Gene Symbol | Gene ID | Gene Info |
---|---|---|
Bptf
|
ENSMUSG00000040481.10 | Bptf |
CRE | Gene | Distance | Association probability | Pearson corr. coef. | P-value | Plot |
---|---|---|---|---|---|---|
Bptf | chr11_107131631_107132030 | 92 | 0.961623 | 0.77 | 5.3e-12 | Click! |
Bptf | chr11_107132118_107132455 | 159 | 0.942023 | 0.77 | 6.1e-12 | Click! |
Bptf | chr11_107044409_107044584 | 790 | 0.571719 | 0.68 | 8.8e-09 | Click! |
Bptf | chr11_107113224_107113410 | 18605 | 0.145602 | 0.68 | 1.4e-08 | Click! |
Bptf | chr11_107131243_107131610 | 496 | 0.753088 | 0.66 | 3.1e-08 | Click! |
Move your cursor over a bar to see sample name and corresponding Z-value.
Cis Regulatory Element (CRE) | Target Score | Top associated gene | Gene Info | Distance of CRE to TSS | CRE/Gene association probability |
---|---|---|---|---|---|
chr11_115805461_115805717 | 8.61 |
Caskin2 |
CASK-interacting protein 2 |
2513 |
0.15 |
chr10_127508848_127510720 | 6.92 |
Stac3 |
SH3 and cysteine rich domain 3 |
2559 |
0.15 |
chr5_142920434_142920596 | 6.73 |
Actb |
actin, beta |
13761 |
0.14 |
chr4_141161724_141161914 | 6.32 |
Fbxo42 |
F-box protein 42 |
13897 |
0.11 |
chr14_75138884_75139052 | 6.22 |
Gm15628 |
predicted gene 15628 |
2056 |
0.24 |
chr3_98045074_98045277 | 5.83 |
Gm42819 |
predicted gene 42819 |
14488 |
0.18 |
chr9_66182054_66182393 | 5.50 |
Dapk2 |
death-associated protein kinase 2 |
23988 |
0.17 |
chr6_116350044_116350568 | 5.25 |
Marchf8 |
membrane associated ring-CH-type finger 8 |
79 |
0.95 |
chr6_146611446_146611715 | 5.24 |
Tm7sf3 |
transmembrane 7 superfamily member 3 |
22918 |
0.11 |
chrX_51204673_51205680 | 5.23 |
Mbnl3 |
muscleblind like splicing factor 3 |
656 |
0.65 |
chr13_101692140_101693278 | 5.12 |
Pik3r1 |
phosphoinositide-3-kinase regulatory subunit 1 |
79 |
0.98 |
chr1_134460444_134460597 | 5.04 |
Klhl12 |
kelch-like 12 |
4965 |
0.12 |
chr6_123293239_123293390 | 5.01 |
Clec4e |
C-type lectin domain family 4, member e |
3444 |
0.18 |
chr6_136858196_136858347 | 5.01 |
Art4 |
ADP-ribosyltransferase 4 |
538 |
0.6 |
chr5_23850355_23851323 | 4.95 |
2700038G22Rik |
RIKEN cDNA 2700038G22 gene |
238 |
0.81 |
chr11_69605027_69606271 | 4.90 |
Atp1b2 |
ATPase, Na+/K+ transporting, beta 2 polypeptide |
180 |
0.83 |
chr9_71165769_71165959 | 4.84 |
Aqp9 |
aquaporin 9 |
642 |
0.67 |
chr8_85379330_85379502 | 4.82 |
Mylk3 |
myosin light chain kinase 3 |
1562 |
0.3 |
chr4_80003865_80004026 | 4.76 |
Gm11408 |
predicted gene 11408 |
31 |
0.5 |
chr9_48723467_48723688 | 4.72 |
Zbtb16 |
zinc finger and BTB domain containing 16 |
112368 |
0.06 |
chr3_9581040_9581227 | 4.70 |
Zfp704 |
zinc finger protein 704 |
15834 |
0.23 |
chr4_41331115_41331433 | 4.70 |
Gm26084 |
predicted gene, 26084 |
14677 |
0.1 |
chr3_115793348_115794044 | 4.70 |
Gm9889 |
predicted gene 9889 |
78546 |
0.07 |
chr19_32237159_32237315 | 4.69 |
Sgms1 |
sphingomyelin synthase 1 |
1575 |
0.45 |
chr14_47533459_47534172 | 4.69 |
Fbxo34 |
F-box protein 34 |
7736 |
0.12 |
chr11_32265240_32265445 | 4.57 |
Nprl3 |
nitrogen permease regulator-like 3 |
2205 |
0.17 |
chr11_48855844_48857180 | 4.53 |
Gm16170 |
predicted gene 16170 |
3019 |
0.13 |
chr11_57960034_57960300 | 4.47 |
Gm12245 |
predicted gene 12245 |
11082 |
0.15 |
chr1_133119922_133120368 | 4.45 |
Ppp1r15b |
protein phosphatase 1, regulatory subunit 15B |
10998 |
0.14 |
chr12_103737920_103738559 | 4.44 |
Serpina1b |
serine (or cysteine) preptidase inhibitor, clade A, member 1B |
81 |
0.95 |
chr4_119036970_119037397 | 4.41 |
Gm12866 |
predicted gene 12866 |
31928 |
0.08 |
chr7_103871119_103871278 | 4.40 |
Olfr66 |
olfactory receptor 66 |
11043 |
0.06 |
chr1_23163479_23163639 | 4.40 |
Ppp1r14bl |
protein phosphatase 1, regulatory inhibitor subunit 14B like |
61306 |
0.1 |
chr4_137651076_137651230 | 4.35 |
Usp48 |
ubiquitin specific peptidase 48 |
852 |
0.58 |
chr5_139382230_139382534 | 4.32 |
Gpr146 |
G protein-coupled receptor 146 |
1801 |
0.22 |
chr1_189756746_189757047 | 4.30 |
Ptpn14 |
protein tyrosine phosphatase, non-receptor type 14 |
28621 |
0.16 |
chr4_120674662_120674851 | 4.20 |
Cited4 |
Cbp/p300-interacting transactivator, with Glu/Asp-rich carboxy-terminal domain, 4 |
8184 |
0.15 |
chr6_142757611_142757918 | 4.20 |
Cmas |
cytidine monophospho-N-acetylneuraminic acid synthetase |
989 |
0.56 |
chr18_50030754_50031163 | 4.18 |
Tnfaip8 |
tumor necrosis factor, alpha-induced protein 8 |
60 |
0.98 |
chr3_103171228_103172264 | 4.16 |
Bcas2 |
breast carcinoma amplified sequence 2 |
3 |
0.97 |
chr12_111443494_111443821 | 4.16 |
Tnfaip2 |
tumor necrosis factor, alpha-induced protein 2 |
667 |
0.58 |
chr6_113696610_113696876 | 4.15 |
Tatdn2 |
TatD DNase domain containing 2 |
307 |
0.74 |
chr11_49088403_49088584 | 4.13 |
Gm12188 |
predicted gene 12188 |
50 |
0.71 |
chr11_120980765_120980945 | 4.12 |
Csnk1d |
casein kinase 1, delta |
9230 |
0.1 |
chr5_134919074_134919381 | 4.11 |
4933439J24Rik |
RIKEN cDNA 4933439J24 gene |
561 |
0.47 |
chr13_63567343_63568686 | 4.09 |
A930032L01Rik |
RIKEN cDNA A930032L01 gene |
40 |
0.96 |
chr2_119566179_119566455 | 4.09 |
Chp1 |
calcineurin-like EF hand protein 1 |
288 |
0.85 |
chr17_48447816_48447985 | 4.08 |
Tspo2 |
translocator protein 2 |
2170 |
0.2 |
chr4_45402888_45403200 | 4.08 |
Slc25a51 |
solute carrier family 25, member 51 |
1822 |
0.27 |
chr13_59766977_59767492 | 4.08 |
Isca1 |
iron-sulfur cluster assembly 1 |
2243 |
0.13 |
chr3_94926503_94926673 | 4.04 |
Gm26279 |
predicted gene, 26279 |
6165 |
0.1 |
chr9_112996220_112996412 | 4.02 |
Gm36251 |
predicted gene, 36251 |
126713 |
0.06 |
chr7_68129597_68129887 | 3.98 |
Igf1r |
insulin-like growth factor I receptor |
18848 |
0.23 |
chr9_107974575_107974737 | 3.96 |
Uba7 |
ubiquitin-like modifier activating enzyme 7 |
849 |
0.29 |
chr4_139179928_139180623 | 3.95 |
Gm16287 |
predicted gene 16287 |
380 |
0.82 |
chr6_125573659_125573981 | 3.95 |
Vwf |
Von Willebrand factor |
7569 |
0.21 |
chr12_103863072_103863984 | 3.94 |
Serpina1a |
serine (or cysteine) peptidase inhibitor, clade A, member 1A |
23 |
0.95 |
chr13_112745515_112745688 | 3.94 |
Slc38a9 |
solute carrier family 38, member 9 |
9991 |
0.15 |
chr11_30166306_30166594 | 3.91 |
Sptbn1 |
spectrin beta, non-erythrocytic 1 |
31807 |
0.19 |
chr12_26472861_26473143 | 3.91 |
Cmpk2 |
cytidine monophosphate (UMP-CMP) kinase 2, mitochondrial |
928 |
0.5 |
chr9_64793074_64793409 | 3.91 |
Dennd4a |
DENN/MADD domain containing 4A |
18099 |
0.18 |
chr7_138902128_138902279 | 3.90 |
Gm18258 |
predicted gene, 18258 |
2815 |
0.15 |
chr11_115899580_115900578 | 3.90 |
Smim5 |
small integral membrane protein 5 |
99 |
0.93 |
chr8_105821377_105821718 | 3.86 |
Ranbp10 |
RAN binding protein 10 |
5658 |
0.1 |
chr17_36869302_36869591 | 3.82 |
Trim10 |
tripartite motif-containing 10 |
128 |
0.9 |
chr7_103826228_103826489 | 3.77 |
Hbb-bs |
hemoglobin, beta adult s chain |
1367 |
0.17 |
chr10_117106272_117106596 | 3.72 |
Frs2 |
fibroblast growth factor receptor substrate 2 |
24412 |
0.12 |
chr1_166002288_166003185 | 3.70 |
Pou2f1 |
POU domain, class 2, transcription factor 1 |
58 |
0.72 |
chr6_149193406_149193557 | 3.69 |
Amn1 |
antagonist of mitotic exit network 1 |
4769 |
0.17 |
chr7_126676246_126676573 | 3.68 |
Sult1a1 |
sulfotransferase family 1A, phenol-preferring, member 1 |
23 |
0.93 |
chr6_55359082_55359253 | 3.67 |
Ghrhr |
growth hormone releasing hormone receptor |
17128 |
0.14 |
chr4_119077561_119077722 | 3.64 |
Gm12866 |
predicted gene 12866 |
8530 |
0.11 |
chr19_41829631_41829806 | 3.64 |
Frat1 |
frequently rearranged in advanced T cell lymphomas |
252 |
0.9 |
chr5_73311488_73311911 | 3.64 |
Gm42732 |
predicted gene 42732 |
335 |
0.78 |
chr9_98299297_98299586 | 3.64 |
Gm28530 |
predicted gene 28530 |
2209 |
0.3 |
chr15_89215773_89216393 | 3.62 |
Ppp6r2 |
protein phosphatase 6, regulatory subunit 2 |
4482 |
0.12 |
chr9_62341481_62341954 | 3.62 |
Anp32a |
acidic (leucine-rich) nuclear phosphoprotein 32 family, member A |
185 |
0.95 |
chr1_131125857_131126184 | 3.61 |
Dyrk3 |
dual-specificity tyrosine-(Y)-phosphorylation regulated kinase 3 |
12225 |
0.13 |
chr8_126589589_126589740 | 3.61 |
Irf2bp2 |
interferon regulatory factor 2 binding protein 2 |
4322 |
0.26 |
chr4_43038488_43038791 | 3.61 |
Fam214b |
family with sequence similarity 214, member B |
692 |
0.51 |
chr8_117197998_117198390 | 3.59 |
Gan |
giant axonal neuropathy |
40057 |
0.14 |
chr11_4031679_4031852 | 3.58 |
Sec14l4 |
SEC14-like lipid binding 4 |
18 |
0.96 |
chr12_3619122_3619284 | 3.57 |
Dtnb |
dystrobrevin, beta |
13719 |
0.22 |
chr11_117782445_117782614 | 3.56 |
Tmc8 |
transmembrane channel-like gene family 8 |
129 |
0.72 |
chr1_170292570_170292993 | 3.56 |
Gm7694 |
predicted gene 7694 |
13551 |
0.12 |
chr1_75136821_75137108 | 3.53 |
Cnppd1 |
cyclin Pas1/PHO80 domain containing 1 |
842 |
0.37 |
chr14_70515756_70516019 | 3.51 |
Bmp1 |
bone morphogenetic protein 1 |
4262 |
0.12 |
chr7_6860549_6860988 | 3.51 |
Gm44586 |
predicted gene 44586 |
30270 |
0.1 |
chr5_64753725_64753876 | 3.50 |
Gm20033 |
predicted gene, 20033 |
32043 |
0.12 |
chr15_100411395_100411719 | 3.50 |
Slc11a2 |
solute carrier family 11 (proton-coupled divalent metal ion transporters), member 2 |
8135 |
0.11 |
chr18_5603185_5603788 | 3.50 |
Zeb1 |
zinc finger E-box binding homeobox 1 |
258 |
0.88 |
chr4_105309056_105309241 | 3.49 |
Gm12722 |
predicted gene 12722 |
65798 |
0.13 |
chr11_70221528_70222219 | 3.49 |
Slc16a13 |
solute carrier family 16 (monocarboxylic acid transporters), member 13 |
809 |
0.35 |
chr3_96488882_96489252 | 3.44 |
Gm22614 |
predicted gene, 22614 |
338 |
0.67 |
chr14_73179429_73179594 | 3.44 |
Rcbtb2 |
regulator of chromosome condensation (RCC1) and BTB (POZ) domain containing protein 2 |
5060 |
0.17 |
chr10_20046153_20046446 | 3.41 |
Map3k5 |
mitogen-activated protein kinase kinase kinase 5 |
53226 |
0.13 |
chr19_41482494_41483686 | 3.35 |
Lcor |
ligand dependent nuclear receptor corepressor |
61 |
0.98 |
chr11_69097394_69097796 | 3.35 |
Per1 |
period circadian clock 1 |
1353 |
0.2 |
chr3_89871354_89871796 | 3.34 |
She |
src homology 2 domain-containing transforming protein E |
33686 |
0.09 |
chr15_8444807_8445586 | 3.31 |
Nipbl |
NIPBL cohesin loading factor |
733 |
0.65 |
chr1_131613467_131613641 | 3.28 |
Avpr1b |
arginine vasopressin receptor 1B |
13831 |
0.14 |
chr3_97844853_97845110 | 3.28 |
Pde4dip |
phosphodiesterase 4D interacting protein (myomegalin) |
20360 |
0.17 |
chr9_20804366_20804599 | 3.27 |
Col5a3 |
collagen, type V, alpha 3 |
10585 |
0.11 |
chr2_121955584_121956519 | 3.27 |
Mageb3 |
melanoma antigen, family B, 3 |
41 |
0.5 |
chr4_132078007_132078158 | 3.26 |
Epb41 |
erythrocyte membrane protein band 4.1 |
2761 |
0.15 |
chr4_117474036_117474212 | 3.25 |
Rnf220 |
ring finger protein 220 |
20887 |
0.13 |
chr7_16815354_16816404 | 3.24 |
Strn4 |
striatin, calmodulin binding protein 4 |
10 |
0.69 |
chr15_32964823_32965125 | 3.24 |
Sdc2 |
syndecan 2 |
44251 |
0.18 |
chr17_46857818_46858430 | 3.24 |
Bicral |
BRD4 interacting chromatin remodeling complex associated protein like |
358 |
0.84 |
chr9_65196833_65197269 | 3.23 |
Gm25313 |
predicted gene, 25313 |
364 |
0.76 |
chr16_32660493_32661316 | 3.22 |
Tnk2 |
tyrosine kinase, non-receptor, 2 |
330 |
0.85 |
chr7_142622245_142622528 | 3.22 |
Gm33148 |
predicted gene, 33148 |
30642 |
0.08 |
chr13_43231981_43232458 | 3.22 |
Tbc1d7 |
TBC1 domain family, member 7 |
60718 |
0.11 |
chr12_80113547_80113987 | 3.21 |
Zfp36l1 |
zinc finger protein 36, C3H type-like 1 |
754 |
0.51 |
chrX_142680720_142682167 | 3.20 |
Tmem164 |
transmembrane protein 164 |
25 |
0.98 |
chr5_116026177_116026354 | 3.20 |
Prkab1 |
protein kinase, AMP-activated, beta 1 non-catalytic subunit |
1757 |
0.24 |
chr9_61368343_61369239 | 3.19 |
Gm10655 |
predicted gene 10655 |
2836 |
0.25 |
chr19_60872283_60872608 | 3.17 |
Prdx3 |
peroxiredoxin 3 |
2111 |
0.23 |
chr3_84036959_84037218 | 3.17 |
Tmem131l |
transmembrane 131 like |
3040 |
0.3 |
chr6_82821825_82822006 | 3.17 |
Gm32591 |
predicted gene, 32591 |
1299 |
0.34 |
chr18_6516413_6517044 | 3.16 |
Epc1 |
enhancer of polycomb homolog 1 |
620 |
0.7 |
chr6_86497590_86497948 | 3.16 |
Gm28719 |
predicted gene 28719 |
1012 |
0.29 |
chr17_71235938_71236335 | 3.16 |
Lpin2 |
lipin 2 |
2526 |
0.24 |
chr8_84704492_84705305 | 3.15 |
Nfix |
nuclear factor I/X |
2818 |
0.13 |
chr2_167628701_167629206 | 3.15 |
Ube2v1 |
ubiquitin-conjugating enzyme E2 variant 1 |
3014 |
0.15 |
chr6_115700910_115701135 | 3.15 |
Gm24008 |
predicted gene, 24008 |
22810 |
0.1 |
chr7_119280318_119280619 | 3.14 |
Gm4083 |
predicted gene 4083 |
21239 |
0.18 |
chr1_59174641_59174801 | 3.14 |
Mpp4 |
membrane protein, palmitoylated 4 (MAGUK p55 subfamily member 4) |
11332 |
0.13 |
chr5_88767790_88768091 | 3.13 |
Dck |
deoxycytidine kinase |
1419 |
0.35 |
chr18_62165959_62166113 | 3.13 |
Adrb2 |
adrenergic receptor, beta 2 |
13923 |
0.18 |
chr1_80408527_80409167 | 3.12 |
Gm6189 |
predicted gene 6189 |
23662 |
0.13 |
chr8_94183221_94183742 | 3.12 |
Gm39228 |
predicted gene, 39228 |
192 |
0.89 |
chr14_69536637_69537045 | 3.12 |
Gm27174 |
predicted gene 27174 |
18491 |
0.09 |
chr13_99100048_99100764 | 3.11 |
Gm807 |
predicted gene 807 |
300 |
0.89 |
chr14_66111628_66111781 | 3.11 |
Ephx2 |
epoxide hydrolase 2, cytoplasmic |
682 |
0.66 |
chr19_5841346_5841905 | 3.10 |
Neat1 |
nuclear paraspeckle assembly transcript 1 (non-protein coding) |
3634 |
0.09 |
chr7_104315172_104315330 | 3.10 |
Trim12a |
tripartite motif-containing 12A |
92 |
0.67 |
chr8_72303493_72303644 | 3.06 |
Gm10282 |
predicted pseudogene 10282 |
1692 |
0.24 |
chr11_108396201_108396352 | 3.06 |
Apoh |
apolipoprotein H |
983 |
0.51 |
chr15_82407139_82407298 | 3.06 |
Cyp2d10 |
cytochrome P450, family 2, subfamily d, polypeptide 10 |
23 |
0.51 |
chr13_22022304_22022635 | 3.06 |
Gm11292 |
predicted gene 11292 |
4230 |
0.06 |
chr10_54042474_54042667 | 3.05 |
Gm47917 |
predicted gene, 47917 |
21241 |
0.18 |
chrX_160426520_160426808 | 3.05 |
Adgrg2 |
adhesion G protein-coupled receptor G2 |
628 |
0.76 |
chr11_12291035_12291789 | 3.05 |
Gm12002 |
predicted gene 12002 |
23102 |
0.24 |
chr1_118389237_118390220 | 3.02 |
Clasp1 |
CLIP associating protein 1 |
211 |
0.93 |
chrX_42149228_42149390 | 3.02 |
Stag2 |
stromal antigen 2 |
8 |
0.95 |
chr15_3247489_3247792 | 3.02 |
Selenop |
selenoprotein P |
20907 |
0.18 |
chr3_38128678_38128843 | 3.02 |
Gm43821 |
predicted gene 43821 |
1431 |
0.43 |
chr2_71874194_71874386 | 3.02 |
Pdk1 |
pyruvate dehydrogenase kinase, isoenzyme 1 |
547 |
0.77 |
chr9_64789410_64789567 | 3.02 |
Dennd4a |
DENN/MADD domain containing 4A |
21852 |
0.17 |
chr12_69759930_69760224 | 3.00 |
Mir681 |
microRNA 681 |
3867 |
0.15 |
chr11_31001375_31001526 | 2.99 |
Gm12102 |
predicted gene 12102 |
2448 |
0.25 |
chr4_12087867_12088383 | 2.99 |
Tmem67 |
transmembrane protein 67 |
118 |
0.93 |
chr6_148517623_148517896 | 2.98 |
Tmtc1 |
transmembrane and tetratricopeptide repeat containing 1 |
73370 |
0.08 |
chr15_57906456_57906624 | 2.98 |
Tbc1d31 |
TBC1 domain family, member 31 |
5659 |
0.21 |
chr7_80719251_80719402 | 2.98 |
Iqgap1 |
IQ motif containing GTPase activating protein 1 |
10922 |
0.16 |
chr9_21955926_21956287 | 2.98 |
Swsap1 |
SWIM type zinc finger 7 associated protein 1 |
351 |
0.73 |
chr7_111179367_111179913 | 2.98 |
1700012D14Rik |
RIKEN cDNA 1700012D14 gene |
56956 |
0.11 |
chr4_43492744_43493113 | 2.98 |
Ccdc107 |
coiled-coil domain containing 107 |
28 |
0.6 |
chr7_131410440_131411022 | 2.98 |
Acadsb |
acyl-Coenzyme A dehydrogenase, short/branched chain |
4 |
0.72 |
chr19_53312357_53312867 | 2.97 |
Mxi1 |
MAX interactor 1, dimerization protein |
454 |
0.77 |
chr8_34097973_34098161 | 2.97 |
Dctn6 |
dynactin 6 |
376 |
0.78 |
chr1_131638611_131638779 | 2.97 |
Ctse |
cathepsin E |
201 |
0.93 |
chr2_104122044_104122383 | 2.96 |
A930018P22Rik |
RIKEN cDNA A930018P22 gene |
556 |
0.68 |
chr9_61370339_61371660 | 2.96 |
Gm10655 |
predicted gene 10655 |
628 |
0.63 |
chr6_67161317_67161500 | 2.95 |
A430010J10Rik |
RIKEN cDNA A430010J10 gene |
3516 |
0.2 |
chr4_95385679_95385958 | 2.94 |
Gm29064 |
predicted gene 29064 |
16972 |
0.23 |
chr5_146703717_146704190 | 2.94 |
4930573C15Rik |
RIKEN cDNA 4930573C15 gene |
2669 |
0.26 |
chr15_98831750_98831931 | 2.93 |
Prkag1 |
protein kinase, AMP-activated, gamma 1 non-catalytic subunit |
319 |
0.76 |
chr12_51842142_51842293 | 2.92 |
Gm19309 |
predicted gene, 19309 |
1596 |
0.38 |
chr17_47535748_47536285 | 2.92 |
Ccnd3 |
cyclin D3 |
30775 |
0.1 |
chr14_31019341_31019698 | 2.92 |
Pbrm1 |
polybromo 1 |
311 |
0.48 |
chr16_23056267_23056418 | 2.91 |
Kng1 |
kininogen 1 |
1523 |
0.18 |
chr17_46994757_46994923 | 2.91 |
Ubr2 |
ubiquitin protein ligase E3 component n-recognin 2 |
15639 |
0.16 |
chr5_51868314_51868494 | 2.90 |
Gm43606 |
predicted gene 43606 |
9629 |
0.17 |
chr3_153852117_153852268 | 2.90 |
Asb17os |
ankyrin repeat and SOCS box-containing 17, opposite strand |
209 |
0.88 |
chr3_100438275_100438426 | 2.90 |
Gm43121 |
predicted gene 43121 |
516 |
0.73 |
chr11_30648868_30649937 | 2.90 |
Acyp2 |
acylphosphatase 2, muscle type |
185 |
0.95 |
chr9_108338578_108339700 | 2.90 |
Gpx1 |
glutathione peroxidase 1 |
85 |
0.89 |
chr12_83520606_83520966 | 2.89 |
Dcaf4 |
DDB1 and CUL4 associated factor 4 |
152 |
0.95 |
chr16_76323171_76323322 | 2.89 |
Nrip1 |
nuclear receptor interacting protein 1 |
412 |
0.88 |
chr14_26670093_26670244 | 2.89 |
9930004E17Rik |
RIKEN cDNA 9930004E17 gene |
158 |
0.6 |
chr7_120861739_120862019 | 2.88 |
Eef2k |
eukaryotic elongation factor-2 kinase |
10690 |
0.13 |
chr12_85280626_85280832 | 2.88 |
Acyp1 |
acylphosphatase 1, erythrocyte (common) type |
294 |
0.82 |
chr6_149310741_149310934 | 2.88 |
Resf1 |
retroelement silencing factor 1 |
579 |
0.7 |
chr1_86479174_86479713 | 2.88 |
Rpl30-ps6 |
ribosomal protein L30, pseudogene 6 |
5784 |
0.15 |
chr7_46829767_46829918 | 2.87 |
Gm45308 |
predicted gene 45308 |
2622 |
0.13 |
chr7_65337688_65337841 | 2.87 |
Tjp1 |
tight junction protein 1 |
5033 |
0.23 |
chr7_104287855_104288006 | 2.87 |
Trim5 |
tripartite motif-containing 5 |
164 |
0.88 |
chr8_126805357_126806196 | 2.85 |
A630001O12Rik |
RIKEN cDNA A630001O12 gene |
33457 |
0.16 |
chr2_126876392_126876625 | 2.84 |
Trpm7 |
transient receptor potential cation channel, subfamily M, member 7 |
278 |
0.89 |
chr15_73180293_73180464 | 2.84 |
Ago2 |
argonaute RISC catalytic subunit 2 |
2531 |
0.29 |
chr11_69096542_69097348 | 2.83 |
Per1 |
period circadian clock 1 |
1728 |
0.15 |
chr10_98504531_98504809 | 2.83 |
Gm37631 |
predicted gene, 37631 |
17797 |
0.23 |
chr1_118480880_118481748 | 2.83 |
Clasp1 |
CLIP associating protein 1 |
725 |
0.54 |
chr5_139793074_139793252 | 2.83 |
Mafk |
v-maf musculoaponeurotic fibrosarcoma oncogene family, protein K (avian) |
1629 |
0.26 |
chr11_44512747_44512998 | 2.82 |
Rnf145 |
ring finger protein 145 |
6092 |
0.18 |
chr7_45053315_45053629 | 2.82 |
Prr12 |
proline rich 12 |
591 |
0.39 |
chr2_52925121_52925400 | 2.81 |
Fmnl2 |
formin-like 2 |
67392 |
0.13 |
chr11_120307657_120307928 | 2.80 |
Bahcc1 |
BAH domain and coiled-coil containing 1 |
17999 |
0.09 |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
2.0 | 10.2 | GO:0071918 | urea transmembrane transport(GO:0071918) |
1.8 | 5.5 | GO:0001543 | ovarian follicle rupture(GO:0001543) |
1.8 | 5.4 | GO:1900169 | regulation of glucocorticoid mediated signaling pathway(GO:1900169) |
1.7 | 5.0 | GO:1903690 | negative regulation of wound healing, spreading of epidermal cells(GO:1903690) |
1.7 | 5.0 | GO:0021699 | cerebellar cortex maturation(GO:0021699) |
1.4 | 4.3 | GO:1903286 | regulation of potassium ion import(GO:1903286) positive regulation of potassium ion import(GO:1903288) |
1.1 | 3.4 | GO:0006982 | response to lipid hydroperoxide(GO:0006982) |
1.1 | 2.3 | GO:0097252 | oligodendrocyte apoptotic process(GO:0097252) |
1.1 | 3.4 | GO:0034197 | acylglycerol transport(GO:0034196) triglyceride transport(GO:0034197) |
1.1 | 4.2 | GO:0038094 | Fc-gamma receptor signaling pathway(GO:0038094) |
1.0 | 2.1 | GO:0034443 | negative regulation of lipoprotein oxidation(GO:0034443) |
1.0 | 4.1 | GO:0010510 | regulation of acetyl-CoA biosynthetic process from pyruvate(GO:0010510) |
1.0 | 3.0 | GO:0032907 | transforming growth factor beta3 production(GO:0032907) regulation of transforming growth factor beta3 production(GO:0032910) |
1.0 | 3.9 | GO:0007023 | post-chaperonin tubulin folding pathway(GO:0007023) |
1.0 | 2.9 | GO:0007525 | somatic muscle development(GO:0007525) |
1.0 | 4.9 | GO:0032876 | negative regulation of DNA endoreduplication(GO:0032876) |
1.0 | 3.8 | GO:1900378 | positive regulation of melanin biosynthetic process(GO:0048023) positive regulation of secondary metabolite biosynthetic process(GO:1900378) |
0.9 | 3.7 | GO:2000504 | positive regulation of blood vessel remodeling(GO:2000504) |
0.9 | 3.7 | GO:0032417 | positive regulation of sodium:proton antiporter activity(GO:0032417) |
0.9 | 4.6 | GO:0033132 | negative regulation of glucokinase activity(GO:0033132) negative regulation of hexokinase activity(GO:1903300) |
0.9 | 2.7 | GO:2000870 | regulation of progesterone secretion(GO:2000870) |
0.9 | 2.7 | GO:0006203 | dGTP catabolic process(GO:0006203) |
0.9 | 2.7 | GO:1904690 | regulation of cap-independent translational initiation(GO:1903677) positive regulation of cap-independent translational initiation(GO:1903679) regulation of cytoplasmic translational initiation(GO:1904688) positive regulation of cytoplasmic translational initiation(GO:1904690) |
0.9 | 2.6 | GO:0072361 | regulation of glycolytic process by regulation of transcription from RNA polymerase II promoter(GO:0072361) |
0.9 | 0.9 | GO:1903689 | regulation of wound healing, spreading of epidermal cells(GO:1903689) |
0.9 | 3.4 | GO:0061113 | pancreas morphogenesis(GO:0061113) |
0.8 | 2.5 | GO:0002086 | diaphragm contraction(GO:0002086) |
0.8 | 2.5 | GO:0040031 | snRNA modification(GO:0040031) |
0.8 | 4.1 | GO:0006686 | sphingomyelin biosynthetic process(GO:0006686) |
0.8 | 2.4 | GO:0061010 | gall bladder development(GO:0061010) |
0.8 | 2.4 | GO:0046271 | phenylpropanoid catabolic process(GO:0046271) |
0.8 | 2.4 | GO:0000087 | mitotic M phase(GO:0000087) |
0.8 | 3.8 | GO:0032237 | activation of store-operated calcium channel activity(GO:0032237) |
0.8 | 0.8 | GO:0046501 | protoporphyrinogen IX metabolic process(GO:0046501) |
0.8 | 2.3 | GO:0032929 | negative regulation of superoxide anion generation(GO:0032929) |
0.8 | 2.3 | GO:1900060 | negative regulation of ceramide biosynthetic process(GO:1900060) |
0.7 | 3.0 | GO:0006362 | transcription elongation from RNA polymerase I promoter(GO:0006362) |
0.7 | 2.2 | GO:1900126 | negative regulation of hyaluronan biosynthetic process(GO:1900126) |
0.7 | 2.2 | GO:0097051 | establishment of protein localization to endoplasmic reticulum membrane(GO:0097051) |
0.7 | 2.2 | GO:1900095 | regulation of dosage compensation by inactivation of X chromosome(GO:1900095) |
0.7 | 3.0 | GO:0046060 | dATP metabolic process(GO:0046060) |
0.7 | 5.9 | GO:0048387 | negative regulation of retinoic acid receptor signaling pathway(GO:0048387) |
0.7 | 2.2 | GO:0002904 | positive regulation of B cell apoptotic process(GO:0002904) |
0.7 | 2.2 | GO:0002314 | germinal center B cell differentiation(GO:0002314) |
0.7 | 3.6 | GO:0090435 | protein localization to nuclear envelope(GO:0090435) |
0.7 | 1.4 | GO:0071930 | negative regulation of transcription involved in G1/S transition of mitotic cell cycle(GO:0071930) |
0.7 | 2.2 | GO:1904217 | regulation of CDP-diacylglycerol-serine O-phosphatidyltransferase activity(GO:1904217) positive regulation of CDP-diacylglycerol-serine O-phosphatidyltransferase activity(GO:1904219) regulation of serine C-palmitoyltransferase activity(GO:1904220) positive regulation of serine C-palmitoyltransferase activity(GO:1904222) |
0.7 | 1.4 | GO:2001245 | regulation of phosphatidylcholine biosynthetic process(GO:2001245) |
0.7 | 3.5 | GO:0003241 | growth involved in heart morphogenesis(GO:0003241) |
0.7 | 2.1 | GO:0010989 | negative regulation of low-density lipoprotein particle clearance(GO:0010989) |
0.7 | 0.7 | GO:0021986 | epithalamus development(GO:0021538) habenula development(GO:0021986) |
0.7 | 2.1 | GO:0006235 | dTTP biosynthetic process(GO:0006235) pyrimidine deoxyribonucleoside triphosphate biosynthetic process(GO:0009212) dTTP metabolic process(GO:0046075) |
0.7 | 3.4 | GO:0010961 | cellular magnesium ion homeostasis(GO:0010961) |
0.7 | 2.7 | GO:0010727 | negative regulation of hydrogen peroxide metabolic process(GO:0010727) |
0.7 | 2.7 | GO:0010897 | negative regulation of triglyceride catabolic process(GO:0010897) |
0.7 | 2.7 | GO:2001269 | positive regulation of cysteine-type endopeptidase activity involved in apoptotic signaling pathway(GO:2001269) |
0.7 | 0.7 | GO:1904996 | positive regulation of leukocyte adhesion to vascular endothelial cell(GO:1904996) |
0.7 | 2.0 | GO:1990086 | lens fiber cell apoptotic process(GO:1990086) |
0.7 | 1.3 | GO:2000646 | positive regulation of receptor catabolic process(GO:2000646) |
0.7 | 2.0 | GO:2000303 | positive regulation of sphingolipid biosynthetic process(GO:0090154) regulation of ceramide biosynthetic process(GO:2000303) positive regulation of ceramide biosynthetic process(GO:2000304) |
0.6 | 4.5 | GO:0034379 | very-low-density lipoprotein particle assembly(GO:0034379) |
0.6 | 1.9 | GO:0008228 | opsonization(GO:0008228) |
0.6 | 1.9 | GO:0031087 | nuclear-transcribed mRNA catabolic process, deadenylation-independent decay(GO:0031086) deadenylation-independent decapping of nuclear-transcribed mRNA(GO:0031087) |
0.6 | 6.3 | GO:0016540 | protein autoprocessing(GO:0016540) |
0.6 | 0.6 | GO:1904354 | negative regulation of telomere capping(GO:1904354) |
0.6 | 3.8 | GO:2000323 | negative regulation of glucocorticoid receptor signaling pathway(GO:2000323) |
0.6 | 1.9 | GO:1901421 | positive regulation of response to alcohol(GO:1901421) |
0.6 | 1.2 | GO:0014873 | response to muscle activity involved in regulation of muscle adaptation(GO:0014873) |
0.6 | 3.7 | GO:0034372 | very-low-density lipoprotein particle remodeling(GO:0034372) |
0.6 | 1.8 | GO:1904430 | negative regulation of t-circle formation(GO:1904430) |
0.6 | 1.8 | GO:0038028 | insulin receptor signaling pathway via phosphatidylinositol 3-kinase(GO:0038028) |
0.6 | 2.4 | GO:0010606 | positive regulation of cytoplasmic mRNA processing body assembly(GO:0010606) |
0.6 | 1.8 | GO:1902218 | intrinsic apoptotic signaling pathway in response to osmotic stress(GO:0008627) regulation of intrinsic apoptotic signaling pathway in response to osmotic stress(GO:1902218) negative regulation of intrinsic apoptotic signaling pathway in response to osmotic stress(GO:1902219) |
0.6 | 1.2 | GO:0000255 | allantoin metabolic process(GO:0000255) |
0.6 | 1.8 | GO:0045472 | response to ether(GO:0045472) |
0.6 | 1.8 | GO:0006556 | S-adenosylmethionine biosynthetic process(GO:0006556) |
0.6 | 1.8 | GO:0048021 | regulation of melanin biosynthetic process(GO:0048021) regulation of secondary metabolite biosynthetic process(GO:1900376) |
0.6 | 1.8 | GO:0006741 | NADP biosynthetic process(GO:0006741) |
0.6 | 7.0 | GO:0071378 | growth hormone receptor signaling pathway(GO:0060396) cellular response to growth hormone stimulus(GO:0071378) |
0.6 | 1.7 | GO:1903238 | positive regulation of leukocyte tethering or rolling(GO:1903238) |
0.6 | 1.7 | GO:0070947 | neutrophil mediated killing of fungus(GO:0070947) |
0.6 | 5.7 | GO:0060211 | regulation of nuclear-transcribed mRNA poly(A) tail shortening(GO:0060211) positive regulation of nuclear-transcribed mRNA poly(A) tail shortening(GO:0060213) |
0.6 | 1.7 | GO:0036091 | positive regulation of transcription from RNA polymerase II promoter in response to oxidative stress(GO:0036091) |
0.6 | 2.3 | GO:2000741 | positive regulation of mesenchymal stem cell differentiation(GO:2000741) |
0.6 | 2.8 | GO:2000169 | regulation of peptidyl-cysteine S-nitrosylation(GO:2000169) |
0.6 | 2.2 | GO:0048254 | snoRNA localization(GO:0048254) |
0.5 | 2.2 | GO:1990144 | intrinsic apoptotic signaling pathway in response to hypoxia(GO:1990144) |
0.5 | 1.6 | GO:0019371 | cyclooxygenase pathway(GO:0019371) |
0.5 | 3.8 | GO:0060235 | lens induction in camera-type eye(GO:0060235) |
0.5 | 2.2 | GO:0045053 | protein retention in Golgi apparatus(GO:0045053) |
0.5 | 2.1 | GO:0045091 | regulation of single stranded viral RNA replication via double stranded DNA intermediate(GO:0045091) |
0.5 | 2.6 | GO:0072656 | maintenance of protein location in mitochondrion(GO:0072656) |
0.5 | 2.6 | GO:0046485 | ether lipid metabolic process(GO:0046485) |
0.5 | 2.1 | GO:1903553 | positive regulation of extracellular exosome assembly(GO:1903553) |
0.5 | 1.6 | GO:0060921 | sinoatrial node cell differentiation(GO:0060921) sinoatrial node cell development(GO:0060931) |
0.5 | 1.6 | GO:0035790 | platelet-derived growth factor receptor-alpha signaling pathway(GO:0035790) |
0.5 | 2.6 | GO:0006824 | cobalt ion transport(GO:0006824) |
0.5 | 2.1 | GO:0001712 | ectodermal cell fate commitment(GO:0001712) |
0.5 | 4.6 | GO:0061157 | mRNA destabilization(GO:0061157) |
0.5 | 1.5 | GO:1902498 | regulation of protein autoubiquitination(GO:1902498) |
0.5 | 2.0 | GO:0042699 | follicle-stimulating hormone signaling pathway(GO:0042699) |
0.5 | 1.5 | GO:0006393 | termination of mitochondrial transcription(GO:0006393) |
0.5 | 1.0 | GO:0061511 | centriole elongation(GO:0061511) |
0.5 | 2.5 | GO:0006207 | 'de novo' pyrimidine nucleobase biosynthetic process(GO:0006207) pyrimidine nucleobase biosynthetic process(GO:0019856) |
0.5 | 0.5 | GO:0030970 | retrograde protein transport, ER to cytosol(GO:0030970) |
0.5 | 1.5 | GO:0071787 | endoplasmic reticulum tubular network assembly(GO:0071787) |
0.5 | 1.5 | GO:0036258 | multivesicular body assembly(GO:0036258) |
0.5 | 1.0 | GO:0007597 | blood coagulation, intrinsic pathway(GO:0007597) |
0.5 | 4.0 | GO:0000083 | regulation of transcription involved in G1/S transition of mitotic cell cycle(GO:0000083) |
0.5 | 3.0 | GO:0051013 | microtubule severing(GO:0051013) |
0.5 | 1.5 | GO:2000346 | negative regulation of hepatocyte proliferation(GO:2000346) |
0.5 | 2.5 | GO:0006685 | sphingomyelin catabolic process(GO:0006685) |
0.5 | 0.5 | GO:0019661 | fermentation(GO:0006113) glucose catabolic process to lactate(GO:0019659) glycolytic fermentation(GO:0019660) glucose catabolic process to lactate via pyruvate(GO:0019661) |
0.5 | 1.0 | GO:0046340 | diacylglycerol catabolic process(GO:0046340) |
0.5 | 2.4 | GO:2000042 | negative regulation of double-strand break repair via homologous recombination(GO:2000042) |
0.5 | 3.9 | GO:0030644 | cellular chloride ion homeostasis(GO:0030644) |
0.5 | 1.5 | GO:0071447 | cellular response to hydroperoxide(GO:0071447) |
0.5 | 1.4 | GO:1990705 | cholangiocyte proliferation(GO:1990705) |
0.5 | 1.4 | GO:2001168 | regulation of histone H2B ubiquitination(GO:2001166) positive regulation of histone H2B ubiquitination(GO:2001168) |
0.5 | 3.4 | GO:0035459 | cargo loading into vesicle(GO:0035459) |
0.5 | 1.0 | GO:0009051 | pentose-phosphate shunt, oxidative branch(GO:0009051) |
0.5 | 1.4 | GO:0015817 | histidine transport(GO:0015817) |
0.5 | 1.9 | GO:0048549 | positive regulation of pinocytosis(GO:0048549) |
0.5 | 2.9 | GO:0009226 | nucleotide-sugar biosynthetic process(GO:0009226) |
0.5 | 2.9 | GO:0070561 | vitamin D receptor signaling pathway(GO:0070561) |
0.5 | 2.4 | GO:0009115 | xanthine catabolic process(GO:0009115) xanthine metabolic process(GO:0046110) |
0.5 | 1.4 | GO:0072429 | response to intra-S DNA damage checkpoint signaling(GO:0072429) |
0.5 | 0.9 | GO:0010891 | negative regulation of sequestering of triglyceride(GO:0010891) |
0.5 | 0.5 | GO:0060331 | negative regulation of response to interferon-gamma(GO:0060331) negative regulation of interferon-gamma-mediated signaling pathway(GO:0060336) |
0.5 | 1.4 | GO:0016259 | selenocysteine metabolic process(GO:0016259) |
0.5 | 0.5 | GO:0060139 | induction of programmed cell death(GO:0012502) positive regulation of apoptotic process in other organism(GO:0044533) positive regulation by symbiont of host programmed cell death(GO:0052042) positive regulation by symbiont of host apoptotic process(GO:0052151) positive regulation by organism of programmed cell death in other organism involved in symbiotic interaction(GO:0052330) positive regulation by organism of apoptotic process in other organism involved in symbiotic interaction(GO:0052501) positive regulation of apoptotic process by virus(GO:0060139) |
0.5 | 2.3 | GO:0006572 | tyrosine catabolic process(GO:0006572) |
0.5 | 1.4 | GO:0035425 | autocrine signaling(GO:0035425) |
0.5 | 1.8 | GO:1900038 | negative regulation of cellular response to hypoxia(GO:1900038) |
0.5 | 2.7 | GO:2000676 | positive regulation of type B pancreatic cell apoptotic process(GO:2000676) |
0.5 | 1.4 | GO:0033668 | negative regulation by symbiont of host apoptotic process(GO:0033668) negative regulation by symbiont of host programmed cell death(GO:0052041) negative regulation by organism of programmed cell death in other organism involved in symbiotic interaction(GO:0052490) |
0.5 | 0.5 | GO:0060375 | regulation of mast cell differentiation(GO:0060375) |
0.5 | 1.4 | GO:0008050 | female courtship behavior(GO:0008050) |
0.5 | 3.2 | GO:0051409 | response to nitrosative stress(GO:0051409) |
0.5 | 5.4 | GO:0030449 | regulation of complement activation(GO:0030449) |
0.4 | 0.9 | GO:0090611 | ubiquitin-independent protein catabolic process via the multivesicular body sorting pathway(GO:0090611) |
0.4 | 1.8 | GO:0036480 | neuron intrinsic apoptotic signaling pathway in response to oxidative stress(GO:0036480) regulation of oxidative stress-induced neuron intrinsic apoptotic signaling pathway(GO:1903376) |
0.4 | 0.4 | GO:2001270 | regulation of cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:2001270) negative regulation of cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:2001271) |
0.4 | 1.8 | GO:0097039 | protein linear polyubiquitination(GO:0097039) |
0.4 | 7.9 | GO:0046597 | negative regulation of viral entry into host cell(GO:0046597) |
0.4 | 1.3 | GO:0015766 | disaccharide transport(GO:0015766) sucrose transport(GO:0015770) oligosaccharide transport(GO:0015772) |
0.4 | 1.3 | GO:0035771 | interleukin-4-mediated signaling pathway(GO:0035771) |
0.4 | 2.2 | GO:0007042 | lysosomal lumen acidification(GO:0007042) |
0.4 | 3.5 | GO:0032464 | positive regulation of protein homooligomerization(GO:0032464) |
0.4 | 1.7 | GO:0046125 | pyrimidine deoxyribonucleoside metabolic process(GO:0046125) |
0.4 | 2.2 | GO:0032020 | ISG15-protein conjugation(GO:0032020) |
0.4 | 0.9 | GO:0021553 | olfactory nerve development(GO:0021553) |
0.4 | 1.3 | GO:0036394 | amylase secretion(GO:0036394) |
0.4 | 1.7 | GO:0015886 | heme transport(GO:0015886) |
0.4 | 1.7 | GO:0042420 | dopamine catabolic process(GO:0042420) |
0.4 | 2.9 | GO:0060613 | fat pad development(GO:0060613) |
0.4 | 0.8 | GO:2000391 | regulation of neutrophil extravasation(GO:2000389) positive regulation of neutrophil extravasation(GO:2000391) |
0.4 | 0.8 | GO:0090241 | negative regulation of histone H4 acetylation(GO:0090241) |
0.4 | 2.5 | GO:0060295 | regulation of cilium movement involved in cell motility(GO:0060295) regulation of cilium beat frequency involved in ciliary motility(GO:0060296) regulation of cilium-dependent cell motility(GO:1902019) |
0.4 | 0.8 | GO:0033184 | positive regulation of histone ubiquitination(GO:0033184) |
0.4 | 1.2 | GO:1905216 | positive regulation of mRNA binding(GO:1902416) positive regulation of RNA binding(GO:1905216) |
0.4 | 6.1 | GO:0043968 | histone H2A acetylation(GO:0043968) |
0.4 | 2.5 | GO:1902969 | mitotic DNA replication(GO:1902969) |
0.4 | 1.2 | GO:0035526 | retrograde transport, plasma membrane to Golgi(GO:0035526) |
0.4 | 1.2 | GO:0006701 | progesterone biosynthetic process(GO:0006701) |
0.4 | 2.4 | GO:1904262 | negative regulation of TORC1 signaling(GO:1904262) |
0.4 | 1.6 | GO:0060298 | positive regulation of sarcomere organization(GO:0060298) |
0.4 | 0.8 | GO:0030423 | targeting of mRNA for destruction involved in RNA interference(GO:0030423) siRNA loading onto RISC involved in RNA interference(GO:0035087) |
0.4 | 2.0 | GO:0033211 | adiponectin-activated signaling pathway(GO:0033211) |
0.4 | 1.6 | GO:0002826 | negative regulation of T-helper 1 type immune response(GO:0002826) |
0.4 | 0.4 | GO:0000727 | double-strand break repair via break-induced replication(GO:0000727) |
0.4 | 4.3 | GO:0051895 | negative regulation of focal adhesion assembly(GO:0051895) |
0.4 | 1.2 | GO:0010748 | negative regulation of plasma membrane long-chain fatty acid transport(GO:0010748) |
0.4 | 3.1 | GO:0010388 | cullin deneddylation(GO:0010388) |
0.4 | 0.8 | GO:1904706 | negative regulation of vascular smooth muscle cell proliferation(GO:1904706) |
0.4 | 3.9 | GO:0001731 | formation of translation preinitiation complex(GO:0001731) |
0.4 | 1.2 | GO:0002447 | eosinophil activation involved in immune response(GO:0002278) eosinophil mediated immunity(GO:0002447) eosinophil degranulation(GO:0043308) |
0.4 | 2.3 | GO:0070072 | vacuolar proton-transporting V-type ATPase complex assembly(GO:0070072) |
0.4 | 0.8 | GO:0018171 | peptidyl-cysteine oxidation(GO:0018171) |
0.4 | 3.1 | GO:0048096 | chromatin-mediated maintenance of transcription(GO:0048096) |
0.4 | 0.4 | GO:0002036 | regulation of L-glutamate transport(GO:0002036) |
0.4 | 1.9 | GO:0046133 | pyrimidine ribonucleoside catabolic process(GO:0046133) pyrimidine nucleoside catabolic process(GO:0046135) |
0.4 | 1.1 | GO:0070317 | negative regulation of G0 to G1 transition(GO:0070317) |
0.4 | 2.3 | GO:0015671 | oxygen transport(GO:0015671) |
0.4 | 0.8 | GO:0046066 | purine deoxyribonucleoside diphosphate metabolic process(GO:0009182) dGDP metabolic process(GO:0046066) |
0.4 | 1.1 | GO:0030242 | pexophagy(GO:0030242) |
0.4 | 0.8 | GO:0033567 | DNA replication, Okazaki fragment processing(GO:0033567) DNA replication, removal of RNA primer(GO:0043137) |
0.4 | 0.8 | GO:0034384 | high-density lipoprotein particle clearance(GO:0034384) |
0.4 | 2.6 | GO:0006995 | cellular response to nitrogen starvation(GO:0006995) cellular response to nitrogen levels(GO:0043562) |
0.4 | 1.9 | GO:0010886 | positive regulation of cholesterol storage(GO:0010886) |
0.4 | 0.4 | GO:0033031 | positive regulation of neutrophil apoptotic process(GO:0033031) |
0.4 | 1.1 | GO:0000290 | deadenylation-dependent decapping of nuclear-transcribed mRNA(GO:0000290) |
0.4 | 1.5 | GO:0015825 | L-serine transport(GO:0015825) |
0.4 | 1.9 | GO:0034720 | histone H3-K4 demethylation(GO:0034720) |
0.4 | 0.4 | GO:0023021 | termination of signal transduction(GO:0023021) |
0.4 | 1.5 | GO:0036265 | RNA (guanine-N7)-methylation(GO:0036265) |
0.4 | 1.1 | GO:0071288 | cellular response to mercury ion(GO:0071288) |
0.4 | 0.4 | GO:0044004 | killing by symbiont of host cells(GO:0001907) disruption by symbiont of host cell(GO:0044004) |
0.4 | 5.9 | GO:0006783 | heme biosynthetic process(GO:0006783) |
0.4 | 1.1 | GO:0051918 | negative regulation of fibrinolysis(GO:0051918) |
0.4 | 0.4 | GO:0009080 | alanine catabolic process(GO:0006524) pyruvate family amino acid catabolic process(GO:0009080) |
0.4 | 0.7 | GO:2000974 | negative regulation of pro-B cell differentiation(GO:2000974) |
0.4 | 3.3 | GO:1990440 | positive regulation of transcription from RNA polymerase II promoter in response to endoplasmic reticulum stress(GO:1990440) |
0.4 | 1.8 | GO:0051138 | regulation of NK T cell differentiation(GO:0051136) positive regulation of NK T cell differentiation(GO:0051138) |
0.4 | 4.0 | GO:0009396 | folic acid-containing compound biosynthetic process(GO:0009396) |
0.4 | 0.7 | GO:0010746 | regulation of plasma membrane long-chain fatty acid transport(GO:0010746) |
0.4 | 1.4 | GO:1904469 | positive regulation of tumor necrosis factor secretion(GO:1904469) |
0.4 | 1.1 | GO:0000379 | tRNA-type intron splice site recognition and cleavage(GO:0000379) |
0.4 | 2.9 | GO:0032460 | negative regulation of protein oligomerization(GO:0032460) |
0.4 | 1.4 | GO:0006348 | chromatin silencing at telomere(GO:0006348) |
0.4 | 1.1 | GO:0006546 | glycine catabolic process(GO:0006546) glycine decarboxylation via glycine cleavage system(GO:0019464) |
0.4 | 2.5 | GO:0071404 | cellular response to low-density lipoprotein particle stimulus(GO:0071404) |
0.4 | 1.1 | GO:0042866 | pyruvate biosynthetic process(GO:0042866) |
0.4 | 2.9 | GO:0030213 | hyaluronan biosynthetic process(GO:0030213) |
0.4 | 1.4 | GO:0070475 | rRNA base methylation(GO:0070475) |
0.4 | 0.7 | GO:0044027 | hypermethylation of CpG island(GO:0044027) |
0.4 | 0.7 | GO:1902065 | response to L-glutamate(GO:1902065) |
0.4 | 0.7 | GO:0072718 | response to cisplatin(GO:0072718) |
0.4 | 2.8 | GO:0010826 | negative regulation of centrosome duplication(GO:0010826) negative regulation of centrosome cycle(GO:0046606) |
0.4 | 11.6 | GO:0006953 | acute-phase response(GO:0006953) |
0.4 | 2.1 | GO:0060753 | regulation of mast cell chemotaxis(GO:0060753) |
0.4 | 1.4 | GO:0044314 | protein K27-linked ubiquitination(GO:0044314) |
0.3 | 2.8 | GO:0043249 | erythrocyte maturation(GO:0043249) |
0.3 | 2.1 | GO:1902902 | negative regulation of autophagosome assembly(GO:1902902) |
0.3 | 7.3 | GO:0017144 | drug metabolic process(GO:0017144) |
0.3 | 0.3 | GO:0036302 | atrial septum primum morphogenesis(GO:0003289) atrioventricular canal development(GO:0036302) |
0.3 | 1.4 | GO:0001672 | regulation of chromatin assembly or disassembly(GO:0001672) |
0.3 | 1.7 | GO:0034141 | positive regulation of toll-like receptor 3 signaling pathway(GO:0034141) |
0.3 | 0.7 | GO:0060825 | fibroblast growth factor receptor signaling pathway involved in neural plate anterior/posterior pattern formation(GO:0060825) regulation of fibroblast growth factor receptor signaling pathway involved in neural plate anterior/posterior pattern formation(GO:2000313) |
0.3 | 0.3 | GO:0018298 | protein-chromophore linkage(GO:0018298) |
0.3 | 2.4 | GO:0042760 | very long-chain fatty acid catabolic process(GO:0042760) |
0.3 | 0.3 | GO:0006189 | 'de novo' IMP biosynthetic process(GO:0006189) |
0.3 | 3.7 | GO:2000188 | regulation of cholesterol homeostasis(GO:2000188) |
0.3 | 0.7 | GO:2000418 | positive regulation of eosinophil migration(GO:2000418) |
0.3 | 0.7 | GO:0046208 | spermine catabolic process(GO:0046208) |
0.3 | 1.3 | GO:0070837 | dehydroascorbic acid transport(GO:0070837) |
0.3 | 1.0 | GO:0035754 | B cell chemotaxis(GO:0035754) |
0.3 | 1.0 | GO:0070973 | protein localization to endoplasmic reticulum exit site(GO:0070973) |
0.3 | 0.7 | GO:1903525 | regulation of membrane tubulation(GO:1903525) |
0.3 | 0.7 | GO:0009838 | abscission(GO:0009838) |
0.3 | 0.7 | GO:0045196 | establishment or maintenance of neuroblast polarity(GO:0045196) establishment of neuroblast polarity(GO:0045200) |
0.3 | 1.0 | GO:2001170 | negative regulation of ATP biosynthetic process(GO:2001170) |
0.3 | 2.0 | GO:0060710 | chorio-allantoic fusion(GO:0060710) |
0.3 | 1.0 | GO:0010046 | response to mycotoxin(GO:0010046) |
0.3 | 0.7 | GO:1902445 | regulation of mitochondrial membrane permeability involved in programmed necrotic cell death(GO:1902445) |
0.3 | 0.7 | GO:1901187 | regulation of ephrin receptor signaling pathway(GO:1901187) |
0.3 | 2.3 | GO:0000185 | activation of MAPKKK activity(GO:0000185) |
0.3 | 1.6 | GO:0071712 | ER-associated misfolded protein catabolic process(GO:0071712) |
0.3 | 1.0 | GO:0072531 | pyrimidine-containing compound transmembrane transport(GO:0072531) |
0.3 | 2.0 | GO:0048539 | bone marrow development(GO:0048539) |
0.3 | 1.3 | GO:0003348 | cardiac endothelial cell differentiation(GO:0003348) |
0.3 | 1.0 | GO:1901078 | negative regulation of relaxation of muscle(GO:1901078) |
0.3 | 1.0 | GO:0070782 | phosphatidylserine exposure on apoptotic cell surface(GO:0070782) |
0.3 | 2.9 | GO:0002098 | tRNA wobble uridine modification(GO:0002098) |
0.3 | 2.9 | GO:0010801 | negative regulation of peptidyl-threonine phosphorylation(GO:0010801) |
0.3 | 1.3 | GO:0006499 | N-terminal protein myristoylation(GO:0006499) |
0.3 | 0.3 | GO:0075509 | receptor-mediated endocytosis of virus by host cell(GO:0019065) endocytosis involved in viral entry into host cell(GO:0075509) |
0.3 | 0.3 | GO:0039692 | single stranded viral RNA replication via double stranded DNA intermediate(GO:0039692) |
0.3 | 0.6 | GO:0060268 | regulation of respiratory burst involved in inflammatory response(GO:0060264) negative regulation of respiratory burst involved in inflammatory response(GO:0060266) negative regulation of respiratory burst(GO:0060268) |
0.3 | 1.9 | GO:0044351 | macropinocytosis(GO:0044351) |
0.3 | 1.3 | GO:0097368 | establishment of Sertoli cell barrier(GO:0097368) |
0.3 | 6.4 | GO:0006471 | protein ADP-ribosylation(GO:0006471) |
0.3 | 0.3 | GO:1903887 | motile primary cilium assembly(GO:1903887) |
0.3 | 0.9 | GO:0033133 | positive regulation of glucokinase activity(GO:0033133) |
0.3 | 1.6 | GO:0090400 | stress-induced premature senescence(GO:0090400) |
0.3 | 1.3 | GO:0033015 | porphyrin-containing compound catabolic process(GO:0006787) tetrapyrrole catabolic process(GO:0033015) |
0.3 | 3.8 | GO:0006047 | UDP-N-acetylglucosamine metabolic process(GO:0006047) |
0.3 | 0.3 | GO:0031860 | telomeric 3' overhang formation(GO:0031860) |
0.3 | 5.3 | GO:0000413 | protein peptidyl-prolyl isomerization(GO:0000413) |
0.3 | 0.6 | GO:1903659 | regulation of complement-dependent cytotoxicity(GO:1903659) negative regulation of complement-dependent cytotoxicity(GO:1903660) |
0.3 | 1.2 | GO:0010626 | negative regulation of Schwann cell proliferation(GO:0010626) |
0.3 | 1.2 | GO:0019805 | quinolinate biosynthetic process(GO:0019805) |
0.3 | 1.2 | GO:0051775 | response to redox state(GO:0051775) |
0.3 | 0.9 | GO:0006624 | vacuolar protein processing(GO:0006624) |
0.3 | 0.3 | GO:1901977 | negative regulation of cell cycle checkpoint(GO:1901977) |
0.3 | 1.5 | GO:0031507 | heterochromatin assembly(GO:0031507) |
0.3 | 1.5 | GO:0051122 | hepoxilin metabolic process(GO:0051121) hepoxilin biosynthetic process(GO:0051122) |
0.3 | 1.2 | GO:1902916 | positive regulation of protein polyubiquitination(GO:1902916) |
0.3 | 1.2 | GO:0031508 | pericentric heterochromatin assembly(GO:0031508) |
0.3 | 0.3 | GO:0034214 | protein hexamerization(GO:0034214) |
0.3 | 1.2 | GO:0070236 | negative regulation of activation-induced cell death of T cells(GO:0070236) |
0.3 | 0.6 | GO:0060300 | regulation of cytokine activity(GO:0060300) |
0.3 | 1.5 | GO:0070244 | negative regulation of thymocyte apoptotic process(GO:0070244) |
0.3 | 1.2 | GO:0032790 | ribosome disassembly(GO:0032790) |
0.3 | 3.3 | GO:0035873 | lactate transport(GO:0015727) lactate transmembrane transport(GO:0035873) plasma membrane lactate transport(GO:0035879) |
0.3 | 0.3 | GO:0070534 | protein K63-linked ubiquitination(GO:0070534) |
0.3 | 1.2 | GO:0072675 | osteoclast fusion(GO:0072675) |
0.3 | 2.7 | GO:1903427 | negative regulation of reactive oxygen species biosynthetic process(GO:1903427) |
0.3 | 2.4 | GO:0060391 | positive regulation of SMAD protein import into nucleus(GO:0060391) |
0.3 | 1.2 | GO:0006983 | ER overload response(GO:0006983) |
0.3 | 1.2 | GO:0090209 | negative regulation of triglyceride metabolic process(GO:0090209) |
0.3 | 1.2 | GO:0007256 | activation of JNKK activity(GO:0007256) |
0.3 | 0.6 | GO:0043201 | response to leucine(GO:0043201) cellular response to leucine(GO:0071233) |
0.3 | 5.2 | GO:0048596 | embryonic camera-type eye morphogenesis(GO:0048596) |
0.3 | 0.3 | GO:0051900 | regulation of mitochondrial depolarization(GO:0051900) |
0.3 | 1.7 | GO:0045629 | negative regulation of T-helper 2 cell differentiation(GO:0045629) |
0.3 | 3.2 | GO:0033962 | cytoplasmic mRNA processing body assembly(GO:0033962) |
0.3 | 2.3 | GO:0048199 | vesicle targeting, to, from or within Golgi(GO:0048199) |
0.3 | 0.9 | GO:1901164 | negative regulation of trophoblast cell migration(GO:1901164) |
0.3 | 1.2 | GO:0048386 | positive regulation of retinoic acid receptor signaling pathway(GO:0048386) |
0.3 | 3.5 | GO:2000001 | regulation of DNA damage checkpoint(GO:2000001) |
0.3 | 0.9 | GO:0045628 | regulation of T-helper 2 cell differentiation(GO:0045628) positive regulation of T-helper 2 cell differentiation(GO:0045630) |
0.3 | 1.7 | GO:0006013 | mannose metabolic process(GO:0006013) |
0.3 | 1.4 | GO:0071569 | protein ufmylation(GO:0071569) |
0.3 | 0.3 | GO:0075136 | response to defenses of other organism involved in symbiotic interaction(GO:0052173) response to host defenses(GO:0052200) response to host(GO:0075136) |
0.3 | 1.4 | GO:0036289 | peptidyl-serine autophosphorylation(GO:0036289) |
0.3 | 0.8 | GO:0035928 | rRNA import into mitochondrion(GO:0035928) |
0.3 | 1.1 | GO:0017183 | peptidyl-diphthamide metabolic process(GO:0017182) peptidyl-diphthamide biosynthetic process from peptidyl-histidine(GO:0017183) |
0.3 | 0.8 | GO:0060390 | regulation of SMAD protein import into nucleus(GO:0060390) |
0.3 | 0.6 | GO:0071847 | TNFSF11-mediated signaling pathway(GO:0071847) |
0.3 | 1.7 | GO:0051574 | positive regulation of histone H3-K9 methylation(GO:0051574) |
0.3 | 2.0 | GO:1902231 | positive regulation of intrinsic apoptotic signaling pathway in response to DNA damage(GO:1902231) |
0.3 | 0.8 | GO:0032911 | negative regulation of transforming growth factor beta1 production(GO:0032911) |
0.3 | 0.6 | GO:0045347 | negative regulation of MHC class II biosynthetic process(GO:0045347) |
0.3 | 1.4 | GO:0006545 | glycine biosynthetic process(GO:0006545) |
0.3 | 1.7 | GO:0000212 | meiotic spindle organization(GO:0000212) |
0.3 | 1.1 | GO:0072488 | ammonium transmembrane transport(GO:0072488) |
0.3 | 0.8 | GO:0051410 | detoxification of nitrogen compound(GO:0051410) cellular detoxification of nitrogen compound(GO:0070458) |
0.3 | 0.6 | GO:1901535 | regulation of DNA demethylation(GO:1901535) negative regulation of DNA demethylation(GO:1901536) |
0.3 | 0.8 | GO:0032485 | regulation of Ral protein signal transduction(GO:0032485) |
0.3 | 1.1 | GO:0090666 | scaRNA localization to Cajal body(GO:0090666) |
0.3 | 1.4 | GO:0001842 | neural fold formation(GO:0001842) |
0.3 | 1.9 | GO:0030575 | nuclear body organization(GO:0030575) |
0.3 | 6.3 | GO:0006308 | DNA catabolic process(GO:0006308) |
0.3 | 1.1 | GO:1900194 | negative regulation of oocyte maturation(GO:1900194) |
0.3 | 0.8 | GO:0048009 | insulin-like growth factor receptor signaling pathway(GO:0048009) |
0.3 | 1.6 | GO:0060136 | embryonic process involved in female pregnancy(GO:0060136) |
0.3 | 3.0 | GO:0043518 | negative regulation of DNA damage response, signal transduction by p53 class mediator(GO:0043518) |
0.3 | 0.5 | GO:0035927 | RNA import into mitochondrion(GO:0035927) |
0.3 | 1.4 | GO:0090267 | positive regulation of mitotic cell cycle spindle assembly checkpoint(GO:0090267) |
0.3 | 1.1 | GO:0070125 | mitochondrial translational elongation(GO:0070125) |
0.3 | 0.5 | GO:0071877 | regulation of adrenergic receptor signaling pathway(GO:0071877) |
0.3 | 0.3 | GO:0001555 | oocyte growth(GO:0001555) |
0.3 | 0.5 | GO:0019676 | ammonia assimilation cycle(GO:0019676) |
0.3 | 1.1 | GO:0021698 | cerebellar cortex structural organization(GO:0021698) |
0.3 | 0.3 | GO:0034140 | negative regulation of toll-like receptor 3 signaling pathway(GO:0034140) |
0.3 | 1.6 | GO:0022027 | interkinetic nuclear migration(GO:0022027) |
0.3 | 1.6 | GO:0044252 | negative regulation of collagen metabolic process(GO:0010713) negative regulation of collagen biosynthetic process(GO:0032966) negative regulation of multicellular organismal metabolic process(GO:0044252) |
0.3 | 0.3 | GO:2000384 | regulation of ectoderm development(GO:2000383) negative regulation of ectoderm development(GO:2000384) |
0.3 | 1.1 | GO:0060762 | regulation of branching involved in mammary gland duct morphogenesis(GO:0060762) |
0.3 | 0.3 | GO:0071225 | cellular response to muramyl dipeptide(GO:0071225) |
0.3 | 0.3 | GO:2000553 | positive regulation of T-helper 2 cell cytokine production(GO:2000553) |
0.3 | 1.8 | GO:1904816 | positive regulation of protein localization to chromosome, telomeric region(GO:1904816) |
0.3 | 3.4 | GO:0046827 | positive regulation of protein export from nucleus(GO:0046827) |
0.3 | 1.0 | GO:0035021 | negative regulation of Rac protein signal transduction(GO:0035021) |
0.3 | 3.1 | GO:0035455 | response to interferon-alpha(GO:0035455) |
0.3 | 1.3 | GO:0052805 | histidine metabolic process(GO:0006547) histidine catabolic process(GO:0006548) imidazole-containing compound catabolic process(GO:0052805) |
0.3 | 0.5 | GO:0042360 | vitamin E metabolic process(GO:0042360) |
0.3 | 0.3 | GO:0018076 | N-terminal peptidyl-lysine acetylation(GO:0018076) |
0.3 | 1.8 | GO:2000059 | negative regulation of protein ubiquitination involved in ubiquitin-dependent protein catabolic process(GO:2000059) |
0.3 | 0.8 | GO:0051088 | PMA-inducible membrane protein ectodomain proteolysis(GO:0051088) |
0.3 | 3.0 | GO:2000369 | regulation of clathrin-mediated endocytosis(GO:2000369) |
0.3 | 0.8 | GO:0060161 | positive regulation of dopamine receptor signaling pathway(GO:0060161) |
0.3 | 4.0 | GO:0000028 | ribosomal small subunit assembly(GO:0000028) |
0.3 | 0.5 | GO:0070682 | proteasome regulatory particle assembly(GO:0070682) |
0.3 | 1.5 | GO:0016266 | O-glycan processing(GO:0016266) |
0.3 | 1.5 | GO:0045542 | positive regulation of cholesterol biosynthetic process(GO:0045542) positive regulation of cholesterol metabolic process(GO:0090205) |
0.2 | 0.7 | GO:1900086 | regulation of peptidyl-tyrosine autophosphorylation(GO:1900084) positive regulation of peptidyl-tyrosine autophosphorylation(GO:1900086) |
0.2 | 0.5 | GO:0009092 | homoserine metabolic process(GO:0009092) transsulfuration(GO:0019346) hydrogen sulfide biosynthetic process(GO:0070814) |
0.2 | 1.2 | GO:0009437 | carnitine metabolic process(GO:0009437) |
0.2 | 0.2 | GO:0010918 | positive regulation of mitochondrial membrane potential(GO:0010918) |
0.2 | 0.2 | GO:0010832 | negative regulation of myotube differentiation(GO:0010832) |
0.2 | 1.0 | GO:0046688 | response to copper ion(GO:0046688) |
0.2 | 0.7 | GO:0007084 | mitotic nuclear envelope reassembly(GO:0007084) |
0.2 | 1.0 | GO:0071763 | nuclear membrane organization(GO:0071763) |
0.2 | 0.7 | GO:1990874 | regulation of vascular smooth muscle cell proliferation(GO:1904705) vascular smooth muscle cell proliferation(GO:1990874) |
0.2 | 0.7 | GO:1902896 | terminal web assembly(GO:1902896) |
0.2 | 1.0 | GO:0006083 | acetate metabolic process(GO:0006083) |
0.2 | 1.2 | GO:0070200 | establishment of protein localization to telomere(GO:0070200) |
0.2 | 2.9 | GO:0007076 | mitotic chromosome condensation(GO:0007076) |
0.2 | 1.5 | GO:0050862 | positive regulation of T cell receptor signaling pathway(GO:0050862) |
0.2 | 0.2 | GO:0055005 | ventricular cardiac myofibril assembly(GO:0055005) |
0.2 | 0.2 | GO:0060159 | regulation of dopamine receptor signaling pathway(GO:0060159) |
0.2 | 0.7 | GO:0035523 | protein K29-linked deubiquitination(GO:0035523) protein K33-linked deubiquitination(GO:1990168) |
0.2 | 1.9 | GO:0006012 | galactose metabolic process(GO:0006012) |
0.2 | 0.2 | GO:2000551 | regulation of T-helper 2 cell cytokine production(GO:2000551) |
0.2 | 1.2 | GO:0009446 | putrescine biosynthetic process(GO:0009446) |
0.2 | 1.0 | GO:2000348 | regulation of CD40 signaling pathway(GO:2000348) |
0.2 | 0.5 | GO:0039534 | negative regulation of MDA-5 signaling pathway(GO:0039534) |
0.2 | 1.7 | GO:2000480 | negative regulation of cAMP-dependent protein kinase activity(GO:2000480) |
0.2 | 1.9 | GO:0046085 | adenosine metabolic process(GO:0046085) |
0.2 | 0.5 | GO:0003062 | regulation of heart rate by chemical signal(GO:0003062) |
0.2 | 0.2 | GO:0002906 | mature B cell apoptotic process(GO:0002901) regulation of mature B cell apoptotic process(GO:0002905) negative regulation of mature B cell apoptotic process(GO:0002906) |
0.2 | 7.1 | GO:0000245 | spliceosomal complex assembly(GO:0000245) |
0.2 | 1.2 | GO:0015871 | choline transport(GO:0015871) |
0.2 | 1.9 | GO:0043248 | proteasome assembly(GO:0043248) |
0.2 | 0.5 | GO:0032074 | negative regulation of nuclease activity(GO:0032074) |
0.2 | 2.1 | GO:0031954 | positive regulation of protein autophosphorylation(GO:0031954) |
0.2 | 1.2 | GO:0045908 | negative regulation of vasodilation(GO:0045908) |
0.2 | 3.3 | GO:0070328 | acylglycerol homeostasis(GO:0055090) triglyceride homeostasis(GO:0070328) |
0.2 | 0.7 | GO:0043988 | histone H3-S28 phosphorylation(GO:0043988) |
0.2 | 2.1 | GO:0006144 | purine nucleobase metabolic process(GO:0006144) |
0.2 | 0.7 | GO:0001880 | Mullerian duct regression(GO:0001880) |
0.2 | 0.2 | GO:0014744 | positive regulation of muscle adaptation(GO:0014744) |
0.2 | 2.1 | GO:0007097 | nuclear migration(GO:0007097) |
0.2 | 0.2 | GO:2001180 | negative regulation of interleukin-10 secretion(GO:2001180) |
0.2 | 0.5 | GO:0061304 | retinal blood vessel morphogenesis(GO:0061304) |
0.2 | 0.2 | GO:0070447 | positive regulation of oligodendrocyte progenitor proliferation(GO:0070447) |
0.2 | 0.9 | GO:0031581 | hemidesmosome assembly(GO:0031581) |
0.2 | 3.0 | GO:0043982 | histone H4-K5 acetylation(GO:0043981) histone H4-K8 acetylation(GO:0043982) |
0.2 | 0.5 | GO:0045829 | negative regulation of isotype switching(GO:0045829) |
0.2 | 0.5 | GO:0002215 | defense response to nematode(GO:0002215) |
0.2 | 0.5 | GO:0030997 | regulation of centriole-centriole cohesion(GO:0030997) |
0.2 | 6.6 | GO:0000387 | spliceosomal snRNP assembly(GO:0000387) |
0.2 | 0.5 | GO:0042726 | flavin-containing compound metabolic process(GO:0042726) |
0.2 | 0.5 | GO:0032466 | negative regulation of cytokinesis(GO:0032466) |
0.2 | 0.7 | GO:0000960 | mitochondrial RNA catabolic process(GO:0000957) regulation of mitochondrial RNA catabolic process(GO:0000960) |
0.2 | 0.7 | GO:0036444 | calcium ion transmembrane import into mitochondrion(GO:0036444) |
0.2 | 0.2 | GO:0002432 | granuloma formation(GO:0002432) |
0.2 | 2.0 | GO:0002862 | negative regulation of inflammatory response to antigenic stimulus(GO:0002862) |
0.2 | 1.6 | GO:0015838 | amino-acid betaine transport(GO:0015838) |
0.2 | 0.7 | GO:0051593 | response to folic acid(GO:0051593) |
0.2 | 0.7 | GO:0072383 | plus-end-directed vesicle transport along microtubule(GO:0072383) plus-end-directed organelle transport along microtubule(GO:0072386) |
0.2 | 1.1 | GO:0007091 | metaphase/anaphase transition of mitotic cell cycle(GO:0007091) regulation of mitotic sister chromatid separation(GO:0010965) metaphase/anaphase transition of cell cycle(GO:0044784) |
0.2 | 0.4 | GO:0031914 | negative regulation of synaptic plasticity(GO:0031914) |
0.2 | 1.3 | GO:0035372 | protein localization to microtubule(GO:0035372) |
0.2 | 0.4 | GO:0002767 | immune response-inhibiting cell surface receptor signaling pathway(GO:0002767) |
0.2 | 0.7 | GO:0042045 | epithelial fluid transport(GO:0042045) |
0.2 | 0.2 | GO:0097167 | circadian regulation of translation(GO:0097167) |
0.2 | 1.3 | GO:0042454 | purine nucleoside catabolic process(GO:0006152) ribonucleoside catabolic process(GO:0042454) purine ribonucleoside catabolic process(GO:0046130) |
0.2 | 1.3 | GO:0001866 | NK T cell proliferation(GO:0001866) |
0.2 | 2.0 | GO:0035278 | miRNA mediated inhibition of translation(GO:0035278) |
0.2 | 0.7 | GO:0097680 | double-strand break repair via classical nonhomologous end joining(GO:0097680) |
0.2 | 0.4 | GO:0045351 | type I interferon biosynthetic process(GO:0045351) |
0.2 | 0.4 | GO:0051562 | negative regulation of mitochondrial calcium ion concentration(GO:0051562) |
0.2 | 0.9 | GO:0016584 | nucleosome positioning(GO:0016584) |
0.2 | 4.6 | GO:0090162 | establishment of epithelial cell polarity(GO:0090162) |
0.2 | 7.4 | GO:0006611 | protein export from nucleus(GO:0006611) |
0.2 | 2.2 | GO:0006415 | translational termination(GO:0006415) |
0.2 | 0.9 | GO:0044068 | modulation by symbiont of host cellular process(GO:0044068) |
0.2 | 0.4 | GO:0036092 | phosphatidylinositol-3-phosphate biosynthetic process(GO:0036092) |
0.2 | 0.2 | GO:0046599 | regulation of centriole replication(GO:0046599) |
0.2 | 0.4 | GO:1902075 | cellular response to salt(GO:1902075) |
0.2 | 1.1 | GO:2000378 | negative regulation of reactive oxygen species metabolic process(GO:2000378) |
0.2 | 0.6 | GO:0034499 | late endosome to Golgi transport(GO:0034499) |
0.2 | 0.2 | GO:0002840 | T cell mediated immune response to tumor cell(GO:0002424) regulation of T cell mediated immune response to tumor cell(GO:0002840) |
0.2 | 1.3 | GO:0051044 | positive regulation of membrane protein ectodomain proteolysis(GO:0051044) |
0.2 | 0.2 | GO:0072319 | vesicle uncoating(GO:0072319) |
0.2 | 0.4 | GO:0032290 | peripheral nervous system myelin formation(GO:0032290) |
0.2 | 4.5 | GO:0006301 | postreplication repair(GO:0006301) |
0.2 | 0.2 | GO:0050904 | diapedesis(GO:0050904) |
0.2 | 0.2 | GO:0009078 | alanine metabolic process(GO:0006522) pyruvate family amino acid metabolic process(GO:0009078) |
0.2 | 0.4 | GO:0043652 | engulfment of apoptotic cell(GO:0043652) |
0.2 | 0.6 | GO:0046013 | T cell homeostatic proliferation(GO:0001777) regulation of T cell homeostatic proliferation(GO:0046013) |
0.2 | 2.1 | GO:0043116 | negative regulation of vascular permeability(GO:0043116) |
0.2 | 0.6 | GO:2000474 | regulation of opioid receptor signaling pathway(GO:2000474) |
0.2 | 0.2 | GO:0009445 | putrescine metabolic process(GO:0009445) |
0.2 | 0.4 | GO:0033029 | regulation of neutrophil apoptotic process(GO:0033029) negative regulation of neutrophil apoptotic process(GO:0033030) |
0.2 | 0.4 | GO:0003431 | growth plate cartilage chondrocyte development(GO:0003431) |
0.2 | 0.4 | GO:0002913 | positive regulation of T cell anergy(GO:0002669) positive regulation of lymphocyte anergy(GO:0002913) |
0.2 | 2.1 | GO:0015937 | coenzyme A biosynthetic process(GO:0015937) |
0.2 | 1.7 | GO:0008343 | adult feeding behavior(GO:0008343) |
0.2 | 1.7 | GO:0061014 | positive regulation of mRNA catabolic process(GO:0061014) |
0.2 | 1.9 | GO:0001833 | inner cell mass cell proliferation(GO:0001833) |
0.2 | 0.6 | GO:1900108 | negative regulation of nodal signaling pathway(GO:1900108) |
0.2 | 0.8 | GO:0006651 | diacylglycerol biosynthetic process(GO:0006651) |
0.2 | 1.9 | GO:1902236 | negative regulation of endoplasmic reticulum stress-induced intrinsic apoptotic signaling pathway(GO:1902236) |
0.2 | 1.3 | GO:0010875 | positive regulation of cholesterol efflux(GO:0010875) |
0.2 | 1.2 | GO:0071267 | amino acid salvage(GO:0043102) L-methionine biosynthetic process(GO:0071265) L-methionine salvage(GO:0071267) |
0.2 | 0.4 | GO:0052803 | imidazole-containing compound metabolic process(GO:0052803) |
0.2 | 0.6 | GO:0006481 | C-terminal protein methylation(GO:0006481) |
0.2 | 2.9 | GO:0030488 | tRNA methylation(GO:0030488) |
0.2 | 4.2 | GO:0043567 | regulation of insulin-like growth factor receptor signaling pathway(GO:0043567) |
0.2 | 2.5 | GO:0006098 | pentose-phosphate shunt(GO:0006098) |
0.2 | 0.4 | GO:0070574 | cadmium ion transport(GO:0015691) cadmium ion transmembrane transport(GO:0070574) |
0.2 | 0.4 | GO:0060839 | endothelial cell fate commitment(GO:0060839) |
0.2 | 0.8 | GO:0060971 | embryonic heart tube left/right pattern formation(GO:0060971) |
0.2 | 0.2 | GO:0033629 | negative regulation of cell adhesion mediated by integrin(GO:0033629) |
0.2 | 0.2 | GO:0061428 | negative regulation of transcription from RNA polymerase II promoter in response to hypoxia(GO:0061428) |
0.2 | 7.0 | GO:0070936 | protein K48-linked ubiquitination(GO:0070936) |
0.2 | 0.2 | GO:1903598 | positive regulation of gap junction assembly(GO:1903598) |
0.2 | 0.2 | GO:2000630 | positive regulation of miRNA metabolic process(GO:2000630) |
0.2 | 2.0 | GO:0042407 | cristae formation(GO:0042407) |
0.2 | 0.6 | GO:0061084 | negative regulation of protein refolding(GO:0061084) |
0.2 | 4.7 | GO:0006754 | ATP biosynthetic process(GO:0006754) |
0.2 | 0.4 | GO:0071883 | activation of MAPK activity by adrenergic receptor signaling pathway(GO:0071883) |
0.2 | 0.6 | GO:0002309 | T cell proliferation involved in immune response(GO:0002309) |
0.2 | 1.0 | GO:0097340 | inhibition of cysteine-type endopeptidase activity(GO:0097340) zymogen inhibition(GO:0097341) inhibition of cysteine-type endopeptidase activity involved in apoptotic process(GO:1990001) |
0.2 | 1.0 | GO:0016255 | attachment of GPI anchor to protein(GO:0016255) |
0.2 | 1.0 | GO:0015712 | hexose phosphate transport(GO:0015712) glucose-6-phosphate transport(GO:0015760) |
0.2 | 1.6 | GO:0045725 | positive regulation of glycogen biosynthetic process(GO:0045725) |
0.2 | 0.4 | GO:0070831 | basement membrane assembly(GO:0070831) |
0.2 | 0.8 | GO:0043951 | negative regulation of cAMP-mediated signaling(GO:0043951) |
0.2 | 4.6 | GO:1900047 | negative regulation of blood coagulation(GO:0030195) negative regulation of hemostasis(GO:1900047) |
0.2 | 3.4 | GO:0045662 | negative regulation of myoblast differentiation(GO:0045662) |
0.2 | 0.2 | GO:1901978 | positive regulation of cell cycle checkpoint(GO:1901978) |
0.2 | 1.2 | GO:0007008 | outer mitochondrial membrane organization(GO:0007008) |
0.2 | 0.8 | GO:0043619 | regulation of transcription from RNA polymerase II promoter in response to oxidative stress(GO:0043619) |
0.2 | 0.8 | GO:0030854 | positive regulation of granulocyte differentiation(GO:0030854) |
0.2 | 0.8 | GO:0042518 | negative regulation of tyrosine phosphorylation of Stat3 protein(GO:0042518) |
0.2 | 1.4 | GO:0032801 | receptor catabolic process(GO:0032801) |
0.2 | 1.4 | GO:0044794 | positive regulation by host of viral process(GO:0044794) |
0.2 | 1.0 | GO:0042904 | 9-cis-retinoic acid biosynthetic process(GO:0042904) 9-cis-retinoic acid metabolic process(GO:0042905) |
0.2 | 0.2 | GO:2000507 | positive regulation of energy homeostasis(GO:2000507) |
0.2 | 0.4 | GO:0007386 | compartment pattern specification(GO:0007386) |
0.2 | 0.8 | GO:0038165 | oncostatin-M-mediated signaling pathway(GO:0038165) |
0.2 | 0.2 | GO:0034116 | positive regulation of heterotypic cell-cell adhesion(GO:0034116) |
0.2 | 0.6 | GO:0070681 | glutaminyl-tRNAGln biosynthesis via transamidation(GO:0070681) |
0.2 | 0.2 | GO:1904292 | regulation of ERAD pathway(GO:1904292) |
0.2 | 1.2 | GO:0061099 | negative regulation of protein tyrosine kinase activity(GO:0061099) |
0.2 | 1.4 | GO:0090026 | positive regulation of monocyte chemotaxis(GO:0090026) |
0.2 | 0.6 | GO:0002924 | negative regulation of humoral immune response mediated by circulating immunoglobulin(GO:0002924) |
0.2 | 0.4 | GO:0035507 | regulation of myosin-light-chain-phosphatase activity(GO:0035507) |
0.2 | 0.4 | GO:0019230 | proprioception(GO:0019230) |
0.2 | 0.6 | GO:0060319 | primitive erythrocyte differentiation(GO:0060319) |
0.2 | 1.5 | GO:0036297 | interstrand cross-link repair(GO:0036297) |
0.2 | 0.2 | GO:0036015 | response to interleukin-3(GO:0036015) cellular response to interleukin-3(GO:0036016) |
0.2 | 0.4 | GO:0019081 | viral translation(GO:0019081) |
0.2 | 1.0 | GO:0033601 | positive regulation of mammary gland epithelial cell proliferation(GO:0033601) |
0.2 | 0.2 | GO:0002461 | tolerance induction dependent upon immune response(GO:0002461) |
0.2 | 1.7 | GO:0070269 | pyroptosis(GO:0070269) |
0.2 | 0.8 | GO:0034627 | 'de novo' NAD biosynthetic process(GO:0034627) |
0.2 | 0.2 | GO:0002430 | complement receptor mediated signaling pathway(GO:0002430) |
0.2 | 0.2 | GO:0003347 | epicardial cell to mesenchymal cell transition(GO:0003347) |
0.2 | 0.2 | GO:0003032 | detection of oxygen(GO:0003032) |
0.2 | 0.2 | GO:1901857 | positive regulation of cellular respiration(GO:1901857) |
0.2 | 0.8 | GO:0043923 | positive regulation by host of viral transcription(GO:0043923) |
0.2 | 0.2 | GO:0009750 | response to fructose(GO:0009750) cellular response to fructose stimulus(GO:0071332) |
0.2 | 0.6 | GO:0031642 | negative regulation of myelination(GO:0031642) |
0.2 | 0.4 | GO:0035622 | intrahepatic bile duct development(GO:0035622) |
0.2 | 1.1 | GO:0006104 | succinyl-CoA metabolic process(GO:0006104) |
0.2 | 0.6 | GO:0046628 | positive regulation of insulin receptor signaling pathway(GO:0046628) |
0.2 | 0.4 | GO:0032621 | interleukin-18 production(GO:0032621) |
0.2 | 2.8 | GO:0071539 | protein localization to centrosome(GO:0071539) |
0.2 | 1.5 | GO:0035269 | protein O-linked mannosylation(GO:0035269) |
0.2 | 1.7 | GO:0045945 | positive regulation of transcription from RNA polymerase III promoter(GO:0045945) |
0.2 | 0.4 | GO:0046391 | 5-phosphoribose 1-diphosphate biosynthetic process(GO:0006015) 5-phosphoribose 1-diphosphate metabolic process(GO:0046391) |
0.2 | 0.9 | GO:0006384 | transcription initiation from RNA polymerase III promoter(GO:0006384) |
0.2 | 0.4 | GO:0071044 | histone mRNA catabolic process(GO:0071044) |
0.2 | 8.1 | GO:0030218 | erythrocyte differentiation(GO:0030218) |
0.2 | 1.7 | GO:0042574 | retinal metabolic process(GO:0042574) |
0.2 | 0.9 | GO:0006561 | proline biosynthetic process(GO:0006561) |
0.2 | 0.2 | GO:0042758 | long-chain fatty acid catabolic process(GO:0042758) |
0.2 | 0.7 | GO:0033574 | response to testosterone(GO:0033574) |
0.2 | 3.3 | GO:0046854 | phosphatidylinositol phosphorylation(GO:0046854) |
0.2 | 1.3 | GO:2000353 | positive regulation of endothelial cell apoptotic process(GO:2000353) |
0.2 | 2.5 | GO:0006607 | NLS-bearing protein import into nucleus(GO:0006607) |
0.2 | 0.7 | GO:0050975 | sensory perception of touch(GO:0050975) |
0.2 | 0.7 | GO:0006573 | valine metabolic process(GO:0006573) |
0.2 | 0.7 | GO:0060708 | spongiotrophoblast differentiation(GO:0060708) |
0.2 | 1.3 | GO:0051014 | actin filament severing(GO:0051014) |
0.2 | 1.6 | GO:0051292 | nuclear pore complex assembly(GO:0051292) |
0.2 | 2.5 | GO:0032007 | negative regulation of TOR signaling(GO:0032007) |
0.2 | 0.2 | GO:0035627 | ceramide transport(GO:0035627) |
0.2 | 0.5 | GO:0002525 | acute inflammatory response to non-antigenic stimulus(GO:0002525) |
0.2 | 1.3 | GO:0034498 | early endosome to Golgi transport(GO:0034498) |
0.2 | 3.6 | GO:0016180 | snRNA processing(GO:0016180) |
0.2 | 0.4 | GO:0042938 | dipeptide transport(GO:0042938) |
0.2 | 0.2 | GO:1901896 | positive regulation of calcium-transporting ATPase activity(GO:1901896) |
0.2 | 0.9 | GO:0042448 | progesterone metabolic process(GO:0042448) |
0.2 | 0.7 | GO:0032825 | positive regulation of natural killer cell differentiation(GO:0032825) |
0.2 | 0.7 | GO:0035999 | tetrahydrofolate interconversion(GO:0035999) |
0.2 | 0.5 | GO:0030951 | establishment or maintenance of microtubule cytoskeleton polarity(GO:0030951) |
0.2 | 0.9 | GO:0033152 | immunoglobulin V(D)J recombination(GO:0033152) |
0.2 | 0.5 | GO:1903334 | positive regulation of protein folding(GO:1903334) |
0.2 | 0.7 | GO:0090168 | Golgi reassembly(GO:0090168) |
0.2 | 0.2 | GO:0032435 | negative regulation of proteasomal ubiquitin-dependent protein catabolic process(GO:0032435) |
0.2 | 0.9 | GO:0048227 | plasma membrane to endosome transport(GO:0048227) |
0.2 | 0.5 | GO:0010960 | magnesium ion homeostasis(GO:0010960) |
0.2 | 0.3 | GO:0032000 | positive regulation of fatty acid beta-oxidation(GO:0032000) |
0.2 | 0.7 | GO:2000653 | regulation of genetic imprinting(GO:2000653) |
0.2 | 0.5 | GO:1904938 | dopaminergic neuron axon guidance(GO:0036514) planar cell polarity pathway involved in axon guidance(GO:1904938) |
0.2 | 0.2 | GO:0035166 | post-embryonic hemopoiesis(GO:0035166) |
0.2 | 0.5 | GO:0044375 | regulation of peroxisome size(GO:0044375) |
0.2 | 0.2 | GO:1900227 | positive regulation of NLRP3 inflammasome complex assembly(GO:1900227) |
0.2 | 1.0 | GO:0006265 | DNA topological change(GO:0006265) |
0.2 | 1.4 | GO:0090286 | cytoskeletal anchoring at nuclear membrane(GO:0090286) |
0.2 | 0.9 | GO:0051694 | pointed-end actin filament capping(GO:0051694) |
0.2 | 1.0 | GO:0009299 | mRNA transcription(GO:0009299) |
0.2 | 1.2 | GO:0090207 | regulation of triglyceride metabolic process(GO:0090207) |
0.2 | 0.5 | GO:0010499 | proteasomal ubiquitin-independent protein catabolic process(GO:0010499) |
0.2 | 1.5 | GO:0034497 | protein localization to pre-autophagosomal structure(GO:0034497) |
0.2 | 0.7 | GO:0042780 | tRNA 3'-end processing(GO:0042780) |
0.2 | 0.7 | GO:0036233 | glycine import(GO:0036233) |
0.2 | 0.7 | GO:1903964 | monounsaturated fatty acid metabolic process(GO:1903964) monounsaturated fatty acid biosynthetic process(GO:1903966) |
0.2 | 0.3 | GO:0018992 | germ-line sex determination(GO:0018992) |
0.2 | 0.3 | GO:0034729 | histone H3-K79 methylation(GO:0034729) |
0.2 | 0.2 | GO:1903599 | positive regulation of mitophagy(GO:1903599) |
0.2 | 0.3 | GO:0035751 | regulation of lysosomal lumen pH(GO:0035751) |
0.2 | 0.5 | GO:0006369 | termination of RNA polymerase II transcription(GO:0006369) |
0.2 | 0.5 | GO:0002414 | immunoglobulin transcytosis in epithelial cells(GO:0002414) |
0.2 | 2.0 | GO:0031952 | regulation of protein autophosphorylation(GO:0031952) |
0.2 | 0.3 | GO:0050427 | nucleoside bisphosphate biosynthetic process(GO:0033866) ribonucleoside bisphosphate biosynthetic process(GO:0034030) purine nucleoside bisphosphate biosynthetic process(GO:0034033) 3'-phosphoadenosine 5'-phosphosulfate metabolic process(GO:0050427) |
0.2 | 0.8 | GO:2000766 | negative regulation of cytoplasmic translation(GO:2000766) |
0.2 | 0.7 | GO:0006703 | estrogen biosynthetic process(GO:0006703) |
0.2 | 0.8 | GO:0070417 | cellular response to cold(GO:0070417) |
0.2 | 0.5 | GO:1903347 | negative regulation of bicellular tight junction assembly(GO:1903347) |
0.2 | 1.2 | GO:0006895 | Golgi to endosome transport(GO:0006895) |
0.2 | 1.2 | GO:0021903 | rostrocaudal neural tube patterning(GO:0021903) |
0.2 | 0.7 | GO:0031293 | membrane protein intracellular domain proteolysis(GO:0031293) |
0.2 | 0.2 | GO:0034374 | low-density lipoprotein particle remodeling(GO:0034374) |
0.2 | 2.3 | GO:0033119 | negative regulation of RNA splicing(GO:0033119) |
0.2 | 1.0 | GO:0017196 | N-terminal peptidyl-methionine acetylation(GO:0017196) |
0.2 | 3.2 | GO:0046626 | regulation of insulin receptor signaling pathway(GO:0046626) |
0.2 | 1.7 | GO:0010569 | regulation of double-strand break repair via homologous recombination(GO:0010569) |
0.2 | 0.5 | GO:0018199 | peptidyl-glutamine modification(GO:0018199) |
0.2 | 2.7 | GO:0033539 | fatty acid beta-oxidation using acyl-CoA dehydrogenase(GO:0033539) |
0.2 | 3.6 | GO:0000380 | alternative mRNA splicing, via spliceosome(GO:0000380) |
0.2 | 3.6 | GO:0000184 | nuclear-transcribed mRNA catabolic process, nonsense-mediated decay(GO:0000184) |
0.2 | 0.5 | GO:0072321 | chaperone-mediated protein transport(GO:0072321) |
0.2 | 1.1 | GO:0070935 | 3'-UTR-mediated mRNA stabilization(GO:0070935) |
0.2 | 0.2 | GO:0060050 | positive regulation of protein glycosylation(GO:0060050) |
0.2 | 0.7 | GO:0071711 | basement membrane organization(GO:0071711) |
0.2 | 1.0 | GO:0070493 | thrombin receptor signaling pathway(GO:0070493) |
0.2 | 0.2 | GO:0097212 | lysosomal membrane organization(GO:0097212) |
0.2 | 1.0 | GO:0006677 | glycosylceramide metabolic process(GO:0006677) |
0.2 | 0.3 | GO:2001185 | regulation of CD8-positive, alpha-beta T cell activation(GO:2001185) |
0.2 | 0.6 | GO:0051195 | negative regulation of glycolytic process(GO:0045820) negative regulation of cofactor metabolic process(GO:0051195) negative regulation of coenzyme metabolic process(GO:0051198) |
0.2 | 0.6 | GO:0090335 | regulation of brown fat cell differentiation(GO:0090335) |
0.2 | 1.3 | GO:0044130 | negative regulation of growth of symbiont in host(GO:0044130) negative regulation of growth of symbiont involved in interaction with host(GO:0044146) |
0.2 | 0.5 | GO:0090038 | negative regulation of protein kinase C signaling(GO:0090038) |
0.2 | 1.6 | GO:0010758 | regulation of macrophage chemotaxis(GO:0010758) |
0.2 | 1.0 | GO:0043117 | positive regulation of vascular permeability(GO:0043117) |
0.2 | 1.0 | GO:0031274 | positive regulation of pseudopodium assembly(GO:0031274) |
0.2 | 0.5 | GO:0016480 | negative regulation of transcription from RNA polymerase III promoter(GO:0016480) |
0.2 | 0.2 | GO:0072674 | multinuclear osteoclast differentiation(GO:0072674) |
0.2 | 0.3 | GO:0034377 | plasma lipoprotein particle assembly(GO:0034377) |
0.2 | 0.5 | GO:1902267 | polyamine transmembrane transport(GO:1902047) regulation of polyamine transmembrane transport(GO:1902267) |
0.2 | 0.3 | GO:0051256 | mitotic spindle elongation(GO:0000022) spindle elongation(GO:0051231) spindle midzone assembly(GO:0051255) mitotic spindle midzone assembly(GO:0051256) |
0.2 | 0.5 | GO:0072366 | regulation of cellular ketone metabolic process by positive regulation of transcription from RNA polymerase II promoter(GO:0072366) |
0.2 | 0.2 | GO:0086023 | adrenergic receptor signaling pathway involved in heart process(GO:0086023) |
0.2 | 0.9 | GO:2000058 | regulation of protein ubiquitination involved in ubiquitin-dependent protein catabolic process(GO:2000058) |
0.2 | 0.3 | GO:0015936 | coenzyme A metabolic process(GO:0015936) |
0.2 | 0.3 | GO:0010804 | negative regulation of tumor necrosis factor-mediated signaling pathway(GO:0010804) |
0.2 | 0.3 | GO:0015670 | carbon dioxide transport(GO:0015670) |
0.2 | 2.0 | GO:0015721 | bile acid and bile salt transport(GO:0015721) |
0.2 | 1.6 | GO:0009648 | photoperiodism(GO:0009648) |
0.2 | 0.5 | GO:0046512 | diol biosynthetic process(GO:0034312) sphingosine biosynthetic process(GO:0046512) |
0.2 | 0.6 | GO:0090084 | negative regulation of inclusion body assembly(GO:0090084) |
0.2 | 5.9 | GO:0032436 | positive regulation of proteasomal ubiquitin-dependent protein catabolic process(GO:0032436) |
0.2 | 0.3 | GO:0061635 | regulation of protein complex stability(GO:0061635) |
0.2 | 0.3 | GO:0097067 | cellular response to thyroid hormone stimulus(GO:0097067) |
0.2 | 2.9 | GO:0043484 | regulation of RNA splicing(GO:0043484) |
0.2 | 0.5 | GO:0030718 | germ-line stem cell population maintenance(GO:0030718) |
0.2 | 0.6 | GO:0072520 | seminiferous tubule development(GO:0072520) |
0.2 | 0.2 | GO:0070432 | regulation of nucleotide-binding oligomerization domain containing signaling pathway(GO:0070424) regulation of nucleotide-binding oligomerization domain containing 2 signaling pathway(GO:0070432) |
0.2 | 0.3 | GO:0072602 | interleukin-4 secretion(GO:0072602) |
0.2 | 1.2 | GO:0033598 | mammary gland epithelial cell proliferation(GO:0033598) |
0.2 | 1.1 | GO:0032042 | mitochondrial DNA metabolic process(GO:0032042) |
0.2 | 0.3 | GO:0050434 | positive regulation of viral transcription(GO:0050434) |
0.2 | 0.9 | GO:0071985 | multivesicular body sorting pathway(GO:0071985) |
0.2 | 0.3 | GO:0090074 | negative regulation of protein homodimerization activity(GO:0090074) |
0.2 | 0.8 | GO:0034501 | protein localization to kinetochore(GO:0034501) |
0.2 | 0.5 | GO:0006116 | NADH oxidation(GO:0006116) |
0.2 | 0.6 | GO:0097428 | protein maturation by iron-sulfur cluster transfer(GO:0097428) |
0.2 | 0.3 | GO:0090005 | negative regulation of establishment of protein localization to plasma membrane(GO:0090005) |
0.1 | 2.2 | GO:0006730 | one-carbon metabolic process(GO:0006730) |
0.1 | 2.8 | GO:0032611 | interleukin-1 beta production(GO:0032611) |
0.1 | 0.3 | GO:0051901 | positive regulation of mitochondrial depolarization(GO:0051901) |
0.1 | 3.4 | GO:0016239 | positive regulation of macroautophagy(GO:0016239) positive regulation of response to extracellular stimulus(GO:0032106) positive regulation of response to nutrient levels(GO:0032109) |
0.1 | 0.6 | GO:0007549 | dosage compensation(GO:0007549) dosage compensation by inactivation of X chromosome(GO:0009048) |
0.1 | 1.2 | GO:0051383 | kinetochore organization(GO:0051383) |
0.1 | 0.7 | GO:1902033 | regulation of hematopoietic stem cell proliferation(GO:1902033) |
0.1 | 0.4 | GO:0032227 | negative regulation of synaptic transmission, dopaminergic(GO:0032227) |
0.1 | 0.4 | GO:0046685 | response to arsenic-containing substance(GO:0046685) |
0.1 | 2.1 | GO:0071173 | mitotic spindle assembly checkpoint(GO:0007094) spindle assembly checkpoint(GO:0071173) |
0.1 | 0.1 | GO:0033634 | positive regulation of cell-cell adhesion mediated by integrin(GO:0033634) |
0.1 | 1.3 | GO:0000305 | response to oxygen radical(GO:0000305) |
0.1 | 12.2 | GO:0000398 | RNA splicing, via transesterification reactions with bulged adenosine as nucleophile(GO:0000377) mRNA splicing, via spliceosome(GO:0000398) |
0.1 | 0.7 | GO:0043173 | nucleotide salvage(GO:0043173) |
0.1 | 0.3 | GO:0045717 | negative regulation of fatty acid biosynthetic process(GO:0045717) |
0.1 | 0.1 | GO:0030050 | vesicle transport along actin filament(GO:0030050) |
0.1 | 0.6 | GO:0046697 | decidualization(GO:0046697) |
0.1 | 0.9 | GO:0000060 | protein import into nucleus, translocation(GO:0000060) |
0.1 | 0.1 | GO:0006344 | maintenance of chromatin silencing(GO:0006344) |
0.1 | 0.1 | GO:0039663 | fusion of virus membrane with host plasma membrane(GO:0019064) membrane fusion involved in viral entry into host cell(GO:0039663) multi-organism membrane fusion(GO:0044800) |
0.1 | 0.1 | GO:1901252 | regulation of intracellular transport of viral material(GO:1901252) |
0.1 | 0.7 | GO:0045723 | positive regulation of fatty acid biosynthetic process(GO:0045723) |
0.1 | 0.3 | GO:1900016 | negative regulation of cytokine production involved in inflammatory response(GO:1900016) |
0.1 | 1.1 | GO:1901185 | negative regulation of ERBB signaling pathway(GO:1901185) |
0.1 | 0.1 | GO:0043415 | positive regulation of skeletal muscle tissue regeneration(GO:0043415) |
0.1 | 0.3 | GO:0051344 | negative regulation of cyclic-nucleotide phosphodiesterase activity(GO:0051344) |
0.1 | 1.9 | GO:0070979 | protein K11-linked ubiquitination(GO:0070979) |
0.1 | 0.6 | GO:0001561 | fatty acid alpha-oxidation(GO:0001561) |
0.1 | 1.0 | GO:0070189 | kynurenine metabolic process(GO:0070189) |
0.1 | 0.3 | GO:0001798 | type IIa hypersensitivity(GO:0001794) regulation of type IIa hypersensitivity(GO:0001796) positive regulation of type IIa hypersensitivity(GO:0001798) type II hypersensitivity(GO:0002445) regulation of type II hypersensitivity(GO:0002892) positive regulation of type II hypersensitivity(GO:0002894) |
0.1 | 1.4 | GO:0035518 | histone H2A monoubiquitination(GO:0035518) |
0.1 | 1.6 | GO:0015693 | magnesium ion transport(GO:0015693) |
0.1 | 0.3 | GO:0006102 | isocitrate metabolic process(GO:0006102) |
0.1 | 0.4 | GO:0046341 | CDP-diacylglycerol metabolic process(GO:0046341) |
0.1 | 0.1 | GO:0030952 | establishment or maintenance of actin cytoskeleton polarity(GO:0030950) establishment or maintenance of cytoskeleton polarity(GO:0030952) |
0.1 | 0.1 | GO:0071501 | response to sterol depletion(GO:0006991) SREBP signaling pathway(GO:0032933) cellular response to sterol depletion(GO:0071501) |
0.1 | 1.3 | GO:0060670 | branching involved in labyrinthine layer morphogenesis(GO:0060670) |
0.1 | 3.1 | GO:0043044 | ATP-dependent chromatin remodeling(GO:0043044) |
0.1 | 0.8 | GO:0043457 | regulation of cellular respiration(GO:0043457) |
0.1 | 0.4 | GO:0006419 | alanyl-tRNA aminoacylation(GO:0006419) |
0.1 | 1.1 | GO:0006103 | 2-oxoglutarate metabolic process(GO:0006103) |
0.1 | 1.4 | GO:0030150 | protein import into mitochondrial matrix(GO:0030150) |
0.1 | 0.1 | GO:0035912 | dorsal aorta development(GO:0035907) dorsal aorta morphogenesis(GO:0035912) |
0.1 | 0.3 | GO:0032439 | endosome localization(GO:0032439) |
0.1 | 0.1 | GO:0002677 | negative regulation of chronic inflammatory response(GO:0002677) |
0.1 | 0.4 | GO:0090527 | actin filament reorganization(GO:0090527) |
0.1 | 0.1 | GO:0001828 | inner cell mass cell fate commitment(GO:0001827) inner cell mass cellular morphogenesis(GO:0001828) |
0.1 | 0.4 | GO:1900078 | positive regulation of cellular response to insulin stimulus(GO:1900078) |
0.1 | 0.3 | GO:0065001 | specification of axis polarity(GO:0065001) |
0.1 | 0.3 | GO:0002426 | immunoglobulin production in mucosal tissue(GO:0002426) |
0.1 | 0.3 | GO:0017187 | peptidyl-glutamic acid carboxylation(GO:0017187) |
0.1 | 0.4 | GO:1900165 | negative regulation of interleukin-6 secretion(GO:1900165) |
0.1 | 0.3 | GO:0033210 | leptin-mediated signaling pathway(GO:0033210) |
0.1 | 0.3 | GO:0046533 | negative regulation of photoreceptor cell differentiation(GO:0046533) |
0.1 | 5.1 | GO:0006888 | ER to Golgi vesicle-mediated transport(GO:0006888) |
0.1 | 2.2 | GO:1901184 | regulation of ERBB signaling pathway(GO:1901184) |
0.1 | 0.3 | GO:1903774 | positive regulation of viral budding via host ESCRT complex(GO:1903774) |
0.1 | 1.1 | GO:0042659 | regulation of cell fate specification(GO:0042659) |
0.1 | 0.1 | GO:0044793 | negative regulation by host of viral process(GO:0044793) |
0.1 | 0.1 | GO:0045650 | negative regulation of macrophage differentiation(GO:0045650) |
0.1 | 1.0 | GO:0090520 | sphingolipid mediated signaling pathway(GO:0090520) |
0.1 | 0.1 | GO:0015677 | copper ion import(GO:0015677) |
0.1 | 0.3 | GO:1990034 | calcium ion export from cell(GO:1990034) |
0.1 | 0.7 | GO:0006851 | mitochondrial calcium ion transport(GO:0006851) |
0.1 | 0.5 | GO:0019048 | modulation by virus of host morphology or physiology(GO:0019048) |
0.1 | 0.7 | GO:0061179 | negative regulation of insulin secretion involved in cellular response to glucose stimulus(GO:0061179) |
0.1 | 0.3 | GO:0019853 | L-ascorbic acid biosynthetic process(GO:0019853) |
0.1 | 0.4 | GO:0015014 | heparan sulfate proteoglycan biosynthetic process, polysaccharide chain biosynthetic process(GO:0015014) |
0.1 | 0.7 | GO:0071578 | zinc II ion transmembrane import(GO:0071578) |
0.1 | 0.4 | GO:0046643 | regulation of gamma-delta T cell differentiation(GO:0045586) regulation of gamma-delta T cell activation(GO:0046643) |
0.1 | 0.4 | GO:0006287 | base-excision repair, gap-filling(GO:0006287) |
0.1 | 0.5 | GO:0002820 | negative regulation of adaptive immune response(GO:0002820) |
0.1 | 0.5 | GO:0031468 | nuclear envelope reassembly(GO:0031468) |
0.1 | 0.4 | GO:0032066 | nucleolus to nucleoplasm transport(GO:0032066) |
0.1 | 0.3 | GO:0098700 | aminergic neurotransmitter loading into synaptic vesicle(GO:0015842) neurotransmitter loading into synaptic vesicle(GO:0098700) |
0.1 | 0.5 | GO:0015697 | quaternary ammonium group transport(GO:0015697) |
0.1 | 0.4 | GO:0034508 | centromere complex assembly(GO:0034508) |
0.1 | 0.3 | GO:0015889 | cobalamin transport(GO:0015889) |
0.1 | 0.1 | GO:0007000 | nucleolus organization(GO:0007000) |
0.1 | 0.8 | GO:0051639 | actin filament network formation(GO:0051639) |
0.1 | 0.4 | GO:0034421 | post-translational protein acetylation(GO:0034421) |
0.1 | 0.3 | GO:0043129 | surfactant homeostasis(GO:0043129) |
0.1 | 1.0 | GO:0044406 | adhesion of symbiont to host(GO:0044406) |
0.1 | 0.4 | GO:0010273 | detoxification of copper ion(GO:0010273) stress response to copper ion(GO:1990169) |
0.1 | 0.4 | GO:0072610 | interleukin-12 secretion(GO:0072610) regulation of interleukin-12 secretion(GO:2001182) positive regulation of interleukin-12 secretion(GO:2001184) |
0.1 | 0.1 | GO:0006610 | ribosomal protein import into nucleus(GO:0006610) |
0.1 | 0.6 | GO:0001992 | regulation of systemic arterial blood pressure by vasopressin(GO:0001992) |
0.1 | 1.8 | GO:0051123 | RNA polymerase II transcriptional preinitiation complex assembly(GO:0051123) |
0.1 | 0.1 | GO:0008535 | respiratory chain complex IV assembly(GO:0008535) |
0.1 | 0.6 | GO:0010955 | negative regulation of protein processing(GO:0010955) negative regulation of protein maturation(GO:1903318) |
0.1 | 0.1 | GO:0034375 | high-density lipoprotein particle remodeling(GO:0034375) |
0.1 | 0.9 | GO:0042347 | negative regulation of NF-kappaB import into nucleus(GO:0042347) |
0.1 | 0.5 | GO:0060330 | regulation of response to interferon-gamma(GO:0060330) |
0.1 | 0.1 | GO:1901674 | histone H3-K27 acetylation(GO:0043974) regulation of histone H3-K27 acetylation(GO:1901674) |
0.1 | 1.0 | GO:0042149 | cellular response to glucose starvation(GO:0042149) |
0.1 | 0.3 | GO:0006778 | porphyrin-containing compound metabolic process(GO:0006778) |
0.1 | 0.1 | GO:0010993 | regulation of ubiquitin homeostasis(GO:0010993) free ubiquitin chain polymerization(GO:0010994) |
0.1 | 0.1 | GO:0035630 | bone mineralization involved in bone maturation(GO:0035630) |
0.1 | 0.3 | GO:0060789 | hair follicle placode formation(GO:0060789) |
0.1 | 0.8 | GO:0033314 | mitotic DNA replication checkpoint(GO:0033314) |
0.1 | 1.1 | GO:0002183 | cytoplasmic translational initiation(GO:0002183) |
0.1 | 2.0 | GO:0050873 | brown fat cell differentiation(GO:0050873) |
0.1 | 0.5 | GO:0035589 | G-protein coupled purinergic nucleotide receptor signaling pathway(GO:0035589) |
0.1 | 0.1 | GO:0051029 | rRNA export from nucleus(GO:0006407) rRNA transport(GO:0051029) |
0.1 | 0.4 | GO:1904729 | regulation of intestinal cholesterol absorption(GO:0030300) regulation of intestinal lipid absorption(GO:1904729) |
0.1 | 0.6 | GO:0042559 | pteridine-containing compound biosynthetic process(GO:0042559) |
0.1 | 0.3 | GO:0018879 | biphenyl metabolic process(GO:0018879) |
0.1 | 0.1 | GO:0042364 | water-soluble vitamin biosynthetic process(GO:0042364) |
0.1 | 0.3 | GO:0046909 | intermembrane transport(GO:0046909) |
0.1 | 0.3 | GO:0090315 | negative regulation of protein targeting to membrane(GO:0090315) |
0.1 | 0.5 | GO:0032596 | protein transport into membrane raft(GO:0032596) |
0.1 | 0.2 | GO:0002254 | kinin cascade(GO:0002254) |
0.1 | 0.2 | GO:0000430 | regulation of transcription from RNA polymerase II promoter by glucose(GO:0000430) positive regulation of transcription from RNA polymerase II promoter by glucose(GO:0000432) |
0.1 | 2.5 | GO:0000470 | maturation of LSU-rRNA(GO:0000470) |
0.1 | 0.7 | GO:0042026 | protein refolding(GO:0042026) |
0.1 | 0.4 | GO:1904491 | protein localization to ciliary transition zone(GO:1904491) |
0.1 | 1.4 | GO:0036158 | outer dynein arm assembly(GO:0036158) |
0.1 | 0.4 | GO:0046292 | formaldehyde metabolic process(GO:0046292) |
0.1 | 0.1 | GO:0019626 | short-chain fatty acid catabolic process(GO:0019626) |
0.1 | 2.3 | GO:0060976 | coronary vasculature development(GO:0060976) |
0.1 | 0.1 | GO:0002741 | positive regulation of cytokine secretion involved in immune response(GO:0002741) |
0.1 | 0.2 | GO:0045636 | positive regulation of melanocyte differentiation(GO:0045636) |
0.1 | 0.4 | GO:0033160 | positive regulation of protein import into nucleus, translocation(GO:0033160) |
0.1 | 0.4 | GO:1902897 | regulation of postsynaptic density protein 95 clustering(GO:1902897) |
0.1 | 0.1 | GO:0051025 | negative regulation of immunoglobulin secretion(GO:0051025) |
0.1 | 0.7 | GO:0033136 | serine phosphorylation of STAT3 protein(GO:0033136) |
0.1 | 0.6 | GO:0018401 | peptidyl-proline hydroxylation to 4-hydroxy-L-proline(GO:0018401) |
0.1 | 0.2 | GO:0051315 | attachment of mitotic spindle microtubules to kinetochore(GO:0051315) |
0.1 | 0.4 | GO:0002828 | regulation of type 2 immune response(GO:0002828) |
0.1 | 0.4 | GO:0010039 | response to iron ion(GO:0010039) |
0.1 | 0.6 | GO:0071480 | cellular response to gamma radiation(GO:0071480) |
0.1 | 5.4 | GO:0051028 | mRNA transport(GO:0051028) |
0.1 | 0.2 | GO:0001915 | negative regulation of T cell mediated cytotoxicity(GO:0001915) |
0.1 | 0.4 | GO:0039694 | viral RNA genome replication(GO:0039694) RNA replication(GO:0039703) |
0.1 | 0.4 | GO:0006167 | AMP biosynthetic process(GO:0006167) |
0.1 | 0.4 | GO:0032486 | Rap protein signal transduction(GO:0032486) |
0.1 | 0.5 | GO:0035188 | blastocyst hatching(GO:0001835) hatching(GO:0035188) organism emergence from protective structure(GO:0071684) |
0.1 | 0.5 | GO:0044803 | multi-organism membrane organization(GO:0044803) |
0.1 | 0.1 | GO:0090259 | regulation of retinal ganglion cell axon guidance(GO:0090259) |
0.1 | 0.1 | GO:1901976 | regulation of spindle checkpoint(GO:0090231) regulation of cell cycle checkpoint(GO:1901976) |
0.1 | 0.1 | GO:0035426 | extracellular matrix-cell signaling(GO:0035426) |
0.1 | 0.5 | GO:0035735 | intraciliary transport involved in cilium morphogenesis(GO:0035735) |
0.1 | 0.6 | GO:0071803 | positive regulation of podosome assembly(GO:0071803) |
0.1 | 0.2 | GO:0048291 | isotype switching to IgG isotypes(GO:0048291) |
0.1 | 0.1 | GO:0019852 | L-ascorbic acid metabolic process(GO:0019852) |
0.1 | 0.2 | GO:0061146 | Peyer's patch morphogenesis(GO:0061146) |
0.1 | 1.4 | GO:0042771 | intrinsic apoptotic signaling pathway in response to DNA damage by p53 class mediator(GO:0042771) |
0.1 | 0.1 | GO:2000491 | positive regulation of hepatic stellate cell activation(GO:2000491) |
0.1 | 0.6 | GO:0001832 | blastocyst growth(GO:0001832) |
0.1 | 0.7 | GO:0070525 | tRNA threonylcarbamoyladenosine metabolic process(GO:0070525) |
0.1 | 0.2 | GO:0071243 | cellular response to arsenic-containing substance(GO:0071243) |
0.1 | 0.7 | GO:0051124 | synaptic growth at neuromuscular junction(GO:0051124) |
0.1 | 0.2 | GO:0002551 | mast cell chemotaxis(GO:0002551) |
0.1 | 0.1 | GO:0001887 | selenium compound metabolic process(GO:0001887) |
0.1 | 1.1 | GO:0008053 | mitochondrial fusion(GO:0008053) |
0.1 | 0.2 | GO:0030520 | intracellular estrogen receptor signaling pathway(GO:0030520) |
0.1 | 0.3 | GO:0033014 | porphyrin-containing compound biosynthetic process(GO:0006779) tetrapyrrole biosynthetic process(GO:0033014) |
0.1 | 0.7 | GO:0071318 | cellular response to ATP(GO:0071318) |
0.1 | 0.5 | GO:0032099 | negative regulation of appetite(GO:0032099) |
0.1 | 0.1 | GO:0014010 | Schwann cell proliferation(GO:0014010) |
0.1 | 0.9 | GO:0046686 | response to cadmium ion(GO:0046686) |
0.1 | 1.0 | GO:0002347 | response to tumor cell(GO:0002347) |
0.1 | 0.1 | GO:1901524 | regulation of macromitophagy(GO:1901524) |
0.1 | 0.6 | GO:0042554 | superoxide anion generation(GO:0042554) |
0.1 | 0.8 | GO:0097286 | iron ion import(GO:0097286) |
0.1 | 0.3 | GO:0060631 | regulation of meiosis I(GO:0060631) |
0.1 | 0.3 | GO:0070966 | nuclear-transcribed mRNA catabolic process, no-go decay(GO:0070966) |
0.1 | 0.2 | GO:1900745 | positive regulation of p38MAPK cascade(GO:1900745) |
0.1 | 0.6 | GO:0036010 | protein localization to endosome(GO:0036010) |
0.1 | 0.6 | GO:0032785 | negative regulation of DNA-templated transcription, elongation(GO:0032785) |
0.1 | 0.2 | GO:0060414 | aorta smooth muscle tissue morphogenesis(GO:0060414) |
0.1 | 1.2 | GO:1900026 | positive regulation of substrate adhesion-dependent cell spreading(GO:1900026) |
0.1 | 1.2 | GO:0014733 | regulation of skeletal muscle adaptation(GO:0014733) |
0.1 | 0.6 | GO:0006801 | superoxide metabolic process(GO:0006801) |
0.1 | 1.1 | GO:0006465 | signal peptide processing(GO:0006465) |
0.1 | 1.0 | GO:0030826 | regulation of cGMP biosynthetic process(GO:0030826) |
0.1 | 0.1 | GO:0002645 | positive regulation of tolerance induction(GO:0002645) |
0.1 | 1.4 | GO:0006891 | intra-Golgi vesicle-mediated transport(GO:0006891) |
0.1 | 0.2 | GO:0006450 | regulation of translational fidelity(GO:0006450) |
0.1 | 0.7 | GO:0060712 | spongiotrophoblast layer development(GO:0060712) |
0.1 | 0.8 | GO:0034340 | response to type I interferon(GO:0034340) |
0.1 | 0.3 | GO:0036066 | protein O-linked fucosylation(GO:0036066) |
0.1 | 0.4 | GO:0006646 | phosphatidylethanolamine biosynthetic process(GO:0006646) |
0.1 | 0.4 | GO:0007217 | tachykinin receptor signaling pathway(GO:0007217) |
0.1 | 0.2 | GO:0036123 | histone H3-K9 dimethylation(GO:0036123) |
0.1 | 0.4 | GO:0033623 | regulation of integrin activation(GO:0033623) |
0.1 | 1.1 | GO:1902042 | negative regulation of extrinsic apoptotic signaling pathway via death domain receptors(GO:1902042) |
0.1 | 0.1 | GO:0032747 | positive regulation of interleukin-23 production(GO:0032747) |
0.1 | 0.3 | GO:0032769 | negative regulation of monooxygenase activity(GO:0032769) |
0.1 | 1.0 | GO:0060009 | Sertoli cell development(GO:0060009) |
0.1 | 0.4 | GO:0001867 | complement activation, lectin pathway(GO:0001867) |
0.1 | 0.3 | GO:0000447 | endonucleolytic cleavage in ITS1 to separate SSU-rRNA from 5.8S rRNA and LSU-rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000447) |
0.1 | 0.1 | GO:0060112 | generation of ovulation cycle rhythm(GO:0060112) |
0.1 | 1.0 | GO:0046326 | positive regulation of glucose import(GO:0046326) |
0.1 | 1.3 | GO:0051220 | cytoplasmic sequestering of protein(GO:0051220) |
0.1 | 0.1 | GO:0032898 | neurotrophin production(GO:0032898) |
0.1 | 0.3 | GO:0051973 | positive regulation of telomerase activity(GO:0051973) |
0.1 | 0.4 | GO:0045063 | T-helper 1 cell differentiation(GO:0045063) |
0.1 | 0.6 | GO:0060294 | cilium movement involved in cell motility(GO:0060294) |
0.1 | 0.4 | GO:0034975 | protein folding in endoplasmic reticulum(GO:0034975) |
0.1 | 0.1 | GO:1903026 | negative regulation of RNA polymerase II regulatory region sequence-specific DNA binding(GO:1903026) |
0.1 | 0.1 | GO:0042769 | DNA damage response, detection of DNA damage(GO:0042769) |
0.1 | 0.1 | GO:0010482 | epidermal cell division(GO:0010481) regulation of epidermal cell division(GO:0010482) |
0.1 | 0.3 | GO:0003084 | positive regulation of systemic arterial blood pressure(GO:0003084) |
0.1 | 1.0 | GO:0000154 | rRNA modification(GO:0000154) |
0.1 | 0.3 | GO:0051310 | metaphase plate congression(GO:0051310) |
0.1 | 0.1 | GO:0016539 | intein-mediated protein splicing(GO:0016539) protein splicing(GO:0030908) |
0.1 | 1.1 | GO:0050892 | intestinal absorption(GO:0050892) |
0.1 | 0.3 | GO:0009826 | unidimensional cell growth(GO:0009826) |
0.1 | 0.6 | GO:0035520 | monoubiquitinated protein deubiquitination(GO:0035520) |
0.1 | 0.1 | GO:0055059 | asymmetric neuroblast division(GO:0055059) |
0.1 | 0.6 | GO:0034390 | smooth muscle cell apoptotic process(GO:0034390) regulation of smooth muscle cell apoptotic process(GO:0034391) |
0.1 | 0.2 | GO:0043489 | RNA stabilization(GO:0043489) |
0.1 | 1.1 | GO:0000186 | activation of MAPKK activity(GO:0000186) |
0.1 | 0.5 | GO:0061299 | retina vasculature morphogenesis in camera-type eye(GO:0061299) |
0.1 | 0.5 | GO:0050651 | dermatan sulfate proteoglycan biosynthetic process(GO:0050651) |
0.1 | 0.2 | GO:0032095 | regulation of response to food(GO:0032095) |
0.1 | 5.0 | GO:1903955 | positive regulation of protein targeting to mitochondrion(GO:1903955) |
0.1 | 0.2 | GO:0097320 | membrane tubulation(GO:0097320) |
0.1 | 0.1 | GO:0033127 | regulation of histone phosphorylation(GO:0033127) |
0.1 | 0.3 | GO:0031053 | primary miRNA processing(GO:0031053) |
0.1 | 0.1 | GO:0034773 | histone H4-K20 trimethylation(GO:0034773) |
0.1 | 0.3 | GO:0071071 | regulation of phospholipid biosynthetic process(GO:0071071) |
0.1 | 0.1 | GO:0060353 | regulation of cell adhesion molecule production(GO:0060353) |
0.1 | 0.7 | GO:0019432 | triglyceride biosynthetic process(GO:0019432) |
0.1 | 0.1 | GO:0060744 | thelarche(GO:0042695) mammary gland branching involved in thelarche(GO:0060744) |
0.1 | 0.7 | GO:0007080 | mitotic metaphase plate congression(GO:0007080) |
0.1 | 0.4 | GO:1901223 | negative regulation of NIK/NF-kappaB signaling(GO:1901223) |
0.1 | 3.6 | GO:0006749 | glutathione metabolic process(GO:0006749) |
0.1 | 0.2 | GO:0061502 | early endosome to recycling endosome transport(GO:0061502) |
0.1 | 1.3 | GO:0036342 | post-anal tail morphogenesis(GO:0036342) |
0.1 | 0.5 | GO:2000096 | positive regulation of Wnt signaling pathway, planar cell polarity pathway(GO:2000096) |
0.1 | 0.7 | GO:0090181 | regulation of cholesterol metabolic process(GO:0090181) |
0.1 | 0.2 | GO:0002291 | T cell activation via T cell receptor contact with antigen bound to MHC molecule on antigen presenting cell(GO:0002291) |
0.1 | 0.6 | GO:0072673 | lamellipodium morphogenesis(GO:0072673) |
0.1 | 0.4 | GO:0000076 | DNA replication checkpoint(GO:0000076) |
0.1 | 1.8 | GO:0008089 | anterograde axonal transport(GO:0008089) |
0.1 | 0.3 | GO:0032534 | regulation of microvillus assembly(GO:0032534) |
0.1 | 0.4 | GO:0045838 | positive regulation of membrane potential(GO:0045838) |
0.1 | 0.1 | GO:0006337 | nucleosome disassembly(GO:0006337) chromatin disassembly(GO:0031498) protein-DNA complex disassembly(GO:0032986) |
0.1 | 0.4 | GO:1902402 | signal transduction involved in mitotic cell cycle checkpoint(GO:0072413) signal transduction involved in mitotic G1 DNA damage checkpoint(GO:0072431) intracellular signal transduction involved in G1 DNA damage checkpoint(GO:1902400) signal transduction involved in mitotic DNA damage checkpoint(GO:1902402) signal transduction involved in mitotic DNA integrity checkpoint(GO:1902403) |
0.1 | 0.3 | GO:0002082 | regulation of oxidative phosphorylation(GO:0002082) |
0.1 | 0.3 | GO:0046339 | diacylglycerol metabolic process(GO:0046339) |
0.1 | 2.1 | GO:0007569 | cell aging(GO:0007569) |
0.1 | 0.1 | GO:1902186 | regulation of viral release from host cell(GO:1902186) |
0.1 | 0.2 | GO:0034587 | piRNA metabolic process(GO:0034587) |
0.1 | 0.1 | GO:0070198 | protein localization to chromosome, telomeric region(GO:0070198) |
0.1 | 0.1 | GO:0060416 | response to growth hormone(GO:0060416) |
0.1 | 0.2 | GO:0060087 | relaxation of vascular smooth muscle(GO:0060087) |
0.1 | 1.1 | GO:0006182 | cGMP biosynthetic process(GO:0006182) |
0.1 | 0.2 | GO:1902031 | regulation of NADP metabolic process(GO:1902031) |
0.1 | 0.2 | GO:0046598 | positive regulation of viral entry into host cell(GO:0046598) |
0.1 | 0.3 | GO:1904357 | negative regulation of telomere maintenance via telomere lengthening(GO:1904357) |
0.1 | 1.5 | GO:0060325 | face morphogenesis(GO:0060325) |
0.1 | 0.7 | GO:0045943 | positive regulation of transcription from RNA polymerase I promoter(GO:0045943) |
0.1 | 0.2 | GO:0050765 | negative regulation of phagocytosis(GO:0050765) |
0.1 | 0.2 | GO:0035811 | negative regulation of urine volume(GO:0035811) |
0.1 | 0.3 | GO:0001522 | pseudouridine synthesis(GO:0001522) |
0.1 | 0.1 | GO:0032725 | positive regulation of granulocyte macrophage colony-stimulating factor production(GO:0032725) |
0.1 | 0.9 | GO:0050860 | negative regulation of T cell receptor signaling pathway(GO:0050860) |
0.1 | 0.4 | GO:0014848 | urinary tract smooth muscle contraction(GO:0014848) |
0.1 | 0.2 | GO:0071218 | cellular response to misfolded protein(GO:0071218) |
0.1 | 0.8 | GO:0016446 | somatic hypermutation of immunoglobulin genes(GO:0016446) |
0.1 | 0.3 | GO:0046951 | ketone body biosynthetic process(GO:0046951) |
0.1 | 0.8 | GO:0009225 | nucleotide-sugar metabolic process(GO:0009225) |
0.1 | 0.3 | GO:1901660 | calcium ion export(GO:1901660) |
0.1 | 0.8 | GO:0070129 | regulation of mitochondrial translation(GO:0070129) |
0.1 | 0.5 | GO:0019720 | Mo-molybdopterin cofactor biosynthetic process(GO:0006777) Mo-molybdopterin cofactor metabolic process(GO:0019720) molybdopterin cofactor biosynthetic process(GO:0032324) molybdopterin cofactor metabolic process(GO:0043545) prosthetic group metabolic process(GO:0051189) |
0.1 | 2.9 | GO:0030168 | platelet activation(GO:0030168) |
0.1 | 0.5 | GO:0009191 | ribonucleoside diphosphate catabolic process(GO:0009191) |
0.1 | 0.8 | GO:0006123 | mitochondrial electron transport, cytochrome c to oxygen(GO:0006123) |
0.1 | 0.5 | GO:0070327 | thyroid hormone transport(GO:0070327) |
0.1 | 1.1 | GO:1901796 | regulation of signal transduction by p53 class mediator(GO:1901796) |
0.1 | 0.2 | GO:2000637 | positive regulation of posttranscriptional gene silencing(GO:0060148) positive regulation of gene silencing by miRNA(GO:2000637) |
0.1 | 0.1 | GO:0023035 | CD40 signaling pathway(GO:0023035) |
0.1 | 0.2 | GO:0046641 | positive regulation of alpha-beta T cell proliferation(GO:0046641) |
0.1 | 0.1 | GO:2000562 | CD4-positive, alpha-beta T cell proliferation(GO:0035739) regulation of CD4-positive, alpha-beta T cell proliferation(GO:2000561) negative regulation of CD4-positive, alpha-beta T cell proliferation(GO:2000562) |
0.1 | 0.2 | GO:0034242 | negative regulation of syncytium formation by plasma membrane fusion(GO:0034242) |
0.1 | 0.8 | GO:0030261 | chromosome condensation(GO:0030261) |
0.1 | 0.9 | GO:0006383 | transcription from RNA polymerase III promoter(GO:0006383) |
0.1 | 0.1 | GO:0030656 | regulation of vitamin metabolic process(GO:0030656) |
0.1 | 1.2 | GO:0019835 | cytolysis(GO:0019835) |
0.1 | 0.5 | GO:0002002 | regulation of angiotensin levels in blood(GO:0002002) |
0.1 | 1.6 | GO:0043631 | mRNA polyadenylation(GO:0006378) RNA polyadenylation(GO:0043631) |
0.1 | 0.1 | GO:0046621 | negative regulation of organ growth(GO:0046621) |
0.1 | 0.1 | GO:0042891 | antibiotic transport(GO:0042891) |
0.1 | 0.1 | GO:0051799 | negative regulation of hair follicle development(GO:0051799) |
0.1 | 0.3 | GO:0010216 | maintenance of DNA methylation(GO:0010216) |
0.1 | 2.9 | GO:0050821 | protein stabilization(GO:0050821) |
0.1 | 0.4 | GO:0010390 | histone monoubiquitination(GO:0010390) |
0.1 | 0.1 | GO:0040009 | regulation of growth rate(GO:0040009) |
0.1 | 0.5 | GO:0032310 | prostaglandin secretion(GO:0032310) |
0.1 | 0.3 | GO:0015819 | lysine transport(GO:0015819) |
0.1 | 0.2 | GO:0090343 | positive regulation of cell aging(GO:0090343) |
0.1 | 0.2 | GO:0010893 | positive regulation of steroid biosynthetic process(GO:0010893) |
0.1 | 0.6 | GO:1904358 | positive regulation of telomere maintenance via telomere lengthening(GO:1904358) |
0.1 | 0.1 | GO:0048070 | regulation of developmental pigmentation(GO:0048070) |
0.1 | 1.5 | GO:0010761 | fibroblast migration(GO:0010761) |
0.1 | 0.1 | GO:0061668 | mitochondrial ribosome assembly(GO:0061668) |
0.1 | 0.2 | GO:0045821 | positive regulation of nucleotide catabolic process(GO:0030813) positive regulation of glycolytic process(GO:0045821) |
0.1 | 1.9 | GO:0002181 | cytoplasmic translation(GO:0002181) |
0.1 | 0.1 | GO:2000836 | androgen secretion(GO:0035935) regulation of androgen secretion(GO:2000834) positive regulation of androgen secretion(GO:2000836) |
0.1 | 0.3 | GO:0045579 | positive regulation of B cell differentiation(GO:0045579) |
0.1 | 0.4 | GO:0060158 | phospholipase C-activating dopamine receptor signaling pathway(GO:0060158) |
0.1 | 0.3 | GO:0070862 | negative regulation of protein exit from endoplasmic reticulum(GO:0070862) negative regulation of retrograde protein transport, ER to cytosol(GO:1904153) negative regulation of ERAD pathway(GO:1904293) |
0.1 | 0.1 | GO:0046349 | amino sugar biosynthetic process(GO:0046349) |
0.1 | 0.1 | GO:0016561 | protein import into peroxisome matrix, translocation(GO:0016561) |
0.1 | 0.7 | GO:0071549 | cellular response to dexamethasone stimulus(GO:0071549) |
0.1 | 2.6 | GO:0006338 | chromatin remodeling(GO:0006338) |
0.1 | 2.9 | GO:0031396 | regulation of protein ubiquitination(GO:0031396) |
0.1 | 0.1 | GO:0042537 | benzene-containing compound metabolic process(GO:0042537) |
0.1 | 0.6 | GO:0010591 | regulation of lamellipodium assembly(GO:0010591) |
0.1 | 0.4 | GO:0046836 | glycolipid transport(GO:0046836) |
0.1 | 1.3 | GO:0072332 | intrinsic apoptotic signaling pathway by p53 class mediator(GO:0072332) |
0.1 | 0.2 | GO:1905098 | negative regulation of guanyl-nucleotide exchange factor activity(GO:1905098) |
0.1 | 0.2 | GO:0006896 | Golgi to vacuole transport(GO:0006896) |
0.1 | 0.1 | GO:0035973 | aggrephagy(GO:0035973) |
0.1 | 0.2 | GO:1903025 | regulation of RNA polymerase II regulatory region sequence-specific DNA binding(GO:1903025) |
0.1 | 0.3 | GO:0015744 | succinate transport(GO:0015744) |
0.1 | 0.4 | GO:0002441 | histamine production involved in inflammatory response(GO:0002349) histamine secretion involved in inflammatory response(GO:0002441) histamine secretion by mast cell(GO:0002553) |
0.1 | 2.0 | GO:0006958 | complement activation, classical pathway(GO:0006958) |
0.1 | 0.1 | GO:0060842 | arterial endothelial cell differentiation(GO:0060842) |
0.1 | 0.1 | GO:1901163 | regulation of trophoblast cell migration(GO:1901163) |
0.1 | 0.3 | GO:0048312 | intracellular distribution of mitochondria(GO:0048312) |
0.1 | 0.1 | GO:0034146 | toll-like receptor 5 signaling pathway(GO:0034146) |
0.1 | 0.1 | GO:0051964 | negative regulation of synapse assembly(GO:0051964) |
0.1 | 0.3 | GO:0030321 | transepithelial chloride transport(GO:0030321) |
0.1 | 0.2 | GO:0048388 | endosomal lumen acidification(GO:0048388) |
0.1 | 1.4 | GO:0006099 | tricarboxylic acid cycle(GO:0006099) |
0.1 | 1.2 | GO:0035329 | hippo signaling(GO:0035329) |
0.1 | 0.1 | GO:0033004 | negative regulation of mast cell activation(GO:0033004) |
0.1 | 0.2 | GO:0046337 | phosphatidylcholine catabolic process(GO:0034638) phosphatidylethanolamine metabolic process(GO:0046337) |
0.1 | 0.1 | GO:0046602 | regulation of mitotic centrosome separation(GO:0046602) |
0.1 | 0.3 | GO:1901029 | negative regulation of mitochondrial outer membrane permeabilization involved in apoptotic signaling pathway(GO:1901029) |
0.1 | 0.3 | GO:0033234 | negative regulation of protein sumoylation(GO:0033234) |
0.1 | 0.3 | GO:0046475 | glycerophospholipid catabolic process(GO:0046475) |
0.1 | 0.3 | GO:0006370 | 7-methylguanosine mRNA capping(GO:0006370) |
0.1 | 0.4 | GO:0032098 | regulation of appetite(GO:0032098) |
0.1 | 0.4 | GO:0051570 | regulation of histone H3-K9 methylation(GO:0051570) |
0.1 | 0.2 | GO:0022007 | neural plate elongation(GO:0014022) convergent extension involved in neural plate elongation(GO:0022007) |
0.1 | 0.2 | GO:0016554 | cytidine to uridine editing(GO:0016554) |
0.1 | 0.8 | GO:0006513 | protein monoubiquitination(GO:0006513) |
0.1 | 0.2 | GO:0043101 | purine-containing compound salvage(GO:0043101) |
0.1 | 0.1 | GO:0060439 | trachea morphogenesis(GO:0060439) |
0.1 | 0.1 | GO:0040033 | negative regulation of translation, ncRNA-mediated(GO:0040033) regulation of translation, ncRNA-mediated(GO:0045974) |
0.1 | 0.1 | GO:0000966 | RNA 5'-end processing(GO:0000966) |
0.1 | 0.2 | GO:0045651 | positive regulation of macrophage differentiation(GO:0045651) |
0.1 | 1.8 | GO:0001824 | blastocyst development(GO:0001824) |
0.1 | 0.3 | GO:0044380 | protein localization to cytoskeleton(GO:0044380) |
0.1 | 4.1 | GO:0008033 | tRNA processing(GO:0008033) |
0.1 | 0.5 | GO:0048757 | endosome to melanosome transport(GO:0035646) endosome to pigment granule transport(GO:0043485) pigment granule maturation(GO:0048757) |
0.1 | 0.2 | GO:0034134 | toll-like receptor 2 signaling pathway(GO:0034134) |
0.1 | 0.2 | GO:0090042 | tubulin deacetylation(GO:0090042) |
0.1 | 0.5 | GO:0071468 | cellular response to acidic pH(GO:0071468) |
0.1 | 0.2 | GO:0018125 | peptidyl-cysteine methylation(GO:0018125) |
0.1 | 0.2 | GO:1903052 | positive regulation of proteolysis involved in cellular protein catabolic process(GO:1903052) |
0.1 | 1.4 | GO:0034314 | Arp2/3 complex-mediated actin nucleation(GO:0034314) |
0.1 | 3.1 | GO:0043039 | tRNA aminoacylation(GO:0043039) |
0.1 | 0.1 | GO:0045064 | T-helper 2 cell differentiation(GO:0045064) |
0.1 | 1.9 | GO:0009108 | coenzyme biosynthetic process(GO:0009108) |
0.1 | 0.2 | GO:1902715 | positive regulation of interferon-gamma secretion(GO:1902715) |
0.1 | 0.3 | GO:0061462 | protein localization to lysosome(GO:0061462) |
0.1 | 1.0 | GO:1901222 | regulation of NIK/NF-kappaB signaling(GO:1901222) |
0.1 | 0.1 | GO:0032971 | regulation of muscle filament sliding(GO:0032971) |
0.1 | 0.2 | GO:0061589 | calcium activated phosphatidylserine scrambling(GO:0061589) |
0.1 | 0.4 | GO:0080182 | histone H3-K4 trimethylation(GO:0080182) |
0.1 | 0.1 | GO:2000286 | receptor internalization involved in canonical Wnt signaling pathway(GO:2000286) |
0.1 | 0.1 | GO:0034454 | microtubule anchoring at centrosome(GO:0034454) |
0.1 | 0.2 | GO:0060394 | negative regulation of pathway-restricted SMAD protein phosphorylation(GO:0060394) |
0.1 | 0.2 | GO:0019086 | late viral transcription(GO:0019086) |
0.1 | 0.1 | GO:0090594 | wound healing involved in inflammatory response(GO:0002246) connective tissue replacement involved in inflammatory response wound healing(GO:0002248) inflammatory response to wounding(GO:0090594) connective tissue replacement(GO:0097709) |
0.1 | 0.1 | GO:0070459 | prolactin secretion(GO:0070459) |
0.1 | 0.2 | GO:1903224 | regulation of endodermal cell differentiation(GO:1903224) negative regulation of endodermal cell differentiation(GO:1903225) |
0.1 | 0.6 | GO:0052646 | alditol phosphate metabolic process(GO:0052646) |
0.1 | 1.1 | GO:0032467 | positive regulation of cytokinesis(GO:0032467) |
0.1 | 0.7 | GO:0035458 | cellular response to interferon-beta(GO:0035458) |
0.1 | 0.1 | GO:0034035 | purine ribonucleoside bisphosphate metabolic process(GO:0034035) |
0.1 | 0.2 | GO:0009629 | response to gravity(GO:0009629) |
0.1 | 0.1 | GO:0042348 | regulation of NF-kappaB import into nucleus(GO:0042345) NF-kappaB import into nucleus(GO:0042348) |
0.1 | 0.2 | GO:0072364 | regulation of cellular ketone metabolic process by regulation of transcription from RNA polymerase II promoter(GO:0072364) |
0.1 | 1.6 | GO:0010501 | RNA secondary structure unwinding(GO:0010501) |
0.1 | 0.1 | GO:0010701 | positive regulation of norepinephrine secretion(GO:0010701) |
0.1 | 0.2 | GO:0030579 | ubiquitin-dependent SMAD protein catabolic process(GO:0030579) |
0.1 | 0.1 | GO:0051106 | regulation of DNA ligation(GO:0051105) positive regulation of DNA ligation(GO:0051106) |
0.1 | 0.6 | GO:0032965 | regulation of collagen biosynthetic process(GO:0032965) |
0.1 | 2.7 | GO:0006352 | DNA-templated transcription, initiation(GO:0006352) |
0.1 | 0.1 | GO:0044246 | regulation of collagen metabolic process(GO:0010712) regulation of multicellular organismal metabolic process(GO:0044246) |
0.1 | 4.7 | GO:0016579 | protein deubiquitination(GO:0016579) |
0.1 | 0.1 | GO:0044336 | canonical Wnt signaling pathway involved in negative regulation of apoptotic process(GO:0044336) |
0.1 | 0.1 | GO:0061535 | glutamate secretion, neurotransmission(GO:0061535) |
0.1 | 0.2 | GO:0032788 | saturated monocarboxylic acid metabolic process(GO:0032788) unsaturated monocarboxylic acid metabolic process(GO:0032789) |
0.1 | 0.2 | GO:0031665 | negative regulation of lipopolysaccharide-mediated signaling pathway(GO:0031665) |
0.1 | 3.0 | GO:0007030 | Golgi organization(GO:0007030) |
0.1 | 0.2 | GO:0070828 | heterochromatin organization(GO:0070828) |
0.1 | 0.1 | GO:0006213 | pyrimidine nucleoside metabolic process(GO:0006213) |
0.1 | 0.2 | GO:0032527 | protein exit from endoplasmic reticulum(GO:0032527) |
0.1 | 0.1 | GO:0051387 | negative regulation of neurotrophin TRK receptor signaling pathway(GO:0051387) |
0.1 | 0.6 | GO:0009303 | rRNA transcription(GO:0009303) |
0.1 | 1.7 | GO:0010950 | positive regulation of endopeptidase activity(GO:0010950) |
0.1 | 4.9 | GO:0006457 | protein folding(GO:0006457) |
0.1 | 2.6 | GO:0007596 | blood coagulation(GO:0007596) |
0.1 | 0.4 | GO:0007343 | egg activation(GO:0007343) |
0.1 | 0.2 | GO:1904659 | glucose transmembrane transport(GO:1904659) |
0.1 | 0.2 | GO:0098535 | de novo centriole assembly(GO:0098535) |
0.1 | 1.0 | GO:0045047 | protein targeting to ER(GO:0045047) |
0.1 | 0.1 | GO:0098902 | regulation of membrane depolarization during action potential(GO:0098902) |
0.1 | 1.2 | GO:0048741 | skeletal muscle fiber development(GO:0048741) |
0.1 | 0.1 | GO:0045738 | negative regulation of DNA repair(GO:0045738) |
0.1 | 0.2 | GO:0006244 | pyrimidine nucleotide catabolic process(GO:0006244) |
0.1 | 0.1 | GO:0061484 | hematopoietic stem cell homeostasis(GO:0061484) |
0.1 | 0.1 | GO:0006107 | oxaloacetate metabolic process(GO:0006107) |
0.1 | 0.1 | GO:0051451 | myoblast migration(GO:0051451) |
0.1 | 0.1 | GO:2000210 | positive regulation of anoikis(GO:2000210) |
0.1 | 0.3 | GO:0034551 | respiratory chain complex III assembly(GO:0017062) mitochondrial respiratory chain complex III assembly(GO:0034551) mitochondrial respiratory chain complex III biogenesis(GO:0097033) |
0.1 | 0.5 | GO:0006084 | acetyl-CoA metabolic process(GO:0006084) |
0.1 | 0.4 | GO:1900264 | regulation of DNA-directed DNA polymerase activity(GO:1900262) positive regulation of DNA-directed DNA polymerase activity(GO:1900264) |
0.1 | 0.7 | GO:0032922 | circadian regulation of gene expression(GO:0032922) |
0.1 | 0.1 | GO:0010992 | ubiquitin homeostasis(GO:0010992) |
0.1 | 0.1 | GO:0060352 | cell adhesion molecule production(GO:0060352) |
0.1 | 0.4 | GO:0006699 | bile acid biosynthetic process(GO:0006699) |
0.1 | 0.6 | GO:0010508 | positive regulation of autophagy(GO:0010508) |
0.1 | 0.2 | GO:0006768 | biotin metabolic process(GO:0006768) |
0.1 | 0.2 | GO:0009438 | methylglyoxal metabolic process(GO:0009438) |
0.1 | 0.7 | GO:1902108 | regulation of mitochondrial membrane permeability involved in apoptotic process(GO:1902108) |
0.1 | 0.1 | GO:1903232 | melanosome assembly(GO:1903232) |
0.1 | 0.1 | GO:1901724 | positive regulation of cell proliferation involved in kidney development(GO:1901724) |
0.1 | 0.6 | GO:0006298 | mismatch repair(GO:0006298) |
0.1 | 0.1 | GO:0010225 | response to UV-C(GO:0010225) |
0.1 | 0.9 | GO:0032008 | positive regulation of TOR signaling(GO:0032008) |
0.1 | 0.1 | GO:2000698 | positive regulation of epithelial cell differentiation involved in kidney development(GO:2000698) |
0.1 | 0.2 | GO:0002159 | desmosome assembly(GO:0002159) |
0.1 | 0.1 | GO:0035405 | histone-threonine phosphorylation(GO:0035405) |
0.1 | 0.5 | GO:0060216 | definitive hemopoiesis(GO:0060216) |
0.1 | 0.4 | GO:0060539 | diaphragm development(GO:0060539) |
0.1 | 0.1 | GO:0043922 | negative regulation by host of viral transcription(GO:0043922) |
0.1 | 0.1 | GO:0051036 | regulation of endosome size(GO:0051036) |
0.1 | 0.3 | GO:0070266 | necroptotic process(GO:0070266) |
0.1 | 0.3 | GO:0009081 | branched-chain amino acid metabolic process(GO:0009081) |
0.1 | 0.1 | GO:0003383 | apical constriction(GO:0003383) |
0.1 | 0.4 | GO:2000505 | regulation of energy homeostasis(GO:2000505) |
0.1 | 0.7 | GO:0045672 | positive regulation of osteoclast differentiation(GO:0045672) |
0.1 | 0.2 | GO:0002675 | positive regulation of acute inflammatory response(GO:0002675) |
0.1 | 0.1 | GO:0031937 | positive regulation of chromatin silencing(GO:0031937) |
0.1 | 0.2 | GO:0032727 | positive regulation of interferon-alpha production(GO:0032727) |
0.1 | 0.1 | GO:0042138 | meiotic DNA double-strand break formation(GO:0042138) |
0.1 | 2.4 | GO:0043123 | positive regulation of I-kappaB kinase/NF-kappaB signaling(GO:0043123) |
0.1 | 0.1 | GO:0035524 | proline transmembrane transport(GO:0035524) |
0.1 | 0.5 | GO:0050710 | negative regulation of cytokine secretion(GO:0050710) |
0.1 | 0.3 | GO:0018103 | protein C-linked glycosylation(GO:0018103) peptidyl-tryptophan modification(GO:0018211) protein C-linked glycosylation via tryptophan(GO:0018317) protein C-linked glycosylation via 2'-alpha-mannosyl-L-tryptophan(GO:0018406) |
0.1 | 0.2 | GO:0008594 | photoreceptor cell morphogenesis(GO:0008594) |
0.1 | 0.5 | GO:0030212 | hyaluronan metabolic process(GO:0030212) |
0.1 | 0.1 | GO:1901492 | positive regulation of lymphangiogenesis(GO:1901492) |
0.1 | 2.2 | GO:0043330 | response to exogenous dsRNA(GO:0043330) |
0.1 | 0.4 | GO:0001771 | immunological synapse formation(GO:0001771) |
0.1 | 0.3 | GO:0009404 | toxin metabolic process(GO:0009404) |
0.1 | 0.2 | GO:0032482 | Rab protein signal transduction(GO:0032482) |
0.1 | 0.1 | GO:0044838 | cell quiescence(GO:0044838) |
0.1 | 0.3 | GO:0045116 | protein neddylation(GO:0045116) |
0.1 | 0.1 | GO:0043435 | response to corticotropin-releasing hormone(GO:0043435) cellular response to corticotropin-releasing hormone stimulus(GO:0071376) |
0.1 | 0.6 | GO:0072662 | protein targeting to peroxisome(GO:0006625) peroxisomal transport(GO:0043574) protein localization to peroxisome(GO:0072662) establishment of protein localization to peroxisome(GO:0072663) |
0.1 | 0.1 | GO:0071596 | ubiquitin-dependent protein catabolic process via the N-end rule pathway(GO:0071596) |
0.1 | 0.1 | GO:0008298 | intracellular mRNA localization(GO:0008298) |
0.1 | 0.1 | GO:0061009 | common bile duct development(GO:0061009) |
0.1 | 0.1 | GO:0032286 | central nervous system myelin maintenance(GO:0032286) |
0.1 | 0.4 | GO:0098734 | protein depalmitoylation(GO:0002084) macromolecule depalmitoylation(GO:0098734) |
0.1 | 0.5 | GO:0008631 | intrinsic apoptotic signaling pathway in response to oxidative stress(GO:0008631) |
0.1 | 0.6 | GO:0007032 | endosome organization(GO:0007032) |
0.1 | 0.3 | GO:0044062 | regulation of excretion(GO:0044062) |
0.1 | 0.1 | GO:0002035 | brain renin-angiotensin system(GO:0002035) |
0.1 | 0.2 | GO:0032780 | negative regulation of ATPase activity(GO:0032780) |
0.1 | 0.1 | GO:0000291 | nuclear-transcribed mRNA catabolic process, exonucleolytic(GO:0000291) |
0.1 | 0.1 | GO:0007252 | I-kappaB phosphorylation(GO:0007252) |
0.1 | 0.1 | GO:0038061 | NIK/NF-kappaB signaling(GO:0038061) |
0.1 | 1.1 | GO:0006446 | regulation of translational initiation(GO:0006446) |
0.1 | 0.1 | GO:0090051 | negative regulation of cell migration involved in sprouting angiogenesis(GO:0090051) |
0.1 | 1.4 | GO:0051092 | positive regulation of NF-kappaB transcription factor activity(GO:0051092) |
0.1 | 0.4 | GO:0042632 | cholesterol homeostasis(GO:0042632) sterol homeostasis(GO:0055092) |
0.1 | 0.1 | GO:0046890 | regulation of lipid biosynthetic process(GO:0046890) |
0.1 | 0.1 | GO:1903012 | positive regulation of bone development(GO:1903012) |
0.1 | 0.2 | GO:0034653 | diterpenoid catabolic process(GO:0016103) retinoic acid catabolic process(GO:0034653) |
0.1 | 3.0 | GO:0007051 | spindle organization(GO:0007051) |
0.1 | 0.4 | GO:0033617 | mitochondrial respiratory chain complex IV assembly(GO:0033617) mitochondrial respiratory chain complex IV biogenesis(GO:0097034) |
0.1 | 0.1 | GO:0048102 | autophagic cell death(GO:0048102) |
0.1 | 0.7 | GO:0009250 | glycogen biosynthetic process(GO:0005978) glucan biosynthetic process(GO:0009250) |
0.1 | 2.6 | GO:0008380 | RNA splicing(GO:0008380) |
0.1 | 0.1 | GO:0001893 | maternal placenta development(GO:0001893) |
0.1 | 0.1 | GO:0003419 | growth plate cartilage chondrocyte proliferation(GO:0003419) |
0.1 | 0.7 | GO:0051205 | protein insertion into membrane(GO:0051205) |
0.1 | 0.1 | GO:0006046 | N-acetylglucosamine catabolic process(GO:0006046) |
0.1 | 0.1 | GO:0070633 | transepithelial transport(GO:0070633) |
0.1 | 0.2 | GO:0007398 | ectoderm development(GO:0007398) |
0.1 | 0.4 | GO:0051602 | response to electrical stimulus(GO:0051602) |
0.1 | 0.2 | GO:0019370 | leukotriene biosynthetic process(GO:0019370) |
0.1 | 0.1 | GO:1901097 | negative regulation of autophagosome maturation(GO:1901097) |
0.1 | 1.4 | GO:0006892 | post-Golgi vesicle-mediated transport(GO:0006892) |
0.1 | 0.4 | GO:0016926 | protein desumoylation(GO:0016926) |
0.1 | 0.2 | GO:0043931 | ossification involved in bone maturation(GO:0043931) |
0.1 | 0.3 | GO:0033209 | tumor necrosis factor-mediated signaling pathway(GO:0033209) |
0.1 | 0.2 | GO:1902093 | positive regulation of sperm motility(GO:1902093) |
0.1 | 0.1 | GO:0014045 | establishment of endothelial blood-brain barrier(GO:0014045) |
0.1 | 0.1 | GO:0070498 | interleukin-1-mediated signaling pathway(GO:0070498) |
0.1 | 0.1 | GO:1903059 | regulation of protein lipidation(GO:1903059) |
0.1 | 0.1 | GO:0000492 | small nucleolar ribonucleoprotein complex assembly(GO:0000491) box C/D snoRNP assembly(GO:0000492) |
0.1 | 0.6 | GO:0045824 | negative regulation of innate immune response(GO:0045824) |
0.1 | 0.3 | GO:0006656 | phosphatidylcholine biosynthetic process(GO:0006656) |
0.1 | 0.1 | GO:0050849 | negative regulation of calcium-mediated signaling(GO:0050849) |
0.1 | 0.3 | GO:0032515 | negative regulation of phosphoprotein phosphatase activity(GO:0032515) |
0.1 | 1.1 | GO:0007339 | binding of sperm to zona pellucida(GO:0007339) |
0.1 | 0.3 | GO:2001244 | positive regulation of intrinsic apoptotic signaling pathway(GO:2001244) |
0.1 | 0.3 | GO:0046037 | GMP metabolic process(GO:0046037) |
0.1 | 0.3 | GO:0006488 | dolichol-linked oligosaccharide biosynthetic process(GO:0006488) |
0.1 | 0.1 | GO:0018206 | peptidyl-methionine modification(GO:0018206) |
0.1 | 0.1 | GO:0032717 | negative regulation of interleukin-8 production(GO:0032717) |
0.1 | 0.1 | GO:0060455 | negative regulation of gastric acid secretion(GO:0060455) |
0.1 | 0.1 | GO:0031573 | intra-S DNA damage checkpoint(GO:0031573) |
0.1 | 1.1 | GO:0043966 | histone H3 acetylation(GO:0043966) |
0.1 | 0.3 | GO:0001516 | prostaglandin biosynthetic process(GO:0001516) prostanoid biosynthetic process(GO:0046457) |
0.1 | 0.2 | GO:2000253 | positive regulation of feeding behavior(GO:2000253) |
0.1 | 0.2 | GO:0070940 | dephosphorylation of RNA polymerase II C-terminal domain(GO:0070940) |
0.1 | 0.1 | GO:0071726 | response to diacyl bacterial lipopeptide(GO:0071724) cellular response to diacyl bacterial lipopeptide(GO:0071726) |
0.1 | 1.1 | GO:0018279 | peptidyl-asparagine modification(GO:0018196) protein N-linked glycosylation via asparagine(GO:0018279) |
0.1 | 0.2 | GO:0000956 | nuclear-transcribed mRNA catabolic process(GO:0000956) |
0.1 | 0.3 | GO:1904030 | negative regulation of cyclin-dependent protein serine/threonine kinase activity(GO:0045736) negative regulation of cyclin-dependent protein kinase activity(GO:1904030) |
0.1 | 0.2 | GO:0006054 | N-acetylneuraminate metabolic process(GO:0006054) |
0.1 | 0.1 | GO:0016115 | terpenoid catabolic process(GO:0016115) |
0.1 | 0.2 | GO:0016125 | sterol metabolic process(GO:0016125) |
0.1 | 0.1 | GO:0097029 | mature conventional dendritic cell differentiation(GO:0097029) |
0.1 | 0.8 | GO:0045727 | positive regulation of translation(GO:0045727) |
0.1 | 0.1 | GO:0042320 | regulation of circadian sleep/wake cycle, REM sleep(GO:0042320) circadian sleep/wake cycle, REM sleep(GO:0042747) |
0.1 | 0.3 | GO:0033146 | regulation of intracellular estrogen receptor signaling pathway(GO:0033146) |
0.1 | 0.3 | GO:0071557 | histone H3-K27 demethylation(GO:0071557) |
0.1 | 0.3 | GO:0045603 | positive regulation of endothelial cell differentiation(GO:0045603) |
0.1 | 0.1 | GO:0061052 | negative regulation of cell growth involved in cardiac muscle cell development(GO:0061052) |
0.1 | 0.6 | GO:0043304 | regulation of mast cell activation involved in immune response(GO:0033006) regulation of mast cell degranulation(GO:0043304) |
0.1 | 0.1 | GO:2001046 | positive regulation of integrin-mediated signaling pathway(GO:2001046) |
0.1 | 0.8 | GO:0006491 | N-glycan processing(GO:0006491) |
0.1 | 0.1 | GO:0007182 | common-partner SMAD protein phosphorylation(GO:0007182) |
0.1 | 2.3 | GO:0019369 | arachidonic acid metabolic process(GO:0019369) |
0.1 | 0.3 | GO:0000731 | DNA synthesis involved in DNA repair(GO:0000731) |
0.1 | 0.1 | GO:0006285 | base-excision repair, AP site formation(GO:0006285) |
0.1 | 0.1 | GO:0008211 | glucocorticoid metabolic process(GO:0008211) |
0.1 | 0.1 | GO:1901339 | regulation of store-operated calcium channel activity(GO:1901339) |
0.0 | 0.3 | GO:0048873 | homeostasis of number of cells within a tissue(GO:0048873) |
0.0 | 0.8 | GO:0018345 | protein palmitoylation(GO:0018345) |
0.0 | 0.3 | GO:0009247 | glycolipid biosynthetic process(GO:0009247) |
0.0 | 0.0 | GO:1903902 | positive regulation of viral life cycle(GO:1903902) |
0.0 | 0.2 | GO:0051697 | protein delipidation(GO:0051697) |
0.0 | 0.2 | GO:0044275 | cellular carbohydrate catabolic process(GO:0044275) |
0.0 | 0.0 | GO:0098754 | detoxification(GO:0098754) |
0.0 | 0.1 | GO:0045141 | telomere tethering at nuclear periphery(GO:0034398) meiotic telomere tethering at nuclear periphery(GO:0044821) meiotic telomere clustering(GO:0045141) meiotic attachment of telomere to nuclear envelope(GO:0070197) chromosome attachment to the nuclear envelope(GO:0097240) |
0.0 | 0.0 | GO:0007100 | mitotic centrosome separation(GO:0007100) |
0.0 | 0.0 | GO:0071462 | cellular response to water stimulus(GO:0071462) |
0.0 | 0.3 | GO:0006120 | mitochondrial electron transport, NADH to ubiquinone(GO:0006120) |
0.0 | 0.5 | GO:0032233 | positive regulation of actin filament bundle assembly(GO:0032233) |
0.0 | 0.0 | GO:0046185 | aldehyde catabolic process(GO:0046185) |
0.0 | 0.1 | GO:0015780 | nucleotide-sugar transport(GO:0015780) pyrimidine nucleotide-sugar transport(GO:0015781) |
0.0 | 0.0 | GO:0019042 | viral latency(GO:0019042) |
0.0 | 0.0 | GO:0045622 | regulation of T-helper cell differentiation(GO:0045622) |
0.0 | 0.0 | GO:0090037 | positive regulation of protein kinase C signaling(GO:0090037) |
0.0 | 0.3 | GO:0060716 | labyrinthine layer blood vessel development(GO:0060716) |
0.0 | 0.1 | GO:0042092 | type 2 immune response(GO:0042092) |
0.0 | 0.2 | GO:0003283 | atrial septum development(GO:0003283) |
0.0 | 0.0 | GO:0060837 | blood vessel endothelial cell differentiation(GO:0060837) |
0.0 | 0.2 | GO:0000460 | maturation of 5.8S rRNA(GO:0000460) |
0.0 | 0.1 | GO:0060591 | chondroblast differentiation(GO:0060591) |
0.0 | 0.8 | GO:0048635 | negative regulation of muscle organ development(GO:0048635) |
0.0 | 0.2 | GO:0045176 | apical protein localization(GO:0045176) |
0.0 | 0.0 | GO:0051299 | centrosome separation(GO:0051299) |
0.0 | 0.2 | GO:0042492 | gamma-delta T cell differentiation(GO:0042492) |
0.0 | 0.3 | GO:0021692 | cerebellar Purkinje cell layer morphogenesis(GO:0021692) |
0.0 | 0.2 | GO:0071800 | podosome assembly(GO:0071800) |
0.0 | 2.3 | GO:0008654 | phospholipid biosynthetic process(GO:0008654) |
0.0 | 0.3 | GO:0034331 | cell junction maintenance(GO:0034331) cell-cell junction maintenance(GO:0045217) |
0.0 | 0.0 | GO:0035092 | sperm chromatin condensation(GO:0035092) |
0.0 | 0.0 | GO:0016445 | somatic diversification of immunoglobulins(GO:0016445) |
0.0 | 0.1 | GO:1901662 | phylloquinone metabolic process(GO:0042374) phylloquinone catabolic process(GO:0042376) quinone catabolic process(GO:1901662) |
0.0 | 0.0 | GO:1901727 | positive regulation of histone deacetylase activity(GO:1901727) |
0.0 | 0.0 | GO:0000237 | leptotene(GO:0000237) |
0.0 | 0.1 | GO:0070345 | negative regulation of fat cell proliferation(GO:0070345) |
0.0 | 1.6 | GO:0008203 | cholesterol metabolic process(GO:0008203) |
0.0 | 0.4 | GO:0048488 | synaptic vesicle endocytosis(GO:0048488) |
0.0 | 0.0 | GO:0014827 | intestine smooth muscle contraction(GO:0014827) |
0.0 | 0.5 | GO:0030322 | stabilization of membrane potential(GO:0030322) |
0.0 | 0.5 | GO:0060351 | cartilage development involved in endochondral bone morphogenesis(GO:0060351) |
0.0 | 0.2 | GO:0048251 | elastic fiber assembly(GO:0048251) |
0.0 | 0.1 | GO:0045072 | regulation of interferon-gamma biosynthetic process(GO:0045072) positive regulation of interferon-gamma biosynthetic process(GO:0045078) |
0.0 | 0.8 | GO:0055072 | iron ion homeostasis(GO:0055072) |
0.0 | 0.0 | GO:0006598 | polyamine catabolic process(GO:0006598) |
0.0 | 4.2 | GO:0044257 | cellular protein catabolic process(GO:0044257) |
0.0 | 0.9 | GO:0003341 | cilium movement(GO:0003341) |
0.0 | 0.1 | GO:0002673 | regulation of acute inflammatory response(GO:0002673) |
0.0 | 0.0 | GO:0001510 | RNA methylation(GO:0001510) |
0.0 | 0.1 | GO:0071577 | zinc II ion transmembrane transport(GO:0071577) |
0.0 | 0.0 | GO:0090311 | regulation of protein deacetylation(GO:0090311) |
0.0 | 0.1 | GO:0033227 | dsRNA transport(GO:0033227) |
0.0 | 0.0 | GO:0099515 | actin filament-based transport(GO:0099515) |
0.0 | 0.2 | GO:0042984 | amyloid precursor protein biosynthetic process(GO:0042983) regulation of amyloid precursor protein biosynthetic process(GO:0042984) |
0.0 | 5.5 | GO:0016567 | protein ubiquitination(GO:0016567) |
0.0 | 0.3 | GO:0006590 | thyroid hormone generation(GO:0006590) |
0.0 | 4.4 | GO:0006396 | RNA processing(GO:0006396) |
0.0 | 0.1 | GO:0048850 | hypophysis morphogenesis(GO:0048850) |
0.0 | 0.0 | GO:0007599 | hemostasis(GO:0007599) |
0.0 | 0.0 | GO:2001286 | regulation of caveolin-mediated endocytosis(GO:2001286) |
0.0 | 0.2 | GO:2000272 | negative regulation of receptor activity(GO:2000272) |
0.0 | 0.1 | GO:0048711 | positive regulation of astrocyte differentiation(GO:0048711) |
0.0 | 0.1 | GO:1901620 | regulation of smoothened signaling pathway involved in dorsal/ventral neural tube patterning(GO:1901620) |
0.0 | 0.2 | GO:0002579 | positive regulation of antigen processing and presentation(GO:0002579) |
0.0 | 0.1 | GO:0046716 | muscle cell cellular homeostasis(GO:0046716) |
0.0 | 0.1 | GO:0048597 | post-embryonic camera-type eye morphogenesis(GO:0048597) |
0.0 | 0.0 | GO:0051683 | establishment of Golgi localization(GO:0051683) |
0.0 | 0.0 | GO:0042508 | tyrosine phosphorylation of Stat1 protein(GO:0042508) regulation of tyrosine phosphorylation of Stat1 protein(GO:0042510) positive regulation of tyrosine phosphorylation of Stat1 protein(GO:0042511) |
0.0 | 0.1 | GO:0000733 | DNA strand renaturation(GO:0000733) |
0.0 | 0.1 | GO:0007351 | tripartite regional subdivision(GO:0007351) anterior/posterior axis specification, embryo(GO:0008595) |
0.0 | 0.1 | GO:0001865 | NK T cell differentiation(GO:0001865) |
0.0 | 0.0 | GO:0051385 | response to mineralocorticoid(GO:0051385) |
0.0 | 0.3 | GO:0000070 | mitotic sister chromatid segregation(GO:0000070) |
0.0 | 0.1 | GO:1902626 | assembly of large subunit precursor of preribosome(GO:1902626) |
0.0 | 0.0 | GO:1901317 | regulation of sperm motility(GO:1901317) |
0.0 | 0.1 | GO:0006527 | arginine catabolic process(GO:0006527) |
0.0 | 0.0 | GO:1900076 | regulation of cellular response to insulin stimulus(GO:1900076) |
0.0 | 0.0 | GO:0072350 | tricarboxylic acid metabolic process(GO:0072350) |
0.0 | 0.0 | GO:0002720 | positive regulation of cytokine production involved in immune response(GO:0002720) |
0.0 | 0.3 | GO:0046466 | membrane lipid catabolic process(GO:0046466) |
0.0 | 0.1 | GO:0035162 | embryonic hemopoiesis(GO:0035162) |
0.0 | 0.2 | GO:0030049 | muscle filament sliding(GO:0030049) |
0.0 | 0.0 | GO:0048875 | chemical homeostasis within a tissue(GO:0048875) |
0.0 | 3.1 | GO:0006631 | fatty acid metabolic process(GO:0006631) |
0.0 | 0.0 | GO:0007181 | transforming growth factor beta receptor complex assembly(GO:0007181) |
0.0 | 0.1 | GO:0030223 | neutrophil differentiation(GO:0030223) |
0.0 | 0.1 | GO:0018101 | protein citrullination(GO:0018101) |
0.0 | 0.1 | GO:0060632 | regulation of microtubule-based movement(GO:0060632) |
0.0 | 0.1 | GO:0036089 | cleavage furrow formation(GO:0036089) |
0.0 | 0.1 | GO:0042517 | positive regulation of tyrosine phosphorylation of Stat3 protein(GO:0042517) |
0.0 | 0.0 | GO:0032497 | detection of lipopolysaccharide(GO:0032497) |
0.0 | 0.3 | GO:0033561 | regulation of water loss via skin(GO:0033561) |
0.0 | 0.1 | GO:0042483 | negative regulation of odontogenesis(GO:0042483) |
0.0 | 0.5 | GO:0019731 | antibacterial humoral response(GO:0019731) |
0.0 | 0.1 | GO:0044872 | lipoprotein transport(GO:0042953) lipoprotein localization(GO:0044872) |
0.0 | 0.2 | GO:0002381 | immunoglobulin production involved in immunoglobulin mediated immune response(GO:0002381) |
0.0 | 0.0 | GO:0009650 | UV protection(GO:0009650) |
0.0 | 0.1 | GO:0006297 | nucleotide-excision repair, DNA gap filling(GO:0006297) |
0.0 | 0.0 | GO:0006505 | GPI anchor metabolic process(GO:0006505) |
0.0 | 0.0 | GO:0045601 | regulation of endothelial cell differentiation(GO:0045601) |
0.0 | 0.1 | GO:0021670 | lateral ventricle development(GO:0021670) |
0.0 | 0.1 | GO:0001553 | luteinization(GO:0001553) |
0.0 | 0.0 | GO:0051365 | cellular response to potassium ion starvation(GO:0051365) |
0.0 | 0.1 | GO:0043084 | penile erection(GO:0043084) |
0.0 | 0.1 | GO:0042447 | hormone catabolic process(GO:0042447) |
0.0 | 0.1 | GO:0031639 | plasminogen activation(GO:0031639) |
0.0 | 0.1 | GO:0032964 | collagen biosynthetic process(GO:0032964) |
0.0 | 0.1 | GO:1903416 | response to glycoside(GO:1903416) |
0.0 | 0.4 | GO:1900003 | regulation of serine-type endopeptidase activity(GO:1900003) negative regulation of serine-type endopeptidase activity(GO:1900004) regulation of serine-type peptidase activity(GO:1902571) negative regulation of serine-type peptidase activity(GO:1902572) |
0.0 | 0.1 | GO:0008295 | spermidine biosynthetic process(GO:0008295) |
0.0 | 0.3 | GO:0007190 | activation of adenylate cyclase activity(GO:0007190) |
0.0 | 0.3 | GO:0051180 | vitamin transport(GO:0051180) |
0.0 | 0.4 | GO:0006890 | retrograde vesicle-mediated transport, Golgi to ER(GO:0006890) |
0.0 | 0.0 | GO:0010561 | negative regulation of glycoprotein biosynthetic process(GO:0010561) |
0.0 | 0.1 | GO:0090080 | positive regulation of MAPKKK cascade by fibroblast growth factor receptor signaling pathway(GO:0090080) |
0.0 | 0.1 | GO:0072224 | metanephric glomerulus development(GO:0072224) |
0.0 | 0.3 | GO:0044458 | motile cilium assembly(GO:0044458) |
0.0 | 0.2 | GO:0035987 | endodermal cell differentiation(GO:0035987) |
0.0 | 0.1 | GO:1902606 | regulation of large conductance calcium-activated potassium channel activity(GO:1902606) positive regulation of large conductance calcium-activated potassium channel activity(GO:1902608) |
0.0 | 0.0 | GO:1903725 | regulation of phospholipid metabolic process(GO:1903725) |
0.0 | 0.0 | GO:0033690 | positive regulation of osteoblast proliferation(GO:0033690) |
0.0 | 0.1 | GO:0097210 | response to gonadotropin-releasing hormone(GO:0097210) cellular response to gonadotropin-releasing hormone(GO:0097211) |
0.0 | 0.0 | GO:0090503 | RNA phosphodiester bond hydrolysis, exonucleolytic(GO:0090503) |
0.0 | 0.0 | GO:1900424 | regulation of defense response to bacterium(GO:1900424) |
0.0 | 0.0 | GO:0014724 | regulation of twitch skeletal muscle contraction(GO:0014724) regulation of fast-twitch skeletal muscle fiber contraction(GO:0031446) positive regulation of fast-twitch skeletal muscle fiber contraction(GO:0031448) |
0.0 | 0.1 | GO:0006957 | complement activation, alternative pathway(GO:0006957) |
0.0 | 0.1 | GO:0006907 | pinocytosis(GO:0006907) |
0.0 | 0.0 | GO:0033566 | gamma-tubulin complex localization(GO:0033566) |
0.0 | 0.1 | GO:0051534 | negative regulation of NFAT protein import into nucleus(GO:0051534) |
0.0 | 0.1 | GO:0042359 | vitamin D metabolic process(GO:0042359) |
0.0 | 0.0 | GO:0003223 | ventricular compact myocardium morphogenesis(GO:0003223) |
0.0 | 0.1 | GO:0007221 | positive regulation of transcription of Notch receptor target(GO:0007221) |
0.0 | 0.4 | GO:0043550 | regulation of lipid kinase activity(GO:0043550) |
0.0 | 0.0 | GO:1901679 | nucleotide transmembrane transport(GO:1901679) |
0.0 | 0.1 | GO:0046498 | S-adenosylhomocysteine metabolic process(GO:0046498) |
0.0 | 0.1 | GO:0031664 | regulation of lipopolysaccharide-mediated signaling pathway(GO:0031664) |
0.0 | 0.1 | GO:0003085 | negative regulation of systemic arterial blood pressure(GO:0003085) |
0.0 | 0.1 | GO:1903077 | negative regulation of protein localization to plasma membrane(GO:1903077) negative regulation of protein localization to cell periphery(GO:1904376) |
0.0 | 0.3 | GO:0072528 | pyrimidine-containing compound biosynthetic process(GO:0072528) |
0.0 | 0.4 | GO:0007602 | phototransduction(GO:0007602) |
0.0 | 0.1 | GO:0033299 | secretion of lysosomal enzymes(GO:0033299) |
0.0 | 0.1 | GO:0033622 | integrin activation(GO:0033622) |
0.0 | 0.2 | GO:0070830 | bicellular tight junction assembly(GO:0070830) |
0.0 | 0.3 | GO:0000272 | polysaccharide catabolic process(GO:0000272) |
0.0 | 0.0 | GO:0070059 | intrinsic apoptotic signaling pathway in response to endoplasmic reticulum stress(GO:0070059) |
0.0 | 0.0 | GO:0006266 | DNA ligation(GO:0006266) |
0.0 | 0.0 | GO:1902202 | regulation of hepatocyte growth factor receptor signaling pathway(GO:1902202) |
0.0 | 0.1 | GO:0080154 | regulation of fertilization(GO:0080154) |
0.0 | 0.1 | GO:0008206 | bile acid metabolic process(GO:0008206) |
0.0 | 0.1 | GO:0006627 | protein processing involved in protein targeting to mitochondrion(GO:0006627) mitochondrial protein processing(GO:0034982) |
0.0 | 0.1 | GO:0006490 | oligosaccharide-lipid intermediate biosynthetic process(GO:0006490) |
0.0 | 0.1 | GO:0006706 | steroid catabolic process(GO:0006706) |
0.0 | 0.0 | GO:0060011 | Sertoli cell proliferation(GO:0060011) |
0.0 | 0.1 | GO:0042732 | D-xylose metabolic process(GO:0042732) |
0.0 | 0.0 | GO:0051560 | mitochondrial calcium ion homeostasis(GO:0051560) |
0.0 | 0.1 | GO:1900101 | regulation of endoplasmic reticulum unfolded protein response(GO:1900101) |
0.0 | 0.5 | GO:0006694 | steroid biosynthetic process(GO:0006694) |
0.0 | 0.0 | GO:0055088 | lipid homeostasis(GO:0055088) |
0.0 | 0.0 | GO:0048859 | formation of anatomical boundary(GO:0048859) |
0.0 | 0.1 | GO:0050917 | sensory perception of umami taste(GO:0050917) |
0.0 | 0.0 | GO:0009649 | entrainment of circadian clock(GO:0009649) |
0.0 | 0.0 | GO:0072053 | renal inner medulla development(GO:0072053) |
0.0 | 0.0 | GO:0070243 | regulation of thymocyte apoptotic process(GO:0070243) |
0.0 | 0.1 | GO:0014041 | regulation of neuron maturation(GO:0014041) |
0.0 | 0.1 | GO:0033631 | cell-cell adhesion mediated by integrin(GO:0033631) |
0.0 | 0.1 | GO:0051457 | maintenance of protein location in nucleus(GO:0051457) |
0.0 | 0.2 | GO:0071880 | adenylate cyclase-activating adrenergic receptor signaling pathway(GO:0071880) |
0.0 | 0.0 | GO:0071321 | cellular response to cGMP(GO:0071321) |
0.0 | 0.0 | GO:2000402 | negative regulation of lymphocyte migration(GO:2000402) |
0.0 | 0.0 | GO:0008065 | establishment of blood-nerve barrier(GO:0008065) |
0.0 | 0.0 | GO:0042590 | antigen processing and presentation of exogenous peptide antigen via MHC class I(GO:0042590) |
0.0 | 0.3 | GO:0006720 | isoprenoid metabolic process(GO:0006720) |
0.0 | 0.1 | GO:0002251 | organ or tissue specific immune response(GO:0002251) mucosal immune response(GO:0002385) |
0.0 | 0.1 | GO:0015074 | DNA integration(GO:0015074) |
0.0 | 0.0 | GO:0046007 | negative regulation of activated T cell proliferation(GO:0046007) |
0.0 | 0.0 | GO:0006071 | glycerol metabolic process(GO:0006071) |
0.0 | 0.0 | GO:0009133 | nucleoside diphosphate biosynthetic process(GO:0009133) |
0.0 | 0.0 | GO:0033615 | mitochondrial proton-transporting ATP synthase complex assembly(GO:0033615) |
0.0 | 0.0 | GO:0045794 | negative regulation of cell volume(GO:0045794) |
0.0 | 0.1 | GO:1901739 | regulation of myoblast fusion(GO:1901739) |
0.0 | 0.2 | GO:0002902 | regulation of B cell apoptotic process(GO:0002902) |
0.0 | 0.7 | GO:0001580 | detection of chemical stimulus involved in sensory perception of bitter taste(GO:0001580) |
0.0 | 0.0 | GO:0051446 | positive regulation of meiotic cell cycle(GO:0051446) |
0.0 | 1.0 | GO:0016042 | lipid catabolic process(GO:0016042) |
0.0 | 0.2 | GO:0090305 | nucleic acid phosphodiester bond hydrolysis(GO:0090305) |
0.0 | 0.0 | GO:0010818 | T cell chemotaxis(GO:0010818) |
0.0 | 2.0 | GO:0019236 | response to pheromone(GO:0019236) |
0.0 | 0.6 | GO:0008643 | carbohydrate transport(GO:0008643) |
0.0 | 0.0 | GO:2000049 | positive regulation of cell-cell adhesion mediated by cadherin(GO:2000049) |
0.0 | 0.1 | GO:0001845 | phagolysosome assembly(GO:0001845) |
0.0 | 0.0 | GO:0043030 | regulation of macrophage activation(GO:0043030) |
0.0 | 0.0 | GO:0072076 | nephrogenic mesenchyme development(GO:0072076) |
0.0 | 0.2 | GO:0006829 | zinc II ion transport(GO:0006829) |
0.0 | 0.0 | GO:0018343 | protein farnesylation(GO:0018343) |
0.0 | 0.1 | GO:0042403 | thyroid hormone metabolic process(GO:0042403) |
0.0 | 0.1 | GO:0010172 | embryonic body morphogenesis(GO:0010172) |
0.0 | 0.0 | GO:0032754 | positive regulation of interleukin-5 production(GO:0032754) |
0.0 | 0.0 | GO:0042628 | mating plug formation(GO:0042628) single-organism reproductive behavior(GO:0044704) post-mating behavior(GO:0045297) |
0.0 | 0.0 | GO:2000678 | negative regulation of transcription regulatory region DNA binding(GO:2000678) |
0.0 | 0.0 | GO:0006349 | regulation of gene expression by genetic imprinting(GO:0006349) |
0.0 | 0.0 | GO:0033239 | negative regulation of cellular amine metabolic process(GO:0033239) |
0.0 | 0.0 | GO:0007412 | axon target recognition(GO:0007412) |
0.0 | 0.0 | GO:0032494 | response to peptidoglycan(GO:0032494) |
0.0 | 0.1 | GO:0045732 | positive regulation of protein catabolic process(GO:0045732) |
0.0 | 0.0 | GO:0008292 | acetylcholine biosynthetic process(GO:0008292) acetate ester biosynthetic process(GO:1900620) |
0.0 | 0.0 | GO:0008078 | mesodermal cell migration(GO:0008078) |
0.0 | 0.0 | GO:0009186 | deoxyribonucleoside diphosphate metabolic process(GO:0009186) |
0.0 | 0.1 | GO:0071624 | positive regulation of granulocyte chemotaxis(GO:0071624) |
0.0 | 0.0 | GO:0050891 | multicellular organismal water homeostasis(GO:0050891) |
0.0 | 0.2 | GO:0097031 | NADH dehydrogenase complex assembly(GO:0010257) mitochondrial respiratory chain complex I assembly(GO:0032981) mitochondrial respiratory chain complex I biogenesis(GO:0097031) |
0.0 | 0.0 | GO:0031052 | programmed DNA elimination(GO:0031049) chromosome breakage(GO:0031052) |
0.0 | 0.0 | GO:0005984 | disaccharide metabolic process(GO:0005984) |
0.0 | 0.0 | GO:0007144 | female meiosis I(GO:0007144) |
0.0 | 0.1 | GO:0051823 | regulation of synapse structural plasticity(GO:0051823) |
0.0 | 0.0 | GO:0007288 | sperm axoneme assembly(GO:0007288) |
0.0 | 0.0 | GO:0002934 | desmosome organization(GO:0002934) |
0.0 | 0.0 | GO:0051131 | chaperone-mediated protein complex assembly(GO:0051131) |
0.0 | 0.0 | GO:0000729 | DNA double-strand break processing(GO:0000729) |
0.0 | 0.0 | GO:0050856 | regulation of T cell receptor signaling pathway(GO:0050856) |
0.0 | 0.0 | GO:0018094 | protein polyglycylation(GO:0018094) |
0.0 | 0.0 | GO:1902683 | regulation of receptor localization to synapse(GO:1902683) |
0.0 | 0.1 | GO:0042481 | regulation of odontogenesis(GO:0042481) |
0.0 | 0.2 | GO:0006305 | DNA alkylation(GO:0006305) DNA methylation(GO:0006306) |
0.0 | 0.0 | GO:0015747 | urate transport(GO:0015747) |
0.0 | 0.0 | GO:0051156 | glucose 6-phosphate metabolic process(GO:0051156) |
0.0 | 0.1 | GO:0002690 | positive regulation of leukocyte chemotaxis(GO:0002690) |
0.0 | 0.0 | GO:0038031 | non-canonical Wnt signaling pathway via JNK cascade(GO:0038031) |
0.0 | 0.1 | GO:0034505 | tooth mineralization(GO:0034505) |
0.0 | 0.0 | GO:0086042 | cardiac muscle cell-cardiac muscle cell adhesion(GO:0086042) |
0.0 | 0.0 | GO:0045345 | MHC class I biosynthetic process(GO:0045341) regulation of MHC class I biosynthetic process(GO:0045343) positive regulation of MHC class I biosynthetic process(GO:0045345) |
0.0 | 0.0 | GO:0051341 | regulation of oxidoreductase activity(GO:0051341) |
0.0 | 0.1 | GO:0023058 | adaptation of signaling pathway(GO:0023058) |
0.0 | 0.0 | GO:0035562 | negative regulation of chromatin binding(GO:0035562) |
0.0 | 0.0 | GO:0010831 | positive regulation of myotube differentiation(GO:0010831) |
0.0 | 0.0 | GO:0002457 | T cell antigen processing and presentation(GO:0002457) |
0.0 | 0.0 | GO:0035435 | phosphate ion transmembrane transport(GO:0035435) |
0.0 | 0.0 | GO:0097186 | amelogenesis(GO:0097186) |
0.0 | 0.1 | GO:0018344 | protein geranylgeranylation(GO:0018344) |
0.0 | 0.0 | GO:0032530 | regulation of microvillus organization(GO:0032530) regulation of microvillus length(GO:0032532) |
0.0 | 0.0 | GO:0045743 | positive regulation of fibroblast growth factor receptor signaling pathway(GO:0045743) |
0.0 | 0.0 | GO:0042989 | sequestering of actin monomers(GO:0042989) |
0.0 | 0.1 | GO:0009268 | response to pH(GO:0009268) |
0.0 | 0.0 | GO:1901979 | regulation of inward rectifier potassium channel activity(GO:1901979) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
1.6 | 4.8 | GO:0030981 | cortical microtubule cytoskeleton(GO:0030981) |
1.4 | 4.2 | GO:0005967 | mitochondrial pyruvate dehydrogenase complex(GO:0005967) |
1.1 | 5.5 | GO:0031838 | haptoglobin-hemoglobin complex(GO:0031838) |
1.0 | 5.9 | GO:1990462 | omegasome(GO:1990462) |
0.9 | 2.8 | GO:0000811 | GINS complex(GO:0000811) |
0.9 | 2.8 | GO:0034365 | discoidal high-density lipoprotein particle(GO:0034365) |
0.9 | 2.7 | GO:0097418 | neurofibrillary tangle(GO:0097418) |
0.9 | 2.7 | GO:0097413 | Lewy body(GO:0097413) |
0.8 | 2.5 | GO:0031933 | telomeric heterochromatin(GO:0031933) |
0.7 | 2.9 | GO:1990130 | Iml1 complex(GO:1990130) |
0.7 | 2.9 | GO:0032777 | Piccolo NuA4 histone acetyltransferase complex(GO:0032777) |
0.7 | 2.1 | GO:0005833 | hemoglobin complex(GO:0005833) |
0.7 | 2.1 | GO:0097057 | TRAF2-GSTP1 complex(GO:0097057) |
0.7 | 2.8 | GO:0072487 | MSL complex(GO:0072487) |
0.7 | 2.6 | GO:0071141 | SMAD protein complex(GO:0071141) |
0.6 | 3.2 | GO:0016281 | eukaryotic translation initiation factor 4F complex(GO:0016281) |
0.6 | 2.6 | GO:0032541 | cortical endoplasmic reticulum(GO:0032541) |
0.6 | 2.4 | GO:0005828 | kinetochore microtubule(GO:0005828) |
0.6 | 2.3 | GO:0097169 | AIM2 inflammasome complex(GO:0097169) |
0.6 | 2.3 | GO:0016602 | CCAAT-binding factor complex(GO:0016602) |
0.6 | 5.1 | GO:0005869 | dynactin complex(GO:0005869) |
0.6 | 2.2 | GO:0035339 | SPOTS complex(GO:0035339) |
0.5 | 1.6 | GO:0005944 | phosphatidylinositol 3-kinase complex, class IB(GO:0005944) |
0.5 | 2.6 | GO:0033093 | Weibel-Palade body(GO:0033093) |
0.5 | 4.2 | GO:0019773 | proteasome core complex, alpha-subunit complex(GO:0019773) |
0.5 | 4.1 | GO:0008385 | IkappaB kinase complex(GO:0008385) |
0.5 | 2.5 | GO:0005672 | transcription factor TFIIA complex(GO:0005672) |
0.5 | 3.9 | GO:0005890 | sodium:potassium-exchanging ATPase complex(GO:0005890) |
0.5 | 2.0 | GO:0034366 | spherical high-density lipoprotein particle(GO:0034366) |
0.5 | 2.9 | GO:0000138 | Golgi trans cisterna(GO:0000138) |
0.5 | 1.4 | GO:0020016 | ciliary pocket(GO:0020016) ciliary pocket membrane(GO:0020018) |
0.5 | 5.0 | GO:0031588 | nucleotide-activated protein kinase complex(GO:0031588) |
0.5 | 6.8 | GO:0034364 | high-density lipoprotein particle(GO:0034364) |
0.4 | 2.2 | GO:0005683 | U7 snRNP(GO:0005683) |
0.4 | 1.3 | GO:0048476 | Holliday junction resolvase complex(GO:0048476) |
0.4 | 2.2 | GO:0061617 | MICOS complex(GO:0061617) |
0.4 | 4.3 | GO:0048188 | Set1C/COMPASS complex(GO:0048188) |
0.4 | 1.7 | GO:0000214 | tRNA-intron endonuclease complex(GO:0000214) |
0.4 | 1.7 | GO:0089701 | U2AF(GO:0089701) |
0.4 | 5.7 | GO:0005942 | phosphatidylinositol 3-kinase complex(GO:0005942) |
0.4 | 1.6 | GO:0035189 | Rb-E2F complex(GO:0035189) |
0.4 | 0.4 | GO:0031595 | nuclear proteasome complex(GO:0031595) |
0.4 | 3.2 | GO:1902562 | NuA4 histone acetyltransferase complex(GO:0035267) H4/H2A histone acetyltransferase complex(GO:0043189) H4 histone acetyltransferase complex(GO:1902562) |
0.4 | 2.8 | GO:0005688 | U6 snRNP(GO:0005688) |
0.4 | 2.8 | GO:0042382 | paraspeckles(GO:0042382) |
0.4 | 5.9 | GO:0071012 | catalytic step 1 spliceosome(GO:0071012) |
0.4 | 5.1 | GO:0071004 | U2-type prespliceosome(GO:0071004) |
0.4 | 2.3 | GO:0070761 | pre-snoRNP complex(GO:0070761) |
0.4 | 4.2 | GO:0032797 | SMN complex(GO:0032797) |
0.4 | 22.0 | GO:0000118 | histone deacetylase complex(GO:0000118) |
0.4 | 1.5 | GO:0031262 | Ndc80 complex(GO:0031262) |
0.4 | 1.1 | GO:0097443 | sorting endosome(GO:0097443) |
0.4 | 2.2 | GO:0000812 | Swr1 complex(GO:0000812) |
0.4 | 2.1 | GO:0030915 | Smc5-Smc6 complex(GO:0030915) |
0.4 | 5.3 | GO:0030014 | CCR4-NOT complex(GO:0030014) |
0.3 | 10.8 | GO:0008180 | COP9 signalosome(GO:0008180) |
0.3 | 1.4 | GO:0061689 | tricellular tight junction(GO:0061689) |
0.3 | 1.0 | GO:0031088 | platelet dense granule membrane(GO:0031088) |
0.3 | 1.4 | GO:0031313 | extrinsic component of endosome membrane(GO:0031313) |
0.3 | 2.7 | GO:0001650 | fibrillar center(GO:0001650) |
0.3 | 1.7 | GO:0034388 | Pwp2p-containing subcomplex of 90S preribosome(GO:0034388) |
0.3 | 0.3 | GO:0044327 | dendritic spine head(GO:0044327) |
0.3 | 1.0 | GO:0005853 | eukaryotic translation elongation factor 1 complex(GO:0005853) |
0.3 | 3.9 | GO:0005847 | mRNA cleavage and polyadenylation specificity factor complex(GO:0005847) |
0.3 | 2.3 | GO:0072669 | tRNA-splicing ligase complex(GO:0072669) |
0.3 | 3.5 | GO:0005839 | proteasome core complex(GO:0005839) |
0.3 | 1.0 | GO:1990604 | IRE1-TRAF2-ASK1 complex(GO:1990604) |
0.3 | 2.9 | GO:0031010 | ISWI-type complex(GO:0031010) |
0.3 | 1.3 | GO:0042612 | MHC class I protein complex(GO:0042612) |
0.3 | 1.9 | GO:0070847 | core mediator complex(GO:0070847) |
0.3 | 2.2 | GO:0031462 | Cul2-RING ubiquitin ligase complex(GO:0031462) |
0.3 | 2.8 | GO:0005742 | mitochondrial outer membrane translocase complex(GO:0005742) |
0.3 | 7.0 | GO:0080008 | Cul4-RING E3 ubiquitin ligase complex(GO:0080008) |
0.3 | 0.9 | GO:0031523 | Myb complex(GO:0031523) |
0.3 | 3.3 | GO:0031143 | pseudopodium(GO:0031143) |
0.3 | 12.6 | GO:0000932 | cytoplasmic mRNA processing body(GO:0000932) |
0.3 | 3.9 | GO:0097431 | mitotic spindle pole(GO:0097431) |
0.3 | 2.7 | GO:0032593 | insulin-responsive compartment(GO:0032593) |
0.3 | 2.7 | GO:0070938 | contractile ring(GO:0070938) |
0.3 | 2.4 | GO:0034464 | BBSome(GO:0034464) |
0.3 | 2.1 | GO:0000276 | mitochondrial proton-transporting ATP synthase complex, coupling factor F(o)(GO:0000276) |
0.3 | 0.9 | GO:0005899 | insulin receptor complex(GO:0005899) |
0.3 | 2.0 | GO:0061700 | Seh1-associated complex(GO:0035859) GATOR2 complex(GO:0061700) |
0.3 | 1.4 | GO:0005797 | Golgi medial cisterna(GO:0005797) |
0.3 | 1.1 | GO:0005947 | mitochondrial alpha-ketoglutarate dehydrogenase complex(GO:0005947) |
0.3 | 0.8 | GO:0071664 | catenin-TCF7L2 complex(GO:0071664) |
0.3 | 0.8 | GO:0070552 | BRISC complex(GO:0070552) |
0.3 | 0.8 | GO:0097451 | glial limiting end-foot(GO:0097451) |
0.3 | 1.3 | GO:0030870 | Mre11 complex(GO:0030870) |
0.3 | 4.2 | GO:0000145 | exocyst(GO:0000145) |
0.3 | 0.8 | GO:0032127 | dense core granule membrane(GO:0032127) |
0.3 | 0.5 | GO:0097648 | G-protein coupled receptor dimeric complex(GO:0038037) G-protein coupled receptor complex(GO:0097648) |
0.3 | 1.0 | GO:0044326 | dendritic spine neck(GO:0044326) |
0.3 | 1.3 | GO:0098553 | integral component of cytoplasmic side of endoplasmic reticulum membrane(GO:0071458) integral component of lumenal side of endoplasmic reticulum membrane(GO:0071556) lumenal side of endoplasmic reticulum membrane(GO:0098553) |
0.3 | 0.8 | GO:0005745 | m-AAA complex(GO:0005745) |
0.3 | 3.8 | GO:0000421 | autophagosome membrane(GO:0000421) |
0.3 | 2.0 | GO:0031080 | nuclear pore outer ring(GO:0031080) |
0.3 | 2.5 | GO:0036513 | Derlin-1 retrotranslocation complex(GO:0036513) |
0.2 | 1.2 | GO:0005638 | lamin filament(GO:0005638) |
0.2 | 4.7 | GO:0071339 | MLL1/2 complex(GO:0044665) MLL1 complex(GO:0071339) |
0.2 | 0.5 | GO:0036488 | CHOP-C/EBP complex(GO:0036488) |
0.2 | 11.7 | GO:0030864 | cortical actin cytoskeleton(GO:0030864) |
0.2 | 3.1 | GO:0000164 | protein phosphatase type 1 complex(GO:0000164) |
0.2 | 7.0 | GO:0016592 | mediator complex(GO:0016592) |
0.2 | 2.2 | GO:0033179 | proton-transporting V-type ATPase, V0 domain(GO:0033179) |
0.2 | 0.2 | GO:0030669 | clathrin-coated endocytic vesicle membrane(GO:0030669) |
0.2 | 4.9 | GO:0090544 | BAF-type complex(GO:0090544) |
0.2 | 1.9 | GO:0005916 | fascia adherens(GO:0005916) |
0.2 | 3.0 | GO:0005666 | DNA-directed RNA polymerase III complex(GO:0005666) |
0.2 | 1.2 | GO:0033503 | HULC complex(GO:0033503) |
0.2 | 3.0 | GO:0005665 | DNA-directed RNA polymerase II, core complex(GO:0005665) |
0.2 | 3.6 | GO:0000159 | protein phosphatase type 2A complex(GO:0000159) |
0.2 | 0.7 | GO:0072357 | PTW/PP1 phosphatase complex(GO:0072357) |
0.2 | 3.2 | GO:0000177 | cytoplasmic exosome (RNase complex)(GO:0000177) |
0.2 | 0.2 | GO:0042575 | DNA polymerase complex(GO:0042575) |
0.2 | 0.9 | GO:0045298 | tubulin complex(GO:0045298) |
0.2 | 0.7 | GO:0097543 | ciliary inversin compartment(GO:0097543) |
0.2 | 1.8 | GO:0070652 | HAUS complex(GO:0070652) |
0.2 | 0.4 | GO:0033177 | proton-transporting two-sector ATPase complex, proton-transporting domain(GO:0033177) |
0.2 | 0.9 | GO:0019815 | B cell receptor complex(GO:0019815) |
0.2 | 2.0 | GO:0000815 | ESCRT III complex(GO:0000815) |
0.2 | 2.4 | GO:0032039 | integrator complex(GO:0032039) |
0.2 | 1.3 | GO:0005677 | chromatin silencing complex(GO:0005677) |
0.2 | 0.2 | GO:0031618 | nuclear pericentric heterochromatin(GO:0031618) |
0.2 | 1.9 | GO:0005885 | Arp2/3 protein complex(GO:0005885) |
0.2 | 0.4 | GO:0097513 | myosin II filament(GO:0097513) |
0.2 | 0.6 | GO:0032299 | ribonuclease H2 complex(GO:0032299) |
0.2 | 1.9 | GO:0097539 | ciliary transition fiber(GO:0097539) |
0.2 | 2.7 | GO:0010369 | chromocenter(GO:0010369) |
0.2 | 0.6 | GO:0045098 | type III intermediate filament(GO:0045098) |
0.2 | 1.7 | GO:0035631 | CD40 receptor complex(GO:0035631) |
0.2 | 2.3 | GO:0035098 | ESC/E(Z) complex(GO:0035098) |
0.2 | 0.4 | GO:0044614 | nuclear pore cytoplasmic filaments(GO:0044614) |
0.2 | 0.6 | GO:0033063 | Rad51B-Rad51C-Rad51D-XRCC2 complex(GO:0033063) |
0.2 | 0.4 | GO:0030062 | mitochondrial tricarboxylic acid cycle enzyme complex(GO:0030062) |
0.2 | 0.8 | GO:0097470 | ribbon synapse(GO:0097470) |
0.2 | 10.5 | GO:0016363 | nuclear matrix(GO:0016363) |
0.2 | 0.6 | GO:0005658 | alpha DNA polymerase:primase complex(GO:0005658) |
0.2 | 0.8 | GO:0008622 | epsilon DNA polymerase complex(GO:0008622) |
0.2 | 4.0 | GO:0035145 | exon-exon junction complex(GO:0035145) |
0.2 | 1.0 | GO:0042765 | GPI-anchor transamidase complex(GO:0042765) |
0.2 | 3.2 | GO:0031306 | intrinsic component of mitochondrial outer membrane(GO:0031306) |
0.2 | 1.0 | GO:0031414 | N-terminal protein acetyltransferase complex(GO:0031414) |
0.2 | 1.8 | GO:0032045 | guanyl-nucleotide exchange factor complex(GO:0032045) |
0.2 | 18.3 | GO:0072562 | blood microparticle(GO:0072562) |
0.2 | 0.4 | GO:0034385 | very-low-density lipoprotein particle(GO:0034361) triglyceride-rich lipoprotein particle(GO:0034385) |
0.2 | 0.6 | GO:0042585 | germinal vesicle(GO:0042585) |
0.2 | 2.5 | GO:0001891 | phagocytic cup(GO:0001891) |
0.2 | 0.6 | GO:0030956 | glutamyl-tRNA(Gln) amidotransferase complex(GO:0030956) |
0.2 | 2.5 | GO:0005669 | transcription factor TFIID complex(GO:0005669) |
0.2 | 0.6 | GO:0030868 | smooth endoplasmic reticulum membrane(GO:0030868) smooth endoplasmic reticulum part(GO:0097425) |
0.2 | 0.8 | GO:0005642 | annulate lamellae(GO:0005642) |
0.2 | 0.8 | GO:0032009 | early phagosome(GO:0032009) |
0.2 | 0.8 | GO:0000322 | storage vacuole(GO:0000322) |
0.2 | 0.2 | GO:0098799 | outer mitochondrial membrane protein complex(GO:0098799) |
0.2 | 7.8 | GO:0009295 | nucleoid(GO:0009295) mitochondrial nucleoid(GO:0042645) |
0.2 | 0.7 | GO:0070776 | H3 histone acetyltransferase complex(GO:0070775) MOZ/MORF histone acetyltransferase complex(GO:0070776) |
0.2 | 0.5 | GO:0005896 | interleukin-6 receptor complex(GO:0005896) |
0.2 | 3.3 | GO:0000407 | pre-autophagosomal structure(GO:0000407) |
0.2 | 0.4 | GO:0005956 | protein kinase CK2 complex(GO:0005956) |
0.2 | 0.4 | GO:0042405 | nuclear inclusion body(GO:0042405) |
0.2 | 2.3 | GO:0030131 | clathrin adaptor complex(GO:0030131) |
0.2 | 3.1 | GO:0035861 | site of double-strand break(GO:0035861) |
0.2 | 4.6 | GO:0035869 | ciliary transition zone(GO:0035869) |
0.2 | 0.9 | GO:0034709 | methylosome(GO:0034709) |
0.2 | 1.1 | GO:0030061 | mitochondrial crista(GO:0030061) |
0.2 | 1.1 | GO:0098645 | collagen type IV trimer(GO:0005587) network-forming collagen trimer(GO:0098642) collagen network(GO:0098645) basement membrane collagen trimer(GO:0098651) |
0.2 | 0.2 | GO:0071203 | WASH complex(GO:0071203) |
0.2 | 0.7 | GO:0000805 | X chromosome(GO:0000805) |
0.2 | 0.7 | GO:0044354 | pinosome(GO:0044352) macropinosome(GO:0044354) |
0.2 | 1.2 | GO:0020005 | symbiont-containing vacuole membrane(GO:0020005) |
0.2 | 0.7 | GO:1990246 | uniplex complex(GO:1990246) |
0.2 | 0.5 | GO:0070765 | gamma-secretase complex(GO:0070765) |
0.2 | 8.4 | GO:0016605 | PML body(GO:0016605) |
0.2 | 0.5 | GO:0042627 | chylomicron(GO:0042627) |
0.2 | 0.9 | GO:0005663 | DNA replication factor C complex(GO:0005663) |
0.2 | 1.2 | GO:0016593 | Cdc73/Paf1 complex(GO:0016593) |
0.2 | 0.3 | GO:0008282 | ATP-sensitive potassium channel complex(GO:0008282) |
0.2 | 0.8 | GO:0019907 | cyclin-dependent protein kinase activating kinase holoenzyme complex(GO:0019907) |
0.2 | 3.7 | GO:0010494 | cytoplasmic stress granule(GO:0010494) |
0.2 | 1.0 | GO:0034098 | VCP-NPL4-UFD1 AAA ATPase complex(GO:0034098) |
0.2 | 0.7 | GO:0005675 | holo TFIIH complex(GO:0005675) |
0.2 | 1.7 | GO:0012510 | trans-Golgi network transport vesicle membrane(GO:0012510) |
0.2 | 0.7 | GO:0000408 | EKC/KEOPS complex(GO:0000408) |
0.2 | 0.8 | GO:0000796 | condensin complex(GO:0000796) |
0.2 | 0.3 | GO:0072559 | NLRP3 inflammasome complex(GO:0072559) |
0.2 | 2.8 | GO:0017053 | transcriptional repressor complex(GO:0017053) |
0.2 | 1.5 | GO:0005751 | mitochondrial respiratory chain complex IV(GO:0005751) |
0.2 | 0.8 | GO:0034992 | microtubule organizing center attachment site(GO:0034992) LINC complex(GO:0034993) |
0.2 | 0.7 | GO:0031371 | ubiquitin conjugating enzyme complex(GO:0031371) |
0.2 | 0.2 | GO:0016471 | vacuolar proton-transporting V-type ATPase complex(GO:0016471) |
0.2 | 2.0 | GO:0033391 | chromatoid body(GO:0033391) |
0.2 | 2.5 | GO:0070971 | endoplasmic reticulum exit site(GO:0070971) |
0.2 | 0.5 | GO:0031084 | BLOC-2 complex(GO:0031084) |
0.2 | 1.8 | GO:0005686 | U2 snRNP(GO:0005686) |
0.2 | 0.3 | GO:0031298 | replication fork protection complex(GO:0031298) |
0.2 | 1.5 | GO:0005682 | U5 snRNP(GO:0005682) |
0.2 | 0.8 | GO:0046930 | pore complex(GO:0046930) |
0.2 | 10.6 | GO:0005814 | centriole(GO:0005814) |
0.2 | 1.9 | GO:0016591 | DNA-directed RNA polymerase II, holoenzyme(GO:0016591) |
0.2 | 0.5 | GO:0042719 | mitochondrial intermembrane space protein transporter complex(GO:0042719) |
0.2 | 0.5 | GO:0042788 | polysomal ribosome(GO:0042788) |
0.2 | 0.2 | GO:0030991 | intraciliary transport particle A(GO:0030991) |
0.2 | 1.3 | GO:0070852 | cell body fiber(GO:0070852) |
0.2 | 20.4 | GO:0042579 | peroxisome(GO:0005777) microbody(GO:0042579) |
0.2 | 0.2 | GO:0031264 | death-inducing signaling complex(GO:0031264) |
0.2 | 7.2 | GO:0005643 | nuclear pore(GO:0005643) |
0.2 | 6.3 | GO:0022627 | cytosolic small ribosomal subunit(GO:0022627) |
0.2 | 7.6 | GO:0005811 | lipid particle(GO:0005811) |
0.2 | 0.8 | GO:0043219 | lateral loop(GO:0043219) |
0.2 | 0.5 | GO:0090543 | Flemming body(GO:0090543) |
0.2 | 0.9 | GO:0031931 | TORC1 complex(GO:0031931) |
0.2 | 7.4 | GO:0005758 | mitochondrial intermembrane space(GO:0005758) |
0.2 | 0.5 | GO:0005588 | collagen type V trimer(GO:0005588) |
0.2 | 4.1 | GO:0005801 | cis-Golgi network(GO:0005801) |
0.2 | 0.2 | GO:0097504 | Gemini of coiled bodies(GO:0097504) |
0.2 | 0.8 | GO:0045334 | clathrin-coated endocytic vesicle(GO:0045334) |
0.2 | 3.9 | GO:1990391 | DNA repair complex(GO:1990391) |
0.2 | 1.4 | GO:0045120 | pronucleus(GO:0045120) |
0.1 | 0.6 | GO:1990124 | messenger ribonucleoprotein complex(GO:1990124) |
0.1 | 0.7 | GO:0042105 | alpha-beta T cell receptor complex(GO:0042105) |
0.1 | 0.6 | GO:0098533 | ATPase dependent transmembrane transport complex(GO:0098533) |
0.1 | 0.9 | GO:1990454 | L-type voltage-gated calcium channel complex(GO:1990454) |
0.1 | 2.9 | GO:0030863 | cortical cytoskeleton(GO:0030863) |
0.1 | 2.2 | GO:0043196 | varicosity(GO:0043196) |
0.1 | 12.8 | GO:0000775 | chromosome, centromeric region(GO:0000775) |
0.1 | 0.4 | GO:0043293 | apoptosome(GO:0043293) |
0.1 | 0.1 | GO:0005915 | zonula adherens(GO:0005915) |
0.1 | 1.2 | GO:0008250 | oligosaccharyltransferase complex(GO:0008250) |
0.1 | 0.6 | GO:0044232 | organelle membrane contact site(GO:0044232) |
0.1 | 1.1 | GO:0030125 | clathrin vesicle coat(GO:0030125) |
0.1 | 2.3 | GO:0000307 | cyclin-dependent protein kinase holoenzyme complex(GO:0000307) |
0.1 | 0.6 | GO:0030689 | Noc complex(GO:0030689) |
0.1 | 5.4 | GO:0005905 | clathrin-coated pit(GO:0005905) |
0.1 | 8.1 | GO:0005938 | cell cortex(GO:0005938) |
0.1 | 0.4 | GO:0008540 | proteasome regulatory particle, base subcomplex(GO:0008540) |
0.1 | 0.4 | GO:0034457 | Mpp10 complex(GO:0034457) |
0.1 | 0.8 | GO:0005671 | Ada2/Gcn5/Ada3 transcription activator complex(GO:0005671) |
0.1 | 0.8 | GO:0000439 | core TFIIH complex(GO:0000439) |
0.1 | 1.6 | GO:0016234 | inclusion body(GO:0016234) |
0.1 | 0.7 | GO:0042587 | glycogen granule(GO:0042587) |
0.1 | 0.5 | GO:0046540 | U4/U6 x U5 tri-snRNP complex(GO:0046540) |
0.1 | 2.3 | GO:0005844 | polysome(GO:0005844) |
0.1 | 1.6 | GO:0005697 | telomerase holoenzyme complex(GO:0005697) |
0.1 | 1.0 | GO:0097208 | alveolar lamellar body(GO:0097208) |
0.1 | 2.2 | GO:0005788 | endoplasmic reticulum lumen(GO:0005788) |
0.1 | 1.3 | GO:0046581 | intercellular canaliculus(GO:0046581) |
0.1 | 0.1 | GO:0065010 | extracellular membrane-bounded organelle(GO:0065010) |
0.1 | 1.1 | GO:0008074 | guanylate cyclase complex, soluble(GO:0008074) |
0.1 | 1.0 | GO:0000346 | transcription export complex(GO:0000346) |
0.1 | 0.1 | GO:0044294 | dendritic growth cone(GO:0044294) |
0.1 | 1.3 | GO:0005795 | Golgi stack(GO:0005795) |
0.1 | 0.8 | GO:0071986 | Ragulator complex(GO:0071986) |
0.1 | 0.4 | GO:0000172 | ribonuclease MRP complex(GO:0000172) |
0.1 | 0.1 | GO:0097149 | centralspindlin complex(GO:0097149) |
0.1 | 6.6 | GO:0016607 | nuclear speck(GO:0016607) |
0.1 | 1.1 | GO:0031528 | microvillus membrane(GO:0031528) |
0.1 | 1.1 | GO:0005832 | chaperonin-containing T-complex(GO:0005832) |
0.1 | 1.2 | GO:0030126 | COPI vesicle coat(GO:0030126) |
0.1 | 1.2 | GO:0032580 | Golgi cisterna membrane(GO:0032580) |
0.1 | 6.7 | GO:0031463 | Cul3-RING ubiquitin ligase complex(GO:0031463) |
0.1 | 1.9 | GO:0001725 | stress fiber(GO:0001725) actin filament bundle(GO:0032432) contractile actin filament bundle(GO:0097517) |
0.1 | 0.2 | GO:0002193 | MAML1-RBP-Jkappa- ICN1 complex(GO:0002193) |
0.1 | 0.2 | GO:0005955 | calcineurin complex(GO:0005955) |
0.1 | 1.2 | GO:0030119 | AP-type membrane coat adaptor complex(GO:0030119) |
0.1 | 0.7 | GO:0001931 | uropod(GO:0001931) cell trailing edge(GO:0031254) |
0.1 | 0.2 | GO:0097255 | R2TP complex(GO:0097255) |
0.1 | 2.4 | GO:0045171 | intercellular bridge(GO:0045171) |
0.1 | 0.2 | GO:0044393 | microspike(GO:0044393) |
0.1 | 0.4 | GO:0070044 | synaptobrevin 2-SNAP-25-syntaxin-1a complex(GO:0070044) |
0.1 | 1.1 | GO:0097546 | ciliary base(GO:0097546) |
0.1 | 0.2 | GO:0009331 | glycerol-3-phosphate dehydrogenase complex(GO:0009331) |
0.1 | 1.3 | GO:0035327 | transcriptionally active chromatin(GO:0035327) |
0.1 | 2.7 | GO:0008023 | transcription elongation factor complex(GO:0008023) |
0.1 | 4.1 | GO:0000315 | organellar large ribosomal subunit(GO:0000315) mitochondrial large ribosomal subunit(GO:0005762) |
0.1 | 0.4 | GO:0070688 | MLL5-L complex(GO:0070688) |
0.1 | 0.7 | GO:0016600 | flotillin complex(GO:0016600) |
0.1 | 1.8 | GO:0002080 | acrosomal membrane(GO:0002080) |
0.1 | 0.6 | GO:0045252 | dihydrolipoyl dehydrogenase complex(GO:0045240) oxoglutarate dehydrogenase complex(GO:0045252) |
0.1 | 0.3 | GO:0031232 | extrinsic component of external side of plasma membrane(GO:0031232) |
0.1 | 0.5 | GO:0097136 | Bcl-2 family protein complex(GO:0097136) |
0.1 | 0.7 | GO:0000242 | pericentriolar material(GO:0000242) |
0.1 | 0.5 | GO:0044194 | cytolytic granule(GO:0044194) |
0.1 | 0.1 | GO:0097450 | astrocyte end-foot(GO:0097450) |
0.1 | 0.4 | GO:0035867 | alphav-beta3 integrin-IGF-1-IGF1R complex(GO:0035867) |
0.1 | 1.5 | GO:0032391 | photoreceptor connecting cilium(GO:0032391) |
0.1 | 0.2 | GO:0005652 | nuclear lamina(GO:0005652) |
0.1 | 0.4 | GO:0030688 | preribosome, small subunit precursor(GO:0030688) |
0.1 | 3.6 | GO:0045178 | basal part of cell(GO:0045178) |
0.1 | 0.4 | GO:0045259 | proton-transporting ATP synthase complex(GO:0045259) |
0.1 | 112.7 | GO:0005829 | cytosol(GO:0005829) |
0.1 | 1.9 | GO:0000786 | nucleosome(GO:0000786) |
0.1 | 1.1 | GO:0034663 | endoplasmic reticulum chaperone complex(GO:0034663) |
0.1 | 22.9 | GO:0005813 | centrosome(GO:0005813) |
0.1 | 0.7 | GO:0000124 | SAGA complex(GO:0000124) |
0.1 | 0.6 | GO:0032591 | dendritic spine membrane(GO:0032591) |
0.1 | 0.6 | GO:0000502 | proteasome complex(GO:0000502) |
0.1 | 0.6 | GO:0070603 | SWI/SNF superfamily-type complex(GO:0070603) |
0.1 | 0.3 | GO:0001520 | outer dense fiber(GO:0001520) |
0.1 | 3.6 | GO:0045271 | mitochondrial respiratory chain complex I(GO:0005747) NADH dehydrogenase complex(GO:0030964) respiratory chain complex I(GO:0045271) |
0.1 | 0.2 | GO:0016442 | RISC complex(GO:0016442) RNAi effector complex(GO:0031332) |
0.1 | 0.1 | GO:0020003 | symbiont-containing vacuole(GO:0020003) |
0.1 | 0.3 | GO:0032154 | cleavage furrow(GO:0032154) cell surface furrow(GO:0097610) |
0.1 | 0.4 | GO:0030127 | COPII vesicle coat(GO:0030127) |
0.1 | 0.5 | GO:0031512 | motile primary cilium(GO:0031512) |
0.1 | 0.2 | GO:0000835 | ER ubiquitin ligase complex(GO:0000835) Hrd1p ubiquitin ligase complex(GO:0000836) |
0.1 | 0.3 | GO:0005840 | ribosome(GO:0005840) |
0.1 | 0.2 | GO:0097452 | GAIT complex(GO:0097452) |
0.1 | 2.1 | GO:0030496 | midbody(GO:0030496) |
0.1 | 1.0 | GO:0005771 | multivesicular body(GO:0005771) |
0.1 | 1.6 | GO:0000152 | nuclear ubiquitin ligase complex(GO:0000152) |
0.1 | 20.7 | GO:0005743 | mitochondrial inner membrane(GO:0005743) |
0.1 | 6.4 | GO:0005903 | brush border(GO:0005903) |
0.1 | 0.4 | GO:0000813 | ESCRT I complex(GO:0000813) |
0.1 | 0.2 | GO:1990923 | PET complex(GO:1990923) |
0.1 | 1.2 | GO:0005852 | eukaryotic translation initiation factor 3 complex(GO:0005852) |
0.1 | 0.3 | GO:0044462 | cell outer membrane(GO:0009279) cell envelope(GO:0030313) external encapsulating structure part(GO:0044462) |
0.1 | 1.8 | GO:0031519 | PcG protein complex(GO:0031519) |
0.1 | 0.3 | GO:0046691 | intracellular canaliculus(GO:0046691) |
0.1 | 2.8 | GO:0005793 | endoplasmic reticulum-Golgi intermediate compartment(GO:0005793) |
0.1 | 0.4 | GO:0034518 | mRNA cap binding complex(GO:0005845) RNA cap binding complex(GO:0034518) |
0.1 | 0.4 | GO:0016272 | prefoldin complex(GO:0016272) |
0.1 | 23.4 | GO:0005694 | chromosome(GO:0005694) |
0.1 | 69.8 | GO:0005654 | nucleoplasm(GO:0005654) |
0.1 | 0.5 | GO:0017119 | Golgi transport complex(GO:0017119) |
0.1 | 0.5 | GO:0000127 | transcription factor TFIIIC complex(GO:0000127) |
0.1 | 0.1 | GO:0030137 | COPI-coated vesicle(GO:0030137) |
0.1 | 0.3 | GO:0002102 | podosome(GO:0002102) |
0.1 | 0.3 | GO:0031970 | organelle envelope lumen(GO:0031970) |
0.1 | 2.7 | GO:0001750 | photoreceptor outer segment(GO:0001750) |
0.1 | 0.2 | GO:0097512 | cardiac myofibril(GO:0097512) |
0.1 | 0.4 | GO:0045335 | phagocytic vesicle(GO:0045335) |
0.1 | 0.2 | GO:0002199 | zona pellucida receptor complex(GO:0002199) |
0.1 | 0.1 | GO:0090576 | RNA polymerase III transcription factor complex(GO:0090576) |
0.1 | 0.2 | GO:0032937 | SREBP-SCAP-Insig complex(GO:0032937) |
0.1 | 0.2 | GO:0097422 | tubular endosome(GO:0097422) |
0.1 | 0.3 | GO:0042581 | specific granule(GO:0042581) |
0.1 | 0.2 | GO:0005968 | Rab-protein geranylgeranyltransferase complex(GO:0005968) |
0.1 | 0.2 | GO:0030485 | smooth muscle contractile fiber(GO:0030485) |
0.1 | 0.1 | GO:0043657 | host(GO:0018995) host cell part(GO:0033643) host cell(GO:0043657) |
0.1 | 0.1 | GO:0034673 | inhibin-betaglycan-ActRII complex(GO:0034673) |
0.1 | 3.1 | GO:0010008 | endosome membrane(GO:0010008) |
0.1 | 0.2 | GO:0071782 | endoplasmic reticulum tubular network(GO:0071782) |
0.1 | 0.4 | GO:0005964 | phosphorylase kinase complex(GO:0005964) |
0.1 | 2.2 | GO:0019005 | SCF ubiquitin ligase complex(GO:0019005) |
0.1 | 0.1 | GO:1990909 | Wnt signalosome(GO:1990909) |
0.1 | 0.1 | GO:0005785 | signal recognition particle receptor complex(GO:0005785) |
0.1 | 0.3 | GO:0030681 | nucleolar ribonuclease P complex(GO:0005655) ribonuclease P complex(GO:0030677) multimeric ribonuclease P complex(GO:0030681) |
0.1 | 2.3 | GO:0016459 | myosin complex(GO:0016459) |
0.1 | 0.2 | GO:0005610 | laminin-5 complex(GO:0005610) |
0.1 | 0.4 | GO:0048500 | signal recognition particle, endoplasmic reticulum targeting(GO:0005786) signal recognition particle(GO:0048500) |
0.1 | 1.1 | GO:0055037 | recycling endosome(GO:0055037) |
0.1 | 0.1 | GO:0030687 | preribosome, large subunit precursor(GO:0030687) |
0.1 | 0.3 | GO:0030008 | TRAPP complex(GO:0030008) |
0.1 | 0.6 | GO:0055038 | recycling endosome membrane(GO:0055038) |
0.1 | 0.3 | GO:0071011 | precatalytic spliceosome(GO:0071011) |
0.1 | 0.1 | GO:1990712 | HFE-transferrin receptor complex(GO:1990712) |
0.1 | 2.5 | GO:0000151 | ubiquitin ligase complex(GO:0000151) |
0.1 | 44.0 | GO:0005739 | mitochondrion(GO:0005739) |
0.1 | 0.3 | GO:0005851 | eukaryotic translation initiation factor 2B complex(GO:0005851) |
0.1 | 7.0 | GO:0000139 | Golgi membrane(GO:0000139) |
0.1 | 4.0 | GO:0045177 | apical part of cell(GO:0045177) |
0.1 | 0.1 | GO:0042583 | chromaffin granule(GO:0042583) |
0.1 | 0.1 | GO:0001917 | photoreceptor inner segment(GO:0001917) |
0.1 | 0.1 | GO:0044308 | axonal spine(GO:0044308) |
0.1 | 0.1 | GO:0005577 | fibrinogen complex(GO:0005577) |
0.1 | 0.7 | GO:0005902 | microvillus(GO:0005902) |
0.1 | 2.5 | GO:0005681 | spliceosomal complex(GO:0005681) |
0.1 | 1.4 | GO:0005815 | microtubule organizing center(GO:0005815) |
0.1 | 0.7 | GO:0005605 | basal lamina(GO:0005605) |
0.1 | 0.1 | GO:0097449 | astrocyte projection(GO:0097449) |
0.1 | 2.0 | GO:0045111 | intermediate filament cytoskeleton(GO:0045111) |
0.0 | 0.0 | GO:0005796 | Golgi lumen(GO:0005796) |
0.0 | 0.3 | GO:0097197 | tetraspanin-enriched microdomain(GO:0097197) |
0.0 | 0.1 | GO:1990745 | EARP complex(GO:1990745) |
0.0 | 0.1 | GO:0033185 | dolichol-phosphate-mannose synthase complex(GO:0033185) |
0.0 | 55.4 | GO:0070062 | extracellular exosome(GO:0070062) |
0.0 | 0.3 | GO:0005776 | autophagosome(GO:0005776) |
0.0 | 0.1 | GO:0000176 | nuclear exosome (RNase complex)(GO:0000176) |
0.0 | 0.7 | GO:0005865 | striated muscle thin filament(GO:0005865) |
0.0 | 0.1 | GO:0038201 | TORC2 complex(GO:0031932) TOR complex(GO:0038201) |
0.0 | 0.0 | GO:0070032 | synaptobrevin 2-SNAP-25-syntaxin-1a-complexin I complex(GO:0070032) |
0.0 | 0.1 | GO:0070578 | RISC-loading complex(GO:0070578) |
0.0 | 0.1 | GO:0005914 | spot adherens junction(GO:0005914) |
0.0 | 1.4 | GO:0098852 | lysosomal membrane(GO:0005765) lytic vacuole membrane(GO:0098852) |
0.0 | 0.1 | GO:0031501 | mannosyltransferase complex(GO:0031501) |
0.0 | 0.7 | GO:0016328 | lateral plasma membrane(GO:0016328) |
0.0 | 0.0 | GO:0000938 | GARP complex(GO:0000938) |
0.0 | 1.7 | GO:0005581 | collagen trimer(GO:0005581) |
0.0 | 0.0 | GO:0030880 | RNA polymerase complex(GO:0030880) |
0.0 | 0.0 | GO:0031074 | nucleocytoplasmic shuttling complex(GO:0031074) |
0.0 | 1.8 | GO:0001669 | acrosomal vesicle(GO:0001669) |
0.0 | 0.1 | GO:1903293 | protein serine/threonine phosphatase complex(GO:0008287) phosphatase complex(GO:1903293) |
0.0 | 2.7 | GO:0005764 | lytic vacuole(GO:0000323) lysosome(GO:0005764) |
0.0 | 0.1 | GO:0030289 | protein phosphatase 4 complex(GO:0030289) |
0.0 | 0.0 | GO:0098827 | endoplasmic reticulum subcompartment(GO:0098827) |
0.0 | 0.1 | GO:0016528 | sarcoplasm(GO:0016528) |
0.0 | 0.1 | GO:0032584 | growth cone membrane(GO:0032584) |
0.0 | 0.1 | GO:1990131 | EGO complex(GO:0034448) Gtr1-Gtr2 GTPase complex(GO:1990131) |
0.0 | 0.1 | GO:0034708 | methyltransferase complex(GO:0034708) |
0.0 | 0.1 | GO:0030897 | HOPS complex(GO:0030897) |
0.0 | 0.1 | GO:0002177 | manchette(GO:0002177) |
0.0 | 0.0 | GO:0033269 | internode region of axon(GO:0033269) |
0.0 | 0.1 | GO:1990204 | oxidoreductase complex(GO:1990204) |
0.0 | 0.1 | GO:0031091 | platelet alpha granule(GO:0031091) |
0.0 | 0.2 | GO:0005732 | small nucleolar ribonucleoprotein complex(GO:0005732) |
0.0 | 0.0 | GO:0097386 | glial cell projection(GO:0097386) |
0.0 | 0.3 | GO:0090665 | dystrophin-associated glycoprotein complex(GO:0016010) glycoprotein complex(GO:0090665) |
0.0 | 0.1 | GO:0060170 | ciliary membrane(GO:0060170) |
0.0 | 0.1 | GO:0030667 | secretory granule membrane(GO:0030667) |
0.0 | 0.2 | GO:0098636 | protein complex involved in cell adhesion(GO:0098636) |
0.0 | 0.1 | GO:0042599 | lamellar body(GO:0042599) |
0.0 | 1.3 | GO:0016323 | basolateral plasma membrane(GO:0016323) |
0.0 | 0.0 | GO:1990716 | axonemal central apparatus(GO:1990716) |
0.0 | 3.6 | GO:0031974 | membrane-enclosed lumen(GO:0031974) |
0.0 | 0.1 | GO:0035686 | sperm fibrous sheath(GO:0035686) |
0.0 | 0.0 | GO:0000178 | exosome (RNase complex)(GO:0000178) |
0.0 | 0.3 | GO:0045095 | keratin filament(GO:0045095) |
0.0 | 0.5 | GO:0001726 | ruffle(GO:0001726) |
0.0 | 0.0 | GO:0042641 | actomyosin(GO:0042641) |
0.0 | 10.1 | GO:0005783 | endoplasmic reticulum(GO:0005783) |
0.0 | 0.3 | GO:0005921 | gap junction(GO:0005921) |
0.0 | 0.1 | GO:0036157 | outer dynein arm(GO:0036157) |
0.0 | 0.0 | GO:0001674 | female germ cell nucleus(GO:0001674) |
0.0 | 0.4 | GO:0031514 | motile cilium(GO:0031514) |
0.0 | 1.2 | GO:0005667 | transcription factor complex(GO:0005667) |
0.0 | 0.0 | GO:0034362 | low-density lipoprotein particle(GO:0034362) |
0.0 | 0.0 | GO:0097058 | CRLF-CLCF1 complex(GO:0097058) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
2.9 | 8.7 | GO:0005345 | purine nucleobase transmembrane transporter activity(GO:0005345) pyrimidine nucleobase transmembrane transporter activity(GO:0005350) nucleobase transmembrane transporter activity(GO:0015205) |
1.4 | 4.1 | GO:0043125 | ErbB-3 class receptor binding(GO:0043125) |
1.3 | 7.6 | GO:0003956 | NAD(P)+-protein-arginine ADP-ribosyltransferase activity(GO:0003956) |
1.1 | 1.1 | GO:0043423 | 3-phosphoinositide-dependent protein kinase binding(GO:0043423) |
1.1 | 4.3 | GO:0043515 | kinetochore binding(GO:0043515) |
1.1 | 4.3 | GO:0035615 | clathrin adaptor activity(GO:0035615) endocytic adaptor activity(GO:0098748) |
1.0 | 4.1 | GO:0004740 | pyruvate dehydrogenase (acetyl-transferring) kinase activity(GO:0004740) |
1.0 | 2.9 | GO:0046573 | lactonohydrolase activity(GO:0046573) acyl-L-homoserine-lactone lactonohydrolase activity(GO:0102007) |
0.9 | 3.8 | GO:0031721 | hemoglobin alpha binding(GO:0031721) |
0.9 | 3.7 | GO:0070053 | thrombospondin receptor activity(GO:0070053) |
0.9 | 3.6 | GO:0004062 | aryl sulfotransferase activity(GO:0004062) |
0.9 | 2.7 | GO:0060230 | lipoprotein lipase activator activity(GO:0060230) |
0.9 | 2.7 | GO:0030492 | hemoglobin binding(GO:0030492) |
0.8 | 2.5 | GO:0031711 | bradykinin receptor binding(GO:0031711) |
0.7 | 2.2 | GO:1990188 | euchromatin binding(GO:1990188) |
0.7 | 0.7 | GO:0042392 | sphingosine-1-phosphate phosphatase activity(GO:0042392) |
0.7 | 2.2 | GO:0019961 | interferon binding(GO:0019961) |
0.7 | 0.7 | GO:0018423 | protein C-terminal leucine carboxyl O-methyltransferase activity(GO:0018423) |
0.7 | 2.1 | GO:0008142 | oxysterol binding(GO:0008142) |
0.7 | 7.6 | GO:0070410 | co-SMAD binding(GO:0070410) |
0.7 | 5.4 | GO:0008430 | selenium binding(GO:0008430) |
0.7 | 2.0 | GO:0009041 | uridylate kinase activity(GO:0009041) |
0.7 | 2.6 | GO:0008970 | phosphatidylcholine 1-acylhydrolase activity(GO:0008970) |
0.7 | 2.6 | GO:0036033 | mediator complex binding(GO:0036033) |
0.6 | 1.9 | GO:0008525 | phosphatidylcholine transporter activity(GO:0008525) |
0.6 | 4.4 | GO:0005078 | MAP-kinase scaffold activity(GO:0005078) |
0.6 | 1.9 | GO:0016635 | oxidoreductase activity, acting on the CH-CH group of donors, quinone or related compound as acceptor(GO:0016635) |
0.6 | 1.8 | GO:0071208 | histone pre-mRNA DCP binding(GO:0071208) |
0.6 | 2.4 | GO:0052650 | NADP-retinol dehydrogenase activity(GO:0052650) |
0.6 | 2.4 | GO:0033592 | RNA strand annealing activity(GO:0033592) |
0.6 | 1.8 | GO:0004687 | myosin light chain kinase activity(GO:0004687) |
0.6 | 4.7 | GO:0097371 | MDM2/MDM4 family protein binding(GO:0097371) |
0.6 | 1.7 | GO:0030350 | iron-responsive element binding(GO:0030350) |
0.6 | 1.7 | GO:0004616 | phosphogluconate dehydrogenase (decarboxylating) activity(GO:0004616) |
0.6 | 2.9 | GO:0017034 | Rap guanyl-nucleotide exchange factor activity(GO:0017034) |
0.6 | 2.9 | GO:0004301 | epoxide hydrolase activity(GO:0004301) |
0.6 | 1.7 | GO:0031800 | type 3 metabotropic glutamate receptor binding(GO:0031800) |
0.6 | 1.7 | GO:0003941 | L-serine ammonia-lyase activity(GO:0003941) |
0.6 | 2.2 | GO:0004887 | thyroid hormone receptor activity(GO:0004887) |
0.6 | 2.2 | GO:0071074 | eukaryotic initiation factor eIF2 binding(GO:0071074) |
0.6 | 1.7 | GO:0043546 | molybdopterin cofactor binding(GO:0043546) |
0.5 | 1.6 | GO:0019960 | C-X3-C chemokine binding(GO:0019960) |
0.5 | 2.2 | GO:0004095 | carnitine O-palmitoyltransferase activity(GO:0004095) |
0.5 | 3.2 | GO:0045505 | dynein intermediate chain binding(GO:0045505) |
0.5 | 2.1 | GO:0004566 | beta-glucuronidase activity(GO:0004566) |
0.5 | 2.7 | GO:0001884 | pyrimidine nucleoside binding(GO:0001884) |
0.5 | 1.1 | GO:0008545 | JUN kinase kinase activity(GO:0008545) |
0.5 | 3.2 | GO:0004322 | ferroxidase activity(GO:0004322) oxidoreductase activity, oxidizing metal ions, oxygen as acceptor(GO:0016724) |
0.5 | 1.0 | GO:0016803 | ether hydrolase activity(GO:0016803) |
0.5 | 2.1 | GO:0000340 | RNA 7-methylguanosine cap binding(GO:0000340) |
0.5 | 1.6 | GO:0015265 | urea channel activity(GO:0015265) |
0.5 | 3.6 | GO:0019957 | C-C chemokine binding(GO:0019957) |
0.5 | 0.5 | GO:0070538 | oleic acid binding(GO:0070538) |
0.5 | 7.2 | GO:0001671 | ATPase activator activity(GO:0001671) |
0.5 | 3.5 | GO:0098505 | G-rich strand telomeric DNA binding(GO:0098505) |
0.5 | 1.5 | GO:0004345 | glucose-6-phosphate dehydrogenase activity(GO:0004345) |
0.5 | 2.0 | GO:0032554 | purine deoxyribonucleotide binding(GO:0032554) |
0.5 | 3.0 | GO:0016937 | short-branched-chain-acyl-CoA dehydrogenase activity(GO:0016937) |
0.5 | 0.5 | GO:0033677 | DNA/RNA helicase activity(GO:0033677) |
0.5 | 2.5 | GO:0052724 | inositol hexakisphosphate kinase activity(GO:0000828) inositol hexakisphosphate 5-kinase activity(GO:0000832) inositol hexakisphosphate 1-kinase activity(GO:0052723) inositol hexakisphosphate 3-kinase activity(GO:0052724) |
0.5 | 9.7 | GO:0046965 | retinoid X receptor binding(GO:0046965) |
0.5 | 1.9 | GO:0019158 | fructokinase activity(GO:0008865) mannokinase activity(GO:0019158) |
0.5 | 1.4 | GO:0015182 | L-asparagine transmembrane transporter activity(GO:0015182) L-glutamine transmembrane transporter activity(GO:0015186) |
0.5 | 3.8 | GO:0022889 | L-serine transmembrane transporter activity(GO:0015194) serine transmembrane transporter activity(GO:0022889) |
0.5 | 2.3 | GO:0070728 | leucine binding(GO:0070728) |
0.5 | 4.7 | GO:0043024 | ribosomal small subunit binding(GO:0043024) |
0.5 | 1.9 | GO:0005173 | stem cell factor receptor binding(GO:0005173) |
0.5 | 1.4 | GO:0055100 | adiponectin binding(GO:0055100) |
0.5 | 1.8 | GO:0000293 | ferric-chelate reductase activity(GO:0000293) |
0.5 | 0.5 | GO:0015925 | galactosidase activity(GO:0015925) |
0.4 | 1.3 | GO:0004487 | methenyltetrahydrofolate cyclohydrolase activity(GO:0004477) methylenetetrahydrofolate dehydrogenase (NAD+) activity(GO:0004487) |
0.4 | 2.2 | GO:0004791 | thioredoxin-disulfide reductase activity(GO:0004791) |
0.4 | 2.2 | GO:1990239 | steroid hormone binding(GO:1990239) |
0.4 | 2.7 | GO:0061505 | DNA topoisomerase type II (ATP-hydrolyzing) activity(GO:0003918) DNA topoisomerase II activity(GO:0061505) |
0.4 | 1.3 | GO:0016649 | electron-transferring-flavoprotein dehydrogenase activity(GO:0004174) oxidoreductase activity, acting on the CH-NH group of donors, quinone or similar compound as acceptor(GO:0016649) |
0.4 | 0.9 | GO:0070644 | vitamin D response element binding(GO:0070644) |
0.4 | 1.3 | GO:0008506 | sucrose:proton symporter activity(GO:0008506) sucrose transmembrane transporter activity(GO:0008515) disaccharide transmembrane transporter activity(GO:0015154) oligosaccharide transmembrane transporter activity(GO:0015157) |
0.4 | 5.3 | GO:0035497 | cAMP response element binding(GO:0035497) |
0.4 | 2.6 | GO:0001094 | TFIID-class transcription factor binding(GO:0001094) |
0.4 | 0.9 | GO:0004706 | JUN kinase kinase kinase activity(GO:0004706) |
0.4 | 1.3 | GO:0051575 | 5'-deoxyribose-5-phosphate lyase activity(GO:0051575) |
0.4 | 1.7 | GO:0015232 | heme transporter activity(GO:0015232) |
0.4 | 1.3 | GO:0008384 | IkappaB kinase activity(GO:0008384) |
0.4 | 2.1 | GO:0030292 | protein tyrosine kinase inhibitor activity(GO:0030292) |
0.4 | 4.5 | GO:0043138 | 3'-5' DNA helicase activity(GO:0043138) |
0.4 | 1.2 | GO:0031752 | D5 dopamine receptor binding(GO:0031752) |
0.4 | 1.6 | GO:0004090 | carbonyl reductase (NADPH) activity(GO:0004090) |
0.4 | 1.2 | GO:0061665 | SUMO ligase activity(GO:0061665) |
0.4 | 2.4 | GO:0005049 | nuclear export signal receptor activity(GO:0005049) |
0.4 | 3.6 | GO:0043995 | histone acetyltransferase activity (H4-K5 specific)(GO:0043995) histone acetyltransferase activity (H4-K8 specific)(GO:0043996) histone acetyltransferase activity (H4-K16 specific)(GO:0046972) |
0.4 | 0.4 | GO:0035368 | selenocysteine insertion sequence binding(GO:0035368) |
0.4 | 4.7 | GO:0031994 | insulin-like growth factor I binding(GO:0031994) |
0.4 | 5.9 | GO:0004679 | AMP-activated protein kinase activity(GO:0004679) |
0.4 | 2.0 | GO:0047499 | calcium-independent phospholipase A2 activity(GO:0047499) |
0.4 | 0.8 | GO:0005072 | transforming growth factor beta receptor, cytoplasmic mediator activity(GO:0005072) |
0.4 | 0.8 | GO:0031720 | haptoglobin binding(GO:0031720) |
0.4 | 1.6 | GO:0042809 | vitamin D receptor binding(GO:0042809) |
0.4 | 0.8 | GO:0004694 | eukaryotic translation initiation factor 2alpha kinase activity(GO:0004694) |
0.4 | 3.1 | GO:0001164 | RNA polymerase I regulatory region sequence-specific DNA binding(GO:0001163) RNA polymerase I CORE element sequence-specific DNA binding(GO:0001164) |
0.4 | 0.4 | GO:0001013 | RNA polymerase I regulatory region DNA binding(GO:0001013) |
0.4 | 1.5 | GO:0047105 | aminobutyraldehyde dehydrogenase activity(GO:0019145) 4-trimethylammoniobutyraldehyde dehydrogenase activity(GO:0047105) |
0.4 | 1.5 | GO:0003847 | 1-alkyl-2-acetylglycerophosphocholine esterase activity(GO:0003847) |
0.4 | 8.4 | GO:0043027 | cysteine-type endopeptidase inhibitor activity involved in apoptotic process(GO:0043027) |
0.4 | 1.1 | GO:0008732 | threonine aldolase activity(GO:0004793) L-allo-threonine aldolase activity(GO:0008732) |
0.4 | 7.9 | GO:0070003 | threonine-type endopeptidase activity(GO:0004298) threonine-type peptidase activity(GO:0070003) |
0.4 | 1.5 | GO:0055056 | D-glucose transmembrane transporter activity(GO:0055056) |
0.4 | 1.5 | GO:1990715 | mRNA CDS binding(GO:1990715) |
0.4 | 0.7 | GO:0001069 | regulatory region RNA binding(GO:0001069) |
0.4 | 2.9 | GO:0042974 | retinoic acid receptor binding(GO:0042974) |
0.4 | 3.6 | GO:0070016 | armadillo repeat domain binding(GO:0070016) |
0.4 | 0.4 | GO:0030519 | snoRNP binding(GO:0030519) |
0.4 | 2.9 | GO:0010314 | phosphatidylinositol-5-phosphate binding(GO:0010314) |
0.4 | 1.1 | GO:0070548 | L-glutamine aminotransferase activity(GO:0070548) |
0.4 | 1.4 | GO:0004591 | oxoglutarate dehydrogenase (succinyl-transferring) activity(GO:0004591) |
0.4 | 1.8 | GO:0016151 | nickel cation binding(GO:0016151) |
0.4 | 1.1 | GO:0045340 | mercury ion binding(GO:0045340) |
0.4 | 4.6 | GO:0008329 | signaling pattern recognition receptor activity(GO:0008329) pattern recognition receptor activity(GO:0038187) |
0.4 | 5.7 | GO:0070412 | R-SMAD binding(GO:0070412) |
0.4 | 0.7 | GO:0060228 | phosphatidylcholine-sterol O-acyltransferase activator activity(GO:0060228) |
0.3 | 1.0 | GO:0004064 | arylesterase activity(GO:0004064) |
0.3 | 1.4 | GO:0004839 | ubiquitin activating enzyme activity(GO:0004839) |
0.3 | 2.1 | GO:0050733 | RS domain binding(GO:0050733) |
0.3 | 1.0 | GO:0010484 | H3 histone acetyltransferase activity(GO:0010484) |
0.3 | 6.6 | GO:0001848 | complement binding(GO:0001848) |
0.3 | 0.3 | GO:0004698 | calcium-dependent protein kinase C activity(GO:0004698) |
0.3 | 3.8 | GO:0004535 | poly(A)-specific ribonuclease activity(GO:0004535) |
0.3 | 4.4 | GO:0017091 | AU-rich element binding(GO:0017091) |
0.3 | 1.4 | GO:0030957 | Tat protein binding(GO:0030957) |
0.3 | 1.0 | GO:0070653 | high-density lipoprotein particle receptor binding(GO:0070653) |
0.3 | 1.0 | GO:0016716 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, another compound as one donor, and incorporation of one atom of oxygen(GO:0016716) |
0.3 | 3.1 | GO:0008568 | microtubule-severing ATPase activity(GO:0008568) |
0.3 | 4.4 | GO:1900750 | glutathione binding(GO:0043295) oligopeptide binding(GO:1900750) |
0.3 | 2.4 | GO:0050072 | m7G(5')pppN diphosphatase activity(GO:0050072) |
0.3 | 3.0 | GO:0001206 | transcriptional repressor activity, RNA polymerase II distal enhancer sequence-specific binding(GO:0001206) |
0.3 | 1.3 | GO:0004792 | thiosulfate sulfurtransferase activity(GO:0004792) |
0.3 | 16.6 | GO:0070491 | repressing transcription factor binding(GO:0070491) |
0.3 | 1.0 | GO:0008503 | benzodiazepine receptor activity(GO:0008503) |
0.3 | 2.6 | GO:0004767 | sphingomyelin phosphodiesterase activity(GO:0004767) |
0.3 | 1.0 | GO:0050252 | retinol O-fatty-acyltransferase activity(GO:0050252) |
0.3 | 1.0 | GO:0019002 | GMP binding(GO:0019002) |
0.3 | 0.6 | GO:0016743 | carboxyl- or carbamoyltransferase activity(GO:0016743) |
0.3 | 2.2 | GO:0035005 | 1-phosphatidylinositol-4-phosphate 3-kinase activity(GO:0035005) |
0.3 | 2.2 | GO:0048027 | mRNA 5'-UTR binding(GO:0048027) |
0.3 | 0.9 | GO:0071535 | RING-like zinc finger domain binding(GO:0071535) |
0.3 | 0.3 | GO:0015204 | urea transmembrane transporter activity(GO:0015204) |
0.3 | 2.5 | GO:0071933 | Arp2/3 complex binding(GO:0071933) |
0.3 | 1.6 | GO:0016783 | sulfurtransferase activity(GO:0016783) |
0.3 | 1.3 | GO:0015220 | choline transmembrane transporter activity(GO:0015220) |
0.3 | 0.9 | GO:0016149 | translation release factor activity, codon specific(GO:0016149) |
0.3 | 0.9 | GO:0005094 | Rho GDP-dissociation inhibitor activity(GO:0005094) |
0.3 | 3.7 | GO:0017166 | vinculin binding(GO:0017166) |
0.3 | 9.6 | GO:0004712 | protein serine/threonine/tyrosine kinase activity(GO:0004712) |
0.3 | 0.6 | GO:0003986 | acetyl-CoA hydrolase activity(GO:0003986) |
0.3 | 0.6 | GO:0051434 | BH3 domain binding(GO:0051434) |
0.3 | 2.1 | GO:0009931 | calcium-dependent protein serine/threonine kinase activity(GO:0009931) |
0.3 | 3.9 | GO:0016290 | palmitoyl-CoA hydrolase activity(GO:0016290) |
0.3 | 0.3 | GO:0004942 | anaphylatoxin receptor activity(GO:0004942) |
0.3 | 3.9 | GO:0004190 | aspartic-type endopeptidase activity(GO:0004190) aspartic-type peptidase activity(GO:0070001) |
0.3 | 8.7 | GO:0004693 | cyclin-dependent protein serine/threonine kinase activity(GO:0004693) cyclin-dependent protein kinase activity(GO:0097472) |
0.3 | 3.3 | GO:0015129 | lactate transmembrane transporter activity(GO:0015129) |
0.3 | 1.2 | GO:0004337 | geranyltranstransferase activity(GO:0004337) |
0.3 | 0.9 | GO:0004719 | protein-L-isoaspartate (D-aspartate) O-methyltransferase activity(GO:0004719) |
0.3 | 1.5 | GO:0031013 | troponin I binding(GO:0031013) |
0.3 | 1.8 | GO:0035312 | 5'-3' exodeoxyribonuclease activity(GO:0035312) |
0.3 | 0.3 | GO:0098847 | sequence-specific single stranded DNA binding(GO:0098847) |
0.3 | 4.7 | GO:0016780 | phosphotransferase activity, for other substituted phosphate groups(GO:0016780) |
0.3 | 0.3 | GO:0046978 | TAP1 binding(GO:0046978) TAP2 binding(GO:0046979) |
0.3 | 5.2 | GO:0043325 | phosphatidylinositol-3,4-bisphosphate binding(GO:0043325) |
0.3 | 1.2 | GO:0000213 | tRNA-intron endonuclease activity(GO:0000213) |
0.3 | 1.1 | GO:0043842 | Kdo transferase activity(GO:0043842) |
0.3 | 0.8 | GO:0004920 | interleukin-10 receptor activity(GO:0004920) |
0.3 | 2.3 | GO:0038036 | sphingosine-1-phosphate receptor activity(GO:0038036) |
0.3 | 0.3 | GO:0008504 | monoamine transmembrane transporter activity(GO:0008504) |
0.3 | 8.1 | GO:0017112 | Rab guanyl-nucleotide exchange factor activity(GO:0017112) |
0.3 | 3.6 | GO:0046966 | thyroid hormone receptor binding(GO:0046966) |
0.3 | 3.6 | GO:0010181 | FMN binding(GO:0010181) |
0.3 | 0.6 | GO:0050692 | DBD domain binding(GO:0050692) |
0.3 | 0.8 | GO:0008898 | S-adenosylmethionine-homocysteine S-methyltransferase activity(GO:0008898) |
0.3 | 4.1 | GO:0008143 | poly(A) binding(GO:0008143) |
0.3 | 0.8 | GO:0030628 | pre-mRNA 3'-splice site binding(GO:0030628) |
0.3 | 2.5 | GO:0042500 | aspartic endopeptidase activity, intramembrane cleaving(GO:0042500) |
0.3 | 1.6 | GO:0097153 | cysteine-type endopeptidase activity involved in apoptotic process(GO:0097153) |
0.3 | 3.2 | GO:0070273 | phosphatidylinositol-4-phosphate binding(GO:0070273) |
0.3 | 3.5 | GO:0070567 | cytidylyltransferase activity(GO:0070567) |
0.3 | 0.8 | GO:0047192 | 1-alkylglycerophosphocholine O-acetyltransferase activity(GO:0047192) |
0.3 | 1.1 | GO:0004735 | pyrroline-5-carboxylate reductase activity(GO:0004735) |
0.3 | 0.3 | GO:0050145 | nucleoside phosphate kinase activity(GO:0050145) |
0.3 | 3.4 | GO:0005123 | death receptor binding(GO:0005123) |
0.3 | 10.5 | GO:0003730 | mRNA 3'-UTR binding(GO:0003730) |
0.3 | 0.8 | GO:0030620 | U2 snRNA binding(GO:0030620) |
0.3 | 1.0 | GO:0004897 | ciliary neurotrophic factor receptor activity(GO:0004897) |
0.3 | 1.0 | GO:0004332 | fructose-bisphosphate aldolase activity(GO:0004332) |
0.3 | 1.8 | GO:0008432 | JUN kinase binding(GO:0008432) |
0.3 | 2.3 | GO:0016857 | racemase and epimerase activity, acting on carbohydrates and derivatives(GO:0016857) |
0.3 | 1.5 | GO:0031730 | CCR5 chemokine receptor binding(GO:0031730) |
0.3 | 1.0 | GO:0009374 | biotin binding(GO:0009374) |
0.3 | 1.3 | GO:0004128 | cytochrome-b5 reductase activity, acting on NAD(P)H(GO:0004128) |
0.3 | 1.0 | GO:0016286 | small conductance calcium-activated potassium channel activity(GO:0016286) |
0.3 | 1.0 | GO:0042134 | rRNA primary transcript binding(GO:0042134) |
0.2 | 2.0 | GO:0102391 | decanoate--CoA ligase activity(GO:0102391) |
0.2 | 0.7 | GO:0016726 | xanthine dehydrogenase activity(GO:0004854) oxidoreductase activity, acting on CH or CH2 groups, NAD or NADP as acceptor(GO:0016726) |
0.2 | 1.7 | GO:0048531 | beta-1,3-galactosyltransferase activity(GO:0048531) |
0.2 | 1.0 | GO:0008349 | MAP kinase kinase kinase kinase activity(GO:0008349) |
0.2 | 2.2 | GO:0004499 | N,N-dimethylaniline monooxygenase activity(GO:0004499) |
0.2 | 0.5 | GO:0050220 | prostaglandin-E synthase activity(GO:0050220) |
0.2 | 0.7 | GO:0008172 | S-methyltransferase activity(GO:0008172) |
0.2 | 0.7 | GO:0046974 | histone methyltransferase activity (H3-K9 specific)(GO:0046974) |
0.2 | 0.7 | GO:0042296 | ISG15 transferase activity(GO:0042296) |
0.2 | 3.6 | GO:0016863 | intramolecular oxidoreductase activity, transposing C=C bonds(GO:0016863) |
0.2 | 1.7 | GO:0004862 | cAMP-dependent protein kinase inhibitor activity(GO:0004862) |
0.2 | 1.2 | GO:0032453 | histone demethylase activity (H3-K4 specific)(GO:0032453) |
0.2 | 1.2 | GO:0005168 | neurotrophin TRKA receptor binding(GO:0005168) |
0.2 | 0.7 | GO:0004946 | bombesin receptor activity(GO:0004946) |
0.2 | 0.9 | GO:0002060 | purine nucleobase binding(GO:0002060) |
0.2 | 0.7 | GO:1990050 | phosphatidic acid transporter activity(GO:1990050) |
0.2 | 0.2 | GO:0030621 | U4 snRNA binding(GO:0030621) |
0.2 | 0.7 | GO:0004366 | glycerol-3-phosphate O-acyltransferase activity(GO:0004366) |
0.2 | 1.4 | GO:0008641 | small protein activating enzyme activity(GO:0008641) |
0.2 | 0.9 | GO:0046790 | virion binding(GO:0046790) |
0.2 | 0.9 | GO:0015375 | glycine:sodium symporter activity(GO:0015375) |
0.2 | 0.9 | GO:0098639 | collagen binding involved in cell-matrix adhesion(GO:0098639) |
0.2 | 1.2 | GO:1990247 | N6-methyladenosine-containing RNA binding(GO:1990247) |
0.2 | 1.6 | GO:0004908 | interleukin-1 receptor activity(GO:0004908) |
0.2 | 0.7 | GO:0015315 | hexose phosphate transmembrane transporter activity(GO:0015119) organophosphate:inorganic phosphate antiporter activity(GO:0015315) hexose-phosphate:inorganic phosphate antiporter activity(GO:0015526) glucose 6-phosphate:inorganic phosphate antiporter activity(GO:0061513) |
0.2 | 1.4 | GO:0000182 | rDNA binding(GO:0000182) |
0.2 | 4.0 | GO:0005035 | tumor necrosis factor-activated receptor activity(GO:0005031) death receptor activity(GO:0005035) |
0.2 | 1.8 | GO:0045322 | unmethylated CpG binding(GO:0045322) |
0.2 | 1.1 | GO:0000774 | adenyl-nucleotide exchange factor activity(GO:0000774) |
0.2 | 0.2 | GO:0050816 | phosphothreonine binding(GO:0050816) |
0.2 | 0.7 | GO:0031545 | peptidyl-proline 4-dioxygenase activity(GO:0031545) |
0.2 | 0.2 | GO:0031871 | proteinase activated receptor binding(GO:0031871) |
0.2 | 2.2 | GO:0034236 | protein kinase A catalytic subunit binding(GO:0034236) |
0.2 | 3.9 | GO:0001056 | RNA polymerase III activity(GO:0001056) |
0.2 | 1.1 | GO:0016936 | galactoside binding(GO:0016936) |
0.2 | 1.3 | GO:0015288 | porin activity(GO:0015288) |
0.2 | 20.0 | GO:0002020 | protease binding(GO:0002020) |
0.2 | 0.6 | GO:0005220 | inositol 1,4,5-trisphosphate-sensitive calcium-release channel activity(GO:0005220) |
0.2 | 0.2 | GO:0005176 | ErbB-2 class receptor binding(GO:0005176) |
0.2 | 0.9 | GO:0019808 | polyamine binding(GO:0019808) |
0.2 | 0.6 | GO:1990460 | leptin receptor binding(GO:1990460) |
0.2 | 1.9 | GO:0004176 | ATP-dependent peptidase activity(GO:0004176) |
0.2 | 1.1 | GO:0030250 | cyclase activator activity(GO:0010853) guanylate cyclase activator activity(GO:0030250) |
0.2 | 1.7 | GO:0004571 | mannosyl-oligosaccharide 1,2-alpha-mannosidase activity(GO:0004571) |
0.2 | 1.9 | GO:0004438 | phosphatidylinositol-3-phosphatase activity(GO:0004438) |
0.2 | 4.0 | GO:0003746 | translation elongation factor activity(GO:0003746) |
0.2 | 0.6 | GO:0004699 | calcium-independent protein kinase C activity(GO:0004699) |
0.2 | 1.5 | GO:1990405 | protein antigen binding(GO:1990405) |
0.2 | 0.8 | GO:0019966 | interleukin-1 binding(GO:0019966) |
0.2 | 3.7 | GO:0005547 | phosphatidylinositol-3,4,5-trisphosphate binding(GO:0005547) |
0.2 | 3.3 | GO:0005070 | SH3/SH2 adaptor activity(GO:0005070) |
0.2 | 1.0 | GO:0043426 | MRF binding(GO:0043426) |
0.2 | 1.4 | GO:0003836 | beta-galactoside (CMP) alpha-2,3-sialyltransferase activity(GO:0003836) |
0.2 | 3.9 | GO:0003755 | peptidyl-prolyl cis-trans isomerase activity(GO:0003755) |
0.2 | 0.8 | GO:0004565 | beta-galactosidase activity(GO:0004565) |
0.2 | 10.7 | GO:0051082 | unfolded protein binding(GO:0051082) |
0.2 | 0.4 | GO:0000104 | succinate dehydrogenase activity(GO:0000104) |
0.2 | 2.4 | GO:0070577 | lysine-acetylated histone binding(GO:0070577) |
0.2 | 0.8 | GO:0010997 | anaphase-promoting complex binding(GO:0010997) |
0.2 | 0.8 | GO:0044020 | histone methyltransferase activity (H4-R3 specific)(GO:0044020) |
0.2 | 1.4 | GO:0051010 | microtubule plus-end binding(GO:0051010) |
0.2 | 0.6 | GO:0015319 | sodium:inorganic phosphate symporter activity(GO:0015319) |
0.2 | 4.0 | GO:0008139 | nuclear localization sequence binding(GO:0008139) |
0.2 | 0.8 | GO:0043262 | adenosine-diphosphatase activity(GO:0043262) |
0.2 | 9.3 | GO:0019209 | kinase activator activity(GO:0019209) |
0.2 | 1.8 | GO:0070182 | DNA polymerase binding(GO:0070182) |
0.2 | 1.2 | GO:0003993 | acid phosphatase activity(GO:0003993) |
0.2 | 6.3 | GO:0048487 | beta-tubulin binding(GO:0048487) |
0.2 | 0.6 | GO:0004611 | phosphoenolpyruvate carboxykinase activity(GO:0004611) |
0.2 | 0.6 | GO:0050567 | glutaminyl-tRNA synthase (glutamine-hydrolyzing) activity(GO:0050567) |
0.2 | 1.0 | GO:0004726 | non-membrane spanning protein tyrosine phosphatase activity(GO:0004726) |
0.2 | 0.6 | GO:0070878 | primary miRNA binding(GO:0070878) |
0.2 | 1.4 | GO:0005000 | vasopressin receptor activity(GO:0005000) |
0.2 | 0.2 | GO:0052744 | phosphatidylinositol monophosphate phosphatase activity(GO:0052744) |
0.2 | 1.9 | GO:0019206 | nucleoside kinase activity(GO:0019206) |
0.2 | 1.7 | GO:0034778 | pinocarveol dehydrogenase activity(GO:0018446) chloral hydrate dehydrogenase activity(GO:0018447) hydroxymethylmethylsilanediol oxidase activity(GO:0018448) 1-phenylethanol dehydrogenase activity(GO:0018449) myrtenol dehydrogenase activity(GO:0018450) cis-1,2-dihydroxy-1,2-dihydro-8-carboxynaphthalene dehydrogenase activity(GO:0034522) 3-hydroxy-4-methyloctanoyl-CoA dehydrogenase activity(GO:0034582) 2-hydroxy-4-isopropenylcyclohexane-1-carboxyl-CoA dehydrogenase activity(GO:0034778) cis-9,10-dihydroanthracene-9,10-diol dehydrogenase activity(GO:0034817) citronellol dehydrogenase activity(GO:0034821) naphthyl-2-hydroxymethyl-succinyl-CoA dehydrogenase activity(GO:0034847) 2,4,4-trimethyl-1-pentanol dehydrogenase activity(GO:0034863) 2,4,4-trimethyl-3-hydroxypentanoyl-CoA dehydrogenase activity(GO:0034868) 1-hydroxy-4,4-dimethylpentan-3-one dehydrogenase activity(GO:0034871) endosulfan diol dehydrogenase activity(GO:0034891) endosulfan hydroxyether dehydrogenase activity(GO:0034901) 3-hydroxy-2-methylhexanoyl-CoA dehydrogenase activity(GO:0034918) 3-hydroxy-2,6-dimethyl-5-methylene-heptanoyl-CoA dehydrogenase activity(GO:0034944) versicolorin reductase activity(GO:0042469) ketoreductase activity(GO:0045703) |
0.2 | 1.1 | GO:0004017 | adenylate kinase activity(GO:0004017) |
0.2 | 0.6 | GO:0031826 | type 2A serotonin receptor binding(GO:0031826) |
0.2 | 1.1 | GO:0008508 | bile acid:sodium symporter activity(GO:0008508) |
0.2 | 2.8 | GO:0008252 | nucleotidase activity(GO:0008252) |
0.2 | 0.7 | GO:0042015 | interleukin-20 binding(GO:0042015) |
0.2 | 0.6 | GO:0003987 | acetate-CoA ligase activity(GO:0003987) |
0.2 | 0.4 | GO:0004096 | catalase activity(GO:0004096) |
0.2 | 0.6 | GO:0015651 | quaternary ammonium group transmembrane transporter activity(GO:0015651) |
0.2 | 0.7 | GO:0004614 | phosphoglucomutase activity(GO:0004614) |
0.2 | 0.7 | GO:0031419 | cobalamin binding(GO:0031419) |
0.2 | 2.4 | GO:1990841 | promoter-specific chromatin binding(GO:1990841) |
0.2 | 0.5 | GO:0004427 | inorganic diphosphatase activity(GO:0004427) |
0.2 | 1.6 | GO:0000980 | RNA polymerase II distal enhancer sequence-specific DNA binding(GO:0000980) |
0.2 | 0.5 | GO:0030346 | protein phosphatase 2B binding(GO:0030346) |
0.2 | 2.1 | GO:0001784 | phosphotyrosine binding(GO:0001784) |
0.2 | 0.5 | GO:0043560 | insulin receptor substrate binding(GO:0043560) |
0.2 | 0.5 | GO:0047756 | chondroitin 4-sulfotransferase activity(GO:0047756) |
0.2 | 0.5 | GO:0004104 | cholinesterase activity(GO:0004104) |
0.2 | 1.9 | GO:0031435 | mitogen-activated protein kinase kinase kinase binding(GO:0031435) |
0.2 | 0.7 | GO:0016778 | diphosphotransferase activity(GO:0016778) |
0.2 | 0.9 | GO:0042979 | ornithine decarboxylase regulator activity(GO:0042979) |
0.2 | 1.9 | GO:0071949 | FAD binding(GO:0071949) |
0.2 | 0.7 | GO:0004046 | aminoacylase activity(GO:0004046) |
0.2 | 1.4 | GO:0042171 | lysophosphatidic acid acyltransferase activity(GO:0042171) |
0.2 | 0.9 | GO:0003997 | acyl-CoA oxidase activity(GO:0003997) |
0.2 | 2.2 | GO:0005521 | lamin binding(GO:0005521) |
0.2 | 1.7 | GO:0005545 | 1-phosphatidylinositol binding(GO:0005545) |
0.2 | 0.5 | GO:0030984 | kininogen binding(GO:0030984) |
0.2 | 1.4 | GO:0001222 | transcription corepressor binding(GO:0001222) |
0.2 | 1.7 | GO:0035259 | glucocorticoid receptor binding(GO:0035259) |
0.2 | 0.7 | GO:0032896 | palmitoyl-CoA 9-desaturase activity(GO:0032896) |
0.2 | 0.3 | GO:0000268 | peroxisome targeting sequence binding(GO:0000268) |
0.2 | 0.8 | GO:0016505 | peptidase activator activity involved in apoptotic process(GO:0016505) |
0.2 | 0.3 | GO:0004779 | sulfate adenylyltransferase activity(GO:0004779) |
0.2 | 2.9 | GO:0016875 | ligase activity, forming carbon-oxygen bonds(GO:0016875) ligase activity, forming aminoacyl-tRNA and related compounds(GO:0016876) |
0.2 | 0.7 | GO:0035184 | histone threonine kinase activity(GO:0035184) |
0.2 | 0.7 | GO:0003873 | 6-phosphofructo-2-kinase activity(GO:0003873) |
0.2 | 0.3 | GO:0004052 | arachidonate 12-lipoxygenase activity(GO:0004052) |
0.2 | 0.7 | GO:0016812 | hydrolase activity, acting on carbon-nitrogen (but not peptide) bonds, in cyclic amides(GO:0016812) |
0.2 | 1.5 | GO:0008195 | phosphatidate phosphatase activity(GO:0008195) |
0.2 | 3.8 | GO:0016702 | oxidoreductase activity, acting on single donors with incorporation of molecular oxygen, incorporation of two atoms of oxygen(GO:0016702) |
0.2 | 0.8 | GO:0097322 | 7SK snRNA binding(GO:0097322) |
0.2 | 0.5 | GO:0000309 | nicotinamide-nucleotide adenylyltransferase activity(GO:0000309) nicotinate-nucleotide adenylyltransferase activity(GO:0004515) |
0.2 | 1.0 | GO:0017070 | U6 snRNA binding(GO:0017070) |
0.2 | 3.6 | GO:0003887 | DNA-directed DNA polymerase activity(GO:0003887) |
0.2 | 0.7 | GO:0016661 | oxidoreductase activity, acting on other nitrogenous compounds as donors(GO:0016661) |
0.2 | 0.2 | GO:0032422 | purine-rich negative regulatory element binding(GO:0032422) |
0.2 | 3.0 | GO:0005528 | macrolide binding(GO:0005527) FK506 binding(GO:0005528) |
0.2 | 0.7 | GO:0032451 | demethylase activity(GO:0032451) |
0.2 | 1.3 | GO:0046933 | proton-transporting ATP synthase activity, rotational mechanism(GO:0046933) |
0.2 | 1.1 | GO:0008175 | tRNA methyltransferase activity(GO:0008175) |
0.2 | 1.3 | GO:0008171 | O-methyltransferase activity(GO:0008171) |
0.2 | 0.8 | GO:0004523 | RNA-DNA hybrid ribonuclease activity(GO:0004523) |
0.2 | 2.6 | GO:0000907 | sulfonate dioxygenase activity(GO:0000907) 2,4-dichlorophenoxyacetate alpha-ketoglutarate dioxygenase activity(GO:0018602) hypophosphite dioxygenase activity(GO:0034792) gibberellin 2-beta-dioxygenase activity(GO:0045543) C-19 gibberellin 2-beta-dioxygenase activity(GO:0052634) C-20 gibberellin 2-beta-dioxygenase activity(GO:0052635) |
0.2 | 12.3 | GO:0016423 | tRNA (guanine) methyltransferase activity(GO:0016423) |
0.2 | 0.5 | GO:0005344 | oxygen transporter activity(GO:0005344) |
0.2 | 0.5 | GO:1901612 | cardiolipin binding(GO:1901612) |
0.2 | 0.8 | GO:0031849 | olfactory receptor binding(GO:0031849) |
0.2 | 4.6 | GO:0061650 | ubiquitin conjugating enzyme activity(GO:0061631) ubiquitin-like protein conjugating enzyme activity(GO:0061650) |
0.2 | 0.2 | GO:0005290 | L-histidine transmembrane transporter activity(GO:0005290) |
0.2 | 1.9 | GO:0001221 | transcription cofactor binding(GO:0001221) |
0.2 | 1.1 | GO:0016846 | carbon-sulfur lyase activity(GO:0016846) |
0.2 | 0.9 | GO:0019870 | potassium channel inhibitor activity(GO:0019870) |
0.2 | 0.9 | GO:0008140 | cAMP response element binding protein binding(GO:0008140) |
0.2 | 2.2 | GO:0030515 | snoRNA binding(GO:0030515) |
0.2 | 3.3 | GO:0045502 | dynein binding(GO:0045502) |
0.2 | 0.6 | GO:0008273 | calcium, potassium:sodium antiporter activity(GO:0008273) |
0.2 | 4.6 | GO:0016860 | intramolecular oxidoreductase activity(GO:0016860) |
0.2 | 0.6 | GO:0015093 | ferrous iron transmembrane transporter activity(GO:0015093) |
0.2 | 0.3 | GO:0070546 | L-phenylalanine aminotransferase activity(GO:0070546) |
0.2 | 0.3 | GO:0016899 | oxidoreductase activity, acting on the CH-OH group of donors, oxygen as acceptor(GO:0016899) |
0.2 | 0.3 | GO:0061676 | importin-alpha family protein binding(GO:0061676) |
0.2 | 1.8 | GO:0008601 | protein phosphatase type 2A regulator activity(GO:0008601) |
0.2 | 0.2 | GO:0030899 | calcium-dependent ATPase activity(GO:0030899) |
0.2 | 0.5 | GO:0004514 | nicotinate-nucleotide diphosphorylase (carboxylating) activity(GO:0004514) |
0.1 | 0.4 | GO:0003945 | N-acetyllactosamine synthase activity(GO:0003945) |
0.1 | 2.2 | GO:0031489 | myosin V binding(GO:0031489) |
0.1 | 0.7 | GO:0015165 | pyrimidine nucleotide-sugar transmembrane transporter activity(GO:0015165) |
0.1 | 0.3 | GO:0098519 | nucleotide phosphatase activity, acting on free nucleotides(GO:0098519) |
0.1 | 4.4 | GO:0052771 | coenzyme F390-A hydrolase activity(GO:0052770) coenzyme F390-G hydrolase activity(GO:0052771) |
0.1 | 0.1 | GO:0070411 | I-SMAD binding(GO:0070411) |
0.1 | 0.7 | GO:0004556 | alpha-amylase activity(GO:0004556) |
0.1 | 0.4 | GO:0004505 | phenylalanine 4-monooxygenase activity(GO:0004505) |
0.1 | 0.7 | GO:0019784 | NEDD8-specific protease activity(GO:0019784) |
0.1 | 0.4 | GO:0051022 | Rho GDP-dissociation inhibitor binding(GO:0051022) |
0.1 | 0.1 | GO:0008408 | 3'-5' exonuclease activity(GO:0008408) |
0.1 | 0.9 | GO:0008821 | crossover junction endodeoxyribonuclease activity(GO:0008821) |
0.1 | 0.3 | GO:0016841 | ammonia-lyase activity(GO:0016841) |
0.1 | 0.3 | GO:0043008 | ATP-dependent protein binding(GO:0043008) |
0.1 | 0.4 | GO:0097617 | annealing activity(GO:0097617) |
0.1 | 0.4 | GO:0035197 | siRNA binding(GO:0035197) |
0.1 | 0.7 | GO:0032041 | histone deacetylase activity (H3-K14 specific)(GO:0031078) NAD-dependent histone deacetylase activity (H3-K14 specific)(GO:0032041) |
0.1 | 0.4 | GO:0005534 | galactose binding(GO:0005534) |
0.1 | 0.1 | GO:0070573 | metallodipeptidase activity(GO:0070573) |
0.1 | 0.1 | GO:0030487 | inositol-4,5-bisphosphate 5-phosphatase activity(GO:0030487) |
0.1 | 2.8 | GO:0070063 | RNA polymerase binding(GO:0070063) |
0.1 | 0.4 | GO:0072542 | protein phosphatase activator activity(GO:0072542) |
0.1 | 0.6 | GO:0019788 | NEDD8 transferase activity(GO:0019788) |
0.1 | 0.4 | GO:0016520 | growth hormone-releasing hormone receptor activity(GO:0016520) |
0.1 | 0.4 | GO:0004813 | alanine-tRNA ligase activity(GO:0004813) |
0.1 | 2.1 | GO:0004709 | MAP kinase kinase kinase activity(GO:0004709) |
0.1 | 8.9 | GO:0004843 | thiol-dependent ubiquitin-specific protease activity(GO:0004843) |
0.1 | 0.4 | GO:0016742 | hydroxymethyl-, formyl- and related transferase activity(GO:0016742) |
0.1 | 0.1 | GO:0050693 | LBD domain binding(GO:0050693) |
0.1 | 4.4 | GO:0031593 | polyubiquitin binding(GO:0031593) |
0.1 | 1.0 | GO:0016888 | endodeoxyribonuclease activity, producing 5'-phosphomonoesters(GO:0016888) |
0.1 | 1.5 | GO:0050681 | androgen receptor binding(GO:0050681) |
0.1 | 0.6 | GO:0003923 | GPI-anchor transamidase activity(GO:0003923) |
0.1 | 0.7 | GO:0017040 | ceramidase activity(GO:0017040) |
0.1 | 0.4 | GO:0008475 | procollagen-lysine 5-dioxygenase activity(GO:0008475) |
0.1 | 0.7 | GO:0005412 | glucose:sodium symporter activity(GO:0005412) |
0.1 | 1.2 | GO:0016493 | C-C chemokine receptor activity(GO:0016493) |
0.1 | 0.1 | GO:0030911 | TPR domain binding(GO:0030911) |
0.1 | 1.0 | GO:0015266 | protein channel activity(GO:0015266) |
0.1 | 0.4 | GO:0016774 | phosphotransferase activity, carboxyl group as acceptor(GO:0016774) |
0.1 | 1.4 | GO:0030552 | cAMP binding(GO:0030552) |
0.1 | 6.5 | GO:0008138 | protein tyrosine/serine/threonine phosphatase activity(GO:0008138) |
0.1 | 3.4 | GO:0015485 | cholesterol binding(GO:0015485) |
0.1 | 0.4 | GO:0004938 | alpha2-adrenergic receptor activity(GO:0004938) |
0.1 | 0.8 | GO:0031996 | thioesterase binding(GO:0031996) |
0.1 | 1.3 | GO:0045294 | alpha-catenin binding(GO:0045294) |
0.1 | 0.4 | GO:0043184 | vascular endothelial growth factor receptor 2 binding(GO:0043184) |
0.1 | 0.4 | GO:0042030 | ATPase inhibitor activity(GO:0042030) |
0.1 | 1.2 | GO:0001618 | virus receptor activity(GO:0001618) |
0.1 | 0.4 | GO:0050508 | glucuronosyl-N-acetylglucosaminyl-proteoglycan 4-alpha-N-acetylglucosaminyltransferase activity(GO:0050508) |
0.1 | 1.7 | GO:0051879 | Hsp90 protein binding(GO:0051879) |
0.1 | 1.0 | GO:0017160 | Ral GTPase binding(GO:0017160) |
0.1 | 1.0 | GO:0050649 | testosterone 6-beta-hydroxylase activity(GO:0050649) |
0.1 | 3.5 | GO:0016831 | carboxy-lyase activity(GO:0016831) |
0.1 | 0.5 | GO:0017127 | cholesterol transporter activity(GO:0017127) |
0.1 | 1.0 | GO:0019213 | deacetylase activity(GO:0019213) |
0.1 | 0.1 | GO:0031686 | A1 adenosine receptor binding(GO:0031686) |
0.1 | 0.5 | GO:0019911 | structural constituent of myelin sheath(GO:0019911) |
0.1 | 1.8 | GO:0032452 | histone demethylase activity(GO:0032452) |
0.1 | 1.1 | GO:0004383 | guanylate cyclase activity(GO:0004383) |
0.1 | 2.7 | GO:0005385 | zinc ion transmembrane transporter activity(GO:0005385) |
0.1 | 1.9 | GO:0015095 | magnesium ion transmembrane transporter activity(GO:0015095) |
0.1 | 1.3 | GO:0034987 | immunoglobulin receptor binding(GO:0034987) |
0.1 | 0.8 | GO:0070097 | delta-catenin binding(GO:0070097) |
0.1 | 0.5 | GO:0016744 | transferase activity, transferring aldehyde or ketonic groups(GO:0016744) |
0.1 | 0.4 | GO:0000171 | ribonuclease MRP activity(GO:0000171) |
0.1 | 0.2 | GO:0003964 | telomerase activity(GO:0003720) RNA-directed DNA polymerase activity(GO:0003964) |
0.1 | 1.2 | GO:0030898 | actin-dependent ATPase activity(GO:0030898) |
0.1 | 3.5 | GO:0061733 | peptide-lysine-N-acetyltransferase activity(GO:0061733) |
0.1 | 0.4 | GO:0045134 | uridine-diphosphatase activity(GO:0045134) |
0.1 | 1.2 | GO:0034185 | apolipoprotein binding(GO:0034185) |
0.1 | 0.9 | GO:0008239 | dipeptidyl-peptidase activity(GO:0008239) |
0.1 | 1.1 | GO:0005388 | calcium-transporting ATPase activity(GO:0005388) |
0.1 | 0.1 | GO:0090482 | vitamin transmembrane transporter activity(GO:0090482) |
0.1 | 0.2 | GO:0004677 | DNA-dependent protein kinase activity(GO:0004677) |
0.1 | 1.0 | GO:0008889 | glycerophosphodiester phosphodiesterase activity(GO:0008889) |
0.1 | 0.1 | GO:0017098 | sulfonylurea receptor binding(GO:0017098) |
0.1 | 0.4 | GO:0008174 | mRNA methyltransferase activity(GO:0008174) |
0.1 | 1.3 | GO:0001730 | 2'-5'-oligoadenylate synthetase activity(GO:0001730) |
0.1 | 0.2 | GO:0030619 | U1 snRNA binding(GO:0030619) |
0.1 | 1.5 | GO:0043531 | ADP binding(GO:0043531) |
0.1 | 0.4 | GO:0008321 | Ral guanyl-nucleotide exchange factor activity(GO:0008321) |
0.1 | 0.4 | GO:0008199 | ferric iron binding(GO:0008199) |
0.1 | 16.7 | GO:0061630 | ubiquitin protein ligase activity(GO:0061630) ubiquitin-like protein ligase activity(GO:0061659) |
0.1 | 0.6 | GO:0047035 | testosterone dehydrogenase (NAD+) activity(GO:0047035) |
0.1 | 0.2 | GO:0002094 | polyprenyltransferase activity(GO:0002094) |
0.1 | 0.2 | GO:0005338 | nucleotide-sugar transmembrane transporter activity(GO:0005338) |
0.1 | 0.4 | GO:0051525 | NFAT protein binding(GO:0051525) |
0.1 | 0.4 | GO:0004305 | ethanolamine kinase activity(GO:0004305) |
0.1 | 0.7 | GO:0036312 | phosphatidylinositol 3-kinase regulatory subunit binding(GO:0036312) |
0.1 | 0.2 | GO:0030976 | thiamine pyrophosphate binding(GO:0030976) |
0.1 | 0.5 | GO:0016641 | oxidoreductase activity, acting on the CH-NH2 group of donors, oxygen as acceptor(GO:0016641) |
0.1 | 0.2 | GO:0008240 | tripeptidyl-peptidase activity(GO:0008240) |
0.1 | 2.1 | GO:0016799 | hydrolase activity, hydrolyzing N-glycosyl compounds(GO:0016799) |
0.1 | 0.8 | GO:0004526 | ribonuclease P activity(GO:0004526) |
0.1 | 1.5 | GO:0046961 | proton-transporting ATPase activity, rotational mechanism(GO:0046961) |
0.1 | 1.5 | GO:0051059 | NF-kappaB binding(GO:0051059) |
0.1 | 0.6 | GO:0031749 | D2 dopamine receptor binding(GO:0031749) |
0.1 | 0.3 | GO:0004346 | glucose-6-phosphatase activity(GO:0004346) sugar-terminal-phosphatase activity(GO:0050309) |
0.1 | 3.9 | GO:0017022 | myosin binding(GO:0017022) |
0.1 | 1.0 | GO:0001158 | enhancer sequence-specific DNA binding(GO:0001158) |
0.1 | 2.3 | GO:0016675 | oxidoreductase activity, acting on a heme group of donors(GO:0016675) |
0.1 | 1.4 | GO:0045182 | translation regulator activity(GO:0045182) |
0.1 | 2.5 | GO:0031491 | nucleosome binding(GO:0031491) |
0.1 | 0.2 | GO:0044183 | protein binding involved in protein folding(GO:0044183) |
0.1 | 1.1 | GO:0015643 | toxic substance binding(GO:0015643) |
0.1 | 0.3 | GO:0004949 | cannabinoid receptor activity(GO:0004949) |
0.1 | 2.5 | GO:0008757 | S-adenosylmethionine-dependent methyltransferase activity(GO:0008757) |
0.1 | 1.7 | GO:0051537 | 2 iron, 2 sulfur cluster binding(GO:0051537) |
0.1 | 0.3 | GO:0072345 | NAADP-sensitive calcium-release channel activity(GO:0072345) |
0.1 | 2.6 | GO:0070888 | E-box binding(GO:0070888) |
0.1 | 0.3 | GO:0019862 | IgA binding(GO:0019862) |
0.1 | 0.2 | GO:0016262 | protein N-acetylglucosaminyltransferase activity(GO:0016262) |
0.1 | 1.3 | GO:0051721 | protein phosphatase 2A binding(GO:0051721) |
0.1 | 0.5 | GO:0034046 | poly(G) binding(GO:0034046) |
0.1 | 0.5 | GO:0001515 | opioid peptide activity(GO:0001515) |
0.1 | 1.4 | GO:0001205 | transcriptional activator activity, RNA polymerase II distal enhancer sequence-specific binding(GO:0001205) |
0.1 | 0.7 | GO:0004521 | endoribonuclease activity(GO:0004521) |
0.1 | 0.3 | GO:0047276 | N-acetyllactosaminide 3-alpha-galactosyltransferase activity(GO:0047276) |
0.1 | 1.1 | GO:0004602 | glutathione peroxidase activity(GO:0004602) |
0.1 | 1.7 | GO:0008519 | ammonium transmembrane transporter activity(GO:0008519) |
0.1 | 0.3 | GO:0004013 | adenosylhomocysteinase activity(GO:0004013) trialkylsulfonium hydrolase activity(GO:0016802) |
0.1 | 0.1 | GO:0030792 | methylarsonite methyltransferase activity(GO:0030792) |
0.1 | 0.3 | GO:0004367 | glycerol-3-phosphate dehydrogenase [NAD+] activity(GO:0004367) |
0.1 | 0.5 | GO:0005007 | fibroblast growth factor-activated receptor activity(GO:0005007) |
0.1 | 0.9 | GO:0030983 | mismatched DNA binding(GO:0030983) |
0.1 | 1.3 | GO:0101005 | thiol-dependent ubiquitinyl hydrolase activity(GO:0036459) ubiquitinyl hydrolase activity(GO:0101005) |
0.1 | 0.4 | GO:0004945 | angiotensin type II receptor activity(GO:0004945) |
0.1 | 1.3 | GO:0045236 | CXCR chemokine receptor binding(GO:0045236) |
0.1 | 0.2 | GO:0042577 | lipid phosphatase activity(GO:0042577) |
0.1 | 0.3 | GO:0019770 | IgG receptor activity(GO:0019770) |
0.1 | 0.1 | GO:0005159 | insulin-like growth factor receptor binding(GO:0005159) |
0.1 | 0.5 | GO:0001665 | alpha-N-acetylgalactosaminide alpha-2,6-sialyltransferase activity(GO:0001665) |
0.1 | 0.3 | GO:0044548 | S100 protein binding(GO:0044548) |
0.1 | 0.5 | GO:0005536 | glucose binding(GO:0005536) |
0.1 | 0.2 | GO:0047623 | AMP deaminase activity(GO:0003876) adenosine-phosphate deaminase activity(GO:0047623) |
0.1 | 0.2 | GO:1990825 | sequence-specific mRNA binding(GO:1990825) |
0.1 | 2.5 | GO:0016209 | antioxidant activity(GO:0016209) |
0.1 | 0.6 | GO:0016922 | ligand-dependent nuclear receptor binding(GO:0016922) |
0.1 | 8.2 | GO:0017137 | Rab GTPase binding(GO:0017137) |
0.1 | 1.0 | GO:0008413 | 8-oxo-7,8-dihydroguanosine triphosphate pyrophosphatase activity(GO:0008413) |
0.1 | 0.2 | GO:0016889 | endodeoxyribonuclease activity, producing 3'-phosphomonoesters(GO:0016889) |
0.1 | 1.7 | GO:0031369 | translation initiation factor binding(GO:0031369) |
0.1 | 1.0 | GO:0042800 | histone methyltransferase activity (H3-K4 specific)(GO:0042800) |
0.1 | 0.3 | GO:0016714 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, reduced pteridine as one donor, and incorporation of one atom of oxygen(GO:0016714) |
0.1 | 0.1 | GO:0043533 | inositol 1,3,4,5 tetrakisphosphate binding(GO:0043533) |
0.1 | 1.6 | GO:0004198 | calcium-dependent cysteine-type endopeptidase activity(GO:0004198) |
0.1 | 1.0 | GO:0017081 | chloride channel regulator activity(GO:0017081) |
0.1 | 0.2 | GO:0035175 | histone kinase activity (H3-S10 specific)(GO:0035175) |
0.1 | 0.2 | GO:0032552 | deoxyribonucleotide binding(GO:0032552) |
0.1 | 6.9 | GO:0005178 | integrin binding(GO:0005178) |
0.1 | 0.4 | GO:0004004 | ATP-dependent RNA helicase activity(GO:0004004) RNA-dependent ATPase activity(GO:0008186) |
0.1 | 0.1 | GO:0032405 | MutLalpha complex binding(GO:0032405) |
0.1 | 0.4 | GO:0008440 | inositol-1,4,5-trisphosphate 3-kinase activity(GO:0008440) |
0.1 | 0.9 | GO:0004774 | succinate-CoA ligase activity(GO:0004774) |
0.1 | 1.5 | GO:0015238 | drug transmembrane transporter activity(GO:0015238) |
0.1 | 0.6 | GO:0019789 | SUMO transferase activity(GO:0019789) |
0.1 | 0.8 | GO:0016891 | endoribonuclease activity, producing 5'-phosphomonoesters(GO:0016891) |
0.1 | 1.4 | GO:0071889 | 14-3-3 protein binding(GO:0071889) |
0.1 | 0.4 | GO:0070566 | adenylyltransferase activity(GO:0070566) |
0.1 | 2.6 | GO:0043130 | ubiquitin binding(GO:0043130) |
0.1 | 0.1 | GO:0000386 | second spliceosomal transesterification activity(GO:0000386) |
0.1 | 4.3 | GO:0004536 | deoxyribonuclease activity(GO:0004536) |
0.1 | 0.4 | GO:0004582 | dolichyl-phosphate beta-D-mannosyltransferase activity(GO:0004582) |
0.1 | 1.6 | GO:0002039 | p53 binding(GO:0002039) |
0.1 | 9.4 | GO:0003714 | transcription corepressor activity(GO:0003714) |
0.1 | 4.3 | GO:0003697 | single-stranded DNA binding(GO:0003697) |
0.1 | 0.5 | GO:0036122 | BMP binding(GO:0036122) |
0.1 | 1.1 | GO:0008307 | structural constituent of muscle(GO:0008307) |
0.1 | 0.5 | GO:0005024 | transforming growth factor beta-activated receptor activity(GO:0005024) |
0.1 | 0.1 | GO:0031727 | CCR2 chemokine receptor binding(GO:0031727) |
0.1 | 4.4 | GO:0016836 | hydro-lyase activity(GO:0016836) |
0.1 | 0.9 | GO:0017049 | GTP-Rho binding(GO:0017049) |
0.1 | 0.8 | GO:0034212 | peptide N-acetyltransferase activity(GO:0034212) |
0.1 | 2.2 | GO:0019706 | protein-cysteine S-palmitoyltransferase activity(GO:0019706) |
0.1 | 0.3 | GO:0019864 | IgG binding(GO:0019864) |
0.1 | 0.7 | GO:0070064 | proline-rich region binding(GO:0070064) |
0.1 | 0.1 | GO:0004549 | tRNA-specific ribonuclease activity(GO:0004549) |
0.1 | 0.2 | GO:0016615 | malate dehydrogenase activity(GO:0016615) |
0.1 | 0.5 | GO:0008454 | alpha-1,3-mannosylglycoprotein 4-beta-N-acetylglucosaminyltransferase activity(GO:0008454) |
0.1 | 0.4 | GO:0030942 | endoplasmic reticulum signal peptide binding(GO:0030942) |
0.1 | 0.2 | GO:0004311 | farnesyltranstransferase activity(GO:0004311) |
0.1 | 86.1 | GO:0003723 | RNA binding(GO:0003723) |
0.1 | 2.3 | GO:0043621 | protein self-association(GO:0043621) |
0.1 | 3.6 | GO:0048306 | calcium-dependent protein binding(GO:0048306) |
0.1 | 0.4 | GO:0034237 | protein kinase A regulatory subunit binding(GO:0034237) |
0.1 | 0.3 | GO:0008934 | inositol monophosphate 1-phosphatase activity(GO:0008934) inositol monophosphate 3-phosphatase activity(GO:0052832) inositol monophosphate 4-phosphatase activity(GO:0052833) inositol monophosphate phosphatase activity(GO:0052834) |
0.1 | 0.2 | GO:0032190 | acrosin binding(GO:0032190) |
0.1 | 0.4 | GO:0016176 | superoxide-generating NADPH oxidase activator activity(GO:0016176) |
0.1 | 0.4 | GO:0038100 | nodal binding(GO:0038100) |
0.1 | 1.4 | GO:0001614 | purinergic nucleotide receptor activity(GO:0001614) nucleotide receptor activity(GO:0016502) |
0.1 | 0.7 | GO:0043142 | single-stranded DNA-dependent ATPase activity(GO:0043142) |
0.1 | 0.9 | GO:0004806 | triglyceride lipase activity(GO:0004806) |
0.1 | 0.4 | GO:0051787 | misfolded protein binding(GO:0051787) |
0.1 | 0.3 | GO:0015141 | succinate transmembrane transporter activity(GO:0015141) |
0.1 | 1.8 | GO:0004869 | cysteine-type endopeptidase inhibitor activity(GO:0004869) |
0.1 | 0.3 | GO:0016833 | oxo-acid-lyase activity(GO:0016833) |
0.1 | 0.2 | GO:0017162 | aryl hydrocarbon receptor binding(GO:0017162) |
0.1 | 0.1 | GO:0034235 | GPI anchor binding(GO:0034235) |
0.1 | 0.2 | GO:0003680 | AT DNA binding(GO:0003680) |
0.1 | 1.0 | GO:0032266 | phosphatidylinositol-3-phosphate binding(GO:0032266) |
0.1 | 0.3 | GO:0003829 | beta-1,3-galactosyl-O-glycosyl-glycoprotein beta-1,6-N-acetylglucosaminyltransferase activity(GO:0003829) |
0.1 | 1.9 | GO:0050699 | WW domain binding(GO:0050699) |
0.1 | 0.3 | GO:0008599 | protein phosphatase type 1 regulator activity(GO:0008599) |
0.1 | 0.5 | GO:0050780 | dopamine receptor binding(GO:0050780) |
0.1 | 0.2 | GO:0008401 | retinoic acid 4-hydroxylase activity(GO:0008401) |
0.1 | 0.9 | GO:0016813 | hydrolase activity, acting on carbon-nitrogen (but not peptide) bonds, in linear amidines(GO:0016813) |
0.1 | 1.0 | GO:0008094 | DNA-dependent ATPase activity(GO:0008094) |
0.1 | 0.1 | GO:0019237 | centromeric DNA binding(GO:0019237) |
0.1 | 0.4 | GO:0008121 | ubiquinol-cytochrome-c reductase activity(GO:0008121) oxidoreductase activity, acting on diphenols and related substances as donors, cytochrome as acceptor(GO:0016681) |
0.1 | 0.1 | GO:0042054 | histone methyltransferase activity(GO:0042054) |
0.1 | 0.4 | GO:0005487 | nucleocytoplasmic transporter activity(GO:0005487) |
0.1 | 0.1 | GO:0008905 | mannose-phosphate guanylyltransferase activity(GO:0008905) |
0.1 | 0.6 | GO:0042288 | MHC class I protein binding(GO:0042288) |
0.1 | 1.4 | GO:0008137 | NADH dehydrogenase (ubiquinone) activity(GO:0008137) NADH dehydrogenase (quinone) activity(GO:0050136) |
0.1 | 0.4 | GO:0008294 | calcium- and calmodulin-responsive adenylate cyclase activity(GO:0008294) |
0.1 | 0.2 | GO:0004359 | glutaminase activity(GO:0004359) |
0.1 | 0.1 | GO:0051021 | GDP-dissociation inhibitor binding(GO:0051021) |
0.1 | 1.9 | GO:0004114 | 3',5'-cyclic-nucleotide phosphodiesterase activity(GO:0004114) |
0.1 | 0.4 | GO:0016886 | ligase activity, forming phosphoric ester bonds(GO:0016886) |
0.1 | 1.4 | GO:0004519 | endonuclease activity(GO:0004519) |
0.1 | 0.2 | GO:0004948 | calcitonin receptor activity(GO:0004948) |
0.1 | 0.3 | GO:0004594 | pantothenate kinase activity(GO:0004594) |
0.1 | 0.8 | GO:0004707 | MAP kinase activity(GO:0004707) |
0.1 | 0.5 | GO:0005225 | volume-sensitive anion channel activity(GO:0005225) |
0.1 | 0.2 | GO:0070569 | uridylyltransferase activity(GO:0070569) |
0.1 | 3.9 | GO:0042626 | ATPase activity, coupled to transmembrane movement of substances(GO:0042626) |
0.1 | 0.3 | GO:0008526 | phosphatidylinositol transporter activity(GO:0008526) |
0.1 | 0.2 | GO:0004082 | bisphosphoglycerate mutase activity(GO:0004082) phosphoglycerate mutase activity(GO:0004619) 2,3-bisphosphoglycerate-dependent phosphoglycerate mutase activity(GO:0046538) |
0.1 | 0.4 | GO:0004016 | adenylate cyclase activity(GO:0004016) |
0.1 | 6.3 | GO:0003735 | structural constituent of ribosome(GO:0003735) |
0.1 | 0.4 | GO:0005113 | patched binding(GO:0005113) |
0.1 | 0.4 | GO:0003684 | damaged DNA binding(GO:0003684) |
0.1 | 0.2 | GO:0070051 | fibrinogen binding(GO:0070051) |
0.1 | 1.5 | GO:0000979 | RNA polymerase II core promoter sequence-specific DNA binding(GO:0000979) |
0.1 | 0.4 | GO:0008131 | primary amine oxidase activity(GO:0008131) |
0.1 | 0.1 | GO:0005131 | growth hormone receptor binding(GO:0005131) |
0.1 | 0.1 | GO:0016634 | oxidoreductase activity, acting on the CH-CH group of donors, oxygen as acceptor(GO:0016634) |
0.1 | 0.4 | GO:0030332 | cyclin binding(GO:0030332) |
0.1 | 0.1 | GO:0035033 | histone deacetylase regulator activity(GO:0035033) |
0.1 | 0.1 | GO:0017151 | DEAD/H-box RNA helicase binding(GO:0017151) |
0.1 | 0.2 | GO:0035651 | AP-3 adaptor complex binding(GO:0035651) |
0.1 | 1.2 | GO:0004623 | phospholipase A2 activity(GO:0004623) |
0.1 | 5.8 | GO:0016881 | acid-amino acid ligase activity(GO:0016881) |
0.1 | 0.3 | GO:0035035 | histone acetyltransferase binding(GO:0035035) |
0.1 | 1.2 | GO:0051119 | sugar transmembrane transporter activity(GO:0051119) |
0.1 | 0.5 | GO:0016308 | 1-phosphatidylinositol-4-phosphate 5-kinase activity(GO:0016308) |
0.1 | 0.1 | GO:0043023 | ribosomal large subunit binding(GO:0043023) |
0.1 | 10.0 | GO:0008134 | transcription factor binding(GO:0008134) |
0.1 | 0.1 | GO:0017153 | sodium:dicarboxylate symporter activity(GO:0017153) |
0.1 | 0.4 | GO:0004689 | phosphorylase kinase activity(GO:0004689) |
0.1 | 0.7 | GO:0015279 | store-operated calcium channel activity(GO:0015279) |
0.1 | 0.1 | GO:0032052 | bile acid binding(GO:0032052) |
0.1 | 0.6 | GO:0048407 | platelet-derived growth factor binding(GO:0048407) |
0.1 | 0.2 | GO:0016868 | intramolecular transferase activity, phosphotransferases(GO:0016868) |
0.1 | 0.1 | GO:0008429 | phosphatidylethanolamine binding(GO:0008429) |
0.1 | 1.5 | GO:0042605 | peptide antigen binding(GO:0042605) |
0.1 | 0.6 | GO:0016706 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, 2-oxoglutarate as one donor, and incorporation of one atom each of oxygen into both donors(GO:0016706) |
0.1 | 0.5 | GO:0050664 | oxidoreductase activity, acting on NAD(P)H, oxygen as acceptor(GO:0050664) |
0.1 | 1.9 | GO:0002161 | aminoacyl-tRNA editing activity(GO:0002161) |
0.1 | 0.2 | GO:0004967 | glucagon receptor activity(GO:0004967) |
0.1 | 0.1 | GO:0016822 | hydrolase activity, acting on acid carbon-carbon bonds(GO:0016822) hydrolase activity, acting on acid carbon-carbon bonds, in ketonic substances(GO:0016823) |
0.1 | 0.2 | GO:0017110 | nucleoside-diphosphatase activity(GO:0017110) |
0.1 | 0.1 | GO:0017150 | tRNA dihydrouridine synthase activity(GO:0017150) |
0.1 | 0.1 | GO:0051373 | FATZ binding(GO:0051373) |
0.1 | 0.4 | GO:0001758 | retinal dehydrogenase activity(GO:0001758) |
0.1 | 0.1 | GO:0016307 | phosphatidylinositol phosphate kinase activity(GO:0016307) |
0.1 | 0.1 | GO:0043199 | sulfate binding(GO:0043199) |
0.1 | 0.4 | GO:0004540 | ribonuclease activity(GO:0004540) |
0.1 | 0.2 | GO:0047961 | glycine N-acyltransferase activity(GO:0047961) |
0.1 | 0.1 | GO:0018638 | 3-(3-hydroxyphenyl)propionate hydroxylase activity(GO:0008688) 4-chlorobenzaldehyde oxidase activity(GO:0018471) 3,5-xylenol methylhydroxylase activity(GO:0018630) phenylacetate hydroxylase activity(GO:0018631) 4-nitrophenol 4-monooxygenase activity(GO:0018632) dimethyl sulfide monooxygenase activity(GO:0018633) alpha-pinene monooxygenase [NADH] activity(GO:0018634) 1-hydroxy-2-naphthoate hydroxylase activity(GO:0018637) toluene 4-monooxygenase activity(GO:0018638) xylene monooxygenase activity(GO:0018639) dibenzothiophene monooxygenase activity(GO:0018640) 6-hydroxy-3-methyl-2-oxo-1,2-dihydroquinoline 6-monooxygenase activity(GO:0018641) chlorophenol 4-monooxygenase activity(GO:0018642) carbon disulfide oxygenase activity(GO:0018643) toluene 2-monooxygenase activity(GO:0018644) 1-hydroxy-2-oxolimonene 1,2-monooxygenase activity(GO:0018646) phenanthrene 1,2-monooxygenase activity(GO:0018647) tetrahydrofuran hydroxylase activity(GO:0018649) styrene monooxygenase activity(GO:0018650) toluene-4-sulfonate monooxygenase activity(GO:0018651) toluene-sulfonate methyl-monooxygenase activity(GO:0018652) 3-methyl-2-oxo-1,2-dihydroquinoline 6-monooxygenase activity(GO:0018653) 2-hydroxy-phenylacetate hydroxylase activity(GO:0018654) 2-oxo-delta3-4,5,5-trimethylcyclopentenylacetyl-CoA 1,2-monooxygenase activity(GO:0018655) phenanthrene 3,4-monooxygenase activity(GO:0018656) toluene 3-monooxygenase activity(GO:0018657) 4-hydroxyphenylacetate,NADH:oxygen oxidoreductase (3-hydroxylating) activity(GO:0018660) limonene monooxygenase activity(GO:0019113) 2-methylnaphthalene hydroxylase activity(GO:0034526) 1-methylnaphthalene hydroxylase activity(GO:0034534) bisphenol A hydroxylase A activity(GO:0034560) salicylate 5-hydroxylase activity(GO:0034785) isobutylamine N-hydroxylase activity(GO:0034791) branched-chain dodecylbenzene sulfonate monooxygenase activity(GO:0034802) 3-HSA hydroxylase activity(GO:0034819) 4-hydroxypyridine-3-hydroxylase activity(GO:0034894) 2-octaprenyl-3-methyl-6-methoxy-1,4-benzoquinol hydroxylase activity(GO:0043719) 6-hydroxynicotinate 3-monooxygenase activity(GO:0043731) thalianol hydroxylase activity(GO:0080014) |
0.1 | 0.1 | GO:0019855 | calcium channel inhibitor activity(GO:0019855) |
0.1 | 0.1 | GO:0016361 | activin receptor activity, type I(GO:0016361) |
0.1 | 0.1 | GO:0004711 | ribosomal protein S6 kinase activity(GO:0004711) |
0.1 | 0.2 | GO:0047184 | 1-acylglycerophosphocholine O-acyltransferase activity(GO:0047184) |
0.1 | 0.1 | GO:0042301 | phosphate ion binding(GO:0042301) |
0.1 | 0.2 | GO:0034603 | pyruvate dehydrogenase activity(GO:0004738) pyruvate dehydrogenase [NAD(P)+] activity(GO:0034603) pyruvate dehydrogenase (NAD+) activity(GO:0034604) |
0.1 | 0.1 | GO:0016015 | morphogen activity(GO:0016015) |
0.1 | 1.4 | GO:0051087 | chaperone binding(GO:0051087) |
0.1 | 0.4 | GO:0050291 | sphingosine N-acyltransferase activity(GO:0050291) |
0.1 | 1.0 | GO:0042826 | histone deacetylase binding(GO:0042826) |
0.1 | 0.1 | GO:0004022 | alcohol dehydrogenase (NAD) activity(GO:0004022) |
0.1 | 0.9 | GO:0043021 | ribonucleoprotein complex binding(GO:0043021) |
0.1 | 0.1 | GO:0004703 | G-protein coupled receptor kinase activity(GO:0004703) |
0.1 | 0.5 | GO:0008168 | methyltransferase activity(GO:0008168) |
0.1 | 0.1 | GO:0047391 | alkylglycerophosphoethanolamine phosphodiesterase activity(GO:0047391) |
0.1 | 0.2 | GO:0042609 | CD4 receptor binding(GO:0042609) |
0.1 | 0.8 | GO:0043236 | laminin binding(GO:0043236) |
0.1 | 0.3 | GO:0016884 | carbon-nitrogen ligase activity, with glutamine as amido-N-donor(GO:0016884) |
0.1 | 0.2 | GO:0004468 | lysine N-acetyltransferase activity, acting on acetyl phosphate as donor(GO:0004468) |
0.1 | 0.3 | GO:0070628 | proteasome binding(GO:0070628) |
0.1 | 0.3 | GO:0004972 | NMDA glutamate receptor activity(GO:0004972) |
0.1 | 0.1 | GO:0008796 | bis(5'-nucleosyl)-tetraphosphatase activity(GO:0008796) |
0.1 | 0.1 | GO:0015563 | uptake transmembrane transporter activity(GO:0015563) |
0.1 | 1.3 | GO:0015078 | hydrogen ion transmembrane transporter activity(GO:0015078) |
0.1 | 0.1 | GO:0005324 | long-chain fatty acid transporter activity(GO:0005324) |
0.1 | 1.2 | GO:0016790 | thiolester hydrolase activity(GO:0016790) |
0.1 | 0.1 | GO:0070698 | type I activin receptor binding(GO:0070698) |
0.1 | 0.1 | GO:0051213 | dioxygenase activity(GO:0051213) |
0.1 | 0.7 | GO:0017128 | phospholipid scramblase activity(GO:0017128) |
0.1 | 0.7 | GO:0022840 | leak channel activity(GO:0022840) potassium ion leak channel activity(GO:0022841) narrow pore channel activity(GO:0022842) |
0.1 | 0.1 | GO:0003831 | beta-N-acetylglucosaminylglycopeptide beta-1,4-galactosyltransferase activity(GO:0003831) |
0.1 | 0.2 | GO:0004966 | galanin receptor activity(GO:0004966) |
0.1 | 0.5 | GO:0005158 | insulin receptor binding(GO:0005158) |
0.1 | 0.8 | GO:0043015 | gamma-tubulin binding(GO:0043015) |
0.1 | 1.6 | GO:0005132 | type I interferon receptor binding(GO:0005132) |
0.1 | 1.2 | GO:0005200 | structural constituent of cytoskeleton(GO:0005200) |
0.1 | 0.3 | GO:0050321 | tau-protein kinase activity(GO:0050321) |
0.1 | 2.4 | GO:0008392 | arachidonic acid epoxygenase activity(GO:0008392) |
0.1 | 0.7 | GO:0005319 | lipid transporter activity(GO:0005319) |
0.1 | 1.1 | GO:0019212 | phosphatase inhibitor activity(GO:0019212) |
0.1 | 0.6 | GO:0016829 | lyase activity(GO:0016829) |
0.1 | 8.5 | GO:0004252 | serine-type endopeptidase activity(GO:0004252) |
0.1 | 0.2 | GO:0032050 | clathrin heavy chain binding(GO:0032050) |
0.1 | 0.3 | GO:0008420 | CTD phosphatase activity(GO:0008420) |
0.1 | 1.5 | GO:0004722 | protein serine/threonine phosphatase activity(GO:0004722) |
0.1 | 10.6 | GO:0005525 | GTP binding(GO:0005525) |
0.0 | 0.0 | GO:0004771 | sterol esterase activity(GO:0004771) |
0.0 | 0.4 | GO:0016805 | dipeptidase activity(GO:0016805) |
0.0 | 0.2 | GO:0035586 | G-protein coupled adenosine receptor activity(GO:0001609) purinergic receptor activity(GO:0035586) |
0.0 | 0.4 | GO:0016811 | hydrolase activity, acting on carbon-nitrogen (but not peptide) bonds, in linear amides(GO:0016811) |
0.0 | 0.2 | GO:0016997 | exo-alpha-sialidase activity(GO:0004308) alpha-sialidase activity(GO:0016997) exo-alpha-(2->3)-sialidase activity(GO:0052794) exo-alpha-(2->6)-sialidase activity(GO:0052795) exo-alpha-(2->8)-sialidase activity(GO:0052796) |
0.0 | 0.8 | GO:0016763 | transferase activity, transferring pentosyl groups(GO:0016763) |
0.0 | 0.2 | GO:0043274 | phospholipase binding(GO:0043274) |
0.0 | 0.1 | GO:0001591 | dopamine neurotransmitter receptor activity, coupled via Gi/Go(GO:0001591) |
0.0 | 0.1 | GO:0034912 | enoyl-[acyl-carrier-protein] reductase activity(GO:0016631) 2,3-dihydroxy-2,3-dihydro-phenylpropionate dehydrogenase activity(GO:0018498) cis-2,3-dihydrodiol DDT dehydrogenase activity(GO:0018499) trans-9R,10R-dihydrodiolphenanthrene dehydrogenase activity(GO:0018500) cis-chlorobenzene dihydrodiol dehydrogenase activity(GO:0018501) 2,5-dichloro-2,5-cyclohexadiene-1,4-diol dehydrogenase activity(GO:0018502) trans-1,2-dihydrodiolphenanthrene dehydrogenase activity(GO:0018503) 3,4-dihydroxy-3,4-dihydrofluorene dehydrogenase activity(GO:0034790) benzo(a)pyrene-trans-11,12-dihydrodiol dehydrogenase activity(GO:0034805) benzo(a)pyrene-cis-4,5-dihydrodiol dehydrogenase activity(GO:0034809) citronellyl-CoA dehydrogenase activity(GO:0034824) menthone dehydrogenase activity(GO:0034838) phthalate 3,4-cis-dihydrodiol dehydrogenase activity(GO:0034912) cinnamate reductase activity(GO:0043786) NADPH-dependent curcumin reductase activity(GO:0052849) NADPH-dependent dihydrocurcumin reductase activity(GO:0052850) |
0.0 | 0.7 | GO:0004745 | retinol dehydrogenase activity(GO:0004745) |
0.0 | 0.2 | GO:0070891 | lipoteichoic acid binding(GO:0070891) |
0.0 | 1.0 | GO:0005507 | copper ion binding(GO:0005507) |
0.0 | 0.0 | GO:0097642 | calcitonin family receptor activity(GO:0097642) |
0.0 | 0.2 | GO:0031779 | melanocortin receptor binding(GO:0031779) type 3 melanocortin receptor binding(GO:0031781) type 4 melanocortin receptor binding(GO:0031782) |
0.0 | 0.1 | GO:0070139 | ubiquitin-like protein-specific endopeptidase activity(GO:0070137) SUMO-specific endopeptidase activity(GO:0070139) |
0.0 | 0.6 | GO:0022829 | wide pore channel activity(GO:0022829) |
0.0 | 1.6 | GO:0047485 | protein N-terminus binding(GO:0047485) |
0.0 | 0.1 | GO:0046923 | ER retention sequence binding(GO:0046923) |
0.0 | 0.1 | GO:0017089 | glycolipid transporter activity(GO:0017089) |
0.0 | 0.0 | GO:0003916 | DNA topoisomerase activity(GO:0003916) |
0.0 | 0.1 | GO:0008260 | 3-oxoacid CoA-transferase activity(GO:0008260) |
0.0 | 4.1 | GO:0004867 | serine-type endopeptidase inhibitor activity(GO:0004867) |
0.0 | 0.0 | GO:0019763 | immunoglobulin receptor activity(GO:0019763) |
0.0 | 0.3 | GO:0043014 | alpha-tubulin binding(GO:0043014) |
0.0 | 0.4 | GO:0008327 | methyl-CpG binding(GO:0008327) |
0.0 | 2.6 | GO:0003712 | transcription cofactor activity(GO:0003712) |
0.0 | 0.3 | GO:0016717 | oxidoreductase activity, acting on paired donors, with oxidation of a pair of donors resulting in the reduction of molecular oxygen to two molecules of water(GO:0016717) |
0.0 | 0.2 | GO:0004028 | 3-chloroallyl aldehyde dehydrogenase activity(GO:0004028) |
0.0 | 0.2 | GO:0032183 | SUMO binding(GO:0032183) |
0.0 | 0.1 | GO:0050510 | N-acetylgalactosaminyl-proteoglycan 3-beta-glucuronosyltransferase activity(GO:0050510) |
0.0 | 0.2 | GO:0004445 | inositol-polyphosphate 5-phosphatase activity(GO:0004445) |
0.0 | 0.0 | GO:0047045 | testosterone 17-beta-dehydrogenase (NADP+) activity(GO:0047045) |
0.0 | 0.0 | GO:0005119 | smoothened binding(GO:0005119) |
0.0 | 0.0 | GO:0016971 | flavin-linked sulfhydryl oxidase activity(GO:0016971) thiol oxidase activity(GO:0016972) |
0.0 | 0.0 | GO:0008410 | CoA-transferase activity(GO:0008410) |
0.0 | 0.2 | GO:0004449 | isocitrate dehydrogenase (NAD+) activity(GO:0004449) |
0.0 | 0.2 | GO:0001135 | transcription factor activity, RNA polymerase II transcription factor recruiting(GO:0001135) |
0.0 | 0.1 | GO:0004995 | tachykinin receptor activity(GO:0004995) |
0.0 | 0.6 | GO:0001594 | trace-amine receptor activity(GO:0001594) |
0.0 | 0.3 | GO:0031681 | G-protein beta-subunit binding(GO:0031681) |
0.0 | 0.1 | GO:0035662 | Toll-like receptor 4 binding(GO:0035662) |
0.0 | 0.1 | GO:0008427 | calcium-dependent protein kinase inhibitor activity(GO:0008427) calcium-dependent protein kinase regulator activity(GO:0010858) |
0.0 | 0.0 | GO:0048030 | disaccharide binding(GO:0048030) |
0.0 | 0.1 | GO:0050833 | pyruvate transmembrane transporter activity(GO:0050833) |
0.0 | 0.2 | GO:0016646 | oxidoreductase activity, acting on the CH-NH group of donors, NAD or NADP as acceptor(GO:0016646) |
0.0 | 0.0 | GO:0004741 | [pyruvate dehydrogenase (lipoamide)] phosphatase activity(GO:0004741) |
0.0 | 1.2 | GO:0030674 | protein binding, bridging(GO:0030674) |
0.0 | 0.0 | GO:0015927 | trehalase activity(GO:0015927) |
0.0 | 0.2 | GO:0015321 | sodium:phosphate symporter activity(GO:0005436) sodium-dependent phosphate transmembrane transporter activity(GO:0015321) |
0.0 | 0.1 | GO:0005157 | macrophage colony-stimulating factor receptor binding(GO:0005157) |
0.0 | 0.1 | GO:0005127 | ciliary neurotrophic factor receptor binding(GO:0005127) |
0.0 | 0.4 | GO:0008061 | chitin binding(GO:0008061) |
0.0 | 0.1 | GO:0046848 | hydroxyapatite binding(GO:0046848) |
0.0 | 0.1 | GO:0046624 | sphingolipid transporter activity(GO:0046624) |
0.0 | 0.0 | GO:0050815 | phosphoserine binding(GO:0050815) |
0.0 | 0.2 | GO:0001161 | intronic transcription regulatory region sequence-specific DNA binding(GO:0001161) |
0.0 | 0.4 | GO:0031072 | heat shock protein binding(GO:0031072) |
0.0 | 0.2 | GO:0050431 | transforming growth factor beta binding(GO:0050431) |
0.0 | 0.4 | GO:0008536 | Ran GTPase binding(GO:0008536) |
0.0 | 0.0 | GO:0031559 | oxidosqualene cyclase activity(GO:0031559) |
0.0 | 0.1 | GO:0051429 | corticotropin-releasing hormone receptor binding(GO:0051429) |
0.0 | 0.0 | GO:0016880 | acid-ammonia (or amide) ligase activity(GO:0016880) |
0.0 | 0.1 | GO:0004365 | glyceraldehyde-3-phosphate dehydrogenase (NAD+) (phosphorylating) activity(GO:0004365) glyceraldehyde-3-phosphate dehydrogenase (NAD(P)+) (phosphorylating) activity(GO:0043891) |
0.0 | 0.8 | GO:0016874 | ligase activity(GO:0016874) |
0.0 | 0.1 | GO:0060229 | lipase activator activity(GO:0060229) |
0.0 | 0.1 | GO:0004974 | leukotriene receptor activity(GO:0004974) |
0.0 | 0.1 | GO:0019992 | diacylglycerol binding(GO:0019992) |
0.0 | 0.3 | GO:0035257 | nuclear hormone receptor binding(GO:0035257) |
0.0 | 0.0 | GO:0043559 | insulin binding(GO:0043559) |
0.0 | 0.0 | GO:0004518 | nuclease activity(GO:0004518) |
0.0 | 0.9 | GO:0042393 | histone binding(GO:0042393) |
0.0 | 0.1 | GO:0070403 | NAD+ binding(GO:0070403) |
0.0 | 3.8 | GO:0003682 | chromatin binding(GO:0003682) |
0.0 | 0.0 | GO:0034618 | arginine binding(GO:0034618) |
0.0 | 0.1 | GO:2001069 | glycogen binding(GO:2001069) |
0.0 | 0.0 | GO:0015142 | citrate transmembrane transporter activity(GO:0015137) tricarboxylic acid transmembrane transporter activity(GO:0015142) |
0.0 | 0.1 | GO:1990254 | keratin filament binding(GO:1990254) |
0.0 | 0.1 | GO:0008486 | diphosphoinositol-polyphosphate diphosphatase activity(GO:0008486) |
0.0 | 0.1 | GO:0016624 | oxidoreductase activity, acting on the aldehyde or oxo group of donors, disulfide as acceptor(GO:0016624) |
0.0 | 0.1 | GO:0004000 | adenosine deaminase activity(GO:0004000) |
0.0 | 0.1 | GO:0005499 | vitamin D binding(GO:0005499) |
0.0 | 0.1 | GO:0050786 | RAGE receptor binding(GO:0050786) |
0.0 | 0.1 | GO:0004060 | arylamine N-acetyltransferase activity(GO:0004060) |
0.0 | 0.1 | GO:0031708 | endothelin B receptor binding(GO:0031708) |
0.0 | 0.2 | GO:0003796 | lysozyme activity(GO:0003796) |
0.0 | 0.0 | GO:0070052 | collagen V binding(GO:0070052) |
0.0 | 0.2 | GO:0005229 | intracellular calcium activated chloride channel activity(GO:0005229) |
0.0 | 0.1 | GO:0005143 | interleukin-12 receptor binding(GO:0005143) |
0.0 | 0.1 | GO:0005172 | vascular endothelial growth factor receptor binding(GO:0005172) |
0.0 | 0.1 | GO:0035325 | Toll-like receptor binding(GO:0035325) |
0.0 | 0.1 | GO:0051428 | peptide hormone receptor binding(GO:0051428) |
0.0 | 0.2 | GO:0032794 | GTPase activating protein binding(GO:0032794) |
0.0 | 0.1 | GO:0005041 | low-density lipoprotein receptor activity(GO:0005041) |
0.0 | 0.3 | GO:0004435 | phosphatidylinositol phospholipase C activity(GO:0004435) |
0.0 | 0.1 | GO:0036374 | gamma-glutamyltransferase activity(GO:0003840) glutathione hydrolase activity(GO:0036374) |
0.0 | 2.2 | GO:0005550 | pheromone binding(GO:0005550) |
0.0 | 0.1 | GO:0003688 | DNA replication origin binding(GO:0003688) |
0.0 | 0.5 | GO:0005184 | neuropeptide hormone activity(GO:0005184) |
0.0 | 0.1 | GO:0004169 | dolichyl-phosphate-mannose-protein mannosyltransferase activity(GO:0004169) |
0.0 | 0.1 | GO:0004029 | aldehyde dehydrogenase (NAD) activity(GO:0004029) |
0.0 | 3.1 | GO:0005125 | cytokine activity(GO:0005125) |
0.0 | 0.2 | GO:0004559 | alpha-mannosidase activity(GO:0004559) |
0.0 | 0.1 | GO:0031210 | phosphatidylcholine binding(GO:0031210) |
0.0 | 0.1 | GO:0003854 | 3-beta-hydroxy-delta5-steroid dehydrogenase activity(GO:0003854) |
0.0 | 0.0 | GO:1901611 | phosphatidylglycerol binding(GO:1901611) |
0.0 | 0.0 | GO:0008147 | structural constituent of bone(GO:0008147) |
0.0 | 0.0 | GO:0034452 | dynactin binding(GO:0034452) |
0.0 | 0.0 | GO:0030249 | guanylate cyclase regulator activity(GO:0030249) |
0.0 | 0.0 | GO:0015057 | thrombin receptor activity(GO:0015057) |
0.0 | 0.0 | GO:0047023 | androsterone dehydrogenase activity(GO:0047023) |
0.0 | 1.9 | GO:0019787 | ubiquitin-like protein transferase activity(GO:0019787) |
0.0 | 0.1 | GO:0015349 | thyroid hormone transmembrane transporter activity(GO:0015349) |
0.0 | 0.2 | GO:0015035 | protein disulfide oxidoreductase activity(GO:0015035) |
0.0 | 0.0 | GO:0038181 | bile acid receptor activity(GO:0038181) |
0.0 | 0.0 | GO:0042162 | telomeric DNA binding(GO:0042162) |
0.0 | 0.0 | GO:0004731 | purine-nucleoside phosphorylase activity(GO:0004731) |
0.0 | 0.0 | GO:0001846 | opsonin binding(GO:0001846) |
0.0 | 0.0 | GO:0031705 | bombesin receptor binding(GO:0031705) |
0.0 | 0.0 | GO:0042379 | chemokine receptor binding(GO:0042379) |
0.0 | 0.0 | GO:0071617 | lysophospholipid acyltransferase activity(GO:0071617) |
0.0 | 0.1 | GO:0015252 | hydrogen ion channel activity(GO:0015252) |
0.0 | 0.1 | GO:0050811 | GABA receptor binding(GO:0050811) |
0.0 | 0.0 | GO:0046934 | phosphatidylinositol-4,5-bisphosphate 3-kinase activity(GO:0046934) |
0.0 | 0.1 | GO:0035256 | G-protein coupled glutamate receptor binding(GO:0035256) |
0.0 | 0.3 | GO:0050840 | extracellular matrix binding(GO:0050840) |
0.0 | 0.0 | GO:0032934 | sterol binding(GO:0032934) |
0.0 | 0.1 | GO:0097016 | L27 domain binding(GO:0097016) |
0.0 | 0.2 | GO:0004364 | glutathione transferase activity(GO:0004364) |
0.0 | 0.1 | GO:0004630 | phospholipase D activity(GO:0004630) |
0.0 | 0.1 | GO:0008422 | beta-glucosidase activity(GO:0008422) |
0.0 | 0.1 | GO:0035671 | enone reductase activity(GO:0035671) |
0.0 | 0.1 | GO:0004579 | dolichyl-diphosphooligosaccharide-protein glycotransferase activity(GO:0004579) |
0.0 | 0.1 | GO:0005222 | intracellular cAMP activated cation channel activity(GO:0005222) |
0.0 | 0.0 | GO:0008301 | DNA binding, bending(GO:0008301) |
0.0 | 2.5 | GO:0016818 | hydrolase activity, acting on acid anhydrides, in phosphorus-containing anhydrides(GO:0016818) |
0.0 | 0.0 | GO:0034711 | inhibin binding(GO:0034711) |
0.0 | 0.0 | GO:0030229 | very-low-density lipoprotein particle receptor activity(GO:0030229) |
0.0 | 0.7 | GO:0000287 | magnesium ion binding(GO:0000287) |
0.0 | 0.0 | GO:0033691 | sialic acid binding(GO:0033691) |
0.0 | 0.0 | GO:0019976 | interleukin-2 binding(GO:0019976) |
0.0 | 0.0 | GO:0004461 | lactose synthase activity(GO:0004461) |
0.0 | 0.1 | GO:0019865 | immunoglobulin binding(GO:0019865) |
0.0 | 0.3 | GO:0004715 | non-membrane spanning protein tyrosine kinase activity(GO:0004715) |
0.0 | 0.1 | GO:0030548 | acetylcholine receptor regulator activity(GO:0030548) neurotransmitter receptor regulator activity(GO:0099602) |
0.0 | 0.0 | GO:0043422 | protein kinase B binding(GO:0043422) |
0.0 | 0.0 | GO:0033265 | choline binding(GO:0033265) |
0.0 | 0.0 | GO:0008107 | galactoside 2-alpha-L-fucosyltransferase activity(GO:0008107) alpha-(1,2)-fucosyltransferase activity(GO:0031127) |
0.0 | 0.0 | GO:0046935 | 1-phosphatidylinositol-3-kinase regulator activity(GO:0046935) |
0.0 | 0.5 | GO:0019903 | protein phosphatase binding(GO:0019903) |
0.0 | 0.0 | GO:0004957 | prostaglandin E receptor activity(GO:0004957) |
0.0 | 0.0 | GO:0001595 | angiotensin receptor activity(GO:0001595) |
0.0 | 0.1 | GO:0005080 | protein kinase C binding(GO:0005080) |
0.0 | 0.1 | GO:0001047 | core promoter binding(GO:0001047) |
0.0 | 0.1 | GO:0035326 | enhancer binding(GO:0035326) |
0.0 | 0.2 | GO:0030414 | peptidase inhibitor activity(GO:0030414) |
0.0 | 0.0 | GO:0004924 | oncostatin-M receptor activity(GO:0004924) |
0.0 | 0.3 | GO:0005496 | steroid binding(GO:0005496) |
0.0 | 0.0 | GO:0051371 | muscle alpha-actinin binding(GO:0051371) |
0.0 | 1.2 | GO:0016758 | transferase activity, transferring hexosyl groups(GO:0016758) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.7 | 9.7 | PID IL5 PATHWAY | IL5-mediated signaling events |
0.5 | 7.4 | PID CIRCADIAN PATHWAY | Circadian rhythm pathway |
0.5 | 0.5 | PID TCR JNK PATHWAY | JNK signaling in the CD4+ TCR pathway |
0.4 | 2.8 | PID IL2 STAT5 PATHWAY | IL2 signaling events mediated by STAT5 |
0.4 | 6.6 | PID SMAD2 3PATHWAY | Regulation of cytoplasmic and nuclear SMAD2/3 signaling |
0.4 | 1.1 | SA FAS SIGNALING | The TNF-type receptor Fas induces apoptosis on ligand binding. |
0.3 | 2.0 | ST JAK STAT PATHWAY | Jak-STAT Pathway |
0.3 | 10.8 | PID ARF6 PATHWAY | Arf6 signaling events |
0.3 | 17.9 | PID HIF1 TFPATHWAY | HIF-1-alpha transcription factor network |
0.3 | 3.7 | SA REG CASCADE OF CYCLIN EXPR | Expression of cyclins regulates progression through the cell cycle by activating cyclin-dependent kinases. |
0.3 | 18.9 | PID ERA GENOMIC PATHWAY | Validated nuclear estrogen receptor alpha network |
0.3 | 0.6 | PID ERB GENOMIC PATHWAY | Validated nuclear estrogen receptor beta network |
0.3 | 2.0 | ST INTERLEUKIN 4 PATHWAY | Interleukin 4 (IL-4) Pathway |
0.3 | 2.0 | SA G2 AND M PHASES | Cdc25 activates the cdc2/cyclin B complex to induce the G2/M transition. |
0.3 | 1.4 | SA PTEN PATHWAY | PTEN is a tumor suppressor that dephosphorylates the lipid messenger phosphatidylinositol triphosphate. |
0.3 | 10.8 | PID PLK1 PATHWAY | PLK1 signaling events |
0.3 | 10.6 | PID P53 REGULATION PATHWAY | p53 pathway |
0.3 | 2.1 | PID ERBB1 RECEPTOR PROXIMAL PATHWAY | EGF receptor (ErbB1) signaling pathway |
0.3 | 11.5 | PID DELTA NP63 PATHWAY | Validated transcriptional targets of deltaNp63 isoforms |
0.3 | 0.8 | PID TCR RAS PATHWAY | Ras signaling in the CD4+ TCR pathway |
0.3 | 3.9 | PID AURORA A PATHWAY | Aurora A signaling |
0.3 | 4.3 | PID THROMBIN PAR1 PATHWAY | PAR1-mediated thrombin signaling events |
0.3 | 5.0 | PID IL8 CXCR2 PATHWAY | IL8- and CXCR2-mediated signaling events |
0.2 | 5.9 | PID FAS PATHWAY | FAS (CD95) signaling pathway |
0.2 | 5.4 | PID IFNG PATHWAY | IFN-gamma pathway |
0.2 | 11.7 | PID VEGFR1 2 PATHWAY | Signaling events mediated by VEGFR1 and VEGFR2 |
0.2 | 0.7 | ST TYPE I INTERFERON PATHWAY | Type I Interferon (alpha/beta IFN) Pathway |
0.2 | 10.3 | PID REG GR PATHWAY | Glucocorticoid receptor regulatory network |
0.2 | 8.6 | PID ILK PATHWAY | Integrin-linked kinase signaling |
0.2 | 0.2 | SA PROGRAMMED CELL DEATH | Programmed cell death, or apoptosis, eliminates damaged or unneeded cells. |
0.2 | 3.8 | PID HEDGEHOG GLI PATHWAY | Hedgehog signaling events mediated by Gli proteins |
0.2 | 1.4 | SIG PIP3 SIGNALING IN CARDIAC MYOCTES | Genes related to PIP3 signaling in cardiac myocytes |
0.2 | 5.6 | ST P38 MAPK PATHWAY | p38 MAPK Pathway |
0.2 | 3.7 | PID IL2 PI3K PATHWAY | IL2 signaling events mediated by PI3K |
0.2 | 5.3 | PID CERAMIDE PATHWAY | Ceramide signaling pathway |
0.2 | 3.0 | PID LYMPH ANGIOGENESIS PATHWAY | VEGFR3 signaling in lymphatic endothelium |
0.2 | 9.8 | PID TELOMERASE PATHWAY | Regulation of Telomerase |
0.2 | 3.6 | PID RXR VDR PATHWAY | RXR and RAR heterodimerization with other nuclear receptor |
0.2 | 2.8 | ST WNT CA2 CYCLIC GMP PATHWAY | Wnt/Ca2+/cyclic GMP signaling. |
0.2 | 0.2 | PID EPHA2 FWD PATHWAY | EPHA2 forward signaling |
0.2 | 2.5 | PID IL6 7 PATHWAY | IL6-mediated signaling events |
0.2 | 13.9 | PID P53 DOWNSTREAM PATHWAY | Direct p53 effectors |
0.2 | 0.9 | PID GMCSF PATHWAY | GMCSF-mediated signaling events |
0.2 | 3.0 | PID KIT PATHWAY | Signaling events mediated by Stem cell factor receptor (c-Kit) |
0.2 | 2.4 | PID HIF2PATHWAY | HIF-2-alpha transcription factor network |
0.2 | 0.9 | ST PHOSPHOINOSITIDE 3 KINASE PATHWAY | PI3K Pathway |
0.2 | 2.0 | PID SYNDECAN 2 PATHWAY | Syndecan-2-mediated signaling events |
0.2 | 5.5 | PID HDAC CLASSI PATHWAY | Signaling events mediated by HDAC Class I |
0.2 | 1.8 | PID IL23 PATHWAY | IL23-mediated signaling events |
0.2 | 0.4 | ST GAQ PATHWAY | G alpha q Pathway |
0.2 | 4.2 | PID PS1 PATHWAY | Presenilin action in Notch and Wnt signaling |
0.2 | 0.5 | PID PDGFRA PATHWAY | PDGFR-alpha signaling pathway |
0.2 | 1.3 | SA CASPASE CASCADE | Apoptosis is mediated by caspases, cysteine proteases arranged in a proteolytic cascade. |
0.2 | 2.3 | PID RB 1PATHWAY | Regulation of retinoblastoma protein |
0.2 | 0.5 | PID EPO PATHWAY | EPO signaling pathway |
0.2 | 3.8 | PID AURORA B PATHWAY | Aurora B signaling |
0.2 | 1.6 | PID WNT CANONICAL PATHWAY | Canonical Wnt signaling pathway |
0.2 | 1.5 | SIG CD40PATHWAYMAP | Genes related to CD40 signaling |
0.2 | 1.5 | PID HDAC CLASSIII PATHWAY | Signaling events mediated by HDAC Class III |
0.2 | 2.3 | PID ERBB1 INTERNALIZATION PATHWAY | Internalization of ErbB1 |
0.2 | 2.6 | SIG INSULIN RECEPTOR PATHWAY IN CARDIAC MYOCYTES | Genes related to the insulin receptor pathway |
0.2 | 0.3 | PID IGF1 PATHWAY | IGF1 pathway |
0.1 | 4.2 | PID FANCONI PATHWAY | Fanconi anemia pathway |
0.1 | 2.2 | PID RAC1 PATHWAY | RAC1 signaling pathway |
0.1 | 4.3 | ST INTEGRIN SIGNALING PATHWAY | Integrin Signaling Pathway |
0.1 | 6.3 | PID PDGFRB PATHWAY | PDGFR-beta signaling pathway |
0.1 | 4.1 | PID IL12 2PATHWAY | IL12-mediated signaling events |
0.1 | 4.2 | PID SMAD2 3NUCLEAR PATHWAY | Regulation of nuclear SMAD2/3 signaling |
0.1 | 1.0 | PID RHOA PATHWAY | RhoA signaling pathway |
0.1 | 0.4 | PID AMB2 NEUTROPHILS PATHWAY | amb2 Integrin signaling |
0.1 | 2.1 | PID TNF PATHWAY | TNF receptor signaling pathway |
0.1 | 0.9 | PID PI3K PLC TRK PATHWAY | Trk receptor signaling mediated by PI3K and PLC-gamma |
0.1 | 0.3 | PID MET PATHWAY | Signaling events mediated by Hepatocyte Growth Factor Receptor (c-Met) |
0.1 | 1.3 | PID INTEGRIN A9B1 PATHWAY | Alpha9 beta1 integrin signaling events |
0.1 | 2.8 | PID NFAT TFPATHWAY | Calcineurin-regulated NFAT-dependent transcription in lymphocytes |
0.1 | 2.1 | ST FAS SIGNALING PATHWAY | Fas Signaling Pathway |
0.1 | 0.4 | PID SYNDECAN 1 PATHWAY | Syndecan-1-mediated signaling events |
0.1 | 2.8 | PID MYC REPRESS PATHWAY | Validated targets of C-MYC transcriptional repression |
0.1 | 0.5 | PID AVB3 INTEGRIN PATHWAY | Integrins in angiogenesis |
0.1 | 0.1 | SIG BCR SIGNALING PATHWAY | Members of the BCR signaling pathway |
0.1 | 0.2 | ST PAC1 RECEPTOR PATHWAY | PAC1 Receptor Pathway |
0.1 | 1.6 | PID P38 ALPHA BETA DOWNSTREAM PATHWAY | Signaling mediated by p38-alpha and p38-beta |
0.1 | 0.4 | PID SYNDECAN 4 PATHWAY | Syndecan-4-mediated signaling events |
0.1 | 1.7 | PID CASPASE PATHWAY | Caspase cascade in apoptosis |
0.1 | 2.3 | PID P73PATHWAY | p73 transcription factor network |
0.1 | 0.9 | PID PI3KCI PATHWAY | Class I PI3K signaling events |
0.1 | 0.8 | PID WNT NONCANONICAL PATHWAY | Noncanonical Wnt signaling pathway |
0.1 | 0.8 | PID PRL SIGNALING EVENTS PATHWAY | Signaling events mediated by PRL |
0.1 | 0.3 | SIG CHEMOTAXIS | Genes related to chemotaxis |
0.1 | 0.4 | ST DIFFERENTIATION PATHWAY IN PC12 CELLS | Differentiation Pathway in PC12 Cells; this is a specific case of PAC1 Receptor Pathway. |
0.1 | 0.8 | PID ALK2 PATHWAY | ALK2 signaling events |
0.1 | 1.3 | PID BCR 5PATHWAY | BCR signaling pathway |
0.1 | 1.0 | PID ANGIOPOIETIN RECEPTOR PATHWAY | Angiopoietin receptor Tie2-mediated signaling |
0.1 | 2.4 | PID HNF3B PATHWAY | FOXA2 and FOXA3 transcription factor networks |
0.1 | 1.3 | PID WNT SIGNALING PATHWAY | Wnt signaling network |
0.1 | 0.5 | PID NECTIN PATHWAY | Nectin adhesion pathway |
0.1 | 1.1 | PID CXCR4 PATHWAY | CXCR4-mediated signaling events |
0.1 | 0.9 | SIG REGULATION OF THE ACTIN CYTOSKELETON BY RHO GTPASES | Genes related to regulation of the actin cytoskeleton |
0.1 | 2.5 | PID CMYB PATHWAY | C-MYB transcription factor network |
0.1 | 1.2 | PID A6B1 A6B4 INTEGRIN PATHWAY | a6b1 and a6b4 Integrin signaling |
0.1 | 3.1 | PID MYC ACTIV PATHWAY | Validated targets of C-MYC transcriptional activation |
0.1 | 1.5 | PID RHODOPSIN PATHWAY | Visual signal transduction: Rods |
0.1 | 1.5 | PID MTOR 4PATHWAY | mTOR signaling pathway |
0.1 | 1.6 | PID E2F PATHWAY | E2F transcription factor network |
0.1 | 0.6 | PID FCER1 PATHWAY | Fc-epsilon receptor I signaling in mast cells |
0.1 | 0.9 | PID UPA UPAR PATHWAY | Urokinase-type plasminogen activator (uPA) and uPAR-mediated signaling |
0.1 | 1.5 | PID INTEGRIN3 PATHWAY | Beta3 integrin cell surface interactions |
0.1 | 0.9 | PID ECADHERIN STABILIZATION PATHWAY | Stabilization and expansion of the E-cadherin adherens junction |
0.1 | 2.2 | WNT SIGNALING | Genes related to Wnt-mediated signal transduction |
0.1 | 1.0 | PID IL4 2PATHWAY | IL4-mediated signaling events |
0.1 | 0.7 | PID LPA4 PATHWAY | LPA4-mediated signaling events |
0.1 | 0.8 | PID AR TF PATHWAY | Regulation of Androgen receptor activity |
0.1 | 0.6 | PID ARF 3PATHWAY | Arf1 pathway |
0.1 | 0.8 | PID AP1 PATHWAY | AP-1 transcription factor network |
0.1 | 0.1 | ST GRANULE CELL SURVIVAL PATHWAY | Granule Cell Survival Pathway is a specific case of more general PAC1 Receptor Pathway. |
0.1 | 0.2 | PID HIF1A PATHWAY | Hypoxic and oxygen homeostasis regulation of HIF-1-alpha |
0.1 | 0.1 | PID NFKAPPAB ATYPICAL PATHWAY | Atypical NF-kappaB pathway |
0.1 | 0.2 | PID REELIN PATHWAY | Reelin signaling pathway |
0.1 | 0.2 | PID NEPHRIN NEPH1 PATHWAY | Nephrin/Neph1 signaling in the kidney podocyte |
0.1 | 0.6 | PID CD8 TCR DOWNSTREAM PATHWAY | Downstream signaling in naïve CD8+ T cells |
0.1 | 0.6 | PID LIS1 PATHWAY | Lissencephaly gene (LIS1) in neuronal migration and development |
0.0 | 0.8 | PID P75 NTR PATHWAY | p75(NTR)-mediated signaling |
0.0 | 0.4 | PID GLYPICAN 1PATHWAY | Glypican 1 network |
0.0 | 0.2 | PID FAK PATHWAY | Signaling events mediated by focal adhesion kinase |
0.0 | 0.3 | PID ERBB2 ERBB3 PATHWAY | ErbB2/ErbB3 signaling events |
0.0 | 0.4 | PID IL1 PATHWAY | IL1-mediated signaling events |
0.0 | 0.3 | PID FRA PATHWAY | Validated transcriptional targets of AP1 family members Fra1 and Fra2 |
0.0 | 0.7 | PID LKB1 PATHWAY | LKB1 signaling events |
0.0 | 0.3 | PID MAPK TRK PATHWAY | Trk receptor signaling mediated by the MAPK pathway |
0.0 | 1.3 | NABA PROTEOGLYCANS | Genes encoding proteoglycans |
0.0 | 0.1 | PID CD40 PATHWAY | CD40/CD40L signaling |
0.0 | 0.2 | PID FOXO PATHWAY | FoxO family signaling |
0.0 | 0.6 | PID TOLL ENDOGENOUS PATHWAY | Endogenous TLR signaling |
0.0 | 0.2 | PID BARD1 PATHWAY | BARD1 signaling events |
0.0 | 0.1 | ST T CELL SIGNAL TRANSDUCTION | T Cell Signal Transduction |
0.0 | 0.1 | PID TRAIL PATHWAY | TRAIL signaling pathway |
0.0 | 0.0 | PID PI3KCI AKT PATHWAY | Class I PI3K signaling events mediated by Akt |
0.0 | 0.0 | SIG PIP3 SIGNALING IN B LYMPHOCYTES | Genes related to PIP3 signaling in B lymphocytes |
0.0 | 0.1 | PID S1P S1P4 PATHWAY | S1P4 pathway |
0.0 | 0.2 | SA MMP CYTOKINE CONNECTION | Cytokines can induce activation of matrix metalloproteinases, which degrade extracellular matrix. |
0.0 | 0.6 | PID BETA CATENIN NUC PATHWAY | Regulation of nuclear beta catenin signaling and target gene transcription |
0.0 | 0.1 | PID ER NONGENOMIC PATHWAY | Plasma membrane estrogen receptor signaling |
0.0 | 0.1 | PID CXCR3 PATHWAY | CXCR3-mediated signaling events |
0.0 | 0.1 | ST JNK MAPK PATHWAY | JNK MAPK Pathway |
0.0 | 0.0 | ST G ALPHA S PATHWAY | G alpha s Pathway |
0.0 | 0.1 | PID PTP1B PATHWAY | Signaling events mediated by PTP1B |
0.0 | 0.2 | PID ERBB1 DOWNSTREAM PATHWAY | ErbB1 downstream signaling |
0.0 | 0.3 | PID TGFBR PATHWAY | TGF-beta receptor signaling |
0.0 | 0.2 | PID TAP63 PATHWAY | Validated transcriptional targets of TAp63 isoforms |
0.0 | 0.0 | PID P38 GAMMA DELTA PATHWAY | Signaling mediated by p38-gamma and p38-delta |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
1.2 | 1.2 | REACTOME DEADENYLATION DEPENDENT MRNA DECAY | Genes involved in Deadenylation-dependent mRNA decay |
1.0 | 2.0 | REACTOME DESTABILIZATION OF MRNA BY TRISTETRAPROLIN TTP | Genes involved in Destabilization of mRNA by Tristetraprolin (TTP) |
0.9 | 9.0 | REACTOME PASSIVE TRANSPORT BY AQUAPORINS | Genes involved in Passive Transport by Aquaporins |
0.8 | 3.8 | REACTOME RNA POL I PROMOTER OPENING | Genes involved in RNA Polymerase I Promoter Opening |
0.7 | 12.7 | REACTOME DOWNREGULATION OF SMAD2 3 SMAD4 TRANSCRIPTIONAL ACTIVITY | Genes involved in Downregulation of SMAD2/3:SMAD4 transcriptional activity |
0.6 | 5.5 | REACTOME PURINE CATABOLISM | Genes involved in Purine catabolism |
0.5 | 5.0 | REACTOME REGULATION OF COMPLEMENT CASCADE | Genes involved in Regulation of Complement cascade |
0.5 | 1.5 | REACTOME AQUAPORIN MEDIATED TRANSPORT | Genes involved in Aquaporin-mediated transport |
0.5 | 5.4 | REACTOME IL 7 SIGNALING | Genes involved in Interleukin-7 signaling |
0.5 | 8.3 | REACTOME ACTIVATED AMPK STIMULATES FATTY ACID OXIDATION IN MUSCLE | Genes involved in Activated AMPK stimulates fatty-acid oxidation in muscle |
0.4 | 6.2 | REACTOME METABOLISM OF PORPHYRINS | Genes involved in Metabolism of porphyrins |
0.4 | 6.9 | REACTOME CHYLOMICRON MEDIATED LIPID TRANSPORT | Genes involved in Chylomicron-mediated lipid transport |
0.4 | 12.7 | REACTOME BMAL1 CLOCK NPAS2 ACTIVATES CIRCADIAN EXPRESSION | Genes involved in BMAL1:CLOCK/NPAS2 Activates Circadian Expression |
0.4 | 2.3 | REACTOME NFKB ACTIVATION THROUGH FADD RIP1 PATHWAY MEDIATED BY CASPASE 8 AND10 | Genes involved in NF-kB activation through FADD/RIP-1 pathway mediated by caspase-8 and -10 |
0.4 | 5.7 | REACTOME CTNNB1 PHOSPHORYLATION CASCADE | Genes involved in Beta-catenin phosphorylation cascade |
0.4 | 8.1 | REACTOME G0 AND EARLY G1 | Genes involved in G0 and Early G1 |
0.4 | 7.7 | REACTOME G1 PHASE | Genes involved in G1 Phase |
0.4 | 25.5 | REACTOME MITOTIC PROMETAPHASE | Genes involved in Mitotic Prometaphase |
0.4 | 2.9 | REACTOME SIGNAL REGULATORY PROTEIN SIRP FAMILY INTERACTIONS | Genes involved in Signal regulatory protein (SIRP) family interactions |
0.4 | 5.3 | REACTOME P130CAS LINKAGE TO MAPK SIGNALING FOR INTEGRINS | Genes involved in p130Cas linkage to MAPK signaling for integrins |
0.4 | 4.9 | REACTOME REGULATION OF INSULIN LIKE GROWTH FACTOR IGF ACTIVITY BY INSULIN LIKE GROWTH FACTOR BINDING PROTEINS IGFBPS | Genes involved in Regulation of Insulin-like Growth Factor (IGF) Activity by Insulin-like Growth Factor Binding Proteins (IGFBPs) |
0.4 | 7.7 | REACTOME SMOOTH MUSCLE CONTRACTION | Genes involved in Smooth Muscle Contraction |
0.3 | 3.8 | REACTOME ACTIVATION OF BH3 ONLY PROTEINS | Genes involved in Activation of BH3-only proteins |
0.3 | 2.3 | REACTOME CREATION OF C4 AND C2 ACTIVATORS | Genes involved in Creation of C4 and C2 activators |
0.3 | 3.9 | REACTOME TGF BETA RECEPTOR SIGNALING IN EMT EPITHELIAL TO MESENCHYMAL TRANSITION | Genes involved in TGF-beta receptor signaling in EMT (epithelial to mesenchymal transition) |
0.3 | 1.6 | REACTOME REGULATION OF THE FANCONI ANEMIA PATHWAY | Genes involved in Regulation of the Fanconi anemia pathway |
0.3 | 0.6 | REACTOME P53 INDEPENDENT G1 S DNA DAMAGE CHECKPOINT | Genes involved in p53-Independent G1/S DNA damage checkpoint |
0.3 | 1.9 | REACTOME REGULATION OF ORNITHINE DECARBOXYLASE ODC | Genes involved in Regulation of ornithine decarboxylase (ODC) |
0.3 | 5.1 | REACTOME POST CHAPERONIN TUBULIN FOLDING PATHWAY | Genes involved in Post-chaperonin tubulin folding pathway |
0.3 | 4.4 | REACTOME MRNA DECAY BY 5 TO 3 EXORIBONUCLEASE | Genes involved in mRNA Decay by 5' to 3' Exoribonuclease |
0.3 | 7.5 | REACTOME NEGATIVE REGULATORS OF RIG I MDA5 SIGNALING | Genes involved in Negative regulators of RIG-I/MDA5 signaling |
0.3 | 5.2 | REACTOME DEADENYLATION OF MRNA | Genes involved in Deadenylation of mRNA |
0.3 | 0.6 | REACTOME S PHASE | Genes involved in S Phase |
0.3 | 0.3 | REACTOME CONVERSION FROM APC C CDC20 TO APC C CDH1 IN LATE ANAPHASE | Genes involved in Conversion from APC/C:Cdc20 to APC/C:Cdh1 in late anaphase |
0.3 | 0.3 | REACTOME SIGNALING BY WNT | Genes involved in Signaling by Wnt |
0.3 | 3.3 | REACTOME PURINE SALVAGE | Genes involved in Purine salvage |
0.3 | 4.1 | REACTOME DESTABILIZATION OF MRNA BY BRF1 | Genes involved in Destabilization of mRNA by Butyrate Response Factor 1 (BRF1) |
0.3 | 3.5 | REACTOME REGULATION OF PYRUVATE DEHYDROGENASE PDH COMPLEX | Genes involved in Regulation of pyruvate dehydrogenase (PDH) complex |
0.3 | 11.5 | REACTOME CLEAVAGE OF GROWING TRANSCRIPT IN THE TERMINATION REGION | Genes involved in Cleavage of Growing Transcript in the Termination Region |
0.3 | 3.8 | REACTOME METABOLISM OF NON CODING RNA | Genes involved in Metabolism of non-coding RNA |
0.3 | 0.5 | REACTOME MRNA CAPPING | Genes involved in mRNA Capping |
0.3 | 6.2 | REACTOME SULFUR AMINO ACID METABOLISM | Genes involved in Sulfur amino acid metabolism |
0.3 | 2.9 | REACTOME REGULATION OF IFNG SIGNALING | Genes involved in Regulation of IFNG signaling |
0.3 | 11.9 | REACTOME GOLGI ASSOCIATED VESICLE BIOGENESIS | Genes involved in Golgi Associated Vesicle Biogenesis |
0.3 | 2.3 | REACTOME PYRIMIDINE CATABOLISM | Genes involved in Pyrimidine catabolism |
0.3 | 0.5 | REACTOME PEPTIDE CHAIN ELONGATION | Genes involved in Peptide chain elongation |
0.2 | 4.0 | REACTOME PRE NOTCH TRANSCRIPTION AND TRANSLATION | Genes involved in Pre-NOTCH Transcription and Translation |
0.2 | 0.7 | REACTOME TRAF3 DEPENDENT IRF ACTIVATION PATHWAY | Genes involved in TRAF3-dependent IRF activation pathway |
0.2 | 6.1 | REACTOME RNA POL III TRANSCRIPTION INITIATION FROM TYPE 3 PROMOTER | Genes involved in RNA Polymerase III Transcription Initiation From Type 3 Promoter |
0.2 | 13.4 | REACTOME REGULATION OF MRNA STABILITY BY PROTEINS THAT BIND AU RICH ELEMENTS | Genes involved in Regulation of mRNA Stability by Proteins that Bind AU-rich Elements |
0.2 | 2.7 | REACTOME SMAD2 SMAD3 SMAD4 HETEROTRIMER REGULATES TRANSCRIPTION | Genes involved in SMAD2/SMAD3:SMAD4 heterotrimer regulates transcription |
0.2 | 1.2 | REACTOME PACKAGING OF TELOMERE ENDS | Genes involved in Packaging Of Telomere Ends |
0.2 | 3.1 | REACTOME INFLAMMASOMES | Genes involved in Inflammasomes |
0.2 | 6.3 | REACTOME SPHINGOLIPID DE NOVO BIOSYNTHESIS | Genes involved in Sphingolipid de novo biosynthesis |
0.2 | 9.0 | REACTOME INTERFERON ALPHA BETA SIGNALING | Genes involved in Interferon alpha/beta signaling |
0.2 | 3.5 | REACTOME INTRINSIC PATHWAY | Genes involved in Intrinsic Pathway |
0.2 | 1.8 | REACTOME MTORC1 MEDIATED SIGNALLING | Genes involved in mTORC1-mediated signalling |
0.2 | 4.1 | REACTOME SIGNALING BY HIPPO | Genes involved in Signaling by Hippo |
0.2 | 2.2 | REACTOME CYTOSOLIC SULFONATION OF SMALL MOLECULES | Genes involved in Cytosolic sulfonation of small molecules |
0.2 | 2.4 | REACTOME BILE SALT AND ORGANIC ANION SLC TRANSPORTERS | Genes involved in Bile salt and organic anion SLC transporters |
0.2 | 0.9 | REACTOME PKB MEDIATED EVENTS | Genes involved in PKB-mediated events |
0.2 | 2.8 | REACTOME SIGNALING BY FGFR1 FUSION MUTANTS | Genes involved in Signaling by FGFR1 fusion mutants |
0.2 | 0.9 | REACTOME INFLUENZA VIRAL RNA TRANSCRIPTION AND REPLICATION | Genes involved in Influenza Viral RNA Transcription and Replication |
0.2 | 1.3 | REACTOME ABACAVIR TRANSPORT AND METABOLISM | Genes involved in Abacavir transport and metabolism |
0.2 | 2.1 | REACTOME HYALURONAN UPTAKE AND DEGRADATION | Genes involved in Hyaluronan uptake and degradation |
0.2 | 6.4 | REACTOME RNA POL II TRANSCRIPTION PRE INITIATION AND PROMOTER OPENING | Genes involved in RNA Polymerase II Transcription Pre-Initiation And Promoter Opening |
0.2 | 1.5 | REACTOME RAF MAP KINASE CASCADE | Genes involved in RAF/MAP kinase cascade |
0.2 | 14.3 | REACTOME PPARA ACTIVATES GENE EXPRESSION | Genes involved in PPARA Activates Gene Expression |
0.2 | 3.4 | REACTOME BRANCHED CHAIN AMINO ACID CATABOLISM | Genes involved in Branched-chain amino acid catabolism |
0.2 | 3.0 | REACTOME SYNTHESIS OF BILE ACIDS AND BILE SALTS VIA 7ALPHA HYDROXYCHOLESTEROL | Genes involved in Synthesis of bile acids and bile salts via 7alpha-hydroxycholesterol |
0.2 | 3.4 | REACTOME AMINO ACID TRANSPORT ACROSS THE PLASMA MEMBRANE | Genes involved in Amino acid transport across the plasma membrane |
0.2 | 1.2 | REACTOME PROLONGED ERK ACTIVATION EVENTS | Genes involved in Prolonged ERK activation events |
0.2 | 1.8 | REACTOME NUCLEOTIDE BINDING DOMAIN LEUCINE RICH REPEAT CONTAINING RECEPTOR NLR SIGNALING PATHWAYS | Genes involved in Nucleotide-binding domain, leucine rich repeat containing receptor (NLR) signaling pathways |
0.2 | 0.4 | REACTOME ACTIVATED TAK1 MEDIATES P38 MAPK ACTIVATION | Genes involved in activated TAK1 mediates p38 MAPK activation |
0.2 | 4.0 | REACTOME ACYL CHAIN REMODELLING OF PC | Genes involved in Acyl chain remodelling of PC |
0.2 | 1.3 | REACTOME METABOLISM OF POLYAMINES | Genes involved in Metabolism of polyamines |
0.2 | 0.2 | REACTOME P53 DEPENDENT G1 DNA DAMAGE RESPONSE | Genes involved in p53-Dependent G1 DNA Damage Response |
0.2 | 2.1 | REACTOME VITAMIN B5 PANTOTHENATE METABOLISM | Genes involved in Vitamin B5 (pantothenate) metabolism |
0.2 | 5.6 | REACTOME GLUCOSE TRANSPORT | Genes involved in Glucose transport |
0.2 | 3.7 | REACTOME BASIGIN INTERACTIONS | Genes involved in Basigin interactions |
0.2 | 2.1 | REACTOME TRAFFICKING AND PROCESSING OF ENDOSOMAL TLR | Genes involved in Trafficking and processing of endosomal TLR |
0.2 | 0.9 | REACTOME TRANS GOLGI NETWORK VESICLE BUDDING | Genes involved in trans-Golgi Network Vesicle Budding |
0.2 | 3.5 | REACTOME SEMA4D INDUCED CELL MIGRATION AND GROWTH CONE COLLAPSE | Genes involved in Sema4D induced cell migration and growth-cone collapse |
0.2 | 8.4 | REACTOME MRNA SPLICING | Genes involved in mRNA Splicing |
0.2 | 0.7 | REACTOME ACTIVATION OF THE AP1 FAMILY OF TRANSCRIPTION FACTORS | Genes involved in Activation of the AP-1 family of transcription factors |
0.2 | 2.0 | REACTOME FORMATION OF ATP BY CHEMIOSMOTIC COUPLING | Genes involved in Formation of ATP by chemiosmotic coupling |
0.2 | 2.0 | REACTOME TRAF6 MEDIATED NFKB ACTIVATION | Genes involved in TRAF6 mediated NF-kB activation |
0.2 | 2.7 | REACTOME PREFOLDIN MEDIATED TRANSFER OF SUBSTRATE TO CCT TRIC | Genes involved in Prefoldin mediated transfer of substrate to CCT/TriC |
0.2 | 1.6 | REACTOME INTRINSIC PATHWAY FOR APOPTOSIS | Genes involved in Intrinsic Pathway for Apoptosis |
0.2 | 2.3 | REACTOME SYNTHESIS OF PA | Genes involved in Synthesis of PA |
0.2 | 2.6 | REACTOME ZINC TRANSPORTERS | Genes involved in Zinc transporters |
0.2 | 1.9 | REACTOME PYRIMIDINE METABOLISM | Genes involved in Pyrimidine metabolism |
0.2 | 1.6 | REACTOME CASPASE MEDIATED CLEAVAGE OF CYTOSKELETAL PROTEINS | Genes involved in Caspase-mediated cleavage of cytoskeletal proteins |
0.2 | 1.3 | REACTOME HDL MEDIATED LIPID TRANSPORT | Genes involved in HDL-mediated lipid transport |
0.2 | 2.1 | REACTOME REGULATION OF HYPOXIA INDUCIBLE FACTOR HIF BY OXYGEN | Genes involved in Regulation of Hypoxia-inducible Factor (HIF) by Oxygen |
0.2 | 0.6 | REACTOME GAMMA CARBOXYLATION TRANSPORT AND AMINO TERMINAL CLEAVAGE OF PROTEINS | Genes involved in Gamma-carboxylation, transport, and amino-terminal cleavage of proteins |
0.2 | 5.4 | REACTOME METABOLISM OF VITAMINS AND COFACTORS | Genes involved in Metabolism of vitamins and cofactors |
0.2 | 6.5 | REACTOME ACTIVATION OF THE MRNA UPON BINDING OF THE CAP BINDING COMPLEX AND EIFS AND SUBSEQUENT BINDING TO 43S | Genes involved in Activation of the mRNA upon binding of the cap-binding complex and eIFs, and subsequent binding to 43S |
0.2 | 1.1 | REACTOME METAL ION SLC TRANSPORTERS | Genes involved in Metal ion SLC transporters |
0.2 | 1.2 | REACTOME ACTIVATION OF CHAPERONES BY ATF6 ALPHA | Genes involved in Activation of Chaperones by ATF6-alpha |
0.1 | 1.2 | REACTOME SYNTHESIS SECRETION AND DEACYLATION OF GHRELIN | Genes involved in Synthesis, Secretion, and Deacylation of Ghrelin |
0.1 | 4.9 | REACTOME TRANSLATION | Genes involved in Translation |
0.1 | 2.1 | REACTOME APC C CDH1 MEDIATED DEGRADATION OF CDC20 AND OTHER APC C CDH1 TARGETED PROTEINS IN LATE MITOSIS EARLY G1 | Genes involved in APC/C:Cdh1 mediated degradation of Cdc20 and other APC/C:Cdh1 targeted proteins in late mitosis/early G1 |
0.1 | 3.5 | REACTOME AMINE COMPOUND SLC TRANSPORTERS | Genes involved in Amine compound SLC transporters |
0.1 | 8.2 | REACTOME NONSENSE MEDIATED DECAY ENHANCED BY THE EXON JUNCTION COMPLEX | Genes involved in Nonsense Mediated Decay Enhanced by the Exon Junction Complex |
0.1 | 5.2 | REACTOME PHASE1 FUNCTIONALIZATION OF COMPOUNDS | Genes involved in Phase 1 - Functionalization of compounds |
0.1 | 1.4 | REACTOME SYNTHESIS OF PE | Genes involved in Synthesis of PE |
0.1 | 1.2 | REACTOME DCC MEDIATED ATTRACTIVE SIGNALING | Genes involved in DCC mediated attractive signaling |
0.1 | 4.4 | REACTOME ACTIVATION OF CHAPERONE GENES BY XBP1S | Genes involved in Activation of Chaperone Genes by XBP1(S) |
0.1 | 1.6 | REACTOME CELL EXTRACELLULAR MATRIX INTERACTIONS | Genes involved in Cell-extracellular matrix interactions |
0.1 | 0.9 | REACTOME COMMON PATHWAY | Genes involved in Common Pathway |
0.1 | 2.2 | REACTOME GLUTATHIONE CONJUGATION | Genes involved in Glutathione conjugation |
0.1 | 2.1 | REACTOME MEIOTIC RECOMBINATION | Genes involved in Meiotic Recombination |
0.1 | 4.9 | REACTOME LOSS OF NLP FROM MITOTIC CENTROSOMES | Genes involved in Loss of Nlp from mitotic centrosomes |
0.1 | 1.8 | REACTOME SYNTHESIS OF SUBSTRATES IN N GLYCAN BIOSYTHESIS | Genes involved in Synthesis of substrates in N-glycan biosythesis |
0.1 | 2.1 | REACTOME CITRIC ACID CYCLE TCA CYCLE | Genes involved in Citric acid cycle (TCA cycle) |
0.1 | 1.2 | REACTOME DARPP 32 EVENTS | Genes involved in DARPP-32 events |
0.1 | 1.0 | REACTOME HORMONE SENSITIVE LIPASE HSL MEDIATED TRIACYLGLYCEROL HYDROLYSIS | Genes involved in Hormone-sensitive lipase (HSL)-mediated triacylglycerol hydrolysis |
0.1 | 4.7 | REACTOME NUCLEAR RECEPTOR TRANSCRIPTION PATHWAY | Genes involved in Nuclear Receptor transcription pathway |
0.1 | 3.2 | REACTOME ABC FAMILY PROTEINS MEDIATED TRANSPORT | Genes involved in ABC-family proteins mediated transport |
0.1 | 0.5 | REACTOME INHIBITION OF REPLICATION INITIATION OF DAMAGED DNA BY RB1 E2F1 | Genes involved in Inhibition of replication initiation of damaged DNA by RB1/E2F1 |
0.1 | 0.4 | REACTOME IRAK1 RECRUITS IKK COMPLEX | Genes involved in IRAK1 recruits IKK complex |
0.1 | 3.5 | REACTOME SPHINGOLIPID METABOLISM | Genes involved in Sphingolipid metabolism |
0.1 | 0.2 | REACTOME SYNTHESIS OF PIPS AT THE EARLY ENDOSOME MEMBRANE | Genes involved in Synthesis of PIPs at the early endosome membrane |
0.1 | 0.7 | REACTOME UNFOLDED PROTEIN RESPONSE | Genes involved in Unfolded Protein Response |
0.1 | 2.4 | REACTOME GLUCONEOGENESIS | Genes involved in Gluconeogenesis |
0.1 | 3.0 | REACTOME GLYCEROPHOSPHOLIPID BIOSYNTHESIS | Genes involved in Glycerophospholipid biosynthesis |
0.1 | 1.0 | REACTOME TRYPTOPHAN CATABOLISM | Genes involved in Tryptophan catabolism |
0.1 | 0.4 | REACTOME ELONGATION ARREST AND RECOVERY | Genes involved in Elongation arrest and recovery |
0.1 | 1.2 | REACTOME GLYCOGEN BREAKDOWN GLYCOGENOLYSIS | Genes involved in Glycogen breakdown (glycogenolysis) |
0.1 | 2.4 | REACTOME EXTENSION OF TELOMERES | Genes involved in Extension of Telomeres |
0.1 | 2.7 | REACTOME SYNTHESIS OF PIPS AT THE PLASMA MEMBRANE | Genes involved in Synthesis of PIPs at the plasma membrane |
0.1 | 4.1 | REACTOME MITOCHONDRIAL PROTEIN IMPORT | Genes involved in Mitochondrial Protein Import |
0.1 | 5.4 | REACTOME FACTORS INVOLVED IN MEGAKARYOCYTE DEVELOPMENT AND PLATELET PRODUCTION | Genes involved in Factors involved in megakaryocyte development and platelet production |
0.1 | 1.2 | REACTOME JNK C JUN KINASES PHOSPHORYLATION AND ACTIVATION MEDIATED BY ACTIVATED HUMAN TAK1 | Genes involved in JNK (c-Jun kinases) phosphorylation and activation mediated by activated human TAK1 |
0.1 | 7.8 | REACTOME METABOLISM OF AMINO ACIDS AND DERIVATIVES | Genes involved in Metabolism of amino acids and derivatives |
0.1 | 1.8 | REACTOME DAG AND IP3 SIGNALING | Genes involved in DAG and IP3 signaling |
0.1 | 0.2 | REACTOME TRANSPORT OF RIBONUCLEOPROTEINS INTO THE HOST NUCLEUS | Genes involved in Transport of Ribonucleoproteins into the Host Nucleus |
0.1 | 0.1 | REACTOME CIRCADIAN REPRESSION OF EXPRESSION BY REV ERBA | Genes involved in Circadian Repression of Expression by REV-ERBA |
0.1 | 0.7 | REACTOME CD28 DEPENDENT VAV1 PATHWAY | Genes involved in CD28 dependent Vav1 pathway |
0.1 | 2.3 | REACTOME ENDOSOMAL SORTING COMPLEX REQUIRED FOR TRANSPORT ESCRT | Genes involved in Endosomal Sorting Complex Required For Transport (ESCRT) |
0.1 | 1.1 | REACTOME PURINE RIBONUCLEOSIDE MONOPHOSPHATE BIOSYNTHESIS | Genes involved in Purine ribonucleoside monophosphate biosynthesis |
0.1 | 1.1 | REACTOME DNA STRAND ELONGATION | Genes involved in DNA strand elongation |
0.1 | 1.1 | REACTOME M G1 TRANSITION | Genes involved in M/G1 Transition |
0.1 | 0.3 | REACTOME IL 6 SIGNALING | Genes involved in Interleukin-6 signaling |
0.1 | 1.4 | REACTOME IL1 SIGNALING | Genes involved in Interleukin-1 signaling |
0.1 | 0.8 | REACTOME GLOBAL GENOMIC NER GG NER | Genes involved in Global Genomic NER (GG-NER) |
0.1 | 1.2 | REACTOME FANCONI ANEMIA PATHWAY | Genes involved in Fanconi Anemia pathway |
0.1 | 1.0 | REACTOME TRANSCRIPTIONAL REGULATION OF WHITE ADIPOCYTE DIFFERENTIATION | Genes involved in Transcriptional Regulation of White Adipocyte Differentiation |
0.1 | 0.4 | REACTOME MITOTIC M M G1 PHASES | Genes involved in Mitotic M-M/G1 phases |
0.1 | 0.8 | REACTOME PHOSPHORYLATION OF CD3 AND TCR ZETA CHAINS | Genes involved in Phosphorylation of CD3 and TCR zeta chains |
0.1 | 1.4 | REACTOME STEROID HORMONES | Genes involved in Steroid hormones |
0.1 | 1.1 | REACTOME P2Y RECEPTORS | Genes involved in P2Y receptors |
0.1 | 1.3 | REACTOME APOPTOTIC CLEAVAGE OF CELLULAR PROTEINS | Genes involved in Apoptotic cleavage of cellular proteins |
0.1 | 0.8 | REACTOME REGULATION OF INSULIN SECRETION BY ACETYLCHOLINE | Genes involved in Regulation of Insulin Secretion by Acetylcholine |
0.1 | 0.7 | REACTOME ANTIGEN ACTIVATES B CELL RECEPTOR LEADING TO GENERATION OF SECOND MESSENGERS | Genes involved in Antigen Activates B Cell Receptor Leading to Generation of Second Messengers |
0.1 | 2.0 | REACTOME CYTOSOLIC TRNA AMINOACYLATION | Genes involved in Cytosolic tRNA aminoacylation |
0.1 | 0.6 | REACTOME KERATAN SULFATE DEGRADATION | Genes involved in Keratan sulfate degradation |
0.1 | 1.7 | REACTOME DOWNSTREAM SIGNAL TRANSDUCTION | Genes involved in Downstream signal transduction |
0.1 | 0.1 | REACTOME CIRCADIAN CLOCK | Genes involved in Circadian Clock |
0.1 | 10.5 | REACTOME ANTIGEN PROCESSING UBIQUITINATION PROTEASOME DEGRADATION | Genes involved in Antigen processing: Ubiquitination & Proteasome degradation |
0.1 | 0.4 | REACTOME ADENYLATE CYCLASE INHIBITORY PATHWAY | Genes involved in Adenylate cyclase inhibitory pathway |
0.1 | 1.2 | REACTOME BIOSYNTHESIS OF THE N GLYCAN PRECURSOR DOLICHOL LIPID LINKED OLIGOSACCHARIDE LLO AND TRANSFER TO A NASCENT PROTEIN | Genes involved in Biosynthesis of the N-glycan precursor (dolichol lipid-linked oligosaccharide, LLO) and transfer to a nascent protein |
0.1 | 1.0 | REACTOME RECYCLING PATHWAY OF L1 | Genes involved in Recycling pathway of L1 |
0.1 | 0.9 | REACTOME SYNTHESIS OF PIPS AT THE GOLGI MEMBRANE | Genes involved in Synthesis of PIPs at the Golgi membrane |
0.1 | 0.5 | REACTOME REGULATION OF SIGNALING BY CBL | Genes involved in Regulation of signaling by CBL |
0.1 | 2.4 | REACTOME TRANSPORT TO THE GOLGI AND SUBSEQUENT MODIFICATION | Genes involved in Transport to the Golgi and subsequent modification |
0.1 | 0.2 | REACTOME SIGNALLING TO P38 VIA RIT AND RIN | Genes involved in Signalling to p38 via RIT and RIN |
0.1 | 1.2 | REACTOME ASSOCIATION OF TRIC CCT WITH TARGET PROTEINS DURING BIOSYNTHESIS | Genes involved in Association of TriC/CCT with target proteins during biosynthesis |
0.1 | 0.1 | REACTOME ADVANCED GLYCOSYLATION ENDPRODUCT RECEPTOR SIGNALING | Genes involved in Advanced glycosylation endproduct receptor signaling |
0.1 | 1.5 | REACTOME NOTCH1 INTRACELLULAR DOMAIN REGULATES TRANSCRIPTION | Genes involved in NOTCH1 Intracellular Domain Regulates Transcription |
0.1 | 3.1 | REACTOME MHC CLASS II ANTIGEN PRESENTATION | Genes involved in MHC class II antigen presentation |
0.1 | 0.5 | REACTOME CGMP EFFECTS | Genes involved in cGMP effects |
0.1 | 0.5 | REACTOME EXTRINSIC PATHWAY FOR APOPTOSIS | Genes involved in Extrinsic Pathway for Apoptosis |
0.1 | 0.3 | REACTOME THE ROLE OF NEF IN HIV1 REPLICATION AND DISEASE PATHOGENESIS | Genes involved in The role of Nef in HIV-1 replication and disease pathogenesis |
0.1 | 0.2 | REACTOME RECYCLING OF BILE ACIDS AND SALTS | Genes involved in Recycling of bile acids and salts |
0.1 | 0.9 | REACTOME ANTIVIRAL MECHANISM BY IFN STIMULATED GENES | Genes involved in Antiviral mechanism by IFN-stimulated genes |
0.1 | 0.1 | REACTOME INITIAL TRIGGERING OF COMPLEMENT | Genes involved in Initial triggering of complement |
0.1 | 0.8 | REACTOME REGULATION OF GENE EXPRESSION IN BETA CELLS | Genes involved in Regulation of gene expression in beta cells |
0.1 | 0.8 | REACTOME PRE NOTCH PROCESSING IN GOLGI | Genes involved in Pre-NOTCH Processing in Golgi |
0.1 | 0.1 | REACTOME MEMBRANE BINDING AND TARGETTING OF GAG PROTEINS | Genes involved in Membrane binding and targetting of GAG proteins |
0.1 | 0.1 | REACTOME INSULIN RECEPTOR RECYCLING | Genes involved in Insulin receptor recycling |
0.1 | 3.1 | REACTOME CHEMOKINE RECEPTORS BIND CHEMOKINES | Genes involved in Chemokine receptors bind chemokines |
0.1 | 0.6 | REACTOME LATENT INFECTION OF HOMO SAPIENS WITH MYCOBACTERIUM TUBERCULOSIS | Genes involved in Latent infection of Homo sapiens with Mycobacterium tuberculosis |
0.1 | 0.3 | REACTOME NUCLEOTIDE LIKE PURINERGIC RECEPTORS | Genes involved in Nucleotide-like (purinergic) receptors |
0.1 | 0.4 | REACTOME METABOLISM OF STEROID HORMONES AND VITAMINS A AND D | Genes involved in Metabolism of steroid hormones and vitamins A and D |
0.1 | 0.1 | REACTOME SPRY REGULATION OF FGF SIGNALING | Genes involved in Spry regulation of FGF signaling |
0.1 | 0.4 | REACTOME ELEVATION OF CYTOSOLIC CA2 LEVELS | Genes involved in Elevation of cytosolic Ca2+ levels |
0.1 | 0.1 | REACTOME OLFACTORY SIGNALING PATHWAY | Genes involved in Olfactory Signaling Pathway |
0.1 | 1.4 | REACTOME SIGNALING BY NOTCH1 | Genes involved in Signaling by NOTCH1 |
0.1 | 2.1 | REACTOME AMINE LIGAND BINDING RECEPTORS | Genes involved in Amine ligand-binding receptors |
0.1 | 1.1 | REACTOME GENERIC TRANSCRIPTION PATHWAY | Genes involved in Generic Transcription Pathway |
0.1 | 0.8 | REACTOME ASPARAGINE N LINKED GLYCOSYLATION | Genes involved in Asparagine N-linked glycosylation |
0.1 | 0.9 | REACTOME HS GAG DEGRADATION | Genes involved in HS-GAG degradation |
0.1 | 0.2 | REACTOME DOWNSTREAM TCR SIGNALING | Genes involved in Downstream TCR signaling |
0.1 | 0.1 | REACTOME PECAM1 INTERACTIONS | Genes involved in PECAM1 interactions |
0.1 | 0.2 | REACTOME SEMA4D IN SEMAPHORIN SIGNALING | Genes involved in Sema4D in semaphorin signaling |
0.1 | 0.3 | REACTOME TIE2 SIGNALING | Genes involved in Tie2 Signaling |
0.1 | 1.2 | REACTOME IRON UPTAKE AND TRANSPORT | Genes involved in Iron uptake and transport |
0.1 | 1.7 | REACTOME RESPONSE TO ELEVATED PLATELET CYTOSOLIC CA2 | Genes involved in Response to elevated platelet cytosolic Ca2+ |
0.1 | 0.5 | REACTOME MITOTIC G2 G2 M PHASES | Genes involved in Mitotic G2-G2/M phases |
0.1 | 2.0 | REACTOME P75 NTR RECEPTOR MEDIATED SIGNALLING | Genes involved in p75 NTR receptor-mediated signalling |
0.1 | 0.5 | REACTOME KERATAN SULFATE BIOSYNTHESIS | Genes involved in Keratan sulfate biosynthesis |
0.0 | 0.4 | REACTOME ORGANIC CATION ANION ZWITTERION TRANSPORT | Genes involved in Organic cation/anion/zwitterion transport |
0.0 | 0.2 | REACTOME RNA POL III TRANSCRIPTION INITIATION FROM TYPE 2 PROMOTER | Genes involved in RNA Polymerase III Transcription Initiation From Type 2 Promoter |
0.0 | 0.3 | REACTOME SIGNAL ATTENUATION | Genes involved in Signal attenuation |
0.0 | 0.8 | REACTOME CHOLESTEROL BIOSYNTHESIS | Genes involved in Cholesterol biosynthesis |
0.0 | 0.3 | REACTOME ROLE OF DCC IN REGULATING APOPTOSIS | Genes involved in Role of DCC in regulating apoptosis |
0.0 | 0.0 | REACTOME DOWNREGULATION OF ERBB2 ERBB3 SIGNALING | Genes involved in Downregulation of ERBB2:ERBB3 signaling |
0.0 | 0.1 | REACTOME INTEGRIN ALPHAIIB BETA3 SIGNALING | Genes involved in Integrin alphaIIb beta3 signaling |
0.0 | 0.0 | REACTOME TRANSLOCATION OF ZAP 70 TO IMMUNOLOGICAL SYNAPSE | Genes involved in Translocation of ZAP-70 to Immunological synapse |
0.0 | 2.4 | REACTOME SIGNALING BY RHO GTPASES | Genes involved in Signaling by Rho GTPases |
0.0 | 0.3 | REACTOME DEPOSITION OF NEW CENPA CONTAINING NUCLEOSOMES AT THE CENTROMERE | Genes involved in Deposition of New CENPA-containing Nucleosomes at the Centromere |
0.0 | 0.6 | REACTOME METABOLISM OF NUCLEOTIDES | Genes involved in Metabolism of nucleotides |
0.0 | 0.0 | REACTOME RETROGRADE NEUROTROPHIN SIGNALLING | Genes involved in Retrograde neurotrophin signalling |
0.0 | 1.4 | REACTOME O LINKED GLYCOSYLATION OF MUCINS | Genes involved in O-linked glycosylation of mucins |
0.0 | 0.4 | REACTOME TANDEM PORE DOMAIN POTASSIUM CHANNELS | Genes involved in Tandem pore domain potassium channels |
0.0 | 0.1 | REACTOME LATE PHASE OF HIV LIFE CYCLE | Genes involved in Late Phase of HIV Life Cycle |
0.0 | 0.5 | REACTOME PHASE II CONJUGATION | Genes involved in Phase II conjugation |
0.0 | 0.1 | REACTOME PLATELET ADHESION TO EXPOSED COLLAGEN | Genes involved in Platelet Adhesion to exposed collagen |
0.0 | 0.2 | REACTOME MICRORNA MIRNA BIOGENESIS | Genes involved in MicroRNA (miRNA) Biogenesis |
0.0 | 2.1 | REACTOME RESPIRATORY ELECTRON TRANSPORT ATP SYNTHESIS BY CHEMIOSMOTIC COUPLING AND HEAT PRODUCTION BY UNCOUPLING PROTEINS | Genes involved in Respiratory electron transport, ATP synthesis by chemiosmotic coupling, and heat production by uncoupling proteins. |
0.0 | 0.1 | REACTOME GASTRIN CREB SIGNALLING PATHWAY VIA PKC AND MAPK | Genes involved in Gastrin-CREB signalling pathway via PKC and MAPK |
0.0 | 0.6 | REACTOME CHONDROITIN SULFATE BIOSYNTHESIS | Genes involved in Chondroitin sulfate biosynthesis |
0.0 | 0.5 | REACTOME SYNTHESIS OF GLYCOSYLPHOSPHATIDYLINOSITOL GPI | Genes involved in Synthesis of glycosylphosphatidylinositol (GPI) |
0.0 | 0.5 | REACTOME MUSCLE CONTRACTION | Genes involved in Muscle contraction |
0.0 | 0.0 | REACTOME BILE ACID AND BILE SALT METABOLISM | Genes involved in Bile acid and bile salt metabolism |
0.0 | 0.4 | REACTOME MITOCHONDRIAL TRNA AMINOACYLATION | Genes involved in Mitochondrial tRNA aminoacylation |
0.0 | 0.0 | REACTOME PLATELET AGGREGATION PLUG FORMATION | Genes involved in Platelet Aggregation (Plug Formation) |
0.0 | 0.1 | REACTOME ERKS ARE INACTIVATED | Genes involved in ERKs are inactivated |
0.0 | 0.0 | REACTOME NITRIC OXIDE STIMULATES GUANYLATE CYCLASE | Genes involved in Nitric oxide stimulates guanylate cyclase |
0.0 | 0.1 | REACTOME PROLACTIN RECEPTOR SIGNALING | Genes involved in Prolactin receptor signaling |
0.0 | 0.2 | REACTOME MITOCHONDRIAL FATTY ACID BETA OXIDATION | Genes involved in Mitochondrial Fatty Acid Beta-Oxidation |
0.0 | 0.6 | REACTOME IMMUNOREGULATORY INTERACTIONS BETWEEN A LYMPHOID AND A NON LYMPHOID CELL | Genes involved in Immunoregulatory interactions between a Lymphoid and a non-Lymphoid cell |
0.0 | 0.1 | REACTOME PTM GAMMA CARBOXYLATION HYPUSINE FORMATION AND ARYLSULFATASE ACTIVATION | Genes involved in PTM: gamma carboxylation, hypusine formation and arylsulfatase activation |
0.0 | 0.2 | REACTOME COSTIMULATION BY THE CD28 FAMILY | Genes involved in Costimulation by the CD28 family |
0.0 | 0.0 | REACTOME G2 M DNA DAMAGE CHECKPOINT | Genes involved in G2/M DNA damage checkpoint |
0.0 | 0.1 | REACTOME RNA POL I TRANSCRIPTION TERMINATION | Genes involved in RNA Polymerase I Transcription Termination |
0.0 | 0.0 | REACTOME RNA POL I TRANSCRIPTION INITIATION | Genes involved in RNA Polymerase I Transcription Initiation |
0.0 | 0.0 | REACTOME LIPID DIGESTION MOBILIZATION AND TRANSPORT | Genes involved in Lipid digestion, mobilization, and transport |
0.0 | 0.1 | REACTOME HIV INFECTION | Genes involved in HIV Infection |
0.0 | 0.1 | REACTOME SIGNALING BY EGFR IN CANCER | Genes involved in Signaling by EGFR in Cancer |