Gene Symbol | Gene ID | Gene Info |
---|---|---|
Atf6
|
ENSMUSG00000026663.6 | Atf6 |
CRE | Gene | Distance | Association probability | Pearson corr. coef. | P-value | Plot |
---|---|---|---|---|---|---|
Atf6 | chr1_170855156_170855330 | 12528 | 0.103027 | 0.08 | 5.5e-01 | Click! |
Atf6 | chr1_170867250_170867406 | 443 | 0.647530 | -0.06 | 6.6e-01 | Click! |
Atf6 | chr1_170850771_170850985 | 16893 | 0.100389 | 0.05 | 7.1e-01 | Click! |
Atf6 | chr1_170866999_170867150 | 697 | 0.473189 | 0.04 | 7.6e-01 | Click! |
Atf6 | chr1_170867460_170867930 | 76 | 0.919235 | -0.03 | 8.3e-01 | Click! |
Move your cursor over a bar to see sample name and corresponding Z-value.
Cis Regulatory Element (CRE) | Target Score | Top associated gene | Gene Info | Distance of CRE to TSS | CRE/Gene association probability |
---|---|---|---|---|---|
chr19_10417552_10417752 | 7.90 |
Syt7 |
synaptotagmin VII |
13634 |
0.14 |
chr8_90907824_90909226 | 5.51 |
Chd9 |
chromodomain helicase DNA binding protein 9 |
89 |
0.52 |
chr13_41345703_41345930 | 4.51 |
Nedd9 |
neural precursor cell expressed, developmentally down-regulated gene 9 |
13431 |
0.14 |
chr2_27848491_27848652 | 4.30 |
Col5a1 |
collagen, type V, alpha 1 |
37854 |
0.16 |
chr2_167827045_167827196 | 4.27 |
1200007C13Rik |
RIKEN cDNA 1200007C13 gene |
6526 |
0.17 |
chr16_10351259_10351719 | 4.04 |
Gm1600 |
predicted gene 1600 |
3898 |
0.19 |
chr13_37460302_37460827 | 4.04 |
Gm29458 |
predicted gene 29458 |
7356 |
0.1 |
chrX_164436838_164436999 | 3.96 |
Asb11 |
ankyrin repeat and SOCS box-containing 11 |
76 |
0.97 |
chr8_84197696_84198961 | 3.81 |
Gm26887 |
predicted gene, 26887 |
661 |
0.38 |
chr4_139213940_139214097 | 3.79 |
Capzb |
capping protein (actin filament) muscle Z-line, beta |
12943 |
0.15 |
chr1_184748562_184748934 | 3.66 |
Gm34342 |
predicted gene, 34342 |
11771 |
0.14 |
chr7_134569284_134569581 | 3.42 |
D7Ertd443e |
DNA segment, Chr 7, ERATO Doi 443, expressed |
68272 |
0.12 |
chr5_123135787_123136333 | 3.34 |
Gm38102 |
predicted gene, 38102 |
299 |
0.74 |
chr7_100993244_100993564 | 3.33 |
P2ry2 |
purinergic receptor P2Y, G-protein coupled 2 |
10483 |
0.13 |
chr2_156732225_156732397 | 3.31 |
Dlgap4 |
DLG associated protein 4 |
10819 |
0.13 |
chr13_98117551_98117726 | 3.26 |
Arhgef28 |
Rho guanine nucleotide exchange factor (GEF) 28 |
58349 |
0.13 |
chr17_78791164_78791351 | 3.26 |
Heatr5b |
HEAT repeat containing 5B |
4856 |
0.16 |
chr13_38253808_38253959 | 3.20 |
Gm47978 |
predicted gene, 47978 |
16726 |
0.16 |
chr2_77113899_77114088 | 3.20 |
Gm44360 |
predicted gene, 44360 |
39641 |
0.16 |
chr4_57679055_57679353 | 3.16 |
Pakap |
paralemmin A kinase anchor protein |
38453 |
0.18 |
chr9_111228449_111228782 | 3.13 |
Mlh1 |
mutL homolog 1 |
2021 |
0.29 |
chr12_103487330_103487489 | 3.10 |
Gm47267 |
predicted gene, 47267 |
3967 |
0.15 |
chr8_70698268_70700333 | 3.10 |
Jund |
jun D proto-oncogene |
351 |
0.45 |
chr19_9942900_9943051 | 3.02 |
Gm50346 |
predicted gene, 50346 |
143 |
0.9 |
chr9_69046064_69046216 | 2.88 |
Rora |
RAR-related orphan receptor alpha |
149401 |
0.04 |
chr4_154393373_154393582 | 2.87 |
Prdm16 |
PR domain containing 16 |
45020 |
0.13 |
chrX_142833203_142833366 | 2.87 |
Tmem164 |
transmembrane protein 164 |
7543 |
0.24 |
chr7_19756613_19756898 | 2.86 |
Bcam |
basal cell adhesion molecule |
196 |
0.85 |
chr11_100938783_100940230 | 2.84 |
Stat3 |
signal transducer and activator of transcription 3 |
27 |
0.97 |
chr13_45627470_45627741 | 2.84 |
Gmpr |
guanosine monophosphate reductase |
81452 |
0.1 |
chr13_73260419_73260749 | 2.81 |
Irx4 |
Iroquois homeobox 4 |
87 |
0.96 |
chr17_24020724_24021065 | 2.81 |
Gm25092 |
predicted gene, 25092 |
2434 |
0.11 |
chr19_45017868_45018274 | 2.75 |
Lzts2 |
leucine zipper, putative tumor suppressor 2 |
85 |
0.94 |
chr16_30502475_30502893 | 2.75 |
Tmem44 |
transmembrane protein 44 |
38225 |
0.14 |
chr4_123699563_123699729 | 2.73 |
Gm12922 |
predicted gene 12922 |
10381 |
0.13 |
chr7_29233778_29234096 | 2.72 |
Kcnk6 |
potassium inwardly-rectifying channel, subfamily K, member 6 |
1422 |
0.22 |
chr9_65661124_65661275 | 2.68 |
Rbpms2 |
RNA binding protein with multiple splicing 2 |
2222 |
0.25 |
chr18_75319478_75319960 | 2.67 |
2010010A06Rik |
RIKEN cDNA 2010010A06 gene |
22390 |
0.19 |
chr7_67741804_67741976 | 2.65 |
Synm |
synemin, intermediate filament protein |
1296 |
0.33 |
chr9_71622105_71622256 | 2.60 |
Cgnl1 |
cingulin-like 1 |
8929 |
0.19 |
chr5_77114815_77115020 | 2.60 |
Hopx |
HOP homeobox |
204 |
0.91 |
chr7_122716584_122716735 | 2.60 |
Gm44749 |
predicted gene 44749 |
14741 |
0.2 |
chr2_31172122_31172302 | 2.57 |
Gpr107 |
G protein-coupled receptor 107 |
55 |
0.97 |
chr9_48835918_48836556 | 2.57 |
Zbtb16 |
zinc finger and BTB domain containing 16 |
15 |
0.98 |
chr16_11479732_11479883 | 2.56 |
Gm15897 |
predicted gene 15897 |
16499 |
0.21 |
chr10_99237302_99237455 | 2.55 |
Gm48884 |
predicted gene, 48884 |
238 |
0.87 |
chr17_15192818_15193036 | 2.54 |
Gm35455 |
predicted gene, 35455 |
40768 |
0.13 |
chr8_124630562_124630728 | 2.53 |
Capn9 |
calpain 9 |
17205 |
0.15 |
chr16_4273811_4274410 | 2.51 |
Gm5766 |
predicted gene 5766 |
43809 |
0.12 |
chr5_135727069_135727234 | 2.51 |
Por |
P450 (cytochrome) oxidoreductase |
1423 |
0.26 |
chr4_98857329_98857480 | 2.51 |
Gm12851 |
predicted gene 12851 |
1790 |
0.32 |
chr9_108267770_108267921 | 2.48 |
Dag1 |
dystroglycan 1 |
3887 |
0.11 |
chr17_27970134_27970285 | 2.46 |
Gm15597 |
predicted gene 15597 |
4893 |
0.13 |
chr4_137960858_137961150 | 2.46 |
Eif4g3 |
eukaryotic translation initiation factor 4 gamma, 3 |
32018 |
0.16 |
chr16_34228583_34229181 | 2.45 |
Kalrn |
kalirin, RhoGEF kinase |
23433 |
0.27 |
chr6_5495964_5496856 | 2.41 |
Pdk4 |
pyruvate dehydrogenase kinase, isoenzyme 4 |
101 |
0.98 |
chr13_43226202_43226353 | 2.40 |
Tbc1d7 |
TBC1 domain family, member 7 |
54776 |
0.12 |
chr7_128523401_128523909 | 2.40 |
Bag3 |
BCL2-associated athanogene 3 |
39 |
0.96 |
chr5_30617970_30618148 | 2.38 |
Kcnk3 |
potassium channel, subfamily K, member 3 |
3314 |
0.17 |
chr5_32135044_32135941 | 2.38 |
Fosl2 |
fos-like antigen 2 |
309 |
0.86 |
chr12_104041402_104041700 | 2.34 |
Serpina12 |
serine (or cysteine) peptidase inhibitor, clade A (alpha-1 antiproteinase, antitrypsin), member 12 |
2892 |
0.15 |
chr11_54904327_54904534 | 2.33 |
Gpx3 |
glutathione peroxidase 3 |
1504 |
0.31 |
chr14_51007948_51008099 | 2.28 |
Rnase10 |
ribonuclease, RNase A family, 10 (non-active) |
94 |
0.93 |
chr9_65409098_65409310 | 2.27 |
Rasl12 |
RAS-like, family 12 |
10670 |
0.09 |
chr6_72671244_72671460 | 2.27 |
Tcf7l1 |
transcription factor 7 like 1 (T cell specific, HMG box) |
52 |
0.95 |
chr8_46613450_46613820 | 2.26 |
Primpol |
primase and polymerase (DNA-directed) |
620 |
0.65 |
chr15_79390430_79390617 | 2.23 |
Tmem184b |
transmembrane protein 184b |
6333 |
0.11 |
chr4_43399086_43399373 | 2.19 |
Rusc2 |
RUN and SH3 domain containing 2 |
2009 |
0.23 |
chr4_102574322_102574644 | 2.19 |
Pde4b |
phosphodiesterase 4B, cAMP specific |
4388 |
0.34 |
chr5_122637032_122637213 | 2.19 |
P2rx7 |
purinergic receptor P2X, ligand-gated ion channel, 7 |
6789 |
0.14 |
chr8_111509409_111509600 | 2.18 |
Wdr59 |
WD repeat domain 59 |
12483 |
0.17 |
chr10_61723378_61723529 | 2.17 |
Aifm2 |
apoptosis-inducing factor, mitochondrion-associated 2 |
2804 |
0.19 |
chr5_125053018_125053196 | 2.11 |
Ncor2 |
nuclear receptor co-repressor 2 |
2881 |
0.23 |
chr9_64794477_64794818 | 2.11 |
Dennd4a |
DENN/MADD domain containing 4A |
16693 |
0.19 |
chr10_40069375_40069526 | 2.11 |
Slc16a10 |
solute carrier family 16 (monocarboxylic acid transporters), member 10 |
7155 |
0.15 |
chr2_172862447_172862662 | 2.10 |
Gm22773 |
predicted gene, 22773 |
1787 |
0.43 |
chr6_4483869_4484020 | 2.05 |
Gm37883 |
predicted gene, 37883 |
254 |
0.91 |
chr1_74352924_74353075 | 2.02 |
Catip |
ciliogenesis associated TTC17 interacting protein |
9109 |
0.09 |
chr18_82742472_82742765 | 2.01 |
Gm50355 |
predicted gene, 50355 |
12637 |
0.09 |
chr10_84533171_84534667 | 2.01 |
Ckap4 |
cytoskeleton-associated protein 4 |
117 |
0.94 |
chr1_184289754_184289909 | 2.00 |
Gm37223 |
predicted gene, 37223 |
68498 |
0.11 |
chr3_55336962_55337323 | 2.00 |
Gm19817 |
predicted gene, 19817 |
6301 |
0.18 |
chr15_27503321_27503541 | 2.00 |
B230362B09Rik |
RIKEN cDNA B230362B09 gene |
481 |
0.78 |
chr11_94872744_94873468 | 1.99 |
A430060F13Rik |
RIKEN cDNA A430060F13 gene |
11347 |
0.12 |
chr5_130059751_130059902 | 1.97 |
Tpst1 |
protein-tyrosine sulfotransferase 1 |
13500 |
0.12 |
chr8_13660491_13660642 | 1.97 |
Rasa3 |
RAS p21 protein activator 3 |
16885 |
0.17 |
chr15_36491355_36491506 | 1.96 |
Ankrd46 |
ankyrin repeat domain 46 |
5285 |
0.16 |
chr19_46151936_46152617 | 1.95 |
Gbf1 |
golgi-specific brefeldin A-resistance factor 1 |
233 |
0.89 |
chr16_87661084_87661458 | 1.95 |
Bach1 |
BTB and CNC homology 1, basic leucine zipper transcription factor 1 |
37674 |
0.14 |
chr7_44869037_44870235 | 1.94 |
Ptov1 |
prostate tumor over expressed gene 1 |
152 |
0.87 |
chr14_103815679_103815830 | 1.94 |
Ednrb |
endothelin receptor type B |
27941 |
0.22 |
chr2_168019550_168019745 | 1.94 |
Ripor3 |
RIPOR family member 3 |
9029 |
0.15 |
chr11_50674517_50674668 | 1.94 |
Gm12199 |
predicted gene 12199 |
44323 |
0.11 |
chr17_56279872_56280039 | 1.94 |
Ticam1 |
toll-like receptor adaptor molecule 1 |
3169 |
0.12 |
chr11_103383637_103383788 | 1.94 |
Plekhm1 |
pleckstrin homology domain containing, family M (with RUN domain) member 1 |
11056 |
0.12 |
chr4_43000389_43000942 | 1.93 |
Vcp |
valosin containing protein |
158 |
0.91 |
chr18_5931922_5932614 | 1.93 |
Gm34804 |
predicted gene, 34804 |
12915 |
0.25 |
chr9_61370339_61371660 | 1.93 |
Gm10655 |
predicted gene 10655 |
628 |
0.63 |
chr1_22579584_22579735 | 1.93 |
Rims1 |
regulating synaptic membrane exocytosis 1 |
67130 |
0.14 |
chr1_86525613_86527056 | 1.92 |
Ptma |
prothymosin alpha |
392 |
0.81 |
chr7_100461618_100461935 | 1.92 |
C2cd3 |
C2 calcium-dependent domain containing 3 |
2435 |
0.15 |
chr5_24320568_24320732 | 1.91 |
Kcnh2 |
potassium voltage-gated channel, subfamily H (eag-related), member 2 |
1604 |
0.25 |
chr11_98587750_98588586 | 1.91 |
Ormdl3 |
ORM1-like 3 (S. cerevisiae) |
800 |
0.46 |
chr9_67121771_67121922 | 1.90 |
Gm19299 |
predicted gene, 19299 |
11714 |
0.16 |
chr17_87391284_87391612 | 1.89 |
Ttc7 |
tetratricopeptide repeat domain 7 |
12595 |
0.13 |
chr6_88961054_88961210 | 1.85 |
4933427D06Rik |
RIKEN cDNA 4933427D06 gene |
10449 |
0.16 |
chr8_122639928_122640335 | 1.85 |
Cbfa2t3 |
CBFA2/RUNX1 translocation partner 3 |
6335 |
0.1 |
chr5_96162084_96163134 | 1.84 |
Cnot6l |
CCR4-NOT transcription complex, subunit 6-like |
619 |
0.75 |
chr11_106536171_106536382 | 1.83 |
Tex2 |
testis expressed gene 2 |
30834 |
0.12 |
chr1_91044338_91044489 | 1.83 |
Lrrfip1 |
leucine rich repeat (in FLII) interacting protein 1 |
9031 |
0.2 |
chr3_108562098_108562631 | 1.82 |
Tmem167b |
transmembrane protein 167B |
102 |
0.92 |
chr2_58971392_58971543 | 1.81 |
Gm13557 |
predicted gene 13557 |
11760 |
0.23 |
chr14_74899968_74900226 | 1.81 |
Lrch1 |
leucine-rich repeats and calponin homology (CH) domain containing 1 |
375 |
0.88 |
chr10_80433949_80434450 | 1.79 |
Tcf3 |
transcription factor 3 |
552 |
0.57 |
chr6_118478826_118479369 | 1.78 |
Zfp9 |
zinc finger protein 9 |
223 |
0.91 |
chr7_132587176_132587435 | 1.77 |
Gm16764 |
predicted gene, 16764 |
10082 |
0.14 |
chrX_6926420_6926600 | 1.77 |
Dgkk |
diacylglycerol kinase kappa |
53026 |
0.15 |
chr10_21669955_21670106 | 1.77 |
Gm5420 |
predicted gene 5420 |
16381 |
0.21 |
chr4_56831175_56831326 | 1.75 |
Ctnnal1 |
catenin (cadherin associated protein), alpha-like 1 |
1397 |
0.35 |
chr15_36794181_36794614 | 1.75 |
Ywhaz |
tyrosine 3-monooxygenase/tryptophan 5-monooxygenase activation protein, zeta polypeptide |
134 |
0.95 |
chr15_97042032_97042236 | 1.75 |
Slc38a4 |
solute carrier family 38, member 4 |
7953 |
0.28 |
chr5_139428154_139428305 | 1.75 |
Gper1 |
G protein-coupled estrogen receptor 1 |
4949 |
0.13 |
chr2_120871851_120872002 | 1.74 |
Ubr1 |
ubiquitin protein ligase E3 component n-recognin 1 |
400 |
0.8 |
chr17_31905754_31906191 | 1.74 |
2310015A16Rik |
RIKEN cDNA 2310015A16 gene |
3057 |
0.18 |
chr11_119105840_119105991 | 1.73 |
Gm11754 |
predicted gene 11754 |
5510 |
0.15 |
chr12_70707601_70707898 | 1.73 |
Gm32369 |
predicted gene, 32369 |
25899 |
0.14 |
chr12_112101169_112101320 | 1.73 |
Aspg |
asparaginase |
5435 |
0.13 |
chr11_93531125_93531303 | 1.71 |
Gm24856 |
predicted gene, 24856 |
117890 |
0.06 |
chr2_145937102_145937253 | 1.70 |
Crnkl1 |
crooked neck pre-mRNA splicing factor 1 |
2163 |
0.24 |
chr11_48855844_48857180 | 1.70 |
Gm16170 |
predicted gene 16170 |
3019 |
0.13 |
chr3_19645540_19645691 | 1.69 |
Trim55 |
tripartite motif-containing 55 |
1107 |
0.45 |
chr4_126371656_126371807 | 1.66 |
Ago3 |
argonaute RISC catalytic subunit 3 |
20829 |
0.12 |
chr18_70624065_70624216 | 1.64 |
Mbd2 |
methyl-CpG binding domain protein 2 |
6367 |
0.21 |
chr7_45037804_45037955 | 1.64 |
Prr12 |
proline rich 12 |
3485 |
0.07 |
chr17_35164786_35165560 | 1.64 |
Gm17705 |
predicted gene, 17705 |
54 |
0.72 |
chr4_141575439_141575680 | 1.64 |
Fblim1 |
filamin binding LIM protein 1 |
20910 |
0.1 |
chr12_70598524_70598675 | 1.63 |
Gm24474 |
predicted gene, 24474 |
51583 |
0.11 |
chr7_29232187_29232588 | 1.63 |
Kcnk6 |
potassium inwardly-rectifying channel, subfamily K, member 6 |
128 |
0.91 |
chr17_26361700_26361851 | 1.62 |
Gm50015 |
predicted gene, 50015 |
39153 |
0.09 |
chr11_102777610_102777816 | 1.62 |
Adam11 |
a disintegrin and metallopeptidase domain 11 |
1159 |
0.35 |
chr11_96829897_96830242 | 1.60 |
Nfe2l1 |
nuclear factor, erythroid derived 2,-like 1 |
101 |
0.94 |
chr6_90707207_90707417 | 1.60 |
Iqsec1 |
IQ motif and Sec7 domain 1 |
9217 |
0.16 |
chr18_53536154_53536326 | 1.59 |
Prdm6 |
PR domain containing 6 |
1018 |
0.67 |
chr12_12549740_12549891 | 1.58 |
AC107703.1 |
novel transcript |
120102 |
0.05 |
chr17_28280473_28280635 | 1.58 |
Ppard |
peroxisome proliferator activator receptor delta |
8435 |
0.11 |
chr15_79516202_79516528 | 1.57 |
Kdelr3 |
KDEL (Lys-Asp-Glu-Leu) endoplasmic reticulum protein retention receptor 3 |
46 |
0.95 |
chr2_27714224_27714502 | 1.57 |
Rxra |
retinoid X receptor alpha |
3780 |
0.31 |
chr19_43939736_43940357 | 1.57 |
Dnmbp |
dynamin binding protein |
126 |
0.95 |
chr6_88914923_88915074 | 1.56 |
Tpra1 |
transmembrane protein, adipocyte asscociated 1 |
4399 |
0.13 |
chr4_135817367_135817518 | 1.56 |
Myom3 |
myomesin family, member 3 |
16798 |
0.12 |
chr2_32317120_32318698 | 1.55 |
Gm23363 |
predicted gene, 23363 |
356 |
0.45 |
chr17_31904257_31904408 | 1.55 |
2310015A16Rik |
RIKEN cDNA 2310015A16 gene |
4697 |
0.15 |
chr18_77825234_77825396 | 1.55 |
F830208F22Rik |
RIKEN cDNA F830208F22 gene |
28572 |
0.14 |
chr11_115186835_115187966 | 1.54 |
Nat9 |
N-acetyltransferase 9 (GCN5-related, putative) |
10 |
0.56 |
chr11_57973370_57973530 | 1.54 |
Gm12249 |
predicted gene 12249 |
316 |
0.87 |
chr7_109191268_109192295 | 1.54 |
Lmo1 |
LIM domain only 1 |
16574 |
0.17 |
chr7_128749045_128749196 | 1.54 |
Sec23ip |
Sec23 interacting protein |
3700 |
0.11 |
chr4_134677015_134677166 | 1.54 |
Man1c1 |
mannosidase, alpha, class 1C, member 1 |
26677 |
0.17 |
chr15_53258350_53258611 | 1.54 |
Ext1 |
exostosin glycosyltransferase 1 |
62225 |
0.15 |
chr19_46502635_46503186 | 1.53 |
Trim8 |
tripartite motif-containing 8 |
1208 |
0.41 |
chr2_91656850_91657112 | 1.52 |
Arhgap1 |
Rho GTPase activating protein 1 |
3773 |
0.13 |
chr6_29432981_29433458 | 1.51 |
Flnc |
filamin C, gamma |
37 |
0.95 |
chr11_116581477_116581809 | 1.50 |
Ube2o |
ubiquitin-conjugating enzyme E2O |
196 |
0.88 |
chr15_88831534_88831784 | 1.50 |
Gm23144 |
predicted gene, 23144 |
3641 |
0.16 |
chr8_45796337_45796566 | 1.49 |
Sorbs2 |
sorbin and SH3 domain containing 2 |
6757 |
0.16 |
chr14_25738589_25738953 | 1.48 |
Zcchc24 |
zinc finger, CCHC domain containing 24 |
18979 |
0.13 |
chr5_120648646_120649011 | 1.48 |
Rasal1 |
RAS protein activator like 1 (GAP1 like) |
6 |
0.92 |
chr1_134092523_134093737 | 1.47 |
Gm38140 |
predicted gene, 38140 |
6029 |
0.13 |
chr19_34753350_34753516 | 1.47 |
Gm27476 |
predicted gene, 27476 |
2923 |
0.17 |
chr13_95012007_95012158 | 1.47 |
Wdr41 |
WD repeat domain 41 |
5502 |
0.15 |
chr8_70200067_70200255 | 1.47 |
Slc25a42 |
solute carrier family 25, member 42 |
12095 |
0.09 |
chr16_33752890_33753206 | 1.46 |
Heg1 |
heart development protein with EGF-like domains 1 |
108 |
0.97 |
chr2_150789308_150789491 | 1.46 |
Pygb |
brain glycogen phosphorylase |
393 |
0.82 |
chr1_91701517_91701668 | 1.45 |
Gm28380 |
predicted gene 28380 |
90186 |
0.07 |
chr9_61789202_61789353 | 1.44 |
Gm47241 |
predicted gene, 47241 |
26193 |
0.21 |
chr8_92323834_92324111 | 1.44 |
Gm21817 |
predicted gene, 21817 |
15278 |
0.17 |
chr4_135986508_135987621 | 1.44 |
Pithd1 |
PITH (C-terminal proteasome-interacting domain of thioredoxin-like) domain containing 1 |
17 |
0.95 |
chr7_98418569_98418720 | 1.43 |
Gm44507 |
predicted gene 44507 |
3020 |
0.18 |
chr7_98834864_98835138 | 1.43 |
Wnt11 |
wingless-type MMTV integration site family, member 11 |
111 |
0.96 |
chr13_12369982_12370308 | 1.43 |
Gm5445 |
predicted gene 5445 |
8013 |
0.16 |
chr4_94752503_94752932 | 1.42 |
Tek |
TEK receptor tyrosine kinase |
13199 |
0.21 |
chr15_79030528_79031002 | 1.40 |
Gcat |
glycine C-acetyltransferase (2-amino-3-ketobutyrate-coenzyme A ligase) |
109 |
0.89 |
chr19_53424916_53425094 | 1.39 |
Mirt1 |
myocardial infarction associated transcript 1 |
26486 |
0.1 |
chr5_135264692_135264843 | 1.39 |
9430007M09Rik |
RIKEN cDNA 9430007M09 gene |
441 |
0.75 |
chr5_143403974_143404614 | 1.38 |
Kdelr2 |
KDEL (Lys-Asp-Glu-Leu) endoplasmic reticulum protein retention receptor 2 |
456 |
0.44 |
chr12_75860060_75860211 | 1.38 |
Syne2 |
spectrin repeat containing, nuclear envelope 2 |
7405 |
0.25 |
chr17_86271368_86271533 | 1.38 |
2010106C02Rik |
RIKEN cDNA 2010106C02 gene |
15728 |
0.25 |
chrX_20870016_20870250 | 1.37 |
Timp1 |
tissue inhibitor of metalloproteinase 1 |
33 |
0.95 |
chr7_127886071_127886222 | 1.37 |
Prss53 |
protease, serine 53 |
4821 |
0.07 |
chr19_10435006_10435255 | 1.37 |
Gm50268 |
predicted gene, 50268 |
4767 |
0.15 |
chr7_79890546_79891013 | 1.36 |
Gm26646 |
predicted gene, 26646 |
26158 |
0.08 |
chr8_110676672_110677057 | 1.36 |
Vac14 |
Vac14 homolog (S. cerevisiae) |
31284 |
0.14 |
chr11_5740506_5741309 | 1.36 |
Urgcp |
upregulator of cell proliferation |
239 |
0.89 |
chr1_51872793_51872944 | 1.36 |
Gm28323 |
predicted gene 28323 |
6740 |
0.16 |
chr6_72389979_72390703 | 1.36 |
Vamp8 |
vesicle-associated membrane protein 8 |
362 |
0.76 |
chr9_108301892_108302239 | 1.35 |
Tcta |
T cell leukemia translocation altered gene |
3883 |
0.09 |
chr14_54993778_54993936 | 1.35 |
Myh7 |
myosin, heavy polypeptide 7, cardiac muscle, beta |
166 |
0.86 |
chr6_97311994_97312190 | 1.35 |
Frmd4b |
FERM domain containing 4B |
288 |
0.93 |
chr5_65492817_65493477 | 1.35 |
4930589O11Rik |
RIKEN cDNA 4930589O11 gene |
51 |
0.48 |
chr17_29347287_29347638 | 1.34 |
Mtch1 |
mitochondrial carrier 1 |
54 |
0.95 |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.9 | 4.5 | GO:2001171 | positive regulation of ATP biosynthetic process(GO:2001171) |
0.7 | 2.2 | GO:0045896 | regulation of transcription during mitosis(GO:0045896) positive regulation of transcription during mitosis(GO:0045897) |
0.6 | 2.6 | GO:1902093 | positive regulation of sperm motility(GO:1902093) |
0.6 | 1.8 | GO:0070973 | protein localization to endoplasmic reticulum exit site(GO:0070973) |
0.6 | 2.4 | GO:0010510 | regulation of acetyl-CoA biosynthetic process from pyruvate(GO:0010510) |
0.5 | 1.5 | GO:0043201 | response to leucine(GO:0043201) cellular response to leucine(GO:0071233) |
0.5 | 2.5 | GO:0043415 | positive regulation of skeletal muscle tissue regeneration(GO:0043415) |
0.5 | 1.5 | GO:0044333 | Wnt signaling pathway involved in digestive tract morphogenesis(GO:0044333) |
0.5 | 1.9 | GO:0090168 | Golgi reassembly(GO:0090168) |
0.4 | 2.2 | GO:0048133 | germ-line stem cell division(GO:0042078) male germ-line stem cell asymmetric division(GO:0048133) germline stem cell asymmetric division(GO:0098728) |
0.4 | 1.3 | GO:0090271 | positive regulation of fibroblast growth factor production(GO:0090271) |
0.3 | 1.0 | GO:0036394 | amylase secretion(GO:0036394) |
0.3 | 2.0 | GO:0014721 | voluntary skeletal muscle contraction(GO:0003010) twitch skeletal muscle contraction(GO:0014721) |
0.3 | 1.0 | GO:0032513 | negative regulation of protein phosphatase type 2B activity(GO:0032513) |
0.3 | 1.0 | GO:0021524 | visceral motor neuron differentiation(GO:0021524) |
0.3 | 1.0 | GO:2000017 | positive regulation of determination of dorsal identity(GO:2000017) |
0.3 | 1.3 | GO:1901164 | negative regulation of trophoblast cell migration(GO:1901164) |
0.3 | 0.9 | GO:0040031 | snRNA modification(GO:0040031) |
0.3 | 0.6 | GO:1900019 | regulation of protein kinase C activity(GO:1900019) positive regulation of protein kinase C activity(GO:1900020) |
0.3 | 1.2 | GO:0097039 | protein linear polyubiquitination(GO:0097039) |
0.3 | 0.9 | GO:1900060 | negative regulation of ceramide biosynthetic process(GO:1900060) |
0.3 | 1.4 | GO:0010606 | positive regulation of cytoplasmic mRNA processing body assembly(GO:0010606) |
0.3 | 1.4 | GO:0033132 | negative regulation of glucokinase activity(GO:0033132) negative regulation of hexokinase activity(GO:1903300) |
0.3 | 0.3 | GO:0014904 | myotube cell development(GO:0014904) |
0.3 | 1.3 | GO:0060075 | regulation of resting membrane potential(GO:0060075) |
0.3 | 0.8 | GO:1904059 | regulation of locomotor rhythm(GO:1904059) |
0.3 | 0.5 | GO:0036166 | phenotypic switching(GO:0036166) |
0.2 | 0.5 | GO:1901078 | negative regulation of relaxation of muscle(GO:1901078) |
0.2 | 0.7 | GO:0097167 | circadian regulation of translation(GO:0097167) |
0.2 | 0.9 | GO:0016321 | female meiosis chromosome segregation(GO:0016321) |
0.2 | 1.4 | GO:0006621 | protein retention in ER lumen(GO:0006621) |
0.2 | 0.7 | GO:0061366 | behavioral response to chemical pain(GO:0061366) behavioral response to formalin induced pain(GO:0061368) |
0.2 | 0.7 | GO:0003419 | growth plate cartilage chondrocyte proliferation(GO:0003419) |
0.2 | 0.9 | GO:0010288 | response to lead ion(GO:0010288) |
0.2 | 0.6 | GO:0035359 | negative regulation of peroxisome proliferator activated receptor signaling pathway(GO:0035359) |
0.2 | 0.4 | GO:0090296 | regulation of mitochondrial DNA replication(GO:0090296) |
0.2 | 0.4 | GO:2000974 | negative regulation of pro-B cell differentiation(GO:2000974) |
0.2 | 1.0 | GO:0002326 | B cell lineage commitment(GO:0002326) |
0.2 | 0.8 | GO:0070836 | caveola assembly(GO:0070836) |
0.2 | 1.4 | GO:0051151 | negative regulation of smooth muscle cell differentiation(GO:0051151) |
0.2 | 0.6 | GO:0006848 | pyruvate transport(GO:0006848) pyruvate transmembrane transport(GO:1901475) |
0.2 | 0.2 | GO:0090156 | negative regulation of sphingolipid biosynthetic process(GO:0090155) cellular sphingolipid homeostasis(GO:0090156) |
0.2 | 0.6 | GO:0097623 | potassium ion export across plasma membrane(GO:0097623) |
0.2 | 0.6 | GO:0030210 | heparin biosynthetic process(GO:0030210) |
0.2 | 0.6 | GO:1902268 | negative regulation of polyamine transmembrane transport(GO:1902268) |
0.2 | 0.7 | GO:0060528 | secretory columnal luminar epithelial cell differentiation involved in prostate glandular acinus development(GO:0060528) |
0.2 | 1.6 | GO:0006264 | mitochondrial DNA replication(GO:0006264) |
0.2 | 1.4 | GO:0001778 | plasma membrane repair(GO:0001778) |
0.2 | 0.7 | GO:0030035 | microspike assembly(GO:0030035) |
0.2 | 0.5 | GO:0007494 | midgut development(GO:0007494) |
0.2 | 0.5 | GO:0070827 | chromatin maintenance(GO:0070827) |
0.2 | 0.7 | GO:1903225 | negative regulation of endodermal cell differentiation(GO:1903225) |
0.2 | 0.5 | GO:0007227 | signal transduction downstream of smoothened(GO:0007227) |
0.2 | 0.5 | GO:2000646 | positive regulation of receptor catabolic process(GO:2000646) |
0.2 | 0.5 | GO:0045041 | protein import into mitochondrial intermembrane space(GO:0045041) |
0.2 | 0.6 | GO:0035795 | negative regulation of mitochondrial membrane permeability(GO:0035795) |
0.2 | 0.8 | GO:0006824 | cobalt ion transport(GO:0006824) |
0.1 | 0.6 | GO:0002741 | positive regulation of cytokine secretion involved in immune response(GO:0002741) |
0.1 | 2.1 | GO:0003334 | keratinocyte development(GO:0003334) |
0.1 | 0.3 | GO:0061511 | centriole elongation(GO:0061511) |
0.1 | 0.4 | GO:0060161 | positive regulation of dopamine receptor signaling pathway(GO:0060161) |
0.1 | 0.6 | GO:0008626 | granzyme-mediated apoptotic signaling pathway(GO:0008626) |
0.1 | 0.4 | GO:2000304 | positive regulation of sphingolipid biosynthetic process(GO:0090154) positive regulation of ceramide biosynthetic process(GO:2000304) |
0.1 | 2.6 | GO:0071260 | cellular response to mechanical stimulus(GO:0071260) |
0.1 | 0.8 | GO:1902414 | protein localization to cell junction(GO:1902414) |
0.1 | 0.1 | GO:1902075 | cellular response to salt(GO:1902075) |
0.1 | 0.3 | GO:0034214 | protein hexamerization(GO:0034214) |
0.1 | 0.3 | GO:1990144 | intrinsic apoptotic signaling pathway in response to hypoxia(GO:1990144) |
0.1 | 0.4 | GO:0006982 | response to lipid hydroperoxide(GO:0006982) |
0.1 | 0.8 | GO:1902805 | positive regulation of synaptic vesicle transport(GO:1902805) |
0.1 | 0.3 | GO:0038027 | apolipoprotein A-I-mediated signaling pathway(GO:0038027) |
0.1 | 0.4 | GO:0061470 | T follicular helper cell differentiation(GO:0061470) |
0.1 | 0.4 | GO:0071926 | cannabinoid signaling pathway(GO:0038171) endocannabinoid signaling pathway(GO:0071926) |
0.1 | 1.6 | GO:0043486 | histone exchange(GO:0043486) |
0.1 | 0.7 | GO:0031584 | activation of phospholipase D activity(GO:0031584) |
0.1 | 0.7 | GO:0060903 | positive regulation of meiosis I(GO:0060903) |
0.1 | 0.2 | GO:0070384 | Harderian gland development(GO:0070384) |
0.1 | 1.2 | GO:0045721 | negative regulation of gluconeogenesis(GO:0045721) |
0.1 | 0.8 | GO:0023035 | CD40 signaling pathway(GO:0023035) |
0.1 | 0.2 | GO:1901301 | regulation of cargo loading into COPII-coated vesicle(GO:1901301) |
0.1 | 0.3 | GO:0036438 | maintenance of lens transparency(GO:0036438) |
0.1 | 0.6 | GO:0090336 | positive regulation of brown fat cell differentiation(GO:0090336) |
0.1 | 0.5 | GO:0016576 | histone dephosphorylation(GO:0016576) |
0.1 | 0.8 | GO:0002756 | MyD88-independent toll-like receptor signaling pathway(GO:0002756) |
0.1 | 0.2 | GO:0061419 | positive regulation of transcription from RNA polymerase II promoter in response to hypoxia(GO:0061419) |
0.1 | 0.3 | GO:1904706 | negative regulation of vascular smooth muscle cell proliferation(GO:1904706) |
0.1 | 1.1 | GO:0046085 | adenosine metabolic process(GO:0046085) |
0.1 | 0.7 | GO:1902902 | negative regulation of autophagosome assembly(GO:1902902) |
0.1 | 0.3 | GO:0035553 | oxidative RNA demethylation(GO:0035513) oxidative single-stranded RNA demethylation(GO:0035553) |
0.1 | 0.7 | GO:1901678 | iron coordination entity transport(GO:1901678) |
0.1 | 0.3 | GO:0097296 | activation of cysteine-type endopeptidase activity involved in apoptotic signaling pathway(GO:0097296) |
0.1 | 0.4 | GO:0072697 | protein localization to cell cortex(GO:0072697) |
0.1 | 1.8 | GO:1903861 | regulation of dendrite extension(GO:1903859) positive regulation of dendrite extension(GO:1903861) |
0.1 | 0.3 | GO:2000686 | regulation of rubidium ion transmembrane transporter activity(GO:2000686) |
0.1 | 0.6 | GO:0045629 | negative regulation of T-helper 2 cell differentiation(GO:0045629) |
0.1 | 0.6 | GO:1903799 | negative regulation of production of miRNAs involved in gene silencing by miRNA(GO:1903799) |
0.1 | 0.3 | GO:2000467 | positive regulation of glycogen (starch) synthase activity(GO:2000467) |
0.1 | 0.5 | GO:0032596 | protein transport into membrane raft(GO:0032596) |
0.1 | 0.6 | GO:0010668 | ectodermal cell differentiation(GO:0010668) |
0.1 | 0.6 | GO:0018401 | peptidyl-proline hydroxylation to 4-hydroxy-L-proline(GO:0018401) |
0.1 | 0.3 | GO:0048633 | positive regulation of skeletal muscle tissue growth(GO:0048633) |
0.1 | 0.1 | GO:1900825 | regulation of membrane depolarization during cardiac muscle cell action potential(GO:1900825) |
0.1 | 0.3 | GO:0050717 | positive regulation of interleukin-1 alpha secretion(GO:0050717) |
0.1 | 0.4 | GO:0046600 | negative regulation of centriole replication(GO:0046600) |
0.1 | 0.3 | GO:0006068 | ethanol catabolic process(GO:0006068) |
0.1 | 0.2 | GO:0002309 | T cell proliferation involved in immune response(GO:0002309) |
0.1 | 0.6 | GO:0006477 | protein sulfation(GO:0006477) |
0.1 | 0.3 | GO:0001951 | intestinal D-glucose absorption(GO:0001951) |
0.1 | 0.5 | GO:0090166 | Golgi disassembly(GO:0090166) |
0.1 | 0.8 | GO:0000730 | DNA recombinase assembly(GO:0000730) double-strand break repair via synthesis-dependent strand annealing(GO:0045003) |
0.1 | 0.6 | GO:0090267 | positive regulation of mitotic cell cycle spindle assembly checkpoint(GO:0090267) |
0.1 | 0.2 | GO:1901187 | regulation of ephrin receptor signaling pathway(GO:1901187) |
0.1 | 0.4 | GO:0034454 | microtubule anchoring at centrosome(GO:0034454) |
0.1 | 0.1 | GO:1901382 | chorionic trophoblast cell proliferation(GO:0097360) regulation of chorionic trophoblast cell proliferation(GO:1901382) |
0.1 | 0.2 | GO:0000965 | mitochondrial RNA 3'-end processing(GO:0000965) |
0.1 | 1.2 | GO:0007095 | mitotic G2 DNA damage checkpoint(GO:0007095) |
0.1 | 0.6 | GO:0002315 | marginal zone B cell differentiation(GO:0002315) |
0.1 | 0.5 | GO:0035330 | regulation of hippo signaling(GO:0035330) |
0.1 | 0.3 | GO:0001777 | T cell homeostatic proliferation(GO:0001777) |
0.1 | 0.4 | GO:0045714 | regulation of low-density lipoprotein particle receptor biosynthetic process(GO:0045714) |
0.1 | 0.3 | GO:0061052 | negative regulation of cell growth involved in cardiac muscle cell development(GO:0061052) |
0.1 | 0.7 | GO:0010614 | negative regulation of cardiac muscle hypertrophy(GO:0010614) |
0.1 | 0.3 | GO:0021775 | smoothened signaling pathway involved in ventral spinal cord interneuron specification(GO:0021775) smoothened signaling pathway involved in spinal cord motor neuron cell fate specification(GO:0021776) |
0.1 | 0.3 | GO:0016480 | negative regulation of transcription from RNA polymerase III promoter(GO:0016480) |
0.1 | 0.3 | GO:1903715 | regulation of aerobic respiration(GO:1903715) |
0.1 | 0.1 | GO:0071314 | cellular response to cocaine(GO:0071314) |
0.1 | 0.3 | GO:0032286 | central nervous system myelin maintenance(GO:0032286) |
0.1 | 0.2 | GO:2000384 | regulation of ectoderm development(GO:2000383) negative regulation of ectoderm development(GO:2000384) |
0.1 | 1.2 | GO:0002076 | osteoblast development(GO:0002076) |
0.1 | 0.2 | GO:0002904 | positive regulation of B cell apoptotic process(GO:0002904) |
0.1 | 0.2 | GO:0015014 | heparan sulfate proteoglycan biosynthetic process, polysaccharide chain biosynthetic process(GO:0015014) |
0.1 | 0.6 | GO:0006995 | cellular response to nitrogen starvation(GO:0006995) cellular response to nitrogen levels(GO:0043562) |
0.1 | 0.8 | GO:0035563 | positive regulation of chromatin binding(GO:0035563) |
0.1 | 0.5 | GO:0070257 | positive regulation of mucus secretion(GO:0070257) |
0.1 | 1.2 | GO:0006474 | N-terminal protein amino acid acetylation(GO:0006474) |
0.1 | 0.2 | GO:2000857 | positive regulation of mineralocorticoid secretion(GO:2000857) positive regulation of aldosterone secretion(GO:2000860) |
0.1 | 0.2 | GO:0050703 | interleukin-1 alpha secretion(GO:0050703) |
0.1 | 0.5 | GO:0030321 | transepithelial chloride transport(GO:0030321) |
0.1 | 0.2 | GO:1990036 | calcium ion import into sarcoplasmic reticulum(GO:1990036) |
0.1 | 0.3 | GO:0045345 | MHC class I biosynthetic process(GO:0045341) regulation of MHC class I biosynthetic process(GO:0045343) positive regulation of MHC class I biosynthetic process(GO:0045345) |
0.1 | 0.5 | GO:0048312 | intracellular distribution of mitochondria(GO:0048312) |
0.1 | 0.3 | GO:0035735 | intraciliary transport involved in cilium morphogenesis(GO:0035735) |
0.1 | 0.4 | GO:0060373 | regulation of ventricular cardiac muscle cell membrane depolarization(GO:0060373) |
0.1 | 0.1 | GO:0043321 | regulation of natural killer cell degranulation(GO:0043321) |
0.1 | 0.1 | GO:0052203 | modulation of catalytic activity in other organism involved in symbiotic interaction(GO:0052203) modulation by host of symbiont catalytic activity(GO:0052422) |
0.1 | 0.1 | GO:0002051 | osteoblast fate commitment(GO:0002051) |
0.1 | 0.7 | GO:0001921 | positive regulation of receptor recycling(GO:0001921) |
0.1 | 0.4 | GO:0010746 | regulation of plasma membrane long-chain fatty acid transport(GO:0010746) |
0.1 | 0.3 | GO:1902036 | regulation of hematopoietic stem cell differentiation(GO:1902036) |
0.1 | 1.3 | GO:0009251 | glycogen catabolic process(GO:0005980) glucan catabolic process(GO:0009251) cellular polysaccharide catabolic process(GO:0044247) |
0.1 | 0.4 | GO:0099515 | actin filament-based transport(GO:0099515) |
0.1 | 1.3 | GO:0031571 | mitotic G1 DNA damage checkpoint(GO:0031571) |
0.1 | 0.1 | GO:0042117 | monocyte activation(GO:0042117) |
0.1 | 0.3 | GO:0034975 | protein folding in endoplasmic reticulum(GO:0034975) |
0.1 | 0.1 | GO:0015819 | lysine transport(GO:0015819) |
0.1 | 0.2 | GO:0000272 | polysaccharide catabolic process(GO:0000272) |
0.1 | 0.1 | GO:0060842 | arterial endothelial cell differentiation(GO:0060842) |
0.1 | 0.1 | GO:0051081 | membrane disassembly(GO:0030397) nuclear envelope disassembly(GO:0051081) |
0.1 | 0.1 | GO:1900104 | hyaluranon cable assembly(GO:0036118) regulation of hyaluranon cable assembly(GO:1900104) positive regulation of hyaluranon cable assembly(GO:1900106) |
0.1 | 0.1 | GO:0061325 | cell proliferation involved in outflow tract morphogenesis(GO:0061325) |
0.1 | 0.4 | GO:0007016 | cytoskeletal anchoring at plasma membrane(GO:0007016) |
0.1 | 0.2 | GO:0046951 | ketone body biosynthetic process(GO:0046951) |
0.1 | 0.5 | GO:0010793 | regulation of mRNA export from nucleus(GO:0010793) regulation of ribonucleoprotein complex localization(GO:2000197) |
0.1 | 0.2 | GO:0036515 | serotonergic neuron axon guidance(GO:0036515) |
0.1 | 0.5 | GO:0071493 | cellular response to UV-B(GO:0071493) |
0.1 | 0.2 | GO:0043328 | late endosome to vacuole transport via multivesicular body sorting pathway(GO:0032511) protein targeting to vacuole involved in ubiquitin-dependent protein catabolic process via the multivesicular body sorting pathway(GO:0043328) |
0.1 | 0.1 | GO:0010694 | positive regulation of alkaline phosphatase activity(GO:0010694) |
0.1 | 0.4 | GO:0006545 | glycine biosynthetic process(GO:0006545) |
0.1 | 0.3 | GO:2001260 | regulation of semaphorin-plexin signaling pathway(GO:2001260) |
0.1 | 0.4 | GO:0010807 | regulation of synaptic vesicle priming(GO:0010807) |
0.1 | 0.7 | GO:0036158 | outer dynein arm assembly(GO:0036158) |
0.1 | 0.5 | GO:0031274 | positive regulation of pseudopodium assembly(GO:0031274) |
0.1 | 0.3 | GO:0045901 | positive regulation of translational elongation(GO:0045901) |
0.1 | 0.5 | GO:0030953 | astral microtubule organization(GO:0030953) |
0.1 | 1.2 | GO:0090162 | establishment of epithelial cell polarity(GO:0090162) |
0.1 | 0.1 | GO:1902445 | regulation of mitochondrial membrane permeability involved in programmed necrotic cell death(GO:1902445) |
0.1 | 0.1 | GO:0031118 | rRNA pseudouridine synthesis(GO:0031118) |
0.1 | 0.1 | GO:0060931 | sinoatrial node cell differentiation(GO:0060921) sinoatrial node cell development(GO:0060931) |
0.1 | 0.3 | GO:0061635 | regulation of protein complex stability(GO:0061635) |
0.1 | 2.3 | GO:0072583 | clathrin-mediated endocytosis(GO:0072583) |
0.1 | 0.3 | GO:0060050 | positive regulation of protein glycosylation(GO:0060050) |
0.1 | 0.2 | GO:0032898 | neurotrophin production(GO:0032898) |
0.1 | 0.1 | GO:0001560 | regulation of cell growth by extracellular stimulus(GO:0001560) |
0.1 | 0.2 | GO:0097428 | protein maturation by iron-sulfur cluster transfer(GO:0097428) |
0.1 | 0.3 | GO:0090400 | stress-induced premature senescence(GO:0090400) |
0.1 | 0.1 | GO:0014738 | regulation of muscle hyperplasia(GO:0014738) muscle hyperplasia(GO:0014900) |
0.1 | 0.2 | GO:0006533 | aspartate catabolic process(GO:0006533) |
0.1 | 0.2 | GO:0018214 | peptidyl-glutamic acid carboxylation(GO:0017187) protein carboxylation(GO:0018214) |
0.1 | 0.5 | GO:0046007 | negative regulation of activated T cell proliferation(GO:0046007) |
0.1 | 0.2 | GO:0061622 | galactose catabolic process via UDP-galactose(GO:0033499) glycolytic process through glucose-1-phosphate(GO:0061622) glycolytic process from galactose(GO:0061623) |
0.1 | 0.3 | GO:0035810 | positive regulation of urine volume(GO:0035810) |
0.1 | 0.2 | GO:0045628 | regulation of T-helper 2 cell differentiation(GO:0045628) |
0.1 | 0.6 | GO:0031115 | negative regulation of microtubule polymerization(GO:0031115) |
0.1 | 0.5 | GO:0040016 | embryonic cleavage(GO:0040016) |
0.1 | 0.2 | GO:0060671 | epithelial cell differentiation involved in embryonic placenta development(GO:0060671) epithelial cell morphogenesis involved in placental branching(GO:0060672) |
0.1 | 0.1 | GO:0001543 | ovarian follicle rupture(GO:0001543) |
0.1 | 0.2 | GO:0035461 | vitamin transmembrane transport(GO:0035461) |
0.1 | 0.2 | GO:1902993 | positive regulation of beta-amyloid formation(GO:1902004) positive regulation of amyloid precursor protein catabolic process(GO:1902993) |
0.1 | 0.1 | GO:1903984 | positive regulation of TRAIL-activated apoptotic signaling pathway(GO:1903984) |
0.1 | 0.2 | GO:2000504 | positive regulation of blood vessel remodeling(GO:2000504) |
0.1 | 0.1 | GO:0002432 | granuloma formation(GO:0002432) |
0.1 | 0.1 | GO:0010908 | regulation of heparan sulfate proteoglycan biosynthetic process(GO:0010908) positive regulation of heparan sulfate proteoglycan biosynthetic process(GO:0010909) positive regulation of proteoglycan biosynthetic process(GO:1902730) |
0.1 | 0.1 | GO:1901979 | regulation of inward rectifier potassium channel activity(GO:1901979) |
0.1 | 0.2 | GO:1902255 | positive regulation of intrinsic apoptotic signaling pathway by p53 class mediator(GO:1902255) |
0.1 | 0.1 | GO:0039536 | negative regulation of RIG-I signaling pathway(GO:0039536) |
0.1 | 0.3 | GO:0006572 | tyrosine catabolic process(GO:0006572) |
0.1 | 0.2 | GO:0043974 | histone H3-K27 acetylation(GO:0043974) regulation of histone H3-K27 acetylation(GO:1901674) |
0.1 | 0.2 | GO:0071440 | regulation of histone H3-K14 acetylation(GO:0071440) positive regulation of histone H3-K14 acetylation(GO:0071442) |
0.1 | 0.1 | GO:0003289 | septum primum development(GO:0003284) atrial septum primum morphogenesis(GO:0003289) |
0.1 | 0.1 | GO:0071280 | cellular response to copper ion(GO:0071280) |
0.1 | 0.7 | GO:0014850 | response to muscle activity(GO:0014850) |
0.1 | 1.4 | GO:0030513 | positive regulation of BMP signaling pathway(GO:0030513) |
0.1 | 0.3 | GO:0006528 | asparagine metabolic process(GO:0006528) |
0.1 | 0.1 | GO:1902534 | single-organism membrane invagination(GO:1902534) |
0.1 | 0.2 | GO:0034499 | late endosome to Golgi transport(GO:0034499) |
0.1 | 0.2 | GO:1900738 | positive regulation of phospholipase C-activating G-protein coupled receptor signaling pathway(GO:1900738) |
0.1 | 0.1 | GO:1903599 | positive regulation of mitophagy(GO:1903599) |
0.1 | 1.0 | GO:0046597 | negative regulation of viral entry into host cell(GO:0046597) |
0.1 | 0.5 | GO:0030813 | positive regulation of nucleotide catabolic process(GO:0030813) |
0.1 | 0.4 | GO:0038063 | collagen-activated tyrosine kinase receptor signaling pathway(GO:0038063) |
0.1 | 0.1 | GO:0000720 | pyrimidine dimer repair by nucleotide-excision repair(GO:0000720) |
0.1 | 0.7 | GO:0043984 | histone H4-K16 acetylation(GO:0043984) |
0.1 | 0.3 | GO:0000395 | mRNA 5'-splice site recognition(GO:0000395) |
0.1 | 0.1 | GO:0070682 | proteasome regulatory particle assembly(GO:0070682) |
0.1 | 0.2 | GO:0070086 | ubiquitin-dependent endocytosis(GO:0070086) |
0.1 | 0.3 | GO:0006384 | transcription initiation from RNA polymerase III promoter(GO:0006384) |
0.1 | 0.2 | GO:2000427 | positive regulation of apoptotic cell clearance(GO:2000427) |
0.1 | 0.2 | GO:0006172 | ADP biosynthetic process(GO:0006172) |
0.1 | 0.1 | GO:0039663 | fusion of virus membrane with host plasma membrane(GO:0019064) membrane fusion involved in viral entry into host cell(GO:0039663) multi-organism membrane fusion(GO:0044800) |
0.1 | 0.1 | GO:0035995 | detection of muscle stretch(GO:0035995) |
0.1 | 0.2 | GO:0061450 | trophoblast cell migration(GO:0061450) |
0.1 | 0.2 | GO:0035405 | histone-threonine phosphorylation(GO:0035405) |
0.1 | 0.2 | GO:0019254 | carnitine metabolic process, CoA-linked(GO:0019254) |
0.1 | 0.1 | GO:0001996 | positive regulation of heart rate by epinephrine-norepinephrine(GO:0001996) |
0.1 | 0.3 | GO:0048387 | negative regulation of retinoic acid receptor signaling pathway(GO:0048387) |
0.0 | 0.2 | GO:0031659 | regulation of cyclin-dependent protein serine/threonine kinase activity involved in G1/S transition of mitotic cell cycle(GO:0031657) positive regulation of cyclin-dependent protein serine/threonine kinase activity involved in G1/S transition of mitotic cell cycle(GO:0031659) |
0.0 | 0.5 | GO:0032486 | Rap protein signal transduction(GO:0032486) |
0.0 | 0.2 | GO:0050882 | voluntary musculoskeletal movement(GO:0050882) |
0.0 | 0.1 | GO:1902809 | regulation of skeletal muscle fiber differentiation(GO:1902809) |
0.0 | 0.1 | GO:0039534 | negative regulation of MDA-5 signaling pathway(GO:0039534) |
0.0 | 0.3 | GO:0070345 | negative regulation of fat cell proliferation(GO:0070345) |
0.0 | 0.1 | GO:0019676 | ammonia assimilation cycle(GO:0019676) |
0.0 | 2.6 | GO:1900181 | negative regulation of protein localization to nucleus(GO:1900181) |
0.0 | 0.0 | GO:0060710 | chorio-allantoic fusion(GO:0060710) |
0.0 | 0.2 | GO:0006987 | activation of signaling protein activity involved in unfolded protein response(GO:0006987) |
0.0 | 0.3 | GO:0018065 | protein-cofactor linkage(GO:0018065) |
0.0 | 0.1 | GO:0071712 | ER-associated misfolded protein catabolic process(GO:0071712) |
0.0 | 0.2 | GO:0007256 | activation of JNKK activity(GO:0007256) |
0.0 | 0.3 | GO:0006032 | chitin metabolic process(GO:0006030) chitin catabolic process(GO:0006032) |
0.0 | 0.1 | GO:1903261 | regulation of serine phosphorylation of STAT3 protein(GO:1903261) |
0.0 | 0.2 | GO:0070814 | hydrogen sulfide biosynthetic process(GO:0070814) |
0.0 | 0.1 | GO:0035582 | sequestering of BMP in extracellular matrix(GO:0035582) |
0.0 | 0.1 | GO:0001920 | negative regulation of receptor recycling(GO:0001920) |
0.0 | 0.1 | GO:0007195 | adenylate cyclase-inhibiting dopamine receptor signaling pathway(GO:0007195) |
0.0 | 0.3 | GO:1902018 | negative regulation of cilium assembly(GO:1902018) |
0.0 | 1.0 | GO:0030815 | negative regulation of cyclic nucleotide metabolic process(GO:0030800) negative regulation of cAMP metabolic process(GO:0030815) |
0.0 | 0.3 | GO:0006102 | isocitrate metabolic process(GO:0006102) |
0.0 | 0.1 | GO:0030886 | negative regulation of myeloid dendritic cell activation(GO:0030886) |
0.0 | 0.4 | GO:0000244 | spliceosomal tri-snRNP complex assembly(GO:0000244) |
0.0 | 0.2 | GO:0035865 | response to potassium ion(GO:0035864) cellular response to potassium ion(GO:0035865) |
0.0 | 0.1 | GO:0046341 | CDP-diacylglycerol metabolic process(GO:0046341) |
0.0 | 0.1 | GO:0002414 | immunoglobulin transcytosis in epithelial cells(GO:0002414) |
0.0 | 0.1 | GO:1903525 | regulation of membrane tubulation(GO:1903525) |
0.0 | 0.1 | GO:0099558 | maintenance of synapse structure(GO:0099558) |
0.0 | 0.2 | GO:1902570 | protein localization to nucleolus(GO:1902570) |
0.0 | 0.1 | GO:0019464 | glycine catabolic process(GO:0006546) glycine decarboxylation via glycine cleavage system(GO:0019464) |
0.0 | 0.1 | GO:0023021 | termination of signal transduction(GO:0023021) |
0.0 | 0.1 | GO:0071895 | odontoblast differentiation(GO:0071895) |
0.0 | 0.4 | GO:0046475 | glycerophospholipid catabolic process(GO:0046475) |
0.0 | 0.2 | GO:1901387 | positive regulation of voltage-gated calcium channel activity(GO:1901387) |
0.0 | 0.7 | GO:0006896 | Golgi to vacuole transport(GO:0006896) |
0.0 | 0.5 | GO:0016556 | mRNA modification(GO:0016556) |
0.0 | 0.3 | GO:0015670 | carbon dioxide transport(GO:0015670) |
0.0 | 0.2 | GO:1903553 | positive regulation of extracellular exosome assembly(GO:1903553) |
0.0 | 0.3 | GO:0000012 | single strand break repair(GO:0000012) |
0.0 | 0.0 | GO:0061502 | early endosome to recycling endosome transport(GO:0061502) |
0.0 | 0.4 | GO:0051481 | negative regulation of cytosolic calcium ion concentration(GO:0051481) |
0.0 | 0.1 | GO:0036072 | intramembranous ossification(GO:0001957) direct ossification(GO:0036072) |
0.0 | 0.2 | GO:0035106 | operant conditioning(GO:0035106) |
0.0 | 0.2 | GO:1903352 | ornithine transport(GO:0015822) L-ornithine transmembrane transport(GO:1903352) |
0.0 | 0.1 | GO:0032287 | peripheral nervous system myelin maintenance(GO:0032287) |
0.0 | 0.4 | GO:0000463 | maturation of LSU-rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000463) |
0.0 | 0.0 | GO:1901897 | regulation of relaxation of cardiac muscle(GO:1901897) |
0.0 | 0.1 | GO:0042364 | water-soluble vitamin biosynthetic process(GO:0042364) |
0.0 | 0.4 | GO:0009648 | photoperiodism(GO:0009648) |
0.0 | 0.4 | GO:0014887 | muscle hypertrophy in response to stress(GO:0003299) cardiac muscle adaptation(GO:0014887) cardiac muscle hypertrophy in response to stress(GO:0014898) |
0.0 | 0.6 | GO:0042026 | protein refolding(GO:0042026) |
0.0 | 0.4 | GO:0000083 | regulation of transcription involved in G1/S transition of mitotic cell cycle(GO:0000083) |
0.0 | 0.3 | GO:0033147 | negative regulation of intracellular estrogen receptor signaling pathway(GO:0033147) |
0.0 | 0.1 | GO:0043137 | DNA replication, removal of RNA primer(GO:0043137) |
0.0 | 0.4 | GO:0000188 | inactivation of MAPK activity(GO:0000188) |
0.0 | 0.1 | GO:0002278 | eosinophil activation involved in immune response(GO:0002278) eosinophil mediated immunity(GO:0002447) eosinophil degranulation(GO:0043308) |
0.0 | 1.1 | GO:0060325 | face morphogenesis(GO:0060325) |
0.0 | 0.1 | GO:0014053 | negative regulation of gamma-aminobutyric acid secretion(GO:0014053) |
0.0 | 0.0 | GO:0032911 | negative regulation of transforming growth factor beta1 production(GO:0032911) |
0.0 | 0.1 | GO:2000074 | regulation of type B pancreatic cell development(GO:2000074) |
0.0 | 0.1 | GO:0060480 | lung goblet cell differentiation(GO:0060480) |
0.0 | 0.2 | GO:0008090 | retrograde axonal transport(GO:0008090) |
0.0 | 0.2 | GO:0033623 | regulation of integrin activation(GO:0033623) |
0.0 | 0.6 | GO:0033539 | fatty acid beta-oxidation using acyl-CoA dehydrogenase(GO:0033539) |
0.0 | 0.1 | GO:0010032 | meiotic chromosome condensation(GO:0010032) |
0.0 | 0.1 | GO:1901525 | negative regulation of macromitophagy(GO:1901525) |
0.0 | 0.1 | GO:0097242 | beta-amyloid clearance(GO:0097242) |
0.0 | 0.1 | GO:1904754 | positive regulation of vascular associated smooth muscle cell migration(GO:1904754) |
0.0 | 0.2 | GO:0050847 | progesterone receptor signaling pathway(GO:0050847) |
0.0 | 0.1 | GO:0050968 | detection of chemical stimulus involved in sensory perception of pain(GO:0050968) |
0.0 | 0.0 | GO:0061314 | Notch signaling involved in heart development(GO:0061314) |
0.0 | 0.2 | GO:0045717 | negative regulation of fatty acid biosynthetic process(GO:0045717) |
0.0 | 1.0 | GO:0061077 | chaperone-mediated protein folding(GO:0061077) |
0.0 | 0.1 | GO:0035283 | central nervous system segmentation(GO:0035283) brain segmentation(GO:0035284) |
0.0 | 0.2 | GO:0070544 | histone H3-K36 demethylation(GO:0070544) |
0.0 | 0.2 | GO:0045617 | negative regulation of keratinocyte differentiation(GO:0045617) |
0.0 | 0.1 | GO:1902514 | regulation of calcium ion transmembrane transport via high voltage-gated calcium channel(GO:1902514) |
0.0 | 0.0 | GO:0061343 | cell adhesion involved in heart morphogenesis(GO:0061343) |
0.0 | 0.1 | GO:0003383 | apical constriction(GO:0003383) |
0.0 | 0.2 | GO:0048539 | bone marrow development(GO:0048539) |
0.0 | 0.1 | GO:0071847 | TNFSF11-mediated signaling pathway(GO:0071847) |
0.0 | 0.1 | GO:0080154 | regulation of fertilization(GO:0080154) |
0.0 | 0.1 | GO:0035694 | mitochondrial protein catabolic process(GO:0035694) |
0.0 | 0.2 | GO:0009235 | cobalamin metabolic process(GO:0009235) |
0.0 | 0.1 | GO:0044791 | modulation by host of viral release from host cell(GO:0044789) positive regulation by host of viral release from host cell(GO:0044791) |
0.0 | 0.4 | GO:0045943 | positive regulation of transcription from RNA polymerase I promoter(GO:0045943) |
0.0 | 0.3 | GO:0009191 | ribonucleoside diphosphate catabolic process(GO:0009191) |
0.0 | 0.0 | GO:0036493 | positive regulation of translation in response to endoplasmic reticulum stress(GO:0036493) |
0.0 | 0.1 | GO:2000483 | negative regulation of interleukin-8 secretion(GO:2000483) |
0.0 | 0.1 | GO:0060448 | dichotomous subdivision of terminal units involved in lung branching(GO:0060448) |
0.0 | 0.2 | GO:0006488 | dolichol-linked oligosaccharide biosynthetic process(GO:0006488) |
0.0 | 0.3 | GO:0044068 | modulation by symbiont of host cellular process(GO:0044068) |
0.0 | 0.1 | GO:0007296 | vitellogenesis(GO:0007296) |
0.0 | 1.3 | GO:0006749 | glutathione metabolic process(GO:0006749) |
0.0 | 1.0 | GO:0006506 | GPI anchor biosynthetic process(GO:0006506) |
0.0 | 0.2 | GO:0002318 | myeloid progenitor cell differentiation(GO:0002318) |
0.0 | 0.2 | GO:0015868 | purine ribonucleotide transport(GO:0015868) |
0.0 | 0.1 | GO:1902459 | positive regulation of stem cell population maintenance(GO:1902459) |
0.0 | 0.1 | GO:0033058 | directional locomotion(GO:0033058) |
0.0 | 0.3 | GO:0035879 | lactate transport(GO:0015727) lactate transmembrane transport(GO:0035873) plasma membrane lactate transport(GO:0035879) |
0.0 | 0.1 | GO:0036159 | inner dynein arm assembly(GO:0036159) |
0.0 | 0.1 | GO:0033160 | positive regulation of protein import into nucleus, translocation(GO:0033160) |
0.0 | 0.1 | GO:0043985 | histone H4-R3 methylation(GO:0043985) |
0.0 | 0.2 | GO:0006013 | mannose metabolic process(GO:0006013) |
0.0 | 0.1 | GO:0055089 | fatty acid homeostasis(GO:0055089) |
0.0 | 0.1 | GO:0046726 | positive regulation by virus of viral protein levels in host cell(GO:0046726) |
0.0 | 0.4 | GO:0043968 | histone H2A acetylation(GO:0043968) |
0.0 | 0.3 | GO:0032780 | negative regulation of ATPase activity(GO:0032780) |
0.0 | 0.1 | GO:0090261 | positive regulation of inclusion body assembly(GO:0090261) |
0.0 | 0.1 | GO:0046104 | thymidine metabolic process(GO:0046104) |
0.0 | 0.1 | GO:0030091 | protein repair(GO:0030091) |
0.0 | 0.1 | GO:0000467 | exonucleolytic trimming involved in rRNA processing(GO:0000459) exonucleolytic trimming to generate mature 3'-end of 5.8S rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000467) |
0.0 | 0.1 | GO:0030853 | negative regulation of granulocyte differentiation(GO:0030853) |
0.0 | 0.1 | GO:0032803 | low-density lipoprotein particle receptor catabolic process(GO:0032802) regulation of low-density lipoprotein particle receptor catabolic process(GO:0032803) |
0.0 | 0.1 | GO:1900126 | negative regulation of hyaluronan biosynthetic process(GO:1900126) |
0.0 | 0.1 | GO:1990086 | lens fiber cell apoptotic process(GO:1990086) |
0.0 | 0.0 | GO:0098902 | regulation of membrane depolarization during action potential(GO:0098902) |
0.0 | 0.1 | GO:0097680 | double-strand break repair via classical nonhomologous end joining(GO:0097680) |
0.0 | 0.1 | GO:0042866 | pyruvate biosynthetic process(GO:0042866) |
0.0 | 0.1 | GO:0097500 | receptor localization to nonmotile primary cilium(GO:0097500) |
0.0 | 0.1 | GO:1901841 | regulation of high voltage-gated calcium channel activity(GO:1901841) |
0.0 | 0.2 | GO:0061154 | endothelial tube morphogenesis(GO:0061154) |
0.0 | 0.1 | GO:0048199 | vesicle targeting, to, from or within Golgi(GO:0048199) |
0.0 | 0.2 | GO:0042987 | amyloid precursor protein catabolic process(GO:0042987) |
0.0 | 0.3 | GO:0002931 | response to ischemia(GO:0002931) |
0.0 | 0.6 | GO:0070328 | acylglycerol homeostasis(GO:0055090) triglyceride homeostasis(GO:0070328) |
0.0 | 0.1 | GO:0033483 | gas homeostasis(GO:0033483) |
0.0 | 0.1 | GO:0060279 | positive regulation of ovulation(GO:0060279) |
0.0 | 0.2 | GO:0060052 | neurofilament cytoskeleton organization(GO:0060052) |
0.0 | 0.2 | GO:0002024 | diet induced thermogenesis(GO:0002024) adaptive thermogenesis(GO:1990845) |
0.0 | 0.1 | GO:0006296 | nucleotide-excision repair, DNA incision, 5'-to lesion(GO:0006296) |
0.0 | 0.0 | GO:2000491 | positive regulation of hepatic stellate cell activation(GO:2000491) |
0.0 | 0.2 | GO:0050901 | leukocyte tethering or rolling(GO:0050901) |
0.0 | 0.2 | GO:0045945 | positive regulation of transcription from RNA polymerase III promoter(GO:0045945) |
0.0 | 0.1 | GO:0071569 | protein ufmylation(GO:0071569) protein polyufmylation(GO:1990564) protein K69-linked ufmylation(GO:1990592) |
0.0 | 0.1 | GO:0051013 | microtubule severing(GO:0051013) |
0.0 | 0.1 | GO:0051001 | negative regulation of nitric-oxide synthase activity(GO:0051001) |
0.0 | 0.1 | GO:2000726 | negative regulation of cardiac muscle cell differentiation(GO:2000726) |
0.0 | 0.1 | GO:0010992 | ubiquitin homeostasis(GO:0010992) |
0.0 | 0.1 | GO:0060605 | tube lumen cavitation(GO:0060605) salivary gland cavitation(GO:0060662) |
0.0 | 0.1 | GO:0000389 | mRNA 3'-splice site recognition(GO:0000389) |
0.0 | 0.2 | GO:0051923 | sulfation(GO:0051923) |
0.0 | 0.1 | GO:0033227 | dsRNA transport(GO:0033227) |
0.0 | 0.1 | GO:0032482 | Rab protein signal transduction(GO:0032482) |
0.0 | 0.1 | GO:0098528 | skeletal muscle fiber differentiation(GO:0098528) |
0.0 | 0.1 | GO:0033327 | Leydig cell differentiation(GO:0033327) |
0.0 | 0.3 | GO:1901741 | positive regulation of myoblast fusion(GO:1901741) |
0.0 | 0.1 | GO:0006563 | L-serine metabolic process(GO:0006563) |
0.0 | 0.1 | GO:0010749 | regulation of nitric oxide mediated signal transduction(GO:0010749) |
0.0 | 0.2 | GO:0051764 | actin crosslink formation(GO:0051764) |
0.0 | 0.2 | GO:0097062 | dendritic spine maintenance(GO:0097062) |
0.0 | 0.1 | GO:0030421 | defecation(GO:0030421) |
0.0 | 0.1 | GO:0060510 | Type II pneumocyte differentiation(GO:0060510) |
0.0 | 0.1 | GO:0010936 | negative regulation of macrophage cytokine production(GO:0010936) |
0.0 | 0.3 | GO:0001675 | acrosome assembly(GO:0001675) |
0.0 | 0.1 | GO:0038165 | oncostatin-M-mediated signaling pathway(GO:0038165) |
0.0 | 0.1 | GO:0042532 | negative regulation of tyrosine phosphorylation of STAT protein(GO:0042532) |
0.0 | 0.2 | GO:1903025 | regulation of RNA polymerase II regulatory region sequence-specific DNA binding(GO:1903025) |
0.0 | 0.6 | GO:0043407 | negative regulation of MAP kinase activity(GO:0043407) |
0.0 | 0.1 | GO:0043652 | engulfment of apoptotic cell(GO:0043652) |
0.0 | 0.0 | GO:0014734 | skeletal muscle hypertrophy(GO:0014734) |
0.0 | 0.4 | GO:0009261 | ribonucleotide catabolic process(GO:0009261) |
0.0 | 0.1 | GO:0043569 | negative regulation of insulin-like growth factor receptor signaling pathway(GO:0043569) |
0.0 | 0.1 | GO:0060020 | Bergmann glial cell differentiation(GO:0060020) |
0.0 | 0.1 | GO:0019852 | L-ascorbic acid metabolic process(GO:0019852) |
0.0 | 0.1 | GO:0046485 | ether lipid metabolic process(GO:0046485) |
0.0 | 0.1 | GO:2000051 | negative regulation of non-canonical Wnt signaling pathway(GO:2000051) |
0.0 | 0.0 | GO:0009174 | UMP biosynthetic process(GO:0006222) pyrimidine ribonucleoside monophosphate metabolic process(GO:0009173) pyrimidine ribonucleoside monophosphate biosynthetic process(GO:0009174) UMP metabolic process(GO:0046049) |
0.0 | 0.1 | GO:0034383 | low-density lipoprotein particle clearance(GO:0034383) |
0.0 | 0.1 | GO:0000237 | leptotene(GO:0000237) |
0.0 | 0.0 | GO:1903223 | positive regulation of oxidative stress-induced neuron death(GO:1903223) |
0.0 | 0.1 | GO:1904491 | protein localization to ciliary transition zone(GO:1904491) |
0.0 | 0.2 | GO:0033137 | negative regulation of peptidyl-serine phosphorylation(GO:0033137) |
0.0 | 0.2 | GO:0051642 | centrosome localization(GO:0051642) |
0.0 | 0.0 | GO:0035789 | cell migration involved in kidney development(GO:0035787) cell migration involved in metanephros development(GO:0035788) metanephric mesenchymal cell migration(GO:0035789) positive regulation of metanephric mesenchymal cell migration by platelet-derived growth factor receptor-beta signaling pathway(GO:0035793) regulation of metanephric mesenchymal cell migration by platelet-derived growth factor receptor-beta signaling pathway(GO:1900238) regulation of metanephric mesenchymal cell migration(GO:2000589) positive regulation of metanephric mesenchymal cell migration(GO:2000591) |
0.0 | 0.0 | GO:0060948 | cardiac vascular smooth muscle cell development(GO:0060948) |
0.0 | 0.1 | GO:0097202 | activation of cysteine-type endopeptidase activity(GO:0097202) |
0.0 | 1.0 | GO:0006919 | activation of cysteine-type endopeptidase activity involved in apoptotic process(GO:0006919) |
0.0 | 0.1 | GO:0010792 | DNA double-strand break processing involved in repair via single-strand annealing(GO:0010792) |
0.0 | 0.2 | GO:0002021 | response to dietary excess(GO:0002021) |
0.0 | 0.4 | GO:0006182 | cGMP biosynthetic process(GO:0006182) |
0.0 | 0.1 | GO:0061303 | cornea development in camera-type eye(GO:0061303) |
0.0 | 0.1 | GO:0032211 | negative regulation of telomere maintenance via telomerase(GO:0032211) |
0.0 | 0.0 | GO:0006680 | glucosylceramide catabolic process(GO:0006680) |
0.0 | 0.1 | GO:0018094 | protein polyglycylation(GO:0018094) |
0.0 | 0.0 | GO:0035526 | retrograde transport, plasma membrane to Golgi(GO:0035526) |
0.0 | 0.1 | GO:0014029 | neural crest formation(GO:0014029) |
0.0 | 0.0 | GO:0072093 | ureteric bud invasion(GO:0072092) metanephric renal vesicle formation(GO:0072093) |
0.0 | 0.2 | GO:0050860 | negative regulation of T cell receptor signaling pathway(GO:0050860) |
0.0 | 0.1 | GO:0097320 | membrane tubulation(GO:0097320) |
0.0 | 0.1 | GO:0043353 | enucleate erythrocyte differentiation(GO:0043353) |
0.0 | 0.1 | GO:0006002 | fructose 6-phosphate metabolic process(GO:0006002) |
0.0 | 0.0 | GO:0019740 | nitrogen utilization(GO:0019740) |
0.0 | 0.1 | GO:2000060 | positive regulation of protein ubiquitination involved in ubiquitin-dependent protein catabolic process(GO:2000060) |
0.0 | 0.1 | GO:0014733 | regulation of skeletal muscle adaptation(GO:0014733) |
0.0 | 0.0 | GO:0051775 | response to redox state(GO:0051775) |
0.0 | 0.2 | GO:0046339 | diacylglycerol metabolic process(GO:0046339) |
0.0 | 0.0 | GO:0097694 | establishment of RNA localization to telomere(GO:0097694) |
0.0 | 0.1 | GO:0006363 | termination of RNA polymerase I transcription(GO:0006363) |
0.0 | 0.5 | GO:0048843 | negative regulation of axon extension involved in axon guidance(GO:0048843) |
0.0 | 0.0 | GO:0010745 | negative regulation of macrophage derived foam cell differentiation(GO:0010745) |
0.0 | 0.3 | GO:0071800 | podosome assembly(GO:0071800) |
0.0 | 0.1 | GO:0021699 | cerebellar cortex maturation(GO:0021699) |
0.0 | 0.7 | GO:0043666 | regulation of phosphoprotein phosphatase activity(GO:0043666) |
0.0 | 0.1 | GO:0045657 | positive regulation of monocyte differentiation(GO:0045657) |
0.0 | 0.1 | GO:0046929 | negative regulation of neurotransmitter secretion(GO:0046929) |
0.0 | 0.0 | GO:0019478 | D-amino acid catabolic process(GO:0019478) D-amino acid metabolic process(GO:0046416) |
0.0 | 0.0 | GO:0035771 | interleukin-4-mediated signaling pathway(GO:0035771) |
0.0 | 0.1 | GO:0006356 | regulation of transcription from RNA polymerase I promoter(GO:0006356) |
0.0 | 0.0 | GO:0060391 | positive regulation of SMAD protein import into nucleus(GO:0060391) |
0.0 | 0.0 | GO:0043497 | regulation of protein heterodimerization activity(GO:0043497) |
0.0 | 0.1 | GO:0007525 | somatic muscle development(GO:0007525) |
0.0 | 0.0 | GO:0051315 | attachment of mitotic spindle microtubules to kinetochore(GO:0051315) |
0.0 | 0.1 | GO:0046469 | platelet activating factor biosynthetic process(GO:0006663) platelet activating factor metabolic process(GO:0046469) |
0.0 | 0.1 | GO:0045040 | protein import into mitochondrial outer membrane(GO:0045040) |
0.0 | 0.0 | GO:0071694 | protein localization to extracellular region(GO:0071692) maintenance of protein location in extracellular region(GO:0071694) |
0.0 | 0.3 | GO:0015985 | energy coupled proton transport, down electrochemical gradient(GO:0015985) ATP synthesis coupled proton transport(GO:0015986) |
0.0 | 0.1 | GO:0042523 | regulation of tyrosine phosphorylation of Stat5 protein(GO:0042522) positive regulation of tyrosine phosphorylation of Stat5 protein(GO:0042523) |
0.0 | 0.0 | GO:1904124 | microglial cell migration(GO:1904124) regulation of microglial cell migration(GO:1904139) |
0.0 | 0.1 | GO:0042905 | 9-cis-retinoic acid biosynthetic process(GO:0042904) 9-cis-retinoic acid metabolic process(GO:0042905) |
0.0 | 0.2 | GO:0006670 | sphingosine metabolic process(GO:0006670) |
0.0 | 0.1 | GO:2000623 | regulation of nuclear-transcribed mRNA catabolic process, nonsense-mediated decay(GO:2000622) negative regulation of nuclear-transcribed mRNA catabolic process, nonsense-mediated decay(GO:2000623) |
0.0 | 0.0 | GO:0061152 | trachea submucosa development(GO:0061152) trachea gland development(GO:0061153) |
0.0 | 0.1 | GO:0071397 | cellular response to cholesterol(GO:0071397) |
0.0 | 0.8 | GO:0002474 | antigen processing and presentation of peptide antigen via MHC class I(GO:0002474) |
0.0 | 0.1 | GO:0050689 | negative regulation of defense response to virus by host(GO:0050689) |
0.0 | 0.1 | GO:0061073 | ciliary body morphogenesis(GO:0061073) |
0.0 | 0.1 | GO:0003348 | cardiac endothelial cell differentiation(GO:0003348) |
0.0 | 0.0 | GO:0006551 | leucine metabolic process(GO:0006551) |
0.0 | 0.3 | GO:1900047 | negative regulation of blood coagulation(GO:0030195) negative regulation of hemostasis(GO:1900047) |
0.0 | 0.1 | GO:0043988 | histone H3-S28 phosphorylation(GO:0043988) |
0.0 | 0.1 | GO:0042659 | regulation of cell fate specification(GO:0042659) |
0.0 | 0.0 | GO:0061046 | regulation of branching involved in lung morphogenesis(GO:0061046) |
0.0 | 0.0 | GO:0050849 | negative regulation of calcium-mediated signaling(GO:0050849) |
0.0 | 0.1 | GO:0033299 | secretion of lysosomal enzymes(GO:0033299) |
0.0 | 0.2 | GO:0045075 | interleukin-12 biosynthetic process(GO:0042090) regulation of interleukin-12 biosynthetic process(GO:0045075) |
0.0 | 0.1 | GO:0048680 | positive regulation of axon regeneration(GO:0048680) |
0.0 | 0.2 | GO:0001731 | formation of translation preinitiation complex(GO:0001731) |
0.0 | 0.1 | GO:0000972 | transcription-dependent tethering of RNA polymerase II gene DNA at nuclear periphery(GO:0000972) |
0.0 | 0.1 | GO:0075522 | IRES-dependent viral translational initiation(GO:0075522) |
0.0 | 0.1 | GO:0006048 | UDP-N-acetylglucosamine biosynthetic process(GO:0006048) |
0.0 | 0.0 | GO:0038033 | positive regulation of endothelial cell chemotaxis by VEGF-activated vascular endothelial growth factor receptor signaling pathway(GO:0038033) |
0.0 | 0.1 | GO:0031468 | nuclear envelope reassembly(GO:0031468) |
0.0 | 0.0 | GO:0035902 | response to immobilization stress(GO:0035902) |
0.0 | 0.0 | GO:0045053 | protein retention in Golgi apparatus(GO:0045053) |
0.0 | 0.0 | GO:0061144 | alveolar secondary septum development(GO:0061144) |
0.0 | 0.1 | GO:2000773 | negative regulation of cellular senescence(GO:2000773) |
0.0 | 0.1 | GO:2000628 | regulation of miRNA metabolic process(GO:2000628) |
0.0 | 0.0 | GO:0060481 | lobar bronchus epithelium development(GO:0060481) |
0.0 | 0.5 | GO:0000245 | spliceosomal complex assembly(GO:0000245) |
0.0 | 0.8 | GO:0009408 | response to heat(GO:0009408) |
0.0 | 2.0 | GO:0007160 | cell-matrix adhesion(GO:0007160) |
0.0 | 0.0 | GO:2000574 | regulation of microtubule motor activity(GO:2000574) |
0.0 | 0.1 | GO:0046835 | carbohydrate phosphorylation(GO:0046835) |
0.0 | 0.0 | GO:0061198 | fungiform papilla formation(GO:0061198) |
0.0 | 0.1 | GO:1901727 | positive regulation of histone deacetylase activity(GO:1901727) |
0.0 | 0.0 | GO:0060385 | axonogenesis involved in innervation(GO:0060385) |
0.0 | 0.0 | GO:1904526 | regulation of microtubule binding(GO:1904526) positive regulation of microtubule binding(GO:1904528) |
0.0 | 0.1 | GO:0010718 | positive regulation of epithelial to mesenchymal transition(GO:0010718) |
0.0 | 0.1 | GO:1990126 | retrograde transport, endosome to plasma membrane(GO:1990126) |
0.0 | 0.3 | GO:0030318 | melanocyte differentiation(GO:0030318) |
0.0 | 0.0 | GO:0044557 | relaxation of smooth muscle(GO:0044557) relaxation of vascular smooth muscle(GO:0060087) |
0.0 | 0.1 | GO:0070681 | glutaminyl-tRNAGln biosynthesis via transamidation(GO:0070681) |
0.0 | 0.2 | GO:0032007 | negative regulation of TOR signaling(GO:0032007) |
0.0 | 0.1 | GO:0032026 | response to magnesium ion(GO:0032026) |
0.0 | 0.5 | GO:0048747 | muscle fiber development(GO:0048747) |
0.0 | 0.0 | GO:0000957 | mitochondrial RNA catabolic process(GO:0000957) regulation of mitochondrial RNA catabolic process(GO:0000960) |
0.0 | 0.1 | GO:0043570 | meiotic mismatch repair(GO:0000710) maintenance of DNA repeat elements(GO:0043570) |
0.0 | 0.1 | GO:0035814 | negative regulation of renal sodium excretion(GO:0035814) |
0.0 | 0.3 | GO:2000311 | regulation of alpha-amino-3-hydroxy-5-methyl-4-isoxazole propionate selective glutamate receptor activity(GO:2000311) |
0.0 | 0.2 | GO:0090181 | regulation of cholesterol metabolic process(GO:0090181) |
0.0 | 0.0 | GO:2000416 | regulation of eosinophil migration(GO:2000416) positive regulation of eosinophil migration(GO:2000418) |
0.0 | 0.0 | GO:0007196 | adenylate cyclase-inhibiting G-protein coupled glutamate receptor signaling pathway(GO:0007196) |
0.0 | 0.1 | GO:1902857 | positive regulation of nonmotile primary cilium assembly(GO:1902857) |
0.0 | 0.1 | GO:0015712 | hexose phosphate transport(GO:0015712) glucose-6-phosphate transport(GO:0015760) |
0.0 | 0.1 | GO:0005984 | disaccharide metabolic process(GO:0005984) |
0.0 | 0.3 | GO:0006879 | cellular iron ion homeostasis(GO:0006879) |
0.0 | 0.0 | GO:1903393 | positive regulation of adherens junction organization(GO:1903393) |
0.0 | 0.1 | GO:0033169 | histone H3-K9 demethylation(GO:0033169) |
0.0 | 0.1 | GO:0003207 | cardiac chamber formation(GO:0003207) |
0.0 | 0.0 | GO:0060159 | regulation of dopamine receptor signaling pathway(GO:0060159) |
0.0 | 0.1 | GO:0016322 | neuron remodeling(GO:0016322) |
0.0 | 0.0 | GO:2001269 | positive regulation of cysteine-type endopeptidase activity involved in apoptotic signaling pathway(GO:2001269) |
0.0 | 0.1 | GO:2000810 | regulation of bicellular tight junction assembly(GO:2000810) |
0.0 | 0.2 | GO:0042149 | cellular response to glucose starvation(GO:0042149) |
0.0 | 0.1 | GO:0000160 | phosphorelay signal transduction system(GO:0000160) |
0.0 | 0.1 | GO:0009299 | mRNA transcription(GO:0009299) |
0.0 | 0.0 | GO:0045110 | intermediate filament bundle assembly(GO:0045110) |
0.0 | 0.1 | GO:0010566 | regulation of ketone biosynthetic process(GO:0010566) |
0.0 | 0.1 | GO:0043456 | regulation of pentose-phosphate shunt(GO:0043456) |
0.0 | 0.1 | GO:0044539 | long-chain fatty acid import(GO:0044539) |
0.0 | 0.1 | GO:0060718 | chorionic trophoblast cell differentiation(GO:0060718) |
0.0 | 0.1 | GO:0045063 | T-helper 1 cell differentiation(GO:0045063) |
0.0 | 0.2 | GO:1902017 | regulation of cilium assembly(GO:1902017) |
0.0 | 0.1 | GO:0010758 | regulation of macrophage chemotaxis(GO:0010758) |
0.0 | 0.0 | GO:0006362 | transcription elongation from RNA polymerase I promoter(GO:0006362) |
0.0 | 0.0 | GO:0001807 | regulation of type IV hypersensitivity(GO:0001807) |
0.0 | 0.0 | GO:0019230 | proprioception(GO:0019230) |
0.0 | 0.0 | GO:0070989 | oxidative demethylation(GO:0070989) |
0.0 | 0.0 | GO:0051121 | hepoxilin metabolic process(GO:0051121) hepoxilin biosynthetic process(GO:0051122) |
0.0 | 0.0 | GO:0021590 | cerebellum maturation(GO:0021590) |
0.0 | 0.0 | GO:0070164 | negative regulation of adiponectin secretion(GO:0070164) |
0.0 | 0.1 | GO:0000132 | establishment of mitotic spindle orientation(GO:0000132) |
0.0 | 0.0 | GO:0072053 | renal inner medulla development(GO:0072053) |
0.0 | 0.1 | GO:0034227 | tRNA thio-modification(GO:0034227) |
0.0 | 0.0 | GO:0071360 | cellular response to exogenous dsRNA(GO:0071360) |
0.0 | 0.1 | GO:0033617 | mitochondrial respiratory chain complex IV assembly(GO:0033617) mitochondrial respiratory chain complex IV biogenesis(GO:0097034) |
0.0 | 0.0 | GO:1990123 | L-glutamate(1-) import into cell(GO:1903802) L-glutamate import into cell(GO:1990123) |
0.0 | 0.0 | GO:0090080 | positive regulation of MAPKKK cascade by fibroblast growth factor receptor signaling pathway(GO:0090080) |
0.0 | 0.2 | GO:0060716 | labyrinthine layer blood vessel development(GO:0060716) |
0.0 | 0.0 | GO:0032290 | peripheral nervous system myelin formation(GO:0032290) |
0.0 | 0.0 | GO:0038128 | ERBB2 signaling pathway(GO:0038128) |
0.0 | 0.0 | GO:0034433 | steroid esterification(GO:0034433) sterol esterification(GO:0034434) cholesterol esterification(GO:0034435) |
0.0 | 0.0 | GO:0033632 | regulation of cell-cell adhesion mediated by integrin(GO:0033632) |
0.0 | 0.1 | GO:0048671 | negative regulation of collateral sprouting(GO:0048671) |
0.0 | 0.0 | GO:0035425 | autocrine signaling(GO:0035425) |
0.0 | 0.0 | GO:0021626 | hindbrain maturation(GO:0021578) central nervous system maturation(GO:0021626) |
0.0 | 0.1 | GO:0009083 | branched-chain amino acid catabolic process(GO:0009083) |
0.0 | 0.0 | GO:0010455 | positive regulation of cell fate commitment(GO:0010455) |
0.0 | 0.3 | GO:0048240 | sperm capacitation(GO:0048240) |
0.0 | 0.2 | GO:0034198 | cellular response to amino acid starvation(GO:0034198) |
0.0 | 0.0 | GO:0044034 | negative stranded viral RNA replication(GO:0039689) multi-organism biosynthetic process(GO:0044034) |
0.0 | 0.0 | GO:0036444 | calcium ion transmembrane import into mitochondrion(GO:0036444) |
0.0 | 0.1 | GO:0006020 | inositol metabolic process(GO:0006020) |
0.0 | 0.0 | GO:0016081 | synaptic vesicle docking(GO:0016081) |
0.0 | 0.0 | GO:0090031 | positive regulation of steroid hormone biosynthetic process(GO:0090031) |
0.0 | 0.1 | GO:0070166 | enamel mineralization(GO:0070166) |
0.0 | 0.2 | GO:0051491 | positive regulation of filopodium assembly(GO:0051491) |
0.0 | 0.1 | GO:0032484 | Ral protein signal transduction(GO:0032484) |
0.0 | 0.0 | GO:0046439 | cysteine catabolic process(GO:0009093) L-cysteine catabolic process(GO:0019448) L-cysteine metabolic process(GO:0046439) |
0.0 | 0.1 | GO:0015816 | glycine transport(GO:0015816) |
0.0 | 0.1 | GO:0031666 | positive regulation of lipopolysaccharide-mediated signaling pathway(GO:0031666) |
0.0 | 0.0 | GO:0042138 | meiotic DNA double-strand break formation(GO:0042138) |
0.0 | 0.1 | GO:0032782 | bile acid secretion(GO:0032782) |
0.0 | 0.1 | GO:0070307 | lens fiber cell development(GO:0070307) |
0.0 | 0.1 | GO:0019509 | L-methionine biosynthetic process from methylthioadenosine(GO:0019509) |
0.0 | 0.0 | GO:0070459 | prolactin secretion(GO:0070459) |
0.0 | 0.0 | GO:0001880 | Mullerian duct regression(GO:0001880) |
0.0 | 0.0 | GO:0042160 | lipoprotein modification(GO:0042160) lipoprotein oxidation(GO:0042161) |
0.0 | 0.0 | GO:0051657 | maintenance of organelle location(GO:0051657) |
0.0 | 0.1 | GO:0000059 | protein import into nucleus, docking(GO:0000059) |
0.0 | 0.1 | GO:0018904 | ether metabolic process(GO:0018904) |
0.0 | 0.3 | GO:0070527 | platelet aggregation(GO:0070527) |
0.0 | 0.1 | GO:0061469 | regulation of type B pancreatic cell proliferation(GO:0061469) |
0.0 | 0.1 | GO:1904814 | regulation of protein localization to chromosome, telomeric region(GO:1904814) positive regulation of protein localization to chromosome, telomeric region(GO:1904816) |
0.0 | 0.2 | GO:0007257 | activation of JUN kinase activity(GO:0007257) |
0.0 | 0.1 | GO:0010898 | positive regulation of triglyceride catabolic process(GO:0010898) |
0.0 | 0.0 | GO:1901856 | negative regulation of cellular respiration(GO:1901856) |
0.0 | 0.1 | GO:0030647 | polyketide metabolic process(GO:0030638) aminoglycoside antibiotic metabolic process(GO:0030647) daunorubicin metabolic process(GO:0044597) doxorubicin metabolic process(GO:0044598) |
0.0 | 0.0 | GO:0060666 | dichotomous subdivision of terminal units involved in salivary gland branching(GO:0060666) |
0.0 | 0.0 | GO:0006290 | pyrimidine dimer repair(GO:0006290) |
0.0 | 0.1 | GO:0030174 | regulation of DNA-dependent DNA replication initiation(GO:0030174) |
0.0 | 0.0 | GO:1901201 | regulation of extracellular matrix assembly(GO:1901201) |
0.0 | 0.1 | GO:0071398 | cellular response to fatty acid(GO:0071398) |
0.0 | 0.1 | GO:0030502 | negative regulation of bone mineralization(GO:0030502) |
0.0 | 0.0 | GO:0048318 | axial mesoderm development(GO:0048318) |
0.0 | 0.1 | GO:0070131 | positive regulation of mitochondrial translation(GO:0070131) |
0.0 | 0.1 | GO:0032196 | transposition(GO:0032196) |
0.0 | 0.1 | GO:0008340 | determination of adult lifespan(GO:0008340) |
0.0 | 0.0 | GO:0002874 | regulation of chronic inflammatory response to antigenic stimulus(GO:0002874) |
0.0 | 0.1 | GO:0097094 | craniofacial suture morphogenesis(GO:0097094) |
0.0 | 0.0 | GO:0070278 | extracellular matrix constituent secretion(GO:0070278) |
0.0 | 0.0 | GO:2001032 | regulation of double-strand break repair via nonhomologous end joining(GO:2001032) |
0.0 | 0.0 | GO:0098735 | positive regulation of the force of heart contraction(GO:0098735) |
0.0 | 0.0 | GO:0072310 | glomerular visceral epithelial cell development(GO:0072015) glomerular epithelial cell development(GO:0072310) |
0.0 | 0.0 | GO:0032594 | protein transport within lipid bilayer(GO:0032594) |
0.0 | 0.0 | GO:0033387 | putrescine biosynthetic process from ornithine(GO:0033387) |
0.0 | 0.1 | GO:0030311 | poly-N-acetyllactosamine metabolic process(GO:0030309) poly-N-acetyllactosamine biosynthetic process(GO:0030311) |
0.0 | 0.0 | GO:0010756 | positive regulation of plasminogen activation(GO:0010756) |
0.0 | 0.0 | GO:0060283 | negative regulation of oocyte development(GO:0060283) |
0.0 | 0.2 | GO:0031294 | lymphocyte costimulation(GO:0031294) |
0.0 | 0.1 | GO:0045932 | negative regulation of muscle contraction(GO:0045932) |
0.0 | 0.0 | GO:0070212 | protein poly-ADP-ribosylation(GO:0070212) |
0.0 | 0.0 | GO:0044849 | estrous cycle(GO:0044849) |
0.0 | 0.1 | GO:0051574 | positive regulation of histone H3-K9 methylation(GO:0051574) |
0.0 | 0.1 | GO:0051823 | regulation of synapse structural plasticity(GO:0051823) |
0.0 | 0.0 | GO:0042271 | susceptibility to natural killer cell mediated cytotoxicity(GO:0042271) |
0.0 | 0.0 | GO:0060126 | somatotropin secreting cell differentiation(GO:0060126) |
0.0 | 0.0 | GO:0001561 | fatty acid alpha-oxidation(GO:0001561) |
0.0 | 0.0 | GO:0018125 | peptidyl-cysteine methylation(GO:0018125) |
0.0 | 0.0 | GO:0060509 | Type I pneumocyte differentiation(GO:0060509) |
0.0 | 0.1 | GO:0019262 | N-acetylneuraminate catabolic process(GO:0019262) |
0.0 | 0.0 | GO:0007223 | Wnt signaling pathway, calcium modulating pathway(GO:0007223) |
0.0 | 0.0 | GO:0009068 | aspartate family amino acid catabolic process(GO:0009068) |
0.0 | 0.1 | GO:0046116 | queuosine biosynthetic process(GO:0008616) queuosine metabolic process(GO:0046116) |
0.0 | 0.0 | GO:0060028 | convergent extension involved in axis elongation(GO:0060028) |
0.0 | 0.2 | GO:0016180 | snRNA processing(GO:0016180) |
0.0 | 0.0 | GO:0061010 | gall bladder development(GO:0061010) |
0.0 | 0.0 | GO:0036092 | phosphatidylinositol-3-phosphate biosynthetic process(GO:0036092) |
0.0 | 0.0 | GO:0090161 | Golgi ribbon formation(GO:0090161) |
0.0 | 0.1 | GO:0036035 | osteoclast development(GO:0036035) |
0.0 | 0.1 | GO:0002827 | positive regulation of T-helper 1 type immune response(GO:0002827) |
0.0 | 0.0 | GO:0014807 | regulation of somitogenesis(GO:0014807) |
0.0 | 0.1 | GO:0072673 | lamellipodium morphogenesis(GO:0072673) |
0.0 | 0.0 | GO:0030825 | positive regulation of cGMP metabolic process(GO:0030825) |
0.0 | 0.0 | GO:0097155 | fasciculation of sensory neuron axon(GO:0097155) |
0.0 | 0.1 | GO:0032534 | regulation of microvillus assembly(GO:0032534) |
0.0 | 0.0 | GO:0007097 | nuclear migration(GO:0007097) |
0.0 | 0.0 | GO:0010982 | regulation of high-density lipoprotein particle clearance(GO:0010982) positive regulation of lipoprotein particle clearance(GO:0010986) |
0.0 | 0.1 | GO:0060575 | intestinal epithelial cell differentiation(GO:0060575) |
0.0 | 0.0 | GO:0060789 | hair follicle placode formation(GO:0060789) |
0.0 | 0.1 | GO:0051601 | exocyst localization(GO:0051601) |
0.0 | 0.0 | GO:0060689 | cell differentiation involved in salivary gland development(GO:0060689) |
0.0 | 0.1 | GO:0034587 | piRNA metabolic process(GO:0034587) |
0.0 | 0.2 | GO:0042130 | negative regulation of T cell proliferation(GO:0042130) |
0.0 | 0.0 | GO:0070831 | basement membrane assembly(GO:0070831) |
0.0 | 0.1 | GO:0042759 | long-chain fatty acid biosynthetic process(GO:0042759) |
0.0 | 0.0 | GO:0050748 | negative regulation of lipoprotein metabolic process(GO:0050748) |
0.0 | 0.1 | GO:0015012 | heparan sulfate proteoglycan biosynthetic process(GO:0015012) |
0.0 | 0.0 | GO:0045835 | negative regulation of meiotic nuclear division(GO:0045835) |
0.0 | 0.1 | GO:0060056 | mammary gland involution(GO:0060056) |
0.0 | 0.1 | GO:0071353 | cellular response to interleukin-4(GO:0071353) |
0.0 | 0.0 | GO:0045085 | negative regulation of interleukin-2 biosynthetic process(GO:0045085) |
0.0 | 0.0 | GO:0046984 | regulation of hemoglobin biosynthetic process(GO:0046984) |
0.0 | 0.6 | GO:0008203 | cholesterol metabolic process(GO:0008203) |
0.0 | 0.0 | GO:0043173 | nucleotide salvage(GO:0043173) |
0.0 | 0.1 | GO:0003301 | physiological muscle hypertrophy(GO:0003298) physiological cardiac muscle hypertrophy(GO:0003301) cell growth involved in cardiac muscle cell development(GO:0061049) |
0.0 | 0.1 | GO:0070633 | transepithelial transport(GO:0070633) |
0.0 | 0.1 | GO:0061298 | retina vasculature development in camera-type eye(GO:0061298) |
0.0 | 0.0 | GO:0002036 | regulation of L-glutamate transport(GO:0002036) |
0.0 | 0.0 | GO:0061029 | eyelid development in camera-type eye(GO:0061029) |
0.0 | 0.0 | GO:0030718 | germ-line stem cell population maintenance(GO:0030718) |
0.0 | 0.0 | GO:1902669 | positive regulation of axon extension involved in axon guidance(GO:0048842) positive regulation of axon guidance(GO:1902669) |
0.0 | 0.0 | GO:0046348 | amino sugar catabolic process(GO:0046348) |
0.0 | 0.2 | GO:0071475 | cellular hyperosmotic salinity response(GO:0071475) |
0.0 | 0.0 | GO:0048625 | myoblast fate commitment(GO:0048625) |
0.0 | 0.0 | GO:0034773 | histone H4-K20 trimethylation(GO:0034773) |
0.0 | 0.1 | GO:0034982 | protein processing involved in protein targeting to mitochondrion(GO:0006627) mitochondrial protein processing(GO:0034982) |
0.0 | 0.0 | GO:0072364 | regulation of gluconeogenesis by regulation of transcription from RNA polymerase II promoter(GO:0035947) regulation of cellular ketone metabolic process by regulation of transcription from RNA polymerase II promoter(GO:0072364) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.4 | 1.2 | GO:0060053 | neurofilament cytoskeleton(GO:0060053) |
0.3 | 0.9 | GO:0005712 | chiasma(GO:0005712) |
0.3 | 0.8 | GO:0043293 | apoptosome(GO:0043293) |
0.3 | 1.8 | GO:0034098 | VCP-NPL4-UFD1 AAA ATPase complex(GO:0034098) |
0.2 | 0.8 | GO:0035339 | SPOTS complex(GO:0035339) |
0.2 | 0.6 | GO:0005588 | collagen type V trimer(GO:0005588) |
0.2 | 0.7 | GO:0070545 | PeBoW complex(GO:0070545) |
0.2 | 0.5 | GO:1990635 | proximal dendrite(GO:1990635) |
0.2 | 0.5 | GO:0005745 | m-AAA complex(GO:0005745) |
0.2 | 2.0 | GO:0031235 | intrinsic component of the cytoplasmic side of the plasma membrane(GO:0031235) |
0.2 | 0.5 | GO:0097543 | ciliary inversin compartment(GO:0097543) |
0.2 | 0.5 | GO:0097443 | sorting endosome(GO:0097443) |
0.2 | 0.6 | GO:0071203 | WASH complex(GO:0071203) |
0.1 | 1.0 | GO:0000788 | nuclear nucleosome(GO:0000788) |
0.1 | 1.0 | GO:0032009 | early phagosome(GO:0032009) |
0.1 | 0.5 | GO:0009279 | cell outer membrane(GO:0009279) cell envelope(GO:0030313) external encapsulating structure part(GO:0044462) |
0.1 | 0.9 | GO:0033061 | DNA recombinase mediator complex(GO:0033061) |
0.1 | 0.9 | GO:0000506 | glycosylphosphatidylinositol-N-acetylglucosaminyltransferase (GPI-GnT) complex(GO:0000506) |
0.1 | 1.1 | GO:0005766 | primary lysosome(GO:0005766) azurophil granule(GO:0042582) |
0.1 | 3.7 | GO:0005801 | cis-Golgi network(GO:0005801) |
0.1 | 0.3 | GO:0044393 | microspike(GO:0044393) |
0.1 | 0.1 | GO:0071664 | catenin-TCF7L2 complex(GO:0071664) |
0.1 | 0.3 | GO:0097413 | Lewy body(GO:0097413) |
0.1 | 0.9 | GO:0005859 | muscle myosin complex(GO:0005859) |
0.1 | 0.2 | GO:0031264 | death-inducing signaling complex(GO:0031264) |
0.1 | 0.5 | GO:0031315 | extrinsic component of mitochondrial outer membrane(GO:0031315) |
0.1 | 0.2 | GO:1990597 | AIP1-IRE1 complex(GO:1990597) |
0.1 | 0.4 | GO:0033093 | Weibel-Palade body(GO:0033093) |
0.1 | 0.3 | GO:0072487 | MSL complex(GO:0072487) |
0.1 | 0.3 | GO:0035363 | histone locus body(GO:0035363) |
0.1 | 0.4 | GO:0031298 | replication fork protection complex(GO:0031298) |
0.1 | 0.4 | GO:0070044 | synaptobrevin 2-SNAP-25-syntaxin-1a complex(GO:0070044) |
0.1 | 0.5 | GO:0031258 | lamellipodium membrane(GO:0031258) |
0.1 | 1.3 | GO:0002102 | podosome(GO:0002102) |
0.1 | 0.4 | GO:0035032 | phosphatidylinositol 3-kinase complex, class III(GO:0035032) |
0.1 | 0.2 | GO:0031074 | nucleocytoplasmic shuttling complex(GO:0031074) |
0.1 | 0.2 | GO:0016222 | procollagen-proline 4-dioxygenase complex(GO:0016222) |
0.1 | 1.0 | GO:0030014 | CCR4-NOT complex(GO:0030014) |
0.1 | 0.2 | GO:0000814 | ESCRT II complex(GO:0000814) |
0.1 | 0.5 | GO:0016342 | catenin complex(GO:0016342) |
0.1 | 0.4 | GO:0071014 | post-mRNA release spliceosomal complex(GO:0071014) |
0.1 | 0.3 | GO:0045261 | mitochondrial proton-transporting ATP synthase complex, catalytic core F(1)(GO:0000275) proton-transporting ATP synthase complex, catalytic core F(1)(GO:0045261) |
0.1 | 0.2 | GO:0005642 | annulate lamellae(GO:0005642) |
0.1 | 0.8 | GO:0042612 | MHC class I protein complex(GO:0042612) |
0.1 | 0.2 | GO:0097136 | Bcl-2 family protein complex(GO:0097136) |
0.1 | 0.5 | GO:0030991 | intraciliary transport particle A(GO:0030991) |
0.1 | 3.3 | GO:0005811 | lipid particle(GO:0005811) |
0.1 | 0.5 | GO:0036157 | outer dynein arm(GO:0036157) |
0.1 | 1.2 | GO:0033017 | sarcoplasmic reticulum membrane(GO:0033017) |
0.1 | 4.0 | GO:0017053 | transcriptional repressor complex(GO:0017053) |
0.1 | 0.2 | GO:0034457 | Mpp10 complex(GO:0034457) |
0.1 | 0.6 | GO:0036038 | MKS complex(GO:0036038) |
0.0 | 0.8 | GO:0000930 | gamma-tubulin complex(GO:0000930) |
0.0 | 0.8 | GO:0000421 | autophagosome membrane(GO:0000421) |
0.0 | 0.1 | GO:0036194 | muscle cell projection(GO:0036194) muscle cell projection membrane(GO:0036195) |
0.0 | 0.3 | GO:0097470 | ribbon synapse(GO:0097470) |
0.0 | 0.0 | GO:0000812 | Swr1 complex(GO:0000812) |
0.0 | 0.3 | GO:0016460 | myosin II complex(GO:0016460) |
0.0 | 0.4 | GO:0005916 | fascia adherens(GO:0005916) |
0.0 | 0.4 | GO:0008074 | guanylate cyclase complex, soluble(GO:0008074) |
0.0 | 0.4 | GO:0032045 | guanyl-nucleotide exchange factor complex(GO:0032045) |
0.0 | 0.2 | GO:0071141 | SMAD protein complex(GO:0071141) |
0.0 | 0.5 | GO:0043240 | Fanconi anaemia nuclear complex(GO:0043240) |
0.0 | 0.2 | GO:0097342 | ripoptosome(GO:0097342) |
0.0 | 0.4 | GO:0034663 | endoplasmic reticulum chaperone complex(GO:0034663) |
0.0 | 0.6 | GO:0034364 | high-density lipoprotein particle(GO:0034364) |
0.0 | 0.2 | GO:0008541 | proteasome regulatory particle, lid subcomplex(GO:0008541) |
0.0 | 0.1 | GO:0042585 | germinal vesicle(GO:0042585) |
0.0 | 0.2 | GO:0070847 | core mediator complex(GO:0070847) |
0.0 | 0.2 | GO:0005828 | kinetochore microtubule(GO:0005828) |
0.0 | 1.7 | GO:0032432 | actin filament bundle(GO:0032432) |
0.0 | 0.6 | GO:0000786 | nucleosome(GO:0000786) |
0.0 | 0.7 | GO:0032588 | trans-Golgi network membrane(GO:0032588) |
0.0 | 0.2 | GO:0030056 | hemidesmosome(GO:0030056) |
0.0 | 0.2 | GO:0031094 | platelet dense tubular network(GO:0031094) |
0.0 | 0.3 | GO:0061700 | GATOR2 complex(GO:0061700) |
0.0 | 0.4 | GO:0035098 | ESC/E(Z) complex(GO:0035098) |
0.0 | 0.4 | GO:0034709 | methylosome(GO:0034709) |
0.0 | 0.2 | GO:0033256 | I-kappaB/NF-kappaB complex(GO:0033256) |
0.0 | 0.3 | GO:0032982 | myosin filament(GO:0032982) |
0.0 | 0.2 | GO:0030870 | Mre11 complex(GO:0030870) |
0.0 | 0.1 | GO:0043219 | lateral loop(GO:0043219) |
0.0 | 11.4 | GO:0005667 | transcription factor complex(GO:0005667) |
0.0 | 0.1 | GO:0071438 | invadopodium membrane(GO:0071438) |
0.0 | 0.1 | GO:0032280 | symmetric synapse(GO:0032280) |
0.0 | 0.5 | GO:0043196 | varicosity(GO:0043196) |
0.0 | 0.3 | GO:0070652 | HAUS complex(GO:0070652) |
0.0 | 0.4 | GO:0031588 | nucleotide-activated protein kinase complex(GO:0031588) |
0.0 | 0.5 | GO:0002199 | zona pellucida receptor complex(GO:0002199) |
0.0 | 0.1 | GO:0016533 | cyclin-dependent protein kinase 5 holoenzyme complex(GO:0016533) |
0.0 | 0.6 | GO:0043218 | compact myelin(GO:0043218) |
0.0 | 0.3 | GO:0031932 | TORC2 complex(GO:0031932) |
0.0 | 0.3 | GO:0070578 | RISC-loading complex(GO:0070578) |
0.0 | 0.5 | GO:1902562 | NuA4 histone acetyltransferase complex(GO:0035267) H4/H2A histone acetyltransferase complex(GO:0043189) H4 histone acetyltransferase complex(GO:1902562) |
0.0 | 0.1 | GO:0044611 | nuclear pore inner ring(GO:0044611) |
0.0 | 0.7 | GO:0000118 | histone deacetylase complex(GO:0000118) |
0.0 | 0.1 | GO:0032541 | cortical endoplasmic reticulum(GO:0032541) |
0.0 | 1.3 | GO:0016528 | sarcoplasm(GO:0016528) |
0.0 | 0.6 | GO:0005689 | U12-type spliceosomal complex(GO:0005689) |
0.0 | 0.5 | GO:0005697 | telomerase holoenzyme complex(GO:0005697) |
0.0 | 0.1 | GO:1990316 | ATG1/ULK1 kinase complex(GO:1990316) |
0.0 | 0.4 | GO:0005639 | integral component of nuclear inner membrane(GO:0005639) intrinsic component of nuclear inner membrane(GO:0031229) |
0.0 | 0.0 | GO:0005683 | U7 snRNP(GO:0005683) |
0.0 | 0.2 | GO:0070852 | cell body fiber(GO:0070852) |
0.0 | 0.6 | GO:0005865 | striated muscle thin filament(GO:0005865) |
0.0 | 0.1 | GO:0044354 | pinosome(GO:0044352) macropinosome(GO:0044354) |
0.0 | 0.2 | GO:0033180 | proton-transporting V-type ATPase, V1 domain(GO:0033180) |
0.0 | 0.2 | GO:0036128 | CatSper complex(GO:0036128) |
0.0 | 0.5 | GO:0005637 | nuclear inner membrane(GO:0005637) |
0.0 | 0.3 | GO:0032039 | integrator complex(GO:0032039) |
0.0 | 0.3 | GO:0097038 | perinuclear endoplasmic reticulum(GO:0097038) |
0.0 | 3.0 | GO:0072562 | blood microparticle(GO:0072562) |
0.0 | 0.0 | GO:1990423 | RZZ complex(GO:1990423) |
0.0 | 0.2 | GO:0000815 | ESCRT III complex(GO:0000815) |
0.0 | 0.1 | GO:0030121 | AP-1 adaptor complex(GO:0030121) |
0.0 | 0.1 | GO:0031465 | Cul4B-RING E3 ubiquitin ligase complex(GO:0031465) |
0.0 | 0.1 | GO:0070938 | contractile ring(GO:0070938) |
0.0 | 0.1 | GO:0031092 | platelet alpha granule membrane(GO:0031092) |
0.0 | 0.1 | GO:0045298 | tubulin complex(GO:0045298) |
0.0 | 0.1 | GO:0042406 | extrinsic component of endoplasmic reticulum membrane(GO:0042406) |
0.0 | 0.2 | GO:0097539 | ciliary transition fiber(GO:0097539) |
0.0 | 0.1 | GO:0042641 | actomyosin(GO:0042641) |
0.0 | 1.0 | GO:0030173 | integral component of Golgi membrane(GO:0030173) |
0.0 | 0.0 | GO:1903349 | omegasome membrane(GO:1903349) |
0.0 | 0.3 | GO:0042575 | DNA polymerase complex(GO:0042575) |
0.0 | 0.3 | GO:0000242 | pericentriolar material(GO:0000242) |
0.0 | 0.0 | GO:0032010 | phagolysosome(GO:0032010) |
0.0 | 0.7 | GO:0016459 | myosin complex(GO:0016459) |
0.0 | 0.0 | GO:0035867 | alphav-beta3 integrin-IGF-1-IGF1R complex(GO:0035867) |
0.0 | 0.3 | GO:0002080 | acrosomal membrane(GO:0002080) |
0.0 | 0.1 | GO:0070552 | BRISC complex(GO:0070552) |
0.0 | 0.3 | GO:0000407 | pre-autophagosomal structure(GO:0000407) |
0.0 | 0.8 | GO:0045095 | keratin filament(GO:0045095) |
0.0 | 0.0 | GO:0001651 | dense fibrillar component(GO:0001651) |
0.0 | 0.6 | GO:0045171 | intercellular bridge(GO:0045171) |
0.0 | 0.1 | GO:0071547 | piP-body(GO:0071547) |
0.0 | 0.1 | GO:0005915 | zonula adherens(GO:0005915) |
0.0 | 1.5 | GO:0030136 | clathrin-coated vesicle(GO:0030136) |
0.0 | 0.2 | GO:0042587 | glycogen granule(GO:0042587) |
0.0 | 0.1 | GO:0005967 | mitochondrial pyruvate dehydrogenase complex(GO:0005967) |
0.0 | 0.1 | GO:0005853 | eukaryotic translation elongation factor 1 complex(GO:0005853) |
0.0 | 0.1 | GO:0005688 | U6 snRNP(GO:0005688) |
0.0 | 0.2 | GO:0005682 | U5 snRNP(GO:0005682) |
0.0 | 1.7 | GO:0030496 | midbody(GO:0030496) |
0.0 | 0.1 | GO:0072559 | NLRP3 inflammasome complex(GO:0072559) |
0.0 | 0.1 | GO:0031084 | BLOC-2 complex(GO:0031084) |
0.0 | 0.0 | GO:0033185 | dolichol-phosphate-mannose synthase complex(GO:0033185) |
0.0 | 0.1 | GO:0016281 | eukaryotic translation initiation factor 4F complex(GO:0016281) |
0.0 | 0.4 | GO:0031902 | late endosome membrane(GO:0031902) |
0.0 | 0.2 | GO:0071010 | prespliceosome(GO:0071010) |
0.0 | 0.3 | GO:0000159 | protein phosphatase type 2A complex(GO:0000159) |
0.0 | 0.1 | GO:0005947 | mitochondrial alpha-ketoglutarate dehydrogenase complex(GO:0005947) |
0.0 | 0.2 | GO:0046930 | pore complex(GO:0046930) |
0.0 | 0.0 | GO:0097512 | cardiac myofibril(GO:0097512) |
0.0 | 1.0 | GO:0016363 | nuclear matrix(GO:0016363) |
0.0 | 0.2 | GO:0035102 | PRC1 complex(GO:0035102) |
0.0 | 0.0 | GO:1990812 | growth cone filopodium(GO:1990812) |
0.0 | 0.1 | GO:0030956 | glutamyl-tRNA(Gln) amidotransferase complex(GO:0030956) |
0.0 | 0.0 | GO:0070522 | ERCC4-ERCC1 complex(GO:0070522) |
0.0 | 0.1 | GO:0031983 | vesicle lumen(GO:0031983) |
0.0 | 0.3 | GO:0031307 | integral component of mitochondrial outer membrane(GO:0031307) |
0.0 | 0.1 | GO:0017101 | aminoacyl-tRNA synthetase multienzyme complex(GO:0017101) |
0.0 | 0.1 | GO:1904115 | axon cytoplasm(GO:1904115) |
0.0 | 0.1 | GO:0031931 | TORC1 complex(GO:0031931) |
0.0 | 0.1 | GO:0030485 | smooth muscle contractile fiber(GO:0030485) |
0.0 | 0.0 | GO:0005945 | 6-phosphofructokinase complex(GO:0005945) |
0.0 | 0.0 | GO:0000138 | Golgi trans cisterna(GO:0000138) |
0.0 | 0.4 | GO:0015030 | Cajal body(GO:0015030) |
0.0 | 0.1 | GO:0042589 | zymogen granule membrane(GO:0042589) |
0.0 | 0.0 | GO:0000439 | core TFIIH complex(GO:0000439) |
0.0 | 0.1 | GO:0030688 | preribosome, small subunit precursor(GO:0030688) |
0.0 | 0.2 | GO:0016327 | apicolateral plasma membrane(GO:0016327) |
0.0 | 0.0 | GO:1990357 | terminal web(GO:1990357) |
0.0 | 0.6 | GO:0000932 | cytoplasmic mRNA processing body(GO:0000932) |
0.0 | 0.9 | GO:0001726 | ruffle(GO:0001726) |
0.0 | 0.1 | GO:0036513 | Derlin-1 retrotranslocation complex(GO:0036513) |
0.0 | 0.1 | GO:0031414 | N-terminal protein acetyltransferase complex(GO:0031414) |
0.0 | 0.3 | GO:0009925 | basal plasma membrane(GO:0009925) |
0.0 | 1.1 | GO:0030027 | lamellipodium(GO:0030027) |
0.0 | 0.4 | GO:0030864 | cortical actin cytoskeleton(GO:0030864) |
0.0 | 0.1 | GO:0005751 | mitochondrial respiratory chain complex IV(GO:0005751) |
0.0 | 0.2 | GO:0044665 | MLL1/2 complex(GO:0044665) MLL1 complex(GO:0071339) |
0.0 | 0.8 | GO:0005901 | caveola(GO:0005901) |
0.0 | 0.1 | GO:0031211 | serine C-palmitoyltransferase complex(GO:0017059) endoplasmic reticulum palmitoyltransferase complex(GO:0031211) |
0.0 | 0.0 | GO:0005610 | laminin-5 complex(GO:0005610) |
0.0 | 0.1 | GO:0072687 | meiotic spindle(GO:0072687) |
0.0 | 0.1 | GO:0031466 | Cul5-RING ubiquitin ligase complex(GO:0031466) |
0.0 | 0.0 | GO:1990454 | L-type voltage-gated calcium channel complex(GO:1990454) |
0.0 | 0.2 | GO:0008305 | integrin complex(GO:0008305) |
0.0 | 0.1 | GO:0031232 | extrinsic component of external side of plasma membrane(GO:0031232) |
0.0 | 0.2 | GO:0030686 | 90S preribosome(GO:0030686) |
0.0 | 0.2 | GO:0035327 | transcriptionally active chromatin(GO:0035327) |
0.0 | 0.2 | GO:0043205 | fibril(GO:0043205) |
0.0 | 0.1 | GO:0000808 | origin recognition complex(GO:0000808) nuclear origin of replication recognition complex(GO:0005664) |
0.0 | 0.1 | GO:0030914 | STAGA complex(GO:0030914) |
0.0 | 0.0 | GO:0071439 | clathrin complex(GO:0071439) |
0.0 | 0.0 | GO:0097255 | R2TP complex(GO:0097255) |
0.0 | 0.1 | GO:0032300 | mismatch repair complex(GO:0032300) |
0.0 | 0.1 | GO:0030896 | checkpoint clamp complex(GO:0030896) |
0.0 | 0.1 | GO:0044214 | spanning component of plasma membrane(GO:0044214) spanning component of membrane(GO:0089717) |
0.0 | 0.0 | GO:1990246 | uniplex complex(GO:1990246) |
0.0 | 0.0 | GO:0048787 | presynaptic active zone membrane(GO:0048787) |
0.0 | 0.1 | GO:0071546 | pi-body(GO:0071546) |
0.0 | 0.2 | GO:0005868 | cytoplasmic dynein complex(GO:0005868) |
0.0 | 0.1 | GO:0032426 | stereocilium tip(GO:0032426) |
0.0 | 0.1 | GO:0098651 | collagen type IV trimer(GO:0005587) network-forming collagen trimer(GO:0098642) collagen network(GO:0098645) basement membrane collagen trimer(GO:0098651) |
0.0 | 0.0 | GO:0042629 | mast cell granule(GO:0042629) |
0.0 | 0.1 | GO:0036452 | ESCRT complex(GO:0036452) |
0.0 | 0.2 | GO:0035145 | exon-exon junction complex(GO:0035145) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.6 | 2.4 | GO:0004740 | pyruvate dehydrogenase (acetyl-transferring) kinase activity(GO:0004740) |
0.6 | 1.7 | GO:0070644 | vitamin D response element binding(GO:0070644) |
0.5 | 1.5 | GO:0046923 | ER retention sequence binding(GO:0046923) |
0.5 | 2.3 | GO:0000774 | adenyl-nucleotide exchange factor activity(GO:0000774) |
0.4 | 1.8 | GO:0036435 | K48-linked polyubiquitin binding(GO:0036435) |
0.4 | 2.6 | GO:0032050 | clathrin heavy chain binding(GO:0032050) |
0.4 | 1.2 | GO:0008184 | glycogen phosphorylase activity(GO:0008184) |
0.4 | 2.7 | GO:0031730 | CCR5 chemokine receptor binding(GO:0031730) |
0.3 | 0.9 | GO:0032137 | guanine/thymine mispair binding(GO:0032137) |
0.3 | 0.9 | GO:0071553 | uridine nucleotide receptor activity(GO:0015065) G-protein coupled pyrimidinergic nucleotide receptor activity(GO:0071553) |
0.3 | 2.6 | GO:0001206 | transcriptional repressor activity, RNA polymerase II distal enhancer sequence-specific binding(GO:0001206) |
0.3 | 1.5 | GO:0070728 | leucine binding(GO:0070728) |
0.3 | 1.5 | GO:0043338 | CTP:2,3-di-O-geranylgeranyl-sn-glycero-1-phosphate cytidyltransferase activity(GO:0043338) phospholactate guanylyltransferase activity(GO:0043814) ATP:coenzyme F420 adenylyltransferase activity(GO:0043910) UDP-N-acetylgalactosamine diphosphorylase activity(GO:0052630) |
0.2 | 0.7 | GO:0045134 | uridine-diphosphatase activity(GO:0045134) |
0.2 | 0.9 | GO:0017176 | phosphatidylinositol N-acetylglucosaminyltransferase activity(GO:0017176) |
0.2 | 1.1 | GO:0055131 | C3HC4-type RING finger domain binding(GO:0055131) |
0.2 | 1.2 | GO:0001727 | lipid kinase activity(GO:0001727) |
0.2 | 0.6 | GO:0050833 | pyruvate transmembrane transporter activity(GO:0050833) |
0.2 | 1.0 | GO:0035033 | histone deacetylase regulator activity(GO:0035033) |
0.2 | 0.6 | GO:0008073 | ornithine decarboxylase inhibitor activity(GO:0008073) |
0.2 | 0.7 | GO:0052650 | NADP-retinol dehydrogenase activity(GO:0052650) |
0.2 | 0.7 | GO:0008865 | fructokinase activity(GO:0008865) mannokinase activity(GO:0019158) |
0.2 | 0.5 | GO:0046976 | histone methyltransferase activity (H3-K27 specific)(GO:0046976) |
0.2 | 0.5 | GO:0033829 | O-fucosylpeptide 3-beta-N-acetylglucosaminyltransferase activity(GO:0033829) |
0.2 | 0.5 | GO:0070915 | lysophosphatidic acid receptor activity(GO:0070915) |
0.2 | 0.5 | GO:0004174 | electron-transferring-flavoprotein dehydrogenase activity(GO:0004174) oxidoreductase activity, acting on the CH-NH group of donors, quinone or similar compound as acceptor(GO:0016649) |
0.2 | 1.1 | GO:0019855 | calcium channel inhibitor activity(GO:0019855) |
0.1 | 0.7 | GO:0070290 | N-acylphosphatidylethanolamine-specific phospholipase D activity(GO:0070290) |
0.1 | 1.1 | GO:0008430 | selenium binding(GO:0008430) |
0.1 | 1.8 | GO:0008191 | metalloendopeptidase inhibitor activity(GO:0008191) |
0.1 | 0.4 | GO:0051373 | FATZ binding(GO:0051373) |
0.1 | 0.7 | GO:0003958 | NADPH-hemoprotein reductase activity(GO:0003958) |
0.1 | 1.4 | GO:0030898 | actin-dependent ATPase activity(GO:0030898) |
0.1 | 1.0 | GO:0019869 | chloride channel inhibitor activity(GO:0019869) |
0.1 | 0.5 | GO:0044020 | histone methyltransferase activity (H4-R3 specific)(GO:0044020) |
0.1 | 1.1 | GO:0038191 | neuropilin binding(GO:0038191) |
0.1 | 1.5 | GO:0004535 | poly(A)-specific ribonuclease activity(GO:0004535) |
0.1 | 0.6 | GO:0019870 | potassium channel inhibitor activity(GO:0019870) |
0.1 | 1.2 | GO:0031702 | type 1 angiotensin receptor binding(GO:0031702) |
0.1 | 0.3 | GO:0061676 | importin-alpha family protein binding(GO:0061676) |
0.1 | 0.3 | GO:0005483 | soluble NSF attachment protein activity(GO:0005483) |
0.1 | 1.7 | GO:0022841 | potassium ion leak channel activity(GO:0022841) |
0.1 | 0.3 | GO:0004427 | inorganic diphosphatase activity(GO:0004427) |
0.1 | 1.2 | GO:0070182 | DNA polymerase binding(GO:0070182) |
0.1 | 0.7 | GO:0005072 | transforming growth factor beta receptor, cytoplasmic mediator activity(GO:0005072) |
0.1 | 2.4 | GO:0005086 | ARF guanyl-nucleotide exchange factor activity(GO:0005086) |
0.1 | 1.3 | GO:0017166 | vinculin binding(GO:0017166) |
0.1 | 0.3 | GO:0035515 | oxidative RNA demethylase activity(GO:0035515) |
0.1 | 0.3 | GO:0004699 | calcium-independent protein kinase C activity(GO:0004699) |
0.1 | 0.8 | GO:0008140 | cAMP response element binding protein binding(GO:0008140) |
0.1 | 2.1 | GO:0016922 | ligand-dependent nuclear receptor binding(GO:0016922) |
0.1 | 0.3 | GO:0008732 | threonine aldolase activity(GO:0004793) L-allo-threonine aldolase activity(GO:0008732) |
0.1 | 0.3 | GO:0035276 | ethanol binding(GO:0035276) |
0.1 | 1.3 | GO:0034237 | protein kinase A regulatory subunit binding(GO:0034237) |
0.1 | 0.3 | GO:2001070 | starch binding(GO:2001070) |
0.1 | 0.3 | GO:0050510 | N-acetylgalactosaminyl-proteoglycan 3-beta-glucuronosyltransferase activity(GO:0050510) |
0.1 | 0.5 | GO:0003680 | AT DNA binding(GO:0003680) |
0.1 | 0.3 | GO:0015016 | [heparan sulfate]-glucosamine N-sulfotransferase activity(GO:0015016) |
0.1 | 1.2 | GO:0050431 | transforming growth factor beta binding(GO:0050431) |
0.1 | 0.2 | GO:0038064 | collagen receptor activity(GO:0038064) |
0.1 | 0.3 | GO:0015057 | thrombin receptor activity(GO:0015057) |
0.1 | 0.2 | GO:0050508 | glucuronosyl-N-acetylglucosaminyl-proteoglycan 4-alpha-N-acetylglucosaminyltransferase activity(GO:0050508) |
0.1 | 0.6 | GO:0031545 | peptidyl-proline 4-dioxygenase activity(GO:0031545) |
0.1 | 0.2 | GO:0030519 | snoRNP binding(GO:0030519) |
0.1 | 2.3 | GO:0043236 | laminin binding(GO:0043236) |
0.1 | 0.2 | GO:0004939 | beta-adrenergic receptor activity(GO:0004939) |
0.1 | 0.7 | GO:0043995 | histone acetyltransferase activity (H4-K5 specific)(GO:0043995) histone acetyltransferase activity (H4-K8 specific)(GO:0043996) histone acetyltransferase activity (H4-K16 specific)(GO:0046972) |
0.1 | 0.7 | GO:0016857 | racemase and epimerase activity, acting on carbohydrates and derivatives(GO:0016857) |
0.1 | 0.3 | GO:0016833 | oxo-acid-lyase activity(GO:0016833) |
0.1 | 0.4 | GO:0051022 | Rho GDP-dissociation inhibitor binding(GO:0051022) |
0.1 | 0.6 | GO:0017070 | U6 snRNA binding(GO:0017070) |
0.1 | 0.1 | GO:0032139 | dinucleotide insertion or deletion binding(GO:0032139) single guanine insertion binding(GO:0032142) |
0.1 | 1.9 | GO:0001205 | transcriptional activator activity, RNA polymerase II distal enhancer sequence-specific binding(GO:0001205) |
0.1 | 0.2 | GO:0004517 | nitric-oxide synthase activity(GO:0004517) |
0.1 | 0.4 | GO:0008420 | CTD phosphatase activity(GO:0008420) |
0.1 | 0.8 | GO:0050811 | GABA receptor binding(GO:0050811) |
0.1 | 0.6 | GO:0003691 | double-stranded telomeric DNA binding(GO:0003691) |
0.1 | 0.9 | GO:0008253 | 5'-nucleotidase activity(GO:0008253) |
0.1 | 0.1 | GO:0004630 | phospholipase D activity(GO:0004630) |
0.1 | 0.4 | GO:0004439 | phosphatidylinositol-4,5-bisphosphate 5-phosphatase activity(GO:0004439) |
0.1 | 0.1 | GO:0035727 | lysophosphatidic acid binding(GO:0035727) |
0.1 | 0.2 | GO:0016842 | amidine-lyase activity(GO:0016842) |
0.1 | 0.3 | GO:0097642 | calcitonin family receptor activity(GO:0097642) |
0.1 | 0.7 | GO:0046977 | TAP binding(GO:0046977) |
0.1 | 0.6 | GO:0070180 | large ribosomal subunit rRNA binding(GO:0070180) |
0.1 | 1.3 | GO:0030506 | ankyrin binding(GO:0030506) |
0.1 | 0.3 | GO:0017034 | Rap guanyl-nucleotide exchange factor activity(GO:0017034) |
0.1 | 0.2 | GO:0080130 | L-phenylalanine:2-oxoglutarate aminotransferase activity(GO:0080130) |
0.1 | 0.2 | GO:0047499 | calcium-independent phospholipase A2 activity(GO:0047499) |
0.1 | 0.2 | GO:0005146 | leukemia inhibitory factor receptor binding(GO:0005146) |
0.1 | 0.4 | GO:0003708 | retinoic acid receptor activity(GO:0003708) |
0.1 | 0.4 | GO:0043426 | MRF binding(GO:0043426) |
0.1 | 2.0 | GO:0018024 | histone-lysine N-methyltransferase activity(GO:0018024) |
0.1 | 0.2 | GO:0004416 | hydroxyacylglutathione hydrolase activity(GO:0004416) |
0.1 | 0.4 | GO:0035197 | siRNA binding(GO:0035197) |
0.1 | 0.2 | GO:0051434 | BH3 domain binding(GO:0051434) |
0.1 | 0.2 | GO:0042392 | sphingosine-1-phosphate phosphatase activity(GO:0042392) |
0.1 | 0.2 | GO:0071987 | WD40-repeat domain binding(GO:0071987) |
0.1 | 1.8 | GO:0043741 | dihydrolipoamide branched chain acyltransferase activity(GO:0004147) palmitoleoyl [acyl-carrier-protein]-dependent acyltransferase activity(GO:0008951) serine O-acyltransferase activity(GO:0016412) O-succinyltransferase activity(GO:0016750) sinapoyltransferase activity(GO:0016752) O-sinapoyltransferase activity(GO:0016753) peptidyl-lysine N6-myristoyltransferase activity(GO:0018030) peptidyl-lysine N6-palmitoyltransferase activity(GO:0018031) benzoyl acetate-CoA thiolase activity(GO:0018711) 3-hydroxybutyryl-CoA thiolase activity(GO:0018712) 3-ketopimelyl-CoA thiolase activity(GO:0018713) N-palmitoyltransferase activity(GO:0019105) acyl-CoA N-acyltransferase activity(GO:0019186) protein-cysteine S-myristoyltransferase activity(GO:0019705) glucosaminyl-phosphotidylinositol O-acyltransferase activity(GO:0032216) ergosterol O-acyltransferase activity(GO:0034737) lanosterol O-acyltransferase activity(GO:0034738) naphthyl-2-oxomethyl-succinyl-CoA succinyl transferase activity(GO:0034848) 2,4,4-trimethyl-3-oxopentanoyl-CoA 2-C-propanoyl transferase activity(GO:0034851) 2-methylhexanoyl-CoA C-acetyltransferase activity(GO:0034915) butyryl-CoA 2-C-propionyltransferase activity(GO:0034919) 2,6-dimethyl-5-methylene-3-oxo-heptanoyl-CoA C-acetyltransferase activity(GO:0034945) L-2-aminoadipate N-acetyltransferase activity(GO:0043741) keto acid formate lyase activity(GO:0043806) azetidine-2-carboxylic acid acetyltransferase activity(GO:0046941) peptidyl-lysine N-acetyltransferase activity, acting on acetyl phosphate as donor(GO:0052858) acetyl-CoA:L-lysine N6-acetyltransferase(GO:0090595) |
0.1 | 0.2 | GO:0097200 | cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:0097200) |
0.1 | 0.4 | GO:0004931 | extracellular ATP-gated cation channel activity(GO:0004931) ATP-gated ion channel activity(GO:0035381) |
0.1 | 0.3 | GO:0070191 | methionine-R-sulfoxide reductase activity(GO:0070191) |
0.1 | 0.9 | GO:0052890 | oxidoreductase activity, acting on the CH-CH group of donors, with a flavin as acceptor(GO:0052890) |
0.1 | 0.3 | GO:0001025 | RNA polymerase III transcription factor binding(GO:0001025) |
0.1 | 0.3 | GO:0003847 | 1-alkyl-2-acetylglycerophosphocholine esterase activity(GO:0003847) |
0.1 | 0.4 | GO:0102391 | decanoate--CoA ligase activity(GO:0102391) |
0.1 | 0.5 | GO:0004568 | chitinase activity(GO:0004568) |
0.1 | 0.3 | GO:0038132 | neuregulin binding(GO:0038132) |
0.1 | 0.5 | GO:0015168 | glycerol transmembrane transporter activity(GO:0015168) glycerol channel activity(GO:0015254) |
0.1 | 0.3 | GO:0003910 | DNA ligase activity(GO:0003909) DNA ligase (ATP) activity(GO:0003910) |
0.1 | 0.1 | GO:0035615 | clathrin adaptor activity(GO:0035615) endocytic adaptor activity(GO:0098748) |
0.0 | 0.3 | GO:0005078 | MAP-kinase scaffold activity(GO:0005078) |
0.0 | 1.1 | GO:0030332 | cyclin binding(GO:0030332) |
0.0 | 0.2 | GO:0008532 | N-acetyllactosaminide beta-1,3-N-acetylglucosaminyltransferase activity(GO:0008532) |
0.0 | 1.0 | GO:0043531 | ADP binding(GO:0043531) |
0.0 | 1.3 | GO:0001103 | RNA polymerase II repressing transcription factor binding(GO:0001103) |
0.0 | 0.1 | GO:0004605 | phosphatidate cytidylyltransferase activity(GO:0004605) |
0.0 | 0.2 | GO:0030284 | estrogen receptor activity(GO:0030284) |
0.0 | 0.0 | GO:0051525 | NFAT protein binding(GO:0051525) |
0.0 | 0.2 | GO:0000832 | inositol hexakisphosphate kinase activity(GO:0000828) inositol hexakisphosphate 5-kinase activity(GO:0000832) inositol hexakisphosphate 1-kinase activity(GO:0052723) inositol hexakisphosphate 3-kinase activity(GO:0052724) |
0.0 | 0.3 | GO:0003688 | DNA replication origin binding(GO:0003688) |
0.0 | 0.1 | GO:0043120 | tumor necrosis factor binding(GO:0043120) |
0.0 | 0.1 | GO:0000182 | rDNA binding(GO:0000182) |
0.0 | 0.4 | GO:0008429 | phosphatidylethanolamine binding(GO:0008429) |
0.0 | 1.3 | GO:0070888 | E-box binding(GO:0070888) |
0.0 | 0.2 | GO:0015189 | arginine transmembrane transporter activity(GO:0015181) L-lysine transmembrane transporter activity(GO:0015189) |
0.0 | 0.5 | GO:0034450 | ubiquitin-ubiquitin ligase activity(GO:0034450) |
0.0 | 0.1 | GO:0031685 | adenosine receptor binding(GO:0031685) |
0.0 | 0.2 | GO:0070569 | uridylyltransferase activity(GO:0070569) |
0.0 | 0.1 | GO:0017116 | single-stranded DNA-dependent ATP-dependent DNA helicase activity(GO:0017116) |
0.0 | 0.4 | GO:0004383 | guanylate cyclase activity(GO:0004383) |
0.0 | 0.3 | GO:0004322 | ferroxidase activity(GO:0004322) oxidoreductase activity, oxidizing metal ions, oxygen as acceptor(GO:0016724) |
0.0 | 0.5 | GO:0070700 | BMP receptor binding(GO:0070700) |
0.0 | 1.1 | GO:0005154 | epidermal growth factor receptor binding(GO:0005154) |
0.0 | 0.2 | GO:0016018 | cyclosporin A binding(GO:0016018) |
0.0 | 0.2 | GO:0030292 | protein tyrosine kinase inhibitor activity(GO:0030292) |
0.0 | 0.2 | GO:0004301 | epoxide hydrolase activity(GO:0004301) |
0.0 | 0.2 | GO:0004311 | farnesyltranstransferase activity(GO:0004311) |
0.0 | 0.1 | GO:0034186 | apolipoprotein A-I binding(GO:0034186) |
0.0 | 0.1 | GO:0031800 | type 3 metabotropic glutamate receptor binding(GO:0031800) |
0.0 | 0.1 | GO:0050309 | glucose-6-phosphatase activity(GO:0004346) sugar-terminal-phosphatase activity(GO:0050309) |
0.0 | 0.2 | GO:0015216 | adenine nucleotide transmembrane transporter activity(GO:0000295) purine ribonucleotide transmembrane transporter activity(GO:0005346) purine nucleotide transmembrane transporter activity(GO:0015216) |
0.0 | 1.5 | GO:0033613 | activating transcription factor binding(GO:0033613) |
0.0 | 0.4 | GO:0050998 | nitric-oxide synthase binding(GO:0050998) |
0.0 | 0.4 | GO:0015643 | toxic substance binding(GO:0015643) |
0.0 | 2.7 | GO:0004540 | ribonuclease activity(GO:0004540) |
0.0 | 0.8 | GO:0043027 | cysteine-type endopeptidase inhibitor activity involved in apoptotic process(GO:0043027) |
0.0 | 0.0 | GO:0034594 | phosphatidylinositol trisphosphate phosphatase activity(GO:0034594) |
0.0 | 0.1 | GO:0005173 | stem cell factor receptor binding(GO:0005173) |
0.0 | 0.2 | GO:0015280 | ligand-gated sodium channel activity(GO:0015280) |
0.0 | 0.2 | GO:0001222 | transcription corepressor binding(GO:0001222) |
0.0 | 0.2 | GO:0000014 | single-stranded DNA endodeoxyribonuclease activity(GO:0000014) |
0.0 | 0.1 | GO:0008525 | phosphatidylcholine transporter activity(GO:0008525) |
0.0 | 0.2 | GO:0003918 | DNA topoisomerase type II (ATP-hydrolyzing) activity(GO:0003918) DNA topoisomerase II activity(GO:0061505) |
0.0 | 1.0 | GO:0005484 | SNAP receptor activity(GO:0005484) |
0.0 | 0.8 | GO:0030331 | estrogen receptor binding(GO:0030331) |
0.0 | 0.6 | GO:0031435 | mitogen-activated protein kinase kinase kinase binding(GO:0031435) |
0.0 | 0.3 | GO:0004143 | diacylglycerol kinase activity(GO:0004143) |
0.0 | 0.2 | GO:0042609 | CD4 receptor binding(GO:0042609) |
0.0 | 0.1 | GO:0032190 | acrosin binding(GO:0032190) |
0.0 | 0.1 | GO:0070878 | primary miRNA binding(GO:0070878) |
0.0 | 1.2 | GO:0005109 | frizzled binding(GO:0005109) |
0.0 | 0.2 | GO:0035014 | phosphatidylinositol 3-kinase regulator activity(GO:0035014) |
0.0 | 0.1 | GO:0097371 | MDM2/MDM4 family protein binding(GO:0097371) |
0.0 | 0.1 | GO:0016015 | morphogen activity(GO:0016015) |
0.0 | 0.7 | GO:0051879 | Hsp90 protein binding(GO:0051879) |
0.0 | 0.5 | GO:0008330 | protein tyrosine/threonine phosphatase activity(GO:0008330) |
0.0 | 1.3 | GO:0005544 | calcium-dependent phospholipid binding(GO:0005544) |
0.0 | 0.3 | GO:0044548 | S100 protein binding(GO:0044548) |
0.0 | 0.5 | GO:0005527 | macrolide binding(GO:0005527) FK506 binding(GO:0005528) |
0.0 | 0.2 | GO:0004571 | mannosyl-oligosaccharide 1,2-alpha-mannosidase activity(GO:0004571) |
0.0 | 0.2 | GO:0050786 | RAGE receptor binding(GO:0050786) |
0.0 | 0.1 | GO:0004046 | aminoacylase activity(GO:0004046) |
0.0 | 0.4 | GO:0070412 | R-SMAD binding(GO:0070412) |
0.0 | 0.9 | GO:0015485 | cholesterol binding(GO:0015485) |
0.0 | 0.3 | GO:0015129 | lactate transmembrane transporter activity(GO:0015129) |
0.0 | 0.2 | GO:0005384 | manganese ion transmembrane transporter activity(GO:0005384) |
0.0 | 0.5 | GO:0031489 | myosin V binding(GO:0031489) |
0.0 | 0.1 | GO:0004687 | myosin light chain kinase activity(GO:0004687) |
0.0 | 0.1 | GO:0008597 | calcium-dependent protein serine/threonine phosphatase regulator activity(GO:0008597) |
0.0 | 0.1 | GO:0042809 | vitamin D receptor binding(GO:0042809) |
0.0 | 0.2 | GO:0032552 | deoxyribonucleotide binding(GO:0032552) |
0.0 | 0.1 | GO:0004566 | beta-glucuronidase activity(GO:0004566) |
0.0 | 0.1 | GO:0005157 | macrophage colony-stimulating factor receptor binding(GO:0005157) |
0.0 | 0.3 | GO:0044606 | thiamine-pyrophosphatase activity(GO:0004787) UDP-2,3-diacylglucosamine hydrolase activity(GO:0008758) dATP pyrophosphohydrolase activity(GO:0008828) dihydroneopterin monophosphate phosphatase activity(GO:0019176) dihydroneopterin triphosphate pyrophosphohydrolase activity(GO:0019177) dTTP diphosphatase activity(GO:0036218) phosphocholine hydrolase activity(GO:0044606) |
0.0 | 0.1 | GO:1904264 | ubiquitin protein ligase activity involved in ERAD pathway(GO:1904264) |
0.0 | 0.2 | GO:0005049 | nuclear export signal receptor activity(GO:0005049) |
0.0 | 0.1 | GO:0016509 | long-chain-3-hydroxyacyl-CoA dehydrogenase activity(GO:0016509) |
0.0 | 0.0 | GO:0005095 | GTPase inhibitor activity(GO:0005095) |
0.0 | 0.2 | GO:0001849 | complement component C1q binding(GO:0001849) |
0.0 | 0.2 | GO:0001609 | G-protein coupled adenosine receptor activity(GO:0001609) |
0.0 | 0.1 | GO:2001069 | glycogen binding(GO:2001069) |
0.0 | 0.2 | GO:0036041 | long-chain fatty acid binding(GO:0036041) |
0.0 | 0.2 | GO:0047372 | acylglycerol lipase activity(GO:0047372) |
0.0 | 0.2 | GO:0050733 | RS domain binding(GO:0050733) |
0.0 | 0.1 | GO:0008898 | S-adenosylmethionine-homocysteine S-methyltransferase activity(GO:0008898) |
0.0 | 0.1 | GO:0031127 | galactoside 2-alpha-L-fucosyltransferase activity(GO:0008107) alpha-(1,2)-fucosyltransferase activity(GO:0031127) |
0.0 | 0.6 | GO:0030552 | cAMP binding(GO:0030552) |
0.0 | 0.5 | GO:0005385 | zinc ion transmembrane transporter activity(GO:0005385) |
0.0 | 0.1 | GO:0051431 | corticotropin-releasing hormone receptor 2 binding(GO:0051431) |
0.0 | 0.0 | GO:0050692 | DBD domain binding(GO:0050692) |
0.0 | 0.1 | GO:0004582 | dolichyl-phosphate beta-D-mannosyltransferase activity(GO:0004582) |
0.0 | 0.1 | GO:0031493 | nucleosomal histone binding(GO:0031493) |
0.0 | 0.6 | GO:0045296 | cadherin binding(GO:0045296) |
0.0 | 0.0 | GO:0008379 | thioredoxin peroxidase activity(GO:0008379) |
0.0 | 1.2 | GO:0003743 | translation initiation factor activity(GO:0003743) |
0.0 | 0.4 | GO:0004623 | phospholipase A2 activity(GO:0004623) |
0.0 | 0.2 | GO:0032036 | myosin heavy chain binding(GO:0032036) |
0.0 | 0.0 | GO:0030172 | troponin C binding(GO:0030172) |
0.0 | 0.4 | GO:0017049 | GTP-Rho binding(GO:0017049) |
0.0 | 1.5 | GO:0042826 | histone deacetylase binding(GO:0042826) |
0.0 | 0.1 | GO:0009374 | biotin binding(GO:0009374) |
0.0 | 0.6 | GO:0043394 | proteoglycan binding(GO:0043394) |
0.0 | 0.1 | GO:0016838 | carbon-oxygen lyase activity, acting on phosphates(GO:0016838) |
0.0 | 0.4 | GO:0050840 | extracellular matrix binding(GO:0050840) |
0.0 | 0.0 | GO:0016401 | palmitoyl-CoA oxidase activity(GO:0016401) |
0.0 | 0.1 | GO:0004949 | cannabinoid receptor activity(GO:0004949) |
0.0 | 0.2 | GO:0019203 | carbohydrate phosphatase activity(GO:0019203) sugar-phosphatase activity(GO:0050308) |
0.0 | 0.0 | GO:0033743 | peptide-methionine (R)-S-oxide reductase activity(GO:0033743) |
0.0 | 0.7 | GO:0004364 | glutathione transferase activity(GO:0004364) |
0.0 | 0.1 | GO:0004514 | nicotinate-nucleotide diphosphorylase (carboxylating) activity(GO:0004514) |
0.0 | 0.0 | GO:0004022 | alcohol dehydrogenase (NAD) activity(GO:0004022) |
0.0 | 0.2 | GO:0031005 | filamin binding(GO:0031005) |
0.0 | 0.3 | GO:0030544 | Hsp70 protein binding(GO:0030544) |
0.0 | 0.1 | GO:0034596 | phosphatidylinositol phosphate 4-phosphatase activity(GO:0034596) |
0.0 | 0.1 | GO:0005176 | ErbB-2 class receptor binding(GO:0005176) |
0.0 | 0.1 | GO:0004445 | inositol-polyphosphate 5-phosphatase activity(GO:0004445) |
0.0 | 0.3 | GO:0019789 | SUMO transferase activity(GO:0019789) |
0.0 | 0.4 | GO:0004198 | calcium-dependent cysteine-type endopeptidase activity(GO:0004198) |
0.0 | 0.1 | GO:0051787 | misfolded protein binding(GO:0051787) |
0.0 | 0.1 | GO:0015467 | G-protein activated inward rectifier potassium channel activity(GO:0015467) |
0.0 | 0.1 | GO:0004859 | phospholipase inhibitor activity(GO:0004859) |
0.0 | 0.1 | GO:0005412 | glucose:sodium symporter activity(GO:0005412) |
0.0 | 0.1 | GO:0004663 | Rab geranylgeranyltransferase activity(GO:0004663) |
0.0 | 0.0 | GO:0032405 | MutLalpha complex binding(GO:0032405) |
0.0 | 0.1 | GO:0043559 | insulin binding(GO:0043559) |
0.0 | 0.1 | GO:0016312 | inositol bisphosphate phosphatase activity(GO:0016312) |
0.0 | 0.2 | GO:0042500 | aspartic endopeptidase activity, intramembrane cleaving(GO:0042500) |
0.0 | 0.1 | GO:0004095 | carnitine O-palmitoyltransferase activity(GO:0004095) |
0.0 | 0.1 | GO:0015173 | aromatic amino acid transmembrane transporter activity(GO:0015173) |
0.0 | 0.1 | GO:0034513 | box H/ACA snoRNA binding(GO:0034513) |
0.0 | 0.2 | GO:0043024 | ribosomal small subunit binding(GO:0043024) |
0.0 | 0.3 | GO:0008198 | ferrous iron binding(GO:0008198) |
0.0 | 0.1 | GO:0003945 | N-acetyllactosamine synthase activity(GO:0003945) |
0.0 | 0.1 | GO:0016615 | malate dehydrogenase activity(GO:0016615) |
0.0 | 0.1 | GO:0016714 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, reduced pteridine as one donor, and incorporation of one atom of oxygen(GO:0016714) |
0.0 | 0.0 | GO:0030911 | TPR domain binding(GO:0030911) |
0.0 | 0.1 | GO:0036402 | proteasome-activating ATPase activity(GO:0036402) |
0.0 | 0.1 | GO:0086007 | voltage-gated calcium channel activity involved in cardiac muscle cell action potential(GO:0086007) voltage-gated calcium channel activity involved in AV node cell action potential(GO:0086056) |
0.0 | 0.0 | GO:0005350 | purine nucleobase transmembrane transporter activity(GO:0005345) pyrimidine nucleobase transmembrane transporter activity(GO:0005350) nucleobase transmembrane transporter activity(GO:0015205) |
0.0 | 0.0 | GO:0070653 | high-density lipoprotein particle receptor binding(GO:0070653) |
0.0 | 0.1 | GO:0004035 | alkaline phosphatase activity(GO:0004035) |
0.0 | 0.3 | GO:0008408 | 3'-5' exonuclease activity(GO:0008408) |
0.0 | 0.1 | GO:0090482 | vitamin transmembrane transporter activity(GO:0090482) |
0.0 | 0.1 | GO:0016494 | C-X-C chemokine receptor activity(GO:0016494) |
0.0 | 0.1 | GO:0008823 | cupric reductase activity(GO:0008823) ferric-chelate reductase (NADPH) activity(GO:0052851) |
0.0 | 0.1 | GO:0048027 | mRNA 5'-UTR binding(GO:0048027) |
0.0 | 0.2 | GO:0016215 | acyl-CoA desaturase activity(GO:0016215) |
0.0 | 0.1 | GO:0004017 | adenylate kinase activity(GO:0004017) |
0.0 | 0.4 | GO:0005212 | structural constituent of eye lens(GO:0005212) |
0.0 | 0.0 | GO:0035662 | Toll-like receptor 4 binding(GO:0035662) |
0.0 | 0.1 | GO:0050567 | glutaminyl-tRNA synthase (glutamine-hydrolyzing) activity(GO:0050567) |
0.0 | 1.7 | GO:0004222 | metalloendopeptidase activity(GO:0004222) |
0.0 | 0.0 | GO:0008384 | IkappaB kinase activity(GO:0008384) |
0.0 | 0.1 | GO:0005092 | GDP-dissociation inhibitor activity(GO:0005092) |
0.0 | 0.2 | GO:0048038 | quinone binding(GO:0048038) |
0.0 | 0.1 | GO:0051010 | microtubule plus-end binding(GO:0051010) |
0.0 | 0.5 | GO:0017112 | Rab guanyl-nucleotide exchange factor activity(GO:0017112) |
0.0 | 0.1 | GO:0016176 | superoxide-generating NADPH oxidase activator activity(GO:0016176) |
0.0 | 0.1 | GO:0072542 | protein phosphatase activator activity(GO:0072542) |
0.0 | 0.5 | GO:0031072 | heat shock protein binding(GO:0031072) |
0.0 | 0.1 | GO:0015272 | ATP-activated inward rectifier potassium channel activity(GO:0015272) |
0.0 | 0.1 | GO:0035198 | miRNA binding(GO:0035198) |
0.0 | 0.4 | GO:0051539 | 4 iron, 4 sulfur cluster binding(GO:0051539) |
0.0 | 0.1 | GO:0022833 | mechanically-gated ion channel activity(GO:0008381) mechanically gated channel activity(GO:0022833) |
0.0 | 0.1 | GO:0008273 | calcium, potassium:sodium antiporter activity(GO:0008273) |
0.0 | 0.1 | GO:0008307 | structural constituent of muscle(GO:0008307) |
0.0 | 0.0 | GO:0005415 | nucleoside:sodium symporter activity(GO:0005415) |
0.0 | 0.1 | GO:0015187 | glycine transmembrane transporter activity(GO:0015187) |
0.0 | 0.0 | GO:0035877 | death effector domain binding(GO:0035877) |
0.0 | 0.0 | GO:0003872 | 6-phosphofructokinase activity(GO:0003872) |
0.0 | 0.1 | GO:0000155 | phosphorelay sensor kinase activity(GO:0000155) |
0.0 | 0.0 | GO:0030158 | protein xylosyltransferase activity(GO:0030158) |
0.0 | 0.0 | GO:0015111 | iodide transmembrane transporter activity(GO:0015111) |
0.0 | 0.5 | GO:0004864 | protein phosphatase inhibitor activity(GO:0004864) |
0.0 | 0.2 | GO:0000149 | SNARE binding(GO:0000149) |
0.0 | 0.2 | GO:0070064 | proline-rich region binding(GO:0070064) |
0.0 | 0.2 | GO:0070300 | phosphatidic acid binding(GO:0070300) |
0.0 | 0.1 | GO:0043008 | ATP-dependent protein binding(GO:0043008) |
0.0 | 0.3 | GO:0051721 | protein phosphatase 2A binding(GO:0051721) |
0.0 | 1.0 | GO:0005089 | Rho guanyl-nucleotide exchange factor activity(GO:0005089) |
0.0 | 0.1 | GO:0034871 | pinocarveol dehydrogenase activity(GO:0018446) chloral hydrate dehydrogenase activity(GO:0018447) hydroxymethylmethylsilanediol oxidase activity(GO:0018448) 1-phenylethanol dehydrogenase activity(GO:0018449) myrtenol dehydrogenase activity(GO:0018450) cis-1,2-dihydroxy-1,2-dihydro-8-carboxynaphthalene dehydrogenase activity(GO:0034522) 3-hydroxy-4-methyloctanoyl-CoA dehydrogenase activity(GO:0034582) 2-hydroxy-4-isopropenylcyclohexane-1-carboxyl-CoA dehydrogenase activity(GO:0034778) cis-9,10-dihydroanthracene-9,10-diol dehydrogenase activity(GO:0034817) citronellol dehydrogenase activity(GO:0034821) naphthyl-2-hydroxymethyl-succinyl-CoA dehydrogenase activity(GO:0034847) 2,4,4-trimethyl-1-pentanol dehydrogenase activity(GO:0034863) 2,4,4-trimethyl-3-hydroxypentanoyl-CoA dehydrogenase activity(GO:0034868) 1-hydroxy-4,4-dimethylpentan-3-one dehydrogenase activity(GO:0034871) endosulfan diol dehydrogenase activity(GO:0034891) endosulfan hydroxyether dehydrogenase activity(GO:0034901) 3-hydroxy-2-methylhexanoyl-CoA dehydrogenase activity(GO:0034918) 3-hydroxy-2,6-dimethyl-5-methylene-heptanoyl-CoA dehydrogenase activity(GO:0034944) versicolorin reductase activity(GO:0042469) ketoreductase activity(GO:0045703) |
0.0 | 0.1 | GO:0050656 | 3'-phosphoadenosine 5'-phosphosulfate binding(GO:0050656) |
0.0 | 0.6 | GO:0019905 | syntaxin binding(GO:0019905) |
0.0 | 0.1 | GO:0097027 | ubiquitin-protein transferase activator activity(GO:0097027) |
0.0 | 1.2 | GO:0017137 | Rab GTPase binding(GO:0017137) |
0.0 | 0.3 | GO:0030515 | snoRNA binding(GO:0030515) |
0.0 | 0.0 | GO:0051033 | nucleic acid transmembrane transporter activity(GO:0051032) RNA transmembrane transporter activity(GO:0051033) |
0.0 | 0.0 | GO:0045503 | dynein light chain binding(GO:0045503) |
0.0 | 0.1 | GO:0004861 | cyclin-dependent protein serine/threonine kinase inhibitor activity(GO:0004861) |
0.0 | 0.1 | GO:0035174 | histone serine kinase activity(GO:0035174) |
0.0 | 0.0 | GO:0016418 | S-acetyltransferase activity(GO:0016418) |
0.0 | 0.2 | GO:0043539 | protein serine/threonine kinase activator activity(GO:0043539) |
0.0 | 0.1 | GO:0019136 | deoxynucleoside kinase activity(GO:0019136) |
0.0 | 0.1 | GO:0043495 | protein anchor(GO:0043495) |
0.0 | 0.0 | GO:0015526 | hexose phosphate transmembrane transporter activity(GO:0015119) organophosphate:inorganic phosphate antiporter activity(GO:0015315) hexose-phosphate:inorganic phosphate antiporter activity(GO:0015526) glucose 6-phosphate:inorganic phosphate antiporter activity(GO:0061513) |
0.0 | 0.1 | GO:0003956 | NAD(P)+-protein-arginine ADP-ribosyltransferase activity(GO:0003956) |
0.0 | 0.0 | GO:0005001 | transmembrane receptor protein tyrosine phosphatase activity(GO:0005001) |
0.0 | 0.4 | GO:0001085 | RNA polymerase II transcription factor binding(GO:0001085) |
0.0 | 0.3 | GO:0036002 | pre-mRNA binding(GO:0036002) |
0.0 | 0.3 | GO:0001540 | beta-amyloid binding(GO:0001540) |
0.0 | 0.2 | GO:0005088 | Ras guanyl-nucleotide exchange factor activity(GO:0005088) |
0.0 | 0.0 | GO:0003876 | AMP deaminase activity(GO:0003876) adenosine-phosphate deaminase activity(GO:0047623) |
0.0 | 0.1 | GO:0030983 | mismatched DNA binding(GO:0030983) |
0.0 | 0.0 | GO:0097016 | L27 domain binding(GO:0097016) |
0.0 | 0.0 | GO:0008252 | nucleotidase activity(GO:0008252) |
0.0 | 0.0 | GO:0016901 | oxidoreductase activity, acting on the CH-OH group of donors, quinone or similar compound as acceptor(GO:0016901) |
0.0 | 0.0 | GO:0019770 | IgG receptor activity(GO:0019770) |
0.0 | 0.0 | GO:0008526 | phosphatidylinositol transporter activity(GO:0008526) |
0.0 | 0.1 | GO:0018741 | alkyl sulfatase activity(GO:0018741) endosulfan hemisulfate sulfatase activity(GO:0034889) endosulfan sulfate hydrolase activity(GO:0034902) |
0.0 | 0.2 | GO:0031492 | nucleosomal DNA binding(GO:0031492) |
0.0 | 0.1 | GO:0102344 | 3-hydroxy-behenoyl-CoA dehydratase activity(GO:0102344) 3-hydroxy-lignoceroyl-CoA dehydratase activity(GO:0102345) |
0.0 | 0.1 | GO:0034584 | piRNA binding(GO:0034584) |
0.0 | 0.1 | GO:0004994 | somatostatin receptor activity(GO:0004994) |
0.0 | 0.0 | GO:0019788 | NEDD8 transferase activity(GO:0019788) |
0.0 | 0.0 | GO:0005131 | growth hormone receptor binding(GO:0005131) |
0.0 | 0.1 | GO:0008121 | ubiquinol-cytochrome-c reductase activity(GO:0008121) oxidoreductase activity, acting on diphenols and related substances as donors, cytochrome as acceptor(GO:0016681) |
0.0 | 1.1 | GO:0003774 | motor activity(GO:0003774) |
0.0 | 1.3 | GO:0004867 | serine-type endopeptidase inhibitor activity(GO:0004867) |
0.0 | 0.0 | GO:0070840 | dynein complex binding(GO:0070840) |
0.0 | 0.0 | GO:0043141 | ATP-dependent 5'-3' DNA helicase activity(GO:0043141) |
0.0 | 0.0 | GO:0004563 | beta-N-acetylhexosaminidase activity(GO:0004563) |
0.0 | 0.0 | GO:0016406 | carnitine O-acyltransferase activity(GO:0016406) |
0.0 | 0.1 | GO:0043560 | insulin receptor substrate binding(GO:0043560) |
0.0 | 0.0 | GO:1990715 | mRNA CDS binding(GO:1990715) |
0.0 | 0.0 | GO:0038181 | bile acid receptor activity(GO:0038181) |
0.0 | 0.0 | GO:0004082 | bisphosphoglycerate mutase activity(GO:0004082) bisphosphoglycerate 2-phosphatase activity(GO:0004083) phosphoglycerate mutase activity(GO:0004619) 2,3-bisphosphoglycerate-dependent phosphoglycerate mutase activity(GO:0046538) |
0.0 | 0.1 | GO:0004596 | peptide alpha-N-acetyltransferase activity(GO:0004596) |
0.0 | 0.1 | GO:0099604 | calcium-release channel activity(GO:0015278) ligand-gated calcium channel activity(GO:0099604) |
0.0 | 0.9 | GO:0051015 | actin filament binding(GO:0051015) |
0.0 | 0.0 | GO:0004735 | pyrroline-5-carboxylate reductase activity(GO:0004735) |
0.0 | 0.0 | GO:0071532 | ankyrin repeat binding(GO:0071532) |
0.0 | 0.0 | GO:0015232 | heme transporter activity(GO:0015232) |
0.0 | 0.0 | GO:0004673 | protein histidine kinase activity(GO:0004673) |
0.0 | 0.0 | GO:0010997 | anaphase-promoting complex binding(GO:0010997) |
0.0 | 0.0 | GO:0004645 | phosphorylase activity(GO:0004645) |
0.0 | 0.0 | GO:0060230 | lipoprotein lipase activator activity(GO:0060230) |
0.0 | 0.3 | GO:0005245 | voltage-gated calcium channel activity(GO:0005245) |
0.0 | 0.0 | GO:0070698 | type I activin receptor binding(GO:0070698) |
0.0 | 0.0 | GO:1901611 | phosphatidylglycerol binding(GO:1901611) cardiolipin binding(GO:1901612) |
0.0 | 0.0 | GO:0098518 | polynucleotide phosphatase activity(GO:0098518) |
0.0 | 0.1 | GO:0061133 | endopeptidase activator activity(GO:0061133) |
0.0 | 0.1 | GO:0045502 | dynein binding(GO:0045502) |
0.0 | 0.1 | GO:0001786 | phosphatidylserine binding(GO:0001786) |
0.0 | 0.0 | GO:0071208 | histone pre-mRNA DCP binding(GO:0071208) |
0.0 | 0.0 | GO:0016361 | activin receptor activity, type I(GO:0016361) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.3 | 2.8 | ST STAT3 PATHWAY | STAT3 Pathway |
0.2 | 0.7 | PID HDAC CLASSII PATHWAY | Signaling events mediated by HDAC Class II |
0.1 | 4.2 | PID FRA PATHWAY | Validated transcriptional targets of AP1 family members Fra1 and Fra2 |
0.1 | 1.1 | SA REG CASCADE OF CYCLIN EXPR | Expression of cyclins regulates progression through the cell cycle by activating cyclin-dependent kinases. |
0.1 | 2.2 | PID IL3 PATHWAY | IL3-mediated signaling events |
0.1 | 1.1 | PID ARF6 DOWNSTREAM PATHWAY | Arf6 downstream pathway |
0.1 | 2.7 | PID RETINOIC ACID PATHWAY | Retinoic acid receptors-mediated signaling |
0.1 | 1.5 | SA CASPASE CASCADE | Apoptosis is mediated by caspases, cysteine proteases arranged in a proteolytic cascade. |
0.1 | 0.8 | PID CIRCADIAN PATHWAY | Circadian rhythm pathway |
0.1 | 3.0 | PID DELTA NP63 PATHWAY | Validated transcriptional targets of deltaNp63 isoforms |
0.1 | 1.8 | PID RAS PATHWAY | Regulation of Ras family activation |
0.1 | 1.8 | PID IL6 7 PATHWAY | IL6-mediated signaling events |
0.1 | 2.0 | PID HES HEY PATHWAY | Notch-mediated HES/HEY network |
0.1 | 1.2 | PID P73PATHWAY | p73 transcription factor network |
0.1 | 0.1 | PID REELIN PATHWAY | Reelin signaling pathway |
0.0 | 0.2 | PID ER NONGENOMIC PATHWAY | Plasma membrane estrogen receptor signaling |
0.0 | 0.5 | PID AR TF PATHWAY | Regulation of Androgen receptor activity |
0.0 | 0.3 | ST PAC1 RECEPTOR PATHWAY | PAC1 Receptor Pathway |
0.0 | 1.4 | SIG REGULATION OF THE ACTIN CYTOSKELETON BY RHO GTPASES | Genes related to regulation of the actin cytoskeleton |
0.0 | 0.2 | ST GA12 PATHWAY | G alpha 12 Pathway |
0.0 | 2.0 | PID HIF1 TFPATHWAY | HIF-1-alpha transcription factor network |
0.0 | 0.9 | PID IFNG PATHWAY | IFN-gamma pathway |
0.0 | 1.4 | PID TAP63 PATHWAY | Validated transcriptional targets of TAp63 isoforms |
0.0 | 0.3 | ST G ALPHA S PATHWAY | G alpha s Pathway |
0.0 | 2.0 | PID MYC ACTIV PATHWAY | Validated targets of C-MYC transcriptional activation |
0.0 | 0.5 | PID ARF 3PATHWAY | Arf1 pathway |
0.0 | 0.3 | PID ALK2 PATHWAY | ALK2 signaling events |
0.0 | 0.4 | PID INTEGRIN5 PATHWAY | Beta5 beta6 beta7 and beta8 integrin cell surface interactions |
0.0 | 0.5 | PID AURORA A PATHWAY | Aurora A signaling |
0.0 | 0.7 | PID ANGIOPOIETIN RECEPTOR PATHWAY | Angiopoietin receptor Tie2-mediated signaling |
0.0 | 0.5 | PID HEDGEHOG 2PATHWAY | Signaling events mediated by the Hedgehog family |
0.0 | 0.2 | PID NFKAPPAB ATYPICAL PATHWAY | Atypical NF-kappaB pathway |
0.0 | 1.2 | ST FAS SIGNALING PATHWAY | Fas Signaling Pathway |
0.0 | 0.4 | PID FOXM1 PATHWAY | FOXM1 transcription factor network |
0.0 | 0.6 | PID INTEGRIN2 PATHWAY | Beta2 integrin cell surface interactions |
0.0 | 0.1 | SA FAS SIGNALING | The TNF-type receptor Fas induces apoptosis on ligand binding. |
0.0 | 0.9 | PID LKB1 PATHWAY | LKB1 signaling events |
0.0 | 0.7 | PID NCADHERIN PATHWAY | N-cadherin signaling events |
0.0 | 0.5 | PID ERBB1 DOWNSTREAM PATHWAY | ErbB1 downstream signaling |
0.0 | 0.6 | PID INTEGRIN A4B1 PATHWAY | Alpha4 beta1 integrin signaling events |
0.0 | 0.2 | PID EPO PATHWAY | EPO signaling pathway |
0.0 | 0.1 | ST GRANULE CELL SURVIVAL PATHWAY | Granule Cell Survival Pathway is a specific case of more general PAC1 Receptor Pathway. |
0.0 | 0.4 | PID EPHRINB REV PATHWAY | Ephrin B reverse signaling |
0.0 | 0.1 | PID MYC PATHWAY | C-MYC pathway |
0.0 | 1.9 | PID P53 DOWNSTREAM PATHWAY | Direct p53 effectors |
0.0 | 0.5 | PID A6B1 A6B4 INTEGRIN PATHWAY | a6b1 and a6b4 Integrin signaling |
0.0 | 0.2 | PID HIV NEF PATHWAY | HIV-1 Nef: Negative effector of Fas and TNF-alpha |
0.0 | 0.2 | PID FAS PATHWAY | FAS (CD95) signaling pathway |
0.0 | 0.1 | PID P38 MK2 PATHWAY | p38 signaling mediated by MAPKAP kinases |
0.0 | 0.2 | SIG INSULIN RECEPTOR PATHWAY IN CARDIAC MYOCYTES | Genes related to the insulin receptor pathway |
0.0 | 0.1 | PID IL2 1PATHWAY | IL2-mediated signaling events |
0.0 | 0.0 | PID IL8 CXCR1 PATHWAY | IL8- and CXCR1-mediated signaling events |
0.0 | 0.1 | PID P38 GAMMA DELTA PATHWAY | Signaling mediated by p38-gamma and p38-delta |
0.0 | 0.1 | PID AMB2 NEUTROPHILS PATHWAY | amb2 Integrin signaling |
0.0 | 0.5 | PID PLK1 PATHWAY | PLK1 signaling events |
0.0 | 0.1 | PID LYMPH ANGIOGENESIS PATHWAY | VEGFR3 signaling in lymphatic endothelium |
0.0 | 0.2 | PID SYNDECAN 4 PATHWAY | Syndecan-4-mediated signaling events |
0.0 | 0.2 | PID RXR VDR PATHWAY | RXR and RAR heterodimerization with other nuclear receptor |
0.0 | 0.0 | ST B CELL ANTIGEN RECEPTOR | B Cell Antigen Receptor |
0.0 | 0.5 | PID IL12 2PATHWAY | IL12-mediated signaling events |
0.0 | 0.3 | PID TOLL ENDOGENOUS PATHWAY | Endogenous TLR signaling |
0.0 | 0.0 | PID ERBB1 RECEPTOR PROXIMAL PATHWAY | EGF receptor (ErbB1) signaling pathway |
0.0 | 0.2 | ST ADRENERGIC | Adrenergic Pathway |
0.0 | 0.1 | PID ECADHERIN NASCENT AJ PATHWAY | E-cadherin signaling in the nascent adherens junction |
0.0 | 0.5 | PID TCR PATHWAY | TCR signaling in naïve CD4+ T cells |
0.0 | 0.3 | PID ILK PATHWAY | Integrin-linked kinase signaling |
0.0 | 0.1 | PID SYNDECAN 2 PATHWAY | Syndecan-2-mediated signaling events |
0.0 | 0.4 | PID ARF6 TRAFFICKING PATHWAY | Arf6 trafficking events |
0.0 | 0.1 | PID IL23 PATHWAY | IL23-mediated signaling events |
0.0 | 0.3 | PID MTOR 4PATHWAY | mTOR signaling pathway |
0.0 | 0.3 | PID P53 REGULATION PATHWAY | p53 pathway |
0.0 | 0.0 | ST INTERFERON GAMMA PATHWAY | Interferon gamma pathway. |
0.0 | 0.1 | PID NFAT 3PATHWAY | Role of Calcineurin-dependent NFAT signaling in lymphocytes |
0.0 | 0.1 | PID FANCONI PATHWAY | Fanconi anemia pathway |
0.0 | 0.1 | SIG CD40PATHWAYMAP | Genes related to CD40 signaling |
0.0 | 0.2 | PID ECADHERIN STABILIZATION PATHWAY | Stabilization and expansion of the E-cadherin adherens junction |
0.0 | 0.2 | PID BARD1 PATHWAY | BARD1 signaling events |
0.0 | 0.1 | PID GLYPICAN 1PATHWAY | Glypican 1 network |
0.0 | 1.3 | NABA ECM AFFILIATED | Genes encoding proteins affiliated structurally or functionally to extracellular matrix proteins |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.3 | 2.8 | REACTOME IL 6 SIGNALING | Genes involved in Interleukin-6 signaling |
0.2 | 1.7 | REACTOME TANDEM PORE DOMAIN POTASSIUM CHANNELS | Genes involved in Tandem pore domain potassium channels |
0.1 | 1.7 | REACTOME REGULATION OF PYRUVATE DEHYDROGENASE PDH COMPLEX | Genes involved in Regulation of pyruvate dehydrogenase (PDH) complex |
0.1 | 1.8 | REACTOME CELL EXTRACELLULAR MATRIX INTERACTIONS | Genes involved in Cell-extracellular matrix interactions |
0.1 | 1.8 | REACTOME RAP1 SIGNALLING | Genes involved in Rap1 signalling |
0.1 | 0.4 | REACTOME MRNA PROCESSING | Genes involved in mRNA Processing |
0.1 | 0.4 | REACTOME RNA POL I PROMOTER OPENING | Genes involved in RNA Polymerase I Promoter Opening |
0.1 | 3.0 | REACTOME INTRINSIC PATHWAY FOR APOPTOSIS | Genes involved in Intrinsic Pathway for Apoptosis |
0.1 | 1.3 | REACTOME RESOLUTION OF AP SITES VIA THE SINGLE NUCLEOTIDE REPLACEMENT PATHWAY | Genes involved in Resolution of AP sites via the single-nucleotide replacement pathway |
0.1 | 0.6 | REACTOME REGULATION OF ORNITHINE DECARBOXYLASE ODC | Genes involved in Regulation of ornithine decarboxylase (ODC) |
0.1 | 0.7 | REACTOME ABACAVIR TRANSPORT AND METABOLISM | Genes involved in Abacavir transport and metabolism |
0.1 | 1.3 | REACTOME GLYCOGEN BREAKDOWN GLYCOGENOLYSIS | Genes involved in Glycogen breakdown (glycogenolysis) |
0.1 | 2.3 | REACTOME MEIOTIC RECOMBINATION | Genes involved in Meiotic Recombination |
0.1 | 0.9 | REACTOME P2Y RECEPTORS | Genes involved in P2Y receptors |
0.1 | 0.7 | REACTOME APOPTOTIC CLEAVAGE OF CELL ADHESION PROTEINS | Genes involved in Apoptotic cleavage of cell adhesion proteins |
0.1 | 0.1 | REACTOME DESTABILIZATION OF MRNA BY TRISTETRAPROLIN TTP | Genes involved in Destabilization of mRNA by Tristetraprolin (TTP) |
0.1 | 2.1 | REACTOME BMAL1 CLOCK NPAS2 ACTIVATES CIRCADIAN EXPRESSION | Genes involved in BMAL1:CLOCK/NPAS2 Activates Circadian Expression |
0.1 | 0.1 | REACTOME NEP NS2 INTERACTS WITH THE CELLULAR EXPORT MACHINERY | Genes involved in NEP/NS2 Interacts with the Cellular Export Machinery |
0.1 | 1.2 | REACTOME SMOOTH MUSCLE CONTRACTION | Genes involved in Smooth Muscle Contraction |
0.1 | 1.0 | REACTOME SYNTHESIS OF GLYCOSYLPHOSPHATIDYLINOSITOL GPI | Genes involved in Synthesis of glycosylphosphatidylinositol (GPI) |
0.1 | 0.6 | REACTOME DCC MEDIATED ATTRACTIVE SIGNALING | Genes involved in DCC mediated attractive signaling |
0.1 | 0.7 | REACTOME GLUCOSE TRANSPORT | Genes involved in Glucose transport |
0.1 | 0.1 | REACTOME ASSEMBLY OF THE PRE REPLICATIVE COMPLEX | Genes involved in Assembly of the pre-replicative complex |
0.1 | 0.7 | REACTOME REGULATION OF HYPOXIA INDUCIBLE FACTOR HIF BY OXYGEN | Genes involved in Regulation of Hypoxia-inducible Factor (HIF) by Oxygen |
0.1 | 0.5 | REACTOME PASSIVE TRANSPORT BY AQUAPORINS | Genes involved in Passive Transport by Aquaporins |
0.1 | 0.5 | REACTOME NOREPINEPHRINE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Norepinephrine Neurotransmitter Release Cycle |
0.0 | 0.5 | REACTOME BILE SALT AND ORGANIC ANION SLC TRANSPORTERS | Genes involved in Bile salt and organic anion SLC transporters |
0.0 | 0.0 | REACTOME DESTABILIZATION OF MRNA BY BRF1 | Genes involved in Destabilization of mRNA by Butyrate Response Factor 1 (BRF1) |
0.0 | 1.9 | REACTOME ACTIVATION OF CHAPERONE GENES BY XBP1S | Genes involved in Activation of Chaperone Genes by XBP1(S) |
0.0 | 1.0 | REACTOME EFFECTS OF PIP2 HYDROLYSIS | Genes involved in Effects of PIP2 hydrolysis |
0.0 | 0.2 | REACTOME DESTABILIZATION OF MRNA BY AUF1 HNRNP D0 | Genes involved in Destabilization of mRNA by AUF1 (hnRNP D0) |
0.0 | 1.1 | REACTOME MYOGENESIS | Genes involved in Myogenesis |
0.0 | 1.6 | REACTOME NOTCH1 INTRACELLULAR DOMAIN REGULATES TRANSCRIPTION | Genes involved in NOTCH1 Intracellular Domain Regulates Transcription |
0.0 | 0.3 | REACTOME TRAF6 MEDIATED INDUCTION OF TAK1 COMPLEX | Genes involved in TRAF6 mediated induction of TAK1 complex |
0.0 | 1.3 | REACTOME HS GAG BIOSYNTHESIS | Genes involved in HS-GAG biosynthesis |
0.0 | 1.1 | REACTOME DEGRADATION OF THE EXTRACELLULAR MATRIX | Genes involved in Degradation of the extracellular matrix |
0.0 | 0.6 | REACTOME INSULIN SYNTHESIS AND PROCESSING | Genes involved in Insulin Synthesis and Processing |
0.0 | 0.5 | REACTOME RETROGRADE NEUROTROPHIN SIGNALLING | Genes involved in Retrograde neurotrophin signalling |
0.0 | 0.0 | REACTOME GLUTAMATE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Glutamate Neurotransmitter Release Cycle |
0.0 | 0.1 | REACTOME REGULATION OF THE FANCONI ANEMIA PATHWAY | Genes involved in Regulation of the Fanconi anemia pathway |
0.0 | 0.9 | REACTOME BIOSYNTHESIS OF THE N GLYCAN PRECURSOR DOLICHOL LIPID LINKED OLIGOSACCHARIDE LLO AND TRANSFER TO A NASCENT PROTEIN | Genes involved in Biosynthesis of the N-glycan precursor (dolichol lipid-linked oligosaccharide, LLO) and transfer to a nascent protein |
0.0 | 0.5 | REACTOME PRE NOTCH PROCESSING IN GOLGI | Genes involved in Pre-NOTCH Processing in Golgi |
0.0 | 0.3 | REACTOME THE NLRP3 INFLAMMASOME | Genes involved in The NLRP3 inflammasome |
0.0 | 0.1 | REACTOME APC C CDC20 MEDIATED DEGRADATION OF CYCLIN B | Genes involved in APC/C:Cdc20 mediated degradation of Cyclin B |
0.0 | 0.3 | REACTOME YAP1 AND WWTR1 TAZ STIMULATED GENE EXPRESSION | Genes involved in YAP1- and WWTR1 (TAZ)-stimulated gene expression |
0.0 | 0.4 | REACTOME MTORC1 MEDIATED SIGNALLING | Genes involved in mTORC1-mediated signalling |
0.0 | 0.1 | REACTOME REGULATION OF SIGNALING BY CBL | Genes involved in Regulation of signaling by CBL |
0.0 | 0.3 | REACTOME CIRCADIAN CLOCK | Genes involved in Circadian Clock |
0.0 | 1.6 | REACTOME ANTIVIRAL MECHANISM BY IFN STIMULATED GENES | Genes involved in Antiviral mechanism by IFN-stimulated genes |
0.0 | 0.5 | REACTOME AMYLOIDS | Genes involved in Amyloids |
0.0 | 0.6 | REACTOME PTM GAMMA CARBOXYLATION HYPUSINE FORMATION AND ARYLSULFATASE ACTIVATION | Genes involved in PTM: gamma carboxylation, hypusine formation and arylsulfatase activation |
0.0 | 0.1 | REACTOME NUCLEOTIDE LIKE PURINERGIC RECEPTORS | Genes involved in Nucleotide-like (purinergic) receptors |
0.0 | 0.4 | REACTOME REGULATION OF IFNA SIGNALING | Genes involved in Regulation of IFNA signaling |
0.0 | 0.9 | REACTOME IL1 SIGNALING | Genes involved in Interleukin-1 signaling |
0.0 | 0.6 | REACTOME SIGNALING BY BMP | Genes involved in Signaling by BMP |
0.0 | 0.2 | REACTOME TETRAHYDROBIOPTERIN BH4 SYNTHESIS RECYCLING SALVAGE AND REGULATION | Genes involved in Tetrahydrobiopterin (BH4) synthesis, recycling, salvage and regulation |
0.0 | 0.3 | REACTOME ALPHA LINOLENIC ACID ALA METABOLISM | Genes involved in alpha-linolenic acid (ALA) metabolism |
0.0 | 0.8 | REACTOME MRNA SPLICING MINOR PATHWAY | Genes involved in mRNA Splicing - Minor Pathway |
0.0 | 5.1 | REACTOME ANTIGEN PROCESSING UBIQUITINATION PROTEASOME DEGRADATION | Genes involved in Antigen processing: Ubiquitination & Proteasome degradation |
0.0 | 0.3 | REACTOME FORMATION OF ATP BY CHEMIOSMOTIC COUPLING | Genes involved in Formation of ATP by chemiosmotic coupling |
0.0 | 0.6 | REACTOME ELONGATION ARREST AND RECOVERY | Genes involved in Elongation arrest and recovery |
0.0 | 0.3 | REACTOME METABOLISM OF NON CODING RNA | Genes involved in Metabolism of non-coding RNA |
0.0 | 0.1 | REACTOME PECAM1 INTERACTIONS | Genes involved in PECAM1 interactions |
0.0 | 0.2 | REACTOME COMMON PATHWAY | Genes involved in Common Pathway |
0.0 | 0.2 | REACTOME LATENT INFECTION OF HOMO SAPIENS WITH MYCOBACTERIUM TUBERCULOSIS | Genes involved in Latent infection of Homo sapiens with Mycobacterium tuberculosis |
0.0 | 0.6 | REACTOME SEMA4D IN SEMAPHORIN SIGNALING | Genes involved in Sema4D in semaphorin signaling |
0.0 | 0.3 | REACTOME TIE2 SIGNALING | Genes involved in Tie2 Signaling |
0.0 | 0.1 | REACTOME PLATELET ADHESION TO EXPOSED COLLAGEN | Genes involved in Platelet Adhesion to exposed collagen |
0.0 | 0.1 | REACTOME ETHANOL OXIDATION | Genes involved in Ethanol oxidation |
0.0 | 0.4 | REACTOME ACYL CHAIN REMODELLING OF PE | Genes involved in Acyl chain remodelling of PE |
0.0 | 0.3 | REACTOME NEPHRIN INTERACTIONS | Genes involved in Nephrin interactions |
0.0 | 0.4 | REACTOME DARPP 32 EVENTS | Genes involved in DARPP-32 events |
0.0 | 0.1 | REACTOME THE ROLE OF NEF IN HIV1 REPLICATION AND DISEASE PATHOGENESIS | Genes involved in The role of Nef in HIV-1 replication and disease pathogenesis |
0.0 | 1.5 | REACTOME PPARA ACTIVATES GENE EXPRESSION | Genes involved in PPARA Activates Gene Expression |
0.0 | 0.3 | REACTOME METABOLISM OF POLYAMINES | Genes involved in Metabolism of polyamines |
0.0 | 0.2 | REACTOME ACTIVATION OF NF KAPPAB IN B CELLS | Genes involved in Activation of NF-kappaB in B Cells |
0.0 | 0.2 | REACTOME REGULATION OF INSULIN SECRETION BY GLUCAGON LIKE PEPTIDE1 | Genes involved in Regulation of Insulin Secretion by Glucagon-like Peptide-1 |
0.0 | 0.2 | REACTOME FANCONI ANEMIA PATHWAY | Genes involved in Fanconi Anemia pathway |
0.0 | 0.1 | REACTOME ENOS ACTIVATION AND REGULATION | Genes involved in eNOS activation and regulation |
0.0 | 0.1 | REACTOME RECEPTOR LIGAND BINDING INITIATES THE SECOND PROTEOLYTIC CLEAVAGE OF NOTCH RECEPTOR | Genes involved in Receptor-ligand binding initiates the second proteolytic cleavage of Notch receptor |
0.0 | 0.3 | REACTOME SYNTHESIS OF PIPS AT THE PLASMA MEMBRANE | Genes involved in Synthesis of PIPs at the plasma membrane |
0.0 | 0.1 | REACTOME TRAFFICKING AND PROCESSING OF ENDOSOMAL TLR | Genes involved in Trafficking and processing of endosomal TLR |
0.0 | 0.3 | REACTOME CHONDROITIN SULFATE BIOSYNTHESIS | Genes involved in Chondroitin sulfate biosynthesis |
0.0 | 0.1 | REACTOME RESOLUTION OF AP SITES VIA THE MULTIPLE NUCLEOTIDE PATCH REPLACEMENT PATHWAY | Genes involved in Resolution of AP sites via the multiple-nucleotide patch replacement pathway |
0.0 | 0.9 | REACTOME GLYCEROPHOSPHOLIPID BIOSYNTHESIS | Genes involved in Glycerophospholipid biosynthesis |
0.0 | 0.2 | REACTOME SYNTHESIS OF PIPS AT THE EARLY ENDOSOME MEMBRANE | Genes involved in Synthesis of PIPs at the early endosome membrane |
0.0 | 0.5 | REACTOME IRON UPTAKE AND TRANSPORT | Genes involved in Iron uptake and transport |
0.0 | 0.1 | REACTOME HYALURONAN UPTAKE AND DEGRADATION | Genes involved in Hyaluronan uptake and degradation |
0.0 | 0.1 | REACTOME REGULATION OF KIT SIGNALING | Genes involved in Regulation of KIT signaling |
0.0 | 0.1 | REACTOME PROTEOLYTIC CLEAVAGE OF SNARE COMPLEX PROTEINS | Genes involved in Proteolytic cleavage of SNARE complex proteins |
0.0 | 0.3 | REACTOME ENDOSOMAL SORTING COMPLEX REQUIRED FOR TRANSPORT ESCRT | Genes involved in Endosomal Sorting Complex Required For Transport (ESCRT) |
0.0 | 0.0 | REACTOME APC CDC20 MEDIATED DEGRADATION OF NEK2A | Genes involved in APC-Cdc20 mediated degradation of Nek2A |
0.0 | 0.2 | REACTOME PYRIMIDINE CATABOLISM | Genes involved in Pyrimidine catabolism |
0.0 | 0.1 | REACTOME SIGNALING BY WNT | Genes involved in Signaling by Wnt |
0.0 | 0.2 | REACTOME FORMATION OF FIBRIN CLOT CLOTTING CASCADE | Genes involved in Formation of Fibrin Clot (Clotting Cascade) |
0.0 | 0.1 | REACTOME FORMATION OF INCISION COMPLEX IN GG NER | Genes involved in Formation of incision complex in GG-NER |
0.0 | 0.1 | REACTOME EXTRINSIC PATHWAY FOR APOPTOSIS | Genes involved in Extrinsic Pathway for Apoptosis |
0.0 | 0.0 | REACTOME INHIBITION OF REPLICATION INITIATION OF DAMAGED DNA BY RB1 E2F1 | Genes involved in Inhibition of replication initiation of damaged DNA by RB1/E2F1 |
0.0 | 0.2 | REACTOME CITRIC ACID CYCLE TCA CYCLE | Genes involved in Citric acid cycle (TCA cycle) |
0.0 | 0.0 | REACTOME PHOSPHORYLATION OF CD3 AND TCR ZETA CHAINS | Genes involved in Phosphorylation of CD3 and TCR zeta chains |
0.0 | 0.3 | REACTOME NUCLEAR SIGNALING BY ERBB4 | Genes involved in Nuclear signaling by ERBB4 |
0.0 | 0.1 | REACTOME CHYLOMICRON MEDIATED LIPID TRANSPORT | Genes involved in Chylomicron-mediated lipid transport |
0.0 | 0.1 | REACTOME PLATELET SENSITIZATION BY LDL | Genes involved in Platelet sensitization by LDL |
0.0 | 0.1 | REACTOME HEMOSTASIS | Genes involved in Hemostasis |
0.0 | 0.1 | REACTOME THROMBOXANE SIGNALLING THROUGH TP RECEPTOR | Genes involved in Thromboxane signalling through TP receptor |
0.0 | 0.1 | REACTOME CASPASE MEDIATED CLEAVAGE OF CYTOSKELETAL PROTEINS | Genes involved in Caspase-mediated cleavage of cytoskeletal proteins |
0.0 | 0.1 | REACTOME CRMPS IN SEMA3A SIGNALING | Genes involved in CRMPs in Sema3A signaling |
0.0 | 0.0 | REACTOME MRNA DECAY BY 3 TO 5 EXORIBONUCLEASE | Genes involved in mRNA Decay by 3' to 5' Exoribonuclease |