate transport(GO:0015813) |
0.0 | 0.0 | GO:0032725 | positive regulation of granulocyte macrophage colony-stimulating factor production(GO:0032725) |
0.0 | 0.0 | GO:0060700 | regulation of ribonuclease activity(GO:0060700) |
0.0 | 0.0 | GO:0060620 | regulation of cholesterol import(GO:0060620) regulation of sterol import(GO:2000909) |
0.0 | 0.0 | GO:0032740 | positive regulation of interleukin-17 production(GO:0032740) |
0.0 | 0.0 | GO:0001983 | baroreceptor response to increased systemic arterial blood pressure(GO:0001983) |
0.0 | 0.0 | GO:0034085 | establishment of sister chromatid cohesion(GO:0034085) cohesin loading(GO:0071921) regulation of cohesin loading(GO:0071922) |
0.0 | 0.0 | GO:0046950 | cellular ketone body metabolic process(GO:0046950) |
0.0 | 0.0 | GO:0097411 | hypoxia-inducible factor-1alpha signaling pathway(GO:0097411) |
0.0 | 0.0 | GO:0007096 | regulation of exit from mitosis(GO:0007096) |
0.0 | 0.0 | GO:0019732 | antifungal humoral response(GO:0019732) |
0.0 | 0.6 | GO:0008033 | tRNA processing(GO:0008033) |
0.0 | 0.1 | GO:0035094 | response to nicotine(GO:0035094) |
0.0 | 0.1 | GO:1901223 | negative regulation of NIK/NF-kappaB signaling(GO:1901223) |
0.0 | 0.1 | GO:0080009 | mRNA methylation(GO:0080009) |
0.0 | 0.1 | GO:0006123 | mitochondrial electron transport, cytochrome c to oxygen(GO:0006123) |
0.0 | 0.0 | GO:0010994 | regulation of ubiquitin homeostasis(GO:0010993) free ubiquitin chain polymerization(GO:0010994) |
0.0 | 1.2 | GO:0019236 | response to pheromone(GO:0019236) |
0.0 | 0.0 | GO:0010980 | regulation of vitamin D 24-hydroxylase activity(GO:0010979) positive regulation of vitamin D 24-hydroxylase activity(GO:0010980) |
0.0 | 0.0 | GO:1900736 | regulation of phospholipase C-activating G-protein coupled receptor signaling pathway(GO:1900736) |
0.0 | 0.0 | GO:0034136 | negative regulation of toll-like receptor 2 signaling pathway(GO:0034136) |
0.0 | 0.1 | GO:0000244 | spliceosomal tri-snRNP complex assembly(GO:0000244) |
0.0 | 0.0 | GO:0060830 | ciliary receptor clustering involved in smoothened signaling pathway(GO:0060830) |
0.0 | 0.0 | GO:0051452 | intracellular pH reduction(GO:0051452) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
1.5 | 4.4 | GO:0038037 | G-protein coupled receptor dimeric complex(GO:0038037) G-protein coupled receptor complex(GO:0097648) |
1.0 | 2.9 | GO:0070939 | Dsl1p complex(GO:0070939) |
0.9 | 2.7 | GO:0034666 | integrin alpha2-beta1 complex(GO:0034666) |
0.8 | 3.2 | GO:0005968 | Rab-protein geranylgeranyltransferase complex(GO:0005968) |
0.8 | 2.3 | GO:0042719 | mitochondrial intermembrane space protein transporter complex(GO:0042719) |
0.7 | 2.6 | GO:0032777 | Piccolo NuA4 histone acetyltransferase complex(GO:0032777) |
0.6 | 2.3 | GO:0031262 | Ndc80 complex(GO:0031262) |
0.6 | 2.3 | GO:0098536 | deuterosome(GO:0098536) |
0.6 | 2.3 | GO:0036449 | microtubule minus-end(GO:0036449) |
0.6 | 3.9 | GO:0071437 | invadopodium(GO:0071437) |
0.5 | 2.7 | GO:0000235 | astral microtubule(GO:0000235) |
0.5 | 1.6 | GO:0090661 | box H/ACA telomerase RNP complex(GO:0090661) |
0.5 | 1.5 | GO:0097025 | MPP7-DLG1-LIN7 complex(GO:0097025) |
0.5 | 3.5 | GO:0005952 | cAMP-dependent protein kinase complex(GO:0005952) |
0.5 | 1.4 | GO:0005899 | insulin receptor complex(GO:0005899) |
0.5 | 1.8 | GO:0030868 | smooth endoplasmic reticulum membrane(GO:0030868) smooth endoplasmic reticulum part(GO:0097425) |
0.4 | 1.3 | GO:0097451 | glial limiting end-foot(GO:0097451) |
0.4 | 1.7 | GO:0032541 | cortical endoplasmic reticulum(GO:0032541) |
0.4 | 1.7 | GO:0044615 | nuclear pore nuclear basket(GO:0044615) |
0.4 | 1.2 | GO:0033186 | CAF-1 complex(GO:0033186) |
0.4 | 2.8 | GO:0030285 | integral component of synaptic vesicle membrane(GO:0030285) intrinsic component of synaptic vesicle membrane(GO:0098563) |
0.4 | 2.0 | GO:0097433 | dense body(GO:0097433) |
0.4 | 1.2 | GO:0097058 | CRLF-CLCF1 complex(GO:0097058) |
0.4 | 1.6 | GO:0072487 | MSL complex(GO:0072487) |
0.4 | 1.5 | GO:0032021 | NELF complex(GO:0032021) |
0.4 | 2.2 | GO:0070775 | H3 histone acetyltransferase complex(GO:0070775) MOZ/MORF histone acetyltransferase complex(GO:0070776) |
0.4 | 1.5 | GO:0000408 | EKC/KEOPS complex(GO:0000408) |
0.4 | 1.1 | GO:0005971 | ribonucleoside-diphosphate reductase complex(GO:0005971) |
0.4 | 1.1 | GO:0070110 | ciliary neurotrophic factor receptor complex(GO:0070110) |
0.3 | 1.4 | GO:1990726 | Lsm1-7-Pat1 complex(GO:1990726) |
0.3 | 2.0 | GO:0030915 | Smc5-Smc6 complex(GO:0030915) |
0.3 | 1.7 | GO:0070044 | synaptobrevin 2-SNAP-25-syntaxin-1a complex(GO:0070044) |
0.3 | 2.9 | GO:0008385 | IkappaB kinase complex(GO:0008385) |
0.3 | 1.2 | GO:0031313 | extrinsic component of endosome membrane(GO:0031313) |
0.3 | 3.1 | GO:0044224 | juxtaparanode region of axon(GO:0044224) |
0.3 | 0.3 | GO:0032592 | integral component of mitochondrial membrane(GO:0032592) |
0.3 | 1.7 | GO:0014731 | spectrin-associated cytoskeleton(GO:0014731) |
0.3 | 3.1 | GO:0043194 | axon initial segment(GO:0043194) |
0.3 | 1.4 | GO:0000805 | X chromosome(GO:0000805) |
0.3 | 1.4 | GO:0031838 | haptoglobin-hemoglobin complex(GO:0031838) |
0.3 | 1.7 | GO:0002139 | stereocilia coupling link(GO:0002139) |
0.3 | 1.7 | GO:0000347 | THO complex(GO:0000347) THO complex part of transcription export complex(GO:0000445) |
0.3 | 0.8 | GO:0097149 | centralspindlin complex(GO:0097149) |
0.3 | 1.1 | GO:0000836 | ER ubiquitin ligase complex(GO:0000835) Hrd1p ubiquitin ligase complex(GO:0000836) |
0.3 | 2.4 | GO:0032593 | insulin-responsive compartment(GO:0032593) |
0.3 | 1.1 | GO:0030015 | CCR4-NOT core complex(GO:0030015) |
0.3 | 1.1 | GO:0030891 | VCB complex(GO:0030891) |
0.3 | 3.7 | GO:0031011 | Ino80 complex(GO:0031011) |
0.3 | 0.8 | GO:0000172 | ribonuclease MRP complex(GO:0000172) |
0.3 | 2.6 | GO:0016442 | RISC complex(GO:0016442) RNAi effector complex(GO:0031332) |
0.3 | 1.0 | GO:0044308 | axonal spine(GO:0044308) |
0.3 | 0.8 | GO:0032280 | symmetric synapse(GO:0032280) |
0.2 | 1.0 | GO:0097422 | tubular endosome(GO:0097422) |
0.2 | 0.7 | GO:0000015 | phosphopyruvate hydratase complex(GO:0000015) |
0.2 | 0.2 | GO:0043293 | apoptosome(GO:0043293) |
0.2 | 10.7 | GO:0098878 | ionotropic glutamate receptor complex(GO:0008328) neurotransmitter receptor complex(GO:0098878) |
0.2 | 1.6 | GO:0033180 | proton-transporting V-type ATPase, V1 domain(GO:0033180) |
0.2 | 0.7 | GO:0097255 | R2TP complex(GO:0097255) |
0.2 | 2.3 | GO:0044232 | organelle membrane contact site(GO:0044232) |
0.2 | 0.9 | GO:0071797 | LUBAC complex(GO:0071797) |
0.2 | 0.7 | GO:0000802 | transverse filament(GO:0000802) |
0.2 | 1.8 | GO:0012507 | ER to Golgi transport vesicle membrane(GO:0012507) |
0.2 | 0.9 | GO:0000931 | gamma-tubulin large complex(GO:0000931) gamma-tubulin ring complex(GO:0008274) |
0.2 | 2.7 | GO:0043240 | Fanconi anaemia nuclear complex(GO:0043240) |
0.2 | 2.2 | GO:0030134 | ER to Golgi transport vesicle(GO:0030134) |
0.2 | 3.0 | GO:0032839 | dendrite cytoplasm(GO:0032839) |
0.2 | 3.2 | GO:0030904 | retromer complex(GO:0030904) |
0.2 | 1.1 | GO:0032133 | chromosome passenger complex(GO:0032133) |
0.2 | 1.0 | GO:0045261 | mitochondrial proton-transporting ATP synthase complex, catalytic core F(1)(GO:0000275) proton-transporting ATP synthase complex, catalytic core F(1)(GO:0045261) |
0.2 | 1.2 | GO:0030688 | preribosome, small subunit precursor(GO:0030688) |
0.2 | 0.6 | GO:0000125 | PCAF complex(GO:0000125) |
0.2 | 3.2 | GO:0031082 | BLOC complex(GO:0031082) |
0.2 | 4.9 | GO:0044298 | cell body membrane(GO:0044298) |
0.2 | 0.6 | GO:0005958 | DNA-dependent protein kinase-DNA ligase 4 complex(GO:0005958) |
0.2 | 8.0 | GO:0042734 | presynaptic membrane(GO:0042734) |
0.2 | 6.8 | GO:0000315 | organellar large ribosomal subunit(GO:0000315) mitochondrial large ribosomal subunit(GO:0005762) |
0.2 | 1.2 | GO:0030140 | trans-Golgi network transport vesicle(GO:0030140) |
0.2 | 0.8 | GO:0031502 | dolichyl-phosphate-mannose-protein mannosyltransferase complex(GO:0031502) |
0.2 | 1.9 | GO:0098984 | asymmetric synapse(GO:0032279) neuron to neuron synapse(GO:0098984) |
0.2 | 1.7 | GO:0097542 | ciliary tip(GO:0097542) |
0.2 | 0.6 | GO:0005642 | annulate lamellae(GO:0005642) |
0.2 | 0.5 | GO:0033648 | host intracellular organelle(GO:0033647) host intracellular membrane-bounded organelle(GO:0033648) |
0.2 | 1.6 | GO:0000124 | SAGA complex(GO:0000124) |
0.2 | 0.9 | GO:0031261 | DNA replication preinitiation complex(GO:0031261) |
0.2 | 0.5 | GO:0031523 | Myb complex(GO:0031523) |
0.2 | 0.7 | GO:0061689 | tricellular tight junction(GO:0061689) |
0.2 | 0.7 | GO:0016602 | CCAAT-binding factor complex(GO:0016602) |
0.2 | 0.2 | GO:0005818 | aster(GO:0005818) |
0.2 | 4.6 | GO:0099501 | synaptic vesicle membrane(GO:0030672) exocytic vesicle membrane(GO:0099501) |
0.2 | 1.4 | GO:0042788 | polysomal ribosome(GO:0042788) |
0.2 | 2.2 | GO:0005671 | Ada2/Gcn5/Ada3 transcription activator complex(GO:0005671) |
0.2 | 1.5 | GO:0031080 | nuclear pore outer ring(GO:0031080) |
0.2 | 2.7 | GO:0005892 | acetylcholine-gated channel complex(GO:0005892) |
0.2 | 0.8 | GO:0005845 | mRNA cap binding complex(GO:0005845) RNA cap binding complex(GO:0034518) |
0.2 | 1.0 | GO:0000801 | central element(GO:0000801) |
0.2 | 0.7 | GO:0070876 | SOSS complex(GO:0070876) |
0.2 | 1.9 | GO:0010369 | chromocenter(GO:0010369) |
0.2 | 2.6 | GO:0000242 | pericentriolar material(GO:0000242) |
0.2 | 4.4 | GO:0005763 | organellar small ribosomal subunit(GO:0000314) mitochondrial small ribosomal subunit(GO:0005763) |
0.2 | 0.3 | GO:0008275 | gamma-tubulin small complex(GO:0008275) |
0.2 | 0.6 | GO:0035032 | phosphatidylinositol 3-kinase complex, class III(GO:0035032) |
0.2 | 1.8 | GO:0030014 | CCR4-NOT complex(GO:0030014) |
0.2 | 0.6 | GO:0030681 | nucleolar ribonuclease P complex(GO:0005655) ribonuclease P complex(GO:0030677) multimeric ribonuclease P complex(GO:0030681) |
0.2 | 1.7 | GO:0000940 | condensed chromosome outer kinetochore(GO:0000940) |
0.2 | 1.7 | GO:0000777 | condensed chromosome kinetochore(GO:0000777) |
0.2 | 0.8 | GO:0030122 | AP-2 adaptor complex(GO:0030122) |
0.2 | 1.1 | GO:0044666 | MLL3/4 complex(GO:0044666) |
0.2 | 0.8 | GO:0045252 | oxoglutarate dehydrogenase complex(GO:0045252) |
0.2 | 1.1 | GO:0036057 | filtration diaphragm(GO:0036056) slit diaphragm(GO:0036057) |
0.1 | 0.9 | GO:0090571 | RNA polymerase II transcription repressor complex(GO:0090571) |
0.1 | 0.7 | GO:1990909 | Wnt signalosome(GO:1990909) |
0.1 | 2.2 | GO:1902710 | GABA receptor complex(GO:1902710) GABA-A receptor complex(GO:1902711) |
0.1 | 4.5 | GO:0005891 | voltage-gated calcium channel complex(GO:0005891) |
0.1 | 0.4 | GO:0005742 | mitochondrial outer membrane translocase complex(GO:0005742) |
0.1 | 0.4 | GO:0030956 | glutamyl-tRNA(Gln) amidotransferase complex(GO:0030956) |
0.1 | 1.7 | GO:0048786 | presynaptic active zone(GO:0048786) |
0.1 | 0.4 | GO:0032010 | phagolysosome(GO:0032010) |
0.1 | 0.6 | GO:0043203 | axon hillock(GO:0043203) |
0.1 | 1.6 | GO:0030126 | COPI vesicle coat(GO:0030126) |
0.1 | 0.4 | GO:0035748 | myelin sheath abaxonal region(GO:0035748) |
0.1 | 2.1 | GO:0005665 | DNA-directed RNA polymerase II, core complex(GO:0005665) |
0.1 | 0.6 | GO:0032389 | MutLalpha complex(GO:0032389) |
0.1 | 2.7 | GO:0032588 | trans-Golgi network membrane(GO:0032588) |
0.1 | 0.6 | GO:0000938 | GARP complex(GO:0000938) |
0.1 | 0.3 | GO:0033178 | proton-transporting two-sector ATPase complex, catalytic domain(GO:0033178) |
0.1 | 0.3 | GO:0033588 | Elongator holoenzyme complex(GO:0033588) |
0.1 | 0.4 | GO:0043527 | tRNA methyltransferase complex(GO:0043527) |
0.1 | 0.4 | GO:0030289 | protein phosphatase 4 complex(GO:0030289) |
0.1 | 1.6 | GO:0030867 | rough endoplasmic reticulum membrane(GO:0030867) |
0.1 | 0.5 | GO:0030313 | cell outer membrane(GO:0009279) cell envelope(GO:0030313) external encapsulating structure part(GO:0044462) |
0.1 | 0.8 | GO:0031415 | NatA complex(GO:0031415) |
0.1 | 0.4 | GO:0032937 | SREBP-SCAP-Insig complex(GO:0032937) |
0.1 | 0.9 | GO:0031390 | Ctf18 RFC-like complex(GO:0031390) |
0.1 | 1.2 | GO:0032039 | integrator complex(GO:0032039) |
0.1 | 3.8 | GO:0031201 | SNARE complex(GO:0031201) |
0.1 | 0.6 | GO:0005672 | transcription factor TFIIA complex(GO:0005672) |
0.1 | 2.4 | GO:0005838 | proteasome regulatory particle(GO:0005838) |
0.1 | 0.4 | GO:0033503 | HULC complex(GO:0033503) |
0.1 | 0.7 | GO:0000796 | condensin complex(GO:0000796) |
0.1 | 0.2 | GO:0055087 | Ski complex(GO:0055087) |
0.1 | 0.3 | GO:0097169 | AIM2 inflammasome complex(GO:0097169) |
0.1 | 1.4 | GO:0005847 | mRNA cleavage and polyadenylation specificity factor complex(GO:0005847) |
0.1 | 1.7 | GO:0045120 | pronucleus(GO:0045120) |
0.1 | 0.8 | GO:0016593 | Cdc73/Paf1 complex(GO:0016593) |
0.1 | 1.1 | GO:0060077 | inhibitory synapse(GO:0060077) |
0.1 | 2.0 | GO:0005790 | smooth endoplasmic reticulum(GO:0005790) |
0.1 | 0.3 | GO:0070522 | ERCC4-ERCC1 complex(GO:0070522) |
0.1 | 0.1 | GO:0042585 | germinal vesicle(GO:0042585) |
0.1 | 0.1 | GO:0034274 | Atg12-Atg5-Atg16 complex(GO:0034274) |
0.1 | 0.2 | GO:0071564 | npBAF complex(GO:0071564) |
0.1 | 0.5 | GO:0030132 | clathrin coat of coated pit(GO:0030132) |
0.1 | 0.4 | GO:1990130 | Iml1 complex(GO:1990130) |
0.1 | 0.1 | GO:0097629 | extrinsic component of omegasome membrane(GO:0097629) |
0.1 | 0.8 | GO:1904115 | axon cytoplasm(GO:1904115) |
0.1 | 0.5 | GO:0072357 | PTW/PP1 phosphatase complex(GO:0072357) |
0.1 | 0.4 | GO:0071598 | neuronal ribonucleoprotein granule(GO:0071598) |
0.1 | 0.4 | GO:1990246 | uniplex complex(GO:1990246) |
0.1 | 1.4 | GO:0005662 | DNA replication factor A complex(GO:0005662) |
0.1 | 0.6 | GO:0070937 | CRD-mediated mRNA stability complex(GO:0070937) |
0.1 | 1.4 | GO:0001741 | XY body(GO:0001741) |
0.1 | 1.6 | GO:0090545 | NuRD complex(GO:0016581) CHD-type complex(GO:0090545) |
0.1 | 1.8 | GO:0071339 | MLL1/2 complex(GO:0044665) MLL1 complex(GO:0071339) |
0.1 | 0.3 | GO:0097543 | ciliary inversin compartment(GO:0097543) |
0.1 | 0.1 | GO:0031618 | nuclear pericentric heterochromatin(GO:0031618) |
0.1 | 3.8 | GO:0005776 | autophagosome(GO:0005776) |
0.1 | 0.3 | GO:0070761 | pre-snoRNP complex(GO:0070761) |
0.1 | 0.8 | GO:0070652 | HAUS complex(GO:0070652) |
0.1 | 0.3 | GO:0005827 | polar microtubule(GO:0005827) |
0.1 | 2.9 | GO:0005788 | endoplasmic reticulum lumen(GO:0005788) |
0.1 | 0.3 | GO:0044322 | endoplasmic reticulum quality control compartment(GO:0044322) |
0.1 | 0.4 | GO:0045298 | tubulin complex(GO:0045298) |
0.1 | 0.5 | GO:0034715 | pICln-Sm protein complex(GO:0034715) |
0.1 | 0.5 | GO:0042611 | MHC protein complex(GO:0042611) |
0.1 | 0.5 | GO:0043083 | synaptic cleft(GO:0043083) |
0.1 | 1.8 | GO:0005782 | peroxisomal matrix(GO:0005782) microbody lumen(GO:0031907) |
0.1 | 2.4 | GO:0008023 | transcription elongation factor complex(GO:0008023) |
0.1 | 1.8 | GO:0031306 | intrinsic component of mitochondrial outer membrane(GO:0031306) |
0.1 | 0.5 | GO:0061617 | MICOS complex(GO:0061617) |
0.1 | 0.6 | GO:0034464 | BBSome(GO:0034464) |
0.1 | 5.5 | GO:0008021 | synaptic vesicle(GO:0008021) |
0.1 | 1.6 | GO:0035861 | site of double-strand break(GO:0035861) |
0.1 | 0.9 | GO:0005721 | pericentric heterochromatin(GO:0005721) |
0.1 | 0.2 | GO:0008622 | epsilon DNA polymerase complex(GO:0008622) |
0.1 | 1.4 | GO:0097610 | cleavage furrow(GO:0032154) cell surface furrow(GO:0097610) |
0.1 | 0.6 | GO:0031462 | Cul2-RING ubiquitin ligase complex(GO:0031462) |
0.1 | 0.5 | GO:0016012 | dystroglycan complex(GO:0016011) sarcoglycan complex(GO:0016012) |
0.1 | 0.9 | GO:0072546 | ER membrane protein complex(GO:0072546) |
0.1 | 0.4 | GO:0000346 | transcription export complex(GO:0000346) |
0.1 | 0.4 | GO:0097449 | astrocyte projection(GO:0097449) |
0.1 | 6.9 | GO:0030176 | integral component of endoplasmic reticulum membrane(GO:0030176) |
0.1 | 0.9 | GO:0032590 | dendrite membrane(GO:0032590) |
0.1 | 0.7 | GO:0031010 | ISWI-type complex(GO:0031010) |
0.1 | 0.8 | GO:0005669 | transcription factor TFIID complex(GO:0005669) |
0.1 | 0.4 | GO:0005579 | membrane attack complex(GO:0005579) |
0.1 | 0.2 | GO:0010009 | cytoplasmic side of endosome membrane(GO:0010009) |
0.1 | 0.8 | GO:0070822 | Sin3-type complex(GO:0070822) |
0.1 | 0.5 | GO:0042588 | zymogen granule(GO:0042588) |
0.1 | 1.0 | GO:0005689 | U12-type spliceosomal complex(GO:0005689) |
0.1 | 0.3 | GO:0032300 | mismatch repair complex(GO:0032300) |
0.1 | 4.5 | GO:0000776 | kinetochore(GO:0000776) |
0.1 | 0.5 | GO:0031983 | vesicle lumen(GO:0031983) |
0.1 | 3.6 | GO:0005643 | nuclear pore(GO:0005643) |
0.1 | 0.2 | GO:0072534 | perineuronal net(GO:0072534) |
0.1 | 3.7 | GO:0005791 | rough endoplasmic reticulum(GO:0005791) |
0.1 | 0.9 | GO:0001891 | phagocytic cup(GO:0001891) |
0.1 | 0.6 | GO:1990124 | messenger ribonucleoprotein complex(GO:1990124) |
0.1 | 8.8 | GO:0045211 | postsynaptic membrane(GO:0045211) |
0.1 | 0.2 | GO:0071008 | U2-type post-mRNA release spliceosomal complex(GO:0071008) |
0.1 | 2.2 | GO:0072686 | mitotic spindle(GO:0072686) |
0.1 | 0.3 | GO:0070695 | FHF complex(GO:0070695) |
0.1 | 4.5 | GO:0005795 | Golgi stack(GO:0005795) |
0.1 | 0.6 | GO:0060091 | kinocilium(GO:0060091) |
0.1 | 0.3 | GO:0005593 | FACIT collagen trimer(GO:0005593) |
0.1 | 0.3 | GO:0002079 | inner acrosomal membrane(GO:0002079) |
0.1 | 0.2 | GO:0005833 | hemoglobin complex(GO:0005833) |
0.1 | 0.2 | GO:0030689 | Noc complex(GO:0030689) |
0.1 | 3.1 | GO:0000502 | proteasome complex(GO:0000502) |
0.1 | 0.2 | GO:0032299 | ribonuclease H2 complex(GO:0032299) |
0.1 | 6.1 | GO:0016607 | nuclear speck(GO:0016607) |
0.1 | 0.1 | GO:0098799 | outer mitochondrial membrane protein complex(GO:0098799) |
0.1 | 0.2 | GO:0016461 | unconventional myosin complex(GO:0016461) |
0.1 | 0.8 | GO:0030877 | beta-catenin destruction complex(GO:0030877) |
0.1 | 1.5 | GO:0005680 | anaphase-promoting complex(GO:0005680) |
0.1 | 1.0 | GO:0035145 | exon-exon junction complex(GO:0035145) |
0.1 | 1.3 | GO:0034451 | centriolar satellite(GO:0034451) |
0.1 | 3.9 | GO:0031463 | Cul3-RING ubiquitin ligase complex(GO:0031463) |
0.1 | 0.9 | GO:0038201 | TOR complex(GO:0038201) |
0.1 | 0.3 | GO:0044530 | supraspliceosomal complex(GO:0044530) |
0.1 | 0.6 | GO:0031045 | dense core granule(GO:0031045) |
0.1 | 2.4 | GO:0000932 | cytoplasmic mRNA processing body(GO:0000932) |
0.1 | 7.8 | GO:0042579 | peroxisome(GO:0005777) microbody(GO:0042579) |
0.1 | 8.7 | GO:0000139 | Golgi membrane(GO:0000139) |
0.1 | 0.6 | GO:0097440 | apical dendrite(GO:0097440) |
0.1 | 0.6 | GO:0017119 | Golgi transport complex(GO:0017119) |
0.1 | 1.9 | GO:0009295 | nucleoid(GO:0009295) mitochondrial nucleoid(GO:0042645) |
0.1 | 0.3 | GO:0097524 | sperm plasma membrane(GO:0097524) |
0.1 | 0.1 | GO:0033185 | dolichol-phosphate-mannose synthase complex(GO:0033185) |
0.1 | 0.7 | GO:0005675 | holo TFIIH complex(GO:0005675) |
0.1 | 0.5 | GO:0034366 | spherical high-density lipoprotein particle(GO:0034366) |
0.1 | 0.2 | GO:0014701 | junctional sarcoplasmic reticulum membrane(GO:0014701) |
0.1 | 0.1 | GO:0016939 | kinesin II complex(GO:0016939) |
0.1 | 1.1 | GO:0000178 | exosome (RNase complex)(GO:0000178) |
0.1 | 0.5 | GO:0000974 | Prp19 complex(GO:0000974) |
0.1 | 20.9 | GO:0005743 | mitochondrial inner membrane(GO:0005743) |
0.1 | 0.5 | GO:0032045 | guanyl-nucleotide exchange factor complex(GO:0032045) |
0.1 | 0.2 | GO:0044326 | dendritic spine neck(GO:0044326) |
0.1 | 1.0 | GO:0032391 | photoreceptor connecting cilium(GO:0032391) |
0.1 | 0.3 | GO:0005664 | origin recognition complex(GO:0000808) nuclear origin of replication recognition complex(GO:0005664) |
0.1 | 0.2 | GO:0030314 | junctional membrane complex(GO:0030314) |
0.1 | 0.8 | GO:0005732 | small nucleolar ribonucleoprotein complex(GO:0005732) |
0.1 | 0.1 | GO:0034991 | nuclear meiotic cohesin complex(GO:0034991) |
0.1 | 0.9 | GO:0000159 | protein phosphatase type 2A complex(GO:0000159) |
0.1 | 0.5 | GO:0032040 | small-subunit processome(GO:0032040) |
0.1 | 0.4 | GO:0000506 | glycosylphosphatidylinositol-N-acetylglucosaminyltransferase (GPI-GnT) complex(GO:0000506) |
0.1 | 0.2 | GO:0005851 | eukaryotic translation initiation factor 2B complex(GO:0005851) |
0.1 | 1.2 | GO:0030687 | preribosome, large subunit precursor(GO:0030687) |
0.1 | 0.2 | GO:0070852 | cell body fiber(GO:0070852) |
0.1 | 0.5 | GO:0046540 | U4/U6 x U5 tri-snRNP complex(GO:0046540) |
0.1 | 0.1 | GO:0033202 | DNA helicase complex(GO:0033202) |
0.1 | 0.1 | GO:0097342 | ripoptosome(GO:0097342) |
0.1 | 0.2 | GO:0071782 | endoplasmic reticulum tubular network(GO:0071782) |
0.1 | 0.3 | GO:0036513 | Derlin-1 retrotranslocation complex(GO:0036513) |
0.1 | 0.4 | GO:0072669 | tRNA-splicing ligase complex(GO:0072669) |
0.1 | 0.2 | GO:0042587 | glycogen granule(GO:0042587) |
0.1 | 0.8 | GO:0005686 | U2 snRNP(GO:0005686) |
0.1 | 0.4 | GO:0045254 | pyruvate dehydrogenase complex(GO:0045254) |
0.1 | 3.2 | GO:0022625 | cytosolic large ribosomal subunit(GO:0022625) |
0.1 | 0.4 | GO:0008250 | oligosaccharyltransferase complex(GO:0008250) |
0.1 | 0.2 | GO:0043202 | lysosomal lumen(GO:0043202) |
0.1 | 0.1 | GO:0030684 | preribosome(GO:0030684) |
0.1 | 0.5 | GO:0030123 | AP-3 adaptor complex(GO:0030123) |
0.1 | 0.3 | GO:0005786 | signal recognition particle, endoplasmic reticulum targeting(GO:0005786) signal recognition particle(GO:0048500) |
0.1 | 0.2 | GO:0005853 | eukaryotic translation elongation factor 1 complex(GO:0005853) |
0.1 | 0.7 | GO:0035686 | sperm fibrous sheath(GO:0035686) |
0.1 | 0.3 | GO:0071986 | Ragulator complex(GO:0071986) |
0.1 | 3.1 | GO:0005814 | centriole(GO:0005814) |
0.1 | 3.7 | GO:0005840 | ribosome(GO:0005840) |
0.1 | 0.1 | GO:0070552 | BRISC complex(GO:0070552) |
0.1 | 0.2 | GO:0005945 | 6-phosphofructokinase complex(GO:0005945) |
0.0 | 0.2 | GO:0005964 | phosphorylase kinase complex(GO:0005964) |
0.0 | 1.0 | GO:0005871 | kinesin complex(GO:0005871) |
0.0 | 0.6 | GO:1990391 | DNA repair complex(GO:1990391) |
0.0 | 0.2 | GO:0000120 | RNA polymerase I transcription factor complex(GO:0000120) |
0.0 | 0.1 | GO:0005850 | eukaryotic translation initiation factor 2 complex(GO:0005850) |
0.0 | 0.5 | GO:0005798 | Golgi-associated vesicle(GO:0005798) |
0.0 | 0.2 | GO:0097208 | alveolar lamellar body(GO:0097208) |
0.0 | 0.1 | GO:0045293 | mRNA editing complex(GO:0045293) |
0.0 | 0.2 | GO:0034098 | VCP-NPL4-UFD1 AAA ATPase complex(GO:0034098) |
0.0 | 0.3 | GO:0001673 | male germ cell nucleus(GO:0001673) |
0.0 | 0.3 | GO:0035253 | ciliary rootlet(GO:0035253) |
0.0 | 0.2 | GO:0002199 | zona pellucida receptor complex(GO:0002199) |
0.0 | 0.7 | GO:0030992 | intraciliary transport particle B(GO:0030992) |
0.0 | 0.2 | GO:0000800 | lateral element(GO:0000800) |
0.0 | 0.9 | GO:0032420 | stereocilium(GO:0032420) |
0.0 | 0.7 | GO:0016235 | aggresome(GO:0016235) |
0.0 | 0.1 | GO:0033063 | Rad51B-Rad51C-Rad51D-XRCC2 complex(GO:0033063) |
0.0 | 0.0 | GO:0005896 | interleukin-6 receptor complex(GO:0005896) |
0.0 | 0.0 | GO:0035985 | senescence-associated heterochromatin focus(GO:0035985) |
0.0 | 0.1 | GO:0005796 | Golgi lumen(GO:0005796) |
0.0 | 0.4 | GO:0016514 | SWI/SNF complex(GO:0016514) |
0.0 | 0.2 | GO:0005849 | mRNA cleavage factor complex(GO:0005849) |
0.0 | 0.0 | GO:0070765 | gamma-secretase complex(GO:0070765) |
0.0 | 0.5 | GO:0005876 | spindle microtubule(GO:0005876) |
0.0 | 0.1 | GO:0044316 | cone cell pedicle(GO:0044316) |
0.0 | 0.2 | GO:0017101 | aminoacyl-tRNA synthetase multienzyme complex(GO:0017101) |
0.0 | 0.1 | GO:0016533 | cyclin-dependent protein kinase 5 holoenzyme complex(GO:0016533) |
0.0 | 0.3 | GO:0043196 | varicosity(GO:0043196) |
0.0 | 0.6 | GO:1990204 | oxidoreductase complex(GO:1990204) |
0.0 | 0.5 | GO:0030686 | 90S preribosome(GO:0030686) |
0.0 | 0.1 | GO:1902555 | endoribonuclease complex(GO:1902555) |
0.0 | 0.4 | GO:0097060 | synaptic membrane(GO:0097060) |
0.0 | 0.3 | GO:0005832 | chaperonin-containing T-complex(GO:0005832) |
0.0 | 0.1 | GO:0005682 | U5 snRNP(GO:0005682) |
0.0 | 0.3 | GO:0008074 | guanylate cyclase complex, soluble(GO:0008074) |
0.0 | 0.0 | GO:1990597 | AIP1-IRE1 complex(GO:1990597) |
0.0 | 0.4 | GO:0005771 | multivesicular body(GO:0005771) |
0.0 | 6.5 | GO:0005813 | centrosome(GO:0005813) |
0.0 | 0.1 | GO:0032444 | activin responsive factor complex(GO:0032444) |
0.0 | 0.4 | GO:0035869 | ciliary transition zone(GO:0035869) |
0.0 | 0.1 | GO:0030008 | TRAPP complex(GO:0030008) |
0.0 | 0.6 | GO:0034707 | chloride channel complex(GO:0034707) |
0.0 | 0.1 | GO:0005868 | cytoplasmic dynein complex(GO:0005868) |
0.0 | 0.1 | GO:0032584 | growth cone membrane(GO:0032584) |
0.0 | 0.2 | GO:0071012 | U2-type catalytic step 1 spliceosome(GO:0071006) catalytic step 1 spliceosome(GO:0071012) |
0.0 | 0.2 | GO:0070187 | telosome(GO:0070187) |
0.0 | 0.1 | GO:0042105 | alpha-beta T cell receptor complex(GO:0042105) |
0.0 | 0.2 | GO:0033391 | chromatoid body(GO:0033391) |
0.0 | 0.4 | GO:0031233 | intrinsic component of external side of plasma membrane(GO:0031233) |
0.0 | 0.1 | GO:0031264 | death-inducing signaling complex(GO:0031264) |
0.0 | 0.1 | GO:0045009 | melanosome membrane(GO:0033162) chitosome(GO:0045009) |
0.0 | 0.1 | GO:0005640 | nuclear outer membrane(GO:0005640) |
0.0 | 0.0 | GO:1990745 | EARP complex(GO:1990745) |
0.0 | 0.0 | GO:0033116 | endoplasmic reticulum-Golgi intermediate compartment membrane(GO:0033116) |
0.0 | 0.6 | GO:0071013 | catalytic step 2 spliceosome(GO:0071013) |
0.0 | 0.2 | GO:0005736 | DNA-directed RNA polymerase I complex(GO:0005736) |
0.0 | 0.6 | GO:0016529 | sarcoplasmic reticulum(GO:0016529) |
0.0 | 0.0 | GO:0097487 | multivesicular body, internal vesicle(GO:0097487) |
0.0 | 1.1 | GO:0031514 | motile cilium(GO:0031514) |
0.0 | 0.7 | GO:0005905 | clathrin-coated pit(GO:0005905) |
0.0 | 0.1 | GO:0033269 | internode region of axon(GO:0033269) |
0.0 | 0.1 | GO:0042612 | MHC class I protein complex(GO:0042612) |
0.0 | 0.2 | GO:0016272 | prefoldin complex(GO:0016272) |
0.0 | 0.1 | GO:0089717 | spanning component of plasma membrane(GO:0044214) spanning component of membrane(GO:0089717) |
0.0 | 0.9 | GO:0005811 | lipid particle(GO:0005811) |
0.0 | 0.2 | GO:0031902 | late endosome membrane(GO:0031902) |
0.0 | 0.1 | GO:0005610 | laminin-5 complex(GO:0005610) |
0.0 | 0.0 | GO:0034705 | potassium channel complex(GO:0034705) |
0.0 | 0.1 | GO:0032421 | stereocilium bundle(GO:0032421) |
0.0 | 0.3 | GO:0000775 | chromosome, centromeric region(GO:0000775) |
0.0 | 0.1 | GO:0070971 | endoplasmic reticulum exit site(GO:0070971) |
0.0 | 0.1 | GO:0035339 | SPOTS complex(GO:0035339) |
0.0 | 0.0 | GO:0089701 | U2AF(GO:0089701) |
0.0 | 0.0 | GO:0071817 | MMXD complex(GO:0071817) |
0.0 | 0.0 | GO:0005663 | DNA replication factor C complex(GO:0005663) |
0.0 | 15.0 | GO:0005739 | mitochondrion(GO:0005739) |
0.0 | 0.0 | GO:0035838 | growing cell tip(GO:0035838) |
0.0 | 0.2 | GO:0042101 | T cell receptor complex(GO:0042101) |
0.0 | 0.1 | GO:0031464 | Cul4A-RING E3 ubiquitin ligase complex(GO:0031464) |
0.0 | 0.2 | GO:0005801 | cis-Golgi network(GO:0005801) |
0.0 | 0.9 | GO:0005759 | mitochondrial matrix(GO:0005759) |
0.0 | 0.8 | GO:0008076 | voltage-gated potassium channel complex(GO:0008076) |
0.0 | 0.0 | GO:0017071 | intracellular cyclic nucleotide activated cation channel complex(GO:0017071) |
0.0 | 0.6 | GO:0043204 | perikaryon(GO:0043204) |
0.0 | 0.0 | GO:0044393 | microspike(GO:0044393) |
0.0 | 0.1 | GO:0035859 | Seh1-associated complex(GO:0035859) |
0.0 | 0.1 | GO:0019908 | nuclear cyclin-dependent protein kinase holoenzyme complex(GO:0019908) |
0.0 | 0.2 | GO:1903293 | protein serine/threonine phosphatase complex(GO:0008287) phosphatase complex(GO:1903293) |
0.0 | 0.1 | GO:0000795 | synaptonemal complex(GO:0000795) |
0.0 | 0.0 | GO:0033268 | node of Ranvier(GO:0033268) |
0.0 | 0.0 | GO:0061574 | ASAP complex(GO:0061574) |
0.0 | 0.0 | GO:0031211 | palmitoyltransferase complex(GO:0002178) serine C-palmitoyltransferase complex(GO:0017059) endoplasmic reticulum palmitoyltransferase complex(GO:0031211) |
0.0 | 1.4 | GO:0031225 | anchored component of membrane(GO:0031225) |
0.0 | 1.1 | GO:0035068 | micro-ribonucleoprotein complex(GO:0035068) |
0.0 | 0.2 | GO:0008180 | COP9 signalosome(GO:0008180) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
1.5 | 4.5 | GO:0050508 | glucuronosyl-N-acetylglucosaminyl-proteoglycan 4-alpha-N-acetylglucosaminyltransferase activity(GO:0050508) |
1.5 | 4.4 | GO:0004965 | G-protein coupled GABA receptor activity(GO:0004965) |
0.9 | 4.4 | GO:0019960 | C-X3-C chemokine binding(GO:0019960) |
0.8 | 2.4 | GO:0097016 | L27 domain binding(GO:0097016) |
0.8 | 3.1 | GO:0034511 | U3 snoRNA binding(GO:0034511) |
0.8 | 2.3 | GO:0097109 | neuroligin family protein binding(GO:0097109) |
0.7 | 2.2 | GO:0036042 | long-chain fatty acyl-CoA binding(GO:0036042) |
0.7 | 0.7 | GO:0004897 | ciliary neurotrophic factor receptor activity(GO:0004897) |
0.7 | 4.9 | GO:0102336 | fatty acid elongase activity(GO:0009922) 3-oxo-arachidoyl-CoA synthase activity(GO:0102336) 3-oxo-cerotoyl-CoA synthase activity(GO:0102337) 3-oxo-lignoceronyl-CoA synthase activity(GO:0102338) |
0.7 | 2.0 | GO:0019770 | IgG receptor activity(GO:0019770) |
0.7 | 0.7 | GO:0051920 | peroxiredoxin activity(GO:0051920) |
0.7 | 2.7 | GO:0032051 | clathrin light chain binding(GO:0032051) |
0.6 | 1.9 | GO:0003829 | beta-1,3-galactosyl-O-glycosyl-glycoprotein beta-1,6-N-acetylglucosaminyltransferase activity(GO:0003829) |
0.6 | 1.9 | GO:0000309 | nicotinamide-nucleotide adenylyltransferase activity(GO:0000309) nicotinate-nucleotide adenylyltransferase activity(GO:0004515) |
0.6 | 1.9 | GO:0008384 | IkappaB kinase activity(GO:0008384) |
0.6 | 1.8 | GO:0035175 | histone kinase activity (H3-S10 specific)(GO:0035175) |
0.6 | 1.7 | GO:0005128 | erythropoietin receptor binding(GO:0005128) |
0.6 | 1.7 | GO:0043423 | 3-phosphoinositide-dependent protein kinase binding(GO:0043423) |
0.5 | 2.1 | GO:0004165 | dodecenoyl-CoA delta-isomerase activity(GO:0004165) |
0.5 | 1.6 | GO:0034513 | box H/ACA snoRNA binding(GO:0034513) |
0.5 | 1.6 | GO:0005483 | soluble NSF attachment protein activity(GO:0005483) |
0.5 | 1.0 | GO:0008525 | phosphatidylcholine transporter activity(GO:0008525) |
0.5 | 3.0 | GO:0005225 | volume-sensitive anion channel activity(GO:0005225) |
0.5 | 1.9 | GO:0016286 | small conductance calcium-activated potassium channel activity(GO:0016286) |
0.5 | 1.4 | GO:0042296 | ISG15 transferase activity(GO:0042296) |
0.5 | 4.7 | GO:0005247 | voltage-gated chloride channel activity(GO:0005247) |
0.5 | 1.4 | GO:0004691 | cAMP-dependent protein kinase activity(GO:0004691) |
0.5 | 1.4 | GO:0031893 | vasopressin receptor binding(GO:0031893) |
0.5 | 1.8 | GO:0019788 | NEDD8 transferase activity(GO:0019788) |
0.4 | 1.3 | GO:0032767 | copper-dependent protein binding(GO:0032767) |
0.4 | 6.5 | GO:1990841 | promoter-specific chromatin binding(GO:1990841) |
0.4 | 1.7 | GO:0055056 | D-glucose transmembrane transporter activity(GO:0055056) |
0.4 | 2.1 | GO:0017151 | DEAD/H-box RNA helicase binding(GO:0017151) |
0.4 | 1.3 | GO:0004719 | protein-L-isoaspartate (D-aspartate) O-methyltransferase activity(GO:0004719) |
0.4 | 1.3 | GO:0004980 | melanocyte-stimulating hormone receptor activity(GO:0004980) |
0.4 | 1.3 | GO:1990829 | C-rich single-stranded DNA binding(GO:1990829) |
0.4 | 1.2 | GO:0009041 | uridylate kinase activity(GO:0009041) |
0.4 | 1.2 | GO:0016822 | hydrolase activity, acting on acid carbon-carbon bonds(GO:0016822) hydrolase activity, acting on acid carbon-carbon bonds, in ketonic substances(GO:0016823) |
0.4 | 0.8 | GO:0015111 | iodide transmembrane transporter activity(GO:0015111) |
0.4 | 1.2 | GO:0004999 | vasoactive intestinal polypeptide receptor activity(GO:0004999) |
0.4 | 0.4 | GO:1990381 | ubiquitin-specific protease binding(GO:1990381) |
0.4 | 3.2 | GO:0051011 | microtubule minus-end binding(GO:0051011) |
0.4 | 1.2 | GO:0001069 | regulatory region RNA binding(GO:0001069) |
0.4 | 1.2 | GO:0004977 | melanocortin receptor activity(GO:0004977) |
0.4 | 1.1 | GO:0004104 | cholinesterase activity(GO:0004104) |
0.4 | 3.8 | GO:0008239 | dipeptidyl-peptidase activity(GO:0008239) |
0.4 | 1.1 | GO:1990460 | leptin receptor binding(GO:1990460) |
0.4 | 1.1 | GO:0048101 | calcium- and calmodulin-regulated 3',5'-cyclic-GMP phosphodiesterase activity(GO:0048101) |
0.4 | 1.1 | GO:0016728 | ribonucleoside-diphosphate reductase activity, thioredoxin disulfide as acceptor(GO:0004748) oxidoreductase activity, acting on CH or CH2 groups, disulfide as acceptor(GO:0016728) ribonucleoside-diphosphate reductase activity(GO:0061731) |
0.4 | 1.1 | GO:0016149 | translation release factor activity, codon specific(GO:0016149) |
0.4 | 3.9 | GO:0033130 | acetylcholine receptor binding(GO:0033130) |
0.3 | 3.1 | GO:0022889 | L-serine transmembrane transporter activity(GO:0015194) serine transmembrane transporter activity(GO:0022889) |
0.3 | 1.0 | GO:0043533 | inositol 1,3,4,5 tetrakisphosphate binding(GO:0043533) |
0.3 | 1.0 | GO:0016842 | amidine-lyase activity(GO:0016842) |
0.3 | 0.3 | GO:0030911 | TPR domain binding(GO:0030911) |
0.3 | 1.7 | GO:0003828 | alpha-N-acetylneuraminate alpha-2,8-sialyltransferase activity(GO:0003828) |
0.3 | 1.0 | GO:0004416 | hydroxyacylglutathione hydrolase activity(GO:0004416) |
0.3 | 2.7 | GO:0004571 | mannosyl-oligosaccharide 1,2-alpha-mannosidase activity(GO:0004571) |
0.3 | 1.3 | GO:0031720 | haptoglobin binding(GO:0031720) |
0.3 | 4.6 | GO:0045295 | gamma-catenin binding(GO:0045295) |
0.3 | 1.0 | GO:0070699 | type II activin receptor binding(GO:0070699) |
0.3 | 2.3 | GO:0019957 | C-C chemokine binding(GO:0019957) |
0.3 | 1.6 | GO:0004468 | lysine N-acetyltransferase activity, acting on acetyl phosphate as donor(GO:0004468) |
0.3 | 4.2 | GO:0008601 | protein phosphatase type 2A regulator activity(GO:0008601) |
0.3 | 1.9 | GO:0008603 | cAMP-dependent protein kinase regulator activity(GO:0008603) |
0.3 | 1.9 | GO:0005166 | neurotrophin p75 receptor binding(GO:0005166) |
0.3 | 2.2 | GO:0005138 | interleukin-6 receptor binding(GO:0005138) |
0.3 | 1.0 | GO:0016647 | oxidoreductase activity, acting on the CH-NH group of donors, oxygen as acceptor(GO:0016647) |
0.3 | 1.3 | GO:0005375 | copper ion transmembrane transporter activity(GO:0005375) |
0.3 | 1.9 | GO:0004064 | arylesterase activity(GO:0004064) |
0.3 | 3.4 | GO:0008331 | high voltage-gated calcium channel activity(GO:0008331) |
0.3 | 0.9 | GO:0015142 | citrate transmembrane transporter activity(GO:0015137) tricarboxylic acid transmembrane transporter activity(GO:0015142) |
0.3 | 0.9 | GO:0030350 | iron-responsive element binding(GO:0030350) |
0.3 | 0.9 | GO:0003987 | acetate-CoA ligase activity(GO:0003987) |
0.3 | 1.2 | GO:0043262 | adenosine-diphosphatase activity(GO:0043262) |
0.3 | 0.3 | GO:0001226 | RNA polymerase II transcription corepressor binding(GO:0001226) |
0.3 | 1.5 | GO:0004726 | non-membrane spanning protein tyrosine phosphatase activity(GO:0004726) |
0.3 | 2.4 | GO:0102391 | decanoate--CoA ligase activity(GO:0102391) |
0.3 | 0.9 | GO:0016882 | cyclo-ligase activity(GO:0016882) |
0.3 | 0.9 | GO:0019862 | IgA binding(GO:0019862) |
0.3 | 1.8 | GO:0048495 | Roundabout binding(GO:0048495) |
0.3 | 1.2 | GO:0031852 | mu-type opioid receptor binding(GO:0031852) |
0.3 | 5.8 | GO:0017075 | syntaxin-1 binding(GO:0017075) |
0.3 | 2.9 | GO:0070679 | inositol 1,4,5 trisphosphate binding(GO:0070679) |
0.3 | 1.1 | GO:0032357 | oxidized DNA binding(GO:0032356) oxidized purine DNA binding(GO:0032357) |
0.3 | 0.3 | GO:0015185 | gamma-aminobutyric acid transmembrane transporter activity(GO:0015185) |
0.3 | 1.7 | GO:0016151 | nickel cation binding(GO:0016151) |
0.3 | 1.1 | GO:0016453 | acetyl-CoA C-acetyltransferase activity(GO:0003985) C-acetyltransferase activity(GO:0016453) |
0.3 | 1.9 | GO:0030957 | Tat protein binding(GO:0030957) |
0.3 | 1.1 | GO:0035184 | histone threonine kinase activity(GO:0035184) |
0.3 | 1.9 | GO:0004908 | interleukin-1 receptor activity(GO:0004908) |
0.3 | 1.1 | GO:0004370 | glycerol kinase activity(GO:0004370) |
0.3 | 0.8 | GO:0000171 | ribonuclease MRP activity(GO:0000171) |
0.3 | 1.8 | GO:0016907 | G-protein coupled acetylcholine receptor activity(GO:0016907) |
0.3 | 0.5 | GO:0015222 | serotonin transmembrane transporter activity(GO:0015222) |
0.3 | 1.5 | GO:0046624 | sphingolipid transporter activity(GO:0046624) |
0.2 | 1.2 | GO:0017040 | ceramidase activity(GO:0017040) |
0.2 | 2.0 | GO:0047372 | acylglycerol lipase activity(GO:0047372) |
0.2 | 1.0 | GO:0004849 | uridine kinase activity(GO:0004849) |
0.2 | 4.4 | GO:0004970 | ionotropic glutamate receptor activity(GO:0004970) |
0.2 | 1.0 | GO:0004694 | eukaryotic translation initiation factor 2alpha kinase activity(GO:0004694) |
0.2 | 0.5 | GO:0004127 | cytidylate kinase activity(GO:0004127) |
0.2 | 0.9 | GO:0043515 | kinetochore binding(GO:0043515) |
0.2 | 0.9 | GO:0008410 | CoA-transferase activity(GO:0008410) |
0.2 | 0.2 | GO:0008401 | retinoic acid 4-hydroxylase activity(GO:0008401) |
0.2 | 1.2 | GO:0001135 | transcription factor activity, RNA polymerase II transcription factor recruiting(GO:0001135) |
0.2 | 4.7 | GO:0043027 | cysteine-type endopeptidase inhibitor activity involved in apoptotic process(GO:0043027) |
0.2 | 1.4 | GO:0048406 | nerve growth factor binding(GO:0048406) |
0.2 | 1.8 | GO:0008599 | protein phosphatase type 1 regulator activity(GO:0008599) |
0.2 | 5.7 | GO:0004407 | histone deacetylase activity(GO:0004407) |
0.2 | 1.6 | GO:0048531 | beta-1,3-galactosyltransferase activity(GO:0048531) |
0.2 | 0.9 | GO:0004035 | alkaline phosphatase activity(GO:0004035) |
0.2 | 0.7 | GO:0047751 | 3-oxo-5-alpha-steroid 4-dehydrogenase activity(GO:0003865) cholestenone 5-alpha-reductase activity(GO:0047751) |
0.2 | 0.5 | GO:0032139 | dinucleotide insertion or deletion binding(GO:0032139) |
0.2 | 0.7 | GO:0051377 | mannose-ethanolamine phosphotransferase activity(GO:0051377) |
0.2 | 0.9 | GO:0008294 | calcium- and calmodulin-responsive adenylate cyclase activity(GO:0008294) |
0.2 | 0.7 | GO:0004813 | alanine-tRNA ligase activity(GO:0004813) |
0.2 | 3.3 | GO:0031210 | phosphatidylcholine binding(GO:0031210) |
0.2 | 1.1 | GO:0004887 | thyroid hormone receptor activity(GO:0004887) |
0.2 | 0.9 | GO:0016833 | oxo-acid-lyase activity(GO:0016833) |
0.2 | 0.9 | GO:0008349 | MAP kinase kinase kinase kinase activity(GO:0008349) |
0.2 | 0.6 | GO:0030158 | protein xylosyltransferase activity(GO:0030158) |
0.2 | 0.6 | GO:0008240 | tripeptidyl-peptidase activity(GO:0008240) |
0.2 | 0.6 | GO:0050815 | phosphoserine binding(GO:0050815) |
0.2 | 2.6 | GO:0035198 | miRNA binding(GO:0035198) |
0.2 | 0.2 | GO:0018423 | protein C-terminal leucine carboxyl O-methyltransferase activity(GO:0018423) |
0.2 | 0.8 | GO:0001642 | group III metabotropic glutamate receptor activity(GO:0001642) |
0.2 | 1.1 | GO:0086080 | protein binding involved in heterotypic cell-cell adhesion(GO:0086080) |
0.2 | 0.6 | GO:0031686 | A1 adenosine receptor binding(GO:0031686) |
0.2 | 2.7 | GO:0005092 | GDP-dissociation inhibitor activity(GO:0005092) |
0.2 | 1.9 | GO:0016920 | pyroglutamyl-peptidase activity(GO:0016920) |
0.2 | 0.2 | GO:0016274 | arginine N-methyltransferase activity(GO:0016273) protein-arginine N-methyltransferase activity(GO:0016274) |
0.2 | 1.0 | GO:0035473 | lipase binding(GO:0035473) |
0.2 | 4.1 | GO:0035255 | ionotropic glutamate receptor binding(GO:0035255) |
0.2 | 3.5 | GO:0035254 | glutamate receptor binding(GO:0035254) |
0.2 | 1.6 | GO:0043522 | leucine zipper domain binding(GO:0043522) |
0.2 | 2.2 | GO:0015129 | lactate transmembrane transporter activity(GO:0015129) |
0.2 | 1.0 | GO:0031849 | olfactory receptor binding(GO:0031849) |
0.2 | 3.2 | GO:0004708 | MAP kinase kinase activity(GO:0004708) |
0.2 | 2.0 | GO:0035613 | RNA stem-loop binding(GO:0035613) |
0.2 | 1.6 | GO:0016861 | intramolecular oxidoreductase activity, interconverting aldoses and ketoses(GO:0016861) |
0.2 | 0.8 | GO:0005127 | ciliary neurotrophic factor receptor binding(GO:0005127) |
0.2 | 0.6 | GO:0004477 | methenyltetrahydrofolate cyclohydrolase activity(GO:0004477) methylenetetrahydrofolate dehydrogenase (NAD+) activity(GO:0004487) |
0.2 | 0.8 | GO:0005250 | A-type (transient outward) potassium channel activity(GO:0005250) |
0.2 | 0.4 | GO:0098632 | protein binding involved in cell-cell adhesion(GO:0098632) |
0.2 | 1.2 | GO:0015037 | peptide disulfide oxidoreductase activity(GO:0015037) |
0.2 | 1.5 | GO:0046933 | proton-transporting ATP synthase activity, rotational mechanism(GO:0046933) |
0.2 | 0.4 | GO:0097001 | ceramide binding(GO:0097001) |
0.2 | 0.8 | GO:0070053 | thrombospondin receptor activity(GO:0070053) |
0.2 | 0.8 | GO:0000104 | succinate dehydrogenase activity(GO:0000104) |
0.2 | 0.4 | GO:0015563 | uptake transmembrane transporter activity(GO:0015563) |
0.2 | 1.3 | GO:0046790 | virion binding(GO:0046790) |
0.2 | 2.1 | GO:0005283 | sodium:amino acid symporter activity(GO:0005283) |
0.2 | 0.6 | GO:0005087 | Ran guanyl-nucleotide exchange factor activity(GO:0005087) |
0.2 | 0.7 | GO:0070815 | peptidyl-lysine 5-dioxygenase activity(GO:0070815) |
0.2 | 0.6 | GO:0008515 | sucrose:proton symporter activity(GO:0008506) sucrose transmembrane transporter activity(GO:0008515) disaccharide transmembrane transporter activity(GO:0015154) oligosaccharide transmembrane transporter activity(GO:0015157) |
0.2 | 0.7 | GO:0070728 | leucine binding(GO:0070728) |
0.2 | 0.5 | GO:0004739 | pyruvate dehydrogenase (acetyl-transferring) activity(GO:0004739) |
0.2 | 1.1 | GO:0005004 | GPI-linked ephrin receptor activity(GO:0005004) |
0.2 | 0.7 | GO:0034190 | apolipoprotein receptor binding(GO:0034190) |
0.2 | 6.0 | GO:0015459 | potassium channel regulator activity(GO:0015459) |
0.2 | 0.5 | GO:0018598 | mono-butyltin dioxygenase activity(GO:0018586) tri-n-butyltin dioxygenase activity(GO:0018588) di-n-butyltin dioxygenase activity(GO:0018589) methylsilanetriol hydroxylase activity(GO:0018590) methyl tertiary butyl ether 3-monooxygenase activity(GO:0018591) 4-nitrocatechol 4-monooxygenase activity(GO:0018592) 4-chlorophenoxyacetate monooxygenase activity(GO:0018593) tert-butanol 2-monooxygenase activity(GO:0018594) alpha-pinene monooxygenase activity(GO:0018595) dimethylsilanediol hydroxylase activity(GO:0018596) ammonia monooxygenase activity(GO:0018597) hydroxymethylsilanetriol oxidase activity(GO:0018598) 2-hydroxyisobutyrate 3-monooxygenase activity(GO:0018599) alpha-pinene dehydrogenase activity(GO:0018600) bisphenol A hydroxylase B activity(GO:0034559) 2,2-bis(4-hydroxyphenyl)-1-propanol hydroxylase activity(GO:0034562) 9-fluorenone-3,4-dioxygenase activity(GO:0034786) anthracene 9,10-dioxygenase activity(GO:0034816) 2-(methylthio)benzothiazole monooxygenase activity(GO:0034857) 2-hydroxybenzothiazole monooxygenase activity(GO:0034858) benzothiazole monooxygenase activity(GO:0034859) 2,6-dihydroxybenzothiazole monooxygenase activity(GO:0034862) pinacolone 5-monooxygenase activity(GO:0034870) thioacetamide S-oxygenase activity(GO:0034873) thioacetamide S-oxide S-oxygenase activity(GO:0034874) endosulfan monooxygenase I activity(GO:0034888) N-nitrodimethylamine hydroxylase activity(GO:0034893) 4-(1-ethyl-1,4-dimethyl-pentyl)phenol monoxygenase activity(GO:0034897) endosulfan ether monooxygenase activity(GO:0034903) pyrene 4,5-monooxygenase activity(GO:0034925) pyrene 1,2-monooxygenase activity(GO:0034927) 1-hydroxypyrene 6,7-monooxygenase activity(GO:0034928) 1-hydroxypyrene 7,8-monooxygenase activity(GO:0034929) phenylboronic acid monooxygenase activity(GO:0034950) spheroidene monooxygenase activity(GO:0043823) |
0.2 | 0.9 | GO:0031628 | opioid receptor binding(GO:0031628) |
0.2 | 0.2 | GO:0061676 | importin-alpha family protein binding(GO:0061676) |
0.2 | 1.0 | GO:0016595 | glutamate binding(GO:0016595) |
0.2 | 1.7 | GO:0016884 | carbon-nitrogen ligase activity, with glutamine as amido-N-donor(GO:0016884) |
0.2 | 1.0 | GO:0032027 | myosin light chain binding(GO:0032027) |
0.2 | 2.6 | GO:0005229 | intracellular calcium activated chloride channel activity(GO:0005229) |
0.2 | 0.5 | GO:0016309 | 1-phosphatidylinositol-5-phosphate 4-kinase activity(GO:0016309) |
0.2 | 0.7 | GO:0004594 | pantothenate kinase activity(GO:0004594) |
0.2 | 1.7 | GO:0004983 | neuropeptide Y receptor activity(GO:0004983) |
0.2 | 0.2 | GO:0015087 | cobalt ion transmembrane transporter activity(GO:0015087) |
0.2 | 2.7 | GO:0035259 | glucocorticoid receptor binding(GO:0035259) |
0.2 | 0.5 | GO:0019166 | trans-2-enoyl-CoA reductase (NADPH) activity(GO:0019166) |
0.2 | 1.3 | GO:0004779 | sulfate adenylyltransferase activity(GO:0004779) |
0.2 | 1.2 | GO:0005237 | inhibitory extracellular ligand-gated ion channel activity(GO:0005237) |
0.2 | 1.0 | GO:0002054 | nucleobase binding(GO:0002054) |
0.2 | 0.7 | GO:0051185 | coenzyme transporter activity(GO:0051185) |
0.2 | 0.3 | GO:0000405 | bubble DNA binding(GO:0000405) |
0.2 | 1.3 | GO:0009931 | calcium-dependent protein serine/threonine kinase activity(GO:0009931) |
0.2 | 0.8 | GO:0004791 | thioredoxin-disulfide reductase activity(GO:0004791) |
0.2 | 0.7 | GO:0047631 | ADP-ribose diphosphatase activity(GO:0047631) |
0.2 | 0.5 | GO:0033265 | choline binding(GO:0033265) |
0.2 | 6.3 | GO:0016876 | ligase activity, forming carbon-oxygen bonds(GO:0016875) ligase activity, forming aminoacyl-tRNA and related compounds(GO:0016876) |
0.2 | 1.4 | GO:0016846 | carbon-sulfur lyase activity(GO:0016846) |
0.2 | 1.1 | GO:0050291 | sphingosine N-acyltransferase activity(GO:0050291) |
0.2 | 0.5 | GO:0016668 | oxidoreductase activity, acting on a sulfur group of donors, NAD(P) as acceptor(GO:0016668) |
0.2 | 0.9 | GO:0017128 | phospholipid scramblase activity(GO:0017128) |
0.2 | 1.4 | GO:0016857 | racemase and epimerase activity, acting on carbohydrates and derivatives(GO:0016857) |
0.2 | 0.3 | GO:0004027 | alcohol sulfotransferase activity(GO:0004027) |
0.2 | 0.3 | GO:0015186 | L-asparagine transmembrane transporter activity(GO:0015182) L-glutamine transmembrane transporter activity(GO:0015186) |
0.2 | 0.8 | GO:0051959 | dynein light intermediate chain binding(GO:0051959) |
0.2 | 0.3 | GO:0005047 | signal recognition particle binding(GO:0005047) |
0.1 | 1.8 | GO:0043176 | amine binding(GO:0043176) |
0.1 | 0.6 | GO:0050693 | LBD domain binding(GO:0050693) |
0.1 | 1.2 | GO:0016634 | oxidoreductase activity, acting on the CH-CH group of donors, oxygen as acceptor(GO:0016634) |
0.1 | 0.4 | GO:1904288 | BAT3 complex binding(GO:1904288) |
0.1 | 2.5 | GO:0050997 | quaternary ammonium group binding(GO:0050997) |
0.1 | 0.6 | GO:0016972 | thiol oxidase activity(GO:0016972) |
0.1 | 0.7 | GO:0004565 | beta-galactosidase activity(GO:0004565) |
0.1 | 6.7 | GO:0035064 | methylated histone binding(GO:0035064) |
0.1 | 0.4 | GO:0003986 | acetyl-CoA hydrolase activity(GO:0003986) |
0.1 | 2.6 | GO:0008198 | ferrous iron binding(GO:0008198) |
0.1 | 0.9 | GO:0008517 | folic acid transporter activity(GO:0008517) |
0.1 | 2.7 | GO:0070530 | K63-linked polyubiquitin binding(GO:0070530) |
0.1 | 0.7 | GO:0009378 | four-way junction helicase activity(GO:0009378) |
0.1 | 4.6 | GO:0005484 | SNAP receptor activity(GO:0005484) |
0.1 | 1.0 | GO:0003836 | beta-galactoside (CMP) alpha-2,3-sialyltransferase activity(GO:0003836) |
0.1 | 0.6 | GO:0052832 | inositol monophosphate 1-phosphatase activity(GO:0008934) inositol monophosphate 3-phosphatase activity(GO:0052832) inositol monophosphate 4-phosphatase activity(GO:0052833) inositol monophosphate phosphatase activity(GO:0052834) |
0.1 | 0.4 | GO:0070087 | chromo shadow domain binding(GO:0070087) |
0.1 | 0.8 | GO:0008190 | eukaryotic initiation factor 4E binding(GO:0008190) |
0.1 | 0.7 | GO:0004634 | phosphopyruvate hydratase activity(GO:0004634) |
0.1 | 3.0 | GO:0071837 | HMG box domain binding(GO:0071837) |
0.1 | 0.4 | GO:0016854 | racemase and epimerase activity(GO:0016854) |
0.1 | 0.8 | GO:0004169 | dolichyl-phosphate-mannose-protein mannosyltransferase activity(GO:0004169) |
0.1 | 0.4 | GO:0070137 | ubiquitin-like protein-specific endopeptidase activity(GO:0070137) SUMO-specific endopeptidase activity(GO:0070139) |
0.1 | 0.4 | GO:0004611 | phosphoenolpyruvate carboxykinase activity(GO:0004611) |
0.1 | 0.3 | GO:0051765 | inositol tetrakisphosphate kinase activity(GO:0051765) |
0.1 | 0.8 | GO:0004534 | 5'-3' exoribonuclease activity(GO:0004534) |
0.1 | 0.3 | GO:0030144 | alpha-1,6-mannosylglycoprotein 6-beta-N-acetylglucosaminyltransferase activity(GO:0030144) |
0.1 | 2.6 | GO:0008139 | nuclear localization sequence binding(GO:0008139) |
0.1 | 0.5 | GO:0015467 | G-protein activated inward rectifier potassium channel activity(GO:0015467) |
0.1 | 0.9 | GO:0005315 | inorganic phosphate transmembrane transporter activity(GO:0005315) |
0.1 | 1.2 | GO:0005003 | ephrin receptor activity(GO:0005003) |
0.1 | 0.5 | GO:0008823 | cupric reductase activity(GO:0008823) ferric-chelate reductase (NADPH) activity(GO:0052851) |
0.1 | 1.8 | GO:0016500 | protein-hormone receptor activity(GO:0016500) |
0.1 | 0.4 | GO:0008046 | axon guidance receptor activity(GO:0008046) |
0.1 | 2.7 | GO:0043015 | gamma-tubulin binding(GO:0043015) |
0.1 | 0.4 | GO:0016802 | adenosylhomocysteinase activity(GO:0004013) trialkylsulfonium hydrolase activity(GO:0016802) |
0.1 | 0.3 | GO:0035673 | oligopeptide transmembrane transporter activity(GO:0035673) |
0.1 | 0.5 | GO:0097157 | pre-mRNA intronic binding(GO:0097157) |
0.1 | 0.3 | GO:0004690 | cyclic nucleotide-dependent protein kinase activity(GO:0004690) |
0.1 | 1.8 | GO:0016661 | oxidoreductase activity, acting on other nitrogenous compounds as donors(GO:0016661) |
0.1 | 2.0 | GO:0031492 | nucleosomal DNA binding(GO:0031492) |
0.1 | 0.4 | GO:0000386 | second spliceosomal transesterification activity(GO:0000386) |
0.1 | 0.1 | GO:0031493 | nucleosomal histone binding(GO:0031493) |
0.1 | 1.1 | GO:0003689 | DNA clamp loader activity(GO:0003689) protein-DNA loading ATPase activity(GO:0033170) |
0.1 | 0.4 | GO:0004771 | sterol esterase activity(GO:0004771) |
0.1 | 1.4 | GO:0016863 | intramolecular oxidoreductase activity, transposing C=C bonds(GO:0016863) |
0.1 | 0.4 | GO:0030621 | U4 snRNA binding(GO:0030621) |
0.1 | 2.3 | GO:0017025 | TBP-class protein binding(GO:0017025) |
0.1 | 0.4 | GO:0005219 | ryanodine-sensitive calcium-release channel activity(GO:0005219) |
0.1 | 1.3 | GO:0004535 | poly(A)-specific ribonuclease activity(GO:0004535) |
0.1 | 1.4 | GO:0001618 | virus receptor activity(GO:0001618) |
0.1 | 0.8 | GO:0033691 | sialic acid binding(GO:0033691) |
0.1 | 0.5 | GO:0038064 | collagen receptor activity(GO:0038064) |
0.1 | 0.2 | GO:0015562 | efflux transmembrane transporter activity(GO:0015562) |
0.1 | 2.2 | GO:0031593 | polyubiquitin binding(GO:0031593) |
0.1 | 1.8 | GO:0022840 | leak channel activity(GO:0022840) narrow pore channel activity(GO:0022842) |
0.1 | 1.1 | GO:0001055 | RNA polymerase II activity(GO:0001055) |
0.1 | 0.6 | GO:0004994 | somatostatin receptor activity(GO:0004994) |
0.1 | 1.0 | GO:0032296 | ribonuclease III activity(GO:0004525) double-stranded RNA-specific ribonuclease activity(GO:0032296) |
0.1 | 3.5 | GO:0000049 | tRNA binding(GO:0000049) |
0.1 | 0.4 | GO:0004839 | ubiquitin activating enzyme activity(GO:0004839) |
0.1 | 0.6 | GO:0046935 | 1-phosphatidylinositol-3-kinase regulator activity(GO:0046935) |
0.1 | 2.3 | GO:0030742 | GTP-dependent protein binding(GO:0030742) |
0.1 | 1.7 | GO:0004653 | polypeptide N-acetylgalactosaminyltransferase activity(GO:0004653) |
0.1 | 0.2 | GO:0015183 | L-aspartate transmembrane transporter activity(GO:0015183) |
0.1 | 1.4 | GO:0070577 | lysine-acetylated histone binding(GO:0070577) |
0.1 | 0.4 | GO:0003917 | DNA topoisomerase type I activity(GO:0003917) |
0.1 | 0.4 | GO:0008502 | melatonin receptor activity(GO:0008502) |
0.1 | 0.1 | GO:0018585 | fluorene oxygenase activity(GO:0018585) |
0.1 | 1.2 | GO:0008195 | phosphatidate phosphatase activity(GO:0008195) |
0.1 | 0.4 | GO:0016004 | phospholipase activator activity(GO:0016004) |
0.1 | 4.4 | GO:0043022 | ribosome binding(GO:0043022) |
0.1 | 0.1 | GO:0016262 | protein N-acetylglucosaminyltransferase activity(GO:0016262) |
0.1 | 0.2 | GO:0070840 | dynein complex binding(GO:0070840) |
0.1 | 0.7 | GO:0019206 | nucleoside kinase activity(GO:0019206) |
0.1 | 0.3 | GO:0019869 | chloride channel inhibitor activity(GO:0019869) |
0.1 | 0.4 | GO:0030292 | protein tyrosine kinase inhibitor activity(GO:0030292) |
0.1 | 0.4 | GO:0005173 | stem cell factor receptor binding(GO:0005173) |
0.1 | 0.2 | GO:0043140 | ATP-dependent 3'-5' DNA helicase activity(GO:0043140) |
0.1 | 0.3 | GO:0008900 | hydrogen:potassium-exchanging ATPase activity(GO:0008900) |
0.1 | 20.0 | GO:0003735 | structural constituent of ribosome(GO:0003735) |
0.1 | 0.2 | GO:0097371 | MDM2/MDM4 family protein binding(GO:0097371) |
0.1 | 0.5 | GO:0030291 | protein serine/threonine kinase inhibitor activity(GO:0030291) |
0.1 | 0.4 | GO:0043138 | 3'-5' DNA helicase activity(GO:0043138) |
0.1 | 0.2 | GO:0005346 | adenine nucleotide transmembrane transporter activity(GO:0000295) purine ribonucleotide transmembrane transporter activity(GO:0005346) purine nucleotide transmembrane transporter activity(GO:0015216) |
0.1 | 0.5 | GO:0015204 | urea transmembrane transporter activity(GO:0015204) |
0.1 | 2.0 | GO:0008137 | NADH dehydrogenase (ubiquinone) activity(GO:0008137) NADH dehydrogenase (quinone) activity(GO:0050136) |
0.1 | 0.3 | GO:0035529 | NADH pyrophosphatase activity(GO:0035529) |
0.1 | 0.3 | GO:1901702 | urate transmembrane transporter activity(GO:0015143) salt transmembrane transporter activity(GO:1901702) |
0.1 | 0.4 | GO:0004985 | opioid receptor activity(GO:0004985) |
0.1 | 1.5 | GO:0015035 | protein disulfide oxidoreductase activity(GO:0015035) |
0.1 | 0.7 | GO:0003688 | DNA replication origin binding(GO:0003688) |
0.1 | 1.4 | GO:0016646 | oxidoreductase activity, acting on the CH-NH group of donors, NAD or NADP as acceptor(GO:0016646) |
0.1 | 2.4 | GO:0030507 | spectrin binding(GO:0030507) |
0.1 | 0.9 | GO:0016886 | ligase activity, forming phosphoric ester bonds(GO:0016886) |
0.1 | 0.3 | GO:0070569 | uridylyltransferase activity(GO:0070569) |
0.1 | 0.2 | GO:0001884 | pyrimidine nucleoside binding(GO:0001884) UTP binding(GO:0002134) pyrimidine ribonucleoside binding(GO:0032551) |
0.1 | 0.9 | GO:0042043 | neurexin family protein binding(GO:0042043) |
0.1 | 1.6 | GO:0004890 | GABA-A receptor activity(GO:0004890) |
0.1 | 2.5 | GO:0016538 | cyclin-dependent protein serine/threonine kinase regulator activity(GO:0016538) |
0.1 | 0.4 | GO:0015173 | aromatic amino acid transmembrane transporter activity(GO:0015173) |
0.1 | 1.4 | GO:0005487 | nucleocytoplasmic transporter activity(GO:0005487) |
0.1 | 1.1 | GO:0008574 | ATP-dependent microtubule motor activity, plus-end-directed(GO:0008574) |
0.1 | 1.2 | GO:0016290 | palmitoyl-CoA hydrolase activity(GO:0016290) |
0.1 | 0.5 | GO:0000014 | single-stranded DNA endodeoxyribonuclease activity(GO:0000014) |
0.1 | 0.4 | GO:0042301 | phosphate ion binding(GO:0042301) |
0.1 | 0.1 | GO:0000403 | Y-form DNA binding(GO:0000403) |
0.1 | 0.3 | GO:0001537 | N-acetylgalactosamine 4-O-sulfotransferase activity(GO:0001537) |
0.1 | 0.3 | GO:0016508 | long-chain-enoyl-CoA hydratase activity(GO:0016508) |
0.1 | 0.4 | GO:0098988 | G-protein coupled glutamate receptor activity(GO:0098988) |
0.1 | 1.2 | GO:0070035 | ATP-dependent helicase activity(GO:0008026) purine NTP-dependent helicase activity(GO:0070035) |
0.1 | 1.0 | GO:0016805 | dipeptidase activity(GO:0016805) |
0.1 | 3.6 | GO:0008235 | metalloexopeptidase activity(GO:0008235) |
0.1 | 0.5 | GO:0031730 | CCR5 chemokine receptor binding(GO:0031730) |
0.1 | 0.4 | GO:0004614 | phosphoglucomutase activity(GO:0004614) |
0.1 | 0.9 | GO:0036218 | thiamine-pyrophosphatase activity(GO:0004787) UDP-2,3-diacylglucosamine hydrolase activity(GO:0008758) dATP pyrophosphohydrolase activity(GO:0008828) dihydroneopterin monophosphate phosphatase activity(GO:0019176) dihydroneopterin triphosphate pyrophosphohydrolase activity(GO:0019177) dTTP diphosphatase activity(GO:0036218) phosphocholine hydrolase activity(GO:0044606) |
0.1 | 0.4 | GO:0003906 | DNA-(apurinic or apyrimidinic site) lyase activity(GO:0003906) |
0.1 | 0.3 | GO:0030984 | kininogen binding(GO:0030984) |
0.1 | 0.7 | GO:0017056 | structural constituent of nuclear pore(GO:0017056) |
0.1 | 0.5 | GO:0015165 | pyrimidine nucleotide-sugar transmembrane transporter activity(GO:0015165) |
0.1 | 1.3 | GO:0004602 | glutathione peroxidase activity(GO:0004602) |
0.1 | 0.4 | GO:0052650 | NADP-retinol dehydrogenase activity(GO:0052650) |
0.1 | 0.4 | GO:0019211 | phosphatase activator activity(GO:0019211) |
0.1 | 0.3 | GO:0030297 | transmembrane receptor protein tyrosine kinase activator activity(GO:0030297) |
0.1 | 0.5 | GO:0032050 | clathrin heavy chain binding(GO:0032050) |
0.1 | 0.2 | GO:0004645 | phosphorylase activity(GO:0004645) |
0.1 | 0.2 | GO:0004359 | glutaminase activity(GO:0004359) |
0.1 | 0.3 | GO:0072345 | NAADP-sensitive calcium-release channel activity(GO:0072345) |
0.1 | 0.3 | GO:0008559 | xenobiotic-transporting ATPase activity(GO:0008559) |
0.1 | 0.1 | GO:0051880 | G-quadruplex DNA binding(GO:0051880) |
0.1 | 0.5 | GO:0098505 | single-stranded telomeric DNA binding(GO:0043047) G-rich strand telomeric DNA binding(GO:0098505) |
0.1 | 0.1 | GO:0070538 | oleic acid binding(GO:0070538) |
0.1 | 0.2 | GO:0015215 | nucleotide-sugar transmembrane transporter activity(GO:0005338) nucleotide transmembrane transporter activity(GO:0015215) |
0.1 | 1.0 | GO:0009982 | pseudouridine synthase activity(GO:0009982) |
0.1 | 0.3 | GO:0019864 | IgG binding(GO:0019864) |
0.1 | 0.3 | GO:0071987 | WD40-repeat domain binding(GO:0071987) |
0.1 | 0.4 | GO:0016594 | glycine binding(GO:0016594) |
0.1 | 0.3 | GO:0031404 | chloride ion binding(GO:0031404) |
0.1 | 0.2 | GO:0034040 | lipid-transporting ATPase activity(GO:0034040) |
0.1 | 0.2 | GO:2001069 | glycogen binding(GO:2001069) |
0.1 | 1.9 | GO:0051059 | NF-kappaB binding(GO:0051059) |
0.1 | 0.2 | GO:0004126 | cytidine deaminase activity(GO:0004126) |
0.1 | 0.4 | GO:0099589 | G-protein coupled serotonin receptor activity(GO:0004993) serotonin receptor activity(GO:0099589) |
0.1 | 0.7 | GO:0004438 | phosphatidylinositol-3-phosphatase activity(GO:0004438) |
0.1 | 1.2 | GO:0031369 | translation initiation factor binding(GO:0031369) |
0.1 | 0.3 | GO:0016889 | endodeoxyribonuclease activity, producing 3'-phosphomonoesters(GO:0016889) |
0.1 | 0.2 | GO:0005519 | cytoskeletal regulatory protein binding(GO:0005519) |
0.1 | 0.6 | GO:0016888 | endodeoxyribonuclease activity, producing 5'-phosphomonoesters(GO:0016888) |
0.1 | 1.9 | GO:0045502 | dynein binding(GO:0045502) |
0.1 | 0.3 | GO:1990226 | histone methyltransferase binding(GO:1990226) |
0.1 | 0.4 | GO:0030492 | hemoglobin binding(GO:0030492) |
0.1 | 0.9 | GO:0030881 | beta-2-microglobulin binding(GO:0030881) |
0.1 | 1.6 | GO:0005086 | ARF guanyl-nucleotide exchange factor activity(GO:0005086) |
0.1 | 1.3 | GO:0005035 | tumor necrosis factor-activated receptor activity(GO:0005031) death receptor activity(GO:0005035) |
0.1 | 4.6 | GO:0004004 | RNA helicase activity(GO:0003724) ATP-dependent RNA helicase activity(GO:0004004) RNA-dependent ATPase activity(GO:0008186) |
0.1 | 0.4 | GO:0042015 | interleukin-20 binding(GO:0042015) |
0.1 | 4.1 | GO:0003697 | single-stranded DNA binding(GO:0003697) |
0.1 | 0.3 | GO:0003916 | DNA topoisomerase activity(GO:0003916) |
0.1 | 0.4 | GO:0043023 | ribosomal large subunit binding(GO:0043023) |
0.1 | 0.3 | GO:0008138 | protein tyrosine/serine/threonine phosphatase activity(GO:0008138) |
0.1 | 0.3 | GO:0032453 | histone demethylase activity (H3-K4 specific)(GO:0032453) |
0.1 | 0.2 | GO:0047192 | 1-alkylglycerophosphocholine O-acetyltransferase activity(GO:0047192) |
0.1 | 0.6 | GO:0044653 | dextrin alpha-glucosidase activity(GO:0044653) starch alpha-glucosidase activity(GO:0044654) beta-glucanase activity(GO:0052736) beta-6-sulfate-N-acetylglucosaminidase activity(GO:0052769) glucan endo-1,4-beta-glucosidase activity(GO:0052859) |
0.1 | 0.4 | GO:0000268 | peroxisome targeting sequence binding(GO:0000268) |
0.1 | 0.5 | GO:0070628 | proteasome binding(GO:0070628) |
0.1 | 0.2 | GO:0050072 | m7G(5')pppN diphosphatase activity(GO:0050072) |
0.1 | 0.8 | GO:0008353 | RNA polymerase II carboxy-terminal domain kinase activity(GO:0008353) |
0.1 | 0.4 | GO:0103116 | alpha-D-galactofuranose transporter activity(GO:0103116) |
0.1 | 0.2 | GO:0045545 | syndecan binding(GO:0045545) |
0.1 | 0.1 | GO:0019961 | interferon binding(GO:0019961) |
0.1 | 0.5 | GO:0004596 | peptide alpha-N-acetyltransferase activity(GO:0004596) |
0.1 | 0.7 | GO:0015386 | sodium:proton antiporter activity(GO:0015385) potassium:proton antiporter activity(GO:0015386) |
0.1 | 0.3 | GO:0030235 | nitric-oxide synthase regulator activity(GO:0030235) |
0.1 | 0.2 | GO:0047961 | glycine N-acyltransferase activity(GO:0047961) |
0.1 | 0.7 | GO:0008327 | methyl-CpG binding(GO:0008327) |
0.1 | 0.4 | GO:0004016 | adenylate cyclase activity(GO:0004016) |
0.1 | 0.2 | GO:0004366 | glycerol-3-phosphate O-acyltransferase activity(GO:0004366) |
0.1 | 0.2 | GO:0050501 | hyaluronan synthase activity(GO:0050501) |
0.1 | 0.2 | GO:0003876 | AMP deaminase activity(GO:0003876) adenosine-phosphate deaminase activity(GO:0047623) |
0.1 | 0.5 | GO:0008469 | histone-arginine N-methyltransferase activity(GO:0008469) |
0.1 | 0.2 | GO:0032184 | SUMO polymer binding(GO:0032184) |
0.1 | 0.5 | GO:0031491 | nucleosome binding(GO:0031491) |
0.1 | 0.3 | GO:0017176 | phosphatidylinositol N-acetylglucosaminyltransferase activity(GO:0017176) |
0.1 | 0.1 | GO:0008409 | 5'-3' exonuclease activity(GO:0008409) |
0.1 | 0.2 | GO:0017070 | U6 snRNA binding(GO:0017070) |
0.1 | 0.9 | GO:0051537 | 2 iron, 2 sulfur cluster binding(GO:0051537) |
0.1 | 1.4 | GO:0032867 | C-3 sterol dehydrogenase (C-4 sterol decarboxylase) activity(GO:0000252) mevaldate reductase activity(GO:0004495) gluconate dehydrogenase activity(GO:0008875) epoxide dehydrogenase activity(GO:0018451) 5-exo-hydroxycamphor dehydrogenase activity(GO:0018452) 2-hydroxytetrahydrofuran dehydrogenase activity(GO:0018453) acetoin dehydrogenase activity(GO:0019152) phenylcoumaran benzylic ether reductase activity(GO:0032442) D-xylose:NADP reductase activity(GO:0032866) L-arabinose:NADP reductase activity(GO:0032867) D-arabinitol dehydrogenase, D-ribulose forming (NADP+) activity(GO:0033709) (R)-(-)-1,2,3,4-tetrahydronaphthol dehydrogenase activity(GO:0034831) 3-hydroxymenthone dehydrogenase activity(GO:0034840) very long-chain-3-hydroxyacyl-CoA dehydrogenase activity(GO:0035380) (R)-2-hydroxyisocaproate dehydrogenase activity(GO:0043713) L-arabinose 1-dehydrogenase (NADP+) activity(GO:0044103) L-xylulose reductase (NAD+) activity(GO:0044105) 3-ketoglucose-reductase activity(GO:0048258) D-arabinitol dehydrogenase, D-xylulose forming (NADP+) activity(GO:0052677) |
0.1 | 0.2 | GO:0019776 | Atg8 ligase activity(GO:0019776) |
0.1 | 0.3 | GO:0008312 | 7S RNA binding(GO:0008312) |
0.1 | 0.1 | GO:0004663 | Rab geranylgeranyltransferase activity(GO:0004663) |
0.1 | 1.0 | GO:0019003 | GDP binding(GO:0019003) |
0.1 | 0.3 | GO:0043237 | laminin-1 binding(GO:0043237) |
0.1 | 0.3 | GO:0004430 | 1-phosphatidylinositol 4-kinase activity(GO:0004430) |
0.1 | 0.1 | GO:0030983 | mismatched DNA binding(GO:0030983) |
0.1 | 0.2 | GO:0016774 | phosphotransferase activity, carboxyl group as acceptor(GO:0016774) |
0.1 | 0.7 | GO:0008376 | acetylgalactosaminyltransferase activity(GO:0008376) |
0.1 | 0.3 | GO:0004566 | beta-glucuronidase activity(GO:0004566) |
0.1 | 1.3 | GO:0015002 | cytochrome-c oxidase activity(GO:0004129) heme-copper terminal oxidase activity(GO:0015002) oxidoreductase activity, acting on a heme group of donors, oxygen as acceptor(GO:0016676) |
0.1 | 0.4 | GO:0035612 | AP-2 adaptor complex binding(GO:0035612) |
0.1 | 2.4 | GO:0030971 | receptor tyrosine kinase binding(GO:0030971) |
0.1 | 0.2 | GO:0005167 | neurotrophin receptor binding(GO:0005165) neurotrophin TRK receptor binding(GO:0005167) |
0.1 | 0.2 | GO:0034452 | dynactin binding(GO:0034452) |
0.1 | 0.4 | GO:0043995 | histone acetyltransferase activity (H4-K5 specific)(GO:0043995) histone acetyltransferase activity (H4-K8 specific)(GO:0043996) histone acetyltransferase activity (H4-K16 specific)(GO:0046972) |
0.1 | 0.2 | GO:0004652 | polynucleotide adenylyltransferase activity(GO:0004652) |
0.1 | 0.4 | GO:0047035 | testosterone dehydrogenase (NAD+) activity(GO:0047035) |
0.1 | 0.3 | GO:0005432 | calcium:sodium antiporter activity(GO:0005432) |
0.1 | 0.1 | GO:0004676 | 3-phosphoinositide-dependent protein kinase activity(GO:0004676) |
0.1 | 0.7 | GO:0016813 | hydrolase activity, acting on carbon-nitrogen (but not peptide) bonds, in linear amidines(GO:0016813) |
0.1 | 0.3 | GO:0047429 | nucleoside-triphosphate diphosphatase activity(GO:0047429) |
0.1 | 0.4 | GO:0015269 | calcium-activated potassium channel activity(GO:0015269) |
0.1 | 0.5 | GO:0050786 | RAGE receptor binding(GO:0050786) |
0.1 | 0.5 | GO:0042923 | neuropeptide binding(GO:0042923) |
0.1 | 0.9 | GO:0001103 | RNA polymerase II repressing transcription factor binding(GO:0001103) |
0.1 | 0.1 | GO:0008379 | thioredoxin peroxidase activity(GO:0008379) |
0.1 | 0.2 | GO:0004449 | isocitrate dehydrogenase (NAD+) activity(GO:0004449) |
0.1 | 0.7 | GO:0019841 | retinol binding(GO:0019841) |
0.1 | 0.1 | GO:0070324 | thyroid hormone binding(GO:0070324) |
0.1 | 0.5 | GO:0019531 | oxalate transmembrane transporter activity(GO:0019531) |
0.1 | 0.5 | GO:0016929 | SUMO-specific protease activity(GO:0016929) |
0.1 | 1.2 | GO:0008579 | JUN kinase phosphatase activity(GO:0008579) |
0.1 | 0.5 | GO:0009975 | cyclase activity(GO:0009975) |
0.1 | 0.2 | GO:0043559 | insulin binding(GO:0043559) |
0.1 | 0.3 | GO:0070095 | fructose-6-phosphate binding(GO:0070095) |
0.1 | 0.2 | GO:0005384 | manganese ion transmembrane transporter activity(GO:0005384) |
0.1 | 0.2 | GO:0005042 | netrin receptor activity(GO:0005042) |
0.1 | 0.1 | GO:0042731 | PH domain binding(GO:0042731) |
0.1 | 1.2 | GO:0004364 | glutathione transferase activity(GO:0004364) |
0.1 | 0.5 | GO:0003905 | alkylbase DNA N-glycosylase activity(GO:0003905) DNA-3-methylbase glycosylase activity(GO:0043733) |
0.1 | 0.2 | GO:0004792 | thiosulfate sulfurtransferase activity(GO:0004792) |
0.1 | 0.1 | GO:0004703 | G-protein coupled receptor kinase activity(GO:0004703) |
0.1 | 0.1 | GO:1990430 | extracellular matrix protein binding(GO:1990430) |
0.1 | 2.4 | GO:0034483 | heparan sulfate sulfotransferase activity(GO:0034483) |
0.1 | 3.8 | GO:0008175 | tRNA methyltransferase activity(GO:0008175) |
0.1 | 0.2 | GO:0000828 | inositol hexakisphosphate kinase activity(GO:0000828) inositol hexakisphosphate 5-kinase activity(GO:0000832) inositol hexakisphosphate 1-kinase activity(GO:0052723) inositol hexakisphosphate 3-kinase activity(GO:0052724) |
0.1 | 0.2 | GO:0015106 | bicarbonate transmembrane transporter activity(GO:0015106) |
0.1 | 0.7 | GO:0004622 | lysophospholipase activity(GO:0004622) |
0.1 | 0.7 | GO:0042800 | histone methyltransferase activity (H3-K4 specific)(GO:0042800) |
0.1 | 0.1 | GO:0015925 | galactosidase activity(GO:0015925) |
0.1 | 2.8 | GO:0000149 | SNARE binding(GO:0000149) |
0.0 | 0.4 | GO:0097602 | cullin family protein binding(GO:0097602) |
0.0 | 0.1 | GO:0015093 | ferrous iron transmembrane transporter activity(GO:0015093) |
0.0 | 1.2 | GO:0005245 | voltage-gated calcium channel activity(GO:0005245) |
0.0 | 0.1 | GO:0004461 | lactose synthase activity(GO:0004461) |
0.0 | 0.1 | GO:0019002 | GMP binding(GO:0019002) |
0.0 | 0.2 | GO:0004312 | fatty acid synthase activity(GO:0004312) |
0.0 | 0.1 | GO:0005326 | neurotransmitter transporter activity(GO:0005326) |
0.0 | 0.5 | GO:0016799 | hydrolase activity, hydrolyzing N-glycosyl compounds(GO:0016799) |
0.0 | 0.2 | GO:0004689 | phosphorylase kinase activity(GO:0004689) |
0.0 | 0.2 | GO:0010997 | anaphase-promoting complex binding(GO:0010997) |
0.0 | 0.7 | GO:0008375 | acetylglucosaminyltransferase activity(GO:0008375) |
0.0 | 0.2 | GO:0032454 | histone demethylase activity (H3-K9 specific)(GO:0032454) |
0.0 | 0.7 | GO:0004029 | aldehyde dehydrogenase (NAD) activity(GO:0004029) |
0.0 | 0.2 | GO:0005329 | dopamine transmembrane transporter activity(GO:0005329) |
0.0 | 0.2 | GO:0016655 | oxidoreductase activity, acting on NAD(P)H, quinone or similar compound as acceptor(GO:0016655) |
0.0 | 0.5 | GO:0004089 | carbonate dehydratase activity(GO:0004089) |
0.0 | 0.0 | GO:0035650 | AP-1 adaptor complex binding(GO:0035650) |
0.0 | 0.2 | GO:0019863 | IgE binding(GO:0019863) |
0.0 | 0.2 | GO:0003857 | 3-hydroxyacyl-CoA dehydrogenase activity(GO:0003857) |
0.0 | 0.5 | GO:0004683 | calmodulin-dependent protein kinase activity(GO:0004683) |
0.0 | 0.2 | GO:0004945 | angiotensin type II receptor activity(GO:0004945) |
0.0 | 0.8 | GO:0030215 | semaphorin receptor binding(GO:0030215) |
0.0 | 0.2 | GO:0048019 | receptor antagonist activity(GO:0048019) |
0.0 | 0.9 | GO:0004298 | threonine-type endopeptidase activity(GO:0004298) threonine-type peptidase activity(GO:0070003) |
0.0 | 0.2 | GO:0002151 | G-quadruplex RNA binding(GO:0002151) |
0.0 | 0.1 | GO:0004523 | RNA-DNA hybrid ribonuclease activity(GO:0004523) |
0.0 | 0.2 | GO:0019808 | polyamine binding(GO:0019808) |
0.0 | 0.0 | GO:0060230 | lipoprotein lipase activator activity(GO:0060230) |
0.0 | 0.8 | GO:0017091 | AU-rich element binding(GO:0017091) |
0.0 | 2.1 | GO:0046527 | glucosyltransferase activity(GO:0046527) |
0.0 | 1.5 | GO:0042562 | hormone binding(GO:0042562) |
0.0 | 0.2 | GO:0032052 | bile acid binding(GO:0032052) |
0.0 | 0.2 | GO:0004095 | carnitine O-palmitoyltransferase activity(GO:0004095) |
0.0 | 0.9 | GO:0016765 | transferase activity, transferring alkyl or aryl (other than methyl) groups(GO:0016765) |
0.0 | 0.1 | GO:0008970 | phosphatidylcholine 1-acylhydrolase activity(GO:0008970) |
0.0 | 0.1 | GO:0008607 | phosphorylase kinase regulator activity(GO:0008607) |
0.0 | 0.1 | GO:0051990 | (R)-2-hydroxyglutarate dehydrogenase activity(GO:0051990) |
0.0 | 0.3 | GO:0031386 | protein tag(GO:0031386) |
0.0 | 0.6 | GO:0051536 | iron-sulfur cluster binding(GO:0051536) metal cluster binding(GO:0051540) |
0.0 | 0.0 | GO:0000099 | sulfur amino acid transmembrane transporter activity(GO:0000099) |
0.0 | 0.5 | GO:0008553 | hydrogen-exporting ATPase activity, phosphorylative mechanism(GO:0008553) |
0.0 | 0.2 | GO:0019784 | NEDD8-specific protease activity(GO:0019784) |
0.0 | 0.1 | GO:0047498 | calcium-dependent phospholipase A2 activity(GO:0047498) |
0.0 | 0.1 | GO:0042609 | CD4 receptor binding(GO:0042609) |
0.0 | 0.1 | GO:0098631 | protein binding involved in cell adhesion(GO:0098631) |
0.0 | 0.4 | GO:0015266 | protein channel activity(GO:0015266) |
0.0 | 0.1 | GO:0030229 | very-low-density lipoprotein particle receptor activity(GO:0030229) |
0.0 | 0.1 | GO:0004591 | oxoglutarate dehydrogenase (succinyl-transferring) activity(GO:0004591) |
0.0 | 0.7 | GO:0034212 | peptide N-acetyltransferase activity(GO:0034212) |
0.0 | 0.3 | GO:0003993 | acid phosphatase activity(GO:0003993) |
0.0 | 0.4 | GO:0003684 | damaged DNA binding(GO:0003684) |
0.0 | 0.2 | GO:0016721 | superoxide dismutase activity(GO:0004784) oxidoreductase activity, acting on superoxide radicals as acceptor(GO:0016721) |
0.0 | 0.1 | GO:0000033 | alpha-1,3-mannosyltransferase activity(GO:0000033) |
0.0 | 0.8 | GO:0003887 | DNA-directed DNA polymerase activity(GO:0003887) |
0.0 | 0.2 | GO:0008171 | O-methyltransferase activity(GO:0008171) |
0.0 | 0.1 | GO:0003941 | L-serine ammonia-lyase activity(GO:0003941) |
0.0 | 0.1 | GO:0046934 | phosphatidylinositol-4,5-bisphosphate 3-kinase activity(GO:0046934) |
0.0 | 0.2 | GO:0016208 | AMP binding(GO:0016208) |
0.0 | 0.8 | GO:0070063 | RNA polymerase binding(GO:0070063) |
0.0 | 0.1 | GO:0036137 | kynurenine-oxoglutarate transaminase activity(GO:0016212) kynurenine aminotransferase activity(GO:0036137) |
0.0 | 0.1 | GO:0005143 | interleukin-12 receptor binding(GO:0005143) |
0.0 | 0.0 | GO:0019763 | immunoglobulin receptor activity(GO:0019763) |
0.0 | 0.3 | GO:0031402 | sodium ion binding(GO:0031402) |
0.0 | 0.4 | GO:0045236 | CXCR chemokine receptor binding(GO:0045236) |
0.0 | 0.8 | GO:0004869 | cysteine-type endopeptidase inhibitor activity(GO:0004869) |
0.0 | 0.1 | GO:0050543 | icosatetraenoic acid binding(GO:0050543) |
0.0 | 1.0 | GO:0061631 | ubiquitin conjugating enzyme activity(GO:0061631) |
0.0 | 0.1 | GO:0015211 | purine nucleoside transmembrane transporter activity(GO:0015211) |
0.0 | 0.1 | GO:0035877 | death effector domain binding(GO:0035877) |
0.0 | 0.8 | GO:0005164 | tumor necrosis factor receptor binding(GO:0005164) |
0.0 | 0.1 | GO:0019865 | immunoglobulin binding(GO:0019865) |
0.0 | 0.2 | GO:0003958 | NADPH-hemoprotein reductase activity(GO:0003958) |
0.0 | 1.0 | GO:0030170 | pyridoxal phosphate binding(GO:0030170) |
0.0 | 0.2 | GO:0052849 | enoyl-[acyl-carrier-protein] reductase activity(GO:0016631) 2,3-dihydroxy-2,3-dihydro-phenylpropionate dehydrogenase activity(GO:0018498) cis-2,3-dihydrodiol DDT dehydrogenase activity(GO:0018499) trans-9R,10R-dihydrodiolphenanthrene dehydrogenase activity(GO:0018500) cis-chlorobenzene dihydrodiol dehydrogenase activity(GO:0018501) 2,5-dichloro-2,5-cyclohexadiene-1,4-diol dehydrogenase activity(GO:0018502) trans-1,2-dihydrodiolphenanthrene dehydrogenase activity(GO:0018503) 3,4-dihydroxy-3,4-dihydrofluorene dehydrogenase activity(GO:0034790) benzo(a)pyrene-trans-11,12-dihydrodiol dehydrogenase activity(GO:0034805) benzo(a)pyrene-cis-4,5-dihydrodiol dehydrogenase activity(GO:0034809) citronellyl-CoA dehydrogenase activity(GO:0034824) menthone dehydrogenase activity(GO:0034838) phthalate 3,4-cis-dihydrodiol dehydrogenase activity(GO:0034912) cinnamate reductase activity(GO:0043786) NADPH-dependent curcumin reductase activity(GO:0052849) NADPH-dependent dihydrocurcumin reductase activity(GO:0052850) |
0.0 | 0.0 | GO:0008796 | bis(5'-nucleosyl)-tetraphosphatase activity(GO:0008796) |
0.0 | 0.6 | GO:0001102 | RNA polymerase II activating transcription factor binding(GO:0001102) |
0.0 | 0.5 | GO:0001594 | trace-amine receptor activity(GO:0001594) |
0.0 | 0.0 | GO:0035373 | chondroitin sulfate proteoglycan binding(GO:0035373) |
0.0 | 0.3 | GO:0044183 | protein binding involved in protein folding(GO:0044183) |
0.0 | 0.3 | GO:0016493 | C-C chemokine receptor activity(GO:0016493) |
0.0 | 0.1 | GO:0016716 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, another compound as one donor, and incorporation of one atom of oxygen(GO:0016716) |
0.0 | 0.3 | GO:0004806 | triglyceride lipase activity(GO:0004806) |
0.0 | 0.3 | GO:0070491 | repressing transcription factor binding(GO:0070491) |
0.0 | 0.0 | GO:0003954 | NADH dehydrogenase activity(GO:0003954) |
0.0 | 0.2 | GO:0042171 | lysophosphatidic acid acyltransferase activity(GO:0042171) |
0.0 | 0.1 | GO:0000155 | phosphorelay sensor kinase activity(GO:0000155) |
0.0 | 0.1 | GO:0031735 | CCR10 chemokine receptor binding(GO:0031735) |
0.0 | 0.1 | GO:0010485 | H4 histone acetyltransferase activity(GO:0010485) |
0.0 | 0.1 | GO:0034618 | arginine binding(GO:0034618) |
0.0 | 0.1 | GO:0034046 | poly(G) binding(GO:0034046) |
0.0 | 0.1 | GO:0071558 | histone demethylase activity (H3-K27 specific)(GO:0071558) |
0.0 | 0.1 | GO:0008094 | DNA-dependent ATPase activity(GO:0008094) |
0.0 | 0.2 | GO:0051010 | microtubule plus-end binding(GO:0051010) |
0.0 | 0.4 | GO:0043014 | alpha-tubulin binding(GO:0043014) |
0.0 | 0.1 | GO:0004833 | tryptophan 2,3-dioxygenase activity(GO:0004833) |
0.0 | 0.0 | GO:0071532 | ankyrin repeat binding(GO:0071532) |
0.0 | 0.0 | GO:0004376 | glycolipid mannosyltransferase activity(GO:0004376) |
0.0 | 0.1 | GO:0001094 | TFIID-class transcription factor binding(GO:0001094) |
0.0 | 0.7 | GO:0004386 | helicase activity(GO:0004386) |
0.0 | 0.2 | GO:0001727 | lipid kinase activity(GO:0001727) |
0.0 | 0.1 | GO:0001013 | RNA polymerase I regulatory region DNA binding(GO:0001013) RNA polymerase I regulatory region sequence-specific DNA binding(GO:0001163) RNA polymerase I CORE element sequence-specific DNA binding(GO:0001164) |
0.0 | 4.0 | GO:0003924 | GTPase activity(GO:0003924) |
0.0 | 0.1 | GO:0004946 | bombesin receptor activity(GO:0004946) |
0.0 | 7.3 | GO:0004842 | ubiquitin-protein transferase activity(GO:0004842) |
0.0 | 0.0 | GO:0019237 | centromeric DNA binding(GO:0019237) |
0.0 | 1.3 | GO:0042393 | histone binding(GO:0042393) |
0.0 | 0.1 | GO:0004514 | nicotinate-nucleotide diphosphorylase (carboxylating) activity(GO:0004514) |
0.0 | 0.0 | GO:0001591 | dopamine neurotransmitter receptor activity, coupled via Gi/Go(GO:0001591) |
0.0 | 0.2 | GO:0004526 | ribonuclease P activity(GO:0004526) |
0.0 | 0.0 | GO:0032183 | SUMO binding(GO:0032183) |
0.0 | 0.1 | GO:0004800 | thyroxine 5'-deiodinase activity(GO:0004800) |
0.0 | 1.6 | GO:0004725 | protein tyrosine phosphatase activity(GO:0004725) |
0.0 | 0.5 | GO:0008276 | protein methyltransferase activity(GO:0008276) |
0.0 | 0.4 | GO:0043395 | heparan sulfate proteoglycan binding(GO:0043395) |
0.0 | 0.1 | GO:0071208 | histone pre-mRNA DCP binding(GO:0071208) |
0.0 | 0.6 | GO:0017080 | sodium channel regulator activity(GO:0017080) |
0.0 | 0.2 | GO:0001054 | RNA polymerase I activity(GO:0001054) |
0.0 | 0.3 | GO:0052890 | oxidoreductase activity, acting on the CH-CH group of donors, with a flavin as acceptor(GO:0052890) |
0.0 | 0.5 | GO:0001105 | RNA polymerase II transcription coactivator activity(GO:0001105) |
0.0 | 0.1 | GO:0005412 | glucose:sodium symporter activity(GO:0005412) |
0.0 | 0.0 | GO:0043546 | molybdopterin cofactor binding(GO:0043546) |
0.0 | 0.2 | GO:0016713 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, reduced iron-sulfur protein as one donor, and incorporation of one atom of oxygen(GO:0016713) |
0.0 | 0.1 | GO:0017169 | CDP-alcohol phosphatidyltransferase activity(GO:0017169) |
0.0 | 0.3 | GO:0015175 | neutral amino acid transmembrane transporter activity(GO:0015175) |
0.0 | 0.2 | GO:0004499 | N,N-dimethylaniline monooxygenase activity(GO:0004499) |
0.0 | 0.1 | GO:0003746 | translation elongation factor activity(GO:0003746) |
0.0 | 0.3 | GO:0051879 | Hsp90 protein binding(GO:0051879) |
0.0 | 0.3 | GO:0004623 | phospholipase A2 activity(GO:0004623) |
0.0 | 0.1 | GO:0001849 | complement component C1q binding(GO:0001849) |
0.0 | 0.1 | GO:0031489 | myosin V binding(GO:0031489) |
0.0 | 0.1 | GO:0042895 | antibiotic transporter activity(GO:0042895) |
0.0 | 0.0 | GO:0004720 | protein-lysine 6-oxidase activity(GO:0004720) |
0.0 | 2.0 | GO:0016503 | pheromone receptor activity(GO:0016503) |
0.0 | 0.1 | GO:0004920 | interleukin-10 receptor activity(GO:0004920) |
0.0 | 0.2 | GO:0070742 | C2H2 zinc finger domain binding(GO:0070742) |
0.0 | 0.1 | GO:0070051 | fibrinogen binding(GO:0070051) |
0.0 | 0.5 | GO:0030374 | ligand-dependent nuclear receptor transcription coactivator activity(GO:0030374) |
0.0 | 0.0 | GO:0004758 | serine C-palmitoyltransferase activity(GO:0004758) |
0.0 | 0.1 | GO:0004505 | phenylalanine 4-monooxygenase activity(GO:0004505) |
0.0 | 0.2 | GO:0001848 | complement binding(GO:0001848) |
0.0 | 0.0 | GO:0005146 | leukemia inhibitory factor receptor binding(GO:0005146) |
0.0 | 0.1 | GO:0015036 | disulfide oxidoreductase activity(GO:0015036) |
0.0 | 0.2 | GO:0008188 | neuropeptide receptor activity(GO:0008188) |
0.0 | 0.0 | GO:0045118 | azole transporter activity(GO:0045118) azole transmembrane transporter activity(GO:1901474) |
0.0 | 0.0 | GO:0008430 | selenium binding(GO:0008430) |
0.0 | 0.1 | GO:0051431 | corticotropin-releasing hormone receptor 2 binding(GO:0051431) |
0.0 | 0.1 | GO:0016714 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, reduced pteridine as one donor, and incorporation of one atom of oxygen(GO:0016714) |
0.0 | 0.3 | GO:0048020 | CCR chemokine receptor binding(GO:0048020) |
0.0 | 0.1 | GO:0015349 | thyroid hormone transmembrane transporter activity(GO:0015349) |
0.0 | 0.2 | GO:0003950 | NAD+ ADP-ribosyltransferase activity(GO:0003950) |
0.0 | 0.2 | GO:0016289 | CoA hydrolase activity(GO:0016289) |
0.0 | 0.9 | GO:0016881 | acid-amino acid ligase activity(GO:0016881) |
0.0 | 0.1 | GO:0003796 | lysozyme activity(GO:0003796) |
0.0 | 0.0 | GO:0004082 | bisphosphoglycerate mutase activity(GO:0004082) phosphoglycerate mutase activity(GO:0004619) 2,3-bisphosphoglycerate-dependent phosphoglycerate mutase activity(GO:0046538) |
0.0 | 0.0 | GO:0005436 | sodium:phosphate symporter activity(GO:0005436) |
0.0 | 1.2 | GO:0017137 | Rab GTPase binding(GO:0017137) |
0.0 | 0.0 | GO:0003854 | 3-beta-hydroxy-delta5-steroid dehydrogenase activity(GO:0003854) |
0.0 | 0.1 | GO:0070016 | armadillo repeat domain binding(GO:0070016) |
0.0 | 0.0 | GO:0034416 | bisphosphoglycerate 2-phosphatase activity(GO:0004083) bisphosphoglycerate phosphatase activity(GO:0034416) |
0.0 | 0.1 | GO:0008174 | mRNA methyltransferase activity(GO:0008174) |
0.0 | 0.4 | GO:0052771 | coenzyme F390-A hydrolase activity(GO:0052770) coenzyme F390-G hydrolase activity(GO:0052771) |
0.0 | 0.2 | GO:0005149 | interleukin-1 receptor binding(GO:0005149) |
0.0 | 0.6 | GO:0051087 | chaperone binding(GO:0051087) |
0.0 | 0.0 | GO:0019153 | protein-disulfide reductase (glutathione) activity(GO:0019153) |
0.0 | 0.0 | GO:0043125 | ErbB-3 class receptor binding(GO:0043125) |
0.0 | 0.0 | GO:0030628 | pre-mRNA 3'-splice site binding(GO:0030628) |
0.0 | 0.1 | GO:0043539 | protein serine/threonine kinase activator activity(GO:0043539) |
0.0 | 0.2 | GO:0015095 | magnesium ion transmembrane transporter activity(GO:0015095) |
0.0 | 0.1 | GO:0005248 | voltage-gated sodium channel activity(GO:0005248) voltage-gated ion channel activity involved in regulation of postsynaptic membrane potential(GO:1905030) |
0.0 | 0.0 | GO:0015018 | galactosylgalactosylxylosylprotein 3-beta-glucuronosyltransferase activity(GO:0015018) |
0.0 | 0.1 | GO:0008519 | ammonium transmembrane transporter activity(GO:0008519) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
1.3 | 1.3 | PID EPHA2 FWD PATHWAY | EPHA2 forward signaling |
0.4 | 1.5 | PID ECADHERIN KERATINOCYTE PATHWAY | E-cadherin signaling in keratinocytes |
0.3 | 4.5 | PID ANTHRAX PATHWAY | Cellular roles of Anthrax toxin |
0.3 | 4.3 | PID LYMPH ANGIOGENESIS PATHWAY | VEGFR3 signaling in lymphatic endothelium |
0.2 | 4.5 | PID S1P S1P2 PATHWAY | S1P2 pathway |
0.2 | 7.2 | PID GMCSF PATHWAY | GMCSF-mediated signaling events |
0.2 | 0.6 | PID RETINOIC ACID PATHWAY | Retinoic acid receptors-mediated signaling |
0.2 | 1.1 | ST PHOSPHOINOSITIDE 3 KINASE PATHWAY | PI3K Pathway |
0.2 | 5.9 | PID BARD1 PATHWAY | BARD1 signaling events |
0.2 | 4.8 | PID MYC PATHWAY | C-MYC pathway |
0.2 | 2.2 | PID SMAD2 3NUCLEAR PATHWAY | Regulation of nuclear SMAD2/3 signaling |
0.2 | 3.2 | PID NFKAPPAB CANONICAL PATHWAY | Canonical NF-kappaB pathway |
0.2 | 1.3 | PID IL2 1PATHWAY | IL2-mediated signaling events |
0.2 | 0.5 | PID INTEGRIN A9B1 PATHWAY | Alpha9 beta1 integrin signaling events |
0.2 | 1.2 | PID ARF6 PATHWAY | Arf6 signaling events |
0.2 | 1.5 | PID TCR JNK PATHWAY | JNK signaling in the CD4+ TCR pathway |
0.1 | 0.9 | PID P38 GAMMA DELTA PATHWAY | Signaling mediated by p38-gamma and p38-delta |
0.1 | 5.6 | PID TRKR PATHWAY | Neurotrophic factor-mediated Trk receptor signaling |
0.1 | 0.3 | SA CASPASE CASCADE | Apoptosis is mediated by caspases, cysteine proteases arranged in a proteolytic cascade. |
0.1 | 1.1 | PID NFAT TFPATHWAY | Calcineurin-regulated NFAT-dependent transcription in lymphocytes |
0.1 | 0.9 | PID ATF2 PATHWAY | ATF-2 transcription factor network |
0.1 | 0.5 | PID IL6 7 PATHWAY | IL6-mediated signaling events |
0.1 | 2.5 | PID CXCR3 PATHWAY | CXCR3-mediated signaling events |
0.1 | 1.5 | PID MAPK TRK PATHWAY | Trk receptor signaling mediated by the MAPK pathway |
0.1 | 0.1 | PID INTEGRIN5 PATHWAY | Beta5 beta6 beta7 and beta8 integrin cell surface interactions |
0.1 | 1.6 | PID INSULIN GLUCOSE PATHWAY | Insulin-mediated glucose transport |
0.1 | 1.3 | PID TCR CALCIUM PATHWAY | Calcium signaling in the CD4+ TCR pathway |
0.1 | 0.4 | PID PI3KCI AKT PATHWAY | Class I PI3K signaling events mediated by Akt |
0.1 | 0.9 | PID FOXM1 PATHWAY | FOXM1 transcription factor network |
0.1 | 0.9 | PID PDGFRA PATHWAY | PDGFR-alpha signaling pathway |
0.1 | 3.1 | PID ATR PATHWAY | ATR signaling pathway |
0.1 | 2.8 | PID CDC42 REG PATHWAY | Regulation of CDC42 activity |
0.1 | 1.2 | PID INSULIN PATHWAY | Insulin Pathway |
0.1 | 2.0 | PID FCER1 PATHWAY | Fc-epsilon receptor I signaling in mast cells |
0.1 | 0.7 | PID PI3K PLC TRK PATHWAY | Trk receptor signaling mediated by PI3K and PLC-gamma |
0.1 | 0.6 | PID CERAMIDE PATHWAY | Ceramide signaling pathway |
0.1 | 1.2 | ST P38 MAPK PATHWAY | p38 MAPK Pathway |
0.1 | 1.7 | PID ERBB1 INTERNALIZATION PATHWAY | Internalization of ErbB1 |
0.1 | 1.3 | PID ERB GENOMIC PATHWAY | Validated nuclear estrogen receptor beta network |
0.1 | 0.7 | SA PTEN PATHWAY | PTEN is a tumor suppressor that dephosphorylates the lipid messenger phosphatidylinositol triphosphate. |
0.1 | 1.3 | PID SYNDECAN 3 PATHWAY | Syndecan-3-mediated signaling events |
0.1 | 2.7 | PID AURORA B PATHWAY | Aurora B signaling |
0.1 | 1.5 | ST MYOCYTE AD PATHWAY | Myocyte Adrenergic Pathway is a specific case of the generalized Adrenergic Pathway. |
0.1 | 2.3 | PID FAK PATHWAY | Signaling events mediated by focal adhesion kinase |
0.1 | 1.2 | ST DIFFERENTIATION PATHWAY IN PC12 CELLS | Differentiation Pathway in PC12 Cells; this is a specific case of PAC1 Receptor Pathway. |
0.1 | 0.8 | PID RET PATHWAY | Signaling events regulated by Ret tyrosine kinase |
0.1 | 0.9 | PID HIF1A PATHWAY | Hypoxic and oxygen homeostasis regulation of HIF-1-alpha |
0.1 | 0.1 | PID ECADHERIN NASCENT AJ PATHWAY | E-cadherin signaling in the nascent adherens junction |
0.1 | 1.3 | ST TUMOR NECROSIS FACTOR PATHWAY | Tumor Necrosis Factor Pathway. |
0.1 | 0.3 | PID TRAIL PATHWAY | TRAIL signaling pathway |
0.1 | 0.3 | PID IL2 PI3K PATHWAY | IL2 signaling events mediated by PI3K |
0.1 | 1.0 | PID LIS1 PATHWAY | Lissencephaly gene (LIS1) in neuronal migration and development |
0.1 | 0.5 | ST GA13 PATHWAY | G alpha 13 Pathway |
0.1 | 1.6 | PID PLK1 PATHWAY | PLK1 signaling events |
0.1 | 1.0 | PID MYC REPRESS PATHWAY | Validated targets of C-MYC transcriptional repression |
0.0 | 0.7 | PID ATM PATHWAY | ATM pathway |
0.0 | 2.5 | PID HDAC CLASSI PATHWAY | Signaling events mediated by HDAC Class I |
0.0 | 0.1 | SA REG CASCADE OF CYCLIN EXPR | Expression of cyclins regulates progression through the cell cycle by activating cyclin-dependent kinases. |
0.0 | 0.6 | PID ER NONGENOMIC PATHWAY | Plasma membrane estrogen receptor signaling |
0.0 | 0.2 | ST INTERFERON GAMMA PATHWAY | Interferon gamma pathway. |
0.0 | 0.1 | PID IL5 PATHWAY | IL5-mediated signaling events |
0.0 | 0.7 | PID ARF 3PATHWAY | Arf1 pathway |
0.0 | 0.2 | SA FAS SIGNALING | The TNF-type receptor Fas induces apoptosis on ligand binding. |
0.0 | 0.4 | ST WNT BETA CATENIN PATHWAY | Wnt/beta-catenin Pathway |
0.0 | 0.2 | SA MMP CYTOKINE CONNECTION | Cytokines can induce activation of matrix metalloproteinases, which degrade extracellular matrix. |
0.0 | 0.1 | ST T CELL SIGNAL TRANSDUCTION | T Cell Signal Transduction |
0.0 | 1.2 | NABA PROTEOGLYCANS | Genes encoding proteoglycans |
0.0 | 0.0 | SA PROGRAMMED CELL DEATH | Programmed cell death, or apoptosis, eliminates damaged or unneeded cells. |
0.0 | 0.6 | SIG INSULIN RECEPTOR PATHWAY IN CARDIAC MYOCYTES | Genes related to the insulin receptor pathway |
0.0 | 0.4 | PID LPA4 PATHWAY | LPA4-mediated signaling events |
0.0 | 0.2 | PID ERBB4 PATHWAY | ErbB4 signaling events |
0.0 | 0.1 | SIG CD40PATHWAYMAP | Genes related to CD40 signaling |
0.0 | 0.1 | ST G ALPHA I PATHWAY | G alpha i Pathway |
0.0 | 0.7 | PID HNF3A PATHWAY | FOXA1 transcription factor network |
0.0 | 0.8 | PID IL4 2PATHWAY | IL4-mediated signaling events |
0.0 | 0.0 | PID S1P S1P4 PATHWAY | S1P4 pathway |
0.0 | 0.0 | PID FAS PATHWAY | FAS (CD95) signaling pathway |
0.0 | 0.5 | PID NOTCH PATHWAY | Notch signaling pathway |
0.0 | 0.1 | PID S1P META PATHWAY | Sphingosine 1-phosphate (S1P) pathway |
0.0 | 0.2 | PID P38 ALPHA BETA PATHWAY | Regulation of p38-alpha and p38-beta |
0.0 | 0.0 | PID ARF6 DOWNSTREAM PATHWAY | Arf6 downstream pathway |
0.0 | 0.1 | PID DNA PK PATHWAY | DNA-PK pathway in nonhomologous end joining |
0.0 | 0.1 | PID INTEGRIN CS PATHWAY | Integrin family cell surface interactions |
0.0 | 0.1 | PID NETRIN PATHWAY | Netrin-mediated signaling events |
0.0 | 0.0 | SIG BCR SIGNALING PATHWAY | Members of the BCR signaling pathway |
0.0 | 0.3 | PID UPA UPAR PATHWAY | Urokinase-type plasminogen activator (uPA) and uPAR-mediated signaling |
0.0 | 0.0 | PID THROMBIN PAR4 PATHWAY | PAR4-mediated thrombin signaling events |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.5 | 7.4 | REACTOME SYNTHESIS OF VERY LONG CHAIN FATTY ACYL COAS | Genes involved in Synthesis of very long-chain fatty acyl-CoAs |
0.5 | 5.4 | REACTOME CD28 DEPENDENT VAV1 PATHWAY | Genes involved in CD28 dependent Vav1 pathway |
0.5 | 0.5 | REACTOME SIGNALING BY NOTCH4 | Genes involved in Signaling by NOTCH4 |
0.5 | 0.9 | REACTOME CA DEPENDENT EVENTS | Genes involved in Ca-dependent events |
0.4 | 5.2 | REACTOME CLASS C 3 METABOTROPIC GLUTAMATE PHEROMONE RECEPTORS | Genes involved in Class C/3 (Metabotropic glutamate/pheromone receptors) |
0.4 | 0.7 | REACTOME TRANSFERRIN ENDOCYTOSIS AND RECYCLING | Genes involved in Transferrin endocytosis and recycling |
0.3 | 4.8 | REACTOME SHC RELATED EVENTS | Genes involved in SHC-related events |
0.3 | 2.9 | REACTOME IRAK1 RECRUITS IKK COMPLEX | Genes involved in IRAK1 recruits IKK complex |
0.3 | 0.9 | REACTOME G2 M DNA DAMAGE CHECKPOINT | Genes involved in G2/M DNA damage checkpoint |
0.3 | 0.6 | REACTOME PROSTACYCLIN SIGNALLING THROUGH PROSTACYCLIN RECEPTOR | Genes involved in Prostacyclin signalling through prostacyclin receptor |
0.3 | 2.0 | REACTOME NEGATIVE REGULATION OF THE PI3K AKT NETWORK | Genes involved in Negative regulation of the PI3K/AKT network |
0.2 | 7.3 | REACTOME HS GAG BIOSYNTHESIS | Genes involved in HS-GAG biosynthesis |
0.2 | 5.6 | REACTOME IL RECEPTOR SHC SIGNALING | Genes involved in Interleukin receptor SHC signaling |
0.2 | 1.4 | REACTOME NOREPINEPHRINE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Norepinephrine Neurotransmitter Release Cycle |
0.2 | 2.1 | REACTOME PROLACTIN RECEPTOR SIGNALING | Genes involved in Prolactin receptor signaling |
0.2 | 3.5 | REACTOME BOTULINUM NEUROTOXICITY | Genes involved in Botulinum neurotoxicity |
0.2 | 2.0 | REACTOME TRYPTOPHAN CATABOLISM | Genes involved in Tryptophan catabolism |
0.2 | 2.4 | REACTOME HIGHLY CALCIUM PERMEABLE POSTSYNAPTIC NICOTINIC ACETYLCHOLINE RECEPTORS | Genes involved in Highly calcium permeable postsynaptic nicotinic acetylcholine receptors |
0.2 | 2.6 | REACTOME GABA A RECEPTOR ACTIVATION | Genes involved in GABA A receptor activation |
0.2 | 2.3 | REACTOME CYCLIN A B1 ASSOCIATED EVENTS DURING G2 M TRANSITION | Genes involved in Cyclin A/B1 associated events during G2/M transition |
0.2 | 2.5 | REACTOME INTRINSIC PATHWAY | Genes involved in Intrinsic Pathway |
0.2 | 1.7 | REACTOME IONOTROPIC ACTIVITY OF KAINATE RECEPTORS | Genes involved in Ionotropic activity of Kainate Receptors |
0.2 | 3.4 | REACTOME INSULIN SYNTHESIS AND PROCESSING | Genes involved in Insulin Synthesis and Processing |
0.2 | 3.4 | REACTOME CONVERSION FROM APC C CDC20 TO APC C CDH1 IN LATE ANAPHASE | Genes involved in Conversion from APC/C:Cdc20 to APC/C:Cdh1 in late anaphase |
0.2 | 2.1 | REACTOME SYNTHESIS OF PIPS AT THE LATE ENDOSOME MEMBRANE | Genes involved in Synthesis of PIPs at the late endosome membrane |
0.2 | 3.3 | REACTOME PKA MEDIATED PHOSPHORYLATION OF CREB | Genes involved in PKA-mediated phosphorylation of CREB |
0.2 | 1.9 | REACTOME RECRUITMENT OF NUMA TO MITOTIC CENTROSOMES | Genes involved in Recruitment of NuMA to mitotic centrosomes |
0.2 | 1.2 | REACTOME E2F ENABLED INHIBITION OF PRE REPLICATION COMPLEX FORMATION | Genes involved in E2F-enabled inhibition of pre-replication complex formation |
0.2 | 3.3 | REACTOME G1 S SPECIFIC TRANSCRIPTION | Genes involved in G1/S-Specific Transcription |
0.2 | 2.8 | REACTOME MRNA DECAY BY 5 TO 3 EXORIBONUCLEASE | Genes involved in mRNA Decay by 5' to 3' Exoribonuclease |
0.2 | 2.7 | REACTOME METABOLISM OF PORPHYRINS | Genes involved in Metabolism of porphyrins |
0.2 | 0.8 | REACTOME APC C CDH1 MEDIATED DEGRADATION OF CDC20 AND OTHER APC C CDH1 TARGETED PROTEINS IN LATE MITOSIS EARLY G1 | Genes involved in APC/C:Cdh1 mediated degradation of Cdc20 and other APC/C:Cdh1 targeted proteins in late mitosis/early G1 |
0.2 | 5.1 | REACTOME REGULATION OF BETA CELL DEVELOPMENT | Genes involved in Regulation of beta-cell development |
0.2 | 2.8 | REACTOME AMINO ACID SYNTHESIS AND INTERCONVERSION TRANSAMINATION | Genes involved in Amino acid synthesis and interconversion (transamination) |
0.2 | 2.1 | REACTOME SEROTONIN RECEPTORS | Genes involved in Serotonin receptors |
0.2 | 3.6 | REACTOME MITOCHONDRIAL TRNA AMINOACYLATION | Genes involved in Mitochondrial tRNA aminoacylation |
0.2 | 2.9 | REACTOME PLATELET CALCIUM HOMEOSTASIS | Genes involved in Platelet calcium homeostasis |
0.2 | 1.9 | REACTOME PLATELET ADHESION TO EXPOSED COLLAGEN | Genes involved in Platelet Adhesion to exposed collagen |
0.2 | 0.2 | REACTOME VIF MEDIATED DEGRADATION OF APOBEC3G | Genes involved in Vif-mediated degradation of APOBEC3G |
0.2 | 2.6 | REACTOME UNBLOCKING OF NMDA RECEPTOR GLUTAMATE BINDING AND ACTIVATION | Genes involved in Unblocking of NMDA receptor, glutamate binding and activation |
0.2 | 0.3 | REACTOME ACTIVATED TAK1 MEDIATES P38 MAPK ACTIVATION | Genes involved in activated TAK1 mediates p38 MAPK activation |
0.2 | 0.8 | REACTOME CTNNB1 PHOSPHORYLATION CASCADE | Genes involved in Beta-catenin phosphorylation cascade |
0.2 | 2.8 | REACTOME FANCONI ANEMIA PATHWAY | Genes involved in Fanconi Anemia pathway |
0.2 | 2.4 | REACTOME EGFR DOWNREGULATION | Genes involved in EGFR downregulation |
0.2 | 1.6 | REACTOME CYTOSOLIC SULFONATION OF SMALL MOLECULES | Genes involved in Cytosolic sulfonation of small molecules |
0.2 | 6.2 | REACTOME NOTCH1 INTRACELLULAR DOMAIN REGULATES TRANSCRIPTION | Genes involved in NOTCH1 Intracellular Domain Regulates Transcription |
0.2 | 4.1 | REACTOME NEP NS2 INTERACTS WITH THE CELLULAR EXPORT MACHINERY | Genes involved in NEP/NS2 Interacts with the Cellular Export Machinery |
0.2 | 0.5 | REACTOME INFLUENZA VIRAL RNA TRANSCRIPTION AND REPLICATION | Genes involved in Influenza Viral RNA Transcription and Replication |
0.2 | 1.4 | REACTOME COPI MEDIATED TRANSPORT | Genes involved in COPI Mediated Transport |
0.2 | 0.2 | REACTOME TRAF6 MEDIATED IRF7 ACTIVATION | Genes involved in TRAF6 mediated IRF7 activation |
0.2 | 3.5 | REACTOME SIGNALING BY NOTCH1 | Genes involved in Signaling by NOTCH1 |
0.2 | 6.9 | REACTOME METABOLISM OF VITAMINS AND COFACTORS | Genes involved in Metabolism of vitamins and cofactors |
0.1 | 1.2 | REACTOME P75 NTR RECEPTOR MEDIATED SIGNALLING | Genes involved in p75 NTR receptor-mediated signalling |
0.1 | 1.5 | REACTOME GABA B RECEPTOR ACTIVATION | Genes involved in GABA B receptor activation |
0.1 | 0.9 | REACTOME ETHANOL OXIDATION | Genes involved in Ethanol oxidation |
0.1 | 0.3 | REACTOME ACETYLCHOLINE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Acetylcholine Neurotransmitter Release Cycle |
0.1 | 2.1 | REACTOME ANTIGEN PRESENTATION FOLDING ASSEMBLY AND PEPTIDE LOADING OF CLASS I MHC | Genes involved in Antigen Presentation: Folding, assembly and peptide loading of class I MHC |
0.1 | 0.1 | REACTOME PLC BETA MEDIATED EVENTS | Genes involved in PLC beta mediated events |
0.1 | 1.8 | REACTOME MITOCHONDRIAL FATTY ACID BETA OXIDATION | Genes involved in Mitochondrial Fatty Acid Beta-Oxidation |
0.1 | 2.9 | REACTOME KINESINS | Genes involved in Kinesins |
0.1 | 1.5 | REACTOME ACTIVATION OF GENES BY ATF4 | Genes involved in Activation of Genes by ATF4 |
0.1 | 1.3 | REACTOME GABA SYNTHESIS RELEASE REUPTAKE AND DEGRADATION | Genes involved in GABA synthesis, release, reuptake and degradation |
0.1 | 2.5 | REACTOME DEPOSITION OF NEW CENPA CONTAINING NUCLEOSOMES AT THE CENTROMERE | Genes involved in Deposition of New CENPA-containing Nucleosomes at the Centromere |
0.1 | 2.3 | REACTOME SYNTHESIS OF PC | Genes involved in Synthesis of PC |
0.1 | 2.4 | REACTOME INTERACTION BETWEEN L1 AND ANKYRINS | Genes involved in Interaction between L1 and Ankyrins |
0.1 | 1.0 | REACTOME DARPP 32 EVENTS | Genes involved in DARPP-32 events |
0.1 | 2.1 | REACTOME MICRORNA MIRNA BIOGENESIS | Genes involved in MicroRNA (miRNA) Biogenesis |
0.1 | 0.7 | REACTOME TETRAHYDROBIOPTERIN BH4 SYNTHESIS RECYCLING SALVAGE AND REGULATION | Genes involved in Tetrahydrobiopterin (BH4) synthesis, recycling, salvage and regulation |
0.1 | 0.1 | REACTOME TRANSLOCATION OF ZAP 70 TO IMMUNOLOGICAL SYNAPSE | Genes involved in Translocation of ZAP-70 to Immunological synapse |
0.1 | 1.3 | REACTOME FORMATION OF ATP BY CHEMIOSMOTIC COUPLING | Genes involved in Formation of ATP by chemiosmotic coupling |
0.1 | 1.6 | REACTOME G ALPHA Z SIGNALLING EVENTS | Genes involved in G alpha (z) signalling events |
0.1 | 1.1 | REACTOME GLUCOSE TRANSPORT | Genes involved in Glucose transport |
0.1 | 0.1 | REACTOME SIGNALING BY NOTCH2 | Genes involved in Signaling by NOTCH2 |
0.1 | 1.4 | REACTOME PURINE SALVAGE | Genes involved in Purine salvage |
0.1 | 0.2 | REACTOME TRANSPORT OF RIBONUCLEOPROTEINS INTO THE HOST NUCLEUS | Genes involved in Transport of Ribonucleoproteins into the Host Nucleus |
0.1 | 0.5 | REACTOME ACTIVATION OF CHAPERONES BY ATF6 ALPHA | Genes involved in Activation of Chaperones by ATF6-alpha |
0.1 | 0.2 | REACTOME INTERACTIONS OF VPR WITH HOST CELLULAR PROTEINS | Genes involved in Interactions of Vpr with host cellular proteins |
0.1 | 1.6 | REACTOME ACTIVATION OF NMDA RECEPTOR UPON GLUTAMATE BINDING AND POSTSYNAPTIC EVENTS | Genes involved in Activation of NMDA receptor upon glutamate binding and postsynaptic events |
0.1 | 0.9 | REACTOME RECYCLING OF BILE ACIDS AND SALTS | Genes involved in Recycling of bile acids and salts |
0.1 | 0.9 | REACTOME HORMONE SENSITIVE LIPASE HSL MEDIATED TRIACYLGLYCEROL HYDROLYSIS | Genes involved in Hormone-sensitive lipase (HSL)-mediated triacylglycerol hydrolysis |
0.1 | 1.1 | REACTOME BASE FREE SUGAR PHOSPHATE REMOVAL VIA THE SINGLE NUCLEOTIDE REPLACEMENT PATHWAY | Genes involved in Base-free sugar-phosphate removal via the single-nucleotide replacement pathway |
0.1 | 1.5 | REACTOME NEPHRIN INTERACTIONS | Genes involved in Nephrin interactions |
0.1 | 0.4 | REACTOME BINDING AND ENTRY OF HIV VIRION | Genes involved in Binding and entry of HIV virion |
0.1 | 3.0 | REACTOME SPHINGOLIPID DE NOVO BIOSYNTHESIS | Genes involved in Sphingolipid de novo biosynthesis |
0.1 | 1.4 | REACTOME METABOLISM OF POLYAMINES | Genes involved in Metabolism of polyamines |
0.1 | 0.2 | REACTOME VIRAL MESSENGER RNA SYNTHESIS | Genes involved in Viral Messenger RNA Synthesis |
0.1 | 0.9 | REACTOME CALNEXIN CALRETICULIN CYCLE | Genes involved in Calnexin/calreticulin cycle |
0.1 | 1.5 | REACTOME ACYL CHAIN REMODELLING OF PS | Genes involved in Acyl chain remodelling of PS |
0.1 | 2.6 | REACTOME TRANSPORT TO THE GOLGI AND SUBSEQUENT MODIFICATION | Genes involved in Transport to the Golgi and subsequent modification |
0.1 | 3.1 | REACTOME ANTIVIRAL MECHANISM BY IFN STIMULATED GENES | Genes involved in Antiviral mechanism by IFN-stimulated genes |
0.1 | 1.2 | REACTOME DESTABILIZATION OF MRNA BY BRF1 | Genes involved in Destabilization of mRNA by Butyrate Response Factor 1 (BRF1) |
0.1 | 6.4 | REACTOME RESPIRATORY ELECTRON TRANSPORT | Genes involved in Respiratory electron transport |
0.1 | 0.4 | REACTOME ADENYLATE CYCLASE INHIBITORY PATHWAY | Genes involved in Adenylate cyclase inhibitory pathway |
0.1 | 4.5 | REACTOME ER PHAGOSOME PATHWAY | Genes involved in ER-Phagosome pathway |
0.1 | 1.7 | REACTOME FORMATION OF INCISION COMPLEX IN GG NER | Genes involved in Formation of incision complex in GG-NER |
0.1 | 1.5 | REACTOME RNA POL II TRANSCRIPTION PRE INITIATION AND PROMOTER OPENING | Genes involved in RNA Polymerase II Transcription Pre-Initiation And Promoter Opening |
0.1 | 1.5 | REACTOME SYNTHESIS AND INTERCONVERSION OF NUCLEOTIDE DI AND TRIPHOSPHATES | Genes involved in Synthesis and interconversion of nucleotide di- and triphosphates |
0.1 | 0.4 | REACTOME RNA POL I PROMOTER OPENING | Genes involved in RNA Polymerase I Promoter Opening |
0.1 | 1.3 | REACTOME PROCESSING OF INTRONLESS PRE MRNAS | Genes involved in Processing of Intronless Pre-mRNAs |
0.1 | 2.2 | REACTOME G PROTEIN ACTIVATION | Genes involved in G-protein activation |
0.1 | 0.3 | REACTOME ACYL CHAIN REMODELLING OF PG | Genes involved in Acyl chain remodelling of PG |
0.1 | 0.5 | REACTOME REGULATION OF INSULIN SECRETION BY ACETYLCHOLINE | Genes involved in Regulation of Insulin Secretion by Acetylcholine |
0.1 | 0.3 | REACTOME IL 6 SIGNALING | Genes involved in Interleukin-6 signaling |
0.1 | 1.0 | REACTOME COMMON PATHWAY | Genes involved in Common Pathway |
0.1 | 0.1 | REACTOME APC CDC20 MEDIATED DEGRADATION OF NEK2A | Genes involved in APC-Cdc20 mediated degradation of Nek2A |
0.1 | 0.2 | REACTOME G1 S TRANSITION | Genes involved in G1/S Transition |
0.1 | 0.9 | REACTOME SYNTHESIS OF BILE ACIDS AND BILE SALTS VIA 7ALPHA HYDROXYCHOLESTEROL | Genes involved in Synthesis of bile acids and bile salts via 7alpha-hydroxycholesterol |
0.1 | 1.3 | REACTOME AMINE COMPOUND SLC TRANSPORTERS | Genes involved in Amine compound SLC transporters |
0.1 | 1.0 | REACTOME PYRIMIDINE CATABOLISM | Genes involved in Pyrimidine catabolism |
0.1 | 3.6 | REACTOME TRANSMISSION ACROSS CHEMICAL SYNAPSES | Genes involved in Transmission across Chemical Synapses |
0.1 | 0.7 | REACTOME REGULATION OF COMPLEMENT CASCADE | Genes involved in Regulation of Complement cascade |
0.1 | 0.4 | REACTOME PLATELET SENSITIZATION BY LDL | Genes involved in Platelet sensitization by LDL |
0.1 | 0.6 | REACTOME GLUCURONIDATION | Genes involved in Glucuronidation |
0.1 | 0.9 | REACTOME G0 AND EARLY G1 | Genes involved in G0 and Early G1 |
0.1 | 0.2 | REACTOME IRON UPTAKE AND TRANSPORT | Genes involved in Iron uptake and transport |
0.1 | 3.3 | REACTOME NUCLEAR RECEPTOR TRANSCRIPTION PATHWAY | Genes involved in Nuclear Receptor transcription pathway |
0.1 | 1.3 | REACTOME PTM GAMMA CARBOXYLATION HYPUSINE FORMATION AND ARYLSULFATASE ACTIVATION | Genes involved in PTM: gamma carboxylation, hypusine formation and arylsulfatase activation |
0.1 | 0.8 | REACTOME GLYCOGEN BREAKDOWN GLYCOGENOLYSIS | Genes involved in Glycogen breakdown (glycogenolysis) |
0.1 | 3.3 | REACTOME O LINKED GLYCOSYLATION OF MUCINS | Genes involved in O-linked glycosylation of mucins |
0.1 | 1.2 | REACTOME SULFUR AMINO ACID METABOLISM | Genes involved in Sulfur amino acid metabolism |
0.1 | 1.3 | REACTOME PYRUVATE METABOLISM | Genes involved in Pyruvate metabolism |
0.1 | 0.7 | REACTOME ACTIVATION OF NF KAPPAB IN B CELLS | Genes involved in Activation of NF-kappaB in B Cells |
0.1 | 0.5 | REACTOME HS GAG DEGRADATION | Genes involved in HS-GAG degradation |
0.1 | 1.3 | REACTOME GLYCOLYSIS | Genes involved in Glycolysis |
0.1 | 0.5 | REACTOME ANDROGEN BIOSYNTHESIS | Genes involved in Androgen biosynthesis |
0.1 | 1.0 | REACTOME GLUCAGON TYPE LIGAND RECEPTORS | Genes involved in Glucagon-type ligand receptors |
0.1 | 0.1 | REACTOME PERK REGULATED GENE EXPRESSION | Genes involved in PERK regulated gene expression |
0.1 | 1.4 | REACTOME CHOLESTEROL BIOSYNTHESIS | Genes involved in Cholesterol biosynthesis |
0.1 | 0.6 | REACTOME HORMONE LIGAND BINDING RECEPTORS | Genes involved in Hormone ligand-binding receptors |
0.1 | 6.7 | REACTOME SRP DEPENDENT COTRANSLATIONAL PROTEIN TARGETING TO MEMBRANE | Genes involved in SRP-dependent cotranslational protein targeting to membrane |
0.1 | 0.5 | REACTOME RNA POL III TRANSCRIPTION INITIATION FROM TYPE 3 PROMOTER | Genes involved in RNA Polymerase III Transcription Initiation From Type 3 Promoter |
0.1 | 0.3 | REACTOME ABACAVIR TRANSPORT AND METABOLISM | Genes involved in Abacavir transport and metabolism |
0.1 | 3.3 | REACTOME MITOTIC PROMETAPHASE | Genes involved in Mitotic Prometaphase |
0.1 | 2.2 | REACTOME MHC CLASS II ANTIGEN PRESENTATION | Genes involved in MHC class II antigen presentation |
0.1 | 0.4 | REACTOME INTEGRATION OF PROVIRUS | Genes involved in Integration of provirus |
0.1 | 0.8 | REACTOME INFLAMMASOMES | Genes involved in Inflammasomes |
0.1 | 1.6 | REACTOME TIGHT JUNCTION INTERACTIONS | Genes involved in Tight junction interactions |
0.1 | 0.4 | REACTOME PHOSPHORYLATION OF CD3 AND TCR ZETA CHAINS | Genes involved in Phosphorylation of CD3 and TCR zeta chains |
0.1 | 1.5 | REACTOME BIOSYNTHESIS OF THE N GLYCAN PRECURSOR DOLICHOL LIPID LINKED OLIGOSACCHARIDE LLO AND TRANSFER TO A NASCENT PROTEIN | Genes involved in Biosynthesis of the N-glycan precursor (dolichol lipid-linked oligosaccharide, LLO) and transfer to a nascent protein |
0.1 | 7.0 | REACTOME ANTIGEN PROCESSING UBIQUITINATION PROTEASOME DEGRADATION | Genes involved in Antigen processing: Ubiquitination & Proteasome degradation |
0.1 | 1.0 | REACTOME STEROID HORMONES | Genes involved in Steroid hormones |
0.1 | 0.7 | REACTOME AMINE DERIVED HORMONES | Genes involved in Amine-derived hormones |
0.1 | 0.6 | REACTOME TANDEM PORE DOMAIN POTASSIUM CHANNELS | Genes involved in Tandem pore domain potassium channels |
0.1 | 0.1 | REACTOME SPRY REGULATION OF FGF SIGNALING | Genes involved in Spry regulation of FGF signaling |
0.1 | 0.2 | REACTOME SIGNALLING TO P38 VIA RIT AND RIN | Genes involved in Signalling to p38 via RIT and RIN |
0.1 | 0.9 | REACTOME SYNTHESIS OF GLYCOSYLPHOSPHATIDYLINOSITOL GPI | Genes involved in Synthesis of glycosylphosphatidylinositol (GPI) |
0.1 | 0.3 | REACTOME LIGAND GATED ION CHANNEL TRANSPORT | Genes involved in Ligand-gated ion channel transport |
0.0 | 0.5 | REACTOME REPAIR SYNTHESIS FOR GAP FILLING BY DNA POL IN TC NER | Genes involved in Repair synthesis for gap-filling by DNA polymerase in TC-NER |
0.0 | 1.1 | REACTOME CELL CELL JUNCTION ORGANIZATION | Genes involved in Cell-cell junction organization |
0.0 | 0.5 | REACTOME REGULATION OF APOPTOSIS | Genes involved in Regulation of Apoptosis |
0.0 | 0.1 | REACTOME RAP1 SIGNALLING | Genes involved in Rap1 signalling |
0.0 | 0.3 | REACTOME CASPASE MEDIATED CLEAVAGE OF CYTOSKELETAL PROTEINS | Genes involved in Caspase-mediated cleavage of cytoskeletal proteins |
0.0 | 0.2 | REACTOME MTORC1 MEDIATED SIGNALLING | Genes involved in mTORC1-mediated signalling |
0.0 | 0.3 | REACTOME CREATION OF C4 AND C2 ACTIVATORS | Genes involved in Creation of C4 and C2 activators |
0.0 | 0.4 | REACTOME ORGANIC CATION ANION ZWITTERION TRANSPORT | Genes involved in Organic cation/anion/zwitterion transport |
0.0 | 0.1 | REACTOME ALPHA LINOLENIC ACID ALA METABOLISM | Genes involved in alpha-linolenic acid (ALA) metabolism |
0.0 | 0.1 | REACTOME PLATELET AGGREGATION PLUG FORMATION | Genes involved in Platelet Aggregation (Plug Formation) |
0.0 | 0.7 | REACTOME PYRUVATE METABOLISM AND CITRIC ACID TCA CYCLE | Genes involved in Pyruvate metabolism and Citric Acid (TCA) cycle |
0.0 | 0.3 | REACTOME NEGATIVE REGULATORS OF RIG I MDA5 SIGNALING | Genes involved in Negative regulators of RIG-I/MDA5 signaling |
0.0 | 0.9 | REACTOME SPHINGOLIPID METABOLISM | Genes involved in Sphingolipid metabolism |
0.0 | 0.1 | REACTOME TRAF6 MEDIATED IRF7 ACTIVATION IN TLR7 8 OR 9 SIGNALING | Genes involved in TRAF6 mediated IRF7 activation in TLR7/8 or 9 signaling |
0.0 | 0.5 | REACTOME APOPTOTIC EXECUTION PHASE | Genes involved in Apoptotic execution phase |
0.0 | 0.6 | REACTOME RNA POL III TRANSCRIPTION INITIATION FROM TYPE 2 PROMOTER | Genes involved in RNA Polymerase III Transcription Initiation From Type 2 Promoter |
0.0 | 0.3 | REACTOME COMPLEMENT CASCADE | Genes involved in Complement cascade |
0.0 | 0.3 | REACTOME SYNTHESIS OF PIPS AT THE GOLGI MEMBRANE | Genes involved in Synthesis of PIPs at the Golgi membrane |
0.0 | 0.5 | REACTOME ABCA TRANSPORTERS IN LIPID HOMEOSTASIS | Genes involved in ABCA transporters in lipid homeostasis |
0.0 | 0.3 | REACTOME TRAF3 DEPENDENT IRF ACTIVATION PATHWAY | Genes involved in TRAF3-dependent IRF activation pathway |
0.0 | 0.6 | REACTOME NOD1 2 SIGNALING PATHWAY | Genes involved in NOD1/2 Signaling Pathway |
0.0 | 0.3 | REACTOME UNWINDING OF DNA | Genes involved in Unwinding of DNA |
0.0 | 0.0 | REACTOME BILE ACID AND BILE SALT METABOLISM | Genes involved in Bile acid and bile salt metabolism |
0.0 | 0.6 | REACTOME METABOLISM OF NON CODING RNA | Genes involved in Metabolism of non-coding RNA |
0.0 | 1.1 | REACTOME MITOCHONDRIAL PROTEIN IMPORT | Genes involved in Mitochondrial Protein Import |
0.0 | 0.7 | REACTOME PREFOLDIN MEDIATED TRANSFER OF SUBSTRATE TO CCT TRIC | Genes involved in Prefoldin mediated transfer of substrate to CCT/TriC |
0.0 | 0.6 | REACTOME CYTOSOLIC TRNA AMINOACYLATION | Genes involved in Cytosolic tRNA aminoacylation |
0.0 | 0.1 | REACTOME ACTIVATION OF THE PRE REPLICATIVE COMPLEX | Genes involved in Activation of the pre-replicative complex |
0.0 | 0.1 | REACTOME IL 7 SIGNALING | Genes involved in Interleukin-7 signaling |
0.0 | 0.0 | REACTOME TRANSPORT OF MATURE MRNA DERIVED FROM AN INTRONLESS TRANSCRIPT | Genes involved in Transport of Mature mRNA Derived from an Intronless Transcript |
0.0 | 0.1 | REACTOME DESTABILIZATION OF MRNA BY AUF1 HNRNP D0 | Genes involved in Destabilization of mRNA by AUF1 (hnRNP D0) |
0.0 | 0.1 | REACTOME NFKB ACTIVATION THROUGH FADD RIP1 PATHWAY MEDIATED BY CASPASE 8 AND10 | Genes involved in NF-kB activation through FADD/RIP-1 pathway mediated by caspase-8 and -10 |
0.0 | 0.1 | REACTOME FORMATION OF TRANSCRIPTION COUPLED NER TC NER REPAIR COMPLEX | Genes involved in Formation of transcription-coupled NER (TC-NER) repair complex |
0.0 | 1.6 | REACTOME METABOLISM OF AMINO ACIDS AND DERIVATIVES | Genes involved in Metabolism of amino acids and derivatives |
0.0 | 0.4 | REACTOME DNA REPAIR | Genes involved in DNA Repair |
0.0 | 0.0 | REACTOME REMOVAL OF THE FLAP INTERMEDIATE FROM THE C STRAND | Genes involved in Removal of the Flap Intermediate from the C-strand |
0.0 | 0.3 | REACTOME ASSOCIATION OF TRIC CCT WITH TARGET PROTEINS DURING BIOSYNTHESIS | Genes involved in Association of TriC/CCT with target proteins during biosynthesis |
0.0 | 0.2 | REACTOME EXTENSION OF TELOMERES | Genes involved in Extension of Telomeres |
0.0 | 0.2 | REACTOME TIE2 SIGNALING | Genes involved in Tie2 Signaling |
0.0 | 0.2 | REACTOME KERATAN SULFATE BIOSYNTHESIS | Genes involved in Keratan sulfate biosynthesis |
0.0 | 0.1 | REACTOME ENDOGENOUS STEROLS | Genes involved in Endogenous sterols |
0.0 | 0.0 | REACTOME PEPTIDE CHAIN ELONGATION | Genes involved in Peptide chain elongation |
0.0 | 0.1 | REACTOME GROWTH HORMONE RECEPTOR SIGNALING | Genes involved in Growth hormone receptor signaling |
0.0 | 0.1 | REACTOME APOPTOSIS INDUCED DNA FRAGMENTATION | Genes involved in Apoptosis induced DNA fragmentation |
0.0 | 0.2 | REACTOME HEPARAN SULFATE HEPARIN HS GAG METABOLISM | Genes involved in Heparan sulfate/heparin (HS-GAG) metabolism |
0.0 | 0.3 | REACTOME NONSENSE MEDIATED DECAY ENHANCED BY THE EXON JUNCTION COMPLEX | Genes involved in Nonsense Mediated Decay Enhanced by the Exon Junction Complex |
0.0 | 0.1 | REACTOME GENERATION OF SECOND MESSENGER MOLECULES | Genes involved in Generation of second messenger molecules |
0.0 | 0.1 | REACTOME CD28 DEPENDENT PI3K AKT SIGNALING | Genes involved in CD28 dependent PI3K/Akt signaling |
0.0 | 0.2 | REACTOME PURINE RIBONUCLEOSIDE MONOPHOSPHATE BIOSYNTHESIS | Genes involved in Purine ribonucleoside monophosphate biosynthesis |
0.0 | 0.1 | REACTOME PACKAGING OF TELOMERE ENDS | Genes involved in Packaging Of Telomere Ends |
0.0 | 0.3 | REACTOME AMINE LIGAND BINDING RECEPTORS | Genes involved in Amine ligand-binding receptors |
0.0 | 0.1 | REACTOME DOWNREGULATION OF SMAD2 3 SMAD4 TRANSCRIPTIONAL ACTIVITY | Genes involved in Downregulation of SMAD2/3:SMAD4 transcriptional activity |
0.0 | 0.1 | REACTOME BETA DEFENSINS | Genes involved in Beta defensins |
0.0 | 0.1 | REACTOME BASIGIN INTERACTIONS | Genes involved in Basigin interactions |
0.0 | 0.1 | REACTOME EXTRINSIC PATHWAY FOR APOPTOSIS | Genes involved in Extrinsic Pathway for Apoptosis |
0.0 | 0.1 | REACTOME METABOLISM OF STEROID HORMONES AND VITAMINS A AND D | Genes involved in Metabolism of steroid hormones and vitamins A and D |
0.0 | 0.1 | REACTOME DEADENYLATION OF MRNA | Genes involved in Deadenylation of mRNA |