Gene Symbol | Gene ID | Gene Info |
---|---|---|
Obox3
|
ENSMUSG00000066772.6 | Obox3 |
Gene | Promoter | Pearson corr. coef. | P-value | Plot |
---|---|---|---|---|
Obox3 | mm10_chr7_16098394_16098698 | 0.27 | 5.0e-02 | Click! |
Move your cursor over a bar to see sample name and corresponding Z-value.
Cis Regulatory Element (CRE) | Target Score | Top associated gene | Gene Info | Distance of CRE to TSS | CRE/Gene association probability |
---|---|---|---|---|---|
chr6_86832842_86833107 | 14.42 |
2610306M01Rik |
RIKEN cDNA 2610306M01 gene |
16466 |
0.12 |
chr13_53262691_53263037 | 13.79 |
Ror2 |
receptor tyrosine kinase-like orphan receptor 2 |
12794 |
0.26 |
chr9_65646098_65646318 | 11.26 |
Rbpms2 |
RNA binding protein with multiple splicing 2 |
12769 |
0.15 |
chr4_135565726_135565884 | 10.47 |
Grhl3 |
grainyhead like transcription factor 3 |
7825 |
0.14 |
chr1_24613351_24614205 | 9.98 |
Gm28437 |
predicted gene 28437 |
193 |
0.69 |
chr7_135605115_135605302 | 9.86 |
Ptpre |
protein tyrosine phosphatase, receptor type, E |
620 |
0.73 |
chr1_34389196_34389610 | 9.42 |
Gm5266 |
predicted gene 5266 |
22032 |
0.09 |
chr6_91546250_91546583 | 9.29 |
Gm45216 |
predicted gene 45216 |
24007 |
0.11 |
chr2_152639915_152640229 | 8.61 |
Rem1 |
rad and gem related GTP binding protein 1 |
7105 |
0.09 |
chr2_30093353_30094532 | 8.32 |
Zdhhc12 |
zinc finger, DHHC domain containing 12 |
294 |
0.82 |
chr19_11813724_11813929 | 8.27 |
Stx3 |
syntaxin 3 |
4895 |
0.11 |
chr13_12337818_12338180 | 8.25 |
Actn2 |
actinin alpha 2 |
2725 |
0.25 |
chr4_123425697_123425901 | 8.04 |
Gm12924 |
predicted gene 12924 |
9818 |
0.17 |
chr19_3767273_3768554 | 7.96 |
Kmt5b |
lysine methyltransferase 5B |
120 |
0.93 |
chr9_67161207_67161368 | 7.86 |
Gm19299 |
predicted gene, 19299 |
27726 |
0.16 |
chr1_37478171_37478387 | 7.55 |
4930594C11Rik |
RIKEN cDNA 4930594C11 gene |
10326 |
0.14 |
chr10_76258309_76258460 | 7.39 |
S100b |
S100 protein, beta polypeptide, neural |
4531 |
0.14 |
chr2_153492229_153493481 | 7.33 |
4930404H24Rik |
RIKEN cDNA 4930404H24 gene |
65 |
0.82 |
chr18_62044092_62044268 | 7.33 |
Sh3tc2 |
SH3 domain and tetratricopeptide repeats 2 |
66221 |
0.1 |
chr1_171263156_171263797 | 7.31 |
B4galt3 |
UDP-Gal:betaGlcNAc beta 1,4-galactosyltransferase, polypeptide 3 |
6852 |
0.07 |
chr11_30648868_30649937 | 7.25 |
Acyp2 |
acylphosphatase 2, muscle type |
185 |
0.95 |
chr9_62732677_62732861 | 7.24 |
Itga11 |
integrin alpha 11 |
54909 |
0.11 |
chr7_142658735_142659435 | 7.20 |
Igf2 |
insulin-like growth factor 2 |
404 |
0.55 |
chr15_79690079_79691459 | 7.17 |
Gtpbp1 |
GTP binding protein 1 |
76 |
0.92 |
chr8_57303574_57303863 | 6.98 |
Hand2os1 |
Hand2, opposite strand 1 |
1640 |
0.3 |
chr1_118359132_118359293 | 6.97 |
Gm28867 |
predicted gene 28867 |
1900 |
0.3 |
chr14_76448983_76449138 | 6.83 |
Tsc22d1 |
TSC22 domain family, member 1 |
10127 |
0.25 |
chr11_88068171_88069196 | 6.72 |
Vezf1 |
vascular endothelial zinc finger 1 |
404 |
0.76 |
chr7_139258503_139258654 | 6.62 |
Pwwp2b |
PWWP domain containing 2B |
7221 |
0.16 |
chr6_53944559_53944783 | 6.60 |
Cpvl |
carboxypeptidase, vitellogenic-like |
33991 |
0.15 |
chr16_49953839_49953990 | 6.58 |
Cd47 |
CD47 antigen (Rh-related antigen, integrin-associated signal transducer) |
87081 |
0.1 |
chr17_12741201_12741959 | 6.50 |
Airn |
antisense Igf2r RNA |
182 |
0.93 |
chr16_44696231_44696444 | 6.50 |
Nepro |
nucleolus and neural progenitor protein |
27964 |
0.16 |
chr1_157008233_157008389 | 6.34 |
Gm10531 |
predicted gene 10531 |
35236 |
0.13 |
chr4_139387042_139387343 | 6.31 |
Ubr4 |
ubiquitin protein ligase E3 component n-recognin 4 |
6523 |
0.12 |
chr7_46833351_46833657 | 6.30 |
Gm45308 |
predicted gene 45308 |
1040 |
0.32 |
chr5_114558159_114558686 | 6.15 |
Gm13790 |
predicted gene 13790 |
7133 |
0.17 |
chr5_119449261_119449471 | 6.09 |
Gm31314 |
predicted gene, 31314 |
78588 |
0.09 |
chr3_30999453_30999632 | 6.00 |
Prkci |
protein kinase C, iota |
3795 |
0.19 |
chr10_42523392_42523543 | 5.97 |
Snx3 |
sorting nexin 3 |
21177 |
0.17 |
chr17_9407729_9407880 | 5.94 |
Gm17728 |
predicted gene, 17728 |
14256 |
0.19 |
chr9_58295835_58296041 | 5.94 |
Loxl1 |
lysyl oxidase-like 1 |
17248 |
0.13 |
chr6_82897462_82897613 | 5.90 |
Gm45145 |
predicted gene 45145 |
563 |
0.61 |
chr13_101111941_101112124 | 5.88 |
Hmgb1-ps9 |
high mobility group box 1, pseudogene 9 |
72786 |
0.09 |
chr13_41511132_41511334 | 5.87 |
Nedd9 |
neural precursor cell expressed, developmentally down-regulated gene 9 |
23871 |
0.13 |
chr19_61057665_61057910 | 5.87 |
Gm22520 |
predicted gene, 22520 |
44242 |
0.12 |
chr7_45017042_45018019 | 5.86 |
Rras |
related RAS viral (r-ras) oncogene |
431 |
0.52 |
chr2_22587496_22588353 | 5.71 |
Gm13341 |
predicted gene 13341 |
38 |
0.95 |
chr12_102324651_102324838 | 5.57 |
Rin3 |
Ras and Rab interactor 3 |
30001 |
0.18 |
chr2_145233569_145233742 | 5.57 |
Slc24a3 |
solute carrier family 24 (sodium/potassium/calcium exchanger), member 3 |
8956 |
0.28 |
chr7_83842594_83842745 | 5.56 |
Gm44993 |
predicted gene 44993 |
8070 |
0.11 |
chr2_160700529_160700680 | 5.55 |
Top1 |
topoisomerase (DNA) I |
1539 |
0.39 |
chr6_113795101_113795729 | 5.53 |
Gm44167 |
predicted gene, 44167 |
4269 |
0.16 |
chr13_43525454_43525719 | 5.50 |
Gm32939 |
predicted gene, 32939 |
4634 |
0.16 |
chr17_47914586_47915244 | 5.49 |
Gm15556 |
predicted gene 15556 |
7463 |
0.14 |
chr14_32861100_32861956 | 5.48 |
Vstm4 |
V-set and transmembrane domain containing 4 |
4772 |
0.2 |
chr9_30997297_30997517 | 5.43 |
Gm29724 |
predicted gene, 29724 |
12656 |
0.17 |
chr7_126862086_126862870 | 5.39 |
Hirip3 |
HIRA interacting protein 3 |
3 |
0.57 |
chr13_109790070_109790257 | 5.37 |
Pde4d |
phosphodiesterase 4D, cAMP specific |
32942 |
0.24 |
chr8_22443114_22443265 | 5.36 |
Mrps31 |
mitochondrial ribosomal protein S31 |
31791 |
0.08 |
chr16_31319415_31319566 | 5.33 |
Apod |
apolipoprotein D |
4682 |
0.12 |
chr1_191349153_191349313 | 5.27 |
Ppp2r5a |
protein phosphatase 2, regulatory subunit B', alpha |
7232 |
0.15 |
chr17_31183682_31183851 | 5.26 |
Tmprss3 |
transmembrane protease, serine 3 |
13983 |
0.11 |
chr15_77163426_77163602 | 5.25 |
Rbfox2 |
RNA binding protein, fox-1 homolog (C. elegans) 2 |
9702 |
0.14 |
chr17_84156966_84157484 | 5.24 |
Gm19696 |
predicted gene, 19696 |
785 |
0.6 |
chr6_88189509_88190427 | 5.21 |
Gm38708 |
predicted gene, 38708 |
713 |
0.56 |
chr2_128508005_128508180 | 5.21 |
Morrbid |
myeloid RNA regulator of BCL2L11 induced cell death |
5327 |
0.2 |
chr17_84942782_84942953 | 5.21 |
Ppm1b |
protein phosphatase 1B, magnesium dependent, beta isoform |
13874 |
0.16 |
chr4_131918525_131919090 | 5.19 |
Gm12992 |
predicted gene 12992 |
1222 |
0.27 |
chr3_89449599_89449953 | 5.18 |
Pmvk |
phosphomevalonate kinase |
4765 |
0.1 |
chr11_107337855_107338006 | 5.17 |
Gm11716 |
predicted gene 11716 |
120 |
0.72 |
chr5_134734247_134734398 | 5.15 |
Eln |
elastin |
5216 |
0.16 |
chr1_58795840_58796038 | 5.13 |
Casp8 |
caspase 8 |
462 |
0.72 |
chr7_109602539_109603238 | 5.09 |
Denn2b |
DENN domain containing 2B |
223 |
0.93 |
chr18_5390246_5390643 | 5.07 |
Gm50065 |
predicted gene, 50065 |
19962 |
0.19 |
chr14_76152031_76153227 | 5.00 |
Nufip1 |
nuclear fragile X mental retardation protein interacting protein 1 |
41738 |
0.14 |
chr15_102393639_102394041 | 4.96 |
Sp1 |
trans-acting transcription factor 1 |
12303 |
0.09 |
chr5_107081347_107081515 | 4.95 |
Gm33474 |
predicted gene, 33474 |
32595 |
0.14 |
chr2_27210396_27210569 | 4.88 |
Sardh |
sarcosine dehydrogenase |
545 |
0.7 |
chr9_64085051_64085432 | 4.82 |
Scarletltr |
Scarletltr, erythroid developmental long intergenic non-protein coding transcript |
4480 |
0.14 |
chr4_12087867_12088383 | 4.79 |
Tmem67 |
transmembrane protein 67 |
118 |
0.93 |
chrX_38711718_38711878 | 4.78 |
Ap3s1-ps1 |
adaptor-related protein complex 3, sigma 1 subunit, pseudogene 1 |
25628 |
0.13 |
chr11_72397159_72397355 | 4.77 |
Smtnl2 |
smoothelin-like 2 |
5484 |
0.13 |
chr1_166003194_166003591 | 4.76 |
Gm26665 |
predicted gene, 26665 |
432 |
0.61 |
chr7_44985781_44987176 | 4.76 |
Prmt1 |
protein arginine N-methyltransferase 1 |
14 |
0.83 |
chr9_107298173_107298407 | 4.76 |
Cish |
cytokine inducible SH2-containing protein |
865 |
0.33 |
chr17_75285359_75285510 | 4.73 |
Ltbp1 |
latent transforming growth factor beta binding protein 1 |
4542 |
0.33 |
chr5_105792302_105792740 | 4.70 |
Rps15a-ps5 |
ribosomal protein S15A, pseudogene 5 |
5192 |
0.18 |
chr7_24461704_24461855 | 4.69 |
Plaur |
plasminogen activator, urokinase receptor |
705 |
0.47 |
chr18_35848127_35849279 | 4.69 |
Cxxc5 |
CXXC finger 5 |
5984 |
0.11 |
chr19_53781358_53781549 | 4.67 |
Rbm20 |
RNA binding motif protein 20 |
11855 |
0.17 |
chr11_53307542_53307735 | 4.66 |
Hspa4 |
heat shock protein 4 |
7181 |
0.15 |
chr10_86313513_86313715 | 4.64 |
Timp3 |
tissue inhibitor of metalloproteinase 3 |
10760 |
0.23 |
chr11_100146046_100146514 | 4.63 |
Krt19 |
keratin 19 |
160 |
0.89 |
chr7_82422391_82422688 | 4.62 |
Adamtsl3 |
ADAMTS-like 3 |
14065 |
0.24 |
chr17_35164786_35165560 | 4.60 |
Gm17705 |
predicted gene, 17705 |
54 |
0.72 |
chr19_10023037_10023221 | 4.60 |
Rab3il1 |
RAB3A interacting protein (rabin3)-like 1 |
4864 |
0.13 |
chr17_48418119_48418309 | 4.55 |
Gm49893 |
predicted gene, 49893 |
934 |
0.42 |
chr14_76817069_76817629 | 4.54 |
Gm48968 |
predicted gene, 48968 |
15472 |
0.18 |
chr2_172922703_172922901 | 4.51 |
Bmp7 |
bone morphogenetic protein 7 |
17290 |
0.18 |
chr18_56431644_56432210 | 4.50 |
Gramd3 |
GRAM domain containing 3 |
205 |
0.95 |
chr7_122716584_122716735 | 4.49 |
Gm44749 |
predicted gene 44749 |
14741 |
0.2 |
chr15_76269958_76270116 | 4.48 |
Mirt2 |
myocardial infraction associated transcript 2 |
198 |
0.82 |
chr4_64595518_64595669 | 4.48 |
Gm23950 |
predicted gene, 23950 |
150863 |
0.04 |
chr4_141999596_142000221 | 4.46 |
Fhad1 |
forkhead-associated (FHA) phosphopeptide binding domain 1 |
11729 |
0.12 |
chr7_110982411_110982739 | 4.45 |
Mrvi1 |
MRV integration site 1 |
114 |
0.97 |
chr2_91117589_91117772 | 4.45 |
Mybpc3 |
myosin binding protein C, cardiac |
464 |
0.71 |
chr11_100411983_100412150 | 4.43 |
P3h4 |
prolyl 3-hydroxylase family member 4 (non-enzymatic) |
192 |
0.85 |
chr11_101056668_101056819 | 4.42 |
Atp6v0a1 |
ATPase, H+ transporting, lysosomal V0 subunit A1 |
12928 |
0.08 |
chr11_85761334_85761490 | 4.40 |
Mir5110 |
microRNA 5110 |
710 |
0.59 |
chr2_166608713_166608864 | 4.38 |
Prex1 |
phosphatidylinositol-3,4,5-trisphosphate-dependent Rac exchange factor 1 |
5701 |
0.24 |
chr2_163385368_163385519 | 4.36 |
Jph2 |
junctophilin 2 |
12506 |
0.14 |
chr4_70536654_70537067 | 4.34 |
Megf9 |
multiple EGF-like-domains 9 |
1865 |
0.51 |
chr3_103140164_103140356 | 4.33 |
Dennd2c |
DENN/MADD domain containing 2C |
66 |
0.96 |
chr10_68276153_68276912 | 4.32 |
Arid5b |
AT rich interactive domain 5B (MRF1-like) |
2189 |
0.35 |
chr10_62076266_62076474 | 4.31 |
Gm5424 |
predicted gene 5424 |
5247 |
0.19 |
chr2_11375744_11376037 | 4.29 |
Gm37730 |
predicted gene, 37730 |
8439 |
0.1 |
chr8_41787037_41787444 | 4.29 |
2810404M03Rik |
RIKEN cDNA 2810404M03 gene |
40027 |
0.2 |
chr15_102149650_102149914 | 4.28 |
Soat2 |
sterol O-acyltransferase 2 |
744 |
0.48 |
chr14_120292725_120293127 | 4.27 |
Mbnl2 |
muscleblind like splicing factor 2 |
4748 |
0.3 |
chr1_44216808_44216982 | 4.23 |
Mettl21e |
methyltransferase like 21E |
2018 |
0.29 |
chr15_101261167_101261318 | 4.22 |
Nr4a1 |
nuclear receptor subfamily 4, group A, member 1 |
5604 |
0.11 |
chr12_84876551_84876702 | 4.18 |
Ltbp2 |
latent transforming growth factor beta binding protein 2 |
94 |
0.92 |
chr13_34784975_34785139 | 4.17 |
Gm47157 |
predicted gene, 47157 |
29487 |
0.11 |
chr16_95800811_95800965 | 4.17 |
2810404F17Rik |
RIKEN cDNA 2810404F17 gene |
7429 |
0.18 |
chr1_153265203_153265400 | 4.14 |
Lamc1 |
laminin, gamma 1 |
14840 |
0.17 |
chr8_126497512_126498658 | 4.09 |
Gm6091 |
predicted pseudogene 6091 |
21673 |
0.18 |
chr13_98695132_98695882 | 4.05 |
Tmem171 |
transmembrane protein 171 |
673 |
0.61 |
chr12_85859877_85860028 | 4.04 |
Ttll5 |
tubulin tyrosine ligase-like family, member 5 |
19034 |
0.18 |
chr5_131869765_131870101 | 4.03 |
4930563F08Rik |
RIKEN cDNA 4930563F08 gene |
10336 |
0.15 |
chr11_53794334_53794485 | 4.03 |
Gm12216 |
predicted gene 12216 |
1466 |
0.28 |
chr8_33993568_33993719 | 4.02 |
Gm45817 |
predicted gene 45817 |
6443 |
0.16 |
chr7_70358895_70359853 | 4.02 |
Nr2f2 |
nuclear receptor subfamily 2, group F, member 2 |
521 |
0.68 |
chr7_80542454_80542814 | 4.00 |
Blm |
Bloom syndrome, RecQ like helicase |
7515 |
0.17 |
chr14_34618983_34619138 | 3.98 |
Opn4 |
opsin 4 (melanopsin) |
18918 |
0.11 |
chr17_35821127_35821780 | 3.98 |
Ier3 |
immediate early response 3 |
231 |
0.8 |
chr15_101309099_101309263 | 3.98 |
Gm49499 |
predicted gene, 49499 |
6921 |
0.1 |
chr19_24457291_24457567 | 3.97 |
Fam122a |
family with sequence similarity 122, member A |
19927 |
0.2 |
chr4_118543957_118544344 | 3.96 |
Tmem125 |
transmembrane protein 125 |
106 |
0.94 |
chr10_13245772_13245998 | 3.95 |
Gm47402 |
predicted gene, 47402 |
40659 |
0.14 |
chr7_140920489_140920671 | 3.95 |
Nlrp6 |
NLR family, pyrin domain containing 6 |
322 |
0.71 |
chr6_4902832_4903901 | 3.94 |
Ppp1r9a |
protein phosphatase 1, regulatory subunit 9A |
7 |
0.97 |
chr8_4512099_4512559 | 3.93 |
Gm36956 |
predicted gene, 36956 |
9796 |
0.14 |
chr6_125478835_125479057 | 3.92 |
Cd9 |
CD9 antigen |
644 |
0.63 |
chr11_95247117_95247412 | 3.92 |
Tac4 |
tachykinin 4 |
14265 |
0.13 |
chr17_39845065_39845666 | 3.90 |
CT010467.1 |
18s RNA, related sequence 5 |
988 |
0.52 |
chr12_73448743_73448982 | 3.89 |
Gm33929 |
predicted gene, 33929 |
544 |
0.74 |
chr1_165684512_165684692 | 3.88 |
Gm44458 |
predicted gene, 44458 |
10163 |
0.11 |
chr19_5989954_5990323 | 3.86 |
Slc22a20 |
solute carrier family 22 (organic anion transporter), member 20 |
3995 |
0.09 |
chr13_95679133_95679359 | 3.84 |
Iqgap2 |
IQ motif containing GTPase activating protein 2 |
3078 |
0.18 |
chr5_99669969_99670445 | 3.83 |
Gm16226 |
predicted gene 16226 |
12203 |
0.14 |
chr1_72255145_72255783 | 3.82 |
Gm25939 |
predicted gene, 25939 |
456 |
0.72 |
chr6_72371124_72371346 | 3.82 |
Vamp5 |
vesicle-associated membrane protein 5 |
900 |
0.38 |
chr8_10936772_10936949 | 3.81 |
Gm45042 |
predicted gene 45042 |
6973 |
0.11 |
chr9_71163197_71163362 | 3.80 |
Aqp9 |
aquaporin 9 |
10 |
0.91 |
chr4_126512394_126512660 | 3.80 |
Ago4 |
argonaute RISC catalytic subunit 4 |
4385 |
0.12 |
chr18_61828049_61828200 | 3.80 |
Afap1l1 |
actin filament associated protein 1-like 1 |
41422 |
0.13 |
chr5_114647301_114647958 | 3.79 |
Trpv4 |
transient receptor potential cation channel, subfamily V, member 4 |
2730 |
0.21 |
chr1_51266156_51266321 | 3.78 |
Cavin2 |
caveolae associated 2 |
22888 |
0.18 |
chr10_95839927_95840078 | 3.78 |
Gm33543 |
predicted gene, 33543 |
2894 |
0.18 |
chr9_50922918_50923071 | 3.77 |
Gm25558 |
predicted gene, 25558 |
35044 |
0.13 |
chr17_73092191_73092342 | 3.75 |
Lclat1 |
lysocardiolipin acyltransferase 1 |
15719 |
0.22 |
chr17_34373426_34373577 | 3.74 |
Btnl1 |
butyrophilin-like 1 |
3631 |
0.1 |
chr2_146099017_146099372 | 3.74 |
Cfap61 |
cilia and flagella associated protein 61 |
51943 |
0.15 |
chr8_94682719_94683077 | 3.73 |
Pllp |
plasma membrane proteolipid |
2816 |
0.16 |
chr11_68780827_68781014 | 3.73 |
Myh10 |
myosin, heavy polypeptide 10, non-muscle |
2512 |
0.28 |
chr15_100201810_100201961 | 3.73 |
Dip2b |
disco interacting protein 2 homolog B |
1251 |
0.37 |
chr8_88576214_88576365 | 3.69 |
Nkd1 |
naked cuticle 1 |
6516 |
0.2 |
chr1_59907800_59907951 | 3.69 |
Fam117b |
family with sequence similarity 117, member B |
5131 |
0.16 |
chr11_98709033_98709497 | 3.69 |
Med24 |
mediator complex subunit 24 |
1262 |
0.24 |
chr18_75284555_75284742 | 3.68 |
2010010A06Rik |
RIKEN cDNA 2010010A06 gene |
4535 |
0.27 |
chr3_136836868_136837153 | 3.67 |
Ppp3ca |
protein phosphatase 3, catalytic subunit, alpha isoform |
2317 |
0.33 |
chr11_120686363_120686514 | 3.66 |
Aspscr1 |
alveolar soft part sarcoma chromosome region, candidate 1 (human) |
255 |
0.77 |
chr15_66816680_66816831 | 3.66 |
Sla |
src-like adaptor |
4162 |
0.23 |
chr14_120383181_120383500 | 3.65 |
Mbnl2 |
muscleblind like splicing factor 2 |
4099 |
0.26 |
chr5_104224446_104224597 | 3.65 |
Dmp1 |
dentin matrix protein 1 |
21908 |
0.13 |
chr15_101241288_101241455 | 3.64 |
Nr4a1 |
nuclear receptor subfamily 4, group A, member 1 |
12898 |
0.09 |
chr2_11429503_11430010 | 3.64 |
Gm13296 |
predicted gene 13296 |
9532 |
0.12 |
chr5_30887859_30888698 | 3.64 |
Agbl5 |
ATP/GTP binding protein-like 5 |
416 |
0.67 |
chr4_34976323_34976505 | 3.64 |
Gm12364 |
predicted gene 12364 |
14194 |
0.17 |
chr6_71227250_71227434 | 3.64 |
Smyd1 |
SET and MYND domain containing 1 |
10468 |
0.12 |
chr4_84015788_84016142 | 3.64 |
6030471H07Rik |
RIKEN cDNA 6030471H07 gene |
28914 |
0.21 |
chr8_123164334_123164485 | 3.62 |
Gm4316 |
predicted gene 4316 |
846 |
0.36 |
chr9_44326071_44326312 | 3.61 |
Dpagt1 |
dolichyl-phosphate (UDP-N-acetylglucosamine) acetylglucosaminephosphotransferase 1 (GlcNAc-1-P transferase) |
172 |
0.83 |
chr8_125349336_125349650 | 3.59 |
Gm16237 |
predicted gene 16237 |
122170 |
0.05 |
chr12_31242069_31242220 | 3.59 |
Gm6993 |
predicted gene 6993 |
1374 |
0.3 |
chr19_45074275_45074460 | 3.59 |
Kazald1 |
Kazal-type serine peptidase inhibitor domain 1 |
874 |
0.47 |
chr8_34753233_34753384 | 3.59 |
Dusp4 |
dual specificity phosphatase 4 |
53989 |
0.12 |
chr10_31242622_31242800 | 3.59 |
Gm5422 |
predicted pseudogene 5422 |
5312 |
0.2 |
chr15_59658827_59659108 | 3.58 |
Trib1 |
tribbles pseudokinase 1 |
10314 |
0.2 |
chr1_86478862_86479013 | 3.58 |
Rpl30-ps6 |
ribosomal protein L30, pseudogene 6 |
5278 |
0.15 |
chr13_71980339_71980490 | 3.57 |
Irx1 |
Iroquois homeobox 1 |
16691 |
0.24 |
chr4_6415452_6415881 | 3.54 |
Nsmaf |
neutral sphingomyelinase (N-SMase) activation associated factor |
8322 |
0.19 |
chr8_46875988_46876273 | 3.53 |
Gm45481 |
predicted gene 45481 |
42218 |
0.13 |
chr9_45849822_45850289 | 3.52 |
Bace1 |
beta-site APP cleaving enzyme 1 |
2668 |
0.13 |
chr9_103861119_103861275 | 3.49 |
Gm5372 |
predicted gene 5372 |
26812 |
0.18 |
chr12_21265061_21265212 | 3.49 |
Itgb1bp1 |
integrin beta 1 binding protein 1 |
6987 |
0.12 |
chr1_73942269_73942604 | 3.49 |
Tns1 |
tensin 1 |
1422 |
0.48 |
chr3_153935942_153936170 | 3.47 |
Acadm |
acyl-Coenzyme A dehydrogenase, medium chain |
734 |
0.5 |
chr7_54139113_54139343 | 3.46 |
Gm25956 |
predicted gene, 25956 |
74157 |
0.12 |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
2.0 | 2.0 | GO:0048769 | sarcomerogenesis(GO:0048769) |
1.6 | 4.7 | GO:0038028 | insulin receptor signaling pathway via phosphatidylinositol 3-kinase(GO:0038028) |
1.3 | 4.0 | GO:0046985 | positive regulation of hemoglobin biosynthetic process(GO:0046985) |
1.2 | 3.5 | GO:1903690 | negative regulation of wound healing, spreading of epidermal cells(GO:1903690) |
1.1 | 4.4 | GO:0007223 | Wnt signaling pathway, calcium modulating pathway(GO:0007223) |
0.9 | 4.7 | GO:0010606 | positive regulation of cytoplasmic mRNA processing body assembly(GO:0010606) |
0.8 | 3.9 | GO:0048386 | positive regulation of retinoic acid receptor signaling pathway(GO:0048386) |
0.8 | 3.0 | GO:0046959 | habituation(GO:0046959) |
0.7 | 3.5 | GO:1900454 | positive regulation of long term synaptic depression(GO:1900454) |
0.7 | 3.5 | GO:1901029 | negative regulation of mitochondrial outer membrane permeabilization involved in apoptotic signaling pathway(GO:1901029) |
0.7 | 3.5 | GO:0031034 | myosin filament assembly(GO:0031034) |
0.7 | 3.5 | GO:0071918 | urea transmembrane transport(GO:0071918) |
0.7 | 2.0 | GO:0032074 | negative regulation of nuclease activity(GO:0032074) |
0.6 | 1.9 | GO:0019254 | carnitine metabolic process, CoA-linked(GO:0019254) |
0.6 | 2.4 | GO:0061158 | 3'-UTR-mediated mRNA destabilization(GO:0061158) |
0.6 | 2.3 | GO:0030035 | microspike assembly(GO:0030035) |
0.5 | 3.2 | GO:0036462 | TRAIL-activated apoptotic signaling pathway(GO:0036462) |
0.5 | 3.7 | GO:0060087 | relaxation of vascular smooth muscle(GO:0060087) |
0.5 | 2.7 | GO:0015886 | heme transport(GO:0015886) |
0.5 | 1.6 | GO:1902268 | negative regulation of polyamine transmembrane transport(GO:1902268) |
0.5 | 3.1 | GO:0060836 | lymphatic endothelial cell differentiation(GO:0060836) |
0.5 | 2.6 | GO:0070934 | CRD-mediated mRNA stabilization(GO:0070934) |
0.5 | 3.1 | GO:0019348 | dolichol metabolic process(GO:0019348) |
0.5 | 2.5 | GO:2001268 | negative regulation of cysteine-type endopeptidase activity involved in apoptotic signaling pathway(GO:2001268) |
0.5 | 1.5 | GO:1903232 | melanosome assembly(GO:1903232) |
0.5 | 1.5 | GO:0070814 | hydrogen sulfide biosynthetic process(GO:0070814) |
0.5 | 1.4 | GO:0046340 | diacylglycerol catabolic process(GO:0046340) |
0.5 | 1.9 | GO:0072133 | kidney mesenchyme morphogenesis(GO:0072131) metanephric mesenchyme morphogenesis(GO:0072133) |
0.5 | 1.4 | GO:0035771 | interleukin-4-mediated signaling pathway(GO:0035771) |
0.5 | 2.8 | GO:0015871 | choline transport(GO:0015871) |
0.5 | 0.5 | GO:0000320 | re-entry into mitotic cell cycle(GO:0000320) |
0.5 | 1.4 | GO:0006203 | dGTP catabolic process(GO:0006203) |
0.5 | 4.7 | GO:0051895 | negative regulation of focal adhesion assembly(GO:0051895) |
0.5 | 0.5 | GO:0035995 | detection of muscle stretch(GO:0035995) |
0.5 | 2.3 | GO:0032803 | low-density lipoprotein particle receptor catabolic process(GO:0032802) regulation of low-density lipoprotein particle receptor catabolic process(GO:0032803) |
0.5 | 4.1 | GO:0010826 | negative regulation of centrosome duplication(GO:0010826) negative regulation of centrosome cycle(GO:0046606) |
0.5 | 2.7 | GO:0035608 | protein deglutamylation(GO:0035608) |
0.4 | 1.3 | GO:2000504 | positive regulation of blood vessel remodeling(GO:2000504) |
0.4 | 3.9 | GO:0035999 | tetrahydrofolate interconversion(GO:0035999) |
0.4 | 2.2 | GO:0060480 | lung goblet cell differentiation(GO:0060480) |
0.4 | 3.0 | GO:0001778 | plasma membrane repair(GO:0001778) |
0.4 | 1.3 | GO:0006663 | platelet activating factor biosynthetic process(GO:0006663) platelet activating factor metabolic process(GO:0046469) |
0.4 | 1.3 | GO:0003347 | epicardial cell to mesenchymal cell transition(GO:0003347) |
0.4 | 1.3 | GO:0045218 | zonula adherens maintenance(GO:0045218) |
0.4 | 3.7 | GO:0071404 | cellular response to low-density lipoprotein particle stimulus(GO:0071404) |
0.4 | 1.2 | GO:0007084 | mitotic nuclear envelope reassembly(GO:0007084) |
0.4 | 1.2 | GO:1900825 | regulation of membrane depolarization during cardiac muscle cell action potential(GO:1900825) |
0.4 | 0.8 | GO:2001197 | regulation of basement membrane assembly involved in embryonic body morphogenesis(GO:1904259) positive regulation of basement membrane assembly involved in embryonic body morphogenesis(GO:1904261) basement membrane assembly involved in embryonic body morphogenesis(GO:2001197) |
0.4 | 1.6 | GO:0006499 | N-terminal protein myristoylation(GO:0006499) |
0.4 | 8.8 | GO:0061014 | positive regulation of mRNA catabolic process(GO:0061014) |
0.4 | 0.8 | GO:2000304 | positive regulation of sphingolipid biosynthetic process(GO:0090154) positive regulation of ceramide biosynthetic process(GO:2000304) |
0.4 | 1.2 | GO:0071608 | macrophage inflammatory protein-1 alpha production(GO:0071608) |
0.4 | 0.8 | GO:0060137 | maternal process involved in parturition(GO:0060137) |
0.4 | 2.7 | GO:0030718 | germ-line stem cell population maintenance(GO:0030718) |
0.4 | 1.5 | GO:0071225 | cellular response to muramyl dipeptide(GO:0071225) |
0.4 | 1.1 | GO:0060414 | aorta smooth muscle tissue morphogenesis(GO:0060414) |
0.4 | 1.5 | GO:0051593 | response to folic acid(GO:0051593) |
0.4 | 1.1 | GO:2000483 | negative regulation of interleukin-8 secretion(GO:2000483) |
0.4 | 1.1 | GO:0061052 | negative regulation of cell growth involved in cardiac muscle cell development(GO:0061052) |
0.4 | 1.1 | GO:0046341 | CDP-diacylglycerol metabolic process(GO:0046341) |
0.4 | 1.1 | GO:0070634 | transepithelial ammonium transport(GO:0070634) |
0.4 | 0.7 | GO:2000705 | regulation of dense core granule biogenesis(GO:2000705) |
0.4 | 4.0 | GO:0043206 | extracellular fibril organization(GO:0043206) |
0.4 | 1.1 | GO:0061325 | cell proliferation involved in outflow tract morphogenesis(GO:0061325) |
0.3 | 1.0 | GO:0045658 | regulation of neutrophil differentiation(GO:0045658) |
0.3 | 2.4 | GO:0006265 | DNA topological change(GO:0006265) |
0.3 | 1.0 | GO:1902416 | positive regulation of mRNA binding(GO:1902416) positive regulation of RNA binding(GO:1905216) |
0.3 | 1.3 | GO:1901164 | negative regulation of trophoblast cell migration(GO:1901164) |
0.3 | 0.3 | GO:0070813 | hydrogen sulfide metabolic process(GO:0070813) |
0.3 | 0.7 | GO:1902988 | neurofibrillary tangle assembly(GO:1902988) regulation of neurofibrillary tangle assembly(GO:1902996) |
0.3 | 1.0 | GO:1900095 | regulation of dosage compensation by inactivation of X chromosome(GO:1900095) |
0.3 | 0.7 | GO:2001187 | positive regulation of CD8-positive, alpha-beta T cell activation(GO:2001187) |
0.3 | 1.6 | GO:0010612 | regulation of cardiac muscle adaptation(GO:0010612) regulation of cardiac muscle hypertrophy in response to stress(GO:1903242) |
0.3 | 7.3 | GO:0018345 | protein palmitoylation(GO:0018345) |
0.3 | 2.5 | GO:0034379 | very-low-density lipoprotein particle assembly(GO:0034379) |
0.3 | 1.9 | GO:1903961 | positive regulation of anion transmembrane transport(GO:1903961) |
0.3 | 0.9 | GO:0097477 | lateral motor column neuron migration(GO:0097477) |
0.3 | 0.9 | GO:0035524 | proline transmembrane transport(GO:0035524) |
0.3 | 1.2 | GO:0090219 | negative regulation of lipid kinase activity(GO:0090219) |
0.3 | 0.6 | GO:1903689 | regulation of wound healing, spreading of epidermal cells(GO:1903689) |
0.3 | 0.9 | GO:0034436 | glycoprotein transport(GO:0034436) |
0.3 | 1.8 | GO:0006620 | posttranslational protein targeting to membrane(GO:0006620) |
0.3 | 0.9 | GO:0000715 | nucleotide-excision repair, DNA damage recognition(GO:0000715) |
0.3 | 9.7 | GO:0046627 | negative regulation of insulin receptor signaling pathway(GO:0046627) |
0.3 | 1.2 | GO:2000189 | positive regulation of cholesterol homeostasis(GO:2000189) |
0.3 | 3.9 | GO:0002862 | negative regulation of inflammatory response to antigenic stimulus(GO:0002862) |
0.3 | 5.1 | GO:0006349 | regulation of gene expression by genetic imprinting(GO:0006349) |
0.3 | 0.6 | GO:0060066 | oviduct development(GO:0060066) |
0.3 | 1.2 | GO:0045875 | negative regulation of sister chromatid cohesion(GO:0045875) |
0.3 | 1.5 | GO:1904354 | negative regulation of telomere capping(GO:1904354) |
0.3 | 0.9 | GO:1904502 | regulation of lipophagy(GO:1904502) positive regulation of lipophagy(GO:1904504) |
0.3 | 2.3 | GO:0098870 | neuronal action potential propagation(GO:0019227) action potential propagation(GO:0098870) |
0.3 | 0.9 | GO:0019287 | isopentenyl diphosphate biosynthetic process(GO:0009240) isopentenyl diphosphate biosynthetic process, mevalonate pathway(GO:0019287) |
0.3 | 1.1 | GO:0010724 | regulation of definitive erythrocyte differentiation(GO:0010724) |
0.3 | 0.9 | GO:1904526 | regulation of microtubule binding(GO:1904526) positive regulation of microtubule binding(GO:1904528) |
0.3 | 2.8 | GO:0038065 | collagen-activated signaling pathway(GO:0038065) |
0.3 | 1.1 | GO:0090666 | scaRNA localization to Cajal body(GO:0090666) |
0.3 | 2.2 | GO:0031507 | heterochromatin assembly(GO:0031507) |
0.3 | 1.9 | GO:0032782 | bile acid secretion(GO:0032782) |
0.3 | 0.8 | GO:0008626 | granzyme-mediated apoptotic signaling pathway(GO:0008626) |
0.3 | 0.8 | GO:0036066 | protein O-linked fucosylation(GO:0036066) |
0.3 | 0.3 | GO:0070384 | Harderian gland development(GO:0070384) |
0.3 | 1.0 | GO:1990414 | replication-born double-strand break repair via sister chromatid exchange(GO:1990414) |
0.3 | 1.0 | GO:0071376 | response to corticotropin-releasing hormone(GO:0043435) cellular response to corticotropin-releasing hormone stimulus(GO:0071376) |
0.3 | 0.3 | GO:0010459 | negative regulation of heart rate(GO:0010459) |
0.3 | 1.0 | GO:0000727 | double-strand break repair via break-induced replication(GO:0000727) |
0.3 | 1.3 | GO:1904747 | apoptotic process involved in mammary gland involution(GO:0060057) positive regulation of apoptotic process involved in mammary gland involution(GO:0060058) positive regulation of apoptotic process involved in morphogenesis(GO:1902339) regulation of mammary gland involution(GO:1903519) positive regulation of mammary gland involution(GO:1903521) positive regulation of apoptotic process involved in development(GO:1904747) |
0.3 | 2.0 | GO:0048194 | Golgi vesicle budding(GO:0048194) |
0.3 | 1.0 | GO:0008228 | opsonization(GO:0008228) |
0.2 | 1.5 | GO:1903715 | regulation of aerobic respiration(GO:1903715) |
0.2 | 0.5 | GO:0042998 | positive regulation of Golgi to plasma membrane protein transport(GO:0042998) |
0.2 | 1.2 | GO:0060681 | branch elongation involved in ureteric bud branching(GO:0060681) |
0.2 | 0.7 | GO:0006113 | fermentation(GO:0006113) glucose catabolic process to lactate(GO:0019659) glycolytic fermentation(GO:0019660) glucose catabolic process to lactate via pyruvate(GO:0019661) |
0.2 | 0.2 | GO:0061010 | gall bladder development(GO:0061010) |
0.2 | 6.2 | GO:0045214 | sarcomere organization(GO:0045214) |
0.2 | 0.5 | GO:0061101 | neuroendocrine cell differentiation(GO:0061101) |
0.2 | 1.9 | GO:0006000 | fructose metabolic process(GO:0006000) |
0.2 | 2.4 | GO:0007097 | nuclear migration(GO:0007097) |
0.2 | 2.4 | GO:0042416 | dopamine biosynthetic process(GO:0042416) |
0.2 | 1.2 | GO:0038031 | non-canonical Wnt signaling pathway via JNK cascade(GO:0038031) |
0.2 | 2.1 | GO:0048149 | behavioral response to ethanol(GO:0048149) |
0.2 | 0.9 | GO:0010835 | regulation of protein ADP-ribosylation(GO:0010835) |
0.2 | 0.9 | GO:0003383 | apical constriction(GO:0003383) |
0.2 | 0.7 | GO:1903336 | negative regulation of vacuolar transport(GO:1903336) |
0.2 | 0.4 | GO:0035405 | histone-threonine phosphorylation(GO:0035405) |
0.2 | 2.7 | GO:0006750 | glutathione biosynthetic process(GO:0006750) |
0.2 | 0.4 | GO:0090271 | positive regulation of fibroblast growth factor production(GO:0090271) |
0.2 | 0.4 | GO:0016321 | female meiosis chromosome segregation(GO:0016321) |
0.2 | 0.9 | GO:0031581 | hemidesmosome assembly(GO:0031581) |
0.2 | 0.7 | GO:0007525 | somatic muscle development(GO:0007525) |
0.2 | 2.2 | GO:1903504 | regulation of mitotic cell cycle spindle assembly checkpoint(GO:0090266) regulation of mitotic spindle checkpoint(GO:1903504) |
0.2 | 1.1 | GO:0003105 | negative regulation of glomerular filtration(GO:0003105) |
0.2 | 0.6 | GO:0032474 | otolith morphogenesis(GO:0032474) |
0.2 | 2.6 | GO:0030213 | hyaluronan biosynthetic process(GO:0030213) |
0.2 | 0.4 | GO:0061031 | endodermal digestive tract morphogenesis(GO:0061031) |
0.2 | 0.4 | GO:1901097 | negative regulation of autophagosome maturation(GO:1901097) |
0.2 | 0.8 | GO:0051005 | negative regulation of lipoprotein lipase activity(GO:0051005) |
0.2 | 0.6 | GO:0009794 | regulation of mitotic cell cycle, embryonic(GO:0009794) mitotic cell cycle, embryonic(GO:0045448) |
0.2 | 0.4 | GO:1904468 | negative regulation of tumor necrosis factor secretion(GO:1904468) |
0.2 | 1.3 | GO:0042866 | pyruvate biosynthetic process(GO:0042866) |
0.2 | 0.2 | GO:0002554 | serotonin secretion by platelet(GO:0002554) |
0.2 | 0.4 | GO:0014826 | vein smooth muscle contraction(GO:0014826) |
0.2 | 2.1 | GO:0030889 | negative regulation of B cell proliferation(GO:0030889) |
0.2 | 1.9 | GO:0070633 | transepithelial transport(GO:0070633) |
0.2 | 2.5 | GO:0007216 | G-protein coupled glutamate receptor signaling pathway(GO:0007216) |
0.2 | 2.7 | GO:0001921 | positive regulation of receptor recycling(GO:0001921) |
0.2 | 1.2 | GO:0010815 | bradykinin catabolic process(GO:0010815) |
0.2 | 1.0 | GO:0045636 | positive regulation of melanocyte differentiation(GO:0045636) |
0.2 | 0.4 | GO:0006624 | vacuolar protein processing(GO:0006624) |
0.2 | 0.2 | GO:0010957 | negative regulation of vitamin D biosynthetic process(GO:0010957) |
0.2 | 1.4 | GO:0070493 | thrombin receptor signaling pathway(GO:0070493) |
0.2 | 0.6 | GO:0001543 | ovarian follicle rupture(GO:0001543) |
0.2 | 0.6 | GO:0042045 | epithelial fluid transport(GO:0042045) |
0.2 | 0.8 | GO:0009838 | abscission(GO:0009838) |
0.2 | 1.2 | GO:0035280 | miRNA loading onto RISC involved in gene silencing by miRNA(GO:0035280) |
0.2 | 1.2 | GO:0090336 | positive regulation of brown fat cell differentiation(GO:0090336) |
0.2 | 0.4 | GO:0051307 | meiotic chromosome separation(GO:0051307) |
0.2 | 0.4 | GO:0071314 | cellular response to cocaine(GO:0071314) |
0.2 | 1.4 | GO:0060613 | fat pad development(GO:0060613) |
0.2 | 1.0 | GO:0042118 | endothelial cell activation(GO:0042118) |
0.2 | 0.8 | GO:0070173 | regulation of enamel mineralization(GO:0070173) |
0.2 | 0.6 | GO:0051794 | regulation of catagen(GO:0051794) |
0.2 | 0.8 | GO:0060023 | soft palate development(GO:0060023) |
0.2 | 0.4 | GO:0000733 | DNA strand renaturation(GO:0000733) |
0.2 | 0.6 | GO:0030222 | eosinophil differentiation(GO:0030222) |
0.2 | 0.6 | GO:0090210 | regulation of establishment of blood-brain barrier(GO:0090210) |
0.2 | 0.6 | GO:0033762 | response to glucagon(GO:0033762) |
0.2 | 0.4 | GO:1901979 | regulation of inward rectifier potassium channel activity(GO:1901979) |
0.2 | 1.1 | GO:2000628 | regulation of miRNA metabolic process(GO:2000628) |
0.2 | 0.2 | GO:0010746 | regulation of plasma membrane long-chain fatty acid transport(GO:0010746) negative regulation of plasma membrane long-chain fatty acid transport(GO:0010748) |
0.2 | 0.4 | GO:0070103 | regulation of interleukin-6-mediated signaling pathway(GO:0070103) |
0.2 | 0.7 | GO:0035740 | CD8-positive, alpha-beta T cell proliferation(GO:0035740) |
0.2 | 0.7 | GO:0015691 | cadmium ion transport(GO:0015691) cadmium ion transmembrane transport(GO:0070574) |
0.2 | 0.5 | GO:0001777 | T cell homeostatic proliferation(GO:0001777) regulation of T cell homeostatic proliferation(GO:0046013) |
0.2 | 0.2 | GO:0090232 | positive regulation of spindle checkpoint(GO:0090232) |
0.2 | 0.5 | GO:0060355 | positive regulation of cell adhesion molecule production(GO:0060355) |
0.2 | 0.4 | GO:0060290 | transdifferentiation(GO:0060290) |
0.2 | 0.5 | GO:0071677 | positive regulation of mononuclear cell migration(GO:0071677) |
0.2 | 0.2 | GO:0072173 | metanephric tubule morphogenesis(GO:0072173) metanephric nephron tubule morphogenesis(GO:0072282) |
0.2 | 0.9 | GO:0034242 | negative regulation of syncytium formation by plasma membrane fusion(GO:0034242) |
0.2 | 0.7 | GO:0018243 | protein O-linked glycosylation via threonine(GO:0018243) |
0.2 | 0.4 | GO:0030997 | regulation of centriole-centriole cohesion(GO:0030997) |
0.2 | 1.4 | GO:0035563 | positive regulation of chromatin binding(GO:0035563) |
0.2 | 0.7 | GO:1902894 | negative regulation of pri-miRNA transcription from RNA polymerase II promoter(GO:1902894) |
0.2 | 2.8 | GO:0014829 | vascular smooth muscle contraction(GO:0014829) |
0.2 | 1.6 | GO:0038166 | angiotensin-activated signaling pathway(GO:0038166) |
0.2 | 1.0 | GO:0032287 | peripheral nervous system myelin maintenance(GO:0032287) |
0.2 | 0.2 | GO:0044027 | hypermethylation of CpG island(GO:0044027) |
0.2 | 0.9 | GO:0060391 | positive regulation of SMAD protein import into nucleus(GO:0060391) |
0.2 | 0.3 | GO:1902047 | polyamine transmembrane transport(GO:1902047) regulation of polyamine transmembrane transport(GO:1902267) |
0.2 | 1.9 | GO:0007398 | ectoderm development(GO:0007398) |
0.2 | 0.7 | GO:0030091 | protein repair(GO:0030091) |
0.2 | 0.5 | GO:1904938 | dopaminergic neuron axon guidance(GO:0036514) planar cell polarity pathway involved in axon guidance(GO:1904938) |
0.2 | 2.1 | GO:0015858 | nucleoside transport(GO:0015858) |
0.2 | 0.7 | GO:0001880 | Mullerian duct regression(GO:0001880) |
0.2 | 1.9 | GO:0007095 | mitotic G2 DNA damage checkpoint(GO:0007095) |
0.2 | 0.5 | GO:0006686 | sphingomyelin biosynthetic process(GO:0006686) |
0.2 | 7.6 | GO:0001885 | endothelial cell development(GO:0001885) |
0.2 | 0.8 | GO:0060316 | positive regulation of ryanodine-sensitive calcium-release channel activity(GO:0060316) |
0.2 | 2.3 | GO:0071157 | negative regulation of cell cycle arrest(GO:0071157) |
0.2 | 1.5 | GO:0016540 | protein autoprocessing(GO:0016540) |
0.2 | 0.3 | GO:0009051 | pentose-phosphate shunt, oxidative branch(GO:0009051) |
0.2 | 0.5 | GO:0021564 | vagus nerve development(GO:0021564) |
0.2 | 1.0 | GO:0016081 | synaptic vesicle docking(GO:0016081) |
0.2 | 0.7 | GO:0043951 | negative regulation of cAMP-mediated signaling(GO:0043951) |
0.2 | 0.7 | GO:1902410 | mitotic cytokinetic process(GO:1902410) |
0.2 | 1.3 | GO:0033623 | regulation of integrin activation(GO:0033623) |
0.2 | 0.8 | GO:0051639 | actin filament network formation(GO:0051639) |
0.2 | 0.2 | GO:0042518 | negative regulation of tyrosine phosphorylation of Stat3 protein(GO:0042518) |
0.2 | 0.3 | GO:1901078 | negative regulation of relaxation of muscle(GO:1901078) |
0.2 | 0.8 | GO:0055003 | cardiac myofibril assembly(GO:0055003) |
0.2 | 0.2 | GO:0009157 | deoxyribonucleoside monophosphate biosynthetic process(GO:0009157) pyrimidine deoxyribonucleoside monophosphate biosynthetic process(GO:0009177) |
0.2 | 3.9 | GO:0070979 | protein K11-linked ubiquitination(GO:0070979) |
0.2 | 0.6 | GO:0017183 | peptidyl-diphthamide metabolic process(GO:0017182) peptidyl-diphthamide biosynthetic process from peptidyl-histidine(GO:0017183) |
0.2 | 0.5 | GO:2001271 | negative regulation of cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:2001271) |
0.2 | 0.2 | GO:0032696 | negative regulation of interleukin-13 production(GO:0032696) |
0.2 | 0.5 | GO:0032485 | regulation of Ral protein signal transduction(GO:0032485) |
0.2 | 0.5 | GO:0060373 | regulation of ventricular cardiac muscle cell membrane depolarization(GO:0060373) |
0.2 | 0.6 | GO:0034975 | protein folding in endoplasmic reticulum(GO:0034975) |
0.2 | 0.6 | GO:0032486 | Rap protein signal transduction(GO:0032486) |
0.2 | 0.3 | GO:0035973 | aggrephagy(GO:0035973) |
0.2 | 0.2 | GO:0032290 | peripheral nervous system myelin formation(GO:0032290) |
0.2 | 0.6 | GO:0006681 | galactosylceramide metabolic process(GO:0006681) |
0.2 | 0.8 | GO:0007256 | activation of JNKK activity(GO:0007256) |
0.2 | 1.2 | GO:0014883 | transition between fast and slow fiber(GO:0014883) |
0.2 | 0.3 | GO:0070827 | chromatin maintenance(GO:0070827) |
0.1 | 0.1 | GO:0014722 | regulation of skeletal muscle contraction by calcium ion signaling(GO:0014722) |
0.1 | 0.6 | GO:0046060 | dATP metabolic process(GO:0046060) |
0.1 | 0.3 | GO:0044034 | negative stranded viral RNA replication(GO:0039689) multi-organism biosynthetic process(GO:0044034) |
0.1 | 0.7 | GO:0070314 | G1 to G0 transition(GO:0070314) |
0.1 | 0.6 | GO:0050917 | sensory perception of umami taste(GO:0050917) |
0.1 | 0.7 | GO:0048387 | negative regulation of retinoic acid receptor signaling pathway(GO:0048387) |
0.1 | 1.9 | GO:0006465 | signal peptide processing(GO:0006465) |
0.1 | 0.7 | GO:2000766 | negative regulation of cytoplasmic translation(GO:2000766) |
0.1 | 0.3 | GO:0086046 | membrane depolarization during SA node cell action potential(GO:0086046) |
0.1 | 0.3 | GO:0030397 | membrane disassembly(GO:0030397) nuclear envelope disassembly(GO:0051081) |
0.1 | 0.4 | GO:1903999 | negative regulation of eating behavior(GO:1903999) |
0.1 | 0.1 | GO:1903525 | regulation of membrane tubulation(GO:1903525) |
0.1 | 0.4 | GO:0090310 | negative regulation of methylation-dependent chromatin silencing(GO:0090310) |
0.1 | 1.3 | GO:0000244 | spliceosomal tri-snRNP complex assembly(GO:0000244) |
0.1 | 0.4 | GO:0000350 | generation of catalytic spliceosome for second transesterification step(GO:0000350) |
0.1 | 0.3 | GO:0042726 | flavin-containing compound metabolic process(GO:0042726) |
0.1 | 0.3 | GO:0006534 | cysteine metabolic process(GO:0006534) cysteine catabolic process(GO:0009093) L-cysteine catabolic process(GO:0019448) L-cysteine metabolic process(GO:0046439) |
0.1 | 0.6 | GO:2000323 | negative regulation of glucocorticoid receptor signaling pathway(GO:2000323) |
0.1 | 0.1 | GO:0055098 | response to low-density lipoprotein particle(GO:0055098) |
0.1 | 0.3 | GO:0006003 | fructose 2,6-bisphosphate metabolic process(GO:0006003) |
0.1 | 0.6 | GO:0045629 | negative regulation of T-helper 2 cell differentiation(GO:0045629) |
0.1 | 0.7 | GO:0060710 | chorio-allantoic fusion(GO:0060710) |
0.1 | 0.4 | GO:0034184 | regulation of maintenance of sister chromatid cohesion(GO:0034091) positive regulation of maintenance of sister chromatid cohesion(GO:0034093) regulation of maintenance of mitotic sister chromatid cohesion(GO:0034182) positive regulation of maintenance of mitotic sister chromatid cohesion(GO:0034184) |
0.1 | 0.1 | GO:0070375 | ERK5 cascade(GO:0070375) |
0.1 | 0.6 | GO:0010891 | negative regulation of sequestering of triglyceride(GO:0010891) |
0.1 | 0.7 | GO:0007175 | negative regulation of epidermal growth factor-activated receptor activity(GO:0007175) |
0.1 | 1.5 | GO:0046697 | decidualization(GO:0046697) |
0.1 | 0.4 | GO:0014707 | branchiomeric skeletal muscle development(GO:0014707) |
0.1 | 0.4 | GO:1903116 | positive regulation of actin filament-based movement(GO:1903116) |
0.1 | 0.3 | GO:0060155 | platelet dense granule organization(GO:0060155) |
0.1 | 0.5 | GO:0050847 | progesterone receptor signaling pathway(GO:0050847) |
0.1 | 0.7 | GO:0045653 | negative regulation of megakaryocyte differentiation(GO:0045653) |
0.1 | 0.3 | GO:0043137 | DNA replication, removal of RNA primer(GO:0043137) |
0.1 | 1.2 | GO:0006527 | arginine catabolic process(GO:0006527) |
0.1 | 0.1 | GO:0060623 | regulation of chromosome condensation(GO:0060623) |
0.1 | 0.4 | GO:0023021 | termination of signal transduction(GO:0023021) |
0.1 | 0.8 | GO:0048012 | hepatocyte growth factor receptor signaling pathway(GO:0048012) |
0.1 | 0.3 | GO:0035754 | B cell chemotaxis(GO:0035754) |
0.1 | 0.3 | GO:0010159 | specification of organ position(GO:0010159) |
0.1 | 0.4 | GO:0006269 | DNA replication, synthesis of RNA primer(GO:0006269) |
0.1 | 0.3 | GO:0061502 | early endosome to recycling endosome transport(GO:0061502) |
0.1 | 0.1 | GO:0070447 | positive regulation of oligodendrocyte progenitor proliferation(GO:0070447) |
0.1 | 0.5 | GO:2000427 | positive regulation of apoptotic cell clearance(GO:2000427) |
0.1 | 0.5 | GO:0060743 | epithelial cell maturation involved in prostate gland development(GO:0060743) |
0.1 | 0.1 | GO:0061439 | renal system vasculature morphogenesis(GO:0061438) kidney vasculature morphogenesis(GO:0061439) |
0.1 | 0.4 | GO:0048014 | Tie signaling pathway(GO:0048014) |
0.1 | 0.7 | GO:0007016 | cytoskeletal anchoring at plasma membrane(GO:0007016) |
0.1 | 0.3 | GO:0010040 | response to iron(II) ion(GO:0010040) |
0.1 | 0.7 | GO:0033211 | adiponectin-activated signaling pathway(GO:0033211) |
0.1 | 0.4 | GO:0070947 | neutrophil mediated killing of fungus(GO:0070947) |
0.1 | 0.1 | GO:1902083 | negative regulation of peptidyl-cysteine S-nitrosylation(GO:1902083) |
0.1 | 3.9 | GO:0035825 | reciprocal meiotic recombination(GO:0007131) reciprocal DNA recombination(GO:0035825) |
0.1 | 0.1 | GO:0070358 | actin polymerization-dependent cell motility(GO:0070358) |
0.1 | 0.3 | GO:0072488 | ammonium transmembrane transport(GO:0072488) |
0.1 | 0.1 | GO:0060448 | dichotomous subdivision of terminal units involved in lung branching(GO:0060448) |
0.1 | 0.4 | GO:0019853 | L-ascorbic acid biosynthetic process(GO:0019853) |
0.1 | 0.4 | GO:0045041 | protein import into mitochondrial intermembrane space(GO:0045041) |
0.1 | 0.4 | GO:0035507 | regulation of myosin-light-chain-phosphatase activity(GO:0035507) |
0.1 | 0.5 | GO:0001893 | maternal placenta development(GO:0001893) |
0.1 | 1.0 | GO:0051561 | positive regulation of mitochondrial calcium ion concentration(GO:0051561) |
0.1 | 0.5 | GO:0001996 | positive regulation of heart rate by epinephrine-norepinephrine(GO:0001996) |
0.1 | 0.4 | GO:2000416 | regulation of eosinophil migration(GO:2000416) positive regulation of eosinophil migration(GO:2000418) |
0.1 | 2.0 | GO:0090162 | establishment of epithelial cell polarity(GO:0090162) |
0.1 | 0.1 | GO:0070831 | basement membrane assembly(GO:0070831) |
0.1 | 0.3 | GO:0033092 | positive regulation of immature T cell proliferation(GO:0033091) positive regulation of immature T cell proliferation in thymus(GO:0033092) |
0.1 | 2.0 | GO:0060445 | branching involved in salivary gland morphogenesis(GO:0060445) |
0.1 | 0.9 | GO:0090136 | epithelial cell-cell adhesion(GO:0090136) |
0.1 | 0.8 | GO:2000051 | negative regulation of non-canonical Wnt signaling pathway(GO:2000051) |
0.1 | 0.7 | GO:0071285 | cellular response to lithium ion(GO:0071285) |
0.1 | 0.1 | GO:0071332 | cellular response to fructose stimulus(GO:0071332) |
0.1 | 0.5 | GO:0006116 | NADH oxidation(GO:0006116) |
0.1 | 0.2 | GO:0018992 | germ-line sex determination(GO:0018992) |
0.1 | 0.2 | GO:1900041 | negative regulation of interleukin-2 secretion(GO:1900041) |
0.1 | 0.5 | GO:0046501 | protoporphyrinogen IX metabolic process(GO:0046501) |
0.1 | 0.5 | GO:0072319 | vesicle uncoating(GO:0072319) |
0.1 | 1.7 | GO:0046597 | negative regulation of viral entry into host cell(GO:0046597) |
0.1 | 0.2 | GO:1903774 | positive regulation of viral budding via host ESCRT complex(GO:1903774) |
0.1 | 0.2 | GO:0070278 | extracellular matrix constituent secretion(GO:0070278) |
0.1 | 0.9 | GO:0016056 | rhodopsin mediated signaling pathway(GO:0016056) |
0.1 | 0.2 | GO:0006295 | nucleotide-excision repair, DNA incision, 3'-to lesion(GO:0006295) |
0.1 | 0.4 | GO:0043031 | negative regulation of macrophage activation(GO:0043031) |
0.1 | 1.0 | GO:0045721 | negative regulation of gluconeogenesis(GO:0045721) |
0.1 | 0.5 | GO:0045628 | regulation of T-helper 2 cell differentiation(GO:0045628) |
0.1 | 0.4 | GO:0030327 | prenylated protein catabolic process(GO:0030327) |
0.1 | 1.3 | GO:0006264 | mitochondrial DNA replication(GO:0006264) |
0.1 | 0.1 | GO:0032497 | detection of lipopolysaccharide(GO:0032497) |
0.1 | 0.4 | GO:0036394 | amylase secretion(GO:0036394) |
0.1 | 1.0 | GO:0032516 | positive regulation of phosphoprotein phosphatase activity(GO:0032516) |
0.1 | 0.7 | GO:0071073 | positive regulation of phospholipid biosynthetic process(GO:0071073) |
0.1 | 0.6 | GO:0006398 | mRNA 3'-end processing by stem-loop binding and cleavage(GO:0006398) |
0.1 | 0.1 | GO:0010871 | negative regulation of receptor biosynthetic process(GO:0010871) |
0.1 | 0.5 | GO:0044336 | canonical Wnt signaling pathway involved in negative regulation of apoptotic process(GO:0044336) |
0.1 | 0.6 | GO:0042270 | protection from natural killer cell mediated cytotoxicity(GO:0042270) |
0.1 | 0.5 | GO:0070102 | interleukin-6-mediated signaling pathway(GO:0070102) |
0.1 | 0.2 | GO:1903800 | positive regulation of production of miRNAs involved in gene silencing by miRNA(GO:1903800) |
0.1 | 0.2 | GO:0010936 | negative regulation of macrophage cytokine production(GO:0010936) |
0.1 | 0.5 | GO:0035331 | negative regulation of hippo signaling(GO:0035331) |
0.1 | 1.3 | GO:0043153 | entrainment of circadian clock by photoperiod(GO:0043153) |
0.1 | 0.9 | GO:0009437 | carnitine metabolic process(GO:0009437) |
0.1 | 0.2 | GO:0045713 | low-density lipoprotein particle receptor biosynthetic process(GO:0045713) regulation of low-density lipoprotein particle receptor biosynthetic process(GO:0045714) |
0.1 | 0.9 | GO:0048715 | negative regulation of oligodendrocyte differentiation(GO:0048715) |
0.1 | 0.9 | GO:0043983 | histone H4-K12 acetylation(GO:0043983) |
0.1 | 0.3 | GO:0001957 | intramembranous ossification(GO:0001957) direct ossification(GO:0036072) |
0.1 | 1.0 | GO:0007035 | vacuolar acidification(GO:0007035) |
0.1 | 0.2 | GO:0034499 | late endosome to Golgi transport(GO:0034499) |
0.1 | 0.6 | GO:0016255 | attachment of GPI anchor to protein(GO:0016255) |
0.1 | 0.2 | GO:0051791 | medium-chain fatty acid metabolic process(GO:0051791) |
0.1 | 3.2 | GO:0060325 | face morphogenesis(GO:0060325) |
0.1 | 0.3 | GO:0045053 | protein retention in Golgi apparatus(GO:0045053) |
0.1 | 0.3 | GO:0015838 | amino-acid betaine transport(GO:0015838) |
0.1 | 0.3 | GO:0019244 | lactate biosynthetic process from pyruvate(GO:0019244) lactate biosynthetic process(GO:0019249) |
0.1 | 0.6 | GO:0097421 | liver regeneration(GO:0097421) |
0.1 | 1.5 | GO:0006783 | heme biosynthetic process(GO:0006783) |
0.1 | 0.4 | GO:0015809 | arginine transport(GO:0015809) |
0.1 | 0.8 | GO:0032211 | negative regulation of telomere maintenance via telomerase(GO:0032211) |
0.1 | 0.2 | GO:0014012 | peripheral nervous system axon regeneration(GO:0014012) |
0.1 | 0.2 | GO:0002159 | desmosome assembly(GO:0002159) |
0.1 | 0.2 | GO:0030223 | neutrophil differentiation(GO:0030223) |
0.1 | 0.4 | GO:0090435 | protein localization to nuclear envelope(GO:0090435) |
0.1 | 0.3 | GO:0045897 | regulation of transcription during mitosis(GO:0045896) positive regulation of transcription during mitosis(GO:0045897) |
0.1 | 0.8 | GO:0002756 | MyD88-independent toll-like receptor signaling pathway(GO:0002756) |
0.1 | 0.4 | GO:0048852 | diencephalon morphogenesis(GO:0048852) |
0.1 | 2.0 | GO:0035987 | endodermal cell differentiation(GO:0035987) |
0.1 | 0.3 | GO:0051534 | negative regulation of NFAT protein import into nucleus(GO:0051534) |
0.1 | 0.9 | GO:0018095 | protein polyglutamylation(GO:0018095) |
0.1 | 0.2 | GO:0007182 | common-partner SMAD protein phosphorylation(GO:0007182) |
0.1 | 0.5 | GO:0060510 | Type II pneumocyte differentiation(GO:0060510) |
0.1 | 0.1 | GO:0044800 | fusion of virus membrane with host plasma membrane(GO:0019064) membrane fusion involved in viral entry into host cell(GO:0039663) multi-organism membrane fusion(GO:0044800) |
0.1 | 0.2 | GO:0021603 | cranial nerve formation(GO:0021603) |
0.1 | 0.3 | GO:0046149 | heme catabolic process(GO:0042167) pigment catabolic process(GO:0046149) |
0.1 | 0.5 | GO:0033622 | integrin activation(GO:0033622) |
0.1 | 0.2 | GO:1901142 | insulin metabolic process(GO:1901142) |
0.1 | 0.1 | GO:1900019 | regulation of protein kinase C activity(GO:1900019) positive regulation of protein kinase C activity(GO:1900020) |
0.1 | 0.7 | GO:2000810 | regulation of bicellular tight junction assembly(GO:2000810) |
0.1 | 0.2 | GO:0060398 | regulation of growth hormone receptor signaling pathway(GO:0060398) |
0.1 | 0.4 | GO:0002023 | reduction of food intake in response to dietary excess(GO:0002023) |
0.1 | 0.1 | GO:0042364 | water-soluble vitamin biosynthetic process(GO:0042364) |
0.1 | 0.2 | GO:2001185 | regulation of CD8-positive, alpha-beta T cell activation(GO:2001185) |
0.1 | 0.6 | GO:0010744 | positive regulation of macrophage derived foam cell differentiation(GO:0010744) |
0.1 | 0.7 | GO:0001706 | endoderm formation(GO:0001706) |
0.1 | 1.2 | GO:0032967 | positive regulation of collagen biosynthetic process(GO:0032967) |
0.1 | 0.3 | GO:0031126 | snoRNA 3'-end processing(GO:0031126) |
0.1 | 2.2 | GO:0016180 | snRNA processing(GO:0016180) |
0.1 | 0.1 | GO:0060459 | left lung development(GO:0060459) |
0.1 | 0.4 | GO:1903553 | positive regulation of extracellular exosome assembly(GO:1903553) |
0.1 | 0.7 | GO:0097062 | dendritic spine maintenance(GO:0097062) |
0.1 | 0.4 | GO:0060075 | regulation of resting membrane potential(GO:0060075) |
0.1 | 0.4 | GO:0010991 | regulation of SMAD protein complex assembly(GO:0010990) negative regulation of SMAD protein complex assembly(GO:0010991) |
0.1 | 0.2 | GO:0032055 | negative regulation of translation in response to stress(GO:0032055) |
0.1 | 0.4 | GO:0070970 | interleukin-2 secretion(GO:0070970) |
0.1 | 0.6 | GO:2000344 | positive regulation of acrosome reaction(GO:2000344) |
0.1 | 0.3 | GO:1901165 | positive regulation of trophoblast cell migration(GO:1901165) |
0.1 | 0.1 | GO:0006680 | glucosylceramide catabolic process(GO:0006680) |
0.1 | 0.2 | GO:0072366 | positive regulation of gluconeogenesis by positive regulation of transcription from RNA polymerase II promoter(GO:0035948) regulation of cellular ketone metabolic process by positive regulation of transcription from RNA polymerase II promoter(GO:0072366) |
0.1 | 0.6 | GO:0090399 | replicative senescence(GO:0090399) |
0.1 | 3.6 | GO:0007044 | cell-substrate junction assembly(GO:0007044) |
0.1 | 0.6 | GO:0090051 | negative regulation of cell migration involved in sprouting angiogenesis(GO:0090051) |
0.1 | 0.5 | GO:0042754 | negative regulation of circadian rhythm(GO:0042754) |
0.1 | 0.3 | GO:0019042 | viral latency(GO:0019042) |
0.1 | 0.3 | GO:0046952 | ketone body catabolic process(GO:0046952) |
0.1 | 0.2 | GO:0002439 | chronic inflammatory response to antigenic stimulus(GO:0002439) |
0.1 | 0.3 | GO:0000379 | tRNA-type intron splice site recognition and cleavage(GO:0000379) |
0.1 | 0.2 | GO:0000479 | endonucleolytic cleavage of tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000479) |
0.1 | 0.3 | GO:0070164 | negative regulation of adiponectin secretion(GO:0070164) |
0.1 | 0.4 | GO:0086042 | cardiac muscle cell-cardiac muscle cell adhesion(GO:0086042) bundle of His cell-Purkinje myocyte adhesion involved in cell communication(GO:0086073) |
0.1 | 0.4 | GO:0060347 | heart trabecula formation(GO:0060347) |
0.1 | 0.6 | GO:0032464 | positive regulation of protein homooligomerization(GO:0032464) |
0.1 | 1.2 | GO:0043248 | proteasome assembly(GO:0043248) |
0.1 | 1.3 | GO:0010758 | regulation of macrophage chemotaxis(GO:0010758) |
0.1 | 0.2 | GO:0060375 | regulation of mast cell differentiation(GO:0060375) |
0.1 | 0.4 | GO:0030575 | nuclear body organization(GO:0030575) |
0.1 | 0.2 | GO:0033030 | negative regulation of neutrophil apoptotic process(GO:0033030) |
0.1 | 0.4 | GO:0009071 | serine family amino acid catabolic process(GO:0009071) |
0.1 | 0.2 | GO:0006356 | regulation of transcription from RNA polymerase I promoter(GO:0006356) |
0.1 | 0.1 | GO:0035526 | retrograde transport, plasma membrane to Golgi(GO:0035526) |
0.1 | 0.1 | GO:0098915 | membrane repolarization during ventricular cardiac muscle cell action potential(GO:0098915) |
0.1 | 0.2 | GO:0002337 | B-1a B cell differentiation(GO:0002337) |
0.1 | 0.2 | GO:0000960 | mitochondrial RNA catabolic process(GO:0000957) regulation of mitochondrial RNA catabolic process(GO:0000960) |
0.1 | 0.9 | GO:0034377 | plasma lipoprotein particle assembly(GO:0034377) |
0.1 | 0.1 | GO:2000489 | hepatic stellate cell activation(GO:0035733) regulation of hepatic stellate cell activation(GO:2000489) |
0.1 | 0.4 | GO:0033132 | negative regulation of glucokinase activity(GO:0033132) negative regulation of hexokinase activity(GO:1903300) |
0.1 | 0.4 | GO:0045901 | positive regulation of translational elongation(GO:0045901) |
0.1 | 0.3 | GO:0060671 | epithelial cell differentiation involved in embryonic placenta development(GO:0060671) epithelial cell morphogenesis involved in placental branching(GO:0060672) |
0.1 | 0.2 | GO:0033024 | mast cell homeostasis(GO:0033023) mast cell apoptotic process(GO:0033024) regulation of mast cell apoptotic process(GO:0033025) |
0.1 | 1.6 | GO:0070306 | lens fiber cell differentiation(GO:0070306) |
0.1 | 0.3 | GO:0048680 | positive regulation of axon regeneration(GO:0048680) |
0.1 | 1.0 | GO:0033962 | cytoplasmic mRNA processing body assembly(GO:0033962) |
0.1 | 0.1 | GO:0009106 | lipoate metabolic process(GO:0009106) |
0.1 | 0.8 | GO:0000103 | sulfate assimilation(GO:0000103) |
0.1 | 0.4 | GO:0015760 | hexose phosphate transport(GO:0015712) glucose-6-phosphate transport(GO:0015760) |
0.1 | 0.1 | GO:0060591 | chondroblast differentiation(GO:0060591) |
0.1 | 1.1 | GO:1900026 | positive regulation of substrate adhesion-dependent cell spreading(GO:1900026) |
0.1 | 0.4 | GO:1900864 | mitochondrial tRNA modification(GO:0070900) mitochondrial RNA modification(GO:1900864) |
0.1 | 0.2 | GO:0060596 | mammary placode formation(GO:0060596) |
0.1 | 0.3 | GO:0008090 | retrograde axonal transport(GO:0008090) |
0.1 | 1.7 | GO:0001574 | ganglioside biosynthetic process(GO:0001574) |
0.1 | 0.5 | GO:0015671 | oxygen transport(GO:0015671) |
0.1 | 0.9 | GO:0031065 | positive regulation of histone deacetylation(GO:0031065) |
0.1 | 0.4 | GO:0043320 | natural killer cell degranulation(GO:0043320) |
0.1 | 1.1 | GO:0030277 | maintenance of gastrointestinal epithelium(GO:0030277) |
0.1 | 0.5 | GO:0000185 | activation of MAPKKK activity(GO:0000185) |
0.1 | 0.3 | GO:0070874 | negative regulation of glycogen metabolic process(GO:0070874) |
0.1 | 0.1 | GO:0071288 | cellular response to mercury ion(GO:0071288) |
0.1 | 0.8 | GO:0043249 | erythrocyte maturation(GO:0043249) |
0.1 | 0.2 | GO:0006068 | ethanol catabolic process(GO:0006068) |
0.1 | 0.5 | GO:0070995 | NADPH oxidation(GO:0070995) |
0.1 | 0.2 | GO:0051105 | regulation of DNA ligation(GO:0051105) positive regulation of DNA ligation(GO:0051106) |
0.1 | 0.5 | GO:0015669 | gas transport(GO:0015669) carbon dioxide transport(GO:0015670) |
0.1 | 0.4 | GO:0030049 | muscle filament sliding(GO:0030049) |
0.1 | 0.4 | GO:0006646 | phosphatidylethanolamine biosynthetic process(GO:0006646) |
0.1 | 0.8 | GO:0042574 | retinal metabolic process(GO:0042574) |
0.1 | 0.3 | GO:0021555 | midbrain-hindbrain boundary morphogenesis(GO:0021555) |
0.1 | 0.6 | GO:0051131 | chaperone-mediated protein complex assembly(GO:0051131) |
0.1 | 0.9 | GO:0035721 | intraciliary retrograde transport(GO:0035721) |
0.1 | 0.4 | GO:0051136 | regulation of NK T cell differentiation(GO:0051136) positive regulation of NK T cell differentiation(GO:0051138) |
0.1 | 0.4 | GO:0071569 | protein ufmylation(GO:0071569) |
0.1 | 0.2 | GO:0036480 | neuron intrinsic apoptotic signaling pathway in response to oxidative stress(GO:0036480) regulation of oxidative stress-induced neuron intrinsic apoptotic signaling pathway(GO:1903376) |
0.1 | 0.2 | GO:2000598 | regulation of cyclin catabolic process(GO:2000598) negative regulation of cyclin catabolic process(GO:2000599) |
0.1 | 0.4 | GO:0003376 | sphingosine-1-phosphate signaling pathway(GO:0003376) |
0.1 | 0.3 | GO:0000492 | small nucleolar ribonucleoprotein complex assembly(GO:0000491) box C/D snoRNP assembly(GO:0000492) |
0.1 | 0.3 | GO:0015889 | cobalamin transport(GO:0015889) |
0.1 | 0.3 | GO:0021570 | rhombomere 4 development(GO:0021570) |
0.1 | 0.3 | GO:0072656 | maintenance of protein location in mitochondrion(GO:0072656) |
0.1 | 0.1 | GO:0043589 | skin morphogenesis(GO:0043589) |
0.1 | 1.3 | GO:0034142 | toll-like receptor 4 signaling pathway(GO:0034142) |
0.1 | 0.8 | GO:2000251 | positive regulation of actin cytoskeleton reorganization(GO:2000251) |
0.1 | 0.1 | GO:0034392 | negative regulation of smooth muscle cell apoptotic process(GO:0034392) |
0.1 | 0.3 | GO:0090050 | positive regulation of cell migration involved in sprouting angiogenesis(GO:0090050) |
0.1 | 0.4 | GO:1900121 | negative regulation of receptor binding(GO:1900121) |
0.1 | 0.1 | GO:1902606 | regulation of large conductance calcium-activated potassium channel activity(GO:1902606) positive regulation of large conductance calcium-activated potassium channel activity(GO:1902608) |
0.1 | 1.0 | GO:2001015 | negative regulation of skeletal muscle cell differentiation(GO:2001015) |
0.1 | 0.1 | GO:0019230 | proprioception(GO:0019230) |
0.1 | 0.3 | GO:2001046 | positive regulation of integrin-mediated signaling pathway(GO:2001046) |
0.1 | 0.3 | GO:0017187 | peptidyl-glutamic acid carboxylation(GO:0017187) |
0.1 | 0.6 | GO:0002024 | diet induced thermogenesis(GO:0002024) adaptive thermogenesis(GO:1990845) |
0.1 | 0.2 | GO:0010482 | epidermal cell division(GO:0010481) regulation of epidermal cell division(GO:0010482) |
0.1 | 0.4 | GO:0060330 | regulation of response to interferon-gamma(GO:0060330) |
0.1 | 0.1 | GO:1904996 | positive regulation of leukocyte adhesion to vascular endothelial cell(GO:1904996) |
0.1 | 1.8 | GO:0010831 | positive regulation of myotube differentiation(GO:0010831) |
0.1 | 0.3 | GO:0010869 | regulation of receptor biosynthetic process(GO:0010869) |
0.1 | 0.2 | GO:0000711 | meiotic DNA repair synthesis(GO:0000711) |
0.1 | 0.3 | GO:0031936 | negative regulation of chromatin silencing(GO:0031936) |
0.1 | 0.3 | GO:0034421 | post-translational protein acetylation(GO:0034421) |
0.1 | 0.3 | GO:0000972 | transcription-dependent tethering of RNA polymerase II gene DNA at nuclear periphery(GO:0000972) |
0.1 | 0.3 | GO:0035630 | bone mineralization involved in bone maturation(GO:0035630) |
0.1 | 0.4 | GO:0035878 | nail development(GO:0035878) |
0.1 | 0.2 | GO:0038128 | ERBB2 signaling pathway(GO:0038128) |
0.1 | 0.3 | GO:0034393 | positive regulation of smooth muscle cell apoptotic process(GO:0034393) |
0.1 | 0.1 | GO:0034196 | acylglycerol transport(GO:0034196) triglyceride transport(GO:0034197) |
0.1 | 0.3 | GO:0006438 | valyl-tRNA aminoacylation(GO:0006438) |
0.1 | 0.5 | GO:1901339 | regulation of store-operated calcium channel activity(GO:1901339) |
0.1 | 0.1 | GO:0042536 | negative regulation of tumor necrosis factor biosynthetic process(GO:0042536) |
0.1 | 0.2 | GO:0051964 | negative regulation of synapse assembly(GO:0051964) |
0.1 | 0.3 | GO:0006004 | fucose metabolic process(GO:0006004) |
0.1 | 0.5 | GO:0043517 | positive regulation of DNA damage response, signal transduction by p53 class mediator(GO:0043517) |
0.1 | 0.3 | GO:0003338 | metanephros morphogenesis(GO:0003338) |
0.1 | 0.1 | GO:2000574 | regulation of microtubule motor activity(GO:2000574) |
0.1 | 1.5 | GO:0043551 | regulation of phosphatidylinositol 3-kinase activity(GO:0043551) |
0.1 | 0.4 | GO:0030219 | megakaryocyte differentiation(GO:0030219) |
0.1 | 0.2 | GO:0061038 | uterus morphogenesis(GO:0061038) |
0.1 | 0.5 | GO:0048304 | positive regulation of isotype switching to IgG isotypes(GO:0048304) |
0.1 | 0.2 | GO:1904424 | regulation of GTP binding(GO:1904424) |
0.1 | 0.2 | GO:1990036 | calcium ion import into sarcoplasmic reticulum(GO:1990036) |
0.1 | 0.3 | GO:0032876 | negative regulation of DNA endoreduplication(GO:0032876) |
0.1 | 0.8 | GO:0030212 | hyaluronan metabolic process(GO:0030212) |
0.1 | 0.3 | GO:2000210 | positive regulation of anoikis(GO:2000210) |
0.1 | 0.2 | GO:0060154 | cellular process regulating host cell cycle in response to virus(GO:0060154) |
0.1 | 0.1 | GO:0070212 | protein poly-ADP-ribosylation(GO:0070212) |
0.1 | 0.2 | GO:0006901 | vesicle coating(GO:0006901) |
0.1 | 3.6 | GO:0035914 | skeletal muscle cell differentiation(GO:0035914) |
0.1 | 0.6 | GO:0042347 | negative regulation of NF-kappaB import into nucleus(GO:0042347) |
0.1 | 0.2 | GO:0030578 | PML body organization(GO:0030578) |
0.1 | 0.1 | GO:0021569 | rhombomere 3 development(GO:0021569) |
0.1 | 0.8 | GO:0045943 | positive regulation of transcription from RNA polymerase I promoter(GO:0045943) |
0.1 | 0.2 | GO:0034454 | microtubule anchoring at centrosome(GO:0034454) |
0.1 | 0.4 | GO:0016266 | O-glycan processing(GO:0016266) |
0.1 | 0.3 | GO:0010804 | negative regulation of tumor necrosis factor-mediated signaling pathway(GO:0010804) |
0.1 | 1.1 | GO:0030150 | protein import into mitochondrial matrix(GO:0030150) |
0.1 | 0.4 | GO:0060068 | vagina development(GO:0060068) |
0.1 | 0.7 | GO:0006978 | DNA damage response, signal transduction by p53 class mediator resulting in transcription of p21 class mediator(GO:0006978) |
0.1 | 1.1 | GO:0002385 | mucosal immune response(GO:0002385) |
0.1 | 0.3 | GO:2000059 | negative regulation of protein ubiquitination involved in ubiquitin-dependent protein catabolic process(GO:2000059) |
0.1 | 0.4 | GO:0046836 | glycolipid transport(GO:0046836) |
0.1 | 0.2 | GO:0043307 | eosinophil activation involved in immune response(GO:0002278) eosinophil mediated immunity(GO:0002447) eosinophil activation(GO:0043307) eosinophil degranulation(GO:0043308) |
0.1 | 0.2 | GO:0036233 | glycine import(GO:0036233) |
0.1 | 0.2 | GO:0042520 | positive regulation of tyrosine phosphorylation of Stat4 protein(GO:0042520) |
0.1 | 0.2 | GO:0006419 | alanyl-tRNA aminoacylation(GO:0006419) |
0.1 | 0.2 | GO:0033685 | negative regulation of luteinizing hormone secretion(GO:0033685) |
0.1 | 0.2 | GO:0048742 | regulation of skeletal muscle fiber development(GO:0048742) |
0.1 | 1.4 | GO:0031952 | regulation of protein autophosphorylation(GO:0031952) |
0.1 | 0.6 | GO:0045056 | transcytosis(GO:0045056) |
0.1 | 0.2 | GO:0048840 | otolith development(GO:0048840) |
0.1 | 0.1 | GO:0042421 | norepinephrine biosynthetic process(GO:0042421) |
0.1 | 0.7 | GO:0060561 | apoptotic process involved in morphogenesis(GO:0060561) |
0.1 | 0.9 | GO:0071158 | positive regulation of cell cycle arrest(GO:0071158) |
0.1 | 0.9 | GO:0031103 | axon regeneration(GO:0031103) |
0.1 | 0.1 | GO:0050968 | detection of chemical stimulus involved in sensory perception of pain(GO:0050968) |
0.1 | 0.2 | GO:0008343 | adult feeding behavior(GO:0008343) |
0.1 | 0.7 | GO:0048268 | clathrin coat assembly(GO:0048268) |
0.1 | 0.1 | GO:0071336 | regulation of hair follicle cell proliferation(GO:0071336) |
0.1 | 0.5 | GO:0075522 | IRES-dependent viral translational initiation(GO:0075522) |
0.1 | 0.2 | GO:0006848 | pyruvate transport(GO:0006848) pyruvate transmembrane transport(GO:1901475) |
0.1 | 0.6 | GO:0042795 | snRNA transcription from RNA polymerase II promoter(GO:0042795) |
0.1 | 0.1 | GO:0007494 | midgut development(GO:0007494) |
0.1 | 0.1 | GO:1901492 | positive regulation of lymphangiogenesis(GO:1901492) |
0.1 | 0.1 | GO:0033234 | negative regulation of protein sumoylation(GO:0033234) |
0.1 | 0.1 | GO:0043096 | purine nucleobase salvage(GO:0043096) |
0.1 | 0.2 | GO:0021797 | forebrain anterior/posterior pattern specification(GO:0021797) |
0.1 | 0.1 | GO:0006007 | glucose catabolic process(GO:0006007) |
0.1 | 0.2 | GO:0072383 | plus-end-directed vesicle transport along microtubule(GO:0072383) plus-end-directed organelle transport along microtubule(GO:0072386) |
0.1 | 0.1 | GO:1903059 | regulation of protein lipidation(GO:1903059) positive regulation of protein lipidation(GO:1903061) |
0.1 | 0.1 | GO:0010635 | regulation of mitochondrial fusion(GO:0010635) negative regulation of mitochondrial fusion(GO:0010637) |
0.1 | 0.1 | GO:0098902 | regulation of membrane depolarization during action potential(GO:0098902) |
0.1 | 2.0 | GO:0046324 | regulation of glucose import(GO:0046324) |
0.1 | 0.1 | GO:0033083 | regulation of immature T cell proliferation(GO:0033083) |
0.1 | 0.1 | GO:0031033 | myosin filament organization(GO:0031033) |
0.1 | 5.6 | GO:0043484 | regulation of RNA splicing(GO:0043484) |
0.1 | 0.1 | GO:1904217 | regulation of CDP-diacylglycerol-serine O-phosphatidyltransferase activity(GO:1904217) positive regulation of CDP-diacylglycerol-serine O-phosphatidyltransferase activity(GO:1904219) regulation of serine C-palmitoyltransferase activity(GO:1904220) positive regulation of serine C-palmitoyltransferase activity(GO:1904222) |
0.1 | 0.2 | GO:0042732 | D-xylose metabolic process(GO:0042732) |
0.1 | 0.1 | GO:0033045 | regulation of sister chromatid segregation(GO:0033045) |
0.1 | 0.3 | GO:0072675 | osteoclast fusion(GO:0072675) |
0.1 | 0.4 | GO:0071763 | nuclear membrane organization(GO:0071763) |
0.1 | 0.1 | GO:0033058 | directional locomotion(GO:0033058) |
0.1 | 1.4 | GO:0045747 | positive regulation of Notch signaling pathway(GO:0045747) |
0.1 | 0.1 | GO:0009648 | photoperiodism(GO:0009648) |
0.1 | 0.1 | GO:0042033 | chemokine biosynthetic process(GO:0042033) regulation of chemokine biosynthetic process(GO:0045073) negative regulation of chemokine biosynthetic process(GO:0045079) |
0.1 | 0.3 | GO:1900028 | negative regulation of ruffle assembly(GO:1900028) |
0.1 | 0.1 | GO:0038145 | macrophage colony-stimulating factor signaling pathway(GO:0038145) |
0.1 | 0.3 | GO:0070127 | tRNA aminoacylation for mitochondrial protein translation(GO:0070127) |
0.1 | 0.3 | GO:0045654 | positive regulation of megakaryocyte differentiation(GO:0045654) |
0.1 | 0.1 | GO:1901503 | ether lipid biosynthetic process(GO:0008611) glycerol ether biosynthetic process(GO:0046504) cellular lipid biosynthetic process(GO:0097384) ether biosynthetic process(GO:1901503) |
0.1 | 0.7 | GO:0090036 | regulation of protein kinase C signaling(GO:0090036) |
0.1 | 0.2 | GO:0016264 | gap junction assembly(GO:0016264) |
0.1 | 0.2 | GO:0060689 | cell differentiation involved in salivary gland development(GO:0060689) |
0.1 | 1.4 | GO:0006491 | N-glycan processing(GO:0006491) |
0.1 | 0.9 | GO:0043171 | peptide catabolic process(GO:0043171) |
0.1 | 0.1 | GO:0035519 | protein K29-linked ubiquitination(GO:0035519) |
0.1 | 0.6 | GO:2000272 | negative regulation of receptor activity(GO:2000272) |
0.1 | 0.1 | GO:0071638 | negative regulation of monocyte chemotactic protein-1 production(GO:0071638) |
0.1 | 0.1 | GO:0036506 | maintenance of unfolded protein(GO:0036506) maintenance of unfolded protein involved in ERAD pathway(GO:1904378) |
0.1 | 0.4 | GO:0032099 | negative regulation of appetite(GO:0032099) |
0.1 | 0.5 | GO:0035590 | purinergic nucleotide receptor signaling pathway(GO:0035590) |
0.1 | 0.1 | GO:0035089 | establishment of apical/basal cell polarity(GO:0035089) |
0.1 | 0.1 | GO:1902309 | negative regulation of peptidyl-serine dephosphorylation(GO:1902309) |
0.1 | 0.6 | GO:0032506 | cytokinetic process(GO:0032506) |
0.1 | 0.1 | GO:0006868 | glutamine transport(GO:0006868) |
0.1 | 0.2 | GO:0048739 | cardiac muscle fiber development(GO:0048739) |
0.1 | 0.5 | GO:0018026 | peptidyl-lysine monomethylation(GO:0018026) |
0.1 | 0.1 | GO:0060044 | negative regulation of cardiac muscle cell proliferation(GO:0060044) |
0.1 | 0.7 | GO:0001731 | formation of translation preinitiation complex(GO:0001731) |
0.1 | 0.1 | GO:0046499 | S-adenosylmethioninamine metabolic process(GO:0046499) |
0.1 | 0.2 | GO:0006336 | DNA replication-independent nucleosome assembly(GO:0006336) DNA replication-independent nucleosome organization(GO:0034724) |
0.1 | 0.3 | GO:0034755 | iron ion transmembrane transport(GO:0034755) |
0.1 | 0.1 | GO:0044805 | lysosomal microautophagy(GO:0016237) piecemeal microautophagy of nucleus(GO:0034727) late nucleophagy(GO:0044805) |
0.1 | 0.1 | GO:0060018 | astrocyte fate commitment(GO:0060018) |
0.1 | 0.1 | GO:0007567 | parturition(GO:0007567) |
0.1 | 0.3 | GO:0006451 | selenocysteine incorporation(GO:0001514) translational readthrough(GO:0006451) |
0.1 | 0.2 | GO:0072015 | glomerular visceral epithelial cell development(GO:0072015) glomerular epithelial cell development(GO:0072310) |
0.1 | 0.1 | GO:0051799 | negative regulation of hair follicle development(GO:0051799) |
0.1 | 0.7 | GO:0071548 | response to dexamethasone(GO:0071548) cellular response to dexamethasone stimulus(GO:0071549) |
0.1 | 0.1 | GO:0046125 | pyrimidine deoxyribonucleoside metabolic process(GO:0046125) |
0.1 | 0.2 | GO:0072678 | T cell migration(GO:0072678) |
0.1 | 0.2 | GO:0006391 | transcription initiation from mitochondrial promoter(GO:0006391) |
0.1 | 0.3 | GO:0070475 | rRNA base methylation(GO:0070475) |
0.1 | 0.3 | GO:0045955 | negative regulation of calcium ion-dependent exocytosis(GO:0045955) |
0.1 | 0.1 | GO:1900227 | positive regulation of NLRP3 inflammasome complex assembly(GO:1900227) |
0.1 | 0.1 | GO:1903599 | positive regulation of mitophagy(GO:1903599) |
0.1 | 0.3 | GO:0046929 | negative regulation of neurotransmitter secretion(GO:0046929) |
0.1 | 0.1 | GO:0045347 | negative regulation of MHC class II biosynthetic process(GO:0045347) |
0.1 | 0.1 | GO:0046121 | deoxyribonucleoside catabolic process(GO:0046121) |
0.1 | 0.1 | GO:0061724 | lipophagy(GO:0061724) |
0.1 | 0.1 | GO:0005984 | disaccharide metabolic process(GO:0005984) |
0.1 | 0.1 | GO:0006505 | GPI anchor metabolic process(GO:0006505) |
0.1 | 0.4 | GO:0050930 | induction of positive chemotaxis(GO:0050930) |
0.1 | 0.1 | GO:1904294 | positive regulation of ERAD pathway(GO:1904294) |
0.1 | 1.1 | GO:0001556 | oocyte maturation(GO:0001556) |
0.1 | 0.3 | GO:0045974 | negative regulation of translation, ncRNA-mediated(GO:0040033) regulation of translation, ncRNA-mediated(GO:0045974) |
0.1 | 0.1 | GO:0043353 | enucleate erythrocyte differentiation(GO:0043353) |
0.1 | 0.1 | GO:0035646 | endosome to melanosome transport(GO:0035646) endosome to pigment granule transport(GO:0043485) pigment granule maturation(GO:0048757) |
0.1 | 0.2 | GO:0044341 | sodium-dependent phosphate transport(GO:0044341) |
0.1 | 0.2 | GO:0042790 | transcription of nuclear large rRNA transcript from RNA polymerase I promoter(GO:0042790) |
0.1 | 0.1 | GO:0015746 | tricarboxylic acid transport(GO:0006842) citrate transport(GO:0015746) |
0.1 | 2.0 | GO:0007127 | meiosis I(GO:0007127) |
0.1 | 0.1 | GO:0031052 | programmed DNA elimination(GO:0031049) chromosome breakage(GO:0031052) |
0.1 | 0.7 | GO:0045475 | locomotor rhythm(GO:0045475) |
0.1 | 0.1 | GO:0072718 | response to cisplatin(GO:0072718) |
0.1 | 1.9 | GO:0000462 | maturation of SSU-rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000462) |
0.1 | 2.2 | GO:0006073 | glycogen metabolic process(GO:0005977) cellular glucan metabolic process(GO:0006073) glucan metabolic process(GO:0044042) |
0.1 | 0.1 | GO:0031914 | negative regulation of synaptic plasticity(GO:0031914) |
0.1 | 1.0 | GO:0048016 | inositol phosphate-mediated signaling(GO:0048016) |
0.1 | 0.1 | GO:0001887 | selenium compound metabolic process(GO:0001887) |
0.1 | 0.1 | GO:0006114 | glycerol biosynthetic process(GO:0006114) |
0.1 | 0.1 | GO:2000535 | entry of bacterium into host cell(GO:0035635) regulation of entry of bacterium into host cell(GO:2000535) |
0.1 | 0.4 | GO:0050860 | negative regulation of T cell receptor signaling pathway(GO:0050860) |
0.1 | 0.1 | GO:0006610 | ribosomal protein import into nucleus(GO:0006610) |
0.1 | 0.2 | GO:0097428 | protein maturation by iron-sulfur cluster transfer(GO:0097428) |
0.1 | 0.1 | GO:0006933 | negative regulation of cell adhesion involved in substrate-bound cell migration(GO:0006933) |
0.1 | 0.1 | GO:0006667 | sphinganine metabolic process(GO:0006667) |
0.1 | 0.2 | GO:0070816 | phosphorylation of RNA polymerase II C-terminal domain(GO:0070816) |
0.1 | 0.1 | GO:1905048 | regulation of metallopeptidase activity(GO:1905048) |
0.1 | 0.4 | GO:0032469 | endoplasmic reticulum calcium ion homeostasis(GO:0032469) |
0.1 | 0.7 | GO:0050892 | intestinal absorption(GO:0050892) |
0.1 | 0.2 | GO:0046621 | negative regulation of organ growth(GO:0046621) |
0.1 | 0.1 | GO:1905206 | positive regulation of hydrogen peroxide-mediated programmed cell death(GO:1901300) positive regulation of hydrogen peroxide-induced cell death(GO:1905206) |
0.1 | 0.1 | GO:0002098 | tRNA wobble uridine modification(GO:0002098) |
0.1 | 1.4 | GO:0043407 | negative regulation of MAP kinase activity(GO:0043407) |
0.1 | 0.6 | GO:0046475 | glycerophospholipid catabolic process(GO:0046475) |
0.1 | 0.9 | GO:0007062 | sister chromatid cohesion(GO:0007062) |
0.1 | 0.1 | GO:1901252 | regulation of intracellular transport of viral material(GO:1901252) |
0.1 | 1.6 | GO:0006749 | glutathione metabolic process(GO:0006749) |
0.1 | 0.1 | GO:0048341 | paraxial mesoderm formation(GO:0048341) |
0.1 | 4.4 | GO:0008654 | phospholipid biosynthetic process(GO:0008654) |
0.1 | 0.1 | GO:0071651 | positive regulation of chemokine (C-C motif) ligand 5 production(GO:0071651) |
0.1 | 0.2 | GO:1901660 | calcium ion export(GO:1901660) |
0.1 | 0.3 | GO:0097500 | receptor localization to nonmotile primary cilium(GO:0097500) |
0.1 | 0.1 | GO:0010248 | establishment or maintenance of transmembrane electrochemical gradient(GO:0010248) |
0.1 | 0.1 | GO:0002339 | B cell selection(GO:0002339) |
0.1 | 0.2 | GO:0072610 | interleukin-12 secretion(GO:0072610) regulation of interleukin-12 secretion(GO:2001182) |
0.1 | 0.1 | GO:0072053 | renal inner medulla development(GO:0072053) |
0.1 | 0.3 | GO:0006995 | cellular response to nitrogen starvation(GO:0006995) cellular response to nitrogen levels(GO:0043562) |
0.1 | 0.2 | GO:0015695 | organic cation transport(GO:0015695) |
0.1 | 0.1 | GO:1901897 | regulation of relaxation of cardiac muscle(GO:1901897) |
0.1 | 0.1 | GO:0030421 | defecation(GO:0030421) |
0.1 | 0.2 | GO:0007435 | salivary gland morphogenesis(GO:0007435) |
0.1 | 1.5 | GO:0008333 | endosome to lysosome transport(GO:0008333) |
0.1 | 0.1 | GO:2000104 | negative regulation of DNA-dependent DNA replication(GO:2000104) |
0.1 | 0.1 | GO:0048643 | positive regulation of skeletal muscle tissue development(GO:0048643) |
0.1 | 0.1 | GO:0006824 | cobalt ion transport(GO:0006824) |
0.1 | 0.1 | GO:1904180 | negative regulation of membrane depolarization(GO:1904180) |
0.1 | 0.1 | GO:0097051 | establishment of protein localization to endoplasmic reticulum membrane(GO:0097051) |
0.1 | 0.3 | GO:0070131 | positive regulation of mitochondrial translation(GO:0070131) |
0.1 | 0.1 | GO:1903795 | regulation of inorganic anion transmembrane transport(GO:1903795) |
0.1 | 0.4 | GO:0030033 | microvillus assembly(GO:0030033) |
0.1 | 0.2 | GO:0030502 | negative regulation of bone mineralization(GO:0030502) |
0.1 | 0.2 | GO:0009256 | 10-formyltetrahydrofolate metabolic process(GO:0009256) |
0.1 | 0.1 | GO:0032488 | Cdc42 protein signal transduction(GO:0032488) |
0.1 | 0.1 | GO:0038095 | Fc-epsilon receptor signaling pathway(GO:0038095) |
0.1 | 0.2 | GO:0071803 | positive regulation of podosome assembly(GO:0071803) |
0.1 | 1.3 | GO:0042073 | intraciliary transport(GO:0042073) |
0.1 | 0.2 | GO:0050765 | negative regulation of phagocytosis(GO:0050765) |
0.1 | 0.1 | GO:0042851 | alanine metabolic process(GO:0006522) pyruvate family amino acid metabolic process(GO:0009078) L-alanine metabolic process(GO:0042851) |
0.1 | 0.3 | GO:0060052 | neurofilament cytoskeleton organization(GO:0060052) |
0.1 | 0.1 | GO:0044539 | long-chain fatty acid import(GO:0044539) |
0.1 | 0.2 | GO:0015744 | succinate transport(GO:0015744) |
0.1 | 0.1 | GO:0006041 | glucosamine metabolic process(GO:0006041) |
0.1 | 0.2 | GO:0050812 | regulation of acetyl-CoA biosynthetic process from pyruvate(GO:0010510) regulation of acyl-CoA biosynthetic process(GO:0050812) |
0.1 | 0.1 | GO:0001794 | type IIa hypersensitivity(GO:0001794) regulation of type IIa hypersensitivity(GO:0001796) positive regulation of type IIa hypersensitivity(GO:0001798) type II hypersensitivity(GO:0002445) regulation of type II hypersensitivity(GO:0002892) positive regulation of type II hypersensitivity(GO:0002894) |
0.1 | 0.1 | GO:0090526 | regulation of gluconeogenesis involved in cellular glucose homeostasis(GO:0090526) |
0.1 | 0.3 | GO:0034501 | protein localization to kinetochore(GO:0034501) |
0.1 | 0.1 | GO:0072193 | ureter smooth muscle development(GO:0072191) ureter smooth muscle cell differentiation(GO:0072193) |
0.1 | 0.3 | GO:0006002 | fructose 6-phosphate metabolic process(GO:0006002) |
0.1 | 0.2 | GO:0033499 | galactose catabolic process via UDP-galactose(GO:0033499) glycolytic process through glucose-1-phosphate(GO:0061622) glycolytic process from galactose(GO:0061623) |
0.1 | 0.2 | GO:0032769 | negative regulation of monooxygenase activity(GO:0032769) |
0.1 | 0.2 | GO:0070389 | chaperone cofactor-dependent protein refolding(GO:0070389) |
0.1 | 0.1 | GO:0034146 | toll-like receptor 5 signaling pathway(GO:0034146) |
0.1 | 0.1 | GO:1900118 | negative regulation of execution phase of apoptosis(GO:1900118) |
0.1 | 0.4 | GO:0000076 | DNA replication checkpoint(GO:0000076) |
0.1 | 0.1 | GO:1901800 | positive regulation of proteasomal protein catabolic process(GO:1901800) |
0.1 | 0.1 | GO:0043985 | histone H4-R3 methylation(GO:0043985) |
0.1 | 0.1 | GO:1904037 | positive regulation of epithelial cell apoptotic process(GO:1904037) |
0.1 | 0.2 | GO:0035523 | protein K29-linked deubiquitination(GO:0035523) protein K33-linked deubiquitination(GO:1990168) |
0.1 | 0.3 | GO:0046685 | response to arsenic-containing substance(GO:0046685) |
0.1 | 0.1 | GO:0021898 | commitment of multipotent stem cells to neuronal lineage in forebrain(GO:0021898) |
0.1 | 0.2 | GO:0006549 | isoleucine metabolic process(GO:0006549) |
0.1 | 0.1 | GO:0009128 | purine nucleoside monophosphate catabolic process(GO:0009128) |
0.1 | 0.2 | GO:0048312 | intracellular distribution of mitochondria(GO:0048312) |
0.0 | 0.0 | GO:0031657 | regulation of cyclin-dependent protein serine/threonine kinase activity involved in G1/S transition of mitotic cell cycle(GO:0031657) positive regulation of cyclin-dependent protein serine/threonine kinase activity involved in G1/S transition of mitotic cell cycle(GO:0031659) |
0.0 | 0.2 | GO:0006152 | purine nucleoside catabolic process(GO:0006152) purine ribonucleoside catabolic process(GO:0046130) |
0.0 | 0.0 | GO:0000965 | mitochondrial RNA 3'-end processing(GO:0000965) |
0.0 | 0.3 | GO:0034625 | fatty acid elongation, saturated fatty acid(GO:0019367) fatty acid elongation, unsaturated fatty acid(GO:0019368) fatty acid elongation, monounsaturated fatty acid(GO:0034625) fatty acid elongation, polyunsaturated fatty acid(GO:0034626) |
0.0 | 0.7 | GO:0006607 | NLS-bearing protein import into nucleus(GO:0006607) |
0.0 | 0.1 | GO:2000249 | regulation of actin cytoskeleton reorganization(GO:2000249) |
0.0 | 0.0 | GO:0009301 | snRNA transcription(GO:0009301) |
0.0 | 0.0 | GO:0001923 | B-1 B cell differentiation(GO:0001923) |
0.0 | 0.1 | GO:0050755 | chemokine metabolic process(GO:0050755) |
0.0 | 0.0 | GO:0035022 | positive regulation of Rac protein signal transduction(GO:0035022) |
0.0 | 0.0 | GO:0060638 | mesenchymal-epithelial cell signaling(GO:0060638) |
0.0 | 0.1 | GO:0090084 | negative regulation of inclusion body assembly(GO:0090084) |
0.0 | 0.2 | GO:0051444 | negative regulation of ubiquitin-protein transferase activity(GO:0051444) |
0.0 | 0.5 | GO:1900017 | positive regulation of cytokine production involved in inflammatory response(GO:1900017) |
0.0 | 0.0 | GO:0036438 | maintenance of lens transparency(GO:0036438) |
0.0 | 0.1 | GO:0003096 | renal sodium ion transport(GO:0003096) |
0.0 | 0.0 | GO:0000966 | RNA 5'-end processing(GO:0000966) |
0.0 | 0.2 | GO:2000353 | positive regulation of endothelial cell apoptotic process(GO:2000353) |
0.0 | 0.3 | GO:1902018 | negative regulation of cilium assembly(GO:1902018) |
0.0 | 0.6 | GO:0006895 | Golgi to endosome transport(GO:0006895) |
0.0 | 0.0 | GO:2001044 | regulation of integrin-mediated signaling pathway(GO:2001044) |
0.0 | 0.0 | GO:0035112 | genitalia morphogenesis(GO:0035112) |
0.0 | 0.4 | GO:0048147 | negative regulation of fibroblast proliferation(GO:0048147) |
0.0 | 0.1 | GO:0010825 | positive regulation of centrosome duplication(GO:0010825) |
0.0 | 0.1 | GO:0046015 | regulation of transcription by glucose(GO:0046015) |
0.0 | 0.2 | GO:0044351 | macropinocytosis(GO:0044351) |
0.0 | 0.1 | GO:0001915 | negative regulation of T cell mediated cytotoxicity(GO:0001915) |
0.0 | 0.4 | GO:0046085 | adenosine metabolic process(GO:0046085) |
0.0 | 0.0 | GO:0098840 | protein transport along microtubule(GO:0098840) |
0.0 | 0.0 | GO:1903071 | positive regulation of ER-associated ubiquitin-dependent protein catabolic process(GO:1903071) |
0.0 | 0.0 | GO:0048290 | isotype switching to IgA isotypes(GO:0048290) regulation of isotype switching to IgA isotypes(GO:0048296) |
0.0 | 0.1 | GO:0050916 | sensory perception of sweet taste(GO:0050916) |
0.0 | 0.4 | GO:0007213 | G-protein coupled acetylcholine receptor signaling pathway(GO:0007213) |
0.0 | 0.1 | GO:0009650 | UV protection(GO:0009650) |
0.0 | 0.2 | GO:0046322 | negative regulation of fatty acid oxidation(GO:0046322) |
0.0 | 0.1 | GO:0006556 | S-adenosylmethionine biosynthetic process(GO:0006556) |
0.0 | 0.1 | GO:0042701 | progesterone secretion(GO:0042701) |
0.0 | 0.2 | GO:0006703 | estrogen biosynthetic process(GO:0006703) |
0.0 | 0.2 | GO:0046185 | aldehyde catabolic process(GO:0046185) |
0.0 | 0.0 | GO:0060433 | bronchus development(GO:0060433) |
0.0 | 0.4 | GO:0034315 | regulation of Arp2/3 complex-mediated actin nucleation(GO:0034315) |
0.0 | 0.2 | GO:0043173 | nucleotide salvage(GO:0043173) |
0.0 | 0.1 | GO:1990705 | cholangiocyte proliferation(GO:1990705) |
0.0 | 1.2 | GO:0070527 | platelet aggregation(GO:0070527) |
0.0 | 0.0 | GO:0034587 | piRNA metabolic process(GO:0034587) |
0.0 | 0.2 | GO:0036336 | dendritic cell migration(GO:0036336) |
0.0 | 0.1 | GO:0046950 | cellular ketone body metabolic process(GO:0046950) |
0.0 | 0.2 | GO:0030854 | positive regulation of granulocyte differentiation(GO:0030854) |
0.0 | 0.2 | GO:0006851 | mitochondrial calcium ion transport(GO:0006851) |
0.0 | 0.1 | GO:0033184 | positive regulation of histone ubiquitination(GO:0033184) |
0.0 | 0.4 | GO:0006123 | mitochondrial electron transport, cytochrome c to oxygen(GO:0006123) |
0.0 | 0.7 | GO:0046513 | ceramide biosynthetic process(GO:0046513) |
0.0 | 0.2 | GO:0060050 | positive regulation of protein glycosylation(GO:0060050) |
0.0 | 0.0 | GO:0042789 | mRNA transcription from RNA polymerase II promoter(GO:0042789) |
0.0 | 0.1 | GO:2000297 | negative regulation of synapse maturation(GO:2000297) |
0.0 | 0.2 | GO:0046835 | carbohydrate phosphorylation(GO:0046835) |
0.0 | 0.0 | GO:0032096 | negative regulation of response to food(GO:0032096) |
0.0 | 0.1 | GO:1903660 | complement-dependent cytotoxicity(GO:0097278) regulation of complement-dependent cytotoxicity(GO:1903659) negative regulation of complement-dependent cytotoxicity(GO:1903660) |
0.0 | 0.2 | GO:0048148 | behavioral response to cocaine(GO:0048148) |
0.0 | 0.2 | GO:0060340 | positive regulation of type I interferon-mediated signaling pathway(GO:0060340) |
0.0 | 0.1 | GO:1904705 | regulation of vascular smooth muscle cell proliferation(GO:1904705) vascular smooth muscle cell proliferation(GO:1990874) |
0.0 | 0.1 | GO:0090206 | negative regulation of cholesterol biosynthetic process(GO:0045541) negative regulation of cholesterol metabolic process(GO:0090206) |
0.0 | 0.1 | GO:0007290 | spermatid nucleus elongation(GO:0007290) |
0.0 | 0.3 | GO:2000036 | regulation of stem cell population maintenance(GO:2000036) |
0.0 | 0.0 | GO:0010701 | positive regulation of norepinephrine secretion(GO:0010701) |
0.0 | 0.0 | GO:0042908 | xenobiotic transport(GO:0042908) |
0.0 | 0.0 | GO:0072513 | positive regulation of secondary heart field cardioblast proliferation(GO:0072513) |
0.0 | 0.0 | GO:0019626 | short-chain fatty acid catabolic process(GO:0019626) |
0.0 | 1.1 | GO:0000027 | ribosomal large subunit assembly(GO:0000027) |
0.0 | 0.1 | GO:0060371 | regulation of atrial cardiac muscle cell membrane depolarization(GO:0060371) |
0.0 | 0.0 | GO:0042447 | hormone catabolic process(GO:0042447) |
0.0 | 0.3 | GO:0006122 | mitochondrial electron transport, ubiquinol to cytochrome c(GO:0006122) |
0.0 | 0.2 | GO:0045586 | regulation of gamma-delta T cell differentiation(GO:0045586) regulation of gamma-delta T cell activation(GO:0046643) |
0.0 | 0.1 | GO:0045110 | intermediate filament bundle assembly(GO:0045110) |
0.0 | 0.3 | GO:1902236 | negative regulation of endoplasmic reticulum stress-induced intrinsic apoptotic signaling pathway(GO:1902236) |
0.0 | 0.2 | GO:0006013 | mannose metabolic process(GO:0006013) |
0.0 | 0.0 | GO:0045652 | regulation of megakaryocyte differentiation(GO:0045652) |
0.0 | 0.3 | GO:0006878 | cellular copper ion homeostasis(GO:0006878) |
0.0 | 0.1 | GO:0060390 | regulation of SMAD protein import into nucleus(GO:0060390) |
0.0 | 0.2 | GO:0034227 | tRNA thio-modification(GO:0034227) |
0.0 | 0.0 | GO:0030431 | sleep(GO:0030431) |
0.0 | 0.1 | GO:0046543 | development of secondary female sexual characteristics(GO:0046543) |
0.0 | 0.7 | GO:0021591 | ventricular system development(GO:0021591) |
0.0 | 0.5 | GO:0060716 | labyrinthine layer blood vessel development(GO:0060716) |
0.0 | 0.2 | GO:0010818 | T cell chemotaxis(GO:0010818) |
0.0 | 0.1 | GO:0009597 | detection of virus(GO:0009597) |
0.0 | 0.0 | GO:0030885 | regulation of myeloid dendritic cell activation(GO:0030885) negative regulation of myeloid dendritic cell activation(GO:0030886) |
0.0 | 0.2 | GO:0070935 | 3'-UTR-mediated mRNA stabilization(GO:0070935) |
0.0 | 0.2 | GO:0045603 | positive regulation of endothelial cell differentiation(GO:0045603) |
0.0 | 0.1 | GO:0061302 | smooth muscle cell-matrix adhesion(GO:0061302) regulation of smooth muscle cell-matrix adhesion(GO:2000097) |
0.0 | 0.2 | GO:1900262 | regulation of DNA-directed DNA polymerase activity(GO:1900262) positive regulation of DNA-directed DNA polymerase activity(GO:1900264) |
0.0 | 0.0 | GO:0007431 | salivary gland development(GO:0007431) |
0.0 | 0.0 | GO:2000348 | regulation of CD40 signaling pathway(GO:2000348) |
0.0 | 0.1 | GO:0090069 | regulation of ribosome biogenesis(GO:0090069) |
0.0 | 0.3 | GO:0034498 | early endosome to Golgi transport(GO:0034498) |
0.0 | 0.0 | GO:1901725 | regulation of histone deacetylase activity(GO:1901725) |
0.0 | 0.2 | GO:0006547 | histidine metabolic process(GO:0006547) histidine catabolic process(GO:0006548) imidazole-containing compound catabolic process(GO:0052805) |
0.0 | 0.0 | GO:2000169 | regulation of peptidyl-cysteine S-nitrosylation(GO:2000169) |
0.0 | 0.1 | GO:0042758 | long-chain fatty acid catabolic process(GO:0042758) |
0.0 | 0.2 | GO:0019276 | UDP-N-acetylgalactosamine metabolic process(GO:0019276) |
0.0 | 0.1 | GO:0042994 | cytoplasmic sequestering of transcription factor(GO:0042994) |
0.0 | 0.1 | GO:0002586 | regulation of antigen processing and presentation of peptide or polysaccharide antigen via MHC class II(GO:0002580) regulation of antigen processing and presentation of peptide antigen via MHC class II(GO:0002586) |
0.0 | 0.3 | GO:0019432 | triglyceride biosynthetic process(GO:0019432) |
0.0 | 0.1 | GO:1901185 | negative regulation of ERBB signaling pathway(GO:1901185) |
0.0 | 1.0 | GO:2000134 | negative regulation of G1/S transition of mitotic cell cycle(GO:2000134) |
0.0 | 0.1 | GO:2001241 | positive regulation of extrinsic apoptotic signaling pathway in absence of ligand(GO:2001241) |
0.0 | 0.5 | GO:0006144 | purine nucleobase metabolic process(GO:0006144) |
0.0 | 0.1 | GO:0016480 | negative regulation of transcription from RNA polymerase III promoter(GO:0016480) |
0.0 | 0.1 | GO:0032825 | positive regulation of natural killer cell differentiation(GO:0032825) |
0.0 | 0.1 | GO:0015808 | L-alanine transport(GO:0015808) |
0.0 | 0.2 | GO:1900037 | regulation of cellular response to hypoxia(GO:1900037) |
0.0 | 0.6 | GO:0006383 | transcription from RNA polymerase III promoter(GO:0006383) |
0.0 | 0.2 | GO:0097284 | hepatocyte apoptotic process(GO:0097284) |
0.0 | 0.0 | GO:0046292 | formaldehyde metabolic process(GO:0046292) |
0.0 | 0.0 | GO:0060948 | cardiac vascular smooth muscle cell development(GO:0060948) |
0.0 | 0.5 | GO:1902808 | positive regulation of cell cycle G1/S phase transition(GO:1902808) |
0.0 | 0.2 | GO:2000609 | regulation of thyroid hormone generation(GO:2000609) |
0.0 | 0.2 | GO:0045947 | negative regulation of translational initiation(GO:0045947) |
0.0 | 0.0 | GO:0097460 | ferrous iron import(GO:0070627) ferrous iron import into cell(GO:0097460) |
0.0 | 0.2 | GO:0046602 | regulation of mitotic centrosome separation(GO:0046602) |
0.0 | 0.0 | GO:1901096 | regulation of autophagosome maturation(GO:1901096) |
0.0 | 0.1 | GO:0000272 | polysaccharide catabolic process(GO:0000272) |
0.0 | 1.0 | GO:0030032 | lamellipodium assembly(GO:0030032) |
0.0 | 0.1 | GO:0060027 | convergent extension involved in gastrulation(GO:0060027) |
0.0 | 0.3 | GO:0006817 | phosphate ion transport(GO:0006817) |
0.0 | 0.6 | GO:0070936 | protein K48-linked ubiquitination(GO:0070936) |
0.0 | 0.1 | GO:0061152 | trachea submucosa development(GO:0061152) trachea gland development(GO:0061153) |
0.0 | 0.0 | GO:0009299 | mRNA transcription(GO:0009299) |
0.0 | 0.6 | GO:0071300 | cellular response to retinoic acid(GO:0071300) |
0.0 | 0.1 | GO:0045646 | regulation of erythrocyte differentiation(GO:0045646) |
0.0 | 0.1 | GO:0032466 | negative regulation of cytokinesis(GO:0032466) |
0.0 | 0.1 | GO:0045647 | negative regulation of erythrocyte differentiation(GO:0045647) |
0.0 | 0.1 | GO:0031077 | post-embryonic camera-type eye development(GO:0031077) |
0.0 | 0.3 | GO:0009081 | branched-chain amino acid metabolic process(GO:0009081) |
0.0 | 0.1 | GO:0001946 | lymphangiogenesis(GO:0001946) lymph vessel morphogenesis(GO:0036303) |
0.0 | 0.0 | GO:0034035 | purine ribonucleoside bisphosphate metabolic process(GO:0034035) |
0.0 | 0.5 | GO:0015693 | magnesium ion transport(GO:0015693) |
0.0 | 0.1 | GO:0035372 | protein localization to microtubule(GO:0035372) |
0.0 | 0.1 | GO:0072531 | pyrimidine-containing compound transmembrane transport(GO:0072531) nucleotide transmembrane transport(GO:1901679) |
0.0 | 0.1 | GO:0071895 | odontoblast differentiation(GO:0071895) |
0.0 | 1.4 | GO:0031338 | regulation of vesicle fusion(GO:0031338) |
0.0 | 0.1 | GO:0061635 | regulation of protein complex stability(GO:0061635) |
0.0 | 0.0 | GO:0060430 | lung saccule development(GO:0060430) |
0.0 | 1.0 | GO:1901343 | negative regulation of vasculature development(GO:1901343) |
0.0 | 0.1 | GO:1902895 | regulation of pri-miRNA transcription from RNA polymerase II promoter(GO:1902893) positive regulation of pri-miRNA transcription from RNA polymerase II promoter(GO:1902895) |
0.0 | 0.2 | GO:0001953 | negative regulation of cell-matrix adhesion(GO:0001953) |
0.0 | 0.5 | GO:0033539 | fatty acid beta-oxidation using acyl-CoA dehydrogenase(GO:0033539) |
0.0 | 0.2 | GO:0000469 | cleavage involved in rRNA processing(GO:0000469) |
0.0 | 0.3 | GO:1990001 | inhibition of cysteine-type endopeptidase activity(GO:0097340) zymogen inhibition(GO:0097341) inhibition of cysteine-type endopeptidase activity involved in apoptotic process(GO:1990001) |
0.0 | 0.2 | GO:0006030 | chitin metabolic process(GO:0006030) chitin catabolic process(GO:0006032) |
0.0 | 0.2 | GO:0071577 | zinc II ion transmembrane transport(GO:0071577) |
0.0 | 0.4 | GO:0098581 | detection of external biotic stimulus(GO:0098581) |
0.0 | 0.0 | GO:0045651 | positive regulation of macrophage differentiation(GO:0045651) |
0.0 | 0.0 | GO:0030836 | positive regulation of actin filament depolymerization(GO:0030836) |
0.0 | 0.1 | GO:0030916 | otic vesicle formation(GO:0030916) |
0.0 | 0.2 | GO:0006337 | nucleosome disassembly(GO:0006337) protein-DNA complex disassembly(GO:0032986) |
0.0 | 0.1 | GO:0002803 | positive regulation of antimicrobial peptide production(GO:0002225) positive regulation of antibacterial peptide production(GO:0002803) |
0.0 | 0.0 | GO:1901264 | carbohydrate derivative transport(GO:1901264) |
0.0 | 0.1 | GO:1900108 | negative regulation of nodal signaling pathway(GO:1900108) |
0.0 | 0.5 | GO:0045187 | regulation of circadian sleep/wake cycle, sleep(GO:0045187) |
0.0 | 0.1 | GO:0032570 | response to progesterone(GO:0032570) |
0.0 | 1.0 | GO:0001892 | embryonic placenta development(GO:0001892) |
0.0 | 0.1 | GO:0033628 | regulation of cell adhesion mediated by integrin(GO:0033628) |
0.0 | 0.1 | GO:0043328 | endosome transport via multivesicular body sorting pathway(GO:0032509) late endosome to vacuole transport via multivesicular body sorting pathway(GO:0032511) protein targeting to vacuole involved in ubiquitin-dependent protein catabolic process via the multivesicular body sorting pathway(GO:0043328) |
0.0 | 0.2 | GO:0006307 | DNA dealkylation involved in DNA repair(GO:0006307) |
0.0 | 0.1 | GO:0001302 | replicative cell aging(GO:0001302) |
0.0 | 0.0 | GO:0045869 | negative regulation of single stranded viral RNA replication via double stranded DNA intermediate(GO:0045869) |
0.0 | 0.1 | GO:0035927 | RNA import into mitochondrion(GO:0035927) rRNA import into mitochondrion(GO:0035928) |
0.0 | 0.2 | GO:0016226 | iron-sulfur cluster assembly(GO:0016226) metallo-sulfur cluster assembly(GO:0031163) |
0.0 | 0.0 | GO:0048865 | stem cell fate commitment(GO:0048865) |
0.0 | 0.0 | GO:1903725 | regulation of phospholipid metabolic process(GO:1903725) |
0.0 | 0.2 | GO:0021702 | cerebellar Purkinje cell differentiation(GO:0021702) |
0.0 | 0.2 | GO:0046415 | urate metabolic process(GO:0046415) |
0.0 | 0.1 | GO:0031442 | positive regulation of mRNA 3'-end processing(GO:0031442) |
0.0 | 0.0 | GO:1903299 | regulation of glucokinase activity(GO:0033131) regulation of hexokinase activity(GO:1903299) |
0.0 | 0.5 | GO:0017144 | drug metabolic process(GO:0017144) |
0.0 | 0.6 | GO:0015988 | energy coupled proton transmembrane transport, against electrochemical gradient(GO:0015988) ATP hydrolysis coupled proton transport(GO:0015991) ATP hydrolysis coupled transmembrane transport(GO:0090662) |
0.0 | 0.0 | GO:0010847 | regulation of chromatin assembly(GO:0010847) |
0.0 | 0.1 | GO:0006189 | 'de novo' IMP biosynthetic process(GO:0006189) |
0.0 | 0.2 | GO:0007210 | serotonin receptor signaling pathway(GO:0007210) |
0.0 | 0.3 | GO:0006614 | SRP-dependent cotranslational protein targeting to membrane(GO:0006614) |
0.0 | 0.0 | GO:0032286 | central nervous system myelin maintenance(GO:0032286) |
0.0 | 0.1 | GO:0048733 | sebaceous gland development(GO:0048733) |
0.0 | 0.0 | GO:2000515 | negative regulation of CD4-positive, alpha-beta T cell activation(GO:2000515) |
0.0 | 0.1 | GO:2000255 | negative regulation of male germ cell proliferation(GO:2000255) |
0.0 | 0.2 | GO:0010827 | regulation of glucose transport(GO:0010827) |
0.0 | 0.2 | GO:0014041 | regulation of neuron maturation(GO:0014041) |
0.0 | 0.0 | GO:0014900 | regulation of muscle hyperplasia(GO:0014738) muscle hyperplasia(GO:0014900) negative regulation of smooth muscle cell chemotaxis(GO:0071672) |
0.0 | 0.0 | GO:0007217 | tachykinin receptor signaling pathway(GO:0007217) |
0.0 | 0.0 | GO:0019065 | receptor-mediated endocytosis of virus by host cell(GO:0019065) endocytosis involved in viral entry into host cell(GO:0075509) |
0.0 | 0.1 | GO:0042640 | anagen(GO:0042640) |
0.0 | 0.1 | GO:0009396 | folic acid-containing compound biosynthetic process(GO:0009396) |
0.0 | 0.3 | GO:2000401 | regulation of lymphocyte migration(GO:2000401) |
0.0 | 0.1 | GO:0009130 | pyrimidine nucleoside monophosphate biosynthetic process(GO:0009130) |
0.0 | 0.1 | GO:2000010 | positive regulation of protein localization to cell surface(GO:2000010) |
0.0 | 0.1 | GO:0016561 | protein import into peroxisome matrix, translocation(GO:0016561) |
0.0 | 0.1 | GO:0030263 | apoptotic chromosome condensation(GO:0030263) |
0.0 | 0.0 | GO:0034384 | high-density lipoprotein particle clearance(GO:0034384) |
0.0 | 0.2 | GO:1904970 | brush border assembly(GO:1904970) |
0.0 | 0.3 | GO:0042990 | regulation of transcription factor import into nucleus(GO:0042990) |
0.0 | 0.1 | GO:0022417 | protein maturation by protein folding(GO:0022417) |
0.0 | 0.4 | GO:0034067 | protein localization to Golgi apparatus(GO:0034067) |
0.0 | 0.0 | GO:0034729 | histone H3-K79 methylation(GO:0034729) |
0.0 | 0.1 | GO:0000414 | regulation of histone H3-K36 methylation(GO:0000414) |
0.0 | 0.1 | GO:1901874 | regulation of post-translational protein modification(GO:1901873) negative regulation of post-translational protein modification(GO:1901874) |
0.0 | 0.0 | GO:0035622 | intrahepatic bile duct development(GO:0035622) |
0.0 | 0.0 | GO:1905154 | negative regulation of membrane invagination(GO:1905154) |
0.0 | 0.0 | GO:0009826 | unidimensional cell growth(GO:0009826) |
0.0 | 0.0 | GO:0003415 | chondrocyte hypertrophy(GO:0003415) |
0.0 | 0.0 | GO:0045085 | negative regulation of interleukin-2 biosynthetic process(GO:0045085) |
0.0 | 0.0 | GO:0035493 | SNARE complex assembly(GO:0035493) |
0.0 | 0.0 | GO:0045064 | T-helper 2 cell differentiation(GO:0045064) |
0.0 | 0.0 | GO:0002584 | negative regulation of antigen processing and presentation of peptide antigen(GO:0002584) |
0.0 | 0.0 | GO:0048254 | snoRNA localization(GO:0048254) |
0.0 | 0.4 | GO:0045737 | positive regulation of cyclin-dependent protein serine/threonine kinase activity(GO:0045737) |
0.0 | 0.1 | GO:0019371 | cyclooxygenase pathway(GO:0019371) |
0.0 | 0.1 | GO:0010586 | miRNA metabolic process(GO:0010586) |
0.0 | 0.1 | GO:0006528 | asparagine metabolic process(GO:0006528) |
0.0 | 0.0 | GO:0042161 | lipoprotein modification(GO:0042160) lipoprotein oxidation(GO:0042161) |
0.0 | 0.1 | GO:2000474 | regulation of opioid receptor signaling pathway(GO:2000474) |
0.0 | 0.1 | GO:0090315 | negative regulation of protein targeting to membrane(GO:0090315) |
0.0 | 0.2 | GO:0097369 | sodium ion import(GO:0097369) |
0.0 | 0.4 | GO:0006883 | cellular sodium ion homeostasis(GO:0006883) |
0.0 | 0.1 | GO:2000672 | negative regulation of motor neuron apoptotic process(GO:2000672) |
0.0 | 0.3 | GO:0023058 | desensitization of G-protein coupled receptor protein signaling pathway(GO:0002029) negative adaptation of signaling pathway(GO:0022401) adaptation of signaling pathway(GO:0023058) |
0.0 | 0.0 | GO:0001844 | protein insertion into mitochondrial membrane involved in apoptotic signaling pathway(GO:0001844) |
0.0 | 0.1 | GO:0035093 | spermatogenesis, exchange of chromosomal proteins(GO:0035093) |
0.0 | 0.5 | GO:0050829 | defense response to Gram-negative bacterium(GO:0050829) |
0.0 | 0.4 | GO:0070373 | negative regulation of ERK1 and ERK2 cascade(GO:0070373) |
0.0 | 0.4 | GO:0030488 | tRNA methylation(GO:0030488) |
0.0 | 0.1 | GO:0051127 | positive regulation of actin nucleation(GO:0051127) |
0.0 | 0.7 | GO:0031532 | actin cytoskeleton reorganization(GO:0031532) |
0.0 | 0.3 | GO:0032786 | positive regulation of DNA-templated transcription, elongation(GO:0032786) |
0.0 | 0.1 | GO:0033240 | positive regulation of cellular amine metabolic process(GO:0033240) |
0.0 | 0.2 | GO:0006390 | transcription from mitochondrial promoter(GO:0006390) |
0.0 | 0.5 | GO:0050891 | multicellular organismal water homeostasis(GO:0050891) |
0.0 | 0.1 | GO:0060216 | definitive hemopoiesis(GO:0060216) |
0.0 | 0.1 | GO:0010566 | regulation of ketone biosynthetic process(GO:0010566) |
0.0 | 0.0 | GO:0033275 | actin-myosin filament sliding(GO:0033275) |
0.0 | 0.1 | GO:0043586 | tongue development(GO:0043586) |
0.0 | 0.1 | GO:0043162 | ubiquitin-dependent protein catabolic process via the multivesicular body sorting pathway(GO:0043162) |
0.0 | 0.2 | GO:0016127 | cholesterol catabolic process(GO:0006707) sterol catabolic process(GO:0016127) |
0.0 | 0.1 | GO:0033262 | regulation of nuclear cell cycle DNA replication(GO:0033262) |
0.0 | 0.2 | GO:0034723 | DNA replication-dependent nucleosome assembly(GO:0006335) DNA replication-dependent nucleosome organization(GO:0034723) |
0.0 | 0.1 | GO:0035970 | peptidyl-threonine dephosphorylation(GO:0035970) |
0.0 | 0.0 | GO:0008594 | photoreceptor cell morphogenesis(GO:0008594) |
0.0 | 0.1 | GO:0097011 | cellular response to granulocyte macrophage colony-stimulating factor stimulus(GO:0097011) |
0.0 | 0.1 | GO:0060467 | negative regulation of fertilization(GO:0060467) prevention of polyspermy(GO:0060468) |
0.0 | 0.2 | GO:0031274 | pseudopodium assembly(GO:0031269) positive regulation of pseudopodium assembly(GO:0031274) |
0.0 | 0.1 | GO:0035247 | peptidyl-arginine omega-N-methylation(GO:0035247) |
0.0 | 0.1 | GO:0061684 | chaperone-mediated autophagy(GO:0061684) |
0.0 | 0.0 | GO:0051610 | serotonin uptake(GO:0051610) |
0.0 | 0.2 | GO:0006561 | proline biosynthetic process(GO:0006561) |
0.0 | 0.0 | GO:0090309 | positive regulation of methylation-dependent chromatin silencing(GO:0090309) |
0.0 | 0.1 | GO:0032020 | ISG15-protein conjugation(GO:0032020) |
0.0 | 0.0 | GO:2000354 | regulation of ovarian follicle development(GO:2000354) |
0.0 | 1.5 | GO:0032434 | regulation of proteasomal ubiquitin-dependent protein catabolic process(GO:0032434) |
0.0 | 0.2 | GO:0044117 | growth involved in symbiotic interaction(GO:0044110) growth of symbiont involved in interaction with host(GO:0044116) growth of symbiont in host(GO:0044117) |
0.0 | 0.1 | GO:0006706 | steroid catabolic process(GO:0006706) |
0.0 | 0.0 | GO:0043379 | memory T cell differentiation(GO:0043379) |
0.0 | 0.0 | GO:0075136 | response to defenses of other organism involved in symbiotic interaction(GO:0052173) response to host defenses(GO:0052200) response to host(GO:0075136) |
0.0 | 0.1 | GO:0014807 | regulation of somitogenesis(GO:0014807) |
0.0 | 0.1 | GO:0061050 | regulation of cell growth involved in cardiac muscle cell development(GO:0061050) |
0.0 | 0.0 | GO:0051025 | negative regulation of immunoglobulin secretion(GO:0051025) |
0.0 | 0.1 | GO:0039536 | negative regulation of RIG-I signaling pathway(GO:0039536) |
0.0 | 0.1 | GO:0045792 | negative regulation of cell size(GO:0045792) |
0.0 | 0.2 | GO:0006879 | cellular iron ion homeostasis(GO:0006879) |
0.0 | 0.3 | GO:0006826 | iron ion transport(GO:0006826) |
0.0 | 0.1 | GO:0050861 | positive regulation of B cell receptor signaling pathway(GO:0050861) |
0.0 | 0.1 | GO:0051560 | mitochondrial calcium ion homeostasis(GO:0051560) |
0.0 | 0.0 | GO:0042590 | antigen processing and presentation of exogenous peptide antigen via MHC class I(GO:0042590) |
0.0 | 0.1 | GO:0000050 | urea cycle(GO:0000050) |
0.0 | 0.1 | GO:1901162 | serotonin biosynthetic process(GO:0042427) primary amino compound biosynthetic process(GO:1901162) |
0.0 | 0.5 | GO:0043303 | mast cell activation involved in immune response(GO:0002279) mast cell mediated immunity(GO:0002448) mast cell degranulation(GO:0043303) |
0.0 | 0.0 | GO:1902807 | negative regulation of cell cycle G1/S phase transition(GO:1902807) |
0.0 | 0.7 | GO:0031424 | keratinization(GO:0031424) |
0.0 | 2.4 | GO:0042742 | defense response to bacterium(GO:0042742) |
0.0 | 0.1 | GO:0043097 | pyrimidine-containing compound salvage(GO:0008655) pyrimidine nucleoside salvage(GO:0043097) |
0.0 | 0.0 | GO:0002669 | positive regulation of T cell anergy(GO:0002669) positive regulation of lymphocyte anergy(GO:0002913) |
0.0 | 0.1 | GO:0045835 | negative regulation of meiotic nuclear division(GO:0045835) |
0.0 | 0.0 | GO:0040031 | snRNA modification(GO:0040031) |
0.0 | 0.5 | GO:0046839 | phospholipid dephosphorylation(GO:0046839) |
0.0 | 0.2 | GO:0034394 | protein localization to cell surface(GO:0034394) |
0.0 | 0.4 | GO:0030433 | ER-associated ubiquitin-dependent protein catabolic process(GO:0030433) |
0.0 | 0.0 | GO:0010544 | negative regulation of platelet activation(GO:0010544) |
0.0 | 0.1 | GO:0042921 | glucocorticoid receptor signaling pathway(GO:0042921) |
0.0 | 0.2 | GO:0002418 | immune response to tumor cell(GO:0002418) |
0.0 | 0.3 | GO:0016973 | poly(A)+ mRNA export from nucleus(GO:0016973) |
0.0 | 0.4 | GO:0006081 | cellular aldehyde metabolic process(GO:0006081) |
0.0 | 0.1 | GO:0045065 | cytotoxic T cell differentiation(GO:0045065) |
0.0 | 0.1 | GO:0000466 | maturation of 5.8S rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000466) |
0.0 | 0.0 | GO:0015755 | fructose transport(GO:0015755) |
0.0 | 0.1 | GO:1902187 | negative regulation of viral release from host cell(GO:1902187) |
0.0 | 0.1 | GO:0070940 | dephosphorylation of RNA polymerase II C-terminal domain(GO:0070940) |
0.0 | 0.1 | GO:0042492 | gamma-delta T cell differentiation(GO:0042492) |
0.0 | 0.0 | GO:0006532 | aspartate biosynthetic process(GO:0006532) |
0.0 | 0.1 | GO:0035767 | endothelial cell chemotaxis(GO:0035767) |
0.0 | 0.0 | GO:2000359 | regulation of binding of sperm to zona pellucida(GO:2000359) |
0.0 | 0.1 | GO:0071392 | cellular response to estradiol stimulus(GO:0071392) |
0.0 | 0.4 | GO:0003009 | skeletal muscle contraction(GO:0003009) |
0.0 | 0.1 | GO:0060252 | positive regulation of glial cell proliferation(GO:0060252) |
0.0 | 0.0 | GO:0042759 | long-chain fatty acid biosynthetic process(GO:0042759) |
0.0 | 0.1 | GO:0000380 | alternative mRNA splicing, via spliceosome(GO:0000380) |
0.0 | 0.1 | GO:0001866 | NK T cell proliferation(GO:0001866) |
0.0 | 0.1 | GO:0031167 | rRNA methylation(GO:0031167) |
0.0 | 0.1 | GO:1990126 | retrograde transport, endosome to plasma membrane(GO:1990126) |
0.0 | 0.1 | GO:0046909 | intermembrane transport(GO:0046909) |
0.0 | 0.1 | GO:0003158 | endothelium development(GO:0003158) |
0.0 | 0.1 | GO:0010812 | negative regulation of cell-substrate adhesion(GO:0010812) |
0.0 | 0.0 | GO:0036344 | platelet morphogenesis(GO:0036344) |
0.0 | 0.1 | GO:0099515 | actin filament-based transport(GO:0099515) |
0.0 | 0.4 | GO:0006301 | postreplication repair(GO:0006301) |
0.0 | 0.0 | GO:0061113 | pancreas morphogenesis(GO:0061113) |
0.0 | 0.0 | GO:0048339 | paraxial mesoderm development(GO:0048339) |
0.0 | 0.1 | GO:0042026 | protein refolding(GO:0042026) |
0.0 | 0.0 | GO:0030730 | sequestering of triglyceride(GO:0030730) |
0.0 | 0.1 | GO:0031053 | primary miRNA processing(GO:0031053) |
0.0 | 0.0 | GO:0015791 | polyol transport(GO:0015791) |
0.0 | 0.0 | GO:0072210 | metanephric nephron development(GO:0072210) |
0.0 | 0.5 | GO:0007566 | embryo implantation(GO:0007566) |
0.0 | 0.2 | GO:0000132 | establishment of mitotic spindle orientation(GO:0000132) |
0.0 | 0.0 | GO:0045852 | pH elevation(GO:0045852) intracellular pH elevation(GO:0051454) |
0.0 | 0.0 | GO:0009129 | pyrimidine nucleoside monophosphate metabolic process(GO:0009129) pyrimidine deoxyribonucleoside monophosphate metabolic process(GO:0009176) |
0.0 | 0.0 | GO:1904995 | negative regulation of leukocyte tethering or rolling(GO:1903237) negative regulation of leukocyte adhesion to vascular endothelial cell(GO:1904995) |
0.0 | 0.0 | GO:1904751 | regulation of protein localization to nucleolus(GO:1904749) positive regulation of protein localization to nucleolus(GO:1904751) |
0.0 | 0.1 | GO:0001842 | neural fold formation(GO:0001842) |
0.0 | 0.1 | GO:0099625 | regulation of ventricular cardiac muscle cell membrane repolarization(GO:0060307) ventricular cardiac muscle cell membrane repolarization(GO:0099625) |
0.0 | 0.1 | GO:0042572 | retinol metabolic process(GO:0042572) |
0.0 | 0.1 | GO:0015888 | thiamine transport(GO:0015888) |
0.0 | 0.0 | GO:0006538 | glutamate catabolic process(GO:0006538) |
0.0 | 0.1 | GO:0006048 | UDP-N-acetylglucosamine biosynthetic process(GO:0006048) |
0.0 | 0.2 | GO:0031639 | plasminogen activation(GO:0031639) |
0.0 | 0.0 | GO:0090160 | positive regulation of pinocytosis(GO:0048549) Golgi to lysosome transport(GO:0090160) |
0.0 | 0.7 | GO:0002323 | natural killer cell activation involved in immune response(GO:0002323) |
0.0 | 0.1 | GO:0046116 | queuosine biosynthetic process(GO:0008616) queuosine metabolic process(GO:0046116) |
0.0 | 0.0 | GO:0019676 | ammonia assimilation cycle(GO:0019676) |
0.0 | 0.1 | GO:0043649 | dicarboxylic acid catabolic process(GO:0043649) |
0.0 | 0.0 | GO:0009649 | entrainment of circadian clock(GO:0009649) |
0.0 | 0.1 | GO:0006833 | water transport(GO:0006833) |
0.0 | 0.0 | GO:0060586 | multicellular organismal iron ion homeostasis(GO:0060586) |
0.0 | 0.0 | GO:0060061 | Spemann organizer formation(GO:0060061) limb bud formation(GO:0060174) |
0.0 | 0.2 | GO:0008299 | isoprenoid biosynthetic process(GO:0008299) |
0.0 | 0.4 | GO:0010507 | negative regulation of autophagy(GO:0010507) |
0.0 | 0.1 | GO:0018904 | ether metabolic process(GO:0018904) |
0.0 | 0.0 | GO:0060060 | post-embryonic retina morphogenesis in camera-type eye(GO:0060060) |
0.0 | 0.1 | GO:0006907 | pinocytosis(GO:0006907) |
0.0 | 0.1 | GO:0051971 | positive regulation of transmission of nerve impulse(GO:0051971) |
0.0 | 0.1 | GO:1990440 | positive regulation of transcription from RNA polymerase II promoter in response to endoplasmic reticulum stress(GO:1990440) |
0.0 | 0.2 | GO:0034340 | response to type I interferon(GO:0034340) |
0.0 | 0.1 | GO:0060024 | rhythmic synaptic transmission(GO:0060024) |
0.0 | 0.1 | GO:0001696 | gastric acid secretion(GO:0001696) |
0.0 | 0.1 | GO:0010224 | response to UV-B(GO:0010224) |
0.0 | 0.0 | GO:0090190 | positive regulation of branching involved in ureteric bud morphogenesis(GO:0090190) |
0.0 | 0.1 | GO:1904262 | negative regulation of TORC1 signaling(GO:1904262) |
0.0 | 0.2 | GO:0006730 | one-carbon metabolic process(GO:0006730) |
0.0 | 0.0 | GO:0046813 | receptor-mediated virion attachment to host cell(GO:0046813) |
0.0 | 0.1 | GO:0006621 | protein retention in ER lumen(GO:0006621) |
0.0 | 0.0 | GO:0060825 | fibroblast growth factor receptor signaling pathway involved in neural plate anterior/posterior pattern formation(GO:0060825) regulation of fibroblast growth factor receptor signaling pathway involved in neural plate anterior/posterior pattern formation(GO:2000313) |
0.0 | 0.1 | GO:0016446 | somatic hypermutation of immunoglobulin genes(GO:0016446) |
0.0 | 0.0 | GO:0071930 | negative regulation of transcription involved in G1/S transition of mitotic cell cycle(GO:0071930) |
0.0 | 0.0 | GO:0038003 | opioid receptor signaling pathway(GO:0038003) |
0.0 | 0.0 | GO:0009188 | ribonucleoside diphosphate biosynthetic process(GO:0009188) |
0.0 | 0.0 | GO:0090383 | phagosome acidification(GO:0090383) |
0.0 | 0.1 | GO:0070341 | fat cell proliferation(GO:0070341) regulation of fat cell proliferation(GO:0070344) |
0.0 | 0.0 | GO:0007161 | calcium-independent cell-matrix adhesion(GO:0007161) |
0.0 | 0.1 | GO:0001927 | exocyst assembly(GO:0001927) |
0.0 | 0.1 | GO:0006896 | Golgi to vacuole transport(GO:0006896) |
0.0 | 0.1 | GO:0015870 | acetylcholine transport(GO:0015870) acetate ester transport(GO:1901374) |
0.0 | 0.1 | GO:0014002 | astrocyte development(GO:0014002) |
0.0 | 0.0 | GO:0018119 | protein nitrosylation(GO:0017014) peptidyl-cysteine S-nitrosylation(GO:0018119) |
0.0 | 0.0 | GO:0006407 | rRNA export from nucleus(GO:0006407) |
0.0 | 0.1 | GO:0044597 | polyketide metabolic process(GO:0030638) aminoglycoside antibiotic metabolic process(GO:0030647) daunorubicin metabolic process(GO:0044597) doxorubicin metabolic process(GO:0044598) |
0.0 | 0.1 | GO:2000973 | regulation of pro-B cell differentiation(GO:2000973) |
0.0 | 0.1 | GO:0018401 | peptidyl-proline hydroxylation to 4-hydroxy-L-proline(GO:0018401) |
0.0 | 0.0 | GO:0002679 | respiratory burst involved in defense response(GO:0002679) |
0.0 | 0.0 | GO:0048255 | mRNA stabilization(GO:0048255) |
0.0 | 0.0 | GO:0039694 | viral RNA genome replication(GO:0039694) RNA replication(GO:0039703) |
0.0 | 0.1 | GO:1902683 | regulation of receptor localization to synapse(GO:1902683) |
0.0 | 0.0 | GO:0010596 | negative regulation of endothelial cell migration(GO:0010596) |
0.0 | 0.0 | GO:0042423 | catechol-containing compound biosynthetic process(GO:0009713) catecholamine biosynthetic process(GO:0042423) |
0.0 | 0.1 | GO:0006026 | aminoglycan catabolic process(GO:0006026) glycosaminoglycan catabolic process(GO:0006027) |
0.0 | 0.1 | GO:0006776 | vitamin A metabolic process(GO:0006776) |
0.0 | 0.0 | GO:1901798 | positive regulation of signal transduction by p53 class mediator(GO:1901798) |
0.0 | 0.0 | GO:1903862 | positive regulation of oxidative phosphorylation(GO:1903862) |
0.0 | 0.0 | GO:0007406 | negative regulation of neuroblast proliferation(GO:0007406) |
0.0 | 0.1 | GO:0002820 | negative regulation of adaptive immune response(GO:0002820) |
0.0 | 0.1 | GO:0032308 | positive regulation of prostaglandin secretion(GO:0032308) |
0.0 | 0.3 | GO:0031365 | N-terminal protein amino acid modification(GO:0031365) |
0.0 | 0.0 | GO:0006577 | amino-acid betaine metabolic process(GO:0006577) |
0.0 | 0.0 | GO:0031665 | negative regulation of lipopolysaccharide-mediated signaling pathway(GO:0031665) |
0.0 | 0.1 | GO:0006020 | inositol metabolic process(GO:0006020) |
0.0 | 0.1 | GO:0042473 | outer ear morphogenesis(GO:0042473) |
0.0 | 0.0 | GO:0097205 | renal filtration(GO:0097205) |
0.0 | 0.3 | GO:0019835 | cytolysis(GO:0019835) |
0.0 | 0.1 | GO:0006420 | arginyl-tRNA aminoacylation(GO:0006420) |
0.0 | 0.1 | GO:0043550 | regulation of lipid kinase activity(GO:0043550) |
0.0 | 0.2 | GO:0071880 | adenylate cyclase-activating adrenergic receptor signaling pathway(GO:0071880) |
0.0 | 0.0 | GO:0050849 | negative regulation of calcium-mediated signaling(GO:0050849) |
0.0 | 0.4 | GO:0032465 | regulation of cytokinesis(GO:0032465) |
0.0 | 0.3 | GO:0072348 | sulfur compound transport(GO:0072348) |
0.0 | 0.1 | GO:0006862 | nucleotide transport(GO:0006862) |
0.0 | 0.0 | GO:1902445 | regulation of mitochondrial membrane permeability involved in programmed necrotic cell death(GO:1902445) |
0.0 | 0.0 | GO:0007181 | transforming growth factor beta receptor complex assembly(GO:0007181) |
0.0 | 0.2 | GO:0009409 | response to cold(GO:0009409) |
0.0 | 0.3 | GO:0032008 | positive regulation of TOR signaling(GO:0032008) |
0.0 | 0.0 | GO:0034982 | mitochondrial protein processing(GO:0034982) |
0.0 | 0.0 | GO:0046831 | regulation of nucleobase-containing compound transport(GO:0032239) regulation of RNA export from nucleus(GO:0046831) |
0.0 | 0.1 | GO:0033299 | secretion of lysosomal enzymes(GO:0033299) |
0.0 | 0.0 | GO:0045112 | integrin biosynthetic process(GO:0045112) |
0.0 | 0.1 | GO:0043982 | histone H4-K5 acetylation(GO:0043981) histone H4-K8 acetylation(GO:0043982) |
0.0 | 0.0 | GO:2000252 | negative regulation of feeding behavior(GO:2000252) |
0.0 | 0.0 | GO:0090027 | negative regulation of monocyte chemotaxis(GO:0090027) |
0.0 | 0.0 | GO:0030007 | cellular potassium ion homeostasis(GO:0030007) |
0.0 | 0.0 | GO:0002097 | tRNA wobble base modification(GO:0002097) |
0.0 | 0.0 | GO:0002036 | regulation of L-glutamate transport(GO:0002036) |
0.0 | 0.2 | GO:0071108 | protein K48-linked deubiquitination(GO:0071108) |
0.0 | 0.0 | GO:1902956 | regulation of mitochondrial electron transport, NADH to ubiquinone(GO:1902956) |
0.0 | 0.2 | GO:0015936 | coenzyme A metabolic process(GO:0015936) |
0.0 | 1.2 | GO:0030198 | extracellular matrix organization(GO:0030198) |
0.0 | 0.1 | GO:0071711 | basement membrane organization(GO:0071711) |
0.0 | 0.1 | GO:0010529 | regulation of transposition(GO:0010528) negative regulation of transposition(GO:0010529) |
0.0 | 0.0 | GO:0071442 | positive regulation of histone H3-K14 acetylation(GO:0071442) |
0.0 | 0.1 | GO:0043486 | histone exchange(GO:0043486) |
0.0 | 0.1 | GO:0042744 | hydrogen peroxide catabolic process(GO:0042744) |
0.0 | 0.0 | GO:0002121 | inter-male aggressive behavior(GO:0002121) |
0.0 | 0.1 | GO:0036065 | fucosylation(GO:0036065) |
0.0 | 0.1 | GO:0009249 | protein lipoylation(GO:0009249) |
0.0 | 0.0 | GO:0006545 | glycine biosynthetic process(GO:0006545) |
0.0 | 0.0 | GO:0001829 | trophectodermal cell differentiation(GO:0001829) |
0.0 | 0.0 | GO:0015697 | quaternary ammonium group transport(GO:0015697) |
0.0 | 0.0 | GO:2000271 | positive regulation of fibroblast apoptotic process(GO:2000271) |
0.0 | 0.1 | GO:0070830 | bicellular tight junction assembly(GO:0070830) |
0.0 | 0.1 | GO:0006613 | cotranslational protein targeting to membrane(GO:0006613) |
0.0 | 0.1 | GO:0030206 | chondroitin sulfate biosynthetic process(GO:0030206) |
0.0 | 0.1 | GO:0032754 | positive regulation of interleukin-5 production(GO:0032754) |
0.0 | 0.1 | GO:0060009 | Sertoli cell development(GO:0060009) |
0.0 | 0.1 | GO:0051482 | positive regulation of cytosolic calcium ion concentration involved in phospholipase C-activating G-protein coupled signaling pathway(GO:0051482) |
0.0 | 0.0 | GO:0090520 | sphingolipid mediated signaling pathway(GO:0090520) |
0.0 | 0.1 | GO:0006458 | 'de novo' protein folding(GO:0006458) 'de novo' posttranslational protein folding(GO:0051084) |
0.0 | 0.1 | GO:0033280 | response to vitamin D(GO:0033280) |
0.0 | 0.0 | GO:0031284 | positive regulation of guanylate cyclase activity(GO:0031284) |
0.0 | 0.2 | GO:0007616 | long-term memory(GO:0007616) |
0.0 | 0.0 | GO:0043415 | positive regulation of skeletal muscle tissue regeneration(GO:0043415) |
0.0 | 0.1 | GO:0000338 | protein deneddylation(GO:0000338) cullin deneddylation(GO:0010388) |
0.0 | 0.1 | GO:0034389 | lipid particle organization(GO:0034389) |
0.0 | 0.0 | GO:0030656 | regulation of vitamin metabolic process(GO:0030656) |
0.0 | 0.0 | GO:0048875 | chemical homeostasis within a tissue(GO:0048875) |
0.0 | 0.1 | GO:0033617 | mitochondrial respiratory chain complex IV assembly(GO:0033617) mitochondrial respiratory chain complex IV biogenesis(GO:0097034) |
0.0 | 0.0 | GO:0000395 | mRNA 5'-splice site recognition(GO:0000395) |
0.0 | 0.0 | GO:0030579 | ubiquitin-dependent SMAD protein catabolic process(GO:0030579) |
0.0 | 0.1 | GO:0033687 | osteoblast proliferation(GO:0033687) |
0.0 | 0.0 | GO:0045830 | positive regulation of isotype switching(GO:0045830) |
0.0 | 0.0 | GO:1903265 | positive regulation of tumor necrosis factor-mediated signaling pathway(GO:1903265) |
0.0 | 0.0 | GO:0035751 | regulation of lysosomal lumen pH(GO:0035751) |
0.0 | 0.1 | GO:0034332 | adherens junction organization(GO:0034332) |
0.0 | 0.0 | GO:0009946 | proximal/distal axis specification(GO:0009946) specification of axis polarity(GO:0065001) |
0.0 | 0.0 | GO:1903679 | regulation of cap-independent translational initiation(GO:1903677) positive regulation of cap-independent translational initiation(GO:1903679) regulation of cytoplasmic translational initiation(GO:1904688) positive regulation of cytoplasmic translational initiation(GO:1904690) |
0.0 | 0.0 | GO:0036123 | histone H3-K9 dimethylation(GO:0036123) |
0.0 | 0.0 | GO:0042095 | interferon-gamma biosynthetic process(GO:0042095) |
0.0 | 0.0 | GO:0021523 | somatic motor neuron differentiation(GO:0021523) |
0.0 | 0.1 | GO:0003323 | type B pancreatic cell development(GO:0003323) |
0.0 | 0.0 | GO:0001954 | positive regulation of cell-matrix adhesion(GO:0001954) |
0.0 | 0.0 | GO:0032098 | regulation of appetite(GO:0032098) |
0.0 | 0.0 | GO:1903205 | regulation of hydrogen peroxide-induced cell death(GO:1903205) |
0.0 | 0.8 | GO:0051321 | meiotic cell cycle(GO:0051321) |
0.0 | 0.0 | GO:0009445 | putrescine metabolic process(GO:0009445) |
0.0 | 0.3 | GO:0070206 | protein trimerization(GO:0070206) |
0.0 | 0.1 | GO:0043467 | regulation of generation of precursor metabolites and energy(GO:0043467) |
0.0 | 0.1 | GO:0060736 | prostate gland growth(GO:0060736) |
0.0 | 0.0 | GO:0044036 | cell wall macromolecule metabolic process(GO:0044036) cell wall organization or biogenesis(GO:0071554) |
0.0 | 0.0 | GO:0042532 | negative regulation of tyrosine phosphorylation of STAT protein(GO:0042532) |
0.0 | 0.1 | GO:0003334 | keratinocyte development(GO:0003334) |
0.0 | 0.0 | GO:0038092 | nodal signaling pathway(GO:0038092) |
0.0 | 0.0 | GO:0043117 | positive regulation of vascular permeability(GO:0043117) |
0.0 | 0.0 | GO:0033326 | cerebrospinal fluid secretion(GO:0033326) |
0.0 | 0.0 | GO:1903670 | regulation of sprouting angiogenesis(GO:1903670) |
0.0 | 0.0 | GO:1905098 | negative regulation of guanyl-nucleotide exchange factor activity(GO:1905098) |
0.0 | 0.0 | GO:0045953 | negative regulation of natural killer cell mediated cytotoxicity(GO:0045953) |
0.0 | 0.0 | GO:0030948 | negative regulation of vascular endothelial growth factor receptor signaling pathway(GO:0030948) |
0.0 | 0.0 | GO:0019372 | lipoxygenase pathway(GO:0019372) |
0.0 | 0.0 | GO:1902915 | negative regulation of protein K63-linked ubiquitination(GO:1900045) negative regulation of protein polyubiquitination(GO:1902915) |
0.0 | 0.0 | GO:0002017 | regulation of blood volume by renal aldosterone(GO:0002017) |
0.0 | 0.0 | GO:2000834 | androgen secretion(GO:0035935) regulation of androgen secretion(GO:2000834) positive regulation of androgen secretion(GO:2000836) |
0.0 | 0.0 | GO:0048227 | plasma membrane to endosome transport(GO:0048227) |
0.0 | 0.0 | GO:0002634 | regulation of germinal center formation(GO:0002634) |
0.0 | 0.0 | GO:0016584 | nucleosome positioning(GO:0016584) |
0.0 | 0.0 | GO:0071462 | cellular response to water stimulus(GO:0071462) |
0.0 | 0.0 | GO:0048368 | lateral mesoderm development(GO:0048368) |
0.0 | 0.0 | GO:1903261 | regulation of serine phosphorylation of STAT3 protein(GO:1903261) |
0.0 | 0.1 | GO:0006509 | membrane protein ectodomain proteolysis(GO:0006509) |
0.0 | 0.1 | GO:0046329 | negative regulation of JNK cascade(GO:0046329) |
0.0 | 0.2 | GO:0048144 | fibroblast proliferation(GO:0048144) |
0.0 | 0.1 | GO:0032515 | negative regulation of phosphoprotein phosphatase activity(GO:0032515) |
0.0 | 0.0 | GO:0045063 | T-helper 1 cell differentiation(GO:0045063) |
0.0 | 0.2 | GO:0032233 | positive regulation of actin filament bundle assembly(GO:0032233) |
0.0 | 0.0 | GO:0060314 | regulation of ryanodine-sensitive calcium-release channel activity(GO:0060314) |
0.0 | 0.2 | GO:0030970 | retrograde protein transport, ER to cytosol(GO:0030970) |
0.0 | 0.0 | GO:0016137 | glycoside metabolic process(GO:0016137) |
0.0 | 0.1 | GO:0000301 | retrograde transport, vesicle recycling within Golgi(GO:0000301) |
0.0 | 0.0 | GO:0002827 | positive regulation of T-helper 1 type immune response(GO:0002827) |
0.0 | 0.1 | GO:0042159 | protein depalmitoylation(GO:0002084) lipoprotein catabolic process(GO:0042159) macromolecule depalmitoylation(GO:0098734) |
0.0 | 0.0 | GO:0071985 | multivesicular body sorting pathway(GO:0071985) |
0.0 | 0.1 | GO:0032784 | regulation of DNA-templated transcription, elongation(GO:0032784) |
0.0 | 0.0 | GO:0039702 | viral budding via host ESCRT complex(GO:0039702) |
0.0 | 0.0 | GO:0010613 | positive regulation of cardiac muscle hypertrophy(GO:0010613) positive regulation of muscle hypertrophy(GO:0014742) |
0.0 | 0.3 | GO:0006986 | response to unfolded protein(GO:0006986) |
0.0 | 0.1 | GO:0030866 | cortical actin cytoskeleton organization(GO:0030866) |
0.0 | 0.3 | GO:0000910 | cytokinesis(GO:0000910) |
0.0 | 0.0 | GO:0046596 | regulation of viral entry into host cell(GO:0046596) |
0.0 | 0.0 | GO:0019370 | leukotriene biosynthetic process(GO:0019370) |
0.0 | 0.0 | GO:0042637 | catagen(GO:0042637) |
0.0 | 0.2 | GO:0060218 | hematopoietic stem cell differentiation(GO:0060218) |
0.0 | 0.0 | GO:0071107 | response to parathyroid hormone(GO:0071107) |
0.0 | 0.0 | GO:0007262 | STAT protein import into nucleus(GO:0007262) |
0.0 | 0.2 | GO:0098876 | vesicle-mediated transport to the plasma membrane(GO:0098876) |
0.0 | 0.0 | GO:0008063 | Toll signaling pathway(GO:0008063) |
0.0 | 0.0 | GO:0045061 | thymic T cell selection(GO:0045061) |
0.0 | 0.1 | GO:0032119 | sequestering of zinc ion(GO:0032119) regulation of sequestering of zinc ion(GO:0061088) |
0.0 | 0.2 | GO:0003333 | amino acid transmembrane transport(GO:0003333) |
0.0 | 0.3 | GO:0002474 | antigen processing and presentation of peptide antigen via MHC class I(GO:0002474) |
0.0 | 0.0 | GO:0033029 | regulation of neutrophil apoptotic process(GO:0033029) |
0.0 | 0.0 | GO:0051549 | regulation of keratinocyte migration(GO:0051547) positive regulation of keratinocyte migration(GO:0051549) |
0.0 | 0.0 | GO:0090184 | positive regulation of kidney development(GO:0090184) |
0.0 | 0.1 | GO:0072676 | lymphocyte migration(GO:0072676) |
0.0 | 0.1 | GO:0035873 | lactate transport(GO:0015727) lactate transmembrane transport(GO:0035873) plasma membrane lactate transport(GO:0035879) |
0.0 | 0.1 | GO:0090286 | cytoskeletal anchoring at nuclear membrane(GO:0090286) |
0.0 | 0.0 | GO:1904181 | positive regulation of membrane depolarization(GO:1904181) |
0.0 | 0.0 | GO:0010830 | regulation of myotube differentiation(GO:0010830) |
0.0 | 0.0 | GO:0006448 | regulation of translational elongation(GO:0006448) regulation of translational fidelity(GO:0006450) |
0.0 | 0.0 | GO:2001138 | regulation of phospholipid transport(GO:2001138) positive regulation of phospholipid transport(GO:2001140) |
0.0 | 0.2 | GO:0031146 | SCF-dependent proteasomal ubiquitin-dependent protein catabolic process(GO:0031146) |
0.0 | 0.0 | GO:0010452 | histone H3-K36 methylation(GO:0010452) |
0.0 | 0.2 | GO:0006306 | DNA alkylation(GO:0006305) DNA methylation(GO:0006306) |
0.0 | 0.1 | GO:0071480 | cellular response to gamma radiation(GO:0071480) |
0.0 | 0.0 | GO:2000765 | regulation of cytoplasmic translation(GO:2000765) |
0.0 | 0.0 | GO:0032789 | saturated monocarboxylic acid metabolic process(GO:0032788) unsaturated monocarboxylic acid metabolic process(GO:0032789) |
0.0 | 0.0 | GO:0042755 | eating behavior(GO:0042755) |
0.0 | 0.0 | GO:0070973 | protein localization to endoplasmic reticulum exit site(GO:0070973) |
0.0 | 0.1 | GO:0045010 | actin nucleation(GO:0045010) |
0.0 | 0.0 | GO:0032460 | negative regulation of protein oligomerization(GO:0032460) |
0.0 | 0.0 | GO:0002091 | negative regulation of receptor internalization(GO:0002091) |
0.0 | 0.0 | GO:0035791 | platelet-derived growth factor receptor-beta signaling pathway(GO:0035791) |
0.0 | 0.0 | GO:0071599 | otic vesicle development(GO:0071599) |
0.0 | 0.1 | GO:0070525 | tRNA threonylcarbamoyladenosine metabolic process(GO:0070525) |
0.0 | 0.0 | GO:0070125 | mitochondrial translational elongation(GO:0070125) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
1.4 | 4.1 | GO:0030981 | cortical microtubule cytoskeleton(GO:0030981) |
1.2 | 3.6 | GO:1990761 | growth cone lamellipodium(GO:1990761) |
1.1 | 3.3 | GO:0005863 | striated muscle myosin thick filament(GO:0005863) |
0.9 | 3.8 | GO:1990357 | terminal web(GO:1990357) |
0.9 | 3.7 | GO:0030689 | Noc complex(GO:0030689) |
0.7 | 5.9 | GO:0097470 | ribbon synapse(GO:0097470) |
0.6 | 2.8 | GO:0001651 | dense fibrillar component(GO:0001651) |
0.5 | 1.5 | GO:0097513 | myosin II filament(GO:0097513) |
0.5 | 2.5 | GO:0034388 | Pwp2p-containing subcomplex of 90S preribosome(GO:0034388) |
0.5 | 6.8 | GO:0000177 | cytoplasmic exosome (RNase complex)(GO:0000177) |
0.4 | 2.6 | GO:0070937 | CRD-mediated mRNA stability complex(GO:0070937) |
0.4 | 1.7 | GO:0005955 | calcineurin complex(GO:0005955) |
0.4 | 4.1 | GO:0034709 | methylosome(GO:0034709) |
0.4 | 2.3 | GO:0014731 | spectrin-associated cytoskeleton(GO:0014731) |
0.4 | 1.2 | GO:0043259 | laminin-10 complex(GO:0043259) |
0.4 | 2.2 | GO:0071556 | integral component of cytoplasmic side of endoplasmic reticulum membrane(GO:0071458) integral component of lumenal side of endoplasmic reticulum membrane(GO:0071556) lumenal side of endoplasmic reticulum membrane(GO:0098553) |
0.4 | 5.4 | GO:0030014 | CCR4-NOT complex(GO:0030014) |
0.3 | 1.4 | GO:0071953 | elastic fiber(GO:0071953) |
0.3 | 7.2 | GO:0005680 | anaphase-promoting complex(GO:0005680) |
0.3 | 3.0 | GO:0032045 | guanyl-nucleotide exchange factor complex(GO:0032045) |
0.3 | 1.3 | GO:0005726 | perichromatin fibrils(GO:0005726) |
0.3 | 1.3 | GO:0000444 | MIS12/MIND type complex(GO:0000444) |
0.3 | 1.3 | GO:0045180 | basal cortex(GO:0045180) |
0.3 | 0.9 | GO:0005944 | phosphatidylinositol 3-kinase complex, class IB(GO:0005944) |
0.3 | 1.2 | GO:0035189 | Rb-E2F complex(GO:0035189) |
0.3 | 3.8 | GO:0036038 | MKS complex(GO:0036038) |
0.3 | 1.5 | GO:0030485 | smooth muscle contractile fiber(GO:0030485) |
0.3 | 0.9 | GO:0071942 | XPC complex(GO:0071942) |
0.3 | 1.1 | GO:0044352 | pinosome(GO:0044352) macropinosome(GO:0044354) |
0.3 | 1.4 | GO:0005964 | phosphorylase kinase complex(GO:0005964) |
0.3 | 0.5 | GO:0043296 | apical junction complex(GO:0043296) |
0.3 | 1.5 | GO:0098645 | collagen type IV trimer(GO:0005587) network-forming collagen trimer(GO:0098642) collagen network(GO:0098645) basement membrane collagen trimer(GO:0098651) |
0.2 | 1.5 | GO:0000127 | transcription factor TFIIIC complex(GO:0000127) |
0.2 | 1.5 | GO:0016363 | nuclear matrix(GO:0016363) |
0.2 | 2.7 | GO:0030061 | mitochondrial crista(GO:0030061) |
0.2 | 1.0 | GO:1990726 | Lsm1-7-Pat1 complex(GO:1990726) |
0.2 | 1.2 | GO:0046696 | lipopolysaccharide receptor complex(GO:0046696) |
0.2 | 1.4 | GO:0005915 | zonula adherens(GO:0005915) |
0.2 | 0.7 | GO:0097418 | neurofibrillary tangle(GO:0097418) |
0.2 | 3.2 | GO:0035327 | transcriptionally active chromatin(GO:0035327) |
0.2 | 2.4 | GO:0005641 | nuclear envelope lumen(GO:0005641) |
0.2 | 2.0 | GO:0071439 | clathrin complex(GO:0071439) |
0.2 | 0.9 | GO:0031466 | Cul5-RING ubiquitin ligase complex(GO:0031466) |
0.2 | 0.6 | GO:0070765 | gamma-secretase complex(GO:0070765) |
0.2 | 3.6 | GO:0005614 | interstitial matrix(GO:0005614) |
0.2 | 2.7 | GO:0061702 | inflammasome complex(GO:0061702) |
0.2 | 0.2 | GO:0005683 | U7 snRNP(GO:0005683) |
0.2 | 7.3 | GO:0000795 | synaptonemal complex(GO:0000795) |
0.2 | 1.4 | GO:0034993 | microtubule organizing center attachment site(GO:0034992) LINC complex(GO:0034993) |
0.2 | 1.4 | GO:0070688 | MLL5-L complex(GO:0070688) |
0.2 | 4.4 | GO:0036379 | myofilament(GO:0036379) |
0.2 | 0.2 | GO:0016461 | unconventional myosin complex(GO:0016461) |
0.2 | 0.4 | GO:0032127 | dense core granule membrane(GO:0032127) |
0.2 | 0.6 | GO:0005658 | alpha DNA polymerase:primase complex(GO:0005658) |
0.2 | 0.7 | GO:0035339 | SPOTS complex(GO:0035339) |
0.2 | 0.5 | GO:0060053 | neurofilament cytoskeleton(GO:0060053) |
0.2 | 0.4 | GO:0031523 | Myb complex(GO:0031523) |
0.2 | 5.3 | GO:0000307 | cyclin-dependent protein kinase holoenzyme complex(GO:0000307) |
0.2 | 0.5 | GO:0044393 | microspike(GO:0044393) |
0.2 | 2.3 | GO:0035686 | sperm fibrous sheath(GO:0035686) |
0.2 | 1.4 | GO:0005677 | chromatin silencing complex(GO:0005677) |
0.2 | 1.5 | GO:0097539 | ciliary transition fiber(GO:0097539) |
0.2 | 1.8 | GO:0032039 | integrator complex(GO:0032039) |
0.2 | 0.5 | GO:0000178 | exosome (RNase complex)(GO:0000178) |
0.2 | 0.3 | GO:0031074 | nucleocytoplasmic shuttling complex(GO:0031074) |
0.2 | 0.5 | GO:0034457 | Mpp10 complex(GO:0034457) |
0.2 | 0.5 | GO:0031933 | telomeric heterochromatin(GO:0031933) |
0.2 | 7.5 | GO:0045178 | basal part of cell(GO:0045178) |
0.1 | 0.6 | GO:0071203 | WASH complex(GO:0071203) |
0.1 | 0.3 | GO:0008091 | spectrin(GO:0008091) |
0.1 | 1.2 | GO:0001931 | uropod(GO:0001931) cell trailing edge(GO:0031254) |
0.1 | 0.3 | GO:0097431 | mitotic spindle pole(GO:0097431) |
0.1 | 1.9 | GO:0031430 | M band(GO:0031430) |
0.1 | 1.0 | GO:0032009 | early phagosome(GO:0032009) |
0.1 | 0.4 | GO:0034673 | inhibin-betaglycan-ActRII complex(GO:0034673) |
0.1 | 1.1 | GO:0030991 | intraciliary transport particle A(GO:0030991) |
0.1 | 0.4 | GO:0005642 | annulate lamellae(GO:0005642) |
0.1 | 1.1 | GO:0031501 | mannosyltransferase complex(GO:0031501) |
0.1 | 0.4 | GO:0031094 | platelet dense tubular network(GO:0031094) |
0.1 | 0.4 | GO:0097487 | multivesicular body, internal vesicle(GO:0097487) |
0.1 | 1.1 | GO:0070578 | RISC-loading complex(GO:0070578) |
0.1 | 0.3 | GO:0016939 | kinesin II complex(GO:0016939) |
0.1 | 1.8 | GO:0031011 | Ino80 complex(GO:0031011) |
0.1 | 0.8 | GO:0002081 | outer acrosomal membrane(GO:0002081) |
0.1 | 0.2 | GO:0097629 | extrinsic component of omegasome membrane(GO:0097629) |
0.1 | 0.5 | GO:0030870 | Mre11 complex(GO:0030870) |
0.1 | 0.4 | GO:0000811 | GINS complex(GO:0000811) |
0.1 | 0.9 | GO:0090543 | Flemming body(GO:0090543) |
0.1 | 0.4 | GO:0005967 | mitochondrial pyruvate dehydrogenase complex(GO:0005967) |
0.1 | 0.8 | GO:0030312 | external encapsulating structure(GO:0030312) |
0.1 | 6.0 | GO:0001725 | stress fiber(GO:0001725) contractile actin filament bundle(GO:0097517) |
0.1 | 1.4 | GO:0033391 | chromatoid body(GO:0033391) |
0.1 | 1.1 | GO:0005675 | holo TFIIH complex(GO:0005675) |
0.1 | 0.5 | GO:0002189 | ribose phosphate diphosphokinase complex(GO:0002189) |
0.1 | 0.5 | GO:0044530 | supraspliceosomal complex(GO:0044530) |
0.1 | 1.0 | GO:0033179 | proton-transporting V-type ATPase, V0 domain(GO:0033179) |
0.1 | 0.6 | GO:0042765 | GPI-anchor transamidase complex(GO:0042765) |
0.1 | 1.2 | GO:0031597 | cytosolic proteasome complex(GO:0031597) |
0.1 | 0.4 | GO:0097136 | Bcl-2 family protein complex(GO:0097136) |
0.1 | 0.9 | GO:1990124 | messenger ribonucleoprotein complex(GO:1990124) |
0.1 | 0.6 | GO:0016281 | eukaryotic translation initiation factor 4F complex(GO:0016281) |
0.1 | 0.1 | GO:0000814 | ESCRT II complex(GO:0000814) |
0.1 | 2.6 | GO:0014704 | intercalated disc(GO:0014704) |
0.1 | 0.4 | GO:0044613 | nuclear pore central transport channel(GO:0044613) |
0.1 | 1.6 | GO:0005697 | telomerase holoenzyme complex(GO:0005697) |
0.1 | 0.9 | GO:0019773 | proteasome core complex, alpha-subunit complex(GO:0019773) |
0.1 | 1.2 | GO:0001673 | male germ cell nucleus(GO:0001673) |
0.1 | 0.9 | GO:0008250 | oligosaccharyltransferase complex(GO:0008250) |
0.1 | 1.3 | GO:0005682 | U5 snRNP(GO:0005682) |
0.1 | 1.0 | GO:0001527 | microfibril(GO:0001527) |
0.1 | 1.1 | GO:0005838 | proteasome regulatory particle(GO:0005838) |
0.1 | 0.2 | GO:0001674 | female germ cell nucleus(GO:0001674) |
0.1 | 0.8 | GO:0070938 | contractile ring(GO:0070938) |
0.1 | 0.7 | GO:0005666 | DNA-directed RNA polymerase III complex(GO:0005666) |
0.1 | 0.5 | GO:0042406 | extrinsic component of endoplasmic reticulum membrane(GO:0042406) |
0.1 | 0.5 | GO:0043219 | lateral loop(GO:0043219) |
0.1 | 0.1 | GO:0097427 | microtubule bundle(GO:0097427) |
0.1 | 2.0 | GO:0031305 | integral component of mitochondrial inner membrane(GO:0031305) |
0.1 | 0.3 | GO:0031084 | BLOC-2 complex(GO:0031084) |
0.1 | 7.4 | GO:0030496 | midbody(GO:0030496) |
0.1 | 1.0 | GO:0042575 | DNA polymerase complex(GO:0042575) |
0.1 | 1.4 | GO:0000159 | protein phosphatase type 2A complex(GO:0000159) |
0.1 | 0.4 | GO:1990316 | ATG1/ULK1 kinase complex(GO:1990316) |
0.1 | 5.0 | GO:0005811 | lipid particle(GO:0005811) |
0.1 | 0.4 | GO:0030132 | clathrin coat of coated pit(GO:0030132) |
0.1 | 1.9 | GO:0080008 | Cul4-RING E3 ubiquitin ligase complex(GO:0080008) |
0.1 | 0.8 | GO:0005869 | dynactin complex(GO:0005869) |
0.1 | 0.2 | GO:0005914 | spot adherens junction(GO:0005914) |
0.1 | 0.3 | GO:1990423 | RZZ complex(GO:1990423) |
0.1 | 0.3 | GO:0031092 | platelet alpha granule membrane(GO:0031092) |
0.1 | 1.3 | GO:0000118 | histone deacetylase complex(GO:0000118) |
0.1 | 1.1 | GO:0046930 | pore complex(GO:0046930) |
0.1 | 0.9 | GO:0005639 | integral component of nuclear inner membrane(GO:0005639) intrinsic component of nuclear inner membrane(GO:0031229) nuclear membrane part(GO:0044453) |
0.1 | 0.9 | GO:0043034 | costamere(GO:0043034) |
0.1 | 0.1 | GO:0031143 | pseudopodium(GO:0031143) |
0.1 | 1.9 | GO:0008305 | integrin complex(GO:0008305) |
0.1 | 0.4 | GO:0030128 | clathrin coat of endocytic vesicle(GO:0030128) |
0.1 | 0.7 | GO:0031932 | TORC2 complex(GO:0031932) |
0.1 | 0.5 | GO:0030915 | Smc5-Smc6 complex(GO:0030915) |
0.1 | 0.2 | GO:0097413 | Lewy body(GO:0097413) |
0.1 | 1.0 | GO:0005844 | polysome(GO:0005844) |
0.1 | 0.3 | GO:0070820 | tertiary granule(GO:0070820) |
0.1 | 0.3 | GO:0016602 | CCAAT-binding factor complex(GO:0016602) |
0.1 | 1.0 | GO:0031528 | microvillus membrane(GO:0031528) |
0.1 | 0.5 | GO:0033116 | endoplasmic reticulum-Golgi intermediate compartment membrane(GO:0033116) |
0.1 | 0.2 | GO:0032299 | ribonuclease H2 complex(GO:0032299) |
0.1 | 0.5 | GO:0005952 | cAMP-dependent protein kinase complex(GO:0005952) |
0.1 | 0.3 | GO:0043202 | lysosomal lumen(GO:0043202) |
0.1 | 0.2 | GO:0005827 | polar microtubule(GO:0005827) |
0.1 | 0.4 | GO:0031264 | death-inducing signaling complex(GO:0031264) |
0.1 | 0.9 | GO:0031362 | anchored component of external side of plasma membrane(GO:0031362) |
0.1 | 0.1 | GO:0000322 | storage vacuole(GO:0000322) |
0.1 | 2.6 | GO:0045171 | intercellular bridge(GO:0045171) |
0.1 | 0.2 | GO:0048179 | activin receptor complex(GO:0048179) |
0.1 | 0.1 | GO:0016460 | myosin II complex(GO:0016460) |
0.1 | 0.9 | GO:0000421 | autophagosome membrane(GO:0000421) |
0.1 | 0.1 | GO:0098554 | cytoplasmic side of endoplasmic reticulum membrane(GO:0098554) |
0.1 | 0.5 | GO:0000813 | ESCRT I complex(GO:0000813) |
0.1 | 0.5 | GO:0016272 | prefoldin complex(GO:0016272) |
0.1 | 1.8 | GO:0016235 | aggresome(GO:0016235) |
0.1 | 0.6 | GO:0042641 | actomyosin(GO:0042641) |
0.1 | 0.1 | GO:0097524 | sperm plasma membrane(GO:0097524) |
0.1 | 0.8 | GO:0005847 | mRNA cleavage and polyadenylation specificity factor complex(GO:0005847) |
0.1 | 0.7 | GO:0072546 | ER membrane protein complex(GO:0072546) |
0.1 | 0.9 | GO:0005736 | DNA-directed RNA polymerase I complex(GO:0005736) |
0.1 | 0.5 | GO:0097208 | alveolar lamellar body(GO:0097208) |
0.1 | 1.5 | GO:0031902 | late endosome membrane(GO:0031902) |
0.1 | 0.5 | GO:0046581 | intercellular canaliculus(GO:0046581) |
0.1 | 0.3 | GO:0030688 | preribosome, small subunit precursor(GO:0030688) |
0.1 | 0.5 | GO:0005640 | nuclear outer membrane(GO:0005640) |
0.1 | 0.3 | GO:0089717 | spanning component of plasma membrane(GO:0044214) spanning component of membrane(GO:0089717) |
0.1 | 0.1 | GO:0097057 | TRAF2-GSTP1 complex(GO:0097057) |
0.1 | 0.5 | GO:0030008 | TRAPP complex(GO:0030008) |
0.1 | 1.6 | GO:0030118 | clathrin coat(GO:0030118) |
0.1 | 0.1 | GO:0034399 | nuclear periphery(GO:0034399) |
0.1 | 0.7 | GO:0000164 | protein phosphatase type 1 complex(GO:0000164) |
0.1 | 0.5 | GO:0061700 | GATOR2 complex(GO:0061700) |
0.1 | 0.4 | GO:0005833 | hemoglobin complex(GO:0005833) |
0.1 | 0.1 | GO:0005686 | U2 snRNP(GO:0005686) |
0.1 | 1.5 | GO:0055038 | recycling endosome membrane(GO:0055038) |
0.1 | 0.4 | GO:0044300 | cerebellar mossy fiber(GO:0044300) |
0.1 | 1.7 | GO:0005788 | endoplasmic reticulum lumen(GO:0005788) |
0.1 | 0.4 | GO:0098827 | endoplasmic reticulum subcompartment(GO:0098827) |
0.1 | 0.2 | GO:0005968 | Rab-protein geranylgeranyltransferase complex(GO:0005968) |
0.1 | 0.2 | GO:1990604 | IRE1-TRAF2-ASK1 complex(GO:1990604) |
0.1 | 2.7 | GO:0031526 | brush border membrane(GO:0031526) |
0.1 | 0.4 | GO:0042599 | lamellar body(GO:0042599) |
0.1 | 0.9 | GO:0016327 | apicolateral plasma membrane(GO:0016327) |
0.1 | 0.3 | GO:0042105 | alpha-beta T cell receptor complex(GO:0042105) |
0.1 | 1.1 | GO:0035861 | site of double-strand break(GO:0035861) |
0.1 | 0.2 | GO:0097443 | sorting endosome(GO:0097443) |
0.1 | 7.0 | GO:0005741 | mitochondrial outer membrane(GO:0005741) |
0.1 | 0.5 | GO:0017119 | Golgi transport complex(GO:0017119) |
0.1 | 0.1 | GO:0098576 | lumenal side of membrane(GO:0098576) |
0.1 | 1.8 | GO:0000794 | condensed nuclear chromosome(GO:0000794) |
0.1 | 0.5 | GO:0000781 | chromosome, telomeric region(GO:0000781) |
0.1 | 0.2 | GO:0000938 | GARP complex(GO:0000938) |
0.1 | 0.2 | GO:0000214 | tRNA-intron endonuclease complex(GO:0000214) |
0.1 | 0.8 | GO:0030686 | 90S preribosome(GO:0030686) |
0.1 | 0.2 | GO:0032591 | dendritic spine membrane(GO:0032591) |
0.1 | 0.4 | GO:0032982 | myosin filament(GO:0032982) |
0.1 | 0.4 | GO:0043020 | NADPH oxidase complex(GO:0043020) |
0.1 | 0.6 | GO:0043196 | varicosity(GO:0043196) |
0.1 | 0.3 | GO:1990454 | L-type voltage-gated calcium channel complex(GO:1990454) |
0.1 | 0.2 | GO:0071818 | BAT3 complex(GO:0071818) ER membrane insertion complex(GO:0072379) |
0.1 | 0.2 | GO:0000137 | Golgi cis cisterna(GO:0000137) |
0.1 | 0.2 | GO:0030127 | COPII vesicle coat(GO:0030127) |
0.1 | 0.1 | GO:0036488 | CHOP-C/EBP complex(GO:0036488) |
0.1 | 0.5 | GO:0030134 | ER to Golgi transport vesicle(GO:0030134) |
0.1 | 0.4 | GO:0051233 | spindle midzone(GO:0051233) |
0.1 | 0.2 | GO:0044194 | cytolytic granule(GO:0044194) |
0.1 | 0.3 | GO:0034366 | spherical high-density lipoprotein particle(GO:0034366) |
0.1 | 0.4 | GO:0000974 | Prp19 complex(GO:0000974) |
0.1 | 2.4 | GO:0016529 | sarcoplasmic reticulum(GO:0016529) |
0.1 | 1.7 | GO:0016328 | lateral plasma membrane(GO:0016328) |
0.1 | 1.1 | GO:0030992 | intraciliary transport particle B(GO:0030992) |
0.1 | 0.2 | GO:0005921 | gap junction(GO:0005921) |
0.1 | 0.4 | GO:0048500 | signal recognition particle, endoplasmic reticulum targeting(GO:0005786) signal recognition particle(GO:0048500) |
0.1 | 2.0 | GO:0045095 | keratin filament(GO:0045095) |
0.1 | 1.0 | GO:0005922 | connexon complex(GO:0005922) |
0.1 | 0.3 | GO:0030057 | desmosome(GO:0030057) |
0.1 | 0.4 | GO:0042101 | T cell receptor complex(GO:0042101) |
0.1 | 0.2 | GO:0044308 | axonal spine(GO:0044308) |
0.1 | 2.1 | GO:0030173 | integral component of Golgi membrane(GO:0030173) |
0.1 | 0.2 | GO:0043203 | axon hillock(GO:0043203) |
0.1 | 3.1 | GO:0032993 | protein-DNA complex(GO:0032993) |
0.1 | 1.4 | GO:0000502 | proteasome complex(GO:0000502) |
0.1 | 0.1 | GO:0034365 | discoidal high-density lipoprotein particle(GO:0034365) |
0.1 | 0.2 | GO:0016514 | SWI/SNF complex(GO:0016514) |
0.1 | 0.8 | GO:0005782 | peroxisomal matrix(GO:0005782) microbody lumen(GO:0031907) |
0.1 | 0.5 | GO:0000124 | SAGA complex(GO:0000124) |
0.1 | 0.2 | GO:0045298 | tubulin complex(GO:0045298) |
0.0 | 1.3 | GO:0005801 | cis-Golgi network(GO:0005801) |
0.0 | 9.3 | GO:0005759 | mitochondrial matrix(GO:0005759) |
0.0 | 0.5 | GO:0034706 | sodium channel complex(GO:0034706) |
0.0 | 0.2 | GO:0033063 | Rad51B-Rad51C-Rad51D-XRCC2 complex(GO:0033063) |
0.0 | 4.9 | GO:0045111 | intermediate filament cytoskeleton(GO:0045111) |
0.0 | 0.6 | GO:0001772 | immunological synapse(GO:0001772) |
0.0 | 11.4 | GO:0005925 | focal adhesion(GO:0005925) |
0.0 | 0.4 | GO:0008180 | COP9 signalosome(GO:0008180) |
0.0 | 0.1 | GO:0016533 | cyclin-dependent protein kinase 5 holoenzyme complex(GO:0016533) |
0.0 | 0.1 | GO:0097255 | R2TP complex(GO:0097255) |
0.0 | 4.5 | GO:0016323 | basolateral plasma membrane(GO:0016323) |
0.0 | 0.5 | GO:0030140 | trans-Golgi network transport vesicle(GO:0030140) |
0.0 | 0.9 | GO:0035145 | exon-exon junction complex(GO:0035145) |
0.0 | 0.8 | GO:0005657 | replication fork(GO:0005657) |
0.0 | 5.3 | GO:0005938 | cell cortex(GO:0005938) |
0.0 | 0.1 | GO:0038201 | TOR complex(GO:0038201) |
0.0 | 0.0 | GO:0030990 | intraciliary transport particle(GO:0030990) |
0.0 | 1.8 | GO:0055037 | recycling endosome(GO:0055037) |
0.0 | 0.3 | GO:0070847 | core mediator complex(GO:0070847) |
0.0 | 0.8 | GO:0008023 | transcription elongation factor complex(GO:0008023) |
0.0 | 0.1 | GO:0042583 | chromaffin granule(GO:0042583) |
0.0 | 1.3 | GO:0005903 | brush border(GO:0005903) |
0.0 | 1.5 | GO:0005923 | bicellular tight junction(GO:0005923) |
0.0 | 0.1 | GO:0044326 | dendritic spine neck(GO:0044326) |
0.0 | 0.2 | GO:0031428 | box C/D snoRNP complex(GO:0031428) |
0.0 | 0.0 | GO:0030893 | meiotic cohesin complex(GO:0030893) |
0.0 | 1.0 | GO:0005891 | voltage-gated calcium channel complex(GO:0005891) |
0.0 | 1.9 | GO:0017053 | transcriptional repressor complex(GO:0017053) |
0.0 | 0.3 | GO:1902554 | serine/threonine protein kinase complex(GO:1902554) |
0.0 | 0.0 | GO:0070552 | BRISC complex(GO:0070552) |
0.0 | 0.2 | GO:0016471 | vacuolar proton-transporting V-type ATPase complex(GO:0016471) |
0.0 | 0.2 | GO:0098533 | ATPase dependent transmembrane transport complex(GO:0098533) |
0.0 | 9.7 | GO:0000228 | nuclear chromosome(GO:0000228) |
0.0 | 0.1 | GO:0071598 | neuronal ribonucleoprotein granule(GO:0071598) |
0.0 | 0.2 | GO:0005796 | Golgi lumen(GO:0005796) |
0.0 | 0.6 | GO:0030137 | COPI-coated vesicle(GO:0030137) |
0.0 | 0.1 | GO:0005588 | collagen type V trimer(GO:0005588) |
0.0 | 0.1 | GO:0071204 | histone pre-mRNA 3'end processing complex(GO:0071204) |
0.0 | 0.0 | GO:0034518 | mRNA cap binding complex(GO:0005845) RNA cap binding complex(GO:0034518) |
0.0 | 0.2 | GO:0097225 | sperm midpiece(GO:0097225) |
0.0 | 0.3 | GO:0005750 | mitochondrial respiratory chain complex III(GO:0005750) respiratory chain complex III(GO:0045275) |
0.0 | 0.1 | GO:0030868 | smooth endoplasmic reticulum membrane(GO:0030868) smooth endoplasmic reticulum part(GO:0097425) |
0.0 | 0.2 | GO:0042788 | polysomal ribosome(GO:0042788) |
0.0 | 0.5 | GO:0005771 | multivesicular body(GO:0005771) |
0.0 | 0.0 | GO:0035631 | CD40 receptor complex(GO:0035631) |
0.0 | 0.0 | GO:1990712 | HFE-transferrin receptor complex(GO:1990712) |
0.0 | 4.0 | GO:0031965 | nuclear membrane(GO:0031965) |
0.0 | 0.3 | GO:0031672 | A band(GO:0031672) |
0.0 | 0.0 | GO:0044316 | cone cell pedicle(GO:0044316) |
0.0 | 8.5 | GO:0042175 | nuclear outer membrane-endoplasmic reticulum membrane network(GO:0042175) |
0.0 | 2.1 | GO:0070469 | respiratory chain(GO:0070469) |
0.0 | 0.1 | GO:0000152 | nuclear ubiquitin ligase complex(GO:0000152) |
0.0 | 0.3 | GO:0071541 | eukaryotic translation initiation factor 3 complex, eIF3m(GO:0071541) |
0.0 | 0.3 | GO:0042613 | MHC class II protein complex(GO:0042613) |
0.0 | 0.1 | GO:0072487 | MSL complex(GO:0072487) |
0.0 | 0.0 | GO:0097452 | GAIT complex(GO:0097452) |
0.0 | 0.1 | GO:0044292 | dendrite terminus(GO:0044292) |
0.0 | 0.2 | GO:0033270 | paranode region of axon(GO:0033270) |
0.0 | 0.2 | GO:0031371 | ubiquitin conjugating enzyme complex(GO:0031371) |
0.0 | 0.1 | GO:0005945 | 6-phosphofructokinase complex(GO:0005945) |
0.0 | 1.2 | GO:0005901 | caveola(GO:0005901) |
0.0 | 0.1 | GO:0097197 | tetraspanin-enriched microdomain(GO:0097197) |
0.0 | 0.8 | GO:0034358 | plasma lipoprotein particle(GO:0034358) lipoprotein particle(GO:1990777) |
0.0 | 0.1 | GO:0031467 | Cul7-RING ubiquitin ligase complex(GO:0031467) |
0.0 | 0.2 | GO:0031588 | nucleotide-activated protein kinase complex(GO:0031588) |
0.0 | 0.8 | GO:0010494 | cytoplasmic stress granule(GO:0010494) |
0.0 | 0.1 | GO:0071001 | U4/U6 snRNP(GO:0071001) |
0.0 | 0.0 | GO:0031233 | intrinsic component of external side of plasma membrane(GO:0031233) |
0.0 | 0.8 | GO:0046658 | anchored component of plasma membrane(GO:0046658) |
0.0 | 0.3 | GO:0002102 | podosome(GO:0002102) |
0.0 | 0.1 | GO:0051286 | cell tip(GO:0051286) |
0.0 | 2.4 | GO:0005635 | nuclear envelope(GO:0005635) |
0.0 | 0.1 | GO:0002199 | zona pellucida receptor complex(GO:0002199) |
0.0 | 1.7 | GO:0005802 | trans-Golgi network(GO:0005802) |
0.0 | 0.1 | GO:0043159 | acrosomal matrix(GO:0043159) |
0.0 | 0.1 | GO:0042405 | nuclear inclusion body(GO:0042405) |
0.0 | 0.3 | GO:0032588 | trans-Golgi network membrane(GO:0032588) |
0.0 | 0.1 | GO:0005896 | interleukin-6 receptor complex(GO:0005896) |
0.0 | 0.1 | GO:0000791 | euchromatin(GO:0000791) |
0.0 | 0.1 | GO:0031417 | NatC complex(GO:0031417) |
0.0 | 0.0 | GO:0044614 | nuclear pore cytoplasmic filaments(GO:0044614) |
0.0 | 1.1 | GO:0005769 | early endosome(GO:0005769) |
0.0 | 0.1 | GO:0031091 | platelet alpha granule(GO:0031091) |
0.0 | 0.1 | GO:0002193 | MAML1-RBP-Jkappa- ICN1 complex(GO:0002193) |
0.0 | 0.1 | GO:0001650 | fibrillar center(GO:0001650) |
0.0 | 1.1 | GO:0016605 | PML body(GO:0016605) |
0.0 | 0.2 | GO:0035253 | ciliary rootlet(GO:0035253) |
0.0 | 0.1 | GO:0030123 | AP-3 adaptor complex(GO:0030123) |
0.0 | 0.0 | GO:0030880 | RNA polymerase complex(GO:0030880) |
0.0 | 0.4 | GO:0005793 | endoplasmic reticulum-Golgi intermediate compartment(GO:0005793) |
0.0 | 1.4 | GO:0000139 | Golgi membrane(GO:0000139) |
0.0 | 0.2 | GO:0031616 | spindle pole centrosome(GO:0031616) |
0.0 | 0.4 | GO:0071011 | precatalytic spliceosome(GO:0071011) |
0.0 | 0.1 | GO:0005688 | U6 snRNP(GO:0005688) |
0.0 | 0.1 | GO:0048770 | melanosome(GO:0042470) pigment granule(GO:0048770) |
0.0 | 0.1 | GO:0001520 | outer dense fiber(GO:0001520) |
0.0 | 0.1 | GO:0000346 | transcription export complex(GO:0000346) |
0.0 | 0.1 | GO:0030891 | VCB complex(GO:0030891) |
0.0 | 0.2 | GO:0001891 | phagocytic cup(GO:0001891) |
0.0 | 0.1 | GO:0031512 | motile primary cilium(GO:0031512) |
0.0 | 0.8 | GO:0005795 | Golgi stack(GO:0005795) |
0.0 | 1.0 | GO:0030016 | myofibril(GO:0030016) |
0.0 | 0.9 | GO:0005758 | mitochondrial intermembrane space(GO:0005758) |
0.0 | 0.2 | GO:0005671 | Ada2/Gcn5/Ada3 transcription activator complex(GO:0005671) |
0.0 | 0.0 | GO:0044449 | contractile fiber part(GO:0044449) |
0.0 | 5.4 | GO:0005764 | lytic vacuole(GO:0000323) lysosome(GO:0005764) |
0.0 | 0.1 | GO:0033093 | Weibel-Palade body(GO:0033093) |
0.0 | 0.1 | GO:0005851 | eukaryotic translation initiation factor 2B complex(GO:0005851) |
0.0 | 7.1 | GO:0031012 | extracellular matrix(GO:0031012) |
0.0 | 1.1 | GO:0016607 | nuclear speck(GO:0016607) |
0.0 | 0.0 | GO:0045293 | mRNA editing complex(GO:0045293) |
0.0 | 21.0 | GO:0005829 | cytosol(GO:0005829) |
0.0 | 0.2 | GO:0031941 | filamentous actin(GO:0031941) |
0.0 | 0.2 | GO:0000242 | pericentriolar material(GO:0000242) |
0.0 | 0.0 | GO:0016222 | procollagen-proline 4-dioxygenase complex(GO:0016222) |
0.0 | 0.3 | GO:0005905 | clathrin-coated pit(GO:0005905) |
0.0 | 0.7 | GO:0019005 | SCF ubiquitin ligase complex(GO:0019005) |
0.0 | 0.0 | GO:0045335 | phagocytic vesicle(GO:0045335) |
0.0 | 0.0 | GO:0010009 | cytoplasmic side of endosome membrane(GO:0010009) |
0.0 | 0.1 | GO:0017101 | aminoacyl-tRNA synthetase multienzyme complex(GO:0017101) |
0.0 | 0.0 | GO:0070069 | cytochrome complex(GO:0070069) |
0.0 | 1.1 | GO:0045177 | apical part of cell(GO:0045177) |
0.0 | 0.1 | GO:0031209 | SCAR complex(GO:0031209) |
0.0 | 0.1 | GO:0005689 | U12-type spliceosomal complex(GO:0005689) |
0.0 | 0.0 | GO:0000815 | ESCRT III complex(GO:0000815) |
0.0 | 0.2 | GO:0031231 | intrinsic component of peroxisomal membrane(GO:0031231) |
0.0 | 0.4 | GO:0005774 | vacuolar membrane(GO:0005774) |
0.0 | 0.1 | GO:0043527 | tRNA methyltransferase complex(GO:0043527) |
0.0 | 0.4 | GO:0005581 | collagen trimer(GO:0005581) |
0.0 | 0.0 | GO:0032389 | MutLalpha complex(GO:0032389) |
0.0 | 0.0 | GO:0061574 | ASAP complex(GO:0061574) |
0.0 | 0.1 | GO:0042555 | MCM complex(GO:0042555) |
0.0 | 0.0 | GO:0048476 | Holliday junction resolvase complex(GO:0048476) |
0.0 | 0.1 | GO:0005868 | cytoplasmic dynein complex(GO:0005868) |
0.0 | 1.4 | GO:0005694 | chromosome(GO:0005694) |
0.0 | 0.1 | GO:0030904 | retromer complex(GO:0030904) |
0.0 | 1.1 | GO:0001669 | acrosomal vesicle(GO:0001669) |
0.0 | 0.0 | GO:0030289 | protein phosphatase 4 complex(GO:0030289) |
0.0 | 0.4 | GO:0031594 | neuromuscular junction(GO:0031594) |
0.0 | 0.1 | GO:0035371 | microtubule plus-end(GO:0035371) |
0.0 | 0.3 | GO:0000932 | cytoplasmic mRNA processing body(GO:0000932) |
0.0 | 0.4 | GO:0031519 | PcG protein complex(GO:0031519) |
0.0 | 0.1 | GO:0071004 | U2-type prespliceosome(GO:0071004) |
0.0 | 0.0 | GO:0005744 | mitochondrial inner membrane presequence translocase complex(GO:0005744) |
0.0 | 0.2 | GO:0032281 | AMPA glutamate receptor complex(GO:0032281) |
0.0 | 0.0 | GO:0005853 | eukaryotic translation elongation factor 1 complex(GO:0005853) |
0.0 | 0.4 | GO:0000922 | spindle pole(GO:0000922) |
0.0 | 0.3 | GO:0071013 | catalytic step 2 spliceosome(GO:0071013) |
0.0 | 0.0 | GO:0042612 | MHC class I protein complex(GO:0042612) |
0.0 | 8.8 | GO:0005783 | endoplasmic reticulum(GO:0005783) |
0.0 | 0.0 | GO:0031390 | Ctf18 RFC-like complex(GO:0031390) |
0.0 | 10.1 | GO:0005654 | nucleoplasm(GO:0005654) |
0.0 | 0.0 | GO:0035355 | Toll-like receptor 2-Toll-like receptor 6 protein complex(GO:0035355) |
0.0 | 0.2 | GO:0015030 | Cajal body(GO:0015030) |
0.0 | 0.1 | GO:0005776 | autophagosome(GO:0005776) |
0.0 | 2.8 | GO:0005667 | transcription factor complex(GO:0005667) |
0.0 | 0.0 | GO:0016234 | inclusion body(GO:0016234) |
0.0 | 13.9 | GO:0070062 | extracellular exosome(GO:0070062) |
0.0 | 0.0 | GO:0000930 | gamma-tubulin complex(GO:0000930) |
0.0 | 0.1 | GO:0032279 | asymmetric synapse(GO:0032279) |
0.0 | 0.0 | GO:0033588 | Elongator holoenzyme complex(GO:0033588) |
0.0 | 0.1 | GO:0005753 | mitochondrial proton-transporting ATP synthase complex(GO:0005753) |
0.0 | 0.0 | GO:0098536 | deuterosome(GO:0098536) |
0.0 | 0.0 | GO:0005685 | U1 snRNP(GO:0005685) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
1.5 | 4.5 | GO:0030519 | snoRNP binding(GO:0030519) |
1.2 | 3.5 | GO:0015205 | purine nucleobase transmembrane transporter activity(GO:0005345) pyrimidine nucleobase transmembrane transporter activity(GO:0005350) nucleobase transmembrane transporter activity(GO:0015205) |
1.1 | 3.3 | GO:0035877 | death effector domain binding(GO:0035877) |
1.0 | 3.0 | GO:0003976 | UDP-N-acetylglucosamine-lysosomal-enzyme N-acetylglucosaminephosphotransferase activity(GO:0003976) |
0.9 | 3.5 | GO:0043515 | kinetochore binding(GO:0043515) |
0.7 | 2.1 | GO:0004687 | myosin light chain kinase activity(GO:0004687) |
0.7 | 2.1 | GO:0051373 | FATZ binding(GO:0051373) |
0.7 | 2.6 | GO:0015232 | heme transporter activity(GO:0015232) |
0.7 | 3.3 | GO:0005095 | GTPase inhibitor activity(GO:0005095) |
0.6 | 2.5 | GO:0015220 | choline transmembrane transporter activity(GO:0015220) |
0.5 | 2.2 | GO:0003917 | DNA topoisomerase type I activity(GO:0003917) |
0.5 | 8.4 | GO:0008307 | structural constituent of muscle(GO:0008307) |
0.5 | 1.6 | GO:0008073 | ornithine decarboxylase inhibitor activity(GO:0008073) |
0.5 | 1.5 | GO:0003941 | L-serine ammonia-lyase activity(GO:0003941) |
0.4 | 1.3 | GO:0005094 | Rho GDP-dissociation inhibitor activity(GO:0005094) |
0.4 | 1.3 | GO:0008321 | Ral guanyl-nucleotide exchange factor activity(GO:0008321) |
0.4 | 3.0 | GO:0005000 | vasopressin receptor activity(GO:0005000) |
0.4 | 2.1 | GO:0008526 | phosphatidylinositol transporter activity(GO:0008526) |
0.4 | 5.4 | GO:0031005 | filamin binding(GO:0031005) |
0.4 | 2.1 | GO:0017169 | CDP-alcohol phosphatidyltransferase activity(GO:0017169) |
0.4 | 4.8 | GO:0004535 | poly(A)-specific ribonuclease activity(GO:0004535) |
0.4 | 1.6 | GO:0000386 | second spliceosomal transesterification activity(GO:0000386) |
0.4 | 1.2 | GO:0017116 | single-stranded DNA-dependent ATP-dependent DNA helicase activity(GO:0017116) |
0.4 | 1.9 | GO:0070061 | fructose binding(GO:0070061) |
0.4 | 2.3 | GO:0047498 | calcium-dependent phospholipase A2 activity(GO:0047498) |
0.3 | 4.4 | GO:0005159 | insulin-like growth factor receptor binding(GO:0005159) |
0.3 | 0.6 | GO:0010997 | anaphase-promoting complex binding(GO:0010997) |
0.3 | 1.6 | GO:0008273 | calcium, potassium:sodium antiporter activity(GO:0008273) |
0.3 | 1.2 | GO:0019834 | phospholipase A2 inhibitor activity(GO:0019834) |
0.3 | 0.3 | GO:0046976 | histone methyltransferase activity (H3-K27 specific)(GO:0046976) |
0.3 | 4.0 | GO:0005542 | folic acid binding(GO:0005542) |
0.3 | 5.8 | GO:0003746 | translation elongation factor activity(GO:0003746) |
0.3 | 1.2 | GO:0003945 | N-acetyllactosamine synthase activity(GO:0003945) |
0.3 | 1.2 | GO:0043559 | insulin binding(GO:0043559) |
0.3 | 2.7 | GO:0042500 | aspartic endopeptidase activity, intramembrane cleaving(GO:0042500) |
0.3 | 1.2 | GO:0038064 | collagen receptor activity(GO:0038064) |
0.3 | 7.3 | GO:0019706 | protein-cysteine S-palmitoyltransferase activity(GO:0019706) |
0.3 | 2.6 | GO:0034821 | pinocarveol dehydrogenase activity(GO:0018446) chloral hydrate dehydrogenase activity(GO:0018447) hydroxymethylmethylsilanediol oxidase activity(GO:0018448) 1-phenylethanol dehydrogenase activity(GO:0018449) myrtenol dehydrogenase activity(GO:0018450) cis-1,2-dihydroxy-1,2-dihydro-8-carboxynaphthalene dehydrogenase activity(GO:0034522) 3-hydroxy-4-methyloctanoyl-CoA dehydrogenase activity(GO:0034582) 2-hydroxy-4-isopropenylcyclohexane-1-carboxyl-CoA dehydrogenase activity(GO:0034778) cis-9,10-dihydroanthracene-9,10-diol dehydrogenase activity(GO:0034817) citronellol dehydrogenase activity(GO:0034821) naphthyl-2-hydroxymethyl-succinyl-CoA dehydrogenase activity(GO:0034847) 2,4,4-trimethyl-1-pentanol dehydrogenase activity(GO:0034863) 2,4,4-trimethyl-3-hydroxypentanoyl-CoA dehydrogenase activity(GO:0034868) 1-hydroxy-4,4-dimethylpentan-3-one dehydrogenase activity(GO:0034871) endosulfan diol dehydrogenase activity(GO:0034891) endosulfan hydroxyether dehydrogenase activity(GO:0034901) 3-hydroxy-2-methylhexanoyl-CoA dehydrogenase activity(GO:0034918) 3-hydroxy-2,6-dimethyl-5-methylene-heptanoyl-CoA dehydrogenase activity(GO:0034944) versicolorin reductase activity(GO:0042469) ketoreductase activity(GO:0045703) |
0.3 | 0.9 | GO:1990825 | sequence-specific mRNA binding(GO:1990825) |
0.3 | 2.5 | GO:0035256 | G-protein coupled glutamate receptor binding(GO:0035256) |
0.3 | 1.1 | GO:0022833 | mechanically-gated ion channel activity(GO:0008381) mechanically gated channel activity(GO:0022833) |
0.3 | 1.1 | GO:0004090 | carbonyl reductase (NADPH) activity(GO:0004090) |
0.3 | 1.4 | GO:0004689 | phosphorylase kinase activity(GO:0004689) |
0.3 | 0.8 | GO:0001069 | regulatory region RNA binding(GO:0001069) |
0.3 | 0.8 | GO:0005220 | inositol 1,4,5-trisphosphate-sensitive calcium-release channel activity(GO:0005220) |
0.3 | 7.8 | GO:0042974 | retinoic acid receptor binding(GO:0042974) |
0.3 | 1.1 | GO:0070053 | thrombospondin receptor activity(GO:0070053) |
0.3 | 1.3 | GO:0090482 | vitamin transmembrane transporter activity(GO:0090482) |
0.3 | 1.0 | GO:0033192 | calmodulin-dependent protein phosphatase activity(GO:0033192) |
0.3 | 2.3 | GO:0048027 | mRNA 5'-UTR binding(GO:0048027) |
0.3 | 1.3 | GO:0009378 | four-way junction helicase activity(GO:0009378) |
0.3 | 2.3 | GO:0017166 | vinculin binding(GO:0017166) |
0.2 | 0.2 | GO:0015189 | arginine transmembrane transporter activity(GO:0015181) L-lysine transmembrane transporter activity(GO:0015189) |
0.2 | 2.0 | GO:0003841 | 1-acylglycerol-3-phosphate O-acyltransferase activity(GO:0003841) |
0.2 | 1.0 | GO:0015375 | glycine:sodium symporter activity(GO:0015375) |
0.2 | 0.7 | GO:0005502 | 11-cis retinal binding(GO:0005502) |
0.2 | 1.2 | GO:0008454 | alpha-1,3-mannosylglycoprotein 4-beta-N-acetylglucosaminyltransferase activity(GO:0008454) |
0.2 | 0.2 | GO:0000405 | bubble DNA binding(GO:0000405) |
0.2 | 2.4 | GO:0031702 | type 1 angiotensin receptor binding(GO:0031702) |
0.2 | 0.2 | GO:0030375 | thyroid hormone receptor coactivator activity(GO:0030375) |
0.2 | 1.0 | GO:0015057 | thrombin receptor activity(GO:0015057) |
0.2 | 1.6 | GO:0035612 | AP-2 adaptor complex binding(GO:0035612) |
0.2 | 1.4 | GO:0032554 | purine deoxyribonucleotide binding(GO:0032554) |
0.2 | 0.9 | GO:0016401 | palmitoyl-CoA oxidase activity(GO:0016401) |
0.2 | 0.5 | GO:0016634 | oxidoreductase activity, acting on the CH-CH group of donors, oxygen as acceptor(GO:0016634) |
0.2 | 2.8 | GO:0005123 | death receptor binding(GO:0005123) |
0.2 | 1.4 | GO:0070991 | medium-chain-acyl-CoA dehydrogenase activity(GO:0070991) |
0.2 | 0.2 | GO:0001224 | RNA polymerase II transcription cofactor binding(GO:0001224) |
0.2 | 0.4 | GO:1902282 | voltage-gated potassium channel activity involved in ventricular cardiac muscle cell action potential repolarization(GO:1902282) |
0.2 | 1.1 | GO:0004945 | angiotensin type II receptor activity(GO:0004945) |
0.2 | 0.9 | GO:0046935 | 1-phosphatidylinositol-3-kinase regulator activity(GO:0046935) |
0.2 | 0.9 | GO:0030984 | kininogen binding(GO:0030984) |
0.2 | 1.5 | GO:0003836 | beta-galactoside (CMP) alpha-2,3-sialyltransferase activity(GO:0003836) |
0.2 | 0.8 | GO:0003916 | DNA topoisomerase activity(GO:0003916) |
0.2 | 1.3 | GO:0008420 | CTD phosphatase activity(GO:0008420) |
0.2 | 1.0 | GO:0097322 | 7SK snRNA binding(GO:0097322) |
0.2 | 3.9 | GO:0008157 | protein phosphatase 1 binding(GO:0008157) |
0.2 | 0.6 | GO:0050692 | DBD domain binding(GO:0050692) |
0.2 | 2.2 | GO:0005337 | nucleoside transmembrane transporter activity(GO:0005337) |
0.2 | 1.6 | GO:0102391 | decanoate--CoA ligase activity(GO:0102391) |
0.2 | 0.8 | GO:0005168 | neurotrophin TRKA receptor binding(GO:0005168) |
0.2 | 0.2 | GO:0071208 | histone pre-mRNA DCP binding(GO:0071208) |
0.2 | 2.1 | GO:0044548 | S100 protein binding(GO:0044548) |
0.2 | 1.9 | GO:0070034 | telomerase RNA binding(GO:0070034) |
0.2 | 0.8 | GO:0050897 | cobalt ion binding(GO:0050897) |
0.2 | 4.3 | GO:0030515 | snoRNA binding(GO:0030515) |
0.2 | 0.6 | GO:0008597 | calcium-dependent protein serine/threonine phosphatase regulator activity(GO:0008597) |
0.2 | 0.4 | GO:0031698 | beta-2 adrenergic receptor binding(GO:0031698) |
0.2 | 0.7 | GO:0004095 | carnitine O-palmitoyltransferase activity(GO:0004095) |
0.2 | 0.7 | GO:0004046 | aminoacylase activity(GO:0004046) |
0.2 | 0.4 | GO:0004887 | thyroid hormone receptor activity(GO:0004887) |
0.2 | 1.3 | GO:0030306 | ADP-ribosylation factor binding(GO:0030306) |
0.2 | 2.7 | GO:0016290 | palmitoyl-CoA hydrolase activity(GO:0016290) |
0.2 | 1.6 | GO:0008093 | cytoskeletal adaptor activity(GO:0008093) |
0.2 | 0.7 | GO:0004792 | thiosulfate sulfurtransferase activity(GO:0004792) |
0.2 | 0.4 | GO:0031711 | bradykinin receptor binding(GO:0031711) |
0.2 | 0.5 | GO:0042134 | rRNA primary transcript binding(GO:0042134) |
0.2 | 2.1 | GO:0001972 | retinoic acid binding(GO:0001972) |
0.2 | 7.3 | GO:0005044 | scavenger receptor activity(GO:0005044) |
0.2 | 1.1 | GO:0046974 | histone methyltransferase activity (H3-K9 specific)(GO:0046974) |
0.2 | 0.5 | GO:1990829 | C-rich single-stranded DNA binding(GO:1990829) |
0.2 | 0.5 | GO:0055100 | adiponectin binding(GO:0055100) |
0.2 | 0.5 | GO:0033592 | RNA strand annealing activity(GO:0033592) |
0.2 | 0.5 | GO:0070548 | L-glutamine aminotransferase activity(GO:0070548) |
0.2 | 0.3 | GO:0042979 | ornithine decarboxylase regulator activity(GO:0042979) |
0.2 | 0.5 | GO:0004605 | phosphatidate cytidylyltransferase activity(GO:0004605) |
0.2 | 1.0 | GO:0043912 | D-lysine oxidase activity(GO:0043912) |
0.2 | 0.3 | GO:0098821 | BMP receptor activity(GO:0098821) |
0.2 | 2.8 | GO:1900750 | glutathione binding(GO:0043295) oligopeptide binding(GO:1900750) |
0.2 | 1.0 | GO:0017070 | U6 snRNA binding(GO:0017070) |
0.2 | 1.2 | GO:0043208 | glycosphingolipid binding(GO:0043208) |
0.2 | 0.7 | GO:0017162 | aryl hydrocarbon receptor binding(GO:0017162) |
0.2 | 1.2 | GO:0043522 | leucine zipper domain binding(GO:0043522) |
0.2 | 0.5 | GO:0004104 | cholinesterase activity(GO:0004104) |
0.2 | 0.8 | GO:0019863 | IgE binding(GO:0019863) |
0.2 | 1.5 | GO:0030983 | mismatched DNA binding(GO:0030983) |
0.2 | 0.3 | GO:0003831 | beta-N-acetylglucosaminylglycopeptide beta-1,4-galactosyltransferase activity(GO:0003831) |
0.2 | 0.2 | GO:0032422 | purine-rich negative regulatory element binding(GO:0032422) |
0.2 | 0.5 | GO:0004616 | phosphogluconate dehydrogenase (decarboxylating) activity(GO:0004616) |
0.2 | 0.8 | GO:0051371 | muscle alpha-actinin binding(GO:0051371) |
0.2 | 0.3 | GO:0043533 | inositol 1,3,4,5 tetrakisphosphate binding(GO:0043533) |
0.2 | 0.2 | GO:0070573 | metallodipeptidase activity(GO:0070573) |
0.2 | 0.6 | GO:0004459 | L-lactate dehydrogenase activity(GO:0004459) |
0.2 | 2.3 | GO:0070064 | proline-rich region binding(GO:0070064) |
0.2 | 1.1 | GO:0003680 | AT DNA binding(GO:0003680) |
0.2 | 0.8 | GO:0035184 | histone threonine kinase activity(GO:0035184) |
0.2 | 2.8 | GO:0001530 | lipopolysaccharide binding(GO:0001530) |
0.2 | 0.6 | GO:0031721 | hemoglobin alpha binding(GO:0031721) |
0.1 | 0.4 | GO:0036033 | mediator complex binding(GO:0036033) |
0.1 | 0.4 | GO:0015319 | sodium:inorganic phosphate symporter activity(GO:0015319) |
0.1 | 4.0 | GO:0035035 | histone acetyltransferase binding(GO:0035035) |
0.1 | 0.6 | GO:0035276 | ethanol binding(GO:0035276) |
0.1 | 4.9 | GO:0005484 | SNAP receptor activity(GO:0005484) |
0.1 | 1.0 | GO:0070097 | delta-catenin binding(GO:0070097) |
0.1 | 1.6 | GO:0010314 | phosphatidylinositol-5-phosphate binding(GO:0010314) |
0.1 | 0.6 | GO:0009374 | biotin binding(GO:0009374) |
0.1 | 0.7 | GO:0019784 | NEDD8-specific protease activity(GO:0019784) |
0.1 | 1.7 | GO:0035259 | glucocorticoid receptor binding(GO:0035259) |
0.1 | 1.0 | GO:0005068 | transmembrane receptor protein tyrosine kinase adaptor activity(GO:0005068) |
0.1 | 1.5 | GO:0003906 | DNA-(apurinic or apyrimidinic site) lyase activity(GO:0003906) |
0.1 | 0.4 | GO:0035651 | AP-3 adaptor complex binding(GO:0035651) |
0.1 | 0.5 | GO:0010521 | telomerase inhibitor activity(GO:0010521) |
0.1 | 0.7 | GO:0008097 | 5S rRNA binding(GO:0008097) |
0.1 | 0.8 | GO:0070191 | methionine-R-sulfoxide reductase activity(GO:0070191) |
0.1 | 1.5 | GO:0070700 | BMP receptor binding(GO:0070700) |
0.1 | 0.9 | GO:0050291 | sphingosine N-acyltransferase activity(GO:0050291) |
0.1 | 1.3 | GO:0048185 | activin binding(GO:0048185) |
0.1 | 1.7 | GO:0030676 | Rac guanyl-nucleotide exchange factor activity(GO:0030676) |
0.1 | 3.7 | GO:0017112 | Rab guanyl-nucleotide exchange factor activity(GO:0017112) |
0.1 | 0.1 | GO:0016436 | rRNA methyltransferase activity(GO:0008649) rRNA (uridine) methyltransferase activity(GO:0016436) |
0.1 | 2.5 | GO:0030506 | ankyrin binding(GO:0030506) |
0.1 | 0.5 | GO:0000213 | tRNA-intron endonuclease activity(GO:0000213) |
0.1 | 0.8 | GO:0015288 | porin activity(GO:0015288) |
0.1 | 2.7 | GO:0004129 | cytochrome-c oxidase activity(GO:0004129) heme-copper terminal oxidase activity(GO:0015002) oxidoreductase activity, acting on a heme group of donors, oxygen as acceptor(GO:0016676) |
0.1 | 0.9 | GO:0000900 | translation repressor activity, nucleic acid binding(GO:0000900) |
0.1 | 0.1 | GO:0015927 | trehalase activity(GO:0015927) |
0.1 | 1.3 | GO:0070180 | large ribosomal subunit rRNA binding(GO:0070180) |
0.1 | 0.8 | GO:0018741 | alkyl sulfatase activity(GO:0018741) endosulfan hemisulfate sulfatase activity(GO:0034889) endosulfan sulfate hydrolase activity(GO:0034902) |
0.1 | 0.5 | GO:0008865 | fructokinase activity(GO:0008865) mannokinase activity(GO:0019158) |
0.1 | 0.5 | GO:0070883 | pre-miRNA binding(GO:0070883) |
0.1 | 0.4 | GO:0004705 | JUN kinase activity(GO:0004705) SAP kinase activity(GO:0016909) |
0.1 | 1.2 | GO:0070410 | co-SMAD binding(GO:0070410) |
0.1 | 0.4 | GO:1990226 | histone methyltransferase binding(GO:1990226) |
0.1 | 2.7 | GO:0000062 | fatty-acyl-CoA binding(GO:0000062) |
0.1 | 0.1 | GO:0008413 | 8-oxo-7,8-dihydroguanosine triphosphate pyrophosphatase activity(GO:0008413) |
0.1 | 0.5 | GO:0036310 | annealing helicase activity(GO:0036310) |
0.1 | 0.5 | GO:0036374 | gamma-glutamyltransferase activity(GO:0003840) glutathione hydrolase activity(GO:0036374) |
0.1 | 0.5 | GO:0005315 | inorganic phosphate transmembrane transporter activity(GO:0005315) |
0.1 | 0.4 | GO:0032557 | pyrimidine ribonucleotide binding(GO:0032557) |
0.1 | 0.6 | GO:0047499 | calcium-independent phospholipase A2 activity(GO:0047499) |
0.1 | 0.5 | GO:0004749 | ribose phosphate diphosphokinase activity(GO:0004749) |
0.1 | 5.8 | GO:0000979 | RNA polymerase II core promoter sequence-specific DNA binding(GO:0000979) |
0.1 | 0.6 | GO:0003933 | GTP cyclohydrolase activity(GO:0003933) |
0.1 | 9.3 | GO:0005178 | integrin binding(GO:0005178) |
0.1 | 0.9 | GO:0030955 | potassium ion binding(GO:0030955) |
0.1 | 0.6 | GO:0004758 | serine C-palmitoyltransferase activity(GO:0004758) |
0.1 | 0.9 | GO:0071933 | Arp2/3 complex binding(GO:0071933) |
0.1 | 4.2 | GO:0005109 | frizzled binding(GO:0005109) |
0.1 | 0.8 | GO:0004385 | guanylate kinase activity(GO:0004385) |
0.1 | 0.4 | GO:0051431 | corticotropin-releasing hormone receptor 2 binding(GO:0051431) |
0.1 | 2.9 | GO:0016538 | cyclin-dependent protein serine/threonine kinase regulator activity(GO:0016538) |
0.1 | 0.7 | GO:0016176 | superoxide-generating NADPH oxidase activator activity(GO:0016176) |
0.1 | 0.3 | GO:0072542 | protein phosphatase activator activity(GO:0072542) |
0.1 | 1.2 | GO:0035497 | cAMP response element binding(GO:0035497) |
0.1 | 0.1 | GO:0001884 | pyrimidine nucleoside binding(GO:0001884) |
0.1 | 2.3 | GO:0004364 | glutathione transferase activity(GO:0004364) |
0.1 | 3.1 | GO:0004693 | cyclin-dependent protein serine/threonine kinase activity(GO:0004693) cyclin-dependent protein kinase activity(GO:0097472) |
0.1 | 0.6 | GO:0035925 | mRNA 3'-UTR AU-rich region binding(GO:0035925) |
0.1 | 0.5 | GO:0000064 | L-ornithine transmembrane transporter activity(GO:0000064) |
0.1 | 1.2 | GO:0016813 | hydrolase activity, acting on carbon-nitrogen (but not peptide) bonds, in linear amidines(GO:0016813) |
0.1 | 0.1 | GO:0003986 | acetyl-CoA hydrolase activity(GO:0003986) |
0.1 | 0.2 | GO:0045340 | mercury ion binding(GO:0045340) |
0.1 | 0.4 | GO:0070087 | chromo shadow domain binding(GO:0070087) |
0.1 | 0.7 | GO:0015280 | ligand-gated sodium channel activity(GO:0015280) |
0.1 | 3.6 | GO:0004180 | carboxypeptidase activity(GO:0004180) |
0.1 | 0.4 | GO:0030942 | endoplasmic reticulum signal peptide binding(GO:0030942) |
0.1 | 1.3 | GO:0004745 | retinol dehydrogenase activity(GO:0004745) |
0.1 | 0.6 | GO:0008199 | ferric iron binding(GO:0008199) |
0.1 | 0.3 | GO:0070653 | high-density lipoprotein particle receptor binding(GO:0070653) |
0.1 | 0.1 | GO:0004457 | lactate dehydrogenase activity(GO:0004457) |
0.1 | 0.4 | GO:0003873 | 6-phosphofructo-2-kinase activity(GO:0003873) |
0.1 | 0.1 | GO:0030350 | iron-responsive element binding(GO:0030350) |
0.1 | 0.3 | GO:0008260 | 3-oxoacid CoA-transferase activity(GO:0008260) |
0.1 | 0.1 | GO:0031489 | myosin V binding(GO:0031489) |
0.1 | 0.6 | GO:0043814 | CTP:2,3-di-O-geranylgeranyl-sn-glycero-1-phosphate cytidyltransferase activity(GO:0043338) phospholactate guanylyltransferase activity(GO:0043814) ATP:coenzyme F420 adenylyltransferase activity(GO:0043910) UDP-N-acetylgalactosamine diphosphorylase activity(GO:0052630) |
0.1 | 0.3 | GO:1990460 | leptin receptor binding(GO:1990460) |
0.1 | 0.2 | GO:0043423 | 3-phosphoinositide-dependent protein kinase binding(GO:0043423) |
0.1 | 0.3 | GO:1901612 | cardiolipin binding(GO:1901612) |
0.1 | 0.3 | GO:0004438 | phosphatidylinositol-3-phosphatase activity(GO:0004438) |
0.1 | 1.0 | GO:0048407 | platelet-derived growth factor binding(GO:0048407) |
0.1 | 0.9 | GO:0016215 | acyl-CoA desaturase activity(GO:0016215) |
0.1 | 0.4 | GO:0002046 | opsin binding(GO:0002046) |
0.1 | 0.9 | GO:0008191 | metalloendopeptidase inhibitor activity(GO:0008191) |
0.1 | 0.5 | GO:0017034 | Rap guanyl-nucleotide exchange factor activity(GO:0017034) |
0.1 | 0.4 | GO:0017089 | glycolipid transporter activity(GO:0017089) |
0.1 | 1.2 | GO:0055103 | ligase regulator activity(GO:0055103) |
0.1 | 0.8 | GO:0051010 | microtubule plus-end binding(GO:0051010) |
0.1 | 0.4 | GO:0043138 | 3'-5' DNA helicase activity(GO:0043138) |
0.1 | 0.3 | GO:0016838 | carbon-oxygen lyase activity, acting on phosphates(GO:0016838) |
0.1 | 0.2 | GO:0016151 | nickel cation binding(GO:0016151) |
0.1 | 0.4 | GO:0004126 | cytidine deaminase activity(GO:0004126) |
0.1 | 0.8 | GO:0016671 | oxidoreductase activity, acting on a sulfur group of donors, disulfide as acceptor(GO:0016671) |
0.1 | 0.2 | GO:0004939 | beta-adrenergic receptor activity(GO:0004939) |
0.1 | 2.8 | GO:0052634 | sulfonate dioxygenase activity(GO:0000907) 2,4-dichlorophenoxyacetate alpha-ketoglutarate dioxygenase activity(GO:0018602) hypophosphite dioxygenase activity(GO:0034792) gibberellin 2-beta-dioxygenase activity(GO:0045543) C-19 gibberellin 2-beta-dioxygenase activity(GO:0052634) C-20 gibberellin 2-beta-dioxygenase activity(GO:0052635) |
0.1 | 0.6 | GO:0008353 | RNA polymerase II carboxy-terminal domain kinase activity(GO:0008353) |
0.1 | 0.5 | GO:0032052 | bile acid binding(GO:0032052) |
0.1 | 0.2 | GO:0031686 | A1 adenosine receptor binding(GO:0031686) |
0.1 | 0.4 | GO:0000104 | succinate dehydrogenase activity(GO:0000104) |
0.1 | 1.0 | GO:0035198 | miRNA binding(GO:0035198) |
0.1 | 0.4 | GO:0043560 | insulin receptor substrate binding(GO:0043560) |
0.1 | 0.3 | GO:0031435 | mitogen-activated protein kinase kinase kinase binding(GO:0031435) |
0.1 | 4.2 | GO:0005200 | structural constituent of cytoskeleton(GO:0005200) |
0.1 | 0.1 | GO:0031701 | angiotensin receptor binding(GO:0031701) |
0.1 | 0.3 | GO:1990430 | extracellular matrix protein binding(GO:1990430) |
0.1 | 0.6 | GO:0001091 | RNA polymerase II basal transcription factor binding(GO:0001091) |
0.1 | 0.3 | GO:0004703 | G-protein coupled receptor kinase activity(GO:0004703) |
0.1 | 0.3 | GO:0051434 | BH3 domain binding(GO:0051434) |
0.1 | 0.3 | GO:0004663 | Rab geranylgeranyltransferase activity(GO:0004663) |
0.1 | 0.8 | GO:0042577 | lipid phosphatase activity(GO:0042577) |
0.1 | 0.3 | GO:0004832 | valine-tRNA ligase activity(GO:0004832) |
0.1 | 2.1 | GO:0051721 | protein phosphatase 2A binding(GO:0051721) |
0.1 | 0.2 | GO:0005001 | transmembrane receptor protein tyrosine phosphatase activity(GO:0005001) |
0.1 | 1.2 | GO:0008266 | poly(U) RNA binding(GO:0008266) |
0.1 | 0.5 | GO:0008603 | cAMP-dependent protein kinase regulator activity(GO:0008603) |
0.1 | 0.8 | GO:0016780 | phosphotransferase activity, for other substituted phosphate groups(GO:0016780) |
0.1 | 0.2 | GO:0032552 | deoxyribonucleotide binding(GO:0032552) |
0.1 | 0.4 | GO:0008140 | cAMP response element binding protein binding(GO:0008140) |
0.1 | 1.0 | GO:0017160 | Ral GTPase binding(GO:0017160) |
0.1 | 0.4 | GO:0005007 | fibroblast growth factor-activated receptor activity(GO:0005007) |
0.1 | 0.7 | GO:0004499 | N,N-dimethylaniline monooxygenase activity(GO:0004499) |
0.1 | 0.4 | GO:0035381 | extracellular ATP-gated cation channel activity(GO:0004931) ATP-gated ion channel activity(GO:0035381) |
0.1 | 4.1 | GO:0019003 | GDP binding(GO:0019003) |
0.1 | 1.8 | GO:0042169 | SH2 domain binding(GO:0042169) |
0.1 | 1.5 | GO:0003887 | DNA-directed DNA polymerase activity(GO:0003887) |
0.1 | 1.1 | GO:0004697 | protein kinase C activity(GO:0004697) |
0.1 | 0.6 | GO:0015266 | protein channel activity(GO:0015266) |
0.1 | 0.5 | GO:0001609 | G-protein coupled adenosine receptor activity(GO:0001609) |
0.1 | 0.3 | GO:0046975 | histone methyltransferase activity (H3-K36 specific)(GO:0046975) |
0.1 | 1.2 | GO:0071889 | 14-3-3 protein binding(GO:0071889) |
0.1 | 0.3 | GO:0004301 | epoxide hydrolase activity(GO:0004301) |
0.1 | 2.6 | GO:0003684 | damaged DNA binding(GO:0003684) |
0.1 | 0.2 | GO:0004468 | lysine N-acetyltransferase activity, acting on acetyl phosphate as donor(GO:0004468) |
0.1 | 0.1 | GO:0030911 | TPR domain binding(GO:0030911) |
0.1 | 0.4 | GO:0034481 | chondroitin sulfotransferase activity(GO:0034481) |
0.1 | 6.7 | GO:0004725 | protein tyrosine phosphatase activity(GO:0004725) |
0.1 | 0.5 | GO:0032050 | clathrin heavy chain binding(GO:0032050) |
0.1 | 0.2 | GO:0061513 | hexose phosphate transmembrane transporter activity(GO:0015119) organophosphate:inorganic phosphate antiporter activity(GO:0015315) hexose-phosphate:inorganic phosphate antiporter activity(GO:0015526) glucose 6-phosphate:inorganic phosphate antiporter activity(GO:0061513) |
0.1 | 0.9 | GO:0001054 | RNA polymerase I activity(GO:0001054) |
0.1 | 0.2 | GO:0050833 | pyruvate transmembrane transporter activity(GO:0050833) |
0.1 | 0.3 | GO:0030371 | translation repressor activity(GO:0030371) |
0.1 | 0.1 | GO:0051765 | inositol tetrakisphosphate kinase activity(GO:0051765) |
0.1 | 0.8 | GO:1901505 | carbohydrate derivative transporter activity(GO:1901505) |
0.1 | 0.1 | GO:0038085 | vascular endothelial growth factor binding(GO:0038085) |
0.1 | 0.2 | GO:0050309 | glucose-6-phosphatase activity(GO:0004346) sugar-terminal-phosphatase activity(GO:0050309) |
0.1 | 0.4 | GO:0046624 | sphingolipid transporter activity(GO:0046624) |
0.1 | 0.2 | GO:0008320 | protein transmembrane transporter activity(GO:0008320) |
0.1 | 0.1 | GO:0097200 | cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:0097200) |
0.1 | 0.4 | GO:0008195 | phosphatidate phosphatase activity(GO:0008195) |
0.1 | 0.4 | GO:0070008 | serine-type exopeptidase activity(GO:0070008) |
0.1 | 0.2 | GO:0031735 | CCR10 chemokine receptor binding(GO:0031735) |
0.1 | 0.2 | GO:0001595 | angiotensin receptor activity(GO:0001595) |
0.1 | 0.2 | GO:0008107 | galactoside 2-alpha-L-fucosyltransferase activity(GO:0008107) alpha-(1,2)-fucosyltransferase activity(GO:0031127) |
0.1 | 1.0 | GO:0004089 | carbonate dehydratase activity(GO:0004089) |
0.1 | 0.4 | GO:0008440 | inositol-1,4,5-trisphosphate 3-kinase activity(GO:0008440) |
0.1 | 0.6 | GO:0001013 | RNA polymerase I regulatory region DNA binding(GO:0001013) |
0.1 | 0.6 | GO:0050321 | tau-protein kinase activity(GO:0050321) |
0.1 | 0.1 | GO:0061676 | importin-alpha family protein binding(GO:0061676) |
0.1 | 2.6 | GO:0005544 | calcium-dependent phospholipid binding(GO:0005544) |
0.1 | 0.6 | GO:0070273 | phosphatidylinositol-4-phosphate binding(GO:0070273) |
0.1 | 0.3 | GO:0005412 | glucose:sodium symporter activity(GO:0005412) |
0.1 | 0.2 | GO:0043199 | sulfate binding(GO:0043199) |
0.1 | 0.5 | GO:0016670 | oxidoreductase activity, acting on a sulfur group of donors, oxygen as acceptor(GO:0016670) |
0.1 | 0.3 | GO:0042015 | interleukin-20 binding(GO:0042015) |
0.1 | 0.2 | GO:0030899 | calcium-dependent ATPase activity(GO:0030899) |
0.1 | 0.1 | GO:0034617 | tetrahydrobiopterin binding(GO:0034617) |
0.1 | 0.3 | GO:0030346 | protein phosphatase 2B binding(GO:0030346) |
0.1 | 0.1 | GO:0001515 | opioid peptide activity(GO:0001515) |
0.1 | 0.1 | GO:1901677 | phosphate transmembrane transporter activity(GO:1901677) |
0.1 | 0.6 | GO:0051787 | misfolded protein binding(GO:0051787) |
0.1 | 0.9 | GO:0005520 | insulin-like growth factor binding(GO:0005520) |
0.1 | 0.2 | GO:0061665 | SUMO ligase activity(GO:0061665) |
0.1 | 0.3 | GO:0019763 | immunoglobulin receptor activity(GO:0019763) |
0.1 | 0.9 | GO:1990939 | ATP-dependent microtubule motor activity(GO:1990939) |
0.1 | 0.8 | GO:0008553 | hydrogen-exporting ATPase activity, phosphorylative mechanism(GO:0008553) |
0.1 | 0.1 | GO:0009019 | tRNA (guanine-N1-)-methyltransferase activity(GO:0009019) |
0.1 | 0.2 | GO:0019166 | trans-2-enoyl-CoA reductase (NADPH) activity(GO:0019166) |
0.1 | 0.1 | GO:0051380 | norepinephrine binding(GO:0051380) |
0.1 | 0.4 | GO:0048531 | beta-1,3-galactosyltransferase activity(GO:0048531) |
0.1 | 0.2 | GO:0070569 | uridylyltransferase activity(GO:0070569) |
0.1 | 2.8 | GO:0061733 | peptide-lysine-N-acetyltransferase activity(GO:0061733) |
0.1 | 0.2 | GO:0030492 | hemoglobin binding(GO:0030492) |
0.1 | 0.3 | GO:0097371 | MDM2/MDM4 family protein binding(GO:0097371) |
0.1 | 0.1 | GO:0015142 | citrate transmembrane transporter activity(GO:0015137) tricarboxylic acid transmembrane transporter activity(GO:0015142) |
0.1 | 0.2 | GO:0004366 | glycerol-3-phosphate O-acyltransferase activity(GO:0004366) |
0.1 | 0.1 | GO:0004859 | phospholipase inhibitor activity(GO:0004859) |
0.1 | 0.2 | GO:0015173 | aromatic amino acid transmembrane transporter activity(GO:0015173) |
0.1 | 0.5 | GO:0008601 | protein phosphatase type 2A regulator activity(GO:0008601) |
0.1 | 0.2 | GO:0003726 | double-stranded RNA adenosine deaminase activity(GO:0003726) |
0.1 | 0.4 | GO:0050733 | RS domain binding(GO:0050733) |
0.1 | 0.2 | GO:0004694 | eukaryotic translation initiation factor 2alpha kinase activity(GO:0004694) |
0.1 | 0.5 | GO:0008331 | high voltage-gated calcium channel activity(GO:0008331) |
0.1 | 0.2 | GO:0000293 | ferric-chelate reductase activity(GO:0000293) |
0.1 | 0.5 | GO:0005172 | vascular endothelial growth factor receptor binding(GO:0005172) |
0.1 | 0.3 | GO:0004675 | transmembrane receptor protein serine/threonine kinase activity(GO:0004675) |
0.1 | 0.1 | GO:0019959 | interleukin-8 binding(GO:0019959) |
0.1 | 0.3 | GO:0070290 | N-acylphosphatidylethanolamine-specific phospholipase D activity(GO:0070290) |
0.1 | 0.6 | GO:0005451 | monovalent cation:proton antiporter activity(GO:0005451) |
0.1 | 0.2 | GO:0032794 | GTPase activating protein binding(GO:0032794) |
0.1 | 0.1 | GO:0015928 | fucosidase activity(GO:0015928) |
0.1 | 1.1 | GO:0004198 | calcium-dependent cysteine-type endopeptidase activity(GO:0004198) |
0.1 | 1.8 | GO:0050840 | extracellular matrix binding(GO:0050840) |
0.1 | 0.2 | GO:0051864 | histone demethylase activity (H3-K36 specific)(GO:0051864) |
0.1 | 0.2 | GO:0004345 | glucose-6-phosphate dehydrogenase activity(GO:0004345) |
0.1 | 0.7 | GO:0005521 | lamin binding(GO:0005521) |
0.1 | 0.3 | GO:0004111 | creatine kinase activity(GO:0004111) |
0.1 | 0.2 | GO:0004813 | alanine-tRNA ligase activity(GO:0004813) |
0.1 | 0.1 | GO:0004427 | inorganic diphosphatase activity(GO:0004427) |
0.1 | 0.1 | GO:0034618 | arginine binding(GO:0034618) |
0.1 | 0.3 | GO:0051920 | peroxiredoxin activity(GO:0051920) |
0.1 | 0.4 | GO:0008253 | 5'-nucleotidase activity(GO:0008253) |
0.1 | 0.1 | GO:0008240 | tripeptidyl-peptidase activity(GO:0008240) |
0.1 | 1.6 | GO:0004722 | protein serine/threonine phosphatase activity(GO:0004722) |
0.1 | 0.2 | GO:0005143 | interleukin-12 receptor binding(GO:0005143) |
0.1 | 0.1 | GO:0003964 | telomerase activity(GO:0003720) RNA-directed DNA polymerase activity(GO:0003964) |
0.1 | 0.4 | GO:0001608 | G-protein coupled nucleotide receptor activity(GO:0001608) G-protein coupled purinergic nucleotide receptor activity(GO:0045028) |
0.1 | 0.4 | GO:0044213 | intronic transcription regulatory region DNA binding(GO:0044213) |
0.1 | 0.8 | GO:0004653 | polypeptide N-acetylgalactosaminyltransferase activity(GO:0004653) |
0.1 | 0.3 | GO:0008508 | bile acid:sodium symporter activity(GO:0008508) |
0.1 | 0.6 | GO:0046703 | natural killer cell lectin-like receptor binding(GO:0046703) |
0.1 | 0.2 | GO:0015141 | succinate transmembrane transporter activity(GO:0015141) |
0.1 | 0.4 | GO:0008301 | DNA binding, bending(GO:0008301) |
0.1 | 2.4 | GO:0004869 | cysteine-type endopeptidase inhibitor activity(GO:0004869) |
0.1 | 0.2 | GO:0016802 | adenosylhomocysteinase activity(GO:0004013) trialkylsulfonium hydrolase activity(GO:0016802) |
0.1 | 0.2 | GO:0071253 | connexin binding(GO:0071253) |
0.1 | 0.1 | GO:0038100 | nodal binding(GO:0038100) |
0.1 | 0.1 | GO:0005176 | ErbB-2 class receptor binding(GO:0005176) |
0.1 | 0.2 | GO:0051021 | GDP-dissociation inhibitor binding(GO:0051021) Rho GDP-dissociation inhibitor binding(GO:0051022) |
0.1 | 0.2 | GO:0004740 | pyruvate dehydrogenase (acetyl-transferring) kinase activity(GO:0004740) |
0.1 | 0.5 | GO:0034450 | ubiquitin-ubiquitin ligase activity(GO:0034450) |
0.1 | 0.5 | GO:0070402 | NADPH binding(GO:0070402) |
0.1 | 0.6 | GO:0044183 | protein binding involved in protein folding(GO:0044183) |
0.1 | 2.4 | GO:0008392 | arachidonic acid epoxygenase activity(GO:0008392) |
0.1 | 0.8 | GO:0016646 | oxidoreductase activity, acting on the CH-NH group of donors, NAD or NADP as acceptor(GO:0016646) |
0.1 | 0.3 | GO:0046790 | virion binding(GO:0046790) |
0.1 | 0.4 | GO:0016175 | superoxide-generating NADPH oxidase activity(GO:0016175) |
0.1 | 0.5 | GO:0004028 | 3-chloroallyl aldehyde dehydrogenase activity(GO:0004028) |
0.1 | 0.2 | GO:0002060 | purine nucleobase binding(GO:0002060) |
0.1 | 0.3 | GO:0030368 | interleukin-17 receptor activity(GO:0030368) |
0.1 | 1.0 | GO:0004003 | ATP-dependent DNA helicase activity(GO:0004003) |
0.1 | 0.4 | GO:0015377 | cation:chloride symporter activity(GO:0015377) |
0.0 | 1.1 | GO:0005154 | epidermal growth factor receptor binding(GO:0005154) |
0.0 | 0.2 | GO:0004017 | adenylate kinase activity(GO:0004017) |
0.0 | 0.0 | GO:0000253 | 3-keto sterol reductase activity(GO:0000253) |
0.0 | 0.3 | GO:0102336 | fatty acid elongase activity(GO:0009922) 3-oxo-arachidoyl-CoA synthase activity(GO:0102336) 3-oxo-cerotoyl-CoA synthase activity(GO:0102337) 3-oxo-lignoceronyl-CoA synthase activity(GO:0102338) |
0.0 | 0.2 | GO:0004523 | RNA-DNA hybrid ribonuclease activity(GO:0004523) |
0.0 | 0.5 | GO:0070006 | metalloaminopeptidase activity(GO:0070006) |
0.0 | 0.3 | GO:0030296 | protein tyrosine kinase activator activity(GO:0030296) |
0.0 | 0.1 | GO:0022884 | macromolecule transmembrane transporter activity(GO:0022884) |
0.0 | 0.3 | GO:0005078 | MAP-kinase scaffold activity(GO:0005078) |
0.0 | 0.3 | GO:0036312 | phosphatidylinositol 3-kinase regulatory subunit binding(GO:0036312) |
0.0 | 0.4 | GO:0008143 | poly(A) binding(GO:0008143) |
0.0 | 1.4 | GO:0061631 | ubiquitin conjugating enzyme activity(GO:0061631) |
0.0 | 0.7 | GO:0015095 | magnesium ion transmembrane transporter activity(GO:0015095) |
0.0 | 0.1 | GO:0015143 | urate transmembrane transporter activity(GO:0015143) salt transmembrane transporter activity(GO:1901702) |
0.0 | 0.1 | GO:0051718 | DNA (cytosine-5-)-methyltransferase activity(GO:0003886) DNA (cytosine-5-)-methyltransferase activity, acting on CpG substrates(GO:0051718) |
0.0 | 0.6 | GO:0050811 | GABA receptor binding(GO:0050811) |
0.0 | 0.1 | GO:0016743 | carboxyl- or carbamoyltransferase activity(GO:0016743) |
0.0 | 0.2 | GO:0000774 | adenyl-nucleotide exchange factor activity(GO:0000774) |
0.0 | 0.0 | GO:0070538 | oleic acid binding(GO:0070538) |
0.0 | 0.4 | GO:0008519 | ammonium transmembrane transporter activity(GO:0008519) |
0.0 | 0.0 | GO:1904288 | BAT3 complex binding(GO:1904288) |
0.0 | 0.3 | GO:0015491 | cation:cation antiporter activity(GO:0015491) |
0.0 | 0.2 | GO:0004679 | AMP-activated protein kinase activity(GO:0004679) |
0.0 | 0.1 | GO:0017151 | DEAD/H-box RNA helicase binding(GO:0017151) |
0.0 | 0.2 | GO:0004311 | farnesyltranstransferase activity(GO:0004311) |
0.0 | 0.0 | GO:0030619 | U1 snRNA binding(GO:0030619) |
0.0 | 0.3 | GO:0050700 | CARD domain binding(GO:0050700) |
0.0 | 0.4 | GO:0004767 | sphingomyelin phosphodiesterase activity(GO:0004767) |
0.0 | 2.2 | GO:0030674 | protein binding, bridging(GO:0030674) |
0.0 | 0.2 | GO:0005344 | oxygen transporter activity(GO:0005344) |
0.0 | 0.2 | GO:0005105 | type 1 fibroblast growth factor receptor binding(GO:0005105) |
0.0 | 1.0 | GO:0008200 | ion channel inhibitor activity(GO:0008200) |
0.0 | 0.2 | GO:0008349 | MAP kinase kinase kinase kinase activity(GO:0008349) |
0.0 | 0.1 | GO:0004416 | hydroxyacylglutathione hydrolase activity(GO:0004416) |
0.0 | 0.4 | GO:0003854 | 3-beta-hydroxy-delta5-steroid dehydrogenase activity(GO:0003854) |
0.0 | 0.4 | GO:0000993 | RNA polymerase II core binding(GO:0000993) |
0.0 | 0.6 | GO:0017091 | AU-rich element binding(GO:0017091) |
0.0 | 0.0 | GO:0098847 | sequence-specific single stranded DNA binding(GO:0098847) |
0.0 | 0.2 | GO:0035613 | RNA stem-loop binding(GO:0035613) |
0.0 | 0.1 | GO:0086006 | voltage-gated sodium channel activity involved in cardiac muscle cell action potential(GO:0086006) |
0.0 | 0.2 | GO:0004957 | prostaglandin E receptor activity(GO:0004957) |
0.0 | 0.6 | GO:0016307 | phosphatidylinositol phosphate kinase activity(GO:0016307) |
0.0 | 0.1 | GO:0015182 | L-asparagine transmembrane transporter activity(GO:0015182) L-glutamine transmembrane transporter activity(GO:0015186) |
0.0 | 0.1 | GO:0032767 | copper-dependent protein binding(GO:0032767) |
0.0 | 1.5 | GO:0033613 | activating transcription factor binding(GO:0033613) |
0.0 | 0.1 | GO:0043120 | tumor necrosis factor binding(GO:0043120) |
0.0 | 0.5 | GO:0004190 | aspartic-type endopeptidase activity(GO:0004190) aspartic-type peptidase activity(GO:0070001) |
0.0 | 0.2 | GO:0035197 | siRNA binding(GO:0035197) |
0.0 | 0.2 | GO:0004582 | dolichyl-phosphate beta-D-mannosyltransferase activity(GO:0004582) |
0.0 | 0.2 | GO:0008484 | sulfuric ester hydrolase activity(GO:0008484) |
0.0 | 0.3 | GO:0070251 | succinate-CoA ligase activity(GO:0004774) 3-oxo-2-(2'-pentenyl)cyclopentane-1-octanoic acid CoA ligase activity(GO:0010435) 3-isopropenyl-6-oxoheptanoyl-CoA synthetase activity(GO:0018854) 2-oxo-delta3-4,5,5-trimethylcyclopentenylacetyl-CoA synthetase activity(GO:0018855) benzoyl acetate-CoA ligase activity(GO:0018856) 2,4-dichlorobenzoate-CoA ligase activity(GO:0018857) pivalate-CoA ligase activity(GO:0034783) cyclopropanecarboxylate-CoA ligase activity(GO:0034793) adipate-CoA ligase activity(GO:0034796) citronellyl-CoA ligase activity(GO:0034823) mentha-1,3-dione-CoA ligase activity(GO:0034841) thiophene-2-carboxylate-CoA ligase activity(GO:0034842) 2,4,4-trimethylpentanoate-CoA ligase activity(GO:0034865) cis-2-methyl-5-isopropylhexa-2,5-dienoate-CoA ligase activity(GO:0034942) trans-2-methyl-5-isopropylhexa-2,5-dienoate-CoA ligase activity(GO:0034943) branched-chain acyl-CoA synthetase (ADP-forming) activity(GO:0043759) aryl-CoA synthetase (ADP-forming) activity(GO:0043762) 3-hydroxypropionyl-CoA synthetase activity(GO:0043955) perillic acid:CoA ligase (ADP-forming) activity(GO:0052685) perillic acid:CoA ligase (AMP-forming) activity(GO:0052686) (3R)-3-isopropenyl-6-oxoheptanoate:CoA ligase (ADP-forming) activity(GO:0052687) (3R)-3-isopropenyl-6-oxoheptanoate:CoA ligase (AMP-forming) activity(GO:0052688) pristanate-CoA ligase activity(GO:0070251) malonyl-CoA synthetase activity(GO:0090409) |
0.0 | 0.3 | GO:0003909 | DNA ligase activity(GO:0003909) DNA ligase (ATP) activity(GO:0003910) |
0.0 | 0.4 | GO:0048038 | quinone binding(GO:0048038) |
0.0 | 0.1 | GO:0031752 | D5 dopamine receptor binding(GO:0031752) |
0.0 | 0.1 | GO:0097016 | L27 domain binding(GO:0097016) |
0.0 | 0.2 | GO:0001665 | alpha-N-acetylgalactosaminide alpha-2,6-sialyltransferase activity(GO:0001665) |
0.0 | 0.5 | GO:0016854 | racemase and epimerase activity(GO:0016854) |
0.0 | 0.1 | GO:0070698 | type I activin receptor binding(GO:0070698) |
0.0 | 0.6 | GO:0031492 | nucleosomal DNA binding(GO:0031492) |
0.0 | 0.1 | GO:0097493 | structural molecule activity conferring elasticity(GO:0097493) |
0.0 | 1.0 | GO:0003730 | mRNA 3'-UTR binding(GO:0003730) |
0.0 | 0.4 | GO:0004568 | chitinase activity(GO:0004568) |
0.0 | 0.0 | GO:0050220 | prostaglandin-E synthase activity(GO:0050220) |
0.0 | 0.2 | GO:0036402 | proteasome-activating ATPase activity(GO:0036402) |
0.0 | 0.2 | GO:0004784 | superoxide dismutase activity(GO:0004784) oxidoreductase activity, acting on superoxide radicals as acceptor(GO:0016721) |
0.0 | 0.1 | GO:0031078 | histone deacetylase activity (H3-K14 specific)(GO:0031078) NAD-dependent histone deacetylase activity (H3-K14 specific)(GO:0032041) |
0.0 | 0.2 | GO:0036435 | K48-linked polyubiquitin binding(GO:0036435) |
0.0 | 0.0 | GO:0015252 | hydrogen ion channel activity(GO:0015252) |
0.0 | 0.6 | GO:0032266 | phosphatidylinositol-3-phosphate binding(GO:0032266) |
0.0 | 0.3 | GO:0005522 | profilin binding(GO:0005522) |
0.0 | 2.7 | GO:0004809 | tRNA (guanine-N2-)-methyltransferase activity(GO:0004809) |
0.0 | 0.8 | GO:0008483 | transaminase activity(GO:0008483) |
0.0 | 0.6 | GO:0003950 | NAD+ ADP-ribosyltransferase activity(GO:0003950) |
0.0 | 0.3 | GO:0015168 | glycerol transmembrane transporter activity(GO:0015168) glycerol channel activity(GO:0015254) |
0.0 | 0.0 | GO:0035173 | histone kinase activity(GO:0035173) |
0.0 | 0.2 | GO:0035174 | histone serine kinase activity(GO:0035174) |
0.0 | 0.0 | GO:0034739 | histone deacetylase activity (H4-K16 specific)(GO:0034739) |
0.0 | 0.1 | GO:0045505 | dynein intermediate chain binding(GO:0045505) |
0.0 | 0.2 | GO:0052833 | inositol monophosphate 1-phosphatase activity(GO:0008934) inositol monophosphate 3-phosphatase activity(GO:0052832) inositol monophosphate 4-phosphatase activity(GO:0052833) inositol monophosphate phosphatase activity(GO:0052834) |
0.0 | 0.0 | GO:0016714 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, reduced pteridine as one donor, and incorporation of one atom of oxygen(GO:0016714) |
0.0 | 0.6 | GO:0045296 | cadherin binding(GO:0045296) |
0.0 | 0.1 | GO:0016899 | oxidoreductase activity, acting on the CH-OH group of donors, oxygen as acceptor(GO:0016899) |
0.0 | 0.8 | GO:0008422 | beta-glucosidase activity(GO:0008422) |
0.0 | 0.2 | GO:0003988 | acetyl-CoA C-acyltransferase activity(GO:0003988) |
0.0 | 0.3 | GO:0042162 | telomeric DNA binding(GO:0042162) |
0.0 | 0.2 | GO:0003724 | RNA helicase activity(GO:0003724) |
0.0 | 0.1 | GO:0072345 | NAADP-sensitive calcium-release channel activity(GO:0072345) |
0.0 | 0.5 | GO:0017056 | structural constituent of nuclear pore(GO:0017056) |
0.0 | 0.0 | GO:0004741 | [pyruvate dehydrogenase (lipoamide)] phosphatase activity(GO:0004741) |
0.0 | 0.1 | GO:0008432 | JUN kinase binding(GO:0008432) |
0.0 | 0.1 | GO:0043262 | adenosine-diphosphatase activity(GO:0043262) |
0.0 | 0.3 | GO:0009931 | calcium-dependent protein serine/threonine kinase activity(GO:0009931) |
0.0 | 0.1 | GO:0003876 | AMP deaminase activity(GO:0003876) adenosine-phosphate deaminase activity(GO:0047623) |
0.0 | 0.8 | GO:0052693 | N-ethylmaleimide reductase activity(GO:0008748) reduced coenzyme F420 dehydrogenase activity(GO:0043738) sulfur oxygenase reductase activity(GO:0043826) malolactic enzyme activity(GO:0043883) epoxyqueuosine reductase activity(GO:0052693) |
0.0 | 0.1 | GO:0019862 | IgA binding(GO:0019862) |
0.0 | 0.8 | GO:0005385 | zinc ion transmembrane transporter activity(GO:0005385) |
0.0 | 0.7 | GO:0050699 | WW domain binding(GO:0050699) |
0.0 | 0.4 | GO:0045236 | CXCR chemokine receptor binding(GO:0045236) |
0.0 | 0.1 | GO:0001727 | lipid kinase activity(GO:0001727) |
0.0 | 0.7 | GO:0016765 | transferase activity, transferring alkyl or aryl (other than methyl) groups(GO:0016765) |
0.0 | 0.1 | GO:0005087 | Ran guanyl-nucleotide exchange factor activity(GO:0005087) |
0.0 | 1.7 | GO:0004860 | protein kinase inhibitor activity(GO:0004860) |
0.0 | 0.1 | GO:0050786 | RAGE receptor binding(GO:0050786) |
0.0 | 0.3 | GO:0070063 | RNA polymerase binding(GO:0070063) |
0.0 | 0.2 | GO:0019911 | structural constituent of myelin sheath(GO:0019911) |
0.0 | 0.3 | GO:0001190 | transcriptional activator activity, RNA polymerase II transcription factor binding(GO:0001190) transcriptional repressor activity, RNA polymerase II activating transcription factor binding(GO:0098811) |
0.0 | 0.4 | GO:0015036 | disulfide oxidoreductase activity(GO:0015036) |
0.0 | 0.6 | GO:0008139 | nuclear localization sequence binding(GO:0008139) |
0.0 | 0.1 | GO:0005146 | leukemia inhibitory factor receptor binding(GO:0005146) |
0.0 | 0.0 | GO:1990715 | mRNA CDS binding(GO:1990715) |
0.0 | 0.1 | GO:0031779 | melanocortin receptor binding(GO:0031779) type 3 melanocortin receptor binding(GO:0031781) type 4 melanocortin receptor binding(GO:0031782) |
0.0 | 0.1 | GO:0097603 | temperature-gated ion channel activity(GO:0097603) |
0.0 | 0.3 | GO:0005092 | GDP-dissociation inhibitor activity(GO:0005092) |
0.0 | 0.1 | GO:0004995 | tachykinin receptor activity(GO:0004995) |
0.0 | 0.1 | GO:0043495 | protein anchor(GO:0043495) |
0.0 | 0.3 | GO:0016814 | hydrolase activity, acting on carbon-nitrogen (but not peptide) bonds, in cyclic amidines(GO:0016814) |
0.0 | 0.0 | GO:0008905 | mannose-phosphate guanylyltransferase activity(GO:0008905) |
0.0 | 0.2 | GO:0032036 | myosin heavy chain binding(GO:0032036) |
0.0 | 0.1 | GO:0031544 | procollagen-proline 3-dioxygenase activity(GO:0019797) peptidyl-proline 3-dioxygenase activity(GO:0031544) |
0.0 | 0.0 | GO:0004716 | receptor signaling protein tyrosine kinase activity(GO:0004716) |
0.0 | 0.1 | GO:0070915 | lysophosphatidic acid receptor activity(GO:0070915) |
0.0 | 0.4 | GO:0046961 | proton-transporting ATPase activity, rotational mechanism(GO:0046961) |
0.0 | 0.1 | GO:0005375 | copper ion transmembrane transporter activity(GO:0005375) |
0.0 | 0.7 | GO:0030276 | clathrin binding(GO:0030276) |
0.0 | 0.1 | GO:0008310 | single-stranded DNA 3'-5' exodeoxyribonuclease activity(GO:0008310) |
0.0 | 0.2 | GO:0031849 | olfactory receptor binding(GO:0031849) |
0.0 | 0.1 | GO:0043023 | ribosomal large subunit binding(GO:0043023) |
0.0 | 0.2 | GO:0070628 | proteasome binding(GO:0070628) |
0.0 | 0.3 | GO:0031559 | oxidosqualene cyclase activity(GO:0031559) |
0.0 | 0.0 | GO:0015563 | uptake transmembrane transporter activity(GO:0015563) |
0.0 | 2.5 | GO:0036459 | thiol-dependent ubiquitinyl hydrolase activity(GO:0036459) ubiquitinyl hydrolase activity(GO:0101005) |
0.0 | 0.2 | GO:0103116 | alpha-D-galactofuranose transporter activity(GO:0103116) |
0.0 | 0.0 | GO:0010858 | calcium-dependent protein kinase regulator activity(GO:0010858) |
0.0 | 0.1 | GO:1990381 | ubiquitin-specific protease binding(GO:1990381) |
0.0 | 0.4 | GO:0043014 | alpha-tubulin binding(GO:0043014) |
0.0 | 0.1 | GO:0046923 | ER retention sequence binding(GO:0046923) |
0.0 | 0.1 | GO:0071532 | ankyrin repeat binding(GO:0071532) |
0.0 | 1.0 | GO:0005160 | transforming growth factor beta receptor binding(GO:0005160) |
0.0 | 0.0 | GO:0070840 | dynein complex binding(GO:0070840) |
0.0 | 1.1 | GO:0003697 | single-stranded DNA binding(GO:0003697) |
0.0 | 0.2 | GO:0032184 | SUMO polymer binding(GO:0032184) |
0.0 | 0.2 | GO:0035325 | Toll-like receptor binding(GO:0035325) |
0.0 | 0.1 | GO:0070326 | very-low-density lipoprotein particle receptor binding(GO:0070326) |
0.0 | 0.8 | GO:0016701 | oxidoreductase activity, acting on single donors with incorporation of molecular oxygen(GO:0016701) oxidoreductase activity, acting on single donors with incorporation of molecular oxygen, incorporation of two atoms of oxygen(GO:0016702) |
0.0 | 0.0 | GO:0038181 | bile acid receptor activity(GO:0038181) |
0.0 | 0.4 | GO:0016493 | C-C chemokine receptor activity(GO:0016493) |
0.0 | 0.6 | GO:0045502 | dynein binding(GO:0045502) |
0.0 | 0.7 | GO:0005245 | voltage-gated calcium channel activity(GO:0005245) |
0.0 | 0.1 | GO:0031871 | proteinase activated receptor binding(GO:0031871) |
0.0 | 0.1 | GO:0016812 | hydrolase activity, acting on carbon-nitrogen (but not peptide) bonds, in cyclic amides(GO:0016812) |
0.0 | 0.1 | GO:0030546 | receptor activator activity(GO:0030546) |
0.0 | 0.1 | GO:0004839 | ubiquitin activating enzyme activity(GO:0004839) |
0.0 | 0.1 | GO:0003847 | 1-alkyl-2-acetylglycerophosphocholine esterase activity(GO:0003847) |
0.0 | 0.2 | GO:1901682 | sulfur compound transmembrane transporter activity(GO:1901682) |
0.0 | 0.0 | GO:0098518 | polynucleotide phosphatase activity(GO:0098518) |
0.0 | 0.3 | GO:0043274 | phospholipase binding(GO:0043274) |
0.0 | 0.1 | GO:0004980 | melanocyte-stimulating hormone receptor activity(GO:0004980) |
0.0 | 0.2 | GO:0016641 | oxidoreductase activity, acting on the CH-NH2 group of donors, oxygen as acceptor(GO:0016641) |
0.0 | 0.2 | GO:0019200 | carbohydrate kinase activity(GO:0019200) |
0.0 | 1.4 | GO:0004896 | cytokine receptor activity(GO:0004896) |
0.0 | 0.1 | GO:0016443 | ribonuclease III activity(GO:0004525) bidentate ribonuclease III activity(GO:0016443) double-stranded RNA-specific ribonuclease activity(GO:0032296) |
0.0 | 0.1 | GO:0005157 | macrophage colony-stimulating factor receptor binding(GO:0005157) |
0.0 | 0.1 | GO:0015440 | peptide-transporting ATPase activity(GO:0015440) |
0.0 | 0.0 | GO:0070324 | thyroid hormone binding(GO:0070324) |
0.0 | 0.1 | GO:0000175 | 3'-5'-exoribonuclease activity(GO:0000175) exoribonuclease activity, producing 5'-phosphomonoesters(GO:0016896) |
0.0 | 0.1 | GO:0031490 | chromatin DNA binding(GO:0031490) |
0.0 | 0.0 | GO:0070679 | inositol 1,4,5 trisphosphate binding(GO:0070679) |
0.0 | 0.3 | GO:0070491 | repressing transcription factor binding(GO:0070491) |
0.0 | 0.0 | GO:0019211 | phosphatase activator activity(GO:0019211) |
0.0 | 0.2 | GO:0046977 | TAP binding(GO:0046977) |
0.0 | 0.1 | GO:0030284 | estrogen receptor activity(GO:0030284) |
0.0 | 0.2 | GO:0070530 | K63-linked polyubiquitin binding(GO:0070530) |
0.0 | 0.0 | GO:0032452 | histone demethylase activity(GO:0032452) |
0.0 | 0.0 | GO:0031432 | titin binding(GO:0031432) |
0.0 | 0.1 | GO:0038036 | sphingosine-1-phosphate receptor activity(GO:0038036) |
0.0 | 0.1 | GO:0004514 | nicotinate-nucleotide diphosphorylase (carboxylating) activity(GO:0004514) |
0.0 | 0.1 | GO:0000339 | RNA cap binding(GO:0000339) |
0.0 | 0.4 | GO:0001221 | transcription cofactor binding(GO:0001221) |
0.0 | 0.0 | GO:0004771 | sterol esterase activity(GO:0004771) |
0.0 | 0.1 | GO:0005324 | long-chain fatty acid transporter activity(GO:0005324) |
0.0 | 0.1 | GO:0042975 | peroxisome proliferator activated receptor binding(GO:0042975) |
0.0 | 0.2 | GO:0038187 | signaling pattern recognition receptor activity(GO:0008329) pattern recognition receptor activity(GO:0038187) |
0.0 | 0.3 | GO:0042056 | chemoattractant activity(GO:0042056) |
0.0 | 0.1 | GO:0042289 | MHC class II protein binding(GO:0042289) |
0.0 | 0.1 | GO:0019239 | deaminase activity(GO:0019239) |
0.0 | 0.1 | GO:0010851 | cyclase regulator activity(GO:0010851) guanylate cyclase regulator activity(GO:0030249) |
0.0 | 0.3 | GO:0015106 | bicarbonate transmembrane transporter activity(GO:0015106) |
0.0 | 0.6 | GO:0070566 | adenylyltransferase activity(GO:0070566) |
0.0 | 0.0 | GO:0030792 | methylarsonite methyltransferase activity(GO:0030792) |
0.0 | 0.0 | GO:0034875 | oxidoreductase activity, acting on CH or CH2 groups, quinone or similar compound as acceptor(GO:0033695) caffeine oxidase activity(GO:0034875) |
0.0 | 0.1 | GO:0070411 | I-SMAD binding(GO:0070411) |
0.0 | 0.3 | GO:0019206 | nucleoside kinase activity(GO:0019206) |
0.0 | 0.1 | GO:0050252 | retinol O-fatty-acyltransferase activity(GO:0050252) |
0.0 | 0.2 | GO:0003796 | lysozyme activity(GO:0003796) |
0.0 | 0.0 | GO:0033265 | choline binding(GO:0033265) |
0.0 | 0.3 | GO:0005031 | tumor necrosis factor-activated receptor activity(GO:0005031) death receptor activity(GO:0005035) |
0.0 | 0.0 | GO:0008900 | hydrogen:potassium-exchanging ATPase activity(GO:0008900) |
0.0 | 0.3 | GO:0001594 | trace-amine receptor activity(GO:0001594) |
0.0 | 0.1 | GO:0034235 | GPI anchor binding(GO:0034235) |
0.0 | 0.4 | GO:0046332 | SMAD binding(GO:0046332) |
0.0 | 0.5 | GO:0005507 | copper ion binding(GO:0005507) |
0.0 | 0.0 | GO:0015166 | polyol transmembrane transporter activity(GO:0015166) |
0.0 | 0.1 | GO:0004966 | galanin receptor activity(GO:0004966) |
0.0 | 0.2 | GO:0034185 | apolipoprotein binding(GO:0034185) |
0.0 | 0.2 | GO:0023026 | MHC class II protein complex binding(GO:0023026) |
0.0 | 0.1 | GO:0008479 | queuine tRNA-ribosyltransferase activity(GO:0008479) |
0.0 | 0.0 | GO:0005128 | erythropoietin receptor binding(GO:0005128) |
0.0 | 0.1 | GO:0016941 | natriuretic peptide receptor activity(GO:0016941) |
0.0 | 3.0 | GO:0005125 | cytokine activity(GO:0005125) |
0.0 | 0.4 | GO:0004709 | MAP kinase kinase kinase activity(GO:0004709) |
0.0 | 0.1 | GO:0016679 | oxidoreductase activity, acting on diphenols and related substances as donors(GO:0016679) |
0.0 | 0.1 | GO:0004985 | opioid receptor activity(GO:0004985) |
0.0 | 0.1 | GO:0005164 | tumor necrosis factor receptor binding(GO:0005164) |
0.0 | 0.0 | GO:0004103 | choline kinase activity(GO:0004103) |
0.0 | 0.0 | GO:0031434 | mitogen-activated protein kinase kinase binding(GO:0031434) |
0.0 | 0.4 | GO:0042826 | histone deacetylase binding(GO:0042826) |
0.0 | 0.2 | GO:0008242 | omega peptidase activity(GO:0008242) |
0.0 | 0.0 | GO:0016018 | cyclosporin A binding(GO:0016018) |
0.0 | 0.1 | GO:0031545 | peptidyl-proline 4-dioxygenase activity(GO:0031545) |
0.0 | 0.0 | GO:0017150 | tRNA dihydrouridine synthase activity(GO:0017150) |
0.0 | 0.2 | GO:0070577 | lysine-acetylated histone binding(GO:0070577) |
0.0 | 0.1 | GO:0004031 | aldehyde oxidase activity(GO:0004031) oxidoreductase activity, acting on the aldehyde or oxo group of donors, oxygen as acceptor(GO:0016623) |
0.0 | 0.2 | GO:0004435 | phosphatidylinositol phospholipase C activity(GO:0004435) |
0.0 | 0.8 | GO:0051087 | chaperone binding(GO:0051087) |
0.0 | 0.0 | GO:0098519 | nucleotide phosphatase activity, acting on free nucleotides(GO:0098519) |
0.0 | 0.7 | GO:0008188 | neuropeptide receptor activity(GO:0008188) |
0.0 | 0.0 | GO:0008545 | JUN kinase kinase activity(GO:0008545) |
0.0 | 0.1 | GO:0070137 | ubiquitin-like protein-specific endopeptidase activity(GO:0070137) SUMO-specific endopeptidase activity(GO:0070139) |
0.0 | 0.0 | GO:0016841 | ammonia-lyase activity(GO:0016841) |
0.0 | 0.2 | GO:0043142 | single-stranded DNA-dependent ATPase activity(GO:0043142) |
0.0 | 0.1 | GO:0042288 | MHC class I protein binding(GO:0042288) |
0.0 | 0.0 | GO:0051525 | NFAT protein binding(GO:0051525) |
0.0 | 0.1 | GO:0070181 | small ribosomal subunit rRNA binding(GO:0070181) |
0.0 | 0.1 | GO:0008532 | N-acetyllactosaminide beta-1,3-N-acetylglucosaminyltransferase activity(GO:0008532) |
0.0 | 0.0 | GO:0016015 | morphogen activity(GO:0016015) |
0.0 | 0.0 | GO:0005381 | iron ion transmembrane transporter activity(GO:0005381) |
0.0 | 0.2 | GO:0030742 | GTP-dependent protein binding(GO:0030742) |
0.0 | 0.1 | GO:0047276 | N-acetyllactosaminide 3-alpha-galactosyltransferase activity(GO:0047276) |
0.0 | 0.0 | GO:0016778 | diphosphotransferase activity(GO:0016778) |
0.0 | 0.0 | GO:0003696 | satellite DNA binding(GO:0003696) |
0.0 | 0.4 | GO:0016655 | oxidoreductase activity, acting on NAD(P)H, quinone or similar compound as acceptor(GO:0016655) |
0.0 | 0.1 | GO:0016922 | ligand-dependent nuclear receptor binding(GO:0016922) |
0.0 | 0.1 | GO:0050664 | oxidoreductase activity, acting on NAD(P)H, oxygen as acceptor(GO:0050664) |
0.0 | 0.2 | GO:0015129 | lactate transmembrane transporter activity(GO:0015129) |
0.0 | 0.1 | GO:0033829 | O-fucosylpeptide 3-beta-N-acetylglucosaminyltransferase activity(GO:0033829) |
0.0 | 0.4 | GO:0008536 | Ran GTPase binding(GO:0008536) |
0.0 | 0.0 | GO:0052650 | NADP-retinol dehydrogenase activity(GO:0052650) |
0.0 | 0.3 | GO:0030552 | cAMP binding(GO:0030552) |
0.0 | 0.4 | GO:0005184 | neuropeptide hormone activity(GO:0005184) |
0.0 | 0.0 | GO:0008384 | IkappaB kinase activity(GO:0008384) |
0.0 | 0.2 | GO:0099589 | G-protein coupled serotonin receptor activity(GO:0004993) serotonin receptor activity(GO:0099589) |
0.0 | 0.5 | GO:0019208 | phosphatase regulator activity(GO:0019208) |
0.0 | 0.0 | GO:0004711 | ribosomal protein S6 kinase activity(GO:0004711) |
0.0 | 0.1 | GO:0015279 | store-operated calcium channel activity(GO:0015279) |
0.0 | 0.0 | GO:1904680 | oligopeptide transmembrane transporter activity(GO:0035673) peptide transmembrane transporter activity(GO:1904680) |
0.0 | 0.1 | GO:0004955 | prostaglandin receptor activity(GO:0004955) |
0.0 | 0.0 | GO:0070051 | fibrinogen binding(GO:0070051) |
0.0 | 0.0 | GO:0032027 | myosin light chain binding(GO:0032027) |
0.0 | 0.0 | GO:0004704 | NF-kappaB-inducing kinase activity(GO:0004704) |
0.0 | 1.7 | GO:0003713 | transcription coactivator activity(GO:0003713) |
0.0 | 0.0 | GO:0019145 | aminobutyraldehyde dehydrogenase activity(GO:0019145) 4-trimethylammoniobutyraldehyde dehydrogenase activity(GO:0047105) |
0.0 | 0.1 | GO:0016805 | dipeptidase activity(GO:0016805) |
0.0 | 0.1 | GO:1990405 | protein antigen binding(GO:1990405) |
0.0 | 0.0 | GO:0031418 | L-ascorbic acid binding(GO:0031418) |
0.0 | 0.2 | GO:0034596 | phosphatidylinositol phosphate 4-phosphatase activity(GO:0034596) |
0.0 | 0.2 | GO:0004683 | calmodulin-dependent protein kinase activity(GO:0004683) |
0.0 | 0.0 | GO:0022858 | L-alanine transmembrane transporter activity(GO:0015180) alanine transmembrane transporter activity(GO:0022858) |
0.0 | 0.0 | GO:0015651 | quaternary ammonium group transmembrane transporter activity(GO:0015651) |
0.0 | 0.5 | GO:0008565 | protein transporter activity(GO:0008565) |
0.0 | 0.0 | GO:0004814 | arginine-tRNA ligase activity(GO:0004814) |
0.0 | 0.0 | GO:0004591 | oxoglutarate dehydrogenase (succinyl-transferring) activity(GO:0004591) |
0.0 | 0.1 | GO:0004707 | MAP kinase activity(GO:0004707) |
0.0 | 0.4 | GO:0031072 | heat shock protein binding(GO:0031072) |
0.0 | 0.0 | GO:0004949 | cannabinoid receptor activity(GO:0004949) |
0.0 | 0.0 | GO:0016769 | transferase activity, transferring nitrogenous groups(GO:0016769) |
0.0 | 2.9 | GO:0005525 | GTP binding(GO:0005525) |
0.0 | 0.1 | GO:0001784 | phosphotyrosine binding(GO:0001784) |
0.0 | 0.0 | GO:0043734 | DNA-N1-methyladenine dioxygenase activity(GO:0043734) |
0.0 | 0.0 | GO:0097642 | calcitonin family receptor activity(GO:0097642) |
0.0 | 0.3 | GO:0051082 | unfolded protein binding(GO:0051082) |
0.0 | 0.0 | GO:0016423 | tRNA (guanine) methyltransferase activity(GO:0016423) |
0.0 | 0.3 | GO:0051219 | phosphoprotein binding(GO:0051219) |
0.0 | 0.2 | GO:0004721 | phosphoprotein phosphatase activity(GO:0004721) |
0.0 | 0.0 | GO:0004305 | ethanolamine kinase activity(GO:0004305) |
0.0 | 0.1 | GO:0042285 | UDP-xylosyltransferase activity(GO:0035252) xylosyltransferase activity(GO:0042285) |
0.0 | 0.0 | GO:0043426 | MRF binding(GO:0043426) |
0.0 | 0.0 | GO:0016774 | phosphotransferase activity, carboxyl group as acceptor(GO:0016774) |
0.0 | 0.1 | GO:0016907 | G-protein coupled acetylcholine receptor activity(GO:0016907) |
0.0 | 0.0 | GO:0004829 | threonine-tRNA ligase activity(GO:0004829) |
0.0 | 0.0 | GO:0008252 | nucleotidase activity(GO:0008252) |
0.0 | 0.1 | GO:0004614 | phosphoglucomutase activity(GO:0004614) |
0.0 | 0.1 | GO:0034584 | piRNA binding(GO:0034584) |
0.0 | 0.1 | GO:0070742 | C2H2 zinc finger domain binding(GO:0070742) |
0.0 | 0.0 | GO:0048403 | brain-derived neurotrophic factor binding(GO:0048403) |
0.0 | 0.3 | GO:0019843 | rRNA binding(GO:0019843) |
0.0 | 0.0 | GO:0003953 | NAD+ nucleosidase activity(GO:0003953) |
0.0 | 0.0 | GO:0015245 | fatty acid transporter activity(GO:0015245) |
0.0 | 0.1 | GO:0004579 | dolichyl-diphosphooligosaccharide-protein glycotransferase activity(GO:0004579) |
0.0 | 0.2 | GO:0001205 | transcriptional activator activity, RNA polymerase II distal enhancer sequence-specific binding(GO:0001205) |
0.0 | 2.5 | GO:0000982 | transcription factor activity, RNA polymerase II core promoter proximal region sequence-specific binding(GO:0000982) |
0.0 | 0.0 | GO:0045134 | uridine-diphosphatase activity(GO:0045134) |
0.0 | 0.1 | GO:0031491 | nucleosome binding(GO:0031491) |
0.0 | 0.0 | GO:0043024 | ribosomal small subunit binding(GO:0043024) |
0.0 | 1.9 | GO:0070737 | UDP-N-acetylmuramoylalanyl-D-glutamyl-2,6-diaminopimelate-D-alanyl-D-alanine ligase activity(GO:0008766) ribosomal S6-glutamic acid ligase activity(GO:0018169) coenzyme F420-0 gamma-glutamyl ligase activity(GO:0043773) coenzyme F420-2 alpha-glutamyl ligase activity(GO:0043774) protein-glycine ligase activity(GO:0070735) protein-glycine ligase activity, initiating(GO:0070736) protein-glycine ligase activity, elongating(GO:0070737) tubulin-glycine ligase activity(GO:0070738) |
0.0 | 0.4 | GO:0043130 | ubiquitin binding(GO:0043130) |
0.0 | 0.1 | GO:0001085 | RNA polymerase II transcription factor binding(GO:0001085) |
0.0 | 1.1 | GO:0031625 | ubiquitin protein ligase binding(GO:0031625) |
0.0 | 0.0 | GO:0050508 | glucuronosyl-N-acetylglucosaminyl-proteoglycan 4-alpha-N-acetylglucosaminyltransferase activity(GO:0050508) |
0.0 | 9.0 | GO:0003723 | RNA binding(GO:0003723) |
0.0 | 0.0 | GO:0097153 | cysteine-type endopeptidase activity involved in apoptotic process(GO:0097153) |
0.0 | 0.2 | GO:0042605 | peptide antigen binding(GO:0042605) |
0.0 | 0.1 | GO:0015643 | toxic substance binding(GO:0015643) |
0.0 | 0.0 | GO:0031957 | very long-chain fatty acid-CoA ligase activity(GO:0031957) |
0.0 | 0.0 | GO:0030550 | acetylcholine receptor inhibitor activity(GO:0030550) |
0.0 | 0.6 | GO:0005506 | iron ion binding(GO:0005506) |
0.0 | 0.0 | GO:0001671 | ATPase activator activity(GO:0001671) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.6 | 4.7 | SA FAS SIGNALING | The TNF-type receptor Fas induces apoptosis on ligand binding. |
0.3 | 2.0 | ST JAK STAT PATHWAY | Jak-STAT Pathway |
0.2 | 9.9 | PID IL6 7 PATHWAY | IL6-mediated signaling events |
0.2 | 4.2 | PID IL2 STAT5 PATHWAY | IL2 signaling events mediated by STAT5 |
0.2 | 0.2 | PID EPHRINB REV PATHWAY | Ephrin B reverse signaling |
0.2 | 0.6 | PID THROMBIN PAR1 PATHWAY | PAR1-mediated thrombin signaling events |
0.2 | 3.3 | PID INTEGRIN5 PATHWAY | Beta5 beta6 beta7 and beta8 integrin cell surface interactions |
0.2 | 2.1 | PID ALK2 PATHWAY | ALK2 signaling events |
0.2 | 4.9 | PID P38 ALPHA BETA DOWNSTREAM PATHWAY | Signaling mediated by p38-alpha and p38-beta |
0.2 | 0.2 | NABA BASEMENT MEMBRANES | Genes encoding structural components of basement membranes |
0.2 | 7.6 | PID RHOA REG PATHWAY | Regulation of RhoA activity |
0.2 | 4.5 | PID RAS PATHWAY | Regulation of Ras family activation |
0.2 | 1.9 | PID P38 MK2 PATHWAY | p38 signaling mediated by MAPKAP kinases |
0.2 | 6.0 | PID A6B1 A6B4 INTEGRIN PATHWAY | a6b1 and a6b4 Integrin signaling |
0.2 | 1.4 | ST INTERLEUKIN 4 PATHWAY | Interleukin 4 (IL-4) Pathway |
0.2 | 2.3 | PID CIRCADIAN PATHWAY | Circadian rhythm pathway |
0.1 | 4.1 | PID WNT SIGNALING PATHWAY | Wnt signaling network |
0.1 | 7.1 | PID AR PATHWAY | Coregulation of Androgen receptor activity |
0.1 | 0.5 | ST INTEGRIN SIGNALING PATHWAY | Integrin Signaling Pathway |
0.1 | 1.2 | PID WNT CANONICAL PATHWAY | Canonical Wnt signaling pathway |
0.1 | 0.4 | PID SYNDECAN 2 PATHWAY | Syndecan-2-mediated signaling events |
0.1 | 0.6 | PID PTP1B PATHWAY | Signaling events mediated by PTP1B |
0.1 | 6.0 | PID ERA GENOMIC PATHWAY | Validated nuclear estrogen receptor alpha network |
0.1 | 5.8 | PID TELOMERASE PATHWAY | Regulation of Telomerase |
0.1 | 1.4 | PID INSULIN GLUCOSE PATHWAY | Insulin-mediated glucose transport |
0.1 | 7.0 | WNT SIGNALING | Genes related to Wnt-mediated signal transduction |
0.1 | 1.7 | PID INTEGRIN A9B1 PATHWAY | Alpha9 beta1 integrin signaling events |
0.1 | 3.5 | PID NFAT 3PATHWAY | Role of Calcineurin-dependent NFAT signaling in lymphocytes |
0.1 | 1.0 | PID PDGFRA PATHWAY | PDGFR-alpha signaling pathway |
0.1 | 2.4 | SIG PIP3 SIGNALING IN B LYMPHOCYTES | Genes related to PIP3 signaling in B lymphocytes |
0.1 | 3.6 | PID MYC REPRESS PATHWAY | Validated targets of C-MYC transcriptional repression |
0.1 | 4.1 | PID HNF3B PATHWAY | FOXA2 and FOXA3 transcription factor networks |
0.1 | 0.5 | PID IL5 PATHWAY | IL5-mediated signaling events |
0.1 | 3.1 | PID INTEGRIN3 PATHWAY | Beta3 integrin cell surface interactions |
0.1 | 4.1 | PID HIF1 TFPATHWAY | HIF-1-alpha transcription factor network |
0.1 | 0.7 | PID P38 GAMMA DELTA PATHWAY | Signaling mediated by p38-gamma and p38-delta |
0.1 | 0.4 | PID IL2 PI3K PATHWAY | IL2 signaling events mediated by PI3K |
0.1 | 0.2 | PID HIV NEF PATHWAY | HIV-1 Nef: Negative effector of Fas and TNF-alpha |
0.1 | 0.1 | PID P38 ALPHA BETA PATHWAY | Regulation of p38-alpha and p38-beta |
0.1 | 8.4 | PID P53 DOWNSTREAM PATHWAY | Direct p53 effectors |
0.1 | 1.7 | PID AURORA A PATHWAY | Aurora A signaling |
0.1 | 1.0 | PID ALK1 PATHWAY | ALK1 signaling events |
0.1 | 2.2 | PID FOXM1 PATHWAY | FOXM1 transcription factor network |
0.1 | 2.7 | PID ILK PATHWAY | Integrin-linked kinase signaling |
0.1 | 0.9 | PID FAK PATHWAY | Signaling events mediated by focal adhesion kinase |
0.1 | 1.6 | PID P38 MKK3 6PATHWAY | p38 MAPK signaling pathway |
0.1 | 2.5 | PID P53 REGULATION PATHWAY | p53 pathway |
0.1 | 2.2 | PID RHOA PATHWAY | RhoA signaling pathway |
0.1 | 0.5 | PID FGF PATHWAY | FGF signaling pathway |
0.1 | 2.2 | PID TNF PATHWAY | TNF receptor signaling pathway |
0.1 | 2.0 | PID CASPASE PATHWAY | Caspase cascade in apoptosis |
0.1 | 1.0 | PID RAC1 PATHWAY | RAC1 signaling pathway |
0.1 | 0.1 | PID GMCSF PATHWAY | GMCSF-mediated signaling events |
0.1 | 0.7 | ST ERK1 ERK2 MAPK PATHWAY | ERK1/ERK2 MAPK Pathway |
0.1 | 1.8 | PID TGFBR PATHWAY | TGF-beta receptor signaling |
0.1 | 2.5 | PID ARF6 TRAFFICKING PATHWAY | Arf6 trafficking events |
0.1 | 0.2 | PID IGF1 PATHWAY | IGF1 pathway |
0.1 | 0.3 | PID ANTHRAX PATHWAY | Cellular roles of Anthrax toxin |
0.1 | 0.2 | PID NECTIN PATHWAY | Nectin adhesion pathway |
0.1 | 0.1 | PID LYMPH ANGIOGENESIS PATHWAY | VEGFR3 signaling in lymphatic endothelium |
0.1 | 0.6 | PID ANGIOPOIETIN RECEPTOR PATHWAY | Angiopoietin receptor Tie2-mediated signaling |
0.1 | 0.5 | PID SYNDECAN 4 PATHWAY | Syndecan-4-mediated signaling events |
0.1 | 1.9 | PID AVB3 INTEGRIN PATHWAY | Integrins in angiogenesis |
0.1 | 1.7 | PID FANCONI PATHWAY | Fanconi anemia pathway |
0.1 | 0.6 | PID HIF2PATHWAY | HIF-2-alpha transcription factor network |
0.1 | 0.4 | PID NFKAPPAB CANONICAL PATHWAY | Canonical NF-kappaB pathway |
0.1 | 1.2 | PID LKB1 PATHWAY | LKB1 signaling events |
0.1 | 1.5 | PID BETA CATENIN NUC PATHWAY | Regulation of nuclear beta catenin signaling and target gene transcription |
0.1 | 1.6 | PID MTOR 4PATHWAY | mTOR signaling pathway |
0.1 | 1.1 | PID VEGFR1 2 PATHWAY | Signaling events mediated by VEGFR1 and VEGFR2 |
0.1 | 0.6 | PID ATM PATHWAY | ATM pathway |
0.1 | 1.5 | PID P73PATHWAY | p73 transcription factor network |
0.1 | 0.4 | ST G ALPHA S PATHWAY | G alpha s Pathway |
0.1 | 2.6 | PID PDGFRB PATHWAY | PDGFR-beta signaling pathway |
0.1 | 0.8 | PID ERBB1 INTERNALIZATION PATHWAY | Internalization of ErbB1 |
0.1 | 0.2 | PID ECADHERIN KERATINOCYTE PATHWAY | E-cadherin signaling in keratinocytes |
0.1 | 0.4 | PID ATR PATHWAY | ATR signaling pathway |
0.1 | 0.1 | ST IL 13 PATHWAY | Interleukin 13 (IL-13) Pathway |
0.0 | 0.6 | PID ERBB1 DOWNSTREAM PATHWAY | ErbB1 downstream signaling |
0.0 | 0.1 | PID AR NONGENOMIC PATHWAY | Nongenotropic Androgen signaling |
0.0 | 0.1 | ST GRANULE CELL SURVIVAL PATHWAY | Granule Cell Survival Pathway is a specific case of more general PAC1 Receptor Pathway. |
0.0 | 1.0 | PID CONE PATHWAY | Visual signal transduction: Cones |
0.0 | 0.0 | PID IL8 CXCR1 PATHWAY | IL8- and CXCR1-mediated signaling events |
0.0 | 0.5 | PID ALPHA SYNUCLEIN PATHWAY | Alpha-synuclein signaling |
0.0 | 0.3 | PID MAPK TRK PATHWAY | Trk receptor signaling mediated by the MAPK pathway |
0.0 | 0.5 | ST GAQ PATHWAY | G alpha q Pathway |
0.0 | 0.1 | PID INSULIN PATHWAY | Insulin Pathway |
0.0 | 0.2 | PID CERAMIDE PATHWAY | Ceramide signaling pathway |
0.0 | 0.2 | PID VEGF VEGFR PATHWAY | VEGF and VEGFR signaling network |
0.0 | 0.8 | PID IL12 2PATHWAY | IL12-mediated signaling events |
0.0 | 0.7 | PID DELTA NP63 PATHWAY | Validated transcriptional targets of deltaNp63 isoforms |
0.0 | 0.3 | PID RETINOIC ACID PATHWAY | Retinoic acid receptors-mediated signaling |
0.0 | 0.4 | PID IL1 PATHWAY | IL1-mediated signaling events |
0.0 | 0.3 | PID PRL SIGNALING EVENTS PATHWAY | Signaling events mediated by PRL |
0.0 | 0.6 | PID AP1 PATHWAY | AP-1 transcription factor network |
0.0 | 0.1 | PID NFKAPPAB ATYPICAL PATHWAY | Atypical NF-kappaB pathway |
0.0 | 0.7 | PID IL4 2PATHWAY | IL4-mediated signaling events |
0.0 | 1.0 | PID HDAC CLASSI PATHWAY | Signaling events mediated by HDAC Class I |
0.0 | 0.1 | ST GA12 PATHWAY | G alpha 12 Pathway |
0.0 | 0.1 | ST TUMOR NECROSIS FACTOR PATHWAY | Tumor Necrosis Factor Pathway. |
0.0 | 0.4 | PID BCR 5PATHWAY | BCR signaling pathway |
0.0 | 0.3 | PID NFAT TFPATHWAY | Calcineurin-regulated NFAT-dependent transcription in lymphocytes |
0.0 | 0.4 | PID FCER1 PATHWAY | Fc-epsilon receptor I signaling in mast cells |
0.0 | 0.0 | PID TCPTP PATHWAY | Signaling events mediated by TCPTP |
0.0 | 0.6 | PID SMAD2 3NUCLEAR PATHWAY | Regulation of nuclear SMAD2/3 signaling |
0.0 | 0.4 | PID HES HEY PATHWAY | Notch-mediated HES/HEY network |
0.0 | 0.4 | PID TAP63 PATHWAY | Validated transcriptional targets of TAp63 isoforms |
0.0 | 0.9 | PID MYC ACTIV PATHWAY | Validated targets of C-MYC transcriptional activation |
0.0 | 0.0 | PID REELIN PATHWAY | Reelin signaling pathway |
0.0 | 0.2 | PID MET PATHWAY | Signaling events mediated by Hepatocyte Growth Factor Receptor (c-Met) |
0.0 | 0.1 | PID LYSOPHOSPHOLIPID PATHWAY | LPA receptor mediated events |
0.0 | 0.1 | PID SMAD2 3PATHWAY | Regulation of cytoplasmic and nuclear SMAD2/3 signaling |
0.0 | 0.2 | ST JNK MAPK PATHWAY | JNK MAPK Pathway |
0.0 | 0.3 | NABA COLLAGENS | Genes encoding collagen proteins |
0.0 | 0.0 | PID TCR RAS PATHWAY | Ras signaling in the CD4+ TCR pathway |
0.0 | 0.2 | PID KIT PATHWAY | Signaling events mediated by Stem cell factor receptor (c-Kit) |
0.0 | 0.1 | PID PI3KCI PATHWAY | Class I PI3K signaling events |
0.0 | 0.1 | PID CD40 PATHWAY | CD40/CD40L signaling |
0.0 | 0.1 | PID HIF1A PATHWAY | Hypoxic and oxygen homeostasis regulation of HIF-1-alpha |
0.0 | 2.5 | NABA ECM AFFILIATED | Genes encoding proteins affiliated structurally or functionally to extracellular matrix proteins |
0.0 | 0.0 | PID ERB GENOMIC PATHWAY | Validated nuclear estrogen receptor beta network |
0.0 | 0.4 | PID PLK1 PATHWAY | PLK1 signaling events |
0.0 | 0.1 | PID IL23 PATHWAY | IL23-mediated signaling events |
0.0 | 0.0 | SA TRKA RECEPTOR | The TrkA receptor binds nerve growth factor to activate MAP kinase pathways and promote cell growth. |
0.0 | 0.2 | PID CD8 TCR DOWNSTREAM PATHWAY | Downstream signaling in naïve CD8+ T cells |
0.0 | 3.2 | NABA SECRETED FACTORS | Genes encoding secreted soluble factors |
0.0 | 0.1 | PID ECADHERIN NASCENT AJ PATHWAY | E-cadherin signaling in the nascent adherens junction |
0.0 | 0.1 | PID SHP2 PATHWAY | SHP2 signaling |
0.0 | 0.0 | PID EPHA2 FWD PATHWAY | EPHA2 forward signaling |
0.0 | 0.1 | PID CD8 TCR PATHWAY | TCR signaling in naïve CD8+ T cells |
0.0 | 0.2 | PID INTEGRIN2 PATHWAY | Beta2 integrin cell surface interactions |
0.0 | 2.5 | NABA ECM REGULATORS | Genes encoding enzymes and their regulators involved in the remodeling of the extracellular matrix |
0.0 | 0.0 | PID VEGFR1 PATHWAY | VEGFR1 specific signals |
0.0 | 0.2 | PID REG GR PATHWAY | Glucocorticoid receptor regulatory network |
0.0 | 0.0 | SIG CD40PATHWAYMAP | Genes related to CD40 signaling |
0.0 | 0.0 | SIG BCR SIGNALING PATHWAY | Members of the BCR signaling pathway |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.4 | 5.0 | REACTOME CASPASE MEDIATED CLEAVAGE OF CYTOSKELETAL PROTEINS | Genes involved in Caspase-mediated cleavage of cytoskeletal proteins |
0.4 | 3.7 | REACTOME PASSIVE TRANSPORT BY AQUAPORINS | Genes involved in Passive Transport by Aquaporins |
0.3 | 1.8 | REACTOME REGULATION OF ORNITHINE DECARBOXYLASE ODC | Genes involved in Regulation of ornithine decarboxylase (ODC) |
0.2 | 5.6 | REACTOME SMOOTH MUSCLE CONTRACTION | Genes involved in Smooth Muscle Contraction |
0.2 | 6.0 | REACTOME SEMA4D IN SEMAPHORIN SIGNALING | Genes involved in Sema4D in semaphorin signaling |
0.2 | 0.2 | REACTOME CDK MEDIATED PHOSPHORYLATION AND REMOVAL OF CDC6 | Genes involved in CDK-mediated phosphorylation and removal of Cdc6 |
0.2 | 3.2 | REACTOME REGULATION OF INSULIN LIKE GROWTH FACTOR IGF ACTIVITY BY INSULIN LIKE GROWTH FACTOR BINDING PROTEINS IGFBPS | Genes involved in Regulation of Insulin-like Growth Factor (IGF) Activity by Insulin-like Growth Factor Binding Proteins (IGFBPs) |
0.2 | 3.5 | REACTOME PHOSPHORYLATION OF THE APC C | Genes involved in Phosphorylation of the APC/C |
0.2 | 0.6 | REACTOME PKB MEDIATED EVENTS | Genes involved in PKB-mediated events |
0.2 | 1.8 | REACTOME APOPTOTIC CLEAVAGE OF CELL ADHESION PROTEINS | Genes involved in Apoptotic cleavage of cell adhesion proteins |
0.2 | 4.1 | REACTOME GLUTATHIONE CONJUGATION | Genes involved in Glutathione conjugation |
0.2 | 2.3 | REACTOME PROTEOLYTIC CLEAVAGE OF SNARE COMPLEX PROTEINS | Genes involved in Proteolytic cleavage of SNARE complex proteins |
0.2 | 2.1 | REACTOME ERKS ARE INACTIVATED | Genes involved in ERKs are inactivated |
0.2 | 2.2 | REACTOME N GLYCAN ANTENNAE ELONGATION | Genes involved in N-Glycan antennae elongation |
0.2 | 0.5 | REACTOME TRAF6 MEDIATED IRF7 ACTIVATION IN TLR7 8 OR 9 SIGNALING | Genes involved in TRAF6 mediated IRF7 activation in TLR7/8 or 9 signaling |
0.2 | 0.2 | REACTOME DOWNSTREAM SIGNALING EVENTS OF B CELL RECEPTOR BCR | Genes involved in Downstream Signaling Events Of B Cell Receptor (BCR) |
0.2 | 3.6 | REACTOME EFFECTS OF PIP2 HYDROLYSIS | Genes involved in Effects of PIP2 hydrolysis |
0.2 | 1.6 | REACTOME ADVANCED GLYCOSYLATION ENDPRODUCT RECEPTOR SIGNALING | Genes involved in Advanced glycosylation endproduct receptor signaling |
0.2 | 1.8 | REACTOME HORMONE SENSITIVE LIPASE HSL MEDIATED TRIACYLGLYCEROL HYDROLYSIS | Genes involved in Hormone-sensitive lipase (HSL)-mediated triacylglycerol hydrolysis |
0.2 | 2.9 | REACTOME SMAD2 SMAD3 SMAD4 HETEROTRIMER REGULATES TRANSCRIPTION | Genes involved in SMAD2/SMAD3:SMAD4 heterotrimer regulates transcription |
0.2 | 4.5 | REACTOME G1 PHASE | Genes involved in G1 Phase |
0.2 | 0.3 | REACTOME REGULATION OF SIGNALING BY CBL | Genes involved in Regulation of signaling by CBL |
0.2 | 1.8 | REACTOME DARPP 32 EVENTS | Genes involved in DARPP-32 events |
0.1 | 2.7 | REACTOME ACTIVATED AMPK STIMULATES FATTY ACID OXIDATION IN MUSCLE | Genes involved in Activated AMPK stimulates fatty-acid oxidation in muscle |
0.1 | 2.5 | REACTOME DEADENYLATION OF MRNA | Genes involved in Deadenylation of mRNA |
0.1 | 1.2 | REACTOME ABACAVIR TRANSPORT AND METABOLISM | Genes involved in Abacavir transport and metabolism |
0.1 | 1.9 | REACTOME SYNTHESIS OF VERY LONG CHAIN FATTY ACYL COAS | Genes involved in Synthesis of very long-chain fatty acyl-CoAs |
0.1 | 3.2 | REACTOME MUSCLE CONTRACTION | Genes involved in Muscle contraction |
0.1 | 1.3 | REACTOME CTNNB1 PHOSPHORYLATION CASCADE | Genes involved in Beta-catenin phosphorylation cascade |
0.1 | 0.7 | REACTOME IL 6 SIGNALING | Genes involved in Interleukin-6 signaling |
0.1 | 3.4 | REACTOME BIOSYNTHESIS OF THE N GLYCAN PRECURSOR DOLICHOL LIPID LINKED OLIGOSACCHARIDE LLO AND TRANSFER TO A NASCENT PROTEIN | Genes involved in Biosynthesis of the N-glycan precursor (dolichol lipid-linked oligosaccharide, LLO) and transfer to a nascent protein |
0.1 | 3.6 | REACTOME POST TRANSLATIONAL MODIFICATION SYNTHESIS OF GPI ANCHORED PROTEINS | Genes involved in Post-translational modification: synthesis of GPI-anchored proteins |
0.1 | 1.5 | REACTOME TRAFFICKING AND PROCESSING OF ENDOSOMAL TLR | Genes involved in Trafficking and processing of endosomal TLR |
0.1 | 1.9 | REACTOME METABOLISM OF PORPHYRINS | Genes involved in Metabolism of porphyrins |
0.1 | 3.3 | REACTOME SYNTHESIS OF PA | Genes involved in Synthesis of PA |
0.1 | 2.2 | REACTOME TERMINATION OF O GLYCAN BIOSYNTHESIS | Genes involved in Termination of O-glycan biosynthesis |
0.1 | 1.4 | REACTOME GLYCOGEN BREAKDOWN GLYCOGENOLYSIS | Genes involved in Glycogen breakdown (glycogenolysis) |
0.1 | 1.7 | REACTOME CELL EXTRACELLULAR MATRIX INTERACTIONS | Genes involved in Cell-extracellular matrix interactions |
0.1 | 2.1 | REACTOME NCAM SIGNALING FOR NEURITE OUT GROWTH | Genes involved in NCAM signaling for neurite out-growth |
0.1 | 0.4 | REACTOME UNWINDING OF DNA | Genes involved in Unwinding of DNA |
0.1 | 0.6 | REACTOME P130CAS LINKAGE TO MAPK SIGNALING FOR INTEGRINS | Genes involved in p130Cas linkage to MAPK signaling for integrins |
0.1 | 1.7 | REACTOME FORMATION OF INCISION COMPLEX IN GG NER | Genes involved in Formation of incision complex in GG-NER |
0.1 | 3.1 | REACTOME MEIOTIC RECOMBINATION | Genes involved in Meiotic Recombination |
0.1 | 1.3 | REACTOME PURINE SALVAGE | Genes involved in Purine salvage |
0.1 | 0.5 | REACTOME DCC MEDIATED ATTRACTIVE SIGNALING | Genes involved in DCC mediated attractive signaling |
0.1 | 1.5 | REACTOME MITOCHONDRIAL FATTY ACID BETA OXIDATION | Genes involved in Mitochondrial Fatty Acid Beta-Oxidation |
0.1 | 0.5 | REACTOME ADENYLATE CYCLASE INHIBITORY PATHWAY | Genes involved in Adenylate cyclase inhibitory pathway |
0.1 | 0.3 | REACTOME ELEVATION OF CYTOSOLIC CA2 LEVELS | Genes involved in Elevation of cytosolic Ca2+ levels |
0.1 | 2.1 | REACTOME GROWTH HORMONE RECEPTOR SIGNALING | Genes involved in Growth hormone receptor signaling |
0.1 | 1.2 | REACTOME MRNA DECAY BY 5 TO 3 EXORIBONUCLEASE | Genes involved in mRNA Decay by 5' to 3' Exoribonuclease |
0.1 | 0.8 | REACTOME SIGNALING BY EGFR IN CANCER | Genes involved in Signaling by EGFR in Cancer |
0.1 | 1.5 | REACTOME SIGNALING BY CONSTITUTIVELY ACTIVE EGFR | Genes involved in Signaling by constitutively active EGFR |
0.1 | 3.5 | REACTOME BMAL1 CLOCK NPAS2 ACTIVATES CIRCADIAN EXPRESSION | Genes involved in BMAL1:CLOCK/NPAS2 Activates Circadian Expression |
0.1 | 0.4 | REACTOME INFLUENZA LIFE CYCLE | Genes involved in Influenza Life Cycle |
0.1 | 0.7 | REACTOME ALPHA LINOLENIC ACID ALA METABOLISM | Genes involved in alpha-linolenic acid (ALA) metabolism |
0.1 | 1.0 | REACTOME P75NTR RECRUITS SIGNALLING COMPLEXES | Genes involved in p75NTR recruits signalling complexes |
0.1 | 0.2 | REACTOME BOTULINUM NEUROTOXICITY | Genes involved in Botulinum neurotoxicity |
0.1 | 1.0 | REACTOME SYNTHESIS OF PE | Genes involved in Synthesis of PE |
0.1 | 0.6 | REACTOME TRANSPORT OF MATURE MRNA DERIVED FROM AN INTRONLESS TRANSCRIPT | Genes involved in Transport of Mature mRNA Derived from an Intronless Transcript |
0.1 | 0.8 | REACTOME THE ACTIVATION OF ARYLSULFATASES | Genes involved in The activation of arylsulfatases |
0.1 | 0.5 | REACTOME APC CDC20 MEDIATED DEGRADATION OF NEK2A | Genes involved in APC-Cdc20 mediated degradation of Nek2A |
0.1 | 0.9 | REACTOME ACTIVATION OF CHAPERONES BY ATF6 ALPHA | Genes involved in Activation of Chaperones by ATF6-alpha |
0.1 | 6.4 | REACTOME RESPONSE TO ELEVATED PLATELET CYTOSOLIC CA2 | Genes involved in Response to elevated platelet cytosolic Ca2+ |
0.1 | 2.2 | REACTOME MEIOSIS | Genes involved in Meiosis |
0.1 | 3.9 | REACTOME GLYCEROPHOSPHOLIPID BIOSYNTHESIS | Genes involved in Glycerophospholipid biosynthesis |
0.1 | 6.4 | REACTOME MITOTIC PROMETAPHASE | Genes involved in Mitotic Prometaphase |
0.1 | 0.8 | REACTOME SIGNAL REGULATORY PROTEIN SIRP FAMILY INTERACTIONS | Genes involved in Signal regulatory protein (SIRP) family interactions |
0.1 | 1.3 | REACTOME AMYLOIDS | Genes involved in Amyloids |
0.1 | 0.8 | REACTOME NEF MEDIATED DOWNREGULATION OF MHC CLASS I COMPLEX CELL SURFACE EXPRESSION | Genes involved in Nef mediated downregulation of MHC class I complex cell surface expression |
0.1 | 0.8 | REACTOME OPSINS | Genes involved in Opsins |
0.1 | 1.8 | REACTOME CGMP EFFECTS | Genes involved in cGMP effects |
0.1 | 6.5 | REACTOME REGULATION OF MRNA STABILITY BY PROTEINS THAT BIND AU RICH ELEMENTS | Genes involved in Regulation of mRNA Stability by Proteins that Bind AU-rich Elements |
0.1 | 0.7 | REACTOME RAP1 SIGNALLING | Genes involved in Rap1 signalling |
0.1 | 1.8 | REACTOME TRANSPORT OF MATURE TRANSCRIPT TO CYTOPLASM | Genes involved in Transport of Mature Transcript to Cytoplasm |
0.1 | 1.8 | REACTOME CHOLESTEROL BIOSYNTHESIS | Genes involved in Cholesterol biosynthesis |
0.1 | 6.7 | REACTOME FACTORS INVOLVED IN MEGAKARYOCYTE DEVELOPMENT AND PLATELET PRODUCTION | Genes involved in Factors involved in megakaryocyte development and platelet production |
0.1 | 1.5 | REACTOME RNA POL III CHAIN ELONGATION | Genes involved in RNA Polymerase III Chain Elongation |
0.1 | 1.3 | REACTOME SIGNALING BY HIPPO | Genes involved in Signaling by Hippo |
0.1 | 3.4 | REACTOME ANTIVIRAL MECHANISM BY IFN STIMULATED GENES | Genes involved in Antiviral mechanism by IFN-stimulated genes |
0.1 | 1.7 | REACTOME INTERACTION BETWEEN L1 AND ANKYRINS | Genes involved in Interaction between L1 and Ankyrins |
0.1 | 0.2 | REACTOME RNA POL III TRANSCRIPTION TERMINATION | Genes involved in RNA Polymerase III Transcription Termination |
0.1 | 5.7 | REACTOME DIABETES PATHWAYS | Genes involved in Diabetes pathways |
0.1 | 0.7 | REACTOME NUCLEAR EVENTS KINASE AND TRANSCRIPTION FACTOR ACTIVATION | Genes involved in Nuclear Events (kinase and transcription factor activation) |
0.1 | 0.2 | REACTOME APOBEC3G MEDIATED RESISTANCE TO HIV1 INFECTION | Genes involved in APOBEC3G mediated resistance to HIV-1 infection |
0.1 | 1.1 | REACTOME CHYLOMICRON MEDIATED LIPID TRANSPORT | Genes involved in Chylomicron-mediated lipid transport |
0.1 | 0.5 | REACTOME ACTIVATION OF THE AP1 FAMILY OF TRANSCRIPTION FACTORS | Genes involved in Activation of the AP-1 family of transcription factors |
0.1 | 0.8 | REACTOME BILE SALT AND ORGANIC ANION SLC TRANSPORTERS | Genes involved in Bile salt and organic anion SLC transporters |
0.1 | 3.5 | REACTOME INTEGRIN CELL SURFACE INTERACTIONS | Genes involved in Integrin cell surface interactions |
0.1 | 0.7 | REACTOME ABORTIVE ELONGATION OF HIV1 TRANSCRIPT IN THE ABSENCE OF TAT | Genes involved in Abortive elongation of HIV-1 transcript in the absence of Tat |
0.1 | 0.1 | REACTOME CYTOKINE SIGNALING IN IMMUNE SYSTEM | Genes involved in Cytokine Signaling in Immune system |
0.1 | 0.8 | REACTOME FGFR2C LIGAND BINDING AND ACTIVATION | Genes involved in FGFR2c ligand binding and activation |
0.1 | 0.6 | REACTOME ACTIVATION OF BH3 ONLY PROTEINS | Genes involved in Activation of BH3-only proteins |
0.1 | 0.8 | REACTOME PTM GAMMA CARBOXYLATION HYPUSINE FORMATION AND ARYLSULFATASE ACTIVATION | Genes involved in PTM: gamma carboxylation, hypusine formation and arylsulfatase activation |
0.1 | 2.8 | REACTOME TRANSCRIPTIONAL REGULATION OF WHITE ADIPOCYTE DIFFERENTIATION | Genes involved in Transcriptional Regulation of White Adipocyte Differentiation |
0.1 | 0.5 | REACTOME HDL MEDIATED LIPID TRANSPORT | Genes involved in HDL-mediated lipid transport |
0.1 | 0.2 | REACTOME TRANSCRIPTIONAL ACTIVITY OF SMAD2 SMAD3 SMAD4 HETEROTRIMER | Genes involved in Transcriptional activity of SMAD2/SMAD3:SMAD4 heterotrimer |
0.1 | 0.4 | REACTOME SLBP DEPENDENT PROCESSING OF REPLICATION DEPENDENT HISTONE PRE MRNAS | Genes involved in SLBP Dependent Processing of Replication-Dependent Histone Pre-mRNAs |
0.1 | 1.4 | REACTOME TELOMERE MAINTENANCE | Genes involved in Telomere Maintenance |
0.1 | 0.5 | REACTOME TIE2 SIGNALING | Genes involved in Tie2 Signaling |
0.1 | 0.5 | REACTOME DOWNREGULATION OF TGF BETA RECEPTOR SIGNALING | Genes involved in Downregulation of TGF-beta receptor signaling |
0.1 | 0.1 | REACTOME SHC1 EVENTS IN EGFR SIGNALING | Genes involved in SHC1 events in EGFR signaling |
0.1 | 0.2 | REACTOME HOMOLOGOUS RECOMBINATION REPAIR OF REPLICATION INDEPENDENT DOUBLE STRAND BREAKS | Genes involved in Homologous recombination repair of replication-independent double-strand breaks |
0.1 | 0.1 | REACTOME RETROGRADE NEUROTROPHIN SIGNALLING | Genes involved in Retrograde neurotrophin signalling |
0.1 | 1.3 | REACTOME ENDOSOMAL SORTING COMPLEX REQUIRED FOR TRANSPORT ESCRT | Genes involved in Endosomal Sorting Complex Required For Transport (ESCRT) |
0.1 | 1.6 | REACTOME IMMUNOREGULATORY INTERACTIONS BETWEEN A LYMPHOID AND A NON LYMPHOID CELL | Genes involved in Immunoregulatory interactions between a Lymphoid and a non-Lymphoid cell |
0.1 | 1.7 | REACTOME AMINO ACID TRANSPORT ACROSS THE PLASMA MEMBRANE | Genes involved in Amino acid transport across the plasma membrane |
0.1 | 1.1 | REACTOME SULFUR AMINO ACID METABOLISM | Genes involved in Sulfur amino acid metabolism |
0.1 | 0.1 | REACTOME REGULATION OF AMPK ACTIVITY VIA LKB1 | Genes involved in Regulation of AMPK activity via LKB1 |
0.1 | 0.6 | REACTOME ACTIVATED TAK1 MEDIATES P38 MAPK ACTIVATION | Genes involved in activated TAK1 mediates p38 MAPK activation |
0.1 | 1.0 | REACTOME SIGNALING BY BMP | Genes involved in Signaling by BMP |
0.1 | 0.9 | REACTOME ACTIVATION OF THE PRE REPLICATIVE COMPLEX | Genes involved in Activation of the pre-replicative complex |
0.0 | 0.6 | REACTOME ZINC TRANSPORTERS | Genes involved in Zinc transporters |
0.0 | 0.4 | REACTOME IRON UPTAKE AND TRANSPORT | Genes involved in Iron uptake and transport |
0.0 | 0.8 | REACTOME GAP JUNCTION ASSEMBLY | Genes involved in Gap junction assembly |
0.0 | 0.4 | REACTOME REGULATORY RNA PATHWAYS | Genes involved in Regulatory RNA pathways |
0.0 | 0.5 | REACTOME GLUCOSE TRANSPORT | Genes involved in Glucose transport |
0.0 | 1.1 | REACTOME GLYCOSPHINGOLIPID METABOLISM | Genes involved in Glycosphingolipid metabolism |
0.0 | 2.8 | REACTOME TRANSPORT OF INORGANIC CATIONS ANIONS AND AMINO ACIDS OLIGOPEPTIDES | Genes involved in Transport of inorganic cations/anions and amino acids/oligopeptides |
0.0 | 0.4 | REACTOME OXYGEN DEPENDENT PROLINE HYDROXYLATION OF HYPOXIA INDUCIBLE FACTOR ALPHA | Genes involved in Oxygen-dependent Proline Hydroxylation of Hypoxia-inducible Factor Alpha |
0.0 | 0.4 | REACTOME PLATELET AGGREGATION PLUG FORMATION | Genes involved in Platelet Aggregation (Plug Formation) |
0.0 | 0.6 | REACTOME ASSOCIATION OF TRIC CCT WITH TARGET PROTEINS DURING BIOSYNTHESIS | Genes involved in Association of TriC/CCT with target proteins during biosynthesis |
0.0 | 1.5 | REACTOME DOWNSTREAM SIGNAL TRANSDUCTION | Genes involved in Downstream signal transduction |
0.0 | 0.1 | REACTOME METAL ION SLC TRANSPORTERS | Genes involved in Metal ion SLC transporters |
0.0 | 0.5 | REACTOME TANDEM PORE DOMAIN POTASSIUM CHANNELS | Genes involved in Tandem pore domain potassium channels |
0.0 | 0.4 | REACTOME ACTIVATION OF NF KAPPAB IN B CELLS | Genes involved in Activation of NF-kappaB in B Cells |
0.0 | 1.2 | REACTOME SPHINGOLIPID DE NOVO BIOSYNTHESIS | Genes involved in Sphingolipid de novo biosynthesis |
0.0 | 1.4 | REACTOME NRAGE SIGNALS DEATH THROUGH JNK | Genes involved in NRAGE signals death through JNK |
0.0 | 0.6 | REACTOME SRP DEPENDENT COTRANSLATIONAL PROTEIN TARGETING TO MEMBRANE | Genes involved in SRP-dependent cotranslational protein targeting to membrane |
0.0 | 0.2 | REACTOME NRIF SIGNALS CELL DEATH FROM THE NUCLEUS | Genes involved in NRIF signals cell death from the nucleus |
0.0 | 2.6 | REACTOME SIGNALING BY RHO GTPASES | Genes involved in Signaling by Rho GTPases |
0.0 | 0.2 | REACTOME ANTIGEN ACTIVATES B CELL RECEPTOR LEADING TO GENERATION OF SECOND MESSENGERS | Genes involved in Antigen Activates B Cell Receptor Leading to Generation of Second Messengers |
0.0 | 0.2 | REACTOME HYALURONAN UPTAKE AND DEGRADATION | Genes involved in Hyaluronan uptake and degradation |
0.0 | 0.6 | REACTOME NUCLEOTIDE LIKE PURINERGIC RECEPTORS | Genes involved in Nucleotide-like (purinergic) receptors |
0.0 | 0.3 | REACTOME APOPTOTIC CLEAVAGE OF CELLULAR PROTEINS | Genes involved in Apoptotic cleavage of cellular proteins |
0.0 | 0.1 | REACTOME ROLE OF SECOND MESSENGERS IN NETRIN1 SIGNALING | Genes involved in Role of second messengers in netrin-1 signaling |
0.0 | 1.7 | REACTOME METABOLISM OF VITAMINS AND COFACTORS | Genes involved in Metabolism of vitamins and cofactors |
0.0 | 1.0 | REACTOME INTERFERON GAMMA SIGNALING | Genes involved in Interferon gamma signaling |
0.0 | 1.5 | REACTOME NUCLEAR RECEPTOR TRANSCRIPTION PATHWAY | Genes involved in Nuclear Receptor transcription pathway |
0.0 | 0.1 | REACTOME ENERGY DEPENDENT REGULATION OF MTOR BY LKB1 AMPK | Genes involved in Energy dependent regulation of mTOR by LKB1-AMPK |
0.0 | 0.1 | REACTOME APOPTOSIS INDUCED DNA FRAGMENTATION | Genes involved in Apoptosis induced DNA fragmentation |
0.0 | 0.3 | REACTOME NA CL DEPENDENT NEUROTRANSMITTER TRANSPORTERS | Genes involved in Na+/Cl- dependent neurotransmitter transporters |
0.0 | 0.1 | REACTOME APC C CDH1 MEDIATED DEGRADATION OF CDC20 AND OTHER APC C CDH1 TARGETED PROTEINS IN LATE MITOSIS EARLY G1 | Genes involved in APC/C:Cdh1 mediated degradation of Cdc20 and other APC/C:Cdh1 targeted proteins in late mitosis/early G1 |
0.0 | 1.0 | REACTOME LATENT INFECTION OF HOMO SAPIENS WITH MYCOBACTERIUM TUBERCULOSIS | Genes involved in Latent infection of Homo sapiens with Mycobacterium tuberculosis |
0.0 | 0.3 | REACTOME SIGNALING BY FGFR1 FUSION MUTANTS | Genes involved in Signaling by FGFR1 fusion mutants |
0.0 | 0.8 | REACTOME PRE NOTCH EXPRESSION AND PROCESSING | Genes involved in Pre-NOTCH Expression and Processing |
0.0 | 0.1 | REACTOME DIGESTION OF DIETARY CARBOHYDRATE | Genes involved in Digestion of dietary carbohydrate |
0.0 | 0.8 | REACTOME PREFOLDIN MEDIATED TRANSFER OF SUBSTRATE TO CCT TRIC | Genes involved in Prefoldin mediated transfer of substrate to CCT/TriC |
0.0 | 0.2 | REACTOME ETHANOL OXIDATION | Genes involved in Ethanol oxidation |
0.0 | 0.4 | REACTOME AMINE DERIVED HORMONES | Genes involved in Amine-derived hormones |
0.0 | 0.5 | REACTOME INTERFERON SIGNALING | Genes involved in Interferon Signaling |
0.0 | 0.2 | REACTOME TRAFFICKING OF GLUR2 CONTAINING AMPA RECEPTORS | Genes involved in Trafficking of GluR2-containing AMPA receptors |
0.0 | 3.5 | REACTOME ANTIGEN PROCESSING UBIQUITINATION PROTEASOME DEGRADATION | Genes involved in Antigen processing: Ubiquitination & Proteasome degradation |
0.0 | 0.1 | REACTOME RNA POL I PROMOTER OPENING | Genes involved in RNA Polymerase I Promoter Opening |
0.0 | 0.3 | REACTOME NOD1 2 SIGNALING PATHWAY | Genes involved in NOD1/2 Signaling Pathway |
0.0 | 0.0 | REACTOME SIGNALING BY FGFR3 MUTANTS | Genes involved in Signaling by FGFR3 mutants |
0.0 | 0.7 | REACTOME SYNTHESIS OF PIPS AT THE PLASMA MEMBRANE | Genes involved in Synthesis of PIPs at the plasma membrane |
0.0 | 0.4 | REACTOME PEROXISOMAL LIPID METABOLISM | Genes involved in Peroxisomal lipid metabolism |
0.0 | 0.0 | REACTOME BINDING AND ENTRY OF HIV VIRION | Genes involved in Binding and entry of HIV virion |
0.0 | 0.5 | REACTOME GENERIC TRANSCRIPTION PATHWAY | Genes involved in Generic Transcription Pathway |
0.0 | 0.6 | REACTOME TIGHT JUNCTION INTERACTIONS | Genes involved in Tight junction interactions |
0.0 | 0.3 | REACTOME RESOLUTION OF AP SITES VIA THE SINGLE NUCLEOTIDE REPLACEMENT PATHWAY | Genes involved in Resolution of AP sites via the single-nucleotide replacement pathway |
0.0 | 1.0 | REACTOME CHEMOKINE RECEPTORS BIND CHEMOKINES | Genes involved in Chemokine receptors bind chemokines |
0.0 | 0.2 | REACTOME GLUCURONIDATION | Genes involved in Glucuronidation |
0.0 | 0.2 | REACTOME SIGNALING BY FGFR MUTANTS | Genes involved in Signaling by FGFR mutants |
0.0 | 0.2 | REACTOME ANTIGEN PRESENTATION FOLDING ASSEMBLY AND PEPTIDE LOADING OF CLASS I MHC | Genes involved in Antigen Presentation: Folding, assembly and peptide loading of class I MHC |
0.0 | 0.0 | REACTOME REGULATION OF KIT SIGNALING | Genes involved in Regulation of KIT signaling |
0.0 | 0.5 | REACTOME MHC CLASS II ANTIGEN PRESENTATION | Genes involved in MHC class II antigen presentation |
0.0 | 0.1 | REACTOME VEGF LIGAND RECEPTOR INTERACTIONS | Genes involved in VEGF ligand-receptor interactions |
0.0 | 0.7 | REACTOME AMINE LIGAND BINDING RECEPTORS | Genes involved in Amine ligand-binding receptors |
0.0 | 0.1 | REACTOME XENOBIOTICS | Genes involved in Xenobiotics |
0.0 | 1.9 | REACTOME NONSENSE MEDIATED DECAY ENHANCED BY THE EXON JUNCTION COMPLEX | Genes involved in Nonsense Mediated Decay Enhanced by the Exon Junction Complex |
0.0 | 0.1 | REACTOME SYNTHESIS OF BILE ACIDS AND BILE SALTS VIA 24 HYDROXYCHOLESTEROL | Genes involved in Synthesis of bile acids and bile salts via 24-hydroxycholesterol |
0.0 | 0.2 | REACTOME REGULATION OF COMPLEMENT CASCADE | Genes involved in Regulation of Complement cascade |
0.0 | 0.2 | REACTOME IL RECEPTOR SHC SIGNALING | Genes involved in Interleukin receptor SHC signaling |
0.0 | 0.1 | REACTOME SEMA3A PAK DEPENDENT AXON REPULSION | Genes involved in Sema3A PAK dependent Axon repulsion |
0.0 | 0.2 | REACTOME GENERATION OF SECOND MESSENGER MOLECULES | Genes involved in Generation of second messenger molecules |
0.0 | 0.1 | REACTOME E2F MEDIATED REGULATION OF DNA REPLICATION | Genes involved in E2F mediated regulation of DNA replication |
0.0 | 0.8 | REACTOME COLLAGEN FORMATION | Genes involved in Collagen formation |
0.0 | 0.0 | REACTOME MAP KINASE ACTIVATION IN TLR CASCADE | Genes involved in MAP kinase activation in TLR cascade |
0.0 | 0.8 | REACTOME MITOCHONDRIAL PROTEIN IMPORT | Genes involved in Mitochondrial Protein Import |
0.0 | 0.2 | REACTOME INTRINSIC PATHWAY FOR APOPTOSIS | Genes involved in Intrinsic Pathway for Apoptosis |
0.0 | 0.1 | REACTOME SIGNALING BY FGFR IN DISEASE | Genes involved in Signaling by FGFR in disease |
0.0 | 0.5 | REACTOME PHASE1 FUNCTIONALIZATION OF COMPOUNDS | Genes involved in Phase 1 - Functionalization of compounds |
0.0 | 0.2 | REACTOME IL1 SIGNALING | Genes involved in Interleukin-1 signaling |
0.0 | 0.1 | REACTOME LIPID DIGESTION MOBILIZATION AND TRANSPORT | Genes involved in Lipid digestion, mobilization, and transport |
0.0 | 0.2 | REACTOME G0 AND EARLY G1 | Genes involved in G0 and Early G1 |
0.0 | 0.0 | REACTOME GAP JUNCTION TRAFFICKING | Genes involved in Gap junction trafficking |
0.0 | 0.1 | REACTOME CYCLIN A B1 ASSOCIATED EVENTS DURING G2 M TRANSITION | Genes involved in Cyclin A/B1 associated events during G2/M transition |
0.0 | 0.4 | REACTOME O LINKED GLYCOSYLATION OF MUCINS | Genes involved in O-linked glycosylation of mucins |
0.0 | 0.1 | REACTOME KERATAN SULFATE DEGRADATION | Genes involved in Keratan sulfate degradation |
0.0 | 0.2 | REACTOME TOLL RECEPTOR CASCADES | Genes involved in Toll Receptor Cascades |
0.0 | 0.0 | REACTOME RIP MEDIATED NFKB ACTIVATION VIA DAI | Genes involved in RIP-mediated NFkB activation via DAI |
0.0 | 0.0 | REACTOME REGULATION OF HYPOXIA INDUCIBLE FACTOR HIF BY OXYGEN | Genes involved in Regulation of Hypoxia-inducible Factor (HIF) by Oxygen |
0.0 | 0.1 | REACTOME RNA POL I TRANSCRIPTION INITIATION | Genes involved in RNA Polymerase I Transcription Initiation |
0.0 | 0.1 | REACTOME FANCONI ANEMIA PATHWAY | Genes involved in Fanconi Anemia pathway |
0.0 | 0.0 | REACTOME FATTY ACYL COA BIOSYNTHESIS | Genes involved in Fatty Acyl-CoA Biosynthesis |
0.0 | 0.1 | REACTOME ACTIVATION OF IRF3 IRF7 MEDIATED BY TBK1 IKK EPSILON | Genes involved in Activation of IRF3/IRF7 mediated by TBK1/IKK epsilon |