Gene Symbol | Gene ID | Gene Info |
---|---|---|
Gmeb1
|
ENSMUSG00000028901.7 | Gmeb1 |
CRE | Gene | Distance | Association probability | Pearson corr. coef. | P-value | Plot |
---|---|---|---|---|---|---|
Gmeb1 | chr4_132261591_132261774 | 80 | 0.910301 | 0.75 | 6.0e-11 | Click! |
Gmeb1 | chr4_132260660_132261341 | 521 | 0.516045 | 0.66 | 3.5e-08 | Click! |
Gmeb1 | chr4_132261904_132262055 | 377 | 0.646150 | 0.64 | 1.2e-07 | Click! |
Gmeb1 | chr4_132247566_132247721 | 1575 | 0.158991 | 0.46 | 4.2e-04 | Click! |
Gmeb1 | chr4_132234845_132234996 | 14 | 0.937812 | 0.05 | 7.0e-01 | Click! |
Move your cursor over a bar to see sample name and corresponding Z-value.
Cis Regulatory Element (CRE) | Target Score | Top associated gene | Gene Info | Distance of CRE to TSS | CRE/Gene association probability |
---|---|---|---|---|---|
chr19_32359184_32359393 | 2.94 |
Sgms1 |
sphingomyelin synthase 1 |
9972 |
0.19 |
chr2_173152672_173153088 | 2.43 |
Pck1 |
phosphoenolpyruvate carboxykinase 1, cytosolic |
168 |
0.95 |
chr7_80534267_80534427 | 2.37 |
Blm |
Bloom syndrome, RecQ like helicase |
651 |
0.67 |
chr8_14888182_14888655 | 2.24 |
Cln8 |
CLN8 transmembrane ER and ERGIC protein |
307 |
0.9 |
chr3_14886091_14887033 | 2.23 |
Car2 |
carbonic anhydrase 2 |
77 |
0.97 |
chr10_61544152_61544753 | 2.14 |
Gm47594 |
predicted gene, 47594 |
26459 |
0.1 |
chr16_90177436_90177587 | 1.98 |
Gm7307 |
predicted gene 7307 |
14331 |
0.15 |
chr7_120875584_120875916 | 1.93 |
Gm15774 |
predicted gene 15774 |
452 |
0.45 |
chr5_23432721_23432928 | 1.90 |
5031425E22Rik |
RIKEN cDNA 5031425E22 gene |
485 |
0.7 |
chr11_4035757_4035908 | 1.90 |
Sec14l4 |
SEC14-like lipid binding 4 |
3990 |
0.13 |
chr17_24362637_24362819 | 1.86 |
Gm25618 |
predicted gene, 25618 |
184 |
0.88 |
chr6_134700538_134701162 | 1.75 |
Borcs5 |
BLOC-1 related complex subunit 5 |
700 |
0.61 |
chr12_84204731_84204889 | 1.73 |
Gm31513 |
predicted gene, 31513 |
8841 |
0.11 |
chr6_87661849_87662015 | 1.70 |
Gm44097 |
predicted gene, 44097 |
4178 |
0.13 |
chr6_36175191_36175478 | 1.69 |
Gm43443 |
predicted gene 43443 |
13765 |
0.28 |
chr15_8569801_8569984 | 1.67 |
Gm49250 |
predicted gene, 49250 |
40301 |
0.11 |
chr13_46930401_46930639 | 1.66 |
Kif13a |
kinesin family member 13A |
653 |
0.61 |
chr11_103102675_103103532 | 1.66 |
Acbd4 |
acyl-Coenzyme A binding domain containing 4 |
5 |
0.95 |
chr5_51868314_51868494 | 1.61 |
Gm43606 |
predicted gene 43606 |
9629 |
0.17 |
chr14_31428304_31428502 | 1.59 |
Sh3bp5 |
SH3-domain binding protein 5 (BTK-associated) |
7662 |
0.15 |
chr3_108327338_108327659 | 1.59 |
Sort1 |
sortilin 1 |
27969 |
0.07 |
chr1_151619279_151619636 | 1.58 |
Fam129a |
family with sequence similarity 129, member A |
47961 |
0.12 |
chr16_87612556_87612731 | 1.57 |
Gm22808 |
predicted gene, 22808 |
8477 |
0.2 |
chr7_120861739_120862019 | 1.56 |
Eef2k |
eukaryotic elongation factor-2 kinase |
10690 |
0.13 |
chr10_20503767_20503918 | 1.54 |
Gm17229 |
predicted gene 17229 |
14322 |
0.21 |
chr4_141870986_141871283 | 1.54 |
Efhd2 |
EF hand domain containing 2 |
3786 |
0.13 |
chr7_111179367_111179913 | 1.51 |
1700012D14Rik |
RIKEN cDNA 1700012D14 gene |
56956 |
0.11 |
chr1_39425558_39425731 | 1.50 |
Gm37265 |
predicted gene, 37265 |
5712 |
0.18 |
chr14_8099840_8099998 | 1.49 |
Pxk |
PX domain containing serine/threonine kinase |
1664 |
0.36 |
chr4_86690175_86690553 | 1.48 |
Plin2 |
perilipin 2 |
20304 |
0.17 |
chr5_31698378_31698642 | 1.47 |
Babam2 |
BRISC and BRCA1 A complex member 2 |
459 |
0.62 |
chr6_55342334_55342687 | 1.47 |
Aqp1 |
aquaporin 1 |
6078 |
0.17 |
chr3_108562098_108562631 | 1.47 |
Tmem167b |
transmembrane protein 167B |
102 |
0.92 |
chr17_31855866_31856073 | 1.44 |
Sik1 |
salt inducible kinase 1 |
165 |
0.94 |
chr9_61370339_61371660 | 1.44 |
Gm10655 |
predicted gene 10655 |
628 |
0.63 |
chr1_166002288_166003185 | 1.44 |
Pou2f1 |
POU domain, class 2, transcription factor 1 |
58 |
0.72 |
chr17_84957544_84957954 | 1.44 |
1110020A21Rik |
RIKEN cDNA 1110020A21 gene |
39 |
0.77 |
chr10_128493802_128494117 | 1.42 |
Myl6 |
myosin, light polypeptide 6, alkali, smooth muscle and non-muscle |
59 |
0.91 |
chr13_62908154_62908567 | 1.41 |
Fbp1 |
fructose bisphosphatase 1 |
20078 |
0.13 |
chr19_61057665_61057910 | 1.41 |
Gm22520 |
predicted gene, 22520 |
44242 |
0.12 |
chr19_57713206_57713357 | 1.40 |
Atrnl1 |
attractin like 1 |
102247 |
0.07 |
chr13_80885089_80885255 | 1.40 |
1700023H06Rik |
RIKEN cDNA 1700023H06 gene |
352 |
0.76 |
chr1_82836309_82836627 | 1.40 |
Gm22396 |
predicted gene, 22396 |
2978 |
0.13 |
chr7_118532929_118533139 | 1.40 |
Coq7 |
demethyl-Q 7 |
263 |
0.9 |
chr2_104590618_104591031 | 1.39 |
Cstf3 |
cleavage stimulation factor, 3' pre-RNA, subunit 3 |
206 |
0.9 |
chr5_99284500_99284682 | 1.39 |
Gm35394 |
predicted gene, 35394 |
10496 |
0.23 |
chr10_95291520_95291671 | 1.38 |
Gm48880 |
predicted gene, 48880 |
23258 |
0.13 |
chr4_126202831_126203382 | 1.37 |
Thrap3 |
thyroid hormone receptor associated protein 3 |
346 |
0.78 |
chr2_119898364_119898546 | 1.37 |
Mga |
MAX gene associated |
1150 |
0.44 |
chr5_130200680_130200989 | 1.36 |
Rabgef1 |
RAB guanine nucleotide exchange factor (GEF) 1 |
6219 |
0.1 |
chr4_154025644_154026533 | 1.36 |
Smim1 |
small integral membrane protein 1 |
51 |
0.95 |
chr19_4096651_4097007 | 1.35 |
Cdk2ap2 |
CDK2-associated protein 2 |
353 |
0.65 |
chr19_37442831_37443030 | 1.34 |
Hhex |
hematopoietically expressed homeobox |
6191 |
0.13 |
chr16_17638547_17638739 | 1.34 |
Smpd4 |
sphingomyelin phosphodiesterase 4 |
56 |
0.95 |
chr1_64787464_64787940 | 1.34 |
Plekhm3 |
pleckstrin homology domain containing, family M, member 3 |
49062 |
0.1 |
chr11_78245651_78245816 | 1.33 |
Sdf2 |
stromal cell derived factor 2 |
13 |
0.76 |
chr8_83585335_83585534 | 1.30 |
Gm45823 |
predicted gene 45823 |
91 |
0.93 |
chr8_36685476_36685694 | 1.29 |
Dlc1 |
deleted in liver cancer 1 |
47469 |
0.18 |
chr11_101086864_101087041 | 1.29 |
Mlx |
MAX-like protein X |
325 |
0.74 |
chr5_108694436_108695224 | 1.29 |
Fgfrl1 |
fibroblast growth factor receptor-like 1 |
328 |
0.81 |
chr4_129276500_129276803 | 1.29 |
Gm22994 |
predicted gene, 22994 |
6295 |
0.12 |
chr9_44567755_44567911 | 1.28 |
Cxcr5 |
chemokine (C-X-C motif) receptor 5 |
5956 |
0.09 |
chr7_79259206_79259503 | 1.28 |
Gm31510 |
predicted gene, 31510 |
13457 |
0.14 |
chr1_43098367_43098560 | 1.27 |
Tgfbrap1 |
transforming growth factor, beta receptor associated protein 1 |
99 |
0.7 |
chr2_90661416_90661595 | 1.27 |
Nup160 |
nucleoporin 160 |
15710 |
0.19 |
chr6_126939455_126939771 | 1.27 |
Rad51ap1 |
RAD51 associated protein 1 |
26 |
0.83 |
chr6_120039566_120039987 | 1.27 |
Wnk1 |
WNK lysine deficient protein kinase 1 |
1104 |
0.47 |
chr1_91080381_91080716 | 1.26 |
Lrrfip1 |
leucine rich repeat (in FLII) interacting protein 1 |
26962 |
0.16 |
chr2_167924845_167925406 | 1.24 |
Ptpn1 |
protein tyrosine phosphatase, non-receptor type 1 |
6932 |
0.19 |
chr13_73443093_73443461 | 1.23 |
Lpcat1 |
lysophosphatidylcholine acyltransferase 1 |
23920 |
0.19 |
chr6_37442094_37442881 | 1.22 |
Creb3l2 |
cAMP responsive element binding protein 3-like 2 |
341 |
0.92 |
chr6_87662289_87662458 | 1.21 |
Gm44097 |
predicted gene, 44097 |
4619 |
0.13 |
chr7_128854662_128855004 | 1.20 |
Gm25778 |
predicted gene, 25778 |
28486 |
0.15 |
chr18_74444048_74444226 | 1.19 |
Myo5b |
myosin VB |
1530 |
0.39 |
chr2_75683398_75683552 | 1.19 |
Gm24996 |
predicted gene, 24996 |
3363 |
0.16 |
chr11_23305787_23305938 | 1.18 |
Usp34 |
ubiquitin specific peptidase 34 |
1033 |
0.56 |
chr11_69096542_69097348 | 1.18 |
Per1 |
period circadian clock 1 |
1728 |
0.15 |
chr13_76018055_76018421 | 1.17 |
Rfesd |
Rieske (Fe-S) domain containing |
230 |
0.88 |
chr15_99724323_99725930 | 1.17 |
Cox14 |
cytochrome c oxidase assembly protein 14 |
521 |
0.41 |
chr11_11733080_11733257 | 1.17 |
Gm12000 |
predicted gene 12000 |
36729 |
0.13 |
chr11_32605437_32605622 | 1.17 |
Stk10 |
serine/threonine kinase 10 |
16934 |
0.2 |
chr9_35116070_35117303 | 1.17 |
4930581F22Rik |
RIKEN cDNA 4930581F22 gene |
42 |
0.69 |
chr4_86886186_86886590 | 1.16 |
Acer2 |
alkaline ceramidase 2 |
11974 |
0.21 |
chr6_31145797_31145976 | 1.15 |
Gm37728 |
predicted gene, 37728 |
1533 |
0.28 |
chr19_34877947_34878527 | 1.15 |
Pank1 |
pantothenate kinase 1 |
320 |
0.88 |
chr13_52822329_52822509 | 1.15 |
BB123696 |
expressed sequence BB123696 |
65214 |
0.12 |
chr8_119670595_119671169 | 1.15 |
Gm32352 |
predicted gene, 32352 |
1 |
0.96 |
chr16_8637214_8637589 | 1.15 |
Pmm2 |
phosphomannomutase 2 |
273 |
0.5 |
chr4_139387042_139387343 | 1.14 |
Ubr4 |
ubiquitin protein ligase E3 component n-recognin 4 |
6523 |
0.12 |
chr16_55781925_55782128 | 1.14 |
Gm26369 |
predicted gene, 26369 |
2882 |
0.26 |
chr13_13954963_13955179 | 1.13 |
B3galnt2 |
UDP-GalNAc:betaGlcNAc beta 1,3-galactosaminyltransferase, polypeptide 2 |
397 |
0.75 |
chr11_6291318_6291683 | 1.13 |
Ogdh |
oxoglutarate (alpha-ketoglutarate) dehydrogenase (lipoamide) |
133 |
0.93 |
chr10_39432725_39432913 | 1.13 |
Gm6963 |
predicted gene 6963 |
7823 |
0.21 |
chr6_43337631_43337850 | 1.12 |
Nobox |
NOBOX oogenesis homeobox |
28186 |
0.12 |
chr8_10914614_10914775 | 1.12 |
3930402G23Rik |
RIKEN cDNA 3930402G23 gene |
13750 |
0.09 |
chr9_61339619_61339770 | 1.12 |
Gm10655 |
predicted gene 10655 |
31933 |
0.15 |
chr17_14990902_14991058 | 1.11 |
9030025P20Rik |
RIKEN cDNA 9030025P20 gene |
11481 |
0.1 |
chr5_93206745_93206954 | 1.11 |
2010109A12Rik |
RIKEN cDNA 2010109A12 gene |
316 |
0.5 |
chr7_132575729_132575929 | 1.11 |
Oat |
ornithine aminotransferase |
111 |
0.96 |
chr17_15053571_15053727 | 1.11 |
Ermard |
ER membrane associated RNA degradation |
590 |
0.67 |
chr6_140546653_140546821 | 1.10 |
Plekha5 |
pleckstrin homology domain containing, family A member 5 |
2584 |
0.34 |
chr11_119428664_119428855 | 1.10 |
Rnf213 |
ring finger protein 213 |
35659 |
0.11 |
chr2_49451967_49452295 | 1.10 |
Epc2 |
enhancer of polycomb homolog 2 |
645 |
0.79 |
chr16_97610844_97611343 | 1.09 |
Tmprss2 |
transmembrane protease, serine 2 |
95 |
0.97 |
chr2_164737848_164738020 | 1.08 |
Wfdc3 |
WAP four-disulfide core domain 3 |
5378 |
0.08 |
chr2_121956618_121956943 | 1.08 |
Ctdspl2 |
CTD (carboxy-terminal domain, RNA polymerase II, polypeptide A) small phosphatase like 2 |
121 |
0.89 |
chr17_15022271_15022433 | 1.08 |
Gm3435 |
predicted gene 3435 |
12017 |
0.11 |
chr14_8098298_8098902 | 1.07 |
Pxk |
PX domain containing serine/threonine kinase |
345 |
0.88 |
chr15_36716214_36716736 | 1.07 |
Gm49263 |
predicted gene, 49263 |
7172 |
0.15 |
chr16_17270032_17270183 | 1.07 |
Tmem191c |
transmembrane protein 191C |
5970 |
0.12 |
chr11_119126513_119126714 | 1.07 |
Gm11755 |
predicted gene 11755 |
11808 |
0.13 |
chr12_17507244_17507446 | 1.07 |
Odc1 |
ornithine decarboxylase, structural 1 |
37449 |
0.12 |
chr1_37347409_37347570 | 1.07 |
Inpp4a |
inositol polyphosphate-4-phosphatase, type I |
9908 |
0.14 |
chr15_41788849_41789548 | 1.07 |
Oxr1 |
oxidation resistance 1 |
183 |
0.64 |
chr16_19884186_19884483 | 1.07 |
A930003A15Rik |
RIKEN cDNA A930003A15 gene |
60 |
0.84 |
chr4_8689860_8690380 | 1.07 |
Chd7 |
chromodomain helicase DNA binding protein 7 |
286 |
0.93 |
chr15_38079084_38079362 | 1.06 |
Gm49312 |
predicted gene, 49312 |
121 |
0.78 |
chr6_56901863_56902058 | 1.06 |
Nt5c3 |
5'-nucleotidase, cytosolic III |
74 |
0.96 |
chr14_119006528_119007145 | 1.06 |
Uggt2 |
UDP-glucose glycoprotein glucosyltransferase 2 |
119 |
0.97 |
chr16_91597948_91598208 | 1.06 |
Tmem50b |
transmembrane protein 50B |
278 |
0.83 |
chr4_151823125_151823276 | 1.06 |
Camta1 |
calmodulin binding transcription activator 1 |
38450 |
0.17 |
chr1_91459004_91459242 | 1.06 |
Per2 |
period circadian clock 2 |
201 |
0.9 |
chr2_148046536_148046746 | 1.05 |
Foxa2 |
forkhead box A2 |
255 |
0.9 |
chr12_54162465_54163130 | 1.05 |
Egln3 |
egl-9 family hypoxia-inducible factor 3 |
41063 |
0.13 |
chr14_14351950_14353283 | 1.05 |
Il3ra |
interleukin 3 receptor, alpha chain |
2995 |
0.15 |
chr19_24999677_24999851 | 1.04 |
Dock8 |
dedicator of cytokinesis 8 |
220 |
0.94 |
chr12_69646368_69646533 | 1.04 |
Sos2 |
SOS Ras/Rho guanine nucleotide exchange factor 2 |
29331 |
0.13 |
chrX_7899224_7899430 | 1.04 |
Timm17b |
translocase of inner mitochondrial membrane 17b |
30 |
0.51 |
chr4_33031224_33031991 | 1.03 |
Ube2j1 |
ubiquitin-conjugating enzyme E2J 1 |
79 |
0.75 |
chr10_127508848_127510720 | 1.03 |
Stac3 |
SH3 and cysteine rich domain 3 |
2559 |
0.15 |
chr1_153487898_153488152 | 1.03 |
Dhx9 |
DEAH (Asp-Glu-Ala-His) box polypeptide 9 |
365 |
0.85 |
chr6_118963312_118963644 | 1.02 |
Cacna1c |
calcium channel, voltage-dependent, L type, alpha 1C subunit |
116529 |
0.06 |
chr15_81522170_81522661 | 1.02 |
Gm5218 |
predicted gene 5218 |
22870 |
0.11 |
chr1_184675628_184676155 | 1.02 |
Gm38358 |
predicted gene, 38358 |
19143 |
0.14 |
chr17_5893214_5893395 | 1.01 |
Gm8376 |
predicted gene 8376 |
45783 |
0.1 |
chr9_78533358_78533557 | 1.01 |
Gm47430 |
predicted gene, 47430 |
12911 |
0.13 |
chr13_74733722_74734048 | 1.01 |
Cast |
calpastatin |
346 |
0.89 |
chr5_99336655_99336806 | 1.01 |
Gm35394 |
predicted gene, 35394 |
62635 |
0.12 |
chr3_149811186_149811406 | 1.01 |
Gm31121 |
predicted gene, 31121 |
150900 |
0.04 |
chrX_103616321_103616657 | 1.01 |
Ftx |
Ftx transcript, Xist regulator (non-protein coding) |
346 |
0.76 |
chr2_69135675_69135888 | 1.00 |
Nostrin |
nitric oxide synthase trafficker |
19 |
0.98 |
chr15_11802353_11802504 | 1.00 |
Npr3 |
natriuretic peptide receptor 3 |
88560 |
0.07 |
chrX_7947774_7948496 | 1.00 |
Hdac6 |
histone deacetylase 6 |
246 |
0.81 |
chr6_49096972_49097479 | 1.00 |
Igf2bp3 |
insulin-like growth factor 2 mRNA binding protein 3 |
3014 |
0.16 |
chr6_73232141_73232347 | 1.00 |
Gm40377 |
predicted gene, 40377 |
9194 |
0.17 |
chr6_143166517_143167346 | 1.00 |
Etnk1 |
ethanolamine kinase 1 |
290 |
0.88 |
chr2_180042362_180042537 | 0.99 |
Psma7 |
proteasome subunit alpha 7 |
16 |
0.52 |
chr6_135065234_135065761 | 0.99 |
Gprc5a |
G protein-coupled receptor, family C, group 5, member A |
154 |
0.94 |
chr2_84519488_84520043 | 0.99 |
Gm13710 |
predicted gene 13710 |
11557 |
0.16 |
chr6_112696574_112696767 | 0.99 |
Rad18 |
RAD18 E3 ubiquitin protein ligase |
0 |
0.98 |
chr19_21598923_21599076 | 0.98 |
1110059E24Rik |
RIKEN cDNA 1110059E24 gene |
5320 |
0.24 |
chr2_38950276_38950825 | 0.98 |
Gm13473 |
predicted gene 13473 |
11207 |
0.1 |
chr13_93499641_93500021 | 0.98 |
Jmy |
junction-mediating and regulatory protein |
23 |
0.98 |
chr12_72760597_72761228 | 0.97 |
Ppm1a |
protein phosphatase 1A, magnesium dependent, alpha isoform |
111 |
0.97 |
chr4_55353166_55353317 | 0.97 |
Rad23b |
RAD23 homolog B, nucleotide excision repair protein |
3151 |
0.21 |
chr14_69261775_69261926 | 0.97 |
Gm27222 |
predicted gene 27222 |
2704 |
0.15 |
chr1_87650598_87650818 | 0.97 |
Inpp5d |
inositol polyphosphate-5-phosphatase D |
25531 |
0.15 |
chr18_47585531_47585742 | 0.97 |
Gm5095 |
predicted gene 5095 |
47901 |
0.15 |
chr7_112788365_112788757 | 0.97 |
Tead1 |
TEA domain family member 1 |
29015 |
0.19 |
chr6_146577671_146578047 | 0.96 |
Fgfr1op2 |
FGFR1 oncogene partner 2 |
0 |
0.5 |
chr4_150784890_150785122 | 0.96 |
Gm13049 |
predicted gene 13049 |
40727 |
0.13 |
chr2_29972356_29972557 | 0.96 |
Sptan1 |
spectrin alpha, non-erythrocytic 1 |
5924 |
0.12 |
chr4_154160973_154161381 | 0.95 |
Tprgl |
transformation related protein 63 regulated like |
511 |
0.68 |
chr19_47454755_47455010 | 0.95 |
Sh3pxd2a |
SH3 and PX domains 2A |
9365 |
0.2 |
chr8_10879176_10879327 | 0.95 |
B930025P03Rik |
RIKEN cDNA B930025P03 gene |
3184 |
0.14 |
chr7_126862086_126862870 | 0.95 |
Hirip3 |
HIRA interacting protein 3 |
3 |
0.57 |
chr3_69859829_69860171 | 0.95 |
Sptssb |
serine palmitoyltransferase, small subunit B |
60 |
0.98 |
chr5_123641600_123641767 | 0.95 |
Clip1 |
CAP-GLY domain containing linker protein 1 |
5409 |
0.13 |
chr12_70227533_70227906 | 0.95 |
Pygl |
liver glycogen phosphorylase |
36 |
0.6 |
chr17_17373690_17374333 | 0.94 |
AC154200.1 |
novel transcript |
195 |
0.62 |
chr13_95961565_95961742 | 0.94 |
Sv2c |
synaptic vesicle glycoprotein 2c |
23197 |
0.19 |
chr15_95887488_95887691 | 0.94 |
Gm25070 |
predicted gene, 25070 |
7772 |
0.19 |
chr11_30648868_30649937 | 0.94 |
Acyp2 |
acylphosphatase 2, muscle type |
185 |
0.95 |
chr5_64345191_64345628 | 0.94 |
Gm43838 |
predicted gene 43838 |
15105 |
0.14 |
chr9_7184877_7185459 | 0.93 |
Dcun1d5 |
DCN1, defective in cullin neddylation 1, domain containing 5 (S. cerevisiae) |
617 |
0.49 |
chr10_24948265_24948731 | 0.93 |
Gm36172 |
predicted gene, 36172 |
20879 |
0.13 |
chr14_69480027_69480178 | 0.93 |
Gm37094 |
predicted gene, 37094 |
20288 |
0.1 |
chr16_14291316_14291502 | 0.93 |
Myh11 |
myosin, heavy polypeptide 11, smooth muscle |
37 |
0.97 |
chr5_114569794_114570108 | 0.93 |
Fam222a |
family with sequence similarity 222, member A |
1934 |
0.29 |
chr6_21949844_21950121 | 0.93 |
Ing3 |
inhibitor of growth family, member 3 |
38 |
0.98 |
chr10_30200002_30200752 | 0.93 |
Cenpw |
centromere protein W |
115 |
0.97 |
chrX_94366585_94367598 | 0.93 |
Apoo |
apolipoprotein O |
26 |
0.81 |
chr13_9017242_9017485 | 0.93 |
Gtpbp4 |
GTP binding protein 4 |
21280 |
0.1 |
chr13_42298480_42298631 | 0.93 |
Edn1 |
endothelin 1 |
2921 |
0.3 |
chr19_9899867_9900057 | 0.92 |
Gm50340 |
predicted gene, 50340 |
27 |
0.84 |
chr8_117200945_117201248 | 0.92 |
Gan |
giant axonal neuropathy |
42959 |
0.14 |
chr3_31094981_31095132 | 0.92 |
Skil |
SKI-like |
2 |
0.98 |
chr2_157394940_157395253 | 0.92 |
Src |
Rous sarcoma oncogene |
23348 |
0.14 |
chr8_94954971_94955272 | 0.92 |
Gm10286 |
predicted gene 10286 |
14633 |
0.11 |
chr4_40269778_40270008 | 0.92 |
Topors |
topoisomerase I binding, arginine/serine-rich |
43 |
0.58 |
chr5_4004856_4005069 | 0.92 |
Wdr46-ps |
Wdr46 retrotransposed pseudogene |
15956 |
0.17 |
chr11_58938800_58939568 | 0.92 |
Rnf187 |
ring finger protein 187 |
268 |
0.76 |
chr10_83153951_83154113 | 0.92 |
Gm23122 |
predicted gene, 23122 |
4095 |
0.24 |
chr1_82184058_82184248 | 0.91 |
Gm9747 |
predicted gene 9747 |
48959 |
0.13 |
chr9_57247476_57247657 | 0.91 |
Trcg1 |
taste receptor cell gene 1 |
11010 |
0.15 |
chr5_143548497_143549313 | 0.91 |
Fam220a |
family with sequence similarity 220, member A |
135 |
0.95 |
chr11_74831594_74833056 | 0.91 |
Mnt |
max binding protein |
1405 |
0.31 |
chr11_53795859_53796353 | 0.90 |
Gm12216 |
predicted gene 12216 |
231 |
0.89 |
chr18_53745005_53745200 | 0.90 |
Cep120 |
centrosomal protein 120 |
494 |
0.87 |
chr8_60982744_60983185 | 0.90 |
Clcn3 |
chloride channel, voltage-sensitive 3 |
275 |
0.66 |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
1.1 | 3.3 | GO:0007571 | age-dependent response to oxidative stress(GO:0001306) age-dependent general metabolic decline(GO:0007571) |
0.7 | 2.2 | GO:0042938 | dipeptide transport(GO:0042938) |
0.6 | 2.4 | GO:0006114 | glycerol biosynthetic process(GO:0006114) |
0.5 | 1.6 | GO:0032058 | positive regulation of translational initiation in response to stress(GO:0032058) |
0.5 | 1.5 | GO:1900095 | regulation of dosage compensation by inactivation of X chromosome(GO:1900095) |
0.5 | 1.4 | GO:0021553 | olfactory nerve development(GO:0021553) |
0.5 | 1.4 | GO:1903265 | positive regulation of tumor necrosis factor-mediated signaling pathway(GO:1903265) |
0.4 | 1.7 | GO:0060528 | secretory columnal luminar epithelial cell differentiation involved in prostate glandular acinus development(GO:0060528) |
0.4 | 1.2 | GO:1900126 | negative regulation of hyaluronan biosynthetic process(GO:1900126) |
0.4 | 1.7 | GO:1990414 | replication-born double-strand break repair via sister chromatid exchange(GO:1990414) |
0.4 | 1.2 | GO:0000432 | regulation of transcription from RNA polymerase II promoter by glucose(GO:0000430) positive regulation of transcription from RNA polymerase II promoter by glucose(GO:0000432) |
0.4 | 1.2 | GO:0009240 | isopentenyl diphosphate biosynthetic process(GO:0009240) isopentenyl diphosphate biosynthetic process, mevalonate pathway(GO:0019287) |
0.4 | 1.6 | GO:0072383 | plus-end-directed vesicle transport along microtubule(GO:0072383) plus-end-directed organelle transport along microtubule(GO:0072386) |
0.4 | 0.8 | GO:0061343 | cell adhesion involved in heart morphogenesis(GO:0061343) |
0.4 | 1.8 | GO:0006686 | sphingomyelin biosynthetic process(GO:0006686) |
0.4 | 1.1 | GO:0090283 | regulation of protein glycosylation in Golgi(GO:0090283) |
0.4 | 1.4 | GO:1905206 | positive regulation of hydrogen peroxide-mediated programmed cell death(GO:1901300) positive regulation of hydrogen peroxide-induced cell death(GO:1905206) |
0.3 | 1.0 | GO:0097051 | establishment of protein localization to endoplasmic reticulum membrane(GO:0097051) |
0.3 | 1.4 | GO:0034214 | protein hexamerization(GO:0034214) |
0.3 | 1.0 | GO:0072361 | regulation of glycolytic process by regulation of transcription from RNA polymerase II promoter(GO:0072361) |
0.3 | 1.0 | GO:0042126 | nitrate metabolic process(GO:0042126) |
0.3 | 1.3 | GO:0019276 | UDP-N-acetylgalactosamine metabolic process(GO:0019276) |
0.3 | 1.3 | GO:0070589 | cell wall mannoprotein biosynthetic process(GO:0000032) mannoprotein metabolic process(GO:0006056) mannoprotein biosynthetic process(GO:0006057) cell wall glycoprotein biosynthetic process(GO:0031506) cell wall biogenesis(GO:0042546) cell wall macromolecule biosynthetic process(GO:0044038) chain elongation of O-linked mannose residue(GO:0044845) cellular component macromolecule biosynthetic process(GO:0070589) |
0.3 | 1.3 | GO:0006499 | N-terminal protein myristoylation(GO:0006499) |
0.3 | 0.9 | GO:0048388 | endosomal lumen acidification(GO:0048388) |
0.3 | 0.9 | GO:0035771 | interleukin-4-mediated signaling pathway(GO:0035771) |
0.3 | 1.6 | GO:0032792 | negative regulation of CREB transcription factor activity(GO:0032792) |
0.3 | 2.4 | GO:0035562 | negative regulation of chromatin binding(GO:0035562) |
0.3 | 0.6 | GO:0006106 | fumarate metabolic process(GO:0006106) |
0.3 | 1.2 | GO:0090666 | scaRNA localization to Cajal body(GO:0090666) |
0.3 | 0.9 | GO:0046391 | 5-phosphoribose 1-diphosphate biosynthetic process(GO:0006015) 5-phosphoribose 1-diphosphate metabolic process(GO:0046391) |
0.3 | 0.9 | GO:0071336 | regulation of hair follicle cell proliferation(GO:0071336) |
0.3 | 0.8 | GO:0009051 | pentose-phosphate shunt, oxidative branch(GO:0009051) |
0.3 | 0.3 | GO:2000686 | regulation of rubidium ion transmembrane transporter activity(GO:2000686) |
0.3 | 0.8 | GO:1903690 | negative regulation of wound healing, spreading of epidermal cells(GO:1903690) |
0.3 | 0.3 | GO:0019401 | alditol biosynthetic process(GO:0019401) |
0.3 | 0.8 | GO:1903898 | negative regulation of PERK-mediated unfolded protein response(GO:1903898) |
0.3 | 0.8 | GO:0097477 | lateral motor column neuron migration(GO:0097477) |
0.3 | 0.3 | GO:0060623 | regulation of chromosome condensation(GO:0060623) |
0.3 | 0.8 | GO:0070358 | actin polymerization-dependent cell motility(GO:0070358) |
0.3 | 0.8 | GO:0006438 | valyl-tRNA aminoacylation(GO:0006438) |
0.3 | 0.3 | GO:0061086 | negative regulation of histone H3-K27 methylation(GO:0061086) |
0.3 | 1.3 | GO:0051987 | positive regulation of attachment of spindle microtubules to kinetochore(GO:0051987) |
0.3 | 0.8 | GO:0032911 | negative regulation of transforming growth factor beta1 production(GO:0032911) |
0.3 | 1.3 | GO:1900125 | regulation of hyaluronan biosynthetic process(GO:1900125) |
0.2 | 1.0 | GO:2000622 | regulation of nuclear-transcribed mRNA catabolic process, nonsense-mediated decay(GO:2000622) negative regulation of nuclear-transcribed mRNA catabolic process, nonsense-mediated decay(GO:2000623) |
0.2 | 1.5 | GO:0006104 | succinyl-CoA metabolic process(GO:0006104) |
0.2 | 1.4 | GO:0000972 | transcription-dependent tethering of RNA polymerase II gene DNA at nuclear periphery(GO:0000972) |
0.2 | 0.7 | GO:0034729 | histone H3-K79 methylation(GO:0034729) |
0.2 | 0.9 | GO:0006083 | acetate metabolic process(GO:0006083) |
0.2 | 0.7 | GO:0045347 | negative regulation of MHC class II biosynthetic process(GO:0045347) |
0.2 | 0.7 | GO:1900825 | regulation of membrane depolarization during cardiac muscle cell action potential(GO:1900825) |
0.2 | 0.5 | GO:1900625 | regulation of monocyte aggregation(GO:1900623) positive regulation of monocyte aggregation(GO:1900625) |
0.2 | 0.5 | GO:0032077 | positive regulation of deoxyribonuclease activity(GO:0032077) |
0.2 | 0.7 | GO:0097167 | circadian regulation of translation(GO:0097167) |
0.2 | 0.4 | GO:0007386 | compartment pattern specification(GO:0007386) |
0.2 | 0.7 | GO:0061010 | gall bladder development(GO:0061010) |
0.2 | 1.1 | GO:0046485 | ether lipid metabolic process(GO:0046485) |
0.2 | 0.7 | GO:0021698 | cerebellar cortex structural organization(GO:0021698) |
0.2 | 1.1 | GO:0070934 | CRD-mediated mRNA stabilization(GO:0070934) |
0.2 | 0.4 | GO:0003213 | cardiac right atrium morphogenesis(GO:0003213) |
0.2 | 0.4 | GO:0043974 | histone H3-K27 acetylation(GO:0043974) regulation of histone H3-K27 acetylation(GO:1901674) |
0.2 | 1.3 | GO:0006685 | sphingomyelin catabolic process(GO:0006685) |
0.2 | 0.4 | GO:0035483 | gastric emptying(GO:0035483) |
0.2 | 0.6 | GO:0032066 | nucleolus to nucleoplasm transport(GO:0032066) |
0.2 | 1.0 | GO:0042256 | mature ribosome assembly(GO:0042256) |
0.2 | 1.0 | GO:0010825 | positive regulation of centrosome duplication(GO:0010825) |
0.2 | 0.2 | GO:1903147 | negative regulation of mitophagy(GO:1903147) |
0.2 | 0.6 | GO:0030951 | establishment or maintenance of microtubule cytoskeleton polarity(GO:0030951) |
0.2 | 1.6 | GO:1902231 | positive regulation of intrinsic apoptotic signaling pathway in response to DNA damage(GO:1902231) |
0.2 | 0.4 | GO:1905216 | positive regulation of mRNA binding(GO:1902416) positive regulation of RNA binding(GO:1905216) |
0.2 | 0.6 | GO:1901078 | negative regulation of relaxation of muscle(GO:1901078) |
0.2 | 1.2 | GO:2001269 | positive regulation of cysteine-type endopeptidase activity involved in apoptotic signaling pathway(GO:2001269) |
0.2 | 0.2 | GO:1902263 | apoptotic process involved in embryonic digit morphogenesis(GO:1902263) |
0.2 | 1.2 | GO:0048539 | bone marrow development(GO:0048539) |
0.2 | 1.0 | GO:0009249 | protein lipoylation(GO:0009249) |
0.2 | 1.0 | GO:0018230 | peptidyl-L-cysteine S-palmitoylation(GO:0018230) peptidyl-S-diacylglycerol-L-cysteine biosynthetic process from peptidyl-cysteine(GO:0018231) |
0.2 | 1.6 | GO:0061418 | regulation of transcription from RNA polymerase II promoter in response to hypoxia(GO:0061418) |
0.2 | 0.6 | GO:0006681 | galactosylceramide metabolic process(GO:0006681) |
0.2 | 0.6 | GO:0009298 | GDP-mannose biosynthetic process(GO:0009298) |
0.2 | 0.6 | GO:1902775 | mitochondrial large ribosomal subunit assembly(GO:1902775) |
0.2 | 0.6 | GO:0010046 | response to mycotoxin(GO:0010046) |
0.2 | 0.8 | GO:0070574 | cadmium ion transport(GO:0015691) cadmium ion transmembrane transport(GO:0070574) |
0.2 | 1.2 | GO:0006646 | phosphatidylethanolamine biosynthetic process(GO:0006646) |
0.2 | 0.6 | GO:0035513 | oxidative RNA demethylation(GO:0035513) oxidative single-stranded RNA demethylation(GO:0035553) |
0.2 | 0.8 | GO:0034080 | CENP-A containing nucleosome assembly(GO:0034080) CENP-A containing chromatin organization(GO:0061641) |
0.2 | 0.6 | GO:0090086 | negative regulation of protein deubiquitination(GO:0090086) |
0.2 | 0.6 | GO:0006344 | maintenance of chromatin silencing(GO:0006344) |
0.2 | 1.3 | GO:0046598 | positive regulation of viral entry into host cell(GO:0046598) |
0.2 | 1.7 | GO:0048280 | vesicle fusion with Golgi apparatus(GO:0048280) |
0.2 | 0.8 | GO:0060161 | positive regulation of dopamine receptor signaling pathway(GO:0060161) |
0.2 | 0.9 | GO:0071447 | cellular response to hydroperoxide(GO:0071447) |
0.2 | 0.4 | GO:0071072 | negative regulation of phospholipid biosynthetic process(GO:0071072) |
0.2 | 1.1 | GO:0061087 | positive regulation of histone H3-K27 methylation(GO:0061087) |
0.2 | 0.6 | GO:0043382 | positive regulation of memory T cell differentiation(GO:0043382) |
0.2 | 0.4 | GO:0046122 | purine deoxyribonucleoside metabolic process(GO:0046122) |
0.2 | 1.7 | GO:0051382 | kinetochore assembly(GO:0051382) |
0.2 | 0.5 | GO:1903223 | positive regulation of oxidative stress-induced neuron death(GO:1903223) |
0.2 | 0.4 | GO:0051409 | response to nitrosative stress(GO:0051409) |
0.2 | 0.4 | GO:0034196 | acylglycerol transport(GO:0034196) triglyceride transport(GO:0034197) |
0.2 | 0.5 | GO:0060137 | maternal process involved in parturition(GO:0060137) |
0.2 | 0.5 | GO:0060397 | JAK-STAT cascade involved in growth hormone signaling pathway(GO:0060397) |
0.2 | 0.4 | GO:0051106 | regulation of DNA ligation(GO:0051105) positive regulation of DNA ligation(GO:0051106) |
0.2 | 0.2 | GO:0003330 | regulation of extracellular matrix constituent secretion(GO:0003330) positive regulation of extracellular matrix constituent secretion(GO:0003331) |
0.2 | 0.7 | GO:0010993 | regulation of ubiquitin homeostasis(GO:0010993) free ubiquitin chain polymerization(GO:0010994) |
0.2 | 0.7 | GO:0046292 | formaldehyde metabolic process(GO:0046292) |
0.2 | 0.4 | GO:0098814 | spontaneous neurotransmitter secretion(GO:0061669) spontaneous synaptic transmission(GO:0098814) |
0.2 | 0.5 | GO:1901856 | negative regulation of cellular respiration(GO:1901856) |
0.2 | 0.5 | GO:1901421 | positive regulation of response to alcohol(GO:1901421) |
0.2 | 0.4 | GO:0032025 | response to cobalt ion(GO:0032025) |
0.2 | 0.4 | GO:0032596 | protein transport into membrane raft(GO:0032596) |
0.2 | 0.7 | GO:0097343 | ripoptosome assembly(GO:0097343) ripoptosome assembly involved in necroptotic process(GO:1901026) |
0.2 | 0.9 | GO:0030910 | olfactory placode formation(GO:0030910) olfactory placode development(GO:0071698) olfactory placode morphogenesis(GO:0071699) |
0.2 | 1.0 | GO:0060770 | negative regulation of epithelial cell proliferation involved in prostate gland development(GO:0060770) |
0.2 | 0.3 | GO:0035751 | regulation of lysosomal lumen pH(GO:0035751) |
0.2 | 0.8 | GO:0001561 | fatty acid alpha-oxidation(GO:0001561) |
0.2 | 0.3 | GO:0035694 | mitochondrial protein catabolic process(GO:0035694) |
0.2 | 0.8 | GO:0006451 | selenocysteine incorporation(GO:0001514) translational readthrough(GO:0006451) |
0.2 | 0.5 | GO:0060743 | epithelial cell maturation involved in prostate gland development(GO:0060743) |
0.2 | 0.7 | GO:0051121 | hepoxilin metabolic process(GO:0051121) hepoxilin biosynthetic process(GO:0051122) |
0.2 | 0.7 | GO:0051292 | nuclear pore complex assembly(GO:0051292) |
0.2 | 0.5 | GO:1900740 | regulation of protein insertion into mitochondrial membrane involved in apoptotic signaling pathway(GO:1900739) positive regulation of protein insertion into mitochondrial membrane involved in apoptotic signaling pathway(GO:1900740) |
0.2 | 0.3 | GO:2000834 | androgen secretion(GO:0035935) regulation of androgen secretion(GO:2000834) positive regulation of androgen secretion(GO:2000836) |
0.2 | 0.5 | GO:0090579 | transcriptional activation by promoter-enhancer looping(GO:0071733) gene looping(GO:0090202) dsDNA loop formation(GO:0090579) |
0.2 | 0.6 | GO:1901679 | nucleotide transmembrane transport(GO:1901679) |
0.2 | 0.6 | GO:0006189 | 'de novo' IMP biosynthetic process(GO:0006189) |
0.2 | 0.2 | GO:2000465 | regulation of glycogen (starch) synthase activity(GO:2000465) |
0.2 | 0.5 | GO:0098535 | de novo centriole assembly(GO:0098535) |
0.2 | 0.5 | GO:0071494 | cellular response to UV-C(GO:0071494) |
0.2 | 0.5 | GO:0032439 | endosome localization(GO:0032439) |
0.2 | 1.2 | GO:0035372 | protein localization to microtubule(GO:0035372) |
0.2 | 0.6 | GO:0031117 | positive regulation of microtubule depolymerization(GO:0031117) |
0.2 | 0.5 | GO:0061084 | negative regulation of protein refolding(GO:0061084) |
0.2 | 1.4 | GO:0071786 | endoplasmic reticulum tubular network organization(GO:0071786) |
0.1 | 0.7 | GO:0015886 | heme transport(GO:0015886) |
0.1 | 0.9 | GO:0010815 | bradykinin catabolic process(GO:0010815) |
0.1 | 1.0 | GO:0000059 | protein import into nucleus, docking(GO:0000059) |
0.1 | 1.3 | GO:0080182 | histone H3-K4 trimethylation(GO:0080182) |
0.1 | 0.4 | GO:0051684 | maintenance of Golgi location(GO:0051684) |
0.1 | 0.1 | GO:0090526 | regulation of gluconeogenesis involved in cellular glucose homeostasis(GO:0090526) |
0.1 | 0.4 | GO:1903849 | regulation of aorta morphogenesis(GO:1903847) positive regulation of aorta morphogenesis(GO:1903849) |
0.1 | 0.6 | GO:0090168 | Golgi reassembly(GO:0090168) |
0.1 | 1.1 | GO:2000480 | negative regulation of cAMP-dependent protein kinase activity(GO:2000480) |
0.1 | 0.4 | GO:0046341 | CDP-diacylglycerol metabolic process(GO:0046341) |
0.1 | 0.4 | GO:0016081 | synaptic vesicle docking(GO:0016081) |
0.1 | 0.7 | GO:0072675 | osteoclast fusion(GO:0072675) |
0.1 | 0.4 | GO:0090365 | regulation of mRNA modification(GO:0090365) |
0.1 | 0.7 | GO:0045915 | positive regulation of catecholamine metabolic process(GO:0045915) positive regulation of dopamine metabolic process(GO:0045964) |
0.1 | 0.7 | GO:1990592 | protein polyufmylation(GO:1990564) protein K69-linked ufmylation(GO:1990592) |
0.1 | 0.4 | GO:0060398 | regulation of growth hormone receptor signaling pathway(GO:0060398) |
0.1 | 0.6 | GO:0035521 | monoubiquitinated histone deubiquitination(GO:0035521) monoubiquitinated histone H2A deubiquitination(GO:0035522) |
0.1 | 0.4 | GO:0036215 | response to stem cell factor(GO:0036215) cellular response to stem cell factor stimulus(GO:0036216) Kit signaling pathway(GO:0038109) |
0.1 | 1.4 | GO:0015937 | coenzyme A biosynthetic process(GO:0015937) |
0.1 | 0.8 | GO:1902035 | positive regulation of hematopoietic stem cell proliferation(GO:1902035) |
0.1 | 0.4 | GO:0015014 | heparan sulfate proteoglycan biosynthetic process, polysaccharide chain biosynthetic process(GO:0015014) |
0.1 | 0.4 | GO:0021648 | vestibulocochlear nerve morphogenesis(GO:0021648) |
0.1 | 1.7 | GO:0032780 | negative regulation of ATPase activity(GO:0032780) |
0.1 | 0.4 | GO:0090071 | negative regulation of ribosome biogenesis(GO:0090071) |
0.1 | 0.1 | GO:1902402 | signal transduction involved in mitotic cell cycle checkpoint(GO:0072413) signal transduction involved in mitotic DNA damage checkpoint(GO:1902402) signal transduction involved in mitotic DNA integrity checkpoint(GO:1902403) |
0.1 | 0.6 | GO:0007023 | post-chaperonin tubulin folding pathway(GO:0007023) |
0.1 | 0.7 | GO:2000301 | negative regulation of synaptic vesicle exocytosis(GO:2000301) |
0.1 | 0.3 | GO:0048296 | isotype switching to IgA isotypes(GO:0048290) regulation of isotype switching to IgA isotypes(GO:0048296) |
0.1 | 0.7 | GO:0033227 | dsRNA transport(GO:0033227) |
0.1 | 0.3 | GO:0006362 | transcription elongation from RNA polymerase I promoter(GO:0006362) |
0.1 | 0.9 | GO:0034508 | centromere complex assembly(GO:0034508) |
0.1 | 1.2 | GO:0007175 | negative regulation of epidermal growth factor-activated receptor activity(GO:0007175) |
0.1 | 1.1 | GO:0070862 | negative regulation of protein exit from endoplasmic reticulum(GO:0070862) negative regulation of retrograde protein transport, ER to cytosol(GO:1904153) |
0.1 | 0.5 | GO:0090241 | negative regulation of histone H4 acetylation(GO:0090241) |
0.1 | 0.5 | GO:0009235 | cobalamin metabolic process(GO:0009235) |
0.1 | 1.2 | GO:0051895 | negative regulation of focal adhesion assembly(GO:0051895) |
0.1 | 0.3 | GO:0048850 | hypophysis morphogenesis(GO:0048850) |
0.1 | 0.5 | GO:2001286 | regulation of caveolin-mediated endocytosis(GO:2001286) |
0.1 | 1.0 | GO:0045820 | negative regulation of glycolytic process(GO:0045820) |
0.1 | 0.5 | GO:0048633 | positive regulation of skeletal muscle tissue growth(GO:0048633) |
0.1 | 0.4 | GO:0002949 | tRNA threonylcarbamoyladenosine modification(GO:0002949) |
0.1 | 0.5 | GO:0070966 | nuclear-transcribed mRNA catabolic process, no-go decay(GO:0070966) |
0.1 | 0.1 | GO:0016259 | selenocysteine metabolic process(GO:0016259) |
0.1 | 0.8 | GO:0006975 | DNA damage induced protein phosphorylation(GO:0006975) |
0.1 | 0.3 | GO:0046477 | glycosylceramide catabolic process(GO:0046477) |
0.1 | 0.9 | GO:0048251 | elastic fiber assembly(GO:0048251) |
0.1 | 1.0 | GO:0034058 | endosomal vesicle fusion(GO:0034058) |
0.1 | 1.4 | GO:0009083 | branched-chain amino acid catabolic process(GO:0009083) |
0.1 | 0.6 | GO:0006003 | fructose 2,6-bisphosphate metabolic process(GO:0006003) |
0.1 | 0.4 | GO:0046078 | dUMP metabolic process(GO:0046078) |
0.1 | 0.2 | GO:0090292 | nuclear matrix organization(GO:0043578) nuclear matrix anchoring at nuclear membrane(GO:0090292) |
0.1 | 0.1 | GO:0042524 | negative regulation of tyrosine phosphorylation of Stat5 protein(GO:0042524) |
0.1 | 0.5 | GO:0035509 | negative regulation of myosin-light-chain-phosphatase activity(GO:0035509) |
0.1 | 0.4 | GO:1900060 | negative regulation of sphingolipid biosynthetic process(GO:0090155) cellular sphingolipid homeostasis(GO:0090156) negative regulation of ceramide biosynthetic process(GO:1900060) |
0.1 | 0.9 | GO:1902170 | cellular response to reactive nitrogen species(GO:1902170) |
0.1 | 0.2 | GO:1902083 | negative regulation of peptidyl-cysteine S-nitrosylation(GO:1902083) |
0.1 | 0.2 | GO:0072095 | regulation of branch elongation involved in ureteric bud branching(GO:0072095) |
0.1 | 0.5 | GO:0010606 | positive regulation of cytoplasmic mRNA processing body assembly(GO:0010606) |
0.1 | 0.5 | GO:0016479 | negative regulation of transcription from RNA polymerase I promoter(GO:0016479) |
0.1 | 0.2 | GO:2000049 | positive regulation of cell-cell adhesion mediated by cadherin(GO:2000049) |
0.1 | 0.1 | GO:0071930 | negative regulation of transcription involved in G1/S transition of mitotic cell cycle(GO:0071930) |
0.1 | 0.7 | GO:0051574 | positive regulation of histone H3-K9 methylation(GO:0051574) |
0.1 | 0.5 | GO:0002051 | osteoblast fate commitment(GO:0002051) |
0.1 | 1.1 | GO:0010614 | negative regulation of cardiac muscle hypertrophy(GO:0010614) |
0.1 | 0.5 | GO:0010499 | proteasomal ubiquitin-independent protein catabolic process(GO:0010499) |
0.1 | 0.5 | GO:0031860 | telomeric 3' overhang formation(GO:0031860) |
0.1 | 0.5 | GO:0045006 | DNA deamination(GO:0045006) |
0.1 | 0.7 | GO:0010739 | positive regulation of protein kinase A signaling(GO:0010739) |
0.1 | 0.7 | GO:0003406 | retinal pigment epithelium development(GO:0003406) |
0.1 | 0.4 | GO:2001271 | regulation of cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:2001270) negative regulation of cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:2001271) |
0.1 | 0.6 | GO:0060056 | mammary gland involution(GO:0060056) |
0.1 | 1.1 | GO:0034349 | glial cell apoptotic process(GO:0034349) |
0.1 | 0.7 | GO:0071360 | cellular response to exogenous dsRNA(GO:0071360) |
0.1 | 0.2 | GO:0046098 | guanine metabolic process(GO:0046098) |
0.1 | 0.3 | GO:0000965 | mitochondrial RNA 3'-end processing(GO:0000965) |
0.1 | 1.0 | GO:0000103 | sulfate assimilation(GO:0000103) |
0.1 | 1.2 | GO:0051984 | positive regulation of chromosome segregation(GO:0051984) |
0.1 | 0.5 | GO:0018202 | peptidyl-diphthamide metabolic process(GO:0017182) peptidyl-diphthamide biosynthetic process from peptidyl-histidine(GO:0017183) peptidyl-histidine modification(GO:0018202) |
0.1 | 0.6 | GO:0044336 | canonical Wnt signaling pathway involved in negative regulation of apoptotic process(GO:0044336) |
0.1 | 0.8 | GO:0061099 | negative regulation of protein tyrosine kinase activity(GO:0061099) |
0.1 | 0.3 | GO:0046149 | heme catabolic process(GO:0042167) pigment catabolic process(GO:0046149) |
0.1 | 0.6 | GO:0006290 | pyrimidine dimer repair(GO:0006290) |
0.1 | 0.3 | GO:2000504 | positive regulation of blood vessel remodeling(GO:2000504) |
0.1 | 0.2 | GO:0002314 | germinal center B cell differentiation(GO:0002314) |
0.1 | 0.3 | GO:0015803 | branched-chain amino acid transport(GO:0015803) leucine transport(GO:0015820) |
0.1 | 0.2 | GO:0051031 | tRNA transport(GO:0051031) |
0.1 | 0.2 | GO:0061484 | hematopoietic stem cell homeostasis(GO:0061484) |
0.1 | 0.9 | GO:0044090 | positive regulation of vacuole organization(GO:0044090) |
0.1 | 0.7 | GO:0045916 | negative regulation of complement activation(GO:0045916) negative regulation of protein activation cascade(GO:2000258) |
0.1 | 0.3 | GO:0060988 | lipid tube assembly(GO:0060988) |
0.1 | 1.2 | GO:0006743 | ubiquinone metabolic process(GO:0006743) |
0.1 | 0.3 | GO:0046208 | spermine catabolic process(GO:0046208) |
0.1 | 0.3 | GO:0002432 | granuloma formation(GO:0002432) |
0.1 | 0.3 | GO:0033092 | positive regulation of immature T cell proliferation in thymus(GO:0033092) |
0.1 | 0.2 | GO:0070782 | phosphatidylserine exposure on apoptotic cell surface(GO:0070782) |
0.1 | 2.9 | GO:0043489 | RNA stabilization(GO:0043489) |
0.1 | 0.9 | GO:0010807 | regulation of synaptic vesicle priming(GO:0010807) |
0.1 | 0.2 | GO:0045054 | constitutive secretory pathway(GO:0045054) |
0.1 | 0.3 | GO:1904742 | regulation of telomeric DNA binding(GO:1904742) |
0.1 | 2.2 | GO:0006379 | mRNA cleavage(GO:0006379) |
0.1 | 0.3 | GO:0070535 | histone H2A K63-linked ubiquitination(GO:0070535) |
0.1 | 0.7 | GO:0042796 | snRNA transcription from RNA polymerase III promoter(GO:0042796) |
0.1 | 0.9 | GO:0033523 | histone H2B ubiquitination(GO:0033523) |
0.1 | 0.9 | GO:0034063 | stress granule assembly(GO:0034063) |
0.1 | 0.2 | GO:0034140 | negative regulation of toll-like receptor 3 signaling pathway(GO:0034140) |
0.1 | 0.6 | GO:0032464 | positive regulation of protein homooligomerization(GO:0032464) |
0.1 | 0.5 | GO:0090073 | positive regulation of protein homodimerization activity(GO:0090073) |
0.1 | 0.1 | GO:2001170 | negative regulation of ATP biosynthetic process(GO:2001170) |
0.1 | 1.1 | GO:0030049 | muscle filament sliding(GO:0030049) |
0.1 | 0.5 | GO:0051036 | regulation of endosome size(GO:0051036) |
0.1 | 0.2 | GO:0002309 | T cell proliferation involved in immune response(GO:0002309) |
0.1 | 0.4 | GO:0006824 | cobalt ion transport(GO:0006824) |
0.1 | 1.5 | GO:0043982 | histone H4-K5 acetylation(GO:0043981) histone H4-K8 acetylation(GO:0043982) |
0.1 | 0.4 | GO:0000393 | spliceosomal conformational changes to generate catalytic conformation(GO:0000393) |
0.1 | 1.1 | GO:0046085 | adenosine metabolic process(GO:0046085) |
0.1 | 0.5 | GO:0050915 | sensory perception of sour taste(GO:0050915) |
0.1 | 1.5 | GO:0070584 | mitochondrion morphogenesis(GO:0070584) |
0.1 | 0.1 | GO:0071332 | cellular response to fructose stimulus(GO:0071332) |
0.1 | 0.2 | GO:1903912 | negative regulation of endoplasmic reticulum stress-induced eIF2 alpha phosphorylation(GO:1903912) |
0.1 | 1.1 | GO:0036336 | dendritic cell migration(GO:0036336) |
0.1 | 0.4 | GO:0002317 | plasma cell differentiation(GO:0002317) |
0.1 | 0.3 | GO:0048861 | leukemia inhibitory factor signaling pathway(GO:0048861) |
0.1 | 0.2 | GO:0006741 | NADP biosynthetic process(GO:0006741) |
0.1 | 0.3 | GO:0046951 | ketone body biosynthetic process(GO:0046951) |
0.1 | 0.5 | GO:0035331 | negative regulation of hippo signaling(GO:0035331) |
0.1 | 1.0 | GO:0071380 | cellular response to prostaglandin E stimulus(GO:0071380) |
0.1 | 0.4 | GO:0006307 | DNA dealkylation involved in DNA repair(GO:0006307) |
0.1 | 1.1 | GO:0007035 | vacuolar acidification(GO:0007035) |
0.1 | 0.4 | GO:0051919 | positive regulation of fibrinolysis(GO:0051919) |
0.1 | 0.5 | GO:0051988 | regulation of attachment of spindle microtubules to kinetochore(GO:0051988) |
0.1 | 0.3 | GO:0018002 | N-terminal peptidyl-serine acetylation(GO:0017198) N-terminal peptidyl-glutamic acid acetylation(GO:0018002) peptidyl-serine acetylation(GO:0030920) |
0.1 | 0.4 | GO:0021942 | radial glia guided migration of Purkinje cell(GO:0021942) |
0.1 | 0.4 | GO:0060059 | embryonic retina morphogenesis in camera-type eye(GO:0060059) |
0.1 | 0.4 | GO:0000056 | ribosomal small subunit export from nucleus(GO:0000056) |
0.1 | 0.2 | GO:1902071 | regulation of hypoxia-inducible factor-1alpha signaling pathway(GO:1902071) |
0.1 | 0.5 | GO:0031665 | negative regulation of lipopolysaccharide-mediated signaling pathway(GO:0031665) |
0.1 | 0.3 | GO:0045658 | regulation of neutrophil differentiation(GO:0045658) |
0.1 | 0.1 | GO:0061724 | lipophagy(GO:0061724) |
0.1 | 0.3 | GO:0008050 | female courtship behavior(GO:0008050) |
0.1 | 0.3 | GO:0002071 | glandular epithelial cell maturation(GO:0002071) |
0.1 | 1.0 | GO:0006607 | NLS-bearing protein import into nucleus(GO:0006607) |
0.1 | 0.2 | GO:0043137 | DNA replication, removal of RNA primer(GO:0043137) |
0.1 | 0.2 | GO:0071879 | regulation of adrenergic receptor signaling pathway(GO:0071877) positive regulation of adrenergic receptor signaling pathway(GO:0071879) |
0.1 | 0.6 | GO:0060136 | embryonic process involved in female pregnancy(GO:0060136) |
0.1 | 0.4 | GO:0070236 | negative regulation of activation-induced cell death of T cells(GO:0070236) |
0.1 | 0.4 | GO:1903553 | positive regulation of extracellular exosome assembly(GO:1903553) |
0.1 | 1.1 | GO:0009437 | carnitine metabolic process(GO:0009437) |
0.1 | 0.2 | GO:0010982 | regulation of high-density lipoprotein particle clearance(GO:0010982) |
0.1 | 0.8 | GO:0010869 | regulation of receptor biosynthetic process(GO:0010869) |
0.1 | 0.3 | GO:0045048 | protein insertion into ER membrane(GO:0045048) tail-anchored membrane protein insertion into ER membrane(GO:0071816) |
0.1 | 1.3 | GO:0043968 | histone H2A acetylation(GO:0043968) |
0.1 | 0.5 | GO:0010032 | meiotic chromosome condensation(GO:0010032) |
0.1 | 0.2 | GO:0018065 | protein-cofactor linkage(GO:0018065) |
0.1 | 0.8 | GO:0098869 | cellular oxidant detoxification(GO:0098869) |
0.1 | 0.5 | GO:0045647 | negative regulation of erythrocyte differentiation(GO:0045647) |
0.1 | 0.4 | GO:0035622 | intrahepatic bile duct development(GO:0035622) |
0.1 | 0.4 | GO:0032463 | negative regulation of protein homooligomerization(GO:0032463) |
0.1 | 0.4 | GO:0007182 | common-partner SMAD protein phosphorylation(GO:0007182) |
0.1 | 0.2 | GO:0060447 | bud outgrowth involved in lung branching(GO:0060447) |
0.1 | 2.1 | GO:0006383 | transcription from RNA polymerase III promoter(GO:0006383) |
0.1 | 0.1 | GO:0001844 | protein insertion into mitochondrial membrane involved in apoptotic signaling pathway(GO:0001844) |
0.1 | 0.2 | GO:1904754 | positive regulation of vascular associated smooth muscle cell migration(GO:1904754) |
0.1 | 0.5 | GO:0072161 | mesenchymal cell differentiation involved in kidney development(GO:0072161) mesenchymal cell differentiation involved in renal system development(GO:2001012) |
0.1 | 0.6 | GO:0022616 | DNA strand elongation(GO:0022616) |
0.1 | 0.1 | GO:0060681 | branch elongation involved in ureteric bud branching(GO:0060681) |
0.1 | 0.9 | GO:0007097 | nuclear migration(GO:0007097) |
0.1 | 0.1 | GO:0006971 | hypotonic response(GO:0006971) cellular hypotonic response(GO:0071476) |
0.1 | 0.7 | GO:0006670 | sphingosine metabolic process(GO:0006670) |
0.1 | 0.9 | GO:0035721 | intraciliary retrograde transport(GO:0035721) |
0.1 | 0.1 | GO:0038108 | negative regulation of appetite by leptin-mediated signaling pathway(GO:0038108) |
0.1 | 0.6 | GO:0046874 | quinolinate metabolic process(GO:0046874) |
0.1 | 0.3 | GO:0046167 | glycerol-3-phosphate biosynthetic process(GO:0046167) |
0.1 | 1.0 | GO:0000042 | protein targeting to Golgi(GO:0000042) |
0.1 | 0.1 | GO:0036089 | cleavage furrow formation(GO:0036089) |
0.1 | 0.5 | GO:0034501 | protein localization to kinetochore(GO:0034501) protein localization to chromosome, centromeric region(GO:0071459) |
0.1 | 0.3 | GO:2000323 | negative regulation of glucocorticoid receptor signaling pathway(GO:2000323) |
0.1 | 0.4 | GO:2000271 | positive regulation of fibroblast apoptotic process(GO:2000271) |
0.1 | 0.7 | GO:0070493 | thrombin receptor signaling pathway(GO:0070493) |
0.1 | 0.3 | GO:1904263 | positive regulation of TORC1 signaling(GO:1904263) |
0.1 | 0.4 | GO:0019673 | GDP-mannose metabolic process(GO:0019673) |
0.1 | 0.7 | GO:2000773 | negative regulation of cellular senescence(GO:2000773) |
0.1 | 0.2 | GO:0014873 | response to muscle activity involved in regulation of muscle adaptation(GO:0014873) |
0.1 | 0.3 | GO:0030422 | production of siRNA involved in RNA interference(GO:0030422) |
0.1 | 0.3 | GO:0033499 | galactose catabolic process via UDP-galactose(GO:0033499) glycolytic process from galactose(GO:0061623) |
0.1 | 0.2 | GO:0072718 | response to cisplatin(GO:0072718) |
0.1 | 0.2 | GO:0010724 | regulation of definitive erythrocyte differentiation(GO:0010724) |
0.1 | 0.4 | GO:0097428 | protein maturation by iron-sulfur cluster transfer(GO:0097428) |
0.1 | 2.1 | GO:0000027 | ribosomal large subunit assembly(GO:0000027) |
0.1 | 0.2 | GO:0010040 | response to iron(II) ion(GO:0010040) |
0.1 | 0.8 | GO:0000729 | DNA double-strand break processing(GO:0000729) |
0.1 | 0.4 | GO:0033129 | positive regulation of histone phosphorylation(GO:0033129) |
0.1 | 0.3 | GO:0006642 | triglyceride mobilization(GO:0006642) |
0.1 | 2.2 | GO:0061512 | protein localization to cilium(GO:0061512) |
0.1 | 1.6 | GO:0000413 | protein peptidyl-prolyl isomerization(GO:0000413) |
0.1 | 0.4 | GO:0090219 | negative regulation of lipid kinase activity(GO:0090219) |
0.1 | 0.9 | GO:0006264 | mitochondrial DNA replication(GO:0006264) |
0.1 | 0.2 | GO:0010748 | negative regulation of plasma membrane long-chain fatty acid transport(GO:0010748) |
0.1 | 0.2 | GO:0060126 | somatotropin secreting cell differentiation(GO:0060126) |
0.1 | 0.3 | GO:0018206 | peptidyl-methionine modification(GO:0018206) |
0.1 | 0.4 | GO:0061469 | regulation of type B pancreatic cell proliferation(GO:0061469) |
0.1 | 0.3 | GO:0002017 | regulation of blood volume by renal aldosterone(GO:0002017) |
0.1 | 0.3 | GO:0018076 | N-terminal peptidyl-lysine acetylation(GO:0018076) |
0.1 | 0.3 | GO:1903288 | regulation of potassium ion import(GO:1903286) positive regulation of potassium ion import(GO:1903288) |
0.1 | 0.3 | GO:0007021 | tubulin complex assembly(GO:0007021) |
0.1 | 0.4 | GO:2000189 | positive regulation of cholesterol homeostasis(GO:2000189) |
0.1 | 0.9 | GO:0071577 | zinc II ion transmembrane transport(GO:0071577) |
0.1 | 0.2 | GO:0043308 | eosinophil activation involved in immune response(GO:0002278) eosinophil mediated immunity(GO:0002447) eosinophil degranulation(GO:0043308) |
0.1 | 0.3 | GO:0010387 | COP9 signalosome assembly(GO:0010387) |
0.1 | 0.4 | GO:0060708 | spongiotrophoblast differentiation(GO:0060708) |
0.1 | 0.3 | GO:2000346 | negative regulation of hepatocyte proliferation(GO:2000346) |
0.1 | 0.3 | GO:0045053 | protein retention in Golgi apparatus(GO:0045053) |
0.1 | 0.1 | GO:2000409 | positive regulation of T cell extravasation(GO:2000409) |
0.1 | 0.2 | GO:1904688 | regulation of cap-independent translational initiation(GO:1903677) positive regulation of cap-independent translational initiation(GO:1903679) regulation of cytoplasmic translational initiation(GO:1904688) positive regulation of cytoplasmic translational initiation(GO:1904690) |
0.1 | 0.5 | GO:0033962 | cytoplasmic mRNA processing body assembly(GO:0033962) |
0.1 | 0.3 | GO:0000303 | response to superoxide(GO:0000303) |
0.1 | 0.4 | GO:0006572 | tyrosine catabolic process(GO:0006572) |
0.1 | 0.4 | GO:0006983 | ER overload response(GO:0006983) |
0.1 | 0.2 | GO:0019230 | proprioception(GO:0019230) |
0.1 | 0.2 | GO:0006177 | GMP biosynthetic process(GO:0006177) |
0.1 | 0.5 | GO:0048227 | plasma membrane to endosome transport(GO:0048227) |
0.1 | 1.2 | GO:0042744 | hydrogen peroxide catabolic process(GO:0042744) |
0.1 | 0.2 | GO:0090306 | spindle assembly involved in meiosis(GO:0090306) |
0.1 | 0.7 | GO:0007343 | egg activation(GO:0007343) |
0.1 | 0.1 | GO:0070103 | regulation of interleukin-6-mediated signaling pathway(GO:0070103) |
0.1 | 0.2 | GO:0042732 | D-xylose metabolic process(GO:0042732) |
0.1 | 0.4 | GO:0034116 | positive regulation of heterotypic cell-cell adhesion(GO:0034116) |
0.1 | 0.3 | GO:1903966 | monounsaturated fatty acid metabolic process(GO:1903964) monounsaturated fatty acid biosynthetic process(GO:1903966) |
0.1 | 0.3 | GO:1900364 | negative regulation of mRNA polyadenylation(GO:1900364) |
0.1 | 0.4 | GO:0035280 | miRNA loading onto RISC involved in gene silencing by miRNA(GO:0035280) |
0.1 | 0.2 | GO:0061535 | glutamate secretion, neurotransmission(GO:0061535) |
0.1 | 0.4 | GO:0090188 | negative regulation of pancreatic juice secretion(GO:0090188) |
0.1 | 0.3 | GO:0036265 | RNA (guanine-N7)-methylation(GO:0036265) |
0.1 | 0.6 | GO:0017062 | respiratory chain complex III assembly(GO:0017062) mitochondrial respiratory chain complex III assembly(GO:0034551) mitochondrial respiratory chain complex III biogenesis(GO:0097033) |
0.1 | 0.2 | GO:0071712 | ER-associated misfolded protein catabolic process(GO:0071712) |
0.1 | 0.2 | GO:0043490 | malate-aspartate shuttle(GO:0043490) |
0.1 | 0.6 | GO:0043568 | positive regulation of insulin-like growth factor receptor signaling pathway(GO:0043568) |
0.1 | 1.4 | GO:0006783 | heme biosynthetic process(GO:0006783) |
0.1 | 0.1 | GO:1902445 | regulation of mitochondrial membrane permeability involved in programmed necrotic cell death(GO:1902445) |
0.1 | 0.9 | GO:0033235 | positive regulation of protein sumoylation(GO:0033235) |
0.1 | 0.1 | GO:0060375 | regulation of mast cell differentiation(GO:0060375) |
0.1 | 0.2 | GO:0010963 | regulation of L-arginine import(GO:0010963) |
0.1 | 0.2 | GO:0045901 | positive regulation of translational elongation(GO:0045901) |
0.1 | 0.6 | GO:0031167 | rRNA methylation(GO:0031167) |
0.1 | 0.7 | GO:0006474 | N-terminal protein amino acid acetylation(GO:0006474) |
0.1 | 0.2 | GO:0033483 | gas homeostasis(GO:0033483) |
0.1 | 1.0 | GO:0045116 | protein neddylation(GO:0045116) |
0.1 | 1.5 | GO:0070979 | protein K11-linked ubiquitination(GO:0070979) |
0.1 | 0.2 | GO:0060480 | lung goblet cell differentiation(GO:0060480) |
0.1 | 0.7 | GO:0000463 | maturation of LSU-rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000463) |
0.1 | 1.1 | GO:0044783 | G1 DNA damage checkpoint(GO:0044783) |
0.1 | 0.1 | GO:2000383 | regulation of ectoderm development(GO:2000383) negative regulation of ectoderm development(GO:2000384) |
0.1 | 0.2 | GO:0000491 | small nucleolar ribonucleoprotein complex assembly(GO:0000491) box C/D snoRNP assembly(GO:0000492) |
0.1 | 0.4 | GO:2000676 | positive regulation of type B pancreatic cell apoptotic process(GO:2000676) |
0.1 | 0.1 | GO:0035526 | retrograde transport, plasma membrane to Golgi(GO:0035526) |
0.1 | 0.4 | GO:1904417 | regulation of xenophagy(GO:1904415) positive regulation of xenophagy(GO:1904417) |
0.1 | 0.2 | GO:0002913 | positive regulation of T cell anergy(GO:0002669) positive regulation of lymphocyte anergy(GO:0002913) |
0.1 | 0.4 | GO:0043144 | snoRNA processing(GO:0043144) |
0.1 | 0.9 | GO:0060575 | intestinal epithelial cell differentiation(GO:0060575) |
0.1 | 0.1 | GO:1903750 | regulation of intrinsic apoptotic signaling pathway in response to hydrogen peroxide(GO:1903750) negative regulation of intrinsic apoptotic signaling pathway in response to hydrogen peroxide(GO:1903751) |
0.1 | 0.7 | GO:0002098 | tRNA wobble uridine modification(GO:0002098) |
0.1 | 0.4 | GO:0007100 | mitotic centrosome separation(GO:0007100) |
0.1 | 1.3 | GO:0016925 | protein sumoylation(GO:0016925) |
0.1 | 0.3 | GO:0034975 | protein folding in endoplasmic reticulum(GO:0034975) |
0.1 | 0.4 | GO:0006501 | C-terminal protein lipidation(GO:0006501) |
0.1 | 0.2 | GO:0000379 | tRNA-type intron splice site recognition and cleavage(GO:0000379) |
0.1 | 0.2 | GO:0042276 | error-prone translesion synthesis(GO:0042276) |
0.1 | 0.2 | GO:0070681 | glutaminyl-tRNAGln biosynthesis via transamidation(GO:0070681) |
0.1 | 0.5 | GO:0000290 | deadenylation-dependent decapping of nuclear-transcribed mRNA(GO:0000290) |
0.1 | 0.4 | GO:0016266 | O-glycan processing(GO:0016266) |
0.1 | 0.1 | GO:0042998 | positive regulation of Golgi to plasma membrane protein transport(GO:0042998) |
0.1 | 1.4 | GO:0006308 | DNA catabolic process(GO:0006308) |
0.1 | 0.4 | GO:2000059 | negative regulation of protein ubiquitination involved in ubiquitin-dependent protein catabolic process(GO:2000059) |
0.1 | 0.1 | GO:0035948 | positive regulation of gluconeogenesis by positive regulation of transcription from RNA polymerase II promoter(GO:0035948) |
0.1 | 0.7 | GO:0006337 | nucleosome disassembly(GO:0006337) protein-DNA complex disassembly(GO:0032986) |
0.1 | 0.1 | GO:0036123 | histone H3-K9 dimethylation(GO:0036123) |
0.1 | 0.3 | GO:0032252 | secretory granule localization(GO:0032252) |
0.1 | 0.1 | GO:0034139 | regulation of toll-like receptor 3 signaling pathway(GO:0034139) positive regulation of toll-like receptor 3 signaling pathway(GO:0034141) |
0.1 | 0.1 | GO:0045590 | negative regulation of regulatory T cell differentiation(GO:0045590) |
0.1 | 0.7 | GO:0035518 | histone H2A monoubiquitination(GO:0035518) |
0.1 | 0.3 | GO:0035520 | monoubiquitinated protein deubiquitination(GO:0035520) |
0.1 | 0.2 | GO:0070682 | proteasome regulatory particle assembly(GO:0070682) |
0.1 | 0.2 | GO:0032474 | otolith morphogenesis(GO:0032474) |
0.1 | 1.9 | GO:0010508 | positive regulation of autophagy(GO:0010508) |
0.1 | 0.4 | GO:0006620 | posttranslational protein targeting to membrane(GO:0006620) |
0.1 | 0.6 | GO:0006656 | phosphatidylcholine biosynthetic process(GO:0006656) |
0.1 | 1.1 | GO:0016578 | histone deubiquitination(GO:0016578) |
0.1 | 0.2 | GO:1900112 | regulation of histone H3-K9 trimethylation(GO:1900112) negative regulation of histone H3-K9 trimethylation(GO:1900113) |
0.1 | 0.6 | GO:0034453 | microtubule anchoring(GO:0034453) |
0.1 | 0.3 | GO:0040016 | embryonic cleavage(GO:0040016) |
0.1 | 0.1 | GO:0010519 | negative regulation of phospholipase activity(GO:0010519) |
0.1 | 0.5 | GO:0033617 | mitochondrial respiratory chain complex IV assembly(GO:0033617) mitochondrial respiratory chain complex IV biogenesis(GO:0097034) |
0.1 | 0.3 | GO:0051657 | maintenance of organelle location(GO:0051657) |
0.1 | 1.6 | GO:0018196 | peptidyl-asparagine modification(GO:0018196) |
0.1 | 0.2 | GO:0006624 | vacuolar protein processing(GO:0006624) |
0.1 | 0.2 | GO:0000087 | mitotic M phase(GO:0000087) |
0.1 | 0.1 | GO:1990034 | calcium ion export from cell(GO:1990034) |
0.1 | 0.1 | GO:0003062 | regulation of heart rate by chemical signal(GO:0003062) |
0.1 | 0.3 | GO:0030213 | hyaluronan biosynthetic process(GO:0030213) |
0.1 | 1.4 | GO:0033119 | negative regulation of RNA splicing(GO:0033119) |
0.1 | 0.8 | GO:0042407 | cristae formation(GO:0042407) |
0.1 | 0.1 | GO:1904016 | response to Thyroglobulin triiodothyronine(GO:1904016) cellular response to Thyroglobulin triiodothyronine(GO:1904017) |
0.1 | 0.1 | GO:1901382 | chorionic trophoblast cell proliferation(GO:0097360) regulation of chorionic trophoblast cell proliferation(GO:1901382) |
0.1 | 0.3 | GO:0046543 | development of secondary female sexual characteristics(GO:0046543) |
0.1 | 0.1 | GO:2001180 | negative regulation of interleukin-10 secretion(GO:2001180) |
0.1 | 0.1 | GO:2001225 | regulation of chloride transport(GO:2001225) |
0.1 | 0.1 | GO:0044320 | cellular response to leptin stimulus(GO:0044320) |
0.1 | 0.3 | GO:1903608 | protein localization to cytoplasmic stress granule(GO:1903608) |
0.1 | 0.7 | GO:0040037 | negative regulation of fibroblast growth factor receptor signaling pathway(GO:0040037) |
0.1 | 0.3 | GO:0045040 | protein import into mitochondrial outer membrane(GO:0045040) |
0.1 | 0.3 | GO:0000727 | double-strand break repair via break-induced replication(GO:0000727) |
0.1 | 0.5 | GO:0090503 | RNA phosphodiester bond hydrolysis, exonucleolytic(GO:0090503) |
0.1 | 0.2 | GO:0042738 | exogenous drug catabolic process(GO:0042738) |
0.1 | 0.3 | GO:0097039 | protein linear polyubiquitination(GO:0097039) |
0.1 | 0.6 | GO:0006241 | CTP biosynthetic process(GO:0006241) CTP metabolic process(GO:0046036) |
0.1 | 0.3 | GO:0044351 | macropinocytosis(GO:0044351) |
0.1 | 0.3 | GO:0045719 | negative regulation of glycogen biosynthetic process(GO:0045719) |
0.1 | 0.6 | GO:0007603 | phototransduction, visible light(GO:0007603) |
0.1 | 0.1 | GO:0042795 | snRNA transcription from RNA polymerase II promoter(GO:0042795) |
0.1 | 0.1 | GO:0006659 | phosphatidylserine biosynthetic process(GO:0006659) |
0.1 | 0.1 | GO:0042494 | detection of bacterial lipoprotein(GO:0042494) |
0.1 | 1.9 | GO:0071427 | mRNA export from nucleus(GO:0006406) mRNA-containing ribonucleoprotein complex export from nucleus(GO:0071427) |
0.1 | 0.3 | GO:0006995 | cellular response to nitrogen starvation(GO:0006995) cellular response to nitrogen levels(GO:0043562) |
0.1 | 0.1 | GO:1903689 | regulation of wound healing, spreading of epidermal cells(GO:1903689) |
0.1 | 0.2 | GO:0010694 | positive regulation of alkaline phosphatase activity(GO:0010694) |
0.1 | 0.2 | GO:1900016 | negative regulation of cytokine production involved in inflammatory response(GO:1900016) |
0.1 | 0.6 | GO:0050434 | positive regulation of viral transcription(GO:0050434) |
0.1 | 0.3 | GO:0035457 | cellular response to interferon-alpha(GO:0035457) |
0.1 | 0.1 | GO:0070141 | response to UV-A(GO:0070141) |
0.1 | 0.6 | GO:0030149 | sphingolipid catabolic process(GO:0030149) |
0.1 | 0.2 | GO:0007221 | positive regulation of transcription of Notch receptor target(GO:0007221) |
0.1 | 0.2 | GO:0046130 | purine nucleoside catabolic process(GO:0006152) purine ribonucleoside catabolic process(GO:0046130) |
0.1 | 0.5 | GO:0000244 | spliceosomal tri-snRNP complex assembly(GO:0000244) |
0.1 | 0.1 | GO:0033034 | positive regulation of myeloid cell apoptotic process(GO:0033034) |
0.1 | 0.2 | GO:1902916 | positive regulation of protein polyubiquitination(GO:1902916) |
0.1 | 0.2 | GO:0010891 | negative regulation of sequestering of triglyceride(GO:0010891) |
0.1 | 0.1 | GO:0045627 | positive regulation of T-helper 1 cell differentiation(GO:0045627) |
0.1 | 0.1 | GO:0003431 | growth plate cartilage chondrocyte development(GO:0003431) |
0.1 | 0.1 | GO:0000055 | ribosomal large subunit export from nucleus(GO:0000055) |
0.1 | 0.1 | GO:0009313 | oligosaccharide catabolic process(GO:0009313) |
0.1 | 0.1 | GO:0034770 | histone H4-K20 methylation(GO:0034770) histone H4-K20 trimethylation(GO:0034773) |
0.1 | 0.3 | GO:0090267 | positive regulation of mitotic cell cycle spindle assembly checkpoint(GO:0090267) |
0.1 | 0.1 | GO:0000715 | nucleotide-excision repair, DNA damage recognition(GO:0000715) |
0.1 | 0.4 | GO:1902018 | negative regulation of cilium assembly(GO:1902018) |
0.1 | 0.2 | GO:0018401 | peptidyl-proline hydroxylation to 4-hydroxy-L-proline(GO:0018401) |
0.1 | 0.1 | GO:0051342 | regulation of cyclic-nucleotide phosphodiesterase activity(GO:0051342) |
0.1 | 0.3 | GO:0031115 | negative regulation of microtubule polymerization(GO:0031115) |
0.1 | 0.2 | GO:0010626 | negative regulation of Schwann cell proliferation(GO:0010626) |
0.1 | 0.1 | GO:2000630 | positive regulation of miRNA metabolic process(GO:2000630) |
0.1 | 0.2 | GO:0006597 | spermine biosynthetic process(GO:0006597) |
0.1 | 0.1 | GO:0009642 | response to light intensity(GO:0009642) |
0.1 | 0.6 | GO:0030811 | regulation of nucleotide catabolic process(GO:0030811) |
0.1 | 0.3 | GO:0086073 | bundle of His cell-Purkinje myocyte adhesion involved in cell communication(GO:0086073) |
0.1 | 0.4 | GO:0006120 | mitochondrial electron transport, NADH to ubiquinone(GO:0006120) |
0.1 | 0.2 | GO:0071442 | positive regulation of histone H3-K14 acetylation(GO:0071442) |
0.1 | 0.3 | GO:0032570 | response to progesterone(GO:0032570) |
0.1 | 0.2 | GO:0051775 | response to redox state(GO:0051775) |
0.1 | 1.9 | GO:0051865 | protein autoubiquitination(GO:0051865) |
0.1 | 0.2 | GO:0018094 | protein polyglycylation(GO:0018094) |
0.1 | 0.6 | GO:0043508 | negative regulation of JUN kinase activity(GO:0043508) |
0.1 | 0.1 | GO:0034372 | very-low-density lipoprotein particle remodeling(GO:0034372) |
0.1 | 0.1 | GO:0046051 | UTP metabolic process(GO:0046051) |
0.1 | 0.2 | GO:0030638 | polyketide metabolic process(GO:0030638) aminoglycoside antibiotic metabolic process(GO:0030647) daunorubicin metabolic process(GO:0044597) doxorubicin metabolic process(GO:0044598) |
0.1 | 0.2 | GO:0018894 | dibenzo-p-dioxin metabolic process(GO:0018894) |
0.1 | 0.2 | GO:0090400 | stress-induced premature senescence(GO:0090400) |
0.1 | 0.2 | GO:0051547 | regulation of keratinocyte migration(GO:0051547) positive regulation of keratinocyte migration(GO:0051549) |
0.1 | 0.4 | GO:2001256 | regulation of store-operated calcium entry(GO:2001256) |
0.1 | 0.3 | GO:0051764 | actin crosslink formation(GO:0051764) |
0.1 | 0.2 | GO:0002326 | B cell lineage commitment(GO:0002326) |
0.1 | 0.1 | GO:0006990 | positive regulation of transcription from RNA polymerase II promoter involved in unfolded protein response(GO:0006990) |
0.1 | 0.1 | GO:0055118 | negative regulation of cardiac muscle contraction(GO:0055118) |
0.1 | 0.4 | GO:0006851 | mitochondrial calcium ion transport(GO:0006851) |
0.1 | 0.1 | GO:0072338 | creatinine metabolic process(GO:0046449) cellular lactam metabolic process(GO:0072338) |
0.1 | 0.1 | GO:0016237 | lysosomal microautophagy(GO:0016237) piecemeal microautophagy of nucleus(GO:0034727) late nucleophagy(GO:0044805) |
0.1 | 0.6 | GO:0071548 | response to dexamethasone(GO:0071548) cellular response to dexamethasone stimulus(GO:0071549) |
0.1 | 0.1 | GO:0001302 | replicative cell aging(GO:0001302) |
0.1 | 0.1 | GO:0048320 | axial mesoderm formation(GO:0048320) |
0.1 | 0.5 | GO:0010759 | positive regulation of macrophage chemotaxis(GO:0010759) |
0.1 | 0.2 | GO:1904694 | negative regulation of vascular smooth muscle contraction(GO:1904694) |
0.1 | 0.1 | GO:2000327 | regulation of ligand-dependent nuclear receptor transcription coactivator activity(GO:2000325) positive regulation of ligand-dependent nuclear receptor transcription coactivator activity(GO:2000327) |
0.1 | 0.2 | GO:0015744 | succinate transport(GO:0015744) |
0.1 | 0.1 | GO:0006369 | termination of RNA polymerase II transcription(GO:0006369) |
0.1 | 1.3 | GO:0042073 | intraciliary transport(GO:0042073) |
0.1 | 0.3 | GO:0032287 | peripheral nervous system myelin maintenance(GO:0032287) |
0.1 | 0.3 | GO:0000185 | activation of MAPKKK activity(GO:0000185) |
0.1 | 0.5 | GO:0006490 | oligosaccharide-lipid intermediate biosynthetic process(GO:0006490) |
0.1 | 0.2 | GO:1901162 | serotonin biosynthetic process(GO:0042427) primary amino compound biosynthetic process(GO:1901162) |
0.1 | 0.1 | GO:0090069 | regulation of ribosome biogenesis(GO:0090069) |
0.1 | 0.6 | GO:0097484 | dendrite extension(GO:0097484) |
0.1 | 0.2 | GO:1903237 | negative regulation of leukocyte tethering or rolling(GO:1903237) |
0.1 | 0.1 | GO:0003100 | regulation of systemic arterial blood pressure by endothelin(GO:0003100) |
0.1 | 0.2 | GO:0034047 | regulation of protein phosphatase type 2A activity(GO:0034047) |
0.1 | 0.5 | GO:0015858 | nucleoside transport(GO:0015858) |
0.1 | 0.2 | GO:0060334 | regulation of interferon-gamma-mediated signaling pathway(GO:0060334) |
0.1 | 0.2 | GO:0006167 | AMP biosynthetic process(GO:0006167) |
0.1 | 0.5 | GO:0006828 | manganese ion transport(GO:0006828) |
0.1 | 1.1 | GO:0010507 | negative regulation of autophagy(GO:0010507) |
0.1 | 0.1 | GO:2000741 | positive regulation of mesenchymal stem cell differentiation(GO:2000741) |
0.1 | 0.1 | GO:0019086 | late viral transcription(GO:0019086) |
0.1 | 0.1 | GO:0061470 | T follicular helper cell differentiation(GO:0061470) |
0.1 | 0.3 | GO:0015712 | hexose phosphate transport(GO:0015712) glucose-6-phosphate transport(GO:0015760) |
0.1 | 0.2 | GO:0060672 | epithelial cell differentiation involved in embryonic placenta development(GO:0060671) epithelial cell morphogenesis involved in placental branching(GO:0060672) |
0.1 | 0.2 | GO:0097107 | postsynaptic density organization(GO:0097106) postsynaptic density assembly(GO:0097107) |
0.1 | 0.2 | GO:0009181 | purine nucleoside diphosphate catabolic process(GO:0009137) purine ribonucleoside diphosphate catabolic process(GO:0009181) |
0.1 | 0.3 | GO:0035610 | protein side chain deglutamylation(GO:0035610) |
0.1 | 0.3 | GO:2000353 | positive regulation of endothelial cell apoptotic process(GO:2000353) |
0.0 | 0.1 | GO:0032876 | negative regulation of DNA endoreduplication(GO:0032876) |
0.0 | 0.0 | GO:1904707 | positive regulation of vascular smooth muscle cell proliferation(GO:1904707) |
0.0 | 0.4 | GO:0032897 | negative regulation of viral transcription(GO:0032897) |
0.0 | 0.3 | GO:0051044 | positive regulation of membrane protein ectodomain proteolysis(GO:0051044) |
0.0 | 0.1 | GO:0000022 | mitotic spindle elongation(GO:0000022) mitotic spindle midzone assembly(GO:0051256) |
0.0 | 1.3 | GO:0071277 | cellular response to calcium ion(GO:0071277) |
0.0 | 0.2 | GO:1901725 | regulation of histone deacetylase activity(GO:1901725) |
0.0 | 0.2 | GO:0051001 | negative regulation of nitric-oxide synthase activity(GO:0051001) |
0.0 | 0.1 | GO:0031507 | heterochromatin assembly(GO:0031507) |
0.0 | 0.1 | GO:0060060 | post-embryonic retina morphogenesis in camera-type eye(GO:0060060) |
0.0 | 0.1 | GO:0007252 | I-kappaB phosphorylation(GO:0007252) |
0.0 | 0.0 | GO:0008594 | photoreceptor cell morphogenesis(GO:0008594) |
0.0 | 0.1 | GO:0039536 | negative regulation of RIG-I signaling pathway(GO:0039536) |
0.0 | 0.3 | GO:0030854 | positive regulation of granulocyte differentiation(GO:0030854) |
0.0 | 0.2 | GO:0046116 | queuosine biosynthetic process(GO:0008616) queuosine metabolic process(GO:0046116) |
0.0 | 0.0 | GO:2000402 | negative regulation of lymphocyte migration(GO:2000402) |
0.0 | 0.0 | GO:0098840 | protein transport along microtubule(GO:0098840) |
0.0 | 0.1 | GO:0032460 | negative regulation of protein oligomerization(GO:0032460) |
0.0 | 0.1 | GO:0061620 | glycolytic process through glucose-6-phosphate(GO:0061620) |
0.0 | 0.3 | GO:0032790 | ribosome disassembly(GO:0032790) |
0.0 | 0.6 | GO:0006144 | purine nucleobase metabolic process(GO:0006144) |
0.0 | 1.8 | GO:0043038 | amino acid activation(GO:0043038) |
0.0 | 0.2 | GO:0006002 | fructose 6-phosphate metabolic process(GO:0006002) |
0.0 | 0.1 | GO:0006363 | termination of RNA polymerase I transcription(GO:0006363) |
0.0 | 0.4 | GO:0006614 | SRP-dependent cotranslational protein targeting to membrane(GO:0006614) |
0.0 | 1.6 | GO:0051028 | mRNA transport(GO:0051028) |
0.0 | 1.0 | GO:1901998 | toxin transport(GO:1901998) |
0.0 | 0.1 | GO:0045875 | negative regulation of sister chromatid cohesion(GO:0045875) |
0.0 | 0.1 | GO:0015888 | thiamine transport(GO:0015888) |
0.0 | 0.0 | GO:0046490 | isopentenyl diphosphate metabolic process(GO:0046490) |
0.0 | 0.1 | GO:0048254 | snoRNA localization(GO:0048254) |
0.0 | 0.1 | GO:0010745 | negative regulation of macrophage derived foam cell differentiation(GO:0010745) |
0.0 | 0.1 | GO:0048312 | intracellular distribution of mitochondria(GO:0048312) |
0.0 | 0.3 | GO:1902254 | negative regulation of intrinsic apoptotic signaling pathway by p53 class mediator(GO:1902254) |
0.0 | 0.1 | GO:1904468 | negative regulation of tumor necrosis factor secretion(GO:1904468) |
0.0 | 0.1 | GO:0071677 | positive regulation of mononuclear cell migration(GO:0071677) |
0.0 | 1.2 | GO:0006695 | cholesterol biosynthetic process(GO:0006695) secondary alcohol biosynthetic process(GO:1902653) |
0.0 | 0.0 | GO:0035434 | copper ion transmembrane transport(GO:0035434) |
0.0 | 0.1 | GO:0002911 | lymphocyte anergy(GO:0002249) regulation of T cell anergy(GO:0002667) T cell anergy(GO:0002870) regulation of lymphocyte anergy(GO:0002911) |
0.0 | 0.3 | GO:0006517 | protein deglycosylation(GO:0006517) |
0.0 | 0.5 | GO:0046827 | positive regulation of protein export from nucleus(GO:0046827) |
0.0 | 0.2 | GO:0042168 | heme metabolic process(GO:0042168) |
0.0 | 0.1 | GO:1902261 | positive regulation of delayed rectifier potassium channel activity(GO:1902261) positive regulation of voltage-gated potassium channel activity(GO:1903818) |
0.0 | 0.2 | GO:0070129 | regulation of mitochondrial translation(GO:0070129) |
0.0 | 0.1 | GO:0061732 | mitochondrial acetyl-CoA biosynthetic process from pyruvate(GO:0061732) |
0.0 | 0.2 | GO:0034138 | toll-like receptor 3 signaling pathway(GO:0034138) |
0.0 | 0.0 | GO:0034395 | regulation of transcription from RNA polymerase II promoter in response to iron(GO:0034395) |
0.0 | 0.2 | GO:0000012 | single strand break repair(GO:0000012) |
0.0 | 0.3 | GO:0060211 | regulation of nuclear-transcribed mRNA poly(A) tail shortening(GO:0060211) positive regulation of nuclear-transcribed mRNA poly(A) tail shortening(GO:0060213) |
0.0 | 0.2 | GO:0090161 | Golgi ribbon formation(GO:0090161) |
0.0 | 0.2 | GO:0019321 | pentose metabolic process(GO:0019321) |
0.0 | 0.3 | GO:0036297 | interstrand cross-link repair(GO:0036297) |
0.0 | 0.2 | GO:0097210 | response to gonadotropin-releasing hormone(GO:0097210) cellular response to gonadotropin-releasing hormone(GO:0097211) |
0.0 | 0.2 | GO:0042420 | dopamine catabolic process(GO:0042420) |
0.0 | 0.3 | GO:0019240 | citrulline biosynthetic process(GO:0019240) |
0.0 | 0.3 | GO:0009143 | nucleoside triphosphate catabolic process(GO:0009143) |
0.0 | 0.2 | GO:0034393 | positive regulation of smooth muscle cell apoptotic process(GO:0034393) |
0.0 | 0.7 | GO:0007032 | endosome organization(GO:0007032) |
0.0 | 0.1 | GO:0097411 | hypoxia-inducible factor-1alpha signaling pathway(GO:0097411) |
0.0 | 0.2 | GO:0006102 | isocitrate metabolic process(GO:0006102) |
0.0 | 0.4 | GO:0046835 | carbohydrate phosphorylation(GO:0046835) |
0.0 | 0.3 | GO:0034497 | protein localization to pre-autophagosomal structure(GO:0034497) |
0.0 | 0.0 | GO:0001887 | selenium compound metabolic process(GO:0001887) |
0.0 | 0.1 | GO:1990086 | lens fiber cell apoptotic process(GO:1990086) |
0.0 | 0.1 | GO:0018199 | peptidyl-glutamine modification(GO:0018199) |
0.0 | 0.1 | GO:0042723 | thiamine metabolic process(GO:0006772) thiamine-containing compound metabolic process(GO:0042723) |
0.0 | 0.4 | GO:0030828 | positive regulation of cGMP biosynthetic process(GO:0030828) |
0.0 | 0.1 | GO:0035022 | positive regulation of Rac protein signal transduction(GO:0035022) |
0.0 | 0.2 | GO:0060586 | multicellular organismal iron ion homeostasis(GO:0060586) |
0.0 | 0.1 | GO:0033600 | negative regulation of mammary gland epithelial cell proliferation(GO:0033600) |
0.0 | 0.0 | GO:0010481 | epidermal cell division(GO:0010481) regulation of epidermal cell division(GO:0010482) |
0.0 | 0.0 | GO:0071502 | cellular response to temperature stimulus(GO:0071502) |
0.0 | 0.2 | GO:1902715 | positive regulation of interferon-gamma secretion(GO:1902715) |
0.0 | 0.4 | GO:0030150 | protein import into mitochondrial matrix(GO:0030150) |
0.0 | 0.2 | GO:0031987 | locomotion involved in locomotory behavior(GO:0031987) |
0.0 | 0.5 | GO:0015985 | energy coupled proton transport, down electrochemical gradient(GO:0015985) ATP synthesis coupled proton transport(GO:0015986) |
0.0 | 0.2 | GO:0090026 | positive regulation of monocyte chemotaxis(GO:0090026) |
0.0 | 0.2 | GO:0033762 | response to glucagon(GO:0033762) |
0.0 | 0.1 | GO:0006105 | succinate metabolic process(GO:0006105) |
0.0 | 0.1 | GO:1902809 | regulation of skeletal muscle fiber differentiation(GO:1902809) |
0.0 | 0.5 | GO:1901798 | positive regulation of signal transduction by p53 class mediator(GO:1901798) |
0.0 | 0.2 | GO:0010668 | ectodermal cell differentiation(GO:0010668) |
0.0 | 0.2 | GO:0006004 | fucose metabolic process(GO:0006004) |
0.0 | 0.3 | GO:0019886 | antigen processing and presentation of exogenous peptide antigen via MHC class II(GO:0019886) |
0.0 | 0.0 | GO:0072395 | signal transduction involved in cell cycle checkpoint(GO:0072395) signal transduction involved in DNA integrity checkpoint(GO:0072401) signal transduction involved in DNA damage checkpoint(GO:0072422) |
0.0 | 0.0 | GO:1901896 | positive regulation of calcium-transporting ATPase activity(GO:1901896) |
0.0 | 0.0 | GO:0045829 | negative regulation of isotype switching(GO:0045829) |
0.0 | 0.3 | GO:0016572 | histone phosphorylation(GO:0016572) |
0.0 | 0.1 | GO:0000707 | meiotic DNA recombinase assembly(GO:0000707) |
0.0 | 0.1 | GO:0060050 | positive regulation of protein glycosylation(GO:0060050) |
0.0 | 0.1 | GO:0042518 | negative regulation of tyrosine phosphorylation of Stat3 protein(GO:0042518) |
0.0 | 0.2 | GO:0045792 | negative regulation of cell size(GO:0045792) |
0.0 | 0.2 | GO:0051013 | microtubule severing(GO:0051013) |
0.0 | 0.0 | GO:1901165 | positive regulation of trophoblast cell migration(GO:1901165) |
0.0 | 0.1 | GO:1904467 | regulation of tumor necrosis factor secretion(GO:1904467) tumor necrosis factor secretion(GO:1990774) |
0.0 | 0.1 | GO:1900108 | negative regulation of nodal signaling pathway(GO:1900108) |
0.0 | 0.4 | GO:0002755 | MyD88-dependent toll-like receptor signaling pathway(GO:0002755) |
0.0 | 0.1 | GO:0018916 | nitrobenzene metabolic process(GO:0018916) |
0.0 | 0.7 | GO:0014823 | response to activity(GO:0014823) |
0.0 | 0.4 | GO:0034724 | DNA replication-independent nucleosome assembly(GO:0006336) DNA replication-independent nucleosome organization(GO:0034724) |
0.0 | 0.0 | GO:0032493 | response to bacterial lipoprotein(GO:0032493) |
0.0 | 0.3 | GO:0045056 | transcytosis(GO:0045056) |
0.0 | 0.1 | GO:0035927 | RNA import into mitochondrion(GO:0035927) |
0.0 | 0.0 | GO:0051964 | negative regulation of synapse assembly(GO:0051964) |
0.0 | 0.7 | GO:0043029 | T cell homeostasis(GO:0043029) |
0.0 | 0.3 | GO:0045332 | phospholipid translocation(GO:0045332) |
0.0 | 0.1 | GO:2001032 | regulation of double-strand break repair via nonhomologous end joining(GO:2001032) |
0.0 | 0.0 | GO:0034311 | diol metabolic process(GO:0034311) |
0.0 | 0.0 | GO:0033028 | myeloid cell apoptotic process(GO:0033028) |
0.0 | 0.1 | GO:0060903 | positive regulation of meiosis I(GO:0060903) |
0.0 | 0.2 | GO:0048703 | embryonic viscerocranium morphogenesis(GO:0048703) |
0.0 | 1.5 | GO:0031338 | regulation of vesicle fusion(GO:0031338) |
0.0 | 0.0 | GO:0006551 | leucine metabolic process(GO:0006551) |
0.0 | 0.2 | GO:0002360 | T cell lineage commitment(GO:0002360) |
0.0 | 0.2 | GO:0007076 | mitotic chromosome condensation(GO:0007076) |
0.0 | 0.1 | GO:0046337 | phosphatidylethanolamine metabolic process(GO:0046337) |
0.0 | 0.0 | GO:0055099 | response to high density lipoprotein particle(GO:0055099) |
0.0 | 0.1 | GO:0051561 | positive regulation of mitochondrial calcium ion concentration(GO:0051561) |
0.0 | 0.5 | GO:0070328 | acylglycerol homeostasis(GO:0055090) triglyceride homeostasis(GO:0070328) |
0.0 | 0.1 | GO:0042590 | antigen processing and presentation of exogenous peptide antigen via MHC class I(GO:0042590) |
0.0 | 0.2 | GO:0046415 | urate metabolic process(GO:0046415) |
0.0 | 0.2 | GO:0060416 | response to growth hormone(GO:0060416) |
0.0 | 0.0 | GO:0072364 | regulation of cellular ketone metabolic process by regulation of transcription from RNA polymerase II promoter(GO:0072364) |
0.0 | 0.2 | GO:0071397 | cellular response to cholesterol(GO:0071397) |
0.0 | 0.3 | GO:0030575 | nuclear body organization(GO:0030575) |
0.0 | 0.2 | GO:2001214 | positive regulation of vasculogenesis(GO:2001214) |
0.0 | 0.1 | GO:2000210 | positive regulation of anoikis(GO:2000210) |
0.0 | 0.1 | GO:0019471 | 4-hydroxyproline metabolic process(GO:0019471) |
0.0 | 0.2 | GO:0042921 | glucocorticoid receptor signaling pathway(GO:0042921) |
0.0 | 0.2 | GO:0043486 | histone exchange(GO:0043486) |
0.0 | 0.1 | GO:0033326 | cerebrospinal fluid secretion(GO:0033326) |
0.0 | 0.1 | GO:0048208 | vesicle targeting, rough ER to cis-Golgi(GO:0048207) COPII vesicle coating(GO:0048208) |
0.0 | 0.1 | GO:0060068 | vagina development(GO:0060068) |
0.0 | 0.1 | GO:0006768 | biotin metabolic process(GO:0006768) |
0.0 | 0.1 | GO:0061687 | detoxification of copper ion(GO:0010273) detoxification of inorganic compound(GO:0061687) stress response to copper ion(GO:1990169) |
0.0 | 0.1 | GO:0031659 | regulation of cyclin-dependent protein serine/threonine kinase activity involved in G1/S transition of mitotic cell cycle(GO:0031657) positive regulation of cyclin-dependent protein serine/threonine kinase activity involved in G1/S transition of mitotic cell cycle(GO:0031659) |
0.0 | 0.1 | GO:0010039 | response to iron ion(GO:0010039) |
0.0 | 0.1 | GO:0006244 | pyrimidine nucleotide catabolic process(GO:0006244) |
0.0 | 0.1 | GO:0033159 | negative regulation of protein import into nucleus, translocation(GO:0033159) |
0.0 | 0.1 | GO:0042985 | negative regulation of amyloid precursor protein biosynthetic process(GO:0042985) |
0.0 | 0.0 | GO:0034035 | purine ribonucleoside bisphosphate metabolic process(GO:0034035) |
0.0 | 2.4 | GO:0006457 | protein folding(GO:0006457) |
0.0 | 0.2 | GO:0060009 | Sertoli cell development(GO:0060009) |
0.0 | 0.1 | GO:0007000 | nucleolus organization(GO:0007000) |
0.0 | 0.0 | GO:0036092 | phosphatidylinositol-3-phosphate biosynthetic process(GO:0036092) |
0.0 | 0.1 | GO:0019478 | D-amino acid catabolic process(GO:0019478) |
0.0 | 0.1 | GO:0032482 | Rab protein signal transduction(GO:0032482) |
0.0 | 0.6 | GO:0046834 | lipid phosphorylation(GO:0046834) |
0.0 | 0.2 | GO:0008300 | isoprenoid catabolic process(GO:0008300) |
0.0 | 0.1 | GO:0015793 | glycerol transport(GO:0015793) |
0.0 | 0.1 | GO:1904729 | regulation of intestinal lipid absorption(GO:1904729) |
0.0 | 0.2 | GO:0042373 | vitamin K metabolic process(GO:0042373) |
0.0 | 0.1 | GO:0070836 | caveola assembly(GO:0070836) |
0.0 | 0.2 | GO:0032469 | endoplasmic reticulum calcium ion homeostasis(GO:0032469) |
0.0 | 0.2 | GO:0033206 | meiotic cytokinesis(GO:0033206) |
0.0 | 0.1 | GO:0006046 | N-acetylglucosamine catabolic process(GO:0006046) |
0.0 | 0.2 | GO:0035845 | photoreceptor cell outer segment organization(GO:0035845) |
0.0 | 0.0 | GO:0051231 | spindle elongation(GO:0051231) |
0.0 | 0.1 | GO:0048311 | mitochondrion distribution(GO:0048311) |
0.0 | 0.1 | GO:0051533 | positive regulation of NFAT protein import into nucleus(GO:0051533) |
0.0 | 0.1 | GO:1904684 | negative regulation of metalloendopeptidase activity(GO:1904684) negative regulation of metallopeptidase activity(GO:1905049) |
0.0 | 0.3 | GO:0060216 | definitive hemopoiesis(GO:0060216) |
0.0 | 0.2 | GO:0033599 | regulation of mammary gland epithelial cell proliferation(GO:0033599) |
0.0 | 0.2 | GO:0010388 | cullin deneddylation(GO:0010388) |
0.0 | 0.1 | GO:0070933 | histone H4 deacetylation(GO:0070933) |
0.0 | 0.1 | GO:0034244 | negative regulation of DNA-templated transcription, elongation(GO:0032785) negative regulation of transcription elongation from RNA polymerase II promoter(GO:0034244) |
0.0 | 0.0 | GO:0035435 | phosphate ion transmembrane transport(GO:0035435) |
0.0 | 0.1 | GO:0030259 | lipid glycosylation(GO:0030259) |
0.0 | 0.1 | GO:0051660 | establishment of centrosome localization(GO:0051660) |
0.0 | 0.1 | GO:0001555 | oocyte growth(GO:0001555) |
0.0 | 0.1 | GO:1905097 | regulation of guanyl-nucleotide exchange factor activity(GO:1905097) |
0.0 | 0.1 | GO:2000427 | positive regulation of apoptotic cell clearance(GO:2000427) |
0.0 | 0.1 | GO:0030091 | protein repair(GO:0030091) |
0.0 | 0.8 | GO:0033003 | regulation of mast cell activation(GO:0033003) |
0.0 | 0.1 | GO:0006779 | porphyrin-containing compound biosynthetic process(GO:0006779) tetrapyrrole biosynthetic process(GO:0033014) |
0.0 | 0.2 | GO:0071425 | hematopoietic stem cell proliferation(GO:0071425) |
0.0 | 0.3 | GO:0001675 | acrosome assembly(GO:0001675) |
0.0 | 0.1 | GO:0018243 | protein O-linked glycosylation via threonine(GO:0018243) |
0.0 | 0.1 | GO:0038165 | oncostatin-M-mediated signaling pathway(GO:0038165) |
0.0 | 0.0 | GO:0048295 | positive regulation of isotype switching to IgE isotypes(GO:0048295) |
0.0 | 0.2 | GO:0032310 | prostaglandin secretion(GO:0032310) |
0.0 | 0.1 | GO:0033194 | response to hydroperoxide(GO:0033194) |
0.0 | 0.4 | GO:0048535 | lymph node development(GO:0048535) |
0.0 | 0.1 | GO:0003344 | pericardium morphogenesis(GO:0003344) |
0.0 | 0.1 | GO:0033169 | histone H3-K9 demethylation(GO:0033169) |
0.0 | 0.2 | GO:0070498 | interleukin-1-mediated signaling pathway(GO:0070498) |
0.0 | 0.0 | GO:0070875 | positive regulation of glycogen metabolic process(GO:0070875) |
0.0 | 0.1 | GO:0010746 | regulation of plasma membrane long-chain fatty acid transport(GO:0010746) |
0.0 | 0.1 | GO:0000289 | nuclear-transcribed mRNA poly(A) tail shortening(GO:0000289) |
0.0 | 0.3 | GO:0097345 | mitochondrial outer membrane permeabilization(GO:0097345) |
0.0 | 0.1 | GO:0061050 | regulation of cell growth involved in cardiac muscle cell development(GO:0061050) |
0.0 | 0.1 | GO:0032430 | positive regulation of phospholipase A2 activity(GO:0032430) |
0.0 | 0.3 | GO:0007213 | G-protein coupled acetylcholine receptor signaling pathway(GO:0007213) |
0.0 | 0.8 | GO:0070373 | negative regulation of ERK1 and ERK2 cascade(GO:0070373) |
0.0 | 0.0 | GO:0070213 | protein auto-ADP-ribosylation(GO:0070213) |
0.0 | 0.1 | GO:0030327 | prenylated protein catabolic process(GO:0030327) |
0.0 | 0.1 | GO:1903887 | motile primary cilium assembly(GO:1903887) |
0.0 | 0.0 | GO:0043691 | reverse cholesterol transport(GO:0043691) |
0.0 | 0.7 | GO:0006400 | tRNA modification(GO:0006400) |
0.0 | 0.0 | GO:0051387 | negative regulation of neurotrophin TRK receptor signaling pathway(GO:0051387) |
0.0 | 0.1 | GO:0097340 | inhibition of cysteine-type endopeptidase activity(GO:0097340) zymogen inhibition(GO:0097341) inhibition of cysteine-type endopeptidase activity involved in apoptotic process(GO:1990001) |
0.0 | 0.1 | GO:0042506 | tyrosine phosphorylation of Stat5 protein(GO:0042506) |
0.0 | 0.2 | GO:0009404 | toxin metabolic process(GO:0009404) |
0.0 | 0.2 | GO:0003356 | regulation of cilium movement(GO:0003352) regulation of cilium beat frequency(GO:0003356) |
0.0 | 0.0 | GO:0033182 | regulation of histone ubiquitination(GO:0033182) |
0.0 | 0.5 | GO:0031952 | regulation of protein autophosphorylation(GO:0031952) |
0.0 | 0.2 | GO:0006415 | translational termination(GO:0006415) |
0.0 | 0.1 | GO:0010818 | T cell chemotaxis(GO:0010818) |
0.0 | 0.1 | GO:0046952 | ketone body catabolic process(GO:0046952) |
0.0 | 1.0 | GO:0008033 | tRNA processing(GO:0008033) |
0.0 | 0.5 | GO:0000387 | spliceosomal snRNP assembly(GO:0000387) |
0.0 | 0.1 | GO:0045292 | mRNA cis splicing, via spliceosome(GO:0045292) |
0.0 | 0.1 | GO:0033033 | negative regulation of myeloid cell apoptotic process(GO:0033033) |
0.0 | 0.1 | GO:0032966 | negative regulation of collagen metabolic process(GO:0010713) negative regulation of collagen biosynthetic process(GO:0032966) |
0.0 | 0.2 | GO:0002024 | diet induced thermogenesis(GO:0002024) adaptive thermogenesis(GO:1990845) |
0.0 | 0.1 | GO:0032099 | negative regulation of appetite(GO:0032099) |
0.0 | 1.0 | GO:0042501 | serine phosphorylation of STAT protein(GO:0042501) |
0.0 | 0.1 | GO:1901164 | negative regulation of trophoblast cell migration(GO:1901164) |
0.0 | 0.5 | GO:0030968 | endoplasmic reticulum unfolded protein response(GO:0030968) |
0.0 | 0.0 | GO:0006559 | L-phenylalanine catabolic process(GO:0006559) erythrose 4-phosphate/phosphoenolpyruvate family amino acid catabolic process(GO:1902222) |
0.0 | 0.1 | GO:0071557 | histone H3-K27 demethylation(GO:0071557) |
0.0 | 0.1 | GO:0071025 | RNA surveillance(GO:0071025) nuclear RNA surveillance(GO:0071027) nuclear mRNA surveillance(GO:0071028) |
0.0 | 0.0 | GO:0010536 | positive regulation of activation of Janus kinase activity(GO:0010536) |
0.0 | 0.1 | GO:0060352 | cell adhesion molecule production(GO:0060352) |
0.0 | 0.1 | GO:0043545 | Mo-molybdopterin cofactor biosynthetic process(GO:0006777) Mo-molybdopterin cofactor metabolic process(GO:0019720) molybdopterin cofactor biosynthetic process(GO:0032324) molybdopterin cofactor metabolic process(GO:0043545) prosthetic group metabolic process(GO:0051189) |
0.0 | 0.0 | GO:1900020 | regulation of protein kinase C activity(GO:1900019) positive regulation of protein kinase C activity(GO:1900020) |
0.0 | 0.2 | GO:0010592 | positive regulation of lamellipodium assembly(GO:0010592) |
0.0 | 0.0 | GO:0002159 | desmosome assembly(GO:0002159) |
0.0 | 0.0 | GO:0019065 | receptor-mediated endocytosis of virus by host cell(GO:0019065) endocytosis involved in viral entry into host cell(GO:0075509) |
0.0 | 0.1 | GO:0035523 | protein K29-linked deubiquitination(GO:0035523) protein K33-linked deubiquitination(GO:1990168) |
0.0 | 0.0 | GO:0060481 | lobar bronchus epithelium development(GO:0060481) lobar bronchus development(GO:0060482) |
0.0 | 0.4 | GO:0007029 | endoplasmic reticulum organization(GO:0007029) |
0.0 | 0.9 | GO:0008637 | apoptotic mitochondrial changes(GO:0008637) |
0.0 | 0.1 | GO:0042760 | very long-chain fatty acid catabolic process(GO:0042760) |
0.0 | 0.0 | GO:2000574 | regulation of microtubule motor activity(GO:2000574) |
0.0 | 0.1 | GO:0010457 | centriole-centriole cohesion(GO:0010457) |
0.0 | 0.0 | GO:0002441 | histamine production involved in inflammatory response(GO:0002349) histamine secretion involved in inflammatory response(GO:0002441) histamine secretion by mast cell(GO:0002553) |
0.0 | 0.1 | GO:0048263 | determination of dorsal/ventral asymmetry(GO:0048262) determination of dorsal identity(GO:0048263) |
0.0 | 0.0 | GO:1903525 | regulation of membrane tubulation(GO:1903525) |
0.0 | 0.3 | GO:0051123 | RNA polymerase II transcriptional preinitiation complex assembly(GO:0051123) |
0.0 | 0.3 | GO:0006298 | mismatch repair(GO:0006298) |
0.0 | 0.1 | GO:0046686 | response to cadmium ion(GO:0046686) |
0.0 | 0.1 | GO:0032801 | receptor catabolic process(GO:0032801) |
0.0 | 0.1 | GO:0006543 | glutamine catabolic process(GO:0006543) |
0.0 | 0.0 | GO:0051599 | response to hydrostatic pressure(GO:0051599) |
0.0 | 0.0 | GO:2000297 | negative regulation of synapse maturation(GO:2000297) |
0.0 | 0.0 | GO:0044539 | long-chain fatty acid import(GO:0044539) |
0.0 | 0.0 | GO:0006578 | amino-acid betaine biosynthetic process(GO:0006578) |
0.0 | 0.1 | GO:0072502 | cellular phosphate ion homeostasis(GO:0030643) cellular trivalent inorganic anion homeostasis(GO:0072502) |
0.0 | 0.1 | GO:0090077 | foam cell differentiation(GO:0090077) |
0.0 | 0.2 | GO:0016926 | protein desumoylation(GO:0016926) |
0.0 | 0.0 | GO:0043652 | engulfment of apoptotic cell(GO:0043652) |
0.0 | 0.0 | GO:0030321 | transepithelial chloride transport(GO:0030321) |
0.0 | 0.2 | GO:0045725 | positive regulation of glycogen biosynthetic process(GO:0045725) |
0.0 | 0.1 | GO:0032770 | positive regulation of monooxygenase activity(GO:0032770) |
0.0 | 0.0 | GO:0070723 | response to cholesterol(GO:0070723) |
0.0 | 0.3 | GO:0010569 | regulation of double-strand break repair via homologous recombination(GO:0010569) |
0.0 | 0.0 | GO:0006677 | glycosylceramide metabolic process(GO:0006677) |
0.0 | 0.2 | GO:0071711 | basement membrane organization(GO:0071711) |
0.0 | 0.1 | GO:0042149 | cellular response to glucose starvation(GO:0042149) |
0.0 | 0.0 | GO:0043091 | L-arginine import(GO:0043091) arginine import(GO:0090467) L-arginine transport(GO:1902023) |
0.0 | 0.0 | GO:0032789 | saturated monocarboxylic acid metabolic process(GO:0032788) unsaturated monocarboxylic acid metabolic process(GO:0032789) |
0.0 | 0.1 | GO:1904219 | regulation of CDP-diacylglycerol-serine O-phosphatidyltransferase activity(GO:1904217) positive regulation of CDP-diacylglycerol-serine O-phosphatidyltransferase activity(GO:1904219) regulation of serine C-palmitoyltransferase activity(GO:1904220) positive regulation of serine C-palmitoyltransferase activity(GO:1904222) |
0.0 | 0.1 | GO:0016559 | peroxisome fission(GO:0016559) |
0.0 | 0.0 | GO:0031573 | intra-S DNA damage checkpoint(GO:0031573) |
0.0 | 0.1 | GO:0008608 | attachment of spindle microtubules to kinetochore(GO:0008608) |
0.0 | 0.4 | GO:0045454 | cell redox homeostasis(GO:0045454) |
0.0 | 0.1 | GO:0060252 | positive regulation of glial cell proliferation(GO:0060252) |
0.0 | 0.1 | GO:0007256 | activation of JNKK activity(GO:0007256) |
0.0 | 0.1 | GO:0006020 | inositol metabolic process(GO:0006020) |
0.0 | 0.5 | GO:0043966 | histone H3 acetylation(GO:0043966) |
0.0 | 0.1 | GO:0007168 | receptor guanylyl cyclase signaling pathway(GO:0007168) |
0.0 | 0.2 | GO:0032793 | positive regulation of CREB transcription factor activity(GO:0032793) |
0.0 | 0.1 | GO:0034383 | low-density lipoprotein particle clearance(GO:0034383) |
0.0 | 0.2 | GO:0045188 | regulation of circadian sleep/wake cycle, non-REM sleep(GO:0045188) |
0.0 | 0.0 | GO:0042091 | interleukin-10 biosynthetic process(GO:0042091) regulation of interleukin-10 biosynthetic process(GO:0045074) |
0.0 | 0.0 | GO:0030952 | establishment or maintenance of cytoskeleton polarity(GO:0030952) |
0.0 | 0.1 | GO:0030579 | ubiquitin-dependent SMAD protein catabolic process(GO:0030579) |
0.0 | 0.0 | GO:0060018 | astrocyte fate commitment(GO:0060018) |
0.0 | 0.0 | GO:0070417 | cellular response to cold(GO:0070417) |
0.0 | 0.0 | GO:0002572 | pro-T cell differentiation(GO:0002572) |
0.0 | 0.1 | GO:0042447 | hormone catabolic process(GO:0042447) |
0.0 | 0.0 | GO:0051683 | establishment of Golgi localization(GO:0051683) |
0.0 | 0.1 | GO:2000785 | regulation of autophagosome assembly(GO:2000785) |
0.0 | 0.0 | GO:0034204 | lipid translocation(GO:0034204) |
0.0 | 0.1 | GO:0006356 | regulation of transcription from RNA polymerase I promoter(GO:0006356) |
0.0 | 0.0 | GO:0032074 | negative regulation of nuclease activity(GO:0032074) |
0.0 | 0.0 | GO:0046104 | thymidine metabolic process(GO:0046104) |
0.0 | 0.1 | GO:0045940 | positive regulation of steroid metabolic process(GO:0045940) |
0.0 | 0.0 | GO:0014831 | gastro-intestinal system smooth muscle contraction(GO:0014831) |
0.0 | 0.1 | GO:0035278 | miRNA mediated inhibition of translation(GO:0035278) |
0.0 | 0.1 | GO:0070327 | thyroid hormone transport(GO:0070327) |
0.0 | 0.0 | GO:0034983 | peptidyl-lysine deacetylation(GO:0034983) |
0.0 | 0.1 | GO:0042574 | retinal metabolic process(GO:0042574) |
0.0 | 0.1 | GO:0018208 | peptidyl-proline modification(GO:0018208) |
0.0 | 0.2 | GO:1901072 | glucosamine-containing compound catabolic process(GO:1901072) |
0.0 | 0.1 | GO:0007263 | nitric oxide mediated signal transduction(GO:0007263) |
0.0 | 0.0 | GO:0071318 | cellular response to ATP(GO:0071318) |
0.0 | 0.1 | GO:0032815 | negative regulation of natural killer cell activation(GO:0032815) |
0.0 | 0.0 | GO:1902224 | ketone body metabolic process(GO:1902224) |
0.0 | 0.0 | GO:0060585 | regulation of prostaglandin-endoperoxide synthase activity(GO:0060584) positive regulation of prostaglandin-endoperoxide synthase activity(GO:0060585) |
0.0 | 0.1 | GO:1902187 | negative regulation of viral release from host cell(GO:1902187) |
0.0 | 0.0 | GO:2000348 | regulation of CD40 signaling pathway(GO:2000348) |
0.0 | 0.2 | GO:0046856 | phosphatidylinositol dephosphorylation(GO:0046856) |
0.0 | 0.1 | GO:0010735 | positive regulation of transcription via serum response element binding(GO:0010735) |
0.0 | 0.0 | GO:0035360 | positive regulation of peroxisome proliferator activated receptor signaling pathway(GO:0035360) |
0.0 | 0.1 | GO:0010700 | negative regulation of norepinephrine secretion(GO:0010700) |
0.0 | 0.0 | GO:0034086 | maintenance of sister chromatid cohesion(GO:0034086) maintenance of mitotic sister chromatid cohesion(GO:0034088) |
0.0 | 0.1 | GO:0016558 | protein import into peroxisome matrix(GO:0016558) |
0.0 | 0.2 | GO:0019363 | pyridine nucleotide biosynthetic process(GO:0019363) |
0.0 | 0.1 | GO:0007084 | mitotic nuclear envelope reassembly(GO:0007084) |
0.0 | 0.0 | GO:0018214 | peptidyl-glutamic acid carboxylation(GO:0017187) protein carboxylation(GO:0018214) |
0.0 | 0.2 | GO:2000401 | regulation of lymphocyte migration(GO:2000401) |
0.0 | 0.1 | GO:0033313 | meiotic cell cycle checkpoint(GO:0033313) |
0.0 | 0.1 | GO:0045743 | positive regulation of fibroblast growth factor receptor signaling pathway(GO:0045743) |
0.0 | 0.1 | GO:0032485 | regulation of Ral protein signal transduction(GO:0032485) |
0.0 | 0.0 | GO:0048840 | otolith development(GO:0048840) |
0.0 | 0.1 | GO:0071803 | positive regulation of podosome assembly(GO:0071803) |
0.0 | 0.1 | GO:0051126 | negative regulation of Arp2/3 complex-mediated actin nucleation(GO:0034316) negative regulation of actin nucleation(GO:0051126) |
0.0 | 0.1 | GO:0030502 | negative regulation of bone mineralization(GO:0030502) |
0.0 | 0.1 | GO:0002031 | G-protein coupled receptor internalization(GO:0002031) |
0.0 | 0.1 | GO:0035811 | negative regulation of urine volume(GO:0035811) |
0.0 | 0.4 | GO:0032465 | regulation of cytokinesis(GO:0032465) |
0.0 | 0.0 | GO:0008215 | spermine metabolic process(GO:0008215) |
0.0 | 0.0 | GO:1901252 | regulation of intracellular transport of viral material(GO:1901252) |
0.0 | 0.2 | GO:0000184 | nuclear-transcribed mRNA catabolic process, nonsense-mediated decay(GO:0000184) |
0.0 | 0.0 | GO:0044333 | Wnt signaling pathway involved in digestive tract morphogenesis(GO:0044333) |
0.0 | 0.0 | GO:0043152 | induction of bacterial agglutination(GO:0043152) |
0.0 | 0.0 | GO:1900165 | negative regulation of interleukin-6 secretion(GO:1900165) |
0.0 | 0.4 | GO:0072332 | intrinsic apoptotic signaling pathway by p53 class mediator(GO:0072332) |
0.0 | 0.1 | GO:0032494 | response to peptidoglycan(GO:0032494) |
0.0 | 0.0 | GO:0007195 | adenylate cyclase-inhibiting dopamine receptor signaling pathway(GO:0007195) |
0.0 | 0.0 | GO:0098902 | regulation of membrane depolarization during action potential(GO:0098902) |
0.0 | 0.2 | GO:0033561 | regulation of water loss via skin(GO:0033561) |
0.0 | 0.1 | GO:0032717 | negative regulation of interleukin-8 production(GO:0032717) |
0.0 | 0.0 | GO:0051140 | regulation of NK T cell proliferation(GO:0051140) positive regulation of NK T cell proliferation(GO:0051142) |
0.0 | 0.0 | GO:0032968 | positive regulation of transcription elongation from RNA polymerase II promoter(GO:0032968) |
0.0 | 0.1 | GO:0045779 | negative regulation of bone resorption(GO:0045779) negative regulation of bone remodeling(GO:0046851) |
0.0 | 0.0 | GO:0008298 | intracellular mRNA localization(GO:0008298) |
0.0 | 0.0 | GO:1904431 | positive regulation of t-circle formation(GO:1904431) |
0.0 | 0.1 | GO:0010611 | regulation of cardiac muscle hypertrophy(GO:0010611) |
0.0 | 0.0 | GO:0051464 | positive regulation of cortisol secretion(GO:0051464) |
0.0 | 0.0 | GO:0070814 | hydrogen sulfide biosynthetic process(GO:0070814) |
0.0 | 0.0 | GO:0002884 | regulation of type IV hypersensitivity(GO:0001807) negative regulation of hypersensitivity(GO:0002884) |
0.0 | 0.0 | GO:0045079 | negative regulation of chemokine biosynthetic process(GO:0045079) |
0.0 | 0.1 | GO:0006528 | asparagine metabolic process(GO:0006528) |
0.0 | 0.0 | GO:0034367 | macromolecular complex remodeling(GO:0034367) protein-lipid complex remodeling(GO:0034368) plasma lipoprotein particle remodeling(GO:0034369) |
0.0 | 0.1 | GO:0016574 | histone ubiquitination(GO:0016574) |
0.0 | 0.0 | GO:0048549 | positive regulation of pinocytosis(GO:0048549) |
0.0 | 0.0 | GO:0033625 | positive regulation of integrin activation(GO:0033625) positive regulation of cell-cell adhesion mediated by integrin(GO:0033634) |
0.0 | 0.0 | GO:0000820 | regulation of glutamine family amino acid metabolic process(GO:0000820) |
0.0 | 0.0 | GO:0090214 | spongiotrophoblast layer developmental growth(GO:0090214) |
0.0 | 0.0 | GO:0000389 | mRNA 3'-splice site recognition(GO:0000389) |
0.0 | 0.1 | GO:0060017 | parathyroid gland development(GO:0060017) |
0.0 | 0.0 | GO:0006654 | phosphatidic acid biosynthetic process(GO:0006654) |
0.0 | 0.0 | GO:0019695 | choline metabolic process(GO:0019695) |
0.0 | 0.0 | GO:0002835 | negative regulation of response to tumor cell(GO:0002835) negative regulation of immune response to tumor cell(GO:0002838) |
0.0 | 0.0 | GO:0048819 | regulation of hair follicle maturation(GO:0048819) |
0.0 | 0.2 | GO:0032008 | positive regulation of TOR signaling(GO:0032008) |
0.0 | 0.0 | GO:0044314 | protein K27-linked ubiquitination(GO:0044314) |
0.0 | 0.0 | GO:0000101 | sulfur amino acid transport(GO:0000101) |
0.0 | 0.3 | GO:0000245 | spliceosomal complex assembly(GO:0000245) |
0.0 | 0.0 | GO:0036015 | response to interleukin-3(GO:0036015) cellular response to interleukin-3(GO:0036016) |
0.0 | 0.0 | GO:0034720 | histone H3-K4 demethylation(GO:0034720) |
0.0 | 0.0 | GO:2000643 | positive regulation of early endosome to late endosome transport(GO:2000643) |
0.0 | 0.3 | GO:0019835 | cytolysis(GO:0019835) |
0.0 | 0.0 | GO:0009804 | coumarin metabolic process(GO:0009804) |
0.0 | 0.1 | GO:0001731 | formation of translation preinitiation complex(GO:0001731) |
0.0 | 0.1 | GO:0051136 | regulation of NK T cell differentiation(GO:0051136) positive regulation of NK T cell differentiation(GO:0051138) |
0.0 | 0.1 | GO:0050891 | multicellular organismal water homeostasis(GO:0050891) |
0.0 | 0.1 | GO:0007342 | fusion of sperm to egg plasma membrane(GO:0007342) |
0.0 | 0.0 | GO:0002215 | defense response to nematode(GO:0002215) |
0.0 | 0.0 | GO:0070947 | neutrophil mediated killing of fungus(GO:0070947) |
0.0 | 0.0 | GO:2000416 | regulation of eosinophil migration(GO:2000416) |
0.0 | 0.0 | GO:0051560 | mitochondrial calcium ion homeostasis(GO:0051560) |
0.0 | 0.1 | GO:1901386 | negative regulation of voltage-gated calcium channel activity(GO:1901386) |
0.0 | 0.2 | GO:0017144 | drug metabolic process(GO:0017144) |
0.0 | 0.0 | GO:0060741 | prostate gland stromal morphogenesis(GO:0060741) |
0.0 | 0.1 | GO:0046580 | negative regulation of Ras protein signal transduction(GO:0046580) |
0.0 | 0.0 | GO:2000169 | regulation of peptidyl-cysteine S-nitrosylation(GO:2000169) |
0.0 | 0.0 | GO:0051902 | negative regulation of mitochondrial depolarization(GO:0051902) negative regulation of membrane depolarization(GO:1904180) |
0.0 | 0.1 | GO:1900454 | positive regulation of long term synaptic depression(GO:1900454) |
0.0 | 0.1 | GO:0045577 | regulation of B cell differentiation(GO:0045577) |
0.0 | 0.0 | GO:0048386 | positive regulation of retinoic acid receptor signaling pathway(GO:0048386) |
0.0 | 0.1 | GO:0070189 | kynurenine metabolic process(GO:0070189) |
0.0 | 0.0 | GO:0009092 | homoserine metabolic process(GO:0009092) transsulfuration(GO:0019346) |
0.0 | 0.1 | GO:0035024 | negative regulation of Rho protein signal transduction(GO:0035024) |
0.0 | 0.3 | GO:0030032 | lamellipodium assembly(GO:0030032) |
0.0 | 0.0 | GO:0042726 | flavin-containing compound metabolic process(GO:0042726) |
0.0 | 0.1 | GO:0015697 | quaternary ammonium group transport(GO:0015697) |
0.0 | 0.1 | GO:0006729 | tetrahydrobiopterin biosynthetic process(GO:0006729) |
0.0 | 0.1 | GO:0045646 | regulation of erythrocyte differentiation(GO:0045646) |
0.0 | 0.0 | GO:2000286 | receptor internalization involved in canonical Wnt signaling pathway(GO:2000286) |
0.0 | 0.1 | GO:0045589 | regulation of regulatory T cell differentiation(GO:0045589) |
0.0 | 0.0 | GO:0035973 | aggrephagy(GO:0035973) |
0.0 | 0.1 | GO:0000045 | autophagosome assembly(GO:0000045) |
0.0 | 0.1 | GO:1902287 | semaphorin-plexin signaling pathway involved in axon guidance(GO:1902287) |
0.0 | 0.0 | GO:0001920 | negative regulation of receptor recycling(GO:0001920) |
0.0 | 0.1 | GO:0048012 | hepatocyte growth factor receptor signaling pathway(GO:0048012) |
0.0 | 0.0 | GO:0002693 | positive regulation of cellular extravasation(GO:0002693) |
0.0 | 0.3 | GO:0042273 | ribosomal large subunit biogenesis(GO:0042273) |
0.0 | 0.0 | GO:2000778 | positive regulation of interleukin-6 secretion(GO:2000778) |
0.0 | 0.0 | GO:0060179 | male mating behavior(GO:0060179) |
0.0 | 0.0 | GO:0045341 | MHC class I biosynthetic process(GO:0045341) regulation of MHC class I biosynthetic process(GO:0045343) positive regulation of MHC class I biosynthetic process(GO:0045345) |
0.0 | 0.0 | GO:0002072 | optic cup morphogenesis involved in camera-type eye development(GO:0002072) |
0.0 | 0.0 | GO:0046688 | response to copper ion(GO:0046688) |
0.0 | 0.0 | GO:0061450 | trophoblast cell migration(GO:0061450) |
0.0 | 0.1 | GO:0055064 | chloride ion homeostasis(GO:0055064) |
0.0 | 0.0 | GO:0009299 | mRNA transcription(GO:0009299) |
0.0 | 0.1 | GO:0016226 | iron-sulfur cluster assembly(GO:0016226) metallo-sulfur cluster assembly(GO:0031163) |
0.0 | 0.0 | GO:0051295 | establishment of meiotic spindle localization(GO:0051295) |
0.0 | 0.0 | GO:0016576 | histone dephosphorylation(GO:0016576) |
0.0 | 0.0 | GO:0032823 | regulation of natural killer cell differentiation(GO:0032823) positive regulation of natural killer cell differentiation(GO:0032825) |
0.0 | 0.0 | GO:0046416 | D-amino acid metabolic process(GO:0046416) |
0.0 | 0.0 | GO:0035589 | G-protein coupled purinergic nucleotide receptor signaling pathway(GO:0035589) |
0.0 | 0.0 | GO:0009134 | nucleoside diphosphate catabolic process(GO:0009134) |
0.0 | 0.0 | GO:0010226 | response to lithium ion(GO:0010226) |
0.0 | 0.1 | GO:0008272 | sulfate transport(GO:0008272) |
0.0 | 0.0 | GO:0006566 | threonine metabolic process(GO:0006566) |
0.0 | 1.8 | GO:0008380 | RNA splicing(GO:0008380) |
0.0 | 0.1 | GO:0042159 | lipoprotein catabolic process(GO:0042159) |
0.0 | 0.0 | GO:0046060 | dATP metabolic process(GO:0046060) |
0.0 | 0.1 | GO:1901374 | acetylcholine transport(GO:0015870) acetate ester transport(GO:1901374) |
0.0 | 0.0 | GO:0007171 | activation of transmembrane receptor protein tyrosine kinase activity(GO:0007171) |
0.0 | 0.1 | GO:0061154 | endothelial tube morphogenesis(GO:0061154) |
0.0 | 0.0 | GO:1902237 | positive regulation of endoplasmic reticulum stress-induced intrinsic apoptotic signaling pathway(GO:1902237) |
0.0 | 0.3 | GO:0009060 | aerobic respiration(GO:0009060) |
0.0 | 0.0 | GO:0065001 | specification of axis polarity(GO:0065001) |
0.0 | 0.1 | GO:0071243 | cellular response to arsenic-containing substance(GO:0071243) |
0.0 | 0.0 | GO:0039694 | viral RNA genome replication(GO:0039694) RNA replication(GO:0039703) |
0.0 | 0.0 | GO:2000628 | regulation of miRNA metabolic process(GO:2000628) |
0.0 | 0.0 | GO:0043649 | dicarboxylic acid catabolic process(GO:0043649) |
0.0 | 0.3 | GO:0051289 | protein homotetramerization(GO:0051289) |
0.0 | 0.1 | GO:0007205 | protein kinase C-activating G-protein coupled receptor signaling pathway(GO:0007205) |
0.0 | 0.0 | GO:0003348 | cardiac endothelial cell differentiation(GO:0003348) |
0.0 | 0.0 | GO:0035872 | nucleotide-binding domain, leucine rich repeat containing receptor signaling pathway(GO:0035872) |
0.0 | 0.8 | GO:0042787 | protein ubiquitination involved in ubiquitin-dependent protein catabolic process(GO:0042787) |
0.0 | 0.1 | GO:0003094 | glomerular filtration(GO:0003094) |
0.0 | 0.0 | GO:0032286 | central nervous system myelin maintenance(GO:0032286) |
0.0 | 0.0 | GO:0046519 | sphingoid metabolic process(GO:0046519) |
0.0 | 0.0 | GO:1901529 | positive regulation of anion channel activity(GO:1901529) |
0.0 | 0.2 | GO:0006879 | cellular iron ion homeostasis(GO:0006879) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.4 | 1.8 | GO:0032777 | Piccolo NuA4 histone acetyltransferase complex(GO:0032777) |
0.3 | 1.3 | GO:0031502 | dolichyl-phosphate-mannose-protein mannosyltransferase complex(GO:0031502) |
0.3 | 1.3 | GO:1990604 | IRE1-TRAF2-ASK1 complex(GO:1990604) |
0.3 | 0.8 | GO:0097513 | myosin II filament(GO:0097513) |
0.3 | 0.8 | GO:0030981 | cortical microtubule cytoskeleton(GO:0030981) |
0.2 | 1.2 | GO:0016461 | unconventional myosin complex(GO:0016461) |
0.2 | 0.7 | GO:0000172 | ribonuclease MRP complex(GO:0000172) |
0.2 | 0.5 | GO:0045179 | apical cortex(GO:0045179) |
0.2 | 0.5 | GO:0042585 | germinal vesicle(GO:0042585) |
0.2 | 0.6 | GO:0002193 | MAML1-RBP-Jkappa- ICN1 complex(GO:0002193) |
0.2 | 0.6 | GO:0031523 | Myb complex(GO:0031523) |
0.2 | 1.3 | GO:0045252 | oxoglutarate dehydrogenase complex(GO:0045252) |
0.2 | 1.0 | GO:0033093 | Weibel-Palade body(GO:0033093) |
0.2 | 0.8 | GO:0032389 | MutLalpha complex(GO:0032389) |
0.2 | 0.6 | GO:0005863 | striated muscle myosin thick filament(GO:0005863) |
0.2 | 0.2 | GO:0033063 | Rad51B-Rad51C-Rad51D-XRCC2 complex(GO:0033063) |
0.2 | 1.2 | GO:0070937 | CRD-mediated mRNA stability complex(GO:0070937) |
0.2 | 0.9 | GO:0030485 | smooth muscle contractile fiber(GO:0030485) |
0.2 | 0.7 | GO:0098536 | deuterosome(GO:0098536) |
0.2 | 1.8 | GO:0002178 | palmitoyltransferase complex(GO:0002178) |
0.2 | 0.7 | GO:0000322 | storage vacuole(GO:0000322) |
0.2 | 3.6 | GO:0045120 | pronucleus(GO:0045120) |
0.2 | 0.5 | GO:0097629 | extrinsic component of omegasome membrane(GO:0097629) |
0.2 | 0.5 | GO:0097443 | sorting endosome(GO:0097443) |
0.2 | 2.0 | GO:0035098 | ESC/E(Z) complex(GO:0035098) |
0.2 | 0.9 | GO:0070695 | FHF complex(GO:0070695) |
0.2 | 0.8 | GO:0061617 | MICOS complex(GO:0061617) |
0.2 | 0.5 | GO:0032299 | ribonuclease H2 complex(GO:0032299) |
0.2 | 0.2 | GO:0034719 | SMN-Sm protein complex(GO:0034719) |
0.2 | 0.5 | GO:0036488 | CHOP-C/EBP complex(GO:0036488) |
0.2 | 1.1 | GO:0033263 | CORVET complex(GO:0033263) |
0.2 | 1.4 | GO:0005869 | dynactin complex(GO:0005869) |
0.2 | 1.4 | GO:1990909 | Wnt signalosome(GO:1990909) |
0.2 | 0.5 | GO:0032444 | activin responsive factor complex(GO:0032444) |
0.2 | 1.0 | GO:0030660 | Golgi-associated vesicle membrane(GO:0030660) |
0.2 | 0.8 | GO:0000235 | astral microtubule(GO:0000235) |
0.2 | 0.9 | GO:0000138 | Golgi trans cisterna(GO:0000138) |
0.2 | 0.6 | GO:0002079 | inner acrosomal membrane(GO:0002079) |
0.2 | 0.6 | GO:0061689 | tricellular tight junction(GO:0061689) |
0.2 | 1.5 | GO:0031080 | nuclear pore outer ring(GO:0031080) |
0.2 | 0.9 | GO:0014731 | spectrin-associated cytoskeleton(GO:0014731) |
0.1 | 0.4 | GO:1990316 | ATG1/ULK1 kinase complex(GO:1990316) |
0.1 | 0.7 | GO:1990111 | spermatoproteasome complex(GO:1990111) |
0.1 | 3.2 | GO:0035145 | exon-exon junction complex(GO:0035145) |
0.1 | 1.0 | GO:0005952 | cAMP-dependent protein kinase complex(GO:0005952) |
0.1 | 1.0 | GO:0016593 | Cdc73/Paf1 complex(GO:0016593) |
0.1 | 1.0 | GO:0070688 | MLL5-L complex(GO:0070688) |
0.1 | 1.4 | GO:0035631 | CD40 receptor complex(GO:0035631) |
0.1 | 0.8 | GO:0045239 | tricarboxylic acid cycle enzyme complex(GO:0045239) |
0.1 | 1.5 | GO:0035102 | PRC1 complex(GO:0035102) |
0.1 | 0.9 | GO:0030130 | clathrin coat of trans-Golgi network vesicle(GO:0030130) |
0.1 | 0.3 | GO:0031512 | motile primary cilium(GO:0031512) |
0.1 | 0.9 | GO:0072669 | tRNA-splicing ligase complex(GO:0072669) |
0.1 | 0.9 | GO:0019773 | proteasome core complex, alpha-subunit complex(GO:0019773) |
0.1 | 0.4 | GO:0005899 | insulin receptor complex(GO:0005899) |
0.1 | 0.5 | GO:0097524 | sperm plasma membrane(GO:0097524) |
0.1 | 0.4 | GO:0012510 | trans-Golgi network transport vesicle membrane(GO:0012510) |
0.1 | 1.9 | GO:0031519 | PcG protein complex(GO:0031519) |
0.1 | 1.2 | GO:0042405 | nuclear inclusion body(GO:0042405) |
0.1 | 1.3 | GO:0016580 | Sin3 complex(GO:0016580) |
0.1 | 0.5 | GO:0044352 | pinosome(GO:0044352) macropinosome(GO:0044354) |
0.1 | 0.4 | GO:0005955 | calcineurin complex(GO:0005955) |
0.1 | 1.1 | GO:0005832 | chaperonin-containing T-complex(GO:0005832) |
0.1 | 0.1 | GO:0044614 | nuclear pore cytoplasmic filaments(GO:0044614) |
0.1 | 1.3 | GO:0016442 | RISC complex(GO:0016442) RNAi effector complex(GO:0031332) |
0.1 | 0.3 | GO:0072357 | PTW/PP1 phosphatase complex(GO:0072357) |
0.1 | 0.6 | GO:0097255 | R2TP complex(GO:0097255) |
0.1 | 0.9 | GO:0012507 | ER to Golgi transport vesicle membrane(GO:0012507) |
0.1 | 1.3 | GO:0005652 | nuclear lamina(GO:0005652) |
0.1 | 0.2 | GO:0005677 | chromatin silencing complex(GO:0005677) |
0.1 | 1.0 | GO:0000124 | SAGA complex(GO:0000124) |
0.1 | 0.3 | GO:0005642 | annulate lamellae(GO:0005642) |
0.1 | 4.4 | GO:0045171 | intercellular bridge(GO:0045171) |
0.1 | 2.0 | GO:0032588 | trans-Golgi network membrane(GO:0032588) |
0.1 | 1.6 | GO:0030014 | CCR4-NOT complex(GO:0030014) |
0.1 | 0.3 | GO:0033185 | dolichol-phosphate-mannose synthase complex(GO:0033185) |
0.1 | 1.9 | GO:0005666 | DNA-directed RNA polymerase III complex(GO:0005666) |
0.1 | 0.2 | GO:0070939 | Dsl1p complex(GO:0070939) |
0.1 | 0.1 | GO:0071664 | catenin-TCF7L2 complex(GO:0071664) |
0.1 | 8.2 | GO:0000776 | kinetochore(GO:0000776) |
0.1 | 0.3 | GO:0032127 | dense core granule membrane(GO:0032127) |
0.1 | 0.9 | GO:1990023 | mitotic spindle midzone(GO:1990023) |
0.1 | 2.8 | GO:0010494 | cytoplasmic stress granule(GO:0010494) |
0.1 | 0.3 | GO:0071818 | BAT3 complex(GO:0071818) ER membrane insertion complex(GO:0072379) |
0.1 | 0.6 | GO:0034464 | BBSome(GO:0034464) |
0.1 | 0.5 | GO:0000220 | vacuolar proton-transporting V-type ATPase, V0 domain(GO:0000220) |
0.1 | 3.2 | GO:0030286 | dynein complex(GO:0030286) |
0.1 | 0.4 | GO:0031094 | platelet dense tubular network(GO:0031094) |
0.1 | 0.3 | GO:0000811 | GINS complex(GO:0000811) |
0.1 | 1.0 | GO:0051233 | spindle midzone(GO:0051233) |
0.1 | 0.3 | GO:0071797 | LUBAC complex(GO:0071797) |
0.1 | 0.6 | GO:0005688 | U6 snRNP(GO:0005688) |
0.1 | 0.4 | GO:0035032 | phosphatidylinositol 3-kinase complex, class III(GO:0035032) |
0.1 | 3.6 | GO:0005643 | nuclear pore(GO:0005643) |
0.1 | 0.8 | GO:0008250 | oligosaccharyltransferase complex(GO:0008250) |
0.1 | 0.5 | GO:0005744 | mitochondrial inner membrane presequence translocase complex(GO:0005744) |
0.1 | 0.8 | GO:0071782 | endoplasmic reticulum tubular network(GO:0071782) |
0.1 | 0.3 | GO:0030891 | VCB complex(GO:0030891) |
0.1 | 1.2 | GO:0000974 | Prp19 complex(GO:0000974) |
0.1 | 0.6 | GO:0080008 | Cul4-RING E3 ubiquitin ligase complex(GO:0080008) |
0.1 | 0.3 | GO:0031254 | uropod(GO:0001931) cell trailing edge(GO:0031254) |
0.1 | 0.7 | GO:0044232 | organelle membrane contact site(GO:0044232) |
0.1 | 0.9 | GO:0042581 | specific granule(GO:0042581) |
0.1 | 0.3 | GO:0008622 | epsilon DNA polymerase complex(GO:0008622) |
0.1 | 0.3 | GO:0000408 | EKC/KEOPS complex(GO:0000408) |
0.1 | 0.4 | GO:1990124 | messenger ribonucleoprotein complex(GO:1990124) |
0.1 | 0.5 | GO:1990075 | periciliary membrane compartment(GO:1990075) |
0.1 | 2.4 | GO:0032391 | photoreceptor connecting cilium(GO:0032391) |
0.1 | 0.5 | GO:0031415 | NatA complex(GO:0031415) |
0.1 | 0.7 | GO:0030119 | AP-type membrane coat adaptor complex(GO:0030119) |
0.1 | 3.2 | GO:0031228 | integral component of Golgi membrane(GO:0030173) intrinsic component of Golgi membrane(GO:0031228) |
0.1 | 0.5 | GO:0070775 | H3 histone acetyltransferase complex(GO:0070775) MOZ/MORF histone acetyltransferase complex(GO:0070776) |
0.1 | 0.6 | GO:0034045 | pre-autophagosomal structure membrane(GO:0034045) |
0.1 | 0.5 | GO:0031462 | Cul2-RING ubiquitin ligase complex(GO:0031462) |
0.1 | 0.2 | GO:0005945 | 6-phosphofructokinase complex(GO:0005945) |
0.1 | 0.2 | GO:0016589 | NURF complex(GO:0016589) |
0.1 | 0.5 | GO:0017101 | aminoacyl-tRNA synthetase multienzyme complex(GO:0017101) |
0.1 | 0.4 | GO:0061700 | GATOR2 complex(GO:0061700) |
0.1 | 0.2 | GO:0030956 | glutamyl-tRNA(Gln) amidotransferase complex(GO:0030956) |
0.1 | 2.4 | GO:0016592 | mediator complex(GO:0016592) |
0.1 | 0.4 | GO:0031315 | extrinsic component of mitochondrial outer membrane(GO:0031315) |
0.1 | 0.4 | GO:0031264 | death-inducing signaling complex(GO:0031264) |
0.1 | 1.4 | GO:0005776 | autophagosome(GO:0005776) |
0.1 | 0.1 | GO:0097648 | G-protein coupled receptor dimeric complex(GO:0038037) G-protein coupled receptor complex(GO:0097648) |
0.1 | 0.3 | GO:0042406 | extrinsic component of endoplasmic reticulum membrane(GO:0042406) |
0.1 | 0.6 | GO:0031011 | Ino80 complex(GO:0031011) |
0.1 | 0.3 | GO:0089701 | U2AF(GO:0089701) |
0.1 | 0.3 | GO:0005797 | Golgi medial cisterna(GO:0005797) |
0.1 | 0.1 | GO:0030880 | RNA polymerase complex(GO:0030880) |
0.1 | 0.7 | GO:0032797 | SMN complex(GO:0032797) |
0.1 | 0.5 | GO:0097539 | ciliary transition fiber(GO:0097539) |
0.1 | 0.2 | GO:0097454 | Schwann cell microvillus(GO:0097454) |
0.1 | 0.8 | GO:0036038 | MKS complex(GO:0036038) |
0.1 | 0.8 | GO:0031235 | intrinsic component of the cytoplasmic side of the plasma membrane(GO:0031235) |
0.1 | 0.2 | GO:0090661 | box H/ACA telomerase RNP complex(GO:0090661) |
0.1 | 0.3 | GO:0005964 | phosphorylase kinase complex(GO:0005964) |
0.1 | 0.4 | GO:0005845 | mRNA cap binding complex(GO:0005845) RNA cap binding complex(GO:0034518) |
0.1 | 1.9 | GO:0005637 | nuclear inner membrane(GO:0005637) |
0.1 | 1.1 | GO:0002102 | podosome(GO:0002102) |
0.1 | 0.7 | GO:0034709 | methylosome(GO:0034709) |
0.1 | 0.2 | GO:0031465 | Cul4B-RING E3 ubiquitin ligase complex(GO:0031465) |
0.1 | 0.4 | GO:0036513 | Derlin-1 retrotranslocation complex(GO:0036513) |
0.1 | 0.3 | GO:0000835 | ER ubiquitin ligase complex(GO:0000835) Hrd1p ubiquitin ligase complex(GO:0000836) |
0.1 | 1.4 | GO:0035861 | site of double-strand break(GO:0035861) |
0.1 | 0.1 | GO:0035189 | Rb-E2F complex(GO:0035189) |
0.1 | 0.2 | GO:0031933 | telomeric heterochromatin(GO:0031933) |
0.1 | 0.2 | GO:0031298 | replication fork protection complex(GO:0031298) |
0.1 | 0.2 | GO:0005672 | transcription factor TFIIA complex(GO:0005672) |
0.1 | 4.0 | GO:0022625 | cytosolic large ribosomal subunit(GO:0022625) |
0.1 | 0.2 | GO:0097346 | INO80-type complex(GO:0097346) |
0.1 | 2.2 | GO:0030118 | clathrin coat(GO:0030118) |
0.1 | 0.1 | GO:0033553 | rDNA heterochromatin(GO:0033553) |
0.1 | 1.3 | GO:0071339 | MLL1/2 complex(GO:0044665) MLL1 complex(GO:0071339) |
0.1 | 0.4 | GO:0098642 | collagen type IV trimer(GO:0005587) network-forming collagen trimer(GO:0098642) collagen network(GO:0098645) basement membrane collagen trimer(GO:0098651) |
0.1 | 0.2 | GO:0070761 | pre-snoRNP complex(GO:0070761) |
0.1 | 0.2 | GO:0005853 | eukaryotic translation elongation factor 1 complex(GO:0005853) |
0.1 | 1.9 | GO:0000775 | chromosome, centromeric region(GO:0000775) |
0.1 | 0.9 | GO:0070971 | endoplasmic reticulum exit site(GO:0070971) |
0.1 | 4.3 | GO:0005902 | microvillus(GO:0005902) |
0.1 | 0.2 | GO:0005662 | DNA replication factor A complex(GO:0005662) |
0.1 | 0.1 | GO:0044462 | cell outer membrane(GO:0009279) cell envelope(GO:0030313) external encapsulating structure part(GO:0044462) |
0.1 | 0.1 | GO:0071942 | XPC complex(GO:0071942) |
0.1 | 0.2 | GO:0016602 | CCAAT-binding factor complex(GO:0016602) |
0.1 | 0.5 | GO:0070652 | HAUS complex(GO:0070652) |
0.1 | 2.3 | GO:0030964 | mitochondrial respiratory chain complex I(GO:0005747) NADH dehydrogenase complex(GO:0030964) respiratory chain complex I(GO:0045271) |
0.1 | 0.2 | GO:0010009 | cytoplasmic side of endosome membrane(GO:0010009) |
0.1 | 0.2 | GO:0005745 | m-AAA complex(GO:0005745) |
0.1 | 0.6 | GO:0072546 | ER membrane protein complex(GO:0072546) |
0.1 | 0.3 | GO:0031931 | TORC1 complex(GO:0031931) |
0.1 | 0.2 | GO:0032437 | cuticular plate(GO:0032437) |
0.1 | 1.2 | GO:0000118 | histone deacetylase complex(GO:0000118) |
0.1 | 0.6 | GO:0000421 | autophagosome membrane(GO:0000421) |
0.1 | 0.2 | GO:0000137 | Golgi cis cisterna(GO:0000137) |
0.1 | 0.4 | GO:0008278 | cohesin complex(GO:0008278) |
0.1 | 0.2 | GO:0005826 | actomyosin contractile ring(GO:0005826) |
0.1 | 1.6 | GO:0008023 | transcription elongation factor complex(GO:0008023) |
0.1 | 0.4 | GO:0000788 | nuclear nucleosome(GO:0000788) |
0.1 | 0.5 | GO:0031143 | pseudopodium(GO:0031143) |
0.1 | 0.2 | GO:0071203 | WASH complex(GO:0071203) |
0.1 | 0.6 | GO:0005942 | phosphatidylinositol 3-kinase complex(GO:0005942) |
0.1 | 0.2 | GO:0016281 | eukaryotic translation initiation factor 4F complex(GO:0016281) |
0.1 | 1.0 | GO:0005719 | nuclear euchromatin(GO:0005719) |
0.1 | 1.2 | GO:0000307 | cyclin-dependent protein kinase holoenzyme complex(GO:0000307) |
0.1 | 2.7 | GO:0016605 | PML body(GO:0016605) |
0.1 | 0.4 | GO:0042382 | paraspeckles(GO:0042382) |
0.1 | 0.2 | GO:0001650 | fibrillar center(GO:0001650) |
0.1 | 0.2 | GO:0036396 | MIS complex(GO:0036396) |
0.1 | 0.2 | GO:0030896 | checkpoint clamp complex(GO:0030896) |
0.1 | 0.3 | GO:0034098 | VCP-NPL4-UFD1 AAA ATPase complex(GO:0034098) |
0.1 | 0.1 | GO:0034666 | integrin alpha2-beta1 complex(GO:0034666) |
0.0 | 0.7 | GO:0000177 | cytoplasmic exosome (RNase complex)(GO:0000177) |
0.0 | 0.6 | GO:0030914 | STAGA complex(GO:0030914) |
0.0 | 0.1 | GO:0031417 | NatC complex(GO:0031417) |
0.0 | 0.7 | GO:0031231 | intrinsic component of peroxisomal membrane(GO:0031231) |
0.0 | 0.1 | GO:0070522 | ERCC4-ERCC1 complex(GO:0070522) |
0.0 | 0.2 | GO:0000214 | tRNA-intron endonuclease complex(GO:0000214) |
0.0 | 0.3 | GO:0016235 | aggresome(GO:0016235) |
0.0 | 0.0 | GO:0097504 | Gemini of coiled bodies(GO:0097504) |
0.0 | 0.7 | GO:0005689 | U12-type spliceosomal complex(GO:0005689) |
0.0 | 0.4 | GO:0005795 | Golgi stack(GO:0005795) |
0.0 | 0.1 | GO:0097512 | cardiac myofibril(GO:0097512) |
0.0 | 0.8 | GO:0090544 | BAF-type complex(GO:0090544) |
0.0 | 0.9 | GO:0005680 | anaphase-promoting complex(GO:0005680) |
0.0 | 0.1 | GO:0016222 | procollagen-proline 4-dioxygenase complex(GO:0016222) |
0.0 | 2.7 | GO:0030496 | midbody(GO:0030496) |
0.0 | 0.2 | GO:0044294 | dendritic growth cone(GO:0044294) |
0.0 | 2.3 | GO:0005758 | mitochondrial intermembrane space(GO:0005758) |
0.0 | 0.5 | GO:0042627 | chylomicron(GO:0042627) |
0.0 | 0.6 | GO:0045259 | proton-transporting ATP synthase complex(GO:0045259) |
0.0 | 0.3 | GO:0000439 | core TFIIH complex(GO:0000439) |
0.0 | 0.2 | GO:0033177 | proton-transporting two-sector ATPase complex, proton-transporting domain(GO:0033177) |
0.0 | 0.1 | GO:0031428 | box C/D snoRNP complex(GO:0031428) |
0.0 | 0.2 | GO:0042575 | DNA polymerase complex(GO:0042575) |
0.0 | 0.3 | GO:0005839 | proteasome core complex(GO:0005839) |
0.0 | 0.1 | GO:0016234 | inclusion body(GO:0016234) |
0.0 | 1.1 | GO:0000123 | histone acetyltransferase complex(GO:0000123) |
0.0 | 0.4 | GO:0042622 | photoreceptor outer segment membrane(GO:0042622) |
0.0 | 0.2 | GO:0030140 | trans-Golgi network transport vesicle(GO:0030140) |
0.0 | 0.1 | GO:0055087 | Ski complex(GO:0055087) |
0.0 | 1.7 | GO:0005793 | endoplasmic reticulum-Golgi intermediate compartment(GO:0005793) |
0.0 | 0.2 | GO:0097197 | tetraspanin-enriched microdomain(GO:0097197) |
0.0 | 0.2 | GO:0005577 | fibrinogen complex(GO:0005577) |
0.0 | 0.3 | GO:0034663 | endoplasmic reticulum chaperone complex(GO:0034663) |
0.0 | 0.5 | GO:0005771 | multivesicular body(GO:0005771) |
0.0 | 1.5 | GO:0000502 | proteasome complex(GO:0000502) |
0.0 | 0.3 | GO:0016272 | prefoldin complex(GO:0016272) |
0.0 | 0.4 | GO:0017119 | Golgi transport complex(GO:0017119) |
0.0 | 0.1 | GO:0031092 | platelet alpha granule membrane(GO:0031092) |
0.0 | 0.5 | GO:0046930 | pore complex(GO:0046930) |
0.0 | 0.1 | GO:0045298 | tubulin complex(GO:0045298) |
0.0 | 0.1 | GO:0030677 | nucleolar ribonuclease P complex(GO:0005655) ribonuclease P complex(GO:0030677) multimeric ribonuclease P complex(GO:0030681) |
0.0 | 0.4 | GO:0000164 | protein phosphatase type 1 complex(GO:0000164) |
0.0 | 0.9 | GO:0032040 | small-subunit processome(GO:0032040) |
0.0 | 0.1 | GO:0000796 | condensin complex(GO:0000796) |
0.0 | 0.6 | GO:0030687 | preribosome, large subunit precursor(GO:0030687) |
0.0 | 0.3 | GO:0016600 | flotillin complex(GO:0016600) |
0.0 | 0.1 | GO:0070603 | SWI/SNF superfamily-type complex(GO:0070603) |
0.0 | 0.2 | GO:0032009 | early phagosome(GO:0032009) |
0.0 | 0.3 | GO:0000782 | telomere cap complex(GO:0000782) nuclear telomere cap complex(GO:0000783) |
0.0 | 0.0 | GO:0097136 | Bcl-2 family protein complex(GO:0097136) |
0.0 | 0.1 | GO:0005896 | interleukin-6 receptor complex(GO:0005896) |
0.0 | 0.2 | GO:0030991 | intraciliary transport particle A(GO:0030991) |
0.0 | 0.3 | GO:0035869 | ciliary transition zone(GO:0035869) |
0.0 | 0.3 | GO:0005847 | mRNA cleavage and polyadenylation specificity factor complex(GO:0005847) |
0.0 | 0.3 | GO:0002116 | semaphorin receptor complex(GO:0002116) |
0.0 | 2.1 | GO:0035770 | ribonucleoprotein granule(GO:0035770) |
0.0 | 0.0 | GO:0031501 | mannosyltransferase complex(GO:0031501) |
0.0 | 0.3 | GO:0016363 | nuclear matrix(GO:0016363) |
0.0 | 2.4 | GO:0000313 | organellar ribosome(GO:0000313) mitochondrial ribosome(GO:0005761) |
0.0 | 0.1 | GO:0005610 | laminin-5 complex(GO:0005610) |
0.0 | 0.2 | GO:0005742 | mitochondrial outer membrane translocase complex(GO:0005742) |
0.0 | 0.2 | GO:0000242 | pericentriolar material(GO:0000242) |
0.0 | 8.1 | GO:0005743 | mitochondrial inner membrane(GO:0005743) |
0.0 | 0.0 | GO:0070820 | tertiary granule(GO:0070820) |
0.0 | 0.1 | GO:0035749 | myelin sheath adaxonal region(GO:0035749) |
0.0 | 0.1 | GO:0097431 | mitotic spindle pole(GO:0097431) |
0.0 | 0.6 | GO:0005876 | spindle microtubule(GO:0005876) |
0.0 | 0.3 | GO:0070852 | cell body fiber(GO:0070852) |
0.0 | 0.0 | GO:0031088 | platelet dense granule membrane(GO:0031088) |
0.0 | 0.0 | GO:0045293 | mRNA editing complex(GO:0045293) |
0.0 | 0.1 | GO:0044530 | supraspliceosomal complex(GO:0044530) |
0.0 | 3.0 | GO:0042579 | peroxisome(GO:0005777) microbody(GO:0042579) |
0.0 | 1.0 | GO:0005814 | centriole(GO:0005814) |
0.0 | 1.2 | GO:0005811 | lipid particle(GO:0005811) |
0.0 | 0.1 | GO:0001741 | XY body(GO:0001741) |
0.0 | 0.1 | GO:0002199 | zona pellucida receptor complex(GO:0002199) |
0.0 | 0.0 | GO:0034365 | discoidal high-density lipoprotein particle(GO:0034365) |
0.0 | 0.2 | GO:0000808 | origin recognition complex(GO:0000808) nuclear origin of replication recognition complex(GO:0005664) |
0.0 | 0.4 | GO:0005801 | cis-Golgi network(GO:0005801) |
0.0 | 0.2 | GO:0097208 | alveolar lamellar body(GO:0097208) |
0.0 | 0.2 | GO:0071986 | Ragulator complex(GO:0071986) |
0.0 | 0.1 | GO:0097057 | TRAF2-GSTP1 complex(GO:0097057) |
0.0 | 0.2 | GO:0000407 | pre-autophagosomal structure(GO:0000407) |
0.0 | 0.2 | GO:0032593 | insulin-responsive compartment(GO:0032593) |
0.0 | 0.1 | GO:0031983 | vesicle lumen(GO:0031983) |
0.0 | 0.0 | GO:0098827 | endoplasmic reticulum subcompartment(GO:0098827) |
0.0 | 0.1 | GO:1990923 | PET complex(GO:1990923) |
0.0 | 1.3 | GO:0036064 | ciliary basal body(GO:0036064) |
0.0 | 0.2 | GO:0030663 | COPI-coated vesicle membrane(GO:0030663) |
0.0 | 1.3 | GO:0017053 | transcriptional repressor complex(GO:0017053) |
0.0 | 0.1 | GO:0071953 | elastic fiber(GO:0071953) |
0.0 | 0.2 | GO:0005736 | DNA-directed RNA polymerase I complex(GO:0005736) |
0.0 | 0.1 | GO:0002177 | manchette(GO:0002177) |
0.0 | 2.2 | GO:0072562 | blood microparticle(GO:0072562) |
0.0 | 0.2 | GO:0005669 | transcription factor TFIID complex(GO:0005669) |
0.0 | 4.6 | GO:0005813 | centrosome(GO:0005813) |
0.0 | 1.4 | GO:0016607 | nuclear speck(GO:0016607) |
0.0 | 0.1 | GO:0000791 | euchromatin(GO:0000791) |
0.0 | 0.2 | GO:0005682 | U5 snRNP(GO:0005682) |
0.0 | 0.0 | GO:0017071 | intracellular cyclic nucleotide activated cation channel complex(GO:0017071) |
0.0 | 0.5 | GO:0008180 | COP9 signalosome(GO:0008180) |
0.0 | 0.2 | GO:0043194 | axon initial segment(GO:0043194) |
0.0 | 0.0 | GO:0005967 | mitochondrial pyruvate dehydrogenase complex(GO:0005967) |
0.0 | 0.1 | GO:0042582 | primary lysosome(GO:0005766) azurophil granule(GO:0042582) |
0.0 | 0.1 | GO:0042612 | MHC class I protein complex(GO:0042612) |
0.0 | 0.2 | GO:0015030 | Cajal body(GO:0015030) |
0.0 | 0.1 | GO:0016471 | vacuolar proton-transporting V-type ATPase complex(GO:0016471) |
0.0 | 0.1 | GO:0033256 | I-kappaB/NF-kappaB complex(GO:0033256) |
0.0 | 0.1 | GO:0032982 | myosin filament(GO:0032982) |
0.0 | 0.2 | GO:0002080 | acrosomal membrane(GO:0002080) |
0.0 | 0.2 | GO:0071004 | U2-type prespliceosome(GO:0071004) |
0.0 | 0.1 | GO:0034362 | low-density lipoprotein particle(GO:0034362) |
0.0 | 0.5 | GO:0030864 | cortical actin cytoskeleton(GO:0030864) |
0.0 | 1.4 | GO:0005681 | spliceosomal complex(GO:0005681) |
0.0 | 0.0 | GO:0030669 | clathrin-coated endocytic vesicle membrane(GO:0030669) |
0.0 | 0.5 | GO:0097014 | axoneme(GO:0005930) ciliary plasm(GO:0097014) |
0.0 | 0.1 | GO:0005663 | DNA replication factor C complex(GO:0005663) |
0.0 | 0.5 | GO:0031201 | SNARE complex(GO:0031201) |
0.0 | 1.7 | GO:0031965 | nuclear membrane(GO:0031965) |
0.0 | 0.3 | GO:0005815 | microtubule organizing center(GO:0005815) |
0.0 | 0.1 | GO:0031209 | SCAR complex(GO:0031209) |
0.0 | 0.3 | GO:0016604 | nuclear body(GO:0016604) |
0.0 | 0.3 | GO:0090575 | RNA polymerase II transcription factor complex(GO:0090575) |
0.0 | 0.1 | GO:0008385 | IkappaB kinase complex(GO:0008385) |
0.0 | 0.4 | GO:0005844 | polysome(GO:0005844) |
0.0 | 0.1 | GO:0097422 | tubular endosome(GO:0097422) |
0.0 | 0.0 | GO:0030688 | preribosome, small subunit precursor(GO:0030688) |
0.0 | 0.1 | GO:0097470 | ribbon synapse(GO:0097470) |
0.0 | 0.3 | GO:0061695 | transferase complex, transferring phosphorus-containing groups(GO:0061695) |
0.0 | 4.9 | GO:0005764 | lytic vacuole(GO:0000323) lysosome(GO:0005764) |
0.0 | 0.0 | GO:0030665 | clathrin-coated vesicle membrane(GO:0030665) |
0.0 | 0.0 | GO:0031464 | Cul4A-RING E3 ubiquitin ligase complex(GO:0031464) |
0.0 | 0.3 | GO:0030667 | secretory granule membrane(GO:0030667) |
0.0 | 0.2 | GO:0098533 | ATPase dependent transmembrane transport complex(GO:0098533) ATPase complex(GO:1904949) |
0.0 | 0.0 | GO:0005914 | spot adherens junction(GO:0005914) |
0.0 | 0.1 | GO:0032154 | cleavage furrow(GO:0032154) cell surface furrow(GO:0097610) |
0.0 | 0.1 | GO:0016460 | myosin II complex(GO:0016460) |
0.0 | 0.0 | GO:1990761 | growth cone lamellipodium(GO:1990761) |
0.0 | 13.2 | GO:0005654 | nucleoplasm(GO:0005654) |
0.0 | 0.0 | GO:0038201 | TOR complex(GO:0038201) |
0.0 | 0.1 | GO:1902555 | endoribonuclease complex(GO:1902555) |
0.0 | 5.5 | GO:0005730 | nucleolus(GO:0005730) |
0.0 | 0.3 | GO:1990204 | oxidoreductase complex(GO:1990204) |
0.0 | 0.1 | GO:0042587 | glycogen granule(GO:0042587) |
0.0 | 0.0 | GO:0042824 | MHC class I peptide loading complex(GO:0042824) TAP complex(GO:0042825) |
0.0 | 0.1 | GO:0030863 | cortical cytoskeleton(GO:0030863) |
0.0 | 10.5 | GO:0005739 | mitochondrion(GO:0005739) |
0.0 | 0.0 | GO:0035327 | transcriptionally active chromatin(GO:0035327) |
0.0 | 0.9 | GO:0000139 | Golgi membrane(GO:0000139) |
0.0 | 0.1 | GO:0001891 | phagocytic cup(GO:0001891) |
0.0 | 0.0 | GO:1990752 | microtubule end(GO:1990752) |
0.0 | 0.0 | GO:0072534 | perineuronal net(GO:0072534) |
0.0 | 0.0 | GO:0000152 | nuclear ubiquitin ligase complex(GO:0000152) |
0.0 | 0.0 | GO:0005796 | Golgi lumen(GO:0005796) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.7 | 2.2 | GO:0004611 | phosphoenolpyruvate carboxykinase activity(GO:0004611) |
0.5 | 2.4 | GO:0009378 | four-way junction helicase activity(GO:0009378) |
0.4 | 2.4 | GO:0004064 | arylesterase activity(GO:0004064) |
0.4 | 1.1 | GO:0051032 | nucleic acid transmembrane transporter activity(GO:0051032) RNA transmembrane transporter activity(GO:0051033) |
0.4 | 1.8 | GO:0030976 | thiamine pyrophosphate binding(GO:0030976) |
0.3 | 1.0 | GO:0070644 | vitamin D response element binding(GO:0070644) |
0.3 | 0.9 | GO:0008184 | glycogen phosphorylase activity(GO:0008184) |
0.3 | 0.9 | GO:0005483 | soluble NSF attachment protein activity(GO:0005483) |
0.3 | 0.9 | GO:0008597 | calcium-dependent protein serine/threonine phosphatase regulator activity(GO:0008597) |
0.3 | 0.3 | GO:0008193 | tRNA guanylyltransferase activity(GO:0008193) |
0.3 | 1.1 | GO:0004305 | ethanolamine kinase activity(GO:0004305) |
0.3 | 1.1 | GO:0004594 | pantothenate kinase activity(GO:0004594) |
0.3 | 1.6 | GO:0004169 | dolichyl-phosphate-mannose-protein mannosyltransferase activity(GO:0004169) |
0.3 | 0.8 | GO:0004832 | valine-tRNA ligase activity(GO:0004832) |
0.3 | 0.8 | GO:0070840 | dynein complex binding(GO:0070840) |
0.2 | 0.7 | GO:0000403 | Y-form DNA binding(GO:0000403) |
0.2 | 1.0 | GO:0033192 | calmodulin-dependent protein phosphatase activity(GO:0033192) |
0.2 | 1.7 | GO:0008688 | 3-(3-hydroxyphenyl)propionate hydroxylase activity(GO:0008688) 4-chlorobenzaldehyde oxidase activity(GO:0018471) 3,5-xylenol methylhydroxylase activity(GO:0018630) phenylacetate hydroxylase activity(GO:0018631) 4-nitrophenol 4-monooxygenase activity(GO:0018632) dimethyl sulfide monooxygenase activity(GO:0018633) alpha-pinene monooxygenase [NADH] activity(GO:0018634) 1-hydroxy-2-naphthoate hydroxylase activity(GO:0018637) toluene 4-monooxygenase activity(GO:0018638) xylene monooxygenase activity(GO:0018639) dibenzothiophene monooxygenase activity(GO:0018640) 6-hydroxy-3-methyl-2-oxo-1,2-dihydroquinoline 6-monooxygenase activity(GO:0018641) chlorophenol 4-monooxygenase activity(GO:0018642) carbon disulfide oxygenase activity(GO:0018643) toluene 2-monooxygenase activity(GO:0018644) 1-hydroxy-2-oxolimonene 1,2-monooxygenase activity(GO:0018646) phenanthrene 1,2-monooxygenase activity(GO:0018647) tetrahydrofuran hydroxylase activity(GO:0018649) styrene monooxygenase activity(GO:0018650) toluene-4-sulfonate monooxygenase activity(GO:0018651) toluene-sulfonate methyl-monooxygenase activity(GO:0018652) 3-methyl-2-oxo-1,2-dihydroquinoline 6-monooxygenase activity(GO:0018653) 2-hydroxy-phenylacetate hydroxylase activity(GO:0018654) 2-oxo-delta3-4,5,5-trimethylcyclopentenylacetyl-CoA 1,2-monooxygenase activity(GO:0018655) phenanthrene 3,4-monooxygenase activity(GO:0018656) toluene 3-monooxygenase activity(GO:0018657) 4-hydroxyphenylacetate,NADH:oxygen oxidoreductase (3-hydroxylating) activity(GO:0018660) limonene monooxygenase activity(GO:0019113) 2-methylnaphthalene hydroxylase activity(GO:0034526) 1-methylnaphthalene hydroxylase activity(GO:0034534) bisphenol A hydroxylase A activity(GO:0034560) salicylate 5-hydroxylase activity(GO:0034785) isobutylamine N-hydroxylase activity(GO:0034791) branched-chain dodecylbenzene sulfonate monooxygenase activity(GO:0034802) 3-HSA hydroxylase activity(GO:0034819) 4-hydroxypyridine-3-hydroxylase activity(GO:0034894) 2-octaprenyl-3-methyl-6-methoxy-1,4-benzoquinol hydroxylase activity(GO:0043719) 6-hydroxynicotinate 3-monooxygenase activity(GO:0043731) thalianol hydroxylase activity(GO:0080014) |
0.2 | 1.4 | GO:0005225 | volume-sensitive anion channel activity(GO:0005225) |
0.2 | 1.2 | GO:0017040 | ceramidase activity(GO:0017040) |
0.2 | 0.5 | GO:0032139 | dinucleotide insertion or deletion binding(GO:0032139) |
0.2 | 0.9 | GO:0004046 | aminoacylase activity(GO:0004046) |
0.2 | 0.7 | GO:0000171 | ribonuclease MRP activity(GO:0000171) |
0.2 | 0.8 | GO:0017162 | aryl hydrocarbon receptor binding(GO:0017162) |
0.2 | 0.2 | GO:0034211 | GTP-dependent protein kinase activity(GO:0034211) |
0.2 | 0.8 | GO:0015232 | heme transporter activity(GO:0015232) |
0.2 | 0.6 | GO:0004174 | electron-transferring-flavoprotein dehydrogenase activity(GO:0004174) oxidoreductase activity, acting on the CH-NH group of donors, quinone or similar compound as acceptor(GO:0016649) |
0.2 | 1.4 | GO:0008905 | mannose-phosphate guanylyltransferase activity(GO:0008905) |
0.2 | 1.6 | GO:0008140 | cAMP response element binding protein binding(GO:0008140) |
0.2 | 1.4 | GO:0003836 | beta-galactoside (CMP) alpha-2,3-sialyltransferase activity(GO:0003836) |
0.2 | 0.6 | GO:0035515 | oxidative RNA demethylase activity(GO:0035515) |
0.2 | 0.6 | GO:0045504 | dynein heavy chain binding(GO:0045504) |
0.2 | 1.1 | GO:0008603 | cAMP-dependent protein kinase regulator activity(GO:0008603) |
0.2 | 0.9 | GO:0035368 | selenocysteine insertion sequence binding(GO:0035368) |
0.2 | 0.5 | GO:0035851 | Krueppel-associated box domain binding(GO:0035851) |
0.2 | 2.5 | GO:1990841 | promoter-specific chromatin binding(GO:1990841) |
0.2 | 1.3 | GO:0098505 | G-rich strand telomeric DNA binding(GO:0098505) |
0.2 | 0.9 | GO:0035033 | histone deacetylase regulator activity(GO:0035033) |
0.2 | 0.9 | GO:0004957 | prostaglandin E receptor activity(GO:0004957) |
0.2 | 0.9 | GO:0051022 | Rho GDP-dissociation inhibitor binding(GO:0051022) |
0.2 | 0.7 | GO:0004045 | aminoacyl-tRNA hydrolase activity(GO:0004045) |
0.2 | 0.5 | GO:0030350 | iron-responsive element binding(GO:0030350) |
0.2 | 3.1 | GO:0016780 | phosphotransferase activity, for other substituted phosphate groups(GO:0016780) |
0.2 | 1.2 | GO:0016714 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, reduced pteridine as one donor, and incorporation of one atom of oxygen(GO:0016714) |
0.2 | 0.7 | GO:0003873 | 6-phosphofructo-2-kinase activity(GO:0003873) |
0.2 | 1.3 | GO:0070181 | small ribosomal subunit rRNA binding(GO:0070181) |
0.2 | 1.0 | GO:0032050 | clathrin heavy chain binding(GO:0032050) |
0.2 | 0.2 | GO:0030487 | inositol-4,5-bisphosphate 5-phosphatase activity(GO:0030487) |
0.2 | 0.6 | GO:0043262 | adenosine-diphosphatase activity(GO:0043262) |
0.2 | 1.3 | GO:0004767 | sphingomyelin phosphodiesterase activity(GO:0004767) |
0.2 | 0.5 | GO:0033829 | O-fucosylpeptide 3-beta-N-acetylglucosaminyltransferase activity(GO:0033829) |
0.2 | 0.6 | GO:0071074 | eukaryotic initiation factor eIF2 binding(GO:0071074) |
0.2 | 0.5 | GO:0050816 | phosphothreonine binding(GO:0050816) |
0.2 | 0.9 | GO:0005049 | nuclear export signal receptor activity(GO:0005049) |
0.2 | 1.7 | GO:0070410 | co-SMAD binding(GO:0070410) |
0.2 | 0.3 | GO:0043140 | ATP-dependent 3'-5' DNA helicase activity(GO:0043140) |
0.1 | 0.6 | GO:0052851 | cupric reductase activity(GO:0008823) ferric-chelate reductase (NADPH) activity(GO:0052851) |
0.1 | 0.6 | GO:0000340 | RNA 7-methylguanosine cap binding(GO:0000340) |
0.1 | 1.2 | GO:0008430 | selenium binding(GO:0008430) |
0.1 | 1.5 | GO:0051010 | microtubule plus-end binding(GO:0051010) |
0.1 | 0.1 | GO:0030351 | inositol-1,3,4,5,6-pentakisphosphate 3-phosphatase activity(GO:0030351) inositol-1,4,5,6-tetrakisphosphate 6-phosphatase activity(GO:0030352) inositol pentakisphosphate phosphatase activity(GO:0052827) |
0.1 | 0.7 | GO:0015093 | ferrous iron transmembrane transporter activity(GO:0015093) |
0.1 | 0.7 | GO:0005007 | fibroblast growth factor-activated receptor activity(GO:0005007) |
0.1 | 0.4 | GO:0097200 | cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:0097200) |
0.1 | 0.4 | GO:0043023 | ribosomal large subunit binding(GO:0043023) |
0.1 | 0.1 | GO:0051021 | GDP-dissociation inhibitor binding(GO:0051021) |
0.1 | 1.1 | GO:0042171 | lysophosphatidic acid acyltransferase activity(GO:0042171) |
0.1 | 1.0 | GO:0030957 | Tat protein binding(GO:0030957) |
0.1 | 3.0 | GO:0046966 | thyroid hormone receptor binding(GO:0046966) |
0.1 | 0.5 | GO:0036033 | mediator complex binding(GO:0036033) |
0.1 | 0.5 | GO:0044020 | histone methyltransferase activity (H4-R3 specific)(GO:0044020) |
0.1 | 0.9 | GO:0019870 | potassium channel inhibitor activity(GO:0019870) |
0.1 | 2.0 | GO:0019789 | SUMO transferase activity(GO:0019789) |
0.1 | 1.2 | GO:0008568 | microtubule-severing ATPase activity(GO:0008568) |
0.1 | 0.3 | GO:0043008 | ATP-dependent protein binding(GO:0043008) |
0.1 | 2.1 | GO:0035259 | glucocorticoid receptor binding(GO:0035259) |
0.1 | 0.6 | GO:1990380 | Lys48-specific deubiquitinase activity(GO:1990380) |
0.1 | 1.3 | GO:0035497 | cAMP response element binding(GO:0035497) |
0.1 | 1.8 | GO:0070577 | lysine-acetylated histone binding(GO:0070577) |
0.1 | 0.4 | GO:0070728 | leucine binding(GO:0070728) |
0.1 | 1.4 | GO:0008252 | nucleotidase activity(GO:0008252) |
0.1 | 0.7 | GO:0097322 | 7SK snRNA binding(GO:0097322) |
0.1 | 0.6 | GO:0030292 | protein tyrosine kinase inhibitor activity(GO:0030292) |
0.1 | 0.4 | GO:0031708 | endothelin B receptor binding(GO:0031708) |
0.1 | 1.8 | GO:0000993 | RNA polymerase II core binding(GO:0000993) |
0.1 | 0.2 | GO:0036435 | K48-linked polyubiquitin binding(GO:0036435) |
0.1 | 0.6 | GO:0004523 | RNA-DNA hybrid ribonuclease activity(GO:0004523) |
0.1 | 0.4 | GO:0047192 | 1-alkylglycerophosphocholine O-acetyltransferase activity(GO:0047192) |
0.1 | 0.5 | GO:0004062 | aryl sulfotransferase activity(GO:0004062) |
0.1 | 0.4 | GO:0004616 | phosphogluconate dehydrogenase (decarboxylating) activity(GO:0004616) |
0.1 | 0.3 | GO:0000014 | single-stranded DNA endodeoxyribonuclease activity(GO:0000014) |
0.1 | 0.3 | GO:0004924 | oncostatin-M receptor activity(GO:0004924) |
0.1 | 0.5 | GO:0019808 | polyamine binding(GO:0019808) |
0.1 | 0.3 | GO:1901612 | cardiolipin binding(GO:1901612) |
0.1 | 0.7 | GO:0035312 | 5'-3' exodeoxyribonuclease activity(GO:0035312) |
0.1 | 0.3 | GO:0008384 | IkappaB kinase activity(GO:0008384) |
0.1 | 0.2 | GO:0015143 | urate transmembrane transporter activity(GO:0015143) salt transmembrane transporter activity(GO:1901702) |
0.1 | 0.7 | GO:0030274 | LIM domain binding(GO:0030274) |
0.1 | 0.4 | GO:0017151 | DEAD/H-box RNA helicase binding(GO:0017151) |
0.1 | 0.4 | GO:0005487 | nucleocytoplasmic transporter activity(GO:0005487) |
0.1 | 0.7 | GO:0050733 | RS domain binding(GO:0050733) |
0.1 | 0.5 | GO:0004784 | superoxide dismutase activity(GO:0004784) oxidoreductase activity, acting on superoxide radicals as acceptor(GO:0016721) |
0.1 | 0.7 | GO:0030983 | mismatched DNA binding(GO:0030983) |
0.1 | 0.6 | GO:0008131 | primary amine oxidase activity(GO:0008131) |
0.1 | 1.0 | GO:1990381 | ubiquitin-specific protease binding(GO:1990381) |
0.1 | 0.3 | GO:0004711 | ribosomal protein S6 kinase activity(GO:0004711) |
0.1 | 0.3 | GO:0031800 | type 3 metabotropic glutamate receptor binding(GO:0031800) |
0.1 | 2.5 | GO:0043812 | phosphatidylinositol-4-phosphate phosphatase activity(GO:0043812) |
0.1 | 0.3 | GO:0004366 | glycerol-3-phosphate O-acyltransferase activity(GO:0004366) |
0.1 | 2.3 | GO:0008483 | transaminase activity(GO:0008483) |
0.1 | 1.9 | GO:0001056 | RNA polymerase III activity(GO:0001056) |
0.1 | 0.1 | GO:0070061 | fructose binding(GO:0070061) |
0.1 | 0.4 | GO:0034714 | type III transforming growth factor beta receptor binding(GO:0034714) |
0.1 | 0.8 | GO:0008429 | phosphatidylethanolamine binding(GO:0008429) |
0.1 | 0.4 | GO:0008486 | diphosphoinositol-polyphosphate diphosphatase activity(GO:0008486) |
0.1 | 3.2 | GO:0061650 | ubiquitin conjugating enzyme activity(GO:0061631) ubiquitin-like protein conjugating enzyme activity(GO:0061650) |
0.1 | 2.0 | GO:0008139 | nuclear localization sequence binding(GO:0008139) |
0.1 | 1.5 | GO:0016671 | oxidoreductase activity, acting on a sulfur group of donors, disulfide as acceptor(GO:0016671) |
0.1 | 0.3 | GO:1990189 | peptide-serine-N-acetyltransferase activity(GO:1990189) peptide-glutamate-N-acetyltransferase activity(GO:1990190) |
0.1 | 0.9 | GO:0031996 | thioesterase binding(GO:0031996) |
0.1 | 0.3 | GO:0070139 | ubiquitin-like protein-specific endopeptidase activity(GO:0070137) SUMO-specific endopeptidase activity(GO:0070139) |
0.1 | 0.9 | GO:0001206 | transcriptional repressor activity, RNA polymerase II distal enhancer sequence-specific binding(GO:0001206) |
0.1 | 0.3 | GO:0071987 | WD40-repeat domain binding(GO:0071987) |
0.1 | 2.4 | GO:0051537 | 2 iron, 2 sulfur cluster binding(GO:0051537) |
0.1 | 0.6 | GO:0008479 | queuine tRNA-ribosyltransferase activity(GO:0008479) |
0.1 | 0.4 | GO:0016899 | oxidoreductase activity, acting on the CH-OH group of donors, oxygen as acceptor(GO:0016899) |
0.1 | 0.4 | GO:0005173 | stem cell factor receptor binding(GO:0005173) |
0.1 | 1.6 | GO:0008307 | structural constituent of muscle(GO:0008307) |
0.1 | 0.4 | GO:0004095 | carnitine O-palmitoyltransferase activity(GO:0004095) |
0.1 | 0.4 | GO:0016401 | palmitoyl-CoA oxidase activity(GO:0016401) |
0.1 | 0.1 | GO:0016615 | malate dehydrogenase activity(GO:0016615) |
0.1 | 0.5 | GO:0000774 | adenyl-nucleotide exchange factor activity(GO:0000774) |
0.1 | 0.9 | GO:0004774 | succinate-CoA ligase activity(GO:0004774) |
0.1 | 0.1 | GO:0009931 | calcium-dependent protein serine/threonine kinase activity(GO:0009931) |
0.1 | 0.7 | GO:0017070 | U6 snRNA binding(GO:0017070) |
0.1 | 0.8 | GO:0043995 | histone acetyltransferase activity (H4-K5 specific)(GO:0043995) histone acetyltransferase activity (H4-K8 specific)(GO:0043996) histone acetyltransferase activity (H4-K16 specific)(GO:0046972) |
0.1 | 1.9 | GO:0070003 | threonine-type endopeptidase activity(GO:0004298) threonine-type peptidase activity(GO:0070003) |
0.1 | 0.6 | GO:0004579 | dolichyl-diphosphooligosaccharide-protein glycotransferase activity(GO:0004579) |
0.1 | 0.3 | GO:0015119 | hexose phosphate transmembrane transporter activity(GO:0015119) organophosphate:inorganic phosphate antiporter activity(GO:0015315) hexose-phosphate:inorganic phosphate antiporter activity(GO:0015526) glucose 6-phosphate:inorganic phosphate antiporter activity(GO:0061513) |
0.1 | 0.4 | GO:0004758 | serine C-palmitoyltransferase activity(GO:0004758) |
0.1 | 0.5 | GO:0001727 | lipid kinase activity(GO:0001727) |
0.1 | 0.2 | GO:0008309 | double-stranded DNA exodeoxyribonuclease activity(GO:0008309) |
0.1 | 1.0 | GO:0008198 | ferrous iron binding(GO:0008198) |
0.1 | 2.2 | GO:0001103 | RNA polymerase II repressing transcription factor binding(GO:0001103) |
0.1 | 0.8 | GO:0048156 | tau protein binding(GO:0048156) |
0.1 | 0.5 | GO:0047372 | acylglycerol lipase activity(GO:0047372) |
0.1 | 2.3 | GO:0004683 | calmodulin-dependent protein kinase activity(GO:0004683) |
0.1 | 0.6 | GO:0097027 | ubiquitin-protein transferase activator activity(GO:0097027) |
0.1 | 0.4 | GO:0004726 | non-membrane spanning protein tyrosine phosphatase activity(GO:0004726) |
0.1 | 1.1 | GO:0070034 | telomerase RNA binding(GO:0070034) |
0.1 | 0.9 | GO:0097602 | cullin family protein binding(GO:0097602) |
0.1 | 1.3 | GO:0008143 | poly(A) binding(GO:0008143) |
0.1 | 0.2 | GO:0016635 | oxidoreductase activity, acting on the CH-CH group of donors, quinone or related compound as acceptor(GO:0016635) |
0.1 | 0.2 | GO:0008545 | JUN kinase kinase activity(GO:0008545) |
0.1 | 0.3 | GO:0060230 | lipoprotein lipase activator activity(GO:0060230) |
0.1 | 0.3 | GO:0015057 | thrombin receptor activity(GO:0015057) |
0.1 | 1.2 | GO:0008308 | voltage-gated anion channel activity(GO:0008308) |
0.1 | 0.3 | GO:0002046 | opsin binding(GO:0002046) |
0.1 | 0.2 | GO:0016309 | 1-phosphatidylinositol-5-phosphate 4-kinase activity(GO:0016309) |
0.1 | 0.2 | GO:0000339 | RNA cap binding(GO:0000339) |
0.1 | 0.3 | GO:0032896 | palmitoyl-CoA 9-desaturase activity(GO:0032896) |
0.1 | 0.3 | GO:0016833 | oxo-acid-lyase activity(GO:0016833) |
0.1 | 0.4 | GO:0035184 | histone threonine kinase activity(GO:0035184) |
0.1 | 0.6 | GO:0019534 | toxin transporter activity(GO:0019534) |
0.1 | 0.4 | GO:0015450 | P-P-bond-hydrolysis-driven protein transmembrane transporter activity(GO:0015450) |
0.1 | 0.3 | GO:0071253 | connexin binding(GO:0071253) |
0.1 | 2.2 | GO:0032451 | demethylase activity(GO:0032451) |
0.1 | 3.0 | GO:0035064 | methylated histone binding(GO:0035064) |
0.1 | 0.4 | GO:0043184 | vascular endothelial growth factor receptor 2 binding(GO:0043184) |
0.1 | 0.3 | GO:0052795 | exo-alpha-sialidase activity(GO:0004308) alpha-sialidase activity(GO:0016997) exo-alpha-(2->3)-sialidase activity(GO:0052794) exo-alpha-(2->6)-sialidase activity(GO:0052795) exo-alpha-(2->8)-sialidase activity(GO:0052796) |
0.1 | 0.1 | GO:0070915 | lysophosphatidic acid receptor activity(GO:0070915) |
0.1 | 0.5 | GO:0001094 | TFIID-class transcription factor binding(GO:0001094) |
0.1 | 0.7 | GO:0050321 | tau-protein kinase activity(GO:0050321) |
0.1 | 0.3 | GO:0070053 | thrombospondin receptor activity(GO:0070053) |
0.1 | 0.2 | GO:0003872 | 6-phosphofructokinase activity(GO:0003872) |
0.1 | 0.3 | GO:0000182 | rDNA binding(GO:0000182) |
0.1 | 0.4 | GO:0046935 | 1-phosphatidylinositol-3-kinase regulator activity(GO:0046935) |
0.1 | 1.6 | GO:0005385 | zinc ion transmembrane transporter activity(GO:0005385) |
0.1 | 0.1 | GO:0035014 | phosphatidylinositol 3-kinase regulator activity(GO:0035014) |
0.1 | 0.2 | GO:0050567 | glutaminyl-tRNA synthase (glutamine-hydrolyzing) activity(GO:0050567) |
0.1 | 0.2 | GO:0003986 | acetyl-CoA hydrolase activity(GO:0003986) |
0.1 | 0.1 | GO:0061629 | RNA polymerase II sequence-specific DNA binding transcription factor binding(GO:0061629) |
0.1 | 0.1 | GO:0042809 | vitamin D receptor binding(GO:0042809) |
0.1 | 0.4 | GO:0017166 | vinculin binding(GO:0017166) |
0.1 | 0.1 | GO:0019788 | NEDD8 transferase activity(GO:0019788) |
0.1 | 0.3 | GO:0017150 | tRNA dihydrouridine synthase activity(GO:0017150) |
0.1 | 0.4 | GO:0016176 | superoxide-generating NADPH oxidase activator activity(GO:0016176) |
0.1 | 0.3 | GO:0043138 | 3'-5' DNA helicase activity(GO:0043138) |
0.1 | 1.0 | GO:0043734 | DNA-N1-methyladenine dioxygenase activity(GO:0043734) |
0.1 | 0.7 | GO:0016868 | intramolecular transferase activity, phosphotransferases(GO:0016868) |
0.1 | 0.2 | GO:0008503 | benzodiazepine receptor activity(GO:0008503) |
0.1 | 0.2 | GO:0008379 | thioredoxin peroxidase activity(GO:0008379) |
0.1 | 0.7 | GO:0030898 | actin-dependent ATPase activity(GO:0030898) |
0.1 | 0.5 | GO:0035612 | AP-2 adaptor complex binding(GO:0035612) |
0.1 | 0.7 | GO:0003746 | translation elongation factor activity(GO:0003746) |
0.1 | 0.3 | GO:0008174 | mRNA methyltransferase activity(GO:0008174) |
0.1 | 0.5 | GO:0050544 | arachidonic acid binding(GO:0050544) |
0.1 | 0.1 | GO:0033142 | progesterone receptor binding(GO:0033142) |
0.1 | 1.2 | GO:0008137 | NADH dehydrogenase (ubiquinone) activity(GO:0008137) NADH dehydrogenase (quinone) activity(GO:0050136) |
0.1 | 0.3 | GO:0042609 | CD4 receptor binding(GO:0042609) |
0.1 | 0.2 | GO:0032564 | dATP binding(GO:0032564) |
0.1 | 0.4 | GO:0001013 | RNA polymerase I regulatory region DNA binding(GO:0001013) |
0.1 | 1.6 | GO:0004709 | MAP kinase kinase kinase activity(GO:0004709) |
0.1 | 0.2 | GO:0016888 | endodeoxyribonuclease activity, producing 5'-phosphomonoesters(GO:0016888) |
0.1 | 2.3 | GO:0016859 | cis-trans isomerase activity(GO:0016859) |
0.1 | 0.1 | GO:1990825 | sequence-specific mRNA binding(GO:1990825) |
0.1 | 0.2 | GO:0016151 | nickel cation binding(GO:0016151) |
0.1 | 0.9 | GO:0070402 | NADPH binding(GO:0070402) |
0.1 | 0.3 | GO:0046912 | transferase activity, transferring acyl groups, acyl groups converted into alkyl on transfer(GO:0046912) |
0.1 | 0.2 | GO:0070326 | very-low-density lipoprotein particle receptor binding(GO:0070326) |
0.1 | 1.5 | GO:0003887 | DNA-directed DNA polymerase activity(GO:0003887) |
0.1 | 0.7 | GO:0005123 | death receptor binding(GO:0005123) |
0.1 | 0.2 | GO:0008970 | phosphatidylcholine 1-acylhydrolase activity(GO:0008970) |
0.1 | 0.2 | GO:0016774 | phosphotransferase activity, carboxyl group as acceptor(GO:0016774) |
0.1 | 0.7 | GO:0017056 | structural constituent of nuclear pore(GO:0017056) |
0.1 | 0.5 | GO:0019869 | chloride channel inhibitor activity(GO:0019869) |
0.1 | 0.2 | GO:0031698 | beta-2 adrenergic receptor binding(GO:0031698) |
0.1 | 0.6 | GO:0010314 | phosphatidylinositol-5-phosphate binding(GO:0010314) |
0.1 | 0.6 | GO:0001671 | ATPase activator activity(GO:0001671) |
0.1 | 0.4 | GO:0070492 | oligosaccharide binding(GO:0070492) |
0.1 | 0.3 | GO:0016308 | 1-phosphatidylinositol-4-phosphate 5-kinase activity(GO:0016308) |
0.1 | 0.4 | GO:0035381 | extracellular ATP-gated cation channel activity(GO:0004931) ATP-gated ion channel activity(GO:0035381) |
0.1 | 0.1 | GO:0030621 | U4 snRNA binding(GO:0030621) |
0.1 | 0.3 | GO:0051959 | dynein light intermediate chain binding(GO:0051959) |
0.1 | 0.1 | GO:0003854 | 3-beta-hydroxy-delta5-steroid dehydrogenase activity(GO:0003854) |
0.1 | 1.6 | GO:0031369 | translation initiation factor binding(GO:0031369) |
0.1 | 0.2 | GO:0016520 | growth hormone-releasing hormone receptor activity(GO:0016520) |
0.1 | 0.3 | GO:0005131 | growth hormone receptor binding(GO:0005131) |
0.1 | 0.3 | GO:0003956 | NAD(P)+-protein-arginine ADP-ribosyltransferase activity(GO:0003956) |
0.1 | 0.1 | GO:0030911 | TPR domain binding(GO:0030911) |
0.1 | 0.2 | GO:0032552 | deoxyribonucleotide binding(GO:0032552) |
0.1 | 1.6 | GO:0017112 | Rab guanyl-nucleotide exchange factor activity(GO:0017112) |
0.1 | 3.1 | GO:0051082 | unfolded protein binding(GO:0051082) |
0.1 | 0.2 | GO:0032051 | clathrin light chain binding(GO:0032051) |
0.1 | 0.2 | GO:0016941 | natriuretic peptide receptor activity(GO:0016941) |
0.1 | 0.3 | GO:0015165 | pyrimidine nucleotide-sugar transmembrane transporter activity(GO:0015165) |
0.1 | 0.2 | GO:0017116 | single-stranded DNA-dependent ATP-dependent DNA helicase activity(GO:0017116) |
0.1 | 0.4 | GO:0042299 | pivalyl-CoA mutase activity(GO:0034784) o-hydroxylaminobenzoate mutase activity(GO:0034951) lupeol synthase activity(GO:0042299) beta-amyrin synthase activity(GO:0042300) baruol synthase activity(GO:0080011) |
0.1 | 0.3 | GO:0008454 | alpha-1,3-mannosylglycoprotein 4-beta-N-acetylglucosaminyltransferase activity(GO:0008454) |
0.1 | 0.4 | GO:0031702 | type 1 angiotensin receptor binding(GO:0031702) |
0.1 | 0.3 | GO:0045545 | syndecan binding(GO:0045545) |
0.1 | 0.5 | GO:0042975 | peroxisome proliferator activated receptor binding(GO:0042975) |
0.1 | 0.2 | GO:0000213 | tRNA-intron endonuclease activity(GO:0000213) |
0.1 | 0.2 | GO:0015141 | succinate transmembrane transporter activity(GO:0015141) |
0.1 | 0.5 | GO:0030676 | Rac guanyl-nucleotide exchange factor activity(GO:0030676) |
0.1 | 0.3 | GO:0070717 | poly-purine tract binding(GO:0070717) |
0.1 | 0.2 | GO:0004691 | cAMP-dependent protein kinase activity(GO:0004691) |
0.1 | 0.8 | GO:0016863 | intramolecular oxidoreductase activity, transposing C=C bonds(GO:0016863) |
0.1 | 0.1 | GO:0005114 | type II transforming growth factor beta receptor binding(GO:0005114) |
0.1 | 0.3 | GO:0000268 | peroxisome targeting sequence binding(GO:0000268) |
0.1 | 0.2 | GO:0031871 | proteinase activated receptor binding(GO:0031871) |
0.1 | 0.2 | GO:0004566 | beta-glucuronidase activity(GO:0004566) |
0.0 | 0.1 | GO:0015319 | sodium:inorganic phosphate symporter activity(GO:0015319) |
0.0 | 0.3 | GO:0050308 | sugar-phosphatase activity(GO:0050308) |
0.0 | 0.1 | GO:0004653 | polypeptide N-acetylgalactosaminyltransferase activity(GO:0004653) |
0.0 | 0.2 | GO:0004300 | enoyl-CoA hydratase activity(GO:0004300) |
0.0 | 0.0 | GO:0016419 | S-malonyltransferase activity(GO:0016419) malonyltransferase activity(GO:0016420) |
0.0 | 0.1 | GO:0042030 | ATPase inhibitor activity(GO:0042030) |
0.0 | 0.2 | GO:0003831 | beta-N-acetylglucosaminylglycopeptide beta-1,4-galactosyltransferase activity(GO:0003831) |
0.0 | 0.4 | GO:0071933 | Arp2/3 complex binding(GO:0071933) |
0.0 | 0.1 | GO:0004605 | phosphatidate cytidylyltransferase activity(GO:0004605) |
0.0 | 0.4 | GO:0015172 | acidic amino acid transmembrane transporter activity(GO:0015172) |
0.0 | 0.3 | GO:0016936 | galactoside binding(GO:0016936) |
0.0 | 0.8 | GO:0016702 | oxidoreductase activity, acting on single donors with incorporation of molecular oxygen, incorporation of two atoms of oxygen(GO:0016702) |
0.0 | 0.2 | GO:0001025 | RNA polymerase III transcription factor binding(GO:0001025) |
0.0 | 0.1 | GO:0018566 | 2,3-dihydroxy DDT 1,2-dioxygenase activity(GO:0018542) phenanthrene dioxygenase activity(GO:0018555) 2,2',3-trihydroxybiphenyl dioxygenase activity(GO:0018556) 1,2-dihydroxyfluorene 1,1-alpha-dioxygenase activity(GO:0018557) 5,6-dihydroxy-3-methyl-2-oxo-1,2-dihydroquinoline dioxygenase activity(GO:0018558) 1,1-dichloro-2-(dihydroxy-4-chlorophenyl)-(4-chlorophenyl)ethene 1,2-dioxygenase activity(GO:0018559) protocatechuate 3,4-dioxygenase type II activity(GO:0018560) 2'-aminobiphenyl-2,3-diol 1,2-dioxygenase activity(GO:0018561) 3,4-dihydroxyfluorene 4,4-alpha-dioxygenase activity(GO:0018562) 2,3-dihydroxy-ethylbenzene 1,2-dioxygenase activity(GO:0018563) carbazole 1,9a-dioxygenase activity(GO:0018564) dihydroxydibenzothiophene dioxygenase activity(GO:0018565) 1,2-dihydroxynaphthalene-6-sulfonate 1,8a-dioxygenase activity(GO:0018566) styrene dioxygenase activity(GO:0018567) 3,4-dihydroxyphenanthrene dioxygenase activity(GO:0018568) hydroquinone 1,2-dioxygenase activity(GO:0018569) p-cumate 2,3-dioxygenase activity(GO:0018570) 2,3-dihydroxy-p-cumate dioxygenase activity(GO:0018571) 3,5-dichlorocatechol 1,2-dioxygenase activity(GO:0018572) 2-aminophenol 1,6-dioxygenase activity(GO:0018573) 2,6-dichloro-p-hydroquinone 1,2-dioxygenase activity(GO:0018574) chlorocatechol 1,2-dioxygenase activity(GO:0018575) catechol dioxygenase activity(GO:0019114) dihydroxyfluorene dioxygenase activity(GO:0019117) 5-aminosalicylate dioxygenase activity(GO:0034543) 3-hydroxy-2-naphthoate 2,3-dioxygenase activity(GO:0034803) benzo(a)pyrene 11,12-dioxygenase activity(GO:0034806) benzo(a)pyrene 4,5-dioxygenase activity(GO:0034808) 4,5-dihydroxybenzo(a)pyrene dioxygenase activity(GO:0034810) benzo(a)pyrene 9,10-dioxygenase activity(GO:0034811) 9,10-dihydroxybenzo(a)pyrene dioxygenase activity(GO:0034812) benzo(a)pyrene 7,8-dioxygenase activity(GO:0034813) 7,8-dihydroxy benzo(a)pyrene dioxygenase activity(GO:0034814) 1,2-dihydroxy-5,6,7,8-tetrahydronaphthalene extradiol dioxygenase activity(GO:0034827) 2-mercaptobenzothiazole dioxygenase activity(GO:0034834) pyridine-3,4-diol dioxygenase activity(GO:0034895) pyrene dioxygenase activity(GO:0034920) 4,5-dihydroxypyrene dioxygenase activity(GO:0034922) phenanthrene-4-carboxylate dioxygenase activity(GO:0034934) tetrachlorobenzene dioxygenase activity(GO:0034935) 4,6-dichloro-3-methylcatechol 1,2-dioxygenase activity(GO:0034936) 2,3-dihydroxydiphenyl ether dioxygenase activity(GO:0034955) diphenyl ether 1,2-dioxygenase activity(GO:0034956) arachidonate 8(S)-lipoxygenase activity(GO:0036403) 4-hydroxycatechol 1,2-dioxygenase activity(GO:0047074) |
0.0 | 0.2 | GO:0016681 | ubiquinol-cytochrome-c reductase activity(GO:0008121) oxidoreductase activity, acting on diphenols and related substances as donors(GO:0016679) oxidoreductase activity, acting on diphenols and related substances as donors, cytochrome as acceptor(GO:0016681) |
0.0 | 0.0 | GO:0001069 | regulatory region RNA binding(GO:0001069) |
0.0 | 0.1 | GO:0004862 | cAMP-dependent protein kinase inhibitor activity(GO:0004862) |
0.0 | 0.2 | GO:0048256 | flap endonuclease activity(GO:0048256) |
0.0 | 0.1 | GO:0034452 | dynactin binding(GO:0034452) |
0.0 | 0.2 | GO:0042015 | interleukin-20 binding(GO:0042015) |
0.0 | 0.3 | GO:0070324 | thyroid hormone binding(GO:0070324) |
0.0 | 0.1 | GO:0015065 | uridine nucleotide receptor activity(GO:0015065) G-protein coupled pyrimidinergic nucleotide receptor activity(GO:0071553) |
0.0 | 0.1 | GO:0005338 | nucleotide-sugar transmembrane transporter activity(GO:0005338) |
0.0 | 0.3 | GO:0043024 | ribosomal small subunit binding(GO:0043024) |
0.0 | 0.4 | GO:0008889 | glycerophosphodiester phosphodiesterase activity(GO:0008889) |
0.0 | 0.1 | GO:0004090 | carbonyl reductase (NADPH) activity(GO:0004090) |
0.0 | 0.1 | GO:0004703 | G-protein coupled receptor kinase activity(GO:0004703) |
0.0 | 0.2 | GO:0008532 | N-acetyllactosaminide beta-1,3-N-acetylglucosaminyltransferase activity(GO:0008532) |
0.0 | 1.2 | GO:0016289 | CoA hydrolase activity(GO:0016289) |
0.0 | 0.0 | GO:0060228 | phosphatidylcholine-sterol O-acyltransferase activator activity(GO:0060228) |
0.0 | 0.5 | GO:0004535 | poly(A)-specific ribonuclease activity(GO:0004535) |
0.0 | 0.2 | GO:0019145 | aminobutyraldehyde dehydrogenase activity(GO:0019145) 4-trimethylammoniobutyraldehyde dehydrogenase activity(GO:0047105) |
0.0 | 0.1 | GO:0045294 | alpha-catenin binding(GO:0045294) |
0.0 | 0.4 | GO:0031545 | peptidyl-proline 4-dioxygenase activity(GO:0031545) |
0.0 | 0.0 | GO:0004096 | catalase activity(GO:0004096) |
0.0 | 0.3 | GO:0008187 | poly-pyrimidine tract binding(GO:0008187) |
0.0 | 0.4 | GO:0070180 | large ribosomal subunit rRNA binding(GO:0070180) |
0.0 | 0.1 | GO:0004793 | threonine aldolase activity(GO:0004793) L-allo-threonine aldolase activity(GO:0008732) |
0.0 | 0.2 | GO:1990405 | protein antigen binding(GO:1990405) |
0.0 | 0.1 | GO:0004949 | cannabinoid receptor activity(GO:0004949) |
0.0 | 0.3 | GO:0005223 | intracellular cGMP activated cation channel activity(GO:0005223) |
0.0 | 0.1 | GO:0050508 | glucuronosyl-N-acetylglucosaminyl-proteoglycan 4-alpha-N-acetylglucosaminyltransferase activity(GO:0050508) |
0.0 | 0.6 | GO:0045502 | dynein binding(GO:0045502) |
0.0 | 0.2 | GO:0019136 | deoxynucleoside kinase activity(GO:0019136) |
0.0 | 0.1 | GO:2001069 | glycogen binding(GO:2001069) |
0.0 | 1.3 | GO:0030145 | manganese ion binding(GO:0030145) |
0.0 | 0.1 | GO:0052650 | NADP-retinol dehydrogenase activity(GO:0052650) |
0.0 | 1.2 | GO:0019212 | phosphatase inhibitor activity(GO:0019212) |
0.0 | 0.2 | GO:0038100 | nodal binding(GO:0038100) |
0.0 | 1.2 | GO:0004402 | histone acetyltransferase activity(GO:0004402) |
0.0 | 0.1 | GO:0019776 | Atg8 ligase activity(GO:0019776) |
0.0 | 0.8 | GO:0030332 | cyclin binding(GO:0030332) |
0.0 | 0.1 | GO:0048408 | epidermal growth factor binding(GO:0048408) |
0.0 | 0.1 | GO:0016149 | translation release factor activity, codon specific(GO:0016149) |
0.0 | 0.7 | GO:0043014 | alpha-tubulin binding(GO:0043014) |
0.0 | 0.1 | GO:0004731 | purine-nucleoside phosphorylase activity(GO:0004731) |
0.0 | 0.2 | GO:0097153 | cysteine-type endopeptidase activity involved in apoptotic process(GO:0097153) |
0.0 | 0.1 | GO:0005094 | Rho GDP-dissociation inhibitor activity(GO:0005094) |
0.0 | 0.4 | GO:0050681 | androgen receptor binding(GO:0050681) |
0.0 | 0.9 | GO:0051990 | (R)-2-hydroxyglutarate dehydrogenase activity(GO:0051990) |
0.0 | 0.5 | GO:0005337 | nucleoside transmembrane transporter activity(GO:0005337) |
0.0 | 0.0 | GO:0051373 | FATZ binding(GO:0051373) |
0.0 | 0.6 | GO:0004198 | calcium-dependent cysteine-type endopeptidase activity(GO:0004198) |
0.0 | 1.0 | GO:0019706 | protein-cysteine S-palmitoyltransferase activity(GO:0019706) |
0.0 | 0.3 | GO:0004549 | tRNA-specific ribonuclease activity(GO:0004549) |
0.0 | 2.0 | GO:0061630 | ubiquitin protein ligase activity(GO:0061630) ubiquitin-like protein ligase activity(GO:0061659) |
0.0 | 0.2 | GO:0035174 | histone serine kinase activity(GO:0035174) |
0.0 | 0.3 | GO:0016846 | carbon-sulfur lyase activity(GO:0016846) |
0.0 | 0.1 | GO:0008525 | phosphatidylcholine transporter activity(GO:0008525) |
0.0 | 0.0 | GO:0030151 | molybdenum ion binding(GO:0030151) |
0.0 | 0.3 | GO:0070097 | delta-catenin binding(GO:0070097) |
0.0 | 0.2 | GO:0015016 | [heparan sulfate]-glucosamine N-sulfotransferase activity(GO:0015016) |
0.0 | 0.4 | GO:0017154 | semaphorin receptor activity(GO:0017154) |
0.0 | 0.3 | GO:0016832 | aldehyde-lyase activity(GO:0016832) |
0.0 | 1.0 | GO:0000049 | tRNA binding(GO:0000049) |
0.0 | 0.9 | GO:0003684 | damaged DNA binding(GO:0003684) |
0.0 | 0.1 | GO:0015932 | nucleobase-containing compound transmembrane transporter activity(GO:0015932) |
0.0 | 0.1 | GO:0004359 | glutaminase activity(GO:0004359) |
0.0 | 0.4 | GO:0070064 | proline-rich region binding(GO:0070064) |
0.0 | 2.2 | GO:0008013 | beta-catenin binding(GO:0008013) |
0.0 | 1.4 | GO:0004812 | aminoacyl-tRNA ligase activity(GO:0004812) |
0.0 | 0.2 | GO:0050700 | CARD domain binding(GO:0050700) |
0.0 | 0.1 | GO:0015226 | amino-acid betaine transmembrane transporter activity(GO:0015199) carnitine transmembrane transporter activity(GO:0015226) |
0.0 | 0.2 | GO:0030250 | cyclase activator activity(GO:0010853) guanylate cyclase activator activity(GO:0030250) |
0.0 | 0.5 | GO:0016493 | C-C chemokine receptor activity(GO:0016493) |
0.0 | 8.3 | GO:0016879 | ligase activity, forming carbon-nitrogen bonds(GO:0016879) |
0.0 | 0.1 | GO:0034236 | protein kinase A catalytic subunit binding(GO:0034236) |
0.0 | 1.9 | GO:0003724 | RNA helicase activity(GO:0003724) |
0.0 | 0.1 | GO:0003829 | beta-1,3-galactosyl-O-glycosyl-glycoprotein beta-1,6-N-acetylglucosaminyltransferase activity(GO:0003829) |
0.0 | 0.1 | GO:0070653 | high-density lipoprotein particle receptor binding(GO:0070653) |
0.0 | 0.1 | GO:0061676 | importin-alpha family protein binding(GO:0061676) |
0.0 | 0.0 | GO:0097371 | MDM2/MDM4 family protein binding(GO:0097371) |
0.0 | 0.2 | GO:0036310 | annealing helicase activity(GO:0036310) |
0.0 | 0.2 | GO:0048531 | beta-1,3-galactosyltransferase activity(GO:0048531) |
0.0 | 0.2 | GO:0035197 | siRNA binding(GO:0035197) |
0.0 | 0.7 | GO:0048487 | beta-tubulin binding(GO:0048487) |
0.0 | 1.1 | GO:0005132 | type I interferon receptor binding(GO:0005132) |
0.0 | 0.5 | GO:0030544 | Hsp70 protein binding(GO:0030544) |
0.0 | 0.1 | GO:0016812 | hydrolase activity, acting on carbon-nitrogen (but not peptide) bonds, in cyclic amides(GO:0016812) |
0.0 | 0.6 | GO:0005070 | SH3/SH2 adaptor activity(GO:0005070) |
0.0 | 0.9 | GO:0036442 | hydrogen-exporting ATPase activity(GO:0036442) |
0.0 | 0.1 | GO:0005329 | dopamine transmembrane transporter activity(GO:0005329) |
0.0 | 0.2 | GO:0016866 | intramolecular transferase activity(GO:0016866) |
0.0 | 0.1 | GO:0070403 | NAD+ binding(GO:0070403) |
0.0 | 0.1 | GO:0004514 | nicotinate-nucleotide diphosphorylase (carboxylating) activity(GO:0004514) |
0.0 | 0.2 | GO:0048406 | nerve growth factor binding(GO:0048406) |
0.0 | 0.2 | GO:0005536 | glucose binding(GO:0005536) |
0.0 | 0.0 | GO:0031752 | D5 dopamine receptor binding(GO:0031752) |
0.0 | 0.1 | GO:0016885 | ligase activity, forming carbon-carbon bonds(GO:0016885) |
0.0 | 0.0 | GO:0052743 | inositol tetrakisphosphate phosphatase activity(GO:0052743) |
0.0 | 1.4 | GO:0004197 | cysteine-type endopeptidase activity(GO:0004197) |
0.0 | 0.3 | GO:0016929 | SUMO-specific protease activity(GO:0016929) |
0.0 | 0.0 | GO:0031493 | nucleosomal histone binding(GO:0031493) |
0.0 | 0.1 | GO:1901677 | phosphate transmembrane transporter activity(GO:1901677) |
0.0 | 0.1 | GO:0035529 | NADH pyrophosphatase activity(GO:0035529) |
0.0 | 0.1 | GO:0000104 | succinate dehydrogenase activity(GO:0000104) |
0.0 | 0.2 | GO:0004668 | protein-arginine deiminase activity(GO:0004668) |
0.0 | 0.4 | GO:0008574 | ATP-dependent microtubule motor activity, plus-end-directed(GO:0008574) |
0.0 | 0.0 | GO:0070698 | type I activin receptor binding(GO:0070698) |
0.0 | 0.1 | GO:0031432 | titin binding(GO:0031432) |
0.0 | 2.7 | GO:0016278 | lysine N-methyltransferase activity(GO:0016278) protein-lysine N-methyltransferase activity(GO:0016279) |
0.0 | 0.1 | GO:0002162 | dystroglycan binding(GO:0002162) |
0.0 | 0.2 | GO:0003910 | DNA ligase activity(GO:0003909) DNA ligase (ATP) activity(GO:0003910) |
0.0 | 0.1 | GO:0032052 | bile acid binding(GO:0032052) |
0.0 | 0.1 | GO:1990247 | N6-methyladenosine-containing RNA binding(GO:1990247) |
0.0 | 0.1 | GO:0090079 | translation regulator activity, nucleic acid binding(GO:0090079) |
0.0 | 0.0 | GO:0030523 | dihydrolipoamide S-acyltransferase activity(GO:0030523) |
0.0 | 0.0 | GO:0016273 | arginine N-methyltransferase activity(GO:0016273) protein-arginine N-methyltransferase activity(GO:0016274) |
0.0 | 0.6 | GO:0005031 | tumor necrosis factor-activated receptor activity(GO:0005031) death receptor activity(GO:0005035) |
0.0 | 0.2 | GO:0008353 | RNA polymerase II carboxy-terminal domain kinase activity(GO:0008353) |
0.0 | 0.2 | GO:0046965 | retinoid X receptor binding(GO:0046965) |
0.0 | 0.1 | GO:0015651 | quaternary ammonium group transmembrane transporter activity(GO:0015651) |
0.0 | 0.1 | GO:0001054 | RNA polymerase I activity(GO:0001054) |
0.0 | 0.1 | GO:0033300 | dehydroascorbic acid transporter activity(GO:0033300) |
0.0 | 0.3 | GO:0051879 | Hsp90 protein binding(GO:0051879) |
0.0 | 0.3 | GO:0004568 | chitinase activity(GO:0004568) |
0.0 | 1.1 | GO:0004722 | protein serine/threonine phosphatase activity(GO:0004722) |
0.0 | 0.3 | GO:0031489 | myosin V binding(GO:0031489) |
0.0 | 0.5 | GO:0098531 | RNA polymerase II transcription factor activity, ligand-activated sequence-specific DNA binding(GO:0004879) transcription factor activity, direct ligand regulated sequence-specific DNA binding(GO:0098531) |
0.0 | 0.3 | GO:0035925 | mRNA 3'-UTR AU-rich region binding(GO:0035925) |
0.0 | 0.5 | GO:0051059 | NF-kappaB binding(GO:0051059) |
0.0 | 0.1 | GO:0070290 | N-acylphosphatidylethanolamine-specific phospholipase D activity(GO:0070290) |
0.0 | 0.1 | GO:0097642 | calcitonin family receptor activity(GO:0097642) |
0.0 | 0.3 | GO:0071949 | FAD binding(GO:0071949) |
0.0 | 0.1 | GO:0016971 | flavin-linked sulfhydryl oxidase activity(GO:0016971) |
0.0 | 0.1 | GO:1990226 | histone methyltransferase binding(GO:1990226) |
0.0 | 0.7 | GO:0052771 | coenzyme F390-A hydrolase activity(GO:0052770) coenzyme F390-G hydrolase activity(GO:0052771) |
0.0 | 0.1 | GO:0004596 | peptide alpha-N-acetyltransferase activity(GO:0004596) |
0.0 | 4.7 | GO:0003735 | structural constituent of ribosome(GO:0003735) |
0.0 | 0.3 | GO:0070491 | repressing transcription factor binding(GO:0070491) |
0.0 | 0.3 | GO:0004602 | glutathione peroxidase activity(GO:0004602) |
0.0 | 0.1 | GO:0047499 | calcium-independent phospholipase A2 activity(GO:0047499) |
0.0 | 0.1 | GO:0004679 | AMP-activated protein kinase activity(GO:0004679) |
0.0 | 0.0 | GO:0004723 | calcium-dependent protein serine/threonine phosphatase activity(GO:0004723) |
0.0 | 0.6 | GO:0004129 | cytochrome-c oxidase activity(GO:0004129) heme-copper terminal oxidase activity(GO:0015002) oxidoreductase activity, acting on a heme group of donors, oxygen as acceptor(GO:0016676) |
0.0 | 1.3 | GO:0016836 | hydro-lyase activity(GO:0016836) |
0.0 | 0.4 | GO:0008536 | Ran GTPase binding(GO:0008536) |
0.0 | 0.1 | GO:0030284 | estrogen receptor activity(GO:0030284) |
0.0 | 0.0 | GO:0016532 | superoxide dismutase copper chaperone activity(GO:0016532) |
0.0 | 0.1 | GO:0004430 | 1-phosphatidylinositol 4-kinase activity(GO:0004430) |
0.0 | 0.1 | GO:0016670 | oxidoreductase activity, acting on a sulfur group of donors, oxygen as acceptor(GO:0016670) |
0.0 | 0.1 | GO:0016778 | diphosphotransferase activity(GO:0016778) |
0.0 | 0.1 | GO:0005176 | ErbB-2 class receptor binding(GO:0005176) |
0.0 | 1.1 | GO:0046332 | SMAD binding(GO:0046332) |
0.0 | 0.1 | GO:0050897 | cobalt ion binding(GO:0050897) |
0.0 | 0.7 | GO:0004527 | exonuclease activity(GO:0004527) |
0.0 | 0.2 | GO:0103116 | alpha-D-galactofuranose transporter activity(GO:0103116) |
0.0 | 0.6 | GO:0005154 | epidermal growth factor receptor binding(GO:0005154) |
0.0 | 0.1 | GO:0051380 | beta-adrenergic receptor activity(GO:0004939) norepinephrine binding(GO:0051380) |
0.0 | 0.1 | GO:0050072 | m7G(5')pppN diphosphatase activity(GO:0050072) |
0.0 | 0.2 | GO:0004551 | nucleotide diphosphatase activity(GO:0004551) |
0.0 | 0.1 | GO:0005219 | ryanodine-sensitive calcium-release channel activity(GO:0005219) |
0.0 | 0.0 | GO:0010861 | thyroid hormone receptor activator activity(GO:0010861) |
0.0 | 0.4 | GO:0070008 | serine-type exopeptidase activity(GO:0070008) |
0.0 | 0.0 | GO:0008413 | 8-oxo-7,8-dihydroguanosine triphosphate pyrophosphatase activity(GO:0008413) |
0.0 | 0.3 | GO:0043022 | ribosome binding(GO:0043022) |
0.0 | 0.0 | GO:0050220 | prostaglandin-E synthase activity(GO:0050220) |
0.0 | 0.2 | GO:0070513 | death domain binding(GO:0070513) |
0.0 | 0.1 | GO:0019966 | interleukin-1 binding(GO:0019966) |
0.0 | 0.4 | GO:0030742 | GTP-dependent protein binding(GO:0030742) |
0.0 | 0.1 | GO:0000155 | phosphorelay sensor kinase activity(GO:0000155) |
0.0 | 0.2 | GO:0019213 | deacetylase activity(GO:0019213) |
0.0 | 0.1 | GO:0032296 | ribonuclease III activity(GO:0004525) double-stranded RNA-specific ribonuclease activity(GO:0032296) |
0.0 | 0.3 | GO:0031434 | mitogen-activated protein kinase kinase binding(GO:0031434) |
0.0 | 0.1 | GO:0045134 | uridine-diphosphatase activity(GO:0045134) |
0.0 | 0.0 | GO:0016886 | ligase activity, forming phosphoric ester bonds(GO:0016886) |
0.0 | 0.1 | GO:0004740 | pyruvate dehydrogenase (acetyl-transferring) kinase activity(GO:0004740) |
0.0 | 0.1 | GO:0019166 | trans-2-enoyl-CoA reductase (NADPH) activity(GO:0019166) |
0.0 | 0.2 | GO:0016208 | AMP binding(GO:0016208) |
0.0 | 0.2 | GO:0004385 | guanylate kinase activity(GO:0004385) |
0.0 | 1.2 | GO:0000030 | mannosyltransferase activity(GO:0000030) |
0.0 | 0.3 | GO:0017091 | AU-rich element binding(GO:0017091) |
0.0 | 0.2 | GO:1900750 | glutathione binding(GO:0043295) oligopeptide binding(GO:1900750) |
0.0 | 0.4 | GO:0008157 | protein phosphatase 1 binding(GO:0008157) |
0.0 | 0.0 | GO:0004104 | cholinesterase activity(GO:0004104) |
0.0 | 1.0 | GO:0008565 | protein transporter activity(GO:0008565) |
0.0 | 0.0 | GO:0015037 | peptide disulfide oxidoreductase activity(GO:0015037) |
0.0 | 0.1 | GO:0008508 | bile acid:sodium symporter activity(GO:0008508) |
0.0 | 0.0 | GO:0016262 | protein N-acetylglucosaminyltransferase activity(GO:0016262) |
0.0 | 0.0 | GO:0071208 | histone pre-mRNA DCP binding(GO:0071208) |
0.0 | 0.1 | GO:0031419 | cobalamin binding(GO:0031419) |
0.0 | 0.0 | GO:0031749 | D2 dopamine receptor binding(GO:0031749) |
0.0 | 0.1 | GO:0032795 | heterotrimeric G-protein binding(GO:0032795) |
0.0 | 0.1 | GO:0004345 | glucose-6-phosphate dehydrogenase activity(GO:0004345) |
0.0 | 0.3 | GO:0004029 | aldehyde dehydrogenase (NAD) activity(GO:0004029) |
0.0 | 0.1 | GO:0031435 | mitogen-activated protein kinase kinase kinase binding(GO:0031435) |
0.0 | 0.1 | GO:0043559 | insulin binding(GO:0043559) |
0.0 | 0.1 | GO:0004448 | isocitrate dehydrogenase activity(GO:0004448) |
0.0 | 0.5 | GO:0016538 | cyclin-dependent protein serine/threonine kinase regulator activity(GO:0016538) |
0.0 | 0.1 | GO:0050291 | sphingosine N-acyltransferase activity(GO:0050291) |
0.0 | 0.0 | GO:0042134 | rRNA primary transcript binding(GO:0042134) |
0.0 | 0.1 | GO:0016937 | short-branched-chain-acyl-CoA dehydrogenase activity(GO:0016937) |
0.0 | 0.6 | GO:0004386 | helicase activity(GO:0004386) |
0.0 | 0.2 | GO:0008641 | small protein activating enzyme activity(GO:0008641) |
0.0 | 0.5 | GO:0005484 | SNAP receptor activity(GO:0005484) |
0.0 | 0.6 | GO:0019003 | GDP binding(GO:0019003) |
0.0 | 0.1 | GO:0005502 | 11-cis retinal binding(GO:0005502) |
0.0 | 0.1 | GO:0038064 | collagen receptor activity(GO:0038064) |
0.0 | 1.7 | GO:0003729 | mRNA binding(GO:0003729) |
0.0 | 0.2 | GO:0005521 | lamin binding(GO:0005521) |
0.0 | 0.2 | GO:0016502 | purinergic nucleotide receptor activity(GO:0001614) nucleotide receptor activity(GO:0016502) |
0.0 | 0.5 | GO:0016406 | carnitine O-acyltransferase activity(GO:0016406) |
0.0 | 0.1 | GO:0010181 | FMN binding(GO:0010181) |
0.0 | 0.1 | GO:0019911 | structural constituent of myelin sheath(GO:0019911) |
0.0 | 0.2 | GO:0005149 | interleukin-1 receptor binding(GO:0005149) |
0.0 | 2.5 | GO:0015631 | tubulin binding(GO:0015631) |
0.0 | 0.1 | GO:0036402 | proteasome-activating ATPase activity(GO:0036402) |
0.0 | 0.1 | GO:0070300 | phosphatidic acid binding(GO:0070300) |
0.0 | 0.1 | GO:0008260 | 3-oxoacid CoA-transferase activity(GO:0008260) |
0.0 | 0.6 | GO:0008235 | metalloexopeptidase activity(GO:0008235) |
0.0 | 0.0 | GO:0016312 | inositol bisphosphate phosphatase activity(GO:0016312) |
0.0 | 0.1 | GO:0034062 | RNA polymerase activity(GO:0034062) |
0.0 | 0.6 | GO:0004869 | cysteine-type endopeptidase inhibitor activity(GO:0004869) |
0.0 | 0.2 | GO:0016854 | racemase and epimerase activity(GO:0016854) |
0.0 | 0.3 | GO:0097472 | cyclin-dependent protein serine/threonine kinase activity(GO:0004693) cyclin-dependent protein kinase activity(GO:0097472) |
0.0 | 0.3 | GO:0016831 | carboxy-lyase activity(GO:0016831) |
0.0 | 1.3 | GO:0017137 | Rab GTPase binding(GO:0017137) |
0.0 | 0.1 | GO:0008273 | calcium, potassium:sodium antiporter activity(GO:0008273) |
0.0 | 0.0 | GO:0004942 | anaphylatoxin receptor activity(GO:0004942) |
0.0 | 0.1 | GO:0004439 | phosphatidylinositol-4,5-bisphosphate 5-phosphatase activity(GO:0004439) |
0.0 | 0.0 | GO:0031705 | bombesin receptor binding(GO:0031705) |
0.0 | 0.1 | GO:0004716 | receptor signaling protein tyrosine kinase activity(GO:0004716) |
0.0 | 0.1 | GO:0017127 | cholesterol transporter activity(GO:0017127) |
0.0 | 0.1 | GO:0043176 | amine binding(GO:0043176) |
0.0 | 0.1 | GO:0003688 | DNA replication origin binding(GO:0003688) |
0.0 | 0.1 | GO:0036122 | BMP binding(GO:0036122) |
0.0 | 0.0 | GO:0034988 | Fc-gamma receptor I complex binding(GO:0034988) |
0.0 | 0.0 | GO:0030792 | methylarsonite methyltransferase activity(GO:0030792) |
0.0 | 0.0 | GO:0035373 | chondroitin sulfate proteoglycan binding(GO:0035373) |
0.0 | 0.1 | GO:0004966 | galanin receptor activity(GO:0004966) |
0.0 | 0.1 | GO:0015036 | disulfide oxidoreductase activity(GO:0015036) |
0.0 | 0.5 | GO:0005044 | scavenger receptor activity(GO:0005044) |
0.0 | 0.1 | GO:1901505 | carbohydrate derivative transporter activity(GO:1901505) |
0.0 | 0.0 | GO:0070991 | medium-chain-acyl-CoA dehydrogenase activity(GO:0070991) |
0.0 | 0.0 | GO:0034511 | U3 snoRNA binding(GO:0034511) |
0.0 | 0.1 | GO:0070063 | RNA polymerase binding(GO:0070063) |
0.0 | 0.1 | GO:0034863 | pinocarveol dehydrogenase activity(GO:0018446) chloral hydrate dehydrogenase activity(GO:0018447) hydroxymethylmethylsilanediol oxidase activity(GO:0018448) 1-phenylethanol dehydrogenase activity(GO:0018449) myrtenol dehydrogenase activity(GO:0018450) cis-1,2-dihydroxy-1,2-dihydro-8-carboxynaphthalene dehydrogenase activity(GO:0034522) 3-hydroxy-4-methyloctanoyl-CoA dehydrogenase activity(GO:0034582) 2-hydroxy-4-isopropenylcyclohexane-1-carboxyl-CoA dehydrogenase activity(GO:0034778) cis-9,10-dihydroanthracene-9,10-diol dehydrogenase activity(GO:0034817) citronellol dehydrogenase activity(GO:0034821) naphthyl-2-hydroxymethyl-succinyl-CoA dehydrogenase activity(GO:0034847) 2,4,4-trimethyl-1-pentanol dehydrogenase activity(GO:0034863) 2,4,4-trimethyl-3-hydroxypentanoyl-CoA dehydrogenase activity(GO:0034868) 1-hydroxy-4,4-dimethylpentan-3-one dehydrogenase activity(GO:0034871) endosulfan diol dehydrogenase activity(GO:0034891) endosulfan hydroxyether dehydrogenase activity(GO:0034901) 3-hydroxy-2-methylhexanoyl-CoA dehydrogenase activity(GO:0034918) 3-hydroxy-2,6-dimethyl-5-methylene-heptanoyl-CoA dehydrogenase activity(GO:0034944) versicolorin reductase activity(GO:0042469) ketoreductase activity(GO:0045703) |
0.0 | 0.2 | GO:0003743 | translation initiation factor activity(GO:0003743) |
0.0 | 0.1 | GO:0030296 | protein tyrosine kinase activator activity(GO:0030296) |
0.0 | 0.1 | GO:0045118 | azole transporter activity(GO:0045118) azole transmembrane transporter activity(GO:1901474) |
0.0 | 0.5 | GO:0008527 | taste receptor activity(GO:0008527) |
0.0 | 0.0 | GO:0042284 | sphingolipid delta-4 desaturase activity(GO:0042284) |
0.0 | 0.1 | GO:0019206 | nucleoside kinase activity(GO:0019206) |
0.0 | 0.1 | GO:0034185 | apolipoprotein binding(GO:0034185) |
0.0 | 0.7 | GO:0047485 | protein N-terminus binding(GO:0047485) |
0.0 | 0.0 | GO:0016531 | copper chaperone activity(GO:0016531) |
0.0 | 0.1 | GO:0004060 | arylamine N-acetyltransferase activity(GO:0004060) |
0.0 | 0.1 | GO:0019215 | intermediate filament binding(GO:0019215) |
0.0 | 0.1 | GO:0016783 | sulfurtransferase activity(GO:0016783) |
0.0 | 0.0 | GO:0004859 | phospholipase inhibitor activity(GO:0004859) |
0.0 | 0.0 | GO:0008599 | protein phosphatase type 1 regulator activity(GO:0008599) |
0.0 | 0.1 | GO:0015280 | ligand-gated sodium channel activity(GO:0015280) |
0.0 | 0.0 | GO:0001758 | retinal dehydrogenase activity(GO:0001758) |
0.0 | 0.2 | GO:0016755 | transferase activity, transferring amino-acyl groups(GO:0016755) |
0.0 | 0.1 | GO:0035035 | histone acetyltransferase binding(GO:0035035) |
0.0 | 0.0 | GO:0022833 | mechanically-gated ion channel activity(GO:0008381) mechanically gated channel activity(GO:0022833) |
0.0 | 0.2 | GO:0004712 | protein serine/threonine/tyrosine kinase activity(GO:0004712) |
0.0 | 0.1 | GO:0050998 | nitric-oxide synthase binding(GO:0050998) |
0.0 | 0.0 | GO:0008172 | S-methyltransferase activity(GO:0008172) |
0.0 | 0.1 | GO:0005542 | folic acid binding(GO:0005542) |
0.0 | 5.9 | GO:0044822 | poly(A) RNA binding(GO:0044822) |
0.0 | 0.1 | GO:0015168 | glycerol transmembrane transporter activity(GO:0015168) glycerol channel activity(GO:0015254) |
0.0 | 0.2 | GO:0005504 | fatty acid binding(GO:0005504) |
0.0 | 0.0 | GO:0035198 | miRNA binding(GO:0035198) |
0.0 | 0.0 | GO:0001962 | alpha-1,3-galactosyltransferase activity(GO:0001962) |
0.0 | 0.0 | GO:0004127 | cytidylate kinase activity(GO:0004127) |
0.0 | 0.0 | GO:0045182 | translation regulator activity(GO:0045182) |
0.0 | 0.0 | GO:0004563 | beta-N-acetylhexosaminidase activity(GO:0004563) |
0.0 | 0.0 | GO:0070883 | pre-miRNA binding(GO:0070883) |
0.0 | 0.0 | GO:0031735 | CCR10 chemokine receptor binding(GO:0031735) |
0.0 | 0.1 | GO:0099602 | acetylcholine receptor regulator activity(GO:0030548) neurotransmitter receptor regulator activity(GO:0099602) |
0.0 | 0.0 | GO:0046979 | TAP1 binding(GO:0046978) TAP2 binding(GO:0046979) |
0.0 | 0.0 | GO:0051765 | inositol tetrakisphosphate kinase activity(GO:0051765) |
0.0 | 0.1 | GO:0019531 | oxalate transmembrane transporter activity(GO:0019531) |
0.0 | 0.0 | GO:0008294 | calcium- and calmodulin-responsive adenylate cyclase activity(GO:0008294) |
0.0 | 0.0 | GO:0005138 | interleukin-6 receptor binding(GO:0005138) |
0.0 | 0.0 | GO:0004967 | glucagon receptor activity(GO:0004967) |
0.0 | 0.1 | GO:0004303 | estradiol 17-beta-dehydrogenase activity(GO:0004303) |
0.0 | 0.0 | GO:0035663 | Toll-like receptor 2 binding(GO:0035663) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.2 | 2.2 | PID P38 GAMMA DELTA PATHWAY | Signaling mediated by p38-gamma and p38-delta |
0.2 | 3.1 | PID CIRCADIAN PATHWAY | Circadian rhythm pathway |
0.2 | 0.3 | ST JAK STAT PATHWAY | Jak-STAT Pathway |
0.2 | 2.7 | PID SMAD2 3PATHWAY | Regulation of cytoplasmic and nuclear SMAD2/3 signaling |
0.2 | 6.7 | PID HNF3B PATHWAY | FOXA2 and FOXA3 transcription factor networks |
0.1 | 2.0 | PID HIF1A PATHWAY | Hypoxic and oxygen homeostasis regulation of HIF-1-alpha |
0.1 | 1.2 | ST STAT3 PATHWAY | STAT3 Pathway |
0.1 | 2.0 | PID BETA CATENIN DEG PATHWAY | Degradation of beta catenin |
0.1 | 6.8 | PID TELOMERASE PATHWAY | Regulation of Telomerase |
0.1 | 2.9 | PID PI3KCI AKT PATHWAY | Class I PI3K signaling events mediated by Akt |
0.1 | 1.1 | PID INSULIN GLUCOSE PATHWAY | Insulin-mediated glucose transport |
0.1 | 0.3 | ST TYPE I INTERFERON PATHWAY | Type I Interferon (alpha/beta IFN) Pathway |
0.1 | 2.2 | PID TCR CALCIUM PATHWAY | Calcium signaling in the CD4+ TCR pathway |
0.1 | 2.4 | PID NFAT TFPATHWAY | Calcineurin-regulated NFAT-dependent transcription in lymphocytes |
0.1 | 0.6 | PID IL5 PATHWAY | IL5-mediated signaling events |
0.1 | 0.3 | PID SYNDECAN 2 PATHWAY | Syndecan-2-mediated signaling events |
0.1 | 0.5 | SA PTEN PATHWAY | PTEN is a tumor suppressor that dephosphorylates the lipid messenger phosphatidylinositol triphosphate. |
0.1 | 2.3 | PID HDAC CLASSII PATHWAY | Signaling events mediated by HDAC Class II |
0.1 | 1.5 | PID MYC PATHWAY | C-MYC pathway |
0.1 | 0.9 | PID NFKAPPAB CANONICAL PATHWAY | Canonical NF-kappaB pathway |
0.1 | 0.5 | PID CD40 PATHWAY | CD40/CD40L signaling |
0.1 | 1.5 | PID RXR VDR PATHWAY | RXR and RAR heterodimerization with other nuclear receptor |
0.1 | 2.1 | PID LKB1 PATHWAY | LKB1 signaling events |
0.1 | 1.0 | ST INTERLEUKIN 4 PATHWAY | Interleukin 4 (IL-4) Pathway |
0.1 | 3.1 | PID AR PATHWAY | Coregulation of Androgen receptor activity |
0.1 | 1.8 | ST TUMOR NECROSIS FACTOR PATHWAY | Tumor Necrosis Factor Pathway. |
0.1 | 1.6 | PID IFNG PATHWAY | IFN-gamma pathway |
0.1 | 1.3 | PID ATM PATHWAY | ATM pathway |
0.1 | 1.1 | PID WNT NONCANONICAL PATHWAY | Noncanonical Wnt signaling pathway |
0.1 | 0.9 | PID PRL SIGNALING EVENTS PATHWAY | Signaling events mediated by PRL |
0.1 | 0.8 | PID FAS PATHWAY | FAS (CD95) signaling pathway |
0.1 | 0.4 | PID AVB3 INTEGRIN PATHWAY | Integrins in angiogenesis |
0.1 | 0.4 | SA REG CASCADE OF CYCLIN EXPR | Expression of cyclins regulates progression through the cell cycle by activating cyclin-dependent kinases. |
0.1 | 0.5 | PID TCR RAS PATHWAY | Ras signaling in the CD4+ TCR pathway |
0.1 | 0.8 | PID IL2 PI3K PATHWAY | IL2 signaling events mediated by PI3K |
0.1 | 2.4 | PID ERA GENOMIC PATHWAY | Validated nuclear estrogen receptor alpha network |
0.1 | 1.2 | PID INSULIN PATHWAY | Insulin Pathway |
0.1 | 0.5 | PID P38 MKK3 6PATHWAY | p38 MAPK signaling pathway |
0.0 | 1.6 | PID P53 REGULATION PATHWAY | p53 pathway |
0.0 | 0.1 | SA PROGRAMMED CELL DEATH | Programmed cell death, or apoptosis, eliminates damaged or unneeded cells. |
0.0 | 0.8 | PID ARF 3PATHWAY | Arf1 pathway |
0.0 | 0.3 | PID ECADHERIN KERATINOCYTE PATHWAY | E-cadherin signaling in keratinocytes |
0.0 | 1.2 | PID TGFBR PATHWAY | TGF-beta receptor signaling |
0.0 | 1.4 | PID CASPASE PATHWAY | Caspase cascade in apoptosis |
0.0 | 1.6 | PID HIF1 TFPATHWAY | HIF-1-alpha transcription factor network |
0.0 | 1.8 | PID MYC ACTIV PATHWAY | Validated targets of C-MYC transcriptional activation |
0.0 | 0.5 | PID IL2 1PATHWAY | IL2-mediated signaling events |
0.0 | 0.9 | PID ATR PATHWAY | ATR signaling pathway |
0.0 | 0.4 | PID ALK2 PATHWAY | ALK2 signaling events |
0.0 | 0.5 | PID CERAMIDE PATHWAY | Ceramide signaling pathway |
0.0 | 0.7 | PID RAS PATHWAY | Regulation of Ras family activation |
0.0 | 0.1 | PID VEGFR1 PATHWAY | VEGFR1 specific signals |
0.0 | 0.1 | PID ERB GENOMIC PATHWAY | Validated nuclear estrogen receptor beta network |
0.0 | 0.5 | PID IL6 7 PATHWAY | IL6-mediated signaling events |
0.0 | 0.1 | SA G1 AND S PHASES | Cdk2, 4, and 6 bind cyclin D in G1, while cdk2/cyclin E promotes the G1/S transition. |
0.0 | 0.3 | SIG CD40PATHWAYMAP | Genes related to CD40 signaling |
0.0 | 0.1 | ST B CELL ANTIGEN RECEPTOR | B Cell Antigen Receptor |
0.0 | 0.3 | ST JNK MAPK PATHWAY | JNK MAPK Pathway |
0.0 | 0.3 | PID FANCONI PATHWAY | Fanconi anemia pathway |
0.0 | 0.3 | PID BARD1 PATHWAY | BARD1 signaling events |
0.0 | 0.8 | PID AURORA B PATHWAY | Aurora B signaling |
0.0 | 0.5 | PID VEGFR1 2 PATHWAY | Signaling events mediated by VEGFR1 and VEGFR2 |
0.0 | 0.6 | PID BCR 5PATHWAY | BCR signaling pathway |
0.0 | 0.2 | SA MMP CYTOKINE CONNECTION | Cytokines can induce activation of matrix metalloproteinases, which degrade extracellular matrix. |
0.0 | 0.1 | SA G2 AND M PHASES | Cdc25 activates the cdc2/cyclin B complex to induce the G2/M transition. |
0.0 | 0.0 | PID INTEGRIN1 PATHWAY | Beta1 integrin cell surface interactions |
0.0 | 0.4 | PID ILK PATHWAY | Integrin-linked kinase signaling |
0.0 | 0.3 | PID CDC42 REG PATHWAY | Regulation of CDC42 activity |
0.0 | 0.3 | PID HIF2PATHWAY | HIF-2-alpha transcription factor network |
0.0 | 0.1 | PID ANTHRAX PATHWAY | Cellular roles of Anthrax toxin |
0.0 | 0.2 | PID KIT PATHWAY | Signaling events mediated by Stem cell factor receptor (c-Kit) |
0.0 | 0.5 | PID REG GR PATHWAY | Glucocorticoid receptor regulatory network |
0.0 | 0.3 | PID CD8 TCR DOWNSTREAM PATHWAY | Downstream signaling in naïve CD8+ T cells |
0.0 | 0.1 | PID P38 MK2 PATHWAY | p38 signaling mediated by MAPKAP kinases |
0.0 | 0.2 | ST GA12 PATHWAY | G alpha 12 Pathway |
0.0 | 0.2 | PID IL1 PATHWAY | IL1-mediated signaling events |
0.0 | 0.4 | PID P73PATHWAY | p73 transcription factor network |
0.0 | 0.1 | PID SYNDECAN 3 PATHWAY | Syndecan-3-mediated signaling events |
0.0 | 0.2 | PID DNA PK PATHWAY | DNA-PK pathway in nonhomologous end joining |
0.0 | 0.0 | SA FAS SIGNALING | The TNF-type receptor Fas induces apoptosis on ligand binding. |
0.0 | 0.3 | PID CONE PATHWAY | Visual signal transduction: Cones |
0.0 | 0.2 | PID ALPHA SYNUCLEIN PATHWAY | Alpha-synuclein signaling |
0.0 | 0.4 | PID ERBB1 DOWNSTREAM PATHWAY | ErbB1 downstream signaling |
0.0 | 0.1 | PID IL8 CXCR1 PATHWAY | IL8- and CXCR1-mediated signaling events |
0.0 | 0.1 | PID FOXM1 PATHWAY | FOXM1 transcription factor network |
0.0 | 0.1 | PID ANGIOPOIETIN RECEPTOR PATHWAY | Angiopoietin receptor Tie2-mediated signaling |
0.0 | 0.0 | PID AMB2 NEUTROPHILS PATHWAY | amb2 Integrin signaling |
0.0 | 0.4 | PID MYC REPRESS PATHWAY | Validated targets of C-MYC transcriptional repression |
0.0 | 0.0 | PID IL2 STAT5 PATHWAY | IL2 signaling events mediated by STAT5 |
0.0 | 0.4 | PID RHOA REG PATHWAY | Regulation of RhoA activity |
0.0 | 0.1 | PID FOXO PATHWAY | FoxO family signaling |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.5 | 0.5 | REACTOME G ALPHA1213 SIGNALLING EVENTS | Genes involved in G alpha (12/13) signalling events |
0.3 | 0.3 | REACTOME ABORTIVE ELONGATION OF HIV1 TRANSCRIPT IN THE ABSENCE OF TAT | Genes involved in Abortive elongation of HIV-1 transcript in the absence of Tat |
0.3 | 0.5 | REACTOME RORA ACTIVATES CIRCADIAN EXPRESSION | Genes involved in RORA Activates Circadian Expression |
0.3 | 2.1 | REACTOME ABACAVIR TRANSPORT AND METABOLISM | Genes involved in Abacavir transport and metabolism |
0.2 | 4.7 | REACTOME DOWNREGULATION OF SMAD2 3 SMAD4 TRANSCRIPTIONAL ACTIVITY | Genes involved in Downregulation of SMAD2/3:SMAD4 transcriptional activity |
0.2 | 2.1 | REACTOME MTORC1 MEDIATED SIGNALLING | Genes involved in mTORC1-mediated signalling |
0.2 | 4.8 | REACTOME SPHINGOLIPID DE NOVO BIOSYNTHESIS | Genes involved in Sphingolipid de novo biosynthesis |
0.2 | 4.1 | REACTOME RNA POL III TRANSCRIPTION INITIATION FROM TYPE 3 PROMOTER | Genes involved in RNA Polymerase III Transcription Initiation From Type 3 Promoter |
0.2 | 3.8 | REACTOME SEMA4D INDUCED CELL MIGRATION AND GROWTH CONE COLLAPSE | Genes involved in Sema4D induced cell migration and growth-cone collapse |
0.2 | 1.4 | REACTOME GAP JUNCTION DEGRADATION | Genes involved in Gap junction degradation |
0.2 | 2.3 | REACTOME REGULATION OF HYPOXIA INDUCIBLE FACTOR HIF BY OXYGEN | Genes involved in Regulation of Hypoxia-inducible Factor (HIF) by Oxygen |
0.1 | 4.5 | REACTOME BMAL1 CLOCK NPAS2 ACTIVATES CIRCADIAN EXPRESSION | Genes involved in BMAL1:CLOCK/NPAS2 Activates Circadian Expression |
0.1 | 1.2 | REACTOME APOPTOSIS INDUCED DNA FRAGMENTATION | Genes involved in Apoptosis induced DNA fragmentation |
0.1 | 2.2 | REACTOME AMINO ACID SYNTHESIS AND INTERCONVERSION TRANSAMINATION | Genes involved in Amino acid synthesis and interconversion (transamination) |
0.1 | 1.3 | REACTOME SYNTHESIS OF PE | Genes involved in Synthesis of PE |
0.1 | 0.1 | REACTOME ACTIVATED TAK1 MEDIATES P38 MAPK ACTIVATION | Genes involved in activated TAK1 mediates p38 MAPK activation |
0.1 | 1.8 | REACTOME PROCESSING OF INTRONLESS PRE MRNAS | Genes involved in Processing of Intronless Pre-mRNAs |
0.1 | 1.9 | REACTOME DARPP 32 EVENTS | Genes involved in DARPP-32 events |
0.1 | 10.1 | REACTOME MITOTIC PROMETAPHASE | Genes involved in Mitotic Prometaphase |
0.1 | 1.7 | REACTOME GLYCOGEN BREAKDOWN GLYCOGENOLYSIS | Genes involved in Glycogen breakdown (glycogenolysis) |
0.1 | 2.7 | REACTOME G0 AND EARLY G1 | Genes involved in G0 and Early G1 |
0.1 | 1.3 | REACTOME SIGNALING BY CONSTITUTIVELY ACTIVE EGFR | Genes involved in Signaling by constitutively active EGFR |
0.1 | 1.9 | REACTOME PRE NOTCH PROCESSING IN GOLGI | Genes involved in Pre-NOTCH Processing in Golgi |
0.1 | 1.5 | REACTOME REGULATION OF IFNG SIGNALING | Genes involved in Regulation of IFNG signaling |
0.1 | 1.2 | REACTOME VITAMIN B5 PANTOTHENATE METABOLISM | Genes involved in Vitamin B5 (pantothenate) metabolism |
0.1 | 0.9 | REACTOME NOTCH HLH TRANSCRIPTION PATHWAY | Genes involved in Notch-HLH transcription pathway |
0.1 | 0.6 | REACTOME DESTABILIZATION OF MRNA BY KSRP | Genes involved in Destabilization of mRNA by KSRP |
0.1 | 1.8 | REACTOME SIGNALING BY FGFR1 FUSION MUTANTS | Genes involved in Signaling by FGFR1 fusion mutants |
0.1 | 0.5 | REACTOME RNA POL I PROMOTER OPENING | Genes involved in RNA Polymerase I Promoter Opening |
0.1 | 1.3 | REACTOME PYRIMIDINE CATABOLISM | Genes involved in Pyrimidine catabolism |
0.1 | 0.9 | REACTOME P75NTR RECRUITS SIGNALLING COMPLEXES | Genes involved in p75NTR recruits signalling complexes |
0.1 | 0.3 | REACTOME REGULATION OF THE FANCONI ANEMIA PATHWAY | Genes involved in Regulation of the Fanconi anemia pathway |
0.1 | 2.7 | REACTOME BIOSYNTHESIS OF THE N GLYCAN PRECURSOR DOLICHOL LIPID LINKED OLIGOSACCHARIDE LLO AND TRANSFER TO A NASCENT PROTEIN | Genes involved in Biosynthesis of the N-glycan precursor (dolichol lipid-linked oligosaccharide, LLO) and transfer to a nascent protein |
0.1 | 2.1 | REACTOME G1 PHASE | Genes involved in G1 Phase |
0.1 | 1.4 | REACTOME DEADENYLATION OF MRNA | Genes involved in Deadenylation of mRNA |
0.1 | 0.7 | REACTOME IL 7 SIGNALING | Genes involved in Interleukin-7 signaling |
0.1 | 0.6 | REACTOME CTNNB1 PHOSPHORYLATION CASCADE | Genes involved in Beta-catenin phosphorylation cascade |
0.1 | 0.3 | REACTOME DESTABILIZATION OF MRNA BY TRISTETRAPROLIN TTP | Genes involved in Destabilization of mRNA by Tristetraprolin (TTP) |
0.1 | 0.5 | REACTOME G2 M DNA DAMAGE CHECKPOINT | Genes involved in G2/M DNA damage checkpoint |
0.1 | 1.9 | REACTOME CHOLESTEROL BIOSYNTHESIS | Genes involved in Cholesterol biosynthesis |
0.1 | 1.0 | REACTOME PURINE RIBONUCLEOSIDE MONOPHOSPHATE BIOSYNTHESIS | Genes involved in Purine ribonucleoside monophosphate biosynthesis |
0.1 | 0.9 | REACTOME DCC MEDIATED ATTRACTIVE SIGNALING | Genes involved in DCC mediated attractive signaling |
0.1 | 0.3 | REACTOME DNA STRAND ELONGATION | Genes involved in DNA strand elongation |
0.1 | 1.8 | REACTOME MRNA 3 END PROCESSING | Genes involved in mRNA 3'-end processing |
0.1 | 0.7 | REACTOME PROSTANOID LIGAND RECEPTORS | Genes involved in Prostanoid ligand receptors |
0.1 | 1.5 | REACTOME BRANCHED CHAIN AMINO ACID CATABOLISM | Genes involved in Branched-chain amino acid catabolism |
0.1 | 2.0 | REACTOME MEIOTIC RECOMBINATION | Genes involved in Meiotic Recombination |
0.1 | 1.6 | REACTOME CITRIC ACID CYCLE TCA CYCLE | Genes involved in Citric acid cycle (TCA cycle) |
0.1 | 0.5 | REACTOME CYCLIN A B1 ASSOCIATED EVENTS DURING G2 M TRANSITION | Genes involved in Cyclin A/B1 associated events during G2/M transition |
0.1 | 0.5 | REACTOME HORMONE SENSITIVE LIPASE HSL MEDIATED TRIACYLGLYCEROL HYDROLYSIS | Genes involved in Hormone-sensitive lipase (HSL)-mediated triacylglycerol hydrolysis |
0.1 | 1.3 | REACTOME ENOS ACTIVATION AND REGULATION | Genes involved in eNOS activation and regulation |
0.1 | 1.0 | REACTOME ACTIVATION OF BH3 ONLY PROTEINS | Genes involved in Activation of BH3-only proteins |
0.1 | 2.0 | REACTOME TRAF6 MEDIATED IRF7 ACTIVATION | Genes involved in TRAF6 mediated IRF7 activation |
0.1 | 1.0 | REACTOME MRNA DECAY BY 3 TO 5 EXORIBONUCLEASE | Genes involved in mRNA Decay by 3' to 5' Exoribonuclease |
0.1 | 2.2 | REACTOME PREFOLDIN MEDIATED TRANSFER OF SUBSTRATE TO CCT TRIC | Genes involved in Prefoldin mediated transfer of substrate to CCT/TriC |
0.1 | 0.9 | REACTOME PURINE SALVAGE | Genes involved in Purine salvage |
0.1 | 0.4 | REACTOME GLUCONEOGENESIS | Genes involved in Gluconeogenesis |
0.1 | 1.4 | REACTOME TRANSPORT OF RIBONUCLEOPROTEINS INTO THE HOST NUCLEUS | Genes involved in Transport of Ribonucleoproteins into the Host Nucleus |
0.1 | 1.1 | REACTOME CONVERSION FROM APC C CDC20 TO APC C CDH1 IN LATE ANAPHASE | Genes involved in Conversion from APC/C:Cdc20 to APC/C:Cdh1 in late anaphase |
0.1 | 1.0 | REACTOME DEADENYLATION DEPENDENT MRNA DECAY | Genes involved in Deadenylation-dependent mRNA decay |
0.1 | 0.8 | REACTOME BASE FREE SUGAR PHOSPHATE REMOVAL VIA THE SINGLE NUCLEOTIDE REPLACEMENT PATHWAY | Genes involved in Base-free sugar-phosphate removal via the single-nucleotide replacement pathway |
0.1 | 0.2 | REACTOME MRNA CAPPING | Genes involved in mRNA Capping |
0.1 | 1.3 | REACTOME ANTIVIRAL MECHANISM BY IFN STIMULATED GENES | Genes involved in Antiviral mechanism by IFN-stimulated genes |
0.1 | 2.7 | REACTOME LOSS OF NLP FROM MITOTIC CENTROSOMES | Genes involved in Loss of Nlp from mitotic centrosomes |
0.1 | 0.1 | REACTOME CYCLIN E ASSOCIATED EVENTS DURING G1 S TRANSITION | Genes involved in Cyclin E associated events during G1/S transition |
0.1 | 2.3 | REACTOME SPHINGOLIPID METABOLISM | Genes involved in Sphingolipid metabolism |
0.1 | 0.1 | REACTOME NEF MEDIATED DOWNREGULATION OF MHC CLASS I COMPLEX CELL SURFACE EXPRESSION | Genes involved in Nef mediated downregulation of MHC class I complex cell surface expression |
0.1 | 0.2 | REACTOME ELEVATION OF CYTOSOLIC CA2 LEVELS | Genes involved in Elevation of cytosolic Ca2+ levels |
0.1 | 0.4 | REACTOME RETROGRADE NEUROTROPHIN SIGNALLING | Genes involved in Retrograde neurotrophin signalling |
0.1 | 0.4 | REACTOME POST CHAPERONIN TUBULIN FOLDING PATHWAY | Genes involved in Post-chaperonin tubulin folding pathway |
0.1 | 1.1 | REACTOME NEGATIVE REGULATORS OF RIG I MDA5 SIGNALING | Genes involved in Negative regulators of RIG-I/MDA5 signaling |
0.1 | 3.3 | REACTOME TRANSCRIPTIONAL REGULATION OF WHITE ADIPOCYTE DIFFERENTIATION | Genes involved in Transcriptional Regulation of White Adipocyte Differentiation |
0.1 | 1.2 | REACTOME ASSOCIATION OF TRIC CCT WITH TARGET PROTEINS DURING BIOSYNTHESIS | Genes involved in Association of TriC/CCT with target proteins during biosynthesis |
0.1 | 0.9 | REACTOME METABOLISM OF PORPHYRINS | Genes involved in Metabolism of porphyrins |
0.1 | 1.4 | REACTOME PIP3 ACTIVATES AKT SIGNALING | Genes involved in PIP3 activates AKT signaling |
0.1 | 0.3 | REACTOME APOPTOTIC CLEAVAGE OF CELL ADHESION PROTEINS | Genes involved in Apoptotic cleavage of cell adhesion proteins |
0.1 | 1.5 | REACTOME CYTOSOLIC TRNA AMINOACYLATION | Genes involved in Cytosolic tRNA aminoacylation |
0.1 | 0.7 | REACTOME GROWTH HORMONE RECEPTOR SIGNALING | Genes involved in Growth hormone receptor signaling |
0.1 | 1.0 | REACTOME SMOOTH MUSCLE CONTRACTION | Genes involved in Smooth Muscle Contraction |
0.1 | 0.7 | REACTOME REGULATION OF AMPK ACTIVITY VIA LKB1 | Genes involved in Regulation of AMPK activity via LKB1 |
0.1 | 0.2 | REACTOME REGULATION OF IFNA SIGNALING | Genes involved in Regulation of IFNA signaling |
0.1 | 0.4 | REACTOME P38MAPK EVENTS | Genes involved in p38MAPK events |
0.1 | 0.3 | REACTOME FORMATION OF INCISION COMPLEX IN GG NER | Genes involved in Formation of incision complex in GG-NER |
0.1 | 0.6 | REACTOME REGULATION OF COMPLEMENT CASCADE | Genes involved in Regulation of Complement cascade |
0.1 | 0.6 | REACTOME ARMS MEDIATED ACTIVATION | Genes involved in ARMS-mediated activation |
0.1 | 5.3 | REACTOME NONSENSE MEDIATED DECAY ENHANCED BY THE EXON JUNCTION COMPLEX | Genes involved in Nonsense Mediated Decay Enhanced by the Exon Junction Complex |
0.1 | 1.3 | REACTOME GLUTATHIONE CONJUGATION | Genes involved in Glutathione conjugation |
0.1 | 1.1 | REACTOME METABOLISM OF NON CODING RNA | Genes involved in Metabolism of non-coding RNA |
0.1 | 1.1 | REACTOME PEROXISOMAL LIPID METABOLISM | Genes involved in Peroxisomal lipid metabolism |
0.1 | 3.2 | REACTOME MRNA SPLICING | Genes involved in mRNA Splicing |
0.1 | 0.8 | REACTOME RNA POL II TRANSCRIPTION PRE INITIATION AND PROMOTER OPENING | Genes involved in RNA Polymerase II Transcription Pre-Initiation And Promoter Opening |
0.1 | 0.4 | REACTOME INFLUENZA LIFE CYCLE | Genes involved in Influenza Life Cycle |
0.1 | 0.3 | REACTOME PRE NOTCH TRANSCRIPTION AND TRANSLATION | Genes involved in Pre-NOTCH Transcription and Translation |
0.1 | 0.2 | REACTOME XENOBIOTICS | Genes involved in Xenobiotics |
0.1 | 0.7 | REACTOME COMMON PATHWAY | Genes involved in Common Pathway |
0.1 | 0.5 | REACTOME ACTIVATION OF CHAPERONES BY ATF6 ALPHA | Genes involved in Activation of Chaperones by ATF6-alpha |
0.1 | 0.8 | REACTOME ZINC TRANSPORTERS | Genes involved in Zinc transporters |
0.1 | 0.8 | REACTOME SYNTHESIS OF PIPS AT THE GOLGI MEMBRANE | Genes involved in Synthesis of PIPs at the Golgi membrane |
0.1 | 1.4 | REACTOME TRANSPORT OF VITAMINS NUCLEOSIDES AND RELATED MOLECULES | Genes involved in Transport of vitamins, nucleosides, and related molecules |
0.1 | 0.8 | REACTOME TERMINATION OF O GLYCAN BIOSYNTHESIS | Genes involved in Termination of O-glycan biosynthesis |
0.1 | 0.1 | REACTOME PLATELET ADHESION TO EXPOSED COLLAGEN | Genes involved in Platelet Adhesion to exposed collagen |
0.1 | 0.5 | REACTOME TRYPTOPHAN CATABOLISM | Genes involved in Tryptophan catabolism |
0.1 | 0.7 | REACTOME FORMATION OF TRANSCRIPTION COUPLED NER TC NER REPAIR COMPLEX | Genes involved in Formation of transcription-coupled NER (TC-NER) repair complex |
0.0 | 0.6 | REACTOME METABOLISM OF POLYAMINES | Genes involved in Metabolism of polyamines |
0.0 | 0.1 | REACTOME PROCESSING OF CAPPED INTRON CONTAINING PRE MRNA | Genes involved in Processing of Capped Intron-Containing Pre-mRNA |
0.0 | 1.6 | REACTOME ACTIVATION OF CHAPERONE GENES BY XBP1S | Genes involved in Activation of Chaperone Genes by XBP1(S) |
0.0 | 1.1 | REACTOME SYNTHESIS OF PA | Genes involved in Synthesis of PA |
0.0 | 0.9 | REACTOME GLYCOLYSIS | Genes involved in Glycolysis |
0.0 | 1.0 | REACTOME INTERFERON ALPHA BETA SIGNALING | Genes involved in Interferon alpha/beta signaling |
0.0 | 0.4 | REACTOME LYSOSOME VESICLE BIOGENESIS | Genes involved in Lysosome Vesicle Biogenesis |
0.0 | 1.3 | REACTOME ION TRANSPORT BY P TYPE ATPASES | Genes involved in Ion transport by P-type ATPases |
0.0 | 0.2 | REACTOME TRAF6 MEDIATED IRF7 ACTIVATION IN TLR7 8 OR 9 SIGNALING | Genes involved in TRAF6 mediated IRF7 activation in TLR7/8 or 9 signaling |
0.0 | 0.2 | REACTOME REGULATION OF SIGNALING BY CBL | Genes involved in Regulation of signaling by CBL |
0.0 | 0.3 | REACTOME COPI MEDIATED TRANSPORT | Genes involved in COPI Mediated Transport |
0.0 | 0.1 | REACTOME CS DS DEGRADATION | Genes involved in CS/DS degradation |
0.0 | 0.4 | REACTOME FACILITATIVE NA INDEPENDENT GLUCOSE TRANSPORTERS | Genes involved in Facilitative Na+-independent glucose transporters |
0.0 | 0.1 | REACTOME ENDOSOMAL VACUOLAR PATHWAY | Genes involved in Endosomal/Vacuolar pathway |
0.0 | 0.4 | REACTOME PASSIVE TRANSPORT BY AQUAPORINS | Genes involved in Passive Transport by Aquaporins |
0.0 | 0.1 | REACTOME IL 6 SIGNALING | Genes involved in Interleukin-6 signaling |
0.0 | 0.6 | REACTOME NOD1 2 SIGNALING PATHWAY | Genes involved in NOD1/2 Signaling Pathway |
0.0 | 0.3 | REACTOME HORMONE LIGAND BINDING RECEPTORS | Genes involved in Hormone ligand-binding receptors |
0.0 | 0.7 | REACTOME BASIGIN INTERACTIONS | Genes involved in Basigin interactions |
0.0 | 1.7 | REACTOME REGULATION OF MRNA STABILITY BY PROTEINS THAT BIND AU RICH ELEMENTS | Genes involved in Regulation of mRNA Stability by Proteins that Bind AU-rich Elements |
0.0 | 0.6 | REACTOME TRNA AMINOACYLATION | Genes involved in tRNA Aminoacylation |
0.0 | 0.4 | REACTOME IL1 SIGNALING | Genes involved in Interleukin-1 signaling |
0.0 | 0.1 | REACTOME SCF BETA TRCP MEDIATED DEGRADATION OF EMI1 | Genes involved in SCF-beta-TrCP mediated degradation of Emi1 |
0.0 | 0.2 | REACTOME PURINE METABOLISM | Genes involved in Purine metabolism |
0.0 | 1.0 | REACTOME MHC CLASS II ANTIGEN PRESENTATION | Genes involved in MHC class II antigen presentation |
0.0 | 0.1 | REACTOME IRAK1 RECRUITS IKK COMPLEX | Genes involved in IRAK1 recruits IKK complex |
0.0 | 0.1 | REACTOME DOPAMINE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Dopamine Neurotransmitter Release Cycle |
0.0 | 2.0 | REACTOME FACTORS INVOLVED IN MEGAKARYOCYTE DEVELOPMENT AND PLATELET PRODUCTION | Genes involved in Factors involved in megakaryocyte development and platelet production |
0.0 | 0.3 | REACTOME N GLYCAN TRIMMING IN THE ER AND CALNEXIN CALRETICULIN CYCLE | Genes involved in N-glycan trimming in the ER and Calnexin/Calreticulin cycle |
0.0 | 0.1 | REACTOME ADVANCED GLYCOSYLATION ENDPRODUCT RECEPTOR SIGNALING | Genes involved in Advanced glycosylation endproduct receptor signaling |
0.0 | 0.2 | REACTOME TRAF6 MEDIATED NFKB ACTIVATION | Genes involved in TRAF6 mediated NF-kB activation |
0.0 | 0.2 | REACTOME ER PHAGOSOME PATHWAY | Genes involved in ER-Phagosome pathway |
0.0 | 0.2 | REACTOME HYALURONAN UPTAKE AND DEGRADATION | Genes involved in Hyaluronan uptake and degradation |
0.0 | 0.9 | REACTOME REGULATION OF WATER BALANCE BY RENAL AQUAPORINS | Genes involved in Regulation of Water Balance by Renal Aquaporins |
0.0 | 0.2 | REACTOME ETHANOL OXIDATION | Genes involved in Ethanol oxidation |
0.0 | 0.4 | REACTOME ABCA TRANSPORTERS IN LIPID HOMEOSTASIS | Genes involved in ABCA transporters in lipid homeostasis |
0.0 | 0.0 | REACTOME GLUCAGON SIGNALING IN METABOLIC REGULATION | Genes involved in Glucagon signaling in metabolic regulation |
0.0 | 0.2 | REACTOME FORMATION OF ATP BY CHEMIOSMOTIC COUPLING | Genes involved in Formation of ATP by chemiosmotic coupling |
0.0 | 0.6 | REACTOME EXTENSION OF TELOMERES | Genes involved in Extension of Telomeres |
0.0 | 0.1 | REACTOME PKB MEDIATED EVENTS | Genes involved in PKB-mediated events |
0.0 | 0.1 | REACTOME GLYCOPROTEIN HORMONES | Genes involved in Glycoprotein hormones |
0.0 | 0.5 | REACTOME SIGNALING BY ROBO RECEPTOR | Genes involved in Signaling by Robo receptor |
0.0 | 0.2 | REACTOME METAL ION SLC TRANSPORTERS | Genes involved in Metal ion SLC transporters |
0.0 | 1.0 | REACTOME MITOCHONDRIAL PROTEIN IMPORT | Genes involved in Mitochondrial Protein Import |
0.0 | 0.2 | REACTOME CASPASE MEDIATED CLEAVAGE OF CYTOSKELETAL PROTEINS | Genes involved in Caspase-mediated cleavage of cytoskeletal proteins |
0.0 | 0.2 | REACTOME ANDROGEN BIOSYNTHESIS | Genes involved in Androgen biosynthesis |
0.0 | 0.2 | REACTOME ORGANIC CATION ANION ZWITTERION TRANSPORT | Genes involved in Organic cation/anion/zwitterion transport |
0.0 | 0.3 | REACTOME AMINE DERIVED HORMONES | Genes involved in Amine-derived hormones |
0.0 | 2.3 | REACTOME ANTIGEN PROCESSING UBIQUITINATION PROTEASOME DEGRADATION | Genes involved in Antigen processing: Ubiquitination & Proteasome degradation |
0.0 | 0.2 | REACTOME SEMA3A PAK DEPENDENT AXON REPULSION | Genes involved in Sema3A PAK dependent Axon repulsion |
0.0 | 0.2 | REACTOME MITOCHONDRIAL FATTY ACID BETA OXIDATION | Genes involved in Mitochondrial Fatty Acid Beta-Oxidation |
0.0 | 0.3 | REACTOME SRP DEPENDENT COTRANSLATIONAL PROTEIN TARGETING TO MEMBRANE | Genes involved in SRP-dependent cotranslational protein targeting to membrane |
0.0 | 0.1 | REACTOME CA DEPENDENT EVENTS | Genes involved in Ca-dependent events |
0.0 | 0.2 | REACTOME SYNTHESIS OF PC | Genes involved in Synthesis of PC |
0.0 | 0.5 | REACTOME GLYCEROPHOSPHOLIPID BIOSYNTHESIS | Genes involved in Glycerophospholipid biosynthesis |
0.0 | 0.1 | REACTOME REGULATION OF KIT SIGNALING | Genes involved in Regulation of KIT signaling |
0.0 | 0.2 | REACTOME FANCONI ANEMIA PATHWAY | Genes involved in Fanconi Anemia pathway |
0.0 | 0.0 | REACTOME PECAM1 INTERACTIONS | Genes involved in PECAM1 interactions |
0.0 | 0.1 | REACTOME E2F ENABLED INHIBITION OF PRE REPLICATION COMPLEX FORMATION | Genes involved in E2F-enabled inhibition of pre-replication complex formation |
0.0 | 0.1 | REACTOME GAMMA CARBOXYLATION TRANSPORT AND AMINO TERMINAL CLEAVAGE OF PROTEINS | Genes involved in Gamma-carboxylation, transport, and amino-terminal cleavage of proteins |
0.0 | 0.5 | REACTOME O LINKED GLYCOSYLATION OF MUCINS | Genes involved in O-linked glycosylation of mucins |
0.0 | 0.6 | REACTOME AMINO ACID AND OLIGOPEPTIDE SLC TRANSPORTERS | Genes involved in Amino acid and oligopeptide SLC transporters |
0.0 | 0.2 | REACTOME CHYLOMICRON MEDIATED LIPID TRANSPORT | Genes involved in Chylomicron-mediated lipid transport |
0.0 | 0.2 | REACTOME P2Y RECEPTORS | Genes involved in P2Y receptors |
0.0 | 0.0 | REACTOME G BETA GAMMA SIGNALLING THROUGH PLC BETA | Genes involved in G beta:gamma signalling through PLC beta |
0.0 | 0.1 | REACTOME NUCLEOTIDE LIKE PURINERGIC RECEPTORS | Genes involved in Nucleotide-like (purinergic) receptors |
0.0 | 0.5 | REACTOME NUCLEAR RECEPTOR TRANSCRIPTION PATHWAY | Genes involved in Nuclear Receptor transcription pathway |
0.0 | 0.1 | REACTOME TRANSCRIPTIONAL ACTIVITY OF SMAD2 SMAD3 SMAD4 HETEROTRIMER | Genes involved in Transcriptional activity of SMAD2/SMAD3:SMAD4 heterotrimer |
0.0 | 0.2 | REACTOME PYRIMIDINE METABOLISM | Genes involved in Pyrimidine metabolism |
0.0 | 0.3 | REACTOME SYNTHESIS OF PIPS AT THE PLASMA MEMBRANE | Genes involved in Synthesis of PIPs at the plasma membrane |
0.0 | 0.0 | REACTOME HOMOLOGOUS RECOMBINATION REPAIR OF REPLICATION INDEPENDENT DOUBLE STRAND BREAKS | Genes involved in Homologous recombination repair of replication-independent double-strand breaks |
0.0 | 0.4 | REACTOME TIGHT JUNCTION INTERACTIONS | Genes involved in Tight junction interactions |
0.0 | 0.2 | REACTOME G2 M CHECKPOINTS | Genes involved in G2/M Checkpoints |
0.0 | 0.1 | REACTOME SYNTHESIS SECRETION AND DEACYLATION OF GHRELIN | Genes involved in Synthesis, Secretion, and Deacylation of Ghrelin |
0.0 | 0.1 | REACTOME CELL EXTRACELLULAR MATRIX INTERACTIONS | Genes involved in Cell-extracellular matrix interactions |
0.0 | 0.1 | REACTOME CGMP EFFECTS | Genes involved in cGMP effects |
0.0 | 0.1 | REACTOME THROMBIN SIGNALLING THROUGH PROTEINASE ACTIVATED RECEPTORS PARS | Genes involved in Thrombin signalling through proteinase activated receptors (PARs) |
0.0 | 0.0 | REACTOME SIGNALING BY TGF BETA RECEPTOR COMPLEX | Genes involved in Signaling by TGF-beta Receptor Complex |