Gene Symbol | Gene ID | Gene Info |
---|---|---|
Nkx2-6
|
ENSMUSG00000044186.9 | Nkx2-6 |
Gene | Promoter | Pearson corr. coef. | P-value | Plot |
---|---|---|---|---|
Nkx2-6 | mm10_chr14_69135966_69136117 | 0.56 | 8.4e-06 | Click! |
Move your cursor over a bar to see sample name and corresponding Z-value.
Cis Regulatory Element (CRE) | Target Score | Top associated gene | Gene Info | Distance of CRE to TSS | CRE/Gene association probability |
---|---|---|---|---|---|
chr3_97076076_97076280 | 5.94 |
4930573H18Rik |
RIKEN cDNA 4930573H18 gene |
16607 |
0.15 |
chr2_128850140_128850291 | 5.83 |
Tmem87b |
transmembrane protein 87B |
255 |
0.9 |
chr3_98410923_98411117 | 5.75 |
Zfp697 |
zinc finger protein 697 |
28472 |
0.12 |
chr15_63065959_63066540 | 5.59 |
Gm30159 |
predicted gene, 30159 |
74158 |
0.1 |
chr11_88555646_88556084 | 5.54 |
Msi2 |
musashi RNA-binding protein 2 |
34282 |
0.19 |
chr9_111056507_111056723 | 5.48 |
Ccrl2 |
chemokine (C-C motif) receptor-like 2 |
631 |
0.55 |
chr5_122602364_122602555 | 5.34 |
Ift81 |
intraflagellar transport 81 |
1034 |
0.42 |
chr9_67163871_67164040 | 5.29 |
Gm19299 |
predicted gene, 19299 |
30394 |
0.15 |
chr9_69459008_69459311 | 5.11 |
Mir3109 |
microRNA 3109 |
2215 |
0.19 |
chr5_127282655_127282806 | 4.89 |
Tmem132cos |
transmembrane protein 132C, opposite strand |
1096 |
0.53 |
chr17_70979455_70979649 | 4.87 |
Myl12b |
myosin, light chain 12B, regulatory |
1020 |
0.36 |
chr10_117987340_117987491 | 4.81 |
Gm37852 |
predicted gene, 37852 |
17523 |
0.19 |
chr4_57592877_57593028 | 4.81 |
Pakap |
paralemmin A kinase anchor protein |
24622 |
0.23 |
chr8_126833325_126834152 | 4.73 |
A630001O12Rik |
RIKEN cDNA A630001O12 gene |
5495 |
0.23 |
chr16_57569043_57569375 | 4.58 |
Filip1l |
filamin A interacting protein 1-like |
19967 |
0.21 |
chr15_3433353_3433783 | 4.46 |
Ghr |
growth hormone receptor |
38076 |
0.2 |
chr9_56260137_56260407 | 4.43 |
Peak1os |
pseudopodium-enriched atypical kinase 1, opposite strand |
2382 |
0.2 |
chr2_166196495_166196648 | 4.36 |
Gm11466 |
predicted gene 11466 |
5709 |
0.17 |
chr8_33905789_33906327 | 4.34 |
Rbpms |
RNA binding protein gene with multiple splicing |
14294 |
0.16 |
chr12_8099252_8099403 | 4.33 |
Apob |
apolipoprotein B |
86968 |
0.08 |
chr1_52251069_52251220 | 4.25 |
Gls |
glutaminase |
17912 |
0.19 |
chr1_150984135_150984286 | 4.14 |
Hmcn1 |
hemicentin 1 |
8841 |
0.19 |
chr16_25011199_25011350 | 4.06 |
A230028O05Rik |
RIKEN cDNA A230028O05 gene |
48365 |
0.18 |
chr7_112268723_112268946 | 4.04 |
Mical2 |
microtubule associated monooxygenase, calponin and LIM domain containing 2 |
2465 |
0.41 |
chr7_126636753_126636921 | 3.99 |
Nupr1 |
nuclear protein transcription regulator 1 |
5976 |
0.08 |
chr5_73358879_73359363 | 3.98 |
Ociad2 |
OCIA domain containing 2 |
18093 |
0.11 |
chr13_104636008_104636486 | 3.98 |
2610204G07Rik |
RIKEN cDNA 2610204G07 gene |
48684 |
0.17 |
chr7_16583787_16584087 | 3.94 |
Gm29443 |
predicted gene 29443 |
29887 |
0.08 |
chr17_26864441_26864592 | 3.93 |
Gm20468 |
predicted gene 20468 |
3095 |
0.13 |
chr4_83206835_83207691 | 3.87 |
Gm11185 |
predicted gene 11185 |
13275 |
0.19 |
chr17_78791500_78791895 | 3.81 |
Heatr5b |
HEAT repeat containing 5B |
4416 |
0.16 |
chr2_164449524_164449675 | 3.78 |
Sdc4 |
syndecan 4 |
5712 |
0.09 |
chr1_185311896_185312216 | 3.76 |
2010103J01Rik |
RIKEN cDNA 2010103J01 gene |
131 |
0.88 |
chrX_72761638_72761789 | 3.76 |
Gabrq |
gamma-aminobutyric acid (GABA) A receptor, subunit theta |
63465 |
0.09 |
chr7_115466804_115467141 | 3.75 |
Sox6 |
SRY (sex determining region Y)-box 6 |
130924 |
0.05 |
chr2_142641897_142642048 | 3.68 |
Kif16b |
kinesin family member 16B |
6791 |
0.27 |
chr8_122036418_122036587 | 3.50 |
Banp |
BTG3 associated nuclear protein |
35655 |
0.12 |
chr11_55405684_55405936 | 3.35 |
Sparc |
secreted acidic cysteine rich glycoprotein |
3645 |
0.2 |
chr4_139432894_139433045 | 3.29 |
Ubr4 |
ubiquitin protein ligase E3 component n-recognin 4 |
2041 |
0.29 |
chr5_43981740_43981912 | 3.28 |
Fgfbp1 |
fibroblast growth factor binding protein 1 |
47 |
0.96 |
chr15_85347412_85347563 | 3.25 |
Gm23517 |
predicted gene, 23517 |
3767 |
0.24 |
chr16_23498930_23499285 | 3.21 |
Gm49514 |
predicted gene, 49514 |
15163 |
0.14 |
chr4_142221224_142221954 | 3.18 |
Kazn |
kazrin, periplakin interacting protein |
11383 |
0.22 |
chr16_4978726_4978909 | 3.17 |
4930451G09Rik |
RIKEN cDNA 4930451G09 gene |
12562 |
0.09 |
chr10_25432432_25432611 | 3.11 |
Epb41l2 |
erythrocyte membrane protein band 4.1 like 2 |
78 |
0.97 |
chr9_62775485_62775741 | 3.00 |
Gm7653 |
predicted gene 7653 |
14291 |
0.17 |
chr10_117042006_117042172 | 2.98 |
Gm10747 |
predicted gene 10747 |
1657 |
0.26 |
chr4_155780948_155781191 | 2.94 |
Tmem88b |
transmembrane protein 88B |
4805 |
0.07 |
chr6_53509175_53509326 | 2.89 |
Creb5 |
cAMP responsive element binding protein 5 |
64050 |
0.12 |
chr6_92468381_92468552 | 2.84 |
Prickle2 |
prickle planar cell polarity protein 2 |
12926 |
0.26 |
chr8_70631552_70631912 | 2.75 |
Gdf15 |
growth differentiation factor 15 |
363 |
0.72 |
chr5_34217838_34218173 | 2.73 |
Gm42848 |
predicted gene 42848 |
3157 |
0.14 |
chr3_95695418_95695636 | 2.72 |
Adamtsl4 |
ADAMTS-like 4 |
7610 |
0.11 |
chr4_97752084_97752245 | 2.69 |
Gm12676 |
predicted gene 12676 |
5225 |
0.23 |
chr4_32890040_32890622 | 2.66 |
Gm11941 |
predicted gene 11941 |
2355 |
0.28 |
chr5_146846682_146846833 | 2.64 |
Rasl11a |
RAS-like, family 11, member A |
992 |
0.43 |
chr14_28010907_28011197 | 2.60 |
Erc2 |
ELKS/RAB6-interacting/CAST family member 2 |
35376 |
0.23 |
chr9_9165529_9165680 | 2.60 |
Gm16833 |
predicted gene, 16833 |
70684 |
0.11 |
chr18_13560776_13561017 | 2.59 |
AC103362.1 |
novel transcript |
40504 |
0.21 |
chr11_109343659_109343810 | 2.57 |
1700096J18Rik |
RIKEN cDNA 1700096J18 gene |
3105 |
0.19 |
chr10_116267458_116267676 | 2.56 |
Ptprb |
protein tyrosine phosphatase, receptor type, B |
7956 |
0.2 |
chr2_32455207_32455358 | 2.55 |
Slc25a25 |
solute carrier family 25 (mitochondrial carrier, phosphate carrier), member 25 |
3837 |
0.12 |
chr3_137940725_137941098 | 2.51 |
Dapp1 |
dual adaptor for phosphotyrosine and 3-phosphoinositides 1 |
13802 |
0.09 |
chr3_97072490_97072737 | 2.51 |
4930573H18Rik |
RIKEN cDNA 4930573H18 gene |
20172 |
0.14 |
chr2_20909530_20909690 | 2.51 |
Arhgap21 |
Rho GTPase activating protein 21 |
5084 |
0.23 |
chr12_32995560_32995750 | 2.49 |
Gm24922 |
predicted gene, 24922 |
4355 |
0.17 |
chr2_35496015_35496166 | 2.44 |
Gm13445 |
predicted gene 13445 |
4571 |
0.15 |
chr4_65813555_65813735 | 2.42 |
Trim32 |
tripartite motif-containing 32 |
208396 |
0.03 |
chr9_71663389_71664022 | 2.39 |
Cgnl1 |
cingulin-like 1 |
15355 |
0.21 |
chr6_122702513_122702906 | 2.37 |
Gm10224 |
predicted pseudogene 10224 |
3681 |
0.14 |
chr5_77129945_77130248 | 2.35 |
Gm15831 |
predicted gene 15831 |
7748 |
0.13 |
chr17_47957975_47958336 | 2.35 |
Gm5228 |
predicted gene 5228 |
22065 |
0.12 |
chr3_79726744_79726895 | 2.30 |
Rxfp1 |
relaxin/insulin-like family peptide receptor 1 |
10975 |
0.19 |
chr4_134156862_134157025 | 2.29 |
Cep85 |
centrosomal protein 85 |
22 |
0.95 |
chr3_27503428_27503579 | 2.28 |
Gm43344 |
predicted gene 43344 |
43138 |
0.17 |
chr16_18705131_18705282 | 2.26 |
Rps2-ps7 |
ribosomal protein S2, pseudogene 7 |
22990 |
0.14 |
chr6_94710006_94710162 | 2.23 |
Lrig1 |
leucine-rich repeats and immunoglobulin-like domains 1 |
9926 |
0.23 |
chr17_44213343_44213499 | 2.21 |
Clic5 |
chloride intracellular channel 5 |
23685 |
0.24 |
chr11_72428738_72428932 | 2.20 |
Ggt6 |
gamma-glutamyltransferase 6 |
6691 |
0.13 |
chr9_59684059_59684343 | 2.20 |
Gramd2 |
GRAM domain containing 2 |
4057 |
0.16 |
chr16_21818710_21818992 | 2.19 |
Map3k13 |
mitogen-activated protein kinase kinase kinase 13 |
7091 |
0.12 |
chr13_56634717_56634868 | 2.19 |
Tgfbi |
transforming growth factor, beta induced |
3579 |
0.25 |
chr2_35582270_35582457 | 2.19 |
Dab2ip |
disabled 2 interacting protein |
477 |
0.81 |
chr1_151236148_151236299 | 2.18 |
Gm24402 |
predicted gene, 24402 |
24691 |
0.11 |
chr2_125667173_125667345 | 2.15 |
Eid1 |
EP300 interacting inhibitor of differentiation 1 |
5836 |
0.2 |
chr7_65388709_65388861 | 2.15 |
Gm44795 |
predicted gene 44795 |
13062 |
0.18 |
chr2_166514481_166514632 | 2.14 |
Gm14267 |
predicted gene 14267 |
1810 |
0.4 |
chr15_97004302_97004609 | 2.13 |
Slc38a4 |
solute carrier family 38, member 4 |
15496 |
0.26 |
chr13_45960285_45960579 | 2.12 |
Atxn1 |
ataxin 1 |
4525 |
0.21 |
chr18_21255157_21255390 | 2.11 |
Garem1 |
GRB2 associated regulator of MAPK1 subtype 1 |
44850 |
0.13 |
chr16_91406926_91407165 | 2.11 |
Il10rb |
interleukin 10 receptor, beta |
601 |
0.6 |
chr13_36097100_36097272 | 2.10 |
Fars2 |
phenylalanine-tRNA synthetase 2 (mitochondrial) |
20226 |
0.16 |
chr14_57753296_57753601 | 2.10 |
Lats2 |
large tumor suppressor 2 |
4940 |
0.14 |
chr7_80445219_80445911 | 2.09 |
Blm |
Bloom syndrome, RecQ like helicase |
11807 |
0.12 |
chr1_60824662_60824820 | 2.07 |
Gm11581 |
predicted gene 11581 |
15625 |
0.12 |
chr10_79988772_79989315 | 2.07 |
Cnn2 |
calponin 2 |
420 |
0.61 |
chr4_120612775_120612947 | 2.07 |
Gm12860 |
predicted gene 12860 |
2979 |
0.2 |
chr19_5827433_5827790 | 2.05 |
Neat1 |
nuclear paraspeckle assembly transcript 1 (non-protein coding) |
401 |
0.66 |
chr8_79068249_79068400 | 2.01 |
Zfp827 |
zinc finger protein 827 |
39737 |
0.15 |
chr3_126737260_126737412 | 2.01 |
Gm42515 |
predicted gene 42515 |
161 |
0.94 |
chr5_12127914_12128278 | 1.95 |
Gm42910 |
predicted gene 42910 |
16865 |
0.19 |
chr5_99339717_99339868 | 1.93 |
Gm35394 |
predicted gene, 35394 |
65697 |
0.12 |
chr16_23058582_23058733 | 1.92 |
Kng1 |
kininogen 1 |
264 |
0.79 |
chr3_69808597_69808748 | 1.92 |
Sptssb |
serine palmitoyltransferase, small subunit B |
51250 |
0.12 |
chr3_51408404_51409520 | 1.91 |
Ndufc1 |
NADH:ubiquinone oxidoreductase subunit C1 |
2 |
0.95 |
chr8_34397835_34398401 | 1.89 |
Gm33831 |
predicted gene, 33831 |
12290 |
0.16 |
chr9_121345573_121345775 | 1.88 |
Gm47092 |
predicted gene, 47092 |
882 |
0.55 |
chr1_77213582_77213738 | 1.88 |
Gm38265 |
predicted gene, 38265 |
66668 |
0.12 |
chr17_71120731_71120895 | 1.86 |
Myom1 |
myomesin 1 |
91 |
0.96 |
chr4_45966218_45966369 | 1.86 |
Tdrd7 |
tudor domain containing 7 |
959 |
0.59 |
chr10_33092534_33092685 | 1.85 |
Trdn |
triadin |
9048 |
0.26 |
chr17_24633284_24633465 | 1.84 |
Nthl1 |
nth (endonuclease III)-like 1 (E.coli) |
655 |
0.34 |
chr14_31408809_31409022 | 1.84 |
Sh3bp5 |
SH3-domain binding protein 5 (BTK-associated) |
1530 |
0.33 |
chr16_30259470_30259621 | 1.83 |
Gm49645 |
predicted gene, 49645 |
4393 |
0.16 |
chr13_99323745_99323902 | 1.80 |
Ptcd2 |
pentatricopeptide repeat domain 2 |
20882 |
0.18 |
chr17_42900854_42901005 | 1.75 |
Cd2ap |
CD2-associated protein |
24264 |
0.24 |
chr12_91963291_91963442 | 1.75 |
Gm21614 |
predicted gene, 21614 |
6211 |
0.2 |
chr1_54829957_54830108 | 1.74 |
Ankrd44 |
ankyrin repeat domain 44 |
16589 |
0.2 |
chr14_16558154_16558318 | 1.72 |
Rarb |
retinoic acid receptor, beta |
16809 |
0.21 |
chr19_54072365_54072516 | 1.71 |
Gm50186 |
predicted gene, 50186 |
12119 |
0.19 |
chr7_122020256_122021011 | 1.71 |
Gga2 |
golgi associated, gamma adaptin ear containing, ARF binding protein 2 |
534 |
0.7 |
chr8_40905669_40905866 | 1.71 |
Slc7a2 |
solute carrier family 7 (cationic amino acid transporter, y+ system), member 2 |
7329 |
0.17 |
chr5_145648340_145648491 | 1.70 |
Cyp3a63-ps |
cytochrome P450, family 3, subfamily a, member 63, pseudogene |
14422 |
0.15 |
chr9_47529664_47530419 | 1.68 |
Cadm1 |
cell adhesion molecule 1 |
132 |
0.96 |
chr14_32509476_32509771 | 1.67 |
Ercc6 |
excision repair cross-complementing rodent repair deficiency, complementation group 6 |
3898 |
0.2 |
chr18_61331814_61332067 | 1.67 |
Pde6a |
phosphodiesterase 6A, cGMP-specific, rod, alpha |
56917 |
0.08 |
chr17_26511994_26512145 | 1.65 |
Dusp1 |
dual specificity phosphatase 1 |
3550 |
0.13 |
chr2_34526490_34527362 | 1.65 |
Gm13408 |
predicted gene 13408 |
38073 |
0.15 |
chr5_77126733_77126884 | 1.65 |
Gm15831 |
predicted gene 15831 |
4460 |
0.15 |
chr13_16715662_16715820 | 1.64 |
Gm7537 |
predicted gene 7537 |
76251 |
0.11 |
chr2_50419752_50419903 | 1.64 |
Gm13486 |
predicted gene 13486 |
10495 |
0.22 |
chr16_22542946_22543153 | 1.63 |
Gm49565 |
predicted gene, 49565 |
2576 |
0.17 |
chr8_85386352_85386514 | 1.61 |
Mylk3 |
myosin light chain kinase 3 |
88 |
0.96 |
chr5_114146874_114147025 | 1.61 |
Acacb |
acetyl-Coenzyme A carboxylase beta |
414 |
0.75 |
chr15_93744240_93744451 | 1.60 |
Gm30339 |
predicted gene, 30339 |
9932 |
0.21 |
chr6_51333845_51334059 | 1.59 |
Gm6559 |
predicted gene 6559 |
45758 |
0.12 |
chr12_55446416_55447473 | 1.59 |
Psma6 |
proteasome subunit alpha 6 |
39561 |
0.11 |
chr11_96969209_96969687 | 1.59 |
Sp2 |
Sp2 transcription factor |
783 |
0.43 |
chr10_70166527_70166678 | 1.58 |
Ccdc6 |
coiled-coil domain containing 6 |
7907 |
0.23 |
chr19_9027902_9028237 | 1.54 |
Ahnak |
AHNAK nucleoprotein (desmoyokin) |
28409 |
0.09 |
chr11_86603943_86604094 | 1.54 |
Vmp1 |
vacuole membrane protein 1 |
1723 |
0.3 |
chr7_121075217_121075402 | 1.53 |
Mettl9 |
methyltransferase like 9 |
22 |
0.92 |
chr14_57035004_57035538 | 1.53 |
B020004C17Rik |
RIKEN cDNA B020004C17 gene |
20137 |
0.15 |
chr12_73408241_73408392 | 1.52 |
D830013O20Rik |
RIKEN cDNA D830013O20 gene |
1241 |
0.44 |
chr5_134644858_134645082 | 1.48 |
Eif4h |
eukaryotic translation initiation factor 4H |
5480 |
0.13 |
chr5_31931244_31931395 | 1.47 |
Gm43811 |
predicted gene 43811 |
4622 |
0.27 |
chr13_28738828_28739005 | 1.47 |
Mir6368 |
microRNA 6368 |
28043 |
0.21 |
chr14_62878156_62878444 | 1.46 |
n-R5s47 |
nuclear encoded rRNA 5S 47 |
8586 |
0.14 |
chr11_98874014_98874222 | 1.44 |
Gm23640 |
predicted gene, 23640 |
3619 |
0.13 |
chr17_35917836_35918372 | 1.44 |
Mir1894 |
microRNA 1894 |
215 |
0.72 |
chr1_168502263_168502495 | 1.41 |
Mir6348 |
microRNA 6348 |
11736 |
0.27 |
chr16_18594050_18594201 | 1.41 |
4930588K23Rik |
RIKEN cDNA 4930588K23 gene |
2133 |
0.2 |
chr5_144248241_144248469 | 1.41 |
2900089D17Rik |
RIKEN cDNA 2900089D17 gene |
1849 |
0.23 |
chr3_68508629_68508947 | 1.40 |
Schip1 |
schwannomin interacting protein 1 |
14580 |
0.22 |
chr17_45987935_45988089 | 1.40 |
Gm49805 |
predicted gene, 49805 |
26153 |
0.14 |
chr15_99084260_99084606 | 1.39 |
Troap |
trophinin associated protein |
1601 |
0.18 |
chr6_30528830_30529010 | 1.38 |
Cpa2 |
carboxypeptidase A2, pancreatic |
12662 |
0.12 |
chr10_60269559_60269710 | 1.38 |
Psap |
prosaposin |
7993 |
0.19 |
chr4_117835051_117836181 | 1.36 |
Slc6a9 |
solute carrier family 6 (neurotransmitter transporter, glycine), member 9 |
178 |
0.91 |
chr4_149327381_149327548 | 1.36 |
Ube4b |
ubiquitination factor E4B |
4368 |
0.14 |
chrX_52372264_52372415 | 1.35 |
Mir6384 |
microRNA 6384 |
5842 |
0.25 |
chr8_36714054_36714221 | 1.34 |
Dlc1 |
deleted in liver cancer 1 |
18917 |
0.27 |
chr4_116894849_116895006 | 1.34 |
Gm26355 |
predicted gene, 26355 |
9710 |
0.09 |
chr4_89445910_89446091 | 1.33 |
Gm12608 |
predicted gene 12608 |
1356 |
0.46 |
chr13_14088703_14089136 | 1.32 |
Gm26129 |
predicted gene, 26129 |
1480 |
0.31 |
chr5_136394928_136395103 | 1.32 |
Mir721 |
microRNA 721 |
19212 |
0.16 |
chr12_17440410_17440594 | 1.32 |
Gm36752 |
predicted gene, 36752 |
3884 |
0.24 |
chr13_81352350_81352692 | 1.32 |
Adgrv1 |
adhesion G protein-coupled receptor V1 |
895 |
0.71 |
chr13_119613872_119614873 | 1.31 |
Gm48265 |
predicted gene, 48265 |
900 |
0.48 |
chr2_9970678_9970952 | 1.31 |
Taf3 |
TATA-box binding protein associated factor 3 |
17158 |
0.14 |
chr13_52037283_52037591 | 1.30 |
Gm37872 |
predicted gene, 37872 |
15510 |
0.21 |
chr7_107755997_107756148 | 1.30 |
Cyb5r2 |
cytochrome b5 reductase 2 |
1924 |
0.22 |
chr3_89113073_89113337 | 1.29 |
Gm29704 |
predicted gene, 29704 |
3519 |
0.09 |
chr4_136138962_136139113 | 1.28 |
Gm26001 |
predicted gene, 26001 |
1541 |
0.29 |
chr11_97682543_97682929 | 1.28 |
Cisd3 |
CDGSH iron sulfur domain 3 |
3090 |
0.1 |
chr7_142459385_142459826 | 1.27 |
Lsp1 |
lymphocyte specific 1 |
1204 |
0.3 |
chr2_36172438_36172589 | 1.27 |
Mrrf |
mitochondrial ribosome recycling factor |
25410 |
0.1 |
chr12_77151612_77151767 | 1.27 |
Gm22696 |
predicted gene, 22696 |
35257 |
0.17 |
chr8_36159018_36159251 | 1.27 |
Gm38414 |
predicted gene, 38414 |
345 |
0.85 |
chr8_26352467_26353019 | 1.26 |
Gm31784 |
predicted gene, 31784 |
40409 |
0.11 |
chr5_88711650_88711977 | 1.26 |
Mob1b |
MOB kinase activator 1B |
9042 |
0.16 |
chr13_56112615_56112776 | 1.25 |
Macroh2a1 |
macroH2A.1 histone |
22130 |
0.16 |
chr3_132831269_132831452 | 1.25 |
Gm9403 |
predicted gene 9403 |
11036 |
0.14 |
chr1_153278361_153278512 | 1.25 |
Gm38009 |
predicted gene, 38009 |
8754 |
0.18 |
chr1_91058255_91058406 | 1.24 |
Lrrfip1 |
leucine rich repeat (in FLII) interacting protein 1 |
4744 |
0.23 |
chr8_10501879_10502030 | 1.23 |
5330413D20Rik |
RIKEN cDNA 5330413D20 gene |
174959 |
0.03 |
chr11_79710875_79711409 | 1.23 |
Mir193a |
microRNA 193a |
827 |
0.5 |
chr18_44473059_44473270 | 1.23 |
Mcc |
mutated in colorectal cancers |
46352 |
0.16 |
chr9_106345236_106345430 | 1.23 |
Gm29123 |
predicted gene 29123 |
9500 |
0.12 |
chr1_190106720_190107128 | 1.23 |
Gm28172 |
predicted gene 28172 |
61746 |
0.11 |
chr19_45787512_45787663 | 1.22 |
Oga |
O-GlcNAcase |
3750 |
0.17 |
chr17_26382840_26382991 | 1.21 |
Neurl1b |
neuralized E3 ubiquitin protein ligase 1B |
31914 |
0.11 |
chr2_145822470_145822698 | 1.21 |
Rin2 |
Ras and Rab interactor 2 |
295 |
0.92 |
chr6_30300388_30301283 | 1.20 |
Ube2h |
ubiquitin-conjugating enzyme E2H |
3687 |
0.18 |
chr11_78986846_78986997 | 1.19 |
Lgals9 |
lectin, galactose binding, soluble 9 |
1975 |
0.31 |
chr3_38254908_38255074 | 1.19 |
Gm2965 |
predicted gene 2965 |
31540 |
0.17 |
chr5_28055448_28055803 | 1.19 |
Gm26608 |
predicted gene, 26608 |
166 |
0.94 |
chr13_96387644_96388785 | 1.18 |
Poc5 |
POC5 centriolar protein |
80 |
0.97 |
chr13_30031781_30032211 | 1.18 |
Gm11368 |
predicted gene 11368 |
26681 |
0.16 |
chr1_156667254_156667741 | 1.17 |
Tor3a |
torsin family 3, member A |
767 |
0.6 |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.8 | 2.5 | GO:0010735 | positive regulation of transcription via serum response element binding(GO:0010735) |
0.7 | 2.1 | GO:2000599 | regulation of cyclin catabolic process(GO:2000598) negative regulation of cyclin catabolic process(GO:2000599) |
0.5 | 1.6 | GO:0009826 | unidimensional cell growth(GO:0009826) |
0.5 | 1.6 | GO:0048769 | sarcomerogenesis(GO:0048769) |
0.5 | 3.1 | GO:0045743 | positive regulation of fibroblast growth factor receptor signaling pathway(GO:0045743) |
0.5 | 2.3 | GO:0046602 | regulation of mitotic centrosome separation(GO:0046602) |
0.3 | 2.2 | GO:0035735 | intraciliary transport involved in cilium morphogenesis(GO:0035735) |
0.3 | 0.8 | GO:0006543 | glutamine catabolic process(GO:0006543) |
0.3 | 0.8 | GO:0086017 | Purkinje myocyte action potential(GO:0086017) |
0.3 | 0.8 | GO:2000645 | negative regulation of receptor catabolic process(GO:2000645) |
0.3 | 1.3 | GO:0036233 | glycine import(GO:0036233) |
0.2 | 1.0 | GO:0006987 | activation of signaling protein activity involved in unfolded protein response(GO:0006987) |
0.2 | 0.7 | GO:0036216 | response to stem cell factor(GO:0036215) cellular response to stem cell factor stimulus(GO:0036216) Kit signaling pathway(GO:0038109) |
0.2 | 0.7 | GO:0006285 | base-excision repair, AP site formation(GO:0006285) |
0.2 | 0.9 | GO:0006549 | isoleucine metabolic process(GO:0006549) |
0.2 | 0.2 | GO:0019747 | regulation of isoprenoid metabolic process(GO:0019747) |
0.2 | 1.1 | GO:0031999 | negative regulation of fatty acid beta-oxidation(GO:0031999) |
0.2 | 0.4 | GO:0032911 | negative regulation of transforming growth factor beta1 production(GO:0032911) |
0.2 | 0.9 | GO:1900194 | negative regulation of oocyte maturation(GO:1900194) |
0.2 | 0.5 | GO:1904059 | regulation of locomotor rhythm(GO:1904059) |
0.2 | 0.9 | GO:0048496 | maintenance of organ identity(GO:0048496) |
0.2 | 0.5 | GO:0044860 | protein localization to plasma membrane raft(GO:0044860) |
0.2 | 0.7 | GO:2000491 | positive regulation of hepatic stellate cell activation(GO:2000491) |
0.2 | 0.5 | GO:0090158 | endoplasmic reticulum membrane organization(GO:0090158) |
0.2 | 0.5 | GO:0043578 | nuclear matrix organization(GO:0043578) nuclear matrix anchoring at nuclear membrane(GO:0090292) |
0.2 | 0.5 | GO:0035860 | glial cell-derived neurotrophic factor receptor signaling pathway(GO:0035860) |
0.1 | 0.4 | GO:0051684 | maintenance of Golgi location(GO:0051684) |
0.1 | 0.6 | GO:0036484 | trunk segmentation(GO:0035290) trunk neural crest cell migration(GO:0036484) ventral trunk neural crest cell migration(GO:0036486) sympathetic neuron projection extension(GO:0097490) sympathetic neuron projection guidance(GO:0097491) |
0.1 | 1.6 | GO:0030575 | nuclear body organization(GO:0030575) |
0.1 | 0.4 | GO:0060618 | nipple development(GO:0060618) |
0.1 | 0.4 | GO:0072566 | chemokine (C-X-C motif) ligand 1 production(GO:0072566) regulation of chemokine (C-X-C motif) ligand 1 production(GO:2000338) |
0.1 | 0.5 | GO:2000741 | positive regulation of mesenchymal stem cell differentiation(GO:2000741) |
0.1 | 2.5 | GO:1901741 | positive regulation of myoblast fusion(GO:1901741) |
0.1 | 0.6 | GO:0061635 | regulation of protein complex stability(GO:0061635) |
0.1 | 0.4 | GO:1990036 | calcium ion import into sarcoplasmic reticulum(GO:1990036) |
0.1 | 0.6 | GO:0090286 | cytoskeletal anchoring at nuclear membrane(GO:0090286) |
0.1 | 0.4 | GO:0043321 | regulation of natural killer cell degranulation(GO:0043321) |
0.1 | 0.5 | GO:0043415 | positive regulation of skeletal muscle tissue regeneration(GO:0043415) |
0.1 | 0.4 | GO:0035694 | mitochondrial protein catabolic process(GO:0035694) |
0.1 | 0.3 | GO:0016095 | polyprenol catabolic process(GO:0016095) |
0.1 | 1.1 | GO:0042511 | positive regulation of tyrosine phosphorylation of Stat1 protein(GO:0042511) |
0.1 | 0.6 | GO:0060982 | coronary artery morphogenesis(GO:0060982) |
0.1 | 0.3 | GO:0006701 | progesterone biosynthetic process(GO:0006701) |
0.1 | 1.0 | GO:0048671 | negative regulation of collateral sprouting(GO:0048671) |
0.1 | 0.2 | GO:0034137 | positive regulation of toll-like receptor 2 signaling pathway(GO:0034137) |
0.1 | 1.6 | GO:0006895 | Golgi to endosome transport(GO:0006895) |
0.1 | 0.2 | GO:0010909 | regulation of heparan sulfate proteoglycan biosynthetic process(GO:0010908) positive regulation of heparan sulfate proteoglycan biosynthetic process(GO:0010909) positive regulation of proteoglycan biosynthetic process(GO:1902730) |
0.1 | 0.5 | GO:0070940 | dephosphorylation of RNA polymerase II C-terminal domain(GO:0070940) |
0.1 | 0.3 | GO:0001827 | inner cell mass cell fate commitment(GO:0001827) |
0.1 | 0.3 | GO:0018197 | peptidyl-aspartic acid modification(GO:0018197) |
0.1 | 0.2 | GO:0008626 | granzyme-mediated apoptotic signaling pathway(GO:0008626) |
0.1 | 0.5 | GO:2001286 | regulation of caveolin-mediated endocytosis(GO:2001286) |
0.1 | 0.4 | GO:0015819 | lysine transport(GO:0015819) |
0.1 | 0.4 | GO:0007016 | cytoskeletal anchoring at plasma membrane(GO:0007016) |
0.1 | 2.5 | GO:0030866 | cortical actin cytoskeleton organization(GO:0030866) |
0.1 | 0.3 | GO:1904694 | negative regulation of vascular smooth muscle contraction(GO:1904694) |
0.1 | 0.3 | GO:1903265 | positive regulation of tumor necrosis factor-mediated signaling pathway(GO:1903265) |
0.1 | 1.2 | GO:0045943 | positive regulation of transcription from RNA polymerase I promoter(GO:0045943) |
0.1 | 0.1 | GO:0048382 | mesendoderm development(GO:0048382) |
0.1 | 0.3 | GO:0050717 | positive regulation of interleukin-1 alpha secretion(GO:0050717) |
0.1 | 0.3 | GO:0006566 | threonine metabolic process(GO:0006566) |
0.1 | 0.3 | GO:1901844 | regulation of cell communication by electrical coupling involved in cardiac conduction(GO:1901844) |
0.1 | 0.3 | GO:0006362 | transcription elongation from RNA polymerase I promoter(GO:0006362) |
0.1 | 0.3 | GO:0006432 | phenylalanyl-tRNA aminoacylation(GO:0006432) |
0.1 | 0.5 | GO:0032049 | cardiolipin biosynthetic process(GO:0032049) |
0.1 | 1.3 | GO:0050765 | negative regulation of phagocytosis(GO:0050765) |
0.1 | 0.2 | GO:1903999 | negative regulation of eating behavior(GO:1903999) |
0.1 | 0.5 | GO:0090557 | establishment of endothelial intestinal barrier(GO:0090557) |
0.1 | 0.2 | GO:0007529 | establishment of synaptic specificity at neuromuscular junction(GO:0007529) |
0.1 | 0.3 | GO:0045950 | negative regulation of mitotic recombination(GO:0045950) |
0.1 | 0.1 | GO:1902075 | cellular response to salt(GO:1902075) |
0.1 | 0.2 | GO:0006059 | hexitol metabolic process(GO:0006059) |
0.1 | 0.2 | GO:0006435 | threonyl-tRNA aminoacylation(GO:0006435) |
0.1 | 0.3 | GO:0090666 | scaRNA localization to Cajal body(GO:0090666) |
0.1 | 0.4 | GO:0051610 | serotonin uptake(GO:0051610) |
0.1 | 0.4 | GO:0006642 | triglyceride mobilization(GO:0006642) |
0.1 | 0.2 | GO:0038108 | negative regulation of appetite by leptin-mediated signaling pathway(GO:0038108) |
0.1 | 0.2 | GO:0043490 | malate-aspartate shuttle(GO:0043490) |
0.1 | 0.3 | GO:0060480 | lung goblet cell differentiation(GO:0060480) |
0.1 | 0.3 | GO:0042663 | regulation of endodermal cell fate specification(GO:0042663) |
0.1 | 0.8 | GO:0060391 | positive regulation of SMAD protein import into nucleus(GO:0060391) |
0.1 | 0.4 | GO:0051639 | actin filament network formation(GO:0051639) |
0.1 | 0.4 | GO:2000096 | positive regulation of Wnt signaling pathway, planar cell polarity pathway(GO:2000096) |
0.1 | 0.1 | GO:0003383 | apical constriction(GO:0003383) |
0.1 | 0.5 | GO:0090085 | regulation of protein deubiquitination(GO:0090085) |
0.1 | 0.1 | GO:0055005 | ventricular cardiac myofibril assembly(GO:0055005) |
0.1 | 1.1 | GO:0061099 | negative regulation of protein tyrosine kinase activity(GO:0061099) |
0.1 | 0.3 | GO:0098535 | de novo centriole assembly(GO:0098535) |
0.1 | 0.1 | GO:0021559 | trigeminal nerve development(GO:0021559) |
0.1 | 0.1 | GO:0042322 | negative regulation of circadian sleep/wake cycle, REM sleep(GO:0042322) |
0.1 | 0.4 | GO:0090527 | actin filament reorganization(GO:0090527) |
0.1 | 0.5 | GO:0045618 | positive regulation of keratinocyte differentiation(GO:0045618) |
0.1 | 0.1 | GO:0071688 | skeletal muscle myosin thick filament assembly(GO:0030241) striated muscle myosin thick filament assembly(GO:0071688) |
0.1 | 0.2 | GO:0060743 | epithelial cell maturation involved in prostate gland development(GO:0060743) |
0.1 | 0.2 | GO:0050955 | thermoception(GO:0050955) |
0.1 | 0.4 | GO:0042866 | pyruvate biosynthetic process(GO:0042866) |
0.1 | 0.2 | GO:0035696 | monocyte extravasation(GO:0035696) regulation of monocyte extravasation(GO:2000437) |
0.1 | 0.3 | GO:2000210 | positive regulation of anoikis(GO:2000210) |
0.1 | 0.2 | GO:1902036 | regulation of hematopoietic stem cell differentiation(GO:1902036) |
0.1 | 0.7 | GO:0060088 | auditory receptor cell stereocilium organization(GO:0060088) |
0.1 | 0.2 | GO:1903223 | positive regulation of oxidative stress-induced neuron death(GO:1903223) |
0.1 | 0.3 | GO:0046643 | regulation of gamma-delta T cell differentiation(GO:0045586) regulation of gamma-delta T cell activation(GO:0046643) |
0.1 | 0.2 | GO:0003062 | regulation of heart rate by chemical signal(GO:0003062) |
0.1 | 0.7 | GO:0051601 | exocyst localization(GO:0051601) |
0.1 | 0.2 | GO:0046813 | receptor-mediated virion attachment to host cell(GO:0046813) |
0.1 | 0.3 | GO:0042796 | snRNA transcription from RNA polymerase III promoter(GO:0042796) |
0.1 | 0.3 | GO:0035360 | positive regulation of peroxisome proliferator activated receptor signaling pathway(GO:0035360) |
0.1 | 0.4 | GO:0032808 | lacrimal gland development(GO:0032808) |
0.1 | 0.2 | GO:0035864 | response to potassium ion(GO:0035864) cellular response to potassium ion(GO:0035865) |
0.1 | 0.4 | GO:0060742 | epithelial cell differentiation involved in prostate gland development(GO:0060742) |
0.1 | 0.6 | GO:0003148 | outflow tract septum morphogenesis(GO:0003148) |
0.1 | 0.2 | GO:0032696 | negative regulation of interleukin-13 production(GO:0032696) |
0.1 | 1.0 | GO:0030488 | tRNA methylation(GO:0030488) |
0.1 | 1.1 | GO:0002089 | lens morphogenesis in camera-type eye(GO:0002089) |
0.1 | 0.3 | GO:0006824 | cobalt ion transport(GO:0006824) |
0.1 | 0.2 | GO:0038044 | transforming growth factor-beta secretion(GO:0038044) regulation of transforming growth factor-beta secretion(GO:2001201) |
0.1 | 0.5 | GO:1902287 | semaphorin-plexin signaling pathway involved in neuron projection guidance(GO:1902285) semaphorin-plexin signaling pathway involved in axon guidance(GO:1902287) |
0.1 | 0.8 | GO:0015858 | nucleoside transport(GO:0015858) |
0.1 | 0.2 | GO:2000065 | negative regulation of aldosterone metabolic process(GO:0032345) negative regulation of aldosterone biosynthetic process(GO:0032348) negative regulation of cortisol biosynthetic process(GO:2000065) |
0.1 | 0.2 | GO:0072656 | maintenance of protein location in mitochondrion(GO:0072656) |
0.1 | 0.3 | GO:0007042 | lysosomal lumen acidification(GO:0007042) |
0.1 | 0.1 | GO:0009301 | snRNA transcription(GO:0009301) snRNA transcription from RNA polymerase II promoter(GO:0042795) |
0.1 | 0.2 | GO:0031581 | hemidesmosome assembly(GO:0031581) |
0.1 | 0.2 | GO:0072386 | plus-end-directed vesicle transport along microtubule(GO:0072383) plus-end-directed organelle transport along microtubule(GO:0072386) |
0.1 | 0.1 | GO:0002439 | chronic inflammatory response to antigenic stimulus(GO:0002439) |
0.1 | 0.2 | GO:0032474 | otolith morphogenesis(GO:0032474) |
0.1 | 0.3 | GO:0002227 | innate immune response in mucosa(GO:0002227) |
0.1 | 0.1 | GO:0045590 | negative regulation of regulatory T cell differentiation(GO:0045590) |
0.0 | 0.3 | GO:0031584 | activation of phospholipase D activity(GO:0031584) |
0.0 | 0.3 | GO:0003376 | sphingosine-1-phosphate signaling pathway(GO:0003376) |
0.0 | 0.1 | GO:1903237 | negative regulation of leukocyte tethering or rolling(GO:1903237) |
0.0 | 0.1 | GO:0048371 | lateral mesoderm morphogenesis(GO:0048369) lateral mesoderm formation(GO:0048370) lateral mesodermal cell differentiation(GO:0048371) |
0.0 | 0.1 | GO:0038128 | ERBB2 signaling pathway(GO:0038128) |
0.0 | 0.1 | GO:0048625 | myoblast fate commitment(GO:0048625) |
0.0 | 0.2 | GO:0034239 | regulation of macrophage fusion(GO:0034239) |
0.0 | 0.2 | GO:0061087 | positive regulation of histone H3-K27 methylation(GO:0061087) |
0.0 | 0.1 | GO:0001880 | Mullerian duct regression(GO:0001880) |
0.0 | 0.2 | GO:0006348 | chromatin silencing at telomere(GO:0006348) |
0.0 | 0.8 | GO:0051205 | protein insertion into membrane(GO:0051205) |
0.0 | 0.2 | GO:1904659 | glucose transmembrane transport(GO:1904659) |
0.0 | 0.2 | GO:1903964 | monounsaturated fatty acid metabolic process(GO:1903964) monounsaturated fatty acid biosynthetic process(GO:1903966) |
0.0 | 0.1 | GO:0042938 | dipeptide transport(GO:0042938) |
0.0 | 0.3 | GO:2000480 | negative regulation of cAMP-dependent protein kinase activity(GO:2000480) |
0.0 | 0.5 | GO:0000479 | endonucleolytic cleavage of tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000479) |
0.0 | 0.1 | GO:0042536 | negative regulation of tumor necrosis factor biosynthetic process(GO:0042536) |
0.0 | 0.2 | GO:0051031 | tRNA transport(GO:0051031) |
0.0 | 0.1 | GO:0038161 | prolactin signaling pathway(GO:0038161) |
0.0 | 0.1 | GO:1901552 | positive regulation of endothelial cell development(GO:1901552) positive regulation of establishment of endothelial barrier(GO:1903142) |
0.0 | 0.6 | GO:0035024 | negative regulation of Rho protein signal transduction(GO:0035024) |
0.0 | 0.3 | GO:0097062 | dendritic spine maintenance(GO:0097062) |
0.0 | 0.2 | GO:0070086 | ubiquitin-dependent endocytosis(GO:0070086) |
0.0 | 0.1 | GO:0021776 | smoothened signaling pathway involved in ventral spinal cord interneuron specification(GO:0021775) smoothened signaling pathway involved in spinal cord motor neuron cell fate specification(GO:0021776) |
0.0 | 0.1 | GO:1904431 | positive regulation of t-circle formation(GO:1904431) |
0.0 | 0.1 | GO:0036289 | peptidyl-serine autophosphorylation(GO:0036289) |
0.0 | 0.1 | GO:0090071 | regulation of ribosome biogenesis(GO:0090069) negative regulation of ribosome biogenesis(GO:0090071) |
0.0 | 0.1 | GO:0060700 | regulation of ribonuclease activity(GO:0060700) |
0.0 | 0.1 | GO:0044598 | polyketide metabolic process(GO:0030638) aminoglycoside antibiotic metabolic process(GO:0030647) daunorubicin metabolic process(GO:0044597) doxorubicin metabolic process(GO:0044598) |
0.0 | 0.1 | GO:2000653 | regulation of genetic imprinting(GO:2000653) |
0.0 | 0.8 | GO:0006883 | cellular sodium ion homeostasis(GO:0006883) |
0.0 | 0.2 | GO:0043456 | regulation of pentose-phosphate shunt(GO:0043456) |
0.0 | 0.6 | GO:0044130 | negative regulation of growth of symbiont in host(GO:0044130) negative regulation of growth of symbiont involved in interaction with host(GO:0044146) |
0.0 | 0.2 | GO:1903553 | positive regulation of extracellular exosome assembly(GO:1903553) |
0.0 | 0.0 | GO:0006975 | DNA damage induced protein phosphorylation(GO:0006975) |
0.0 | 0.2 | GO:1901525 | negative regulation of macromitophagy(GO:1901525) negative regulation of mitophagy(GO:1903147) |
0.0 | 0.2 | GO:1903799 | negative regulation of production of miRNAs involved in gene silencing by miRNA(GO:1903799) |
0.0 | 0.1 | GO:0034628 | nicotinamide nucleotide biosynthetic process from aspartate(GO:0019355) 'de novo' NAD biosynthetic process from aspartate(GO:0034628) |
0.0 | 0.1 | GO:0045852 | pH elevation(GO:0045852) intracellular pH elevation(GO:0051454) |
0.0 | 0.1 | GO:0007228 | signal transduction downstream of smoothened(GO:0007227) positive regulation of hh target transcription factor activity(GO:0007228) |
0.0 | 0.1 | GO:0035964 | COPI-coated vesicle budding(GO:0035964) |
0.0 | 0.2 | GO:0097039 | protein linear polyubiquitination(GO:0097039) |
0.0 | 0.1 | GO:0009730 | detection of carbohydrate stimulus(GO:0009730) detection of hexose stimulus(GO:0009732) detection of monosaccharide stimulus(GO:0034287) detection of glucose(GO:0051594) |
0.0 | 0.1 | GO:0036151 | phosphatidylcholine acyl-chain remodeling(GO:0036151) |
0.0 | 0.1 | GO:0001712 | ectodermal cell fate commitment(GO:0001712) |
0.0 | 0.3 | GO:0006490 | oligosaccharide-lipid intermediate biosynthetic process(GO:0006490) |
0.0 | 0.2 | GO:0032825 | positive regulation of natural killer cell differentiation(GO:0032825) |
0.0 | 0.1 | GO:1901301 | regulation of cargo loading into COPII-coated vesicle(GO:1901301) |
0.0 | 0.5 | GO:0009143 | nucleoside triphosphate catabolic process(GO:0009143) |
0.0 | 0.1 | GO:0016264 | gap junction assembly(GO:0016264) |
0.0 | 0.3 | GO:0051457 | maintenance of protein location in nucleus(GO:0051457) |
0.0 | 0.1 | GO:0046499 | S-adenosylmethioninamine metabolic process(GO:0046499) |
0.0 | 0.1 | GO:1904354 | negative regulation of telomere capping(GO:1904354) |
0.0 | 0.1 | GO:2000562 | negative regulation of CD4-positive, alpha-beta T cell proliferation(GO:2000562) |
0.0 | 0.9 | GO:0001937 | negative regulation of endothelial cell proliferation(GO:0001937) |
0.0 | 0.0 | GO:0002036 | regulation of L-glutamate transport(GO:0002036) |
0.0 | 0.0 | GO:0035701 | hematopoietic stem cell migration(GO:0035701) |
0.0 | 0.2 | GO:0010815 | bradykinin catabolic process(GO:0010815) |
0.0 | 0.1 | GO:2000169 | regulation of peptidyl-cysteine S-nitrosylation(GO:2000169) |
0.0 | 0.1 | GO:0002727 | natural killer cell cytokine production(GO:0002370) regulation of natural killer cell cytokine production(GO:0002727) |
0.0 | 0.1 | GO:0070307 | lens fiber cell development(GO:0070307) |
0.0 | 0.2 | GO:0032486 | Rap protein signal transduction(GO:0032486) |
0.0 | 0.2 | GO:0031282 | regulation of guanylate cyclase activity(GO:0031282) |
0.0 | 0.1 | GO:0044854 | plasma membrane raft assembly(GO:0044854) plasma membrane raft organization(GO:0044857) caveola assembly(GO:0070836) |
0.0 | 0.1 | GO:2001185 | regulation of CD8-positive, alpha-beta T cell activation(GO:2001185) |
0.0 | 0.2 | GO:1902459 | positive regulation of stem cell population maintenance(GO:1902459) |
0.0 | 0.1 | GO:0045085 | negative regulation of interleukin-2 biosynthetic process(GO:0045085) |
0.0 | 0.1 | GO:0035405 | histone-threonine phosphorylation(GO:0035405) |
0.0 | 0.1 | GO:0070126 | mitochondrial translational termination(GO:0070126) |
0.0 | 0.1 | GO:0048936 | peripheral nervous system neuron axonogenesis(GO:0048936) |
0.0 | 0.2 | GO:0000055 | ribosomal large subunit export from nucleus(GO:0000055) |
0.0 | 0.7 | GO:0045197 | establishment or maintenance of epithelial cell apical/basal polarity(GO:0045197) |
0.0 | 0.2 | GO:0002756 | MyD88-independent toll-like receptor signaling pathway(GO:0002756) |
0.0 | 0.1 | GO:0010040 | response to iron(II) ion(GO:0010040) |
0.0 | 0.1 | GO:0070278 | extracellular matrix constituent secretion(GO:0070278) |
0.0 | 0.3 | GO:2000194 | regulation of female gonad development(GO:2000194) |
0.0 | 0.2 | GO:0097500 | receptor localization to nonmotile primary cilium(GO:0097500) |
0.0 | 1.1 | GO:0045744 | negative regulation of G-protein coupled receptor protein signaling pathway(GO:0045744) |
0.0 | 0.1 | GO:0070427 | nucleotide-binding oligomerization domain containing 1 signaling pathway(GO:0070427) |
0.0 | 0.1 | GO:0045163 | clustering of voltage-gated potassium channels(GO:0045163) |
0.0 | 0.2 | GO:0030853 | negative regulation of granulocyte differentiation(GO:0030853) |
0.0 | 0.1 | GO:0097195 | pilomotor reflex(GO:0097195) |
0.0 | 0.2 | GO:1901678 | iron coordination entity transport(GO:1901678) |
0.0 | 0.3 | GO:0006750 | glutathione biosynthetic process(GO:0006750) |
0.0 | 0.1 | GO:0018076 | N-terminal peptidyl-lysine acetylation(GO:0018076) |
0.0 | 0.3 | GO:0060252 | positive regulation of glial cell proliferation(GO:0060252) |
0.0 | 0.0 | GO:0060638 | mesenchymal-epithelial cell signaling(GO:0060638) |
0.0 | 0.2 | GO:0045625 | regulation of T-helper 1 cell differentiation(GO:0045625) |
0.0 | 0.1 | GO:1901535 | regulation of DNA demethylation(GO:1901535) negative regulation of DNA demethylation(GO:1901536) |
0.0 | 0.1 | GO:0035992 | tendon cell differentiation(GO:0035990) tendon formation(GO:0035992) |
0.0 | 0.1 | GO:1990086 | lens fiber cell apoptotic process(GO:1990086) |
0.0 | 0.1 | GO:0034975 | protein folding in endoplasmic reticulum(GO:0034975) |
0.0 | 0.1 | GO:0039692 | single stranded viral RNA replication via double stranded DNA intermediate(GO:0039692) |
0.0 | 0.1 | GO:0070345 | negative regulation of fat cell proliferation(GO:0070345) |
0.0 | 0.2 | GO:1901223 | negative regulation of NIK/NF-kappaB signaling(GO:1901223) |
0.0 | 0.1 | GO:0014012 | peripheral nervous system axon regeneration(GO:0014012) |
0.0 | 0.0 | GO:0022009 | central nervous system vasculogenesis(GO:0022009) |
0.0 | 0.1 | GO:0070141 | response to UV-A(GO:0070141) |
0.0 | 0.1 | GO:0060375 | mast cell differentiation(GO:0060374) regulation of mast cell differentiation(GO:0060375) |
0.0 | 0.0 | GO:0045168 | cell-cell signaling involved in cell fate commitment(GO:0045168) negative regulation of auditory receptor cell differentiation(GO:0045608) |
0.0 | 0.7 | GO:0046580 | negative regulation of Ras protein signal transduction(GO:0046580) |
0.0 | 0.1 | GO:0007296 | vitellogenesis(GO:0007296) |
0.0 | 0.1 | GO:0061162 | establishment of monopolar cell polarity(GO:0061162) establishment or maintenance of monopolar cell polarity(GO:0061339) |
0.0 | 0.1 | GO:0060100 | positive regulation of phagocytosis, engulfment(GO:0060100) positive regulation of membrane invagination(GO:1905155) |
0.0 | 0.1 | GO:0051126 | negative regulation of actin nucleation(GO:0051126) |
0.0 | 0.1 | GO:0035461 | vitamin transmembrane transport(GO:0035461) |
0.0 | 0.0 | GO:0060591 | chondroblast differentiation(GO:0060591) |
0.0 | 0.1 | GO:0034773 | histone H4-K20 trimethylation(GO:0034773) |
0.0 | 0.1 | GO:0021825 | substrate-dependent cerebral cortex tangential migration(GO:0021825) |
0.0 | 0.1 | GO:2000384 | regulation of ectoderm development(GO:2000383) negative regulation of ectoderm development(GO:2000384) |
0.0 | 1.2 | GO:0042311 | vasodilation(GO:0042311) |
0.0 | 0.1 | GO:0010760 | negative regulation of macrophage chemotaxis(GO:0010760) |
0.0 | 0.1 | GO:0002414 | immunoglobulin transcytosis in epithelial cells(GO:0002414) |
0.0 | 0.1 | GO:0021555 | midbrain-hindbrain boundary morphogenesis(GO:0021555) |
0.0 | 0.1 | GO:1903116 | positive regulation of actin filament-based movement(GO:1903116) |
0.0 | 0.1 | GO:0051764 | actin crosslink formation(GO:0051764) |
0.0 | 0.1 | GO:0014719 | skeletal muscle satellite cell activation(GO:0014719) |
0.0 | 0.1 | GO:2000489 | regulation of hepatic stellate cell activation(GO:2000489) |
0.0 | 0.7 | GO:1901998 | toxin transport(GO:1901998) |
0.0 | 0.2 | GO:0046037 | GMP metabolic process(GO:0046037) |
0.0 | 1.1 | GO:0043966 | histone H3 acetylation(GO:0043966) |
0.0 | 0.0 | GO:0042091 | interleukin-10 biosynthetic process(GO:0042091) regulation of interleukin-10 biosynthetic process(GO:0045074) |
0.0 | 0.4 | GO:0002021 | response to dietary excess(GO:0002021) |
0.0 | 0.2 | GO:0090136 | epithelial cell-cell adhesion(GO:0090136) |
0.0 | 0.0 | GO:0046083 | adenine metabolic process(GO:0046083) adenine biosynthetic process(GO:0046084) |
0.0 | 0.0 | GO:0030859 | polarized epithelial cell differentiation(GO:0030859) |
0.0 | 0.1 | GO:1903887 | motile primary cilium assembly(GO:1903887) |
0.0 | 0.1 | GO:0046600 | negative regulation of centriole replication(GO:0046600) |
0.0 | 0.5 | GO:0007214 | gamma-aminobutyric acid signaling pathway(GO:0007214) |
0.0 | 0.1 | GO:0035627 | ceramide transport(GO:0035627) |
0.0 | 0.0 | GO:0070314 | G1 to G0 transition(GO:0070314) |
0.0 | 0.5 | GO:0035065 | regulation of histone acetylation(GO:0035065) |
0.0 | 0.1 | GO:0071493 | cellular response to UV-B(GO:0071493) |
0.0 | 0.6 | GO:0003333 | amino acid transmembrane transport(GO:0003333) |
0.0 | 0.0 | GO:0042668 | auditory receptor cell fate determination(GO:0042668) |
0.0 | 0.0 | GO:0045914 | negative regulation of catecholamine metabolic process(GO:0045914) negative regulation of dopamine metabolic process(GO:0045963) |
0.0 | 0.1 | GO:0010917 | negative regulation of mitochondrial membrane potential(GO:0010917) |
0.0 | 0.1 | GO:0036119 | response to platelet-derived growth factor(GO:0036119) cellular response to platelet-derived growth factor stimulus(GO:0036120) |
0.0 | 0.2 | GO:0036336 | dendritic cell migration(GO:0036336) |
0.0 | 0.0 | GO:2001170 | negative regulation of ATP biosynthetic process(GO:2001170) |
0.0 | 0.1 | GO:0048304 | positive regulation of isotype switching to IgG isotypes(GO:0048304) |
0.0 | 0.3 | GO:0006878 | cellular copper ion homeostasis(GO:0006878) |
0.0 | 0.2 | GO:0010801 | negative regulation of peptidyl-threonine phosphorylation(GO:0010801) |
0.0 | 0.1 | GO:0042414 | epinephrine metabolic process(GO:0042414) |
0.0 | 0.1 | GO:0060671 | epithelial cell differentiation involved in embryonic placenta development(GO:0060671) epithelial cell morphogenesis involved in placental branching(GO:0060672) |
0.0 | 0.0 | GO:0002730 | dendritic cell cytokine production(GO:0002371) regulation of dendritic cell cytokine production(GO:0002730) |
0.0 | 0.1 | GO:0060510 | Type II pneumocyte differentiation(GO:0060510) |
0.0 | 0.0 | GO:0006537 | glutamate biosynthetic process(GO:0006537) |
0.0 | 0.1 | GO:0032789 | saturated monocarboxylic acid metabolic process(GO:0032788) unsaturated monocarboxylic acid metabolic process(GO:0032789) |
0.0 | 0.0 | GO:0010694 | positive regulation of alkaline phosphatase activity(GO:0010694) |
0.0 | 2.2 | GO:0008360 | regulation of cell shape(GO:0008360) |
0.0 | 0.1 | GO:0015772 | disaccharide transport(GO:0015766) sucrose transport(GO:0015770) oligosaccharide transport(GO:0015772) |
0.0 | 0.2 | GO:0051444 | negative regulation of ubiquitin-protein transferase activity(GO:0051444) |
0.0 | 0.1 | GO:0046125 | pyrimidine deoxyribonucleoside metabolic process(GO:0046125) |
0.0 | 0.0 | GO:1901896 | positive regulation of calcium-transporting ATPase activity(GO:1901896) |
0.0 | 0.2 | GO:0070935 | 3'-UTR-mediated mRNA stabilization(GO:0070935) |
0.0 | 0.0 | GO:0051562 | negative regulation of mitochondrial calcium ion concentration(GO:0051562) |
0.0 | 0.2 | GO:0003334 | keratinocyte development(GO:0003334) |
0.0 | 0.1 | GO:0010838 | positive regulation of keratinocyte proliferation(GO:0010838) |
0.0 | 0.1 | GO:0001915 | negative regulation of T cell mediated cytotoxicity(GO:0001915) |
0.0 | 0.5 | GO:2000279 | negative regulation of DNA biosynthetic process(GO:2000279) |
0.0 | 0.0 | GO:0032289 | central nervous system myelin formation(GO:0032289) |
0.0 | 0.0 | GO:0014734 | skeletal muscle hypertrophy(GO:0014734) |
0.0 | 0.1 | GO:0022007 | neural plate elongation(GO:0014022) convergent extension involved in neural plate elongation(GO:0022007) |
0.0 | 0.1 | GO:0032331 | negative regulation of chondrocyte differentiation(GO:0032331) |
0.0 | 0.0 | GO:0070100 | negative regulation of chemokine-mediated signaling pathway(GO:0070100) |
0.0 | 0.1 | GO:0051534 | negative regulation of NFAT protein import into nucleus(GO:0051534) |
0.0 | 0.2 | GO:0019321 | pentose metabolic process(GO:0019321) |
0.0 | 0.1 | GO:0035729 | response to hepatocyte growth factor(GO:0035728) cellular response to hepatocyte growth factor stimulus(GO:0035729) |
0.0 | 0.1 | GO:0006689 | ganglioside catabolic process(GO:0006689) |
0.0 | 0.4 | GO:0036075 | endochondral ossification(GO:0001958) replacement ossification(GO:0036075) |
0.0 | 0.1 | GO:0021853 | cerebral cortex GABAergic interneuron migration(GO:0021853) interneuron migration(GO:1904936) |
0.0 | 0.1 | GO:0043568 | positive regulation of insulin-like growth factor receptor signaling pathway(GO:0043568) |
0.0 | 0.0 | GO:0045448 | regulation of mitotic cell cycle, embryonic(GO:0009794) mitotic cell cycle, embryonic(GO:0045448) |
0.0 | 0.3 | GO:0045974 | negative regulation of translation, ncRNA-mediated(GO:0040033) regulation of translation, ncRNA-mediated(GO:0045974) |
0.0 | 0.0 | GO:0046607 | positive regulation of centrosome duplication(GO:0010825) positive regulation of centrosome cycle(GO:0046607) |
0.0 | 0.1 | GO:0002155 | regulation of thyroid hormone mediated signaling pathway(GO:0002155) |
0.0 | 0.1 | GO:1904424 | regulation of GTP binding(GO:1904424) |
0.0 | 0.1 | GO:0035582 | sequestering of BMP in extracellular matrix(GO:0035582) |
0.0 | 1.0 | GO:0006661 | phosphatidylinositol biosynthetic process(GO:0006661) |
0.0 | 0.0 | GO:0060120 | auditory receptor cell fate commitment(GO:0009912) inner ear receptor cell fate commitment(GO:0060120) |
0.0 | 0.0 | GO:0007386 | compartment pattern specification(GO:0007386) |
0.0 | 0.1 | GO:0070682 | proteasome regulatory particle assembly(GO:0070682) |
0.0 | 0.1 | GO:0016576 | histone dephosphorylation(GO:0016576) |
0.0 | 0.1 | GO:0048633 | positive regulation of skeletal muscle tissue growth(GO:0048633) |
0.0 | 0.1 | GO:0033572 | transferrin transport(GO:0033572) |
0.0 | 0.1 | GO:0030865 | cortical cytoskeleton organization(GO:0030865) |
0.0 | 0.0 | GO:0090365 | regulation of mRNA modification(GO:0090365) |
0.0 | 0.2 | GO:0010758 | regulation of macrophage chemotaxis(GO:0010758) |
0.0 | 0.1 | GO:0050916 | sensory perception of sweet taste(GO:0050916) |
0.0 | 0.0 | GO:2001180 | negative regulation of interleukin-10 secretion(GO:2001180) |
0.0 | 0.1 | GO:0071918 | urea transmembrane transport(GO:0071918) |
0.0 | 0.1 | GO:0010452 | histone H3-K36 methylation(GO:0010452) |
0.0 | 0.2 | GO:0043403 | skeletal muscle tissue regeneration(GO:0043403) |
0.0 | 0.0 | GO:0030007 | cellular potassium ion homeostasis(GO:0030007) |
0.0 | 0.1 | GO:0007468 | regulation of rhodopsin gene expression(GO:0007468) |
0.0 | 0.0 | GO:0002339 | B cell selection(GO:0002339) |
0.0 | 1.9 | GO:0098779 | mitophagy in response to mitochondrial depolarization(GO:0098779) response to mitochondrial depolarisation(GO:0098780) |
0.0 | 0.1 | GO:1902683 | regulation of receptor localization to synapse(GO:1902683) |
0.0 | 0.1 | GO:1901660 | calcium ion export(GO:1901660) |
0.0 | 0.1 | GO:1902715 | positive regulation of interferon-gamma secretion(GO:1902715) |
0.0 | 0.1 | GO:0014883 | transition between fast and slow fiber(GO:0014883) |
0.0 | 0.1 | GO:0061366 | behavioral response to chemical pain(GO:0061366) behavioral response to formalin induced pain(GO:0061368) |
0.0 | 0.1 | GO:1903300 | negative regulation of glucokinase activity(GO:0033132) negative regulation of hexokinase activity(GO:1903300) |
0.0 | 0.1 | GO:0007621 | negative regulation of female receptivity(GO:0007621) |
0.0 | 0.1 | GO:0044387 | negative regulation of protein kinase activity by regulation of protein phosphorylation(GO:0044387) |
0.0 | 0.1 | GO:0061304 | retinal blood vessel morphogenesis(GO:0061304) |
0.0 | 0.2 | GO:0051923 | sulfation(GO:0051923) |
0.0 | 0.0 | GO:0010796 | regulation of multivesicular body size(GO:0010796) |
0.0 | 0.1 | GO:1901407 | regulation of phosphorylation of RNA polymerase II C-terminal domain(GO:1901407) positive regulation of phosphorylation of RNA polymerase II C-terminal domain(GO:1901409) |
0.0 | 0.0 | GO:0070093 | negative regulation of glucagon secretion(GO:0070093) |
0.0 | 0.1 | GO:0000972 | transcription-dependent tethering of RNA polymerase II gene DNA at nuclear periphery(GO:0000972) |
0.0 | 0.0 | GO:0048294 | negative regulation of isotype switching to IgE isotypes(GO:0048294) |
0.0 | 0.0 | GO:0033629 | negative regulation of cell adhesion mediated by integrin(GO:0033629) |
0.0 | 0.1 | GO:0098532 | histone H3-K27 trimethylation(GO:0098532) |
0.0 | 0.0 | GO:0060379 | cardiac muscle cell myoblast differentiation(GO:0060379) |
0.0 | 0.1 | GO:0060468 | prevention of polyspermy(GO:0060468) |
0.0 | 0.1 | GO:1901679 | pyrimidine-containing compound transmembrane transport(GO:0072531) nucleotide transmembrane transport(GO:1901679) |
0.0 | 0.2 | GO:0090077 | foam cell differentiation(GO:0090077) |
0.0 | 0.5 | GO:0051568 | histone H3-K4 methylation(GO:0051568) |
0.0 | 0.1 | GO:0070072 | vacuolar proton-transporting V-type ATPase complex assembly(GO:0070072) |
0.0 | 0.1 | GO:0030502 | negative regulation of bone mineralization(GO:0030502) |
0.0 | 0.1 | GO:0034035 | purine ribonucleoside bisphosphate metabolic process(GO:0034035) |
0.0 | 0.0 | GO:0060431 | primary lung bud formation(GO:0060431) |
0.0 | 0.1 | GO:0006041 | glucosamine metabolic process(GO:0006041) |
0.0 | 0.0 | GO:1990441 | negative regulation of transcription from RNA polymerase II promoter in response to endoplasmic reticulum stress(GO:1990441) |
0.0 | 0.0 | GO:1901097 | negative regulation of autophagosome maturation(GO:1901097) |
0.0 | 0.1 | GO:0009597 | detection of virus(GO:0009597) |
0.0 | 0.0 | GO:0001922 | B-1 B cell homeostasis(GO:0001922) |
0.0 | 0.1 | GO:0009235 | cobalamin metabolic process(GO:0009235) |
0.0 | 0.0 | GO:0033387 | putrescine biosynthetic process from ornithine(GO:0033387) |
0.0 | 0.2 | GO:0042744 | hydrogen peroxide catabolic process(GO:0042744) |
0.0 | 0.0 | GO:0015808 | L-alanine transport(GO:0015808) |
0.0 | 0.1 | GO:1901201 | regulation of extracellular matrix assembly(GO:1901201) |
0.0 | 0.1 | GO:0006241 | CTP biosynthetic process(GO:0006241) CTP metabolic process(GO:0046036) |
0.0 | 0.1 | GO:0033578 | protein glycosylation in Golgi(GO:0033578) |
0.0 | 0.1 | GO:0035162 | embryonic hemopoiesis(GO:0035162) |
0.0 | 0.0 | GO:0060390 | regulation of SMAD protein import into nucleus(GO:0060390) |
0.0 | 0.1 | GO:0042473 | outer ear morphogenesis(GO:0042473) |
0.0 | 0.0 | GO:0010614 | negative regulation of cardiac muscle hypertrophy(GO:0010614) |
0.0 | 0.0 | GO:0034196 | acylglycerol transport(GO:0034196) triglyceride transport(GO:0034197) |
0.0 | 0.0 | GO:0015889 | cobalamin transport(GO:0015889) |
0.0 | 0.0 | GO:0032489 | regulation of Cdc42 protein signal transduction(GO:0032489) |
0.0 | 0.3 | GO:1902108 | regulation of mitochondrial membrane permeability involved in apoptotic process(GO:1902108) |
0.0 | 0.0 | GO:0002051 | osteoblast fate commitment(GO:0002051) |
0.0 | 0.0 | GO:0070125 | mitochondrial translational elongation(GO:0070125) |
0.0 | 0.0 | GO:0031052 | programmed DNA elimination(GO:0031049) chromosome breakage(GO:0031052) |
0.0 | 0.0 | GO:0035872 | nucleotide-binding domain, leucine rich repeat containing receptor signaling pathway(GO:0035872) |
0.0 | 0.0 | GO:0060748 | tertiary branching involved in mammary gland duct morphogenesis(GO:0060748) |
0.0 | 0.1 | GO:1902018 | negative regulation of cilium assembly(GO:1902018) |
0.0 | 0.1 | GO:0016242 | negative regulation of macroautophagy(GO:0016242) |
0.0 | 0.1 | GO:0006903 | vesicle targeting(GO:0006903) |
0.0 | 0.0 | GO:0090435 | protein localization to nuclear envelope(GO:0090435) |
0.0 | 0.1 | GO:0071985 | multivesicular body sorting pathway(GO:0071985) |
0.0 | 0.0 | GO:0002679 | respiratory burst involved in defense response(GO:0002679) |
0.0 | 0.0 | GO:0036296 | response to increased oxygen levels(GO:0036296) response to hyperoxia(GO:0055093) |
0.0 | 0.1 | GO:0046838 | phosphorylated carbohydrate dephosphorylation(GO:0046838) |
0.0 | 0.3 | GO:0008299 | isoprenoid biosynthetic process(GO:0008299) |
0.0 | 0.0 | GO:0051459 | regulation of corticotropin secretion(GO:0051459) positive regulation of corticotropin secretion(GO:0051461) |
0.0 | 0.1 | GO:0071257 | cellular response to electrical stimulus(GO:0071257) |
0.0 | 0.2 | GO:0031952 | regulation of protein autophosphorylation(GO:0031952) |
0.0 | 0.3 | GO:0046825 | regulation of protein export from nucleus(GO:0046825) |
0.0 | 0.1 | GO:0060050 | positive regulation of protein glycosylation(GO:0060050) |
0.0 | 0.3 | GO:0045214 | sarcomere organization(GO:0045214) |
0.0 | 0.1 | GO:0090502 | RNA phosphodiester bond hydrolysis, endonucleolytic(GO:0090502) |
0.0 | 0.1 | GO:0015838 | amino-acid betaine transport(GO:0015838) |
0.0 | 0.0 | GO:0000733 | DNA strand renaturation(GO:0000733) |
0.0 | 0.1 | GO:1900262 | regulation of DNA-directed DNA polymerase activity(GO:1900262) positive regulation of DNA-directed DNA polymerase activity(GO:1900264) |
0.0 | 0.1 | GO:0048312 | intracellular distribution of mitochondria(GO:0048312) |
0.0 | 0.2 | GO:0007614 | short-term memory(GO:0007614) |
0.0 | 0.1 | GO:0002026 | regulation of the force of heart contraction(GO:0002026) |
0.0 | 0.0 | GO:0023021 | termination of signal transduction(GO:0023021) |
0.0 | 0.0 | GO:0002018 | renin-angiotensin regulation of aldosterone production(GO:0002018) |
0.0 | 0.0 | GO:0015817 | histidine transport(GO:0015817) |
0.0 | 0.1 | GO:0010793 | regulation of mRNA export from nucleus(GO:0010793) regulation of ribonucleoprotein complex localization(GO:2000197) |
0.0 | 0.0 | GO:0071394 | cellular response to testosterone stimulus(GO:0071394) |
0.0 | 0.0 | GO:0061030 | epithelial cell differentiation involved in mammary gland alveolus development(GO:0061030) |
0.0 | 0.0 | GO:0036112 | medium-chain fatty-acyl-CoA metabolic process(GO:0036112) |
0.0 | 0.1 | GO:2000369 | regulation of clathrin-mediated endocytosis(GO:2000369) |
0.0 | 0.0 | GO:0006007 | glucose catabolic process(GO:0006007) |
0.0 | 0.0 | GO:0015840 | urea transport(GO:0015840) |
0.0 | 0.0 | GO:1903376 | neuron intrinsic apoptotic signaling pathway in response to oxidative stress(GO:0036480) regulation of oxidative stress-induced neuron intrinsic apoptotic signaling pathway(GO:1903376) |
0.0 | 0.0 | GO:0030916 | otic vesicle formation(GO:0030916) |
0.0 | 0.4 | GO:0031424 | keratinization(GO:0031424) |
0.0 | 0.1 | GO:0071044 | histone mRNA catabolic process(GO:0071044) |
0.0 | 0.0 | GO:1903751 | regulation of intrinsic apoptotic signaling pathway in response to hydrogen peroxide(GO:1903750) negative regulation of intrinsic apoptotic signaling pathway in response to hydrogen peroxide(GO:1903751) |
0.0 | 0.1 | GO:0001921 | positive regulation of receptor recycling(GO:0001921) |
0.0 | 0.5 | GO:0070936 | protein K48-linked ubiquitination(GO:0070936) |
0.0 | 0.1 | GO:0038065 | collagen-activated signaling pathway(GO:0038065) |
0.0 | 0.0 | GO:0007512 | adult heart development(GO:0007512) |
0.0 | 0.2 | GO:0009648 | photoperiodism(GO:0009648) |
0.0 | 0.0 | GO:2000501 | natural killer cell chemotaxis(GO:0035747) regulation of natural killer cell chemotaxis(GO:2000501) positive regulation of natural killer cell chemotaxis(GO:2000503) |
0.0 | 0.1 | GO:2000467 | positive regulation of glycogen (starch) synthase activity(GO:2000467) |
0.0 | 0.1 | GO:0060710 | chorio-allantoic fusion(GO:0060710) |
0.0 | 0.0 | GO:0019184 | nonribosomal peptide biosynthetic process(GO:0019184) |
0.0 | 0.0 | GO:0060083 | smooth muscle contraction involved in micturition(GO:0060083) |
0.0 | 0.1 | GO:0046415 | urate metabolic process(GO:0046415) |
0.0 | 0.1 | GO:0070932 | histone H3 deacetylation(GO:0070932) |
0.0 | 0.2 | GO:0032012 | ARF protein signal transduction(GO:0032011) regulation of ARF protein signal transduction(GO:0032012) |
0.0 | 0.1 | GO:0031657 | regulation of cyclin-dependent protein serine/threonine kinase activity involved in G1/S transition of mitotic cell cycle(GO:0031657) positive regulation of cyclin-dependent protein serine/threonine kinase activity involved in G1/S transition of mitotic cell cycle(GO:0031659) |
0.0 | 0.1 | GO:1900048 | positive regulation of blood coagulation(GO:0030194) positive regulation of hemostasis(GO:1900048) |
0.0 | 0.0 | GO:0060066 | oviduct development(GO:0060066) |
0.0 | 0.2 | GO:0045662 | negative regulation of myoblast differentiation(GO:0045662) |
0.0 | 0.1 | GO:0006020 | inositol metabolic process(GO:0006020) |
0.0 | 0.1 | GO:0032060 | bleb assembly(GO:0032060) |
0.0 | 0.2 | GO:0042503 | tyrosine phosphorylation of Stat3 protein(GO:0042503) regulation of tyrosine phosphorylation of Stat3 protein(GO:0042516) |
0.0 | 0.1 | GO:0030643 | cellular phosphate ion homeostasis(GO:0030643) cellular trivalent inorganic anion homeostasis(GO:0072502) |
0.0 | 0.2 | GO:1900003 | regulation of serine-type endopeptidase activity(GO:1900003) negative regulation of serine-type endopeptidase activity(GO:1900004) regulation of serine-type peptidase activity(GO:1902571) negative regulation of serine-type peptidase activity(GO:1902572) |
0.0 | 0.0 | GO:0098902 | regulation of membrane depolarization during action potential(GO:0098902) |
0.0 | 0.0 | GO:0017187 | peptidyl-glutamic acid carboxylation(GO:0017187) |
0.0 | 0.0 | GO:0070966 | nuclear-transcribed mRNA catabolic process, no-go decay(GO:0070966) |
0.0 | 0.3 | GO:0010633 | negative regulation of epithelial cell migration(GO:0010633) |
0.0 | 0.1 | GO:0045737 | positive regulation of cyclin-dependent protein serine/threonine kinase activity(GO:0045737) |
0.0 | 0.2 | GO:0055010 | ventricular cardiac muscle tissue morphogenesis(GO:0055010) |
0.0 | 0.2 | GO:0098781 | ncRNA transcription(GO:0098781) |
0.0 | 0.0 | GO:0006663 | platelet activating factor biosynthetic process(GO:0006663) platelet activating factor metabolic process(GO:0046469) |
0.0 | 0.0 | GO:2001260 | regulation of semaphorin-plexin signaling pathway(GO:2001260) |
0.0 | 0.0 | GO:0008582 | regulation of synaptic growth at neuromuscular junction(GO:0008582) |
0.0 | 0.1 | GO:0045838 | positive regulation of membrane potential(GO:0045838) |
0.0 | 0.0 | GO:1902809 | regulation of skeletal muscle fiber differentiation(GO:1902809) |
0.0 | 0.2 | GO:0000186 | activation of MAPKK activity(GO:0000186) |
0.0 | 0.1 | GO:0071549 | response to dexamethasone(GO:0071548) cellular response to dexamethasone stimulus(GO:0071549) |
0.0 | 0.0 | GO:0060136 | embryonic process involved in female pregnancy(GO:0060136) |
0.0 | 0.0 | GO:0022615 | protein to membrane docking(GO:0022615) |
0.0 | 0.1 | GO:0018026 | peptidyl-lysine monomethylation(GO:0018026) |
0.0 | 0.0 | GO:0070493 | thrombin receptor signaling pathway(GO:0070493) |
0.0 | 0.0 | GO:0045988 | negative regulation of striated muscle contraction(GO:0045988) |
0.0 | 0.1 | GO:0006670 | sphingosine metabolic process(GO:0006670) |
0.0 | 0.1 | GO:0097094 | craniofacial suture morphogenesis(GO:0097094) |
0.0 | 0.1 | GO:0051152 | positive regulation of smooth muscle cell differentiation(GO:0051152) |
0.0 | 0.0 | GO:1902176 | negative regulation of oxidative stress-induced intrinsic apoptotic signaling pathway(GO:1902176) |
0.0 | 0.1 | GO:0060716 | labyrinthine layer blood vessel development(GO:0060716) |
0.0 | 0.1 | GO:0034551 | respiratory chain complex III assembly(GO:0017062) mitochondrial respiratory chain complex III assembly(GO:0034551) mitochondrial respiratory chain complex III biogenesis(GO:0097033) |
0.0 | 0.1 | GO:0030878 | thyroid gland development(GO:0030878) |
0.0 | 0.0 | GO:1905097 | regulation of guanyl-nucleotide exchange factor activity(GO:1905097) |
0.0 | 0.0 | GO:1990705 | cholangiocyte proliferation(GO:1990705) |
0.0 | 0.3 | GO:0030835 | negative regulation of actin filament depolymerization(GO:0030835) |
0.0 | 0.1 | GO:0045116 | protein neddylation(GO:0045116) |
0.0 | 0.1 | GO:1902742 | apoptotic process involved in development(GO:1902742) |
0.0 | 0.1 | GO:0035455 | response to interferon-alpha(GO:0035455) |
0.0 | 0.0 | GO:0019230 | proprioception(GO:0019230) |
0.0 | 0.2 | GO:1900026 | positive regulation of substrate adhesion-dependent cell spreading(GO:1900026) |
0.0 | 0.0 | GO:0002331 | pre-B cell allelic exclusion(GO:0002331) |
0.0 | 0.1 | GO:0006528 | asparagine metabolic process(GO:0006528) |
0.0 | 0.0 | GO:0015825 | L-serine transport(GO:0015825) |
0.0 | 0.1 | GO:0006013 | mannose metabolic process(GO:0006013) |
0.0 | 0.0 | GO:0031665 | negative regulation of lipopolysaccharide-mediated signaling pathway(GO:0031665) |
0.0 | 0.0 | GO:0007221 | positive regulation of transcription of Notch receptor target(GO:0007221) |
0.0 | 0.1 | GO:0010842 | retina layer formation(GO:0010842) |
0.0 | 0.2 | GO:0003009 | skeletal muscle contraction(GO:0003009) |
0.0 | 0.0 | GO:0022417 | protein maturation by protein folding(GO:0022417) |
0.0 | 0.0 | GO:2000143 | negative regulation of transcription initiation from RNA polymerase II promoter(GO:0060633) negative regulation of DNA-templated transcription, initiation(GO:2000143) |
0.0 | 0.0 | GO:0080154 | regulation of fertilization(GO:0080154) |
0.0 | 0.3 | GO:0000027 | ribosomal large subunit assembly(GO:0000027) |
0.0 | 0.0 | GO:0046102 | inosine metabolic process(GO:0046102) inosine biosynthetic process(GO:0046103) |
0.0 | 0.0 | GO:0000720 | pyrimidine dimer repair by nucleotide-excision repair(GO:0000720) |
0.0 | 0.3 | GO:0008333 | endosome to lysosome transport(GO:0008333) |
0.0 | 0.0 | GO:0009106 | lipoate metabolic process(GO:0009106) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.8 | 2.3 | GO:1990597 | AIP1-IRE1 complex(GO:1990597) |
0.2 | 0.7 | GO:0031092 | platelet alpha granule membrane(GO:0031092) |
0.2 | 0.9 | GO:0002142 | stereocilia ankle link complex(GO:0002142) |
0.2 | 1.4 | GO:0042382 | paraspeckles(GO:0042382) |
0.2 | 1.0 | GO:0072357 | PTW/PP1 phosphatase complex(GO:0072357) |
0.2 | 0.5 | GO:0033596 | TSC1-TSC2 complex(GO:0033596) |
0.2 | 0.6 | GO:0044354 | pinosome(GO:0044352) macropinosome(GO:0044354) |
0.1 | 2.1 | GO:0031430 | M band(GO:0031430) |
0.1 | 1.1 | GO:0034992 | microtubule organizing center attachment site(GO:0034992) LINC complex(GO:0034993) |
0.1 | 1.9 | GO:0016460 | myosin II complex(GO:0016460) |
0.1 | 0.5 | GO:0070545 | PeBoW complex(GO:0070545) |
0.1 | 1.4 | GO:0070852 | cell body fiber(GO:0070852) |
0.1 | 2.3 | GO:0000242 | pericentriolar material(GO:0000242) |
0.1 | 2.1 | GO:0097225 | sperm midpiece(GO:0097225) |
0.1 | 0.3 | GO:0071001 | U4/U6 snRNP(GO:0071001) |
0.1 | 0.2 | GO:0071664 | catenin-TCF7L2 complex(GO:0071664) |
0.1 | 0.6 | GO:0070776 | H3 histone acetyltransferase complex(GO:0070775) MOZ/MORF histone acetyltransferase complex(GO:0070776) |
0.1 | 0.3 | GO:0031074 | nucleocytoplasmic shuttling complex(GO:0031074) |
0.1 | 0.3 | GO:0035363 | histone locus body(GO:0035363) |
0.1 | 1.1 | GO:0033391 | chromatoid body(GO:0033391) |
0.1 | 2.4 | GO:0008180 | COP9 signalosome(GO:0008180) |
0.1 | 0.2 | GO:0005606 | laminin-1 complex(GO:0005606) laminin-10 complex(GO:0043259) |
0.1 | 1.4 | GO:0016327 | apicolateral plasma membrane(GO:0016327) |
0.1 | 0.2 | GO:0005610 | laminin-5 complex(GO:0005610) |
0.1 | 0.3 | GO:0034363 | intermediate-density lipoprotein particle(GO:0034363) |
0.1 | 1.4 | GO:0005922 | connexon complex(GO:0005922) |
0.1 | 0.5 | GO:0031254 | uropod(GO:0001931) cell trailing edge(GO:0031254) |
0.1 | 2.9 | GO:0001725 | stress fiber(GO:0001725) contractile actin filament bundle(GO:0097517) |
0.1 | 0.9 | GO:0000145 | exocyst(GO:0000145) |
0.1 | 0.4 | GO:0005916 | fascia adherens(GO:0005916) |
0.1 | 0.5 | GO:0002116 | semaphorin receptor complex(GO:0002116) |
0.1 | 2.1 | GO:0005747 | mitochondrial respiratory chain complex I(GO:0005747) NADH dehydrogenase complex(GO:0030964) respiratory chain complex I(GO:0045271) |
0.1 | 0.6 | GO:0042405 | nuclear inclusion body(GO:0042405) |
0.1 | 0.2 | GO:0071953 | elastic fiber(GO:0071953) |
0.0 | 0.3 | GO:0005952 | cAMP-dependent protein kinase complex(GO:0005952) |
0.0 | 0.5 | GO:0032426 | stereocilium tip(GO:0032426) |
0.0 | 0.2 | GO:0097136 | Bcl-2 family protein complex(GO:0097136) |
0.0 | 0.3 | GO:0071986 | Ragulator complex(GO:0071986) |
0.0 | 0.8 | GO:0090545 | NuRD complex(GO:0016581) CHD-type complex(GO:0090545) |
0.0 | 0.2 | GO:0016281 | eukaryotic translation initiation factor 4F complex(GO:0016281) |
0.0 | 0.2 | GO:0034464 | BBSome(GO:0034464) |
0.0 | 0.2 | GO:0042825 | TAP complex(GO:0042825) |
0.0 | 0.2 | GO:0045098 | type III intermediate filament(GO:0045098) |
0.0 | 1.0 | GO:0030131 | clathrin adaptor complex(GO:0030131) |
0.0 | 0.5 | GO:0043034 | costamere(GO:0043034) |
0.0 | 0.5 | GO:0000421 | autophagosome membrane(GO:0000421) |
0.0 | 0.1 | GO:0030478 | actin cap(GO:0030478) |
0.0 | 0.2 | GO:0044666 | MLL3/4 complex(GO:0044666) |
0.0 | 0.3 | GO:0005832 | chaperonin-containing T-complex(GO:0005832) |
0.0 | 0.1 | GO:0030313 | cell outer membrane(GO:0009279) cell envelope(GO:0030313) external encapsulating structure part(GO:0044462) |
0.0 | 0.2 | GO:0005638 | lamin filament(GO:0005638) |
0.0 | 0.3 | GO:0030314 | junctional membrane complex(GO:0030314) |
0.0 | 0.3 | GO:0042581 | specific granule(GO:0042581) |
0.0 | 0.1 | GO:0043202 | lysosomal lumen(GO:0043202) |
0.0 | 0.2 | GO:0005861 | troponin complex(GO:0005861) |
0.0 | 0.6 | GO:0031941 | filamentous actin(GO:0031941) |
0.0 | 0.1 | GO:0071797 | LUBAC complex(GO:0071797) |
0.0 | 0.4 | GO:0005671 | Ada2/Gcn5/Ada3 transcription activator complex(GO:0005671) |
0.0 | 0.1 | GO:0070688 | MLL5-L complex(GO:0070688) |
0.0 | 0.1 | GO:0071942 | XPC complex(GO:0071942) |
0.0 | 0.1 | GO:0030485 | smooth muscle contractile fiber(GO:0030485) |
0.0 | 0.2 | GO:0044233 | ER-mitochondrion membrane contact site(GO:0044233) |
0.0 | 0.2 | GO:0012510 | trans-Golgi network transport vesicle membrane(GO:0012510) |
0.0 | 0.3 | GO:0005639 | integral component of nuclear inner membrane(GO:0005639) intrinsic component of nuclear inner membrane(GO:0031229) |
0.0 | 0.3 | GO:0001891 | phagocytic cup(GO:0001891) |
0.0 | 0.1 | GO:0044316 | cone cell pedicle(GO:0044316) |
0.0 | 0.5 | GO:0032420 | stereocilium(GO:0032420) |
0.0 | 1.5 | GO:0030667 | secretory granule membrane(GO:0030667) |
0.0 | 0.1 | GO:0031258 | lamellipodium membrane(GO:0031258) |
0.0 | 0.1 | GO:0005712 | chiasma(GO:0005712) |
0.0 | 0.6 | GO:0051233 | spindle midzone(GO:0051233) |
0.0 | 0.9 | GO:0016459 | myosin complex(GO:0016459) |
0.0 | 0.2 | GO:0031211 | serine C-palmitoyltransferase complex(GO:0017059) endoplasmic reticulum palmitoyltransferase complex(GO:0031211) |
0.0 | 0.1 | GO:0031094 | platelet dense tubular network(GO:0031094) |
0.0 | 0.4 | GO:0005614 | interstitial matrix(GO:0005614) |
0.0 | 0.2 | GO:0097470 | ribbon synapse(GO:0097470) |
0.0 | 0.2 | GO:0042627 | chylomicron(GO:0042627) |
0.0 | 0.2 | GO:0008385 | IkappaB kinase complex(GO:0008385) |
0.0 | 0.1 | GO:0034448 | EGO complex(GO:0034448) Gtr1-Gtr2 GTPase complex(GO:1990131) |
0.0 | 1.2 | GO:0005871 | kinesin complex(GO:0005871) |
0.0 | 0.1 | GO:1990635 | proximal dendrite(GO:1990635) |
0.0 | 0.2 | GO:0019773 | proteasome core complex, alpha-subunit complex(GO:0019773) |
0.0 | 0.2 | GO:0005655 | nucleolar ribonuclease P complex(GO:0005655) ribonuclease P complex(GO:0030677) multimeric ribonuclease P complex(GO:0030681) |
0.0 | 0.2 | GO:0000940 | condensed chromosome outer kinetochore(GO:0000940) |
0.0 | 0.1 | GO:0043219 | lateral loop(GO:0043219) |
0.0 | 0.1 | GO:0005663 | DNA replication factor C complex(GO:0005663) |
0.0 | 0.1 | GO:0030289 | protein phosphatase 4 complex(GO:0030289) |
0.0 | 1.7 | GO:0005604 | basement membrane(GO:0005604) |
0.0 | 0.1 | GO:0045180 | basal cortex(GO:0045180) |
0.0 | 0.2 | GO:0031235 | intrinsic component of the cytoplasmic side of the plasma membrane(GO:0031235) |
0.0 | 0.1 | GO:0035985 | senescence-associated heterochromatin focus(GO:0035985) |
0.0 | 0.1 | GO:0031084 | BLOC-2 complex(GO:0031084) |
0.0 | 0.1 | GO:0001651 | dense fibrillar component(GO:0001651) |
0.0 | 0.3 | GO:0000159 | protein phosphatase type 2A complex(GO:0000159) |
0.0 | 0.1 | GO:0005785 | signal recognition particle receptor complex(GO:0005785) |
0.0 | 0.1 | GO:0000220 | vacuolar proton-transporting V-type ATPase, V0 domain(GO:0000220) |
0.0 | 0.3 | GO:0001673 | male germ cell nucleus(GO:0001673) |
0.0 | 0.1 | GO:0002189 | ribose phosphate diphosphokinase complex(GO:0002189) |
0.0 | 0.1 | GO:0098563 | integral component of synaptic vesicle membrane(GO:0030285) intrinsic component of synaptic vesicle membrane(GO:0098563) |
0.0 | 0.1 | GO:0042719 | mitochondrial intermembrane space protein transporter complex(GO:0042719) |
0.0 | 0.2 | GO:0035102 | PRC1 complex(GO:0035102) |
0.0 | 0.2 | GO:0036379 | myofilament(GO:0036379) |
0.0 | 0.0 | GO:1990761 | growth cone lamellipodium(GO:1990761) growth cone filopodium(GO:1990812) |
0.0 | 0.1 | GO:0070652 | HAUS complex(GO:0070652) |
0.0 | 0.5 | GO:0098636 | protein complex involved in cell adhesion(GO:0098636) |
0.0 | 0.1 | GO:0071203 | WASH complex(GO:0071203) |
0.0 | 0.2 | GO:0032580 | Golgi cisterna membrane(GO:0032580) |
0.0 | 0.0 | GO:0030312 | external encapsulating structure(GO:0030312) |
0.0 | 0.1 | GO:0001939 | female pronucleus(GO:0001939) |
0.0 | 0.1 | GO:0070578 | RISC-loading complex(GO:0070578) |
0.0 | 0.0 | GO:0033185 | dolichol-phosphate-mannose synthase complex(GO:0033185) |
0.0 | 0.1 | GO:0005579 | membrane attack complex(GO:0005579) |
0.0 | 0.0 | GO:0034750 | Scrib-APC-beta-catenin complex(GO:0034750) |
0.0 | 0.1 | GO:0071541 | eukaryotic translation initiation factor 3 complex, eIF3m(GO:0071541) |
0.0 | 0.8 | GO:0005811 | lipid particle(GO:0005811) |
0.0 | 0.9 | GO:0000922 | spindle pole(GO:0000922) |
0.0 | 0.0 | GO:0033093 | Weibel-Palade body(GO:0033093) |
0.0 | 0.1 | GO:0044613 | nuclear pore central transport channel(GO:0044613) |
0.0 | 0.1 | GO:0008540 | proteasome regulatory particle, base subcomplex(GO:0008540) |
0.0 | 0.1 | GO:0032591 | dendritic spine membrane(GO:0032591) |
0.0 | 0.6 | GO:0005788 | endoplasmic reticulum lumen(GO:0005788) |
0.0 | 0.1 | GO:0031932 | TORC2 complex(GO:0031932) |
0.0 | 0.3 | GO:0048786 | presynaptic active zone(GO:0048786) |
0.0 | 1.3 | GO:0072562 | blood microparticle(GO:0072562) |
0.0 | 0.1 | GO:0030665 | clathrin-coated vesicle membrane(GO:0030665) |
0.0 | 0.1 | GO:0008024 | cyclin/CDK positive transcription elongation factor complex(GO:0008024) |
0.0 | 0.7 | GO:0000932 | cytoplasmic mRNA processing body(GO:0000932) |
0.0 | 0.2 | GO:0031597 | cytosolic proteasome complex(GO:0031597) |
0.0 | 0.1 | GO:0031528 | microvillus membrane(GO:0031528) |
0.0 | 0.0 | GO:0031933 | telomeric heterochromatin(GO:0031933) |
0.0 | 0.5 | GO:0005834 | heterotrimeric G-protein complex(GO:0005834) |
0.0 | 0.0 | GO:0043625 | delta DNA polymerase complex(GO:0043625) |
0.0 | 0.1 | GO:0005869 | dynactin complex(GO:0005869) |
0.0 | 0.0 | GO:0005850 | eukaryotic translation initiation factor 2 complex(GO:0005850) |
0.0 | 0.1 | GO:0097209 | epidermal lamellar body(GO:0097209) |
0.0 | 0.0 | GO:0044614 | nuclear pore cytoplasmic filaments(GO:0044614) |
0.0 | 0.1 | GO:0072487 | MSL complex(GO:0072487) |
0.0 | 0.3 | GO:0016235 | aggresome(GO:0016235) |
0.0 | 0.0 | GO:0033269 | internode region of axon(GO:0033269) |
0.0 | 0.0 | GO:0033179 | proton-transporting V-type ATPase, V0 domain(GO:0033179) |
0.0 | 0.3 | GO:0015030 | Cajal body(GO:0015030) |
0.0 | 0.2 | GO:0043196 | varicosity(GO:0043196) |
0.0 | 1.1 | GO:0090575 | RNA polymerase II transcription factor complex(GO:0090575) |
0.0 | 0.1 | GO:1990454 | L-type voltage-gated calcium channel complex(GO:1990454) |
0.0 | 0.1 | GO:0031080 | nuclear pore outer ring(GO:0031080) |
0.0 | 0.2 | GO:0097610 | cleavage furrow(GO:0032154) cell surface furrow(GO:0097610) |
0.0 | 2.1 | GO:0000139 | Golgi membrane(GO:0000139) |
0.0 | 0.2 | GO:0005637 | nuclear inner membrane(GO:0005637) |
0.0 | 0.0 | GO:0061689 | tricellular tight junction(GO:0061689) |
0.0 | 0.2 | GO:0010494 | cytoplasmic stress granule(GO:0010494) |
0.0 | 0.1 | GO:0010369 | chromocenter(GO:0010369) |
0.0 | 0.1 | GO:0098799 | outer mitochondrial membrane protein complex(GO:0098799) |
0.0 | 0.3 | GO:0031901 | early endosome membrane(GO:0031901) |
0.0 | 0.3 | GO:0000791 | euchromatin(GO:0000791) |
0.0 | 0.0 | GO:0071598 | neuronal ribonucleoprotein granule(GO:0071598) |
0.0 | 0.0 | GO:0031265 | CD95 death-inducing signaling complex(GO:0031265) |
0.0 | 0.1 | GO:0005883 | neurofilament(GO:0005883) |
0.0 | 0.8 | GO:0030017 | sarcomere(GO:0030017) |
0.0 | 0.4 | GO:0000118 | histone deacetylase complex(GO:0000118) |
0.0 | 0.4 | GO:0005844 | polysome(GO:0005844) |
0.0 | 0.4 | GO:0043198 | dendritic shaft(GO:0043198) |
0.0 | 0.5 | GO:0016605 | PML body(GO:0016605) |
0.0 | 0.2 | GO:0005801 | cis-Golgi network(GO:0005801) |
0.0 | 0.1 | GO:0045252 | oxoglutarate dehydrogenase complex(GO:0045252) |
0.0 | 0.2 | GO:0035861 | site of double-strand break(GO:0035861) |
0.0 | 0.1 | GO:0000164 | protein phosphatase type 1 complex(GO:0000164) |
0.0 | 0.1 | GO:0031143 | pseudopodium(GO:0031143) |
0.0 | 0.2 | GO:0031306 | intrinsic component of mitochondrial outer membrane(GO:0031306) |
0.0 | 0.6 | GO:0022625 | cytosolic large ribosomal subunit(GO:0022625) |
0.0 | 0.0 | GO:0043203 | axon hillock(GO:0043203) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.8 | 3.1 | GO:0042731 | PH domain binding(GO:0042731) |
0.6 | 1.8 | GO:0004687 | myosin light chain kinase activity(GO:0004687) |
0.5 | 1.4 | GO:0004920 | interleukin-10 receptor activity(GO:0004920) |
0.4 | 2.1 | GO:0035662 | Toll-like receptor 4 binding(GO:0035662) |
0.4 | 1.1 | GO:0043120 | tumor necrosis factor binding(GO:0043120) |
0.3 | 1.0 | GO:0061629 | RNA polymerase II sequence-specific DNA binding transcription factor binding(GO:0061629) |
0.3 | 1.2 | GO:0015375 | glycine:sodium symporter activity(GO:0015375) |
0.3 | 1.2 | GO:0009374 | biotin binding(GO:0009374) |
0.3 | 0.8 | GO:0004359 | glutaminase activity(GO:0004359) |
0.2 | 1.6 | GO:0018639 | 3-(3-hydroxyphenyl)propionate hydroxylase activity(GO:0008688) 4-chlorobenzaldehyde oxidase activity(GO:0018471) 3,5-xylenol methylhydroxylase activity(GO:0018630) phenylacetate hydroxylase activity(GO:0018631) 4-nitrophenol 4-monooxygenase activity(GO:0018632) dimethyl sulfide monooxygenase activity(GO:0018633) alpha-pinene monooxygenase [NADH] activity(GO:0018634) 1-hydroxy-2-naphthoate hydroxylase activity(GO:0018637) toluene 4-monooxygenase activity(GO:0018638) xylene monooxygenase activity(GO:0018639) dibenzothiophene monooxygenase activity(GO:0018640) 6-hydroxy-3-methyl-2-oxo-1,2-dihydroquinoline 6-monooxygenase activity(GO:0018641) chlorophenol 4-monooxygenase activity(GO:0018642) carbon disulfide oxygenase activity(GO:0018643) toluene 2-monooxygenase activity(GO:0018644) 1-hydroxy-2-oxolimonene 1,2-monooxygenase activity(GO:0018646) phenanthrene 1,2-monooxygenase activity(GO:0018647) tetrahydrofuran hydroxylase activity(GO:0018649) styrene monooxygenase activity(GO:0018650) toluene-4-sulfonate monooxygenase activity(GO:0018651) toluene-sulfonate methyl-monooxygenase activity(GO:0018652) 3-methyl-2-oxo-1,2-dihydroquinoline 6-monooxygenase activity(GO:0018653) 2-hydroxy-phenylacetate hydroxylase activity(GO:0018654) 2-oxo-delta3-4,5,5-trimethylcyclopentenylacetyl-CoA 1,2-monooxygenase activity(GO:0018655) phenanthrene 3,4-monooxygenase activity(GO:0018656) toluene 3-monooxygenase activity(GO:0018657) 4-hydroxyphenylacetate,NADH:oxygen oxidoreductase (3-hydroxylating) activity(GO:0018660) limonene monooxygenase activity(GO:0019113) 2-methylnaphthalene hydroxylase activity(GO:0034526) 1-methylnaphthalene hydroxylase activity(GO:0034534) bisphenol A hydroxylase A activity(GO:0034560) salicylate 5-hydroxylase activity(GO:0034785) isobutylamine N-hydroxylase activity(GO:0034791) branched-chain dodecylbenzene sulfonate monooxygenase activity(GO:0034802) 3-HSA hydroxylase activity(GO:0034819) 4-hydroxypyridine-3-hydroxylase activity(GO:0034894) 2-octaprenyl-3-methyl-6-methoxy-1,4-benzoquinol hydroxylase activity(GO:0043719) 6-hydroxynicotinate 3-monooxygenase activity(GO:0043731) thalianol hydroxylase activity(GO:0080014) |
0.2 | 3.1 | GO:0016493 | C-C chemokine receptor activity(GO:0016493) |
0.2 | 1.1 | GO:0030274 | LIM domain binding(GO:0030274) |
0.2 | 1.8 | GO:0032036 | myosin heavy chain binding(GO:0032036) |
0.2 | 0.7 | GO:0019834 | phospholipase A2 inhibitor activity(GO:0019834) |
0.2 | 1.2 | GO:0030306 | ADP-ribosylation factor binding(GO:0030306) |
0.2 | 0.8 | GO:0071253 | connexin binding(GO:0071253) |
0.2 | 1.0 | GO:0018499 | enoyl-[acyl-carrier-protein] reductase activity(GO:0016631) 2,3-dihydroxy-2,3-dihydro-phenylpropionate dehydrogenase activity(GO:0018498) cis-2,3-dihydrodiol DDT dehydrogenase activity(GO:0018499) trans-9R,10R-dihydrodiolphenanthrene dehydrogenase activity(GO:0018500) cis-chlorobenzene dihydrodiol dehydrogenase activity(GO:0018501) 2,5-dichloro-2,5-cyclohexadiene-1,4-diol dehydrogenase activity(GO:0018502) trans-1,2-dihydrodiolphenanthrene dehydrogenase activity(GO:0018503) 3,4-dihydroxy-3,4-dihydrofluorene dehydrogenase activity(GO:0034790) benzo(a)pyrene-trans-11,12-dihydrodiol dehydrogenase activity(GO:0034805) benzo(a)pyrene-cis-4,5-dihydrodiol dehydrogenase activity(GO:0034809) citronellyl-CoA dehydrogenase activity(GO:0034824) menthone dehydrogenase activity(GO:0034838) phthalate 3,4-cis-dihydrodiol dehydrogenase activity(GO:0034912) cinnamate reductase activity(GO:0043786) NADPH-dependent curcumin reductase activity(GO:0052849) NADPH-dependent dihydrocurcumin reductase activity(GO:0052850) |
0.1 | 0.7 | GO:0031849 | olfactory receptor binding(GO:0031849) |
0.1 | 0.4 | GO:0008449 | N-acetylglucosamine-6-sulfatase activity(GO:0008449) |
0.1 | 3.1 | GO:0017134 | fibroblast growth factor binding(GO:0017134) |
0.1 | 0.3 | GO:0031752 | D5 dopamine receptor binding(GO:0031752) |
0.1 | 0.3 | GO:0015222 | serotonin transmembrane transporter activity(GO:0015222) |
0.1 | 0.3 | GO:0047276 | N-acetyllactosaminide 3-alpha-galactosyltransferase activity(GO:0047276) |
0.1 | 0.3 | GO:0016971 | flavin-linked sulfhydryl oxidase activity(GO:0016971) |
0.1 | 1.9 | GO:0008266 | poly(U) RNA binding(GO:0008266) |
0.1 | 0.3 | GO:0008142 | oxysterol binding(GO:0008142) |
0.1 | 0.6 | GO:0019870 | potassium channel inhibitor activity(GO:0019870) |
0.1 | 0.6 | GO:0008420 | CTD phosphatase activity(GO:0008420) |
0.1 | 0.6 | GO:0016936 | galactoside binding(GO:0016936) |
0.1 | 0.5 | GO:0051525 | NFAT protein binding(GO:0051525) |
0.1 | 1.1 | GO:0008574 | ATP-dependent microtubule motor activity, plus-end-directed(GO:0008574) |
0.1 | 0.6 | GO:0016308 | 1-phosphatidylinositol-4-phosphate 5-kinase activity(GO:0016308) |
0.1 | 0.3 | GO:0070053 | thrombospondin receptor activity(GO:0070053) |
0.1 | 0.2 | GO:0004938 | alpha2-adrenergic receptor activity(GO:0004938) |
0.1 | 0.3 | GO:0016531 | copper chaperone activity(GO:0016531) |
0.1 | 0.4 | GO:0015189 | arginine transmembrane transporter activity(GO:0015181) L-lysine transmembrane transporter activity(GO:0015189) |
0.1 | 0.3 | GO:0071532 | ankyrin repeat binding(GO:0071532) |
0.1 | 0.2 | GO:0004096 | catalase activity(GO:0004096) |
0.1 | 0.2 | GO:0004829 | threonine-tRNA ligase activity(GO:0004829) |
0.1 | 0.3 | GO:0030572 | cardiolipin synthase activity(GO:0008808) phosphatidyltransferase activity(GO:0030572) |
0.1 | 0.3 | GO:0003840 | gamma-glutamyltransferase activity(GO:0003840) glutathione hydrolase activity(GO:0036374) |
0.1 | 0.2 | GO:0004174 | electron-transferring-flavoprotein dehydrogenase activity(GO:0004174) oxidoreductase activity, acting on the CH-NH group of donors, quinone or similar compound as acceptor(GO:0016649) |
0.1 | 0.3 | GO:0004826 | phenylalanine-tRNA ligase activity(GO:0004826) |
0.1 | 0.2 | GO:0004082 | bisphosphoglycerate mutase activity(GO:0004082) phosphoglycerate mutase activity(GO:0004619) 2,3-bisphosphoglycerate-dependent phosphoglycerate mutase activity(GO:0046538) |
0.1 | 0.5 | GO:0003708 | retinoic acid receptor activity(GO:0003708) |
0.1 | 1.1 | GO:0042800 | histone methyltransferase activity (H3-K4 specific)(GO:0042800) |
0.1 | 0.8 | GO:0008143 | poly(A) binding(GO:0008143) |
0.1 | 0.6 | GO:0005172 | vascular endothelial growth factor receptor binding(GO:0005172) |
0.1 | 0.1 | GO:0070698 | type I activin receptor binding(GO:0070698) |
0.1 | 0.7 | GO:0017065 | single-strand selective uracil DNA N-glycosylase activity(GO:0017065) nicotinamide riboside hydrolase activity(GO:0070635) nicotinic acid riboside hydrolase activity(GO:0070636) deoxyribonucleoside 5'-monophosphate N-glycosidase activity(GO:0070694) |
0.1 | 0.2 | GO:0030943 | mitochondrion targeting sequence binding(GO:0030943) |
0.1 | 0.8 | GO:0008418 | protein-N-terminal asparagine amidohydrolase activity(GO:0008418) UDP-3-O-[3-hydroxymyristoyl] N-acetylglucosamine deacetylase activity(GO:0008759) iprodione amidohydrolase activity(GO:0018748) (3,5-dichlorophenylurea)acetate amidohydrolase activity(GO:0018749) 4'-(2-hydroxyisopropyl)phenylurea amidohydrolase activity(GO:0034571) didemethylisoproturon amidohydrolase activity(GO:0034573) N-isopropylacetanilide amidohydrolase activity(GO:0034576) N-cyclohexylformamide amidohydrolase activity(GO:0034781) isonicotinic acid hydrazide hydrolase activity(GO:0034876) cis-aconitamide amidase activity(GO:0034882) gamma-N-formylaminovinylacetate hydrolase activity(GO:0034885) N2-acetyl-L-lysine deacetylase activity(GO:0043747) O-succinylbenzoate synthase activity(GO:0043748) indoleacetamide hydrolase activity(GO:0043864) N-acetylcitrulline deacetylase activity(GO:0043909) N-acetylgalactosamine-6-phosphate deacetylase activity(GO:0047419) diacetylchitobiose deacetylase activity(GO:0052773) chitooligosaccharide deacetylase activity(GO:0052790) |
0.1 | 0.8 | GO:0005337 | nucleoside transmembrane transporter activity(GO:0005337) |
0.1 | 0.2 | GO:0000405 | bubble DNA binding(GO:0000405) |
0.1 | 0.2 | GO:0033592 | RNA strand annealing activity(GO:0033592) |
0.1 | 0.3 | GO:0046624 | sphingolipid transporter activity(GO:0046624) |
0.1 | 0.2 | GO:0070051 | fibrinogen binding(GO:0070051) |
0.1 | 0.8 | GO:0005521 | lamin binding(GO:0005521) |
0.1 | 0.3 | GO:0004396 | glucokinase activity(GO:0004340) hexokinase activity(GO:0004396) |
0.1 | 1.1 | GO:0005070 | SH3/SH2 adaptor activity(GO:0005070) |
0.1 | 0.6 | GO:0017154 | semaphorin receptor activity(GO:0017154) |
0.1 | 0.3 | GO:0035473 | lipase binding(GO:0035473) |
0.1 | 0.2 | GO:0015183 | L-aspartate transmembrane transporter activity(GO:0015183) |
0.1 | 0.3 | GO:0008603 | cAMP-dependent protein kinase regulator activity(GO:0008603) |
0.1 | 0.4 | GO:0043023 | ribosomal large subunit binding(GO:0043023) |
0.1 | 0.2 | GO:0046978 | TAP1 binding(GO:0046978) TAP2 binding(GO:0046979) |
0.0 | 0.1 | GO:0070644 | vitamin D response element binding(GO:0070644) |
0.0 | 0.2 | GO:0004337 | geranyltranstransferase activity(GO:0004337) |
0.0 | 0.1 | GO:0030172 | troponin C binding(GO:0030172) |
0.0 | 0.2 | GO:0042015 | interleukin-20 binding(GO:0042015) |
0.0 | 0.1 | GO:0050692 | DBD domain binding(GO:0050692) |
0.0 | 0.1 | GO:0030350 | iron-responsive element binding(GO:0030350) |
0.0 | 0.2 | GO:0004758 | serine C-palmitoyltransferase activity(GO:0004758) |
0.0 | 0.7 | GO:0017081 | chloride channel regulator activity(GO:0017081) |
0.0 | 0.2 | GO:0004165 | dodecenoyl-CoA delta-isomerase activity(GO:0004165) |
0.0 | 0.3 | GO:0031432 | titin binding(GO:0031432) |
0.0 | 0.3 | GO:0004128 | cytochrome-b5 reductase activity, acting on NAD(P)H(GO:0004128) |
0.0 | 0.2 | GO:0047499 | calcium-independent phospholipase A2 activity(GO:0047499) |
0.0 | 0.2 | GO:0032896 | palmitoyl-CoA 9-desaturase activity(GO:0032896) |
0.0 | 0.2 | GO:0051434 | BH3 domain binding(GO:0051434) |
0.0 | 0.5 | GO:0005243 | gap junction channel activity(GO:0005243) |
0.0 | 0.2 | GO:0004062 | aryl sulfotransferase activity(GO:0004062) |
0.0 | 0.3 | GO:0019966 | interleukin-1 binding(GO:0019966) |
0.0 | 2.3 | GO:0004869 | cysteine-type endopeptidase inhibitor activity(GO:0004869) |
0.0 | 0.1 | GO:0008597 | calcium-dependent protein serine/threonine phosphatase regulator activity(GO:0008597) |
0.0 | 0.4 | GO:0031996 | thioesterase binding(GO:0031996) |
0.0 | 0.2 | GO:0005534 | galactose binding(GO:0005534) |
0.0 | 0.4 | GO:0003854 | 3-beta-hydroxy-delta5-steroid dehydrogenase activity(GO:0003854) |
0.0 | 0.3 | GO:0001758 | retinal dehydrogenase activity(GO:0001758) |
0.0 | 0.2 | GO:0005250 | A-type (transient outward) potassium channel activity(GO:0005250) |
0.0 | 0.2 | GO:0098639 | collagen binding involved in cell-matrix adhesion(GO:0098639) |
0.0 | 0.3 | GO:0032552 | deoxyribonucleotide binding(GO:0032552) |
0.0 | 0.3 | GO:0004931 | extracellular ATP-gated cation channel activity(GO:0004931) ATP-gated ion channel activity(GO:0035381) |
0.0 | 0.1 | GO:0004515 | nicotinamide-nucleotide adenylyltransferase activity(GO:0000309) nicotinate-nucleotide adenylyltransferase activity(GO:0004515) |
0.0 | 0.4 | GO:0001162 | RNA polymerase II intronic transcription regulatory region sequence-specific DNA binding(GO:0001162) |
0.0 | 1.9 | GO:0005160 | transforming growth factor beta receptor binding(GO:0005160) |
0.0 | 0.3 | GO:1990381 | ubiquitin-specific protease binding(GO:1990381) |
0.0 | 0.4 | GO:0070016 | armadillo repeat domain binding(GO:0070016) |
0.0 | 0.1 | GO:0033265 | choline binding(GO:0033265) |
0.0 | 0.1 | GO:0004616 | phosphogluconate dehydrogenase (decarboxylating) activity(GO:0004616) |
0.0 | 0.2 | GO:0005134 | interleukin-2 receptor binding(GO:0005134) |
0.0 | 0.1 | GO:0005006 | epidermal growth factor-activated receptor activity(GO:0005006) |
0.0 | 0.4 | GO:0003993 | acid phosphatase activity(GO:0003993) |
0.0 | 0.8 | GO:0071889 | 14-3-3 protein binding(GO:0071889) |
0.0 | 0.1 | GO:0030229 | very-low-density lipoprotein particle receptor activity(GO:0030229) |
0.0 | 0.1 | GO:0050220 | prostaglandin-E synthase activity(GO:0050220) |
0.0 | 0.4 | GO:0030296 | protein tyrosine kinase activator activity(GO:0030296) |
0.0 | 0.1 | GO:0071987 | WD40-repeat domain binding(GO:0071987) |
0.0 | 0.3 | GO:0071949 | FAD binding(GO:0071949) |
0.0 | 0.1 | GO:0015232 | heme transporter activity(GO:0015232) |
0.0 | 0.1 | GO:0005176 | ErbB-2 class receptor binding(GO:0005176) |
0.0 | 0.1 | GO:0005047 | signal recognition particle binding(GO:0005047) |
0.0 | 0.1 | GO:0016885 | ligase activity, forming carbon-carbon bonds(GO:0016885) |
0.0 | 0.2 | GO:0070290 | N-acylphosphatidylethanolamine-specific phospholipase D activity(GO:0070290) |
0.0 | 0.3 | GO:0050649 | testosterone 6-beta-hydroxylase activity(GO:0050649) |
0.0 | 0.5 | GO:0043274 | phospholipase binding(GO:0043274) |
0.0 | 0.5 | GO:0030955 | potassium ion binding(GO:0030955) |
0.0 | 0.3 | GO:0016857 | racemase and epimerase activity, acting on carbohydrates and derivatives(GO:0016857) |
0.0 | 0.1 | GO:0035175 | histone kinase activity (H3-S10 specific)(GO:0035175) |
0.0 | 0.2 | GO:0031730 | CCR5 chemokine receptor binding(GO:0031730) |
0.0 | 0.1 | GO:0003886 | DNA (cytosine-5-)-methyltransferase activity(GO:0003886) DNA (cytosine-5-)-methyltransferase activity, acting on CpG substrates(GO:0051718) |
0.0 | 0.5 | GO:0042975 | peroxisome proliferator activated receptor binding(GO:0042975) |
0.0 | 0.2 | GO:0003680 | AT DNA binding(GO:0003680) |
0.0 | 0.5 | GO:0004089 | carbonate dehydratase activity(GO:0004089) |
0.0 | 1.1 | GO:0048487 | beta-tubulin binding(GO:0048487) |
0.0 | 0.2 | GO:0050072 | m7G(5')pppN diphosphatase activity(GO:0050072) |
0.0 | 0.2 | GO:0030957 | Tat protein binding(GO:0030957) |
0.0 | 0.1 | GO:0031014 | troponin T binding(GO:0031014) |
0.0 | 1.3 | GO:0050840 | extracellular matrix binding(GO:0050840) |
0.0 | 0.1 | GO:0046912 | transferase activity, transferring acyl groups, acyl groups converted into alkyl on transfer(GO:0046912) |
0.0 | 0.1 | GO:0001884 | pyrimidine nucleoside binding(GO:0001884) |
0.0 | 0.2 | GO:0016175 | superoxide-generating NADPH oxidase activity(GO:0016175) |
0.0 | 0.1 | GO:0008504 | monoamine transmembrane transporter activity(GO:0008504) |
0.0 | 1.6 | GO:0005200 | structural constituent of cytoskeleton(GO:0005200) |
0.0 | 0.1 | GO:0016520 | growth hormone-releasing hormone receptor activity(GO:0016520) |
0.0 | 0.3 | GO:0044183 | protein binding involved in protein folding(GO:0044183) |
0.0 | 0.1 | GO:0005173 | stem cell factor receptor binding(GO:0005173) |
0.0 | 0.4 | GO:0032794 | GTPase activating protein binding(GO:0032794) |
0.0 | 0.2 | GO:0043208 | glycosphingolipid binding(GO:0043208) |
0.0 | 0.1 | GO:0004445 | inositol-polyphosphate 5-phosphatase activity(GO:0004445) |
0.0 | 0.1 | GO:0019784 | NEDD8-specific protease activity(GO:0019784) |
0.0 | 0.2 | GO:0008307 | structural constituent of muscle(GO:0008307) |
0.0 | 0.1 | GO:0032137 | guanine/thymine mispair binding(GO:0032137) |
0.0 | 0.3 | GO:0044548 | S100 protein binding(GO:0044548) |
0.0 | 0.2 | GO:0052835 | cobinamide kinase activity(GO:0008819) phytol kinase activity(GO:0010276) phenol kinase activity(GO:0018720) cyclin-dependent protein kinase activating kinase regulator activity(GO:0019914) inositol tetrakisphosphate 2-kinase activity(GO:0032942) heptose 7-phosphate kinase activity(GO:0033785) aminoglycoside phosphotransferase activity(GO:0034071) eukaryotic elongation factor-2 kinase regulator activity(GO:0042556) eukaryotic elongation factor-2 kinase activator activity(GO:0042557) LPPG:FO 2-phospho-L-lactate transferase activity(GO:0043743) cytidine kinase activity(GO:0043771) glycerate 2-kinase activity(GO:0043798) (S)-lactate 2-kinase activity(GO:0043841) phosphoserine:homoserine phosphotransferase activity(GO:0043899) L-seryl-tRNA(Sec) kinase activity(GO:0043915) phosphocholine transferase activity(GO:0044605) GTP-dependent polynucleotide kinase activity(GO:0051735) farnesol kinase activity(GO:0052668) CTP:2-trans,-6-trans-farnesol kinase activity(GO:0052669) geraniol kinase activity(GO:0052670) geranylgeraniol kinase activity(GO:0052671) CTP:geranylgeraniol kinase activity(GO:0052672) prenol kinase activity(GO:0052673) 1-phosphatidylinositol-5-kinase activity(GO:0052810) 1-phosphatidylinositol-3-phosphate 4-kinase activity(GO:0052811) phosphatidylinositol-3,4-bisphosphate 5-kinase activity(GO:0052812) inositol-3,4,6-trisphosphate 1-kinase activity(GO:0052835) inositol 5-diphosphate pentakisphosphate 5-kinase activity(GO:0052836) inositol diphosphate tetrakisphosphate kinase activity(GO:0052839) |
0.0 | 0.2 | GO:0048406 | nerve growth factor binding(GO:0048406) |
0.0 | 0.5 | GO:0008157 | protein phosphatase 1 binding(GO:0008157) |
0.0 | 0.0 | GO:0048408 | epidermal growth factor binding(GO:0048408) |
0.0 | 0.1 | GO:0015057 | thrombin receptor activity(GO:0015057) |
0.0 | 0.3 | GO:0001784 | phosphotyrosine binding(GO:0001784) |
0.0 | 0.4 | GO:0051393 | alpha-actinin binding(GO:0051393) |
0.0 | 0.0 | GO:0070915 | lysophosphatidic acid receptor activity(GO:0070915) |
0.0 | 0.1 | GO:0004862 | cAMP-dependent protein kinase inhibitor activity(GO:0004862) |
0.0 | 0.4 | GO:0031434 | mitogen-activated protein kinase kinase binding(GO:0031434) |
0.0 | 0.0 | GO:0031893 | vasopressin receptor binding(GO:0031893) |
0.0 | 0.9 | GO:0004715 | non-membrane spanning protein tyrosine kinase activity(GO:0004715) |
0.0 | 0.1 | GO:0097322 | 7SK snRNA binding(GO:0097322) |
0.0 | 0.1 | GO:0015265 | urea channel activity(GO:0015265) |
0.0 | 0.1 | GO:0003918 | DNA topoisomerase type II (ATP-hydrolyzing) activity(GO:0003918) DNA topoisomerase II activity(GO:0061505) |
0.0 | 0.3 | GO:0043325 | phosphatidylinositol-3,4-bisphosphate binding(GO:0043325) |
0.0 | 0.1 | GO:0017108 | 5'-flap endonuclease activity(GO:0017108) |
0.0 | 0.3 | GO:0008327 | methyl-CpG binding(GO:0008327) |
0.0 | 0.2 | GO:0005161 | platelet-derived growth factor receptor binding(GO:0005161) |
0.0 | 0.1 | GO:0005168 | neurotrophin TRKA receptor binding(GO:0005168) |
0.0 | 0.9 | GO:0035064 | methylated histone binding(GO:0035064) |
0.0 | 0.0 | GO:0045322 | unmethylated CpG binding(GO:0045322) |
0.0 | 0.0 | GO:0016530 | metallochaperone activity(GO:0016530) |
0.0 | 1.9 | GO:0042826 | histone deacetylase binding(GO:0042826) |
0.0 | 0.2 | GO:0019531 | oxalate transmembrane transporter activity(GO:0019531) |
0.0 | 2.2 | GO:0030165 | PDZ domain binding(GO:0030165) |
0.0 | 0.1 | GO:0008515 | sucrose:proton symporter activity(GO:0008506) sucrose transmembrane transporter activity(GO:0008515) disaccharide transmembrane transporter activity(GO:0015154) oligosaccharide transmembrane transporter activity(GO:0015157) |
0.0 | 0.1 | GO:0046975 | histone methyltransferase activity (H3-K36 specific)(GO:0046975) |
0.0 | 0.1 | GO:0005105 | type 1 fibroblast growth factor receptor binding(GO:0005105) |
0.0 | 0.0 | GO:0004103 | choline kinase activity(GO:0004103) |
0.0 | 0.2 | GO:0038191 | neuropilin binding(GO:0038191) |
0.0 | 0.1 | GO:0032190 | acrosin binding(GO:0032190) |
0.0 | 0.3 | GO:0043539 | protein serine/threonine kinase activator activity(GO:0043539) |
0.0 | 0.1 | GO:0030250 | cyclase activator activity(GO:0010853) guanylate cyclase activator activity(GO:0030250) |
0.0 | 0.0 | GO:0005519 | cytoskeletal regulatory protein binding(GO:0005519) |
0.0 | 0.1 | GO:0034481 | chondroitin sulfotransferase activity(GO:0034481) |
0.0 | 0.1 | GO:0061665 | SUMO ligase activity(GO:0061665) |
0.0 | 0.1 | GO:0016778 | diphosphotransferase activity(GO:0016778) |
0.0 | 0.1 | GO:0017034 | Rap guanyl-nucleotide exchange factor activity(GO:0017034) |
0.0 | 0.0 | GO:0034046 | poly(G) binding(GO:0034046) |
0.0 | 0.2 | GO:0070180 | large ribosomal subunit rRNA binding(GO:0070180) |
0.0 | 0.1 | GO:0047192 | 1-alkylglycerophosphocholine O-acetyltransferase activity(GO:0047192) |
0.0 | 0.8 | GO:0000049 | tRNA binding(GO:0000049) |
0.0 | 0.0 | GO:0070905 | serine binding(GO:0070905) |
0.0 | 0.1 | GO:0048027 | mRNA 5'-UTR binding(GO:0048027) |
0.0 | 2.6 | GO:0005516 | calmodulin binding(GO:0005516) |
0.0 | 0.1 | GO:0044213 | intronic transcription regulatory region DNA binding(GO:0044213) |
0.0 | 0.8 | GO:0017022 | myosin binding(GO:0017022) |
0.0 | 0.0 | GO:0072542 | protein phosphatase activator activity(GO:0072542) |
0.0 | 0.1 | GO:0001069 | regulatory region RNA binding(GO:0001069) |
0.0 | 0.1 | GO:0052796 | exo-alpha-sialidase activity(GO:0004308) alpha-sialidase activity(GO:0016997) exo-alpha-(2->3)-sialidase activity(GO:0052794) exo-alpha-(2->6)-sialidase activity(GO:0052795) exo-alpha-(2->8)-sialidase activity(GO:0052796) |
0.0 | 0.2 | GO:0047555 | 3',5'-cyclic-GMP phosphodiesterase activity(GO:0047555) |
0.0 | 0.0 | GO:0060228 | phosphatidylcholine-sterol O-acyltransferase activator activity(GO:0060228) |
0.0 | 0.1 | GO:0004013 | adenosylhomocysteinase activity(GO:0004013) trialkylsulfonium hydrolase activity(GO:0016802) |
0.0 | 0.1 | GO:0031749 | D2 dopamine receptor binding(GO:0031749) |
0.0 | 0.2 | GO:0034450 | ubiquitin-ubiquitin ligase activity(GO:0034450) |
0.0 | 0.1 | GO:0031995 | insulin-like growth factor II binding(GO:0031995) |
0.0 | 0.1 | GO:0004301 | epoxide hydrolase activity(GO:0004301) |
0.0 | 0.0 | GO:0004699 | calcium-independent protein kinase C activity(GO:0004699) |
0.0 | 0.1 | GO:0070653 | high-density lipoprotein particle receptor binding(GO:0070653) |
0.0 | 0.1 | GO:0016401 | palmitoyl-CoA oxidase activity(GO:0016401) |
0.0 | 1.4 | GO:0017124 | SH3 domain binding(GO:0017124) |
0.0 | 0.1 | GO:0050897 | cobalt ion binding(GO:0050897) |
0.0 | 1.5 | GO:0017137 | Rab GTPase binding(GO:0017137) |
0.0 | 0.1 | GO:0003836 | beta-galactoside (CMP) alpha-2,3-sialyltransferase activity(GO:0003836) |
0.0 | 0.1 | GO:0005338 | nucleotide-sugar transmembrane transporter activity(GO:0005338) |
0.0 | 0.0 | GO:0035529 | NADH pyrophosphatase activity(GO:0035529) |
0.0 | 0.7 | GO:0048306 | calcium-dependent protein binding(GO:0048306) |
0.0 | 0.1 | GO:0001515 | opioid peptide activity(GO:0001515) |
0.0 | 0.1 | GO:0004716 | receptor signaling protein tyrosine kinase activity(GO:0004716) |
0.0 | 0.1 | GO:0004652 | polynucleotide adenylyltransferase activity(GO:0004652) |
0.0 | 0.0 | GO:0019862 | IgA binding(GO:0019862) |
0.0 | 0.4 | GO:0003887 | DNA-directed DNA polymerase activity(GO:0003887) |
0.0 | 0.2 | GO:0005547 | phosphatidylinositol-3,4,5-trisphosphate binding(GO:0005547) |
0.0 | 0.0 | GO:0043262 | adenosine-diphosphatase activity(GO:0043262) |
0.0 | 0.0 | GO:0015106 | bicarbonate transmembrane transporter activity(GO:0015106) |
0.0 | 0.1 | GO:0004767 | sphingomyelin phosphodiesterase activity(GO:0004767) |
0.0 | 0.3 | GO:0004181 | metallocarboxypeptidase activity(GO:0004181) |
0.0 | 0.0 | GO:0097506 | uracil DNA N-glycosylase activity(GO:0004844) deaminated base DNA N-glycosylase activity(GO:0097506) |
0.0 | 0.1 | GO:0070410 | co-SMAD binding(GO:0070410) |
0.0 | 0.1 | GO:0004045 | aminoacyl-tRNA hydrolase activity(GO:0004045) |
0.0 | 0.2 | GO:0004551 | nucleotide diphosphatase activity(GO:0004551) |
0.0 | 0.2 | GO:0070008 | serine-type exopeptidase activity(GO:0070008) |
0.0 | 0.0 | GO:0019961 | interferon binding(GO:0019961) |
0.0 | 0.0 | GO:0019776 | Atg8 ligase activity(GO:0019776) |
0.0 | 0.0 | GO:0015450 | P-P-bond-hydrolysis-driven protein transmembrane transporter activity(GO:0015450) |
0.0 | 0.1 | GO:0015193 | L-proline transmembrane transporter activity(GO:0015193) |
0.0 | 0.0 | GO:0030375 | thyroid hormone receptor coactivator activity(GO:0030375) |
0.0 | 0.1 | GO:0015037 | peptide disulfide oxidoreductase activity(GO:0015037) |
0.0 | 0.2 | GO:0005123 | death receptor binding(GO:0005123) |
0.0 | 0.1 | GO:0050811 | GABA receptor binding(GO:0050811) |
0.0 | 0.2 | GO:0005035 | tumor necrosis factor-activated receptor activity(GO:0005031) death receptor activity(GO:0005035) |
0.0 | 0.0 | GO:0043533 | inositol 1,3,4,5 tetrakisphosphate binding(GO:0043533) |
0.0 | 0.0 | GO:0004942 | anaphylatoxin receptor activity(GO:0004942) |
0.0 | 0.3 | GO:0004298 | threonine-type endopeptidase activity(GO:0004298) threonine-type peptidase activity(GO:0070003) |
0.0 | 0.0 | GO:0042284 | sphingolipid delta-4 desaturase activity(GO:0042284) |
0.0 | 0.0 | GO:0004661 | protein geranylgeranyltransferase activity(GO:0004661) |
0.0 | 0.1 | GO:0004526 | ribonuclease P activity(GO:0004526) |
0.0 | 0.1 | GO:0097371 | MDM2/MDM4 family protein binding(GO:0097371) |
0.0 | 0.1 | GO:0001968 | fibronectin binding(GO:0001968) |
0.0 | 0.1 | GO:0033170 | DNA clamp loader activity(GO:0003689) protein-DNA loading ATPase activity(GO:0033170) |
0.0 | 0.0 | GO:0015252 | hydrogen ion channel activity(GO:0015252) |
0.0 | 0.1 | GO:0017176 | phosphatidylinositol N-acetylglucosaminyltransferase activity(GO:0017176) |
0.0 | 0.1 | GO:0005225 | volume-sensitive anion channel activity(GO:0005225) |
0.0 | 0.1 | GO:0008889 | glycerophosphodiester phosphodiesterase activity(GO:0008889) |
0.0 | 0.1 | GO:0034889 | alkyl sulfatase activity(GO:0018741) endosulfan hemisulfate sulfatase activity(GO:0034889) endosulfan sulfate hydrolase activity(GO:0034902) |
0.0 | 0.8 | GO:0004896 | cytokine receptor activity(GO:0004896) |
0.0 | 0.2 | GO:0016641 | oxidoreductase activity, acting on the CH-NH2 group of donors, oxygen as acceptor(GO:0016641) |
0.0 | 0.1 | GO:0035497 | cAMP response element binding(GO:0035497) |
0.0 | 0.1 | GO:0016920 | pyroglutamyl-peptidase activity(GO:0016920) |
0.0 | 0.1 | GO:0030546 | receptor activator activity(GO:0030546) |
0.0 | 0.0 | GO:0003726 | double-stranded RNA adenosine deaminase activity(GO:0003726) |
0.0 | 0.1 | GO:0008494 | translation activator activity(GO:0008494) |
0.0 | 0.0 | GO:0004972 | NMDA glutamate receptor activity(GO:0004972) |
0.0 | 0.1 | GO:0004579 | dolichyl-diphosphooligosaccharide-protein glycotransferase activity(GO:0004579) |
0.0 | 0.0 | GO:1990380 | Lys48-specific deubiquitinase activity(GO:1990380) |
0.0 | 0.3 | GO:0005385 | zinc ion transmembrane transporter activity(GO:0005385) |
0.0 | 0.2 | GO:0016290 | palmitoyl-CoA hydrolase activity(GO:0016290) |
0.0 | 0.0 | GO:0017153 | sodium:dicarboxylate symporter activity(GO:0017153) |
0.0 | 0.1 | GO:0005523 | tropomyosin binding(GO:0005523) |
0.0 | 0.0 | GO:0051864 | histone demethylase activity (H3-K36 specific)(GO:0051864) |
0.0 | 0.0 | GO:0004582 | dolichyl-phosphate beta-D-mannosyltransferase activity(GO:0004582) |
0.0 | 0.0 | GO:0008475 | procollagen-lysine 5-dioxygenase activity(GO:0008475) |
0.0 | 0.0 | GO:0032795 | heterotrimeric G-protein binding(GO:0032795) |
0.0 | 0.1 | GO:0005520 | insulin-like growth factor binding(GO:0005520) |
0.0 | 0.1 | GO:0005049 | nuclear export signal receptor activity(GO:0005049) |
0.0 | 0.2 | GO:0001103 | RNA polymerase II repressing transcription factor binding(GO:0001103) |
0.0 | 0.8 | GO:0003774 | motor activity(GO:0003774) |
0.0 | 0.0 | GO:0016015 | morphogen activity(GO:0016015) |
0.0 | 0.0 | GO:1990226 | histone methyltransferase binding(GO:1990226) |
0.0 | 0.1 | GO:0003688 | DNA replication origin binding(GO:0003688) |
0.0 | 0.0 | GO:0016018 | cyclosporin A binding(GO:0016018) |
0.0 | 0.1 | GO:0103116 | alpha-D-galactofuranose transporter activity(GO:0103116) |
0.0 | 0.0 | GO:0004332 | fructose-bisphosphate aldolase activity(GO:0004332) |
0.0 | 0.1 | GO:0097602 | cullin family protein binding(GO:0097602) |
0.0 | 0.1 | GO:0005149 | interleukin-1 receptor binding(GO:0005149) |
0.0 | 0.0 | GO:0002094 | polyprenyltransferase activity(GO:0002094) |
0.0 | 0.0 | GO:0004514 | nicotinate-nucleotide diphosphorylase (carboxylating) activity(GO:0004514) |
0.0 | 0.1 | GO:0050733 | RS domain binding(GO:0050733) |
0.0 | 0.0 | GO:0005143 | interleukin-12 receptor binding(GO:0005143) |
0.0 | 0.1 | GO:0008140 | cAMP response element binding protein binding(GO:0008140) |
0.0 | 0.4 | GO:0033613 | activating transcription factor binding(GO:0033613) |
0.0 | 0.0 | GO:2001069 | glycogen binding(GO:2001069) |
0.0 | 0.1 | GO:0070064 | proline-rich region binding(GO:0070064) |
0.0 | 0.1 | GO:0031419 | cobalamin binding(GO:0031419) |
0.0 | 0.2 | GO:0051019 | mitogen-activated protein kinase binding(GO:0051019) |
0.0 | 0.1 | GO:0005487 | nucleocytoplasmic transporter activity(GO:0005487) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.1 | 2.9 | PID RAS PATHWAY | Regulation of Ras family activation |
0.1 | 2.0 | PID INTEGRIN2 PATHWAY | Beta2 integrin cell surface interactions |
0.1 | 0.9 | SA MMP CYTOKINE CONNECTION | Cytokines can induce activation of matrix metalloproteinases, which degrade extracellular matrix. |
0.1 | 0.7 | PID ANTHRAX PATHWAY | Cellular roles of Anthrax toxin |
0.1 | 1.0 | PID PDGFRA PATHWAY | PDGFR-alpha signaling pathway |
0.1 | 1.3 | PID LYMPH ANGIOGENESIS PATHWAY | VEGFR3 signaling in lymphatic endothelium |
0.0 | 0.7 | PID VEGFR1 PATHWAY | VEGFR1 specific signals |
0.0 | 0.2 | PID FOXO PATHWAY | FoxO family signaling |
0.0 | 0.3 | SIG PIP3 SIGNALING IN CARDIAC MYOCTES | Genes related to PIP3 signaling in cardiac myocytes |
0.0 | 1.1 | PID AURORA A PATHWAY | Aurora A signaling |
0.0 | 2.1 | PID TAP63 PATHWAY | Validated transcriptional targets of TAp63 isoforms |
0.0 | 0.4 | PID INTEGRIN4 PATHWAY | Alpha6 beta4 integrin-ligand interactions |
0.0 | 0.1 | PID PI3KCI AKT PATHWAY | Class I PI3K signaling events mediated by Akt |
0.0 | 0.8 | PID RETINOIC ACID PATHWAY | Retinoic acid receptors-mediated signaling |
0.0 | 0.5 | ST G ALPHA S PATHWAY | G alpha s Pathway |
0.0 | 0.1 | ST INTERFERON GAMMA PATHWAY | Interferon gamma pathway. |
0.0 | 0.5 | PID P38 MK2 PATHWAY | p38 signaling mediated by MAPKAP kinases |
0.0 | 0.4 | PID HIF1A PATHWAY | Hypoxic and oxygen homeostasis regulation of HIF-1-alpha |
0.0 | 0.8 | PID HNF3A PATHWAY | FOXA1 transcription factor network |
0.0 | 0.1 | ST JNK MAPK PATHWAY | JNK MAPK Pathway |
0.0 | 0.1 | ST JAK STAT PATHWAY | Jak-STAT Pathway |
0.0 | 1.0 | PID FAK PATHWAY | Signaling events mediated by focal adhesion kinase |
0.0 | 0.9 | NABA BASEMENT MEMBRANES | Genes encoding structural components of basement membranes |
0.0 | 0.0 | ST TYPE I INTERFERON PATHWAY | Type I Interferon (alpha/beta IFN) Pathway |
0.0 | 0.4 | PID THROMBIN PAR4 PATHWAY | PAR4-mediated thrombin signaling events |
0.0 | 0.5 | PID WNT CANONICAL PATHWAY | Canonical Wnt signaling pathway |
0.0 | 0.5 | PID GMCSF PATHWAY | GMCSF-mediated signaling events |
0.0 | 0.4 | PID HDAC CLASSIII PATHWAY | Signaling events mediated by HDAC Class III |
0.0 | 0.0 | PID TCPTP PATHWAY | Signaling events mediated by TCPTP |
0.0 | 0.9 | PID ERA GENOMIC PATHWAY | Validated nuclear estrogen receptor alpha network |
0.0 | 0.3 | PID AVB3 OPN PATHWAY | Osteopontin-mediated events |
0.0 | 0.4 | PID INTEGRIN3 PATHWAY | Beta3 integrin cell surface interactions |
0.0 | 0.8 | PID MET PATHWAY | Signaling events mediated by Hepatocyte Growth Factor Receptor (c-Met) |
0.0 | 0.1 | PID AMB2 NEUTROPHILS PATHWAY | amb2 Integrin signaling |
0.0 | 0.2 | PID IFNG PATHWAY | IFN-gamma pathway |
0.0 | 0.5 | PID RHODOPSIN PATHWAY | Visual signal transduction: Rods |
0.0 | 0.3 | ST P38 MAPK PATHWAY | p38 MAPK Pathway |
0.0 | 0.3 | PID IL1 PATHWAY | IL1-mediated signaling events |
0.0 | 0.8 | PID HIF1 TFPATHWAY | HIF-1-alpha transcription factor network |
0.0 | 0.5 | PID ATM PATHWAY | ATM pathway |
0.0 | 0.4 | PID HIV NEF PATHWAY | HIV-1 Nef: Negative effector of Fas and TNF-alpha |
0.0 | 0.5 | SIG REGULATION OF THE ACTIN CYTOSKELETON BY RHO GTPASES | Genes related to regulation of the actin cytoskeleton |
0.0 | 0.5 | PID TGFBR PATHWAY | TGF-beta receptor signaling |
0.0 | 0.1 | PID ERB GENOMIC PATHWAY | Validated nuclear estrogen receptor beta network |
0.0 | 0.0 | SA FAS SIGNALING | The TNF-type receptor Fas induces apoptosis on ligand binding. |
0.0 | 0.8 | PID SMAD2 3NUCLEAR PATHWAY | Regulation of nuclear SMAD2/3 signaling |
0.0 | 0.1 | PID FCER1 PATHWAY | Fc-epsilon receptor I signaling in mast cells |
0.0 | 0.5 | PID HES HEY PATHWAY | Notch-mediated HES/HEY network |
0.0 | 0.1 | PID ALK2 PATHWAY | ALK2 signaling events |
0.0 | 0.0 | SA PROGRAMMED CELL DEATH | Programmed cell death, or apoptosis, eliminates damaged or unneeded cells. |
0.0 | 0.2 | PID ER NONGENOMIC PATHWAY | Plasma membrane estrogen receptor signaling |
0.0 | 0.5 | PID AR PATHWAY | Coregulation of Androgen receptor activity |
0.0 | 0.1 | PID HIF2PATHWAY | HIF-2-alpha transcription factor network |
0.0 | 0.3 | ST WNT BETA CATENIN PATHWAY | Wnt/beta-catenin Pathway |
0.0 | 0.2 | PID REG GR PATHWAY | Glucocorticoid receptor regulatory network |
0.0 | 0.1 | SA REG CASCADE OF CYCLIN EXPR | Expression of cyclins regulates progression through the cell cycle by activating cyclin-dependent kinases. |
0.0 | 0.1 | PID INTEGRIN CS PATHWAY | Integrin family cell surface interactions |
0.0 | 0.2 | PID NFAT 3PATHWAY | Role of Calcineurin-dependent NFAT signaling in lymphocytes |
0.0 | 0.0 | PID BETA CATENIN DEG PATHWAY | Degradation of beta catenin |
0.0 | 0.2 | PID IL27 PATHWAY | IL27-mediated signaling events |
0.0 | 0.5 | PID BETA CATENIN NUC PATHWAY | Regulation of nuclear beta catenin signaling and target gene transcription |
0.0 | 0.1 | PID ARF6 DOWNSTREAM PATHWAY | Arf6 downstream pathway |
0.0 | 0.2 | PID CASPASE PATHWAY | Caspase cascade in apoptosis |
0.0 | 0.1 | PID GLYPICAN 1PATHWAY | Glypican 1 network |
0.0 | 0.2 | PID ECADHERIN NASCENT AJ PATHWAY | E-cadherin signaling in the nascent adherens junction |
0.0 | 0.1 | PID CERAMIDE PATHWAY | Ceramide signaling pathway |
0.0 | 0.1 | PID INSULIN GLUCOSE PATHWAY | Insulin-mediated glucose transport |
0.0 | 1.5 | NABA ECM AFFILIATED | Genes encoding proteins affiliated structurally or functionally to extracellular matrix proteins |
0.0 | 0.3 | PID MYC REPRESS PATHWAY | Validated targets of C-MYC transcriptional repression |
0.0 | 0.1 | PID ANGIOPOIETIN RECEPTOR PATHWAY | Angiopoietin receptor Tie2-mediated signaling |
0.0 | 0.1 | PID FOXM1 PATHWAY | FOXM1 transcription factor network |
0.0 | 0.2 | PID KIT PATHWAY | Signaling events mediated by Stem cell factor receptor (c-Kit) |
0.0 | 0.3 | NABA COLLAGENS | Genes encoding collagen proteins |
0.0 | 0.1 | PID PI3KCI PATHWAY | Class I PI3K signaling events |
0.0 | 0.2 | PID BCR 5PATHWAY | BCR signaling pathway |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.2 | 0.5 | REACTOME REGULATION OF RHEB GTPASE ACTIVITY BY AMPK | Genes involved in Regulation of Rheb GTPase activity by AMPK |
0.1 | 1.4 | REACTOME EXTRINSIC PATHWAY FOR APOPTOSIS | Genes involved in Extrinsic Pathway for Apoptosis |
0.1 | 2.6 | REACTOME SMOOTH MUSCLE CONTRACTION | Genes involved in Smooth Muscle Contraction |
0.1 | 1.8 | REACTOME INTRINSIC PATHWAY | Genes involved in Intrinsic Pathway |
0.1 | 1.3 | REACTOME GAP JUNCTION ASSEMBLY | Genes involved in Gap junction assembly |
0.1 | 1.2 | REACTOME NA CL DEPENDENT NEUROTRANSMITTER TRANSPORTERS | Genes involved in Na+/Cl- dependent neurotransmitter transporters |
0.1 | 0.7 | REACTOME PROLACTIN RECEPTOR SIGNALING | Genes involved in Prolactin receptor signaling |
0.1 | 0.6 | REACTOME APOPTOTIC CLEAVAGE OF CELL ADHESION PROTEINS | Genes involved in Apoptotic cleavage of cell adhesion proteins |
0.1 | 1.2 | REACTOME ACTIVATED AMPK STIMULATES FATTY ACID OXIDATION IN MUSCLE | Genes involved in Activated AMPK stimulates fatty-acid oxidation in muscle |
0.1 | 1.5 | REACTOME ADHERENS JUNCTIONS INTERACTIONS | Genes involved in Adherens junctions interactions |
0.1 | 0.6 | REACTOME BASE FREE SUGAR PHOSPHATE REMOVAL VIA THE SINGLE NUCLEOTIDE REPLACEMENT PATHWAY | Genes involved in Base-free sugar-phosphate removal via the single-nucleotide replacement pathway |
0.1 | 0.9 | REACTOME AMINO ACID SYNTHESIS AND INTERCONVERSION TRANSAMINATION | Genes involved in Amino acid synthesis and interconversion (transamination) |
0.1 | 1.2 | REACTOME ERK MAPK TARGETS | Genes involved in ERK/MAPK targets |
0.1 | 0.3 | REACTOME P130CAS LINKAGE TO MAPK SIGNALING FOR INTEGRINS | Genes involved in p130Cas linkage to MAPK signaling for integrins |
0.0 | 0.3 | REACTOME CREATION OF C4 AND C2 ACTIVATORS | Genes involved in Creation of C4 and C2 activators |
0.0 | 1.0 | REACTOME AMYLOIDS | Genes involved in Amyloids |
0.0 | 0.4 | REACTOME TRAF6 MEDIATED IRF7 ACTIVATION IN TLR7 8 OR 9 SIGNALING | Genes involved in TRAF6 mediated IRF7 activation in TLR7/8 or 9 signaling |
0.0 | 0.0 | REACTOME ACYL CHAIN REMODELLING OF PS | Genes involved in Acyl chain remodelling of PS |
0.0 | 1.1 | REACTOME SPHINGOLIPID DE NOVO BIOSYNTHESIS | Genes involved in Sphingolipid de novo biosynthesis |
0.0 | 0.1 | REACTOME INFLUENZA VIRAL RNA TRANSCRIPTION AND REPLICATION | Genes involved in Influenza Viral RNA Transcription and Replication |
0.0 | 1.0 | REACTOME AMINO ACID TRANSPORT ACROSS THE PLASMA MEMBRANE | Genes involved in Amino acid transport across the plasma membrane |
0.0 | 0.9 | REACTOME PRE NOTCH TRANSCRIPTION AND TRANSLATION | Genes involved in Pre-NOTCH Transcription and Translation |
0.0 | 0.6 | REACTOME REGULATION OF HYPOXIA INDUCIBLE FACTOR HIF BY OXYGEN | Genes involved in Regulation of Hypoxia-inducible Factor (HIF) by Oxygen |
0.0 | 0.3 | REACTOME ACYL CHAIN REMODELLING OF PC | Genes involved in Acyl chain remodelling of PC |
0.0 | 0.6 | REACTOME MYOGENESIS | Genes involved in Myogenesis |
0.0 | 2.1 | REACTOME RESPIRATORY ELECTRON TRANSPORT | Genes involved in Respiratory electron transport |
0.0 | 0.5 | REACTOME SIGNALING BY FGFR1 FUSION MUTANTS | Genes involved in Signaling by FGFR1 fusion mutants |
0.0 | 0.3 | REACTOME THE NLRP3 INFLAMMASOME | Genes involved in The NLRP3 inflammasome |
0.0 | 0.6 | REACTOME ABORTIVE ELONGATION OF HIV1 TRANSCRIPT IN THE ABSENCE OF TAT | Genes involved in Abortive elongation of HIV-1 transcript in the absence of Tat |
0.0 | 0.5 | REACTOME DARPP 32 EVENTS | Genes involved in DARPP-32 events |
0.0 | 0.5 | REACTOME SIGNALING BY HIPPO | Genes involved in Signaling by Hippo |
0.0 | 0.0 | REACTOME PLATELET ACTIVATION SIGNALING AND AGGREGATION | Genes involved in Platelet activation, signaling and aggregation |
0.0 | 0.3 | REACTOME ACETYLCHOLINE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Acetylcholine Neurotransmitter Release Cycle |
0.0 | 0.4 | REACTOME TRAF6 MEDIATED NFKB ACTIVATION | Genes involved in TRAF6 mediated NF-kB activation |
0.0 | 0.2 | REACTOME GAMMA CARBOXYLATION TRANSPORT AND AMINO TERMINAL CLEAVAGE OF PROTEINS | Genes involved in Gamma-carboxylation, transport, and amino-terminal cleavage of proteins |
0.0 | 0.6 | REACTOME SEMA4D IN SEMAPHORIN SIGNALING | Genes involved in Sema4D in semaphorin signaling |
0.0 | 1.6 | REACTOME RESPONSE TO ELEVATED PLATELET CYTOSOLIC CA2 | Genes involved in Response to elevated platelet cytosolic Ca2+ |
0.0 | 0.2 | REACTOME CYTOSOLIC SULFONATION OF SMALL MOLECULES | Genes involved in Cytosolic sulfonation of small molecules |
0.0 | 0.3 | REACTOME DCC MEDIATED ATTRACTIVE SIGNALING | Genes involved in DCC mediated attractive signaling |
0.0 | 0.2 | REACTOME CDC6 ASSOCIATION WITH THE ORC ORIGIN COMPLEX | Genes involved in CDC6 association with the ORC:origin complex |
0.0 | 0.5 | REACTOME RNA POL I TRANSCRIPTION INITIATION | Genes involved in RNA Polymerase I Transcription Initiation |
0.0 | 0.0 | REACTOME RNA POL I TRANSCRIPTION | Genes involved in RNA Polymerase I Transcription |
0.0 | 0.5 | REACTOME MEIOTIC RECOMBINATION | Genes involved in Meiotic Recombination |
0.0 | 0.4 | REACTOME CIRCADIAN REPRESSION OF EXPRESSION BY REV ERBA | Genes involved in Circadian Repression of Expression by REV-ERBA |
0.0 | 0.2 | REACTOME PURINE CATABOLISM | Genes involved in Purine catabolism |
0.0 | 0.2 | REACTOME SIGNALING BY PDGF | Genes involved in Signaling by PDGF |
0.0 | 0.5 | REACTOME TRANSPORT OF VITAMINS NUCLEOSIDES AND RELATED MOLECULES | Genes involved in Transport of vitamins, nucleosides, and related molecules |
0.0 | 0.3 | REACTOME PLATELET AGGREGATION PLUG FORMATION | Genes involved in Platelet Aggregation (Plug Formation) |
0.0 | 0.3 | REACTOME ZINC TRANSPORTERS | Genes involved in Zinc transporters |
0.0 | 0.1 | REACTOME G BETA GAMMA SIGNALLING THROUGH PLC BETA | Genes involved in G beta:gamma signalling through PLC beta |
0.0 | 0.1 | REACTOME REGULATION OF IFNA SIGNALING | Genes involved in Regulation of IFNA signaling |
0.0 | 0.1 | REACTOME CTLA4 INHIBITORY SIGNALING | Genes involved in CTLA4 inhibitory signaling |
0.0 | 0.7 | REACTOME INTERFERON GAMMA SIGNALING | Genes involved in Interferon gamma signaling |
0.0 | 0.1 | REACTOME TETRAHYDROBIOPTERIN BH4 SYNTHESIS RECYCLING SALVAGE AND REGULATION | Genes involved in Tetrahydrobiopterin (BH4) synthesis, recycling, salvage and regulation |
0.0 | 0.1 | REACTOME PECAM1 INTERACTIONS | Genes involved in PECAM1 interactions |
0.0 | 0.2 | REACTOME ACTIVATION OF RAC | Genes involved in Activation of Rac |
0.0 | 0.3 | REACTOME MITOCHONDRIAL TRNA AMINOACYLATION | Genes involved in Mitochondrial tRNA aminoacylation |
0.0 | 0.1 | REACTOME VEGF LIGAND RECEPTOR INTERACTIONS | Genes involved in VEGF ligand-receptor interactions |
0.0 | 0.0 | REACTOME CELL DEATH SIGNALLING VIA NRAGE NRIF AND NADE | Genes involved in Cell death signalling via NRAGE, NRIF and NADE |
0.0 | 0.2 | REACTOME CHYLOMICRON MEDIATED LIPID TRANSPORT | Genes involved in Chylomicron-mediated lipid transport |
0.0 | 0.4 | REACTOME ASSOCIATION OF TRIC CCT WITH TARGET PROTEINS DURING BIOSYNTHESIS | Genes involved in Association of TriC/CCT with target proteins during biosynthesis |
0.0 | 0.1 | REACTOME SYNTHESIS OF BILE ACIDS AND BILE SALTS VIA 24 HYDROXYCHOLESTEROL | Genes involved in Synthesis of bile acids and bile salts via 24-hydroxycholesterol |
0.0 | 0.4 | REACTOME THROMBIN SIGNALLING THROUGH PROTEINASE ACTIVATED RECEPTORS PARS | Genes involved in Thrombin signalling through proteinase activated receptors (PARs) |
0.0 | 0.1 | REACTOME YAP1 AND WWTR1 TAZ STIMULATED GENE EXPRESSION | Genes involved in YAP1- and WWTR1 (TAZ)-stimulated gene expression |
0.0 | 0.0 | REACTOME PROSTACYCLIN SIGNALLING THROUGH PROSTACYCLIN RECEPTOR | Genes involved in Prostacyclin signalling through prostacyclin receptor |
0.0 | 0.3 | REACTOME STRIATED MUSCLE CONTRACTION | Genes involved in Striated Muscle Contraction |
0.0 | 0.2 | REACTOME DOWNREGULATION OF SMAD2 3 SMAD4 TRANSCRIPTIONAL ACTIVITY | Genes involved in Downregulation of SMAD2/3:SMAD4 transcriptional activity |
0.0 | 0.1 | REACTOME RAP1 SIGNALLING | Genes involved in Rap1 signalling |
0.0 | 0.1 | REACTOME SIGNAL TRANSDUCTION BY L1 | Genes involved in Signal transduction by L1 |
0.0 | 0.0 | REACTOME TRANSFERRIN ENDOCYTOSIS AND RECYCLING | Genes involved in Transferrin endocytosis and recycling |
0.0 | 0.2 | REACTOME RECYCLING PATHWAY OF L1 | Genes involved in Recycling pathway of L1 |
0.0 | 0.2 | REACTOME CELL EXTRACELLULAR MATRIX INTERACTIONS | Genes involved in Cell-extracellular matrix interactions |
0.0 | 0.5 | REACTOME INTEGRIN CELL SURFACE INTERACTIONS | Genes involved in Integrin cell surface interactions |
0.0 | 0.3 | REACTOME A TETRASACCHARIDE LINKER SEQUENCE IS REQUIRED FOR GAG SYNTHESIS | Genes involved in A tetrasaccharide linker sequence is required for GAG synthesis |
0.0 | 0.2 | REACTOME AMINE DERIVED HORMONES | Genes involved in Amine-derived hormones |
0.0 | 0.1 | REACTOME CASPASE MEDIATED CLEAVAGE OF CYTOSKELETAL PROTEINS | Genes involved in Caspase-mediated cleavage of cytoskeletal proteins |
0.0 | 0.1 | REACTOME ENOS ACTIVATION AND REGULATION | Genes involved in eNOS activation and regulation |
0.0 | 0.0 | REACTOME BINDING AND ENTRY OF HIV VIRION | Genes involved in Binding and entry of HIV virion |
0.0 | 0.1 | REACTOME REGULATION OF INSULIN LIKE GROWTH FACTOR IGF ACTIVITY BY INSULIN LIKE GROWTH FACTOR BINDING PROTEINS IGFBPS | Genes involved in Regulation of Insulin-like Growth Factor (IGF) Activity by Insulin-like Growth Factor Binding Proteins (IGFBPs) |
0.0 | 0.7 | REACTOME PPARA ACTIVATES GENE EXPRESSION | Genes involved in PPARA Activates Gene Expression |
0.0 | 0.0 | REACTOME APOBEC3G MEDIATED RESISTANCE TO HIV1 INFECTION | Genes involved in APOBEC3G mediated resistance to HIV-1 infection |
0.0 | 0.4 | REACTOME CELL JUNCTION ORGANIZATION | Genes involved in Cell junction organization |
0.0 | 0.2 | REACTOME PLATELET CALCIUM HOMEOSTASIS | Genes involved in Platelet calcium homeostasis |
0.0 | 0.2 | REACTOME DESTABILIZATION OF MRNA BY BRF1 | Genes involved in Destabilization of mRNA by Butyrate Response Factor 1 (BRF1) |
0.0 | 0.0 | REACTOME ENDOSOMAL VACUOLAR PATHWAY | Genes involved in Endosomal/Vacuolar pathway |
0.0 | 0.2 | REACTOME NONSENSE MEDIATED DECAY ENHANCED BY THE EXON JUNCTION COMPLEX | Genes involved in Nonsense Mediated Decay Enhanced by the Exon Junction Complex |
0.0 | 0.4 | REACTOME GLUCOSE TRANSPORT | Genes involved in Glucose transport |
0.0 | 1.8 | REACTOME ANTIGEN PROCESSING UBIQUITINATION PROTEASOME DEGRADATION | Genes involved in Antigen processing: Ubiquitination & Proteasome degradation |
0.0 | 0.3 | REACTOME CYTOCHROME P450 ARRANGED BY SUBSTRATE TYPE | Genes involved in Cytochrome P450 - arranged by substrate type |
0.0 | 0.0 | REACTOME P53 DEPENDENT G1 DNA DAMAGE RESPONSE | Genes involved in p53-Dependent G1 DNA Damage Response |