Gene Symbol | Gene ID | Gene Info |
---|---|---|
Pitx1
|
ENSMUSG00000021506.7 | Pitx1 |
CRE | Gene | Distance | Association probability | Pearson corr. coef. | P-value | Plot |
---|---|---|---|---|---|---|
Pitx1 | chr13_55899648_55899799 | 63531 | 0.085205 | -0.56 | 1.0e-05 | Click! |
Pitx1 | chr13_55899995_55900146 | 63878 | 0.084802 | -0.43 | 1.1e-03 | Click! |
Pitx1 | chr13_55912241_55912444 | 76150 | 0.071550 | -0.43 | 1.2e-03 | Click! |
Pitx1 | chr13_55855799_55855980 | 19697 | 0.137068 | -0.40 | 2.3e-03 | Click! |
Pitx1 | chr13_55856027_55856178 | 19910 | 0.136898 | -0.40 | 2.7e-03 | Click! |
Move your cursor over a bar to see sample name and corresponding Z-value.
Cis Regulatory Element (CRE) | Target Score | Top associated gene | Gene Info | Distance of CRE to TSS | CRE/Gene association probability |
---|---|---|---|---|---|
chr1_168287679_168288893 | 9.26 |
Gm37524 |
predicted gene, 37524 |
49385 |
0.16 |
chr10_121569006_121569830 | 7.86 |
Tbk1 |
TANK-binding kinase 1 |
937 |
0.48 |
chr7_51991063_51991344 | 7.11 |
Svip |
small VCP/p97-interacting protein |
14495 |
0.16 |
chr1_154034449_154034624 | 6.74 |
Gm28286 |
predicted gene 28286 |
235 |
0.92 |
chr2_155605299_155605479 | 6.70 |
Myh7b |
myosin, heavy chain 7B, cardiac muscle, beta |
5823 |
0.09 |
chr16_76455723_76455887 | 6.61 |
Gm45030 |
predicted gene 45030 |
47104 |
0.13 |
chr11_64801456_64801643 | 6.40 |
Gm12291 |
predicted gene 12291 |
41522 |
0.17 |
chr7_120980473_120980737 | 6.39 |
Cdr2 |
cerebellar degeneration-related 2 |
1185 |
0.29 |
chr11_109550077_109550245 | 6.33 |
Arsg |
arylsulfatase G |
6407 |
0.18 |
chr11_11729316_11729485 | 6.27 |
Gm12000 |
predicted gene 12000 |
32961 |
0.14 |
chr1_136347174_136347468 | 6.24 |
Camsap2 |
calmodulin regulated spectrin-associated protein family, member 2 |
1217 |
0.44 |
chr4_135739766_135739922 | 6.23 |
Il22ra1 |
interleukin 22 receptor, alpha 1 |
11672 |
0.12 |
chr1_82816421_82816691 | 6.21 |
Gm28942 |
predicted gene 28942 |
3279 |
0.12 |
chr13_112749249_112749523 | 6.07 |
Slc38a9 |
solute carrier family 38, member 9 |
13776 |
0.14 |
chr14_14351950_14353283 | 5.99 |
Il3ra |
interleukin 3 receptor, alpha chain |
2995 |
0.15 |
chr14_63124821_63124972 | 5.95 |
Ctsb |
cathepsin B |
2382 |
0.21 |
chr10_43609261_43609415 | 5.90 |
F930017D23Rik |
RIKEN cDNA F930017D23 gene |
14409 |
0.13 |
chr7_79269506_79269840 | 5.86 |
Gm31510 |
predicted gene, 31510 |
3138 |
0.18 |
chr2_153495495_153495649 | 5.81 |
4930404H24Rik |
RIKEN cDNA 4930404H24 gene |
2782 |
0.24 |
chr2_167431166_167431353 | 5.65 |
Slc9a8 |
solute carrier family 9 (sodium/hydrogen exchanger), member 8 |
7140 |
0.18 |
chr11_58351240_58351509 | 5.64 |
Sh3bp5l |
SH3 binding domain protein 5 like |
6062 |
0.1 |
chr9_64792478_64792650 | 5.51 |
Dennd4a |
DENN/MADD domain containing 4A |
18776 |
0.18 |
chr11_60922221_60922530 | 5.38 |
Natd1 |
N-acetyltransferase domain containing 1 |
7625 |
0.13 |
chr3_37503955_37504109 | 5.38 |
Spata5 |
spermatogenesis associated 5 |
10844 |
0.14 |
chr2_79762768_79763048 | 5.37 |
Ppp1r1c |
protein phosphatase 1, regulatory inhibitor subunit 1C |
23683 |
0.25 |
chr7_120880375_120880588 | 5.35 |
Eef2k |
eukaryotic elongation factor-2 kinase |
4261 |
0.14 |
chr10_127135695_127135846 | 5.27 |
Gm4178 |
predicted gene 4178 |
2274 |
0.13 |
chr6_30146983_30147411 | 5.19 |
Mir182 |
microRNA 182 |
18795 |
0.12 |
chr5_148935398_148935729 | 5.19 |
Katnal1 |
katanin p60 subunit A-like 1 |
6243 |
0.1 |
chr11_90664140_90664357 | 5.14 |
Tom1l1 |
target of myb1-like 1 (chicken) |
936 |
0.58 |
chr4_108960317_108960468 | 5.12 |
8030443G20Rik |
RIKEN cDNA 8030443G20 gene |
11685 |
0.13 |
chr5_22557624_22557806 | 5.03 |
6030443J06Rik |
RIKEN cDNA 6030443J06 gene |
3800 |
0.14 |
chr11_48855844_48857180 | 5.01 |
Gm16170 |
predicted gene 16170 |
3019 |
0.13 |
chr13_22040415_22040853 | 4.94 |
H4c9 |
H4 clustered histone 9 |
728 |
0.27 |
chr1_23282966_23283129 | 4.90 |
Gm27028 |
predicted gene, 27028 |
8490 |
0.12 |
chr9_71163197_71163362 | 4.88 |
Aqp9 |
aquaporin 9 |
10 |
0.91 |
chr2_153492229_153493481 | 4.84 |
4930404H24Rik |
RIKEN cDNA 4930404H24 gene |
65 |
0.82 |
chr9_50922918_50923071 | 4.81 |
Gm25558 |
predicted gene, 25558 |
35044 |
0.13 |
chr19_10662035_10662222 | 4.74 |
Vwce |
von Willebrand factor C and EGF domains |
4139 |
0.11 |
chr18_60502311_60502624 | 4.70 |
Smim3 |
small integral membrane protein 3 |
480 |
0.78 |
chr10_98905567_98905872 | 4.68 |
Atp2b1 |
ATPase, Ca++ transporting, plasma membrane 1 |
8687 |
0.28 |
chr14_47515855_47516006 | 4.68 |
Gm35166 |
predicted gene, 35166 |
7743 |
0.12 |
chrX_7966047_7966219 | 4.66 |
Gata1 |
GATA binding protein 1 |
1777 |
0.17 |
chr2_153259980_153260131 | 4.65 |
Pofut1 |
protein O-fucosyltransferase 1 |
2483 |
0.21 |
chr8_60939112_60939287 | 4.61 |
Clcn3 |
chloride channel, voltage-sensitive 3 |
15549 |
0.15 |
chr16_91292688_91293239 | 4.59 |
Olig1 |
oligodendrocyte transcription factor 1 |
23191 |
0.11 |
chr3_146393120_146393289 | 4.55 |
Gm22078 |
predicted gene, 22078 |
5360 |
0.14 |
chr10_93883124_93883275 | 4.52 |
Metap2 |
methionine aminopeptidase 2 |
4287 |
0.15 |
chr11_88045557_88045711 | 4.50 |
Srsf1 |
serine and arginine-rich splicing factor 1 |
1739 |
0.23 |
chr11_102364061_102364256 | 4.49 |
Slc4a1 |
solute carrier family 4 (anion exchanger), member 1 |
454 |
0.69 |
chr19_37667983_37668152 | 4.43 |
Cyp26c1 |
cytochrome P450, family 26, subfamily c, polypeptide 1 |
17514 |
0.18 |
chr17_84942782_84942953 | 4.40 |
Ppm1b |
protein phosphatase 1B, magnesium dependent, beta isoform |
13874 |
0.16 |
chr11_95805551_95805773 | 4.37 |
Phospho1 |
phosphatase, orphan 1 |
18837 |
0.1 |
chr5_17829215_17829531 | 4.33 |
Cd36 |
CD36 molecule |
6323 |
0.32 |
chr1_37436488_37436756 | 4.31 |
Unc50 |
unc-50 homolog |
5278 |
0.16 |
chr3_36918411_36918688 | 4.31 |
4932438A13Rik |
RIKEN cDNA 4932438A13 gene |
10401 |
0.23 |
chr4_156255357_156255711 | 4.24 |
Samd11 |
sterile alpha motif domain containing 11 |
123 |
0.9 |
chr19_24535123_24535505 | 4.24 |
Pip5k1b |
phosphatidylinositol-4-phosphate 5-kinase, type 1 beta |
20475 |
0.18 |
chr19_5266994_5267269 | 4.22 |
Pacs1 |
phosphofurin acidic cluster sorting protein 1 |
5576 |
0.09 |
chr12_24706010_24706213 | 4.21 |
Rrm2 |
ribonucleotide reductase M2 |
2130 |
0.24 |
chr12_83073669_83073943 | 4.19 |
Gm29530 |
predicted gene 29530 |
25068 |
0.16 |
chr15_102149650_102149914 | 4.19 |
Soat2 |
sterol O-acyltransferase 2 |
744 |
0.48 |
chr6_39423688_39423950 | 4.17 |
Gm25402 |
predicted gene, 25402 |
1400 |
0.3 |
chrX_100626534_100626699 | 4.17 |
Pdzd11 |
PDZ domain containing 11 |
48 |
0.93 |
chr7_16781038_16782438 | 4.14 |
Slc1a5 |
solute carrier family 1 (neutral amino acid transporter), member 5 |
370 |
0.78 |
chr1_171203965_171204116 | 4.12 |
Pcp4l1 |
Purkinje cell protein 4-like 1 |
7772 |
0.08 |
chr16_32611664_32611815 | 4.12 |
Tfrc |
transferrin receptor |
2489 |
0.22 |
chr19_32476101_32476290 | 4.11 |
Minpp1 |
multiple inositol polyphosphate histidine phosphatase 1 |
9574 |
0.14 |
chr5_96162084_96163134 | 4.10 |
Cnot6l |
CCR4-NOT transcription complex, subunit 6-like |
619 |
0.75 |
chr5_124052764_124052929 | 4.09 |
Gm43661 |
predicted gene 43661 |
494 |
0.66 |
chrX_101288529_101288688 | 4.08 |
Med12 |
mediator complex subunit 12 |
2584 |
0.14 |
chr1_72255145_72255783 | 4.05 |
Gm25939 |
predicted gene, 25939 |
456 |
0.72 |
chr8_119432614_119432809 | 4.04 |
Osgin1 |
oxidative stress induced growth inhibitor 1 |
1413 |
0.35 |
chr11_30648868_30649937 | 4.04 |
Acyp2 |
acylphosphatase 2, muscle type |
185 |
0.95 |
chr1_161893383_161893559 | 4.04 |
Gm31925 |
predicted gene, 31925 |
1324 |
0.39 |
chr6_38346223_38346374 | 4.01 |
Zc3hav1 |
zinc finger CCCH type, antiviral 1 |
7975 |
0.13 |
chr7_27449324_27449509 | 4.01 |
Blvrb |
biliverdin reductase B (flavin reductase (NADPH)) |
1355 |
0.23 |
chr11_82848029_82848189 | 4.00 |
Rffl |
ring finger and FYVE like domain containing protein |
2017 |
0.21 |
chr13_57577621_57577808 | 3.97 |
Gm48176 |
predicted gene, 48176 |
301036 |
0.01 |
chr5_90474304_90474483 | 3.95 |
Alb |
albumin |
11693 |
0.14 |
chr5_88724244_88724444 | 3.88 |
Mob1b |
MOB kinase activator 1B |
3367 |
0.19 |
chr16_32633733_32633955 | 3.87 |
Tfrc |
transferrin receptor |
9402 |
0.14 |
chr12_80817920_80818091 | 3.85 |
Susd6 |
sushi domain containing 6 |
27446 |
0.12 |
chr11_95012640_95012829 | 3.85 |
Samd14 |
sterile alpha motif domain containing 14 |
2453 |
0.17 |
chr13_92847494_92847645 | 3.85 |
Mtx3 |
metaxin 3 |
2371 |
0.33 |
chr10_75500399_75500620 | 3.84 |
Gm48148 |
predicted gene, 48148 |
4448 |
0.13 |
chr2_166703790_166704107 | 3.83 |
Prex1 |
phosphatidylinositol-3,4,5-trisphosphate-dependent Rac exchange factor 1 |
354 |
0.89 |
chr5_52998429_52998637 | 3.82 |
5033403H07Rik |
RIKEN cDNA 5033403H07 gene |
4097 |
0.18 |
chr1_84851830_84852040 | 3.79 |
Trip12 |
thyroid hormone receptor interactor 12 |
11419 |
0.14 |
chr1_130822276_130822511 | 3.78 |
Gm15848 |
predicted gene 15848 |
1689 |
0.24 |
chr3_146405802_146406427 | 3.76 |
Ssx2ip |
synovial sarcoma, X 2 interacting protein |
1136 |
0.38 |
chr2_122138576_122138727 | 3.71 |
B2m |
beta-2 microglobulin |
9035 |
0.12 |
chr9_15289254_15289422 | 3.70 |
4931406C07Rik |
RIKEN cDNA 4931406C07 gene |
230 |
0.77 |
chr6_134984526_134984686 | 3.69 |
Apold1 |
apolipoprotein L domain containing 1 |
2888 |
0.19 |
chr17_48418119_48418309 | 3.69 |
Gm49893 |
predicted gene, 49893 |
934 |
0.42 |
chr4_93584439_93584596 | 3.68 |
Gm12640 |
predicted gene 12640 |
14669 |
0.19 |
chr4_117312463_117312679 | 3.68 |
Rnf220 |
ring finger protein 220 |
12543 |
0.13 |
chr5_36724217_36724614 | 3.67 |
Gm43701 |
predicted gene 43701 |
24203 |
0.11 |
chr2_39325222_39325466 | 3.67 |
Vmn2r-ps2 |
vomeronasal 2, receptor, pseudogene 2 |
51238 |
0.11 |
chr7_100504925_100505084 | 3.66 |
Ucp2 |
uncoupling protein 2 (mitochondrial, proton carrier) |
6658 |
0.09 |
chr12_100956514_100956691 | 3.66 |
Ccdc88c |
coiled-coil domain containing 88C |
11429 |
0.12 |
chr12_101028530_101029714 | 3.64 |
Ccdc88c |
coiled-coil domain containing 88C |
66 |
0.95 |
chr1_130745693_130745852 | 3.64 |
Gm28857 |
predicted gene 28857 |
4445 |
0.11 |
chr4_117829604_117830012 | 3.63 |
Gm12842 |
predicted gene 12842 |
4152 |
0.14 |
chr1_156987967_156988148 | 3.62 |
4930439D14Rik |
RIKEN cDNA 4930439D14 gene |
48219 |
0.1 |
chr4_53595271_53595830 | 3.62 |
Slc44a1 |
solute carrier family 44, member 1 |
555 |
0.77 |
chr15_98586245_98586397 | 3.61 |
Gm29331 |
predicted gene 29331 |
3669 |
0.1 |
chr4_49559801_49560414 | 3.60 |
Aldob |
aldolase B, fructose-bisphosphate |
10561 |
0.14 |
chr13_98810175_98810479 | 3.58 |
Fcho2 |
FCH domain only 2 |
4826 |
0.14 |
chr6_145335869_145336038 | 3.57 |
Gm15707 |
predicted gene 15707 |
19345 |
0.11 |
chr13_23744597_23744910 | 3.57 |
H3c3 |
H3 clustered histone 3 |
849 |
0.2 |
chr9_90126272_90126558 | 3.57 |
Tmem41b-ps |
transmembrane protein 41B, pseudogene |
7478 |
0.15 |
chr4_148417036_148417552 | 3.56 |
Gm23303 |
predicted gene, 23303 |
26191 |
0.12 |
chr6_90750105_90750422 | 3.56 |
Iqsec1 |
IQ motif and Sec7 domain 1 |
7287 |
0.18 |
chr11_32245173_32245524 | 3.54 |
Nprl3 |
nitrogen permease regulator-like 3 |
4830 |
0.12 |
chr16_93129969_93130276 | 3.54 |
Gm28003 |
predicted gene, 28003 |
57367 |
0.15 |
chr5_115436438_115437458 | 3.54 |
4930430O22Rik |
RIKEN cDNA 4930430O22 gene |
304 |
0.74 |
chr12_79541656_79541860 | 3.51 |
Rad51b |
RAD51 paralog B |
214405 |
0.02 |
chr3_60499024_60499178 | 3.48 |
Mbnl1 |
muscleblind like splicing factor 1 |
1834 |
0.42 |
chr12_59135982_59136133 | 3.46 |
Mia2 |
MIA SH3 domain ER export factor 2 |
52 |
0.96 |
chr15_64310876_64311084 | 3.45 |
Asap1 |
ArfGAP with SH3 domain, ankyrin repeat and PH domain1 |
709 |
0.66 |
chr10_43626024_43626183 | 3.44 |
F930017D23Rik |
RIKEN cDNA F930017D23 gene |
2356 |
0.21 |
chr13_73475366_73476070 | 3.43 |
Lpcat1 |
lysophosphatidylcholine acyltransferase 1 |
3967 |
0.26 |
chr7_63952612_63952794 | 3.41 |
Gm44627 |
predicted gene 44627 |
4025 |
0.16 |
chr3_135843566_135843717 | 3.40 |
4933401H06Rik |
RIKEN cDNA 4933401H06 gene |
3372 |
0.19 |
chr7_144731625_144731794 | 3.40 |
Ano1 |
anoctamin 1, calcium activated chloride channel |
6834 |
0.14 |
chr11_90726852_90727036 | 3.39 |
Tom1l1 |
target of myb1-like 1 (chicken) |
38578 |
0.15 |
chr3_121201659_121201813 | 3.39 |
Gm5710 |
predicted gene 5710 |
20639 |
0.13 |
chr3_14890159_14890319 | 3.38 |
Car2 |
carbonic anhydrase 2 |
3600 |
0.24 |
chr8_83405652_83405829 | 3.37 |
Clgn |
calmegin |
15862 |
0.13 |
chr1_82824949_82825124 | 3.35 |
Gm17764 |
predicted gene, 17764 |
2175 |
0.16 |
chr1_151099337_151099493 | 3.34 |
Gm19087 |
predicted gene, 19087 |
8500 |
0.13 |
chr3_14879430_14879595 | 3.33 |
Car2 |
carbonic anhydrase 2 |
6761 |
0.19 |
chr6_143067791_143067965 | 3.31 |
C2cd5 |
C2 calcium-dependent domain containing 5 |
793 |
0.63 |
chr13_107063669_107063832 | 3.30 |
Gm31452 |
predicted gene, 31452 |
55 |
0.97 |
chr2_146099017_146099372 | 3.30 |
Cfap61 |
cilia and flagella associated protein 61 |
51943 |
0.15 |
chr2_153608221_153608636 | 3.29 |
Commd7 |
COMM domain containing 7 |
24303 |
0.15 |
chr5_114558159_114558686 | 3.29 |
Gm13790 |
predicted gene 13790 |
7133 |
0.17 |
chr1_64788239_64788443 | 3.29 |
Plekhm3 |
pleckstrin homology domain containing, family M, member 3 |
48423 |
0.11 |
chr18_3333014_3333165 | 3.28 |
Gm6225 |
predicted gene 6225 |
3591 |
0.22 |
chr9_48362196_48362510 | 3.28 |
Nxpe4 |
neurexophilin and PC-esterase domain family, member 4 |
312 |
0.89 |
chr8_94354109_94354553 | 3.28 |
Slc12a3 |
solute carrier family 12, member 3 |
715 |
0.52 |
chrX_164425306_164425513 | 3.28 |
Piga |
phosphatidylinositol glycan anchor biosynthesis, class A |
101 |
0.96 |
chr16_76318540_76318889 | 3.27 |
Nrip1 |
nuclear receptor interacting protein 1 |
4944 |
0.27 |
chr17_50024937_50025116 | 3.26 |
AC133946.1 |
oxidoreductase NAD-binding domain containing 1 (OXNAD1) pseudogene |
52199 |
0.12 |
chr5_24426050_24426729 | 3.26 |
Slc4a2 |
solute carrier family 4 (anion exchanger), member 2 |
442 |
0.6 |
chr1_167378051_167378255 | 3.26 |
Aldh9a1 |
aldehyde dehydrogenase 9, subfamily A1 |
13987 |
0.13 |
chr8_25620112_25620378 | 3.25 |
Gm23184 |
predicted gene, 23184 |
9687 |
0.09 |
chr18_61220268_61220450 | 3.25 |
Pde6a |
phosphodiesterase 6A, cGMP-specific, rod, alpha |
44 |
0.97 |
chrX_144536508_144536801 | 3.24 |
Mageb16-ps1 |
melanoma antigen family B, 16, pseudogene 1 |
19683 |
0.2 |
chr10_42244465_42244794 | 3.24 |
Foxo3 |
forkhead box O3 |
13737 |
0.25 |
chr13_99019515_99019689 | 3.24 |
A930014D07Rik |
RIKEN cDNA A930014D07 gene |
12503 |
0.12 |
chr2_79265730_79265889 | 3.23 |
Itga4 |
integrin alpha 4 |
9862 |
0.23 |
chr7_25477037_25477380 | 3.22 |
Ceacam1 |
carcinoembryonic antigen-related cell adhesion molecule 1 |
326 |
0.82 |
chr4_33450422_33450671 | 3.21 |
Gm11935 |
predicted gene 11935 |
2343 |
0.32 |
chr16_8761036_8761187 | 3.21 |
Gm25805 |
predicted gene, 25805 |
5165 |
0.19 |
chr5_139381242_139381406 | 3.21 |
Gpr146 |
G protein-coupled receptor 146 |
743 |
0.52 |
chr8_122319734_122319919 | 3.20 |
Zfpm1 |
zinc finger protein, multitype 1 |
12506 |
0.12 |
chr4_46023185_46023394 | 3.18 |
Tdrd7 |
tudor domain containing 7 |
2812 |
0.27 |
chr7_4744995_4745246 | 3.18 |
Kmt5c |
lysine methyltransferase 5C |
688 |
0.43 |
chr8_117692213_117692415 | 3.18 |
Hsd17b2 |
hydroxysteroid (17-beta) dehydrogenase 2 |
9590 |
0.13 |
chr11_51430302_51430461 | 3.17 |
Col23a1 |
collagen, type XXIII, alpha 1 |
140461 |
0.03 |
chr5_90493596_90493768 | 3.17 |
Afp |
alpha fetoprotein |
2444 |
0.21 |
chr5_142650375_142650737 | 3.16 |
Wipi2 |
WD repeat domain, phosphoinositide interacting 2 |
11958 |
0.15 |
chr5_23850355_23851323 | 3.16 |
2700038G22Rik |
RIKEN cDNA 2700038G22 gene |
238 |
0.81 |
chr11_78065958_78066240 | 3.15 |
Mir144 |
microRNA 144 |
6906 |
0.08 |
chr1_136465841_136466127 | 3.15 |
Kif14 |
kinesin family member 14 |
359 |
0.84 |
chrX_74424469_74424674 | 3.15 |
Ikbkg |
inhibitor of kappaB kinase gamma |
33 |
0.95 |
chr14_34618983_34619138 | 3.15 |
Opn4 |
opsin 4 (melanopsin) |
18918 |
0.11 |
chr15_103248176_103248693 | 3.13 |
Nfe2 |
nuclear factor, erythroid derived 2 |
3031 |
0.14 |
chr2_172289400_172289557 | 3.12 |
Gm14275 |
predicted gene 14275 |
1345 |
0.39 |
chr8_60955047_60955332 | 3.12 |
Clcn3 |
chloride channel, voltage-sensitive 3 |
44 |
0.97 |
chr5_34572994_34573157 | 3.11 |
Add1 |
adducin 1 (alpha) |
589 |
0.49 |
chr17_88460375_88460645 | 3.09 |
Foxn2 |
forkhead box N2 |
19735 |
0.17 |
chr3_35924140_35924343 | 3.09 |
Dcun1d1 |
DCN1, defective in cullin neddylation 1, domain containing 1 (S. cerevisiae) |
3053 |
0.16 |
chr10_69924299_69924606 | 3.09 |
Ank3 |
ankyrin 3, epithelial |
1043 |
0.68 |
chr7_141558984_141559277 | 3.08 |
Ap2a2 |
adaptor-related protein complex 2, alpha 2 subunit |
3043 |
0.15 |
chr11_117782445_117782614 | 3.08 |
Tmc8 |
transmembrane channel-like gene family 8 |
129 |
0.72 |
chr5_65476804_65477100 | 3.08 |
Gm43290 |
predicted gene 43290 |
1109 |
0.32 |
chr4_154121558_154121709 | 3.07 |
Trp73 |
transformation related protein 73 |
5028 |
0.13 |
chr17_39845065_39845666 | 3.06 |
CT010467.1 |
18s RNA, related sequence 5 |
988 |
0.52 |
chr6_88076158_88076310 | 3.06 |
Rpn1 |
ribophorin I |
8248 |
0.13 |
chr11_31844416_31844567 | 3.05 |
Gm12107 |
predicted gene 12107 |
11831 |
0.18 |
chr2_163643706_163643927 | 3.05 |
0610039K10Rik |
RIKEN cDNA 0610039K10 gene |
1034 |
0.35 |
chr11_4217876_4218712 | 3.05 |
Castor1 |
cytosolic arginine sensor for mTORC1 subunit 1 |
69 |
0.94 |
chr5_107230243_107230508 | 3.05 |
Gm8145 |
predicted gene 8145 |
11248 |
0.15 |
chr3_96458985_96459162 | 3.05 |
Gm10685 |
predicted gene 10685 |
864 |
0.24 |
chr9_90269671_90269957 | 3.04 |
Tbc1d2b |
TBC1 domain family, member 2B |
955 |
0.54 |
chr18_68199215_68199539 | 3.02 |
Ldlrad4 |
low density lipoprotein receptor class A domain containing 4 |
28690 |
0.15 |
chr13_40909081_40909376 | 3.02 |
Gm48188 |
predicted gene, 48188 |
2979 |
0.15 |
chr7_131371983_131372134 | 3.02 |
Pstk |
phosphoseryl-tRNA kinase |
891 |
0.38 |
chr5_50015248_50015427 | 3.01 |
Adgra3 |
adhesion G protein-coupled receptor A3 |
5833 |
0.25 |
chr2_155091578_155091729 | 3.00 |
Gm45609 |
predicted gene 45609 |
4091 |
0.16 |
chr17_84926246_84926536 | 3.00 |
Gm49982 |
predicted gene, 49982 |
23822 |
0.14 |
chr11_44509325_44509652 | 3.00 |
Rnf145 |
ring finger protein 145 |
9476 |
0.16 |
chr13_24552125_24552287 | 3.00 |
Ripor2 |
RHO family interacting cell polarization regulator 2 |
29983 |
0.15 |
chr19_4569314_4569621 | 3.00 |
Pcx |
pyruvate carboxylase |
10657 |
0.13 |
chr5_134921609_134921968 | 2.99 |
Gm50473 |
predicted gene, 50473 |
1436 |
0.19 |
chr11_88068171_88069196 | 2.99 |
Vezf1 |
vascular endothelial zinc finger 1 |
404 |
0.76 |
chr11_80086905_80087159 | 2.98 |
Atad5 |
ATPase family, AAA domain containing 5 |
2368 |
0.24 |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
1.5 | 4.5 | GO:0001543 | ovarian follicle rupture(GO:0001543) |
1.4 | 4.2 | GO:0048388 | endosomal lumen acidification(GO:0048388) |
1.4 | 4.1 | GO:0060375 | regulation of mast cell differentiation(GO:0060375) |
1.2 | 3.6 | GO:1900825 | regulation of membrane depolarization during cardiac muscle cell action potential(GO:1900825) |
1.1 | 3.3 | GO:0032910 | transforming growth factor beta3 production(GO:0032907) regulation of transforming growth factor beta3 production(GO:0032910) |
1.1 | 3.2 | GO:2000646 | positive regulation of receptor catabolic process(GO:2000646) |
1.0 | 4.1 | GO:1903361 | protein localization to basolateral plasma membrane(GO:1903361) |
1.0 | 7.9 | GO:0032782 | bile acid secretion(GO:0032782) |
1.0 | 3.9 | GO:0006083 | acetate metabolic process(GO:0006083) |
1.0 | 1.9 | GO:1902988 | neurofibrillary tangle assembly(GO:1902988) regulation of neurofibrillary tangle assembly(GO:1902996) |
0.9 | 4.7 | GO:0010606 | positive regulation of cytoplasmic mRNA processing body assembly(GO:0010606) |
0.9 | 3.7 | GO:0070837 | dehydroascorbic acid transport(GO:0070837) |
0.9 | 2.6 | GO:0038028 | insulin receptor signaling pathway via phosphatidylinositol 3-kinase(GO:0038028) |
0.8 | 2.5 | GO:0003221 | right ventricular cardiac muscle tissue morphogenesis(GO:0003221) |
0.8 | 2.5 | GO:0036066 | protein O-linked fucosylation(GO:0036066) |
0.8 | 1.6 | GO:0014873 | response to muscle activity involved in regulation of muscle adaptation(GO:0014873) |
0.8 | 2.4 | GO:1903061 | positive regulation of protein lipidation(GO:1903061) |
0.8 | 2.4 | GO:0061624 | fructose catabolic process(GO:0006001) fructose catabolic process to hydroxyacetone phosphate and glyceraldehyde-3-phosphate(GO:0061624) glycolytic process through fructose-1-phosphate(GO:0061625) |
0.7 | 3.7 | GO:0019695 | choline metabolic process(GO:0019695) |
0.7 | 2.9 | GO:1903142 | positive regulation of endothelial cell development(GO:1901552) positive regulation of establishment of endothelial barrier(GO:1903142) |
0.7 | 2.1 | GO:0034197 | acylglycerol transport(GO:0034196) triglyceride transport(GO:0034197) |
0.7 | 3.3 | GO:0070934 | CRD-mediated mRNA stabilization(GO:0070934) |
0.7 | 4.6 | GO:0015825 | L-serine transport(GO:0015825) |
0.6 | 1.9 | GO:0030950 | establishment or maintenance of actin cytoskeleton polarity(GO:0030950) |
0.6 | 1.3 | GO:0033119 | negative regulation of RNA splicing(GO:0033119) |
0.6 | 1.9 | GO:0035526 | retrograde transport, plasma membrane to Golgi(GO:0035526) |
0.6 | 3.1 | GO:0051596 | methylglyoxal catabolic process to D-lactate via S-lactoyl-glutathione(GO:0019243) methylglyoxal catabolic process(GO:0051596) methylglyoxal catabolic process to lactate(GO:0061727) |
0.6 | 2.4 | GO:0021698 | cerebellar cortex structural organization(GO:0021698) |
0.6 | 1.8 | GO:0006068 | ethanol catabolic process(GO:0006068) |
0.6 | 2.4 | GO:0010040 | response to iron(II) ion(GO:0010040) |
0.6 | 1.8 | GO:1902915 | negative regulation of protein K63-linked ubiquitination(GO:1900045) negative regulation of protein polyubiquitination(GO:1902915) |
0.6 | 3.0 | GO:1900454 | positive regulation of long term synaptic depression(GO:1900454) |
0.6 | 4.1 | GO:0045359 | positive regulation of interferon-beta biosynthetic process(GO:0045359) |
0.6 | 2.4 | GO:0006742 | NADP catabolic process(GO:0006742) |
0.6 | 3.5 | GO:0015871 | choline transport(GO:0015871) |
0.6 | 1.2 | GO:0010912 | regulation of isomerase activity(GO:0010911) positive regulation of isomerase activity(GO:0010912) |
0.6 | 2.3 | GO:1990414 | replication-born double-strand break repair via sister chromatid exchange(GO:1990414) |
0.6 | 1.1 | GO:1990705 | cholangiocyte proliferation(GO:1990705) |
0.6 | 2.8 | GO:1903689 | regulation of wound healing, spreading of epidermal cells(GO:1903689) |
0.5 | 3.3 | GO:0086073 | bundle of His cell-Purkinje myocyte adhesion involved in cell communication(GO:0086073) |
0.5 | 2.2 | GO:0019346 | homoserine metabolic process(GO:0009092) transsulfuration(GO:0019346) |
0.5 | 1.6 | GO:0046061 | dATP catabolic process(GO:0046061) |
0.5 | 1.6 | GO:0035973 | aggrephagy(GO:0035973) |
0.5 | 1.6 | GO:0009223 | pyrimidine deoxyribonucleotide catabolic process(GO:0009223) |
0.5 | 1.6 | GO:0042938 | dipeptide transport(GO:0042938) |
0.5 | 0.5 | GO:0090232 | positive regulation of spindle checkpoint(GO:0090232) |
0.5 | 2.6 | GO:2001187 | positive regulation of CD8-positive, alpha-beta T cell activation(GO:2001187) |
0.5 | 2.5 | GO:0014744 | positive regulation of muscle adaptation(GO:0014744) |
0.5 | 2.0 | GO:0052055 | modulation by symbiont of host molecular function(GO:0052055) |
0.5 | 1.5 | GO:0045053 | protein retention in Golgi apparatus(GO:0045053) |
0.5 | 1.5 | GO:0008050 | female courtship behavior(GO:0008050) |
0.5 | 1.5 | GO:2001245 | regulation of phosphatidylcholine biosynthetic process(GO:2001245) |
0.5 | 1.0 | GO:0090202 | transcriptional activation by promoter-enhancer looping(GO:0071733) gene looping(GO:0090202) dsDNA loop formation(GO:0090579) |
0.5 | 2.4 | GO:0090435 | protein localization to nuclear envelope(GO:0090435) |
0.5 | 1.0 | GO:0019448 | cysteine catabolic process(GO:0009093) L-cysteine catabolic process(GO:0019448) L-cysteine metabolic process(GO:0046439) |
0.5 | 0.5 | GO:0034140 | negative regulation of toll-like receptor 3 signaling pathway(GO:0034140) |
0.5 | 1.4 | GO:0071336 | regulation of hair follicle cell proliferation(GO:0071336) |
0.5 | 1.4 | GO:1990169 | detoxification of copper ion(GO:0010273) stress response to copper ion(GO:1990169) |
0.5 | 1.4 | GO:0000389 | mRNA 3'-splice site recognition(GO:0000389) |
0.5 | 1.4 | GO:0061010 | gall bladder development(GO:0061010) |
0.5 | 1.8 | GO:0050713 | negative regulation of interleukin-1 beta secretion(GO:0050713) |
0.5 | 3.2 | GO:0009186 | deoxyribonucleoside diphosphate metabolic process(GO:0009186) |
0.5 | 4.6 | GO:0060213 | regulation of nuclear-transcribed mRNA poly(A) tail shortening(GO:0060211) positive regulation of nuclear-transcribed mRNA poly(A) tail shortening(GO:0060213) |
0.5 | 1.4 | GO:0051025 | negative regulation of immunoglobulin secretion(GO:0051025) |
0.5 | 1.8 | GO:0019532 | oxalate transport(GO:0019532) |
0.4 | 3.6 | GO:0046037 | GMP metabolic process(GO:0046037) |
0.4 | 2.7 | GO:0045653 | negative regulation of megakaryocyte differentiation(GO:0045653) |
0.4 | 3.6 | GO:0070493 | thrombin receptor signaling pathway(GO:0070493) |
0.4 | 1.8 | GO:0046726 | positive regulation by virus of viral protein levels in host cell(GO:0046726) |
0.4 | 2.7 | GO:0061620 | glycolytic process through glucose-6-phosphate(GO:0061620) |
0.4 | 1.8 | GO:0038108 | negative regulation of appetite by leptin-mediated signaling pathway(GO:0038108) |
0.4 | 1.8 | GO:0006432 | phenylalanyl-tRNA aminoacylation(GO:0006432) |
0.4 | 2.2 | GO:0042270 | protection from natural killer cell mediated cytotoxicity(GO:0042270) |
0.4 | 1.3 | GO:0001306 | age-dependent response to oxidative stress(GO:0001306) age-dependent general metabolic decline(GO:0007571) |
0.4 | 1.3 | GO:1903336 | negative regulation of vacuolar transport(GO:1903336) |
0.4 | 1.3 | GO:0090245 | axis elongation involved in somitogenesis(GO:0090245) |
0.4 | 0.4 | GO:2000586 | regulation of platelet-derived growth factor receptor-beta signaling pathway(GO:2000586) negative regulation of platelet-derived growth factor receptor-beta signaling pathway(GO:2000587) |
0.4 | 2.1 | GO:0043987 | histone H3-S10 phosphorylation(GO:0043987) |
0.4 | 1.7 | GO:0048254 | snoRNA localization(GO:0048254) |
0.4 | 1.2 | GO:0035771 | interleukin-4-mediated signaling pathway(GO:0035771) |
0.4 | 0.8 | GO:0061091 | regulation of phospholipid translocation(GO:0061091) positive regulation of phospholipid translocation(GO:0061092) |
0.4 | 2.1 | GO:0070627 | ferrous iron import(GO:0070627) |
0.4 | 1.6 | GO:0045039 | protein import into mitochondrial inner membrane(GO:0045039) |
0.4 | 3.2 | GO:0060352 | cell adhesion molecule production(GO:0060352) |
0.4 | 0.8 | GO:0050904 | diapedesis(GO:0050904) |
0.4 | 2.0 | GO:0051342 | regulation of cyclic-nucleotide phosphodiesterase activity(GO:0051342) |
0.4 | 1.2 | GO:0090365 | regulation of mRNA modification(GO:0090365) |
0.4 | 2.3 | GO:0034242 | negative regulation of syncytium formation by plasma membrane fusion(GO:0034242) |
0.4 | 4.2 | GO:0009437 | carnitine metabolic process(GO:0009437) |
0.4 | 1.5 | GO:1905206 | positive regulation of hydrogen peroxide-mediated programmed cell death(GO:1901300) positive regulation of hydrogen peroxide-induced cell death(GO:1905206) |
0.4 | 1.5 | GO:0038026 | reelin-mediated signaling pathway(GO:0038026) |
0.4 | 1.5 | GO:0006499 | N-terminal protein myristoylation(GO:0006499) |
0.4 | 0.4 | GO:0043622 | cortical microtubule organization(GO:0043622) |
0.4 | 1.1 | GO:2000304 | positive regulation of sphingolipid biosynthetic process(GO:0090154) positive regulation of ceramide biosynthetic process(GO:2000304) |
0.4 | 0.7 | GO:0090271 | positive regulation of fibroblast growth factor production(GO:0090271) |
0.4 | 1.1 | GO:0021699 | cerebellar cortex maturation(GO:0021699) |
0.4 | 0.7 | GO:0097212 | lysosomal membrane organization(GO:0097212) |
0.4 | 2.5 | GO:0031659 | positive regulation of cyclin-dependent protein serine/threonine kinase activity involved in G1/S transition of mitotic cell cycle(GO:0031659) |
0.4 | 8.3 | GO:0006779 | porphyrin-containing compound biosynthetic process(GO:0006779) tetrapyrrole biosynthetic process(GO:0033014) |
0.4 | 0.4 | GO:0060336 | negative regulation of response to interferon-gamma(GO:0060331) negative regulation of interferon-gamma-mediated signaling pathway(GO:0060336) |
0.4 | 1.1 | GO:0042167 | heme catabolic process(GO:0042167) pigment catabolic process(GO:0046149) |
0.4 | 1.1 | GO:0097503 | sialylation(GO:0097503) |
0.4 | 1.4 | GO:0046125 | pyrimidine deoxyribonucleoside metabolic process(GO:0046125) |
0.4 | 1.8 | GO:0015670 | carbon dioxide transport(GO:0015670) |
0.4 | 1.1 | GO:0000087 | mitotic M phase(GO:0000087) |
0.4 | 2.1 | GO:0071569 | protein ufmylation(GO:0071569) |
0.3 | 0.3 | GO:0031657 | regulation of cyclin-dependent protein serine/threonine kinase activity involved in G1/S transition of mitotic cell cycle(GO:0031657) |
0.3 | 0.3 | GO:0006577 | amino-acid betaine metabolic process(GO:0006577) |
0.3 | 0.7 | GO:0023021 | termination of signal transduction(GO:0023021) |
0.3 | 2.1 | GO:0034379 | very-low-density lipoprotein particle assembly(GO:0034379) |
0.3 | 0.3 | GO:0061687 | detoxification of inorganic compound(GO:0061687) |
0.3 | 1.4 | GO:0097039 | protein linear polyubiquitination(GO:0097039) |
0.3 | 3.0 | GO:0018206 | peptidyl-methionine modification(GO:0018206) |
0.3 | 0.7 | GO:0002432 | granuloma formation(GO:0002432) |
0.3 | 1.3 | GO:0015886 | heme transport(GO:0015886) |
0.3 | 2.0 | GO:0001514 | selenocysteine incorporation(GO:0001514) translational readthrough(GO:0006451) |
0.3 | 1.0 | GO:0019530 | taurine metabolic process(GO:0019530) |
0.3 | 1.7 | GO:0006686 | sphingomyelin biosynthetic process(GO:0006686) |
0.3 | 2.6 | GO:0032460 | negative regulation of protein oligomerization(GO:0032460) |
0.3 | 1.6 | GO:2000766 | negative regulation of cytoplasmic translation(GO:2000766) |
0.3 | 1.6 | GO:0036462 | TRAIL-activated apoptotic signaling pathway(GO:0036462) |
0.3 | 1.6 | GO:0006000 | fructose metabolic process(GO:0006000) |
0.3 | 2.6 | GO:0008343 | adult feeding behavior(GO:0008343) |
0.3 | 1.0 | GO:0046271 | phenylpropanoid catabolic process(GO:0046271) |
0.3 | 3.9 | GO:0015727 | lactate transport(GO:0015727) lactate transmembrane transport(GO:0035873) plasma membrane lactate transport(GO:0035879) |
0.3 | 6.1 | GO:0000132 | establishment of mitotic spindle orientation(GO:0000132) |
0.3 | 1.6 | GO:1902916 | positive regulation of protein polyubiquitination(GO:1902916) |
0.3 | 1.0 | GO:0030242 | pexophagy(GO:0030242) |
0.3 | 1.3 | GO:0016479 | negative regulation of transcription from RNA polymerase I promoter(GO:0016479) |
0.3 | 1.3 | GO:0034653 | diterpenoid catabolic process(GO:0016103) retinoic acid catabolic process(GO:0034653) |
0.3 | 1.9 | GO:0007042 | lysosomal lumen acidification(GO:0007042) |
0.3 | 1.3 | GO:0035522 | monoubiquitinated histone deubiquitination(GO:0035521) monoubiquitinated histone H2A deubiquitination(GO:0035522) |
0.3 | 0.6 | GO:0035622 | intrahepatic bile duct development(GO:0035622) |
0.3 | 1.2 | GO:0042364 | water-soluble vitamin biosynthetic process(GO:0042364) |
0.3 | 4.6 | GO:0046685 | response to arsenic-containing substance(GO:0046685) |
0.3 | 2.2 | GO:0097067 | cellular response to thyroid hormone stimulus(GO:0097067) |
0.3 | 0.3 | GO:0045914 | negative regulation of catecholamine metabolic process(GO:0045914) negative regulation of dopamine metabolic process(GO:0045963) |
0.3 | 0.9 | GO:0070889 | platelet alpha granule organization(GO:0070889) |
0.3 | 3.9 | GO:0030213 | hyaluronan biosynthetic process(GO:0030213) |
0.3 | 1.2 | GO:0071281 | cellular response to iron ion(GO:0071281) |
0.3 | 2.7 | GO:0033617 | mitochondrial respiratory chain complex IV assembly(GO:0033617) mitochondrial respiratory chain complex IV biogenesis(GO:0097034) |
0.3 | 2.1 | GO:2000675 | negative regulation of type B pancreatic cell apoptotic process(GO:2000675) |
0.3 | 1.8 | GO:1902035 | positive regulation of hematopoietic stem cell proliferation(GO:1902035) |
0.3 | 2.7 | GO:0006670 | sphingosine metabolic process(GO:0006670) |
0.3 | 0.9 | GO:0002835 | negative regulation of response to tumor cell(GO:0002835) negative regulation of immune response to tumor cell(GO:0002838) |
0.3 | 1.8 | GO:0061087 | positive regulation of histone H3-K27 methylation(GO:0061087) |
0.3 | 0.9 | GO:2000346 | negative regulation of hepatocyte proliferation(GO:2000346) |
0.3 | 0.9 | GO:0007084 | mitotic nuclear envelope reassembly(GO:0007084) |
0.3 | 0.9 | GO:1903232 | melanosome assembly(GO:1903232) |
0.3 | 0.9 | GO:0007208 | phospholipase C-activating serotonin receptor signaling pathway(GO:0007208) |
0.3 | 0.9 | GO:0031627 | telomeric loop formation(GO:0031627) |
0.3 | 1.7 | GO:0000447 | endonucleolytic cleavage in ITS1 to separate SSU-rRNA from 5.8S rRNA and LSU-rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000447) |
0.3 | 2.9 | GO:0043922 | negative regulation by host of viral transcription(GO:0043922) |
0.3 | 1.7 | GO:0006104 | succinyl-CoA metabolic process(GO:0006104) |
0.3 | 0.9 | GO:0006362 | transcription elongation from RNA polymerase I promoter(GO:0006362) |
0.3 | 0.6 | GO:0046340 | diacylglycerol catabolic process(GO:0046340) |
0.3 | 0.6 | GO:0072361 | regulation of glycolytic process by regulation of transcription from RNA polymerase II promoter(GO:0072361) |
0.3 | 0.8 | GO:2001271 | negative regulation of cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:2001271) |
0.3 | 1.1 | GO:0060689 | cell differentiation involved in salivary gland development(GO:0060689) |
0.3 | 2.0 | GO:0090266 | regulation of mitotic cell cycle spindle assembly checkpoint(GO:0090266) regulation of mitotic spindle checkpoint(GO:1903504) |
0.3 | 1.1 | GO:0060298 | positive regulation of sarcomere organization(GO:0060298) |
0.3 | 0.8 | GO:0015772 | disaccharide transport(GO:0015766) sucrose transport(GO:0015770) oligosaccharide transport(GO:0015772) |
0.3 | 2.0 | GO:2000051 | negative regulation of non-canonical Wnt signaling pathway(GO:2000051) |
0.3 | 1.1 | GO:0061484 | hematopoietic stem cell homeostasis(GO:0061484) |
0.3 | 0.6 | GO:0032286 | central nervous system myelin maintenance(GO:0032286) |
0.3 | 0.6 | GO:1903898 | negative regulation of PERK-mediated unfolded protein response(GO:1903898) |
0.3 | 2.7 | GO:0048541 | mucosal-associated lymphoid tissue development(GO:0048537) Peyer's patch development(GO:0048541) |
0.3 | 0.5 | GO:0036091 | positive regulation of transcription from RNA polymerase II promoter in response to oxidative stress(GO:0036091) |
0.3 | 0.8 | GO:0031860 | telomeric 3' overhang formation(GO:0031860) |
0.3 | 0.5 | GO:0032077 | positive regulation of deoxyribonuclease activity(GO:0032077) |
0.3 | 0.8 | GO:0002439 | chronic inflammatory response to antigenic stimulus(GO:0002439) |
0.3 | 1.9 | GO:1990001 | inhibition of cysteine-type endopeptidase activity(GO:0097340) zymogen inhibition(GO:0097341) inhibition of cysteine-type endopeptidase activity involved in apoptotic process(GO:1990001) |
0.3 | 2.4 | GO:0030277 | maintenance of gastrointestinal epithelium(GO:0030277) |
0.3 | 3.5 | GO:0031954 | positive regulation of protein autophosphorylation(GO:0031954) |
0.3 | 0.3 | GO:0019344 | cysteine biosynthetic process(GO:0019344) |
0.3 | 0.5 | GO:0035740 | CD8-positive, alpha-beta T cell proliferation(GO:0035740) |
0.3 | 0.8 | GO:0002254 | kinin cascade(GO:0002254) |
0.3 | 1.1 | GO:0000707 | meiotic DNA recombinase assembly(GO:0000707) |
0.3 | 1.1 | GO:0035630 | bone mineralization involved in bone maturation(GO:0035630) |
0.3 | 1.1 | GO:0038165 | oncostatin-M-mediated signaling pathway(GO:0038165) |
0.3 | 0.5 | GO:0018992 | germ-line sex determination(GO:0018992) |
0.3 | 1.3 | GO:0046874 | quinolinate metabolic process(GO:0046874) |
0.3 | 2.9 | GO:1902236 | negative regulation of endoplasmic reticulum stress-induced intrinsic apoptotic signaling pathway(GO:1902236) |
0.3 | 0.8 | GO:0071596 | ubiquitin-dependent protein catabolic process via the N-end rule pathway(GO:0071596) |
0.3 | 0.5 | GO:0046121 | deoxyribonucleoside catabolic process(GO:0046121) |
0.3 | 1.0 | GO:0070475 | rRNA base methylation(GO:0070475) |
0.3 | 2.1 | GO:0007175 | negative regulation of epidermal growth factor-activated receptor activity(GO:0007175) |
0.3 | 1.0 | GO:0044539 | long-chain fatty acid import(GO:0044539) |
0.3 | 2.9 | GO:0060576 | intestinal epithelial cell development(GO:0060576) |
0.3 | 2.9 | GO:0046697 | decidualization(GO:0046697) |
0.3 | 0.5 | GO:0009158 | ribonucleoside monophosphate catabolic process(GO:0009158) purine ribonucleoside monophosphate catabolic process(GO:0009169) |
0.3 | 0.3 | GO:0045647 | negative regulation of erythrocyte differentiation(GO:0045647) |
0.3 | 0.3 | GO:2000138 | positive regulation of cell proliferation involved in heart morphogenesis(GO:2000138) |
0.3 | 1.3 | GO:0043173 | nucleotide salvage(GO:0043173) |
0.3 | 2.1 | GO:0010713 | negative regulation of collagen metabolic process(GO:0010713) negative regulation of collagen biosynthetic process(GO:0032966) |
0.3 | 0.8 | GO:0018125 | peptidyl-cysteine methylation(GO:0018125) |
0.3 | 1.0 | GO:0009957 | epidermal cell fate specification(GO:0009957) |
0.3 | 0.8 | GO:0071073 | positive regulation of phospholipid biosynthetic process(GO:0071073) |
0.3 | 0.5 | GO:0030997 | regulation of centriole-centriole cohesion(GO:0030997) |
0.3 | 4.1 | GO:0001574 | ganglioside biosynthetic process(GO:0001574) |
0.3 | 3.6 | GO:0032012 | ARF protein signal transduction(GO:0032011) regulation of ARF protein signal transduction(GO:0032012) |
0.3 | 0.5 | GO:0019230 | proprioception(GO:0019230) |
0.3 | 1.8 | GO:0034377 | plasma lipoprotein particle assembly(GO:0034377) |
0.3 | 2.5 | GO:0043249 | erythrocyte maturation(GO:0043249) |
0.3 | 1.5 | GO:0001672 | regulation of chromatin assembly or disassembly(GO:0001672) |
0.3 | 2.8 | GO:0020027 | hemoglobin metabolic process(GO:0020027) |
0.3 | 0.5 | GO:0019626 | short-chain fatty acid catabolic process(GO:0019626) |
0.2 | 2.0 | GO:0030953 | astral microtubule organization(GO:0030953) |
0.2 | 1.7 | GO:0035735 | intraciliary transport involved in cilium morphogenesis(GO:0035735) |
0.2 | 1.7 | GO:0031145 | anaphase-promoting complex-dependent catabolic process(GO:0031145) |
0.2 | 0.5 | GO:0002159 | desmosome assembly(GO:0002159) |
0.2 | 0.7 | GO:1903715 | regulation of aerobic respiration(GO:1903715) |
0.2 | 0.7 | GO:0035087 | targeting of mRNA for destruction involved in RNA interference(GO:0030423) siRNA loading onto RISC involved in RNA interference(GO:0035087) |
0.2 | 0.5 | GO:0014057 | positive regulation of acetylcholine secretion, neurotransmission(GO:0014057) |
0.2 | 1.0 | GO:0034035 | purine ribonucleoside bisphosphate metabolic process(GO:0034035) |
0.2 | 1.0 | GO:0090168 | Golgi reassembly(GO:0090168) |
0.2 | 3.4 | GO:0046461 | neutral lipid catabolic process(GO:0046461) acylglycerol catabolic process(GO:0046464) |
0.2 | 1.0 | GO:0010727 | negative regulation of hydrogen peroxide metabolic process(GO:0010727) |
0.2 | 4.6 | GO:0006298 | mismatch repair(GO:0006298) |
0.2 | 0.7 | GO:1900095 | regulation of dosage compensation by inactivation of X chromosome(GO:1900095) |
0.2 | 6.5 | GO:0070328 | acylglycerol homeostasis(GO:0055090) triglyceride homeostasis(GO:0070328) |
0.2 | 0.7 | GO:0090038 | negative regulation of protein kinase C signaling(GO:0090038) |
0.2 | 0.7 | GO:0042732 | D-xylose metabolic process(GO:0042732) |
0.2 | 1.0 | GO:0090209 | negative regulation of triglyceride metabolic process(GO:0090209) |
0.2 | 0.7 | GO:0044004 | killing by symbiont of host cells(GO:0001907) disruption by symbiont of host cell(GO:0044004) |
0.2 | 3.8 | GO:0071108 | protein K48-linked deubiquitination(GO:0071108) |
0.2 | 0.2 | GO:0006678 | glucosylceramide metabolic process(GO:0006678) |
0.2 | 0.2 | GO:0046514 | ceramide catabolic process(GO:0046514) |
0.2 | 0.9 | GO:0032049 | phosphatidylglycerol biosynthetic process(GO:0006655) cardiolipin biosynthetic process(GO:0032049) |
0.2 | 0.5 | GO:0070350 | white fat cell proliferation(GO:0070343) regulation of white fat cell proliferation(GO:0070350) |
0.2 | 0.2 | GO:1901674 | histone H3-K27 acetylation(GO:0043974) regulation of histone H3-K27 acetylation(GO:1901674) |
0.2 | 0.7 | GO:0031118 | rRNA pseudouridine synthesis(GO:0031118) |
0.2 | 1.4 | GO:0070327 | thyroid hormone transport(GO:0070327) |
0.2 | 1.1 | GO:0072378 | blood coagulation, fibrin clot formation(GO:0072378) |
0.2 | 0.5 | GO:0035434 | copper ion transmembrane transport(GO:0035434) |
0.2 | 1.4 | GO:0000185 | activation of MAPKKK activity(GO:0000185) |
0.2 | 0.4 | GO:0061052 | negative regulation of cell growth involved in cardiac muscle cell development(GO:0061052) |
0.2 | 0.4 | GO:0002386 | immune response in mucosal-associated lymphoid tissue(GO:0002386) |
0.2 | 0.7 | GO:0015803 | branched-chain amino acid transport(GO:0015803) leucine transport(GO:0015820) |
0.2 | 0.7 | GO:0008582 | regulation of synaptic growth at neuromuscular junction(GO:0008582) |
0.2 | 0.7 | GO:0046341 | CDP-diacylglycerol metabolic process(GO:0046341) |
0.2 | 0.4 | GO:0070858 | negative regulation of bile acid biosynthetic process(GO:0070858) negative regulation of bile acid metabolic process(GO:1904252) |
0.2 | 0.7 | GO:1904526 | regulation of microtubule binding(GO:1904526) positive regulation of microtubule binding(GO:1904528) |
0.2 | 2.9 | GO:0002862 | negative regulation of inflammatory response to antigenic stimulus(GO:0002862) |
0.2 | 2.2 | GO:0009404 | toxin metabolic process(GO:0009404) |
0.2 | 0.4 | GO:0007525 | somatic muscle development(GO:0007525) |
0.2 | 6.4 | GO:0031648 | protein destabilization(GO:0031648) |
0.2 | 2.9 | GO:2001241 | positive regulation of extrinsic apoptotic signaling pathway in absence of ligand(GO:2001241) |
0.2 | 0.9 | GO:0002034 | regulation of blood vessel size by renin-angiotensin(GO:0002034) renal control of peripheral vascular resistance involved in regulation of systemic arterial blood pressure(GO:0003072) |
0.2 | 1.3 | GO:1900042 | positive regulation of interleukin-2 secretion(GO:1900042) |
0.2 | 0.9 | GO:0019087 | transformation of host cell by virus(GO:0019087) |
0.2 | 0.4 | GO:0070317 | negative regulation of G0 to G1 transition(GO:0070317) |
0.2 | 1.9 | GO:0032494 | response to peptidoglycan(GO:0032494) |
0.2 | 1.1 | GO:0045351 | type I interferon biosynthetic process(GO:0045351) |
0.2 | 1.1 | GO:0006646 | phosphatidylethanolamine biosynthetic process(GO:0006646) |
0.2 | 2.3 | GO:0090140 | regulation of mitochondrial fission(GO:0090140) |
0.2 | 0.8 | GO:1900864 | mitochondrial tRNA modification(GO:0070900) mitochondrial RNA modification(GO:1900864) |
0.2 | 1.1 | GO:0071494 | cellular response to UV-C(GO:0071494) |
0.2 | 1.3 | GO:0033601 | positive regulation of mammary gland epithelial cell proliferation(GO:0033601) |
0.2 | 0.4 | GO:0010499 | proteasomal ubiquitin-independent protein catabolic process(GO:0010499) |
0.2 | 0.8 | GO:0050882 | voluntary musculoskeletal movement(GO:0050882) |
0.2 | 0.4 | GO:0019042 | viral latency(GO:0019042) |
0.2 | 0.6 | GO:0043101 | purine-containing compound salvage(GO:0043101) |
0.2 | 3.3 | GO:0051904 | pigment granule transport(GO:0051904) |
0.2 | 0.4 | GO:1901856 | negative regulation of cellular respiration(GO:1901856) |
0.2 | 0.4 | GO:0070574 | cadmium ion transport(GO:0015691) cadmium ion transmembrane transport(GO:0070574) |
0.2 | 0.4 | GO:1904706 | negative regulation of vascular smooth muscle cell proliferation(GO:1904706) |
0.2 | 0.2 | GO:0071649 | regulation of chemokine (C-C motif) ligand 5 production(GO:0071649) positive regulation of chemokine (C-C motif) ligand 5 production(GO:0071651) |
0.2 | 0.8 | GO:2000121 | regulation of removal of superoxide radicals(GO:2000121) |
0.2 | 0.4 | GO:2000474 | regulation of opioid receptor signaling pathway(GO:2000474) |
0.2 | 1.2 | GO:0006384 | transcription initiation from RNA polymerase III promoter(GO:0006384) |
0.2 | 0.8 | GO:0006189 | 'de novo' IMP biosynthetic process(GO:0006189) |
0.2 | 1.4 | GO:0051382 | kinetochore assembly(GO:0051382) |
0.2 | 0.2 | GO:1901859 | negative regulation of mitochondrial DNA metabolic process(GO:1901859) |
0.2 | 1.2 | GO:0010216 | maintenance of DNA methylation(GO:0010216) |
0.2 | 0.4 | GO:0033668 | negative regulation by symbiont of host apoptotic process(GO:0033668) negative regulation by symbiont of host programmed cell death(GO:0052041) negative regulation by organism of programmed cell death in other organism involved in symbiotic interaction(GO:0052490) |
0.2 | 0.8 | GO:0060024 | rhythmic synaptic transmission(GO:0060024) |
0.2 | 0.6 | GO:0070682 | proteasome regulatory particle assembly(GO:0070682) |
0.2 | 0.4 | GO:0072319 | vesicle uncoating(GO:0072319) |
0.2 | 0.2 | GO:0070782 | phosphatidylserine exposure on apoptotic cell surface(GO:0070782) |
0.2 | 0.8 | GO:0071698 | olfactory placode formation(GO:0030910) olfactory placode development(GO:0071698) olfactory placode morphogenesis(GO:0071699) |
0.2 | 3.0 | GO:0071539 | protein localization to centrosome(GO:0071539) |
0.2 | 0.8 | GO:0032790 | ribosome disassembly(GO:0032790) |
0.2 | 1.6 | GO:0071501 | response to sterol depletion(GO:0006991) SREBP signaling pathway(GO:0032933) cellular response to sterol depletion(GO:0071501) |
0.2 | 0.4 | GO:0033133 | positive regulation of glucokinase activity(GO:0033133) positive regulation of hexokinase activity(GO:1903301) |
0.2 | 0.8 | GO:1903225 | negative regulation of endodermal cell differentiation(GO:1903225) |
0.2 | 0.6 | GO:0001887 | selenium compound metabolic process(GO:0001887) |
0.2 | 1.2 | GO:0045332 | phospholipid translocation(GO:0045332) |
0.2 | 0.2 | GO:0000375 | RNA splicing, via transesterification reactions(GO:0000375) |
0.2 | 0.6 | GO:2000467 | positive regulation of glycogen (starch) synthase activity(GO:2000467) |
0.2 | 0.4 | GO:0098763 | mitotic cell cycle phase(GO:0098763) |
0.2 | 0.8 | GO:0060586 | multicellular organismal iron ion homeostasis(GO:0060586) |
0.2 | 1.8 | GO:0016559 | peroxisome fission(GO:0016559) |
0.2 | 0.6 | GO:0044332 | Wnt signaling pathway involved in dorsal/ventral axis specification(GO:0044332) |
0.2 | 0.6 | GO:1901201 | regulation of extracellular matrix assembly(GO:1901201) |
0.2 | 0.4 | GO:0061724 | lipophagy(GO:0061724) |
0.2 | 0.8 | GO:0070885 | negative regulation of calcineurin-NFAT signaling cascade(GO:0070885) |
0.2 | 0.6 | GO:0015889 | cobalamin transport(GO:0015889) |
0.2 | 0.2 | GO:2000670 | positive regulation of dendritic cell apoptotic process(GO:2000670) |
0.2 | 0.8 | GO:0097120 | receptor localization to synapse(GO:0097120) |
0.2 | 0.4 | GO:0034137 | positive regulation of toll-like receptor 2 signaling pathway(GO:0034137) |
0.2 | 1.0 | GO:0044341 | sodium-dependent phosphate transport(GO:0044341) |
0.2 | 0.2 | GO:0071947 | protein deubiquitination involved in ubiquitin-dependent protein catabolic process(GO:0071947) |
0.2 | 1.5 | GO:0046606 | negative regulation of centrosome duplication(GO:0010826) negative regulation of centrosome cycle(GO:0046606) |
0.2 | 0.6 | GO:0007386 | compartment pattern specification(GO:0007386) |
0.2 | 0.6 | GO:0046292 | formaldehyde metabolic process(GO:0046292) |
0.2 | 0.9 | GO:0006545 | glycine biosynthetic process(GO:0006545) |
0.2 | 0.6 | GO:0045719 | negative regulation of glycogen biosynthetic process(GO:0045719) |
0.2 | 0.2 | GO:0043928 | exonucleolytic nuclear-transcribed mRNA catabolic process involved in deadenylation-dependent decay(GO:0043928) |
0.2 | 0.6 | GO:0034134 | toll-like receptor 2 signaling pathway(GO:0034134) |
0.2 | 0.8 | GO:2000255 | negative regulation of male germ cell proliferation(GO:2000255) |
0.2 | 0.2 | GO:0001698 | gastrin-induced gastric acid secretion(GO:0001698) |
0.2 | 0.4 | GO:0043691 | reverse cholesterol transport(GO:0043691) |
0.2 | 1.3 | GO:0002082 | regulation of oxidative phosphorylation(GO:0002082) |
0.2 | 0.4 | GO:1903416 | response to glycoside(GO:1903416) |
0.2 | 0.2 | GO:0033634 | positive regulation of cell-cell adhesion mediated by integrin(GO:0033634) |
0.2 | 0.7 | GO:0046499 | S-adenosylmethioninamine metabolic process(GO:0046499) |
0.2 | 0.2 | GO:0039534 | negative regulation of MDA-5 signaling pathway(GO:0039534) |
0.2 | 0.6 | GO:0061470 | T follicular helper cell differentiation(GO:0061470) |
0.2 | 1.3 | GO:0007097 | nuclear migration(GO:0007097) |
0.2 | 0.6 | GO:1900186 | negative regulation of clathrin-mediated endocytosis(GO:1900186) |
0.2 | 2.4 | GO:0006144 | purine nucleobase metabolic process(GO:0006144) |
0.2 | 0.7 | GO:0010528 | regulation of transposition(GO:0010528) negative regulation of transposition(GO:0010529) |
0.2 | 1.3 | GO:0006750 | glutathione biosynthetic process(GO:0006750) |
0.2 | 1.7 | GO:0043970 | histone H3-K9 acetylation(GO:0043970) |
0.2 | 0.4 | GO:0060399 | positive regulation of growth hormone receptor signaling pathway(GO:0060399) |
0.2 | 2.0 | GO:1904376 | negative regulation of protein localization to plasma membrane(GO:1903077) negative regulation of protein localization to cell periphery(GO:1904376) |
0.2 | 0.7 | GO:0045656 | negative regulation of monocyte differentiation(GO:0045656) |
0.2 | 0.2 | GO:0097051 | establishment of protein localization to endoplasmic reticulum membrane(GO:0097051) |
0.2 | 1.4 | GO:0042448 | progesterone metabolic process(GO:0042448) |
0.2 | 0.4 | GO:1903026 | negative regulation of RNA polymerase II regulatory region sequence-specific DNA binding(GO:1903026) |
0.2 | 0.5 | GO:0032829 | regulation of CD4-positive, CD25-positive, alpha-beta regulatory T cell differentiation(GO:0032829) positive regulation of CD4-positive, CD25-positive, alpha-beta regulatory T cell differentiation(GO:0032831) |
0.2 | 0.5 | GO:0070966 | nuclear-transcribed mRNA catabolic process, no-go decay(GO:0070966) |
0.2 | 0.4 | GO:0072513 | positive regulation of secondary heart field cardioblast proliferation(GO:0072513) |
0.2 | 1.4 | GO:0000290 | deadenylation-dependent decapping of nuclear-transcribed mRNA(GO:0000290) |
0.2 | 2.3 | GO:0043968 | histone H2A acetylation(GO:0043968) |
0.2 | 0.9 | GO:0006012 | galactose metabolic process(GO:0006012) |
0.2 | 0.9 | GO:0002457 | T cell antigen processing and presentation(GO:0002457) |
0.2 | 0.4 | GO:1901535 | regulation of DNA demethylation(GO:1901535) negative regulation of DNA demethylation(GO:1901536) |
0.2 | 0.9 | GO:1904970 | brush border assembly(GO:1904970) |
0.2 | 0.7 | GO:0045448 | regulation of mitotic cell cycle, embryonic(GO:0009794) mitotic cell cycle, embryonic(GO:0045448) |
0.2 | 0.9 | GO:0060708 | spongiotrophoblast differentiation(GO:0060708) |
0.2 | 1.1 | GO:1901660 | calcium ion export(GO:1901660) |
0.2 | 0.4 | GO:1903265 | positive regulation of tumor necrosis factor-mediated signaling pathway(GO:1903265) |
0.2 | 2.3 | GO:0030449 | regulation of complement activation(GO:0030449) regulation of protein activation cascade(GO:2000257) |
0.2 | 0.5 | GO:0060676 | ureteric bud formation(GO:0060676) |
0.2 | 0.7 | GO:0015705 | iodide transport(GO:0015705) |
0.2 | 0.5 | GO:1901097 | negative regulation of autophagosome maturation(GO:1901097) |
0.2 | 2.3 | GO:0043981 | histone H4-K5 acetylation(GO:0043981) histone H4-K8 acetylation(GO:0043982) |
0.2 | 1.9 | GO:0006390 | transcription from mitochondrial promoter(GO:0006390) |
0.2 | 0.9 | GO:0006528 | asparagine metabolic process(GO:0006528) |
0.2 | 0.3 | GO:0035461 | vitamin transmembrane transport(GO:0035461) |
0.2 | 3.6 | GO:0000470 | maturation of LSU-rRNA(GO:0000470) |
0.2 | 0.5 | GO:2000271 | positive regulation of fibroblast apoptotic process(GO:2000271) |
0.2 | 0.7 | GO:0051572 | negative regulation of histone H3-K4 methylation(GO:0051572) |
0.2 | 1.5 | GO:0031952 | regulation of protein autophosphorylation(GO:0031952) |
0.2 | 0.3 | GO:0060268 | negative regulation of respiratory burst involved in inflammatory response(GO:0060266) negative regulation of respiratory burst(GO:0060268) |
0.2 | 0.5 | GO:0060613 | fat pad development(GO:0060613) |
0.2 | 0.5 | GO:0046013 | T cell homeostatic proliferation(GO:0001777) regulation of T cell homeostatic proliferation(GO:0046013) |
0.2 | 0.2 | GO:0044252 | negative regulation of multicellular organismal metabolic process(GO:0044252) |
0.2 | 0.8 | GO:0010875 | positive regulation of cholesterol efflux(GO:0010875) |
0.2 | 0.2 | GO:0071440 | regulation of histone H3-K14 acetylation(GO:0071440) |
0.2 | 0.8 | GO:0032466 | negative regulation of cytokinesis(GO:0032466) |
0.2 | 3.5 | GO:0032008 | positive regulation of TOR signaling(GO:0032008) |
0.2 | 0.8 | GO:0010739 | positive regulation of protein kinase A signaling(GO:0010739) |
0.2 | 1.3 | GO:0018026 | peptidyl-lysine monomethylation(GO:0018026) |
0.2 | 0.8 | GO:0030718 | germ-line stem cell population maintenance(GO:0030718) |
0.2 | 1.8 | GO:0046500 | S-adenosylmethionine metabolic process(GO:0046500) |
0.2 | 0.2 | GO:0090231 | regulation of spindle checkpoint(GO:0090231) |
0.2 | 0.3 | GO:0030223 | neutrophil differentiation(GO:0030223) |
0.2 | 0.5 | GO:0032439 | endosome localization(GO:0032439) |
0.2 | 1.7 | GO:0051770 | positive regulation of nitric-oxide synthase biosynthetic process(GO:0051770) |
0.2 | 0.7 | GO:1901164 | negative regulation of trophoblast cell migration(GO:1901164) |
0.2 | 1.3 | GO:0010801 | negative regulation of peptidyl-threonine phosphorylation(GO:0010801) |
0.2 | 0.5 | GO:0044860 | protein localization to plasma membrane raft(GO:0044860) |
0.2 | 0.5 | GO:0061684 | chaperone-mediated autophagy(GO:0061684) |
0.2 | 3.5 | GO:0006730 | one-carbon metabolic process(GO:0006730) |
0.2 | 0.2 | GO:0030497 | fatty acid elongation(GO:0030497) |
0.2 | 0.7 | GO:0051462 | cortisol secretion(GO:0043400) regulation of cortisol secretion(GO:0051462) |
0.2 | 1.6 | GO:0034497 | protein localization to pre-autophagosomal structure(GO:0034497) |
0.2 | 0.3 | GO:0010481 | epidermal cell division(GO:0010481) regulation of epidermal cell division(GO:0010482) |
0.2 | 0.5 | GO:0001732 | formation of cytoplasmic translation initiation complex(GO:0001732) |
0.2 | 0.6 | GO:0045743 | positive regulation of fibroblast growth factor receptor signaling pathway(GO:0045743) |
0.2 | 0.8 | GO:2000270 | negative regulation of fibroblast apoptotic process(GO:2000270) |
0.2 | 0.3 | GO:0035754 | B cell chemotaxis(GO:0035754) |
0.2 | 0.6 | GO:0061635 | regulation of protein complex stability(GO:0061635) |
0.2 | 2.9 | GO:0045070 | positive regulation of viral genome replication(GO:0045070) |
0.2 | 0.3 | GO:0032290 | peripheral nervous system myelin formation(GO:0032290) |
0.2 | 0.3 | GO:1904668 | positive regulation of ubiquitin protein ligase activity(GO:1904668) |
0.2 | 0.2 | GO:0015865 | purine nucleotide transport(GO:0015865) |
0.2 | 1.6 | GO:0035162 | embryonic hemopoiesis(GO:0035162) |
0.2 | 0.6 | GO:0048539 | bone marrow development(GO:0048539) |
0.2 | 1.4 | GO:0042994 | cytoplasmic sequestering of transcription factor(GO:0042994) |
0.2 | 0.2 | GO:0015819 | lysine transport(GO:0015819) |
0.2 | 0.5 | GO:0019287 | isopentenyl diphosphate biosynthetic process(GO:0009240) isopentenyl diphosphate biosynthetic process, mevalonate pathway(GO:0019287) |
0.2 | 0.5 | GO:0071787 | endoplasmic reticulum tubular network assembly(GO:0071787) |
0.2 | 0.5 | GO:0046951 | ketone body biosynthetic process(GO:0046951) |
0.2 | 0.2 | GO:0065001 | specification of axis polarity(GO:0065001) |
0.2 | 0.6 | GO:0007023 | post-chaperonin tubulin folding pathway(GO:0007023) |
0.2 | 0.8 | GO:0048387 | negative regulation of retinoic acid receptor signaling pathway(GO:0048387) |
0.2 | 0.6 | GO:0051031 | tRNA transport(GO:0051031) |
0.2 | 0.8 | GO:0060023 | soft palate development(GO:0060023) |
0.2 | 0.9 | GO:0006621 | protein retention in ER lumen(GO:0006621) |
0.2 | 2.0 | GO:0090207 | regulation of triglyceride metabolic process(GO:0090207) |
0.2 | 0.3 | GO:0086064 | cell communication by electrical coupling involved in cardiac conduction(GO:0086064) |
0.2 | 1.4 | GO:0090136 | epithelial cell-cell adhesion(GO:0090136) |
0.2 | 2.6 | GO:1900026 | positive regulation of substrate adhesion-dependent cell spreading(GO:1900026) |
0.2 | 0.5 | GO:1902036 | regulation of hematopoietic stem cell differentiation(GO:1902036) |
0.2 | 0.8 | GO:0061158 | 3'-UTR-mediated mRNA destabilization(GO:0061158) |
0.2 | 0.9 | GO:0048304 | positive regulation of isotype switching to IgG isotypes(GO:0048304) |
0.2 | 1.4 | GO:0015816 | glycine transport(GO:0015816) |
0.2 | 0.2 | GO:0042851 | L-alanine metabolic process(GO:0042851) |
0.2 | 0.6 | GO:0060330 | regulation of response to interferon-gamma(GO:0060330) |
0.2 | 0.6 | GO:0098532 | histone H3-K27 trimethylation(GO:0098532) |
0.2 | 0.6 | GO:1904707 | positive regulation of vascular smooth muscle cell proliferation(GO:1904707) |
0.2 | 1.1 | GO:0042059 | negative regulation of epidermal growth factor receptor signaling pathway(GO:0042059) |
0.2 | 0.6 | GO:1903553 | positive regulation of extracellular exosome assembly(GO:1903553) |
0.2 | 0.6 | GO:0035457 | cellular response to interferon-alpha(GO:0035457) |
0.2 | 1.7 | GO:0000083 | regulation of transcription involved in G1/S transition of mitotic cell cycle(GO:0000083) |
0.2 | 0.2 | GO:0001826 | inner cell mass cell differentiation(GO:0001826) |
0.1 | 0.7 | GO:0019673 | GDP-mannose metabolic process(GO:0019673) |
0.1 | 0.4 | GO:0010046 | response to mycotoxin(GO:0010046) |
0.1 | 0.3 | GO:0044034 | negative stranded viral RNA replication(GO:0039689) multi-organism biosynthetic process(GO:0044034) |
0.1 | 1.6 | GO:0042744 | hydrogen peroxide catabolic process(GO:0042744) |
0.1 | 0.3 | GO:0090085 | regulation of protein deubiquitination(GO:0090085) |
0.1 | 0.6 | GO:0006369 | termination of RNA polymerase II transcription(GO:0006369) |
0.1 | 0.3 | GO:0010764 | negative regulation of fibroblast migration(GO:0010764) |
0.1 | 0.3 | GO:0048549 | positive regulation of pinocytosis(GO:0048549) |
0.1 | 0.3 | GO:1900169 | regulation of glucocorticoid mediated signaling pathway(GO:1900169) |
0.1 | 0.9 | GO:0019348 | dolichol metabolic process(GO:0019348) |
0.1 | 0.4 | GO:0072386 | plus-end-directed vesicle transport along microtubule(GO:0072383) plus-end-directed organelle transport along microtubule(GO:0072386) |
0.1 | 0.3 | GO:1902946 | protein localization to early endosome(GO:1902946) |
0.1 | 0.1 | GO:0060315 | negative regulation of ryanodine-sensitive calcium-release channel activity(GO:0060315) |
0.1 | 0.4 | GO:0034508 | centromere complex assembly(GO:0034508) |
0.1 | 0.7 | GO:0001842 | neural fold formation(GO:0001842) |
0.1 | 0.4 | GO:1900153 | regulation of nuclear-transcribed mRNA catabolic process, deadenylation-dependent decay(GO:1900151) positive regulation of nuclear-transcribed mRNA catabolic process, deadenylation-dependent decay(GO:1900153) |
0.1 | 0.6 | GO:0010571 | positive regulation of nuclear cell cycle DNA replication(GO:0010571) |
0.1 | 0.1 | GO:0060800 | regulation of cell differentiation involved in embryonic placenta development(GO:0060800) |
0.1 | 0.6 | GO:0000727 | double-strand break repair via break-induced replication(GO:0000727) |
0.1 | 0.6 | GO:0008594 | photoreceptor cell morphogenesis(GO:0008594) |
0.1 | 3.2 | GO:0043001 | Golgi to plasma membrane protein transport(GO:0043001) |
0.1 | 0.1 | GO:0019852 | L-ascorbic acid metabolic process(GO:0019852) |
0.1 | 0.7 | GO:0000395 | mRNA 5'-splice site recognition(GO:0000395) |
0.1 | 0.1 | GO:0043045 | DNA methylation involved in embryo development(GO:0043045) changes to DNA methylation involved in embryo development(GO:1901538) |
0.1 | 2.2 | GO:0051865 | protein autoubiquitination(GO:0051865) |
0.1 | 0.3 | GO:0051791 | medium-chain fatty acid metabolic process(GO:0051791) |
0.1 | 0.1 | GO:2001185 | regulation of CD8-positive, alpha-beta T cell activation(GO:2001185) |
0.1 | 0.4 | GO:0043504 | mitochondrial DNA repair(GO:0043504) |
0.1 | 1.0 | GO:0034498 | early endosome to Golgi transport(GO:0034498) |
0.1 | 0.8 | GO:0010226 | response to lithium ion(GO:0010226) |
0.1 | 0.3 | GO:0070827 | chromatin maintenance(GO:0070827) |
0.1 | 0.1 | GO:0070424 | regulation of nucleotide-binding oligomerization domain containing signaling pathway(GO:0070424) regulation of nucleotide-binding oligomerization domain containing 1 signaling pathway(GO:0070428) regulation of nucleotide-binding oligomerization domain containing 2 signaling pathway(GO:0070432) |
0.1 | 0.3 | GO:0060447 | bud outgrowth involved in lung branching(GO:0060447) |
0.1 | 0.5 | GO:2000653 | regulation of genetic imprinting(GO:2000653) |
0.1 | 0.4 | GO:0021942 | radial glia guided migration of Purkinje cell(GO:0021942) |
0.1 | 0.8 | GO:0030644 | cellular chloride ion homeostasis(GO:0030644) chloride ion homeostasis(GO:0055064) |
0.1 | 0.3 | GO:0030046 | parallel actin filament bundle assembly(GO:0030046) |
0.1 | 0.7 | GO:0035269 | protein O-linked mannosylation(GO:0035269) |
0.1 | 0.9 | GO:0006353 | DNA-templated transcription, termination(GO:0006353) |
0.1 | 0.4 | GO:0002445 | type IIa hypersensitivity(GO:0001794) regulation of type IIa hypersensitivity(GO:0001796) positive regulation of type IIa hypersensitivity(GO:0001798) type II hypersensitivity(GO:0002445) regulation of type II hypersensitivity(GO:0002892) positive regulation of type II hypersensitivity(GO:0002894) |
0.1 | 0.3 | GO:0007035 | vacuolar acidification(GO:0007035) |
0.1 | 0.1 | GO:0003100 | regulation of systemic arterial blood pressure by endothelin(GO:0003100) |
0.1 | 0.4 | GO:0032747 | interleukin-23 production(GO:0032627) regulation of interleukin-23 production(GO:0032667) positive regulation of interleukin-23 production(GO:0032747) |
0.1 | 1.5 | GO:0032728 | positive regulation of interferon-beta production(GO:0032728) |
0.1 | 1.1 | GO:0006336 | DNA replication-independent nucleosome assembly(GO:0006336) DNA replication-independent nucleosome organization(GO:0034724) |
0.1 | 0.3 | GO:1903774 | positive regulation of viral budding via host ESCRT complex(GO:1903774) |
0.1 | 0.3 | GO:0014012 | peripheral nervous system axon regeneration(GO:0014012) |
0.1 | 1.2 | GO:0051292 | nuclear pore complex assembly(GO:0051292) |
0.1 | 0.4 | GO:0070127 | tRNA aminoacylation for mitochondrial protein translation(GO:0070127) |
0.1 | 1.3 | GO:0043206 | extracellular fibril organization(GO:0043206) |
0.1 | 0.6 | GO:0040016 | embryonic cleavage(GO:0040016) |
0.1 | 1.0 | GO:0006978 | DNA damage response, signal transduction by p53 class mediator resulting in transcription of p21 class mediator(GO:0006978) |
0.1 | 0.9 | GO:0006474 | N-terminal protein amino acid acetylation(GO:0006474) |
0.1 | 1.7 | GO:0046549 | retinal cone cell development(GO:0046549) |
0.1 | 0.3 | GO:0090042 | tubulin deacetylation(GO:0090042) |
0.1 | 0.4 | GO:0090343 | positive regulation of cell aging(GO:0090343) positive regulation of cellular senescence(GO:2000774) |
0.1 | 3.6 | GO:0006506 | GPI anchor biosynthetic process(GO:0006506) |
0.1 | 0.4 | GO:0006613 | cotranslational protein targeting to membrane(GO:0006613) |
0.1 | 0.1 | GO:0000414 | regulation of histone H3-K36 methylation(GO:0000414) |
0.1 | 0.3 | GO:1902896 | terminal web assembly(GO:1902896) |
0.1 | 1.3 | GO:0051601 | exocyst localization(GO:0051601) |
0.1 | 0.4 | GO:0033762 | response to glucagon(GO:0033762) |
0.1 | 0.1 | GO:0045650 | negative regulation of macrophage differentiation(GO:0045650) |
0.1 | 0.4 | GO:1904431 | positive regulation of t-circle formation(GO:1904431) |
0.1 | 0.4 | GO:0071688 | skeletal muscle myosin thick filament assembly(GO:0030241) striated muscle myosin thick filament assembly(GO:0071688) |
0.1 | 0.1 | GO:1900106 | hyaluranon cable assembly(GO:0036118) regulation of hyaluranon cable assembly(GO:1900104) positive regulation of hyaluranon cable assembly(GO:1900106) |
0.1 | 0.2 | GO:1903376 | neuron intrinsic apoptotic signaling pathway in response to oxidative stress(GO:0036480) regulation of oxidative stress-induced neuron intrinsic apoptotic signaling pathway(GO:1903376) |
0.1 | 0.6 | GO:0018401 | peptidyl-proline hydroxylation to 4-hydroxy-L-proline(GO:0018401) |
0.1 | 0.9 | GO:0009191 | ribonucleoside diphosphate catabolic process(GO:0009191) |
0.1 | 0.4 | GO:0010746 | regulation of plasma membrane long-chain fatty acid transport(GO:0010746) |
0.1 | 0.2 | GO:0051105 | regulation of DNA ligation(GO:0051105) positive regulation of DNA ligation(GO:0051106) |
0.1 | 0.2 | GO:2001274 | negative regulation of glucose import in response to insulin stimulus(GO:2001274) |
0.1 | 0.1 | GO:2000468 | regulation of peroxidase activity(GO:2000468) |
0.1 | 0.2 | GO:0009247 | glycolipid biosynthetic process(GO:0009247) |
0.1 | 0.1 | GO:0006449 | regulation of translational termination(GO:0006449) |
0.1 | 0.4 | GO:1904659 | glucose transmembrane transport(GO:1904659) |
0.1 | 0.9 | GO:0010459 | negative regulation of heart rate(GO:0010459) |
0.1 | 1.2 | GO:0006032 | chitin metabolic process(GO:0006030) chitin catabolic process(GO:0006032) |
0.1 | 0.4 | GO:0075525 | viral translational termination-reinitiation(GO:0075525) |
0.1 | 0.4 | GO:0009233 | menaquinone metabolic process(GO:0009233) |
0.1 | 1.1 | GO:0000305 | response to oxygen radical(GO:0000305) |
0.1 | 0.4 | GO:0010835 | regulation of protein ADP-ribosylation(GO:0010835) |
0.1 | 0.7 | GO:0090051 | negative regulation of cell migration involved in sprouting angiogenesis(GO:0090051) |
0.1 | 0.1 | GO:1903671 | negative regulation of sprouting angiogenesis(GO:1903671) |
0.1 | 0.1 | GO:0002674 | negative regulation of acute inflammatory response(GO:0002674) |
0.1 | 0.4 | GO:0070544 | histone H3-K36 demethylation(GO:0070544) |
0.1 | 2.7 | GO:1900077 | negative regulation of cellular response to insulin stimulus(GO:1900077) |
0.1 | 3.3 | GO:0000387 | spliceosomal snRNP assembly(GO:0000387) |
0.1 | 0.1 | GO:0034421 | post-translational protein acetylation(GO:0034421) |
0.1 | 1.0 | GO:0031935 | regulation of chromatin silencing(GO:0031935) |
0.1 | 0.3 | GO:0021914 | negative regulation of smoothened signaling pathway involved in ventral spinal cord patterning(GO:0021914) |
0.1 | 1.2 | GO:0007095 | mitotic G2 DNA damage checkpoint(GO:0007095) |
0.1 | 0.2 | GO:0019086 | late viral transcription(GO:0019086) |
0.1 | 0.5 | GO:0031581 | hemidesmosome assembly(GO:0031581) |
0.1 | 0.7 | GO:0021707 | cerebellar granular layer formation(GO:0021684) cerebellar granule cell differentiation(GO:0021707) |
0.1 | 0.2 | GO:0007066 | female meiosis sister chromatid cohesion(GO:0007066) |
0.1 | 0.3 | GO:1903912 | negative regulation of endoplasmic reticulum stress-induced eIF2 alpha phosphorylation(GO:1903912) |
0.1 | 0.2 | GO:2000599 | regulation of cyclin catabolic process(GO:2000598) negative regulation of cyclin catabolic process(GO:2000599) |
0.1 | 0.5 | GO:0045908 | negative regulation of vasodilation(GO:0045908) |
0.1 | 0.6 | GO:0035435 | phosphate ion transmembrane transport(GO:0035435) |
0.1 | 0.3 | GO:0042420 | dopamine catabolic process(GO:0042420) |
0.1 | 0.3 | GO:2000192 | negative regulation of fatty acid transport(GO:2000192) |
0.1 | 0.4 | GO:0033182 | regulation of histone ubiquitination(GO:0033182) |
0.1 | 0.7 | GO:0051013 | microtubule severing(GO:0051013) |
0.1 | 0.3 | GO:1901421 | positive regulation of response to alcohol(GO:1901421) |
0.1 | 4.0 | GO:0000079 | regulation of cyclin-dependent protein serine/threonine kinase activity(GO:0000079) |
0.1 | 0.4 | GO:0019276 | UDP-N-acetylgalactosamine metabolic process(GO:0019276) |
0.1 | 0.7 | GO:0016540 | protein autoprocessing(GO:0016540) |
0.1 | 0.6 | GO:0035811 | negative regulation of urine volume(GO:0035811) |
0.1 | 1.7 | GO:0000186 | activation of MAPKK activity(GO:0000186) |
0.1 | 1.8 | GO:0030488 | tRNA methylation(GO:0030488) |
0.1 | 1.3 | GO:0099517 | anterograde synaptic vesicle transport(GO:0048490) synaptic vesicle cytoskeletal transport(GO:0099514) synaptic vesicle transport along microtubule(GO:0099517) |
0.1 | 0.2 | GO:0032328 | alanine transport(GO:0032328) |
0.1 | 0.3 | GO:0015817 | histidine transport(GO:0015817) |
0.1 | 0.2 | GO:0046877 | regulation of saliva secretion(GO:0046877) |
0.1 | 0.1 | GO:2000705 | regulation of dense core granule biogenesis(GO:2000705) |
0.1 | 0.2 | GO:0070358 | actin polymerization-dependent cell motility(GO:0070358) |
0.1 | 0.3 | GO:0035234 | ectopic germ cell programmed cell death(GO:0035234) |
0.1 | 0.5 | GO:0021960 | anterior commissure morphogenesis(GO:0021960) |
0.1 | 0.5 | GO:0016139 | glycoside catabolic process(GO:0016139) |
0.1 | 0.2 | GO:0001692 | histamine metabolic process(GO:0001692) |
0.1 | 0.4 | GO:0071786 | endoplasmic reticulum tubular network organization(GO:0071786) |
0.1 | 0.1 | GO:0006382 | adenosine to inosine editing(GO:0006382) |
0.1 | 0.4 | GO:0006398 | mRNA 3'-end processing by stem-loop binding and cleavage(GO:0006398) |
0.1 | 0.1 | GO:1903660 | regulation of complement-dependent cytotoxicity(GO:1903659) negative regulation of complement-dependent cytotoxicity(GO:1903660) |
0.1 | 0.4 | GO:0097284 | hepatocyte apoptotic process(GO:0097284) |
0.1 | 0.3 | GO:0002337 | B-1a B cell differentiation(GO:0002337) |
0.1 | 0.1 | GO:0040001 | establishment of mitotic spindle localization(GO:0040001) |
0.1 | 0.2 | GO:0010966 | regulation of phosphate transport(GO:0010966) |
0.1 | 0.4 | GO:0015671 | oxygen transport(GO:0015671) |
0.1 | 0.2 | GO:0010724 | regulation of definitive erythrocyte differentiation(GO:0010724) |
0.1 | 1.0 | GO:0043486 | histone exchange(GO:0043486) |
0.1 | 0.3 | GO:1903849 | regulation of aorta morphogenesis(GO:1903847) positive regulation of aorta morphogenesis(GO:1903849) |
0.1 | 1.6 | GO:0016578 | histone deubiquitination(GO:0016578) |
0.1 | 0.3 | GO:0090187 | positive regulation of pancreatic juice secretion(GO:0090187) |
0.1 | 0.3 | GO:0098700 | aminergic neurotransmitter loading into synaptic vesicle(GO:0015842) neurotransmitter loading into synaptic vesicle(GO:0098700) |
0.1 | 0.2 | GO:0007619 | courtship behavior(GO:0007619) |
0.1 | 0.4 | GO:0019482 | beta-alanine metabolic process(GO:0019482) |
0.1 | 0.9 | GO:0010390 | histone monoubiquitination(GO:0010390) |
0.1 | 0.2 | GO:0032929 | negative regulation of superoxide anion generation(GO:0032929) |
0.1 | 0.7 | GO:0034244 | negative regulation of transcription elongation from RNA polymerase II promoter(GO:0034244) |
0.1 | 0.1 | GO:0072367 | regulation of lipid transport by regulation of transcription from RNA polymerase II promoter(GO:0072367) |
0.1 | 0.3 | GO:0031468 | nuclear envelope reassembly(GO:0031468) |
0.1 | 0.5 | GO:0048680 | positive regulation of axon regeneration(GO:0048680) |
0.1 | 0.2 | GO:1903279 | regulation of calcium:sodium antiporter activity(GO:1903279) |
0.1 | 0.4 | GO:0046007 | negative regulation of activated T cell proliferation(GO:0046007) |
0.1 | 0.4 | GO:0034383 | low-density lipoprotein particle clearance(GO:0034383) |
0.1 | 0.1 | GO:2000483 | negative regulation of interleukin-8 secretion(GO:2000483) |
0.1 | 1.0 | GO:0042574 | retinal metabolic process(GO:0042574) |
0.1 | 0.1 | GO:0042524 | negative regulation of tyrosine phosphorylation of Stat5 protein(GO:0042524) |
0.1 | 0.6 | GO:0036089 | cleavage furrow formation(GO:0036089) |
0.1 | 0.2 | GO:0010693 | negative regulation of alkaline phosphatase activity(GO:0010693) |
0.1 | 0.1 | GO:0002572 | pro-T cell differentiation(GO:0002572) |
0.1 | 1.2 | GO:1902187 | negative regulation of viral release from host cell(GO:1902187) |
0.1 | 1.3 | GO:0006607 | NLS-bearing protein import into nucleus(GO:0006607) |
0.1 | 0.2 | GO:2000520 | regulation of immunological synapse formation(GO:2000520) |
0.1 | 0.8 | GO:0006349 | regulation of gene expression by genetic imprinting(GO:0006349) |
0.1 | 0.2 | GO:0000972 | transcription-dependent tethering of RNA polymerase II gene DNA at nuclear periphery(GO:0000972) |
0.1 | 4.2 | GO:0051168 | nuclear export(GO:0051168) |
0.1 | 2.8 | GO:0043966 | histone H3 acetylation(GO:0043966) |
0.1 | 0.6 | GO:0045086 | positive regulation of interleukin-2 biosynthetic process(GO:0045086) |
0.1 | 1.3 | GO:0008088 | axo-dendritic transport(GO:0008088) |
0.1 | 0.4 | GO:0006778 | porphyrin-containing compound metabolic process(GO:0006778) |
0.1 | 0.4 | GO:0090666 | scaRNA localization to Cajal body(GO:0090666) |
0.1 | 0.3 | GO:1902857 | positive regulation of nonmotile primary cilium assembly(GO:1902857) |
0.1 | 0.4 | GO:0030311 | poly-N-acetyllactosamine metabolic process(GO:0030309) poly-N-acetyllactosamine biosynthetic process(GO:0030311) |
0.1 | 0.3 | GO:0043619 | regulation of transcription from RNA polymerase II promoter in response to oxidative stress(GO:0043619) |
0.1 | 0.6 | GO:0046348 | amino sugar catabolic process(GO:0046348) |
0.1 | 0.1 | GO:0046122 | purine deoxyribonucleoside metabolic process(GO:0046122) |
0.1 | 0.2 | GO:1903011 | negative regulation of bone development(GO:1903011) |
0.1 | 0.3 | GO:0045591 | positive regulation of regulatory T cell differentiation(GO:0045591) |
0.1 | 0.4 | GO:0009048 | dosage compensation(GO:0007549) dosage compensation by inactivation of X chromosome(GO:0009048) |
0.1 | 1.0 | GO:0030212 | hyaluronan metabolic process(GO:0030212) |
0.1 | 0.6 | GO:0031507 | heterochromatin assembly(GO:0031507) |
0.1 | 0.5 | GO:2000671 | regulation of motor neuron apoptotic process(GO:2000671) |
0.1 | 0.9 | GO:0032968 | positive regulation of transcription elongation from RNA polymerase II promoter(GO:0032968) |
0.1 | 0.3 | GO:0045896 | regulation of transcription during mitosis(GO:0045896) positive regulation of transcription during mitosis(GO:0045897) |
0.1 | 0.6 | GO:0006303 | double-strand break repair via nonhomologous end joining(GO:0006303) |
0.1 | 0.7 | GO:0006907 | pinocytosis(GO:0006907) |
0.1 | 0.8 | GO:0043248 | proteasome assembly(GO:0043248) |
0.1 | 0.4 | GO:0009109 | coenzyme catabolic process(GO:0009109) |
0.1 | 0.3 | GO:0006931 | substrate-dependent cell migration, cell attachment to substrate(GO:0006931) |
0.1 | 2.4 | GO:0006749 | glutathione metabolic process(GO:0006749) |
0.1 | 0.3 | GO:0045048 | protein insertion into ER membrane(GO:0045048) tail-anchored membrane protein insertion into ER membrane(GO:0071816) |
0.1 | 0.3 | GO:2000042 | negative regulation of double-strand break repair via homologous recombination(GO:2000042) |
0.1 | 0.2 | GO:0003431 | growth plate cartilage chondrocyte development(GO:0003431) |
0.1 | 0.4 | GO:0046826 | negative regulation of protein export from nucleus(GO:0046826) |
0.1 | 0.1 | GO:0039536 | negative regulation of RIG-I signaling pathway(GO:0039536) |
0.1 | 1.3 | GO:0006692 | prostanoid metabolic process(GO:0006692) prostaglandin metabolic process(GO:0006693) |
0.1 | 0.3 | GO:0051988 | regulation of attachment of spindle microtubules to kinetochore(GO:0051988) |
0.1 | 1.0 | GO:0042407 | cristae formation(GO:0042407) |
0.1 | 0.3 | GO:0070131 | positive regulation of mitochondrial translation(GO:0070131) |
0.1 | 1.0 | GO:0051180 | vitamin transport(GO:0051180) |
0.1 | 2.0 | GO:1902850 | mitotic spindle assembly(GO:0090307) microtubule cytoskeleton organization involved in mitosis(GO:1902850) |
0.1 | 0.1 | GO:0048318 | axial mesoderm development(GO:0048318) |
0.1 | 0.1 | GO:0042891 | antibiotic transport(GO:0042891) |
0.1 | 0.3 | GO:0033129 | positive regulation of histone phosphorylation(GO:0033129) |
0.1 | 0.3 | GO:0006419 | alanyl-tRNA aminoacylation(GO:0006419) |
0.1 | 0.1 | GO:0070294 | renal sodium ion absorption(GO:0070294) |
0.1 | 0.2 | GO:0034720 | histone H3-K4 demethylation(GO:0034720) |
0.1 | 0.4 | GO:0035977 | protein deglycosylation involved in glycoprotein catabolic process(GO:0035977) protein demannosylation(GO:0036507) protein alpha-1,2-demannosylation(GO:0036508) mannose trimming involved in glycoprotein ERAD pathway(GO:1904382) |
0.1 | 0.2 | GO:0045717 | negative regulation of fatty acid biosynthetic process(GO:0045717) |
0.1 | 0.9 | GO:0030033 | microvillus assembly(GO:0030033) |
0.1 | 0.2 | GO:0060591 | chondroblast differentiation(GO:0060591) |
0.1 | 0.3 | GO:0000379 | tRNA-type intron splice site recognition and cleavage(GO:0000379) |
0.1 | 0.2 | GO:0046598 | positive regulation of viral entry into host cell(GO:0046598) |
0.1 | 0.4 | GO:0006102 | isocitrate metabolic process(GO:0006102) |
0.1 | 0.2 | GO:0048294 | negative regulation of isotype switching to IgE isotypes(GO:0048294) |
0.1 | 0.4 | GO:2000601 | positive regulation of Arp2/3 complex-mediated actin nucleation(GO:2000601) |
0.1 | 0.7 | GO:0015721 | bile acid and bile salt transport(GO:0015721) |
0.1 | 0.3 | GO:1903300 | negative regulation of glucokinase activity(GO:0033132) negative regulation of hexokinase activity(GO:1903300) |
0.1 | 0.9 | GO:0045671 | negative regulation of osteoclast differentiation(GO:0045671) |
0.1 | 0.3 | GO:2000686 | regulation of rubidium ion transmembrane transporter activity(GO:2000686) |
0.1 | 0.5 | GO:0071364 | cellular response to epidermal growth factor stimulus(GO:0071364) |
0.1 | 0.2 | GO:0072396 | response to cell cycle checkpoint signaling(GO:0072396) response to DNA integrity checkpoint signaling(GO:0072402) response to DNA damage checkpoint signaling(GO:0072423) response to intra-S DNA damage checkpoint signaling(GO:0072429) |
0.1 | 0.4 | GO:0042135 | neurotransmitter catabolic process(GO:0042135) |
0.1 | 0.2 | GO:0071481 | cellular response to X-ray(GO:0071481) |
0.1 | 0.3 | GO:0097240 | telomere tethering at nuclear periphery(GO:0034398) meiotic telomere tethering at nuclear periphery(GO:0044821) meiotic attachment of telomere to nuclear envelope(GO:0070197) chromosome attachment to the nuclear envelope(GO:0097240) |
0.1 | 0.3 | GO:1990440 | positive regulation of transcription from RNA polymerase II promoter in response to endoplasmic reticulum stress(GO:1990440) |
0.1 | 0.1 | GO:0042726 | flavin-containing compound metabolic process(GO:0042726) |
0.1 | 0.1 | GO:1903551 | regulation of extracellular exosome assembly(GO:1903551) |
0.1 | 0.1 | GO:0046813 | angiotensin-mediated drinking behavior(GO:0003051) receptor-mediated virion attachment to host cell(GO:0046813) |
0.1 | 0.2 | GO:2001225 | regulation of chloride transport(GO:2001225) |
0.1 | 0.1 | GO:0050711 | negative regulation of interleukin-1 secretion(GO:0050711) |
0.1 | 0.2 | GO:0007217 | tachykinin receptor signaling pathway(GO:0007217) |
0.1 | 1.0 | GO:0045116 | protein neddylation(GO:0045116) |
0.1 | 0.4 | GO:2000811 | negative regulation of anoikis(GO:2000811) |
0.1 | 0.7 | GO:0052697 | xenobiotic glucuronidation(GO:0052697) |
0.1 | 0.9 | GO:0030150 | protein import into mitochondrial matrix(GO:0030150) |
0.1 | 1.3 | GO:0033363 | secretory granule organization(GO:0033363) |
0.1 | 0.8 | GO:0034122 | negative regulation of toll-like receptor signaling pathway(GO:0034122) |
0.1 | 0.5 | GO:0044819 | mitotic G1/S transition checkpoint(GO:0044819) |
0.1 | 0.5 | GO:0006656 | phosphatidylcholine biosynthetic process(GO:0006656) |
0.1 | 0.1 | GO:1901420 | negative regulation of response to alcohol(GO:1901420) |
0.1 | 0.5 | GO:0051044 | positive regulation of membrane protein ectodomain proteolysis(GO:0051044) |
0.1 | 0.2 | GO:0051547 | regulation of keratinocyte migration(GO:0051547) positive regulation of keratinocyte migration(GO:0051549) |
0.1 | 0.2 | GO:2000741 | positive regulation of mesenchymal stem cell differentiation(GO:2000741) |
0.1 | 0.1 | GO:0032367 | intracellular cholesterol transport(GO:0032367) |
0.1 | 0.2 | GO:0014835 | myoblast differentiation involved in skeletal muscle regeneration(GO:0014835) |
0.1 | 0.5 | GO:2000786 | positive regulation of autophagosome assembly(GO:2000786) |
0.1 | 0.1 | GO:0043652 | engulfment of apoptotic cell(GO:0043652) |
0.1 | 0.3 | GO:0043456 | regulation of pentose-phosphate shunt(GO:0043456) |
0.1 | 0.1 | GO:0043516 | regulation of DNA damage response, signal transduction by p53 class mediator(GO:0043516) |
0.1 | 1.5 | GO:0051225 | spindle assembly(GO:0051225) |
0.1 | 0.9 | GO:0007076 | mitotic chromosome condensation(GO:0007076) |
0.1 | 0.2 | GO:0009146 | purine nucleoside triphosphate catabolic process(GO:0009146) |
0.1 | 0.6 | GO:2000637 | positive regulation of gene silencing by miRNA(GO:2000637) |
0.1 | 0.1 | GO:1902513 | regulation of organelle transport along microtubule(GO:1902513) |
0.1 | 0.2 | GO:0021764 | amygdala development(GO:0021764) |
0.1 | 0.3 | GO:0042138 | meiotic DNA double-strand break formation(GO:0042138) |
0.1 | 0.8 | GO:0034198 | cellular response to amino acid starvation(GO:0034198) |
0.1 | 0.1 | GO:1902093 | positive regulation of sperm motility(GO:1902093) |
0.1 | 0.2 | GO:0097477 | lateral motor column neuron migration(GO:0097477) |
0.1 | 1.4 | GO:0043631 | mRNA polyadenylation(GO:0006378) RNA polyadenylation(GO:0043631) |
0.1 | 0.4 | GO:0021999 | neural plate anterior/posterior regionalization(GO:0021999) |
0.1 | 0.4 | GO:0030205 | dermatan sulfate metabolic process(GO:0030205) |
0.1 | 0.2 | GO:0015760 | hexose phosphate transport(GO:0015712) glucose-6-phosphate transport(GO:0015760) |
0.1 | 5.2 | GO:0051028 | mRNA transport(GO:0051028) |
0.1 | 0.1 | GO:0060623 | regulation of chromosome condensation(GO:0060623) |
0.1 | 0.9 | GO:0071158 | positive regulation of cell cycle arrest(GO:0071158) |
0.1 | 0.8 | GO:0006661 | phosphatidylinositol biosynthetic process(GO:0006661) |
0.1 | 0.2 | GO:0097680 | double-strand break repair via classical nonhomologous end joining(GO:0097680) |
0.1 | 0.2 | GO:0006924 | activation-induced cell death of T cells(GO:0006924) |
0.1 | 0.2 | GO:0090241 | negative regulation of histone H4 acetylation(GO:0090241) |
0.1 | 0.3 | GO:0010510 | regulation of acetyl-CoA biosynthetic process from pyruvate(GO:0010510) |
0.1 | 0.4 | GO:0030299 | intestinal cholesterol absorption(GO:0030299) |
0.1 | 0.8 | GO:0045638 | negative regulation of myeloid cell differentiation(GO:0045638) |
0.1 | 0.2 | GO:0045898 | regulation of RNA polymerase II transcriptional preinitiation complex assembly(GO:0045898) |
0.1 | 0.6 | GO:0006120 | mitochondrial electron transport, NADH to ubiquinone(GO:0006120) |
0.1 | 1.6 | GO:0051310 | metaphase plate congression(GO:0051310) |
0.1 | 0.2 | GO:0000965 | mitochondrial RNA 3'-end processing(GO:0000965) |
0.1 | 1.0 | GO:0098926 | acetylcholine receptor signaling pathway(GO:0095500) postsynaptic signal transduction(GO:0098926) signal transduction involved in cellular response to ammonium ion(GO:1903831) response to acetylcholine(GO:1905144) cellular response to acetylcholine(GO:1905145) |
0.1 | 0.3 | GO:0015015 | heparan sulfate proteoglycan biosynthetic process, enzymatic modification(GO:0015015) |
0.1 | 0.8 | GO:0007052 | mitotic spindle organization(GO:0007052) |
0.1 | 0.4 | GO:0006878 | cellular copper ion homeostasis(GO:0006878) |
0.1 | 0.4 | GO:0016114 | terpenoid biosynthetic process(GO:0016114) |
0.1 | 0.2 | GO:0002934 | desmosome organization(GO:0002934) |
0.1 | 0.1 | GO:0006933 | negative regulation of cell adhesion involved in substrate-bound cell migration(GO:0006933) |
0.1 | 0.4 | GO:0045078 | positive regulation of interferon-gamma biosynthetic process(GO:0045078) |
0.1 | 1.0 | GO:0007031 | peroxisome organization(GO:0007031) |
0.1 | 7.7 | GO:0000209 | protein polyubiquitination(GO:0000209) |
0.1 | 0.7 | GO:0007342 | fusion of sperm to egg plasma membrane(GO:0007342) |
0.1 | 0.4 | GO:0021631 | optic nerve morphogenesis(GO:0021631) |
0.1 | 0.1 | GO:0060060 | post-embryonic retina morphogenesis in camera-type eye(GO:0060060) |
0.1 | 0.2 | GO:0045721 | negative regulation of gluconeogenesis(GO:0045721) |
0.1 | 0.1 | GO:1902630 | regulation of membrane hyperpolarization(GO:1902630) |
0.1 | 0.1 | GO:0071609 | chemokine (C-C motif) ligand 5 production(GO:0071609) |
0.1 | 1.5 | GO:0000038 | very long-chain fatty acid metabolic process(GO:0000038) |
0.1 | 0.4 | GO:0000103 | sulfate assimilation(GO:0000103) |
0.1 | 0.1 | GO:0060468 | prevention of polyspermy(GO:0060468) |
0.1 | 0.1 | GO:1902177 | positive regulation of oxidative stress-induced intrinsic apoptotic signaling pathway(GO:1902177) |
0.1 | 0.5 | GO:0009112 | nucleobase metabolic process(GO:0009112) |
0.1 | 1.4 | GO:0016180 | snRNA processing(GO:0016180) |
0.1 | 0.1 | GO:0051029 | rRNA transport(GO:0051029) |
0.1 | 0.1 | GO:0030575 | nuclear body organization(GO:0030575) |
0.1 | 0.2 | GO:2001180 | negative regulation of interleukin-10 secretion(GO:2001180) |
0.1 | 0.2 | GO:0051725 | protein de-ADP-ribosylation(GO:0051725) |
0.1 | 0.1 | GO:0043320 | natural killer cell degranulation(GO:0043320) |
0.1 | 0.3 | GO:0051123 | RNA polymerase II transcriptional preinitiation complex assembly(GO:0051123) |
0.1 | 0.1 | GO:0000491 | small nucleolar ribonucleoprotein complex assembly(GO:0000491) box C/D snoRNP assembly(GO:0000492) |
0.1 | 0.2 | GO:0036265 | RNA (guanine-N7)-methylation(GO:0036265) |
0.1 | 0.2 | GO:0030579 | ubiquitin-dependent SMAD protein catabolic process(GO:0030579) |
0.1 | 0.1 | GO:0042536 | negative regulation of tumor necrosis factor biosynthetic process(GO:0042536) |
0.1 | 0.2 | GO:0032485 | regulation of Ral protein signal transduction(GO:0032485) |
0.1 | 0.1 | GO:1902415 | regulation of mRNA binding(GO:1902415) regulation of RNA binding(GO:1905214) |
0.1 | 0.9 | GO:0040018 | positive regulation of multicellular organism growth(GO:0040018) |
0.1 | 0.1 | GO:0071763 | nuclear membrane organization(GO:0071763) |
0.1 | 0.3 | GO:0006620 | posttranslational protein targeting to membrane(GO:0006620) |
0.1 | 0.1 | GO:0051902 | negative regulation of mitochondrial depolarization(GO:0051902) |
0.1 | 0.1 | GO:0000076 | DNA replication checkpoint(GO:0000076) |
0.1 | 0.1 | GO:0005984 | disaccharide metabolic process(GO:0005984) |
0.1 | 0.1 | GO:0045079 | negative regulation of chemokine biosynthetic process(GO:0045079) |
0.1 | 0.3 | GO:0032099 | negative regulation of appetite(GO:0032099) |
0.1 | 0.2 | GO:0048023 | positive regulation of melanin biosynthetic process(GO:0048023) positive regulation of secondary metabolite biosynthetic process(GO:1900378) |
0.1 | 0.2 | GO:0060528 | secretory columnal luminar epithelial cell differentiation involved in prostate glandular acinus development(GO:0060528) |
0.1 | 0.4 | GO:0045793 | positive regulation of cell size(GO:0045793) |
0.1 | 0.2 | GO:0044857 | plasma membrane raft assembly(GO:0044854) plasma membrane raft organization(GO:0044857) caveola assembly(GO:0070836) |
0.1 | 0.1 | GO:0060398 | regulation of growth hormone receptor signaling pathway(GO:0060398) |
0.1 | 0.8 | GO:0015812 | gamma-aminobutyric acid transport(GO:0015812) |
0.1 | 0.4 | GO:0006817 | phosphate ion transport(GO:0006817) |
0.1 | 3.2 | GO:0031338 | regulation of vesicle fusion(GO:0031338) |
0.1 | 0.1 | GO:0034723 | DNA replication-dependent nucleosome assembly(GO:0006335) DNA replication-dependent nucleosome organization(GO:0034723) |
0.1 | 0.2 | GO:0032020 | ISG15-protein conjugation(GO:0032020) |
0.1 | 0.5 | GO:0018342 | protein prenylation(GO:0018342) prenylation(GO:0097354) |
0.1 | 0.1 | GO:0007567 | parturition(GO:0007567) |
0.1 | 1.3 | GO:0006637 | acyl-CoA metabolic process(GO:0006637) thioester metabolic process(GO:0035383) |
0.1 | 0.1 | GO:0002752 | cell surface pattern recognition receptor signaling pathway(GO:0002752) |
0.1 | 1.2 | GO:0048240 | sperm capacitation(GO:0048240) |
0.1 | 0.1 | GO:0009128 | purine nucleoside monophosphate catabolic process(GO:0009128) |
0.1 | 1.2 | GO:0045454 | cell redox homeostasis(GO:0045454) |
0.1 | 0.1 | GO:0034350 | regulation of glial cell apoptotic process(GO:0034350) |
0.1 | 0.2 | GO:1904059 | regulation of locomotor rhythm(GO:1904059) |
0.1 | 0.1 | GO:2000823 | regulation of androgen receptor activity(GO:2000823) |
0.1 | 0.2 | GO:0098903 | regulation of membrane repolarization during action potential(GO:0098903) |
0.1 | 0.3 | GO:0042985 | negative regulation of amyloid precursor protein biosynthetic process(GO:0042985) |
0.1 | 0.1 | GO:0030886 | negative regulation of myeloid dendritic cell activation(GO:0030886) |
0.1 | 0.1 | GO:0007228 | positive regulation of hh target transcription factor activity(GO:0007228) |
0.1 | 0.1 | GO:0090220 | telomere localization(GO:0034397) chromosome localization to nuclear envelope involved in homologous chromosome segregation(GO:0090220) |
0.1 | 0.2 | GO:0002072 | optic cup morphogenesis involved in camera-type eye development(GO:0002072) |
0.1 | 0.3 | GO:0051967 | negative regulation of synaptic transmission, glutamatergic(GO:0051967) |
0.1 | 0.1 | GO:0007135 | meiosis II(GO:0007135) |
0.1 | 0.1 | GO:0090360 | platelet-derived growth factor production(GO:0090360) regulation of platelet-derived growth factor production(GO:0090361) |
0.1 | 0.3 | GO:0071354 | cellular response to interleukin-6(GO:0071354) |
0.1 | 0.1 | GO:2000407 | regulation of T cell extravasation(GO:2000407) |
0.1 | 0.2 | GO:0086011 | membrane repolarization during action potential(GO:0086011) |
0.1 | 1.6 | GO:0000027 | ribosomal large subunit assembly(GO:0000027) |
0.1 | 0.1 | GO:1904338 | regulation of dopaminergic neuron differentiation(GO:1904338) |
0.1 | 0.1 | GO:0070295 | renal water absorption(GO:0070295) |
0.1 | 0.1 | GO:1902445 | regulation of mitochondrial membrane permeability involved in programmed necrotic cell death(GO:1902445) |
0.1 | 0.2 | GO:1903966 | monounsaturated fatty acid metabolic process(GO:1903964) monounsaturated fatty acid biosynthetic process(GO:1903966) |
0.1 | 0.3 | GO:0061099 | negative regulation of protein tyrosine kinase activity(GO:0061099) |
0.1 | 0.3 | GO:0031077 | post-embryonic camera-type eye development(GO:0031077) |
0.1 | 0.3 | GO:0045922 | negative regulation of fatty acid metabolic process(GO:0045922) |
0.1 | 0.5 | GO:0031639 | plasminogen activation(GO:0031639) |
0.1 | 0.2 | GO:0080182 | histone H3-K4 trimethylation(GO:0080182) |
0.1 | 0.7 | GO:0045047 | protein targeting to ER(GO:0045047) |
0.1 | 0.1 | GO:2000757 | negative regulation of peptidyl-lysine acetylation(GO:2000757) |
0.1 | 0.4 | GO:0071801 | regulation of podosome assembly(GO:0071801) |
0.1 | 0.1 | GO:0030263 | apoptotic chromosome condensation(GO:0030263) |
0.1 | 0.1 | GO:0003162 | atrioventricular node development(GO:0003162) |
0.1 | 0.8 | GO:0019915 | lipid storage(GO:0019915) |
0.1 | 2.9 | GO:1903955 | positive regulation of protein targeting to mitochondrion(GO:1903955) |
0.1 | 0.3 | GO:0046085 | adenosine metabolic process(GO:0046085) |
0.1 | 0.5 | GO:0008299 | isoprenoid biosynthetic process(GO:0008299) |
0.1 | 0.1 | GO:2001206 | positive regulation of osteoclast development(GO:2001206) |
0.1 | 0.1 | GO:0002125 | maternal aggressive behavior(GO:0002125) |
0.1 | 0.1 | GO:0045629 | negative regulation of T-helper 2 cell differentiation(GO:0045629) |
0.1 | 0.2 | GO:0015860 | purine nucleoside transmembrane transport(GO:0015860) purine-containing compound transmembrane transport(GO:0072530) nucleoside transmembrane transport(GO:1901642) |
0.1 | 0.1 | GO:0070831 | basement membrane assembly(GO:0070831) |
0.1 | 0.5 | GO:1990542 | mitochondrial transmembrane transport(GO:1990542) |
0.1 | 0.3 | GO:0031958 | corticosteroid receptor signaling pathway(GO:0031958) |
0.1 | 0.1 | GO:0006003 | fructose 2,6-bisphosphate metabolic process(GO:0006003) |
0.1 | 0.1 | GO:0031446 | regulation of fast-twitch skeletal muscle fiber contraction(GO:0031446) positive regulation of fast-twitch skeletal muscle fiber contraction(GO:0031448) |
0.1 | 0.2 | GO:1904406 | negative regulation of nitric oxide biosynthetic process(GO:0045019) negative regulation of nitric oxide metabolic process(GO:1904406) |
0.1 | 0.1 | GO:0042769 | DNA damage response, detection of DNA damage(GO:0042769) |
0.1 | 0.1 | GO:1901838 | regulation of transcription of nuclear large rRNA transcript from RNA polymerase I promoter(GO:1901836) positive regulation of transcription of nuclear large rRNA transcript from RNA polymerase I promoter(GO:1901838) |
0.1 | 0.2 | GO:0006438 | valyl-tRNA aminoacylation(GO:0006438) |
0.1 | 0.2 | GO:0002349 | histamine production involved in inflammatory response(GO:0002349) histamine secretion involved in inflammatory response(GO:0002441) histamine secretion by mast cell(GO:0002553) |
0.1 | 0.6 | GO:0031163 | iron-sulfur cluster assembly(GO:0016226) metallo-sulfur cluster assembly(GO:0031163) |
0.1 | 0.3 | GO:0018065 | protein-cofactor linkage(GO:0018065) |
0.1 | 0.1 | GO:0033685 | negative regulation of luteinizing hormone secretion(GO:0033685) |
0.1 | 0.1 | GO:0034454 | microtubule anchoring at centrosome(GO:0034454) |
0.1 | 1.0 | GO:0006099 | tricarboxylic acid cycle(GO:0006099) |
0.1 | 0.1 | GO:0031284 | positive regulation of guanylate cyclase activity(GO:0031284) |
0.1 | 0.3 | GO:0071318 | cellular response to ATP(GO:0071318) |
0.1 | 0.8 | GO:0001913 | T cell mediated cytotoxicity(GO:0001913) |
0.1 | 0.6 | GO:0000413 | protein peptidyl-prolyl isomerization(GO:0000413) |
0.1 | 0.8 | GO:0030866 | cortical actin cytoskeleton organization(GO:0030866) |
0.1 | 0.2 | GO:0010971 | positive regulation of G2/M transition of mitotic cell cycle(GO:0010971) |
0.1 | 0.1 | GO:0034427 | nuclear-transcribed mRNA catabolic process, exonucleolytic, 3'-5'(GO:0034427) |
0.1 | 0.1 | GO:1902237 | positive regulation of endoplasmic reticulum stress-induced intrinsic apoptotic signaling pathway(GO:1902237) |
0.1 | 0.8 | GO:0042255 | ribosome assembly(GO:0042255) |
0.1 | 0.3 | GO:0034331 | cell junction maintenance(GO:0034331) |
0.1 | 0.1 | GO:0032252 | secretory granule localization(GO:0032252) |
0.1 | 0.2 | GO:0006026 | aminoglycan catabolic process(GO:0006026) |
0.1 | 0.1 | GO:0009134 | nucleoside diphosphate catabolic process(GO:0009134) |
0.1 | 0.1 | GO:0007100 | mitotic centrosome separation(GO:0007100) regulation of mitotic centrosome separation(GO:0046602) |
0.1 | 0.2 | GO:0006264 | mitochondrial DNA replication(GO:0006264) |
0.1 | 1.6 | GO:0008654 | phospholipid biosynthetic process(GO:0008654) |
0.1 | 0.1 | GO:0035814 | negative regulation of renal sodium excretion(GO:0035814) |
0.1 | 1.6 | GO:0006418 | tRNA aminoacylation for protein translation(GO:0006418) |
0.1 | 0.2 | GO:0000479 | endonucleolytic cleavage of tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000479) |
0.1 | 1.1 | GO:0007062 | sister chromatid cohesion(GO:0007062) |
0.1 | 0.1 | GO:0006269 | DNA replication, synthesis of RNA primer(GO:0006269) |
0.1 | 0.1 | GO:1902683 | regulation of receptor localization to synapse(GO:1902683) |
0.1 | 1.8 | GO:0042274 | ribosomal small subunit biogenesis(GO:0042274) |
0.1 | 0.2 | GO:0031033 | myosin filament organization(GO:0031033) |
0.1 | 0.2 | GO:0046218 | tryptophan catabolic process(GO:0006569) tryptophan catabolic process to kynurenine(GO:0019441) indole-containing compound catabolic process(GO:0042436) indolalkylamine catabolic process(GO:0046218) |
0.1 | 0.1 | GO:0034770 | histone H4-K20 methylation(GO:0034770) |
0.1 | 0.1 | GO:0010519 | negative regulation of phospholipase activity(GO:0010519) |
0.1 | 0.6 | GO:0097150 | neuronal stem cell population maintenance(GO:0097150) |
0.1 | 0.2 | GO:0019081 | viral translation(GO:0019081) IRES-dependent viral translational initiation(GO:0075522) |
0.1 | 1.6 | GO:0007566 | embryo implantation(GO:0007566) |
0.1 | 0.2 | GO:0007296 | vitellogenesis(GO:0007296) |
0.1 | 0.8 | GO:0006687 | glycosphingolipid metabolic process(GO:0006687) |
0.1 | 0.1 | GO:1903960 | negative regulation of anion transmembrane transport(GO:1903960) |
0.1 | 0.2 | GO:0016137 | glycoside metabolic process(GO:0016137) |
0.1 | 0.4 | GO:0001731 | formation of translation preinitiation complex(GO:0001731) |
0.1 | 0.2 | GO:0050859 | negative regulation of B cell receptor signaling pathway(GO:0050859) |
0.1 | 0.1 | GO:0048625 | myoblast fate commitment(GO:0048625) |
0.1 | 0.2 | GO:0021794 | thalamus development(GO:0021794) |
0.1 | 0.5 | GO:0045947 | negative regulation of translational initiation(GO:0045947) |
0.1 | 4.3 | GO:0006457 | protein folding(GO:0006457) |
0.1 | 0.2 | GO:0051546 | keratinocyte migration(GO:0051546) |
0.1 | 0.4 | GO:0090671 | RNA localization to Cajal body(GO:0090670) telomerase RNA localization to Cajal body(GO:0090671) telomerase RNA localization(GO:0090672) |
0.1 | 0.3 | GO:1904153 | negative regulation of protein exit from endoplasmic reticulum(GO:0070862) negative regulation of retrograde protein transport, ER to cytosol(GO:1904153) |
0.1 | 0.2 | GO:2000303 | regulation of ceramide biosynthetic process(GO:2000303) |
0.1 | 0.1 | GO:0090148 | membrane fission(GO:0090148) |
0.1 | 0.1 | GO:0000963 | mitochondrial RNA processing(GO:0000963) |
0.1 | 0.3 | GO:0035455 | response to interferon-alpha(GO:0035455) |
0.1 | 0.1 | GO:0042590 | antigen processing and presentation of exogenous peptide antigen via MHC class I(GO:0042590) |
0.1 | 0.5 | GO:0048172 | regulation of short-term neuronal synaptic plasticity(GO:0048172) |
0.1 | 0.1 | GO:0036166 | phenotypic switching(GO:0036166) |
0.1 | 0.1 | GO:0033159 | negative regulation of protein import into nucleus, translocation(GO:0033159) |
0.1 | 0.4 | GO:0009148 | CTP biosynthetic process(GO:0006241) pyrimidine nucleoside triphosphate biosynthetic process(GO:0009148) pyrimidine ribonucleoside triphosphate biosynthetic process(GO:0009209) pyrimidine ribonucleotide biosynthetic process(GO:0009220) CTP metabolic process(GO:0046036) pyrimidine ribonucleoside biosynthetic process(GO:0046132) |
0.0 | 0.3 | GO:0030206 | chondroitin sulfate biosynthetic process(GO:0030206) |
0.0 | 0.1 | GO:0033169 | histone H3-K9 demethylation(GO:0033169) |
0.0 | 0.8 | GO:1902808 | positive regulation of cell cycle G1/S phase transition(GO:1902808) |
0.0 | 0.7 | GO:0033209 | tumor necrosis factor-mediated signaling pathway(GO:0033209) |
0.0 | 0.1 | GO:0002525 | acute inflammatory response to non-antigenic stimulus(GO:0002525) |
0.0 | 0.3 | GO:0048280 | vesicle fusion with Golgi apparatus(GO:0048280) |
0.0 | 0.1 | GO:0002675 | positive regulation of acute inflammatory response(GO:0002675) |
0.0 | 0.4 | GO:0019682 | pentose-phosphate shunt(GO:0006098) glyceraldehyde-3-phosphate metabolic process(GO:0019682) |
0.0 | 0.2 | GO:0006515 | misfolded or incompletely synthesized protein catabolic process(GO:0006515) |
0.0 | 0.0 | GO:0001844 | protein insertion into mitochondrial membrane involved in apoptotic signaling pathway(GO:0001844) |
0.0 | 0.2 | GO:1905097 | regulation of guanyl-nucleotide exchange factor activity(GO:1905097) |
0.0 | 0.3 | GO:0070875 | positive regulation of glycogen metabolic process(GO:0070875) |
0.0 | 0.5 | GO:0015858 | nucleoside transport(GO:0015858) |
0.0 | 0.0 | GO:0008291 | acetylcholine metabolic process(GO:0008291) acetate ester metabolic process(GO:1900619) |
0.0 | 0.0 | GO:0097694 | establishment of RNA localization to telomere(GO:0097694) |
0.0 | 0.3 | GO:0021692 | cerebellar Purkinje cell layer morphogenesis(GO:0021692) |
0.0 | 0.2 | GO:0007028 | cytoplasm organization(GO:0007028) |
0.0 | 1.9 | GO:0006633 | fatty acid biosynthetic process(GO:0006633) |
0.0 | 0.1 | GO:0030576 | Cajal body organization(GO:0030576) |
0.0 | 0.1 | GO:0008272 | sulfate transport(GO:0008272) |
0.0 | 0.1 | GO:2000286 | receptor internalization involved in canonical Wnt signaling pathway(GO:2000286) |
0.0 | 0.4 | GO:0007141 | male meiosis I(GO:0007141) |
0.0 | 0.1 | GO:1903288 | regulation of potassium ion import(GO:1903286) positive regulation of potassium ion import(GO:1903288) |
0.0 | 0.2 | GO:0046618 | drug export(GO:0046618) |
0.0 | 0.0 | GO:0010796 | regulation of multivesicular body size(GO:0010796) |
0.0 | 0.1 | GO:0001561 | fatty acid alpha-oxidation(GO:0001561) |
0.0 | 0.1 | GO:1902715 | positive regulation of interferon-gamma secretion(GO:1902715) |
0.0 | 0.5 | GO:1901998 | toxin transport(GO:1901998) |
0.0 | 0.0 | GO:0033689 | negative regulation of osteoblast proliferation(GO:0033689) |
0.0 | 0.0 | GO:0031585 | regulation of inositol 1,4,5-trisphosphate-sensitive calcium-release channel activity(GO:0031585) |
0.0 | 0.0 | GO:0034381 | plasma lipoprotein particle clearance(GO:0034381) |
0.0 | 0.5 | GO:0098927 | vesicle-mediated transport between endosomal compartments(GO:0098927) |
0.0 | 0.1 | GO:1901374 | acetylcholine transport(GO:0015870) acetate ester transport(GO:1901374) |
0.0 | 0.3 | GO:0034063 | stress granule assembly(GO:0034063) |
0.0 | 0.2 | GO:0032957 | inositol trisphosphate metabolic process(GO:0032957) |
0.0 | 0.3 | GO:0071353 | cellular response to interleukin-4(GO:0071353) |
0.0 | 0.7 | GO:0001562 | response to protozoan(GO:0001562) |
0.0 | 0.1 | GO:0021555 | midbrain-hindbrain boundary morphogenesis(GO:0021555) |
0.0 | 0.1 | GO:0048496 | maintenance of organ identity(GO:0048496) |
0.0 | 0.5 | GO:0010591 | regulation of lamellipodium assembly(GO:0010591) |
0.0 | 0.3 | GO:1902099 | regulation of mitotic metaphase/anaphase transition(GO:0030071) regulation of metaphase/anaphase transition of cell cycle(GO:1902099) |
0.0 | 0.1 | GO:0048069 | eye pigmentation(GO:0048069) |
0.0 | 0.1 | GO:2000416 | regulation of eosinophil migration(GO:2000416) positive regulation of eosinophil migration(GO:2000418) |
0.0 | 0.0 | GO:1900112 | regulation of histone H3-K9 trimethylation(GO:1900112) |
0.0 | 0.0 | GO:0006067 | ethanol metabolic process(GO:0006067) ethanol oxidation(GO:0006069) |
0.0 | 0.4 | GO:0031663 | lipopolysaccharide-mediated signaling pathway(GO:0031663) |
0.0 | 0.0 | GO:0051088 | monocyte activation(GO:0042117) PMA-inducible membrane protein ectodomain proteolysis(GO:0051088) |
0.0 | 0.1 | GO:0032607 | interferon-alpha production(GO:0032607) |
0.0 | 0.2 | GO:2000114 | regulation of establishment of cell polarity(GO:2000114) |
0.0 | 0.0 | GO:0035405 | histone-threonine phosphorylation(GO:0035405) |
0.0 | 0.3 | GO:0051567 | histone H3-K9 methylation(GO:0051567) |
0.0 | 0.0 | GO:0034729 | histone H3-K79 methylation(GO:0034729) |
0.0 | 0.1 | GO:0010587 | miRNA catabolic process(GO:0010587) |
0.0 | 0.1 | GO:0021882 | regulation of transcription from RNA polymerase II promoter involved in forebrain neuron fate commitment(GO:0021882) |
0.0 | 1.4 | GO:0006364 | rRNA processing(GO:0006364) |
0.0 | 0.3 | GO:0002251 | organ or tissue specific immune response(GO:0002251) mucosal immune response(GO:0002385) |
0.0 | 0.0 | GO:0071827 | macromolecular complex remodeling(GO:0034367) protein-lipid complex remodeling(GO:0034368) plasma lipoprotein particle remodeling(GO:0034369) plasma lipoprotein particle organization(GO:0071827) |
0.0 | 0.1 | GO:0045724 | positive regulation of cilium assembly(GO:0045724) |
0.0 | 0.1 | GO:0006221 | pyrimidine nucleotide biosynthetic process(GO:0006221) |
0.0 | 0.0 | GO:0009750 | response to fructose(GO:0009750) |
0.0 | 0.3 | GO:1902230 | negative regulation of intrinsic apoptotic signaling pathway in response to DNA damage(GO:1902230) |
0.0 | 0.0 | GO:0032471 | negative regulation of endoplasmic reticulum calcium ion concentration(GO:0032471) |
0.0 | 0.9 | GO:0030433 | ER-associated ubiquitin-dependent protein catabolic process(GO:0030433) |
0.0 | 0.2 | GO:0001779 | natural killer cell differentiation(GO:0001779) |
0.0 | 0.0 | GO:1903969 | regulation of macrophage colony-stimulating factor signaling pathway(GO:1902226) regulation of response to macrophage colony-stimulating factor(GO:1903969) regulation of cellular response to macrophage colony-stimulating factor stimulus(GO:1903972) |
0.0 | 0.4 | GO:0042273 | ribosomal large subunit biogenesis(GO:0042273) |
0.0 | 0.0 | GO:0032071 | regulation of deoxyribonuclease activity(GO:0032070) regulation of endodeoxyribonuclease activity(GO:0032071) |
0.0 | 0.1 | GO:0050655 | dermatan sulfate proteoglycan biosynthetic process(GO:0050651) dermatan sulfate proteoglycan metabolic process(GO:0050655) |
0.0 | 0.3 | GO:0000154 | rRNA modification(GO:0000154) |
0.0 | 0.3 | GO:2000480 | negative regulation of cAMP-dependent protein kinase activity(GO:2000480) |
0.0 | 0.1 | GO:0043951 | negative regulation of cAMP-mediated signaling(GO:0043951) |
0.0 | 0.1 | GO:0001510 | RNA methylation(GO:0001510) |
0.0 | 0.5 | GO:0097031 | NADH dehydrogenase complex assembly(GO:0010257) mitochondrial respiratory chain complex I assembly(GO:0032981) mitochondrial respiratory chain complex I biogenesis(GO:0097031) |
0.0 | 0.0 | GO:0009162 | deoxyribonucleoside monophosphate metabolic process(GO:0009162) |
0.0 | 0.8 | GO:0043487 | regulation of RNA stability(GO:0043487) |
0.0 | 0.1 | GO:0001920 | negative regulation of receptor recycling(GO:0001920) |
0.0 | 0.2 | GO:0009226 | nucleotide-sugar biosynthetic process(GO:0009226) |
0.0 | 1.7 | GO:0010923 | negative regulation of phosphatase activity(GO:0010923) |
0.0 | 0.1 | GO:0043457 | regulation of cellular respiration(GO:0043457) |
0.0 | 0.6 | GO:0051297 | centrosome organization(GO:0051297) |
0.0 | 0.6 | GO:0010107 | potassium ion import(GO:0010107) |
0.0 | 0.7 | GO:0006119 | oxidative phosphorylation(GO:0006119) |
0.0 | 0.4 | GO:0050829 | defense response to Gram-negative bacterium(GO:0050829) |
0.0 | 0.0 | GO:0000715 | nucleotide-excision repair, DNA damage recognition(GO:0000715) |
0.0 | 0.0 | GO:0002036 | regulation of L-glutamate transport(GO:0002036) |
0.0 | 0.0 | GO:0002282 | microglial cell activation involved in immune response(GO:0002282) |
0.0 | 0.1 | GO:1902229 | regulation of intrinsic apoptotic signaling pathway in response to DNA damage(GO:1902229) |
0.0 | 0.2 | GO:0002827 | positive regulation of T-helper 1 type immune response(GO:0002827) |
0.0 | 0.1 | GO:0016480 | negative regulation of transcription from RNA polymerase III promoter(GO:0016480) |
0.0 | 0.0 | GO:0009838 | abscission(GO:0009838) |
0.0 | 0.0 | GO:0048313 | Golgi inheritance(GO:0048313) |
0.0 | 0.1 | GO:0045759 | negative regulation of action potential(GO:0045759) |
0.0 | 0.1 | GO:1900165 | negative regulation of interleukin-6 secretion(GO:1900165) |
0.0 | 0.0 | GO:0030330 | DNA damage response, signal transduction by p53 class mediator(GO:0030330) |
0.0 | 0.0 | GO:2000359 | regulation of binding of sperm to zona pellucida(GO:2000359) |
0.0 | 0.4 | GO:0031146 | SCF-dependent proteasomal ubiquitin-dependent protein catabolic process(GO:0031146) |
0.0 | 0.1 | GO:2000354 | regulation of ovarian follicle development(GO:2000354) |
0.0 | 0.0 | GO:0008300 | isoprenoid catabolic process(GO:0008300) |
0.0 | 0.1 | GO:0045579 | positive regulation of B cell differentiation(GO:0045579) |
0.0 | 0.6 | GO:0006638 | neutral lipid metabolic process(GO:0006638) |
0.0 | 0.1 | GO:0070059 | intrinsic apoptotic signaling pathway in response to endoplasmic reticulum stress(GO:0070059) |
0.0 | 0.1 | GO:0016072 | rRNA metabolic process(GO:0016072) |
0.0 | 0.2 | GO:0002031 | G-protein coupled receptor internalization(GO:0002031) |
0.0 | 0.4 | GO:0051602 | response to electrical stimulus(GO:0051602) |
0.0 | 0.1 | GO:0009642 | response to light intensity(GO:0009642) |
0.0 | 0.6 | GO:0015988 | energy coupled proton transmembrane transport, against electrochemical gradient(GO:0015988) ATP hydrolysis coupled proton transport(GO:0015991) ATP hydrolysis coupled transmembrane transport(GO:0090662) |
0.0 | 0.1 | GO:0031642 | negative regulation of myelination(GO:0031642) |
0.0 | 0.1 | GO:0001302 | replicative cell aging(GO:0001302) |
0.0 | 0.0 | GO:0045588 | positive regulation of gamma-delta T cell differentiation(GO:0045588) positive regulation of gamma-delta T cell activation(GO:0046645) |
0.0 | 0.2 | GO:0033013 | tetrapyrrole metabolic process(GO:0033013) |
0.0 | 0.2 | GO:0010668 | ectodermal cell differentiation(GO:0010668) |
0.0 | 0.5 | GO:0015986 | energy coupled proton transport, down electrochemical gradient(GO:0015985) ATP synthesis coupled proton transport(GO:0015986) |
0.0 | 0.2 | GO:0045815 | positive regulation of gene expression, epigenetic(GO:0045815) |
0.0 | 0.2 | GO:0042572 | retinol metabolic process(GO:0042572) |
0.0 | 0.0 | GO:0055070 | copper ion homeostasis(GO:0055070) |
0.0 | 0.0 | GO:2000698 | positive regulation of epithelial cell differentiation involved in kidney development(GO:2000698) |
0.0 | 1.4 | GO:0010212 | response to ionizing radiation(GO:0010212) |
0.0 | 0.2 | GO:0042104 | positive regulation of activated T cell proliferation(GO:0042104) |
0.0 | 0.1 | GO:0030578 | PML body organization(GO:0030578) |
0.0 | 0.6 | GO:0032465 | regulation of cytokinesis(GO:0032465) |
0.0 | 0.0 | GO:0045347 | negative regulation of MHC class II biosynthetic process(GO:0045347) |
0.0 | 0.2 | GO:0006013 | mannose metabolic process(GO:0006013) |
0.0 | 0.2 | GO:0061000 | negative regulation of dendritic spine development(GO:0061000) |
0.0 | 0.1 | GO:1990845 | diet induced thermogenesis(GO:0002024) adaptive thermogenesis(GO:1990845) |
0.0 | 6.7 | GO:0006397 | mRNA processing(GO:0006397) |
0.0 | 0.7 | GO:0044839 | cell cycle G2/M phase transition(GO:0044839) |
0.0 | 0.1 | GO:0017183 | peptidyl-diphthamide metabolic process(GO:0017182) peptidyl-diphthamide biosynthetic process from peptidyl-histidine(GO:0017183) |
0.0 | 0.0 | GO:0061009 | common bile duct development(GO:0061009) |
0.0 | 0.0 | GO:1901873 | regulation of post-translational protein modification(GO:1901873) negative regulation of post-translational protein modification(GO:1901874) |
0.0 | 0.1 | GO:0031123 | RNA 3'-end processing(GO:0031123) |
0.0 | 0.0 | GO:1901988 | negative regulation of cell cycle phase transition(GO:1901988) |
0.0 | 0.0 | GO:0032481 | positive regulation of type I interferon production(GO:0032481) |
0.0 | 0.0 | GO:0032377 | regulation of intracellular lipid transport(GO:0032377) regulation of intracellular sterol transport(GO:0032380) regulation of intracellular cholesterol transport(GO:0032383) |
0.0 | 2.1 | GO:0043161 | proteasome-mediated ubiquitin-dependent protein catabolic process(GO:0043161) |
0.0 | 0.1 | GO:0043011 | myeloid dendritic cell differentiation(GO:0043011) |
0.0 | 0.1 | GO:0071895 | odontoblast differentiation(GO:0071895) |
0.0 | 0.1 | GO:0007060 | male meiosis chromosome segregation(GO:0007060) |
0.0 | 0.0 | GO:0044340 | canonical Wnt signaling pathway involved in regulation of cell proliferation(GO:0044340) |
0.0 | 0.0 | GO:0097066 | response to thyroid hormone(GO:0097066) |
0.0 | 0.0 | GO:0051024 | positive regulation of immunoglobulin secretion(GO:0051024) |
0.0 | 0.4 | GO:0017144 | drug metabolic process(GO:0017144) |
0.0 | 0.2 | GO:0050884 | neuromuscular process controlling posture(GO:0050884) |
0.0 | 0.1 | GO:0021578 | hindbrain maturation(GO:0021578) pons maturation(GO:0021586) central nervous system maturation(GO:0021626) |
0.0 | 0.0 | GO:0042746 | regulation of circadian sleep/wake cycle, wakefulness(GO:0010840) positive regulation of circadian sleep/wake cycle, wakefulness(GO:0010841) circadian sleep/wake cycle, wakefulness(GO:0042746) |
0.0 | 0.1 | GO:0001893 | maternal placenta development(GO:0001893) |
0.0 | 0.2 | GO:0051798 | positive regulation of hair cycle(GO:0042635) positive regulation of hair follicle development(GO:0051798) |
0.0 | 0.8 | GO:0050830 | defense response to Gram-positive bacterium(GO:0050830) |
0.0 | 0.0 | GO:0070309 | lens fiber cell morphogenesis(GO:0070309) |
0.0 | 0.0 | GO:0070293 | renal absorption(GO:0070293) |
0.0 | 0.1 | GO:0021535 | cell migration in hindbrain(GO:0021535) |
0.0 | 0.1 | GO:0016264 | gap junction assembly(GO:0016264) |
0.0 | 0.0 | GO:0035562 | negative regulation of chromatin binding(GO:0035562) |
0.0 | 0.8 | GO:0000910 | cytokinesis(GO:0000910) |
0.0 | 0.1 | GO:0046950 | cellular ketone body metabolic process(GO:0046950) |
0.0 | 0.1 | GO:0048227 | plasma membrane to endosome transport(GO:0048227) |
0.0 | 0.0 | GO:0007039 | protein catabolic process in the vacuole(GO:0007039) |
0.0 | 0.4 | GO:0006446 | regulation of translational initiation(GO:0006446) |
0.0 | 0.0 | GO:1902202 | regulation of hepatocyte growth factor receptor signaling pathway(GO:1902202) |
0.0 | 0.1 | GO:0050861 | positive regulation of B cell receptor signaling pathway(GO:0050861) |
0.0 | 0.1 | GO:0033136 | serine phosphorylation of STAT3 protein(GO:0033136) |
0.0 | 0.1 | GO:0033599 | regulation of mammary gland epithelial cell proliferation(GO:0033599) |
0.0 | 0.1 | GO:0006532 | aspartate biosynthetic process(GO:0006532) |
0.0 | 0.1 | GO:1903312 | negative regulation of mRNA metabolic process(GO:1903312) |
0.0 | 0.5 | GO:0018345 | protein palmitoylation(GO:0018345) |
0.0 | 0.2 | GO:0007130 | synaptonemal complex assembly(GO:0007130) |
0.0 | 0.2 | GO:0010324 | membrane invagination(GO:0010324) |
0.0 | 0.1 | GO:0070318 | positive regulation of G0 to G1 transition(GO:0070318) |
0.0 | 0.0 | GO:0051306 | mitotic sister chromatid separation(GO:0051306) |
0.0 | 0.0 | GO:0051181 | cofactor transport(GO:0051181) |
0.0 | 0.1 | GO:0035751 | regulation of lysosomal lumen pH(GO:0035751) |
0.0 | 0.1 | GO:0060054 | positive regulation of epithelial cell proliferation involved in wound healing(GO:0060054) |
0.0 | 0.1 | GO:2000780 | negative regulation of double-strand break repair(GO:2000780) |
0.0 | 0.1 | GO:0060124 | positive regulation of growth hormone secretion(GO:0060124) |
0.0 | 0.1 | GO:0072673 | lamellipodium morphogenesis(GO:0072673) |
0.0 | 0.0 | GO:0033031 | positive regulation of neutrophil apoptotic process(GO:0033031) |
0.0 | 0.2 | GO:0061436 | establishment of skin barrier(GO:0061436) |
0.0 | 0.0 | GO:0086023 | adrenergic receptor signaling pathway involved in heart process(GO:0086023) |
0.0 | 0.0 | GO:0061144 | alveolar secondary septum development(GO:0061144) |
0.0 | 0.1 | GO:0021680 | cerebellar Purkinje cell layer development(GO:0021680) |
0.0 | 0.2 | GO:0098719 | sodium ion import across plasma membrane(GO:0098719) sodium ion import into cell(GO:1990118) |
0.0 | 0.0 | GO:2000465 | regulation of glycogen (starch) synthase activity(GO:2000465) |
0.0 | 0.2 | GO:0048535 | lymph node development(GO:0048535) |
0.0 | 0.1 | GO:0099515 | actin filament-based transport(GO:0099515) |
0.0 | 0.0 | GO:0060100 | positive regulation of phagocytosis, engulfment(GO:0060100) positive regulation of membrane invagination(GO:1905155) |
0.0 | 0.2 | GO:0009060 | aerobic respiration(GO:0009060) |
0.0 | 0.1 | GO:1902474 | positive regulation of protein localization to synapse(GO:1902474) |
0.0 | 0.1 | GO:1901800 | positive regulation of proteasomal protein catabolic process(GO:1901800) |
0.0 | 0.0 | GO:0042508 | tyrosine phosphorylation of Stat1 protein(GO:0042508) |
0.0 | 0.0 | GO:0043517 | positive regulation of DNA damage response, signal transduction by p53 class mediator(GO:0043517) |
0.0 | 0.6 | GO:0006890 | retrograde vesicle-mediated transport, Golgi to ER(GO:0006890) |
0.0 | 0.0 | GO:0090315 | negative regulation of protein targeting to membrane(GO:0090315) |
0.0 | 0.0 | GO:2000383 | regulation of ectoderm development(GO:2000383) negative regulation of ectoderm development(GO:2000384) |
0.0 | 0.1 | GO:1901386 | negative regulation of voltage-gated calcium channel activity(GO:1901386) |
0.0 | 0.1 | GO:0035279 | mRNA cleavage involved in gene silencing by miRNA(GO:0035279) mRNA cleavage involved in gene silencing(GO:0098795) |
0.0 | 0.0 | GO:0043137 | DNA replication, Okazaki fragment processing(GO:0033567) DNA replication, removal of RNA primer(GO:0043137) |
0.0 | 0.1 | GO:0000711 | meiotic DNA repair synthesis(GO:0000711) |
0.0 | 0.1 | GO:0045838 | positive regulation of membrane potential(GO:0045838) |
0.0 | 0.0 | GO:1901029 | negative regulation of mitochondrial outer membrane permeabilization involved in apoptotic signaling pathway(GO:1901029) |
0.0 | 0.0 | GO:0090656 | t-circle formation(GO:0090656) |
0.0 | 0.1 | GO:0042036 | negative regulation of cytokine biosynthetic process(GO:0042036) |
0.0 | 0.0 | GO:0090201 | negative regulation of release of cytochrome c from mitochondria(GO:0090201) |
0.0 | 0.1 | GO:0001960 | negative regulation of cytokine-mediated signaling pathway(GO:0001960) |
0.0 | 0.3 | GO:0034314 | Arp2/3 complex-mediated actin nucleation(GO:0034314) |
0.0 | 0.5 | GO:0030641 | regulation of cellular pH(GO:0030641) |
0.0 | 0.0 | GO:0070459 | prolactin secretion(GO:0070459) |
0.0 | 0.1 | GO:0032106 | positive regulation of response to extracellular stimulus(GO:0032106) positive regulation of response to nutrient levels(GO:0032109) |
0.0 | 0.0 | GO:0046337 | phosphatidylcholine catabolic process(GO:0034638) phosphatidylethanolamine metabolic process(GO:0046337) |
0.0 | 0.0 | GO:0018879 | biphenyl metabolic process(GO:0018879) |
0.0 | 0.1 | GO:0038094 | Fc-gamma receptor signaling pathway(GO:0038094) |
0.0 | 0.0 | GO:0021681 | cerebellar granular layer development(GO:0021681) |
0.0 | 0.0 | GO:0006662 | glycerol ether metabolic process(GO:0006662) ether metabolic process(GO:0018904) ether lipid metabolic process(GO:0046485) |
0.0 | 0.0 | GO:0045060 | negative thymic T cell selection(GO:0045060) |
0.0 | 0.6 | GO:0031424 | keratinization(GO:0031424) |
0.0 | 0.0 | GO:0046641 | positive regulation of alpha-beta T cell proliferation(GO:0046641) |
0.0 | 0.1 | GO:0060693 | regulation of branching involved in salivary gland morphogenesis(GO:0060693) |
0.0 | 0.0 | GO:0048845 | venous blood vessel morphogenesis(GO:0048845) |
0.0 | 0.0 | GO:1904467 | regulation of tumor necrosis factor secretion(GO:1904467) tumor necrosis factor secretion(GO:1990774) |
0.0 | 0.0 | GO:1901317 | regulation of sperm motility(GO:1901317) |
0.0 | 0.1 | GO:0036035 | osteoclast development(GO:0036035) |
0.0 | 0.0 | GO:0042226 | interleukin-6 biosynthetic process(GO:0042226) |
0.0 | 0.3 | GO:2000249 | regulation of actin cytoskeleton reorganization(GO:2000249) |
0.0 | 0.0 | GO:1903587 | regulation of blood vessel endothelial cell proliferation involved in sprouting angiogenesis(GO:1903587) |
0.0 | 0.2 | GO:1901264 | carbohydrate derivative transport(GO:1901264) |
0.0 | 0.2 | GO:0002093 | auditory receptor cell morphogenesis(GO:0002093) |
0.0 | 0.0 | GO:0035493 | SNARE complex assembly(GO:0035493) |
0.0 | 0.1 | GO:0015747 | urate transport(GO:0015747) |
0.0 | 0.1 | GO:0048312 | intracellular distribution of mitochondria(GO:0048312) |
0.0 | 0.0 | GO:2000209 | regulation of anoikis(GO:2000209) |
0.0 | 0.1 | GO:0072675 | osteoclast fusion(GO:0072675) |
0.0 | 0.1 | GO:0019886 | antigen processing and presentation of exogenous peptide antigen via MHC class II(GO:0019886) |
0.0 | 0.1 | GO:0009629 | response to gravity(GO:0009629) |
0.0 | 0.1 | GO:0010990 | regulation of SMAD protein complex assembly(GO:0010990) negative regulation of SMAD protein complex assembly(GO:0010991) |
0.0 | 0.1 | GO:0006995 | cellular response to nitrogen starvation(GO:0006995) cellular response to nitrogen levels(GO:0043562) |
0.0 | 0.1 | GO:0090527 | actin filament reorganization(GO:0090527) |
0.0 | 0.2 | GO:0060972 | left/right pattern formation(GO:0060972) |
0.0 | 0.2 | GO:0034505 | tooth mineralization(GO:0034505) |
0.0 | 0.2 | GO:0070207 | protein homotrimerization(GO:0070207) |
0.0 | 0.0 | GO:2000561 | regulation of CD4-positive, alpha-beta T cell proliferation(GO:2000561) |
0.0 | 0.1 | GO:0006572 | tyrosine catabolic process(GO:0006572) |
0.0 | 0.1 | GO:1904355 | positive regulation of telomere capping(GO:1904355) |
0.0 | 0.0 | GO:0035092 | sperm chromatin condensation(GO:0035092) |
0.0 | 0.0 | GO:0031052 | programmed DNA elimination(GO:0031049) chromosome breakage(GO:0031052) |
0.0 | 0.1 | GO:0071514 | genetic imprinting(GO:0071514) |
0.0 | 0.1 | GO:0071577 | zinc II ion transmembrane transport(GO:0071577) |
0.0 | 0.1 | GO:0006561 | proline biosynthetic process(GO:0006561) |
0.0 | 2.1 | GO:0019236 | response to pheromone(GO:0019236) |
0.0 | 0.1 | GO:0046835 | carbohydrate phosphorylation(GO:0046835) |
0.0 | 0.0 | GO:0008635 | activation of cysteine-type endopeptidase activity involved in apoptotic process by cytochrome c(GO:0008635) |
0.0 | 0.1 | GO:0006450 | regulation of translational fidelity(GO:0006450) |
0.0 | 0.0 | GO:0006296 | nucleotide-excision repair, DNA incision, 5'-to lesion(GO:0006296) |
0.0 | 0.0 | GO:0070086 | ubiquitin-dependent endocytosis(GO:0070086) |
0.0 | 0.1 | GO:0002023 | reduction of food intake in response to dietary excess(GO:0002023) |
0.0 | 0.0 | GO:0002291 | T cell activation via T cell receptor contact with antigen bound to MHC molecule on antigen presenting cell(GO:0002291) |
0.0 | 0.3 | GO:0050873 | brown fat cell differentiation(GO:0050873) |
0.0 | 0.2 | GO:0032525 | somite rostral/caudal axis specification(GO:0032525) |
0.0 | 0.2 | GO:0019835 | cytolysis(GO:0019835) |
0.0 | 0.1 | GO:0045143 | homologous chromosome segregation(GO:0045143) |
0.0 | 0.0 | GO:0002584 | negative regulation of antigen processing and presentation of peptide antigen(GO:0002584) |
0.0 | 0.1 | GO:0070126 | mitochondrial translational termination(GO:0070126) |
0.0 | 0.0 | GO:0032025 | response to cobalt ion(GO:0032025) |
0.0 | 0.0 | GO:0035933 | glucocorticoid secretion(GO:0035933) regulation of glucocorticoid secretion(GO:2000849) |
0.0 | 0.1 | GO:0032986 | nucleosome disassembly(GO:0006337) chromatin disassembly(GO:0031498) protein-DNA complex disassembly(GO:0032986) |
0.0 | 0.0 | GO:2001268 | negative regulation of cysteine-type endopeptidase activity involved in apoptotic signaling pathway(GO:2001268) |
0.0 | 0.0 | GO:0006741 | NADP biosynthetic process(GO:0006741) |
0.0 | 0.0 | GO:0035627 | ceramide transport(GO:0035627) |
0.0 | 0.0 | GO:0006553 | lysine metabolic process(GO:0006553) |
0.0 | 0.0 | GO:2000344 | positive regulation of acrosome reaction(GO:2000344) |
0.0 | 0.2 | GO:0050901 | leukocyte tethering or rolling(GO:0050901) |
0.0 | 0.0 | GO:0035963 | response to interleukin-13(GO:0035962) cellular response to interleukin-13(GO:0035963) |
0.0 | 0.0 | GO:1904742 | regulation of telomeric DNA binding(GO:1904742) |
0.0 | 0.0 | GO:0000733 | DNA strand renaturation(GO:0000733) |
0.0 | 0.3 | GO:0007040 | lysosome organization(GO:0007040) lytic vacuole organization(GO:0080171) |
0.0 | 0.0 | GO:0006566 | threonine metabolic process(GO:0006566) |
0.0 | 0.0 | GO:0001951 | intestinal D-glucose absorption(GO:0001951) |
0.0 | 0.1 | GO:0060575 | intestinal epithelial cell differentiation(GO:0060575) |
0.0 | 0.0 | GO:0060214 | endocardium formation(GO:0060214) |
0.0 | 0.0 | GO:1902969 | mitotic DNA replication(GO:1902969) |
0.0 | 0.0 | GO:0006517 | protein deglycosylation(GO:0006517) |
0.0 | 0.2 | GO:0015804 | neutral amino acid transport(GO:0015804) |
0.0 | 0.0 | GO:2000196 | positive regulation of female gonad development(GO:2000196) |
0.0 | 0.1 | GO:1990182 | exosomal secretion(GO:1990182) |
0.0 | 0.1 | GO:0060044 | negative regulation of cardiac muscle cell proliferation(GO:0060044) |
0.0 | 0.0 | GO:0060267 | positive regulation of respiratory burst(GO:0060267) |
0.0 | 0.5 | GO:0072376 | protein activation cascade(GO:0072376) |
0.0 | 0.0 | GO:0071635 | negative regulation of transforming growth factor beta production(GO:0071635) |
0.0 | 0.3 | GO:0010501 | RNA secondary structure unwinding(GO:0010501) |
0.0 | 0.0 | GO:1902221 | L-phenylalanine metabolic process(GO:0006558) erythrose 4-phosphate/phosphoenolpyruvate family amino acid metabolic process(GO:1902221) |
0.0 | 0.0 | GO:0050862 | positive regulation of T cell receptor signaling pathway(GO:0050862) |
0.0 | 0.1 | GO:0035458 | cellular response to interferon-beta(GO:0035458) |
0.0 | 0.0 | GO:0030889 | negative regulation of B cell proliferation(GO:0030889) |
0.0 | 0.1 | GO:1901741 | regulation of myoblast fusion(GO:1901739) positive regulation of myoblast fusion(GO:1901741) |
0.0 | 0.0 | GO:0050869 | negative regulation of B cell activation(GO:0050869) |
0.0 | 0.2 | GO:0070098 | chemokine-mediated signaling pathway(GO:0070098) |
0.0 | 0.0 | GO:0002949 | tRNA threonylcarbamoyladenosine modification(GO:0002949) |
0.0 | 0.0 | GO:0033615 | mitochondrial proton-transporting ATP synthase complex assembly(GO:0033615) |
0.0 | 0.0 | GO:1902302 | potassium ion export across plasma membrane(GO:0097623) regulation of potassium ion export(GO:1902302) |
0.0 | 0.1 | GO:0045824 | negative regulation of innate immune response(GO:0045824) |
0.0 | 0.1 | GO:0090022 | regulation of neutrophil chemotaxis(GO:0090022) |
0.0 | 0.0 | GO:1900226 | negative regulation of NLRP3 inflammasome complex assembly(GO:1900226) |
0.0 | 0.0 | GO:0019372 | lipoxygenase pathway(GO:0019372) |
0.0 | 0.0 | GO:0034501 | protein localization to kinetochore(GO:0034501) |
0.0 | 0.1 | GO:0009301 | snRNA transcription(GO:0009301) |
0.0 | 0.1 | GO:0061097 | regulation of protein tyrosine kinase activity(GO:0061097) |
0.0 | 0.1 | GO:0009312 | oligosaccharide biosynthetic process(GO:0009312) |
0.0 | 0.2 | GO:0006491 | N-glycan processing(GO:0006491) |
0.0 | 0.0 | GO:0051541 | elastin metabolic process(GO:0051541) |
0.0 | 0.1 | GO:0018317 | protein C-linked glycosylation(GO:0018103) peptidyl-tryptophan modification(GO:0018211) protein C-linked glycosylation via tryptophan(GO:0018317) protein C-linked glycosylation via 2'-alpha-mannosyl-L-tryptophan(GO:0018406) |
0.0 | 0.1 | GO:0032098 | regulation of appetite(GO:0032098) |
0.0 | 0.1 | GO:0006020 | inositol metabolic process(GO:0006020) |
0.0 | 0.0 | GO:0002017 | regulation of blood volume by renal aldosterone(GO:0002017) |
0.0 | 0.0 | GO:0039702 | viral budding via host ESCRT complex(GO:0039702) |
0.0 | 0.2 | GO:1902806 | regulation of cell cycle G1/S phase transition(GO:1902806) |
0.0 | 0.0 | GO:0043031 | negative regulation of macrophage activation(GO:0043031) |
0.0 | 0.1 | GO:0043044 | ATP-dependent chromatin remodeling(GO:0043044) |
0.0 | 0.1 | GO:1903352 | ornithine transport(GO:0015822) L-ornithine transmembrane transport(GO:1903352) |
0.0 | 0.3 | GO:0071356 | cellular response to tumor necrosis factor(GO:0071356) |
0.0 | 0.0 | GO:0006505 | GPI anchor metabolic process(GO:0006505) |
0.0 | 0.1 | GO:0098734 | protein depalmitoylation(GO:0002084) macromolecule depalmitoylation(GO:0098734) |
0.0 | 0.1 | GO:0002347 | response to tumor cell(GO:0002347) |
0.0 | 0.0 | GO:0001865 | NK T cell differentiation(GO:0001865) |
0.0 | 0.1 | GO:0022011 | myelination in peripheral nervous system(GO:0022011) peripheral nervous system axon ensheathment(GO:0032292) |
0.0 | 0.2 | GO:0042462 | eye photoreceptor cell development(GO:0042462) |
0.0 | 0.0 | GO:0060732 | positive regulation of inositol phosphate biosynthetic process(GO:0060732) |
0.0 | 0.0 | GO:0072348 | sulfur compound transport(GO:0072348) |
0.0 | 0.0 | GO:0032227 | negative regulation of synaptic transmission, dopaminergic(GO:0032227) |
0.0 | 0.0 | GO:2000060 | positive regulation of protein ubiquitination involved in ubiquitin-dependent protein catabolic process(GO:2000060) |
0.0 | 0.1 | GO:0035278 | miRNA mediated inhibition of translation(GO:0035278) |
0.0 | 0.0 | GO:0033033 | negative regulation of myeloid cell apoptotic process(GO:0033033) |
0.0 | 0.0 | GO:0032815 | negative regulation of natural killer cell activation(GO:0032815) |
0.0 | 0.0 | GO:1901533 | negative regulation of hematopoietic progenitor cell differentiation(GO:1901533) |
0.0 | 0.3 | GO:0043433 | negative regulation of sequence-specific DNA binding transcription factor activity(GO:0043433) |
0.0 | 0.0 | GO:0048241 | epinephrine transport(GO:0048241) |
0.0 | 0.0 | GO:0000722 | telomere maintenance via recombination(GO:0000722) |
0.0 | 0.1 | GO:0033235 | positive regulation of protein sumoylation(GO:0033235) |
0.0 | 0.1 | GO:0009072 | aromatic amino acid family metabolic process(GO:0009072) |
0.0 | 0.0 | GO:2000195 | negative regulation of female gonad development(GO:2000195) |
0.0 | 0.0 | GO:0007000 | nucleolus organization(GO:0007000) |
0.0 | 0.0 | GO:0070431 | nucleotide-binding oligomerization domain containing signaling pathway(GO:0070423) nucleotide-binding oligomerization domain containing 2 signaling pathway(GO:0070431) |
0.0 | 0.0 | GO:0021523 | somatic motor neuron differentiation(GO:0021523) |
0.0 | 0.0 | GO:0060052 | neurofilament cytoskeleton organization(GO:0060052) |
0.0 | 0.0 | GO:0006983 | ER overload response(GO:0006983) |
0.0 | 0.1 | GO:0050908 | detection of light stimulus involved in visual perception(GO:0050908) detection of light stimulus involved in sensory perception(GO:0050962) |
0.0 | 0.1 | GO:0009595 | detection of biotic stimulus(GO:0009595) |
0.0 | 0.0 | GO:0006273 | lagging strand elongation(GO:0006273) |
0.0 | 0.0 | GO:0071799 | response to prostaglandin D(GO:0071798) cellular response to prostaglandin D stimulus(GO:0071799) |
0.0 | 0.0 | GO:0045063 | T-helper 1 cell differentiation(GO:0045063) |
0.0 | 0.0 | GO:0007199 | G-protein coupled receptor signaling pathway coupled to cGMP nucleotide second messenger(GO:0007199) |
0.0 | 0.0 | GO:0070345 | negative regulation of fat cell proliferation(GO:0070345) |
0.0 | 0.0 | GO:0002361 | CD4-positive, CD25-positive, alpha-beta regulatory T cell differentiation(GO:0002361) |
0.0 | 0.1 | GO:0006879 | cellular iron ion homeostasis(GO:0006879) |
0.0 | 0.3 | GO:0009062 | fatty acid catabolic process(GO:0009062) |
0.0 | 0.0 | GO:0060120 | auditory receptor cell fate commitment(GO:0009912) inner ear receptor cell fate commitment(GO:0060120) |
0.0 | 0.0 | GO:0070305 | response to cGMP(GO:0070305) |
0.0 | 0.0 | GO:0006729 | tetrahydrobiopterin biosynthetic process(GO:0006729) |
0.0 | 0.0 | GO:0060075 | regulation of resting membrane potential(GO:0060075) |
0.0 | 0.0 | GO:0070863 | positive regulation of protein exit from endoplasmic reticulum(GO:0070863) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
1.2 | 7.0 | GO:0014731 | spectrin-associated cytoskeleton(GO:0014731) |
1.0 | 3.0 | GO:0005971 | ribonucleoside-diphosphate reductase complex(GO:0005971) |
0.8 | 2.4 | GO:0030981 | cortical microtubule cytoskeleton(GO:0030981) |
0.8 | 3.2 | GO:0036449 | microtubule minus-end(GO:0036449) |
0.8 | 2.4 | GO:1990761 | growth cone lamellipodium(GO:1990761) |
0.7 | 2.2 | GO:0097418 | neurofibrillary tangle(GO:0097418) |
0.6 | 3.8 | GO:0070937 | CRD-mediated mRNA stability complex(GO:0070937) |
0.6 | 0.6 | GO:0097512 | cardiac myofibril(GO:0097512) |
0.6 | 1.9 | GO:0008091 | spectrin(GO:0008091) |
0.6 | 2.5 | GO:0005955 | calcineurin complex(GO:0005955) |
0.6 | 1.8 | GO:0042719 | mitochondrial intermembrane space protein transporter complex(GO:0042719) |
0.6 | 2.8 | GO:0000235 | astral microtubule(GO:0000235) |
0.5 | 2.6 | GO:1990712 | HFE-transferrin receptor complex(GO:1990712) |
0.5 | 2.1 | GO:0030689 | Noc complex(GO:0030689) |
0.5 | 3.1 | GO:0071986 | Ragulator complex(GO:0071986) |
0.5 | 5.4 | GO:0030061 | mitochondrial crista(GO:0030061) |
0.5 | 3.9 | GO:0005775 | vacuolar lumen(GO:0005775) |
0.5 | 1.9 | GO:0071141 | SMAD protein complex(GO:0071141) |
0.5 | 1.4 | GO:0097057 | TRAF2-GSTP1 complex(GO:0097057) |
0.5 | 4.3 | GO:0008385 | IkappaB kinase complex(GO:0008385) |
0.4 | 2.2 | GO:0016461 | unconventional myosin complex(GO:0016461) |
0.4 | 1.3 | GO:0032127 | dense core granule membrane(GO:0032127) |
0.4 | 6.5 | GO:0030014 | CCR4-NOT complex(GO:0030014) |
0.4 | 1.7 | GO:0005828 | kinetochore microtubule(GO:0005828) |
0.4 | 1.7 | GO:0000942 | condensed nuclear chromosome outer kinetochore(GO:0000942) |
0.4 | 0.8 | GO:0000835 | ER ubiquitin ligase complex(GO:0000835) Hrd1p ubiquitin ligase complex(GO:0000836) |
0.4 | 0.8 | GO:0030132 | clathrin coat of coated pit(GO:0030132) |
0.4 | 3.0 | GO:0000506 | glycosylphosphatidylinositol-N-acetylglucosaminyltransferase (GPI-GnT) complex(GO:0000506) |
0.4 | 3.8 | GO:0036513 | Derlin-1 retrotranslocation complex(GO:0036513) |
0.4 | 1.8 | GO:0044613 | nuclear pore central transport channel(GO:0044613) |
0.4 | 1.4 | GO:0033269 | internode region of axon(GO:0033269) |
0.4 | 2.1 | GO:0001940 | male pronucleus(GO:0001940) |
0.4 | 1.8 | GO:0042406 | extrinsic component of endoplasmic reticulum membrane(GO:0042406) |
0.3 | 1.0 | GO:0016939 | kinesin II complex(GO:0016939) |
0.3 | 0.7 | GO:1990597 | AIP1-IRE1 complex(GO:1990597) |
0.3 | 8.1 | GO:0034451 | centriolar satellite(GO:0034451) |
0.3 | 1.3 | GO:1990130 | Iml1 complex(GO:1990130) |
0.3 | 1.6 | GO:0044294 | dendritic growth cone(GO:0044294) |
0.3 | 0.9 | GO:0097629 | extrinsic component of omegasome membrane(GO:0097629) |
0.3 | 0.9 | GO:0031092 | platelet alpha granule membrane(GO:0031092) |
0.3 | 2.1 | GO:0071014 | post-mRNA release spliceosomal complex(GO:0071014) |
0.3 | 1.5 | GO:0031838 | haptoglobin-hemoglobin complex(GO:0031838) |
0.3 | 1.2 | GO:0034363 | intermediate-density lipoprotein particle(GO:0034363) |
0.3 | 0.9 | GO:0036194 | muscle cell projection(GO:0036194) muscle cell projection membrane(GO:0036195) |
0.3 | 0.9 | GO:0032299 | ribonuclease H2 complex(GO:0032299) |
0.3 | 2.7 | GO:0005869 | dynactin complex(GO:0005869) |
0.3 | 1.5 | GO:0033588 | Elongator holoenzyme complex(GO:0033588) |
0.3 | 1.5 | GO:0034388 | Pwp2p-containing subcomplex of 90S preribosome(GO:0034388) |
0.3 | 1.5 | GO:0001651 | dense fibrillar component(GO:0001651) |
0.3 | 4.3 | GO:0000421 | autophagosome membrane(GO:0000421) |
0.3 | 1.1 | GO:0034366 | spherical high-density lipoprotein particle(GO:0034366) |
0.3 | 2.2 | GO:0019773 | proteasome core complex, alpha-subunit complex(GO:0019773) |
0.3 | 3.3 | GO:0042581 | specific granule(GO:0042581) |
0.3 | 4.0 | GO:0070971 | endoplasmic reticulum exit site(GO:0070971) |
0.3 | 0.3 | GO:0070938 | contractile ring(GO:0070938) |
0.3 | 0.8 | GO:0070552 | BRISC complex(GO:0070552) |
0.3 | 0.8 | GO:0031094 | platelet dense tubular network(GO:0031094) |
0.3 | 1.0 | GO:0071797 | LUBAC complex(GO:0071797) |
0.2 | 1.7 | GO:0005577 | fibrinogen complex(GO:0005577) |
0.2 | 1.5 | GO:0035686 | sperm fibrous sheath(GO:0035686) |
0.2 | 1.0 | GO:0000214 | tRNA-intron endonuclease complex(GO:0000214) |
0.2 | 0.7 | GO:0005833 | hemoglobin complex(GO:0005833) |
0.2 | 1.4 | GO:0005744 | mitochondrial inner membrane presequence translocase complex(GO:0005744) |
0.2 | 0.7 | GO:0044611 | nuclear pore inner ring(GO:0044611) |
0.2 | 5.7 | GO:0005689 | U12-type spliceosomal complex(GO:0005689) |
0.2 | 0.2 | GO:0005818 | aster(GO:0005818) |
0.2 | 1.2 | GO:0005826 | actomyosin contractile ring(GO:0005826) |
0.2 | 0.7 | GO:0005588 | collagen type V trimer(GO:0005588) |
0.2 | 1.2 | GO:0097422 | tubular endosome(GO:0097422) |
0.2 | 10.3 | GO:0030173 | integral component of Golgi membrane(GO:0030173) |
0.2 | 0.9 | GO:0097524 | sperm plasma membrane(GO:0097524) |
0.2 | 0.7 | GO:0090661 | box H/ACA snoRNP complex(GO:0031429) box H/ACA RNP complex(GO:0072588) box H/ACA telomerase RNP complex(GO:0090661) |
0.2 | 1.3 | GO:0070761 | pre-snoRNP complex(GO:0070761) |
0.2 | 0.7 | GO:0097413 | Lewy body(GO:0097413) |
0.2 | 0.4 | GO:1990316 | ATG1/ULK1 kinase complex(GO:1990316) |
0.2 | 1.1 | GO:0033063 | Rad51B-Rad51C-Rad51D-XRCC2 complex(GO:0033063) |
0.2 | 0.4 | GO:0032010 | phagolysosome(GO:0032010) |
0.2 | 1.1 | GO:0034709 | methylosome(GO:0034709) |
0.2 | 0.6 | GO:0005899 | insulin receptor complex(GO:0005899) |
0.2 | 3.8 | GO:0005666 | DNA-directed RNA polymerase III complex(GO:0005666) |
0.2 | 3.0 | GO:0030134 | ER to Golgi transport vesicle(GO:0030134) |
0.2 | 1.1 | GO:0061617 | MICOS complex(GO:0061617) |
0.2 | 2.3 | GO:0016442 | RISC complex(GO:0016442) RNAi effector complex(GO:0031332) |
0.2 | 1.5 | GO:1990124 | messenger ribonucleoprotein complex(GO:1990124) |
0.2 | 5.0 | GO:0097228 | sperm principal piece(GO:0097228) |
0.2 | 12.7 | GO:0031526 | brush border membrane(GO:0031526) |
0.2 | 6.2 | GO:0000307 | cyclin-dependent protein kinase holoenzyme complex(GO:0000307) |
0.2 | 1.2 | GO:0045252 | oxoglutarate dehydrogenase complex(GO:0045252) |
0.2 | 1.8 | GO:0031010 | ISWI-type complex(GO:0031010) |
0.2 | 12.2 | GO:0000118 | histone deacetylase complex(GO:0000118) |
0.2 | 0.8 | GO:0070044 | synaptobrevin 2-SNAP-25-syntaxin-1a complex(GO:0070044) |
0.2 | 2.0 | GO:0031080 | nuclear pore outer ring(GO:0031080) |
0.2 | 0.4 | GO:0005868 | cytoplasmic dynein complex(GO:0005868) |
0.2 | 2.6 | GO:0038201 | TOR complex(GO:0038201) |
0.2 | 1.6 | GO:0032591 | dendritic spine membrane(GO:0032591) |
0.2 | 0.2 | GO:0061574 | ASAP complex(GO:0061574) |
0.2 | 0.4 | GO:0034274 | Atg12-Atg5-Atg16 complex(GO:0034274) |
0.2 | 1.2 | GO:0042629 | mast cell granule(GO:0042629) |
0.2 | 2.3 | GO:0036038 | MKS complex(GO:0036038) |
0.2 | 0.4 | GO:0071953 | elastic fiber(GO:0071953) |
0.2 | 3.8 | GO:0051233 | spindle midzone(GO:0051233) |
0.2 | 0.4 | GO:1990357 | terminal web(GO:1990357) |
0.2 | 0.5 | GO:0036488 | CHOP-C/EBP complex(GO:0036488) |
0.2 | 2.7 | GO:0045120 | pronucleus(GO:0045120) |
0.2 | 1.1 | GO:0072557 | IPAF inflammasome complex(GO:0072557) |
0.2 | 0.5 | GO:0097149 | centralspindlin complex(GO:0097149) |
0.2 | 3.9 | GO:0030057 | desmosome(GO:0030057) |
0.2 | 2.0 | GO:0005641 | nuclear envelope lumen(GO:0005641) |
0.2 | 1.6 | GO:0031528 | microvillus membrane(GO:0031528) |
0.2 | 0.7 | GO:0030870 | Mre11 complex(GO:0030870) |
0.2 | 0.2 | GO:1990423 | RZZ complex(GO:1990423) |
0.2 | 3.9 | GO:0000786 | nucleosome(GO:0000786) |
0.2 | 0.5 | GO:0031523 | Myb complex(GO:0031523) |
0.2 | 1.2 | GO:0042382 | paraspeckles(GO:0042382) |
0.2 | 0.2 | GO:0032133 | chromosome passenger complex(GO:0032133) |
0.2 | 1.8 | GO:0032039 | integrator complex(GO:0032039) |
0.2 | 1.1 | GO:0034045 | pre-autophagosomal structure membrane(GO:0034045) |
0.2 | 1.8 | GO:0000159 | protein phosphatase type 2A complex(GO:0000159) |
0.2 | 1.3 | GO:0016600 | flotillin complex(GO:0016600) |
0.2 | 1.5 | GO:0046581 | intercellular canaliculus(GO:0046581) |
0.2 | 1.0 | GO:0005688 | U6 snRNP(GO:0005688) |
0.2 | 0.5 | GO:0000811 | GINS complex(GO:0000811) |
0.2 | 0.8 | GO:0000796 | condensin complex(GO:0000796) |
0.2 | 0.2 | GO:0044615 | nuclear pore nuclear basket(GO:0044615) |
0.2 | 1.4 | GO:0034719 | SMN-Sm protein complex(GO:0034719) |
0.2 | 1.5 | GO:0005671 | Ada2/Gcn5/Ada3 transcription activator complex(GO:0005671) |
0.2 | 0.5 | GO:0044233 | ER-mitochondrion membrane contact site(GO:0044233) |
0.2 | 0.9 | GO:0071598 | neuronal ribonucleoprotein granule(GO:0071598) |
0.2 | 0.5 | GO:1990923 | PET complex(GO:1990923) |
0.2 | 0.5 | GO:0016222 | procollagen-proline 4-dioxygenase complex(GO:0016222) |
0.2 | 1.1 | GO:0070688 | MLL5-L complex(GO:0070688) |
0.1 | 0.4 | GO:0032937 | SREBP-SCAP-Insig complex(GO:0032937) |
0.1 | 0.6 | GO:0097255 | R2TP complex(GO:0097255) |
0.1 | 0.7 | GO:0008541 | proteasome regulatory particle, lid subcomplex(GO:0008541) |
0.1 | 0.4 | GO:0055087 | Ski complex(GO:0055087) |
0.1 | 0.4 | GO:0005967 | mitochondrial pyruvate dehydrogenase complex(GO:0005967) |
0.1 | 0.3 | GO:0044354 | pinosome(GO:0044352) macropinosome(GO:0044354) |
0.1 | 1.7 | GO:0030904 | retromer complex(GO:0030904) |
0.1 | 1.0 | GO:0005677 | chromatin silencing complex(GO:0005677) |
0.1 | 0.7 | GO:0000275 | mitochondrial proton-transporting ATP synthase complex, catalytic core F(1)(GO:0000275) proton-transporting ATP synthase complex, catalytic core F(1)(GO:0045261) |
0.1 | 1.0 | GO:0010369 | chromocenter(GO:0010369) |
0.1 | 0.1 | GO:0005686 | U2 snRNP(GO:0005686) |
0.1 | 0.3 | GO:0032437 | cuticular plate(GO:0032437) |
0.1 | 2.7 | GO:0030665 | clathrin-coated vesicle membrane(GO:0030665) |
0.1 | 0.5 | GO:0097431 | mitotic spindle pole(GO:0097431) |
0.1 | 0.8 | GO:0031254 | uropod(GO:0001931) cell trailing edge(GO:0031254) |
0.1 | 7.1 | GO:0005795 | Golgi stack(GO:0005795) |
0.1 | 7.7 | GO:0005902 | microvillus(GO:0005902) |
0.1 | 0.4 | GO:0031466 | Cul5-RING ubiquitin ligase complex(GO:0031466) |
0.1 | 0.1 | GO:0071664 | catenin-TCF7L2 complex(GO:0071664) |
0.1 | 1.6 | GO:0030914 | STAGA complex(GO:0030914) |
0.1 | 2.1 | GO:0031307 | integral component of mitochondrial outer membrane(GO:0031307) |
0.1 | 0.3 | GO:0031258 | lamellipodium membrane(GO:0031258) |
0.1 | 0.3 | GO:0097025 | MPP7-DLG1-LIN7 complex(GO:0097025) |
0.1 | 0.8 | GO:0001650 | fibrillar center(GO:0001650) |
0.1 | 0.9 | GO:0031464 | Cul4A-RING E3 ubiquitin ligase complex(GO:0031464) |
0.1 | 1.1 | GO:0071011 | precatalytic spliceosome(GO:0071011) |
0.1 | 5.3 | GO:0042645 | nucleoid(GO:0009295) mitochondrial nucleoid(GO:0042645) |
0.1 | 0.4 | GO:0097427 | microtubule bundle(GO:0097427) |
0.1 | 0.4 | GO:0097443 | sorting endosome(GO:0097443) |
0.1 | 0.4 | GO:0035749 | myelin sheath adaxonal region(GO:0035749) |
0.1 | 0.4 | GO:0016602 | CCAAT-binding factor complex(GO:0016602) |
0.1 | 2.0 | GO:0080008 | Cul4-RING E3 ubiquitin ligase complex(GO:0080008) |
0.1 | 4.2 | GO:0005905 | clathrin-coated pit(GO:0005905) |
0.1 | 0.1 | GO:0031306 | intrinsic component of mitochondrial outer membrane(GO:0031306) |
0.1 | 0.1 | GO:0045298 | tubulin complex(GO:0045298) |
0.1 | 0.4 | GO:0044316 | cone cell pedicle(GO:0044316) |
0.1 | 0.5 | GO:0072487 | MSL complex(GO:0072487) |
0.1 | 1.1 | GO:0002116 | semaphorin receptor complex(GO:0002116) |
0.1 | 0.7 | GO:0046540 | U4/U6 x U5 tri-snRNP complex(GO:0046540) |
0.1 | 0.2 | GO:0070419 | nonhomologous end joining complex(GO:0070419) |
0.1 | 0.5 | GO:0070187 | telosome(GO:0070187) |
0.1 | 0.8 | GO:0008290 | F-actin capping protein complex(GO:0008290) |
0.1 | 1.3 | GO:0005682 | U5 snRNP(GO:0005682) |
0.1 | 1.3 | GO:0031588 | nucleotide-activated protein kinase complex(GO:0031588) |
0.1 | 3.0 | GO:0016235 | aggresome(GO:0016235) |
0.1 | 0.2 | GO:0030688 | preribosome, small subunit precursor(GO:0030688) |
0.1 | 0.9 | GO:0035098 | ESC/E(Z) complex(GO:0035098) |
0.1 | 0.4 | GO:1990462 | omegasome(GO:1990462) |
0.1 | 0.6 | GO:0070775 | H3 histone acetyltransferase complex(GO:0070775) MOZ/MORF histone acetyltransferase complex(GO:0070776) |
0.1 | 2.9 | GO:0010494 | cytoplasmic stress granule(GO:0010494) |
0.1 | 0.2 | GO:0034750 | Scrib-APC-beta-catenin complex(GO:0034750) |
0.1 | 0.2 | GO:0043625 | delta DNA polymerase complex(GO:0043625) |
0.1 | 0.7 | GO:0005664 | origin recognition complex(GO:0000808) nuclear origin of replication recognition complex(GO:0005664) |
0.1 | 0.3 | GO:0030891 | VCB complex(GO:0030891) |
0.1 | 1.6 | GO:0005721 | pericentric heterochromatin(GO:0005721) |
0.1 | 1.3 | GO:0060293 | P granule(GO:0043186) pole plasm(GO:0045495) germ plasm(GO:0060293) |
0.1 | 0.3 | GO:0005915 | zonula adherens(GO:0005915) |
0.1 | 1.2 | GO:0001527 | microfibril(GO:0001527) |
0.1 | 0.5 | GO:0002139 | stereocilia coupling link(GO:0002139) stereocilia ankle link(GO:0002141) |
0.1 | 1.6 | GO:0005838 | proteasome regulatory particle(GO:0005838) |
0.1 | 0.5 | GO:0033093 | Weibel-Palade body(GO:0033093) |
0.1 | 8.7 | GO:0072562 | blood microparticle(GO:0072562) |
0.1 | 0.3 | GO:0030915 | Smc5-Smc6 complex(GO:0030915) |
0.1 | 0.5 | GO:0045179 | apical cortex(GO:0045179) |
0.1 | 3.4 | GO:0000795 | synaptonemal complex(GO:0000795) |
0.1 | 4.1 | GO:0005747 | mitochondrial respiratory chain complex I(GO:0005747) NADH dehydrogenase complex(GO:0030964) respiratory chain complex I(GO:0045271) |
0.1 | 1.2 | GO:0001891 | phagocytic cup(GO:0001891) |
0.1 | 0.4 | GO:0072357 | PTW/PP1 phosphatase complex(GO:0072357) |
0.1 | 1.0 | GO:0065010 | extracellular membrane-bounded organelle(GO:0065010) |
0.1 | 0.3 | GO:0033596 | TSC1-TSC2 complex(GO:0033596) |
0.1 | 1.8 | GO:0070469 | respiratory chain(GO:0070469) |
0.1 | 2.8 | GO:0008023 | transcription elongation factor complex(GO:0008023) |
0.1 | 0.6 | GO:0061702 | inflammasome complex(GO:0061702) |
0.1 | 0.4 | GO:0089701 | U2AF(GO:0089701) |
0.1 | 3.3 | GO:1990204 | oxidoreductase complex(GO:1990204) |
0.1 | 0.3 | GO:0008278 | cohesin complex(GO:0008278) |
0.1 | 4.0 | GO:0005788 | endoplasmic reticulum lumen(GO:0005788) |
0.1 | 1.1 | GO:0043189 | NuA4 histone acetyltransferase complex(GO:0035267) H4/H2A histone acetyltransferase complex(GO:0043189) H4 histone acetyltransferase complex(GO:1902562) |
0.1 | 0.3 | GO:0000120 | RNA polymerase I transcription factor complex(GO:0000120) |
0.1 | 2.4 | GO:0000123 | histone acetyltransferase complex(GO:0000123) |
0.1 | 0.3 | GO:0044530 | supraspliceosomal complex(GO:0044530) |
0.1 | 0.4 | GO:0001652 | granular component(GO:0001652) |
0.1 | 0.2 | GO:0033010 | paranodal junction(GO:0033010) |
0.1 | 0.3 | GO:0072379 | BAT3 complex(GO:0071818) ER membrane insertion complex(GO:0072379) |
0.1 | 1.1 | GO:0031011 | Ino80 complex(GO:0031011) |
0.1 | 0.3 | GO:0016533 | cyclin-dependent protein kinase 5 holoenzyme complex(GO:0016533) |
0.1 | 1.7 | GO:0035145 | exon-exon junction complex(GO:0035145) |
0.1 | 0.4 | GO:0089717 | spanning component of plasma membrane(GO:0044214) spanning component of membrane(GO:0089717) |
0.1 | 0.3 | GO:0031262 | Ndc80 complex(GO:0031262) |
0.1 | 11.4 | GO:0042579 | peroxisome(GO:0005777) microbody(GO:0042579) |
0.1 | 4.5 | GO:0005811 | lipid particle(GO:0005811) |
0.1 | 0.4 | GO:0071439 | clathrin complex(GO:0071439) |
0.1 | 1.8 | GO:0005680 | anaphase-promoting complex(GO:0005680) |
0.1 | 0.7 | GO:0030056 | hemidesmosome(GO:0030056) |
0.1 | 0.2 | GO:0000814 | ESCRT II complex(GO:0000814) |
0.1 | 0.8 | GO:0070852 | cell body fiber(GO:0070852) |
0.1 | 0.4 | GO:0071565 | nBAF complex(GO:0071565) |
0.1 | 0.7 | GO:0005876 | spindle microtubule(GO:0005876) |
0.1 | 1.9 | GO:0001772 | immunological synapse(GO:0001772) |
0.1 | 0.1 | GO:0098554 | cytoplasmic side of endoplasmic reticulum membrane(GO:0098554) |
0.1 | 0.2 | GO:1990604 | IRE1-TRAF2-ASK1 complex(GO:1990604) |
0.1 | 1.6 | GO:0008305 | integrin complex(GO:0008305) |
0.1 | 0.2 | GO:0005952 | cAMP-dependent protein kinase complex(GO:0005952) |
0.1 | 0.3 | GO:0099738 | cell cortex region(GO:0099738) |
0.1 | 1.1 | GO:0031901 | early endosome membrane(GO:0031901) |
0.1 | 6.1 | GO:0000775 | chromosome, centromeric region(GO:0000775) |
0.1 | 1.4 | GO:0045111 | intermediate filament cytoskeleton(GO:0045111) |
0.1 | 0.2 | GO:0071564 | npBAF complex(GO:0071564) |
0.1 | 0.1 | GO:0098533 | ATPase dependent transmembrane transport complex(GO:0098533) |
0.1 | 0.2 | GO:0031417 | NatC complex(GO:0031417) |
0.1 | 1.7 | GO:0045335 | phagocytic vesicle(GO:0045335) |
0.1 | 0.3 | GO:0016281 | eukaryotic translation initiation factor 4F complex(GO:0016281) |
0.1 | 0.6 | GO:0031414 | N-terminal protein acetyltransferase complex(GO:0031414) |
0.1 | 0.2 | GO:0036396 | MIS complex(GO:0036396) |
0.1 | 0.4 | GO:0042405 | nuclear inclusion body(GO:0042405) |
0.1 | 0.1 | GO:0005638 | lamin filament(GO:0005638) |
0.1 | 0.2 | GO:0071437 | invadopodium(GO:0071437) |
0.1 | 0.6 | GO:0070652 | HAUS complex(GO:0070652) |
0.1 | 3.2 | GO:0016605 | PML body(GO:0016605) |
0.1 | 1.7 | GO:0030687 | preribosome, large subunit precursor(GO:0030687) |
0.1 | 0.8 | GO:0042599 | lamellar body(GO:0042599) |
0.1 | 3.2 | GO:0000922 | spindle pole(GO:0000922) |
0.1 | 0.3 | GO:0000220 | vacuolar proton-transporting V-type ATPase, V0 domain(GO:0000220) |
0.1 | 2.3 | GO:0016592 | mediator complex(GO:0016592) |
0.1 | 0.6 | GO:0005720 | nuclear heterochromatin(GO:0005720) |
0.1 | 0.5 | GO:0071004 | U2-type prespliceosome(GO:0071004) |
0.1 | 1.4 | GO:0016529 | sarcoplasmic reticulum(GO:0016529) |
0.1 | 2.2 | GO:0016328 | lateral plasma membrane(GO:0016328) |
0.1 | 3.8 | GO:0031463 | Cul3-RING ubiquitin ligase complex(GO:0031463) |
0.1 | 8.9 | GO:0031965 | nuclear membrane(GO:0031965) |
0.1 | 2.2 | GO:0000502 | proteasome complex(GO:0000502) |
0.1 | 0.5 | GO:0005890 | sodium:potassium-exchanging ATPase complex(GO:0005890) |
0.1 | 0.7 | GO:0031083 | BLOC-1 complex(GO:0031083) |
0.1 | 20.6 | GO:0005764 | lytic vacuole(GO:0000323) lysosome(GO:0005764) |
0.1 | 0.1 | GO:0033186 | CAF-1 complex(GO:0033186) |
0.1 | 0.8 | GO:0005849 | mRNA cleavage factor complex(GO:0005849) |
0.1 | 0.1 | GO:0005652 | nuclear lamina(GO:0005652) |
0.1 | 1.3 | GO:0030863 | cortical cytoskeleton(GO:0030863) |
0.1 | 0.2 | GO:0034098 | VCP-NPL4-UFD1 AAA ATPase complex(GO:0034098) |
0.1 | 0.6 | GO:0031371 | ubiquitin conjugating enzyme complex(GO:0031371) |
0.1 | 0.1 | GO:0032433 | filopodium tip(GO:0032433) |
0.1 | 0.5 | GO:0005669 | transcription factor TFIID complex(GO:0005669) |
0.1 | 0.7 | GO:0005732 | small nucleolar ribonucleoprotein complex(GO:0005732) |
0.1 | 0.2 | GO:0016342 | catenin complex(GO:0016342) |
0.1 | 0.6 | GO:0032040 | small-subunit processome(GO:0032040) |
0.1 | 0.9 | GO:0030686 | 90S preribosome(GO:0030686) |
0.1 | 1.2 | GO:0055038 | recycling endosome membrane(GO:0055038) |
0.1 | 1.8 | GO:0005643 | nuclear pore(GO:0005643) |
0.1 | 0.2 | GO:0005944 | phosphatidylinositol 3-kinase complex, class IB(GO:0005944) |
0.1 | 1.5 | GO:0000932 | cytoplasmic mRNA processing body(GO:0000932) |
0.1 | 0.2 | GO:0002079 | inner acrosomal membrane(GO:0002079) |
0.1 | 0.3 | GO:0032593 | insulin-responsive compartment(GO:0032593) |
0.1 | 0.1 | GO:0032300 | mismatch repair complex(GO:0032300) |
0.1 | 1.9 | GO:0005793 | endoplasmic reticulum-Golgi intermediate compartment(GO:0005793) |
0.1 | 6.8 | GO:0016323 | basolateral plasma membrane(GO:0016323) |
0.1 | 0.8 | GO:0035861 | site of double-strand break(GO:0035861) |
0.1 | 0.9 | GO:0005834 | heterotrimeric G-protein complex(GO:0005834) |
0.1 | 0.2 | GO:0043220 | Schmidt-Lanterman incisure(GO:0043220) |
0.1 | 3.9 | GO:0000313 | organellar ribosome(GO:0000313) mitochondrial ribosome(GO:0005761) |
0.1 | 22.4 | GO:0044429 | mitochondrial part(GO:0044429) |
0.1 | 0.1 | GO:0030992 | intraciliary transport particle B(GO:0030992) |
0.1 | 0.5 | GO:0005832 | chaperonin-containing T-complex(GO:0005832) |
0.1 | 1.4 | GO:0031519 | PcG protein complex(GO:0031519) |
0.1 | 0.3 | GO:1990909 | Wnt signalosome(GO:1990909) |
0.1 | 3.3 | GO:0022625 | cytosolic large ribosomal subunit(GO:0022625) |
0.1 | 0.5 | GO:0017119 | Golgi transport complex(GO:0017119) |
0.1 | 13.0 | GO:0042175 | nuclear outer membrane-endoplasmic reticulum membrane network(GO:0042175) |
0.1 | 0.1 | GO:0098636 | protein complex involved in cell adhesion(GO:0098636) |
0.1 | 0.4 | GO:0000346 | transcription export complex(GO:0000346) |
0.1 | 2.0 | GO:0017053 | transcriptional repressor complex(GO:0017053) |
0.1 | 0.2 | GO:0048476 | Holliday junction resolvase complex(GO:0048476) |
0.1 | 0.3 | GO:0042470 | melanosome(GO:0042470) pigment granule(GO:0048770) |
0.1 | 0.3 | GO:0034361 | very-low-density lipoprotein particle(GO:0034361) triglyceride-rich lipoprotein particle(GO:0034385) |
0.1 | 0.1 | GO:0000938 | GARP complex(GO:0000938) |
0.1 | 0.1 | GO:0070069 | cytochrome complex(GO:0070069) |
0.1 | 0.5 | GO:0032045 | guanyl-nucleotide exchange factor complex(GO:0032045) |
0.1 | 0.1 | GO:1990907 | beta-catenin-TCF complex(GO:1990907) |
0.1 | 0.2 | GO:0044292 | dendrite terminus(GO:0044292) |
0.0 | 1.8 | GO:0030496 | midbody(GO:0030496) |
0.0 | 0.1 | GO:0032389 | MutLalpha complex(GO:0032389) |
0.0 | 0.1 | GO:0045334 | clathrin-coated endocytic vesicle(GO:0045334) |
0.0 | 0.1 | GO:0042583 | chromaffin granule(GO:0042583) |
0.0 | 0.3 | GO:0000242 | pericentriolar material(GO:0000242) |
0.0 | 0.1 | GO:0031298 | replication fork protection complex(GO:0031298) |
0.0 | 0.5 | GO:0097440 | apical dendrite(GO:0097440) |
0.0 | 0.5 | GO:0000164 | protein phosphatase type 1 complex(GO:0000164) |
0.0 | 0.7 | GO:0030139 | endocytic vesicle(GO:0030139) |
0.0 | 0.4 | GO:0005697 | telomerase holoenzyme complex(GO:0005697) |
0.0 | 0.6 | GO:0000145 | exocyst(GO:0000145) |
0.0 | 0.1 | GO:0034663 | endoplasmic reticulum chaperone complex(GO:0034663) |
0.0 | 0.3 | GO:0042622 | photoreceptor outer segment membrane(GO:0042622) |
0.0 | 0.3 | GO:0005736 | DNA-directed RNA polymerase I complex(GO:0005736) |
0.0 | 8.6 | GO:0005813 | centrosome(GO:0005813) |
0.0 | 1.3 | GO:0005871 | kinesin complex(GO:0005871) |
0.0 | 0.0 | GO:0020018 | ciliary pocket(GO:0020016) ciliary pocket membrane(GO:0020018) |
0.0 | 0.2 | GO:0036128 | CatSper complex(GO:0036128) |
0.0 | 0.3 | GO:0016272 | prefoldin complex(GO:0016272) |
0.0 | 0.3 | GO:0031209 | SCAR complex(GO:0031209) |
0.0 | 0.1 | GO:0031512 | motile primary cilium(GO:0031512) |
0.0 | 0.2 | GO:0031091 | platelet alpha granule(GO:0031091) |
0.0 | 1.3 | GO:0000784 | nuclear chromosome, telomeric region(GO:0000784) |
0.0 | 0.2 | GO:0005593 | FACIT collagen trimer(GO:0005593) |
0.0 | 0.2 | GO:0005851 | eukaryotic translation initiation factor 2B complex(GO:0005851) |
0.0 | 0.2 | GO:1990745 | EARP complex(GO:1990745) |
0.0 | 3.7 | GO:0005882 | intermediate filament(GO:0005882) |
0.0 | 0.0 | GO:0015934 | large ribosomal subunit(GO:0015934) |
0.0 | 1.1 | GO:0005791 | rough endoplasmic reticulum(GO:0005791) |
0.0 | 0.1 | GO:0019815 | B cell receptor complex(GO:0019815) |
0.0 | 2.4 | GO:0005840 | ribosome(GO:0005840) |
0.0 | 0.2 | GO:0033256 | I-kappaB/NF-kappaB complex(GO:0033256) |
0.0 | 0.9 | GO:0016363 | nuclear matrix(GO:0016363) |
0.0 | 0.1 | GO:0033655 | host cell cytoplasm(GO:0030430) host cell cytoplasm part(GO:0033655) |
0.0 | 56.2 | GO:0070062 | extracellular exosome(GO:0070062) |
0.0 | 0.1 | GO:0030289 | protein phosphatase 4 complex(GO:0030289) |
0.0 | 0.2 | GO:0000792 | heterochromatin(GO:0000792) |
0.0 | 1.4 | GO:0019005 | SCF ubiquitin ligase complex(GO:0019005) |
0.0 | 0.1 | GO:1904115 | axon cytoplasm(GO:1904115) |
0.0 | 0.0 | GO:0000110 | nucleotide-excision repair factor 1 complex(GO:0000110) |
0.0 | 1.4 | GO:0005815 | microtubule organizing center(GO:0005815) |
0.0 | 0.1 | GO:0002199 | zona pellucida receptor complex(GO:0002199) |
0.0 | 0.0 | GO:0097651 | phosphatidylinositol 3-kinase complex, class I(GO:0097651) |
0.0 | 0.2 | GO:0098687 | chromosomal region(GO:0098687) |
0.0 | 0.6 | GO:0005903 | brush border(GO:0005903) |
0.0 | 0.1 | GO:0001674 | female germ cell nucleus(GO:0001674) |
0.0 | 0.0 | GO:0034399 | nuclear periphery(GO:0034399) |
0.0 | 0.0 | GO:0097452 | GAIT complex(GO:0097452) |
0.0 | 18.3 | GO:0005739 | mitochondrion(GO:0005739) |
0.0 | 0.1 | GO:0072669 | tRNA-splicing ligase complex(GO:0072669) |
0.0 | 0.2 | GO:0030131 | clathrin adaptor complex(GO:0030131) |
0.0 | 0.1 | GO:0030312 | external encapsulating structure(GO:0030312) |
0.0 | 0.4 | GO:0015030 | Cajal body(GO:0015030) |
0.0 | 0.1 | GO:0043527 | tRNA methyltransferase complex(GO:0043527) |
0.0 | 0.2 | GO:0035869 | ciliary transition zone(GO:0035869) |
0.0 | 0.0 | GO:0044322 | endoplasmic reticulum quality control compartment(GO:0044322) |
0.0 | 0.0 | GO:0005896 | interleukin-6 receptor complex(GO:0005896) |
0.0 | 0.1 | GO:0005968 | Rab-protein geranylgeranyltransferase complex(GO:0005968) |
0.0 | 0.1 | GO:1990635 | proximal dendrite(GO:1990635) |
0.0 | 0.1 | GO:0030877 | beta-catenin destruction complex(GO:0030877) |
0.0 | 5.4 | GO:0005694 | chromosome(GO:0005694) |
0.0 | 0.1 | GO:0005964 | phosphorylase kinase complex(GO:0005964) |
0.0 | 0.1 | GO:0032391 | photoreceptor connecting cilium(GO:0032391) |
0.0 | 17.8 | GO:0005654 | nucleoplasm(GO:0005654) |
0.0 | 0.3 | GO:0090575 | RNA polymerase II transcription factor complex(GO:0090575) |
0.0 | 0.3 | GO:0001917 | photoreceptor inner segment(GO:0001917) |
0.0 | 0.0 | GO:0097449 | astrocyte projection(GO:0097449) |
0.0 | 2.5 | GO:0005667 | transcription factor complex(GO:0005667) |
0.0 | 0.4 | GO:0005881 | cytoplasmic microtubule(GO:0005881) |
0.0 | 0.0 | GO:0043203 | axon hillock(GO:0043203) |
0.0 | 0.1 | GO:0030663 | COPI-coated vesicle membrane(GO:0030663) |
0.0 | 2.0 | GO:0035068 | micro-ribonucleoprotein complex(GO:0035068) |
0.0 | 0.1 | GO:0032426 | stereocilium tip(GO:0032426) |
0.0 | 0.0 | GO:0071817 | MMXD complex(GO:0071817) |
0.0 | 0.1 | GO:0034362 | low-density lipoprotein particle(GO:0034362) |
0.0 | 0.0 | GO:0097058 | CRLF-CLCF1 complex(GO:0097058) |
0.0 | 0.0 | GO:0051286 | cell tip(GO:0051286) |
0.0 | 0.4 | GO:0055037 | recycling endosome(GO:0055037) |
0.0 | 0.1 | GO:0097543 | ciliary inversin compartment(GO:0097543) |
0.0 | 2.5 | GO:0009897 | external side of plasma membrane(GO:0009897) |
0.0 | 0.2 | GO:0005844 | polysome(GO:0005844) |
0.0 | 0.0 | GO:0000408 | EKC/KEOPS complex(GO:0000408) |
0.0 | 0.1 | GO:0005786 | signal recognition particle, endoplasmic reticulum targeting(GO:0005786) signal recognition particle(GO:0048500) |
0.0 | 0.0 | GO:0005845 | mRNA cap binding complex(GO:0005845) RNA cap binding complex(GO:0034518) |
0.0 | 0.1 | GO:0043073 | germ cell nucleus(GO:0043073) |
0.0 | 0.0 | GO:0070032 | synaptobrevin 2-SNAP-25-syntaxin-1a-complexin I complex(GO:0070032) |
0.0 | 0.0 | GO:0008287 | protein serine/threonine phosphatase complex(GO:0008287) phosphatase complex(GO:1903293) |
0.0 | 0.0 | GO:0000153 | cytoplasmic ubiquitin ligase complex(GO:0000153) |
0.0 | 0.4 | GO:0000151 | ubiquitin ligase complex(GO:0000151) |
0.0 | 0.0 | GO:0005796 | Golgi lumen(GO:0005796) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
1.5 | 4.5 | GO:0005345 | purine nucleobase transmembrane transporter activity(GO:0005345) pyrimidine nucleobase transmembrane transporter activity(GO:0005350) nucleobase transmembrane transporter activity(GO:0015205) |
1.3 | 3.9 | GO:0004104 | cholinesterase activity(GO:0004104) |
1.0 | 3.1 | GO:0003829 | beta-1,3-galactosyl-O-glycosyl-glycoprotein beta-1,6-N-acetylglucosaminyltransferase activity(GO:0003829) |
1.0 | 3.0 | GO:0004748 | ribonucleoside-diphosphate reductase activity, thioredoxin disulfide as acceptor(GO:0004748) oxidoreductase activity, acting on CH or CH2 groups, disulfide as acceptor(GO:0016728) ribonucleoside-diphosphate reductase activity(GO:0061731) |
1.0 | 3.9 | GO:0042731 | PH domain binding(GO:0042731) |
0.9 | 3.8 | GO:0070326 | very-low-density lipoprotein particle receptor binding(GO:0070326) |
0.9 | 3.7 | GO:0033300 | dehydroascorbic acid transporter activity(GO:0033300) |
0.9 | 3.7 | GO:0015220 | choline transmembrane transporter activity(GO:0015220) |
0.8 | 4.9 | GO:0004064 | arylesterase activity(GO:0004064) |
0.8 | 2.3 | GO:0035529 | NADH pyrophosphatase activity(GO:0035529) |
0.7 | 2.2 | GO:0001069 | regulatory region RNA binding(GO:0001069) |
0.7 | 1.4 | GO:0070538 | oleic acid binding(GO:0070538) |
0.7 | 2.8 | GO:0004332 | fructose-bisphosphate aldolase activity(GO:0004332) |
0.7 | 2.7 | GO:0004046 | aminoacylase activity(GO:0004046) |
0.7 | 2.0 | GO:0004416 | hydroxyacylglutathione hydrolase activity(GO:0004416) |
0.6 | 3.2 | GO:0019784 | NEDD8-specific protease activity(GO:0019784) |
0.6 | 1.7 | GO:0008525 | phosphatidylcholine transporter activity(GO:0008525) |
0.6 | 2.2 | GO:0030984 | kininogen binding(GO:0030984) |
0.6 | 2.2 | GO:0008865 | fructokinase activity(GO:0008865) mannokinase activity(GO:0019158) |
0.5 | 3.8 | GO:0003836 | beta-galactoside (CMP) alpha-2,3-sialyltransferase activity(GO:0003836) |
0.5 | 1.6 | GO:0005119 | smoothened binding(GO:0005119) |
0.5 | 1.6 | GO:0035877 | death effector domain binding(GO:0035877) |
0.5 | 3.2 | GO:0005225 | volume-sensitive anion channel activity(GO:0005225) |
0.5 | 4.8 | GO:1990381 | ubiquitin-specific protease binding(GO:1990381) |
0.5 | 4.8 | GO:0008093 | cytoskeletal adaptor activity(GO:0008093) |
0.5 | 1.6 | GO:0004024 | alcohol dehydrogenase activity, zinc-dependent(GO:0004024) |
0.5 | 2.1 | GO:0042134 | rRNA primary transcript binding(GO:0042134) |
0.5 | 4.7 | GO:0022889 | L-serine transmembrane transporter activity(GO:0015194) serine transmembrane transporter activity(GO:0022889) |
0.5 | 2.0 | GO:0036033 | mediator complex binding(GO:0036033) |
0.5 | 2.0 | GO:0016401 | palmitoyl-CoA oxidase activity(GO:0016401) |
0.5 | 2.0 | GO:0033192 | calmodulin-dependent protein phosphatase activity(GO:0033192) |
0.5 | 1.9 | GO:0004792 | thiosulfate sulfurtransferase activity(GO:0004792) |
0.5 | 1.4 | GO:0047192 | 1-alkylglycerophosphocholine O-acetyltransferase activity(GO:0047192) |
0.5 | 4.2 | GO:0030983 | mismatched DNA binding(GO:0030983) |
0.5 | 2.3 | GO:0017169 | CDP-alcohol phosphatidyltransferase activity(GO:0017169) |
0.5 | 0.5 | GO:0016509 | long-chain-3-hydroxyacyl-CoA dehydrogenase activity(GO:0016509) |
0.5 | 3.2 | GO:0046790 | virion binding(GO:0046790) |
0.4 | 1.8 | GO:0043515 | kinetochore binding(GO:0043515) |
0.4 | 2.2 | GO:0009378 | four-way junction helicase activity(GO:0009378) |
0.4 | 1.8 | GO:0015226 | amino-acid betaine transmembrane transporter activity(GO:0015199) carnitine transmembrane transporter activity(GO:0015226) |
0.4 | 0.9 | GO:0035851 | Krueppel-associated box domain binding(GO:0035851) |
0.4 | 1.3 | GO:0008401 | retinoic acid 4-hydroxylase activity(GO:0008401) |
0.4 | 3.4 | GO:0071933 | Arp2/3 complex binding(GO:0071933) |
0.4 | 1.6 | GO:0004591 | oxoglutarate dehydrogenase (succinyl-transferring) activity(GO:0004591) |
0.4 | 1.2 | GO:0003987 | acetate-CoA ligase activity(GO:0003987) |
0.4 | 0.4 | GO:0002054 | nucleobase binding(GO:0002054) |
0.4 | 2.3 | GO:0005072 | transforming growth factor beta receptor, cytoplasmic mediator activity(GO:0005072) |
0.4 | 1.5 | GO:0004095 | carnitine O-palmitoyltransferase activity(GO:0004095) |
0.4 | 3.1 | GO:0032552 | deoxyribonucleotide binding(GO:0032552) |
0.4 | 0.8 | GO:0030519 | snoRNP binding(GO:0030519) |
0.4 | 1.9 | GO:0015450 | P-P-bond-hydrolysis-driven protein transmembrane transporter activity(GO:0015450) |
0.4 | 1.1 | GO:0004731 | purine-nucleoside phosphorylase activity(GO:0004731) |
0.4 | 4.5 | GO:0004535 | poly(A)-specific ribonuclease activity(GO:0004535) |
0.4 | 1.5 | GO:0043842 | Kdo transferase activity(GO:0043842) |
0.4 | 1.1 | GO:0070644 | vitamin D response element binding(GO:0070644) |
0.4 | 1.9 | GO:0034452 | dynactin binding(GO:0034452) |
0.4 | 0.7 | GO:0019237 | centromeric DNA binding(GO:0019237) |
0.4 | 1.8 | GO:0004826 | phenylalanine-tRNA ligase activity(GO:0004826) |
0.4 | 1.1 | GO:0030350 | iron-responsive element binding(GO:0030350) |
0.4 | 1.8 | GO:0004887 | thyroid hormone receptor activity(GO:0004887) |
0.4 | 3.2 | GO:0018449 | pinocarveol dehydrogenase activity(GO:0018446) chloral hydrate dehydrogenase activity(GO:0018447) hydroxymethylmethylsilanediol oxidase activity(GO:0018448) 1-phenylethanol dehydrogenase activity(GO:0018449) myrtenol dehydrogenase activity(GO:0018450) cis-1,2-dihydroxy-1,2-dihydro-8-carboxynaphthalene dehydrogenase activity(GO:0034522) 3-hydroxy-4-methyloctanoyl-CoA dehydrogenase activity(GO:0034582) 2-hydroxy-4-isopropenylcyclohexane-1-carboxyl-CoA dehydrogenase activity(GO:0034778) cis-9,10-dihydroanthracene-9,10-diol dehydrogenase activity(GO:0034817) citronellol dehydrogenase activity(GO:0034821) naphthyl-2-hydroxymethyl-succinyl-CoA dehydrogenase activity(GO:0034847) 2,4,4-trimethyl-1-pentanol dehydrogenase activity(GO:0034863) 2,4,4-trimethyl-3-hydroxypentanoyl-CoA dehydrogenase activity(GO:0034868) 1-hydroxy-4,4-dimethylpentan-3-one dehydrogenase activity(GO:0034871) endosulfan diol dehydrogenase activity(GO:0034891) endosulfan hydroxyether dehydrogenase activity(GO:0034901) 3-hydroxy-2-methylhexanoyl-CoA dehydrogenase activity(GO:0034918) 3-hydroxy-2,6-dimethyl-5-methylene-heptanoyl-CoA dehydrogenase activity(GO:0034944) versicolorin reductase activity(GO:0042469) ketoreductase activity(GO:0045703) |
0.4 | 1.8 | GO:0005113 | patched binding(GO:0005113) |
0.3 | 3.8 | GO:0015129 | lactate transmembrane transporter activity(GO:0015129) |
0.3 | 1.0 | GO:0048408 | epidermal growth factor binding(GO:0048408) |
0.3 | 1.0 | GO:0004305 | ethanolamine kinase activity(GO:0004305) |
0.3 | 0.7 | GO:0035650 | AP-1 adaptor complex binding(GO:0035650) |
0.3 | 1.3 | GO:0004566 | beta-glucuronidase activity(GO:0004566) |
0.3 | 0.7 | GO:0051718 | DNA (cytosine-5-)-methyltransferase activity(GO:0003886) DNA (cytosine-5-)-methyltransferase activity, acting on CpG substrates(GO:0051718) |
0.3 | 1.6 | GO:0004726 | non-membrane spanning protein tyrosine phosphatase activity(GO:0004726) |
0.3 | 1.0 | GO:0043423 | 3-phosphoinositide-dependent protein kinase binding(GO:0043423) |
0.3 | 6.5 | GO:0030506 | ankyrin binding(GO:0030506) |
0.3 | 1.0 | GO:0003976 | UDP-N-acetylglucosamine-lysosomal-enzyme N-acetylglucosaminephosphotransferase activity(GO:0003976) |
0.3 | 1.6 | GO:0019911 | structural constituent of myelin sheath(GO:0019911) |
0.3 | 3.2 | GO:0016717 | oxidoreductase activity, acting on paired donors, with oxidation of a pair of donors resulting in the reduction of molecular oxygen to two molecules of water(GO:0016717) |
0.3 | 1.3 | GO:0031493 | nucleosomal histone binding(GO:0031493) |
0.3 | 1.9 | GO:0050733 | RS domain binding(GO:0050733) |
0.3 | 0.9 | GO:0008732 | threonine aldolase activity(GO:0004793) L-allo-threonine aldolase activity(GO:0008732) |
0.3 | 0.6 | GO:0016532 | superoxide dismutase copper chaperone activity(GO:0016532) |
0.3 | 2.2 | GO:0030492 | hemoglobin binding(GO:0030492) |
0.3 | 5.6 | GO:0046965 | retinoid X receptor binding(GO:0046965) |
0.3 | 0.9 | GO:0071209 | U7 snRNA binding(GO:0071209) |
0.3 | 2.2 | GO:0005338 | nucleotide-sugar transmembrane transporter activity(GO:0005338) |
0.3 | 6.4 | GO:0015002 | cytochrome-c oxidase activity(GO:0004129) heme-copper terminal oxidase activity(GO:0015002) oxidoreductase activity, acting on a heme group of donors, oxygen as acceptor(GO:0016676) |
0.3 | 1.2 | GO:0004165 | dodecenoyl-CoA delta-isomerase activity(GO:0004165) |
0.3 | 0.3 | GO:0043140 | ATP-dependent 3'-5' DNA helicase activity(GO:0043140) |
0.3 | 0.9 | GO:0005094 | Rho GDP-dissociation inhibitor activity(GO:0005094) |
0.3 | 1.5 | GO:0004311 | farnesyltranstransferase activity(GO:0004311) |
0.3 | 1.2 | GO:0052650 | NADP-retinol dehydrogenase activity(GO:0052650) |
0.3 | 2.3 | GO:0016780 | phosphotransferase activity, for other substituted phosphate groups(GO:0016780) |
0.3 | 5.2 | GO:0070530 | K63-linked polyubiquitin binding(GO:0070530) |
0.3 | 0.3 | GO:0004022 | alcohol dehydrogenase (NAD) activity(GO:0004022) |
0.3 | 4.3 | GO:1990841 | promoter-specific chromatin binding(GO:1990841) |
0.3 | 1.1 | GO:0019136 | deoxynucleoside kinase activity(GO:0019136) |
0.3 | 1.1 | GO:0015232 | heme transporter activity(GO:0015232) |
0.3 | 1.1 | GO:0019145 | aminobutyraldehyde dehydrogenase activity(GO:0019145) 4-trimethylammoniobutyraldehyde dehydrogenase activity(GO:0047105) |
0.3 | 0.8 | GO:0015154 | sucrose:proton symporter activity(GO:0008506) sucrose transmembrane transporter activity(GO:0008515) disaccharide transmembrane transporter activity(GO:0015154) oligosaccharide transmembrane transporter activity(GO:0015157) |
0.3 | 3.6 | GO:0008601 | protein phosphatase type 2A regulator activity(GO:0008601) |
0.3 | 0.8 | GO:0042030 | ATPase inhibitor activity(GO:0042030) |
0.3 | 1.4 | GO:0042015 | interleukin-20 binding(GO:0042015) |
0.3 | 0.8 | GO:0008898 | S-adenosylmethionine-homocysteine S-methyltransferase activity(GO:0008898) |
0.3 | 2.4 | GO:0051010 | microtubule plus-end binding(GO:0051010) |
0.3 | 0.8 | GO:0004949 | cannabinoid receptor activity(GO:0004949) |
0.3 | 2.1 | GO:0000900 | translation repressor activity, nucleic acid binding(GO:0000900) |
0.3 | 0.8 | GO:0004687 | myosin light chain kinase activity(GO:0004687) |
0.3 | 0.8 | GO:0046404 | ATP-dependent polydeoxyribonucleotide 5'-hydroxyl-kinase activity(GO:0046404) polydeoxyribonucleotide kinase activity(GO:0051733) |
0.3 | 0.3 | GO:0046976 | histone methyltransferase activity (H3-K27 specific)(GO:0046976) |
0.3 | 2.3 | GO:0048027 | mRNA 5'-UTR binding(GO:0048027) |
0.3 | 0.8 | GO:0004032 | alditol:NADP+ 1-oxidoreductase activity(GO:0004032) |
0.2 | 1.5 | GO:0051920 | peroxiredoxin activity(GO:0051920) |
0.2 | 1.7 | GO:0001094 | TFIID-class transcription factor binding(GO:0001094) |
0.2 | 0.7 | GO:0016743 | carboxyl- or carbamoyltransferase activity(GO:0016743) |
0.2 | 1.2 | GO:0017151 | DEAD/H-box RNA helicase binding(GO:0017151) |
0.2 | 2.6 | GO:0051787 | misfolded protein binding(GO:0051787) |
0.2 | 3.8 | GO:1900750 | glutathione binding(GO:0043295) oligopeptide binding(GO:1900750) |
0.2 | 0.9 | GO:0009374 | biotin binding(GO:0009374) |
0.2 | 2.8 | GO:0070034 | telomerase RNA binding(GO:0070034) |
0.2 | 0.7 | GO:1990460 | leptin receptor binding(GO:1990460) |
0.2 | 0.5 | GO:0004779 | sulfate adenylyltransferase activity(GO:0004779) |
0.2 | 0.2 | GO:0070883 | pre-miRNA binding(GO:0070883) |
0.2 | 0.9 | GO:0022833 | mechanically-gated ion channel activity(GO:0008381) mechanically gated channel activity(GO:0022833) |
0.2 | 1.1 | GO:0034046 | poly(G) binding(GO:0034046) |
0.2 | 0.7 | GO:0004980 | melanocyte-stimulating hormone receptor activity(GO:0004980) |
0.2 | 0.9 | GO:0045505 | dynein intermediate chain binding(GO:0045505) |
0.2 | 1.3 | GO:0097157 | pre-mRNA intronic binding(GO:0097157) |
0.2 | 0.7 | GO:0030621 | U4 snRNA binding(GO:0030621) |
0.2 | 0.6 | GO:1901612 | cardiolipin binding(GO:1901612) |
0.2 | 1.5 | GO:0035197 | siRNA binding(GO:0035197) |
0.2 | 3.2 | GO:0017056 | structural constituent of nuclear pore(GO:0017056) |
0.2 | 0.6 | GO:0003876 | AMP deaminase activity(GO:0003876) adenosine-phosphate deaminase activity(GO:0047623) |
0.2 | 1.3 | GO:0005381 | iron ion transmembrane transporter activity(GO:0005381) |
0.2 | 1.1 | GO:0034416 | bisphosphoglycerate phosphatase activity(GO:0034416) |
0.2 | 0.6 | GO:0005087 | Ran guanyl-nucleotide exchange factor activity(GO:0005087) |
0.2 | 3.8 | GO:0001056 | RNA polymerase III activity(GO:0001056) |
0.2 | 4.4 | GO:0043027 | cysteine-type endopeptidase inhibitor activity involved in apoptotic process(GO:0043027) |
0.2 | 2.5 | GO:0036312 | phosphatidylinositol 3-kinase regulatory subunit binding(GO:0036312) |
0.2 | 0.8 | GO:0005332 | gamma-aminobutyric acid:sodium symporter activity(GO:0005332) |
0.2 | 0.6 | GO:0008526 | phosphatidylinositol transporter activity(GO:0008526) |
0.2 | 1.2 | GO:0017128 | phospholipid scramblase activity(GO:0017128) |
0.2 | 1.4 | GO:0005315 | inorganic phosphate transmembrane transporter activity(GO:0005315) |
0.2 | 0.6 | GO:0042392 | sphingosine-1-phosphate phosphatase activity(GO:0042392) |
0.2 | 3.6 | GO:0017025 | TBP-class protein binding(GO:0017025) |
0.2 | 0.6 | GO:0047023 | androsterone dehydrogenase activity(GO:0047023) |
0.2 | 0.8 | GO:1990380 | Lys48-specific deubiquitinase activity(GO:1990380) |
0.2 | 5.0 | GO:0030507 | spectrin binding(GO:0030507) |
0.2 | 0.6 | GO:0019166 | trans-2-enoyl-CoA reductase (NADPH) activity(GO:0019166) |
0.2 | 0.6 | GO:0019976 | interleukin-2 binding(GO:0019976) |
0.2 | 1.0 | GO:0003720 | telomerase activity(GO:0003720) RNA-directed DNA polymerase activity(GO:0003964) |
0.2 | 0.8 | GO:0015057 | thrombin receptor activity(GO:0015057) |
0.2 | 3.1 | GO:0019825 | oxygen binding(GO:0019825) |
0.2 | 0.6 | GO:0016309 | 1-phosphatidylinositol-5-phosphate 4-kinase activity(GO:0016309) |
0.2 | 1.7 | GO:0003854 | 3-beta-hydroxy-delta5-steroid dehydrogenase activity(GO:0003854) |
0.2 | 0.4 | GO:0051185 | coenzyme transporter activity(GO:0051185) |
0.2 | 1.7 | GO:0043995 | histone acetyltransferase activity (H4-K5 specific)(GO:0043995) histone acetyltransferase activity (H4-K8 specific)(GO:0043996) histone acetyltransferase activity (H4-K16 specific)(GO:0046972) |
0.2 | 0.6 | GO:0043262 | adenosine-diphosphatase activity(GO:0043262) |
0.2 | 4.2 | GO:0005086 | ARF guanyl-nucleotide exchange factor activity(GO:0005086) |
0.2 | 1.7 | GO:0001013 | RNA polymerase I regulatory region DNA binding(GO:0001013) |
0.2 | 1.3 | GO:0004679 | AMP-activated protein kinase activity(GO:0004679) |
0.2 | 0.2 | GO:0016530 | metallochaperone activity(GO:0016530) |
0.2 | 0.2 | GO:0050220 | prostaglandin-E synthase activity(GO:0050220) |
0.2 | 0.6 | GO:0015111 | iodide transmembrane transporter activity(GO:0015111) |
0.2 | 0.7 | GO:0004558 | alpha-1,4-glucosidase activity(GO:0004558) |
0.2 | 0.9 | GO:0004523 | RNA-DNA hybrid ribonuclease activity(GO:0004523) |
0.2 | 5.1 | GO:0000062 | fatty-acyl-CoA binding(GO:0000062) |
0.2 | 1.3 | GO:0048531 | beta-1,3-galactosyltransferase activity(GO:0048531) |
0.2 | 0.5 | GO:0016716 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, another compound as one donor, and incorporation of one atom of oxygen(GO:0016716) |
0.2 | 2.4 | GO:0004089 | carbonate dehydratase activity(GO:0004089) |
0.2 | 0.2 | GO:0030523 | S-acetyltransferase activity(GO:0016418) dihydrolipoamide S-acyltransferase activity(GO:0030523) |
0.2 | 0.7 | GO:0004849 | uridine kinase activity(GO:0004849) |
0.2 | 3.4 | GO:0008157 | protein phosphatase 1 binding(GO:0008157) |
0.2 | 0.9 | GO:0016308 | 1-phosphatidylinositol-4-phosphate 5-kinase activity(GO:0016308) |
0.2 | 2.3 | GO:0046703 | natural killer cell lectin-like receptor binding(GO:0046703) |
0.2 | 0.5 | GO:0070061 | fructose binding(GO:0070061) |
0.2 | 2.3 | GO:0070567 | cytidylyltransferase activity(GO:0070567) |
0.2 | 0.9 | GO:0003933 | GTP cyclohydrolase activity(GO:0003933) |
0.2 | 0.5 | GO:0005483 | soluble NSF attachment protein activity(GO:0005483) |
0.2 | 1.1 | GO:0047372 | acylglycerol lipase activity(GO:0047372) |
0.2 | 0.5 | GO:0015037 | peptide disulfide oxidoreductase activity(GO:0015037) |
0.2 | 1.4 | GO:0102391 | decanoate--CoA ligase activity(GO:0102391) |
0.2 | 0.5 | GO:0004719 | protein-L-isoaspartate (D-aspartate) O-methyltransferase activity(GO:0004719) |
0.2 | 4.0 | GO:0004364 | glutathione transferase activity(GO:0004364) |
0.2 | 0.5 | GO:0043199 | sulfate binding(GO:0043199) |
0.2 | 1.0 | GO:0004630 | phospholipase D activity(GO:0004630) |
0.2 | 0.9 | GO:0050072 | m7G(5')pppN diphosphatase activity(GO:0050072) |
0.2 | 1.2 | GO:0000150 | recombinase activity(GO:0000150) |
0.2 | 0.7 | GO:0003917 | DNA topoisomerase type I activity(GO:0003917) |
0.2 | 1.5 | GO:0004438 | phosphatidylinositol-3-phosphatase activity(GO:0004438) |
0.2 | 0.8 | GO:0030292 | protein tyrosine kinase inhibitor activity(GO:0030292) |
0.2 | 0.7 | GO:0005168 | neurotrophin TRKA receptor binding(GO:0005168) |
0.2 | 1.5 | GO:0019531 | oxalate transmembrane transporter activity(GO:0019531) |
0.2 | 0.5 | GO:0034040 | lipid-transporting ATPase activity(GO:0034040) |
0.2 | 0.5 | GO:0071535 | RING-like zinc finger domain binding(GO:0071535) |
0.2 | 0.5 | GO:0005220 | inositol 1,4,5-trisphosphate-sensitive calcium-release channel activity(GO:0005220) |
0.2 | 2.1 | GO:0008187 | poly-pyrimidine tract binding(GO:0008187) |
0.2 | 2.0 | GO:0019177 | thiamine-pyrophosphatase activity(GO:0004787) UDP-2,3-diacylglucosamine hydrolase activity(GO:0008758) dATP pyrophosphohydrolase activity(GO:0008828) dihydroneopterin monophosphate phosphatase activity(GO:0019176) dihydroneopterin triphosphate pyrophosphohydrolase activity(GO:0019177) dTTP diphosphatase activity(GO:0036218) phosphocholine hydrolase activity(GO:0044606) |
0.2 | 1.3 | GO:0008140 | cAMP response element binding protein binding(GO:0008140) |
0.2 | 0.8 | GO:0047499 | calcium-independent phospholipase A2 activity(GO:0047499) |
0.2 | 0.8 | GO:0048273 | mitogen-activated protein kinase p38 binding(GO:0048273) |
0.2 | 0.8 | GO:0035473 | lipase binding(GO:0035473) |
0.2 | 0.5 | GO:0070139 | ubiquitin-like protein-specific endopeptidase activity(GO:0070137) SUMO-specific endopeptidase activity(GO:0070139) |
0.2 | 1.4 | GO:0016884 | carbon-nitrogen ligase activity, with glutamine as amido-N-donor(GO:0016884) |
0.2 | 0.6 | GO:0035368 | selenocysteine insertion sequence binding(GO:0035368) |
0.2 | 0.2 | GO:0043559 | insulin binding(GO:0043559) |
0.2 | 0.5 | GO:0016802 | adenosylhomocysteinase activity(GO:0004013) trialkylsulfonium hydrolase activity(GO:0016802) |
0.2 | 0.5 | GO:0031802 | type 5 metabotropic glutamate receptor binding(GO:0031802) |
0.2 | 6.1 | GO:0000049 | tRNA binding(GO:0000049) |
0.2 | 0.2 | GO:0004723 | calcium-dependent protein serine/threonine phosphatase activity(GO:0004723) |
0.2 | 1.1 | GO:0005223 | intracellular cGMP activated cation channel activity(GO:0005223) |
0.2 | 0.8 | GO:0015349 | thyroid hormone transmembrane transporter activity(GO:0015349) |
0.2 | 1.4 | GO:0015187 | glycine transmembrane transporter activity(GO:0015187) |
0.2 | 0.9 | GO:0031730 | CCR5 chemokine receptor binding(GO:0031730) |
0.2 | 4.3 | GO:0004869 | cysteine-type endopeptidase inhibitor activity(GO:0004869) |
0.2 | 0.8 | GO:0046912 | transferase activity, transferring acyl groups, acyl groups converted into alkyl on transfer(GO:0046912) |
0.2 | 0.3 | GO:0070548 | L-glutamine aminotransferase activity(GO:0070548) |
0.2 | 1.4 | GO:0009931 | calcium-dependent protein serine/threonine kinase activity(GO:0009931) |
0.1 | 0.3 | GO:0015928 | fucosidase activity(GO:0015928) |
0.1 | 0.3 | GO:0031871 | proteinase activated receptor binding(GO:0031871) |
0.1 | 0.9 | GO:0050897 | cobalt ion binding(GO:0050897) |
0.1 | 0.6 | GO:0000400 | four-way junction DNA binding(GO:0000400) |
0.1 | 0.4 | GO:0004945 | angiotensin type II receptor activity(GO:0004945) |
0.1 | 1.0 | GO:0031545 | peptidyl-proline 4-dioxygenase activity(GO:0031545) |
0.1 | 0.3 | GO:0008035 | high-density lipoprotein particle binding(GO:0008035) |
0.1 | 1.0 | GO:0016846 | carbon-sulfur lyase activity(GO:0016846) |
0.1 | 2.4 | GO:0005229 | intracellular calcium activated chloride channel activity(GO:0005229) |
0.1 | 2.4 | GO:0004003 | ATP-dependent DNA helicase activity(GO:0004003) |
0.1 | 0.9 | GO:0042809 | vitamin D receptor binding(GO:0042809) |
0.1 | 1.6 | GO:0015301 | anion:anion antiporter activity(GO:0015301) |
0.1 | 1.0 | GO:0001135 | transcription factor activity, RNA polymerase II transcription factor recruiting(GO:0001135) |
0.1 | 1.3 | GO:0070742 | C2H2 zinc finger domain binding(GO:0070742) |
0.1 | 0.4 | GO:0008142 | oxysterol binding(GO:0008142) |
0.1 | 1.2 | GO:0015377 | cation:chloride symporter activity(GO:0015377) |
0.1 | 0.4 | GO:0010314 | phosphatidylinositol-5-phosphate binding(GO:0010314) |
0.1 | 0.3 | GO:0030284 | estrogen receptor activity(GO:0030284) |
0.1 | 5.3 | GO:0043022 | ribosome binding(GO:0043022) |
0.1 | 1.4 | GO:0015385 | sodium:proton antiporter activity(GO:0015385) potassium:proton antiporter activity(GO:0015386) |
0.1 | 0.3 | GO:0019961 | interferon binding(GO:0019961) |
0.1 | 1.7 | GO:0004745 | retinol dehydrogenase activity(GO:0004745) |
0.1 | 0.4 | GO:0045322 | unmethylated CpG binding(GO:0045322) |
0.1 | 0.4 | GO:0005222 | intracellular cAMP activated cation channel activity(GO:0005222) |
0.1 | 0.8 | GO:0097371 | MDM2/MDM4 family protein binding(GO:0097371) |
0.1 | 4.1 | GO:0097472 | cyclin-dependent protein serine/threonine kinase activity(GO:0004693) cyclin-dependent protein kinase activity(GO:0097472) |
0.1 | 0.7 | GO:0030250 | cyclase activator activity(GO:0010853) guanylate cyclase activator activity(GO:0030250) |
0.1 | 0.7 | GO:0019960 | C-X3-C chemokine binding(GO:0019960) |
0.1 | 2.9 | GO:0050136 | NADH dehydrogenase (ubiquinone) activity(GO:0008137) NADH dehydrogenase (quinone) activity(GO:0050136) |
0.1 | 0.4 | GO:0047756 | chondroitin 4-sulfotransferase activity(GO:0047756) |
0.1 | 0.7 | GO:0008097 | 5S rRNA binding(GO:0008097) |
0.1 | 0.4 | GO:0019776 | Atg8 ligase activity(GO:0019776) |
0.1 | 0.5 | GO:0000213 | tRNA-intron endonuclease activity(GO:0000213) |
0.1 | 0.5 | GO:0016286 | small conductance calcium-activated potassium channel activity(GO:0016286) |
0.1 | 1.3 | GO:0008195 | phosphatidate phosphatase activity(GO:0008195) |
0.1 | 0.5 | GO:0043237 | laminin-1 binding(GO:0043237) |
0.1 | 0.9 | GO:0031748 | D1 dopamine receptor binding(GO:0031748) |
0.1 | 0.5 | GO:0004703 | G-protein coupled receptor kinase activity(GO:0004703) |
0.1 | 1.0 | GO:0004767 | sphingomyelin phosphodiesterase activity(GO:0004767) |
0.1 | 0.3 | GO:0016894 | endonuclease activity, active with either ribo- or deoxyribonucleic acids and producing 3'-phosphomonoesters(GO:0016894) |
0.1 | 2.5 | GO:0045502 | dynein binding(GO:0045502) |
0.1 | 0.4 | GO:0031800 | type 3 metabotropic glutamate receptor binding(GO:0031800) |
0.1 | 0.4 | GO:0016971 | flavin-linked sulfhydryl oxidase activity(GO:0016971) |
0.1 | 1.7 | GO:0034185 | apolipoprotein binding(GO:0034185) |
0.1 | 0.3 | GO:0004862 | cAMP-dependent protein kinase inhibitor activity(GO:0004862) |
0.1 | 1.1 | GO:0008568 | microtubule-severing ATPase activity(GO:0008568) |
0.1 | 0.4 | GO:0019862 | IgA binding(GO:0019862) |
0.1 | 0.5 | GO:0019238 | cyclohydrolase activity(GO:0019238) |
0.1 | 0.6 | GO:0017040 | ceramidase activity(GO:0017040) |
0.1 | 5.4 | GO:0043621 | protein self-association(GO:0043621) |
0.1 | 0.6 | GO:0030957 | Tat protein binding(GO:0030957) |
0.1 | 0.4 | GO:0048030 | disaccharide binding(GO:0048030) |
0.1 | 1.7 | GO:0015035 | protein disulfide oxidoreductase activity(GO:0015035) |
0.1 | 0.9 | GO:0001846 | opsonin binding(GO:0001846) |
0.1 | 0.1 | GO:0005114 | type II transforming growth factor beta receptor binding(GO:0005114) |
0.1 | 0.2 | GO:0005176 | ErbB-2 class receptor binding(GO:0005176) |
0.1 | 1.2 | GO:0004568 | chitinase activity(GO:0004568) |
0.1 | 0.8 | GO:0019763 | immunoglobulin receptor activity(GO:0019763) |
0.1 | 0.5 | GO:0047035 | testosterone dehydrogenase (NAD+) activity(GO:0047035) |
0.1 | 0.6 | GO:0071558 | histone demethylase activity (H3-K27 specific)(GO:0071558) |
0.1 | 0.4 | GO:0005329 | dopamine transmembrane transporter activity(GO:0005329) |
0.1 | 0.4 | GO:1990247 | N6-methyladenosine-containing RNA binding(GO:1990247) |
0.1 | 0.5 | GO:0043138 | 3'-5' DNA helicase activity(GO:0043138) |
0.1 | 0.6 | GO:0017034 | Rap guanyl-nucleotide exchange factor activity(GO:0017034) |
0.1 | 2.0 | GO:0004709 | MAP kinase kinase kinase activity(GO:0004709) |
0.1 | 0.5 | GO:0003873 | 6-phosphofructo-2-kinase activity(GO:0003873) fructose-2,6-bisphosphate 2-phosphatase activity(GO:0004331) |
0.1 | 0.7 | GO:0016889 | endodeoxyribonuclease activity, producing 3'-phosphomonoesters(GO:0016889) |
0.1 | 0.4 | GO:0004739 | pyruvate dehydrogenase (acetyl-transferring) activity(GO:0004739) |
0.1 | 0.6 | GO:0003831 | beta-N-acetylglucosaminylglycopeptide beta-1,4-galactosyltransferase activity(GO:0003831) |
0.1 | 0.7 | GO:0030346 | protein phosphatase 2B binding(GO:0030346) |
0.1 | 0.5 | GO:0004060 | arylamine N-acetyltransferase activity(GO:0004060) |
0.1 | 3.5 | GO:0061650 | ubiquitin conjugating enzyme activity(GO:0061631) ubiquitin-like protein conjugating enzyme activity(GO:0061650) |
0.1 | 2.4 | GO:0004298 | threonine-type endopeptidase activity(GO:0004298) threonine-type peptidase activity(GO:0070003) |
0.1 | 0.6 | GO:0005078 | MAP-kinase scaffold activity(GO:0005078) |
0.1 | 2.0 | GO:0031489 | myosin V binding(GO:0031489) |
0.1 | 0.3 | GO:0050693 | LBD domain binding(GO:0050693) |
0.1 | 1.2 | GO:0004865 | protein serine/threonine phosphatase inhibitor activity(GO:0004865) |
0.1 | 0.3 | GO:0043120 | tumor necrosis factor binding(GO:0043120) |
0.1 | 4.8 | GO:0004722 | protein serine/threonine phosphatase activity(GO:0004722) |
0.1 | 0.2 | GO:0015562 | efflux transmembrane transporter activity(GO:0015562) |
0.1 | 1.2 | GO:0004185 | serine-type carboxypeptidase activity(GO:0004185) |
0.1 | 0.1 | GO:0051880 | G-quadruplex DNA binding(GO:0051880) |
0.1 | 1.4 | GO:0016290 | palmitoyl-CoA hydrolase activity(GO:0016290) |
0.1 | 0.1 | GO:0036222 | XTP diphosphatase activity(GO:0036222) |
0.1 | 6.0 | GO:0051082 | unfolded protein binding(GO:0051082) |
0.1 | 0.3 | GO:0005290 | L-histidine transmembrane transporter activity(GO:0005290) |
0.1 | 0.1 | GO:0004096 | catalase activity(GO:0004096) |
0.1 | 2.8 | GO:0050699 | WW domain binding(GO:0050699) |
0.1 | 0.3 | GO:0005095 | GTPase inhibitor activity(GO:0005095) |
0.1 | 0.2 | GO:0061676 | importin-alpha family protein binding(GO:0061676) |
0.1 | 4.2 | GO:0035064 | methylated histone binding(GO:0035064) |
0.1 | 0.4 | GO:0017070 | U6 snRNA binding(GO:0017070) |
0.1 | 1.1 | GO:0005337 | nucleoside transmembrane transporter activity(GO:0005337) |
0.1 | 1.0 | GO:0042500 | aspartic endopeptidase activity, intramembrane cleaving(GO:0042500) |
0.1 | 0.7 | GO:0042975 | peroxisome proliferator activated receptor binding(GO:0042975) |
0.1 | 0.4 | GO:0008297 | single-stranded DNA exodeoxyribonuclease activity(GO:0008297) |
0.1 | 1.0 | GO:0070180 | large ribosomal subunit rRNA binding(GO:0070180) |
0.1 | 1.5 | GO:1990939 | ATP-dependent microtubule motor activity(GO:1990939) |
0.1 | 0.3 | GO:0004995 | tachykinin receptor activity(GO:0004995) |
0.1 | 0.3 | GO:0031750 | D3 dopamine receptor binding(GO:0031750) |
0.1 | 2.3 | GO:0001106 | RNA polymerase II transcription corepressor activity(GO:0001106) |
0.1 | 1.0 | GO:0035497 | cAMP response element binding(GO:0035497) |
0.1 | 1.1 | GO:0017154 | semaphorin receptor activity(GO:0017154) |
0.1 | 0.8 | GO:0043024 | ribosomal small subunit binding(GO:0043024) |
0.1 | 0.3 | GO:0016823 | hydrolase activity, acting on acid carbon-carbon bonds(GO:0016822) hydrolase activity, acting on acid carbon-carbon bonds, in ketonic substances(GO:0016823) |
0.1 | 0.1 | GO:0008905 | mannose-phosphate guanylyltransferase activity(GO:0008905) |
0.1 | 2.0 | GO:0005537 | mannose binding(GO:0005537) |
0.1 | 0.5 | GO:0043522 | leucine zipper domain binding(GO:0043522) |
0.1 | 2.9 | GO:0031624 | ubiquitin conjugating enzyme binding(GO:0031624) |
0.1 | 1.5 | GO:0004708 | MAP kinase kinase activity(GO:0004708) |
0.1 | 0.2 | GO:0071074 | eukaryotic initiation factor eIF2 binding(GO:0071074) |
0.1 | 0.5 | GO:0008318 | protein prenyltransferase activity(GO:0008318) |
0.1 | 0.9 | GO:0008641 | small protein activating enzyme activity(GO:0008641) |
0.1 | 0.3 | GO:0004771 | sterol esterase activity(GO:0004771) |
0.1 | 0.3 | GO:0008422 | beta-glucosidase activity(GO:0008422) |
0.1 | 0.7 | GO:0004571 | mannosyl-oligosaccharide 1,2-alpha-mannosidase activity(GO:0004571) |
0.1 | 0.2 | GO:0016406 | carnitine O-acyltransferase activity(GO:0016406) |
0.1 | 3.9 | GO:0003777 | microtubule motor activity(GO:0003777) |
0.1 | 0.9 | GO:0005388 | calcium-transporting ATPase activity(GO:0005388) |
0.1 | 4.8 | GO:0019209 | kinase activator activity(GO:0019209) |
0.1 | 0.3 | GO:0031752 | D5 dopamine receptor binding(GO:0031752) |
0.1 | 3.7 | GO:0016830 | carbon-carbon lyase activity(GO:0016830) |
0.1 | 0.3 | GO:0004802 | transketolase activity(GO:0004802) |
0.1 | 1.2 | GO:0010181 | FMN binding(GO:0010181) |
0.1 | 0.4 | GO:0003840 | gamma-glutamyltransferase activity(GO:0003840) glutathione hydrolase activity(GO:0036374) |
0.1 | 3.9 | GO:0016836 | hydro-lyase activity(GO:0016836) |
0.1 | 0.2 | GO:0051765 | inositol tetrakisphosphate kinase activity(GO:0051765) |
0.1 | 1.0 | GO:0005542 | folic acid binding(GO:0005542) |
0.1 | 0.2 | GO:0000171 | ribonuclease MRP activity(GO:0000171) |
0.1 | 1.1 | GO:0016646 | oxidoreductase activity, acting on the CH-NH group of donors, NAD or NADP as acceptor(GO:0016646) |
0.1 | 0.8 | GO:0045294 | alpha-catenin binding(GO:0045294) |
0.1 | 0.4 | GO:0015467 | G-protein activated inward rectifier potassium channel activity(GO:0015467) |
0.1 | 0.5 | GO:0008190 | eukaryotic initiation factor 4E binding(GO:0008190) |
0.1 | 3.0 | GO:0008235 | metalloexopeptidase activity(GO:0008235) |
0.1 | 0.8 | GO:0004955 | prostaglandin receptor activity(GO:0004955) |
0.1 | 1.0 | GO:0030881 | beta-2-microglobulin binding(GO:0030881) |
0.1 | 1.1 | GO:0030515 | snoRNA binding(GO:0030515) |
0.1 | 0.1 | GO:0004676 | 3-phosphoinositide-dependent protein kinase activity(GO:0004676) |
0.1 | 0.2 | GO:0000104 | succinate dehydrogenase activity(GO:0000104) |
0.1 | 1.7 | GO:0008139 | nuclear localization sequence binding(GO:0008139) |
0.1 | 0.3 | GO:0098748 | clathrin adaptor activity(GO:0035615) endocytic adaptor activity(GO:0098748) |
0.1 | 0.7 | GO:0046933 | proton-transporting ATP synthase activity, rotational mechanism(GO:0046933) |
0.1 | 0.3 | GO:1990226 | histone methyltransferase binding(GO:1990226) |
0.1 | 0.9 | GO:0043176 | amine binding(GO:0043176) |
0.1 | 0.9 | GO:0005123 | death receptor binding(GO:0005123) |
0.1 | 0.7 | GO:0005247 | voltage-gated chloride channel activity(GO:0005247) |
0.1 | 0.4 | GO:0061133 | endopeptidase activator activity(GO:0061133) |
0.1 | 0.3 | GO:0008309 | double-stranded DNA exodeoxyribonuclease activity(GO:0008309) |
0.1 | 4.9 | GO:0004004 | ATP-dependent RNA helicase activity(GO:0004004) RNA-dependent ATPase activity(GO:0008186) |
0.1 | 0.3 | GO:0016274 | arginine N-methyltransferase activity(GO:0016273) protein-arginine N-methyltransferase activity(GO:0016274) |
0.1 | 0.3 | GO:0097016 | L27 domain binding(GO:0097016) |
0.1 | 0.4 | GO:0050051 | leukotriene-B4 20-monooxygenase activity(GO:0050051) |
0.1 | 0.1 | GO:0016937 | short-branched-chain-acyl-CoA dehydrogenase activity(GO:0016937) |
0.1 | 0.2 | GO:0010484 | H3 histone acetyltransferase activity(GO:0010484) |
0.1 | 0.3 | GO:0016520 | growth hormone-releasing hormone receptor activity(GO:0016520) |
0.1 | 1.3 | GO:0009055 | electron carrier activity(GO:0009055) |
0.1 | 0.9 | GO:0080025 | phosphatidylinositol-3,5-bisphosphate binding(GO:0080025) |
0.1 | 0.2 | GO:0070402 | NADPH binding(GO:0070402) |
0.1 | 0.4 | GO:0005412 | glucose:sodium symporter activity(GO:0005412) |
0.1 | 0.2 | GO:0016742 | hydroxymethyl-, formyl- and related transferase activity(GO:0016742) |
0.1 | 0.6 | GO:0005000 | vasopressin receptor activity(GO:0005000) |
0.1 | 0.4 | GO:0005375 | copper ion transmembrane transporter activity(GO:0005375) |
0.1 | 0.5 | GO:0042301 | phosphate ion binding(GO:0042301) |
0.1 | 0.2 | GO:0005143 | interleukin-12 receptor binding(GO:0005143) |
0.1 | 2.8 | GO:0002161 | aminoacyl-tRNA editing activity(GO:0002161) |
0.1 | 0.4 | GO:0003678 | DNA helicase activity(GO:0003678) |
0.1 | 1.4 | GO:0031593 | polyubiquitin binding(GO:0031593) |
0.1 | 0.3 | GO:0030371 | translation repressor activity(GO:0030371) |
0.1 | 1.6 | GO:0005212 | structural constituent of eye lens(GO:0005212) |
0.1 | 0.1 | GO:0016744 | transferase activity, transferring aldehyde or ketonic groups(GO:0016744) |
0.1 | 2.1 | GO:0005547 | phosphatidylinositol-3,4,5-trisphosphate binding(GO:0005547) |
0.1 | 0.1 | GO:0004461 | lactose synthase activity(GO:0004461) |
0.1 | 0.3 | GO:0004602 | glutathione peroxidase activity(GO:0004602) |
0.1 | 0.4 | GO:0008454 | alpha-1,3-mannosylglycoprotein 4-beta-N-acetylglucosaminyltransferase activity(GO:0008454) |
0.1 | 0.6 | GO:0019957 | C-C chemokine binding(GO:0019957) |
0.1 | 0.2 | GO:1901474 | azole transporter activity(GO:0045118) azole transmembrane transporter activity(GO:1901474) |
0.1 | 1.1 | GO:0016805 | dipeptidase activity(GO:0016805) |
0.1 | 0.4 | GO:0004000 | adenosine deaminase activity(GO:0004000) |
0.1 | 0.5 | GO:0001609 | G-protein coupled adenosine receptor activity(GO:0001609) |
0.1 | 0.3 | GO:0004430 | 1-phosphatidylinositol 4-kinase activity(GO:0004430) |
0.1 | 0.3 | GO:0004740 | pyruvate dehydrogenase (acetyl-transferring) kinase activity(GO:0004740) |
0.1 | 0.2 | GO:0004069 | L-aspartate:2-oxoglutarate aminotransferase activity(GO:0004069) |
0.1 | 0.2 | GO:0016634 | oxidoreductase activity, acting on the CH-CH group of donors, oxygen as acceptor(GO:0016634) |
0.1 | 0.1 | GO:0043546 | molybdopterin cofactor binding(GO:0043546) |
0.1 | 0.5 | GO:0097153 | cysteine-type endopeptidase activity involved in apoptotic process(GO:0097153) |
0.1 | 0.2 | GO:0047631 | ADP-ribose diphosphatase activity(GO:0047631) |
0.1 | 0.5 | GO:0030548 | acetylcholine receptor regulator activity(GO:0030548) neurotransmitter receptor regulator activity(GO:0099602) |
0.1 | 1.1 | GO:0031369 | translation initiation factor binding(GO:0031369) |
0.1 | 0.3 | GO:0090079 | translation activator activity(GO:0008494) translation regulator activity, nucleic acid binding(GO:0090079) |
0.1 | 0.6 | GO:0004415 | hyalurononglucosaminidase activity(GO:0004415) |
0.1 | 0.1 | GO:1990932 | 5.8S rRNA binding(GO:1990932) |
0.1 | 2.7 | GO:0043765 | integrase activity(GO:0008907) T/G mismatch-specific endonuclease activity(GO:0043765) retroviral integrase activity(GO:0044823) retroviral 3' processing activity(GO:0044824) |
0.1 | 0.6 | GO:0050649 | testosterone 6-beta-hydroxylase activity(GO:0050649) |
0.1 | 0.3 | GO:0000293 | ferric-chelate reductase activity(GO:0000293) |
0.1 | 0.1 | GO:0015924 | mannosyl-oligosaccharide mannosidase activity(GO:0015924) |
0.1 | 0.1 | GO:0042296 | ISG15 transferase activity(GO:0042296) |
0.1 | 0.2 | GO:0008597 | calcium-dependent protein serine/threonine phosphatase regulator activity(GO:0008597) |
0.1 | 0.2 | GO:0050145 | nucleoside phosphate kinase activity(GO:0050145) |
0.1 | 0.1 | GO:0001226 | RNA polymerase II transcription corepressor binding(GO:0001226) |
0.1 | 0.5 | GO:0016595 | glutamate binding(GO:0016595) |
0.1 | 0.1 | GO:0051864 | histone demethylase activity (H3-K36 specific)(GO:0051864) |
0.1 | 0.1 | GO:0070915 | lysophosphatidic acid receptor activity(GO:0070915) |
0.1 | 0.9 | GO:0015643 | toxic substance binding(GO:0015643) |
0.1 | 0.6 | GO:0034236 | protein kinase A catalytic subunit binding(GO:0034236) |
0.1 | 0.2 | GO:0004920 | interleukin-10 receptor activity(GO:0004920) |
0.1 | 0.2 | GO:0000182 | rDNA binding(GO:0000182) |
0.1 | 1.6 | GO:0016790 | thiolester hydrolase activity(GO:0016790) |
0.1 | 5.0 | GO:0019903 | protein phosphatase binding(GO:0019903) |
0.1 | 0.1 | GO:0030249 | guanylate cyclase regulator activity(GO:0030249) |
0.1 | 0.1 | GO:0018423 | protein C-terminal leucine carboxyl O-methyltransferase activity(GO:0018423) |
0.1 | 1.0 | GO:0015175 | neutral amino acid transmembrane transporter activity(GO:0015175) |
0.1 | 0.9 | GO:0016500 | protein-hormone receptor activity(GO:0016500) |
0.1 | 0.8 | GO:0005048 | signal sequence binding(GO:0005048) |
0.1 | 0.2 | GO:0033829 | O-fucosylpeptide 3-beta-N-acetylglucosaminyltransferase activity(GO:0033829) |
0.1 | 0.3 | GO:0051431 | corticotropin-releasing hormone receptor 2 binding(GO:0051431) |
0.1 | 0.8 | GO:0003746 | translation elongation factor activity(GO:0003746) |
0.1 | 0.1 | GO:0045340 | mercury ion binding(GO:0045340) |
0.1 | 0.3 | GO:0035925 | mRNA 3'-UTR AU-rich region binding(GO:0035925) |
0.1 | 0.8 | GO:0008553 | hydrogen-exporting ATPase activity, phosphorylative mechanism(GO:0008553) |
0.1 | 0.6 | GO:0001671 | ATPase activator activity(GO:0001671) |
0.1 | 0.1 | GO:0090482 | vitamin transmembrane transporter activity(GO:0090482) |
0.1 | 0.4 | GO:0045545 | syndecan binding(GO:0045545) |
0.1 | 1.6 | GO:0034061 | DNA polymerase activity(GO:0034061) |
0.1 | 0.1 | GO:0008192 | RNA guanylyltransferase activity(GO:0008192) |
0.1 | 0.1 | GO:1990715 | mRNA CDS binding(GO:1990715) |
0.1 | 0.4 | GO:0097027 | ubiquitin-protein transferase activator activity(GO:0097027) |
0.1 | 0.2 | GO:0008260 | 3-oxoacid CoA-transferase activity(GO:0008260) |
0.1 | 0.1 | GO:0016015 | morphogen activity(GO:0016015) |
0.1 | 2.5 | GO:0002039 | p53 binding(GO:0002039) |
0.1 | 0.1 | GO:0004045 | aminoacyl-tRNA hydrolase activity(GO:0004045) |
0.1 | 0.1 | GO:0031404 | chloride ion binding(GO:0031404) |
0.1 | 0.4 | GO:0004579 | dolichyl-diphosphooligosaccharide-protein glycotransferase activity(GO:0004579) |
0.1 | 0.2 | GO:0016661 | oxidoreductase activity, acting on other nitrogenous compounds as donors(GO:0016661) |
0.1 | 0.5 | GO:0050321 | tau-protein kinase activity(GO:0050321) |
0.1 | 0.1 | GO:0032454 | histone demethylase activity (H3-K9 specific)(GO:0032454) |
0.1 | 1.7 | GO:0017112 | Rab guanyl-nucleotide exchange factor activity(GO:0017112) |
0.1 | 0.2 | GO:0030628 | pre-mRNA 3'-splice site binding(GO:0030628) |
0.1 | 0.1 | GO:0004439 | phosphatidylinositol-4,5-bisphosphate 5-phosphatase activity(GO:0004439) |
0.1 | 4.0 | GO:0016427 | tRNA (cytosine) methyltransferase activity(GO:0016427) tRNA (cytosine-5-)-methyltransferase activity(GO:0016428) |
0.1 | 0.1 | GO:0070699 | type II activin receptor binding(GO:0070699) |
0.1 | 0.2 | GO:0017176 | phosphatidylinositol N-acetylglucosaminyltransferase activity(GO:0017176) |
0.1 | 0.2 | GO:0043028 | cysteine-type endopeptidase regulator activity involved in apoptotic process(GO:0043028) |
0.1 | 0.3 | GO:0001054 | RNA polymerase I activity(GO:0001054) |
0.1 | 0.2 | GO:0004303 | estradiol 17-beta-dehydrogenase activity(GO:0004303) |
0.1 | 0.1 | GO:1990188 | euchromatin binding(GO:1990188) |
0.1 | 0.9 | GO:0051059 | NF-kappaB binding(GO:0051059) |
0.1 | 0.2 | GO:0047276 | N-acetyllactosaminide 3-alpha-galactosyltransferase activity(GO:0047276) |
0.1 | 0.1 | GO:0016778 | diphosphotransferase activity(GO:0016778) |
0.1 | 0.5 | GO:0019869 | chloride channel inhibitor activity(GO:0019869) |
0.1 | 0.9 | GO:0031492 | nucleosomal DNA binding(GO:0031492) |
0.1 | 0.2 | GO:0017127 | cholesterol transporter activity(GO:0017127) |
0.1 | 0.2 | GO:0008332 | low voltage-gated calcium channel activity(GO:0008332) |
0.1 | 0.4 | GO:0008508 | bile acid:sodium symporter activity(GO:0008508) |
0.1 | 0.2 | GO:0016655 | oxidoreductase activity, acting on NAD(P)H, quinone or similar compound as acceptor(GO:0016655) |
0.1 | 0.6 | GO:0030291 | protein serine/threonine kinase inhibitor activity(GO:0030291) |
0.1 | 0.9 | GO:0005035 | tumor necrosis factor-activated receptor activity(GO:0005031) death receptor activity(GO:0005035) |
0.1 | 0.2 | GO:0004301 | epoxide hydrolase activity(GO:0004301) |
0.1 | 0.5 | GO:0004806 | triglyceride lipase activity(GO:0004806) |
0.1 | 0.4 | GO:0038036 | sphingosine-1-phosphate receptor activity(GO:0038036) |
0.1 | 2.1 | GO:0005507 | copper ion binding(GO:0005507) |
0.1 | 0.5 | GO:0019787 | ubiquitin-like protein transferase activity(GO:0019787) |
0.1 | 7.5 | GO:0061630 | ubiquitin protein ligase activity(GO:0061630) |
0.1 | 10.0 | GO:0003735 | structural constituent of ribosome(GO:0003735) |
0.1 | 0.2 | GO:0072345 | NAADP-sensitive calcium-release channel activity(GO:0072345) |
0.1 | 0.2 | GO:0004090 | carbonyl reductase (NADPH) activity(GO:0004090) |
0.1 | 2.6 | GO:0019003 | GDP binding(GO:0019003) |
0.1 | 0.6 | GO:0001730 | 2'-5'-oligoadenylate synthetase activity(GO:0001730) |
0.1 | 0.3 | GO:0005166 | neurotrophin p75 receptor binding(GO:0005166) |
0.1 | 0.3 | GO:0004645 | phosphorylase activity(GO:0004645) |
0.1 | 0.2 | GO:0004366 | glycerol-3-phosphate O-acyltransferase activity(GO:0004366) |
0.1 | 0.5 | GO:0016493 | C-C chemokine receptor activity(GO:0016493) |
0.1 | 8.3 | GO:0004842 | ubiquitin-protein transferase activity(GO:0004842) |
0.1 | 0.4 | GO:0016868 | intramolecular transferase activity, phosphotransferases(GO:0016868) |
0.1 | 0.2 | GO:0004563 | beta-N-acetylhexosaminidase activity(GO:0004563) |
0.1 | 0.2 | GO:0016174 | NAD(P)H oxidase activity(GO:0016174) |
0.1 | 0.1 | GO:0086008 | voltage-gated potassium channel activity involved in cardiac muscle cell action potential repolarization(GO:0086008) |
0.1 | 0.1 | GO:0015927 | trehalase activity(GO:0015927) |
0.1 | 0.2 | GO:0047184 | 1-acylglycerophosphocholine O-acyltransferase activity(GO:0047184) |
0.1 | 0.2 | GO:0097322 | 7SK snRNA binding(GO:0097322) |
0.1 | 4.8 | GO:0017137 | Rab GTPase binding(GO:0017137) |
0.1 | 0.1 | GO:0032557 | pyrimidine ribonucleotide binding(GO:0032557) |
0.1 | 0.1 | GO:0097602 | cullin family protein binding(GO:0097602) |
0.1 | 0.2 | GO:0045134 | uridine-diphosphatase activity(GO:0045134) |
0.1 | 0.3 | GO:0019855 | calcium channel inhibitor activity(GO:0019855) |
0.1 | 0.5 | GO:0070273 | phosphatidylinositol-4-phosphate binding(GO:0070273) |
0.1 | 0.1 | GO:0010485 | H4 histone acetyltransferase activity(GO:0010485) |
0.1 | 0.1 | GO:0004711 | ribosomal protein S6 kinase activity(GO:0004711) |
0.1 | 0.3 | GO:0016176 | superoxide-generating NADPH oxidase activator activity(GO:0016176) |
0.1 | 0.1 | GO:0034988 | Fc-gamma receptor I complex binding(GO:0034988) |
0.1 | 0.1 | GO:0002060 | purine nucleobase binding(GO:0002060) |
0.1 | 0.6 | GO:0051019 | mitogen-activated protein kinase binding(GO:0051019) |
0.1 | 0.3 | GO:0008440 | inositol-1,4,5-trisphosphate 3-kinase activity(GO:0008440) |
0.1 | 0.6 | GO:0047555 | 3',5'-cyclic-GMP phosphodiesterase activity(GO:0047555) |
0.1 | 0.3 | GO:0070008 | serine-type exopeptidase activity(GO:0070008) |
0.1 | 0.1 | GO:0030911 | TPR domain binding(GO:0030911) |
0.0 | 0.0 | GO:0008413 | 8-oxo-7,8-dihydroguanosine triphosphate pyrophosphatase activity(GO:0008413) |
0.0 | 0.1 | GO:0052658 | inositol-1,4,5-trisphosphate 5-phosphatase activity(GO:0052658) |
0.0 | 0.1 | GO:0008239 | dipeptidyl-peptidase activity(GO:0008239) |
0.0 | 0.2 | GO:0004445 | inositol-polyphosphate 5-phosphatase activity(GO:0004445) |
0.0 | 0.2 | GO:0003841 | 1-acylglycerol-3-phosphate O-acyltransferase activity(GO:0003841) |
0.0 | 0.2 | GO:0005134 | interleukin-2 receptor binding(GO:0005134) |
0.0 | 0.2 | GO:0004128 | cytochrome-b5 reductase activity, acting on NAD(P)H(GO:0004128) |
0.0 | 0.1 | GO:0035727 | lysophosphatidic acid binding(GO:0035727) |
0.0 | 0.0 | GO:0032405 | MutLalpha complex binding(GO:0032405) |
0.0 | 0.2 | GO:0033130 | acetylcholine receptor binding(GO:0033130) |
0.0 | 0.7 | GO:0003725 | double-stranded RNA binding(GO:0003725) |
0.0 | 0.2 | GO:0035612 | AP-2 adaptor complex binding(GO:0035612) |
0.0 | 0.1 | GO:0008131 | primary amine oxidase activity(GO:0008131) |
0.0 | 0.1 | GO:0042895 | antibiotic transporter activity(GO:0042895) |
0.0 | 0.2 | GO:0004177 | aminopeptidase activity(GO:0004177) |
0.0 | 0.1 | GO:0008271 | secondary active sulfate transmembrane transporter activity(GO:0008271) |
0.0 | 1.4 | GO:0052770 | coenzyme F390-A hydrolase activity(GO:0052770) coenzyme F390-G hydrolase activity(GO:0052771) |
0.0 | 0.1 | GO:0001075 | transcription factor activity, RNA polymerase II core promoter sequence-specific binding involved in preinitiation complex assembly(GO:0001075) |
0.0 | 1.6 | GO:0003755 | peptidyl-prolyl cis-trans isomerase activity(GO:0003755) |
0.0 | 0.1 | GO:0043531 | ADP binding(GO:0043531) |
0.0 | 0.1 | GO:0030229 | very-low-density lipoprotein particle receptor activity(GO:0030229) |
0.0 | 0.2 | GO:0031996 | thioesterase binding(GO:0031996) |
0.0 | 0.2 | GO:0017110 | nucleoside-diphosphatase activity(GO:0017110) |
0.0 | 0.0 | GO:0046979 | TAP binding(GO:0046977) TAP1 binding(GO:0046978) TAP2 binding(GO:0046979) |
0.0 | 0.0 | GO:0004529 | exodeoxyribonuclease activity(GO:0004529) exodeoxyribonuclease activity, producing 5'-phosphomonoesters(GO:0016895) |
0.0 | 0.1 | GO:0070300 | phosphatidic acid binding(GO:0070300) |
0.0 | 0.1 | GO:0001595 | angiotensin receptor activity(GO:0001595) |
0.0 | 0.2 | GO:0035174 | histone serine kinase activity(GO:0035174) |
0.0 | 0.7 | GO:0001221 | transcription cofactor binding(GO:0001221) |
0.0 | 0.6 | GO:0015925 | galactosidase activity(GO:0015925) |
0.0 | 0.3 | GO:0050700 | CARD domain binding(GO:0050700) |
0.0 | 0.2 | GO:0052813 | phosphatidylinositol bisphosphate kinase activity(GO:0052813) |
0.0 | 0.2 | GO:0001727 | lipid kinase activity(GO:0001727) |
0.0 | 0.8 | GO:0031683 | G-protein beta/gamma-subunit complex binding(GO:0031683) |
0.0 | 0.0 | GO:0004694 | eukaryotic translation initiation factor 2alpha kinase activity(GO:0004694) |
0.0 | 2.8 | GO:0019207 | kinase regulator activity(GO:0019207) |
0.0 | 0.2 | GO:0015189 | arginine transmembrane transporter activity(GO:0015181) L-lysine transmembrane transporter activity(GO:0015189) |
0.0 | 0.6 | GO:0001103 | RNA polymerase II repressing transcription factor binding(GO:0001103) |
0.0 | 0.1 | GO:0005047 | signal recognition particle binding(GO:0005047) |
0.0 | 0.1 | GO:0017089 | glycolipid transporter activity(GO:0017089) |
0.0 | 0.1 | GO:0016004 | phospholipase activator activity(GO:0016004) |
0.0 | 0.3 | GO:0005092 | GDP-dissociation inhibitor activity(GO:0005092) |
0.0 | 0.1 | GO:0050833 | pyruvate transmembrane transporter activity(GO:0050833) |
0.0 | 0.1 | GO:0016453 | acetyl-CoA C-acetyltransferase activity(GO:0003985) C-acetyltransferase activity(GO:0016453) |
0.0 | 8.2 | GO:0005525 | GTP binding(GO:0005525) |
0.0 | 0.2 | GO:0001758 | retinal dehydrogenase activity(GO:0001758) |
0.0 | 1.2 | GO:0019902 | phosphatase binding(GO:0019902) |
0.0 | 0.1 | GO:0015440 | peptide-transporting ATPase activity(GO:0015440) |
0.0 | 0.2 | GO:0003910 | DNA ligase activity(GO:0003909) DNA ligase (ATP) activity(GO:0003910) |
0.0 | 1.0 | GO:0015171 | amino acid transmembrane transporter activity(GO:0015171) |
0.0 | 0.2 | GO:0047238 | glucuronosyl-N-acetylgalactosaminyl-proteoglycan 4-beta-N-acetylgalactosaminyltransferase activity(GO:0047238) |
0.0 | 0.1 | GO:0008599 | protein phosphatase type 1 regulator activity(GO:0008599) |
0.0 | 1.7 | GO:0051219 | phosphoprotein binding(GO:0051219) |
0.0 | 0.1 | GO:0046975 | histone methyltransferase activity (H3-K36 specific)(GO:0046975) |
0.0 | 0.0 | GO:0023029 | MHC class Ib protein binding(GO:0023029) |
0.0 | 0.2 | GO:0004966 | galanin receptor activity(GO:0004966) |
0.0 | 0.5 | GO:0004012 | phospholipid-translocating ATPase activity(GO:0004012) |
0.0 | 0.2 | GO:0003916 | DNA topoisomerase activity(GO:0003916) |
0.0 | 0.3 | GO:0005521 | lamin binding(GO:0005521) |
0.0 | 0.0 | GO:0004525 | ribonuclease III activity(GO:0004525) double-stranded RNA-specific ribonuclease activity(GO:0032296) |
0.0 | 0.2 | GO:0031491 | nucleosome binding(GO:0031491) |
0.0 | 0.2 | GO:0008320 | protein transmembrane transporter activity(GO:0008320) |
0.0 | 0.0 | GO:0004667 | prostaglandin-D synthase activity(GO:0004667) |
0.0 | 0.1 | GO:0003988 | acetyl-CoA C-acyltransferase activity(GO:0003988) |
0.0 | 0.5 | GO:0005242 | inward rectifier potassium channel activity(GO:0005242) |
0.0 | 0.1 | GO:0003953 | NAD+ nucleosidase activity(GO:0003953) |
0.0 | 0.1 | GO:0004689 | phosphorylase kinase activity(GO:0004689) |
0.0 | 0.3 | GO:0008409 | 5'-3' exonuclease activity(GO:0008409) |
0.0 | 0.1 | GO:1901505 | carbohydrate derivative transporter activity(GO:1901505) |
0.0 | 0.1 | GO:0042162 | telomeric DNA binding(GO:0042162) |
0.0 | 0.3 | GO:0017160 | Ral GTPase binding(GO:0017160) |
0.0 | 0.2 | GO:0016405 | CoA-ligase activity(GO:0016405) |
0.0 | 0.7 | GO:0052634 | sulfonate dioxygenase activity(GO:0000907) 2,4-dichlorophenoxyacetate alpha-ketoglutarate dioxygenase activity(GO:0018602) hypophosphite dioxygenase activity(GO:0034792) gibberellin 2-beta-dioxygenase activity(GO:0045543) C-19 gibberellin 2-beta-dioxygenase activity(GO:0052634) C-20 gibberellin 2-beta-dioxygenase activity(GO:0052635) |
0.0 | 0.2 | GO:0016641 | oxidoreductase activity, acting on the CH-NH2 group of donors, oxygen as acceptor(GO:0016641) |
0.0 | 0.1 | GO:0004942 | anaphylatoxin receptor activity(GO:0004942) |
0.0 | 0.1 | GO:0016774 | phosphotransferase activity, carboxyl group as acceptor(GO:0016774) |
0.0 | 0.2 | GO:0015271 | outward rectifier potassium channel activity(GO:0015271) |
0.0 | 0.2 | GO:0019958 | C-X-C chemokine binding(GO:0019958) |
0.0 | 0.5 | GO:0001594 | trace-amine receptor activity(GO:0001594) |
0.0 | 0.1 | GO:0016888 | endodeoxyribonuclease activity, producing 5'-phosphomonoesters(GO:0016888) |
0.0 | 0.1 | GO:0019956 | chemokine binding(GO:0019956) |
0.0 | 0.0 | GO:0055056 | D-glucose transmembrane transporter activity(GO:0055056) |
0.0 | 0.2 | GO:0016863 | intramolecular oxidoreductase activity, transposing C=C bonds(GO:0016863) |
0.0 | 0.1 | GO:0008199 | ferric iron binding(GO:0008199) |
0.0 | 0.0 | GO:0030792 | methylarsonite methyltransferase activity(GO:0030792) |
0.0 | 0.1 | GO:0016803 | hydrolase activity, acting on ether bonds(GO:0016801) ether hydrolase activity(GO:0016803) |
0.0 | 0.2 | GO:0033691 | sialic acid binding(GO:0033691) |
0.0 | 0.4 | GO:0016849 | phosphorus-oxygen lyase activity(GO:0016849) |
0.0 | 0.1 | GO:0031419 | cobalamin binding(GO:0031419) |
0.0 | 0.2 | GO:0004596 | peptide alpha-N-acetyltransferase activity(GO:0004596) |
0.0 | 0.1 | GO:0070053 | thrombospondin receptor activity(GO:0070053) |
0.0 | 0.5 | GO:0032813 | tumor necrosis factor receptor superfamily binding(GO:0032813) |
0.0 | 0.1 | GO:0005436 | sodium:phosphate symporter activity(GO:0005436) |
0.0 | 0.1 | GO:0103116 | alpha-D-galactofuranose transporter activity(GO:0103116) |
0.0 | 0.0 | GO:0045182 | translation regulator activity(GO:0045182) |
0.0 | 0.3 | GO:0050811 | GABA receptor binding(GO:0050811) |
0.0 | 0.5 | GO:0070063 | RNA polymerase binding(GO:0070063) |
0.0 | 1.6 | GO:0042393 | histone binding(GO:0042393) |
0.0 | 0.6 | GO:0005385 | zinc ion transmembrane transporter activity(GO:0005385) |
0.0 | 0.1 | GO:0043047 | single-stranded telomeric DNA binding(GO:0043047) |
0.0 | 4.6 | GO:0004252 | serine-type endopeptidase activity(GO:0004252) |
0.0 | 0.1 | GO:0015926 | glucosidase activity(GO:0015926) |
0.0 | 1.5 | GO:0016627 | oxidoreductase activity, acting on the CH-CH group of donors(GO:0016627) |
0.0 | 0.1 | GO:0016886 | ligase activity, forming phosphoric ester bonds(GO:0016886) |
0.0 | 0.0 | GO:1990405 | protein antigen binding(GO:1990405) |
0.0 | 0.1 | GO:0004468 | lysine N-acetyltransferase activity, acting on acetyl phosphate as donor(GO:0004468) |
0.0 | 0.5 | GO:0005540 | hyaluronic acid binding(GO:0005540) |
0.0 | 0.3 | GO:0045236 | CXCR chemokine receptor binding(GO:0045236) |
0.0 | 0.4 | GO:0003684 | damaged DNA binding(GO:0003684) |
0.0 | 0.1 | GO:0019206 | nucleoside kinase activity(GO:0019206) |
0.0 | 0.5 | GO:0004198 | calcium-dependent cysteine-type endopeptidase activity(GO:0004198) |
0.0 | 0.2 | GO:0070679 | inositol 1,4,5 trisphosphate binding(GO:0070679) |
0.0 | 0.1 | GO:0005138 | interleukin-6 receptor binding(GO:0005138) |
0.0 | 14.6 | GO:0044822 | poly(A) RNA binding(GO:0044822) |
0.0 | 0.1 | GO:0004652 | polynucleotide adenylyltransferase activity(GO:0004652) |
0.0 | 0.6 | GO:0019706 | protein-cysteine S-palmitoyltransferase activity(GO:0019706) |
0.0 | 4.1 | GO:0004857 | enzyme inhibitor activity(GO:0004857) |
0.0 | 2.0 | GO:0000287 | magnesium ion binding(GO:0000287) |
0.0 | 0.0 | GO:0015018 | galactosylgalactosylxylosylprotein 3-beta-glucuronosyltransferase activity(GO:0015018) |
0.0 | 0.5 | GO:0016749 | N-succinyltransferase activity(GO:0016749) |
0.0 | 3.8 | GO:0016818 | hydrolase activity, acting on acid anhydrides, in phosphorus-containing anhydrides(GO:0016818) |
0.0 | 0.1 | GO:0035381 | extracellular ATP-gated cation channel activity(GO:0004931) ATP-gated ion channel activity(GO:0035381) |
0.0 | 0.2 | GO:0001786 | phosphatidylserine binding(GO:0001786) |
0.0 | 1.0 | GO:0004702 | receptor signaling protein serine/threonine kinase activity(GO:0004702) |
0.0 | 0.5 | GO:0016860 | intramolecular oxidoreductase activity(GO:0016860) |
0.0 | 0.6 | GO:0005544 | calcium-dependent phospholipid binding(GO:0005544) |
0.0 | 0.1 | GO:0042577 | lipid phosphatase activity(GO:0042577) |
0.0 | 0.1 | GO:0031708 | endothelin B receptor binding(GO:0031708) |
0.0 | 1.9 | GO:0005550 | pheromone binding(GO:0005550) |
0.0 | 0.0 | GO:0070569 | uridylyltransferase activity(GO:0070569) |
0.0 | 0.1 | GO:0030021 | extracellular matrix structural constituent conferring compression resistance(GO:0030021) structural constituent of tooth enamel(GO:0030345) |
0.0 | 0.1 | GO:0003688 | DNA replication origin binding(GO:0003688) |
0.0 | 0.1 | GO:0004028 | 3-chloroallyl aldehyde dehydrogenase activity(GO:0004028) |
0.0 | 0.1 | GO:0003923 | GPI-anchor transamidase activity(GO:0003923) |
0.0 | 0.3 | GO:0001965 | G-protein alpha-subunit binding(GO:0001965) |
0.0 | 0.1 | GO:0004977 | melanocortin receptor activity(GO:0004977) |
0.0 | 0.6 | GO:0016712 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, reduced flavin or flavoprotein as one donor, and incorporation of one atom of oxygen(GO:0016712) |
0.0 | 0.0 | GO:0004954 | prostanoid receptor activity(GO:0004954) |
0.0 | 0.0 | GO:0004075 | biotin carboxylase activity(GO:0004075) |
0.0 | 0.0 | GO:0016842 | amidine-lyase activity(GO:0016842) |
0.0 | 0.0 | GO:0051990 | (R)-2-hydroxyglutarate dehydrogenase activity(GO:0051990) |
0.0 | 0.6 | GO:0000979 | RNA polymerase II core promoter sequence-specific DNA binding(GO:0000979) |
0.0 | 0.2 | GO:0017134 | fibroblast growth factor binding(GO:0017134) |
0.0 | 0.1 | GO:0102336 | fatty acid elongase activity(GO:0009922) 3-oxo-arachidoyl-CoA synthase activity(GO:0102336) 3-oxo-cerotoyl-CoA synthase activity(GO:0102337) 3-oxo-lignoceronyl-CoA synthase activity(GO:0102338) |
0.0 | 0.1 | GO:0008430 | selenium binding(GO:0008430) |
0.0 | 0.2 | GO:0004697 | protein kinase C activity(GO:0004697) |
0.0 | 1.0 | GO:0004725 | protein tyrosine phosphatase activity(GO:0004725) |
0.0 | 0.2 | GO:0016651 | oxidoreductase activity, acting on NAD(P)H(GO:0016651) |
0.0 | 0.0 | GO:0070698 | type I activin receptor binding(GO:0070698) |
0.0 | 0.0 | GO:0004505 | phenylalanine 4-monooxygenase activity(GO:0004505) |
0.0 | 0.1 | GO:0008532 | N-acetyllactosaminide beta-1,3-N-acetylglucosaminyltransferase activity(GO:0008532) |
0.0 | 0.1 | GO:0001848 | complement binding(GO:0001848) |
0.0 | 0.3 | GO:0034212 | peptide N-acetyltransferase activity(GO:0034212) |
0.0 | 0.0 | GO:0032452 | histone demethylase activity(GO:0032452) |
0.0 | 0.0 | GO:0034618 | arginine binding(GO:0034618) |
0.0 | 2.6 | GO:0005125 | cytokine activity(GO:0005125) |
0.0 | 0.2 | GO:0015095 | magnesium ion transmembrane transporter activity(GO:0015095) |
0.0 | 0.1 | GO:0071889 | 14-3-3 protein binding(GO:0071889) |
0.0 | 0.1 | GO:0004982 | N-formyl peptide receptor activity(GO:0004982) |
0.0 | 0.1 | GO:0042288 | MHC class I protein binding(GO:0042288) |
0.0 | 0.1 | GO:0008467 | [heparan sulfate]-glucosamine 3-sulfotransferase 1 activity(GO:0008467) |
0.0 | 0.1 | GO:0001972 | retinoic acid binding(GO:0001972) |
0.0 | 0.0 | GO:0019864 | IgG binding(GO:0019864) |
0.0 | 0.0 | GO:0004965 | G-protein coupled GABA receptor activity(GO:0004965) |
0.0 | 0.0 | GO:0048185 | activin binding(GO:0048185) |
0.0 | 0.0 | GO:0015101 | organic cation transmembrane transporter activity(GO:0015101) |
0.0 | 0.1 | GO:0016929 | SUMO-specific protease activity(GO:0016929) |
0.0 | 0.0 | GO:0016899 | oxidoreductase activity, acting on the CH-OH group of donors, oxygen as acceptor(GO:0016899) |
0.0 | 0.1 | GO:0003828 | alpha-N-acetylneuraminate alpha-2,8-sialyltransferase activity(GO:0003828) |
0.0 | 0.1 | GO:0031849 | olfactory receptor binding(GO:0031849) |
0.0 | 0.2 | GO:0051117 | ATPase binding(GO:0051117) |
0.0 | 0.2 | GO:0016875 | ligase activity, forming carbon-oxygen bonds(GO:0016875) ligase activity, forming aminoacyl-tRNA and related compounds(GO:0016876) |
0.0 | 0.2 | GO:0016765 | transferase activity, transferring alkyl or aryl (other than methyl) groups(GO:0016765) |
0.0 | 0.3 | GO:0005251 | delayed rectifier potassium channel activity(GO:0005251) |
0.0 | 0.0 | GO:0048406 | nerve growth factor binding(GO:0048406) |
0.0 | 0.0 | GO:0019863 | IgE binding(GO:0019863) |
0.0 | 0.0 | GO:0050692 | DBD domain binding(GO:0050692) |
0.0 | 0.4 | GO:0018721 | N-acetylglucosamine 6-O-sulfotransferase activity(GO:0001517) heparan sulfate 2-O-sulfotransferase activity(GO:0004394) HNK-1 sulfotransferase activity(GO:0016232) heparan sulfate 6-O-sulfotransferase activity(GO:0017095) trans-9R,10R-dihydrodiolphenanthrene sulfotransferase activity(GO:0018721) 1-phenanthrol sulfotransferase activity(GO:0018722) 3-phenanthrol sulfotransferase activity(GO:0018723) 4-phenanthrol sulfotransferase activity(GO:0018724) trans-3,4-dihydrodiolphenanthrene sulfotransferase activity(GO:0018725) 9-phenanthrol sulfotransferase activity(GO:0018726) 2-phenanthrol sulfotransferase activity(GO:0018727) phenanthrol sulfotransferase activity(GO:0019111) 1-hydroxypyrene sulfotransferase activity(GO:0034930) proteoglycan sulfotransferase activity(GO:0050698) cholesterol sulfotransferase activity(GO:0051922) hydroxyjasmonate sulfotransferase activity(GO:0080131) |
0.0 | 0.0 | GO:0031705 | bombesin receptor binding(GO:0031705) |
0.0 | 0.0 | GO:0001515 | opioid peptide activity(GO:0001515) |
0.0 | 0.0 | GO:0098639 | collagen binding involved in cell-matrix adhesion(GO:0098639) |
0.0 | 0.0 | GO:0001591 | dopamine neurotransmitter receptor activity, coupled via Gi/Go(GO:0001591) |
0.0 | 0.0 | GO:0008970 | phosphatidylcholine 1-acylhydrolase activity(GO:0008970) |
0.0 | 0.1 | GO:0004029 | aldehyde dehydrogenase (NAD) activity(GO:0004029) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.6 | 2.2 | PID IL6 7 PATHWAY | IL6-mediated signaling events |
0.4 | 3.5 | PID P38 GAMMA DELTA PATHWAY | Signaling mediated by p38-gamma and p38-delta |
0.3 | 5.0 | ST WNT CA2 CYCLIC GMP PATHWAY | Wnt/Ca2+/cyclic GMP signaling. |
0.3 | 6.6 | PID IL3 PATHWAY | IL3-mediated signaling events |
0.3 | 0.5 | PID A6B1 A6B4 INTEGRIN PATHWAY | a6b1 and a6b4 Integrin signaling |
0.2 | 0.2 | SIG CHEMOTAXIS | Genes related to chemotaxis |
0.2 | 0.2 | PID MAPK TRK PATHWAY | Trk receptor signaling mediated by the MAPK pathway |
0.2 | 5.1 | PID TRAIL PATHWAY | TRAIL signaling pathway |
0.2 | 4.6 | PID IL2 STAT5 PATHWAY | IL2 signaling events mediated by STAT5 |
0.2 | 3.3 | PID IL2 PI3K PATHWAY | IL2 signaling events mediated by PI3K |
0.2 | 9.1 | PID HNF3B PATHWAY | FOXA2 and FOXA3 transcription factor networks |
0.2 | 3.0 | PID SMAD2 3PATHWAY | Regulation of cytoplasmic and nuclear SMAD2/3 signaling |
0.2 | 0.4 | ST GAQ PATHWAY | G alpha q Pathway |
0.2 | 4.3 | PID TCR CALCIUM PATHWAY | Calcium signaling in the CD4+ TCR pathway |
0.2 | 0.2 | PID EPHA2 FWD PATHWAY | EPHA2 forward signaling |
0.2 | 1.7 | PID WNT NONCANONICAL PATHWAY | Noncanonical Wnt signaling pathway |
0.2 | 1.3 | PID CXCR4 PATHWAY | CXCR4-mediated signaling events |
0.2 | 2.2 | PID HIF1A PATHWAY | Hypoxic and oxygen homeostasis regulation of HIF-1-alpha |
0.2 | 4.9 | SIG PIP3 SIGNALING IN B LYMPHOCYTES | Genes related to PIP3 signaling in B lymphocytes |
0.2 | 7.6 | PID AR PATHWAY | Coregulation of Androgen receptor activity |
0.2 | 0.8 | ST INTERFERON GAMMA PATHWAY | Interferon gamma pathway. |
0.2 | 5.9 | PID LKB1 PATHWAY | LKB1 signaling events |
0.2 | 2.5 | SA CASPASE CASCADE | Apoptosis is mediated by caspases, cysteine proteases arranged in a proteolytic cascade. |
0.2 | 2.9 | PID ARF 3PATHWAY | Arf1 pathway |
0.2 | 1.3 | SA G2 AND M PHASES | Cdc25 activates the cdc2/cyclin B complex to induce the G2/M transition. |
0.2 | 4.0 | PID INTEGRIN2 PATHWAY | Beta2 integrin cell surface interactions |
0.1 | 4.7 | PID FOXO PATHWAY | FoxO family signaling |
0.1 | 0.4 | PID IL5 PATHWAY | IL5-mediated signaling events |
0.1 | 3.0 | PID TCPTP PATHWAY | Signaling events mediated by TCPTP |
0.1 | 2.8 | PID IFNG PATHWAY | IFN-gamma pathway |
0.1 | 1.0 | PID THROMBIN PAR1 PATHWAY | PAR1-mediated thrombin signaling events |
0.1 | 3.4 | PID TNF PATHWAY | TNF receptor signaling pathway |
0.1 | 4.0 | PID CASPASE PATHWAY | Caspase cascade in apoptosis |
0.1 | 0.1 | PID ERB GENOMIC PATHWAY | Validated nuclear estrogen receptor beta network |
0.1 | 1.6 | PID INTEGRIN5 PATHWAY | Beta5 beta6 beta7 and beta8 integrin cell surface interactions |
0.1 | 0.4 | PID HDAC CLASSII PATHWAY | Signaling events mediated by HDAC Class II |
0.1 | 0.2 | PID P38 ALPHA BETA PATHWAY | Regulation of p38-alpha and p38-beta |
0.1 | 4.5 | PID CMYB PATHWAY | C-MYB transcription factor network |
0.1 | 1.4 | PID S1P S1P4 PATHWAY | S1P4 pathway |
0.1 | 4.3 | PID TELOMERASE PATHWAY | Regulation of Telomerase |
0.1 | 0.3 | SA G1 AND S PHASES | Cdk2, 4, and 6 bind cyclin D in G1, while cdk2/cyclin E promotes the G1/S transition. |
0.1 | 4.2 | PID DELTA NP63 PATHWAY | Validated transcriptional targets of deltaNp63 isoforms |
0.1 | 0.4 | SIG IL4RECEPTOR IN B LYPHOCYTES | Genes related to IL4 rceptor signaling in B lymphocytes |
0.1 | 0.3 | SA PTEN PATHWAY | PTEN is a tumor suppressor that dephosphorylates the lipid messenger phosphatidylinositol triphosphate. |
0.1 | 0.5 | PID PI3KCI AKT PATHWAY | Class I PI3K signaling events mediated by Akt |
0.1 | 2.0 | PID RHODOPSIN PATHWAY | Visual signal transduction: Rods |
0.1 | 0.1 | SA TRKA RECEPTOR | The TrkA receptor binds nerve growth factor to activate MAP kinase pathways and promote cell growth. |
0.1 | 7.9 | PID P53 DOWNSTREAM PATHWAY | Direct p53 effectors |
0.1 | 0.6 | SA REG CASCADE OF CYCLIN EXPR | Expression of cyclins regulates progression through the cell cycle by activating cyclin-dependent kinases. |
0.1 | 2.0 | PID ALPHA SYNUCLEIN PATHWAY | Alpha-synuclein signaling |
0.1 | 1.3 | PID AMB2 NEUTROPHILS PATHWAY | amb2 Integrin signaling |
0.1 | 2.2 | PID INSULIN PATHWAY | Insulin Pathway |
0.1 | 1.2 | ST P38 MAPK PATHWAY | p38 MAPK Pathway |
0.1 | 0.8 | ST TUMOR NECROSIS FACTOR PATHWAY | Tumor Necrosis Factor Pathway. |
0.1 | 2.3 | PID ARF6 TRAFFICKING PATHWAY | Arf6 trafficking events |
0.1 | 1.1 | PID WNT CANONICAL PATHWAY | Canonical Wnt signaling pathway |
0.1 | 1.3 | PID FOXM1 PATHWAY | FOXM1 transcription factor network |
0.1 | 3.1 | PID HIF1 TFPATHWAY | HIF-1-alpha transcription factor network |
0.1 | 1.6 | PID NCADHERIN PATHWAY | N-cadherin signaling events |
0.1 | 2.2 | PID CDC42 PATHWAY | CDC42 signaling events |
0.1 | 0.9 | PID S1P META PATHWAY | Sphingosine 1-phosphate (S1P) pathway |
0.1 | 0.2 | PID AVB3 INTEGRIN PATHWAY | Integrins in angiogenesis |
0.1 | 2.6 | NABA PROTEOGLYCANS | Genes encoding proteoglycans |
0.1 | 1.1 | PID ARF6 PATHWAY | Arf6 signaling events |
0.1 | 0.7 | PID FRA PATHWAY | Validated transcriptional targets of AP1 family members Fra1 and Fra2 |
0.1 | 1.2 | PID UPA UPAR PATHWAY | Urokinase-type plasminogen activator (uPA) and uPAR-mediated signaling |
0.1 | 1.7 | PID ATF2 PATHWAY | ATF-2 transcription factor network |
0.1 | 0.1 | ST JAK STAT PATHWAY | Jak-STAT Pathway |
0.1 | 0.3 | PID INTEGRIN3 PATHWAY | Beta3 integrin cell surface interactions |
0.1 | 0.6 | ST ADRENERGIC | Adrenergic Pathway |
0.1 | 1.4 | PID RAS PATHWAY | Regulation of Ras family activation |
0.1 | 1.4 | PID IL4 2PATHWAY | IL4-mediated signaling events |
0.1 | 0.1 | ST INTERLEUKIN 4 PATHWAY | Interleukin 4 (IL-4) Pathway |
0.1 | 1.2 | PID NFAT TFPATHWAY | Calcineurin-regulated NFAT-dependent transcription in lymphocytes |
0.1 | 0.1 | PID ERBB1 RECEPTOR PROXIMAL PATHWAY | EGF receptor (ErbB1) signaling pathway |
0.1 | 1.0 | PID AURORA A PATHWAY | Aurora A signaling |
0.1 | 1.2 | PID LIS1 PATHWAY | Lissencephaly gene (LIS1) in neuronal migration and development |
0.1 | 0.5 | PID P38 MKK3 6PATHWAY | p38 MAPK signaling pathway |
0.1 | 1.9 | PID MYC REPRESS PATHWAY | Validated targets of C-MYC transcriptional repression |
0.1 | 2.1 | PID E2F PATHWAY | E2F transcription factor network |
0.1 | 0.4 | PID P38 MK2 PATHWAY | p38 signaling mediated by MAPKAP kinases |
0.1 | 1.3 | PID REG GR PATHWAY | Glucocorticoid receptor regulatory network |
0.1 | 0.5 | PID CERAMIDE PATHWAY | Ceramide signaling pathway |
0.1 | 0.3 | PID CD40 PATHWAY | CD40/CD40L signaling |
0.1 | 0.2 | PID ANTHRAX PATHWAY | Cellular roles of Anthrax toxin |
0.1 | 0.6 | PID SYNDECAN 2 PATHWAY | Syndecan-2-mediated signaling events |
0.1 | 0.4 | PID P38 ALPHA BETA DOWNSTREAM PATHWAY | Signaling mediated by p38-alpha and p38-beta |
0.1 | 0.2 | PID IL2 1PATHWAY | IL2-mediated signaling events |
0.1 | 1.1 | PID CD8 TCR DOWNSTREAM PATHWAY | Downstream signaling in naïve CD8+ T cells |
0.1 | 0.2 | PID SYNDECAN 1 PATHWAY | Syndecan-1-mediated signaling events |
0.0 | 0.5 | PID HIF2PATHWAY | HIF-2-alpha transcription factor network |
0.0 | 0.8 | PID RXR VDR PATHWAY | RXR and RAR heterodimerization with other nuclear receptor |
0.0 | 0.7 | PID RAC1 PATHWAY | RAC1 signaling pathway |
0.0 | 0.3 | PID EPHRINB REV PATHWAY | Ephrin B reverse signaling |
0.0 | 0.2 | PID BARD1 PATHWAY | BARD1 signaling events |
0.0 | 0.8 | PID MTOR 4PATHWAY | mTOR signaling pathway |
0.0 | 0.7 | PID TAP63 PATHWAY | Validated transcriptional targets of TAp63 isoforms |
0.0 | 0.5 | PID IL1 PATHWAY | IL1-mediated signaling events |
0.0 | 0.2 | PID IL12 STAT4 PATHWAY | IL12 signaling mediated by STAT4 |
0.0 | 0.1 | PID AR NONGENOMIC PATHWAY | Nongenotropic Androgen signaling |
0.0 | 1.1 | PID FANCONI PATHWAY | Fanconi anemia pathway |
0.0 | 0.5 | PID IL23 PATHWAY | IL23-mediated signaling events |
0.0 | 0.9 | PID PLK1 PATHWAY | PLK1 signaling events |
0.0 | 0.1 | PID SYNDECAN 3 PATHWAY | Syndecan-3-mediated signaling events |
0.0 | 0.6 | PID PDGFRB PATHWAY | PDGFR-beta signaling pathway |
0.0 | 0.0 | ST T CELL SIGNAL TRANSDUCTION | T Cell Signal Transduction |
0.0 | 0.5 | PID AR TF PATHWAY | Regulation of Androgen receptor activity |
0.0 | 0.3 | PID HDAC CLASSIII PATHWAY | Signaling events mediated by HDAC Class III |
0.0 | 0.2 | PID PI3K PLC TRK PATHWAY | Trk receptor signaling mediated by PI3K and PLC-gamma |
0.0 | 1.1 | PID ERA GENOMIC PATHWAY | Validated nuclear estrogen receptor alpha network |
0.0 | 0.1 | PID NFKAPPAB ATYPICAL PATHWAY | Atypical NF-kappaB pathway |
0.0 | 0.1 | PID ENDOTHELIN PATHWAY | Endothelins |
0.0 | 0.0 | SA PROGRAMMED CELL DEATH | Programmed cell death, or apoptosis, eliminates damaged or unneeded cells. |
0.0 | 0.2 | PID VEGF VEGFR PATHWAY | VEGF and VEGFR signaling network |
0.0 | 0.0 | PID ER NONGENOMIC PATHWAY | Plasma membrane estrogen receptor signaling |
0.0 | 0.3 | PID RHOA PATHWAY | RhoA signaling pathway |
0.0 | 1.0 | PID MYC ACTIV PATHWAY | Validated targets of C-MYC transcriptional activation |
0.0 | 0.0 | SIG BCR SIGNALING PATHWAY | Members of the BCR signaling pathway |
0.0 | 0.1 | PID GLYPICAN 1PATHWAY | Glypican 1 network |
0.0 | 0.0 | PID ALK2 PATHWAY | ALK2 signaling events |
0.0 | 0.3 | PID AP1 PATHWAY | AP-1 transcription factor network |
0.0 | 0.2 | PID ERBB2 ERBB3 PATHWAY | ErbB2/ErbB3 signaling events |
0.0 | 0.3 | ST WNT BETA CATENIN PATHWAY | Wnt/beta-catenin Pathway |
0.0 | 0.3 | PID P53 REGULATION PATHWAY | p53 pathway |
0.0 | 0.1 | ST DIFFERENTIATION PATHWAY IN PC12 CELLS | Differentiation Pathway in PC12 Cells; this is a specific case of PAC1 Receptor Pathway. |
0.0 | 0.1 | PID LYSOPHOSPHOLIPID PATHWAY | LPA receptor mediated events |
0.0 | 0.1 | ST PHOSPHOINOSITIDE 3 KINASE PATHWAY | PI3K Pathway |
0.0 | 0.2 | PID TOLL ENDOGENOUS PATHWAY | Endogenous TLR signaling |
0.0 | 0.3 | PID AJDISS 2PATHWAY | Posttranslational regulation of adherens junction stability and dissassembly |
0.0 | 0.0 | PID HIV NEF PATHWAY | HIV-1 Nef: Negative effector of Fas and TNF-alpha |
0.0 | 0.3 | PID AURORA B PATHWAY | Aurora B signaling |
0.0 | 0.2 | PID BCR 5PATHWAY | BCR signaling pathway |
0.0 | 0.1 | ST JNK MAPK PATHWAY | JNK MAPK Pathway |
0.0 | 0.2 | PID HEDGEHOG 2PATHWAY | Signaling events mediated by the Hedgehog family |
0.0 | 0.1 | PID ERBB1 INTERNALIZATION PATHWAY | Internalization of ErbB1 |
0.0 | 0.3 | PID TGFBR PATHWAY | TGF-beta receptor signaling |
0.0 | 0.3 | PID HDAC CLASSI PATHWAY | Signaling events mediated by HDAC Class I |
0.0 | 0.0 | ST G ALPHA S PATHWAY | G alpha s Pathway |
0.0 | 0.1 | PID FCER1 PATHWAY | Fc-epsilon receptor I signaling in mast cells |
0.0 | 0.0 | PID FAS PATHWAY | FAS (CD95) signaling pathway |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.6 | 1.8 | REACTOME SYNTHESIS OF PE | Genes involved in Synthesis of PE |
0.6 | 6.0 | REACTOME PASSIVE TRANSPORT BY AQUAPORINS | Genes involved in Passive Transport by Aquaporins |
0.6 | 0.6 | REACTOME ABORTIVE ELONGATION OF HIV1 TRANSCRIPT IN THE ABSENCE OF TAT | Genes involved in Abortive elongation of HIV-1 transcript in the absence of Tat |
0.5 | 8.9 | REACTOME SYNTHESIS OF PC | Genes involved in Synthesis of PC |
0.5 | 5.4 | REACTOME CASPASE MEDIATED CLEAVAGE OF CYTOSKELETAL PROTEINS | Genes involved in Caspase-mediated cleavage of cytoskeletal proteins |
0.5 | 2.7 | REACTOME ETHANOL OXIDATION | Genes involved in Ethanol oxidation |
0.4 | 5.5 | REACTOME METABOLISM OF PORPHYRINS | Genes involved in Metabolism of porphyrins |
0.4 | 3.8 | REACTOME RECRUITMENT OF NUMA TO MITOTIC CENTROSOMES | Genes involved in Recruitment of NuMA to mitotic centrosomes |
0.4 | 6.3 | REACTOME ACTIVATED TAK1 MEDIATES P38 MAPK ACTIVATION | Genes involved in activated TAK1 mediates p38 MAPK activation |
0.4 | 7.3 | REACTOME INTERACTION BETWEEN L1 AND ANKYRINS | Genes involved in Interaction between L1 and Ankyrins |
0.3 | 4.8 | REACTOME TRAF3 DEPENDENT IRF ACTIVATION PATHWAY | Genes involved in TRAF3-dependent IRF activation pathway |
0.3 | 4.1 | REACTOME PURINE SALVAGE | Genes involved in Purine salvage |
0.3 | 0.3 | REACTOME REGULATION OF SIGNALING BY CBL | Genes involved in Regulation of signaling by CBL |
0.3 | 2.5 | REACTOME INHIBITION OF REPLICATION INITIATION OF DAMAGED DNA BY RB1 E2F1 | Genes involved in Inhibition of replication initiation of damaged DNA by RB1/E2F1 |
0.3 | 4.7 | REACTOME G1 S SPECIFIC TRANSCRIPTION | Genes involved in G1/S-Specific Transcription |
0.3 | 5.2 | REACTOME ACTIVATED AMPK STIMULATES FATTY ACID OXIDATION IN MUSCLE | Genes involved in Activated AMPK stimulates fatty-acid oxidation in muscle |
0.3 | 4.8 | REACTOME TERMINATION OF O GLYCAN BIOSYNTHESIS | Genes involved in Termination of O-glycan biosynthesis |
0.3 | 3.1 | REACTOME ACTIVATION OF CHAPERONES BY ATF6 ALPHA | Genes involved in Activation of Chaperones by ATF6-alpha |
0.3 | 3.0 | REACTOME FACILITATIVE NA INDEPENDENT GLUCOSE TRANSPORTERS | Genes involved in Facilitative Na+-independent glucose transporters |
0.3 | 3.4 | REACTOME COMMON PATHWAY | Genes involved in Common Pathway |
0.3 | 2.0 | REACTOME RECYCLING OF BILE ACIDS AND SALTS | Genes involved in Recycling of bile acids and salts |
0.3 | 0.3 | REACTOME GPVI MEDIATED ACTIVATION CASCADE | Genes involved in GPVI-mediated activation cascade |
0.2 | 1.0 | REACTOME DIGESTION OF DIETARY CARBOHYDRATE | Genes involved in Digestion of dietary carbohydrate |
0.2 | 7.2 | REACTOME AMINO ACID TRANSPORT ACROSS THE PLASMA MEMBRANE | Genes involved in Amino acid transport across the plasma membrane |
0.2 | 0.2 | REACTOME VIF MEDIATED DEGRADATION OF APOBEC3G | Genes involved in Vif-mediated degradation of APOBEC3G |
0.2 | 3.3 | REACTOME G0 AND EARLY G1 | Genes involved in G0 and Early G1 |
0.2 | 3.6 | REACTOME RNA POL III CHAIN ELONGATION | Genes involved in RNA Polymerase III Chain Elongation |
0.2 | 4.7 | REACTOME GLUTATHIONE CONJUGATION | Genes involved in Glutathione conjugation |
0.2 | 1.7 | REACTOME RNA POL III TRANSCRIPTION INITIATION FROM TYPE 3 PROMOTER | Genes involved in RNA Polymerase III Transcription Initiation From Type 3 Promoter |
0.2 | 0.4 | REACTOME DESTABILIZATION OF MRNA BY KSRP | Genes involved in Destabilization of mRNA by KSRP |
0.2 | 1.2 | REACTOME SIGNALING BY CONSTITUTIVELY ACTIVE EGFR | Genes involved in Signaling by constitutively active EGFR |
0.2 | 0.6 | REACTOME ENDOSOMAL VACUOLAR PATHWAY | Genes involved in Endosomal/Vacuolar pathway |
0.2 | 0.2 | REACTOME ADVANCED GLYCOSYLATION ENDPRODUCT RECEPTOR SIGNALING | Genes involved in Advanced glycosylation endproduct receptor signaling |
0.2 | 1.6 | REACTOME THE ACTIVATION OF ARYLSULFATASES | Genes involved in The activation of arylsulfatases |
0.2 | 2.7 | REACTOME BASIGIN INTERACTIONS | Genes involved in Basigin interactions |
0.2 | 3.1 | REACTOME CHYLOMICRON MEDIATED LIPID TRANSPORT | Genes involved in Chylomicron-mediated lipid transport |
0.2 | 1.7 | REACTOME TRAFFICKING AND PROCESSING OF ENDOSOMAL TLR | Genes involved in Trafficking and processing of endosomal TLR |
0.2 | 3.1 | REACTOME SYNTHESIS OF GLYCOSYLPHOSPHATIDYLINOSITOL GPI | Genes involved in Synthesis of glycosylphosphatidylinositol (GPI) |
0.2 | 0.9 | REACTOME RNA POL I PROMOTER OPENING | Genes involved in RNA Polymerase I Promoter Opening |
0.2 | 3.8 | REACTOME KINESINS | Genes involved in Kinesins |
0.2 | 5.8 | REACTOME GLUCOSE TRANSPORT | Genes involved in Glucose transport |
0.2 | 4.1 | REACTOME MEIOTIC RECOMBINATION | Genes involved in Meiotic Recombination |
0.2 | 1.2 | REACTOME HORMONE SENSITIVE LIPASE HSL MEDIATED TRIACYLGLYCEROL HYDROLYSIS | Genes involved in Hormone-sensitive lipase (HSL)-mediated triacylglycerol hydrolysis |
0.2 | 1.3 | REACTOME REGULATED PROTEOLYSIS OF P75NTR | Genes involved in Regulated proteolysis of p75NTR |
0.2 | 8.2 | REACTOME LOSS OF NLP FROM MITOTIC CENTROSOMES | Genes involved in Loss of Nlp from mitotic centrosomes |
0.2 | 10.8 | REACTOME TRANSCRIPTIONAL REGULATION OF WHITE ADIPOCYTE DIFFERENTIATION | Genes involved in Transcriptional Regulation of White Adipocyte Differentiation |
0.2 | 1.5 | REACTOME TRYPTOPHAN CATABOLISM | Genes involved in Tryptophan catabolism |
0.2 | 2.9 | REACTOME SIGNALING BY NODAL | Genes involved in Signaling by NODAL |
0.2 | 1.9 | REACTOME ORGANIC CATION ANION ZWITTERION TRANSPORT | Genes involved in Organic cation/anion/zwitterion transport |
0.2 | 1.7 | REACTOME SIGNAL ATTENUATION | Genes involved in Signal attenuation |
0.2 | 3.3 | REACTOME PYRIMIDINE METABOLISM | Genes involved in Pyrimidine metabolism |
0.2 | 1.7 | REACTOME MTORC1 MEDIATED SIGNALLING | Genes involved in mTORC1-mediated signalling |
0.2 | 2.9 | REACTOME ANTIVIRAL MECHANISM BY IFN STIMULATED GENES | Genes involved in Antiviral mechanism by IFN-stimulated genes |
0.2 | 0.3 | REACTOME REGULATION OF RHEB GTPASE ACTIVITY BY AMPK | Genes involved in Regulation of Rheb GTPase activity by AMPK |
0.2 | 2.4 | REACTOME NEGATIVE REGULATORS OF RIG I MDA5 SIGNALING | Genes involved in Negative regulators of RIG-I/MDA5 signaling |
0.1 | 1.3 | REACTOME ALPHA LINOLENIC ACID ALA METABOLISM | Genes involved in alpha-linolenic acid (ALA) metabolism |
0.1 | 1.6 | REACTOME SYNTHESIS SECRETION AND DEACYLATION OF GHRELIN | Genes involved in Synthesis, Secretion, and Deacylation of Ghrelin |
0.1 | 3.2 | REACTOME CYTOSOLIC TRNA AMINOACYLATION | Genes involved in Cytosolic tRNA aminoacylation |
0.1 | 4.4 | REACTOME PRE NOTCH EXPRESSION AND PROCESSING | Genes involved in Pre-NOTCH Expression and Processing |
0.1 | 4.7 | REACTOME MRNA 3 END PROCESSING | Genes involved in mRNA 3'-end processing |
0.1 | 2.9 | REACTOME GLYCOLYSIS | Genes involved in Glycolysis |
0.1 | 1.0 | REACTOME MEMBRANE BINDING AND TARGETTING OF GAG PROTEINS | Genes involved in Membrane binding and targetting of GAG proteins |
0.1 | 0.7 | REACTOME PACKAGING OF TELOMERE ENDS | Genes involved in Packaging Of Telomere Ends |
0.1 | 1.9 | REACTOME DEADENYLATION OF MRNA | Genes involved in Deadenylation of mRNA |
0.1 | 0.3 | REACTOME REGULATION OF KIT SIGNALING | Genes involved in Regulation of KIT signaling |
0.1 | 1.0 | REACTOME REGULATION OF IFNG SIGNALING | Genes involved in Regulation of IFNG signaling |
0.1 | 0.3 | REACTOME DESTABILIZATION OF MRNA BY TRISTETRAPROLIN TTP | Genes involved in Destabilization of mRNA by Tristetraprolin (TTP) |
0.1 | 0.3 | REACTOME INFLUENZA VIRAL RNA TRANSCRIPTION AND REPLICATION | Genes involved in Influenza Viral RNA Transcription and Replication |
0.1 | 2.3 | REACTOME NEF MEDIATES DOWN MODULATION OF CELL SURFACE RECEPTORS BY RECRUITING THEM TO CLATHRIN ADAPTERS | Genes involved in Nef-mediates down modulation of cell surface receptors by recruiting them to clathrin adapters |
0.1 | 2.0 | REACTOME IL 2 SIGNALING | Genes involved in Interleukin-2 signaling |
0.1 | 0.3 | REACTOME SIGNALLING TO P38 VIA RIT AND RIN | Genes involved in Signalling to p38 via RIT and RIN |
0.1 | 1.8 | REACTOME MRNA DECAY BY 5 TO 3 EXORIBONUCLEASE | Genes involved in mRNA Decay by 5' to 3' Exoribonuclease |
0.1 | 8.5 | REACTOME MRNA SPLICING | Genes involved in mRNA Splicing |
0.1 | 1.0 | REACTOME PLATELET SENSITIZATION BY LDL | Genes involved in Platelet sensitization by LDL |
0.1 | 1.7 | REACTOME MITOCHONDRIAL FATTY ACID BETA OXIDATION | Genes involved in Mitochondrial Fatty Acid Beta-Oxidation |
0.1 | 1.4 | REACTOME SYNTHESIS OF VERY LONG CHAIN FATTY ACYL COAS | Genes involved in Synthesis of very long-chain fatty acyl-CoAs |
0.1 | 8.2 | REACTOME FACTORS INVOLVED IN MEGAKARYOCYTE DEVELOPMENT AND PLATELET PRODUCTION | Genes involved in Factors involved in megakaryocyte development and platelet production |
0.1 | 1.1 | REACTOME SHC1 EVENTS IN EGFR SIGNALING | Genes involved in SHC1 events in EGFR signaling |
0.1 | 1.1 | REACTOME OXYGEN DEPENDENT PROLINE HYDROXYLATION OF HYPOXIA INDUCIBLE FACTOR ALPHA | Genes involved in Oxygen-dependent Proline Hydroxylation of Hypoxia-inducible Factor Alpha |
0.1 | 2.1 | REACTOME GROWTH HORMONE RECEPTOR SIGNALING | Genes involved in Growth hormone receptor signaling |
0.1 | 3.5 | REACTOME GOLGI ASSOCIATED VESICLE BIOGENESIS | Genes involved in Golgi Associated Vesicle Biogenesis |
0.1 | 1.4 | REACTOME CS DS DEGRADATION | Genes involved in CS/DS degradation |
0.1 | 1.4 | REACTOME THROMBIN SIGNALLING THROUGH PROTEINASE ACTIVATED RECEPTORS PARS | Genes involved in Thrombin signalling through proteinase activated receptors (PARs) |
0.1 | 0.4 | REACTOME TRAF6 MEDIATED IRF7 ACTIVATION IN TLR7 8 OR 9 SIGNALING | Genes involved in TRAF6 mediated IRF7 activation in TLR7/8 or 9 signaling |
0.1 | 2.2 | REACTOME CITRIC ACID CYCLE TCA CYCLE | Genes involved in Citric acid cycle (TCA cycle) |
0.1 | 1.7 | REACTOME CONVERSION FROM APC C CDC20 TO APC C CDH1 IN LATE ANAPHASE | Genes involved in Conversion from APC/C:Cdc20 to APC/C:Cdh1 in late anaphase |
0.1 | 2.8 | REACTOME INTERFERON GAMMA SIGNALING | Genes involved in Interferon gamma signaling |
0.1 | 1.2 | REACTOME LYSOSOME VESICLE BIOGENESIS | Genes involved in Lysosome Vesicle Biogenesis |
0.1 | 1.0 | REACTOME REGULATION OF COMPLEMENT CASCADE | Genes involved in Regulation of Complement cascade |
0.1 | 0.7 | REACTOME E2F MEDIATED REGULATION OF DNA REPLICATION | Genes involved in E2F mediated regulation of DNA replication |
0.1 | 3.3 | REACTOME MHC CLASS II ANTIGEN PRESENTATION | Genes involved in MHC class II antigen presentation |
0.1 | 10.7 | REACTOME SRP DEPENDENT COTRANSLATIONAL PROTEIN TARGETING TO MEMBRANE | Genes involved in SRP-dependent cotranslational protein targeting to membrane |
0.1 | 0.1 | REACTOME GAB1 SIGNALOSOME | Genes involved in GAB1 signalosome |
0.1 | 0.7 | REACTOME DOWNSTREAM SIGNAL TRANSDUCTION | Genes involved in Downstream signal transduction |
0.1 | 0.8 | REACTOME ADP SIGNALLING THROUGH P2RY12 | Genes involved in ADP signalling through P2Y purinoceptor 12 |
0.1 | 2.0 | REACTOME SULFUR AMINO ACID METABOLISM | Genes involved in Sulfur amino acid metabolism |
0.1 | 0.3 | REACTOME CYCLIN E ASSOCIATED EVENTS DURING G1 S TRANSITION | Genes involved in Cyclin E associated events during G1/S transition |
0.1 | 3.9 | REACTOME AUTODEGRADATION OF CDH1 BY CDH1 APC C | Genes involved in Autodegradation of Cdh1 by Cdh1:APC/C |
0.1 | 2.6 | REACTOME ION TRANSPORT BY P TYPE ATPASES | Genes involved in Ion transport by P-type ATPases |
0.1 | 0.9 | REACTOME REGULATION OF MRNA STABILITY BY PROTEINS THAT BIND AU RICH ELEMENTS | Genes involved in Regulation of mRNA Stability by Proteins that Bind AU-rich Elements |
0.1 | 1.3 | REACTOME AMINE COMPOUND SLC TRANSPORTERS | Genes involved in Amine compound SLC transporters |
0.1 | 6.6 | REACTOME RESPIRATORY ELECTRON TRANSPORT ATP SYNTHESIS BY CHEMIOSMOTIC COUPLING AND HEAT PRODUCTION BY UNCOUPLING PROTEINS | Genes involved in Respiratory electron transport, ATP synthesis by chemiosmotic coupling, and heat production by uncoupling proteins. |
0.1 | 0.3 | REACTOME APC C CDH1 MEDIATED DEGRADATION OF CDC20 AND OTHER APC C CDH1 TARGETED PROTEINS IN LATE MITOSIS EARLY G1 | Genes involved in APC/C:Cdh1 mediated degradation of Cdc20 and other APC/C:Cdh1 targeted proteins in late mitosis/early G1 |
0.1 | 2.4 | REACTOME SYNTHESIS OF PIPS AT THE PLASMA MEMBRANE | Genes involved in Synthesis of PIPs at the plasma membrane |
0.1 | 0.2 | REACTOME ASSOCIATION OF LICENSING FACTORS WITH THE PRE REPLICATIVE COMPLEX | Genes involved in Association of licensing factors with the pre-replicative complex |
0.1 | 0.5 | REACTOME HYALURONAN UPTAKE AND DEGRADATION | Genes involved in Hyaluronan uptake and degradation |
0.1 | 4.5 | REACTOME GLYCEROPHOSPHOLIPID BIOSYNTHESIS | Genes involved in Glycerophospholipid biosynthesis |
0.1 | 1.3 | REACTOME SIGNALING BY HIPPO | Genes involved in Signaling by Hippo |
0.1 | 0.9 | REACTOME DARPP 32 EVENTS | Genes involved in DARPP-32 events |
0.1 | 0.3 | REACTOME P53 DEPENDENT G1 DNA DAMAGE RESPONSE | Genes involved in p53-Dependent G1 DNA Damage Response |
0.1 | 0.8 | REACTOME CYTOSOLIC SULFONATION OF SMALL MOLECULES | Genes involved in Cytosolic sulfonation of small molecules |
0.1 | 0.7 | REACTOME SYNTHESIS OF BILE ACIDS AND BILE SALTS VIA 7ALPHA HYDROXYCHOLESTEROL | Genes involved in Synthesis of bile acids and bile salts via 7alpha-hydroxycholesterol |
0.1 | 0.9 | REACTOME SEROTONIN RECEPTORS | Genes involved in Serotonin receptors |
0.1 | 1.1 | REACTOME ABCA TRANSPORTERS IN LIPID HOMEOSTASIS | Genes involved in ABCA transporters in lipid homeostasis |
0.1 | 4.0 | REACTOME MITOTIC PROMETAPHASE | Genes involved in Mitotic Prometaphase |
0.1 | 4.7 | REACTOME TRANSPORT OF INORGANIC CATIONS ANIONS AND AMINO ACIDS OLIGOPEPTIDES | Genes involved in Transport of inorganic cations/anions and amino acids/oligopeptides |
0.1 | 0.4 | REACTOME G2 M DNA DAMAGE CHECKPOINT | Genes involved in G2/M DNA damage checkpoint |
0.1 | 0.7 | REACTOME LIPOPROTEIN METABOLISM | Genes involved in Lipoprotein metabolism |
0.1 | 1.2 | REACTOME REGULATION OF WATER BALANCE BY RENAL AQUAPORINS | Genes involved in Regulation of Water Balance by Renal Aquaporins |
0.1 | 1.5 | REACTOME CHOLESTEROL BIOSYNTHESIS | Genes involved in Cholesterol biosynthesis |
0.1 | 0.5 | REACTOME PROLONGED ERK ACTIVATION EVENTS | Genes involved in Prolonged ERK activation events |
0.1 | 2.0 | REACTOME ASSOCIATION OF TRIC CCT WITH TARGET PROTEINS DURING BIOSYNTHESIS | Genes involved in Association of TriC/CCT with target proteins during biosynthesis |
0.1 | 1.0 | REACTOME TGF BETA RECEPTOR SIGNALING ACTIVATES SMADS | Genes involved in TGF-beta receptor signaling activates SMADs |
0.1 | 0.2 | REACTOME APOBEC3G MEDIATED RESISTANCE TO HIV1 INFECTION | Genes involved in APOBEC3G mediated resistance to HIV-1 infection |
0.1 | 1.2 | REACTOME ACTIVATION OF GENES BY ATF4 | Genes involved in Activation of Genes by ATF4 |
0.1 | 2.8 | REACTOME MITOCHONDRIAL PROTEIN IMPORT | Genes involved in Mitochondrial Protein Import |
0.1 | 0.4 | REACTOME RECYCLING PATHWAY OF L1 | Genes involved in Recycling pathway of L1 |
0.1 | 0.2 | REACTOME ABACAVIR TRANSPORT AND METABOLISM | Genes involved in Abacavir transport and metabolism |
0.1 | 0.4 | REACTOME MITOTIC G2 G2 M PHASES | Genes involved in Mitotic G2-G2/M phases |
0.1 | 1.7 | REACTOME INHIBITION OF VOLTAGE GATED CA2 CHANNELS VIA GBETA GAMMA SUBUNITS | Genes involved in Inhibition of voltage gated Ca2+ channels via Gbeta/gamma subunits |
0.1 | 1.8 | REACTOME BIOSYNTHESIS OF THE N GLYCAN PRECURSOR DOLICHOL LIPID LINKED OLIGOSACCHARIDE LLO AND TRANSFER TO A NASCENT PROTEIN | Genes involved in Biosynthesis of the N-glycan precursor (dolichol lipid-linked oligosaccharide, LLO) and transfer to a nascent protein |
0.1 | 0.7 | REACTOME REGULATION OF PYRUVATE DEHYDROGENASE PDH COMPLEX | Genes involved in Regulation of pyruvate dehydrogenase (PDH) complex |
0.1 | 0.3 | REACTOME JNK C JUN KINASES PHOSPHORYLATION AND ACTIVATION MEDIATED BY ACTIVATED HUMAN TAK1 | Genes involved in JNK (c-Jun kinases) phosphorylation and activation mediated by activated human TAK1 |
0.1 | 0.5 | REACTOME GLUCURONIDATION | Genes involved in Glucuronidation |
0.1 | 1.5 | REACTOME APOPTOTIC CLEAVAGE OF CELLULAR PROTEINS | Genes involved in Apoptotic cleavage of cellular proteins |
0.1 | 0.6 | REACTOME EXTRINSIC PATHWAY FOR APOPTOSIS | Genes involved in Extrinsic Pathway for Apoptosis |
0.1 | 0.5 | REACTOME G PROTEIN ACTIVATION | Genes involved in G-protein activation |
0.1 | 0.1 | REACTOME INTERACTIONS OF VPR WITH HOST CELLULAR PROTEINS | Genes involved in Interactions of Vpr with host cellular proteins |
0.1 | 0.5 | REACTOME HORMONE LIGAND BINDING RECEPTORS | Genes involved in Hormone ligand-binding receptors |
0.1 | 0.6 | REACTOME UNWINDING OF DNA | Genes involved in Unwinding of DNA |
0.1 | 2.0 | REACTOME ACTIVATION OF CHAPERONE GENES BY XBP1S | Genes involved in Activation of Chaperone Genes by XBP1(S) |
0.1 | 7.1 | REACTOME ANTIGEN PROCESSING UBIQUITINATION PROTEASOME DEGRADATION | Genes involved in Antigen processing: Ubiquitination & Proteasome degradation |
0.1 | 0.3 | REACTOME REGULATION OF HYPOXIA INDUCIBLE FACTOR HIF BY OXYGEN | Genes involved in Regulation of Hypoxia-inducible Factor (HIF) by Oxygen |
0.1 | 2.6 | REACTOME METABOLISM OF VITAMINS AND COFACTORS | Genes involved in Metabolism of vitamins and cofactors |
0.1 | 0.1 | REACTOME HOST INTERACTIONS OF HIV FACTORS | Genes involved in Host Interactions of HIV factors |
0.1 | 0.1 | REACTOME PKA MEDIATED PHOSPHORYLATION OF CREB | Genes involved in PKA-mediated phosphorylation of CREB |
0.1 | 0.3 | REACTOME PURINE CATABOLISM | Genes involved in Purine catabolism |
0.1 | 0.1 | REACTOME TRANSPORT OF MATURE MRNA DERIVED FROM AN INTRONLESS TRANSCRIPT | Genes involved in Transport of Mature mRNA Derived from an Intronless Transcript |
0.1 | 3.0 | REACTOME RESPONSE TO ELEVATED PLATELET CYTOSOLIC CA2 | Genes involved in Response to elevated platelet cytosolic Ca2+ |
0.1 | 0.3 | REACTOME DOWNSTREAM TCR SIGNALING | Genes involved in Downstream TCR signaling |
0.1 | 0.8 | REACTOME NUCLEOTIDE LIKE PURINERGIC RECEPTORS | Genes involved in Nucleotide-like (purinergic) receptors |
0.1 | 0.2 | REACTOME ACTIVATION OF ATR IN RESPONSE TO REPLICATION STRESS | Genes involved in Activation of ATR in response to replication stress |
0.1 | 0.7 | REACTOME METABOLISM OF NON CODING RNA | Genes involved in Metabolism of non-coding RNA |
0.1 | 0.7 | REACTOME AMYLOIDS | Genes involved in Amyloids |
0.1 | 0.1 | REACTOME PEPTIDE CHAIN ELONGATION | Genes involved in Peptide chain elongation |
0.1 | 0.7 | REACTOME SIGNAL TRANSDUCTION BY L1 | Genes involved in Signal transduction by L1 |
0.1 | 0.8 | REACTOME ZINC TRANSPORTERS | Genes involved in Zinc transporters |
0.1 | 0.2 | REACTOME INHIBITION OF INSULIN SECRETION BY ADRENALINE NORADRENALINE | Genes involved in Inhibition of Insulin Secretion by Adrenaline/Noradrenaline |
0.1 | 1.0 | REACTOME PROTEIN FOLDING | Genes involved in Protein folding |
0.1 | 0.8 | REACTOME CYTOCHROME P450 ARRANGED BY SUBSTRATE TYPE | Genes involved in Cytochrome P450 - arranged by substrate type |
0.1 | 0.6 | REACTOME PURINE METABOLISM | Genes involved in Purine metabolism |
0.1 | 0.8 | REACTOME N GLYCAN ANTENNAE ELONGATION IN THE MEDIAL TRANS GOLGI | Genes involved in N-glycan antennae elongation in the medial/trans-Golgi |
0.1 | 0.3 | REACTOME DOWNREGULATION OF ERBB2 ERBB3 SIGNALING | Genes involved in Downregulation of ERBB2:ERBB3 signaling |
0.1 | 0.5 | REACTOME ANDROGEN BIOSYNTHESIS | Genes involved in Androgen biosynthesis |
0.0 | 0.3 | REACTOME ELONGATION ARREST AND RECOVERY | Genes involved in Elongation arrest and recovery |
0.0 | 1.5 | REACTOME PPARA ACTIVATES GENE EXPRESSION | Genes involved in PPARA Activates Gene Expression |
0.0 | 0.2 | REACTOME ACTIVATION OF THE PRE REPLICATIVE COMPLEX | Genes involved in Activation of the pre-replicative complex |
0.0 | 0.5 | REACTOME SYNTHESIS OF PIPS AT THE GOLGI MEMBRANE | Genes involved in Synthesis of PIPs at the Golgi membrane |
0.0 | 0.6 | REACTOME PIP3 ACTIVATES AKT SIGNALING | Genes involved in PIP3 activates AKT signaling |
0.0 | 0.9 | REACTOME GLYCOSPHINGOLIPID METABOLISM | Genes involved in Glycosphingolipid metabolism |
0.0 | 0.5 | REACTOME ANTIGEN PROCESSING CROSS PRESENTATION | Genes involved in Antigen processing-Cross presentation |
0.0 | 0.4 | REACTOME NOD1 2 SIGNALING PATHWAY | Genes involved in NOD1/2 Signaling Pathway |
0.0 | 0.1 | REACTOME P75NTR RECRUITS SIGNALLING COMPLEXES | Genes involved in p75NTR recruits signalling complexes |
0.0 | 0.7 | REACTOME EXTENSION OF TELOMERES | Genes involved in Extension of Telomeres |
0.0 | 0.1 | REACTOME RNA POL III TRANSCRIPTION TERMINATION | Genes involved in RNA Polymerase III Transcription Termination |
0.0 | 0.8 | REACTOME REGULATION OF BETA CELL DEVELOPMENT | Genes involved in Regulation of beta-cell development |
0.0 | 0.2 | REACTOME PHASE II CONJUGATION | Genes involved in Phase II conjugation |
0.0 | 0.7 | REACTOME INTERFERON SIGNALING | Genes involved in Interferon Signaling |
0.0 | 0.5 | REACTOME NUCLEOTIDE BINDING DOMAIN LEUCINE RICH REPEAT CONTAINING RECEPTOR NLR SIGNALING PATHWAYS | Genes involved in Nucleotide-binding domain, leucine rich repeat containing receptor (NLR) signaling pathways |
0.0 | 1.3 | REACTOME IMMUNOREGULATORY INTERACTIONS BETWEEN A LYMPHOID AND A NON LYMPHOID CELL | Genes involved in Immunoregulatory interactions between a Lymphoid and a non-Lymphoid cell |
0.0 | 0.4 | REACTOME INTRINSIC PATHWAY | Genes involved in Intrinsic Pathway |
0.0 | 1.1 | REACTOME O LINKED GLYCOSYLATION OF MUCINS | Genes involved in O-linked glycosylation of mucins |
0.0 | 0.2 | REACTOME GAMMA CARBOXYLATION TRANSPORT AND AMINO TERMINAL CLEAVAGE OF PROTEINS | Genes involved in Gamma-carboxylation, transport, and amino-terminal cleavage of proteins |
0.0 | 0.1 | REACTOME RIP MEDIATED NFKB ACTIVATION VIA DAI | Genes involved in RIP-mediated NFkB activation via DAI |
0.0 | 0.2 | REACTOME TRAF6 MEDIATED NFKB ACTIVATION | Genes involved in TRAF6 mediated NF-kB activation |
0.0 | 0.1 | REACTOME RAP1 SIGNALLING | Genes involved in Rap1 signalling |
0.0 | 0.0 | REACTOME RETROGRADE NEUROTROPHIN SIGNALLING | Genes involved in Retrograde neurotrophin signalling |
0.0 | 0.1 | REACTOME SIGNALLING TO ERKS | Genes involved in Signalling to ERKs |
0.0 | 0.4 | REACTOME CHONDROITIN SULFATE BIOSYNTHESIS | Genes involved in Chondroitin sulfate biosynthesis |
0.0 | 0.2 | REACTOME METAL ION SLC TRANSPORTERS | Genes involved in Metal ion SLC transporters |
0.0 | 0.1 | REACTOME GAP JUNCTION DEGRADATION | Genes involved in Gap junction degradation |
0.0 | 0.4 | REACTOME STEROID HORMONES | Genes involved in Steroid hormones |
0.0 | 0.0 | REACTOME PLATELET ADHESION TO EXPOSED COLLAGEN | Genes involved in Platelet Adhesion to exposed collagen |
0.0 | 0.1 | REACTOME SMAD2 SMAD3 SMAD4 HETEROTRIMER REGULATES TRANSCRIPTION | Genes involved in SMAD2/SMAD3:SMAD4 heterotrimer regulates transcription |
0.0 | 0.2 | REACTOME ELEVATION OF CYTOSOLIC CA2 LEVELS | Genes involved in Elevation of cytosolic Ca2+ levels |
0.0 | 0.1 | REACTOME TRANSPORT TO THE GOLGI AND SUBSEQUENT MODIFICATION | Genes involved in Transport to the Golgi and subsequent modification |
0.0 | 0.0 | REACTOME GLUCAGON SIGNALING IN METABOLIC REGULATION | Genes involved in Glucagon signaling in metabolic regulation |
0.0 | 0.0 | REACTOME PROSTANOID LIGAND RECEPTORS | Genes involved in Prostanoid ligand receptors |
0.0 | 0.4 | REACTOME INSULIN RECEPTOR RECYCLING | Genes involved in Insulin receptor recycling |
0.0 | 0.1 | REACTOME TGF BETA RECEPTOR SIGNALING IN EMT EPITHELIAL TO MESENCHYMAL TRANSITION | Genes involved in TGF-beta receptor signaling in EMT (epithelial to mesenchymal transition) |
0.0 | 0.2 | REACTOME DEPOSITION OF NEW CENPA CONTAINING NUCLEOSOMES AT THE CENTROMERE | Genes involved in Deposition of New CENPA-containing Nucleosomes at the Centromere |
0.0 | 0.1 | REACTOME LATENT INFECTION OF HOMO SAPIENS WITH MYCOBACTERIUM TUBERCULOSIS | Genes involved in Latent infection of Homo sapiens with Mycobacterium tuberculosis |
0.0 | 0.1 | REACTOME PEPTIDE HORMONE BIOSYNTHESIS | Genes involved in Peptide hormone biosynthesis |
0.0 | 0.4 | REACTOME TRANSPORT OF VITAMINS NUCLEOSIDES AND RELATED MOLECULES | Genes involved in Transport of vitamins, nucleosides, and related molecules |
0.0 | 0.0 | REACTOME SIGNAL AMPLIFICATION | Genes involved in Signal amplification |
0.0 | 0.5 | REACTOME LATE PHASE OF HIV LIFE CYCLE | Genes involved in Late Phase of HIV Life Cycle |
0.0 | 0.2 | REACTOME FANCONI ANEMIA PATHWAY | Genes involved in Fanconi Anemia pathway |
0.0 | 0.1 | REACTOME INITIAL TRIGGERING OF COMPLEMENT | Genes involved in Initial triggering of complement |
0.0 | 0.0 | REACTOME TRANS GOLGI NETWORK VESICLE BUDDING | Genes involved in trans-Golgi Network Vesicle Budding |
0.0 | 0.7 | REACTOME CHEMOKINE RECEPTORS BIND CHEMOKINES | Genes involved in Chemokine receptors bind chemokines |
0.0 | 0.5 | REACTOME TRANSLATION | Genes involved in Translation |
0.0 | 0.2 | REACTOME SIGNALING BY ERBB4 | Genes involved in Signaling by ERBB4 |
0.0 | 0.3 | REACTOME NOTCH1 INTRACELLULAR DOMAIN REGULATES TRANSCRIPTION | Genes involved in NOTCH1 Intracellular Domain Regulates Transcription |
0.0 | 0.2 | REACTOME PLATELET AGGREGATION PLUG FORMATION | Genes involved in Platelet Aggregation (Plug Formation) |
0.0 | 0.0 | REACTOME PI3K AKT ACTIVATION | Genes involved in PI3K/AKT activation |
0.0 | 0.4 | REACTOME TIGHT JUNCTION INTERACTIONS | Genes involved in Tight junction interactions |
0.0 | 0.2 | REACTOME CGMP EFFECTS | Genes involved in cGMP effects |
0.0 | 0.2 | REACTOME TRNA AMINOACYLATION | Genes involved in tRNA Aminoacylation |
0.0 | 0.1 | REACTOME RESOLUTION OF AP SITES VIA THE SINGLE NUCLEOTIDE REPLACEMENT PATHWAY | Genes involved in Resolution of AP sites via the single-nucleotide replacement pathway |
0.0 | 0.0 | REACTOME PROSTACYCLIN SIGNALLING THROUGH PROSTACYCLIN RECEPTOR | Genes involved in Prostacyclin signalling through prostacyclin receptor |
0.0 | 0.0 | REACTOME SIGNAL REGULATORY PROTEIN SIRP FAMILY INTERACTIONS | Genes involved in Signal regulatory protein (SIRP) family interactions |
0.0 | 0.1 | REACTOME TETRAHYDROBIOPTERIN BH4 SYNTHESIS RECYCLING SALVAGE AND REGULATION | Genes involved in Tetrahydrobiopterin (BH4) synthesis, recycling, salvage and regulation |
0.0 | 0.1 | REACTOME GLYCOGEN BREAKDOWN GLYCOGENOLYSIS | Genes involved in Glycogen breakdown (glycogenolysis) |
0.0 | 0.0 | REACTOME REGULATION OF INSULIN SECRETION BY GLUCAGON LIKE PEPTIDE1 | Genes involved in Regulation of Insulin Secretion by Glucagon-like Peptide-1 |
0.0 | 0.1 | REACTOME MEIOSIS | Genes involved in Meiosis |