Gene Symbol | Gene ID | Gene Info |
---|---|---|
Irf5
|
ENSMUSG00000029771.6 | Irf5 |
Irf6
|
ENSMUSG00000026638.9 | Irf6 |
CRE | Gene | Distance | Association probability | Pearson corr. coef. | P-value | Plot |
---|---|---|---|---|---|---|
Irf5 | chr6_29524032_29524212 | 2503 | 0.166053 | 0.61 | 6.2e-07 | Click! |
Irf5 | chr6_29529159_29529310 | 48 | 0.955892 | 0.54 | 2.4e-05 | Click! |
Irf5 | chr6_29517238_29517408 | 9302 | 0.102499 | 0.51 | 6.8e-05 | Click! |
Irf5 | chr6_29524288_29524439 | 2262 | 0.178959 | 0.40 | 2.3e-03 | Click! |
Irf5 | chr6_29528050_29528201 | 145 | 0.925018 | 0.35 | 8.0e-03 | Click! |
Irf6 | chr1_193153262_193153458 | 206 | 0.898627 | 0.57 | 6.6e-06 | Click! |
Irf6 | chr1_193152702_193153255 | 133 | 0.934552 | 0.56 | 8.9e-06 | Click! |
Irf6 | chr1_193153475_193153651 | 409 | 0.756837 | 0.51 | 8.2e-05 | Click! |
Irf6 | chr1_193153730_193153897 | 659 | 0.577156 | 0.50 | 8.5e-05 | Click! |
Irf6 | chr1_193156175_193156326 | 419 | 0.745927 | 0.49 | 1.5e-04 | Click! |
Move your cursor over a bar to see sample name and corresponding Z-value.
Cis Regulatory Element (CRE) | Target Score | Top associated gene | Gene Info | Distance of CRE to TSS | CRE/Gene association probability |
---|---|---|---|---|---|
chr1_24613351_24614205 | 6.76 |
Gm28437 |
predicted gene 28437 |
193 |
0.69 |
chr11_113014293_113014953 | 4.44 |
2610035D17Rik |
RIKEN cDNA 2610035D17 gene |
158454 |
0.04 |
chr16_73647165_73647368 | 4.16 |
Gm18168 |
predicted gene, 18168 |
43214 |
0.2 |
chr19_55643252_55643620 | 4.02 |
Tcf7l2 |
transcription factor 7 like 2, T cell specific, HMG box |
98384 |
0.08 |
chr12_40023391_40023561 | 3.96 |
Arl4a |
ADP-ribosylation factor-like 4A |
8992 |
0.19 |
chr18_5603185_5603788 | 3.72 |
Zeb1 |
zinc finger E-box binding homeobox 1 |
258 |
0.88 |
chr3_88133282_88133636 | 3.67 |
Mef2d |
myocyte enhancer factor 2D |
8913 |
0.11 |
chr15_74930453_74930628 | 3.47 |
Gm39556 |
predicted gene, 39556 |
1103 |
0.31 |
chr11_118401778_118402151 | 2.84 |
Lgals3bp |
lectin, galactoside-binding, soluble, 3 binding protein |
92 |
0.96 |
chr5_30887859_30888698 | 2.82 |
Agbl5 |
ATP/GTP binding protein-like 5 |
416 |
0.67 |
chr15_97825087_97825519 | 2.82 |
Hdac7 |
histone deacetylase 7 |
6166 |
0.16 |
chr15_97060183_97060372 | 2.76 |
Slc38a4 |
solute carrier family 38, member 4 |
4321 |
0.32 |
chr11_86201495_86201833 | 2.73 |
Brip1os |
BRCA1 interacting protein C-terminal helicase 1, opposite strand |
281 |
0.65 |
chr1_119290612_119290763 | 2.66 |
Gm29456 |
predicted gene 29456 |
36146 |
0.14 |
chr5_3420545_3420714 | 2.61 |
Cdk6 |
cyclin-dependent kinase 6 |
50320 |
0.1 |
chr8_113635379_113635580 | 2.54 |
Mon1b |
MON1 homolog B, secretory traffciking associated |
108 |
0.96 |
chr2_166995521_166996079 | 2.54 |
Stau1 |
staufen double-stranded RNA binding protein 1 |
303 |
0.83 |
chr11_109705801_109705979 | 2.53 |
Fam20a |
family with sequence similarity 20, member A |
16366 |
0.17 |
chr11_88999276_88999500 | 2.52 |
Trim25 |
tripartite motif-containing 25 |
12 |
0.96 |
chr5_23894337_23894488 | 2.49 |
AC117663.1 |
solute carrier family 40 (iron-regulated transporter), member 1 (Slc40a1), pseudogene |
17969 |
0.11 |
chr14_59365472_59365623 | 2.46 |
Phf11d |
PHD finger protein 11D |
77 |
0.96 |
chr15_76119070_76119502 | 2.45 |
Eppk1 |
epiplakin 1 |
909 |
0.34 |
chr19_47311560_47311711 | 2.44 |
Sh3pxd2a |
SH3 and PX domains 2A |
3116 |
0.23 |
chr16_21818710_21818992 | 2.43 |
Map3k13 |
mitogen-activated protein kinase kinase kinase 13 |
7091 |
0.12 |
chr2_34249625_34250031 | 2.40 |
C79798 |
expressed sequence C79798 |
37943 |
0.16 |
chr7_110893979_110894323 | 2.32 |
Gm16336 |
predicted gene 16336 |
10834 |
0.16 |
chr6_38551798_38552474 | 2.25 |
Luc7l2 |
LUC7-like 2 (S. cerevisiae) |
293 |
0.87 |
chr19_11235141_11235292 | 2.20 |
Ms4a12 |
membrane-spanning 4-domains, subfamily A, member 12 |
2768 |
0.17 |
chr3_94953605_94954192 | 2.17 |
Rfx5 |
regulatory factor X, 5 (influences HLA class II expression) |
177 |
0.88 |
chr4_150787186_150787387 | 2.11 |
Gm13049 |
predicted gene 13049 |
38447 |
0.13 |
chr17_36020770_36020975 | 2.10 |
H2-T24 |
histocompatibility 2, T region locus 24 |
312 |
0.69 |
chr3_94650538_94650690 | 2.07 |
Gm10972 |
predicted gene 10972 |
7516 |
0.1 |
chr10_80932223_80932855 | 2.05 |
Gadd45b |
growth arrest and DNA-damage-inducible 45 beta |
1727 |
0.2 |
chr5_99978641_99979012 | 2.04 |
Hnrnpd |
heterogeneous nuclear ribonucleoprotein D |
33 |
0.75 |
chr4_136250109_136250260 | 2.02 |
Tcea3 |
transcription elongation factor A (SII), 3 |
2211 |
0.24 |
chr3_96427385_96427558 | 2.00 |
Gm24136 |
predicted gene, 24136 |
4738 |
0.06 |
chr15_101105800_101105951 | 1.98 |
Ankrd33 |
ankyrin repeat domain 33 |
9880 |
0.12 |
chr2_51941940_51942128 | 1.97 |
Gm13495 |
predicted gene 13495 |
3365 |
0.21 |
chr3_97076558_97076742 | 1.97 |
4930573H18Rik |
RIKEN cDNA 4930573H18 gene |
16135 |
0.15 |
chr4_63561883_63562216 | 1.96 |
Tmem268 |
transmembrane protein 268 |
1689 |
0.24 |
chr15_103240587_103240738 | 1.94 |
Hnrnpa1 |
heterogeneous nuclear ribonucleoprotein A1 |
168 |
0.86 |
chr15_58507689_58507895 | 1.94 |
Fer1l6 |
fer-1-like 6 (C. elegans) |
2256 |
0.37 |
chr1_180403357_180403508 | 1.91 |
Gm36933 |
predicted gene, 36933 |
26988 |
0.12 |
chr3_89458994_89459453 | 1.90 |
Pmvk |
phosphomevalonate kinase |
105 |
0.93 |
chr12_75853443_75853594 | 1.86 |
Syne2 |
spectrin repeat containing, nuclear envelope 2 |
788 |
0.72 |
chr13_59820217_59820403 | 1.83 |
Tut7 |
terminal uridylyl transferase 7 |
2278 |
0.17 |
chr11_121517818_121517969 | 1.83 |
Zfp750 |
zinc finger protein 750 |
1440 |
0.4 |
chr9_114730432_114730583 | 1.83 |
Cmtm6 |
CKLF-like MARVEL transmembrane domain containing 6 |
609 |
0.7 |
chr8_107502990_107503291 | 1.82 |
Wwp2 |
WW domain containing E3 ubiquitin protein ligase 2 |
572 |
0.75 |
chr11_83534788_83534966 | 1.79 |
Ccl5 |
chemokine (C-C motif) ligand 5 |
4359 |
0.12 |
chr7_123369807_123370220 | 1.79 |
Arhgap17 |
Rho GTPase activating protein 17 |
98 |
0.69 |
chr1_171503352_171503875 | 1.77 |
Alyref2 |
Aly/REF export factor 2 |
135 |
0.7 |
chr17_34836344_34837687 | 1.75 |
Dxo |
decapping exoribonuclease |
4 |
0.52 |
chr6_3399411_3399585 | 1.75 |
Samd9l |
sterile alpha motif domain containing 9-like |
74 |
0.97 |
chr2_181241922_181242214 | 1.70 |
Helz2 |
helicase with zinc finger 2, transcriptional coactivator |
41 |
0.95 |
chr2_162930858_162931274 | 1.67 |
Srsf6 |
serine and arginine-rich splicing factor 6 |
462 |
0.73 |
chr11_101551830_101552448 | 1.67 |
Nbr1 |
NBR1, autophagy cargo receptor |
10 |
0.69 |
chr2_119594451_119595035 | 1.66 |
Oip5os1 |
Opa interacting protein 5, opposite strand 1 |
440 |
0.72 |
chr9_50667662_50667813 | 1.65 |
Dlat |
dihydrolipoamide S-acetyltransferase (E2 component of pyruvate dehydrogenase complex) |
7957 |
0.12 |
chr18_3509123_3509283 | 1.64 |
Bambi |
BMP and activin membrane-bound inhibitor |
1280 |
0.39 |
chr8_35825975_35826580 | 1.62 |
Cldn23 |
claudin 23 |
282 |
0.89 |
chr6_134538920_134539095 | 1.62 |
Lrp6 |
low density lipoprotein receptor-related protein 6 |
2707 |
0.28 |
chr15_81523518_81523718 | 1.61 |
Gm5218 |
predicted gene 5218 |
24073 |
0.11 |
chr3_69469886_69470406 | 1.60 |
Ppm1l |
protein phosphatase 1 (formerly 2C)-like |
27067 |
0.17 |
chr16_92475555_92475724 | 1.58 |
2410124H12Rik |
RIKEN cDNA 2410124H12 gene |
3103 |
0.18 |
chr6_13607973_13608602 | 1.58 |
Tmem168 |
transmembrane protein 168 |
187 |
0.96 |
chr11_80086905_80087159 | 1.56 |
Atad5 |
ATPase family, AAA domain containing 5 |
2368 |
0.24 |
chr5_115235264_115235764 | 1.55 |
Pop5 |
processing of precursor 5, ribonuclease P/MRP family (S. cerevisiae) |
322 |
0.78 |
chrX_12076868_12077753 | 1.53 |
Bcor |
BCL6 interacting corepressor |
3243 |
0.34 |
chr1_64087943_64089121 | 1.52 |
Gm13748 |
predicted gene 13748 |
9878 |
0.19 |
chr13_99018692_99018987 | 1.50 |
A930014D07Rik |
RIKEN cDNA A930014D07 gene |
11740 |
0.12 |
chr15_12447052_12447240 | 1.50 |
Pdzd2 |
PDZ domain containing 2 |
34766 |
0.17 |
chr11_106674335_106675138 | 1.49 |
Pecam1 |
platelet/endothelial cell adhesion molecule 1 |
11410 |
0.17 |
chr3_108751572_108751728 | 1.49 |
Aknad1 |
AKNA domain containing 1 |
876 |
0.52 |
chr17_6782057_6782428 | 1.48 |
Ezr |
ezrin |
542 |
0.73 |
chr8_111299516_111299699 | 1.48 |
Rfwd3 |
ring finger and WD repeat domain 3 |
584 |
0.68 |
chr1_135244155_135244306 | 1.44 |
Gm26642 |
predicted gene, 26642 |
4331 |
0.13 |
chr6_5263302_5263590 | 1.43 |
Pon3 |
paraoxonase 3 |
7160 |
0.17 |
chr8_46844739_46844892 | 1.41 |
Gm45481 |
predicted gene 45481 |
10903 |
0.18 |
chrX_38473528_38474265 | 1.40 |
Gm7598 |
predicted gene 7598 |
2565 |
0.27 |
chr10_62076266_62076474 | 1.40 |
Gm5424 |
predicted gene 5424 |
5247 |
0.19 |
chr12_103434110_103434336 | 1.39 |
Ifi27 |
interferon, alpha-inducible protein 27 |
11 |
0.95 |
chr14_31669663_31670111 | 1.39 |
Hacl1 |
2-hydroxyacyl-CoA lyase 1 |
28601 |
0.12 |
chr10_111558785_111559040 | 1.38 |
4933440J02Rik |
RIKEN cDNA 4933440J02 gene |
35361 |
0.11 |
chrX_73718748_73718906 | 1.38 |
Abcd1 |
ATP-binding cassette, sub-family D (ALD), member 1 |
2087 |
0.17 |
chr5_137345934_137346263 | 1.36 |
Ephb4 |
Eph receptor B4 |
4011 |
0.1 |
chr13_95672502_95672655 | 1.35 |
Iqgap2 |
IQ motif containing GTPase activating protein 2 |
1059 |
0.44 |
chr2_18821861_18822016 | 1.35 |
Carlr |
cardiac and apoptosis-related long non-coding RNA |
20120 |
0.17 |
chr1_73805065_73805216 | 1.34 |
Gm29183 |
predicted gene 29183 |
36777 |
0.14 |
chr8_84912786_84913422 | 1.34 |
Dnase2a |
deoxyribonuclease II alpha |
287 |
0.74 |
chr6_54972984_54973135 | 1.34 |
Nod1 |
nucleotide-binding oligomerization domain containing 1 |
447 |
0.75 |
chr2_163643384_163643535 | 1.34 |
0610039K10Rik |
RIKEN cDNA 0610039K10 gene |
1391 |
0.28 |
chr5_93044795_93044948 | 1.30 |
Sowahb |
sosondowah ankyrin repeat domain family member B |
151 |
0.94 |
chr7_141010676_141010885 | 1.30 |
Ifitm3 |
interferon induced transmembrane protein 3 |
10 |
0.94 |
chr17_23679435_23679764 | 1.29 |
Cldn6 |
claudin 6 |
60 |
0.9 |
chr7_6171760_6172680 | 1.28 |
Zfp444 |
zinc finger protein 444 |
6 |
0.95 |
chr2_72286384_72286535 | 1.28 |
Map3k20 |
mitogen-activated protein kinase kinase kinase 20 |
665 |
0.7 |
chr2_90503274_90503452 | 1.28 |
4933423P22Rik |
RIKEN cDNA 4933423P22 gene |
24113 |
0.16 |
chr13_23747319_23747470 | 1.27 |
H2bc3 |
H2B clustered histone 3 |
660 |
0.24 |
chr1_134962889_134963040 | 1.27 |
Ube2t |
ubiquitin-conjugating enzyme E2T |
346 |
0.87 |
chr1_138617785_138617943 | 1.26 |
Nek7 |
NIMA (never in mitosis gene a)-related expressed kinase 7 |
1810 |
0.35 |
chr12_8351371_8351565 | 1.26 |
Gm48071 |
predicted gene, 48071 |
14751 |
0.15 |
chr12_110601214_110602253 | 1.26 |
Gm35558 |
predicted gene, 35558 |
230 |
0.54 |
chr4_135494313_135495270 | 1.25 |
Stpg1 |
sperm tail PG rich repeat containing 1 |
1 |
0.68 |
chr16_93816332_93816772 | 1.25 |
Dop1b |
DOP1 leucine zipper like protein B |
7118 |
0.14 |
chr11_60954284_60954435 | 1.25 |
Map2k3 |
mitogen-activated protein kinase kinase 3 |
3697 |
0.18 |
chr9_114781250_114781522 | 1.24 |
Cmtm7 |
CKLF-like MARVEL transmembrane domain containing 7 |
446 |
0.72 |
chr15_80948123_80948287 | 1.24 |
Adsl |
adenylosuccinate lyase |
285 |
0.85 |
chr6_3345986_3346180 | 1.24 |
Gm20559 |
predicted gene, 20559 |
12 |
0.96 |
chr5_114922913_114923574 | 1.23 |
Oasl1 |
2'-5' oligoadenylate synthetase-like 1 |
3 |
0.5 |
chr5_100636931_100637107 | 1.23 |
Coq2 |
coenzyme Q2 4-hydroxybenzoate polyprenyltransferase |
27400 |
0.12 |
chr2_167887628_167887813 | 1.22 |
Gm14319 |
predicted gene 14319 |
29135 |
0.14 |
chr13_24246273_24246424 | 1.21 |
Carmil1 |
capping protein regulator and myosin 1 linker 1 |
5804 |
0.17 |
chr17_64622406_64622562 | 1.19 |
Man2a1 |
mannosidase 2, alpha 1 |
21748 |
0.23 |
chr11_49245593_49245837 | 1.18 |
Mgat1 |
mannoside acetylglucosaminyltransferase 1 |
484 |
0.71 |
chr16_17345888_17346201 | 1.17 |
Gm24927 |
predicted gene, 24927 |
4032 |
0.14 |
chr16_8736071_8736286 | 1.17 |
Usp7 |
ubiquitin specific peptidase 7 |
2164 |
0.27 |
chr5_147758193_147758351 | 1.15 |
Gm43156 |
predicted gene 43156 |
12756 |
0.19 |
chr11_102432143_102432294 | 1.14 |
Grn |
granulin |
567 |
0.58 |
chr4_141301097_141301289 | 1.14 |
Epha2 |
Eph receptor A2 |
47 |
0.95 |
chr9_108662236_108662629 | 1.14 |
Slc25a20 |
solute carrier family 25 (mitochondrial carnitine/acylcarnitine translocase), member 20 |
334 |
0.76 |
chr17_25015270_25015559 | 1.14 |
Cramp1l |
cramped chromatin regulator homolog 1 |
184 |
0.83 |
chr7_106529145_106529296 | 1.13 |
Gm8995 |
predicted gene 8995 |
17549 |
0.19 |
chr15_74967736_74967942 | 1.12 |
Ly6e |
lymphocyte antigen 6 complex, locus E |
11284 |
0.08 |
chr11_83078101_83078392 | 1.12 |
Gm20234 |
predicted gene, 20234 |
7000 |
0.08 |
chr13_101551260_101551432 | 1.11 |
Gm41043 |
predicted gene, 41043 |
3194 |
0.21 |
chr17_81064633_81064952 | 1.10 |
Thumpd2 |
THUMP domain containing 2 |
275 |
0.95 |
chr5_132466431_132466777 | 1.09 |
Auts2 |
autism susceptibility candidate 2 |
17244 |
0.12 |
chr11_95988194_95988345 | 1.08 |
Igf2bp1 |
insulin-like growth factor 2 mRNA binding protein 1 |
5658 |
0.1 |
chr2_178416528_178416815 | 1.07 |
Fam217b |
family with sequence similarity 217, member B |
2089 |
0.24 |
chr6_120363672_120363864 | 1.07 |
Kdm5a |
lysine (K)-specific demethylase 5A |
356 |
0.64 |
chr8_94183221_94183742 | 1.06 |
Gm39228 |
predicted gene, 39228 |
192 |
0.89 |
chr15_9114227_9114420 | 1.05 |
Nadk2 |
NAD kinase 2, mitochondrial |
11335 |
0.19 |
chr14_61559937_61560088 | 1.05 |
Gm4118 |
predicted gene 4118 |
1214 |
0.3 |
chr11_72301460_72301663 | 1.04 |
Xaf1 |
XIAP associated factor 1 |
68 |
0.95 |
chr11_101070242_101070609 | 1.03 |
Naglu |
alpha-N-acetylglucosaminidase (Sanfilippo disease IIIB) |
413 |
0.68 |
chr11_86593057_86593325 | 1.02 |
Vmp1 |
vacuole membrane protein 1 |
6197 |
0.16 |
chr5_115565413_115565753 | 1.02 |
Gcn1 |
GCN1 activator of EIF2AK4 |
280 |
0.82 |
chr9_42195741_42195945 | 1.02 |
4930546K05Rik |
RIKEN cDNA 4930546K05 gene |
13370 |
0.19 |
chr8_25040382_25040533 | 1.02 |
Htra4 |
HtrA serine peptidase 4 |
1495 |
0.28 |
chr14_75837044_75838069 | 1.01 |
Gm48931 |
predicted gene, 48931 |
3930 |
0.16 |
chr3_85887352_85888077 | 1.01 |
4933425M03Rik |
RIKEN cDNA 4933425M03 gene |
23 |
0.56 |
chr11_48871235_48871826 | 1.01 |
Irgm1 |
immunity-related GTPase family M member 1 |
110 |
0.93 |
chr4_80895358_80895537 | 1.00 |
Lurap1l |
leucine rich adaptor protein 1-like |
15199 |
0.24 |
chr19_58395865_58396080 | 0.99 |
Gfra1 |
glial cell line derived neurotrophic factor family receptor alpha 1 |
58494 |
0.13 |
chr16_55504891_55505059 | 0.99 |
Mir5118 |
microRNA 5118 |
10244 |
0.28 |
chr5_122762219_122762370 | 0.99 |
Camkk2 |
calcium/calmodulin-dependent protein kinase kinase 2, beta |
1571 |
0.28 |
chr11_80713830_80713981 | 0.99 |
Myo1d |
myosin ID |
66098 |
0.11 |
chr4_115057189_115057563 | 0.98 |
Tal1 |
T cell acute lymphocytic leukemia 1 |
62 |
0.97 |
chr4_150544939_150545172 | 0.98 |
Gm13091 |
predicted gene 13091 |
23489 |
0.18 |
chr16_95708221_95708531 | 0.98 |
Ets2 |
E26 avian leukemia oncogene 2, 3' domain |
2037 |
0.35 |
chr1_85735550_85735788 | 0.98 |
A630001G21Rik |
RIKEN cDNA A630001G21 gene |
885 |
0.45 |
chr17_88064453_88064954 | 0.98 |
Fbxo11 |
F-box protein 11 |
184 |
0.95 |
chr2_91634834_91635130 | 0.97 |
F2 |
coagulation factor II |
1413 |
0.27 |
chr4_133197802_133198325 | 0.97 |
Mir7017 |
microRNA 7017 |
2408 |
0.19 |
chr9_58658697_58658848 | 0.97 |
Rec114 |
REC114 meiotic recombination protein |
520 |
0.78 |
chr10_125896179_125896377 | 0.97 |
Lrig3 |
leucine-rich repeats and immunoglobulin-like domains 3 |
69890 |
0.13 |
chr7_139363722_139364567 | 0.96 |
Inpp5a |
inositol polyphosphate-5-phosphatase A |
24965 |
0.19 |
chr9_110653586_110654769 | 0.96 |
Nbeal2 |
neurobeachin-like 2 |
16 |
0.94 |
chr16_10843863_10844214 | 0.95 |
Rmi2 |
RecQ mediated genome instability 2 |
8970 |
0.1 |
chr11_101582142_101582330 | 0.95 |
Tmem106a |
transmembrane protein 106A |
6 |
0.94 |
chr6_137317920_137318078 | 0.95 |
Ptpro |
protein tyrosine phosphatase, receptor type, O |
65534 |
0.12 |
chrX_71767997_71768148 | 0.94 |
Rpl30-ps10 |
ribosomal protein L30, pseudogene 10 |
35616 |
0.15 |
chr9_121416224_121416375 | 0.94 |
Trak1 |
trafficking protein, kinesin binding 1 |
324 |
0.89 |
chr3_57294794_57295054 | 0.94 |
Tm4sf1 |
transmembrane 4 superfamily member 1 |
35 |
0.98 |
chr11_100387947_100388277 | 0.94 |
Jup |
junction plakoglobin |
1342 |
0.22 |
chr15_66969305_66970311 | 0.94 |
Ndrg1 |
N-myc downstream regulated gene 1 |
168 |
0.8 |
chr11_57962679_57963326 | 0.93 |
Gm12249 |
predicted gene 12249 |
10132 |
0.15 |
chr13_34651459_34651992 | 0.93 |
Pxdc1 |
PX domain containing 1 |
956 |
0.37 |
chr2_165493612_165494390 | 0.93 |
Trp53rka |
transformation related protein 53 regulating kinase A |
677 |
0.63 |
chr5_109844927_109845198 | 0.92 |
Gm10416 |
predicted pseudogene 10416 |
10917 |
0.17 |
chr17_86800656_86800807 | 0.92 |
Epas1 |
endothelial PAS domain protein 1 |
23602 |
0.15 |
chr14_74915830_74916012 | 0.91 |
Gm10847 |
predicted gene 10847 |
10524 |
0.2 |
chr19_60889614_60890006 | 0.91 |
Grk5 |
G protein-coupled receptor kinase 5 |
61 |
0.97 |
chr11_51840369_51840521 | 0.90 |
Jade2 |
jade family PHD finger 2 |
16680 |
0.16 |
chr11_86995691_86995992 | 0.90 |
Gm22387 |
predicted gene, 22387 |
1422 |
0.33 |
chr8_106138461_106138664 | 0.90 |
1810019D21Rik |
RIKEN cDNA 1810019D21 gene |
1497 |
0.23 |
chr7_96801514_96801665 | 0.89 |
Gm15413 |
predicted gene 15413 |
40 |
0.97 |
chr2_122158402_122158553 | 0.88 |
Trim69 |
tripartite motif-containing 69 |
2223 |
0.19 |
chr1_53823747_53824100 | 0.88 |
Hecw2 |
HECT, C2 and WW domain containing E3 ubiquitin protein ligase 2 |
17248 |
0.16 |
chr11_22871975_22872126 | 0.88 |
Gm24917 |
predicted gene, 24917 |
3149 |
0.16 |
chr13_21975054_21975346 | 0.88 |
Pom121l2 |
POM121 membrane glycoprotein-like 2 (rat) |
5994 |
0.07 |
chr13_23751776_23751953 | 0.87 |
Gm44484 |
predicted gene, 44484 |
349 |
0.37 |
chr5_149135169_149135434 | 0.87 |
Gm42787 |
predicted gene 42787 |
6717 |
0.1 |
chr4_132329735_132329903 | 0.87 |
Trnau1ap |
tRNA selenocysteine 1 associated protein 1 |
281 |
0.73 |
chr7_106215296_106215447 | 0.87 |
Gvin1 |
GTPase, very large interferon inducible 1 |
45 |
0.98 |
chr8_31150109_31150428 | 0.87 |
Tti2 |
TELO2 interacting protein 2 |
47 |
0.8 |
chr7_104315472_104315664 | 0.87 |
Trim12a |
tripartite motif-containing 12A |
102 |
0.84 |
chr11_78984796_78985130 | 0.85 |
Lgals9 |
lectin, galactose binding, soluble 9 |
17 |
0.98 |
chr14_116946057_116946269 | 0.85 |
Gpc6 |
glypican 6 |
20227 |
0.3 |
chr15_102025510_102025661 | 0.85 |
Krt18 |
keratin 18 |
2595 |
0.17 |
chr13_21907133_21907284 | 0.84 |
Gm11279 |
predicted gene 11279 |
4052 |
0.08 |
chr5_91402727_91403164 | 0.84 |
Btc |
betacellulin, epidermal growth factor family member |
49 |
0.98 |
chr12_82935466_82935659 | 0.83 |
1700085C21Rik |
RIKEN cDNA 1700085C21 gene |
3593 |
0.28 |
chr4_104824771_104824922 | 0.83 |
C8b |
complement component 8, beta polypeptide |
25638 |
0.17 |
chr19_9989798_9990534 | 0.83 |
Best1 |
bestrophin 1 |
2749 |
0.15 |
chr3_97297851_97298537 | 0.83 |
Bcl9 |
B cell CLL/lymphoma 9 |
277 |
0.91 |
chr5_139389682_139390030 | 0.83 |
Gpr146 |
G protein-coupled receptor 146 |
71 |
0.95 |
chr9_14381410_14381616 | 0.82 |
Endod1 |
endonuclease domain containing 1 |
6 |
0.96 |
chr1_161463766_161463992 | 0.82 |
Tnfsf18 |
tumor necrosis factor (ligand) superfamily, member 18 |
30776 |
0.17 |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.8 | 2.4 | GO:0019086 | late viral transcription(GO:0019086) |
0.6 | 1.8 | GO:0019287 | isopentenyl diphosphate biosynthetic process(GO:0009240) isopentenyl diphosphate biosynthetic process, mevalonate pathway(GO:0019287) |
0.5 | 2.1 | GO:0046726 | positive regulation by virus of viral protein levels in host cell(GO:0046726) |
0.5 | 1.5 | GO:0045472 | response to ether(GO:0045472) |
0.4 | 3.3 | GO:0048752 | semicircular canal morphogenesis(GO:0048752) |
0.4 | 1.5 | GO:0051572 | negative regulation of histone H3-K4 methylation(GO:0051572) |
0.4 | 1.2 | GO:1902896 | terminal web assembly(GO:1902896) |
0.4 | 1.1 | GO:0048320 | axial mesoderm formation(GO:0048320) |
0.3 | 1.0 | GO:0060375 | regulation of mast cell differentiation(GO:0060375) |
0.3 | 1.7 | GO:0006167 | AMP biosynthetic process(GO:0006167) |
0.3 | 1.0 | GO:1900169 | regulation of glucocorticoid mediated signaling pathway(GO:1900169) |
0.3 | 1.3 | GO:0010510 | regulation of acetyl-CoA biosynthetic process from pyruvate(GO:0010510) |
0.3 | 0.9 | GO:0070889 | platelet alpha granule organization(GO:0070889) |
0.3 | 1.8 | GO:0035608 | protein deglutamylation(GO:0035608) |
0.3 | 0.9 | GO:0043321 | regulation of natural killer cell degranulation(GO:0043321) |
0.3 | 0.9 | GO:0002337 | B-1a B cell differentiation(GO:0002337) |
0.3 | 1.4 | GO:0009249 | protein lipoylation(GO:0009249) |
0.3 | 1.1 | GO:0044314 | protein K27-linked ubiquitination(GO:0044314) |
0.3 | 1.8 | GO:2000675 | negative regulation of type B pancreatic cell apoptotic process(GO:2000675) |
0.2 | 0.7 | GO:0010956 | negative regulation of calcidiol 1-monooxygenase activity(GO:0010956) |
0.2 | 2.0 | GO:0034058 | endosomal vesicle fusion(GO:0034058) |
0.2 | 0.7 | GO:0035461 | vitamin transmembrane transport(GO:0035461) |
0.2 | 0.6 | GO:0051902 | negative regulation of mitochondrial depolarization(GO:0051902) |
0.2 | 1.0 | GO:0002606 | positive regulation of dendritic cell antigen processing and presentation(GO:0002606) |
0.2 | 1.5 | GO:0099515 | actin filament-based transport(GO:0099515) |
0.2 | 0.6 | GO:0007181 | transforming growth factor beta receptor complex assembly(GO:0007181) |
0.2 | 1.2 | GO:1901725 | regulation of histone deacetylase activity(GO:1901725) |
0.2 | 3.8 | GO:0046597 | negative regulation of viral entry into host cell(GO:0046597) |
0.2 | 0.7 | GO:0009597 | detection of virus(GO:0009597) |
0.2 | 0.9 | GO:0007217 | tachykinin receptor signaling pathway(GO:0007217) |
0.2 | 0.5 | GO:0035441 | cell migration involved in vasculogenesis(GO:0035441) |
0.2 | 0.5 | GO:0060447 | bud outgrowth involved in lung branching(GO:0060447) |
0.2 | 0.6 | GO:0090168 | Golgi reassembly(GO:0090168) |
0.2 | 0.5 | GO:0032485 | regulation of Ral protein signal transduction(GO:0032485) |
0.2 | 0.5 | GO:0009177 | deoxyribonucleoside monophosphate biosynthetic process(GO:0009157) pyrimidine deoxyribonucleoside monophosphate biosynthetic process(GO:0009177) |
0.2 | 0.5 | GO:0006481 | C-terminal protein methylation(GO:0006481) |
0.1 | 0.7 | GO:0010571 | positive regulation of nuclear cell cycle DNA replication(GO:0010571) |
0.1 | 1.0 | GO:2000051 | negative regulation of non-canonical Wnt signaling pathway(GO:2000051) |
0.1 | 0.3 | GO:0010980 | regulation of vitamin D 24-hydroxylase activity(GO:0010979) positive regulation of vitamin D 24-hydroxylase activity(GO:0010980) |
0.1 | 0.4 | GO:0046077 | dUDP biosynthetic process(GO:0006227) pyrimidine nucleoside diphosphate biosynthetic process(GO:0009139) pyrimidine deoxyribonucleoside diphosphate metabolic process(GO:0009196) pyrimidine deoxyribonucleoside diphosphate biosynthetic process(GO:0009197) dUDP metabolic process(GO:0046077) |
0.1 | 0.4 | GO:0016554 | cytidine to uridine editing(GO:0016554) |
0.1 | 0.4 | GO:0032910 | transforming growth factor beta3 production(GO:0032907) regulation of transforming growth factor beta3 production(GO:0032910) |
0.1 | 0.4 | GO:0021699 | cerebellar cortex maturation(GO:0021699) |
0.1 | 0.9 | GO:1902916 | positive regulation of protein polyubiquitination(GO:1902916) |
0.1 | 0.4 | GO:0070358 | actin polymerization-dependent cell motility(GO:0070358) |
0.1 | 0.1 | GO:1904339 | negative regulation of dopaminergic neuron differentiation(GO:1904339) |
0.1 | 0.6 | GO:0072675 | osteoclast fusion(GO:0072675) |
0.1 | 0.4 | GO:0071787 | endoplasmic reticulum tubular network assembly(GO:0071787) |
0.1 | 0.5 | GO:0050904 | diapedesis(GO:0050904) |
0.1 | 1.0 | GO:0070493 | thrombin receptor signaling pathway(GO:0070493) |
0.1 | 0.4 | GO:0001712 | ectodermal cell fate commitment(GO:0001712) |
0.1 | 0.7 | GO:0018401 | peptidyl-proline hydroxylation to 4-hydroxy-L-proline(GO:0018401) |
0.1 | 0.3 | GO:1903898 | negative regulation of PERK-mediated unfolded protein response(GO:1903898) |
0.1 | 0.3 | GO:0006982 | response to lipid hydroperoxide(GO:0006982) |
0.1 | 0.5 | GO:0036233 | glycine import(GO:0036233) |
0.1 | 0.1 | GO:0061626 | pharyngeal arch artery morphogenesis(GO:0061626) |
0.1 | 0.7 | GO:0048251 | elastic fiber assembly(GO:0048251) |
0.1 | 0.6 | GO:0006451 | selenocysteine incorporation(GO:0001514) translational readthrough(GO:0006451) |
0.1 | 0.8 | GO:0032287 | peripheral nervous system myelin maintenance(GO:0032287) |
0.1 | 1.5 | GO:0050779 | RNA destabilization(GO:0050779) |
0.1 | 0.9 | GO:0070525 | tRNA threonylcarbamoyladenosine metabolic process(GO:0070525) |
0.1 | 0.2 | GO:0090258 | negative regulation of mitochondrial fission(GO:0090258) |
0.1 | 0.3 | GO:0070537 | histone H2A K63-linked deubiquitination(GO:0070537) |
0.1 | 0.3 | GO:0000414 | regulation of histone H3-K36 methylation(GO:0000414) |
0.1 | 0.3 | GO:0021886 | hypothalamus gonadotrophin-releasing hormone neuron differentiation(GO:0021886) hypothalamus gonadotrophin-releasing hormone neuron development(GO:0021888) |
0.1 | 0.3 | GO:0018242 | protein O-linked glycosylation via serine(GO:0018242) |
0.1 | 0.3 | GO:0046985 | positive regulation of hemoglobin biosynthetic process(GO:0046985) |
0.1 | 0.3 | GO:0009629 | response to gravity(GO:0009629) |
0.1 | 0.2 | GO:0048808 | male genitalia morphogenesis(GO:0048808) male anatomical structure morphogenesis(GO:0090598) |
0.1 | 0.4 | GO:0007023 | post-chaperonin tubulin folding pathway(GO:0007023) |
0.1 | 0.4 | GO:0070836 | caveola assembly(GO:0070836) |
0.1 | 0.3 | GO:0097460 | ferrous iron import into cell(GO:0097460) |
0.1 | 0.4 | GO:0006398 | mRNA 3'-end processing by stem-loop binding and cleavage(GO:0006398) |
0.1 | 0.4 | GO:0010572 | positive regulation of platelet activation(GO:0010572) |
0.1 | 0.3 | GO:0036438 | maintenance of lens transparency(GO:0036438) |
0.1 | 0.7 | GO:0035090 | maintenance of apical/basal cell polarity(GO:0035090) |
0.1 | 0.7 | GO:0035413 | positive regulation of catenin import into nucleus(GO:0035413) |
0.1 | 1.1 | GO:2000001 | regulation of DNA damage checkpoint(GO:2000001) |
0.1 | 0.2 | GO:0009804 | coumarin metabolic process(GO:0009804) |
0.1 | 0.7 | GO:0034393 | positive regulation of smooth muscle cell apoptotic process(GO:0034393) |
0.1 | 0.3 | GO:0010387 | COP9 signalosome assembly(GO:0010387) |
0.1 | 0.4 | GO:0060480 | lung goblet cell differentiation(GO:0060480) |
0.1 | 0.3 | GO:0048023 | positive regulation of melanin biosynthetic process(GO:0048023) positive regulation of secondary metabolite biosynthetic process(GO:1900378) |
0.1 | 0.2 | GO:0060020 | Bergmann glial cell differentiation(GO:0060020) |
0.1 | 0.4 | GO:0061635 | regulation of protein complex stability(GO:0061635) |
0.1 | 0.7 | GO:0060179 | male mating behavior(GO:0060179) |
0.1 | 1.7 | GO:0006376 | mRNA splice site selection(GO:0006376) |
0.1 | 0.3 | GO:2001184 | positive regulation of interleukin-12 secretion(GO:2001184) |
0.1 | 0.3 | GO:0032909 | transforming growth factor beta2 production(GO:0032906) regulation of transforming growth factor beta2 production(GO:0032909) |
0.1 | 0.9 | GO:0006047 | UDP-N-acetylglucosamine metabolic process(GO:0006047) |
0.1 | 0.2 | GO:2000525 | regulation of T cell costimulation(GO:2000523) positive regulation of T cell costimulation(GO:2000525) |
0.1 | 0.4 | GO:0045627 | positive regulation of T-helper 1 cell differentiation(GO:0045627) |
0.1 | 0.3 | GO:2000659 | regulation of interleukin-1-mediated signaling pathway(GO:2000659) |
0.1 | 0.2 | GO:0035526 | retrograde transport, plasma membrane to Golgi(GO:0035526) |
0.1 | 0.1 | GO:0002309 | T cell proliferation involved in immune response(GO:0002309) |
0.1 | 0.2 | GO:0045658 | regulation of neutrophil differentiation(GO:0045658) |
0.1 | 0.2 | GO:0010520 | regulation of reciprocal meiotic recombination(GO:0010520) |
0.1 | 0.1 | GO:0072385 | minus-end-directed organelle transport along microtubule(GO:0072385) |
0.1 | 0.8 | GO:0032727 | positive regulation of interferon-alpha production(GO:0032727) |
0.1 | 0.4 | GO:0060373 | regulation of ventricular cardiac muscle cell membrane depolarization(GO:0060373) |
0.1 | 0.8 | GO:0006337 | nucleosome disassembly(GO:0006337) protein-DNA complex disassembly(GO:0032986) |
0.1 | 0.5 | GO:0008090 | retrograde axonal transport(GO:0008090) |
0.1 | 0.2 | GO:0061146 | Peyer's patch morphogenesis(GO:0061146) |
0.1 | 0.7 | GO:0006977 | DNA damage response, signal transduction by p53 class mediator resulting in cell cycle arrest(GO:0006977) |
0.1 | 0.1 | GO:0043309 | regulation of eosinophil degranulation(GO:0043309) |
0.1 | 0.3 | GO:0031293 | membrane protein intracellular domain proteolysis(GO:0031293) |
0.1 | 0.1 | GO:0048625 | myoblast fate commitment(GO:0048625) |
0.1 | 1.1 | GO:0030488 | tRNA methylation(GO:0030488) |
0.1 | 0.2 | GO:0061684 | chaperone-mediated autophagy(GO:0061684) |
0.1 | 0.2 | GO:0006741 | NADP biosynthetic process(GO:0006741) |
0.1 | 0.1 | GO:0009051 | pentose-phosphate shunt, oxidative branch(GO:0009051) |
0.1 | 0.1 | GO:0048294 | negative regulation of isotype switching(GO:0045829) negative regulation of isotype switching to IgE isotypes(GO:0048294) |
0.1 | 0.2 | GO:0072076 | nephrogenic mesenchyme development(GO:0072076) |
0.1 | 0.5 | GO:0035590 | purinergic nucleotide receptor signaling pathway(GO:0035590) |
0.1 | 0.5 | GO:0006012 | galactose metabolic process(GO:0006012) |
0.1 | 0.2 | GO:0070973 | protein localization to endoplasmic reticulum exit site(GO:0070973) |
0.1 | 0.3 | GO:0090435 | protein localization to nuclear envelope(GO:0090435) |
0.1 | 0.3 | GO:0033216 | ferric iron import(GO:0033216) ferric iron import into cell(GO:0097461) |
0.1 | 0.1 | GO:0072610 | interleukin-12 secretion(GO:0072610) |
0.1 | 0.4 | GO:0086073 | bundle of His cell-Purkinje myocyte adhesion involved in cell communication(GO:0086073) |
0.1 | 0.4 | GO:1901223 | negative regulation of NIK/NF-kappaB signaling(GO:1901223) |
0.1 | 0.3 | GO:0048133 | germ-line stem cell division(GO:0042078) male germ-line stem cell asymmetric division(GO:0048133) germline stem cell asymmetric division(GO:0098728) |
0.1 | 0.4 | GO:0006620 | posttranslational protein targeting to membrane(GO:0006620) |
0.1 | 0.9 | GO:0006309 | apoptotic DNA fragmentation(GO:0006309) |
0.1 | 1.9 | GO:0035456 | response to interferon-beta(GO:0035456) |
0.1 | 0.3 | GO:0097500 | receptor localization to nonmotile primary cilium(GO:0097500) |
0.1 | 0.2 | GO:0035021 | negative regulation of Rac protein signal transduction(GO:0035021) |
0.1 | 0.4 | GO:0070072 | vacuolar proton-transporting V-type ATPase complex assembly(GO:0070072) |
0.1 | 0.2 | GO:0030091 | protein repair(GO:0030091) |
0.1 | 0.1 | GO:0008588 | release of cytoplasmic sequestered NF-kappaB(GO:0008588) |
0.1 | 0.5 | GO:0034063 | stress granule assembly(GO:0034063) |
0.1 | 0.2 | GO:0021571 | rhombomere 5 development(GO:0021571) |
0.1 | 0.1 | GO:0032439 | endosome localization(GO:0032439) |
0.1 | 0.1 | GO:0032489 | regulation of Cdc42 protein signal transduction(GO:0032489) |
0.1 | 0.2 | GO:0006362 | transcription elongation from RNA polymerase I promoter(GO:0006362) |
0.1 | 0.2 | GO:0006768 | biotin metabolic process(GO:0006768) |
0.1 | 0.2 | GO:0042758 | long-chain fatty acid catabolic process(GO:0042758) |
0.1 | 0.1 | GO:0044026 | DNA hypermethylation(GO:0044026) hypermethylation of CpG island(GO:0044027) |
0.1 | 0.4 | GO:0048304 | positive regulation of isotype switching to IgG isotypes(GO:0048304) |
0.1 | 0.2 | GO:0035701 | hematopoietic stem cell migration(GO:0035701) |
0.1 | 1.4 | GO:0046825 | regulation of protein export from nucleus(GO:0046825) |
0.1 | 0.5 | GO:0031115 | negative regulation of microtubule polymerization(GO:0031115) |
0.1 | 0.6 | GO:0046548 | retinal rod cell development(GO:0046548) |
0.1 | 0.3 | GO:0015879 | carnitine transport(GO:0015879) |
0.1 | 1.8 | GO:0000380 | alternative mRNA splicing, via spliceosome(GO:0000380) |
0.1 | 0.6 | GO:0021527 | spinal cord association neuron differentiation(GO:0021527) |
0.1 | 0.3 | GO:0043456 | regulation of pentose-phosphate shunt(GO:0043456) |
0.1 | 0.6 | GO:0006957 | complement activation, alternative pathway(GO:0006957) |
0.0 | 0.1 | GO:0002904 | positive regulation of B cell apoptotic process(GO:0002904) |
0.0 | 0.1 | GO:0002019 | regulation of renal output by angiotensin(GO:0002019) |
0.0 | 0.1 | GO:0002017 | regulation of blood volume by renal aldosterone(GO:0002017) |
0.0 | 0.2 | GO:1902166 | negative regulation of intrinsic apoptotic signaling pathway in response to DNA damage by p53 class mediator(GO:1902166) |
0.0 | 0.1 | GO:0051599 | response to hydrostatic pressure(GO:0051599) |
0.0 | 0.5 | GO:0051044 | positive regulation of membrane protein ectodomain proteolysis(GO:0051044) |
0.0 | 0.1 | GO:0046719 | regulation by virus of viral protein levels in host cell(GO:0046719) |
0.0 | 0.1 | GO:0097051 | establishment of protein localization to endoplasmic reticulum membrane(GO:0097051) |
0.0 | 1.4 | GO:0070830 | bicellular tight junction assembly(GO:0070830) |
0.0 | 0.2 | GO:2000042 | negative regulation of double-strand break repair via homologous recombination(GO:2000042) |
0.0 | 0.2 | GO:0035372 | protein localization to microtubule(GO:0035372) |
0.0 | 0.1 | GO:0003105 | negative regulation of glomerular filtration(GO:0003105) |
0.0 | 0.2 | GO:0015886 | heme transport(GO:0015886) |
0.0 | 0.2 | GO:0010891 | negative regulation of sequestering of triglyceride(GO:0010891) |
0.0 | 0.1 | GO:0090191 | negative regulation of branching involved in ureteric bud morphogenesis(GO:0090191) |
0.0 | 0.1 | GO:0006068 | ethanol catabolic process(GO:0006068) |
0.0 | 0.3 | GO:2000096 | positive regulation of Wnt signaling pathway, planar cell polarity pathway(GO:2000096) |
0.0 | 0.2 | GO:0042536 | negative regulation of tumor necrosis factor biosynthetic process(GO:0042536) |
0.0 | 0.1 | GO:0070384 | Harderian gland development(GO:0070384) |
0.0 | 0.1 | GO:0015014 | heparan sulfate proteoglycan biosynthetic process, polysaccharide chain biosynthetic process(GO:0015014) |
0.0 | 0.2 | GO:0060315 | negative regulation of ryanodine-sensitive calcium-release channel activity(GO:0060315) |
0.0 | 0.2 | GO:0032463 | negative regulation of protein homooligomerization(GO:0032463) |
0.0 | 0.3 | GO:2000480 | negative regulation of cAMP-dependent protein kinase activity(GO:2000480) |
0.0 | 1.2 | GO:0000186 | activation of MAPKK activity(GO:0000186) |
0.0 | 0.2 | GO:0032792 | negative regulation of CREB transcription factor activity(GO:0032792) |
0.0 | 0.1 | GO:0006172 | ADP biosynthetic process(GO:0006172) |
0.0 | 0.2 | GO:0055009 | atrial cardiac muscle tissue development(GO:0003228) atrial cardiac muscle tissue morphogenesis(GO:0055009) |
0.0 | 0.1 | GO:0007039 | protein catabolic process in the vacuole(GO:0007039) |
0.0 | 0.3 | GO:0060177 | regulation of angiotensin metabolic process(GO:0060177) |
0.0 | 0.6 | GO:1904355 | positive regulation of telomere capping(GO:1904355) |
0.0 | 0.9 | GO:0045071 | negative regulation of viral genome replication(GO:0045071) |
0.0 | 0.0 | GO:0015819 | lysine transport(GO:0015819) |
0.0 | 0.1 | GO:1900095 | regulation of dosage compensation by inactivation of X chromosome(GO:1900095) |
0.0 | 0.0 | GO:0033121 | regulation of purine nucleotide catabolic process(GO:0033121) |
0.0 | 0.6 | GO:0006828 | manganese ion transport(GO:0006828) |
0.0 | 0.0 | GO:2000507 | positive regulation of energy homeostasis(GO:2000507) |
0.0 | 0.1 | GO:0042908 | xenobiotic transport(GO:0042908) |
0.0 | 0.0 | GO:1904526 | regulation of microtubule binding(GO:1904526) positive regulation of microtubule binding(GO:1904528) |
0.0 | 1.3 | GO:0032784 | regulation of DNA-templated transcription, elongation(GO:0032784) |
0.0 | 1.3 | GO:0070534 | protein K63-linked ubiquitination(GO:0070534) |
0.0 | 0.1 | GO:0044791 | modulation by host of viral release from host cell(GO:0044789) positive regulation by host of viral release from host cell(GO:0044791) |
0.0 | 0.2 | GO:0047484 | regulation of response to osmotic stress(GO:0047484) |
0.0 | 0.1 | GO:0006659 | phosphatidylserine biosynthetic process(GO:0006659) |
0.0 | 0.1 | GO:1902109 | negative regulation of mitochondrial membrane permeability involved in apoptotic process(GO:1902109) |
0.0 | 0.3 | GO:0010216 | maintenance of DNA methylation(GO:0010216) |
0.0 | 0.2 | GO:0060056 | mammary gland involution(GO:0060056) |
0.0 | 0.3 | GO:0048387 | negative regulation of retinoic acid receptor signaling pathway(GO:0048387) |
0.0 | 0.2 | GO:0033030 | negative regulation of neutrophil apoptotic process(GO:0033030) |
0.0 | 0.1 | GO:0008065 | establishment of blood-nerve barrier(GO:0008065) |
0.0 | 0.4 | GO:0070166 | enamel mineralization(GO:0070166) |
0.0 | 0.1 | GO:1903011 | negative regulation of bone development(GO:1903011) |
0.0 | 0.1 | GO:0006564 | L-serine biosynthetic process(GO:0006564) |
0.0 | 0.1 | GO:0006537 | glutamate biosynthetic process(GO:0006537) |
0.0 | 0.2 | GO:0048050 | post-embryonic eye morphogenesis(GO:0048050) post-embryonic camera-type eye morphogenesis(GO:0048597) |
0.0 | 0.1 | GO:0090202 | transcriptional activation by promoter-enhancer looping(GO:0071733) gene looping(GO:0090202) dsDNA loop formation(GO:0090579) |
0.0 | 0.1 | GO:1900108 | negative regulation of nodal signaling pathway(GO:1900108) |
0.0 | 0.3 | GO:0048280 | vesicle fusion with Golgi apparatus(GO:0048280) |
0.0 | 0.3 | GO:0032534 | regulation of microvillus assembly(GO:0032534) |
0.0 | 0.2 | GO:0045602 | negative regulation of endothelial cell differentiation(GO:0045602) |
0.0 | 0.4 | GO:0002087 | regulation of respiratory gaseous exchange by neurological system process(GO:0002087) |
0.0 | 0.7 | GO:0000154 | rRNA modification(GO:0000154) |
0.0 | 0.1 | GO:0035087 | siRNA loading onto RISC involved in RNA interference(GO:0035087) |
0.0 | 0.0 | GO:0018992 | germ-line sex determination(GO:0018992) |
0.0 | 0.4 | GO:0000290 | deadenylation-dependent decapping of nuclear-transcribed mRNA(GO:0000290) |
0.0 | 0.1 | GO:0014043 | negative regulation of neuron maturation(GO:0014043) |
0.0 | 0.1 | GO:0046881 | positive regulation of follicle-stimulating hormone secretion(GO:0046881) |
0.0 | 1.3 | GO:0002474 | antigen processing and presentation of peptide antigen via MHC class I(GO:0002474) |
0.0 | 0.1 | GO:0032782 | bile acid secretion(GO:0032782) |
0.0 | 0.3 | GO:0007250 | activation of NF-kappaB-inducing kinase activity(GO:0007250) |
0.0 | 0.0 | GO:0009138 | pyrimidine nucleoside diphosphate metabolic process(GO:0009138) |
0.0 | 0.1 | GO:0003284 | septum primum development(GO:0003284) |
0.0 | 0.2 | GO:0090073 | positive regulation of protein homodimerization activity(GO:0090073) |
0.0 | 0.2 | GO:0033601 | positive regulation of mammary gland epithelial cell proliferation(GO:0033601) |
0.0 | 0.1 | GO:0070375 | ERK5 cascade(GO:0070375) |
0.0 | 0.1 | GO:0009826 | unidimensional cell growth(GO:0009826) |
0.0 | 0.0 | GO:0060125 | negative regulation of growth hormone secretion(GO:0060125) |
0.0 | 0.3 | GO:0005981 | regulation of glycogen catabolic process(GO:0005981) |
0.0 | 0.1 | GO:0016080 | synaptic vesicle targeting(GO:0016080) |
0.0 | 0.7 | GO:0006084 | acetyl-CoA metabolic process(GO:0006084) |
0.0 | 0.9 | GO:0003333 | amino acid transmembrane transport(GO:0003333) |
0.0 | 0.4 | GO:0009992 | cellular water homeostasis(GO:0009992) |
0.0 | 0.1 | GO:1901165 | positive regulation of trophoblast cell migration(GO:1901165) |
0.0 | 0.1 | GO:0042271 | susceptibility to natural killer cell mediated cytotoxicity(GO:0042271) |
0.0 | 0.1 | GO:0060267 | positive regulation of respiratory burst(GO:0060267) |
0.0 | 0.3 | GO:0035810 | positive regulation of urine volume(GO:0035810) |
0.0 | 0.1 | GO:2000504 | positive regulation of blood vessel remodeling(GO:2000504) |
0.0 | 0.1 | GO:0033160 | positive regulation of protein import into nucleus, translocation(GO:0033160) |
0.0 | 0.1 | GO:1903715 | regulation of aerobic respiration(GO:1903715) |
0.0 | 0.2 | GO:0006287 | base-excision repair, gap-filling(GO:0006287) |
0.0 | 0.3 | GO:0035855 | megakaryocyte development(GO:0035855) |
0.0 | 0.0 | GO:1903660 | regulation of complement-dependent cytotoxicity(GO:1903659) negative regulation of complement-dependent cytotoxicity(GO:1903660) |
0.0 | 0.1 | GO:0050923 | regulation of negative chemotaxis(GO:0050923) |
0.0 | 0.1 | GO:0090527 | actin filament reorganization(GO:0090527) |
0.0 | 0.1 | GO:0022615 | protein to membrane docking(GO:0022615) |
0.0 | 0.1 | GO:0032789 | saturated monocarboxylic acid metabolic process(GO:0032788) unsaturated monocarboxylic acid metabolic process(GO:0032789) |
0.0 | 0.1 | GO:2000048 | negative regulation of cell-cell adhesion mediated by cadherin(GO:2000048) |
0.0 | 0.6 | GO:0043403 | skeletal muscle tissue regeneration(GO:0043403) |
0.0 | 0.2 | GO:1902715 | positive regulation of interferon-gamma secretion(GO:1902715) |
0.0 | 0.0 | GO:0033092 | positive regulation of immature T cell proliferation(GO:0033091) positive regulation of immature T cell proliferation in thymus(GO:0033092) |
0.0 | 0.1 | GO:2000271 | positive regulation of fibroblast apoptotic process(GO:2000271) |
0.0 | 0.2 | GO:0060330 | regulation of response to interferon-gamma(GO:0060330) |
0.0 | 0.3 | GO:0006744 | ubiquinone biosynthetic process(GO:0006744) |
0.0 | 0.1 | GO:0034975 | protein folding in endoplasmic reticulum(GO:0034975) |
0.0 | 0.1 | GO:1903912 | negative regulation of endoplasmic reticulum stress-induced eIF2 alpha phosphorylation(GO:1903912) |
0.0 | 0.2 | GO:0097421 | liver regeneration(GO:0097421) |
0.0 | 0.0 | GO:1902809 | regulation of skeletal muscle fiber differentiation(GO:1902809) |
0.0 | 0.0 | GO:0034135 | regulation of toll-like receptor 2 signaling pathway(GO:0034135) negative regulation of toll-like receptor 2 signaling pathway(GO:0034136) |
0.0 | 0.3 | GO:0006027 | glycosaminoglycan catabolic process(GO:0006027) |
0.0 | 0.1 | GO:0042518 | negative regulation of tyrosine phosphorylation of Stat3 protein(GO:0042518) |
0.0 | 0.1 | GO:0001561 | fatty acid alpha-oxidation(GO:0001561) |
0.0 | 0.2 | GO:0017196 | N-terminal peptidyl-methionine acetylation(GO:0017196) |
0.0 | 0.1 | GO:0060087 | relaxation of vascular smooth muscle(GO:0060087) |
0.0 | 0.1 | GO:0031627 | telomeric loop formation(GO:0031627) |
0.0 | 0.1 | GO:0042637 | catagen(GO:0042637) |
0.0 | 0.1 | GO:0030951 | establishment or maintenance of microtubule cytoskeleton polarity(GO:0030951) |
0.0 | 0.2 | GO:0060211 | regulation of nuclear-transcribed mRNA poly(A) tail shortening(GO:0060211) positive regulation of nuclear-transcribed mRNA poly(A) tail shortening(GO:0060213) |
0.0 | 0.1 | GO:0036295 | cellular response to increased oxygen levels(GO:0036295) cellular response to hyperoxia(GO:0071455) |
0.0 | 0.0 | GO:0036092 | phosphatidylinositol-3-phosphate biosynthetic process(GO:0036092) |
0.0 | 0.1 | GO:0010624 | regulation of Schwann cell proliferation(GO:0010624) negative regulation of Schwann cell proliferation(GO:0010626) |
0.0 | 0.2 | GO:0045721 | negative regulation of gluconeogenesis(GO:0045721) |
0.0 | 0.1 | GO:0070934 | CRD-mediated mRNA stabilization(GO:0070934) |
0.0 | 0.1 | GO:0070842 | aggresome assembly(GO:0070842) |
0.0 | 0.2 | GO:0006102 | isocitrate metabolic process(GO:0006102) |
0.0 | 0.1 | GO:0035845 | photoreceptor cell outer segment organization(GO:0035845) |
0.0 | 0.0 | GO:1902071 | regulation of hypoxia-inducible factor-1alpha signaling pathway(GO:1902071) |
0.0 | 0.2 | GO:0043983 | histone H4-K12 acetylation(GO:0043983) |
0.0 | 0.3 | GO:0045652 | regulation of megakaryocyte differentiation(GO:0045652) |
0.0 | 0.1 | GO:0090148 | membrane fission(GO:0090148) |
0.0 | 0.1 | GO:0002154 | thyroid hormone mediated signaling pathway(GO:0002154) |
0.0 | 0.8 | GO:0033141 | positive regulation of peptidyl-serine phosphorylation of STAT protein(GO:0033141) |
0.0 | 0.1 | GO:2000773 | negative regulation of cellular senescence(GO:2000773) |
0.0 | 0.2 | GO:0046838 | phosphorylated carbohydrate dephosphorylation(GO:0046838) inositol phosphate dephosphorylation(GO:0046855) |
0.0 | 0.1 | GO:0061625 | fructose catabolic process(GO:0006001) fructose catabolic process to hydroxyacetone phosphate and glyceraldehyde-3-phosphate(GO:0061624) glycolytic process through fructose-1-phosphate(GO:0061625) |
0.0 | 0.1 | GO:1902744 | negative regulation of lamellipodium organization(GO:1902744) |
0.0 | 0.2 | GO:0045040 | protein import into mitochondrial outer membrane(GO:0045040) |
0.0 | 0.1 | GO:0051661 | maintenance of centrosome location(GO:0051661) |
0.0 | 0.1 | GO:0045448 | regulation of mitotic cell cycle, embryonic(GO:0009794) mitotic cell cycle, embryonic(GO:0045448) |
0.0 | 0.1 | GO:0021615 | glossopharyngeal nerve morphogenesis(GO:0021615) |
0.0 | 0.1 | GO:0046952 | ketone body catabolic process(GO:0046952) |
0.0 | 0.3 | GO:0042574 | retinal metabolic process(GO:0042574) |
0.0 | 0.4 | GO:0045620 | negative regulation of lymphocyte differentiation(GO:0045620) |
0.0 | 0.1 | GO:0061687 | detoxification of inorganic compound(GO:0061687) |
0.0 | 0.3 | GO:0097284 | hepatocyte apoptotic process(GO:0097284) |
0.0 | 0.0 | GO:0019660 | fermentation(GO:0006113) glucose catabolic process to lactate(GO:0019659) glycolytic fermentation(GO:0019660) glucose catabolic process to lactate via pyruvate(GO:0019661) |
0.0 | 0.0 | GO:0070212 | protein poly-ADP-ribosylation(GO:0070212) |
0.0 | 0.8 | GO:0050873 | brown fat cell differentiation(GO:0050873) |
0.0 | 0.1 | GO:0021940 | positive regulation of cerebellar granule cell precursor proliferation(GO:0021940) |
0.0 | 0.1 | GO:0032570 | response to progesterone(GO:0032570) |
0.0 | 0.1 | GO:0032261 | purine nucleotide salvage(GO:0032261) |
0.0 | 0.8 | GO:0033003 | regulation of mast cell activation(GO:0033003) |
0.0 | 0.2 | GO:0010758 | regulation of macrophage chemotaxis(GO:0010758) |
0.0 | 0.1 | GO:0042635 | positive regulation of hair cycle(GO:0042635) |
0.0 | 0.1 | GO:0043569 | negative regulation of insulin-like growth factor receptor signaling pathway(GO:0043569) |
0.0 | 0.1 | GO:0048633 | positive regulation of skeletal muscle tissue growth(GO:0048633) |
0.0 | 0.3 | GO:0010569 | regulation of double-strand break repair via homologous recombination(GO:0010569) |
0.0 | 0.0 | GO:2000359 | regulation of binding of sperm to zona pellucida(GO:2000359) |
0.0 | 0.9 | GO:0019319 | hexose biosynthetic process(GO:0019319) |
0.0 | 0.1 | GO:0061000 | negative regulation of dendritic spine development(GO:0061000) |
0.0 | 0.1 | GO:0035331 | negative regulation of hippo signaling(GO:0035331) |
0.0 | 0.6 | GO:0060612 | adipose tissue development(GO:0060612) |
0.0 | 0.1 | GO:0036265 | RNA (guanine-N7)-methylation(GO:0036265) |
0.0 | 0.1 | GO:0030311 | poly-N-acetyllactosamine metabolic process(GO:0030309) poly-N-acetyllactosamine biosynthetic process(GO:0030311) |
0.0 | 0.7 | GO:0006805 | xenobiotic metabolic process(GO:0006805) |
0.0 | 0.1 | GO:0021999 | neural plate anterior/posterior regionalization(GO:0021999) |
0.0 | 0.2 | GO:0071459 | protein localization to chromosome, centromeric region(GO:0071459) |
0.0 | 0.1 | GO:0097286 | iron ion import(GO:0097286) |
0.0 | 0.3 | GO:0030212 | hyaluronan metabolic process(GO:0030212) |
0.0 | 0.1 | GO:0043137 | DNA replication, removal of RNA primer(GO:0043137) |
0.0 | 0.1 | GO:0000289 | nuclear-transcribed mRNA poly(A) tail shortening(GO:0000289) |
0.0 | 0.1 | GO:0001732 | formation of cytoplasmic translation initiation complex(GO:0001732) |
0.0 | 0.0 | GO:1901663 | quinone biosynthetic process(GO:1901663) |
0.0 | 0.3 | GO:0032897 | negative regulation of viral transcription(GO:0032897) |
0.0 | 0.1 | GO:0051295 | establishment of meiotic spindle localization(GO:0051295) |
0.0 | 0.1 | GO:0060770 | negative regulation of epithelial cell proliferation involved in prostate gland development(GO:0060770) |
0.0 | 0.1 | GO:0045719 | negative regulation of glycogen biosynthetic process(GO:0045719) |
0.0 | 0.3 | GO:0010718 | positive regulation of epithelial to mesenchymal transition(GO:0010718) |
0.0 | 0.1 | GO:0008594 | photoreceptor cell morphogenesis(GO:0008594) |
0.0 | 0.0 | GO:0035384 | thioester biosynthetic process(GO:0035384) acyl-CoA biosynthetic process(GO:0071616) |
0.0 | 0.1 | GO:0051549 | regulation of keratinocyte migration(GO:0051547) positive regulation of keratinocyte migration(GO:0051549) |
0.0 | 0.1 | GO:0003413 | chondrocyte differentiation involved in endochondral bone morphogenesis(GO:0003413) |
0.0 | 0.1 | GO:0032466 | negative regulation of cytokinesis(GO:0032466) |
0.0 | 0.2 | GO:0007614 | short-term memory(GO:0007614) |
0.0 | 0.7 | GO:0000462 | maturation of SSU-rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000462) |
0.0 | 0.4 | GO:0046854 | phosphatidylinositol phosphorylation(GO:0046854) |
0.0 | 0.1 | GO:0006384 | transcription initiation from RNA polymerase III promoter(GO:0006384) |
0.0 | 0.9 | GO:0030500 | regulation of bone mineralization(GO:0030500) |
0.0 | 0.0 | GO:0019230 | proprioception(GO:0019230) |
0.0 | 0.2 | GO:0015937 | coenzyme A biosynthetic process(GO:0015937) |
0.0 | 0.2 | GO:0006517 | protein deglycosylation(GO:0006517) |
0.0 | 0.1 | GO:1901097 | negative regulation of autophagosome maturation(GO:1901097) |
0.0 | 0.1 | GO:0019695 | choline metabolic process(GO:0019695) |
0.0 | 0.0 | GO:0010804 | negative regulation of tumor necrosis factor-mediated signaling pathway(GO:0010804) |
0.0 | 0.2 | GO:0048025 | negative regulation of mRNA splicing, via spliceosome(GO:0048025) |
0.0 | 0.3 | GO:0003351 | epithelial cilium movement(GO:0003351) |
0.0 | 0.0 | GO:0034729 | histone H3-K79 methylation(GO:0034729) |
0.0 | 0.3 | GO:0060219 | camera-type eye photoreceptor cell differentiation(GO:0060219) |
0.0 | 0.0 | GO:0019896 | axonal transport of mitochondrion(GO:0019896) |
0.0 | 0.0 | GO:0046149 | heme catabolic process(GO:0042167) pigment catabolic process(GO:0046149) |
0.0 | 0.0 | GO:0031659 | regulation of cyclin-dependent protein serine/threonine kinase activity involved in G1/S transition of mitotic cell cycle(GO:0031657) positive regulation of cyclin-dependent protein serine/threonine kinase activity involved in G1/S transition of mitotic cell cycle(GO:0031659) |
0.0 | 0.2 | GO:0001731 | formation of translation preinitiation complex(GO:0001731) |
0.0 | 0.2 | GO:2000398 | regulation of T cell differentiation in thymus(GO:0033081) regulation of thymocyte aggregation(GO:2000398) |
0.0 | 0.1 | GO:0001842 | neural fold formation(GO:0001842) |
0.0 | 0.1 | GO:0007021 | tubulin complex assembly(GO:0007021) |
0.0 | 0.0 | GO:1903026 | negative regulation of RNA polymerase II regulatory region sequence-specific DNA binding(GO:1903026) |
0.0 | 0.0 | GO:0032875 | regulation of DNA endoreduplication(GO:0032875) DNA endoreduplication(GO:0042023) |
0.0 | 0.1 | GO:1990086 | lens fiber cell apoptotic process(GO:1990086) |
0.0 | 0.0 | GO:1902866 | regulation of retina development in camera-type eye(GO:1902866) |
0.0 | 0.1 | GO:0060948 | cardiac vascular smooth muscle cell development(GO:0060948) |
0.0 | 0.1 | GO:0070634 | transepithelial ammonium transport(GO:0070634) |
0.0 | 0.0 | GO:0010724 | regulation of definitive erythrocyte differentiation(GO:0010724) |
0.0 | 0.0 | GO:0072592 | oxygen metabolic process(GO:0072592) |
0.0 | 0.1 | GO:0000103 | sulfate assimilation(GO:0000103) |
0.0 | 0.1 | GO:0016558 | protein import into peroxisome matrix(GO:0016558) |
0.0 | 0.2 | GO:0006607 | NLS-bearing protein import into nucleus(GO:0006607) |
0.0 | 0.1 | GO:2000270 | negative regulation of fibroblast apoptotic process(GO:2000270) |
0.0 | 0.1 | GO:1990036 | calcium ion import into sarcoplasmic reticulum(GO:1990036) |
0.0 | 0.1 | GO:0060059 | embryonic retina morphogenesis in camera-type eye(GO:0060059) |
0.0 | 0.0 | GO:0019065 | receptor-mediated endocytosis of virus by host cell(GO:0019065) endocytosis involved in viral entry into host cell(GO:0075509) |
0.0 | 0.1 | GO:0030208 | dermatan sulfate biosynthetic process(GO:0030208) |
0.0 | 0.1 | GO:0097384 | ether lipid biosynthetic process(GO:0008611) glycerol ether biosynthetic process(GO:0046504) cellular lipid biosynthetic process(GO:0097384) ether biosynthetic process(GO:1901503) |
0.0 | 0.6 | GO:0030032 | lamellipodium assembly(GO:0030032) |
0.0 | 0.1 | GO:0071340 | skeletal muscle acetylcholine-gated channel clustering(GO:0071340) |
0.0 | 0.1 | GO:0070544 | histone H3-K36 demethylation(GO:0070544) |
0.0 | 0.0 | GO:2001286 | regulation of caveolin-mediated endocytosis(GO:2001286) |
0.0 | 0.1 | GO:0001927 | exocyst assembly(GO:0001927) |
0.0 | 0.0 | GO:0060633 | negative regulation of transcription initiation from RNA polymerase II promoter(GO:0060633) negative regulation of DNA-templated transcription, initiation(GO:2000143) |
0.0 | 0.1 | GO:0007175 | negative regulation of epidermal growth factor-activated receptor activity(GO:0007175) |
0.0 | 0.0 | GO:1905216 | positive regulation of mRNA binding(GO:1902416) positive regulation of RNA binding(GO:1905216) |
0.0 | 0.1 | GO:0043152 | induction of bacterial agglutination(GO:0043152) |
0.0 | 0.0 | GO:0000350 | generation of catalytic spliceosome for second transesterification step(GO:0000350) |
0.0 | 0.2 | GO:0006390 | transcription from mitochondrial promoter(GO:0006390) |
0.0 | 0.0 | GO:2000189 | positive regulation of cholesterol homeostasis(GO:2000189) |
0.0 | 0.1 | GO:0045741 | positive regulation of epidermal growth factor-activated receptor activity(GO:0045741) |
0.0 | 0.0 | GO:0034242 | negative regulation of syncytium formation by plasma membrane fusion(GO:0034242) |
0.0 | 0.1 | GO:0042904 | 9-cis-retinoic acid biosynthetic process(GO:0042904) 9-cis-retinoic acid metabolic process(GO:0042905) |
0.0 | 0.0 | GO:0014827 | intestine smooth muscle contraction(GO:0014827) |
0.0 | 0.0 | GO:0071285 | cellular response to lithium ion(GO:0071285) |
0.0 | 0.0 | GO:0086046 | membrane depolarization during SA node cell action potential(GO:0086046) |
0.0 | 0.0 | GO:0032066 | nucleolus to nucleoplasm transport(GO:0032066) |
0.0 | 0.1 | GO:0050916 | sensory perception of sweet taste(GO:0050916) |
0.0 | 0.0 | GO:0000737 | DNA catabolic process, endonucleolytic(GO:0000737) |
0.0 | 0.1 | GO:0046598 | positive regulation of viral entry into host cell(GO:0046598) |
0.0 | 0.0 | GO:0007525 | somatic muscle development(GO:0007525) |
0.0 | 0.0 | GO:0010916 | regulation of very-low-density lipoprotein particle clearance(GO:0010915) negative regulation of very-low-density lipoprotein particle clearance(GO:0010916) |
0.0 | 0.0 | GO:0010534 | regulation of activation of JAK2 kinase activity(GO:0010534) |
0.0 | 0.0 | GO:0002585 | positive regulation of antigen processing and presentation of peptide antigen(GO:0002585) |
0.0 | 0.0 | GO:0042427 | serotonin biosynthetic process(GO:0042427) primary amino compound biosynthetic process(GO:1901162) |
0.0 | 0.0 | GO:0070681 | glutaminyl-tRNAGln biosynthesis via transamidation(GO:0070681) |
0.0 | 0.0 | GO:0030576 | Cajal body organization(GO:0030576) |
0.0 | 0.3 | GO:0007099 | centriole replication(GO:0007099) |
0.0 | 0.0 | GO:0000056 | ribosomal small subunit export from nucleus(GO:0000056) |
0.0 | 0.1 | GO:0009313 | oligosaccharide catabolic process(GO:0009313) |
0.0 | 0.1 | GO:0000244 | spliceosomal tri-snRNP complex assembly(GO:0000244) |
0.0 | 0.0 | GO:0090315 | negative regulation of protein targeting to membrane(GO:0090315) |
0.0 | 0.0 | GO:0071462 | cellular response to water stimulus(GO:0071462) |
0.0 | 0.1 | GO:0060050 | positive regulation of protein glycosylation(GO:0060050) |
0.0 | 0.1 | GO:0002457 | T cell antigen processing and presentation(GO:0002457) |
0.0 | 0.4 | GO:0006890 | retrograde vesicle-mediated transport, Golgi to ER(GO:0006890) |
0.0 | 0.3 | GO:0050891 | multicellular organismal water homeostasis(GO:0050891) |
0.0 | 0.1 | GO:0048712 | negative regulation of astrocyte differentiation(GO:0048712) |
0.0 | 0.0 | GO:0015838 | amino-acid betaine transport(GO:0015838) |
0.0 | 0.0 | GO:1902031 | regulation of NADP metabolic process(GO:1902031) |
0.0 | 0.1 | GO:0042246 | tissue regeneration(GO:0042246) |
0.0 | 0.0 | GO:2000857 | positive regulation of mineralocorticoid secretion(GO:2000857) positive regulation of aldosterone secretion(GO:2000860) |
0.0 | 0.3 | GO:0001574 | ganglioside biosynthetic process(GO:0001574) |
0.0 | 0.1 | GO:0031133 | regulation of axon diameter(GO:0031133) |
0.0 | 0.0 | GO:1902988 | neurofibrillary tangle assembly(GO:1902988) regulation of neurofibrillary tangle assembly(GO:1902996) |
0.0 | 0.0 | GO:0000972 | transcription-dependent tethering of RNA polymerase II gene DNA at nuclear periphery(GO:0000972) |
0.0 | 0.0 | GO:0002679 | respiratory burst involved in defense response(GO:0002679) |
0.0 | 0.5 | GO:0007062 | sister chromatid cohesion(GO:0007062) |
0.0 | 0.0 | GO:0043654 | recognition of apoptotic cell(GO:0043654) |
0.0 | 0.0 | GO:0060741 | prostate gland stromal morphogenesis(GO:0060741) |
0.0 | 0.1 | GO:0015721 | bile acid and bile salt transport(GO:0015721) |
0.0 | 0.2 | GO:0006670 | sphingosine metabolic process(GO:0006670) |
0.0 | 0.1 | GO:0030321 | transepithelial chloride transport(GO:0030321) |
0.0 | 0.1 | GO:0042501 | serine phosphorylation of STAT3 protein(GO:0033136) serine phosphorylation of STAT protein(GO:0042501) |
0.0 | 0.9 | GO:0046488 | phosphatidylinositol metabolic process(GO:0046488) |
0.0 | 0.0 | GO:0007161 | calcium-independent cell-matrix adhesion(GO:0007161) |
0.0 | 0.1 | GO:0048199 | vesicle targeting, to, from or within Golgi(GO:0048199) |
0.0 | 0.1 | GO:0034773 | histone H4-K20 trimethylation(GO:0034773) |
0.0 | 0.0 | GO:0001866 | NK T cell proliferation(GO:0001866) |
0.0 | 0.1 | GO:0014733 | regulation of skeletal muscle adaptation(GO:0014733) |
0.0 | 0.0 | GO:0046104 | thymidine metabolic process(GO:0046104) |
0.0 | 0.1 | GO:0021942 | radial glia guided migration of Purkinje cell(GO:0021942) |
0.0 | 0.1 | GO:1902230 | negative regulation of intrinsic apoptotic signaling pathway in response to DNA damage(GO:1902230) |
0.0 | 0.0 | GO:1901187 | regulation of ephrin receptor signaling pathway(GO:1901187) |
0.0 | 0.3 | GO:0016925 | protein sumoylation(GO:0016925) |
0.0 | 0.0 | GO:2001271 | negative regulation of cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:2001271) |
0.0 | 0.1 | GO:0035873 | lactate transport(GO:0015727) lactate transmembrane transport(GO:0035873) plasma membrane lactate transport(GO:0035879) |
0.0 | 0.0 | GO:0009298 | GDP-mannose biosynthetic process(GO:0009298) |
0.0 | 0.9 | GO:0051028 | mRNA transport(GO:0051028) |
0.0 | 0.1 | GO:2000811 | negative regulation of anoikis(GO:2000811) |
0.0 | 0.2 | GO:0006471 | protein ADP-ribosylation(GO:0006471) |
0.0 | 0.0 | GO:1900103 | positive regulation of endoplasmic reticulum unfolded protein response(GO:1900103) |
0.0 | 0.1 | GO:0034398 | telomere tethering at nuclear periphery(GO:0034398) meiotic telomere tethering at nuclear periphery(GO:0044821) meiotic attachment of telomere to nuclear envelope(GO:0070197) chromosome attachment to the nuclear envelope(GO:0097240) |
0.0 | 0.0 | GO:0030578 | PML body organization(GO:0030578) |
0.0 | 0.0 | GO:2001032 | regulation of double-strand break repair via nonhomologous end joining(GO:2001032) |
0.0 | 0.0 | GO:0010746 | regulation of plasma membrane long-chain fatty acid transport(GO:0010746) |
0.0 | 0.0 | GO:0002215 | defense response to nematode(GO:0002215) |
0.0 | 0.0 | GO:0097503 | sialylation(GO:0097503) |
0.0 | 0.0 | GO:0007008 | outer mitochondrial membrane organization(GO:0007008) |
0.0 | 0.1 | GO:1902042 | negative regulation of extrinsic apoptotic signaling pathway via death domain receptors(GO:1902042) |
0.0 | 0.0 | GO:0061370 | testosterone biosynthetic process(GO:0061370) |
0.0 | 0.0 | GO:0010446 | response to alkaline pH(GO:0010446) |
0.0 | 0.0 | GO:1903279 | regulation of calcium:sodium antiporter activity(GO:1903279) |
0.0 | 0.1 | GO:0032926 | negative regulation of activin receptor signaling pathway(GO:0032926) |
0.0 | 0.1 | GO:1990845 | diet induced thermogenesis(GO:0002024) adaptive thermogenesis(GO:1990845) |
0.0 | 0.0 | GO:0071316 | cellular response to nicotine(GO:0071316) |
0.0 | 0.2 | GO:0032981 | NADH dehydrogenase complex assembly(GO:0010257) mitochondrial respiratory chain complex I assembly(GO:0032981) mitochondrial respiratory chain complex I biogenesis(GO:0097031) |
0.0 | 0.1 | GO:0006855 | drug transmembrane transport(GO:0006855) |
0.0 | 0.1 | GO:0043248 | proteasome assembly(GO:0043248) |
0.0 | 0.0 | GO:1902474 | positive regulation of protein localization to synapse(GO:1902474) |
0.0 | 0.0 | GO:0097428 | protein maturation by iron-sulfur cluster transfer(GO:0097428) |
0.0 | 0.2 | GO:0000470 | maturation of LSU-rRNA(GO:0000470) |
0.0 | 0.1 | GO:1902018 | negative regulation of cilium assembly(GO:1902018) |
0.0 | 0.0 | GO:0000055 | ribosomal large subunit export from nucleus(GO:0000055) |
0.0 | 0.1 | GO:0034723 | DNA replication-dependent nucleosome assembly(GO:0006335) DNA replication-dependent nucleosome organization(GO:0034723) |
0.0 | 0.4 | GO:0002181 | cytoplasmic translation(GO:0002181) |
0.0 | 0.0 | GO:0006407 | rRNA export from nucleus(GO:0006407) |
0.0 | 0.0 | GO:0001302 | replicative cell aging(GO:0001302) |
0.0 | 0.1 | GO:0051127 | positive regulation of actin nucleation(GO:0051127) |
0.0 | 0.0 | GO:0051315 | attachment of mitotic spindle microtubules to kinetochore(GO:0051315) |
0.0 | 0.0 | GO:0021570 | rhombomere 4 development(GO:0021570) |
0.0 | 0.0 | GO:0031581 | hemidesmosome assembly(GO:0031581) |
0.0 | 0.1 | GO:0015695 | organic cation transport(GO:0015695) |
0.0 | 0.0 | GO:0034372 | very-low-density lipoprotein particle remodeling(GO:0034372) |
0.0 | 0.1 | GO:0000245 | spliceosomal complex assembly(GO:0000245) |
0.0 | 1.1 | GO:0042787 | protein ubiquitination involved in ubiquitin-dependent protein catabolic process(GO:0042787) |
0.0 | 0.0 | GO:0009449 | gamma-aminobutyric acid biosynthetic process(GO:0009449) |
0.0 | 0.0 | GO:0032460 | negative regulation of protein oligomerization(GO:0032460) |
0.0 | 0.0 | GO:0035809 | regulation of urine volume(GO:0035809) |
0.0 | 0.0 | GO:0061622 | glycolytic process through glucose-1-phosphate(GO:0061622) |
0.0 | 0.1 | GO:0010875 | positive regulation of cholesterol efflux(GO:0010875) |
0.0 | 0.0 | GO:0031053 | primary miRNA processing(GO:0031053) |
0.0 | 0.0 | GO:0042359 | vitamin D metabolic process(GO:0042359) |
0.0 | 0.1 | GO:0035520 | monoubiquitinated protein deubiquitination(GO:0035520) |
0.0 | 0.0 | GO:2001185 | regulation of CD8-positive, alpha-beta T cell activation(GO:2001185) |
0.0 | 0.0 | GO:0002414 | immunoglobulin transcytosis in epithelial cells(GO:0002414) |
0.0 | 0.0 | GO:0010936 | negative regulation of macrophage cytokine production(GO:0010936) |
0.0 | 0.1 | GO:0019985 | translesion synthesis(GO:0019985) |
0.0 | 0.0 | GO:0000711 | meiotic DNA repair synthesis(GO:0000711) |
0.0 | 0.0 | GO:0010847 | regulation of chromatin assembly(GO:0010847) |
0.0 | 0.0 | GO:0060931 | sinoatrial node cell development(GO:0060931) |
0.0 | 0.0 | GO:1901678 | iron coordination entity transport(GO:1901678) |
0.0 | 0.1 | GO:0061099 | negative regulation of protein tyrosine kinase activity(GO:0061099) |
0.0 | 0.0 | GO:0007158 | neuron cell-cell adhesion(GO:0007158) |
0.0 | 0.0 | GO:0035771 | interleukin-4-mediated signaling pathway(GO:0035771) |
0.0 | 0.0 | GO:0051387 | negative regulation of neurotrophin TRK receptor signaling pathway(GO:0051387) |
0.0 | 0.0 | GO:0015867 | ATP transport(GO:0015867) |
0.0 | 0.1 | GO:0030150 | protein import into mitochondrial matrix(GO:0030150) |
0.0 | 0.0 | GO:0003163 | sinoatrial node development(GO:0003163) growth involved in heart morphogenesis(GO:0003241) sinoatrial node cell differentiation(GO:0060921) |
0.0 | 0.2 | GO:0070328 | acylglycerol homeostasis(GO:0055090) triglyceride homeostasis(GO:0070328) |
0.0 | 0.0 | GO:0045591 | positive regulation of regulatory T cell differentiation(GO:0045591) |
0.0 | 0.0 | GO:0070168 | negative regulation of biomineral tissue development(GO:0070168) |
0.0 | 0.0 | GO:0042376 | phylloquinone metabolic process(GO:0042374) phylloquinone catabolic process(GO:0042376) quinone catabolic process(GO:1901662) |
0.0 | 0.4 | GO:0016126 | sterol biosynthetic process(GO:0016126) |
0.0 | 0.1 | GO:0045217 | cell-cell junction maintenance(GO:0045217) |
0.0 | 0.0 | GO:0015744 | succinate transport(GO:0015744) |
0.0 | 0.0 | GO:0001921 | positive regulation of receptor recycling(GO:0001921) |
0.0 | 0.1 | GO:0048268 | clathrin coat assembly(GO:0048268) |
0.0 | 0.2 | GO:0016239 | positive regulation of macroautophagy(GO:0016239) |
0.0 | 0.0 | GO:0002326 | B cell lineage commitment(GO:0002326) |
0.0 | 0.2 | GO:0007029 | endoplasmic reticulum organization(GO:0007029) |
0.0 | 0.3 | GO:0006637 | acyl-CoA metabolic process(GO:0006637) thioester metabolic process(GO:0035383) |
0.0 | 0.2 | GO:0033120 | positive regulation of RNA splicing(GO:0033120) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.4 | 1.2 | GO:0000172 | ribonuclease MRP complex(GO:0000172) |
0.4 | 1.1 | GO:0044393 | microspike(GO:0044393) |
0.2 | 1.0 | GO:0061689 | tricellular tight junction(GO:0061689) |
0.2 | 0.7 | GO:0005967 | mitochondrial pyruvate dehydrogenase complex(GO:0005967) |
0.2 | 0.9 | GO:0000408 | EKC/KEOPS complex(GO:0000408) |
0.2 | 1.3 | GO:0031258 | lamellipodium membrane(GO:0031258) |
0.2 | 0.6 | GO:0034673 | inhibin-betaglycan-ActRII complex(GO:0034673) |
0.2 | 0.6 | GO:0071664 | catenin-TCF7L2 complex(GO:0071664) |
0.2 | 0.7 | GO:0071953 | elastic fiber(GO:0071953) |
0.2 | 2.6 | GO:0071004 | U2-type prespliceosome(GO:0071004) |
0.2 | 0.6 | GO:0071203 | WASH complex(GO:0071203) |
0.1 | 0.6 | GO:0071256 | Sec61 translocon complex(GO:0005784) translocon complex(GO:0071256) |
0.1 | 0.5 | GO:1990851 | Wnt-Frizzled-LRP5/6 complex(GO:1990851) |
0.1 | 0.8 | GO:0019907 | cyclin-dependent protein kinase activating kinase holoenzyme complex(GO:0019907) |
0.1 | 0.6 | GO:0034388 | Pwp2p-containing subcomplex of 90S preribosome(GO:0034388) |
0.1 | 0.5 | GO:0042825 | TAP complex(GO:0042825) |
0.1 | 0.9 | GO:0042587 | glycogen granule(GO:0042587) |
0.1 | 0.5 | GO:0070531 | BRCA1-A complex(GO:0070531) |
0.1 | 0.7 | GO:0033256 | I-kappaB/NF-kappaB complex(GO:0033256) |
0.1 | 0.3 | GO:0060053 | neurofilament cytoskeleton(GO:0060053) |
0.1 | 0.3 | GO:0031088 | platelet dense granule membrane(GO:0031088) |
0.1 | 0.1 | GO:1903349 | omegasome membrane(GO:1903349) |
0.1 | 0.7 | GO:0035748 | myelin sheath abaxonal region(GO:0035748) |
0.1 | 0.3 | GO:0044352 | pinosome(GO:0044352) macropinosome(GO:0044354) |
0.1 | 0.3 | GO:0030127 | COPII vesicle coat(GO:0030127) |
0.1 | 0.3 | GO:0043219 | lateral loop(GO:0043219) |
0.1 | 0.3 | GO:1990712 | HFE-transferrin receptor complex(GO:1990712) |
0.1 | 2.3 | GO:0010494 | cytoplasmic stress granule(GO:0010494) |
0.1 | 0.9 | GO:0036038 | MKS complex(GO:0036038) |
0.1 | 0.3 | GO:0070032 | synaptobrevin 2-SNAP-25-syntaxin-1a-complexin I complex(GO:0070032) |
0.1 | 2.5 | GO:0005637 | nuclear inner membrane(GO:0005637) |
0.1 | 1.6 | GO:0000407 | pre-autophagosomal structure(GO:0000407) |
0.1 | 0.4 | GO:0016342 | catenin complex(GO:0016342) |
0.1 | 0.2 | GO:0072357 | PTW/PP1 phosphatase complex(GO:0072357) |
0.1 | 0.7 | GO:0031528 | microvillus membrane(GO:0031528) |
0.1 | 0.3 | GO:0001651 | dense fibrillar component(GO:0001651) |
0.1 | 1.5 | GO:0055038 | recycling endosome membrane(GO:0055038) |
0.1 | 0.2 | GO:0048179 | activin receptor complex(GO:0048179) |
0.1 | 0.3 | GO:0005579 | membrane attack complex(GO:0005579) |
0.1 | 0.1 | GO:0020018 | ciliary pocket(GO:0020016) ciliary pocket membrane(GO:0020018) |
0.1 | 0.3 | GO:0000220 | vacuolar proton-transporting V-type ATPase, V0 domain(GO:0000220) |
0.1 | 0.2 | GO:0097443 | sorting endosome(GO:0097443) |
0.1 | 0.3 | GO:0030485 | smooth muscle contractile fiber(GO:0030485) |
0.1 | 0.2 | GO:0071204 | histone pre-mRNA 3'end processing complex(GO:0071204) |
0.1 | 0.4 | GO:0020005 | symbiont-containing vacuole membrane(GO:0020005) |
0.1 | 0.4 | GO:0008385 | IkappaB kinase complex(GO:0008385) |
0.0 | 0.2 | GO:0031428 | box C/D snoRNP complex(GO:0031428) |
0.0 | 2.8 | GO:0072686 | mitotic spindle(GO:0072686) |
0.0 | 1.3 | GO:0035861 | site of double-strand break(GO:0035861) |
0.0 | 0.2 | GO:0033503 | HULC complex(GO:0033503) |
0.0 | 0.1 | GO:0036488 | CHOP-C/EBP complex(GO:0036488) |
0.0 | 1.5 | GO:0005801 | cis-Golgi network(GO:0005801) |
0.0 | 0.2 | GO:0042583 | chromaffin granule(GO:0042583) |
0.0 | 0.3 | GO:0005952 | cAMP-dependent protein kinase complex(GO:0005952) |
0.0 | 0.1 | GO:0016222 | procollagen-proline 4-dioxygenase complex(GO:0016222) |
0.0 | 4.5 | GO:0072562 | blood microparticle(GO:0072562) |
0.0 | 0.2 | GO:1990111 | spermatoproteasome complex(GO:1990111) |
0.0 | 0.2 | GO:0008622 | epsilon DNA polymerase complex(GO:0008622) |
0.0 | 0.6 | GO:0002102 | podosome(GO:0002102) |
0.0 | 0.1 | GO:0070939 | Dsl1p complex(GO:0070939) |
0.0 | 0.2 | GO:0001650 | fibrillar center(GO:0001650) |
0.0 | 0.2 | GO:0045098 | type III intermediate filament(GO:0045098) |
0.0 | 0.1 | GO:0033162 | melanosome membrane(GO:0033162) chitosome(GO:0045009) |
0.0 | 0.1 | GO:0043511 | inhibin complex(GO:0043511) |
0.0 | 0.8 | GO:0090544 | BAF-type complex(GO:0090544) |
0.0 | 0.3 | GO:0019773 | proteasome core complex, alpha-subunit complex(GO:0019773) |
0.0 | 0.2 | GO:0072669 | tRNA-splicing ligase complex(GO:0072669) |
0.0 | 0.1 | GO:0097524 | sperm plasma membrane(GO:0097524) |
0.0 | 0.1 | GO:0045298 | tubulin complex(GO:0045298) |
0.0 | 0.2 | GO:0031415 | NatA complex(GO:0031415) |
0.0 | 0.2 | GO:0030130 | clathrin coat of trans-Golgi network vesicle(GO:0030130) |
0.0 | 0.6 | GO:0032839 | dendrite cytoplasm(GO:0032839) |
0.0 | 0.1 | GO:0030478 | actin cap(GO:0030478) |
0.0 | 0.2 | GO:0030312 | external encapsulating structure(GO:0030312) |
0.0 | 0.2 | GO:0031983 | vesicle lumen(GO:0031983) |
0.0 | 0.1 | GO:0014731 | spectrin-associated cytoskeleton(GO:0014731) |
0.0 | 2.7 | GO:0070160 | bicellular tight junction(GO:0005923) occluding junction(GO:0070160) |
0.0 | 1.3 | GO:0030864 | cortical actin cytoskeleton(GO:0030864) |
0.0 | 0.1 | GO:0005914 | spot adherens junction(GO:0005914) |
0.0 | 0.3 | GO:0017146 | NMDA selective glutamate receptor complex(GO:0017146) |
0.0 | 0.1 | GO:0016281 | eukaryotic translation initiation factor 4F complex(GO:0016281) |
0.0 | 0.3 | GO:0000164 | protein phosphatase type 1 complex(GO:0000164) |
0.0 | 0.1 | GO:0031933 | telomeric heterochromatin(GO:0031933) |
0.0 | 0.2 | GO:0016471 | vacuolar proton-transporting V-type ATPase complex(GO:0016471) |
0.0 | 0.0 | GO:0034363 | intermediate-density lipoprotein particle(GO:0034363) |
0.0 | 0.3 | GO:0090665 | dystrophin-associated glycoprotein complex(GO:0016010) glycoprotein complex(GO:0090665) |
0.0 | 0.0 | GO:0032010 | phagolysosome(GO:0032010) |
0.0 | 0.9 | GO:0032432 | actin filament bundle(GO:0032432) |
0.0 | 0.0 | GO:0034679 | integrin alpha9-beta1 complex(GO:0034679) |
0.0 | 0.2 | GO:0031143 | pseudopodium(GO:0031143) |
0.0 | 0.2 | GO:0005742 | mitochondrial outer membrane translocase complex(GO:0005742) |
0.0 | 0.5 | GO:0000786 | nucleosome(GO:0000786) |
0.0 | 0.1 | GO:0097452 | GAIT complex(GO:0097452) |
0.0 | 0.1 | GO:0001931 | uropod(GO:0001931) cell trailing edge(GO:0031254) |
0.0 | 0.1 | GO:1990909 | Wnt signalosome(GO:1990909) |
0.0 | 0.2 | GO:0032593 | insulin-responsive compartment(GO:0032593) |
0.0 | 0.3 | GO:0000307 | cyclin-dependent protein kinase holoenzyme complex(GO:0000307) |
0.0 | 0.0 | GO:0005683 | U7 snRNP(GO:0005683) |
0.0 | 0.1 | GO:0000814 | ESCRT II complex(GO:0000814) |
0.0 | 0.4 | GO:0031941 | filamentous actin(GO:0031941) |
0.0 | 0.2 | GO:0034709 | methylosome(GO:0034709) |
0.0 | 0.4 | GO:0015030 | Cajal body(GO:0015030) |
0.0 | 1.2 | GO:0000118 | histone deacetylase complex(GO:0000118) |
0.0 | 0.3 | GO:0031231 | intrinsic component of peroxisomal membrane(GO:0031231) |
0.0 | 0.1 | GO:0009331 | glycerol-3-phosphate dehydrogenase complex(GO:0009331) |
0.0 | 0.5 | GO:0001772 | immunological synapse(GO:0001772) |
0.0 | 0.2 | GO:0005847 | mRNA cleavage and polyadenylation specificity factor complex(GO:0005847) |
0.0 | 0.1 | GO:0031094 | platelet dense tubular network(GO:0031094) |
0.0 | 0.3 | GO:0005697 | telomerase holoenzyme complex(GO:0005697) |
0.0 | 0.2 | GO:0032982 | myosin filament(GO:0032982) |
0.0 | 0.7 | GO:0008023 | transcription elongation factor complex(GO:0008023) |
0.0 | 0.1 | GO:0098576 | integral component of cytoplasmic side of endoplasmic reticulum membrane(GO:0071458) integral component of lumenal side of endoplasmic reticulum membrane(GO:0071556) lumenal side of endoplasmic reticulum membrane(GO:0098553) lumenal side of membrane(GO:0098576) |
0.0 | 1.0 | GO:0035097 | histone methyltransferase complex(GO:0035097) |
0.0 | 0.1 | GO:0046691 | intracellular canaliculus(GO:0046691) |
0.0 | 0.1 | GO:0016602 | CCAAT-binding factor complex(GO:0016602) |
0.0 | 0.2 | GO:0031080 | nuclear pore outer ring(GO:0031080) |
0.0 | 0.8 | GO:0005788 | endoplasmic reticulum lumen(GO:0005788) |
0.0 | 0.1 | GO:1990696 | USH2 complex(GO:1990696) |
0.0 | 0.1 | GO:0032009 | early phagosome(GO:0032009) |
0.0 | 0.1 | GO:0031465 | Cul4B-RING E3 ubiquitin ligase complex(GO:0031465) |
0.0 | 0.1 | GO:0030891 | VCB complex(GO:0030891) |
0.0 | 0.1 | GO:0045179 | apical cortex(GO:0045179) |
0.0 | 0.1 | GO:0012507 | ER to Golgi transport vesicle membrane(GO:0012507) |
0.0 | 0.6 | GO:0005747 | mitochondrial respiratory chain complex I(GO:0005747) NADH dehydrogenase complex(GO:0030964) respiratory chain complex I(GO:0045271) |
0.0 | 0.3 | GO:0008180 | COP9 signalosome(GO:0008180) |
0.0 | 0.0 | GO:0030956 | glutamyl-tRNA(Gln) amidotransferase complex(GO:0030956) |
0.0 | 0.2 | GO:0030057 | desmosome(GO:0030057) |
0.0 | 0.0 | GO:1990923 | PET complex(GO:1990923) |
0.0 | 0.1 | GO:0030991 | intraciliary transport particle A(GO:0030991) |
0.0 | 0.0 | GO:0034666 | integrin alpha2-beta1 complex(GO:0034666) |
0.0 | 0.4 | GO:0031519 | PcG protein complex(GO:0031519) |
0.0 | 0.0 | GO:0005594 | collagen type IX trimer(GO:0005594) |
0.0 | 0.1 | GO:0000127 | transcription factor TFIIIC complex(GO:0000127) |
0.0 | 0.2 | GO:0005868 | cytoplasmic dynein complex(GO:0005868) |
0.0 | 0.0 | GO:0033186 | CAF-1 complex(GO:0033186) |
0.0 | 0.0 | GO:0005638 | lamin filament(GO:0005638) |
0.0 | 0.1 | GO:0031209 | SCAR complex(GO:0031209) |
0.0 | 0.2 | GO:0030863 | cortical cytoskeleton(GO:0030863) |
0.0 | 0.1 | GO:0034518 | mRNA cap binding complex(GO:0005845) RNA cap binding complex(GO:0034518) |
0.0 | 0.3 | GO:0030687 | preribosome, large subunit precursor(GO:0030687) |
0.0 | 0.0 | GO:0031523 | Myb complex(GO:0031523) |
0.0 | 0.1 | GO:0032039 | integrator complex(GO:0032039) |
0.0 | 0.0 | GO:0035867 | alphav-beta3 integrin-IGF-1-IGF1R complex(GO:0035867) |
0.0 | 0.2 | GO:0005852 | eukaryotic translation initiation factor 3 complex(GO:0005852) |
0.0 | 0.1 | GO:0071546 | pi-body(GO:0071546) |
0.0 | 0.1 | GO:0001891 | phagocytic cup(GO:0001891) |
0.0 | 0.1 | GO:0032777 | Piccolo NuA4 histone acetyltransferase complex(GO:0032777) |
0.0 | 0.1 | GO:0005849 | mRNA cleavage factor complex(GO:0005849) |
0.0 | 0.1 | GO:0048476 | Holliday junction resolvase complex(GO:0048476) |
0.0 | 0.2 | GO:0097440 | apical dendrite(GO:0097440) |
0.0 | 0.5 | GO:0045095 | keratin filament(GO:0045095) |
0.0 | 0.0 | GO:0071141 | SMAD protein complex(GO:0071141) |
0.0 | 0.0 | GO:0044316 | cone cell pedicle(GO:0044316) |
0.0 | 0.2 | GO:0043196 | varicosity(GO:0043196) |
0.0 | 0.8 | GO:0000776 | kinetochore(GO:0000776) |
0.0 | 3.4 | GO:0005667 | transcription factor complex(GO:0005667) |
0.0 | 0.1 | GO:0098827 | endoplasmic reticulum subcompartment(GO:0098827) |
0.0 | 0.1 | GO:0030056 | hemidesmosome(GO:0030056) |
0.0 | 0.0 | GO:0097433 | dense body(GO:0097433) |
0.0 | 0.0 | GO:0042105 | alpha-beta T cell receptor complex(GO:0042105) |
0.0 | 0.1 | GO:0005744 | mitochondrial inner membrane presequence translocase complex(GO:0005744) |
0.0 | 0.2 | GO:0030992 | intraciliary transport particle B(GO:0030992) |
0.0 | 0.1 | GO:0002116 | semaphorin receptor complex(GO:0002116) |
0.0 | 0.1 | GO:0031501 | mannosyltransferase complex(GO:0031501) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.4 | 1.2 | GO:0000171 | ribonuclease MRP activity(GO:0000171) |
0.3 | 2.4 | GO:1904264 | ubiquitin protein ligase activity involved in ERAD pathway(GO:1904264) |
0.3 | 1.0 | GO:0016842 | amidine-lyase activity(GO:0016842) |
0.3 | 1.3 | GO:0004740 | pyruvate dehydrogenase (acetyl-transferring) kinase activity(GO:0004740) |
0.2 | 0.6 | GO:0004920 | interleukin-10 receptor activity(GO:0004920) |
0.2 | 0.8 | GO:0004703 | G-protein coupled receptor kinase activity(GO:0004703) |
0.2 | 0.5 | GO:0046573 | lactonohydrolase activity(GO:0046573) acyl-L-homoserine-lactone lactonohydrolase activity(GO:0102007) |
0.2 | 1.2 | GO:0003680 | AT DNA binding(GO:0003680) |
0.2 | 0.9 | GO:1990226 | histone methyltransferase binding(GO:1990226) |
0.2 | 0.5 | GO:0016774 | phosphotransferase activity, carboxyl group as acceptor(GO:0016774) |
0.2 | 0.8 | GO:0046975 | histone methyltransferase activity (H3-K36 specific)(GO:0046975) |
0.2 | 0.5 | GO:0046979 | TAP1 binding(GO:0046978) TAP2 binding(GO:0046979) |
0.2 | 0.5 | GO:0070905 | serine binding(GO:0070905) |
0.2 | 2.9 | GO:0008157 | protein phosphatase 1 binding(GO:0008157) |
0.1 | 1.0 | GO:0005078 | MAP-kinase scaffold activity(GO:0005078) |
0.1 | 1.0 | GO:0050700 | CARD domain binding(GO:0050700) |
0.1 | 0.4 | GO:0009041 | uridylate kinase activity(GO:0009041) |
0.1 | 0.3 | GO:0070644 | vitamin D response element binding(GO:0070644) |
0.1 | 0.4 | GO:0034186 | apolipoprotein A-I binding(GO:0034186) |
0.1 | 1.1 | GO:0016889 | endodeoxyribonuclease activity, producing 3'-phosphomonoesters(GO:0016889) |
0.1 | 0.5 | GO:0015375 | glycine:sodium symporter activity(GO:0015375) |
0.1 | 0.7 | GO:0051959 | dynein light intermediate chain binding(GO:0051959) |
0.1 | 4.0 | GO:0070888 | E-box binding(GO:0070888) |
0.1 | 1.3 | GO:0048185 | activin binding(GO:0048185) |
0.1 | 1.6 | GO:0034236 | protein kinase A catalytic subunit binding(GO:0034236) |
0.1 | 1.1 | GO:0015651 | quaternary ammonium group transmembrane transporter activity(GO:0015651) |
0.1 | 0.9 | GO:0004534 | 5'-3' exoribonuclease activity(GO:0004534) |
0.1 | 0.4 | GO:0008532 | N-acetyllactosaminide beta-1,3-N-acetylglucosaminyltransferase activity(GO:0008532) |
0.1 | 0.8 | GO:0097371 | MDM2/MDM4 family protein binding(GO:0097371) |
0.1 | 0.4 | GO:0005332 | gamma-aminobutyric acid:sodium symporter activity(GO:0005332) |
0.1 | 0.4 | GO:0051525 | NFAT protein binding(GO:0051525) |
0.1 | 0.6 | GO:0016936 | galactoside binding(GO:0016936) |
0.1 | 0.6 | GO:0005384 | manganese ion transmembrane transporter activity(GO:0005384) |
0.1 | 0.3 | GO:0030519 | snoRNP binding(GO:0030519) |
0.1 | 0.6 | GO:0016176 | superoxide-generating NADPH oxidase activator activity(GO:0016176) |
0.1 | 0.5 | GO:0032027 | myosin light chain binding(GO:0032027) |
0.1 | 0.7 | GO:0008545 | JUN kinase kinase activity(GO:0008545) |
0.1 | 0.3 | GO:0000340 | RNA 7-methylguanosine cap binding(GO:0000340) |
0.1 | 1.0 | GO:0005161 | platelet-derived growth factor receptor binding(GO:0005161) |
0.1 | 0.6 | GO:0019534 | toxin transporter activity(GO:0019534) |
0.1 | 1.3 | GO:0005003 | ephrin receptor activity(GO:0005003) |
0.1 | 0.7 | GO:0031545 | peptidyl-proline 4-dioxygenase activity(GO:0031545) |
0.1 | 0.1 | GO:0019912 | cyclin-dependent protein kinase activating kinase activity(GO:0019912) |
0.1 | 0.2 | GO:0004082 | bisphosphoglycerate mutase activity(GO:0004082) phosphoglycerate mutase activity(GO:0004619) 2,3-bisphosphoglycerate-dependent phosphoglycerate mutase activity(GO:0046538) |
0.1 | 0.2 | GO:0004706 | JUN kinase kinase kinase activity(GO:0004706) |
0.1 | 0.2 | GO:0008597 | calcium-dependent protein serine/threonine phosphatase regulator activity(GO:0008597) |
0.1 | 0.3 | GO:0004558 | alpha-1,4-glucosidase activity(GO:0004558) |
0.1 | 0.2 | GO:0030620 | U2 snRNA binding(GO:0030620) |
0.1 | 0.6 | GO:0071933 | Arp2/3 complex binding(GO:0071933) |
0.1 | 1.8 | GO:0004181 | metallocarboxypeptidase activity(GO:0004181) |
0.1 | 0.4 | GO:0004300 | enoyl-CoA hydratase activity(GO:0004300) |
0.1 | 1.8 | GO:0036002 | pre-mRNA binding(GO:0036002) |
0.1 | 0.3 | GO:0000293 | ferric-chelate reductase activity(GO:0000293) |
0.1 | 0.4 | GO:0090482 | vitamin transmembrane transporter activity(GO:0090482) |
0.1 | 0.6 | GO:0031386 | protein tag(GO:0031386) |
0.1 | 0.8 | GO:0042301 | phosphate ion binding(GO:0042301) |
0.1 | 0.1 | GO:0016427 | tRNA (cytosine) methyltransferase activity(GO:0016427) tRNA (cytosine-5-)-methyltransferase activity(GO:0016428) |
0.1 | 2.8 | GO:0005044 | scavenger receptor activity(GO:0005044) |
0.1 | 0.5 | GO:0035381 | extracellular ATP-gated cation channel activity(GO:0004931) ATP-gated ion channel activity(GO:0035381) |
0.1 | 0.2 | GO:0034928 | mono-butyltin dioxygenase activity(GO:0018586) tri-n-butyltin dioxygenase activity(GO:0018588) di-n-butyltin dioxygenase activity(GO:0018589) methylsilanetriol hydroxylase activity(GO:0018590) methyl tertiary butyl ether 3-monooxygenase activity(GO:0018591) 4-nitrocatechol 4-monooxygenase activity(GO:0018592) 4-chlorophenoxyacetate monooxygenase activity(GO:0018593) tert-butanol 2-monooxygenase activity(GO:0018594) alpha-pinene monooxygenase activity(GO:0018595) dimethylsilanediol hydroxylase activity(GO:0018596) ammonia monooxygenase activity(GO:0018597) hydroxymethylsilanetriol oxidase activity(GO:0018598) 2-hydroxyisobutyrate 3-monooxygenase activity(GO:0018599) alpha-pinene dehydrogenase activity(GO:0018600) bisphenol A hydroxylase B activity(GO:0034559) 2,2-bis(4-hydroxyphenyl)-1-propanol hydroxylase activity(GO:0034562) 9-fluorenone-3,4-dioxygenase activity(GO:0034786) anthracene 9,10-dioxygenase activity(GO:0034816) 2-(methylthio)benzothiazole monooxygenase activity(GO:0034857) 2-hydroxybenzothiazole monooxygenase activity(GO:0034858) benzothiazole monooxygenase activity(GO:0034859) 2,6-dihydroxybenzothiazole monooxygenase activity(GO:0034862) pinacolone 5-monooxygenase activity(GO:0034870) thioacetamide S-oxygenase activity(GO:0034873) thioacetamide S-oxide S-oxygenase activity(GO:0034874) endosulfan monooxygenase I activity(GO:0034888) N-nitrodimethylamine hydroxylase activity(GO:0034893) 4-(1-ethyl-1,4-dimethyl-pentyl)phenol monoxygenase activity(GO:0034897) endosulfan ether monooxygenase activity(GO:0034903) pyrene 4,5-monooxygenase activity(GO:0034925) pyrene 1,2-monooxygenase activity(GO:0034927) 1-hydroxypyrene 6,7-monooxygenase activity(GO:0034928) 1-hydroxypyrene 7,8-monooxygenase activity(GO:0034929) phenylboronic acid monooxygenase activity(GO:0034950) spheroidene monooxygenase activity(GO:0043823) |
0.1 | 0.3 | GO:0050897 | cobalt ion binding(GO:0050897) |
0.1 | 2.0 | GO:0001102 | RNA polymerase II activating transcription factor binding(GO:0001102) |
0.1 | 0.3 | GO:0070053 | thrombospondin receptor activity(GO:0070053) |
0.1 | 0.3 | GO:0008440 | inositol-1,4,5-trisphosphate 3-kinase activity(GO:0008440) |
0.1 | 0.2 | GO:0016309 | 1-phosphatidylinositol-5-phosphate 4-kinase activity(GO:0016309) |
0.1 | 0.2 | GO:0016716 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, another compound as one donor, and incorporation of one atom of oxygen(GO:0016716) |
0.1 | 0.2 | GO:0031726 | CCR1 chemokine receptor binding(GO:0031726) |
0.1 | 1.2 | GO:0003950 | NAD+ ADP-ribosyltransferase activity(GO:0003950) |
0.1 | 0.2 | GO:0042731 | PH domain binding(GO:0042731) |
0.1 | 0.2 | GO:0042392 | sphingosine-1-phosphate phosphatase activity(GO:0042392) |
0.1 | 0.3 | GO:0008199 | ferric iron binding(GO:0008199) |
0.1 | 0.3 | GO:0016308 | 1-phosphatidylinositol-4-phosphate 5-kinase activity(GO:0016308) |
0.1 | 0.2 | GO:0015232 | heme transporter activity(GO:0015232) |
0.1 | 1.2 | GO:0051019 | mitogen-activated protein kinase binding(GO:0051019) |
0.1 | 0.2 | GO:0003956 | NAD(P)+-protein-arginine ADP-ribosyltransferase activity(GO:0003956) |
0.1 | 0.2 | GO:0031711 | bradykinin receptor binding(GO:0031711) |
0.1 | 1.9 | GO:0016776 | phosphotransferase activity, phosphate group as acceptor(GO:0016776) |
0.1 | 0.2 | GO:0031013 | troponin I binding(GO:0031013) |
0.1 | 0.6 | GO:0004312 | fatty acid synthase activity(GO:0004312) |
0.1 | 0.3 | GO:0070410 | co-SMAD binding(GO:0070410) |
0.1 | 1.0 | GO:0033613 | activating transcription factor binding(GO:0033613) |
0.1 | 0.2 | GO:0050508 | glucuronosyl-N-acetylglucosaminyl-proteoglycan 4-alpha-N-acetylglucosaminyltransferase activity(GO:0050508) |
0.0 | 0.4 | GO:0016920 | pyroglutamyl-peptidase activity(GO:0016920) |
0.0 | 1.1 | GO:0001205 | transcriptional activator activity, RNA polymerase II distal enhancer sequence-specific binding(GO:0001205) |
0.0 | 0.2 | GO:0015016 | [heparan sulfate]-glucosamine N-sulfotransferase activity(GO:0015016) |
0.0 | 0.2 | GO:0031750 | D3 dopamine receptor binding(GO:0031750) |
0.0 | 0.1 | GO:0003876 | AMP deaminase activity(GO:0003876) adenosine-phosphate deaminase activity(GO:0047623) |
0.0 | 0.8 | GO:0004709 | MAP kinase kinase kinase activity(GO:0004709) |
0.0 | 0.6 | GO:0050811 | GABA receptor binding(GO:0050811) |
0.0 | 0.2 | GO:0070883 | pre-miRNA binding(GO:0070883) |
0.0 | 0.2 | GO:1990254 | keratin filament binding(GO:1990254) |
0.0 | 1.4 | GO:0061631 | ubiquitin conjugating enzyme activity(GO:0061631) |
0.0 | 0.2 | GO:0004430 | 1-phosphatidylinositol 4-kinase activity(GO:0004430) |
0.0 | 1.5 | GO:0042605 | peptide antigen binding(GO:0042605) |
0.0 | 0.2 | GO:0071253 | connexin binding(GO:0071253) |
0.0 | 0.2 | GO:0071074 | eukaryotic initiation factor eIF2 binding(GO:0071074) |
0.0 | 0.3 | GO:0008113 | peptide-methionine (S)-S-oxide reductase activity(GO:0008113) |
0.0 | 0.1 | GO:0008158 | hedgehog receptor activity(GO:0008158) |
0.0 | 0.1 | GO:0071208 | histone pre-mRNA DCP binding(GO:0071208) |
0.0 | 0.2 | GO:0015057 | thrombin receptor activity(GO:0015057) |
0.0 | 0.3 | GO:0050656 | 3'-phosphoadenosine 5'-phosphosulfate binding(GO:0050656) |
0.0 | 1.8 | GO:0000049 | tRNA binding(GO:0000049) |
0.0 | 0.2 | GO:0008430 | selenium binding(GO:0008430) |
0.0 | 0.4 | GO:0045295 | gamma-catenin binding(GO:0045295) |
0.0 | 0.4 | GO:0043539 | protein serine/threonine kinase activator activity(GO:0043539) |
0.0 | 0.1 | GO:0016423 | tRNA (guanine) methyltransferase activity(GO:0016423) |
0.0 | 0.4 | GO:0005123 | death receptor binding(GO:0005123) |
0.0 | 0.1 | GO:0004174 | electron-transferring-flavoprotein dehydrogenase activity(GO:0004174) oxidoreductase activity, acting on the CH-NH group of donors, quinone or similar compound as acceptor(GO:0016649) |
0.0 | 0.1 | GO:0000339 | RNA cap binding(GO:0000339) |
0.0 | 0.1 | GO:0033592 | RNA strand annealing activity(GO:0033592) |
0.0 | 0.1 | GO:0043533 | inositol 1,3,4,5 tetrakisphosphate binding(GO:0043533) |
0.0 | 0.1 | GO:0017034 | Rap guanyl-nucleotide exchange factor activity(GO:0017034) |
0.0 | 0.1 | GO:0004461 | lactose synthase activity(GO:0004461) |
0.0 | 0.1 | GO:0031752 | D5 dopamine receptor binding(GO:0031752) |
0.0 | 0.2 | GO:0070087 | chromo shadow domain binding(GO:0070087) |
0.0 | 0.2 | GO:0070290 | N-acylphosphatidylethanolamine-specific phospholipase D activity(GO:0070290) |
0.0 | 0.1 | GO:0008384 | IkappaB kinase activity(GO:0008384) |
0.0 | 0.4 | GO:0032036 | myosin heavy chain binding(GO:0032036) |
0.0 | 0.2 | GO:0001665 | alpha-N-acetylgalactosaminide alpha-2,6-sialyltransferase activity(GO:0001665) |
0.0 | 0.1 | GO:0017108 | 5'-flap endonuclease activity(GO:0017108) |
0.0 | 0.2 | GO:0005021 | vascular endothelial growth factor-activated receptor activity(GO:0005021) |
0.0 | 0.1 | GO:0046923 | ER retention sequence binding(GO:0046923) |
0.0 | 0.2 | GO:0030976 | thiamine pyrophosphate binding(GO:0030976) |
0.0 | 0.4 | GO:0052835 | cobinamide kinase activity(GO:0008819) phytol kinase activity(GO:0010276) phenol kinase activity(GO:0018720) cyclin-dependent protein kinase activating kinase regulator activity(GO:0019914) inositol tetrakisphosphate 2-kinase activity(GO:0032942) heptose 7-phosphate kinase activity(GO:0033785) aminoglycoside phosphotransferase activity(GO:0034071) eukaryotic elongation factor-2 kinase regulator activity(GO:0042556) eukaryotic elongation factor-2 kinase activator activity(GO:0042557) LPPG:FO 2-phospho-L-lactate transferase activity(GO:0043743) cytidine kinase activity(GO:0043771) glycerate 2-kinase activity(GO:0043798) (S)-lactate 2-kinase activity(GO:0043841) phosphoserine:homoserine phosphotransferase activity(GO:0043899) L-seryl-tRNA(Sec) kinase activity(GO:0043915) phosphocholine transferase activity(GO:0044605) GTP-dependent polynucleotide kinase activity(GO:0051735) farnesol kinase activity(GO:0052668) CTP:2-trans,-6-trans-farnesol kinase activity(GO:0052669) geraniol kinase activity(GO:0052670) geranylgeraniol kinase activity(GO:0052671) CTP:geranylgeraniol kinase activity(GO:0052672) prenol kinase activity(GO:0052673) 1-phosphatidylinositol-5-kinase activity(GO:0052810) 1-phosphatidylinositol-3-phosphate 4-kinase activity(GO:0052811) phosphatidylinositol-3,4-bisphosphate 5-kinase activity(GO:0052812) inositol-3,4,6-trisphosphate 1-kinase activity(GO:0052835) inositol 5-diphosphate pentakisphosphate 5-kinase activity(GO:0052836) inositol diphosphate tetrakisphosphate kinase activity(GO:0052839) |
0.0 | 0.1 | GO:0016015 | morphogen activity(GO:0016015) |
0.0 | 0.2 | GO:0004708 | MAP kinase kinase activity(GO:0004708) |
0.0 | 0.2 | GO:0015280 | ligand-gated sodium channel activity(GO:0015280) |
0.0 | 1.1 | GO:0005154 | epidermal growth factor receptor binding(GO:0005154) |
0.0 | 0.7 | GO:0030515 | snoRNA binding(GO:0030515) |
0.0 | 0.3 | GO:0015194 | L-serine transmembrane transporter activity(GO:0015194) serine transmembrane transporter activity(GO:0022889) |
0.0 | 0.1 | GO:0030984 | kininogen binding(GO:0030984) |
0.0 | 0.4 | GO:0001730 | 2'-5'-oligoadenylate synthetase activity(GO:0001730) |
0.0 | 0.3 | GO:0045294 | alpha-catenin binding(GO:0045294) |
0.0 | 0.7 | GO:0005070 | SH3/SH2 adaptor activity(GO:0005070) |
0.0 | 0.1 | GO:0034416 | bisphosphoglycerate phosphatase activity(GO:0034416) |
0.0 | 0.1 | GO:0016532 | superoxide dismutase copper chaperone activity(GO:0016532) |
0.0 | 0.5 | GO:0004602 | glutathione peroxidase activity(GO:0004602) |
0.0 | 0.5 | GO:0008327 | methyl-CpG binding(GO:0008327) |
0.0 | 0.1 | GO:0002094 | polyprenyltransferase activity(GO:0002094) |
0.0 | 0.1 | GO:1901611 | phosphatidylglycerol binding(GO:1901611) |
0.0 | 0.1 | GO:0031493 | nucleosomal histone binding(GO:0031493) |
0.0 | 0.4 | GO:0035591 | signaling adaptor activity(GO:0035591) |
0.0 | 0.5 | GO:0005540 | hyaluronic acid binding(GO:0005540) |
0.0 | 0.1 | GO:0015101 | organic cation transmembrane transporter activity(GO:0015101) |
0.0 | 0.3 | GO:0030296 | protein tyrosine kinase activator activity(GO:0030296) |
0.0 | 0.2 | GO:0005338 | nucleotide-sugar transmembrane transporter activity(GO:0005338) |
0.0 | 1.0 | GO:0051539 | 4 iron, 4 sulfur cluster binding(GO:0051539) |
0.0 | 0.1 | GO:0004022 | alcohol dehydrogenase (NAD) activity(GO:0004022) |
0.0 | 0.1 | GO:0000104 | succinate dehydrogenase activity(GO:0000104) |
0.0 | 0.2 | GO:0003720 | telomerase activity(GO:0003720) RNA-directed DNA polymerase activity(GO:0003964) |
0.0 | 0.1 | GO:0008526 | phosphatidylinositol transporter activity(GO:0008526) |
0.0 | 0.8 | GO:0005132 | type I interferon receptor binding(GO:0005132) |
0.0 | 0.2 | GO:0004185 | serine-type carboxypeptidase activity(GO:0004185) |
0.0 | 0.2 | GO:0016857 | racemase and epimerase activity, acting on carbohydrates and derivatives(GO:0016857) |
0.0 | 0.1 | GO:0004711 | ribosomal protein S6 kinase activity(GO:0004711) |
0.0 | 0.1 | GO:0032050 | clathrin heavy chain binding(GO:0032050) |
0.0 | 0.5 | GO:0045296 | cadherin binding(GO:0045296) |
0.0 | 0.1 | GO:0015220 | choline transmembrane transporter activity(GO:0015220) |
0.0 | 1.4 | GO:0002039 | p53 binding(GO:0002039) |
0.0 | 0.1 | GO:0008260 | 3-oxoacid CoA-transferase activity(GO:0008260) |
0.0 | 0.1 | GO:0017169 | CDP-alcohol phosphatidyltransferase activity(GO:0017169) |
0.0 | 0.2 | GO:0097153 | cysteine-type endopeptidase activity involved in apoptotic process(GO:0097153) |
0.0 | 0.1 | GO:0035033 | histone deacetylase regulator activity(GO:0035033) |
0.0 | 0.2 | GO:0015266 | protein channel activity(GO:0015266) |
0.0 | 0.1 | GO:0043120 | tumor necrosis factor binding(GO:0043120) |
0.0 | 0.2 | GO:0070300 | phosphatidic acid binding(GO:0070300) |
0.0 | 0.1 | GO:0008140 | cAMP response element binding protein binding(GO:0008140) |
0.0 | 0.1 | GO:0051022 | Rho GDP-dissociation inhibitor binding(GO:0051022) |
0.0 | 0.7 | GO:0000907 | sulfonate dioxygenase activity(GO:0000907) 2,4-dichlorophenoxyacetate alpha-ketoglutarate dioxygenase activity(GO:0018602) hypophosphite dioxygenase activity(GO:0034792) gibberellin 2-beta-dioxygenase activity(GO:0045543) C-19 gibberellin 2-beta-dioxygenase activity(GO:0052634) C-20 gibberellin 2-beta-dioxygenase activity(GO:0052635) |
0.0 | 0.1 | GO:0051864 | histone demethylase activity (H3-K36 specific)(GO:0051864) |
0.0 | 0.4 | GO:0004089 | carbonate dehydratase activity(GO:0004089) |
0.0 | 0.1 | GO:0005324 | long-chain fatty acid transporter activity(GO:0005324) |
0.0 | 0.5 | GO:0043027 | cysteine-type endopeptidase inhibitor activity involved in apoptotic process(GO:0043027) |
0.0 | 0.0 | GO:0051575 | 5'-deoxyribose-5-phosphate lyase activity(GO:0051575) |
0.0 | 0.3 | GO:0001671 | ATPase activator activity(GO:0001671) |
0.0 | 0.2 | GO:0070700 | BMP receptor binding(GO:0070700) |
0.0 | 0.6 | GO:0032266 | phosphatidylinositol-3-phosphate binding(GO:0032266) |
0.0 | 0.0 | GO:0004096 | catalase activity(GO:0004096) |
0.0 | 0.2 | GO:0008568 | microtubule-severing ATPase activity(GO:0008568) |
0.0 | 0.2 | GO:0004596 | peptide alpha-N-acetyltransferase activity(GO:0004596) |
0.0 | 0.1 | GO:0034902 | alkyl sulfatase activity(GO:0018741) endosulfan hemisulfate sulfatase activity(GO:0034889) endosulfan sulfate hydrolase activity(GO:0034902) |
0.0 | 0.1 | GO:0017153 | sodium:dicarboxylate symporter activity(GO:0017153) |
0.0 | 0.4 | GO:0035259 | glucocorticoid receptor binding(GO:0035259) |
0.0 | 0.1 | GO:0032564 | dATP binding(GO:0032564) |
0.0 | 0.4 | GO:0005158 | insulin receptor binding(GO:0005158) |
0.0 | 0.6 | GO:0016418 | S-acetyltransferase activity(GO:0016418) |
0.0 | 0.1 | GO:0009374 | biotin binding(GO:0009374) |
0.0 | 0.1 | GO:0004359 | glutaminase activity(GO:0004359) |
0.0 | 0.0 | GO:0016838 | carbon-oxygen lyase activity, acting on phosphates(GO:0016838) |
0.0 | 0.3 | GO:0017128 | phospholipid scramblase activity(GO:0017128) |
0.0 | 0.7 | GO:0030145 | manganese ion binding(GO:0030145) |
0.0 | 0.1 | GO:0008641 | small protein activating enzyme activity(GO:0008641) |
0.0 | 0.0 | GO:0071535 | RING-like zinc finger domain binding(GO:0071535) |
0.0 | 0.1 | GO:0004367 | glycerol-3-phosphate dehydrogenase [NAD+] activity(GO:0004367) |
0.0 | 0.6 | GO:0048487 | beta-tubulin binding(GO:0048487) |
0.0 | 0.0 | GO:0008525 | phosphatidylcholine transporter activity(GO:0008525) |
0.0 | 0.3 | GO:0005035 | tumor necrosis factor-activated receptor activity(GO:0005031) death receptor activity(GO:0005035) |
0.0 | 0.2 | GO:0046703 | natural killer cell lectin-like receptor binding(GO:0046703) |
0.0 | 0.1 | GO:0008147 | structural constituent of bone(GO:0008147) |
0.0 | 0.1 | GO:0004949 | cannabinoid receptor activity(GO:0004949) |
0.0 | 0.2 | GO:0016717 | oxidoreductase activity, acting on paired donors, with oxidation of a pair of donors resulting in the reduction of molecular oxygen to two molecules of water(GO:0016717) |
0.0 | 5.7 | GO:0004842 | ubiquitin-protein transferase activity(GO:0004842) |
0.0 | 0.1 | GO:0003993 | acid phosphatase activity(GO:0003993) |
0.0 | 0.3 | GO:0003954 | NADH dehydrogenase activity(GO:0003954) |
0.0 | 0.2 | GO:0008553 | hydrogen-exporting ATPase activity, phosphorylative mechanism(GO:0008553) |
0.0 | 0.1 | GO:0034711 | inhibin binding(GO:0034711) |
0.0 | 0.4 | GO:0035035 | histone acetyltransferase binding(GO:0035035) |
0.0 | 0.1 | GO:0045134 | uridine-diphosphatase activity(GO:0045134) |
0.0 | 0.2 | GO:0042288 | MHC class I protein binding(GO:0042288) |
0.0 | 0.1 | GO:0050733 | RS domain binding(GO:0050733) |
0.0 | 0.2 | GO:0070566 | adenylyltransferase activity(GO:0070566) |
0.0 | 0.1 | GO:0043546 | molybdopterin cofactor binding(GO:0043546) |
0.0 | 0.1 | GO:0061629 | RNA polymerase II sequence-specific DNA binding transcription factor binding(GO:0061629) |
0.0 | 0.0 | GO:0000386 | second spliceosomal transesterification activity(GO:0000386) |
0.0 | 0.3 | GO:0004532 | exoribonuclease activity(GO:0004532) |
0.0 | 0.2 | GO:0004806 | triglyceride lipase activity(GO:0004806) |
0.0 | 0.1 | GO:0004566 | beta-glucuronidase activity(GO:0004566) |
0.0 | 0.1 | GO:0034046 | poly(G) binding(GO:0034046) |
0.0 | 2.6 | GO:0005125 | cytokine activity(GO:0005125) |
0.0 | 0.3 | GO:0016799 | hydrolase activity, hydrolyzing N-glycosyl compounds(GO:0016799) |
0.0 | 0.1 | GO:0022820 | potassium:chloride symporter activity(GO:0015379) potassium ion symporter activity(GO:0022820) |
0.0 | 0.5 | GO:0005484 | SNAP receptor activity(GO:0005484) |
0.0 | 0.1 | GO:0070181 | small ribosomal subunit rRNA binding(GO:0070181) |
0.0 | 0.1 | GO:0008046 | axon guidance receptor activity(GO:0008046) |
0.0 | 0.1 | GO:0042500 | aspartic endopeptidase activity, intramembrane cleaving(GO:0042500) |
0.0 | 0.0 | GO:0050567 | glutaminyl-tRNA synthase (glutamine-hydrolyzing) activity(GO:0050567) |
0.0 | 0.0 | GO:0004104 | cholinesterase activity(GO:0004104) |
0.0 | 0.5 | GO:0016836 | hydro-lyase activity(GO:0016836) |
0.0 | 0.1 | GO:1990380 | Lys48-specific deubiquitinase activity(GO:1990380) |
0.0 | 0.0 | GO:0019961 | interferon binding(GO:0019961) |
0.0 | 0.1 | GO:0008508 | bile acid:sodium symporter activity(GO:0008508) |
0.0 | 0.2 | GO:0070628 | proteasome binding(GO:0070628) |
0.0 | 0.2 | GO:0034987 | immunoglobulin receptor binding(GO:0034987) |
0.0 | 0.0 | GO:0042296 | ISG15 transferase activity(GO:0042296) |
0.0 | 1.2 | GO:0016879 | ligase activity, forming carbon-nitrogen bonds(GO:0016879) |
0.0 | 0.9 | GO:0003697 | single-stranded DNA binding(GO:0003697) |
0.0 | 0.0 | GO:0046848 | hydroxyapatite binding(GO:0046848) |
0.0 | 0.0 | GO:0030158 | protein xylosyltransferase activity(GO:0030158) |
0.0 | 0.1 | GO:0015245 | fatty acid transporter activity(GO:0015245) |
0.0 | 0.1 | GO:0001784 | phosphotyrosine binding(GO:0001784) |
0.0 | 0.0 | GO:0004046 | aminoacylase activity(GO:0004046) |
0.0 | 0.1 | GO:0019215 | intermediate filament binding(GO:0019215) |
0.0 | 0.1 | GO:0001222 | transcription corepressor binding(GO:0001222) |
0.0 | 0.1 | GO:0051425 | PTB domain binding(GO:0051425) |
0.0 | 0.8 | GO:0015171 | amino acid transmembrane transporter activity(GO:0015171) |
0.0 | 0.0 | GO:0030619 | U1 snRNA binding(GO:0030619) |
0.0 | 0.0 | GO:0070137 | ubiquitin-like protein-specific endopeptidase activity(GO:0070137) SUMO-specific endopeptidase activity(GO:0070139) |
0.0 | 0.1 | GO:0001727 | lipid kinase activity(GO:0001727) |
0.0 | 0.0 | GO:0015093 | ferrous iron transmembrane transporter activity(GO:0015093) |
0.0 | 0.1 | GO:0016713 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, reduced iron-sulfur protein as one donor, and incorporation of one atom of oxygen(GO:0016713) |
0.0 | 0.0 | GO:0048101 | calcium- and calmodulin-regulated 3',5'-cyclic-GMP phosphodiesterase activity(GO:0048101) |
0.0 | 0.0 | GO:0004862 | cAMP-dependent protein kinase inhibitor activity(GO:0004862) |
0.0 | 0.8 | GO:0004197 | cysteine-type endopeptidase activity(GO:0004197) |
0.0 | 0.1 | GO:0030898 | actin-dependent ATPase activity(GO:0030898) |
0.0 | 0.1 | GO:0008889 | glycerophosphodiester phosphodiesterase activity(GO:0008889) |
0.0 | 0.1 | GO:0004449 | isocitrate dehydrogenase (NAD+) activity(GO:0004449) |
0.0 | 0.1 | GO:0004563 | beta-N-acetylhexosaminidase activity(GO:0004563) |
0.0 | 0.0 | GO:0035673 | oligopeptide transmembrane transporter activity(GO:0035673) |
0.0 | 0.1 | GO:0008559 | xenobiotic-transporting ATPase activity(GO:0008559) |
0.0 | 0.0 | GO:0019136 | deoxynucleoside kinase activity(GO:0019136) |
0.0 | 0.0 | GO:0004704 | NF-kappaB-inducing kinase activity(GO:0004704) |
0.0 | 0.0 | GO:0004459 | L-lactate dehydrogenase activity(GO:0004459) |
0.0 | 1.5 | GO:0003729 | mRNA binding(GO:0003729) |
0.0 | 0.0 | GO:0038085 | vascular endothelial growth factor binding(GO:0038085) |
0.0 | 0.0 | GO:0044020 | histone methyltransferase activity (H4-R3 specific)(GO:0044020) |
0.0 | 0.9 | GO:0004725 | protein tyrosine phosphatase activity(GO:0004725) |
0.0 | 0.0 | GO:0004045 | aminoacyl-tRNA hydrolase activity(GO:0004045) |
0.0 | 0.1 | GO:0070273 | phosphatidylinositol-4-phosphate binding(GO:0070273) |
0.0 | 1.4 | GO:0004386 | helicase activity(GO:0004386) |
0.0 | 0.3 | GO:0016701 | oxidoreductase activity, acting on single donors with incorporation of molecular oxygen(GO:0016701) oxidoreductase activity, acting on single donors with incorporation of molecular oxygen, incorporation of two atoms of oxygen(GO:0016702) |
0.0 | 0.1 | GO:0016805 | dipeptidase activity(GO:0016805) |
0.0 | 0.0 | GO:0005128 | erythropoietin receptor binding(GO:0005128) |
0.0 | 0.2 | GO:0016290 | palmitoyl-CoA hydrolase activity(GO:0016290) |
0.0 | 0.0 | GO:0035613 | RNA stem-loop binding(GO:0035613) |
0.0 | 0.1 | GO:0005149 | interleukin-1 receptor binding(GO:0005149) |
0.0 | 0.1 | GO:0008420 | CTD phosphatase activity(GO:0008420) |
0.0 | 0.2 | GO:0004712 | protein serine/threonine/tyrosine kinase activity(GO:0004712) |
0.0 | 0.7 | GO:0018423 | protein C-terminal leucine carboxyl O-methyltransferase activity(GO:0018423) |
0.0 | 0.2 | GO:0005520 | insulin-like growth factor binding(GO:0005520) |
0.0 | 0.0 | GO:0004772 | sterol O-acyltransferase activity(GO:0004772) |
0.0 | 0.0 | GO:0042809 | vitamin D receptor binding(GO:0042809) |
0.0 | 0.2 | GO:0008139 | nuclear localization sequence binding(GO:0008139) |
0.0 | 0.0 | GO:0005143 | interleukin-12 receptor binding(GO:0005143) |
0.0 | 0.1 | GO:0030957 | Tat protein binding(GO:0030957) |
0.0 | 0.2 | GO:0005385 | zinc ion transmembrane transporter activity(GO:0005385) |
0.0 | 0.1 | GO:0017081 | chloride channel regulator activity(GO:0017081) |
0.0 | 0.1 | GO:0005223 | intracellular cGMP activated cation channel activity(GO:0005223) |
0.0 | 0.0 | GO:0008332 | low voltage-gated calcium channel activity(GO:0008332) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.1 | 0.3 | PID VEGFR1 2 PATHWAY | Signaling events mediated by VEGFR1 and VEGFR2 |
0.1 | 3.3 | PID ILK PATHWAY | Integrin-linked kinase signaling |
0.1 | 2.7 | PID RHOA PATHWAY | RhoA signaling pathway |
0.1 | 0.6 | PID VEGF VEGFR PATHWAY | VEGF and VEGFR signaling network |
0.1 | 1.2 | PID P38 MK2 PATHWAY | p38 signaling mediated by MAPKAP kinases |
0.1 | 0.7 | PID NFKAPPAB ATYPICAL PATHWAY | Atypical NF-kappaB pathway |
0.1 | 1.0 | PID EPHA2 FWD PATHWAY | EPHA2 forward signaling |
0.1 | 2.6 | PID FANCONI PATHWAY | Fanconi anemia pathway |
0.1 | 2.9 | PID TGFBR PATHWAY | TGF-beta receptor signaling |
0.1 | 1.5 | PID HDAC CLASSII PATHWAY | Signaling events mediated by HDAC Class II |
0.1 | 0.7 | PID ERBB NETWORK PATHWAY | ErbB receptor signaling network |
0.0 | 0.4 | PID THROMBIN PAR4 PATHWAY | PAR4-mediated thrombin signaling events |
0.0 | 0.0 | ST GRANULE CELL SURVIVAL PATHWAY | Granule Cell Survival Pathway is a specific case of more general PAC1 Receptor Pathway. |
0.0 | 1.2 | PID CDC42 REG PATHWAY | Regulation of CDC42 activity |
0.0 | 0.3 | PID ECADHERIN KERATINOCYTE PATHWAY | E-cadherin signaling in keratinocytes |
0.0 | 1.1 | PID THROMBIN PAR1 PATHWAY | PAR1-mediated thrombin signaling events |
0.0 | 1.7 | SIG PIP3 SIGNALING IN CARDIAC MYOCTES | Genes related to PIP3 signaling in cardiac myocytes |
0.0 | 1.2 | PID HIF2PATHWAY | HIF-2-alpha transcription factor network |
0.0 | 1.0 | PID ALPHA SYNUCLEIN PATHWAY | Alpha-synuclein signaling |
0.0 | 0.5 | PID BETA CATENIN DEG PATHWAY | Degradation of beta catenin |
0.0 | 0.7 | PID P38 MKK3 6PATHWAY | p38 MAPK signaling pathway |
0.0 | 0.5 | SA MMP CYTOKINE CONNECTION | Cytokines can induce activation of matrix metalloproteinases, which degrade extracellular matrix. |
0.0 | 2.0 | PID AR PATHWAY | Coregulation of Androgen receptor activity |
0.0 | 0.1 | PID CERAMIDE PATHWAY | Ceramide signaling pathway |
0.0 | 1.4 | PID P53 REGULATION PATHWAY | p53 pathway |
0.0 | 0.7 | ST JNK MAPK PATHWAY | JNK MAPK Pathway |
0.0 | 1.4 | PID P73PATHWAY | p73 transcription factor network |
0.0 | 1.7 | PID BETA CATENIN NUC PATHWAY | Regulation of nuclear beta catenin signaling and target gene transcription |
0.0 | 0.3 | PID ALK2 PATHWAY | ALK2 signaling events |
0.0 | 0.3 | ST GA12 PATHWAY | G alpha 12 Pathway |
0.0 | 0.4 | PID HDAC CLASSIII PATHWAY | Signaling events mediated by HDAC Class III |
0.0 | 0.0 | PID P38 ALPHA BETA PATHWAY | Regulation of p38-alpha and p38-beta |
0.0 | 0.0 | PID ER NONGENOMIC PATHWAY | Plasma membrane estrogen receptor signaling |
0.0 | 0.7 | PID IL6 7 PATHWAY | IL6-mediated signaling events |
0.0 | 0.0 | PID TCR RAS PATHWAY | Ras signaling in the CD4+ TCR pathway |
0.0 | 0.1 | PID IGF1 PATHWAY | IGF1 pathway |
0.0 | 0.9 | PID MET PATHWAY | Signaling events mediated by Hepatocyte Growth Factor Receptor (c-Met) |
0.0 | 0.2 | PID ALK1 PATHWAY | ALK1 signaling events |
0.0 | 0.3 | PID EPHRINB REV PATHWAY | Ephrin B reverse signaling |
0.0 | 0.4 | PID FOXM1 PATHWAY | FOXM1 transcription factor network |
0.0 | 0.4 | PID KIT PATHWAY | Signaling events mediated by Stem cell factor receptor (c-Kit) |
0.0 | 0.3 | PID SYNDECAN 3 PATHWAY | Syndecan-3-mediated signaling events |
0.0 | 0.7 | PID CASPASE PATHWAY | Caspase cascade in apoptosis |
0.0 | 0.5 | PID CDC42 PATHWAY | CDC42 signaling events |
0.0 | 1.6 | PID P53 DOWNSTREAM PATHWAY | Direct p53 effectors |
0.0 | 0.1 | ST ERK1 ERK2 MAPK PATHWAY | ERK1/ERK2 MAPK Pathway |
0.0 | 0.1 | ST P38 MAPK PATHWAY | p38 MAPK Pathway |
0.0 | 0.2 | PID P38 ALPHA BETA DOWNSTREAM PATHWAY | Signaling mediated by p38-alpha and p38-beta |
0.0 | 0.6 | PID NFAT TFPATHWAY | Calcineurin-regulated NFAT-dependent transcription in lymphocytes |
0.0 | 0.3 | PID NFAT 3PATHWAY | Role of Calcineurin-dependent NFAT signaling in lymphocytes |
0.0 | 0.1 | ST TYPE I INTERFERON PATHWAY | Type I Interferon (alpha/beta IFN) Pathway |
0.0 | 0.6 | PID IL12 2PATHWAY | IL12-mediated signaling events |
0.0 | 0.2 | PID AURORA A PATHWAY | Aurora A signaling |
0.0 | 0.3 | PID INTEGRIN A4B1 PATHWAY | Alpha4 beta1 integrin signaling events |
0.0 | 0.2 | PID FAK PATHWAY | Signaling events mediated by focal adhesion kinase |
0.0 | 0.1 | PID EPHB FWD PATHWAY | EPHB forward signaling |
0.0 | 0.8 | PID CMYB PATHWAY | C-MYB transcription factor network |
0.0 | 0.3 | PID TNF PATHWAY | TNF receptor signaling pathway |
0.0 | 0.1 | PID ERBB4 PATHWAY | ErbB4 signaling events |
0.0 | 0.2 | PID INTEGRIN3 PATHWAY | Beta3 integrin cell surface interactions |
0.0 | 0.2 | ST B CELL ANTIGEN RECEPTOR | B Cell Antigen Receptor |
0.0 | 0.2 | PID SYNDECAN 4 PATHWAY | Syndecan-4-mediated signaling events |
0.0 | 0.1 | PID S1P META PATHWAY | Sphingosine 1-phosphate (S1P) pathway |
0.0 | 0.5 | PID AVB3 INTEGRIN PATHWAY | Integrins in angiogenesis |
0.0 | 0.4 | PID TCR PATHWAY | TCR signaling in naïve CD4+ T cells |
0.0 | 0.3 | PID ERBB1 DOWNSTREAM PATHWAY | ErbB1 downstream signaling |
0.0 | 0.4 | NABA PROTEOGLYCANS | Genes encoding proteoglycans |
0.0 | 0.0 | SA PTEN PATHWAY | PTEN is a tumor suppressor that dephosphorylates the lipid messenger phosphatidylinositol triphosphate. |
0.0 | 0.1 | PID ERB GENOMIC PATHWAY | Validated nuclear estrogen receptor beta network |
0.0 | 0.2 | PID IL4 2PATHWAY | IL4-mediated signaling events |
0.0 | 0.1 | PID FOXO PATHWAY | FoxO family signaling |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.3 | 2.9 | REACTOME NFKB ACTIVATION THROUGH FADD RIP1 PATHWAY MEDIATED BY CASPASE 8 AND10 | Genes involved in NF-kB activation through FADD/RIP-1 pathway mediated by caspase-8 and -10 |
0.2 | 1.7 | REACTOME PURINE RIBONUCLEOSIDE MONOPHOSPHATE BIOSYNTHESIS | Genes involved in Purine ribonucleoside monophosphate biosynthesis |
0.1 | 2.0 | REACTOME JNK C JUN KINASES PHOSPHORYLATION AND ACTIVATION MEDIATED BY ACTIVATED HUMAN TAK1 | Genes involved in JNK (c-Jun kinases) phosphorylation and activation mediated by activated human TAK1 |
0.1 | 1.3 | REACTOME REGULATION OF PYRUVATE DEHYDROGENASE PDH COMPLEX | Genes involved in Regulation of pyruvate dehydrogenase (PDH) complex |
0.1 | 1.2 | REACTOME VITAMIN B5 PANTOTHENATE METABOLISM | Genes involved in Vitamin B5 (pantothenate) metabolism |
0.1 | 2.0 | REACTOME CHOLESTEROL BIOSYNTHESIS | Genes involved in Cholesterol biosynthesis |
0.1 | 4.9 | REACTOME INTERFERON ALPHA BETA SIGNALING | Genes involved in Interferon alpha/beta signaling |
0.1 | 0.6 | REACTOME ACTIVATION OF THE AP1 FAMILY OF TRANSCRIPTION FACTORS | Genes involved in Activation of the AP-1 family of transcription factors |
0.1 | 0.6 | REACTOME P75 NTR RECEPTOR MEDIATED SIGNALLING | Genes involved in p75 NTR receptor-mediated signalling |
0.1 | 1.2 | REACTOME HOMOLOGOUS RECOMBINATION REPAIR OF REPLICATION INDEPENDENT DOUBLE STRAND BREAKS | Genes involved in Homologous recombination repair of replication-independent double-strand breaks |
0.1 | 1.3 | REACTOME REGULATION OF HYPOXIA INDUCIBLE FACTOR HIF BY OXYGEN | Genes involved in Regulation of Hypoxia-inducible Factor (HIF) by Oxygen |
0.1 | 0.2 | REACTOME PROCESSING OF CAPPED INTRONLESS PRE MRNA | Genes involved in Processing of Capped Intronless Pre-mRNA |
0.1 | 1.1 | REACTOME FANCONI ANEMIA PATHWAY | Genes involved in Fanconi Anemia pathway |
0.1 | 0.9 | REACTOME DCC MEDIATED ATTRACTIVE SIGNALING | Genes involved in DCC mediated attractive signaling |
0.1 | 1.8 | REACTOME TIGHT JUNCTION INTERACTIONS | Genes involved in Tight junction interactions |
0.1 | 1.4 | REACTOME RECYCLING PATHWAY OF L1 | Genes involved in Recycling pathway of L1 |
0.1 | 1.6 | REACTOME MEIOTIC SYNAPSIS | Genes involved in Meiotic Synapsis |
0.1 | 0.4 | REACTOME ELONGATION ARREST AND RECOVERY | Genes involved in Elongation arrest and recovery |
0.1 | 2.0 | REACTOME MRNA 3 END PROCESSING | Genes involved in mRNA 3'-end processing |
0.1 | 0.2 | REACTOME ACTIVATED TAK1 MEDIATES P38 MAPK ACTIVATION | Genes involved in activated TAK1 mediates p38 MAPK activation |
0.1 | 0.2 | REACTOME RNA POL I PROMOTER OPENING | Genes involved in RNA Polymerase I Promoter Opening |
0.0 | 3.5 | REACTOME MRNA SPLICING | Genes involved in mRNA Splicing |
0.0 | 0.9 | REACTOME ACTIVATED AMPK STIMULATES FATTY ACID OXIDATION IN MUSCLE | Genes involved in Activated AMPK stimulates fatty-acid oxidation in muscle |
0.0 | 0.7 | REACTOME RAP1 SIGNALLING | Genes involved in Rap1 signalling |
0.0 | 0.1 | REACTOME ENDOSOMAL VACUOLAR PATHWAY | Genes involved in Endosomal/Vacuolar pathway |
0.0 | 1.4 | REACTOME TRANSPORT TO THE GOLGI AND SUBSEQUENT MODIFICATION | Genes involved in Transport to the Golgi and subsequent modification |
0.0 | 0.3 | REACTOME SIGNAL ATTENUATION | Genes involved in Signal attenuation |
0.0 | 1.0 | REACTOME AMINO ACID TRANSPORT ACROSS THE PLASMA MEMBRANE | Genes involved in Amino acid transport across the plasma membrane |
0.0 | 0.7 | REACTOME NA CL DEPENDENT NEUROTRANSMITTER TRANSPORTERS | Genes involved in Na+/Cl- dependent neurotransmitter transporters |
0.0 | 0.2 | REACTOME BINDING AND ENTRY OF HIV VIRION | Genes involved in Binding and entry of HIV virion |
0.0 | 0.5 | REACTOME NOD1 2 SIGNALING PATHWAY | Genes involved in NOD1/2 Signaling Pathway |
0.0 | 0.3 | REACTOME PECAM1 INTERACTIONS | Genes involved in PECAM1 interactions |
0.0 | 0.1 | REACTOME REMOVAL OF THE FLAP INTERMEDIATE FROM THE C STRAND | Genes involved in Removal of the Flap Intermediate from the C-strand |
0.0 | 0.5 | REACTOME HDL MEDIATED LIPID TRANSPORT | Genes involved in HDL-mediated lipid transport |
0.0 | 0.3 | REACTOME REGULATED PROTEOLYSIS OF P75NTR | Genes involved in Regulated proteolysis of p75NTR |
0.0 | 0.7 | REACTOME DOWNREGULATION OF TGF BETA RECEPTOR SIGNALING | Genes involved in Downregulation of TGF-beta receptor signaling |
0.0 | 0.2 | REACTOME SYNTHESIS OF PIPS AT THE GOLGI MEMBRANE | Genes involved in Synthesis of PIPs at the Golgi membrane |
0.0 | 0.3 | REACTOME REGULATION OF COMPLEMENT CASCADE | Genes involved in Regulation of Complement cascade |
0.0 | 0.5 | REACTOME SHC1 EVENTS IN ERBB4 SIGNALING | Genes involved in SHC1 events in ERBB4 signaling |
0.0 | 0.3 | REACTOME ALPHA LINOLENIC ACID ALA METABOLISM | Genes involved in alpha-linolenic acid (ALA) metabolism |
0.0 | 0.3 | REACTOME COMMON PATHWAY | Genes involved in Common Pathway |
0.0 | 0.3 | REACTOME CASPASE MEDIATED CLEAVAGE OF CYTOSKELETAL PROTEINS | Genes involved in Caspase-mediated cleavage of cytoskeletal proteins |
0.0 | 0.1 | REACTOME AQUAPORIN MEDIATED TRANSPORT | Genes involved in Aquaporin-mediated transport |
0.0 | 0.1 | REACTOME DESTABILIZATION OF MRNA BY TRISTETRAPROLIN TTP | Genes involved in Destabilization of mRNA by Tristetraprolin (TTP) |
0.0 | 0.2 | REACTOME HYALURONAN UPTAKE AND DEGRADATION | Genes involved in Hyaluronan uptake and degradation |
0.0 | 0.2 | REACTOME ANTIGEN PRESENTATION FOLDING ASSEMBLY AND PEPTIDE LOADING OF CLASS I MHC | Genes involved in Antigen Presentation: Folding, assembly and peptide loading of class I MHC |
0.0 | 0.1 | REACTOME ERKS ARE INACTIVATED | Genes involved in ERKs are inactivated |
0.0 | 0.2 | REACTOME MRNA DECAY BY 3 TO 5 EXORIBONUCLEASE | Genes involved in mRNA Decay by 3' to 5' Exoribonuclease |
0.0 | 0.0 | REACTOME ERK MAPK TARGETS | Genes involved in ERK/MAPK targets |
0.0 | 0.2 | REACTOME SEMA3A PAK DEPENDENT AXON REPULSION | Genes involved in Sema3A PAK dependent Axon repulsion |
0.0 | 1.1 | REACTOME LOSS OF NLP FROM MITOTIC CENTROSOMES | Genes involved in Loss of Nlp from mitotic centrosomes |
0.0 | 0.3 | REACTOME PEROXISOMAL LIPID METABOLISM | Genes involved in Peroxisomal lipid metabolism |
0.0 | 0.5 | REACTOME GLUTATHIONE CONJUGATION | Genes involved in Glutathione conjugation |
0.0 | 0.1 | REACTOME FATTY ACID TRIACYLGLYCEROL AND KETONE BODY METABOLISM | Genes involved in Fatty acid, triacylglycerol, and ketone body metabolism |
0.0 | 0.5 | REACTOME TRANSFERRIN ENDOCYTOSIS AND RECYCLING | Genes involved in Transferrin endocytosis and recycling |
0.0 | 0.5 | REACTOME GLYCOLYSIS | Genes involved in Glycolysis |
0.0 | 0.6 | REACTOME HS GAG BIOSYNTHESIS | Genes involved in HS-GAG biosynthesis |
0.0 | 0.2 | REACTOME DOWNREGULATION OF SMAD2 3 SMAD4 TRANSCRIPTIONAL ACTIVITY | Genes involved in Downregulation of SMAD2/3:SMAD4 transcriptional activity |
0.0 | 0.1 | REACTOME RECYCLING OF BILE ACIDS AND SALTS | Genes involved in Recycling of bile acids and salts |
0.0 | 0.1 | REACTOME P38MAPK EVENTS | Genes involved in p38MAPK events |
0.0 | 0.3 | REACTOME IL1 SIGNALING | Genes involved in Interleukin-1 signaling |
0.0 | 0.4 | REACTOME RORA ACTIVATES CIRCADIAN EXPRESSION | Genes involved in RORA Activates Circadian Expression |
0.0 | 0.3 | REACTOME COMPLEMENT CASCADE | Genes involved in Complement cascade |
0.0 | 0.4 | REACTOME CIRCADIAN CLOCK | Genes involved in Circadian Clock |
0.0 | 0.4 | REACTOME INTRINSIC PATHWAY FOR APOPTOSIS | Genes involved in Intrinsic Pathway for Apoptosis |
0.0 | 0.1 | REACTOME TRAF3 DEPENDENT IRF ACTIVATION PATHWAY | Genes involved in TRAF3-dependent IRF activation pathway |
0.0 | 0.1 | REACTOME SYNTHESIS SECRETION AND INACTIVATION OF GIP | Genes involved in Synthesis, Secretion, and Inactivation of Glucose-dependent Insulinotropic Polypeptide (GIP) |
0.0 | 0.2 | REACTOME SYNTHESIS OF PIPS AT THE LATE ENDOSOME MEMBRANE | Genes involved in Synthesis of PIPs at the late endosome membrane |
0.0 | 0.1 | REACTOME TGF BETA RECEPTOR SIGNALING IN EMT EPITHELIAL TO MESENCHYMAL TRANSITION | Genes involved in TGF-beta receptor signaling in EMT (epithelial to mesenchymal transition) |
0.0 | 0.3 | REACTOME KERATAN SULFATE BIOSYNTHESIS | Genes involved in Keratan sulfate biosynthesis |
0.0 | 0.0 | REACTOME APOBEC3G MEDIATED RESISTANCE TO HIV1 INFECTION | Genes involved in APOBEC3G mediated resistance to HIV-1 infection |
0.0 | 0.7 | REACTOME SCFSKP2 MEDIATED DEGRADATION OF P27 P21 | Genes involved in SCF(Skp2)-mediated degradation of p27/p21 |
0.0 | 0.4 | REACTOME NEP NS2 INTERACTS WITH THE CELLULAR EXPORT MACHINERY | Genes involved in NEP/NS2 Interacts with the Cellular Export Machinery |
0.0 | 0.1 | REACTOME REGULATORY RNA PATHWAYS | Genes involved in Regulatory RNA pathways |
0.0 | 0.2 | REACTOME REPAIR SYNTHESIS FOR GAP FILLING BY DNA POL IN TC NER | Genes involved in Repair synthesis for gap-filling by DNA polymerase in TC-NER |
0.0 | 0.7 | REACTOME MITOCHONDRIAL PROTEIN IMPORT | Genes involved in Mitochondrial Protein Import |
0.0 | 0.1 | REACTOME LIPOPROTEIN METABOLISM | Genes involved in Lipoprotein metabolism |
0.0 | 0.4 | REACTOME SPHINGOLIPID DE NOVO BIOSYNTHESIS | Genes involved in Sphingolipid de novo biosynthesis |
0.0 | 0.2 | REACTOME TERMINATION OF O GLYCAN BIOSYNTHESIS | Genes involved in Termination of O-glycan biosynthesis |
0.0 | 0.2 | REACTOME AMINO ACID SYNTHESIS AND INTERCONVERSION TRANSAMINATION | Genes involved in Amino acid synthesis and interconversion (transamination) |
0.0 | 0.2 | REACTOME PKA MEDIATED PHOSPHORYLATION OF CREB | Genes involved in PKA-mediated phosphorylation of CREB |
0.0 | 0.0 | REACTOME SIGNALLING TO RAS | Genes involved in Signalling to RAS |
0.0 | 0.0 | REACTOME P130CAS LINKAGE TO MAPK SIGNALING FOR INTEGRINS | Genes involved in p130Cas linkage to MAPK signaling for integrins |
0.0 | 0.1 | REACTOME MTORC1 MEDIATED SIGNALLING | Genes involved in mTORC1-mediated signalling |
0.0 | 0.1 | REACTOME THE ACTIVATION OF ARYLSULFATASES | Genes involved in The activation of arylsulfatases |
0.0 | 0.2 | REACTOME INSULIN SYNTHESIS AND PROCESSING | Genes involved in Insulin Synthesis and Processing |
0.0 | 0.0 | REACTOME CD28 DEPENDENT VAV1 PATHWAY | Genes involved in CD28 dependent Vav1 pathway |
0.0 | 0.2 | REACTOME MHC CLASS II ANTIGEN PRESENTATION | Genes involved in MHC class II antigen presentation |
0.0 | 0.2 | REACTOME PURINE METABOLISM | Genes involved in Purine metabolism |
0.0 | 0.4 | REACTOME ION TRANSPORT BY P TYPE ATPASES | Genes involved in Ion transport by P-type ATPases |
0.0 | 0.3 | REACTOME SYNTHESIS OF PIPS AT THE PLASMA MEMBRANE | Genes involved in Synthesis of PIPs at the plasma membrane |
0.0 | 0.1 | REACTOME IRON UPTAKE AND TRANSPORT | Genes involved in Iron uptake and transport |
0.0 | 0.1 | REACTOME ORGANIC CATION ANION ZWITTERION TRANSPORT | Genes involved in Organic cation/anion/zwitterion transport |
0.0 | 0.1 | REACTOME GLYCOPROTEIN HORMONES | Genes involved in Glycoprotein hormones |
0.0 | 0.0 | REACTOME ENERGY DEPENDENT REGULATION OF MTOR BY LKB1 AMPK | Genes involved in Energy dependent regulation of mTOR by LKB1-AMPK |
0.0 | 0.6 | REACTOME MITOTIC PROMETAPHASE | Genes involved in Mitotic Prometaphase |
0.0 | 0.0 | REACTOME PKB MEDIATED EVENTS | Genes involved in PKB-mediated events |
0.0 | 0.2 | REACTOME RNA POL III TRANSCRIPTION INITIATION FROM TYPE 2 PROMOTER | Genes involved in RNA Polymerase III Transcription Initiation From Type 2 Promoter |
0.0 | 0.1 | REACTOME ENDOGENOUS STEROLS | Genes involved in Endogenous sterols |