Gene Symbol | Gene ID | Gene Info |
---|---|---|
Pax8
|
ENSMUSG00000026976.9 | Pax8 |
CRE | Gene | Distance | Association probability | Pearson corr. coef. | P-value | Plot |
---|---|---|---|---|---|---|
Pax8 | chr2_24428384_24428703 | 5461 | 0.152088 | 0.63 | 2.9e-07 | Click! |
Pax8 | chr2_24427952_24428346 | 5067 | 0.155126 | 0.59 | 2.6e-06 | Click! |
Pax8 | chr2_24474253_24474426 | 758 | 0.561667 | 0.49 | 1.7e-04 | Click! |
Pax8 | chr2_24475128_24475279 | 12 | 0.967626 | 0.46 | 4.6e-04 | Click! |
Pax8 | chr2_24416723_24417322 | 6060 | 0.149633 | 0.43 | 9.7e-04 | Click! |
Move your cursor over a bar to see sample name and corresponding Z-value.
Cis Regulatory Element (CRE) | Target Score | Top associated gene | Gene Info | Distance of CRE to TSS | CRE/Gene association probability |
---|---|---|---|---|---|
chr9_124439906_124440949 | 4.43 |
Ppp2r3d |
protein phosphatase 2 (formerly 2A), regulatory subunit B'', delta |
441 |
0.79 |
chr5_100108777_100109262 | 3.75 |
Tmem150c |
transmembrane protein 150C |
13777 |
0.15 |
chr15_25026794_25027094 | 3.30 |
Gm2824 |
predicted gene 2824 |
393 |
0.9 |
chr5_149496513_149496757 | 3.13 |
Gm2566 |
predicted gene 2566 |
6417 |
0.14 |
chr3_26641406_26641733 | 3.10 |
Spata16 |
spermatogenesis associated 16 |
3919 |
0.29 |
chr7_75868535_75868959 | 3.09 |
Klhl25 |
kelch-like 25 |
20306 |
0.21 |
chr2_75246191_75246393 | 3.06 |
2600014E21Rik |
RIKEN cDNA 2600014E21 gene |
2108 |
0.3 |
chr17_65961618_65962124 | 2.79 |
Ankrd12 |
ankyrin repeat domain 12 |
10521 |
0.14 |
chr18_31695429_31695731 | 2.77 |
Gm50060 |
predicted gene, 50060 |
43135 |
0.11 |
chrX_105391659_105392013 | 2.66 |
5330434G04Rik |
RIKEN cDNA 5330434G04 gene |
60 |
0.97 |
chr4_5724465_5724747 | 2.64 |
Fam110b |
family with sequence similarity 110, member B |
294 |
0.93 |
chr7_73917720_73918558 | 2.60 |
Gm45003 |
predicted gene 45003 |
29395 |
0.14 |
chr12_29789065_29789261 | 2.52 |
Myt1l |
myelin transcription factor 1-like |
51047 |
0.17 |
chr14_34822716_34823193 | 2.51 |
Grid1 |
glutamate receptor, ionotropic, delta 1 |
2846 |
0.27 |
chr12_46646139_46646307 | 2.46 |
Gm48535 |
predicted gene, 48535 |
19486 |
0.16 |
chr6_6163092_6163256 | 2.39 |
Slc25a13 |
solute carrier family 25 (mitochondrial carrier, adenine nucleotide translocator), member 13 |
10777 |
0.26 |
chr8_13454338_13454755 | 2.31 |
Tmem255b |
transmembrane protein 255B |
932 |
0.51 |
chr8_93570159_93570566 | 2.21 |
Gm45708 |
predicted gene 45708 |
5081 |
0.21 |
chr2_179481023_179481235 | 2.18 |
Cdh4 |
cadherin 4 |
36896 |
0.19 |
chr5_92698263_92699271 | 2.17 |
Shroom3 |
shroom family member 3 |
15142 |
0.16 |
chr12_58512603_58512786 | 2.16 |
Clec14a |
C-type lectin domain family 14, member a |
243404 |
0.02 |
chr14_66934804_66935164 | 2.14 |
4930578I07Rik |
RIKEN cDNA 4930578I07 gene |
2381 |
0.22 |
chr12_52700072_52700263 | 2.11 |
Akap6 |
A kinase (PRKA) anchor protein 6 |
784 |
0.68 |
chr3_68513686_68514094 | 2.09 |
Schip1 |
schwannomin interacting protein 1 |
19682 |
0.2 |
chr4_33736162_33736317 | 2.07 |
Gm24341 |
predicted gene, 24341 |
54748 |
0.15 |
chr1_87142553_87142816 | 2.07 |
Gm29374 |
predicted gene 29374 |
4299 |
0.11 |
chr14_34969519_34969852 | 2.06 |
Mir346 |
microRNA 346 |
75076 |
0.11 |
chr14_66494473_66494955 | 2.05 |
Gm23899 |
predicted gene, 23899 |
96981 |
0.07 |
chr15_92161110_92161283 | 2.01 |
Cntn1 |
contactin 1 |
161 |
0.97 |
chr2_48629270_48629461 | 2.00 |
Gm13481 |
predicted gene 13481 |
172120 |
0.03 |
chr10_23674681_23675112 | 1.95 |
4930520K02Rik |
RIKEN cDNA 4930520K02 gene |
52748 |
0.11 |
chr14_64233778_64233929 | 1.95 |
9630015K15Rik |
RIKEN cDNA 9630015K15 gene |
117539 |
0.05 |
chr3_63740267_63740465 | 1.94 |
Plch1 |
phospholipase C, eta 1 |
499 |
0.82 |
chr4_56128107_56128471 | 1.93 |
Gm12520 |
predicted gene 12520 |
34651 |
0.21 |
chr17_65742516_65742902 | 1.93 |
Rab31 |
RAB31, member RAS oncogene family |
29931 |
0.15 |
chr12_13984177_13984402 | 1.92 |
Gm48479 |
predicted gene, 48479 |
28795 |
0.19 |
chr8_34386163_34386360 | 1.90 |
Gm33831 |
predicted gene, 33831 |
433 |
0.81 |
chr8_125255021_125255229 | 1.90 |
Gm16237 |
predicted gene 16237 |
27802 |
0.23 |
chr4_82915979_82916332 | 1.89 |
Frem1 |
Fras1 related extracellular matrix protein 1 |
1721 |
0.41 |
chr13_8680903_8681086 | 1.89 |
Adarb2 |
adenosine deaminase, RNA-specific, B2 |
77335 |
0.08 |
chr18_39929959_39930127 | 1.88 |
Gm41708 |
predicted gene, 41708 |
669 |
0.81 |
chr1_34665546_34665842 | 1.87 |
Arhgef4 |
Rho guanine nucleotide exchange factor (GEF) 4 |
12494 |
0.12 |
chr9_34202990_34203187 | 1.87 |
Gm27161 |
predicted gene 27161 |
2860 |
0.39 |
chr12_14088942_14089093 | 1.85 |
Gm48482 |
predicted gene, 48482 |
41631 |
0.15 |
chr2_51066438_51066648 | 1.85 |
Rnd3 |
Rho family GTPase 3 |
82551 |
0.1 |
chr10_28464875_28465041 | 1.83 |
Ptprk |
protein tyrosine phosphatase, receptor type, K |
95193 |
0.09 |
chr2_26500316_26500756 | 1.82 |
Notch1 |
notch 1 |
3286 |
0.14 |
chr2_79352157_79352308 | 1.81 |
Gm22606 |
predicted gene, 22606 |
3867 |
0.22 |
chr8_84494821_84494973 | 1.77 |
Cacna1a |
calcium channel, voltage-dependent, P/Q type, alpha 1A subunit |
52197 |
0.11 |
chr13_104517962_104518622 | 1.77 |
2610204G07Rik |
RIKEN cDNA 2610204G07 gene |
166639 |
0.03 |
chr3_107113954_107114434 | 1.77 |
Kcna2 |
potassium voltage-gated channel, shaker-related subfamily, member 2 |
11512 |
0.15 |
chr11_42000751_42000937 | 1.76 |
Gabrg2 |
gamma-aminobutyric acid (GABA) A receptor, subunit gamma 2 |
13 |
0.99 |
chr15_26021931_26022113 | 1.75 |
Zfp622 |
zinc finger protein 622 |
26986 |
0.18 |
chr11_33772843_33773020 | 1.75 |
Gm12120 |
predicted gene 12120 |
67381 |
0.1 |
chr15_91018414_91018934 | 1.75 |
Kif21a |
kinesin family member 21A |
31144 |
0.16 |
chr10_106975829_106976048 | 1.75 |
Gm19007 |
predicted gene, 19007 |
26641 |
0.2 |
chr15_100910457_100910608 | 1.72 |
Scn8a |
sodium channel, voltage-gated, type VIII, alpha |
22897 |
0.17 |
chr5_53992667_53992980 | 1.71 |
Stim2 |
stromal interaction molecule 2 |
5676 |
0.27 |
chr8_14740404_14740731 | 1.69 |
Dlgap2 |
DLG associated protein 2 |
2186 |
0.34 |
chr9_62480807_62480958 | 1.69 |
Coro2b |
coronin, actin binding protein, 2B |
29616 |
0.18 |
chr8_18311041_18311326 | 1.69 |
1700014L14Rik |
RIKEN cDNA 1700014L14 gene |
23155 |
0.22 |
chr3_88238770_88239032 | 1.69 |
Gm3764 |
predicted gene 3764 |
10118 |
0.07 |
chr4_134631621_134631772 | 1.68 |
Mir6403 |
microRNA 6403 |
63845 |
0.08 |
chr6_59407597_59407748 | 1.68 |
Gprin3 |
GPRIN family member 3 |
18622 |
0.28 |
chr2_38622053_38622204 | 1.67 |
Gm13586 |
predicted gene 13586 |
673 |
0.59 |
chr2_52512323_52512474 | 1.67 |
Gm13541 |
predicted gene 13541 |
39571 |
0.14 |
chr5_85239463_85240008 | 1.66 |
Gm21006 |
predicted gene, 21006 |
372890 |
0.01 |
chr17_9849141_9849307 | 1.65 |
Gm34883 |
predicted gene, 34883 |
36 |
0.98 |
chr5_21947651_21947834 | 1.65 |
Dnaja1-ps |
DnaJ heat shock protein family (Hsp40) member A1, pseudogene |
4757 |
0.16 |
chr9_102249536_102249697 | 1.65 |
Gm37260 |
predicted gene, 37260 |
24120 |
0.17 |
chr8_83389953_83390240 | 1.64 |
Clgn |
calmegin |
218 |
0.91 |
chr6_124915577_124916697 | 1.64 |
Ptms |
parathymosin |
608 |
0.37 |
chr10_39535386_39535619 | 1.63 |
Fyn |
Fyn proto-oncogene |
2232 |
0.3 |
chr11_109358733_109358903 | 1.61 |
Gna13 |
guanine nucleotide binding protein, alpha 13 |
4013 |
0.16 |
chr9_100440100_100440330 | 1.61 |
Gm28166 |
predicted gene 28166 |
10107 |
0.15 |
chr1_159593926_159594077 | 1.60 |
Gm37731 |
predicted gene, 37731 |
1147 |
0.54 |
chr9_92174418_92174607 | 1.60 |
Plscr5 |
phospholipid scramblase family, member 5 |
18424 |
0.21 |
chr19_18890461_18890612 | 1.60 |
Trpm6 |
transient receptor potential cation channel, subfamily M, member 6 |
49899 |
0.16 |
chr1_83276868_83277019 | 1.60 |
Sphkap |
SPHK1 interactor, AKAP domain containing |
2222 |
0.27 |
chr17_32180071_32180417 | 1.60 |
Gm50127 |
predicted gene, 50127 |
3093 |
0.16 |
chr1_139080602_139080802 | 1.59 |
Dennd1b |
DENN/MADD domain containing 1B |
5222 |
0.14 |
chrX_140279338_140279615 | 1.58 |
Gm15046 |
predicted gene 15046 |
1614 |
0.42 |
chr6_91286561_91286982 | 1.57 |
Fbln2 |
fibulin 2 |
20892 |
0.16 |
chr9_45651665_45651844 | 1.57 |
Gm22069 |
predicted gene, 22069 |
16942 |
0.18 |
chrX_136104453_136104604 | 1.57 |
5730412P04Rik |
RIKEN cDNA 5730412P04 gene |
75 |
0.96 |
chr11_12231499_12232054 | 1.57 |
Gm12002 |
predicted gene 12002 |
82738 |
0.09 |
chr4_125696238_125696577 | 1.56 |
Mir692-2 |
microRNA 692-2 |
191658 |
0.02 |
chr4_21095762_21096024 | 1.55 |
Gm11871 |
predicted gene 11871 |
84953 |
0.1 |
chr1_57875514_57875995 | 1.53 |
Spats2l |
spermatogenesis associated, serine-rich 2-like |
26317 |
0.18 |
chr17_57086976_57087480 | 1.53 |
Tubb4a |
tubulin, beta 4A class IVA |
554 |
0.53 |
chr14_62003120_62003302 | 1.52 |
Gm47953 |
predicted gene, 47953 |
9108 |
0.26 |
chr3_28265162_28265345 | 1.52 |
Tnik |
TRAF2 and NCK interacting kinase |
1610 |
0.41 |
chr16_74397266_74397471 | 1.52 |
Robo2 |
roundabout guidance receptor 2 |
13544 |
0.25 |
chr5_4812167_4812377 | 1.51 |
Gm44483 |
predicted gene, 44483 |
9815 |
0.12 |
chr13_102698951_102699272 | 1.51 |
Cd180 |
CD180 antigen |
5500 |
0.24 |
chr2_65995622_65995773 | 1.50 |
Gm13617 |
predicted gene 13617 |
41627 |
0.15 |
chrX_70328630_70328781 | 1.50 |
Ids |
iduronate 2-sulfatase |
32386 |
0.12 |
chr12_45466153_45466321 | 1.50 |
Gm33680 |
predicted gene, 33680 |
36 |
0.98 |
chr2_102620868_102621066 | 1.50 |
Pamr1 |
peptidase domain containing associated with muscle regeneration 1 |
15058 |
0.23 |
chr9_42187408_42187734 | 1.49 |
4930546K05Rik |
RIKEN cDNA 4930546K05 gene |
21642 |
0.17 |
chr5_111843996_111844162 | 1.49 |
Gm36535 |
predicted gene, 36535 |
50692 |
0.13 |
chr7_51749835_51750061 | 1.49 |
Gm7336 |
predicted gene 7336 |
3301 |
0.23 |
chr3_57920145_57920311 | 1.48 |
Gm24531 |
predicted gene, 24531 |
1959 |
0.28 |
chr6_66121913_66122064 | 1.48 |
Gm5876 |
predicted gene 5876 |
126351 |
0.04 |
chr13_29273638_29274140 | 1.47 |
Gm11364 |
predicted gene 11364 |
37269 |
0.22 |
chr10_70952281_70952535 | 1.47 |
Bicc1 |
BicC family RNA binding protein 1 |
3919 |
0.2 |
chr14_105483385_105483748 | 1.47 |
4930449E01Rik |
RIKEN cDNA 4930449E01 gene |
15222 |
0.19 |
chr4_111443852_111444203 | 1.46 |
Bend5 |
BEN domain containing 5 |
10708 |
0.22 |
chr2_113829328_113829522 | 1.46 |
Scg5 |
secretogranin V |
304 |
0.91 |
chr1_39774224_39774380 | 1.46 |
Gm3646 |
predicted gene 3646 |
31030 |
0.16 |
chr10_92166162_92166313 | 1.44 |
Rmst |
rhabdomyosarcoma 2 associated transcript (non-coding RNA) |
1067 |
0.55 |
chr2_4113634_4113785 | 1.44 |
Gm38085 |
predicted gene, 38085 |
9832 |
0.11 |
chr14_119857299_119857740 | 1.43 |
4930404K13Rik |
RIKEN cDNA 4930404K13 gene |
58541 |
0.13 |
chr10_21145268_21145562 | 1.43 |
Gm26577 |
predicted gene, 26577 |
321 |
0.81 |
chr17_63285231_63285795 | 1.43 |
4930405O22Rik |
RIKEN cDNA 4930405O22 gene |
27458 |
0.19 |
chr13_12340200_12340584 | 1.41 |
Actn2 |
actinin alpha 2 |
332 |
0.88 |
chr8_95001110_95002377 | 1.40 |
Adgrg1 |
adhesion G protein-coupled receptor G1 |
862 |
0.47 |
chr3_18054074_18054270 | 1.40 |
Bhlhe22 |
basic helix-loop-helix family, member e22 |
2 |
0.98 |
chr6_12118198_12118536 | 1.40 |
Gm6578 |
predicted gene 6578 |
8784 |
0.23 |
chr3_33074300_33074451 | 1.40 |
Gm19445 |
predicted gene, 19445 |
1981 |
0.28 |
chr2_79362121_79362311 | 1.40 |
Gm13673 |
predicted gene 13673 |
2351 |
0.28 |
chr6_103810795_103811013 | 1.40 |
Gm25656 |
predicted gene, 25656 |
21674 |
0.25 |
chr6_52064424_52064620 | 1.40 |
Halr1 |
Hoxa adjacent long noncoding RNA 1 |
38427 |
0.08 |
chr14_76255061_76255467 | 1.40 |
2900040C04Rik |
RIKEN cDNA 2900040C04 gene |
3807 |
0.27 |
chr5_20056465_20056826 | 1.39 |
Gm23570 |
predicted gene, 23570 |
35970 |
0.2 |
chr9_77502289_77502465 | 1.38 |
Lrrc1 |
leucine rich repeat containing 1 |
30067 |
0.14 |
chr3_68139235_68139398 | 1.38 |
Schip1 |
schwannomin interacting protein 1 |
74514 |
0.12 |
chr5_73400144_73400338 | 1.38 |
Gm35960 |
predicted gene, 35960 |
2428 |
0.19 |
chr6_104493049_104493242 | 1.38 |
Cntn6 |
contactin 6 |
91 |
0.99 |
chr9_77502694_77502965 | 1.38 |
Lrrc1 |
leucine rich repeat containing 1 |
29615 |
0.14 |
chr13_48131907_48132058 | 1.37 |
Gm36101 |
predicted gene, 36101 |
100209 |
0.06 |
chr1_75725382_75725667 | 1.36 |
Gm5257 |
predicted gene 5257 |
89134 |
0.07 |
chr15_68301101_68301252 | 1.35 |
Gm10240 |
predicted gene 10240 |
8643 |
0.14 |
chr15_84105394_84105979 | 1.35 |
Sult4a1 |
sulfotransferase family 4A, member 1 |
68 |
0.93 |
chr1_85916954_85917154 | 1.35 |
Itm2c |
integral membrane protein 2C |
10893 |
0.12 |
chr3_89559332_89559497 | 1.34 |
Kcnn3 |
potassium intermediate/small conductance calcium-activated channel, subfamily N, member 3 |
39250 |
0.12 |
chr17_45555491_45556095 | 1.34 |
Nfkbie |
nuclear factor of kappa light polypeptide gene enhancer in B cells inhibitor, epsilon |
54 |
0.94 |
chr16_77291582_77292053 | 1.34 |
Gm31258 |
predicted gene, 31258 |
13743 |
0.19 |
chr9_42240657_42241031 | 1.34 |
Sc5d |
sterol-C5-desaturase |
23356 |
0.15 |
chr2_106425639_106425823 | 1.33 |
Dcdc5 |
doublecortin domain containing 5 |
42044 |
0.18 |
chr4_13599724_13600127 | 1.33 |
Gm11825 |
predicted gene 11825 |
6109 |
0.25 |
chr8_83220848_83220999 | 1.32 |
Tbc1d9 |
TBC1 domain family, member 9 |
38336 |
0.12 |
chr8_89153040_89153191 | 1.32 |
Gm6625 |
predicted gene 6625 |
6057 |
0.26 |
chr10_17411357_17411707 | 1.32 |
Gm47760 |
predicted gene, 47760 |
78655 |
0.09 |
chr4_56001339_56001502 | 1.31 |
Gm12519 |
predicted gene 12519 |
7681 |
0.31 |
chr8_86961747_86962117 | 1.31 |
Gm24781 |
predicted gene, 24781 |
3687 |
0.2 |
chr16_74055287_74055476 | 1.30 |
Gm22163 |
predicted gene, 22163 |
3652 |
0.23 |
chr4_125194460_125194614 | 1.30 |
1700041M05Rik |
RIKEN cDNA 1700041M05 gene |
34060 |
0.15 |
chr11_18413972_18414175 | 1.30 |
Gm37869 |
predicted gene, 37869 |
22169 |
0.21 |
chr18_15391003_15391154 | 1.29 |
Aqp4 |
aquaporin 4 |
8924 |
0.2 |
chr4_148122325_148122775 | 1.29 |
Mad2l2 |
MAD2 mitotic arrest deficient-like 2 |
7834 |
0.1 |
chr14_52010292_52011175 | 1.29 |
Zfp219 |
zinc finger protein 219 |
149 |
0.89 |
chr1_22806464_22806686 | 1.29 |
Rims1 |
regulating synaptic membrane exocytosis 1 |
581 |
0.84 |
chr1_193367873_193368422 | 1.29 |
Gm37942 |
predicted gene, 37942 |
1307 |
0.35 |
chr3_4546148_4546485 | 1.28 |
Gm22944 |
predicted gene, 22944 |
21019 |
0.21 |
chr17_8507809_8507963 | 1.28 |
Pde10a |
phosphodiesterase 10A |
17486 |
0.18 |
chr9_21197538_21198329 | 1.27 |
Pde4a |
phosphodiesterase 4A, cAMP specific |
1228 |
0.29 |
chr12_26635257_26635560 | 1.27 |
1700020D12Rik |
RIKEN cDNA 1700020D12 gene |
33099 |
0.18 |
chr16_13357793_13358521 | 1.26 |
Mrtfb |
myocardin related transcription factor B |
264 |
0.93 |
chr14_8476698_8476849 | 1.26 |
Gm8416 |
predicted gene 8416 |
67856 |
0.11 |
chr16_50009596_50009887 | 1.26 |
Gm8824 |
predicted gene 8824 |
101332 |
0.08 |
chr13_101540430_101540989 | 1.26 |
Gm47533 |
predicted gene, 47533 |
4497 |
0.19 |
chr3_50014297_50014449 | 1.26 |
Gm37854 |
predicted gene, 37854 |
12401 |
0.22 |
chr11_66265434_66265617 | 1.26 |
Dnah9 |
dynein, axonemal, heavy chain 9 |
96974 |
0.08 |
chr13_83735761_83735940 | 1.26 |
Gm33366 |
predicted gene, 33366 |
2685 |
0.17 |
chr10_102184783_102184934 | 1.26 |
Mgat4c |
MGAT4 family, member C |
25779 |
0.25 |
chr18_52808472_52808700 | 1.25 |
Gm50457 |
predicted gene, 50457 |
16724 |
0.21 |
chr19_22905321_22905488 | 1.25 |
Trpm3 |
transient receptor potential cation channel, subfamily M, member 3 |
138770 |
0.04 |
chr17_56366015_56366226 | 1.25 |
Kdm4b |
lysine (K)-specific demethylase 4B |
6175 |
0.14 |
chr17_37078905_37079056 | 1.25 |
Olfr90 |
olfactory receptor 90 |
7256 |
0.08 |
chr8_23669523_23669919 | 1.24 |
Zmat4 |
zinc finger, matrin type 4 |
47 |
0.98 |
chr2_115131879_115132212 | 1.24 |
Gm28493 |
predicted gene 28493 |
3505 |
0.33 |
chr5_118073321_118073637 | 1.24 |
Gm9754 |
predicted gene 9754 |
8119 |
0.17 |
chr17_73507966_73508157 | 1.23 |
AC107792.1 |
Novel transcript |
9694 |
0.17 |
chr18_42590129_42590297 | 1.23 |
Gm50214 |
predicted gene, 50214 |
2872 |
0.2 |
chr13_88088380_88088544 | 1.23 |
Gm27044 |
predicted gene, 27044 |
96994 |
0.08 |
chr18_15391754_15391905 | 1.23 |
Aqp4 |
aquaporin 4 |
8173 |
0.2 |
chr7_84409236_84410328 | 1.23 |
Arnt2 |
aryl hydrocarbon receptor nuclear translocator 2 |
101 |
0.96 |
chr18_45896851_45897467 | 1.23 |
A330093E20Rik |
RIKEN cDNA A330093E20 gene |
650 |
0.79 |
chr12_5088634_5088975 | 1.23 |
Gm9110 |
predicted gene 9110 |
21356 |
0.21 |
chr15_44331817_44332109 | 1.23 |
Gm19235 |
predicted gene, 19235 |
8851 |
0.17 |
chr6_108145994_108146240 | 1.22 |
Sumf1 |
sulfatase modifying factor 1 |
1422 |
0.44 |
chr12_15218537_15218695 | 1.22 |
Gm48539 |
predicted gene, 48539 |
82429 |
0.09 |
chr17_37073219_37073370 | 1.21 |
Gabbr1 |
gamma-aminobutyric acid (GABA) B receptor, 1 |
2850 |
0.12 |
chr6_54554355_54554906 | 1.21 |
Scrn1 |
secernin 1 |
175 |
0.95 |
chr2_27573150_27573355 | 1.21 |
Gm13421 |
predicted gene 13421 |
32823 |
0.13 |
chr7_105569912_105570189 | 1.20 |
Apbb1 |
amyloid beta (A4) precursor protein-binding, family B, member 1 |
458 |
0.7 |
chr16_77236959_77237505 | 1.20 |
Mir99ahg |
Mir99a and Mirlet7c-1 host gene (non-protein coding) |
913 |
0.66 |
chr4_56179255_56179406 | 1.20 |
Gm12520 |
predicted gene 12520 |
16390 |
0.25 |
chr8_41742888_41743070 | 1.20 |
2810404M03Rik |
RIKEN cDNA 2810404M03 gene |
84288 |
0.09 |
chr11_26806391_26806542 | 1.20 |
Gm12070 |
predicted gene 12070 |
19833 |
0.19 |
chr18_12212592_12212775 | 1.19 |
Npc1 |
NPC intracellular cholesterol transporter 1 |
129 |
0.95 |
chr7_59027544_59027695 | 1.19 |
Gm9375 |
predicted gene 9375 |
57382 |
0.07 |
chr15_56344634_56344977 | 1.19 |
Gm49213 |
predicted gene, 49213 |
70208 |
0.13 |
chr18_47609051_47609244 | 1.18 |
Gm5095 |
predicted gene 5095 |
71412 |
0.1 |
chr1_179326733_179326896 | 1.18 |
Smyd3 |
SET and MYND domain containing 3 |
47289 |
0.18 |
chr6_6132401_6132552 | 1.18 |
Slc25a13 |
solute carrier family 25 (mitochondrial carrier, adenine nucleotide translocator), member 13 |
37273 |
0.19 |
chr5_9725659_9726053 | 1.18 |
Grm3 |
glutamate receptor, metabotropic 3 |
686 |
0.74 |
chr9_77790081_77790250 | 1.18 |
Gm34654 |
predicted gene, 34654 |
19628 |
0.13 |
chr4_6682269_6682463 | 1.18 |
Gm11802 |
predicted gene 11802 |
5803 |
0.22 |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.5 | 3.2 | GO:1901897 | regulation of relaxation of cardiac muscle(GO:1901897) |
0.5 | 1.4 | GO:0043490 | malate-aspartate shuttle(GO:0043490) |
0.5 | 2.3 | GO:0042940 | D-amino acid transport(GO:0042940) |
0.4 | 2.2 | GO:2000324 | positive regulation of glucocorticoid receptor signaling pathway(GO:2000324) |
0.4 | 1.2 | GO:0070634 | transepithelial ammonium transport(GO:0070634) |
0.4 | 1.2 | GO:0035860 | glial cell-derived neurotrophic factor receptor signaling pathway(GO:0035860) |
0.4 | 1.2 | GO:0035910 | ascending aorta development(GO:0035905) ascending aorta morphogenesis(GO:0035910) |
0.4 | 1.1 | GO:2000302 | positive regulation of synaptic vesicle exocytosis(GO:2000302) |
0.3 | 1.0 | GO:1901843 | positive regulation of high voltage-gated calcium channel activity(GO:1901843) |
0.3 | 1.0 | GO:0097112 | gamma-aminobutyric acid receptor clustering(GO:0097112) |
0.3 | 2.9 | GO:0021796 | cerebral cortex regionalization(GO:0021796) |
0.3 | 0.9 | GO:0060112 | generation of ovulation cycle rhythm(GO:0060112) |
0.3 | 1.2 | GO:2001137 | positive regulation of endocytic recycling(GO:2001137) |
0.3 | 0.9 | GO:0070649 | formin-nucleated actin cable assembly(GO:0070649) |
0.3 | 0.8 | GO:0021773 | striatal medium spiny neuron differentiation(GO:0021773) |
0.3 | 0.8 | GO:0097118 | neuroligin clustering involved in postsynaptic membrane assembly(GO:0097118) |
0.2 | 0.7 | GO:0015746 | tricarboxylic acid transport(GO:0006842) citrate transport(GO:0015746) |
0.2 | 0.7 | GO:0097252 | oligodendrocyte apoptotic process(GO:0097252) |
0.2 | 1.9 | GO:0071420 | cellular response to histamine(GO:0071420) |
0.2 | 0.7 | GO:0097155 | fasciculation of sensory neuron axon(GO:0097155) |
0.2 | 1.1 | GO:0007171 | activation of transmembrane receptor protein tyrosine kinase activity(GO:0007171) |
0.2 | 1.1 | GO:0016199 | axon midline choice point recognition(GO:0016199) |
0.2 | 0.6 | GO:0098814 | spontaneous neurotransmitter secretion(GO:0061669) spontaneous synaptic transmission(GO:0098814) |
0.2 | 1.8 | GO:0014049 | positive regulation of glutamate secretion(GO:0014049) |
0.2 | 1.6 | GO:1900452 | regulation of long term synaptic depression(GO:1900452) |
0.2 | 0.8 | GO:0019853 | L-ascorbic acid biosynthetic process(GO:0019853) |
0.2 | 1.4 | GO:0042118 | endothelial cell activation(GO:0042118) |
0.2 | 1.4 | GO:0051823 | regulation of synapse structural plasticity(GO:0051823) |
0.2 | 2.2 | GO:0007614 | short-term memory(GO:0007614) |
0.2 | 1.3 | GO:0006930 | substrate-dependent cell migration, cell extension(GO:0006930) |
0.2 | 0.9 | GO:1902866 | regulation of retina development in camera-type eye(GO:1902866) |
0.2 | 0.5 | GO:0060221 | retinal rod cell differentiation(GO:0060221) |
0.2 | 0.9 | GO:0022038 | corpus callosum development(GO:0022038) |
0.2 | 0.7 | GO:0042297 | vocal learning(GO:0042297) imitative learning(GO:0098596) learned vocalization behavior or vocal learning(GO:0098598) |
0.2 | 0.3 | GO:0071873 | response to norepinephrine(GO:0071873) |
0.2 | 0.5 | GO:0061343 | cell adhesion involved in heart morphogenesis(GO:0061343) |
0.2 | 0.5 | GO:0048022 | negative regulation of melanin biosynthetic process(GO:0048022) negative regulation of secondary metabolite biosynthetic process(GO:1900377) |
0.2 | 0.3 | GO:1901656 | glycoside transport(GO:1901656) |
0.2 | 0.5 | GO:0043402 | glucocorticoid mediated signaling pathway(GO:0043402) |
0.2 | 0.5 | GO:0009240 | isopentenyl diphosphate biosynthetic process(GO:0009240) isopentenyl diphosphate biosynthetic process, mevalonate pathway(GO:0019287) |
0.2 | 0.3 | GO:0097151 | positive regulation of inhibitory postsynaptic potential(GO:0097151) |
0.2 | 0.5 | GO:0021586 | pons maturation(GO:0021586) |
0.2 | 0.5 | GO:0048682 | axon extension involved in regeneration(GO:0048677) sprouting of injured axon(GO:0048682) |
0.2 | 0.8 | GO:0034047 | regulation of protein phosphatase type 2A activity(GO:0034047) |
0.2 | 0.5 | GO:1903818 | positive regulation of delayed rectifier potassium channel activity(GO:1902261) positive regulation of voltage-gated potassium channel activity(GO:1903818) |
0.2 | 0.9 | GO:0021631 | optic nerve morphogenesis(GO:0021631) |
0.2 | 0.5 | GO:0021553 | olfactory nerve development(GO:0021553) |
0.2 | 0.3 | GO:0060160 | negative regulation of dopamine receptor signaling pathway(GO:0060160) |
0.1 | 3.1 | GO:0021952 | central nervous system projection neuron axonogenesis(GO:0021952) |
0.1 | 0.9 | GO:0032049 | cardiolipin biosynthetic process(GO:0032049) |
0.1 | 0.9 | GO:0015884 | folic acid transport(GO:0015884) |
0.1 | 1.1 | GO:0021707 | cerebellar granular layer formation(GO:0021684) cerebellar granule cell differentiation(GO:0021707) |
0.1 | 0.7 | GO:0070842 | aggresome assembly(GO:0070842) |
0.1 | 0.5 | GO:0032430 | positive regulation of phospholipase A2 activity(GO:0032430) |
0.1 | 0.4 | GO:2001025 | positive regulation of response to drug(GO:2001025) |
0.1 | 0.4 | GO:0048162 | preantral ovarian follicle growth(GO:0001546) multi-layer follicle stage(GO:0048162) |
0.1 | 0.1 | GO:0048793 | pronephros development(GO:0048793) |
0.1 | 0.5 | GO:0021554 | optic nerve development(GO:0021554) |
0.1 | 0.9 | GO:0021830 | interneuron migration from the subpallium to the cortex(GO:0021830) |
0.1 | 0.4 | GO:1904430 | negative regulation of t-circle formation(GO:1904430) |
0.1 | 0.3 | GO:1903898 | negative regulation of PERK-mediated unfolded protein response(GO:1903898) |
0.1 | 0.3 | GO:0072235 | distal convoluted tubule development(GO:0072025) DCT cell differentiation(GO:0072069) metanephric distal convoluted tubule development(GO:0072221) metanephric distal tubule development(GO:0072235) metanephric DCT cell differentiation(GO:0072240) |
0.1 | 0.5 | GO:0007296 | vitellogenesis(GO:0007296) |
0.1 | 1.4 | GO:0097094 | craniofacial suture morphogenesis(GO:0097094) |
0.1 | 0.5 | GO:0031117 | positive regulation of microtubule depolymerization(GO:0031117) |
0.1 | 0.4 | GO:0072137 | condensed mesenchymal cell proliferation(GO:0072137) |
0.1 | 0.5 | GO:0098908 | regulation of neuronal action potential(GO:0098908) |
0.1 | 0.4 | GO:0032289 | central nervous system myelin formation(GO:0032289) |
0.1 | 0.5 | GO:0061743 | motor learning(GO:0061743) |
0.1 | 0.4 | GO:0021856 | cerebral cortex tangential migration using cell-axon interactions(GO:0021824) gonadotrophin-releasing hormone neuronal migration to the hypothalamus(GO:0021828) hypothalamic tangential migration using cell-axon interactions(GO:0021856) facioacoustic ganglion development(GO:1903375) |
0.1 | 0.1 | GO:0097168 | mesenchymal stem cell proliferation(GO:0097168) |
0.1 | 0.3 | GO:2000111 | positive regulation of macrophage apoptotic process(GO:2000111) |
0.1 | 0.3 | GO:0000733 | DNA strand renaturation(GO:0000733) |
0.1 | 0.6 | GO:0048496 | maintenance of organ identity(GO:0048496) |
0.1 | 0.9 | GO:0050966 | detection of mechanical stimulus involved in sensory perception of pain(GO:0050966) |
0.1 | 0.4 | GO:0010528 | regulation of transposition(GO:0010528) negative regulation of transposition(GO:0010529) |
0.1 | 0.5 | GO:0007256 | activation of JNKK activity(GO:0007256) |
0.1 | 2.1 | GO:0043949 | regulation of cAMP-mediated signaling(GO:0043949) |
0.1 | 0.3 | GO:0030070 | insulin processing(GO:0030070) |
0.1 | 0.2 | GO:0050883 | musculoskeletal movement, spinal reflex action(GO:0050883) |
0.1 | 0.3 | GO:0001834 | trophectodermal cell proliferation(GO:0001834) |
0.1 | 0.4 | GO:0060159 | regulation of dopamine receptor signaling pathway(GO:0060159) |
0.1 | 0.5 | GO:0097500 | receptor localization to nonmotile primary cilium(GO:0097500) |
0.1 | 0.3 | GO:0019244 | lactate biosynthetic process from pyruvate(GO:0019244) lactate biosynthetic process(GO:0019249) |
0.1 | 0.5 | GO:0044597 | polyketide metabolic process(GO:0030638) aminoglycoside antibiotic metabolic process(GO:0030647) daunorubicin metabolic process(GO:0044597) doxorubicin metabolic process(GO:0044598) |
0.1 | 0.1 | GO:0006533 | aspartate catabolic process(GO:0006533) |
0.1 | 0.3 | GO:0032417 | positive regulation of sodium:proton antiporter activity(GO:0032417) |
0.1 | 0.3 | GO:0016080 | synaptic vesicle targeting(GO:0016080) |
0.1 | 0.2 | GO:0019747 | regulation of isoprenoid metabolic process(GO:0019747) |
0.1 | 0.2 | GO:0033159 | negative regulation of protein import into nucleus, translocation(GO:0033159) |
0.1 | 0.4 | GO:0003025 | regulation of systemic arterial blood pressure by baroreceptor feedback(GO:0003025) |
0.1 | 0.2 | GO:0019230 | proprioception(GO:0019230) |
0.1 | 0.1 | GO:0014722 | regulation of skeletal muscle contraction by calcium ion signaling(GO:0014722) |
0.1 | 1.0 | GO:0035235 | ionotropic glutamate receptor signaling pathway(GO:0035235) |
0.1 | 0.2 | GO:0060454 | positive regulation of gastric acid secretion(GO:0060454) |
0.1 | 0.3 | GO:0072061 | inner medullary collecting duct development(GO:0072061) |
0.1 | 0.4 | GO:0006538 | glutamate catabolic process(GO:0006538) |
0.1 | 0.3 | GO:0046013 | regulation of T cell homeostatic proliferation(GO:0046013) |
0.1 | 0.2 | GO:1903984 | positive regulation of TRAIL-activated apoptotic signaling pathway(GO:1903984) |
0.1 | 0.2 | GO:0046532 | regulation of photoreceptor cell differentiation(GO:0046532) |
0.1 | 0.3 | GO:0060825 | fibroblast growth factor receptor signaling pathway involved in neural plate anterior/posterior pattern formation(GO:0060825) regulation of fibroblast growth factor receptor signaling pathway involved in neural plate anterior/posterior pattern formation(GO:2000313) |
0.1 | 1.1 | GO:0016486 | peptide hormone processing(GO:0016486) |
0.1 | 0.4 | GO:0010693 | negative regulation of alkaline phosphatase activity(GO:0010693) |
0.1 | 0.4 | GO:0097105 | presynaptic membrane assembly(GO:0097105) |
0.1 | 0.4 | GO:0035701 | hematopoietic stem cell migration(GO:0035701) |
0.1 | 0.5 | GO:1904667 | negative regulation of ubiquitin protein ligase activity(GO:1904667) |
0.1 | 0.3 | GO:0035609 | C-terminal protein deglutamylation(GO:0035609) |
0.1 | 1.2 | GO:0051481 | negative regulation of cytosolic calcium ion concentration(GO:0051481) |
0.1 | 0.3 | GO:1902744 | negative regulation of lamellipodium organization(GO:1902744) |
0.1 | 0.3 | GO:0046379 | extracellular polysaccharide biosynthetic process(GO:0045226) extracellular polysaccharide metabolic process(GO:0046379) |
0.1 | 0.3 | GO:0035887 | aortic smooth muscle cell differentiation(GO:0035887) |
0.1 | 1.4 | GO:0050650 | chondroitin sulfate proteoglycan biosynthetic process(GO:0050650) |
0.1 | 0.2 | GO:0016198 | axon choice point recognition(GO:0016198) |
0.1 | 0.2 | GO:0021559 | trigeminal nerve development(GO:0021559) |
0.1 | 0.3 | GO:0034436 | glycoprotein transport(GO:0034436) |
0.1 | 0.3 | GO:0021698 | cerebellar cortex structural organization(GO:0021698) |
0.1 | 1.0 | GO:0050965 | detection of temperature stimulus involved in sensory perception(GO:0050961) detection of temperature stimulus involved in sensory perception of pain(GO:0050965) |
0.1 | 0.4 | GO:0009235 | cobalamin metabolic process(GO:0009235) |
0.1 | 0.3 | GO:0070681 | glutaminyl-tRNAGln biosynthesis via transamidation(GO:0070681) |
0.1 | 0.1 | GO:0061317 | canonical Wnt signaling pathway involved in cardiac muscle cell fate commitment(GO:0061317) |
0.1 | 0.2 | GO:0022605 | oogenesis stage(GO:0022605) |
0.1 | 0.4 | GO:2000189 | positive regulation of cholesterol homeostasis(GO:2000189) |
0.1 | 0.2 | GO:0030576 | Cajal body organization(GO:0030576) |
0.1 | 0.4 | GO:0035426 | extracellular matrix-cell signaling(GO:0035426) |
0.1 | 0.2 | GO:0002121 | inter-male aggressive behavior(GO:0002121) |
0.1 | 0.2 | GO:0006001 | fructose catabolic process(GO:0006001) fructose catabolic process to hydroxyacetone phosphate and glyceraldehyde-3-phosphate(GO:0061624) glycolytic process through fructose-1-phosphate(GO:0061625) |
0.1 | 0.2 | GO:0060174 | limb bud formation(GO:0060174) |
0.1 | 0.6 | GO:1904153 | negative regulation of protein exit from endoplasmic reticulum(GO:0070862) negative regulation of retrograde protein transport, ER to cytosol(GO:1904153) |
0.1 | 0.6 | GO:0018344 | protein geranylgeranylation(GO:0018344) |
0.1 | 0.2 | GO:0010835 | regulation of protein ADP-ribosylation(GO:0010835) |
0.1 | 0.5 | GO:0071625 | vocalization behavior(GO:0071625) |
0.1 | 0.2 | GO:1900245 | positive regulation of MDA-5 signaling pathway(GO:1900245) |
0.1 | 1.3 | GO:0071475 | cellular hyperosmotic salinity response(GO:0071475) |
0.1 | 0.7 | GO:0042428 | serotonin metabolic process(GO:0042428) |
0.1 | 1.1 | GO:0060384 | innervation(GO:0060384) |
0.1 | 0.3 | GO:0045113 | regulation of integrin biosynthetic process(GO:0045113) |
0.1 | 0.7 | GO:0070986 | left/right axis specification(GO:0070986) |
0.1 | 0.2 | GO:0060447 | bud outgrowth involved in lung branching(GO:0060447) |
0.1 | 0.3 | GO:0009912 | auditory receptor cell fate commitment(GO:0009912) inner ear receptor cell fate commitment(GO:0060120) |
0.1 | 0.2 | GO:0019805 | quinolinate biosynthetic process(GO:0019805) |
0.1 | 3.8 | GO:0051965 | positive regulation of synapse assembly(GO:0051965) |
0.1 | 0.1 | GO:0071205 | protein localization to juxtaparanode region of axon(GO:0071205) |
0.1 | 0.1 | GO:1903279 | regulation of calcium:sodium antiporter activity(GO:1903279) |
0.1 | 0.3 | GO:0035635 | entry of bacterium into host cell(GO:0035635) regulation of entry of bacterium into host cell(GO:2000535) |
0.1 | 0.2 | GO:0034184 | positive regulation of maintenance of sister chromatid cohesion(GO:0034093) positive regulation of maintenance of mitotic sister chromatid cohesion(GO:0034184) |
0.1 | 0.1 | GO:0051581 | negative regulation of neurotransmitter uptake(GO:0051581) regulation of serotonin uptake(GO:0051611) negative regulation of serotonin uptake(GO:0051612) |
0.1 | 0.3 | GO:0000414 | regulation of histone H3-K36 methylation(GO:0000414) |
0.1 | 0.1 | GO:0060166 | olfactory pit development(GO:0060166) |
0.1 | 0.2 | GO:0061577 | calcium ion transmembrane transport via high voltage-gated calcium channel(GO:0061577) |
0.1 | 0.6 | GO:0031115 | negative regulation of microtubule polymerization(GO:0031115) |
0.1 | 0.4 | GO:0021785 | branchiomotor neuron axon guidance(GO:0021785) |
0.1 | 0.2 | GO:0002678 | positive regulation of chronic inflammatory response(GO:0002678) |
0.1 | 0.2 | GO:0033564 | anterior/posterior axon guidance(GO:0033564) |
0.1 | 0.1 | GO:0061366 | behavioral response to chemical pain(GO:0061366) behavioral response to formalin induced pain(GO:0061368) |
0.1 | 0.1 | GO:0097212 | lysosomal membrane organization(GO:0097212) |
0.1 | 0.2 | GO:1902564 | negative regulation of neutrophil activation(GO:1902564) |
0.1 | 0.2 | GO:1902775 | mitochondrial large ribosomal subunit assembly(GO:1902775) |
0.1 | 0.4 | GO:0019732 | antifungal humoral response(GO:0019732) |
0.1 | 0.5 | GO:0060013 | righting reflex(GO:0060013) |
0.1 | 0.2 | GO:1900368 | regulation of RNA interference(GO:1900368) |
0.1 | 0.1 | GO:0044339 | canonical Wnt signaling pathway involved in osteoblast differentiation(GO:0044339) |
0.1 | 0.2 | GO:2000686 | regulation of rubidium ion transmembrane transporter activity(GO:2000686) |
0.1 | 0.2 | GO:0003219 | cardiac right ventricle formation(GO:0003219) |
0.1 | 0.4 | GO:0050942 | positive regulation of pigment cell differentiation(GO:0050942) |
0.1 | 0.3 | GO:0051967 | negative regulation of synaptic transmission, glutamatergic(GO:0051967) |
0.1 | 0.4 | GO:0006048 | UDP-N-acetylglucosamine biosynthetic process(GO:0006048) |
0.1 | 0.3 | GO:0001927 | exocyst assembly(GO:0001927) |
0.1 | 0.5 | GO:0060736 | prostate gland growth(GO:0060736) |
0.1 | 0.4 | GO:1900113 | negative regulation of histone H3-K9 trimethylation(GO:1900113) |
0.1 | 0.2 | GO:0032229 | negative regulation of synaptic transmission, GABAergic(GO:0032229) |
0.1 | 0.1 | GO:0003213 | cardiac right atrium morphogenesis(GO:0003213) |
0.1 | 0.1 | GO:1901841 | regulation of high voltage-gated calcium channel activity(GO:1901841) |
0.1 | 0.7 | GO:0016082 | synaptic vesicle priming(GO:0016082) |
0.1 | 0.3 | GO:0098789 | pre-mRNA cleavage required for polyadenylation(GO:0098789) |
0.1 | 0.1 | GO:0045213 | neurotransmitter receptor metabolic process(GO:0045213) |
0.1 | 0.1 | GO:0090027 | negative regulation of monocyte chemotaxis(GO:0090027) |
0.1 | 1.4 | GO:0019228 | neuronal action potential(GO:0019228) |
0.1 | 0.2 | GO:0002576 | platelet degranulation(GO:0002576) |
0.1 | 0.1 | GO:0035790 | platelet-derived growth factor receptor-alpha signaling pathway(GO:0035790) |
0.1 | 0.3 | GO:0060353 | regulation of cell adhesion molecule production(GO:0060353) |
0.1 | 0.2 | GO:0071732 | cellular response to nitric oxide(GO:0071732) |
0.1 | 0.3 | GO:0035881 | amacrine cell differentiation(GO:0035881) |
0.1 | 0.2 | GO:0019509 | L-methionine biosynthetic process from methylthioadenosine(GO:0019509) |
0.1 | 0.4 | GO:0035542 | regulation of SNARE complex assembly(GO:0035542) |
0.1 | 0.6 | GO:0042759 | long-chain fatty acid biosynthetic process(GO:0042759) |
0.1 | 0.2 | GO:0051151 | negative regulation of smooth muscle cell differentiation(GO:0051151) |
0.1 | 0.2 | GO:2000767 | positive regulation of cytoplasmic translation(GO:2000767) |
0.1 | 0.2 | GO:2000574 | regulation of microtubule motor activity(GO:2000574) |
0.1 | 0.4 | GO:0098719 | sodium ion import(GO:0097369) sodium ion import across plasma membrane(GO:0098719) sodium ion import into cell(GO:1990118) |
0.1 | 0.2 | GO:0002765 | immune response-inhibiting signal transduction(GO:0002765) |
0.1 | 1.1 | GO:0031111 | negative regulation of microtubule polymerization or depolymerization(GO:0031111) |
0.1 | 0.2 | GO:0021860 | pyramidal neuron development(GO:0021860) |
0.1 | 0.1 | GO:0010637 | negative regulation of mitochondrial fusion(GO:0010637) |
0.1 | 0.2 | GO:0019262 | N-acetylneuraminate catabolic process(GO:0019262) |
0.1 | 0.2 | GO:0042091 | interleukin-10 biosynthetic process(GO:0042091) regulation of interleukin-10 biosynthetic process(GO:0045074) |
0.1 | 0.3 | GO:0046116 | queuosine biosynthetic process(GO:0008616) queuosine metabolic process(GO:0046116) |
0.1 | 0.2 | GO:0032058 | positive regulation of translation in response to stress(GO:0032056) positive regulation of translational initiation in response to stress(GO:0032058) |
0.1 | 0.8 | GO:0060576 | intestinal epithelial cell development(GO:0060576) |
0.1 | 0.2 | GO:2000622 | regulation of nuclear-transcribed mRNA catabolic process, nonsense-mediated decay(GO:2000622) negative regulation of nuclear-transcribed mRNA catabolic process, nonsense-mediated decay(GO:2000623) |
0.1 | 0.4 | GO:0045760 | positive regulation of action potential(GO:0045760) |
0.1 | 0.3 | GO:0045956 | positive regulation of calcium ion-dependent exocytosis(GO:0045956) |
0.1 | 0.2 | GO:0072321 | chaperone-mediated protein transport(GO:0072321) |
0.1 | 0.3 | GO:0050861 | positive regulation of B cell receptor signaling pathway(GO:0050861) |
0.1 | 0.5 | GO:0008038 | neuron recognition(GO:0008038) |
0.1 | 1.1 | GO:0006904 | vesicle docking involved in exocytosis(GO:0006904) |
0.1 | 0.4 | GO:0090331 | negative regulation of platelet aggregation(GO:0090331) |
0.1 | 0.1 | GO:0060060 | post-embryonic retina morphogenesis in camera-type eye(GO:0060060) |
0.1 | 0.1 | GO:1905209 | positive regulation of cardiocyte differentiation(GO:1905209) |
0.1 | 0.1 | GO:0090135 | actin filament branching(GO:0090135) |
0.1 | 0.2 | GO:0014719 | skeletal muscle satellite cell activation(GO:0014719) |
0.1 | 0.2 | GO:0006931 | substrate-dependent cell migration, cell attachment to substrate(GO:0006931) |
0.1 | 0.1 | GO:0071435 | potassium ion export(GO:0071435) |
0.1 | 0.3 | GO:0032020 | ISG15-protein conjugation(GO:0032020) |
0.1 | 0.2 | GO:0045759 | negative regulation of action potential(GO:0045759) |
0.1 | 0.2 | GO:0042758 | long-chain fatty acid catabolic process(GO:0042758) |
0.0 | 0.1 | GO:0035582 | sequestering of BMP in extracellular matrix(GO:0035582) |
0.0 | 0.7 | GO:0048488 | synaptic vesicle endocytosis(GO:0048488) |
0.0 | 0.8 | GO:0048026 | positive regulation of mRNA splicing, via spliceosome(GO:0048026) |
0.0 | 0.1 | GO:0032278 | positive regulation of gonadotropin secretion(GO:0032278) positive regulation of follicle-stimulating hormone secretion(GO:0046881) |
0.0 | 0.2 | GO:0042780 | tRNA 3'-end processing(GO:0042780) |
0.0 | 0.2 | GO:1900028 | negative regulation of ruffle assembly(GO:1900028) |
0.0 | 0.7 | GO:0050962 | detection of light stimulus involved in visual perception(GO:0050908) detection of light stimulus involved in sensory perception(GO:0050962) |
0.0 | 0.1 | GO:0072092 | ureteric bud invasion(GO:0072092) metanephric renal vesicle formation(GO:0072093) |
0.0 | 0.2 | GO:0060414 | aorta smooth muscle tissue morphogenesis(GO:0060414) |
0.0 | 0.1 | GO:0015755 | fructose transport(GO:0015755) |
0.0 | 0.1 | GO:0051665 | membrane raft localization(GO:0051665) |
0.0 | 0.3 | GO:0000022 | mitotic spindle elongation(GO:0000022) mitotic spindle midzone assembly(GO:0051256) |
0.0 | 0.2 | GO:0014062 | regulation of serotonin secretion(GO:0014062) |
0.0 | 0.8 | GO:0048745 | smooth muscle tissue development(GO:0048745) |
0.0 | 0.4 | GO:0090136 | epithelial cell-cell adhesion(GO:0090136) |
0.0 | 0.2 | GO:0032237 | activation of store-operated calcium channel activity(GO:0032237) |
0.0 | 0.3 | GO:2000671 | regulation of motor neuron apoptotic process(GO:2000671) |
0.0 | 0.1 | GO:0048014 | Tie signaling pathway(GO:0048014) |
0.0 | 0.2 | GO:0014028 | notochord formation(GO:0014028) |
0.0 | 0.0 | GO:0060459 | left lung development(GO:0060459) |
0.0 | 0.0 | GO:0072048 | pattern specification involved in kidney development(GO:0061004) renal system pattern specification(GO:0072048) |
0.0 | 0.2 | GO:0002322 | B cell proliferation involved in immune response(GO:0002322) |
0.0 | 0.1 | GO:0045875 | negative regulation of sister chromatid cohesion(GO:0045875) |
0.0 | 0.1 | GO:0045041 | protein import into mitochondrial intermembrane space(GO:0045041) |
0.0 | 0.8 | GO:0033539 | fatty acid beta-oxidation using acyl-CoA dehydrogenase(GO:0033539) |
0.0 | 0.0 | GO:0061031 | endodermal digestive tract morphogenesis(GO:0061031) |
0.0 | 0.1 | GO:0021529 | spinal cord oligodendrocyte cell differentiation(GO:0021529) spinal cord oligodendrocyte cell fate specification(GO:0021530) |
0.0 | 0.1 | GO:0035405 | histone-threonine phosphorylation(GO:0035405) |
0.0 | 0.6 | GO:0010738 | regulation of protein kinase A signaling(GO:0010738) |
0.0 | 0.1 | GO:1902488 | cholangiocyte apoptotic process(GO:1902488) regulation of cholangiocyte apoptotic process(GO:1904192) negative regulation of cholangiocyte apoptotic process(GO:1904193) |
0.0 | 0.1 | GO:1902683 | regulation of protein localization to synapse(GO:1902473) regulation of receptor localization to synapse(GO:1902683) |
0.0 | 0.2 | GO:0035627 | ceramide transport(GO:0035627) |
0.0 | 0.1 | GO:0023041 | neuronal signal transduction(GO:0023041) |
0.0 | 0.1 | GO:0071503 | response to heparin(GO:0071503) cellular response to heparin(GO:0071504) |
0.0 | 0.2 | GO:1903779 | regulation of cardiac conduction(GO:1903779) |
0.0 | 0.1 | GO:0006868 | glutamine transport(GO:0006868) |
0.0 | 0.1 | GO:2000821 | regulation of grooming behavior(GO:2000821) |
0.0 | 0.1 | GO:0090240 | positive regulation of histone H4 acetylation(GO:0090240) |
0.0 | 0.1 | GO:0006624 | vacuolar protein processing(GO:0006624) |
0.0 | 0.6 | GO:0070841 | inclusion body assembly(GO:0070841) regulation of inclusion body assembly(GO:0090083) |
0.0 | 0.2 | GO:0060897 | neural plate regionalization(GO:0060897) |
0.0 | 0.5 | GO:0015858 | nucleoside transport(GO:0015858) |
0.0 | 0.2 | GO:0051204 | protein insertion into mitochondrial membrane(GO:0051204) |
0.0 | 0.2 | GO:0032596 | protein transport into membrane raft(GO:0032596) |
0.0 | 0.1 | GO:0061738 | late endosomal microautophagy(GO:0061738) |
0.0 | 0.6 | GO:0072525 | pyridine-containing compound biosynthetic process(GO:0072525) |
0.0 | 0.1 | GO:0035633 | maintenance of blood-brain barrier(GO:0035633) |
0.0 | 0.1 | GO:0051684 | maintenance of Golgi location(GO:0051684) |
0.0 | 0.1 | GO:0035106 | operant conditioning(GO:0035106) |
0.0 | 0.2 | GO:0044828 | negative regulation by host of viral genome replication(GO:0044828) |
0.0 | 0.9 | GO:0010765 | positive regulation of sodium ion transport(GO:0010765) |
0.0 | 0.7 | GO:0006303 | double-strand break repair via nonhomologous end joining(GO:0006303) |
0.0 | 0.1 | GO:0031339 | negative regulation of vesicle fusion(GO:0031339) |
0.0 | 0.6 | GO:0031110 | regulation of microtubule polymerization or depolymerization(GO:0031110) |
0.0 | 1.3 | GO:0007157 | heterophilic cell-cell adhesion via plasma membrane cell adhesion molecules(GO:0007157) |
0.0 | 0.0 | GO:2000670 | positive regulation of dendritic cell apoptotic process(GO:2000670) |
0.0 | 0.0 | GO:0072262 | metanephric glomerular mesangium development(GO:0072223) metanephric glomerular mesangial cell proliferation involved in metanephros development(GO:0072262) |
0.0 | 0.4 | GO:0017121 | phospholipid scrambling(GO:0017121) |
0.0 | 0.1 | GO:1903587 | regulation of blood vessel endothelial cell proliferation involved in sprouting angiogenesis(GO:1903587) |
0.0 | 0.1 | GO:0051661 | maintenance of centrosome location(GO:0051661) |
0.0 | 0.1 | GO:1902455 | negative regulation of stem cell population maintenance(GO:1902455) |
0.0 | 0.2 | GO:0099515 | actin filament-based transport(GO:0099515) |
0.0 | 0.1 | GO:0090296 | regulation of mitochondrial DNA replication(GO:0090296) |
0.0 | 0.1 | GO:0035021 | negative regulation of Rac protein signal transduction(GO:0035021) |
0.0 | 0.0 | GO:0032025 | response to cobalt ion(GO:0032025) |
0.0 | 0.0 | GO:2000705 | dense core granule biogenesis(GO:0061110) regulation of dense core granule biogenesis(GO:2000705) |
0.0 | 0.2 | GO:0051045 | negative regulation of membrane protein ectodomain proteolysis(GO:0051045) |
0.0 | 0.2 | GO:1904814 | regulation of protein localization to chromosome, telomeric region(GO:1904814) |
0.0 | 0.0 | GO:0061535 | glutamate secretion, neurotransmission(GO:0061535) |
0.0 | 0.1 | GO:0045162 | clustering of voltage-gated sodium channels(GO:0045162) |
0.0 | 0.1 | GO:1903265 | positive regulation of tumor necrosis factor-mediated signaling pathway(GO:1903265) |
0.0 | 0.2 | GO:0042985 | negative regulation of amyloid precursor protein biosynthetic process(GO:0042985) |
0.0 | 0.0 | GO:0045163 | clustering of voltage-gated potassium channels(GO:0045163) |
0.0 | 0.2 | GO:0099625 | regulation of ventricular cardiac muscle cell membrane repolarization(GO:0060307) ventricular cardiac muscle cell membrane repolarization(GO:0099625) |
0.0 | 0.0 | GO:0051503 | adenine nucleotide transport(GO:0051503) |
0.0 | 0.1 | GO:0072107 | regulation of ureteric bud formation(GO:0072106) positive regulation of ureteric bud formation(GO:0072107) |
0.0 | 0.1 | GO:0034350 | regulation of glial cell apoptotic process(GO:0034350) |
0.0 | 0.2 | GO:2001214 | positive regulation of vasculogenesis(GO:2001214) |
0.0 | 0.1 | GO:0007412 | axon target recognition(GO:0007412) |
0.0 | 0.0 | GO:0031999 | negative regulation of fatty acid beta-oxidation(GO:0031999) |
0.0 | 0.1 | GO:0018364 | peptidyl-glutamine methylation(GO:0018364) |
0.0 | 0.1 | GO:0000189 | MAPK import into nucleus(GO:0000189) |
0.0 | 0.6 | GO:0000413 | protein peptidyl-prolyl isomerization(GO:0000413) |
0.0 | 0.1 | GO:1901386 | negative regulation of voltage-gated calcium channel activity(GO:1901386) |
0.0 | 0.2 | GO:0048505 | regulation of timing of cell differentiation(GO:0048505) |
0.0 | 0.1 | GO:2000301 | negative regulation of synaptic vesicle transport(GO:1902804) negative regulation of synaptic vesicle exocytosis(GO:2000301) |
0.0 | 0.1 | GO:0036112 | medium-chain fatty-acyl-CoA metabolic process(GO:0036112) |
0.0 | 0.1 | GO:1903912 | negative regulation of endoplasmic reticulum stress-induced eIF2 alpha phosphorylation(GO:1903912) |
0.0 | 0.1 | GO:0021615 | glossopharyngeal nerve development(GO:0021563) glossopharyngeal nerve morphogenesis(GO:0021615) |
0.0 | 0.2 | GO:0042026 | protein refolding(GO:0042026) |
0.0 | 0.1 | GO:2000852 | corticosterone secretion(GO:0035934) regulation of corticosterone secretion(GO:2000852) |
0.0 | 0.8 | GO:0045739 | positive regulation of DNA repair(GO:0045739) |
0.0 | 0.2 | GO:0007042 | lysosomal lumen acidification(GO:0007042) |
0.0 | 0.1 | GO:1900122 | positive regulation of receptor binding(GO:1900122) |
0.0 | 0.0 | GO:0030210 | heparin biosynthetic process(GO:0030210) |
0.0 | 0.0 | GO:0060435 | bronchiole development(GO:0060435) |
0.0 | 0.0 | GO:0051891 | positive regulation of cardioblast differentiation(GO:0051891) |
0.0 | 0.1 | GO:0010424 | DNA methylation on cytosine within a CG sequence(GO:0010424) DNA methylation on cytosine(GO:0032776) |
0.0 | 0.1 | GO:0030382 | sperm mitochondrion organization(GO:0030382) |
0.0 | 1.0 | GO:0007339 | binding of sperm to zona pellucida(GO:0007339) |
0.0 | 0.1 | GO:0015014 | heparan sulfate proteoglycan biosynthetic process, polysaccharide chain biosynthetic process(GO:0015014) |
0.0 | 0.0 | GO:0035864 | response to potassium ion(GO:0035864) cellular response to potassium ion(GO:0035865) |
0.0 | 0.1 | GO:0009233 | menaquinone metabolic process(GO:0009233) |
0.0 | 0.1 | GO:0006235 | dTTP biosynthetic process(GO:0006235) pyrimidine deoxyribonucleoside triphosphate biosynthetic process(GO:0009212) dTTP metabolic process(GO:0046075) |
0.0 | 0.1 | GO:0097709 | connective tissue replacement involved in inflammatory response wound healing(GO:0002248) connective tissue replacement(GO:0097709) |
0.0 | 0.1 | GO:0031053 | primary miRNA processing(GO:0031053) |
0.0 | 0.1 | GO:0030422 | production of siRNA involved in RNA interference(GO:0030422) |
0.0 | 0.1 | GO:0032252 | secretory granule localization(GO:0032252) |
0.0 | 0.1 | GO:0098910 | regulation of AV node cell action potential(GO:0098904) regulation of atrial cardiac muscle cell action potential(GO:0098910) |
0.0 | 0.3 | GO:0018298 | protein-chromophore linkage(GO:0018298) |
0.0 | 0.1 | GO:1990034 | calcium ion export from cell(GO:1990034) |
0.0 | 0.1 | GO:0071372 | cellular response to follicle-stimulating hormone stimulus(GO:0071372) |
0.0 | 0.1 | GO:0035359 | negative regulation of peroxisome proliferator activated receptor signaling pathway(GO:0035359) |
0.0 | 0.1 | GO:2000346 | negative regulation of hepatocyte proliferation(GO:2000346) |
0.0 | 0.1 | GO:1990036 | calcium ion import into sarcoplasmic reticulum(GO:1990036) |
0.0 | 0.6 | GO:0051930 | regulation of sensory perception of pain(GO:0051930) regulation of sensory perception(GO:0051931) |
0.0 | 0.0 | GO:2000172 | regulation of branching morphogenesis of a nerve(GO:2000172) |
0.0 | 0.2 | GO:0016322 | neuron remodeling(GO:0016322) |
0.0 | 0.1 | GO:0034499 | late endosome to Golgi transport(GO:0034499) |
0.0 | 0.1 | GO:0003406 | retinal pigment epithelium development(GO:0003406) |
0.0 | 0.1 | GO:2000300 | regulation of synaptic vesicle exocytosis(GO:2000300) |
0.0 | 0.3 | GO:1903861 | regulation of dendrite extension(GO:1903859) positive regulation of dendrite extension(GO:1903861) |
0.0 | 0.1 | GO:0090158 | endoplasmic reticulum membrane organization(GO:0090158) |
0.0 | 0.1 | GO:0070973 | protein localization to endoplasmic reticulum exit site(GO:0070973) |
0.0 | 0.1 | GO:0000715 | nucleotide-excision repair, DNA damage recognition(GO:0000715) |
0.0 | 0.1 | GO:0015808 | L-alanine transport(GO:0015808) |
0.0 | 0.3 | GO:0001964 | startle response(GO:0001964) |
0.0 | 0.1 | GO:2000615 | regulation of histone H3-K9 acetylation(GO:2000615) |
0.0 | 0.0 | GO:0097694 | establishment of RNA localization to telomere(GO:0097694) |
0.0 | 0.1 | GO:0060287 | epithelial cilium movement involved in determination of left/right asymmetry(GO:0060287) |
0.0 | 0.2 | GO:0032986 | nucleosome disassembly(GO:0006337) protein-DNA complex disassembly(GO:0032986) |
0.0 | 0.1 | GO:2001023 | regulation of response to drug(GO:2001023) |
0.0 | 0.3 | GO:0051571 | positive regulation of histone H3-K4 methylation(GO:0051571) |
0.0 | 0.1 | GO:0002386 | immune response in mucosal-associated lymphoid tissue(GO:0002386) |
0.0 | 0.3 | GO:0042407 | cristae formation(GO:0042407) |
0.0 | 0.4 | GO:0006613 | cotranslational protein targeting to membrane(GO:0006613) |
0.0 | 0.1 | GO:0031987 | locomotion involved in locomotory behavior(GO:0031987) |
0.0 | 0.2 | GO:0019800 | peptide cross-linking via chondroitin 4-sulfate glycosaminoglycan(GO:0019800) |
0.0 | 0.1 | GO:0000957 | mitochondrial RNA catabolic process(GO:0000957) regulation of mitochondrial RNA catabolic process(GO:0000960) |
0.0 | 0.1 | GO:0051387 | negative regulation of neurotrophin TRK receptor signaling pathway(GO:0051387) |
0.0 | 0.1 | GO:0048194 | Golgi vesicle budding(GO:0048194) |
0.0 | 0.0 | GO:0033122 | negative regulation of purine nucleotide catabolic process(GO:0033122) negative regulation of cyclic-nucleotide phosphodiesterase activity(GO:0051344) |
0.0 | 0.0 | GO:0099624 | regulation of atrial cardiac muscle cell membrane repolarization(GO:0060372) atrial cardiac muscle cell membrane repolarization(GO:0099624) |
0.0 | 0.1 | GO:0007638 | mechanosensory behavior(GO:0007638) |
0.0 | 0.1 | GO:0032696 | negative regulation of interleukin-13 production(GO:0032696) |
0.0 | 0.0 | GO:0021847 | ventricular zone neuroblast division(GO:0021847) |
0.0 | 0.2 | GO:0014047 | glutamate secretion(GO:0014047) |
0.0 | 0.2 | GO:0033198 | response to ATP(GO:0033198) |
0.0 | 0.1 | GO:0015820 | branched-chain amino acid transport(GO:0015803) leucine transport(GO:0015820) |
0.0 | 0.1 | GO:0071318 | cellular response to ATP(GO:0071318) |
0.0 | 0.7 | GO:0043252 | sodium-independent organic anion transport(GO:0043252) |
0.0 | 0.2 | GO:0035428 | hexose transmembrane transport(GO:0035428) |
0.0 | 0.1 | GO:0002860 | positive regulation of natural killer cell mediated immune response to tumor cell(GO:0002857) positive regulation of natural killer cell mediated cytotoxicity directed against tumor cell target(GO:0002860) |
0.0 | 0.1 | GO:1904293 | negative regulation of ERAD pathway(GO:1904293) |
0.0 | 0.2 | GO:1902018 | negative regulation of cilium assembly(GO:1902018) |
0.0 | 0.5 | GO:0046579 | positive regulation of Ras protein signal transduction(GO:0046579) |
0.0 | 0.0 | GO:0014826 | vein smooth muscle contraction(GO:0014826) |
0.0 | 0.2 | GO:0009312 | oligosaccharide biosynthetic process(GO:0009312) |
0.0 | 0.0 | GO:0046985 | positive regulation of hemoglobin biosynthetic process(GO:0046985) |
0.0 | 0.0 | GO:0002074 | extraocular skeletal muscle development(GO:0002074) |
0.0 | 0.1 | GO:0006528 | asparagine metabolic process(GO:0006528) |
0.0 | 0.0 | GO:0006363 | termination of RNA polymerase I transcription(GO:0006363) |
0.0 | 0.0 | GO:0099500 | synaptic vesicle fusion to presynaptic active zone membrane(GO:0031629) vesicle fusion to plasma membrane(GO:0099500) |
0.0 | 0.0 | GO:2000195 | negative regulation of female gonad development(GO:2000195) |
0.0 | 0.1 | GO:0021798 | forebrain dorsal/ventral pattern formation(GO:0021798) |
0.0 | 0.1 | GO:0048672 | positive regulation of collateral sprouting(GO:0048672) |
0.0 | 0.1 | GO:0006393 | termination of mitochondrial transcription(GO:0006393) |
0.0 | 0.0 | GO:0035434 | copper ion transmembrane transport(GO:0035434) |
0.0 | 0.1 | GO:0060080 | inhibitory postsynaptic potential(GO:0060080) |
0.0 | 0.0 | GO:0072695 | negative regulation of DNA recombination at telomere(GO:0048239) regulation of DNA recombination at telomere(GO:0072695) |
0.0 | 0.0 | GO:0032730 | positive regulation of interleukin-1 alpha production(GO:0032730) |
0.0 | 0.1 | GO:0036151 | phosphatidylcholine acyl-chain remodeling(GO:0036151) |
0.0 | 0.1 | GO:0061051 | positive regulation of cell growth involved in cardiac muscle cell development(GO:0061051) |
0.0 | 0.2 | GO:0043928 | exonucleolytic nuclear-transcribed mRNA catabolic process involved in deadenylation-dependent decay(GO:0043928) |
0.0 | 0.0 | GO:1903334 | positive regulation of protein folding(GO:1903334) |
0.0 | 0.0 | GO:0007386 | compartment pattern specification(GO:0007386) |
0.0 | 0.5 | GO:0007340 | acrosome reaction(GO:0007340) |
0.0 | 0.1 | GO:0021914 | negative regulation of smoothened signaling pathway involved in ventral spinal cord patterning(GO:0021914) |
0.0 | 0.5 | GO:0010107 | potassium ion import(GO:0010107) |
0.0 | 0.1 | GO:0072051 | juxtaglomerular apparatus development(GO:0072051) |
0.0 | 0.2 | GO:0045948 | positive regulation of translational initiation(GO:0045948) |
0.0 | 0.2 | GO:1902043 | positive regulation of extrinsic apoptotic signaling pathway via death domain receptors(GO:1902043) |
0.0 | 0.0 | GO:0007158 | neuron cell-cell adhesion(GO:0007158) |
0.0 | 0.1 | GO:0031915 | positive regulation of synaptic plasticity(GO:0031915) |
0.0 | 0.1 | GO:0042421 | norepinephrine biosynthetic process(GO:0042421) |
0.0 | 0.0 | GO:0014834 | skeletal muscle satellite cell maintenance involved in skeletal muscle regeneration(GO:0014834) |
0.0 | 0.1 | GO:0097067 | cellular response to thyroid hormone stimulus(GO:0097067) |
0.0 | 0.2 | GO:0048172 | regulation of short-term neuronal synaptic plasticity(GO:0048172) |
0.0 | 0.1 | GO:0042790 | transcription of nuclear large rRNA transcript from RNA polymerase I promoter(GO:0042790) |
0.0 | 0.0 | GO:0006663 | platelet activating factor biosynthetic process(GO:0006663) platelet activating factor metabolic process(GO:0046469) |
0.0 | 0.0 | GO:0071286 | cellular response to magnesium ion(GO:0071286) |
0.0 | 0.0 | GO:0097051 | establishment of protein localization to endoplasmic reticulum membrane(GO:0097051) |
0.0 | 0.0 | GO:0032672 | regulation of interleukin-3 production(GO:0032672) |
0.0 | 0.3 | GO:0048268 | clathrin coat assembly(GO:0048268) |
0.0 | 0.9 | GO:1902807 | negative regulation of cell cycle G1/S phase transition(GO:1902807) |
0.0 | 0.1 | GO:0006208 | pyrimidine nucleobase catabolic process(GO:0006208) thymine catabolic process(GO:0006210) thymine metabolic process(GO:0019859) |
0.0 | 0.1 | GO:0021854 | hypothalamus development(GO:0021854) |
0.0 | 0.1 | GO:0090271 | positive regulation of fibroblast growth factor production(GO:0090271) |
0.0 | 0.1 | GO:0046541 | saliva secretion(GO:0046541) |
0.0 | 0.0 | GO:0061050 | regulation of cell growth involved in cardiac muscle cell development(GO:0061050) |
0.0 | 0.0 | GO:1904180 | negative regulation of membrane depolarization(GO:1904180) |
0.0 | 0.1 | GO:0001827 | inner cell mass cell fate commitment(GO:0001827) |
0.0 | 0.1 | GO:0051152 | positive regulation of smooth muscle cell differentiation(GO:0051152) |
0.0 | 0.0 | GO:0070094 | positive regulation of glucagon secretion(GO:0070094) |
0.0 | 0.1 | GO:0021902 | commitment of neuronal cell to specific neuron type in forebrain(GO:0021902) |
0.0 | 0.4 | GO:0006491 | N-glycan processing(GO:0006491) |
0.0 | 0.0 | GO:0007195 | adenylate cyclase-inhibiting dopamine receptor signaling pathway(GO:0007195) |
0.0 | 0.1 | GO:0048386 | positive regulation of retinoic acid receptor signaling pathway(GO:0048386) |
0.0 | 0.1 | GO:0070164 | negative regulation of adiponectin secretion(GO:0070164) |
0.0 | 0.2 | GO:0007288 | sperm axoneme assembly(GO:0007288) |
0.0 | 0.0 | GO:0090344 | negative regulation of cell aging(GO:0090344) |
0.0 | 0.0 | GO:0090403 | oxidative stress-induced premature senescence(GO:0090403) |
0.0 | 0.5 | GO:0019226 | transmission of nerve impulse(GO:0019226) |
0.0 | 0.1 | GO:0060332 | positive regulation of response to interferon-gamma(GO:0060332) positive regulation of interferon-gamma-mediated signaling pathway(GO:0060335) |
0.0 | 0.1 | GO:1901069 | guanosine-containing compound catabolic process(GO:1901069) |
0.0 | 0.1 | GO:0032304 | negative regulation of icosanoid secretion(GO:0032304) |
0.0 | 0.1 | GO:0043545 | Mo-molybdopterin cofactor biosynthetic process(GO:0006777) Mo-molybdopterin cofactor metabolic process(GO:0019720) molybdopterin cofactor biosynthetic process(GO:0032324) molybdopterin cofactor metabolic process(GO:0043545) prosthetic group metabolic process(GO:0051189) |
0.0 | 0.1 | GO:0048702 | embryonic neurocranium morphogenesis(GO:0048702) |
0.0 | 0.2 | GO:0002329 | pre-B cell differentiation(GO:0002329) |
0.0 | 0.3 | GO:0046621 | negative regulation of organ growth(GO:0046621) |
0.0 | 0.1 | GO:0035247 | peptidyl-arginine methylation, to asymmetrical-dimethyl arginine(GO:0019919) peptidyl-arginine omega-N-methylation(GO:0035247) |
0.0 | 0.0 | GO:0003431 | growth plate cartilage chondrocyte development(GO:0003431) |
0.0 | 0.1 | GO:0002913 | positive regulation of T cell anergy(GO:0002669) positive regulation of lymphocyte anergy(GO:0002913) |
0.0 | 0.3 | GO:0071242 | cellular response to ammonium ion(GO:0071242) |
0.0 | 0.1 | GO:0060671 | epithelial cell differentiation involved in embryonic placenta development(GO:0060671) epithelial cell morphogenesis involved in placental branching(GO:0060672) |
0.0 | 0.2 | GO:2000269 | regulation of fibroblast apoptotic process(GO:2000269) |
0.0 | 0.1 | GO:0070914 | UV-damage excision repair(GO:0070914) |
0.0 | 0.1 | GO:0007221 | positive regulation of transcription of Notch receptor target(GO:0007221) |
0.0 | 0.0 | GO:1902774 | late endosome to lysosome transport(GO:1902774) |
0.0 | 0.0 | GO:0038128 | ERBB2 signaling pathway(GO:0038128) |
0.0 | 0.0 | GO:0060486 | Clara cell differentiation(GO:0060486) |
0.0 | 0.1 | GO:2000562 | regulation of CD4-positive, alpha-beta T cell proliferation(GO:2000561) negative regulation of CD4-positive, alpha-beta T cell proliferation(GO:2000562) |
0.0 | 0.0 | GO:0006772 | thiamine metabolic process(GO:0006772) thiamine-containing compound metabolic process(GO:0042723) |
0.0 | 0.0 | GO:0071376 | response to corticotropin-releasing hormone(GO:0043435) cellular response to corticotropin-releasing hormone stimulus(GO:0071376) |
0.0 | 0.1 | GO:0060004 | reflex(GO:0060004) |
0.0 | 0.1 | GO:0015871 | choline transport(GO:0015871) |
0.0 | 0.1 | GO:0035284 | central nervous system segmentation(GO:0035283) brain segmentation(GO:0035284) |
0.0 | 0.0 | GO:0042726 | flavin-containing compound metabolic process(GO:0042726) |
0.0 | 0.0 | GO:0045583 | regulation of cytotoxic T cell differentiation(GO:0045583) positive regulation of cytotoxic T cell differentiation(GO:0045585) |
0.0 | 0.2 | GO:1904355 | positive regulation of telomere capping(GO:1904355) |
0.0 | 0.0 | GO:0060837 | blood vessel endothelial cell differentiation(GO:0060837) |
0.0 | 0.1 | GO:0032687 | negative regulation of interferon-alpha production(GO:0032687) |
0.0 | 0.3 | GO:0007271 | synaptic transmission, cholinergic(GO:0007271) |
0.0 | 0.1 | GO:0032792 | negative regulation of CREB transcription factor activity(GO:0032792) |
0.0 | 0.0 | GO:0060677 | ureteric bud elongation(GO:0060677) branch elongation involved in ureteric bud branching(GO:0060681) |
0.0 | 0.1 | GO:0046167 | glycerol-3-phosphate biosynthetic process(GO:0046167) |
0.0 | 0.2 | GO:2000772 | regulation of cellular senescence(GO:2000772) |
0.0 | 0.0 | GO:0032048 | cardiolipin metabolic process(GO:0032048) |
0.0 | 0.1 | GO:0070827 | chromatin maintenance(GO:0070827) |
0.0 | 0.0 | GO:1900019 | regulation of protein kinase C activity(GO:1900019) positive regulation of protein kinase C activity(GO:1900020) |
0.0 | 0.0 | GO:1900157 | regulation of bone mineralization involved in bone maturation(GO:1900157) |
0.0 | 0.1 | GO:0006145 | purine nucleobase catabolic process(GO:0006145) |
0.0 | 0.0 | GO:0060971 | embryonic heart tube left/right pattern formation(GO:0060971) |
0.0 | 0.0 | GO:0045085 | negative regulation of interleukin-2 biosynthetic process(GO:0045085) |
0.0 | 0.1 | GO:1903352 | ornithine transport(GO:0015822) L-ornithine transmembrane transport(GO:1903352) |
0.0 | 0.1 | GO:0051409 | response to nitrosative stress(GO:0051409) |
0.0 | 0.0 | GO:1901077 | regulation of relaxation of muscle(GO:1901077) |
0.0 | 0.0 | GO:0006546 | glycine catabolic process(GO:0006546) glycine decarboxylation via glycine cleavage system(GO:0019464) |
0.0 | 0.2 | GO:0048011 | neurotrophin TRK receptor signaling pathway(GO:0048011) |
0.0 | 0.0 | GO:0035511 | oxidative DNA demethylation(GO:0035511) |
0.0 | 0.4 | GO:0034605 | cellular response to heat(GO:0034605) |
0.0 | 0.1 | GO:0044154 | histone H3-K14 acetylation(GO:0044154) |
0.0 | 0.0 | GO:0060770 | negative regulation of epithelial cell proliferation involved in prostate gland development(GO:0060770) |
0.0 | 0.1 | GO:1900025 | negative regulation of substrate adhesion-dependent cell spreading(GO:1900025) |
0.0 | 0.0 | GO:0032097 | positive regulation of response to food(GO:0032097) positive regulation of appetite(GO:0032100) |
0.0 | 0.0 | GO:0060872 | semicircular canal development(GO:0060872) |
0.0 | 0.1 | GO:1904587 | glycoprotein ERAD pathway(GO:0097466) response to glycoprotein(GO:1904587) |
0.0 | 0.0 | GO:0000056 | ribosomal small subunit export from nucleus(GO:0000056) |
0.0 | 0.0 | GO:2001280 | positive regulation of prostaglandin biosynthetic process(GO:0031394) positive regulation of unsaturated fatty acid biosynthetic process(GO:2001280) |
0.0 | 0.2 | GO:0034587 | piRNA metabolic process(GO:0034587) |
0.0 | 0.0 | GO:0072592 | oxygen metabolic process(GO:0072592) |
0.0 | 0.1 | GO:1902902 | negative regulation of autophagosome assembly(GO:1902902) |
0.0 | 0.1 | GO:0009226 | nucleotide-sugar biosynthetic process(GO:0009226) |
0.0 | 0.8 | GO:0007156 | homophilic cell adhesion via plasma membrane adhesion molecules(GO:0007156) |
0.0 | 0.1 | GO:0006000 | fructose metabolic process(GO:0006000) |
0.0 | 0.1 | GO:2000786 | positive regulation of autophagosome assembly(GO:2000786) |
0.0 | 0.1 | GO:0043615 | astrocyte cell migration(GO:0043615) |
0.0 | 0.3 | GO:0043567 | regulation of insulin-like growth factor receptor signaling pathway(GO:0043567) |
0.0 | 0.0 | GO:1901252 | regulation of intracellular transport of viral material(GO:1901252) |
0.0 | 0.0 | GO:0002434 | immune complex clearance(GO:0002434) |
0.0 | 0.1 | GO:0000055 | ribosomal large subunit export from nucleus(GO:0000055) |
0.0 | 0.1 | GO:0097240 | meiotic telomere tethering at nuclear periphery(GO:0044821) meiotic attachment of telomere to nuclear envelope(GO:0070197) chromosome attachment to the nuclear envelope(GO:0097240) |
0.0 | 0.0 | GO:0042360 | vitamin E metabolic process(GO:0042360) |
0.0 | 0.0 | GO:0035622 | intrahepatic bile duct development(GO:0035622) |
0.0 | 0.0 | GO:0019626 | short-chain fatty acid catabolic process(GO:0019626) |
0.0 | 0.0 | GO:0003433 | chondrocyte development involved in endochondral bone morphogenesis(GO:0003433) |
0.0 | 0.1 | GO:0036065 | fucosylation(GO:0036065) |
0.0 | 0.0 | GO:0014819 | regulation of skeletal muscle contraction(GO:0014819) |
0.0 | 0.0 | GO:0051126 | negative regulation of Arp2/3 complex-mediated actin nucleation(GO:0034316) negative regulation of actin nucleation(GO:0051126) |
0.0 | 0.0 | GO:0060024 | rhythmic synaptic transmission(GO:0060024) |
0.0 | 0.0 | GO:0048696 | regulation of collateral sprouting in absence of injury(GO:0048696) |
0.0 | 0.0 | GO:0003160 | endocardium morphogenesis(GO:0003160) |
0.0 | 0.1 | GO:0019370 | leukotriene biosynthetic process(GO:0019370) |
0.0 | 0.0 | GO:1901187 | regulation of ephrin receptor signaling pathway(GO:1901187) |
0.0 | 0.0 | GO:0034137 | positive regulation of toll-like receptor 2 signaling pathway(GO:0034137) |
0.0 | 0.1 | GO:0033314 | mitotic DNA replication checkpoint(GO:0033314) |
0.0 | 0.1 | GO:0035726 | common myeloid progenitor cell proliferation(GO:0035726) |
0.0 | 0.0 | GO:0061055 | myotome development(GO:0061055) |
0.0 | 0.0 | GO:0034241 | positive regulation of macrophage fusion(GO:0034241) |
0.0 | 0.0 | GO:0043634 | polyadenylation-dependent ncRNA catabolic process(GO:0043634) nuclear ncRNA surveillance(GO:0071029) nuclear polyadenylation-dependent rRNA catabolic process(GO:0071035) nuclear polyadenylation-dependent ncRNA catabolic process(GO:0071046) |
0.0 | 0.0 | GO:1902947 | regulation of tau-protein kinase activity(GO:1902947) |
0.0 | 0.0 | GO:0016078 | tRNA catabolic process(GO:0016078) |
0.0 | 0.0 | GO:0003415 | chondrocyte hypertrophy(GO:0003415) |
0.0 | 0.0 | GO:0035262 | gonad morphogenesis(GO:0035262) |
0.0 | 0.0 | GO:1903546 | protein localization to photoreceptor outer segment(GO:1903546) |
0.0 | 0.0 | GO:2000437 | monocyte extravasation(GO:0035696) regulation of monocyte extravasation(GO:2000437) |
0.0 | 0.0 | GO:0042045 | epithelial fluid transport(GO:0042045) |
0.0 | 0.1 | GO:1902187 | negative regulation of viral release from host cell(GO:1902187) |
0.0 | 0.0 | GO:0021794 | thalamus development(GO:0021794) |
0.0 | 0.0 | GO:0006106 | fumarate metabolic process(GO:0006106) |
0.0 | 0.1 | GO:0034453 | microtubule anchoring(GO:0034453) |
0.0 | 0.0 | GO:0044332 | Wnt signaling pathway involved in dorsal/ventral axis specification(GO:0044332) |
0.0 | 0.0 | GO:0003057 | regulation of the force of heart contraction by chemical signal(GO:0003057) |
0.0 | 0.2 | GO:2001014 | regulation of skeletal muscle cell differentiation(GO:2001014) |
0.0 | 0.0 | GO:0035983 | response to trichostatin A(GO:0035983) cellular response to trichostatin A(GO:0035984) |
0.0 | 0.0 | GO:2001206 | positive regulation of osteoclast development(GO:2001206) |
0.0 | 0.0 | GO:0031087 | nuclear-transcribed mRNA catabolic process, deadenylation-independent decay(GO:0031086) deadenylation-independent decapping of nuclear-transcribed mRNA(GO:0031087) |
0.0 | 0.0 | GO:0010700 | negative regulation of norepinephrine secretion(GO:0010700) |
0.0 | 0.0 | GO:0090038 | negative regulation of protein kinase C signaling(GO:0090038) |
0.0 | 0.0 | GO:0032474 | otolith morphogenesis(GO:0032474) |
0.0 | 0.1 | GO:0006122 | mitochondrial electron transport, ubiquinol to cytochrome c(GO:0006122) |
0.0 | 0.2 | GO:0071539 | protein localization to centrosome(GO:0071539) |
0.0 | 0.0 | GO:0060847 | endothelial cell fate specification(GO:0060847) |
0.0 | 0.1 | GO:0007205 | protein kinase C-activating G-protein coupled receptor signaling pathway(GO:0007205) |
0.0 | 0.0 | GO:1901026 | ripoptosome assembly(GO:0097343) ripoptosome assembly involved in necroptotic process(GO:1901026) |
0.0 | 0.0 | GO:0098700 | aminergic neurotransmitter loading into synaptic vesicle(GO:0015842) neurotransmitter loading into synaptic vesicle(GO:0098700) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.5 | 1.6 | GO:0014701 | junctional sarcoplasmic reticulum membrane(GO:0014701) |
0.3 | 1.0 | GO:1990761 | growth cone lamellipodium(GO:1990761) |
0.2 | 1.3 | GO:1990454 | L-type voltage-gated calcium channel complex(GO:1990454) |
0.2 | 5.9 | GO:0048786 | presynaptic active zone(GO:0048786) |
0.2 | 2.6 | GO:0060077 | inhibitory synapse(GO:0060077) |
0.2 | 0.7 | GO:1990696 | USH2 complex(GO:1990696) |
0.2 | 1.1 | GO:0031258 | lamellipodium membrane(GO:0031258) |
0.2 | 2.9 | GO:0030673 | axolemma(GO:0030673) |
0.2 | 0.5 | GO:1990635 | proximal dendrite(GO:1990635) |
0.2 | 0.6 | GO:0005968 | Rab-protein geranylgeranyltransferase complex(GO:0005968) |
0.2 | 0.8 | GO:0008541 | proteasome regulatory particle, lid subcomplex(GO:0008541) |
0.2 | 1.2 | GO:0043083 | synaptic cleft(GO:0043083) |
0.1 | 0.4 | GO:0097149 | centralspindlin complex(GO:0097149) |
0.1 | 0.5 | GO:0031313 | extrinsic component of endosome membrane(GO:0031313) |
0.1 | 1.1 | GO:0032045 | guanyl-nucleotide exchange factor complex(GO:0032045) |
0.1 | 0.5 | GO:0070033 | synaptobrevin 2-SNAP-25-syntaxin-1a-complexin II complex(GO:0070033) |
0.1 | 0.9 | GO:0032584 | growth cone membrane(GO:0032584) |
0.1 | 0.2 | GO:1990357 | terminal web(GO:1990357) |
0.1 | 0.9 | GO:0032591 | dendritic spine membrane(GO:0032591) |
0.1 | 1.2 | GO:1990023 | mitotic spindle midzone(GO:1990023) |
0.1 | 0.6 | GO:0098563 | integral component of synaptic vesicle membrane(GO:0030285) intrinsic component of synaptic vesicle membrane(GO:0098563) |
0.1 | 0.4 | GO:0030289 | protein phosphatase 4 complex(GO:0030289) |
0.1 | 0.5 | GO:0017071 | intracellular cyclic nucleotide activated cation channel complex(GO:0017071) |
0.1 | 0.2 | GO:0044316 | cone cell pedicle(GO:0044316) |
0.1 | 0.1 | GO:0070110 | ciliary neurotrophic factor receptor complex(GO:0070110) |
0.1 | 1.3 | GO:0043194 | axon initial segment(GO:0043194) |
0.1 | 3.9 | GO:0042734 | presynaptic membrane(GO:0042734) |
0.1 | 2.7 | GO:0005891 | voltage-gated calcium channel complex(GO:0005891) |
0.1 | 1.3 | GO:0000145 | exocyst(GO:0000145) |
0.1 | 0.3 | GO:0002193 | MAML1-RBP-Jkappa- ICN1 complex(GO:0002193) |
0.1 | 1.2 | GO:0031045 | dense core granule(GO:0031045) |
0.1 | 0.3 | GO:0097443 | sorting endosome(GO:0097443) |
0.1 | 0.3 | GO:0097427 | microtubule bundle(GO:0097427) |
0.1 | 0.3 | GO:0032021 | NELF complex(GO:0032021) |
0.1 | 1.2 | GO:0071565 | nBAF complex(GO:0071565) |
0.1 | 0.5 | GO:0033268 | node of Ranvier(GO:0033268) |
0.1 | 0.3 | GO:0030956 | glutamyl-tRNA(Gln) amidotransferase complex(GO:0030956) |
0.1 | 0.2 | GO:0005879 | axonemal microtubule(GO:0005879) |
0.1 | 0.3 | GO:1990716 | axonemal central apparatus(GO:1990716) |
0.1 | 0.3 | GO:0005610 | laminin-5 complex(GO:0005610) |
0.1 | 0.3 | GO:0031618 | nuclear pericentric heterochromatin(GO:0031618) |
0.1 | 0.3 | GO:1990851 | Wnt-Frizzled-LRP5/6 complex(GO:1990851) |
0.1 | 0.3 | GO:0032777 | Piccolo NuA4 histone acetyltransferase complex(GO:0032777) |
0.1 | 0.1 | GO:0016514 | SWI/SNF complex(GO:0016514) |
0.1 | 0.9 | GO:0034704 | calcium channel complex(GO:0034704) |
0.1 | 1.1 | GO:0000159 | protein phosphatase type 2A complex(GO:0000159) |
0.1 | 0.3 | GO:0061617 | MICOS complex(GO:0061617) |
0.1 | 0.2 | GO:0016533 | cyclin-dependent protein kinase 5 holoenzyme complex(GO:0016533) |
0.1 | 0.4 | GO:0005915 | zonula adherens(GO:0005915) |
0.1 | 0.2 | GO:0071942 | XPC complex(GO:0071942) |
0.1 | 0.2 | GO:0090498 | extrinsic component of Golgi membrane(GO:0090498) |
0.1 | 0.4 | GO:0016012 | dystroglycan complex(GO:0016011) sarcoglycan complex(GO:0016012) |
0.1 | 0.2 | GO:0042719 | mitochondrial intermembrane space protein transporter complex(GO:0042719) |
0.1 | 0.2 | GO:0005892 | acetylcholine-gated channel complex(GO:0005892) |
0.1 | 0.2 | GO:0071598 | neuronal ribonucleoprotein granule(GO:0071598) |
0.1 | 0.2 | GO:0044326 | dendritic spine neck(GO:0044326) |
0.1 | 0.2 | GO:0097451 | glial limiting end-foot(GO:0097451) |
0.1 | 0.2 | GO:0005947 | mitochondrial alpha-ketoglutarate dehydrogenase complex(GO:0005947) |
0.1 | 0.5 | GO:0035253 | ciliary rootlet(GO:0035253) |
0.1 | 0.2 | GO:0044300 | cerebellar mossy fiber(GO:0044300) |
0.1 | 0.1 | GO:0097441 | basilar dendrite(GO:0097441) |
0.1 | 0.3 | GO:0071547 | piP-body(GO:0071547) |
0.1 | 0.6 | GO:0031235 | intrinsic component of the cytoplasmic side of the plasma membrane(GO:0031235) |
0.1 | 0.3 | GO:0005890 | sodium:potassium-exchanging ATPase complex(GO:0005890) |
0.1 | 0.3 | GO:0044224 | juxtaparanode region of axon(GO:0044224) |
0.1 | 0.1 | GO:0005850 | eukaryotic translation initiation factor 2 complex(GO:0005850) |
0.1 | 0.2 | GO:0044322 | endoplasmic reticulum quality control compartment(GO:0044322) |
0.0 | 0.3 | GO:0036057 | filtration diaphragm(GO:0036056) slit diaphragm(GO:0036057) |
0.0 | 2.7 | GO:0008076 | voltage-gated potassium channel complex(GO:0008076) |
0.0 | 0.1 | GO:0072534 | perineuronal net(GO:0072534) |
0.0 | 0.3 | GO:0016010 | dystrophin-associated glycoprotein complex(GO:0016010) glycoprotein complex(GO:0090665) |
0.0 | 7.4 | GO:0060076 | excitatory synapse(GO:0060076) |
0.0 | 0.7 | GO:0032809 | neuronal cell body membrane(GO:0032809) |
0.0 | 0.5 | GO:0042405 | nuclear inclusion body(GO:0042405) |
0.0 | 0.2 | GO:0097169 | AIM2 inflammasome complex(GO:0097169) |
0.0 | 0.1 | GO:0005956 | protein kinase CK2 complex(GO:0005956) |
0.0 | 0.0 | GO:0034715 | pICln-Sm protein complex(GO:0034715) |
0.0 | 0.0 | GO:0034666 | integrin alpha2-beta1 complex(GO:0034666) |
0.0 | 0.7 | GO:0032281 | AMPA glutamate receptor complex(GO:0032281) |
0.0 | 4.3 | GO:0045211 | postsynaptic membrane(GO:0045211) |
0.0 | 0.2 | GO:0030314 | junctional membrane complex(GO:0030314) |
0.0 | 0.1 | GO:0070939 | Dsl1p complex(GO:0070939) |
0.0 | 0.1 | GO:0042583 | chromaffin granule(GO:0042583) |
0.0 | 0.1 | GO:0035061 | interchromatin granule(GO:0035061) |
0.0 | 0.4 | GO:0005687 | U4 snRNP(GO:0005687) |
0.0 | 0.6 | GO:0070822 | Sin3-type complex(GO:0070822) |
0.0 | 0.3 | GO:0002116 | semaphorin receptor complex(GO:0002116) |
0.0 | 0.2 | GO:0033503 | HULC complex(GO:0033503) |
0.0 | 0.0 | GO:0035867 | alphav-beta3 integrin-IGF-1-IGF1R complex(GO:0035867) |
0.0 | 0.1 | GO:0030915 | Smc5-Smc6 complex(GO:0030915) |
0.0 | 0.4 | GO:0032580 | Golgi cisterna membrane(GO:0032580) |
0.0 | 0.2 | GO:0070419 | nonhomologous end joining complex(GO:0070419) |
0.0 | 0.2 | GO:0032590 | dendrite membrane(GO:0032590) |
0.0 | 0.3 | GO:0005686 | U2 snRNP(GO:0005686) |
0.0 | 0.1 | GO:0033269 | internode region of axon(GO:0033269) |
0.0 | 0.1 | GO:0061689 | tricellular tight junction(GO:0061689) |
0.0 | 0.3 | GO:0008278 | cohesin complex(GO:0008278) |
0.0 | 0.2 | GO:0030122 | AP-2 adaptor complex(GO:0030122) |
0.0 | 0.1 | GO:0036194 | muscle cell projection(GO:0036194) muscle cell projection membrane(GO:0036195) |
0.0 | 0.1 | GO:0055087 | Ski complex(GO:0055087) |
0.0 | 0.1 | GO:0031262 | Ndc80 complex(GO:0031262) |
0.0 | 0.1 | GO:0033588 | Elongator holoenzyme complex(GO:0033588) |
0.0 | 0.4 | GO:0005605 | basal lamina(GO:0005605) |
0.0 | 0.4 | GO:0005614 | interstitial matrix(GO:0005614) |
0.0 | 0.1 | GO:0031466 | Cul5-RING ubiquitin ligase complex(GO:0031466) |
0.0 | 0.2 | GO:0008074 | guanylate cyclase complex, soluble(GO:0008074) |
0.0 | 0.0 | GO:0035838 | growing cell tip(GO:0035838) |
0.0 | 0.1 | GO:0031233 | intrinsic component of external side of plasma membrane(GO:0031233) |
0.0 | 0.1 | GO:0097422 | tubular endosome(GO:0097422) |
0.0 | 1.1 | GO:0030175 | filopodium(GO:0030175) |
0.0 | 0.1 | GO:0097197 | tetraspanin-enriched microdomain(GO:0097197) |
0.0 | 2.9 | GO:0031225 | anchored component of membrane(GO:0031225) |
0.0 | 0.1 | GO:0000127 | transcription factor TFIIIC complex(GO:0000127) |
0.0 | 0.0 | GO:0090576 | RNA polymerase III transcription factor complex(GO:0090576) |
0.0 | 0.1 | GO:0034673 | inhibin-betaglycan-ActRII complex(GO:0034673) |
0.0 | 0.1 | GO:0005955 | calcineurin complex(GO:0005955) |
0.0 | 1.5 | GO:0030426 | growth cone(GO:0030426) |
0.0 | 0.1 | GO:0097449 | astrocyte projection(GO:0097449) |
0.0 | 0.2 | GO:0005869 | dynactin complex(GO:0005869) |
0.0 | 0.1 | GO:0043159 | acrosomal matrix(GO:0043159) |
0.0 | 0.1 | GO:0034388 | Pwp2p-containing subcomplex of 90S preribosome(GO:0034388) |
0.0 | 0.1 | GO:0005785 | signal recognition particle receptor complex(GO:0005785) |
0.0 | 0.1 | GO:0000808 | origin recognition complex(GO:0000808) nuclear origin of replication recognition complex(GO:0005664) |
0.0 | 0.1 | GO:0000408 | EKC/KEOPS complex(GO:0000408) |
0.0 | 0.2 | GO:0045334 | clathrin-coated endocytic vesicle(GO:0045334) |
0.0 | 0.0 | GO:1990393 | 3M complex(GO:1990393) |
0.0 | 0.1 | GO:0070531 | BRCA1-A complex(GO:0070531) |
0.0 | 0.1 | GO:0098827 | endoplasmic reticulum subcompartment(GO:0098827) |
0.0 | 0.0 | GO:1990075 | periciliary membrane compartment(GO:1990075) |
0.0 | 0.2 | GO:0005641 | nuclear envelope lumen(GO:0005641) |
0.0 | 0.6 | GO:0045171 | intercellular bridge(GO:0045171) |
0.0 | 0.0 | GO:0036449 | microtubule minus-end(GO:0036449) |
0.0 | 0.1 | GO:0001520 | outer dense fiber(GO:0001520) |
0.0 | 0.3 | GO:0016235 | aggresome(GO:0016235) |
0.0 | 0.4 | GO:0005834 | heterotrimeric G-protein complex(GO:0005834) |
0.0 | 0.0 | GO:0070545 | PeBoW complex(GO:0070545) |
0.0 | 0.1 | GO:0032839 | dendrite cytoplasm(GO:0032839) |
0.0 | 0.0 | GO:0005863 | striated muscle myosin thick filament(GO:0005863) |
0.0 | 0.0 | GO:0008275 | gamma-tubulin small complex(GO:0008275) |
0.0 | 0.1 | GO:0031428 | box C/D snoRNP complex(GO:0031428) |
0.0 | 0.0 | GO:0070044 | synaptobrevin 2-SNAP-25-syntaxin-1a complex(GO:0070044) |
0.0 | 0.7 | GO:0031463 | Cul3-RING ubiquitin ligase complex(GO:0031463) |
0.0 | 0.0 | GO:0044299 | C-fiber(GO:0044299) |
0.0 | 0.0 | GO:0005945 | 6-phosphofructokinase complex(GO:0005945) |
0.0 | 0.0 | GO:0030121 | AP-1 adaptor complex(GO:0030121) |
0.0 | 0.0 | GO:0016222 | procollagen-proline 4-dioxygenase complex(GO:0016222) |
0.0 | 0.1 | GO:0030485 | smooth muscle contractile fiber(GO:0030485) |
0.0 | 0.1 | GO:0033270 | paranode region of axon(GO:0033270) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.5 | 2.1 | GO:0005030 | neurotrophin receptor activity(GO:0005030) |
0.4 | 4.9 | GO:0008601 | protein phosphatase type 2A regulator activity(GO:0008601) |
0.4 | 1.1 | GO:0035939 | microsatellite binding(GO:0035939) |
0.4 | 0.7 | GO:0015137 | citrate transmembrane transporter activity(GO:0015137) tricarboxylic acid transmembrane transporter activity(GO:0015142) |
0.4 | 1.1 | GO:0051373 | FATZ binding(GO:0051373) |
0.3 | 0.9 | GO:0008597 | calcium-dependent protein serine/threonine phosphatase regulator activity(GO:0008597) |
0.3 | 1.2 | GO:0015183 | L-aspartate transmembrane transporter activity(GO:0015183) |
0.3 | 0.9 | GO:0030160 | GKAP/Homer scaffold activity(GO:0030160) |
0.3 | 0.9 | GO:0005219 | ryanodine-sensitive calcium-release channel activity(GO:0005219) |
0.3 | 1.2 | GO:0004065 | arylsulfatase activity(GO:0004065) |
0.3 | 1.1 | GO:0004971 | AMPA glutamate receptor activity(GO:0004971) |
0.3 | 1.1 | GO:0017162 | aryl hydrocarbon receptor binding(GO:0017162) |
0.2 | 0.5 | GO:0097109 | neuroligin family protein binding(GO:0097109) |
0.2 | 0.7 | GO:0004351 | glutamate decarboxylase activity(GO:0004351) |
0.2 | 0.7 | GO:0031697 | beta-1 adrenergic receptor binding(GO:0031697) |
0.2 | 0.7 | GO:0005176 | ErbB-2 class receptor binding(GO:0005176) |
0.2 | 0.7 | GO:0043423 | 3-phosphoinositide-dependent protein kinase binding(GO:0043423) |
0.2 | 0.6 | GO:0035373 | chondroitin sulfate proteoglycan binding(GO:0035373) |
0.2 | 0.6 | GO:0005519 | cytoskeletal regulatory protein binding(GO:0005519) |
0.2 | 2.2 | GO:0031681 | G-protein beta-subunit binding(GO:0031681) |
0.2 | 1.0 | GO:0042609 | CD4 receptor binding(GO:0042609) |
0.2 | 1.3 | GO:0043495 | protein anchor(GO:0043495) |
0.2 | 1.1 | GO:0016934 | extracellular-glycine-gated ion channel activity(GO:0016933) extracellular-glycine-gated chloride channel activity(GO:0016934) |
0.2 | 0.5 | GO:0015018 | galactosylgalactosylxylosylprotein 3-beta-glucuronosyltransferase activity(GO:0015018) |
0.2 | 0.5 | GO:0005004 | GPI-linked ephrin receptor activity(GO:0005004) |
0.2 | 0.8 | GO:0044323 | retinoic acid-responsive element binding(GO:0044323) |
0.1 | 1.3 | GO:0016920 | pyroglutamyl-peptidase activity(GO:0016920) |
0.1 | 0.9 | GO:0008517 | folic acid transporter activity(GO:0008517) |
0.1 | 1.3 | GO:0001091 | RNA polymerase II basal transcription factor binding(GO:0001091) |
0.1 | 0.8 | GO:0005005 | transmembrane-ephrin receptor activity(GO:0005005) |
0.1 | 1.0 | GO:0001640 | adenylate cyclase inhibiting G-protein coupled glutamate receptor activity(GO:0001640) |
0.1 | 0.8 | GO:0047184 | 1-acylglycerophosphocholine O-acyltransferase activity(GO:0047184) |
0.1 | 0.4 | GO:0004965 | G-protein coupled GABA receptor activity(GO:0004965) |
0.1 | 1.7 | GO:0004970 | ionotropic glutamate receptor activity(GO:0004970) |
0.1 | 1.7 | GO:0044183 | protein binding involved in protein folding(GO:0044183) |
0.1 | 2.2 | GO:0016917 | GABA-A receptor activity(GO:0004890) GABA receptor activity(GO:0016917) |
0.1 | 0.4 | GO:0086056 | voltage-gated calcium channel activity involved in AV node cell action potential(GO:0086056) |
0.1 | 0.4 | GO:0030144 | alpha-1,6-mannosylglycoprotein 6-beta-N-acetylglucosaminyltransferase activity(GO:0030144) |
0.1 | 0.5 | GO:0033142 | progesterone receptor binding(GO:0033142) |
0.1 | 0.6 | GO:0022824 | transmitter-gated ion channel activity(GO:0022824) transmitter-gated channel activity(GO:0022835) |
0.1 | 0.4 | GO:0035673 | oligopeptide transmembrane transporter activity(GO:0035673) |
0.1 | 0.4 | GO:0030899 | calcium-dependent ATPase activity(GO:0030899) |
0.1 | 0.6 | GO:0034481 | chondroitin sulfotransferase activity(GO:0034481) |
0.1 | 0.5 | GO:0015467 | G-protein activated inward rectifier potassium channel activity(GO:0015467) |
0.1 | 2.0 | GO:0005112 | Notch binding(GO:0005112) |
0.1 | 0.9 | GO:0008599 | protein phosphatase type 1 regulator activity(GO:0008599) |
0.1 | 0.4 | GO:0001602 | pancreatic polypeptide receptor activity(GO:0001602) |
0.1 | 0.4 | GO:0004035 | alkaline phosphatase activity(GO:0004035) |
0.1 | 1.5 | GO:0045295 | gamma-catenin binding(GO:0045295) |
0.1 | 0.4 | GO:0097001 | ceramide binding(GO:0097001) |
0.1 | 1.6 | GO:0031402 | sodium ion binding(GO:0031402) |
0.1 | 0.1 | GO:0051430 | corticotropin-releasing hormone receptor 1 binding(GO:0051430) |
0.1 | 0.4 | GO:0008046 | axon guidance receptor activity(GO:0008046) |
0.1 | 0.5 | GO:0005095 | GTPase inhibitor activity(GO:0005095) |
0.1 | 0.5 | GO:0003828 | alpha-N-acetylneuraminate alpha-2,8-sialyltransferase activity(GO:0003828) |
0.1 | 0.4 | GO:0030229 | very-low-density lipoprotein particle receptor activity(GO:0030229) |
0.1 | 1.7 | GO:0004435 | phosphatidylinositol phospholipase C activity(GO:0004435) |
0.1 | 2.4 | GO:0052714 | calmodulin-dependent cyclic-nucleotide phosphodiesterase activity(GO:0004117) cGMP-stimulated cyclic-nucleotide phosphodiesterase activity(GO:0004118) cGMP-inhibited cyclic-nucleotide phosphodiesterase activity(GO:0004119) photoreceptor cyclic-nucleotide phosphodiesterase activity(GO:0004120) 7,8-dihydro-D-neopterin 2',3'-cyclic phosphate phosphodiesterase activity(GO:0044688) inositol phosphosphingolipid phospholipase activity(GO:0052712) inositol phosphorylceramide phospholipase activity(GO:0052713) mannosyl-inositol phosphorylceramide phospholipase activity(GO:0052714) mannosyl-diinositol phosphorylceramide phospholipase activity(GO:0052715) |
0.1 | 0.7 | GO:0031995 | insulin-like growth factor II binding(GO:0031995) |
0.1 | 0.4 | GO:0005250 | A-type (transient outward) potassium channel activity(GO:0005250) |
0.1 | 0.5 | GO:0016595 | glutamate binding(GO:0016595) |
0.1 | 0.5 | GO:0032027 | myosin light chain binding(GO:0032027) |
0.1 | 0.3 | GO:0042296 | ISG15 transferase activity(GO:0042296) |
0.1 | 0.3 | GO:0032051 | clathrin light chain binding(GO:0032051) |
0.1 | 0.3 | GO:0050567 | glutaminyl-tRNA synthase (glutamine-hydrolyzing) activity(GO:0050567) |
0.1 | 0.3 | GO:0031750 | D3 dopamine receptor binding(GO:0031750) |
0.1 | 0.3 | GO:0019871 | sodium channel inhibitor activity(GO:0019871) |
0.1 | 0.3 | GO:0004985 | opioid receptor activity(GO:0004985) |
0.1 | 1.6 | GO:0017075 | syntaxin-1 binding(GO:0017075) |
0.1 | 0.3 | GO:0005025 | transforming growth factor beta receptor activity, type I(GO:0005025) |
0.1 | 0.2 | GO:0004833 | tryptophan 2,3-dioxygenase activity(GO:0004833) |
0.1 | 2.8 | GO:0005245 | voltage-gated calcium channel activity(GO:0005245) |
0.1 | 0.2 | GO:0016823 | hydrolase activity, acting on acid carbon-carbon bonds(GO:0016822) hydrolase activity, acting on acid carbon-carbon bonds, in ketonic substances(GO:0016823) |
0.1 | 0.4 | GO:0004652 | polynucleotide adenylyltransferase activity(GO:0004652) |
0.1 | 2.3 | GO:0005251 | delayed rectifier potassium channel activity(GO:0005251) |
0.1 | 0.2 | GO:0031752 | D5 dopamine receptor binding(GO:0031752) |
0.1 | 1.2 | GO:0070064 | proline-rich region binding(GO:0070064) |
0.1 | 0.4 | GO:0034190 | apolipoprotein receptor binding(GO:0034190) |
0.1 | 0.2 | GO:0015198 | oligopeptide transporter activity(GO:0015198) |
0.1 | 1.0 | GO:0016805 | dipeptidase activity(GO:0016805) |
0.1 | 0.7 | GO:0042043 | neurexin family protein binding(GO:0042043) |
0.1 | 0.3 | GO:0070290 | N-acylphosphatidylethanolamine-specific phospholipase D activity(GO:0070290) |
0.1 | 0.2 | GO:0019212 | phosphatase inhibitor activity(GO:0019212) |
0.1 | 0.3 | GO:0004459 | L-lactate dehydrogenase activity(GO:0004459) |
0.1 | 0.2 | GO:0019166 | trans-2-enoyl-CoA reductase (NADPH) activity(GO:0019166) |
0.1 | 0.3 | GO:0017040 | ceramidase activity(GO:0017040) |
0.1 | 0.6 | GO:0034450 | ubiquitin-ubiquitin ligase activity(GO:0034450) |
0.1 | 0.4 | GO:0016714 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, reduced pteridine as one donor, and incorporation of one atom of oxygen(GO:0016714) |
0.1 | 0.2 | GO:0034988 | Fc-gamma receptor I complex binding(GO:0034988) |
0.1 | 0.2 | GO:0004427 | inorganic diphosphatase activity(GO:0004427) |
0.1 | 0.2 | GO:0005347 | ATP transmembrane transporter activity(GO:0005347) |
0.1 | 0.2 | GO:0016015 | morphogen activity(GO:0016015) |
0.1 | 0.1 | GO:0015185 | gamma-aminobutyric acid transmembrane transporter activity(GO:0015185) |
0.1 | 0.2 | GO:0016286 | small conductance calcium-activated potassium channel activity(GO:0016286) |
0.1 | 0.3 | GO:0070097 | delta-catenin binding(GO:0070097) |
0.1 | 0.2 | GO:1904288 | BAT3 complex binding(GO:1904288) |
0.1 | 0.7 | GO:0031005 | filamin binding(GO:0031005) |
0.1 | 0.1 | GO:0005502 | 11-cis retinal binding(GO:0005502) |
0.1 | 0.2 | GO:0015111 | iodide transmembrane transporter activity(GO:0015111) |
0.1 | 0.5 | GO:0005068 | transmembrane receptor protein tyrosine kinase adaptor activity(GO:0005068) |
0.1 | 0.4 | GO:0003680 | AT DNA binding(GO:0003680) |
0.1 | 0.1 | GO:0001601 | peptide YY receptor activity(GO:0001601) |
0.1 | 0.2 | GO:0050501 | hyaluronan synthase activity(GO:0050501) |
0.1 | 0.2 | GO:0005042 | netrin receptor activity(GO:0005042) |
0.1 | 0.7 | GO:0005092 | GDP-dissociation inhibitor activity(GO:0005092) |
0.1 | 0.3 | GO:0004791 | thioredoxin-disulfide reductase activity(GO:0004791) |
0.1 | 0.5 | GO:0005283 | sodium:amino acid symporter activity(GO:0005283) |
0.1 | 0.9 | GO:0004198 | calcium-dependent cysteine-type endopeptidase activity(GO:0004198) |
0.0 | 0.1 | GO:0050252 | retinol O-fatty-acyltransferase activity(GO:0050252) |
0.0 | 0.2 | GO:0000268 | peroxisome targeting sequence binding(GO:0000268) |
0.0 | 0.2 | GO:0034056 | estrogen response element binding(GO:0034056) |
0.0 | 0.1 | GO:0015173 | aromatic amino acid transmembrane transporter activity(GO:0015173) |
0.0 | 0.1 | GO:0098821 | BMP receptor activity(GO:0098821) |
0.0 | 0.2 | GO:0047238 | glucuronosyl-N-acetylgalactosaminyl-proteoglycan 4-beta-N-acetylgalactosaminyltransferase activity(GO:0047238) |
0.0 | 0.1 | GO:0016508 | long-chain-enoyl-CoA hydratase activity(GO:0016508) |
0.0 | 0.5 | GO:0022821 | sodium:proton antiporter activity(GO:0015385) potassium:proton antiporter activity(GO:0015386) potassium ion antiporter activity(GO:0022821) |
0.0 | 0.2 | GO:0004994 | somatostatin receptor activity(GO:0004994) |
0.0 | 0.0 | GO:0043125 | ErbB-3 class receptor binding(GO:0043125) |
0.0 | 0.7 | GO:0016725 | oxidoreductase activity, acting on CH or CH2 groups(GO:0016725) |
0.0 | 0.3 | GO:0031748 | D1 dopamine receptor binding(GO:0031748) |
0.0 | 0.1 | GO:0030158 | protein xylosyltransferase activity(GO:0030158) |
0.0 | 0.3 | GO:0015288 | porin activity(GO:0015288) |
0.0 | 0.1 | GO:0004937 | alpha1-adrenergic receptor activity(GO:0004937) |
0.0 | 0.2 | GO:0008454 | alpha-1,3-mannosylglycoprotein 4-beta-N-acetylglucosaminyltransferase activity(GO:0008454) |
0.0 | 0.0 | GO:0004980 | melanocyte-stimulating hormone receptor activity(GO:0004980) |
0.0 | 0.0 | GO:0004517 | nitric-oxide synthase activity(GO:0004517) |
0.0 | 0.2 | GO:0052759 | 4-methyloctanoyl-CoA dehydrogenase activity(GO:0034580) naphthyl-2-methyl-succinyl-CoA dehydrogenase activity(GO:0034845) 2-methylhexanoyl-CoA dehydrogenase activity(GO:0034916) propionyl-CoA dehydrogenase activity(GO:0043820) thiol-driven fumarate reductase activity(GO:0043830) coenzyme F420-dependent 2,4,6-trinitrophenol reductase activity(GO:0052758) coenzyme F420-dependent 2,4,6-trinitrophenol hydride reductase activity(GO:0052759) coenzyme F420-dependent 2,4-dinitrophenol reductase activity(GO:0052760) |
0.0 | 0.1 | GO:0000405 | bubble DNA binding(GO:0000405) |
0.0 | 0.1 | GO:0030620 | U2 snRNA binding(GO:0030620) |
0.0 | 0.2 | GO:0034584 | piRNA binding(GO:0034584) |
0.0 | 0.3 | GO:0036310 | annealing helicase activity(GO:0036310) |
0.0 | 0.9 | GO:0004181 | metallocarboxypeptidase activity(GO:0004181) |
0.0 | 0.1 | GO:0045503 | dynein light chain binding(GO:0045503) |
0.0 | 0.1 | GO:0004104 | cholinesterase activity(GO:0004104) |
0.0 | 0.4 | GO:0016717 | oxidoreductase activity, acting on paired donors, with oxidation of a pair of donors resulting in the reduction of molecular oxygen to two molecules of water(GO:0016717) |
0.0 | 0.1 | GO:0030297 | transmembrane receptor protein tyrosine kinase activator activity(GO:0030297) |
0.0 | 0.4 | GO:0017154 | semaphorin receptor activity(GO:0017154) |
0.0 | 0.1 | GO:0004719 | protein-L-isoaspartate (D-aspartate) O-methyltransferase activity(GO:0004719) |
0.0 | 0.9 | GO:0008519 | ammonium transmembrane transporter activity(GO:0008519) |
0.0 | 0.4 | GO:0005337 | nucleoside transmembrane transporter activity(GO:0005337) |
0.0 | 0.2 | GO:0004468 | lysine N-acetyltransferase activity, acting on acetyl phosphate as donor(GO:0004468) |
0.0 | 0.0 | GO:0016509 | long-chain-3-hydroxyacyl-CoA dehydrogenase activity(GO:0016509) |
0.0 | 0.1 | GO:0051575 | 5'-deoxyribose-5-phosphate lyase activity(GO:0051575) |
0.0 | 0.3 | GO:0008020 | G-protein coupled photoreceptor activity(GO:0008020) |
0.0 | 0.2 | GO:1990247 | N6-methyladenosine-containing RNA binding(GO:1990247) |
0.0 | 0.2 | GO:0032454 | histone demethylase activity (H3-K9 specific)(GO:0032454) |
0.0 | 0.1 | GO:0015186 | L-asparagine transmembrane transporter activity(GO:0015182) L-glutamine transmembrane transporter activity(GO:0015186) |
0.0 | 0.1 | GO:0008502 | melatonin receptor activity(GO:0008502) |
0.0 | 0.3 | GO:0016624 | oxidoreductase activity, acting on the aldehyde or oxo group of donors, disulfide as acceptor(GO:0016624) |
0.0 | 0.1 | GO:0004558 | alpha-1,4-glucosidase activity(GO:0004558) |
0.0 | 0.5 | GO:0005520 | insulin-like growth factor binding(GO:0005520) |
0.0 | 0.5 | GO:0070402 | NADPH binding(GO:0070402) |
0.0 | 0.1 | GO:0015271 | outward rectifier potassium channel activity(GO:0015271) |
0.0 | 0.1 | GO:0071208 | histone pre-mRNA DCP binding(GO:0071208) |
0.0 | 0.2 | GO:0015349 | thyroid hormone transmembrane transporter activity(GO:0015349) |
0.0 | 0.2 | GO:0004931 | extracellular ATP-gated cation channel activity(GO:0004931) ATP-gated ion channel activity(GO:0035381) |
0.0 | 0.5 | GO:0050750 | low-density lipoprotein particle receptor binding(GO:0050750) |
0.0 | 0.4 | GO:0042923 | neuropeptide binding(GO:0042923) |
0.0 | 0.2 | GO:1904264 | ubiquitin protein ligase activity involved in ERAD pathway(GO:1904264) |
0.0 | 0.2 | GO:0086080 | protein binding involved in heterotypic cell-cell adhesion(GO:0086080) |
0.0 | 0.2 | GO:0046974 | histone methyltransferase activity (H3-K9 specific)(GO:0046974) |
0.0 | 0.9 | GO:0030507 | spectrin binding(GO:0030507) |
0.0 | 0.4 | GO:0017128 | phospholipid scramblase activity(GO:0017128) |
0.0 | 0.1 | GO:0015038 | glutathione disulfide oxidoreductase activity(GO:0015038) |
0.0 | 0.7 | GO:0005540 | hyaluronic acid binding(GO:0005540) |
0.0 | 0.1 | GO:0004946 | bombesin receptor activity(GO:0004946) |
0.0 | 0.1 | GO:0042289 | MHC class II protein binding(GO:0042289) |
0.0 | 0.1 | GO:0004449 | isocitrate dehydrogenase (NAD+) activity(GO:0004449) |
0.0 | 0.1 | GO:0016174 | NAD(P)H oxidase activity(GO:0016174) |
0.0 | 0.1 | GO:0008499 | UDP-galactose:beta-N-acetylglucosamine beta-1,3-galactosyltransferase activity(GO:0008499) |
0.0 | 0.8 | GO:0005184 | neuropeptide hormone activity(GO:0005184) |
0.0 | 0.1 | GO:0004949 | cannabinoid receptor activity(GO:0004949) |
0.0 | 0.2 | GO:0015280 | ligand-gated sodium channel activity(GO:0015280) |
0.0 | 0.4 | GO:0015026 | coreceptor activity(GO:0015026) |
0.0 | 0.0 | GO:0042392 | sphingosine-1-phosphate phosphatase activity(GO:0042392) |
0.0 | 0.1 | GO:0004969 | histamine receptor activity(GO:0004969) |
0.0 | 0.2 | GO:0003688 | DNA replication origin binding(GO:0003688) |
0.0 | 1.0 | GO:0019888 | protein phosphatase regulator activity(GO:0019888) |
0.0 | 0.0 | GO:0016941 | natriuretic peptide receptor activity(GO:0016941) |
0.0 | 0.4 | GO:1990841 | promoter-specific chromatin binding(GO:1990841) |
0.0 | 0.1 | GO:0003708 | retinoic acid receptor activity(GO:0003708) |
0.0 | 0.1 | GO:0008900 | hydrogen:potassium-exchanging ATPase activity(GO:0008900) |
0.0 | 0.0 | GO:0016775 | phosphotransferase activity, nitrogenous group as acceptor(GO:0016775) |
0.0 | 0.1 | GO:0008142 | oxysterol binding(GO:0008142) |
0.0 | 0.3 | GO:0008191 | metalloendopeptidase inhibitor activity(GO:0008191) |
0.0 | 0.4 | GO:0008266 | poly(U) RNA binding(GO:0008266) |
0.0 | 0.1 | GO:0005007 | fibroblast growth factor-activated receptor activity(GO:0005007) |
0.0 | 0.2 | GO:0004383 | guanylate cyclase activity(GO:0004383) |
0.0 | 0.5 | GO:0005246 | calcium channel regulator activity(GO:0005246) |
0.0 | 0.1 | GO:0036402 | proteasome-activating ATPase activity(GO:0036402) |
0.0 | 0.0 | GO:0005001 | transmembrane receptor protein tyrosine phosphatase activity(GO:0005001) |
0.0 | 0.2 | GO:0004143 | diacylglycerol kinase activity(GO:0004143) |
0.0 | 1.1 | GO:0051082 | unfolded protein binding(GO:0051082) |
0.0 | 0.1 | GO:0031849 | olfactory receptor binding(GO:0031849) |
0.0 | 0.1 | GO:0004127 | cytidylate kinase activity(GO:0004127) |
0.0 | 0.1 | GO:0004945 | angiotensin type II receptor activity(GO:0004945) |
0.0 | 0.1 | GO:2001070 | starch binding(GO:2001070) |
0.0 | 0.8 | GO:0005109 | frizzled binding(GO:0005109) |
0.0 | 0.4 | GO:0015928 | fucosidase activity(GO:0015928) |
0.0 | 0.3 | GO:0005545 | 1-phosphatidylinositol binding(GO:0005545) |
0.0 | 0.9 | GO:0005544 | calcium-dependent phospholipid binding(GO:0005544) |
0.0 | 0.1 | GO:0034711 | inhibin binding(GO:0034711) |
0.0 | 0.1 | GO:0004430 | 1-phosphatidylinositol 4-kinase activity(GO:0004430) |
0.0 | 0.1 | GO:0016421 | CoA carboxylase activity(GO:0016421) |
0.0 | 0.0 | GO:0001031 | RNA polymerase III type 1 promoter DNA binding(GO:0001030) RNA polymerase III type 2 promoter DNA binding(GO:0001031) RNA polymerase III type 3 promoter DNA binding(GO:0001032) 5S rDNA binding(GO:0080084) |
0.0 | 0.4 | GO:0005086 | ARF guanyl-nucleotide exchange factor activity(GO:0005086) |
0.0 | 0.0 | GO:0019834 | phospholipase A2 inhibitor activity(GO:0019834) |
0.0 | 0.1 | GO:0051377 | mannose-ethanolamine phosphotransferase activity(GO:0051377) |
0.0 | 0.1 | GO:0089720 | caspase binding(GO:0089720) |
0.0 | 0.1 | GO:0033192 | calmodulin-dependent protein phosphatase activity(GO:0033192) |
0.0 | 0.4 | GO:0052867 | phosphohistidine phosphatase activity(GO:0008969) inositol-1,3,4-trisphosphate 4-phosphatase activity(GO:0017161) NADP phosphatase activity(GO:0019178) transmembrane receptor protein phosphatase activity(GO:0019198) 5-amino-6-(5-phosphoribitylamino)uracil phosphatase activity(GO:0043726) phosphatidylinositol-3,5-bisphosphate 5-phosphatase activity(GO:0043813) inositol-1,3,4,5,6-pentakisphosphate 1-phosphatase activity(GO:0052825) inositol-3,4-bisphosphate 4-phosphatase activity(GO:0052828) inositol-1,3,4-trisphosphate 1-phosphatase activity(GO:0052829) inositol-1,3,4,6-tetrakisphosphate 6-phosphatase activity(GO:0052830) inositol-1,3,4,6-tetrakisphosphate 1-phosphatase activity(GO:0052831) phosphatidylinositol-1,4,5-trisphosphate 5-phosphatase activity(GO:0052867) IDP phosphatase activity(GO:1990003) |
0.0 | 0.1 | GO:0098634 | protein binding involved in cell-matrix adhesion(GO:0098634) |
0.0 | 0.2 | GO:0030552 | cAMP binding(GO:0030552) |
0.0 | 0.1 | GO:0009881 | photoreceptor activity(GO:0009881) |
0.0 | 0.2 | GO:0001206 | transcriptional repressor activity, RNA polymerase II distal enhancer sequence-specific binding(GO:0001206) |
0.0 | 0.1 | GO:0031694 | alpha-2A adrenergic receptor binding(GO:0031694) |
0.0 | 0.0 | GO:0004966 | galanin receptor activity(GO:0004966) |
0.0 | 0.3 | GO:0042166 | acetylcholine binding(GO:0042166) |
0.0 | 0.1 | GO:0043023 | ribosomal large subunit binding(GO:0043023) |
0.0 | 0.6 | GO:0051018 | protein kinase A binding(GO:0051018) |
0.0 | 0.0 | GO:0031893 | vasopressin receptor binding(GO:0031893) |
0.0 | 0.4 | GO:0015347 | sodium-independent organic anion transmembrane transporter activity(GO:0015347) |
0.0 | 0.1 | GO:0050811 | GABA receptor binding(GO:0050811) |
0.0 | 0.1 | GO:0070052 | collagen V binding(GO:0070052) |
0.0 | 0.1 | GO:0005227 | calcium activated cation channel activity(GO:0005227) |
0.0 | 0.1 | GO:0043888 | 4-hydroxybenzoate octaprenyltransferase activity(GO:0008412) protoheme IX farnesyltransferase activity(GO:0008495) (S)-2,3-di-O-geranylgeranylglyceryl phosphate synthase activity(GO:0043888) cadaverine aminopropyltransferase activity(GO:0043918) agmatine aminopropyltransferase activity(GO:0043919) 1,4-dihydroxy-2-naphthoate octaprenyltransferase activity(GO:0046428) trans-pentaprenyltranstransferase activity(GO:0048045) ATP dimethylallyltransferase activity(GO:0052622) ADP dimethylallyltransferase activity(GO:0052623) |
0.0 | 0.1 | GO:0004515 | nicotinamide-nucleotide adenylyltransferase activity(GO:0000309) nicotinate-nucleotide adenylyltransferase activity(GO:0004515) |
0.0 | 0.1 | GO:0032795 | heterotrimeric G-protein binding(GO:0032795) |
0.0 | 0.0 | GO:0032564 | dATP binding(GO:0032564) |
0.0 | 0.1 | GO:0050508 | glucuronosyl-N-acetylglucosaminyl-proteoglycan 4-alpha-N-acetylglucosaminyltransferase activity(GO:0050508) |
0.0 | 0.0 | GO:0000774 | adenyl-nucleotide exchange factor activity(GO:0000774) |
0.0 | 0.1 | GO:0004826 | phenylalanine-tRNA ligase activity(GO:0004826) |
0.0 | 0.1 | GO:0019531 | oxalate transmembrane transporter activity(GO:0019531) |
0.0 | 0.1 | GO:0061665 | SUMO ligase activity(GO:0061665) |
0.0 | 0.0 | GO:0035514 | DNA demethylase activity(GO:0035514) |
0.0 | 0.0 | GO:0036042 | long-chain fatty acyl-CoA binding(GO:0036042) |
0.0 | 0.1 | GO:0004499 | N,N-dimethylaniline monooxygenase activity(GO:0004499) |
0.0 | 0.2 | GO:0015269 | calcium-activated potassium channel activity(GO:0015269) |
0.0 | 0.1 | GO:0000900 | translation repressor activity, nucleic acid binding(GO:0000900) |
0.0 | 0.0 | GO:0050816 | phosphothreonine binding(GO:0050816) |
0.0 | 0.1 | GO:0001665 | alpha-N-acetylgalactosaminide alpha-2,6-sialyltransferase activity(GO:0001665) |
0.0 | 0.4 | GO:0005104 | fibroblast growth factor receptor binding(GO:0005104) |
0.0 | 0.0 | GO:0015232 | heme transporter activity(GO:0015232) |
0.0 | 0.1 | GO:0035241 | protein-arginine omega-N monomethyltransferase activity(GO:0035241) |
0.0 | 0.0 | GO:0031698 | beta-2 adrenergic receptor binding(GO:0031698) |
0.0 | 0.0 | GO:0003886 | DNA (cytosine-5-)-methyltransferase activity(GO:0003886) DNA (cytosine-5-)-methyltransferase activity, acting on CpG substrates(GO:0051718) |
0.0 | 0.1 | GO:0008097 | 5S rRNA binding(GO:0008097) |
0.0 | 0.1 | GO:0035613 | RNA stem-loop binding(GO:0035613) |
0.0 | 0.1 | GO:0035184 | histone threonine kinase activity(GO:0035184) |
0.0 | 0.1 | GO:0015016 | [heparan sulfate]-glucosamine N-sulfotransferase activity(GO:0015016) |
0.0 | 0.1 | GO:0019784 | NEDD8-specific protease activity(GO:0019784) |
0.0 | 0.1 | GO:0008093 | cytoskeletal adaptor activity(GO:0008093) |
0.0 | 0.1 | GO:0034618 | arginine binding(GO:0034618) |
0.0 | 0.1 | GO:0004370 | glycerol kinase activity(GO:0004370) |
0.0 | 0.2 | GO:0001784 | phosphotyrosine binding(GO:0001784) |
0.0 | 0.1 | GO:0010997 | anaphase-promoting complex binding(GO:0010997) |
0.0 | 0.1 | GO:0001161 | intronic transcription regulatory region sequence-specific DNA binding(GO:0001161) |
0.0 | 0.1 | GO:0005499 | vitamin D binding(GO:0005499) |
0.0 | 0.1 | GO:0005324 | long-chain fatty acid transporter activity(GO:0005324) |
0.0 | 0.0 | GO:0033829 | O-fucosylpeptide 3-beta-N-acetylglucosaminyltransferase activity(GO:0033829) |
0.0 | 0.4 | GO:0017046 | peptide hormone binding(GO:0017046) |
0.0 | 0.0 | GO:0008556 | potassium-transporting ATPase activity(GO:0008556) |
0.0 | 0.1 | GO:0004111 | creatine kinase activity(GO:0004111) |
0.0 | 0.1 | GO:0051011 | microtubule minus-end binding(GO:0051011) |
0.0 | 0.1 | GO:0005412 | glucose:sodium symporter activity(GO:0005412) |
0.0 | 0.0 | GO:0008427 | calcium-dependent protein kinase inhibitor activity(GO:0008427) |
0.0 | 0.0 | GO:0016907 | G-protein coupled acetylcholine receptor activity(GO:0016907) |
0.0 | 0.1 | GO:0015181 | arginine transmembrane transporter activity(GO:0015181) L-lysine transmembrane transporter activity(GO:0015189) |
0.0 | 0.5 | GO:0005267 | potassium channel activity(GO:0005267) |
0.0 | 0.1 | GO:0042608 | T cell receptor binding(GO:0042608) |
0.0 | 0.0 | GO:0032422 | purine-rich negative regulatory element binding(GO:0032422) |
0.0 | 0.1 | GO:0016812 | hydrolase activity, acting on carbon-nitrogen (but not peptide) bonds, in cyclic amides(GO:0016812) |
0.0 | 0.0 | GO:0003872 | 6-phosphofructokinase activity(GO:0003872) |
0.0 | 0.1 | GO:0035662 | Toll-like receptor 4 binding(GO:0035662) |
0.0 | 0.2 | GO:0017049 | GTP-Rho binding(GO:0017049) |
0.0 | 0.0 | GO:0035612 | AP-2 adaptor complex binding(GO:0035612) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.2 | 3.3 | PID SYNDECAN 3 PATHWAY | Syndecan-3-mediated signaling events |
0.2 | 0.4 | PID WNT NONCANONICAL PATHWAY | Noncanonical Wnt signaling pathway |
0.1 | 2.6 | PID NETRIN PATHWAY | Netrin-mediated signaling events |
0.1 | 0.3 | PID INTEGRIN A9B1 PATHWAY | Alpha9 beta1 integrin signaling events |
0.1 | 0.7 | PID S1P S1P4 PATHWAY | S1P4 pathway |
0.1 | 1.0 | PID ERBB NETWORK PATHWAY | ErbB receptor signaling network |
0.1 | 1.6 | PID NCADHERIN PATHWAY | N-cadherin signaling events |
0.1 | 0.9 | PID AR NONGENOMIC PATHWAY | Nongenotropic Androgen signaling |
0.1 | 1.7 | ST B CELL ANTIGEN RECEPTOR | B Cell Antigen Receptor |
0.1 | 0.3 | PID S1P S1P1 PATHWAY | S1P1 pathway |
0.1 | 0.1 | ST INTERLEUKIN 4 PATHWAY | Interleukin 4 (IL-4) Pathway |
0.0 | 2.6 | PID NOTCH PATHWAY | Notch signaling pathway |
0.0 | 0.4 | PID REELIN PATHWAY | Reelin signaling pathway |
0.0 | 0.1 | ST G ALPHA I PATHWAY | G alpha i Pathway |
0.0 | 0.1 | PID ECADHERIN KERATINOCYTE PATHWAY | E-cadherin signaling in keratinocytes |
0.0 | 0.5 | ST T CELL SIGNAL TRANSDUCTION | T Cell Signal Transduction |
0.0 | 1.3 | PID SHP2 PATHWAY | SHP2 signaling |
0.0 | 0.0 | PID ERB GENOMIC PATHWAY | Validated nuclear estrogen receptor beta network |
0.0 | 0.3 | PID TCR JNK PATHWAY | JNK signaling in the CD4+ TCR pathway |
0.0 | 0.7 | PID WNT SIGNALING PATHWAY | Wnt signaling network |
0.0 | 0.1 | PID GLYPICAN 1PATHWAY | Glypican 1 network |
0.0 | 0.3 | ST GA12 PATHWAY | G alpha 12 Pathway |
0.0 | 0.4 | PID ALPHA SYNUCLEIN PATHWAY | Alpha-synuclein signaling |
0.0 | 0.4 | PID EPHA FWDPATHWAY | EPHA forward signaling |
0.0 | 0.1 | ST PAC1 RECEPTOR PATHWAY | PAC1 Receptor Pathway |
0.0 | 0.5 | PID ECADHERIN STABILIZATION PATHWAY | Stabilization and expansion of the E-cadherin adherens junction |
0.0 | 0.2 | PID INTEGRIN4 PATHWAY | Alpha6 beta4 integrin-ligand interactions |
0.0 | 0.0 | PID EPHA2 FWD PATHWAY | EPHA2 forward signaling |
0.0 | 0.6 | PID ARF6 TRAFFICKING PATHWAY | Arf6 trafficking events |
0.0 | 0.1 | PID ARF6 DOWNSTREAM PATHWAY | Arf6 downstream pathway |
0.0 | 0.1 | ST G ALPHA S PATHWAY | G alpha s Pathway |
0.0 | 0.3 | PID TCR CALCIUM PATHWAY | Calcium signaling in the CD4+ TCR pathway |
0.0 | 0.3 | PID HDAC CLASSII PATHWAY | Signaling events mediated by HDAC Class II |
0.0 | 0.2 | PID SYNDECAN 4 PATHWAY | Syndecan-4-mediated signaling events |
0.0 | 0.1 | PID RAS PATHWAY | Regulation of Ras family activation |
0.0 | 0.1 | PID ANGIOPOIETIN RECEPTOR PATHWAY | Angiopoietin receptor Tie2-mediated signaling |
0.0 | 0.2 | PID DNA PK PATHWAY | DNA-PK pathway in nonhomologous end joining |
0.0 | 0.7 | PID BETA CATENIN NUC PATHWAY | Regulation of nuclear beta catenin signaling and target gene transcription |
0.0 | 0.0 | PID RANBP2 PATHWAY | Sumoylation by RanBP2 regulates transcriptional repression |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.4 | 0.9 | REACTOME REGULATION OF INSULIN SECRETION | Genes involved in Regulation of Insulin Secretion |
0.2 | 3.2 | REACTOME CRMPS IN SEMA3A SIGNALING | Genes involved in CRMPs in Sema3A signaling |
0.2 | 3.2 | REACTOME UNBLOCKING OF NMDA RECEPTOR GLUTAMATE BINDING AND ACTIVATION | Genes involved in Unblocking of NMDA receptor, glutamate binding and activation |
0.2 | 0.2 | REACTOME SIGNALING BY NOTCH3 | Genes involved in Signaling by NOTCH3 |
0.2 | 2.1 | REACTOME GABA A RECEPTOR ACTIVATION | Genes involved in GABA A receptor activation |
0.2 | 0.3 | REACTOME CELL CELL COMMUNICATION | Genes involved in Cell-Cell communication |
0.2 | 2.7 | REACTOME GABA SYNTHESIS RELEASE REUPTAKE AND DEGRADATION | Genes involved in GABA synthesis, release, reuptake and degradation |
0.1 | 1.0 | REACTOME LIGAND GATED ION CHANNEL TRANSPORT | Genes involved in Ligand-gated ion channel transport |
0.1 | 0.4 | REACTOME BINDING AND ENTRY OF HIV VIRION | Genes involved in Binding and entry of HIV virion |
0.1 | 2.4 | REACTOME ACTIVATED NOTCH1 TRANSMITS SIGNAL TO THE NUCLEUS | Genes involved in Activated NOTCH1 Transmits Signal to the Nucleus |
0.1 | 1.5 | REACTOME INSULIN SYNTHESIS AND PROCESSING | Genes involved in Insulin Synthesis and Processing |
0.1 | 1.5 | REACTOME POST CHAPERONIN TUBULIN FOLDING PATHWAY | Genes involved in Post-chaperonin tubulin folding pathway |
0.1 | 1.7 | REACTOME CHONDROITIN SULFATE BIOSYNTHESIS | Genes involved in Chondroitin sulfate biosynthesis |
0.1 | 2.2 | REACTOME MYOGENESIS | Genes involved in Myogenesis |
0.1 | 1.2 | REACTOME CLASS C 3 METABOTROPIC GLUTAMATE PHEROMONE RECEPTORS | Genes involved in Class C/3 (Metabotropic glutamate/pheromone receptors) |
0.1 | 0.8 | REACTOME CYTOSOLIC SULFONATION OF SMALL MOLECULES | Genes involved in Cytosolic sulfonation of small molecules |
0.1 | 0.4 | REACTOME DSCAM INTERACTIONS | Genes involved in DSCAM interactions |
0.1 | 0.6 | REACTOME DOWNREGULATION OF ERBB2 ERBB3 SIGNALING | Genes involved in Downregulation of ERBB2:ERBB3 signaling |
0.1 | 2.1 | REACTOME NETRIN1 SIGNALING | Genes involved in Netrin-1 signaling |
0.1 | 0.9 | REACTOME ACETYLCHOLINE BINDING AND DOWNSTREAM EVENTS | Genes involved in Acetylcholine Binding And Downstream Events |
0.1 | 0.5 | REACTOME THE ACTIVATION OF ARYLSULFATASES | Genes involved in The activation of arylsulfatases |
0.1 | 2.5 | REACTOME VOLTAGE GATED POTASSIUM CHANNELS | Genes involved in Voltage gated Potassium channels |
0.1 | 1.5 | REACTOME G PROTEIN ACTIVATION | Genes involved in G-protein activation |
0.1 | 1.0 | REACTOME TRAFFICKING OF AMPA RECEPTORS | Genes involved in Trafficking of AMPA receptors |
0.0 | 0.4 | REACTOME PHOSPHORYLATION OF CD3 AND TCR ZETA CHAINS | Genes involved in Phosphorylation of CD3 and TCR zeta chains |
0.0 | 0.5 | REACTOME INHIBITION OF VOLTAGE GATED CA2 CHANNELS VIA GBETA GAMMA SUBUNITS | Genes involved in Inhibition of voltage gated Ca2+ channels via Gbeta/gamma subunits |
0.0 | 0.1 | REACTOME DOPAMINE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Dopamine Neurotransmitter Release Cycle |
0.0 | 0.0 | REACTOME INTERACTIONS OF VPR WITH HOST CELLULAR PROTEINS | Genes involved in Interactions of Vpr with host cellular proteins |
0.0 | 0.7 | REACTOME THE ROLE OF NEF IN HIV1 REPLICATION AND DISEASE PATHOGENESIS | Genes involved in The role of Nef in HIV-1 replication and disease pathogenesis |
0.0 | 0.9 | REACTOME DARPP 32 EVENTS | Genes involved in DARPP-32 events |
0.0 | 0.5 | REACTOME SYNTHESIS SECRETION AND INACTIVATION OF GLP1 | Genes involved in Synthesis, Secretion, and Inactivation of Glucagon-like Peptide-1 (GLP-1) |
0.0 | 0.9 | REACTOME AMINE COMPOUND SLC TRANSPORTERS | Genes involved in Amine compound SLC transporters |
0.0 | 0.7 | REACTOME ADHERENS JUNCTIONS INTERACTIONS | Genes involved in Adherens junctions interactions |
0.0 | 0.3 | REACTOME OPSINS | Genes involved in Opsins |
0.0 | 0.3 | REACTOME CREATION OF C4 AND C2 ACTIVATORS | Genes involved in Creation of C4 and C2 activators |
0.0 | 0.2 | REACTOME INHIBITION OF INSULIN SECRETION BY ADRENALINE NORADRENALINE | Genes involved in Inhibition of Insulin Secretion by Adrenaline/Noradrenaline |
0.0 | 0.1 | REACTOME ACYL CHAIN REMODELLING OF PS | Genes involved in Acyl chain remodelling of PS |
0.0 | 0.6 | REACTOME SIGNALING BY ROBO RECEPTOR | Genes involved in Signaling by Robo receptor |
0.0 | 0.1 | REACTOME ALPHA LINOLENIC ACID ALA METABOLISM | Genes involved in alpha-linolenic acid (ALA) metabolism |
0.0 | 0.4 | REACTOME INFLAMMASOMES | Genes involved in Inflammasomes |
0.0 | 0.3 | REACTOME GENERATION OF SECOND MESSENGER MOLECULES | Genes involved in Generation of second messenger molecules |
0.0 | 0.7 | REACTOME YAP1 AND WWTR1 TAZ STIMULATED GENE EXPRESSION | Genes involved in YAP1- and WWTR1 (TAZ)-stimulated gene expression |
0.0 | 0.2 | REACTOME INTEGRATION OF PROVIRUS | Genes involved in Integration of provirus |
0.0 | 0.3 | REACTOME HORMONE LIGAND BINDING RECEPTORS | Genes involved in Hormone ligand-binding receptors |
0.0 | 1.7 | REACTOME ACTIVATION OF NF KAPPAB IN B CELLS | Genes involved in Activation of NF-kappaB in B Cells |
0.0 | 1.7 | REACTOME L1CAM INTERACTIONS | Genes involved in L1CAM interactions |
0.0 | 1.6 | REACTOME P75 NTR RECEPTOR MEDIATED SIGNALLING | Genes involved in p75 NTR receptor-mediated signalling |
0.0 | 0.3 | REACTOME TANDEM PORE DOMAIN POTASSIUM CHANNELS | Genes involved in Tandem pore domain potassium channels |
0.0 | 0.1 | REACTOME VEGF LIGAND RECEPTOR INTERACTIONS | Genes involved in VEGF ligand-receptor interactions |
0.0 | 0.1 | REACTOME CA DEPENDENT EVENTS | Genes involved in Ca-dependent events |
0.0 | 0.5 | REACTOME GLYCOSPHINGOLIPID METABOLISM | Genes involved in Glycosphingolipid metabolism |
0.0 | 0.1 | REACTOME G BETA GAMMA SIGNALLING THROUGH PLC BETA | Genes involved in G beta:gamma signalling through PLC beta |
0.0 | 0.3 | REACTOME SYNTHESIS OF BILE ACIDS AND BILE SALTS VIA 7ALPHA HYDROXYCHOLESTEROL | Genes involved in Synthesis of bile acids and bile salts via 7alpha-hydroxycholesterol |
0.0 | 0.4 | REACTOME POTASSIUM CHANNELS | Genes involved in Potassium Channels |
0.0 | 0.4 | REACTOME CHOLESTEROL BIOSYNTHESIS | Genes involved in Cholesterol biosynthesis |
0.0 | 0.1 | REACTOME CS DS DEGRADATION | Genes involved in CS/DS degradation |
0.0 | 0.9 | REACTOME TRANSMISSION ACROSS CHEMICAL SYNAPSES | Genes involved in Transmission across Chemical Synapses |
0.0 | 0.3 | REACTOME RAP1 SIGNALLING | Genes involved in Rap1 signalling |
0.0 | 0.3 | REACTOME N GLYCAN ANTENNAE ELONGATION | Genes involved in N-Glycan antennae elongation |
0.0 | 0.5 | REACTOME STEROID HORMONES | Genes involved in Steroid hormones |
0.0 | 0.0 | REACTOME FGFR2C LIGAND BINDING AND ACTIVATION | Genes involved in FGFR2c ligand binding and activation |
0.0 | 0.0 | REACTOME NEGATIVE REGULATION OF THE PI3K AKT NETWORK | Genes involved in Negative regulation of the PI3K/AKT network |
0.0 | 0.5 | REACTOME TRANSPORT OF VITAMINS NUCLEOSIDES AND RELATED MOLECULES | Genes involved in Transport of vitamins, nucleosides, and related molecules |
0.0 | 0.8 | REACTOME MITOCHONDRIAL PROTEIN IMPORT | Genes involved in Mitochondrial Protein Import |
0.0 | 0.2 | REACTOME REGULATION OF INSULIN LIKE GROWTH FACTOR IGF ACTIVITY BY INSULIN LIKE GROWTH FACTOR BINDING PROTEINS IGFBPS | Genes involved in Regulation of Insulin-like Growth Factor (IGF) Activity by Insulin-like Growth Factor Binding Proteins (IGFBPs) |
0.0 | 0.2 | REACTOME TRYPTOPHAN CATABOLISM | Genes involved in Tryptophan catabolism |
0.0 | 0.3 | REACTOME ABCA TRANSPORTERS IN LIPID HOMEOSTASIS | Genes involved in ABCA transporters in lipid homeostasis |
0.0 | 0.3 | REACTOME A TETRASACCHARIDE LINKER SEQUENCE IS REQUIRED FOR GAG SYNTHESIS | Genes involved in A tetrasaccharide linker sequence is required for GAG synthesis |
0.0 | 0.0 | REACTOME NOD1 2 SIGNALING PATHWAY | Genes involved in NOD1/2 Signaling Pathway |
0.0 | 0.2 | REACTOME SYNTHESIS OF SUBSTRATES IN N GLYCAN BIOSYTHESIS | Genes involved in Synthesis of substrates in N-glycan biosythesis |
0.0 | 0.1 | REACTOME CIRCADIAN REPRESSION OF EXPRESSION BY REV ERBA | Genes involved in Circadian Repression of Expression by REV-ERBA |
0.0 | 0.2 | REACTOME SIGNALING BY FGFR3 MUTANTS | Genes involved in Signaling by FGFR3 mutants |
0.0 | 0.1 | REACTOME ADVANCED GLYCOSYLATION ENDPRODUCT RECEPTOR SIGNALING | Genes involved in Advanced glycosylation endproduct receptor signaling |
0.0 | 0.0 | REACTOME SHC RELATED EVENTS | Genes involved in SHC-related events |
0.0 | 0.0 | REACTOME PD1 SIGNALING | Genes involved in PD-1 signaling |
0.0 | 0.3 | REACTOME SIGNALING BY BMP | Genes involved in Signaling by BMP |
0.0 | 0.3 | REACTOME MRNA SPLICING MINOR PATHWAY | Genes involved in mRNA Splicing - Minor Pathway |
0.0 | 0.3 | REACTOME SIGNALING BY NOTCH1 | Genes involved in Signaling by NOTCH1 |
0.0 | 0.0 | REACTOME FGFR1 LIGAND BINDING AND ACTIVATION | Genes involved in FGFR1 ligand binding and activation |
0.0 | 0.1 | REACTOME PASSIVE TRANSPORT BY AQUAPORINS | Genes involved in Passive Transport by Aquaporins |