Gene Symbol | Gene ID | Gene Info |
---|---|---|
Hsf2
|
ENSMUSG00000019878.7 | Hsf2 |
CRE | Gene | Distance | Association probability | Pearson corr. coef. | P-value | Plot |
---|---|---|---|---|---|---|
Hsf2 | chr10_57499426_57499714 | 804 | 0.621129 | -0.51 | 5.9e-05 | Click! |
Hsf2 | chr10_57486156_57487093 | 199 | 0.590095 | 0.19 | 1.7e-01 | Click! |
Hsf2 | chr10_57487781_57488095 | 1513 | 0.314474 | -0.01 | 9.5e-01 | Click! |
Hsf2 | chr10_57499847_57500070 | 416 | 0.835882 | -0.01 | 9.7e-01 | Click! |
Move your cursor over a bar to see sample name and corresponding Z-value.
Cis Regulatory Element (CRE) | Target Score | Top associated gene | Gene Info | Distance of CRE to TSS | CRE/Gene association probability |
---|---|---|---|---|---|
chr16_87268014_87268522 | 6.12 |
N6amt1 |
N-6 adenine-specific DNA methyltransferase 1 (putative) |
85917 |
0.08 |
chr1_76658416_76658611 | 5.74 |
Mir6343 |
microRNA 6343 |
148953 |
0.04 |
chr6_83245262_83245462 | 5.40 |
Slc4a5 |
solute carrier family 4, sodium bicarbonate cotransporter, member 5 |
7987 |
0.12 |
chr17_73071829_73071999 | 5.11 |
Lclat1 |
lysocardiolipin acyltransferase 1 |
36071 |
0.16 |
chr13_29202504_29203063 | 5.07 |
Gm11364 |
predicted gene 11364 |
33837 |
0.21 |
chr16_10452370_10452707 | 5.06 |
Tvp23a |
trans-golgi network vesicle protein 23A |
5176 |
0.17 |
chr15_66888181_66888839 | 4.75 |
Ccn4 |
cellular communication network factor 4 |
2810 |
0.26 |
chr3_19566788_19567409 | 4.65 |
Gm23330 |
predicted gene, 23330 |
6845 |
0.18 |
chr16_10351259_10351719 | 4.63 |
Gm1600 |
predicted gene 1600 |
3898 |
0.19 |
chr1_92113452_92113892 | 4.58 |
Hdac4 |
histone deacetylase 4 |
341 |
0.92 |
chr8_78090842_78090993 | 4.57 |
Gm45288 |
predicted gene 45288 |
17043 |
0.23 |
chr13_12284520_12284854 | 4.54 |
Actn2 |
actinin alpha 2 |
2140 |
0.28 |
chr2_27205685_27206025 | 4.48 |
Sardh |
sarcosine dehydrogenase |
4082 |
0.16 |
chrX_102003725_102004324 | 4.45 |
Nhsl2 |
NHS-like 2 |
1020 |
0.5 |
chr1_79858099_79859256 | 4.44 |
Serpine2 |
serine (or cysteine) peptidase inhibitor, clade E, member 2 |
19 |
0.98 |
chr12_56415048_56415200 | 4.41 |
Gm18027 |
predicted gene, 18027 |
4567 |
0.2 |
chr13_64020752_64021456 | 4.34 |
Hsd17b3 |
hydroxysteroid (17-beta) dehydrogenase 3 |
42029 |
0.13 |
chr11_20859449_20859833 | 4.30 |
Gm22807 |
predicted gene, 22807 |
11760 |
0.15 |
chr5_52309656_52309900 | 4.28 |
Gm43179 |
predicted gene 43179 |
32582 |
0.12 |
chr7_114155150_114155326 | 4.26 |
Rras2 |
related RAS viral (r-ras) oncogene 2 |
37457 |
0.15 |
chr13_41339313_41339575 | 4.25 |
Nedd9 |
neural precursor cell expressed, developmentally down-regulated gene 9 |
19803 |
0.13 |
chr3_84745785_84746238 | 4.25 |
Tmem154 |
transmembrane protein 154 |
55788 |
0.13 |
chr2_164404112_164404285 | 4.23 |
Matn4 |
matrilin 4 |
414 |
0.62 |
chr5_74905641_74905990 | 4.22 |
Gm17906 |
predicted gene, 17906 |
22480 |
0.17 |
chr11_52745206_52745362 | 4.19 |
Fstl4 |
follistatin-like 4 |
19350 |
0.27 |
chr5_122950982_122952145 | 4.16 |
Kdm2b |
lysine (K)-specific demethylase 2B |
427 |
0.77 |
chr6_64581354_64581539 | 4.16 |
Grid2 |
glutamate receptor, ionotropic, delta 2 |
81742 |
0.1 |
chr1_24226131_24226533 | 4.14 |
Col9a1 |
collagen, type IX, alpha 1 |
3185 |
0.33 |
chr3_159885217_159885703 | 4.11 |
Gm43307 |
predicted gene 43307 |
9614 |
0.23 |
chr14_46976713_46976988 | 4.11 |
Gm15562 |
predicted gene 15562 |
15410 |
0.13 |
chr5_17574085_17574813 | 4.08 |
Sema3c |
sema domain, immunoglobulin domain (Ig), short basic domain, secreted, (semaphorin) 3C |
168 |
0.97 |
chr12_45013262_45013696 | 4.08 |
Stxbp6 |
syntaxin binding protein 6 (amisyn) |
515 |
0.83 |
chr14_18500642_18500793 | 4.07 |
Gm6781 |
predicted gene 6781 |
30646 |
0.16 |
chr1_98002942_98003123 | 4.06 |
Pam |
peptidylglycine alpha-amidating monooxygenase |
25777 |
0.16 |
chr5_101933220_101933429 | 3.92 |
Wdfy3 |
WD repeat and FYVE domain containing 3 |
2471 |
0.3 |
chr10_94990705_94991025 | 3.91 |
Gm48867 |
predicted gene, 48867 |
8577 |
0.22 |
chr1_44218866_44219364 | 3.87 |
Mettl21e |
methyltransferase like 21E |
154 |
0.95 |
chr8_47354971_47355122 | 3.85 |
Stox2 |
storkhead box 2 |
2698 |
0.34 |
chr16_37893917_37894212 | 3.81 |
Gm15725 |
predicted gene 15725 |
11522 |
0.14 |
chr1_193315965_193316331 | 3.81 |
Lamb3 |
laminin, beta 3 |
4547 |
0.14 |
chr18_11900832_11901017 | 3.78 |
Gm49968 |
predicted gene, 49968 |
12207 |
0.2 |
chr14_22751323_22751729 | 3.75 |
Gm7473 |
predicted gene 7473 |
23718 |
0.26 |
chr8_36639539_36639910 | 3.75 |
Dlc1 |
deleted in liver cancer 1 |
25781 |
0.24 |
chr7_130668964_130669623 | 3.74 |
4930513N20Rik |
RIKEN cDNA 4930513N20 gene |
14901 |
0.18 |
chr10_53466800_53466951 | 3.72 |
Tmem229b-ps |
transmembrane protein 229B, pseudogene |
8089 |
0.14 |
chr9_89850032_89850330 | 3.72 |
4930524O08Rik |
RIKEN cDNA 4930524O08 gene |
23199 |
0.15 |
chr12_101766445_101766798 | 3.71 |
Tc2n |
tandem C2 domains, nuclear |
48098 |
0.12 |
chr6_36818994_36819767 | 3.69 |
Ptn |
pleiotrophin |
9160 |
0.28 |
chr5_129165559_129165849 | 3.68 |
Rps16-ps2 |
ribosomal protein S16, pseudogene 2 |
37187 |
0.18 |
chr9_62536098_62537614 | 3.65 |
Coro2b |
coronin, actin binding protein, 2B |
104 |
0.97 |
chr2_53106122_53106520 | 3.65 |
Prpf40a |
pre-mRNA processing factor 40A |
38988 |
0.2 |
chr9_102864199_102864483 | 3.63 |
Ryk |
receptor-like tyrosine kinase |
4725 |
0.18 |
chr5_65157850_65158278 | 3.58 |
Klhl5 |
kelch-like 5 |
1994 |
0.29 |
chr4_131722135_131722286 | 3.51 |
Gm16080 |
predicted gene 16080 |
11702 |
0.19 |
chr14_54968383_54968865 | 3.50 |
Mhrt |
myosin heavy chain associated RNA transcript |
54 |
0.9 |
chr15_79123814_79124210 | 3.47 |
Micall1 |
microtubule associated monooxygenase, calponin and LIM domain containing -like 1 |
1040 |
0.32 |
chr7_45567801_45568907 | 3.47 |
Bcat2 |
branched chain aminotransferase 2, mitochondrial |
1799 |
0.12 |
chr3_83789572_83790373 | 3.45 |
Gm26771 |
predicted gene, 26771 |
16 |
0.97 |
chr8_75089325_75089958 | 3.42 |
Hmox1 |
heme oxygenase 1 |
3980 |
0.16 |
chr3_110303290_110303472 | 3.41 |
Gm43405 |
predicted gene 43405 |
25909 |
0.17 |
chr13_41339875_41340134 | 3.38 |
Nedd9 |
neural precursor cell expressed, developmentally down-regulated gene 9 |
19243 |
0.13 |
chr2_19553487_19554708 | 3.37 |
4921504E06Rik |
RIKEN cDNA 4921504E06 gene |
183 |
0.94 |
chr6_54554355_54554906 | 3.36 |
Scrn1 |
secernin 1 |
175 |
0.95 |
chr1_85084738_85085997 | 3.36 |
Gm18342 |
predicted gene, 18342 |
5131 |
0.1 |
chr8_45469566_45469946 | 3.36 |
Sorbs2 |
sorbin and SH3 domain containing 2 |
38032 |
0.13 |
chrX_41496630_41496781 | 3.36 |
Gria3 |
glutamate receptor, ionotropic, AMPA3 (alpha 3) |
93965 |
0.08 |
chr9_95705351_95705509 | 3.35 |
Trpc1 |
transient receptor potential cation channel, subfamily C, member 1 |
13184 |
0.14 |
chr11_108910934_108911269 | 3.34 |
Axin2 |
axin 2 |
9248 |
0.21 |
chr7_137745672_137745823 | 3.34 |
Gm45682 |
predicted gene 45682 |
11481 |
0.28 |
chr7_142459385_142459826 | 3.31 |
Lsp1 |
lymphocyte specific 1 |
1204 |
0.3 |
chr7_129937635_129938453 | 3.31 |
Gm4265 |
predicted gene 4265 |
24121 |
0.24 |
chr2_58586322_58586614 | 3.31 |
Upp2 |
uridine phosphorylase 2 |
2792 |
0.3 |
chr4_81744878_81745052 | 3.30 |
Gm11412 |
predicted gene 11412 |
1819 |
0.45 |
chr8_61681266_61681542 | 3.30 |
Palld |
palladin, cytoskeletal associated protein |
78685 |
0.1 |
chr17_59369745_59370054 | 3.26 |
Gm23769 |
predicted gene, 23769 |
144056 |
0.05 |
chr17_31418806_31419097 | 3.25 |
Pde9a |
phosphodiesterase 9A |
4795 |
0.15 |
chr10_76634079_76634294 | 3.24 |
Col6a2 |
collagen, type VI, alpha 2 |
10556 |
0.15 |
chr7_67072393_67072553 | 3.24 |
Gm17909 |
predicted gene, 17909 |
10370 |
0.2 |
chr6_49990055_49990450 | 3.24 |
Gm3455 |
predicted gene 3455 |
60934 |
0.13 |
chr4_155775049_155775727 | 3.24 |
Vwa1 |
von Willebrand factor A domain containing 1 |
690 |
0.4 |
chr2_156626608_156626956 | 3.23 |
Gm14172 |
predicted gene 14172 |
6686 |
0.12 |
chr16_37776737_37777678 | 3.23 |
Fstl1 |
follistatin-like 1 |
55 |
0.98 |
chr9_49571685_49572070 | 3.22 |
Ncam1 |
neural cell adhesion molecule 1 |
3328 |
0.31 |
chr4_150769131_150769447 | 3.22 |
Gm13049 |
predicted gene 13049 |
56444 |
0.1 |
chr10_96338182_96338522 | 3.20 |
Gm48428 |
predicted gene, 48428 |
7472 |
0.18 |
chr4_55125563_55125750 | 3.20 |
Gm12515 |
predicted gene 12515 |
9093 |
0.19 |
chr14_47937173_47937324 | 3.20 |
Gm49303 |
predicted gene, 49303 |
22771 |
0.15 |
chr18_57704186_57704540 | 3.20 |
Gm44491 |
predicted gene, 44491 |
22549 |
0.17 |
chr1_75559272_75559776 | 3.20 |
Slc4a3 |
solute carrier family 4 (anion exchanger), member 3 |
7815 |
0.11 |
chr13_78638604_78638773 | 3.19 |
Gm48402 |
predicted gene, 48402 |
671 |
0.81 |
chr16_14265466_14265813 | 3.19 |
Myh11 |
myosin, heavy polypeptide 11, smooth muscle |
25724 |
0.14 |
chr8_95566440_95566591 | 3.17 |
Prss54 |
protease, serine 54 |
8682 |
0.1 |
chr1_169187638_169187982 | 3.17 |
Gm37839 |
predicted gene, 37839 |
159822 |
0.04 |
chr5_133011027_133011203 | 3.17 |
Gm38373 |
predicted gene, 38373 |
214962 |
0.02 |
chr6_117251530_117251768 | 3.17 |
Rpl28-ps4 |
ribosomal protein L28, pseudogene 4 |
37583 |
0.17 |
chr10_58936543_58936741 | 3.15 |
Gm27672 |
predicted gene, 27672 |
28901 |
0.21 |
chr8_70005285_70005444 | 3.14 |
Gm7730 |
predicted gene 7730 |
5638 |
0.12 |
chr3_68573242_68573402 | 3.13 |
Schip1 |
schwannomin interacting protein 1 |
1077 |
0.57 |
chr2_126060691_126060889 | 3.12 |
Fgf7 |
fibroblast growth factor 7 |
25817 |
0.19 |
chrX_135563132_135563343 | 3.11 |
Gm6228 |
predicted gene 6228 |
14027 |
0.12 |
chr5_112776790_112776941 | 3.10 |
Myo18b |
myosin XVIIIb |
10934 |
0.19 |
chr4_139310211_139311666 | 3.08 |
Akr7a5 |
aldo-keto reductase family 7, member A5 (aflatoxin aldehyde reductase) |
194 |
0.52 |
chrX_56753808_56753959 | 3.08 |
Gm23258 |
predicted gene, 23258 |
3873 |
0.21 |
chr16_19759999_19760363 | 3.07 |
B3gnt5 |
UDP-GlcNAc:betaGal beta-1,3-N-acetylglucosaminyltransferase 5 |
27 |
0.98 |
chr1_181446826_181447104 | 3.06 |
Gm16539 |
predicted gene 16539 |
14565 |
0.18 |
chr7_83443948_83444505 | 3.06 |
Gm44991 |
predicted gene 44991 |
27482 |
0.15 |
chr16_94827069_94827617 | 3.05 |
Kcnj6 |
potassium inwardly-rectifying channel, subfamily J, member 6 |
29329 |
0.18 |
chr6_99666291_99667273 | 3.05 |
Eif4e3 |
eukaryotic translation initiation factor 4E member 3 |
11 |
0.49 |
chr5_54158308_54158653 | 3.05 |
Stim2 |
stromal interaction molecule 2 |
42623 |
0.18 |
chr1_105188349_105188522 | 3.04 |
Gm29013 |
predicted gene 29013 |
55990 |
0.13 |
chr1_79746116_79746296 | 3.03 |
Wdfy1 |
WD repeat and FYVE domain containing 1 |
15515 |
0.16 |
chr1_161451910_161452061 | 3.03 |
Tnfsf18 |
tumor necrosis factor (ligand) superfamily, member 18 |
42670 |
0.14 |
chr17_7642689_7642877 | 3.03 |
Gm49632 |
predicted gene, 49632 |
2545 |
0.33 |
chr9_61655467_61655652 | 3.03 |
Gm47241 |
predicted gene, 47241 |
107525 |
0.06 |
chr15_97992440_97993334 | 3.02 |
Col2a1 |
collagen, type II, alpha 1 |
2411 |
0.25 |
chr1_138487673_138487824 | 3.02 |
Gm28501 |
predicted gene 28501 |
27867 |
0.18 |
chr9_21762154_21762705 | 3.01 |
Spc24 |
SPC24, NDC80 kinetochore complex component, homolog (S. cerevisiae) |
2126 |
0.2 |
chr13_26154314_26155490 | 2.99 |
Gm11352 |
predicted gene 11352 |
39799 |
0.21 |
chr3_93568424_93569054 | 2.99 |
S100a10 |
S100 calcium binding protein A10 (calpactin) |
8012 |
0.13 |
chr11_66188726_66188906 | 2.99 |
Dnah9 |
dynein, axonemal, heavy chain 9 |
20265 |
0.22 |
chr11_117957120_117957410 | 2.98 |
Socs3 |
suppressor of cytokine signaling 3 |
11921 |
0.13 |
chr17_31901817_31902198 | 2.97 |
Gm50000 |
predicted gene, 50000 |
2829 |
0.19 |
chr10_34206475_34207143 | 2.96 |
Dse |
dermatan sulfate epimerase |
268 |
0.86 |
chr7_45460493_45461322 | 2.94 |
Ftl1 |
ferritin light polypeptide 1 |
1023 |
0.19 |
chr1_12947701_12947852 | 2.94 |
Slco5a1 |
solute carrier organic anion transporter family, member 5A1 |
22733 |
0.21 |
chr13_71980339_71980490 | 2.94 |
Irx1 |
Iroquois homeobox 1 |
16691 |
0.24 |
chr11_11828825_11829251 | 2.93 |
Ddc |
dopa decarboxylase |
6117 |
0.2 |
chr9_107259677_107259838 | 2.93 |
Mapkapk3 |
mitogen-activated protein kinase-activated protein kinase 3 |
2179 |
0.17 |
chr4_20777672_20778960 | 2.93 |
Nkain3 |
Na+/K+ transporting ATPase interacting 3 |
251 |
0.96 |
chr11_59635907_59636058 | 2.93 |
Olfr225 |
olfactory receptor 225 |
23016 |
0.1 |
chr9_23378162_23378359 | 2.92 |
Bmper |
BMP-binding endothelial regulator |
4328 |
0.37 |
chr11_20396119_20396652 | 2.91 |
Gm12034 |
predicted gene 12034 |
50027 |
0.12 |
chr5_75472711_75472862 | 2.90 |
Gm42800 |
predicted gene 42800 |
73414 |
0.09 |
chr17_79565400_79565732 | 2.90 |
Rmdn2 |
regulator of microtubule dynamics 2 |
46297 |
0.16 |
chr5_122526992_122527636 | 2.90 |
Gm22965 |
predicted gene, 22965 |
20525 |
0.09 |
chr3_104599330_104600023 | 2.90 |
Gm26091 |
predicted gene, 26091 |
1563 |
0.27 |
chr13_38408006_38408269 | 2.89 |
Bmp6 |
bone morphogenetic protein 6 |
13692 |
0.17 |
chr11_116656854_116657033 | 2.87 |
Prcd |
photoreceptor disc component |
165 |
0.88 |
chr4_64200555_64200730 | 2.87 |
8030451A03Rik |
RIKEN cDNA 8030451A03 gene |
52089 |
0.15 |
chr9_122019046_122019197 | 2.86 |
Gm47117 |
predicted gene, 47117 |
6981 |
0.11 |
chr10_66943980_66944144 | 2.86 |
Gm26576 |
predicted gene, 26576 |
23760 |
0.14 |
chr16_26316464_26316628 | 2.85 |
Cldn1 |
claudin 1 |
44248 |
0.19 |
chr5_118339902_118340120 | 2.85 |
Gm28563 |
predicted gene 28563 |
57319 |
0.1 |
chr15_55417976_55418127 | 2.85 |
1700040F17Rik |
RIKEN cDNA 1700040F17 gene |
20969 |
0.17 |
chr7_96677187_96677373 | 2.84 |
Tenm4 |
teneurin transmembrane protein 4 |
33108 |
0.18 |
chr11_65366075_65366410 | 2.83 |
Gm12295 |
predicted gene 12295 |
444 |
0.89 |
chr12_70598217_70598368 | 2.82 |
Gm24474 |
predicted gene, 24474 |
51890 |
0.11 |
chr13_60455299_60455455 | 2.82 |
Gm35333 |
predicted gene, 35333 |
20646 |
0.15 |
chr7_99352999_99353614 | 2.82 |
Serpinh1 |
serine (or cysteine) peptidase inhibitor, clade H, member 1 |
67 |
0.97 |
chr13_58936184_58936335 | 2.82 |
Ntrk2 |
neurotrophic tyrosine kinase, receptor, type 2 |
64524 |
0.1 |
chr4_149830698_149830849 | 2.81 |
Gm47301 |
predicted gene, 47301 |
13009 |
0.11 |
chr13_9668072_9668415 | 2.81 |
Gm36423 |
predicted gene, 36423 |
15983 |
0.15 |
chr4_83108966_83109117 | 2.81 |
Gm11248 |
predicted gene 11248 |
12500 |
0.2 |
chr5_13470497_13470849 | 2.81 |
Gm43130 |
predicted gene 43130 |
10355 |
0.22 |
chr9_121348136_121348306 | 2.81 |
Gm47092 |
predicted gene, 47092 |
1665 |
0.33 |
chr9_46903783_46904099 | 2.81 |
2900052N01Rik |
RIKEN cDNA 2900052N01 gene |
9552 |
0.24 |
chr2_27200692_27200866 | 2.80 |
Sardh |
sarcosine dehydrogenase |
8519 |
0.13 |
chr14_51915175_51915326 | 2.80 |
Ndrg2 |
N-myc downstream regulated gene 2 |
1092 |
0.28 |
chr3_121735982_121736755 | 2.80 |
F3 |
coagulation factor III |
6821 |
0.11 |
chr14_65900732_65900907 | 2.80 |
Scara3 |
scavenger receptor class A, member 3 |
53116 |
0.1 |
chr1_119053590_119054396 | 2.80 |
Gli2 |
GLI-Kruppel family member GLI2 |
374 |
0.88 |
chr6_88012650_88012801 | 2.80 |
Rab7 |
RAB7, member RAS oncogene family |
7058 |
0.1 |
chr14_53993073_53993284 | 2.80 |
Trdv3 |
T cell receptor delta variable 3 |
7781 |
0.16 |
chr4_70391892_70392044 | 2.79 |
Cdk5rap2 |
CDK5 regulatory subunit associated protein 2 |
11573 |
0.3 |
chr2_30474139_30474693 | 2.79 |
Ier5l |
immediate early response 5-like |
197 |
0.92 |
chr5_142140102_142140271 | 2.77 |
Gm26970 |
predicted gene, 26970 |
142920 |
0.05 |
chr2_50044863_50045062 | 2.77 |
Lypd6 |
LY6/PLAUR domain containing 6 |
21467 |
0.27 |
chr9_62526297_62526844 | 2.76 |
Coro2b |
coronin, actin binding protein, 2B |
6134 |
0.23 |
chr5_136293141_136293512 | 2.76 |
Cux1 |
cut-like homeobox 1 |
9195 |
0.15 |
chr9_51927950_51928376 | 2.75 |
Gm6980 |
predicted gene 6980 |
3498 |
0.2 |
chr1_90718846_90718997 | 2.74 |
Gm9991 |
predicted gene 9991 |
43760 |
0.14 |
chr10_99639743_99639913 | 2.74 |
Gm18409 |
predicted gene, 18409 |
578 |
0.73 |
chr1_171993133_171993284 | 2.74 |
Vangl2 |
VANGL planar cell polarity 2 |
15821 |
0.14 |
chr9_63967551_63967735 | 2.73 |
Gm36033 |
predicted gene, 36033 |
30522 |
0.14 |
chr12_27786818_27786969 | 2.73 |
Gm24326 |
predicted gene, 24326 |
155090 |
0.04 |
chr9_48737748_48737930 | 2.73 |
Zbtb16 |
zinc finger and BTB domain containing 16 |
98106 |
0.07 |
chr10_39639904_39640055 | 2.72 |
Traf3ip2 |
TRAF3 interacting protein 2 |
1155 |
0.38 |
chr2_61454109_61454765 | 2.72 |
Gm22338 |
predicted gene, 22338 |
38329 |
0.2 |
chr10_33083041_33083204 | 2.72 |
Trdn |
triadin |
361 |
0.91 |
chr17_40880084_40880707 | 2.71 |
9130008F23Rik |
RIKEN cDNA 9130008F23 gene |
163 |
0.93 |
chr1_74007725_74008174 | 2.71 |
Tns1 |
tensin 1 |
6382 |
0.25 |
chr2_173339987_173340614 | 2.70 |
Gm14642 |
predicted gene 14642 |
54266 |
0.11 |
chr16_34372080_34372435 | 2.70 |
Kalrn |
kalirin, RhoGEF kinase |
10458 |
0.31 |
chr14_46999474_46999625 | 2.69 |
Samd4 |
sterile alpha motif domain containing 4 |
1766 |
0.3 |
chr13_30245652_30245949 | 2.69 |
Mboat1 |
membrane bound O-acyltransferase domain containing 1 |
13947 |
0.21 |
chr4_55843971_55844321 | 2.69 |
Gm12519 |
predicted gene 12519 |
149593 |
0.04 |
chr2_4517469_4518023 | 2.67 |
Frmd4a |
FERM domain containing 4A |
42008 |
0.14 |
chr10_9005517_9005668 | 2.67 |
Gm48728 |
predicted gene, 48728 |
53643 |
0.12 |
chr9_63092018_63092322 | 2.67 |
Gm48193 |
predicted gene, 48193 |
9197 |
0.17 |
chr8_57841472_57841776 | 2.67 |
Galntl6 |
UDP-N-acetyl-alpha-D-galactosamine:polypeptide N-acetylgalactosaminyltransferase-like 6 |
1434 |
0.48 |
chr17_83889634_83890169 | 2.67 |
1810073O08Rik |
RIKEN cDNA 1810073O08 gene |
28036 |
0.12 |
chr3_145885311_145885687 | 2.66 |
Rpl36a-ps2 |
ribosomal protein L36A, pseudogene 2 |
6479 |
0.2 |
chr15_53467315_53467643 | 2.65 |
Gm27926 |
predicted gene, 27926 |
83560 |
0.09 |
chr15_61766831_61767038 | 2.65 |
D030024E09Rik |
RIKEN cDNA D030024E09 gene |
7517 |
0.28 |
chr4_13767376_13767590 | 2.65 |
Runx1t1 |
RUNX1 translocation partner 1 |
3894 |
0.35 |
chr14_23590073_23590224 | 2.64 |
Gm29626 |
predicted gene 29626 |
29883 |
0.19 |
chr8_36679863_36680205 | 2.64 |
Dlc1 |
deleted in liver cancer 1 |
53020 |
0.16 |
chr11_63115075_63115643 | 2.64 |
Pmp22 |
peripheral myelin protein 22 |
13623 |
0.19 |
chr1_155122669_155122837 | 2.63 |
Mr1 |
major histocompatibility complex, class I-related |
11269 |
0.14 |
chr9_83146500_83146823 | 2.63 |
Hmgn3 |
high mobility group nucleosomal binding domain 3 |
24 |
0.93 |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
2.0 | 5.9 | GO:0003213 | cardiac right atrium morphogenesis(GO:0003213) |
1.6 | 4.7 | GO:0045297 | mating plug formation(GO:0042628) post-mating behavior(GO:0045297) |
1.5 | 7.6 | GO:0060666 | dichotomous subdivision of terminal units involved in salivary gland branching(GO:0060666) |
1.3 | 4.0 | GO:0021776 | smoothened signaling pathway involved in ventral spinal cord interneuron specification(GO:0021775) smoothened signaling pathway involved in spinal cord motor neuron cell fate specification(GO:0021776) |
1.3 | 1.3 | GO:0061643 | chemorepulsion of axon(GO:0061643) |
1.2 | 2.5 | GO:0051891 | positive regulation of cardioblast differentiation(GO:0051891) |
1.2 | 3.5 | GO:0086045 | membrane depolarization during AV node cell action potential(GO:0086045) |
1.2 | 4.6 | GO:0060486 | Clara cell differentiation(GO:0060486) |
1.1 | 3.4 | GO:0061366 | behavioral response to chemical pain(GO:0061366) behavioral response to formalin induced pain(GO:0061368) |
1.1 | 2.2 | GO:0021550 | medulla oblongata development(GO:0021550) |
1.1 | 3.3 | GO:0010735 | positive regulation of transcription via serum response element binding(GO:0010735) |
1.1 | 5.5 | GO:0045636 | positive regulation of melanocyte differentiation(GO:0045636) |
1.0 | 4.2 | GO:1905049 | negative regulation of metalloendopeptidase activity(GO:1904684) negative regulation of metallopeptidase activity(GO:1905049) |
1.0 | 1.0 | GO:1902913 | positive regulation of neuroepithelial cell differentiation(GO:1902913) |
1.0 | 6.1 | GO:0014877 | response to inactivity(GO:0014854) response to muscle inactivity(GO:0014870) response to muscle inactivity involved in regulation of muscle adaptation(GO:0014877) response to denervation involved in regulation of muscle adaptation(GO:0014894) |
1.0 | 5.1 | GO:1902459 | positive regulation of stem cell population maintenance(GO:1902459) |
1.0 | 4.0 | GO:0090245 | axis elongation involved in somitogenesis(GO:0090245) |
1.0 | 3.9 | GO:0030035 | microspike assembly(GO:0030035) |
1.0 | 2.9 | GO:0045218 | zonula adherens maintenance(GO:0045218) |
1.0 | 6.7 | GO:0016198 | axon choice point recognition(GO:0016198) |
0.9 | 3.8 | GO:0010288 | response to lead ion(GO:0010288) |
0.9 | 2.8 | GO:0060741 | prostate gland stromal morphogenesis(GO:0060741) |
0.9 | 6.4 | GO:0021902 | commitment of neuronal cell to specific neuron type in forebrain(GO:0021902) |
0.9 | 0.9 | GO:0061346 | non-canonical Wnt signaling pathway involved in heart development(GO:0061341) planar cell polarity pathway involved in heart morphogenesis(GO:0061346) |
0.9 | 3.5 | GO:1900747 | negative regulation of vascular endothelial growth factor signaling pathway(GO:1900747) |
0.9 | 3.5 | GO:0071847 | TNFSF11-mediated signaling pathway(GO:0071847) |
0.9 | 2.6 | GO:0015820 | branched-chain amino acid transport(GO:0015803) leucine transport(GO:0015820) |
0.8 | 3.4 | GO:0060437 | lung growth(GO:0060437) |
0.8 | 4.1 | GO:0035989 | tendon development(GO:0035989) |
0.8 | 2.4 | GO:0021564 | vagus nerve development(GO:0021564) |
0.8 | 2.4 | GO:0090158 | endoplasmic reticulum membrane organization(GO:0090158) |
0.8 | 4.0 | GO:0003433 | chondrocyte development involved in endochondral bone morphogenesis(GO:0003433) |
0.8 | 2.4 | GO:0030208 | dermatan sulfate biosynthetic process(GO:0030208) |
0.7 | 2.1 | GO:2000275 | regulation of oxidative phosphorylation uncoupler activity(GO:2000275) |
0.7 | 2.1 | GO:0097168 | mesenchymal stem cell proliferation(GO:0097168) |
0.7 | 1.4 | GO:0044333 | Wnt signaling pathway involved in digestive tract morphogenesis(GO:0044333) |
0.7 | 2.1 | GO:1902268 | negative regulation of polyamine transmembrane transport(GO:1902268) |
0.7 | 2.8 | GO:0060221 | retinal rod cell differentiation(GO:0060221) |
0.7 | 2.8 | GO:0031581 | hemidesmosome assembly(GO:0031581) |
0.7 | 2.8 | GO:2000546 | positive regulation of cell chemotaxis to fibroblast growth factor(GO:1904849) positive regulation of endothelial cell chemotaxis to fibroblast growth factor(GO:2000546) |
0.7 | 5.6 | GO:0046069 | cGMP catabolic process(GO:0046069) |
0.7 | 1.4 | GO:1900222 | negative regulation of beta-amyloid clearance(GO:1900222) |
0.7 | 2.1 | GO:2000297 | negative regulation of synapse maturation(GO:2000297) |
0.7 | 4.1 | GO:0060907 | positive regulation of macrophage cytokine production(GO:0060907) |
0.7 | 2.7 | GO:0030091 | protein repair(GO:0030091) |
0.7 | 5.4 | GO:0038063 | collagen-activated tyrosine kinase receptor signaling pathway(GO:0038063) |
0.7 | 2.0 | GO:0032289 | central nervous system myelin formation(GO:0032289) |
0.7 | 0.7 | GO:0097104 | postsynaptic membrane assembly(GO:0097104) |
0.7 | 2.0 | GO:0072061 | inner medullary collecting duct development(GO:0072061) |
0.7 | 2.6 | GO:0071205 | protein localization to juxtaparanode region of axon(GO:0071205) |
0.6 | 3.2 | GO:0021785 | branchiomotor neuron axon guidance(GO:0021785) |
0.6 | 1.9 | GO:0007223 | Wnt signaling pathway, calcium modulating pathway(GO:0007223) |
0.6 | 3.2 | GO:0003228 | atrial cardiac muscle tissue development(GO:0003228) atrial cardiac muscle tissue morphogenesis(GO:0055009) |
0.6 | 0.6 | GO:1901166 | neural crest cell migration involved in autonomic nervous system development(GO:1901166) |
0.6 | 2.5 | GO:0003104 | positive regulation of glomerular filtration(GO:0003104) |
0.6 | 2.5 | GO:0098910 | regulation of atrial cardiac muscle cell action potential(GO:0098910) |
0.6 | 3.1 | GO:1904424 | regulation of GTP binding(GO:1904424) |
0.6 | 2.4 | GO:0060414 | aorta smooth muscle tissue morphogenesis(GO:0060414) |
0.6 | 4.1 | GO:0019800 | peptide cross-linking via chondroitin 4-sulfate glycosaminoglycan(GO:0019800) |
0.6 | 2.4 | GO:0014826 | vein smooth muscle contraction(GO:0014826) |
0.6 | 2.3 | GO:0035995 | detection of muscle stretch(GO:0035995) |
0.6 | 2.9 | GO:0034638 | phosphatidylcholine catabolic process(GO:0034638) |
0.6 | 3.5 | GO:0021830 | interneuron migration from the subpallium to the cortex(GO:0021830) |
0.6 | 2.3 | GO:1902866 | regulation of retina development in camera-type eye(GO:1902866) |
0.6 | 1.7 | GO:0097118 | neuroligin clustering involved in postsynaptic membrane assembly(GO:0097118) |
0.6 | 1.7 | GO:0009449 | gamma-aminobutyric acid biosynthetic process(GO:0009449) |
0.6 | 1.7 | GO:2000823 | regulation of androgen receptor activity(GO:2000823) |
0.5 | 1.6 | GO:0035860 | glial cell-derived neurotrophic factor receptor signaling pathway(GO:0035860) |
0.5 | 1.1 | GO:0048739 | cardiac muscle fiber development(GO:0048739) |
0.5 | 2.7 | GO:0033564 | anterior/posterior axon guidance(GO:0033564) |
0.5 | 2.2 | GO:0046959 | habituation(GO:0046959) |
0.5 | 3.7 | GO:1901387 | positive regulation of voltage-gated calcium channel activity(GO:1901387) |
0.5 | 2.1 | GO:0070213 | protein auto-ADP-ribosylation(GO:0070213) |
0.5 | 1.5 | GO:0036072 | intramembranous ossification(GO:0001957) direct ossification(GO:0036072) |
0.5 | 1.0 | GO:0060028 | convergent extension involved in axis elongation(GO:0060028) |
0.5 | 1.5 | GO:0090292 | nuclear matrix organization(GO:0043578) nuclear matrix anchoring at nuclear membrane(GO:0090292) |
0.5 | 1.4 | GO:0090271 | positive regulation of fibroblast growth factor production(GO:0090271) |
0.5 | 2.9 | GO:0090043 | regulation of tubulin deacetylation(GO:0090043) |
0.5 | 0.9 | GO:0060160 | negative regulation of dopamine receptor signaling pathway(GO:0060160) |
0.5 | 0.5 | GO:0003347 | epicardial cell to mesenchymal cell transition(GO:0003347) |
0.5 | 3.3 | GO:0035542 | regulation of SNARE complex assembly(GO:0035542) |
0.5 | 1.4 | GO:0014722 | regulation of skeletal muscle contraction by calcium ion signaling(GO:0014722) |
0.5 | 1.4 | GO:0048677 | axon extension involved in regeneration(GO:0048677) sprouting of injured axon(GO:0048682) |
0.5 | 1.4 | GO:0000189 | MAPK import into nucleus(GO:0000189) |
0.5 | 1.4 | GO:1902071 | regulation of hypoxia-inducible factor-1alpha signaling pathway(GO:1902071) |
0.5 | 1.4 | GO:1902302 | regulation of potassium ion export(GO:1902302) |
0.5 | 1.4 | GO:0014724 | regulation of twitch skeletal muscle contraction(GO:0014724) |
0.4 | 2.2 | GO:0048852 | diencephalon morphogenesis(GO:0048852) |
0.4 | 1.3 | GO:0072198 | mesenchymal cell proliferation involved in ureter development(GO:0072198) regulation of mesenchymal cell proliferation involved in ureter development(GO:0072199) positive regulation of mesenchymal cell proliferation involved in ureter development(GO:2000729) |
0.4 | 1.3 | GO:2001016 | positive regulation of skeletal muscle cell differentiation(GO:2001016) |
0.4 | 1.8 | GO:2000680 | regulation of rubidium ion transport(GO:2000680) |
0.4 | 2.2 | GO:0042118 | endothelial cell activation(GO:0042118) |
0.4 | 2.2 | GO:0045602 | negative regulation of endothelial cell differentiation(GO:0045602) |
0.4 | 4.7 | GO:0003417 | growth plate cartilage development(GO:0003417) |
0.4 | 1.3 | GO:0030167 | proteoglycan catabolic process(GO:0030167) |
0.4 | 2.1 | GO:0090336 | positive regulation of brown fat cell differentiation(GO:0090336) |
0.4 | 0.8 | GO:1901509 | regulation of endothelial tube morphogenesis(GO:1901509) |
0.4 | 1.2 | GO:2000857 | positive regulation of mineralocorticoid secretion(GO:2000857) positive regulation of aldosterone secretion(GO:2000860) |
0.4 | 2.4 | GO:0090273 | regulation of somatostatin secretion(GO:0090273) |
0.4 | 0.8 | GO:0090360 | platelet-derived growth factor production(GO:0090360) regulation of platelet-derived growth factor production(GO:0090361) |
0.4 | 1.2 | GO:0019355 | nicotinamide nucleotide biosynthetic process from aspartate(GO:0019355) 'de novo' NAD biosynthetic process from aspartate(GO:0034628) |
0.4 | 1.2 | GO:0003278 | apoptotic process involved in heart morphogenesis(GO:0003278) |
0.4 | 1.2 | GO:1902498 | regulation of protein autoubiquitination(GO:1902498) |
0.4 | 6.7 | GO:0048745 | smooth muscle tissue development(GO:0048745) |
0.4 | 1.6 | GO:0015015 | heparan sulfate proteoglycan biosynthetic process, enzymatic modification(GO:0015015) |
0.4 | 0.8 | GO:0060448 | dichotomous subdivision of terminal units involved in lung branching(GO:0060448) |
0.4 | 0.8 | GO:1903587 | regulation of blood vessel endothelial cell proliferation involved in sprouting angiogenesis(GO:1903587) |
0.4 | 1.2 | GO:0046469 | platelet activating factor biosynthetic process(GO:0006663) platelet activating factor metabolic process(GO:0046469) |
0.4 | 1.2 | GO:0035973 | aggrephagy(GO:0035973) |
0.4 | 1.6 | GO:0072051 | juxtaglomerular apparatus development(GO:0072051) |
0.4 | 0.4 | GO:2000040 | regulation of planar cell polarity pathway involved in axis elongation(GO:2000040) negative regulation of planar cell polarity pathway involved in axis elongation(GO:2000041) |
0.4 | 1.6 | GO:0045091 | regulation of single stranded viral RNA replication via double stranded DNA intermediate(GO:0045091) |
0.4 | 3.1 | GO:0051764 | actin crosslink formation(GO:0051764) |
0.4 | 1.5 | GO:0001880 | Mullerian duct regression(GO:0001880) |
0.4 | 1.5 | GO:0046655 | folic acid metabolic process(GO:0046655) |
0.4 | 0.8 | GO:0060596 | mammary placode formation(GO:0060596) |
0.4 | 2.3 | GO:0060718 | chorionic trophoblast cell differentiation(GO:0060718) |
0.4 | 0.4 | GO:0007158 | neuron cell-cell adhesion(GO:0007158) |
0.4 | 1.5 | GO:0007412 | axon target recognition(GO:0007412) |
0.4 | 3.4 | GO:0032060 | bleb assembly(GO:0032060) |
0.4 | 0.4 | GO:0003166 | bundle of His development(GO:0003166) |
0.4 | 7.1 | GO:0008045 | motor neuron axon guidance(GO:0008045) |
0.4 | 0.7 | GO:0070831 | basement membrane assembly(GO:0070831) regulation of extracellular matrix assembly(GO:1901201) positive regulation of extracellular matrix assembly(GO:1901203) regulation of basement membrane assembly involved in embryonic body morphogenesis(GO:1904259) positive regulation of basement membrane assembly involved in embryonic body morphogenesis(GO:1904261) basement membrane assembly involved in embryonic body morphogenesis(GO:2001197) |
0.4 | 3.3 | GO:0048671 | negative regulation of collateral sprouting(GO:0048671) |
0.4 | 0.7 | GO:2000118 | regulation of sodium-dependent phosphate transport(GO:2000118) |
0.4 | 2.9 | GO:0010944 | negative regulation of transcription by competitive promoter binding(GO:0010944) |
0.4 | 1.1 | GO:0060385 | axonogenesis involved in innervation(GO:0060385) |
0.4 | 1.4 | GO:0098735 | positive regulation of the force of heart contraction(GO:0098735) |
0.4 | 1.8 | GO:0030638 | polyketide metabolic process(GO:0030638) aminoglycoside antibiotic metabolic process(GO:0030647) daunorubicin metabolic process(GO:0044597) doxorubicin metabolic process(GO:0044598) |
0.4 | 0.7 | GO:0033088 | negative regulation of immature T cell proliferation in thymus(GO:0033088) |
0.4 | 0.7 | GO:0072137 | condensed mesenchymal cell proliferation(GO:0072137) |
0.4 | 1.1 | GO:0030421 | defecation(GO:0030421) |
0.4 | 1.1 | GO:0070100 | negative regulation of chemokine-mediated signaling pathway(GO:0070100) |
0.4 | 1.1 | GO:0021524 | visceral motor neuron differentiation(GO:0021524) |
0.3 | 0.3 | GO:0021631 | optic nerve morphogenesis(GO:0021631) |
0.3 | 1.4 | GO:0006041 | glucosamine metabolic process(GO:0006041) |
0.3 | 1.0 | GO:0045657 | positive regulation of monocyte differentiation(GO:0045657) |
0.3 | 1.7 | GO:2000807 | regulation of synaptic vesicle clustering(GO:2000807) |
0.3 | 0.7 | GO:2000321 | positive regulation of T-helper 17 cell differentiation(GO:2000321) |
0.3 | 0.7 | GO:0072106 | regulation of ureteric bud formation(GO:0072106) positive regulation of ureteric bud formation(GO:0072107) |
0.3 | 6.4 | GO:0021952 | central nervous system projection neuron axonogenesis(GO:0021952) |
0.3 | 0.3 | GO:0015014 | heparan sulfate proteoglycan biosynthetic process, polysaccharide chain biosynthetic process(GO:0015014) |
0.3 | 1.3 | GO:0030222 | eosinophil differentiation(GO:0030222) |
0.3 | 1.0 | GO:0090214 | spongiotrophoblast layer developmental growth(GO:0090214) |
0.3 | 1.0 | GO:0014734 | skeletal muscle hypertrophy(GO:0014734) |
0.3 | 1.6 | GO:2000618 | regulation of histone H4-K16 acetylation(GO:2000618) |
0.3 | 2.3 | GO:0002756 | MyD88-independent toll-like receptor signaling pathway(GO:0002756) |
0.3 | 2.0 | GO:0035988 | chondrocyte proliferation(GO:0035988) |
0.3 | 2.6 | GO:0090136 | epithelial cell-cell adhesion(GO:0090136) |
0.3 | 1.0 | GO:0002414 | immunoglobulin transcytosis in epithelial cells(GO:0002414) |
0.3 | 0.3 | GO:0003176 | aortic valve development(GO:0003176) aortic valve morphogenesis(GO:0003180) |
0.3 | 0.3 | GO:1903847 | regulation of aorta morphogenesis(GO:1903847) positive regulation of aorta morphogenesis(GO:1903849) |
0.3 | 1.3 | GO:0033326 | cerebrospinal fluid secretion(GO:0033326) |
0.3 | 0.9 | GO:0060618 | nipple development(GO:0060618) |
0.3 | 0.9 | GO:0021586 | pons maturation(GO:0021586) |
0.3 | 1.8 | GO:0048539 | bone marrow development(GO:0048539) |
0.3 | 0.9 | GO:2001201 | transforming growth factor-beta secretion(GO:0038044) regulation of transforming growth factor-beta secretion(GO:2001201) |
0.3 | 0.9 | GO:0042483 | negative regulation of odontogenesis(GO:0042483) |
0.3 | 0.6 | GO:0035694 | mitochondrial protein catabolic process(GO:0035694) |
0.3 | 0.6 | GO:0014738 | regulation of muscle hyperplasia(GO:0014738) muscle hyperplasia(GO:0014900) |
0.3 | 0.9 | GO:0051665 | membrane raft localization(GO:0051665) |
0.3 | 0.9 | GO:0061577 | calcium ion transmembrane transport via high voltage-gated calcium channel(GO:0061577) |
0.3 | 0.9 | GO:0038001 | paracrine signaling(GO:0038001) |
0.3 | 0.9 | GO:0046100 | hypoxanthine metabolic process(GO:0046100) hypoxanthine biosynthetic process(GO:0046101) |
0.3 | 0.3 | GO:0071681 | response to indole-3-methanol(GO:0071680) cellular response to indole-3-methanol(GO:0071681) |
0.3 | 0.9 | GO:0002121 | inter-male aggressive behavior(GO:0002121) |
0.3 | 1.5 | GO:0032792 | negative regulation of CREB transcription factor activity(GO:0032792) |
0.3 | 1.2 | GO:0060638 | mesenchymal-epithelial cell signaling(GO:0060638) |
0.3 | 0.3 | GO:0014873 | response to muscle activity involved in regulation of muscle adaptation(GO:0014873) |
0.3 | 1.1 | GO:0015819 | lysine transport(GO:0015819) |
0.3 | 1.1 | GO:0072697 | protein localization to cell cortex(GO:0072697) |
0.3 | 2.8 | GO:0048268 | clathrin coat assembly(GO:0048268) |
0.3 | 2.0 | GO:0001778 | plasma membrane repair(GO:0001778) |
0.3 | 0.6 | GO:0007403 | glial cell fate determination(GO:0007403) |
0.3 | 1.1 | GO:0045162 | clustering of voltage-gated sodium channels(GO:0045162) |
0.3 | 1.4 | GO:0001955 | blood vessel maturation(GO:0001955) |
0.3 | 0.8 | GO:0002023 | reduction of food intake in response to dietary excess(GO:0002023) |
0.3 | 0.6 | GO:1902260 | negative regulation of delayed rectifier potassium channel activity(GO:1902260) negative regulation of voltage-gated potassium channel activity(GO:1903817) |
0.3 | 3.0 | GO:0003334 | keratinocyte development(GO:0003334) |
0.3 | 0.8 | GO:0060283 | negative regulation of oocyte development(GO:0060283) |
0.3 | 0.8 | GO:0003148 | outflow tract septum morphogenesis(GO:0003148) |
0.3 | 1.4 | GO:0070842 | aggresome assembly(GO:0070842) |
0.3 | 0.8 | GO:0045988 | negative regulation of striated muscle contraction(GO:0045988) |
0.3 | 1.1 | GO:1904751 | regulation of protein localization to nucleolus(GO:1904749) positive regulation of protein localization to nucleolus(GO:1904751) |
0.3 | 1.4 | GO:0032224 | positive regulation of synaptic transmission, cholinergic(GO:0032224) |
0.3 | 0.8 | GO:0034729 | histone H3-K79 methylation(GO:0034729) |
0.3 | 1.4 | GO:0014028 | notochord formation(GO:0014028) |
0.3 | 0.8 | GO:0016576 | histone dephosphorylation(GO:0016576) |
0.3 | 0.8 | GO:0090258 | negative regulation of mitochondrial fission(GO:0090258) |
0.3 | 1.3 | GO:0071225 | cellular response to muramyl dipeptide(GO:0071225) |
0.3 | 1.3 | GO:0097151 | positive regulation of inhibitory postsynaptic potential(GO:0097151) |
0.3 | 0.5 | GO:0014744 | positive regulation of muscle adaptation(GO:0014744) |
0.3 | 1.8 | GO:0060484 | lung-associated mesenchyme development(GO:0060484) |
0.3 | 0.8 | GO:0045794 | negative regulation of cell volume(GO:0045794) |
0.3 | 0.8 | GO:0035799 | ureter maturation(GO:0035799) |
0.3 | 0.5 | GO:0032808 | lacrimal gland development(GO:0032808) |
0.3 | 1.0 | GO:0044336 | canonical Wnt signaling pathway involved in negative regulation of apoptotic process(GO:0044336) |
0.3 | 0.3 | GO:0071677 | positive regulation of mononuclear cell migration(GO:0071677) |
0.3 | 1.5 | GO:0030579 | ubiquitin-dependent SMAD protein catabolic process(GO:0030579) |
0.3 | 0.8 | GO:2000110 | negative regulation of macrophage apoptotic process(GO:2000110) |
0.3 | 4.3 | GO:0016339 | calcium-dependent cell-cell adhesion via plasma membrane cell adhesion molecules(GO:0016339) |
0.2 | 2.0 | GO:0030206 | chondroitin sulfate biosynthetic process(GO:0030206) |
0.2 | 1.7 | GO:0006655 | phosphatidylglycerol biosynthetic process(GO:0006655) |
0.2 | 2.7 | GO:0008038 | neuron recognition(GO:0008038) |
0.2 | 1.5 | GO:0031666 | positive regulation of lipopolysaccharide-mediated signaling pathway(GO:0031666) |
0.2 | 0.7 | GO:0090427 | activation of meiosis(GO:0090427) |
0.2 | 0.7 | GO:0090038 | negative regulation of protein kinase C signaling(GO:0090038) |
0.2 | 0.2 | GO:0010847 | regulation of chromatin assembly(GO:0010847) |
0.2 | 1.0 | GO:0048003 | antigen processing and presentation of lipid antigen via MHC class Ib(GO:0048003) antigen processing and presentation, exogenous lipid antigen via MHC class Ib(GO:0048007) |
0.2 | 0.2 | GO:0003139 | secondary heart field specification(GO:0003139) |
0.2 | 0.5 | GO:0090210 | regulation of establishment of blood-brain barrier(GO:0090210) |
0.2 | 0.5 | GO:0010635 | regulation of mitochondrial fusion(GO:0010635) negative regulation of mitochondrial fusion(GO:0010637) |
0.2 | 0.5 | GO:0002337 | B-1a B cell differentiation(GO:0002337) |
0.2 | 1.6 | GO:0006654 | phosphatidic acid biosynthetic process(GO:0006654) |
0.2 | 1.6 | GO:0006108 | malate metabolic process(GO:0006108) |
0.2 | 0.7 | GO:0003199 | endocardial cushion to mesenchymal transition involved in heart valve formation(GO:0003199) |
0.2 | 0.5 | GO:0038165 | oncostatin-M-mediated signaling pathway(GO:0038165) |
0.2 | 3.7 | GO:0070208 | protein heterotrimerization(GO:0070208) |
0.2 | 0.9 | GO:2000523 | regulation of T cell costimulation(GO:2000523) positive regulation of T cell costimulation(GO:2000525) |
0.2 | 0.2 | GO:0055005 | ventricular cardiac myofibril assembly(GO:0055005) |
0.2 | 0.7 | GO:0090310 | negative regulation of methylation-dependent chromatin silencing(GO:0090310) |
0.2 | 0.2 | GO:0061031 | endodermal digestive tract morphogenesis(GO:0061031) |
0.2 | 3.2 | GO:0042474 | middle ear morphogenesis(GO:0042474) |
0.2 | 0.7 | GO:1905098 | negative regulation of guanyl-nucleotide exchange factor activity(GO:1905098) |
0.2 | 0.9 | GO:0001996 | positive regulation of heart rate by epinephrine-norepinephrine(GO:0001996) |
0.2 | 0.7 | GO:0003284 | septum primum development(GO:0003284) atrial septum primum morphogenesis(GO:0003289) |
0.2 | 0.4 | GO:2000065 | negative regulation of aldosterone metabolic process(GO:0032345) negative regulation of aldosterone biosynthetic process(GO:0032348) negative regulation of cortisol biosynthetic process(GO:2000065) |
0.2 | 0.7 | GO:0014816 | skeletal muscle satellite cell differentiation(GO:0014816) |
0.2 | 0.9 | GO:0071692 | protein localization to extracellular region(GO:0071692) maintenance of protein location in extracellular region(GO:0071694) |
0.2 | 0.7 | GO:0045074 | interleukin-10 biosynthetic process(GO:0042091) regulation of interleukin-10 biosynthetic process(GO:0045074) |
0.2 | 1.1 | GO:0070120 | ciliary neurotrophic factor-mediated signaling pathway(GO:0070120) |
0.2 | 1.3 | GO:0014883 | transition between fast and slow fiber(GO:0014883) |
0.2 | 0.2 | GO:0010643 | cell communication by chemical coupling(GO:0010643) |
0.2 | 1.3 | GO:0071910 | determination of liver left/right asymmetry(GO:0071910) |
0.2 | 0.4 | GO:0033602 | negative regulation of dopamine secretion(GO:0033602) |
0.2 | 0.4 | GO:0090403 | oxidative stress-induced premature senescence(GO:0090403) |
0.2 | 0.4 | GO:0021798 | forebrain dorsal/ventral pattern formation(GO:0021798) |
0.2 | 0.9 | GO:2000651 | positive regulation of sodium ion transmembrane transporter activity(GO:2000651) |
0.2 | 0.4 | GO:0051586 | positive regulation of neurotransmitter uptake(GO:0051582) positive regulation of dopamine uptake involved in synaptic transmission(GO:0051586) positive regulation of catecholamine uptake involved in synaptic transmission(GO:0051944) |
0.2 | 1.3 | GO:0099515 | actin filament-based transport(GO:0099515) |
0.2 | 0.6 | GO:0061152 | trachea submucosa development(GO:0061152) trachea gland development(GO:0061153) |
0.2 | 1.5 | GO:0048715 | negative regulation of oligodendrocyte differentiation(GO:0048715) |
0.2 | 1.9 | GO:0070050 | neuron cellular homeostasis(GO:0070050) |
0.2 | 0.2 | GO:0060373 | regulation of ventricular cardiac muscle cell membrane depolarization(GO:0060373) |
0.2 | 3.1 | GO:0016486 | peptide hormone processing(GO:0016486) |
0.2 | 0.4 | GO:0001560 | regulation of cell growth by extracellular stimulus(GO:0001560) |
0.2 | 1.8 | GO:0034427 | nuclear-transcribed mRNA catabolic process, exonucleolytic, 3'-5'(GO:0034427) |
0.2 | 0.4 | GO:0046103 | inosine biosynthetic process(GO:0046103) |
0.2 | 0.8 | GO:0060045 | positive regulation of cardiac muscle cell proliferation(GO:0060045) |
0.2 | 0.2 | GO:0061043 | regulation of vascular wound healing(GO:0061043) |
0.2 | 0.6 | GO:1904380 | endoplasmic reticulum mannose trimming(GO:1904380) |
0.2 | 0.4 | GO:0032914 | positive regulation of transforming growth factor beta1 production(GO:0032914) |
0.2 | 0.6 | GO:0090188 | negative regulation of pancreatic juice secretion(GO:0090188) |
0.2 | 0.4 | GO:0060406 | positive regulation of penile erection(GO:0060406) |
0.2 | 0.6 | GO:2000325 | regulation of ligand-dependent nuclear receptor transcription coactivator activity(GO:2000325) positive regulation of ligand-dependent nuclear receptor transcription coactivator activity(GO:2000327) |
0.2 | 0.4 | GO:0061055 | myotome development(GO:0061055) |
0.2 | 1.4 | GO:0048251 | elastic fiber assembly(GO:0048251) |
0.2 | 0.6 | GO:0035983 | response to trichostatin A(GO:0035983) cellular response to trichostatin A(GO:0035984) |
0.2 | 1.0 | GO:0035385 | Roundabout signaling pathway(GO:0035385) |
0.2 | 0.8 | GO:0080154 | regulation of fertilization(GO:0080154) |
0.2 | 2.7 | GO:1900119 | positive regulation of execution phase of apoptosis(GO:1900119) |
0.2 | 0.8 | GO:0070086 | ubiquitin-dependent endocytosis(GO:0070086) |
0.2 | 0.6 | GO:1900738 | positive regulation of phospholipase C-activating G-protein coupled receptor signaling pathway(GO:1900738) |
0.2 | 0.2 | GO:0003273 | cell migration involved in endocardial cushion formation(GO:0003273) |
0.2 | 1.3 | GO:0007021 | tubulin complex assembly(GO:0007021) |
0.2 | 2.3 | GO:0097320 | membrane tubulation(GO:0097320) |
0.2 | 0.8 | GO:0003198 | epithelial to mesenchymal transition involved in endocardial cushion formation(GO:0003198) |
0.2 | 0.4 | GO:0061146 | Peyer's patch morphogenesis(GO:0061146) |
0.2 | 0.2 | GO:1904023 | regulation of fermentation(GO:0043465) regulation of NAD metabolic process(GO:1902688) regulation of glucose catabolic process to lactate via pyruvate(GO:1904023) |
0.2 | 0.6 | GO:0014707 | branchiomeric skeletal muscle development(GO:0014707) |
0.2 | 0.2 | GO:0072050 | S-shaped body morphogenesis(GO:0072050) |
0.2 | 1.3 | GO:0001886 | endothelial cell morphogenesis(GO:0001886) |
0.2 | 1.8 | GO:0001975 | response to amphetamine(GO:0001975) |
0.2 | 0.2 | GO:0007161 | calcium-independent cell-matrix adhesion(GO:0007161) |
0.2 | 0.7 | GO:0031915 | positive regulation of synaptic plasticity(GO:0031915) |
0.2 | 0.2 | GO:0033693 | neurofilament bundle assembly(GO:0033693) |
0.2 | 0.5 | GO:0006382 | adenosine to inosine editing(GO:0006382) |
0.2 | 1.4 | GO:0060351 | cartilage development involved in endochondral bone morphogenesis(GO:0060351) |
0.2 | 0.5 | GO:0001765 | membrane raft assembly(GO:0001765) |
0.2 | 0.5 | GO:0072539 | T-helper 17 cell differentiation(GO:0072539) |
0.2 | 0.2 | GO:0072189 | ureter development(GO:0072189) |
0.2 | 0.9 | GO:0080009 | mRNA methylation(GO:0080009) |
0.2 | 2.6 | GO:0045956 | positive regulation of calcium ion-dependent exocytosis(GO:0045956) |
0.2 | 1.2 | GO:0021942 | radial glia guided migration of Purkinje cell(GO:0021942) |
0.2 | 1.0 | GO:0042447 | hormone catabolic process(GO:0042447) |
0.2 | 1.5 | GO:0060043 | regulation of cardiac muscle cell proliferation(GO:0060043) |
0.2 | 1.0 | GO:0072540 | T-helper 17 cell lineage commitment(GO:0072540) |
0.2 | 0.2 | GO:0038065 | collagen-activated signaling pathway(GO:0038065) |
0.2 | 0.3 | GO:0060166 | olfactory pit development(GO:0060166) |
0.2 | 0.7 | GO:0070459 | prolactin secretion(GO:0070459) |
0.2 | 1.2 | GO:0042482 | positive regulation of odontogenesis(GO:0042482) |
0.2 | 0.2 | GO:0045054 | constitutive secretory pathway(GO:0045054) |
0.2 | 0.5 | GO:0048702 | embryonic neurocranium morphogenesis(GO:0048702) |
0.2 | 0.2 | GO:0032910 | transforming growth factor beta3 production(GO:0032907) regulation of transforming growth factor beta3 production(GO:0032910) |
0.2 | 0.2 | GO:0043435 | response to corticotropin-releasing hormone(GO:0043435) cellular response to corticotropin-releasing hormone stimulus(GO:0071376) |
0.2 | 0.3 | GO:0045759 | negative regulation of action potential(GO:0045759) |
0.2 | 0.3 | GO:0044387 | negative regulation of protein kinase activity by regulation of protein phosphorylation(GO:0044387) |
0.2 | 0.6 | GO:0002636 | positive regulation of germinal center formation(GO:0002636) |
0.2 | 0.3 | GO:0060317 | cardiac epithelial to mesenchymal transition(GO:0060317) |
0.2 | 0.3 | GO:1901491 | negative regulation of lymphangiogenesis(GO:1901491) |
0.2 | 0.5 | GO:0022038 | corpus callosum development(GO:0022038) |
0.2 | 0.3 | GO:1904180 | negative regulation of mitochondrial depolarization(GO:0051902) negative regulation of membrane depolarization(GO:1904180) |
0.2 | 0.6 | GO:0000160 | phosphorelay signal transduction system(GO:0000160) |
0.2 | 0.5 | GO:0036066 | protein O-linked fucosylation(GO:0036066) |
0.2 | 0.2 | GO:1904948 | midbrain dopaminergic neuron differentiation(GO:1904948) |
0.2 | 0.3 | GO:0070673 | response to interleukin-18(GO:0070673) cellular response to interleukin-18(GO:0071351) |
0.2 | 0.6 | GO:0051534 | negative regulation of NFAT protein import into nucleus(GO:0051534) |
0.2 | 0.3 | GO:0071895 | odontoblast differentiation(GO:0071895) |
0.2 | 0.3 | GO:0043117 | positive regulation of vascular permeability(GO:0043117) |
0.2 | 0.8 | GO:0051045 | negative regulation of membrane protein ectodomain proteolysis(GO:0051045) |
0.2 | 0.2 | GO:1901420 | negative regulation of response to alcohol(GO:1901420) |
0.2 | 0.6 | GO:0016584 | nucleosome positioning(GO:0016584) |
0.2 | 0.3 | GO:0032621 | interleukin-18 production(GO:0032621) |
0.2 | 0.2 | GO:2000048 | negative regulation of cell-cell adhesion mediated by cadherin(GO:2000048) |
0.2 | 1.5 | GO:0030318 | melanocyte differentiation(GO:0030318) |
0.2 | 0.6 | GO:0022030 | cerebral cortex radial glia guided migration(GO:0021801) telencephalon glial cell migration(GO:0022030) |
0.2 | 0.8 | GO:0030578 | PML body organization(GO:0030578) |
0.2 | 0.3 | GO:2000504 | positive regulation of blood vessel remodeling(GO:2000504) |
0.2 | 0.5 | GO:0070294 | renal sodium ion absorption(GO:0070294) |
0.2 | 1.1 | GO:1901678 | iron coordination entity transport(GO:1901678) |
0.2 | 0.9 | GO:0016338 | calcium-independent cell-cell adhesion via plasma membrane cell-adhesion molecules(GO:0016338) |
0.2 | 0.5 | GO:0097112 | gamma-aminobutyric acid receptor clustering(GO:0097112) |
0.2 | 0.5 | GO:0046909 | intermembrane transport(GO:0046909) |
0.2 | 0.5 | GO:2000097 | regulation of smooth muscle cell-matrix adhesion(GO:2000097) |
0.2 | 0.8 | GO:0051775 | response to redox state(GO:0051775) |
0.2 | 0.9 | GO:1903546 | protein localization to photoreceptor outer segment(GO:1903546) |
0.1 | 0.4 | GO:0060973 | cell migration involved in heart development(GO:0060973) |
0.1 | 0.4 | GO:0006551 | leucine metabolic process(GO:0006551) |
0.1 | 0.1 | GO:0010980 | regulation of vitamin D 24-hydroxylase activity(GO:0010979) positive regulation of vitamin D 24-hydroxylase activity(GO:0010980) |
0.1 | 0.4 | GO:0034141 | positive regulation of toll-like receptor 3 signaling pathway(GO:0034141) |
0.1 | 0.4 | GO:0003383 | apical constriction(GO:0003383) |
0.1 | 0.6 | GO:0010801 | negative regulation of peptidyl-threonine phosphorylation(GO:0010801) |
0.1 | 0.1 | GO:0033092 | positive regulation of immature T cell proliferation(GO:0033091) positive regulation of immature T cell proliferation in thymus(GO:0033092) |
0.1 | 0.4 | GO:0001827 | inner cell mass cell fate commitment(GO:0001827) |
0.1 | 0.6 | GO:0018158 | protein oxidation(GO:0018158) |
0.1 | 1.0 | GO:0051481 | negative regulation of cytosolic calcium ion concentration(GO:0051481) |
0.1 | 0.9 | GO:0006621 | protein retention in ER lumen(GO:0006621) |
0.1 | 0.3 | GO:0051835 | positive regulation of synapse structural plasticity(GO:0051835) |
0.1 | 0.4 | GO:0006296 | nucleotide-excision repair, DNA incision, 5'-to lesion(GO:0006296) |
0.1 | 0.3 | GO:2000304 | positive regulation of sphingolipid biosynthetic process(GO:0090154) positive regulation of ceramide biosynthetic process(GO:2000304) |
0.1 | 0.1 | GO:0035880 | embryonic nail plate morphogenesis(GO:0035880) |
0.1 | 0.6 | GO:0090080 | positive regulation of MAPKKK cascade by fibroblast growth factor receptor signaling pathway(GO:0090080) |
0.1 | 0.6 | GO:0016557 | peroxisome membrane biogenesis(GO:0016557) |
0.1 | 0.4 | GO:0048743 | positive regulation of skeletal muscle fiber development(GO:0048743) |
0.1 | 0.3 | GO:0072257 | metanephric nephron tubule epithelial cell differentiation(GO:0072257) regulation of metanephric nephron tubule epithelial cell differentiation(GO:0072307) |
0.1 | 0.3 | GO:1901740 | negative regulation of myoblast fusion(GO:1901740) |
0.1 | 0.6 | GO:2000324 | positive regulation of glucocorticoid receptor signaling pathway(GO:2000324) |
0.1 | 0.5 | GO:0089711 | L-glutamate transmembrane transport(GO:0089711) |
0.1 | 0.4 | GO:1902172 | keratinocyte apoptotic process(GO:0097283) regulation of keratinocyte apoptotic process(GO:1902172) |
0.1 | 0.3 | GO:0019230 | proprioception(GO:0019230) |
0.1 | 0.4 | GO:0009957 | epidermal cell fate specification(GO:0009957) |
0.1 | 0.4 | GO:0042494 | detection of bacterial lipoprotein(GO:0042494) |
0.1 | 0.4 | GO:0030382 | sperm mitochondrion organization(GO:0030382) |
0.1 | 0.7 | GO:0005513 | detection of calcium ion(GO:0005513) |
0.1 | 0.4 | GO:0030327 | prenylated protein catabolic process(GO:0030327) |
0.1 | 0.4 | GO:0031087 | nuclear-transcribed mRNA catabolic process, deadenylation-independent decay(GO:0031086) deadenylation-independent decapping of nuclear-transcribed mRNA(GO:0031087) |
0.1 | 0.3 | GO:0003011 | involuntary skeletal muscle contraction(GO:0003011) |
0.1 | 0.5 | GO:1903772 | regulation of viral budding via host ESCRT complex(GO:1903772) |
0.1 | 0.1 | GO:0051890 | regulation of cardioblast differentiation(GO:0051890) |
0.1 | 0.3 | GO:0034395 | regulation of transcription from RNA polymerase II promoter in response to iron(GO:0034395) |
0.1 | 0.4 | GO:0033030 | negative regulation of neutrophil apoptotic process(GO:0033030) |
0.1 | 0.7 | GO:0060613 | fat pad development(GO:0060613) |
0.1 | 0.5 | GO:1900029 | positive regulation of ruffle assembly(GO:1900029) |
0.1 | 0.7 | GO:1901339 | regulation of store-operated calcium channel activity(GO:1901339) |
0.1 | 0.7 | GO:0032229 | negative regulation of synaptic transmission, GABAergic(GO:0032229) |
0.1 | 0.7 | GO:0090206 | negative regulation of cholesterol biosynthetic process(GO:0045541) negative regulation of cholesterol metabolic process(GO:0090206) |
0.1 | 0.1 | GO:0070170 | regulation of tooth mineralization(GO:0070170) |
0.1 | 0.4 | GO:1903215 | negative regulation of protein targeting to mitochondrion(GO:1903215) |
0.1 | 0.5 | GO:0048312 | intracellular distribution of mitochondria(GO:0048312) |
0.1 | 0.3 | GO:0042222 | interleukin-1 biosynthetic process(GO:0042222) |
0.1 | 0.5 | GO:0046013 | T cell homeostatic proliferation(GO:0001777) regulation of T cell homeostatic proliferation(GO:0046013) |
0.1 | 0.3 | GO:0002331 | pre-B cell allelic exclusion(GO:0002331) |
0.1 | 0.4 | GO:0035106 | operant conditioning(GO:0035106) |
0.1 | 1.0 | GO:1904869 | protein localization to nuclear body(GO:1903405) protein localization to Cajal body(GO:1904867) regulation of protein localization to Cajal body(GO:1904869) positive regulation of protein localization to Cajal body(GO:1904871) protein localization to nucleoplasm(GO:1990173) |
0.1 | 0.4 | GO:0060462 | lung lobe development(GO:0060462) lung lobe morphogenesis(GO:0060463) |
0.1 | 0.3 | GO:0035246 | peptidyl-arginine methylation, to asymmetrical-dimethyl arginine(GO:0019919) peptidyl-arginine N-methylation(GO:0035246) peptidyl-arginine omega-N-methylation(GO:0035247) |
0.1 | 0.6 | GO:0070314 | G1 to G0 transition(GO:0070314) |
0.1 | 3.6 | GO:0043252 | sodium-independent organic anion transport(GO:0043252) |
0.1 | 1.0 | GO:0036065 | fucosylation(GO:0036065) |
0.1 | 0.1 | GO:0072182 | regulation of nephron tubule epithelial cell differentiation(GO:0072182) |
0.1 | 0.3 | GO:1901529 | positive regulation of anion channel activity(GO:1901529) |
0.1 | 0.1 | GO:0035090 | maintenance of apical/basal cell polarity(GO:0035090) |
0.1 | 0.3 | GO:1902075 | cellular response to salt(GO:1902075) |
0.1 | 0.4 | GO:0015746 | tricarboxylic acid transport(GO:0006842) citrate transport(GO:0015746) |
0.1 | 0.4 | GO:0001767 | establishment of lymphocyte polarity(GO:0001767) establishment of T cell polarity(GO:0001768) |
0.1 | 0.4 | GO:0015889 | cobalamin transport(GO:0015889) |
0.1 | 0.1 | GO:0008588 | release of cytoplasmic sequestered NF-kappaB(GO:0008588) |
0.1 | 0.1 | GO:0061438 | renal system vasculature morphogenesis(GO:0061438) kidney vasculature morphogenesis(GO:0061439) |
0.1 | 0.2 | GO:0002378 | immunoglobulin biosynthetic process(GO:0002378) |
0.1 | 0.2 | GO:0006624 | vacuolar protein processing(GO:0006624) |
0.1 | 0.4 | GO:0071374 | cellular response to parathyroid hormone stimulus(GO:0071374) |
0.1 | 0.5 | GO:0010626 | negative regulation of Schwann cell proliferation(GO:0010626) |
0.1 | 1.0 | GO:0032780 | negative regulation of ATPase activity(GO:0032780) |
0.1 | 0.4 | GO:0032383 | regulation of intracellular lipid transport(GO:0032377) regulation of intracellular sterol transport(GO:0032380) regulation of intracellular cholesterol transport(GO:0032383) |
0.1 | 0.1 | GO:0030011 | maintenance of cell polarity(GO:0030011) |
0.1 | 0.4 | GO:0031117 | positive regulation of microtubule depolymerization(GO:0031117) |
0.1 | 0.2 | GO:0043553 | negative regulation of phosphatidylinositol 3-kinase activity(GO:0043553) |
0.1 | 0.7 | GO:0021684 | cerebellar granular layer formation(GO:0021684) cerebellar granule cell differentiation(GO:0021707) |
0.1 | 0.2 | GO:0034333 | adherens junction assembly(GO:0034333) |
0.1 | 0.2 | GO:0042939 | glutathione transport(GO:0034635) tripeptide transport(GO:0042939) |
0.1 | 0.2 | GO:0014042 | positive regulation of neuron maturation(GO:0014042) |
0.1 | 0.1 | GO:0014819 | regulation of skeletal muscle contraction(GO:0014819) |
0.1 | 1.9 | GO:0048843 | negative regulation of axon extension involved in axon guidance(GO:0048843) |
0.1 | 0.1 | GO:0097374 | sensory neuron axon guidance(GO:0097374) |
0.1 | 0.1 | GO:0001998 | angiotensin mediated vasoconstriction involved in regulation of systemic arterial blood pressure(GO:0001998) |
0.1 | 0.1 | GO:0009448 | gamma-aminobutyric acid metabolic process(GO:0009448) |
0.1 | 0.9 | GO:0032957 | inositol trisphosphate metabolic process(GO:0032957) |
0.1 | 0.6 | GO:0071625 | vocalization behavior(GO:0071625) |
0.1 | 1.2 | GO:0019886 | antigen processing and presentation of exogenous peptide antigen via MHC class II(GO:0019886) |
0.1 | 0.9 | GO:2000251 | positive regulation of actin cytoskeleton reorganization(GO:2000251) |
0.1 | 0.3 | GO:0006177 | GMP biosynthetic process(GO:0006177) |
0.1 | 0.6 | GO:0060736 | prostate gland growth(GO:0060736) |
0.1 | 0.5 | GO:0002158 | osteoclast proliferation(GO:0002158) |
0.1 | 0.2 | GO:2000412 | thymocyte migration(GO:0072679) regulation of thymocyte migration(GO:2000410) positive regulation of thymocyte migration(GO:2000412) |
0.1 | 1.4 | GO:0046339 | diacylglycerol metabolic process(GO:0046339) |
0.1 | 0.5 | GO:0097211 | response to gonadotropin-releasing hormone(GO:0097210) cellular response to gonadotropin-releasing hormone(GO:0097211) |
0.1 | 0.3 | GO:0038033 | positive regulation of endothelial cell chemotaxis by VEGF-activated vascular endothelial growth factor receptor signaling pathway(GO:0038033) |
0.1 | 0.1 | GO:0003149 | membranous septum morphogenesis(GO:0003149) |
0.1 | 1.7 | GO:0001937 | negative regulation of endothelial cell proliferation(GO:0001937) |
0.1 | 0.4 | GO:0061154 | endothelial tube morphogenesis(GO:0061154) |
0.1 | 1.0 | GO:0009396 | folic acid-containing compound biosynthetic process(GO:0009396) |
0.1 | 0.9 | GO:0010763 | positive regulation of fibroblast migration(GO:0010763) |
0.1 | 1.0 | GO:0035994 | response to muscle stretch(GO:0035994) |
0.1 | 0.3 | GO:0070164 | negative regulation of adiponectin secretion(GO:0070164) |
0.1 | 0.3 | GO:0061355 | Wnt protein secretion(GO:0061355) regulation of Wnt protein secretion(GO:0061356) |
0.1 | 0.1 | GO:0001945 | lymph vessel development(GO:0001945) |
0.1 | 0.1 | GO:0045163 | clustering of voltage-gated potassium channels(GO:0045163) |
0.1 | 0.5 | GO:0071380 | cellular response to prostaglandin E stimulus(GO:0071380) |
0.1 | 0.4 | GO:0010578 | regulation of adenylate cyclase activity involved in G-protein coupled receptor signaling pathway(GO:0010578) positive regulation of adenylate cyclase activity involved in G-protein coupled receptor signaling pathway(GO:0010579) |
0.1 | 0.8 | GO:0070995 | NADPH oxidation(GO:0070995) |
0.1 | 5.5 | GO:0051965 | positive regulation of synapse assembly(GO:0051965) |
0.1 | 0.1 | GO:0010159 | specification of organ position(GO:0010159) |
0.1 | 0.3 | GO:0043653 | mitochondrial fragmentation involved in apoptotic process(GO:0043653) |
0.1 | 0.3 | GO:0009174 | UMP biosynthetic process(GO:0006222) pyrimidine ribonucleoside monophosphate metabolic process(GO:0009173) pyrimidine ribonucleoside monophosphate biosynthetic process(GO:0009174) UMP metabolic process(GO:0046049) |
0.1 | 0.4 | GO:0090141 | positive regulation of mitochondrial fission(GO:0090141) |
0.1 | 0.3 | GO:0036092 | phosphatidylinositol-3-phosphate biosynthetic process(GO:0036092) |
0.1 | 0.3 | GO:0015959 | diadenosine polyphosphate metabolic process(GO:0015959) |
0.1 | 0.3 | GO:0002370 | natural killer cell cytokine production(GO:0002370) regulation of natural killer cell cytokine production(GO:0002727) |
0.1 | 0.3 | GO:0048014 | Tie signaling pathway(GO:0048014) |
0.1 | 0.8 | GO:0060065 | uterus development(GO:0060065) |
0.1 | 0.2 | GO:0090071 | negative regulation of ribosome biogenesis(GO:0090071) |
0.1 | 0.6 | GO:0002035 | brain renin-angiotensin system(GO:0002035) |
0.1 | 0.4 | GO:0007060 | male meiosis chromosome segregation(GO:0007060) |
0.1 | 0.6 | GO:0015824 | proline transport(GO:0015824) |
0.1 | 0.5 | GO:0070863 | positive regulation of protein exit from endoplasmic reticulum(GO:0070863) |
0.1 | 0.2 | GO:1902896 | terminal web assembly(GO:1902896) |
0.1 | 0.8 | GO:0021978 | telencephalon regionalization(GO:0021978) |
0.1 | 0.2 | GO:0060988 | lipid tube assembly(GO:0060988) |
0.1 | 0.2 | GO:0046098 | guanine metabolic process(GO:0046098) |
0.1 | 0.1 | GO:0090335 | regulation of brown fat cell differentiation(GO:0090335) |
0.1 | 2.4 | GO:0048678 | response to axon injury(GO:0048678) |
0.1 | 0.3 | GO:0006435 | threonyl-tRNA aminoacylation(GO:0006435) |
0.1 | 0.8 | GO:0051043 | regulation of membrane protein ectodomain proteolysis(GO:0051043) |
0.1 | 0.7 | GO:0010216 | maintenance of DNA methylation(GO:0010216) |
0.1 | 0.5 | GO:0030953 | astral microtubule organization(GO:0030953) |
0.1 | 0.3 | GO:0046882 | negative regulation of follicle-stimulating hormone secretion(GO:0046882) |
0.1 | 0.4 | GO:1903799 | negative regulation of production of miRNAs involved in gene silencing by miRNA(GO:1903799) |
0.1 | 0.6 | GO:0035507 | regulation of myosin-light-chain-phosphatase activity(GO:0035507) |
0.1 | 0.5 | GO:0033227 | dsRNA transport(GO:0033227) |
0.1 | 0.6 | GO:0036120 | cellular response to platelet-derived growth factor stimulus(GO:0036120) |
0.1 | 0.2 | GO:0048294 | negative regulation of isotype switching to IgE isotypes(GO:0048294) |
0.1 | 0.1 | GO:0046532 | regulation of photoreceptor cell differentiation(GO:0046532) |
0.1 | 0.7 | GO:0043206 | extracellular fibril organization(GO:0043206) |
0.1 | 0.1 | GO:2001268 | negative regulation of cysteine-type endopeptidase activity involved in apoptotic signaling pathway(GO:2001268) |
0.1 | 0.3 | GO:0015755 | fructose transport(GO:0015755) |
0.1 | 0.2 | GO:0034727 | lysosomal microautophagy(GO:0016237) piecemeal microautophagy of nucleus(GO:0034727) late nucleophagy(GO:0044805) single-organism membrane invagination(GO:1902534) |
0.1 | 0.2 | GO:0060478 | acrosomal vesicle exocytosis(GO:0060478) |
0.1 | 0.6 | GO:0060573 | ventral spinal cord interneuron specification(GO:0021521) cell fate specification involved in pattern specification(GO:0060573) |
0.1 | 0.4 | GO:0042078 | germ-line stem cell division(GO:0042078) male germ-line stem cell asymmetric division(GO:0048133) germline stem cell asymmetric division(GO:0098728) |
0.1 | 0.4 | GO:0019732 | antifungal humoral response(GO:0019732) |
0.1 | 0.9 | GO:1990845 | diet induced thermogenesis(GO:0002024) adaptive thermogenesis(GO:1990845) |
0.1 | 0.4 | GO:0007256 | activation of JNKK activity(GO:0007256) |
0.1 | 0.1 | GO:0002604 | dendritic cell antigen processing and presentation(GO:0002468) regulation of dendritic cell antigen processing and presentation(GO:0002604) |
0.1 | 0.4 | GO:0060155 | platelet dense granule organization(GO:0060155) |
0.1 | 0.3 | GO:0045964 | positive regulation of catecholamine metabolic process(GO:0045915) positive regulation of dopamine metabolic process(GO:0045964) |
0.1 | 0.4 | GO:1903054 | negative regulation of extracellular matrix organization(GO:1903054) |
0.1 | 0.7 | GO:0033089 | positive regulation of T cell differentiation in thymus(GO:0033089) positive regulation of thymocyte aggregation(GO:2000400) |
0.1 | 0.1 | GO:0097623 | potassium ion export across plasma membrane(GO:0097623) |
0.1 | 0.6 | GO:0071044 | histone mRNA catabolic process(GO:0071044) |
0.1 | 0.1 | GO:1904587 | glycoprotein ERAD pathway(GO:0097466) response to glycoprotein(GO:1904587) |
0.1 | 1.2 | GO:0031114 | negative regulation of microtubule depolymerization(GO:0007026) regulation of microtubule depolymerization(GO:0031114) |
0.1 | 0.1 | GO:0021578 | hindbrain maturation(GO:0021578) central nervous system maturation(GO:0021626) |
0.1 | 0.5 | GO:0002227 | innate immune response in mucosa(GO:0002227) |
0.1 | 0.8 | GO:0006622 | protein targeting to lysosome(GO:0006622) |
0.1 | 0.6 | GO:0010759 | positive regulation of macrophage chemotaxis(GO:0010759) |
0.1 | 0.4 | GO:0043116 | negative regulation of vascular permeability(GO:0043116) |
0.1 | 0.3 | GO:1903423 | positive regulation of synaptic vesicle transport(GO:1902805) positive regulation of synaptic vesicle recycling(GO:1903423) |
0.1 | 0.3 | GO:0060312 | regulation of blood vessel remodeling(GO:0060312) |
0.1 | 0.1 | GO:0061738 | late endosomal microautophagy(GO:0061738) |
0.1 | 0.2 | GO:0044026 | DNA hypermethylation(GO:0044026) hypermethylation of CpG island(GO:0044027) |
0.1 | 0.3 | GO:0098908 | regulation of neuronal action potential(GO:0098908) |
0.1 | 0.4 | GO:0043031 | negative regulation of macrophage activation(GO:0043031) |
0.1 | 0.4 | GO:0010758 | regulation of macrophage chemotaxis(GO:0010758) |
0.1 | 0.9 | GO:0045745 | positive regulation of G-protein coupled receptor protein signaling pathway(GO:0045745) |
0.1 | 0.4 | GO:0051031 | tRNA transport(GO:0051031) |
0.1 | 0.1 | GO:0060947 | cardiac vascular smooth muscle cell differentiation(GO:0060947) |
0.1 | 1.5 | GO:0045197 | establishment or maintenance of epithelial cell apical/basal polarity(GO:0045197) |
0.1 | 0.1 | GO:2000564 | regulation of CD8-positive, alpha-beta T cell proliferation(GO:2000564) |
0.1 | 0.2 | GO:0050968 | detection of chemical stimulus involved in sensory perception of pain(GO:0050968) |
0.1 | 1.4 | GO:0035329 | hippo signaling(GO:0035329) |
0.1 | 0.3 | GO:0035513 | oxidative RNA demethylation(GO:0035513) oxidative single-stranded RNA demethylation(GO:0035553) |
0.1 | 0.3 | GO:0002051 | osteoblast fate commitment(GO:0002051) |
0.1 | 0.3 | GO:0032811 | negative regulation of epinephrine secretion(GO:0032811) |
0.1 | 0.3 | GO:0006678 | glucosylceramide metabolic process(GO:0006678) |
0.1 | 0.2 | GO:0045896 | regulation of transcription during mitosis(GO:0045896) positive regulation of transcription during mitosis(GO:0045897) |
0.1 | 0.1 | GO:0060789 | hair follicle placode formation(GO:0060789) |
0.1 | 0.4 | GO:2000035 | regulation of stem cell division(GO:2000035) |
0.1 | 0.2 | GO:1903225 | negative regulation of endodermal cell differentiation(GO:1903225) |
0.1 | 0.1 | GO:2000017 | positive regulation of determination of dorsal identity(GO:2000017) |
0.1 | 1.1 | GO:0048305 | immunoglobulin secretion(GO:0048305) |
0.1 | 0.2 | GO:0051385 | response to mineralocorticoid(GO:0051385) |
0.1 | 0.2 | GO:0045348 | positive regulation of MHC class II biosynthetic process(GO:0045348) |
0.1 | 0.2 | GO:0014733 | regulation of skeletal muscle adaptation(GO:0014733) |
0.1 | 1.8 | GO:0007340 | acrosome reaction(GO:0007340) |
0.1 | 0.5 | GO:0047497 | establishment of mitochondrion localization, microtubule-mediated(GO:0034643) mitochondrion transport along microtubule(GO:0047497) |
0.1 | 0.1 | GO:0045630 | positive regulation of T-helper 2 cell differentiation(GO:0045630) |
0.1 | 1.8 | GO:0007520 | myoblast fusion(GO:0007520) |
0.1 | 0.2 | GO:0007227 | signal transduction downstream of smoothened(GO:0007227) |
0.1 | 0.4 | GO:0098870 | neuronal action potential propagation(GO:0019227) action potential propagation(GO:0098870) |
0.1 | 1.5 | GO:0007214 | gamma-aminobutyric acid signaling pathway(GO:0007214) |
0.1 | 0.2 | GO:0045110 | intermediate filament bundle assembly(GO:0045110) |
0.1 | 0.2 | GO:0071799 | response to prostaglandin D(GO:0071798) cellular response to prostaglandin D stimulus(GO:0071799) |
0.1 | 0.4 | GO:0051005 | negative regulation of lipoprotein lipase activity(GO:0051005) |
0.1 | 0.5 | GO:0007191 | adenylate cyclase-activating dopamine receptor signaling pathway(GO:0007191) |
0.1 | 0.1 | GO:0051654 | establishment of mitochondrion localization(GO:0051654) |
0.1 | 0.1 | GO:1902956 | regulation of mitochondrial electron transport, NADH to ubiquinone(GO:1902956) |
0.1 | 0.2 | GO:0034472 | snRNA 3'-end processing(GO:0034472) |
0.1 | 0.2 | GO:1902744 | negative regulation of lamellipodium organization(GO:1902744) |
0.1 | 0.2 | GO:0021871 | forebrain regionalization(GO:0021871) |
0.1 | 0.6 | GO:0071257 | cellular response to electrical stimulus(GO:0071257) |
0.1 | 0.2 | GO:0001546 | preantral ovarian follicle growth(GO:0001546) multi-layer follicle stage(GO:0048162) |
0.1 | 0.3 | GO:2000508 | regulation of dendritic cell chemotaxis(GO:2000508) |
0.1 | 0.2 | GO:0097694 | establishment of RNA localization to telomere(GO:0097694) |
0.1 | 0.9 | GO:0014850 | response to muscle activity(GO:0014850) |
0.1 | 0.2 | GO:0045085 | negative regulation of interleukin-2 biosynthetic process(GO:0045085) |
0.1 | 0.5 | GO:0016127 | cholesterol catabolic process(GO:0006707) sterol catabolic process(GO:0016127) |
0.1 | 0.1 | GO:0016321 | female meiosis chromosome segregation(GO:0016321) |
0.1 | 0.2 | GO:0090244 | Wnt signaling pathway involved in somitogenesis(GO:0090244) |
0.1 | 0.5 | GO:0090232 | positive regulation of spindle checkpoint(GO:0090232) |
0.1 | 0.2 | GO:0060164 | regulation of timing of neuron differentiation(GO:0060164) |
0.1 | 0.2 | GO:0036010 | protein localization to endosome(GO:0036010) |
0.1 | 0.4 | GO:2000672 | negative regulation of motor neuron apoptotic process(GO:2000672) |
0.1 | 0.2 | GO:0032304 | negative regulation of icosanoid secretion(GO:0032304) |
0.1 | 0.2 | GO:0021681 | cerebellar granular layer development(GO:0021681) |
0.1 | 0.2 | GO:0060287 | epithelial cilium movement involved in determination of left/right asymmetry(GO:0060287) |
0.1 | 0.1 | GO:0035789 | cell migration involved in metanephros development(GO:0035788) metanephric mesenchymal cell migration(GO:0035789) regulation of metanephric mesenchymal cell migration(GO:2000589) |
0.1 | 0.1 | GO:0007171 | activation of transmembrane receptor protein tyrosine kinase activity(GO:0007171) |
0.1 | 0.5 | GO:0010663 | positive regulation of striated muscle cell apoptotic process(GO:0010663) positive regulation of cardiac muscle cell apoptotic process(GO:0010666) |
0.1 | 0.4 | GO:0051497 | negative regulation of actin filament bundle assembly(GO:0032232) negative regulation of stress fiber assembly(GO:0051497) |
0.1 | 0.9 | GO:0090218 | positive regulation of lipid kinase activity(GO:0090218) |
0.1 | 0.2 | GO:0060011 | Sertoli cell proliferation(GO:0060011) |
0.1 | 0.5 | GO:0060394 | negative regulation of pathway-restricted SMAD protein phosphorylation(GO:0060394) |
0.1 | 0.1 | GO:0032488 | Cdc42 protein signal transduction(GO:0032488) |
0.1 | 0.1 | GO:0021569 | rhombomere 3 development(GO:0021569) |
0.1 | 0.5 | GO:0007197 | adenylate cyclase-inhibiting G-protein coupled acetylcholine receptor signaling pathway(GO:0007197) phospholipase C-activating G-protein coupled acetylcholine receptor signaling pathway(GO:0007207) |
0.1 | 0.3 | GO:0034316 | negative regulation of Arp2/3 complex-mediated actin nucleation(GO:0034316) |
0.1 | 0.1 | GO:0060763 | mammary duct terminal end bud growth(GO:0060763) |
0.1 | 0.4 | GO:0050861 | positive regulation of B cell receptor signaling pathway(GO:0050861) |
0.1 | 0.2 | GO:0043305 | negative regulation of mast cell degranulation(GO:0043305) |
0.1 | 0.1 | GO:0010986 | positive regulation of lipoprotein particle clearance(GO:0010986) |
0.1 | 0.4 | GO:0001696 | gastric acid secretion(GO:0001696) |
0.1 | 0.1 | GO:0046958 | nonassociative learning(GO:0046958) |
0.1 | 0.1 | GO:0042891 | antibiotic transport(GO:0042891) |
0.1 | 0.1 | GO:0038128 | ERBB2 signaling pathway(GO:0038128) |
0.1 | 1.3 | GO:2001014 | regulation of skeletal muscle cell differentiation(GO:2001014) |
0.1 | 0.1 | GO:0098528 | skeletal muscle fiber differentiation(GO:0098528) |
0.1 | 0.6 | GO:0009312 | oligosaccharide biosynthetic process(GO:0009312) |
0.1 | 0.1 | GO:0097084 | vascular smooth muscle cell development(GO:0097084) |
0.1 | 0.6 | GO:1901385 | regulation of voltage-gated calcium channel activity(GO:1901385) |
0.1 | 0.2 | GO:0006001 | fructose catabolic process(GO:0006001) fructose catabolic process to hydroxyacetone phosphate and glyceraldehyde-3-phosphate(GO:0061624) glycolytic process through fructose-1-phosphate(GO:0061625) |
0.1 | 0.5 | GO:0002052 | positive regulation of neuroblast proliferation(GO:0002052) |
0.1 | 0.2 | GO:0018243 | protein O-linked glycosylation via threonine(GO:0018243) |
0.1 | 0.3 | GO:0070940 | dephosphorylation of RNA polymerase II C-terminal domain(GO:0070940) |
0.1 | 0.4 | GO:0097120 | receptor localization to synapse(GO:0097120) |
0.1 | 0.3 | GO:0002325 | natural killer cell differentiation involved in immune response(GO:0002325) negative regulation of natural killer cell differentiation(GO:0032824) regulation of natural killer cell differentiation involved in immune response(GO:0032826) negative regulation of natural killer cell differentiation involved in immune response(GO:0032827) |
0.1 | 0.5 | GO:0035584 | calcium-mediated signaling using intracellular calcium source(GO:0035584) |
0.1 | 0.4 | GO:0036303 | lymphangiogenesis(GO:0001946) lymph vessel morphogenesis(GO:0036303) |
0.1 | 0.1 | GO:1901626 | regulation of postsynaptic membrane organization(GO:1901626) |
0.1 | 0.4 | GO:0008063 | Toll signaling pathway(GO:0008063) |
0.1 | 0.2 | GO:0060013 | righting reflex(GO:0060013) |
0.1 | 0.1 | GO:0050932 | regulation of pigment cell differentiation(GO:0050932) |
0.1 | 0.3 | GO:0002070 | epithelial cell maturation(GO:0002070) |
0.1 | 0.3 | GO:0045176 | apical protein localization(GO:0045176) |
0.1 | 0.2 | GO:0055003 | cardiac myofibril assembly(GO:0055003) |
0.1 | 0.1 | GO:1902047 | polyamine transmembrane transport(GO:1902047) regulation of polyamine transmembrane transport(GO:1902267) |
0.1 | 0.1 | GO:0090306 | spindle assembly involved in meiosis(GO:0090306) |
0.1 | 0.1 | GO:0030210 | heparin biosynthetic process(GO:0030210) |
0.1 | 0.1 | GO:0021555 | midbrain-hindbrain boundary morphogenesis(GO:0021555) |
0.1 | 0.5 | GO:0006490 | oligosaccharide-lipid intermediate biosynthetic process(GO:0006490) |
0.1 | 0.2 | GO:0036295 | cellular response to increased oxygen levels(GO:0036295) cellular response to hyperoxia(GO:0071455) |
0.1 | 0.2 | GO:0061484 | hematopoietic stem cell homeostasis(GO:0061484) |
0.1 | 0.1 | GO:1904238 | glomerular mesangial cell differentiation(GO:0072008) glomerular mesangial cell development(GO:0072144) pericyte cell differentiation(GO:1904238) |
0.1 | 0.1 | GO:0002767 | immune response-inhibiting cell surface receptor signaling pathway(GO:0002767) |
0.1 | 0.2 | GO:0021794 | thalamus development(GO:0021794) |
0.1 | 0.2 | GO:0019478 | D-amino acid catabolic process(GO:0019478) |
0.1 | 0.2 | GO:1904694 | negative regulation of vascular smooth muscle contraction(GO:1904694) |
0.1 | 0.2 | GO:0090036 | regulation of protein kinase C signaling(GO:0090036) |
0.1 | 1.6 | GO:0046847 | filopodium assembly(GO:0046847) |
0.1 | 0.5 | GO:0035428 | hexose transmembrane transport(GO:0035428) |
0.1 | 0.1 | GO:1900377 | negative regulation of melanin biosynthetic process(GO:0048022) negative regulation of secondary metabolite biosynthetic process(GO:1900377) |
0.1 | 0.1 | GO:2000543 | positive regulation of gastrulation(GO:2000543) |
0.1 | 0.1 | GO:0002581 | negative regulation of antigen processing and presentation of peptide or polysaccharide antigen via MHC class II(GO:0002581) |
0.1 | 0.2 | GO:0000733 | DNA strand renaturation(GO:0000733) |
0.1 | 0.4 | GO:0030204 | chondroitin sulfate metabolic process(GO:0030204) |
0.1 | 0.1 | GO:0006931 | substrate-dependent cell migration, cell attachment to substrate(GO:0006931) |
0.1 | 0.2 | GO:0034755 | iron ion transmembrane transport(GO:0034755) |
0.1 | 0.1 | GO:0090135 | actin filament branching(GO:0090135) |
0.1 | 0.1 | GO:0060157 | urinary bladder development(GO:0060157) |
0.1 | 0.2 | GO:1902715 | positive regulation of interferon-gamma secretion(GO:1902715) |
0.1 | 0.2 | GO:0051014 | actin filament severing(GO:0051014) |
0.1 | 0.1 | GO:0005984 | disaccharide metabolic process(GO:0005984) |
0.1 | 0.2 | GO:2000409 | positive regulation of T cell extravasation(GO:2000409) |
0.1 | 0.2 | GO:0060482 | lobar bronchus development(GO:0060482) |
0.1 | 0.3 | GO:0030575 | nuclear body organization(GO:0030575) |
0.1 | 0.1 | GO:0003344 | pericardium morphogenesis(GO:0003344) |
0.1 | 0.2 | GO:0060050 | positive regulation of protein glycosylation(GO:0060050) |
0.1 | 0.2 | GO:0060420 | regulation of heart growth(GO:0060420) |
0.1 | 0.2 | GO:0033211 | adiponectin-activated signaling pathway(GO:0033211) |
0.1 | 0.4 | GO:0042760 | very long-chain fatty acid catabolic process(GO:0042760) |
0.1 | 0.1 | GO:0007468 | regulation of rhodopsin gene expression(GO:0007468) |
0.1 | 2.7 | GO:0001578 | microtubule bundle formation(GO:0001578) |
0.1 | 0.1 | GO:0006407 | rRNA export from nucleus(GO:0006407) |
0.1 | 3.0 | GO:0007156 | homophilic cell adhesion via plasma membrane adhesion molecules(GO:0007156) |
0.1 | 0.2 | GO:0045617 | negative regulation of keratinocyte differentiation(GO:0045617) |
0.1 | 0.1 | GO:0035826 | rubidium ion transport(GO:0035826) |
0.1 | 0.1 | GO:0090050 | positive regulation of cell migration involved in sprouting angiogenesis(GO:0090050) |
0.1 | 0.6 | GO:0018298 | protein-chromophore linkage(GO:0018298) |
0.1 | 0.1 | GO:1900020 | regulation of protein kinase C activity(GO:1900019) positive regulation of protein kinase C activity(GO:1900020) |
0.1 | 0.2 | GO:1900004 | regulation of serine-type endopeptidase activity(GO:1900003) negative regulation of serine-type endopeptidase activity(GO:1900004) regulation of serine-type peptidase activity(GO:1902571) negative regulation of serine-type peptidase activity(GO:1902572) |
0.1 | 0.1 | GO:0070305 | response to cGMP(GO:0070305) |
0.1 | 0.3 | GO:0060074 | synapse maturation(GO:0060074) |
0.1 | 0.1 | GO:1903237 | negative regulation of leukocyte tethering or rolling(GO:1903237) |
0.1 | 0.4 | GO:0035025 | positive regulation of Rho protein signal transduction(GO:0035025) |
0.1 | 0.5 | GO:0098743 | cartilage condensation(GO:0001502) cell aggregation(GO:0098743) |
0.1 | 0.2 | GO:0001927 | exocyst assembly(GO:0001927) |
0.1 | 0.6 | GO:0045214 | sarcomere organization(GO:0045214) |
0.1 | 0.1 | GO:0021612 | facial nerve structural organization(GO:0021612) |
0.1 | 0.7 | GO:0010633 | negative regulation of epithelial cell migration(GO:0010633) |
0.1 | 0.1 | GO:0070874 | negative regulation of glycogen metabolic process(GO:0070874) |
0.1 | 0.1 | GO:0071898 | regulation of estrogen receptor binding(GO:0071898) negative regulation of estrogen receptor binding(GO:0071899) |
0.1 | 0.1 | GO:0002540 | leukotriene production involved in inflammatory response(GO:0002540) |
0.0 | 0.2 | GO:0015884 | folic acid transport(GO:0015884) |
0.0 | 0.1 | GO:0019853 | L-ascorbic acid biosynthetic process(GO:0019853) |
0.0 | 0.5 | GO:0033235 | positive regulation of protein sumoylation(GO:0033235) |
0.0 | 0.2 | GO:1904322 | response to forskolin(GO:1904321) cellular response to forskolin(GO:1904322) |
0.0 | 0.2 | GO:0046110 | xanthine metabolic process(GO:0046110) |
0.0 | 0.0 | GO:0071316 | cellular response to nicotine(GO:0071316) |
0.0 | 0.3 | GO:0098719 | sodium ion import(GO:0097369) sodium ion import across plasma membrane(GO:0098719) sodium ion import into cell(GO:1990118) |
0.0 | 0.2 | GO:1903887 | motile primary cilium assembly(GO:1903887) |
0.0 | 0.1 | GO:0042346 | positive regulation of NF-kappaB import into nucleus(GO:0042346) |
0.0 | 0.0 | GO:0043134 | hindgut contraction(GO:0043133) regulation of hindgut contraction(GO:0043134) |
0.0 | 0.2 | GO:0060316 | positive regulation of ryanodine-sensitive calcium-release channel activity(GO:0060316) |
0.0 | 0.0 | GO:0014060 | regulation of epinephrine secretion(GO:0014060) |
0.0 | 0.1 | GO:0071873 | response to norepinephrine(GO:0071873) |
0.0 | 0.0 | GO:0010701 | positive regulation of norepinephrine secretion(GO:0010701) |
0.0 | 0.2 | GO:1904668 | positive regulation of ubiquitin protein ligase activity(GO:1904668) |
0.0 | 0.1 | GO:0044778 | meiotic DNA integrity checkpoint(GO:0044778) |
0.0 | 0.0 | GO:2000407 | regulation of T cell extravasation(GO:2000407) |
0.0 | 0.1 | GO:0060112 | generation of ovulation cycle rhythm(GO:0060112) |
0.0 | 0.4 | GO:0010799 | regulation of peptidyl-threonine phosphorylation(GO:0010799) |
0.0 | 0.0 | GO:0045113 | regulation of integrin biosynthetic process(GO:0045113) |
0.0 | 0.0 | GO:0042271 | susceptibility to natural killer cell mediated cytotoxicity(GO:0042271) |
0.0 | 0.2 | GO:1902626 | assembly of large subunit precursor of preribosome(GO:1902626) |
0.0 | 0.1 | GO:0051459 | regulation of corticotropin secretion(GO:0051459) |
0.0 | 0.1 | GO:0071340 | skeletal muscle acetylcholine-gated channel clustering(GO:0071340) |
0.0 | 0.1 | GO:0034436 | glycoprotein transport(GO:0034436) |
0.0 | 0.1 | GO:0032511 | late endosome to vacuole transport via multivesicular body sorting pathway(GO:0032511) protein targeting to vacuole involved in ubiquitin-dependent protein catabolic process via the multivesicular body sorting pathway(GO:0043328) |
0.0 | 0.1 | GO:1902455 | negative regulation of stem cell population maintenance(GO:1902455) |
0.0 | 0.1 | GO:0008105 | asymmetric protein localization(GO:0008105) |
0.0 | 0.1 | GO:0014717 | regulation of satellite cell activation involved in skeletal muscle regeneration(GO:0014717) satellite cell activation involved in skeletal muscle regeneration(GO:0014901) |
0.0 | 0.1 | GO:0033690 | positive regulation of osteoblast proliferation(GO:0033690) |
0.0 | 0.1 | GO:0010520 | regulation of reciprocal meiotic recombination(GO:0010520) |
0.0 | 0.2 | GO:0043456 | regulation of pentose-phosphate shunt(GO:0043456) |
0.0 | 0.1 | GO:0090526 | regulation of gluconeogenesis involved in cellular glucose homeostasis(GO:0090526) |
0.0 | 0.1 | GO:2000503 | positive regulation of natural killer cell chemotaxis(GO:2000503) |
0.0 | 0.1 | GO:0060024 | rhythmic synaptic transmission(GO:0060024) |
0.0 | 0.5 | GO:0030322 | stabilization of membrane potential(GO:0030322) |
0.0 | 0.3 | GO:0032401 | establishment of melanosome localization(GO:0032401) melanosome transport(GO:0032402) |
0.0 | 0.2 | GO:0000395 | mRNA 5'-splice site recognition(GO:0000395) |
0.0 | 0.2 | GO:0045955 | negative regulation of calcium ion-dependent exocytosis(GO:0045955) |
0.0 | 0.1 | GO:0018879 | biphenyl metabolic process(GO:0018879) |
0.0 | 0.1 | GO:0002930 | trabecular meshwork development(GO:0002930) |
0.0 | 0.2 | GO:0010831 | positive regulation of myotube differentiation(GO:0010831) |
0.0 | 0.0 | GO:0043587 | tongue morphogenesis(GO:0043587) |
0.0 | 0.0 | GO:0060676 | ureteric bud formation(GO:0060676) |
0.0 | 0.2 | GO:2001199 | negative regulation of dendritic cell differentiation(GO:2001199) |
0.0 | 0.1 | GO:1904970 | brush border assembly(GO:1904970) |
0.0 | 0.1 | GO:0033762 | response to glucagon(GO:0033762) |
0.0 | 0.0 | GO:0003010 | voluntary skeletal muscle contraction(GO:0003010) twitch skeletal muscle contraction(GO:0014721) fast-twitch skeletal muscle fiber contraction(GO:0031443) |
0.0 | 0.2 | GO:0043374 | CD8-positive, alpha-beta T cell differentiation(GO:0043374) |
0.0 | 0.0 | GO:0035747 | natural killer cell chemotaxis(GO:0035747) regulation of natural killer cell chemotaxis(GO:2000501) |
0.0 | 0.3 | GO:0032515 | negative regulation of phosphoprotein phosphatase activity(GO:0032515) |
0.0 | 0.1 | GO:1903261 | regulation of serine phosphorylation of STAT3 protein(GO:1903261) |
0.0 | 0.9 | GO:0010107 | potassium ion import(GO:0010107) |
0.0 | 0.4 | GO:0060997 | dendritic spine morphogenesis(GO:0060997) |
0.0 | 0.3 | GO:0051642 | centrosome localization(GO:0051642) |
0.0 | 0.5 | GO:0015858 | nucleoside transport(GO:0015858) |
0.0 | 0.6 | GO:0009409 | response to cold(GO:0009409) |
0.0 | 0.1 | GO:0045627 | positive regulation of T-helper 1 cell differentiation(GO:0045627) |
0.0 | 0.1 | GO:0051725 | protein de-ADP-ribosylation(GO:0051725) |
0.0 | 0.0 | GO:0032025 | response to cobalt ion(GO:0032025) |
0.0 | 0.1 | GO:0033314 | mitotic DNA replication checkpoint(GO:0033314) |
0.0 | 0.1 | GO:0060526 | prostate glandular acinus morphogenesis(GO:0060526) prostate epithelial cord arborization involved in prostate glandular acinus morphogenesis(GO:0060527) |
0.0 | 0.0 | GO:0060648 | mammary gland bud morphogenesis(GO:0060648) |
0.0 | 0.1 | GO:0060124 | positive regulation of growth hormone secretion(GO:0060124) |
0.0 | 0.2 | GO:0042438 | melanin biosynthetic process(GO:0042438) |
0.0 | 0.0 | GO:0060923 | cardiac muscle cell fate commitment(GO:0060923) |
0.0 | 0.1 | GO:0006290 | pyrimidine dimer repair(GO:0006290) |
0.0 | 0.1 | GO:0070366 | regulation of hepatocyte differentiation(GO:0070366) |
0.0 | 0.2 | GO:0060081 | membrane hyperpolarization(GO:0060081) |
0.0 | 0.3 | GO:0018095 | protein polyglutamylation(GO:0018095) |
0.0 | 0.1 | GO:0060347 | heart trabecula formation(GO:0060347) |
0.0 | 0.0 | GO:0060060 | post-embryonic retina morphogenesis in camera-type eye(GO:0060060) |
0.0 | 0.5 | GO:0071475 | cellular hyperosmotic salinity response(GO:0071475) |
0.0 | 0.1 | GO:0035413 | positive regulation of catenin import into nucleus(GO:0035413) |
0.0 | 0.1 | GO:0034093 | positive regulation of maintenance of sister chromatid cohesion(GO:0034093) positive regulation of maintenance of mitotic sister chromatid cohesion(GO:0034184) |
0.0 | 0.1 | GO:0046439 | cysteine catabolic process(GO:0009093) L-cysteine catabolic process(GO:0019448) L-cysteine metabolic process(GO:0046439) |
0.0 | 0.0 | GO:0071313 | cellular response to caffeine(GO:0071313) cellular response to purine-containing compound(GO:0071415) |
0.0 | 0.2 | GO:0042989 | sequestering of actin monomers(GO:0042989) |
0.0 | 0.2 | GO:1903963 | arachidonic acid secretion(GO:0050482) arachidonate transport(GO:1903963) |
0.0 | 0.1 | GO:2001260 | regulation of semaphorin-plexin signaling pathway(GO:2001260) |
0.0 | 0.0 | GO:0071864 | positive regulation of cell proliferation in bone marrow(GO:0071864) |
0.0 | 0.1 | GO:0097049 | motor neuron apoptotic process(GO:0097049) regulation of motor neuron apoptotic process(GO:2000671) |
0.0 | 0.0 | GO:0071139 | resolution of recombination intermediates(GO:0071139) |
0.0 | 0.0 | GO:1905097 | regulation of guanyl-nucleotide exchange factor activity(GO:1905097) |
0.0 | 0.6 | GO:0019228 | neuronal action potential(GO:0019228) |
0.0 | 0.1 | GO:0046952 | ketone body catabolic process(GO:0046952) |
0.0 | 0.0 | GO:1903208 | neuron death in response to hydrogen peroxide(GO:0036476) regulation of hydrogen peroxide-induced neuron death(GO:1903207) negative regulation of hydrogen peroxide-induced neuron death(GO:1903208) |
0.0 | 0.1 | GO:0043985 | histone H4-R3 methylation(GO:0043985) |
0.0 | 0.1 | GO:0001834 | trophectodermal cell proliferation(GO:0001834) |
0.0 | 0.1 | GO:1901874 | regulation of post-translational protein modification(GO:1901873) negative regulation of post-translational protein modification(GO:1901874) |
0.0 | 0.0 | GO:2000343 | positive regulation of chemokine (C-X-C motif) ligand 2 production(GO:2000343) |
0.0 | 0.2 | GO:0045056 | transcytosis(GO:0045056) |
0.0 | 0.2 | GO:0090197 | positive regulation of chemokine secretion(GO:0090197) |
0.0 | 0.1 | GO:1900452 | regulation of long term synaptic depression(GO:1900452) |
0.0 | 0.2 | GO:0042790 | transcription of nuclear large rRNA transcript from RNA polymerase I promoter(GO:0042790) |
0.0 | 0.2 | GO:0006517 | protein deglycosylation(GO:0006517) |
0.0 | 0.2 | GO:0035024 | negative regulation of Rho protein signal transduction(GO:0035024) |
0.0 | 0.5 | GO:1900449 | regulation of glutamate receptor signaling pathway(GO:1900449) |
0.0 | 1.5 | GO:0097485 | neuron projection guidance(GO:0097485) |
0.0 | 0.1 | GO:2001206 | positive regulation of osteoclast development(GO:2001206) |
0.0 | 1.0 | GO:0007044 | cell-substrate junction assembly(GO:0007044) |
0.0 | 0.1 | GO:1902774 | late endosome to lysosome transport(GO:1902774) |
0.0 | 0.1 | GO:0098789 | pre-mRNA cleavage required for polyadenylation(GO:0098789) |
0.0 | 0.4 | GO:0007416 | synapse assembly(GO:0007416) |
0.0 | 0.1 | GO:0031579 | membrane raft organization(GO:0031579) |
0.0 | 0.0 | GO:2000696 | regulation of epithelial cell differentiation involved in kidney development(GO:2000696) |
0.0 | 0.1 | GO:0043402 | glucocorticoid mediated signaling pathway(GO:0043402) |
0.0 | 0.0 | GO:2001214 | positive regulation of vasculogenesis(GO:2001214) |
0.0 | 0.0 | GO:0042487 | regulation of odontogenesis of dentin-containing tooth(GO:0042487) |
0.0 | 0.1 | GO:0086005 | ventricular cardiac muscle cell action potential(GO:0086005) |
0.0 | 0.1 | GO:2001258 | negative regulation of cation channel activity(GO:2001258) |
0.0 | 0.1 | GO:0046490 | isopentenyl diphosphate biosynthetic process(GO:0009240) isopentenyl diphosphate biosynthetic process, mevalonate pathway(GO:0019287) isopentenyl diphosphate metabolic process(GO:0046490) |
0.0 | 0.1 | GO:0036135 | Schwann cell migration(GO:0036135) regulation of Schwann cell migration(GO:1900147) |
0.0 | 0.1 | GO:0019086 | late viral transcription(GO:0019086) |
0.0 | 0.2 | GO:0002329 | pre-B cell differentiation(GO:0002329) |
0.0 | 0.1 | GO:1901223 | negative regulation of NIK/NF-kappaB signaling(GO:1901223) |
0.0 | 0.0 | GO:0031584 | activation of phospholipase D activity(GO:0031584) |
0.0 | 0.1 | GO:2000774 | positive regulation of cellular senescence(GO:2000774) |
0.0 | 0.1 | GO:0072584 | caveolin-mediated endocytosis(GO:0072584) |
0.0 | 0.2 | GO:0035269 | protein O-linked mannosylation(GO:0035269) |
0.0 | 0.0 | GO:0035262 | gonad morphogenesis(GO:0035262) |
0.0 | 0.4 | GO:0030574 | collagen catabolic process(GO:0030574) |
0.0 | 0.0 | GO:2000721 | positive regulation of transcription from RNA polymerase II promoter involved in smooth muscle cell differentiation(GO:2000721) |
0.0 | 0.0 | GO:0043568 | positive regulation of insulin-like growth factor receptor signaling pathway(GO:0043568) |
0.0 | 0.2 | GO:0036297 | interstrand cross-link repair(GO:0036297) |
0.0 | 0.2 | GO:0048714 | positive regulation of oligodendrocyte differentiation(GO:0048714) |
0.0 | 0.0 | GO:0042414 | epinephrine metabolic process(GO:0042414) |
0.0 | 0.0 | GO:2000427 | positive regulation of apoptotic cell clearance(GO:2000427) |
0.0 | 0.1 | GO:0045950 | negative regulation of mitotic recombination(GO:0045950) |
0.0 | 0.1 | GO:1900273 | positive regulation of long-term synaptic potentiation(GO:1900273) |
0.0 | 0.0 | GO:0071866 | regulation of apoptotic process in bone marrow(GO:0071865) negative regulation of apoptotic process in bone marrow(GO:0071866) |
0.0 | 0.0 | GO:1902570 | protein localization to nucleolus(GO:1902570) |
0.0 | 0.3 | GO:0051153 | regulation of striated muscle cell differentiation(GO:0051153) |
0.0 | 0.0 | GO:1900242 | regulation of synaptic vesicle endocytosis(GO:1900242) |
0.0 | 0.0 | GO:0030205 | dermatan sulfate metabolic process(GO:0030205) |
0.0 | 0.1 | GO:0035964 | COPI-coated vesicle budding(GO:0035964) |
0.0 | 0.1 | GO:0060177 | regulation of angiotensin metabolic process(GO:0060177) |
0.0 | 0.1 | GO:0042998 | positive regulation of Golgi to plasma membrane protein transport(GO:0042998) |
0.0 | 0.0 | GO:0045404 | positive regulation of interleukin-4 biosynthetic process(GO:0045404) |
0.0 | 0.0 | GO:0002407 | dendritic cell chemotaxis(GO:0002407) |
0.0 | 0.0 | GO:0007440 | foregut morphogenesis(GO:0007440) embryonic foregut morphogenesis(GO:0048617) |
0.0 | 0.0 | GO:0008065 | establishment of blood-nerve barrier(GO:0008065) |
0.0 | 0.0 | GO:0042126 | nitrate metabolic process(GO:0042126) |
0.0 | 0.1 | GO:1902775 | mitochondrial large ribosomal subunit assembly(GO:1902775) |
0.0 | 0.3 | GO:0016601 | Rac protein signal transduction(GO:0016601) |
0.0 | 0.3 | GO:0009813 | flavonoid biosynthetic process(GO:0009813) flavonoid glucuronidation(GO:0052696) |
0.0 | 0.0 | GO:0032277 | negative regulation of gonadotropin secretion(GO:0032277) |
0.0 | 0.0 | GO:0008354 | germ cell migration(GO:0008354) |
0.0 | 0.2 | GO:0034587 | piRNA metabolic process(GO:0034587) |
0.0 | 0.0 | GO:2000402 | negative regulation of lymphocyte migration(GO:2000402) |
0.0 | 0.0 | GO:0097062 | dendritic spine maintenance(GO:0097062) |
0.0 | 0.0 | GO:0021910 | smoothened signaling pathway involved in ventral spinal cord patterning(GO:0021910) |
0.0 | 0.0 | GO:2001204 | regulation of osteoclast development(GO:2001204) |
0.0 | 0.1 | GO:0032196 | transposition(GO:0032196) |
0.0 | 0.0 | GO:0007221 | positive regulation of transcription of Notch receptor target(GO:0007221) |
0.0 | 0.0 | GO:0014010 | Schwann cell proliferation(GO:0014010) |
0.0 | 0.0 | GO:0000320 | re-entry into mitotic cell cycle(GO:0000320) |
0.0 | 0.0 | GO:0042481 | regulation of odontogenesis(GO:0042481) |
0.0 | 0.0 | GO:0021554 | optic nerve development(GO:0021554) |
0.0 | 0.1 | GO:0050916 | sensory perception of sweet taste(GO:0050916) |
0.0 | 0.0 | GO:0060037 | pharyngeal system development(GO:0060037) |
0.0 | 0.0 | GO:0018197 | peptidyl-aspartic acid modification(GO:0018197) |
0.0 | 0.0 | GO:0035089 | establishment of apical/basal cell polarity(GO:0035089) |
0.0 | 0.0 | GO:2000551 | regulation of T-helper 2 cell cytokine production(GO:2000551) |
0.0 | 0.0 | GO:0051794 | regulation of catagen(GO:0051794) |
0.0 | 0.0 | GO:0000101 | sulfur amino acid transport(GO:0000101) |
0.0 | 0.0 | GO:1902445 | regulation of mitochondrial membrane permeability involved in programmed necrotic cell death(GO:1902445) |
0.0 | 0.0 | GO:0048241 | epinephrine transport(GO:0048241) |
0.0 | 0.1 | GO:0030823 | regulation of cGMP metabolic process(GO:0030823) |
0.0 | 0.0 | GO:0061209 | cell proliferation involved in mesonephros development(GO:0061209) |
0.0 | 0.0 | GO:0001732 | formation of cytoplasmic translation initiation complex(GO:0001732) |
0.0 | 0.1 | GO:0010829 | negative regulation of glucose transport(GO:0010829) |
0.0 | 0.0 | GO:0060143 | positive regulation of syncytium formation by plasma membrane fusion(GO:0060143) |
0.0 | 0.0 | GO:0001661 | conditioned taste aversion(GO:0001661) |
0.0 | 0.0 | GO:0051823 | regulation of synapse structural plasticity(GO:0051823) |
0.0 | 0.0 | GO:0090073 | positive regulation of protein homodimerization activity(GO:0090073) |
0.0 | 0.1 | GO:0046548 | retinal rod cell development(GO:0046548) |
0.0 | 0.0 | GO:0072053 | renal inner medulla development(GO:0072053) |
0.0 | 0.0 | GO:0006391 | transcription initiation from mitochondrial promoter(GO:0006391) |
0.0 | 0.1 | GO:1902259 | regulation of delayed rectifier potassium channel activity(GO:1902259) |
0.0 | 0.0 | GO:0070268 | cornification(GO:0070268) |
0.0 | 0.0 | GO:0051305 | chromosome movement towards spindle pole(GO:0051305) |
0.0 | 0.0 | GO:0010387 | COP9 signalosome assembly(GO:0010387) |
0.0 | 0.0 | GO:1901535 | regulation of DNA demethylation(GO:1901535) negative regulation of DNA demethylation(GO:1901536) |
0.0 | 0.1 | GO:0009303 | rRNA transcription(GO:0009303) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
1.2 | 3.7 | GO:0014701 | junctional sarcoplasmic reticulum membrane(GO:0014701) |
1.2 | 4.6 | GO:0005610 | laminin-5 complex(GO:0005610) |
0.9 | 5.5 | GO:0098651 | collagen type IV trimer(GO:0005587) network-forming collagen trimer(GO:0098642) collagen network(GO:0098645) basement membrane collagen trimer(GO:0098651) |
0.9 | 2.6 | GO:0097454 | Schwann cell microvillus(GO:0097454) |
0.8 | 2.5 | GO:0097512 | cardiac myofibril(GO:0097512) |
0.8 | 0.8 | GO:0034679 | integrin alpha9-beta1 complex(GO:0034679) |
0.8 | 1.5 | GO:0043259 | laminin-10 complex(GO:0043259) |
0.8 | 2.3 | GO:0002193 | MAML1-RBP-Jkappa- ICN1 complex(GO:0002193) |
0.8 | 3.1 | GO:0016942 | insulin-like growth factor binding protein complex(GO:0016942) growth factor complex(GO:0036454) insulin-like growth factor ternary complex(GO:0042567) |
0.8 | 2.3 | GO:0005588 | collagen type V trimer(GO:0005588) |
0.7 | 4.4 | GO:1990454 | L-type voltage-gated calcium channel complex(GO:1990454) |
0.7 | 0.7 | GO:0043219 | lateral loop(GO:0043219) |
0.6 | 2.5 | GO:0071953 | elastic fiber(GO:0071953) |
0.6 | 1.8 | GO:0072534 | perineuronal net(GO:0072534) |
0.6 | 4.0 | GO:0044300 | cerebellar mossy fiber(GO:0044300) |
0.5 | 8.3 | GO:0005614 | interstitial matrix(GO:0005614) |
0.5 | 4.5 | GO:0005859 | muscle myosin complex(GO:0005859) |
0.5 | 1.4 | GO:1990812 | growth cone filopodium(GO:1990812) |
0.5 | 2.7 | GO:0005915 | zonula adherens(GO:0005915) |
0.4 | 1.3 | GO:0097487 | multivesicular body, internal vesicle(GO:0097487) |
0.4 | 7.6 | GO:0016327 | apicolateral plasma membrane(GO:0016327) |
0.4 | 0.8 | GO:0016939 | kinesin II complex(GO:0016939) |
0.4 | 0.8 | GO:0044393 | microspike(GO:0044393) |
0.4 | 1.1 | GO:0032585 | multivesicular body membrane(GO:0032585) |
0.4 | 1.1 | GO:0016533 | cyclin-dependent protein kinase 5 holoenzyme complex(GO:0016533) |
0.4 | 3.3 | GO:0044224 | juxtaparanode region of axon(GO:0044224) |
0.4 | 2.5 | GO:0031232 | extrinsic component of external side of plasma membrane(GO:0031232) |
0.3 | 0.7 | GO:0090665 | dystrophin-associated glycoprotein complex(GO:0016010) glycoprotein complex(GO:0090665) |
0.3 | 1.0 | GO:0005594 | collagen type IX trimer(GO:0005594) |
0.3 | 1.0 | GO:0020018 | ciliary pocket(GO:0020016) ciliary pocket membrane(GO:0020018) |
0.3 | 3.0 | GO:0002116 | semaphorin receptor complex(GO:0002116) |
0.3 | 0.3 | GO:0005606 | laminin-1 complex(GO:0005606) |
0.3 | 2.9 | GO:0005583 | fibrillar collagen trimer(GO:0005583) banded collagen fibril(GO:0098643) |
0.3 | 2.9 | GO:0036156 | inner dynein arm(GO:0036156) |
0.3 | 1.0 | GO:0070110 | ciliary neurotrophic factor receptor complex(GO:0070110) |
0.3 | 2.2 | GO:0098563 | integral component of synaptic vesicle membrane(GO:0030285) intrinsic component of synaptic vesicle membrane(GO:0098563) |
0.3 | 1.5 | GO:0045098 | type III intermediate filament(GO:0045098) |
0.3 | 2.6 | GO:0032045 | guanyl-nucleotide exchange factor complex(GO:0032045) |
0.3 | 6.1 | GO:0036379 | striated muscle thin filament(GO:0005865) myofilament(GO:0036379) |
0.3 | 16.0 | GO:0001725 | stress fiber(GO:0001725) contractile actin filament bundle(GO:0097517) |
0.3 | 0.8 | GO:0034274 | Atg12-Atg5-Atg16 complex(GO:0034274) |
0.3 | 1.1 | GO:0070033 | synaptobrevin 2-SNAP-25-syntaxin-1a-complexin II complex(GO:0070033) |
0.3 | 1.1 | GO:0030485 | smooth muscle contractile fiber(GO:0030485) |
0.3 | 2.7 | GO:0043194 | axon initial segment(GO:0043194) |
0.3 | 1.6 | GO:0031258 | lamellipodium membrane(GO:0031258) |
0.3 | 0.8 | GO:0008282 | ATP-sensitive potassium channel complex(GO:0008282) |
0.3 | 2.3 | GO:0031527 | filopodium membrane(GO:0031527) |
0.3 | 0.8 | GO:0097443 | sorting endosome(GO:0097443) |
0.3 | 1.0 | GO:1990851 | Wnt-Frizzled-LRP5/6 complex(GO:1990851) |
0.3 | 0.8 | GO:0034673 | inhibin-betaglycan-ActRII complex(GO:0034673) |
0.2 | 0.7 | GO:0000322 | storage vacuole(GO:0000322) |
0.2 | 1.0 | GO:1990357 | terminal web(GO:1990357) |
0.2 | 2.1 | GO:0008074 | guanylate cyclase complex, soluble(GO:0008074) |
0.2 | 0.7 | GO:1990393 | 3M complex(GO:1990393) |
0.2 | 2.1 | GO:0031143 | pseudopodium(GO:0031143) |
0.2 | 2.4 | GO:0031512 | motile primary cilium(GO:0031512) |
0.2 | 1.1 | GO:0032983 | kainate selective glutamate receptor complex(GO:0032983) |
0.2 | 0.6 | GO:0044316 | cone cell pedicle(GO:0044316) |
0.2 | 0.4 | GO:0033010 | paranodal junction(GO:0033010) |
0.2 | 2.2 | GO:0005641 | nuclear envelope lumen(GO:0005641) |
0.2 | 1.0 | GO:0005927 | muscle tendon junction(GO:0005927) |
0.2 | 1.8 | GO:0042613 | MHC class II protein complex(GO:0042613) |
0.2 | 0.6 | GO:0035749 | myelin sheath adaxonal region(GO:0035749) |
0.2 | 1.7 | GO:0031371 | ubiquitin conjugating enzyme complex(GO:0031371) |
0.2 | 2.1 | GO:0005605 | basal lamina(GO:0005605) |
0.2 | 0.4 | GO:0070765 | gamma-secretase complex(GO:0070765) |
0.2 | 0.6 | GO:0044308 | axonal spine(GO:0044308) |
0.2 | 0.9 | GO:0000220 | vacuolar proton-transporting V-type ATPase, V0 domain(GO:0000220) |
0.2 | 8.8 | GO:0031594 | neuromuscular junction(GO:0031594) |
0.2 | 0.7 | GO:0002189 | ribose phosphate diphosphokinase complex(GO:0002189) |
0.2 | 0.2 | GO:0033093 | Weibel-Palade body(GO:0033093) |
0.2 | 0.5 | GO:0005944 | phosphatidylinositol 3-kinase complex, class IB(GO:0005944) |
0.2 | 0.5 | GO:0043293 | apoptosome(GO:0043293) |
0.2 | 0.3 | GO:0000015 | phosphopyruvate hydratase complex(GO:0000015) |
0.2 | 1.6 | GO:0043034 | costamere(GO:0043034) |
0.2 | 3.6 | GO:0048786 | presynaptic active zone(GO:0048786) |
0.2 | 0.2 | GO:0005593 | FACIT collagen trimer(GO:0005593) |
0.2 | 0.6 | GO:0044462 | cell outer membrane(GO:0009279) cell envelope(GO:0030313) external encapsulating structure part(GO:0044462) |
0.2 | 0.5 | GO:0035355 | Toll-like receptor 2-Toll-like receptor 6 protein complex(GO:0035355) |
0.2 | 0.5 | GO:0071438 | invadopodium membrane(GO:0071438) |
0.2 | 0.8 | GO:0097470 | ribbon synapse(GO:0097470) |
0.2 | 1.8 | GO:0031229 | integral component of nuclear inner membrane(GO:0005639) intrinsic component of nuclear inner membrane(GO:0031229) |
0.2 | 0.9 | GO:0043083 | synaptic cleft(GO:0043083) |
0.1 | 0.4 | GO:0005726 | perichromatin fibrils(GO:0005726) |
0.1 | 0.3 | GO:0032432 | actin filament bundle(GO:0032432) |
0.1 | 2.2 | GO:0032839 | dendrite cytoplasm(GO:0032839) |
0.1 | 0.1 | GO:0033268 | node of Ranvier(GO:0033268) |
0.1 | 0.9 | GO:0005851 | eukaryotic translation initiation factor 2B complex(GO:0005851) |
0.1 | 1.7 | GO:0017146 | NMDA selective glutamate receptor complex(GO:0017146) |
0.1 | 0.6 | GO:0043202 | lysosomal lumen(GO:0043202) |
0.1 | 0.5 | GO:0048237 | rough endoplasmic reticulum lumen(GO:0048237) |
0.1 | 7.6 | GO:0008076 | voltage-gated potassium channel complex(GO:0008076) |
0.1 | 2.2 | GO:0000159 | protein phosphatase type 2A complex(GO:0000159) |
0.1 | 0.5 | GO:0061574 | ASAP complex(GO:0061574) |
0.1 | 2.1 | GO:0000145 | exocyst(GO:0000145) |
0.1 | 0.5 | GO:0070876 | SOSS complex(GO:0070876) |
0.1 | 32.9 | GO:0005578 | proteinaceous extracellular matrix(GO:0005578) |
0.1 | 11.5 | GO:0043204 | perikaryon(GO:0043204) |
0.1 | 0.4 | GO:0005712 | chiasma(GO:0005712) |
0.1 | 0.1 | GO:0060053 | neurofilament cytoskeleton(GO:0060053) |
0.1 | 0.2 | GO:0017071 | intracellular cyclic nucleotide activated cation channel complex(GO:0017071) |
0.1 | 17.2 | GO:0060076 | excitatory synapse(GO:0060076) |
0.1 | 4.9 | GO:0005913 | cell-cell adherens junction(GO:0005913) |
0.1 | 3.3 | GO:0005581 | collagen trimer(GO:0005581) |
0.1 | 5.9 | GO:0031012 | extracellular matrix(GO:0031012) |
0.1 | 0.2 | GO:0071008 | U2-type post-mRNA release spliceosomal complex(GO:0071008) |
0.1 | 0.5 | GO:0031315 | extrinsic component of mitochondrial outer membrane(GO:0031315) |
0.1 | 0.2 | GO:0035748 | myelin sheath abaxonal region(GO:0035748) |
0.1 | 1.4 | GO:0001741 | XY body(GO:0001741) |
0.1 | 5.8 | GO:0031463 | Cul3-RING ubiquitin ligase complex(GO:0031463) |
0.1 | 0.4 | GO:0044322 | endoplasmic reticulum quality control compartment(GO:0044322) |
0.1 | 0.9 | GO:0005832 | chaperonin-containing T-complex(GO:0005832) |
0.1 | 1.2 | GO:0031597 | cytosolic proteasome complex(GO:0031597) |
0.1 | 0.8 | GO:0001520 | outer dense fiber(GO:0001520) |
0.1 | 0.4 | GO:0042629 | mast cell granule(GO:0042629) |
0.1 | 1.3 | GO:0014704 | intercalated disc(GO:0014704) |
0.1 | 0.4 | GO:0032541 | cortical endoplasmic reticulum(GO:0032541) |
0.1 | 0.1 | GO:0035838 | growing cell tip(GO:0035838) |
0.1 | 0.3 | GO:0031265 | CD95 death-inducing signaling complex(GO:0031265) |
0.1 | 0.5 | GO:0016011 | dystroglycan complex(GO:0016011) sarcoglycan complex(GO:0016012) |
0.1 | 0.3 | GO:0000110 | nucleotide-excision repair factor 1 complex(GO:0000110) |
0.1 | 1.0 | GO:0034706 | sodium channel complex(GO:0034706) |
0.1 | 0.1 | GO:0097651 | phosphatidylinositol 3-kinase complex, class I(GO:0097651) |
0.1 | 1.6 | GO:0042734 | presynaptic membrane(GO:0042734) |
0.1 | 0.2 | GO:0090498 | extrinsic component of Golgi membrane(GO:0090498) |
0.1 | 0.7 | GO:0000813 | ESCRT I complex(GO:0000813) |
0.1 | 0.2 | GO:0098984 | asymmetric synapse(GO:0032279) neuron to neuron synapse(GO:0098984) |
0.1 | 0.4 | GO:0033588 | Elongator holoenzyme complex(GO:0033588) |
0.1 | 0.7 | GO:0045263 | proton-transporting ATP synthase complex, coupling factor F(o)(GO:0045263) |
0.1 | 0.6 | GO:0000243 | commitment complex(GO:0000243) |
0.1 | 0.4 | GO:0071004 | U2-type prespliceosome(GO:0071004) |
0.1 | 0.9 | GO:0097431 | mitotic spindle pole(GO:0097431) |
0.1 | 1.1 | GO:1902711 | GABA receptor complex(GO:1902710) GABA-A receptor complex(GO:1902711) |
0.1 | 0.3 | GO:0030877 | beta-catenin destruction complex(GO:0030877) |
0.1 | 0.4 | GO:0071204 | histone pre-mRNA 3'end processing complex(GO:0071204) |
0.1 | 0.4 | GO:0030314 | junctional membrane complex(GO:0030314) |
0.1 | 5.4 | GO:0043296 | apical junction complex(GO:0043296) |
0.1 | 4.9 | GO:0045211 | postsynaptic membrane(GO:0045211) |
0.1 | 2.9 | GO:0043195 | terminal bouton(GO:0043195) |
0.1 | 0.9 | GO:0046930 | pore complex(GO:0046930) |
0.1 | 0.6 | GO:0032426 | stereocilium tip(GO:0032426) |
0.1 | 0.2 | GO:0070939 | Dsl1p complex(GO:0070939) |
0.1 | 0.3 | GO:0046696 | lipopolysaccharide receptor complex(GO:0046696) |
0.1 | 0.2 | GO:0000125 | PCAF complex(GO:0000125) |
0.1 | 0.3 | GO:0034991 | nuclear meiotic cohesin complex(GO:0034991) |
0.1 | 0.4 | GO:0016593 | Cdc73/Paf1 complex(GO:0016593) |
0.1 | 0.2 | GO:0071817 | MMXD complex(GO:0071817) |
0.1 | 2.5 | GO:0005793 | endoplasmic reticulum-Golgi intermediate compartment(GO:0005793) |
0.1 | 3.7 | GO:0070382 | exocytic vesicle(GO:0070382) |
0.1 | 0.3 | GO:0030008 | TRAPP complex(GO:0030008) |
0.1 | 0.2 | GO:0071547 | piP-body(GO:0071547) |
0.1 | 2.1 | GO:0016528 | sarcoplasm(GO:0016528) |
0.0 | 0.9 | GO:0055038 | recycling endosome membrane(GO:0055038) |
0.0 | 0.1 | GO:0035061 | interchromatin granule(GO:0035061) |
0.0 | 0.1 | GO:0033647 | host intracellular organelle(GO:0033647) host intracellular membrane-bounded organelle(GO:0033648) |
0.0 | 0.8 | GO:0005686 | U2 snRNP(GO:0005686) |
0.0 | 0.1 | GO:0000802 | transverse filament(GO:0000802) |
0.0 | 0.1 | GO:0048179 | activin receptor complex(GO:0048179) |
0.0 | 0.2 | GO:0070820 | tertiary granule(GO:0070820) |
0.0 | 0.2 | GO:0070695 | FHF complex(GO:0070695) |
0.0 | 0.0 | GO:0044453 | nuclear membrane part(GO:0044453) |
0.0 | 0.1 | GO:0097342 | ripoptosome(GO:0097342) |
0.0 | 0.1 | GO:0033177 | proton-transporting two-sector ATPase complex, proton-transporting domain(GO:0033177) |
0.0 | 0.1 | GO:0097209 | epidermal lamellar body(GO:0097209) |
0.0 | 0.1 | GO:0071797 | LUBAC complex(GO:0071797) |
0.0 | 0.3 | GO:0005858 | axonemal dynein complex(GO:0005858) |
0.0 | 0.1 | GO:0042589 | zymogen granule membrane(GO:0042589) |
0.0 | 0.1 | GO:0031074 | nucleocytoplasmic shuttling complex(GO:0031074) |
0.0 | 0.1 | GO:0002081 | outer acrosomal membrane(GO:0002081) |
0.0 | 0.0 | GO:0070044 | synaptobrevin 2-SNAP-25-syntaxin-1a complex(GO:0070044) |
0.0 | 0.6 | GO:0098878 | ionotropic glutamate receptor complex(GO:0008328) neurotransmitter receptor complex(GO:0098878) |
0.0 | 0.2 | GO:0008290 | F-actin capping protein complex(GO:0008290) |
0.0 | 0.5 | GO:0000176 | nuclear exosome (RNase complex)(GO:0000176) |
0.0 | 0.1 | GO:1990726 | Lsm1-7-Pat1 complex(GO:1990726) |
0.0 | 0.1 | GO:0071141 | SMAD protein complex(GO:0071141) |
0.0 | 1.0 | GO:0030018 | Z disc(GO:0030018) |
0.0 | 0.2 | GO:0005786 | signal recognition particle, endoplasmic reticulum targeting(GO:0005786) signal recognition particle(GO:0048500) |
0.0 | 0.1 | GO:0045251 | mitochondrial electron transfer flavoprotein complex(GO:0017133) electron transfer flavoprotein complex(GO:0045251) |
0.0 | 0.0 | GO:0070160 | occluding junction(GO:0070160) |
0.0 | 0.1 | GO:0036194 | muscle cell projection(GO:0036194) muscle cell projection membrane(GO:0036195) |
0.0 | 0.1 | GO:0034457 | Mpp10 complex(GO:0034457) |
0.0 | 0.1 | GO:0005796 | Golgi lumen(GO:0005796) |
0.0 | 0.1 | GO:0000137 | Golgi cis cisterna(GO:0000137) |
0.0 | 0.2 | GO:0018995 | host(GO:0018995) host cell part(GO:0033643) host cell(GO:0043657) |
0.0 | 0.1 | GO:0043159 | acrosomal matrix(GO:0043159) |
0.0 | 0.0 | GO:0031084 | BLOC-2 complex(GO:0031084) |
0.0 | 0.1 | GO:0098554 | cytoplasmic side of endoplasmic reticulum membrane(GO:0098554) |
0.0 | 0.2 | GO:0030315 | T-tubule(GO:0030315) |
0.0 | 0.1 | GO:0044615 | nuclear pore nuclear basket(GO:0044615) |
0.0 | 0.0 | GO:0044326 | dendritic spine neck(GO:0044326) |
0.0 | 0.3 | GO:0016235 | aggresome(GO:0016235) |
0.0 | 0.1 | GO:0030677 | nucleolar ribonuclease P complex(GO:0005655) ribonuclease P complex(GO:0030677) multimeric ribonuclease P complex(GO:0030681) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
1.2 | 3.5 | GO:0086056 | voltage-gated calcium channel activity involved in AV node cell action potential(GO:0086056) |
1.1 | 3.2 | GO:0051373 | FATZ binding(GO:0051373) |
1.0 | 3.1 | GO:0035373 | chondroitin sulfate proteoglycan binding(GO:0035373) |
0.9 | 3.7 | GO:0035727 | lysophosphatidic acid binding(GO:0035727) |
0.9 | 0.9 | GO:0003945 | N-acetyllactosamine synthase activity(GO:0003945) |
0.9 | 2.6 | GO:0048763 | calcium-induced calcium release activity(GO:0048763) |
0.8 | 7.0 | GO:0038191 | neuropilin binding(GO:0038191) |
0.7 | 0.7 | GO:0070915 | lysophosphatidic acid receptor activity(GO:0070915) |
0.7 | 3.6 | GO:0001025 | RNA polymerase III transcription factor binding(GO:0001025) |
0.7 | 2.1 | GO:0008073 | ornithine decarboxylase inhibitor activity(GO:0008073) |
0.7 | 2.0 | GO:0008449 | N-acetylglucosamine-6-sulfatase activity(GO:0008449) |
0.7 | 3.3 | GO:0044323 | retinoic acid-responsive element binding(GO:0044323) |
0.6 | 1.8 | GO:0005176 | ErbB-2 class receptor binding(GO:0005176) |
0.6 | 2.4 | GO:0034714 | type III transforming growth factor beta receptor binding(GO:0034714) |
0.6 | 2.3 | GO:0097493 | structural molecule activity conferring elasticity(GO:0097493) |
0.6 | 7.0 | GO:0048407 | platelet-derived growth factor binding(GO:0048407) |
0.6 | 1.7 | GO:0043546 | molybdopterin cofactor binding(GO:0043546) |
0.6 | 1.7 | GO:0031708 | endothelin B receptor binding(GO:0031708) |
0.5 | 1.6 | GO:1902282 | voltage-gated potassium channel activity involved in ventricular cardiac muscle cell action potential repolarization(GO:1902282) |
0.5 | 1.6 | GO:0008475 | procollagen-lysine 5-dioxygenase activity(GO:0008475) |
0.5 | 1.6 | GO:0004687 | myosin light chain kinase activity(GO:0004687) |
0.5 | 1.6 | GO:0048101 | calcium- and calmodulin-regulated 3',5'-cyclic-GMP phosphodiesterase activity(GO:0048101) |
0.5 | 0.5 | GO:0005523 | tropomyosin binding(GO:0005523) |
0.5 | 2.0 | GO:0017162 | aryl hydrocarbon receptor binding(GO:0017162) |
0.5 | 1.5 | GO:0070052 | collagen V binding(GO:0070052) |
0.5 | 5.2 | GO:0004143 | diacylglycerol kinase activity(GO:0004143) |
0.5 | 1.4 | GO:0035939 | microsatellite binding(GO:0035939) |
0.5 | 1.9 | GO:0005042 | netrin receptor activity(GO:0005042) |
0.5 | 0.9 | GO:0030899 | calcium-dependent ATPase activity(GO:0030899) |
0.5 | 6.9 | GO:0050431 | transforming growth factor beta binding(GO:0050431) |
0.5 | 1.4 | GO:2001069 | glycogen binding(GO:2001069) |
0.5 | 0.9 | GO:0004886 | 9-cis retinoic acid receptor activity(GO:0004886) |
0.4 | 1.8 | GO:0005105 | type 1 fibroblast growth factor receptor binding(GO:0005105) |
0.4 | 1.3 | GO:0004470 | malic enzyme activity(GO:0004470) malate dehydrogenase (decarboxylating) (NAD+) activity(GO:0004471) |
0.4 | 1.3 | GO:0016882 | cyclo-ligase activity(GO:0016882) |
0.4 | 1.3 | GO:0005006 | epidermal growth factor-activated receptor activity(GO:0005006) |
0.4 | 0.4 | GO:0072542 | protein phosphatase activator activity(GO:0072542) |
0.4 | 1.7 | GO:0071253 | connexin binding(GO:0071253) |
0.4 | 1.3 | GO:0000702 | oxidized base lesion DNA N-glycosylase activity(GO:0000702) |
0.4 | 1.3 | GO:0030172 | troponin C binding(GO:0030172) |
0.4 | 2.9 | GO:0008046 | axon guidance receptor activity(GO:0008046) |
0.4 | 1.7 | GO:0046923 | ER retention sequence binding(GO:0046923) |
0.4 | 1.2 | GO:0016941 | natriuretic peptide receptor activity(GO:0016941) |
0.4 | 1.6 | GO:0005173 | stem cell factor receptor binding(GO:0005173) |
0.4 | 1.2 | GO:0004515 | nicotinamide-nucleotide adenylyltransferase activity(GO:0000309) nicotinate-nucleotide adenylyltransferase activity(GO:0004515) |
0.4 | 2.8 | GO:0018642 | 3-(3-hydroxyphenyl)propionate hydroxylase activity(GO:0008688) 4-chlorobenzaldehyde oxidase activity(GO:0018471) 3,5-xylenol methylhydroxylase activity(GO:0018630) phenylacetate hydroxylase activity(GO:0018631) 4-nitrophenol 4-monooxygenase activity(GO:0018632) dimethyl sulfide monooxygenase activity(GO:0018633) alpha-pinene monooxygenase [NADH] activity(GO:0018634) 1-hydroxy-2-naphthoate hydroxylase activity(GO:0018637) toluene 4-monooxygenase activity(GO:0018638) xylene monooxygenase activity(GO:0018639) dibenzothiophene monooxygenase activity(GO:0018640) 6-hydroxy-3-methyl-2-oxo-1,2-dihydroquinoline 6-monooxygenase activity(GO:0018641) chlorophenol 4-monooxygenase activity(GO:0018642) carbon disulfide oxygenase activity(GO:0018643) toluene 2-monooxygenase activity(GO:0018644) 1-hydroxy-2-oxolimonene 1,2-monooxygenase activity(GO:0018646) phenanthrene 1,2-monooxygenase activity(GO:0018647) tetrahydrofuran hydroxylase activity(GO:0018649) styrene monooxygenase activity(GO:0018650) toluene-4-sulfonate monooxygenase activity(GO:0018651) toluene-sulfonate methyl-monooxygenase activity(GO:0018652) 3-methyl-2-oxo-1,2-dihydroquinoline 6-monooxygenase activity(GO:0018653) 2-hydroxy-phenylacetate hydroxylase activity(GO:0018654) 2-oxo-delta3-4,5,5-trimethylcyclopentenylacetyl-CoA 1,2-monooxygenase activity(GO:0018655) phenanthrene 3,4-monooxygenase activity(GO:0018656) toluene 3-monooxygenase activity(GO:0018657) 4-hydroxyphenylacetate,NADH:oxygen oxidoreductase (3-hydroxylating) activity(GO:0018660) limonene monooxygenase activity(GO:0019113) 2-methylnaphthalene hydroxylase activity(GO:0034526) 1-methylnaphthalene hydroxylase activity(GO:0034534) bisphenol A hydroxylase A activity(GO:0034560) salicylate 5-hydroxylase activity(GO:0034785) isobutylamine N-hydroxylase activity(GO:0034791) branched-chain dodecylbenzene sulfonate monooxygenase activity(GO:0034802) 3-HSA hydroxylase activity(GO:0034819) 4-hydroxypyridine-3-hydroxylase activity(GO:0034894) 2-octaprenyl-3-methyl-6-methoxy-1,4-benzoquinol hydroxylase activity(GO:0043719) 6-hydroxynicotinate 3-monooxygenase activity(GO:0043731) thalianol hydroxylase activity(GO:0080014) |
0.4 | 1.2 | GO:0008503 | benzodiazepine receptor activity(GO:0008503) |
0.4 | 0.8 | GO:0004897 | ciliary neurotrophic factor receptor activity(GO:0004897) |
0.4 | 2.3 | GO:0051371 | muscle alpha-actinin binding(GO:0051371) |
0.4 | 1.9 | GO:0043184 | vascular endothelial growth factor receptor 2 binding(GO:0043184) |
0.4 | 4.2 | GO:0017154 | semaphorin receptor activity(GO:0017154) |
0.4 | 1.1 | GO:0003708 | retinoic acid receptor activity(GO:0003708) |
0.4 | 2.3 | GO:0048495 | Roundabout binding(GO:0048495) |
0.4 | 0.7 | GO:0019959 | interleukin-8 binding(GO:0019959) |
0.4 | 1.5 | GO:0016401 | palmitoyl-CoA oxidase activity(GO:0016401) |
0.4 | 1.5 | GO:0001875 | lipopolysaccharide receptor activity(GO:0001875) |
0.4 | 1.8 | GO:0003958 | NADPH-hemoprotein reductase activity(GO:0003958) |
0.4 | 1.8 | GO:0048403 | brain-derived neurotrophic factor binding(GO:0048403) |
0.4 | 1.1 | GO:0004699 | calcium-independent protein kinase C activity(GO:0004699) |
0.3 | 0.7 | GO:0005157 | macrophage colony-stimulating factor receptor binding(GO:0005157) |
0.3 | 2.7 | GO:0008599 | protein phosphatase type 1 regulator activity(GO:0008599) |
0.3 | 1.0 | GO:0070579 | methylcytosine dioxygenase activity(GO:0070579) |
0.3 | 9.9 | GO:0017147 | Wnt-protein binding(GO:0017147) |
0.3 | 1.7 | GO:0034481 | chondroitin sulfotransferase activity(GO:0034481) |
0.3 | 1.6 | GO:0086080 | protein binding involved in heterotypic cell-cell adhesion(GO:0086080) |
0.3 | 7.5 | GO:0042056 | chemoattractant activity(GO:0042056) |
0.3 | 2.9 | GO:0008331 | high voltage-gated calcium channel activity(GO:0008331) |
0.3 | 4.2 | GO:0030676 | Rac guanyl-nucleotide exchange factor activity(GO:0030676) |
0.3 | 1.0 | GO:0004924 | oncostatin-M receptor activity(GO:0004924) |
0.3 | 1.0 | GO:0005502 | 11-cis retinal binding(GO:0005502) |
0.3 | 1.0 | GO:0008321 | Ral guanyl-nucleotide exchange factor activity(GO:0008321) |
0.3 | 1.2 | GO:0030911 | TPR domain binding(GO:0030911) |
0.3 | 0.9 | GO:0030144 | alpha-1,6-mannosylglycoprotein 6-beta-N-acetylglucosaminyltransferase activity(GO:0030144) |
0.3 | 0.9 | GO:0071553 | uridine nucleotide receptor activity(GO:0015065) G-protein coupled pyrimidinergic nucleotide receptor activity(GO:0071553) |
0.3 | 3.4 | GO:0044548 | S100 protein binding(GO:0044548) |
0.3 | 0.9 | GO:0000253 | 3-keto sterol reductase activity(GO:0000253) |
0.3 | 1.2 | GO:0015467 | G-protein activated inward rectifier potassium channel activity(GO:0015467) |
0.3 | 0.3 | GO:0005221 | intracellular cyclic nucleotide activated cation channel activity(GO:0005221) cyclic nucleotide-gated ion channel activity(GO:0043855) |
0.3 | 0.9 | GO:0031697 | beta-1 adrenergic receptor binding(GO:0031697) |
0.3 | 0.3 | GO:0005001 | transmembrane receptor protein tyrosine phosphatase activity(GO:0005001) |
0.3 | 0.9 | GO:0047045 | testosterone 17-beta-dehydrogenase (NADP+) activity(GO:0047045) |
0.3 | 0.9 | GO:0004605 | phosphatidate cytidylyltransferase activity(GO:0004605) |
0.3 | 0.9 | GO:0008898 | S-adenosylmethionine-homocysteine S-methyltransferase activity(GO:0008898) |
0.3 | 2.6 | GO:0001206 | transcriptional repressor activity, RNA polymerase II distal enhancer sequence-specific binding(GO:0001206) |
0.3 | 1.2 | GO:0004528 | phosphodiesterase I activity(GO:0004528) |
0.3 | 2.6 | GO:0005068 | transmembrane receptor protein tyrosine kinase adaptor activity(GO:0005068) |
0.3 | 1.7 | GO:0034713 | type I transforming growth factor beta receptor binding(GO:0034713) |
0.3 | 0.9 | GO:0005519 | cytoskeletal regulatory protein binding(GO:0005519) |
0.3 | 3.7 | GO:0050811 | GABA receptor binding(GO:0050811) |
0.3 | 1.1 | GO:0016715 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, reduced ascorbate as one donor, and incorporation of one atom of oxygen(GO:0016715) |
0.3 | 2.0 | GO:0031432 | titin binding(GO:0031432) |
0.3 | 0.6 | GO:0045503 | dynein light chain binding(GO:0045503) |
0.3 | 1.9 | GO:0005452 | inorganic anion exchanger activity(GO:0005452) |
0.3 | 0.8 | GO:0004999 | vasoactive intestinal polypeptide receptor activity(GO:0004999) |
0.3 | 0.3 | GO:0050051 | leukotriene-B4 20-monooxygenase activity(GO:0050051) |
0.3 | 9.6 | GO:0005201 | extracellular matrix structural constituent(GO:0005201) |
0.3 | 3.2 | GO:0031005 | filamin binding(GO:0031005) |
0.3 | 1.1 | GO:0015057 | thrombin receptor activity(GO:0015057) |
0.3 | 4.0 | GO:0004653 | polypeptide N-acetylgalactosaminyltransferase activity(GO:0004653) |
0.3 | 1.6 | GO:0043426 | MRF binding(GO:0043426) |
0.3 | 2.6 | GO:0047555 | 3',5'-cyclic-GMP phosphodiesterase activity(GO:0047555) |
0.3 | 0.8 | GO:0045545 | syndecan binding(GO:0045545) |
0.3 | 0.3 | GO:0043423 | 3-phosphoinositide-dependent protein kinase binding(GO:0043423) |
0.3 | 0.8 | GO:0035673 | oligopeptide transmembrane transporter activity(GO:0035673) |
0.2 | 0.7 | GO:0004351 | glutamate decarboxylase activity(GO:0004351) |
0.2 | 0.7 | GO:0019958 | C-X-C chemokine binding(GO:0019958) |
0.2 | 0.5 | GO:0034648 | histone demethylase activity (H3-dimethyl-K4 specific)(GO:0034648) |
0.2 | 1.5 | GO:0005049 | nuclear export signal receptor activity(GO:0005049) |
0.2 | 1.2 | GO:0042609 | CD4 receptor binding(GO:0042609) |
0.2 | 1.0 | GO:0015272 | ATP-activated inward rectifier potassium channel activity(GO:0015272) |
0.2 | 1.0 | GO:0034056 | estrogen response element binding(GO:0034056) |
0.2 | 1.0 | GO:0008486 | diphosphoinositol-polyphosphate diphosphatase activity(GO:0008486) |
0.2 | 1.2 | GO:0003847 | 1-alkyl-2-acetylglycerophosphocholine esterase activity(GO:0003847) |
0.2 | 1.0 | GO:0061665 | SUMO ligase activity(GO:0061665) |
0.2 | 0.2 | GO:0005025 | transforming growth factor beta receptor activity, type I(GO:0005025) |
0.2 | 0.2 | GO:0070097 | delta-catenin binding(GO:0070097) |
0.2 | 2.9 | GO:0043539 | protein serine/threonine kinase activator activity(GO:0043539) |
0.2 | 1.1 | GO:0008467 | [heparan sulfate]-glucosamine 3-sulfotransferase 1 activity(GO:0008467) |
0.2 | 2.2 | GO:0015026 | coreceptor activity(GO:0015026) |
0.2 | 0.7 | GO:0031014 | troponin T binding(GO:0031014) |
0.2 | 0.9 | GO:0030942 | endoplasmic reticulum signal peptide binding(GO:0030942) |
0.2 | 0.6 | GO:0051032 | nucleic acid transmembrane transporter activity(GO:0051032) RNA transmembrane transporter activity(GO:0051033) |
0.2 | 0.8 | GO:0017034 | Rap guanyl-nucleotide exchange factor activity(GO:0017034) |
0.2 | 2.7 | GO:0008307 | structural constituent of muscle(GO:0008307) |
0.2 | 0.6 | GO:0005030 | neurotrophin receptor activity(GO:0005030) |
0.2 | 21.8 | GO:0008201 | heparin binding(GO:0008201) |
0.2 | 0.8 | GO:0031694 | alpha-2A adrenergic receptor binding(GO:0031694) |
0.2 | 0.6 | GO:0015198 | oligopeptide transporter activity(GO:0015198) |
0.2 | 0.4 | GO:0016880 | acid-ammonia (or amide) ligase activity(GO:0016880) |
0.2 | 1.4 | GO:0004383 | guanylate cyclase activity(GO:0004383) |
0.2 | 5.4 | GO:0042169 | SH2 domain binding(GO:0042169) |
0.2 | 0.6 | GO:0018479 | benzaldehyde dehydrogenase (NAD+) activity(GO:0018479) |
0.2 | 0.9 | GO:0003831 | beta-N-acetylglucosaminylglycopeptide beta-1,4-galactosyltransferase activity(GO:0003831) |
0.2 | 0.5 | GO:0005004 | GPI-linked ephrin receptor activity(GO:0005004) |
0.2 | 2.2 | GO:0070300 | phosphatidic acid binding(GO:0070300) |
0.2 | 0.5 | GO:0015018 | galactosylgalactosylxylosylprotein 3-beta-glucuronosyltransferase activity(GO:0015018) |
0.2 | 0.7 | GO:0004749 | ribose phosphate diphosphokinase activity(GO:0004749) |
0.2 | 0.9 | GO:0004565 | beta-galactosidase activity(GO:0004565) |
0.2 | 0.7 | GO:0008379 | thioredoxin peroxidase activity(GO:0008379) |
0.2 | 0.9 | GO:0004301 | epoxide hydrolase activity(GO:0004301) |
0.2 | 0.3 | GO:0071558 | histone demethylase activity (H3-K27 specific)(GO:0071558) |
0.2 | 0.7 | GO:0008499 | UDP-galactose:beta-N-acetylglucosamine beta-1,3-galactosyltransferase activity(GO:0008499) |
0.2 | 0.9 | GO:0004111 | creatine kinase activity(GO:0004111) |
0.2 | 0.7 | GO:0005275 | amine transmembrane transporter activity(GO:0005275) |
0.2 | 0.2 | GO:0001515 | opioid peptide activity(GO:0001515) |
0.2 | 0.7 | GO:0031750 | D3 dopamine receptor binding(GO:0031750) |
0.2 | 0.7 | GO:0015232 | heme transporter activity(GO:0015232) |
0.2 | 3.2 | GO:0005234 | extracellular-glutamate-gated ion channel activity(GO:0005234) |
0.2 | 2.5 | GO:0016805 | dipeptidase activity(GO:0016805) |
0.2 | 1.0 | GO:0015288 | porin activity(GO:0015288) |
0.2 | 0.8 | GO:0015181 | arginine transmembrane transporter activity(GO:0015181) L-lysine transmembrane transporter activity(GO:0015189) |
0.2 | 0.2 | GO:0005072 | transforming growth factor beta receptor, cytoplasmic mediator activity(GO:0005072) |
0.2 | 0.3 | GO:0070840 | dynein complex binding(GO:0070840) |
0.2 | 4.7 | GO:0001540 | beta-amyloid binding(GO:0001540) |
0.2 | 0.8 | GO:1990254 | keratin filament binding(GO:1990254) |
0.2 | 0.5 | GO:0004517 | nitric-oxide synthase activity(GO:0004517) |
0.2 | 1.0 | GO:0004439 | phosphatidylinositol-4,5-bisphosphate 5-phosphatase activity(GO:0004439) |
0.2 | 0.5 | GO:0008142 | oxysterol binding(GO:0008142) |
0.2 | 1.0 | GO:0004630 | phospholipase D activity(GO:0004630) |
0.2 | 0.6 | GO:0000155 | phosphorelay sensor kinase activity(GO:0000155) |
0.2 | 1.1 | GO:0003680 | AT DNA binding(GO:0003680) |
0.2 | 6.5 | GO:0005518 | collagen binding(GO:0005518) |
0.2 | 1.1 | GO:0015280 | ligand-gated sodium channel activity(GO:0015280) |
0.2 | 2.6 | GO:0005112 | Notch binding(GO:0005112) |
0.2 | 0.6 | GO:0002046 | opsin binding(GO:0002046) |
0.2 | 2.9 | GO:0042805 | actinin binding(GO:0042805) |
0.2 | 3.8 | GO:0004683 | calmodulin-dependent protein kinase activity(GO:0004683) |
0.2 | 0.2 | GO:0072345 | NAADP-sensitive calcium-release channel activity(GO:0072345) |
0.1 | 0.1 | GO:0038181 | bile acid receptor activity(GO:0038181) |
0.1 | 4.2 | GO:0005251 | delayed rectifier potassium channel activity(GO:0005251) |
0.1 | 0.3 | GO:0097109 | neuroligin family protein binding(GO:0097109) |
0.1 | 1.8 | GO:0035497 | cAMP response element binding(GO:0035497) |
0.1 | 0.4 | GO:0008607 | phosphorylase kinase regulator activity(GO:0008607) |
0.1 | 0.3 | GO:0005005 | transmembrane-ephrin receptor activity(GO:0005005) |
0.1 | 2.0 | GO:0055106 | ligase regulator activity(GO:0055103) ubiquitin-protein transferase regulator activity(GO:0055106) |
0.1 | 0.9 | GO:0008140 | cAMP response element binding protein binding(GO:0008140) |
0.1 | 1.0 | GO:0008430 | selenium binding(GO:0008430) |
0.1 | 1.0 | GO:0050072 | m7G(5')pppN diphosphatase activity(GO:0050072) |
0.1 | 0.4 | GO:0008107 | galactoside 2-alpha-L-fucosyltransferase activity(GO:0008107) alpha-(1,2)-fucosyltransferase activity(GO:0031127) |
0.1 | 0.4 | GO:0030160 | GKAP/Homer scaffold activity(GO:0030160) |
0.1 | 0.4 | GO:0097603 | temperature-gated ion channel activity(GO:0097603) |
0.1 | 1.4 | GO:0004983 | neuropeptide Y receptor activity(GO:0004983) |
0.1 | 3.9 | GO:0005245 | voltage-gated calcium channel activity(GO:0005245) |
0.1 | 0.3 | GO:0034988 | Fc-gamma receptor I complex binding(GO:0034988) |
0.1 | 0.8 | GO:0019855 | calcium channel inhibitor activity(GO:0019855) |
0.1 | 0.1 | GO:0048408 | epidermal growth factor binding(GO:0048408) |
0.1 | 0.5 | GO:0032051 | clathrin light chain binding(GO:0032051) |
0.1 | 0.7 | GO:0001588 | dopamine neurotransmitter receptor activity, coupled via Gs(GO:0001588) |
0.1 | 1.6 | GO:0001161 | intronic transcription regulatory region sequence-specific DNA binding(GO:0001161) |
0.1 | 0.4 | GO:0050510 | N-acetylgalactosaminyl-proteoglycan 3-beta-glucuronosyltransferase activity(GO:0050510) |
0.1 | 0.9 | GO:0031681 | G-protein beta-subunit binding(GO:0031681) |
0.1 | 2.5 | GO:0005520 | insulin-like growth factor binding(GO:0005520) |
0.1 | 1.6 | GO:0005313 | L-glutamate transmembrane transporter activity(GO:0005313) |
0.1 | 0.4 | GO:0016936 | galactoside binding(GO:0016936) |
0.1 | 0.4 | GO:0005021 | vascular endothelial growth factor-activated receptor activity(GO:0005021) |
0.1 | 0.4 | GO:0019797 | procollagen-proline 3-dioxygenase activity(GO:0019797) |
0.1 | 0.4 | GO:0016015 | morphogen activity(GO:0016015) |
0.1 | 0.6 | GO:0031628 | opioid receptor binding(GO:0031628) |
0.1 | 0.4 | GO:0015137 | citrate transmembrane transporter activity(GO:0015137) tricarboxylic acid transmembrane transporter activity(GO:0015142) |
0.1 | 1.1 | GO:0042577 | lipid phosphatase activity(GO:0042577) |
0.1 | 0.5 | GO:0008502 | melatonin receptor activity(GO:0008502) |
0.1 | 0.5 | GO:0004985 | opioid receptor activity(GO:0004985) |
0.1 | 3.0 | GO:0015347 | sodium-independent organic anion transmembrane transporter activity(GO:0015347) |
0.1 | 2.6 | GO:0004714 | transmembrane receptor protein tyrosine kinase activity(GO:0004714) |
0.1 | 0.4 | GO:0010997 | anaphase-promoting complex binding(GO:0010997) |
0.1 | 0.2 | GO:0030984 | kininogen binding(GO:0030984) |
0.1 | 0.5 | GO:0005250 | A-type (transient outward) potassium channel activity(GO:0005250) |
0.1 | 1.2 | GO:0005242 | inward rectifier potassium channel activity(GO:0005242) |
0.1 | 0.5 | GO:0004488 | methylenetetrahydrofolate dehydrogenase (NADP+) activity(GO:0004488) |
0.1 | 0.7 | GO:0004716 | receptor signaling protein tyrosine kinase activity(GO:0004716) |
0.1 | 1.0 | GO:0016920 | pyroglutamyl-peptidase activity(GO:0016920) |
0.1 | 0.4 | GO:0016286 | small conductance calcium-activated potassium channel activity(GO:0016286) |
0.1 | 1.1 | GO:0004865 | protein serine/threonine phosphatase inhibitor activity(GO:0004865) |
0.1 | 0.3 | GO:0004937 | alpha1-adrenergic receptor activity(GO:0004937) |
0.1 | 2.1 | GO:0004198 | calcium-dependent cysteine-type endopeptidase activity(GO:0004198) |
0.1 | 1.0 | GO:0016857 | racemase and epimerase activity, acting on carbohydrates and derivatives(GO:0016857) |
0.1 | 1.3 | GO:0043394 | proteoglycan binding(GO:0043394) |
0.1 | 0.2 | GO:0030297 | transmembrane receptor protein tyrosine kinase activator activity(GO:0030297) |
0.1 | 0.5 | GO:0043912 | D-lysine oxidase activity(GO:0043912) |
0.1 | 1.0 | GO:0070700 | BMP receptor binding(GO:0070700) |
0.1 | 0.5 | GO:0004994 | somatostatin receptor activity(GO:0004994) |
0.1 | 2.3 | GO:0046875 | ephrin receptor binding(GO:0046875) |
0.1 | 1.5 | GO:0031402 | sodium ion binding(GO:0031402) |
0.1 | 0.5 | GO:0071723 | lipopeptide binding(GO:0071723) |
0.1 | 0.2 | GO:0008158 | hedgehog receptor activity(GO:0008158) |
0.1 | 0.5 | GO:0001758 | retinal dehydrogenase activity(GO:0001758) |
0.1 | 1.3 | GO:0005092 | GDP-dissociation inhibitor activity(GO:0005092) |
0.1 | 0.8 | GO:0001091 | RNA polymerase II basal transcription factor binding(GO:0001091) |
0.1 | 0.3 | GO:0004829 | threonine-tRNA ligase activity(GO:0004829) |
0.1 | 1.9 | GO:0005227 | calcium activated cation channel activity(GO:0005227) |
0.1 | 0.2 | GO:0030284 | estrogen receptor activity(GO:0030284) |
0.1 | 0.3 | GO:0032137 | guanine/thymine mispair binding(GO:0032137) |
0.1 | 2.6 | GO:0071855 | neuropeptide receptor binding(GO:0071855) |
0.1 | 1.5 | GO:1990939 | ATP-dependent microtubule motor activity(GO:1990939) |
0.1 | 5.3 | GO:0005089 | Rho guanyl-nucleotide exchange factor activity(GO:0005089) |
0.1 | 0.4 | GO:0047499 | calcium-independent phospholipase A2 activity(GO:0047499) |
0.1 | 1.4 | GO:0017049 | GTP-Rho binding(GO:0017049) |
0.1 | 0.5 | GO:0004652 | polynucleotide adenylyltransferase activity(GO:0004652) |
0.1 | 0.5 | GO:0047498 | calcium-dependent phospholipase A2 activity(GO:0047498) |
0.1 | 0.7 | GO:0051864 | histone demethylase activity (H3-K36 specific)(GO:0051864) |
0.1 | 0.3 | GO:0071208 | histone pre-mRNA DCP binding(GO:0071208) |
0.1 | 1.0 | GO:0008191 | metalloendopeptidase inhibitor activity(GO:0008191) |
0.1 | 0.3 | GO:0003726 | double-stranded RNA adenosine deaminase activity(GO:0003726) |
0.1 | 0.4 | GO:0005166 | neurotrophin p75 receptor binding(GO:0005166) |
0.1 | 0.1 | GO:0097108 | hedgehog family protein binding(GO:0097108) |
0.1 | 0.6 | GO:0002151 | G-quadruplex RNA binding(GO:0002151) |
0.1 | 0.4 | GO:0005134 | interleukin-2 receptor binding(GO:0005134) |
0.1 | 0.3 | GO:0030158 | protein xylosyltransferase activity(GO:0030158) |
0.1 | 0.3 | GO:0016649 | electron-transferring-flavoprotein dehydrogenase activity(GO:0004174) oxidoreductase activity, acting on the CH-NH group of donors, quinone or similar compound as acceptor(GO:0016649) |
0.1 | 0.3 | GO:0019834 | phospholipase A2 inhibitor activity(GO:0019834) |
0.1 | 0.4 | GO:0015174 | basic amino acid transmembrane transporter activity(GO:0015174) |
0.1 | 0.3 | GO:0004096 | catalase activity(GO:0004096) |
0.1 | 1.4 | GO:0071837 | HMG box domain binding(GO:0071837) |
0.1 | 0.6 | GO:0047372 | acylglycerol lipase activity(GO:0047372) |
0.1 | 0.4 | GO:0032036 | myosin heavy chain binding(GO:0032036) |
0.1 | 0.1 | GO:0061629 | RNA polymerase II sequence-specific DNA binding transcription factor binding(GO:0061629) |
0.1 | 0.2 | GO:0048030 | disaccharide binding(GO:0048030) |
0.1 | 0.9 | GO:0031701 | angiotensin receptor binding(GO:0031701) |
0.1 | 3.0 | GO:0005044 | scavenger receptor activity(GO:0005044) |
0.1 | 2.2 | GO:0005539 | glycosaminoglycan binding(GO:0005539) |
0.1 | 0.3 | GO:0035515 | oxidative RNA demethylase activity(GO:0035515) |
0.1 | 0.7 | GO:0015193 | L-proline transmembrane transporter activity(GO:0015193) |
0.1 | 0.2 | GO:0098632 | protein binding involved in cell-cell adhesion(GO:0098632) |
0.1 | 0.4 | GO:0004945 | angiotensin type II receptor activity(GO:0004945) |
0.1 | 0.2 | GO:0008184 | glycogen phosphorylase activity(GO:0008184) |
0.1 | 0.2 | GO:0048185 | activin binding(GO:0048185) |
0.1 | 3.1 | GO:0005267 | potassium channel activity(GO:0005267) |
0.1 | 0.5 | GO:0030957 | Tat protein binding(GO:0030957) |
0.1 | 1.4 | GO:0003785 | actin monomer binding(GO:0003785) |
0.1 | 0.2 | GO:0003886 | DNA (cytosine-5-)-methyltransferase activity(GO:0003886) DNA (cytosine-5-)-methyltransferase activity, acting on CpG substrates(GO:0051718) |
0.1 | 0.5 | GO:0032052 | bile acid binding(GO:0032052) |
0.1 | 1.1 | GO:0005521 | lamin binding(GO:0005521) |
0.1 | 0.5 | GO:0033691 | sialic acid binding(GO:0033691) |
0.1 | 0.4 | GO:0061505 | DNA topoisomerase type II (ATP-hydrolyzing) activity(GO:0003918) DNA topoisomerase II activity(GO:0061505) |
0.1 | 0.1 | GO:0016494 | C-X-C chemokine receptor activity(GO:0016494) |
0.1 | 0.2 | GO:0043891 | glyceraldehyde-3-phosphate dehydrogenase (NAD+) (phosphorylating) activity(GO:0004365) glyceraldehyde-3-phosphate dehydrogenase (NAD(P)+) (phosphorylating) activity(GO:0043891) |
0.1 | 0.4 | GO:0031821 | G-protein coupled serotonin receptor binding(GO:0031821) |
0.1 | 0.5 | GO:0016907 | G-protein coupled acetylcholine receptor activity(GO:0016907) |
0.1 | 0.2 | GO:0045295 | gamma-catenin binding(GO:0045295) |
0.1 | 0.1 | GO:0042895 | antibiotic transporter activity(GO:0042895) |
0.1 | 0.2 | GO:0032422 | purine-rich negative regulatory element binding(GO:0032422) |
0.1 | 0.3 | GO:0035241 | protein-arginine omega-N monomethyltransferase activity(GO:0035241) |
0.1 | 0.5 | GO:0004534 | 5'-3' exoribonuclease activity(GO:0004534) |
0.1 | 0.9 | GO:0004890 | GABA-A receptor activity(GO:0004890) |
0.1 | 0.2 | GO:0016635 | oxidoreductase activity, acting on the CH-CH group of donors, quinone or related compound as acceptor(GO:0016635) |
0.1 | 0.7 | GO:0016713 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, reduced iron-sulfur protein as one donor, and incorporation of one atom of oxygen(GO:0016713) |
0.1 | 0.1 | GO:0035325 | Toll-like receptor binding(GO:0035325) |
0.1 | 0.1 | GO:0042979 | ornithine decarboxylase regulator activity(GO:0042979) |
0.1 | 0.2 | GO:0005415 | nucleoside:sodium symporter activity(GO:0005415) |
0.1 | 0.3 | GO:0030229 | very-low-density lipoprotein particle receptor activity(GO:0030229) |
0.1 | 0.3 | GO:0008020 | G-protein coupled photoreceptor activity(GO:0008020) |
0.1 | 0.5 | GO:0008889 | glycerophosphodiester phosphodiesterase activity(GO:0008889) |
0.1 | 0.1 | GO:0001591 | dopamine neurotransmitter receptor activity, coupled via Gi/Go(GO:0001591) |
0.1 | 0.5 | GO:0031957 | very long-chain fatty acid-CoA ligase activity(GO:0031957) |
0.1 | 0.9 | GO:0000146 | microfilament motor activity(GO:0000146) |
0.1 | 0.2 | GO:0055100 | adiponectin binding(GO:0055100) |
0.1 | 0.1 | GO:0050656 | 3'-phosphoadenosine 5'-phosphosulfate binding(GO:0050656) |
0.1 | 1.2 | GO:0001786 | phosphatidylserine binding(GO:0001786) |
0.1 | 0.1 | GO:0005172 | vascular endothelial growth factor receptor binding(GO:0005172) |
0.1 | 0.2 | GO:0000774 | adenyl-nucleotide exchange factor activity(GO:0000774) |
0.1 | 0.1 | GO:0004720 | protein-lysine 6-oxidase activity(GO:0004720) |
0.1 | 16.2 | GO:0003779 | actin binding(GO:0003779) |
0.1 | 0.8 | GO:0005070 | SH3/SH2 adaptor activity(GO:0005070) |
0.1 | 0.6 | GO:0043422 | protein kinase B binding(GO:0043422) |
0.1 | 0.2 | GO:0034235 | GPI anchor binding(GO:0034235) |
0.1 | 0.4 | GO:0035381 | extracellular ATP-gated cation channel activity(GO:0004931) ATP-gated ion channel activity(GO:0035381) |
0.1 | 0.2 | GO:0043262 | adenosine-diphosphatase activity(GO:0043262) |
0.1 | 0.7 | GO:0070064 | proline-rich region binding(GO:0070064) |
0.1 | 0.3 | GO:1990446 | U1 snRNP binding(GO:1990446) |
0.1 | 0.8 | GO:0070628 | proteasome binding(GO:0070628) |
0.1 | 0.1 | GO:0008900 | hydrogen:potassium-exchanging ATPase activity(GO:0008900) |
0.1 | 0.1 | GO:0005347 | ATP transmembrane transporter activity(GO:0005347) |
0.1 | 0.5 | GO:0015279 | store-operated calcium channel activity(GO:0015279) |
0.1 | 0.5 | GO:0051184 | cofactor transporter activity(GO:0051184) |
0.1 | 1.2 | GO:0005212 | structural constituent of eye lens(GO:0005212) |
0.1 | 0.3 | GO:0086006 | voltage-gated sodium channel activity involved in cardiac muscle cell action potential(GO:0086006) |
0.1 | 0.4 | GO:0043023 | ribosomal large subunit binding(GO:0043023) |
0.1 | 0.4 | GO:0005536 | glucose binding(GO:0005536) |
0.1 | 0.2 | GO:0035033 | histone deacetylase regulator activity(GO:0035033) |
0.1 | 0.6 | GO:0070006 | metalloaminopeptidase activity(GO:0070006) |
0.1 | 0.2 | GO:0003953 | NAD+ nucleosidase activity(GO:0003953) |
0.0 | 0.2 | GO:0016018 | cyclosporin A binding(GO:0016018) |
0.0 | 0.3 | GO:0032794 | GTPase activating protein binding(GO:0032794) |
0.0 | 0.1 | GO:0005483 | soluble NSF attachment protein activity(GO:0005483) |
0.0 | 0.6 | GO:0017075 | syntaxin-1 binding(GO:0017075) |
0.0 | 0.2 | GO:0031419 | cobalamin binding(GO:0031419) |
0.0 | 0.2 | GO:0032795 | heterotrimeric G-protein binding(GO:0032795) |
0.0 | 0.3 | GO:0036402 | proteasome-activating ATPase activity(GO:0036402) |
0.0 | 0.8 | GO:0005149 | interleukin-1 receptor binding(GO:0005149) |
0.0 | 4.1 | GO:0004222 | metalloendopeptidase activity(GO:0004222) |
0.0 | 1.0 | GO:0030594 | neurotransmitter receptor activity(GO:0030594) |
0.0 | 0.3 | GO:0050700 | CARD domain binding(GO:0050700) |
0.0 | 0.2 | GO:0103116 | alpha-D-galactofuranose transporter activity(GO:0103116) |
0.0 | 0.1 | GO:1990050 | phosphatidic acid transporter activity(GO:1990050) |
0.0 | 0.5 | GO:0004435 | phosphatidylinositol phospholipase C activity(GO:0004435) |
0.0 | 0.2 | GO:0050786 | RAGE receptor binding(GO:0050786) |
0.0 | 0.1 | GO:0035615 | clathrin adaptor activity(GO:0035615) endocytic adaptor activity(GO:0098748) |
0.0 | 0.1 | GO:0003986 | acetyl-CoA hydrolase activity(GO:0003986) |
0.0 | 0.5 | GO:0016661 | oxidoreductase activity, acting on other nitrogenous compounds as donors(GO:0016661) |
0.0 | 0.1 | GO:0004949 | cannabinoid receptor activity(GO:0004949) |
0.0 | 0.1 | GO:0008329 | signaling pattern recognition receptor activity(GO:0008329) pattern recognition receptor activity(GO:0038187) |
0.0 | 0.2 | GO:0016421 | CoA carboxylase activity(GO:0016421) |
0.0 | 0.2 | GO:0001849 | complement component C1q binding(GO:0001849) |
0.0 | 0.8 | GO:0004032 | alditol:NADP+ 1-oxidoreductase activity(GO:0004032) |
0.0 | 0.2 | GO:0051959 | dynein light intermediate chain binding(GO:0051959) |
0.0 | 0.1 | GO:0008260 | 3-oxoacid CoA-transferase activity(GO:0008260) |
0.0 | 0.1 | GO:0035184 | histone threonine kinase activity(GO:0035184) |
0.0 | 0.0 | GO:0035529 | NADH pyrophosphatase activity(GO:0035529) |
0.0 | 0.0 | GO:0005280 | hydrogen:amino acid symporter activity(GO:0005280) |
0.0 | 0.8 | GO:0005109 | frizzled binding(GO:0005109) |
0.0 | 1.0 | GO:0018721 | N-acetylglucosamine 6-O-sulfotransferase activity(GO:0001517) heparan sulfate 2-O-sulfotransferase activity(GO:0004394) HNK-1 sulfotransferase activity(GO:0016232) heparan sulfate 6-O-sulfotransferase activity(GO:0017095) trans-9R,10R-dihydrodiolphenanthrene sulfotransferase activity(GO:0018721) 1-phenanthrol sulfotransferase activity(GO:0018722) 3-phenanthrol sulfotransferase activity(GO:0018723) 4-phenanthrol sulfotransferase activity(GO:0018724) trans-3,4-dihydrodiolphenanthrene sulfotransferase activity(GO:0018725) 9-phenanthrol sulfotransferase activity(GO:0018726) 2-phenanthrol sulfotransferase activity(GO:0018727) phenanthrol sulfotransferase activity(GO:0019111) 1-hydroxypyrene sulfotransferase activity(GO:0034930) proteoglycan sulfotransferase activity(GO:0050698) cholesterol sulfotransferase activity(GO:0051922) hydroxyjasmonate sulfotransferase activity(GO:0080131) |
0.0 | 0.1 | GO:0005248 | voltage-gated sodium channel activity(GO:0005248) voltage-gated ion channel activity involved in regulation of postsynaptic membrane potential(GO:1905030) |
0.0 | 0.1 | GO:0004104 | cholinesterase activity(GO:0004104) |
0.0 | 0.5 | GO:0016709 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, NAD(P)H as one donor, and incorporation of one atom of oxygen(GO:0016709) |
0.0 | 0.0 | GO:0015922 | aspartate oxidase activity(GO:0015922) |
0.0 | 0.1 | GO:0030619 | U1 snRNA binding(GO:0030619) |
0.0 | 0.1 | GO:0034793 | 3-oxo-2-(2'-pentenyl)cyclopentane-1-octanoic acid CoA ligase activity(GO:0010435) 3-isopropenyl-6-oxoheptanoyl-CoA synthetase activity(GO:0018854) 2-oxo-delta3-4,5,5-trimethylcyclopentenylacetyl-CoA synthetase activity(GO:0018855) benzoyl acetate-CoA ligase activity(GO:0018856) 2,4-dichlorobenzoate-CoA ligase activity(GO:0018857) pivalate-CoA ligase activity(GO:0034783) cyclopropanecarboxylate-CoA ligase activity(GO:0034793) adipate-CoA ligase activity(GO:0034796) citronellyl-CoA ligase activity(GO:0034823) mentha-1,3-dione-CoA ligase activity(GO:0034841) thiophene-2-carboxylate-CoA ligase activity(GO:0034842) 2,4,4-trimethylpentanoate-CoA ligase activity(GO:0034865) cis-2-methyl-5-isopropylhexa-2,5-dienoate-CoA ligase activity(GO:0034942) trans-2-methyl-5-isopropylhexa-2,5-dienoate-CoA ligase activity(GO:0034943) branched-chain acyl-CoA synthetase (ADP-forming) activity(GO:0043759) aryl-CoA synthetase (ADP-forming) activity(GO:0043762) 3-hydroxypropionyl-CoA synthetase activity(GO:0043955) perillic acid:CoA ligase (ADP-forming) activity(GO:0052685) perillic acid:CoA ligase (AMP-forming) activity(GO:0052686) (3R)-3-isopropenyl-6-oxoheptanoate:CoA ligase (ADP-forming) activity(GO:0052687) (3R)-3-isopropenyl-6-oxoheptanoate:CoA ligase (AMP-forming) activity(GO:0052688) pristanate-CoA ligase activity(GO:0070251) malonyl-CoA synthetase activity(GO:0090409) |
0.0 | 0.1 | GO:0046975 | histone methyltransferase activity (H3-K36 specific)(GO:0046975) |
0.0 | 0.6 | GO:0022832 | voltage-gated ion channel activity(GO:0005244) voltage-gated channel activity(GO:0022832) |
0.0 | 0.3 | GO:0071889 | 14-3-3 protein binding(GO:0071889) |
0.0 | 0.0 | GO:0008312 | 7S RNA binding(GO:0008312) |
0.0 | 0.0 | GO:0098821 | BMP receptor activity(GO:0098821) |
0.0 | 0.1 | GO:0004582 | dolichyl-phosphate beta-D-mannosyltransferase activity(GO:0004582) |
0.0 | 1.1 | GO:0005178 | integrin binding(GO:0005178) |
0.0 | 0.1 | GO:0071614 | linoleic acid epoxygenase activity(GO:0071614) |
0.0 | 0.1 | GO:0003846 | 2-acylglycerol O-acyltransferase activity(GO:0003846) |
0.0 | 0.1 | GO:0070087 | chromo shadow domain binding(GO:0070087) |
0.0 | 0.5 | GO:0005080 | protein kinase C binding(GO:0005080) |
0.0 | 0.0 | GO:0030519 | snoRNP binding(GO:0030519) |
0.0 | 0.1 | GO:0001609 | G-protein coupled adenosine receptor activity(GO:0001609) |
0.0 | 0.0 | GO:1990430 | extracellular matrix protein binding(GO:1990430) |
0.0 | 0.0 | GO:0031690 | adrenergic receptor binding(GO:0031690) |
0.0 | 0.1 | GO:0001055 | RNA polymerase II activity(GO:0001055) |
0.0 | 1.0 | GO:0005496 | steroid binding(GO:0005496) |
0.0 | 0.5 | GO:0033038 | bitter taste receptor activity(GO:0033038) |
0.0 | 0.0 | GO:0097200 | cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:0097200) |
0.0 | 0.2 | GO:0001784 | phosphotyrosine binding(GO:0001784) |
0.0 | 0.0 | GO:0019862 | IgA binding(GO:0019862) |
0.0 | 0.1 | GO:0030550 | acetylcholine receptor inhibitor activity(GO:0030550) |
0.0 | 0.0 | GO:0051765 | inositol tetrakisphosphate kinase activity(GO:0051765) |
0.0 | 0.0 | GO:0033829 | O-fucosylpeptide 3-beta-N-acetylglucosaminyltransferase activity(GO:0033829) |
0.0 | 0.1 | GO:0004526 | ribonuclease P activity(GO:0004526) |
0.0 | 0.4 | GO:0017022 | myosin binding(GO:0017022) |
0.0 | 0.2 | GO:0015932 | nucleobase-containing compound transmembrane transporter activity(GO:0015932) |
0.0 | 0.6 | GO:0008013 | beta-catenin binding(GO:0008013) |
0.0 | 0.0 | GO:0032190 | acrosin binding(GO:0032190) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.7 | 8.0 | PID INTEGRIN4 PATHWAY | Alpha6 beta4 integrin-ligand interactions |
0.6 | 6.3 | PID RANBP2 PATHWAY | Sumoylation by RanBP2 regulates transcriptional repression |
0.6 | 0.6 | NABA BASEMENT MEMBRANES | Genes encoding structural components of basement membranes |
0.4 | 0.8 | PID EPHA2 FWD PATHWAY | EPHA2 forward signaling |
0.4 | 1.2 | ST G ALPHA I PATHWAY | G alpha i Pathway |
0.4 | 15.4 | NABA COLLAGENS | Genes encoding collagen proteins |
0.4 | 0.4 | PID S1P S1P3 PATHWAY | S1P3 pathway |
0.3 | 8.8 | PID GLYPICAN 1PATHWAY | Glypican 1 network |
0.3 | 1.0 | PID S1P S1P2 PATHWAY | S1P2 pathway |
0.3 | 9.1 | PID WNT SIGNALING PATHWAY | Wnt signaling network |
0.3 | 0.6 | ST G ALPHA S PATHWAY | G alpha s Pathway |
0.3 | 10.9 | PID RAC1 REG PATHWAY | Regulation of RAC1 activity |
0.3 | 0.3 | PID P38 GAMMA DELTA PATHWAY | Signaling mediated by p38-gamma and p38-delta |
0.3 | 1.1 | PID IL12 STAT4 PATHWAY | IL12 signaling mediated by STAT4 |
0.2 | 10.1 | PID FGF PATHWAY | FGF signaling pathway |
0.2 | 2.2 | PID LYSOPHOSPHOLIPID PATHWAY | LPA receptor mediated events |
0.2 | 0.4 | PID IL8 CXCR1 PATHWAY | IL8- and CXCR1-mediated signaling events |
0.2 | 1.4 | PID VEGF VEGFR PATHWAY | VEGF and VEGFR signaling network |
0.2 | 0.4 | PID ANTHRAX PATHWAY | Cellular roles of Anthrax toxin |
0.2 | 2.2 | PID ERBB NETWORK PATHWAY | ErbB receptor signaling network |
0.2 | 0.4 | PID ECADHERIN KERATINOCYTE PATHWAY | E-cadherin signaling in keratinocytes |
0.2 | 7.4 | PID ECADHERIN STABILIZATION PATHWAY | Stabilization and expansion of the E-cadherin adherens junction |
0.2 | 6.0 | ST WNT BETA CATENIN PATHWAY | Wnt/beta-catenin Pathway |
0.2 | 2.1 | PID SYNDECAN 3 PATHWAY | Syndecan-3-mediated signaling events |
0.2 | 0.7 | ST GRANULE CELL SURVIVAL PATHWAY | Granule Cell Survival Pathway is a specific case of more general PAC1 Receptor Pathway. |
0.2 | 3.4 | PID HEDGEHOG 2PATHWAY | Signaling events mediated by the Hedgehog family |
0.2 | 1.4 | PID KIT PATHWAY | Signaling events mediated by Stem cell factor receptor (c-Kit) |
0.2 | 4.4 | PID RAS PATHWAY | Regulation of Ras family activation |
0.2 | 21.1 | NABA ECM AFFILIATED | Genes encoding proteins affiliated structurally or functionally to extracellular matrix proteins |
0.2 | 0.5 | ST GA12 PATHWAY | G alpha 12 Pathway |
0.1 | 1.6 | PID ALK2 PATHWAY | ALK2 signaling events |
0.1 | 1.2 | PID INTEGRIN A9B1 PATHWAY | Alpha9 beta1 integrin signaling events |
0.1 | 3.2 | PID LIS1 PATHWAY | Lissencephaly gene (LIS1) in neuronal migration and development |
0.1 | 4.0 | PID ILK PATHWAY | Integrin-linked kinase signaling |
0.1 | 20.6 | NABA ECM GLYCOPROTEINS | Genes encoding structural ECM glycoproteins |
0.1 | 1.9 | PID EPHRINB REV PATHWAY | Ephrin B reverse signaling |
0.1 | 0.4 | ST GA13 PATHWAY | G alpha 13 Pathway |
0.1 | 1.5 | PID NCADHERIN PATHWAY | N-cadherin signaling events |
0.1 | 1.0 | PID TRKR PATHWAY | Neurotrophic factor-mediated Trk receptor signaling |
0.1 | 0.3 | PID INTEGRIN A4B1 PATHWAY | Alpha4 beta1 integrin signaling events |
0.1 | 0.9 | PID EPHB FWD PATHWAY | EPHB forward signaling |
0.1 | 3.0 | PID RHOA REG PATHWAY | Regulation of RhoA activity |
0.1 | 2.8 | PID SHP2 PATHWAY | SHP2 signaling |
0.1 | 1.3 | PID UPA UPAR PATHWAY | Urokinase-type plasminogen activator (uPA) and uPAR-mediated signaling |
0.1 | 0.4 | PID PTP1B PATHWAY | Signaling events mediated by PTP1B |
0.1 | 16.6 | NABA ECM REGULATORS | Genes encoding enzymes and their regulators involved in the remodeling of the extracellular matrix |
0.1 | 0.9 | PID PDGFRA PATHWAY | PDGFR-alpha signaling pathway |
0.1 | 1.0 | PID EPHA FWDPATHWAY | EPHA forward signaling |
0.1 | 0.1 | PID MAPK TRK PATHWAY | Trk receptor signaling mediated by the MAPK pathway |
0.1 | 0.7 | PID NETRIN PATHWAY | Netrin-mediated signaling events |
0.1 | 0.1 | ST INTERLEUKIN 4 PATHWAY | Interleukin 4 (IL-4) Pathway |
0.1 | 0.6 | PID P38 MK2 PATHWAY | p38 signaling mediated by MAPKAP kinases |
0.1 | 1.2 | PID HDAC CLASSII PATHWAY | Signaling events mediated by HDAC Class II |
0.1 | 0.2 | ST IL 13 PATHWAY | Interleukin 13 (IL-13) Pathway |
0.1 | 3.1 | PID BETA CATENIN NUC PATHWAY | Regulation of nuclear beta catenin signaling and target gene transcription |
0.1 | 1.5 | SIG REGULATION OF THE ACTIN CYTOSKELETON BY RHO GTPASES | Genes related to regulation of the actin cytoskeleton |
0.1 | 0.4 | SA FAS SIGNALING | The TNF-type receptor Fas induces apoptosis on ligand binding. |
0.0 | 0.4 | PID PS1 PATHWAY | Presenilin action in Notch and Wnt signaling |
0.0 | 0.3 | PID S1P S1P1 PATHWAY | S1P1 pathway |
0.0 | 0.3 | PID AMB2 NEUTROPHILS PATHWAY | amb2 Integrin signaling |
0.0 | 0.1 | PID TCR RAS PATHWAY | Ras signaling in the CD4+ TCR pathway |
0.0 | 0.6 | PID RETINOIC ACID PATHWAY | Retinoic acid receptors-mediated signaling |
0.0 | 0.6 | PID ALPHA SYNUCLEIN PATHWAY | Alpha-synuclein signaling |
0.0 | 0.3 | SA G1 AND S PHASES | Cdk2, 4, and 6 bind cyclin D in G1, while cdk2/cyclin E promotes the G1/S transition. |
0.0 | 0.7 | PID BMP PATHWAY | BMP receptor signaling |
0.0 | 0.0 | PID CXCR3 PATHWAY | CXCR3-mediated signaling events |
0.0 | 4.5 | NABA MATRISOME ASSOCIATED | Ensemble of genes encoding ECM-associated proteins including ECM-affilaited proteins, ECM regulators and secreted factors |
0.0 | 0.1 | PID PI3K PLC TRK PATHWAY | Trk receptor signaling mediated by PI3K and PLC-gamma |
0.0 | 0.1 | PID SMAD2 3PATHWAY | Regulation of cytoplasmic and nuclear SMAD2/3 signaling |
0.0 | 0.4 | NABA CORE MATRISOME | Ensemble of genes encoding core extracellular matrix including ECM glycoproteins, collagens and proteoglycans |
0.0 | 0.2 | PID CIRCADIAN PATHWAY | Circadian rhythm pathway |
0.0 | 0.1 | PID NEPHRIN NEPH1 PATHWAY | Nephrin/Neph1 signaling in the kidney podocyte |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.6 | 6.8 | REACTOME DCC MEDIATED ATTRACTIVE SIGNALING | Genes involved in DCC mediated attractive signaling |
0.6 | 7.8 | REACTOME CRMPS IN SEMA3A SIGNALING | Genes involved in CRMPs in Sema3A signaling |
0.5 | 1.5 | REACTOME SHC MEDIATED SIGNALLING | Genes involved in SHC-mediated signalling |
0.5 | 0.5 | REACTOME SIGNALING BY ERBB2 | Genes involved in Signaling by ERBB2 |
0.4 | 16.9 | REACTOME NCAM1 INTERACTIONS | Genes involved in NCAM1 interactions |
0.4 | 0.4 | REACTOME CD28 DEPENDENT PI3K AKT SIGNALING | Genes involved in CD28 dependent PI3K/Akt signaling |
0.4 | 10.0 | REACTOME STRIATED MUSCLE CONTRACTION | Genes involved in Striated Muscle Contraction |
0.4 | 7.8 | REACTOME SIGNALING BY BMP | Genes involved in Signaling by BMP |
0.3 | 4.4 | REACTOME OTHER SEMAPHORIN INTERACTIONS | Genes involved in Other semaphorin interactions |
0.3 | 3.7 | REACTOME SIGNALING BY FGFR3 MUTANTS | Genes involved in Signaling by FGFR3 mutants |
0.3 | 6.9 | REACTOME NETRIN1 SIGNALING | Genes involved in Netrin-1 signaling |
0.3 | 4.9 | REACTOME MUSCLE CONTRACTION | Genes involved in Muscle contraction |
0.3 | 5.2 | REACTOME EFFECTS OF PIP2 HYDROLYSIS | Genes involved in Effects of PIP2 hydrolysis |
0.3 | 0.3 | REACTOME OLFACTORY SIGNALING PATHWAY | Genes involved in Olfactory Signaling Pathway |
0.3 | 9.2 | REACTOME COLLAGEN FORMATION | Genes involved in Collagen formation |
0.3 | 0.5 | REACTOME SIGNALING BY ACTIVATED POINT MUTANTS OF FGFR1 | Genes involved in Signaling by activated point mutants of FGFR1 |
0.3 | 2.0 | REACTOME IONOTROPIC ACTIVITY OF KAINATE RECEPTORS | Genes involved in Ionotropic activity of Kainate Receptors |
0.2 | 2.9 | REACTOME ADVANCED GLYCOSYLATION ENDPRODUCT RECEPTOR SIGNALING | Genes involved in Advanced glycosylation endproduct receptor signaling |
0.2 | 2.9 | REACTOME GABA A RECEPTOR ACTIVATION | Genes involved in GABA A receptor activation |
0.2 | 0.2 | REACTOME ACYL CHAIN REMODELLING OF PI | Genes involved in Acyl chain remodelling of PI |
0.2 | 0.9 | REACTOME SIGNALING BY EGFR IN CANCER | Genes involved in Signaling by EGFR in Cancer |
0.2 | 0.2 | REACTOME TGF BETA RECEPTOR SIGNALING ACTIVATES SMADS | Genes involved in TGF-beta receptor signaling activates SMADs |
0.2 | 3.6 | REACTOME DOWNREGULATION OF TGF BETA RECEPTOR SIGNALING | Genes involved in Downregulation of TGF-beta receptor signaling |
0.2 | 1.6 | REACTOME SPRY REGULATION OF FGF SIGNALING | Genes involved in Spry regulation of FGF signaling |
0.2 | 4.4 | REACTOME A TETRASACCHARIDE LINKER SEQUENCE IS REQUIRED FOR GAG SYNTHESIS | Genes involved in A tetrasaccharide linker sequence is required for GAG synthesis |
0.2 | 2.1 | REACTOME TANDEM PORE DOMAIN POTASSIUM CHANNELS | Genes involved in Tandem pore domain potassium channels |
0.2 | 3.7 | REACTOME CHONDROITIN SULFATE DERMATAN SULFATE METABOLISM | Genes involved in Chondroitin sulfate/dermatan sulfate metabolism |
0.2 | 2.6 | REACTOME SYNTHESIS OF SUBSTRATES IN N GLYCAN BIOSYTHESIS | Genes involved in Synthesis of substrates in N-glycan biosythesis |
0.2 | 4.1 | REACTOME NITRIC OXIDE STIMULATES GUANYLATE CYCLASE | Genes involved in Nitric oxide stimulates guanylate cyclase |
0.2 | 3.5 | REACTOME SIGNALING BY HIPPO | Genes involved in Signaling by Hippo |
0.2 | 0.4 | REACTOME NGF SIGNALLING VIA TRKA FROM THE PLASMA MEMBRANE | Genes involved in NGF signalling via TRKA from the plasma membrane |
0.2 | 1.7 | REACTOME CIRCADIAN REPRESSION OF EXPRESSION BY REV ERBA | Genes involved in Circadian Repression of Expression by REV-ERBA |
0.2 | 0.3 | REACTOME THROMBOXANE SIGNALLING THROUGH TP RECEPTOR | Genes involved in Thromboxane signalling through TP receptor |
0.2 | 1.9 | REACTOME KERATAN SULFATE DEGRADATION | Genes involved in Keratan sulfate degradation |
0.2 | 7.2 | REACTOME VOLTAGE GATED POTASSIUM CHANNELS | Genes involved in Voltage gated Potassium channels |
0.2 | 3.0 | REACTOME GRB2 EVENTS IN ERBB2 SIGNALING | Genes involved in GRB2 events in ERBB2 signaling |
0.2 | 1.9 | REACTOME CELL EXTRACELLULAR MATRIX INTERACTIONS | Genes involved in Cell-extracellular matrix interactions |
0.2 | 0.2 | REACTOME SIGNALING BY NOTCH3 | Genes involved in Signaling by NOTCH3 |
0.2 | 1.8 | REACTOME RAS ACTIVATION UOPN CA2 INFUX THROUGH NMDA RECEPTOR | Genes involved in Ras activation uopn Ca2+ infux through NMDA receptor |
0.1 | 3.4 | REACTOME ADHERENS JUNCTIONS INTERACTIONS | Genes involved in Adherens junctions interactions |
0.1 | 1.4 | REACTOME BASE FREE SUGAR PHOSPHATE REMOVAL VIA THE SINGLE NUCLEOTIDE REPLACEMENT PATHWAY | Genes involved in Base-free sugar-phosphate removal via the single-nucleotide replacement pathway |
0.1 | 11.1 | REACTOME CLASS B 2 SECRETIN FAMILY RECEPTORS | Genes involved in Class B/2 (Secretin family receptors) |
0.1 | 1.3 | REACTOME BMAL1 CLOCK NPAS2 ACTIVATES CIRCADIAN EXPRESSION | Genes involved in BMAL1:CLOCK/NPAS2 Activates Circadian Expression |
0.1 | 0.4 | REACTOME SEMA3A PLEXIN REPULSION SIGNALING BY INHIBITING INTEGRIN ADHESION | Genes involved in SEMA3A-Plexin repulsion signaling by inhibiting Integrin adhesion |
0.1 | 0.1 | REACTOME MRNA DECAY BY 3 TO 5 EXORIBONUCLEASE | Genes involved in mRNA Decay by 3' to 5' Exoribonuclease |
0.1 | 1.1 | REACTOME SYNTHESIS SECRETION AND INACTIVATION OF GIP | Genes involved in Synthesis, Secretion, and Inactivation of Glucose-dependent Insulinotropic Polypeptide (GIP) |
0.1 | 0.7 | REACTOME OPSINS | Genes involved in Opsins |
0.1 | 2.9 | REACTOME NOTCH1 INTRACELLULAR DOMAIN REGULATES TRANSCRIPTION | Genes involved in NOTCH1 Intracellular Domain Regulates Transcription |
0.1 | 0.2 | REACTOME IL 6 SIGNALING | Genes involved in Interleukin-6 signaling |
0.1 | 0.8 | REACTOME CALNEXIN CALRETICULIN CYCLE | Genes involved in Calnexin/calreticulin cycle |
0.1 | 0.6 | REACTOME PECAM1 INTERACTIONS | Genes involved in PECAM1 interactions |
0.1 | 0.5 | REACTOME NEPHRIN INTERACTIONS | Genes involved in Nephrin interactions |
0.1 | 0.6 | REACTOME LIGAND GATED ION CHANNEL TRANSPORT | Genes involved in Ligand-gated ion channel transport |
0.1 | 7.0 | REACTOME SIGNALING BY RHO GTPASES | Genes involved in Signaling by Rho GTPases |
0.1 | 0.6 | REACTOME INTEGRATION OF ENERGY METABOLISM | Genes involved in Integration of energy metabolism |
0.1 | 0.1 | REACTOME SIGNALING BY FGFR | Genes involved in Signaling by FGFR |
0.1 | 1.8 | REACTOME DEGRADATION OF THE EXTRACELLULAR MATRIX | Genes involved in Degradation of the extracellular matrix |
0.1 | 0.6 | REACTOME DSCAM INTERACTIONS | Genes involved in DSCAM interactions |
0.1 | 0.7 | REACTOME DOPAMINE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Dopamine Neurotransmitter Release Cycle |
0.1 | 0.5 | REACTOME TRANSPORT OF ORGANIC ANIONS | Genes involved in Transport of organic anions |
0.1 | 2.2 | REACTOME CELL JUNCTION ORGANIZATION | Genes involved in Cell junction organization |
0.1 | 1.3 | REACTOME YAP1 AND WWTR1 TAZ STIMULATED GENE EXPRESSION | Genes involved in YAP1- and WWTR1 (TAZ)-stimulated gene expression |
0.1 | 0.3 | REACTOME UNBLOCKING OF NMDA RECEPTOR GLUTAMATE BINDING AND ACTIVATION | Genes involved in Unblocking of NMDA receptor, glutamate binding and activation |
0.1 | 0.1 | REACTOME NFKB IS ACTIVATED AND SIGNALS SURVIVAL | Genes involved in NF-kB is activated and signals survival |
0.1 | 0.1 | REACTOME TGF BETA RECEPTOR SIGNALING IN EMT EPITHELIAL TO MESENCHYMAL TRANSITION | Genes involved in TGF-beta receptor signaling in EMT (epithelial to mesenchymal transition) |
0.1 | 0.1 | REACTOME CREB PHOSPHORYLATION THROUGH THE ACTIVATION OF CAMKII | Genes involved in CREB phosphorylation through the activation of CaMKII |
0.1 | 1.5 | REACTOME POTASSIUM CHANNELS | Genes involved in Potassium Channels |
0.1 | 0.7 | REACTOME HIGHLY CALCIUM PERMEABLE POSTSYNAPTIC NICOTINIC ACETYLCHOLINE RECEPTORS | Genes involved in Highly calcium permeable postsynaptic nicotinic acetylcholine receptors |
0.1 | 0.7 | REACTOME ENDOGENOUS STEROLS | Genes involved in Endogenous sterols |
0.1 | 0.3 | REACTOME SYNTHESIS SECRETION AND DEACYLATION OF GHRELIN | Genes involved in Synthesis, Secretion, and Deacylation of Ghrelin |
0.1 | 0.6 | REACTOME P2Y RECEPTORS | Genes involved in P2Y receptors |
0.1 | 0.3 | REACTOME BETA DEFENSINS | Genes involved in Beta defensins |
0.0 | 0.0 | REACTOME APC C CDC20 MEDIATED DEGRADATION OF MITOTIC PROTEINS | Genes involved in APC/C:Cdc20 mediated degradation of mitotic proteins |
0.0 | 0.4 | REACTOME PHOSPHORYLATION OF CD3 AND TCR ZETA CHAINS | Genes involved in Phosphorylation of CD3 and TCR zeta chains |
0.0 | 1.0 | REACTOME STEROID HORMONES | Genes involved in Steroid hormones |
0.0 | 0.1 | REACTOME BINDING AND ENTRY OF HIV VIRION | Genes involved in Binding and entry of HIV virion |
0.0 | 0.3 | REACTOME ERKS ARE INACTIVATED | Genes involved in ERKs are inactivated |
0.0 | 0.6 | REACTOME DESTABILIZATION OF MRNA BY KSRP | Genes involved in Destabilization of mRNA by KSRP |
0.0 | 0.0 | REACTOME ADP SIGNALLING THROUGH P2RY1 | Genes involved in ADP signalling through P2Y purinoceptor 1 |
0.0 | 0.1 | REACTOME SCF BETA TRCP MEDIATED DEGRADATION OF EMI1 | Genes involved in SCF-beta-TrCP mediated degradation of Emi1 |
0.0 | 0.6 | REACTOME BRANCHED CHAIN AMINO ACID CATABOLISM | Genes involved in Branched-chain amino acid catabolism |
0.0 | 0.1 | REACTOME PLC BETA MEDIATED EVENTS | Genes involved in PLC beta mediated events |
0.0 | 0.5 | REACTOME MYOGENESIS | Genes involved in Myogenesis |
0.0 | 0.2 | REACTOME PROLONGED ERK ACTIVATION EVENTS | Genes involved in Prolonged ERK activation events |
0.0 | 0.3 | REACTOME VEGF LIGAND RECEPTOR INTERACTIONS | Genes involved in VEGF ligand-receptor interactions |
0.0 | 0.6 | REACTOME RNA POL III TRANSCRIPTION TERMINATION | Genes involved in RNA Polymerase III Transcription Termination |
0.0 | 0.5 | REACTOME FORMATION OF TUBULIN FOLDING INTERMEDIATES BY CCT TRIC | Genes involved in Formation of tubulin folding intermediates by CCT/TriC |
0.0 | 0.2 | REACTOME MEMBRANE BINDING AND TARGETTING OF GAG PROTEINS | Genes involved in Membrane binding and targetting of GAG proteins |
0.0 | 0.2 | REACTOME GABA SYNTHESIS RELEASE REUPTAKE AND DEGRADATION | Genes involved in GABA synthesis, release, reuptake and degradation |
0.0 | 0.1 | REACTOME NEGATIVE REGULATION OF THE PI3K AKT NETWORK | Genes involved in Negative regulation of the PI3K/AKT network |
0.0 | 0.0 | REACTOME REGULATION OF GLUCOKINASE BY GLUCOKINASE REGULATORY PROTEIN | Genes involved in Regulation of Glucokinase by Glucokinase Regulatory Protein |
0.0 | 0.1 | REACTOME ACTIVATED POINT MUTANTS OF FGFR2 | Genes involved in Activated point mutants of FGFR2 |
0.0 | 0.0 | REACTOME NEP NS2 INTERACTS WITH THE CELLULAR EXPORT MACHINERY | Genes involved in NEP/NS2 Interacts with the Cellular Export Machinery |
0.0 | 0.1 | REACTOME TIE2 SIGNALING | Genes involved in Tie2 Signaling |
0.0 | 0.2 | REACTOME AMINE DERIVED HORMONES | Genes involved in Amine-derived hormones |
0.0 | 0.1 | REACTOME THE ACTIVATION OF ARYLSULFATASES | Genes involved in The activation of arylsulfatases |
0.0 | 0.5 | REACTOME REGULATION OF INSULIN SECRETION | Genes involved in Regulation of Insulin Secretion |
0.0 | 0.2 | REACTOME N GLYCAN ANTENNAE ELONGATION IN THE MEDIAL TRANS GOLGI | Genes involved in N-glycan antennae elongation in the medial/trans-Golgi |
0.0 | 0.0 | REACTOME ERK MAPK TARGETS | Genes involved in ERK/MAPK targets |
0.0 | 0.2 | REACTOME GAP JUNCTION ASSEMBLY | Genes involved in Gap junction assembly |