Gene Symbol | Gene ID | Gene Info |
---|---|---|
Dmc1
|
ENSMUSG00000022429.10 | Dmc1 |
Gene | Promoter | Pearson corr. coef. | P-value | Plot |
---|---|---|---|---|
Dmc1 | mm10_chr15_80254611_80255266 | 0.47 | 3.3e-04 | Click! |
Move your cursor over a bar to see sample name and corresponding Z-value.
Cis Regulatory Element (CRE) | Target Score | Top associated gene | Gene Info | Distance of CRE to TSS | CRE/Gene association probability |
---|---|---|---|---|---|
chrX_162271221_162271394 | 2.53 |
Gm27490 |
predicted gene, 27490 |
34208 |
0.19 |
chr11_16503560_16503934 | 2.44 |
Sec61g |
SEC61, gamma subunit |
1297 |
0.48 |
chr11_32256536_32256847 | 2.21 |
Nprl3 |
nitrogen permease regulator-like 3 |
278 |
0.84 |
chr10_61412962_61413255 | 1.90 |
Nodal |
nodal |
4864 |
0.13 |
chr13_113843409_113843570 | 1.88 |
Arl15 |
ADP-ribosylation factor-like 15 |
48867 |
0.12 |
chr2_79259353_79259890 | 1.83 |
Itga4 |
integrin alpha 4 |
3674 |
0.29 |
chr3_51727985_51728369 | 1.74 |
Gm37342 |
predicted gene, 37342 |
33911 |
0.1 |
chr7_133710460_133710636 | 1.71 |
Uros |
uroporphyrinogen III synthase |
476 |
0.63 |
chr5_73311488_73311911 | 1.67 |
Gm42732 |
predicted gene 42732 |
335 |
0.78 |
chrX_8271734_8271885 | 1.60 |
Slc38a5 |
solute carrier family 38, member 5 |
167 |
0.93 |
chr17_40806499_40806942 | 1.57 |
Crisp2 |
cysteine-rich secretory protein 2 |
283 |
0.88 |
chrX_20364057_20365089 | 1.55 |
Rp2 |
retinitis pigmentosa 2 homolog |
2 |
0.97 |
chr9_70670476_70670731 | 1.53 |
Adam10 |
a disintegrin and metallopeptidase domain 10 |
8394 |
0.17 |
chr3_103130224_103130445 | 1.52 |
Dennd2c |
DENN/MADD domain containing 2C |
2778 |
0.18 |
chr1_167384518_167384727 | 1.52 |
Mgst3 |
microsomal glutathione S-transferase 3 |
9219 |
0.15 |
chr7_110096317_110096468 | 1.50 |
Zfp143 |
zinc finger protein 143 |
4763 |
0.14 |
chr6_143068606_143068801 | 1.50 |
C2cd5 |
C2 calcium-dependent domain containing 5 |
1618 |
0.37 |
chr13_97781724_97782048 | 1.49 |
Gm47577 |
predicted gene, 47577 |
8678 |
0.15 |
chr2_73093042_73093445 | 1.48 |
Gm13665 |
predicted gene 13665 |
23505 |
0.16 |
chr19_59905716_59906059 | 1.44 |
Gm17203 |
predicted gene 17203 |
4825 |
0.24 |
chr5_88721046_88721960 | 1.43 |
Mob1b |
MOB kinase activator 1B |
526 |
0.74 |
chr12_55053367_55053544 | 1.43 |
2700097O09Rik |
RIKEN cDNA 2700097O09 gene |
646 |
0.57 |
chrX_143011915_143012211 | 1.43 |
Ammecr1 |
Alport syndrome, mental retardation, midface hypoplasia and elliptocytosis chromosomal region gene 1 |
45335 |
0.15 |
chr1_58962444_58962764 | 1.42 |
Trak2 |
trafficking protein, kinesin binding 2 |
10825 |
0.14 |
chr9_85749937_85750116 | 1.41 |
Ibtk |
inhibitor of Bruton agammaglobulinemia tyrosine kinase |
692 |
0.48 |
chr4_41087547_41087707 | 1.40 |
Aqp3 |
aquaporin 3 |
6821 |
0.12 |
chr13_100865849_100866049 | 1.40 |
Gm37830 |
predicted gene, 37830 |
6831 |
0.15 |
chr2_78715888_78716039 | 1.39 |
Gm14463 |
predicted gene 14463 |
58534 |
0.14 |
chr10_20518100_20518462 | 1.39 |
Gm17229 |
predicted gene 17229 |
117 |
0.97 |
chr10_115817431_115817601 | 1.38 |
Tspan8 |
tetraspanin 8 |
232 |
0.95 |
chr7_115086686_115087004 | 1.38 |
Gm34225 |
predicted gene, 34225 |
20325 |
0.22 |
chr6_116350044_116350568 | 1.38 |
Marchf8 |
membrane associated ring-CH-type finger 8 |
79 |
0.95 |
chr9_113968750_113968926 | 1.38 |
Ubp1 |
upstream binding protein 1 |
387 |
0.83 |
chr12_117781453_117781614 | 1.37 |
Cdca7l |
cell division cycle associated 7 like |
22756 |
0.18 |
chr4_119036598_119036749 | 1.35 |
Gm12866 |
predicted gene 12866 |
32438 |
0.08 |
chr6_148517970_148518129 | 1.34 |
Tmtc1 |
transmembrane and tetratricopeptide repeat containing 1 |
73660 |
0.08 |
chr9_64953225_64953560 | 1.32 |
Slc24a1 |
solute carrier family 24 (sodium/potassium/calcium exchanger), member 1 |
1785 |
0.27 |
chr2_173038101_173038586 | 1.31 |
Gm14453 |
predicted gene 14453 |
3763 |
0.17 |
chr14_75178362_75178525 | 1.29 |
Lcp1 |
lymphocyte cytosolic protein 1 |
2235 |
0.25 |
chr17_84926246_84926536 | 1.29 |
Gm49982 |
predicted gene, 49982 |
23822 |
0.14 |
chr18_12166800_12167170 | 1.28 |
Rmc1 |
regulator of MON1-CCZ1 |
1732 |
0.26 |
chr4_13784684_13784853 | 1.28 |
Runx1t1 |
RUNX1 translocation partner 1 |
14 |
0.99 |
chr10_21196984_21197164 | 1.26 |
Gm40608 |
predicted gene, 40608 |
7892 |
0.15 |
chr6_7698045_7698383 | 1.26 |
Asns |
asparagine synthetase |
4960 |
0.24 |
chr17_88431657_88431832 | 1.25 |
Foxn2 |
forkhead box N2 |
8967 |
0.19 |
chr15_62159095_62159287 | 1.24 |
Pvt1 |
Pvt1 oncogene |
18984 |
0.25 |
chr9_120114727_120115009 | 1.23 |
Slc25a38 |
solute carrier family 25, member 38 |
18 |
0.94 |
chr1_181335461_181335629 | 1.23 |
Cnih3 |
cornichon family AMPA receptor auxiliary protein 3 |
17083 |
0.15 |
chr16_18428507_18428684 | 1.22 |
Txnrd2 |
thioredoxin reductase 2 |
102 |
0.93 |
chr10_110707438_110707662 | 1.22 |
E2f7 |
E2F transcription factor 7 |
37889 |
0.16 |
chr7_141132187_141132543 | 1.21 |
Ptdss2 |
phosphatidylserine synthase 2 |
73 |
0.93 |
chr18_82522843_82523026 | 1.20 |
Rpl21-ps8 |
ribosomal protein L21, pseudogene 8 |
1087 |
0.51 |
chr5_134915452_134915620 | 1.20 |
Cldn13 |
claudin 13 |
10 |
0.94 |
chr9_24910777_24911106 | 1.20 |
Gm48255 |
predicted gene, 48255 |
42032 |
0.12 |
chr2_118660231_118660403 | 1.19 |
Pak6 |
p21 (RAC1) activated kinase 6 |
2986 |
0.2 |
chrX_52101493_52101777 | 1.19 |
Gpc4 |
glypican 4 |
63617 |
0.13 |
chr13_99019329_99019480 | 1.18 |
A930014D07Rik |
RIKEN cDNA A930014D07 gene |
12305 |
0.12 |
chr17_50021430_50021821 | 1.17 |
AC133946.1 |
oxidoreductase NAD-binding domain containing 1 (OXNAD1) pseudogene |
48798 |
0.13 |
chr1_181216457_181216615 | 1.16 |
Wdr26 |
WD repeat domain 26 |
4535 |
0.16 |
chr1_134526691_134526981 | 1.16 |
Gm29376 |
predicted gene 29376 |
6858 |
0.11 |
chrX_164093486_164093817 | 1.16 |
Cltrn |
collectrin, amino acid transport regulator |
1462 |
0.37 |
chrX_139527078_139527292 | 1.16 |
Rnf128 |
ring finger protein 128 |
36131 |
0.16 |
chr17_50020254_50020555 | 1.16 |
AC133946.1 |
oxidoreductase NAD-binding domain containing 1 (OXNAD1) pseudogene |
47577 |
0.13 |
chr18_78351325_78351617 | 1.15 |
Gm6133 |
predicted gene 6133 |
1717 |
0.5 |
chr6_90750105_90750422 | 1.15 |
Iqsec1 |
IQ motif and Sec7 domain 1 |
7287 |
0.18 |
chr7_109595199_109595528 | 1.15 |
Denn2b |
DENN domain containing 2B |
7302 |
0.17 |
chr6_116286832_116287192 | 1.15 |
Zfand4 |
zinc finger, AN1-type domain 4 |
459 |
0.75 |
chr15_38543513_38543843 | 1.15 |
Azin1 |
antizyme inhibitor 1 |
24412 |
0.1 |
chr14_69284995_69285519 | 1.15 |
Slc25a37 |
solute carrier family 25, member 37 |
145 |
0.8 |
chr13_106893878_106894037 | 1.15 |
Ipo11 |
importin 11 |
31193 |
0.12 |
chr4_46407004_46407329 | 1.14 |
Hemgn |
hemogen |
2930 |
0.18 |
chr6_108529257_108529443 | 1.13 |
Gm44040 |
predicted gene, 44040 |
3663 |
0.19 |
chr1_75179592_75180552 | 1.13 |
Abcb6 |
ATP-binding cassette, sub-family B (MDR/TAP), member 6 |
214 |
0.81 |
chr10_43630601_43630939 | 1.13 |
F930017D23Rik |
RIKEN cDNA F930017D23 gene |
7023 |
0.14 |
chr2_38997551_38998123 | 1.13 |
Wdr38 |
WD repeat domain 38 |
361 |
0.48 |
chr9_90262189_90262370 | 1.13 |
Tbc1d2b |
TBC1 domain family, member 2B |
6352 |
0.18 |
chr9_57505602_57506114 | 1.12 |
Rpp25 |
ribonuclease P/MRP 25 subunit |
1832 |
0.18 |
chr6_35254101_35254395 | 1.12 |
1810058I24Rik |
RIKEN cDNA 1810058I24 gene |
1516 |
0.33 |
chr14_75179359_75179560 | 1.11 |
Lcp1 |
lymphocyte cytosolic protein 1 |
3251 |
0.2 |
chr2_77498469_77498631 | 1.10 |
Zfp385b |
zinc finger protein 385B |
20985 |
0.22 |
chr5_96911548_96911805 | 1.10 |
Gm43147 |
predicted gene 43147 |
1565 |
0.22 |
chr2_15163820_15164009 | 1.10 |
Gm13313 |
predicted gene 13313 |
36314 |
0.17 |
chr8_4304136_4304633 | 1.10 |
Elavl1 |
ELAV (embryonic lethal, abnormal vision)-like 1 (Hu antigen R) |
8235 |
0.1 |
chr6_86660191_86660348 | 1.09 |
Mxd1 |
MAX dimerization protein 1 |
2836 |
0.15 |
chr1_132389850_132390483 | 1.09 |
Tmcc2 |
transmembrane and coiled-coil domains 2 |
152 |
0.94 |
chr11_6589932_6590111 | 1.08 |
Ccm2 |
cerebral cavernous malformation 2 |
3027 |
0.12 |
chr11_4487374_4488056 | 1.08 |
Mtmr3 |
myotubularin related protein 3 |
651 |
0.72 |
chr15_53206371_53206697 | 1.08 |
Ext1 |
exostosin glycosyltransferase 1 |
10279 |
0.31 |
chr8_109693217_109693840 | 1.08 |
Ist1 |
increased sodium tolerance 1 homolog (yeast) |
268 |
0.89 |
chr4_150517147_150517402 | 1.07 |
Rere |
arginine glutamic acid dipeptide (RE) repeats |
28881 |
0.19 |
chr12_32050211_32050499 | 1.07 |
Prkar2b |
protein kinase, cAMP dependent regulatory, type II beta |
10234 |
0.2 |
chr4_63374357_63374718 | 1.07 |
Akna |
AT-hook transcription factor |
6666 |
0.11 |
chr14_103276786_103276959 | 1.07 |
Mycbp2 |
MYC binding protein 2, E3 ubiquitin protein ligase |
1077 |
0.63 |
chr14_26595842_26595993 | 1.06 |
Dennd6a |
DENN/MADD domain containing 6A |
8754 |
0.12 |
chr12_100959221_100959550 | 1.06 |
Ccdc88c |
coiled-coil domain containing 88C |
14212 |
0.12 |
chr17_50020049_50020209 | 1.06 |
AC133946.1 |
oxidoreductase NAD-binding domain containing 1 (OXNAD1) pseudogene |
47302 |
0.13 |
chr1_38447624_38447823 | 1.05 |
Gm34727 |
predicted gene, 34727 |
39796 |
0.17 |
chr6_55324200_55324604 | 1.05 |
Aqp1 |
aquaporin 1 |
12030 |
0.14 |
chr4_126807098_126807255 | 1.05 |
AU040320 |
expressed sequence AU040320 |
9087 |
0.13 |
chr9_108079972_108080508 | 1.05 |
Mst1 |
macrophage stimulating 1 (hepatocyte growth factor-like) |
196 |
0.68 |
chr12_24644181_24644524 | 1.04 |
Gm6969 |
predicted pseudogene 6969 |
5342 |
0.16 |
chr11_87748800_87748969 | 1.04 |
Mir142hg |
Mir142 host gene (non-protein coding) |
6693 |
0.09 |
chr10_24007145_24007298 | 1.04 |
Taar7c-ps |
trace amine-associated receptor 7C, pseudogene |
6249 |
0.08 |
chr15_98837777_98837943 | 1.04 |
Kmt2d |
lysine (K)-specific methyltransferase 2D |
696 |
0.45 |
chrX_9274426_9274597 | 1.04 |
Xk |
X-linked Kx blood group |
1755 |
0.25 |
chr5_91960613_91960775 | 1.03 |
Thap6 |
THAP domain containing 6 |
1695 |
0.2 |
chr11_84822520_84822812 | 1.03 |
Mrm1 |
mitochondrial rRNA methyltransferase 1 |
3151 |
0.16 |
chr18_49747226_49747416 | 1.02 |
Dtwd2 |
DTW domain containing 2 |
8246 |
0.21 |
chr4_115856193_115856618 | 1.02 |
Mknk1 |
MAP kinase-interacting serine/threonine kinase 1 |
627 |
0.61 |
chr6_5237183_5237334 | 1.02 |
Gm44250 |
predicted gene, 44250 |
16772 |
0.15 |
chr4_87807121_87807346 | 1.02 |
Mllt3 |
myeloid/lymphoid or mixed-lineage leukemia; translocated to, 3 |
910 |
0.72 |
chr15_36338833_36339076 | 1.02 |
Gm33936 |
predicted gene, 33936 |
10800 |
0.13 |
chr1_155097341_155097504 | 1.02 |
Ier5 |
immediate early response 5 |
2214 |
0.25 |
chrX_159757617_159757795 | 1.01 |
Sh3kbp1 |
SH3-domain kinase binding protein 1 |
49105 |
0.17 |
chr3_35924140_35924343 | 1.01 |
Dcun1d1 |
DCN1, defective in cullin neddylation 1, domain containing 1 (S. cerevisiae) |
3053 |
0.16 |
chr15_44457390_44457901 | 1.01 |
Pkhd1l1 |
polycystic kidney and hepatic disease 1-like 1 |
92 |
0.97 |
chr6_146630109_146630279 | 1.01 |
Tm7sf3 |
transmembrane 7 superfamily member 3 |
4304 |
0.15 |
chr12_4873957_4874552 | 1.01 |
Mfsd2b |
major facilitator superfamily domain containing 2B |
91 |
0.95 |
chr6_95119496_95119657 | 1.01 |
Kbtbd8 |
kelch repeat and BTB (POZ) domain containing 8 |
1592 |
0.32 |
chr2_118658372_118658729 | 1.01 |
Pak6 |
p21 (RAC1) activated kinase 6 |
4753 |
0.16 |
chr16_62834180_62834338 | 1.00 |
Arl13b |
ADP-ribosylation factor-like 13B |
12734 |
0.15 |
chr10_24040236_24040403 | 1.00 |
Taar7e |
trace amine-associated receptor 7E |
2705 |
0.11 |
chr11_98582720_98583015 | 1.00 |
Ormdl3 |
ORM1-like 3 (S. cerevisiae) |
4501 |
0.12 |
chr1_153424402_153424576 | 0.99 |
Shcbp1l |
Shc SH2-domain binding protein 1-like |
673 |
0.62 |
chr8_107437145_107437413 | 0.99 |
Wwp2 |
WW domain containing E3 ubiquitin protein ligase 2 |
863 |
0.47 |
chr6_113373617_113373789 | 0.99 |
Tada3 |
transcriptional adaptor 3 |
2561 |
0.11 |
chr2_6284874_6285049 | 0.99 |
Gm13383 |
predicted gene 13383 |
27695 |
0.14 |
chr7_67259884_67260151 | 0.99 |
Mef2a |
myocyte enhancer factor 2A |
6145 |
0.17 |
chr4_151957913_151958084 | 0.98 |
Dnajc11 |
DnaJ heat shock protein family (Hsp40) member C11 |
855 |
0.5 |
chr19_24534375_24534662 | 0.98 |
Pip5k1b |
phosphatidylinositol-4-phosphate 5-kinase, type 1 beta |
21271 |
0.17 |
chr4_145200417_145200596 | 0.97 |
Vps13d |
vacuolar protein sorting 13D |
5501 |
0.24 |
chr11_29815794_29815966 | 0.97 |
Eml6 |
echinoderm microtubule associated protein like 6 |
5782 |
0.17 |
chr8_70843407_70843727 | 0.97 |
Arrdc2 |
arrestin domain containing 2 |
3847 |
0.09 |
chr10_28566951_28567102 | 0.96 |
Ptprk |
protein tyrosine phosphatase, receptor type, K |
6875 |
0.3 |
chr13_83344551_83344924 | 0.96 |
Gm48156 |
predicted gene, 48156 |
155028 |
0.04 |
chr5_143633599_143633770 | 0.95 |
Cyth3 |
cytohesin 3 |
382 |
0.86 |
chr13_109686553_109686738 | 0.95 |
Pde4d |
phosphodiesterase 4D, cAMP specific |
469 |
0.9 |
chr1_39430097_39430335 | 0.95 |
Gm37265 |
predicted gene, 37265 |
10284 |
0.17 |
chr13_92592599_92592750 | 0.95 |
Spz1 |
spermatogenic leucine zipper 1 |
16502 |
0.18 |
chr11_82863184_82863335 | 0.95 |
Rffl |
ring finger and FYVE like domain containing protein |
7485 |
0.11 |
chr5_140644792_140645130 | 0.95 |
Ttyh3 |
tweety family member 3 |
4036 |
0.17 |
chr14_16245167_16245371 | 0.95 |
Gm47794 |
predicted gene, 47794 |
1918 |
0.19 |
chr14_121137711_121137965 | 0.95 |
Farp1 |
FERM, RhoGEF (Arhgef) and pleckstrin domain protein 1 (chondrocyte-derived) |
35759 |
0.2 |
chrX_150549714_150550031 | 0.95 |
Alas2 |
aminolevulinic acid synthase 2, erythroid |
2413 |
0.21 |
chr2_173056725_173057347 | 0.95 |
Gm14453 |
predicted gene 14453 |
22456 |
0.12 |
chr6_146629867_146630103 | 0.94 |
Tm7sf3 |
transmembrane 7 superfamily member 3 |
4513 |
0.15 |
chr8_123978544_123978845 | 0.93 |
Abcb10 |
ATP-binding cassette, sub-family B (MDR/TAP), member 10 |
4428 |
0.12 |
chr9_70926847_70927150 | 0.93 |
Gm32017 |
predicted gene, 32017 |
3490 |
0.25 |
chr4_46040327_46040637 | 0.93 |
Tmod1 |
tropomodulin 1 |
1273 |
0.46 |
chr5_64435903_64436054 | 0.93 |
Gm31363 |
predicted gene, 31363 |
2023 |
0.25 |
chr2_103969398_103969685 | 0.93 |
Lmo2 |
LIM domain only 2 |
13 |
0.97 |
chr2_103888048_103888210 | 0.92 |
Gm13876 |
predicted gene 13876 |
195 |
0.9 |
chr15_83425276_83425627 | 0.92 |
Pacsin2 |
protein kinase C and casein kinase substrate in neurons 2 |
1661 |
0.32 |
chr1_194761612_194761775 | 0.92 |
Plxna2 |
plexin A2 |
2874 |
0.24 |
chr9_44286336_44286520 | 0.92 |
Abcg4 |
ATP binding cassette subfamily G member 4 |
1108 |
0.23 |
chr18_56870554_56870904 | 0.92 |
Gm18087 |
predicted gene, 18087 |
45359 |
0.14 |
chr5_5185604_5185793 | 0.92 |
Cdk14 |
cyclin-dependent kinase 14 |
9657 |
0.17 |
chr4_46040126_46040312 | 0.92 |
Tmod1 |
tropomodulin 1 |
1010 |
0.55 |
chr8_122317511_122318419 | 0.91 |
Zfpm1 |
zinc finger protein, multitype 1 |
10645 |
0.13 |
chr16_17132219_17132741 | 0.91 |
Sdf2l1 |
stromal cell-derived factor 2-like 1 |
97 |
0.91 |
chr2_129297548_129297725 | 0.91 |
Gm14023 |
predicted gene 14023 |
266 |
0.61 |
chr7_144787002_144787205 | 0.90 |
Gm34964 |
predicted gene, 34964 |
4705 |
0.13 |
chrX_161972055_161972414 | 0.90 |
Gm15202 |
predicted gene 15202 |
64011 |
0.12 |
chr12_33318119_33318307 | 0.90 |
Atxn7l1 |
ataxin 7-like 1 |
2808 |
0.29 |
chr7_96778767_96778949 | 0.90 |
Tenm4 |
teneurin transmembrane protein 4 |
924 |
0.56 |
chr1_194981097_194981410 | 0.90 |
Gm16897 |
predicted gene, 16897 |
4293 |
0.12 |
chr2_173000783_173000972 | 0.90 |
Rae1 |
ribonucleic acid export 1 |
753 |
0.57 |
chr13_20163704_20164022 | 0.90 |
Elmo1 |
engulfment and cell motility 1 |
21344 |
0.25 |
chr2_129226918_129227069 | 0.90 |
9830144P21Rik |
RIKEN cDNA 9830144P21 gene |
555 |
0.51 |
chr3_79994303_79994554 | 0.89 |
A330069K06Rik |
RIKEN cDNA A330069K06 gene |
60464 |
0.11 |
chr10_100525128_100525286 | 0.89 |
Cep290 |
centrosomal protein 290 |
15247 |
0.14 |
chr3_21988015_21988434 | 0.89 |
Gm43674 |
predicted gene 43674 |
10244 |
0.21 |
chr6_30146983_30147411 | 0.89 |
Mir182 |
microRNA 182 |
18795 |
0.12 |
chr10_58371567_58371922 | 0.89 |
Lims1 |
LIM and senescent cell antigen-like domains 1 |
290 |
0.91 |
chr10_20518494_20518668 | 0.88 |
Gm17229 |
predicted gene 17229 |
417 |
0.87 |
chr5_102045206_102045528 | 0.88 |
Gm43787 |
predicted gene 43787 |
12702 |
0.18 |
chr13_64410982_64411135 | 0.88 |
Cdk20 |
cyclin-dependent kinase 20 |
21256 |
0.1 |
chr16_20704209_20704360 | 0.88 |
Clcn2 |
chloride channel, voltage-sensitive 2 |
4450 |
0.08 |
chr1_145138899_145139309 | 0.88 |
Gm6550 |
predicted gene 6550 |
26839 |
0.2 |
chr13_43260715_43261023 | 0.88 |
Gfod1 |
glucose-fructose oxidoreductase domain containing 1 |
42536 |
0.15 |
chr3_69494373_69494539 | 0.87 |
Ppm1l |
protein phosphatase 1 (formerly 2C)-like |
2757 |
0.3 |
chr2_154765762_154765945 | 0.87 |
Gm14214 |
predicted gene 14214 |
4079 |
0.16 |
chr3_14882817_14883129 | 0.87 |
Car2 |
carbonic anhydrase 2 |
3300 |
0.24 |
chr6_120835077_120835250 | 0.87 |
Bcl2l13 |
BCL2-like 13 (apoptosis facilitator) |
1049 |
0.44 |
chr6_108207290_108207451 | 0.87 |
Itpr1 |
inositol 1,4,5-trisphosphate receptor 1 |
5726 |
0.24 |
chr11_107447539_107447694 | 0.87 |
Gm11714 |
predicted gene 11714 |
19340 |
0.11 |
chr2_34739802_34739961 | 0.86 |
Gapvd1 |
GTPase activating protein and VPS9 domains 1 |
10934 |
0.16 |
chr6_148619872_148620026 | 0.86 |
Gm6313 |
predicted gene 6313 |
5640 |
0.19 |
chr10_82994307_82994460 | 0.86 |
Chst11 |
carbohydrate sulfotransferase 11 |
8885 |
0.18 |
chr9_101710771_101710970 | 0.86 |
Gm47932 |
predicted gene, 47932 |
46835 |
0.12 |
chr2_131454120_131454271 | 0.86 |
Gm14304 |
predicted gene 14304 |
445 |
0.8 |
chr6_32850588_32850766 | 0.86 |
Chchd3 |
coiled-coil-helix-coiled-coil-helix domain containing 3 |
30985 |
0.22 |
chr8_23030341_23030492 | 0.85 |
Ank1 |
ankyrin 1, erythroid |
4683 |
0.21 |
chr13_93388637_93389177 | 0.85 |
Gm47155 |
predicted gene, 47155 |
21876 |
0.14 |
chr15_12340920_12341175 | 0.85 |
1810049J17Rik |
RIKEN cDNA 1810049J17 gene |
19148 |
0.16 |
chr6_55037607_55038099 | 0.85 |
Gars |
glycyl-tRNA synthetase |
154 |
0.96 |
chr17_80482654_80482847 | 0.85 |
Sos1 |
SOS Ras/Rac guanine nucleotide exchange factor 1 |
2297 |
0.33 |
chr11_24080630_24081232 | 0.85 |
Bcl11a |
B cell CLL/lymphoma 11A (zinc finger protein) |
261 |
0.89 |
chr2_120411391_120411551 | 0.84 |
Ganc |
glucosidase, alpha; neutral C |
58 |
0.97 |
chr7_103876880_103877043 | 0.84 |
Olfr66 |
olfactory receptor 66 |
5280 |
0.07 |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.8 | 2.4 | GO:1901844 | regulation of cell communication by electrical coupling involved in cardiac conduction(GO:1901844) |
0.5 | 1.6 | GO:2000346 | negative regulation of hepatocyte proliferation(GO:2000346) |
0.5 | 1.5 | GO:0071336 | regulation of hair follicle cell proliferation(GO:0071336) |
0.4 | 1.3 | GO:0006741 | NADP biosynthetic process(GO:0006741) |
0.4 | 1.3 | GO:0035526 | retrograde transport, plasma membrane to Golgi(GO:0035526) |
0.4 | 1.2 | GO:0048388 | endosomal lumen acidification(GO:0048388) |
0.4 | 1.9 | GO:0046501 | protoporphyrinogen IX metabolic process(GO:0046501) |
0.4 | 1.8 | GO:0050812 | regulation of acyl-CoA biosynthetic process(GO:0050812) |
0.4 | 1.1 | GO:0051599 | response to hydrostatic pressure(GO:0051599) |
0.3 | 0.3 | GO:1904502 | regulation of lipophagy(GO:1904502) positive regulation of lipophagy(GO:1904504) |
0.3 | 0.9 | GO:0038028 | insulin receptor signaling pathway via phosphatidylinositol 3-kinase(GO:0038028) |
0.3 | 0.3 | GO:0055069 | zinc ion homeostasis(GO:0055069) |
0.3 | 0.9 | GO:0015959 | diadenosine polyphosphate metabolic process(GO:0015959) |
0.3 | 4.9 | GO:0006783 | heme biosynthetic process(GO:0006783) |
0.3 | 1.2 | GO:0009838 | abscission(GO:0009838) |
0.3 | 1.5 | GO:0006779 | porphyrin-containing compound biosynthetic process(GO:0006779) tetrapyrrole biosynthetic process(GO:0033014) |
0.3 | 0.9 | GO:0043382 | positive regulation of memory T cell differentiation(GO:0043382) |
0.3 | 1.2 | GO:0007023 | post-chaperonin tubulin folding pathway(GO:0007023) |
0.3 | 1.3 | GO:0000019 | regulation of mitotic recombination(GO:0000019) |
0.3 | 0.8 | GO:1900748 | positive regulation of vascular endothelial growth factor signaling pathway(GO:1900748) |
0.3 | 0.8 | GO:0006393 | termination of mitochondrial transcription(GO:0006393) |
0.3 | 0.3 | GO:1903598 | positive regulation of gap junction assembly(GO:1903598) |
0.3 | 1.0 | GO:0070837 | dehydroascorbic acid transport(GO:0070837) |
0.3 | 1.8 | GO:0045647 | negative regulation of erythrocyte differentiation(GO:0045647) |
0.3 | 1.3 | GO:0006686 | sphingomyelin biosynthetic process(GO:0006686) |
0.3 | 0.8 | GO:0006481 | C-terminal protein methylation(GO:0006481) |
0.2 | 1.2 | GO:0051987 | positive regulation of attachment of spindle microtubules to kinetochore(GO:0051987) |
0.2 | 1.0 | GO:0097460 | ferrous iron import into cell(GO:0097460) |
0.2 | 0.7 | GO:0034727 | lysosomal microautophagy(GO:0016237) piecemeal microautophagy of nucleus(GO:0034727) late nucleophagy(GO:0044805) |
0.2 | 1.0 | GO:0006987 | activation of signaling protein activity involved in unfolded protein response(GO:0006987) |
0.2 | 0.7 | GO:0007525 | somatic muscle development(GO:0007525) |
0.2 | 0.7 | GO:0090526 | regulation of gluconeogenesis involved in cellular glucose homeostasis(GO:0090526) |
0.2 | 1.2 | GO:0032252 | secretory granule localization(GO:0032252) |
0.2 | 0.7 | GO:0035672 | oligopeptide transmembrane transport(GO:0035672) |
0.2 | 0.5 | GO:0052422 | modulation of catalytic activity in other organism involved in symbiotic interaction(GO:0052203) modulation by host of symbiont catalytic activity(GO:0052422) |
0.2 | 0.9 | GO:0044845 | cell wall mannoprotein biosynthetic process(GO:0000032) mannoprotein metabolic process(GO:0006056) mannoprotein biosynthetic process(GO:0006057) cell wall glycoprotein biosynthetic process(GO:0031506) cell wall biogenesis(GO:0042546) cell wall macromolecule biosynthetic process(GO:0044038) chain elongation of O-linked mannose residue(GO:0044845) cellular component macromolecule biosynthetic process(GO:0070589) |
0.2 | 0.7 | GO:1900169 | regulation of glucocorticoid mediated signaling pathway(GO:1900169) |
0.2 | 0.7 | GO:0035694 | mitochondrial protein catabolic process(GO:0035694) |
0.2 | 0.9 | GO:2000535 | entry of bacterium into host cell(GO:0035635) regulation of entry of bacterium into host cell(GO:2000535) |
0.2 | 1.1 | GO:0009446 | putrescine biosynthetic process(GO:0009446) |
0.2 | 0.7 | GO:0060375 | regulation of mast cell differentiation(GO:0060375) |
0.2 | 1.1 | GO:0010961 | cellular magnesium ion homeostasis(GO:0010961) |
0.2 | 0.9 | GO:0006848 | pyruvate transport(GO:0006848) |
0.2 | 0.7 | GO:0038027 | apolipoprotein A-I-mediated signaling pathway(GO:0038027) |
0.2 | 0.7 | GO:0000087 | mitotic M phase(GO:0000087) |
0.2 | 0.7 | GO:0015014 | heparan sulfate proteoglycan biosynthetic process, polysaccharide chain biosynthetic process(GO:0015014) |
0.2 | 0.4 | GO:0038095 | Fc-epsilon receptor signaling pathway(GO:0038095) |
0.2 | 1.1 | GO:0042699 | follicle-stimulating hormone signaling pathway(GO:0042699) |
0.2 | 0.6 | GO:0015691 | cadmium ion transport(GO:0015691) cadmium ion transmembrane transport(GO:0070574) |
0.2 | 0.6 | GO:0050904 | diapedesis(GO:0050904) |
0.2 | 0.6 | GO:0000350 | generation of catalytic spliceosome for second transesterification step(GO:0000350) |
0.2 | 0.8 | GO:0000707 | meiotic DNA recombinase assembly(GO:0000707) |
0.2 | 0.8 | GO:0010499 | proteasomal ubiquitin-independent protein catabolic process(GO:0010499) |
0.2 | 0.8 | GO:0006659 | phosphatidylserine biosynthetic process(GO:0006659) |
0.2 | 0.6 | GO:0033615 | mitochondrial proton-transporting ATP synthase complex assembly(GO:0033615) |
0.2 | 0.6 | GO:0034421 | post-translational protein acetylation(GO:0034421) |
0.2 | 2.0 | GO:0021785 | branchiomotor neuron axon guidance(GO:0021785) |
0.2 | 0.8 | GO:0032929 | negative regulation of superoxide anion generation(GO:0032929) |
0.2 | 0.8 | GO:0015793 | glycerol transport(GO:0015793) |
0.2 | 0.8 | GO:0046125 | pyrimidine deoxyribonucleoside metabolic process(GO:0046125) |
0.2 | 0.6 | GO:0007571 | age-dependent response to oxidative stress(GO:0001306) age-dependent general metabolic decline(GO:0007571) |
0.2 | 0.8 | GO:0006824 | cobalt ion transport(GO:0006824) |
0.2 | 0.2 | GO:0036258 | multivesicular body organization(GO:0036257) multivesicular body assembly(GO:0036258) |
0.2 | 0.6 | GO:1903898 | negative regulation of PERK-mediated unfolded protein response(GO:1903898) |
0.2 | 0.4 | GO:0003331 | regulation of extracellular matrix constituent secretion(GO:0003330) positive regulation of extracellular matrix constituent secretion(GO:0003331) |
0.2 | 0.6 | GO:0017187 | peptidyl-glutamic acid carboxylation(GO:0017187) |
0.2 | 0.9 | GO:0051096 | positive regulation of helicase activity(GO:0051096) |
0.2 | 0.7 | GO:0008228 | opsonization(GO:0008228) |
0.2 | 0.7 | GO:0046292 | formaldehyde metabolic process(GO:0046292) |
0.2 | 1.8 | GO:0046929 | negative regulation of neurotransmitter secretion(GO:0046929) |
0.2 | 0.5 | GO:0018171 | peptidyl-cysteine oxidation(GO:0018171) |
0.2 | 0.7 | GO:1902410 | mitotic cytokinetic process(GO:1902410) |
0.2 | 0.9 | GO:0072656 | maintenance of protein location in mitochondrion(GO:0072656) |
0.2 | 0.5 | GO:0006435 | threonyl-tRNA aminoacylation(GO:0006435) |
0.2 | 0.5 | GO:0045054 | constitutive secretory pathway(GO:0045054) |
0.2 | 0.9 | GO:0045636 | positive regulation of melanocyte differentiation(GO:0045636) |
0.2 | 0.9 | GO:0002155 | regulation of thyroid hormone mediated signaling pathway(GO:0002155) |
0.2 | 0.5 | GO:0019287 | isopentenyl diphosphate biosynthetic process(GO:0009240) isopentenyl diphosphate biosynthetic process, mevalonate pathway(GO:0019287) |
0.2 | 0.5 | GO:2001271 | negative regulation of cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:2001271) |
0.2 | 0.7 | GO:0043987 | histone H3-S10 phosphorylation(GO:0043987) |
0.2 | 0.5 | GO:1990169 | detoxification of copper ion(GO:0010273) stress response to copper ion(GO:1990169) |
0.2 | 0.7 | GO:0006344 | maintenance of chromatin silencing(GO:0006344) |
0.2 | 0.5 | GO:0018199 | peptidyl-glutamine modification(GO:0018199) |
0.2 | 1.1 | GO:0000012 | single strand break repair(GO:0000012) |
0.2 | 0.2 | GO:0036091 | positive regulation of transcription from RNA polymerase II promoter in response to oxidative stress(GO:0036091) |
0.2 | 0.5 | GO:0046061 | dATP catabolic process(GO:0046061) |
0.2 | 2.9 | GO:0001574 | ganglioside biosynthetic process(GO:0001574) |
0.2 | 0.5 | GO:0021699 | cerebellar cortex maturation(GO:0021699) |
0.2 | 0.5 | GO:0071787 | endoplasmic reticulum tubular network assembly(GO:0071787) |
0.2 | 0.6 | GO:1903966 | monounsaturated fatty acid metabolic process(GO:1903964) monounsaturated fatty acid biosynthetic process(GO:1903966) |
0.2 | 0.5 | GO:0001555 | oocyte growth(GO:0001555) |
0.2 | 0.8 | GO:0050882 | voluntary musculoskeletal movement(GO:0050882) |
0.2 | 0.9 | GO:0015871 | choline transport(GO:0015871) |
0.2 | 0.6 | GO:0070236 | negative regulation of activation-induced cell death of T cells(GO:0070236) |
0.2 | 0.5 | GO:1903690 | negative regulation of wound healing, spreading of epidermal cells(GO:1903690) |
0.2 | 1.1 | GO:0006620 | posttranslational protein targeting to membrane(GO:0006620) |
0.2 | 0.8 | GO:0000972 | transcription-dependent tethering of RNA polymerase II gene DNA at nuclear periphery(GO:0000972) |
0.2 | 0.5 | GO:0036394 | amylase secretion(GO:0036394) |
0.2 | 0.6 | GO:0051031 | tRNA transport(GO:0051031) |
0.2 | 1.5 | GO:0015816 | glycine transport(GO:0015816) |
0.2 | 0.5 | GO:0030997 | regulation of centriole-centriole cohesion(GO:0030997) |
0.2 | 0.3 | GO:0018206 | peptidyl-methionine modification(GO:0018206) |
0.1 | 1.2 | GO:0035970 | peptidyl-threonine dephosphorylation(GO:0035970) |
0.1 | 0.3 | GO:0070782 | phosphatidylserine exposure on apoptotic cell surface(GO:0070782) |
0.1 | 0.9 | GO:0042256 | mature ribosome assembly(GO:0042256) |
0.1 | 0.3 | GO:0060398 | regulation of growth hormone receptor signaling pathway(GO:0060398) |
0.1 | 0.6 | GO:0009211 | pyrimidine deoxyribonucleoside triphosphate metabolic process(GO:0009211) |
0.1 | 1.2 | GO:0042795 | snRNA transcription from RNA polymerase II promoter(GO:0042795) |
0.1 | 0.3 | GO:0071233 | response to leucine(GO:0043201) cellular response to leucine(GO:0071233) |
0.1 | 0.4 | GO:1990414 | replication-born double-strand break repair via sister chromatid exchange(GO:1990414) |
0.1 | 0.4 | GO:0060178 | regulation of exocyst localization(GO:0060178) |
0.1 | 0.3 | GO:0032483 | regulation of Rab protein signal transduction(GO:0032483) |
0.1 | 0.9 | GO:0043562 | cellular response to nitrogen starvation(GO:0006995) cellular response to nitrogen levels(GO:0043562) |
0.1 | 0.4 | GO:0045658 | regulation of neutrophil differentiation(GO:0045658) |
0.1 | 1.1 | GO:0035520 | monoubiquitinated protein deubiquitination(GO:0035520) |
0.1 | 0.4 | GO:0032513 | negative regulation of protein phosphatase type 2B activity(GO:0032513) |
0.1 | 0.7 | GO:0002457 | T cell antigen processing and presentation(GO:0002457) |
0.1 | 0.6 | GO:1905206 | positive regulation of hydrogen peroxide-mediated programmed cell death(GO:1901300) positive regulation of hydrogen peroxide-induced cell death(GO:1905206) |
0.1 | 0.4 | GO:0015772 | disaccharide transport(GO:0015766) sucrose transport(GO:0015770) oligosaccharide transport(GO:0015772) |
0.1 | 1.5 | GO:0051383 | kinetochore organization(GO:0051383) |
0.1 | 0.4 | GO:0061092 | regulation of phospholipid translocation(GO:0061091) positive regulation of phospholipid translocation(GO:0061092) |
0.1 | 0.4 | GO:0051088 | PMA-inducible membrane protein ectodomain proteolysis(GO:0051088) |
0.1 | 0.5 | GO:0051791 | medium-chain fatty acid metabolic process(GO:0051791) |
0.1 | 0.5 | GO:0018317 | protein C-linked glycosylation(GO:0018103) peptidyl-tryptophan modification(GO:0018211) protein C-linked glycosylation via tryptophan(GO:0018317) protein C-linked glycosylation via 2'-alpha-mannosyl-L-tryptophan(GO:0018406) |
0.1 | 0.5 | GO:0007296 | vitellogenesis(GO:0007296) |
0.1 | 0.5 | GO:0001969 | activation of membrane attack complex(GO:0001905) regulation of activation of membrane attack complex(GO:0001969) |
0.1 | 1.1 | GO:0097286 | iron ion import(GO:0097286) |
0.1 | 0.8 | GO:0034242 | negative regulation of syncytium formation by plasma membrane fusion(GO:0034242) |
0.1 | 0.8 | GO:2000781 | positive regulation of double-strand break repair(GO:2000781) |
0.1 | 1.3 | GO:0046835 | carbohydrate phosphorylation(GO:0046835) |
0.1 | 0.4 | GO:0006059 | hexitol metabolic process(GO:0006059) |
0.1 | 0.8 | GO:0051694 | pointed-end actin filament capping(GO:0051694) |
0.1 | 0.3 | GO:1903677 | regulation of cap-independent translational initiation(GO:1903677) positive regulation of cap-independent translational initiation(GO:1903679) regulation of cytoplasmic translational initiation(GO:1904688) positive regulation of cytoplasmic translational initiation(GO:1904690) |
0.1 | 0.9 | GO:1900103 | positive regulation of endoplasmic reticulum unfolded protein response(GO:1900103) |
0.1 | 1.6 | GO:0045116 | protein neddylation(GO:0045116) |
0.1 | 0.6 | GO:0045053 | protein retention in Golgi apparatus(GO:0045053) |
0.1 | 0.1 | GO:0090086 | negative regulation of protein deubiquitination(GO:0090086) |
0.1 | 0.1 | GO:0019065 | receptor-mediated endocytosis of virus by host cell(GO:0019065) endocytosis involved in viral entry into host cell(GO:0075509) |
0.1 | 0.2 | GO:0046208 | spermine catabolic process(GO:0046208) |
0.1 | 0.6 | GO:0006528 | asparagine metabolic process(GO:0006528) |
0.1 | 1.6 | GO:0006828 | manganese ion transport(GO:0006828) |
0.1 | 0.2 | GO:0006658 | phosphatidylserine metabolic process(GO:0006658) |
0.1 | 0.1 | GO:0071335 | hair follicle cell proliferation(GO:0071335) |
0.1 | 0.4 | GO:0035927 | RNA import into mitochondrion(GO:0035927) rRNA import into mitochondrion(GO:0035928) |
0.1 | 0.1 | GO:0010745 | negative regulation of macrophage derived foam cell differentiation(GO:0010745) |
0.1 | 0.8 | GO:2000480 | negative regulation of cAMP-dependent protein kinase activity(GO:2000480) |
0.1 | 1.1 | GO:0030917 | midbrain-hindbrain boundary development(GO:0030917) |
0.1 | 0.6 | GO:1905097 | regulation of guanyl-nucleotide exchange factor activity(GO:1905097) |
0.1 | 0.4 | GO:0003223 | ventricular compact myocardium morphogenesis(GO:0003223) |
0.1 | 0.4 | GO:2000850 | negative regulation of steroid hormone secretion(GO:2000832) negative regulation of corticosteroid hormone secretion(GO:2000847) negative regulation of glucocorticoid secretion(GO:2000850) |
0.1 | 0.2 | GO:0042769 | DNA damage response, detection of DNA damage(GO:0042769) |
0.1 | 0.2 | GO:0036499 | PERK-mediated unfolded protein response(GO:0036499) |
0.1 | 0.7 | GO:0060753 | regulation of mast cell chemotaxis(GO:0060753) |
0.1 | 0.5 | GO:0051295 | establishment of meiotic spindle localization(GO:0051295) |
0.1 | 0.7 | GO:1900113 | negative regulation of histone H3-K9 trimethylation(GO:1900113) |
0.1 | 0.2 | GO:0032907 | transforming growth factor beta3 production(GO:0032907) regulation of transforming growth factor beta3 production(GO:0032910) |
0.1 | 0.3 | GO:0090365 | regulation of mRNA modification(GO:0090365) |
0.1 | 0.9 | GO:0033601 | positive regulation of mammary gland epithelial cell proliferation(GO:0033601) |
0.1 | 0.2 | GO:1904417 | regulation of xenophagy(GO:1904415) positive regulation of xenophagy(GO:1904417) |
0.1 | 0.2 | GO:0048382 | mesendoderm development(GO:0048382) |
0.1 | 0.9 | GO:0046642 | negative regulation of alpha-beta T cell proliferation(GO:0046642) |
0.1 | 0.1 | GO:1902473 | regulation of protein localization to synapse(GO:1902473) |
0.1 | 0.5 | GO:0009092 | homoserine metabolic process(GO:0009092) transsulfuration(GO:0019346) |
0.1 | 0.6 | GO:0006501 | C-terminal protein lipidation(GO:0006501) |
0.1 | 0.2 | GO:0009202 | deoxyribonucleoside triphosphate biosynthetic process(GO:0009202) |
0.1 | 0.3 | GO:0070682 | proteasome regulatory particle assembly(GO:0070682) |
0.1 | 0.2 | GO:0036112 | medium-chain fatty-acyl-CoA metabolic process(GO:0036112) |
0.1 | 0.3 | GO:0061511 | centriole elongation(GO:0061511) |
0.1 | 0.1 | GO:1902237 | positive regulation of endoplasmic reticulum stress-induced intrinsic apoptotic signaling pathway(GO:1902237) |
0.1 | 0.2 | GO:0002309 | T cell proliferation involved in immune response(GO:0002309) |
0.1 | 0.9 | GO:0035751 | regulation of lysosomal lumen pH(GO:0035751) |
0.1 | 0.4 | GO:0000480 | endonucleolytic cleavage in 5'-ETS of tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000480) |
0.1 | 0.2 | GO:0045448 | regulation of mitotic cell cycle, embryonic(GO:0009794) mitotic cell cycle, embryonic(GO:0045448) |
0.1 | 0.2 | GO:1903751 | regulation of intrinsic apoptotic signaling pathway in response to hydrogen peroxide(GO:1903750) negative regulation of intrinsic apoptotic signaling pathway in response to hydrogen peroxide(GO:1903751) |
0.1 | 0.1 | GO:0052055 | modulation by symbiont of host molecular function(GO:0052055) |
0.1 | 0.8 | GO:1902902 | negative regulation of autophagosome assembly(GO:1902902) |
0.1 | 0.3 | GO:2001180 | negative regulation of interleukin-10 secretion(GO:2001180) |
0.1 | 0.4 | GO:1902261 | positive regulation of delayed rectifier potassium channel activity(GO:1902261) positive regulation of voltage-gated potassium channel activity(GO:1903818) |
0.1 | 0.3 | GO:0060164 | regulation of timing of neuron differentiation(GO:0060164) |
0.1 | 0.3 | GO:0035935 | androgen secretion(GO:0035935) regulation of androgen secretion(GO:2000834) positive regulation of androgen secretion(GO:2000836) |
0.1 | 0.2 | GO:0000957 | mitochondrial RNA catabolic process(GO:0000957) regulation of mitochondrial RNA catabolic process(GO:0000960) |
0.1 | 0.2 | GO:0060397 | JAK-STAT cascade involved in growth hormone signaling pathway(GO:0060397) |
0.1 | 0.4 | GO:0090188 | negative regulation of pancreatic juice secretion(GO:0090188) |
0.1 | 0.1 | GO:0009301 | snRNA transcription(GO:0009301) |
0.1 | 0.3 | GO:0001907 | killing by symbiont of host cells(GO:0001907) disruption by symbiont of host cell(GO:0044004) |
0.1 | 0.6 | GO:0051151 | negative regulation of smooth muscle cell differentiation(GO:0051151) |
0.1 | 0.1 | GO:0042908 | xenobiotic transport(GO:0042908) |
0.1 | 0.3 | GO:0031087 | nuclear-transcribed mRNA catabolic process, deadenylation-independent decay(GO:0031086) deadenylation-independent decapping of nuclear-transcribed mRNA(GO:0031087) |
0.1 | 1.2 | GO:0000083 | regulation of transcription involved in G1/S transition of mitotic cell cycle(GO:0000083) |
0.1 | 0.1 | GO:0097067 | cellular response to thyroid hormone stimulus(GO:0097067) |
0.1 | 0.2 | GO:0006391 | transcription initiation from mitochondrial promoter(GO:0006391) |
0.1 | 0.8 | GO:0048671 | negative regulation of collateral sprouting(GO:0048671) |
0.1 | 0.3 | GO:0052490 | negative regulation by symbiont of host apoptotic process(GO:0033668) negative regulation by symbiont of host programmed cell death(GO:0052041) negative regulation by organism of programmed cell death in other organism involved in symbiotic interaction(GO:0052490) |
0.1 | 2.2 | GO:0034198 | cellular response to amino acid starvation(GO:0034198) |
0.1 | 0.6 | GO:0050862 | positive regulation of T cell receptor signaling pathway(GO:0050862) |
0.1 | 0.5 | GO:0032020 | ISG15-protein conjugation(GO:0032020) |
0.1 | 0.4 | GO:0010457 | centriole-centriole cohesion(GO:0010457) |
0.1 | 0.9 | GO:0043922 | negative regulation by host of viral transcription(GO:0043922) |
0.1 | 0.3 | GO:0030951 | establishment or maintenance of microtubule cytoskeleton polarity(GO:0030951) |
0.1 | 0.4 | GO:0002291 | T cell activation via T cell receptor contact with antigen bound to MHC molecule on antigen presenting cell(GO:0002291) |
0.1 | 0.3 | GO:0032289 | central nervous system myelin formation(GO:0032289) |
0.1 | 0.3 | GO:0060266 | negative regulation of respiratory burst involved in inflammatory response(GO:0060266) |
0.1 | 0.8 | GO:0010388 | cullin deneddylation(GO:0010388) |
0.1 | 0.2 | GO:0006610 | ribosomal protein import into nucleus(GO:0006610) |
0.1 | 0.6 | GO:0040016 | embryonic cleavage(GO:0040016) |
0.1 | 1.2 | GO:0045898 | regulation of RNA polymerase II transcriptional preinitiation complex assembly(GO:0045898) |
0.1 | 0.2 | GO:0045196 | establishment or maintenance of neuroblast polarity(GO:0045196) establishment of neuroblast polarity(GO:0045200) |
0.1 | 0.4 | GO:0060368 | regulation of Fc receptor mediated stimulatory signaling pathway(GO:0060368) |
0.1 | 0.3 | GO:0006046 | N-acetylglucosamine catabolic process(GO:0006046) |
0.1 | 0.3 | GO:0002525 | acute inflammatory response to non-antigenic stimulus(GO:0002525) |
0.1 | 0.5 | GO:1900127 | positive regulation of hyaluronan biosynthetic process(GO:1900127) |
0.1 | 0.3 | GO:0051388 | positive regulation of neurotrophin TRK receptor signaling pathway(GO:0051388) |
0.1 | 1.7 | GO:0072662 | protein targeting to peroxisome(GO:0006625) peroxisomal transport(GO:0043574) protein localization to peroxisome(GO:0072662) establishment of protein localization to peroxisome(GO:0072663) |
0.1 | 0.3 | GO:1902965 | protein localization to early endosome(GO:1902946) regulation of protein localization to early endosome(GO:1902965) positive regulation of protein localization to early endosome(GO:1902966) |
0.1 | 0.3 | GO:2001170 | negative regulation of ATP biosynthetic process(GO:2001170) |
0.1 | 0.6 | GO:0048227 | plasma membrane to endosome transport(GO:0048227) |
0.1 | 0.4 | GO:0015705 | iodide transport(GO:0015705) |
0.1 | 0.3 | GO:1900126 | negative regulation of hyaluronan biosynthetic process(GO:1900126) |
0.1 | 0.4 | GO:0001887 | selenium compound metabolic process(GO:0001887) |
0.1 | 0.8 | GO:0046085 | adenosine metabolic process(GO:0046085) |
0.1 | 0.1 | GO:0000059 | protein import into nucleus, docking(GO:0000059) |
0.1 | 0.5 | GO:0009186 | deoxyribonucleoside diphosphate metabolic process(GO:0009186) |
0.1 | 0.1 | GO:0051105 | regulation of DNA ligation(GO:0051105) positive regulation of DNA ligation(GO:0051106) |
0.1 | 0.6 | GO:0017196 | N-terminal peptidyl-methionine acetylation(GO:0017196) |
0.1 | 0.6 | GO:0060708 | spongiotrophoblast differentiation(GO:0060708) |
0.1 | 0.9 | GO:0035873 | lactate transport(GO:0015727) lactate transmembrane transport(GO:0035873) plasma membrane lactate transport(GO:0035879) |
0.1 | 0.4 | GO:0044829 | positive regulation by host of viral genome replication(GO:0044829) |
0.1 | 0.3 | GO:0043490 | malate-aspartate shuttle(GO:0043490) |
0.1 | 0.5 | GO:0015825 | L-serine transport(GO:0015825) |
0.1 | 0.4 | GO:0072383 | plus-end-directed vesicle transport along microtubule(GO:0072383) plus-end-directed organelle transport along microtubule(GO:0072386) |
0.1 | 0.3 | GO:0036066 | protein O-linked fucosylation(GO:0036066) |
0.1 | 0.1 | GO:0006808 | regulation of nitrogen utilization(GO:0006808) |
0.1 | 2.0 | GO:0006376 | mRNA splice site selection(GO:0006376) |
0.1 | 0.4 | GO:0018158 | protein oxidation(GO:0018158) |
0.1 | 0.4 | GO:0086045 | membrane depolarization during AV node cell action potential(GO:0086045) |
0.1 | 0.1 | GO:2001270 | regulation of cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:2001270) |
0.1 | 0.5 | GO:0051574 | positive regulation of histone H3-K9 methylation(GO:0051574) |
0.1 | 0.1 | GO:0045914 | negative regulation of catecholamine metabolic process(GO:0045914) negative regulation of dopamine metabolic process(GO:0045963) |
0.1 | 0.4 | GO:0098535 | de novo centriole assembly(GO:0098535) |
0.1 | 0.1 | GO:0090344 | negative regulation of cell aging(GO:0090344) |
0.1 | 1.2 | GO:0060294 | cilium movement involved in cell motility(GO:0060294) |
0.1 | 0.4 | GO:0044789 | modulation by host of viral release from host cell(GO:0044789) positive regulation by host of viral release from host cell(GO:0044791) |
0.1 | 0.4 | GO:1903608 | protein localization to cytoplasmic stress granule(GO:1903608) |
0.1 | 0.3 | GO:0072553 | terminal button organization(GO:0072553) |
0.1 | 0.3 | GO:1903279 | regulation of calcium:sodium antiporter activity(GO:1903279) |
0.1 | 0.2 | GO:0032066 | nucleolus to nucleoplasm transport(GO:0032066) |
0.1 | 0.5 | GO:0051013 | microtubule severing(GO:0051013) |
0.1 | 0.4 | GO:0010994 | regulation of ubiquitin homeostasis(GO:0010993) free ubiquitin chain polymerization(GO:0010994) |
0.1 | 0.4 | GO:2000015 | regulation of determination of dorsal identity(GO:2000015) |
0.1 | 0.2 | GO:1901030 | positive regulation of mitochondrial outer membrane permeabilization involved in apoptotic signaling pathway(GO:1901030) |
0.1 | 0.4 | GO:0098789 | pre-mRNA cleavage required for polyadenylation(GO:0098789) |
0.1 | 0.4 | GO:2000189 | positive regulation of cholesterol homeostasis(GO:2000189) |
0.1 | 0.4 | GO:2000271 | positive regulation of fibroblast apoptotic process(GO:2000271) |
0.1 | 0.3 | GO:0007039 | protein catabolic process in the vacuole(GO:0007039) |
0.1 | 0.4 | GO:0006573 | valine metabolic process(GO:0006573) |
0.1 | 0.3 | GO:0090315 | negative regulation of protein targeting to membrane(GO:0090315) |
0.1 | 0.3 | GO:0006369 | termination of RNA polymerase II transcription(GO:0006369) |
0.1 | 0.3 | GO:0045578 | negative regulation of B cell differentiation(GO:0045578) |
0.1 | 0.2 | GO:0048207 | vesicle targeting, rough ER to cis-Golgi(GO:0048207) COPII vesicle coating(GO:0048208) |
0.1 | 0.1 | GO:0040038 | polar body extrusion after meiotic divisions(GO:0040038) |
0.1 | 0.3 | GO:0006978 | DNA damage response, signal transduction by p53 class mediator resulting in transcription of p21 class mediator(GO:0006978) |
0.1 | 0.5 | GO:0071459 | protein localization to kinetochore(GO:0034501) protein localization to chromosome, centromeric region(GO:0071459) |
0.1 | 0.1 | GO:1990705 | cholangiocyte proliferation(GO:1990705) |
0.1 | 0.7 | GO:0070493 | thrombin receptor signaling pathway(GO:0070493) |
0.1 | 0.8 | GO:2000001 | regulation of DNA damage checkpoint(GO:2000001) |
0.1 | 0.3 | GO:0070827 | chromatin maintenance(GO:0070827) |
0.1 | 0.1 | GO:0043096 | purine nucleobase salvage(GO:0043096) |
0.1 | 0.2 | GO:0031627 | telomeric loop formation(GO:0031627) |
0.1 | 0.8 | GO:2000637 | positive regulation of gene silencing by miRNA(GO:2000637) |
0.1 | 0.1 | GO:0097066 | response to thyroid hormone(GO:0097066) |
0.1 | 0.3 | GO:0010606 | positive regulation of cytoplasmic mRNA processing body assembly(GO:0010606) |
0.1 | 0.4 | GO:0047484 | regulation of response to osmotic stress(GO:0047484) |
0.1 | 0.1 | GO:0009263 | deoxyribonucleotide biosynthetic process(GO:0009263) |
0.1 | 0.1 | GO:0061738 | late endosomal microautophagy(GO:0061738) |
0.1 | 0.5 | GO:0015911 | plasma membrane long-chain fatty acid transport(GO:0015911) fatty acid transmembrane transport(GO:1902001) |
0.1 | 0.3 | GO:0071651 | positive regulation of chemokine (C-C motif) ligand 5 production(GO:0071651) |
0.1 | 0.4 | GO:1901977 | negative regulation of cell cycle checkpoint(GO:1901977) |
0.1 | 0.1 | GO:0014732 | skeletal muscle atrophy(GO:0014732) |
0.1 | 1.1 | GO:0031297 | replication fork processing(GO:0031297) |
0.1 | 0.2 | GO:2000111 | positive regulation of macrophage apoptotic process(GO:2000111) |
0.1 | 0.2 | GO:0002431 | Fc receptor mediated stimulatory signaling pathway(GO:0002431) |
0.1 | 0.5 | GO:0060136 | embryonic process involved in female pregnancy(GO:0060136) |
0.1 | 0.2 | GO:0043321 | regulation of natural killer cell degranulation(GO:0043321) |
0.1 | 0.8 | GO:0008608 | attachment of spindle microtubules to kinetochore(GO:0008608) |
0.1 | 0.2 | GO:0031659 | positive regulation of cyclin-dependent protein serine/threonine kinase activity involved in G1/S transition of mitotic cell cycle(GO:0031659) |
0.1 | 0.1 | GO:0010728 | regulation of hydrogen peroxide biosynthetic process(GO:0010728) |
0.1 | 0.3 | GO:1903553 | positive regulation of extracellular exosome assembly(GO:1903553) |
0.1 | 0.3 | GO:0034627 | 'de novo' NAD biosynthetic process(GO:0034627) |
0.1 | 0.6 | GO:0060158 | phospholipase C-activating dopamine receptor signaling pathway(GO:0060158) |
0.1 | 0.1 | GO:0043379 | memory T cell differentiation(GO:0043379) |
0.1 | 1.3 | GO:0042149 | cellular response to glucose starvation(GO:0042149) |
0.1 | 0.4 | GO:0009052 | pentose-phosphate shunt, non-oxidative branch(GO:0009052) |
0.1 | 0.9 | GO:0060211 | regulation of nuclear-transcribed mRNA poly(A) tail shortening(GO:0060211) positive regulation of nuclear-transcribed mRNA poly(A) tail shortening(GO:0060213) |
0.1 | 0.2 | GO:0032261 | purine nucleotide salvage(GO:0032261) IMP salvage(GO:0032264) |
0.1 | 0.2 | GO:0007004 | RNA-dependent DNA biosynthetic process(GO:0006278) telomere maintenance via telomerase(GO:0007004) |
0.1 | 0.6 | GO:0045292 | mRNA cis splicing, via spliceosome(GO:0045292) |
0.1 | 0.6 | GO:0030644 | cellular chloride ion homeostasis(GO:0030644) |
0.1 | 0.2 | GO:0034720 | histone H3-K4 demethylation(GO:0034720) |
0.1 | 0.9 | GO:0008340 | determination of adult lifespan(GO:0008340) |
0.1 | 0.4 | GO:0032876 | negative regulation of DNA endoreduplication(GO:0032876) |
0.1 | 0.4 | GO:0010815 | bradykinin catabolic process(GO:0010815) |
0.1 | 0.5 | GO:0015074 | DNA integration(GO:0015074) |
0.1 | 0.1 | GO:0006041 | glucosamine metabolic process(GO:0006041) |
0.1 | 0.4 | GO:0032328 | alanine transport(GO:0032328) |
0.1 | 0.2 | GO:0071921 | establishment of sister chromatid cohesion(GO:0034085) cohesin loading(GO:0071921) regulation of cohesin loading(GO:0071922) |
0.1 | 0.3 | GO:0036124 | histone H3-K9 trimethylation(GO:0036124) |
0.1 | 0.4 | GO:0070475 | rRNA base methylation(GO:0070475) |
0.1 | 0.1 | GO:0090241 | negative regulation of histone H4 acetylation(GO:0090241) |
0.1 | 1.3 | GO:0071108 | protein K48-linked deubiquitination(GO:0071108) |
0.1 | 0.1 | GO:2001032 | regulation of double-strand break repair via nonhomologous end joining(GO:2001032) |
0.1 | 0.2 | GO:0006578 | amino-acid betaine biosynthetic process(GO:0006578) |
0.1 | 0.1 | GO:0007354 | zygotic determination of anterior/posterior axis, embryo(GO:0007354) |
0.1 | 0.2 | GO:0009173 | UMP biosynthetic process(GO:0006222) pyrimidine ribonucleoside monophosphate metabolic process(GO:0009173) pyrimidine ribonucleoside monophosphate biosynthetic process(GO:0009174) UMP metabolic process(GO:0046049) |
0.1 | 0.2 | GO:1902947 | regulation of tau-protein kinase activity(GO:1902947) |
0.1 | 0.5 | GO:0060770 | negative regulation of epithelial cell proliferation involved in prostate gland development(GO:0060770) |
0.1 | 0.4 | GO:0085020 | protein K6-linked ubiquitination(GO:0085020) |
0.1 | 0.4 | GO:0016255 | attachment of GPI anchor to protein(GO:0016255) |
0.1 | 0.2 | GO:1901896 | positive regulation of calcium-transporting ATPase activity(GO:1901896) |
0.1 | 0.2 | GO:0034196 | acylglycerol transport(GO:0034196) triglyceride transport(GO:0034197) |
0.1 | 0.5 | GO:0090084 | negative regulation of inclusion body assembly(GO:0090084) |
0.1 | 0.5 | GO:2000096 | positive regulation of Wnt signaling pathway, planar cell polarity pathway(GO:2000096) |
0.1 | 1.1 | GO:0030488 | tRNA methylation(GO:0030488) |
0.1 | 0.4 | GO:0072393 | microtubule anchoring at microtubule organizing center(GO:0072393) |
0.1 | 0.5 | GO:0043983 | histone H4-K12 acetylation(GO:0043983) |
0.1 | 0.2 | GO:0046600 | negative regulation of centriole replication(GO:0046600) |
0.1 | 0.2 | GO:0036151 | phosphatidylcholine acyl-chain remodeling(GO:0036151) |
0.1 | 0.2 | GO:0019230 | proprioception(GO:0019230) |
0.1 | 0.4 | GO:1902033 | regulation of hematopoietic stem cell proliferation(GO:1902033) positive regulation of hematopoietic stem cell proliferation(GO:1902035) |
0.1 | 0.7 | GO:0006527 | arginine catabolic process(GO:0006527) |
0.1 | 0.4 | GO:0022417 | protein maturation by protein folding(GO:0022417) |
0.1 | 0.5 | GO:0032782 | bile acid secretion(GO:0032782) |
0.1 | 0.1 | GO:0036015 | response to interleukin-3(GO:0036015) cellular response to interleukin-3(GO:0036016) |
0.1 | 0.1 | GO:0048807 | female genitalia morphogenesis(GO:0048807) |
0.1 | 0.4 | GO:0046040 | IMP metabolic process(GO:0046040) |
0.1 | 0.1 | GO:0006361 | transcription initiation from RNA polymerase I promoter(GO:0006361) |
0.1 | 0.1 | GO:0034184 | positive regulation of maintenance of sister chromatid cohesion(GO:0034093) positive regulation of maintenance of mitotic sister chromatid cohesion(GO:0034184) |
0.1 | 0.7 | GO:0006851 | mitochondrial calcium ion transport(GO:0006851) |
0.1 | 0.7 | GO:0042168 | heme metabolic process(GO:0042168) |
0.1 | 0.2 | GO:0021764 | amygdala development(GO:0021764) |
0.1 | 0.6 | GO:0042136 | neurotransmitter biosynthetic process(GO:0042136) |
0.1 | 0.2 | GO:1902065 | response to L-glutamate(GO:1902065) |
0.1 | 0.1 | GO:0090435 | protein localization to nuclear envelope(GO:0090435) |
0.1 | 0.2 | GO:0009158 | purine nucleoside monophosphate catabolic process(GO:0009128) ribonucleoside monophosphate catabolic process(GO:0009158) purine ribonucleoside monophosphate catabolic process(GO:0009169) |
0.1 | 3.3 | GO:0045454 | cell redox homeostasis(GO:0045454) |
0.1 | 0.1 | GO:2000409 | positive regulation of T cell extravasation(GO:2000409) |
0.1 | 0.1 | GO:0045875 | negative regulation of sister chromatid cohesion(GO:0045875) |
0.1 | 0.3 | GO:0007000 | nucleolus organization(GO:0007000) |
0.1 | 0.8 | GO:1903427 | negative regulation of reactive oxygen species biosynthetic process(GO:1903427) |
0.1 | 0.5 | GO:1904251 | regulation of bile acid metabolic process(GO:1904251) |
0.1 | 0.1 | GO:0009113 | purine nucleobase biosynthetic process(GO:0009113) |
0.1 | 0.1 | GO:0050942 | positive regulation of pigment cell differentiation(GO:0050942) |
0.1 | 0.1 | GO:0061356 | Wnt protein secretion(GO:0061355) regulation of Wnt protein secretion(GO:0061356) |
0.1 | 0.3 | GO:1901029 | negative regulation of mitochondrial outer membrane permeabilization involved in apoptotic signaling pathway(GO:1901029) |
0.1 | 0.8 | GO:0042754 | negative regulation of circadian rhythm(GO:0042754) |
0.1 | 0.4 | GO:0061732 | mitochondrial acetyl-CoA biosynthetic process from pyruvate(GO:0061732) |
0.1 | 1.1 | GO:0006607 | NLS-bearing protein import into nucleus(GO:0006607) |
0.1 | 0.3 | GO:0000042 | protein targeting to Golgi(GO:0000042) |
0.1 | 0.2 | GO:0045743 | positive regulation of fibroblast growth factor receptor signaling pathway(GO:0045743) |
0.1 | 0.1 | GO:0015677 | copper ion import(GO:0015677) |
0.1 | 0.1 | GO:0072718 | response to cisplatin(GO:0072718) |
0.1 | 0.3 | GO:0006903 | vesicle targeting(GO:0006903) |
0.1 | 0.1 | GO:0006166 | purine ribonucleoside salvage(GO:0006166) |
0.1 | 0.3 | GO:0060696 | regulation of phospholipid catabolic process(GO:0060696) |
0.1 | 0.3 | GO:0042364 | water-soluble vitamin biosynthetic process(GO:0042364) |
0.1 | 0.1 | GO:1904263 | positive regulation of TORC1 signaling(GO:1904263) |
0.1 | 0.2 | GO:0021943 | formation of radial glial scaffolds(GO:0021943) |
0.1 | 0.1 | GO:0002071 | glandular epithelial cell maturation(GO:0002071) |
0.1 | 0.2 | GO:2000483 | negative regulation of interleukin-8 secretion(GO:2000483) |
0.1 | 0.5 | GO:1902254 | negative regulation of intrinsic apoptotic signaling pathway by p53 class mediator(GO:1902254) |
0.1 | 0.3 | GO:0009438 | methylglyoxal metabolic process(GO:0009438) |
0.1 | 0.5 | GO:0006488 | dolichol-linked oligosaccharide biosynthetic process(GO:0006488) |
0.1 | 0.1 | GO:0070358 | actin polymerization-dependent cell motility(GO:0070358) |
0.1 | 0.3 | GO:0072675 | osteoclast fusion(GO:0072675) |
0.1 | 0.1 | GO:0007182 | common-partner SMAD protein phosphorylation(GO:0007182) |
0.1 | 0.1 | GO:0007529 | establishment of synaptic specificity at neuromuscular junction(GO:0007529) |
0.1 | 0.5 | GO:0031639 | plasminogen activation(GO:0031639) |
0.1 | 0.2 | GO:0010637 | negative regulation of mitochondrial fusion(GO:0010637) |
0.1 | 0.3 | GO:0009249 | protein lipoylation(GO:0009249) |
0.1 | 0.2 | GO:0070836 | caveola assembly(GO:0070836) |
0.1 | 0.3 | GO:0034312 | diol biosynthetic process(GO:0034312) sphingosine biosynthetic process(GO:0046512) |
0.1 | 0.1 | GO:1902075 | cellular response to salt(GO:1902075) |
0.1 | 0.2 | GO:0008594 | photoreceptor cell morphogenesis(GO:0008594) |
0.1 | 0.3 | GO:0045908 | negative regulation of vasodilation(GO:0045908) |
0.1 | 0.1 | GO:1902514 | regulation of calcium ion transmembrane transport via high voltage-gated calcium channel(GO:1902514) |
0.1 | 0.1 | GO:0048254 | snoRNA localization(GO:0048254) |
0.1 | 0.1 | GO:0048194 | Golgi vesicle budding(GO:0048194) |
0.1 | 0.3 | GO:0042780 | tRNA 3'-end processing(GO:0042780) |
0.1 | 0.5 | GO:0060056 | mammary gland involution(GO:0060056) |
0.1 | 0.6 | GO:0052646 | alditol phosphate metabolic process(GO:0052646) |
0.1 | 0.2 | GO:0032960 | regulation of inositol trisphosphate biosynthetic process(GO:0032960) |
0.1 | 0.6 | GO:1904293 | negative regulation of ERAD pathway(GO:1904293) |
0.1 | 0.3 | GO:0061051 | positive regulation of cell growth involved in cardiac muscle cell development(GO:0061051) |
0.1 | 0.3 | GO:0002551 | mast cell chemotaxis(GO:0002551) |
0.1 | 0.1 | GO:1901874 | regulation of post-translational protein modification(GO:1901873) negative regulation of post-translational protein modification(GO:1901874) |
0.1 | 0.1 | GO:0045347 | negative regulation of MHC class II biosynthetic process(GO:0045347) |
0.1 | 0.3 | GO:1903715 | regulation of aerobic respiration(GO:1903715) |
0.1 | 2.3 | GO:0030195 | negative regulation of blood coagulation(GO:0030195) negative regulation of hemostasis(GO:1900047) |
0.1 | 0.1 | GO:0032290 | peripheral nervous system myelin formation(GO:0032290) |
0.1 | 0.1 | GO:0060623 | regulation of chromosome condensation(GO:0060623) |
0.1 | 0.5 | GO:0002227 | innate immune response in mucosa(GO:0002227) |
0.1 | 1.0 | GO:0032012 | ARF protein signal transduction(GO:0032011) regulation of ARF protein signal transduction(GO:0032012) |
0.1 | 0.3 | GO:0051533 | positive regulation of NFAT protein import into nucleus(GO:0051533) |
0.1 | 0.3 | GO:0070345 | negative regulation of fat cell proliferation(GO:0070345) |
0.1 | 0.1 | GO:0010042 | response to manganese ion(GO:0010042) |
0.1 | 0.1 | GO:2000645 | negative regulation of receptor catabolic process(GO:2000645) |
0.1 | 0.3 | GO:0045721 | negative regulation of gluconeogenesis(GO:0045721) |
0.1 | 0.4 | GO:0035384 | thioester biosynthetic process(GO:0035384) acyl-CoA biosynthetic process(GO:0071616) |
0.1 | 0.4 | GO:0031274 | positive regulation of pseudopodium assembly(GO:0031274) |
0.1 | 0.1 | GO:0071462 | cellular response to water stimulus(GO:0071462) |
0.1 | 0.1 | GO:0060468 | prevention of polyspermy(GO:0060468) |
0.1 | 0.2 | GO:0097167 | circadian regulation of translation(GO:0097167) |
0.1 | 0.1 | GO:0010572 | positive regulation of platelet activation(GO:0010572) |
0.1 | 0.3 | GO:2000773 | negative regulation of cellular senescence(GO:2000773) |
0.1 | 0.8 | GO:0051770 | positive regulation of nitric-oxide synthase biosynthetic process(GO:0051770) |
0.1 | 0.2 | GO:0035513 | oxidative RNA demethylation(GO:0035513) oxidative single-stranded RNA demethylation(GO:0035553) |
0.1 | 0.9 | GO:0032008 | positive regulation of TOR signaling(GO:0032008) |
0.1 | 0.1 | GO:0034372 | very-low-density lipoprotein particle remodeling(GO:0034372) |
0.1 | 0.2 | GO:0070427 | nucleotide-binding oligomerization domain containing 1 signaling pathway(GO:0070427) |
0.1 | 0.3 | GO:1902916 | positive regulation of protein polyubiquitination(GO:1902916) |
0.1 | 0.2 | GO:0001732 | formation of cytoplasmic translation initiation complex(GO:0001732) |
0.1 | 0.4 | GO:0071786 | endoplasmic reticulum tubular network organization(GO:0071786) |
0.1 | 0.2 | GO:0006362 | transcription elongation from RNA polymerase I promoter(GO:0006362) |
0.1 | 0.4 | GO:0032790 | ribosome disassembly(GO:0032790) |
0.1 | 0.3 | GO:0097011 | cellular response to granulocyte macrophage colony-stimulating factor stimulus(GO:0097011) response to granulocyte macrophage colony-stimulating factor(GO:0097012) |
0.1 | 0.2 | GO:0071447 | cellular response to hydroperoxide(GO:0071447) |
0.1 | 0.1 | GO:1903208 | neuron death in response to hydrogen peroxide(GO:0036476) regulation of hydrogen peroxide-induced neuron death(GO:1903207) negative regulation of hydrogen peroxide-induced neuron death(GO:1903208) |
0.1 | 0.2 | GO:0061668 | mitochondrial ribosome assembly(GO:0061668) |
0.1 | 0.2 | GO:0003383 | apical constriction(GO:0003383) |
0.1 | 0.2 | GO:0008635 | activation of cysteine-type endopeptidase activity involved in apoptotic process by cytochrome c(GO:0008635) |
0.1 | 0.8 | GO:0000154 | rRNA modification(GO:0000154) |
0.1 | 0.2 | GO:2001225 | regulation of chloride transport(GO:2001225) |
0.1 | 1.1 | GO:0033119 | negative regulation of RNA splicing(GO:0033119) |
0.1 | 0.4 | GO:0070922 | small RNA loading onto RISC(GO:0070922) |
0.1 | 0.2 | GO:0023021 | termination of signal transduction(GO:0023021) |
0.1 | 0.4 | GO:0009452 | 7-methylguanosine RNA capping(GO:0009452) RNA capping(GO:0036260) |
0.1 | 0.1 | GO:0009129 | pyrimidine nucleoside monophosphate metabolic process(GO:0009129) |
0.1 | 0.2 | GO:0070126 | mitochondrial translational termination(GO:0070126) |
0.1 | 0.1 | GO:0006449 | regulation of translational termination(GO:0006449) |
0.1 | 0.8 | GO:0099517 | anterograde synaptic vesicle transport(GO:0048490) synaptic vesicle cytoskeletal transport(GO:0099514) synaptic vesicle transport along microtubule(GO:0099517) |
0.1 | 0.3 | GO:0034141 | positive regulation of toll-like receptor 3 signaling pathway(GO:0034141) |
0.1 | 0.2 | GO:0070681 | glutaminyl-tRNAGln biosynthesis via transamidation(GO:0070681) |
0.1 | 0.3 | GO:0043951 | negative regulation of cAMP-mediated signaling(GO:0043951) |
0.1 | 0.1 | GO:0006551 | leucine metabolic process(GO:0006551) |
0.1 | 0.6 | GO:0015693 | magnesium ion transport(GO:0015693) |
0.1 | 0.2 | GO:0001302 | replicative cell aging(GO:0001302) |
0.1 | 0.3 | GO:1990440 | positive regulation of transcription from RNA polymerase II promoter in response to endoplasmic reticulum stress(GO:1990440) |
0.1 | 0.1 | GO:0015803 | branched-chain amino acid transport(GO:0015803) leucine transport(GO:0015820) |
0.1 | 0.3 | GO:2000051 | negative regulation of non-canonical Wnt signaling pathway(GO:2000051) |
0.1 | 0.1 | GO:0006543 | glutamine catabolic process(GO:0006543) |
0.1 | 0.1 | GO:0002036 | regulation of L-glutamate transport(GO:0002036) |
0.1 | 0.8 | GO:1902187 | negative regulation of viral release from host cell(GO:1902187) |
0.1 | 0.6 | GO:0019370 | leukotriene biosynthetic process(GO:0019370) |
0.1 | 0.2 | GO:0006177 | GMP biosynthetic process(GO:0006177) |
0.1 | 0.1 | GO:0042524 | negative regulation of tyrosine phosphorylation of Stat5 protein(GO:0042524) |
0.1 | 0.1 | GO:0032075 | positive regulation of nuclease activity(GO:0032075) |
0.1 | 0.2 | GO:0033632 | regulation of cell-cell adhesion mediated by integrin(GO:0033632) |
0.1 | 0.5 | GO:0048280 | vesicle fusion with Golgi apparatus(GO:0048280) |
0.1 | 0.1 | GO:0001543 | ovarian follicle rupture(GO:0001543) |
0.1 | 0.1 | GO:0030578 | PML body organization(GO:0030578) |
0.1 | 0.1 | GO:0032959 | inositol trisphosphate biosynthetic process(GO:0032959) |
0.1 | 0.4 | GO:0030643 | cellular phosphate ion homeostasis(GO:0030643) cellular trivalent inorganic anion homeostasis(GO:0072502) |
0.1 | 0.3 | GO:0048199 | vesicle targeting, to, from or within Golgi(GO:0048199) |
0.1 | 0.1 | GO:0045901 | positive regulation of translational elongation(GO:0045901) |
0.1 | 0.9 | GO:0048821 | erythrocyte development(GO:0048821) |
0.1 | 0.1 | GO:0070889 | platelet alpha granule organization(GO:0070889) |
0.1 | 0.3 | GO:0045653 | negative regulation of megakaryocyte differentiation(GO:0045653) |
0.1 | 0.1 | GO:1902915 | negative regulation of protein K63-linked ubiquitination(GO:1900045) negative regulation of protein polyubiquitination(GO:1902915) |
0.1 | 0.1 | GO:1902990 | mitotic telomere maintenance via semi-conservative replication(GO:1902990) |
0.1 | 0.2 | GO:0090666 | scaRNA localization to Cajal body(GO:0090666) |
0.1 | 0.2 | GO:0015888 | thiamine transport(GO:0015888) |
0.1 | 0.2 | GO:0044351 | macropinocytosis(GO:0044351) |
0.1 | 0.1 | GO:1902956 | regulation of mitochondrial electron transport, NADH to ubiquinone(GO:1902956) |
0.1 | 0.1 | GO:0051665 | membrane raft localization(GO:0051665) |
0.1 | 0.1 | GO:0043984 | histone H4-K16 acetylation(GO:0043984) |
0.1 | 0.4 | GO:0006689 | ganglioside catabolic process(GO:0006689) |
0.1 | 0.1 | GO:1900226 | negative regulation of NLRP3 inflammasome complex assembly(GO:1900226) |
0.1 | 0.3 | GO:0035435 | phosphate ion transmembrane transport(GO:0035435) |
0.1 | 0.3 | GO:0033623 | regulation of integrin activation(GO:0033623) |
0.1 | 0.1 | GO:2000286 | receptor internalization involved in canonical Wnt signaling pathway(GO:2000286) |
0.1 | 0.2 | GO:0070966 | nuclear-transcribed mRNA catabolic process, no-go decay(GO:0070966) |
0.1 | 0.1 | GO:0014835 | myoblast differentiation involved in skeletal muscle regeneration(GO:0014835) |
0.1 | 0.2 | GO:0000290 | deadenylation-dependent decapping of nuclear-transcribed mRNA(GO:0000290) |
0.1 | 0.5 | GO:0015813 | L-glutamate transport(GO:0015813) |
0.1 | 0.3 | GO:2000465 | regulation of glycogen (starch) synthase activity(GO:2000465) |
0.1 | 0.3 | GO:0097345 | mitochondrial outer membrane permeabilization(GO:0097345) |
0.1 | 0.2 | GO:0035622 | intrahepatic bile duct development(GO:0035622) |
0.1 | 0.1 | GO:0002752 | cell surface pattern recognition receptor signaling pathway(GO:0002752) |
0.1 | 0.3 | GO:2000786 | positive regulation of autophagosome assembly(GO:2000786) |
0.1 | 0.4 | GO:0042759 | long-chain fatty acid biosynthetic process(GO:0042759) |
0.1 | 0.1 | GO:0001828 | inner cell mass cellular morphogenesis(GO:0001828) |
0.1 | 0.2 | GO:0070164 | negative regulation of adiponectin secretion(GO:0070164) |
0.1 | 0.4 | GO:0008343 | adult feeding behavior(GO:0008343) |
0.1 | 0.2 | GO:0006004 | fucose metabolic process(GO:0006004) |
0.1 | 0.2 | GO:0016584 | nucleosome positioning(GO:0016584) |
0.1 | 0.4 | GO:0034498 | early endosome to Golgi transport(GO:0034498) |
0.1 | 0.1 | GO:0045085 | negative regulation of interleukin-2 biosynthetic process(GO:0045085) |
0.1 | 0.8 | GO:0072520 | seminiferous tubule development(GO:0072520) |
0.1 | 0.2 | GO:0021747 | cochlear nucleus development(GO:0021747) |
0.1 | 0.1 | GO:1904751 | regulation of protein localization to nucleolus(GO:1904749) positive regulation of protein localization to nucleolus(GO:1904751) |
0.1 | 0.1 | GO:0015889 | cobalamin transport(GO:0015889) |
0.1 | 0.2 | GO:0035589 | G-protein coupled purinergic nucleotide receptor signaling pathway(GO:0035589) |
0.1 | 0.1 | GO:0042494 | detection of bacterial lipoprotein(GO:0042494) detection of bacterial lipopeptide(GO:0070340) |
0.1 | 0.1 | GO:2000259 | positive regulation of complement activation(GO:0045917) positive regulation of protein activation cascade(GO:2000259) |
0.1 | 0.5 | GO:0060009 | Sertoli cell development(GO:0060009) |
0.1 | 0.4 | GO:0031507 | heterochromatin assembly(GO:0031507) |
0.1 | 0.3 | GO:0010886 | positive regulation of cholesterol storage(GO:0010886) |
0.1 | 0.6 | GO:0046827 | positive regulation of protein export from nucleus(GO:0046827) |
0.1 | 0.3 | GO:0061179 | negative regulation of insulin secretion involved in cellular response to glucose stimulus(GO:0061179) |
0.1 | 0.2 | GO:0000715 | nucleotide-excision repair, DNA damage recognition(GO:0000715) |
0.1 | 0.1 | GO:1904668 | positive regulation of ubiquitin protein ligase activity(GO:1904668) |
0.1 | 0.5 | GO:0051044 | positive regulation of membrane protein ectodomain proteolysis(GO:0051044) |
0.1 | 0.3 | GO:0033313 | meiotic cell cycle checkpoint(GO:0033313) |
0.1 | 0.2 | GO:0044320 | cellular response to leptin stimulus(GO:0044320) |
0.1 | 0.1 | GO:0071280 | cellular response to copper ion(GO:0071280) |
0.1 | 0.2 | GO:0080009 | mRNA methylation(GO:0080009) |
0.0 | 0.5 | GO:0042407 | cristae formation(GO:0042407) |
0.0 | 0.1 | GO:2001268 | negative regulation of cysteine-type endopeptidase activity involved in apoptotic signaling pathway(GO:2001268) |
0.0 | 0.6 | GO:0070328 | acylglycerol homeostasis(GO:0055090) triglyceride homeostasis(GO:0070328) |
0.0 | 0.1 | GO:0090156 | negative regulation of sphingolipid biosynthetic process(GO:0090155) cellular sphingolipid homeostasis(GO:0090156) |
0.0 | 0.1 | GO:0031049 | programmed DNA elimination(GO:0031049) chromosome breakage(GO:0031052) |
0.0 | 0.2 | GO:0051901 | positive regulation of mitochondrial depolarization(GO:0051901) |
0.0 | 0.2 | GO:0031053 | primary miRNA processing(GO:0031053) |
0.0 | 0.0 | GO:0090148 | membrane fission(GO:0090148) |
0.0 | 0.9 | GO:0051220 | cytoplasmic sequestering of protein(GO:0051220) |
0.0 | 0.3 | GO:0035457 | cellular response to interferon-alpha(GO:0035457) |
0.0 | 0.1 | GO:0031936 | negative regulation of chromatin silencing(GO:0031936) |
0.0 | 0.3 | GO:0001672 | regulation of chromatin assembly or disassembly(GO:0001672) |
0.0 | 0.1 | GO:0043320 | natural killer cell degranulation(GO:0043320) |
0.0 | 0.2 | GO:0002082 | regulation of oxidative phosphorylation(GO:0002082) |
0.0 | 0.1 | GO:0010727 | negative regulation of hydrogen peroxide metabolic process(GO:0010727) |
0.0 | 0.0 | GO:1904152 | regulation of retrograde protein transport, ER to cytosol(GO:1904152) |
0.0 | 0.4 | GO:0000244 | spliceosomal tri-snRNP complex assembly(GO:0000244) |
0.0 | 0.0 | GO:0071596 | ubiquitin-dependent protein catabolic process via the N-end rule pathway(GO:0071596) |
0.0 | 0.2 | GO:0015671 | oxygen transport(GO:0015671) |
0.0 | 0.0 | GO:1901859 | regulation of mitochondrial DNA replication(GO:0090296) negative regulation of mitochondrial DNA metabolic process(GO:1901859) |
0.0 | 0.0 | GO:0034086 | maintenance of sister chromatid cohesion(GO:0034086) maintenance of mitotic sister chromatid cohesion(GO:0034088) |
0.0 | 0.3 | GO:0010668 | ectodermal cell differentiation(GO:0010668) |
0.0 | 0.4 | GO:0043982 | histone H4-K5 acetylation(GO:0043981) histone H4-K8 acetylation(GO:0043982) |
0.0 | 0.1 | GO:0071243 | cellular response to arsenic-containing substance(GO:0071243) |
0.0 | 0.1 | GO:2000622 | regulation of nuclear-transcribed mRNA catabolic process, nonsense-mediated decay(GO:2000622) negative regulation of nuclear-transcribed mRNA catabolic process, nonsense-mediated decay(GO:2000623) |
0.0 | 0.3 | GO:0031468 | nuclear envelope reassembly(GO:0031468) |
0.0 | 0.0 | GO:0032817 | regulation of natural killer cell proliferation(GO:0032817) |
0.0 | 1.2 | GO:0019915 | lipid storage(GO:0019915) |
0.0 | 0.3 | GO:0043457 | regulation of cellular respiration(GO:0043457) |
0.0 | 0.2 | GO:0045141 | meiotic telomere clustering(GO:0045141) |
0.0 | 0.1 | GO:0006670 | sphingosine metabolic process(GO:0006670) |
0.0 | 0.2 | GO:0009235 | cobalamin metabolic process(GO:0009235) |
0.0 | 0.4 | GO:0006353 | DNA-templated transcription, termination(GO:0006353) |
0.0 | 0.2 | GO:0090209 | negative regulation of triglyceride metabolic process(GO:0090209) |
0.0 | 0.1 | GO:0006691 | leukotriene metabolic process(GO:0006691) |
0.0 | 0.1 | GO:0002190 | cap-independent translational initiation(GO:0002190) IRES-dependent translational initiation(GO:0002192) |
0.0 | 0.8 | GO:0070979 | protein K11-linked ubiquitination(GO:0070979) |
0.0 | 0.2 | GO:1901621 | negative regulation of smoothened signaling pathway involved in dorsal/ventral neural tube patterning(GO:1901621) |
0.0 | 0.6 | GO:0006298 | mismatch repair(GO:0006298) |
0.0 | 0.7 | GO:0032981 | NADH dehydrogenase complex assembly(GO:0010257) mitochondrial respiratory chain complex I assembly(GO:0032981) mitochondrial respiratory chain complex I biogenesis(GO:0097031) |
0.0 | 0.0 | GO:0010833 | telomere maintenance via telomere lengthening(GO:0010833) |
0.0 | 0.1 | GO:2000325 | regulation of ligand-dependent nuclear receptor transcription coactivator activity(GO:2000325) positive regulation of ligand-dependent nuclear receptor transcription coactivator activity(GO:2000327) |
0.0 | 0.2 | GO:0000301 | retrograde transport, vesicle recycling within Golgi(GO:0000301) |
0.0 | 0.0 | GO:0002461 | tolerance induction dependent upon immune response(GO:0002461) |
0.0 | 0.1 | GO:0032829 | regulation of CD4-positive, CD25-positive, alpha-beta regulatory T cell differentiation(GO:0032829) positive regulation of CD4-positive, CD25-positive, alpha-beta regulatory T cell differentiation(GO:0032831) |
0.0 | 0.0 | GO:0061050 | regulation of cell growth involved in cardiac muscle cell development(GO:0061050) |
0.0 | 1.1 | GO:0006099 | tricarboxylic acid cycle(GO:0006099) |
0.0 | 0.1 | GO:0045079 | negative regulation of chemokine biosynthetic process(GO:0045079) |
0.0 | 0.1 | GO:0061087 | positive regulation of histone H3-K27 methylation(GO:0061087) |
0.0 | 0.1 | GO:0033133 | positive regulation of glucokinase activity(GO:0033133) |
0.0 | 0.0 | GO:1902686 | positive regulation of mitochondrial membrane permeability involved in apoptotic process(GO:1902110) mitochondrial outer membrane permeabilization involved in programmed cell death(GO:1902686) |
0.0 | 0.1 | GO:0031642 | negative regulation of myelination(GO:0031642) |
0.0 | 0.1 | GO:1901421 | positive regulation of response to alcohol(GO:1901421) |
0.0 | 0.6 | GO:0016578 | histone deubiquitination(GO:0016578) |
0.0 | 0.0 | GO:0033566 | gamma-tubulin complex localization(GO:0033566) |
0.0 | 0.8 | GO:0046470 | phosphatidylcholine metabolic process(GO:0046470) |
0.0 | 0.2 | GO:0048014 | Tie signaling pathway(GO:0048014) |
0.0 | 0.4 | GO:0031571 | mitotic G1 DNA damage checkpoint(GO:0031571) |
0.0 | 0.2 | GO:0051189 | Mo-molybdopterin cofactor biosynthetic process(GO:0006777) Mo-molybdopterin cofactor metabolic process(GO:0019720) molybdopterin cofactor biosynthetic process(GO:0032324) molybdopterin cofactor metabolic process(GO:0043545) prosthetic group metabolic process(GO:0051189) |
0.0 | 0.2 | GO:0071071 | regulation of phospholipid biosynthetic process(GO:0071071) |
0.0 | 0.2 | GO:0014022 | neural plate elongation(GO:0014022) convergent extension involved in neural plate elongation(GO:0022007) |
0.0 | 0.7 | GO:0051016 | barbed-end actin filament capping(GO:0051016) |
0.0 | 0.1 | GO:0009298 | GDP-mannose biosynthetic process(GO:0009298) |
0.0 | 0.7 | GO:0032212 | positive regulation of telomere maintenance via telomerase(GO:0032212) positive regulation of telomere maintenance via telomere lengthening(GO:1904358) |
0.0 | 0.4 | GO:0018026 | peptidyl-lysine monomethylation(GO:0018026) |
0.0 | 1.7 | GO:0006418 | tRNA aminoacylation for protein translation(GO:0006418) |
0.0 | 0.1 | GO:0002215 | defense response to nematode(GO:0002215) |
0.0 | 0.4 | GO:0000463 | maturation of LSU-rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000463) |
0.0 | 0.1 | GO:1903336 | negative regulation of vacuolar transport(GO:1903336) |
0.0 | 0.3 | GO:0006013 | mannose metabolic process(GO:0006013) |
0.0 | 0.2 | GO:0034134 | toll-like receptor 2 signaling pathway(GO:0034134) |
0.0 | 0.2 | GO:0071569 | protein ufmylation(GO:0071569) |
0.0 | 0.2 | GO:0046784 | viral mRNA export from host cell nucleus(GO:0046784) |
0.0 | 0.1 | GO:0019852 | L-ascorbic acid metabolic process(GO:0019852) |
0.0 | 0.1 | GO:0035973 | aggrephagy(GO:0035973) |
0.0 | 0.3 | GO:0001731 | formation of translation preinitiation complex(GO:0001731) |
0.0 | 0.1 | GO:0034729 | histone H3-K79 methylation(GO:0034729) |
0.0 | 0.4 | GO:0032793 | positive regulation of CREB transcription factor activity(GO:0032793) |
0.0 | 1.6 | GO:0051865 | protein autoubiquitination(GO:0051865) |
0.0 | 0.1 | GO:0033013 | tetrapyrrole metabolic process(GO:0033013) |
0.0 | 0.1 | GO:0042518 | negative regulation of tyrosine phosphorylation of Stat3 protein(GO:0042518) |
0.0 | 0.2 | GO:0032049 | cardiolipin biosynthetic process(GO:0032049) |
0.0 | 0.2 | GO:0006688 | glycosphingolipid biosynthetic process(GO:0006688) |
0.0 | 0.1 | GO:0043308 | eosinophil activation involved in immune response(GO:0002278) eosinophil mediated immunity(GO:0002447) eosinophil degranulation(GO:0043308) |
0.0 | 0.1 | GO:0006546 | glycine catabolic process(GO:0006546) glycine decarboxylation via glycine cleavage system(GO:0019464) |
0.0 | 0.1 | GO:0045588 | positive regulation of gamma-delta T cell differentiation(GO:0045588) positive regulation of gamma-delta T cell activation(GO:0046645) |
0.0 | 0.3 | GO:0019886 | antigen processing and presentation of exogenous peptide antigen via MHC class II(GO:0019886) |
0.0 | 0.0 | GO:0072008 | glomerular mesangial cell differentiation(GO:0072008) glomerular mesangial cell development(GO:0072144) |
0.0 | 0.2 | GO:0043247 | protection from non-homologous end joining at telomere(GO:0031848) telomere maintenance in response to DNA damage(GO:0043247) |
0.0 | 0.1 | GO:0061010 | gall bladder development(GO:0061010) |
0.0 | 0.3 | GO:0070935 | 3'-UTR-mediated mRNA stabilization(GO:0070935) |
0.0 | 0.2 | GO:0046686 | response to cadmium ion(GO:0046686) |
0.0 | 0.1 | GO:0033131 | regulation of glucokinase activity(GO:0033131) |
0.0 | 0.5 | GO:0007031 | peroxisome organization(GO:0007031) |
0.0 | 0.1 | GO:0072600 | establishment of protein localization to Golgi(GO:0072600) |
0.0 | 0.1 | GO:0006015 | 5-phosphoribose 1-diphosphate biosynthetic process(GO:0006015) 5-phosphoribose 1-diphosphate metabolic process(GO:0046391) |
0.0 | 0.0 | GO:1903416 | response to glycoside(GO:1903416) |
0.0 | 0.2 | GO:0045006 | DNA deamination(GO:0045006) |
0.0 | 0.1 | GO:0060447 | bud outgrowth involved in lung branching(GO:0060447) |
0.0 | 0.4 | GO:0061014 | positive regulation of mRNA catabolic process(GO:0061014) |
0.0 | 0.1 | GO:0043578 | nuclear matrix organization(GO:0043578) nuclear matrix anchoring at nuclear membrane(GO:0090292) |
0.0 | 0.2 | GO:0010614 | negative regulation of cardiac muscle hypertrophy(GO:0010614) |
0.0 | 0.1 | GO:0070375 | ERK5 cascade(GO:0070375) |
0.0 | 0.2 | GO:0000055 | ribosomal large subunit export from nucleus(GO:0000055) |
0.0 | 0.2 | GO:0070129 | regulation of mitochondrial translation(GO:0070129) |
0.0 | 0.1 | GO:2000504 | positive regulation of blood vessel remodeling(GO:2000504) |
0.0 | 0.1 | GO:0044090 | positive regulation of vacuole organization(GO:0044090) |
0.0 | 0.2 | GO:0043328 | late endosome to vacuole transport via multivesicular body sorting pathway(GO:0032511) protein targeting to vacuole involved in ubiquitin-dependent protein catabolic process via the multivesicular body sorting pathway(GO:0043328) |
0.0 | 0.1 | GO:0043137 | DNA replication, removal of RNA primer(GO:0043137) |
0.0 | 0.1 | GO:0061086 | negative regulation of histone H3-K27 methylation(GO:0061086) |
0.0 | 0.3 | GO:0051444 | negative regulation of ligase activity(GO:0051352) negative regulation of ubiquitin-protein transferase activity(GO:0051444) |
0.0 | 0.0 | GO:0055064 | chloride ion homeostasis(GO:0055064) |
0.0 | 0.3 | GO:0006465 | signal peptide processing(GO:0006465) |
0.0 | 0.3 | GO:1902042 | negative regulation of extrinsic apoptotic signaling pathway via death domain receptors(GO:1902042) |
0.0 | 0.8 | GO:0000184 | nuclear-transcribed mRNA catabolic process, nonsense-mediated decay(GO:0000184) |
0.0 | 0.1 | GO:0060060 | post-embryonic retina morphogenesis in camera-type eye(GO:0060060) |
0.0 | 0.1 | GO:0043967 | histone H4 acetylation(GO:0043967) |
0.0 | 0.0 | GO:2000676 | positive regulation of type B pancreatic cell apoptotic process(GO:2000676) |
0.0 | 0.1 | GO:0015682 | ferric iron transport(GO:0015682) trivalent inorganic cation transport(GO:0072512) |
0.0 | 0.0 | GO:0040031 | snRNA modification(GO:0040031) |
0.0 | 0.1 | GO:0042520 | positive regulation of tyrosine phosphorylation of Stat4 protein(GO:0042520) |
0.0 | 0.7 | GO:0015701 | bicarbonate transport(GO:0015701) |
0.0 | 0.1 | GO:0019482 | beta-alanine metabolic process(GO:0019482) |
0.0 | 0.2 | GO:0051683 | establishment of Golgi localization(GO:0051683) |
0.0 | 0.0 | GO:0060167 | regulation of adenosine receptor signaling pathway(GO:0060167) |
0.0 | 0.1 | GO:0018992 | germ-line sex determination(GO:0018992) |
0.0 | 0.1 | GO:0072223 | metanephric glomerular mesangium development(GO:0072223) metanephric glomerular mesangial cell proliferation involved in metanephros development(GO:0072262) |
0.0 | 0.0 | GO:0002314 | germinal center B cell differentiation(GO:0002314) |
0.0 | 0.1 | GO:0031293 | membrane protein intracellular domain proteolysis(GO:0031293) |
0.0 | 0.2 | GO:0006564 | L-serine biosynthetic process(GO:0006564) |
0.0 | 1.0 | GO:0006730 | one-carbon metabolic process(GO:0006730) |
0.0 | 0.1 | GO:1902036 | regulation of hematopoietic stem cell differentiation(GO:1902036) |
0.0 | 0.9 | GO:0006506 | GPI anchor biosynthetic process(GO:0006506) |
0.0 | 0.7 | GO:0000387 | spliceosomal snRNP assembly(GO:0000387) |
0.0 | 0.1 | GO:2000823 | regulation of androgen receptor activity(GO:2000823) |
0.0 | 0.7 | GO:0046854 | phosphatidylinositol phosphorylation(GO:0046854) |
0.0 | 0.1 | GO:0008291 | acetylcholine metabolic process(GO:0008291) acetate ester metabolic process(GO:1900619) |
0.0 | 0.6 | GO:0006491 | N-glycan processing(GO:0006491) |
0.0 | 0.1 | GO:0071883 | activation of MAPK activity by adrenergic receptor signaling pathway(GO:0071883) |
0.0 | 0.2 | GO:0010835 | regulation of protein ADP-ribosylation(GO:0010835) |
0.0 | 0.1 | GO:0001806 | type IV hypersensitivity(GO:0001806) |
0.0 | 0.5 | GO:0030970 | retrograde protein transport, ER to cytosol(GO:0030970) |
0.0 | 0.0 | GO:2001187 | positive regulation of CD8-positive, alpha-beta T cell activation(GO:2001187) |
0.0 | 1.1 | GO:0006446 | regulation of translational initiation(GO:0006446) |
0.0 | 0.2 | GO:0018904 | ether metabolic process(GO:0018904) |
0.0 | 0.1 | GO:0010310 | regulation of hydrogen peroxide metabolic process(GO:0010310) |
0.0 | 0.0 | GO:0032815 | negative regulation of natural killer cell activation(GO:0032815) |
0.0 | 0.0 | GO:0048294 | negative regulation of isotype switching to IgE isotypes(GO:0048294) |
0.0 | 0.4 | GO:0000470 | maturation of LSU-rRNA(GO:0000470) |
0.0 | 0.1 | GO:0090271 | positive regulation of fibroblast growth factor production(GO:0090271) |
0.0 | 0.2 | GO:0071044 | histone mRNA catabolic process(GO:0071044) |
0.0 | 0.1 | GO:1902774 | late endosome to lysosome transport(GO:1902774) |
0.0 | 0.3 | GO:0034204 | lipid translocation(GO:0034204) |
0.0 | 0.0 | GO:0007035 | vacuolar acidification(GO:0007035) |
0.0 | 0.0 | GO:1904016 | response to Thyroglobulin triiodothyronine(GO:1904016) cellular response to Thyroglobulin triiodothyronine(GO:1904017) |
0.0 | 0.3 | GO:0032785 | negative regulation of DNA-templated transcription, elongation(GO:0032785) |
0.0 | 0.1 | GO:0051531 | NFAT protein import into nucleus(GO:0051531) |
0.0 | 0.1 | GO:0002949 | tRNA threonylcarbamoyladenosine modification(GO:0002949) |
0.0 | 0.1 | GO:0045039 | protein import into mitochondrial inner membrane(GO:0045039) |
0.0 | 0.1 | GO:0090360 | platelet-derived growth factor production(GO:0090360) regulation of platelet-derived growth factor production(GO:0090361) |
0.0 | 0.2 | GO:0007095 | mitotic G2 DNA damage checkpoint(GO:0007095) |
0.0 | 0.1 | GO:0034047 | regulation of protein phosphatase type 2A activity(GO:0034047) |
0.0 | 1.5 | GO:0031338 | regulation of vesicle fusion(GO:0031338) |
0.0 | 0.0 | GO:0000056 | ribosomal small subunit export from nucleus(GO:0000056) |
0.0 | 0.8 | GO:0071427 | mRNA export from nucleus(GO:0006406) mRNA-containing ribonucleoprotein complex export from nucleus(GO:0071427) |
0.0 | 0.1 | GO:0017182 | peptidyl-diphthamide metabolic process(GO:0017182) peptidyl-diphthamide biosynthetic process from peptidyl-histidine(GO:0017183) |
0.0 | 0.1 | GO:1902683 | regulation of receptor localization to synapse(GO:1902683) |
0.0 | 0.1 | GO:0030300 | regulation of intestinal cholesterol absorption(GO:0030300) |
0.0 | 0.1 | GO:0006123 | mitochondrial electron transport, cytochrome c to oxygen(GO:0006123) |
0.0 | 0.3 | GO:0019363 | pyridine nucleotide biosynthetic process(GO:0019363) |
0.0 | 0.5 | GO:0030261 | chromosome condensation(GO:0030261) |
0.0 | 0.2 | GO:0006760 | folic acid-containing compound metabolic process(GO:0006760) |
0.0 | 0.0 | GO:0009208 | pyrimidine ribonucleoside triphosphate metabolic process(GO:0009208) |
0.0 | 1.5 | GO:0006892 | post-Golgi vesicle-mediated transport(GO:0006892) |
0.0 | 0.4 | GO:0050869 | negative regulation of B cell activation(GO:0050869) |
0.0 | 0.1 | GO:0032747 | positive regulation of interleukin-23 production(GO:0032747) |
0.0 | 0.1 | GO:0001866 | NK T cell proliferation(GO:0001866) |
0.0 | 0.2 | GO:0032237 | activation of store-operated calcium channel activity(GO:0032237) |
0.0 | 0.1 | GO:0001878 | response to yeast(GO:0001878) |
0.0 | 0.2 | GO:0006268 | DNA unwinding involved in DNA replication(GO:0006268) |
0.0 | 0.0 | GO:0000966 | RNA 5'-end processing(GO:0000966) |
0.0 | 0.1 | GO:0046628 | positive regulation of insulin receptor signaling pathway(GO:0046628) |
0.0 | 0.1 | GO:0015860 | purine nucleoside transmembrane transport(GO:0015860) purine-containing compound transmembrane transport(GO:0072530) nucleoside transmembrane transport(GO:1901642) |
0.0 | 0.1 | GO:0002326 | B cell lineage commitment(GO:0002326) |
0.0 | 0.2 | GO:0001973 | adenosine receptor signaling pathway(GO:0001973) |
0.0 | 0.2 | GO:0017062 | respiratory chain complex III assembly(GO:0017062) mitochondrial respiratory chain complex III assembly(GO:0034551) mitochondrial respiratory chain complex III biogenesis(GO:0097033) |
0.0 | 0.2 | GO:0060546 | negative regulation of necroptotic process(GO:0060546) |
0.0 | 0.1 | GO:0031269 | pseudopodium assembly(GO:0031269) |
0.0 | 1.4 | GO:1902600 | hydrogen ion transmembrane transport(GO:1902600) |
0.0 | 0.3 | GO:0001833 | inner cell mass cell proliferation(GO:0001833) |
0.0 | 0.1 | GO:0060298 | positive regulation of sarcomere organization(GO:0060298) |
0.0 | 0.0 | GO:0046349 | amino sugar biosynthetic process(GO:0046349) |
0.0 | 0.4 | GO:2000369 | regulation of clathrin-mediated endocytosis(GO:2000369) |
0.0 | 0.1 | GO:0007258 | JUN phosphorylation(GO:0007258) |
0.0 | 0.3 | GO:0021702 | cerebellar Purkinje cell differentiation(GO:0021702) |
0.0 | 0.1 | GO:0070940 | dephosphorylation of RNA polymerase II C-terminal domain(GO:0070940) |
0.0 | 0.1 | GO:0043101 | purine-containing compound salvage(GO:0043101) |
0.0 | 0.1 | GO:0033314 | mitotic DNA replication checkpoint(GO:0033314) |
0.0 | 0.1 | GO:0002017 | regulation of blood volume by renal aldosterone(GO:0002017) |
0.0 | 0.1 | GO:0061620 | glycolytic process through glucose-6-phosphate(GO:0061620) |
0.0 | 0.1 | GO:0070102 | interleukin-6-mediated signaling pathway(GO:0070102) |
0.0 | 0.3 | GO:0070076 | histone lysine demethylation(GO:0070076) |
0.0 | 0.0 | GO:0006295 | nucleotide-excision repair, DNA incision, 3'-to lesion(GO:0006295) |
0.0 | 0.0 | GO:1901252 | regulation of intracellular transport of viral material(GO:1901252) |
0.0 | 0.3 | GO:0007141 | male meiosis I(GO:0007141) |
0.0 | 0.1 | GO:0015780 | nucleotide-sugar transport(GO:0015780) pyrimidine nucleotide-sugar transport(GO:0015781) |
0.0 | 0.1 | GO:0051660 | establishment of centrosome localization(GO:0051660) |
0.0 | 0.3 | GO:0035269 | protein O-linked mannosylation(GO:0035269) |
0.0 | 0.1 | GO:0035357 | peroxisome proliferator activated receptor signaling pathway(GO:0035357) |
0.0 | 0.1 | GO:1900363 | regulation of mRNA polyadenylation(GO:1900363) |
0.0 | 0.1 | GO:0010972 | negative regulation of G2/M transition of mitotic cell cycle(GO:0010972) |
0.0 | 0.1 | GO:0022615 | protein to membrane docking(GO:0022615) |
0.0 | 0.0 | GO:0097477 | lateral motor column neuron migration(GO:0097477) |
0.0 | 0.4 | GO:0070816 | phosphorylation of RNA polymerase II C-terminal domain(GO:0070816) |
0.0 | 0.1 | GO:2000851 | positive regulation of glucocorticoid secretion(GO:2000851) |
0.0 | 0.1 | GO:0048070 | regulation of developmental pigmentation(GO:0048070) |
0.0 | 0.3 | GO:0006144 | purine nucleobase metabolic process(GO:0006144) |
0.0 | 0.2 | GO:0060252 | positive regulation of glial cell proliferation(GO:0060252) |
0.0 | 0.0 | GO:0002904 | positive regulation of B cell apoptotic process(GO:0002904) |
0.0 | 0.2 | GO:0046597 | negative regulation of viral entry into host cell(GO:0046597) |
0.0 | 0.2 | GO:0048875 | chemical homeostasis within a tissue(GO:0048875) |
0.0 | 0.1 | GO:0051788 | response to misfolded protein(GO:0051788) |
0.0 | 0.1 | GO:0007343 | egg activation(GO:0007343) |
0.0 | 0.1 | GO:0030321 | transepithelial chloride transport(GO:0030321) |
0.0 | 0.8 | GO:0010501 | RNA secondary structure unwinding(GO:0010501) |
0.0 | 0.1 | GO:0006537 | glutamate biosynthetic process(GO:0006537) |
0.0 | 0.1 | GO:0010528 | regulation of transposition(GO:0010528) negative regulation of transposition(GO:0010529) |
0.0 | 0.0 | GO:0007195 | adenylate cyclase-inhibiting dopamine receptor signaling pathway(GO:0007195) |
0.0 | 0.0 | GO:0030718 | germ-line stem cell population maintenance(GO:0030718) |
0.0 | 0.3 | GO:0060236 | regulation of mitotic spindle organization(GO:0060236) |
0.0 | 0.1 | GO:0033129 | positive regulation of histone phosphorylation(GO:0033129) |
0.0 | 0.1 | GO:0030213 | hyaluronan biosynthetic process(GO:0030213) |
0.0 | 0.1 | GO:0006490 | oligosaccharide-lipid intermediate biosynthetic process(GO:0006490) |
0.0 | 0.0 | GO:2000520 | regulation of immunological synapse formation(GO:2000520) |
0.0 | 0.0 | GO:0097360 | chorionic trophoblast cell proliferation(GO:0097360) regulation of chorionic trophoblast cell proliferation(GO:1901382) |
0.0 | 0.1 | GO:0061368 | behavioral response to chemical pain(GO:0061366) behavioral response to formalin induced pain(GO:0061368) |
0.0 | 0.1 | GO:0001796 | type IIa hypersensitivity(GO:0001794) regulation of type IIa hypersensitivity(GO:0001796) positive regulation of type IIa hypersensitivity(GO:0001798) type II hypersensitivity(GO:0002445) regulation of type II hypersensitivity(GO:0002892) positive regulation of type II hypersensitivity(GO:0002894) |
0.0 | 0.1 | GO:0050915 | sensory perception of sour taste(GO:0050915) |
0.0 | 0.2 | GO:0046599 | regulation of centriole replication(GO:0046599) |
0.0 | 0.0 | GO:0007619 | courtship behavior(GO:0007619) |
0.0 | 0.1 | GO:2001275 | positive regulation of glucose import in response to insulin stimulus(GO:2001275) |
0.0 | 0.1 | GO:0051589 | negative regulation of neurotransmitter transport(GO:0051589) |
0.0 | 0.7 | GO:0009108 | coenzyme biosynthetic process(GO:0009108) |
0.0 | 0.3 | GO:0000245 | spliceosomal complex assembly(GO:0000245) |
0.0 | 0.1 | GO:0071494 | cellular response to UV-C(GO:0071494) |
0.0 | 0.1 | GO:0018101 | protein citrullination(GO:0018101) |
0.0 | 0.0 | GO:0002905 | mature B cell apoptotic process(GO:0002901) regulation of mature B cell apoptotic process(GO:0002905) negative regulation of mature B cell apoptotic process(GO:0002906) |
0.0 | 0.0 | GO:1901620 | regulation of smoothened signaling pathway involved in dorsal/ventral neural tube patterning(GO:1901620) |
0.0 | 0.3 | GO:0008105 | asymmetric protein localization(GO:0008105) |
0.0 | 0.0 | GO:0045650 | negative regulation of macrophage differentiation(GO:0045650) |
0.0 | 0.1 | GO:0090343 | positive regulation of cell aging(GO:0090343) |
0.0 | 0.5 | GO:0030042 | actin filament depolymerization(GO:0030042) |
0.0 | 0.0 | GO:0046490 | isopentenyl diphosphate metabolic process(GO:0046490) |
0.0 | 0.2 | GO:0003376 | sphingosine-1-phosphate signaling pathway(GO:0003376) |
0.0 | 0.1 | GO:0001514 | selenocysteine incorporation(GO:0001514) translational readthrough(GO:0006451) |
0.0 | 0.1 | GO:0035627 | ceramide transport(GO:0035627) |
0.0 | 0.1 | GO:0071850 | mitotic cell cycle arrest(GO:0071850) |
0.0 | 0.6 | GO:0000027 | ribosomal large subunit assembly(GO:0000027) |
0.0 | 0.0 | GO:0018343 | protein farnesylation(GO:0018343) |
0.0 | 0.1 | GO:2000474 | regulation of opioid receptor signaling pathway(GO:2000474) |
0.0 | 0.1 | GO:0071896 | protein localization to adherens junction(GO:0071896) |
0.0 | 0.1 | GO:0071498 | cellular response to fluid shear stress(GO:0071498) |
0.0 | 0.1 | GO:1903332 | regulation of protein folding(GO:1903332) negative regulation of protein folding(GO:1903333) |
0.0 | 0.1 | GO:0060352 | cell adhesion molecule production(GO:0060352) |
0.0 | 0.8 | GO:0051028 | mRNA transport(GO:0051028) |
0.0 | 0.0 | GO:0042536 | negative regulation of tumor necrosis factor biosynthetic process(GO:0042536) |
0.0 | 0.1 | GO:0002679 | respiratory burst involved in defense response(GO:0002679) |
0.0 | 0.0 | GO:0021694 | cerebellar Purkinje cell layer formation(GO:0021694) |
0.0 | 0.1 | GO:0032469 | endoplasmic reticulum calcium ion homeostasis(GO:0032469) |
0.0 | 0.0 | GO:0043504 | mitochondrial DNA repair(GO:0043504) |
0.0 | 0.9 | GO:0043966 | histone H3 acetylation(GO:0043966) |
0.0 | 0.3 | GO:0000002 | mitochondrial genome maintenance(GO:0000002) |
0.0 | 0.1 | GO:0015015 | heparan sulfate proteoglycan biosynthetic process, enzymatic modification(GO:0015015) |
0.0 | 0.1 | GO:2000400 | positive regulation of T cell differentiation in thymus(GO:0033089) positive regulation of thymocyte aggregation(GO:2000400) |
0.0 | 0.0 | GO:0010040 | response to iron(II) ion(GO:0010040) |
0.0 | 0.4 | GO:0031952 | regulation of protein autophosphorylation(GO:0031952) |
0.0 | 0.2 | GO:0006283 | transcription-coupled nucleotide-excision repair(GO:0006283) |
0.0 | 0.1 | GO:1904816 | positive regulation of protein localization to chromosome, telomeric region(GO:1904816) |
0.0 | 0.0 | GO:0010911 | regulation of isomerase activity(GO:0010911) positive regulation of isomerase activity(GO:0010912) |
0.0 | 0.3 | GO:0006693 | prostanoid metabolic process(GO:0006692) prostaglandin metabolic process(GO:0006693) |
0.0 | 0.1 | GO:0090110 | cargo loading into COPII-coated vesicle(GO:0090110) |
0.0 | 0.5 | GO:0006414 | translational elongation(GO:0006414) |
0.0 | 0.1 | GO:0046697 | decidualization(GO:0046697) |
0.0 | 0.1 | GO:0042701 | progesterone secretion(GO:0042701) |
0.0 | 0.4 | GO:0010737 | protein kinase A signaling(GO:0010737) |
0.0 | 0.1 | GO:0032792 | negative regulation of CREB transcription factor activity(GO:0032792) |
0.0 | 0.1 | GO:0051569 | regulation of histone H3-K4 methylation(GO:0051569) |
0.0 | 0.1 | GO:0038128 | ERBB2 signaling pathway(GO:0038128) |
0.0 | 0.2 | GO:0009048 | dosage compensation(GO:0007549) dosage compensation by inactivation of X chromosome(GO:0009048) |
0.0 | 0.1 | GO:0065001 | specification of axis polarity(GO:0065001) |
0.0 | 0.3 | GO:0043968 | histone H2A acetylation(GO:0043968) |
0.0 | 0.2 | GO:0016572 | histone phosphorylation(GO:0016572) |
0.0 | 0.1 | GO:0000920 | cell separation after cytokinesis(GO:0000920) |
0.0 | 0.1 | GO:2000630 | positive regulation of miRNA metabolic process(GO:2000630) |
0.0 | 0.1 | GO:1901836 | regulation of transcription of nuclear large rRNA transcript from RNA polymerase I promoter(GO:1901836) |
0.0 | 0.1 | GO:0018242 | protein O-linked glycosylation via serine(GO:0018242) |
0.0 | 0.1 | GO:0009992 | cellular water homeostasis(GO:0009992) |
0.0 | 0.2 | GO:0000394 | RNA splicing, via endonucleolytic cleavage and ligation(GO:0000394) tRNA splicing, via endonucleolytic cleavage and ligation(GO:0006388) |
0.0 | 1.0 | GO:0051225 | spindle assembly(GO:0051225) |
0.0 | 0.3 | GO:0002507 | tolerance induction(GO:0002507) |
0.0 | 0.0 | GO:0033182 | regulation of histone ubiquitination(GO:0033182) |
0.0 | 0.2 | GO:0006911 | phagocytosis, engulfment(GO:0006911) |
0.0 | 0.1 | GO:0006548 | histidine catabolic process(GO:0006548) imidazole-containing compound catabolic process(GO:0052805) |
0.0 | 0.1 | GO:0010839 | negative regulation of keratinocyte proliferation(GO:0010839) |
0.0 | 0.1 | GO:0045086 | positive regulation of interleukin-2 biosynthetic process(GO:0045086) |
0.0 | 0.0 | GO:0000436 | carbon catabolite regulation of transcription from RNA polymerase II promoter(GO:0000429) carbon catabolite activation of transcription from RNA polymerase II promoter(GO:0000436) |
0.0 | 0.6 | GO:0006413 | translational initiation(GO:0006413) |
0.0 | 0.7 | GO:0030218 | erythrocyte differentiation(GO:0030218) |
0.0 | 0.0 | GO:0045591 | positive regulation of regulatory T cell differentiation(GO:0045591) |
0.0 | 0.1 | GO:0016266 | O-glycan processing(GO:0016266) |
0.0 | 0.0 | GO:0008298 | intracellular mRNA localization(GO:0008298) |
0.0 | 0.0 | GO:0010520 | regulation of reciprocal meiotic recombination(GO:0010520) |
0.0 | 0.1 | GO:0060830 | ciliary receptor clustering involved in smoothened signaling pathway(GO:0060830) |
0.0 | 0.1 | GO:0023035 | CD40 signaling pathway(GO:0023035) |
0.0 | 0.3 | GO:2000779 | regulation of double-strand break repair(GO:2000779) |
0.0 | 0.0 | GO:2000644 | regulation of receptor catabolic process(GO:2000644) |
0.0 | 0.1 | GO:2001013 | epithelial cell proliferation involved in renal tubule morphogenesis(GO:2001013) |
0.0 | 0.0 | GO:0090245 | axis elongation involved in somitogenesis(GO:0090245) |
0.0 | 0.1 | GO:0051310 | metaphase plate congression(GO:0051310) |
0.0 | 0.1 | GO:0090151 | establishment of protein localization to mitochondrial membrane(GO:0090151) |
0.0 | 0.3 | GO:0006891 | intra-Golgi vesicle-mediated transport(GO:0006891) |
0.0 | 0.1 | GO:0019240 | citrulline biosynthetic process(GO:0019240) |
0.0 | 0.0 | GO:0097502 | protein mannosylation(GO:0035268) mannosylation(GO:0097502) |
0.0 | 0.3 | GO:0000413 | protein peptidyl-prolyl isomerization(GO:0000413) |
0.0 | 0.0 | GO:2000418 | positive regulation of eosinophil migration(GO:2000418) |
0.0 | 0.0 | GO:0060631 | regulation of meiosis I(GO:0060631) |
0.0 | 0.2 | GO:0000459 | exonucleolytic trimming involved in rRNA processing(GO:0000459) exonucleolytic trimming to generate mature 3'-end of 5.8S rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000467) |
0.0 | 0.1 | GO:0061113 | pancreas morphogenesis(GO:0061113) |
0.0 | 0.3 | GO:0001522 | pseudouridine synthesis(GO:0001522) |
0.0 | 0.1 | GO:0042095 | interferon-gamma biosynthetic process(GO:0042095) |
0.0 | 0.1 | GO:0007191 | adenylate cyclase-activating dopamine receptor signaling pathway(GO:0007191) |
0.0 | 0.2 | GO:0045724 | positive regulation of cilium assembly(GO:0045724) |
0.0 | 0.1 | GO:0010447 | response to acidic pH(GO:0010447) |
0.0 | 0.0 | GO:0016075 | rRNA catabolic process(GO:0016075) |
0.0 | 0.1 | GO:0042436 | tryptophan catabolic process(GO:0006569) tryptophan catabolic process to kynurenine(GO:0019441) indole-containing compound catabolic process(GO:0042436) indolalkylamine catabolic process(GO:0046218) |
0.0 | 0.3 | GO:0033344 | cholesterol efflux(GO:0033344) |
0.0 | 0.1 | GO:0070269 | pyroptosis(GO:0070269) |
0.0 | 0.0 | GO:0016093 | polyprenol metabolic process(GO:0016093) |
0.0 | 0.1 | GO:1902715 | positive regulation of interferon-gamma secretion(GO:1902715) |
0.0 | 0.1 | GO:0030968 | endoplasmic reticulum unfolded protein response(GO:0030968) |
0.0 | 0.1 | GO:0000729 | DNA double-strand break processing(GO:0000729) |
0.0 | 0.1 | GO:0048304 | positive regulation of isotype switching to IgG isotypes(GO:0048304) |
0.0 | 0.4 | GO:0018345 | protein palmitoylation(GO:0018345) |
0.0 | 1.4 | GO:0006457 | protein folding(GO:0006457) |
0.0 | 0.1 | GO:0006474 | N-terminal protein amino acid acetylation(GO:0006474) |
0.0 | 0.0 | GO:1902430 | negative regulation of beta-amyloid formation(GO:1902430) |
0.0 | 0.2 | GO:0035825 | reciprocal meiotic recombination(GO:0007131) reciprocal DNA recombination(GO:0035825) |
0.0 | 0.1 | GO:0032310 | prostaglandin secretion(GO:0032310) |
0.0 | 0.1 | GO:0046087 | cytidine catabolic process(GO:0006216) cytidine deamination(GO:0009972) cytidine metabolic process(GO:0046087) |
0.0 | 0.0 | GO:0042360 | vitamin E metabolic process(GO:0042360) |
0.0 | 0.0 | GO:0046984 | regulation of hemoglobin biosynthetic process(GO:0046984) |
0.0 | 0.0 | GO:0071806 | intracellular protein transmembrane transport(GO:0065002) protein transmembrane transport(GO:0071806) |
0.0 | 0.0 | GO:2000643 | positive regulation of early endosome to late endosome transport(GO:2000643) |
0.0 | 0.3 | GO:0006493 | protein O-linked glycosylation(GO:0006493) |
0.0 | 0.1 | GO:1905155 | positive regulation of phagocytosis, engulfment(GO:0060100) positive regulation of membrane invagination(GO:1905155) |
0.0 | 0.1 | GO:0036315 | cellular response to sterol(GO:0036315) |
0.0 | 0.2 | GO:0043496 | regulation of protein homodimerization activity(GO:0043496) |
0.0 | 0.0 | GO:0002756 | MyD88-independent toll-like receptor signaling pathway(GO:0002756) |
0.0 | 0.2 | GO:0008053 | mitochondrial fusion(GO:0008053) |
0.0 | 0.2 | GO:0045143 | homologous chromosome segregation(GO:0045143) |
0.0 | 3.0 | GO:0008380 | RNA splicing(GO:0008380) |
0.0 | 0.1 | GO:0019184 | nonribosomal peptide biosynthetic process(GO:0019184) |
0.0 | 0.0 | GO:0033326 | cerebrospinal fluid secretion(GO:0033326) |
0.0 | 0.6 | GO:0006958 | complement activation, classical pathway(GO:0006958) |
0.0 | 0.0 | GO:0043619 | regulation of transcription from RNA polymerase II promoter in response to oxidative stress(GO:0043619) |
0.0 | 0.4 | GO:0006829 | zinc II ion transport(GO:0006829) |
0.0 | 0.0 | GO:0051025 | negative regulation of immunoglobulin secretion(GO:0051025) |
0.0 | 0.0 | GO:0000289 | nuclear-transcribed mRNA poly(A) tail shortening(GO:0000289) |
0.0 | 0.1 | GO:0008295 | spermidine biosynthetic process(GO:0008295) |
0.0 | 0.1 | GO:1900271 | regulation of long-term synaptic potentiation(GO:1900271) |
0.0 | 0.2 | GO:0006221 | pyrimidine nucleotide biosynthetic process(GO:0006221) |
0.0 | 0.1 | GO:0006687 | glycosphingolipid metabolic process(GO:0006687) |
0.0 | 0.1 | GO:0043278 | response to isoquinoline alkaloid(GO:0014072) response to morphine(GO:0043278) |
0.0 | 0.0 | GO:0032703 | negative regulation of interleukin-2 production(GO:0032703) |
0.0 | 0.0 | GO:0045626 | negative regulation of T-helper 1 cell differentiation(GO:0045626) |
0.0 | 0.0 | GO:0045048 | protein insertion into ER membrane(GO:0045048) tail-anchored membrane protein insertion into ER membrane(GO:0071816) |
0.0 | 0.1 | GO:0032099 | negative regulation of appetite(GO:0032099) |
0.0 | 0.0 | GO:0030421 | defecation(GO:0030421) |
0.0 | 0.2 | GO:0015807 | L-amino acid transport(GO:0015807) |
0.0 | 0.1 | GO:0007175 | negative regulation of epidermal growth factor-activated receptor activity(GO:0007175) |
0.0 | 0.0 | GO:0046834 | lipid phosphorylation(GO:0046834) |
0.0 | 0.1 | GO:0033147 | negative regulation of intracellular estrogen receptor signaling pathway(GO:0033147) |
0.0 | 0.1 | GO:0045793 | positive regulation of cell size(GO:0045793) |
0.0 | 0.0 | GO:1990774 | regulation of tumor necrosis factor secretion(GO:1904467) tumor necrosis factor secretion(GO:1990774) |
0.0 | 0.2 | GO:0009060 | aerobic respiration(GO:0009060) |
0.0 | 0.0 | GO:1902591 | single-organism membrane budding(GO:1902591) |
0.0 | 0.1 | GO:0009642 | response to light intensity(GO:0009642) |
0.0 | 0.1 | GO:0006346 | methylation-dependent chromatin silencing(GO:0006346) |
0.0 | 0.1 | GO:0006622 | protein targeting to lysosome(GO:0006622) |
0.0 | 0.1 | GO:0032516 | positive regulation of phosphoprotein phosphatase activity(GO:0032516) |
0.0 | 0.1 | GO:0006833 | water transport(GO:0006833) |
0.0 | 0.3 | GO:2001252 | positive regulation of chromosome organization(GO:2001252) |
0.0 | 1.2 | GO:0006626 | protein targeting to mitochondrion(GO:0006626) |
0.0 | 0.0 | GO:0032490 | detection of molecule of bacterial origin(GO:0032490) |
0.0 | 0.0 | GO:0006269 | DNA replication, synthesis of RNA primer(GO:0006269) |
0.0 | 0.0 | GO:0035093 | spermatogenesis, exchange of chromosomal proteins(GO:0035093) |
0.0 | 0.1 | GO:0045022 | early endosome to late endosome transport(GO:0045022) vesicle-mediated transport between endosomal compartments(GO:0098927) |
0.0 | 0.1 | GO:0070268 | cornification(GO:0070268) |
0.0 | 0.0 | GO:2000662 | interleukin-5 secretion(GO:0072603) interleukin-13 secretion(GO:0072611) regulation of interleukin-5 secretion(GO:2000662) positive regulation of interleukin-5 secretion(GO:2000664) regulation of interleukin-13 secretion(GO:2000665) positive regulation of interleukin-13 secretion(GO:2000667) |
0.0 | 0.0 | GO:0038094 | Fc-gamma receptor signaling pathway(GO:0038094) |
0.0 | 0.1 | GO:0006398 | mRNA 3'-end processing by stem-loop binding and cleavage(GO:0006398) |
0.0 | 0.0 | GO:0048548 | regulation of pinocytosis(GO:0048548) negative regulation of pinocytosis(GO:0048550) |
0.0 | 0.0 | GO:0007597 | blood coagulation, intrinsic pathway(GO:0007597) |
0.0 | 0.1 | GO:0034377 | plasma lipoprotein particle assembly(GO:0034377) |
0.0 | 0.0 | GO:0097114 | NMDA glutamate receptor clustering(GO:0097114) |
0.0 | 2.0 | GO:0032259 | methylation(GO:0032259) |
0.0 | 0.1 | GO:0007143 | female meiotic division(GO:0007143) |
0.0 | 0.0 | GO:0043174 | nucleoside salvage(GO:0043174) |
0.0 | 0.1 | GO:0033280 | response to vitamin D(GO:0033280) |
0.0 | 0.0 | GO:1901662 | phylloquinone metabolic process(GO:0042374) phylloquinone catabolic process(GO:0042376) quinone catabolic process(GO:1901662) |
0.0 | 0.0 | GO:0046514 | ceramide catabolic process(GO:0046514) |
0.0 | 0.0 | GO:0034436 | glycoprotein transport(GO:0034436) |
0.0 | 0.2 | GO:0007062 | sister chromatid cohesion(GO:0007062) |
0.0 | 0.0 | GO:0060137 | maternal process involved in parturition(GO:0060137) |
0.0 | 0.0 | GO:0060467 | negative regulation of fertilization(GO:0060467) |
0.0 | 0.2 | GO:0016180 | snRNA processing(GO:0016180) |
0.0 | 0.0 | GO:0071166 | ribonucleoprotein complex localization(GO:0071166) |
0.0 | 0.2 | GO:0006471 | protein ADP-ribosylation(GO:0006471) |
0.0 | 0.4 | GO:0000724 | double-strand break repair via homologous recombination(GO:0000724) recombinational repair(GO:0000725) |
0.0 | 0.0 | GO:0006122 | mitochondrial electron transport, ubiquinol to cytochrome c(GO:0006122) |
0.0 | 0.1 | GO:1903441 | protein localization to ciliary membrane(GO:1903441) |
0.0 | 0.1 | GO:0001835 | blastocyst hatching(GO:0001835) hatching(GO:0035188) organism emergence from protective structure(GO:0071684) |
0.0 | 0.0 | GO:0030223 | neutrophil differentiation(GO:0030223) |
0.0 | 0.0 | GO:1903525 | regulation of membrane tubulation(GO:1903525) |
0.0 | 0.0 | GO:0010991 | regulation of SMAD protein complex assembly(GO:0010990) negative regulation of SMAD protein complex assembly(GO:0010991) |
0.0 | 0.1 | GO:0006297 | nucleotide-excision repair, DNA gap filling(GO:0006297) |
0.0 | 0.0 | GO:2000574 | regulation of microtubule motor activity(GO:2000574) |
0.0 | 0.1 | GO:0055070 | copper ion homeostasis(GO:0055070) |
0.0 | 0.1 | GO:0009595 | detection of biotic stimulus(GO:0009595) |
0.0 | 0.0 | GO:0045723 | positive regulation of fatty acid biosynthetic process(GO:0045723) |
0.0 | 0.1 | GO:0032438 | melanosome organization(GO:0032438) pigment granule organization(GO:0048753) |
0.0 | 0.4 | GO:0000086 | G2/M transition of mitotic cell cycle(GO:0000086) |
0.0 | 0.0 | GO:0052205 | modulation of molecular function in other organism(GO:0044359) negative regulation of molecular function in other organism(GO:0044362) negative regulation of molecular function in other organism involved in symbiotic interaction(GO:0052204) modulation of molecular function in other organism involved in symbiotic interaction(GO:0052205) |
0.0 | 0.0 | GO:0035790 | platelet-derived growth factor receptor-alpha signaling pathway(GO:0035790) |
0.0 | 0.0 | GO:0048263 | determination of dorsal/ventral asymmetry(GO:0048262) determination of dorsal identity(GO:0048263) |
0.0 | 0.0 | GO:0030046 | parallel actin filament bundle assembly(GO:0030046) |
0.0 | 0.0 | GO:0006104 | succinyl-CoA metabolic process(GO:0006104) |
0.0 | 0.0 | GO:0032788 | saturated monocarboxylic acid metabolic process(GO:0032788) unsaturated monocarboxylic acid metabolic process(GO:0032789) |
0.0 | 0.0 | GO:0010360 | negative regulation of anion channel activity(GO:0010360) |
0.0 | 0.1 | GO:0071361 | cellular response to ethanol(GO:0071361) |
0.0 | 1.3 | GO:0042254 | ribosome biogenesis(GO:0042254) |
0.0 | 0.9 | GO:0043123 | positive regulation of I-kappaB kinase/NF-kappaB signaling(GO:0043123) |
0.0 | 0.0 | GO:0030259 | lipid glycosylation(GO:0030259) |
0.0 | 0.2 | GO:0014003 | oligodendrocyte development(GO:0014003) |
0.0 | 0.0 | GO:0035967 | cellular response to topologically incorrect protein(GO:0035967) |
0.0 | 0.0 | GO:0048143 | astrocyte activation(GO:0048143) |
0.0 | 0.0 | GO:2000394 | positive regulation of lamellipodium morphogenesis(GO:2000394) |
0.0 | 0.0 | GO:0097466 | glycoprotein ERAD pathway(GO:0097466) response to glycoprotein(GO:1904587) |
0.0 | 0.0 | GO:0022616 | DNA strand elongation(GO:0022616) |
0.0 | 0.3 | GO:0006953 | acute-phase response(GO:0006953) |
0.0 | 0.0 | GO:0032736 | positive regulation of interleukin-13 production(GO:0032736) |
0.0 | 0.0 | GO:0014043 | negative regulation of neuron maturation(GO:0014043) |
0.0 | 0.2 | GO:0050891 | multicellular organismal water homeostasis(GO:0050891) |
0.0 | 0.1 | GO:0042905 | 9-cis-retinoic acid biosynthetic process(GO:0042904) 9-cis-retinoic acid metabolic process(GO:0042905) |
0.0 | 0.0 | GO:0015670 | carbon dioxide transport(GO:0015670) |
0.0 | 0.1 | GO:1901072 | glucosamine-containing compound catabolic process(GO:1901072) |
0.0 | 0.0 | GO:0019626 | short-chain fatty acid catabolic process(GO:0019626) |
0.0 | 0.0 | GO:0051661 | maintenance of centrosome location(GO:0051661) |
0.0 | 0.1 | GO:0009226 | nucleotide-sugar biosynthetic process(GO:0009226) |
0.0 | 0.0 | GO:0000320 | re-entry into mitotic cell cycle(GO:0000320) |
0.0 | 0.1 | GO:0042789 | mRNA transcription from RNA polymerase II promoter(GO:0042789) |
0.0 | 0.1 | GO:1904385 | cellular response to angiotensin(GO:1904385) response to angiotensin(GO:1990776) |
0.0 | 0.0 | GO:1902414 | protein localization to cell junction(GO:1902414) |
0.0 | 0.0 | GO:1902071 | regulation of hypoxia-inducible factor-1alpha signaling pathway(GO:1902071) |
0.0 | 0.0 | GO:1904694 | negative regulation of vascular smooth muscle contraction(GO:1904694) |
0.0 | 0.0 | GO:2000674 | regulation of type B pancreatic cell apoptotic process(GO:2000674) |
0.0 | 0.1 | GO:1900264 | regulation of DNA-directed DNA polymerase activity(GO:1900262) positive regulation of DNA-directed DNA polymerase activity(GO:1900264) |
0.0 | 0.0 | GO:0097411 | hypoxia-inducible factor-1alpha signaling pathway(GO:0097411) |
0.0 | 0.0 | GO:2000468 | regulation of peroxidase activity(GO:2000468) |
0.0 | 0.0 | GO:0008214 | protein demethylation(GO:0006482) protein dealkylation(GO:0008214) |
0.0 | 0.0 | GO:0016539 | intein-mediated protein splicing(GO:0016539) protein splicing(GO:0030908) |
0.0 | 0.2 | GO:0032543 | mitochondrial translation(GO:0032543) |
0.0 | 0.1 | GO:0045953 | negative regulation of natural killer cell mediated cytotoxicity(GO:0045953) |
0.0 | 0.1 | GO:0098534 | centriole assembly(GO:0098534) |
0.0 | 0.1 | GO:0050957 | equilibrioception(GO:0050957) |
0.0 | 0.0 | GO:0021914 | negative regulation of smoothened signaling pathway involved in ventral spinal cord patterning(GO:0021914) |
0.0 | 0.0 | GO:1900078 | positive regulation of cellular response to insulin stimulus(GO:1900078) |
0.0 | 0.0 | GO:0044341 | sodium-dependent phosphate transport(GO:0044341) regulation of sodium-dependent phosphate transport(GO:2000118) |
0.0 | 0.0 | GO:0002125 | maternal aggressive behavior(GO:0002125) cellular response to cocaine(GO:0071314) |
0.0 | 0.0 | GO:0046122 | purine deoxyribonucleoside metabolic process(GO:0046122) |
0.0 | 0.0 | GO:2001181 | positive regulation of interleukin-10 secretion(GO:2001181) |
0.0 | 0.1 | GO:0034315 | regulation of Arp2/3 complex-mediated actin nucleation(GO:0034315) |
0.0 | 0.0 | GO:0045925 | positive regulation of female receptivity(GO:0045925) |
0.0 | 0.0 | GO:0051204 | protein insertion into mitochondrial membrane(GO:0051204) |
0.0 | 0.0 | GO:2000321 | positive regulation of T-helper 17 cell differentiation(GO:2000321) |
0.0 | 0.0 | GO:0045730 | respiratory burst(GO:0045730) |
0.0 | 0.0 | GO:0033034 | positive regulation of myeloid cell apoptotic process(GO:0033034) |
0.0 | 0.2 | GO:0072583 | clathrin-mediated endocytosis(GO:0072583) |
0.0 | 0.0 | GO:0019478 | D-amino acid catabolic process(GO:0019478) |
0.0 | 0.1 | GO:0019432 | triglyceride biosynthetic process(GO:0019432) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.5 | 2.1 | GO:1990130 | Iml1 complex(GO:1990130) |
0.3 | 1.0 | GO:0097451 | glial limiting end-foot(GO:0097451) |
0.3 | 1.1 | GO:0033269 | internode region of axon(GO:0033269) |
0.3 | 1.6 | GO:1990075 | periciliary membrane compartment(GO:1990075) |
0.3 | 0.8 | GO:1990761 | growth cone lamellipodium(GO:1990761) |
0.3 | 0.8 | GO:0031092 | platelet alpha granule membrane(GO:0031092) |
0.3 | 0.8 | GO:0005967 | mitochondrial pyruvate dehydrogenase complex(GO:0005967) |
0.2 | 0.5 | GO:0014731 | spectrin-associated cytoskeleton(GO:0014731) |
0.2 | 0.7 | GO:0005944 | phosphatidylinositol 3-kinase complex, class IB(GO:0005944) |
0.2 | 0.9 | GO:0031502 | dolichyl-phosphate-mannose-protein mannosyltransferase complex(GO:0031502) |
0.2 | 0.7 | GO:0005958 | DNA-dependent protein kinase-DNA ligase 4 complex(GO:0005958) |
0.2 | 1.1 | GO:1990712 | HFE-transferrin receptor complex(GO:1990712) |
0.2 | 0.8 | GO:0002079 | inner acrosomal membrane(GO:0002079) |
0.2 | 1.2 | GO:0000138 | Golgi trans cisterna(GO:0000138) |
0.2 | 1.3 | GO:0005952 | cAMP-dependent protein kinase complex(GO:0005952) |
0.2 | 0.9 | GO:0031094 | platelet dense tubular network(GO:0031094) |
0.2 | 1.2 | GO:0090543 | Flemming body(GO:0090543) |
0.2 | 0.9 | GO:0033063 | Rad51B-Rad51C-Rad51D-XRCC2 complex(GO:0033063) |
0.2 | 0.5 | GO:0030981 | cortical microtubule cytoskeleton(GO:0030981) |
0.2 | 0.5 | GO:0005971 | ribonucleoside-diphosphate reductase complex(GO:0005971) |
0.2 | 0.5 | GO:0097413 | Lewy body(GO:0097413) |
0.2 | 0.8 | GO:0031838 | haptoglobin-hemoglobin complex(GO:0031838) |
0.1 | 0.1 | GO:0097629 | extrinsic component of omegasome membrane(GO:0097629) |
0.1 | 1.0 | GO:0070688 | MLL5-L complex(GO:0070688) |
0.1 | 1.0 | GO:0008290 | F-actin capping protein complex(GO:0008290) |
0.1 | 0.4 | GO:0034274 | Atg12-Atg5-Atg16 complex(GO:0034274) |
0.1 | 1.5 | GO:0070938 | contractile ring(GO:0070938) |
0.1 | 0.3 | GO:0034715 | pICln-Sm protein complex(GO:0034715) |
0.1 | 0.8 | GO:0090571 | RNA polymerase II transcription repressor complex(GO:0090571) |
0.1 | 0.1 | GO:0044294 | dendritic growth cone(GO:0044294) |
0.1 | 0.1 | GO:0008091 | spectrin(GO:0008091) |
0.1 | 1.0 | GO:0030122 | AP-2 adaptor complex(GO:0030122) |
0.1 | 1.4 | GO:0031332 | RISC complex(GO:0016442) RNAi effector complex(GO:0031332) |
0.1 | 2.6 | GO:0045120 | pronucleus(GO:0045120) |
0.1 | 0.5 | GO:0070545 | PeBoW complex(GO:0070545) |
0.1 | 0.5 | GO:0000120 | RNA polymerase I transcription factor complex(GO:0000120) |
0.1 | 0.4 | GO:0032127 | dense core granule membrane(GO:0032127) |
0.1 | 0.5 | GO:0000796 | condensin complex(GO:0000796) |
0.1 | 1.7 | GO:0001891 | phagocytic cup(GO:0001891) |
0.1 | 0.5 | GO:0098536 | deuterosome(GO:0098536) |
0.1 | 0.6 | GO:0031298 | replication fork protection complex(GO:0031298) |
0.1 | 0.1 | GO:0001739 | sex chromatin(GO:0001739) |
0.1 | 0.6 | GO:0005663 | DNA replication factor C complex(GO:0005663) |
0.1 | 0.5 | GO:0035363 | histone locus body(GO:0035363) |
0.1 | 0.9 | GO:0032300 | mismatch repair complex(GO:0032300) |
0.1 | 0.3 | GO:0097443 | sorting endosome(GO:0097443) |
0.1 | 0.4 | GO:0005672 | transcription factor TFIIA complex(GO:0005672) |
0.1 | 1.8 | GO:0005721 | pericentric heterochromatin(GO:0005721) |
0.1 | 0.3 | GO:0034666 | integrin alpha2-beta1 complex(GO:0034666) |
0.1 | 0.3 | GO:0071664 | catenin-TCF7L2 complex(GO:0071664) |
0.1 | 0.3 | GO:0005833 | hemoglobin complex(GO:0005833) |
0.1 | 0.5 | GO:0005964 | phosphorylase kinase complex(GO:0005964) |
0.1 | 0.4 | GO:0008622 | epsilon DNA polymerase complex(GO:0008622) |
0.1 | 0.5 | GO:1990111 | spermatoproteasome complex(GO:1990111) |
0.1 | 0.8 | GO:0019908 | nuclear cyclin-dependent protein kinase holoenzyme complex(GO:0019908) |
0.1 | 0.3 | GO:0005955 | calcineurin complex(GO:0005955) |
0.1 | 0.6 | GO:0042582 | primary lysosome(GO:0005766) azurophil granule(GO:0042582) |
0.1 | 0.3 | GO:0031390 | Ctf18 RFC-like complex(GO:0031390) |
0.1 | 0.4 | GO:0072357 | PTW/PP1 phosphatase complex(GO:0072357) |
0.1 | 0.8 | GO:0034464 | BBSome(GO:0034464) |
0.1 | 0.9 | GO:0097539 | ciliary transition fiber(GO:0097539) |
0.1 | 0.2 | GO:0005828 | kinetochore microtubule(GO:0005828) |
0.1 | 0.6 | GO:0005818 | aster(GO:0005818) |
0.1 | 0.6 | GO:1990023 | mitotic spindle midzone(GO:1990023) |
0.1 | 0.5 | GO:0061617 | MICOS complex(GO:0061617) |
0.1 | 0.3 | GO:0036396 | MIS complex(GO:0036396) |
0.1 | 1.4 | GO:0071004 | U2-type prespliceosome(GO:0071004) |
0.1 | 0.5 | GO:0030130 | clathrin coat of trans-Golgi network vesicle(GO:0030130) |
0.1 | 2.7 | GO:0008180 | COP9 signalosome(GO:0008180) |
0.1 | 0.7 | GO:0044666 | MLL3/4 complex(GO:0044666) |
0.1 | 0.4 | GO:0032777 | Piccolo NuA4 histone acetyltransferase complex(GO:0032777) |
0.1 | 0.4 | GO:0045239 | tricarboxylic acid cycle enzyme complex(GO:0045239) |
0.1 | 0.4 | GO:0097255 | R2TP complex(GO:0097255) |
0.1 | 0.8 | GO:0032045 | guanyl-nucleotide exchange factor complex(GO:0032045) |
0.1 | 1.0 | GO:0000940 | condensed chromosome outer kinetochore(GO:0000940) |
0.1 | 0.7 | GO:0072687 | meiotic spindle(GO:0072687) |
0.1 | 3.6 | GO:0032592 | integral component of mitochondrial membrane(GO:0032592) |
0.1 | 2.2 | GO:0010494 | cytoplasmic stress granule(GO:0010494) |
0.1 | 0.4 | GO:0097431 | mitotic spindle pole(GO:0097431) |
0.1 | 0.1 | GO:0005642 | annulate lamellae(GO:0005642) |
0.1 | 0.4 | GO:0033588 | Elongator holoenzyme complex(GO:0033588) |
0.1 | 0.6 | GO:0000307 | cyclin-dependent protein kinase holoenzyme complex(GO:0000307) |
0.1 | 0.2 | GO:0031417 | NatC complex(GO:0031417) |
0.1 | 0.6 | GO:0000506 | glycosylphosphatidylinositol-N-acetylglucosaminyltransferase (GPI-GnT) complex(GO:0000506) |
0.1 | 0.2 | GO:0005899 | insulin receptor complex(GO:0005899) |
0.1 | 0.9 | GO:0005689 | U12-type spliceosomal complex(GO:0005689) |
0.1 | 0.2 | GO:0031084 | BLOC-2 complex(GO:0031084) |
0.1 | 1.8 | GO:0080008 | Cul4-RING E3 ubiquitin ligase complex(GO:0080008) |
0.1 | 0.3 | GO:0071817 | MMXD complex(GO:0071817) |
0.1 | 0.7 | GO:1990124 | messenger ribonucleoprotein complex(GO:1990124) |
0.1 | 0.2 | GO:0038037 | G-protein coupled receptor dimeric complex(GO:0038037) G-protein coupled receptor complex(GO:0097648) |
0.1 | 1.9 | GO:0097228 | sperm principal piece(GO:0097228) |
0.1 | 0.4 | GO:0005638 | lamin filament(GO:0005638) |
0.1 | 0.4 | GO:0042765 | GPI-anchor transamidase complex(GO:0042765) |
0.1 | 0.3 | GO:0031265 | CD95 death-inducing signaling complex(GO:0031265) |
0.1 | 3.6 | GO:0005643 | nuclear pore(GO:0005643) |
0.1 | 0.6 | GO:0045335 | phagocytic vesicle(GO:0045335) |
0.1 | 2.4 | GO:0008023 | transcription elongation factor complex(GO:0008023) |
0.1 | 0.6 | GO:0031080 | nuclear pore outer ring(GO:0031080) |
0.1 | 0.4 | GO:0071986 | Ragulator complex(GO:0071986) |
0.1 | 0.1 | GO:0034363 | intermediate-density lipoprotein particle(GO:0034363) |
0.1 | 0.2 | GO:0070939 | Dsl1p complex(GO:0070939) |
0.1 | 0.3 | GO:0016281 | eukaryotic translation initiation factor 4F complex(GO:0016281) |
0.1 | 1.0 | GO:0030914 | STAGA complex(GO:0030914) |
0.1 | 0.7 | GO:0042405 | nuclear inclusion body(GO:0042405) |
0.1 | 0.6 | GO:0005677 | chromatin silencing complex(GO:0005677) |
0.1 | 0.9 | GO:0005682 | U5 snRNP(GO:0005682) |
0.1 | 0.2 | GO:1990316 | ATG1/ULK1 kinase complex(GO:1990316) |
0.1 | 0.8 | GO:0030123 | AP-3 adaptor complex(GO:0030123) |
0.1 | 0.7 | GO:0031143 | pseudopodium(GO:0031143) |
0.1 | 2.9 | GO:0031228 | intrinsic component of Golgi membrane(GO:0031228) |
0.1 | 0.2 | GO:0097057 | TRAF2-GSTP1 complex(GO:0097057) |
0.1 | 0.1 | GO:0097441 | basilar dendrite(GO:0097441) |
0.1 | 0.7 | GO:0005868 | cytoplasmic dynein complex(GO:0005868) |
0.1 | 0.3 | GO:0097136 | Bcl-2 family protein complex(GO:0097136) |
0.1 | 0.1 | GO:0017101 | aminoacyl-tRNA synthetase multienzyme complex(GO:0017101) |
0.1 | 0.5 | GO:1990909 | Wnt signalosome(GO:1990909) |
0.1 | 0.2 | GO:0042719 | mitochondrial intermembrane space protein transporter complex(GO:0042719) |
0.1 | 0.1 | GO:0097512 | cardiac myofibril(GO:0097512) |
0.1 | 0.4 | GO:0001650 | fibrillar center(GO:0001650) |
0.1 | 0.3 | GO:0097542 | ciliary tip(GO:0097542) |
0.1 | 0.3 | GO:0070937 | CRD-mediated mRNA stability complex(GO:0070937) |
0.1 | 0.5 | GO:0070652 | HAUS complex(GO:0070652) |
0.1 | 0.2 | GO:0046691 | intracellular canaliculus(GO:0046691) |
0.1 | 0.7 | GO:0043240 | Fanconi anaemia nuclear complex(GO:0043240) |
0.1 | 1.1 | GO:0071011 | precatalytic spliceosome(GO:0071011) |
0.1 | 0.2 | GO:0031313 | extrinsic component of endosome membrane(GO:0031313) |
0.1 | 0.6 | GO:0000783 | telomere cap complex(GO:0000782) nuclear telomere cap complex(GO:0000783) |
0.1 | 0.2 | GO:0000110 | nucleotide-excision repair factor 1 complex(GO:0000110) |
0.1 | 2.1 | GO:0016592 | mediator complex(GO:0016592) |
0.1 | 0.9 | GO:0005665 | DNA-directed RNA polymerase II, core complex(GO:0005665) |
0.1 | 0.9 | GO:0000421 | autophagosome membrane(GO:0000421) |
0.1 | 0.2 | GO:0010009 | cytoplasmic side of endosome membrane(GO:0010009) |
0.1 | 0.3 | GO:0045254 | pyruvate dehydrogenase complex(GO:0045254) |
0.1 | 0.5 | GO:0005869 | dynactin complex(GO:0005869) |
0.1 | 0.4 | GO:0031415 | NatA complex(GO:0031415) |
0.1 | 0.2 | GO:0030956 | glutamyl-tRNA(Gln) amidotransferase complex(GO:0030956) |
0.1 | 0.2 | GO:0035749 | myelin sheath adaxonal region(GO:0035749) |
0.1 | 0.4 | GO:0034366 | spherical high-density lipoprotein particle(GO:0034366) |
0.1 | 0.6 | GO:0036513 | Derlin-1 retrotranslocation complex(GO:0036513) |
0.1 | 0.5 | GO:0071782 | endoplasmic reticulum tubular network(GO:0071782) |
0.1 | 0.7 | GO:0000242 | pericentriolar material(GO:0000242) |
0.1 | 0.1 | GO:0000811 | GINS complex(GO:0000811) |
0.1 | 0.2 | GO:0097504 | Gemini of coiled bodies(GO:0097504) |
0.1 | 0.7 | GO:0042581 | specific granule(GO:0042581) |
0.1 | 0.2 | GO:0071256 | Sec61 translocon complex(GO:0005784) translocon complex(GO:0071256) |
0.1 | 0.3 | GO:0030688 | preribosome, small subunit precursor(GO:0030688) |
0.1 | 0.1 | GO:0020018 | ciliary pocket(GO:0020016) ciliary pocket membrane(GO:0020018) |
0.1 | 0.6 | GO:0017119 | Golgi transport complex(GO:0017119) |
0.1 | 0.1 | GO:0002142 | stereocilia ankle link complex(GO:0002142) |
0.1 | 0.2 | GO:0043293 | apoptosome(GO:0043293) |
0.1 | 0.2 | GO:0061574 | ASAP complex(GO:0061574) |
0.1 | 0.2 | GO:0070761 | pre-snoRNP complex(GO:0070761) |
0.1 | 0.4 | GO:0000815 | ESCRT III complex(GO:0000815) |
0.1 | 0.1 | GO:0032444 | activin responsive factor complex(GO:0032444) |
0.1 | 0.2 | GO:0030015 | CCR4-NOT core complex(GO:0030015) |
0.1 | 0.2 | GO:0042612 | MHC class I protein complex(GO:0042612) |
0.1 | 0.7 | GO:0005942 | phosphatidylinositol 3-kinase complex(GO:0005942) |
0.1 | 0.8 | GO:0002080 | acrosomal membrane(GO:0002080) |
0.1 | 0.4 | GO:0097197 | tetraspanin-enriched microdomain(GO:0097197) |
0.1 | 0.1 | GO:0044233 | ER-mitochondrion membrane contact site(GO:0044233) |
0.1 | 0.2 | GO:0016602 | CCAAT-binding factor complex(GO:0016602) |
0.1 | 0.9 | GO:0031907 | peroxisomal matrix(GO:0005782) microbody lumen(GO:0031907) |
0.1 | 0.2 | GO:0012510 | trans-Golgi network transport vesicle membrane(GO:0012510) |
0.1 | 1.0 | GO:0005905 | clathrin-coated pit(GO:0005905) |
0.1 | 0.2 | GO:0044530 | supraspliceosomal complex(GO:0044530) |
0.1 | 0.6 | GO:0005847 | mRNA cleavage and polyadenylation specificity factor complex(GO:0005847) |
0.1 | 0.3 | GO:0031083 | BLOC-1 complex(GO:0031083) |
0.0 | 0.5 | GO:0072546 | ER membrane protein complex(GO:0072546) |
0.0 | 0.2 | GO:0008541 | proteasome regulatory particle, lid subcomplex(GO:0008541) |
0.0 | 0.5 | GO:0002199 | zona pellucida receptor complex(GO:0002199) |
0.0 | 0.2 | GO:0045252 | oxoglutarate dehydrogenase complex(GO:0045252) |
0.0 | 0.5 | GO:0016580 | Sin3 complex(GO:0016580) |
0.0 | 0.2 | GO:0098799 | outer mitochondrial membrane protein complex(GO:0098799) |
0.0 | 0.5 | GO:0030014 | CCR4-NOT complex(GO:0030014) |
0.0 | 2.9 | GO:0000776 | kinetochore(GO:0000776) |
0.0 | 0.8 | GO:1990204 | oxidoreductase complex(GO:1990204) |
0.0 | 0.1 | GO:0000812 | Swr1 complex(GO:0000812) |
0.0 | 0.2 | GO:0000275 | mitochondrial proton-transporting ATP synthase complex, catalytic core F(1)(GO:0000275) proton-transporting ATP synthase complex, catalytic core F(1)(GO:0045261) |
0.0 | 0.9 | GO:0030992 | intraciliary transport particle B(GO:0030992) |
0.0 | 0.9 | GO:0030119 | AP-type membrane coat adaptor complex(GO:0030119) |
0.0 | 0.1 | GO:0000814 | ESCRT II complex(GO:0000814) |
0.0 | 0.5 | GO:0035102 | PRC1 complex(GO:0035102) |
0.0 | 2.0 | GO:0000118 | histone deacetylase complex(GO:0000118) |
0.0 | 0.1 | GO:0005652 | nuclear lamina(GO:0005652) |
0.0 | 0.1 | GO:0042827 | platelet dense granule(GO:0042827) |
0.0 | 0.4 | GO:0031371 | ubiquitin conjugating enzyme complex(GO:0031371) |
0.0 | 0.3 | GO:0072669 | tRNA-splicing ligase complex(GO:0072669) |
0.0 | 0.4 | GO:0045263 | proton-transporting ATP synthase complex, coupling factor F(o)(GO:0045263) |
0.0 | 1.6 | GO:0000315 | organellar large ribosomal subunit(GO:0000315) mitochondrial large ribosomal subunit(GO:0005762) |
0.0 | 0.1 | GO:0005853 | eukaryotic translation elongation factor 1 complex(GO:0005853) |
0.0 | 0.3 | GO:0019773 | proteasome core complex, alpha-subunit complex(GO:0019773) |
0.0 | 2.5 | GO:0016363 | nuclear matrix(GO:0016363) |
0.0 | 1.3 | GO:0009295 | nucleoid(GO:0009295) mitochondrial nucleoid(GO:0042645) |
0.0 | 0.5 | GO:0008540 | proteasome regulatory particle, base subcomplex(GO:0008540) |
0.0 | 0.4 | GO:0002116 | semaphorin receptor complex(GO:0002116) |
0.0 | 0.6 | GO:0071339 | MLL1/2 complex(GO:0044665) MLL1 complex(GO:0071339) |
0.0 | 0.3 | GO:0031010 | ISWI-type complex(GO:0031010) |
0.0 | 1.2 | GO:0005891 | voltage-gated calcium channel complex(GO:0005891) |
0.0 | 0.5 | GO:0046930 | pore complex(GO:0046930) |
0.0 | 0.1 | GO:0043527 | tRNA methyltransferase complex(GO:0043527) |
0.0 | 0.3 | GO:0031462 | Cul2-RING ubiquitin ligase complex(GO:0031462) |
0.0 | 0.1 | GO:0097452 | GAIT complex(GO:0097452) |
0.0 | 0.2 | GO:0030127 | COPII vesicle coat(GO:0030127) |
0.0 | 1.6 | GO:0000123 | histone acetyltransferase complex(GO:0000123) |
0.0 | 0.2 | GO:1990745 | EARP complex(GO:1990745) |
0.0 | 1.0 | GO:0000152 | nuclear ubiquitin ligase complex(GO:0000152) |
0.0 | 0.7 | GO:0030904 | retromer complex(GO:0030904) |
0.0 | 0.3 | GO:0035631 | CD40 receptor complex(GO:0035631) |
0.0 | 0.2 | GO:0032437 | cuticular plate(GO:0032437) |
0.0 | 0.1 | GO:0043625 | delta DNA polymerase complex(GO:0043625) |
0.0 | 0.2 | GO:0031254 | uropod(GO:0001931) cell trailing edge(GO:0031254) |
0.0 | 0.2 | GO:0051233 | spindle midzone(GO:0051233) |
0.0 | 0.4 | GO:0035861 | site of double-strand break(GO:0035861) |
0.0 | 0.2 | GO:0071438 | invadopodium membrane(GO:0071438) |
0.0 | 0.5 | GO:0031528 | microvillus membrane(GO:0031528) |
0.0 | 3.3 | GO:0005759 | mitochondrial matrix(GO:0005759) |
0.0 | 0.2 | GO:0030134 | ER to Golgi transport vesicle(GO:0030134) |
0.0 | 0.3 | GO:0000346 | transcription export complex(GO:0000346) |
0.0 | 0.3 | GO:0008385 | IkappaB kinase complex(GO:0008385) |
0.0 | 1.3 | GO:0005795 | Golgi stack(GO:0005795) |
0.0 | 11.4 | GO:0005743 | mitochondrial inner membrane(GO:0005743) |
0.0 | 0.0 | GO:0097422 | tubular endosome(GO:0097422) |
0.0 | 0.0 | GO:0036488 | CHOP-C/EBP complex(GO:0036488) |
0.0 | 0.1 | GO:0032937 | SREBP-SCAP-Insig complex(GO:0032937) |
0.0 | 0.4 | GO:0000407 | pre-autophagosomal structure(GO:0000407) |
0.0 | 0.2 | GO:0033256 | I-kappaB/NF-kappaB complex(GO:0033256) |
0.0 | 0.8 | GO:0031941 | filamentous actin(GO:0031941) |
0.0 | 1.1 | GO:0017053 | transcriptional repressor complex(GO:0017053) |
0.0 | 0.2 | GO:0005796 | Golgi lumen(GO:0005796) |
0.0 | 1.7 | GO:0005811 | lipid particle(GO:0005811) |
0.0 | 0.8 | GO:0030660 | Golgi-associated vesicle membrane(GO:0030660) |
0.0 | 0.3 | GO:0032806 | holo TFIIH complex(GO:0005675) carboxy-terminal domain protein kinase complex(GO:0032806) |
0.0 | 0.0 | GO:0042585 | germinal vesicle(GO:0042585) |
0.0 | 0.7 | GO:0055038 | recycling endosome membrane(GO:0055038) |
0.0 | 0.0 | GO:0032585 | multivesicular body membrane(GO:0032585) |
0.0 | 4.4 | GO:0000139 | Golgi membrane(GO:0000139) |
0.0 | 0.1 | GO:0071141 | SMAD protein complex(GO:0071141) |
0.0 | 0.2 | GO:0032797 | SMN complex(GO:0032797) |
0.0 | 0.1 | GO:0043203 | axon hillock(GO:0043203) |
0.0 | 0.1 | GO:0016939 | kinesin II complex(GO:0016939) |
0.0 | 0.9 | GO:0032040 | small-subunit processome(GO:0032040) |
0.0 | 1.3 | GO:0044439 | microbody part(GO:0044438) peroxisomal part(GO:0044439) |
0.0 | 0.4 | GO:0005666 | DNA-directed RNA polymerase III complex(GO:0005666) |
0.0 | 0.1 | GO:0090661 | box H/ACA telomerase RNP complex(GO:0090661) |
0.0 | 0.2 | GO:0005840 | ribosome(GO:0005840) |
0.0 | 0.9 | GO:0045171 | intercellular bridge(GO:0045171) |
0.0 | 0.5 | GO:0005876 | spindle microtubule(GO:0005876) |
0.0 | 0.2 | GO:0030915 | Smc5-Smc6 complex(GO:0030915) |
0.0 | 0.1 | GO:0000931 | gamma-tubulin large complex(GO:0000931) gamma-tubulin ring complex(GO:0008274) |
0.0 | 0.3 | GO:0046540 | U4/U6 x U5 tri-snRNP complex(GO:0046540) |
0.0 | 0.2 | GO:0005736 | DNA-directed RNA polymerase I complex(GO:0005736) |
0.0 | 0.2 | GO:0070971 | endoplasmic reticulum exit site(GO:0070971) |
0.0 | 0.2 | GO:0005849 | mRNA cleavage factor complex(GO:0005849) |
0.0 | 0.3 | GO:0000930 | gamma-tubulin complex(GO:0000930) |
0.0 | 0.1 | GO:0044232 | organelle membrane contact site(GO:0044232) |
0.0 | 0.1 | GO:0000805 | X chromosome(GO:0000805) |
0.0 | 0.1 | GO:0032299 | ribonuclease H2 complex(GO:0032299) |
0.0 | 0.3 | GO:0071541 | eukaryotic translation initiation factor 3 complex, eIF3m(GO:0071541) |
0.0 | 0.1 | GO:0097169 | AIM2 inflammasome complex(GO:0097169) |
0.0 | 0.9 | GO:0000775 | chromosome, centromeric region(GO:0000775) |
0.0 | 0.3 | GO:0071006 | U2-type catalytic step 1 spliceosome(GO:0071006) |
0.0 | 0.2 | GO:0031588 | nucleotide-activated protein kinase complex(GO:0031588) |
0.0 | 0.1 | GO:0072557 | IPAF inflammasome complex(GO:0072557) |
0.0 | 0.1 | GO:0030125 | clathrin vesicle coat(GO:0030125) |
0.0 | 0.2 | GO:0035253 | ciliary rootlet(GO:0035253) |
0.0 | 0.4 | GO:0000178 | exosome (RNase complex)(GO:0000178) |
0.0 | 0.3 | GO:0033177 | proton-transporting two-sector ATPase complex, proton-transporting domain(GO:0033177) |
0.0 | 0.2 | GO:0016600 | flotillin complex(GO:0016600) |
0.0 | 0.2 | GO:0042622 | photoreceptor outer segment membrane(GO:0042622) |
0.0 | 0.1 | GO:0030897 | HOPS complex(GO:0030897) |
0.0 | 0.1 | GO:0030896 | checkpoint clamp complex(GO:0030896) |
0.0 | 0.3 | GO:0030687 | preribosome, large subunit precursor(GO:0030687) |
0.0 | 1.0 | GO:0022627 | cytosolic small ribosomal subunit(GO:0022627) |
0.0 | 0.1 | GO:0071204 | histone pre-mRNA 3'end processing complex(GO:0071204) |
0.0 | 0.1 | GO:0031264 | death-inducing signaling complex(GO:0031264) |
0.0 | 1.9 | GO:0022625 | cytosolic large ribosomal subunit(GO:0022625) |
0.0 | 0.5 | GO:0005657 | replication fork(GO:0005657) |
0.0 | 0.2 | GO:0032591 | dendritic spine membrane(GO:0032591) |
0.0 | 2.9 | GO:0016604 | nuclear body(GO:0016604) |
0.0 | 0.2 | GO:0042555 | MCM complex(GO:0042555) |
0.0 | 0.1 | GO:0071008 | U2-type post-mRNA release spliceosomal complex(GO:0071008) |
0.0 | 0.2 | GO:0035327 | transcriptionally active chromatin(GO:0035327) |
0.0 | 0.5 | GO:0090544 | BAF-type complex(GO:0090544) |
0.0 | 0.4 | GO:0005719 | nuclear euchromatin(GO:0005719) |
0.0 | 0.1 | GO:0002177 | manchette(GO:0002177) |
0.0 | 0.9 | GO:0000922 | spindle pole(GO:0000922) |
0.0 | 0.2 | GO:0032426 | stereocilium tip(GO:0032426) |
0.0 | 0.0 | GO:0000938 | GARP complex(GO:0000938) |
0.0 | 0.7 | GO:0030880 | RNA polymerase complex(GO:0030880) |
0.0 | 0.2 | GO:0008074 | guanylate cyclase complex, soluble(GO:0008074) |
0.0 | 0.3 | GO:0000159 | protein phosphatase type 2A complex(GO:0000159) |
0.0 | 0.1 | GO:0097524 | sperm plasma membrane(GO:0097524) |
0.0 | 0.4 | GO:0031901 | early endosome membrane(GO:0031901) |
0.0 | 0.1 | GO:0005879 | axonemal microtubule(GO:0005879) |
0.0 | 0.3 | GO:0016234 | inclusion body(GO:0016234) |
0.0 | 0.0 | GO:0005832 | chaperonin-containing T-complex(GO:0005832) |
0.0 | 0.5 | GO:0000932 | cytoplasmic mRNA processing body(GO:0000932) |
0.0 | 0.4 | GO:0015030 | Cajal body(GO:0015030) |
0.0 | 0.1 | GO:0097025 | MPP7-DLG1-LIN7 complex(GO:0097025) |
0.0 | 0.5 | GO:0000502 | proteasome complex(GO:0000502) |
0.0 | 23.2 | GO:0005739 | mitochondrion(GO:0005739) |
0.0 | 0.0 | GO:0098553 | integral component of cytoplasmic side of endoplasmic reticulum membrane(GO:0071458) integral component of lumenal side of endoplasmic reticulum membrane(GO:0071556) lumenal side of endoplasmic reticulum membrane(GO:0098553) lumenal side of membrane(GO:0098576) |
0.0 | 0.1 | GO:0033093 | Weibel-Palade body(GO:0033093) |
0.0 | 0.5 | GO:0044815 | DNA packaging complex(GO:0044815) |
0.0 | 0.1 | GO:0042406 | extrinsic component of endoplasmic reticulum membrane(GO:0042406) |
0.0 | 0.0 | GO:0030478 | actin cap(GO:0030478) |
0.0 | 1.0 | GO:0005777 | peroxisome(GO:0005777) microbody(GO:0042579) |
0.0 | 0.3 | GO:0005776 | autophagosome(GO:0005776) |
0.0 | 0.1 | GO:0035355 | Toll-like receptor 2-Toll-like receptor 6 protein complex(GO:0035355) |
0.0 | 0.0 | GO:0045293 | mRNA editing complex(GO:0045293) |
0.0 | 0.2 | GO:0035145 | exon-exon junction complex(GO:0035145) |
0.0 | 0.3 | GO:0034364 | high-density lipoprotein particle(GO:0034364) |
0.0 | 0.0 | GO:0031429 | box H/ACA snoRNP complex(GO:0031429) box H/ACA RNP complex(GO:0072588) |
0.0 | 0.5 | GO:0005681 | spliceosomal complex(GO:0005681) |
0.0 | 1.3 | GO:0030176 | integral component of endoplasmic reticulum membrane(GO:0030176) |
0.0 | 0.3 | GO:0000781 | chromosome, telomeric region(GO:0000781) |
0.0 | 0.1 | GO:0097427 | microtubule bundle(GO:0097427) |
0.0 | 0.9 | GO:0016328 | lateral plasma membrane(GO:0016328) |
0.0 | 0.0 | GO:0089701 | U2AF(GO:0089701) |
0.0 | 0.1 | GO:0060091 | kinocilium(GO:0060091) |
0.0 | 0.0 | GO:0034709 | methylosome(GO:0034709) |
0.0 | 0.1 | GO:0000808 | origin recognition complex(GO:0000808) nuclear origin of replication recognition complex(GO:0005664) |
0.0 | 0.2 | GO:0042599 | lamellar body(GO:0042599) |
0.0 | 0.0 | GO:0033648 | host intracellular organelle(GO:0033647) host intracellular membrane-bounded organelle(GO:0033648) |
0.0 | 0.7 | GO:0071013 | catalytic step 2 spliceosome(GO:0071013) |
0.0 | 0.0 | GO:0071439 | clathrin complex(GO:0071439) |
0.0 | 0.0 | GO:0000798 | nuclear cohesin complex(GO:0000798) |
0.0 | 0.1 | GO:0031232 | extrinsic component of external side of plasma membrane(GO:0031232) |
0.0 | 0.1 | GO:0030684 | preribosome(GO:0030684) |
0.0 | 0.0 | GO:0035189 | Rb-E2F complex(GO:0035189) |
0.0 | 0.1 | GO:0035859 | Seh1-associated complex(GO:0035859) |
0.0 | 0.0 | GO:0098827 | endoplasmic reticulum subcompartment(GO:0098827) |
0.0 | 0.1 | GO:0044452 | nucleolar part(GO:0044452) |
0.0 | 0.1 | GO:0005839 | proteasome core complex(GO:0005839) |
0.0 | 0.0 | GO:0008278 | cohesin complex(GO:0008278) |
0.0 | 0.3 | GO:0031519 | PcG protein complex(GO:0031519) |
0.0 | 0.3 | GO:1902555 | endoribonuclease complex(GO:1902555) |
0.0 | 0.2 | GO:0000792 | heterochromatin(GO:0000792) |
0.0 | 0.1 | GO:0033180 | proton-transporting V-type ATPase, V1 domain(GO:0033180) |
0.0 | 0.1 | GO:0005914 | spot adherens junction(GO:0005914) |
0.0 | 0.1 | GO:0097440 | apical dendrite(GO:0097440) |
0.0 | 0.9 | GO:0031463 | Cul3-RING ubiquitin ligase complex(GO:0031463) |
0.0 | 0.4 | GO:0055037 | recycling endosome(GO:0055037) |
0.0 | 4.5 | GO:0000323 | lytic vacuole(GO:0000323) lysosome(GO:0005764) |
0.0 | 0.3 | GO:0000795 | synaptonemal complex(GO:0000795) |
0.0 | 0.2 | GO:0005885 | Arp2/3 protein complex(GO:0005885) |
0.0 | 0.4 | GO:0031201 | SNARE complex(GO:0031201) |
0.0 | 0.4 | GO:0019866 | organelle inner membrane(GO:0019866) |
0.0 | 0.7 | GO:0005814 | centriole(GO:0005814) |
0.0 | 1.4 | GO:0000151 | ubiquitin ligase complex(GO:0000151) |
0.0 | 0.6 | GO:0005834 | heterotrimeric G-protein complex(GO:0005834) |
0.0 | 0.0 | GO:0031523 | Myb complex(GO:0031523) |
0.0 | 0.0 | GO:0044393 | microspike(GO:0044393) |
0.0 | 12.8 | GO:0005829 | cytosol(GO:0005829) |
0.0 | 0.1 | GO:0005732 | small nucleolar ribonucleoprotein complex(GO:0005732) |
0.0 | 0.0 | GO:0030312 | external encapsulating structure(GO:0030312) |
0.0 | 0.0 | GO:0000408 | EKC/KEOPS complex(GO:0000408) |
0.0 | 1.0 | GO:0012506 | vesicle membrane(GO:0012506) |
0.0 | 1.2 | GO:0072562 | blood microparticle(GO:0072562) |
0.0 | 0.0 | GO:0033185 | dolichol-phosphate-mannose synthase complex(GO:0033185) |
0.0 | 0.2 | GO:0000793 | condensed chromosome(GO:0000793) |
0.0 | 0.0 | GO:0030132 | clathrin coat of coated pit(GO:0030132) |
0.0 | 0.1 | GO:0034399 | nuclear periphery(GO:0034399) |
0.0 | 0.2 | GO:0044295 | axonal growth cone(GO:0044295) |
0.0 | 0.0 | GO:0031512 | motile primary cilium(GO:0031512) |
0.0 | 0.3 | GO:0005793 | endoplasmic reticulum-Golgi intermediate compartment(GO:0005793) |
0.0 | 0.2 | GO:0005801 | cis-Golgi network(GO:0005801) |
0.0 | 10.3 | GO:0005654 | nucleoplasm(GO:0005654) |
0.0 | 0.3 | GO:0008305 | integrin complex(GO:0008305) |
0.0 | 0.2 | GO:0001772 | immunological synapse(GO:0001772) |
0.0 | 0.0 | GO:0044299 | C-fiber(GO:0044299) |
0.0 | 0.1 | GO:0097449 | astrocyte projection(GO:0097449) |
0.0 | 0.1 | GO:0005798 | Golgi-associated vesicle(GO:0005798) |
0.0 | 0.3 | GO:0005791 | rough endoplasmic reticulum(GO:0005791) |
0.0 | 0.1 | GO:0008250 | oligosaccharyltransferase complex(GO:0008250) |
0.0 | 0.0 | GO:0031501 | mannosyltransferase complex(GO:0031501) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.6 | 1.9 | GO:0102007 | lactonohydrolase activity(GO:0046573) acyl-L-homoserine-lactone lactonohydrolase activity(GO:0102007) |
0.4 | 1.1 | GO:0001069 | regulatory region RNA binding(GO:0001069) |
0.3 | 2.4 | GO:0003836 | beta-galactoside (CMP) alpha-2,3-sialyltransferase activity(GO:0003836) |
0.3 | 1.0 | GO:0071535 | RING-like zinc finger domain binding(GO:0071535) |
0.3 | 1.3 | GO:0035615 | clathrin adaptor activity(GO:0035615) endocytic adaptor activity(GO:0098748) |
0.3 | 1.5 | GO:0017169 | CDP-alcohol phosphatidyltransferase activity(GO:0017169) |
0.3 | 0.9 | GO:0001226 | RNA polymerase II transcription corepressor binding(GO:0001226) |
0.3 | 1.1 | GO:0004558 | alpha-1,4-glucosidase activity(GO:0004558) |
0.3 | 0.5 | GO:0034040 | lipid-transporting ATPase activity(GO:0034040) |
0.3 | 0.5 | GO:0004694 | eukaryotic translation initiation factor 2alpha kinase activity(GO:0004694) |
0.3 | 1.0 | GO:0033300 | dehydroascorbic acid transporter activity(GO:0033300) |
0.3 | 1.0 | GO:0019788 | NEDD8 transferase activity(GO:0019788) |
0.3 | 1.0 | GO:0015220 | choline transmembrane transporter activity(GO:0015220) |
0.2 | 1.0 | GO:0004740 | pyruvate dehydrogenase (acetyl-transferring) kinase activity(GO:0004740) |
0.2 | 1.5 | GO:0004768 | stearoyl-CoA 9-desaturase activity(GO:0004768) |
0.2 | 0.7 | GO:0004064 | arylesterase activity(GO:0004064) |
0.2 | 0.7 | GO:0032137 | guanine/thymine mispair binding(GO:0032137) |
0.2 | 0.7 | GO:0004724 | magnesium-dependent protein serine/threonine phosphatase activity(GO:0004724) |
0.2 | 0.7 | GO:0043125 | ErbB-3 class receptor binding(GO:0043125) |
0.2 | 0.7 | GO:0019237 | centromeric DNA binding(GO:0019237) |
0.2 | 0.7 | GO:0047276 | N-acetyllactosaminide 3-alpha-galactosyltransferase activity(GO:0047276) |
0.2 | 1.4 | GO:0005225 | volume-sensitive anion channel activity(GO:0005225) |
0.2 | 1.1 | GO:0015562 | efflux transmembrane transporter activity(GO:0015562) |
0.2 | 0.6 | GO:0016262 | protein N-acetylglucosaminyltransferase activity(GO:0016262) |
0.2 | 0.6 | GO:0035175 | histone kinase activity (H3-S10 specific)(GO:0035175) |
0.2 | 0.8 | GO:0071987 | WD40-repeat domain binding(GO:0071987) |
0.2 | 0.6 | GO:0004616 | phosphogluconate dehydrogenase (decarboxylating) activity(GO:0004616) |
0.2 | 2.2 | GO:0005388 | calcium-transporting ATPase activity(GO:0005388) |
0.2 | 0.6 | GO:0003986 | acetyl-CoA hydrolase activity(GO:0003986) |
0.2 | 0.8 | GO:0042731 | PH domain binding(GO:0042731) |
0.2 | 0.6 | GO:0030350 | iron-responsive element binding(GO:0030350) |
0.2 | 0.6 | GO:0004719 | protein-L-isoaspartate (D-aspartate) O-methyltransferase activity(GO:0004719) |
0.2 | 0.7 | GO:0070053 | thrombospondin receptor activity(GO:0070053) |
0.2 | 1.1 | GO:0008199 | ferric iron binding(GO:0008199) |
0.2 | 0.7 | GO:0019158 | fructokinase activity(GO:0008865) mannokinase activity(GO:0019158) |
0.2 | 0.9 | GO:0019911 | structural constituent of myelin sheath(GO:0019911) |
0.2 | 1.6 | GO:0015187 | glycine transmembrane transporter activity(GO:0015187) |
0.2 | 1.3 | GO:0005078 | MAP-kinase scaffold activity(GO:0005078) |
0.2 | 0.7 | GO:0004792 | thiosulfate sulfurtransferase activity(GO:0004792) |
0.2 | 0.5 | GO:0016647 | oxidoreductase activity, acting on the CH-NH group of donors, oxygen as acceptor(GO:0016647) |
0.2 | 0.5 | GO:0004829 | threonine-tRNA ligase activity(GO:0004829) |
0.2 | 1.6 | GO:0004438 | phosphatidylinositol-3-phosphatase activity(GO:0004438) |
0.2 | 0.9 | GO:0019784 | NEDD8-specific protease activity(GO:0019784) |
0.2 | 0.3 | GO:0016634 | oxidoreductase activity, acting on the CH-CH group of donors, oxygen as acceptor(GO:0016634) |
0.2 | 0.7 | GO:0031720 | haptoglobin binding(GO:0031720) |
0.2 | 0.7 | GO:0019136 | deoxynucleoside kinase activity(GO:0019136) |
0.2 | 0.7 | GO:0000386 | second spliceosomal transesterification activity(GO:0000386) |
0.2 | 0.8 | GO:0004791 | thioredoxin-disulfide reductase activity(GO:0004791) |
0.2 | 0.2 | GO:0009041 | uridylate kinase activity(GO:0009041) |
0.2 | 0.3 | GO:0043842 | Kdo transferase activity(GO:0043842) |
0.2 | 0.5 | GO:0061731 | ribonucleoside-diphosphate reductase activity, thioredoxin disulfide as acceptor(GO:0004748) oxidoreductase activity, acting on CH or CH2 groups, disulfide as acceptor(GO:0016728) ribonucleoside-diphosphate reductase activity(GO:0061731) |
0.2 | 1.0 | GO:0008603 | cAMP-dependent protein kinase regulator activity(GO:0008603) |
0.2 | 0.9 | GO:0004169 | dolichyl-phosphate-mannose-protein mannosyltransferase activity(GO:0004169) |
0.2 | 0.5 | GO:0050833 | pyruvate transmembrane transporter activity(GO:0050833) |
0.2 | 0.6 | GO:0000293 | ferric-chelate reductase activity(GO:0000293) |
0.2 | 0.8 | GO:0030292 | protein tyrosine kinase inhibitor activity(GO:0030292) |
0.2 | 0.6 | GO:0043515 | kinetochore binding(GO:0043515) |
0.2 | 0.6 | GO:0031727 | CCR2 chemokine receptor binding(GO:0031727) |
0.2 | 0.8 | GO:0009378 | four-way junction helicase activity(GO:0009378) |
0.1 | 0.9 | GO:0003910 | DNA ligase activity(GO:0003909) DNA ligase (ATP) activity(GO:0003910) |
0.1 | 0.7 | GO:0019960 | C-X3-C chemokine binding(GO:0019960) |
0.1 | 0.4 | GO:0008515 | sucrose:proton symporter activity(GO:0008506) sucrose transmembrane transporter activity(GO:0008515) disaccharide transmembrane transporter activity(GO:0015154) oligosaccharide transmembrane transporter activity(GO:0015157) |
0.1 | 1.8 | GO:0016780 | phosphotransferase activity, for other substituted phosphate groups(GO:0016780) |
0.1 | 1.0 | GO:0034785 | 3-(3-hydroxyphenyl)propionate hydroxylase activity(GO:0008688) 4-chlorobenzaldehyde oxidase activity(GO:0018471) 3,5-xylenol methylhydroxylase activity(GO:0018630) phenylacetate hydroxylase activity(GO:0018631) 4-nitrophenol 4-monooxygenase activity(GO:0018632) dimethyl sulfide monooxygenase activity(GO:0018633) alpha-pinene monooxygenase [NADH] activity(GO:0018634) 1-hydroxy-2-naphthoate hydroxylase activity(GO:0018637) toluene 4-monooxygenase activity(GO:0018638) xylene monooxygenase activity(GO:0018639) dibenzothiophene monooxygenase activity(GO:0018640) 6-hydroxy-3-methyl-2-oxo-1,2-dihydroquinoline 6-monooxygenase activity(GO:0018641) chlorophenol 4-monooxygenase activity(GO:0018642) carbon disulfide oxygenase activity(GO:0018643) toluene 2-monooxygenase activity(GO:0018644) 1-hydroxy-2-oxolimonene 1,2-monooxygenase activity(GO:0018646) phenanthrene 1,2-monooxygenase activity(GO:0018647) tetrahydrofuran hydroxylase activity(GO:0018649) styrene monooxygenase activity(GO:0018650) toluene-4-sulfonate monooxygenase activity(GO:0018651) toluene-sulfonate methyl-monooxygenase activity(GO:0018652) 3-methyl-2-oxo-1,2-dihydroquinoline 6-monooxygenase activity(GO:0018653) 2-hydroxy-phenylacetate hydroxylase activity(GO:0018654) 2-oxo-delta3-4,5,5-trimethylcyclopentenylacetyl-CoA 1,2-monooxygenase activity(GO:0018655) phenanthrene 3,4-monooxygenase activity(GO:0018656) toluene 3-monooxygenase activity(GO:0018657) 4-hydroxyphenylacetate,NADH:oxygen oxidoreductase (3-hydroxylating) activity(GO:0018660) limonene monooxygenase activity(GO:0019113) 2-methylnaphthalene hydroxylase activity(GO:0034526) 1-methylnaphthalene hydroxylase activity(GO:0034534) bisphenol A hydroxylase A activity(GO:0034560) salicylate 5-hydroxylase activity(GO:0034785) isobutylamine N-hydroxylase activity(GO:0034791) branched-chain dodecylbenzene sulfonate monooxygenase activity(GO:0034802) 3-HSA hydroxylase activity(GO:0034819) 4-hydroxypyridine-3-hydroxylase activity(GO:0034894) 2-octaprenyl-3-methyl-6-methoxy-1,4-benzoquinol hydroxylase activity(GO:0043719) 6-hydroxynicotinate 3-monooxygenase activity(GO:0043731) thalianol hydroxylase activity(GO:0080014) |
0.1 | 1.6 | GO:0015250 | water channel activity(GO:0015250) |
0.1 | 1.4 | GO:0008641 | small protein activating enzyme activity(GO:0008641) |
0.1 | 0.5 | GO:0004095 | carnitine O-palmitoyltransferase activity(GO:0004095) |
0.1 | 2.0 | GO:0070577 | lysine-acetylated histone binding(GO:0070577) |
0.1 | 0.5 | GO:0071074 | eukaryotic initiation factor eIF2 binding(GO:0071074) |
0.1 | 0.4 | GO:0042296 | ISG15 transferase activity(GO:0042296) |
0.1 | 0.3 | GO:0043423 | 3-phosphoinositide-dependent protein kinase binding(GO:0043423) |
0.1 | 0.9 | GO:0050072 | m7G(5')pppN diphosphatase activity(GO:0050072) |
0.1 | 0.9 | GO:0000150 | recombinase activity(GO:0000150) |
0.1 | 0.6 | GO:0046934 | phosphatidylinositol-4,5-bisphosphate 3-kinase activity(GO:0046934) |
0.1 | 0.4 | GO:0061676 | importin-alpha family protein binding(GO:0061676) |
0.1 | 0.6 | GO:0035612 | AP-2 adaptor complex binding(GO:0035612) |
0.1 | 0.4 | GO:0050508 | glucuronosyl-N-acetylglucosaminyl-proteoglycan 4-alpha-N-acetylglucosaminyltransferase activity(GO:0050508) |
0.1 | 1.1 | GO:0016004 | phospholipase activator activity(GO:0016004) |
0.1 | 1.1 | GO:0019869 | chloride channel inhibitor activity(GO:0019869) |
0.1 | 0.4 | GO:0019776 | Atg8 ligase activity(GO:0019776) |
0.1 | 0.4 | GO:0086056 | voltage-gated calcium channel activity involved in AV node cell action potential(GO:0086056) |
0.1 | 0.6 | GO:0030983 | mismatched DNA binding(GO:0030983) |
0.1 | 1.1 | GO:0016846 | carbon-sulfur lyase activity(GO:0016846) |
0.1 | 1.1 | GO:0009931 | calcium-dependent protein serine/threonine kinase activity(GO:0009931) |
0.1 | 0.6 | GO:1990380 | Lys48-specific deubiquitinase activity(GO:1990380) |
0.1 | 0.4 | GO:0032422 | purine-rich negative regulatory element binding(GO:0032422) |
0.1 | 0.5 | GO:0019145 | aminobutyraldehyde dehydrogenase activity(GO:0019145) 4-trimethylammoniobutyraldehyde dehydrogenase activity(GO:0047105) |
0.1 | 0.4 | GO:2001070 | starch binding(GO:2001070) |
0.1 | 0.3 | GO:1990460 | leptin receptor binding(GO:1990460) |
0.1 | 0.2 | GO:0019789 | SUMO transferase activity(GO:0019789) |
0.1 | 0.3 | GO:0016972 | thiol oxidase activity(GO:0016972) |
0.1 | 0.9 | GO:0071933 | Arp2/3 complex binding(GO:0071933) |
0.1 | 0.5 | GO:0008273 | calcium, potassium:sodium antiporter activity(GO:0008273) |
0.1 | 0.3 | GO:0004487 | methenyltetrahydrofolate cyclohydrolase activity(GO:0004477) methylenetetrahydrofolate dehydrogenase (NAD+) activity(GO:0004487) |
0.1 | 0.7 | GO:0016151 | nickel cation binding(GO:0016151) |
0.1 | 0.3 | GO:0004939 | beta-adrenergic receptor activity(GO:0004939) |
0.1 | 0.5 | GO:0017162 | aryl hydrocarbon receptor binding(GO:0017162) |
0.1 | 1.9 | GO:0004708 | MAP kinase kinase activity(GO:0004708) |
0.1 | 0.4 | GO:0016286 | small conductance calcium-activated potassium channel activity(GO:0016286) |
0.1 | 2.5 | GO:0005385 | zinc ion transmembrane transporter activity(GO:0005385) |
0.1 | 0.4 | GO:0016997 | exo-alpha-sialidase activity(GO:0004308) alpha-sialidase activity(GO:0016997) exo-alpha-(2->3)-sialidase activity(GO:0052794) exo-alpha-(2->6)-sialidase activity(GO:0052795) exo-alpha-(2->8)-sialidase activity(GO:0052796) |
0.1 | 0.3 | GO:0004739 | pyruvate dehydrogenase (acetyl-transferring) activity(GO:0004739) |
0.1 | 0.4 | GO:0030229 | very-low-density lipoprotein particle receptor activity(GO:0030229) |
0.1 | 0.3 | GO:0004165 | dodecenoyl-CoA delta-isomerase activity(GO:0004165) |
0.1 | 0.1 | GO:0030984 | kininogen binding(GO:0030984) |
0.1 | 3.1 | GO:0017112 | Rab guanyl-nucleotide exchange factor activity(GO:0017112) |
0.1 | 0.3 | GO:0004300 | enoyl-CoA hydratase activity(GO:0004300) |
0.1 | 0.5 | GO:0004726 | non-membrane spanning protein tyrosine phosphatase activity(GO:0004726) |
0.1 | 0.5 | GO:0004689 | phosphorylase kinase activity(GO:0004689) |
0.1 | 0.2 | GO:0031721 | hemoglobin alpha binding(GO:0031721) |
0.1 | 0.8 | GO:0004571 | mannosyl-oligosaccharide 1,2-alpha-mannosidase activity(GO:0004571) |
0.1 | 0.9 | GO:0033170 | DNA clamp loader activity(GO:0003689) protein-DNA loading ATPase activity(GO:0033170) |
0.1 | 0.3 | GO:0016635 | oxidoreductase activity, acting on the CH-CH group of donors, quinone or related compound as acceptor(GO:0016635) |
0.1 | 0.6 | GO:0016423 | tRNA (guanine) methyltransferase activity(GO:0016423) |
0.1 | 0.3 | GO:0051425 | PTB domain binding(GO:0051425) |
0.1 | 0.5 | GO:0004769 | steroid delta-isomerase activity(GO:0004769) |
0.1 | 0.6 | GO:0004679 | AMP-activated protein kinase activity(GO:0004679) |
0.1 | 1.0 | GO:0015129 | lactate transmembrane transporter activity(GO:0015129) |
0.1 | 0.4 | GO:0052650 | NADP-retinol dehydrogenase activity(GO:0052650) |
0.1 | 1.3 | GO:0048156 | tau protein binding(GO:0048156) |
0.1 | 0.3 | GO:0016309 | 1-phosphatidylinositol-5-phosphate 4-kinase activity(GO:0016309) |
0.1 | 0.6 | GO:1990247 | N6-methyladenosine-containing RNA binding(GO:1990247) |
0.1 | 0.3 | GO:0050816 | phosphothreonine binding(GO:0050816) |
0.1 | 0.3 | GO:0035174 | histone serine kinase activity(GO:0035174) |
0.1 | 1.7 | GO:0015035 | protein disulfide oxidoreductase activity(GO:0015035) |
0.1 | 0.2 | GO:0015563 | uptake transmembrane transporter activity(GO:0015563) |
0.1 | 0.4 | GO:0031404 | chloride ion binding(GO:0031404) |
0.1 | 0.7 | GO:0043047 | single-stranded telomeric DNA binding(GO:0043047) |
0.1 | 0.3 | GO:0016508 | long-chain-enoyl-CoA hydratase activity(GO:0016508) |
0.1 | 0.7 | GO:0070181 | small ribosomal subunit rRNA binding(GO:0070181) |
0.1 | 0.4 | GO:0004468 | lysine N-acetyltransferase activity, acting on acetyl phosphate as donor(GO:0004468) |
0.1 | 0.8 | GO:0008568 | microtubule-severing ATPase activity(GO:0008568) |
0.1 | 0.3 | GO:0005220 | inositol 1,4,5-trisphosphate-sensitive calcium-release channel activity(GO:0005220) |
0.1 | 0.2 | GO:0031802 | type 5 metabotropic glutamate receptor binding(GO:0031802) |
0.1 | 0.4 | GO:0031078 | histone deacetylase activity (H3-K14 specific)(GO:0031078) NAD-dependent histone deacetylase activity (H3-K14 specific)(GO:0032041) |
0.1 | 0.5 | GO:0031730 | CCR5 chemokine receptor binding(GO:0031730) |
0.1 | 0.9 | GO:0004602 | glutathione peroxidase activity(GO:0004602) |
0.1 | 1.2 | GO:0016493 | C-C chemokine receptor activity(GO:0016493) |
0.1 | 0.3 | GO:0017116 | single-stranded DNA-dependent ATP-dependent DNA helicase activity(GO:0017116) |
0.1 | 0.3 | GO:0015111 | iodide transmembrane transporter activity(GO:0015111) |
0.1 | 0.3 | GO:0005250 | A-type (transient outward) potassium channel activity(GO:0005250) |
0.1 | 0.8 | GO:0051765 | inositol tetrakisphosphate kinase activity(GO:0051765) |
0.1 | 1.6 | GO:0001848 | complement binding(GO:0001848) |
0.1 | 0.3 | GO:0004430 | 1-phosphatidylinositol 4-kinase activity(GO:0004430) |
0.1 | 0.4 | GO:0051864 | histone demethylase activity (H3-K36 specific)(GO:0051864) |
0.1 | 2.6 | GO:0008536 | Ran GTPase binding(GO:0008536) |
0.1 | 0.3 | GO:0033192 | calmodulin-dependent protein phosphatase activity(GO:0033192) |
0.1 | 1.2 | GO:0034237 | protein kinase A regulatory subunit binding(GO:0034237) |
0.1 | 0.7 | GO:0001055 | RNA polymerase II activity(GO:0001055) |
0.1 | 0.3 | GO:0008349 | MAP kinase kinase kinase kinase activity(GO:0008349) |
0.1 | 0.5 | GO:0030235 | nitric-oxide synthase regulator activity(GO:0030235) |
0.1 | 0.6 | GO:0032454 | histone demethylase activity (H3-K9 specific)(GO:0032454) |
0.1 | 0.4 | GO:0004887 | thyroid hormone receptor activity(GO:0004887) |
0.1 | 0.6 | GO:0051920 | peroxiredoxin activity(GO:0051920) |
0.1 | 0.2 | GO:0016661 | oxidoreductase activity, acting on other nitrogenous compounds as donors(GO:0016661) |
0.1 | 0.6 | GO:0001162 | RNA polymerase II intronic transcription regulatory region sequence-specific DNA binding(GO:0001162) |
0.1 | 0.2 | GO:0047623 | AMP deaminase activity(GO:0003876) adenosine-phosphate deaminase activity(GO:0047623) |
0.1 | 0.1 | GO:0035851 | Krueppel-associated box domain binding(GO:0035851) |
0.1 | 0.4 | GO:0004301 | epoxide hydrolase activity(GO:0004301) |
0.1 | 1.5 | GO:0003746 | translation elongation factor activity(GO:0003746) |
0.1 | 0.5 | GO:0008430 | selenium binding(GO:0008430) |
0.1 | 0.2 | GO:0016427 | tRNA (cytosine) methyltransferase activity(GO:0016427) tRNA (cytosine-5-)-methyltransferase activity(GO:0016428) |
0.1 | 0.5 | GO:0097157 | pre-mRNA intronic binding(GO:0097157) |
0.1 | 0.3 | GO:0002060 | purine nucleobase binding(GO:0002060) |
0.1 | 0.2 | GO:0004366 | glycerol-3-phosphate O-acyltransferase activity(GO:0004366) |
0.1 | 0.2 | GO:0034648 | histone demethylase activity (H3-dimethyl-K4 specific)(GO:0034648) |
0.1 | 0.2 | GO:0047192 | 1-alkylglycerophosphocholine O-acetyltransferase activity(GO:0047192) |
0.1 | 1.1 | GO:0001594 | trace-amine receptor activity(GO:0001594) |
0.1 | 0.2 | GO:0005128 | erythropoietin receptor binding(GO:0005128) |
0.1 | 0.2 | GO:0043140 | ATP-dependent 3'-5' DNA helicase activity(GO:0043140) |
0.1 | 0.5 | GO:0035197 | siRNA binding(GO:0035197) |
0.1 | 0.3 | GO:0043262 | adenosine-diphosphatase activity(GO:0043262) |
0.1 | 1.2 | GO:0008353 | RNA polymerase II carboxy-terminal domain kinase activity(GO:0008353) |
0.1 | 0.1 | GO:0071558 | histone demethylase activity (H3-K27 specific)(GO:0071558) |
0.1 | 0.6 | GO:0003993 | acid phosphatase activity(GO:0003993) |
0.1 | 0.3 | GO:0004594 | pantothenate kinase activity(GO:0004594) |
0.1 | 0.3 | GO:0003873 | 6-phosphofructo-2-kinase activity(GO:0003873) |
0.1 | 0.2 | GO:0004948 | calcitonin receptor activity(GO:0004948) |
0.1 | 1.0 | GO:0008139 | nuclear localization sequence binding(GO:0008139) |
0.1 | 0.4 | GO:0008174 | mRNA methyltransferase activity(GO:0008174) |
0.1 | 0.1 | GO:0097200 | cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:0097200) |
0.1 | 1.1 | GO:1990841 | promoter-specific chromatin binding(GO:1990841) |
0.1 | 0.2 | GO:0003829 | beta-1,3-galactosyl-O-glycosyl-glycoprotein beta-1,6-N-acetylglucosaminyltransferase activity(GO:0003829) |
0.1 | 0.1 | GO:0031852 | mu-type opioid receptor binding(GO:0031852) |
0.1 | 0.2 | GO:0050815 | phosphoserine binding(GO:0050815) |
0.1 | 0.2 | GO:0043138 | 3'-5' DNA helicase activity(GO:0043138) |
0.1 | 0.1 | GO:0019957 | C-C chemokine binding(GO:0019957) |
0.1 | 0.3 | GO:0004060 | arylamine N-acetyltransferase activity(GO:0004060) |
0.1 | 0.4 | GO:0046912 | transferase activity, transferring acyl groups, acyl groups converted into alkyl on transfer(GO:0046912) |
0.1 | 0.1 | GO:0004449 | isocitrate dehydrogenase (NAD+) activity(GO:0004449) |
0.1 | 0.2 | GO:0005168 | neurotrophin TRKA receptor binding(GO:0005168) |
0.1 | 0.3 | GO:0042609 | CD4 receptor binding(GO:0042609) |
0.1 | 0.3 | GO:0070728 | leucine binding(GO:0070728) |
0.1 | 0.1 | GO:0004731 | purine-nucleoside phosphorylase activity(GO:0004731) |
0.1 | 0.7 | GO:0035613 | RNA stem-loop binding(GO:0035613) |
0.1 | 0.3 | GO:0043495 | protein anchor(GO:0043495) |
0.1 | 0.2 | GO:0005381 | iron ion transmembrane transporter activity(GO:0005381) |
0.1 | 0.3 | GO:0005412 | glucose:sodium symporter activity(GO:0005412) |
0.1 | 0.5 | GO:0003688 | DNA replication origin binding(GO:0003688) |
0.1 | 1.2 | GO:0008157 | protein phosphatase 1 binding(GO:0008157) |
0.1 | 0.2 | GO:0050145 | nucleoside phosphate kinase activity(GO:0050145) |
0.1 | 0.8 | GO:0019825 | oxygen binding(GO:0019825) |
0.1 | 2.2 | GO:0048487 | beta-tubulin binding(GO:0048487) |
0.1 | 1.0 | GO:0015095 | magnesium ion transmembrane transporter activity(GO:0015095) |
0.1 | 0.2 | GO:0047756 | chondroitin 4-sulfotransferase activity(GO:0047756) |
0.1 | 0.3 | GO:1990932 | 5.8S rRNA binding(GO:1990932) |
0.1 | 0.4 | GO:0043560 | insulin receptor substrate binding(GO:0043560) |
0.1 | 0.1 | GO:0098519 | nucleotide phosphatase activity, acting on free nucleotides(GO:0098519) |
0.1 | 0.2 | GO:1990239 | steroid hormone binding(GO:1990239) |
0.1 | 1.2 | GO:0017025 | TBP-class protein binding(GO:0017025) |
0.1 | 0.2 | GO:1901612 | cardiolipin binding(GO:1901612) |
0.1 | 0.2 | GO:0030911 | TPR domain binding(GO:0030911) |
0.1 | 1.3 | GO:0030742 | GTP-dependent protein binding(GO:0030742) |
0.1 | 0.1 | GO:0000104 | succinate dehydrogenase activity(GO:0000104) |
0.1 | 0.4 | GO:0016863 | intramolecular oxidoreductase activity, transposing C=C bonds(GO:0016863) |
0.1 | 0.6 | GO:0008932 | lytic endotransglycosylase activity(GO:0008932) |
0.1 | 1.0 | GO:0008252 | nucleotidase activity(GO:0008252) |
0.1 | 2.4 | GO:0004812 | aminoacyl-tRNA ligase activity(GO:0004812) |
0.1 | 0.1 | GO:0050692 | DBD domain binding(GO:0050692) |
0.1 | 0.2 | GO:0035515 | oxidative RNA demethylase activity(GO:0035515) |
0.1 | 0.1 | GO:0034186 | apolipoprotein A-I binding(GO:0034186) |
0.1 | 0.4 | GO:0051787 | misfolded protein binding(GO:0051787) |
0.1 | 2.2 | GO:0001102 | RNA polymerase II activating transcription factor binding(GO:0001102) |
0.1 | 0.2 | GO:0051434 | BH3 domain binding(GO:0051434) |
0.1 | 0.1 | GO:2001069 | glycogen binding(GO:2001069) |
0.1 | 0.6 | GO:0004596 | peptide alpha-N-acetyltransferase activity(GO:0004596) |
0.1 | 0.2 | GO:0019002 | GMP binding(GO:0019002) |
0.1 | 0.2 | GO:0004849 | uridine kinase activity(GO:0004849) |
0.1 | 0.2 | GO:0016149 | translation release factor activity, codon specific(GO:0016149) |
0.1 | 0.2 | GO:0043142 | single-stranded DNA-dependent ATPase activity(GO:0043142) |
0.1 | 2.6 | GO:0070491 | repressing transcription factor binding(GO:0070491) |
0.1 | 0.8 | GO:0035259 | glucocorticoid receptor binding(GO:0035259) |
0.1 | 0.5 | GO:0043008 | ATP-dependent protein binding(GO:0043008) |
0.1 | 4.4 | GO:0018423 | protein C-terminal leucine carboxyl O-methyltransferase activity(GO:0018423) |
0.1 | 0.2 | GO:0030628 | pre-mRNA 3'-splice site binding(GO:0030628) |
0.1 | 1.9 | GO:0005547 | phosphatidylinositol-3,4,5-trisphosphate binding(GO:0005547) |
0.1 | 0.2 | GO:0003831 | beta-N-acetylglucosaminylglycopeptide beta-1,4-galactosyltransferase activity(GO:0003831) |
0.1 | 0.4 | GO:0005315 | inorganic phosphate transmembrane transporter activity(GO:0005315) |
0.1 | 0.5 | GO:0015194 | L-serine transmembrane transporter activity(GO:0015194) serine transmembrane transporter activity(GO:0022889) |
0.1 | 0.5 | GO:0035198 | miRNA binding(GO:0035198) |
0.1 | 0.4 | GO:0050321 | tau-protein kinase activity(GO:0050321) |
0.1 | 0.2 | GO:0050567 | glutaminyl-tRNA synthase (glutamine-hydrolyzing) activity(GO:0050567) |
0.1 | 0.1 | GO:0019961 | interferon binding(GO:0019961) |
0.1 | 0.1 | GO:0016312 | inositol bisphosphate phosphatase activity(GO:0016312) |
0.1 | 0.2 | GO:0003987 | acetate-CoA ligase activity(GO:0003987) |
0.1 | 0.5 | GO:0046933 | proton-transporting ATP synthase activity, rotational mechanism(GO:0046933) |
0.1 | 0.1 | GO:0070324 | thyroid hormone binding(GO:0070324) |
0.1 | 0.3 | GO:0032184 | SUMO polymer binding(GO:0032184) |
0.1 | 0.1 | GO:0005087 | Ran guanyl-nucleotide exchange factor activity(GO:0005087) |
0.1 | 1.7 | GO:0061650 | ubiquitin conjugating enzyme activity(GO:0061631) ubiquitin-like protein conjugating enzyme activity(GO:0061650) |
0.1 | 0.3 | GO:0043422 | protein kinase B binding(GO:0043422) |
0.1 | 0.6 | GO:0016813 | hydrolase activity, acting on carbon-nitrogen (but not peptide) bonds, in linear amidines(GO:0016813) |
0.1 | 0.1 | GO:0035877 | death effector domain binding(GO:0035877) |
0.1 | 0.2 | GO:0046974 | histone methyltransferase activity (H3-K9 specific)(GO:0046974) |
0.1 | 0.3 | GO:0034046 | poly(G) binding(GO:0034046) |
0.1 | 0.3 | GO:0032050 | clathrin heavy chain binding(GO:0032050) |
0.1 | 0.4 | GO:0043996 | histone acetyltransferase activity (H4-K5 specific)(GO:0043995) histone acetyltransferase activity (H4-K8 specific)(GO:0043996) histone acetyltransferase activity (H4-K16 specific)(GO:0046972) |
0.1 | 1.2 | GO:0097472 | cyclin-dependent protein serine/threonine kinase activity(GO:0004693) cyclin-dependent protein kinase activity(GO:0097472) |
0.1 | 0.3 | GO:0008190 | eukaryotic initiation factor 4E binding(GO:0008190) |
0.1 | 0.2 | GO:0030957 | Tat protein binding(GO:0030957) |
0.1 | 0.7 | GO:0008308 | voltage-gated anion channel activity(GO:0008308) |
0.1 | 0.3 | GO:0016936 | galactoside binding(GO:0016936) |
0.1 | 0.5 | GO:0005391 | sodium:potassium-exchanging ATPase activity(GO:0005391) |
0.1 | 2.7 | GO:0016836 | hydro-lyase activity(GO:0016836) |
0.1 | 0.1 | GO:0034452 | dynactin binding(GO:0034452) |
0.1 | 0.3 | GO:0097153 | cysteine-type endopeptidase activity involved in apoptotic process(GO:0097153) |
0.1 | 0.2 | GO:0042030 | ATPase inhibitor activity(GO:0042030) |
0.1 | 0.2 | GO:0034236 | protein kinase A catalytic subunit binding(GO:0034236) |
0.1 | 0.3 | GO:0042015 | interleukin-20 binding(GO:0042015) |
0.1 | 0.7 | GO:0016864 | protein disulfide isomerase activity(GO:0003756) intramolecular oxidoreductase activity, transposing S-S bonds(GO:0016864) |
0.1 | 0.2 | GO:0008475 | procollagen-lysine 5-dioxygenase activity(GO:0008475) |
0.1 | 0.1 | GO:0008525 | phosphatidylcholine transporter activity(GO:0008525) |
0.1 | 0.2 | GO:0103116 | alpha-D-galactofuranose transporter activity(GO:0103116) |
0.1 | 0.2 | GO:0004591 | oxoglutarate dehydrogenase (succinyl-transferring) activity(GO:0004591) |
0.1 | 0.3 | GO:0008172 | S-methyltransferase activity(GO:0008172) |
0.1 | 0.2 | GO:0070698 | type I activin receptor binding(GO:0070698) |
0.1 | 0.1 | GO:0030620 | U2 snRNA binding(GO:0030620) |
0.1 | 0.2 | GO:0030492 | hemoglobin binding(GO:0030492) |
0.1 | 0.3 | GO:0032552 | deoxyribonucleotide binding(GO:0032552) |
0.1 | 0.5 | GO:0032296 | ribonuclease III activity(GO:0004525) double-stranded RNA-specific ribonuclease activity(GO:0032296) |
0.1 | 0.2 | GO:0047184 | 1-acylglycerophosphocholine O-acyltransferase activity(GO:0047184) |
0.1 | 1.0 | GO:0016676 | cytochrome-c oxidase activity(GO:0004129) heme-copper terminal oxidase activity(GO:0015002) oxidoreductase activity, acting on a heme group of donors, oxygen as acceptor(GO:0016676) |
0.1 | 0.5 | GO:0016922 | ligand-dependent nuclear receptor binding(GO:0016922) |
0.1 | 0.5 | GO:0051010 | microtubule plus-end binding(GO:0051010) |
0.1 | 0.2 | GO:0004332 | fructose-bisphosphate aldolase activity(GO:0004332) |
0.1 | 0.2 | GO:0019767 | IgE receptor activity(GO:0019767) |
0.0 | 0.1 | GO:0052622 | 4-hydroxybenzoate octaprenyltransferase activity(GO:0008412) protoheme IX farnesyltransferase activity(GO:0008495) (S)-2,3-di-O-geranylgeranylglyceryl phosphate synthase activity(GO:0043888) cadaverine aminopropyltransferase activity(GO:0043918) agmatine aminopropyltransferase activity(GO:0043919) 1,4-dihydroxy-2-naphthoate octaprenyltransferase activity(GO:0046428) trans-pentaprenyltranstransferase activity(GO:0048045) ATP dimethylallyltransferase activity(GO:0052622) ADP dimethylallyltransferase activity(GO:0052623) |
0.0 | 0.1 | GO:0070538 | oleic acid binding(GO:0070538) |
0.0 | 0.1 | GO:0097371 | MDM2/MDM4 family protein binding(GO:0097371) |
0.0 | 0.3 | GO:0043024 | ribosomal small subunit binding(GO:0043024) |
0.0 | 0.1 | GO:0030621 | U4 snRNA binding(GO:0030621) |
0.0 | 0.2 | GO:0051959 | dynein light intermediate chain binding(GO:0051959) |
0.0 | 0.8 | GO:0004712 | protein serine/threonine/tyrosine kinase activity(GO:0004712) |
0.0 | 1.5 | GO:0030145 | manganese ion binding(GO:0030145) |
0.0 | 0.5 | GO:0008239 | dipeptidyl-peptidase activity(GO:0008239) |
0.0 | 0.1 | GO:0016649 | electron-transferring-flavoprotein dehydrogenase activity(GO:0004174) oxidoreductase activity, acting on the CH-NH group of donors, quinone or similar compound as acceptor(GO:0016649) |
0.0 | 0.6 | GO:0015106 | bicarbonate transmembrane transporter activity(GO:0015106) |
0.0 | 0.1 | GO:0015173 | aromatic amino acid transmembrane transporter activity(GO:0015173) |
0.0 | 0.0 | GO:0036435 | K48-linked polyubiquitin binding(GO:0036435) |
0.0 | 0.3 | GO:0001164 | RNA polymerase I regulatory region sequence-specific DNA binding(GO:0001163) RNA polymerase I CORE element sequence-specific DNA binding(GO:0001164) |
0.0 | 1.1 | GO:0031683 | G-protein beta/gamma-subunit complex binding(GO:0031683) |
0.0 | 0.1 | GO:0015038 | glutathione disulfide oxidoreductase activity(GO:0015038) |
0.0 | 0.5 | GO:0043295 | glutathione binding(GO:0043295) oligopeptide binding(GO:1900750) |
0.0 | 0.1 | GO:0043559 | insulin binding(GO:0043559) |
0.0 | 0.7 | GO:0031489 | myosin V binding(GO:0031489) |
0.0 | 2.7 | GO:0061659 | ubiquitin-like protein ligase activity(GO:0061659) |
0.0 | 0.0 | GO:0033592 | RNA strand annealing activity(GO:0033592) |
0.0 | 0.1 | GO:0008309 | double-stranded DNA exodeoxyribonuclease activity(GO:0008309) |
0.0 | 0.4 | GO:0102391 | decanoate--CoA ligase activity(GO:0102391) |
0.0 | 0.2 | GO:0017176 | phosphatidylinositol N-acetylglucosaminyltransferase activity(GO:0017176) |
0.0 | 0.2 | GO:0016308 | 1-phosphatidylinositol-4-phosphate 5-kinase activity(GO:0016308) |
0.0 | 1.4 | GO:0052771 | coenzyme F390-A hydrolase activity(GO:0052770) coenzyme F390-G hydrolase activity(GO:0052771) |
0.0 | 2.2 | GO:0002039 | p53 binding(GO:0002039) |
0.0 | 0.5 | GO:0034185 | apolipoprotein binding(GO:0034185) |
0.0 | 0.2 | GO:0016717 | oxidoreductase activity, acting on paired donors, with oxidation of a pair of donors resulting in the reduction of molecular oxygen to two molecules of water(GO:0016717) |
0.0 | 0.3 | GO:0016742 | hydroxymethyl-, formyl- and related transferase activity(GO:0016742) |
0.0 | 0.3 | GO:0016631 | enoyl-[acyl-carrier-protein] reductase activity(GO:0016631) 2,3-dihydroxy-2,3-dihydro-phenylpropionate dehydrogenase activity(GO:0018498) cis-2,3-dihydrodiol DDT dehydrogenase activity(GO:0018499) trans-9R,10R-dihydrodiolphenanthrene dehydrogenase activity(GO:0018500) cis-chlorobenzene dihydrodiol dehydrogenase activity(GO:0018501) 2,5-dichloro-2,5-cyclohexadiene-1,4-diol dehydrogenase activity(GO:0018502) trans-1,2-dihydrodiolphenanthrene dehydrogenase activity(GO:0018503) 3,4-dihydroxy-3,4-dihydrofluorene dehydrogenase activity(GO:0034790) benzo(a)pyrene-trans-11,12-dihydrodiol dehydrogenase activity(GO:0034805) benzo(a)pyrene-cis-4,5-dihydrodiol dehydrogenase activity(GO:0034809) citronellyl-CoA dehydrogenase activity(GO:0034824) menthone dehydrogenase activity(GO:0034838) phthalate 3,4-cis-dihydrodiol dehydrogenase activity(GO:0034912) cinnamate reductase activity(GO:0043786) NADPH-dependent curcumin reductase activity(GO:0052849) NADPH-dependent dihydrocurcumin reductase activity(GO:0052850) |
0.0 | 0.3 | GO:1990381 | ubiquitin-specific protease binding(GO:1990381) |
0.0 | 1.0 | GO:0019706 | protein-cysteine S-palmitoyltransferase activity(GO:0019706) |
0.0 | 1.0 | GO:0001105 | RNA polymerase II transcription coactivator activity(GO:0001105) |
0.0 | 0.0 | GO:0070180 | large ribosomal subunit rRNA binding(GO:0070180) |
0.0 | 0.3 | GO:0070492 | oligosaccharide binding(GO:0070492) |
0.0 | 0.2 | GO:0035312 | 5'-3' exodeoxyribonuclease activity(GO:0035312) |
0.0 | 0.3 | GO:0035473 | lipase binding(GO:0035473) |
0.0 | 0.4 | GO:0003810 | protein-glutamine gamma-glutamyltransferase activity(GO:0003810) |
0.0 | 0.6 | GO:0070412 | R-SMAD binding(GO:0070412) |
0.0 | 0.0 | GO:0031559 | oxidosqualene cyclase activity(GO:0031559) |
0.0 | 0.9 | GO:0005031 | tumor necrosis factor-activated receptor activity(GO:0005031) death receptor activity(GO:0005035) |
0.0 | 0.2 | GO:0005173 | stem cell factor receptor binding(GO:0005173) |
0.0 | 0.1 | GO:0002094 | polyprenyltransferase activity(GO:0002094) |
0.0 | 0.5 | GO:0004535 | poly(A)-specific ribonuclease activity(GO:0004535) |
0.0 | 0.1 | GO:0008035 | high-density lipoprotein particle binding(GO:0008035) |
0.0 | 0.5 | GO:0005313 | L-glutamate transmembrane transporter activity(GO:0005313) |
0.0 | 0.2 | GO:0004415 | hyalurononglucosaminidase activity(GO:0004415) |
0.0 | 0.3 | GO:0016778 | diphosphotransferase activity(GO:0016778) |
0.0 | 0.1 | GO:0008240 | tripeptidyl-peptidase activity(GO:0008240) |
0.0 | 0.3 | GO:0008494 | translation activator activity(GO:0008494) |
0.0 | 0.5 | GO:0001618 | virus receptor activity(GO:0001618) |
0.0 | 0.1 | GO:0017151 | DEAD/H-box RNA helicase binding(GO:0017151) |
0.0 | 0.1 | GO:0032453 | histone demethylase activity (H3-K4 specific)(GO:0032453) |
0.0 | 8.0 | GO:0043773 | UDP-N-acetylmuramoylalanyl-D-glutamyl-2,6-diaminopimelate-D-alanyl-D-alanine ligase activity(GO:0008766) ribosomal S6-glutamic acid ligase activity(GO:0018169) coenzyme F420-0 gamma-glutamyl ligase activity(GO:0043773) coenzyme F420-2 alpha-glutamyl ligase activity(GO:0043774) protein-glycine ligase activity(GO:0070735) protein-glycine ligase activity, initiating(GO:0070736) protein-glycine ligase activity, elongating(GO:0070737) tubulin-glycine ligase activity(GO:0070738) |
0.0 | 0.0 | GO:0032452 | histone demethylase activity(GO:0032452) |
0.0 | 0.5 | GO:0016667 | oxidoreductase activity, acting on a sulfur group of donors(GO:0016667) |
0.0 | 0.2 | GO:0016744 | transferase activity, transferring aldehyde or ketonic groups(GO:0016744) |
0.0 | 0.5 | GO:0008327 | methyl-CpG binding(GO:0008327) |
0.0 | 0.2 | GO:0031419 | cobalamin binding(GO:0031419) |
0.0 | 0.1 | GO:0061629 | RNA polymerase II sequence-specific DNA binding transcription factor binding(GO:0061629) |
0.0 | 0.1 | GO:0005502 | 11-cis retinal binding(GO:0005502) |
0.0 | 0.2 | GO:0010997 | anaphase-promoting complex binding(GO:0010997) |
0.0 | 0.2 | GO:0017081 | chloride channel regulator activity(GO:0017081) |
0.0 | 0.7 | GO:0004709 | MAP kinase kinase kinase activity(GO:0004709) |
0.0 | 0.2 | GO:0034235 | GPI anchor binding(GO:0034235) |
0.0 | 0.5 | GO:0016860 | intramolecular oxidoreductase activity(GO:0016860) |
0.0 | 2.2 | GO:0042626 | ATPase activity, coupled to transmembrane movement of substances(GO:0042626) |
0.0 | 0.1 | GO:0004738 | pyruvate dehydrogenase activity(GO:0004738) pyruvate dehydrogenase [NAD(P)+] activity(GO:0034603) pyruvate dehydrogenase (NAD+) activity(GO:0034604) |
0.0 | 0.1 | GO:0004691 | cAMP-dependent protein kinase activity(GO:0004691) |
0.0 | 2.1 | GO:0051117 | ATPase binding(GO:0051117) |
0.0 | 0.1 | GO:0004311 | farnesyltranstransferase activity(GO:0004311) |
0.0 | 1.4 | GO:0003697 | single-stranded DNA binding(GO:0003697) |
0.0 | 0.2 | GO:0005143 | interleukin-12 receptor binding(GO:0005143) |
0.0 | 0.2 | GO:0001054 | RNA polymerase I activity(GO:0001054) |
0.0 | 0.1 | GO:0016716 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, another compound as one donor, and incorporation of one atom of oxygen(GO:0016716) |
0.0 | 0.1 | GO:0004980 | melanocyte-stimulating hormone receptor activity(GO:0004980) |
0.0 | 0.4 | GO:0022821 | potassium ion antiporter activity(GO:0022821) |
0.0 | 0.1 | GO:0016823 | hydrolase activity, acting on acid carbon-carbon bonds(GO:0016822) hydrolase activity, acting on acid carbon-carbon bonds, in ketonic substances(GO:0016823) |
0.0 | 0.3 | GO:0016920 | pyroglutamyl-peptidase activity(GO:0016920) |
0.0 | 0.2 | GO:0016714 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, reduced pteridine as one donor, and incorporation of one atom of oxygen(GO:0016714) |
0.0 | 1.2 | GO:0016655 | oxidoreductase activity, acting on NAD(P)H, quinone or similar compound as acceptor(GO:0016655) |
0.0 | 0.0 | GO:0033677 | DNA/RNA helicase activity(GO:0033677) |
0.0 | 0.1 | GO:0004938 | alpha2-adrenergic receptor activity(GO:0004938) |
0.0 | 0.2 | GO:1990405 | protein antigen binding(GO:1990405) |
0.0 | 0.2 | GO:0004046 | aminoacylase activity(GO:0004046) |
0.0 | 0.1 | GO:0033829 | O-fucosylpeptide 3-beta-N-acetylglucosaminyltransferase activity(GO:0033829) |
0.0 | 1.2 | GO:0043022 | ribosome binding(GO:0043022) |
0.0 | 0.2 | GO:0003956 | NAD(P)+-protein-arginine ADP-ribosyltransferase activity(GO:0003956) |
0.0 | 0.1 | GO:0052658 | inositol-1,4,5-trisphosphate 5-phosphatase activity(GO:0052658) |
0.0 | 0.3 | GO:0010181 | FMN binding(GO:0010181) |
0.0 | 0.3 | GO:0005487 | nucleocytoplasmic transporter activity(GO:0005487) |
0.0 | 0.2 | GO:0016888 | endodeoxyribonuclease activity, producing 5'-phosphomonoesters(GO:0016888) |
0.0 | 0.2 | GO:0042979 | ornithine decarboxylase regulator activity(GO:0042979) |
0.0 | 0.2 | GO:0001727 | lipid kinase activity(GO:0001727) |
0.0 | 1.0 | GO:0004402 | histone acetyltransferase activity(GO:0004402) |
0.0 | 0.0 | GO:0032356 | oxidized DNA binding(GO:0032356) oxidized purine DNA binding(GO:0032357) |
0.0 | 0.1 | GO:0036042 | long-chain fatty acyl-CoA binding(GO:0036042) |
0.0 | 0.2 | GO:0036310 | annealing helicase activity(GO:0036310) |
0.0 | 0.2 | GO:0035925 | mRNA 3'-UTR AU-rich region binding(GO:0035925) |
0.0 | 0.1 | GO:0019808 | polyamine binding(GO:0019808) |
0.0 | 0.0 | GO:0016820 | hydrolase activity, acting on acid anhydrides, catalyzing transmembrane movement of substances(GO:0016820) |
0.0 | 6.6 | GO:0003735 | structural constituent of ribosome(GO:0003735) |
0.0 | 0.2 | GO:0017110 | nucleoside-diphosphatase activity(GO:0017110) |
0.0 | 0.3 | GO:0005521 | lamin binding(GO:0005521) |
0.0 | 0.4 | GO:0017154 | semaphorin receptor activity(GO:0017154) |
0.0 | 0.0 | GO:0005047 | signal recognition particle binding(GO:0005047) |
0.0 | 1.1 | GO:0004722 | protein serine/threonine phosphatase activity(GO:0004722) |
0.0 | 0.1 | GO:0002054 | nucleobase binding(GO:0002054) |
0.0 | 0.4 | GO:0003684 | damaged DNA binding(GO:0003684) |
0.0 | 0.9 | GO:0016831 | carboxy-lyase activity(GO:0016831) |
0.0 | 0.3 | GO:0009881 | photoreceptor activity(GO:0009881) |
0.0 | 0.9 | GO:0005484 | SNAP receptor activity(GO:0005484) |
0.0 | 0.4 | GO:0001056 | RNA polymerase III activity(GO:0001056) |
0.0 | 0.1 | GO:0034062 | RNA polymerase activity(GO:0034062) |
0.0 | 0.1 | GO:0034513 | box H/ACA snoRNA binding(GO:0034513) |
0.0 | 0.9 | GO:0015485 | cholesterol binding(GO:0015485) |
0.0 | 0.0 | GO:0004549 | tRNA-specific ribonuclease activity(GO:0004549) |
0.0 | 0.1 | GO:0010521 | telomerase inhibitor activity(GO:0010521) |
0.0 | 0.1 | GO:0016802 | adenosylhomocysteinase activity(GO:0004013) trialkylsulfonium hydrolase activity(GO:0016802) |
0.0 | 0.2 | GO:0016679 | oxidoreductase activity, acting on diphenols and related substances as donors(GO:0016679) |
0.0 | 0.1 | GO:0016520 | growth hormone-releasing hormone receptor activity(GO:0016520) |
0.0 | 0.2 | GO:0005536 | glucose binding(GO:0005536) |
0.0 | 0.6 | GO:0005527 | macrolide binding(GO:0005527) FK506 binding(GO:0005528) |
0.0 | 0.0 | GO:0000014 | single-stranded DNA endodeoxyribonuclease activity(GO:0000014) |
0.0 | 0.1 | GO:0003985 | acetyl-CoA C-acetyltransferase activity(GO:0003985) C-acetyltransferase activity(GO:0016453) |
0.0 | 0.6 | GO:0003755 | peptidyl-prolyl cis-trans isomerase activity(GO:0003755) |
0.0 | 0.0 | GO:0070326 | very-low-density lipoprotein particle receptor binding(GO:0070326) |
0.0 | 0.1 | GO:0051021 | GDP-dissociation inhibitor binding(GO:0051021) |
0.0 | 1.5 | GO:0008565 | protein transporter activity(GO:0008565) |
0.0 | 0.1 | GO:0008503 | benzodiazepine receptor activity(GO:0008503) |
0.0 | 0.3 | GO:0016884 | carbon-nitrogen ligase activity, with glutamine as amido-N-donor(GO:0016884) |
0.0 | 0.1 | GO:0070087 | chromo shadow domain binding(GO:0070087) |
0.0 | 0.2 | GO:0005113 | patched binding(GO:0005113) |
0.0 | 0.4 | GO:0000049 | tRNA binding(GO:0000049) |
0.0 | 0.7 | GO:0003887 | DNA-directed DNA polymerase activity(GO:0003887) |
0.0 | 0.2 | GO:0031996 | thioesterase binding(GO:0031996) |
0.0 | 0.2 | GO:0010314 | phosphatidylinositol-5-phosphate binding(GO:0010314) |
0.0 | 0.1 | GO:0000268 | peroxisome targeting sequence binding(GO:0000268) |
0.0 | 0.0 | GO:0036033 | mediator complex binding(GO:0036033) |
0.0 | 0.1 | GO:0005094 | Rho GDP-dissociation inhibitor activity(GO:0005094) |
0.0 | 0.1 | GO:0051731 | polynucleotide 5'-hydroxyl-kinase activity(GO:0051731) ATP-dependent polynucleotide kinase activity(GO:0051734) |
0.0 | 0.2 | GO:0017056 | structural constituent of nuclear pore(GO:0017056) |
0.0 | 0.5 | GO:0051059 | NF-kappaB binding(GO:0051059) |
0.0 | 0.3 | GO:0004176 | ATP-dependent peptidase activity(GO:0004176) |
0.0 | 0.2 | GO:0050700 | CARD domain binding(GO:0050700) |
0.0 | 0.0 | GO:0000099 | sulfur amino acid transmembrane transporter activity(GO:0000099) |
0.0 | 0.1 | GO:0016774 | phosphotransferase activity, carboxyl group as acceptor(GO:0016774) |
0.0 | 0.1 | GO:0071208 | histone pre-mRNA DCP binding(GO:0071208) |
0.0 | 0.2 | GO:0030249 | guanylate cyclase regulator activity(GO:0030249) |
0.0 | 0.1 | GO:0019206 | nucleoside kinase activity(GO:0019206) |
0.0 | 0.0 | GO:0061733 | peptide-lysine-N-acetyltransferase activity(GO:0061733) |
0.0 | 0.1 | GO:0004771 | sterol esterase activity(GO:0004771) |
0.0 | 0.4 | GO:0017160 | Ral GTPase binding(GO:0017160) |
0.0 | 0.8 | GO:0008094 | DNA-dependent ATPase activity(GO:0008094) |
0.0 | 0.1 | GO:0004957 | prostaglandin E receptor activity(GO:0004957) |
0.0 | 0.3 | GO:0008601 | protein phosphatase type 2A regulator activity(GO:0008601) |
0.0 | 0.1 | GO:0008147 | structural constituent of bone(GO:0008147) |
0.0 | 0.0 | GO:0004488 | methylenetetrahydrofolate dehydrogenase (NADP+) activity(GO:0004488) |
0.0 | 0.2 | GO:0015280 | ligand-gated sodium channel activity(GO:0015280) |
0.0 | 0.5 | GO:0043130 | ubiquitin binding(GO:0043130) |
0.0 | 1.5 | GO:0051082 | unfolded protein binding(GO:0051082) |
0.0 | 0.1 | GO:0015211 | purine nucleoside transmembrane transporter activity(GO:0015211) |
0.0 | 0.5 | GO:0045502 | dynein binding(GO:0045502) |
0.0 | 0.6 | GO:0004177 | aminopeptidase activity(GO:0004177) |
0.0 | 0.1 | GO:0030371 | translation repressor activity(GO:0030371) |
0.0 | 0.3 | GO:0050681 | androgen receptor binding(GO:0050681) |
0.0 | 1.1 | GO:0016628 | oxidoreductase activity, acting on the CH-CH group of donors, NAD or NADP as acceptor(GO:0016628) |
0.0 | 0.1 | GO:0004566 | beta-glucuronidase activity(GO:0004566) |
0.0 | 0.4 | GO:0004029 | aldehyde dehydrogenase (NAD) activity(GO:0004029) |
0.0 | 0.1 | GO:0046624 | sphingolipid transporter activity(GO:0046624) |
0.0 | 0.1 | GO:0016615 | malate dehydrogenase activity(GO:0016615) |
0.0 | 0.1 | GO:0008599 | protein phosphatase type 1 regulator activity(GO:0008599) |
0.0 | 0.3 | GO:0034843 | 2-oxoglutaryl-CoA thioesterase activity(GO:0034843) 2,4,4-trimethyl-3-oxopentanoyl-CoA thioesterase activity(GO:0034869) 3-isopropylbut-3-enoyl-CoA thioesterase activity(GO:0034946) glutaryl-CoA hydrolase activity(GO:0044466) |
0.0 | 0.1 | GO:0005048 | signal sequence binding(GO:0005048) |
0.0 | 0.2 | GO:0034863 | pinocarveol dehydrogenase activity(GO:0018446) chloral hydrate dehydrogenase activity(GO:0018447) hydroxymethylmethylsilanediol oxidase activity(GO:0018448) 1-phenylethanol dehydrogenase activity(GO:0018449) myrtenol dehydrogenase activity(GO:0018450) cis-1,2-dihydroxy-1,2-dihydro-8-carboxynaphthalene dehydrogenase activity(GO:0034522) 3-hydroxy-4-methyloctanoyl-CoA dehydrogenase activity(GO:0034582) 2-hydroxy-4-isopropenylcyclohexane-1-carboxyl-CoA dehydrogenase activity(GO:0034778) cis-9,10-dihydroanthracene-9,10-diol dehydrogenase activity(GO:0034817) citronellol dehydrogenase activity(GO:0034821) naphthyl-2-hydroxymethyl-succinyl-CoA dehydrogenase activity(GO:0034847) 2,4,4-trimethyl-1-pentanol dehydrogenase activity(GO:0034863) 2,4,4-trimethyl-3-hydroxypentanoyl-CoA dehydrogenase activity(GO:0034868) 1-hydroxy-4,4-dimethylpentan-3-one dehydrogenase activity(GO:0034871) endosulfan diol dehydrogenase activity(GO:0034891) endosulfan hydroxyether dehydrogenase activity(GO:0034901) 3-hydroxy-2-methylhexanoyl-CoA dehydrogenase activity(GO:0034918) 3-hydroxy-2,6-dimethyl-5-methylene-heptanoyl-CoA dehydrogenase activity(GO:0034944) versicolorin reductase activity(GO:0042469) ketoreductase activity(GO:0045703) |
0.0 | 0.2 | GO:0004383 | guanylate cyclase activity(GO:0004383) |
0.0 | 0.2 | GO:0008242 | omega peptidase activity(GO:0008242) |
0.0 | 0.2 | GO:0016646 | oxidoreductase activity, acting on the CH-NH group of donors, NAD or NADP as acceptor(GO:0016646) |
0.0 | 0.1 | GO:0019976 | interleukin-2 binding(GO:0019976) |
0.0 | 0.3 | GO:0043027 | cysteine-type endopeptidase inhibitor activity involved in apoptotic process(GO:0043027) |
0.0 | 2.2 | GO:0003714 | transcription corepressor activity(GO:0003714) |
0.0 | 0.1 | GO:0000182 | rDNA binding(GO:0000182) |
0.0 | 0.3 | GO:0008574 | ATP-dependent microtubule motor activity, plus-end-directed(GO:0008574) |
0.0 | 0.1 | GO:0035256 | G-protein coupled glutamate receptor binding(GO:0035256) |
0.0 | 0.1 | GO:1990226 | histone methyltransferase binding(GO:1990226) |
0.0 | 0.2 | GO:0097602 | cullin family protein binding(GO:0097602) |
0.0 | 0.1 | GO:0008905 | mannose-phosphate guanylyltransferase activity(GO:0008905) |
0.0 | 0.6 | GO:0004190 | aspartic-type endopeptidase activity(GO:0004190) aspartic-type peptidase activity(GO:0070001) |
0.0 | 0.0 | GO:0036137 | kynurenine-oxoglutarate transaminase activity(GO:0016212) kynurenine aminotransferase activity(GO:0036137) |
0.0 | 1.0 | GO:0008135 | translation factor activity, RNA binding(GO:0008135) |
0.0 | 0.1 | GO:0042284 | sphingolipid delta-4 desaturase activity(GO:0042284) |
0.0 | 0.1 | GO:0019870 | potassium channel inhibitor activity(GO:0019870) |
0.0 | 0.0 | GO:0031871 | proteinase activated receptor binding(GO:0031871) |
0.0 | 0.3 | GO:0018602 | sulfonate dioxygenase activity(GO:0000907) 2,4-dichlorophenoxyacetate alpha-ketoglutarate dioxygenase activity(GO:0018602) hypophosphite dioxygenase activity(GO:0034792) gibberellin 2-beta-dioxygenase activity(GO:0045543) C-19 gibberellin 2-beta-dioxygenase activity(GO:0052634) C-20 gibberellin 2-beta-dioxygenase activity(GO:0052635) |
0.0 | 0.1 | GO:0016755 | transferase activity, transferring amino-acyl groups(GO:0016755) |
0.0 | 0.0 | GO:0004345 | glucose-6-phosphate dehydrogenase activity(GO:0004345) |
0.0 | 1.3 | GO:0004004 | RNA helicase activity(GO:0003724) ATP-dependent RNA helicase activity(GO:0004004) RNA-dependent ATPase activity(GO:0008186) |
0.0 | 0.3 | GO:0009982 | pseudouridine synthase activity(GO:0009982) |
0.0 | 0.1 | GO:0070182 | DNA polymerase binding(GO:0070182) |
0.0 | 0.1 | GO:0015222 | serotonin transmembrane transporter activity(GO:0015222) |
0.0 | 0.3 | GO:0001191 | transcriptional repressor activity, RNA polymerase II transcription factor binding(GO:0001191) |
0.0 | 0.1 | GO:0031735 | CCR10 chemokine receptor binding(GO:0031735) |
0.0 | 0.0 | GO:0030284 | estrogen receptor activity(GO:0030284) |
0.0 | 0.1 | GO:0098639 | collagen binding involved in cell-matrix adhesion(GO:0098639) |
0.0 | 0.1 | GO:0004126 | cytidine deaminase activity(GO:0004126) |
0.0 | 0.2 | GO:0070402 | NADPH binding(GO:0070402) |
0.0 | 0.3 | GO:0051537 | 2 iron, 2 sulfur cluster binding(GO:0051537) |
0.0 | 0.3 | GO:0015078 | hydrogen ion transmembrane transporter activity(GO:0015078) |
0.0 | 0.1 | GO:0045545 | syndecan binding(GO:0045545) |
0.0 | 0.5 | GO:0016651 | oxidoreductase activity, acting on NAD(P)H(GO:0016651) |
0.0 | 0.1 | GO:0004075 | biotin carboxylase activity(GO:0004075) |
0.0 | 0.0 | GO:0098518 | polynucleotide phosphatase activity(GO:0098518) |
0.0 | 0.2 | GO:0051011 | microtubule minus-end binding(GO:0051011) |
0.0 | 1.4 | GO:0036459 | thiol-dependent ubiquitinyl hydrolase activity(GO:0036459) ubiquitinyl hydrolase activity(GO:0101005) |
0.0 | 0.1 | GO:0043522 | leucine zipper domain binding(GO:0043522) |
0.0 | 0.2 | GO:0015271 | outward rectifier potassium channel activity(GO:0015271) |
0.0 | 0.8 | GO:0044823 | integrase activity(GO:0008907) T/G mismatch-specific endonuclease activity(GO:0043765) retroviral integrase activity(GO:0044823) retroviral 3' processing activity(GO:0044824) |
0.0 | 0.5 | GO:0031593 | polyubiquitin binding(GO:0031593) |
0.0 | 0.0 | GO:0003917 | DNA topoisomerase type I activity(GO:0003917) |
0.0 | 0.1 | GO:0016909 | JUN kinase activity(GO:0004705) SAP kinase activity(GO:0016909) |
0.0 | 0.0 | GO:0017098 | sulfonylurea receptor binding(GO:0017098) |
0.0 | 0.0 | GO:0001758 | retinal dehydrogenase activity(GO:0001758) |
0.0 | 0.2 | GO:0016849 | phosphorus-oxygen lyase activity(GO:0016849) |
0.0 | 0.0 | GO:0016880 | acid-ammonia (or amide) ligase activity(GO:0016880) |
0.0 | 0.6 | GO:0001104 | RNA polymerase II transcription cofactor activity(GO:0001104) |
0.0 | 0.1 | GO:0004563 | beta-N-acetylhexosaminidase activity(GO:0004563) |
0.0 | 0.1 | GO:0004945 | angiotensin type II receptor activity(GO:0004945) |
0.0 | 0.1 | GO:0004370 | glycerol kinase activity(GO:0004370) |
0.0 | 0.5 | GO:0008757 | S-adenosylmethionine-dependent methyltransferase activity(GO:0008757) |
0.0 | 0.2 | GO:0001608 | G-protein coupled nucleotide receptor activity(GO:0001608) G-protein coupled purinergic nucleotide receptor activity(GO:0045028) |
0.0 | 0.0 | GO:0008171 | O-methyltransferase activity(GO:0008171) |
0.0 | 0.3 | GO:0015928 | fucosidase activity(GO:0015928) |
0.0 | 0.2 | GO:0001206 | transcriptional repressor activity, RNA polymerase II distal enhancer sequence-specific binding(GO:0001206) |
0.0 | 0.1 | GO:0050501 | hyaluronan synthase activity(GO:0050501) |
0.0 | 0.2 | GO:0016248 | channel inhibitor activity(GO:0016248) |
0.0 | 0.1 | GO:0008422 | beta-glucosidase activity(GO:0008422) |
0.0 | 0.1 | GO:0043199 | sulfate binding(GO:0043199) |
0.0 | 0.0 | GO:0016859 | cis-trans isomerase activity(GO:0016859) |
0.0 | 0.4 | GO:0051287 | NAD binding(GO:0051287) |
0.0 | 0.0 | GO:0008184 | glycogen phosphorylase activity(GO:0008184) |
0.0 | 0.3 | GO:0052890 | oxidoreductase activity, acting on the CH-CH group of donors, with a flavin as acceptor(GO:0052890) |
0.0 | 1.5 | GO:0017137 | Rab GTPase binding(GO:0017137) |
0.0 | 0.4 | GO:0004298 | threonine-type endopeptidase activity(GO:0004298) threonine-type peptidase activity(GO:0070003) |
0.0 | 0.0 | GO:0043426 | MRF binding(GO:0043426) |
0.0 | 0.1 | GO:0000400 | four-way junction DNA binding(GO:0000400) |
0.0 | 0.1 | GO:0004579 | dolichyl-diphosphooligosaccharide-protein glycotransferase activity(GO:0004579) |
0.0 | 0.4 | GO:0004521 | endoribonuclease activity(GO:0004521) |
0.0 | 1.3 | GO:0008234 | cysteine-type peptidase activity(GO:0008234) |
0.0 | 0.6 | GO:0019003 | GDP binding(GO:0019003) |
0.0 | 0.1 | GO:0043823 | mono-butyltin dioxygenase activity(GO:0018586) tri-n-butyltin dioxygenase activity(GO:0018588) di-n-butyltin dioxygenase activity(GO:0018589) methylsilanetriol hydroxylase activity(GO:0018590) methyl tertiary butyl ether 3-monooxygenase activity(GO:0018591) 4-nitrocatechol 4-monooxygenase activity(GO:0018592) 4-chlorophenoxyacetate monooxygenase activity(GO:0018593) tert-butanol 2-monooxygenase activity(GO:0018594) alpha-pinene monooxygenase activity(GO:0018595) dimethylsilanediol hydroxylase activity(GO:0018596) ammonia monooxygenase activity(GO:0018597) hydroxymethylsilanetriol oxidase activity(GO:0018598) 2-hydroxyisobutyrate 3-monooxygenase activity(GO:0018599) alpha-pinene dehydrogenase activity(GO:0018600) bisphenol A hydroxylase B activity(GO:0034559) 2,2-bis(4-hydroxyphenyl)-1-propanol hydroxylase activity(GO:0034562) 9-fluorenone-3,4-dioxygenase activity(GO:0034786) anthracene 9,10-dioxygenase activity(GO:0034816) 2-(methylthio)benzothiazole monooxygenase activity(GO:0034857) 2-hydroxybenzothiazole monooxygenase activity(GO:0034858) benzothiazole monooxygenase activity(GO:0034859) 2,6-dihydroxybenzothiazole monooxygenase activity(GO:0034862) pinacolone 5-monooxygenase activity(GO:0034870) thioacetamide S-oxygenase activity(GO:0034873) thioacetamide S-oxide S-oxygenase activity(GO:0034874) endosulfan monooxygenase I activity(GO:0034888) N-nitrodimethylamine hydroxylase activity(GO:0034893) 4-(1-ethyl-1,4-dimethyl-pentyl)phenol monoxygenase activity(GO:0034897) endosulfan ether monooxygenase activity(GO:0034903) pyrene 4,5-monooxygenase activity(GO:0034925) pyrene 1,2-monooxygenase activity(GO:0034927) 1-hydroxypyrene 6,7-monooxygenase activity(GO:0034928) 1-hydroxypyrene 7,8-monooxygenase activity(GO:0034929) phenylboronic acid monooxygenase activity(GO:0034950) spheroidene monooxygenase activity(GO:0043823) |
0.0 | 0.1 | GO:0001515 | opioid peptide activity(GO:0001515) |
0.0 | 0.1 | GO:0004920 | interleukin-10 receptor activity(GO:0004920) |
0.0 | 0.1 | GO:0050733 | RS domain binding(GO:0050733) |
0.0 | 0.0 | GO:0016505 | peptidase activator activity involved in apoptotic process(GO:0016505) |
0.0 | 0.6 | GO:0016811 | hydrolase activity, acting on carbon-nitrogen (but not peptide) bonds, in linear amides(GO:0016811) |
0.0 | 0.4 | GO:0042054 | histone methyltransferase activity(GO:0042054) |
0.0 | 0.2 | GO:0015175 | neutral amino acid transmembrane transporter activity(GO:0015175) |
0.0 | 0.1 | GO:0005111 | type 2 fibroblast growth factor receptor binding(GO:0005111) |
0.0 | 0.3 | GO:0016701 | oxidoreductase activity, acting on single donors with incorporation of molecular oxygen(GO:0016701) oxidoreductase activity, acting on single donors with incorporation of molecular oxygen, incorporation of two atoms of oxygen(GO:0016702) |
0.0 | 0.1 | GO:0048406 | nerve growth factor binding(GO:0048406) |
0.0 | 0.1 | GO:0008179 | adenylate cyclase binding(GO:0008179) |
0.0 | 9.1 | GO:0044822 | poly(A) RNA binding(GO:0044822) |
0.0 | 0.1 | GO:0031210 | phosphatidylcholine binding(GO:0031210) |
0.0 | 0.0 | GO:0015248 | sterol transporter activity(GO:0015248) |
0.0 | 0.1 | GO:0042288 | MHC class I protein binding(GO:0042288) |
0.0 | 0.3 | GO:0016538 | cyclin-dependent protein serine/threonine kinase regulator activity(GO:0016538) |
0.0 | 0.1 | GO:0035014 | phosphatidylinositol 3-kinase regulator activity(GO:0035014) |
0.0 | 0.0 | GO:0004515 | nicotinamide-nucleotide adenylyltransferase activity(GO:0000309) nicotinate-nucleotide adenylyltransferase activity(GO:0004515) |
0.0 | 0.0 | GO:0008173 | RNA methyltransferase activity(GO:0008173) |
0.0 | 0.1 | GO:0008454 | alpha-1,3-mannosylglycoprotein 4-beta-N-acetylglucosaminyltransferase activity(GO:0008454) |
0.0 | 0.1 | GO:0005416 | cation:amino acid symporter activity(GO:0005416) |
0.0 | 0.0 | GO:0032405 | MutLalpha complex binding(GO:0032405) |
0.0 | 0.1 | GO:0000062 | fatty-acyl-CoA binding(GO:0000062) |
0.0 | 0.0 | GO:0031493 | nucleosomal histone binding(GO:0031493) |
0.0 | 0.1 | GO:0005068 | transmembrane receptor protein tyrosine kinase adaptor activity(GO:0005068) |
0.0 | 0.1 | GO:0008479 | queuine tRNA-ribosyltransferase activity(GO:0008479) |
0.0 | 0.0 | GO:0008143 | poly(A) binding(GO:0008143) |
0.0 | 0.2 | GO:0043492 | ATPase activity, coupled to movement of substances(GO:0043492) |
0.0 | 0.0 | GO:0008384 | IkappaB kinase activity(GO:0008384) |
0.0 | 0.0 | GO:0032182 | ubiquitin-like protein binding(GO:0032182) |
0.0 | 1.0 | GO:0003924 | GTPase activity(GO:0003924) |
0.0 | 0.3 | GO:0017017 | MAP kinase tyrosine/serine/threonine phosphatase activity(GO:0017017) |
0.0 | 0.2 | GO:0005452 | inorganic anion exchanger activity(GO:0005452) |
0.0 | 0.0 | GO:0004365 | glyceraldehyde-3-phosphate dehydrogenase (NAD+) (phosphorylating) activity(GO:0004365) glyceraldehyde-3-phosphate dehydrogenase (NAD(P)+) (phosphorylating) activity(GO:0043891) |
0.0 | 0.0 | GO:0051185 | coenzyme transporter activity(GO:0051185) |
0.0 | 0.0 | GO:0004069 | L-aspartate:2-oxoglutarate aminotransferase activity(GO:0004069) |
0.0 | 0.1 | GO:0032027 | myosin light chain binding(GO:0032027) |
0.0 | 0.1 | GO:0071617 | lysophospholipid acyltransferase activity(GO:0071617) |
0.0 | 0.0 | GO:0008597 | calcium-dependent protein serine/threonine phosphatase regulator activity(GO:0008597) |
0.0 | 0.0 | GO:0004966 | galanin receptor activity(GO:0004966) |
0.0 | 0.0 | GO:0005372 | water transmembrane transporter activity(GO:0005372) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.2 | 5.3 | PID IL2 PI3K PATHWAY | IL2 signaling events mediated by PI3K |
0.1 | 1.4 | PID P38 GAMMA DELTA PATHWAY | Signaling mediated by p38-gamma and p38-delta |
0.1 | 0.6 | SA G1 AND S PHASES | Cdk2, 4, and 6 bind cyclin D in G1, while cdk2/cyclin E promotes the G1/S transition. |
0.1 | 0.9 | SA G2 AND M PHASES | Cdc25 activates the cdc2/cyclin B complex to induce the G2/M transition. |
0.1 | 3.3 | PID IL8 CXCR2 PATHWAY | IL8- and CXCR2-mediated signaling events |
0.1 | 0.2 | PID ERBB4 PATHWAY | ErbB4 signaling events |
0.1 | 1.9 | ST ERK1 ERK2 MAPK PATHWAY | ERK1/ERK2 MAPK Pathway |
0.1 | 0.5 | PID CD40 PATHWAY | CD40/CD40L signaling |
0.1 | 0.9 | PID FAS PATHWAY | FAS (CD95) signaling pathway |
0.1 | 2.8 | PID PLK1 PATHWAY | PLK1 signaling events |
0.1 | 1.0 | ST TUMOR NECROSIS FACTOR PATHWAY | Tumor Necrosis Factor Pathway. |
0.1 | 0.4 | SA PTEN PATHWAY | PTEN is a tumor suppressor that dephosphorylates the lipid messenger phosphatidylinositol triphosphate. |
0.1 | 2.0 | ST PHOSPHOINOSITIDE 3 KINASE PATHWAY | PI3K Pathway |
0.1 | 0.8 | PID P38 MKK3 6PATHWAY | p38 MAPK signaling pathway |
0.1 | 2.8 | PID FANCONI PATHWAY | Fanconi anemia pathway |
0.1 | 0.6 | SIG CD40PATHWAYMAP | Genes related to CD40 signaling |
0.1 | 1.5 | PID MYC PATHWAY | C-MYC pathway |
0.1 | 0.1 | ST JAK STAT PATHWAY | Jak-STAT Pathway |
0.1 | 0.6 | SA PROGRAMMED CELL DEATH | Programmed cell death, or apoptosis, eliminates damaged or unneeded cells. |
0.1 | 2.6 | PID TNF PATHWAY | TNF receptor signaling pathway |
0.1 | 0.6 | PID BARD1 PATHWAY | BARD1 signaling events |
0.1 | 0.2 | PID AVB3 INTEGRIN PATHWAY | Integrins in angiogenesis |
0.1 | 0.2 | SA FAS SIGNALING | The TNF-type receptor Fas induces apoptosis on ligand binding. |
0.1 | 2.1 | PID TCPTP PATHWAY | Signaling events mediated by TCPTP |
0.1 | 0.5 | PID P38 ALPHA BETA PATHWAY | Regulation of p38-alpha and p38-beta |
0.1 | 0.4 | PID RANBP2 PATHWAY | Sumoylation by RanBP2 regulates transcriptional repression |
0.1 | 0.7 | PID CIRCADIAN PATHWAY | Circadian rhythm pathway |
0.1 | 1.1 | PID ALPHA SYNUCLEIN PATHWAY | Alpha-synuclein signaling |
0.1 | 1.3 | PID RHOA PATHWAY | RhoA signaling pathway |
0.1 | 0.4 | PID S1P S1P1 PATHWAY | S1P1 pathway |
0.1 | 0.2 | SA REG CASCADE OF CYCLIN EXPR | Expression of cyclins regulates progression through the cell cycle by activating cyclin-dependent kinases. |
0.1 | 2.3 | PID P53 REGULATION PATHWAY | p53 pathway |
0.1 | 0.6 | PID PI3KCI AKT PATHWAY | Class I PI3K signaling events mediated by Akt |
0.1 | 0.2 | ST INTERFERON GAMMA PATHWAY | Interferon gamma pathway. |
0.1 | 1.2 | PID THROMBIN PAR1 PATHWAY | PAR1-mediated thrombin signaling events |
0.1 | 0.5 | PID ERBB1 RECEPTOR PROXIMAL PATHWAY | EGF receptor (ErbB1) signaling pathway |
0.1 | 0.7 | PID ERB GENOMIC PATHWAY | Validated nuclear estrogen receptor beta network |
0.1 | 0.9 | PID FOXM1 PATHWAY | FOXM1 transcription factor network |
0.1 | 0.3 | ST PAC1 RECEPTOR PATHWAY | PAC1 Receptor Pathway |
0.0 | 1.9 | PID TELOMERASE PATHWAY | Regulation of Telomerase |
0.0 | 0.0 | SIG BCR SIGNALING PATHWAY | Members of the BCR signaling pathway |
0.0 | 0.3 | PID IL2 STAT5 PATHWAY | IL2 signaling events mediated by STAT5 |
0.0 | 0.3 | PID AURORA A PATHWAY | Aurora A signaling |
0.0 | 0.4 | PID BETA CATENIN DEG PATHWAY | Degradation of beta catenin |
0.0 | 0.5 | SIG INSULIN RECEPTOR PATHWAY IN CARDIAC MYOCYTES | Genes related to the insulin receptor pathway |
0.0 | 1.6 | PID ERA GENOMIC PATHWAY | Validated nuclear estrogen receptor alpha network |
0.0 | 0.2 | PID RAC1 REG PATHWAY | Regulation of RAC1 activity |
0.0 | 2.0 | PID MYC ACTIV PATHWAY | Validated targets of C-MYC transcriptional activation |
0.0 | 0.8 | PID AMB2 NEUTROPHILS PATHWAY | amb2 Integrin signaling |
0.0 | 0.2 | PID HDAC CLASSIII PATHWAY | Signaling events mediated by HDAC Class III |
0.0 | 0.6 | PID TCR CALCIUM PATHWAY | Calcium signaling in the CD4+ TCR pathway |
0.0 | 0.1 | PID SYNDECAN 1 PATHWAY | Syndecan-1-mediated signaling events |
0.0 | 0.9 | PID CD8 TCR PATHWAY | TCR signaling in naïve CD8+ T cells |
0.0 | 0.1 | PID HIF1A PATHWAY | Hypoxic and oxygen homeostasis regulation of HIF-1-alpha |
0.0 | 0.6 | PID HDAC CLASSII PATHWAY | Signaling events mediated by HDAC Class II |
0.0 | 0.5 | PID IL6 7 PATHWAY | IL6-mediated signaling events |
0.0 | 0.1 | PID AVB3 OPN PATHWAY | Osteopontin-mediated events |
0.0 | 0.5 | PID FCER1 PATHWAY | Fc-epsilon receptor I signaling in mast cells |
0.0 | 0.2 | PID INSULIN GLUCOSE PATHWAY | Insulin-mediated glucose transport |
0.0 | 0.7 | PID AURORA B PATHWAY | Aurora B signaling |
0.0 | 0.1 | ST TYPE I INTERFERON PATHWAY | Type I Interferon (alpha/beta IFN) Pathway |
0.0 | 0.1 | PID ARF6 DOWNSTREAM PATHWAY | Arf6 downstream pathway |
0.0 | 0.4 | PID HIF2PATHWAY | HIF-2-alpha transcription factor network |
0.0 | 0.2 | PID VEGFR1 PATHWAY | VEGFR1 specific signals |
0.0 | 0.1 | PID PDGFRA PATHWAY | PDGFR-alpha signaling pathway |
0.0 | 0.4 | PID INTEGRIN A9B1 PATHWAY | Alpha9 beta1 integrin signaling events |
0.0 | 0.1 | PID ER NONGENOMIC PATHWAY | Plasma membrane estrogen receptor signaling |
0.0 | 0.6 | PID HDAC CLASSI PATHWAY | Signaling events mediated by HDAC Class I |
0.0 | 0.5 | PID LIS1 PATHWAY | Lissencephaly gene (LIS1) in neuronal migration and development |
0.0 | 0.4 | PID ARF 3PATHWAY | Arf1 pathway |
0.0 | 0.0 | PID MET PATHWAY | Signaling events mediated by Hepatocyte Growth Factor Receptor (c-Met) |
0.0 | 0.3 | ST WNT CA2 CYCLIC GMP PATHWAY | Wnt/Ca2+/cyclic GMP signaling. |
0.0 | 0.8 | PID HIF1 TFPATHWAY | HIF-1-alpha transcription factor network |
0.0 | 0.0 | PID SYNDECAN 3 PATHWAY | Syndecan-3-mediated signaling events |
0.0 | 0.7 | PID ARF6 TRAFFICKING PATHWAY | Arf6 trafficking events |
0.0 | 0.2 | SIG PIP3 SIGNALING IN CARDIAC MYOCTES | Genes related to PIP3 signaling in cardiac myocytes |
0.0 | 0.5 | PID LKB1 PATHWAY | LKB1 signaling events |
0.0 | 0.1 | ST G ALPHA I PATHWAY | G alpha i Pathway |
0.0 | 0.5 | PID AR PATHWAY | Coregulation of Androgen receptor activity |
0.0 | 0.2 | PID FRA PATHWAY | Validated transcriptional targets of AP1 family members Fra1 and Fra2 |
0.0 | 0.6 | PID ERBB1 DOWNSTREAM PATHWAY | ErbB1 downstream signaling |
0.0 | 0.5 | PID E2F PATHWAY | E2F transcription factor network |
0.0 | 0.1 | ST JNK MAPK PATHWAY | JNK MAPK Pathway |
0.0 | 0.4 | PID IL12 2PATHWAY | IL12-mediated signaling events |
0.0 | 0.1 | PID ATM PATHWAY | ATM pathway |
0.0 | 1.0 | PID P53 DOWNSTREAM PATHWAY | Direct p53 effectors |
0.0 | 0.3 | PID ILK PATHWAY | Integrin-linked kinase signaling |
0.0 | 0.0 | PID NFKAPPAB ATYPICAL PATHWAY | Atypical NF-kappaB pathway |
0.0 | 0.1 | PID PTP1B PATHWAY | Signaling events mediated by PTP1B |
0.0 | 0.2 | PID IL1 PATHWAY | IL1-mediated signaling events |
0.0 | 0.1 | PID IL23 PATHWAY | IL23-mediated signaling events |
0.0 | 0.2 | PID NFAT TFPATHWAY | Calcineurin-regulated NFAT-dependent transcription in lymphocytes |
0.0 | 0.1 | ST DIFFERENTIATION PATHWAY IN PC12 CELLS | Differentiation Pathway in PC12 Cells; this is a specific case of PAC1 Receptor Pathway. |
0.0 | 0.1 | PID PI3KCI PATHWAY | Class I PI3K signaling events |
0.0 | 0.1 | PID SMAD2 3PATHWAY | Regulation of cytoplasmic and nuclear SMAD2/3 signaling |
0.0 | 0.1 | PID TCR PATHWAY | TCR signaling in naïve CD4+ T cells |
0.0 | 0.1 | PID BCR 5PATHWAY | BCR signaling pathway |
0.0 | 0.0 | SA CASPASE CASCADE | Apoptosis is mediated by caspases, cysteine proteases arranged in a proteolytic cascade. |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.3 | 4.0 | REACTOME METABOLISM OF PORPHYRINS | Genes involved in Metabolism of porphyrins |
0.2 | 0.2 | REACTOME APC C CDC20 MEDIATED DEGRADATION OF MITOTIC PROTEINS | Genes involved in APC/C:Cdc20 mediated degradation of mitotic proteins |
0.2 | 1.1 | REACTOME REGULATION OF ORNITHINE DECARBOXYLASE ODC | Genes involved in Regulation of ornithine decarboxylase (ODC) |
0.2 | 4.1 | REACTOME DARPP 32 EVENTS | Genes involved in DARPP-32 events |
0.1 | 2.5 | REACTOME SIGNALING BY CONSTITUTIVELY ACTIVE EGFR | Genes involved in Signaling by constitutively active EGFR |
0.1 | 0.4 | REACTOME APC C CDH1 MEDIATED DEGRADATION OF CDC20 AND OTHER APC C CDH1 TARGETED PROTEINS IN LATE MITOSIS EARLY G1 | Genes involved in APC/C:Cdh1 mediated degradation of Cdc20 and other APC/C:Cdh1 targeted proteins in late mitosis/early G1 |
0.1 | 0.1 | REACTOME ALPHA LINOLENIC ACID ALA METABOLISM | Genes involved in alpha-linolenic acid (ALA) metabolism |
0.1 | 0.3 | REACTOME NEF MEDIATED DOWNREGULATION OF MHC CLASS I COMPLEX CELL SURFACE EXPRESSION | Genes involved in Nef mediated downregulation of MHC class I complex cell surface expression |
0.1 | 0.5 | REACTOME DESTABILIZATION OF MRNA BY TRISTETRAPROLIN TTP | Genes involved in Destabilization of mRNA by Tristetraprolin (TTP) |
0.1 | 1.6 | REACTOME GRB2 SOS PROVIDES LINKAGE TO MAPK SIGNALING FOR INTERGRINS | Genes involved in GRB2:SOS provides linkage to MAPK signaling for Intergrins |
0.1 | 2.7 | REACTOME LYSOSOME VESICLE BIOGENESIS | Genes involved in Lysosome Vesicle Biogenesis |
0.1 | 0.5 | REACTOME SPRY REGULATION OF FGF SIGNALING | Genes involved in Spry regulation of FGF signaling |
0.1 | 2.5 | REACTOME CHOLESTEROL BIOSYNTHESIS | Genes involved in Cholesterol biosynthesis |
0.1 | 1.5 | REACTOME PURINE SALVAGE | Genes involved in Purine salvage |
0.1 | 1.8 | REACTOME CYCLIN A B1 ASSOCIATED EVENTS DURING G2 M TRANSITION | Genes involved in Cyclin A/B1 associated events during G2/M transition |
0.1 | 1.9 | REACTOME ACTIVATED TAK1 MEDIATES P38 MAPK ACTIVATION | Genes involved in activated TAK1 mediates p38 MAPK activation |
0.1 | 1.1 | REACTOME REGULATION OF COMPLEMENT CASCADE | Genes involved in Regulation of Complement cascade |
0.1 | 1.4 | REACTOME CELL EXTRACELLULAR MATRIX INTERACTIONS | Genes involved in Cell-extracellular matrix interactions |
0.1 | 1.3 | REACTOME REGULATION OF PYRUVATE DEHYDROGENASE PDH COMPLEX | Genes involved in Regulation of pyruvate dehydrogenase (PDH) complex |
0.1 | 1.7 | REACTOME PRE NOTCH PROCESSING IN GOLGI | Genes involved in Pre-NOTCH Processing in Golgi |
0.1 | 2.0 | REACTOME APC CDC20 MEDIATED DEGRADATION OF NEK2A | Genes involved in APC-Cdc20 mediated degradation of Nek2A |
0.1 | 1.1 | REACTOME PASSIVE TRANSPORT BY AQUAPORINS | Genes involved in Passive Transport by Aquaporins |
0.1 | 0.3 | REACTOME G ALPHA Q SIGNALLING EVENTS | Genes involved in G alpha (q) signalling events |
0.1 | 1.4 | REACTOME REGULATION OF AMPK ACTIVITY VIA LKB1 | Genes involved in Regulation of AMPK activity via LKB1 |
0.1 | 0.6 | REACTOME SHC1 EVENTS IN EGFR SIGNALING | Genes involved in SHC1 events in EGFR signaling |
0.1 | 0.2 | REACTOME SCF BETA TRCP MEDIATED DEGRADATION OF EMI1 | Genes involved in SCF-beta-TrCP mediated degradation of Emi1 |
0.1 | 1.6 | REACTOME POST CHAPERONIN TUBULIN FOLDING PATHWAY | Genes involved in Post-chaperonin tubulin folding pathway |
0.1 | 0.7 | REACTOME SIGNAL REGULATORY PROTEIN SIRP FAMILY INTERACTIONS | Genes involved in Signal regulatory protein (SIRP) family interactions |
0.1 | 1.4 | REACTOME ZINC TRANSPORTERS | Genes involved in Zinc transporters |
0.1 | 0.1 | REACTOME ADVANCED GLYCOSYLATION ENDPRODUCT RECEPTOR SIGNALING | Genes involved in Advanced glycosylation endproduct receptor signaling |
0.1 | 2.3 | REACTOME RNA POL III TRANSCRIPTION INITIATION FROM TYPE 3 PROMOTER | Genes involved in RNA Polymerase III Transcription Initiation From Type 3 Promoter |
0.1 | 0.2 | REACTOME SYNTHESIS OF PIPS AT THE EARLY ENDOSOME MEMBRANE | Genes involved in Synthesis of PIPs at the early endosome membrane |
0.1 | 0.7 | REACTOME IL 7 SIGNALING | Genes involved in Interleukin-7 signaling |
0.1 | 2.5 | REACTOME SYNTHESIS OF PIPS AT THE PLASMA MEMBRANE | Genes involved in Synthesis of PIPs at the plasma membrane |
0.1 | 0.1 | REACTOME MRNA DECAY BY 3 TO 5 EXORIBONUCLEASE | Genes involved in mRNA Decay by 3' to 5' Exoribonuclease |
0.1 | 1.4 | REACTOME TERMINATION OF O GLYCAN BIOSYNTHESIS | Genes involved in Termination of O-glycan biosynthesis |
0.1 | 0.8 | REACTOME ACTIVATION OF CHAPERONE GENES BY ATF6 ALPHA | Genes involved in Activation of Chaperone Genes by ATF6-alpha |
0.1 | 2.3 | REACTOME SPHINGOLIPID DE NOVO BIOSYNTHESIS | Genes involved in Sphingolipid de novo biosynthesis |
0.1 | 0.4 | REACTOME REGULATION OF WATER BALANCE BY RENAL AQUAPORINS | Genes involved in Regulation of Water Balance by Renal Aquaporins |
0.1 | 1.2 | REACTOME EGFR DOWNREGULATION | Genes involved in EGFR downregulation |
0.1 | 0.4 | REACTOME PLATELET SENSITIZATION BY LDL | Genes involved in Platelet sensitization by LDL |
0.1 | 0.9 | REACTOME GLYCOGEN BREAKDOWN GLYCOGENOLYSIS | Genes involved in Glycogen breakdown (glycogenolysis) |
0.1 | 4.0 | REACTOME ER PHAGOSOME PATHWAY | Genes involved in ER-Phagosome pathway |
0.1 | 0.1 | REACTOME ENERGY DEPENDENT REGULATION OF MTOR BY LKB1 AMPK | Genes involved in Energy dependent regulation of mTOR by LKB1-AMPK |
0.1 | 2.3 | REACTOME ABC FAMILY PROTEINS MEDIATED TRANSPORT | Genes involved in ABC-family proteins mediated transport |
0.1 | 2.0 | REACTOME NEGATIVE REGULATORS OF RIG I MDA5 SIGNALING | Genes involved in Negative regulators of RIG-I/MDA5 signaling |
0.1 | 0.9 | REACTOME SYNTHESIS OF PIPS AT THE GOLGI MEMBRANE | Genes involved in Synthesis of PIPs at the Golgi membrane |
0.1 | 0.6 | REACTOME THE ACTIVATION OF ARYLSULFATASES | Genes involved in The activation of arylsulfatases |
0.1 | 3.0 | REACTOME GLUCOSE TRANSPORT | Genes involved in Glucose transport |
0.1 | 0.6 | REACTOME GAMMA CARBOXYLATION TRANSPORT AND AMINO TERMINAL CLEAVAGE OF PROTEINS | Genes involved in Gamma-carboxylation, transport, and amino-terminal cleavage of proteins |
0.1 | 0.8 | REACTOME REGULATION OF INSULIN SECRETION BY ACETYLCHOLINE | Genes involved in Regulation of Insulin Secretion by Acetylcholine |
0.1 | 2.3 | REACTOME AMINO ACID TRANSPORT ACROSS THE PLASMA MEMBRANE | Genes involved in Amino acid transport across the plasma membrane |
0.1 | 0.3 | REACTOME RNA POL I PROMOTER OPENING | Genes involved in RNA Polymerase I Promoter Opening |
0.1 | 1.6 | REACTOME METABOLISM OF NON CODING RNA | Genes involved in Metabolism of non-coding RNA |
0.1 | 0.4 | REACTOME EXTENSION OF TELOMERES | Genes involved in Extension of Telomeres |
0.1 | 2.1 | REACTOME ION TRANSPORT BY P TYPE ATPASES | Genes involved in Ion transport by P-type ATPases |
0.1 | 1.4 | REACTOME MITOCHONDRIAL TRNA AMINOACYLATION | Genes involved in Mitochondrial tRNA aminoacylation |
0.1 | 1.4 | REACTOME PERK REGULATED GENE EXPRESSION | Genes involved in PERK regulated gene expression |
0.1 | 0.1 | REACTOME NEGATIVE REGULATION OF THE PI3K AKT NETWORK | Genes involved in Negative regulation of the PI3K/AKT network |
0.1 | 0.7 | REACTOME CYCLIN E ASSOCIATED EVENTS DURING G1 S TRANSITION | Genes involved in Cyclin E associated events during G1/S transition |
0.1 | 0.6 | REACTOME NONSENSE MEDIATED DECAY ENHANCED BY THE EXON JUNCTION COMPLEX | Genes involved in Nonsense Mediated Decay Enhanced by the Exon Junction Complex |
0.1 | 1.4 | REACTOME PYRIMIDINE METABOLISM | Genes involved in Pyrimidine metabolism |
0.1 | 1.7 | REACTOME ASSOCIATION OF TRIC CCT WITH TARGET PROTEINS DURING BIOSYNTHESIS | Genes involved in Association of TriC/CCT with target proteins during biosynthesis |
0.1 | 0.7 | REACTOME MTORC1 MEDIATED SIGNALLING | Genes involved in mTORC1-mediated signalling |
0.1 | 1.1 | REACTOME DOUBLE STRAND BREAK REPAIR | Genes involved in Double-Strand Break Repair |
0.1 | 0.7 | REACTOME REGULATION OF IFNG SIGNALING | Genes involved in Regulation of IFNG signaling |
0.1 | 0.1 | REACTOME PLATELET ADHESION TO EXPOSED COLLAGEN | Genes involved in Platelet Adhesion to exposed collagen |
0.1 | 0.7 | REACTOME SIGNALING BY FGFR1 FUSION MUTANTS | Genes involved in Signaling by FGFR1 fusion mutants |
0.1 | 1.1 | REACTOME FANCONI ANEMIA PATHWAY | Genes involved in Fanconi Anemia pathway |
0.1 | 0.4 | REACTOME G1 S SPECIFIC TRANSCRIPTION | Genes involved in G1/S-Specific Transcription |
0.1 | 3.8 | REACTOME MITOTIC PROMETAPHASE | Genes involved in Mitotic Prometaphase |
0.1 | 0.6 | REACTOME CDC6 ASSOCIATION WITH THE ORC ORIGIN COMPLEX | Genes involved in CDC6 association with the ORC:origin complex |
0.1 | 1.0 | REACTOME G0 AND EARLY G1 | Genes involved in G0 and Early G1 |
0.1 | 0.8 | REACTOME MEIOTIC RECOMBINATION | Genes involved in Meiotic Recombination |
0.1 | 1.1 | REACTOME SYNTHESIS OF PC | Genes involved in Synthesis of PC |
0.1 | 2.6 | REACTOME METABOLISM OF VITAMINS AND COFACTORS | Genes involved in Metabolism of vitamins and cofactors |
0.1 | 0.7 | REACTOME FORMATION OF ATP BY CHEMIOSMOTIC COUPLING | Genes involved in Formation of ATP by chemiosmotic coupling |
0.1 | 0.6 | REACTOME PURINE RIBONUCLEOSIDE MONOPHOSPHATE BIOSYNTHESIS | Genes involved in Purine ribonucleoside monophosphate biosynthesis |
0.1 | 0.6 | REACTOME RNA POL I TRANSCRIPTION TERMINATION | Genes involved in RNA Polymerase I Transcription Termination |
0.1 | 1.1 | REACTOME GLUTATHIONE CONJUGATION | Genes involved in Glutathione conjugation |
0.1 | 0.7 | REACTOME MRNA SPLICING MINOR PATHWAY | Genes involved in mRNA Splicing - Minor Pathway |
0.1 | 0.7 | REACTOME INTRINSIC PATHWAY | Genes involved in Intrinsic Pathway |
0.1 | 0.6 | REACTOME TGF BETA RECEPTOR SIGNALING IN EMT EPITHELIAL TO MESENCHYMAL TRANSITION | Genes involved in TGF-beta receptor signaling in EMT (epithelial to mesenchymal transition) |
0.1 | 0.2 | REACTOME NFKB ACTIVATION THROUGH FADD RIP1 PATHWAY MEDIATED BY CASPASE 8 AND10 | Genes involved in NF-kB activation through FADD/RIP-1 pathway mediated by caspase-8 and -10 |
0.1 | 2.0 | REACTOME LOSS OF NLP FROM MITOTIC CENTROSOMES | Genes involved in Loss of Nlp from mitotic centrosomes |
0.1 | 0.6 | REACTOME THE ROLE OF NEF IN HIV1 REPLICATION AND DISEASE PATHOGENESIS | Genes involved in The role of Nef in HIV-1 replication and disease pathogenesis |
0.1 | 0.3 | REACTOME ETHANOL OXIDATION | Genes involved in Ethanol oxidation |
0.1 | 0.9 | REACTOME SIGNALING BY NODAL | Genes involved in Signaling by NODAL |
0.1 | 1.3 | REACTOME RNA POL II TRANSCRIPTION PRE INITIATION AND PROMOTER OPENING | Genes involved in RNA Polymerase II Transcription Pre-Initiation And Promoter Opening |
0.1 | 0.5 | REACTOME DEADENYLATION OF MRNA | Genes involved in Deadenylation of mRNA |
0.1 | 0.3 | REACTOME INTERACTIONS OF VPR WITH HOST CELLULAR PROTEINS | Genes involved in Interactions of Vpr with host cellular proteins |
0.1 | 1.4 | REACTOME GOLGI ASSOCIATED VESICLE BIOGENESIS | Genes involved in Golgi Associated Vesicle Biogenesis |
0.1 | 0.1 | REACTOME VIF MEDIATED DEGRADATION OF APOBEC3G | Genes involved in Vif-mediated degradation of APOBEC3G |
0.1 | 1.6 | REACTOME MRNA 3 END PROCESSING | Genes involved in mRNA 3'-end processing |
0.1 | 0.4 | REACTOME HORMONE SENSITIVE LIPASE HSL MEDIATED TRIACYLGLYCEROL HYDROLYSIS | Genes involved in Hormone-sensitive lipase (HSL)-mediated triacylglycerol hydrolysis |
0.1 | 0.9 | REACTOME CITRIC ACID CYCLE TCA CYCLE | Genes involved in Citric acid cycle (TCA cycle) |
0.1 | 0.5 | REACTOME REGULATORY RNA PATHWAYS | Genes involved in Regulatory RNA pathways |
0.1 | 0.1 | REACTOME CONVERSION FROM APC C CDC20 TO APC C CDH1 IN LATE ANAPHASE | Genes involved in Conversion from APC/C:Cdc20 to APC/C:Cdh1 in late anaphase |
0.0 | 1.0 | REACTOME ANTIVIRAL MECHANISM BY IFN STIMULATED GENES | Genes involved in Antiviral mechanism by IFN-stimulated genes |
0.0 | 0.3 | REACTOME REMOVAL OF THE FLAP INTERMEDIATE FROM THE C STRAND | Genes involved in Removal of the Flap Intermediate from the C-strand |
0.0 | 0.3 | REACTOME PHOSPHORYLATION OF CD3 AND TCR ZETA CHAINS | Genes involved in Phosphorylation of CD3 and TCR zeta chains |
0.0 | 0.2 | REACTOME PACKAGING OF TELOMERE ENDS | Genes involved in Packaging Of Telomere Ends |
0.0 | 0.6 | REACTOME METABOLISM OF POLYAMINES | Genes involved in Metabolism of polyamines |
0.0 | 0.7 | REACTOME CHYLOMICRON MEDIATED LIPID TRANSPORT | Genes involved in Chylomicron-mediated lipid transport |
0.0 | 0.1 | REACTOME MRNA CAPPING | Genes involved in mRNA Capping |
0.0 | 0.2 | REACTOME THROMBIN SIGNALLING THROUGH PROTEINASE ACTIVATED RECEPTORS PARS | Genes involved in Thrombin signalling through proteinase activated receptors (PARs) |
0.0 | 0.3 | REACTOME ACTIVATED AMPK STIMULATES FATTY ACID OXIDATION IN MUSCLE | Genes involved in Activated AMPK stimulates fatty-acid oxidation in muscle |
0.0 | 0.2 | REACTOME IRAK1 RECRUITS IKK COMPLEX | Genes involved in IRAK1 recruits IKK complex |
0.0 | 1.1 | REACTOME BIOSYNTHESIS OF THE N GLYCAN PRECURSOR DOLICHOL LIPID LINKED OLIGOSACCHARIDE LLO AND TRANSFER TO A NASCENT PROTEIN | Genes involved in Biosynthesis of the N-glycan precursor (dolichol lipid-linked oligosaccharide, LLO) and transfer to a nascent protein |
0.0 | 0.4 | REACTOME PYRUVATE METABOLISM AND CITRIC ACID TCA CYCLE | Genes involved in Pyruvate metabolism and Citric Acid (TCA) cycle |
0.0 | 0.5 | REACTOME TRAF6 MEDIATED NFKB ACTIVATION | Genes involved in TRAF6 mediated NF-kB activation |
0.0 | 0.2 | REACTOME JNK C JUN KINASES PHOSPHORYLATION AND ACTIVATION MEDIATED BY ACTIVATED HUMAN TAK1 | Genes involved in JNK (c-Jun kinases) phosphorylation and activation mediated by activated human TAK1 |
0.0 | 0.9 | REACTOME INTRINSIC PATHWAY FOR APOPTOSIS | Genes involved in Intrinsic Pathway for Apoptosis |
0.0 | 0.0 | REACTOME RETROGRADE NEUROTROPHIN SIGNALLING | Genes involved in Retrograde neurotrophin signalling |
0.0 | 0.0 | REACTOME P53 DEPENDENT G1 DNA DAMAGE RESPONSE | Genes involved in p53-Dependent G1 DNA Damage Response |
0.0 | 0.6 | REACTOME TRAF6 MEDIATED IRF7 ACTIVATION | Genes involved in TRAF6 mediated IRF7 activation |
0.0 | 0.3 | REACTOME GENERATION OF SECOND MESSENGER MOLECULES | Genes involved in Generation of second messenger molecules |
0.0 | 0.9 | REACTOME POST TRANSLATIONAL MODIFICATION SYNTHESIS OF GPI ANCHORED PROTEINS | Genes involved in Post-translational modification: synthesis of GPI-anchored proteins |
0.0 | 0.3 | REACTOME G1 PHASE | Genes involved in G1 Phase |
0.0 | 0.4 | REACTOME SEMA3A PAK DEPENDENT AXON REPULSION | Genes involved in Sema3A PAK dependent Axon repulsion |
0.0 | 1.3 | REACTOME NOTCH1 INTRACELLULAR DOMAIN REGULATES TRANSCRIPTION | Genes involved in NOTCH1 Intracellular Domain Regulates Transcription |
0.0 | 0.4 | REACTOME HYALURONAN UPTAKE AND DEGRADATION | Genes involved in Hyaluronan uptake and degradation |
0.0 | 0.9 | REACTOME DNA REPLICATION | Genes involved in DNA Replication |
0.0 | 0.7 | REACTOME CYTOSOLIC TRNA AMINOACYLATION | Genes involved in Cytosolic tRNA aminoacylation |
0.0 | 0.3 | REACTOME TRYPTOPHAN CATABOLISM | Genes involved in Tryptophan catabolism |
0.0 | 0.1 | REACTOME REGULATION OF KIT SIGNALING | Genes involved in Regulation of KIT signaling |
0.0 | 0.2 | REACTOME PURINE METABOLISM | Genes involved in Purine metabolism |
0.0 | 1.0 | REACTOME TRANSPORT TO THE GOLGI AND SUBSEQUENT MODIFICATION | Genes involved in Transport to the Golgi and subsequent modification |
0.0 | 0.1 | REACTOME TRANS GOLGI NETWORK VESICLE BUDDING | Genes involved in trans-Golgi Network Vesicle Budding |
0.0 | 4.1 | REACTOME TRANSLATION | Genes involved in Translation |
0.0 | 0.1 | REACTOME ENDOSOMAL VACUOLAR PATHWAY | Genes involved in Endosomal/Vacuolar pathway |
0.0 | 0.0 | REACTOME FRS2 MEDIATED CASCADE | Genes involved in FRS2-mediated cascade |
0.0 | 0.1 | REACTOME ANTIGEN PRESENTATION FOLDING ASSEMBLY AND PEPTIDE LOADING OF CLASS I MHC | Genes involved in Antigen Presentation: Folding, assembly and peptide loading of class I MHC |
0.0 | 0.5 | REACTOME BRANCHED CHAIN AMINO ACID CATABOLISM | Genes involved in Branched-chain amino acid catabolism |
0.0 | 1.2 | REACTOME PROCESSING OF CAPPED INTRON CONTAINING PRE MRNA | Genes involved in Processing of Capped Intron-Containing Pre-mRNA |
0.0 | 0.3 | REACTOME MITOCHONDRIAL FATTY ACID BETA OXIDATION | Genes involved in Mitochondrial Fatty Acid Beta-Oxidation |
0.0 | 1.8 | REACTOME GLYCEROPHOSPHOLIPID BIOSYNTHESIS | Genes involved in Glycerophospholipid biosynthesis |
0.0 | 0.4 | REACTOME AMINO ACID SYNTHESIS AND INTERCONVERSION TRANSAMINATION | Genes involved in Amino acid synthesis and interconversion (transamination) |
0.0 | 1.1 | REACTOME MHC CLASS II ANTIGEN PRESENTATION | Genes involved in MHC class II antigen presentation |
0.0 | 0.1 | REACTOME ACTIVATION OF CHAPERONES BY ATF6 ALPHA | Genes involved in Activation of Chaperones by ATF6-alpha |
0.0 | 1.1 | REACTOME MITOCHONDRIAL PROTEIN IMPORT | Genes involved in Mitochondrial Protein Import |
0.0 | 0.2 | REACTOME TIE2 SIGNALING | Genes involved in Tie2 Signaling |
0.0 | 0.1 | REACTOME XENOBIOTICS | Genes involved in Xenobiotics |
0.0 | 0.7 | REACTOME INTERFERON ALPHA BETA SIGNALING | Genes involved in Interferon alpha/beta signaling |
0.0 | 1.7 | REACTOME TCA CYCLE AND RESPIRATORY ELECTRON TRANSPORT | Genes involved in The citric acid (TCA) cycle and respiratory electron transport |
0.0 | 0.9 | REACTOME UNFOLDED PROTEIN RESPONSE | Genes involved in Unfolded Protein Response |
0.0 | 0.2 | REACTOME PROSTANOID LIGAND RECEPTORS | Genes involved in Prostanoid ligand receptors |
0.0 | 0.4 | REACTOME SULFUR AMINO ACID METABOLISM | Genes involved in Sulfur amino acid metabolism |
0.0 | 0.3 | REACTOME DEADENYLATION DEPENDENT MRNA DECAY | Genes involved in Deadenylation-dependent mRNA decay |
0.0 | 1.2 | REACTOME FACTORS INVOLVED IN MEGAKARYOCYTE DEVELOPMENT AND PLATELET PRODUCTION | Genes involved in Factors involved in megakaryocyte development and platelet production |
0.0 | 0.2 | REACTOME ACTIVATION OF RAC | Genes involved in Activation of Rac |
0.0 | 0.2 | REACTOME CELL CYCLE CHECKPOINTS | Genes involved in Cell Cycle Checkpoints |
0.0 | 0.1 | REACTOME COPI MEDIATED TRANSPORT | Genes involved in COPI Mediated Transport |
0.0 | 0.0 | REACTOME RECEPTOR LIGAND BINDING INITIATES THE SECOND PROTEOLYTIC CLEAVAGE OF NOTCH RECEPTOR | Genes involved in Receptor-ligand binding initiates the second proteolytic cleavage of Notch receptor |
0.0 | 0.3 | REACTOME RNA POL I RNA POL III AND MITOCHONDRIAL TRANSCRIPTION | Genes involved in RNA Polymerase I, RNA Polymerase III, and Mitochondrial Transcription |
0.0 | 0.3 | REACTOME HS GAG DEGRADATION | Genes involved in HS-GAG degradation |
0.0 | 0.0 | REACTOME APOBEC3G MEDIATED RESISTANCE TO HIV1 INFECTION | Genes involved in APOBEC3G mediated resistance to HIV-1 infection |
0.0 | 0.3 | REACTOME AMYLOIDS | Genes involved in Amyloids |
0.0 | 0.1 | REACTOME HYALURONAN METABOLISM | Genes involved in Hyaluronan metabolism |
0.0 | 0.1 | REACTOME ERK MAPK TARGETS | Genes involved in ERK/MAPK targets |
0.0 | 0.1 | REACTOME PREFOLDIN MEDIATED TRANSFER OF SUBSTRATE TO CCT TRIC | Genes involved in Prefoldin mediated transfer of substrate to CCT/TriC |
0.0 | 2.1 | REACTOME ANTIGEN PROCESSING UBIQUITINATION PROTEASOME DEGRADATION | Genes involved in Antigen processing: Ubiquitination & Proteasome degradation |
0.0 | 0.1 | REACTOME PROLONGED ERK ACTIVATION EVENTS | Genes involved in Prolonged ERK activation events |
0.0 | 0.2 | REACTOME IL1 SIGNALING | Genes involved in Interleukin-1 signaling |
0.0 | 0.2 | REACTOME SIGNALING BY NOTCH4 | Genes involved in Signaling by NOTCH4 |
0.0 | 0.0 | REACTOME CD28 DEPENDENT VAV1 PATHWAY | Genes involved in CD28 dependent Vav1 pathway |
0.0 | 0.2 | REACTOME CYTOSOLIC SULFONATION OF SMALL MOLECULES | Genes involved in Cytosolic sulfonation of small molecules |
0.0 | 0.0 | REACTOME SOS MEDIATED SIGNALLING | Genes involved in SOS-mediated signalling |
0.0 | 0.2 | REACTOME PEROXISOMAL LIPID METABOLISM | Genes involved in Peroxisomal lipid metabolism |
0.0 | 0.1 | REACTOME NA CL DEPENDENT NEUROTRANSMITTER TRANSPORTERS | Genes involved in Na+/Cl- dependent neurotransmitter transporters |
0.0 | 0.0 | REACTOME INFLUENZA VIRAL RNA TRANSCRIPTION AND REPLICATION | Genes involved in Influenza Viral RNA Transcription and Replication |
0.0 | 0.4 | REACTOME DNA REPAIR | Genes involved in DNA Repair |
0.0 | 0.5 | REACTOME AMINE LIGAND BINDING RECEPTORS | Genes involved in Amine ligand-binding receptors |
0.0 | 0.1 | REACTOME RECYCLING PATHWAY OF L1 | Genes involved in Recycling pathway of L1 |
0.0 | 0.0 | REACTOME CLEAVAGE OF GROWING TRANSCRIPT IN THE TERMINATION REGION | Genes involved in Cleavage of Growing Transcript in the Termination Region |
0.0 | 0.0 | REACTOME BASIGIN INTERACTIONS | Genes involved in Basigin interactions |
0.0 | 0.7 | REACTOME TRANSPORT OF INORGANIC CATIONS ANIONS AND AMINO ACIDS OLIGOPEPTIDES | Genes involved in Transport of inorganic cations/anions and amino acids/oligopeptides |
0.0 | 0.3 | REACTOME O LINKED GLYCOSYLATION OF MUCINS | Genes involved in O-linked glycosylation of mucins |
0.0 | 0.1 | REACTOME BETA DEFENSINS | Genes involved in Beta defensins |
0.0 | 0.2 | REACTOME HS GAG BIOSYNTHESIS | Genes involved in HS-GAG biosynthesis |
0.0 | 0.0 | REACTOME SHC RELATED EVENTS | Genes involved in SHC-related events |