Gene Symbol | Gene ID | Gene Info |
---|---|---|
E2f6
|
ENSMUSG00000057469.7 | E2f6 |
CRE | Gene | Distance | Association probability | Pearson corr. coef. | P-value | Plot |
---|---|---|---|---|---|---|
E2f6 | chr12_16818654_16818818 | 1525 | 0.317000 | -0.67 | 2.8e-08 | Click! |
E2f6 | chr12_16810587_16810810 | 265 | 0.884889 | -0.65 | 6.3e-08 | Click! |
E2f6 | chr12_16818435_16818586 | 1751 | 0.281037 | -0.56 | 9.5e-06 | Click! |
E2f6 | chr12_16818925_16819076 | 1261 | 0.376326 | -0.56 | 1.1e-05 | Click! |
E2f6 | chr12_16810850_16811078 | 1 | 0.968975 | -0.52 | 4.8e-05 | Click! |
Move your cursor over a bar to see sample name and corresponding Z-value.
Cis Regulatory Element (CRE) | Target Score | Top associated gene | Gene Info | Distance of CRE to TSS | CRE/Gene association probability |
---|---|---|---|---|---|
chr15_79690079_79691459 | 12.38 |
Gtpbp1 |
GTP binding protein 1 |
76 |
0.92 |
chr10_127508848_127510720 | 10.09 |
Stac3 |
SH3 and cysteine rich domain 3 |
2559 |
0.15 |
chr15_102470670_102471447 | 9.70 |
Pcbp2 |
poly(rC) binding protein 2 |
10 |
0.95 |
chr2_38286754_38287566 | 7.84 |
Dennd1a |
DENN/MADD domain containing 1A |
28 |
0.97 |
chr1_166002288_166003185 | 7.45 |
Pou2f1 |
POU domain, class 2, transcription factor 1 |
58 |
0.72 |
chr14_115040506_115042372 | 6.94 |
Mir17hg |
Mir17 host gene (non-protein coding) |
1440 |
0.19 |
chr14_25606696_25608421 | 6.30 |
Zmiz1 |
zinc finger, MIZ-type containing 1 |
201 |
0.95 |
chr11_88068171_88069196 | 6.18 |
Vezf1 |
vascular endothelial zinc finger 1 |
404 |
0.76 |
chr8_107095919_107096832 | 5.96 |
Terf2 |
telomeric repeat binding factor 2 |
139 |
0.66 |
chr9_51008308_51009431 | 5.81 |
Sik2 |
salt inducible kinase 2 |
67 |
0.97 |
chrX_42067696_42069057 | 5.52 |
Xiap |
X-linked inhibitor of apoptosis |
22 |
0.98 |
chr8_70609185_70610414 | 5.34 |
Gm45546 |
predicted gene 45546 |
626 |
0.42 |
chrX_142680720_142682167 | 5.33 |
Tmem164 |
transmembrane protein 164 |
25 |
0.98 |
chr6_115852875_115853903 | 5.32 |
Mbd4 |
methyl-CpG binding domain protein 4 |
18 |
0.55 |
chr9_111057150_111057866 | 5.32 |
Ccrl2 |
chemokine (C-C motif) receptor-like 2 |
11 |
0.95 |
chr4_129513695_129514851 | 5.31 |
Marcksl1 |
MARCKS-like 1 |
692 |
0.46 |
chr5_143731658_143732384 | 5.31 |
Usp42 |
ubiquitin specific peptidase 42 |
259 |
0.91 |
chr2_170130477_170131578 | 5.19 |
Zfp217 |
zinc finger protein 217 |
193 |
0.97 |
chr3_144201827_144203140 | 5.13 |
Lmo4 |
LIM domain only 4 |
87 |
0.97 |
chr17_28769114_28769410 | 5.06 |
Mapk13 |
mitogen-activated protein kinase 13 |
35 |
0.96 |
chr14_76504101_76505194 | 5.00 |
Tsc22d1 |
TSC22 domain family, member 1 |
117 |
0.97 |
chr9_100643446_100643943 | 4.97 |
Stag1 |
stromal antigen 1 |
58 |
0.97 |
chr8_70698268_70700333 | 4.84 |
Jund |
jun D proto-oncogene |
351 |
0.45 |
chr12_76709620_76710348 | 4.80 |
Sptb |
spectrin beta, erythrocytic |
39 |
0.98 |
chr4_133552955_133553552 | 4.76 |
Nr0b2 |
nuclear receptor subfamily 0, group B, member 2 |
123 |
0.92 |
chr13_58402391_58403113 | 4.72 |
Rmi1 |
RecQ mediated genome instability 1 |
52 |
0.56 |
chr9_62838488_62838893 | 4.69 |
Cln6 |
ceroid-lipofuscinosis, neuronal 6 |
95 |
0.95 |
chr2_125122926_125123420 | 4.68 |
Myef2 |
myelin basic protein expression factor 2, repressor |
241 |
0.89 |
chr1_75136418_75136604 | 4.67 |
Cnppd1 |
cyclin Pas1/PHO80 domain containing 1 |
1295 |
0.23 |
chr11_19924323_19926342 | 4.66 |
Spred2 |
sprouty-related EVH1 domain containing 2 |
890 |
0.71 |
chr11_117114876_117115708 | 4.65 |
Sec14l1 |
SEC14-like lipid binding 1 |
40 |
0.96 |
chr15_103014087_103015222 | 4.64 |
Mir615 |
microRNA 615 |
256 |
0.74 |
chr7_48880950_48881793 | 4.62 |
Gm2788 |
predicted gene 2788 |
71 |
0.71 |
chr7_36697059_36698174 | 4.57 |
Tshz3 |
teashirt zinc finger family member 3 |
502 |
0.7 |
chr8_11008854_11009914 | 4.49 |
Irs2 |
insulin receptor substrate 2 |
926 |
0.42 |
chr9_66158067_66158548 | 4.47 |
Dapk2 |
death-associated protein kinase 2 |
72 |
0.97 |
chr11_53818750_53818901 | 4.42 |
Gm12216 |
predicted gene 12216 |
22950 |
0.11 |
chr8_123156122_123156399 | 4.41 |
Sult5a1 |
sulfotransferase family 5A, member 1 |
1968 |
0.15 |
chr2_153492229_153493481 | 4.40 |
4930404H24Rik |
RIKEN cDNA 4930404H24 gene |
65 |
0.82 |
chr2_148045489_148046522 | 4.37 |
Foxa2 |
forkhead box A2 |
57 |
0.97 |
chr14_70074487_70075571 | 4.34 |
Egr3 |
early growth response 3 |
2174 |
0.25 |
chr9_62980541_62981320 | 4.33 |
Pias1 |
protein inhibitor of activated STAT 1 |
47 |
0.98 |
chr11_6444058_6445126 | 4.29 |
H2az2 |
H2A.Z histone variant 2 |
149 |
0.88 |
chr12_111945750_111946174 | 4.23 |
5033406O09Rik |
RIKEN cDNA 5033406O09 gene |
1478 |
0.25 |
chr15_98933816_98934775 | 4.17 |
Gm41396 |
predicted gene, 41396 |
30 |
0.62 |
chr5_22344110_22345571 | 4.13 |
Reln |
reelin |
138 |
0.95 |
chr9_110653586_110654769 | 4.13 |
Nbeal2 |
neurobeachin-like 2 |
16 |
0.94 |
chr16_4558782_4559702 | 4.03 |
Tfap4 |
transcription factor AP4 |
459 |
0.75 |
chr5_23850355_23851323 | 4.02 |
2700038G22Rik |
RIKEN cDNA 2700038G22 gene |
238 |
0.81 |
chr8_123982265_123983435 | 4.02 |
Abcb10 |
ATP-binding cassette, sub-family B (MDR/TAP), member 10 |
272 |
0.84 |
chr14_55822948_55823744 | 3.98 |
Nfatc4 |
nuclear factor of activated T cells, cytoplasmic, calcineurin dependent 4 |
202 |
0.87 |
chr9_109094576_109096217 | 3.97 |
Plxnb1 |
plexin B1 |
7 |
0.95 |
chr15_36793516_36794080 | 3.94 |
Ywhaz |
tyrosine 3-monooxygenase/tryptophan 5-monooxygenase activation protein, zeta polypeptide |
39 |
0.97 |
chr17_29490421_29490815 | 3.93 |
Pim1 |
proviral integration site 1 |
135 |
0.84 |
chr9_63757305_63758776 | 3.91 |
Smad3 |
SMAD family member 3 |
46 |
0.98 |
chr12_118301013_118301849 | 3.88 |
Sp4 |
trans-acting transcription factor 4 |
9 |
0.99 |
chr3_100488535_100489982 | 3.87 |
Tent5c |
terminal nucleotidyltransferase 5C |
60 |
0.85 |
chr16_4552562_4553162 | 3.85 |
Tfap4 |
transcription factor AP4 |
100 |
0.95 |
chr17_70850487_70852089 | 3.85 |
Tgif1 |
TGFB-induced factor homeobox 1 |
81 |
0.94 |
chr11_12036502_12038049 | 3.81 |
Grb10 |
growth factor receptor bound protein 10 |
126 |
0.97 |
chr17_34605954_34606404 | 3.78 |
Agpat1 |
1-acylglycerol-3-phosphate O-acyltransferase 1 (lysophosphatidic acid acyltransferase, alpha) |
206 |
0.78 |
chr8_33731690_33732464 | 3.78 |
Gtf2e2 |
general transcription factor II E, polypeptide 2 (beta subunit) |
35 |
0.77 |
chrX_36988645_36990253 | 3.74 |
Septin6 |
septin 6 |
42 |
0.97 |
chr11_87126714_87127907 | 3.72 |
Trim37 |
tripartite motif-containing 37 |
5 |
0.84 |
chr9_44881205_44881917 | 3.68 |
Gm39326 |
predicted gene, 39326 |
167 |
0.6 |
chr10_126978694_126979699 | 3.68 |
Ctdsp2 |
CTD (carboxy-terminal domain, RNA polymerase II, polypeptide A) small phosphatase 2 |
167 |
0.89 |
chr5_114566935_114567994 | 3.66 |
Fam222a |
family with sequence similarity 222, member A |
552 |
0.73 |
chr15_96709352_96710351 | 3.63 |
Gm38144 |
predicted gene, 38144 |
9678 |
0.18 |
chr5_107986404_107987625 | 3.59 |
Dipk1a |
divergent protein kinase domain 1A |
19 |
0.97 |
chr2_25982690_25983958 | 3.58 |
Camsap1 |
calmodulin regulated spectrin-associated protein 1 |
42 |
0.97 |
chr11_58199206_58199387 | 3.57 |
Igtp |
interferon gamma induced GTPase |
260 |
0.53 |
chr5_129019825_129020347 | 3.56 |
Ran |
RAN, member RAS oncogene family |
17 |
0.98 |
chr1_127756612_127756781 | 3.54 |
Acmsd |
amino carboxymuconate semialdehyde decarboxylase |
61 |
0.97 |
chr8_79638728_79640227 | 3.52 |
Otud4 |
OTU domain containing 4 |
141 |
0.96 |
chr4_133967146_133967733 | 3.51 |
Hmgn2 |
high mobility group nucleosomal binding domain 2 |
2 |
0.97 |
chr9_70678675_70679795 | 3.47 |
Adam10 |
a disintegrin and metallopeptidase domain 10 |
219 |
0.93 |
chr2_153161013_153161878 | 3.47 |
Tm9sf4 |
transmembrane 9 superfamily protein member 4 |
96 |
0.96 |
chr10_81524029_81524513 | 3.46 |
Gna15 |
guanine nucleotide binding protein, alpha 15 |
46 |
0.91 |
chr7_144581932_144582774 | 3.45 |
Fadd |
Fas (TNFRSF6)-associated via death domain |
110 |
0.96 |
chr2_167688545_167688770 | 3.43 |
Cebpb |
CCAAT/enhancer binding protein (C/EBP), beta |
258 |
0.81 |
chr5_137502130_137503030 | 3.43 |
Pop7 |
processing of precursor 7, ribonuclease P family, (S. cerevisiae) |
62 |
0.52 |
chr19_47178446_47179494 | 3.43 |
Neurl1a |
neuralized E3 ubiquitin protein ligase 1A |
52 |
0.95 |
chr11_70021148_70021981 | 3.43 |
Dlg4 |
discs large MAGUK scaffold protein 4 |
2356 |
0.11 |
chr17_34893833_34894655 | 3.42 |
Zbtb12 |
zinc finger and BTB domain containing 12 |
315 |
0.63 |
chr5_96951661_96952003 | 3.39 |
Gm43144 |
predicted gene 43144 |
11535 |
0.1 |
chr17_15375662_15377138 | 3.38 |
Dll1 |
delta like canonical Notch ligand 1 |
424 |
0.8 |
chr5_65698076_65698722 | 3.37 |
Pds5a |
PDS5 cohesin associated factor A |
126 |
0.94 |
chr9_57644752_57646108 | 3.36 |
Csk |
c-src tyrosine kinase |
187 |
0.91 |
chr5_115631746_115632284 | 3.36 |
Rab35 |
RAB35, member RAS oncogene family |
107 |
0.62 |
chr12_21417524_21418002 | 3.33 |
Gm4419 |
predicted gene 4419 |
114 |
0.51 |
chr11_78065958_78066240 | 3.33 |
Mir144 |
microRNA 144 |
6906 |
0.08 |
chr4_135855773_135856058 | 3.32 |
Srsf10 |
serine and arginine-rich splicing factor 10 |
37 |
0.95 |
chr4_119190676_119190850 | 3.32 |
Ermap |
erythroblast membrane-associated protein |
752 |
0.43 |
chr11_69996486_69997590 | 3.28 |
Phf23 |
PHD finger protein 23 |
47 |
0.91 |
chr4_141060020_141060759 | 3.24 |
Crocc |
ciliary rootlet coiled-coil, rootletin |
156 |
0.92 |
chr7_128461024_128461519 | 3.24 |
Tial1 |
Tia1 cytotoxic granule-associated RNA binding protein-like 1 |
52 |
0.92 |
chr14_30703222_30703373 | 3.23 |
Sfmbt1 |
Scm-like with four mbt domains 1 |
11552 |
0.15 |
chr16_94569391_94569773 | 3.19 |
Dyrk1a |
dual-specificity tyrosine-(Y)-phosphorylation regulated kinase 1a |
428 |
0.84 |
chr5_149678355_149679261 | 3.17 |
B3glct |
beta-3-glucosyltransferase |
578 |
0.71 |
chr4_129377050_129377794 | 3.10 |
Zbtb8a |
zinc finger and BTB domain containing 8a |
694 |
0.53 |
chr19_21568057_21568222 | 3.09 |
Gm3443 |
predicted gene 3443 |
15198 |
0.21 |
chr7_97749289_97749579 | 3.05 |
Aqp11 |
aquaporin 11 |
11145 |
0.16 |
chr2_114117543_114118072 | 3.03 |
Aqr |
aquarius |
1380 |
0.43 |
chr2_128698196_128698960 | 3.02 |
Mertk |
MER proto-oncogene tyrosine kinase |
378 |
0.84 |
chr9_108996514_108996710 | 3.01 |
Pfkfb4 |
6-phosphofructo-2-kinase/fructose-2,6-biphosphatase 4 |
2276 |
0.14 |
chr17_78199734_78201570 | 2.99 |
Crim1 |
cysteine rich transmembrane BMP regulator 1 (chordin like) |
267 |
0.74 |
chr4_129188973_129189769 | 2.98 |
S100pbp |
S100P binding protein |
127 |
0.78 |
chr13_107021716_107022246 | 2.98 |
Kif2a |
kinesin family member 2A |
46 |
0.9 |
chr13_46273124_46273365 | 2.97 |
Stmnd1 |
stathmin domain containing 1 |
477 |
0.87 |
chr17_88065293_88066116 | 2.96 |
Fbxo11 |
F-box protein 11 |
413 |
0.86 |
chr9_45042149_45042842 | 2.96 |
Mpzl2 |
myelin protein zero-like 2 |
70 |
0.94 |
chr8_122550655_122551216 | 2.95 |
Piezo1 |
piezo-type mechanosensitive ion channel component 1 |
394 |
0.72 |
chr15_100599610_100600576 | 2.95 |
Pou6f1 |
POU domain, class 6, transcription factor 1 |
109 |
0.48 |
chr19_41866816_41866967 | 2.94 |
Frat2 |
frequently rearranged in advanced T cell lymphomas 2 |
18759 |
0.11 |
chr1_156987967_156988148 | 2.91 |
4930439D14Rik |
RIKEN cDNA 4930439D14 gene |
48219 |
0.1 |
chr4_33923766_33925291 | 2.91 |
Cnr1 |
cannabinoid receptor 1 (brain) |
65 |
0.98 |
chr8_120537903_120538228 | 2.91 |
1700016A09Rik |
RIKEN cDNA 1700016A09 gene |
339 |
0.53 |
chr7_143305657_143306136 | 2.88 |
Gm37364 |
predicted gene, 37364 |
8198 |
0.14 |
chr3_86224537_86224723 | 2.86 |
Lrba |
LPS-responsive beige-like anchor |
50 |
0.97 |
chr12_80643316_80643974 | 2.83 |
Erh |
ERH mRNA splicing and mitosis factor |
155 |
0.59 |
chr19_61266773_61267173 | 2.83 |
Gm50357 |
predicted gene, 50357 |
9184 |
0.13 |
chr4_151994882_151995406 | 2.82 |
Phf13 |
PHD finger protein 13 |
1114 |
0.33 |
chr8_94983294_94983708 | 2.82 |
Adgrg1 |
adhesion G protein-coupled receptor G1 |
870 |
0.47 |
chr2_154612961_154614144 | 2.79 |
4930519P11Rik |
RIKEN cDNA 4930519P11 gene |
115 |
0.59 |
chr5_112324889_112325204 | 2.77 |
Tfip11 |
tuftelin interacting protein 11 |
1312 |
0.28 |
chr8_83666002_83667196 | 2.77 |
Ptger1 |
prostaglandin E receptor 1 (subtype EP1) |
79 |
0.95 |
chr11_120378085_120379411 | 2.75 |
Faap100 |
Fanconi anemia core complex associated protein 100 |
12 |
0.94 |
chr7_25279370_25280622 | 2.73 |
Cic |
capicua transcriptional repressor |
355 |
0.74 |
chr8_120536315_120536689 | 2.72 |
Gse1 |
genetic suppressor element 1, coiled-coil protein |
645 |
0.48 |
chr12_25140632_25140783 | 2.72 |
Gm36287 |
predicted gene, 36287 |
10208 |
0.16 |
chr11_70539872_70540330 | 2.72 |
Pld2 |
phospholipase D2 |
37 |
0.86 |
chr12_80114135_80114615 | 2.71 |
Zfp36l1 |
zinc finger protein 36, C3H type-like 1 |
1362 |
0.27 |
chr3_135844986_135845137 | 2.71 |
4933401H06Rik |
RIKEN cDNA 4933401H06 gene |
4792 |
0.16 |
chr19_46484545_46484888 | 2.70 |
Sufu |
SUFU negative regulator of hedgehog signaling |
1619 |
0.32 |
chr17_47909349_47909983 | 2.70 |
Gm15556 |
predicted gene 15556 |
12712 |
0.13 |
chr4_137795768_137796555 | 2.70 |
Alpl |
alkaline phosphatase, liver/bone/kidney |
69 |
0.98 |
chr12_103860813_103860964 | 2.69 |
Serpina1a |
serine (or cysteine) peptidase inhibitor, clade A, member 1A |
2663 |
0.15 |
chr19_29805752_29806710 | 2.68 |
9930021J03Rik |
RIKEN cDNA 9930021J03 gene |
242 |
0.68 |
chr3_96277551_96278312 | 2.68 |
Gm20628 |
predicted gene 20628 |
7642 |
0.04 |
chr19_41482494_41483686 | 2.67 |
Lcor |
ligand dependent nuclear receptor corepressor |
61 |
0.98 |
chr17_84188466_84188948 | 2.66 |
Zfp36l2 |
zinc finger protein 36, C3H type-like 2 |
760 |
0.58 |
chr5_96162084_96163134 | 2.66 |
Cnot6l |
CCR4-NOT transcription complex, subunit 6-like |
619 |
0.75 |
chr5_122501856_122502977 | 2.63 |
Atp2a2 |
ATPase, Ca++ transporting, cardiac muscle, slow twitch 2 |
191 |
0.88 |
chr8_108703603_108704102 | 2.62 |
Zfhx3 |
zinc finger homeobox 3 |
752 |
0.73 |
chr6_52175748_52176249 | 2.61 |
Hoxaas3 |
Hoxa cluster antisense RNA 3 |
763 |
0.28 |
chr10_128525093_128526268 | 2.61 |
Esyt1 |
extended synaptotagmin-like protein 1 |
188 |
0.63 |
chr9_108347370_108348421 | 2.60 |
Usp4 |
ubiquitin specific peptidase 4 (proto-oncogene) |
2 |
0.94 |
chr11_100145857_100146041 | 2.59 |
Krt19 |
keratin 19 |
171 |
0.88 |
chr4_132048326_132049017 | 2.58 |
Epb41 |
erythrocyte membrane protein band 4.1 |
407 |
0.5 |
chr8_23034947_23035228 | 2.58 |
Ank1 |
ankyrin 1, erythroid |
12 |
0.98 |
chr2_48949106_48950119 | 2.58 |
Mbd5 |
methyl-CpG binding domain protein 5 |
89 |
0.8 |
chr6_124919273_124920636 | 2.58 |
Ptms |
parathymosin |
149 |
0.88 |
chr8_83441977_83443210 | 2.58 |
Scoc |
short coiled-coil protein |
86 |
0.96 |
chr2_167808831_167808982 | 2.58 |
1200007C13Rik |
RIKEN cDNA 1200007C13 gene |
24740 |
0.12 |
chr11_97798934_97799757 | 2.57 |
Lasp1 |
LIM and SH3 protein 1 |
220 |
0.84 |
chr3_95356733_95357381 | 2.57 |
Setdb1 |
SET domain, bifurcated 1 |
32 |
0.92 |
chr9_65826224_65827697 | 2.55 |
Zfp609 |
zinc finger protein 609 |
604 |
0.65 |
chr12_82168898_82169558 | 2.55 |
Sipa1l1 |
signal-induced proliferation-associated 1 like 1 |
92 |
0.54 |
chr2_154790876_154791702 | 2.54 |
Raly |
hnRNP-associated with lethal yellow |
63 |
0.56 |
chr5_124862398_124863348 | 2.53 |
Zfp664 |
zinc finger protein 664 |
109 |
0.84 |
chr5_115071111_115071264 | 2.53 |
Sppl3 |
signal peptide peptidase 3 |
3180 |
0.13 |
chr10_76642712_76643426 | 2.53 |
Col6a2 |
collagen, type VI, alpha 2 |
19439 |
0.14 |
chr12_84218167_84218821 | 2.50 |
Elmsan1 |
ELM2 and Myb/SANT-like domain containing 1 |
387 |
0.75 |
chr2_34249625_34250031 | 2.49 |
C79798 |
expressed sequence C79798 |
37943 |
0.16 |
chr7_127777434_127777897 | 2.48 |
Setd1a |
SET domain containing 1A |
30 |
0.93 |
chr2_174602300_174602613 | 2.48 |
Vmn1r-ps1 |
vomeronasal 1 receptor, pseudogene 1 |
11226 |
0.2 |
chr17_34586512_34587397 | 2.47 |
Notch4 |
notch 4 |
9 |
0.91 |
chr16_32643757_32644967 | 2.47 |
Tnk2 |
tyrosine kinase, non-receptor, 2 |
71 |
0.96 |
chr1_181211252_181211896 | 2.46 |
Wdr26 |
WD repeat domain 26 |
137 |
0.94 |
chr4_43508062_43508592 | 2.46 |
Car9 |
carbonic anhydrase 9 |
216 |
0.63 |
chr19_29047281_29048168 | 2.46 |
Ak3 |
adenylate kinase 3 |
237 |
0.85 |
chr1_74506202_74506776 | 2.45 |
Usp37 |
ubiquitin specific peptidase 37 |
206 |
0.7 |
chr12_101028530_101029714 | 2.45 |
Ccdc88c |
coiled-coil domain containing 88C |
66 |
0.95 |
chr9_107982639_107983011 | 2.43 |
Uba7 |
ubiquitin-like modifier activating enzyme 7 |
200 |
0.49 |
chr4_141767404_141767762 | 2.43 |
Dnajc16 |
DnaJ heat shock protein family (Hsp40) member C16 |
7070 |
0.13 |
chr2_79254736_79255032 | 2.41 |
Itga4 |
integrin alpha 4 |
542 |
0.83 |
chr4_119116414_119116694 | 2.40 |
Slc2a1 |
solute carrier family 2 (facilitated glucose transporter), member 1 |
7640 |
0.1 |
chr11_69366461_69367262 | 2.40 |
Chd3 |
chromodomain helicase DNA binding protein 3 |
2082 |
0.14 |
chr4_123282561_123282768 | 2.39 |
Pabpc4 |
poly(A) binding protein, cytoplasmic 4 |
161 |
0.9 |
chr1_37864467_37865139 | 2.39 |
Tsga10 |
testis specific 10 |
33 |
0.89 |
chr7_19822671_19822993 | 2.38 |
Bcl3 |
B cell leukemia/lymphoma 3 |
62 |
0.93 |
chr13_55329820_55330659 | 2.38 |
Mxd3 |
Max dimerization protein 3 |
416 |
0.72 |
chr9_71164457_71164619 | 2.38 |
Aqp9 |
aquaporin 9 |
684 |
0.45 |
chr2_32713345_32713794 | 2.37 |
Cdk9 |
cyclin-dependent kinase 9 (CDC2-related kinase) |
493 |
0.34 |
chr16_32246433_32247287 | 2.36 |
Fbxo45 |
F-box protein 45 |
298 |
0.52 |
chr7_44985781_44987176 | 2.33 |
Prmt1 |
protein arginine N-methyltransferase 1 |
14 |
0.83 |
chr2_153528510_153529333 | 2.33 |
Nol4l |
nucleolar protein 4-like |
1050 |
0.54 |
chr4_133910328_133911371 | 2.33 |
Rps6ka1 |
ribosomal protein S6 kinase polypeptide 1 |
23052 |
0.11 |
chr17_28915321_28915491 | 2.31 |
Bnip5 |
BCL2 interacting protein 5 |
82 |
0.93 |
chr5_5186422_5186573 | 2.31 |
Cdk14 |
cyclin-dependent kinase 14 |
8858 |
0.17 |
chr6_55319573_55319959 | 2.29 |
Gm25458 |
predicted gene, 25458 |
10861 |
0.14 |
chr15_95906315_95906762 | 2.28 |
Gm25070 |
predicted gene, 25070 |
26721 |
0.15 |
chr2_60880792_60881813 | 2.28 |
Rbms1 |
RNA binding motif, single stranded interacting protein 1 |
136 |
0.98 |
chr7_83883305_83884673 | 2.28 |
Tlnrd1 |
talin rod domain containing 1 |
316 |
0.58 |
chr7_16239699_16240021 | 2.27 |
C5ar2 |
complement component 5a receptor 2 |
2471 |
0.15 |
chr11_97186883_97187355 | 2.27 |
Kpnb1 |
karyopherin (importin) beta 1 |
762 |
0.51 |
chr17_46890116_46890759 | 2.27 |
Tbcc |
tubulin-specific chaperone C |
247 |
0.9 |
chr8_71702853_71703362 | 2.26 |
B3gnt3 |
UDP-GlcNAc:betaGal beta-1,3-N-acetylglucosaminyltransferase 3 |
1318 |
0.22 |
chr8_114439234_114440214 | 2.26 |
Wwox |
WW domain-containing oxidoreductase |
22 |
0.98 |
chr19_6291067_6291820 | 2.26 |
Ehd1 |
EH-domain containing 1 |
2738 |
0.11 |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
2.8 | 8.3 | GO:0032483 | regulation of Rab protein signal transduction(GO:0032483) |
2.1 | 12.6 | GO:2001269 | positive regulation of cysteine-type endopeptidase activity involved in apoptotic signaling pathway(GO:2001269) |
1.8 | 5.5 | GO:1901097 | negative regulation of autophagosome maturation(GO:1901097) |
1.7 | 5.1 | GO:2000297 | negative regulation of synapse maturation(GO:2000297) |
1.5 | 10.6 | GO:0075522 | IRES-dependent viral translational initiation(GO:0075522) |
1.5 | 4.5 | GO:0002432 | granuloma formation(GO:0002432) |
1.5 | 4.5 | GO:0000430 | regulation of transcription from RNA polymerase II promoter by glucose(GO:0000430) positive regulation of transcription from RNA polymerase II promoter by glucose(GO:0000432) |
1.5 | 5.8 | GO:0007296 | vitellogenesis(GO:0007296) |
1.4 | 5.6 | GO:0097039 | protein linear polyubiquitination(GO:0097039) |
1.4 | 5.6 | GO:2000418 | positive regulation of eosinophil migration(GO:2000418) |
1.3 | 5.4 | GO:0039536 | negative regulation of RIG-I signaling pathway(GO:0039536) |
1.3 | 4.0 | GO:0072695 | negative regulation of DNA recombination at telomere(GO:0048239) regulation of DNA recombination at telomere(GO:0072695) |
1.2 | 5.0 | GO:0038026 | reelin-mediated signaling pathway(GO:0038026) |
1.2 | 3.6 | GO:1900740 | regulation of protein insertion into mitochondrial membrane involved in apoptotic signaling pathway(GO:1900739) positive regulation of protein insertion into mitochondrial membrane involved in apoptotic signaling pathway(GO:1900740) |
1.2 | 3.5 | GO:0070889 | platelet alpha granule organization(GO:0070889) |
1.1 | 4.6 | GO:0006362 | transcription elongation from RNA polymerase I promoter(GO:0006362) |
1.1 | 3.4 | GO:0043974 | histone H3-K27 acetylation(GO:0043974) regulation of histone H3-K27 acetylation(GO:1901674) |
1.1 | 3.4 | GO:2000449 | regulation of CD8-positive, alpha-beta T cell extravasation(GO:2000449) |
1.1 | 4.4 | GO:0044838 | cell quiescence(GO:0044838) |
1.1 | 3.2 | GO:0006172 | ADP biosynthetic process(GO:0006172) |
1.1 | 3.2 | GO:0060398 | regulation of growth hormone receptor signaling pathway(GO:0060398) |
1.1 | 3.2 | GO:0051088 | PMA-inducible membrane protein ectodomain proteolysis(GO:0051088) |
1.0 | 3.1 | GO:0072194 | kidney smooth muscle tissue development(GO:0072194) |
1.0 | 2.0 | GO:0050904 | diapedesis(GO:0050904) |
1.0 | 1.0 | GO:0055118 | negative regulation of cardiac muscle contraction(GO:0055118) |
1.0 | 5.9 | GO:0006654 | phosphatidic acid biosynthetic process(GO:0006654) |
0.9 | 3.8 | GO:0051572 | negative regulation of histone H3-K4 methylation(GO:0051572) |
0.9 | 4.7 | GO:0000056 | ribosomal small subunit export from nucleus(GO:0000056) |
0.9 | 3.7 | GO:0090168 | Golgi reassembly(GO:0090168) |
0.9 | 3.7 | GO:0046600 | negative regulation of centriole replication(GO:0046600) |
0.9 | 3.7 | GO:0010989 | negative regulation of low-density lipoprotein particle clearance(GO:0010989) |
0.9 | 2.7 | GO:0060397 | JAK-STAT cascade involved in growth hormone signaling pathway(GO:0060397) |
0.9 | 4.5 | GO:0030910 | olfactory placode formation(GO:0030910) olfactory placode development(GO:0071698) olfactory placode morphogenesis(GO:0071699) |
0.9 | 2.6 | GO:1900126 | negative regulation of hyaluronan biosynthetic process(GO:1900126) |
0.9 | 5.2 | GO:0046874 | quinolinate metabolic process(GO:0046874) |
0.8 | 0.8 | GO:0019344 | cysteine biosynthetic process(GO:0019344) |
0.8 | 2.5 | GO:0032066 | nucleolus to nucleoplasm transport(GO:0032066) |
0.8 | 2.5 | GO:0090309 | positive regulation of methylation-dependent chromatin silencing(GO:0090309) |
0.8 | 2.4 | GO:0034421 | post-translational protein acetylation(GO:0034421) |
0.8 | 2.4 | GO:0038028 | insulin receptor signaling pathway via phosphatidylinositol 3-kinase(GO:0038028) |
0.8 | 3.2 | GO:0072367 | regulation of lipid transport by regulation of transcription from RNA polymerase II promoter(GO:0072367) |
0.8 | 2.4 | GO:0007227 | signal transduction downstream of smoothened(GO:0007227) |
0.8 | 2.3 | GO:1990036 | calcium ion import into sarcoplasmic reticulum(GO:1990036) |
0.8 | 2.3 | GO:1903847 | regulation of aorta morphogenesis(GO:1903847) positive regulation of aorta morphogenesis(GO:1903849) |
0.8 | 3.9 | GO:0045719 | negative regulation of glycogen biosynthetic process(GO:0045719) |
0.8 | 4.6 | GO:0007042 | lysosomal lumen acidification(GO:0007042) |
0.8 | 17.5 | GO:0061014 | positive regulation of mRNA catabolic process(GO:0061014) |
0.7 | 2.9 | GO:0007023 | post-chaperonin tubulin folding pathway(GO:0007023) |
0.7 | 2.1 | GO:1903677 | regulation of cap-independent translational initiation(GO:1903677) positive regulation of cap-independent translational initiation(GO:1903679) regulation of cytoplasmic translational initiation(GO:1904688) positive regulation of cytoplasmic translational initiation(GO:1904690) |
0.7 | 2.9 | GO:0031999 | negative regulation of fatty acid beta-oxidation(GO:0031999) |
0.7 | 2.1 | GO:0010748 | negative regulation of plasma membrane long-chain fatty acid transport(GO:0010748) |
0.7 | 2.1 | GO:0045074 | interleukin-10 biosynthetic process(GO:0042091) regulation of interleukin-10 biosynthetic process(GO:0045074) |
0.7 | 2.1 | GO:0007039 | protein catabolic process in the vacuole(GO:0007039) |
0.7 | 2.8 | GO:0033634 | positive regulation of cell-cell adhesion mediated by integrin(GO:0033634) |
0.7 | 2.8 | GO:0002023 | reduction of food intake in response to dietary excess(GO:0002023) |
0.7 | 2.1 | GO:1904059 | regulation of locomotor rhythm(GO:1904059) |
0.7 | 2.8 | GO:0003166 | bundle of His development(GO:0003166) |
0.7 | 3.4 | GO:0015722 | canalicular bile acid transport(GO:0015722) |
0.7 | 2.7 | GO:0031581 | hemidesmosome assembly(GO:0031581) |
0.7 | 2.0 | GO:0090259 | regulation of retinal ganglion cell axon guidance(GO:0090259) |
0.7 | 2.0 | GO:1900169 | regulation of glucocorticoid mediated signaling pathway(GO:1900169) |
0.7 | 2.7 | GO:0061158 | 3'-UTR-mediated mRNA destabilization(GO:0061158) |
0.7 | 2.0 | GO:0046985 | positive regulation of hemoglobin biosynthetic process(GO:0046985) |
0.6 | 1.9 | GO:0042938 | dipeptide transport(GO:0042938) |
0.6 | 1.3 | GO:0060375 | regulation of mast cell differentiation(GO:0060375) |
0.6 | 0.6 | GO:0045876 | positive regulation of sister chromatid cohesion(GO:0045876) |
0.6 | 2.6 | GO:0010499 | proteasomal ubiquitin-independent protein catabolic process(GO:0010499) |
0.6 | 1.9 | GO:0019464 | glycine catabolic process(GO:0006546) glycine decarboxylation via glycine cleavage system(GO:0019464) |
0.6 | 1.3 | GO:0034140 | negative regulation of toll-like receptor 3 signaling pathway(GO:0034140) |
0.6 | 4.4 | GO:0010603 | regulation of cytoplasmic mRNA processing body assembly(GO:0010603) |
0.6 | 0.6 | GO:2001032 | regulation of double-strand break repair via nonhomologous end joining(GO:2001032) |
0.6 | 4.3 | GO:0031659 | positive regulation of cyclin-dependent protein serine/threonine kinase activity involved in G1/S transition of mitotic cell cycle(GO:0031659) |
0.6 | 1.8 | GO:0032439 | endosome localization(GO:0032439) |
0.6 | 1.8 | GO:0019287 | isopentenyl diphosphate biosynthetic process(GO:0009240) isopentenyl diphosphate biosynthetic process, mevalonate pathway(GO:0019287) |
0.6 | 1.8 | GO:0045608 | negative regulation of auditory receptor cell differentiation(GO:0045608) |
0.6 | 1.8 | GO:1904995 | negative regulation of leukocyte adhesion to vascular endothelial cell(GO:1904995) |
0.6 | 1.8 | GO:0034499 | late endosome to Golgi transport(GO:0034499) |
0.6 | 2.9 | GO:0061635 | regulation of protein complex stability(GO:0061635) |
0.6 | 5.9 | GO:0045741 | positive regulation of epidermal growth factor-activated receptor activity(GO:0045741) |
0.6 | 2.3 | GO:0006369 | termination of RNA polymerase II transcription(GO:0006369) |
0.6 | 1.8 | GO:0007525 | somatic muscle development(GO:0007525) |
0.6 | 1.8 | GO:0045578 | negative regulation of B cell differentiation(GO:0045578) |
0.6 | 1.2 | GO:0071462 | cellular response to water stimulus(GO:0071462) |
0.6 | 2.3 | GO:1905206 | positive regulation of hydrogen peroxide-mediated programmed cell death(GO:1901300) positive regulation of hydrogen peroxide-induced cell death(GO:1905206) |
0.6 | 0.6 | GO:1902263 | apoptotic process involved in embryonic digit morphogenesis(GO:1902263) |
0.6 | 1.7 | GO:0071816 | protein insertion into ER membrane(GO:0045048) tail-anchored membrane protein insertion into ER membrane(GO:0071816) |
0.6 | 2.2 | GO:1903300 | negative regulation of glucokinase activity(GO:0033132) negative regulation of hexokinase activity(GO:1903300) |
0.6 | 3.9 | GO:0048387 | negative regulation of retinoic acid receptor signaling pathway(GO:0048387) |
0.6 | 1.7 | GO:0060528 | secretory columnal luminar epithelial cell differentiation involved in prostate glandular acinus development(GO:0060528) |
0.5 | 1.1 | GO:1903334 | positive regulation of protein folding(GO:1903334) |
0.5 | 2.1 | GO:0010693 | negative regulation of alkaline phosphatase activity(GO:0010693) |
0.5 | 1.6 | GO:2000828 | regulation of parathyroid hormone secretion(GO:2000828) |
0.5 | 0.5 | GO:0048549 | positive regulation of pinocytosis(GO:0048549) |
0.5 | 1.1 | GO:1901382 | chorionic trophoblast cell proliferation(GO:0097360) regulation of chorionic trophoblast cell proliferation(GO:1901382) |
0.5 | 1.6 | GO:0019230 | proprioception(GO:0019230) |
0.5 | 1.6 | GO:0006680 | glucosylceramide catabolic process(GO:0006680) |
0.5 | 1.5 | GO:0060155 | platelet dense granule organization(GO:0060155) |
0.5 | 4.6 | GO:0030953 | astral microtubule organization(GO:0030953) |
0.5 | 5.5 | GO:0010801 | negative regulation of peptidyl-threonine phosphorylation(GO:0010801) |
0.5 | 2.0 | GO:0071139 | resolution of recombination intermediates(GO:0071139) |
0.5 | 1.5 | GO:0000350 | generation of catalytic spliceosome for second transesterification step(GO:0000350) |
0.5 | 1.4 | GO:0032485 | regulation of Ral protein signal transduction(GO:0032485) |
0.5 | 1.0 | GO:1902075 | cellular response to salt(GO:1902075) |
0.5 | 1.4 | GO:2000591 | positive regulation of metanephric mesenchymal cell migration by platelet-derived growth factor receptor-beta signaling pathway(GO:0035793) regulation of metanephric mesenchymal cell migration by platelet-derived growth factor receptor-beta signaling pathway(GO:1900238) positive regulation of metanephric mesenchymal cell migration(GO:2000591) |
0.5 | 0.9 | GO:0090219 | negative regulation of lipid kinase activity(GO:0090219) |
0.5 | 5.2 | GO:1902287 | semaphorin-plexin signaling pathway involved in axon guidance(GO:1902287) |
0.5 | 5.6 | GO:0009263 | deoxyribonucleotide biosynthetic process(GO:0009263) |
0.5 | 3.3 | GO:0048227 | plasma membrane to endosome transport(GO:0048227) |
0.5 | 2.3 | GO:0035948 | positive regulation of gluconeogenesis by positive regulation of transcription from RNA polymerase II promoter(GO:0035948) |
0.5 | 2.8 | GO:0006004 | fucose metabolic process(GO:0006004) |
0.5 | 1.4 | GO:0060137 | maternal process involved in parturition(GO:0060137) |
0.5 | 1.4 | GO:0015691 | cadmium ion transport(GO:0015691) cadmium ion transmembrane transport(GO:0070574) |
0.5 | 0.5 | GO:0071947 | protein deubiquitination involved in ubiquitin-dependent protein catabolic process(GO:0071947) |
0.5 | 4.5 | GO:0031269 | pseudopodium assembly(GO:0031269) |
0.5 | 0.5 | GO:0002572 | pro-T cell differentiation(GO:0002572) |
0.4 | 2.2 | GO:0060480 | lung goblet cell differentiation(GO:0060480) |
0.4 | 1.8 | GO:0003241 | growth involved in heart morphogenesis(GO:0003241) |
0.4 | 0.9 | GO:1901165 | positive regulation of trophoblast cell migration(GO:1901165) |
0.4 | 5.3 | GO:0002327 | immature B cell differentiation(GO:0002327) |
0.4 | 1.3 | GO:0000087 | mitotic M phase(GO:0000087) |
0.4 | 1.7 | GO:0033353 | S-adenosylmethionine cycle(GO:0033353) |
0.4 | 1.3 | GO:0032802 | low-density lipoprotein particle receptor catabolic process(GO:0032802) regulation of low-density lipoprotein particle receptor catabolic process(GO:0032803) |
0.4 | 1.3 | GO:0071688 | skeletal muscle myosin thick filament assembly(GO:0030241) striated muscle myosin thick filament assembly(GO:0071688) |
0.4 | 6.8 | GO:0007064 | mitotic sister chromatid cohesion(GO:0007064) |
0.4 | 0.4 | GO:1901727 | positive regulation of histone deacetylase activity(GO:1901727) |
0.4 | 1.3 | GO:1903423 | positive regulation of synaptic vesicle recycling(GO:1903423) |
0.4 | 3.4 | GO:0048096 | chromatin-mediated maintenance of transcription(GO:0048096) |
0.4 | 1.3 | GO:0090038 | negative regulation of protein kinase C signaling(GO:0090038) |
0.4 | 2.1 | GO:0006116 | NADH oxidation(GO:0006116) |
0.4 | 1.6 | GO:0046543 | development of secondary female sexual characteristics(GO:0046543) |
0.4 | 4.0 | GO:0034204 | lipid translocation(GO:0034204) |
0.4 | 2.0 | GO:0032875 | regulation of DNA endoreduplication(GO:0032875) |
0.4 | 1.6 | GO:0072553 | terminal button organization(GO:0072553) |
0.4 | 0.4 | GO:0046078 | dUMP metabolic process(GO:0046078) |
0.4 | 2.8 | GO:0015838 | amino-acid betaine transport(GO:0015838) |
0.4 | 1.6 | GO:1904683 | regulation of metalloendopeptidase activity(GO:1904683) |
0.4 | 1.6 | GO:0051574 | positive regulation of histone H3-K9 methylation(GO:0051574) |
0.4 | 2.4 | GO:0035507 | regulation of myosin-light-chain-phosphatase activity(GO:0035507) |
0.4 | 1.2 | GO:0021586 | pons maturation(GO:0021586) |
0.4 | 2.3 | GO:1902035 | positive regulation of hematopoietic stem cell proliferation(GO:1902035) |
0.4 | 1.2 | GO:0000707 | meiotic DNA recombinase assembly(GO:0000707) |
0.4 | 5.8 | GO:0033235 | positive regulation of protein sumoylation(GO:0033235) |
0.4 | 1.2 | GO:1901838 | positive regulation of transcription of nuclear large rRNA transcript from RNA polymerase I promoter(GO:1901838) |
0.4 | 2.7 | GO:0043922 | negative regulation by host of viral transcription(GO:0043922) |
0.4 | 3.0 | GO:0061179 | negative regulation of insulin secretion involved in cellular response to glucose stimulus(GO:0061179) |
0.4 | 0.4 | GO:0038180 | nerve growth factor signaling pathway(GO:0038180) |
0.4 | 1.5 | GO:0070535 | histone H2A K63-linked ubiquitination(GO:0070535) |
0.4 | 1.1 | GO:0003383 | apical constriction(GO:0003383) |
0.4 | 1.1 | GO:0010891 | negative regulation of sequestering of triglyceride(GO:0010891) |
0.4 | 4.8 | GO:0070828 | heterochromatin organization(GO:0070828) |
0.4 | 8.9 | GO:0033014 | porphyrin-containing compound biosynthetic process(GO:0006779) tetrapyrrole biosynthetic process(GO:0033014) |
0.4 | 1.5 | GO:1902459 | positive regulation of stem cell population maintenance(GO:1902459) |
0.4 | 1.9 | GO:0060753 | regulation of mast cell chemotaxis(GO:0060753) |
0.4 | 2.2 | GO:0010668 | ectodermal cell differentiation(GO:0010668) |
0.4 | 1.1 | GO:0043988 | histone H3-S28 phosphorylation(GO:0043988) |
0.4 | 1.5 | GO:0070814 | hydrogen sulfide biosynthetic process(GO:0070814) |
0.4 | 0.7 | GO:1902488 | cholangiocyte apoptotic process(GO:1902488) regulation of cholangiocyte apoptotic process(GO:1904192) negative regulation of cholangiocyte apoptotic process(GO:1904193) |
0.4 | 1.1 | GO:0060948 | cardiac vascular smooth muscle cell development(GO:0060948) |
0.4 | 1.1 | GO:1903797 | positive regulation of inorganic anion transmembrane transport(GO:1903797) |
0.4 | 1.1 | GO:0072133 | kidney mesenchyme morphogenesis(GO:0072131) metanephric mesenchyme morphogenesis(GO:0072133) |
0.4 | 1.1 | GO:0030951 | establishment or maintenance of microtubule cytoskeleton polarity(GO:0030951) |
0.4 | 2.1 | GO:0019348 | dolichol metabolic process(GO:0019348) |
0.4 | 1.1 | GO:0006344 | maintenance of chromatin silencing(GO:0006344) |
0.4 | 2.5 | GO:0008063 | Toll signaling pathway(GO:0008063) |
0.4 | 1.8 | GO:0043456 | regulation of pentose-phosphate shunt(GO:0043456) |
0.3 | 2.4 | GO:0043983 | histone H4-K12 acetylation(GO:0043983) |
0.3 | 1.0 | GO:0006543 | glutamine catabolic process(GO:0006543) |
0.3 | 1.0 | GO:1902416 | positive regulation of mRNA binding(GO:1902416) positive regulation of RNA binding(GO:1905216) |
0.3 | 1.7 | GO:0007035 | vacuolar acidification(GO:0007035) |
0.3 | 2.1 | GO:0010457 | centriole-centriole cohesion(GO:0010457) |
0.3 | 1.7 | GO:1900246 | positive regulation of RIG-I signaling pathway(GO:1900246) |
0.3 | 4.8 | GO:0043984 | histone H4-K16 acetylation(GO:0043984) |
0.3 | 1.7 | GO:1902969 | mitotic DNA replication(GO:1902969) |
0.3 | 1.7 | GO:0060708 | spongiotrophoblast differentiation(GO:0060708) |
0.3 | 1.7 | GO:0000972 | transcription-dependent tethering of RNA polymerase II gene DNA at nuclear periphery(GO:0000972) |
0.3 | 16.7 | GO:0006367 | transcription initiation from RNA polymerase II promoter(GO:0006367) |
0.3 | 2.7 | GO:0035563 | positive regulation of chromatin binding(GO:0035563) |
0.3 | 0.3 | GO:0061010 | gall bladder development(GO:0061010) |
0.3 | 1.0 | GO:0010255 | carbohydrate mediated signaling(GO:0009756) hexose mediated signaling(GO:0009757) sugar mediated signaling pathway(GO:0010182) glucose mediated signaling pathway(GO:0010255) |
0.3 | 1.0 | GO:0060800 | regulation of cell differentiation involved in embryonic placenta development(GO:0060800) |
0.3 | 0.7 | GO:0060157 | urinary bladder development(GO:0060157) |
0.3 | 2.0 | GO:0048102 | autophagic cell death(GO:0048102) |
0.3 | 3.9 | GO:2000001 | regulation of DNA damage checkpoint(GO:2000001) |
0.3 | 1.3 | GO:2001286 | regulation of caveolin-mediated endocytosis(GO:2001286) |
0.3 | 0.7 | GO:0032077 | positive regulation of deoxyribonuclease activity(GO:0032077) |
0.3 | 1.0 | GO:0070447 | positive regulation of oligodendrocyte progenitor proliferation(GO:0070447) |
0.3 | 1.6 | GO:0051534 | negative regulation of NFAT protein import into nucleus(GO:0051534) |
0.3 | 1.6 | GO:0045607 | regulation of auditory receptor cell differentiation(GO:0045607) regulation of mechanoreceptor differentiation(GO:0045631) regulation of inner ear receptor cell differentiation(GO:2000980) |
0.3 | 1.3 | GO:0070837 | dehydroascorbic acid transport(GO:0070837) |
0.3 | 2.9 | GO:0035518 | histone H2A monoubiquitination(GO:0035518) |
0.3 | 1.0 | GO:0043328 | late endosome to vacuole transport via multivesicular body sorting pathway(GO:0032511) protein targeting to vacuole involved in ubiquitin-dependent protein catabolic process via the multivesicular body sorting pathway(GO:0043328) |
0.3 | 1.3 | GO:0061589 | calcium activated phosphatidylserine scrambling(GO:0061589) |
0.3 | 1.6 | GO:0000059 | protein import into nucleus, docking(GO:0000059) |
0.3 | 1.9 | GO:0060068 | vagina development(GO:0060068) |
0.3 | 1.0 | GO:1903225 | negative regulation of endodermal cell differentiation(GO:1903225) |
0.3 | 0.6 | GO:0030575 | nuclear body organization(GO:0030575) |
0.3 | 1.9 | GO:0045586 | regulation of gamma-delta T cell differentiation(GO:0045586) regulation of gamma-delta T cell activation(GO:0046643) |
0.3 | 1.0 | GO:0046013 | T cell homeostatic proliferation(GO:0001777) regulation of T cell homeostatic proliferation(GO:0046013) |
0.3 | 3.2 | GO:0060158 | phospholipase C-activating dopamine receptor signaling pathway(GO:0060158) |
0.3 | 5.7 | GO:0071108 | protein K48-linked deubiquitination(GO:0071108) |
0.3 | 0.6 | GO:0006975 | DNA damage induced protein phosphorylation(GO:0006975) |
0.3 | 1.9 | GO:0032287 | peripheral nervous system myelin maintenance(GO:0032287) |
0.3 | 1.9 | GO:0046598 | positive regulation of viral entry into host cell(GO:0046598) |
0.3 | 0.9 | GO:0001555 | oocyte growth(GO:0001555) |
0.3 | 1.5 | GO:0070933 | histone H4 deacetylation(GO:0070933) |
0.3 | 0.6 | GO:0090086 | negative regulation of protein deubiquitination(GO:0090086) |
0.3 | 0.9 | GO:0006382 | adenosine to inosine editing(GO:0006382) |
0.3 | 1.2 | GO:0006003 | fructose 2,6-bisphosphate metabolic process(GO:0006003) |
0.3 | 0.6 | GO:0010909 | regulation of heparan sulfate proteoglycan biosynthetic process(GO:0010908) positive regulation of heparan sulfate proteoglycan biosynthetic process(GO:0010909) positive regulation of proteoglycan biosynthetic process(GO:1902730) |
0.3 | 0.9 | GO:0040031 | snRNA modification(GO:0040031) |
0.3 | 1.2 | GO:0006564 | L-serine biosynthetic process(GO:0006564) |
0.3 | 1.2 | GO:0034773 | histone H4-K20 trimethylation(GO:0034773) |
0.3 | 0.6 | GO:2000279 | negative regulation of DNA biosynthetic process(GO:2000279) |
0.3 | 1.5 | GO:0060762 | regulation of branching involved in mammary gland duct morphogenesis(GO:0060762) |
0.3 | 2.7 | GO:0007549 | dosage compensation(GO:0007549) dosage compensation by inactivation of X chromosome(GO:0009048) |
0.3 | 0.6 | GO:0051599 | response to hydrostatic pressure(GO:0051599) |
0.3 | 2.4 | GO:0051292 | nuclear pore complex assembly(GO:0051292) |
0.3 | 0.9 | GO:0042998 | positive regulation of Golgi to plasma membrane protein transport(GO:0042998) |
0.3 | 1.2 | GO:0019482 | beta-alanine metabolic process(GO:0019482) |
0.3 | 3.5 | GO:0021527 | spinal cord association neuron differentiation(GO:0021527) |
0.3 | 1.2 | GO:0045743 | positive regulation of fibroblast growth factor receptor signaling pathway(GO:0045743) |
0.3 | 1.2 | GO:2000667 | positive regulation of interleukin-5 secretion(GO:2000664) positive regulation of interleukin-13 secretion(GO:2000667) |
0.3 | 1.4 | GO:0070934 | CRD-mediated mRNA stabilization(GO:0070934) |
0.3 | 0.9 | GO:0006203 | dGTP catabolic process(GO:0006203) |
0.3 | 1.7 | GO:0060059 | embryonic retina morphogenesis in camera-type eye(GO:0060059) |
0.3 | 2.6 | GO:0018027 | peptidyl-lysine dimethylation(GO:0018027) |
0.3 | 2.0 | GO:0007379 | segment specification(GO:0007379) |
0.3 | 2.3 | GO:0048537 | mucosal-associated lymphoid tissue development(GO:0048537) Peyer's patch development(GO:0048541) |
0.3 | 2.6 | GO:0000244 | spliceosomal tri-snRNP complex assembly(GO:0000244) |
0.3 | 0.8 | GO:1901844 | regulation of cell communication by electrical coupling involved in cardiac conduction(GO:1901844) |
0.3 | 3.1 | GO:2000369 | regulation of clathrin-mediated endocytosis(GO:2000369) |
0.3 | 0.8 | GO:0044860 | protein localization to plasma membrane raft(GO:0044860) |
0.3 | 0.8 | GO:0061086 | negative regulation of histone H3-K27 methylation(GO:0061086) |
0.3 | 2.5 | GO:0035278 | miRNA mediated inhibition of translation(GO:0035278) |
0.3 | 0.6 | GO:2000973 | regulation of pro-B cell differentiation(GO:2000973) |
0.3 | 0.8 | GO:0032474 | otolith morphogenesis(GO:0032474) |
0.3 | 0.3 | GO:0090526 | regulation of gluconeogenesis involved in cellular glucose homeostasis(GO:0090526) |
0.3 | 3.0 | GO:0007097 | nuclear migration(GO:0007097) |
0.3 | 1.1 | GO:1903608 | protein localization to cytoplasmic stress granule(GO:1903608) |
0.3 | 3.6 | GO:0040015 | negative regulation of multicellular organism growth(GO:0040015) |
0.3 | 2.2 | GO:0005981 | regulation of glycogen catabolic process(GO:0005981) |
0.3 | 0.3 | GO:0070350 | white fat cell proliferation(GO:0070343) regulation of white fat cell proliferation(GO:0070350) |
0.3 | 0.8 | GO:0060449 | bud elongation involved in lung branching(GO:0060449) |
0.3 | 0.5 | GO:2000383 | regulation of ectoderm development(GO:2000383) negative regulation of ectoderm development(GO:2000384) |
0.3 | 0.5 | GO:0006563 | L-serine metabolic process(GO:0006563) |
0.3 | 1.3 | GO:1904667 | negative regulation of ubiquitin protein ligase activity(GO:1904667) |
0.3 | 0.3 | GO:1904996 | positive regulation of leukocyte adhesion to vascular endothelial cell(GO:1904996) |
0.3 | 1.6 | GO:0048739 | cardiac muscle fiber development(GO:0048739) |
0.3 | 0.8 | GO:0098700 | aminergic neurotransmitter loading into synaptic vesicle(GO:0015842) neurotransmitter loading into synaptic vesicle(GO:0098700) |
0.3 | 0.5 | GO:0034137 | positive regulation of toll-like receptor 2 signaling pathway(GO:0034137) |
0.3 | 3.2 | GO:0002115 | store-operated calcium entry(GO:0002115) |
0.3 | 1.1 | GO:0008228 | opsonization(GO:0008228) |
0.3 | 0.8 | GO:0070125 | mitochondrial translational elongation(GO:0070125) |
0.3 | 0.5 | GO:0097167 | circadian regulation of translation(GO:0097167) |
0.3 | 0.8 | GO:0044857 | plasma membrane raft assembly(GO:0044854) plasma membrane raft organization(GO:0044857) |
0.3 | 0.5 | GO:0070947 | neutrophil mediated killing of fungus(GO:0070947) |
0.3 | 1.1 | GO:0060696 | regulation of phospholipid catabolic process(GO:0060696) |
0.3 | 0.5 | GO:0010637 | negative regulation of mitochondrial fusion(GO:0010637) |
0.3 | 0.5 | GO:1900625 | regulation of monocyte aggregation(GO:1900623) positive regulation of monocyte aggregation(GO:1900625) |
0.3 | 1.3 | GO:0048312 | intracellular distribution of mitochondria(GO:0048312) |
0.3 | 5.0 | GO:0048025 | negative regulation of mRNA splicing, via spliceosome(GO:0048025) |
0.3 | 0.5 | GO:0019042 | viral latency(GO:0019042) |
0.3 | 0.8 | GO:0006741 | NADP biosynthetic process(GO:0006741) |
0.3 | 1.0 | GO:0015871 | choline transport(GO:0015871) |
0.3 | 2.8 | GO:0007095 | mitotic G2 DNA damage checkpoint(GO:0007095) |
0.3 | 0.8 | GO:0030208 | dermatan sulfate biosynthetic process(GO:0030208) |
0.3 | 0.8 | GO:0071680 | response to indole-3-methanol(GO:0071680) cellular response to indole-3-methanol(GO:0071681) |
0.3 | 0.3 | GO:0061144 | alveolar secondary septum development(GO:0061144) |
0.3 | 1.0 | GO:2000561 | regulation of CD4-positive, alpha-beta T cell proliferation(GO:2000561) negative regulation of CD4-positive, alpha-beta T cell proliferation(GO:2000562) |
0.3 | 0.8 | GO:1990034 | calcium ion export from cell(GO:1990034) |
0.3 | 0.8 | GO:0019448 | cysteine catabolic process(GO:0009093) L-cysteine catabolic process(GO:0019448) L-cysteine metabolic process(GO:0046439) |
0.3 | 1.0 | GO:0051409 | response to nitrosative stress(GO:0051409) |
0.3 | 2.3 | GO:0051044 | positive regulation of membrane protein ectodomain proteolysis(GO:0051044) |
0.2 | 1.0 | GO:0031053 | primary miRNA processing(GO:0031053) |
0.2 | 0.5 | GO:0021550 | medulla oblongata development(GO:0021550) |
0.2 | 0.7 | GO:0046104 | thymidine metabolic process(GO:0046104) |
0.2 | 0.7 | GO:1904354 | negative regulation of telomere capping(GO:1904354) |
0.2 | 0.7 | GO:2000774 | positive regulation of cellular senescence(GO:2000774) |
0.2 | 1.2 | GO:0032463 | negative regulation of protein homooligomerization(GO:0032463) |
0.2 | 0.7 | GO:0039529 | RIG-I signaling pathway(GO:0039529) |
0.2 | 0.7 | GO:0036444 | calcium ion transmembrane import into mitochondrion(GO:0036444) |
0.2 | 1.5 | GO:0010815 | bradykinin catabolic process(GO:0010815) |
0.2 | 0.7 | GO:2000271 | positive regulation of fibroblast apoptotic process(GO:2000271) |
0.2 | 1.2 | GO:2000253 | positive regulation of feeding behavior(GO:2000253) |
0.2 | 0.5 | GO:1903774 | positive regulation of viral budding via host ESCRT complex(GO:1903774) |
0.2 | 1.0 | GO:0006499 | N-terminal protein myristoylation(GO:0006499) |
0.2 | 0.2 | GO:0072711 | response to hydroxyurea(GO:0072710) cellular response to hydroxyurea(GO:0072711) |
0.2 | 2.4 | GO:2001241 | positive regulation of extrinsic apoptotic signaling pathway in absence of ligand(GO:2001241) |
0.2 | 0.5 | GO:0061043 | regulation of vascular wound healing(GO:0061043) |
0.2 | 0.5 | GO:0060454 | positive regulation of gastric acid secretion(GO:0060454) |
0.2 | 1.4 | GO:0035372 | protein localization to microtubule(GO:0035372) |
0.2 | 0.5 | GO:0035511 | oxidative DNA demethylation(GO:0035511) |
0.2 | 0.7 | GO:0014043 | negative regulation of neuron maturation(GO:0014043) |
0.2 | 0.7 | GO:0016480 | negative regulation of transcription from RNA polymerase III promoter(GO:0016480) |
0.2 | 1.2 | GO:0006398 | mRNA 3'-end processing by stem-loop binding and cleavage(GO:0006398) |
0.2 | 3.1 | GO:0046597 | negative regulation of viral entry into host cell(GO:0046597) |
0.2 | 0.5 | GO:0007440 | foregut morphogenesis(GO:0007440) embryonic foregut morphogenesis(GO:0048617) |
0.2 | 1.9 | GO:0071218 | cellular response to misfolded protein(GO:0071218) |
0.2 | 0.7 | GO:0071763 | nuclear membrane organization(GO:0071763) |
0.2 | 0.2 | GO:0048320 | axial mesoderm formation(GO:0048320) |
0.2 | 1.6 | GO:0001866 | NK T cell proliferation(GO:0001866) |
0.2 | 0.2 | GO:0002309 | T cell proliferation involved in immune response(GO:0002309) |
0.2 | 0.5 | GO:0009826 | unidimensional cell growth(GO:0009826) |
0.2 | 0.2 | GO:0061470 | T follicular helper cell differentiation(GO:0061470) |
0.2 | 2.5 | GO:0007176 | regulation of epidermal growth factor-activated receptor activity(GO:0007176) |
0.2 | 1.4 | GO:0044829 | positive regulation by host of viral genome replication(GO:0044829) |
0.2 | 0.7 | GO:0061113 | pancreas morphogenesis(GO:0061113) |
0.2 | 0.7 | GO:0015705 | iodide transport(GO:0015705) |
0.2 | 1.4 | GO:0033601 | positive regulation of mammary gland epithelial cell proliferation(GO:0033601) |
0.2 | 1.8 | GO:0051382 | kinetochore assembly(GO:0051382) |
0.2 | 0.7 | GO:0006438 | valyl-tRNA aminoacylation(GO:0006438) |
0.2 | 1.8 | GO:0019985 | translesion synthesis(GO:0019985) |
0.2 | 0.4 | GO:2000847 | negative regulation of steroid hormone secretion(GO:2000832) negative regulation of corticosteroid hormone secretion(GO:2000847) negative regulation of glucocorticoid secretion(GO:2000850) |
0.2 | 0.4 | GO:0061428 | negative regulation of transcription from RNA polymerase II promoter in response to hypoxia(GO:0061428) |
0.2 | 0.9 | GO:0072675 | osteoclast fusion(GO:0072675) |
0.2 | 0.7 | GO:0001543 | ovarian follicle rupture(GO:0001543) |
0.2 | 0.4 | GO:1903898 | negative regulation of PERK-mediated unfolded protein response(GO:1903898) |
0.2 | 2.4 | GO:0071157 | negative regulation of cell cycle arrest(GO:0071157) |
0.2 | 0.9 | GO:0050434 | positive regulation of viral transcription(GO:0050434) |
0.2 | 0.7 | GO:2000564 | regulation of CD8-positive, alpha-beta T cell proliferation(GO:2000564) |
0.2 | 0.4 | GO:0090306 | spindle assembly involved in meiosis(GO:0090306) |
0.2 | 1.3 | GO:1900016 | negative regulation of cytokine production involved in inflammatory response(GO:1900016) |
0.2 | 1.3 | GO:0007100 | mitotic centrosome separation(GO:0007100) |
0.2 | 0.9 | GO:2000301 | negative regulation of synaptic vesicle exocytosis(GO:2000301) |
0.2 | 1.5 | GO:0032367 | intracellular cholesterol transport(GO:0032367) |
0.2 | 2.4 | GO:0007076 | mitotic chromosome condensation(GO:0007076) |
0.2 | 0.9 | GO:1903553 | positive regulation of extracellular exosome assembly(GO:1903553) |
0.2 | 0.6 | GO:1901798 | positive regulation of signal transduction by p53 class mediator(GO:1901798) |
0.2 | 0.9 | GO:0036302 | atrioventricular canal development(GO:0036302) |
0.2 | 1.9 | GO:0061088 | sequestering of zinc ion(GO:0032119) regulation of sequestering of zinc ion(GO:0061088) |
0.2 | 0.4 | GO:1900221 | regulation of beta-amyloid clearance(GO:1900221) |
0.2 | 0.6 | GO:1904431 | positive regulation of t-circle formation(GO:1904431) |
0.2 | 0.6 | GO:0000154 | rRNA modification(GO:0000154) |
0.2 | 0.4 | GO:0043382 | positive regulation of memory T cell differentiation(GO:0043382) |
0.2 | 0.2 | GO:0009146 | purine nucleoside triphosphate catabolic process(GO:0009146) |
0.2 | 1.0 | GO:0090503 | RNA phosphodiester bond hydrolysis, exonucleolytic(GO:0090503) |
0.2 | 0.6 | GO:0044387 | negative regulation of protein kinase activity by regulation of protein phosphorylation(GO:0044387) |
0.2 | 1.0 | GO:0034243 | regulation of transcription elongation from RNA polymerase II promoter(GO:0034243) |
0.2 | 0.6 | GO:0090271 | positive regulation of fibroblast growth factor production(GO:0090271) |
0.2 | 0.4 | GO:1902309 | negative regulation of peptidyl-serine dephosphorylation(GO:1902309) |
0.2 | 0.6 | GO:0000715 | nucleotide-excision repair, DNA damage recognition(GO:0000715) |
0.2 | 1.8 | GO:0051984 | positive regulation of chromosome segregation(GO:0051984) |
0.2 | 1.2 | GO:0050917 | sensory perception of umami taste(GO:0050917) |
0.2 | 0.4 | GO:1900620 | acetylcholine biosynthetic process(GO:0008292) acetate ester biosynthetic process(GO:1900620) |
0.2 | 0.6 | GO:1904694 | negative regulation of vascular smooth muscle contraction(GO:1904694) |
0.2 | 0.6 | GO:0060385 | axonogenesis involved in innervation(GO:0060385) |
0.2 | 0.2 | GO:0048295 | positive regulation of isotype switching to IgE isotypes(GO:0048295) |
0.2 | 0.6 | GO:0048386 | positive regulation of retinoic acid receptor signaling pathway(GO:0048386) |
0.2 | 0.2 | GO:0071336 | regulation of hair follicle cell proliferation(GO:0071336) |
0.2 | 1.2 | GO:0016266 | O-glycan processing(GO:0016266) |
0.2 | 0.8 | GO:0036233 | glycine import(GO:0036233) |
0.2 | 1.2 | GO:0070935 | 3'-UTR-mediated mRNA stabilization(GO:0070935) |
0.2 | 1.0 | GO:0021999 | neural plate anterior/posterior regionalization(GO:0021999) |
0.2 | 0.6 | GO:2001271 | regulation of cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:2001270) negative regulation of cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:2001271) |
0.2 | 1.9 | GO:2000188 | regulation of cholesterol homeostasis(GO:2000188) |
0.2 | 0.8 | GO:0061073 | ciliary body morphogenesis(GO:0061073) |
0.2 | 1.0 | GO:0080182 | histone H3-K4 trimethylation(GO:0080182) |
0.2 | 0.4 | GO:0010481 | epidermal cell division(GO:0010481) regulation of epidermal cell division(GO:0010482) |
0.2 | 0.4 | GO:1903371 | regulation of endoplasmic reticulum tubular network organization(GO:1903371) |
0.2 | 0.2 | GO:2000048 | negative regulation of cell-cell adhesion mediated by cadherin(GO:2000048) |
0.2 | 0.4 | GO:0050975 | sensory perception of touch(GO:0050975) |
0.2 | 3.6 | GO:0070884 | regulation of calcineurin-NFAT signaling cascade(GO:0070884) |
0.2 | 0.6 | GO:0048625 | myoblast fate commitment(GO:0048625) |
0.2 | 0.8 | GO:0045955 | negative regulation of calcium ion-dependent exocytosis(GO:0045955) |
0.2 | 0.4 | GO:0003062 | regulation of heart rate by chemical signal(GO:0003062) |
0.2 | 0.4 | GO:0002159 | desmosome assembly(GO:0002159) |
0.2 | 1.5 | GO:0006750 | glutathione biosynthetic process(GO:0006750) |
0.2 | 0.4 | GO:0007494 | midgut development(GO:0007494) |
0.2 | 0.7 | GO:0010626 | negative regulation of Schwann cell proliferation(GO:0010626) |
0.2 | 0.6 | GO:0006578 | amino-acid betaine biosynthetic process(GO:0006578) |
0.2 | 1.5 | GO:0033962 | cytoplasmic mRNA processing body assembly(GO:0033962) |
0.2 | 0.7 | GO:0072102 | glomerulus morphogenesis(GO:0072102) |
0.2 | 0.7 | GO:0032020 | ISG15-protein conjugation(GO:0032020) |
0.2 | 0.6 | GO:0035360 | positive regulation of peroxisome proliferator activated receptor signaling pathway(GO:0035360) |
0.2 | 0.7 | GO:1903054 | negative regulation of extracellular matrix organization(GO:1903054) |
0.2 | 0.5 | GO:0008582 | regulation of synaptic growth at neuromuscular junction(GO:0008582) |
0.2 | 0.7 | GO:0000395 | mRNA 5'-splice site recognition(GO:0000395) |
0.2 | 0.7 | GO:0071286 | cellular response to magnesium ion(GO:0071286) |
0.2 | 2.0 | GO:0051568 | histone H3-K4 methylation(GO:0051568) |
0.2 | 0.5 | GO:0034616 | response to laminar fluid shear stress(GO:0034616) cellular response to laminar fluid shear stress(GO:0071499) |
0.2 | 0.5 | GO:0030813 | positive regulation of nucleotide catabolic process(GO:0030813) |
0.2 | 0.5 | GO:1900060 | negative regulation of ceramide biosynthetic process(GO:1900060) |
0.2 | 0.9 | GO:1902369 | negative regulation of RNA catabolic process(GO:1902369) |
0.2 | 1.4 | GO:0046085 | adenosine metabolic process(GO:0046085) |
0.2 | 1.1 | GO:0030643 | cellular phosphate ion homeostasis(GO:0030643) cellular trivalent inorganic anion homeostasis(GO:0072502) |
0.2 | 0.7 | GO:0010940 | positive regulation of necrotic cell death(GO:0010940) |
0.2 | 0.9 | GO:0090336 | positive regulation of brown fat cell differentiation(GO:0090336) |
0.2 | 0.5 | GO:0034392 | negative regulation of smooth muscle cell apoptotic process(GO:0034392) |
0.2 | 1.9 | GO:0006353 | DNA-templated transcription, termination(GO:0006353) |
0.2 | 0.5 | GO:0090435 | protein localization to nuclear envelope(GO:0090435) |
0.2 | 0.3 | GO:0035694 | mitochondrial protein catabolic process(GO:0035694) |
0.2 | 0.7 | GO:0018214 | protein carboxylation(GO:0018214) |
0.2 | 0.9 | GO:2000059 | negative regulation of protein ubiquitination involved in ubiquitin-dependent protein catabolic process(GO:2000059) |
0.2 | 0.7 | GO:0097428 | protein maturation by iron-sulfur cluster transfer(GO:0097428) |
0.2 | 0.3 | GO:0032911 | negative regulation of transforming growth factor beta1 production(GO:0032911) |
0.2 | 0.2 | GO:2000382 | positive regulation of mesoderm development(GO:2000382) |
0.2 | 0.8 | GO:2000628 | regulation of miRNA metabolic process(GO:2000628) |
0.2 | 1.0 | GO:0032968 | positive regulation of transcription elongation from RNA polymerase II promoter(GO:0032968) |
0.2 | 1.2 | GO:0035767 | endothelial cell chemotaxis(GO:0035767) |
0.2 | 0.3 | GO:0010534 | regulation of activation of JAK2 kinase activity(GO:0010534) |
0.2 | 0.7 | GO:0033216 | ferric iron import(GO:0033216) ferric iron import into cell(GO:0097461) |
0.2 | 0.7 | GO:0001794 | type IIa hypersensitivity(GO:0001794) regulation of type IIa hypersensitivity(GO:0001796) positive regulation of type IIa hypersensitivity(GO:0001798) type II hypersensitivity(GO:0002445) regulation of type II hypersensitivity(GO:0002892) positive regulation of type II hypersensitivity(GO:0002894) |
0.2 | 0.3 | GO:0021914 | negative regulation of smoothened signaling pathway involved in ventral spinal cord patterning(GO:0021914) |
0.2 | 3.2 | GO:0070979 | protein K11-linked ubiquitination(GO:0070979) |
0.2 | 0.2 | GO:0060896 | neural plate pattern specification(GO:0060896) |
0.2 | 0.3 | GO:1904016 | response to Thyroglobulin triiodothyronine(GO:1904016) cellular response to Thyroglobulin triiodothyronine(GO:1904017) |
0.2 | 0.8 | GO:0031062 | positive regulation of histone methylation(GO:0031062) |
0.2 | 0.7 | GO:0070345 | negative regulation of fat cell proliferation(GO:0070345) |
0.2 | 0.3 | GO:0033522 | histone H2A ubiquitination(GO:0033522) |
0.2 | 3.5 | GO:0016180 | snRNA processing(GO:0016180) |
0.2 | 0.5 | GO:0030952 | establishment or maintenance of cytoskeleton polarity(GO:0030952) |
0.2 | 0.3 | GO:0001560 | regulation of cell growth by extracellular stimulus(GO:0001560) |
0.2 | 0.3 | GO:0052248 | negative regulation by symbiont of host apoptotic process(GO:0033668) modulation of programmed cell death in other organism(GO:0044531) modulation of apoptotic process in other organism(GO:0044532) modulation by symbiont of host programmed cell death(GO:0052040) negative regulation by symbiont of host programmed cell death(GO:0052041) modulation by symbiont of host apoptotic process(GO:0052150) modulation of programmed cell death in other organism involved in symbiotic interaction(GO:0052248) modulation by organism of apoptotic process in other organism involved in symbiotic interaction(GO:0052433) negative regulation by organism of programmed cell death in other organism involved in symbiotic interaction(GO:0052490) |
0.2 | 0.7 | GO:0007199 | G-protein coupled receptor signaling pathway coupled to cGMP nucleotide second messenger(GO:0007199) |
0.2 | 0.7 | GO:0042754 | negative regulation of circadian rhythm(GO:0042754) |
0.2 | 0.8 | GO:0047484 | regulation of response to osmotic stress(GO:0047484) |
0.2 | 1.0 | GO:0097237 | cellular response to toxic substance(GO:0097237) |
0.2 | 0.8 | GO:0016576 | histone dephosphorylation(GO:0016576) |
0.2 | 2.9 | GO:0016574 | histone ubiquitination(GO:0016574) |
0.2 | 0.3 | GO:0007529 | establishment of synaptic specificity at neuromuscular junction(GO:0007529) |
0.2 | 2.4 | GO:0016578 | histone deubiquitination(GO:0016578) |
0.2 | 0.3 | GO:0075509 | receptor-mediated endocytosis of virus by host cell(GO:0019065) endocytosis involved in viral entry into host cell(GO:0075509) |
0.2 | 0.2 | GO:0035630 | bone mineralization involved in bone maturation(GO:0035630) |
0.2 | 1.3 | GO:1990118 | sodium ion import across plasma membrane(GO:0098719) sodium ion import into cell(GO:1990118) |
0.2 | 2.9 | GO:0090502 | RNA phosphodiester bond hydrolysis, endonucleolytic(GO:0090502) |
0.2 | 0.3 | GO:0033129 | positive regulation of histone phosphorylation(GO:0033129) |
0.2 | 1.4 | GO:0002467 | germinal center formation(GO:0002467) |
0.2 | 1.0 | GO:1900028 | negative regulation of ruffle assembly(GO:1900028) |
0.2 | 0.9 | GO:0060297 | regulation of sarcomere organization(GO:0060297) |
0.2 | 0.5 | GO:0070873 | regulation of glycogen metabolic process(GO:0070873) |
0.2 | 6.1 | GO:0007569 | cell aging(GO:0007569) |
0.2 | 0.6 | GO:0034975 | protein folding in endoplasmic reticulum(GO:0034975) |
0.2 | 0.2 | GO:0070086 | ubiquitin-dependent endocytosis(GO:0070086) |
0.2 | 2.6 | GO:0071353 | cellular response to interleukin-4(GO:0071353) |
0.2 | 0.5 | GO:0006384 | transcription initiation from RNA polymerase III promoter(GO:0006384) |
0.2 | 1.2 | GO:0006607 | NLS-bearing protein import into nucleus(GO:0006607) |
0.2 | 0.5 | GO:0032906 | transforming growth factor beta2 production(GO:0032906) regulation of transforming growth factor beta2 production(GO:0032909) |
0.2 | 2.0 | GO:0031572 | G2 DNA damage checkpoint(GO:0031572) |
0.2 | 1.7 | GO:0010759 | positive regulation of macrophage chemotaxis(GO:0010759) |
0.2 | 1.2 | GO:2000353 | positive regulation of endothelial cell apoptotic process(GO:2000353) |
0.2 | 0.9 | GO:0045721 | negative regulation of gluconeogenesis(GO:0045721) |
0.2 | 2.0 | GO:0045116 | protein neddylation(GO:0045116) |
0.2 | 0.8 | GO:0034063 | stress granule assembly(GO:0034063) |
0.1 | 0.9 | GO:0033262 | regulation of nuclear cell cycle DNA replication(GO:0033262) |
0.1 | 0.7 | GO:1903312 | negative regulation of mRNA metabolic process(GO:1903312) |
0.1 | 2.4 | GO:0045672 | positive regulation of osteoclast differentiation(GO:0045672) |
0.1 | 0.6 | GO:0048875 | chemical homeostasis within a tissue(GO:0048875) |
0.1 | 0.4 | GO:0048388 | endosomal lumen acidification(GO:0048388) |
0.1 | 0.4 | GO:0035964 | COPI-coated vesicle budding(GO:0035964) |
0.1 | 0.4 | GO:1903671 | negative regulation of sprouting angiogenesis(GO:1903671) |
0.1 | 0.4 | GO:0046149 | heme catabolic process(GO:0042167) pigment catabolic process(GO:0046149) |
0.1 | 0.1 | GO:1901725 | regulation of histone deacetylase activity(GO:1901725) |
0.1 | 0.4 | GO:0045163 | clustering of voltage-gated potassium channels(GO:0045163) |
0.1 | 0.1 | GO:0034146 | toll-like receptor 5 signaling pathway(GO:0034146) |
0.1 | 0.9 | GO:0043486 | histone exchange(GO:0043486) |
0.1 | 3.7 | GO:0046626 | regulation of insulin receptor signaling pathway(GO:0046626) |
0.1 | 0.1 | GO:0043201 | response to leucine(GO:0043201) cellular response to leucine(GO:0071233) |
0.1 | 1.1 | GO:0045624 | positive regulation of T-helper cell differentiation(GO:0045624) |
0.1 | 1.3 | GO:0001731 | formation of translation preinitiation complex(GO:0001731) |
0.1 | 1.1 | GO:0006020 | inositol metabolic process(GO:0006020) |
0.1 | 0.4 | GO:0021898 | regulation of transcription from RNA polymerase II promoter involved in forebrain neuron fate commitment(GO:0021882) commitment of multipotent stem cells to neuronal lineage in forebrain(GO:0021898) |
0.1 | 0.6 | GO:0090209 | negative regulation of triglyceride metabolic process(GO:0090209) |
0.1 | 0.1 | GO:0061209 | cell proliferation involved in mesonephros development(GO:0061209) |
0.1 | 0.1 | GO:0032460 | negative regulation of protein oligomerization(GO:0032460) |
0.1 | 0.6 | GO:1900078 | positive regulation of cellular response to insulin stimulus(GO:1900078) |
0.1 | 0.1 | GO:0010159 | specification of organ position(GO:0010159) |
0.1 | 0.6 | GO:0060287 | epithelial cilium movement involved in determination of left/right asymmetry(GO:0060287) |
0.1 | 0.1 | GO:0035633 | maintenance of blood-brain barrier(GO:0035633) |
0.1 | 3.8 | GO:0070936 | protein K48-linked ubiquitination(GO:0070936) |
0.1 | 0.3 | GO:0031584 | activation of phospholipase D activity(GO:0031584) |
0.1 | 2.1 | GO:0031648 | protein destabilization(GO:0031648) |
0.1 | 0.4 | GO:0007084 | mitotic nuclear envelope reassembly(GO:0007084) |
0.1 | 2.6 | GO:0043488 | regulation of mRNA stability(GO:0043488) |
0.1 | 1.5 | GO:0050718 | positive regulation of interleukin-1 secretion(GO:0050716) positive regulation of interleukin-1 beta secretion(GO:0050718) |
0.1 | 0.4 | GO:0060903 | positive regulation of meiosis I(GO:0060903) |
0.1 | 1.2 | GO:0045292 | mRNA cis splicing, via spliceosome(GO:0045292) |
0.1 | 0.7 | GO:0034227 | tRNA thio-modification(GO:0034227) |
0.1 | 0.5 | GO:1904262 | negative regulation of TORC1 signaling(GO:1904262) |
0.1 | 0.4 | GO:0048254 | snoRNA localization(GO:0048254) |
0.1 | 0.4 | GO:0018119 | peptidyl-cysteine S-nitrosylation(GO:0018119) |
0.1 | 0.5 | GO:0031055 | chromatin remodeling at centromere(GO:0031055) CENP-A containing nucleosome assembly(GO:0034080) CENP-A containing chromatin organization(GO:0061641) |
0.1 | 0.9 | GO:0097062 | dendritic spine maintenance(GO:0097062) |
0.1 | 0.4 | GO:0043517 | positive regulation of DNA damage response, signal transduction by p53 class mediator(GO:0043517) |
0.1 | 0.5 | GO:0031848 | protection from non-homologous end joining at telomere(GO:0031848) |
0.1 | 0.5 | GO:0030213 | hyaluronan biosynthetic process(GO:0030213) |
0.1 | 0.8 | GO:0030854 | positive regulation of granulocyte differentiation(GO:0030854) |
0.1 | 0.7 | GO:2000051 | negative regulation of non-canonical Wnt signaling pathway(GO:2000051) |
0.1 | 0.4 | GO:0046341 | CDP-diacylglycerol metabolic process(GO:0046341) |
0.1 | 1.7 | GO:0046326 | positive regulation of glucose import(GO:0046326) |
0.1 | 0.3 | GO:0035166 | post-embryonic hemopoiesis(GO:0035166) |
0.1 | 2.3 | GO:0046677 | response to antibiotic(GO:0046677) |
0.1 | 0.8 | GO:0008343 | adult feeding behavior(GO:0008343) |
0.1 | 1.6 | GO:0006359 | regulation of transcription from RNA polymerase III promoter(GO:0006359) |
0.1 | 0.8 | GO:0051503 | adenine nucleotide transport(GO:0051503) |
0.1 | 0.4 | GO:0070682 | proteasome regulatory particle assembly(GO:0070682) |
0.1 | 0.4 | GO:0031282 | regulation of guanylate cyclase activity(GO:0031282) |
0.1 | 2.7 | GO:0035458 | cellular response to interferon-beta(GO:0035458) |
0.1 | 1.4 | GO:0046835 | carbohydrate phosphorylation(GO:0046835) |
0.1 | 0.4 | GO:1901524 | regulation of macromitophagy(GO:1901524) negative regulation of macromitophagy(GO:1901525) |
0.1 | 0.4 | GO:0002408 | myeloid dendritic cell chemotaxis(GO:0002408) |
0.1 | 0.6 | GO:0043568 | positive regulation of insulin-like growth factor receptor signaling pathway(GO:0043568) |
0.1 | 0.5 | GO:1904251 | regulation of bile acid metabolic process(GO:1904251) |
0.1 | 0.4 | GO:0006562 | proline catabolic process(GO:0006562) |
0.1 | 0.5 | GO:1903025 | regulation of RNA polymerase II regulatory region sequence-specific DNA binding(GO:1903025) |
0.1 | 1.9 | GO:0043552 | positive regulation of phosphatidylinositol 3-kinase activity(GO:0043552) |
0.1 | 0.1 | GO:0061183 | dermatome development(GO:0061054) regulation of dermatome development(GO:0061183) positive regulation of dermatome development(GO:0061184) |
0.1 | 0.4 | GO:1900378 | positive regulation of melanin biosynthetic process(GO:0048023) positive regulation of secondary metabolite biosynthetic process(GO:1900378) |
0.1 | 0.3 | GO:0060447 | bud outgrowth involved in lung branching(GO:0060447) |
0.1 | 0.6 | GO:0070986 | left/right axis specification(GO:0070986) |
0.1 | 1.4 | GO:0044342 | type B pancreatic cell proliferation(GO:0044342) |
0.1 | 0.7 | GO:0060337 | type I interferon signaling pathway(GO:0060337) |
0.1 | 0.4 | GO:0000722 | telomere maintenance via recombination(GO:0000722) |
0.1 | 0.9 | GO:0043508 | negative regulation of JUN kinase activity(GO:0043508) |
0.1 | 0.6 | GO:0001561 | fatty acid alpha-oxidation(GO:0001561) |
0.1 | 0.4 | GO:2001137 | positive regulation of endocytic recycling(GO:2001137) |
0.1 | 1.0 | GO:0038092 | nodal signaling pathway(GO:0038092) |
0.1 | 1.2 | GO:0032793 | positive regulation of CREB transcription factor activity(GO:0032793) |
0.1 | 0.1 | GO:0042023 | DNA endoreduplication(GO:0042023) |
0.1 | 0.6 | GO:0000185 | activation of MAPKKK activity(GO:0000185) |
0.1 | 0.1 | GO:0060681 | branch elongation involved in ureteric bud branching(GO:0060681) |
0.1 | 2.0 | GO:0045747 | positive regulation of Notch signaling pathway(GO:0045747) |
0.1 | 0.4 | GO:0021590 | cerebellum maturation(GO:0021590) |
0.1 | 0.4 | GO:0045617 | negative regulation of keratinocyte differentiation(GO:0045617) |
0.1 | 1.1 | GO:0042574 | retinal metabolic process(GO:0042574) |
0.1 | 1.2 | GO:0070208 | protein heterotrimerization(GO:0070208) |
0.1 | 1.4 | GO:0010718 | positive regulation of epithelial to mesenchymal transition(GO:0010718) |
0.1 | 0.2 | GO:1904705 | regulation of vascular smooth muscle cell proliferation(GO:1904705) vascular smooth muscle cell proliferation(GO:1990874) |
0.1 | 0.2 | GO:0046122 | purine deoxyribonucleoside metabolic process(GO:0046122) |
0.1 | 0.3 | GO:0000379 | tRNA-type intron splice site recognition and cleavage(GO:0000379) |
0.1 | 0.8 | GO:0010838 | positive regulation of keratinocyte proliferation(GO:0010838) |
0.1 | 0.3 | GO:0038171 | cannabinoid signaling pathway(GO:0038171) endocannabinoid signaling pathway(GO:0071926) |
0.1 | 0.5 | GO:0071447 | cellular response to hydroperoxide(GO:0071447) |
0.1 | 0.8 | GO:0006283 | transcription-coupled nucleotide-excision repair(GO:0006283) |
0.1 | 0.3 | GO:0035426 | extracellular matrix-cell signaling(GO:0035426) |
0.1 | 3.0 | GO:0048286 | lung alveolus development(GO:0048286) |
0.1 | 1.9 | GO:0000387 | spliceosomal snRNP assembly(GO:0000387) |
0.1 | 1.0 | GO:1900017 | positive regulation of cytokine production involved in inflammatory response(GO:1900017) |
0.1 | 0.5 | GO:0035927 | RNA import into mitochondrion(GO:0035927) |
0.1 | 0.3 | GO:0006566 | threonine metabolic process(GO:0006566) |
0.1 | 1.8 | GO:0016925 | protein sumoylation(GO:0016925) |
0.1 | 0.2 | GO:0002074 | extraocular skeletal muscle development(GO:0002074) |
0.1 | 1.1 | GO:0043550 | regulation of lipid kinase activity(GO:0043550) |
0.1 | 0.9 | GO:0051894 | positive regulation of focal adhesion assembly(GO:0051894) |
0.1 | 0.8 | GO:0032688 | negative regulation of interferon-beta production(GO:0032688) |
0.1 | 0.8 | GO:0039702 | viral budding via host ESCRT complex(GO:0039702) |
0.1 | 0.2 | GO:0046292 | formaldehyde metabolic process(GO:0046292) |
0.1 | 0.2 | GO:0030240 | skeletal muscle thin filament assembly(GO:0030240) |
0.1 | 0.8 | GO:0000042 | protein targeting to Golgi(GO:0000042) |
0.1 | 1.4 | GO:0006890 | retrograde vesicle-mediated transport, Golgi to ER(GO:0006890) |
0.1 | 0.2 | GO:2000491 | positive regulation of hepatic stellate cell activation(GO:2000491) |
0.1 | 0.2 | GO:0032430 | positive regulation of phospholipase A2 activity(GO:0032430) |
0.1 | 0.2 | GO:0072602 | interleukin-4 secretion(GO:0072602) |
0.1 | 0.3 | GO:0097368 | establishment of Sertoli cell barrier(GO:0097368) |
0.1 | 0.2 | GO:1903525 | regulation of membrane tubulation(GO:1903525) |
0.1 | 0.2 | GO:0006772 | thiamine metabolic process(GO:0006772) thiamine-containing compound metabolic process(GO:0042723) |
0.1 | 0.4 | GO:0070050 | neuron cellular homeostasis(GO:0070050) |
0.1 | 0.4 | GO:0010510 | regulation of acetyl-CoA biosynthetic process from pyruvate(GO:0010510) regulation of acyl-CoA biosynthetic process(GO:0050812) |
0.1 | 0.4 | GO:0015074 | DNA integration(GO:0015074) |
0.1 | 0.3 | GO:0070475 | rRNA base methylation(GO:0070475) |
0.1 | 1.8 | GO:0000413 | protein peptidyl-prolyl isomerization(GO:0000413) |
0.1 | 0.3 | GO:0060468 | prevention of polyspermy(GO:0060468) |
0.1 | 1.0 | GO:0006656 | phosphatidylcholine biosynthetic process(GO:0006656) |
0.1 | 0.5 | GO:0035728 | response to hepatocyte growth factor(GO:0035728) cellular response to hepatocyte growth factor stimulus(GO:0035729) |
0.1 | 0.4 | GO:0051988 | regulation of attachment of spindle microtubules to kinetochore(GO:0051988) |
0.1 | 0.2 | GO:0032691 | negative regulation of interleukin-1 beta production(GO:0032691) |
0.1 | 0.1 | GO:1900019 | regulation of protein kinase C activity(GO:1900019) positive regulation of protein kinase C activity(GO:1900020) |
0.1 | 0.1 | GO:1901164 | negative regulation of trophoblast cell migration(GO:1901164) |
0.1 | 0.8 | GO:1902236 | negative regulation of endoplasmic reticulum stress-induced intrinsic apoptotic signaling pathway(GO:1902236) |
0.1 | 0.1 | GO:0031061 | negative regulation of histone methylation(GO:0031061) |
0.1 | 0.9 | GO:0042074 | cell migration involved in gastrulation(GO:0042074) |
0.1 | 2.1 | GO:0032755 | positive regulation of interleukin-6 production(GO:0032755) |
0.1 | 0.2 | GO:0055009 | atrial cardiac muscle tissue development(GO:0003228) atrial cardiac muscle tissue morphogenesis(GO:0055009) |
0.1 | 1.0 | GO:0048535 | lymph node development(GO:0048535) |
0.1 | 0.1 | GO:0043096 | purine nucleobase salvage(GO:0043096) |
0.1 | 0.3 | GO:0080009 | mRNA methylation(GO:0080009) |
0.1 | 0.2 | GO:1904294 | positive regulation of ERAD pathway(GO:1904294) |
0.1 | 0.6 | GO:0007000 | nucleolus organization(GO:0007000) |
0.1 | 0.2 | GO:0019852 | L-ascorbic acid metabolic process(GO:0019852) |
0.1 | 0.3 | GO:0042706 | eye photoreceptor cell fate commitment(GO:0042706) photoreceptor cell fate commitment(GO:0046552) |
0.1 | 0.8 | GO:0034498 | early endosome to Golgi transport(GO:0034498) |
0.1 | 0.1 | GO:0045820 | negative regulation of glycolytic process(GO:0045820) |
0.1 | 0.3 | GO:0001672 | regulation of chromatin assembly or disassembly(GO:0001672) |
0.1 | 0.4 | GO:0002689 | negative regulation of leukocyte chemotaxis(GO:0002689) |
0.1 | 0.2 | GO:1990928 | response to amino acid starvation(GO:1990928) |
0.1 | 0.6 | GO:0002489 | antigen processing and presentation of endogenous peptide antigen via MHC class Ib via ER pathway(GO:0002488) antigen processing and presentation of endogenous peptide antigen via MHC class Ib via ER pathway, TAP-dependent(GO:0002489) positive regulation of antigen processing and presentation of peptide antigen via MHC class I(GO:0002591) |
0.1 | 0.1 | GO:0009155 | purine deoxyribonucleotide catabolic process(GO:0009155) |
0.1 | 0.5 | GO:0060749 | mammary gland alveolus development(GO:0060749) mammary gland lobule development(GO:0061377) |
0.1 | 0.4 | GO:1900118 | negative regulation of execution phase of apoptosis(GO:1900118) |
0.1 | 0.4 | GO:0098535 | de novo centriole assembly(GO:0098535) |
0.1 | 0.6 | GO:0018158 | protein oxidation(GO:0018158) |
0.1 | 0.2 | GO:2000427 | positive regulation of apoptotic cell clearance(GO:2000427) |
0.1 | 0.5 | GO:0060056 | mammary gland involution(GO:0060056) |
0.1 | 0.3 | GO:0044375 | regulation of peroxisome size(GO:0044375) |
0.1 | 0.6 | GO:0032933 | response to sterol depletion(GO:0006991) SREBP signaling pathway(GO:0032933) cellular response to sterol depletion(GO:0071501) |
0.1 | 0.5 | GO:0020027 | hemoglobin metabolic process(GO:0020027) |
0.1 | 0.4 | GO:0070459 | prolactin secretion(GO:0070459) |
0.1 | 0.5 | GO:0042416 | dopamine biosynthetic process(GO:0042416) |
0.1 | 0.2 | GO:0034340 | response to type I interferon(GO:0034340) |
0.1 | 1.1 | GO:0043968 | histone H2A acetylation(GO:0043968) |
0.1 | 0.1 | GO:0072600 | establishment of protein localization to Golgi(GO:0072600) |
0.1 | 0.3 | GO:1900619 | acetylcholine metabolic process(GO:0008291) acetate ester metabolic process(GO:1900619) |
0.1 | 0.1 | GO:0070200 | establishment of protein localization to chromosome(GO:0070199) establishment of protein localization to telomere(GO:0070200) |
0.1 | 0.4 | GO:0007256 | activation of JNKK activity(GO:0007256) |
0.1 | 0.9 | GO:0048246 | macrophage chemotaxis(GO:0048246) |
0.1 | 0.1 | GO:0051388 | positive regulation of neurotrophin TRK receptor signaling pathway(GO:0051388) |
0.1 | 0.2 | GO:0071725 | response to triacyl bacterial lipopeptide(GO:0071725) cellular response to triacyl bacterial lipopeptide(GO:0071727) |
0.1 | 3.6 | GO:0006418 | tRNA aminoacylation for protein translation(GO:0006418) |
0.1 | 0.5 | GO:0018401 | peptidyl-proline hydroxylation to 4-hydroxy-L-proline(GO:0018401) |
0.1 | 0.5 | GO:0015670 | carbon dioxide transport(GO:0015670) |
0.1 | 0.4 | GO:0046329 | negative regulation of JNK cascade(GO:0046329) |
0.1 | 0.4 | GO:2000672 | negative regulation of motor neuron apoptotic process(GO:2000672) |
0.1 | 1.0 | GO:1901741 | positive regulation of myoblast fusion(GO:1901741) |
0.1 | 2.9 | GO:0006334 | nucleosome assembly(GO:0006334) |
0.1 | 0.3 | GO:0051136 | regulation of NK T cell differentiation(GO:0051136) positive regulation of NK T cell differentiation(GO:0051138) |
0.1 | 0.4 | GO:1904417 | regulation of xenophagy(GO:1904415) positive regulation of xenophagy(GO:1904417) |
0.1 | 1.7 | GO:2000785 | regulation of autophagosome assembly(GO:2000785) |
0.1 | 0.4 | GO:0045717 | negative regulation of fatty acid biosynthetic process(GO:0045717) |
0.1 | 0.9 | GO:0048147 | negative regulation of fibroblast proliferation(GO:0048147) |
0.1 | 0.3 | GO:0034508 | centromere complex assembly(GO:0034508) |
0.1 | 0.2 | GO:2000739 | regulation of mesenchymal stem cell differentiation(GO:2000739) positive regulation of mesenchymal stem cell differentiation(GO:2000741) |
0.1 | 0.3 | GO:2000105 | positive regulation of DNA-dependent DNA replication(GO:2000105) |
0.1 | 0.5 | GO:0007257 | activation of JUN kinase activity(GO:0007257) |
0.1 | 2.2 | GO:0000380 | alternative mRNA splicing, via spliceosome(GO:0000380) |
0.1 | 4.9 | GO:0043433 | negative regulation of sequence-specific DNA binding transcription factor activity(GO:0043433) |
0.1 | 0.2 | GO:0034134 | toll-like receptor 2 signaling pathway(GO:0034134) |
0.1 | 0.5 | GO:0033327 | Leydig cell differentiation(GO:0033327) |
0.1 | 0.2 | GO:0046098 | guanine metabolic process(GO:0046098) |
0.1 | 0.3 | GO:0018094 | protein polyglycylation(GO:0018094) |
0.1 | 0.1 | GO:0051255 | spindle midzone assembly(GO:0051255) |
0.1 | 0.1 | GO:0035701 | hematopoietic stem cell migration(GO:0035701) |
0.1 | 0.2 | GO:0002678 | positive regulation of chronic inflammatory response(GO:0002678) |
0.1 | 0.5 | GO:0055064 | cellular chloride ion homeostasis(GO:0030644) chloride ion homeostasis(GO:0055064) |
0.1 | 0.5 | GO:0021516 | dorsal spinal cord development(GO:0021516) |
0.1 | 0.2 | GO:0010828 | positive regulation of glucose transport(GO:0010828) |
0.1 | 1.7 | GO:0045670 | regulation of osteoclast differentiation(GO:0045670) |
0.1 | 0.1 | GO:0045836 | positive regulation of meiotic nuclear division(GO:0045836) |
0.1 | 0.2 | GO:0007063 | regulation of sister chromatid cohesion(GO:0007063) |
0.1 | 0.2 | GO:0051661 | maintenance of centrosome location(GO:0051661) |
0.1 | 0.4 | GO:0017196 | N-terminal peptidyl-methionine acetylation(GO:0017196) |
0.1 | 0.2 | GO:0036072 | intramembranous ossification(GO:0001957) direct ossification(GO:0036072) |
0.1 | 0.5 | GO:0060539 | diaphragm development(GO:0060539) |
0.1 | 0.4 | GO:0008595 | tripartite regional subdivision(GO:0007351) anterior/posterior axis specification, embryo(GO:0008595) |
0.1 | 1.1 | GO:0042832 | defense response to protozoan(GO:0042832) |
0.1 | 0.1 | GO:0032290 | peripheral nervous system myelin formation(GO:0032290) |
0.1 | 0.3 | GO:0032462 | regulation of protein homooligomerization(GO:0032462) |
0.1 | 0.4 | GO:0021670 | lateral ventricle development(GO:0021670) |
0.1 | 0.2 | GO:0060396 | growth hormone receptor signaling pathway(GO:0060396) cellular response to growth hormone stimulus(GO:0071378) |
0.1 | 0.2 | GO:0033762 | response to glucagon(GO:0033762) |
0.1 | 0.2 | GO:0050916 | sensory perception of sweet taste(GO:0050916) |
0.1 | 0.9 | GO:0070266 | necroptotic process(GO:0070266) |
0.1 | 0.2 | GO:0036089 | cleavage furrow formation(GO:0036089) |
0.1 | 1.1 | GO:0044804 | nucleophagy(GO:0044804) |
0.1 | 0.2 | GO:1901873 | regulation of post-translational protein modification(GO:1901873) negative regulation of post-translational protein modification(GO:1901874) |
0.1 | 1.0 | GO:0000028 | ribosomal small subunit assembly(GO:0000028) |
0.1 | 0.1 | GO:0007182 | common-partner SMAD protein phosphorylation(GO:0007182) |
0.1 | 1.2 | GO:0033539 | fatty acid beta-oxidation using acyl-CoA dehydrogenase(GO:0033539) |
0.1 | 0.2 | GO:0055012 | ventricular cardiac muscle cell differentiation(GO:0055012) |
0.1 | 0.2 | GO:1901642 | purine nucleoside transmembrane transport(GO:0015860) purine-containing compound transmembrane transport(GO:0072530) nucleoside transmembrane transport(GO:1901642) |
0.1 | 0.2 | GO:0035279 | mRNA cleavage involved in gene silencing by miRNA(GO:0035279) mRNA cleavage involved in gene silencing(GO:0098795) |
0.1 | 0.3 | GO:0070234 | positive regulation of T cell apoptotic process(GO:0070234) |
0.1 | 0.3 | GO:1903204 | negative regulation of oxidative stress-induced neuron death(GO:1903204) |
0.1 | 0.2 | GO:0033566 | gamma-tubulin complex localization(GO:0033566) |
0.1 | 1.2 | GO:0050873 | brown fat cell differentiation(GO:0050873) |
0.1 | 0.1 | GO:0072205 | metanephric collecting duct development(GO:0072205) |
0.1 | 0.4 | GO:0000301 | retrograde transport, vesicle recycling within Golgi(GO:0000301) |
0.1 | 0.1 | GO:0006701 | progesterone biosynthetic process(GO:0006701) |
0.1 | 0.9 | GO:0035306 | positive regulation of dephosphorylation(GO:0035306) |
0.1 | 0.2 | GO:0030321 | transepithelial chloride transport(GO:0030321) |
0.1 | 0.2 | GO:1902177 | positive regulation of oxidative stress-induced intrinsic apoptotic signaling pathway(GO:1902177) |
0.1 | 0.2 | GO:0045053 | protein retention in Golgi apparatus(GO:0045053) |
0.1 | 0.1 | GO:0046084 | adenine metabolic process(GO:0046083) adenine biosynthetic process(GO:0046084) |
0.1 | 0.1 | GO:2000389 | regulation of neutrophil extravasation(GO:2000389) positive regulation of neutrophil extravasation(GO:2000391) |
0.1 | 0.3 | GO:0061668 | mitochondrial ribosome assembly(GO:0061668) |
0.1 | 0.4 | GO:0043687 | post-translational protein modification(GO:0043687) |
0.1 | 0.6 | GO:0071380 | cellular response to prostaglandin E stimulus(GO:0071380) |
0.1 | 0.3 | GO:0030091 | protein repair(GO:0030091) |
0.1 | 1.7 | GO:0043966 | histone H3 acetylation(GO:0043966) |
0.1 | 0.3 | GO:0070303 | negative regulation of stress-activated MAPK cascade(GO:0032873) negative regulation of stress-activated protein kinase signaling cascade(GO:0070303) |
0.1 | 1.2 | GO:0006829 | zinc II ion transport(GO:0006829) |
0.1 | 0.1 | GO:0031937 | positive regulation of chromatin silencing(GO:0031937) |
0.1 | 0.1 | GO:0051444 | negative regulation of ubiquitin-protein transferase activity(GO:0051444) |
0.1 | 0.4 | GO:0071557 | histone H3-K27 demethylation(GO:0071557) |
0.1 | 0.5 | GO:0031167 | rRNA methylation(GO:0031167) |
0.1 | 0.2 | GO:0021570 | rhombomere 4 development(GO:0021570) |
0.1 | 0.1 | GO:0030576 | Cajal body organization(GO:0030576) |
0.1 | 0.9 | GO:0008214 | protein demethylation(GO:0006482) protein dealkylation(GO:0008214) |
0.1 | 0.4 | GO:0032815 | negative regulation of natural killer cell activation(GO:0032815) |
0.1 | 0.1 | GO:0070317 | negative regulation of G0 to G1 transition(GO:0070317) |
0.1 | 1.9 | GO:1902850 | mitotic spindle assembly(GO:0090307) microtubule cytoskeleton organization involved in mitosis(GO:1902850) |
0.1 | 0.4 | GO:0045579 | positive regulation of B cell differentiation(GO:0045579) |
0.1 | 0.5 | GO:0071480 | cellular response to gamma radiation(GO:0071480) |
0.1 | 0.1 | GO:1990314 | cellular response to insulin-like growth factor stimulus(GO:1990314) |
0.1 | 0.6 | GO:0010719 | negative regulation of epithelial to mesenchymal transition(GO:0010719) |
0.1 | 0.4 | GO:0035610 | protein side chain deglutamylation(GO:0035610) |
0.1 | 0.4 | GO:0006620 | posttranslational protein targeting to membrane(GO:0006620) |
0.1 | 0.2 | GO:0006659 | phosphatidylserine biosynthetic process(GO:0006659) |
0.1 | 0.1 | GO:0035751 | regulation of lysosomal lumen pH(GO:0035751) |
0.1 | 0.2 | GO:1900029 | positive regulation of ruffle assembly(GO:1900029) |
0.1 | 3.3 | GO:0016579 | protein deubiquitination(GO:0016579) |
0.1 | 0.3 | GO:0006686 | sphingomyelin biosynthetic process(GO:0006686) |
0.1 | 0.2 | GO:0036336 | dendritic cell migration(GO:0036336) |
0.1 | 0.2 | GO:0006681 | galactosylceramide metabolic process(GO:0006681) |
0.1 | 0.1 | GO:2000169 | regulation of peptidyl-cysteine S-nitrosylation(GO:2000169) |
0.1 | 0.7 | GO:0006921 | cellular component disassembly involved in execution phase of apoptosis(GO:0006921) apoptotic nuclear changes(GO:0030262) |
0.1 | 0.1 | GO:0051029 | rRNA transport(GO:0051029) |
0.1 | 1.0 | GO:0008299 | isoprenoid biosynthetic process(GO:0008299) |
0.1 | 0.3 | GO:0039703 | viral RNA genome replication(GO:0039694) RNA replication(GO:0039703) |
0.1 | 0.2 | GO:0042732 | D-xylose metabolic process(GO:0042732) |
0.1 | 0.3 | GO:0015858 | nucleoside transport(GO:0015858) |
0.1 | 1.7 | GO:1902807 | negative regulation of cell cycle G1/S phase transition(GO:1902807) |
0.1 | 0.1 | GO:0036265 | RNA (guanine-N7)-methylation(GO:0036265) |
0.1 | 0.6 | GO:0009404 | toxin metabolic process(GO:0009404) |
0.1 | 0.4 | GO:0006561 | proline biosynthetic process(GO:0006561) |
0.1 | 0.5 | GO:0018095 | protein polyglutamylation(GO:0018095) |
0.1 | 0.1 | GO:0042414 | epinephrine metabolic process(GO:0042414) |
0.1 | 0.3 | GO:0048251 | elastic fiber assembly(GO:0048251) |
0.1 | 0.3 | GO:0097094 | craniofacial suture morphogenesis(GO:0097094) |
0.1 | 0.3 | GO:0050915 | sensory perception of sour taste(GO:0050915) |
0.1 | 0.1 | GO:0050747 | positive regulation of lipoprotein metabolic process(GO:0050747) |
0.1 | 0.3 | GO:0050765 | negative regulation of phagocytosis(GO:0050765) |
0.1 | 0.1 | GO:0030214 | hyaluronan catabolic process(GO:0030214) |
0.1 | 1.2 | GO:0006891 | intra-Golgi vesicle-mediated transport(GO:0006891) |
0.1 | 0.3 | GO:0045838 | positive regulation of membrane potential(GO:0045838) |
0.1 | 0.2 | GO:0042447 | hormone catabolic process(GO:0042447) |
0.1 | 0.2 | GO:0042940 | D-amino acid transport(GO:0042940) |
0.1 | 0.2 | GO:0006370 | 7-methylguanosine mRNA capping(GO:0006370) |
0.1 | 0.1 | GO:0048819 | regulation of hair follicle maturation(GO:0048819) |
0.1 | 0.1 | GO:0016572 | histone phosphorylation(GO:0016572) |
0.1 | 0.3 | GO:0014041 | regulation of neuron maturation(GO:0014041) |
0.1 | 0.1 | GO:0050427 | 3'-phosphoadenosine 5'-phosphosulfate metabolic process(GO:0050427) |
0.1 | 0.4 | GO:0009191 | ribonucleoside diphosphate catabolic process(GO:0009191) |
0.1 | 0.6 | GO:0097034 | mitochondrial respiratory chain complex IV assembly(GO:0033617) mitochondrial respiratory chain complex IV biogenesis(GO:0097034) |
0.1 | 0.2 | GO:0030502 | negative regulation of bone mineralization(GO:0030502) |
0.1 | 0.2 | GO:2000766 | negative regulation of cytoplasmic translation(GO:2000766) |
0.1 | 0.1 | GO:0032074 | negative regulation of nuclease activity(GO:0032074) |
0.1 | 0.1 | GO:0042523 | positive regulation of tyrosine phosphorylation of Stat5 protein(GO:0042523) |
0.1 | 1.9 | GO:0006505 | GPI anchor metabolic process(GO:0006505) |
0.1 | 0.1 | GO:0072537 | fibroblast activation(GO:0072537) |
0.1 | 0.1 | GO:0042726 | flavin-containing compound metabolic process(GO:0042726) |
0.1 | 0.1 | GO:0003032 | detection of oxygen(GO:0003032) |
0.1 | 0.1 | GO:0033058 | directional locomotion(GO:0033058) |
0.1 | 1.1 | GO:0043001 | Golgi to plasma membrane protein transport(GO:0043001) |
0.1 | 0.1 | GO:2000035 | regulation of stem cell division(GO:2000035) |
0.1 | 1.0 | GO:0030865 | cortical cytoskeleton organization(GO:0030865) |
0.1 | 0.6 | GO:0018022 | peptidyl-lysine methylation(GO:0018022) |
0.1 | 0.3 | GO:0036344 | platelet morphogenesis(GO:0036344) |
0.1 | 0.2 | GO:0001887 | selenium compound metabolic process(GO:0001887) |
0.1 | 0.1 | GO:0071169 | establishment of protein localization to chromatin(GO:0071169) |
0.1 | 0.4 | GO:0070862 | negative regulation of protein exit from endoplasmic reticulum(GO:0070862) negative regulation of retrograde protein transport, ER to cytosol(GO:1904153) |
0.1 | 0.7 | GO:0034315 | regulation of Arp2/3 complex-mediated actin nucleation(GO:0034315) |
0.1 | 0.4 | GO:0031119 | tRNA pseudouridine synthesis(GO:0031119) |
0.1 | 0.1 | GO:0035358 | regulation of peroxisome proliferator activated receptor signaling pathway(GO:0035358) |
0.1 | 0.4 | GO:0006513 | protein monoubiquitination(GO:0006513) |
0.1 | 0.5 | GO:0006590 | thyroid hormone generation(GO:0006590) |
0.1 | 0.4 | GO:0042364 | water-soluble vitamin biosynthetic process(GO:0042364) |
0.1 | 0.1 | GO:0060316 | positive regulation of ryanodine-sensitive calcium-release channel activity(GO:0060316) |
0.1 | 0.2 | GO:0042271 | susceptibility to natural killer cell mediated cytotoxicity(GO:0042271) |
0.1 | 0.2 | GO:0015888 | thiamine transport(GO:0015888) |
0.1 | 0.1 | GO:0032960 | regulation of inositol trisphosphate biosynthetic process(GO:0032960) positive regulation of inositol trisphosphate biosynthetic process(GO:0032962) |
0.1 | 0.2 | GO:0051043 | regulation of membrane protein ectodomain proteolysis(GO:0051043) |
0.1 | 0.1 | GO:1901991 | negative regulation of mitotic cell cycle phase transition(GO:1901991) |
0.1 | 0.2 | GO:0032790 | ribosome disassembly(GO:0032790) |
0.1 | 0.2 | GO:0045003 | DNA recombinase assembly(GO:0000730) double-strand break repair via synthesis-dependent strand annealing(GO:0045003) |
0.1 | 0.1 | GO:0010764 | negative regulation of fibroblast migration(GO:0010764) |
0.1 | 0.1 | GO:0001306 | age-dependent response to oxidative stress(GO:0001306) age-dependent general metabolic decline(GO:0007571) |
0.1 | 0.8 | GO:0070528 | protein kinase C signaling(GO:0070528) |
0.1 | 0.7 | GO:0021591 | ventricular system development(GO:0021591) |
0.1 | 0.3 | GO:0071803 | positive regulation of podosome assembly(GO:0071803) |
0.1 | 0.6 | GO:0002021 | response to dietary excess(GO:0002021) |
0.1 | 1.5 | GO:0019835 | cytolysis(GO:0019835) |
0.1 | 0.2 | GO:0006285 | base-excision repair, AP site formation(GO:0006285) |
0.1 | 0.1 | GO:0034405 | response to fluid shear stress(GO:0034405) |
0.1 | 0.2 | GO:0033750 | ribosomal subunit export from nucleus(GO:0000054) ribosome localization(GO:0033750) establishment of ribosome localization(GO:0033753) rRNA-containing ribonucleoprotein complex export from nucleus(GO:0071428) |
0.1 | 0.3 | GO:0060040 | retinal bipolar neuron differentiation(GO:0060040) |
0.1 | 3.0 | GO:0006413 | translational initiation(GO:0006413) |
0.1 | 0.4 | GO:0006903 | vesicle targeting(GO:0006903) |
0.1 | 0.3 | GO:1900264 | regulation of DNA-directed DNA polymerase activity(GO:1900262) positive regulation of DNA-directed DNA polymerase activity(GO:1900264) |
0.1 | 0.1 | GO:2000662 | interleukin-5 secretion(GO:0072603) interleukin-13 secretion(GO:0072611) regulation of interleukin-5 secretion(GO:2000662) regulation of interleukin-13 secretion(GO:2000665) |
0.1 | 0.1 | GO:1903232 | melanosome assembly(GO:1903232) |
0.1 | 0.3 | GO:0002827 | positive regulation of T-helper 1 type immune response(GO:0002827) |
0.1 | 0.2 | GO:0006651 | diacylglycerol biosynthetic process(GO:0006651) |
0.1 | 0.2 | GO:0035162 | embryonic hemopoiesis(GO:0035162) |
0.1 | 0.2 | GO:0050859 | negative regulation of B cell receptor signaling pathway(GO:0050859) |
0.1 | 0.8 | GO:0032527 | protein exit from endoplasmic reticulum(GO:0032527) |
0.1 | 1.1 | GO:0072583 | clathrin-mediated endocytosis(GO:0072583) |
0.1 | 0.1 | GO:0034395 | regulation of transcription from RNA polymerase II promoter in response to iron(GO:0034395) |
0.1 | 0.2 | GO:0019532 | oxalate transport(GO:0019532) |
0.1 | 0.1 | GO:0048340 | paraxial mesoderm morphogenesis(GO:0048340) |
0.1 | 0.2 | GO:0002386 | immune response in mucosal-associated lymphoid tissue(GO:0002386) |
0.1 | 0.1 | GO:0008588 | release of cytoplasmic sequestered NF-kappaB(GO:0008588) |
0.1 | 0.1 | GO:2001180 | negative regulation of interleukin-10 secretion(GO:2001180) |
0.1 | 0.2 | GO:2000780 | negative regulation of double-strand break repair(GO:2000780) |
0.1 | 0.4 | GO:0036303 | lymphangiogenesis(GO:0001946) lymph vessel morphogenesis(GO:0036303) |
0.1 | 0.1 | GO:0030174 | regulation of DNA-dependent DNA replication initiation(GO:0030174) |
0.1 | 0.1 | GO:0042789 | mRNA transcription from RNA polymerase II promoter(GO:0042789) |
0.1 | 0.3 | GO:1901186 | positive regulation of ERBB signaling pathway(GO:1901186) |
0.1 | 0.4 | GO:0030206 | chondroitin sulfate biosynthetic process(GO:0030206) |
0.1 | 0.1 | GO:0034729 | histone H3-K79 methylation(GO:0034729) |
0.1 | 0.2 | GO:1901201 | regulation of extracellular matrix assembly(GO:1901201) |
0.1 | 0.1 | GO:0019371 | cyclooxygenase pathway(GO:0019371) |
0.1 | 0.1 | GO:0033131 | regulation of glucokinase activity(GO:0033131) |
0.1 | 0.4 | GO:0045604 | regulation of epidermal cell differentiation(GO:0045604) |
0.1 | 0.3 | GO:0071468 | cellular response to acidic pH(GO:0071468) |
0.1 | 0.2 | GO:0090042 | tubulin deacetylation(GO:0090042) regulation of tubulin deacetylation(GO:0090043) |
0.1 | 0.4 | GO:0019370 | leukotriene biosynthetic process(GO:0019370) |
0.1 | 1.4 | GO:0055072 | iron ion homeostasis(GO:0055072) |
0.1 | 0.1 | GO:0035864 | response to potassium ion(GO:0035864) cellular response to potassium ion(GO:0035865) |
0.1 | 0.1 | GO:0001562 | response to protozoan(GO:0001562) |
0.1 | 0.2 | GO:0008298 | intracellular mRNA localization(GO:0008298) |
0.1 | 0.3 | GO:0019372 | lipoxygenase pathway(GO:0019372) |
0.1 | 0.1 | GO:0071635 | negative regulation of transforming growth factor beta production(GO:0071635) |
0.1 | 0.2 | GO:0045724 | positive regulation of cilium assembly(GO:0045724) |
0.0 | 0.1 | GO:0035356 | cellular triglyceride homeostasis(GO:0035356) |
0.0 | 0.2 | GO:0042347 | negative regulation of NF-kappaB import into nucleus(GO:0042347) |
0.0 | 0.1 | GO:0036035 | osteoclast development(GO:0036035) |
0.0 | 0.5 | GO:0007213 | G-protein coupled acetylcholine receptor signaling pathway(GO:0007213) |
0.0 | 0.2 | GO:0006072 | glycerol-3-phosphate metabolic process(GO:0006072) |
0.0 | 0.1 | GO:0070131 | positive regulation of mitochondrial translation(GO:0070131) |
0.0 | 0.2 | GO:0032780 | negative regulation of ATPase activity(GO:0032780) |
0.0 | 0.4 | GO:0006614 | SRP-dependent cotranslational protein targeting to membrane(GO:0006614) |
0.0 | 0.1 | GO:0045110 | intermediate filament bundle assembly(GO:0045110) |
0.0 | 0.2 | GO:0051026 | chiasma assembly(GO:0051026) |
0.0 | 0.2 | GO:0007221 | positive regulation of transcription of Notch receptor target(GO:0007221) |
0.0 | 1.4 | GO:0051591 | response to cAMP(GO:0051591) |
0.0 | 0.1 | GO:0036465 | synaptic vesicle recycling(GO:0036465) |
0.0 | 0.0 | GO:0031392 | regulation of prostaglandin biosynthetic process(GO:0031392) regulation of unsaturated fatty acid biosynthetic process(GO:2001279) |
0.0 | 0.2 | GO:0006303 | double-strand break repair via nonhomologous end joining(GO:0006303) |
0.0 | 0.1 | GO:0043353 | enucleate erythrocyte differentiation(GO:0043353) |
0.0 | 0.4 | GO:0003084 | positive regulation of systemic arterial blood pressure(GO:0003084) |
0.0 | 1.2 | GO:0003009 | skeletal muscle contraction(GO:0003009) |
0.0 | 0.0 | GO:0033629 | negative regulation of cell adhesion mediated by integrin(GO:0033629) |
0.0 | 0.5 | GO:0051491 | positive regulation of filopodium assembly(GO:0051491) |
0.0 | 0.1 | GO:0018199 | peptidyl-glutamine modification(GO:0018199) |
0.0 | 0.1 | GO:0006768 | biotin metabolic process(GO:0006768) |
0.0 | 0.1 | GO:0033275 | actin-myosin filament sliding(GO:0033275) |
0.0 | 0.1 | GO:0071692 | protein localization to extracellular region(GO:0071692) maintenance of protein location in extracellular region(GO:0071694) |
0.0 | 0.3 | GO:0060670 | branching involved in labyrinthine layer morphogenesis(GO:0060670) |
0.0 | 0.1 | GO:1902268 | negative regulation of polyamine transmembrane transport(GO:1902268) |
0.0 | 0.3 | GO:0050802 | circadian sleep/wake cycle, sleep(GO:0050802) |
0.0 | 1.3 | GO:0006749 | glutathione metabolic process(GO:0006749) |
0.0 | 0.0 | GO:0070244 | negative regulation of thymocyte apoptotic process(GO:0070244) |
0.0 | 0.1 | GO:0072386 | plus-end-directed vesicle transport along microtubule(GO:0072383) plus-end-directed organelle transport along microtubule(GO:0072386) |
0.0 | 0.1 | GO:0006624 | vacuolar protein processing(GO:0006624) |
0.0 | 0.1 | GO:0060613 | fat pad development(GO:0060613) |
0.0 | 0.4 | GO:0010960 | magnesium ion homeostasis(GO:0010960) |
0.0 | 0.1 | GO:0001955 | blood vessel maturation(GO:0001955) |
0.0 | 0.0 | GO:0045656 | negative regulation of monocyte differentiation(GO:0045656) |
0.0 | 0.3 | GO:0033081 | regulation of T cell differentiation in thymus(GO:0033081) regulation of thymocyte aggregation(GO:2000398) |
0.0 | 0.1 | GO:0019676 | ammonia assimilation cycle(GO:0019676) |
0.0 | 0.1 | GO:0010587 | miRNA catabolic process(GO:0010587) |
0.0 | 0.4 | GO:0035116 | embryonic hindlimb morphogenesis(GO:0035116) |
0.0 | 0.1 | GO:0015889 | cobalamin transport(GO:0015889) |
0.0 | 0.6 | GO:0045600 | positive regulation of fat cell differentiation(GO:0045600) |
0.0 | 0.2 | GO:0070059 | intrinsic apoptotic signaling pathway in response to endoplasmic reticulum stress(GO:0070059) |
0.0 | 0.0 | GO:0043415 | positive regulation of skeletal muscle tissue regeneration(GO:0043415) |
0.0 | 0.1 | GO:0060126 | somatotropin secreting cell differentiation(GO:0060126) |
0.0 | 0.2 | GO:0016188 | synaptic vesicle maturation(GO:0016188) |
0.0 | 0.1 | GO:0045943 | positive regulation of transcription from RNA polymerase I promoter(GO:0045943) |
0.0 | 0.0 | GO:0002246 | wound healing involved in inflammatory response(GO:0002246) inflammatory response to wounding(GO:0090594) |
0.0 | 0.0 | GO:0035995 | detection of muscle stretch(GO:0035995) |
0.0 | 0.0 | GO:0008626 | granzyme-mediated apoptotic signaling pathway(GO:0008626) |
0.0 | 0.2 | GO:0046685 | response to arsenic-containing substance(GO:0046685) |
0.0 | 0.0 | GO:0031268 | pseudopodium organization(GO:0031268) |
0.0 | 0.0 | GO:1900376 | regulation of melanin biosynthetic process(GO:0048021) regulation of secondary metabolite biosynthetic process(GO:1900376) |
0.0 | 0.1 | GO:0002314 | germinal center B cell differentiation(GO:0002314) |
0.0 | 0.6 | GO:0015985 | energy coupled proton transport, down electrochemical gradient(GO:0015985) ATP synthesis coupled proton transport(GO:0015986) |
0.0 | 0.0 | GO:0002679 | respiratory burst involved in defense response(GO:0002679) |
0.0 | 0.1 | GO:0051895 | negative regulation of focal adhesion assembly(GO:0051895) |
0.0 | 0.1 | GO:0007089 | traversing start control point of mitotic cell cycle(GO:0007089) |
0.0 | 1.2 | GO:1903844 | regulation of transforming growth factor beta receptor signaling pathway(GO:0017015) regulation of cellular response to transforming growth factor beta stimulus(GO:1903844) |
0.0 | 0.1 | GO:0016103 | diterpenoid catabolic process(GO:0016103) retinoic acid catabolic process(GO:0034653) |
0.0 | 0.3 | GO:0048745 | smooth muscle tissue development(GO:0048745) |
0.0 | 0.0 | GO:1904467 | regulation of tumor necrosis factor secretion(GO:1904467) positive regulation of tumor necrosis factor secretion(GO:1904469) tumor necrosis factor secretion(GO:1990774) |
0.0 | 0.3 | GO:0050860 | negative regulation of T cell receptor signaling pathway(GO:0050860) |
0.0 | 0.3 | GO:0010592 | positive regulation of lamellipodium assembly(GO:0010592) |
0.0 | 0.1 | GO:0070995 | NADPH oxidation(GO:0070995) |
0.0 | 0.9 | GO:0006289 | nucleotide-excision repair(GO:0006289) |
0.0 | 0.1 | GO:0097211 | response to gonadotropin-releasing hormone(GO:0097210) cellular response to gonadotropin-releasing hormone(GO:0097211) |
0.0 | 0.2 | GO:0021684 | cerebellar granular layer formation(GO:0021684) cerebellar granule cell differentiation(GO:0021707) |
0.0 | 0.2 | GO:0060576 | intestinal epithelial cell development(GO:0060576) |
0.0 | 0.6 | GO:1902806 | regulation of cell cycle G1/S phase transition(GO:1902806) |
0.0 | 0.4 | GO:0034377 | plasma lipoprotein particle assembly(GO:0034377) |
0.0 | 0.1 | GO:0006189 | 'de novo' IMP biosynthetic process(GO:0006189) |
0.0 | 0.1 | GO:2000758 | positive regulation of peptidyl-lysine acetylation(GO:2000758) |
0.0 | 0.4 | GO:0022617 | extracellular matrix disassembly(GO:0022617) |
0.0 | 0.1 | GO:0007016 | cytoskeletal anchoring at plasma membrane(GO:0007016) |
0.0 | 0.5 | GO:0034629 | cellular protein complex localization(GO:0034629) |
0.0 | 0.0 | GO:2001055 | positive regulation of mesenchymal cell apoptotic process(GO:2001055) |
0.0 | 0.0 | GO:0033034 | positive regulation of myeloid cell apoptotic process(GO:0033034) |
0.0 | 0.1 | GO:0051533 | positive regulation of NFAT protein import into nucleus(GO:0051533) |
0.0 | 0.1 | GO:1903275 | regulation of sodium ion export(GO:1903273) positive regulation of sodium ion export(GO:1903275) regulation of sodium ion export from cell(GO:1903276) positive regulation of sodium ion export from cell(GO:1903278) |
0.0 | 0.1 | GO:0019276 | UDP-N-acetylgalactosamine metabolic process(GO:0019276) |
0.0 | 0.1 | GO:0032620 | interleukin-17 production(GO:0032620) |
0.0 | 0.1 | GO:1903541 | regulation of exosomal secretion(GO:1903541) positive regulation of exosomal secretion(GO:1903543) |
0.0 | 0.0 | GO:0050861 | positive regulation of B cell receptor signaling pathway(GO:0050861) |
0.0 | 0.2 | GO:0008295 | spermidine biosynthetic process(GO:0008295) |
0.0 | 0.3 | GO:0000338 | protein deneddylation(GO:0000338) cullin deneddylation(GO:0010388) |
0.0 | 0.2 | GO:0097033 | respiratory chain complex III assembly(GO:0017062) mitochondrial respiratory chain complex III assembly(GO:0034551) mitochondrial respiratory chain complex III biogenesis(GO:0097033) |
0.0 | 0.1 | GO:0043031 | negative regulation of macrophage activation(GO:0043031) |
0.0 | 0.1 | GO:0050955 | thermoception(GO:0050955) |
0.0 | 0.5 | GO:0006998 | nuclear envelope organization(GO:0006998) |
0.0 | 0.1 | GO:0006451 | selenocysteine incorporation(GO:0001514) translational readthrough(GO:0006451) |
0.0 | 0.1 | GO:0006474 | N-terminal protein amino acid acetylation(GO:0006474) |
0.0 | 0.4 | GO:0001659 | temperature homeostasis(GO:0001659) |
0.0 | 0.1 | GO:0032324 | Mo-molybdopterin cofactor biosynthetic process(GO:0006777) Mo-molybdopterin cofactor metabolic process(GO:0019720) molybdopterin cofactor biosynthetic process(GO:0032324) molybdopterin cofactor metabolic process(GO:0043545) prosthetic group metabolic process(GO:0051189) |
0.0 | 0.2 | GO:0060065 | uterus development(GO:0060065) |
0.0 | 0.3 | GO:0045475 | locomotor rhythm(GO:0045475) |
0.0 | 0.1 | GO:0016559 | peroxisome fission(GO:0016559) |
0.0 | 0.1 | GO:0090073 | positive regulation of protein homodimerization activity(GO:0090073) |
0.0 | 0.5 | GO:0034587 | piRNA metabolic process(GO:0034587) |
0.0 | 0.2 | GO:0007008 | outer mitochondrial membrane organization(GO:0007008) |
0.0 | 0.0 | GO:0007290 | spermatid nucleus elongation(GO:0007290) |
0.0 | 0.1 | GO:0042222 | interleukin-1 biosynthetic process(GO:0042222) |
0.0 | 0.4 | GO:0097186 | amelogenesis(GO:0097186) |
0.0 | 0.0 | GO:0072076 | nephrogenic mesenchyme development(GO:0072076) |
0.0 | 0.1 | GO:0007621 | negative regulation of female receptivity(GO:0007621) |
0.0 | 0.1 | GO:0097501 | stress response to metal ion(GO:0097501) |
0.0 | 0.2 | GO:0006388 | tRNA splicing, via endonucleolytic cleavage and ligation(GO:0006388) |
0.0 | 0.9 | GO:0010501 | RNA secondary structure unwinding(GO:0010501) |
0.0 | 0.1 | GO:0009299 | mRNA transcription(GO:0009299) |
0.0 | 0.0 | GO:2000318 | positive regulation of T-helper 17 type immune response(GO:2000318) |
0.0 | 0.1 | GO:0032534 | regulation of microvillus assembly(GO:0032534) |
0.0 | 0.3 | GO:0007062 | sister chromatid cohesion(GO:0007062) |
0.0 | 0.0 | GO:0033483 | gas homeostasis(GO:0033483) |
0.0 | 0.1 | GO:0046952 | ketone body catabolic process(GO:0046952) |
0.0 | 1.2 | GO:0001892 | embryonic placenta development(GO:0001892) |
0.0 | 0.0 | GO:0052173 | response to defenses of other organism involved in symbiotic interaction(GO:0052173) response to host defenses(GO:0052200) response to host(GO:0075136) |
0.0 | 1.3 | GO:0031929 | TOR signaling(GO:0031929) |
0.0 | 0.3 | GO:0042407 | cristae formation(GO:0042407) |
0.0 | 0.0 | GO:0009804 | coumarin metabolic process(GO:0009804) |
0.0 | 0.5 | GO:0071594 | T cell differentiation in thymus(GO:0033077) thymocyte aggregation(GO:0071594) |
0.0 | 0.2 | GO:0046500 | S-adenosylmethionine metabolic process(GO:0046500) |
0.0 | 0.0 | GO:0097459 | iron ion import into cell(GO:0097459) |
0.0 | 0.4 | GO:0017145 | stem cell division(GO:0017145) |
0.0 | 0.1 | GO:0033326 | cerebrospinal fluid secretion(GO:0033326) |
0.0 | 0.1 | GO:0071873 | response to norepinephrine(GO:0071873) |
0.0 | 0.2 | GO:0043124 | negative regulation of I-kappaB kinase/NF-kappaB signaling(GO:0043124) |
0.0 | 0.2 | GO:0052805 | histidine catabolic process(GO:0006548) imidazole-containing compound catabolic process(GO:0052805) |
0.0 | 0.1 | GO:2000359 | regulation of binding of sperm to zona pellucida(GO:2000359) |
0.0 | 0.0 | GO:2000767 | positive regulation of cytoplasmic translation(GO:2000767) |
0.0 | 0.1 | GO:0006083 | acetate metabolic process(GO:0006083) |
0.0 | 0.3 | GO:1904816 | positive regulation of protein localization to chromosome, telomeric region(GO:1904816) positive regulation of establishment of protein localization to telomere(GO:1904851) |
0.0 | 0.0 | GO:0016554 | cytidine to uridine editing(GO:0016554) |
0.0 | 0.1 | GO:0009629 | response to gravity(GO:0009629) |
0.0 | 0.0 | GO:1901509 | regulation of endothelial tube morphogenesis(GO:1901509) |
0.0 | 0.1 | GO:0042492 | gamma-delta T cell differentiation(GO:0042492) |
0.0 | 0.0 | GO:0006610 | ribosomal protein import into nucleus(GO:0006610) |
0.0 | 0.2 | GO:0043117 | positive regulation of vascular permeability(GO:0043117) |
0.0 | 0.5 | GO:0008089 | anterograde axonal transport(GO:0008089) |
0.0 | 1.6 | GO:0043627 | response to estrogen(GO:0043627) |
0.0 | 0.1 | GO:0031293 | membrane protein intracellular domain proteolysis(GO:0031293) |
0.0 | 0.1 | GO:0006449 | regulation of translational termination(GO:0006449) |
0.0 | 0.1 | GO:0097066 | response to thyroid hormone(GO:0097066) |
0.0 | 0.5 | GO:0015893 | drug transport(GO:0015893) |
0.0 | 0.3 | GO:0009250 | glycogen biosynthetic process(GO:0005978) glucan biosynthetic process(GO:0009250) |
0.0 | 0.1 | GO:0045046 | peroxisomal membrane transport(GO:0015919) protein import into peroxisome membrane(GO:0045046) |
0.0 | 0.2 | GO:0046549 | retinal cone cell development(GO:0046549) |
0.0 | 0.1 | GO:0051025 | negative regulation of immunoglobulin secretion(GO:0051025) |
0.0 | 0.2 | GO:2000651 | positive regulation of sodium ion transmembrane transporter activity(GO:2000651) |
0.0 | 0.0 | GO:0016479 | negative regulation of transcription from RNA polymerase I promoter(GO:0016479) |
0.0 | 0.0 | GO:0030423 | targeting of mRNA for destruction involved in RNA interference(GO:0030423) siRNA loading onto RISC involved in RNA interference(GO:0035087) |
0.0 | 0.1 | GO:0046218 | tryptophan catabolic process(GO:0006569) tryptophan catabolic process to kynurenine(GO:0019441) indole-containing compound catabolic process(GO:0042436) indolalkylamine catabolic process(GO:0046218) |
0.0 | 0.1 | GO:0000737 | DNA catabolic process, endonucleolytic(GO:0000737) |
0.0 | 0.1 | GO:1902750 | negative regulation of cell cycle G2/M phase transition(GO:1902750) |
0.0 | 0.2 | GO:0006241 | CTP biosynthetic process(GO:0006241) CTP metabolic process(GO:0046036) |
0.0 | 0.6 | GO:0007339 | binding of sperm to zona pellucida(GO:0007339) |
0.0 | 0.1 | GO:0001842 | neural fold formation(GO:0001842) |
0.0 | 0.1 | GO:0072321 | chaperone-mediated protein transport(GO:0072321) |
0.0 | 0.2 | GO:0070233 | negative regulation of T cell apoptotic process(GO:0070233) |
0.0 | 0.1 | GO:1990086 | lens fiber cell apoptotic process(GO:1990086) |
0.0 | 0.0 | GO:0090232 | positive regulation of spindle checkpoint(GO:0090232) |
0.0 | 0.0 | GO:0072172 | mesonephric tubule formation(GO:0072172) |
0.0 | 0.1 | GO:0001829 | trophectodermal cell differentiation(GO:0001829) |
0.0 | 0.1 | GO:0071786 | endoplasmic reticulum tubular network organization(GO:0071786) |
0.0 | 0.1 | GO:0060037 | pharyngeal system development(GO:0060037) |
0.0 | 0.2 | GO:0006517 | protein deglycosylation(GO:0006517) |
0.0 | 0.1 | GO:0021533 | cell differentiation in hindbrain(GO:0021533) |
0.0 | 0.1 | GO:0033119 | negative regulation of RNA splicing(GO:0033119) |
0.0 | 0.3 | GO:1901222 | regulation of NIK/NF-kappaB signaling(GO:1901222) |
0.0 | 0.7 | GO:0030217 | T cell differentiation(GO:0030217) |
0.0 | 0.0 | GO:0002034 | regulation of blood vessel size by renin-angiotensin(GO:0002034) renal control of peripheral vascular resistance involved in regulation of systemic arterial blood pressure(GO:0003072) |
0.0 | 0.7 | GO:0050821 | protein stabilization(GO:0050821) |
0.0 | 0.3 | GO:0007029 | endoplasmic reticulum organization(GO:0007029) |
0.0 | 0.6 | GO:0046632 | alpha-beta T cell differentiation(GO:0046632) |
0.0 | 0.0 | GO:2000738 | positive regulation of stem cell differentiation(GO:2000738) |
0.0 | 0.1 | GO:0060050 | positive regulation of protein glycosylation(GO:0060050) |
0.0 | 0.1 | GO:0010459 | negative regulation of heart rate(GO:0010459) |
0.0 | 4.1 | GO:0007067 | mitotic nuclear division(GO:0007067) |
0.0 | 0.1 | GO:0019321 | pentose metabolic process(GO:0019321) |
0.0 | 0.5 | GO:0051865 | protein autoubiquitination(GO:0051865) |
0.0 | 0.0 | GO:0010735 | positive regulation of transcription via serum response element binding(GO:0010735) |
0.0 | 0.1 | GO:0009992 | cellular water homeostasis(GO:0009992) |
0.0 | 0.0 | GO:0050779 | RNA destabilization(GO:0050779) |
0.0 | 0.0 | GO:0014028 | notochord formation(GO:0014028) |
0.0 | 0.1 | GO:0032372 | negative regulation of sterol transport(GO:0032372) negative regulation of cholesterol transport(GO:0032375) |
0.0 | 0.1 | GO:0007398 | ectoderm development(GO:0007398) |
0.0 | 0.1 | GO:0032789 | saturated monocarboxylic acid metabolic process(GO:0032788) unsaturated monocarboxylic acid metabolic process(GO:0032789) |
0.0 | 0.0 | GO:0002426 | immunoglobulin production in mucosal tissue(GO:0002426) |
0.0 | 0.0 | GO:0036515 | serotonergic neuron axon guidance(GO:0036515) |
0.0 | 0.3 | GO:0000470 | maturation of LSU-rRNA(GO:0000470) |
0.0 | 0.2 | GO:0051904 | pigment granule transport(GO:0051904) |
0.0 | 0.1 | GO:0031052 | programmed DNA elimination(GO:0031049) chromosome breakage(GO:0031052) |
0.0 | 0.2 | GO:0030150 | protein import into mitochondrial matrix(GO:0030150) |
0.0 | 0.1 | GO:0097435 | fibril organization(GO:0097435) |
0.0 | 0.0 | GO:0001915 | negative regulation of T cell mediated cytotoxicity(GO:0001915) |
0.0 | 0.2 | GO:2000480 | negative regulation of cAMP-dependent protein kinase activity(GO:2000480) |
0.0 | 0.0 | GO:0060743 | epithelial cell maturation involved in prostate gland development(GO:0060743) |
0.0 | 0.2 | GO:0061436 | establishment of skin barrier(GO:0061436) |
0.0 | 0.0 | GO:0034067 | protein localization to Golgi apparatus(GO:0034067) |
0.0 | 0.0 | GO:0006549 | isoleucine metabolic process(GO:0006549) |
0.0 | 0.1 | GO:1904659 | glucose transmembrane transport(GO:1904659) |
0.0 | 0.0 | GO:0034393 | positive regulation of smooth muscle cell apoptotic process(GO:0034393) |
0.0 | 0.2 | GO:0006817 | phosphate ion transport(GO:0006817) |
0.0 | 0.1 | GO:0070389 | chaperone cofactor-dependent protein refolding(GO:0070389) |
0.0 | 0.0 | GO:0046813 | receptor-mediated virion attachment to host cell(GO:0046813) |
0.0 | 0.1 | GO:0018101 | protein citrullination(GO:0018101) |
0.0 | 0.0 | GO:0006290 | pyrimidine dimer repair(GO:0006290) |
0.0 | 0.0 | GO:0002576 | platelet degranulation(GO:0002576) |
0.0 | 0.2 | GO:0009109 | coenzyme catabolic process(GO:0009109) |
0.0 | 0.1 | GO:0050891 | multicellular organismal water homeostasis(GO:0050891) |
0.0 | 0.0 | GO:0010529 | regulation of transposition(GO:0010528) negative regulation of transposition(GO:0010529) |
0.0 | 0.1 | GO:1990440 | positive regulation of transcription from RNA polymerase II promoter in response to endoplasmic reticulum stress(GO:1990440) |
0.0 | 0.0 | GO:1900368 | regulation of RNA interference(GO:1900368) |
0.0 | 0.1 | GO:0019068 | virion assembly(GO:0019068) |
0.0 | 0.1 | GO:0006122 | mitochondrial electron transport, ubiquinol to cytochrome c(GO:0006122) |
0.0 | 0.0 | GO:0034983 | peptidyl-lysine deacetylation(GO:0034983) |
0.0 | 0.2 | GO:0006047 | UDP-N-acetylglucosamine metabolic process(GO:0006047) |
0.0 | 0.0 | GO:0010796 | regulation of multivesicular body size(GO:0010796) |
0.0 | 0.1 | GO:0051181 | cofactor transport(GO:0051181) |
0.0 | 0.0 | GO:0000819 | sister chromatid segregation(GO:0000819) |
0.0 | 0.1 | GO:0070589 | cell wall mannoprotein biosynthetic process(GO:0000032) mannoprotein metabolic process(GO:0006056) mannoprotein biosynthetic process(GO:0006057) cell wall glycoprotein biosynthetic process(GO:0031506) cell wall biogenesis(GO:0042546) cell wall macromolecule biosynthetic process(GO:0044038) chain elongation of O-linked mannose residue(GO:0044845) cellular component macromolecule biosynthetic process(GO:0070589) |
0.0 | 0.1 | GO:1990592 | protein polyufmylation(GO:1990564) protein K69-linked ufmylation(GO:1990592) |
0.0 | 0.0 | GO:0060315 | negative regulation of ryanodine-sensitive calcium-release channel activity(GO:0060315) |
0.0 | 0.1 | GO:0016242 | negative regulation of macroautophagy(GO:0016242) |
0.0 | 0.0 | GO:0051031 | tRNA transport(GO:0051031) |
0.0 | 0.1 | GO:0042759 | long-chain fatty acid biosynthetic process(GO:0042759) |
0.0 | 0.1 | GO:0031163 | iron-sulfur cluster assembly(GO:0016226) metallo-sulfur cluster assembly(GO:0031163) |
0.0 | 0.2 | GO:0050892 | intestinal absorption(GO:0050892) |
0.0 | 0.1 | GO:0002760 | positive regulation of antimicrobial peptide production(GO:0002225) positive regulation of antimicrobial humoral response(GO:0002760) positive regulation of antibacterial peptide production(GO:0002803) |
0.0 | 0.0 | GO:2000535 | entry of bacterium into host cell(GO:0035635) regulation of entry of bacterium into host cell(GO:2000535) |
0.0 | 0.1 | GO:0051205 | protein insertion into membrane(GO:0051205) |
0.0 | 0.1 | GO:0021957 | corticospinal tract morphogenesis(GO:0021957) |
0.0 | 0.1 | GO:0001833 | inner cell mass cell proliferation(GO:0001833) |
0.0 | 0.0 | GO:0043217 | myelin maintenance(GO:0043217) |
0.0 | 0.1 | GO:0008216 | spermidine metabolic process(GO:0008216) |
0.0 | 0.5 | GO:0002474 | antigen processing and presentation of peptide antigen via MHC class I(GO:0002474) |
0.0 | 0.2 | GO:0001522 | pseudouridine synthesis(GO:0001522) |
0.0 | 0.0 | GO:0060236 | regulation of mitotic spindle organization(GO:0060236) |
0.0 | 0.2 | GO:0008156 | negative regulation of DNA replication(GO:0008156) |
0.0 | 0.1 | GO:0007144 | female meiosis I(GO:0007144) |
0.0 | 0.1 | GO:0045577 | regulation of B cell differentiation(GO:0045577) |
0.0 | 0.0 | GO:0002589 | regulation of antigen processing and presentation of peptide antigen via MHC class I(GO:0002589) |
0.0 | 0.0 | GO:0048865 | stem cell fate commitment(GO:0048865) |
0.0 | 0.1 | GO:0060453 | regulation of gastric acid secretion(GO:0060453) |
0.0 | 0.0 | GO:0045047 | protein targeting to ER(GO:0045047) |
0.0 | 0.0 | GO:0036481 | intrinsic apoptotic signaling pathway in response to hydrogen peroxide(GO:0036481) |
0.0 | 0.1 | GO:0042092 | type 2 immune response(GO:0042092) |
0.0 | 0.1 | GO:0060856 | establishment of blood-brain barrier(GO:0060856) |
0.0 | 0.0 | GO:0007619 | courtship behavior(GO:0007619) |
0.0 | 0.0 | GO:0072071 | mesangial cell differentiation(GO:0072007) glomerular mesangial cell differentiation(GO:0072008) kidney interstitial fibroblast differentiation(GO:0072071) renal interstitial fibroblast development(GO:0072141) mesangial cell development(GO:0072143) glomerular mesangial cell development(GO:0072144) |
0.0 | 0.0 | GO:1902036 | regulation of hematopoietic stem cell differentiation(GO:1902036) |
0.0 | 0.1 | GO:0016338 | calcium-independent cell-cell adhesion via plasma membrane cell-adhesion molecules(GO:0016338) |
0.0 | 0.1 | GO:1901552 | positive regulation of endothelial cell development(GO:1901552) positive regulation of establishment of endothelial barrier(GO:1903142) |
0.0 | 0.1 | GO:1903313 | positive regulation of mRNA metabolic process(GO:1903313) |
0.0 | 0.1 | GO:0046909 | intermembrane transport(GO:0046909) |
0.0 | 0.1 | GO:0060177 | regulation of angiotensin metabolic process(GO:0060177) |
0.0 | 0.1 | GO:0034312 | diol biosynthetic process(GO:0034312) sphingosine biosynthetic process(GO:0046512) |
0.0 | 0.0 | GO:0036037 | CD8-positive, alpha-beta T cell activation(GO:0036037) |
0.0 | 0.0 | GO:1900225 | regulation of NLRP3 inflammasome complex assembly(GO:1900225) |
0.0 | 0.1 | GO:0000731 | DNA synthesis involved in DNA repair(GO:0000731) |
0.0 | 0.1 | GO:0006308 | DNA catabolic process(GO:0006308) |
0.0 | 0.0 | GO:0043249 | erythrocyte maturation(GO:0043249) |
0.0 | 0.0 | GO:0009650 | UV protection(GO:0009650) |
0.0 | 0.0 | GO:0046121 | deoxyribonucleoside catabolic process(GO:0046121) |
0.0 | 0.0 | GO:0017085 | response to insecticide(GO:0017085) response to pyrethroid(GO:0046684) |
0.0 | 0.1 | GO:0007141 | male meiosis I(GO:0007141) |
0.0 | 0.0 | GO:0034162 | toll-like receptor 9 signaling pathway(GO:0034162) |
0.0 | 0.1 | GO:0030212 | hyaluronan metabolic process(GO:0030212) |
0.0 | 1.3 | GO:0000375 | RNA splicing, via transesterification reactions(GO:0000375) |
0.0 | 0.0 | GO:0010841 | positive regulation of circadian sleep/wake cycle, wakefulness(GO:0010841) |
0.0 | 0.1 | GO:0002227 | innate immune response in mucosa(GO:0002227) |
0.0 | 0.0 | GO:0051446 | positive regulation of meiotic cell cycle(GO:0051446) |
0.0 | 0.0 | GO:0010756 | positive regulation of plasminogen activation(GO:0010756) |
0.0 | 0.0 | GO:0048512 | circadian behavior(GO:0048512) |
0.0 | 0.2 | GO:0017144 | drug metabolic process(GO:0017144) |
0.0 | 0.0 | GO:0006678 | glucosylceramide metabolic process(GO:0006678) |
0.0 | 0.0 | GO:2000110 | negative regulation of macrophage apoptotic process(GO:2000110) |
0.0 | 0.0 | GO:0001553 | luteinization(GO:0001553) |
0.0 | 0.1 | GO:0006268 | DNA unwinding involved in DNA replication(GO:0006268) |
0.0 | 0.0 | GO:0033313 | meiotic cell cycle checkpoint(GO:0033313) |
0.0 | 0.0 | GO:0032252 | secretory granule localization(GO:0032252) |
0.0 | 0.0 | GO:0070831 | basement membrane assembly(GO:0070831) |
0.0 | 0.0 | GO:0031497 | chromatin assembly(GO:0031497) |
0.0 | 0.0 | GO:2000671 | regulation of motor neuron apoptotic process(GO:2000671) |
0.0 | 0.0 | GO:0051187 | cofactor catabolic process(GO:0051187) |
0.0 | 0.0 | GO:0097503 | sialylation(GO:0097503) |
0.0 | 0.0 | GO:0018206 | peptidyl-methionine modification(GO:0018206) |
0.0 | 0.1 | GO:0032784 | regulation of DNA-templated transcription, elongation(GO:0032784) |
0.0 | 0.0 | GO:0042993 | positive regulation of transcription factor import into nucleus(GO:0042993) |
0.0 | 0.1 | GO:0006104 | succinyl-CoA metabolic process(GO:0006104) |
0.0 | 0.0 | GO:0046533 | negative regulation of photoreceptor cell differentiation(GO:0046533) |
0.0 | 0.1 | GO:0098543 | detection of bacterium(GO:0016045) detection of other organism(GO:0098543) |
0.0 | 0.0 | GO:0046473 | phosphatidic acid metabolic process(GO:0046473) |
0.0 | 0.3 | GO:1904029 | regulation of cyclin-dependent protein kinase activity(GO:1904029) |
0.0 | 0.0 | GO:0061484 | hematopoietic stem cell homeostasis(GO:0061484) |
0.0 | 0.1 | GO:0046007 | negative regulation of activated T cell proliferation(GO:0046007) |
0.0 | 0.1 | GO:0051001 | negative regulation of nitric-oxide synthase activity(GO:0051001) |
0.0 | 0.1 | GO:0030033 | microvillus assembly(GO:0030033) |
0.0 | 0.2 | GO:0043171 | peptide catabolic process(GO:0043171) |
0.0 | 0.0 | GO:0070948 | regulation of neutrophil mediated cytotoxicity(GO:0070948) regulation of neutrophil mediated killing of symbiont cell(GO:0070949) |
0.0 | 0.0 | GO:1901213 | regulation of transcription from RNA polymerase II promoter involved in heart development(GO:1901213) |
0.0 | 0.0 | GO:0001661 | conditioned taste aversion(GO:0001661) |
0.0 | 0.1 | GO:0046037 | GMP metabolic process(GO:0046037) |
0.0 | 0.4 | GO:0006611 | protein export from nucleus(GO:0006611) |
0.0 | 0.1 | GO:0006729 | tetrahydrobiopterin biosynthetic process(GO:0006729) |
0.0 | 0.0 | GO:0051106 | regulation of DNA ligation(GO:0051105) positive regulation of DNA ligation(GO:0051106) |
0.0 | 0.0 | GO:0043320 | natural killer cell degranulation(GO:0043320) |
0.0 | 0.0 | GO:2000643 | positive regulation of early endosome to late endosome transport(GO:2000643) |
0.0 | 0.0 | GO:0035269 | protein O-linked mannosylation(GO:0035269) |
0.0 | 0.0 | GO:0000291 | nuclear-transcribed mRNA catabolic process, exonucleolytic(GO:0000291) |
0.0 | 0.0 | GO:2000354 | regulation of ovarian follicle development(GO:2000354) |
0.0 | 0.0 | GO:0045213 | neurotransmitter receptor metabolic process(GO:0045213) |
0.0 | 0.0 | GO:0045714 | regulation of low-density lipoprotein particle receptor biosynthetic process(GO:0045714) |
0.0 | 0.1 | GO:0003352 | regulation of cilium movement(GO:0003352) |
0.0 | 0.0 | GO:0002318 | myeloid progenitor cell differentiation(GO:0002318) |
0.0 | 0.0 | GO:0051898 | negative regulation of protein kinase B signaling(GO:0051898) |
0.0 | 0.1 | GO:0033273 | response to vitamin(GO:0033273) |
0.0 | 0.0 | GO:0098789 | pre-mRNA cleavage required for polyadenylation(GO:0098789) |
0.0 | 0.1 | GO:0014733 | regulation of skeletal muscle adaptation(GO:0014733) |
0.0 | 0.1 | GO:0006488 | dolichol-linked oligosaccharide biosynthetic process(GO:0006488) |
0.0 | 0.0 | GO:0034661 | ncRNA catabolic process(GO:0034661) |
0.0 | 0.1 | GO:0048520 | positive regulation of behavior(GO:0048520) |
0.0 | 0.0 | GO:0002121 | inter-male aggressive behavior(GO:0002121) |
0.0 | 0.1 | GO:0006390 | transcription from mitochondrial promoter(GO:0006390) |
0.0 | 0.0 | GO:0032714 | negative regulation of interleukin-5 production(GO:0032714) |
0.0 | 0.2 | GO:0031424 | keratinization(GO:0031424) |
0.0 | 0.0 | GO:0030718 | germ-line stem cell population maintenance(GO:0030718) |
0.0 | 0.0 | GO:0009750 | response to fructose(GO:0009750) |
0.0 | 0.0 | GO:0090200 | positive regulation of release of cytochrome c from mitochondria(GO:0090200) |
0.0 | 0.0 | GO:0046641 | positive regulation of alpha-beta T cell proliferation(GO:0046641) |
0.0 | 0.0 | GO:0006059 | hexitol metabolic process(GO:0006059) |
0.0 | 0.2 | GO:0030322 | stabilization of membrane potential(GO:0030322) |
0.0 | 0.0 | GO:0090520 | sphingolipid mediated signaling pathway(GO:0090520) |
0.0 | 0.0 | GO:0005984 | disaccharide metabolic process(GO:0005984) |
0.0 | 0.0 | GO:0010572 | positive regulation of platelet activation(GO:0010572) |
0.0 | 0.0 | GO:0036297 | interstrand cross-link repair(GO:0036297) |
0.0 | 0.0 | GO:0032201 | telomere maintenance via semi-conservative replication(GO:0032201) mitotic telomere maintenance via semi-conservative replication(GO:1902990) |
0.0 | 0.1 | GO:0006415 | translational termination(GO:0006415) |
0.0 | 0.0 | GO:0010586 | miRNA metabolic process(GO:0010586) |
0.0 | 0.0 | GO:0002215 | defense response to nematode(GO:0002215) |
0.0 | 0.0 | GO:0033685 | negative regulation of luteinizing hormone secretion(GO:0033685) |
0.0 | 0.0 | GO:0030890 | positive regulation of B cell proliferation(GO:0030890) |
0.0 | 0.1 | GO:0031297 | replication fork processing(GO:0031297) |
0.0 | 0.2 | GO:0048240 | sperm capacitation(GO:0048240) |
0.0 | 0.0 | GO:0002082 | regulation of oxidative phosphorylation(GO:0002082) |
0.0 | 0.0 | GO:2000074 | regulation of type B pancreatic cell development(GO:2000074) |
0.0 | 0.0 | GO:0001923 | B-1 B cell differentiation(GO:0001923) |
0.0 | 0.1 | GO:0018904 | glycerol ether metabolic process(GO:0006662) ether metabolic process(GO:0018904) |
0.0 | 0.0 | GO:0034035 | purine ribonucleoside bisphosphate metabolic process(GO:0034035) |
0.0 | 0.0 | GO:0002767 | immune response-inhibiting cell surface receptor signaling pathway(GO:0002767) |
0.0 | 0.0 | GO:0050849 | negative regulation of calcium-mediated signaling(GO:0050849) |
0.0 | 0.0 | GO:0043589 | skin morphogenesis(GO:0043589) |
0.0 | 0.0 | GO:0009436 | glyoxylate catabolic process(GO:0009436) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
1.3 | 4.0 | GO:0036488 | CHOP-C/EBP complex(GO:0036488) |
1.3 | 8.0 | GO:0014731 | spectrin-associated cytoskeleton(GO:0014731) |
1.3 | 4.0 | GO:0031074 | nucleocytoplasmic shuttling complex(GO:0031074) |
1.2 | 3.7 | GO:0005971 | ribonucleoside-diphosphate reductase complex(GO:0005971) |
1.0 | 3.9 | GO:0071141 | SMAD protein complex(GO:0071141) |
0.9 | 4.3 | GO:0030870 | Mre11 complex(GO:0030870) |
0.8 | 3.3 | GO:0031265 | CD95 death-inducing signaling complex(GO:0031265) |
0.8 | 12.5 | GO:0000177 | cytoplasmic exosome (RNase complex)(GO:0000177) |
0.8 | 3.1 | GO:0072487 | MSL complex(GO:0072487) |
0.7 | 2.6 | GO:1990357 | terminal web(GO:1990357) |
0.7 | 2.6 | GO:0005642 | annulate lamellae(GO:0005642) |
0.6 | 1.2 | GO:0030132 | clathrin coat of coated pit(GO:0030132) |
0.6 | 4.8 | GO:0001650 | fibrillar center(GO:0001650) |
0.6 | 1.2 | GO:0097451 | glial limiting end-foot(GO:0097451) |
0.6 | 5.1 | GO:0002116 | semaphorin receptor complex(GO:0002116) |
0.6 | 3.4 | GO:0072357 | PTW/PP1 phosphatase complex(GO:0072357) |
0.6 | 1.7 | GO:0072379 | BAT3 complex(GO:0071818) ER membrane insertion complex(GO:0072379) |
0.5 | 2.2 | GO:0044352 | pinosome(GO:0044352) macropinosome(GO:0044354) |
0.5 | 1.6 | GO:0030981 | cortical microtubule cytoskeleton(GO:0030981) |
0.5 | 1.6 | GO:0031933 | telomeric heterochromatin(GO:0031933) |
0.5 | 13.1 | GO:0030665 | clathrin-coated vesicle membrane(GO:0030665) |
0.5 | 2.5 | GO:0005638 | lamin filament(GO:0005638) |
0.5 | 3.5 | GO:0033256 | I-kappaB/NF-kappaB complex(GO:0033256) |
0.5 | 1.5 | GO:0097443 | sorting endosome(GO:0097443) |
0.5 | 3.0 | GO:0070776 | H3 histone acetyltransferase complex(GO:0070775) MOZ/MORF histone acetyltransferase complex(GO:0070776) |
0.5 | 6.8 | GO:0035098 | ESC/E(Z) complex(GO:0035098) |
0.5 | 2.4 | GO:0016281 | eukaryotic translation initiation factor 4F complex(GO:0016281) |
0.5 | 14.9 | GO:0010494 | cytoplasmic stress granule(GO:0010494) |
0.5 | 0.9 | GO:0005697 | telomerase holoenzyme complex(GO:0005697) |
0.4 | 2.7 | GO:0008024 | cyclin/CDK positive transcription elongation factor complex(GO:0008024) |
0.4 | 0.4 | GO:0001939 | female pronucleus(GO:0001939) |
0.4 | 1.7 | GO:0032389 | MutLalpha complex(GO:0032389) |
0.4 | 1.7 | GO:0005672 | transcription factor TFIIA complex(GO:0005672) |
0.4 | 2.1 | GO:0016461 | unconventional myosin complex(GO:0016461) |
0.4 | 4.6 | GO:0065010 | extracellular membrane-bounded organelle(GO:0065010) |
0.4 | 3.8 | GO:0048188 | Set1C/COMPASS complex(GO:0048188) |
0.4 | 1.2 | GO:0035061 | interchromatin granule(GO:0035061) |
0.4 | 2.9 | GO:0097197 | tetraspanin-enriched microdomain(GO:0097197) |
0.4 | 1.6 | GO:1903349 | omegasome membrane(GO:1903349) |
0.4 | 1.2 | GO:1990761 | growth cone lamellipodium(GO:1990761) |
0.4 | 1.6 | GO:0031465 | Cul4B-RING E3 ubiquitin ligase complex(GO:0031465) |
0.4 | 1.2 | GO:0016533 | cyclin-dependent protein kinase 5 holoenzyme complex(GO:0016533) |
0.4 | 1.6 | GO:0097452 | GAIT complex(GO:0097452) |
0.4 | 0.8 | GO:0031332 | RISC complex(GO:0016442) RNAi effector complex(GO:0031332) |
0.4 | 1.2 | GO:0000814 | ESCRT II complex(GO:0000814) |
0.4 | 3.1 | GO:0045179 | apical cortex(GO:0045179) |
0.4 | 1.9 | GO:0033063 | Rad51B-Rad51C-Rad51D-XRCC2 complex(GO:0033063) |
0.4 | 1.1 | GO:0005588 | collagen type V trimer(GO:0005588) |
0.4 | 1.1 | GO:0030689 | Noc complex(GO:0030689) |
0.4 | 2.1 | GO:0001940 | male pronucleus(GO:0001940) |
0.4 | 1.8 | GO:0016589 | NURF complex(GO:0016589) |
0.4 | 1.4 | GO:0033269 | internode region of axon(GO:0033269) |
0.3 | 2.1 | GO:0070847 | core mediator complex(GO:0070847) |
0.3 | 2.4 | GO:0031390 | Ctf18 RFC-like complex(GO:0031390) |
0.3 | 1.0 | GO:0071008 | U2-type post-mRNA release spliceosomal complex(GO:0071008) |
0.3 | 1.0 | GO:0000811 | GINS complex(GO:0000811) |
0.3 | 0.3 | GO:0061574 | ASAP complex(GO:0061574) |
0.3 | 2.9 | GO:0097470 | ribbon synapse(GO:0097470) |
0.3 | 0.6 | GO:0032777 | Piccolo NuA4 histone acetyltransferase complex(GO:0032777) |
0.3 | 1.3 | GO:0001739 | sex chromatin(GO:0001739) |
0.3 | 1.3 | GO:0030015 | CCR4-NOT core complex(GO:0030015) |
0.3 | 2.5 | GO:0010369 | chromocenter(GO:0010369) |
0.3 | 2.1 | GO:0042382 | paraspeckles(GO:0042382) |
0.3 | 3.3 | GO:0032039 | integrator complex(GO:0032039) |
0.3 | 2.1 | GO:0000788 | nuclear nucleosome(GO:0000788) |
0.3 | 0.3 | GO:0032133 | chromosome passenger complex(GO:0032133) |
0.3 | 1.2 | GO:0044530 | supraspliceosomal complex(GO:0044530) |
0.3 | 0.9 | GO:0070552 | BRISC complex(GO:0070552) |
0.3 | 1.4 | GO:0072559 | NLRP3 inflammasome complex(GO:0072559) |
0.3 | 0.8 | GO:0071664 | catenin-TCF7L2 complex(GO:0071664) |
0.3 | 1.1 | GO:0031010 | ISWI-type complex(GO:0031010) |
0.3 | 2.5 | GO:0034709 | methylosome(GO:0034709) |
0.3 | 3.2 | GO:0030914 | STAGA complex(GO:0030914) |
0.3 | 1.1 | GO:0035363 | histone locus body(GO:0035363) |
0.3 | 2.1 | GO:0031595 | nuclear proteasome complex(GO:0031595) |
0.3 | 2.6 | GO:0032797 | SMN complex(GO:0032797) |
0.3 | 1.0 | GO:0071204 | histone pre-mRNA 3'end processing complex(GO:0071204) |
0.3 | 1.0 | GO:0045120 | pronucleus(GO:0045120) |
0.3 | 2.8 | GO:0030014 | CCR4-NOT complex(GO:0030014) |
0.3 | 0.8 | GO:0031417 | NatC complex(GO:0031417) |
0.3 | 2.8 | GO:0005671 | Ada2/Gcn5/Ada3 transcription activator complex(GO:0005671) |
0.3 | 3.3 | GO:0097440 | apical dendrite(GO:0097440) |
0.3 | 2.0 | GO:0030056 | hemidesmosome(GO:0030056) |
0.2 | 0.5 | GO:0031523 | Myb complex(GO:0031523) |
0.2 | 1.0 | GO:0032541 | cortical endoplasmic reticulum(GO:0032541) |
0.2 | 2.7 | GO:0045334 | clathrin-coated endocytic vesicle(GO:0045334) |
0.2 | 10.1 | GO:0017053 | transcriptional repressor complex(GO:0017053) |
0.2 | 0.7 | GO:0097058 | CRLF-CLCF1 complex(GO:0097058) |
0.2 | 1.9 | GO:0044327 | dendritic spine head(GO:0044327) |
0.2 | 2.2 | GO:0044232 | organelle membrane contact site(GO:0044232) |
0.2 | 15.9 | GO:0016363 | nuclear matrix(GO:0016363) |
0.2 | 0.7 | GO:0005687 | U4 snRNP(GO:0005687) |
0.2 | 4.3 | GO:0071339 | MLL1/2 complex(GO:0044665) MLL1 complex(GO:0071339) |
0.2 | 0.5 | GO:0034666 | integrin alpha2-beta1 complex(GO:0034666) |
0.2 | 2.8 | GO:0031616 | spindle pole centrosome(GO:0031616) |
0.2 | 0.7 | GO:0048179 | activin receptor complex(GO:0048179) |
0.2 | 0.7 | GO:0097025 | MPP7-DLG1-LIN7 complex(GO:0097025) |
0.2 | 0.9 | GO:0035867 | alphav-beta3 integrin-IGF-1-IGF1R complex(GO:0035867) |
0.2 | 2.0 | GO:0031080 | nuclear pore outer ring(GO:0031080) |
0.2 | 1.6 | GO:0035102 | PRC1 complex(GO:0035102) |
0.2 | 12.1 | GO:0000118 | histone deacetylase complex(GO:0000118) |
0.2 | 1.3 | GO:0005677 | chromatin silencing complex(GO:0005677) |
0.2 | 0.7 | GO:0000805 | X chromosome(GO:0000805) |
0.2 | 0.4 | GO:0042585 | germinal vesicle(GO:0042585) |
0.2 | 0.9 | GO:0097136 | Bcl-2 family protein complex(GO:0097136) |
0.2 | 2.6 | GO:0043240 | Fanconi anaemia nuclear complex(GO:0043240) |
0.2 | 4.7 | GO:0016592 | mediator complex(GO:0016592) |
0.2 | 0.6 | GO:0097487 | multivesicular body, internal vesicle(GO:0097487) |
0.2 | 1.7 | GO:0090576 | RNA polymerase III transcription factor complex(GO:0090576) |
0.2 | 0.4 | GO:1990316 | ATG1/ULK1 kinase complex(GO:1990316) |
0.2 | 0.6 | GO:0071942 | XPC complex(GO:0071942) |
0.2 | 0.4 | GO:0033061 | DNA recombinase mediator complex(GO:0033061) |
0.2 | 1.8 | GO:0070938 | contractile ring(GO:0070938) |
0.2 | 2.2 | GO:0035631 | CD40 receptor complex(GO:0035631) |
0.2 | 1.8 | GO:0008250 | oligosaccharyltransferase complex(GO:0008250) |
0.2 | 3.8 | GO:0035145 | exon-exon junction complex(GO:0035145) |
0.2 | 0.6 | GO:0009331 | glycerol-3-phosphate dehydrogenase complex(GO:0009331) |
0.2 | 0.4 | GO:0005914 | spot adherens junction(GO:0005914) |
0.2 | 3.2 | GO:0030131 | clathrin adaptor complex(GO:0030131) |
0.2 | 1.1 | GO:0042587 | glycogen granule(GO:0042587) |
0.2 | 0.6 | GO:0042827 | platelet dense granule(GO:0042827) |
0.2 | 9.4 | GO:0016605 | PML body(GO:0016605) |
0.2 | 0.7 | GO:0044294 | dendritic growth cone(GO:0044294) |
0.2 | 1.7 | GO:0031254 | uropod(GO:0001931) cell trailing edge(GO:0031254) |
0.2 | 0.5 | GO:0070939 | Dsl1p complex(GO:0070939) |
0.2 | 0.5 | GO:0070937 | CRD-mediated mRNA stability complex(GO:0070937) |
0.2 | 1.6 | GO:0005682 | U5 snRNP(GO:0005682) |
0.2 | 0.7 | GO:1990246 | uniplex complex(GO:1990246) |
0.2 | 1.2 | GO:0034098 | VCP-NPL4-UFD1 AAA ATPase complex(GO:0034098) |
0.2 | 0.7 | GO:0000444 | MIS12/MIND type complex(GO:0000444) |
0.2 | 0.5 | GO:0032937 | SREBP-SCAP-Insig complex(GO:0032937) |
0.2 | 2.5 | GO:0031519 | PcG protein complex(GO:0031519) |
0.2 | 1.1 | GO:0097539 | ciliary transition fiber(GO:0097539) |
0.2 | 0.7 | GO:0044666 | MLL3/4 complex(GO:0044666) |
0.2 | 0.3 | GO:0000214 | tRNA-intron endonuclease complex(GO:0000214) |
0.2 | 3.5 | GO:0090544 | BAF-type complex(GO:0090544) |
0.2 | 0.7 | GO:0048476 | Holliday junction resolvase complex(GO:0048476) |
0.2 | 1.0 | GO:0071782 | endoplasmic reticulum tubular network(GO:0071782) |
0.2 | 0.7 | GO:0071438 | invadopodium membrane(GO:0071438) |
0.2 | 1.3 | GO:0070578 | RISC-loading complex(GO:0070578) |
0.2 | 0.5 | GO:1990635 | proximal dendrite(GO:1990635) |
0.2 | 3.0 | GO:0035861 | site of double-strand break(GO:0035861) |
0.2 | 0.3 | GO:1990423 | RZZ complex(GO:1990423) |
0.2 | 0.6 | GO:0031094 | platelet dense tubular network(GO:0031094) |
0.2 | 0.2 | GO:0090498 | extrinsic component of Golgi membrane(GO:0090498) |
0.2 | 1.2 | GO:0000815 | ESCRT III complex(GO:0000815) |
0.2 | 0.8 | GO:0005964 | phosphorylase kinase complex(GO:0005964) |
0.1 | 1.2 | GO:0005685 | U1 snRNP(GO:0005685) |
0.1 | 0.1 | GO:0097504 | Gemini of coiled bodies(GO:0097504) |
0.1 | 0.3 | GO:0097513 | myosin II filament(GO:0097513) |
0.1 | 0.3 | GO:0070419 | nonhomologous end joining complex(GO:0070419) |
0.1 | 1.8 | GO:0034663 | endoplasmic reticulum chaperone complex(GO:0034663) |
0.1 | 0.9 | GO:0005744 | mitochondrial inner membrane presequence translocase complex(GO:0005744) |
0.1 | 0.9 | GO:0000307 | cyclin-dependent protein kinase holoenzyme complex(GO:0000307) |
0.1 | 0.4 | GO:0000942 | condensed nuclear chromosome outer kinetochore(GO:0000942) |
0.1 | 33.1 | GO:0000785 | chromatin(GO:0000785) |
0.1 | 1.2 | GO:0033116 | endoplasmic reticulum-Golgi intermediate compartment membrane(GO:0033116) |
0.1 | 3.8 | GO:0000123 | histone acetyltransferase complex(GO:0000123) |
0.1 | 1.2 | GO:0034045 | pre-autophagosomal structure membrane(GO:0034045) |
0.1 | 0.6 | GO:0005797 | Golgi medial cisterna(GO:0005797) |
0.1 | 0.8 | GO:0061700 | GATOR2 complex(GO:0061700) |
0.1 | 1.4 | GO:0032426 | stereocilium tip(GO:0032426) |
0.1 | 1.3 | GO:0032045 | guanyl-nucleotide exchange factor complex(GO:0032045) |
0.1 | 30.9 | GO:0005667 | transcription factor complex(GO:0005667) |
0.1 | 0.6 | GO:0000836 | ER ubiquitin ligase complex(GO:0000835) Hrd1p ubiquitin ligase complex(GO:0000836) |
0.1 | 1.1 | GO:0031143 | pseudopodium(GO:0031143) |
0.1 | 2.6 | GO:0051233 | spindle midzone(GO:0051233) |
0.1 | 0.8 | GO:0005916 | fascia adherens(GO:0005916) |
0.1 | 0.7 | GO:0005652 | nuclear lamina(GO:0005652) |
0.1 | 0.4 | GO:0005967 | mitochondrial pyruvate dehydrogenase complex(GO:0005967) |
0.1 | 0.1 | GO:0034679 | integrin alpha9-beta1 complex(GO:0034679) |
0.1 | 0.9 | GO:0030991 | intraciliary transport particle A(GO:0030991) |
0.1 | 0.1 | GO:0097512 | cardiac myofibril(GO:0097512) |
0.1 | 3.6 | GO:0008180 | COP9 signalosome(GO:0008180) |
0.1 | 0.4 | GO:0070531 | BRCA1-A complex(GO:0070531) |
0.1 | 3.2 | GO:0097228 | sperm principal piece(GO:0097228) |
0.1 | 0.3 | GO:1990923 | PET complex(GO:1990923) |
0.1 | 0.5 | GO:0031464 | Cul4A-RING E3 ubiquitin ligase complex(GO:0031464) |
0.1 | 1.0 | GO:0043020 | NADPH oxidase complex(GO:0043020) |
0.1 | 5.0 | GO:0032592 | integral component of mitochondrial membrane(GO:0032592) |
0.1 | 0.4 | GO:0032806 | carboxy-terminal domain protein kinase complex(GO:0032806) |
0.1 | 1.4 | GO:0031528 | microvillus membrane(GO:0031528) |
0.1 | 4.4 | GO:0005834 | heterotrimeric G-protein complex(GO:0005834) |
0.1 | 0.2 | GO:0071004 | U2-type prespliceosome(GO:0071004) |
0.1 | 4.0 | GO:0071013 | catalytic step 2 spliceosome(GO:0071013) |
0.1 | 0.5 | GO:0071953 | elastic fiber(GO:0071953) |
0.1 | 3.9 | GO:0005905 | clathrin-coated pit(GO:0005905) |
0.1 | 0.6 | GO:0097225 | sperm midpiece(GO:0097225) |
0.1 | 0.5 | GO:0035339 | SPOTS complex(GO:0035339) |
0.1 | 0.6 | GO:0031315 | extrinsic component of mitochondrial outer membrane(GO:0031315) |
0.1 | 5.5 | GO:0005811 | lipid particle(GO:0005811) |
0.1 | 0.7 | GO:0070820 | tertiary granule(GO:0070820) |
0.1 | 0.2 | GO:0000176 | nuclear exosome (RNase complex)(GO:0000176) |
0.1 | 1.7 | GO:0002102 | podosome(GO:0002102) |
0.1 | 0.4 | GO:0070761 | pre-snoRNP complex(GO:0070761) |
0.1 | 1.2 | GO:0030126 | COPI vesicle coat(GO:0030126) |
0.1 | 0.3 | GO:0043625 | delta DNA polymerase complex(GO:0043625) |
0.1 | 0.4 | GO:0002079 | inner acrosomal membrane(GO:0002079) |
0.1 | 0.9 | GO:0000407 | pre-autophagosomal structure(GO:0000407) |
0.1 | 0.5 | GO:0042824 | MHC class I peptide loading complex(GO:0042824) |
0.1 | 0.8 | GO:0031932 | TORC2 complex(GO:0031932) |
0.1 | 5.8 | GO:0005814 | centriole(GO:0005814) |
0.1 | 0.2 | GO:0032010 | phagolysosome(GO:0032010) |
0.1 | 0.5 | GO:0005664 | origin recognition complex(GO:0000808) nuclear origin of replication recognition complex(GO:0005664) |
0.1 | 1.2 | GO:0042589 | zymogen granule membrane(GO:0042589) |
0.1 | 0.1 | GO:0008091 | spectrin(GO:0008091) |
0.1 | 0.3 | GO:0038201 | TORC1 complex(GO:0031931) TOR complex(GO:0038201) |
0.1 | 0.3 | GO:0043293 | apoptosome(GO:0043293) |
0.1 | 1.0 | GO:0000164 | protein phosphatase type 1 complex(GO:0000164) |
0.1 | 0.2 | GO:0072687 | meiotic spindle(GO:0072687) |
0.1 | 0.2 | GO:0005850 | eukaryotic translation initiation factor 2 complex(GO:0005850) |
0.1 | 0.5 | GO:0000940 | condensed chromosome outer kinetochore(GO:0000940) |
0.1 | 0.6 | GO:0000138 | Golgi trans cisterna(GO:0000138) |
0.1 | 0.3 | GO:0000235 | astral microtubule(GO:0000235) |
0.1 | 1.4 | GO:0043034 | costamere(GO:0043034) |
0.1 | 0.1 | GO:0031092 | platelet alpha granule membrane(GO:0031092) |
0.1 | 1.2 | GO:0002080 | acrosomal membrane(GO:0002080) |
0.1 | 0.5 | GO:0000137 | Golgi cis cisterna(GO:0000137) |
0.1 | 0.3 | GO:0030915 | Smc5-Smc6 complex(GO:0030915) |
0.1 | 3.7 | GO:0005788 | endoplasmic reticulum lumen(GO:0005788) |
0.1 | 3.1 | GO:0005776 | autophagosome(GO:0005776) |
0.1 | 1.3 | GO:0031430 | M band(GO:0031430) |
0.1 | 0.4 | GO:0031466 | Cul5-RING ubiquitin ligase complex(GO:0031466) |
0.1 | 3.2 | GO:0045171 | intercellular bridge(GO:0045171) |
0.1 | 0.2 | GO:0033588 | Elongator holoenzyme complex(GO:0033588) |
0.1 | 1.3 | GO:0005666 | DNA-directed RNA polymerase III complex(GO:0005666) |
0.1 | 0.3 | GO:0034993 | microtubule organizing center attachment site(GO:0034992) LINC complex(GO:0034993) |
0.1 | 1.2 | GO:0016471 | vacuolar proton-transporting V-type ATPase complex(GO:0016471) |
0.1 | 1.0 | GO:0034399 | nuclear periphery(GO:0034399) |
0.1 | 3.6 | GO:0005758 | mitochondrial intermembrane space(GO:0005758) |
0.1 | 0.6 | GO:0005662 | DNA replication factor A complex(GO:0005662) |
0.1 | 0.3 | GO:1990604 | IRE1-TRAF2-ASK1 complex(GO:1990604) |
0.1 | 0.6 | GO:0071541 | eukaryotic translation initiation factor 3 complex, eIF3m(GO:0071541) |
0.1 | 7.9 | GO:0072562 | blood microparticle(GO:0072562) |
0.1 | 3.6 | GO:0031228 | intrinsic component of Golgi membrane(GO:0031228) |
0.1 | 0.7 | GO:0070652 | HAUS complex(GO:0070652) |
0.1 | 95.7 | GO:0005654 | nucleoplasm(GO:0005654) |
0.1 | 0.2 | GO:0032154 | cleavage furrow(GO:0032154) cell surface furrow(GO:0097610) |
0.1 | 0.2 | GO:0032585 | multivesicular body membrane(GO:0032585) |
0.1 | 0.3 | GO:0080008 | Cul4-RING E3 ubiquitin ligase complex(GO:0080008) |
0.1 | 0.2 | GO:0045180 | basal cortex(GO:0045180) |
0.1 | 0.5 | GO:0016600 | flotillin complex(GO:0016600) |
0.1 | 0.1 | GO:0000306 | extrinsic component of vacuolar membrane(GO:0000306) |
0.1 | 1.8 | GO:0000932 | cytoplasmic mRNA processing body(GO:0000932) |
0.1 | 0.6 | GO:0000506 | glycosylphosphatidylinositol-N-acetylglucosaminyltransferase (GPI-GnT) complex(GO:0000506) |
0.1 | 1.0 | GO:0016327 | apicolateral plasma membrane(GO:0016327) |
0.1 | 1.2 | GO:0032391 | photoreceptor connecting cilium(GO:0032391) |
0.1 | 0.3 | GO:0045261 | mitochondrial proton-transporting ATP synthase complex, catalytic core F(1)(GO:0000275) proton-transporting ATP synthase complex, catalytic core F(1)(GO:0045261) |
0.1 | 3.4 | GO:0031526 | brush border membrane(GO:0031526) |
0.1 | 1.3 | GO:0005680 | anaphase-promoting complex(GO:0005680) |
0.1 | 0.1 | GO:0030666 | endocytic vesicle membrane(GO:0030666) |
0.1 | 0.9 | GO:0030119 | AP-type membrane coat adaptor complex(GO:0030119) |
0.1 | 0.1 | GO:0097208 | alveolar lamellar body(GO:0097208) |
0.1 | 0.3 | GO:0008540 | proteasome regulatory particle, base subcomplex(GO:0008540) |
0.1 | 0.2 | GO:0034366 | spherical high-density lipoprotein particle(GO:0034366) |
0.1 | 2.7 | GO:0030139 | endocytic vesicle(GO:0030139) |
0.1 | 0.2 | GO:0042575 | DNA polymerase complex(GO:0042575) |
0.1 | 0.2 | GO:0071797 | LUBAC complex(GO:0071797) |
0.1 | 0.4 | GO:1990909 | Wnt signalosome(GO:1990909) |
0.1 | 0.3 | GO:0071547 | piP-body(GO:0071547) |
0.1 | 0.4 | GO:0032593 | insulin-responsive compartment(GO:0032593) |
0.1 | 0.2 | GO:1990130 | Iml1 complex(GO:1990130) |
0.1 | 0.8 | GO:0016235 | aggresome(GO:0016235) |
0.1 | 0.3 | GO:0071986 | Ragulator complex(GO:0071986) |
0.1 | 0.5 | GO:0017119 | Golgi transport complex(GO:0017119) |
0.1 | 0.3 | GO:0046581 | intercellular canaliculus(GO:0046581) |
0.1 | 0.8 | GO:0030992 | intraciliary transport particle B(GO:0030992) |
0.1 | 0.4 | GO:0002199 | zona pellucida receptor complex(GO:0002199) |
0.1 | 2.3 | GO:0042641 | actomyosin(GO:0042641) |
0.1 | 0.4 | GO:0030904 | retromer complex(GO:0030904) |
0.1 | 0.1 | GO:0098827 | endoplasmic reticulum subcompartment(GO:0098827) |
0.1 | 0.1 | GO:0030880 | RNA polymerase complex(GO:0030880) |
0.1 | 0.1 | GO:0035748 | myelin sheath abaxonal region(GO:0035748) |
0.1 | 0.1 | GO:0016222 | procollagen-proline 4-dioxygenase complex(GO:0016222) |
0.0 | 0.3 | GO:0001520 | outer dense fiber(GO:0001520) |
0.0 | 0.2 | GO:0098799 | outer mitochondrial membrane protein complex(GO:0098799) |
0.0 | 0.1 | GO:0097413 | Lewy body(GO:0097413) |
0.0 | 2.7 | GO:0031514 | motile cilium(GO:0031514) |
0.0 | 0.2 | GO:0034464 | BBSome(GO:0034464) |
0.0 | 0.3 | GO:0070852 | cell body fiber(GO:0070852) |
0.0 | 2.0 | GO:0030496 | midbody(GO:0030496) |
0.0 | 0.4 | GO:0005885 | Arp2/3 protein complex(GO:0005885) |
0.0 | 0.1 | GO:0005853 | eukaryotic translation elongation factor 1 complex(GO:0005853) |
0.0 | 0.1 | GO:1904115 | axon cytoplasm(GO:1904115) |
0.0 | 0.1 | GO:0030688 | preribosome, small subunit precursor(GO:0030688) |
0.0 | 3.5 | GO:0009898 | cytoplasmic side of plasma membrane(GO:0009898) |
0.0 | 0.3 | GO:0034385 | very-low-density lipoprotein particle(GO:0034361) triglyceride-rich lipoprotein particle(GO:0034385) |
0.0 | 0.1 | GO:0031902 | late endosome membrane(GO:0031902) |
0.0 | 0.2 | GO:0000801 | central element(GO:0000801) |
0.0 | 0.3 | GO:0005689 | U12-type spliceosomal complex(GO:0005689) |
0.0 | 0.7 | GO:0030286 | dynein complex(GO:0030286) |
0.0 | 0.2 | GO:0042788 | polysomal ribosome(GO:0042788) |
0.0 | 1.6 | GO:0019005 | SCF ubiquitin ligase complex(GO:0019005) |
0.0 | 0.5 | GO:0005942 | phosphatidylinositol 3-kinase complex(GO:0005942) |
0.0 | 0.1 | GO:1990124 | messenger ribonucleoprotein complex(GO:1990124) |
0.0 | 0.0 | GO:0000015 | phosphopyruvate hydratase complex(GO:0000015) |
0.0 | 11.2 | GO:0005764 | lytic vacuole(GO:0000323) lysosome(GO:0005764) |
0.0 | 13.6 | GO:0005730 | nucleolus(GO:0005730) |
0.0 | 0.1 | GO:0044299 | C-fiber(GO:0044299) |
0.0 | 3.6 | GO:0035068 | micro-ribonucleoprotein complex(GO:0035068) |
0.0 | 3.4 | GO:0016323 | basolateral plasma membrane(GO:0016323) |
0.0 | 0.0 | GO:0031597 | cytosolic proteasome complex(GO:0031597) |
0.0 | 0.2 | GO:0031501 | mannosyltransferase complex(GO:0031501) |
0.0 | 0.1 | GO:0030687 | preribosome, large subunit precursor(GO:0030687) |
0.0 | 0.0 | GO:0005833 | hemoglobin complex(GO:0005833) |
0.0 | 0.0 | GO:1990712 | HFE-transferrin receptor complex(GO:1990712) |
0.0 | 0.3 | GO:0036156 | inner dynein arm(GO:0036156) |
0.0 | 0.4 | GO:0042612 | MHC class I protein complex(GO:0042612) |
0.0 | 0.0 | GO:0016460 | myosin II complex(GO:0016460) |
0.0 | 0.1 | GO:0042105 | alpha-beta T cell receptor complex(GO:0042105) |
0.0 | 0.5 | GO:0035869 | ciliary transition zone(GO:0035869) |
0.0 | 0.1 | GO:0008541 | proteasome regulatory particle, lid subcomplex(GO:0008541) |
0.0 | 1.0 | GO:0030863 | cortical cytoskeleton(GO:0030863) |
0.0 | 0.1 | GO:0017133 | mitochondrial electron transfer flavoprotein complex(GO:0017133) electron transfer flavoprotein complex(GO:0045251) |
0.0 | 0.2 | GO:0005952 | cAMP-dependent protein kinase complex(GO:0005952) |
0.0 | 0.1 | GO:0032591 | dendritic spine membrane(GO:0032591) |
0.0 | 0.3 | GO:0001527 | microfibril(GO:0001527) |
0.0 | 0.1 | GO:0017101 | aminoacyl-tRNA synthetase multienzyme complex(GO:0017101) |
0.0 | 0.7 | GO:0000794 | condensed nuclear chromosome(GO:0000794) |
0.0 | 0.1 | GO:0043220 | Schmidt-Lanterman incisure(GO:0043220) |
0.0 | 0.5 | GO:0005844 | polysome(GO:0005844) |
0.0 | 0.4 | GO:0001917 | photoreceptor inner segment(GO:0001917) |
0.0 | 0.9 | GO:0016529 | sarcoplasmic reticulum(GO:0016529) |
0.0 | 0.2 | GO:0034451 | centriolar satellite(GO:0034451) |
0.0 | 0.2 | GO:0005750 | mitochondrial respiratory chain complex III(GO:0005750) respiratory chain complex III(GO:0045275) |
0.0 | 0.4 | GO:0031985 | Golgi cisterna(GO:0031985) |
0.0 | 0.0 | GO:0031512 | motile primary cilium(GO:0031512) |
0.0 | 0.2 | GO:0016234 | inclusion body(GO:0016234) |
0.0 | 0.2 | GO:0031045 | dense core granule(GO:0031045) |
0.0 | 0.2 | GO:0001891 | phagocytic cup(GO:0001891) |
0.0 | 0.2 | GO:0032982 | myosin filament(GO:0032982) |
0.0 | 0.0 | GO:0030289 | protein phosphatase 4 complex(GO:0030289) |
0.0 | 0.9 | GO:0022625 | cytosolic large ribosomal subunit(GO:0022625) |
0.0 | 0.4 | GO:0001772 | immunological synapse(GO:0001772) |
0.0 | 0.0 | GO:0030313 | cell outer membrane(GO:0009279) cell envelope(GO:0030313) external encapsulating structure part(GO:0044462) |
0.0 | 0.2 | GO:0005732 | small nucleolar ribonucleoprotein complex(GO:0005732) |
0.0 | 55.2 | GO:0005634 | nucleus(GO:0005634) |
0.0 | 0.1 | GO:0031672 | A band(GO:0031672) |
0.0 | 0.0 | GO:0005955 | calcineurin complex(GO:0005955) |
0.0 | 0.2 | GO:0017146 | NMDA selective glutamate receptor complex(GO:0017146) |
0.0 | 0.0 | GO:0033179 | proton-transporting V-type ATPase, V0 domain(GO:0033179) |
0.0 | 0.1 | GO:0031414 | N-terminal protein acetyltransferase complex(GO:0031414) |
0.0 | 0.0 | GO:0070765 | gamma-secretase complex(GO:0070765) |
0.0 | 0.4 | GO:0001750 | photoreceptor outer segment(GO:0001750) |
0.0 | 0.1 | GO:0072669 | tRNA-splicing ligase complex(GO:0072669) |
0.0 | 0.1 | GO:0005861 | troponin complex(GO:0005861) |
0.0 | 0.1 | GO:0048770 | melanosome(GO:0042470) pigment granule(GO:0048770) |
0.0 | 0.4 | GO:0015934 | large ribosomal subunit(GO:0015934) |
0.0 | 0.1 | GO:0043196 | varicosity(GO:0043196) |
0.0 | 0.1 | GO:0008074 | guanylate cyclase complex, soluble(GO:0008074) |
0.0 | 0.1 | GO:0034364 | high-density lipoprotein particle(GO:0034364) |
0.0 | 0.0 | GO:0005852 | eukaryotic translation initiation factor 3 complex(GO:0005852) |
0.0 | 0.1 | GO:0036513 | Derlin-1 retrotranslocation complex(GO:0036513) |
0.0 | 0.0 | GO:0031462 | Cul2-RING ubiquitin ligase complex(GO:0031462) |
0.0 | 0.1 | GO:0033391 | chromatoid body(GO:0033391) |
0.0 | 0.3 | GO:0045095 | keratin filament(GO:0045095) |
0.0 | 0.0 | GO:0005851 | eukaryotic translation initiation factor 2B complex(GO:0005851) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
3.8 | 11.3 | GO:1990829 | C-rich single-stranded DNA binding(GO:1990829) |
1.5 | 4.4 | GO:0061676 | importin-alpha family protein binding(GO:0061676) |
1.2 | 3.7 | GO:0004748 | ribonucleoside-diphosphate reductase activity, thioredoxin disulfide as acceptor(GO:0004748) oxidoreductase activity, acting on CH or CH2 groups, disulfide as acceptor(GO:0016728) ribonucleoside-diphosphate reductase activity(GO:0061731) |
1.1 | 4.4 | GO:0070326 | very-low-density lipoprotein particle receptor binding(GO:0070326) |
1.1 | 3.3 | GO:0035877 | death effector domain binding(GO:0035877) |
1.0 | 3.1 | GO:0050692 | DBD domain binding(GO:0050692) |
1.0 | 3.9 | GO:0061665 | SUMO ligase activity(GO:0061665) |
1.0 | 2.9 | GO:0004949 | cannabinoid receptor activity(GO:0004949) |
0.9 | 2.7 | GO:0005350 | purine nucleobase transmembrane transporter activity(GO:0005345) pyrimidine nucleobase transmembrane transporter activity(GO:0005350) nucleobase transmembrane transporter activity(GO:0015205) |
0.9 | 1.8 | GO:0042809 | vitamin D receptor binding(GO:0042809) |
0.8 | 1.7 | GO:0001069 | regulatory region RNA binding(GO:0001069) |
0.8 | 5.0 | GO:0005072 | transforming growth factor beta receptor, cytoplasmic mediator activity(GO:0005072) |
0.8 | 3.1 | GO:0005173 | stem cell factor receptor binding(GO:0005173) |
0.8 | 2.3 | GO:1990188 | euchromatin binding(GO:1990188) |
0.7 | 0.7 | GO:0019237 | centromeric DNA binding(GO:0019237) |
0.7 | 2.1 | GO:0008597 | calcium-dependent protein serine/threonine phosphatase regulator activity(GO:0008597) |
0.7 | 1.4 | GO:1990825 | sequence-specific mRNA binding(GO:1990825) |
0.7 | 2.8 | GO:0035615 | clathrin adaptor activity(GO:0035615) endocytic adaptor activity(GO:0098748) |
0.7 | 2.7 | GO:0004035 | alkaline phosphatase activity(GO:0004035) |
0.7 | 2.0 | GO:0030519 | snoRNP binding(GO:0030519) |
0.7 | 12.7 | GO:0003746 | translation elongation factor activity(GO:0003746) |
0.6 | 1.9 | GO:0070410 | co-SMAD binding(GO:0070410) |
0.6 | 1.9 | GO:0043533 | inositol 1,3,4,5 tetrakisphosphate binding(GO:0043533) |
0.6 | 2.5 | GO:0022833 | mechanically-gated ion channel activity(GO:0008381) mechanically gated channel activity(GO:0022833) |
0.6 | 1.9 | GO:0048408 | epidermal growth factor binding(GO:0048408) |
0.6 | 5.6 | GO:0042171 | lysophosphatidic acid acyltransferase activity(GO:0042171) |
0.6 | 1.9 | GO:0070644 | vitamin D response element binding(GO:0070644) |
0.6 | 3.1 | GO:0070290 | N-acylphosphatidylethanolamine-specific phospholipase D activity(GO:0070290) |
0.6 | 10.9 | GO:0042975 | peroxisome proliferator activated receptor binding(GO:0042975) |
0.6 | 1.8 | GO:0004514 | nicotinate-nucleotide diphosphorylase (carboxylating) activity(GO:0004514) |
0.6 | 1.8 | GO:0004013 | adenosylhomocysteinase activity(GO:0004013) trialkylsulfonium hydrolase activity(GO:0016802) |
0.6 | 1.7 | GO:0003976 | UDP-N-acetylglucosamine-lysosomal-enzyme N-acetylglucosaminephosphotransferase activity(GO:0003976) |
0.6 | 4.6 | GO:0001163 | RNA polymerase I regulatory region sequence-specific DNA binding(GO:0001163) RNA polymerase I CORE element sequence-specific DNA binding(GO:0001164) |
0.6 | 1.7 | GO:0004611 | phosphoenolpyruvate carboxykinase activity(GO:0004611) |
0.6 | 4.5 | GO:0003691 | double-stranded telomeric DNA binding(GO:0003691) |
0.6 | 0.6 | GO:0070991 | medium-chain-acyl-CoA dehydrogenase activity(GO:0070991) |
0.6 | 2.2 | GO:0001224 | RNA polymerase II transcription cofactor binding(GO:0001224) |
0.5 | 3.2 | GO:0004064 | arylesterase activity(GO:0004064) |
0.5 | 0.5 | GO:0031826 | type 2A serotonin receptor binding(GO:0031826) |
0.5 | 5.7 | GO:0017154 | semaphorin receptor activity(GO:0017154) |
0.5 | 3.0 | GO:0008420 | CTD phosphatase activity(GO:0008420) |
0.5 | 1.9 | GO:0031493 | nucleosomal histone binding(GO:0031493) |
0.5 | 0.5 | GO:0070573 | metallodipeptidase activity(GO:0070573) |
0.5 | 1.4 | GO:0004619 | bisphosphoglycerate mutase activity(GO:0004082) phosphoglycerate mutase activity(GO:0004619) 2,3-bisphosphoglycerate-dependent phosphoglycerate mutase activity(GO:0046538) |
0.5 | 1.4 | GO:1990715 | mRNA CDS binding(GO:1990715) |
0.5 | 1.4 | GO:1901612 | cardiolipin binding(GO:1901612) |
0.5 | 1.4 | GO:0050816 | phosphothreonine binding(GO:0050816) |
0.4 | 2.2 | GO:0005007 | fibroblast growth factor-activated receptor activity(GO:0005007) |
0.4 | 1.8 | GO:0004468 | lysine N-acetyltransferase activity, acting on acetyl phosphate as donor(GO:0004468) |
0.4 | 2.2 | GO:0004957 | prostaglandin E receptor activity(GO:0004957) |
0.4 | 2.6 | GO:0031685 | adenosine receptor binding(GO:0031685) |
0.4 | 5.6 | GO:0008432 | JUN kinase binding(GO:0008432) |
0.4 | 3.4 | GO:0004017 | adenylate kinase activity(GO:0004017) |
0.4 | 5.4 | GO:0070577 | lysine-acetylated histone binding(GO:0070577) |
0.4 | 6.2 | GO:0035259 | glucocorticoid receptor binding(GO:0035259) |
0.4 | 1.2 | GO:0008732 | threonine aldolase activity(GO:0004793) L-allo-threonine aldolase activity(GO:0008732) |
0.4 | 2.5 | GO:0008199 | ferric iron binding(GO:0008199) |
0.4 | 0.4 | GO:0033142 | progesterone receptor binding(GO:0033142) |
0.4 | 0.8 | GO:0097200 | cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:0097200) |
0.4 | 0.8 | GO:0005119 | smoothened binding(GO:0005119) |
0.4 | 4.8 | GO:0043024 | ribosomal small subunit binding(GO:0043024) |
0.4 | 1.6 | GO:0015375 | glycine:sodium symporter activity(GO:0015375) |
0.4 | 1.2 | GO:0071535 | RING-like zinc finger domain binding(GO:0071535) |
0.4 | 2.7 | GO:1990405 | protein antigen binding(GO:1990405) |
0.4 | 1.9 | GO:0046975 | histone methyltransferase activity (H3-K36 specific)(GO:0046975) |
0.4 | 5.4 | GO:0016922 | ligand-dependent nuclear receptor binding(GO:0016922) |
0.4 | 0.4 | GO:0035851 | Krueppel-associated box domain binding(GO:0035851) |
0.4 | 1.1 | GO:0016262 | protein N-acetylglucosaminyltransferase activity(GO:0016262) |
0.4 | 5.3 | GO:0016493 | C-C chemokine receptor activity(GO:0016493) |
0.4 | 1.5 | GO:0000386 | second spliceosomal transesterification activity(GO:0000386) |
0.4 | 4.5 | GO:0044548 | S100 protein binding(GO:0044548) |
0.4 | 6.3 | GO:0008307 | structural constituent of muscle(GO:0008307) |
0.4 | 1.9 | GO:0047391 | alkylglycerophosphoethanolamine phosphodiesterase activity(GO:0047391) |
0.4 | 1.9 | GO:0005131 | growth hormone receptor binding(GO:0005131) |
0.4 | 1.5 | GO:0043515 | kinetochore binding(GO:0043515) |
0.4 | 2.5 | GO:1904264 | ubiquitin protein ligase activity involved in ERAD pathway(GO:1904264) |
0.4 | 1.1 | GO:0008184 | glycogen phosphorylase activity(GO:0008184) |
0.4 | 1.1 | GO:0036033 | mediator complex binding(GO:0036033) |
0.4 | 0.4 | GO:0070878 | primary miRNA binding(GO:0070878) |
0.3 | 0.7 | GO:0004030 | aldehyde dehydrogenase [NAD(P)+] activity(GO:0004030) |
0.3 | 5.8 | GO:0046966 | thyroid hormone receptor binding(GO:0046966) |
0.3 | 7.2 | GO:0071889 | 14-3-3 protein binding(GO:0071889) |
0.3 | 2.0 | GO:0097322 | 7SK snRNA binding(GO:0097322) |
0.3 | 1.3 | GO:0008865 | fructokinase activity(GO:0008865) mannokinase activity(GO:0019158) |
0.3 | 1.7 | GO:0000405 | bubble DNA binding(GO:0000405) |
0.3 | 1.3 | GO:0015199 | amino-acid betaine transmembrane transporter activity(GO:0015199) carnitine transmembrane transporter activity(GO:0015226) |
0.3 | 1.3 | GO:0034714 | type III transforming growth factor beta receptor binding(GO:0034714) |
0.3 | 1.0 | GO:0004938 | alpha2-adrenergic receptor activity(GO:0004938) |
0.3 | 1.7 | GO:0035613 | RNA stem-loop binding(GO:0035613) |
0.3 | 1.3 | GO:0003873 | 6-phosphofructo-2-kinase activity(GO:0003873) |
0.3 | 2.3 | GO:0030346 | protein phosphatase 2B binding(GO:0030346) |
0.3 | 0.7 | GO:0035175 | histone kinase activity (H3-S10 specific)(GO:0035175) |
0.3 | 1.3 | GO:0009374 | biotin binding(GO:0009374) |
0.3 | 2.3 | GO:0046972 | histone acetyltransferase activity (H4-K5 specific)(GO:0043995) histone acetyltransferase activity (H4-K8 specific)(GO:0043996) histone acetyltransferase activity (H4-K16 specific)(GO:0046972) |
0.3 | 1.3 | GO:0033300 | dehydroascorbic acid transporter activity(GO:0033300) |
0.3 | 1.9 | GO:0003956 | NAD(P)+-protein-arginine ADP-ribosyltransferase activity(GO:0003956) |
0.3 | 2.9 | GO:0001222 | transcription corepressor binding(GO:0001222) |
0.3 | 10.0 | GO:0070888 | E-box binding(GO:0070888) |
0.3 | 1.0 | GO:0045134 | uridine-diphosphatase activity(GO:0045134) |
0.3 | 1.6 | GO:0017169 | CDP-alcohol phosphatidyltransferase activity(GO:0017169) |
0.3 | 0.6 | GO:0008384 | IkappaB kinase activity(GO:0008384) |
0.3 | 1.2 | GO:0030229 | very-low-density lipoprotein particle receptor activity(GO:0030229) |
0.3 | 2.1 | GO:0016176 | superoxide-generating NADPH oxidase activator activity(GO:0016176) |
0.3 | 0.9 | GO:0004359 | glutaminase activity(GO:0004359) |
0.3 | 7.0 | GO:0017091 | AU-rich element binding(GO:0017091) |
0.3 | 5.1 | GO:0070064 | proline-rich region binding(GO:0070064) |
0.3 | 2.7 | GO:0017166 | vinculin binding(GO:0017166) |
0.3 | 2.1 | GO:0003836 | beta-galactoside (CMP) alpha-2,3-sialyltransferase activity(GO:0003836) |
0.3 | 1.8 | GO:0032554 | purine deoxyribonucleotide binding(GO:0032554) |
0.3 | 7.4 | GO:0001205 | transcriptional activator activity, RNA polymerase II distal enhancer sequence-specific binding(GO:0001205) |
0.3 | 4.1 | GO:1990841 | promoter-specific chromatin binding(GO:1990841) |
0.3 | 1.2 | GO:0036435 | K48-linked polyubiquitin binding(GO:0036435) |
0.3 | 1.4 | GO:0019911 | structural constituent of myelin sheath(GO:0019911) |
0.3 | 1.1 | GO:0004046 | aminoacylase activity(GO:0004046) |
0.3 | 4.6 | GO:0001784 | phosphotyrosine binding(GO:0001784) |
0.3 | 6.8 | GO:0001103 | RNA polymerase II repressing transcription factor binding(GO:0001103) |
0.3 | 1.4 | GO:0004726 | non-membrane spanning protein tyrosine phosphatase activity(GO:0004726) |
0.3 | 1.7 | GO:0008097 | 5S rRNA binding(GO:0008097) |
0.3 | 7.4 | GO:0032266 | phosphatidylinositol-3-phosphate binding(GO:0032266) |
0.3 | 5.7 | GO:0008139 | nuclear localization sequence binding(GO:0008139) |
0.3 | 1.1 | GO:0070053 | thrombospondin receptor activity(GO:0070053) |
0.3 | 2.5 | GO:0032794 | GTPase activating protein binding(GO:0032794) |
0.3 | 1.9 | GO:0000150 | recombinase activity(GO:0000150) |
0.3 | 1.7 | GO:1990381 | ubiquitin-specific protease binding(GO:1990381) |
0.3 | 0.8 | GO:0019002 | GMP binding(GO:0019002) |
0.3 | 1.1 | GO:0030296 | protein tyrosine kinase activator activity(GO:0030296) |
0.3 | 0.5 | GO:0005168 | neurotrophin TRKA receptor binding(GO:0005168) |
0.3 | 1.1 | GO:0000774 | adenyl-nucleotide exchange factor activity(GO:0000774) |
0.3 | 1.3 | GO:0042015 | interleukin-20 binding(GO:0042015) |
0.3 | 0.8 | GO:0034046 | poly(G) binding(GO:0034046) |
0.3 | 1.6 | GO:0004439 | phosphatidylinositol-4,5-bisphosphate 5-phosphatase activity(GO:0004439) |
0.3 | 1.9 | GO:0004579 | dolichyl-diphosphooligosaccharide-protein glycotransferase activity(GO:0004579) |
0.3 | 1.1 | GO:0000340 | RNA 7-methylguanosine cap binding(GO:0000340) |
0.3 | 2.4 | GO:0033170 | DNA clamp loader activity(GO:0003689) protein-DNA loading ATPase activity(GO:0033170) |
0.3 | 0.8 | GO:0001075 | transcription factor activity, RNA polymerase II core promoter sequence-specific binding involved in preinitiation complex assembly(GO:0001075) |
0.3 | 0.8 | GO:0097016 | L27 domain binding(GO:0097016) |
0.3 | 0.8 | GO:0008503 | benzodiazepine receptor activity(GO:0008503) |
0.3 | 1.6 | GO:0070324 | thyroid hormone binding(GO:0070324) |
0.3 | 3.9 | GO:0008143 | poly(A) binding(GO:0008143) |
0.3 | 4.1 | GO:0017049 | GTP-Rho binding(GO:0017049) |
0.3 | 0.3 | GO:0017099 | very-long-chain-acyl-CoA dehydrogenase activity(GO:0017099) |
0.3 | 1.3 | GO:0035612 | AP-2 adaptor complex binding(GO:0035612) |
0.3 | 1.0 | GO:0015220 | choline transmembrane transporter activity(GO:0015220) |
0.3 | 1.0 | GO:0030957 | Tat protein binding(GO:0030957) |
0.3 | 0.8 | GO:0005128 | erythropoietin receptor binding(GO:0005128) |
0.3 | 0.8 | GO:0035514 | DNA demethylase activity(GO:0035514) |
0.2 | 0.7 | GO:0005087 | Ran guanyl-nucleotide exchange factor activity(GO:0005087) |
0.2 | 1.2 | GO:0015216 | adenine nucleotide transmembrane transporter activity(GO:0000295) purine ribonucleotide transmembrane transporter activity(GO:0005346) purine nucleotide transmembrane transporter activity(GO:0015216) |
0.2 | 0.7 | GO:0003726 | double-stranded RNA adenosine deaminase activity(GO:0003726) |
0.2 | 1.2 | GO:0032050 | clathrin heavy chain binding(GO:0032050) |
0.2 | 5.4 | GO:0043027 | cysteine-type endopeptidase inhibitor activity involved in apoptotic process(GO:0043027) |
0.2 | 1.4 | GO:0016889 | endodeoxyribonuclease activity, producing 3'-phosphomonoesters(GO:0016889) |
0.2 | 0.7 | GO:1990460 | leptin receptor binding(GO:1990460) |
0.2 | 0.7 | GO:1990446 | snRNP binding(GO:0070990) U1 snRNP binding(GO:1990446) |
0.2 | 0.7 | GO:0015440 | peptide-transporting ATPase activity(GO:0015440) |
0.2 | 1.2 | GO:0004111 | creatine kinase activity(GO:0004111) |
0.2 | 0.9 | GO:0036374 | gamma-glutamyltransferase activity(GO:0003840) glutathione hydrolase activity(GO:0036374) |
0.2 | 0.7 | GO:0034186 | apolipoprotein A-I binding(GO:0034186) |
0.2 | 2.6 | GO:0070700 | BMP receptor binding(GO:0070700) |
0.2 | 2.1 | GO:0031996 | thioesterase binding(GO:0031996) |
0.2 | 1.8 | GO:0031386 | protein tag(GO:0031386) |
0.2 | 7.5 | GO:0031593 | polyubiquitin binding(GO:0031593) |
0.2 | 0.7 | GO:0047276 | N-acetyllactosaminide 3-alpha-galactosyltransferase activity(GO:0047276) |
0.2 | 0.7 | GO:0015111 | iodide transmembrane transporter activity(GO:0015111) |
0.2 | 1.8 | GO:0003810 | protein-glutamine gamma-glutamyltransferase activity(GO:0003810) |
0.2 | 0.5 | GO:0001025 | RNA polymerase III transcription factor binding(GO:0001025) |
0.2 | 0.2 | GO:0004571 | mannosyl-oligosaccharide 1,2-alpha-mannosidase activity(GO:0004571) |
0.2 | 1.4 | GO:0031419 | cobalamin binding(GO:0031419) |
0.2 | 0.9 | GO:0019136 | deoxynucleoside kinase activity(GO:0019136) |
0.2 | 2.0 | GO:0004861 | cyclin-dependent protein serine/threonine kinase inhibitor activity(GO:0004861) |
0.2 | 2.5 | GO:0000701 | purine-specific mismatch base pair DNA N-glycosylase activity(GO:0000701) |
0.2 | 1.6 | GO:0019870 | potassium channel inhibitor activity(GO:0019870) |
0.2 | 0.7 | GO:0042134 | rRNA primary transcript binding(GO:0042134) |
0.2 | 0.7 | GO:0004832 | valine-tRNA ligase activity(GO:0004832) |
0.2 | 0.9 | GO:1990226 | histone methyltransferase binding(GO:1990226) |
0.2 | 0.9 | GO:0052834 | inositol monophosphate 1-phosphatase activity(GO:0008934) inositol monophosphate 3-phosphatase activity(GO:0052832) inositol monophosphate 4-phosphatase activity(GO:0052833) inositol monophosphate phosphatase activity(GO:0052834) |
0.2 | 0.2 | GO:0004706 | JUN kinase kinase kinase activity(GO:0004706) |
0.2 | 1.1 | GO:1990247 | N6-methyladenosine-containing RNA binding(GO:1990247) |
0.2 | 0.7 | GO:0004942 | anaphylatoxin receptor activity(GO:0004942) |
0.2 | 1.9 | GO:0015386 | sodium:proton antiporter activity(GO:0015385) potassium:proton antiporter activity(GO:0015386) |
0.2 | 6.5 | GO:0030507 | spectrin binding(GO:0030507) |
0.2 | 1.5 | GO:0016308 | 1-phosphatidylinositol-4-phosphate 5-kinase activity(GO:0016308) |
0.2 | 0.2 | GO:0033592 | RNA strand annealing activity(GO:0033592) |
0.2 | 1.5 | GO:0019966 | interleukin-1 binding(GO:0019966) |
0.2 | 5.7 | GO:0070063 | RNA polymerase binding(GO:0070063) |
0.2 | 0.6 | GO:0000253 | 3-keto sterol reductase activity(GO:0000253) |
0.2 | 1.9 | GO:0034450 | ubiquitin-ubiquitin ligase activity(GO:0034450) |
0.2 | 0.6 | GO:0042030 | ATPase inhibitor activity(GO:0042030) |
0.2 | 0.8 | GO:0071074 | eukaryotic initiation factor eIF2 binding(GO:0071074) |
0.2 | 1.8 | GO:0016846 | carbon-sulfur lyase activity(GO:0016846) |
0.2 | 1.8 | GO:0051010 | microtubule plus-end binding(GO:0051010) |
0.2 | 0.6 | GO:0000182 | rDNA binding(GO:0000182) |
0.2 | 0.4 | GO:0019961 | interferon binding(GO:0019961) |
0.2 | 1.9 | GO:0042800 | histone methyltransferase activity (H3-K4 specific)(GO:0042800) |
0.2 | 0.8 | GO:0070579 | methylcytosine dioxygenase activity(GO:0070579) |
0.2 | 1.7 | GO:0005159 | insulin-like growth factor receptor binding(GO:0005159) |
0.2 | 1.5 | GO:0008140 | cAMP response element binding protein binding(GO:0008140) |
0.2 | 1.1 | GO:0031702 | type 1 angiotensin receptor binding(GO:0031702) |
0.2 | 0.6 | GO:0004367 | glycerol-3-phosphate dehydrogenase [NAD+] activity(GO:0004367) |
0.2 | 0.8 | GO:0035173 | histone kinase activity(GO:0035173) |
0.2 | 0.8 | GO:0030292 | protein tyrosine kinase inhibitor activity(GO:0030292) |
0.2 | 0.7 | GO:0030274 | LIM domain binding(GO:0030274) |
0.2 | 1.7 | GO:0070412 | R-SMAD binding(GO:0070412) |
0.2 | 2.6 | GO:0008327 | methyl-CpG binding(GO:0008327) |
0.2 | 0.4 | GO:0019784 | NEDD8-specific protease activity(GO:0019784) |
0.2 | 0.7 | GO:1990239 | steroid hormone binding(GO:1990239) |
0.2 | 1.6 | GO:0034817 | pinocarveol dehydrogenase activity(GO:0018446) chloral hydrate dehydrogenase activity(GO:0018447) hydroxymethylmethylsilanediol oxidase activity(GO:0018448) 1-phenylethanol dehydrogenase activity(GO:0018449) myrtenol dehydrogenase activity(GO:0018450) cis-1,2-dihydroxy-1,2-dihydro-8-carboxynaphthalene dehydrogenase activity(GO:0034522) 3-hydroxy-4-methyloctanoyl-CoA dehydrogenase activity(GO:0034582) 2-hydroxy-4-isopropenylcyclohexane-1-carboxyl-CoA dehydrogenase activity(GO:0034778) cis-9,10-dihydroanthracene-9,10-diol dehydrogenase activity(GO:0034817) citronellol dehydrogenase activity(GO:0034821) naphthyl-2-hydroxymethyl-succinyl-CoA dehydrogenase activity(GO:0034847) 2,4,4-trimethyl-1-pentanol dehydrogenase activity(GO:0034863) 2,4,4-trimethyl-3-hydroxypentanoyl-CoA dehydrogenase activity(GO:0034868) 1-hydroxy-4,4-dimethylpentan-3-one dehydrogenase activity(GO:0034871) endosulfan diol dehydrogenase activity(GO:0034891) endosulfan hydroxyether dehydrogenase activity(GO:0034901) 3-hydroxy-2-methylhexanoyl-CoA dehydrogenase activity(GO:0034918) 3-hydroxy-2,6-dimethyl-5-methylene-heptanoyl-CoA dehydrogenase activity(GO:0034944) versicolorin reductase activity(GO:0042469) ketoreductase activity(GO:0045703) |
0.2 | 0.4 | GO:0071987 | WD40-repeat domain binding(GO:0071987) |
0.2 | 2.0 | GO:0004535 | poly(A)-specific ribonuclease activity(GO:0004535) |
0.2 | 0.4 | GO:0032795 | heterotrimeric G-protein binding(GO:0032795) |
0.2 | 0.7 | GO:0031781 | melanocortin receptor binding(GO:0031779) type 3 melanocortin receptor binding(GO:0031781) type 4 melanocortin receptor binding(GO:0031782) |
0.2 | 0.9 | GO:0035256 | G-protein coupled glutamate receptor binding(GO:0035256) |
0.2 | 0.7 | GO:0004716 | receptor signaling protein tyrosine kinase activity(GO:0004716) |
0.2 | 0.2 | GO:0046978 | TAP1 binding(GO:0046978) TAP2 binding(GO:0046979) |
0.2 | 2.1 | GO:0017056 | structural constituent of nuclear pore(GO:0017056) |
0.2 | 1.2 | GO:0031432 | titin binding(GO:0031432) |
0.2 | 4.9 | GO:0004693 | cyclin-dependent protein serine/threonine kinase activity(GO:0004693) cyclin-dependent protein kinase activity(GO:0097472) |
0.2 | 1.5 | GO:0001055 | RNA polymerase II activity(GO:0001055) |
0.2 | 0.7 | GO:0008823 | cupric reductase activity(GO:0008823) ferric-chelate reductase (NADPH) activity(GO:0052851) |
0.2 | 1.2 | GO:0001104 | RNA polymerase II transcription cofactor activity(GO:0001104) |
0.2 | 1.0 | GO:0030368 | interleukin-17 receptor activity(GO:0030368) |
0.2 | 0.5 | GO:0003941 | L-serine ammonia-lyase activity(GO:0003941) |
0.2 | 0.7 | GO:0030983 | mismatched DNA binding(GO:0030983) |
0.2 | 1.6 | GO:0004774 | succinate-CoA ligase activity(GO:0004774) |
0.2 | 1.6 | GO:0016717 | oxidoreductase activity, acting on paired donors, with oxidation of a pair of donors resulting in the reduction of molecular oxygen to two molecules of water(GO:0016717) |
0.2 | 1.4 | GO:0042500 | aspartic endopeptidase activity, intramembrane cleaving(GO:0042500) |
0.2 | 0.5 | GO:0030621 | U4 snRNA binding(GO:0030621) |
0.2 | 0.6 | GO:0016018 | cyclosporin A binding(GO:0016018) |
0.2 | 1.3 | GO:0004028 | 3-chloroallyl aldehyde dehydrogenase activity(GO:0004028) |
0.2 | 0.9 | GO:0050733 | RS domain binding(GO:0050733) |
0.2 | 0.5 | GO:0003688 | DNA replication origin binding(GO:0003688) |
0.2 | 0.8 | GO:0016755 | transferase activity, transferring amino-acyl groups(GO:0016755) |
0.2 | 3.9 | GO:0004402 | histone acetyltransferase activity(GO:0004402) |
0.2 | 0.9 | GO:0008239 | dipeptidyl-peptidase activity(GO:0008239) |
0.2 | 0.8 | GO:0004689 | phosphorylase kinase activity(GO:0004689) |
0.2 | 0.5 | GO:0035184 | histone threonine kinase activity(GO:0035184) |
0.2 | 4.7 | GO:0004715 | non-membrane spanning protein tyrosine kinase activity(GO:0004715) |
0.2 | 0.8 | GO:0043184 | vascular endothelial growth factor receptor 2 binding(GO:0043184) |
0.2 | 3.8 | GO:0003730 | mRNA 3'-UTR binding(GO:0003730) |
0.2 | 3.0 | GO:0031683 | G-protein beta/gamma-subunit complex binding(GO:0031683) |
0.2 | 9.8 | GO:0004843 | thiol-dependent ubiquitin-specific protease activity(GO:0004843) |
0.1 | 0.9 | GO:0016937 | short-branched-chain-acyl-CoA dehydrogenase activity(GO:0016937) |
0.1 | 6.4 | GO:0003743 | translation initiation factor activity(GO:0003743) |
0.1 | 0.7 | GO:0042285 | UDP-xylosyltransferase activity(GO:0035252) xylosyltransferase activity(GO:0042285) |
0.1 | 0.4 | GO:0004980 | melanocyte-stimulating hormone receptor activity(GO:0004980) |
0.1 | 0.4 | GO:0016971 | flavin-linked sulfhydryl oxidase activity(GO:0016971) |
0.1 | 4.0 | GO:0045182 | translation regulator activity(GO:0045182) |
0.1 | 0.3 | GO:0051434 | BH3 domain binding(GO:0051434) |
0.1 | 3.2 | GO:0005385 | zinc ion transmembrane transporter activity(GO:0005385) |
0.1 | 1.9 | GO:0019206 | nucleoside kinase activity(GO:0019206) |
0.1 | 0.4 | GO:0050220 | prostaglandin-E synthase activity(GO:0050220) |
0.1 | 1.0 | GO:0043138 | 3'-5' DNA helicase activity(GO:0043138) |
0.1 | 2.3 | GO:0070491 | repressing transcription factor binding(GO:0070491) |
0.1 | 1.9 | GO:0045236 | CXCR chemokine receptor binding(GO:0045236) |
0.1 | 0.7 | GO:0043560 | insulin receptor substrate binding(GO:0043560) |
0.1 | 0.9 | GO:0042910 | xenobiotic transporter activity(GO:0042910) |
0.1 | 2.7 | GO:0003684 | damaged DNA binding(GO:0003684) |
0.1 | 0.7 | GO:0003909 | DNA ligase activity(GO:0003909) DNA ligase (ATP) activity(GO:0003910) |
0.1 | 2.3 | GO:0030506 | ankyrin binding(GO:0030506) |
0.1 | 0.6 | GO:0050501 | hyaluronan synthase activity(GO:0050501) |
0.1 | 0.3 | GO:0050321 | tau-protein kinase activity(GO:0050321) |
0.1 | 0.6 | GO:0031750 | D3 dopamine receptor binding(GO:0031750) |
0.1 | 0.4 | GO:0034648 | histone demethylase activity (H3-dimethyl-K4 specific)(GO:0034648) |
0.1 | 2.4 | GO:0001105 | RNA polymerase II transcription coactivator activity(GO:0001105) |
0.1 | 1.5 | GO:0031492 | nucleosomal DNA binding(GO:0031492) |
0.1 | 0.3 | GO:0004844 | uracil DNA N-glycosylase activity(GO:0004844) deaminated base DNA N-glycosylase activity(GO:0097506) |
0.1 | 2.3 | GO:0032452 | histone demethylase activity(GO:0032452) |
0.1 | 0.4 | GO:0004345 | glucose-6-phosphate dehydrogenase activity(GO:0004345) |
0.1 | 0.4 | GO:0004365 | glyceraldehyde-3-phosphate dehydrogenase (NAD+) (phosphorylating) activity(GO:0004365) glyceraldehyde-3-phosphate dehydrogenase (NAD(P)+) (phosphorylating) activity(GO:0043891) |
0.1 | 4.3 | GO:0033613 | activating transcription factor binding(GO:0033613) |
0.1 | 2.3 | GO:0070008 | serine-type exopeptidase activity(GO:0070008) |
0.1 | 1.1 | GO:0004438 | phosphatidylinositol-3-phosphatase activity(GO:0004438) |
0.1 | 0.5 | GO:0010858 | calcium-dependent protein kinase regulator activity(GO:0010858) |
0.1 | 1.3 | GO:0004526 | ribonuclease P activity(GO:0004526) |
0.1 | 0.4 | GO:0035663 | Toll-like receptor 2 binding(GO:0035663) |
0.1 | 0.3 | GO:0034739 | histone deacetylase activity (H4-K16 specific)(GO:0034739) |
0.1 | 0.4 | GO:0019770 | IgG receptor activity(GO:0019770) |
0.1 | 0.4 | GO:0033829 | O-fucosylpeptide 3-beta-N-acetylglucosaminyltransferase activity(GO:0033829) |
0.1 | 0.5 | GO:0017176 | phosphatidylinositol N-acetylglucosaminyltransferase activity(GO:0017176) |
0.1 | 0.1 | GO:0043426 | MRF binding(GO:0043426) |
0.1 | 0.1 | GO:0016662 | oxidoreductase activity, acting on other nitrogenous compounds as donors, cytochrome as acceptor(GO:0016662) |
0.1 | 0.4 | GO:0097109 | neuroligin family protein binding(GO:0097109) |
0.1 | 0.9 | GO:0070492 | oligosaccharide binding(GO:0070492) |
0.1 | 0.5 | GO:0015038 | glutathione disulfide oxidoreductase activity(GO:0015038) |
0.1 | 1.0 | GO:0070182 | DNA polymerase binding(GO:0070182) |
0.1 | 0.8 | GO:0030306 | ADP-ribosylation factor binding(GO:0030306) |
0.1 | 3.4 | GO:0016419 | S-malonyltransferase activity(GO:0016419) malonyltransferase activity(GO:0016420) |
0.1 | 0.5 | GO:0004558 | alpha-1,4-glucosidase activity(GO:0004558) |
0.1 | 0.6 | GO:0031491 | nucleosome binding(GO:0031491) |
0.1 | 0.6 | GO:0030250 | cyclase activator activity(GO:0010853) guanylate cyclase activator activity(GO:0030250) |
0.1 | 3.6 | GO:0061631 | ubiquitin conjugating enzyme activity(GO:0061631) |
0.1 | 0.2 | GO:0000339 | RNA cap binding(GO:0000339) |
0.1 | 0.8 | GO:0097027 | ubiquitin-protein transferase activator activity(GO:0097027) |
0.1 | 0.5 | GO:0015232 | heme transporter activity(GO:0015232) |
0.1 | 0.4 | GO:0030899 | calcium-dependent ATPase activity(GO:0030899) |
0.1 | 0.3 | GO:0030943 | mitochondrion targeting sequence binding(GO:0030943) |
0.1 | 26.1 | GO:0003682 | chromatin binding(GO:0003682) |
0.1 | 0.5 | GO:0016411 | acylglycerol O-acyltransferase activity(GO:0016411) |
0.1 | 1.4 | GO:0043325 | phosphatidylinositol-3,4-bisphosphate binding(GO:0043325) |
0.1 | 0.3 | GO:0046404 | ATP-dependent polydeoxyribonucleotide 5'-hydroxyl-kinase activity(GO:0046404) polydeoxyribonucleotide kinase activity(GO:0051733) |
0.1 | 0.9 | GO:0004534 | 5'-3' exoribonuclease activity(GO:0004534) |
0.1 | 0.6 | GO:0052723 | inositol hexakisphosphate kinase activity(GO:0000828) inositol hexakisphosphate 5-kinase activity(GO:0000832) inositol hexakisphosphate 1-kinase activity(GO:0052723) inositol hexakisphosphate 3-kinase activity(GO:0052724) |
0.1 | 0.6 | GO:0070728 | leucine binding(GO:0070728) |
0.1 | 0.2 | GO:0016778 | diphosphotransferase activity(GO:0016778) |
0.1 | 5.6 | GO:0003697 | single-stranded DNA binding(GO:0003697) |
0.1 | 8.6 | GO:0001078 | transcriptional repressor activity, RNA polymerase II core promoter proximal region sequence-specific binding(GO:0001078) |
0.1 | 0.2 | GO:0004720 | protein-lysine 6-oxidase activity(GO:0004720) |
0.1 | 0.3 | GO:0050510 | N-acetylgalactosaminyl-proteoglycan 3-beta-glucuronosyltransferase activity(GO:0050510) |
0.1 | 0.3 | GO:0005095 | GTPase inhibitor activity(GO:0005095) |
0.1 | 1.1 | GO:0001618 | virus receptor activity(GO:0001618) |
0.1 | 1.3 | GO:0070006 | metalloaminopeptidase activity(GO:0070006) |
0.1 | 0.1 | GO:0008135 | translation factor activity, RNA binding(GO:0008135) |
0.1 | 0.4 | GO:0000104 | succinate dehydrogenase activity(GO:0000104) |
0.1 | 0.1 | GO:0043849 | Ras palmitoyltransferase activity(GO:0043849) |
0.1 | 0.2 | GO:0034040 | lipid-transporting ATPase activity(GO:0034040) |
0.1 | 1.1 | GO:0042974 | retinoic acid receptor binding(GO:0042974) |
0.1 | 4.0 | GO:0035326 | enhancer binding(GO:0035326) |
0.1 | 1.0 | GO:0005523 | tropomyosin binding(GO:0005523) |
0.1 | 1.2 | GO:0070273 | phosphatidylinositol-4-phosphate binding(GO:0070273) |
0.1 | 0.4 | GO:0001094 | RNA polymerase II basal transcription factor binding(GO:0001091) TFIID-class transcription factor binding(GO:0001094) |
0.1 | 0.4 | GO:0004740 | pyruvate dehydrogenase (acetyl-transferring) kinase activity(GO:0004740) |
0.1 | 3.5 | GO:0042826 | histone deacetylase binding(GO:0042826) |
0.1 | 1.4 | GO:0009982 | pseudouridine synthase activity(GO:0009982) |
0.1 | 0.1 | GO:0031698 | beta-2 adrenergic receptor binding(GO:0031698) |
0.1 | 0.4 | GO:0090482 | vitamin transmembrane transporter activity(GO:0090482) |
0.1 | 0.3 | GO:0050681 | androgen receptor binding(GO:0050681) |
0.1 | 0.9 | GO:0097602 | cullin family protein binding(GO:0097602) |
0.1 | 0.3 | GO:0031800 | type 3 metabotropic glutamate receptor binding(GO:0031800) |
0.1 | 0.5 | GO:0030976 | thiamine pyrophosphate binding(GO:0030976) |
0.1 | 0.4 | GO:0016401 | palmitoyl-CoA oxidase activity(GO:0016401) |
0.1 | 1.2 | GO:0008198 | ferrous iron binding(GO:0008198) |
0.1 | 0.6 | GO:0043522 | leucine zipper domain binding(GO:0043522) |
0.1 | 1.0 | GO:0005247 | voltage-gated chloride channel activity(GO:0005247) |
0.1 | 0.4 | GO:0004656 | procollagen-proline 4-dioxygenase activity(GO:0004656) |
0.1 | 2.2 | GO:0005164 | tumor necrosis factor receptor binding(GO:0005164) |
0.1 | 0.4 | GO:0004594 | pantothenate kinase activity(GO:0004594) |
0.1 | 2.8 | GO:0001085 | RNA polymerase II transcription factor binding(GO:0001085) |
0.1 | 4.5 | GO:0042393 | histone binding(GO:0042393) |
0.1 | 0.5 | GO:0034481 | chondroitin sulfotransferase activity(GO:0034481) |
0.1 | 0.3 | GO:0034511 | U3 snoRNA binding(GO:0034511) |
0.1 | 0.5 | GO:0004679 | AMP-activated protein kinase activity(GO:0004679) |
0.1 | 0.6 | GO:0045545 | syndecan binding(GO:0045545) |
0.1 | 4.7 | GO:0051117 | ATPase binding(GO:0051117) |
0.1 | 1.3 | GO:0004089 | carbonate dehydratase activity(GO:0004089) |
0.1 | 0.1 | GO:0055056 | D-glucose transmembrane transporter activity(GO:0055056) |
0.1 | 0.1 | GO:0016751 | S-succinyltransferase activity(GO:0016751) |
0.1 | 0.6 | GO:0032813 | tumor necrosis factor receptor superfamily binding(GO:0032813) |
0.1 | 0.6 | GO:0070097 | delta-catenin binding(GO:0070097) |
0.1 | 0.2 | GO:0005220 | inositol 1,4,5-trisphosphate-sensitive calcium-release channel activity(GO:0005220) |
0.1 | 0.4 | GO:0031545 | peptidyl-proline 4-dioxygenase activity(GO:0031545) |
0.1 | 7.1 | GO:0003713 | transcription coactivator activity(GO:0003713) |
0.1 | 1.0 | GO:0043021 | ribonucleoprotein complex binding(GO:0043021) |
0.1 | 0.1 | GO:0045503 | dynein light chain binding(GO:0045503) |
0.1 | 0.3 | GO:0016649 | electron-transferring-flavoprotein dehydrogenase activity(GO:0004174) oxidoreductase activity, acting on the CH-NH group of donors, quinone or similar compound as acceptor(GO:0016649) |
0.1 | 0.6 | GO:0015266 | protein channel activity(GO:0015266) |
0.1 | 1.7 | GO:0005520 | insulin-like growth factor binding(GO:0005520) |
0.1 | 0.3 | GO:0000983 | transcription factor activity, RNA polymerase II core promoter sequence-specific(GO:0000983) |
0.1 | 0.3 | GO:0004022 | alcohol dehydrogenase (NAD) activity(GO:0004022) |
0.1 | 0.8 | GO:0005521 | lamin binding(GO:0005521) |
0.1 | 0.8 | GO:0051019 | mitogen-activated protein kinase binding(GO:0051019) |
0.1 | 0.3 | GO:0016286 | small conductance calcium-activated potassium channel activity(GO:0016286) |
0.1 | 0.2 | GO:0052658 | inositol-1,4,5-trisphosphate 5-phosphatase activity(GO:0052658) |
0.1 | 1.9 | GO:0045502 | dynein binding(GO:0045502) |
0.1 | 0.8 | GO:0005522 | profilin binding(GO:0005522) |
0.1 | 0.8 | GO:0017160 | Ral GTPase binding(GO:0017160) |
0.1 | 0.3 | GO:0016634 | oxidoreductase activity, acting on the CH-CH group of donors, oxygen as acceptor(GO:0016634) |
0.1 | 0.9 | GO:0001056 | RNA polymerase III activity(GO:0001056) |
0.1 | 1.5 | GO:0042169 | SH2 domain binding(GO:0042169) |
0.1 | 0.5 | GO:0005127 | ciliary neurotrophic factor receptor binding(GO:0005127) |
0.1 | 0.2 | GO:0005078 | MAP-kinase scaffold activity(GO:0005078) |
0.1 | 0.2 | GO:0003865 | 3-oxo-5-alpha-steroid 4-dehydrogenase activity(GO:0003865) cholestenone 5-alpha-reductase activity(GO:0047751) |
0.1 | 0.2 | GO:0016841 | ammonia-lyase activity(GO:0016841) |
0.1 | 0.4 | GO:0005536 | glucose binding(GO:0005536) |
0.1 | 0.6 | GO:0016799 | hydrolase activity, hydrolyzing N-glycosyl compounds(GO:0016799) |
0.1 | 0.4 | GO:0031434 | mitogen-activated protein kinase kinase binding(GO:0031434) |
0.1 | 1.4 | GO:0004707 | MAP kinase activity(GO:0004707) |
0.1 | 0.3 | GO:0000213 | tRNA-intron endonuclease activity(GO:0000213) |
0.1 | 2.0 | GO:0043022 | ribosome binding(GO:0043022) |
0.1 | 2.5 | GO:0051018 | protein kinase A binding(GO:0051018) |
0.1 | 0.5 | GO:0042162 | telomeric DNA binding(GO:0042162) |
0.1 | 0.6 | GO:0005388 | calcium-transporting ATPase activity(GO:0005388) |
0.1 | 0.2 | GO:0017151 | DEAD/H-box RNA helicase binding(GO:0017151) |
0.1 | 0.9 | GO:0008601 | protein phosphatase type 2A regulator activity(GO:0008601) |
0.1 | 0.2 | GO:0042284 | sphingolipid delta-4 desaturase activity(GO:0042284) |
0.1 | 0.6 | GO:0046933 | proton-transporting ATP synthase activity, rotational mechanism(GO:0046933) |
0.1 | 0.9 | GO:0008253 | 5'-nucleotidase activity(GO:0008253) |
0.1 | 0.4 | GO:0004634 | phosphopyruvate hydratase activity(GO:0004634) |
0.1 | 0.2 | GO:0016361 | activin receptor activity, type I(GO:0016361) |
0.1 | 0.9 | GO:0022841 | potassium ion leak channel activity(GO:0022841) |
0.1 | 0.9 | GO:0008408 | 3'-5' exonuclease activity(GO:0008408) |
0.1 | 0.3 | GO:0001076 | transcription factor activity, RNA polymerase II transcription factor binding(GO:0001076) |
0.1 | 0.9 | GO:0017025 | TBP-class protein binding(GO:0017025) |
0.1 | 1.4 | GO:0030215 | semaphorin receptor binding(GO:0030215) |
0.1 | 0.2 | GO:0097371 | MDM2/MDM4 family protein binding(GO:0097371) |
0.1 | 0.3 | GO:0008349 | MAP kinase kinase kinase kinase activity(GO:0008349) |
0.1 | 0.5 | GO:0070567 | cytidylyltransferase activity(GO:0070567) |
0.1 | 0.3 | GO:0004052 | arachidonate 12-lipoxygenase activity(GO:0004052) |
0.1 | 0.3 | GO:0004012 | phospholipid-translocating ATPase activity(GO:0004012) |
0.1 | 0.1 | GO:0002094 | polyprenyltransferase activity(GO:0002094) |
0.1 | 0.6 | GO:0008242 | omega peptidase activity(GO:0008242) |
0.1 | 0.2 | GO:0002060 | purine nucleobase binding(GO:0002060) |
0.1 | 0.2 | GO:0008321 | Ral guanyl-nucleotide exchange factor activity(GO:0008321) |
0.1 | 0.2 | GO:0004800 | thyroxine 5'-deiodinase activity(GO:0004800) |
0.1 | 0.1 | GO:0004549 | tRNA-specific ribonuclease activity(GO:0004549) |
0.1 | 0.3 | GO:0035198 | miRNA binding(GO:0035198) |
0.1 | 0.1 | GO:0001227 | transcriptional repressor activity, RNA polymerase II transcription regulatory region sequence-specific binding(GO:0001227) |
0.1 | 0.3 | GO:0005134 | interleukin-2 receptor binding(GO:0005134) |
0.1 | 0.1 | GO:0004075 | biotin carboxylase activity(GO:0004075) |
0.1 | 1.2 | GO:0005031 | tumor necrosis factor-activated receptor activity(GO:0005031) death receptor activity(GO:0005035) |
0.1 | 0.1 | GO:0004779 | sulfate adenylyltransferase activity(GO:0004779) |
0.1 | 8.3 | GO:0008134 | transcription factor binding(GO:0008134) |
0.1 | 0.2 | GO:0005432 | calcium:sodium antiporter activity(GO:0005432) |
0.1 | 0.2 | GO:0035035 | histone acetyltransferase binding(GO:0035035) |
0.1 | 0.2 | GO:0008905 | mannose-phosphate guanylyltransferase activity(GO:0008905) |
0.1 | 0.2 | GO:0030881 | beta-2-microglobulin binding(GO:0030881) |
0.1 | 0.5 | GO:0016783 | sulfurtransferase activity(GO:0016783) |
0.1 | 0.5 | GO:0003707 | steroid hormone receptor activity(GO:0003707) |
0.1 | 0.4 | GO:0015280 | ligand-gated sodium channel activity(GO:0015280) |
0.1 | 0.2 | GO:0060230 | lipoprotein lipase activator activity(GO:0060230) |
0.1 | 0.2 | GO:0004967 | glucagon receptor activity(GO:0004967) |
0.1 | 0.3 | GO:0005337 | nucleoside transmembrane transporter activity(GO:0005337) |
0.1 | 0.4 | GO:0008113 | peptide-methionine (S)-S-oxide reductase activity(GO:0008113) |
0.1 | 1.8 | GO:0003714 | transcription corepressor activity(GO:0003714) |
0.1 | 0.2 | GO:0001609 | G-protein coupled adenosine receptor activity(GO:0001609) |
0.1 | 0.2 | GO:0005094 | Rho GDP-dissociation inhibitor activity(GO:0005094) |
0.1 | 5.7 | GO:0061659 | ubiquitin protein ligase activity(GO:0061630) ubiquitin-like protein ligase activity(GO:0061659) |
0.1 | 6.8 | GO:0003924 | GTPase activity(GO:0003924) |
0.1 | 5.1 | GO:0000978 | RNA polymerase II core promoter proximal region sequence-specific DNA binding(GO:0000978) |
0.1 | 0.4 | GO:0047372 | acylglycerol lipase activity(GO:0047372) |
0.1 | 0.1 | GO:0042296 | ISG15 transferase activity(GO:0042296) |
0.1 | 0.2 | GO:0051371 | muscle alpha-actinin binding(GO:0051371) |
0.1 | 0.1 | GO:0070538 | oleic acid binding(GO:0070538) |
0.1 | 0.6 | GO:0030544 | Hsp70 protein binding(GO:0030544) |
0.1 | 0.1 | GO:1904288 | BAT3 complex binding(GO:1904288) |
0.0 | 0.3 | GO:0004972 | NMDA glutamate receptor activity(GO:0004972) |
0.0 | 0.0 | GO:0035671 | enone reductase activity(GO:0035671) |
0.0 | 0.1 | GO:0004704 | NF-kappaB-inducing kinase activity(GO:0004704) |
0.0 | 0.0 | GO:0031893 | vasopressin receptor binding(GO:0031893) |
0.0 | 0.3 | GO:0071933 | Arp2/3 complex binding(GO:0071933) |
0.0 | 0.1 | GO:0019834 | phospholipase A2 inhibitor activity(GO:0019834) |
0.0 | 1.8 | GO:0004812 | aminoacyl-tRNA ligase activity(GO:0004812) |
0.0 | 0.2 | GO:0004735 | pyrroline-5-carboxylate reductase activity(GO:0004735) |
0.0 | 1.2 | GO:0043826 | N-ethylmaleimide reductase activity(GO:0008748) reduced coenzyme F420 dehydrogenase activity(GO:0043738) sulfur oxygenase reductase activity(GO:0043826) malolactic enzyme activity(GO:0043883) epoxyqueuosine reductase activity(GO:0052693) |
0.0 | 0.5 | GO:0042608 | T cell receptor binding(GO:0042608) |
0.0 | 0.8 | GO:0004198 | calcium-dependent cysteine-type endopeptidase activity(GO:0004198) |
0.0 | 0.8 | GO:0016628 | oxidoreductase activity, acting on the CH-CH group of donors, NAD or NADP as acceptor(GO:0016628) |
0.0 | 0.1 | GO:0008073 | ornithine decarboxylase inhibitor activity(GO:0008073) |
0.0 | 0.1 | GO:0004772 | sterol O-acyltransferase activity(GO:0004772) |
0.0 | 0.3 | GO:0004311 | farnesyltranstransferase activity(GO:0004311) |
0.0 | 0.4 | GO:0015254 | glycerol transmembrane transporter activity(GO:0015168) glycerol channel activity(GO:0015254) |
0.0 | 2.4 | GO:0008565 | protein transporter activity(GO:0008565) |
0.0 | 0.9 | GO:0008422 | beta-glucosidase activity(GO:0008422) |
0.0 | 0.4 | GO:0019841 | retinol binding(GO:0019841) |
0.0 | 0.1 | GO:1900750 | glutathione binding(GO:0043295) oligopeptide binding(GO:1900750) |
0.0 | 1.2 | GO:0005544 | calcium-dependent phospholipid binding(GO:0005544) |
0.0 | 0.0 | GO:0015563 | uptake transmembrane transporter activity(GO:0015563) |
0.0 | 1.9 | GO:0008186 | ATP-dependent RNA helicase activity(GO:0004004) RNA-dependent ATPase activity(GO:0008186) |
0.0 | 0.1 | GO:0016520 | growth hormone-releasing hormone receptor activity(GO:0016520) |
0.0 | 0.6 | GO:0015238 | drug transmembrane transporter activity(GO:0015238) |
0.0 | 0.0 | GO:0003720 | telomerase activity(GO:0003720) RNA-directed DNA polymerase activity(GO:0003964) |
0.0 | 0.4 | GO:0016813 | hydrolase activity, acting on carbon-nitrogen (but not peptide) bonds, in linear amidines(GO:0016813) |
0.0 | 0.7 | GO:0030295 | protein kinase activator activity(GO:0030295) |
0.0 | 0.4 | GO:0050431 | transforming growth factor beta binding(GO:0050431) |
0.0 | 0.2 | GO:0000064 | L-ornithine transmembrane transporter activity(GO:0000064) |
0.0 | 0.9 | GO:0005504 | fatty acid binding(GO:0005504) |
0.0 | 4.8 | GO:0008168 | methyltransferase activity(GO:0008168) |
0.0 | 0.6 | GO:0016641 | oxidoreductase activity, acting on the CH-NH2 group of donors, oxygen as acceptor(GO:0016641) |
0.0 | 0.1 | GO:0030350 | iron-responsive element binding(GO:0030350) |
0.0 | 0.2 | GO:0052890 | oxidoreductase activity, acting on the CH-CH group of donors, with a flavin as acceptor(GO:0052890) |
0.0 | 0.4 | GO:0036459 | thiol-dependent ubiquitinyl hydrolase activity(GO:0036459) ubiquitinyl hydrolase activity(GO:0101005) |
0.0 | 0.3 | GO:0023026 | MHC class II protein complex binding(GO:0023026) |
0.0 | 0.2 | GO:0016936 | galactoside binding(GO:0016936) |
0.0 | 1.6 | GO:0003823 | antigen binding(GO:0003823) |
0.0 | 0.3 | GO:0050664 | oxidoreductase activity, acting on NAD(P)H, oxygen as acceptor(GO:0050664) |
0.0 | 30.4 | GO:0003677 | DNA binding(GO:0003677) |
0.0 | 0.0 | GO:0030628 | pre-mRNA 3'-splice site binding(GO:0030628) |
0.0 | 0.2 | GO:0035005 | 1-phosphatidylinositol-4-phosphate 3-kinase activity(GO:0035005) |
0.0 | 0.2 | GO:0036002 | pre-mRNA binding(GO:0036002) |
0.0 | 0.1 | GO:0030942 | endoplasmic reticulum signal peptide binding(GO:0030942) |
0.0 | 0.2 | GO:0003993 | acid phosphatase activity(GO:0003993) |
0.0 | 0.1 | GO:0015174 | basic amino acid transmembrane transporter activity(GO:0015174) |
0.0 | 0.5 | GO:0000049 | tRNA binding(GO:0000049) |
0.0 | 0.2 | GO:0043422 | protein kinase B binding(GO:0043422) |
0.0 | 0.1 | GO:0015926 | glucosidase activity(GO:0015926) |
0.0 | 0.1 | GO:0016886 | ligase activity, forming phosphoric ester bonds(GO:0016886) |
0.0 | 0.1 | GO:0008260 | 3-oxoacid CoA-transferase activity(GO:0008260) |
0.0 | 0.0 | GO:0071208 | histone pre-mRNA DCP binding(GO:0071208) |
0.0 | 0.2 | GO:0070891 | lipoteichoic acid binding(GO:0070891) |
0.0 | 0.1 | GO:0034547 | N-cyclopropylmelamine deaminase activity(GO:0034547) N-cyclopropylammeline deaminase activity(GO:0034548) N-cyclopropylammelide alkylamino hydrolase activity(GO:0034549) 2,5-diamino-6-ribitylamino-4(3H)-pyrimidinone 5'-phosphate deaminase activity(GO:0043723) tRNA-specific adenosine-37 deaminase activity(GO:0043829) archaeal-specific GTP cyclohydrolase activity(GO:0044682) tRNA-specific adenosine-34 deaminase activity(GO:0052717) |
0.0 | 0.2 | GO:0008430 | selenium binding(GO:0008430) |
0.0 | 0.6 | GO:0016776 | phosphotransferase activity, phosphate group as acceptor(GO:0016776) |
0.0 | 0.4 | GO:0000062 | fatty-acyl-CoA binding(GO:0000062) |
0.0 | 0.0 | GO:0031078 | histone deacetylase activity (H3-K14 specific)(GO:0031078) NAD-dependent histone deacetylase activity (H3-K14 specific)(GO:0032041) |
0.0 | 0.1 | GO:0004687 | myosin light chain kinase activity(GO:0004687) |
0.0 | 0.0 | GO:0070087 | chromo shadow domain binding(GO:0070087) |
0.0 | 1.1 | GO:0004536 | deoxyribonuclease activity(GO:0004536) |
0.0 | 0.2 | GO:0048038 | quinone binding(GO:0048038) |
0.0 | 0.1 | GO:0005113 | patched binding(GO:0005113) |
0.0 | 0.0 | GO:0047238 | glucuronosyl-N-acetylgalactosaminyl-proteoglycan 4-beta-N-acetylgalactosaminyltransferase activity(GO:0047238) |
0.0 | 0.1 | GO:0017089 | glycolipid transporter activity(GO:0017089) |
0.0 | 0.2 | GO:0042301 | phosphate ion binding(GO:0042301) |
0.0 | 0.1 | GO:0005534 | galactose binding(GO:0005534) |
0.0 | 0.2 | GO:0004563 | beta-N-acetylhexosaminidase activity(GO:0004563) |
0.0 | 0.1 | GO:0019209 | kinase activator activity(GO:0019209) |
0.0 | 0.4 | GO:0001848 | complement binding(GO:0001848) |
0.0 | 0.2 | GO:0070402 | NADPH binding(GO:0070402) |
0.0 | 0.1 | GO:0004616 | phosphogluconate dehydrogenase (decarboxylating) activity(GO:0004616) |
0.0 | 0.1 | GO:0038100 | nodal binding(GO:0038100) |
0.0 | 0.8 | GO:0031072 | heat shock protein binding(GO:0031072) |
0.0 | 0.1 | GO:0017040 | ceramidase activity(GO:0017040) |
0.0 | 0.0 | GO:0004694 | eukaryotic translation initiation factor 2alpha kinase activity(GO:0004694) |
0.0 | 0.9 | GO:0019843 | rRNA binding(GO:0019843) |
0.0 | 0.1 | GO:1990254 | keratin filament binding(GO:1990254) |
0.0 | 0.4 | GO:0030247 | pattern binding(GO:0001871) polysaccharide binding(GO:0030247) |
0.0 | 2.5 | GO:0003735 | structural constituent of ribosome(GO:0003735) |
0.0 | 0.2 | GO:0042043 | neurexin family protein binding(GO:0042043) |
0.0 | 0.3 | GO:0051539 | 4 iron, 4 sulfur cluster binding(GO:0051539) |
0.0 | 0.7 | GO:0043621 | protein self-association(GO:0043621) |
0.0 | 0.0 | GO:0043914 | NADPH:sulfur oxidoreductase activity(GO:0043914) |
0.0 | 0.1 | GO:0036312 | phosphatidylinositol 3-kinase regulatory subunit binding(GO:0036312) |
0.0 | 0.1 | GO:0003987 | acetate-CoA ligase activity(GO:0003987) |
0.0 | 0.3 | GO:0000988 | transcription factor activity, protein binding(GO:0000988) |
0.0 | 0.2 | GO:0015279 | store-operated calcium channel activity(GO:0015279) |
0.0 | 0.1 | GO:0016882 | cyclo-ligase activity(GO:0016882) |
0.0 | 0.0 | GO:0034416 | bisphosphoglycerate phosphatase activity(GO:0034416) |
0.0 | 13.4 | GO:0044822 | poly(A) RNA binding(GO:0044822) |
0.0 | 0.3 | GO:0003785 | actin monomer binding(GO:0003785) |
0.0 | 0.2 | GO:0005344 | oxygen transporter activity(GO:0005344) |
0.0 | 0.0 | GO:0005176 | ErbB-2 class receptor binding(GO:0005176) |
0.0 | 4.6 | GO:0005096 | GTPase activator activity(GO:0005096) |
0.0 | 0.0 | GO:0097642 | calcitonin family receptor activity(GO:0097642) |
0.0 | 0.0 | GO:0004104 | cholinesterase activity(GO:0004104) |
0.0 | 0.3 | GO:0005112 | Notch binding(GO:0005112) |
0.0 | 0.0 | GO:0043559 | insulin binding(GO:0043559) |
0.0 | 0.1 | GO:0016868 | intramolecular transferase activity, phosphotransferases(GO:0016868) |
0.0 | 0.0 | GO:0008035 | high-density lipoprotein particle binding(GO:0008035) |
0.0 | 0.6 | GO:0004364 | glutathione transferase activity(GO:0004364) |
0.0 | 0.1 | GO:0016832 | aldehyde-lyase activity(GO:0016832) |
0.0 | 0.1 | GO:0016801 | hydrolase activity, acting on ether bonds(GO:0016801) |
0.0 | 0.1 | GO:0070300 | phosphatidic acid binding(GO:0070300) |
0.0 | 0.3 | GO:0016863 | intramolecular oxidoreductase activity, transposing C=C bonds(GO:0016863) |
0.0 | 0.1 | GO:0031849 | olfactory receptor binding(GO:0031849) |
0.0 | 0.2 | GO:0016679 | oxidoreductase activity, acting on diphenols and related substances as donors(GO:0016679) |
0.0 | 0.4 | GO:0043130 | ubiquitin binding(GO:0043130) |
0.0 | 0.0 | GO:0004045 | aminoacyl-tRNA hydrolase activity(GO:0004045) |
0.0 | 0.8 | GO:0016811 | hydrolase activity, acting on carbon-nitrogen (but not peptide) bonds, in linear amides(GO:0016811) |
0.0 | 0.6 | GO:0016831 | carboxy-lyase activity(GO:0016831) |
0.0 | 0.0 | GO:0018556 | 2,3-dihydroxy DDT 1,2-dioxygenase activity(GO:0018542) phenanthrene dioxygenase activity(GO:0018555) 2,2',3-trihydroxybiphenyl dioxygenase activity(GO:0018556) 1,2-dihydroxyfluorene 1,1-alpha-dioxygenase activity(GO:0018557) 5,6-dihydroxy-3-methyl-2-oxo-1,2-dihydroquinoline dioxygenase activity(GO:0018558) 1,1-dichloro-2-(dihydroxy-4-chlorophenyl)-(4-chlorophenyl)ethene 1,2-dioxygenase activity(GO:0018559) protocatechuate 3,4-dioxygenase type II activity(GO:0018560) 2'-aminobiphenyl-2,3-diol 1,2-dioxygenase activity(GO:0018561) 3,4-dihydroxyfluorene 4,4-alpha-dioxygenase activity(GO:0018562) 2,3-dihydroxy-ethylbenzene 1,2-dioxygenase activity(GO:0018563) carbazole 1,9a-dioxygenase activity(GO:0018564) dihydroxydibenzothiophene dioxygenase activity(GO:0018565) 1,2-dihydroxynaphthalene-6-sulfonate 1,8a-dioxygenase activity(GO:0018566) styrene dioxygenase activity(GO:0018567) 3,4-dihydroxyphenanthrene dioxygenase activity(GO:0018568) hydroquinone 1,2-dioxygenase activity(GO:0018569) p-cumate 2,3-dioxygenase activity(GO:0018570) 2,3-dihydroxy-p-cumate dioxygenase activity(GO:0018571) 3,5-dichlorocatechol 1,2-dioxygenase activity(GO:0018572) 2-aminophenol 1,6-dioxygenase activity(GO:0018573) 2,6-dichloro-p-hydroquinone 1,2-dioxygenase activity(GO:0018574) chlorocatechol 1,2-dioxygenase activity(GO:0018575) catechol dioxygenase activity(GO:0019114) dihydroxyfluorene dioxygenase activity(GO:0019117) 5-aminosalicylate dioxygenase activity(GO:0034543) 3-hydroxy-2-naphthoate 2,3-dioxygenase activity(GO:0034803) benzo(a)pyrene 11,12-dioxygenase activity(GO:0034806) benzo(a)pyrene 4,5-dioxygenase activity(GO:0034808) 4,5-dihydroxybenzo(a)pyrene dioxygenase activity(GO:0034810) benzo(a)pyrene 9,10-dioxygenase activity(GO:0034811) 9,10-dihydroxybenzo(a)pyrene dioxygenase activity(GO:0034812) benzo(a)pyrene 7,8-dioxygenase activity(GO:0034813) 7,8-dihydroxy benzo(a)pyrene dioxygenase activity(GO:0034814) 1,2-dihydroxy-5,6,7,8-tetrahydronaphthalene extradiol dioxygenase activity(GO:0034827) 2-mercaptobenzothiazole dioxygenase activity(GO:0034834) pyridine-3,4-diol dioxygenase activity(GO:0034895) pyrene dioxygenase activity(GO:0034920) 4,5-dihydroxypyrene dioxygenase activity(GO:0034922) phenanthrene-4-carboxylate dioxygenase activity(GO:0034934) tetrachlorobenzene dioxygenase activity(GO:0034935) 4,6-dichloro-3-methylcatechol 1,2-dioxygenase activity(GO:0034936) 2,3-dihydroxydiphenyl ether dioxygenase activity(GO:0034955) diphenyl ether 1,2-dioxygenase activity(GO:0034956) arachidonate 8(S)-lipoxygenase activity(GO:0036403) 4-hydroxycatechol 1,2-dioxygenase activity(GO:0047074) |
0.0 | 2.1 | GO:0000287 | magnesium ion binding(GO:0000287) |
0.0 | 0.1 | GO:0070513 | death domain binding(GO:0070513) |
0.0 | 0.1 | GO:0004974 | leukotriene receptor activity(GO:0004974) |
0.0 | 0.6 | GO:0051723 | protein methylesterase activity(GO:0051723) |
0.0 | 0.1 | GO:0004169 | dolichyl-phosphate-mannose-protein mannosyltransferase activity(GO:0004169) |
0.0 | 0.1 | GO:0019864 | IgG binding(GO:0019864) |
0.0 | 0.2 | GO:0004190 | aspartic-type endopeptidase activity(GO:0004190) aspartic-type peptidase activity(GO:0070001) |
0.0 | 0.4 | GO:0005212 | structural constituent of eye lens(GO:0005212) |
0.0 | 0.0 | GO:0016748 | succinyltransferase activity(GO:0016748) |
0.0 | 0.0 | GO:0030249 | guanylate cyclase regulator activity(GO:0030249) |
0.0 | 0.1 | GO:0003854 | 3-beta-hydroxy-delta5-steroid dehydrogenase activity(GO:0003854) |
0.0 | 0.1 | GO:0019869 | chloride channel inhibitor activity(GO:0019869) |
0.0 | 0.0 | GO:0061733 | peptide-lysine-N-acetyltransferase activity(GO:0061733) |
0.0 | 0.0 | GO:0015087 | cobalt ion transmembrane transporter activity(GO:0015087) |
0.0 | 0.1 | GO:0070051 | fibrinogen binding(GO:0070051) |
0.0 | 0.1 | GO:0005250 | A-type (transient outward) potassium channel activity(GO:0005250) |
0.0 | 0.1 | GO:0050700 | CARD domain binding(GO:0050700) |
0.0 | 0.0 | GO:0072542 | protein phosphatase activator activity(GO:0072542) |
0.0 | 0.1 | GO:0008440 | inositol-1,4,5-trisphosphate 3-kinase activity(GO:0008440) |
0.0 | 0.0 | GO:0005024 | transforming growth factor beta-activated receptor activity(GO:0005024) |
0.0 | 0.3 | GO:0016655 | oxidoreductase activity, acting on NAD(P)H, quinone or similar compound as acceptor(GO:0016655) |
0.0 | 0.0 | GO:0015252 | hydrogen ion channel activity(GO:0015252) |
0.0 | 0.0 | GO:0019976 | interleukin-2 binding(GO:0019976) |
0.0 | 0.2 | GO:0019239 | deaminase activity(GO:0019239) |
0.0 | 0.0 | GO:0046848 | hydroxyapatite binding(GO:0046848) |
0.0 | 0.1 | GO:0004176 | ATP-dependent peptidase activity(GO:0004176) |
0.0 | 0.0 | GO:0005329 | dopamine transmembrane transporter activity(GO:0005329) |
0.0 | 0.0 | GO:0004711 | ribosomal protein S6 kinase activity(GO:0004711) |
0.0 | 0.4 | GO:0051087 | chaperone binding(GO:0051087) |
0.0 | 0.0 | GO:0043199 | sulfate binding(GO:0043199) |
0.0 | 0.0 | GO:0004445 | inositol-polyphosphate 5-phosphatase activity(GO:0004445) |
0.0 | 0.0 | GO:0005021 | vascular endothelial growth factor-activated receptor activity(GO:0005021) |
0.0 | 0.1 | GO:0016780 | phosphotransferase activity, for other substituted phosphate groups(GO:0016780) |
0.0 | 0.0 | GO:0001228 | transcriptional activator activity, RNA polymerase II transcription regulatory region sequence-specific binding(GO:0001228) |
0.0 | 0.0 | GO:0043495 | protein anchor(GO:0043495) |
0.0 | 0.0 | GO:0015057 | thrombin receptor activity(GO:0015057) |
0.0 | 0.0 | GO:0050253 | retinyl-palmitate esterase activity(GO:0050253) |
0.0 | 0.1 | GO:0016857 | racemase and epimerase activity, acting on carbohydrates and derivatives(GO:0016857) |
0.0 | 0.1 | GO:0032182 | ubiquitin-like protein binding(GO:0032182) |
0.0 | 0.0 | GO:0016418 | S-acetyltransferase activity(GO:0016418) |
0.0 | 0.1 | GO:0004383 | guanylate cyclase activity(GO:0004383) |
0.0 | 0.1 | GO:0004966 | galanin receptor activity(GO:0004966) |
0.0 | 0.2 | GO:0004745 | retinol dehydrogenase activity(GO:0004745) |
0.0 | 0.1 | GO:0005149 | interleukin-1 receptor binding(GO:0005149) |
0.0 | 0.0 | GO:0005143 | interleukin-12 receptor binding(GO:0005143) |
0.0 | 0.0 | GO:0003829 | beta-1,3-galactosyl-O-glycosyl-glycoprotein beta-1,6-N-acetylglucosaminyltransferase activity(GO:0003829) |
0.0 | 0.0 | GO:0030280 | structural constituent of epidermis(GO:0030280) |
0.0 | 0.2 | GO:0015095 | magnesium ion transmembrane transporter activity(GO:0015095) |
0.0 | 0.0 | GO:0050308 | carbohydrate phosphatase activity(GO:0019203) sugar-phosphatase activity(GO:0050308) |
0.0 | 0.0 | GO:0043262 | adenosine-diphosphatase activity(GO:0043262) |
0.0 | 0.0 | GO:0005275 | amine transmembrane transporter activity(GO:0005275) |
0.0 | 0.1 | GO:0005499 | vitamin D binding(GO:0005499) |
0.0 | 0.1 | GO:0035255 | ionotropic glutamate receptor binding(GO:0035255) |
0.0 | 0.0 | GO:0015923 | mannosidase activity(GO:0015923) |
0.0 | 0.0 | GO:0051373 | FATZ binding(GO:0051373) |
0.0 | 0.1 | GO:0005161 | platelet-derived growth factor receptor binding(GO:0005161) |
0.0 | 0.2 | GO:0004869 | cysteine-type endopeptidase inhibitor activity(GO:0004869) |
0.0 | 0.0 | GO:0070883 | pre-miRNA binding(GO:0070883) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.8 | 9.3 | PID RANBP2 PATHWAY | Sumoylation by RanBP2 regulates transcriptional repression |
0.8 | 12.7 | PID SMAD2 3PATHWAY | Regulation of cytoplasmic and nuclear SMAD2/3 signaling |
0.6 | 14.1 | PID IL3 PATHWAY | IL3-mediated signaling events |
0.5 | 4.8 | PID P38 GAMMA DELTA PATHWAY | Signaling mediated by p38-gamma and p38-delta |
0.4 | 6.3 | PID ERB GENOMIC PATHWAY | Validated nuclear estrogen receptor beta network |
0.4 | 7.2 | SA CASPASE CASCADE | Apoptosis is mediated by caspases, cysteine proteases arranged in a proteolytic cascade. |
0.4 | 9.8 | PID TCR CALCIUM PATHWAY | Calcium signaling in the CD4+ TCR pathway |
0.4 | 2.1 | ST STAT3 PATHWAY | STAT3 Pathway |
0.3 | 8.0 | PID IGF1 PATHWAY | IGF1 pathway |
0.3 | 5.2 | PID CIRCADIAN PATHWAY | Circadian rhythm pathway |
0.3 | 15.4 | PID AR PATHWAY | Coregulation of Androgen receptor activity |
0.3 | 6.3 | ST GA12 PATHWAY | G alpha 12 Pathway |
0.3 | 3.9 | PID THROMBIN PAR4 PATHWAY | PAR4-mediated thrombin signaling events |
0.3 | 8.0 | PID LIS1 PATHWAY | Lissencephaly gene (LIS1) in neuronal migration and development |
0.3 | 3.5 | SA G1 AND S PHASES | Cdk2, 4, and 6 bind cyclin D in G1, while cdk2/cyclin E promotes the G1/S transition. |
0.3 | 3.4 | PID NFKAPPAB ATYPICAL PATHWAY | Atypical NF-kappaB pathway |
0.3 | 5.0 | ST B CELL ANTIGEN RECEPTOR | B Cell Antigen Receptor |
0.3 | 1.7 | SA G2 AND M PHASES | Cdc25 activates the cdc2/cyclin B complex to induce the G2/M transition. |
0.3 | 3.7 | PID PRL SIGNALING EVENTS PATHWAY | Signaling events mediated by PRL |
0.3 | 6.4 | ST TUMOR NECROSIS FACTOR PATHWAY | Tumor Necrosis Factor Pathway. |
0.3 | 6.1 | PID RHOA PATHWAY | RhoA signaling pathway |
0.3 | 4.5 | SIG PIP3 SIGNALING IN B LYMPHOCYTES | Genes related to PIP3 signaling in B lymphocytes |
0.3 | 11.1 | PID ERA GENOMIC PATHWAY | Validated nuclear estrogen receptor alpha network |
0.2 | 8.1 | PID LKB1 PATHWAY | LKB1 signaling events |
0.2 | 11.3 | PID NOTCH PATHWAY | Notch signaling pathway |
0.2 | 11.1 | PID TELOMERASE PATHWAY | Regulation of Telomerase |
0.2 | 4.3 | PID ERBB2 ERBB3 PATHWAY | ErbB2/ErbB3 signaling events |
0.2 | 7.9 | PID P53 REGULATION PATHWAY | p53 pathway |
0.2 | 8.5 | PID HNF3B PATHWAY | FOXA2 and FOXA3 transcription factor networks |
0.2 | 1.8 | PID CD40 PATHWAY | CD40/CD40L signaling |
0.2 | 2.9 | PID P38 MKK3 6PATHWAY | p38 MAPK signaling pathway |
0.2 | 2.3 | PID MYC PATHWAY | C-MYC pathway |
0.2 | 1.8 | PID VEGF VEGFR PATHWAY | VEGF and VEGFR signaling network |
0.2 | 0.6 | PID AVB3 INTEGRIN PATHWAY | Integrins in angiogenesis |
0.2 | 5.3 | PID RB 1PATHWAY | Regulation of retinoblastoma protein |
0.2 | 8.1 | PID E2F PATHWAY | E2F transcription factor network |
0.2 | 1.0 | PID IL2 PI3K PATHWAY | IL2 signaling events mediated by PI3K |
0.2 | 5.4 | PID HDAC CLASSI PATHWAY | Signaling events mediated by HDAC Class I |
0.2 | 0.5 | SIG INSULIN RECEPTOR PATHWAY IN CARDIAC MYOCYTES | Genes related to the insulin receptor pathway |
0.2 | 7.1 | PID P73PATHWAY | p73 transcription factor network |
0.2 | 0.7 | SIG CD40PATHWAYMAP | Genes related to CD40 signaling |
0.2 | 0.5 | PID TRAIL PATHWAY | TRAIL signaling pathway |
0.2 | 2.9 | PID WNT NONCANONICAL PATHWAY | Noncanonical Wnt signaling pathway |
0.2 | 2.2 | PID MAPK TRK PATHWAY | Trk receptor signaling mediated by the MAPK pathway |
0.2 | 0.7 | PID THROMBIN PAR1 PATHWAY | PAR1-mediated thrombin signaling events |
0.2 | 2.1 | PID NECTIN PATHWAY | Nectin adhesion pathway |
0.2 | 4.5 | PID FANCONI PATHWAY | Fanconi anemia pathway |
0.2 | 0.3 | SA FAS SIGNALING | The TNF-type receptor Fas induces apoptosis on ligand binding. |
0.2 | 0.9 | ST TYPE I INTERFERON PATHWAY | Type I Interferon (alpha/beta IFN) Pathway |
0.2 | 0.9 | PID P38 MK2 PATHWAY | p38 signaling mediated by MAPKAP kinases |
0.1 | 2.4 | PID FOXM1 PATHWAY | FOXM1 transcription factor network |
0.1 | 1.5 | PID IL2 1PATHWAY | IL2-mediated signaling events |
0.1 | 3.2 | PID VEGFR1 2 PATHWAY | Signaling events mediated by VEGFR1 and VEGFR2 |
0.1 | 2.5 | PID P38 ALPHA BETA DOWNSTREAM PATHWAY | Signaling mediated by p38-alpha and p38-beta |
0.1 | 0.7 | PID LYMPH ANGIOGENESIS PATHWAY | VEGFR3 signaling in lymphatic endothelium |
0.1 | 3.0 | ST FAS SIGNALING PATHWAY | Fas Signaling Pathway |
0.1 | 0.2 | PID EPHA2 FWD PATHWAY | EPHA2 forward signaling |
0.1 | 0.4 | ST INTERFERON GAMMA PATHWAY | Interferon gamma pathway. |
0.1 | 1.3 | PID CERAMIDE PATHWAY | Ceramide signaling pathway |
0.1 | 1.5 | PID RXR VDR PATHWAY | RXR and RAR heterodimerization with other nuclear receptor |
0.1 | 1.7 | PID AR TF PATHWAY | Regulation of Androgen receptor activity |
0.1 | 1.6 | PID TNF PATHWAY | TNF receptor signaling pathway |
0.1 | 2.1 | PID FRA PATHWAY | Validated transcriptional targets of AP1 family members Fra1 and Fra2 |
0.1 | 2.4 | PID MTOR 4PATHWAY | mTOR signaling pathway |
0.1 | 0.9 | PID MET PATHWAY | Signaling events mediated by Hepatocyte Growth Factor Receptor (c-Met) |
0.1 | 1.8 | PID NFAT TFPATHWAY | Calcineurin-regulated NFAT-dependent transcription in lymphocytes |
0.1 | 1.1 | PID RAC1 PATHWAY | RAC1 signaling pathway |
0.1 | 1.6 | PID ARF 3PATHWAY | Arf1 pathway |
0.1 | 2.9 | PID PLK1 PATHWAY | PLK1 signaling events |
0.1 | 2.5 | PID CDC42 PATHWAY | CDC42 signaling events |
0.1 | 2.3 | PID REG GR PATHWAY | Glucocorticoid receptor regulatory network |
0.1 | 1.5 | PID FAK PATHWAY | Signaling events mediated by focal adhesion kinase |
0.1 | 2.4 | PID HIF1 TFPATHWAY | HIF-1-alpha transcription factor network |
0.1 | 1.7 | PID KIT PATHWAY | Signaling events mediated by Stem cell factor receptor (c-Kit) |
0.1 | 0.2 | ST P38 MAPK PATHWAY | p38 MAPK Pathway |
0.1 | 0.4 | ST PHOSPHOINOSITIDE 3 KINASE PATHWAY | PI3K Pathway |
0.1 | 0.3 | PID BARD1 PATHWAY | BARD1 signaling events |
0.1 | 1.2 | PID AMB2 NEUTROPHILS PATHWAY | amb2 Integrin signaling |
0.1 | 1.7 | PID HIF2PATHWAY | HIF-2-alpha transcription factor network |
0.1 | 1.7 | PID TGFBR PATHWAY | TGF-beta receptor signaling |
0.1 | 0.7 | PID SYNDECAN 2 PATHWAY | Syndecan-2-mediated signaling events |
0.1 | 0.8 | PID INSULIN GLUCOSE PATHWAY | Insulin-mediated glucose transport |
0.1 | 1.1 | PID NCADHERIN PATHWAY | N-cadherin signaling events |
0.1 | 0.3 | PID HIF1A PATHWAY | Hypoxic and oxygen homeostasis regulation of HIF-1-alpha |
0.1 | 0.9 | PID ERBB1 INTERNALIZATION PATHWAY | Internalization of ErbB1 |
0.1 | 1.4 | PID RHODOPSIN PATHWAY | Visual signal transduction: Rods |
0.1 | 1.6 | PID PDGFRB PATHWAY | PDGFR-beta signaling pathway |
0.1 | 0.2 | PID ECADHERIN KERATINOCYTE PATHWAY | E-cadherin signaling in keratinocytes |
0.1 | 0.3 | PID HDAC CLASSII PATHWAY | Signaling events mediated by HDAC Class II |
0.1 | 0.1 | ST JAK STAT PATHWAY | Jak-STAT Pathway |
0.1 | 0.2 | PID RETINOIC ACID PATHWAY | Retinoic acid receptors-mediated signaling |
0.0 | 0.4 | PID PTP1B PATHWAY | Signaling events mediated by PTP1B |
0.0 | 0.1 | ST PAC1 RECEPTOR PATHWAY | PAC1 Receptor Pathway |
0.0 | 0.1 | PID S1P S1P4 PATHWAY | S1P4 pathway |
0.0 | 1.1 | PID MYC REPRESS PATHWAY | Validated targets of C-MYC transcriptional repression |
0.0 | 0.1 | PID AR NONGENOMIC PATHWAY | Nongenotropic Androgen signaling |
0.0 | 0.7 | PID AURORA B PATHWAY | Aurora B signaling |
0.0 | 0.2 | PID PI3KCI PATHWAY | Class I PI3K signaling events |
0.0 | 0.1 | PID IL27 PATHWAY | IL27-mediated signaling events |
0.0 | 0.1 | PID SYNDECAN 1 PATHWAY | Syndecan-1-mediated signaling events |
0.0 | 0.1 | SIG BCR SIGNALING PATHWAY | Members of the BCR signaling pathway |
0.0 | 0.1 | PID HIV NEF PATHWAY | HIV-1 Nef: Negative effector of Fas and TNF-alpha |
0.0 | 0.0 | PID S1P S1P2 PATHWAY | S1P2 pathway |
0.0 | 0.9 | PID RHOA REG PATHWAY | Regulation of RhoA activity |
0.0 | 0.1 | ST INTEGRIN SIGNALING PATHWAY | Integrin Signaling Pathway |
0.0 | 0.2 | PID ATM PATHWAY | ATM pathway |
0.0 | 0.4 | PID TOLL ENDOGENOUS PATHWAY | Endogenous TLR signaling |
0.0 | 0.7 | PID CMYB PATHWAY | C-MYB transcription factor network |
0.0 | 0.5 | PID HEDGEHOG GLI PATHWAY | Hedgehog signaling events mediated by Gli proteins |
0.0 | 0.2 | PID ARF6 PATHWAY | Arf6 signaling events |
0.0 | 0.1 | ST WNT CA2 CYCLIC GMP PATHWAY | Wnt/Ca2+/cyclic GMP signaling. |
0.0 | 0.3 | PID CASPASE PATHWAY | Caspase cascade in apoptosis |
0.0 | 0.0 | PID BETA CATENIN DEG PATHWAY | Degradation of beta catenin |
0.0 | 0.2 | PID INTEGRIN A4B1 PATHWAY | Alpha4 beta1 integrin signaling events |
0.0 | 0.4 | PID TAP63 PATHWAY | Validated transcriptional targets of TAp63 isoforms |
0.0 | 0.1 | PID ANTHRAX PATHWAY | Cellular roles of Anthrax toxin |
0.0 | 0.1 | PID CXCR3 PATHWAY | CXCR3-mediated signaling events |
0.0 | 0.5 | PID MYC ACTIV PATHWAY | Validated targets of C-MYC transcriptional activation |
0.0 | 0.1 | NABA BASEMENT MEMBRANES | Genes encoding structural components of basement membranes |
0.0 | 0.0 | PID FAS PATHWAY | FAS (CD95) signaling pathway |
0.0 | 0.0 | SA PTEN PATHWAY | PTEN is a tumor suppressor that dephosphorylates the lipid messenger phosphatidylinositol triphosphate. |
0.0 | 0.1 | PID HDAC CLASSIII PATHWAY | Signaling events mediated by HDAC Class III |
0.0 | 0.0 | PID PDGFRA PATHWAY | PDGFR-alpha signaling pathway |
0.0 | 1.5 | NABA ECM AFFILIATED | Genes encoding proteins affiliated structurally or functionally to extracellular matrix proteins |
0.0 | 0.1 | PID ALK2 PATHWAY | ALK2 signaling events |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
1.3 | 6.6 | REACTOME RNA POL I PROMOTER OPENING | Genes involved in RNA Polymerase I Promoter Opening |
1.3 | 1.3 | REACTOME DESTABILIZATION OF MRNA BY KSRP | Genes involved in Destabilization of mRNA by KSRP |
0.8 | 0.8 | REACTOME DESTABILIZATION OF MRNA BY BRF1 | Genes involved in Destabilization of mRNA by Butyrate Response Factor 1 (BRF1) |
0.7 | 16.1 | REACTOME SMAD2 SMAD3 SMAD4 HETEROTRIMER REGULATES TRANSCRIPTION | Genes involved in SMAD2/SMAD3:SMAD4 heterotrimer regulates transcription |
0.7 | 3.5 | REACTOME PACKAGING OF TELOMERE ENDS | Genes involved in Packaging Of Telomere Ends |
0.7 | 7.5 | REACTOME RECEPTOR LIGAND BINDING INITIATES THE SECOND PROTEOLYTIC CLEAVAGE OF NOTCH RECEPTOR | Genes involved in Receptor-ligand binding initiates the second proteolytic cleavage of Notch receptor |
0.7 | 3.9 | REACTOME NFKB ACTIVATION THROUGH FADD RIP1 PATHWAY MEDIATED BY CASPASE 8 AND10 | Genes involved in NF-kB activation through FADD/RIP-1 pathway mediated by caspase-8 and -10 |
0.6 | 16.2 | REACTOME NEGATIVE REGULATORS OF RIG I MDA5 SIGNALING | Genes involved in Negative regulators of RIG-I/MDA5 signaling |
0.6 | 1.9 | REACTOME AQUAPORIN MEDIATED TRANSPORT | Genes involved in Aquaporin-mediated transport |
0.6 | 0.6 | REACTOME MRNA DECAY BY 3 TO 5 EXORIBONUCLEASE | Genes involved in mRNA Decay by 3' to 5' Exoribonuclease |
0.6 | 6.5 | REACTOME SIGNAL ATTENUATION | Genes involved in Signal attenuation |
0.5 | 6.6 | REACTOME REGULATION OF IFNG SIGNALING | Genes involved in Regulation of IFNG signaling |
0.5 | 0.5 | REACTOME CYCLIN E ASSOCIATED EVENTS DURING G1 S TRANSITION | Genes involved in Cyclin E associated events during G1/S transition |
0.5 | 3.2 | REACTOME APOPTOSIS INDUCED DNA FRAGMENTATION | Genes involved in Apoptosis induced DNA fragmentation |
0.4 | 3.6 | REACTOME TRYPTOPHAN CATABOLISM | Genes involved in Tryptophan catabolism |
0.4 | 5.7 | REACTOME POST CHAPERONIN TUBULIN FOLDING PATHWAY | Genes involved in Post-chaperonin tubulin folding pathway |
0.4 | 8.2 | REACTOME INTRINSIC PATHWAY FOR APOPTOSIS | Genes involved in Intrinsic Pathway for Apoptosis |
0.4 | 3.9 | REACTOME GROWTH HORMONE RECEPTOR SIGNALING | Genes involved in Growth hormone receptor signaling |
0.3 | 6.2 | REACTOME G0 AND EARLY G1 | Genes involved in G0 and Early G1 |
0.3 | 0.3 | REACTOME APC C CDC20 MEDIATED DEGRADATION OF MITOTIC PROTEINS | Genes involved in APC/C:Cdc20 mediated degradation of mitotic proteins |
0.3 | 7.6 | REACTOME MEIOTIC SYNAPSIS | Genes involved in Meiotic Synapsis |
0.3 | 5.9 | REACTOME MICRORNA MIRNA BIOGENESIS | Genes involved in MicroRNA (miRNA) Biogenesis |
0.3 | 3.2 | REACTOME PD1 SIGNALING | Genes involved in PD-1 signaling |
0.3 | 3.2 | REACTOME ROLE OF DCC IN REGULATING APOPTOSIS | Genes involved in Role of DCC in regulating apoptosis |
0.3 | 4.1 | REACTOME PRE NOTCH PROCESSING IN GOLGI | Genes involved in Pre-NOTCH Processing in Golgi |
0.3 | 3.1 | REACTOME BASE FREE SUGAR PHOSPHATE REMOVAL VIA THE SINGLE NUCLEOTIDE REPLACEMENT PATHWAY | Genes involved in Base-free sugar-phosphate removal via the single-nucleotide replacement pathway |
0.3 | 7.2 | REACTOME G1 PHASE | Genes involved in G1 Phase |
0.3 | 5.1 | REACTOME SYNTHESIS AND INTERCONVERSION OF NUCLEOTIDE DI AND TRIPHOSPHATES | Genes involved in Synthesis and interconversion of nucleotide di- and triphosphates |
0.3 | 2.8 | REACTOME PASSIVE TRANSPORT BY AQUAPORINS | Genes involved in Passive Transport by Aquaporins |
0.3 | 2.8 | REACTOME REGULATION OF INSULIN SECRETION BY ACETYLCHOLINE | Genes involved in Regulation of Insulin Secretion by Acetylcholine |
0.3 | 0.3 | REACTOME THROMBOXANE SIGNALLING THROUGH TP RECEPTOR | Genes involved in Thromboxane signalling through TP receptor |
0.3 | 5.4 | REACTOME RNA POL III TRANSCRIPTION INITIATION FROM TYPE 3 PROMOTER | Genes involved in RNA Polymerase III Transcription Initiation From Type 3 Promoter |
0.3 | 6.6 | REACTOME SYNTHESIS OF PA | Genes involved in Synthesis of PA |
0.3 | 2.6 | REACTOME EGFR DOWNREGULATION | Genes involved in EGFR downregulation |
0.3 | 8.4 | REACTOME BMAL1 CLOCK NPAS2 ACTIVATES CIRCADIAN EXPRESSION | Genes involved in BMAL1:CLOCK/NPAS2 Activates Circadian Expression |
0.3 | 3.4 | REACTOME RETROGRADE NEUROTROPHIN SIGNALLING | Genes involved in Retrograde neurotrophin signalling |
0.3 | 2.3 | REACTOME ORGANIC CATION ANION ZWITTERION TRANSPORT | Genes involved in Organic cation/anion/zwitterion transport |
0.2 | 2.6 | REACTOME SEMA3A PLEXIN REPULSION SIGNALING BY INHIBITING INTEGRIN ADHESION | Genes involved in SEMA3A-Plexin repulsion signaling by inhibiting Integrin adhesion |
0.2 | 5.3 | REACTOME RNA POL II TRANSCRIPTION PRE INITIATION AND PROMOTER OPENING | Genes involved in RNA Polymerase II Transcription Pre-Initiation And Promoter Opening |
0.2 | 0.2 | REACTOME POST NMDA RECEPTOR ACTIVATION EVENTS | Genes involved in Post NMDA receptor activation events |
0.2 | 2.1 | REACTOME YAP1 AND WWTR1 TAZ STIMULATED GENE EXPRESSION | Genes involved in YAP1- and WWTR1 (TAZ)-stimulated gene expression |
0.2 | 5.5 | REACTOME SEMA4D INDUCED CELL MIGRATION AND GROWTH CONE COLLAPSE | Genes involved in Sema4D induced cell migration and growth-cone collapse |
0.2 | 16.3 | REACTOME MITOTIC PROMETAPHASE | Genes involved in Mitotic Prometaphase |
0.2 | 1.1 | REACTOME SPRY REGULATION OF FGF SIGNALING | Genes involved in Spry regulation of FGF signaling |
0.2 | 1.8 | REACTOME ELEVATION OF CYTOSOLIC CA2 LEVELS | Genes involved in Elevation of cytosolic Ca2+ levels |
0.2 | 1.1 | REACTOME RNA POL III TRANSCRIPTION INITIATION FROM TYPE 2 PROMOTER | Genes involved in RNA Polymerase III Transcription Initiation From Type 2 Promoter |
0.2 | 1.8 | REACTOME PROSTANOID LIGAND RECEPTORS | Genes involved in Prostanoid ligand receptors |
0.2 | 1.1 | REACTOME ACTIVATION OF THE AP1 FAMILY OF TRANSCRIPTION FACTORS | Genes involved in Activation of the AP-1 family of transcription factors |
0.2 | 1.8 | REACTOME DOWNREGULATION OF SMAD2 3 SMAD4 TRANSCRIPTIONAL ACTIVITY | Genes involved in Downregulation of SMAD2/3:SMAD4 transcriptional activity |
0.2 | 0.9 | REACTOME ELONGATION ARREST AND RECOVERY | Genes involved in Elongation arrest and recovery |
0.2 | 0.2 | REACTOME PHOSPHORYLATION OF THE APC C | Genes involved in Phosphorylation of the APC/C |
0.2 | 8.8 | REACTOME TRANSPORT OF MATURE TRANSCRIPT TO CYTOPLASM | Genes involved in Transport of Mature Transcript to Cytoplasm |
0.2 | 1.5 | REACTOME HORMONE SENSITIVE LIPASE HSL MEDIATED TRIACYLGLYCEROL HYDROLYSIS | Genes involved in Hormone-sensitive lipase (HSL)-mediated triacylglycerol hydrolysis |
0.2 | 2.3 | REACTOME METABOLISM OF NON CODING RNA | Genes involved in Metabolism of non-coding RNA |
0.2 | 1.3 | REACTOME ABACAVIR TRANSPORT AND METABOLISM | Genes involved in Abacavir transport and metabolism |
0.2 | 2.8 | REACTOME ZINC TRANSPORTERS | Genes involved in Zinc transporters |
0.2 | 2.9 | REACTOME CHYLOMICRON MEDIATED LIPID TRANSPORT | Genes involved in Chylomicron-mediated lipid transport |
0.2 | 1.8 | REACTOME LIPOPROTEIN METABOLISM | Genes involved in Lipoprotein metabolism |
0.2 | 4.9 | REACTOME ABC FAMILY PROTEINS MEDIATED TRANSPORT | Genes involved in ABC-family proteins mediated transport |
0.2 | 2.5 | REACTOME SIGNALING BY NODAL | Genes involved in Signaling by NODAL |
0.2 | 0.5 | REACTOME OLFACTORY SIGNALING PATHWAY | Genes involved in Olfactory Signaling Pathway |
0.2 | 0.4 | REACTOME NEF MEDIATED DOWNREGULATION OF MHC CLASS I COMPLEX CELL SURFACE EXPRESSION | Genes involved in Nef mediated downregulation of MHC class I complex cell surface expression |
0.2 | 1.9 | REACTOME TRAF6 MEDIATED NFKB ACTIVATION | Genes involved in TRAF6 mediated NF-kB activation |
0.2 | 3.5 | REACTOME SIGNALLING TO ERKS | Genes involved in Signalling to ERKs |
0.2 | 0.5 | REACTOME ALPHA LINOLENIC ACID ALA METABOLISM | Genes involved in alpha-linolenic acid (ALA) metabolism |
0.2 | 2.2 | REACTOME HOMOLOGOUS RECOMBINATION REPAIR OF REPLICATION INDEPENDENT DOUBLE STRAND BREAKS | Genes involved in Homologous recombination repair of replication-independent double-strand breaks |
0.2 | 6.4 | REACTOME ACTIVATION OF CHAPERONE GENES BY XBP1S | Genes involved in Activation of Chaperone Genes by XBP1(S) |
0.2 | 2.0 | REACTOME ANTIVIRAL MECHANISM BY IFN STIMULATED GENES | Genes involved in Antiviral mechanism by IFN-stimulated genes |
0.2 | 7.3 | REACTOME TRANSCRIPTIONAL REGULATION OF WHITE ADIPOCYTE DIFFERENTIATION | Genes involved in Transcriptional Regulation of White Adipocyte Differentiation |
0.2 | 0.2 | REACTOME G ALPHA1213 SIGNALLING EVENTS | Genes involved in G alpha (12/13) signalling events |
0.2 | 1.8 | REACTOME PURINE SALVAGE | Genes involved in Purine salvage |
0.2 | 2.2 | REACTOME RAP1 SIGNALLING | Genes involved in Rap1 signalling |
0.2 | 4.0 | REACTOME GLUCONEOGENESIS | Genes involved in Gluconeogenesis |
0.2 | 0.5 | REACTOME REGULATORY RNA PATHWAYS | Genes involved in Regulatory RNA pathways |
0.2 | 1.2 | REACTOME DCC MEDIATED ATTRACTIVE SIGNALING | Genes involved in DCC mediated attractive signaling |
0.2 | 1.1 | REACTOME GENERATION OF SECOND MESSENGER MOLECULES | Genes involved in Generation of second messenger molecules |
0.2 | 0.9 | REACTOME CTNNB1 PHOSPHORYLATION CASCADE | Genes involved in Beta-catenin phosphorylation cascade |
0.2 | 1.2 | REACTOME COPI MEDIATED TRANSPORT | Genes involved in COPI Mediated Transport |
0.2 | 0.9 | REACTOME APOPTOTIC CLEAVAGE OF CELL ADHESION PROTEINS | Genes involved in Apoptotic cleavage of cell adhesion proteins |
0.2 | 0.8 | REACTOME IRAK1 RECRUITS IKK COMPLEX | Genes involved in IRAK1 recruits IKK complex |
0.1 | 3.0 | REACTOME ENDOSOMAL SORTING COMPLEX REQUIRED FOR TRANSPORT ESCRT | Genes involved in Endosomal Sorting Complex Required For Transport (ESCRT) |
0.1 | 2.7 | REACTOME SMOOTH MUSCLE CONTRACTION | Genes involved in Smooth Muscle Contraction |
0.1 | 0.4 | REACTOME CYCLIN A B1 ASSOCIATED EVENTS DURING G2 M TRANSITION | Genes involved in Cyclin A/B1 associated events during G2/M transition |
0.1 | 2.1 | REACTOME APC CDC20 MEDIATED DEGRADATION OF NEK2A | Genes involved in APC-Cdc20 mediated degradation of Nek2A |
0.1 | 2.2 | REACTOME DEADENYLATION OF MRNA | Genes involved in Deadenylation of mRNA |
0.1 | 5.8 | REACTOME INTERFERON ALPHA BETA SIGNALING | Genes involved in Interferon alpha/beta signaling |
0.1 | 1.8 | REACTOME REGULATION OF HYPOXIA INDUCIBLE FACTOR HIF BY OXYGEN | Genes involved in Regulation of Hypoxia-inducible Factor (HIF) by Oxygen |
0.1 | 0.1 | REACTOME SIGNALING BY FGFR IN DISEASE | Genes involved in Signaling by FGFR in disease |
0.1 | 0.9 | REACTOME ASSOCIATION OF LICENSING FACTORS WITH THE PRE REPLICATIVE COMPLEX | Genes involved in Association of licensing factors with the pre-replicative complex |
0.1 | 1.8 | REACTOME METABOLISM OF PORPHYRINS | Genes involved in Metabolism of porphyrins |
0.1 | 5.3 | REACTOME GOLGI ASSOCIATED VESICLE BIOGENESIS | Genes involved in Golgi Associated Vesicle Biogenesis |
0.1 | 2.9 | REACTOME SIGNALING BY ROBO RECEPTOR | Genes involved in Signaling by Robo receptor |
0.1 | 0.5 | REACTOME APOBEC3G MEDIATED RESISTANCE TO HIV1 INFECTION | Genes involved in APOBEC3G mediated resistance to HIV-1 infection |
0.1 | 1.5 | REACTOME AMINO ACID SYNTHESIS AND INTERCONVERSION TRANSAMINATION | Genes involved in Amino acid synthesis and interconversion (transamination) |
0.1 | 1.0 | REACTOME GPVI MEDIATED ACTIVATION CASCADE | Genes involved in GPVI-mediated activation cascade |
0.1 | 1.5 | REACTOME MEIOTIC RECOMBINATION | Genes involved in Meiotic Recombination |
0.1 | 2.5 | REACTOME STRIATED MUSCLE CONTRACTION | Genes involved in Striated Muscle Contraction |
0.1 | 7.3 | REACTOME MRNA SPLICING | Genes involved in mRNA Splicing |
0.1 | 1.9 | REACTOME SYNTHESIS OF PC | Genes involved in Synthesis of PC |
0.1 | 0.6 | REACTOME MTORC1 MEDIATED SIGNALLING | Genes involved in mTORC1-mediated signalling |
0.1 | 0.6 | REACTOME NEGATIVE REGULATION OF THE PI3K AKT NETWORK | Genes involved in Negative regulation of the PI3K/AKT network |
0.1 | 0.8 | REACTOME CASPASE MEDIATED CLEAVAGE OF CYTOSKELETAL PROTEINS | Genes involved in Caspase-mediated cleavage of cytoskeletal proteins |
0.1 | 0.1 | REACTOME APC C CDH1 MEDIATED DEGRADATION OF CDC20 AND OTHER APC C CDH1 TARGETED PROTEINS IN LATE MITOSIS EARLY G1 | Genes involved in APC/C:Cdh1 mediated degradation of Cdc20 and other APC/C:Cdh1 targeted proteins in late mitosis/early G1 |
0.1 | 4.0 | REACTOME TRNA AMINOACYLATION | Genes involved in tRNA Aminoacylation |
0.1 | 1.0 | REACTOME REGULATION OF COMPLEMENT CASCADE | Genes involved in Regulation of Complement cascade |
0.1 | 2.7 | REACTOME SYNTHESIS OF PIPS AT THE PLASMA MEMBRANE | Genes involved in Synthesis of PIPs at the plasma membrane |
0.1 | 1.1 | REACTOME NONSENSE MEDIATED DECAY ENHANCED BY THE EXON JUNCTION COMPLEX | Genes involved in Nonsense Mediated Decay Enhanced by the Exon Junction Complex |
0.1 | 1.1 | REACTOME GLYCOGEN BREAKDOWN GLYCOGENOLYSIS | Genes involved in Glycogen breakdown (glycogenolysis) |
0.1 | 1.4 | REACTOME DESTABILIZATION OF MRNA BY TRISTETRAPROLIN TTP | Genes involved in Destabilization of mRNA by Tristetraprolin (TTP) |
0.1 | 0.8 | REACTOME CD28 DEPENDENT PI3K AKT SIGNALING | Genes involved in CD28 dependent PI3K/Akt signaling |
0.1 | 0.4 | REACTOME ACYL CHAIN REMODELLING OF PG | Genes involved in Acyl chain remodelling of PG |
0.1 | 1.0 | REACTOME TANDEM PORE DOMAIN POTASSIUM CHANNELS | Genes involved in Tandem pore domain potassium channels |
0.1 | 2.3 | REACTOME ASSOCIATION OF TRIC CCT WITH TARGET PROTEINS DURING BIOSYNTHESIS | Genes involved in Association of TriC/CCT with target proteins during biosynthesis |
0.1 | 0.4 | REACTOME THROMBIN SIGNALLING THROUGH PROTEINASE ACTIVATED RECEPTORS PARS | Genes involved in Thrombin signalling through proteinase activated receptors (PARs) |
0.1 | 1.8 | REACTOME CHOLESTEROL BIOSYNTHESIS | Genes involved in Cholesterol biosynthesis |
0.1 | 1.9 | REACTOME GLUTATHIONE CONJUGATION | Genes involved in Glutathione conjugation |
0.1 | 0.8 | REACTOME FACILITATIVE NA INDEPENDENT GLUCOSE TRANSPORTERS | Genes involved in Facilitative Na+-independent glucose transporters |
0.1 | 1.3 | REACTOME SIGNALING BY HIPPO | Genes involved in Signaling by Hippo |
0.1 | 2.5 | REACTOME GLYCEROPHOSPHOLIPID BIOSYNTHESIS | Genes involved in Glycerophospholipid biosynthesis |
0.1 | 0.6 | REACTOME ACTIVATION OF NF KAPPAB IN B CELLS | Genes involved in Activation of NF-kappaB in B Cells |
0.1 | 1.9 | REACTOME PYRIMIDINE METABOLISM | Genes involved in Pyrimidine metabolism |
0.1 | 2.2 | REACTOME BIOSYNTHESIS OF THE N GLYCAN PRECURSOR DOLICHOL LIPID LINKED OLIGOSACCHARIDE LLO AND TRANSFER TO A NASCENT PROTEIN | Genes involved in Biosynthesis of the N-glycan precursor (dolichol lipid-linked oligosaccharide, LLO) and transfer to a nascent protein |
0.1 | 0.2 | REACTOME REGULATION OF KIT SIGNALING | Genes involved in Regulation of KIT signaling |
0.1 | 0.4 | REACTOME G2 M DNA DAMAGE CHECKPOINT | Genes involved in G2/M DNA damage checkpoint |
0.1 | 0.2 | REACTOME SEMA3A PAK DEPENDENT AXON REPULSION | Genes involved in Sema3A PAK dependent Axon repulsion |
0.1 | 0.6 | REACTOME ACTIVATION OF CHAPERONE GENES BY ATF6 ALPHA | Genes involved in Activation of Chaperone Genes by ATF6-alpha |
0.1 | 0.1 | REACTOME PROLACTIN RECEPTOR SIGNALING | Genes involved in Prolactin receptor signaling |
0.1 | 0.3 | REACTOME ADP SIGNALLING THROUGH P2RY12 | Genes involved in ADP signalling through P2Y purinoceptor 12 |
0.1 | 6.5 | REACTOME 3 UTR MEDIATED TRANSLATIONAL REGULATION | Genes involved in 3' -UTR-mediated translational regulation |
0.1 | 2.0 | REACTOME TIGHT JUNCTION INTERACTIONS | Genes involved in Tight junction interactions |
0.1 | 0.7 | REACTOME DEADENYLATION DEPENDENT MRNA DECAY | Genes involved in Deadenylation-dependent mRNA decay |
0.1 | 0.1 | REACTOME TRIF MEDIATED TLR3 SIGNALING | Genes involved in TRIF mediated TLR3 signaling |
0.1 | 0.8 | REACTOME SYNTHESIS SECRETION AND INACTIVATION OF GIP | Genes involved in Synthesis, Secretion, and Inactivation of Glucose-dependent Insulinotropic Polypeptide (GIP) |
0.1 | 0.3 | REACTOME LATE PHASE OF HIV LIFE CYCLE | Genes involved in Late Phase of HIV Life Cycle |
0.1 | 0.2 | REACTOME PECAM1 INTERACTIONS | Genes involved in PECAM1 interactions |
0.1 | 1.0 | REACTOME REGULATION OF GENE EXPRESSION IN BETA CELLS | Genes involved in Regulation of gene expression in beta cells |
0.1 | 0.5 | REACTOME FORMATION OF INCISION COMPLEX IN GG NER | Genes involved in Formation of incision complex in GG-NER |
0.1 | 0.7 | REACTOME MITOCHONDRIAL FATTY ACID BETA OXIDATION | Genes involved in Mitochondrial Fatty Acid Beta-Oxidation |
0.1 | 7.5 | REACTOME ANTIGEN PROCESSING UBIQUITINATION PROTEASOME DEGRADATION | Genes involved in Antigen processing: Ubiquitination & Proteasome degradation |
0.1 | 0.7 | REACTOME GLUCOSE METABOLISM | Genes involved in Glucose metabolism |
0.1 | 1.1 | REACTOME MYOGENESIS | Genes involved in Myogenesis |
0.1 | 4.3 | REACTOME FACTORS INVOLVED IN MEGAKARYOCYTE DEVELOPMENT AND PLATELET PRODUCTION | Genes involved in Factors involved in megakaryocyte development and platelet production |
0.1 | 1.2 | REACTOME INSULIN RECEPTOR RECYCLING | Genes involved in Insulin receptor recycling |
0.1 | 1.1 | REACTOME SULFUR AMINO ACID METABOLISM | Genes involved in Sulfur amino acid metabolism |
0.1 | 0.1 | REACTOME ADP SIGNALLING THROUGH P2RY1 | Genes involved in ADP signalling through P2Y purinoceptor 1 |
0.1 | 0.9 | REACTOME AMINE DERIVED HORMONES | Genes involved in Amine-derived hormones |
0.1 | 0.9 | REACTOME ACTIVATED NOTCH1 TRANSMITS SIGNAL TO THE NUCLEUS | Genes involved in Activated NOTCH1 Transmits Signal to the Nucleus |
0.1 | 0.2 | REACTOME IRAK2 MEDIATED ACTIVATION OF TAK1 COMPLEX UPON TLR7 8 OR 9 STIMULATION | Genes involved in IRAK2 mediated activation of TAK1 complex upon TLR7/8 or 9 stimulation |
0.1 | 0.1 | REACTOME SYNTHESIS OF PIPS AT THE EARLY ENDOSOME MEMBRANE | Genes involved in Synthesis of PIPs at the early endosome membrane |
0.1 | 2.4 | REACTOME METABOLISM OF MRNA | Genes involved in Metabolism of mRNA |
0.1 | 1.8 | REACTOME LOSS OF NLP FROM MITOTIC CENTROSOMES | Genes involved in Loss of Nlp from mitotic centrosomes |
0.1 | 0.8 | REACTOME SYNTHESIS OF GLYCOSYLPHOSPHATIDYLINOSITOL GPI | Genes involved in Synthesis of glycosylphosphatidylinositol (GPI) |
0.0 | 2.0 | REACTOME CHEMOKINE RECEPTORS BIND CHEMOKINES | Genes involved in Chemokine receptors bind chemokines |
0.0 | 0.7 | REACTOME SRP DEPENDENT COTRANSLATIONAL PROTEIN TARGETING TO MEMBRANE | Genes involved in SRP-dependent cotranslational protein targeting to membrane |
0.0 | 0.4 | REACTOME SYNTHESIS OF PIPS AT THE GOLGI MEMBRANE | Genes involved in Synthesis of PIPs at the Golgi membrane |
0.0 | 0.1 | REACTOME PLATELET SENSITIZATION BY LDL | Genes involved in Platelet sensitization by LDL |
0.0 | 0.2 | REACTOME ACTIVATED TAK1 MEDIATES P38 MAPK ACTIVATION | Genes involved in activated TAK1 mediates p38 MAPK activation |
0.0 | 0.2 | REACTOME ETHANOL OXIDATION | Genes involved in Ethanol oxidation |
0.0 | 1.6 | REACTOME MITOCHONDRIAL PROTEIN IMPORT | Genes involved in Mitochondrial Protein Import |
0.0 | 0.7 | REACTOME INTERACTION BETWEEN L1 AND ANKYRINS | Genes involved in Interaction between L1 and Ankyrins |
0.0 | 0.2 | REACTOME PURINE CATABOLISM | Genes involved in Purine catabolism |
0.0 | 0.1 | REACTOME ACTIVATION OF GENES BY ATF4 | Genes involved in Activation of Genes by ATF4 |
0.0 | 0.3 | REACTOME DEPOSITION OF NEW CENPA CONTAINING NUCLEOSOMES AT THE CENTROMERE | Genes involved in Deposition of New CENPA-containing Nucleosomes at the Centromere |
0.0 | 0.1 | REACTOME SIGNALING BY CONSTITUTIVELY ACTIVE EGFR | Genes involved in Signaling by constitutively active EGFR |
0.0 | 0.4 | REACTOME VITAMIN B5 PANTOTHENATE METABOLISM | Genes involved in Vitamin B5 (pantothenate) metabolism |
0.0 | 0.4 | REACTOME TRANSLATION | Genes involved in Translation |
0.0 | 1.3 | REACTOME NUCLEAR RECEPTOR TRANSCRIPTION PATHWAY | Genes involved in Nuclear Receptor transcription pathway |
0.0 | 0.4 | REACTOME AMYLOIDS | Genes involved in Amyloids |
0.0 | 0.3 | REACTOME ANDROGEN BIOSYNTHESIS | Genes involved in Androgen biosynthesis |
0.0 | 0.9 | REACTOME MYD88 MAL CASCADE INITIATED ON PLASMA MEMBRANE | Genes involved in MyD88:Mal cascade initiated on plasma membrane |
0.0 | 0.1 | REACTOME INFLUENZA VIRAL RNA TRANSCRIPTION AND REPLICATION | Genes involved in Influenza Viral RNA Transcription and Replication |
0.0 | 0.1 | REACTOME LYSOSOME VESICLE BIOGENESIS | Genes involved in Lysosome Vesicle Biogenesis |
0.0 | 0.1 | REACTOME SEMA4D IN SEMAPHORIN SIGNALING | Genes involved in Sema4D in semaphorin signaling |
0.0 | 0.8 | REACTOME SIGNALING BY NOTCH | Genes involved in Signaling by NOTCH |
0.0 | 0.0 | REACTOME CIRCADIAN REPRESSION OF EXPRESSION BY REV ERBA | Genes involved in Circadian Repression of Expression by REV-ERBA |
0.0 | 0.4 | REACTOME PROSTACYCLIN SIGNALLING THROUGH PROSTACYCLIN RECEPTOR | Genes involved in Prostacyclin signalling through prostacyclin receptor |
0.0 | 0.2 | REACTOME NEPHRIN INTERACTIONS | Genes involved in Nephrin interactions |
0.0 | 0.4 | REACTOME HS GAG DEGRADATION | Genes involved in HS-GAG degradation |
0.0 | 0.4 | REACTOME SIGNALING BY ERBB4 | Genes involved in Signaling by ERBB4 |
0.0 | 0.2 | REACTOME PURINE METABOLISM | Genes involved in Purine metabolism |
0.0 | 0.1 | REACTOME XENOBIOTICS | Genes involved in Xenobiotics |
0.0 | 0.0 | REACTOME ENDOSOMAL VACUOLAR PATHWAY | Genes involved in Endosomal/Vacuolar pathway |
0.0 | 1.4 | REACTOME RESPIRATORY ELECTRON TRANSPORT ATP SYNTHESIS BY CHEMIOSMOTIC COUPLING AND HEAT PRODUCTION BY UNCOUPLING PROTEINS | Genes involved in Respiratory electron transport, ATP synthesis by chemiosmotic coupling, and heat production by uncoupling proteins. |
0.0 | 0.5 | REACTOME TRANSPORT OF VITAMINS NUCLEOSIDES AND RELATED MOLECULES | Genes involved in Transport of vitamins, nucleosides, and related molecules |
0.0 | 0.2 | REACTOME RNA POL I TRANSCRIPTION | Genes involved in RNA Polymerase I Transcription |
0.0 | 0.2 | REACTOME IL1 SIGNALING | Genes involved in Interleukin-1 signaling |
0.0 | 0.0 | REACTOME CDT1 ASSOCIATION WITH THE CDC6 ORC ORIGIN COMPLEX | Genes involved in CDT1 association with the CDC6:ORC:origin complex |
0.0 | 0.0 | REACTOME REMOVAL OF THE FLAP INTERMEDIATE FROM THE C STRAND | Genes involved in Removal of the Flap Intermediate from the C-strand |
0.0 | 0.0 | REACTOME ADVANCED GLYCOSYLATION ENDPRODUCT RECEPTOR SIGNALING | Genes involved in Advanced glycosylation endproduct receptor signaling |
0.0 | 0.3 | REACTOME TERMINATION OF O GLYCAN BIOSYNTHESIS | Genes involved in Termination of O-glycan biosynthesis |
0.0 | 0.2 | REACTOME GLOBAL GENOMIC NER GG NER | Genes involved in Global Genomic NER (GG-NER) |
0.0 | 0.2 | REACTOME REGULATION OF INSULIN LIKE GROWTH FACTOR IGF ACTIVITY BY INSULIN LIKE GROWTH FACTOR BINDING PROTEINS IGFBPS | Genes involved in Regulation of Insulin-like Growth Factor (IGF) Activity by Insulin-like Growth Factor Binding Proteins (IGFBPs) |
0.0 | 0.1 | REACTOME CELL EXTRACELLULAR MATRIX INTERACTIONS | Genes involved in Cell-extracellular matrix interactions |
0.0 | 0.1 | REACTOME IL 7 SIGNALING | Genes involved in Interleukin-7 signaling |
0.0 | 0.2 | REACTOME SYNTHESIS OF BILE ACIDS AND BILE SALTS VIA 7ALPHA HYDROXYCHOLESTEROL | Genes involved in Synthesis of bile acids and bile salts via 7alpha-hydroxycholesterol |
0.0 | 0.0 | REACTOME EICOSANOID LIGAND BINDING RECEPTORS | Genes involved in Eicosanoid ligand-binding receptors |
0.0 | 0.0 | REACTOME ACTIVATION OF CHAPERONES BY ATF6 ALPHA | Genes involved in Activation of Chaperones by ATF6-alpha |
0.0 | 0.0 | REACTOME LATENT INFECTION OF HOMO SAPIENS WITH MYCOBACTERIUM TUBERCULOSIS | Genes involved in Latent infection of Homo sapiens with Mycobacterium tuberculosis |
0.0 | 0.0 | REACTOME REGULATION OF THE FANCONI ANEMIA PATHWAY | Genes involved in Regulation of the Fanconi anemia pathway |
0.0 | 0.1 | REACTOME ANTIGEN PROCESSING CROSS PRESENTATION | Genes involved in Antigen processing-Cross presentation |
0.0 | 0.1 | REACTOME ANTIGEN ACTIVATES B CELL RECEPTOR LEADING TO GENERATION OF SECOND MESSENGERS | Genes involved in Antigen Activates B Cell Receptor Leading to Generation of Second Messengers |