Gene Symbol | Gene ID | Gene Info |
---|---|---|
Klf8
|
ENSMUSG00000041649.7 | Klf8 |
CRE | Gene | Distance | Association probability | Pearson corr. coef. | P-value | Plot |
---|---|---|---|---|---|---|
Klf8 | chrX_153360808_153360959 | 1270 | 0.516062 | 0.29 | 3.0e-02 | Click! |
Klf8 | chrX_153311510_153311661 | 48028 | 0.138330 | -0.29 | 3.3e-02 | Click! |
Klf8 | chrX_153359977_153360149 | 450 | 0.856753 | -0.27 | 4.8e-02 | Click! |
Klf8 | chrX_153238337_153238525 | 683 | 0.709806 | 0.16 | 2.5e-01 | Click! |
Klf8 | chrX_153237931_153238103 | 269 | 0.920522 | 0.15 | 2.7e-01 | Click! |
Move your cursor over a bar to see sample name and corresponding Z-value.
Cis Regulatory Element (CRE) | Target Score | Top associated gene | Gene Info | Distance of CRE to TSS | CRE/Gene association probability |
---|---|---|---|---|---|
chr2_165511107_165511805 | 6.02 |
Slc2a10 |
solute carrier family 2 (facilitated glucose transporter), member 10 |
2675 |
0.23 |
chr1_5261781_5261932 | 5.29 |
Gm7182 |
predicted gene 7182 |
15481 |
0.23 |
chr5_112239158_112239879 | 5.11 |
Miat |
myocardial infarction associated transcript (non-protein coding) |
10123 |
0.11 |
chr3_134339308_134339650 | 4.55 |
Gm43558 |
predicted gene 43558 |
17813 |
0.17 |
chr1_5261531_5261682 | 4.55 |
Gm7182 |
predicted gene 7182 |
15731 |
0.23 |
chr5_77207847_77208140 | 4.47 |
Spink2 |
serine peptidase inhibitor, Kazal type 2 |
3212 |
0.19 |
chr3_146101045_146101508 | 4.39 |
Wdr63 |
WD repeat domain 63 |
6854 |
0.16 |
chr4_110050502_110051534 | 4.35 |
Dmrta2 |
doublesex and mab-3 related transcription factor like family A2 |
72965 |
0.11 |
chr4_53320817_53321016 | 3.92 |
Gm12495 |
predicted gene 12495 |
12690 |
0.2 |
chr14_14347096_14348750 | 3.67 |
Gm48860 |
predicted gene, 48860 |
659 |
0.44 |
chr14_14350947_14351733 | 3.42 |
Il3ra |
interleukin 3 receptor, alpha chain |
1719 |
0.23 |
chr10_79681206_79682337 | 3.29 |
Cdc34 |
cell division cycle 34 |
424 |
0.63 |
chr7_31127074_31128340 | 2.82 |
Scn1b |
sodium channel, voltage-gated, type I, beta |
704 |
0.47 |
chr6_136173009_136173858 | 2.80 |
Grin2b |
glutamate receptor, ionotropic, NMDA2B (epsilon 2) |
56 |
0.85 |
chr3_154628350_154628601 | 2.76 |
Cryz |
crystallin, zeta |
12591 |
0.17 |
chr2_105468055_105468206 | 2.76 |
4930527A07Rik |
RIKEN cDNA 4930527A07 gene |
8371 |
0.23 |
chr2_92877789_92877995 | 2.74 |
Gm13792 |
predicted gene 13792 |
4583 |
0.23 |
chr12_3236518_3237725 | 2.72 |
Rab10os |
RAB10, member RAS oncogene family, opposite strand |
510 |
0.74 |
chr14_115040506_115042372 | 2.67 |
Mir17hg |
Mir17 host gene (non-protein coding) |
1440 |
0.19 |
chr7_144081458_144081765 | 2.63 |
Gm44999 |
predicted gene 44999 |
29474 |
0.18 |
chr6_126435359_126435702 | 2.58 |
Gm44431 |
predicted gene, 44431 |
98663 |
0.06 |
chr14_118812628_118813057 | 2.48 |
n-R5s51 |
nuclear encoded rRNA 5S 51 |
14189 |
0.15 |
chr2_105468339_105468490 | 2.39 |
4930527A07Rik |
RIKEN cDNA 4930527A07 gene |
8087 |
0.23 |
chr6_126434795_126435070 | 2.28 |
Gm44431 |
predicted gene, 44431 |
98065 |
0.06 |
chr3_88230737_88231417 | 2.24 |
Gm3764 |
predicted gene 3764 |
2294 |
0.13 |
chr2_118444281_118444538 | 2.23 |
Eif2ak4 |
eukaryotic translation initiation factor 2 alpha kinase 4 |
5567 |
0.18 |
chr2_105468503_105468654 | 2.23 |
4930527A07Rik |
RIKEN cDNA 4930527A07 gene |
7923 |
0.23 |
chr18_12947284_12947832 | 2.22 |
Osbpl1a |
oxysterol binding protein-like 1A |
5717 |
0.19 |
chr2_118445342_118445493 | 2.15 |
Eif2ak4 |
eukaryotic translation initiation factor 2 alpha kinase 4 |
6575 |
0.17 |
chr18_80104802_80104953 | 2.13 |
Gm21886 |
predicted gene, 21886 |
14915 |
0.1 |
chr2_118444676_118444863 | 2.11 |
Eif2ak4 |
eukaryotic translation initiation factor 2 alpha kinase 4 |
5927 |
0.18 |
chr4_151396761_151396913 | 2.08 |
4930589P08Rik |
RIKEN cDNA 4930589P08 gene |
20367 |
0.27 |
chr2_180825654_180825866 | 2.03 |
Gm14340 |
predicted gene 14340 |
1130 |
0.35 |
chr9_20726843_20728134 | 2.01 |
Olfm2 |
olfactomedin 2 |
551 |
0.72 |
chr9_86879639_86880662 | 2.00 |
Snap91 |
synaptosomal-associated protein 91 |
247 |
0.94 |
chr14_118801904_118802055 | 1.99 |
Cldn10 |
claudin 10 |
14061 |
0.15 |
chr18_81251894_81252538 | 1.98 |
Gm30192 |
predicted gene, 30192 |
12475 |
0.22 |
chr7_127026546_127028177 | 1.97 |
Maz |
MYC-associated zinc finger protein (purine-binding transcription factor) |
324 |
0.58 |
chr17_24689202_24689794 | 1.96 |
Syngr3 |
synaptogyrin 3 |
457 |
0.54 |
chr2_151701768_151703133 | 1.96 |
Tmem74b |
transmembrane protein 74B |
139 |
0.92 |
chr13_63918756_63919481 | 1.93 |
Ercc6l2 |
excision repair cross-complementing rodent repair deficiency, complementation group 6 like 2 |
25091 |
0.15 |
chr19_61225302_61226760 | 1.90 |
Csf2ra |
colony stimulating factor 2 receptor, alpha, low-affinity (granulocyte-macrophage) |
541 |
0.67 |
chr14_14349938_14350878 | 1.90 |
Il3ra |
interleukin 3 receptor, alpha chain |
787 |
0.48 |
chr6_55676658_55677265 | 1.89 |
Neurod6 |
neurogenic differentiation 6 |
4302 |
0.26 |
chr7_19118025_19118835 | 1.88 |
Gm4969 |
predicted gene 4969 |
62 |
0.92 |
chr9_124439906_124440949 | 1.86 |
Ppp2r3d |
protein phosphatase 2 (formerly 2A), regulatory subunit B'', delta |
441 |
0.79 |
chr13_78938103_78938304 | 1.84 |
Gm8345 |
predicted gene 8345 |
16589 |
0.29 |
chr9_21953247_21953604 | 1.84 |
Swsap1 |
SWIM type zinc finger 7 associated protein 1 |
2330 |
0.14 |
chr2_125059582_125059841 | 1.81 |
Slc24a5 |
solute carrier family 24, member 5 |
8413 |
0.19 |
chr8_70315603_70316677 | 1.81 |
Cers1 |
ceramide synthase 1 |
353 |
0.75 |
chr12_33341296_33341797 | 1.80 |
Atxn7l1 |
ataxin 7-like 1 |
3759 |
0.23 |
chr2_125059284_125059435 | 1.78 |
Slc24a5 |
solute carrier family 24, member 5 |
8765 |
0.19 |
chr10_116472994_116474473 | 1.76 |
Kcnmb4 |
potassium large conductance calcium-activated channel, subfamily M, beta member 4 |
145 |
0.69 |
chr9_49796724_49798126 | 1.74 |
Ncam1 |
neural cell adhesion molecule 1 |
1333 |
0.53 |
chr15_8605708_8605859 | 1.74 |
Slc1a3 |
solute carrier family 1 (glial high affinity glutamate transporter), member 3 |
37464 |
0.13 |
chr9_124439329_124439899 | 1.74 |
Ppp2r3d |
protein phosphatase 2 (formerly 2A), regulatory subunit B'', delta |
1254 |
0.4 |
chr8_4677704_4678740 | 1.73 |
Gm7461 |
predicted gene 7461 |
143 |
0.62 |
chr1_161034434_161035250 | 1.73 |
Zbtb37 |
zinc finger and BTB domain containing 37 |
6 |
0.51 |
chr10_81559146_81561402 | 1.71 |
Tle5 |
TLE family member 5, transcriptional modulator |
770 |
0.38 |
chr18_64265188_64265726 | 1.70 |
St8sia3 |
ST8 alpha-N-acetyl-neuraminide alpha-2,8-sialyltransferase 3 |
529 |
0.73 |
chr7_66689066_66689961 | 1.69 |
Asb7 |
ankyrin repeat and SOCS box-containing 7 |
2 |
0.86 |
chr11_99071812_99072098 | 1.69 |
Tns4 |
tensin 4 |
1909 |
0.25 |
chr7_4119309_4120004 | 1.69 |
Ttyh1 |
tweety family member 1 |
34 |
0.91 |
chr11_24129398_24130415 | 1.68 |
Bcl11a |
B cell CLL/lymphoma 11A (zinc finger protein) |
12473 |
0.15 |
chr2_125060613_125060772 | 1.68 |
Slc24a5 |
solute carrier family 24, member 5 |
7432 |
0.19 |
chr2_33130296_33131698 | 1.67 |
Garnl3 |
GTPase activating RANGAP domain-like 3 |
389 |
0.84 |
chr19_56061960_56062370 | 1.66 |
D730002M21Rik |
RIKEN cDNA D730002M21 gene |
27069 |
0.18 |
chr4_118548171_118548349 | 1.65 |
Tmem125 |
transmembrane protein 125 |
4216 |
0.14 |
chr11_35856666_35857239 | 1.59 |
Wwc1 |
WW, C2 and coiled-coil domain containing 1 |
3398 |
0.24 |
chr11_121259259_121260714 | 1.58 |
Foxk2 |
forkhead box K2 |
4 |
0.96 |
chr4_141335224_141335761 | 1.58 |
Gm25690 |
predicted gene, 25690 |
10672 |
0.09 |
chr2_50743859_50744010 | 1.57 |
Gm13484 |
predicted gene 13484 |
85867 |
0.1 |
chr9_62536098_62537614 | 1.56 |
Coro2b |
coronin, actin binding protein, 2B |
104 |
0.97 |
chr11_101740178_101740354 | 1.55 |
Dhx8 |
DEAH (Asp-Glu-Ala-His) box polypeptide 8 |
7225 |
0.15 |
chr11_54057634_54057839 | 1.55 |
Pdlim4 |
PDZ and LIM domain 4 |
6832 |
0.16 |
chrX_135053750_135054274 | 1.55 |
3632454L22Rik |
RIKEN cDNA 3632454L22 gene |
6324 |
0.19 |
chr10_87501180_87501623 | 1.55 |
Gm48120 |
predicted gene, 48120 |
6461 |
0.19 |
chr1_17145272_17145872 | 1.54 |
Gdap1 |
ganglioside-induced differentiation-associated-protein 1 |
104 |
0.97 |
chr7_75868535_75868959 | 1.54 |
Klhl25 |
kelch-like 25 |
20306 |
0.21 |
chr4_156342718_156343009 | 1.54 |
Vmn2r125 |
vomeronasal 2, receptor 125 |
1337 |
0.4 |
chr5_32713265_32714499 | 1.54 |
Gm43852 |
predicted gene 43852 |
106 |
0.94 |
chr14_25401486_25402359 | 1.53 |
Gm26660 |
predicted gene, 26660 |
22313 |
0.15 |
chr3_68072068_68072422 | 1.52 |
Schip1 |
schwannomin interacting protein 1 |
7443 |
0.3 |
chr6_83794439_83795940 | 1.51 |
Nagk |
N-acetylglucosamine kinase |
19 |
0.94 |
chr5_37716863_37717819 | 1.51 |
Stk32b |
serine/threonine kinase 32B |
170 |
0.96 |
chr14_118132237_118133349 | 1.51 |
Tgds |
TDP-glucose 4,6-dehydratase |
38 |
0.97 |
chr11_118247752_118249318 | 1.51 |
Cyth1 |
cytohesin 1 |
25 |
0.97 |
chr19_36553934_36555231 | 1.51 |
Hectd2 |
HECT domain E3 ubiquitin protein ligase 2 |
57 |
0.98 |
chr4_57433554_57433766 | 1.49 |
Pakap |
paralemmin A kinase anchor protein |
587 |
0.73 |
chr9_45608224_45608399 | 1.49 |
Gm22069 |
predicted gene, 22069 |
26501 |
0.18 |
chr13_34129793_34130880 | 1.48 |
Tubb2b |
tubulin, beta 2B class IIB |
18 |
0.96 |
chr8_125569269_125570645 | 1.47 |
Sipa1l2 |
signal-induced proliferation-associated 1 like 2 |
149 |
0.97 |
chr5_23415909_23416466 | 1.47 |
5031425E22Rik |
RIKEN cDNA 5031425E22 gene |
17122 |
0.11 |
chr7_109781147_109782179 | 1.47 |
Nrip3 |
nuclear receptor interacting protein 3 |
118 |
0.94 |
chr15_12039646_12039856 | 1.46 |
Gm2559 |
predicted gene 2559 |
7824 |
0.18 |
chr15_57162413_57162847 | 1.46 |
Gm26178 |
predicted gene, 26178 |
76483 |
0.11 |
chr15_4375774_4376213 | 1.45 |
Plcxd3 |
phosphatidylinositol-specific phospholipase C, X domain containing 3 |
489 |
0.88 |
chr14_118783637_118783805 | 1.45 |
Cldn10 |
claudin 10 |
4187 |
0.19 |
chr17_66448520_66450314 | 1.45 |
Mtcl1 |
microtubule crosslinking factor 1 |
333 |
0.57 |
chr8_105320451_105321442 | 1.44 |
Lrrc29 |
leucine rich repeat containing 29 |
5313 |
0.07 |
chr8_84638710_84639759 | 1.44 |
Cacna1a |
calcium channel, voltage-dependent, P/Q type, alpha 1A subunit |
243 |
0.87 |
chr11_98959522_98960759 | 1.44 |
Rara |
retinoic acid receptor, alpha |
272 |
0.84 |
chr6_126434508_126434660 | 1.43 |
Gm44431 |
predicted gene, 44431 |
97717 |
0.06 |
chr11_22858998_22860305 | 1.42 |
B3gnt2 |
UDP-GlcNAc:betaGal beta-1,3-N-acetylglucosaminyltransferase 2 |
106 |
0.89 |
chr15_85708879_85709635 | 1.42 |
Mirlet7b |
microRNA let7b |
1938 |
0.23 |
chr2_181581056_181582098 | 1.41 |
Uckl1 |
uridine-cytidine kinase 1-like 1 |
49 |
0.9 |
chr5_38560766_38562198 | 1.40 |
Wdr1 |
WD repeat domain 1 |
61 |
0.97 |
chr7_65370376_65371384 | 1.40 |
Tjp1 |
tight junction protein 1 |
135 |
0.96 |
chr8_122737772_122738218 | 1.39 |
C230057M02Rik |
RIKEN cDNA C230057M02 gene |
516 |
0.65 |
chr15_83765468_83765992 | 1.39 |
Mpped1 |
metallophosphoesterase domain containing 1 |
13737 |
0.21 |
chr3_8510910_8511440 | 1.38 |
Stmn2 |
stathmin-like 2 |
1589 |
0.43 |
chr8_95703143_95704225 | 1.37 |
Ndrg4 |
N-myc downstream regulated gene 4 |
614 |
0.57 |
chr15_95891918_95892289 | 1.37 |
Gm25070 |
predicted gene, 25070 |
12286 |
0.18 |
chr11_74649608_74650568 | 1.36 |
Cluh |
clustered mitochondria (cluA/CLU1) homolog |
258 |
0.9 |
chr5_37028527_37029187 | 1.36 |
Jakmip1 |
janus kinase and microtubule interacting protein 1 |
255 |
0.91 |
chr12_113222098_113223172 | 1.35 |
Gm25622 |
predicted gene, 25622 |
8486 |
0.14 |
chr12_51117995_51118377 | 1.35 |
Gm7172 |
predicted gene 7172 |
16516 |
0.22 |
chr7_40901519_40901801 | 1.34 |
A230077H06Rik |
RIKEN cDNA A230077H06 gene |
723 |
0.5 |
chr7_133704018_133704252 | 1.33 |
Uros |
uroporphyrinogen III synthase |
1519 |
0.27 |
chr11_51855495_51856955 | 1.33 |
Jade2 |
jade family PHD finger 2 |
900 |
0.57 |
chr9_115604498_115604804 | 1.33 |
n-R5s92 |
nuclear encoded rRNA 5S 92 |
22067 |
0.2 |
chr9_15732381_15732849 | 1.32 |
Slc36a4 |
solute carrier family 36 (proton/amino acid symporter), member 4 |
5727 |
0.22 |
chr1_173366946_173367141 | 1.32 |
Cadm3 |
cell adhesion molecule 3 |
590 |
0.7 |
chr9_99441957_99442108 | 1.31 |
Mras |
muscle and microspikes RAS |
4651 |
0.19 |
chr11_101465601_101466398 | 1.31 |
Vat1 |
vesicle amine transport 1 |
231 |
0.67 |
chr7_139388425_139389476 | 1.30 |
Inpp5a |
inositol polyphosphate-5-phosphatase A |
159 |
0.97 |
chr7_109493646_109494020 | 1.30 |
Trim66 |
tripartite motif-containing 66 |
95 |
0.95 |
chr1_154724125_154724297 | 1.29 |
Cacna1e |
calcium channel, voltage-dependent, R type, alpha 1E subunit |
1709 |
0.52 |
chr11_101740511_101740671 | 1.29 |
Dhx8 |
DEAH (Asp-Glu-Ala-His) box polypeptide 8 |
7550 |
0.14 |
chr8_25465368_25465990 | 1.27 |
Gm10689 |
predicted gene 10689 |
11406 |
0.11 |
chrY_90744335_90744901 | 1.27 |
Mid1-ps1 |
midline 1, pseudogene 1 |
8439 |
0.18 |
chr10_58227289_58228680 | 1.27 |
Gm10807 |
predicted gene 10807 |
667 |
0.56 |
chr10_75994691_75995012 | 1.27 |
Gm16220 |
predicted gene 16220 |
859 |
0.4 |
chr17_45548642_45549512 | 1.26 |
Tmem151b |
transmembrane protein 151B |
600 |
0.55 |
chr11_69559283_69560047 | 1.25 |
Efnb3 |
ephrin B3 |
540 |
0.54 |
chr6_39871251_39871962 | 1.25 |
Tmem178b |
transmembrane protein 178B |
145 |
0.75 |
chr1_175039884_175040035 | 1.24 |
Rgs7 |
regulator of G protein signaling 7 |
38986 |
0.21 |
chr1_167661178_167661500 | 1.23 |
Lmx1a |
LIM homeobox transcription factor 1 alpha |
27898 |
0.21 |
chr17_65961618_65962124 | 1.22 |
Ankrd12 |
ankyrin repeat domain 12 |
10521 |
0.14 |
chr17_87676993_87677384 | 1.22 |
Msh2 |
mutS homolog 2 |
4579 |
0.24 |
chr16_4879750_4880811 | 1.22 |
Ubald1 |
UBA-like domain containing 1 |
35 |
0.96 |
chr12_4220043_4220458 | 1.21 |
Gm48210 |
predicted gene, 48210 |
1852 |
0.19 |
chr1_136102700_136103274 | 1.21 |
Cacna1s |
calcium channel, voltage-dependent, L type, alpha 1S subunit |
2419 |
0.19 |
chr3_32616403_32617072 | 1.21 |
Gnb4 |
guanine nucleotide binding protein (G protein), beta 4 |
152 |
0.95 |
chr3_133352761_133352953 | 1.21 |
Ppa2 |
pyrophosphatase (inorganic) 2 |
4781 |
0.24 |
chr9_87144540_87144939 | 1.20 |
Mrap2 |
melanocortin 2 receptor accessory protein 2 |
396 |
0.84 |
chr1_20819843_20820501 | 1.20 |
Mcm3 |
minichromosome maintenance complex component 3 |
88 |
0.93 |
chr7_60003898_60004931 | 1.20 |
Snurf |
SNRPN upstream reading frame |
635 |
0.26 |
chr2_33543695_33544688 | 1.19 |
Gm13530 |
predicted gene 13530 |
54409 |
0.1 |
chr7_43489442_43490064 | 1.19 |
Iglon5 |
IgLON family member 5 |
322 |
0.72 |
chr5_27873604_27873982 | 1.19 |
Gm5551 |
predicted gene 5551 |
13344 |
0.15 |
chr18_25678986_25679896 | 1.19 |
0710001A04Rik |
RIKEN cDNA 0710001A04 gene |
34329 |
0.19 |
chr10_94621478_94622295 | 1.19 |
Gm48657 |
predicted gene, 48657 |
1346 |
0.34 |
chr3_10439292_10440192 | 1.18 |
Snx16 |
sorting nexin 16 |
345 |
0.89 |
chr13_109116814_109117670 | 1.18 |
Pde4d |
phosphodiesterase 4D, cAMP specific |
601 |
0.86 |
chr7_92234788_92235188 | 1.18 |
Dlg2 |
discs large MAGUK scaffold protein 2 |
8 |
0.99 |
chr4_109099000_109099151 | 1.18 |
Osbpl9 |
oxysterol binding protein-like 9 |
8956 |
0.2 |
chr19_6499050_6499464 | 1.18 |
Nrxn2 |
neurexin II |
1422 |
0.29 |
chr1_71652594_71653937 | 1.17 |
Fn1 |
fibronectin 1 |
65 |
0.5 |
chr2_156421620_156421951 | 1.17 |
Epb41l1 |
erythrocyte membrane protein band 4.1 like 1 |
673 |
0.5 |
chr11_5788301_5789276 | 1.16 |
Dbnl |
drebrin-like |
258 |
0.86 |
chr4_118620310_118621356 | 1.16 |
Ebna1bp2 |
EBNA1 binding protein 2 |
15 |
0.52 |
chr5_27049317_27050134 | 1.16 |
Dpp6 |
dipeptidylpeptidase 6 |
332 |
0.92 |
chr5_8065282_8065433 | 1.16 |
Sri |
sorcin |
4091 |
0.18 |
chr11_3132475_3133419 | 1.15 |
Sfi1 |
Sfi1 homolog, spindle assembly associated (yeast) |
3060 |
0.17 |
chrX_7639834_7640277 | 1.15 |
Syp |
synaptophysin |
294 |
0.76 |
chr7_25181449_25181675 | 1.15 |
Pou2f2 |
POU domain, class 2, transcription factor 2 |
1836 |
0.19 |
chr8_70840798_70841569 | 1.15 |
Arrdc2 |
arrestin domain containing 2 |
1463 |
0.19 |
chr15_83853422_83853573 | 1.15 |
Mpped1 |
metallophosphoesterase domain containing 1 |
17457 |
0.2 |
chr6_7566515_7566679 | 1.14 |
Tac1 |
tachykinin 1 |
4229 |
0.25 |
chr2_28882454_28882605 | 1.14 |
Ddx31 |
DEAD/H (Asp-Glu-Ala-Asp/His) box polypeptide 31 |
25388 |
0.13 |
chr5_112481948_112482441 | 1.14 |
Sez6l |
seizure related 6 homolog like |
7067 |
0.17 |
chr2_21917593_21918874 | 1.14 |
Gm24886 |
predicted gene, 24886 |
123178 |
0.06 |
chr13_78183985_78184266 | 1.14 |
Gm38604 |
predicted gene, 38604 |
957 |
0.45 |
chr6_142964266_142965074 | 1.13 |
St8sia1 |
ST8 alpha-N-acetyl-neuraminide alpha-2,8-sialyltransferase 1 |
218 |
0.91 |
chr6_119847609_119848667 | 1.13 |
Erc1 |
ELKS/RAB6-interacting/CAST family member 1 |
4 |
0.98 |
chr7_31053000_31053572 | 1.13 |
Fxyd1 |
FXYD domain-containing ion transport regulator 1 |
164 |
0.87 |
chr12_111758304_111760062 | 1.13 |
Klc1 |
kinesin light chain 1 |
170 |
0.91 |
chr6_85265565_85265716 | 1.12 |
Sfxn5 |
sideroflexin 5 |
707 |
0.65 |
chrX_49480554_49480737 | 1.12 |
Arhgap36 |
Rho GTPase activating protein 36 |
5030 |
0.25 |
chr2_77758483_77758775 | 1.12 |
Zfp385b |
zinc finger protein 385B |
38890 |
0.19 |
chr8_32792963_32793144 | 1.12 |
Nrg1 |
neuregulin 1 |
90809 |
0.1 |
chr7_96718538_96719200 | 1.12 |
Tenm4 |
teneurin transmembrane protein 4 |
59065 |
0.11 |
chr19_20918104_20918255 | 1.11 |
Gm32750 |
predicted gene, 32750 |
4213 |
0.29 |
chrY_90828855_90829206 | 1.11 |
Gm21742 |
predicted gene, 21742 |
8383 |
0.19 |
chr4_140103440_140103668 | 1.11 |
Gm13027 |
predicted gene 13027 |
28323 |
0.17 |
chr1_3094658_3094926 | 1.11 |
Gm26206 |
predicted gene, 26206 |
7224 |
0.25 |
chr9_114026283_114026988 | 1.11 |
Fbxl2 |
F-box and leucine-rich repeat protein 2 |
91 |
0.97 |
chr3_9833533_9834642 | 1.10 |
Pag1 |
phosphoprotein associated with glycosphingolipid microdomains 1 |
408 |
0.84 |
chr5_110104232_110105008 | 1.10 |
Gtpbp6 |
GTP binding protein 6 (putative) |
715 |
0.46 |
chr7_18926314_18927174 | 1.10 |
Nova2 |
NOVA alternative splicing regulator 2 |
856 |
0.42 |
chr4_57567702_57568390 | 1.09 |
Pakap |
paralemmin A kinase anchor protein |
113 |
0.98 |
chr9_108587464_108588439 | 1.09 |
Gm49209 |
predicted gene, 49209 |
899 |
0.26 |
chr18_43390705_43391091 | 1.09 |
Dpysl3 |
dihydropyrimidinase-like 3 |
2479 |
0.33 |
chr2_180889406_180890514 | 1.09 |
Gm14342 |
predicted gene 14342 |
300 |
0.8 |
chr8_118162301_118162492 | 1.08 |
Gm25200 |
predicted gene, 25200 |
41442 |
0.2 |
chr9_40268412_40269319 | 1.08 |
Scn3b |
sodium channel, voltage-gated, type III, beta |
352 |
0.82 |
chrX_75673394_75674325 | 1.08 |
Gm15065 |
predicted gene 15065 |
31550 |
0.13 |
chr13_96180688_96180913 | 1.07 |
Gm29543 |
predicted gene 29543 |
47431 |
0.12 |
chr4_118547537_118547702 | 1.07 |
Tmem125 |
transmembrane protein 125 |
3575 |
0.14 |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
1.0 | 3.0 | GO:2000474 | regulation of opioid receptor signaling pathway(GO:2000474) |
1.0 | 3.0 | GO:0021550 | medulla oblongata development(GO:0021550) |
0.8 | 3.3 | GO:0071205 | protein localization to juxtaparanode region of axon(GO:0071205) |
0.8 | 2.3 | GO:0097118 | neuroligin clustering involved in postsynaptic membrane assembly(GO:0097118) |
0.8 | 2.3 | GO:0021773 | striatal medium spiny neuron differentiation(GO:0021773) |
0.7 | 3.0 | GO:0007412 | axon target recognition(GO:0007412) |
0.7 | 2.2 | GO:0021564 | vagus nerve development(GO:0021564) |
0.7 | 2.2 | GO:0071492 | cellular response to UV-A(GO:0071492) |
0.7 | 2.0 | GO:0033058 | directional locomotion(GO:0033058) |
0.6 | 1.9 | GO:0032058 | positive regulation of translational initiation in response to stress(GO:0032058) |
0.6 | 1.9 | GO:0006842 | tricarboxylic acid transport(GO:0006842) citrate transport(GO:0015746) |
0.6 | 1.9 | GO:1902564 | negative regulation of neutrophil activation(GO:1902564) |
0.6 | 1.7 | GO:0046684 | response to pyrethroid(GO:0046684) |
0.6 | 1.7 | GO:1900377 | negative regulation of melanin biosynthetic process(GO:0048022) negative regulation of secondary metabolite biosynthetic process(GO:1900377) |
0.5 | 1.1 | GO:0070094 | positive regulation of glucagon secretion(GO:0070094) |
0.5 | 1.6 | GO:0097503 | sialylation(GO:0097503) |
0.5 | 1.6 | GO:0061502 | early endosome to recycling endosome transport(GO:0061502) |
0.5 | 0.5 | GO:0021586 | pons maturation(GO:0021586) |
0.5 | 0.5 | GO:0061642 | chemoattraction of axon(GO:0061642) |
0.5 | 1.5 | GO:0014724 | regulation of twitch skeletal muscle contraction(GO:0014724) |
0.5 | 1.5 | GO:0060178 | regulation of exocyst localization(GO:0060178) |
0.5 | 0.5 | GO:0061669 | spontaneous neurotransmitter secretion(GO:0061669) spontaneous synaptic transmission(GO:0098814) |
0.5 | 1.9 | GO:1902261 | positive regulation of delayed rectifier potassium channel activity(GO:1902261) positive regulation of voltage-gated potassium channel activity(GO:1903818) |
0.5 | 6.2 | GO:0035235 | ionotropic glutamate receptor signaling pathway(GO:0035235) |
0.5 | 1.9 | GO:0032971 | regulation of muscle filament sliding(GO:0032971) |
0.5 | 2.3 | GO:0098735 | positive regulation of the force of heart contraction(GO:0098735) |
0.5 | 1.4 | GO:1900738 | positive regulation of phospholipase C-activating G-protein coupled receptor signaling pathway(GO:1900738) |
0.5 | 4.5 | GO:0071625 | vocalization behavior(GO:0071625) |
0.5 | 0.5 | GO:0060748 | tertiary branching involved in mammary gland duct morphogenesis(GO:0060748) |
0.4 | 1.8 | GO:0086045 | membrane depolarization during AV node cell action potential(GO:0086045) |
0.4 | 0.9 | GO:1901843 | positive regulation of high voltage-gated calcium channel activity(GO:1901843) |
0.4 | 1.3 | GO:2000302 | positive regulation of synaptic vesicle exocytosis(GO:2000302) |
0.4 | 0.9 | GO:1904956 | regulation of midbrain dopaminergic neuron differentiation(GO:1904956) |
0.4 | 1.3 | GO:0032289 | central nervous system myelin formation(GO:0032289) |
0.4 | 1.3 | GO:0072137 | condensed mesenchymal cell proliferation(GO:0072137) |
0.4 | 1.7 | GO:0061743 | motor learning(GO:0061743) |
0.4 | 2.5 | GO:0016198 | axon choice point recognition(GO:0016198) |
0.4 | 0.4 | GO:0097151 | positive regulation of inhibitory postsynaptic potential(GO:0097151) modulation of inhibitory postsynaptic potential(GO:0098828) |
0.4 | 1.2 | GO:0039663 | fusion of virus membrane with host plasma membrane(GO:0019064) membrane fusion involved in viral entry into host cell(GO:0039663) multi-organism membrane fusion(GO:0044800) |
0.4 | 2.4 | GO:0090273 | regulation of somatostatin secretion(GO:0090273) |
0.4 | 2.4 | GO:0021631 | optic nerve morphogenesis(GO:0021631) |
0.4 | 1.6 | GO:0007196 | adenylate cyclase-inhibiting G-protein coupled glutamate receptor signaling pathway(GO:0007196) |
0.4 | 4.7 | GO:0048268 | clathrin coat assembly(GO:0048268) |
0.4 | 1.2 | GO:1990034 | calcium ion export from cell(GO:1990034) |
0.4 | 2.7 | GO:0097011 | cellular response to granulocyte macrophage colony-stimulating factor stimulus(GO:0097011) |
0.4 | 1.1 | GO:0033693 | neurofilament bundle assembly(GO:0033693) |
0.4 | 0.8 | GO:0072069 | distal convoluted tubule development(GO:0072025) DCT cell differentiation(GO:0072069) metanephric distal convoluted tubule development(GO:0072221) metanephric distal tubule development(GO:0072235) metanephric DCT cell differentiation(GO:0072240) |
0.4 | 1.1 | GO:0001927 | exocyst assembly(GO:0001927) |
0.4 | 1.1 | GO:1902071 | regulation of hypoxia-inducible factor-1alpha signaling pathway(GO:1902071) |
0.4 | 2.9 | GO:0021707 | cerebellar granular layer formation(GO:0021684) cerebellar granule cell differentiation(GO:0021707) |
0.4 | 2.5 | GO:0045161 | neuronal ion channel clustering(GO:0045161) |
0.4 | 1.4 | GO:0033564 | anterior/posterior axon guidance(GO:0033564) |
0.3 | 0.3 | GO:0003358 | noradrenergic neuron development(GO:0003358) |
0.3 | 0.3 | GO:0007403 | glial cell fate determination(GO:0007403) |
0.3 | 1.4 | GO:0070777 | D-aspartate transport(GO:0070777) D-aspartate import(GO:0070779) |
0.3 | 1.0 | GO:0046103 | inosine biosynthetic process(GO:0046103) |
0.3 | 1.3 | GO:0019919 | peptidyl-arginine methylation, to asymmetrical-dimethyl arginine(GO:0019919) |
0.3 | 2.0 | GO:0086015 | SA node cell action potential(GO:0086015) SA node cell to atrial cardiac muscle cell signalling(GO:0086018) SA node cell to atrial cardiac muscle cell communication(GO:0086070) |
0.3 | 0.3 | GO:0051365 | cellular response to potassium ion starvation(GO:0051365) |
0.3 | 0.7 | GO:1900157 | regulation of bone mineralization involved in bone maturation(GO:1900157) |
0.3 | 1.6 | GO:0032229 | negative regulation of synaptic transmission, GABAergic(GO:0032229) |
0.3 | 1.3 | GO:0033563 | dorsal/ventral axon guidance(GO:0033563) |
0.3 | 0.6 | GO:0009449 | gamma-aminobutyric acid biosynthetic process(GO:0009449) |
0.3 | 0.3 | GO:0061341 | non-canonical Wnt signaling pathway involved in heart development(GO:0061341) planar cell polarity pathway involved in heart morphogenesis(GO:0061346) |
0.3 | 0.6 | GO:1905049 | negative regulation of metalloendopeptidase activity(GO:1904684) negative regulation of metallopeptidase activity(GO:1905049) |
0.3 | 1.8 | GO:0045213 | neurotransmitter receptor metabolic process(GO:0045213) |
0.3 | 1.5 | GO:0016081 | synaptic vesicle docking(GO:0016081) |
0.3 | 0.9 | GO:0060478 | acrosomal vesicle exocytosis(GO:0060478) |
0.3 | 0.6 | GO:0060160 | negative regulation of dopamine receptor signaling pathway(GO:0060160) |
0.3 | 0.9 | GO:0070634 | transepithelial ammonium transport(GO:0070634) |
0.3 | 0.6 | GO:0097477 | lateral motor column neuron migration(GO:0097477) |
0.3 | 1.7 | GO:2000766 | negative regulation of cytoplasmic translation(GO:2000766) |
0.3 | 0.6 | GO:0038128 | ERBB2 signaling pathway(GO:0038128) |
0.3 | 1.4 | GO:0097466 | glycoprotein ERAD pathway(GO:0097466) response to glycoprotein(GO:1904587) |
0.3 | 1.1 | GO:0014877 | response to inactivity(GO:0014854) response to muscle inactivity(GO:0014870) response to muscle inactivity involved in regulation of muscle adaptation(GO:0014877) response to denervation involved in regulation of muscle adaptation(GO:0014894) |
0.3 | 0.8 | GO:0090292 | nuclear matrix organization(GO:0043578) nuclear matrix anchoring at nuclear membrane(GO:0090292) |
0.3 | 1.7 | GO:0005513 | detection of calcium ion(GO:0005513) |
0.3 | 1.1 | GO:1903977 | positive regulation of glial cell migration(GO:1903977) |
0.3 | 0.6 | GO:0097168 | mesenchymal stem cell proliferation(GO:0097168) |
0.3 | 0.8 | GO:0030070 | insulin processing(GO:0030070) |
0.3 | 0.8 | GO:0014734 | skeletal muscle hypertrophy(GO:0014734) |
0.3 | 0.8 | GO:0030240 | skeletal muscle thin filament assembly(GO:0030240) |
0.3 | 0.8 | GO:1901529 | positive regulation of anion channel activity(GO:1901529) |
0.3 | 1.4 | GO:0021681 | cerebellar granular layer development(GO:0021681) |
0.3 | 0.3 | GO:0021558 | trochlear nerve development(GO:0021558) |
0.3 | 1.4 | GO:0000160 | phosphorelay signal transduction system(GO:0000160) |
0.3 | 0.8 | GO:0090427 | activation of meiosis(GO:0090427) |
0.3 | 0.5 | GO:0008588 | release of cytoplasmic sequestered NF-kappaB(GO:0008588) |
0.3 | 0.8 | GO:0072385 | minus-end-directed organelle transport along microtubule(GO:0072385) |
0.3 | 0.8 | GO:0014053 | negative regulation of gamma-aminobutyric acid secretion(GO:0014053) |
0.3 | 0.8 | GO:2000019 | negative regulation of male gonad development(GO:2000019) |
0.3 | 2.1 | GO:0010996 | response to auditory stimulus(GO:0010996) |
0.3 | 1.5 | GO:0051823 | regulation of synapse structural plasticity(GO:0051823) |
0.3 | 1.0 | GO:0007195 | adenylate cyclase-inhibiting dopamine receptor signaling pathway(GO:0007195) |
0.3 | 0.8 | GO:0021882 | regulation of transcription from RNA polymerase II promoter involved in forebrain neuron fate commitment(GO:0021882) |
0.3 | 0.8 | GO:0033566 | gamma-tubulin complex localization(GO:0033566) |
0.3 | 1.0 | GO:1901386 | negative regulation of voltage-gated calcium channel activity(GO:1901386) |
0.3 | 0.5 | GO:1900451 | positive regulation of glutamate receptor signaling pathway(GO:1900451) positive regulation of alpha-amino-3-hydroxy-5-methyl-4-isoxazole propionate selective glutamate receptor activity(GO:2000969) |
0.3 | 1.0 | GO:0071692 | protein localization to extracellular region(GO:0071692) maintenance of protein location in extracellular region(GO:0071694) |
0.3 | 1.8 | GO:0015812 | gamma-aminobutyric acid transport(GO:0015812) |
0.3 | 1.3 | GO:0021764 | amygdala development(GO:0021764) |
0.3 | 0.5 | GO:0089700 | protein kinase D signaling(GO:0089700) |
0.2 | 0.7 | GO:0051582 | positive regulation of neurotransmitter uptake(GO:0051582) positive regulation of dopamine uptake involved in synaptic transmission(GO:0051586) positive regulation of catecholamine uptake involved in synaptic transmission(GO:0051944) |
0.2 | 1.2 | GO:0003025 | regulation of systemic arterial blood pressure by baroreceptor feedback(GO:0003025) |
0.2 | 2.0 | GO:0007216 | G-protein coupled glutamate receptor signaling pathway(GO:0007216) |
0.2 | 0.5 | GO:0014722 | regulation of skeletal muscle contraction by calcium ion signaling(GO:0014722) |
0.2 | 0.7 | GO:0070827 | chromatin maintenance(GO:0070827) |
0.2 | 2.0 | GO:0072102 | glomerulus morphogenesis(GO:0072102) |
0.2 | 7.6 | GO:0019228 | neuronal action potential(GO:0019228) |
0.2 | 2.4 | GO:0060272 | embryonic skeletal joint morphogenesis(GO:0060272) |
0.2 | 1.0 | GO:0051725 | protein de-ADP-ribosylation(GO:0051725) |
0.2 | 0.2 | GO:0060221 | retinal rod cell differentiation(GO:0060221) |
0.2 | 1.0 | GO:0060024 | rhythmic synaptic transmission(GO:0060024) |
0.2 | 1.0 | GO:0003219 | cardiac right ventricle formation(GO:0003219) |
0.2 | 1.2 | GO:0021894 | cerebral cortex GABAergic interneuron development(GO:0021894) |
0.2 | 1.4 | GO:0019262 | N-acetylneuraminate catabolic process(GO:0019262) |
0.2 | 1.2 | GO:0070120 | ciliary neurotrophic factor-mediated signaling pathway(GO:0070120) |
0.2 | 0.5 | GO:0009448 | gamma-aminobutyric acid metabolic process(GO:0009448) |
0.2 | 1.7 | GO:0045199 | maintenance of epithelial cell apical/basal polarity(GO:0045199) |
0.2 | 1.4 | GO:2000344 | positive regulation of acrosome reaction(GO:2000344) |
0.2 | 1.2 | GO:0090244 | Wnt signaling pathway involved in somitogenesis(GO:0090244) |
0.2 | 1.2 | GO:0034227 | tRNA thio-modification(GO:0034227) |
0.2 | 0.9 | GO:1903626 | positive regulation of apoptotic DNA fragmentation(GO:1902512) positive regulation of DNA catabolic process(GO:1903626) |
0.2 | 0.5 | GO:0060084 | synaptic transmission involved in micturition(GO:0060084) |
0.2 | 0.7 | GO:1902866 | regulation of retina development in camera-type eye(GO:1902866) |
0.2 | 1.4 | GO:0033239 | negative regulation of cellular amine metabolic process(GO:0033239) |
0.2 | 0.2 | GO:0072050 | S-shaped body morphogenesis(GO:0072050) |
0.2 | 2.3 | GO:0015816 | glycine transport(GO:0015816) |
0.2 | 0.2 | GO:0097476 | motor neuron migration(GO:0097475) spinal cord motor neuron migration(GO:0097476) |
0.2 | 0.7 | GO:0070649 | formin-nucleated actin cable assembly(GO:0070649) |
0.2 | 0.9 | GO:0034047 | regulation of protein phosphatase type 2A activity(GO:0034047) |
0.2 | 0.5 | GO:0021826 | substrate-independent telencephalic tangential migration(GO:0021826) substrate-independent telencephalic tangential interneuron migration(GO:0021843) |
0.2 | 2.3 | GO:0010919 | regulation of inositol phosphate biosynthetic process(GO:0010919) |
0.2 | 1.4 | GO:1900452 | regulation of long term synaptic depression(GO:1900452) |
0.2 | 1.6 | GO:0043951 | negative regulation of cAMP-mediated signaling(GO:0043951) |
0.2 | 0.7 | GO:0097155 | fasciculation of sensory neuron axon(GO:0097155) |
0.2 | 2.7 | GO:0006198 | cAMP catabolic process(GO:0006198) |
0.2 | 4.5 | GO:0007214 | gamma-aminobutyric acid signaling pathway(GO:0007214) |
0.2 | 0.5 | GO:0060686 | negative regulation of prostatic bud formation(GO:0060686) |
0.2 | 0.5 | GO:0042940 | D-amino acid transport(GO:0042940) |
0.2 | 1.3 | GO:0001955 | blood vessel maturation(GO:0001955) |
0.2 | 0.9 | GO:0010693 | negative regulation of alkaline phosphatase activity(GO:0010693) |
0.2 | 0.2 | GO:0010751 | negative regulation of nitric oxide mediated signal transduction(GO:0010751) |
0.2 | 0.7 | GO:0002930 | trabecular meshwork development(GO:0002930) |
0.2 | 0.2 | GO:1900222 | negative regulation of beta-amyloid clearance(GO:1900222) |
0.2 | 0.2 | GO:0035995 | detection of muscle stretch(GO:0035995) |
0.2 | 0.4 | GO:0071321 | cellular response to cGMP(GO:0071321) |
0.2 | 0.2 | GO:1904322 | response to forskolin(GO:1904321) cellular response to forskolin(GO:1904322) |
0.2 | 0.2 | GO:2000347 | positive regulation of hepatocyte proliferation(GO:2000347) |
0.2 | 1.1 | GO:0048852 | diencephalon morphogenesis(GO:0048852) |
0.2 | 0.7 | GO:0034395 | regulation of transcription from RNA polymerase II promoter in response to iron(GO:0034395) |
0.2 | 1.5 | GO:0045956 | positive regulation of calcium ion-dependent exocytosis(GO:0045956) |
0.2 | 11.3 | GO:0051965 | positive regulation of synapse assembly(GO:0051965) |
0.2 | 0.7 | GO:0072092 | ureteric bud invasion(GO:0072092) |
0.2 | 1.9 | GO:0070050 | neuron cellular homeostasis(GO:0070050) |
0.2 | 1.7 | GO:0035881 | amacrine cell differentiation(GO:0035881) |
0.2 | 3.2 | GO:0035418 | protein localization to synapse(GO:0035418) |
0.2 | 2.6 | GO:0061003 | positive regulation of dendritic spine morphogenesis(GO:0061003) |
0.2 | 0.8 | GO:0051791 | medium-chain fatty acid metabolic process(GO:0051791) |
0.2 | 0.6 | GO:2000574 | regulation of microtubule motor activity(GO:2000574) |
0.2 | 0.8 | GO:0030311 | poly-N-acetyllactosamine metabolic process(GO:0030309) poly-N-acetyllactosamine biosynthetic process(GO:0030311) |
0.2 | 0.4 | GO:0051385 | response to mineralocorticoid(GO:0051385) |
0.2 | 0.6 | GO:0061000 | negative regulation of dendritic spine development(GO:0061000) |
0.2 | 0.4 | GO:1902498 | regulation of protein autoubiquitination(GO:1902498) |
0.2 | 2.3 | GO:0001964 | startle response(GO:0001964) |
0.2 | 0.8 | GO:0060591 | chondroblast differentiation(GO:0060591) |
0.2 | 1.6 | GO:0021796 | cerebral cortex regionalization(GO:0021796) |
0.2 | 0.6 | GO:2000048 | negative regulation of cell-cell adhesion mediated by cadherin(GO:2000048) |
0.2 | 0.8 | GO:0006931 | substrate-dependent cell migration, cell attachment to substrate(GO:0006931) |
0.2 | 0.8 | GO:0006987 | activation of signaling protein activity involved in unfolded protein response(GO:0006987) |
0.2 | 1.0 | GO:0070940 | dephosphorylation of RNA polymerase II C-terminal domain(GO:0070940) |
0.2 | 0.6 | GO:0035434 | copper ion transmembrane transport(GO:0035434) |
0.2 | 1.4 | GO:2001135 | regulation of endocytic recycling(GO:2001135) |
0.2 | 2.8 | GO:0032011 | ARF protein signal transduction(GO:0032011) regulation of ARF protein signal transduction(GO:0032012) |
0.2 | 0.2 | GO:2001245 | regulation of phosphatidylcholine biosynthetic process(GO:2001245) |
0.2 | 0.6 | GO:0060159 | regulation of dopamine receptor signaling pathway(GO:0060159) |
0.2 | 0.8 | GO:0090385 | phagosome-lysosome fusion(GO:0090385) |
0.2 | 0.6 | GO:0003357 | noradrenergic neuron differentiation(GO:0003357) |
0.2 | 0.2 | GO:0061101 | neuroendocrine cell differentiation(GO:0061101) |
0.2 | 0.6 | GO:0034436 | glycoprotein transport(GO:0034436) |
0.2 | 1.0 | GO:0048312 | intracellular distribution of mitochondria(GO:0048312) |
0.2 | 0.2 | GO:1904193 | cholangiocyte apoptotic process(GO:1902488) regulation of cholangiocyte apoptotic process(GO:1904192) negative regulation of cholangiocyte apoptotic process(GO:1904193) |
0.2 | 0.4 | GO:0014873 | response to muscle activity involved in regulation of muscle adaptation(GO:0014873) |
0.2 | 3.2 | GO:0048488 | synaptic vesicle endocytosis(GO:0048488) |
0.2 | 0.7 | GO:0043097 | pyrimidine-containing compound salvage(GO:0008655) pyrimidine nucleoside salvage(GO:0043097) |
0.2 | 0.6 | GO:0035359 | negative regulation of peroxisome proliferator activated receptor signaling pathway(GO:0035359) |
0.2 | 0.6 | GO:0036072 | intramembranous ossification(GO:0001957) direct ossification(GO:0036072) |
0.2 | 0.6 | GO:0006393 | termination of mitochondrial transcription(GO:0006393) |
0.2 | 0.7 | GO:0016103 | diterpenoid catabolic process(GO:0016103) retinoic acid catabolic process(GO:0034653) |
0.2 | 0.4 | GO:1903797 | positive regulation of inorganic anion transmembrane transport(GO:1903797) |
0.2 | 0.2 | GO:0031635 | adenylate cyclase-inhibiting opioid receptor signaling pathway(GO:0031635) |
0.2 | 0.7 | GO:0033326 | cerebrospinal fluid secretion(GO:0033326) |
0.2 | 1.1 | GO:0090557 | establishment of endothelial intestinal barrier(GO:0090557) |
0.2 | 0.4 | GO:2000017 | positive regulation of determination of dorsal identity(GO:2000017) |
0.2 | 1.3 | GO:1901223 | negative regulation of NIK/NF-kappaB signaling(GO:1901223) |
0.2 | 0.4 | GO:0030382 | sperm mitochondrion organization(GO:0030382) |
0.2 | 0.5 | GO:0061152 | trachea submucosa development(GO:0061152) trachea gland development(GO:0061153) |
0.2 | 0.4 | GO:0008355 | olfactory learning(GO:0008355) |
0.2 | 1.8 | GO:2000311 | regulation of alpha-amino-3-hydroxy-5-methyl-4-isoxazole propionate selective glutamate receptor activity(GO:2000311) |
0.2 | 0.9 | GO:1903215 | negative regulation of protein targeting to mitochondrion(GO:1903215) |
0.2 | 0.2 | GO:1903371 | regulation of endoplasmic reticulum tubular network organization(GO:1903371) |
0.2 | 0.7 | GO:2000463 | positive regulation of excitatory postsynaptic potential(GO:2000463) |
0.2 | 0.2 | GO:0003415 | chondrocyte hypertrophy(GO:0003415) |
0.2 | 1.4 | GO:0001778 | plasma membrane repair(GO:0001778) |
0.2 | 0.5 | GO:0051182 | coenzyme transport(GO:0051182) |
0.2 | 0.5 | GO:0061589 | calcium activated phosphatidylserine scrambling(GO:0061589) |
0.2 | 0.9 | GO:0035989 | tendon development(GO:0035989) |
0.2 | 0.5 | GO:0061043 | regulation of vascular wound healing(GO:0061043) |
0.2 | 0.3 | GO:0021637 | trigeminal nerve morphogenesis(GO:0021636) trigeminal nerve structural organization(GO:0021637) |
0.2 | 0.5 | GO:0031293 | membrane protein intracellular domain proteolysis(GO:0031293) |
0.2 | 0.2 | GO:0060166 | olfactory pit development(GO:0060166) |
0.2 | 0.5 | GO:0042276 | error-prone translesion synthesis(GO:0042276) |
0.2 | 0.2 | GO:0060982 | coronary artery morphogenesis(GO:0060982) |
0.2 | 0.3 | GO:0021957 | corticospinal tract morphogenesis(GO:0021957) |
0.2 | 0.2 | GO:0021827 | cerebral cortex tangential migration using cell-cell interactions(GO:0021823) postnatal olfactory bulb interneuron migration(GO:0021827) |
0.2 | 1.2 | GO:0099623 | regulation of cardiac muscle cell membrane repolarization(GO:0099623) |
0.2 | 1.3 | GO:0046855 | inositol phosphate dephosphorylation(GO:0046855) |
0.2 | 0.5 | GO:0034239 | regulation of macrophage fusion(GO:0034239) |
0.2 | 0.7 | GO:0031339 | negative regulation of vesicle fusion(GO:0031339) |
0.2 | 0.3 | GO:0001698 | gastrin-induced gastric acid secretion(GO:0001698) |
0.2 | 0.3 | GO:0021979 | hypothalamus cell differentiation(GO:0021979) |
0.2 | 1.0 | GO:0097264 | self proteolysis(GO:0097264) |
0.2 | 0.5 | GO:0046882 | negative regulation of follicle-stimulating hormone secretion(GO:0046882) |
0.2 | 0.2 | GO:0098903 | regulation of membrane repolarization during action potential(GO:0098903) |
0.2 | 0.6 | GO:0007158 | neuron cell-cell adhesion(GO:0007158) |
0.2 | 0.6 | GO:0030050 | vesicle transport along actin filament(GO:0030050) |
0.2 | 0.2 | GO:0032346 | positive regulation of aldosterone metabolic process(GO:0032346) positive regulation of aldosterone biosynthetic process(GO:0032349) |
0.2 | 0.5 | GO:0071930 | negative regulation of transcription involved in G1/S transition of mitotic cell cycle(GO:0071930) |
0.2 | 0.3 | GO:0003278 | apoptotic process involved in heart morphogenesis(GO:0003278) |
0.2 | 2.7 | GO:0050650 | chondroitin sulfate proteoglycan biosynthetic process(GO:0050650) |
0.2 | 0.6 | GO:0006627 | protein processing involved in protein targeting to mitochondrion(GO:0006627) |
0.2 | 1.4 | GO:1902259 | regulation of delayed rectifier potassium channel activity(GO:1902259) |
0.2 | 1.2 | GO:0001975 | response to amphetamine(GO:0001975) |
0.2 | 0.5 | GO:0019276 | UDP-N-acetylgalactosamine metabolic process(GO:0019276) |
0.2 | 0.6 | GO:0019853 | L-ascorbic acid biosynthetic process(GO:0019853) |
0.2 | 0.5 | GO:2000852 | corticosterone secretion(GO:0035934) regulation of corticosterone secretion(GO:2000852) |
0.2 | 0.6 | GO:0046532 | regulation of photoreceptor cell differentiation(GO:0046532) |
0.2 | 0.6 | GO:0015824 | proline transport(GO:0015824) |
0.2 | 0.6 | GO:0031117 | positive regulation of microtubule depolymerization(GO:0031117) |
0.2 | 0.3 | GO:0007468 | regulation of rhodopsin gene expression(GO:0007468) |
0.2 | 0.5 | GO:0042473 | outer ear morphogenesis(GO:0042473) |
0.2 | 0.3 | GO:0030167 | proteoglycan catabolic process(GO:0030167) |
0.2 | 1.1 | GO:0043267 | negative regulation of potassium ion transport(GO:0043267) |
0.2 | 0.8 | GO:0097500 | receptor localization to nonmotile primary cilium(GO:0097500) |
0.2 | 0.5 | GO:0009093 | cysteine catabolic process(GO:0009093) L-cysteine catabolic process(GO:0019448) L-cysteine metabolic process(GO:0046439) |
0.2 | 0.5 | GO:0007638 | mechanosensory behavior(GO:0007638) |
0.2 | 0.5 | GO:0070889 | platelet alpha granule organization(GO:0070889) |
0.2 | 0.5 | GO:0035624 | receptor transactivation(GO:0035624) epidermal growth factor-activated receptor transactivation by G-protein coupled receptor signaling pathway(GO:0035625) |
0.2 | 0.3 | GO:0014721 | voluntary skeletal muscle contraction(GO:0003010) twitch skeletal muscle contraction(GO:0014721) |
0.1 | 0.4 | GO:0035609 | C-terminal protein deglutamylation(GO:0035609) |
0.1 | 0.7 | GO:2000096 | positive regulation of Wnt signaling pathway, planar cell polarity pathway(GO:2000096) |
0.1 | 2.1 | GO:0061037 | negative regulation of cartilage development(GO:0061037) |
0.1 | 0.7 | GO:0051418 | interphase microtubule nucleation by interphase microtubule organizing center(GO:0051415) microtubule nucleation by microtubule organizing center(GO:0051418) |
0.1 | 0.1 | GO:0021524 | visceral motor neuron differentiation(GO:0021524) |
0.1 | 0.4 | GO:1902268 | negative regulation of polyamine transmembrane transport(GO:1902268) |
0.1 | 0.1 | GO:0006598 | polyamine catabolic process(GO:0006598) |
0.1 | 0.3 | GO:0021530 | spinal cord oligodendrocyte cell differentiation(GO:0021529) spinal cord oligodendrocyte cell fate specification(GO:0021530) |
0.1 | 0.6 | GO:0045657 | positive regulation of monocyte differentiation(GO:0045657) |
0.1 | 0.9 | GO:0015671 | oxygen transport(GO:0015671) |
0.1 | 0.6 | GO:0010637 | negative regulation of mitochondrial fusion(GO:0010637) |
0.1 | 1.3 | GO:0035428 | hexose transmembrane transport(GO:0035428) |
0.1 | 1.2 | GO:0048671 | negative regulation of collateral sprouting(GO:0048671) |
0.1 | 0.1 | GO:0016344 | meiotic chromosome movement towards spindle pole(GO:0016344) |
0.1 | 0.4 | GO:0071435 | potassium ion export(GO:0071435) |
0.1 | 0.6 | GO:0039689 | negative stranded viral RNA replication(GO:0039689) multi-organism biosynthetic process(GO:0044034) |
0.1 | 0.9 | GO:0031536 | positive regulation of exit from mitosis(GO:0031536) |
0.1 | 0.3 | GO:0035507 | regulation of myosin-light-chain-phosphatase activity(GO:0035507) |
0.1 | 0.1 | GO:0014866 | skeletal myofibril assembly(GO:0014866) |
0.1 | 0.4 | GO:0001923 | B-1 B cell differentiation(GO:0001923) |
0.1 | 0.7 | GO:0007253 | cytoplasmic sequestering of NF-kappaB(GO:0007253) |
0.1 | 0.4 | GO:0050955 | thermoception(GO:0050955) |
0.1 | 0.4 | GO:0021914 | negative regulation of smoothened signaling pathway involved in ventral spinal cord patterning(GO:0021914) |
0.1 | 0.1 | GO:2001214 | positive regulation of vasculogenesis(GO:2001214) |
0.1 | 0.4 | GO:0001831 | trophectodermal cellular morphogenesis(GO:0001831) |
0.1 | 1.1 | GO:0006020 | inositol metabolic process(GO:0006020) |
0.1 | 0.3 | GO:0021797 | forebrain anterior/posterior pattern specification(GO:0021797) |
0.1 | 2.3 | GO:0071475 | cellular hyperosmotic salinity response(GO:0071475) |
0.1 | 0.3 | GO:0072530 | purine nucleoside transmembrane transport(GO:0015860) purine-containing compound transmembrane transport(GO:0072530) nucleoside transmembrane transport(GO:1901642) |
0.1 | 0.5 | GO:0035627 | ceramide transport(GO:0035627) |
0.1 | 0.3 | GO:2000097 | regulation of smooth muscle cell-matrix adhesion(GO:2000097) |
0.1 | 0.4 | GO:1901656 | glycoside transport(GO:1901656) |
0.1 | 0.4 | GO:0071361 | cellular response to ethanol(GO:0071361) |
0.1 | 0.9 | GO:2000653 | regulation of genetic imprinting(GO:2000653) |
0.1 | 1.8 | GO:0061462 | protein localization to lysosome(GO:0061462) |
0.1 | 0.3 | GO:0061511 | centriole elongation(GO:0061511) |
0.1 | 0.1 | GO:0086064 | cell communication by electrical coupling involved in cardiac conduction(GO:0086064) |
0.1 | 0.9 | GO:0031145 | anaphase-promoting complex-dependent catabolic process(GO:0031145) |
0.1 | 0.5 | GO:0015015 | heparan sulfate proteoglycan biosynthetic process, enzymatic modification(GO:0015015) |
0.1 | 0.1 | GO:0048382 | mesendoderm development(GO:0048382) |
0.1 | 3.7 | GO:1901379 | regulation of potassium ion transmembrane transport(GO:1901379) |
0.1 | 1.0 | GO:0032509 | endosome transport via multivesicular body sorting pathway(GO:0032509) |
0.1 | 0.1 | GO:1903116 | positive regulation of actin filament-based movement(GO:1903116) |
0.1 | 0.4 | GO:0032808 | lacrimal gland development(GO:0032808) |
0.1 | 0.4 | GO:0014029 | neural crest formation(GO:0014029) |
0.1 | 0.1 | GO:2001025 | positive regulation of response to drug(GO:2001025) |
0.1 | 0.1 | GO:1901668 | regulation of superoxide dismutase activity(GO:1901668) |
0.1 | 1.3 | GO:0031290 | retinal ganglion cell axon guidance(GO:0031290) |
0.1 | 0.2 | GO:0031585 | regulation of inositol 1,4,5-trisphosphate-sensitive calcium-release channel activity(GO:0031585) |
0.1 | 0.2 | GO:0030208 | dermatan sulfate biosynthetic process(GO:0030208) dermatan sulfate proteoglycan biosynthetic process(GO:0050651) |
0.1 | 0.1 | GO:0070093 | negative regulation of glucagon secretion(GO:0070093) |
0.1 | 0.2 | GO:0060447 | bud outgrowth involved in lung branching(GO:0060447) |
0.1 | 0.7 | GO:0021860 | pyramidal neuron development(GO:0021860) |
0.1 | 0.1 | GO:0097051 | establishment of protein localization to endoplasmic reticulum membrane(GO:0097051) |
0.1 | 0.2 | GO:0019227 | neuronal action potential propagation(GO:0019227) action potential propagation(GO:0098870) |
0.1 | 0.8 | GO:0000083 | regulation of transcription involved in G1/S transition of mitotic cell cycle(GO:0000083) |
0.1 | 0.2 | GO:0032025 | response to cobalt ion(GO:0032025) |
0.1 | 0.2 | GO:0070213 | protein auto-ADP-ribosylation(GO:0070213) |
0.1 | 0.2 | GO:0045838 | positive regulation of membrane potential(GO:0045838) |
0.1 | 0.1 | GO:1903279 | regulation of calcium:sodium antiporter activity(GO:1903279) |
0.1 | 0.6 | GO:0031033 | myosin filament organization(GO:0031033) |
0.1 | 0.2 | GO:0070428 | regulation of nucleotide-binding oligomerization domain containing 1 signaling pathway(GO:0070428) |
0.1 | 0.3 | GO:1903059 | regulation of protein lipidation(GO:1903059) |
0.1 | 0.5 | GO:0071947 | protein deubiquitination involved in ubiquitin-dependent protein catabolic process(GO:0071947) |
0.1 | 7.9 | GO:0071805 | potassium ion transmembrane transport(GO:0071805) |
0.1 | 0.2 | GO:0061055 | myotome development(GO:0061055) |
0.1 | 1.0 | GO:0048714 | positive regulation of oligodendrocyte differentiation(GO:0048714) |
0.1 | 0.1 | GO:0071926 | cannabinoid signaling pathway(GO:0038171) endocannabinoid signaling pathway(GO:0071926) |
0.1 | 1.5 | GO:0098926 | acetylcholine receptor signaling pathway(GO:0095500) postsynaptic signal transduction(GO:0098926) signal transduction involved in cellular response to ammonium ion(GO:1903831) response to acetylcholine(GO:1905144) cellular response to acetylcholine(GO:1905145) |
0.1 | 1.2 | GO:0002176 | male germ cell proliferation(GO:0002176) |
0.1 | 0.4 | GO:0016560 | protein import into peroxisome matrix, docking(GO:0016560) |
0.1 | 0.6 | GO:0071420 | response to histamine(GO:0034776) cellular response to histamine(GO:0071420) |
0.1 | 0.3 | GO:1900368 | regulation of RNA interference(GO:1900368) |
0.1 | 1.1 | GO:0001976 | neurological system process involved in regulation of systemic arterial blood pressure(GO:0001976) |
0.1 | 1.3 | GO:0016486 | peptide hormone processing(GO:0016486) |
0.1 | 0.4 | GO:0042428 | serotonin metabolic process(GO:0042428) |
0.1 | 1.1 | GO:0030238 | male sex determination(GO:0030238) |
0.1 | 0.1 | GO:0030421 | defecation(GO:0030421) |
0.1 | 0.9 | GO:2000671 | regulation of motor neuron apoptotic process(GO:2000671) |
0.1 | 0.7 | GO:0051764 | actin crosslink formation(GO:0051764) |
0.1 | 0.3 | GO:0002901 | mature B cell apoptotic process(GO:0002901) regulation of mature B cell apoptotic process(GO:0002905) negative regulation of mature B cell apoptotic process(GO:0002906) |
0.1 | 0.3 | GO:0035521 | monoubiquitinated histone deubiquitination(GO:0035521) monoubiquitinated histone H2A deubiquitination(GO:0035522) |
0.1 | 0.2 | GO:0019230 | proprioception(GO:0019230) |
0.1 | 0.3 | GO:0060005 | vestibular reflex(GO:0060005) |
0.1 | 0.5 | GO:0060040 | retinal bipolar neuron differentiation(GO:0060040) |
0.1 | 0.3 | GO:0035701 | hematopoietic stem cell migration(GO:0035701) |
0.1 | 0.1 | GO:0008065 | establishment of blood-nerve barrier(GO:0008065) |
0.1 | 1.4 | GO:0050962 | detection of light stimulus involved in visual perception(GO:0050908) detection of light stimulus involved in sensory perception(GO:0050962) |
0.1 | 0.4 | GO:0015780 | nucleotide-sugar transport(GO:0015780) pyrimidine nucleotide-sugar transport(GO:0015781) |
0.1 | 0.1 | GO:0003340 | negative regulation of mesenchymal to epithelial transition involved in metanephros morphogenesis(GO:0003340) |
0.1 | 0.5 | GO:0045541 | negative regulation of cholesterol biosynthetic process(GO:0045541) negative regulation of cholesterol metabolic process(GO:0090206) |
0.1 | 0.2 | GO:0010360 | negative regulation of anion channel activity(GO:0010360) |
0.1 | 0.1 | GO:0070295 | renal water absorption(GO:0070295) |
0.1 | 0.2 | GO:1903862 | positive regulation of oxidative phosphorylation(GO:1903862) |
0.1 | 0.1 | GO:0031547 | brain-derived neurotrophic factor receptor signaling pathway(GO:0031547) |
0.1 | 0.3 | GO:2001032 | regulation of double-strand break repair via nonhomologous end joining(GO:2001032) |
0.1 | 0.8 | GO:0070525 | tRNA threonylcarbamoyladenosine metabolic process(GO:0070525) |
0.1 | 0.4 | GO:0060179 | male mating behavior(GO:0060179) |
0.1 | 0.7 | GO:0008038 | neuron recognition(GO:0008038) |
0.1 | 0.3 | GO:0090135 | actin filament branching(GO:0090135) |
0.1 | 0.7 | GO:0008215 | spermine metabolic process(GO:0008215) |
0.1 | 0.5 | GO:2000009 | negative regulation of protein localization to cell surface(GO:2000009) |
0.1 | 0.3 | GO:0010835 | regulation of protein ADP-ribosylation(GO:0010835) |
0.1 | 0.1 | GO:1901841 | regulation of high voltage-gated calcium channel activity(GO:1901841) |
0.1 | 1.0 | GO:0060997 | dendritic spine morphogenesis(GO:0060997) |
0.1 | 0.3 | GO:0032377 | regulation of intracellular lipid transport(GO:0032377) regulation of intracellular sterol transport(GO:0032380) regulation of intracellular cholesterol transport(GO:0032383) |
0.1 | 0.5 | GO:0021871 | forebrain regionalization(GO:0021871) |
0.1 | 0.2 | GO:1903587 | regulation of blood vessel endothelial cell proliferation involved in sprouting angiogenesis(GO:1903587) |
0.1 | 0.3 | GO:0001560 | regulation of cell growth by extracellular stimulus(GO:0001560) |
0.1 | 0.3 | GO:2000195 | negative regulation of female gonad development(GO:2000195) |
0.1 | 1.4 | GO:0006613 | cotranslational protein targeting to membrane(GO:0006613) |
0.1 | 0.7 | GO:0050957 | equilibrioception(GO:0050957) |
0.1 | 0.6 | GO:0051930 | regulation of sensory perception of pain(GO:0051930) regulation of sensory perception(GO:0051931) |
0.1 | 0.2 | GO:0072318 | clathrin coat disassembly(GO:0072318) |
0.1 | 0.1 | GO:0048861 | leukemia inhibitory factor signaling pathway(GO:0048861) |
0.1 | 0.2 | GO:0015705 | iodide transport(GO:0015705) |
0.1 | 0.1 | GO:0071787 | endoplasmic reticulum tubular network assembly(GO:0071787) |
0.1 | 0.6 | GO:0090084 | negative regulation of inclusion body assembly(GO:0090084) |
0.1 | 0.3 | GO:2000847 | negative regulation of steroid hormone secretion(GO:2000832) negative regulation of corticosteroid hormone secretion(GO:2000847) negative regulation of glucocorticoid secretion(GO:2000850) |
0.1 | 0.1 | GO:0072048 | pattern specification involved in kidney development(GO:0061004) renal system pattern specification(GO:0072048) |
0.1 | 0.6 | GO:0044387 | negative regulation of protein kinase activity by regulation of protein phosphorylation(GO:0044387) |
0.1 | 0.1 | GO:0070672 | response to interleukin-15(GO:0070672) |
0.1 | 0.1 | GO:2000807 | regulation of synaptic vesicle clustering(GO:2000807) |
0.1 | 0.4 | GO:0090370 | negative regulation of cholesterol efflux(GO:0090370) |
0.1 | 1.7 | GO:0007416 | synapse assembly(GO:0007416) |
0.1 | 0.2 | GO:0002087 | regulation of respiratory gaseous exchange by neurological system process(GO:0002087) |
0.1 | 0.2 | GO:0006041 | glucosamine metabolic process(GO:0006041) |
0.1 | 0.2 | GO:0048752 | semicircular canal morphogenesis(GO:0048752) |
0.1 | 0.3 | GO:1900045 | negative regulation of protein K63-linked ubiquitination(GO:1900045) negative regulation of protein polyubiquitination(GO:1902915) |
0.1 | 0.3 | GO:0060897 | neural plate regionalization(GO:0060897) |
0.1 | 2.6 | GO:1902476 | chloride transmembrane transport(GO:1902476) |
0.1 | 0.1 | GO:2001012 | mesenchymal cell differentiation involved in kidney development(GO:0072161) mesenchymal cell differentiation involved in renal system development(GO:2001012) |
0.1 | 0.6 | GO:0002084 | protein depalmitoylation(GO:0002084) macromolecule depalmitoylation(GO:0098734) |
0.1 | 0.4 | GO:1904424 | regulation of GTP binding(GO:1904424) |
0.1 | 0.3 | GO:0048549 | positive regulation of pinocytosis(GO:0048549) |
0.1 | 0.7 | GO:0019800 | peptide cross-linking via chondroitin 4-sulfate glycosaminoglycan(GO:0019800) |
0.1 | 0.6 | GO:0007628 | adult walking behavior(GO:0007628) walking behavior(GO:0090659) |
0.1 | 0.3 | GO:0018879 | biphenyl metabolic process(GO:0018879) |
0.1 | 0.3 | GO:0060666 | dichotomous subdivision of terminal units involved in salivary gland branching(GO:0060666) |
0.1 | 0.4 | GO:0006398 | mRNA 3'-end processing by stem-loop binding and cleavage(GO:0006398) |
0.1 | 0.1 | GO:0033603 | positive regulation of dopamine secretion(GO:0033603) |
0.1 | 0.3 | GO:0042996 | regulation of Golgi to plasma membrane protein transport(GO:0042996) |
0.1 | 0.5 | GO:0051152 | positive regulation of smooth muscle cell differentiation(GO:0051152) |
0.1 | 0.3 | GO:1903779 | regulation of cardiac conduction(GO:1903779) |
0.1 | 0.3 | GO:0030091 | protein repair(GO:0030091) |
0.1 | 0.3 | GO:0046013 | T cell homeostatic proliferation(GO:0001777) regulation of T cell homeostatic proliferation(GO:0046013) |
0.1 | 0.2 | GO:0051481 | negative regulation of cytosolic calcium ion concentration(GO:0051481) |
0.1 | 0.4 | GO:0048739 | cardiac muscle fiber development(GO:0048739) |
0.1 | 0.4 | GO:0006450 | regulation of translational fidelity(GO:0006450) |
0.1 | 0.1 | GO:0007199 | G-protein coupled receptor signaling pathway coupled to cGMP nucleotide second messenger(GO:0007199) |
0.1 | 0.4 | GO:0010587 | miRNA catabolic process(GO:0010587) |
0.1 | 0.1 | GO:0042231 | interleukin-13 biosynthetic process(GO:0042231) |
0.1 | 0.2 | GO:0021895 | cerebral cortex neuron differentiation(GO:0021895) |
0.1 | 2.2 | GO:0050885 | neuromuscular process controlling balance(GO:0050885) |
0.1 | 0.2 | GO:0007066 | female meiosis sister chromatid cohesion(GO:0007066) |
0.1 | 0.2 | GO:0032811 | negative regulation of epinephrine secretion(GO:0032811) |
0.1 | 0.5 | GO:0035385 | Roundabout signaling pathway(GO:0035385) |
0.1 | 0.2 | GO:0030397 | membrane disassembly(GO:0030397) nuclear envelope disassembly(GO:0051081) |
0.1 | 0.6 | GO:0006707 | cholesterol catabolic process(GO:0006707) sterol catabolic process(GO:0016127) |
0.1 | 0.8 | GO:1903861 | regulation of dendrite extension(GO:1903859) positive regulation of dendrite extension(GO:1903861) |
0.1 | 0.4 | GO:0016339 | calcium-dependent cell-cell adhesion via plasma membrane cell adhesion molecules(GO:0016339) |
0.1 | 0.2 | GO:0006407 | rRNA export from nucleus(GO:0006407) |
0.1 | 0.2 | GO:0072051 | juxtaglomerular apparatus development(GO:0072051) |
0.1 | 0.1 | GO:1904849 | positive regulation of cell chemotaxis to fibroblast growth factor(GO:1904849) positive regulation of endothelial cell chemotaxis to fibroblast growth factor(GO:2000546) |
0.1 | 0.1 | GO:0060174 | limb bud formation(GO:0060174) |
0.1 | 0.1 | GO:0090666 | scaRNA localization to Cajal body(GO:0090666) |
0.1 | 0.2 | GO:0042891 | antibiotic transport(GO:0042891) |
0.1 | 0.1 | GO:0060584 | regulation of prostaglandin-endoperoxide synthase activity(GO:0060584) positive regulation of prostaglandin-endoperoxide synthase activity(GO:0060585) |
0.1 | 0.9 | GO:0034104 | negative regulation of tissue remodeling(GO:0034104) |
0.1 | 0.1 | GO:1903715 | regulation of aerobic respiration(GO:1903715) |
0.1 | 0.3 | GO:0048254 | snoRNA localization(GO:0048254) |
0.1 | 0.3 | GO:0007220 | Notch receptor processing(GO:0007220) |
0.1 | 0.2 | GO:1900186 | negative regulation of clathrin-mediated endocytosis(GO:1900186) |
0.1 | 5.3 | GO:0007156 | homophilic cell adhesion via plasma membrane adhesion molecules(GO:0007156) |
0.1 | 0.3 | GO:0006369 | termination of RNA polymerase II transcription(GO:0006369) |
0.1 | 0.1 | GO:0036159 | inner dynein arm assembly(GO:0036159) |
0.1 | 0.1 | GO:2000354 | regulation of ovarian follicle development(GO:2000354) |
0.1 | 0.3 | GO:0007406 | negative regulation of neuroblast proliferation(GO:0007406) |
0.1 | 0.1 | GO:0046548 | retinal rod cell development(GO:0046548) |
0.1 | 0.2 | GO:0006269 | DNA replication, synthesis of RNA primer(GO:0006269) |
0.1 | 0.2 | GO:0010961 | cellular magnesium ion homeostasis(GO:0010961) |
0.1 | 0.2 | GO:1901873 | regulation of post-translational protein modification(GO:1901873) negative regulation of post-translational protein modification(GO:1901874) |
0.1 | 0.2 | GO:0006083 | acetate metabolic process(GO:0006083) |
0.1 | 0.8 | GO:0090103 | cochlea morphogenesis(GO:0090103) |
0.1 | 0.3 | GO:0050884 | neuromuscular process controlling posture(GO:0050884) |
0.1 | 0.2 | GO:0035093 | spermatogenesis, exchange of chromosomal proteins(GO:0035093) |
0.1 | 0.2 | GO:1901525 | negative regulation of macromitophagy(GO:1901525) |
0.1 | 0.2 | GO:0031086 | nuclear-transcribed mRNA catabolic process, deadenylation-independent decay(GO:0031086) deadenylation-independent decapping of nuclear-transcribed mRNA(GO:0031087) |
0.1 | 0.3 | GO:0032020 | ISG15-protein conjugation(GO:0032020) |
0.1 | 0.3 | GO:0061484 | hematopoietic stem cell homeostasis(GO:0061484) |
0.1 | 0.4 | GO:0035584 | calcium-mediated signaling using intracellular calcium source(GO:0035584) |
0.1 | 1.2 | GO:0007271 | synaptic transmission, cholinergic(GO:0007271) |
0.1 | 0.3 | GO:0060907 | positive regulation of macrophage cytokine production(GO:0060907) |
0.1 | 0.5 | GO:0042670 | retinal cone cell differentiation(GO:0042670) retinal cone cell development(GO:0046549) |
0.1 | 0.1 | GO:0099612 | protein localization to axon(GO:0099612) |
0.1 | 0.2 | GO:0045113 | regulation of integrin biosynthetic process(GO:0045113) |
0.1 | 0.1 | GO:0016561 | protein import into peroxisome matrix, translocation(GO:0016561) |
0.1 | 0.2 | GO:0032596 | protein transport into membrane raft(GO:0032596) |
0.1 | 0.1 | GO:0001922 | B-1 B cell homeostasis(GO:0001922) |
0.1 | 0.1 | GO:1904528 | regulation of microtubule binding(GO:1904526) positive regulation of microtubule binding(GO:1904528) |
0.1 | 0.1 | GO:0050655 | dermatan sulfate metabolic process(GO:0030205) dermatan sulfate proteoglycan metabolic process(GO:0050655) |
0.1 | 0.2 | GO:0006562 | proline catabolic process(GO:0006562) |
0.1 | 0.4 | GO:0035845 | photoreceptor cell outer segment organization(GO:0035845) |
0.1 | 0.3 | GO:0042135 | neurotransmitter catabolic process(GO:0042135) |
0.1 | 0.9 | GO:0030224 | monocyte differentiation(GO:0030224) |
0.1 | 0.1 | GO:0035887 | aortic smooth muscle cell differentiation(GO:0035887) |
0.1 | 0.1 | GO:2000821 | regulation of grooming behavior(GO:2000821) |
0.1 | 1.9 | GO:0007019 | microtubule depolymerization(GO:0007019) |
0.1 | 0.6 | GO:0003417 | growth plate cartilage development(GO:0003417) |
0.1 | 1.0 | GO:0008053 | mitochondrial fusion(GO:0008053) |
0.1 | 0.1 | GO:1990036 | calcium ion import into sarcoplasmic reticulum(GO:1990036) |
0.1 | 0.3 | GO:1901026 | ripoptosome assembly(GO:0097343) ripoptosome assembly involved in necroptotic process(GO:1901026) |
0.1 | 0.2 | GO:0009128 | purine nucleoside monophosphate catabolic process(GO:0009128) |
0.1 | 0.1 | GO:0061590 | calcium activated phospholipid scrambling(GO:0061588) calcium activated phosphatidylcholine scrambling(GO:0061590) calcium activated galactosylceramide scrambling(GO:0061591) |
0.1 | 0.4 | GO:0009651 | response to salt stress(GO:0009651) |
0.1 | 0.2 | GO:0036016 | response to interleukin-3(GO:0036015) cellular response to interleukin-3(GO:0036016) |
0.1 | 0.3 | GO:0034080 | CENP-A containing nucleosome assembly(GO:0034080) CENP-A containing chromatin organization(GO:0061641) |
0.1 | 0.1 | GO:0072174 | metanephric tubule formation(GO:0072174) |
0.1 | 1.1 | GO:0006904 | vesicle docking involved in exocytosis(GO:0006904) |
0.1 | 0.8 | GO:0048791 | calcium ion-regulated exocytosis of neurotransmitter(GO:0048791) |
0.1 | 0.3 | GO:0007256 | activation of JNKK activity(GO:0007256) |
0.1 | 0.2 | GO:0003091 | renal water homeostasis(GO:0003091) |
0.1 | 0.1 | GO:0051967 | negative regulation of synaptic transmission, glutamatergic(GO:0051967) |
0.1 | 0.4 | GO:0090141 | positive regulation of mitochondrial fission(GO:0090141) |
0.1 | 0.1 | GO:0003402 | planar cell polarity pathway involved in axis elongation(GO:0003402) regulation of planar cell polarity pathway involved in axis elongation(GO:2000040) negative regulation of planar cell polarity pathway involved in axis elongation(GO:2000041) |
0.1 | 0.4 | GO:0015884 | folic acid transport(GO:0015884) |
0.1 | 0.2 | GO:1903237 | negative regulation of leukocyte tethering or rolling(GO:1903237) |
0.1 | 0.1 | GO:0034729 | histone H3-K79 methylation(GO:0034729) |
0.1 | 0.2 | GO:0032049 | cardiolipin biosynthetic process(GO:0032049) |
0.1 | 0.1 | GO:0086091 | regulation of heart rate by cardiac conduction(GO:0086091) |
0.1 | 0.2 | GO:0030432 | peristalsis(GO:0030432) |
0.1 | 0.1 | GO:1900086 | positive regulation of peptidyl-tyrosine autophosphorylation(GO:1900086) |
0.1 | 0.2 | GO:1900116 | sequestering of extracellular ligand from receptor(GO:0035581) extracellular regulation of signal transduction(GO:1900115) extracellular negative regulation of signal transduction(GO:1900116) |
0.1 | 0.6 | GO:0007020 | microtubule nucleation(GO:0007020) |
0.1 | 0.1 | GO:0046122 | purine deoxyribonucleoside metabolic process(GO:0046122) |
0.1 | 0.1 | GO:0090310 | negative regulation of methylation-dependent chromatin silencing(GO:0090310) |
0.1 | 0.2 | GO:0010166 | wax biosynthetic process(GO:0010025) wax metabolic process(GO:0010166) |
0.1 | 0.2 | GO:0090308 | regulation of methylation-dependent chromatin silencing(GO:0090308) |
0.1 | 0.1 | GO:0086036 | regulation of cardiac muscle cell membrane potential(GO:0086036) |
0.1 | 0.1 | GO:0051665 | membrane raft localization(GO:0051665) |
0.1 | 0.5 | GO:0035176 | social behavior(GO:0035176) intraspecies interaction between organisms(GO:0051703) |
0.1 | 1.2 | GO:0045494 | photoreceptor cell maintenance(GO:0045494) |
0.1 | 0.2 | GO:2000503 | positive regulation of natural killer cell chemotaxis(GO:2000503) |
0.1 | 0.6 | GO:0036158 | outer dynein arm assembly(GO:0036158) |
0.1 | 0.6 | GO:0060294 | cilium movement involved in cell motility(GO:0060294) |
0.1 | 0.1 | GO:0072205 | metanephric collecting duct development(GO:0072205) |
0.1 | 0.2 | GO:0019747 | regulation of isoprenoid metabolic process(GO:0019747) |
0.1 | 0.2 | GO:0003433 | chondrocyte development involved in endochondral bone morphogenesis(GO:0003433) |
0.1 | 0.2 | GO:0014824 | artery smooth muscle contraction(GO:0014824) |
0.1 | 0.3 | GO:2000035 | regulation of stem cell division(GO:2000035) |
0.1 | 0.2 | GO:0015747 | urate transport(GO:0015747) |
0.1 | 0.3 | GO:0006621 | protein retention in ER lumen(GO:0006621) |
0.1 | 0.2 | GO:0000715 | nucleotide-excision repair, DNA damage recognition(GO:0000715) |
0.1 | 0.2 | GO:0044860 | protein localization to plasma membrane raft(GO:0044860) |
0.1 | 0.2 | GO:0045085 | negative regulation of interleukin-2 biosynthetic process(GO:0045085) |
0.1 | 0.3 | GO:0048672 | positive regulation of collateral sprouting(GO:0048672) |
0.1 | 0.1 | GO:0052203 | modulation of catalytic activity in other organism involved in symbiotic interaction(GO:0052203) modulation by host of symbiont catalytic activity(GO:0052422) |
0.1 | 0.2 | GO:0030259 | lipid glycosylation(GO:0030259) |
0.1 | 0.2 | GO:0033353 | S-adenosylmethionine cycle(GO:0033353) |
0.1 | 0.1 | GO:0035815 | positive regulation of renal sodium excretion(GO:0035815) |
0.1 | 0.3 | GO:0007135 | meiosis II(GO:0007135) |
0.1 | 0.1 | GO:0034499 | late endosome to Golgi transport(GO:0034499) |
0.1 | 0.1 | GO:0001907 | killing by symbiont of host cells(GO:0001907) disruption by symbiont of host cell(GO:0044004) |
0.1 | 0.4 | GO:0034626 | fatty acid elongation, saturated fatty acid(GO:0019367) fatty acid elongation, unsaturated fatty acid(GO:0019368) fatty acid elongation, monounsaturated fatty acid(GO:0034625) fatty acid elongation, polyunsaturated fatty acid(GO:0034626) |
0.1 | 0.1 | GO:0048865 | stem cell fate commitment(GO:0048865) |
0.1 | 0.3 | GO:0046654 | tetrahydrofolate biosynthetic process(GO:0046654) |
0.1 | 0.3 | GO:1904872 | regulation of telomerase RNA localization to Cajal body(GO:1904872) positive regulation of telomerase RNA localization to Cajal body(GO:1904874) |
0.1 | 0.1 | GO:0060266 | negative regulation of respiratory burst involved in inflammatory response(GO:0060266) |
0.1 | 0.5 | GO:1904355 | positive regulation of telomere capping(GO:1904355) |
0.1 | 0.1 | GO:0097029 | mature conventional dendritic cell differentiation(GO:0097029) |
0.1 | 0.1 | GO:0014707 | branchiomeric skeletal muscle development(GO:0014707) |
0.0 | 0.0 | GO:0072679 | thymocyte migration(GO:0072679) regulation of thymocyte migration(GO:2000410) positive regulation of thymocyte migration(GO:2000412) |
0.0 | 0.1 | GO:0002540 | leukotriene production involved in inflammatory response(GO:0002540) |
0.0 | 0.1 | GO:0071910 | determination of liver left/right asymmetry(GO:0071910) |
0.0 | 0.4 | GO:0071260 | cellular response to mechanical stimulus(GO:0071260) |
0.0 | 0.1 | GO:0044838 | cell quiescence(GO:0044838) |
0.0 | 0.0 | GO:1902563 | regulation of neutrophil activation(GO:1902563) |
0.0 | 0.2 | GO:0050951 | sensory perception of temperature stimulus(GO:0050951) |
0.0 | 0.1 | GO:0060762 | regulation of branching involved in mammary gland duct morphogenesis(GO:0060762) |
0.0 | 0.0 | GO:0042519 | tyrosine phosphorylation of Stat4 protein(GO:0042504) regulation of tyrosine phosphorylation of Stat4 protein(GO:0042519) |
0.0 | 0.1 | GO:0042637 | catagen(GO:0042637) |
0.0 | 0.4 | GO:0045687 | positive regulation of glial cell differentiation(GO:0045687) |
0.0 | 0.6 | GO:0021516 | dorsal spinal cord development(GO:0021516) |
0.0 | 0.3 | GO:0032700 | negative regulation of interleukin-17 production(GO:0032700) |
0.0 | 0.1 | GO:0099515 | actin filament-based transport(GO:0099515) |
0.0 | 0.2 | GO:0071493 | cellular response to UV-B(GO:0071493) |
0.0 | 0.4 | GO:1990173 | protein localization to nuclear body(GO:1903405) protein localization to Cajal body(GO:1904867) regulation of protein localization to Cajal body(GO:1904869) positive regulation of protein localization to Cajal body(GO:1904871) protein localization to nucleoplasm(GO:1990173) |
0.0 | 0.0 | GO:0060287 | epithelial cilium movement involved in determination of left/right asymmetry(GO:0060287) |
0.0 | 0.0 | GO:0021859 | pyramidal neuron differentiation(GO:0021859) |
0.0 | 0.0 | GO:1901256 | macrophage colony-stimulating factor production(GO:0036301) granulocyte colony-stimulating factor production(GO:0071611) regulation of granulocyte colony-stimulating factor production(GO:0071655) regulation of macrophage colony-stimulating factor production(GO:1901256) |
0.0 | 0.2 | GO:0009624 | response to nematode(GO:0009624) |
0.0 | 0.5 | GO:0035025 | positive regulation of Rho protein signal transduction(GO:0035025) |
0.0 | 0.1 | GO:0003199 | endocardial cushion to mesenchymal transition involved in heart valve formation(GO:0003199) |
0.0 | 0.0 | GO:0046049 | UMP biosynthetic process(GO:0006222) pyrimidine ribonucleoside monophosphate metabolic process(GO:0009173) pyrimidine ribonucleoside monophosphate biosynthetic process(GO:0009174) UMP metabolic process(GO:0046049) |
0.0 | 0.2 | GO:0009111 | vitamin catabolic process(GO:0009111) fat-soluble vitamin catabolic process(GO:0042363) |
0.0 | 0.0 | GO:0016188 | synaptic vesicle maturation(GO:0016188) |
0.0 | 0.1 | GO:0060800 | regulation of cell differentiation involved in embryonic placenta development(GO:0060800) |
0.0 | 0.1 | GO:1903660 | complement-dependent cytotoxicity(GO:0097278) regulation of complement-dependent cytotoxicity(GO:1903659) negative regulation of complement-dependent cytotoxicity(GO:1903660) |
0.0 | 0.1 | GO:0032227 | negative regulation of synaptic transmission, dopaminergic(GO:0032227) |
0.0 | 0.6 | GO:0090036 | regulation of protein kinase C signaling(GO:0090036) |
0.0 | 0.1 | GO:0001956 | positive regulation of neurotransmitter secretion(GO:0001956) |
0.0 | 0.1 | GO:0006667 | sphinganine metabolic process(GO:0006667) |
0.0 | 0.1 | GO:1900042 | positive regulation of interleukin-2 secretion(GO:1900042) |
0.0 | 0.2 | GO:0060766 | negative regulation of androgen receptor signaling pathway(GO:0060766) |
0.0 | 0.3 | GO:0048715 | negative regulation of oligodendrocyte differentiation(GO:0048715) |
0.0 | 0.1 | GO:2000381 | negative regulation of mesoderm development(GO:2000381) |
0.0 | 0.1 | GO:0043615 | astrocyte cell migration(GO:0043615) |
0.0 | 0.1 | GO:2000510 | positive regulation of dendritic cell chemotaxis(GO:2000510) |
0.0 | 0.2 | GO:0046499 | S-adenosylmethioninamine metabolic process(GO:0046499) |
0.0 | 0.0 | GO:0032417 | positive regulation of sodium:proton antiporter activity(GO:0032417) |
0.0 | 0.7 | GO:0009225 | nucleotide-sugar metabolic process(GO:0009225) |
0.0 | 0.1 | GO:1901894 | regulation of calcium-transporting ATPase activity(GO:1901894) |
0.0 | 0.1 | GO:0019244 | lactate biosynthetic process from pyruvate(GO:0019244) lactate biosynthetic process(GO:0019249) |
0.0 | 0.1 | GO:1903071 | positive regulation of ER-associated ubiquitin-dependent protein catabolic process(GO:1903071) |
0.0 | 0.3 | GO:0043162 | ubiquitin-dependent protein catabolic process via the multivesicular body sorting pathway(GO:0043162) |
0.0 | 0.2 | GO:0060292 | long term synaptic depression(GO:0060292) |
0.0 | 0.1 | GO:0035092 | sperm chromatin condensation(GO:0035092) |
0.0 | 0.1 | GO:0070318 | positive regulation of G0 to G1 transition(GO:0070318) |
0.0 | 0.2 | GO:0002043 | blood vessel endothelial cell proliferation involved in sprouting angiogenesis(GO:0002043) |
0.0 | 0.1 | GO:0090050 | positive regulation of cell migration involved in sprouting angiogenesis(GO:0090050) |
0.0 | 0.2 | GO:0006538 | glutamate catabolic process(GO:0006538) |
0.0 | 0.1 | GO:0045054 | constitutive secretory pathway(GO:0045054) |
0.0 | 0.1 | GO:0030327 | prenylated protein catabolic process(GO:0030327) |
0.0 | 1.0 | GO:0006270 | DNA replication initiation(GO:0006270) |
0.0 | 0.1 | GO:0010918 | positive regulation of mitochondrial membrane potential(GO:0010918) |
0.0 | 0.2 | GO:0048172 | regulation of short-term neuronal synaptic plasticity(GO:0048172) |
0.0 | 0.1 | GO:0061046 | regulation of branching involved in lung morphogenesis(GO:0061046) |
0.0 | 0.0 | GO:0009212 | dTTP biosynthetic process(GO:0006235) pyrimidine deoxyribonucleoside triphosphate biosynthetic process(GO:0009212) dTTP metabolic process(GO:0046075) |
0.0 | 0.1 | GO:0090598 | male genitalia morphogenesis(GO:0048808) male anatomical structure morphogenesis(GO:0090598) |
0.0 | 0.0 | GO:0071440 | regulation of histone H3-K14 acetylation(GO:0071440) |
0.0 | 0.0 | GO:0003331 | regulation of extracellular matrix constituent secretion(GO:0003330) positive regulation of extracellular matrix constituent secretion(GO:0003331) |
0.0 | 0.2 | GO:0046541 | saliva secretion(GO:0046541) |
0.0 | 0.2 | GO:0001835 | blastocyst hatching(GO:0001835) hatching(GO:0035188) organism emergence from protective structure(GO:0071684) |
0.0 | 0.1 | GO:0071169 | establishment of protein localization to chromatin(GO:0071169) |
0.0 | 0.3 | GO:0006012 | galactose metabolic process(GO:0006012) |
0.0 | 0.1 | GO:0071921 | establishment of sister chromatid cohesion(GO:0034085) cohesin loading(GO:0071921) regulation of cohesin loading(GO:0071922) |
0.0 | 0.0 | GO:1990035 | calcium ion import into cell(GO:1990035) |
0.0 | 0.2 | GO:0007210 | serotonin receptor signaling pathway(GO:0007210) |
0.0 | 0.1 | GO:0070375 | ERK5 cascade(GO:0070375) |
0.0 | 0.6 | GO:0016578 | histone deubiquitination(GO:0016578) |
0.0 | 0.3 | GO:0021884 | forebrain neuron development(GO:0021884) |
0.0 | 0.4 | GO:0070536 | protein K63-linked deubiquitination(GO:0070536) |
0.0 | 0.3 | GO:0042772 | DNA damage response, signal transduction by p53 class mediator resulting in transcription of p21 class mediator(GO:0006978) DNA damage response, signal transduction resulting in transcription(GO:0042772) |
0.0 | 0.1 | GO:0030576 | Cajal body organization(GO:0030576) |
0.0 | 0.1 | GO:0060751 | epithelial cell proliferation involved in mammary gland duct elongation(GO:0060750) branch elongation involved in mammary gland duct branching(GO:0060751) |
0.0 | 0.1 | GO:0055003 | cardiac myofibril assembly(GO:0055003) |
0.0 | 0.3 | GO:0034453 | microtubule anchoring(GO:0034453) |
0.0 | 0.1 | GO:0042447 | hormone catabolic process(GO:0042447) |
0.0 | 0.1 | GO:0050915 | sensory perception of sour taste(GO:0050915) |
0.0 | 0.1 | GO:0038031 | non-canonical Wnt signaling pathway via JNK cascade(GO:0038031) |
0.0 | 0.1 | GO:0010847 | regulation of chromatin assembly(GO:0010847) |
0.0 | 0.3 | GO:0035745 | T-helper 2 cell cytokine production(GO:0035745) |
0.0 | 0.4 | GO:0016973 | poly(A)+ mRNA export from nucleus(GO:0016973) |
0.0 | 0.2 | GO:0016056 | rhodopsin mediated signaling pathway(GO:0016056) |
0.0 | 0.1 | GO:0008063 | Toll signaling pathway(GO:0008063) |
0.0 | 1.4 | GO:0007218 | neuropeptide signaling pathway(GO:0007218) |
0.0 | 0.1 | GO:0010756 | positive regulation of plasminogen activation(GO:0010756) |
0.0 | 0.1 | GO:0042138 | meiotic DNA double-strand break formation(GO:0042138) |
0.0 | 0.1 | GO:0033578 | protein glycosylation in Golgi(GO:0033578) |
0.0 | 0.1 | GO:0002322 | B cell proliferation involved in immune response(GO:0002322) |
0.0 | 0.0 | GO:0070253 | somatostatin secretion(GO:0070253) |
0.0 | 0.1 | GO:0031936 | negative regulation of chromatin silencing(GO:0031936) |
0.0 | 0.1 | GO:0018364 | peptidyl-glutamine methylation(GO:0018364) |
0.0 | 0.6 | GO:0046839 | phospholipid dephosphorylation(GO:0046839) |
0.0 | 0.1 | GO:2000095 | regulation of Wnt signaling pathway, planar cell polarity pathway(GO:2000095) |
0.0 | 0.0 | GO:0046959 | habituation(GO:0046959) |
0.0 | 0.1 | GO:2000321 | positive regulation of T-helper 17 cell differentiation(GO:2000321) |
0.0 | 0.7 | GO:0031146 | SCF-dependent proteasomal ubiquitin-dependent protein catabolic process(GO:0031146) |
0.0 | 0.0 | GO:0019087 | transformation of host cell by virus(GO:0019087) |
0.0 | 0.1 | GO:0050689 | negative regulation of defense response to virus by host(GO:0050689) |
0.0 | 0.0 | GO:0014050 | negative regulation of glutamate secretion(GO:0014050) |
0.0 | 0.1 | GO:0032486 | Rap protein signal transduction(GO:0032486) |
0.0 | 1.6 | GO:0010923 | negative regulation of phosphatase activity(GO:0010923) |
0.0 | 0.0 | GO:0009996 | negative regulation of cell fate specification(GO:0009996) |
0.0 | 0.2 | GO:0071918 | urea transmembrane transport(GO:0071918) |
0.0 | 0.1 | GO:0042360 | vitamin E metabolic process(GO:0042360) |
0.0 | 0.2 | GO:0008334 | histone mRNA metabolic process(GO:0008334) histone mRNA catabolic process(GO:0071044) |
0.0 | 0.1 | GO:0038095 | Fc-epsilon receptor signaling pathway(GO:0038095) |
0.0 | 0.0 | GO:0002904 | positive regulation of B cell apoptotic process(GO:0002904) |
0.0 | 0.1 | GO:1904742 | regulation of telomeric DNA binding(GO:1904742) |
0.0 | 0.0 | GO:0003257 | positive regulation of transcription from RNA polymerase II promoter involved in myocardial precursor cell differentiation(GO:0003257) |
0.0 | 0.7 | GO:0034605 | cellular response to heat(GO:0034605) |
0.0 | 0.1 | GO:0035826 | rubidium ion transport(GO:0035826) |
0.0 | 0.1 | GO:2000271 | positive regulation of fibroblast apoptotic process(GO:2000271) |
0.0 | 0.1 | GO:0042414 | epinephrine metabolic process(GO:0042414) |
0.0 | 0.1 | GO:0006551 | leucine metabolic process(GO:0006551) |
0.0 | 0.2 | GO:0052697 | xenobiotic glucuronidation(GO:0052697) |
0.0 | 0.0 | GO:0010446 | response to alkaline pH(GO:0010446) |
0.0 | 0.1 | GO:0008078 | mesodermal cell migration(GO:0008078) |
0.0 | 0.1 | GO:1903441 | protein localization to ciliary membrane(GO:1903441) |
0.0 | 0.0 | GO:0060676 | ureteric bud formation(GO:0060676) |
0.0 | 0.2 | GO:0008105 | asymmetric protein localization(GO:0008105) |
0.0 | 0.1 | GO:0031937 | positive regulation of chromatin silencing(GO:0031937) |
0.0 | 0.3 | GO:0006957 | complement activation, alternative pathway(GO:0006957) |
0.0 | 0.0 | GO:0032661 | regulation of interleukin-18 production(GO:0032661) |
0.0 | 0.1 | GO:0060278 | regulation of ovulation(GO:0060278) |
0.0 | 1.2 | GO:0006836 | neurotransmitter transport(GO:0006836) |
0.0 | 0.3 | GO:0009312 | oligosaccharide biosynthetic process(GO:0009312) |
0.0 | 0.1 | GO:0098868 | bone growth(GO:0098868) |
0.0 | 0.1 | GO:0043985 | histone H4-R3 methylation(GO:0043985) |
0.0 | 0.1 | GO:0002017 | regulation of blood volume by renal aldosterone(GO:0002017) |
0.0 | 0.1 | GO:0000710 | meiotic mismatch repair(GO:0000710) |
0.0 | 0.1 | GO:0007096 | regulation of exit from mitosis(GO:0007096) |
0.0 | 0.1 | GO:0048266 | behavioral response to pain(GO:0048266) |
0.0 | 0.0 | GO:1900106 | hyaluranon cable assembly(GO:0036118) regulation of hyaluranon cable assembly(GO:1900104) positive regulation of hyaluranon cable assembly(GO:1900106) |
0.0 | 0.0 | GO:2000286 | receptor internalization involved in canonical Wnt signaling pathway(GO:2000286) |
0.0 | 0.2 | GO:0006108 | malate metabolic process(GO:0006108) |
0.0 | 0.1 | GO:2001204 | regulation of osteoclast development(GO:2001204) |
0.0 | 0.2 | GO:0042989 | sequestering of actin monomers(GO:0042989) |
0.0 | 0.0 | GO:0001998 | angiotensin mediated vasoconstriction involved in regulation of systemic arterial blood pressure(GO:0001998) |
0.0 | 0.1 | GO:1902410 | mitotic cytokinetic process(GO:1902410) |
0.0 | 0.0 | GO:0003105 | negative regulation of glomerular filtration(GO:0003105) |
0.0 | 0.0 | GO:2000318 | positive regulation of T-helper 17 type immune response(GO:2000318) |
0.0 | 0.1 | GO:0002839 | positive regulation of response to tumor cell(GO:0002836) positive regulation of immune response to tumor cell(GO:0002839) |
0.0 | 0.6 | GO:0007193 | adenylate cyclase-inhibiting G-protein coupled receptor signaling pathway(GO:0007193) |
0.0 | 0.3 | GO:0048026 | positive regulation of mRNA splicing, via spliceosome(GO:0048026) |
0.0 | 0.1 | GO:0043586 | tongue development(GO:0043586) |
0.0 | 0.1 | GO:0002430 | complement receptor mediated signaling pathway(GO:0002430) |
0.0 | 0.1 | GO:0060332 | positive regulation of response to interferon-gamma(GO:0060332) positive regulation of interferon-gamma-mediated signaling pathway(GO:0060335) |
0.0 | 0.1 | GO:0070126 | mitochondrial translational termination(GO:0070126) |
0.0 | 0.0 | GO:0021554 | optic nerve development(GO:0021554) |
0.0 | 0.0 | GO:0048265 | response to pain(GO:0048265) |
0.0 | 0.4 | GO:0008542 | visual learning(GO:0008542) |
0.0 | 1.3 | GO:0007626 | locomotory behavior(GO:0007626) |
0.0 | 0.0 | GO:0002370 | natural killer cell cytokine production(GO:0002370) regulation of natural killer cell cytokine production(GO:0002727) |
0.0 | 0.0 | GO:0034755 | iron ion transmembrane transport(GO:0034755) |
0.0 | 0.1 | GO:0042790 | transcription of nuclear large rRNA transcript from RNA polymerase I promoter(GO:0042790) |
0.0 | 0.0 | GO:0046121 | deoxyribonucleoside catabolic process(GO:0046121) |
0.0 | 0.0 | GO:0035754 | B cell chemotaxis(GO:0035754) |
0.0 | 0.0 | GO:0052405 | negative regulation by host of symbiont molecular function(GO:0052405) modification by host of symbiont molecular function(GO:0052428) |
0.0 | 0.0 | GO:0009629 | response to gravity(GO:0009629) |
0.0 | 0.0 | GO:0006975 | DNA damage induced protein phosphorylation(GO:0006975) |
0.0 | 0.1 | GO:0071816 | protein insertion into ER membrane(GO:0045048) tail-anchored membrane protein insertion into ER membrane(GO:0071816) |
0.0 | 0.0 | GO:1903208 | neuron death in response to hydrogen peroxide(GO:0036476) regulation of hydrogen peroxide-induced neuron death(GO:1903207) negative regulation of hydrogen peroxide-induced neuron death(GO:1903208) |
0.0 | 0.2 | GO:0001553 | luteinization(GO:0001553) |
0.0 | 0.1 | GO:0018158 | protein oxidation(GO:0018158) |
0.0 | 0.0 | GO:0070681 | glutaminyl-tRNAGln biosynthesis via transamidation(GO:0070681) |
0.0 | 0.1 | GO:0006742 | NADP catabolic process(GO:0006742) |
0.0 | 0.1 | GO:0070125 | mitochondrial translational elongation(GO:0070125) |
0.0 | 0.1 | GO:0006772 | thiamine metabolic process(GO:0006772) thiamine-containing compound metabolic process(GO:0042723) |
0.0 | 0.1 | GO:0006983 | ER overload response(GO:0006983) |
0.0 | 0.0 | GO:0043312 | neutrophil degranulation(GO:0043312) |
0.0 | 0.1 | GO:0097283 | keratinocyte apoptotic process(GO:0097283) regulation of keratinocyte apoptotic process(GO:1902172) |
0.0 | 0.0 | GO:0014901 | regulation of satellite cell activation involved in skeletal muscle regeneration(GO:0014717) satellite cell activation involved in skeletal muscle regeneration(GO:0014901) |
0.0 | 0.0 | GO:0010881 | regulation of cardiac muscle contraction by regulation of the release of sequestered calcium ion(GO:0010881) |
0.0 | 0.1 | GO:0070173 | regulation of enamel mineralization(GO:0070173) |
0.0 | 0.1 | GO:0033234 | negative regulation of protein sumoylation(GO:0033234) |
0.0 | 0.0 | GO:0050862 | positive regulation of T cell receptor signaling pathway(GO:0050862) |
0.0 | 0.1 | GO:0018343 | protein farnesylation(GO:0018343) |
0.0 | 0.0 | GO:0090240 | positive regulation of histone H4 acetylation(GO:0090240) |
0.0 | 0.1 | GO:0007341 | penetration of zona pellucida(GO:0007341) |
0.0 | 0.1 | GO:0036123 | histone H3-K9 dimethylation(GO:0036123) |
0.0 | 0.1 | GO:0009186 | deoxyribonucleoside diphosphate metabolic process(GO:0009186) |
0.0 | 0.0 | GO:1901491 | negative regulation of lymphangiogenesis(GO:1901491) |
0.0 | 0.0 | GO:0035880 | embryonic nail plate morphogenesis(GO:0035880) |
0.0 | 0.1 | GO:1902231 | positive regulation of intrinsic apoptotic signaling pathway in response to DNA damage(GO:1902231) |
0.0 | 0.0 | GO:0001992 | regulation of systemic arterial blood pressure by vasopressin(GO:0001992) |
0.0 | 0.1 | GO:1902031 | regulation of NADP metabolic process(GO:1902031) |
0.0 | 0.0 | GO:0045423 | granulocyte macrophage colony-stimulating factor biosynthetic process(GO:0042253) regulation of granulocyte macrophage colony-stimulating factor biosynthetic process(GO:0045423) |
0.0 | 0.0 | GO:0038044 | transforming growth factor-beta secretion(GO:0038044) regulation of transforming growth factor-beta secretion(GO:2001201) |
0.0 | 0.2 | GO:0009268 | response to pH(GO:0009268) |
0.0 | 0.0 | GO:1990168 | protein K29-linked deubiquitination(GO:0035523) protein K33-linked deubiquitination(GO:1990168) |
0.0 | 0.0 | GO:2000053 | regulation of Wnt signaling pathway involved in dorsal/ventral axis specification(GO:2000053) |
0.0 | 0.0 | GO:0006054 | N-acetylneuraminate metabolic process(GO:0006054) |
0.0 | 0.0 | GO:0016115 | terpenoid catabolic process(GO:0016115) |
0.0 | 0.1 | GO:0018095 | protein polyglutamylation(GO:0018095) |
0.0 | 0.0 | GO:2001270 | regulation of cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:2001270) negative regulation of cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:2001271) |
0.0 | 0.5 | GO:0008277 | regulation of G-protein coupled receptor protein signaling pathway(GO:0008277) |
0.0 | 0.1 | GO:0002934 | desmosome organization(GO:0002934) |
0.0 | 0.0 | GO:1903772 | regulation of viral budding via host ESCRT complex(GO:1903772) |
0.0 | 0.0 | GO:0030422 | production of siRNA involved in RNA interference(GO:0030422) |
0.0 | 0.0 | GO:0010359 | regulation of anion channel activity(GO:0010359) |
0.0 | 0.0 | GO:2000259 | positive regulation of complement activation(GO:0045917) positive regulation of protein activation cascade(GO:2000259) |
0.0 | 0.0 | GO:0035743 | CD4-positive, alpha-beta T cell cytokine production(GO:0035743) |
0.0 | 0.0 | GO:0070934 | CRD-mediated mRNA stabilization(GO:0070934) |
0.0 | 0.2 | GO:0034587 | piRNA metabolic process(GO:0034587) |
0.0 | 0.0 | GO:0045409 | negative regulation of interleukin-6 biosynthetic process(GO:0045409) |
0.0 | 0.0 | GO:0010764 | negative regulation of fibroblast migration(GO:0010764) |
0.0 | 0.0 | GO:0002677 | negative regulation of chronic inflammatory response(GO:0002677) |
0.0 | 0.0 | GO:0051901 | positive regulation of mitochondrial depolarization(GO:0051901) |
0.0 | 0.0 | GO:0002752 | cell surface pattern recognition receptor signaling pathway(GO:0002752) |
0.0 | 0.0 | GO:0007042 | lysosomal lumen acidification(GO:0007042) |
0.0 | 0.0 | GO:0044314 | protein K27-linked ubiquitination(GO:0044314) |
0.0 | 0.0 | GO:0090238 | positive regulation of arachidonic acid secretion(GO:0090238) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.8 | 2.4 | GO:0097648 | G-protein coupled receptor dimeric complex(GO:0038037) G-protein coupled receptor complex(GO:0097648) |
0.6 | 4.5 | GO:0098563 | integral component of synaptic vesicle membrane(GO:0030285) intrinsic component of synaptic vesicle membrane(GO:0098563) |
0.6 | 2.5 | GO:0044308 | axonal spine(GO:0044308) |
0.6 | 6.8 | GO:0017146 | NMDA selective glutamate receptor complex(GO:0017146) |
0.5 | 1.6 | GO:0005594 | collagen type IX trimer(GO:0005594) |
0.5 | 2.1 | GO:0097425 | smooth endoplasmic reticulum membrane(GO:0030868) smooth endoplasmic reticulum part(GO:0097425) |
0.5 | 4.9 | GO:0044224 | juxtaparanode region of axon(GO:0044224) |
0.5 | 1.4 | GO:1990812 | growth cone filopodium(GO:1990812) |
0.4 | 1.3 | GO:0097454 | Schwann cell microvillus(GO:0097454) |
0.4 | 1.6 | GO:0042583 | chromaffin granule(GO:0042583) |
0.4 | 1.2 | GO:0070110 | ciliary neurotrophic factor receptor complex(GO:0070110) |
0.4 | 1.5 | GO:0044326 | dendritic spine neck(GO:0044326) |
0.4 | 4.2 | GO:0001518 | voltage-gated sodium channel complex(GO:0001518) |
0.3 | 3.1 | GO:0005859 | muscle myosin complex(GO:0005859) |
0.3 | 1.0 | GO:0097427 | microtubule bundle(GO:0097427) |
0.3 | 0.3 | GO:0032983 | kainate selective glutamate receptor complex(GO:0032983) |
0.3 | 1.0 | GO:0000015 | phosphopyruvate hydratase complex(GO:0000015) |
0.3 | 0.3 | GO:0032279 | asymmetric synapse(GO:0032279) |
0.3 | 2.6 | GO:0005861 | troponin complex(GO:0005861) |
0.3 | 1.6 | GO:0048787 | presynaptic active zone membrane(GO:0048787) |
0.3 | 0.9 | GO:0014701 | junctional sarcoplasmic reticulum membrane(GO:0014701) |
0.3 | 0.6 | GO:0014731 | spectrin-associated cytoskeleton(GO:0014731) |
0.3 | 10.3 | GO:0005891 | voltage-gated calcium channel complex(GO:0005891) |
0.3 | 14.0 | GO:0042734 | presynaptic membrane(GO:0042734) |
0.3 | 5.1 | GO:0048786 | presynaptic active zone(GO:0048786) |
0.3 | 1.8 | GO:0030314 | junctional membrane complex(GO:0030314) |
0.3 | 0.9 | GO:0005899 | insulin receptor complex(GO:0005899) |
0.3 | 0.9 | GO:0045251 | mitochondrial electron transfer flavoprotein complex(GO:0017133) electron transfer flavoprotein complex(GO:0045251) |
0.3 | 0.8 | GO:0072534 | perineuronal net(GO:0072534) |
0.3 | 0.3 | GO:0070032 | synaptobrevin 2-SNAP-25-syntaxin-1a-complexin I complex(GO:0070032) |
0.3 | 1.3 | GO:0008091 | spectrin(GO:0008091) |
0.3 | 2.3 | GO:0030673 | axolemma(GO:0030673) |
0.2 | 5.9 | GO:0098878 | ionotropic glutamate receptor complex(GO:0008328) neurotransmitter receptor complex(GO:0098878) |
0.2 | 0.9 | GO:0097651 | phosphatidylinositol 3-kinase complex, class I(GO:0097651) |
0.2 | 0.9 | GO:0036454 | insulin-like growth factor binding protein complex(GO:0016942) growth factor complex(GO:0036454) insulin-like growth factor ternary complex(GO:0042567) |
0.2 | 0.9 | GO:0000931 | gamma-tubulin large complex(GO:0000931) gamma-tubulin ring complex(GO:0008274) |
0.2 | 2.0 | GO:0035253 | ciliary rootlet(GO:0035253) |
0.2 | 12.9 | GO:0008076 | voltage-gated potassium channel complex(GO:0008076) |
0.2 | 0.6 | GO:0016533 | cyclin-dependent protein kinase 5 holoenzyme complex(GO:0016533) |
0.2 | 1.5 | GO:0032584 | growth cone membrane(GO:0032584) |
0.2 | 0.6 | GO:0005853 | eukaryotic translation elongation factor 1 complex(GO:0005853) |
0.2 | 5.0 | GO:0099501 | synaptic vesicle membrane(GO:0030672) exocytic vesicle membrane(GO:0099501) |
0.2 | 0.6 | GO:0032010 | phagolysosome(GO:0032010) |
0.2 | 1.0 | GO:0043083 | synaptic cleft(GO:0043083) |
0.2 | 0.8 | GO:0043194 | axon initial segment(GO:0043194) |
0.2 | 0.4 | GO:0097441 | basilar dendrite(GO:0097441) |
0.2 | 0.2 | GO:0035985 | senescence-associated heterochromatin focus(GO:0035985) |
0.2 | 1.6 | GO:0000813 | ESCRT I complex(GO:0000813) |
0.2 | 0.7 | GO:0032591 | dendritic spine membrane(GO:0032591) |
0.2 | 2.2 | GO:0030877 | beta-catenin destruction complex(GO:0030877) |
0.2 | 2.0 | GO:0098643 | fibrillar collagen trimer(GO:0005583) banded collagen fibril(GO:0098643) |
0.2 | 1.9 | GO:0031045 | dense core granule(GO:0031045) |
0.2 | 0.5 | GO:0000322 | storage vacuole(GO:0000322) |
0.2 | 1.0 | GO:0016012 | sarcoglycan complex(GO:0016012) |
0.2 | 0.7 | GO:0000408 | EKC/KEOPS complex(GO:0000408) |
0.2 | 2.6 | GO:1902710 | GABA receptor complex(GO:1902710) GABA-A receptor complex(GO:1902711) |
0.2 | 1.2 | GO:0005883 | neurofilament(GO:0005883) |
0.1 | 1.6 | GO:0042555 | MCM complex(GO:0042555) |
0.1 | 0.6 | GO:0044322 | endoplasmic reticulum quality control compartment(GO:0044322) |
0.1 | 0.4 | GO:0032280 | symmetric synapse(GO:0032280) |
0.1 | 1.5 | GO:0032839 | dendrite cytoplasm(GO:0032839) |
0.1 | 0.9 | GO:0072687 | meiotic spindle(GO:0072687) |
0.1 | 2.0 | GO:0032589 | neuron projection membrane(GO:0032589) |
0.1 | 0.9 | GO:0036057 | filtration diaphragm(GO:0036056) slit diaphragm(GO:0036057) |
0.1 | 0.1 | GO:0031523 | Myb complex(GO:0031523) |
0.1 | 0.5 | GO:0071598 | neuronal ribonucleoprotein granule(GO:0071598) |
0.1 | 0.5 | GO:0017071 | intracellular cyclic nucleotide activated cation channel complex(GO:0017071) |
0.1 | 2.9 | GO:0043198 | dendritic shaft(GO:0043198) |
0.1 | 0.6 | GO:0042629 | mast cell granule(GO:0042629) |
0.1 | 1.3 | GO:0030061 | mitochondrial crista(GO:0030061) |
0.1 | 0.6 | GO:0002139 | stereocilia coupling link(GO:0002139) |
0.1 | 0.1 | GO:0097512 | cardiac myofibril(GO:0097512) |
0.1 | 0.5 | GO:0031313 | extrinsic component of endosome membrane(GO:0031313) |
0.1 | 0.3 | GO:0045098 | type III intermediate filament(GO:0045098) |
0.1 | 15.7 | GO:0045211 | postsynaptic membrane(GO:0045211) |
0.1 | 0.9 | GO:0042788 | polysomal ribosome(GO:0042788) |
0.1 | 3.6 | GO:0005834 | heterotrimeric G-protein complex(GO:0005834) |
0.1 | 0.4 | GO:1990131 | EGO complex(GO:0034448) Gtr1-Gtr2 GTPase complex(GO:1990131) |
0.1 | 0.7 | GO:0005786 | signal recognition particle, endoplasmic reticulum targeting(GO:0005786) signal recognition particle(GO:0048500) |
0.1 | 0.3 | GO:0005971 | ribonucleoside-diphosphate reductase complex(GO:0005971) |
0.1 | 1.0 | GO:0060091 | kinocilium(GO:0060091) |
0.1 | 0.2 | GO:0031618 | nuclear pericentric heterochromatin(GO:0031618) |
0.1 | 0.3 | GO:0035749 | myelin sheath adaxonal region(GO:0035749) |
0.1 | 0.6 | GO:0008290 | F-actin capping protein complex(GO:0008290) |
0.1 | 0.8 | GO:0036156 | inner dynein arm(GO:0036156) |
0.1 | 0.5 | GO:0071204 | histone pre-mRNA 3'end processing complex(GO:0071204) |
0.1 | 0.3 | GO:1990130 | Iml1 complex(GO:1990130) |
0.1 | 0.3 | GO:0044300 | cerebellar mossy fiber(GO:0044300) |
0.1 | 0.3 | GO:0031466 | Cul5-RING ubiquitin ligase complex(GO:0031466) |
0.1 | 0.8 | GO:0005641 | nuclear envelope lumen(GO:0005641) |
0.1 | 0.3 | GO:1990075 | periciliary membrane compartment(GO:1990075) |
0.1 | 0.2 | GO:0043511 | inhibin complex(GO:0043511) |
0.1 | 0.5 | GO:0030008 | TRAPP complex(GO:0030008) |
0.1 | 0.4 | GO:0046696 | lipopolysaccharide receptor complex(GO:0046696) |
0.1 | 0.6 | GO:0000137 | Golgi cis cisterna(GO:0000137) |
0.1 | 0.7 | GO:0032809 | neuronal cell body membrane(GO:0032809) |
0.1 | 0.8 | GO:0000346 | transcription export complex(GO:0000346) |
0.1 | 0.5 | GO:0071556 | integral component of cytoplasmic side of endoplasmic reticulum membrane(GO:0071458) integral component of lumenal side of endoplasmic reticulum membrane(GO:0071556) lumenal side of endoplasmic reticulum membrane(GO:0098553) |
0.1 | 0.5 | GO:0000798 | nuclear cohesin complex(GO:0000798) |
0.1 | 0.9 | GO:0000159 | protein phosphatase type 2A complex(GO:0000159) |
0.1 | 0.5 | GO:0001520 | outer dense fiber(GO:0001520) |
0.1 | 0.4 | GO:0035748 | myelin sheath abaxonal region(GO:0035748) |
0.1 | 0.9 | GO:0034704 | calcium channel complex(GO:0034704) |
0.1 | 0.4 | GO:0005915 | zonula adherens(GO:0005915) |
0.1 | 0.9 | GO:0000145 | exocyst(GO:0000145) |
0.1 | 1.1 | GO:0005614 | interstitial matrix(GO:0005614) |
0.1 | 0.2 | GO:0030121 | AP-1 adaptor complex(GO:0030121) |
0.1 | 0.2 | GO:0032937 | SREBP-SCAP-Insig complex(GO:0032937) |
0.1 | 0.6 | GO:0005687 | U4 snRNP(GO:0005687) |
0.1 | 0.2 | GO:0045298 | tubulin complex(GO:0045298) |
0.1 | 0.3 | GO:0070695 | FHF complex(GO:0070695) |
0.1 | 0.2 | GO:0030981 | cortical microtubule cytoskeleton(GO:0030981) |
0.1 | 0.2 | GO:0071942 | XPC complex(GO:0071942) |
0.1 | 3.7 | GO:0043195 | terminal bouton(GO:0043195) |
0.1 | 6.6 | GO:0098794 | postsynapse(GO:0098794) |
0.1 | 2.0 | GO:0030315 | T-tubule(GO:0030315) |
0.1 | 0.4 | GO:0097197 | tetraspanin-enriched microdomain(GO:0097197) |
0.1 | 3.7 | GO:0098793 | presynapse(GO:0098793) |
0.1 | 0.5 | GO:0000124 | SAGA complex(GO:0000124) |
0.1 | 8.1 | GO:0031225 | anchored component of membrane(GO:0031225) |
0.1 | 0.2 | GO:0032133 | chromosome passenger complex(GO:0032133) |
0.1 | 0.3 | GO:0035032 | phosphatidylinositol 3-kinase complex, class III(GO:0035032) |
0.1 | 0.3 | GO:0000805 | X chromosome(GO:0000805) |
0.1 | 3.4 | GO:0031463 | Cul3-RING ubiquitin ligase complex(GO:0031463) |
0.1 | 0.7 | GO:0032580 | Golgi cisterna membrane(GO:0032580) |
0.1 | 0.2 | GO:0070545 | PeBoW complex(GO:0070545) |
0.1 | 0.3 | GO:0071547 | piP-body(GO:0071547) |
0.1 | 0.4 | GO:0070419 | nonhomologous end joining complex(GO:0070419) |
0.1 | 0.6 | GO:0000930 | gamma-tubulin complex(GO:0000930) |
0.1 | 0.3 | GO:0048188 | Set1C/COMPASS complex(GO:0048188) |
0.0 | 0.4 | GO:0032433 | filopodium tip(GO:0032433) |
0.0 | 0.6 | GO:0010369 | chromocenter(GO:0010369) |
0.0 | 1.9 | GO:0005871 | kinesin complex(GO:0005871) |
0.0 | 0.1 | GO:0090498 | extrinsic component of Golgi membrane(GO:0090498) |
0.0 | 0.2 | GO:0070761 | pre-snoRNP complex(GO:0070761) |
0.0 | 0.1 | GO:1990909 | Wnt signalosome(GO:1990909) |
0.0 | 0.4 | GO:0097539 | ciliary transition fiber(GO:0097539) |
0.0 | 1.9 | GO:0019005 | SCF ubiquitin ligase complex(GO:0019005) |
0.0 | 0.1 | GO:0033186 | CAF-1 complex(GO:0033186) |
0.0 | 0.5 | GO:0033017 | sarcoplasmic reticulum membrane(GO:0033017) |
0.0 | 0.1 | GO:0044292 | dendrite terminus(GO:0044292) |
0.0 | 0.2 | GO:0005579 | membrane attack complex(GO:0005579) |
0.0 | 0.1 | GO:0031428 | box C/D snoRNP complex(GO:0031428) |
0.0 | 0.2 | GO:0001739 | sex chromatin(GO:0001739) |
0.0 | 0.2 | GO:0044530 | supraspliceosomal complex(GO:0044530) |
0.0 | 0.2 | GO:0032585 | multivesicular body membrane(GO:0032585) |
0.0 | 0.2 | GO:1990716 | axonemal central apparatus(GO:1990716) |
0.0 | 0.2 | GO:0001652 | granular component(GO:0001652) |
0.0 | 0.4 | GO:0005686 | U2 snRNP(GO:0005686) |
0.0 | 0.3 | GO:0005832 | chaperonin-containing T-complex(GO:0005832) |
0.0 | 0.3 | GO:0005833 | hemoglobin complex(GO:0005833) |
0.0 | 0.1 | GO:0030478 | actin cap(GO:0030478) |
0.0 | 0.1 | GO:0071008 | U2-type post-mRNA release spliceosomal complex(GO:0071008) |
0.0 | 0.3 | GO:0097431 | mitotic spindle pole(GO:0097431) |
0.0 | 5.6 | GO:0045202 | synapse(GO:0045202) |
0.0 | 0.3 | GO:0044666 | MLL3/4 complex(GO:0044666) |
0.0 | 1.1 | GO:0005844 | polysome(GO:0005844) |
0.0 | 0.0 | GO:0097504 | Gemini of coiled bodies(GO:0097504) |
0.0 | 0.2 | GO:0044613 | nuclear pore central transport channel(GO:0044613) |
0.0 | 0.4 | GO:0071564 | npBAF complex(GO:0071564) |
0.0 | 0.3 | GO:0044295 | axonal growth cone(GO:0044295) |
0.0 | 0.1 | GO:0000235 | astral microtubule(GO:0000235) |
0.0 | 0.8 | GO:0005921 | gap junction(GO:0005921) |
0.0 | 0.2 | GO:0060293 | P granule(GO:0043186) pole plasm(GO:0045495) germ plasm(GO:0060293) |
0.0 | 0.1 | GO:0055087 | Ski complex(GO:0055087) |
0.0 | 0.1 | GO:0098536 | deuterosome(GO:0098536) |
0.0 | 0.1 | GO:0097209 | epidermal lamellar body(GO:0097209) |
0.0 | 0.2 | GO:0000506 | glycosylphosphatidylinositol-N-acetylglucosaminyltransferase (GPI-GnT) complex(GO:0000506) |
0.0 | 0.2 | GO:0005869 | dynactin complex(GO:0005869) |
0.0 | 0.1 | GO:0071439 | clathrin complex(GO:0071439) |
0.0 | 1.1 | GO:0043204 | perikaryon(GO:0043204) |
0.0 | 0.1 | GO:0030127 | COPII vesicle coat(GO:0030127) |
0.0 | 0.0 | GO:0032437 | cuticular plate(GO:0032437) |
0.0 | 0.2 | GO:0031597 | cytosolic proteasome complex(GO:0031597) |
0.0 | 0.1 | GO:0071818 | BAT3 complex(GO:0071818) ER membrane insertion complex(GO:0072379) |
0.0 | 0.2 | GO:0030991 | intraciliary transport particle A(GO:0030991) |
0.0 | 0.3 | GO:0016581 | NuRD complex(GO:0016581) CHD-type complex(GO:0090545) |
0.0 | 0.1 | GO:0089717 | spanning component of plasma membrane(GO:0044214) spanning component of membrane(GO:0089717) |
0.0 | 1.8 | GO:0035068 | micro-ribonucleoprotein complex(GO:0035068) |
0.0 | 0.0 | GO:0030893 | meiotic cohesin complex(GO:0030893) |
0.0 | 0.1 | GO:0031314 | extrinsic component of mitochondrial inner membrane(GO:0031314) |
0.0 | 0.1 | GO:0030689 | Noc complex(GO:0030689) |
0.0 | 0.2 | GO:0032588 | trans-Golgi network membrane(GO:0032588) |
0.0 | 0.1 | GO:0035371 | microtubule plus-end(GO:0035371) |
0.0 | 0.1 | GO:0008250 | oligosaccharyltransferase complex(GO:0008250) |
0.0 | 0.0 | GO:0005955 | calcineurin complex(GO:0005955) |
0.0 | 0.1 | GO:0005845 | mRNA cap binding complex(GO:0005845) RNA cap binding complex(GO:0034518) |
0.0 | 0.2 | GO:0035686 | sperm fibrous sheath(GO:0035686) |
0.0 | 0.3 | GO:0031306 | intrinsic component of mitochondrial outer membrane(GO:0031306) |
0.0 | 0.0 | GO:0005606 | laminin-1 complex(GO:0005606) |
0.0 | 0.0 | GO:0012507 | ER to Golgi transport vesicle membrane(GO:0012507) |
0.0 | 0.3 | GO:0070069 | cytochrome complex(GO:0070069) |
0.0 | 0.1 | GO:0005577 | fibrinogen complex(GO:0005577) |
0.0 | 0.1 | GO:0033588 | Elongator holoenzyme complex(GO:0033588) |
0.0 | 0.1 | GO:0032045 | guanyl-nucleotide exchange factor complex(GO:0032045) |
0.0 | 0.0 | GO:0070876 | SOSS complex(GO:0070876) |
0.0 | 0.0 | GO:1990851 | Wnt-Frizzled-LRP5/6 complex(GO:1990851) |
0.0 | 0.6 | GO:0005581 | collagen trimer(GO:0005581) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
1.3 | 3.8 | GO:0030160 | GKAP/Homer scaffold activity(GO:0030160) |
0.7 | 3.6 | GO:0003828 | alpha-N-acetylneuraminate alpha-2,8-sialyltransferase activity(GO:0003828) |
0.7 | 5.2 | GO:0004972 | NMDA glutamate receptor activity(GO:0004972) |
0.6 | 1.9 | GO:0008332 | low voltage-gated calcium channel activity(GO:0008332) |
0.6 | 1.9 | GO:0015137 | citrate transmembrane transporter activity(GO:0015137) tricarboxylic acid transmembrane transporter activity(GO:0015142) |
0.6 | 1.8 | GO:0015018 | galactosylgalactosylxylosylprotein 3-beta-glucuronosyltransferase activity(GO:0015018) |
0.6 | 3.0 | GO:0044323 | retinoic acid-responsive element binding(GO:0044323) |
0.6 | 2.9 | GO:0086080 | protein binding involved in heterotypic cell-cell adhesion(GO:0086080) |
0.6 | 2.3 | GO:0004971 | AMPA glutamate receptor activity(GO:0004971) |
0.6 | 2.8 | GO:0015185 | gamma-aminobutyric acid transmembrane transporter activity(GO:0015185) |
0.6 | 1.7 | GO:0005519 | cytoskeletal regulatory protein binding(GO:0005519) |
0.6 | 1.7 | GO:0004965 | G-protein coupled GABA receptor activity(GO:0004965) |
0.5 | 1.1 | GO:0086056 | voltage-gated calcium channel activity involved in AV node cell action potential(GO:0086056) |
0.5 | 2.1 | GO:0031014 | troponin T binding(GO:0031014) |
0.5 | 0.5 | GO:0072345 | NAADP-sensitive calcium-release channel activity(GO:0072345) |
0.5 | 4.7 | GO:0098988 | G-protein coupled glutamate receptor activity(GO:0098988) |
0.5 | 1.5 | GO:0034040 | lipid-transporting ATPase activity(GO:0034040) |
0.5 | 1.5 | GO:0008503 | benzodiazepine receptor activity(GO:0008503) |
0.5 | 1.0 | GO:0031697 | beta-1 adrenergic receptor binding(GO:0031697) |
0.5 | 1.4 | GO:0048101 | calcium- and calmodulin-regulated 3',5'-cyclic-GMP phosphodiesterase activity(GO:0048101) |
0.5 | 1.4 | GO:0097109 | neuroligin family protein binding(GO:0097109) |
0.5 | 1.4 | GO:0030899 | calcium-dependent ATPase activity(GO:0030899) |
0.5 | 2.3 | GO:0086006 | voltage-gated sodium channel activity involved in cardiac muscle cell action potential(GO:0086006) |
0.4 | 2.2 | GO:0008294 | calcium- and calmodulin-responsive adenylate cyclase activity(GO:0008294) |
0.4 | 3.8 | GO:0008331 | high voltage-gated calcium channel activity(GO:0008331) |
0.4 | 2.4 | GO:0004970 | ionotropic glutamate receptor activity(GO:0004970) |
0.4 | 1.1 | GO:0005176 | ErbB-2 class receptor binding(GO:0005176) |
0.4 | 1.9 | GO:0005432 | calcium:sodium antiporter activity(GO:0005432) |
0.4 | 1.5 | GO:0015368 | calcium:cation antiporter activity(GO:0015368) |
0.4 | 1.8 | GO:0005005 | transmembrane-ephrin receptor activity(GO:0005005) |
0.4 | 1.4 | GO:0042731 | PH domain binding(GO:0042731) |
0.4 | 1.4 | GO:0032051 | clathrin light chain binding(GO:0032051) |
0.3 | 2.0 | GO:0004385 | guanylate kinase activity(GO:0004385) |
0.3 | 1.0 | GO:0070996 | type 1 melanocortin receptor binding(GO:0070996) |
0.3 | 1.0 | GO:0000155 | phosphorelay sensor kinase activity(GO:0000155) |
0.3 | 0.7 | GO:0048763 | calcium-induced calcium release activity(GO:0048763) |
0.3 | 2.2 | GO:0019992 | diacylglycerol binding(GO:0019992) |
0.3 | 0.9 | GO:0008449 | N-acetylglucosamine-6-sulfatase activity(GO:0008449) |
0.3 | 1.2 | GO:0004897 | ciliary neurotrophic factor receptor activity(GO:0004897) |
0.3 | 3.9 | GO:0008601 | protein phosphatase type 2A regulator activity(GO:0008601) |
0.3 | 0.3 | GO:0047391 | alkylglycerophosphoethanolamine phosphodiesterase activity(GO:0047391) |
0.3 | 0.9 | GO:0004741 | [pyruvate dehydrogenase (lipoamide)] phosphatase activity(GO:0004741) |
0.3 | 0.8 | GO:0004351 | glutamate decarboxylase activity(GO:0004351) |
0.3 | 8.9 | GO:0005251 | delayed rectifier potassium channel activity(GO:0005251) |
0.3 | 1.1 | GO:0016286 | small conductance calcium-activated potassium channel activity(GO:0016286) |
0.3 | 1.9 | GO:0005283 | sodium:amino acid symporter activity(GO:0005283) |
0.3 | 1.3 | GO:0030550 | acetylcholine receptor inhibitor activity(GO:0030550) |
0.3 | 1.6 | GO:0048495 | Roundabout binding(GO:0048495) |
0.3 | 1.0 | GO:0015467 | G-protein activated inward rectifier potassium channel activity(GO:0015467) |
0.3 | 1.6 | GO:0032050 | clathrin heavy chain binding(GO:0032050) |
0.3 | 3.8 | GO:0005248 | voltage-gated sodium channel activity(GO:0005248) voltage-gated ion channel activity involved in regulation of postsynaptic membrane potential(GO:1905030) |
0.2 | 1.0 | GO:0035727 | lysophosphatidic acid binding(GO:0035727) |
0.2 | 3.2 | GO:0050811 | GABA receptor binding(GO:0050811) |
0.2 | 1.0 | GO:0071074 | eukaryotic initiation factor eIF2 binding(GO:0071074) |
0.2 | 1.7 | GO:0005167 | neurotrophin TRK receptor binding(GO:0005167) |
0.2 | 0.2 | GO:0032422 | purine-rich negative regulatory element binding(GO:0032422) |
0.2 | 0.5 | GO:0072542 | protein phosphatase activator activity(GO:0072542) |
0.2 | 0.5 | GO:0002046 | opsin binding(GO:0002046) |
0.2 | 0.9 | GO:0031694 | alpha-2A adrenergic receptor binding(GO:0031694) |
0.2 | 0.5 | GO:0043125 | ErbB-3 class receptor binding(GO:0043125) |
0.2 | 0.9 | GO:0005250 | A-type (transient outward) potassium channel activity(GO:0005250) |
0.2 | 0.9 | GO:0005042 | netrin receptor activity(GO:0005042) |
0.2 | 1.6 | GO:0031821 | G-protein coupled serotonin receptor binding(GO:0031821) |
0.2 | 1.6 | GO:0003680 | AT DNA binding(GO:0003680) |
0.2 | 0.7 | GO:0030297 | transmembrane receptor protein tyrosine kinase activator activity(GO:0030297) |
0.2 | 0.4 | GO:0004886 | 9-cis retinoic acid receptor activity(GO:0004886) |
0.2 | 1.3 | GO:0047184 | 1-acylglycerophosphocholine O-acyltransferase activity(GO:0047184) |
0.2 | 1.1 | GO:0046934 | phosphatidylinositol-4,5-bisphosphate 3-kinase activity(GO:0046934) |
0.2 | 0.4 | GO:0001032 | RNA polymerase III type 1 promoter DNA binding(GO:0001030) RNA polymerase III type 2 promoter DNA binding(GO:0001031) RNA polymerase III type 3 promoter DNA binding(GO:0001032) 5S rDNA binding(GO:0080084) |
0.2 | 0.4 | GO:0045503 | dynein light chain binding(GO:0045503) |
0.2 | 0.6 | GO:0019797 | procollagen-proline 3-dioxygenase activity(GO:0019797) |
0.2 | 1.4 | GO:0035242 | protein-arginine omega-N asymmetric methyltransferase activity(GO:0035242) |
0.2 | 0.6 | GO:0008475 | procollagen-lysine 5-dioxygenase activity(GO:0008475) |
0.2 | 0.8 | GO:0031433 | telethonin binding(GO:0031433) |
0.2 | 2.9 | GO:1990939 | ATP-dependent microtubule motor activity(GO:1990939) |
0.2 | 0.6 | GO:0042296 | ISG15 transferase activity(GO:0042296) |
0.2 | 0.7 | GO:0004849 | uridine kinase activity(GO:0004849) |
0.2 | 2.0 | GO:0005522 | profilin binding(GO:0005522) |
0.2 | 0.5 | GO:0051373 | FATZ binding(GO:0051373) |
0.2 | 1.3 | GO:0005237 | inhibitory extracellular ligand-gated ion channel activity(GO:0005237) |
0.2 | 5.3 | GO:0001540 | beta-amyloid binding(GO:0001540) |
0.2 | 0.5 | GO:0004427 | inorganic diphosphatase activity(GO:0004427) |
0.2 | 0.9 | GO:0048403 | brain-derived neurotrophic factor binding(GO:0048403) |
0.2 | 1.7 | GO:0042577 | lipid phosphatase activity(GO:0042577) |
0.2 | 0.5 | GO:0022824 | transmitter-gated ion channel activity(GO:0022824) transmitter-gated channel activity(GO:0022835) |
0.2 | 0.7 | GO:0008532 | N-acetyllactosaminide beta-1,3-N-acetylglucosaminyltransferase activity(GO:0008532) |
0.2 | 3.3 | GO:0005086 | ARF guanyl-nucleotide exchange factor activity(GO:0005086) |
0.2 | 0.6 | GO:1904288 | BAT3 complex binding(GO:1904288) |
0.2 | 5.3 | GO:0015459 | potassium channel regulator activity(GO:0015459) |
0.2 | 1.9 | GO:0005545 | 1-phosphatidylinositol binding(GO:0005545) |
0.2 | 0.9 | GO:0005225 | volume-sensitive anion channel activity(GO:0005225) |
0.2 | 4.1 | GO:0005245 | voltage-gated calcium channel activity(GO:0005245) |
0.2 | 1.2 | GO:0005068 | transmembrane receptor protein tyrosine kinase adaptor activity(GO:0005068) |
0.2 | 0.5 | GO:0016842 | amidine-lyase activity(GO:0016842) |
0.2 | 0.8 | GO:0008312 | 7S RNA binding(GO:0008312) |
0.2 | 0.6 | GO:0004035 | alkaline phosphatase activity(GO:0004035) |
0.1 | 0.7 | GO:0051959 | dynein light intermediate chain binding(GO:0051959) |
0.1 | 0.4 | GO:0008073 | ornithine decarboxylase inhibitor activity(GO:0008073) |
0.1 | 2.8 | GO:0030552 | cAMP binding(GO:0030552) |
0.1 | 3.4 | GO:0045499 | chemorepellent activity(GO:0045499) |
0.1 | 0.4 | GO:0008427 | calcium-dependent protein kinase inhibitor activity(GO:0008427) |
0.1 | 0.9 | GO:0005344 | oxygen transporter activity(GO:0005344) |
0.1 | 0.4 | GO:0008401 | retinoic acid 4-hydroxylase activity(GO:0008401) |
0.1 | 0.4 | GO:0004980 | melanocyte-stimulating hormone receptor activity(GO:0004980) |
0.1 | 0.3 | GO:0070538 | oleic acid binding(GO:0070538) |
0.1 | 0.7 | GO:0004634 | phosphopyruvate hydratase activity(GO:0004634) |
0.1 | 0.6 | GO:0004985 | opioid receptor activity(GO:0004985) |
0.1 | 0.1 | GO:0097200 | cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:0097200) |
0.1 | 0.7 | GO:0038085 | vascular endothelial growth factor binding(GO:0038085) |
0.1 | 0.7 | GO:0048273 | mitogen-activated protein kinase p38 binding(GO:0048273) |
0.1 | 0.4 | GO:0004937 | alpha1-adrenergic receptor activity(GO:0004937) |
0.1 | 2.6 | GO:0017075 | syntaxin-1 binding(GO:0017075) |
0.1 | 0.5 | GO:0035612 | AP-2 adaptor complex binding(GO:0035612) |
0.1 | 0.5 | GO:0005004 | GPI-linked ephrin receptor activity(GO:0005004) |
0.1 | 4.1 | GO:0004864 | protein phosphatase inhibitor activity(GO:0004864) |
0.1 | 0.1 | GO:0038191 | neuropilin binding(GO:0038191) |
0.1 | 1.2 | GO:0016920 | pyroglutamyl-peptidase activity(GO:0016920) |
0.1 | 3.5 | GO:0030507 | spectrin binding(GO:0030507) |
0.1 | 0.5 | GO:0004969 | histamine receptor activity(GO:0004969) |
0.1 | 0.1 | GO:0070815 | peptidyl-lysine 5-dioxygenase activity(GO:0070815) |
0.1 | 2.4 | GO:0005452 | inorganic anion exchanger activity(GO:0005452) |
0.1 | 1.4 | GO:0015643 | toxic substance binding(GO:0015643) |
0.1 | 1.9 | GO:0051428 | peptide hormone receptor binding(GO:0051428) |
0.1 | 0.4 | GO:0004995 | tachykinin receptor activity(GO:0004995) |
0.1 | 0.5 | GO:0005025 | transforming growth factor beta receptor activity, type I(GO:0005025) |
0.1 | 0.1 | GO:0030172 | troponin C binding(GO:0030172) |
0.1 | 0.5 | GO:0097001 | ceramide binding(GO:0097001) |
0.1 | 2.0 | GO:0042166 | acetylcholine binding(GO:0042166) |
0.1 | 1.0 | GO:0005328 | neurotransmitter:sodium symporter activity(GO:0005328) |
0.1 | 0.6 | GO:0048406 | nerve growth factor binding(GO:0048406) |
0.1 | 0.6 | GO:0008467 | [heparan sulfate]-glucosamine 3-sulfotransferase 1 activity(GO:0008467) |
0.1 | 0.2 | GO:0015205 | purine nucleobase transmembrane transporter activity(GO:0005345) pyrimidine nucleobase transmembrane transporter activity(GO:0005350) nucleobase transmembrane transporter activity(GO:0015205) |
0.1 | 0.9 | GO:0030955 | potassium ion binding(GO:0030955) |
0.1 | 2.6 | GO:0005104 | fibroblast growth factor receptor binding(GO:0005104) |
0.1 | 0.2 | GO:0016262 | protein N-acetylglucosaminyltransferase activity(GO:0016262) |
0.1 | 2.2 | GO:0003785 | actin monomer binding(GO:0003785) |
0.1 | 0.4 | GO:0015265 | urea channel activity(GO:0015265) |
0.1 | 0.3 | GO:0047756 | chondroitin 4-sulfotransferase activity(GO:0047756) |
0.1 | 0.2 | GO:0034481 | chondroitin sulfotransferase activity(GO:0034481) |
0.1 | 0.3 | GO:0005502 | 11-cis retinal binding(GO:0005502) |
0.1 | 1.3 | GO:0008191 | metalloendopeptidase inhibitor activity(GO:0008191) |
0.1 | 0.6 | GO:0051011 | microtubule minus-end binding(GO:0051011) |
0.1 | 0.7 | GO:0050291 | sphingosine N-acyltransferase activity(GO:0050291) |
0.1 | 0.3 | GO:0071209 | U7 snRNA binding(GO:0071209) |
0.1 | 0.6 | GO:0008035 | high-density lipoprotein particle binding(GO:0008035) |
0.1 | 0.8 | GO:0004445 | inositol-polyphosphate 5-phosphatase activity(GO:0004445) |
0.1 | 1.1 | GO:0048018 | receptor agonist activity(GO:0048018) |
0.1 | 0.3 | GO:0031802 | type 5 metabotropic glutamate receptor binding(GO:0031802) |
0.1 | 0.6 | GO:0031748 | D1 dopamine receptor binding(GO:0031748) |
0.1 | 2.2 | GO:0005540 | hyaluronic acid binding(GO:0005540) |
0.1 | 0.3 | GO:0016728 | ribonucleoside-diphosphate reductase activity, thioredoxin disulfide as acceptor(GO:0004748) oxidoreductase activity, acting on CH or CH2 groups, disulfide as acceptor(GO:0016728) ribonucleoside-diphosphate reductase activity(GO:0061731) |
0.1 | 4.0 | GO:0030276 | clathrin binding(GO:0030276) |
0.1 | 0.5 | GO:0019958 | C-X-C chemokine binding(GO:0019958) |
0.1 | 0.5 | GO:0001601 | peptide YY receptor activity(GO:0001601) |
0.1 | 3.7 | GO:0034483 | heparan sulfate sulfotransferase activity(GO:0034483) |
0.1 | 0.9 | GO:0001972 | retinoic acid binding(GO:0001972) |
0.1 | 1.2 | GO:0005092 | GDP-dissociation inhibitor activity(GO:0005092) |
0.1 | 0.6 | GO:0032036 | myosin heavy chain binding(GO:0032036) |
0.1 | 0.5 | GO:0015193 | L-proline transmembrane transporter activity(GO:0015193) |
0.1 | 1.3 | GO:0005242 | inward rectifier potassium channel activity(GO:0005242) |
0.1 | 0.6 | GO:0070991 | medium-chain-acyl-CoA dehydrogenase activity(GO:0070991) |
0.1 | 0.9 | GO:0005247 | voltage-gated chloride channel activity(GO:0005247) |
0.1 | 1.4 | GO:0004653 | polypeptide N-acetylgalactosaminyltransferase activity(GO:0004653) |
0.1 | 1.3 | GO:0030275 | LRR domain binding(GO:0030275) |
0.1 | 0.6 | GO:0031432 | titin binding(GO:0031432) |
0.1 | 0.2 | GO:0004065 | arylsulfatase activity(GO:0004065) |
0.1 | 0.3 | GO:0051575 | 5'-deoxyribose-5-phosphate lyase activity(GO:0051575) |
0.1 | 0.8 | GO:0008179 | adenylate cyclase binding(GO:0008179) |
0.1 | 0.2 | GO:0030619 | U1 snRNA binding(GO:0030619) |
0.1 | 0.3 | GO:0004839 | ubiquitin activating enzyme activity(GO:0004839) |
0.1 | 0.1 | GO:0031852 | mu-type opioid receptor binding(GO:0031852) |
0.1 | 0.5 | GO:0032027 | myosin light chain binding(GO:0032027) |
0.1 | 0.2 | GO:0015111 | iodide transmembrane transporter activity(GO:0015111) |
0.1 | 1.0 | GO:0016917 | GABA receptor activity(GO:0016917) |
0.1 | 0.2 | GO:0005275 | amine transmembrane transporter activity(GO:0005275) |
0.1 | 0.4 | GO:0001515 | opioid peptide activity(GO:0001515) |
0.1 | 0.2 | GO:0008900 | hydrogen:potassium-exchanging ATPase activity(GO:0008900) |
0.1 | 0.2 | GO:0016015 | morphogen activity(GO:0016015) |
0.1 | 0.2 | GO:0042030 | ATPase inhibitor activity(GO:0042030) |
0.1 | 0.4 | GO:0004983 | neuropeptide Y receptor activity(GO:0004983) |
0.1 | 0.4 | GO:0004565 | beta-galactosidase activity(GO:0004565) |
0.1 | 0.9 | GO:0003905 | alkylbase DNA N-glycosylase activity(GO:0003905) DNA-3-methylbase glycosylase activity(GO:0043733) |
0.1 | 0.5 | GO:0033691 | sialic acid binding(GO:0033691) |
0.1 | 0.4 | GO:0000268 | peroxisome targeting sequence binding(GO:0000268) |
0.1 | 0.7 | GO:0001206 | transcriptional repressor activity, RNA polymerase II distal enhancer sequence-specific binding(GO:0001206) |
0.1 | 0.6 | GO:0008474 | palmitoyl-(protein) hydrolase activity(GO:0008474) palmitoyl hydrolase activity(GO:0098599) |
0.1 | 0.2 | GO:0002151 | G-quadruplex RNA binding(GO:0002151) |
0.1 | 0.3 | GO:0070051 | fibrinogen binding(GO:0070051) |
0.1 | 0.2 | GO:0004505 | phenylalanine 4-monooxygenase activity(GO:0004505) |
0.1 | 0.2 | GO:0005148 | prolactin receptor binding(GO:0005148) |
0.1 | 0.3 | GO:0008853 | exodeoxyribonuclease III activity(GO:0008853) |
0.1 | 0.3 | GO:0008499 | UDP-galactose:beta-N-acetylglucosamine beta-1,3-galactosyltransferase activity(GO:0008499) |
0.1 | 0.2 | GO:0047276 | N-acetyllactosaminide 3-alpha-galactosyltransferase activity(GO:0047276) |
0.1 | 0.1 | GO:0071987 | WD40-repeat domain binding(GO:0071987) |
0.1 | 0.3 | GO:0004994 | somatostatin receptor activity(GO:0004994) |
0.1 | 0.9 | GO:0099589 | G-protein coupled serotonin receptor activity(GO:0004993) serotonin receptor activity(GO:0099589) |
0.1 | 0.3 | GO:0035250 | UDP-galactosyltransferase activity(GO:0035250) |
0.1 | 1.5 | GO:0004181 | metallocarboxypeptidase activity(GO:0004181) |
0.1 | 0.3 | GO:0004111 | creatine kinase activity(GO:0004111) |
0.1 | 1.0 | GO:0016805 | dipeptidase activity(GO:0016805) |
0.1 | 0.3 | GO:0070579 | methylcytosine dioxygenase activity(GO:0070579) |
0.1 | 1.4 | GO:0070001 | aspartic-type endopeptidase activity(GO:0004190) aspartic-type peptidase activity(GO:0070001) |
0.1 | 0.1 | GO:0004938 | alpha2-adrenergic receptor activity(GO:0004938) |
0.1 | 0.9 | GO:0022842 | leak channel activity(GO:0022840) narrow pore channel activity(GO:0022842) |
0.1 | 0.2 | GO:0030158 | protein xylosyltransferase activity(GO:0030158) |
0.1 | 0.9 | GO:0005351 | sugar:proton symporter activity(GO:0005351) |
0.1 | 0.3 | GO:0004758 | serine C-palmitoyltransferase activity(GO:0004758) |
0.1 | 0.2 | GO:0070052 | collagen V binding(GO:0070052) |
0.1 | 0.4 | GO:0008517 | folic acid transporter activity(GO:0008517) |
0.1 | 0.2 | GO:0004083 | bisphosphoglycerate 2-phosphatase activity(GO:0004083) |
0.1 | 0.2 | GO:0004013 | adenosylhomocysteinase activity(GO:0004013) trialkylsulfonium hydrolase activity(GO:0016802) |
0.1 | 0.2 | GO:0016882 | cyclo-ligase activity(GO:0016882) |
0.1 | 0.3 | GO:0004826 | phenylalanine-tRNA ligase activity(GO:0004826) |
0.1 | 0.9 | GO:0005112 | Notch binding(GO:0005112) |
0.1 | 0.6 | GO:0015172 | L-glutamate transmembrane transporter activity(GO:0005313) acidic amino acid transmembrane transporter activity(GO:0015172) |
0.1 | 0.1 | GO:0098632 | protein binding involved in cell-cell adhesion(GO:0098632) |
0.1 | 0.5 | GO:0070990 | snRNP binding(GO:0070990) |
0.1 | 0.2 | GO:0004416 | hydroxyacylglutathione hydrolase activity(GO:0004416) |
0.1 | 0.5 | GO:0031681 | G-protein beta-subunit binding(GO:0031681) |
0.1 | 0.4 | GO:0016861 | intramolecular oxidoreductase activity, interconverting aldoses and ketoses(GO:0016861) |
0.1 | 0.4 | GO:0003896 | DNA primase activity(GO:0003896) |
0.1 | 0.1 | GO:0043199 | sulfate binding(GO:0043199) |
0.1 | 0.2 | GO:0004667 | prostaglandin-D synthase activity(GO:0004667) |
0.1 | 0.1 | GO:0071532 | ankyrin repeat binding(GO:0071532) |
0.1 | 0.4 | GO:0000900 | translation repressor activity, nucleic acid binding(GO:0000900) |
0.1 | 0.7 | GO:0051183 | vitamin transporter activity(GO:0051183) |
0.1 | 0.2 | GO:0043515 | kinetochore binding(GO:0043515) |
0.1 | 0.4 | GO:0102336 | fatty acid elongase activity(GO:0009922) 3-oxo-arachidoyl-CoA synthase activity(GO:0102336) 3-oxo-cerotoyl-CoA synthase activity(GO:0102337) 3-oxo-lignoceronyl-CoA synthase activity(GO:0102338) |
0.1 | 0.2 | GO:0016649 | electron-transferring-flavoprotein dehydrogenase activity(GO:0004174) oxidoreductase activity, acting on the CH-NH group of donors, quinone or similar compound as acceptor(GO:0016649) |
0.1 | 0.2 | GO:0003987 | acetate-CoA ligase activity(GO:0003987) |
0.1 | 0.5 | GO:0048407 | platelet-derived growth factor binding(GO:0048407) |
0.1 | 0.2 | GO:0000403 | Y-form DNA binding(GO:0000403) |
0.1 | 0.7 | GO:0017128 | phospholipid scramblase activity(GO:0017128) |
0.1 | 0.4 | GO:0001595 | angiotensin receptor activity(GO:0001595) |
0.1 | 0.3 | GO:0070883 | pre-miRNA binding(GO:0070883) |
0.1 | 0.1 | GO:0046921 | alpha-(1->6)-fucosyltransferase activity(GO:0046921) |
0.1 | 0.3 | GO:0016615 | malate dehydrogenase activity(GO:0016615) |
0.0 | 0.2 | GO:0004459 | L-lactate dehydrogenase activity(GO:0004459) |
0.0 | 0.5 | GO:0050321 | tau-protein kinase activity(GO:0050321) |
0.0 | 0.2 | GO:0005143 | interleukin-12 receptor binding(GO:0005143) |
0.0 | 0.6 | GO:0070016 | armadillo repeat domain binding(GO:0070016) |
0.0 | 0.3 | GO:0070191 | methionine-R-sulfoxide reductase activity(GO:0070191) |
0.0 | 0.9 | GO:0005487 | nucleocytoplasmic transporter activity(GO:0005487) |
0.0 | 0.2 | GO:0031849 | olfactory receptor binding(GO:0031849) |
0.0 | 0.2 | GO:0098518 | polynucleotide phosphatase activity(GO:0098518) |
0.0 | 0.2 | GO:0008502 | melatonin receptor activity(GO:0008502) |
0.0 | 1.9 | GO:0003777 | microtubule motor activity(GO:0003777) |
0.0 | 0.2 | GO:0010997 | anaphase-promoting complex binding(GO:0010997) |
0.0 | 0.1 | GO:1990430 | extracellular matrix protein binding(GO:1990430) |
0.0 | 0.4 | GO:0015125 | bile acid transmembrane transporter activity(GO:0015125) |
0.0 | 0.0 | GO:0035529 | NADH pyrophosphatase activity(GO:0035529) |
0.0 | 0.2 | GO:0004591 | oxoglutarate dehydrogenase (succinyl-transferring) activity(GO:0004591) |
0.0 | 0.0 | GO:0051870 | methotrexate binding(GO:0051870) |
0.0 | 0.2 | GO:0035473 | lipase binding(GO:0035473) |
0.0 | 0.2 | GO:0004449 | isocitrate dehydrogenase (NAD+) activity(GO:0004449) |
0.0 | 0.4 | GO:0005227 | calcium activated cation channel activity(GO:0005227) |
0.0 | 0.2 | GO:0008508 | bile acid:sodium symporter activity(GO:0008508) |
0.0 | 0.1 | GO:0019808 | polyamine binding(GO:0019808) |
0.0 | 0.2 | GO:0030551 | cyclic nucleotide binding(GO:0030551) |
0.0 | 0.6 | GO:0031683 | G-protein beta/gamma-subunit complex binding(GO:0031683) |
0.0 | 0.1 | GO:0005157 | macrophage colony-stimulating factor receptor binding(GO:0005157) |
0.0 | 0.0 | GO:0004769 | steroid delta-isomerase activity(GO:0004769) |
0.0 | 0.5 | GO:0015026 | coreceptor activity(GO:0015026) |
0.0 | 0.6 | GO:0008266 | poly(U) RNA binding(GO:0008266) |
0.0 | 0.2 | GO:0004075 | biotin carboxylase activity(GO:0004075) |
0.0 | 0.1 | GO:0032190 | acrosin binding(GO:0032190) |
0.0 | 0.1 | GO:2001070 | starch binding(GO:2001070) |
0.0 | 0.3 | GO:0003854 | 3-beta-hydroxy-delta5-steroid dehydrogenase activity(GO:0003854) |
0.0 | 0.2 | GO:0019784 | NEDD8-specific protease activity(GO:0019784) |
0.0 | 0.5 | GO:0042800 | histone methyltransferase activity (H3-K4 specific)(GO:0042800) |
0.0 | 0.1 | GO:0005146 | leukemia inhibitory factor receptor binding(GO:0005146) |
0.0 | 0.4 | GO:0004435 | phosphatidylinositol phospholipase C activity(GO:0004435) |
0.0 | 0.1 | GO:0008310 | single-stranded DNA 3'-5' exodeoxyribonuclease activity(GO:0008310) |
0.0 | 0.5 | GO:0001965 | G-protein alpha-subunit binding(GO:0001965) |
0.0 | 0.7 | GO:0035254 | glutamate receptor binding(GO:0035254) |
0.0 | 0.2 | GO:0035312 | 5'-3' exodeoxyribonuclease activity(GO:0035312) |
0.0 | 0.1 | GO:0008486 | diphosphoinositol-polyphosphate diphosphatase activity(GO:0008486) |
0.0 | 0.1 | GO:0097016 | L27 domain binding(GO:0097016) |
0.0 | 0.3 | GO:0034450 | ubiquitin-ubiquitin ligase activity(GO:0034450) |
0.0 | 0.1 | GO:0005138 | interleukin-6 receptor binding(GO:0005138) |
0.0 | 0.1 | GO:0050145 | nucleoside phosphate kinase activity(GO:0050145) |
0.0 | 0.2 | GO:0001135 | transcription factor activity, RNA polymerase II transcription factor recruiting(GO:0001135) |
0.0 | 0.2 | GO:0009881 | photoreceptor activity(GO:0009881) |
0.0 | 0.3 | GO:0050431 | transforming growth factor beta binding(GO:0050431) |
0.0 | 0.1 | GO:0015198 | oligopeptide transporter activity(GO:0015198) |
0.0 | 0.1 | GO:0017176 | phosphatidylinositol N-acetylglucosaminyltransferase activity(GO:0017176) |
0.0 | 0.0 | GO:0051425 | PTB domain binding(GO:0051425) |
0.0 | 0.3 | GO:0022821 | potassium ion antiporter activity(GO:0022821) |
0.0 | 0.1 | GO:0034511 | U3 snoRNA binding(GO:0034511) |
0.0 | 0.1 | GO:0046935 | 1-phosphatidylinositol-3-kinase regulator activity(GO:0046935) |
0.0 | 0.1 | GO:0008187 | poly-pyrimidine tract binding(GO:0008187) |
0.0 | 0.1 | GO:0016714 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, reduced pteridine as one donor, and incorporation of one atom of oxygen(GO:0016714) |
0.0 | 0.2 | GO:0005272 | sodium channel activity(GO:0005272) |
0.0 | 0.1 | GO:0005166 | neurotrophin p75 receptor binding(GO:0005166) |
0.0 | 0.2 | GO:0001162 | RNA polymerase II intronic transcription regulatory region sequence-specific DNA binding(GO:0001162) |
0.0 | 0.4 | GO:0052859 | dextrin alpha-glucosidase activity(GO:0044653) starch alpha-glucosidase activity(GO:0044654) beta-glucanase activity(GO:0052736) beta-6-sulfate-N-acetylglucosaminidase activity(GO:0052769) glucan endo-1,4-beta-glucosidase activity(GO:0052859) |
0.0 | 0.2 | GO:0015377 | cation:chloride symporter activity(GO:0015377) |
0.0 | 0.1 | GO:0033142 | progesterone receptor binding(GO:0033142) |
0.0 | 0.7 | GO:0017147 | Wnt-protein binding(GO:0017147) |
0.0 | 0.1 | GO:0005499 | vitamin D binding(GO:0005499) |
0.0 | 0.1 | GO:0043237 | laminin-1 binding(GO:0043237) |
0.0 | 0.2 | GO:0070034 | telomerase RNA binding(GO:0070034) |
0.0 | 0.0 | GO:0015925 | galactosidase activity(GO:0015925) |
0.0 | 0.4 | GO:0016646 | oxidoreductase activity, acting on the CH-NH group of donors, NAD or NADP as acceptor(GO:0016646) |
0.0 | 0.1 | GO:0042923 | neuropeptide binding(GO:0042923) |
0.0 | 0.2 | GO:0001094 | TFIID-class transcription factor binding(GO:0001094) |
0.0 | 0.6 | GO:0052771 | coenzyme F390-A hydrolase activity(GO:0052770) coenzyme F390-G hydrolase activity(GO:0052771) |
0.0 | 0.1 | GO:0003726 | double-stranded RNA adenosine deaminase activity(GO:0003726) |
0.0 | 0.1 | GO:0046923 | ER retention sequence binding(GO:0046923) |
0.0 | 0.1 | GO:0001665 | alpha-N-acetylgalactosaminide alpha-2,6-sialyltransferase activity(GO:0001665) |
0.0 | 0.1 | GO:0047238 | glucuronosyl-N-acetylgalactosaminyl-proteoglycan 4-beta-N-acetylgalactosaminyltransferase activity(GO:0047238) |
0.0 | 0.1 | GO:0018685 | alkane 1-monooxygenase activity(GO:0018685) |
0.0 | 0.0 | GO:0034191 | apolipoprotein A-I receptor binding(GO:0034191) |
0.0 | 0.7 | GO:0017022 | myosin binding(GO:0017022) |
0.0 | 0.0 | GO:0061629 | RNA polymerase II sequence-specific DNA binding transcription factor binding(GO:0061629) |
0.0 | 0.1 | GO:0047631 | ADP-ribose diphosphatase activity(GO:0047631) |
0.0 | 0.1 | GO:0030292 | protein tyrosine kinase inhibitor activity(GO:0030292) |
0.0 | 0.1 | GO:0035851 | Krueppel-associated box domain binding(GO:0035851) |
0.0 | 0.1 | GO:0050815 | phosphoserine binding(GO:0050815) |
0.0 | 0.1 | GO:0031995 | insulin-like growth factor II binding(GO:0031995) |
0.0 | 1.0 | GO:0008376 | acetylgalactosaminyltransferase activity(GO:0008376) |
0.0 | 0.3 | GO:0030676 | Rac guanyl-nucleotide exchange factor activity(GO:0030676) |
0.0 | 0.5 | GO:0005212 | structural constituent of eye lens(GO:0005212) |
0.0 | 0.1 | GO:0035939 | microsatellite binding(GO:0035939) |
0.0 | 0.1 | GO:0004652 | polynucleotide adenylyltransferase activity(GO:0004652) |
0.0 | 0.1 | GO:0004579 | dolichyl-diphosphooligosaccharide-protein glycotransferase activity(GO:0004579) |
0.0 | 0.1 | GO:0004031 | aldehyde oxidase activity(GO:0004031) oxidoreductase activity, acting on the aldehyde or oxo group of donors, oxygen as acceptor(GO:0016623) |
0.0 | 0.9 | GO:0008081 | phosphoric diester hydrolase activity(GO:0008081) |
0.0 | 0.3 | GO:0071855 | neuropeptide receptor binding(GO:0071855) |
0.0 | 0.4 | GO:0008188 | neuropeptide receptor activity(GO:0008188) |
0.0 | 0.0 | GO:0008046 | axon guidance receptor activity(GO:0008046) |
0.0 | 0.2 | GO:0015370 | solute:sodium symporter activity(GO:0015370) |
0.0 | 0.2 | GO:0031005 | filamin binding(GO:0031005) |
0.0 | 0.3 | GO:0008198 | ferrous iron binding(GO:0008198) |
0.0 | 0.1 | GO:0004784 | superoxide dismutase activity(GO:0004784) oxidoreductase activity, acting on superoxide radicals as acceptor(GO:0016721) |
0.0 | 0.0 | GO:0016309 | 1-phosphatidylinositol-5-phosphate 4-kinase activity(GO:0016309) |
0.0 | 0.2 | GO:0005520 | insulin-like growth factor binding(GO:0005520) |
0.0 | 0.1 | GO:0008079 | translation release factor activity(GO:0003747) translation termination factor activity(GO:0008079) |
0.0 | 0.1 | GO:0003688 | DNA replication origin binding(GO:0003688) |
0.0 | 0.1 | GO:0032184 | SUMO polymer binding(GO:0032184) |
0.0 | 0.3 | GO:0042056 | chemoattractant activity(GO:0042056) |
0.0 | 0.0 | GO:0019153 | protein-disulfide reductase (glutathione) activity(GO:0019153) |
0.0 | 0.0 | GO:0004045 | aminoacyl-tRNA hydrolase activity(GO:0004045) |
0.0 | 0.2 | GO:0005521 | lamin binding(GO:0005521) |
0.0 | 0.3 | GO:0019706 | protein-cysteine S-palmitoyltransferase activity(GO:0019706) |
0.0 | 0.1 | GO:0034584 | piRNA binding(GO:0034584) |
0.0 | 0.0 | GO:0004517 | nitric-oxide synthase activity(GO:0004517) |
0.0 | 0.3 | GO:0045296 | cadherin binding(GO:0045296) |
0.0 | 0.0 | GO:0004027 | alcohol sulfotransferase activity(GO:0004027) |
0.0 | 0.2 | GO:0001594 | trace-amine receptor activity(GO:0001594) |
0.0 | 0.2 | GO:0080025 | phosphatidylinositol-3,5-bisphosphate binding(GO:0080025) |
0.0 | 0.1 | GO:0004415 | hyalurononglucosaminidase activity(GO:0004415) |
0.0 | 0.2 | GO:0017134 | fibroblast growth factor binding(GO:0017134) |
0.0 | 0.0 | GO:0019767 | IgE receptor activity(GO:0019767) |
0.0 | 0.0 | GO:0048019 | receptor antagonist activity(GO:0048019) |
0.0 | 0.0 | GO:0016715 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, reduced ascorbate as one donor, and incorporation of one atom of oxygen(GO:0016715) |
0.0 | 0.0 | GO:0016880 | acid-ammonia (or amide) ligase activity(GO:0016880) |
0.0 | 0.0 | GO:0008147 | structural constituent of bone(GO:0008147) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.3 | 7.9 | PID REELIN PATHWAY | Reelin signaling pathway |
0.2 | 2.3 | PID LPA4 PATHWAY | LPA4-mediated signaling events |
0.1 | 0.1 | PID S1P S1P2 PATHWAY | S1P2 pathway |
0.1 | 2.4 | PID NCADHERIN PATHWAY | N-cadherin signaling events |
0.1 | 0.2 | SIG CD40PATHWAYMAP | Genes related to CD40 signaling |
0.1 | 1.2 | PID S1P S1P4 PATHWAY | S1P4 pathway |
0.1 | 1.0 | PID EPHB FWD PATHWAY | EPHB forward signaling |
0.1 | 1.1 | PID RET PATHWAY | Signaling events regulated by Ret tyrosine kinase |
0.1 | 1.0 | PID INTEGRIN A9B1 PATHWAY | Alpha9 beta1 integrin signaling events |
0.1 | 0.5 | PID VEGF VEGFR PATHWAY | VEGF and VEGFR signaling network |
0.1 | 0.7 | PID TCR JNK PATHWAY | JNK signaling in the CD4+ TCR pathway |
0.1 | 1.9 | ST WNT BETA CATENIN PATHWAY | Wnt/beta-catenin Pathway |
0.1 | 1.1 | ST GRANULE CELL SURVIVAL PATHWAY | Granule Cell Survival Pathway is a specific case of more general PAC1 Receptor Pathway. |
0.1 | 0.5 | PID RANBP2 PATHWAY | Sumoylation by RanBP2 regulates transcriptional repression |
0.1 | 2.8 | NABA COLLAGENS | Genes encoding collagen proteins |
0.1 | 0.1 | PID IL2 STAT5 PATHWAY | IL2 signaling events mediated by STAT5 |
0.1 | 0.4 | PID GLYPICAN 1PATHWAY | Glypican 1 network |
0.1 | 1.7 | PID WNT SIGNALING PATHWAY | Wnt signaling network |
0.1 | 0.7 | PID SYNDECAN 3 PATHWAY | Syndecan-3-mediated signaling events |
0.1 | 2.9 | PID TRKR PATHWAY | Neurotrophic factor-mediated Trk receptor signaling |
0.1 | 1.1 | PID NEPHRIN NEPH1 PATHWAY | Nephrin/Neph1 signaling in the kidney podocyte |
0.1 | 1.0 | PID NETRIN PATHWAY | Netrin-mediated signaling events |
0.1 | 0.3 | PID AR NONGENOMIC PATHWAY | Nongenotropic Androgen signaling |
0.1 | 0.3 | PID EPHRINB REV PATHWAY | Ephrin B reverse signaling |
0.1 | 0.7 | PID ERBB NETWORK PATHWAY | ErbB receptor signaling network |
0.0 | 0.2 | PID IL8 CXCR1 PATHWAY | IL8- and CXCR1-mediated signaling events |
0.0 | 1.4 | ST T CELL SIGNAL TRANSDUCTION | T Cell Signal Transduction |
0.0 | 7.4 | NABA ECM GLYCOPROTEINS | Genes encoding structural ECM glycoproteins |
0.0 | 0.1 | ST ADRENERGIC | Adrenergic Pathway |
0.0 | 0.6 | PID DNA PK PATHWAY | DNA-PK pathway in nonhomologous end joining |
0.0 | 0.1 | SIG PIP3 SIGNALING IN B LYMPHOCYTES | Genes related to PIP3 signaling in B lymphocytes |
0.0 | 0.1 | PID S1P S1P3 PATHWAY | S1P3 pathway |
0.0 | 0.9 | PID SHP2 PATHWAY | SHP2 signaling |
0.0 | 0.2 | ST B CELL ANTIGEN RECEPTOR | B Cell Antigen Receptor |
0.0 | 1.1 | PID P75 NTR PATHWAY | p75(NTR)-mediated signaling |
0.0 | 0.9 | NABA PROTEOGLYCANS | Genes encoding proteoglycans |
0.0 | 0.5 | PID ARF 3PATHWAY | Arf1 pathway |
0.0 | 0.7 | PID RAC1 REG PATHWAY | Regulation of RAC1 activity |
0.0 | 0.2 | PID INSULIN GLUCOSE PATHWAY | Insulin-mediated glucose transport |
0.0 | 0.4 | PID NFKAPPAB CANONICAL PATHWAY | Canonical NF-kappaB pathway |
0.0 | 0.3 | PID P38 ALPHA BETA PATHWAY | Regulation of p38-alpha and p38-beta |
0.0 | 0.2 | PID INSULIN PATHWAY | Insulin Pathway |
0.0 | 0.3 | PID ILK PATHWAY | Integrin-linked kinase signaling |
0.0 | 0.0 | SA REG CASCADE OF CYCLIN EXPR | Expression of cyclins regulates progression through the cell cycle by activating cyclin-dependent kinases. |
0.0 | 0.1 | PID LIS1 PATHWAY | Lissencephaly gene (LIS1) in neuronal migration and development |
0.0 | 0.1 | ST G ALPHA S PATHWAY | G alpha s Pathway |
0.0 | 0.2 | PID BCR 5PATHWAY | BCR signaling pathway |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.6 | 8.6 | REACTOME UNBLOCKING OF NMDA RECEPTOR GLUTAMATE BINDING AND ACTIVATION | Genes involved in Unblocking of NMDA receptor, glutamate binding and activation |
0.4 | 7.4 | REACTOME INTERACTION BETWEEN L1 AND ANKYRINS | Genes involved in Interaction between L1 and Ankyrins |
0.3 | 4.9 | REACTOME CLASS C 3 METABOTROPIC GLUTAMATE PHEROMONE RECEPTORS | Genes involved in Class C/3 (Metabotropic glutamate/pheromone receptors) |
0.3 | 2.0 | REACTOME INHIBITION OF INSULIN SECRETION BY ADRENALINE NORADRENALINE | Genes involved in Inhibition of Insulin Secretion by Adrenaline/Noradrenaline |
0.3 | 3.8 | REACTOME GABA A RECEPTOR ACTIVATION | Genes involved in GABA A receptor activation |
0.3 | 4.4 | REACTOME CRMPS IN SEMA3A SIGNALING | Genes involved in CRMPs in Sema3A signaling |
0.3 | 3.1 | REACTOME ADENYLATE CYCLASE ACTIVATING PATHWAY | Genes involved in Adenylate cyclase activating pathway |
0.3 | 4.9 | REACTOME GABA SYNTHESIS RELEASE REUPTAKE AND DEGRADATION | Genes involved in GABA synthesis, release, reuptake and degradation |
0.3 | 1.1 | REACTOME DOPAMINE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Dopamine Neurotransmitter Release Cycle |
0.3 | 11.5 | REACTOME VOLTAGE GATED POTASSIUM CHANNELS | Genes involved in Voltage gated Potassium channels |
0.3 | 10.5 | REACTOME NCAM1 INTERACTIONS | Genes involved in NCAM1 interactions |
0.2 | 0.5 | REACTOME REGULATION OF GLUCOKINASE BY GLUCOKINASE REGULATORY PROTEIN | Genes involved in Regulation of Glucokinase by Glucokinase Regulatory Protein |
0.2 | 4.9 | REACTOME IL RECEPTOR SHC SIGNALING | Genes involved in Interleukin receptor SHC signaling |
0.2 | 3.4 | REACTOME CGMP EFFECTS | Genes involved in cGMP effects |
0.2 | 1.0 | REACTOME G PROTEIN ACTIVATION | Genes involved in G-protein activation |
0.2 | 0.5 | REACTOME SIGNALLING TO P38 VIA RIT AND RIN | Genes involved in Signalling to p38 via RIT and RIN |
0.2 | 1.7 | REACTOME IONOTROPIC ACTIVITY OF KAINATE RECEPTORS | Genes involved in Ionotropic activity of Kainate Receptors |
0.2 | 0.2 | REACTOME ACYL CHAIN REMODELLING OF PI | Genes involved in Acyl chain remodelling of PI |
0.2 | 1.8 | REACTOME PRESYNAPTIC NICOTINIC ACETYLCHOLINE RECEPTORS | Genes involved in Presynaptic nicotinic acetylcholine receptors |
0.2 | 1.7 | REACTOME NEPHRIN INTERACTIONS | Genes involved in Nephrin interactions |
0.1 | 0.3 | REACTOME RAS ACTIVATION UOPN CA2 INFUX THROUGH NMDA RECEPTOR | Genes involved in Ras activation uopn Ca2+ infux through NMDA receptor |
0.1 | 1.1 | REACTOME LIGAND GATED ION CHANNEL TRANSPORT | Genes involved in Ligand-gated ion channel transport |
0.1 | 3.6 | REACTOME STRIATED MUSCLE CONTRACTION | Genes involved in Striated Muscle Contraction |
0.1 | 1.4 | REACTOME DSCAM INTERACTIONS | Genes involved in DSCAM interactions |
0.1 | 1.3 | REACTOME UNWINDING OF DNA | Genes involved in Unwinding of DNA |
0.1 | 1.8 | REACTOME PLATELET CALCIUM HOMEOSTASIS | Genes involved in Platelet calcium homeostasis |
0.1 | 0.3 | REACTOME ADENYLATE CYCLASE INHIBITORY PATHWAY | Genes involved in Adenylate cyclase inhibitory pathway |
0.1 | 0.3 | REACTOME ACTIVATION OF NF KAPPAB IN B CELLS | Genes involved in Activation of NF-kappaB in B Cells |
0.1 | 1.3 | REACTOME NA CL DEPENDENT NEUROTRANSMITTER TRANSPORTERS | Genes involved in Na+/Cl- dependent neurotransmitter transporters |
0.1 | 5.3 | REACTOME POTASSIUM CHANNELS | Genes involved in Potassium Channels |
0.1 | 1.2 | REACTOME CALNEXIN CALRETICULIN CYCLE | Genes involved in Calnexin/calreticulin cycle |
0.1 | 1.1 | REACTOME DOWNREGULATION OF ERBB2 ERBB3 SIGNALING | Genes involved in Downregulation of ERBB2:ERBB3 signaling |
0.1 | 0.1 | REACTOME SIGNAL REGULATORY PROTEIN SIRP FAMILY INTERACTIONS | Genes involved in Signal regulatory protein (SIRP) family interactions |
0.1 | 1.9 | REACTOME FORMATION OF TUBULIN FOLDING INTERMEDIATES BY CCT TRIC | Genes involved in Formation of tubulin folding intermediates by CCT/TriC |
0.1 | 1.2 | REACTOME SYNTHESIS OF PIPS AT THE EARLY ENDOSOME MEMBRANE | Genes involved in Synthesis of PIPs at the early endosome membrane |
0.1 | 0.7 | REACTOME MEMBRANE BINDING AND TARGETTING OF GAG PROTEINS | Genes involved in Membrane binding and targetting of GAG proteins |
0.1 | 0.4 | REACTOME BINDING AND ENTRY OF HIV VIRION | Genes involved in Binding and entry of HIV virion |
0.1 | 0.1 | REACTOME SIGNALING BY NOTCH3 | Genes involved in Signaling by NOTCH3 |
0.1 | 2.0 | REACTOME ADHERENS JUNCTIONS INTERACTIONS | Genes involved in Adherens junctions interactions |
0.1 | 1.2 | REACTOME RAP1 SIGNALLING | Genes involved in Rap1 signalling |
0.1 | 0.7 | REACTOME SYNTHESIS OF BILE ACIDS AND BILE SALTS VIA 24 HYDROXYCHOLESTEROL | Genes involved in Synthesis of bile acids and bile salts via 24-hydroxycholesterol |
0.1 | 0.9 | REACTOME SEROTONIN RECEPTORS | Genes involved in Serotonin receptors |
0.1 | 1.0 | REACTOME N GLYCAN ANTENNAE ELONGATION | Genes involved in N-Glycan antennae elongation |
0.1 | 3.0 | REACTOME NRAGE SIGNALS DEATH THROUGH JNK | Genes involved in NRAGE signals death through JNK |
0.1 | 0.6 | REACTOME PHOSPHORYLATION OF CD3 AND TCR ZETA CHAINS | Genes involved in Phosphorylation of CD3 and TCR zeta chains |
0.1 | 1.0 | REACTOME SYNTHESIS SECRETION AND INACTIVATION OF GIP | Genes involved in Synthesis, Secretion, and Inactivation of Glucose-dependent Insulinotropic Polypeptide (GIP) |
0.1 | 0.8 | REACTOME CS DS DEGRADATION | Genes involved in CS/DS degradation |
0.1 | 0.5 | REACTOME CREATION OF C4 AND C2 ACTIVATORS | Genes involved in Creation of C4 and C2 activators |
0.1 | 0.1 | REACTOME IL 3 5 AND GM CSF SIGNALING | Genes involved in Interleukin-3, 5 and GM-CSF signaling |
0.1 | 1.6 | REACTOME KINESINS | Genes involved in Kinesins |
0.1 | 0.1 | REACTOME HIGHLY CALCIUM PERMEABLE POSTSYNAPTIC NICOTINIC ACETYLCHOLINE RECEPTORS | Genes involved in Highly calcium permeable postsynaptic nicotinic acetylcholine receptors |
0.1 | 1.3 | REACTOME TRAFFICKING OF AMPA RECEPTORS | Genes involved in Trafficking of AMPA receptors |
0.1 | 0.9 | REACTOME FGFR1 LIGAND BINDING AND ACTIVATION | Genes involved in FGFR1 ligand binding and activation |
0.1 | 0.7 | REACTOME SLBP DEPENDENT PROCESSING OF REPLICATION DEPENDENT HISTONE PRE MRNAS | Genes involved in SLBP Dependent Processing of Replication-Dependent Histone Pre-mRNAs |
0.1 | 0.9 | REACTOME INSULIN SYNTHESIS AND PROCESSING | Genes involved in Insulin Synthesis and Processing |
0.1 | 0.2 | REACTOME ACETYLCHOLINE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Acetylcholine Neurotransmitter Release Cycle |
0.1 | 1.3 | REACTOME KERATAN SULFATE KERATIN METABOLISM | Genes involved in Keratan sulfate/keratin metabolism |
0.1 | 0.9 | REACTOME ACTIVATED NOTCH1 TRANSMITS SIGNAL TO THE NUCLEUS | Genes involved in Activated NOTCH1 Transmits Signal to the Nucleus |
0.1 | 0.1 | REACTOME IL 2 SIGNALING | Genes involved in Interleukin-2 signaling |
0.1 | 0.2 | REACTOME IRAK1 RECRUITS IKK COMPLEX | Genes involved in IRAK1 recruits IKK complex |
0.1 | 0.9 | REACTOME SYNTHESIS OF GLYCOSYLPHOSPHATIDYLINOSITOL GPI | Genes involved in Synthesis of glycosylphosphatidylinositol (GPI) |
0.1 | 0.4 | REACTOME ENDOGENOUS STEROLS | Genes involved in Endogenous sterols |
0.1 | 0.5 | REACTOME CYTOSOLIC SULFONATION OF SMALL MOLECULES | Genes involved in Cytosolic sulfonation of small molecules |
0.1 | 0.1 | REACTOME PEPTIDE CHAIN ELONGATION | Genes involved in Peptide chain elongation |
0.0 | 0.4 | REACTOME COPI MEDIATED TRANSPORT | Genes involved in COPI Mediated Transport |
0.0 | 0.3 | REACTOME INTEGRATION OF PROVIRUS | Genes involved in Integration of provirus |
0.0 | 0.5 | REACTOME G ALPHA Z SIGNALLING EVENTS | Genes involved in G alpha (z) signalling events |
0.0 | 1.8 | REACTOME HEPARAN SULFATE HEPARIN HS GAG METABOLISM | Genes involved in Heparan sulfate/heparin (HS-GAG) metabolism |
0.0 | 0.4 | REACTOME ACTIVATION OF CHAPERONE GENES BY ATF6 ALPHA | Genes involved in Activation of Chaperone Genes by ATF6-alpha |
0.0 | 0.1 | REACTOME ABORTIVE ELONGATION OF HIV1 TRANSCRIPT IN THE ABSENCE OF TAT | Genes involved in Abortive elongation of HIV-1 transcript in the absence of Tat |
0.0 | 0.3 | REACTOME OPSINS | Genes involved in Opsins |
0.0 | 0.3 | REACTOME P38MAPK EVENTS | Genes involved in p38MAPK events |
0.0 | 0.2 | REACTOME AMINE LIGAND BINDING RECEPTORS | Genes involved in Amine ligand-binding receptors |
0.0 | 0.1 | REACTOME CROSS PRESENTATION OF SOLUBLE EXOGENOUS ANTIGENS ENDOSOMES | Genes involved in Cross-presentation of soluble exogenous antigens (endosomes) |
0.0 | 0.1 | REACTOME SIGNALING BY FGFR3 MUTANTS | Genes involved in Signaling by FGFR3 mutants |
0.0 | 0.5 | REACTOME GLUCAGON TYPE LIGAND RECEPTORS | Genes involved in Glucagon-type ligand receptors |
0.0 | 0.2 | REACTOME G BETA GAMMA SIGNALLING THROUGH PI3KGAMMA | Genes involved in G beta:gamma signalling through PI3Kgamma |
0.0 | 0.6 | REACTOME ABCA TRANSPORTERS IN LIPID HOMEOSTASIS | Genes involved in ABCA transporters in lipid homeostasis |
0.0 | 1.1 | REACTOME TRANSMISSION ACROSS CHEMICAL SYNAPSES | Genes involved in Transmission across Chemical Synapses |
0.0 | 0.4 | REACTOME METABOLISM OF PORPHYRINS | Genes involved in Metabolism of porphyrins |
0.0 | 0.7 | REACTOME NETRIN1 SIGNALING | Genes involved in Netrin-1 signaling |
0.0 | 0.0 | REACTOME CONVERSION FROM APC C CDC20 TO APC C CDH1 IN LATE ANAPHASE | Genes involved in Conversion from APC/C:Cdc20 to APC/C:Cdh1 in late anaphase |
0.0 | 0.2 | REACTOME PLATELET AGGREGATION PLUG FORMATION | Genes involved in Platelet Aggregation (Plug Formation) |
0.0 | 0.0 | REACTOME RNA POL I PROMOTER OPENING | Genes involved in RNA Polymerase I Promoter Opening |
0.0 | 0.3 | REACTOME ABC FAMILY PROTEINS MEDIATED TRANSPORT | Genes involved in ABC-family proteins mediated transport |
0.0 | 0.5 | REACTOME ASSOCIATION OF TRIC CCT WITH TARGET PROTEINS DURING BIOSYNTHESIS | Genes involved in Association of TriC/CCT with target proteins during biosynthesis |
0.0 | 0.1 | REACTOME SHC MEDIATED SIGNALLING | Genes involved in SHC-mediated signalling |
0.0 | 0.3 | REACTOME FACILITATIVE NA INDEPENDENT GLUCOSE TRANSPORTERS | Genes involved in Facilitative Na+-independent glucose transporters |
0.0 | 0.2 | REACTOME METABOLISM OF POLYAMINES | Genes involved in Metabolism of polyamines |
0.0 | 0.4 | REACTOME DEPOSITION OF NEW CENPA CONTAINING NUCLEOSOMES AT THE CENTROMERE | Genes involved in Deposition of New CENPA-containing Nucleosomes at the Centromere |
0.0 | 0.4 | REACTOME CHONDROITIN SULFATE DERMATAN SULFATE METABOLISM | Genes involved in Chondroitin sulfate/dermatan sulfate metabolism |
0.0 | 0.3 | REACTOME DOWNSTREAM TCR SIGNALING | Genes involved in Downstream TCR signaling |
0.0 | 0.5 | REACTOME SIGNALING BY ROBO RECEPTOR | Genes involved in Signaling by Robo receptor |
0.0 | 0.3 | REACTOME OPIOID SIGNALLING | Genes involved in Opioid Signalling |
0.0 | 0.3 | REACTOME REGULATION OF INSULIN LIKE GROWTH FACTOR IGF ACTIVITY BY INSULIN LIKE GROWTH FACTOR BINDING PROTEINS IGFBPS | Genes involved in Regulation of Insulin-like Growth Factor (IGF) Activity by Insulin-like Growth Factor Binding Proteins (IGFBPs) |
0.0 | 0.2 | REACTOME INHIBITION OF REPLICATION INITIATION OF DAMAGED DNA BY RB1 E2F1 | Genes involved in Inhibition of replication initiation of damaged DNA by RB1/E2F1 |
0.0 | 0.1 | REACTOME GLYCOPROTEIN HORMONES | Genes involved in Glycoprotein hormones |
0.0 | 0.2 | REACTOME RECRUITMENT OF NUMA TO MITOTIC CENTROSOMES | Genes involved in Recruitment of NuMA to mitotic centrosomes |
0.0 | 0.0 | REACTOME THROMBIN SIGNALLING THROUGH PROTEINASE ACTIVATED RECEPTORS PARS | Genes involved in Thrombin signalling through proteinase activated receptors (PARs) |
0.0 | 0.2 | REACTOME HORMONE LIGAND BINDING RECEPTORS | Genes involved in Hormone ligand-binding receptors |
0.0 | 0.7 | REACTOME COLLAGEN FORMATION | Genes involved in Collagen formation |
0.0 | 0.2 | REACTOME GRB2 SOS PROVIDES LINKAGE TO MAPK SIGNALING FOR INTERGRINS | Genes involved in GRB2:SOS provides linkage to MAPK signaling for Intergrins |
0.0 | 0.5 | REACTOME P75 NTR RECEPTOR MEDIATED SIGNALLING | Genes involved in p75 NTR receptor-mediated signalling |
0.0 | 0.1 | REACTOME NITRIC OXIDE STIMULATES GUANYLATE CYCLASE | Genes involved in Nitric oxide stimulates guanylate cyclase |
0.0 | 1.0 | REACTOME RESPIRATORY ELECTRON TRANSPORT | Genes involved in Respiratory electron transport |
0.0 | 0.2 | REACTOME MRNA DECAY BY 5 TO 3 EXORIBONUCLEASE | Genes involved in mRNA Decay by 5' to 3' Exoribonuclease |
0.0 | 0.1 | REACTOME TGF BETA RECEPTOR SIGNALING IN EMT EPITHELIAL TO MESENCHYMAL TRANSITION | Genes involved in TGF-beta receptor signaling in EMT (epithelial to mesenchymal transition) |
0.0 | 0.1 | REACTOME ANTIGEN ACTIVATES B CELL RECEPTOR LEADING TO GENERATION OF SECOND MESSENGERS | Genes involved in Antigen Activates B Cell Receptor Leading to Generation of Second Messengers |
0.0 | 0.0 | REACTOME PROSTACYCLIN SIGNALLING THROUGH PROSTACYCLIN RECEPTOR | Genes involved in Prostacyclin signalling through prostacyclin receptor |
0.0 | 0.3 | REACTOME ACYL CHAIN REMODELLING OF PC | Genes involved in Acyl chain remodelling of PC |
0.0 | 0.1 | REACTOME EFFECTS OF PIP2 HYDROLYSIS | Genes involved in Effects of PIP2 hydrolysis |
0.0 | 1.4 | REACTOME G ALPHA I SIGNALLING EVENTS | Genes involved in G alpha (i) signalling events |
0.0 | 0.2 | REACTOME MYOGENESIS | Genes involved in Myogenesis |