Gene Symbol | Gene ID | Gene Info |
---|---|---|
Fubp1
|
ENSMUSG00000028034.9 | Fubp1 |
CRE | Gene | Distance | Association probability | Pearson corr. coef. | P-value | Plot |
---|---|---|---|---|---|---|
Fubp1 | chr3_152231447_152231726 | 3745 | 0.151588 | 0.60 | 1.1e-06 | Click! |
Fubp1 | chr3_152212054_152212257 | 1634 | 0.236984 | 0.43 | 1.0e-03 | Click! |
Fubp1 | chr3_152211876_152212033 | 1433 | 0.261726 | 0.35 | 9.2e-03 | Click! |
Fubp1 | chr3_152211032_152211210 | 600 | 0.480548 | 0.35 | 9.3e-03 | Click! |
Fubp1 | chr3_152210627_152211009 | 297 | 0.645281 | 0.34 | 1.0e-02 | Click! |
Move your cursor over a bar to see sample name and corresponding Z-value.
Cis Regulatory Element (CRE) | Target Score | Top associated gene | Gene Info | Distance of CRE to TSS | CRE/Gene association probability |
---|---|---|---|---|---|
chr17_36869302_36869591 | 6.89 |
Trim10 |
tripartite motif-containing 10 |
128 |
0.9 |
chr18_62165959_62166113 | 5.94 |
Adrb2 |
adrenergic receptor, beta 2 |
13923 |
0.18 |
chr3_9581040_9581227 | 5.92 |
Zfp704 |
zinc finger protein 704 |
15834 |
0.23 |
chr13_107101149_107101349 | 5.80 |
Gm31452 |
predicted gene, 31452 |
37554 |
0.14 |
chr6_38443950_38444228 | 5.49 |
Ubn2 |
ubinuclein 2 |
3556 |
0.2 |
chr11_57960034_57960300 | 5.46 |
Gm12245 |
predicted gene 12245 |
11082 |
0.15 |
chr1_88206786_88207160 | 5.43 |
Dnajb3 |
DnaJ heat shock protein family (Hsp40) member B3 |
1191 |
0.22 |
chr4_117474036_117474212 | 5.24 |
Rnf220 |
ring finger protein 220 |
20887 |
0.13 |
chr2_151010955_151011124 | 5.22 |
Ninl |
ninein-like |
1641 |
0.26 |
chr6_55359082_55359253 | 5.06 |
Ghrhr |
growth hormone releasing hormone receptor |
17128 |
0.14 |
chr4_120665004_120665155 | 4.84 |
Cited4 |
Cbp/p300-interacting transactivator, with Glu/Asp-rich carboxy-terminal domain, 4 |
1493 |
0.34 |
chr4_105309056_105309241 | 4.81 |
Gm12722 |
predicted gene 12722 |
65798 |
0.13 |
chr1_134460444_134460597 | 4.80 |
Klhl12 |
kelch-like 12 |
4965 |
0.12 |
chr6_127577634_127578087 | 4.77 |
Cracr2a |
calcium release activated channel regulator 2A |
37 |
0.98 |
chr9_21962987_21963253 | 4.69 |
Epor |
erythropoietin receptor |
386 |
0.7 |
chr2_133688494_133688765 | 4.61 |
Gm25258 |
predicted gene, 25258 |
104208 |
0.07 |
chr8_105323693_105323844 | 4.55 |
Lrrc29 |
leucine rich repeat containing 29 |
2491 |
0.09 |
chr1_161791684_161791835 | 4.38 |
Fasl |
Fas ligand (TNF superfamily, member 6) |
3264 |
0.18 |
chr7_119280318_119280619 | 4.36 |
Gm4083 |
predicted gene 4083 |
21239 |
0.18 |
chrX_164447849_164448001 | 4.33 |
Asb11 |
ankyrin repeat and SOCS box-containing 11 |
9867 |
0.16 |
chr10_54042474_54042667 | 4.22 |
Gm47917 |
predicted gene, 47917 |
21241 |
0.18 |
chr14_69536637_69537045 | 4.13 |
Gm27174 |
predicted gene 27174 |
18491 |
0.09 |
chr7_109636980_109637131 | 4.06 |
Denn2b |
DENN domain containing 2B |
19908 |
0.15 |
chr3_94926503_94926673 | 4.03 |
Gm26279 |
predicted gene, 26279 |
6165 |
0.1 |
chr11_102375874_102376188 | 3.95 |
Bloodlinc |
Bloodlinc, erythroid developmental long intergenic non-protein coding transcript |
989 |
0.36 |
chr11_5573649_5573822 | 3.93 |
Ankrd36 |
ankyrin repeat domain 36 |
348 |
0.83 |
chr7_103871119_103871278 | 3.79 |
Olfr66 |
olfactory receptor 66 |
11043 |
0.06 |
chr10_93143358_93143676 | 3.68 |
Cdk17 |
cyclin-dependent kinase 17 |
17358 |
0.17 |
chr16_76323171_76323322 | 3.66 |
Nrip1 |
nuclear receptor interacting protein 1 |
412 |
0.88 |
chr6_123293239_123293390 | 3.54 |
Clec4e |
C-type lectin domain family 4, member e |
3444 |
0.18 |
chr15_81530960_81531122 | 3.54 |
Gm5218 |
predicted gene 5218 |
31496 |
0.1 |
chr5_73311488_73311911 | 3.53 |
Gm42732 |
predicted gene 42732 |
335 |
0.78 |
chr9_71162558_71162709 | 3.53 |
Aqp9 |
aquaporin 9 |
0 |
0.96 |
chr4_132078007_132078158 | 3.51 |
Epb41 |
erythrocyte membrane protein band 4.1 |
2761 |
0.15 |
chr3_94686124_94686275 | 3.45 |
Selenbp2 |
selenium binding protein 2 |
7357 |
0.11 |
chr3_9767710_9767878 | 3.38 |
Gm16337 |
predicted gene 16337 |
10187 |
0.22 |
chr4_33466883_33467152 | 3.37 |
Gm11935 |
predicted gene 11935 |
14128 |
0.21 |
chr11_16503276_16503437 | 3.35 |
Sec61g |
SEC61, gamma subunit |
1688 |
0.39 |
chr6_131364405_131364668 | 3.30 |
Ybx3 |
Y box protein 3 |
4482 |
0.16 |
chr7_103850583_103850750 | 3.26 |
Hbb-bh0 |
hemoglobin, beta, pseudogene bh0 |
518 |
0.49 |
chr1_190724564_190725420 | 3.20 |
Rps6kc1 |
ribosomal protein S6 kinase polypeptide 1 |
85471 |
0.09 |
chr6_3989036_3989187 | 3.19 |
Tfpi2 |
tissue factor pathway inhibitor 2 |
192 |
0.93 |
chr10_86392361_86392559 | 3.16 |
Timp3 |
tissue inhibitor of metalloproteinase 3 |
89606 |
0.06 |
chr1_155882749_155882936 | 3.15 |
Gm37383 |
predicted gene, 37383 |
296 |
0.85 |
chr1_134405635_134406423 | 3.13 |
Cyb5r1 |
cytochrome b5 reductase 1 |
1 |
0.96 |
chr4_106296482_106296646 | 3.13 |
Gm37253 |
predicted gene, 37253 |
2171 |
0.25 |
chr5_100899819_100900094 | 3.05 |
Gm36793 |
predicted gene, 36793 |
13751 |
0.14 |
chr15_76254074_76254241 | 3.04 |
Mir6953 |
microRNA 6953 |
5966 |
0.07 |
chr17_66881067_66881230 | 3.03 |
Gm49940 |
predicted gene, 49940 |
18908 |
0.16 |
chr16_11270757_11270983 | 3.00 |
Mir1945 |
microRNA 1945 |
16425 |
0.12 |
chr2_30417599_30417778 | 3.00 |
Ptpa |
protein phosphatase 2 protein activator |
1386 |
0.24 |
chr14_69318389_69318982 | 2.99 |
Gm16677 |
predicted gene, 16677 |
18397 |
0.08 |
chr10_40125174_40125635 | 2.98 |
Gm25613 |
predicted gene, 25613 |
15942 |
0.13 |
chr4_119077561_119077722 | 2.97 |
Gm12866 |
predicted gene 12866 |
8530 |
0.11 |
chr7_16815354_16816404 | 2.97 |
Strn4 |
striatin, calmodulin binding protein 4 |
10 |
0.69 |
chr5_21672893_21673153 | 2.96 |
Gm15719 |
predicted gene 15719 |
16518 |
0.12 |
chr3_86567480_86567631 | 2.95 |
Mab21l2 |
mab-21-like 2 |
18926 |
0.19 |
chr6_149278562_149278728 | 2.95 |
Gm10388 |
predicted gene 10388 |
8128 |
0.16 |
chr5_73191359_73191511 | 2.94 |
Fryl |
FRY like transcription coactivator |
444 |
0.66 |
chr1_86055937_86056215 | 2.93 |
Psmd1 |
proteasome (prosome, macropain) 26S subunit, non-ATPase, 1 |
8311 |
0.11 |
chr7_103825678_103825891 | 2.92 |
Hbb-bs |
hemoglobin, beta adult s chain |
1941 |
0.12 |
chr4_41089916_41090070 | 2.89 |
Aqp3 |
aquaporin 3 |
4455 |
0.13 |
chr5_142920434_142920596 | 2.89 |
Actb |
actin, beta |
13761 |
0.14 |
chr11_53481482_53481656 | 2.88 |
Sowaha |
sosondowah ankyrin repeat domain family member A |
1295 |
0.2 |
chr4_135898801_135898969 | 2.82 |
Cnr2 |
cannabinoid receptor 2 (macrophage) |
3491 |
0.13 |
chr1_185452329_185452480 | 2.80 |
Slc30a10 |
solute carrier family 30, member 10 |
2444 |
0.18 |
chr4_46454503_46454788 | 2.78 |
Anp32b |
acidic (leucine-rich) nuclear phosphoprotein 32 family, member B |
3743 |
0.16 |
chr3_94686389_94686586 | 2.78 |
Selenbp2 |
selenium binding protein 2 |
7069 |
0.11 |
chr15_83563229_83563380 | 2.77 |
Tspo |
translocator protein |
288 |
0.63 |
chrX_163958863_163959147 | 2.77 |
Zrsr2 |
zinc finger (CCCH type), RNA binding motif and serine/arginine rich 2 |
344 |
0.9 |
chr4_130297144_130297500 | 2.76 |
Fabp3 |
fatty acid binding protein 3, muscle and heart |
11273 |
0.14 |
chr4_141749939_141750090 | 2.76 |
Agmat |
agmatine ureohydrolase (agmatinase) |
3342 |
0.16 |
chr11_78163296_78164397 | 2.74 |
Traf4 |
TNF receptor associated factor 4 |
1670 |
0.14 |
chr13_37715025_37715360 | 2.72 |
Gm40918 |
predicted gene, 40918 |
1119 |
0.39 |
chr9_71162797_71162981 | 2.71 |
Aqp9 |
aquaporin 9 |
256 |
0.84 |
chr10_98906364_98906526 | 2.67 |
Atp2b1 |
ATPase, Ca++ transporting, plasma membrane 1 |
7961 |
0.28 |
chr5_74536302_74536459 | 2.65 |
Fip1l1 |
FIP1 like 1 (S. cerevisiae) |
401 |
0.84 |
chr13_75706913_75707570 | 2.65 |
1700037F03Rik |
RIKEN cDNA 1700037F03 gene |
69 |
0.81 |
chr4_24497055_24497214 | 2.64 |
Mms22l |
MMS22-like, DNA repair protein |
590 |
0.82 |
chr3_5576774_5576976 | 2.64 |
Pex2 |
peroxisomal biogenesis factor 2 |
636 |
0.81 |
chr1_185203642_185204638 | 2.63 |
Rab3gap2 |
RAB3 GTPase activating protein subunit 2 |
23 |
0.97 |
chr18_70530960_70531272 | 2.60 |
Poli |
polymerase (DNA directed), iota |
496 |
0.77 |
chr5_97007024_97007189 | 2.60 |
Bmp2k |
BMP2 inducible kinase |
9417 |
0.14 |
chr13_93388637_93389177 | 2.59 |
Gm47155 |
predicted gene, 47155 |
21876 |
0.14 |
chr8_122329580_122330425 | 2.58 |
Zfpm1 |
zinc finger protein, multitype 1 |
3696 |
0.15 |
chr1_166002288_166003185 | 2.57 |
Pou2f1 |
POU domain, class 2, transcription factor 1 |
58 |
0.72 |
chr7_103876880_103877043 | 2.54 |
Olfr66 |
olfactory receptor 66 |
5280 |
0.07 |
chr7_81587259_81587432 | 2.53 |
Gm45698 |
predicted gene 45698 |
3549 |
0.13 |
chr3_135843566_135843717 | 2.52 |
4933401H06Rik |
RIKEN cDNA 4933401H06 gene |
3372 |
0.19 |
chr7_141393860_141394011 | 2.50 |
Taldo1 |
transaldolase 1 |
1692 |
0.15 |
chr13_76421096_76421255 | 2.50 |
Gm48078 |
predicted gene, 48078 |
18156 |
0.2 |
chr8_13200676_13200973 | 2.49 |
2810030D12Rik |
RIKEN cDNA 2810030D12 gene |
4 |
0.72 |
chr4_120674662_120674851 | 2.44 |
Cited4 |
Cbp/p300-interacting transactivator, with Glu/Asp-rich carboxy-terminal domain, 4 |
8184 |
0.15 |
chr15_32964823_32965125 | 2.40 |
Sdc2 |
syndecan 2 |
44251 |
0.18 |
chr3_105763225_105763393 | 2.40 |
Gm43329 |
predicted gene 43329 |
6888 |
0.11 |
chr3_7515479_7515657 | 2.40 |
Zc2hc1a |
zinc finger, C2HC-type containing 1A |
12082 |
0.18 |
chr4_52439590_52439741 | 2.38 |
Smc2 |
structural maintenance of chromosomes 2 |
396 |
0.65 |
chr15_102350239_102351186 | 2.38 |
Aaas |
achalasia, adrenocortical insufficiency, alacrimia |
17 |
0.59 |
chr2_143994541_143994838 | 2.38 |
Rrbp1 |
ribosome binding protein 1 |
11524 |
0.18 |
chr12_32123372_32123548 | 2.37 |
5430401H09Rik |
RIKEN cDNA 5430401H09 gene |
242 |
0.93 |
chr12_76673740_76674235 | 2.37 |
Sptb |
spectrin beta, erythrocytic |
36036 |
0.15 |
chr10_81095272_81095757 | 2.37 |
Creb3l3 |
cAMP responsive element binding protein 3-like 3 |
2939 |
0.1 |
chr11_90727394_90727734 | 2.35 |
Tom1l1 |
target of myb1-like 1 (chicken) |
39198 |
0.15 |
chr10_128821121_128821535 | 2.31 |
Ormdl2 |
ORM1-like 2 (S. cerevisiae) |
263 |
0.67 |
chr12_101025980_101026134 | 2.30 |
Ccdc88c |
coiled-coil domain containing 88C |
2852 |
0.16 |
chr2_122234287_122234941 | 2.29 |
Sord |
sorbitol dehydrogenase |
135 |
0.93 |
chr5_8928690_8928841 | 2.27 |
Abcb4 |
ATP-binding cassette, sub-family B (MDR/TAP), member 4 |
39 |
0.97 |
chr1_120120075_120121610 | 2.26 |
Dbi |
diazepam binding inhibitor |
95 |
0.8 |
chr5_145203722_145203935 | 2.25 |
Zkscan5 |
zinc finger with KRAB and SCAN domains 5 |
734 |
0.46 |
chr11_115872435_115872990 | 2.24 |
Myo15b |
myosin XVB |
4804 |
0.11 |
chr11_11729010_11729176 | 2.24 |
Gm12000 |
predicted gene 12000 |
32654 |
0.14 |
chr10_83019897_83020322 | 2.23 |
Gm10773 |
predicted gene 10773 |
11586 |
0.19 |
chr1_40230393_40230707 | 2.23 |
Il1r1 |
interleukin 1 receptor, type I |
5470 |
0.21 |
chr16_92825845_92826239 | 2.22 |
Runx1 |
runt related transcription factor 1 |
32 |
0.98 |
chr10_128187495_128187653 | 2.21 |
Gm4556 |
predicted gene 4556 |
2955 |
0.11 |
chr3_60167575_60168076 | 2.20 |
Gm24382 |
predicted gene, 24382 |
40078 |
0.17 |
chr3_122247078_122247551 | 2.18 |
Gclm |
glutamate-cysteine ligase, modifier subunit |
1233 |
0.27 |
chr6_120605559_120605721 | 2.18 |
Gm44124 |
predicted gene, 44124 |
25464 |
0.13 |
chr16_32507446_32507734 | 2.17 |
Zdhhc19 |
zinc finger, DHHC domain containing 19 |
7979 |
0.13 |
chr12_108174909_108175060 | 2.17 |
Setd3 |
SET domain containing 3 |
4229 |
0.23 |
chr15_89356281_89356678 | 2.17 |
Ncaph2 |
non-SMC condensin II complex, subunit H2 |
565 |
0.42 |
chr8_126589589_126589740 | 2.16 |
Irf2bp2 |
interferon regulatory factor 2 binding protein 2 |
4322 |
0.26 |
chr15_3995248_3995572 | 2.15 |
AW549877 |
expressed sequence AW549877 |
334 |
0.65 |
chr8_23245810_23246147 | 2.14 |
Golga7 |
golgi autoantigen, golgin subfamily a, 7 |
800 |
0.51 |
chr4_145281154_145281467 | 2.14 |
Tnfrsf8 |
tumor necrosis factor receptor superfamily, member 8 |
33837 |
0.14 |
chr9_32098335_32098486 | 2.12 |
Arhgap32 |
Rho GTPase activating protein 32 |
17726 |
0.15 |
chr11_67722541_67722704 | 2.11 |
Rcvrn |
recoverin |
27296 |
0.14 |
chr6_135204808_135205108 | 2.10 |
Fam234b |
family with sequence similarity 234, member B |
6546 |
0.12 |
chr13_58475506_58475838 | 2.07 |
Gm47918 |
predicted gene, 47918 |
32651 |
0.13 |
chr16_76323639_76324221 | 2.07 |
Nrip1 |
nuclear receptor interacting protein 1 |
272 |
0.94 |
chr6_118832765_118832916 | 2.06 |
Gm25905 |
predicted gene, 25905 |
2060 |
0.42 |
chr9_99557665_99557816 | 2.06 |
Armc8 |
armadillo repeat containing 8 |
10909 |
0.17 |
chr5_137115775_137116361 | 2.05 |
Trim56 |
tripartite motif-containing 56 |
139 |
0.93 |
chr2_151009013_151009599 | 2.03 |
Ninl |
ninein-like |
26 |
0.96 |
chr5_150118145_150118469 | 2.02 |
Fry |
FRY microtubule binding protein |
338 |
0.88 |
chr2_110488197_110488348 | 2.01 |
Gm13935 |
predicted gene 13935 |
68653 |
0.11 |
chr9_66182054_66182393 | 2.01 |
Dapk2 |
death-associated protein kinase 2 |
23988 |
0.17 |
chr12_83073005_83073315 | 2.01 |
Gm29530 |
predicted gene 29530 |
25714 |
0.15 |
chr18_62174603_62175149 | 2.00 |
Adrb2 |
adrenergic receptor, beta 2 |
5083 |
0.21 |
chr12_3619122_3619284 | 2.00 |
Dtnb |
dystrobrevin, beta |
13719 |
0.22 |
chr4_120630429_120630582 | 1.98 |
Gm12860 |
predicted gene 12860 |
14665 |
0.13 |
chr3_84155055_84155590 | 1.98 |
Mnd1 |
meiotic nuclear divisions 1 |
464 |
0.82 |
chr12_3618411_3618590 | 1.97 |
Dtnb |
dystrobrevin, beta |
14422 |
0.21 |
chr11_78847975_78848170 | 1.97 |
Lyrm9 |
LYR motif containing 9 |
21443 |
0.15 |
chr17_94864943_94865205 | 1.97 |
Gm20939 |
predicted gene, 20939 |
156 |
0.93 |
chr9_66186516_66186707 | 1.96 |
Dapk2 |
death-associated protein kinase 2 |
28376 |
0.17 |
chrX_48514027_48514178 | 1.96 |
Aifm1 |
apoptosis-inducing factor, mitochondrion-associated 1 |
539 |
0.74 |
chr7_100466744_100466943 | 1.95 |
Gm10603 |
predicted gene 10603 |
347 |
0.73 |
chr15_102296754_102296921 | 1.95 |
Espl1 |
extra spindle pole bodies 1, separase |
532 |
0.42 |
chr12_39990993_39991301 | 1.94 |
Arl4a |
ADP-ribosylation factor-like 4A |
23337 |
0.16 |
chr7_90131731_90132337 | 1.94 |
Picalm |
phosphatidylinositol binding clathrin assembly protein |
389 |
0.48 |
chr15_66827533_66827688 | 1.93 |
Sla |
src-like adaptor |
4036 |
0.23 |
chr4_156110130_156110565 | 1.93 |
9430015G10Rik |
RIKEN cDNA 9430015G10 gene |
308 |
0.8 |
chr3_98082215_98082528 | 1.92 |
Gm42820 |
predicted gene 42820 |
39217 |
0.13 |
chr13_118387692_118387843 | 1.91 |
Mrps30 |
mitochondrial ribosomal protein S30 |
515 |
0.7 |
chr4_119189949_119190118 | 1.91 |
Ermap |
erythroblast membrane-associated protein |
22 |
0.95 |
chr1_180031771_180031928 | 1.90 |
Gm38169 |
predicted gene, 38169 |
10787 |
0.21 |
chr6_113661937_113662175 | 1.90 |
Irak2 |
interleukin-1 receptor-associated kinase 2 |
6794 |
0.08 |
chr16_18419103_18419260 | 1.90 |
Gm15764 |
predicted gene 15764 |
2296 |
0.17 |
chr3_127132438_127132589 | 1.90 |
Ank2 |
ankyrin 2, brain |
7651 |
0.15 |
chr7_113349240_113349391 | 1.90 |
Btbd10 |
BTB (POZ) domain containing 10 |
2030 |
0.28 |
chr13_24576741_24577191 | 1.89 |
Ripor2 |
RHO family interacting cell polarization regulator 2 |
5223 |
0.22 |
chr4_47294782_47294966 | 1.89 |
Col15a1 |
collagen, type XV, alpha 1 |
6587 |
0.24 |
chr7_114275561_114276736 | 1.88 |
Psma1 |
proteasome subunit alpha 1 |
30 |
0.98 |
chr3_153806260_153806830 | 1.88 |
5730460C07Rik |
RIKEN cDNA 5730460C07 gene |
14458 |
0.11 |
chr6_136468328_136469393 | 1.87 |
Gm6728 |
predicted gene 6728 |
18326 |
0.12 |
chr14_93009182_93009529 | 1.87 |
Gm48963 |
predicted gene, 48963 |
116653 |
0.06 |
chr6_28682138_28682325 | 1.86 |
Snd1 |
staphylococcal nuclease and tudor domain containing 1 |
22678 |
0.21 |
chr5_53957458_53957616 | 1.84 |
Gm43266 |
predicted gene 43266 |
39093 |
0.14 |
chr4_150520169_150520324 | 1.83 |
Rere |
arginine glutamic acid dipeptide (RE) repeats |
31853 |
0.18 |
chr1_155408109_155408274 | 1.83 |
Xpr1 |
xenotropic and polytropic retrovirus receptor 1 |
9138 |
0.25 |
chr12_4680347_4680714 | 1.82 |
Gm17541 |
predicted gene, 17541 |
9396 |
0.12 |
chr16_94568896_94569342 | 1.82 |
Dyrk1a |
dual-specificity tyrosine-(Y)-phosphorylation regulated kinase 1a |
891 |
0.6 |
chr16_58454803_58455144 | 1.82 |
Dcbld2 |
discoidin, CUB and LCCL domain containing 2 |
218 |
0.94 |
chr5_145166377_145166528 | 1.81 |
Ptcd1 |
pentatricopeptide repeat domain 1 |
504 |
0.49 |
chr8_111991906_111992412 | 1.80 |
Adat1 |
adenosine deaminase, tRNA-specific 1 |
143 |
0.94 |
chr11_74620608_74620783 | 1.79 |
Ccdc92b |
coiled-coil domain containing 92B |
1090 |
0.47 |
chr4_115071414_115071662 | 1.79 |
Tal1 |
T cell acute lymphocytic leukemia 1 |
12030 |
0.14 |
chrX_162888679_162888830 | 1.79 |
Syap1 |
synapse associated protein 1 |
307 |
0.83 |
chr14_103349231_103349394 | 1.79 |
Mycbp2 |
MYC binding protein 2, E3 ubiquitin protein ligase |
2498 |
0.32 |
chr15_9114613_9115328 | 1.78 |
Nadk2 |
NAD kinase 2, mitochondrial |
11982 |
0.18 |
chr13_46724791_46724942 | 1.78 |
Nup153 |
nucleoporin 153 |
3074 |
0.23 |
chr5_140034121_140034770 | 1.78 |
Gm43702 |
predicted gene 43702 |
2269 |
0.28 |
chr16_49773137_49773291 | 1.78 |
Gm15518 |
predicted gene 15518 |
25656 |
0.19 |
chr18_68196140_68196291 | 1.77 |
Gm18149 |
predicted gene, 18149 |
27248 |
0.16 |
chr6_122625404_122625555 | 1.77 |
Dppa3 |
developmental pluripotency-associated 3 |
931 |
0.43 |
chr4_6416264_6416419 | 1.77 |
Nsmaf |
neutral sphingomyelinase (N-SMase) activation associated factor |
7647 |
0.19 |
chr19_43453054_43453237 | 1.77 |
Gm47936 |
predicted gene, 47936 |
12685 |
0.13 |
chr16_17638547_17638739 | 1.76 |
Smpd4 |
sphingomyelin phosphodiesterase 4 |
56 |
0.95 |
chrX_169320661_169320812 | 1.76 |
Gm15246 |
predicted gene 15246 |
114 |
0.79 |
chr6_136857573_136857913 | 1.76 |
Art4 |
ADP-ribosyltransferase 4 |
10 |
0.95 |
chr6_72324229_72324418 | 1.76 |
Usp39 |
ubiquitin specific peptidase 39 |
9045 |
0.11 |
chr11_44512747_44512998 | 1.75 |
Rnf145 |
ring finger protein 145 |
6092 |
0.18 |
chr10_91169571_91169722 | 1.75 |
Tmpo |
thymopoietin |
816 |
0.59 |
chr1_23998505_23998704 | 1.75 |
Gm26524 |
predicted gene, 26524 |
6901 |
0.18 |
chr6_122339632_122340371 | 1.75 |
Phc1 |
polyhomeotic 1 |
223 |
0.9 |
chr2_36198075_36199103 | 1.75 |
Gm13429 |
predicted gene 13429 |
3725 |
0.15 |
chr13_14304202_14304378 | 1.75 |
Hecw1 |
HECT, C2 and WW domain containing E3 ubiquitin protein ligase 1 |
12876 |
0.22 |
chr9_67878503_67878797 | 1.74 |
Vps13c |
vacuolar protein sorting 13C |
38238 |
0.15 |
chr7_28977776_28977927 | 1.74 |
Eif3k |
eukaryotic translation initiation factor 3, subunit K |
3015 |
0.14 |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
1.7 | 5.0 | GO:0001543 | ovarian follicle rupture(GO:0001543) |
1.4 | 6.9 | GO:0071918 | urea transmembrane transport(GO:0071918) |
1.1 | 5.5 | GO:0032237 | activation of store-operated calcium channel activity(GO:0032237) |
1.0 | 3.0 | GO:0097051 | establishment of protein localization to endoplasmic reticulum membrane(GO:0097051) |
0.9 | 2.6 | GO:2000870 | regulation of progesterone secretion(GO:2000870) |
0.8 | 2.3 | GO:0045472 | response to ether(GO:0045472) |
0.7 | 2.2 | GO:0006059 | hexitol metabolic process(GO:0006059) |
0.6 | 1.9 | GO:0048388 | endosomal lumen acidification(GO:0048388) |
0.6 | 3.7 | GO:0090527 | actin filament reorganization(GO:0090527) |
0.6 | 1.8 | GO:1900060 | negative regulation of ceramide biosynthetic process(GO:1900060) |
0.6 | 1.8 | GO:0036151 | phosphatidylcholine acyl-chain remodeling(GO:0036151) |
0.6 | 1.8 | GO:0018879 | biphenyl metabolic process(GO:0018879) |
0.6 | 1.7 | GO:0034140 | negative regulation of toll-like receptor 3 signaling pathway(GO:0034140) |
0.5 | 2.1 | GO:0010510 | regulation of acetyl-CoA biosynthetic process from pyruvate(GO:0010510) |
0.5 | 1.5 | GO:0002025 | vasodilation by norepinephrine-epinephrine involved in regulation of systemic arterial blood pressure(GO:0002025) |
0.5 | 1.5 | GO:1902219 | intrinsic apoptotic signaling pathway in response to osmotic stress(GO:0008627) regulation of intrinsic apoptotic signaling pathway in response to osmotic stress(GO:1902218) negative regulation of intrinsic apoptotic signaling pathway in response to osmotic stress(GO:1902219) |
0.5 | 1.4 | GO:1903223 | positive regulation of oxidative stress-induced neuron death(GO:1903223) |
0.5 | 1.4 | GO:2000909 | regulation of cholesterol import(GO:0060620) regulation of sterol import(GO:2000909) |
0.4 | 2.2 | GO:0071698 | olfactory placode formation(GO:0030910) olfactory placode development(GO:0071698) olfactory placode morphogenesis(GO:0071699) |
0.4 | 1.3 | GO:0002314 | germinal center B cell differentiation(GO:0002314) |
0.4 | 1.3 | GO:0032910 | transforming growth factor beta3 production(GO:0032907) regulation of transforming growth factor beta3 production(GO:0032910) |
0.4 | 2.1 | GO:0072656 | maintenance of protein location in mitochondrion(GO:0072656) |
0.4 | 2.1 | GO:0071494 | cellular response to UV-C(GO:0071494) |
0.4 | 1.2 | GO:1903800 | positive regulation of production of miRNAs involved in gene silencing by miRNA(GO:1903800) |
0.4 | 1.9 | GO:0010032 | meiotic chromosome condensation(GO:0010032) |
0.4 | 1.2 | GO:0021553 | olfactory nerve development(GO:0021553) |
0.4 | 0.8 | GO:0042701 | progesterone secretion(GO:0042701) |
0.4 | 7.2 | GO:0046597 | negative regulation of viral entry into host cell(GO:0046597) |
0.4 | 0.8 | GO:0048208 | vesicle targeting, rough ER to cis-Golgi(GO:0048207) COPII vesicle coating(GO:0048208) |
0.4 | 1.4 | GO:0018343 | protein farnesylation(GO:0018343) |
0.4 | 1.1 | GO:0006556 | S-adenosylmethionine biosynthetic process(GO:0006556) |
0.4 | 1.1 | GO:1900169 | regulation of glucocorticoid mediated signaling pathway(GO:1900169) |
0.3 | 1.0 | GO:0031627 | telomeric loop formation(GO:0031627) |
0.3 | 2.8 | GO:0061032 | visceral serous pericardium development(GO:0061032) |
0.3 | 0.7 | GO:2000304 | positive regulation of sphingolipid biosynthetic process(GO:0090154) positive regulation of ceramide biosynthetic process(GO:2000304) |
0.3 | 0.7 | GO:0046061 | dATP catabolic process(GO:0046061) |
0.3 | 1.0 | GO:0032485 | regulation of Ral protein signal transduction(GO:0032485) |
0.3 | 1.0 | GO:0000087 | mitotic M phase(GO:0000087) |
0.3 | 0.3 | GO:0052422 | modulation of catalytic activity in other organism involved in symbiotic interaction(GO:0052203) modulation by host of symbiont catalytic activity(GO:0052422) |
0.3 | 0.9 | GO:0007525 | somatic muscle development(GO:0007525) |
0.3 | 0.9 | GO:1904217 | regulation of CDP-diacylglycerol-serine O-phosphatidyltransferase activity(GO:1904217) positive regulation of CDP-diacylglycerol-serine O-phosphatidyltransferase activity(GO:1904219) regulation of serine C-palmitoyltransferase activity(GO:1904220) positive regulation of serine C-palmitoyltransferase activity(GO:1904222) |
0.3 | 0.6 | GO:0070295 | renal water absorption(GO:0070295) |
0.3 | 0.9 | GO:0002309 | T cell proliferation involved in immune response(GO:0002309) |
0.3 | 1.8 | GO:0006685 | sphingomyelin catabolic process(GO:0006685) |
0.3 | 0.9 | GO:0008228 | opsonization(GO:0008228) |
0.3 | 2.1 | GO:1901970 | positive regulation of mitotic sister chromatid separation(GO:1901970) |
0.3 | 0.9 | GO:1901421 | positive regulation of response to alcohol(GO:1901421) |
0.3 | 1.5 | GO:0006824 | cobalt ion transport(GO:0006824) |
0.3 | 0.3 | GO:0043402 | glucocorticoid mediated signaling pathway(GO:0043402) |
0.3 | 1.1 | GO:0042780 | tRNA 3'-end processing(GO:0042780) |
0.3 | 1.7 | GO:1902035 | positive regulation of hematopoietic stem cell proliferation(GO:1902035) |
0.3 | 1.1 | GO:0038094 | Fc-gamma receptor signaling pathway(GO:0038094) |
0.3 | 0.8 | GO:2000325 | regulation of ligand-dependent nuclear receptor transcription coactivator activity(GO:2000325) positive regulation of ligand-dependent nuclear receptor transcription coactivator activity(GO:2000327) |
0.3 | 0.8 | GO:0015014 | heparan sulfate proteoglycan biosynthetic process, polysaccharide chain biosynthetic process(GO:0015014) |
0.3 | 1.3 | GO:0021764 | amygdala development(GO:0021764) |
0.3 | 0.8 | GO:0008050 | female courtship behavior(GO:0008050) |
0.3 | 0.8 | GO:1901078 | negative regulation of relaxation of muscle(GO:1901078) |
0.3 | 1.0 | GO:0070837 | dehydroascorbic acid transport(GO:0070837) |
0.3 | 1.0 | GO:0045053 | protein retention in Golgi apparatus(GO:0045053) |
0.3 | 1.0 | GO:0098910 | regulation of atrial cardiac muscle cell action potential(GO:0098910) |
0.3 | 0.8 | GO:1901536 | regulation of DNA demethylation(GO:1901535) negative regulation of DNA demethylation(GO:1901536) |
0.2 | 0.7 | GO:0006362 | transcription elongation from RNA polymerase I promoter(GO:0006362) |
0.2 | 0.7 | GO:0060375 | regulation of mast cell differentiation(GO:0060375) |
0.2 | 3.7 | GO:0031297 | replication fork processing(GO:0031297) |
0.2 | 0.5 | GO:0045876 | positive regulation of sister chromatid cohesion(GO:0045876) |
0.2 | 0.9 | GO:2000418 | positive regulation of eosinophil migration(GO:2000418) |
0.2 | 3.9 | GO:0097031 | NADH dehydrogenase complex assembly(GO:0010257) mitochondrial respiratory chain complex I assembly(GO:0032981) mitochondrial respiratory chain complex I biogenesis(GO:0097031) |
0.2 | 1.1 | GO:0015671 | oxygen transport(GO:0015671) |
0.2 | 0.9 | GO:1902897 | regulation of postsynaptic density protein 95 clustering(GO:1902897) |
0.2 | 0.7 | GO:0006741 | NADP biosynthetic process(GO:0006741) |
0.2 | 0.7 | GO:0032025 | response to cobalt ion(GO:0032025) |
0.2 | 0.4 | GO:0045347 | negative regulation of MHC class II biosynthetic process(GO:0045347) |
0.2 | 0.9 | GO:1901552 | positive regulation of endothelial cell development(GO:1901552) positive regulation of establishment of endothelial barrier(GO:1903142) |
0.2 | 0.9 | GO:0019230 | proprioception(GO:0019230) |
0.2 | 0.6 | GO:0038028 | insulin receptor signaling pathway via phosphatidylinositol 3-kinase(GO:0038028) |
0.2 | 1.1 | GO:0016139 | glycoside catabolic process(GO:0016139) |
0.2 | 2.5 | GO:0016558 | protein import into peroxisome matrix(GO:0016558) |
0.2 | 0.8 | GO:1905049 | negative regulation of metalloendopeptidase activity(GO:1904684) negative regulation of metallopeptidase activity(GO:1905049) |
0.2 | 0.8 | GO:0018406 | protein C-linked glycosylation(GO:0018103) peptidyl-tryptophan modification(GO:0018211) protein C-linked glycosylation via tryptophan(GO:0018317) protein C-linked glycosylation via 2'-alpha-mannosyl-L-tryptophan(GO:0018406) |
0.2 | 0.8 | GO:0045636 | positive regulation of melanocyte differentiation(GO:0045636) |
0.2 | 1.0 | GO:0018231 | peptidyl-L-cysteine S-palmitoylation(GO:0018230) peptidyl-S-diacylglycerol-L-cysteine biosynthetic process from peptidyl-cysteine(GO:0018231) |
0.2 | 2.3 | GO:0060211 | regulation of nuclear-transcribed mRNA poly(A) tail shortening(GO:0060211) positive regulation of nuclear-transcribed mRNA poly(A) tail shortening(GO:0060213) |
0.2 | 1.6 | GO:0043249 | erythrocyte maturation(GO:0043249) |
0.2 | 0.6 | GO:0006982 | response to lipid hydroperoxide(GO:0006982) |
0.2 | 0.6 | GO:0045658 | regulation of neutrophil differentiation(GO:0045658) |
0.2 | 0.2 | GO:0052055 | modulation by symbiont of host molecular function(GO:0052055) |
0.2 | 0.8 | GO:1903553 | positive regulation of extracellular exosome assembly(GO:1903553) |
0.2 | 0.6 | GO:0036444 | calcium ion transmembrane import into mitochondrion(GO:0036444) |
0.2 | 0.4 | GO:0034196 | acylglycerol transport(GO:0034196) triglyceride transport(GO:0034197) |
0.2 | 0.9 | GO:0051096 | positive regulation of helicase activity(GO:0051096) |
0.2 | 0.7 | GO:0046485 | ether lipid metabolic process(GO:0046485) |
0.2 | 0.6 | GO:0001920 | negative regulation of receptor recycling(GO:0001920) |
0.2 | 0.4 | GO:2001245 | regulation of phosphatidylcholine biosynthetic process(GO:2001245) |
0.2 | 0.4 | GO:0015691 | cadmium ion transport(GO:0015691) cadmium ion transmembrane transport(GO:0070574) |
0.2 | 0.7 | GO:0060126 | somatotropin secreting cell differentiation(GO:0060126) |
0.2 | 0.9 | GO:0010961 | cellular magnesium ion homeostasis(GO:0010961) |
0.2 | 0.7 | GO:0001905 | activation of membrane attack complex(GO:0001905) regulation of activation of membrane attack complex(GO:0001969) |
0.2 | 0.5 | GO:0021699 | cerebellar cortex maturation(GO:0021699) |
0.2 | 0.2 | GO:1901725 | regulation of histone deacetylase activity(GO:1901725) |
0.2 | 0.5 | GO:0071139 | resolution of recombination intermediates(GO:0071139) |
0.2 | 1.2 | GO:0070070 | proton-transporting V-type ATPase complex assembly(GO:0070070) |
0.2 | 0.7 | GO:0010989 | negative regulation of low-density lipoprotein particle clearance(GO:0010989) |
0.2 | 0.5 | GO:0035087 | siRNA loading onto RISC involved in RNA interference(GO:0035087) |
0.2 | 0.5 | GO:0072531 | pyrimidine-containing compound transmembrane transport(GO:0072531) |
0.2 | 0.7 | GO:0098535 | de novo centriole assembly(GO:0098535) |
0.2 | 0.7 | GO:2001013 | epithelial cell proliferation involved in renal tubule morphogenesis(GO:2001013) |
0.2 | 0.7 | GO:0070317 | negative regulation of G0 to G1 transition(GO:0070317) |
0.2 | 2.0 | GO:0002862 | negative regulation of inflammatory response to antigenic stimulus(GO:0002862) |
0.2 | 0.8 | GO:1902369 | negative regulation of RNA catabolic process(GO:1902369) |
0.2 | 0.6 | GO:0000480 | endonucleolytic cleavage in 5'-ETS of tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000480) |
0.2 | 1.4 | GO:0034393 | positive regulation of smooth muscle cell apoptotic process(GO:0034393) |
0.2 | 0.8 | GO:0015712 | hexose phosphate transport(GO:0015712) glucose-6-phosphate transport(GO:0015760) |
0.2 | 0.5 | GO:0036066 | protein O-linked fucosylation(GO:0036066) |
0.2 | 0.5 | GO:0070973 | protein localization to endoplasmic reticulum exit site(GO:0070973) |
0.2 | 0.2 | GO:0046060 | dATP metabolic process(GO:0046060) |
0.2 | 0.5 | GO:0090074 | negative regulation of protein homodimerization activity(GO:0090074) |
0.2 | 0.3 | GO:1990414 | replication-born double-strand break repair via sister chromatid exchange(GO:1990414) |
0.2 | 1.1 | GO:0010886 | positive regulation of cholesterol storage(GO:0010886) |
0.2 | 0.8 | GO:0009052 | pentose-phosphate shunt, non-oxidative branch(GO:0009052) |
0.2 | 0.6 | GO:0036265 | RNA (guanine-N7)-methylation(GO:0036265) |
0.2 | 0.5 | GO:2000048 | negative regulation of cell-cell adhesion mediated by cadherin(GO:2000048) |
0.2 | 0.2 | GO:0046499 | S-adenosylmethioninamine metabolic process(GO:0046499) |
0.2 | 1.2 | GO:0010388 | cullin deneddylation(GO:0010388) |
0.2 | 0.5 | GO:0015819 | lysine transport(GO:0015819) |
0.2 | 0.6 | GO:0002584 | negative regulation of antigen processing and presentation of peptide antigen(GO:0002584) |
0.2 | 1.5 | GO:0006054 | N-acetylneuraminate metabolic process(GO:0006054) |
0.2 | 1.5 | GO:0006534 | cysteine metabolic process(GO:0006534) |
0.2 | 0.6 | GO:0061113 | pancreas morphogenesis(GO:0061113) |
0.1 | 0.7 | GO:0044027 | hypermethylation of CpG island(GO:0044027) |
0.1 | 0.4 | GO:0031118 | rRNA pseudouridine synthesis(GO:0031118) |
0.1 | 2.2 | GO:0032011 | ARF protein signal transduction(GO:0032011) regulation of ARF protein signal transduction(GO:0032012) |
0.1 | 0.6 | GO:0051919 | positive regulation of fibrinolysis(GO:0051919) |
0.1 | 0.6 | GO:0070213 | protein auto-ADP-ribosylation(GO:0070213) |
0.1 | 0.1 | GO:0006987 | activation of signaling protein activity involved in unfolded protein response(GO:0006987) |
0.1 | 0.4 | GO:0010897 | negative regulation of triglyceride catabolic process(GO:0010897) |
0.1 | 0.6 | GO:0006787 | porphyrin-containing compound catabolic process(GO:0006787) tetrapyrrole catabolic process(GO:0033015) |
0.1 | 0.3 | GO:0034729 | histone H3-K79 methylation(GO:0034729) |
0.1 | 0.4 | GO:0038108 | negative regulation of appetite by leptin-mediated signaling pathway(GO:0038108) |
0.1 | 0.4 | GO:0006553 | lysine metabolic process(GO:0006553) |
0.1 | 0.4 | GO:0030920 | N-terminal peptidyl-serine acetylation(GO:0017198) N-terminal peptidyl-glutamic acid acetylation(GO:0018002) peptidyl-serine acetylation(GO:0030920) |
0.1 | 0.4 | GO:0051987 | positive regulation of attachment of spindle microtubules to kinetochore(GO:0051987) |
0.1 | 0.5 | GO:2000741 | positive regulation of mesenchymal stem cell differentiation(GO:2000741) |
0.1 | 0.7 | GO:0014744 | positive regulation of muscle adaptation(GO:0014744) |
0.1 | 0.3 | GO:0035754 | B cell chemotaxis(GO:0035754) |
0.1 | 0.4 | GO:1990705 | cholangiocyte proliferation(GO:1990705) |
0.1 | 0.3 | GO:2000566 | positive regulation of CD8-positive, alpha-beta T cell proliferation(GO:2000566) |
0.1 | 0.3 | GO:1901563 | response to camptothecin(GO:1901563) |
0.1 | 0.4 | GO:0035928 | rRNA import into mitochondrion(GO:0035928) |
0.1 | 0.5 | GO:0070475 | rRNA base methylation(GO:0070475) |
0.1 | 0.4 | GO:0009804 | coumarin metabolic process(GO:0009804) |
0.1 | 0.5 | GO:0070885 | negative regulation of calcineurin-NFAT signaling cascade(GO:0070885) |
0.1 | 1.2 | GO:0006977 | DNA damage response, signal transduction by p53 class mediator resulting in cell cycle arrest(GO:0006977) |
0.1 | 0.3 | GO:0097252 | oligodendrocyte apoptotic process(GO:0097252) |
0.1 | 0.4 | GO:0032512 | regulation of protein phosphatase type 2B activity(GO:0032512) |
0.1 | 0.5 | GO:0051451 | myoblast migration(GO:0051451) |
0.1 | 0.9 | GO:0030718 | germ-line stem cell population maintenance(GO:0030718) |
0.1 | 0.5 | GO:0001887 | selenium compound metabolic process(GO:0001887) |
0.1 | 0.4 | GO:0030397 | membrane disassembly(GO:0030397) nuclear envelope disassembly(GO:0051081) |
0.1 | 0.6 | GO:0006348 | chromatin silencing at telomere(GO:0006348) |
0.1 | 0.5 | GO:2000659 | regulation of interleukin-1-mediated signaling pathway(GO:2000659) |
0.1 | 0.1 | GO:0044026 | DNA hypermethylation(GO:0044026) |
0.1 | 0.5 | GO:0006499 | N-terminal protein myristoylation(GO:0006499) |
0.1 | 1.3 | GO:1990440 | positive regulation of transcription from RNA polymerase II promoter in response to endoplasmic reticulum stress(GO:1990440) |
0.1 | 0.1 | GO:1900157 | regulation of bone mineralization involved in bone maturation(GO:1900157) |
0.1 | 0.2 | GO:0046208 | spermine catabolic process(GO:0046208) |
0.1 | 0.4 | GO:2000504 | positive regulation of blood vessel remodeling(GO:2000504) |
0.1 | 0.5 | GO:0070126 | mitochondrial translational termination(GO:0070126) |
0.1 | 1.0 | GO:1902902 | negative regulation of autophagosome assembly(GO:1902902) |
0.1 | 0.4 | GO:1900186 | negative regulation of clathrin-mediated endocytosis(GO:1900186) |
0.1 | 0.6 | GO:0071073 | positive regulation of phospholipid biosynthetic process(GO:0071073) |
0.1 | 0.1 | GO:0097466 | glycoprotein ERAD pathway(GO:0097466) response to glycoprotein(GO:1904587) |
0.1 | 0.2 | GO:0097118 | neuroligin clustering involved in postsynaptic membrane assembly(GO:0097118) |
0.1 | 0.2 | GO:0045963 | negative regulation of catecholamine metabolic process(GO:0045914) negative regulation of dopamine metabolic process(GO:0045963) |
0.1 | 1.1 | GO:0043116 | negative regulation of vascular permeability(GO:0043116) |
0.1 | 0.4 | GO:0006868 | glutamine transport(GO:0006868) |
0.1 | 1.2 | GO:0070257 | positive regulation of mucus secretion(GO:0070257) |
0.1 | 0.5 | GO:0072383 | plus-end-directed vesicle transport along microtubule(GO:0072383) plus-end-directed organelle transport along microtubule(GO:0072386) |
0.1 | 0.6 | GO:0030174 | regulation of DNA-dependent DNA replication initiation(GO:0030174) |
0.1 | 1.2 | GO:0001731 | formation of translation preinitiation complex(GO:0001731) |
0.1 | 0.3 | GO:0006481 | C-terminal protein methylation(GO:0006481) |
0.1 | 0.5 | GO:0016080 | synaptic vesicle targeting(GO:0016080) |
0.1 | 0.6 | GO:0015886 | heme transport(GO:0015886) |
0.1 | 0.7 | GO:1901660 | calcium ion export(GO:1901660) |
0.1 | 0.6 | GO:1900016 | negative regulation of cytokine production involved in inflammatory response(GO:1900016) |
0.1 | 0.3 | GO:0044828 | negative regulation by host of viral genome replication(GO:0044828) |
0.1 | 0.3 | GO:0006420 | arginyl-tRNA aminoacylation(GO:0006420) |
0.1 | 0.2 | GO:1902956 | regulation of mitochondrial electron transport, NADH to ubiquinone(GO:1902956) |
0.1 | 0.8 | GO:0052697 | xenobiotic glucuronidation(GO:0052697) |
0.1 | 2.0 | GO:0006301 | postreplication repair(GO:0006301) |
0.1 | 0.6 | GO:0006686 | sphingomyelin biosynthetic process(GO:0006686) |
0.1 | 0.3 | GO:0006624 | vacuolar protein processing(GO:0006624) |
0.1 | 0.2 | GO:0033159 | negative regulation of protein import into nucleus, translocation(GO:0033159) |
0.1 | 0.8 | GO:0097320 | membrane tubulation(GO:0097320) |
0.1 | 0.4 | GO:0051315 | attachment of mitotic spindle microtubules to kinetochore(GO:0051315) |
0.1 | 0.6 | GO:0009446 | putrescine biosynthetic process(GO:0009446) |
0.1 | 1.7 | GO:0052646 | alditol phosphate metabolic process(GO:0052646) |
0.1 | 0.1 | GO:0043928 | exonucleolytic nuclear-transcribed mRNA catabolic process involved in deadenylation-dependent decay(GO:0043928) |
0.1 | 0.4 | GO:0000972 | transcription-dependent tethering of RNA polymerase II gene DNA at nuclear periphery(GO:0000972) |
0.1 | 0.4 | GO:0043353 | enucleate erythrocyte differentiation(GO:0043353) |
0.1 | 0.4 | GO:0008594 | photoreceptor cell morphogenesis(GO:0008594) |
0.1 | 0.2 | GO:0048239 | negative regulation of DNA recombination at telomere(GO:0048239) regulation of DNA recombination at telomere(GO:0072695) |
0.1 | 3.4 | GO:0043631 | mRNA polyadenylation(GO:0006378) RNA polyadenylation(GO:0043631) |
0.1 | 0.2 | GO:0014891 | skeletal muscle atrophy(GO:0014732) striated muscle atrophy(GO:0014891) |
0.1 | 4.3 | GO:0000245 | spliceosomal complex assembly(GO:0000245) |
0.1 | 0.2 | GO:0003130 | BMP signaling pathway involved in heart induction(GO:0003130) endodermal-mesodermal cell signaling(GO:0003133) endodermal-mesodermal cell signaling involved in heart induction(GO:0003134) |
0.1 | 0.2 | GO:0061511 | centriole elongation(GO:0061511) |
0.1 | 0.4 | GO:0034080 | CENP-A containing nucleosome assembly(GO:0034080) CENP-A containing chromatin organization(GO:0061641) |
0.1 | 0.8 | GO:0070493 | thrombin receptor signaling pathway(GO:0070493) |
0.1 | 0.5 | GO:0001672 | regulation of chromatin assembly or disassembly(GO:0001672) |
0.1 | 0.2 | GO:0046340 | diacylglycerol catabolic process(GO:0046340) |
0.1 | 0.1 | GO:0046271 | phenylpropanoid catabolic process(GO:0046271) |
0.1 | 0.6 | GO:0006307 | DNA dealkylation involved in DNA repair(GO:0006307) |
0.1 | 0.9 | GO:0046606 | negative regulation of centrosome duplication(GO:0010826) negative regulation of centrosome cycle(GO:0046606) |
0.1 | 0.2 | GO:0018171 | peptidyl-cysteine oxidation(GO:0018171) |
0.1 | 0.7 | GO:0007076 | mitotic chromosome condensation(GO:0007076) |
0.1 | 1.0 | GO:0009396 | folic acid-containing compound biosynthetic process(GO:0009396) |
0.1 | 0.3 | GO:0098795 | mRNA cleavage involved in gene silencing by miRNA(GO:0035279) mRNA cleavage involved in gene silencing(GO:0098795) |
0.1 | 0.8 | GO:0032119 | sequestering of zinc ion(GO:0032119) regulation of sequestering of zinc ion(GO:0061088) |
0.1 | 0.9 | GO:0006677 | glycosylceramide metabolic process(GO:0006677) |
0.1 | 0.8 | GO:0090311 | regulation of protein deacetylation(GO:0090311) |
0.1 | 0.4 | GO:0050862 | positive regulation of T cell receptor signaling pathway(GO:0050862) |
0.1 | 0.3 | GO:0015705 | iodide transport(GO:0015705) |
0.1 | 0.4 | GO:0009138 | pyrimidine nucleoside diphosphate metabolic process(GO:0009138) |
0.1 | 0.2 | GO:0001827 | inner cell mass cell fate commitment(GO:0001827) |
0.1 | 0.4 | GO:1904469 | positive regulation of tumor necrosis factor secretion(GO:1904469) |
0.1 | 0.1 | GO:0001547 | antral ovarian follicle growth(GO:0001547) |
0.1 | 0.3 | GO:0032489 | regulation of Cdc42 protein signal transduction(GO:0032489) |
0.1 | 0.9 | GO:0006047 | UDP-N-acetylglucosamine metabolic process(GO:0006047) |
0.1 | 0.3 | GO:0060066 | oviduct development(GO:0060066) |
0.1 | 0.8 | GO:0034145 | positive regulation of toll-like receptor 4 signaling pathway(GO:0034145) |
0.1 | 0.4 | GO:0034433 | steroid esterification(GO:0034433) sterol esterification(GO:0034434) cholesterol esterification(GO:0034435) |
0.1 | 0.3 | GO:1903525 | regulation of membrane tubulation(GO:1903525) |
0.1 | 0.3 | GO:0008054 | negative regulation of cyclin-dependent protein serine/threonine kinase by cyclin degradation(GO:0008054) |
0.1 | 0.6 | GO:0044829 | positive regulation by host of viral genome replication(GO:0044829) |
0.1 | 2.2 | GO:0000387 | spliceosomal snRNP assembly(GO:0000387) |
0.1 | 0.3 | GO:1903999 | negative regulation of eating behavior(GO:1903999) |
0.1 | 2.1 | GO:0006308 | DNA catabolic process(GO:0006308) |
0.1 | 0.2 | GO:0051610 | serotonin uptake(GO:0051610) |
0.1 | 0.5 | GO:0009133 | nucleoside diphosphate biosynthetic process(GO:0009133) |
0.1 | 0.2 | GO:1902174 | positive regulation of keratinocyte apoptotic process(GO:1902174) |
0.1 | 0.2 | GO:2000169 | regulation of peptidyl-cysteine S-nitrosylation(GO:2000169) |
0.1 | 0.4 | GO:1900227 | positive regulation of NLRP3 inflammasome complex assembly(GO:1900227) |
0.1 | 2.0 | GO:0046854 | phosphatidylinositol phosphorylation(GO:0046854) |
0.1 | 0.3 | GO:0034473 | U1 snRNA 3'-end processing(GO:0034473) U5 snRNA 3'-end processing(GO:0034476) |
0.1 | 0.7 | GO:0035269 | protein O-linked mannosylation(GO:0035269) |
0.1 | 2.8 | GO:0043044 | ATP-dependent chromatin remodeling(GO:0043044) |
0.1 | 0.1 | GO:0061724 | lipophagy(GO:0061724) |
0.1 | 0.8 | GO:0051383 | kinetochore organization(GO:0051383) |
0.1 | 2.3 | GO:0032008 | positive regulation of TOR signaling(GO:0032008) |
0.1 | 0.3 | GO:1900095 | regulation of dosage compensation by inactivation of X chromosome(GO:1900095) |
0.1 | 0.4 | GO:0032227 | negative regulation of synaptic transmission, dopaminergic(GO:0032227) |
0.1 | 0.4 | GO:0030263 | apoptotic chromosome condensation(GO:0030263) |
0.1 | 0.8 | GO:0006656 | phosphatidylcholine biosynthetic process(GO:0006656) |
0.1 | 1.5 | GO:0090312 | positive regulation of protein deacetylation(GO:0090312) |
0.1 | 0.1 | GO:1990000 | amyloid fibril formation(GO:1990000) |
0.1 | 0.2 | GO:0048936 | peripheral nervous system neuron axonogenesis(GO:0048936) |
0.1 | 0.9 | GO:0043923 | positive regulation by host of viral transcription(GO:0043923) |
0.1 | 0.2 | GO:0042117 | monocyte activation(GO:0042117) |
0.1 | 0.6 | GO:0032534 | regulation of microvillus assembly(GO:0032534) |
0.1 | 0.4 | GO:1900103 | positive regulation of endoplasmic reticulum unfolded protein response(GO:1900103) |
0.1 | 0.4 | GO:0072321 | chaperone-mediated protein transport(GO:0072321) |
0.1 | 1.6 | GO:0006471 | protein ADP-ribosylation(GO:0006471) |
0.1 | 1.0 | GO:0042407 | cristae formation(GO:0042407) |
0.1 | 0.6 | GO:1902221 | L-phenylalanine metabolic process(GO:0006558) erythrose 4-phosphate/phosphoenolpyruvate family amino acid metabolic process(GO:1902221) |
0.1 | 0.6 | GO:0033601 | positive regulation of mammary gland epithelial cell proliferation(GO:0033601) |
0.1 | 1.1 | GO:0034377 | plasma lipoprotein particle assembly(GO:0034377) |
0.1 | 0.3 | GO:0071712 | ER-associated misfolded protein catabolic process(GO:0071712) |
0.1 | 0.4 | GO:0048312 | intracellular distribution of mitochondria(GO:0048312) |
0.1 | 0.8 | GO:0021819 | layer formation in cerebral cortex(GO:0021819) |
0.1 | 0.6 | GO:2000480 | negative regulation of cAMP-dependent protein kinase activity(GO:2000480) |
0.1 | 0.5 | GO:0021999 | neural plate anterior/posterior regionalization(GO:0021999) |
0.1 | 0.3 | GO:0046909 | intermembrane transport(GO:0046909) |
0.1 | 0.6 | GO:0006271 | DNA strand elongation involved in DNA replication(GO:0006271) |
0.1 | 0.3 | GO:0006543 | glutamine catabolic process(GO:0006543) |
0.1 | 0.3 | GO:0061368 | behavioral response to chemical pain(GO:0061366) behavioral response to formalin induced pain(GO:0061368) |
0.1 | 0.1 | GO:0010912 | regulation of isomerase activity(GO:0010911) positive regulation of isomerase activity(GO:0010912) |
0.1 | 2.2 | GO:0006778 | porphyrin-containing compound metabolic process(GO:0006778) |
0.1 | 0.3 | GO:0090168 | Golgi reassembly(GO:0090168) |
0.1 | 0.2 | GO:0033615 | mitochondrial proton-transporting ATP synthase complex assembly(GO:0033615) |
0.1 | 0.4 | GO:1902916 | positive regulation of protein polyubiquitination(GO:1902916) |
0.1 | 0.2 | GO:1903421 | regulation of synaptic vesicle recycling(GO:1903421) |
0.1 | 0.3 | GO:0033600 | negative regulation of mammary gland epithelial cell proliferation(GO:0033600) |
0.1 | 0.8 | GO:0051044 | positive regulation of membrane protein ectodomain proteolysis(GO:0051044) |
0.1 | 0.3 | GO:2000017 | positive regulation of determination of dorsal identity(GO:2000017) |
0.1 | 1.3 | GO:0030728 | ovulation(GO:0030728) |
0.1 | 0.3 | GO:0031848 | protection from non-homologous end joining at telomere(GO:0031848) |
0.1 | 0.2 | GO:0002322 | B cell proliferation involved in immune response(GO:0002322) |
0.1 | 0.2 | GO:1903026 | negative regulation of RNA polymerase II regulatory region sequence-specific DNA binding(GO:1903026) |
0.1 | 0.5 | GO:1900038 | negative regulation of cellular response to hypoxia(GO:1900038) |
0.1 | 0.2 | GO:0046066 | purine deoxyribonucleoside diphosphate metabolic process(GO:0009182) dGDP metabolic process(GO:0046066) |
0.1 | 0.7 | GO:2000369 | regulation of clathrin-mediated endocytosis(GO:2000369) |
0.1 | 0.2 | GO:0071879 | positive regulation of adrenergic receptor signaling pathway(GO:0071879) |
0.1 | 0.2 | GO:0002430 | complement receptor mediated signaling pathway(GO:0002430) |
0.1 | 0.2 | GO:0061623 | galactose catabolic process via UDP-galactose(GO:0033499) glycolytic process from galactose(GO:0061623) |
0.1 | 0.2 | GO:0043152 | induction of bacterial agglutination(GO:0043152) |
0.1 | 0.2 | GO:0021538 | epithalamus development(GO:0021538) habenula development(GO:0021986) |
0.1 | 2.9 | GO:0016126 | sterol biosynthetic process(GO:0016126) |
0.1 | 0.7 | GO:1904153 | negative regulation of protein exit from endoplasmic reticulum(GO:0070862) negative regulation of retrograde protein transport, ER to cytosol(GO:1904153) |
0.1 | 0.4 | GO:0090073 | positive regulation of protein homodimerization activity(GO:0090073) |
0.1 | 0.6 | GO:0000478 | endonucleolytic cleavage involved in rRNA processing(GO:0000478) |
0.1 | 1.1 | GO:0043968 | histone H2A acetylation(GO:0043968) |
0.1 | 1.0 | GO:0048488 | synaptic vesicle endocytosis(GO:0048488) |
0.1 | 0.7 | GO:0032968 | positive regulation of transcription elongation from RNA polymerase II promoter(GO:0032968) |
0.1 | 0.1 | GO:0035905 | ascending aorta development(GO:0035905) ascending aorta morphogenesis(GO:0035910) |
0.1 | 0.2 | GO:0010727 | negative regulation of hydrogen peroxide metabolic process(GO:0010727) |
0.1 | 0.2 | GO:0035633 | maintenance of blood-brain barrier(GO:0035633) |
0.1 | 0.7 | GO:2000188 | regulation of cholesterol homeostasis(GO:2000188) |
0.1 | 0.5 | GO:0006104 | succinyl-CoA metabolic process(GO:0006104) |
0.1 | 0.3 | GO:0033210 | leptin-mediated signaling pathway(GO:0033210) |
0.1 | 0.3 | GO:0022007 | neural plate elongation(GO:0014022) convergent extension involved in neural plate elongation(GO:0022007) |
0.1 | 0.2 | GO:0042997 | negative regulation of Golgi to plasma membrane protein transport(GO:0042997) |
0.1 | 0.2 | GO:1903147 | negative regulation of mitophagy(GO:1903147) |
0.1 | 1.0 | GO:0010569 | regulation of double-strand break repair via homologous recombination(GO:0010569) |
0.1 | 0.2 | GO:1903352 | ornithine transport(GO:0015822) L-ornithine transmembrane transport(GO:1903352) |
0.1 | 0.2 | GO:0001692 | histamine metabolic process(GO:0001692) |
0.1 | 0.6 | GO:0006903 | vesicle targeting(GO:0006903) |
0.1 | 0.2 | GO:0035771 | interleukin-4-mediated signaling pathway(GO:0035771) |
0.1 | 0.2 | GO:0015919 | peroxisomal membrane transport(GO:0015919) protein import into peroxisome membrane(GO:0045046) |
0.1 | 0.3 | GO:0035405 | histone-threonine phosphorylation(GO:0035405) |
0.1 | 0.1 | GO:0060112 | generation of ovulation cycle rhythm(GO:0060112) |
0.1 | 0.2 | GO:0046726 | positive regulation by virus of viral protein levels in host cell(GO:0046726) |
0.1 | 0.3 | GO:0015722 | canalicular bile acid transport(GO:0015722) |
0.1 | 0.5 | GO:0070995 | NADPH oxidation(GO:0070995) |
0.1 | 0.2 | GO:0043570 | maintenance of DNA repeat elements(GO:0043570) |
0.1 | 0.2 | GO:0001732 | formation of cytoplasmic translation initiation complex(GO:0001732) |
0.1 | 0.3 | GO:0034975 | protein folding in endoplasmic reticulum(GO:0034975) |
0.1 | 0.6 | GO:0000394 | RNA splicing, via endonucleolytic cleavage and ligation(GO:0000394) tRNA splicing, via endonucleolytic cleavage and ligation(GO:0006388) |
0.1 | 0.7 | GO:0051770 | positive regulation of nitric-oxide synthase biosynthetic process(GO:0051770) |
0.1 | 0.8 | GO:0006743 | ubiquinone metabolic process(GO:0006743) ubiquinone biosynthetic process(GO:0006744) |
0.1 | 0.2 | GO:0030242 | pexophagy(GO:0030242) |
0.1 | 0.3 | GO:0051031 | tRNA transport(GO:0051031) |
0.1 | 0.1 | GO:1903334 | positive regulation of protein folding(GO:1903334) |
0.1 | 0.5 | GO:0034498 | early endosome to Golgi transport(GO:0034498) |
0.1 | 0.4 | GO:0070389 | chaperone cofactor-dependent protein refolding(GO:0070389) |
0.1 | 0.3 | GO:0061635 | regulation of protein complex stability(GO:0061635) |
0.1 | 0.5 | GO:0033299 | secretion of lysosomal enzymes(GO:0033299) |
0.1 | 0.1 | GO:0071898 | regulation of estrogen receptor binding(GO:0071898) negative regulation of estrogen receptor binding(GO:0071899) |
0.1 | 0.1 | GO:0060164 | regulation of timing of neuron differentiation(GO:0060164) |
0.1 | 0.6 | GO:0008608 | attachment of spindle microtubules to kinetochore(GO:0008608) |
0.1 | 0.4 | GO:0045591 | positive regulation of regulatory T cell differentiation(GO:0045591) |
0.1 | 0.1 | GO:0002577 | regulation of antigen processing and presentation(GO:0002577) |
0.1 | 0.5 | GO:0090502 | RNA phosphodiester bond hydrolysis, endonucleolytic(GO:0090502) |
0.1 | 0.4 | GO:0033004 | negative regulation of mast cell activation(GO:0033004) |
0.1 | 0.1 | GO:0014057 | positive regulation of acetylcholine secretion, neurotransmission(GO:0014057) |
0.1 | 0.6 | GO:0015721 | bile acid and bile salt transport(GO:0015721) |
0.1 | 1.1 | GO:0031954 | positive regulation of protein autophosphorylation(GO:0031954) |
0.1 | 0.1 | GO:0035359 | negative regulation of peroxisome proliferator activated receptor signaling pathway(GO:0035359) |
0.1 | 0.2 | GO:1902683 | regulation of receptor localization to synapse(GO:1902683) |
0.1 | 0.1 | GO:1903347 | negative regulation of bicellular tight junction assembly(GO:1903347) |
0.1 | 0.6 | GO:0051292 | nuclear pore complex assembly(GO:0051292) |
0.1 | 2.0 | GO:0000184 | nuclear-transcribed mRNA catabolic process, nonsense-mediated decay(GO:0000184) |
0.1 | 0.1 | GO:2000097 | regulation of smooth muscle cell-matrix adhesion(GO:2000097) |
0.1 | 0.3 | GO:0045717 | negative regulation of fatty acid biosynthetic process(GO:0045717) |
0.1 | 0.6 | GO:0042535 | positive regulation of tumor necrosis factor biosynthetic process(GO:0042535) |
0.1 | 0.1 | GO:0007354 | zygotic determination of anterior/posterior axis, embryo(GO:0007354) |
0.1 | 0.2 | GO:0046951 | ketone body biosynthetic process(GO:0046951) |
0.1 | 0.7 | GO:0035337 | fatty-acyl-CoA metabolic process(GO:0035337) |
0.1 | 0.9 | GO:0030859 | polarized epithelial cell differentiation(GO:0030859) |
0.1 | 0.5 | GO:0051657 | maintenance of organelle location(GO:0051657) |
0.1 | 0.4 | GO:2000096 | positive regulation of Wnt signaling pathway, planar cell polarity pathway(GO:2000096) |
0.1 | 0.2 | GO:0043328 | late endosome to vacuole transport via multivesicular body sorting pathway(GO:0032511) protein targeting to vacuole involved in ubiquitin-dependent protein catabolic process via the multivesicular body sorting pathway(GO:0043328) |
0.1 | 0.3 | GO:0036465 | synaptic vesicle recycling(GO:0036465) |
0.1 | 0.1 | GO:0071651 | positive regulation of chemokine (C-C motif) ligand 5 production(GO:0071651) |
0.1 | 1.1 | GO:0030488 | tRNA methylation(GO:0030488) |
0.1 | 0.4 | GO:0033194 | response to hydroperoxide(GO:0033194) |
0.1 | 0.2 | GO:0090071 | negative regulation of ribosome biogenesis(GO:0090071) |
0.1 | 0.1 | GO:0022615 | protein to membrane docking(GO:0022615) |
0.1 | 0.9 | GO:0032469 | endoplasmic reticulum calcium ion homeostasis(GO:0032469) |
0.1 | 0.3 | GO:0045006 | DNA deamination(GO:0045006) |
0.1 | 0.6 | GO:0000042 | protein targeting to Golgi(GO:0000042) |
0.1 | 0.1 | GO:1900041 | negative regulation of interleukin-2 secretion(GO:1900041) |
0.1 | 0.2 | GO:0042138 | meiotic DNA double-strand break formation(GO:0042138) |
0.1 | 0.3 | GO:0010452 | histone H3-K36 methylation(GO:0010452) |
0.1 | 0.2 | GO:0050859 | negative regulation of B cell receptor signaling pathway(GO:0050859) |
0.1 | 0.5 | GO:0031145 | anaphase-promoting complex-dependent catabolic process(GO:0031145) |
0.1 | 1.0 | GO:1901741 | positive regulation of myoblast fusion(GO:1901741) |
0.1 | 0.1 | GO:0008065 | establishment of blood-nerve barrier(GO:0008065) |
0.1 | 0.1 | GO:1903237 | negative regulation of leukocyte tethering or rolling(GO:1903237) |
0.1 | 0.1 | GO:0000237 | leptotene(GO:0000237) |
0.1 | 0.3 | GO:0031125 | rRNA 3'-end processing(GO:0031125) |
0.1 | 0.4 | GO:1902031 | regulation of NADP metabolic process(GO:1902031) |
0.1 | 0.3 | GO:0051574 | positive regulation of histone H3-K9 methylation(GO:0051574) |
0.1 | 0.1 | GO:0090289 | regulation of osteoclast proliferation(GO:0090289) positive regulation of osteoclast proliferation(GO:0090290) |
0.1 | 0.1 | GO:1903599 | positive regulation of mitophagy(GO:1903599) |
0.1 | 0.2 | GO:1900151 | regulation of nuclear-transcribed mRNA catabolic process, deadenylation-dependent decay(GO:1900151) positive regulation of nuclear-transcribed mRNA catabolic process, deadenylation-dependent decay(GO:1900153) |
0.1 | 1.1 | GO:0006883 | cellular sodium ion homeostasis(GO:0006883) |
0.1 | 0.1 | GO:0032202 | telomere assembly(GO:0032202) |
0.1 | 0.4 | GO:0045647 | negative regulation of erythrocyte differentiation(GO:0045647) |
0.1 | 0.1 | GO:0042738 | exogenous drug catabolic process(GO:0042738) |
0.1 | 0.4 | GO:0030854 | positive regulation of granulocyte differentiation(GO:0030854) |
0.1 | 0.3 | GO:0051697 | protein delipidation(GO:0051697) |
0.1 | 0.4 | GO:0006384 | transcription initiation from RNA polymerase III promoter(GO:0006384) |
0.1 | 0.1 | GO:0007096 | regulation of exit from mitosis(GO:0007096) |
0.1 | 0.1 | GO:1904667 | negative regulation of ubiquitin protein ligase activity(GO:1904667) |
0.1 | 0.2 | GO:1990592 | protein polyufmylation(GO:1990564) protein K69-linked ufmylation(GO:1990592) |
0.1 | 0.2 | GO:0006620 | posttranslational protein targeting to membrane(GO:0006620) |
0.1 | 1.5 | GO:0030195 | negative regulation of blood coagulation(GO:0030195) negative regulation of hemostasis(GO:1900047) |
0.1 | 0.1 | GO:0090231 | regulation of spindle checkpoint(GO:0090231) |
0.1 | 0.5 | GO:0046929 | negative regulation of neurotransmitter secretion(GO:0046929) |
0.1 | 0.2 | GO:0046959 | habituation(GO:0046959) |
0.1 | 0.2 | GO:0097012 | cellular response to granulocyte macrophage colony-stimulating factor stimulus(GO:0097011) response to granulocyte macrophage colony-stimulating factor(GO:0097012) |
0.1 | 0.2 | GO:1990168 | protein K29-linked deubiquitination(GO:0035523) protein K33-linked deubiquitination(GO:1990168) |
0.1 | 0.1 | GO:0072718 | response to cisplatin(GO:0072718) |
0.1 | 0.1 | GO:0001555 | oocyte growth(GO:0001555) |
0.1 | 0.4 | GO:0007252 | I-kappaB phosphorylation(GO:0007252) |
0.1 | 3.6 | GO:0008033 | tRNA processing(GO:0008033) |
0.1 | 0.2 | GO:0010606 | positive regulation of cytoplasmic mRNA processing body assembly(GO:0010606) |
0.1 | 1.5 | GO:0032467 | positive regulation of cytokinesis(GO:0032467) |
0.1 | 0.2 | GO:0006207 | 'de novo' pyrimidine nucleobase biosynthetic process(GO:0006207) pyrimidine nucleobase biosynthetic process(GO:0019856) |
0.1 | 0.1 | GO:1902896 | terminal web assembly(GO:1902896) |
0.1 | 0.1 | GO:0014722 | regulation of skeletal muscle contraction by calcium ion signaling(GO:0014722) |
0.1 | 0.8 | GO:0030261 | chromosome condensation(GO:0030261) |
0.1 | 0.1 | GO:0061083 | regulation of protein refolding(GO:0061083) negative regulation of protein refolding(GO:0061084) |
0.1 | 0.3 | GO:0009226 | nucleotide-sugar biosynthetic process(GO:0009226) |
0.1 | 0.5 | GO:0070886 | positive regulation of calcineurin-NFAT signaling cascade(GO:0070886) |
0.1 | 0.6 | GO:0072512 | ferric iron transport(GO:0015682) trivalent inorganic cation transport(GO:0072512) |
0.1 | 0.2 | GO:0032911 | negative regulation of transforming growth factor beta1 production(GO:0032911) |
0.1 | 0.3 | GO:0060020 | Bergmann glial cell differentiation(GO:0060020) |
0.1 | 0.2 | GO:0007161 | calcium-independent cell-matrix adhesion(GO:0007161) |
0.1 | 0.6 | GO:0035493 | SNARE complex assembly(GO:0035493) |
0.1 | 0.6 | GO:0048149 | behavioral response to ethanol(GO:0048149) |
0.1 | 0.3 | GO:0051415 | interphase microtubule nucleation by interphase microtubule organizing center(GO:0051415) microtubule nucleation by microtubule organizing center(GO:0051418) |
0.1 | 0.7 | GO:0048026 | positive regulation of mRNA splicing, via spliceosome(GO:0048026) |
0.1 | 0.1 | GO:2000809 | positive regulation of synaptic vesicle clustering(GO:2000809) |
0.1 | 0.3 | GO:0048148 | behavioral response to cocaine(GO:0048148) |
0.1 | 0.2 | GO:0006083 | acetate metabolic process(GO:0006083) |
0.1 | 0.3 | GO:0035855 | megakaryocyte development(GO:0035855) |
0.1 | 0.4 | GO:0018344 | protein geranylgeranylation(GO:0018344) |
0.1 | 0.2 | GO:0032786 | positive regulation of DNA-templated transcription, elongation(GO:0032786) |
0.1 | 0.1 | GO:0042524 | negative regulation of tyrosine phosphorylation of Stat5 protein(GO:0042524) |
0.1 | 0.1 | GO:2000321 | positive regulation of T-helper 17 cell differentiation(GO:2000321) |
0.1 | 1.3 | GO:0006099 | tricarboxylic acid cycle(GO:0006099) |
0.1 | 0.1 | GO:0097119 | postsynaptic density protein 95 clustering(GO:0097119) |
0.1 | 0.1 | GO:2000259 | positive regulation of complement activation(GO:0045917) positive regulation of protein activation cascade(GO:2000259) |
0.1 | 0.1 | GO:0006269 | DNA replication, synthesis of RNA primer(GO:0006269) |
0.1 | 0.3 | GO:0060267 | positive regulation of respiratory burst(GO:0060267) |
0.1 | 0.1 | GO:0045901 | positive regulation of translational elongation(GO:0045901) |
0.1 | 0.2 | GO:1900165 | negative regulation of interleukin-6 secretion(GO:1900165) |
0.1 | 0.3 | GO:0051901 | positive regulation of mitochondrial depolarization(GO:0051901) |
0.1 | 0.5 | GO:0030206 | chondroitin sulfate biosynthetic process(GO:0030206) |
0.1 | 0.2 | GO:0002215 | defense response to nematode(GO:0002215) |
0.1 | 0.4 | GO:0035735 | intraciliary transport involved in cilium morphogenesis(GO:0035735) |
0.1 | 0.2 | GO:0090385 | phagosome-lysosome fusion(GO:0090385) |
0.1 | 0.1 | GO:0014045 | establishment of endothelial blood-brain barrier(GO:0014045) |
0.1 | 0.6 | GO:0006614 | SRP-dependent cotranslational protein targeting to membrane(GO:0006614) |
0.1 | 0.1 | GO:1900106 | hyaluranon cable assembly(GO:0036118) regulation of hyaluranon cable assembly(GO:1900104) positive regulation of hyaluranon cable assembly(GO:1900106) |
0.1 | 0.1 | GO:0071883 | activation of MAPK activity by adrenergic receptor signaling pathway(GO:0071883) |
0.1 | 0.1 | GO:0015889 | cobalamin transport(GO:0015889) |
0.1 | 0.2 | GO:0010694 | positive regulation of alkaline phosphatase activity(GO:0010694) |
0.1 | 0.3 | GO:0032020 | ISG15-protein conjugation(GO:0032020) |
0.1 | 0.2 | GO:0031581 | hemidesmosome assembly(GO:0031581) |
0.1 | 0.4 | GO:0072502 | cellular phosphate ion homeostasis(GO:0030643) cellular trivalent inorganic anion homeostasis(GO:0072502) |
0.1 | 0.1 | GO:1904378 | maintenance of unfolded protein(GO:0036506) maintenance of unfolded protein involved in ERAD pathway(GO:1904378) |
0.1 | 0.1 | GO:0060282 | positive regulation of oocyte development(GO:0060282) |
0.1 | 0.1 | GO:0045080 | positive regulation of chemokine biosynthetic process(GO:0045080) |
0.1 | 0.5 | GO:0032607 | interferon-alpha production(GO:0032607) |
0.1 | 0.1 | GO:0010536 | positive regulation of activation of Janus kinase activity(GO:0010536) |
0.1 | 0.1 | GO:0060050 | positive regulation of protein glycosylation(GO:0060050) |
0.1 | 0.1 | GO:0046826 | negative regulation of protein export from nucleus(GO:0046826) |
0.1 | 0.3 | GO:0031053 | primary miRNA processing(GO:0031053) |
0.1 | 0.2 | GO:0060295 | regulation of cilium movement involved in cell motility(GO:0060295) regulation of cilium beat frequency involved in ciliary motility(GO:0060296) regulation of cilium-dependent cell motility(GO:1902019) |
0.1 | 0.6 | GO:0030150 | protein import into mitochondrial matrix(GO:0030150) |
0.1 | 0.2 | GO:0015820 | branched-chain amino acid transport(GO:0015803) leucine transport(GO:0015820) |
0.1 | 0.4 | GO:0030828 | positive regulation of cGMP biosynthetic process(GO:0030828) |
0.1 | 0.4 | GO:0008340 | determination of adult lifespan(GO:0008340) |
0.1 | 0.4 | GO:0097120 | receptor localization to synapse(GO:0097120) |
0.1 | 0.1 | GO:0006610 | ribosomal protein import into nucleus(GO:0006610) |
0.1 | 0.2 | GO:0052803 | imidazole-containing compound metabolic process(GO:0052803) |
0.1 | 0.1 | GO:0031296 | B cell costimulation(GO:0031296) |
0.0 | 0.5 | GO:0070584 | mitochondrion morphogenesis(GO:0070584) |
0.0 | 0.2 | GO:0001866 | NK T cell proliferation(GO:0001866) |
0.0 | 0.5 | GO:0046325 | negative regulation of glucose import(GO:0046325) |
0.0 | 0.6 | GO:0051601 | exocyst localization(GO:0051601) |
0.0 | 0.5 | GO:0045898 | regulation of RNA polymerase II transcriptional preinitiation complex assembly(GO:0045898) |
0.0 | 0.4 | GO:0000154 | rRNA modification(GO:0000154) |
0.0 | 0.5 | GO:0007190 | activation of adenylate cyclase activity(GO:0007190) |
0.0 | 1.1 | GO:0006491 | N-glycan processing(GO:0006491) |
0.0 | 0.1 | GO:0006646 | phosphatidylethanolamine biosynthetic process(GO:0006646) |
0.0 | 0.5 | GO:0007031 | peroxisome organization(GO:0007031) |
0.0 | 0.5 | GO:0046827 | positive regulation of protein export from nucleus(GO:0046827) |
0.0 | 0.8 | GO:0006607 | NLS-bearing protein import into nucleus(GO:0006607) |
0.0 | 0.2 | GO:0046599 | regulation of centriole replication(GO:0046599) |
0.0 | 0.0 | GO:0010520 | regulation of reciprocal meiotic recombination(GO:0010520) |
0.0 | 0.1 | GO:0007144 | female meiosis I(GO:0007144) |
0.0 | 0.1 | GO:0032667 | interleukin-23 production(GO:0032627) regulation of interleukin-23 production(GO:0032667) positive regulation of interleukin-23 production(GO:0032747) |
0.0 | 0.0 | GO:1903333 | regulation of protein folding(GO:1903332) negative regulation of protein folding(GO:1903333) |
0.0 | 0.3 | GO:0007202 | activation of phospholipase C activity(GO:0007202) |
0.0 | 0.1 | GO:0002725 | negative regulation of T cell cytokine production(GO:0002725) |
0.0 | 0.2 | GO:0009191 | ribonucleoside diphosphate catabolic process(GO:0009191) |
0.0 | 0.1 | GO:0060316 | positive regulation of ryanodine-sensitive calcium-release channel activity(GO:0060316) |
0.0 | 0.2 | GO:0033132 | negative regulation of glucokinase activity(GO:0033132) negative regulation of hexokinase activity(GO:1903300) |
0.0 | 0.2 | GO:0060710 | chorio-allantoic fusion(GO:0060710) |
0.0 | 0.1 | GO:1903966 | monounsaturated fatty acid metabolic process(GO:1903964) monounsaturated fatty acid biosynthetic process(GO:1903966) |
0.0 | 1.4 | GO:0071427 | mRNA export from nucleus(GO:0006406) mRNA-containing ribonucleoprotein complex export from nucleus(GO:0071427) |
0.0 | 0.1 | GO:0006613 | cotranslational protein targeting to membrane(GO:0006613) |
0.0 | 0.0 | GO:0002767 | immune response-inhibiting signal transduction(GO:0002765) immune response-inhibiting cell surface receptor signaling pathway(GO:0002767) |
0.0 | 0.2 | GO:2000348 | regulation of CD40 signaling pathway(GO:2000348) |
0.0 | 0.0 | GO:2000767 | positive regulation of cytoplasmic translation(GO:2000767) |
0.0 | 0.3 | GO:0006120 | mitochondrial electron transport, NADH to ubiquinone(GO:0006120) |
0.0 | 0.1 | GO:0018197 | peptidyl-aspartic acid modification(GO:0018197) |
0.0 | 0.4 | GO:0034497 | protein localization to pre-autophagosomal structure(GO:0034497) |
0.0 | 2.6 | GO:0051297 | centrosome organization(GO:0051297) |
0.0 | 0.2 | GO:0033169 | histone H3-K9 demethylation(GO:0033169) |
0.0 | 0.4 | GO:0071577 | zinc II ion transmembrane transport(GO:0071577) |
0.0 | 0.1 | GO:0035609 | C-terminal protein deglutamylation(GO:0035609) |
0.0 | 0.3 | GO:0009225 | nucleotide-sugar metabolic process(GO:0009225) |
0.0 | 0.4 | GO:0048268 | clathrin coat assembly(GO:0048268) |
0.0 | 3.9 | GO:0016579 | protein deubiquitination(GO:0016579) |
0.0 | 0.1 | GO:0016344 | meiotic chromosome movement towards spindle pole(GO:0016344) chromosome movement towards spindle pole(GO:0051305) |
0.0 | 0.2 | GO:0006851 | mitochondrial calcium ion transport(GO:0006851) |
0.0 | 0.1 | GO:0050915 | sensory perception of sour taste(GO:0050915) |
0.0 | 0.1 | GO:0070966 | nuclear-transcribed mRNA catabolic process, no-go decay(GO:0070966) |
0.0 | 0.3 | GO:2000353 | positive regulation of endothelial cell apoptotic process(GO:2000353) |
0.0 | 0.2 | GO:0043983 | histone H4-K12 acetylation(GO:0043983) |
0.0 | 1.1 | GO:0007029 | endoplasmic reticulum organization(GO:0007029) |
0.0 | 0.2 | GO:0045602 | negative regulation of endothelial cell differentiation(GO:0045602) |
0.0 | 0.1 | GO:0043031 | negative regulation of macrophage activation(GO:0043031) |
0.0 | 0.0 | GO:0036394 | amylase secretion(GO:0036394) |
0.0 | 0.3 | GO:0035881 | amacrine cell differentiation(GO:0035881) |
0.0 | 0.1 | GO:0097167 | circadian regulation of translation(GO:0097167) |
0.0 | 0.1 | GO:0070827 | chromatin maintenance(GO:0070827) |
0.0 | 0.2 | GO:0042760 | very long-chain fatty acid catabolic process(GO:0042760) |
0.0 | 0.2 | GO:0006551 | leucine metabolic process(GO:0006551) |
0.0 | 0.2 | GO:0034770 | histone H4-K20 methylation(GO:0034770) |
0.0 | 0.1 | GO:0036123 | histone H3-K9 dimethylation(GO:0036123) |
0.0 | 0.3 | GO:1901976 | regulation of cell cycle checkpoint(GO:1901976) |
0.0 | 0.0 | GO:0002408 | myeloid dendritic cell chemotaxis(GO:0002408) |
0.0 | 0.5 | GO:0031952 | regulation of protein autophosphorylation(GO:0031952) |
0.0 | 0.0 | GO:0044314 | protein K27-linked ubiquitination(GO:0044314) |
0.0 | 1.2 | GO:0071300 | cellular response to retinoic acid(GO:0071300) |
0.0 | 0.2 | GO:0043970 | histone H3-K9 acetylation(GO:0043970) |
0.0 | 0.1 | GO:0045624 | positive regulation of T-helper cell differentiation(GO:0045624) |
0.0 | 0.0 | GO:0071569 | protein ufmylation(GO:0071569) |
0.0 | 0.1 | GO:0042511 | positive regulation of tyrosine phosphorylation of Stat1 protein(GO:0042511) |
0.0 | 0.1 | GO:0097680 | double-strand break repair via classical nonhomologous end joining(GO:0097680) |
0.0 | 0.0 | GO:0042421 | norepinephrine biosynthetic process(GO:0042421) |
0.0 | 0.9 | GO:0070534 | protein K63-linked ubiquitination(GO:0070534) |
0.0 | 0.2 | GO:0031536 | positive regulation of exit from mitosis(GO:0031536) |
0.0 | 0.1 | GO:0051122 | hepoxilin metabolic process(GO:0051121) hepoxilin biosynthetic process(GO:0051122) |
0.0 | 0.1 | GO:0048386 | positive regulation of retinoic acid receptor signaling pathway(GO:0048386) |
0.0 | 0.1 | GO:0046102 | inosine metabolic process(GO:0046102) |
0.0 | 0.0 | GO:0090245 | axis elongation involved in somitogenesis(GO:0090245) |
0.0 | 0.2 | GO:2000773 | negative regulation of cellular senescence(GO:2000773) |
0.0 | 0.2 | GO:0018401 | peptidyl-proline hydroxylation to 4-hydroxy-L-proline(GO:0018401) |
0.0 | 0.2 | GO:0035878 | nail development(GO:0035878) |
0.0 | 0.4 | GO:0032878 | regulation of establishment or maintenance of cell polarity(GO:0032878) |
0.0 | 0.0 | GO:0033184 | positive regulation of histone ubiquitination(GO:0033184) |
0.0 | 0.0 | GO:0090306 | spindle assembly involved in meiosis(GO:0090306) |
0.0 | 0.4 | GO:0061049 | physiological muscle hypertrophy(GO:0003298) physiological cardiac muscle hypertrophy(GO:0003301) cell growth involved in cardiac muscle cell development(GO:0061049) |
0.0 | 0.2 | GO:0045072 | regulation of interferon-gamma biosynthetic process(GO:0045072) |
0.0 | 0.1 | GO:2000359 | regulation of binding of sperm to zona pellucida(GO:2000359) |
0.0 | 0.4 | GO:1900271 | regulation of long-term synaptic potentiation(GO:1900271) |
0.0 | 0.5 | GO:1902850 | mitotic spindle assembly(GO:0090307) microtubule cytoskeleton organization involved in mitosis(GO:1902850) |
0.0 | 0.2 | GO:0045002 | double-strand break repair via single-strand annealing(GO:0045002) |
0.0 | 0.2 | GO:0006622 | protein targeting to lysosome(GO:0006622) |
0.0 | 0.2 | GO:0032482 | Rab protein signal transduction(GO:0032482) |
0.0 | 0.2 | GO:0002724 | regulation of T cell cytokine production(GO:0002724) |
0.0 | 0.2 | GO:0071557 | histone H3-K27 demethylation(GO:0071557) |
0.0 | 0.1 | GO:0070858 | negative regulation of bile acid biosynthetic process(GO:0070858) negative regulation of bile acid metabolic process(GO:1904252) |
0.0 | 0.2 | GO:0051138 | regulation of NK T cell differentiation(GO:0051136) positive regulation of NK T cell differentiation(GO:0051138) |
0.0 | 0.6 | GO:0010591 | regulation of lamellipodium assembly(GO:0010591) |
0.0 | 0.0 | GO:0045351 | type I interferon biosynthetic process(GO:0045351) |
0.0 | 0.2 | GO:0031937 | positive regulation of chromatin silencing(GO:0031937) |
0.0 | 0.2 | GO:0045723 | positive regulation of fatty acid biosynthetic process(GO:0045723) |
0.0 | 0.1 | GO:0016584 | nucleosome positioning(GO:0016584) |
0.0 | 0.1 | GO:0014049 | positive regulation of glutamate secretion(GO:0014049) |
0.0 | 0.4 | GO:0015693 | magnesium ion transport(GO:0015693) |
0.0 | 0.1 | GO:0032790 | ribosome disassembly(GO:0032790) |
0.0 | 0.4 | GO:0051127 | positive regulation of actin nucleation(GO:0051127) |
0.0 | 0.1 | GO:0035948 | positive regulation of gluconeogenesis by positive regulation of transcription from RNA polymerase II promoter(GO:0035948) |
0.0 | 0.8 | GO:0016601 | Rac protein signal transduction(GO:0016601) |
0.0 | 0.3 | GO:0006122 | mitochondrial electron transport, ubiquinol to cytochrome c(GO:0006122) |
0.0 | 0.0 | GO:0060332 | positive regulation of response to interferon-gamma(GO:0060332) positive regulation of interferon-gamma-mediated signaling pathway(GO:0060335) |
0.0 | 0.2 | GO:0031274 | positive regulation of pseudopodium assembly(GO:0031274) |
0.0 | 0.0 | GO:1903116 | positive regulation of actin filament-based movement(GO:1903116) |
0.0 | 0.3 | GO:0034643 | establishment of mitochondrion localization, microtubule-mediated(GO:0034643) mitochondrion transport along microtubule(GO:0047497) |
0.0 | 0.3 | GO:0009209 | CTP biosynthetic process(GO:0006241) pyrimidine ribonucleoside triphosphate metabolic process(GO:0009208) pyrimidine ribonucleoside triphosphate biosynthetic process(GO:0009209) CTP metabolic process(GO:0046036) |
0.0 | 0.1 | GO:0097210 | response to gonadotropin-releasing hormone(GO:0097210) cellular response to gonadotropin-releasing hormone(GO:0097211) |
0.0 | 0.1 | GO:0033034 | positive regulation of neutrophil apoptotic process(GO:0033031) positive regulation of myeloid cell apoptotic process(GO:0033034) |
0.0 | 0.2 | GO:0010896 | regulation of triglyceride catabolic process(GO:0010896) positive regulation of triglyceride catabolic process(GO:0010898) |
0.0 | 0.1 | GO:0006114 | glycerol biosynthetic process(GO:0006114) alditol biosynthetic process(GO:0019401) |
0.0 | 0.1 | GO:0035234 | ectopic germ cell programmed cell death(GO:0035234) |
0.0 | 0.1 | GO:0009750 | response to fructose(GO:0009750) |
0.0 | 0.0 | GO:0003431 | growth plate cartilage chondrocyte development(GO:0003431) |
0.0 | 0.2 | GO:0006528 | asparagine metabolic process(GO:0006528) |
0.0 | 0.0 | GO:0050904 | diapedesis(GO:0050904) |
0.0 | 1.0 | GO:0051304 | chromosome separation(GO:0051304) |
0.0 | 0.6 | GO:0030501 | positive regulation of bone mineralization(GO:0030501) |
0.0 | 0.1 | GO:0030327 | prenylated protein catabolic process(GO:0030327) |
0.0 | 0.1 | GO:0060159 | regulation of dopamine receptor signaling pathway(GO:0060159) |
0.0 | 0.3 | GO:0046685 | response to arsenic-containing substance(GO:0046685) |
0.0 | 0.0 | GO:0071225 | cellular response to muramyl dipeptide(GO:0071225) |
0.0 | 0.5 | GO:0015986 | energy coupled proton transport, down electrochemical gradient(GO:0015985) ATP synthesis coupled proton transport(GO:0015986) |
0.0 | 0.3 | GO:0035025 | positive regulation of Rho protein signal transduction(GO:0035025) |
0.0 | 0.1 | GO:0032460 | negative regulation of protein oligomerization(GO:0032460) |
0.0 | 0.2 | GO:0043619 | regulation of transcription from RNA polymerase II promoter in response to oxidative stress(GO:0043619) |
0.0 | 0.0 | GO:0060281 | regulation of oocyte development(GO:0060281) |
0.0 | 0.0 | GO:2000520 | regulation of immunological synapse formation(GO:2000520) |
0.0 | 0.0 | GO:0006419 | alanyl-tRNA aminoacylation(GO:0006419) |
0.0 | 0.1 | GO:0016480 | negative regulation of transcription from RNA polymerase III promoter(GO:0016480) |
0.0 | 0.3 | GO:0051014 | actin filament severing(GO:0051014) |
0.0 | 0.0 | GO:0085020 | protein K6-linked ubiquitination(GO:0085020) |
0.0 | 0.6 | GO:0016239 | positive regulation of macroautophagy(GO:0016239) |
0.0 | 3.2 | GO:0007596 | blood coagulation(GO:0007596) |
0.0 | 0.7 | GO:0006119 | oxidative phosphorylation(GO:0006119) |
0.0 | 0.2 | GO:0048227 | plasma membrane to endosome transport(GO:0048227) |
0.0 | 0.0 | GO:0051344 | negative regulation of cyclic-nucleotide phosphodiesterase activity(GO:0051344) |
0.0 | 0.0 | GO:0043308 | eosinophil activation involved in immune response(GO:0002278) eosinophil mediated immunity(GO:0002447) eosinophil degranulation(GO:0043308) |
0.0 | 0.1 | GO:0019464 | glycine catabolic process(GO:0006546) glycine decarboxylation via glycine cleavage system(GO:0019464) |
0.0 | 0.1 | GO:0034243 | regulation of transcription elongation from RNA polymerase II promoter(GO:0034243) |
0.0 | 0.1 | GO:0061014 | positive regulation of mRNA catabolic process(GO:0061014) |
0.0 | 0.6 | GO:0007052 | mitotic spindle organization(GO:0007052) |
0.0 | 0.3 | GO:0019184 | nonribosomal peptide biosynthetic process(GO:0019184) |
0.0 | 0.1 | GO:0046598 | positive regulation of viral entry into host cell(GO:0046598) |
0.0 | 0.2 | GO:0060294 | cilium movement involved in cell motility(GO:0060294) |
0.0 | 1.0 | GO:0006687 | glycosphingolipid metabolic process(GO:0006687) |
0.0 | 0.1 | GO:0060468 | prevention of polyspermy(GO:0060468) |
0.0 | 0.2 | GO:1904262 | TORC1 signaling(GO:0038202) regulation of TORC1 signaling(GO:1903432) negative regulation of TORC1 signaling(GO:1904262) |
0.0 | 0.1 | GO:0042126 | nitrate metabolic process(GO:0042126) |
0.0 | 0.1 | GO:0072385 | minus-end-directed organelle transport along microtubule(GO:0072385) |
0.0 | 0.1 | GO:0070120 | ciliary neurotrophic factor-mediated signaling pathway(GO:0070120) |
0.0 | 0.1 | GO:0001955 | blood vessel maturation(GO:0001955) |
0.0 | 0.3 | GO:0050930 | induction of positive chemotaxis(GO:0050930) |
0.0 | 0.2 | GO:0007000 | nucleolus organization(GO:0007000) |
0.0 | 0.0 | GO:1901097 | negative regulation of autophagosome maturation(GO:1901097) |
0.0 | 0.1 | GO:1904479 | negative regulation of intestinal absorption(GO:1904479) |
0.0 | 0.0 | GO:0001865 | NK T cell differentiation(GO:0001865) |
0.0 | 0.1 | GO:1901252 | regulation of intracellular transport of viral material(GO:1901252) |
0.0 | 0.8 | GO:0043966 | histone H3 acetylation(GO:0043966) |
0.0 | 0.0 | GO:0046813 | receptor-mediated virion attachment to host cell(GO:0046813) |
0.0 | 0.2 | GO:0070935 | 3'-UTR-mediated mRNA stabilization(GO:0070935) |
0.0 | 0.0 | GO:0031468 | nuclear envelope reassembly(GO:0031468) |
0.0 | 0.0 | GO:0071474 | cellular hyperosmotic response(GO:0071474) |
0.0 | 0.2 | GO:0045292 | mRNA cis splicing, via spliceosome(GO:0045292) |
0.0 | 0.3 | GO:0048280 | vesicle fusion with Golgi apparatus(GO:0048280) |
0.0 | 0.1 | GO:0048631 | regulation of skeletal muscle tissue growth(GO:0048631) |
0.0 | 0.0 | GO:0052173 | response to defenses of other organism involved in symbiotic interaction(GO:0052173) response to host defenses(GO:0052200) response to host(GO:0075136) |
0.0 | 0.1 | GO:0071803 | positive regulation of podosome assembly(GO:0071803) |
0.0 | 0.3 | GO:0044253 | positive regulation of collagen metabolic process(GO:0010714) positive regulation of collagen biosynthetic process(GO:0032967) positive regulation of multicellular organismal metabolic process(GO:0044253) |
0.0 | 0.2 | GO:0007217 | tachykinin receptor signaling pathway(GO:0007217) |
0.0 | 0.7 | GO:0032611 | interleukin-1 beta production(GO:0032611) |
0.0 | 0.1 | GO:0003383 | apical constriction(GO:0003383) |
0.0 | 0.0 | GO:0032079 | positive regulation of endodeoxyribonuclease activity(GO:0032079) |
0.0 | 0.2 | GO:0034063 | stress granule assembly(GO:0034063) |
0.0 | 0.1 | GO:0051123 | RNA polymerase II transcriptional preinitiation complex assembly(GO:0051123) |
0.0 | 1.3 | GO:0045454 | cell redox homeostasis(GO:0045454) |
0.0 | 2.0 | GO:0046488 | phosphatidylinositol metabolic process(GO:0046488) |
0.0 | 0.2 | GO:2000051 | negative regulation of non-canonical Wnt signaling pathway(GO:2000051) |
0.0 | 0.1 | GO:0032287 | peripheral nervous system myelin maintenance(GO:0032287) |
0.0 | 0.1 | GO:0001661 | conditioned taste aversion(GO:0001661) |
0.0 | 0.2 | GO:0002084 | protein depalmitoylation(GO:0002084) macromolecule depalmitoylation(GO:0098734) |
0.0 | 0.6 | GO:1902808 | positive regulation of cell cycle G1/S phase transition(GO:1902808) |
0.0 | 0.2 | GO:0001659 | temperature homeostasis(GO:0001659) |
0.0 | 0.1 | GO:0032876 | negative regulation of DNA endoreduplication(GO:0032876) |
0.0 | 0.0 | GO:0045578 | negative regulation of B cell differentiation(GO:0045578) |
0.0 | 0.3 | GO:2000060 | positive regulation of protein ubiquitination involved in ubiquitin-dependent protein catabolic process(GO:2000060) |
0.0 | 0.0 | GO:0030422 | production of siRNA involved in RNA interference(GO:0030422) |
0.0 | 0.4 | GO:2000401 | regulation of lymphocyte migration(GO:2000401) |
0.0 | 0.0 | GO:0033634 | positive regulation of cell-cell adhesion mediated by integrin(GO:0033634) |
0.0 | 0.2 | GO:0006303 | double-strand break repair via nonhomologous end joining(GO:0006303) |
0.0 | 0.4 | GO:0034587 | piRNA metabolic process(GO:0034587) |
0.0 | 0.0 | GO:0033239 | negative regulation of cellular amine metabolic process(GO:0033239) regulation of glutamate metabolic process(GO:2000211) |
0.0 | 0.0 | GO:0006931 | substrate-dependent cell migration, cell attachment to substrate(GO:0006931) |
0.0 | 0.0 | GO:0030007 | cellular potassium ion homeostasis(GO:0030007) |
0.0 | 0.4 | GO:0007212 | dopamine receptor signaling pathway(GO:0007212) |
0.0 | 0.0 | GO:0040009 | regulation of growth rate(GO:0040009) |
0.0 | 0.1 | GO:0008089 | anterograde axonal transport(GO:0008089) |
0.0 | 0.4 | GO:0033119 | negative regulation of RNA splicing(GO:0033119) |
0.0 | 0.2 | GO:0035330 | regulation of hippo signaling(GO:0035330) |
0.0 | 0.1 | GO:0090031 | positive regulation of steroid hormone biosynthetic process(GO:0090031) |
0.0 | 0.1 | GO:0030576 | Cajal body organization(GO:0030576) |
0.0 | 0.1 | GO:0002031 | G-protein coupled receptor internalization(GO:0002031) |
0.0 | 0.1 | GO:0006578 | amino-acid betaine biosynthetic process(GO:0006578) |
0.0 | 0.1 | GO:1901896 | positive regulation of calcium-transporting ATPase activity(GO:1901896) |
0.0 | 0.1 | GO:0060921 | sinoatrial node cell differentiation(GO:0060921) sinoatrial node cell development(GO:0060931) |
0.0 | 0.2 | GO:2000300 | regulation of synaptic vesicle transport(GO:1902803) regulation of synaptic vesicle exocytosis(GO:2000300) |
0.0 | 0.0 | GO:0018214 | protein carboxylation(GO:0018214) |
0.0 | 0.1 | GO:1901642 | purine nucleoside transmembrane transport(GO:0015860) purine-containing compound transmembrane transport(GO:0072530) nucleoside transmembrane transport(GO:1901642) |
0.0 | 0.0 | GO:0035630 | bone mineralization involved in bone maturation(GO:0035630) |
0.0 | 0.3 | GO:0048490 | anterograde synaptic vesicle transport(GO:0048490) synaptic vesicle cytoskeletal transport(GO:0099514) synaptic vesicle transport along microtubule(GO:0099517) |
0.0 | 0.1 | GO:0007066 | female meiosis sister chromatid cohesion(GO:0007066) |
0.0 | 0.1 | GO:0070366 | regulation of hepatocyte differentiation(GO:0070366) |
0.0 | 0.1 | GO:0046884 | follicle-stimulating hormone secretion(GO:0046884) |
0.0 | 0.2 | GO:0042136 | neurotransmitter biosynthetic process(GO:0042136) |
0.0 | 0.1 | GO:2000774 | positive regulation of cellular senescence(GO:2000774) |
0.0 | 0.0 | GO:0051342 | regulation of cyclic-nucleotide phosphodiesterase activity(GO:0051342) |
0.0 | 0.0 | GO:2000354 | regulation of ovarian follicle development(GO:2000354) |
0.0 | 0.1 | GO:0051799 | negative regulation of hair follicle development(GO:0051799) |
0.0 | 0.1 | GO:0000056 | ribosomal small subunit export from nucleus(GO:0000056) |
0.0 | 0.4 | GO:0043551 | regulation of phosphatidylinositol 3-kinase activity(GO:0043551) |
0.0 | 0.0 | GO:0034241 | positive regulation of macrophage fusion(GO:0034241) |
0.0 | 0.0 | GO:2000104 | replication fork protection(GO:0048478) negative regulation of DNA-dependent DNA replication(GO:2000104) |
0.0 | 0.2 | GO:0019370 | leukotriene biosynthetic process(GO:0019370) |
0.0 | 0.2 | GO:0043550 | regulation of lipid kinase activity(GO:0043550) |
0.0 | 0.1 | GO:0009629 | response to gravity(GO:0009629) |
0.0 | 0.1 | GO:0000463 | maturation of LSU-rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000463) |
0.0 | 0.1 | GO:0051466 | corticotropin-releasing hormone secretion(GO:0043396) regulation of corticotropin-releasing hormone secretion(GO:0043397) positive regulation of corticotropin-releasing hormone secretion(GO:0051466) |
0.0 | 0.1 | GO:0035526 | retrograde transport, plasma membrane to Golgi(GO:0035526) |
0.0 | 0.9 | GO:0051865 | protein autoubiquitination(GO:0051865) |
0.0 | 0.1 | GO:0010804 | negative regulation of tumor necrosis factor-mediated signaling pathway(GO:0010804) |
0.0 | 0.1 | GO:0023035 | CD40 signaling pathway(GO:0023035) |
0.0 | 0.0 | GO:0061158 | 3'-UTR-mediated mRNA destabilization(GO:0061158) |
0.0 | 0.1 | GO:0000469 | cleavage involved in rRNA processing(GO:0000469) |
0.0 | 0.1 | GO:0075522 | IRES-dependent viral translational initiation(GO:0075522) |
0.0 | 0.1 | GO:0070125 | mitochondrial translational elongation(GO:0070125) |
0.0 | 0.1 | GO:0030223 | neutrophil differentiation(GO:0030223) |
0.0 | 0.1 | GO:0090503 | RNA phosphodiester bond hydrolysis, exonucleolytic(GO:0090503) |
0.0 | 0.1 | GO:0035799 | ureter maturation(GO:0035799) |
0.0 | 0.1 | GO:0039534 | negative regulation of MDA-5 signaling pathway(GO:0039534) |
0.0 | 0.0 | GO:0002432 | granuloma formation(GO:0002432) |
0.0 | 0.1 | GO:0019478 | D-amino acid catabolic process(GO:0019478) |
0.0 | 0.1 | GO:0007084 | mitotic nuclear envelope reassembly(GO:0007084) |
0.0 | 0.1 | GO:0061085 | regulation of histone H3-K27 methylation(GO:0061085) |
0.0 | 0.8 | GO:0051028 | mRNA transport(GO:0051028) |
0.0 | 0.1 | GO:1901874 | regulation of post-translational protein modification(GO:1901873) negative regulation of post-translational protein modification(GO:1901874) |
0.0 | 0.1 | GO:0042373 | vitamin K metabolic process(GO:0042373) |
0.0 | 0.1 | GO:0006098 | pentose-phosphate shunt(GO:0006098) |
0.0 | 0.1 | GO:0035435 | phosphate ion transmembrane transport(GO:0035435) |
0.0 | 0.1 | GO:0006012 | galactose metabolic process(GO:0006012) |
0.0 | 0.1 | GO:0003164 | His-Purkinje system development(GO:0003164) |
0.0 | 0.1 | GO:0044034 | negative stranded viral RNA replication(GO:0039689) multi-organism biosynthetic process(GO:0044034) |
0.0 | 0.2 | GO:0046839 | phospholipid dephosphorylation(GO:0046839) |
0.0 | 0.1 | GO:0030214 | hyaluronan catabolic process(GO:0030214) |
0.0 | 0.1 | GO:2000483 | negative regulation of interleukin-8 secretion(GO:2000483) |
0.0 | 0.1 | GO:0070316 | G0 to G1 transition(GO:0045023) regulation of G0 to G1 transition(GO:0070316) |
0.0 | 0.0 | GO:0048296 | isotype switching to IgA isotypes(GO:0048290) regulation of isotype switching to IgA isotypes(GO:0048296) |
0.0 | 0.2 | GO:0019367 | fatty acid elongation, saturated fatty acid(GO:0019367) fatty acid elongation, unsaturated fatty acid(GO:0019368) fatty acid elongation, monounsaturated fatty acid(GO:0034625) fatty acid elongation, polyunsaturated fatty acid(GO:0034626) |
0.0 | 0.1 | GO:0006369 | termination of RNA polymerase II transcription(GO:0006369) |
0.0 | 0.1 | GO:0018298 | protein-chromophore linkage(GO:0018298) |
0.0 | 0.1 | GO:0006983 | ER overload response(GO:0006983) |
0.0 | 0.1 | GO:0045793 | positive regulation of cell size(GO:0045793) |
0.0 | 0.0 | GO:0045073 | chemokine biosynthetic process(GO:0042033) regulation of chemokine biosynthetic process(GO:0045073) |
0.0 | 0.1 | GO:1901838 | positive regulation of transcription of nuclear large rRNA transcript from RNA polymerase I promoter(GO:1901838) |
0.0 | 0.0 | GO:0016242 | negative regulation of macroautophagy(GO:0016242) |
0.0 | 1.2 | GO:0007030 | Golgi organization(GO:0007030) |
0.0 | 0.1 | GO:0006370 | 7-methylguanosine mRNA capping(GO:0006370) |
0.0 | 0.2 | GO:0050710 | negative regulation of cytokine secretion(GO:0050710) |
0.0 | 0.1 | GO:1904526 | regulation of microtubule binding(GO:1904526) positive regulation of microtubule binding(GO:1904528) |
0.0 | 0.0 | GO:0006290 | pyrimidine dimer repair(GO:0006290) |
0.0 | 0.1 | GO:0033136 | serine phosphorylation of STAT3 protein(GO:0033136) |
0.0 | 0.0 | GO:0010992 | ubiquitin homeostasis(GO:0010992) |
0.0 | 0.1 | GO:0033262 | regulation of nuclear cell cycle DNA replication(GO:0033262) |
0.0 | 1.0 | GO:0009062 | fatty acid catabolic process(GO:0009062) |
0.0 | 0.0 | GO:0051683 | establishment of Golgi localization(GO:0051683) |
0.0 | 0.1 | GO:0018125 | peptidyl-cysteine methylation(GO:0018125) |
0.0 | 0.0 | GO:1902744 | negative regulation of lamellipodium organization(GO:1902744) |
0.0 | 0.0 | GO:0072539 | T-helper 17 cell differentiation(GO:0072539) |
0.0 | 0.2 | GO:0035845 | photoreceptor cell outer segment organization(GO:0035845) |
0.0 | 0.4 | GO:0021680 | cerebellar Purkinje cell layer development(GO:0021680) |
0.0 | 0.0 | GO:1903596 | regulation of gap junction assembly(GO:1903596) positive regulation of gap junction assembly(GO:1903598) |
0.0 | 0.0 | GO:0043173 | nucleotide salvage(GO:0043173) |
0.0 | 0.1 | GO:0097428 | protein maturation by iron-sulfur cluster transfer(GO:0097428) |
0.0 | 0.2 | GO:0007250 | activation of NF-kappaB-inducing kinase activity(GO:0007250) |
0.0 | 0.0 | GO:0070200 | establishment of protein localization to telomere(GO:0070200) |
0.0 | 0.1 | GO:0008655 | pyrimidine-containing compound salvage(GO:0008655) pyrimidine nucleoside salvage(GO:0043097) |
0.0 | 0.2 | GO:0046348 | amino sugar catabolic process(GO:0046348) |
0.0 | 0.0 | GO:0045722 | positive regulation of gluconeogenesis(GO:0045722) |
0.0 | 0.1 | GO:0001973 | adenosine receptor signaling pathway(GO:0001973) |
0.0 | 0.0 | GO:0030826 | regulation of cGMP biosynthetic process(GO:0030826) |
0.0 | 0.1 | GO:2000785 | regulation of autophagosome assembly(GO:2000785) |
0.0 | 0.1 | GO:0036297 | interstrand cross-link repair(GO:0036297) |
0.0 | 0.1 | GO:1903301 | positive regulation of glucokinase activity(GO:0033133) positive regulation of hexokinase activity(GO:1903301) |
0.0 | 0.2 | GO:0060576 | intestinal epithelial cell development(GO:0060576) |
0.0 | 0.8 | GO:0008654 | phospholipid biosynthetic process(GO:0008654) |
0.0 | 0.1 | GO:0048245 | eosinophil chemotaxis(GO:0048245) |
0.0 | 0.1 | GO:1901621 | negative regulation of smoothened signaling pathway involved in dorsal/ventral neural tube patterning(GO:1901621) |
0.0 | 0.0 | GO:0006415 | translational termination(GO:0006415) |
0.0 | 0.8 | GO:0031338 | regulation of vesicle fusion(GO:0031338) |
0.0 | 0.0 | GO:0000466 | maturation of 5.8S rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000466) |
0.0 | 0.0 | GO:0035815 | positive regulation of renal sodium excretion(GO:0035815) |
0.0 | 0.0 | GO:0002826 | negative regulation of T-helper 1 type immune response(GO:0002826) |
0.0 | 0.0 | GO:0000291 | nuclear-transcribed mRNA catabolic process, exonucleolytic(GO:0000291) |
0.0 | 0.1 | GO:0072384 | organelle transport along microtubule(GO:0072384) |
0.0 | 0.1 | GO:0006206 | pyrimidine nucleobase metabolic process(GO:0006206) |
0.0 | 1.5 | GO:0008643 | carbohydrate transport(GO:0008643) |
0.0 | 0.1 | GO:0045908 | negative regulation of vasodilation(GO:0045908) |
0.0 | 0.2 | GO:0002026 | regulation of the force of heart contraction(GO:0002026) |
0.0 | 0.0 | GO:0009247 | glycolipid biosynthetic process(GO:0009247) |
0.0 | 0.0 | GO:0001302 | replicative cell aging(GO:0001302) |
0.0 | 0.1 | GO:0010880 | regulation of release of sequestered calcium ion into cytosol by sarcoplasmic reticulum(GO:0010880) |
0.0 | 0.0 | GO:0031585 | regulation of inositol 1,4,5-trisphosphate-sensitive calcium-release channel activity(GO:0031585) |
0.0 | 0.2 | GO:0000060 | protein import into nucleus, translocation(GO:0000060) |
0.0 | 0.1 | GO:2000653 | regulation of genetic imprinting(GO:2000653) |
0.0 | 0.0 | GO:1901897 | regulation of relaxation of cardiac muscle(GO:1901897) |
0.0 | 0.1 | GO:0043101 | purine-containing compound salvage(GO:0043101) |
0.0 | 0.3 | GO:0007026 | negative regulation of microtubule depolymerization(GO:0007026) |
0.0 | 0.1 | GO:0090273 | regulation of somatostatin secretion(GO:0090273) |
0.0 | 0.0 | GO:0060591 | chondroblast differentiation(GO:0060591) |
0.0 | 2.0 | GO:0051321 | meiotic cell cycle(GO:0051321) |
0.0 | 0.1 | GO:0007210 | serotonin receptor signaling pathway(GO:0007210) |
0.0 | 0.1 | GO:0045948 | positive regulation of translational initiation(GO:0045948) |
0.0 | 0.1 | GO:2000020 | positive regulation of male gonad development(GO:2000020) |
0.0 | 0.1 | GO:0051013 | microtubule severing(GO:0051013) |
0.0 | 1.3 | GO:0042787 | protein ubiquitination involved in ubiquitin-dependent protein catabolic process(GO:0042787) |
0.0 | 0.1 | GO:0060179 | male mating behavior(GO:0060179) |
0.0 | 0.0 | GO:0097039 | protein linear polyubiquitination(GO:0097039) |
0.0 | 0.1 | GO:0032026 | response to magnesium ion(GO:0032026) |
0.0 | 0.0 | GO:1903215 | negative regulation of protein targeting to mitochondrion(GO:1903215) |
0.0 | 0.0 | GO:0098543 | detection of bacterium(GO:0016045) detection of other organism(GO:0098543) |
0.0 | 0.2 | GO:0017121 | phospholipid scrambling(GO:0017121) |
0.0 | 0.6 | GO:0007339 | binding of sperm to zona pellucida(GO:0007339) |
0.0 | 0.1 | GO:2000253 | positive regulation of feeding behavior(GO:2000253) |
0.0 | 0.8 | GO:0051092 | positive regulation of NF-kappaB transcription factor activity(GO:0051092) |
0.0 | 0.0 | GO:0003105 | negative regulation of glomerular filtration(GO:0003105) |
0.0 | 0.0 | GO:0010481 | epidermal cell division(GO:0010481) regulation of epidermal cell division(GO:0010482) |
0.0 | 0.0 | GO:0098700 | aminergic neurotransmitter loading into synaptic vesicle(GO:0015842) neurotransmitter loading into synaptic vesicle(GO:0098700) |
0.0 | 0.0 | GO:0060926 | cardiac pacemaker cell differentiation(GO:0060920) cardiac pacemaker cell development(GO:0060926) |
0.0 | 0.1 | GO:0035036 | sperm-egg recognition(GO:0035036) |
0.0 | 0.0 | GO:1902809 | regulation of skeletal muscle fiber differentiation(GO:1902809) |
0.0 | 0.6 | GO:0002181 | cytoplasmic translation(GO:0002181) |
0.0 | 0.1 | GO:0002360 | T cell lineage commitment(GO:0002360) |
0.0 | 0.1 | GO:0002759 | regulation of antimicrobial humoral response(GO:0002759) |
0.0 | 0.2 | GO:0044342 | type B pancreatic cell proliferation(GO:0044342) |
0.0 | 0.1 | GO:0006103 | 2-oxoglutarate metabolic process(GO:0006103) |
0.0 | 0.0 | GO:0002840 | T cell mediated immune response to tumor cell(GO:0002424) regulation of T cell mediated immune response to tumor cell(GO:0002840) |
0.0 | 0.0 | GO:0055059 | asymmetric neuroblast division(GO:0055059) |
0.0 | 0.1 | GO:0044845 | cell wall mannoprotein biosynthetic process(GO:0000032) mannoprotein metabolic process(GO:0006056) mannoprotein biosynthetic process(GO:0006057) cell wall glycoprotein biosynthetic process(GO:0031506) cell wall biogenesis(GO:0042546) cell wall macromolecule biosynthetic process(GO:0044038) chain elongation of O-linked mannose residue(GO:0044845) cellular component macromolecule biosynthetic process(GO:0070589) |
0.0 | 0.1 | GO:0010225 | response to UV-C(GO:0010225) |
0.0 | 0.0 | GO:0032494 | response to peptidoglycan(GO:0032494) |
0.0 | 0.1 | GO:0035024 | negative regulation of Rho protein signal transduction(GO:0035024) |
0.0 | 0.0 | GO:0001956 | positive regulation of neurotransmitter secretion(GO:0001956) |
0.0 | 0.1 | GO:0070327 | thyroid hormone transport(GO:0070327) |
0.0 | 0.1 | GO:0044872 | lipoprotein transport(GO:0042953) lipoprotein localization(GO:0044872) |
0.0 | 0.3 | GO:2000398 | regulation of T cell differentiation in thymus(GO:0033081) regulation of thymocyte aggregation(GO:2000398) |
0.0 | 0.1 | GO:2000257 | regulation of protein activation cascade(GO:2000257) |
0.0 | 0.0 | GO:0035934 | corticosterone secretion(GO:0035934) regulation of corticosterone secretion(GO:2000852) |
0.0 | 0.1 | GO:0048170 | positive regulation of long-term neuronal synaptic plasticity(GO:0048170) |
0.0 | 0.4 | GO:0007274 | neuromuscular synaptic transmission(GO:0007274) |
0.0 | 0.1 | GO:0061099 | negative regulation of protein tyrosine kinase activity(GO:0061099) |
0.0 | 0.0 | GO:0042538 | hyperosmotic salinity response(GO:0042538) |
0.0 | 0.0 | GO:0010637 | negative regulation of mitochondrial fusion(GO:0010637) |
0.0 | 0.2 | GO:0002089 | lens morphogenesis in camera-type eye(GO:0002089) |
0.0 | 0.1 | GO:0009158 | ribonucleoside monophosphate catabolic process(GO:0009158) purine ribonucleoside monophosphate catabolic process(GO:0009169) |
0.0 | 0.4 | GO:0000724 | double-strand break repair via homologous recombination(GO:0000724) recombinational repair(GO:0000725) |
0.0 | 0.0 | GO:0036336 | dendritic cell migration(GO:0036336) |
0.0 | 0.1 | GO:0007095 | mitotic G2 DNA damage checkpoint(GO:0007095) |
0.0 | 0.1 | GO:0045187 | regulation of circadian sleep/wake cycle, sleep(GO:0045187) |
0.0 | 0.1 | GO:1900108 | negative regulation of nodal signaling pathway(GO:1900108) |
0.0 | 0.2 | GO:0007176 | regulation of epidermal growth factor-activated receptor activity(GO:0007176) |
0.0 | 0.2 | GO:1990118 | sodium ion import across plasma membrane(GO:0098719) sodium ion import into cell(GO:1990118) |
0.0 | 0.1 | GO:0006515 | misfolded or incompletely synthesized protein catabolic process(GO:0006515) |
0.0 | 0.0 | GO:0010745 | negative regulation of macrophage derived foam cell differentiation(GO:0010745) |
0.0 | 0.0 | GO:0010578 | regulation of adenylate cyclase activity involved in G-protein coupled receptor signaling pathway(GO:0010578) positive regulation of adenylate cyclase activity involved in G-protein coupled receptor signaling pathway(GO:0010579) |
0.0 | 0.1 | GO:0002820 | negative regulation of adaptive immune response(GO:0002820) |
0.0 | 0.4 | GO:0035458 | cellular response to interferon-beta(GO:0035458) |
0.0 | 0.0 | GO:0035610 | protein side chain deglutamylation(GO:0035610) |
0.0 | 0.0 | GO:0034134 | toll-like receptor 2 signaling pathway(GO:0034134) |
0.0 | 0.1 | GO:0035999 | tetrahydrofolate interconversion(GO:0035999) |
0.0 | 0.0 | GO:1903551 | regulation of extracellular exosome assembly(GO:1903551) |
0.0 | 0.6 | GO:0002474 | antigen processing and presentation of peptide antigen via MHC class I(GO:0002474) |
0.0 | 0.0 | GO:0060024 | rhythmic synaptic transmission(GO:0060024) |
0.0 | 0.1 | GO:0002523 | leukocyte migration involved in inflammatory response(GO:0002523) |
0.0 | 0.1 | GO:0043102 | amino acid salvage(GO:0043102) L-methionine biosynthetic process(GO:0071265) L-methionine salvage(GO:0071267) |
0.0 | 0.0 | GO:0045650 | negative regulation of macrophage differentiation(GO:0045650) |
0.0 | 0.0 | GO:0019732 | antifungal humoral response(GO:0019732) |
0.0 | 0.0 | GO:0036289 | peptidyl-serine autophosphorylation(GO:0036289) |
0.0 | 0.1 | GO:0044597 | polyketide metabolic process(GO:0030638) aminoglycoside antibiotic metabolic process(GO:0030647) daunorubicin metabolic process(GO:0044597) doxorubicin metabolic process(GO:0044598) |
0.0 | 0.1 | GO:0003056 | regulation of vascular smooth muscle contraction(GO:0003056) |
0.0 | 0.0 | GO:2000676 | positive regulation of type B pancreatic cell apoptotic process(GO:2000676) |
0.0 | 0.1 | GO:0015074 | DNA integration(GO:0015074) |
0.0 | 0.0 | GO:0033762 | response to glucagon(GO:0033762) |
0.0 | 0.1 | GO:0043011 | myeloid dendritic cell differentiation(GO:0043011) |
0.0 | 0.2 | GO:0097484 | dendrite extension(GO:0097484) |
0.0 | 0.1 | GO:0010447 | response to acidic pH(GO:0010447) |
0.0 | 0.3 | GO:0032755 | positive regulation of interleukin-6 production(GO:0032755) |
0.0 | 0.1 | GO:0046125 | pyrimidine deoxyribonucleoside metabolic process(GO:0046125) |
0.0 | 0.1 | GO:0060586 | multicellular organismal iron ion homeostasis(GO:0060586) |
0.0 | 0.1 | GO:0042753 | positive regulation of circadian rhythm(GO:0042753) |
0.0 | 0.1 | GO:0044030 | regulation of DNA methylation(GO:0044030) |
0.0 | 0.0 | GO:0043922 | negative regulation by host of viral transcription(GO:0043922) |
0.0 | 0.0 | GO:0003096 | renal sodium ion transport(GO:0003096) renal sodium ion absorption(GO:0070294) |
0.0 | 0.1 | GO:0050858 | negative regulation of antigen receptor-mediated signaling pathway(GO:0050858) |
0.0 | 0.1 | GO:0060040 | retinal bipolar neuron differentiation(GO:0060040) |
0.0 | 0.1 | GO:0008295 | spermidine biosynthetic process(GO:0008295) |
0.0 | 0.1 | GO:0043162 | ubiquitin-dependent protein catabolic process via the multivesicular body sorting pathway(GO:0043162) |
0.0 | 0.1 | GO:0060009 | Sertoli cell development(GO:0060009) |
0.0 | 0.0 | GO:0010499 | proteasomal ubiquitin-independent protein catabolic process(GO:0010499) |
0.0 | 0.1 | GO:0043584 | nose development(GO:0043584) |
0.0 | 0.0 | GO:0014029 | neural crest formation(GO:0014029) |
0.0 | 0.1 | GO:0006699 | bile acid biosynthetic process(GO:0006699) |
0.0 | 0.0 | GO:1900619 | acetylcholine metabolic process(GO:0008291) acetate ester metabolic process(GO:1900619) |
0.0 | 0.1 | GO:0045652 | regulation of megakaryocyte differentiation(GO:0045652) |
0.0 | 0.0 | GO:0043046 | DNA methylation involved in gamete generation(GO:0043046) |
0.0 | 0.0 | GO:0008588 | release of cytoplasmic sequestered NF-kappaB(GO:0008588) |
0.0 | 0.0 | GO:0010890 | positive regulation of sequestering of triglyceride(GO:0010890) |
0.0 | 0.3 | GO:0007602 | phototransduction(GO:0007602) |
0.0 | 0.0 | GO:0051387 | negative regulation of neurotrophin TRK receptor signaling pathway(GO:0051387) |
0.0 | 0.1 | GO:0017014 | protein nitrosylation(GO:0017014) |
0.0 | 0.0 | GO:0031914 | negative regulation of synaptic plasticity(GO:0031914) |
0.0 | 0.1 | GO:0010922 | positive regulation of phosphatase activity(GO:0010922) |
0.0 | 0.0 | GO:0048677 | axon extension involved in regeneration(GO:0048677) sprouting of injured axon(GO:0048682) |
0.0 | 0.1 | GO:1902047 | polyamine transmembrane transport(GO:1902047) regulation of polyamine transmembrane transport(GO:1902267) |
0.0 | 0.0 | GO:0071220 | response to bacterial lipopeptide(GO:0070339) cellular response to bacterial lipoprotein(GO:0071220) cellular response to bacterial lipopeptide(GO:0071221) |
0.0 | 0.1 | GO:0018023 | peptidyl-lysine trimethylation(GO:0018023) |
0.0 | 0.1 | GO:0045909 | positive regulation of vasodilation(GO:0045909) |
0.0 | 0.0 | GO:1902473 | regulation of protein localization to synapse(GO:1902473) |
0.0 | 0.0 | GO:0070673 | response to interleukin-18(GO:0070673) cellular response to interleukin-18(GO:0071351) |
0.0 | 0.1 | GO:0031572 | G2 DNA damage checkpoint(GO:0031572) |
0.0 | 0.0 | GO:0000429 | carbon catabolite regulation of transcription from RNA polymerase II promoter(GO:0000429) carbon catabolite activation of transcription from RNA polymerase II promoter(GO:0000436) |
0.0 | 0.5 | GO:0050868 | negative regulation of T cell activation(GO:0050868) |
0.0 | 0.0 | GO:1900424 | regulation of defense response to bacterium(GO:1900424) |
0.0 | 0.0 | GO:0002866 | positive regulation of acute inflammatory response to antigenic stimulus(GO:0002866) |
0.0 | 0.2 | GO:0016339 | calcium-dependent cell-cell adhesion via plasma membrane cell adhesion molecules(GO:0016339) |
0.0 | 0.3 | GO:0000462 | maturation of SSU-rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000462) |
0.0 | 0.0 | GO:0007199 | G-protein coupled receptor signaling pathway coupled to cGMP nucleotide second messenger(GO:0007199) |
0.0 | 0.0 | GO:0002638 | negative regulation of immunoglobulin production(GO:0002638) |
0.0 | 0.0 | GO:0002317 | plasma cell differentiation(GO:0002317) |
0.0 | 0.4 | GO:0061077 | chaperone-mediated protein folding(GO:0061077) |
0.0 | 0.0 | GO:0051385 | response to mineralocorticoid(GO:0051385) |
0.0 | 0.1 | GO:2000378 | negative regulation of reactive oxygen species metabolic process(GO:2000378) |
0.0 | 0.2 | GO:0071472 | cellular response to salt stress(GO:0071472) |
0.0 | 0.0 | GO:0014010 | Schwann cell proliferation(GO:0014010) |
0.0 | 0.1 | GO:0046697 | decidualization(GO:0046697) |
0.0 | 0.2 | GO:0016575 | histone deacetylation(GO:0016575) |
0.0 | 0.0 | GO:0090308 | regulation of methylation-dependent chromatin silencing(GO:0090308) |
0.0 | 0.0 | GO:0050927 | positive regulation of positive chemotaxis(GO:0050927) |
0.0 | 0.0 | GO:0046952 | ketone body catabolic process(GO:0046952) |
0.0 | 0.0 | GO:0010603 | regulation of cytoplasmic mRNA processing body assembly(GO:0010603) |
0.0 | 0.0 | GO:1902261 | positive regulation of delayed rectifier potassium channel activity(GO:1902261) positive regulation of voltage-gated potassium channel activity(GO:1903818) |
0.0 | 0.8 | GO:0043627 | response to estrogen(GO:0043627) |
0.0 | 0.0 | GO:0045213 | neurotransmitter receptor metabolic process(GO:0045213) |
0.0 | 0.2 | GO:0009812 | flavonoid metabolic process(GO:0009812) |
0.0 | 0.2 | GO:0006493 | protein O-linked glycosylation(GO:0006493) |
0.0 | 0.0 | GO:0038093 | Fc receptor signaling pathway(GO:0038093) |
0.0 | 0.0 | GO:0006068 | ethanol catabolic process(GO:0006068) |
0.0 | 0.1 | GO:0018202 | peptidyl-diphthamide metabolic process(GO:0017182) peptidyl-diphthamide biosynthetic process from peptidyl-histidine(GO:0017183) peptidyl-histidine modification(GO:0018202) |
0.0 | 0.0 | GO:0046958 | nonassociative learning(GO:0046958) |
0.0 | 0.1 | GO:0050655 | dermatan sulfate proteoglycan metabolic process(GO:0050655) |
0.0 | 0.1 | GO:0042663 | regulation of endodermal cell fate specification(GO:0042663) |
0.0 | 0.1 | GO:0051797 | regulation of hair follicle development(GO:0051797) |
0.0 | 0.0 | GO:0045743 | positive regulation of fibroblast growth factor receptor signaling pathway(GO:0045743) |
0.0 | 0.2 | GO:2000249 | regulation of actin cytoskeleton reorganization(GO:2000249) |
0.0 | 0.0 | GO:0032439 | endosome localization(GO:0032439) |
0.0 | 0.1 | GO:1902230 | negative regulation of intrinsic apoptotic signaling pathway in response to DNA damage(GO:1902230) |
0.0 | 0.1 | GO:0042921 | corticosteroid receptor signaling pathway(GO:0031958) glucocorticoid receptor signaling pathway(GO:0042921) |
0.0 | 0.0 | GO:0045620 | negative regulation of lymphocyte differentiation(GO:0045620) |
0.0 | 0.1 | GO:0061179 | negative regulation of insulin secretion involved in cellular response to glucose stimulus(GO:0061179) |
0.0 | 0.0 | GO:0034628 | nicotinamide nucleotide biosynthetic process from aspartate(GO:0019355) 'de novo' NAD biosynthetic process from aspartate(GO:0034628) |
0.0 | 0.1 | GO:0046549 | retinal cone cell differentiation(GO:0042670) retinal cone cell development(GO:0046549) |
0.0 | 0.0 | GO:0001983 | baroreceptor response to increased systemic arterial blood pressure(GO:0001983) |
0.0 | 0.1 | GO:0042989 | sequestering of actin monomers(GO:0042989) |
0.0 | 0.0 | GO:0070813 | hydrogen sulfide metabolic process(GO:0070813) |
0.0 | 0.0 | GO:0061484 | hematopoietic stem cell homeostasis(GO:0061484) |
0.0 | 0.0 | GO:1990036 | calcium ion import into sarcoplasmic reticulum(GO:1990036) |
0.0 | 0.1 | GO:0043248 | proteasome assembly(GO:0043248) |
0.0 | 0.2 | GO:2001014 | regulation of skeletal muscle cell differentiation(GO:2001014) |
0.0 | 0.0 | GO:1990123 | L-glutamate(1-) import into cell(GO:1903802) L-glutamate import into cell(GO:1990123) |
0.0 | 0.1 | GO:0034508 | centromere complex assembly(GO:0034508) |
0.0 | 0.1 | GO:0051450 | myoblast proliferation(GO:0051450) |
0.0 | 0.0 | GO:0051005 | negative regulation of lipoprotein lipase activity(GO:0051005) |
0.0 | 0.0 | GO:0051560 | mitochondrial calcium ion homeostasis(GO:0051560) |
0.0 | 0.0 | GO:0007181 | transforming growth factor beta receptor complex assembly(GO:0007181) |
0.0 | 0.0 | GO:0060022 | hard palate development(GO:0060022) |
0.0 | 0.1 | GO:0070166 | enamel mineralization(GO:0070166) |
0.0 | 0.0 | GO:0007343 | egg activation(GO:0007343) |
0.0 | 0.6 | GO:0033138 | positive regulation of peptidyl-serine phosphorylation(GO:0033138) |
0.0 | 0.1 | GO:0035455 | response to interferon-alpha(GO:0035455) |
0.0 | 0.1 | GO:0001867 | complement activation, lectin pathway(GO:0001867) |
0.0 | 0.0 | GO:0071318 | cellular response to ATP(GO:0071318) |
0.0 | 0.0 | GO:1903377 | negative regulation of oxidative stress-induced neuron intrinsic apoptotic signaling pathway(GO:1903377) |
0.0 | 0.1 | GO:0035640 | exploration behavior(GO:0035640) |
0.0 | 0.0 | GO:0018894 | dibenzo-p-dioxin metabolic process(GO:0018894) |
0.0 | 0.0 | GO:0070102 | interleukin-6-mediated signaling pathway(GO:0070102) |
0.0 | 0.1 | GO:0006221 | pyrimidine nucleotide biosynthetic process(GO:0006221) |
0.0 | 0.0 | GO:0018094 | protein polyglycylation(GO:0018094) |
0.0 | 0.0 | GO:0033211 | adiponectin-activated signaling pathway(GO:0033211) |
0.0 | 0.1 | GO:0042574 | retinal metabolic process(GO:0042574) |
0.0 | 0.2 | GO:0007093 | mitotic cell cycle checkpoint(GO:0007093) |
0.0 | 0.0 | GO:0006667 | sphinganine metabolic process(GO:0006667) |
0.0 | 0.0 | GO:0072048 | pattern specification involved in kidney development(GO:0061004) renal system pattern specification(GO:0072048) nephrogenic mesenchyme development(GO:0072076) |
0.0 | 0.1 | GO:0032332 | positive regulation of chondrocyte differentiation(GO:0032332) |
0.0 | 0.1 | GO:0006220 | pyrimidine nucleotide metabolic process(GO:0006220) |
0.0 | 0.0 | GO:0052695 | cellular glucuronidation(GO:0052695) |
0.0 | 0.0 | GO:2000525 | regulation of T cell costimulation(GO:2000523) positive regulation of T cell costimulation(GO:2000525) |
0.0 | 0.0 | GO:0033145 | positive regulation of intracellular steroid hormone receptor signaling pathway(GO:0033145) |
0.0 | 0.4 | GO:0006418 | tRNA aminoacylation for protein translation(GO:0006418) |
0.0 | 0.0 | GO:0061668 | mitochondrial ribosome assembly(GO:0061668) |
0.0 | 0.0 | GO:0019676 | ammonia assimilation cycle(GO:0019676) |
0.0 | 0.0 | GO:0033108 | mitochondrial respiratory chain complex assembly(GO:0033108) |
0.0 | 0.1 | GO:0030277 | maintenance of gastrointestinal epithelium(GO:0030277) |
0.0 | 0.0 | GO:0060300 | regulation of cytokine activity(GO:0060300) |
0.0 | 0.1 | GO:0006020 | inositol metabolic process(GO:0006020) |
0.0 | 0.0 | GO:0070474 | positive regulation of uterine smooth muscle contraction(GO:0070474) |
0.0 | 0.0 | GO:0046633 | alpha-beta T cell proliferation(GO:0046633) regulation of alpha-beta T cell proliferation(GO:0046640) |
0.0 | 0.0 | GO:2001286 | regulation of caveolin-mediated endocytosis(GO:2001286) |
0.0 | 0.2 | GO:0010389 | regulation of G2/M transition of mitotic cell cycle(GO:0010389) regulation of cell cycle G2/M phase transition(GO:1902749) |
0.0 | 0.4 | GO:0032543 | mitochondrial translation(GO:0032543) |
0.0 | 0.1 | GO:0030490 | maturation of SSU-rRNA(GO:0030490) |
0.0 | 0.2 | GO:0030101 | natural killer cell activation(GO:0030101) |
0.0 | 0.7 | GO:0000209 | protein polyubiquitination(GO:0000209) |
0.0 | 0.0 | GO:0032988 | ribonucleoprotein complex disassembly(GO:0032988) |
0.0 | 0.1 | GO:0019915 | lipid storage(GO:0019915) |
0.0 | 0.0 | GO:0032364 | oxygen homeostasis(GO:0032364) |
0.0 | 0.1 | GO:0090190 | positive regulation of branching involved in ureteric bud morphogenesis(GO:0090190) |
0.0 | 0.1 | GO:0050850 | positive regulation of calcium-mediated signaling(GO:0050850) |
0.0 | 0.0 | GO:1902074 | response to salt(GO:1902074) |
0.0 | 0.2 | GO:0018345 | protein palmitoylation(GO:0018345) |
0.0 | 0.0 | GO:0007256 | activation of JNKK activity(GO:0007256) |
0.0 | 0.0 | GO:1903336 | negative regulation of vacuolar transport(GO:1903336) |
0.0 | 0.1 | GO:0061436 | establishment of skin barrier(GO:0061436) |
0.0 | 0.0 | GO:0072678 | T cell migration(GO:0072678) |
0.0 | 0.2 | GO:1902600 | hydrogen ion transmembrane transport(GO:1902600) |
0.0 | 0.1 | GO:0032784 | regulation of DNA-templated transcription, elongation(GO:0032784) |
0.0 | 0.1 | GO:0048169 | regulation of long-term neuronal synaptic plasticity(GO:0048169) |
0.0 | 0.0 | GO:0051131 | chaperone-mediated protein complex assembly(GO:0051131) |
0.0 | 0.1 | GO:0071479 | cellular response to ionizing radiation(GO:0071479) |
0.0 | 0.0 | GO:0097340 | inhibition of cysteine-type endopeptidase activity(GO:0097340) zymogen inhibition(GO:0097341) inhibition of cysteine-type endopeptidase activity involved in apoptotic process(GO:1990001) |
0.0 | 0.1 | GO:0051016 | barbed-end actin filament capping(GO:0051016) |
0.0 | 0.0 | GO:0014719 | skeletal muscle satellite cell activation(GO:0014719) |
0.0 | 0.0 | GO:0098581 | detection of external biotic stimulus(GO:0098581) |
0.0 | 0.0 | GO:0071850 | mitotic cell cycle arrest(GO:0071850) |
0.0 | 0.0 | GO:0043084 | penile erection(GO:0043084) |
0.0 | 0.1 | GO:0008535 | respiratory chain complex IV assembly(GO:0008535) |
0.0 | 0.1 | GO:0071435 | potassium ion export(GO:0071435) |
0.0 | 0.0 | GO:0071462 | cellular response to water stimulus(GO:0071462) |
0.0 | 0.0 | GO:0090005 | negative regulation of establishment of protein localization to plasma membrane(GO:0090005) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.7 | 2.1 | GO:0005967 | mitochondrial pyruvate dehydrogenase complex(GO:0005967) |
0.5 | 2.5 | GO:0089701 | U2AF(GO:0089701) |
0.4 | 1.7 | GO:0035339 | SPOTS complex(GO:0035339) |
0.4 | 1.2 | GO:0097418 | neurofibrillary tangle(GO:0097418) |
0.3 | 2.4 | GO:0016593 | Cdc73/Paf1 complex(GO:0016593) |
0.3 | 2.3 | GO:0005833 | hemoglobin complex(GO:0005833) |
0.3 | 1.3 | GO:0097136 | Bcl-2 family protein complex(GO:0097136) |
0.3 | 3.7 | GO:0005847 | mRNA cleavage and polyadenylation specificity factor complex(GO:0005847) |
0.3 | 0.9 | GO:0020016 | ciliary pocket(GO:0020016) ciliary pocket membrane(GO:0020018) |
0.3 | 1.8 | GO:0000796 | condensin complex(GO:0000796) |
0.3 | 1.2 | GO:0071141 | SMAD protein complex(GO:0071141) |
0.3 | 1.4 | GO:0033093 | Weibel-Palade body(GO:0033093) |
0.3 | 1.6 | GO:0001739 | sex chromatin(GO:0001739) |
0.3 | 1.0 | GO:0032777 | Piccolo NuA4 histone acetyltransferase complex(GO:0032777) |
0.2 | 1.4 | GO:0034366 | spherical high-density lipoprotein particle(GO:0034366) |
0.2 | 1.4 | GO:0071986 | Ragulator complex(GO:0071986) |
0.2 | 1.9 | GO:0019773 | proteasome core complex, alpha-subunit complex(GO:0019773) |
0.2 | 0.7 | GO:0000811 | GINS complex(GO:0000811) |
0.2 | 0.7 | GO:0043511 | inhibin complex(GO:0043511) |
0.2 | 0.2 | GO:0031595 | nuclear proteasome complex(GO:0031595) |
0.2 | 0.6 | GO:0032127 | dense core granule membrane(GO:0032127) |
0.2 | 0.6 | GO:0097413 | Lewy body(GO:0097413) |
0.2 | 0.6 | GO:0005785 | signal recognition particle receptor complex(GO:0005785) |
0.2 | 0.9 | GO:0061617 | MICOS complex(GO:0061617) |
0.2 | 1.9 | GO:0046581 | intercellular canaliculus(GO:0046581) |
0.2 | 0.2 | GO:0031838 | haptoglobin-hemoglobin complex(GO:0031838) |
0.2 | 1.5 | GO:0001939 | female pronucleus(GO:0001939) |
0.2 | 0.5 | GO:0030981 | cortical microtubule cytoskeleton(GO:0030981) |
0.2 | 0.7 | GO:0098536 | deuterosome(GO:0098536) |
0.2 | 1.1 | GO:0002178 | palmitoyltransferase complex(GO:0002178) |
0.2 | 0.7 | GO:0072487 | MSL complex(GO:0072487) |
0.2 | 0.7 | GO:0045298 | tubulin complex(GO:0045298) |
0.2 | 2.4 | GO:0034719 | SMN-Sm protein complex(GO:0034719) |
0.2 | 1.0 | GO:0045252 | oxoglutarate dehydrogenase complex(GO:0045252) |
0.2 | 0.5 | GO:0097427 | microtubule bundle(GO:0097427) |
0.2 | 0.5 | GO:0030289 | protein phosphatase 4 complex(GO:0030289) |
0.2 | 1.3 | GO:0070652 | HAUS complex(GO:0070652) |
0.2 | 0.6 | GO:0032021 | NELF complex(GO:0032021) |
0.2 | 1.4 | GO:0005869 | dynactin complex(GO:0005869) |
0.2 | 0.6 | GO:1990246 | uniplex complex(GO:1990246) |
0.2 | 0.2 | GO:0060053 | neurofilament cytoskeleton(GO:0060053) |
0.1 | 0.4 | GO:0090661 | box H/ACA telomerase RNP complex(GO:0090661) |
0.1 | 0.7 | GO:0016281 | eukaryotic translation initiation factor 4F complex(GO:0016281) |
0.1 | 0.7 | GO:0031315 | extrinsic component of mitochondrial outer membrane(GO:0031315) |
0.1 | 2.3 | GO:0097038 | perinuclear endoplasmic reticulum(GO:0097038) |
0.1 | 1.0 | GO:0070187 | telosome(GO:0070187) |
0.1 | 1.8 | GO:0000974 | Prp19 complex(GO:0000974) |
0.1 | 0.8 | GO:0000812 | Swr1 complex(GO:0000812) |
0.1 | 1.7 | GO:0005736 | DNA-directed RNA polymerase I complex(GO:0005736) |
0.1 | 0.4 | GO:0035061 | interchromatin granule(GO:0035061) |
0.1 | 0.4 | GO:0070765 | gamma-secretase complex(GO:0070765) |
0.1 | 1.2 | GO:0032045 | guanyl-nucleotide exchange factor complex(GO:0032045) |
0.1 | 1.4 | GO:0042555 | MCM complex(GO:0042555) |
0.1 | 0.4 | GO:0014701 | junctional sarcoplasmic reticulum membrane(GO:0014701) |
0.1 | 0.5 | GO:0005642 | annulate lamellae(GO:0005642) |
0.1 | 0.4 | GO:0043625 | delta DNA polymerase complex(GO:0043625) |
0.1 | 0.1 | GO:0034715 | pICln-Sm protein complex(GO:0034715) |
0.1 | 0.6 | GO:0097433 | dense body(GO:0097433) |
0.1 | 0.3 | GO:0008275 | gamma-tubulin small complex(GO:0008275) |
0.1 | 1.7 | GO:0030014 | CCR4-NOT complex(GO:0030014) |
0.1 | 0.2 | GO:0034666 | integrin alpha2-beta1 complex(GO:0034666) |
0.1 | 0.9 | GO:0044666 | MLL3/4 complex(GO:0044666) |
0.1 | 2.2 | GO:0005680 | anaphase-promoting complex(GO:0005680) |
0.1 | 0.1 | GO:0034365 | discoidal high-density lipoprotein particle(GO:0034365) |
0.1 | 0.6 | GO:0000138 | Golgi trans cisterna(GO:0000138) |
0.1 | 0.5 | GO:0030062 | mitochondrial tricarboxylic acid cycle enzyme complex(GO:0030062) |
0.1 | 0.4 | GO:0031313 | extrinsic component of endosome membrane(GO:0031313) |
0.1 | 1.0 | GO:0071782 | endoplasmic reticulum tubular network(GO:0071782) |
0.1 | 6.1 | GO:0000118 | histone deacetylase complex(GO:0000118) |
0.1 | 0.7 | GO:0000439 | core TFIIH complex(GO:0000439) |
0.1 | 0.5 | GO:0000220 | vacuolar proton-transporting V-type ATPase, V0 domain(GO:0000220) |
0.1 | 0.5 | GO:0035032 | phosphatidylinositol 3-kinase complex, class III(GO:0035032) |
0.1 | 0.3 | GO:0000783 | telomere cap complex(GO:0000782) nuclear telomere cap complex(GO:0000783) |
0.1 | 0.6 | GO:0005688 | U6 snRNP(GO:0005688) |
0.1 | 0.3 | GO:0097169 | AIM2 inflammasome complex(GO:0097169) |
0.1 | 0.3 | GO:0042719 | mitochondrial intermembrane space protein transporter complex(GO:0042719) |
0.1 | 0.6 | GO:0071437 | invadopodium(GO:0071437) |
0.1 | 0.9 | GO:0030061 | mitochondrial crista(GO:0030061) |
0.1 | 0.3 | GO:0016602 | CCAAT-binding factor complex(GO:0016602) |
0.1 | 0.2 | GO:0097513 | myosin II filament(GO:0097513) |
0.1 | 0.8 | GO:0031371 | ubiquitin conjugating enzyme complex(GO:0031371) |
0.1 | 0.4 | GO:0005955 | calcineurin complex(GO:0005955) |
0.1 | 0.3 | GO:0048179 | activin receptor complex(GO:0048179) |
0.1 | 0.8 | GO:0008385 | IkappaB kinase complex(GO:0008385) |
0.1 | 1.0 | GO:0000346 | transcription export complex(GO:0000346) |
0.1 | 0.3 | GO:0005968 | Rab-protein geranylgeranyltransferase complex(GO:0005968) |
0.1 | 1.5 | GO:0016010 | dystrophin-associated glycoprotein complex(GO:0016010) glycoprotein complex(GO:0090665) |
0.1 | 1.7 | GO:0035145 | exon-exon junction complex(GO:0035145) |
0.1 | 0.9 | GO:0005839 | proteasome core complex(GO:0005839) |
0.1 | 0.3 | GO:0046691 | intracellular canaliculus(GO:0046691) |
0.1 | 0.7 | GO:0061700 | GATOR2 complex(GO:0061700) |
0.1 | 0.5 | GO:0072357 | PTW/PP1 phosphatase complex(GO:0072357) |
0.1 | 0.3 | GO:0030868 | smooth endoplasmic reticulum membrane(GO:0030868) smooth endoplasmic reticulum part(GO:0097425) |
0.1 | 0.1 | GO:0045171 | intercellular bridge(GO:0045171) |
0.1 | 1.2 | GO:0043034 | costamere(GO:0043034) |
0.1 | 0.2 | GO:0097648 | G-protein coupled receptor dimeric complex(GO:0038037) G-protein coupled receptor complex(GO:0097648) |
0.1 | 0.6 | GO:0017101 | aminoacyl-tRNA synthetase multienzyme complex(GO:0017101) |
0.1 | 0.2 | GO:0031094 | platelet dense tubular network(GO:0031094) |
0.1 | 1.5 | GO:0030134 | ER to Golgi transport vesicle(GO:0030134) |
0.1 | 0.5 | GO:0097197 | tetraspanin-enriched microdomain(GO:0097197) |
0.1 | 0.6 | GO:0000276 | mitochondrial proton-transporting ATP synthase complex, coupling factor F(o)(GO:0000276) |
0.1 | 0.7 | GO:0080008 | Cul4-RING E3 ubiquitin ligase complex(GO:0080008) |
0.1 | 1.9 | GO:0097228 | sperm principal piece(GO:0097228) |
0.1 | 0.2 | GO:1990316 | ATG1/ULK1 kinase complex(GO:1990316) |
0.1 | 0.5 | GO:0043219 | lateral loop(GO:0043219) |
0.1 | 0.4 | GO:0014731 | spectrin-associated cytoskeleton(GO:0014731) |
0.1 | 0.5 | GO:0034464 | BBSome(GO:0034464) |
0.1 | 0.2 | GO:0010009 | cytoplasmic side of endosome membrane(GO:0010009) |
0.1 | 0.2 | GO:0005658 | alpha DNA polymerase:primase complex(GO:0005658) |
0.1 | 0.9 | GO:0031597 | cytosolic proteasome complex(GO:0031597) |
0.1 | 0.2 | GO:0097451 | glial limiting end-foot(GO:0097451) |
0.1 | 0.3 | GO:0097651 | phosphatidylinositol 3-kinase complex, class I(GO:0097651) |
0.1 | 0.3 | GO:0000942 | condensed nuclear chromosome outer kinetochore(GO:0000942) |
0.1 | 0.4 | GO:0005675 | holo TFIIH complex(GO:0005675) |
0.1 | 0.8 | GO:0042581 | specific granule(GO:0042581) |
0.1 | 0.4 | GO:0071547 | piP-body(GO:0071547) |
0.1 | 0.4 | GO:0031415 | NatA complex(GO:0031415) |
0.1 | 0.2 | GO:0000814 | ESCRT II complex(GO:0000814) |
0.1 | 0.8 | GO:0005640 | nuclear outer membrane(GO:0005640) |
0.1 | 1.4 | GO:0005875 | microtubule associated complex(GO:0005875) |
0.1 | 0.2 | GO:1990130 | Iml1 complex(GO:1990130) |
0.1 | 0.1 | GO:0090576 | RNA polymerase III transcription factor complex(GO:0090576) |
0.1 | 0.4 | GO:0070776 | H3 histone acetyltransferase complex(GO:0070775) MOZ/MORF histone acetyltransferase complex(GO:0070776) |
0.1 | 0.5 | GO:0036513 | Derlin-1 retrotranslocation complex(GO:0036513) |
0.1 | 0.7 | GO:0005682 | U5 snRNP(GO:0005682) |
0.1 | 0.3 | GO:0097422 | tubular endosome(GO:0097422) |
0.1 | 0.3 | GO:0070688 | MLL5-L complex(GO:0070688) |
0.1 | 0.1 | GO:1990923 | PET complex(GO:1990923) |
0.1 | 0.8 | GO:0030992 | intraciliary transport particle B(GO:0030992) |
0.1 | 0.1 | GO:1990111 | spermatoproteasome complex(GO:1990111) |
0.1 | 1.3 | GO:0097546 | ciliary base(GO:0097546) |
0.1 | 3.5 | GO:0005643 | nuclear pore(GO:0005643) |
0.1 | 0.1 | GO:0044322 | endoplasmic reticulum quality control compartment(GO:0044322) |
0.1 | 3.3 | GO:0005758 | mitochondrial intermembrane space(GO:0005758) |
0.1 | 0.6 | GO:0010369 | chromocenter(GO:0010369) |
0.1 | 1.0 | GO:0000145 | exocyst(GO:0000145) |
0.1 | 0.2 | GO:0019907 | cyclin-dependent protein kinase activating kinase holoenzyme complex(GO:0019907) |
0.1 | 0.4 | GO:0042627 | chylomicron(GO:0042627) |
0.1 | 0.8 | GO:0001891 | phagocytic cup(GO:0001891) |
0.1 | 0.4 | GO:0031931 | TORC1 complex(GO:0031931) |
0.1 | 0.5 | GO:0000506 | glycosylphosphatidylinositol-N-acetylglucosaminyltransferase (GPI-GnT) complex(GO:0000506) |
0.1 | 0.2 | GO:0044462 | cell outer membrane(GO:0009279) cell envelope(GO:0030313) external encapsulating structure part(GO:0044462) |
0.1 | 0.4 | GO:0070419 | nonhomologous end joining complex(GO:0070419) |
0.1 | 0.3 | GO:0042105 | alpha-beta T cell receptor complex(GO:0042105) |
0.1 | 0.4 | GO:0060091 | kinocilium(GO:0060091) |
0.1 | 0.2 | GO:0005767 | secondary lysosome(GO:0005767) |
0.1 | 0.7 | GO:0034663 | endoplasmic reticulum chaperone complex(GO:0034663) |
0.1 | 0.5 | GO:0031332 | RISC complex(GO:0016442) RNAi effector complex(GO:0031332) |
0.1 | 0.2 | GO:0005828 | kinetochore microtubule(GO:0005828) |
0.1 | 0.4 | GO:0033180 | proton-transporting V-type ATPase, V1 domain(GO:0033180) |
0.1 | 0.5 | GO:0031462 | Cul2-RING ubiquitin ligase complex(GO:0031462) |
0.1 | 0.3 | GO:0005664 | origin recognition complex(GO:0000808) nuclear origin of replication recognition complex(GO:0005664) |
0.1 | 2.2 | GO:0000502 | proteasome complex(GO:0000502) |
0.1 | 0.8 | GO:0043196 | varicosity(GO:0043196) |
0.1 | 0.3 | GO:0030056 | hemidesmosome(GO:0030056) |
0.1 | 0.1 | GO:0098827 | endoplasmic reticulum subcompartment(GO:0098827) |
0.1 | 2.3 | GO:0042645 | nucleoid(GO:0009295) mitochondrial nucleoid(GO:0042645) |
0.1 | 0.4 | GO:0072687 | meiotic spindle(GO:0072687) |
0.1 | 1.1 | GO:0031306 | intrinsic component of mitochondrial outer membrane(GO:0031306) |
0.1 | 0.4 | GO:0032591 | dendritic spine membrane(GO:0032591) |
0.1 | 0.2 | GO:0032937 | SREBP-SCAP-Insig complex(GO:0032937) |
0.1 | 0.7 | GO:0043218 | compact myelin(GO:0043218) |
0.1 | 0.2 | GO:1990907 | beta-catenin-TCF complex(GO:1990907) |
0.1 | 0.9 | GO:0000159 | protein phosphatase type 2A complex(GO:0000159) |
0.1 | 0.1 | GO:0030666 | endocytic vesicle membrane(GO:0030666) |
0.1 | 0.4 | GO:0005750 | mitochondrial respiratory chain complex III(GO:0005750) respiratory chain complex III(GO:0045275) |
0.1 | 0.2 | GO:0012510 | trans-Golgi network transport vesicle membrane(GO:0012510) |
0.1 | 0.3 | GO:0045098 | type III intermediate filament(GO:0045098) |
0.1 | 0.2 | GO:0000214 | tRNA-intron endonuclease complex(GO:0000214) |
0.1 | 0.5 | GO:0000815 | ESCRT III complex(GO:0000815) |
0.1 | 0.1 | GO:1990761 | growth cone lamellipodium(GO:1990761) |
0.1 | 0.1 | GO:0032797 | SMN complex(GO:0032797) |
0.0 | 0.5 | GO:0005721 | pericentric heterochromatin(GO:0005721) |
0.0 | 1.4 | GO:0008180 | COP9 signalosome(GO:0008180) |
0.0 | 0.1 | GO:0000015 | phosphopyruvate hydratase complex(GO:0000015) |
0.0 | 0.4 | GO:0031588 | nucleotide-activated protein kinase complex(GO:0031588) |
0.0 | 0.3 | GO:0030681 | nucleolar ribonuclease P complex(GO:0005655) ribonuclease P complex(GO:0030677) multimeric ribonuclease P complex(GO:0030681) |
0.0 | 0.1 | GO:0035861 | site of double-strand break(GO:0035861) |
0.0 | 0.2 | GO:0070044 | synaptobrevin 2-SNAP-25-syntaxin-1a complex(GO:0070044) |
0.0 | 0.1 | GO:0031618 | nuclear pericentric heterochromatin(GO:0031618) |
0.0 | 0.6 | GO:0030904 | retromer complex(GO:0030904) |
0.0 | 0.7 | GO:0030125 | clathrin vesicle coat(GO:0030125) |
0.0 | 3.9 | GO:0030176 | integral component of endoplasmic reticulum membrane(GO:0030176) |
0.0 | 0.3 | GO:0042382 | paraspeckles(GO:0042382) |
0.0 | 0.5 | GO:0031083 | BLOC-1 complex(GO:0031083) |
0.0 | 0.6 | GO:0000177 | cytoplasmic exosome (RNase complex)(GO:0000177) |
0.0 | 0.2 | GO:1990712 | HFE-transferrin receptor complex(GO:1990712) |
0.0 | 0.8 | GO:0042588 | zymogen granule(GO:0042588) |
0.0 | 0.1 | GO:0031430 | M band(GO:0031430) |
0.0 | 0.3 | GO:0005577 | fibrinogen complex(GO:0005577) |
0.0 | 0.2 | GO:0034448 | EGO complex(GO:0034448) Gtr1-Gtr2 GTPase complex(GO:1990131) |
0.0 | 0.3 | GO:0005719 | nuclear euchromatin(GO:0005719) |
0.0 | 0.1 | GO:0005683 | U7 snRNP(GO:0005683) |
0.0 | 0.8 | GO:0008023 | transcription elongation factor complex(GO:0008023) |
0.0 | 1.2 | GO:0005921 | gap junction(GO:0005921) |
0.0 | 0.3 | GO:0008250 | oligosaccharyltransferase complex(GO:0008250) |
0.0 | 0.2 | GO:0005744 | mitochondrial inner membrane presequence translocase complex(GO:0005744) |
0.0 | 0.2 | GO:0097342 | ripoptosome(GO:0097342) |
0.0 | 1.0 | GO:0000307 | cyclin-dependent protein kinase holoenzyme complex(GO:0000307) |
0.0 | 0.3 | GO:0098563 | integral component of synaptic vesicle membrane(GO:0030285) intrinsic component of synaptic vesicle membrane(GO:0098563) |
0.0 | 0.2 | GO:0000137 | Golgi cis cisterna(GO:0000137) |
0.0 | 0.1 | GO:0016939 | kinesin II complex(GO:0016939) |
0.0 | 0.7 | GO:0033017 | sarcoplasmic reticulum membrane(GO:0033017) |
0.0 | 0.0 | GO:0097452 | GAIT complex(GO:0097452) |
0.0 | 0.2 | GO:0000778 | condensed nuclear chromosome kinetochore(GO:0000778) |
0.0 | 0.2 | GO:0032593 | insulin-responsive compartment(GO:0032593) |
0.0 | 0.8 | GO:0034451 | centriolar satellite(GO:0034451) |
0.0 | 0.2 | GO:0000127 | transcription factor TFIIIC complex(GO:0000127) |
0.0 | 0.1 | GO:0036128 | CatSper complex(GO:0036128) |
0.0 | 0.1 | GO:0044233 | ER-mitochondrion membrane contact site(GO:0044233) |
0.0 | 0.3 | GO:0033116 | endoplasmic reticulum-Golgi intermediate compartment membrane(GO:0033116) |
0.0 | 0.1 | GO:0031512 | motile primary cilium(GO:0031512) |
0.0 | 1.2 | GO:0016592 | mediator complex(GO:0016592) |
0.0 | 0.1 | GO:0033648 | host intracellular organelle(GO:0033647) host intracellular membrane-bounded organelle(GO:0033648) |
0.0 | 0.9 | GO:0030687 | preribosome, large subunit precursor(GO:0030687) |
0.0 | 0.2 | GO:0002177 | manchette(GO:0002177) |
0.0 | 0.3 | GO:0031010 | ISWI-type complex(GO:0031010) |
0.0 | 1.1 | GO:0032040 | small-subunit processome(GO:0032040) |
0.0 | 0.0 | GO:0097524 | sperm plasma membrane(GO:0097524) |
0.0 | 1.3 | GO:0000932 | cytoplasmic mRNA processing body(GO:0000932) |
0.0 | 0.2 | GO:0043020 | NADPH oxidase complex(GO:0043020) |
0.0 | 0.2 | GO:0016327 | apicolateral plasma membrane(GO:0016327) |
0.0 | 0.2 | GO:0097225 | sperm midpiece(GO:0097225) |
0.0 | 0.0 | GO:0043293 | apoptosome(GO:0043293) |
0.0 | 0.5 | GO:0000421 | autophagosome membrane(GO:0000421) |
0.0 | 5.4 | GO:0005938 | cell cortex(GO:0005938) |
0.0 | 0.2 | GO:1904115 | axon cytoplasm(GO:1904115) |
0.0 | 1.1 | GO:0000315 | organellar large ribosomal subunit(GO:0000315) mitochondrial large ribosomal subunit(GO:0005762) |
0.0 | 0.0 | GO:0070938 | contractile ring(GO:0070938) |
0.0 | 0.1 | GO:0002199 | zona pellucida receptor complex(GO:0002199) |
0.0 | 0.2 | GO:0038201 | TORC2 complex(GO:0031932) TOR complex(GO:0038201) |
0.0 | 0.1 | GO:0000275 | mitochondrial proton-transporting ATP synthase complex, catalytic core F(1)(GO:0000275) proton-transporting ATP synthase complex, catalytic core F(1)(GO:0045261) |
0.0 | 0.1 | GO:0005914 | spot adherens junction(GO:0005914) |
0.0 | 1.3 | GO:0022627 | cytosolic small ribosomal subunit(GO:0022627) |
0.0 | 0.1 | GO:0033179 | proton-transporting V-type ATPase, V0 domain(GO:0033179) |
0.0 | 0.6 | GO:0090575 | RNA polymerase II transcription factor complex(GO:0090575) |
0.0 | 0.4 | GO:0017119 | Golgi transport complex(GO:0017119) |
0.0 | 0.4 | GO:0005790 | smooth endoplasmic reticulum(GO:0005790) |
0.0 | 0.4 | GO:0045334 | clathrin-coated endocytic vesicle(GO:0045334) |
0.0 | 0.3 | GO:1904949 | ATPase complex(GO:1904949) |
0.0 | 0.3 | GO:0071339 | MLL1/2 complex(GO:0044665) MLL1 complex(GO:0071339) |
0.0 | 0.1 | GO:0042583 | chromaffin granule(GO:0042583) |
0.0 | 0.1 | GO:0051286 | cell tip(GO:0051286) |
0.0 | 2.5 | GO:0000775 | chromosome, centromeric region(GO:0000775) |
0.0 | 0.2 | GO:0030008 | TRAPP complex(GO:0030008) |
0.0 | 2.4 | GO:0072562 | blood microparticle(GO:0072562) |
0.0 | 2.3 | GO:0019867 | outer membrane(GO:0019867) |
0.0 | 0.2 | GO:0070937 | CRD-mediated mRNA stability complex(GO:0070937) |
0.0 | 1.3 | GO:0015630 | microtubule cytoskeleton(GO:0015630) |
0.0 | 0.6 | GO:0055038 | recycling endosome membrane(GO:0055038) |
0.0 | 0.2 | GO:0031143 | pseudopodium(GO:0031143) |
0.0 | 0.1 | GO:0070110 | ciliary neurotrophic factor receptor complex(GO:0070110) |
0.0 | 0.4 | GO:0030057 | desmosome(GO:0030057) |
0.0 | 0.7 | GO:0001772 | immunological synapse(GO:0001772) |
0.0 | 0.4 | GO:0034364 | high-density lipoprotein particle(GO:0034364) |
0.0 | 0.3 | GO:0005671 | Ada2/Gcn5/Ada3 transcription activator complex(GO:0005671) |
0.0 | 0.6 | GO:0032809 | neuronal cell body membrane(GO:0032809) |
0.0 | 2.0 | GO:0016607 | nuclear speck(GO:0016607) |
0.0 | 5.0 | GO:0005789 | endoplasmic reticulum membrane(GO:0005789) |
0.0 | 8.0 | GO:0005743 | mitochondrial inner membrane(GO:0005743) |
0.0 | 4.3 | GO:0016323 | basolateral plasma membrane(GO:0016323) |
0.0 | 2.5 | GO:0005759 | mitochondrial matrix(GO:0005759) |
0.0 | 0.2 | GO:0000788 | nuclear nucleosome(GO:0000788) |
0.0 | 0.2 | GO:0005942 | phosphatidylinositol 3-kinase complex(GO:0005942) |
0.0 | 0.2 | GO:0010494 | cytoplasmic stress granule(GO:0010494) |
0.0 | 0.0 | GO:0097470 | ribbon synapse(GO:0097470) |
0.0 | 1.5 | GO:0031514 | motile cilium(GO:0031514) |
0.0 | 0.2 | GO:0035631 | CD40 receptor complex(GO:0035631) |
0.0 | 0.3 | GO:0030131 | clathrin adaptor complex(GO:0030131) |
0.0 | 0.2 | GO:0036057 | filtration diaphragm(GO:0036056) slit diaphragm(GO:0036057) |
0.0 | 0.4 | GO:0016328 | lateral plasma membrane(GO:0016328) |
0.0 | 0.1 | GO:0005694 | chromosome(GO:0005694) |
0.0 | 0.4 | GO:0031985 | Golgi cisterna(GO:0031985) |
0.0 | 0.1 | GO:0030665 | clathrin-coated vesicle membrane(GO:0030665) |
0.0 | 0.1 | GO:0005899 | insulin receptor complex(GO:0005899) |
0.0 | 4.7 | GO:0005874 | microtubule(GO:0005874) |
0.0 | 7.3 | GO:0000323 | lytic vacuole(GO:0000323) lysosome(GO:0005764) |
0.0 | 0.2 | GO:0005666 | DNA-directed RNA polymerase III complex(GO:0005666) |
0.0 | 2.2 | GO:0005840 | ribosome(GO:0005840) |
0.0 | 0.0 | GO:0036488 | CHOP-C/EBP complex(GO:0036488) |
0.0 | 0.1 | GO:0042575 | DNA polymerase complex(GO:0042575) |
0.0 | 0.0 | GO:0071564 | npBAF complex(GO:0071564) |
0.0 | 6.8 | GO:0005813 | centrosome(GO:0005813) |
0.0 | 0.1 | GO:0000125 | PCAF complex(GO:0000125) |
0.0 | 0.1 | GO:0035327 | transcriptionally active chromatin(GO:0035327) |
0.0 | 0.2 | GO:0044815 | DNA packaging complex(GO:0044815) |
0.0 | 0.0 | GO:0005956 | protein kinase CK2 complex(GO:0005956) |
0.0 | 0.9 | GO:0017053 | transcriptional repressor complex(GO:0017053) |
0.0 | 0.7 | GO:0030173 | integral component of Golgi membrane(GO:0030173) |
0.0 | 0.2 | GO:0016272 | prefoldin complex(GO:0016272) |
0.0 | 0.0 | GO:0031933 | telomeric heterochromatin(GO:0031933) |
0.0 | 0.0 | GO:0030132 | clathrin coat of coated pit(GO:0030132) |
0.0 | 0.1 | GO:0005697 | telomerase holoenzyme complex(GO:0005697) |
0.0 | 0.1 | GO:0005845 | mRNA cap binding complex(GO:0005845) RNA cap binding complex(GO:0034518) |
0.0 | 0.1 | GO:0005663 | DNA replication factor C complex(GO:0005663) |
0.0 | 0.0 | GO:0030686 | 90S preribosome(GO:0030686) |
0.0 | 0.1 | GO:0005795 | Golgi stack(GO:0005795) |
0.0 | 0.2 | GO:0005801 | cis-Golgi network(GO:0005801) |
0.0 | 0.1 | GO:0031209 | SCAR complex(GO:0031209) |
0.0 | 0.1 | GO:0033553 | rDNA heterochromatin(GO:0033553) |
0.0 | 0.3 | GO:0005852 | eukaryotic translation initiation factor 3 complex(GO:0005852) |
0.0 | 0.0 | GO:0036194 | muscle cell projection(GO:0036194) muscle cell projection membrane(GO:0036195) |
0.0 | 8.0 | GO:0005730 | nucleolus(GO:0005730) |
0.0 | 0.0 | GO:0046540 | U4/U6 x U5 tri-snRNP complex(GO:0046540) |
0.0 | 0.0 | GO:0072559 | NLRP3 inflammasome complex(GO:0072559) |
0.0 | 0.1 | GO:0016461 | unconventional myosin complex(GO:0016461) |
0.0 | 0.8 | GO:0031463 | Cul3-RING ubiquitin ligase complex(GO:0031463) |
0.0 | 0.5 | GO:0005819 | spindle(GO:0005819) |
0.0 | 1.3 | GO:0031234 | extrinsic component of cytoplasmic side of plasma membrane(GO:0031234) |
0.0 | 0.1 | GO:0001673 | male germ cell nucleus(GO:0001673) |
0.0 | 0.0 | GO:0044294 | dendritic growth cone(GO:0044294) |
0.0 | 12.8 | GO:0005739 | mitochondrion(GO:0005739) |
0.0 | 0.1 | GO:0030915 | Smc5-Smc6 complex(GO:0030915) |
0.0 | 0.1 | GO:0031907 | peroxisomal matrix(GO:0005782) microbody lumen(GO:0031907) |
0.0 | 0.1 | GO:0000801 | central element(GO:0000801) |
0.0 | 0.1 | GO:0035098 | ESC/E(Z) complex(GO:0035098) |
0.0 | 0.0 | GO:0034361 | very-low-density lipoprotein particle(GO:0034361) triglyceride-rich lipoprotein particle(GO:0034385) |
0.0 | 0.3 | GO:0005657 | replication fork(GO:0005657) |
0.0 | 0.0 | GO:0044308 | axonal spine(GO:0044308) |
0.0 | 0.1 | GO:0020003 | symbiont-containing vacuole(GO:0020003) host cell cytoplasm(GO:0030430) host intracellular part(GO:0033646) host cell cytoplasm part(GO:0033655) intracellular region of host(GO:0043656) |
0.0 | 0.0 | GO:0031092 | platelet alpha granule membrane(GO:0031092) |
0.0 | 0.2 | GO:0000795 | synaptonemal complex(GO:0000795) |
0.0 | 0.3 | GO:0031201 | SNARE complex(GO:0031201) |
0.0 | 15.4 | GO:0005654 | nucleoplasm(GO:0005654) |
0.0 | 0.0 | GO:0090543 | Flemming body(GO:0090543) |
0.0 | 0.0 | GO:0008290 | F-actin capping protein complex(GO:0008290) |
0.0 | 0.0 | GO:0065010 | extracellular membrane-bounded organelle(GO:0065010) |
0.0 | 0.0 | GO:0033588 | Elongator holoenzyme complex(GO:0033588) |
0.0 | 0.1 | GO:0044798 | nuclear transcription factor complex(GO:0044798) |
0.0 | 0.2 | GO:0005905 | clathrin-coated pit(GO:0005905) |
0.0 | 0.0 | GO:0030314 | junctional membrane complex(GO:0030314) |
0.0 | 0.0 | GO:0070939 | Dsl1p complex(GO:0070939) |
0.0 | 0.0 | GO:0005796 | Golgi lumen(GO:0005796) |
0.0 | 0.0 | GO:0043527 | tRNA methyltransferase complex(GO:0043527) |
0.0 | 0.0 | GO:0000178 | exosome (RNase complex)(GO:0000178) |
0.0 | 0.2 | GO:0042612 | MHC class I protein complex(GO:0042612) |
0.0 | 0.0 | GO:0005610 | laminin-5 complex(GO:0005610) |
0.0 | 0.1 | GO:0031235 | intrinsic component of the cytoplasmic side of the plasma membrane(GO:0031235) |
0.0 | 0.2 | GO:0005892 | acetylcholine-gated channel complex(GO:0005892) |
0.0 | 30.1 | GO:0005634 | nucleus(GO:0005634) |
0.0 | 0.6 | GO:0042579 | peroxisome(GO:0005777) microbody(GO:0042579) |
0.0 | 0.0 | GO:0044393 | microspike(GO:0044393) |
0.0 | 0.2 | GO:0016528 | sarcoplasm(GO:0016528) |
0.0 | 0.0 | GO:0031254 | uropod(GO:0001931) cell trailing edge(GO:0031254) |
0.0 | 0.1 | GO:0032588 | trans-Golgi network membrane(GO:0032588) |
0.0 | 0.0 | GO:0019815 | B cell receptor complex(GO:0019815) |
0.0 | 2.0 | GO:0009897 | external side of plasma membrane(GO:0009897) |
0.0 | 0.0 | GO:0000164 | protein phosphatase type 1 complex(GO:0000164) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
2.2 | 6.5 | GO:0015205 | purine nucleobase transmembrane transporter activity(GO:0005345) pyrimidine nucleobase transmembrane transporter activity(GO:0005350) nucleobase transmembrane transporter activity(GO:0015205) |
0.9 | 1.8 | GO:0036042 | long-chain fatty acyl-CoA binding(GO:0036042) |
0.9 | 2.6 | GO:0008525 | phosphatidylcholine transporter activity(GO:0008525) |
0.6 | 2.5 | GO:0030628 | pre-mRNA 3'-splice site binding(GO:0030628) |
0.6 | 1.8 | GO:0008503 | benzodiazepine receptor activity(GO:0008503) |
0.6 | 2.3 | GO:0031721 | hemoglobin alpha binding(GO:0031721) |
0.6 | 3.4 | GO:0004128 | cytochrome-b5 reductase activity, acting on NAD(P)H(GO:0004128) |
0.6 | 1.7 | GO:0046573 | lactonohydrolase activity(GO:0046573) acyl-L-homoserine-lactone lactonohydrolase activity(GO:0102007) |
0.5 | 2.1 | GO:0004740 | pyruvate dehydrogenase (acetyl-transferring) kinase activity(GO:0004740) |
0.5 | 1.5 | GO:0031711 | bradykinin receptor binding(GO:0031711) |
0.4 | 1.3 | GO:0070653 | high-density lipoprotein particle receptor binding(GO:0070653) |
0.4 | 1.2 | GO:0004174 | electron-transferring-flavoprotein dehydrogenase activity(GO:0004174) oxidoreductase activity, acting on the CH-NH group of donors, quinone or similar compound as acceptor(GO:0016649) |
0.4 | 0.4 | GO:0070538 | oleic acid binding(GO:0070538) |
0.4 | 1.5 | GO:0004839 | ubiquitin activating enzyme activity(GO:0004839) |
0.4 | 1.5 | GO:0051434 | BH3 domain binding(GO:0051434) |
0.3 | 1.7 | GO:0008251 | tRNA-specific adenosine deaminase activity(GO:0008251) |
0.3 | 1.3 | GO:0035615 | clathrin adaptor activity(GO:0035615) endocytic adaptor activity(GO:0098748) |
0.3 | 0.3 | GO:0018423 | protein C-terminal leucine carboxyl O-methyltransferase activity(GO:0018423) |
0.3 | 1.2 | GO:0070053 | thrombospondin receptor activity(GO:0070053) |
0.3 | 0.9 | GO:0004477 | methenyltetrahydrofolate cyclohydrolase activity(GO:0004477) methylenetetrahydrofolate dehydrogenase (NAD+) activity(GO:0004487) |
0.3 | 1.7 | GO:0004311 | farnesyltranstransferase activity(GO:0004311) |
0.3 | 1.7 | GO:0003956 | NAD(P)+-protein-arginine ADP-ribosyltransferase activity(GO:0003956) |
0.3 | 5.0 | GO:0035259 | glucocorticoid receptor binding(GO:0035259) |
0.3 | 0.3 | GO:0051377 | mannose-ethanolamine phosphotransferase activity(GO:0051377) |
0.3 | 0.3 | GO:0003933 | GTP cyclohydrolase activity(GO:0003933) |
0.3 | 1.0 | GO:0033300 | dehydroascorbic acid transporter activity(GO:0033300) |
0.3 | 1.3 | GO:0000832 | inositol hexakisphosphate kinase activity(GO:0000828) inositol hexakisphosphate 5-kinase activity(GO:0000832) inositol hexakisphosphate 1-kinase activity(GO:0052723) inositol hexakisphosphate 3-kinase activity(GO:0052724) |
0.3 | 1.5 | GO:0005225 | volume-sensitive anion channel activity(GO:0005225) |
0.2 | 1.0 | GO:0008526 | phosphatidylinositol transporter activity(GO:0008526) |
0.2 | 0.7 | GO:0016520 | growth hormone-releasing hormone receptor activity(GO:0016520) |
0.2 | 2.0 | GO:0004767 | sphingomyelin phosphodiesterase activity(GO:0004767) |
0.2 | 0.7 | GO:0061513 | hexose phosphate transmembrane transporter activity(GO:0015119) organophosphate:inorganic phosphate antiporter activity(GO:0015315) hexose-phosphate:inorganic phosphate antiporter activity(GO:0015526) glucose 6-phosphate:inorganic phosphate antiporter activity(GO:0061513) |
0.2 | 1.0 | GO:0004591 | oxoglutarate dehydrogenase (succinyl-transferring) activity(GO:0004591) |
0.2 | 0.7 | GO:0004949 | cannabinoid receptor activity(GO:0004949) |
0.2 | 0.7 | GO:0043423 | 3-phosphoinositide-dependent protein kinase binding(GO:0043423) |
0.2 | 1.1 | GO:0004887 | thyroid hormone receptor activity(GO:0004887) |
0.2 | 1.1 | GO:0070513 | death domain binding(GO:0070513) |
0.2 | 1.7 | GO:0008430 | selenium binding(GO:0008430) |
0.2 | 0.6 | GO:0071208 | histone pre-mRNA DCP binding(GO:0071208) |
0.2 | 0.6 | GO:0070699 | type II activin receptor binding(GO:0070699) |
0.2 | 1.1 | GO:0004769 | steroid delta-isomerase activity(GO:0004769) |
0.2 | 1.1 | GO:0016530 | metallochaperone activity(GO:0016530) |
0.2 | 0.6 | GO:0050508 | glucuronosyl-N-acetylglucosaminyl-proteoglycan 4-alpha-N-acetylglucosaminyltransferase activity(GO:0050508) |
0.2 | 0.8 | GO:0019158 | fructokinase activity(GO:0008865) mannokinase activity(GO:0019158) |
0.2 | 0.8 | GO:0019788 | NEDD8 transferase activity(GO:0019788) |
0.2 | 0.8 | GO:0004566 | beta-glucuronidase activity(GO:0004566) |
0.2 | 0.8 | GO:0043842 | Kdo transferase activity(GO:0043842) |
0.2 | 2.6 | GO:0070016 | armadillo repeat domain binding(GO:0070016) |
0.2 | 0.8 | GO:0005047 | signal recognition particle binding(GO:0005047) |
0.2 | 0.8 | GO:0033192 | calmodulin-dependent protein phosphatase activity(GO:0033192) |
0.2 | 1.9 | GO:0016888 | endodeoxyribonuclease activity, producing 5'-phosphomonoesters(GO:0016888) |
0.2 | 0.6 | GO:0035650 | AP-1 adaptor complex binding(GO:0035650) |
0.2 | 0.2 | GO:0008193 | tRNA guanylyltransferase activity(GO:0008193) |
0.2 | 1.3 | GO:0098505 | G-rich strand telomeric DNA binding(GO:0098505) |
0.2 | 1.3 | GO:0005078 | MAP-kinase scaffold activity(GO:0005078) |
0.2 | 0.7 | GO:0033592 | RNA strand annealing activity(GO:0033592) |
0.2 | 0.7 | GO:0005173 | stem cell factor receptor binding(GO:0005173) |
0.2 | 1.0 | GO:0005072 | transforming growth factor beta receptor, cytoplasmic mediator activity(GO:0005072) |
0.2 | 0.5 | GO:0003976 | UDP-N-acetylglucosamine-lysosomal-enzyme N-acetylglucosaminephosphotransferase activity(GO:0003976) |
0.2 | 0.6 | GO:0015038 | glutathione disulfide oxidoreductase activity(GO:0015038) |
0.2 | 0.5 | GO:0043125 | ErbB-3 class receptor binding(GO:0043125) |
0.2 | 0.5 | GO:0047756 | chondroitin 4-sulfotransferase activity(GO:0047756) |
0.2 | 0.5 | GO:0016635 | oxidoreductase activity, acting on the CH-CH group of donors, quinone or related compound as acceptor(GO:0016635) |
0.2 | 0.5 | GO:0016647 | oxidoreductase activity, acting on the CH-NH group of donors, oxygen as acceptor(GO:0016647) |
0.1 | 1.8 | GO:0001054 | RNA polymerase I activity(GO:0001054) |
0.1 | 0.4 | GO:0034513 | box H/ACA snoRNA binding(GO:0034513) |
0.1 | 0.4 | GO:0008384 | IkappaB kinase activity(GO:0008384) |
0.1 | 0.6 | GO:0043515 | kinetochore binding(GO:0043515) |
0.1 | 0.6 | GO:0004095 | carnitine O-palmitoyltransferase activity(GO:0004095) |
0.1 | 0.3 | GO:0015928 | fucosidase activity(GO:0015928) |
0.1 | 0.6 | GO:0015232 | heme transporter activity(GO:0015232) |
0.1 | 1.0 | GO:0019966 | interleukin-1 binding(GO:0019966) |
0.1 | 1.8 | GO:0019215 | intermediate filament binding(GO:0019215) |
0.1 | 0.6 | GO:0004792 | thiosulfate sulfurtransferase activity(GO:0004792) |
0.1 | 0.5 | GO:0000213 | tRNA-intron endonuclease activity(GO:0000213) |
0.1 | 0.4 | GO:1990190 | peptide-serine-N-acetyltransferase activity(GO:1990189) peptide-glutamate-N-acetyltransferase activity(GO:1990190) |
0.1 | 0.8 | GO:0031419 | cobalamin binding(GO:0031419) |
0.1 | 1.5 | GO:0048156 | tau protein binding(GO:0048156) |
0.1 | 0.5 | GO:0005025 | transforming growth factor beta receptor activity, type I(GO:0005025) |
0.1 | 0.4 | GO:0060230 | lipoprotein lipase activator activity(GO:0060230) |
0.1 | 1.5 | GO:0045294 | alpha-catenin binding(GO:0045294) |
0.1 | 0.4 | GO:1990460 | leptin receptor binding(GO:1990460) |
0.1 | 2.8 | GO:0070003 | threonine-type endopeptidase activity(GO:0004298) threonine-type peptidase activity(GO:0070003) |
0.1 | 0.8 | GO:0050733 | RS domain binding(GO:0050733) |
0.1 | 0.5 | GO:0034618 | arginine binding(GO:0034618) |
0.1 | 0.8 | GO:0003747 | translation release factor activity(GO:0003747) translation termination factor activity(GO:0008079) |
0.1 | 1.2 | GO:0016857 | racemase and epimerase activity, acting on carbohydrates and derivatives(GO:0016857) |
0.1 | 0.5 | GO:0015204 | urea transmembrane transporter activity(GO:0015204) |
0.1 | 2.2 | GO:0019865 | immunoglobulin binding(GO:0019865) |
0.1 | 1.3 | GO:0034450 | ubiquitin-ubiquitin ligase activity(GO:0034450) |
0.1 | 0.3 | GO:0030492 | hemoglobin binding(GO:0030492) |
0.1 | 2.1 | GO:0004708 | MAP kinase kinase activity(GO:0004708) |
0.1 | 0.9 | GO:0016803 | ether hydrolase activity(GO:0016803) |
0.1 | 0.6 | GO:0015189 | arginine transmembrane transporter activity(GO:0015181) L-lysine transmembrane transporter activity(GO:0015189) |
0.1 | 2.7 | GO:0005385 | zinc ion transmembrane transporter activity(GO:0005385) |
0.1 | 0.6 | GO:0019784 | NEDD8-specific protease activity(GO:0019784) |
0.1 | 0.5 | GO:0031493 | nucleosomal histone binding(GO:0031493) |
0.1 | 0.4 | GO:0008142 | oxysterol binding(GO:0008142) |
0.1 | 3.0 | GO:0003887 | DNA-directed DNA polymerase activity(GO:0003887) |
0.1 | 0.6 | GO:0070290 | N-acylphosphatidylethanolamine-specific phospholipase D activity(GO:0070290) |
0.1 | 0.4 | GO:0005001 | transmembrane receptor protein tyrosine phosphatase activity(GO:0005001) |
0.1 | 0.1 | GO:0071209 | U7 snRNA binding(GO:0071209) |
0.1 | 1.2 | GO:0043008 | ATP-dependent protein binding(GO:0043008) |
0.1 | 0.1 | GO:0070573 | metallodipeptidase activity(GO:0070573) |
0.1 | 0.9 | GO:0003810 | protein-glutamine gamma-glutamyltransferase activity(GO:0003810) |
0.1 | 0.2 | GO:0070548 | L-glutamine aminotransferase activity(GO:0070548) |
0.1 | 0.3 | GO:0003886 | DNA (cytosine-5-)-methyltransferase activity(GO:0003886) DNA (cytosine-5-)-methyltransferase activity, acting on CpG substrates(GO:0051718) |
0.1 | 0.4 | GO:0000293 | ferric-chelate reductase activity(GO:0000293) |
0.1 | 1.2 | GO:0004535 | poly(A)-specific ribonuclease activity(GO:0004535) |
0.1 | 0.5 | GO:0001665 | alpha-N-acetylgalactosaminide alpha-2,6-sialyltransferase activity(GO:0001665) |
0.1 | 0.4 | GO:0017151 | DEAD/H-box RNA helicase binding(GO:0017151) |
0.1 | 1.5 | GO:0005351 | sugar:proton symporter activity(GO:0005351) |
0.1 | 3.1 | GO:0017112 | Rab guanyl-nucleotide exchange factor activity(GO:0017112) |
0.1 | 1.7 | GO:0017049 | GTP-Rho binding(GO:0017049) |
0.1 | 1.5 | GO:0005545 | 1-phosphatidylinositol binding(GO:0005545) |
0.1 | 1.3 | GO:0043138 | 3'-5' DNA helicase activity(GO:0043138) |
0.1 | 0.3 | GO:0055100 | adiponectin binding(GO:0055100) |
0.1 | 0.3 | GO:0004942 | anaphylatoxin receptor activity(GO:0004942) |
0.1 | 1.4 | GO:0005123 | death receptor binding(GO:0005123) |
0.1 | 0.3 | GO:0016262 | protein N-acetylglucosaminyltransferase activity(GO:0016262) |
0.1 | 0.9 | GO:0016846 | carbon-sulfur lyase activity(GO:0016846) |
0.1 | 0.4 | GO:0004332 | fructose-bisphosphate aldolase activity(GO:0004332) |
0.1 | 0.6 | GO:0045545 | syndecan binding(GO:0045545) |
0.1 | 0.3 | GO:0008475 | procollagen-lysine 5-dioxygenase activity(GO:0008475) |
0.1 | 0.3 | GO:0015186 | L-asparagine transmembrane transporter activity(GO:0015182) L-glutamine transmembrane transporter activity(GO:0015186) |
0.1 | 0.9 | GO:0035497 | cAMP response element binding(GO:0035497) |
0.1 | 0.1 | GO:0097200 | cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:0097200) |
0.1 | 0.4 | GO:0016286 | small conductance calcium-activated potassium channel activity(GO:0016286) |
0.1 | 0.4 | GO:0032554 | purine deoxyribonucleotide binding(GO:0032554) |
0.1 | 0.6 | GO:0000182 | rDNA binding(GO:0000182) |
0.1 | 1.8 | GO:0017025 | TBP-class protein binding(GO:0017025) |
0.1 | 1.1 | GO:0008195 | phosphatidate phosphatase activity(GO:0008195) |
0.1 | 0.3 | GO:0004471 | malic enzyme activity(GO:0004470) malate dehydrogenase (decarboxylating) (NAD+) activity(GO:0004471) |
0.1 | 0.2 | GO:0019957 | C-C chemokine binding(GO:0019957) |
0.1 | 0.3 | GO:0045340 | mercury ion binding(GO:0045340) |
0.1 | 0.6 | GO:0000339 | RNA cap binding(GO:0000339) |
0.1 | 0.7 | GO:0009931 | calcium-dependent protein serine/threonine kinase activity(GO:0009931) |
0.1 | 0.7 | GO:0046933 | proton-transporting ATP synthase activity, rotational mechanism(GO:0046933) |
0.1 | 0.4 | GO:0016744 | transferase activity, transferring aldehyde or ketonic groups(GO:0016744) |
0.1 | 0.1 | GO:0060228 | phosphatidylcholine-sterol O-acyltransferase activator activity(GO:0060228) |
0.1 | 0.6 | GO:0005223 | intracellular cGMP activated cation channel activity(GO:0005223) |
0.1 | 0.8 | GO:0008093 | cytoskeletal adaptor activity(GO:0008093) |
0.1 | 0.5 | GO:0032027 | myosin light chain binding(GO:0032027) |
0.1 | 0.3 | GO:0015087 | cobalt ion transmembrane transporter activity(GO:0015087) |
0.1 | 0.3 | GO:0097109 | neuroligin family protein binding(GO:0097109) |
0.1 | 0.3 | GO:0031752 | D5 dopamine receptor binding(GO:0031752) |
0.1 | 0.6 | GO:0050072 | m7G(5')pppN diphosphatase activity(GO:0050072) |
0.1 | 0.8 | GO:0045295 | gamma-catenin binding(GO:0045295) |
0.1 | 1.9 | GO:0005086 | ARF guanyl-nucleotide exchange factor activity(GO:0005086) |
0.1 | 0.3 | GO:0004359 | glutaminase activity(GO:0004359) |
0.1 | 0.3 | GO:0004430 | 1-phosphatidylinositol 4-kinase activity(GO:0004430) |
0.1 | 0.4 | GO:0038132 | neuregulin binding(GO:0038132) |
0.1 | 0.3 | GO:0008379 | thioredoxin peroxidase activity(GO:0008379) |
0.1 | 0.9 | GO:0004312 | fatty acid synthase activity(GO:0004312) |
0.1 | 0.3 | GO:0045134 | uridine-diphosphatase activity(GO:0045134) |
0.1 | 0.4 | GO:0004075 | biotin carboxylase activity(GO:0004075) |
0.1 | 0.1 | GO:0008192 | RNA guanylyltransferase activity(GO:0008192) |
0.1 | 0.4 | GO:0097153 | cysteine-type endopeptidase activity involved in apoptotic process(GO:0097153) |
0.1 | 0.2 | GO:0005176 | ErbB-2 class receptor binding(GO:0005176) |
0.1 | 0.4 | GO:0008454 | alpha-1,3-mannosylglycoprotein 4-beta-N-acetylglucosaminyltransferase activity(GO:0008454) |
0.1 | 0.3 | GO:0071074 | eukaryotic initiation factor eIF2 binding(GO:0071074) |
0.1 | 0.2 | GO:0008898 | S-adenosylmethionine-homocysteine S-methyltransferase activity(GO:0008898) |
0.1 | 0.2 | GO:0004967 | glucagon receptor activity(GO:0004967) |
0.1 | 2.4 | GO:0097472 | cyclin-dependent protein serine/threonine kinase activity(GO:0004693) cyclin-dependent protein kinase activity(GO:0097472) |
0.1 | 1.0 | GO:0016780 | phosphotransferase activity, for other substituted phosphate groups(GO:0016780) |
0.1 | 0.5 | GO:0015288 | porin activity(GO:0015288) |
0.1 | 2.0 | GO:0004712 | protein serine/threonine/tyrosine kinase activity(GO:0004712) |
0.1 | 0.6 | GO:0043495 | protein anchor(GO:0043495) |
0.1 | 0.4 | GO:0010853 | cyclase activator activity(GO:0010853) guanylate cyclase activator activity(GO:0030250) |
0.1 | 0.2 | GO:0015319 | sodium:inorganic phosphate symporter activity(GO:0015319) |
0.1 | 0.5 | GO:0016668 | oxidoreductase activity, acting on a sulfur group of donors, NAD(P) as acceptor(GO:0016668) |
0.1 | 0.4 | GO:0046934 | phosphatidylinositol-4,5-bisphosphate 3-kinase activity(GO:0046934) |
0.1 | 0.3 | GO:0070569 | uridylyltransferase activity(GO:0070569) |
0.1 | 0.9 | GO:0070567 | cytidylyltransferase activity(GO:0070567) |
0.1 | 0.3 | GO:0017162 | aryl hydrocarbon receptor binding(GO:0017162) |
0.1 | 0.5 | GO:0008508 | bile acid:sodium symporter activity(GO:0008508) |
0.1 | 0.3 | GO:0003840 | gamma-glutamyltransferase activity(GO:0003840) glutathione hydrolase activity(GO:0036374) |
0.1 | 0.5 | GO:0003836 | beta-galactoside (CMP) alpha-2,3-sialyltransferase activity(GO:0003836) |
0.1 | 0.2 | GO:0004965 | G-protein coupled GABA receptor activity(GO:0004965) |
0.1 | 0.4 | GO:0008417 | fucosyltransferase activity(GO:0008417) |
0.1 | 0.2 | GO:0004505 | phenylalanine 4-monooxygenase activity(GO:0004505) |
0.1 | 0.2 | GO:0004980 | melanocyte-stimulating hormone receptor activity(GO:0004980) |
0.1 | 0.3 | GO:0052833 | inositol monophosphate 1-phosphatase activity(GO:0008934) inositol monophosphate 3-phosphatase activity(GO:0052832) inositol monophosphate 4-phosphatase activity(GO:0052833) inositol monophosphate phosphatase activity(GO:0052834) |
0.1 | 2.5 | GO:0001102 | RNA polymerase II activating transcription factor binding(GO:0001102) |
0.1 | 0.2 | GO:0008599 | protein phosphatase type 1 regulator activity(GO:0008599) |
0.1 | 0.2 | GO:0019789 | SUMO transferase activity(GO:0019789) |
0.1 | 0.3 | GO:0015057 | thrombin receptor activity(GO:0015057) |
0.1 | 1.2 | GO:0004709 | MAP kinase kinase kinase activity(GO:0004709) |
0.1 | 0.4 | GO:0051021 | GDP-dissociation inhibitor binding(GO:0051021) |
0.1 | 0.2 | GO:0035174 | histone serine kinase activity(GO:0035174) |
0.1 | 0.1 | GO:0071535 | RING-like zinc finger domain binding(GO:0071535) |
0.1 | 0.4 | GO:0015349 | thyroid hormone transmembrane transporter activity(GO:0015349) |
0.1 | 0.4 | GO:0070051 | fibrinogen binding(GO:0070051) |
0.1 | 0.6 | GO:0018448 | pinocarveol dehydrogenase activity(GO:0018446) chloral hydrate dehydrogenase activity(GO:0018447) hydroxymethylmethylsilanediol oxidase activity(GO:0018448) 1-phenylethanol dehydrogenase activity(GO:0018449) myrtenol dehydrogenase activity(GO:0018450) cis-1,2-dihydroxy-1,2-dihydro-8-carboxynaphthalene dehydrogenase activity(GO:0034522) 3-hydroxy-4-methyloctanoyl-CoA dehydrogenase activity(GO:0034582) 2-hydroxy-4-isopropenylcyclohexane-1-carboxyl-CoA dehydrogenase activity(GO:0034778) cis-9,10-dihydroanthracene-9,10-diol dehydrogenase activity(GO:0034817) citronellol dehydrogenase activity(GO:0034821) naphthyl-2-hydroxymethyl-succinyl-CoA dehydrogenase activity(GO:0034847) 2,4,4-trimethyl-1-pentanol dehydrogenase activity(GO:0034863) 2,4,4-trimethyl-3-hydroxypentanoyl-CoA dehydrogenase activity(GO:0034868) 1-hydroxy-4,4-dimethylpentan-3-one dehydrogenase activity(GO:0034871) endosulfan diol dehydrogenase activity(GO:0034891) endosulfan hydroxyether dehydrogenase activity(GO:0034901) 3-hydroxy-2-methylhexanoyl-CoA dehydrogenase activity(GO:0034918) 3-hydroxy-2,6-dimethyl-5-methylene-heptanoyl-CoA dehydrogenase activity(GO:0034944) versicolorin reductase activity(GO:0042469) ketoreductase activity(GO:0045703) |
0.1 | 0.7 | GO:0070180 | large ribosomal subunit rRNA binding(GO:0070180) |
0.1 | 0.2 | GO:0035368 | selenocysteine insertion sequence binding(GO:0035368) |
0.1 | 0.5 | GO:1990381 | ubiquitin-specific protease binding(GO:1990381) |
0.1 | 0.4 | GO:0000900 | translation repressor activity, nucleic acid binding(GO:0000900) |
0.1 | 0.7 | GO:0016500 | protein-hormone receptor activity(GO:0016500) |
0.1 | 0.3 | GO:0019808 | polyamine binding(GO:0019808) |
0.1 | 0.2 | GO:0042577 | lipid phosphatase activity(GO:0042577) |
0.1 | 1.1 | GO:0043027 | cysteine-type endopeptidase inhibitor activity involved in apoptotic process(GO:0043027) |
0.1 | 0.3 | GO:0004165 | dodecenoyl-CoA delta-isomerase activity(GO:0004165) |
0.1 | 4.6 | GO:0004843 | thiol-dependent ubiquitin-specific protease activity(GO:0004843) |
0.1 | 0.5 | GO:0004862 | cAMP-dependent protein kinase inhibitor activity(GO:0004862) |
0.1 | 0.2 | GO:0046935 | 1-phosphatidylinositol-3-kinase regulator activity(GO:0046935) |
0.1 | 0.4 | GO:0035312 | 5'-3' exodeoxyribonuclease activity(GO:0035312) |
0.1 | 0.3 | GO:0070579 | methylcytosine dioxygenase activity(GO:0070579) |
0.1 | 0.1 | GO:0019960 | C-X3-C chemokine binding(GO:0019960) |
0.1 | 0.5 | GO:0016679 | oxidoreductase activity, acting on diphenols and related substances as donors(GO:0016679) |
0.1 | 0.5 | GO:0031434 | mitogen-activated protein kinase kinase binding(GO:0031434) |
0.1 | 0.8 | GO:0008191 | metalloendopeptidase inhibitor activity(GO:0008191) |
0.1 | 0.8 | GO:0070300 | phosphatidic acid binding(GO:0070300) |
0.1 | 2.0 | GO:0031491 | nucleosome binding(GO:0031491) |
0.1 | 0.3 | GO:0004826 | phenylalanine-tRNA ligase activity(GO:0004826) |
0.1 | 0.2 | GO:0001069 | regulatory region RNA binding(GO:0001069) |
0.1 | 0.2 | GO:0030160 | GKAP/Homer scaffold activity(GO:0030160) |
0.1 | 1.9 | GO:0061631 | ubiquitin conjugating enzyme activity(GO:0061631) |
0.1 | 0.4 | GO:0005049 | nuclear export signal receptor activity(GO:0005049) |
0.1 | 1.1 | GO:0017110 | nucleoside-diphosphatase activity(GO:0017110) |
0.1 | 0.4 | GO:0016812 | hydrolase activity, acting on carbon-nitrogen (but not peptide) bonds, in cyclic amides(GO:0016812) |
0.1 | 0.1 | GO:0034739 | histone deacetylase activity (H4-K16 specific)(GO:0034739) |
0.1 | 0.6 | GO:0010314 | phosphatidylinositol-5-phosphate binding(GO:0010314) |
0.1 | 0.2 | GO:0035173 | histone kinase activity(GO:0035173) |
0.1 | 1.4 | GO:0051537 | 2 iron, 2 sulfur cluster binding(GO:0051537) |
0.1 | 0.2 | GO:0043184 | vascular endothelial growth factor receptor 2 binding(GO:0043184) |
0.1 | 4.1 | GO:0003697 | single-stranded DNA binding(GO:0003697) |
0.1 | 0.2 | GO:0004731 | purine-nucleoside phosphorylase activity(GO:0004731) |
0.1 | 0.4 | GO:0031821 | G-protein coupled serotonin receptor binding(GO:0031821) |
0.1 | 0.2 | GO:0004103 | choline kinase activity(GO:0004103) |
0.1 | 0.4 | GO:0016937 | short-branched-chain-acyl-CoA dehydrogenase activity(GO:0016937) |
0.1 | 0.2 | GO:0004999 | vasoactive intestinal polypeptide receptor activity(GO:0004999) |
0.1 | 0.2 | GO:0016833 | oxo-acid-lyase activity(GO:0016833) |
0.1 | 0.5 | GO:0031996 | thioesterase binding(GO:0031996) |
0.1 | 0.5 | GO:0022889 | L-serine transmembrane transporter activity(GO:0015194) serine transmembrane transporter activity(GO:0022889) |
0.1 | 0.8 | GO:0017081 | chloride channel regulator activity(GO:0017081) |
0.1 | 0.2 | GO:0005220 | inositol 1,4,5-trisphosphate-sensitive calcium-release channel activity(GO:0005220) |
0.1 | 0.2 | GO:0034186 | apolipoprotein A-I binding(GO:0034186) |
0.1 | 0.9 | GO:0070412 | R-SMAD binding(GO:0070412) |
0.1 | 0.2 | GO:0061665 | SUMO ligase activity(GO:0061665) |
0.1 | 1.1 | GO:0016676 | cytochrome-c oxidase activity(GO:0004129) heme-copper terminal oxidase activity(GO:0015002) oxidoreductase activity, acting on a heme group of donors(GO:0016675) oxidoreductase activity, acting on a heme group of donors, oxygen as acceptor(GO:0016676) |
0.1 | 0.2 | GO:0003987 | acetate-CoA ligase activity(GO:0003987) |
0.1 | 0.1 | GO:0001884 | pyrimidine nucleoside binding(GO:0001884) |
0.1 | 0.2 | GO:0005095 | GTPase inhibitor activity(GO:0005095) |
0.1 | 0.4 | GO:0002162 | dystroglycan binding(GO:0002162) |
0.1 | 0.2 | GO:0042134 | rRNA primary transcript binding(GO:0042134) |
0.1 | 0.2 | GO:0004813 | alanine-tRNA ligase activity(GO:0004813) |
0.1 | 0.2 | GO:0005381 | iron ion transmembrane transporter activity(GO:0005381) |
0.1 | 8.5 | GO:0061630 | ubiquitin protein ligase activity(GO:0061630) ubiquitin-like protein ligase activity(GO:0061659) |
0.1 | 0.1 | GO:0070411 | I-SMAD binding(GO:0070411) |
0.1 | 1.0 | GO:0005035 | tumor necrosis factor-activated receptor activity(GO:0005031) death receptor activity(GO:0005035) |
0.1 | 0.3 | GO:0035925 | mRNA 3'-UTR AU-rich region binding(GO:0035925) |
0.1 | 0.5 | GO:0008474 | palmitoyl-(protein) hydrolase activity(GO:0008474) palmitoyl hydrolase activity(GO:0098599) |
0.1 | 0.2 | GO:0034040 | lipid-transporting ATPase activity(GO:0034040) |
0.1 | 0.1 | GO:0019153 | protein-disulfide reductase (glutathione) activity(GO:0019153) |
0.1 | 0.1 | GO:0000702 | oxidized base lesion DNA N-glycosylase activity(GO:0000702) |
0.1 | 0.1 | GO:0043546 | molybdopterin cofactor binding(GO:0043546) |
0.1 | 0.2 | GO:0015165 | pyrimidine nucleotide-sugar transmembrane transporter activity(GO:0015165) |
0.1 | 0.1 | GO:0004938 | alpha2-adrenergic receptor activity(GO:0004938) |
0.1 | 0.9 | GO:0017128 | phospholipid scramblase activity(GO:0017128) |
0.1 | 0.7 | GO:0001618 | virus receptor activity(GO:0001618) |
0.1 | 0.6 | GO:0070577 | lysine-acetylated histone binding(GO:0070577) |
0.1 | 0.2 | GO:0005219 | ryanodine-sensitive calcium-release channel activity(GO:0005219) |
0.1 | 0.2 | GO:0043199 | sulfate binding(GO:0043199) |
0.1 | 0.1 | GO:0070991 | medium-chain-acyl-CoA dehydrogenase activity(GO:0070991) |
0.1 | 4.3 | GO:0004896 | cytokine receptor activity(GO:0004896) |
0.1 | 0.6 | GO:0005388 | calcium-transporting ATPase activity(GO:0005388) |
0.1 | 0.1 | GO:0030911 | TPR domain binding(GO:0030911) |
0.1 | 0.3 | GO:0061505 | DNA topoisomerase type II (ATP-hydrolyzing) activity(GO:0003918) DNA topoisomerase II activity(GO:0061505) |
0.1 | 0.2 | GO:0004720 | protein-lysine 6-oxidase activity(GO:0004720) |
0.1 | 0.4 | GO:0004571 | mannosyl-oligosaccharide 1,2-alpha-mannosidase activity(GO:0004571) |
0.1 | 0.5 | GO:0010181 | FMN binding(GO:0010181) |
0.1 | 0.1 | GO:0000009 | alpha-1,6-mannosyltransferase activity(GO:0000009) |
0.1 | 0.1 | GO:0051425 | PTB domain binding(GO:0051425) |
0.1 | 0.5 | GO:0008568 | microtubule-severing ATPase activity(GO:0008568) |
0.0 | 0.1 | GO:0031686 | A1 adenosine receptor binding(GO:0031686) |
0.0 | 0.4 | GO:0030898 | actin-dependent ATPase activity(GO:0030898) |
0.0 | 0.8 | GO:0008139 | nuclear localization sequence binding(GO:0008139) |
0.0 | 2.0 | GO:0070491 | repressing transcription factor binding(GO:0070491) |
0.0 | 0.2 | GO:0005134 | interleukin-2 receptor binding(GO:0005134) |
0.0 | 0.2 | GO:0071933 | Arp2/3 complex binding(GO:0071933) |
0.0 | 0.0 | GO:0030792 | methylarsonite methyltransferase activity(GO:0030792) |
0.0 | 0.7 | GO:0036459 | thiol-dependent ubiquitinyl hydrolase activity(GO:0036459) ubiquitinyl hydrolase activity(GO:0101005) |
0.0 | 0.1 | GO:0003986 | acetyl-CoA hydrolase activity(GO:0003986) |
0.0 | 0.1 | GO:0071532 | ankyrin repeat binding(GO:0071532) |
0.0 | 0.3 | GO:0103116 | alpha-D-galactofuranose transporter activity(GO:0103116) |
0.0 | 0.0 | GO:0008097 | 5S rRNA binding(GO:0008097) |
0.0 | 0.0 | GO:0061676 | importin-alpha family protein binding(GO:0061676) |
0.0 | 0.1 | GO:0031735 | CCR10 chemokine receptor binding(GO:0031735) |
0.0 | 1.2 | GO:0045502 | dynein binding(GO:0045502) |
0.0 | 1.4 | GO:0045543 | sulfonate dioxygenase activity(GO:0000907) 2,4-dichlorophenoxyacetate alpha-ketoglutarate dioxygenase activity(GO:0018602) hypophosphite dioxygenase activity(GO:0034792) gibberellin 2-beta-dioxygenase activity(GO:0045543) C-19 gibberellin 2-beta-dioxygenase activity(GO:0052634) C-20 gibberellin 2-beta-dioxygenase activity(GO:0052635) |
0.0 | 1.5 | GO:0048487 | beta-tubulin binding(GO:0048487) |
0.0 | 1.6 | GO:0000049 | tRNA binding(GO:0000049) |
0.0 | 0.3 | GO:0004439 | phosphatidylinositol-4,5-bisphosphate 5-phosphatase activity(GO:0004439) |
0.0 | 0.5 | GO:0016813 | hydrolase activity, acting on carbon-nitrogen (but not peptide) bonds, in linear amidines(GO:0016813) |
0.0 | 0.7 | GO:0015925 | galactosidase activity(GO:0015925) |
0.0 | 0.3 | GO:0015295 | solute:proton symporter activity(GO:0015295) |
0.0 | 1.7 | GO:0035064 | methylated histone binding(GO:0035064) |
0.0 | 2.1 | GO:0030276 | clathrin binding(GO:0030276) |
0.0 | 0.1 | GO:0015143 | urate transmembrane transporter activity(GO:0015143) salt transmembrane transporter activity(GO:1901702) |
0.0 | 0.9 | GO:0051990 | (R)-2-hydroxyglutarate dehydrogenase activity(GO:0051990) |
0.0 | 0.4 | GO:0004774 | succinate-CoA ligase activity(GO:0004774) |
0.0 | 0.1 | GO:0000104 | succinate dehydrogenase activity(GO:0000104) |
0.0 | 1.7 | GO:0061733 | peptide-lysine-N-acetyltransferase activity(GO:0061733) |
0.0 | 5.1 | GO:0016881 | acid-amino acid ligase activity(GO:0016881) |
0.0 | 0.8 | GO:0050136 | NADH dehydrogenase (ubiquinone) activity(GO:0008137) NADH dehydrogenase (quinone) activity(GO:0050136) |
0.0 | 1.3 | GO:0052771 | coenzyme F390-A hydrolase activity(GO:0052770) coenzyme F390-G hydrolase activity(GO:0052771) |
0.0 | 0.5 | GO:1990841 | promoter-specific chromatin binding(GO:1990841) |
0.0 | 1.0 | GO:0016893 | endoribonuclease activity, producing 5'-phosphomonoesters(GO:0016891) endonuclease activity, active with either ribo- or deoxyribonucleic acids and producing 5'-phosphomonoesters(GO:0016893) |
0.0 | 0.4 | GO:0017160 | Ral GTPase binding(GO:0017160) |
0.0 | 0.1 | GO:0008184 | glycogen phosphorylase activity(GO:0008184) |
0.0 | 0.5 | GO:0004407 | histone deacetylase activity(GO:0004407) |
0.0 | 0.2 | GO:0030983 | mismatched DNA binding(GO:0030983) |
0.0 | 0.1 | GO:0031871 | proteinase activated receptor binding(GO:0031871) |
0.0 | 0.5 | GO:0016290 | palmitoyl-CoA hydrolase activity(GO:0016290) |
0.0 | 0.4 | GO:0034987 | immunoglobulin receptor binding(GO:0034987) |
0.0 | 0.3 | GO:0017166 | vinculin binding(GO:0017166) |
0.0 | 0.1 | GO:0010851 | cyclase regulator activity(GO:0010851) |
0.0 | 0.5 | GO:0046961 | ATPase activity, coupled to transmembrane movement of ions, rotational mechanism(GO:0044769) proton-transporting ATPase activity, rotational mechanism(GO:0046961) |
0.0 | 0.8 | GO:0005537 | mannose binding(GO:0005537) |
0.0 | 0.0 | GO:0042296 | ISG15 transferase activity(GO:0042296) |
0.0 | 0.1 | GO:0097371 | MDM2/MDM4 family protein binding(GO:0097371) |
0.0 | 0.2 | GO:0070181 | small ribosomal subunit rRNA binding(GO:0070181) |
0.0 | 0.2 | GO:0052650 | NADP-retinol dehydrogenase activity(GO:0052650) |
0.0 | 0.2 | GO:0004985 | opioid receptor activity(GO:0004985) |
0.0 | 0.2 | GO:0022820 | potassium:chloride symporter activity(GO:0015379) potassium ion symporter activity(GO:0022820) |
0.0 | 0.2 | GO:0003985 | acetyl-CoA C-acetyltransferase activity(GO:0003985) C-acetyltransferase activity(GO:0016453) |
0.0 | 0.5 | GO:0030676 | Rac guanyl-nucleotide exchange factor activity(GO:0030676) |
0.0 | 0.5 | GO:1901505 | carbohydrate derivative transporter activity(GO:1901505) |
0.0 | 0.2 | GO:1990247 | N6-methyladenosine-containing RNA binding(GO:1990247) |
0.0 | 2.2 | GO:0016820 | hydrolase activity, acting on acid anhydrides, catalyzing transmembrane movement of substances(GO:0016820) |
0.0 | 0.3 | GO:0042288 | MHC class I protein binding(GO:0042288) |
0.0 | 0.2 | GO:1990405 | protein antigen binding(GO:1990405) |
0.0 | 0.1 | GO:0008821 | crossover junction endodeoxyribonuclease activity(GO:0008821) |
0.0 | 0.1 | GO:0004948 | calcitonin receptor activity(GO:0004948) |
0.0 | 0.4 | GO:0045236 | CXCR chemokine receptor binding(GO:0045236) |
0.0 | 0.2 | GO:0005436 | sodium:phosphate symporter activity(GO:0005436) sodium-dependent phosphate transmembrane transporter activity(GO:0015321) |
0.0 | 0.1 | GO:0015222 | serotonin transmembrane transporter activity(GO:0015222) |
0.0 | 0.3 | GO:0043425 | bHLH transcription factor binding(GO:0043425) |
0.0 | 0.0 | GO:0019238 | cyclohydrolase activity(GO:0019238) |
0.0 | 0.1 | GO:0060229 | lipase activator activity(GO:0060229) |
0.0 | 0.2 | GO:0003857 | 3-hydroxyacyl-CoA dehydrogenase activity(GO:0003857) |
0.0 | 0.5 | GO:0008536 | Ran GTPase binding(GO:0008536) |
0.0 | 0.1 | GO:0050145 | nucleoside phosphate kinase activity(GO:0050145) |
0.0 | 0.7 | GO:0000062 | fatty-acyl-CoA binding(GO:0000062) |
0.0 | 0.4 | GO:0004697 | protein kinase C activity(GO:0004697) |
0.0 | 0.4 | GO:0042975 | peroxisome proliferator activated receptor binding(GO:0042975) |
0.0 | 0.4 | GO:0043176 | amine binding(GO:0043176) |
0.0 | 2.9 | GO:0015020 | glucuronosyltransferase activity(GO:0015020) |
0.0 | 0.1 | GO:0042809 | vitamin D receptor binding(GO:0042809) |
0.0 | 0.2 | GO:0047760 | butyrate-CoA ligase activity(GO:0047760) |
0.0 | 0.1 | GO:0003923 | GPI-anchor transamidase activity(GO:0003923) |
0.0 | 0.1 | GO:0004558 | alpha-1,4-glucosidase activity(GO:0004558) |
0.0 | 0.1 | GO:0002046 | opsin binding(GO:0002046) |
0.0 | 0.1 | GO:0098639 | collagen binding involved in cell-matrix adhesion(GO:0098639) |
0.0 | 0.1 | GO:0004661 | protein geranylgeranyltransferase activity(GO:0004661) |
0.0 | 0.1 | GO:0004645 | phosphorylase activity(GO:0004645) |
0.0 | 0.3 | GO:0036312 | phosphatidylinositol 3-kinase regulatory subunit binding(GO:0036312) |
0.0 | 0.7 | GO:0070063 | RNA polymerase binding(GO:0070063) |
0.0 | 0.1 | GO:0000033 | alpha-1,3-mannosyltransferase activity(GO:0000033) |
0.0 | 0.4 | GO:0015643 | toxic substance binding(GO:0015643) |
0.0 | 0.1 | GO:0004793 | threonine aldolase activity(GO:0004793) L-allo-threonine aldolase activity(GO:0008732) |
0.0 | 0.3 | GO:0008889 | glycerophosphodiester phosphodiesterase activity(GO:0008889) |
0.0 | 0.7 | GO:0004190 | aspartic-type endopeptidase activity(GO:0004190) aspartic-type peptidase activity(GO:0070001) |
0.0 | 0.1 | GO:0030021 | extracellular matrix structural constituent conferring compression resistance(GO:0030021) structural constituent of tooth enamel(GO:0030345) |
0.0 | 0.1 | GO:0042301 | phosphate ion binding(GO:0042301) |
0.0 | 0.0 | GO:0048408 | epidermal growth factor binding(GO:0048408) |
0.0 | 0.4 | GO:0070530 | K63-linked polyubiquitin binding(GO:0070530) |
0.0 | 0.1 | GO:0004064 | arylesterase activity(GO:0004064) |
0.0 | 0.9 | GO:0005484 | SNAP receptor activity(GO:0005484) |
0.0 | 0.2 | GO:0051787 | misfolded protein binding(GO:0051787) |
0.0 | 0.1 | GO:0035033 | histone deacetylase regulator activity(GO:0035033) |
0.0 | 0.1 | GO:0030621 | U4 snRNA binding(GO:0030621) |
0.0 | 4.3 | GO:0008017 | microtubule binding(GO:0008017) |
0.0 | 0.0 | GO:0003880 | protein C-terminal carboxyl O-methyltransferase activity(GO:0003880) |
0.0 | 0.1 | GO:0004957 | prostaglandin E receptor activity(GO:0004957) |
0.0 | 0.4 | GO:0015095 | magnesium ion transmembrane transporter activity(GO:0015095) |
0.0 | 0.0 | GO:0070087 | chromo shadow domain binding(GO:0070087) |
0.0 | 3.2 | GO:0004867 | serine-type endopeptidase inhibitor activity(GO:0004867) |
0.0 | 1.4 | GO:0000149 | SNARE binding(GO:0000149) |
0.0 | 0.2 | GO:0015215 | nucleotide transmembrane transporter activity(GO:0015215) |
0.0 | 0.7 | GO:0019706 | protein-cysteine S-palmitoyltransferase activity(GO:0019706) |
0.0 | 0.3 | GO:0004568 | chitinase activity(GO:0004568) |
0.0 | 0.2 | GO:0004499 | N,N-dimethylaniline monooxygenase activity(GO:0004499) |
0.0 | 1.4 | GO:0051087 | chaperone binding(GO:0051087) |
0.0 | 1.5 | GO:0001158 | enhancer sequence-specific DNA binding(GO:0001158) |
0.0 | 0.1 | GO:0017116 | single-stranded DNA-dependent ATP-dependent DNA helicase activity(GO:0017116) |
0.0 | 0.0 | GO:0061629 | RNA polymerase II sequence-specific DNA binding transcription factor binding(GO:0061629) |
0.0 | 0.1 | GO:0032190 | acrosin binding(GO:0032190) |
0.0 | 0.3 | GO:0042800 | histone methyltransferase activity (H3-K4 specific)(GO:0042800) |
0.0 | 0.2 | GO:0016861 | intramolecular oxidoreductase activity, interconverting aldoses and ketoses(GO:0016861) |
0.0 | 0.1 | GO:0090599 | alpha-glucosidase activity(GO:0090599) |
0.0 | 0.1 | GO:0004652 | polynucleotide adenylyltransferase activity(GO:0004652) |
0.0 | 0.8 | GO:0005080 | protein kinase C binding(GO:0005080) |
0.0 | 0.2 | GO:0008157 | protein phosphatase 1 binding(GO:0008157) |
0.0 | 0.6 | GO:0051018 | protein kinase A binding(GO:0051018) |
0.0 | 0.2 | GO:0070182 | DNA polymerase binding(GO:0070182) |
0.0 | 0.1 | GO:0004741 | [pyruvate dehydrogenase (lipoamide)] phosphatase activity(GO:0004741) |
0.0 | 0.2 | GO:0031545 | peptidyl-proline 4-dioxygenase activity(GO:0031545) |
0.0 | 0.1 | GO:0032896 | palmitoyl-CoA 9-desaturase activity(GO:0032896) |
0.0 | 0.4 | GO:0008094 | DNA-dependent ATPase activity(GO:0008094) |
0.0 | 0.2 | GO:0016922 | ligand-dependent nuclear receptor binding(GO:0016922) |
0.0 | 0.4 | GO:0030506 | ankyrin binding(GO:0030506) |
0.0 | 4.4 | GO:0003735 | structural constituent of ribosome(GO:0003735) |
0.0 | 0.3 | GO:0051059 | NF-kappaB binding(GO:0051059) |
0.0 | 0.1 | GO:0004849 | uridine kinase activity(GO:0004849) |
0.0 | 0.1 | GO:0008410 | CoA-transferase activity(GO:0008410) |
0.0 | 0.3 | GO:0043015 | gamma-tubulin binding(GO:0043015) |
0.0 | 0.1 | GO:0046974 | histone methyltransferase activity (H3-K9 specific)(GO:0046974) |
0.0 | 0.0 | GO:0030899 | calcium-dependent ATPase activity(GO:0030899) |
0.0 | 0.2 | GO:0043325 | phosphatidylinositol-3,4-bisphosphate binding(GO:0043325) |
0.0 | 0.1 | GO:0019911 | structural constituent of myelin sheath(GO:0019911) |
0.0 | 0.1 | GO:0004634 | phosphopyruvate hydratase activity(GO:0004634) |
0.0 | 0.1 | GO:0042979 | ornithine decarboxylase regulator activity(GO:0042979) |
0.0 | 1.7 | GO:0008175 | tRNA methyltransferase activity(GO:0008175) |
0.0 | 0.1 | GO:0050700 | CARD domain binding(GO:0050700) |
0.0 | 0.2 | GO:0001595 | angiotensin receptor activity(GO:0001595) |
0.0 | 0.3 | GO:0001056 | RNA polymerase III activity(GO:0001056) |
0.0 | 0.0 | GO:0031802 | type 5 metabotropic glutamate receptor binding(GO:0031802) |
0.0 | 0.3 | GO:0004745 | retinol dehydrogenase activity(GO:0004745) |
0.0 | 0.1 | GO:0099589 | G-protein coupled serotonin receptor activity(GO:0004993) serotonin receptor activity(GO:0099589) |
0.0 | 0.2 | GO:0008171 | O-methyltransferase activity(GO:0008171) |
0.0 | 0.1 | GO:0070034 | telomerase RNA binding(GO:0070034) |
0.0 | 0.1 | GO:0004069 | L-aspartate:2-oxoglutarate aminotransferase activity(GO:0004069) |
0.0 | 0.0 | GO:0008035 | high-density lipoprotein particle binding(GO:0008035) |
0.0 | 0.1 | GO:0004995 | tachykinin receptor activity(GO:0004995) |
0.0 | 0.0 | GO:0004711 | ribosomal protein S6 kinase activity(GO:0004711) |
0.0 | 0.8 | GO:0043130 | ubiquitin binding(GO:0043130) |
0.0 | 0.1 | GO:0048406 | nerve growth factor binding(GO:0048406) |
0.0 | 0.2 | GO:0015129 | lactate transmembrane transporter activity(GO:0015129) |
0.0 | 0.1 | GO:0017150 | tRNA dihydrouridine synthase activity(GO:0017150) |
0.0 | 0.6 | GO:0002039 | p53 binding(GO:0002039) |
0.0 | 0.0 | GO:0045322 | unmethylated CpG binding(GO:0045322) |
0.0 | 0.1 | GO:0034190 | apolipoprotein receptor binding(GO:0034190) |
0.0 | 0.1 | GO:0015377 | cation:chloride symporter activity(GO:0015377) |
0.0 | 0.1 | GO:0004367 | glycerol-3-phosphate dehydrogenase [NAD+] activity(GO:0004367) |
0.0 | 0.2 | GO:0016868 | intramolecular transferase activity, phosphotransferases(GO:0016868) |
0.0 | 0.8 | GO:0051082 | unfolded protein binding(GO:0051082) |
0.0 | 0.2 | GO:0008242 | omega peptidase activity(GO:0008242) |
0.0 | 0.6 | GO:0016875 | aminoacyl-tRNA ligase activity(GO:0004812) ligase activity, forming carbon-oxygen bonds(GO:0016875) ligase activity, forming aminoacyl-tRNA and related compounds(GO:0016876) |
0.0 | 0.1 | GO:0034784 | pivalyl-CoA mutase activity(GO:0034784) o-hydroxylaminobenzoate mutase activity(GO:0034951) lupeol synthase activity(GO:0042299) beta-amyrin synthase activity(GO:0042300) baruol synthase activity(GO:0080011) |
0.0 | 0.1 | GO:0047961 | glycine N-acyltransferase activity(GO:0047961) |
0.0 | 0.1 | GO:0001163 | RNA polymerase I regulatory region sequence-specific DNA binding(GO:0001163) RNA polymerase I CORE element sequence-specific DNA binding(GO:0001164) |
0.0 | 0.0 | GO:0008796 | bis(5'-nucleosyl)-tetraphosphatase activity(GO:0008796) |
0.0 | 0.2 | GO:0071617 | lysophospholipid acyltransferase activity(GO:0071617) |
0.0 | 0.0 | GO:0030284 | estrogen receptor activity(GO:0030284) |
0.0 | 1.7 | GO:0004386 | helicase activity(GO:0004386) |
0.0 | 0.1 | GO:0016832 | aldehyde-lyase activity(GO:0016832) |
0.0 | 0.9 | GO:0004722 | protein serine/threonine phosphatase activity(GO:0004722) |
0.0 | 0.0 | GO:0034235 | GPI anchor binding(GO:0034235) |
0.0 | 0.0 | GO:0005168 | neurotrophin TRKA receptor binding(GO:0005168) |
0.0 | 0.2 | GO:0015149 | hexose transmembrane transporter activity(GO:0015149) |
0.0 | 0.1 | GO:0003696 | satellite DNA binding(GO:0003696) |
0.0 | 0.0 | GO:0005324 | long-chain fatty acid transporter activity(GO:0005324) |
0.0 | 0.0 | GO:0034046 | poly(G) binding(GO:0034046) |
0.0 | 0.3 | GO:0005243 | gap junction channel activity(GO:0005243) |
0.0 | 0.0 | GO:0002054 | nucleobase binding(GO:0002054) |
0.0 | 0.5 | GO:0005158 | insulin receptor binding(GO:0005158) |
0.0 | 0.4 | GO:0004869 | cysteine-type endopeptidase inhibitor activity(GO:0004869) |
0.0 | 0.0 | GO:0050816 | phosphothreonine binding(GO:0050816) |
0.0 | 0.1 | GO:0000400 | four-way junction DNA binding(GO:0000400) |
0.0 | 0.1 | GO:0050681 | androgen receptor binding(GO:0050681) |
0.0 | 1.1 | GO:0008135 | translation factor activity, RNA binding(GO:0008135) |
0.0 | 3.8 | GO:0003682 | chromatin binding(GO:0003682) |
0.0 | 0.0 | GO:0008905 | mannose-phosphate guanylyltransferase activity(GO:0008905) |
0.0 | 0.1 | GO:0043522 | leucine zipper domain binding(GO:0043522) |
0.0 | 0.1 | GO:0047617 | acyl-CoA hydrolase activity(GO:0047617) |
0.0 | 0.1 | GO:0043023 | ribosomal large subunit binding(GO:0043023) |
0.0 | 0.0 | GO:0071987 | WD40-repeat domain binding(GO:0071987) |
0.0 | 0.0 | GO:0015145 | monosaccharide transmembrane transporter activity(GO:0015145) |
0.0 | 0.0 | GO:0034452 | dynactin binding(GO:0034452) |
0.0 | 0.6 | GO:0051117 | ATPase binding(GO:0051117) |
0.0 | 0.1 | GO:0005250 | A-type (transient outward) potassium channel activity(GO:0005250) |
0.0 | 0.5 | GO:0052693 | N-ethylmaleimide reductase activity(GO:0008748) reduced coenzyme F420 dehydrogenase activity(GO:0043738) sulfur oxygenase reductase activity(GO:0043826) malolactic enzyme activity(GO:0043883) epoxyqueuosine reductase activity(GO:0052693) |
0.0 | 0.3 | GO:0001594 | trace-amine receptor activity(GO:0001594) |
0.0 | 0.1 | GO:0031543 | peptidyl-proline dioxygenase activity(GO:0031543) |
0.0 | 0.0 | GO:0032795 | heterotrimeric G-protein binding(GO:0032795) |
0.0 | 0.1 | GO:0009055 | electron carrier activity(GO:0009055) |
0.0 | 0.0 | GO:0016634 | oxidoreductase activity, acting on the CH-CH group of donors, oxygen as acceptor(GO:0016634) |
0.0 | 0.1 | GO:0047372 | acylglycerol lipase activity(GO:0047372) |
0.0 | 0.3 | GO:0001105 | RNA polymerase II transcription coactivator activity(GO:0001105) |
0.0 | 0.5 | GO:0042605 | peptide antigen binding(GO:0042605) |
0.0 | 0.0 | GO:0034481 | chondroitin sulfotransferase activity(GO:0034481) |
0.0 | 0.1 | GO:0008440 | inositol-1,4,5-trisphosphate 3-kinase activity(GO:0008440) |
0.0 | 0.1 | GO:0005534 | galactose binding(GO:0005534) |
0.0 | 0.1 | GO:0008429 | phosphatidylethanolamine binding(GO:0008429) |
0.0 | 0.0 | GO:0047023 | androsterone dehydrogenase activity(GO:0047023) |
0.0 | 0.1 | GO:0016308 | 1-phosphatidylinositol-4-phosphate 5-kinase activity(GO:0016308) |
0.0 | 0.1 | GO:0016176 | superoxide-generating NADPH oxidase activator activity(GO:0016176) |
0.0 | 0.3 | GO:0005528 | macrolide binding(GO:0005527) FK506 binding(GO:0005528) |
0.0 | 0.0 | GO:0004611 | phosphoenolpyruvate carboxykinase activity(GO:0004611) |
0.0 | 0.0 | GO:0030620 | U2 snRNA binding(GO:0030620) |
0.0 | 0.1 | GO:0004385 | guanylate kinase activity(GO:0004385) |
0.0 | 0.0 | GO:0005315 | inorganic phosphate transmembrane transporter activity(GO:0005315) |
0.0 | 0.0 | GO:0070996 | type 1 melanocortin receptor binding(GO:0070996) |
0.0 | 0.1 | GO:0034875 | oxidoreductase activity, acting on CH or CH2 groups, quinone or similar compound as acceptor(GO:0033695) caffeine oxidase activity(GO:0034875) |
0.0 | 0.1 | GO:0070891 | lipoteichoic acid binding(GO:0070891) |
0.0 | 0.0 | GO:0071553 | uridine nucleotide receptor activity(GO:0015065) G-protein coupled pyrimidinergic nucleotide receptor activity(GO:0071553) |
0.0 | 0.1 | GO:0004449 | isocitrate dehydrogenase (NAD+) activity(GO:0004449) |
0.0 | 0.8 | GO:0015171 | amino acid transmembrane transporter activity(GO:0015171) |
0.0 | 0.1 | GO:0016884 | carbon-nitrogen ligase activity, with glutamine as amido-N-donor(GO:0016884) |
0.0 | 0.1 | GO:0001222 | transcription corepressor binding(GO:0001222) |
0.0 | 0.1 | GO:0005172 | vascular endothelial growth factor receptor binding(GO:0005172) |
0.0 | 0.3 | GO:0042166 | acetylcholine binding(GO:0042166) |
0.0 | 0.0 | GO:0019763 | immunoglobulin receptor activity(GO:0019763) |
0.0 | 0.0 | GO:0046978 | TAP1 binding(GO:0046978) TAP2 binding(GO:0046979) |
0.0 | 0.0 | GO:0016936 | galactoside binding(GO:0016936) |
0.0 | 0.0 | GO:0008332 | low voltage-gated calcium channel activity(GO:0008332) |
0.0 | 0.1 | GO:0001784 | phosphotyrosine binding(GO:0001784) |
0.0 | 0.0 | GO:0005128 | erythropoietin receptor binding(GO:0005128) |
0.0 | 0.0 | GO:0000309 | nicotinamide-nucleotide adenylyltransferase activity(GO:0000309) nicotinate-nucleotide adenylyltransferase activity(GO:0004515) |
0.0 | 0.1 | GO:0043024 | ribosomal small subunit binding(GO:0043024) |
0.0 | 0.0 | GO:0098821 | BMP receptor activity(GO:0098821) |
0.0 | 0.1 | GO:0061133 | endopeptidase activator activity(GO:0061133) |
0.0 | 0.4 | GO:0004527 | exonuclease activity(GO:0004527) |
0.0 | 1.8 | GO:0003924 | GTPase activity(GO:0003924) |
0.0 | 0.0 | GO:0001223 | transcription coactivator binding(GO:0001223) |
0.0 | 0.1 | GO:0004594 | pantothenate kinase activity(GO:0004594) |
0.0 | 0.0 | GO:0097642 | calcitonin family receptor activity(GO:0097642) |
0.0 | 0.0 | GO:0072345 | NAADP-sensitive calcium-release channel activity(GO:0072345) |
0.0 | 0.0 | GO:0050542 | icosanoid binding(GO:0050542) arachidonic acid binding(GO:0050544) fatty acid derivative binding(GO:1901567) |
0.0 | 0.0 | GO:0010521 | telomerase inhibitor activity(GO:0010521) |
0.0 | 0.0 | GO:0005275 | amine transmembrane transporter activity(GO:0005275) |
0.0 | 0.0 | GO:0016889 | endodeoxyribonuclease activity, producing 3'-phosphomonoesters(GO:0016889) |
0.0 | 0.0 | GO:0008499 | UDP-galactose:beta-N-acetylglucosamine beta-1,3-galactosyltransferase activity(GO:0008499) |
0.0 | 0.0 | GO:0019237 | centromeric DNA binding(GO:0019237) |
0.0 | 0.1 | GO:0030296 | protein tyrosine kinase activator activity(GO:0030296) |
0.0 | 0.0 | GO:0061135 | endopeptidase regulator activity(GO:0061135) |
0.0 | 0.0 | GO:0002094 | polyprenyltransferase activity(GO:0002094) |
0.0 | 0.1 | GO:0008239 | dipeptidyl-peptidase activity(GO:0008239) |
0.0 | 0.0 | GO:0047184 | 1-acylglycerophosphocholine O-acyltransferase activity(GO:0047184) |
0.0 | 0.0 | GO:0008390 | testosterone 16-alpha-hydroxylase activity(GO:0008390) |
0.0 | 0.1 | GO:0050649 | testosterone 6-beta-hydroxylase activity(GO:0050649) |
0.0 | 0.0 | GO:0003873 | 6-phosphofructo-2-kinase activity(GO:0003873) |
0.0 | 0.0 | GO:0015562 | efflux transmembrane transporter activity(GO:0015562) |
0.0 | 0.1 | GO:0005247 | voltage-gated chloride channel activity(GO:0005247) |
0.0 | 0.2 | GO:0016831 | carboxy-lyase activity(GO:0016831) |
0.0 | 0.0 | GO:0016854 | racemase and epimerase activity(GO:0016854) |
0.0 | 0.1 | GO:0016790 | thiolester hydrolase activity(GO:0016790) |
0.0 | 0.0 | GO:0004052 | arachidonate 12-lipoxygenase activity(GO:0004052) |
0.0 | 0.0 | GO:0008641 | small protein activating enzyme activity(GO:0008641) |
0.0 | 0.0 | GO:0070905 | serine binding(GO:0070905) |
0.0 | 0.2 | GO:0043394 | proteoglycan binding(GO:0043394) |
0.0 | 0.0 | GO:0004739 | pyruvate dehydrogenase (acetyl-transferring) activity(GO:0004739) |
0.0 | 1.2 | GO:0004857 | enzyme inhibitor activity(GO:0004857) |
0.0 | 0.0 | GO:0008502 | melatonin receptor activity(GO:0008502) |
0.0 | 0.1 | GO:0005229 | intracellular calcium activated chloride channel activity(GO:0005229) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.3 | 1.0 | PID INTEGRIN3 PATHWAY | Beta3 integrin cell surface interactions |
0.2 | 1.2 | SA G2 AND M PHASES | Cdc25 activates the cdc2/cyclin B complex to induce the G2/M transition. |
0.1 | 5.3 | PID HNF3A PATHWAY | FOXA1 transcription factor network |
0.1 | 5.8 | PID PLK1 PATHWAY | PLK1 signaling events |
0.1 | 2.3 | PID SMAD2 3PATHWAY | Regulation of cytoplasmic and nuclear SMAD2/3 signaling |
0.1 | 1.3 | PID P38 GAMMA DELTA PATHWAY | Signaling mediated by p38-gamma and p38-delta |
0.1 | 1.7 | PID HIF1A PATHWAY | Hypoxic and oxygen homeostasis regulation of HIF-1-alpha |
0.1 | 5.7 | PID KIT PATHWAY | Signaling events mediated by Stem cell factor receptor (c-Kit) |
0.1 | 3.9 | PID THROMBIN PAR1 PATHWAY | PAR1-mediated thrombin signaling events |
0.1 | 2.7 | PID ARF6 PATHWAY | Arf6 signaling events |
0.1 | 2.8 | PID CERAMIDE PATHWAY | Ceramide signaling pathway |
0.1 | 0.7 | PID IL5 PATHWAY | IL5-mediated signaling events |
0.1 | 1.2 | PID IL8 CXCR2 PATHWAY | IL8- and CXCR2-mediated signaling events |
0.1 | 1.2 | SA MMP CYTOKINE CONNECTION | Cytokines can induce activation of matrix metalloproteinases, which degrade extracellular matrix. |
0.1 | 0.8 | PID IL2 STAT5 PATHWAY | IL2 signaling events mediated by STAT5 |
0.1 | 0.8 | PID ARF6 DOWNSTREAM PATHWAY | Arf6 downstream pathway |
0.1 | 2.1 | PID IL1 PATHWAY | IL1-mediated signaling events |
0.1 | 1.7 | PID IL2 PI3K PATHWAY | IL2 signaling events mediated by PI3K |
0.1 | 1.5 | PID SYNDECAN 2 PATHWAY | Syndecan-2-mediated signaling events |
0.1 | 0.1 | PID SYNDECAN 1 PATHWAY | Syndecan-1-mediated signaling events |
0.1 | 0.6 | PID WNT CANONICAL PATHWAY | Canonical Wnt signaling pathway |
0.1 | 0.6 | PID HIF2PATHWAY | HIF-2-alpha transcription factor network |
0.1 | 2.5 | PID DELTA NP63 PATHWAY | Validated transcriptional targets of deltaNp63 isoforms |
0.1 | 2.1 | PID HNF3B PATHWAY | FOXA2 and FOXA3 transcription factor networks |
0.1 | 0.7 | SA CASPASE CASCADE | Apoptosis is mediated by caspases, cysteine proteases arranged in a proteolytic cascade. |
0.1 | 0.3 | PID EPO PATHWAY | EPO signaling pathway |
0.1 | 1.2 | PID IL6 7 PATHWAY | IL6-mediated signaling events |
0.1 | 0.1 | PID VEGF VEGFR PATHWAY | VEGF and VEGFR signaling network |
0.1 | 0.9 | PID TCPTP PATHWAY | Signaling events mediated by TCPTP |
0.1 | 0.4 | PID AR NONGENOMIC PATHWAY | Nongenotropic Androgen signaling |
0.1 | 1.6 | PID TAP63 PATHWAY | Validated transcriptional targets of TAp63 isoforms |
0.1 | 0.1 | PID INTEGRIN1 PATHWAY | Beta1 integrin cell surface interactions |
0.1 | 0.3 | PID CD40 PATHWAY | CD40/CD40L signaling |
0.0 | 0.3 | SA PTEN PATHWAY | PTEN is a tumor suppressor that dephosphorylates the lipid messenger phosphatidylinositol triphosphate. |
0.0 | 0.2 | PID NECTIN PATHWAY | Nectin adhesion pathway |
0.0 | 0.4 | ST GA12 PATHWAY | G alpha 12 Pathway |
0.0 | 0.9 | PID RHOA PATHWAY | RhoA signaling pathway |
0.0 | 1.6 | PID CDC42 PATHWAY | CDC42 signaling events |
0.0 | 0.8 | PID VEGFR1 2 PATHWAY | Signaling events mediated by VEGFR1 and VEGFR2 |
0.0 | 0.4 | PID P38 MKK3 6PATHWAY | p38 MAPK signaling pathway |
0.0 | 0.3 | PID HIV NEF PATHWAY | HIV-1 Nef: Negative effector of Fas and TNF-alpha |
0.0 | 0.1 | SA G1 AND S PHASES | Cdk2, 4, and 6 bind cyclin D in G1, while cdk2/cyclin E promotes the G1/S transition. |
0.0 | 0.4 | PID INTEGRIN A9B1 PATHWAY | Alpha9 beta1 integrin signaling events |
0.0 | 0.8 | PID INTEGRIN2 PATHWAY | Beta2 integrin cell surface interactions |
0.0 | 0.7 | PID TCR CALCIUM PATHWAY | Calcium signaling in the CD4+ TCR pathway |
0.0 | 1.6 | PID NOTCH PATHWAY | Notch signaling pathway |
0.0 | 0.7 | PID WNT NONCANONICAL PATHWAY | Noncanonical Wnt signaling pathway |
0.0 | 0.4 | PID INSULIN PATHWAY | Insulin Pathway |
0.0 | 0.6 | PID IL23 PATHWAY | IL23-mediated signaling events |
0.0 | 0.5 | PID AURORA A PATHWAY | Aurora A signaling |
0.0 | 0.0 | PID P38 ALPHA BETA PATHWAY | Regulation of p38-alpha and p38-beta |
0.0 | 1.3 | PID CXCR4 PATHWAY | CXCR4-mediated signaling events |
0.0 | 0.7 | PID HIF1 TFPATHWAY | HIF-1-alpha transcription factor network |
0.0 | 0.0 | PID EPHRINB REV PATHWAY | Ephrin B reverse signaling |
0.0 | 0.5 | PID RXR VDR PATHWAY | RXR and RAR heterodimerization with other nuclear receptor |
0.0 | 0.2 | SA REG CASCADE OF CYCLIN EXPR | Expression of cyclins regulates progression through the cell cycle by activating cyclin-dependent kinases. |
0.0 | 0.3 | PID ERBB2 ERBB3 PATHWAY | ErbB2/ErbB3 signaling events |
0.0 | 0.2 | PID UPA UPAR PATHWAY | Urokinase-type plasminogen activator (uPA) and uPAR-mediated signaling |
0.0 | 0.5 | PID NFAT TFPATHWAY | Calcineurin-regulated NFAT-dependent transcription in lymphocytes |
0.0 | 0.2 | ST PHOSPHOINOSITIDE 3 KINASE PATHWAY | PI3K Pathway |
0.0 | 0.8 | PID REG GR PATHWAY | Glucocorticoid receptor regulatory network |
0.0 | 1.9 | PID P53 DOWNSTREAM PATHWAY | Direct p53 effectors |
0.0 | 0.5 | PID ALK1 PATHWAY | ALK1 signaling events |
0.0 | 0.6 | PID ILK PATHWAY | Integrin-linked kinase signaling |
0.0 | 0.5 | PID ATM PATHWAY | ATM pathway |
0.0 | 0.8 | PID MTOR 4PATHWAY | mTOR signaling pathway |
0.0 | 0.3 | SIG CD40PATHWAYMAP | Genes related to CD40 signaling |
0.0 | 0.4 | PID LKB1 PATHWAY | LKB1 signaling events |
0.0 | 1.1 | PID HDAC CLASSI PATHWAY | Signaling events mediated by HDAC Class I |
0.0 | 0.2 | PID PDGFRB PATHWAY | PDGFR-beta signaling pathway |
0.0 | 0.5 | PID AURORA B PATHWAY | Aurora B signaling |
0.0 | 0.6 | PID ERA GENOMIC PATHWAY | Validated nuclear estrogen receptor alpha network |
0.0 | 0.3 | ST ERK1 ERK2 MAPK PATHWAY | ERK1/ERK2 MAPK Pathway |
0.0 | 0.5 | PID TRKR PATHWAY | Neurotrophic factor-mediated Trk receptor signaling |
0.0 | 0.9 | PID MYC ACTIV PATHWAY | Validated targets of C-MYC transcriptional activation |
0.0 | 0.4 | PID AP1 PATHWAY | AP-1 transcription factor network |
0.0 | 0.4 | PID RHODOPSIN PATHWAY | Visual signal transduction: Rods |
0.0 | 0.2 | PID ANGIOPOIETIN RECEPTOR PATHWAY | Angiopoietin receptor Tie2-mediated signaling |
0.0 | 0.6 | PID CMYB PATHWAY | C-MYB transcription factor network |
0.0 | 0.0 | SA PROGRAMMED CELL DEATH | Programmed cell death, or apoptosis, eliminates damaged or unneeded cells. |
0.0 | 0.2 | ST G ALPHA I PATHWAY | G alpha i Pathway |
0.0 | 0.1 | PID VEGFR1 PATHWAY | VEGFR1 specific signals |
0.0 | 0.1 | PID IL2 1PATHWAY | IL2-mediated signaling events |
0.0 | 0.2 | PID RET PATHWAY | Signaling events regulated by Ret tyrosine kinase |
0.0 | 0.3 | PID BETA CATENIN NUC PATHWAY | Regulation of nuclear beta catenin signaling and target gene transcription |
0.0 | 0.0 | SIG CHEMOTAXIS | Genes related to chemotaxis |
0.0 | 0.3 | PID TELOMERASE PATHWAY | Regulation of Telomerase |
0.0 | 0.1 | PID IL27 PATHWAY | IL27-mediated signaling events |
0.0 | 0.2 | PID RAC1 PATHWAY | RAC1 signaling pathway |
0.0 | 0.2 | PID RB 1PATHWAY | Regulation of retinoblastoma protein |
0.0 | 0.1 | SIG INSULIN RECEPTOR PATHWAY IN CARDIAC MYOCYTES | Genes related to the insulin receptor pathway |
0.0 | 0.0 | ST PAC1 RECEPTOR PATHWAY | PAC1 Receptor Pathway |
0.0 | 0.1 | ST JNK MAPK PATHWAY | JNK MAPK Pathway |
0.0 | 0.1 | PID PS1 PATHWAY | Presenilin action in Notch and Wnt signaling |
0.0 | 0.1 | PID CXCR3 PATHWAY | CXCR3-mediated signaling events |
0.0 | 0.1 | PID PRL SIGNALING EVENTS PATHWAY | Signaling events mediated by PRL |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.7 | 6.9 | REACTOME PASSIVE TRANSPORT BY AQUAPORINS | Genes involved in Passive Transport by Aquaporins |
0.3 | 0.6 | REACTOME HIV INFECTION | Genes involved in HIV Infection |
0.2 | 0.2 | REACTOME DESTABILIZATION OF MRNA BY BRF1 | Genes involved in Destabilization of mRNA by Butyrate Response Factor 1 (BRF1) |
0.2 | 1.0 | REACTOME PACKAGING OF TELOMERE ENDS | Genes involved in Packaging Of Telomere Ends |
0.2 | 0.5 | REACTOME CDT1 ASSOCIATION WITH THE CDC6 ORC ORIGIN COMPLEX | Genes involved in CDT1 association with the CDC6:ORC:origin complex |
0.2 | 2.7 | REACTOME P130CAS LINKAGE TO MAPK SIGNALING FOR INTEGRINS | Genes involved in p130Cas linkage to MAPK signaling for integrins |
0.2 | 2.1 | REACTOME REGULATION OF PYRUVATE DEHYDROGENASE PDH COMPLEX | Genes involved in Regulation of pyruvate dehydrogenase (PDH) complex |
0.2 | 1.4 | REACTOME SIGNAL REGULATORY PROTEIN SIRP FAMILY INTERACTIONS | Genes involved in Signal regulatory protein (SIRP) family interactions |
0.1 | 5.4 | REACTOME GLUCOSE TRANSPORT | Genes involved in Glucose transport |
0.1 | 0.1 | REACTOME INSULIN RECEPTOR RECYCLING | Genes involved in Insulin receptor recycling |
0.1 | 1.3 | REACTOME GAMMA CARBOXYLATION TRANSPORT AND AMINO TERMINAL CLEAVAGE OF PROTEINS | Genes involved in Gamma-carboxylation, transport, and amino-terminal cleavage of proteins |
0.1 | 1.2 | REACTOME E2F ENABLED INHIBITION OF PRE REPLICATION COMPLEX FORMATION | Genes involved in E2F-enabled inhibition of pre-replication complex formation |
0.1 | 1.3 | REACTOME RAF MAP KINASE CASCADE | Genes involved in RAF/MAP kinase cascade |
0.1 | 3.2 | REACTOME RNA POL III TRANSCRIPTION INITIATION FROM TYPE 3 PROMOTER | Genes involved in RNA Polymerase III Transcription Initiation From Type 3 Promoter |
0.1 | 1.8 | REACTOME DEADENYLATION OF MRNA | Genes involved in Deadenylation of mRNA |
0.1 | 0.6 | REACTOME HORMONE LIGAND BINDING RECEPTORS | Genes involved in Hormone ligand-binding receptors |
0.1 | 6.7 | REACTOME ER PHAGOSOME PATHWAY | Genes involved in ER-Phagosome pathway |
0.1 | 0.1 | REACTOME CS DS DEGRADATION | Genes involved in CS/DS degradation |
0.1 | 1.7 | REACTOME AUTODEGRADATION OF CDH1 BY CDH1 APC C | Genes involved in Autodegradation of Cdh1 by Cdh1:APC/C |
0.1 | 1.3 | REACTOME MTORC1 MEDIATED SIGNALLING | Genes involved in mTORC1-mediated signalling |
0.1 | 0.2 | REACTOME S PHASE | Genes involved in S Phase |
0.1 | 1.1 | REACTOME SYNTHESIS OF PE | Genes involved in Synthesis of PE |
0.1 | 2.2 | REACTOME G0 AND EARLY G1 | Genes involved in G0 and Early G1 |
0.1 | 1.1 | REACTOME ANDROGEN BIOSYNTHESIS | Genes involved in Androgen biosynthesis |
0.1 | 0.4 | REACTOME RNA POL I PROMOTER OPENING | Genes involved in RNA Polymerase I Promoter Opening |
0.1 | 2.5 | REACTOME SULFUR AMINO ACID METABOLISM | Genes involved in Sulfur amino acid metabolism |
0.1 | 5.5 | REACTOME LOSS OF NLP FROM MITOTIC CENTROSOMES | Genes involved in Loss of Nlp from mitotic centrosomes |
0.1 | 0.5 | REACTOME SIGNALING BY WNT | Genes involved in Signaling by Wnt |
0.1 | 1.0 | REACTOME ROLE OF DCC IN REGULATING APOPTOSIS | Genes involved in Role of DCC in regulating apoptosis |
0.1 | 1.0 | REACTOME SLBP DEPENDENT PROCESSING OF REPLICATION DEPENDENT HISTONE PRE MRNAS | Genes involved in SLBP Dependent Processing of Replication-Dependent Histone Pre-mRNAs |
0.1 | 1.5 | REACTOME ZINC TRANSPORTERS | Genes involved in Zinc transporters |
0.1 | 0.8 | REACTOME METABOLISM OF POLYAMINES | Genes involved in Metabolism of polyamines |
0.1 | 1.1 | REACTOME ACTIVATED NOTCH1 TRANSMITS SIGNAL TO THE NUCLEUS | Genes involved in Activated NOTCH1 Transmits Signal to the Nucleus |
0.1 | 1.5 | REACTOME CHYLOMICRON MEDIATED LIPID TRANSPORT | Genes involved in Chylomicron-mediated lipid transport |
0.1 | 0.1 | REACTOME NEF MEDIATED DOWNREGULATION OF MHC CLASS I COMPLEX CELL SURFACE EXPRESSION | Genes involved in Nef mediated downregulation of MHC class I complex cell surface expression |
0.1 | 1.0 | REACTOME IL 7 SIGNALING | Genes involved in Interleukin-7 signaling |
0.1 | 0.2 | REACTOME VIF MEDIATED DEGRADATION OF APOBEC3G | Genes involved in Vif-mediated degradation of APOBEC3G |
0.1 | 0.7 | REACTOME RECYCLING OF BILE ACIDS AND SALTS | Genes involved in Recycling of bile acids and salts |
0.1 | 0.2 | REACTOME ENDOSOMAL VACUOLAR PATHWAY | Genes involved in Endosomal/Vacuolar pathway |
0.1 | 0.3 | REACTOME PRE NOTCH TRANSCRIPTION AND TRANSLATION | Genes involved in Pre-NOTCH Transcription and Translation |
0.1 | 2.2 | REACTOME ABC FAMILY PROTEINS MEDIATED TRANSPORT | Genes involved in ABC-family proteins mediated transport |
0.1 | 1.0 | REACTOME SIGNALING BY NOTCH2 | Genes involved in Signaling by NOTCH2 |
0.1 | 0.8 | REACTOME ACTIVATION OF CHAPERONES BY ATF6 ALPHA | Genes involved in Activation of Chaperones by ATF6-alpha |
0.1 | 0.2 | REACTOME XENOBIOTICS | Genes involved in Xenobiotics |
0.1 | 1.8 | REACTOME MEIOTIC RECOMBINATION | Genes involved in Meiotic Recombination |
0.1 | 1.5 | REACTOME ACYL CHAIN REMODELLING OF PE | Genes involved in Acyl chain remodelling of PE |
0.1 | 0.7 | REACTOME PHOSPHORYLATION OF CD3 AND TCR ZETA CHAINS | Genes involved in Phosphorylation of CD3 and TCR zeta chains |
0.1 | 0.4 | REACTOME BETA DEFENSINS | Genes involved in Beta defensins |
0.1 | 0.5 | REACTOME GLYCOPROTEIN HORMONES | Genes involved in Glycoprotein hormones |
0.1 | 1.0 | REACTOME MRNA DECAY BY 5 TO 3 EXORIBONUCLEASE | Genes involved in mRNA Decay by 5' to 3' Exoribonuclease |
0.1 | 1.2 | REACTOME SIGNALING BY NODAL | Genes involved in Signaling by NODAL |
0.1 | 0.4 | REACTOME APC C CDH1 MEDIATED DEGRADATION OF CDC20 AND OTHER APC C CDH1 TARGETED PROTEINS IN LATE MITOSIS EARLY G1 | Genes involved in APC/C:Cdh1 mediated degradation of Cdc20 and other APC/C:Cdh1 targeted proteins in late mitosis/early G1 |
0.1 | 0.2 | REACTOME LYSOSOME VESICLE BIOGENESIS | Genes involved in Lysosome Vesicle Biogenesis |
0.1 | 0.4 | REACTOME TRAF3 DEPENDENT IRF ACTIVATION PATHWAY | Genes involved in TRAF3-dependent IRF activation pathway |
0.1 | 0.9 | REACTOME MITOCHONDRIAL FATTY ACID BETA OXIDATION | Genes involved in Mitochondrial Fatty Acid Beta-Oxidation |
0.1 | 0.4 | REACTOME ACTIVATED AMPK STIMULATES FATTY ACID OXIDATION IN MUSCLE | Genes involved in Activated AMPK stimulates fatty-acid oxidation in muscle |
0.1 | 0.7 | REACTOME IKK COMPLEX RECRUITMENT MEDIATED BY RIP1 | Genes involved in IKK complex recruitment mediated by RIP1 |
0.1 | 1.2 | REACTOME SYNTHESIS AND INTERCONVERSION OF NUCLEOTIDE DI AND TRIPHOSPHATES | Genes involved in Synthesis and interconversion of nucleotide di- and triphosphates |
0.1 | 0.4 | REACTOME NRIF SIGNALS CELL DEATH FROM THE NUCLEUS | Genes involved in NRIF signals cell death from the nucleus |
0.1 | 0.7 | REACTOME PURINE CATABOLISM | Genes involved in Purine catabolism |
0.1 | 1.7 | REACTOME NEGATIVE REGULATORS OF RIG I MDA5 SIGNALING | Genes involved in Negative regulators of RIG-I/MDA5 signaling |
0.1 | 1.0 | REACTOME REGULATORY RNA PATHWAYS | Genes involved in Regulatory RNA pathways |
0.1 | 1.4 | REACTOME KINESINS | Genes involved in Kinesins |
0.1 | 0.9 | REACTOME METABOLISM OF PORPHYRINS | Genes involved in Metabolism of porphyrins |
0.1 | 0.8 | REACTOME REGULATION OF HYPOXIA INDUCIBLE FACTOR HIF BY OXYGEN | Genes involved in Regulation of Hypoxia-inducible Factor (HIF) by Oxygen |
0.1 | 0.8 | REACTOME POL SWITCHING | Genes involved in Polymerase switching |
0.1 | 0.4 | REACTOME APOPTOTIC CLEAVAGE OF CELL ADHESION PROTEINS | Genes involved in Apoptotic cleavage of cell adhesion proteins |
0.1 | 0.7 | REACTOME FORMATION OF ATP BY CHEMIOSMOTIC COUPLING | Genes involved in Formation of ATP by chemiosmotic coupling |
0.1 | 1.0 | REACTOME CITRIC ACID CYCLE TCA CYCLE | Genes involved in Citric acid cycle (TCA cycle) |
0.1 | 0.1 | REACTOME ADP SIGNALLING THROUGH P2RY1 | Genes involved in ADP signalling through P2Y purinoceptor 1 |
0.1 | 0.9 | REACTOME METABOLISM OF NON CODING RNA | Genes involved in Metabolism of non-coding RNA |
0.1 | 0.9 | REACTOME ACTIVATED TAK1 MEDIATES P38 MAPK ACTIVATION | Genes involved in activated TAK1 mediates p38 MAPK activation |
0.1 | 0.1 | REACTOME PLATELET ADHESION TO EXPOSED COLLAGEN | Genes involved in Platelet Adhesion to exposed collagen |
0.1 | 2.0 | REACTOME AMINE LIGAND BINDING RECEPTORS | Genes involved in Amine ligand-binding receptors |
0.1 | 0.7 | REACTOME REGULATION OF AMPK ACTIVITY VIA LKB1 | Genes involved in Regulation of AMPK activity via LKB1 |
0.1 | 0.2 | REACTOME DOWNREGULATION OF ERBB2 ERBB3 SIGNALING | Genes involved in Downregulation of ERBB2:ERBB3 signaling |
0.1 | 1.0 | REACTOME PERK REGULATED GENE EXPRESSION | Genes involved in PERK regulated gene expression |
0.1 | 1.7 | REACTOME GLYCOSPHINGOLIPID METABOLISM | Genes involved in Glycosphingolipid metabolism |
0.1 | 0.8 | REACTOME HS GAG DEGRADATION | Genes involved in HS-GAG degradation |
0.1 | 0.7 | REACTOME INTRINSIC PATHWAY | Genes involved in Intrinsic Pathway |
0.1 | 0.6 | REACTOME DOPAMINE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Dopamine Neurotransmitter Release Cycle |
0.0 | 2.1 | REACTOME GOLGI ASSOCIATED VESICLE BIOGENESIS | Genes involved in Golgi Associated Vesicle Biogenesis |
0.0 | 5.5 | REACTOME ANTIGEN PROCESSING UBIQUITINATION PROTEASOME DEGRADATION | Genes involved in Antigen processing: Ubiquitination & Proteasome degradation |
0.0 | 1.0 | REACTOME ENDOSOMAL SORTING COMPLEX REQUIRED FOR TRANSPORT ESCRT | Genes involved in Endosomal Sorting Complex Required For Transport (ESCRT) |
0.0 | 0.6 | REACTOME MRNA CAPPING | Genes involved in mRNA Capping |
0.0 | 0.5 | REACTOME TGF BETA RECEPTOR SIGNALING IN EMT EPITHELIAL TO MESENCHYMAL TRANSITION | Genes involved in TGF-beta receptor signaling in EMT (epithelial to mesenchymal transition) |
0.0 | 0.1 | REACTOME PLATELET SENSITIZATION BY LDL | Genes involved in Platelet sensitization by LDL |
0.0 | 0.4 | REACTOME THROMBIN SIGNALLING THROUGH PROTEINASE ACTIVATED RECEPTORS PARS | Genes involved in Thrombin signalling through proteinase activated receptors (PARs) |
0.0 | 0.0 | REACTOME SCF BETA TRCP MEDIATED DEGRADATION OF EMI1 | Genes involved in SCF-beta-TrCP mediated degradation of Emi1 |
0.0 | 0.3 | REACTOME ELONGATION ARREST AND RECOVERY | Genes involved in Elongation arrest and recovery |
0.0 | 0.5 | REACTOME ADENYLATE CYCLASE INHIBITORY PATHWAY | Genes involved in Adenylate cyclase inhibitory pathway |
0.0 | 0.6 | REACTOME MHC CLASS II ANTIGEN PRESENTATION | Genes involved in MHC class II antigen presentation |
0.0 | 0.7 | REACTOME TERMINATION OF O GLYCAN BIOSYNTHESIS | Genes involved in Termination of O-glycan biosynthesis |
0.0 | 1.5 | REACTOME MITOCHONDRIAL PROTEIN IMPORT | Genes involved in Mitochondrial Protein Import |
0.0 | 0.7 | REACTOME HS GAG BIOSYNTHESIS | Genes involved in HS-GAG biosynthesis |
0.0 | 1.8 | REACTOME NUCLEAR RECEPTOR TRANSCRIPTION PATHWAY | Genes involved in Nuclear Receptor transcription pathway |
0.0 | 0.6 | REACTOME MRNA SPLICING MINOR PATHWAY | Genes involved in mRNA Splicing - Minor Pathway |
0.0 | 0.1 | REACTOME PEPTIDE CHAIN ELONGATION | Genes involved in Peptide chain elongation |
0.0 | 0.2 | REACTOME SEMA3A PAK DEPENDENT AXON REPULSION | Genes involved in Sema3A PAK dependent Axon repulsion |
0.0 | 0.6 | REACTOME DEPOSITION OF NEW CENPA CONTAINING NUCLEOSOMES AT THE CENTROMERE | Genes involved in Deposition of New CENPA-containing Nucleosomes at the Centromere |
0.0 | 0.4 | REACTOME SYNTHESIS OF PC | Genes involved in Synthesis of PC |
0.0 | 0.7 | REACTOME ANTIVIRAL MECHANISM BY IFN STIMULATED GENES | Genes involved in Antiviral mechanism by IFN-stimulated genes |
0.0 | 2.8 | REACTOME PPARA ACTIVATES GENE EXPRESSION | Genes involved in PPARA Activates Gene Expression |
0.0 | 0.5 | REACTOME PRE NOTCH EXPRESSION AND PROCESSING | Genes involved in Pre-NOTCH Expression and Processing |
0.0 | 0.4 | REACTOME SYNTHESIS OF BILE ACIDS AND BILE SALTS VIA 7ALPHA HYDROXYCHOLESTEROL | Genes involved in Synthesis of bile acids and bile salts via 7alpha-hydroxycholesterol |
0.0 | 0.7 | REACTOME CHONDROITIN SULFATE BIOSYNTHESIS | Genes involved in Chondroitin sulfate biosynthesis |
0.0 | 0.4 | REACTOME POST CHAPERONIN TUBULIN FOLDING PATHWAY | Genes involved in Post-chaperonin tubulin folding pathway |
0.0 | 0.3 | REACTOME PYRIMIDINE CATABOLISM | Genes involved in Pyrimidine catabolism |
0.0 | 0.1 | REACTOME TRANSPORT OF MATURE MRNA DERIVED FROM AN INTRONLESS TRANSCRIPT | Genes involved in Transport of Mature mRNA Derived from an Intronless Transcript |
0.0 | 0.3 | REACTOME UNWINDING OF DNA | Genes involved in Unwinding of DNA |
0.0 | 0.4 | REACTOME AMINO ACID AND OLIGOPEPTIDE SLC TRANSPORTERS | Genes involved in Amino acid and oligopeptide SLC transporters |
0.0 | 0.5 | REACTOME IL1 SIGNALING | Genes involved in Interleukin-1 signaling |
0.0 | 0.6 | REACTOME DARPP 32 EVENTS | Genes involved in DARPP-32 events |
0.0 | 0.2 | REACTOME REGULATION OF ORNITHINE DECARBOXYLASE ODC | Genes involved in Regulation of ornithine decarboxylase (ODC) |
0.0 | 0.9 | REACTOME AMINO ACID TRANSPORT ACROSS THE PLASMA MEMBRANE | Genes involved in Amino acid transport across the plasma membrane |
0.0 | 0.1 | REACTOME REGULATION OF THE FANCONI ANEMIA PATHWAY | Genes involved in Regulation of the Fanconi anemia pathway |
0.0 | 0.2 | REACTOME RNA POL III TRANSCRIPTION INITIATION FROM TYPE 2 PROMOTER | Genes involved in RNA Polymerase III Transcription Initiation From Type 2 Promoter |
0.0 | 0.2 | REACTOME ELEVATION OF CYTOSOLIC CA2 LEVELS | Genes involved in Elevation of cytosolic Ca2+ levels |
0.0 | 0.0 | REACTOME INHIBITION OF REPLICATION INITIATION OF DAMAGED DNA BY RB1 E2F1 | Genes involved in Inhibition of replication initiation of damaged DNA by RB1/E2F1 |
0.0 | 1.1 | REACTOME ACTIVATION OF CHAPERONE GENES BY XBP1S | Genes involved in Activation of Chaperone Genes by XBP1(S) |
0.0 | 0.4 | REACTOME SYNTHESIS OF SUBSTRATES IN N GLYCAN BIOSYTHESIS | Genes involved in Synthesis of substrates in N-glycan biosythesis |
0.0 | 0.2 | REACTOME FACILITATIVE NA INDEPENDENT GLUCOSE TRANSPORTERS | Genes involved in Facilitative Na+-independent glucose transporters |
0.0 | 0.4 | REACTOME TRANSPORT OF MATURE TRANSCRIPT TO CYTOPLASM | Genes involved in Transport of Mature Transcript to Cytoplasm |
0.0 | 0.3 | REACTOME PURINE SALVAGE | Genes involved in Purine salvage |
0.0 | 0.5 | REACTOME GLUTATHIONE CONJUGATION | Genes involved in Glutathione conjugation |
0.0 | 1.2 | REACTOME GENERIC TRANSCRIPTION PATHWAY | Genes involved in Generic Transcription Pathway |
0.0 | 0.4 | REACTOME BIOSYNTHESIS OF THE N GLYCAN PRECURSOR DOLICHOL LIPID LINKED OLIGOSACCHARIDE LLO AND TRANSFER TO A NASCENT PROTEIN | Genes involved in Biosynthesis of the N-glycan precursor (dolichol lipid-linked oligosaccharide, LLO) and transfer to a nascent protein |
0.0 | 0.2 | REACTOME CASPASE MEDIATED CLEAVAGE OF CYTOSKELETAL PROTEINS | Genes involved in Caspase-mediated cleavage of cytoskeletal proteins |
0.0 | 0.7 | REACTOME TRANSPORT TO THE GOLGI AND SUBSEQUENT MODIFICATION | Genes involved in Transport to the Golgi and subsequent modification |
0.0 | 0.5 | REACTOME STEROID HORMONES | Genes involved in Steroid hormones |
0.0 | 0.2 | REACTOME CLEAVAGE OF GROWING TRANSCRIPT IN THE TERMINATION REGION | Genes involved in Cleavage of Growing Transcript in the Termination Region |
0.0 | 0.2 | REACTOME CREATION OF C4 AND C2 ACTIVATORS | Genes involved in Creation of C4 and C2 activators |
0.0 | 1.1 | REACTOME ACTIVATION OF THE MRNA UPON BINDING OF THE CAP BINDING COMPLEX AND EIFS AND SUBSEQUENT BINDING TO 43S | Genes involved in Activation of the mRNA upon binding of the cap-binding complex and eIFs, and subsequent binding to 43S |
0.0 | 0.2 | REACTOME TRAFFICKING AND PROCESSING OF ENDOSOMAL TLR | Genes involved in Trafficking and processing of endosomal TLR |
0.0 | 0.2 | REACTOME NOD1 2 SIGNALING PATHWAY | Genes involved in NOD1/2 Signaling Pathway |
0.0 | 0.3 | REACTOME BOTULINUM NEUROTOXICITY | Genes involved in Botulinum neurotoxicity |
0.0 | 0.7 | REACTOME PROTEIN FOLDING | Genes involved in Protein folding |
0.0 | 0.3 | REACTOME G1 PHASE | Genes involved in G1 Phase |
0.0 | 1.2 | REACTOME INFLUENZA VIRAL RNA TRANSCRIPTION AND REPLICATION | Genes involved in Influenza Viral RNA Transcription and Replication |
0.0 | 1.0 | REACTOME CHEMOKINE RECEPTORS BIND CHEMOKINES | Genes involved in Chemokine receptors bind chemokines |
0.0 | 0.0 | REACTOME CIRCADIAN REPRESSION OF EXPRESSION BY REV ERBA | Genes involved in Circadian Repression of Expression by REV-ERBA |
0.0 | 0.1 | REACTOME P2Y RECEPTORS | Genes involved in P2Y receptors |
0.0 | 0.3 | REACTOME CLASS C 3 METABOTROPIC GLUTAMATE PHEROMONE RECEPTORS | Genes involved in Class C/3 (Metabotropic glutamate/pheromone receptors) |
0.0 | 0.1 | REACTOME AQUAPORIN MEDIATED TRANSPORT | Genes involved in Aquaporin-mediated transport |
0.0 | 0.1 | REACTOME RNA POL I TRANSCRIPTION TERMINATION | Genes involved in RNA Polymerase I Transcription Termination |
0.0 | 0.2 | REACTOME GLUTAMATE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Glutamate Neurotransmitter Release Cycle |
0.0 | 0.1 | REACTOME DIGESTION OF DIETARY CARBOHYDRATE | Genes involved in Digestion of dietary carbohydrate |
0.0 | 0.4 | REACTOME EFFECTS OF PIP2 HYDROLYSIS | Genes involved in Effects of PIP2 hydrolysis |
0.0 | 0.0 | REACTOME DESTABILIZATION OF MRNA BY TRISTETRAPROLIN TTP | Genes involved in Destabilization of mRNA by Tristetraprolin (TTP) |
0.0 | 0.2 | REACTOME PYRIMIDINE METABOLISM | Genes involved in Pyrimidine metabolism |
0.0 | 0.8 | REACTOME PI METABOLISM | Genes involved in PI Metabolism |
0.0 | 0.2 | REACTOME FATTY ACID TRIACYLGLYCEROL AND KETONE BODY METABOLISM | Genes involved in Fatty acid, triacylglycerol, and ketone body metabolism |
0.0 | 0.1 | REACTOME APOPTOSIS INDUCED DNA FRAGMENTATION | Genes involved in Apoptosis induced DNA fragmentation |
0.0 | 0.2 | REACTOME PRESYNAPTIC NICOTINIC ACETYLCHOLINE RECEPTORS | Genes involved in Presynaptic nicotinic acetylcholine receptors |
0.0 | 0.0 | REACTOME SIGNALING BY ERBB2 | Genes involved in Signaling by ERBB2 |
0.0 | 0.1 | REACTOME G ALPHA Q SIGNALLING EVENTS | Genes involved in G alpha (q) signalling events |
0.0 | 0.1 | REACTOME GLUCURONIDATION | Genes involved in Glucuronidation |
0.0 | 0.2 | REACTOME CIRCADIAN CLOCK | Genes involved in Circadian Clock |
0.0 | 0.1 | REACTOME PROSTANOID LIGAND RECEPTORS | Genes involved in Prostanoid ligand receptors |
0.0 | 0.0 | REACTOME G PROTEIN ACTIVATION | Genes involved in G-protein activation |
0.0 | 0.1 | REACTOME REGULATION OF COMPLEMENT CASCADE | Genes involved in Regulation of Complement cascade |
0.0 | 0.1 | REACTOME HYALURONAN UPTAKE AND DEGRADATION | Genes involved in Hyaluronan uptake and degradation |
0.0 | 0.1 | REACTOME REGULATION OF IFNG SIGNALING | Genes involved in Regulation of IFNG signaling |
0.0 | 0.3 | REACTOME GLUCONEOGENESIS | Genes involved in Gluconeogenesis |
0.0 | 0.0 | REACTOME TAK1 ACTIVATES NFKB BY PHOSPHORYLATION AND ACTIVATION OF IKKS COMPLEX | Genes involved in TAK1 activates NFkB by phosphorylation and activation of IKKs complex |
0.0 | 0.4 | REACTOME TRANSPORT OF VITAMINS NUCLEOSIDES AND RELATED MOLECULES | Genes involved in Transport of vitamins, nucleosides, and related molecules |
0.0 | 0.2 | REACTOME SYNTHESIS OF VERY LONG CHAIN FATTY ACYL COAS | Genes involved in Synthesis of very long-chain fatty acyl-CoAs |
0.0 | 0.3 | REACTOME TRANSFERRIN ENDOCYTOSIS AND RECYCLING | Genes involved in Transferrin endocytosis and recycling |
0.0 | 0.5 | REACTOME GLUCAGON TYPE LIGAND RECEPTORS | Genes involved in Glucagon-type ligand receptors |
0.0 | 0.0 | REACTOME CD28 DEPENDENT VAV1 PATHWAY | Genes involved in CD28 dependent Vav1 pathway |
0.0 | 0.1 | REACTOME A TETRASACCHARIDE LINKER SEQUENCE IS REQUIRED FOR GAG SYNTHESIS | Genes involved in A tetrasaccharide linker sequence is required for GAG synthesis |
0.0 | 0.2 | REACTOME INFLAMMASOMES | Genes involved in Inflammasomes |
0.0 | 0.1 | REACTOME GABA SYNTHESIS RELEASE REUPTAKE AND DEGRADATION | Genes involved in GABA synthesis, release, reuptake and degradation |
0.0 | 0.1 | REACTOME ADVANCED GLYCOSYLATION ENDPRODUCT RECEPTOR SIGNALING | Genes involved in Advanced glycosylation endproduct receptor signaling |
0.0 | 0.1 | REACTOME EXTRINSIC PATHWAY FOR APOPTOSIS | Genes involved in Extrinsic Pathway for Apoptosis |
0.0 | 0.1 | REACTOME NONSENSE MEDIATED DECAY ENHANCED BY THE EXON JUNCTION COMPLEX | Genes involved in Nonsense Mediated Decay Enhanced by the Exon Junction Complex |
0.0 | 0.1 | REACTOME PLATELET CALCIUM HOMEOSTASIS | Genes involved in Platelet calcium homeostasis |