Gene Symbol | Gene ID | Gene Info |
---|---|---|
Rxra
|
ENSMUSG00000015846.8 | Rxra |
CRE | Gene | Distance | Association probability | Pearson corr. coef. | P-value | Plot |
---|---|---|---|---|---|---|
Rxra | chr2_27626687_27626870 | 49662 | 0.126224 | 0.82 | 2.8e-14 | Click! |
Rxra | chr2_27702992_27703610 | 5991 | 0.278339 | 0.79 | 7.0e-13 | Click! |
Rxra | chr2_27624746_27625249 | 51443 | 0.121421 | 0.79 | 1.0e-12 | Click! |
Rxra | chr2_27703794_27704322 | 5234 | 0.285996 | 0.78 | 2.6e-12 | Click! |
Rxra | chr2_27627008_27627159 | 49357 | 0.127060 | 0.77 | 5.1e-12 | Click! |
Move your cursor over a bar to see sample name and corresponding Z-value.
Cis Regulatory Element (CRE) | Target Score | Top associated gene | Gene Info | Distance of CRE to TSS | CRE/Gene association probability |
---|---|---|---|---|---|
chr10_127508848_127510720 | 38.21 |
Stac3 |
SH3 and cysteine rich domain 3 |
2559 |
0.15 |
chr8_46404279_46404464 | 34.48 |
Gm45253 |
predicted gene 45253 |
18483 |
0.13 |
chr2_72785445_72785619 | 27.93 |
6430710C18Rik |
RIKEN cDNA 6430710C18 gene |
14622 |
0.23 |
chr11_98904631_98904915 | 27.05 |
Cdc6 |
cell division cycle 6 |
3028 |
0.15 |
chr2_131222259_131222421 | 25.81 |
Mavs |
mitochondrial antiviral signaling protein |
11723 |
0.1 |
chr2_173050678_173051259 | 25.22 |
Gm14453 |
predicted gene 14453 |
16388 |
0.13 |
chr6_71199690_71199907 | 23.31 |
Fabp1 |
fatty acid binding protein 1, liver |
29 |
0.96 |
chr17_5893214_5893395 | 23.07 |
Gm8376 |
predicted gene 8376 |
45783 |
0.1 |
chr6_136647483_136647837 | 22.54 |
Plbd1 |
phospholipase B domain containing 1 |
13102 |
0.15 |
chr2_84810833_84811663 | 22.45 |
Ube2l6 |
ubiquitin-conjugating enzyme E2L 6 |
5019 |
0.11 |
chr2_173152448_173152646 | 21.82 |
Pck1 |
phosphoenolpyruvate carboxykinase 1, cytosolic |
501 |
0.77 |
chr15_85771411_85771582 | 21.44 |
Ppara |
peroxisome proliferator activated receptor alpha |
718 |
0.61 |
chr2_115520519_115520722 | 19.91 |
3110099E03Rik |
RIKEN cDNA 3110099E03 gene |
7124 |
0.25 |
chr10_80332200_80332394 | 19.83 |
Reep6 |
receptor accessory protein 6 |
2095 |
0.11 |
chr5_36724217_36724614 | 19.83 |
Gm43701 |
predicted gene 43701 |
24203 |
0.11 |
chr7_127276694_127276979 | 19.79 |
Sephs2 |
selenophosphate synthetase 2 |
2781 |
0.1 |
chr5_65350579_65350731 | 19.78 |
Klb |
klotho beta |
2247 |
0.19 |
chr11_102241268_102241471 | 19.63 |
Hrob |
homologous recombination factor with OB-fold |
7513 |
0.09 |
chr13_9057349_9057545 | 19.19 |
Gm36264 |
predicted gene, 36264 |
19004 |
0.13 |
chr2_78718744_78718973 | 19.07 |
Gm14463 |
predicted gene 14463 |
61429 |
0.13 |
chr1_190059141_190059311 | 18.85 |
Gm28172 |
predicted gene 28172 |
109444 |
0.06 |
chr11_86580429_86580773 | 18.73 |
Mir21a |
microRNA 21a |
3557 |
0.18 |
chr9_54571273_54571435 | 18.70 |
Cib2 |
calcium and integrin binding family member 2 |
11136 |
0.16 |
chr2_126575507_126575676 | 18.66 |
Slc27a2 |
solute carrier family 27 (fatty acid transporter), member 2 |
10831 |
0.18 |
chr4_150685197_150685518 | 18.57 |
Gm16079 |
predicted gene 16079 |
6565 |
0.21 |
chr1_180821249_180821410 | 18.32 |
H3f3a |
H3.3 histone A |
7386 |
0.1 |
chr2_51137657_51137866 | 18.26 |
Rnd3 |
Rho family GTPase 3 |
11333 |
0.25 |
chr11_79771332_79771811 | 18.20 |
9130204K15Rik |
RIKEN cDNA 9130204K15 gene |
11316 |
0.16 |
chr1_185515526_185516243 | 17.98 |
5033404E19Rik |
RIKEN cDNA 5033404E19 gene |
18496 |
0.17 |
chr4_59440015_59440357 | 17.93 |
Susd1 |
sushi domain containing 1 |
1553 |
0.42 |
chr14_76817069_76817629 | 17.93 |
Gm48968 |
predicted gene, 48968 |
15472 |
0.18 |
chr2_35419345_35419505 | 17.88 |
Ggta1 |
glycoprotein galactosyltransferase alpha 1, 3 |
3902 |
0.16 |
chr1_55173634_55173814 | 17.78 |
Gm6822 |
predicted pseudogene 6822 |
12671 |
0.12 |
chr8_33987514_33987726 | 17.72 |
Gm45817 |
predicted gene 45817 |
420 |
0.77 |
chr2_164774058_164774238 | 17.68 |
Ube2c |
ubiquitin-conjugating enzyme E2C |
4245 |
0.08 |
chr11_98446586_98447075 | 17.68 |
Grb7 |
growth factor receptor bound protein 7 |
4 |
0.95 |
chr6_141615453_141615641 | 17.64 |
Slco1b2 |
solute carrier organic anion transporter family, member 1b2 |
13971 |
0.25 |
chr16_13276181_13276648 | 17.62 |
Mrtfb |
myocardin related transcription factor B |
11338 |
0.26 |
chr8_85380323_85380758 | 17.47 |
Mylk3 |
myosin light chain kinase 3 |
438 |
0.77 |
chr10_59403524_59403720 | 17.46 |
Pla2g12b |
phospholipase A2, group XIIB |
38 |
0.97 |
chr4_118526862_118527114 | 17.44 |
2610528J11Rik |
RIKEN cDNA 2610528J11 gene |
11 |
0.96 |
chr1_182268291_182268667 | 17.26 |
Degs1 |
delta(4)-desaturase, sphingolipid 1 |
13745 |
0.17 |
chr16_26368186_26368413 | 17.24 |
Cldn1 |
claudin 1 |
3542 |
0.35 |
chr2_173152672_173153088 | 17.20 |
Pck1 |
phosphoenolpyruvate carboxykinase 1, cytosolic |
168 |
0.95 |
chr3_98255299_98255471 | 17.02 |
Gm42821 |
predicted gene 42821 |
6786 |
0.15 |
chr12_40888538_40889137 | 16.97 |
Gm7239 |
predicted gene 7239 |
4223 |
0.18 |
chr4_80949512_80949709 | 16.95 |
Gm27452 |
predicted gene, 27452 |
17834 |
0.24 |
chr10_99202377_99202686 | 16.87 |
Poc1b |
POC1 centriolar protein B |
9639 |
0.12 |
chr12_118186558_118187081 | 16.86 |
Dnah11 |
dynein, axonemal, heavy chain 11 |
12224 |
0.25 |
chr17_13129871_13130154 | 16.77 |
Unc93a |
unc-93 homolog A |
1743 |
0.25 |
chr9_50922435_50922631 | 16.66 |
Gm25558 |
predicted gene, 25558 |
34583 |
0.13 |
chr11_4998343_4998516 | 16.45 |
Ap1b1 |
adaptor protein complex AP-1, beta 1 subunit |
11045 |
0.13 |
chr7_97747129_97747413 | 16.42 |
Aqp11 |
aquaporin 11 |
8982 |
0.16 |
chr17_7383532_7383841 | 16.38 |
Unc93a2 |
unc-93 homolog A2 |
1698 |
0.28 |
chr7_80451935_80452166 | 16.38 |
Blm |
Bloom syndrome, RecQ like helicase |
5322 |
0.14 |
chr14_31433815_31434149 | 16.37 |
Sh3bp5 |
SH3-domain binding protein 5 (BTK-associated) |
2083 |
0.25 |
chrX_10239544_10239841 | 16.33 |
Otc |
ornithine transcarbamylase |
12613 |
0.22 |
chr8_110530474_110530628 | 16.19 |
Gm44489 |
predicted gene, 44489 |
26311 |
0.16 |
chr19_47402722_47402937 | 16.13 |
Sh3pxd2a |
SH3 and PX domains 2A |
7530 |
0.23 |
chr5_27708254_27708552 | 15.95 |
Paxip1 |
PAX interacting (with transcription-activation domain) protein 1 |
42892 |
0.16 |
chr19_43782049_43782382 | 15.94 |
Abcc2 |
ATP-binding cassette, sub-family C (CFTR/MRP), member 2 |
23 |
0.97 |
chr14_54383598_54383819 | 15.94 |
Slc7a7 |
solute carrier family 7 (cationic amino acid transporter, y+ system), member 7 |
459 |
0.67 |
chr8_40572970_40573513 | 15.94 |
Mtmr7 |
myotubularin related protein 7 |
17273 |
0.16 |
chr12_99418877_99419035 | 15.87 |
Foxn3 |
forkhead box N3 |
6351 |
0.18 |
chr10_45422405_45422561 | 15.77 |
Lin28b |
lin-28 homolog B (C. elegans) |
47718 |
0.13 |
chr12_111440900_111441076 | 15.72 |
Tnfaip2 |
tumor necrosis factor, alpha-induced protein 2 |
1481 |
0.28 |
chr17_12385565_12385750 | 15.70 |
Plg |
plasminogen |
6998 |
0.17 |
chr7_135521666_135522037 | 15.67 |
Clrn3 |
clarin 3 |
6803 |
0.18 |
chr1_133372136_133372518 | 15.45 |
Etnk2 |
ethanolamine kinase 2 |
5040 |
0.15 |
chr2_164458650_164458990 | 15.28 |
Sys1 |
SYS1 Golgi-localized integral membrane protein homolog (S. cerevisiae) |
1732 |
0.15 |
chr9_57638713_57638942 | 15.27 |
Csk |
c-src tyrosine kinase |
4760 |
0.13 |
chr16_38294342_38294493 | 15.25 |
Nr1i2 |
nuclear receptor subfamily 1, group I, member 2 |
407 |
0.8 |
chr18_34915845_34916002 | 15.23 |
Etf1 |
eukaryotic translation termination factor 1 |
16084 |
0.11 |
chr16_46507399_46507598 | 15.20 |
Nectin3 |
nectin cell adhesion molecule 3 |
8973 |
0.26 |
chr9_55250981_55251141 | 15.18 |
Nrg4 |
neuregulin 4 |
8600 |
0.18 |
chr6_117888112_117888277 | 15.16 |
Gm29509 |
predicted gene 29509 |
11007 |
0.11 |
chr19_40500083_40500248 | 15.09 |
Sorbs1 |
sorbin and SH3 domain containing 1 |
12419 |
0.18 |
chr8_46446013_46446209 | 15.04 |
Gm45245 |
predicted gene 45245 |
6193 |
0.16 |
chr3_121867514_121867696 | 14.96 |
Gm42593 |
predicted gene 42593 |
4763 |
0.19 |
chr12_16726352_16726557 | 14.95 |
Greb1 |
gene regulated by estrogen in breast cancer protein |
13674 |
0.17 |
chr5_63847196_63847458 | 14.95 |
0610040J01Rik |
RIKEN cDNA 0610040J01 gene |
28982 |
0.16 |
chr14_75837044_75838069 | 14.92 |
Gm48931 |
predicted gene, 48931 |
3930 |
0.16 |
chr17_50544959_50545159 | 14.88 |
Plcl2 |
phospholipase C-like 2 |
35656 |
0.22 |
chr16_24879019_24879367 | 14.87 |
Gm22672 |
predicted gene, 22672 |
4980 |
0.26 |
chr2_32418807_32418958 | 14.84 |
Slc25a25 |
solute carrier family 25 (mitochondrial carrier, phosphate carrier), member 25 |
1052 |
0.33 |
chr15_82693079_82693230 | 14.79 |
Cyp2d37-ps |
cytochrome P450, family 2, subfamily d, polypeptide 37, pseudogene |
6 |
0.95 |
chr1_134460754_134460905 | 14.78 |
Klhl12 |
kelch-like 12 |
5274 |
0.11 |
chr9_53607384_53607535 | 14.75 |
Acat1 |
acetyl-Coenzyme A acetyltransferase 1 |
2871 |
0.2 |
chr11_32283952_32284215 | 14.71 |
Hba-a1 |
hemoglobin alpha, adult chain 1 |
272 |
0.83 |
chr12_31083123_31083348 | 14.71 |
Gm32443 |
predicted gene, 32443 |
6235 |
0.14 |
chr1_125519111_125519711 | 14.64 |
Slc35f5 |
solute carrier family 35, member F5 |
41184 |
0.17 |
chr6_8506676_8506940 | 14.62 |
A430035B10Rik |
RIKEN cDNA A430035B10 gene |
2213 |
0.24 |
chr5_96919678_96919932 | 14.61 |
Gm8013 |
predicted gene 8013 |
1467 |
0.22 |
chr7_25450305_25450456 | 14.61 |
Gm15495 |
predicted gene 15495 |
6917 |
0.11 |
chr2_60269924_60270087 | 14.59 |
Rpl10a-ps4 |
ribosomal protein L10A, pseudogene 4 |
5569 |
0.17 |
chr14_17785456_17785612 | 14.58 |
Gm48320 |
predicted gene, 48320 |
14412 |
0.28 |
chr7_116292432_116292818 | 14.55 |
Gm44867 |
predicted gene 44867 |
9740 |
0.14 |
chr1_125694397_125694731 | 14.45 |
Gpr39 |
G protein-coupled receptor 39 |
17569 |
0.22 |
chr11_96638027_96638367 | 14.43 |
Skap1 |
src family associated phosphoprotein 1 |
70038 |
0.08 |
chr2_163575250_163575556 | 14.42 |
Hnf4a |
hepatic nuclear factor 4, alpha |
25320 |
0.11 |
chr11_94589805_94589967 | 14.38 |
Acsf2 |
acyl-CoA synthetase family member 2 |
11883 |
0.11 |
chr9_110343931_110344181 | 14.38 |
Scap |
SREBF chaperone |
143 |
0.93 |
chr7_120150374_120150547 | 14.37 |
Zp2 |
zona pellucida glycoprotein 2 |
5169 |
0.14 |
chr4_154911733_154912047 | 14.36 |
Prxl2b |
peroxiredoxin like 2B |
12755 |
0.11 |
chr9_57664734_57664895 | 14.35 |
Csk |
c-src tyrosine kinase |
11183 |
0.11 |
chr10_118629771_118629922 | 14.30 |
Ifngas1 |
Ifng antisense RNA 1 |
73321 |
0.08 |
chr7_19677850_19678232 | 14.27 |
Apoc2 |
apolipoprotein C-II |
100 |
0.91 |
chr15_82407139_82407298 | 14.23 |
Cyp2d10 |
cytochrome P450, family 2, subfamily d, polypeptide 10 |
23 |
0.51 |
chrX_93089100_93089251 | 14.18 |
1700003E24Rik |
RIKEN cDNA 1700003E24 gene |
66979 |
0.11 |
chr7_80971099_80971312 | 14.17 |
Gm18782 |
predicted gene, 18782 |
8688 |
0.11 |
chr19_11022451_11022797 | 14.08 |
Ms4a18 |
membrane-spanning 4-domains, subfamily A, member 18 |
4593 |
0.12 |
chr17_88543781_88543932 | 14.06 |
Gm38109 |
predicted gene, 38109 |
10829 |
0.17 |
chr12_105757874_105758401 | 14.05 |
Ak7 |
adenylate kinase 7 |
12862 |
0.17 |
chr13_37715866_37716054 | 14.00 |
Gm40918 |
predicted gene, 40918 |
351 |
0.82 |
chr1_180262307_180262462 | 14.00 |
Psen2 |
presenilin 2 |
1054 |
0.45 |
chr12_102691257_102691551 | 14.00 |
Itpk1 |
inositol 1,3,4-triphosphate 5/6 kinase |
4398 |
0.12 |
chr4_154913822_154913989 | 13.94 |
Tnfrsf14 |
tumor necrosis factor receptor superfamily, member 14 (herpesvirus entry mediator) |
14172 |
0.11 |
chr16_8603622_8604209 | 13.94 |
Abat |
4-aminobutyrate aminotransferase |
8963 |
0.12 |
chr8_70653352_70653535 | 13.93 |
Pgpep1 |
pyroglutamyl-peptidase I |
1936 |
0.16 |
chr8_123051510_123051721 | 13.90 |
2810013P06Rik |
RIKEN cDNA 2810013P06 gene |
9149 |
0.1 |
chr13_100201785_100201950 | 13.89 |
Naip2 |
NLR family, apoptosis inhibitory protein 2 |
94 |
0.96 |
chr8_128473975_128474138 | 13.77 |
Nrp1 |
neuropilin 1 |
114659 |
0.06 |
chr6_17568755_17568934 | 13.77 |
Met |
met proto-oncogene |
21871 |
0.2 |
chrX_164427419_164427599 | 13.76 |
Piga |
phosphatidylinositol glycan anchor biosynthesis, class A |
1999 |
0.29 |
chr9_108079972_108080508 | 13.73 |
Mst1 |
macrophage stimulating 1 (hepatocyte growth factor-like) |
196 |
0.68 |
chr5_91292941_91293393 | 13.71 |
Gm19619 |
predicted gene, 19619 |
9746 |
0.24 |
chr12_84161616_84161799 | 13.68 |
Elmsan1 |
ELM2 and Myb/SANT-like domain containing 1 |
1569 |
0.24 |
chr8_120486990_120488549 | 13.68 |
Gse1 |
genetic suppressor element 1, coiled-coil protein |
678 |
0.64 |
chr19_27325717_27325868 | 13.63 |
Kcnv2 |
potassium channel, subfamily V, member 2 |
3204 |
0.23 |
chr9_103287972_103288152 | 13.60 |
1300017J02Rik |
RIKEN cDNA 1300017J02 gene |
162 |
0.95 |
chr2_173157455_173157674 | 13.54 |
Pck1 |
phosphoenolpyruvate carboxykinase 1, cytosolic |
4482 |
0.19 |
chr5_137530580_137532081 | 13.47 |
Gnb2 |
guanine nucleotide binding protein (G protein), beta 2 |
33 |
0.9 |
chr12_51915224_51915476 | 13.43 |
Heatr5a |
HEAT repeat containing 5A |
3376 |
0.27 |
chr13_112055175_112055369 | 13.41 |
Gm15323 |
predicted gene 15323 |
49770 |
0.12 |
chr3_52617525_52617678 | 13.41 |
Gm10293 |
predicted pseudogene 10293 |
4766 |
0.28 |
chr12_111028361_111028545 | 13.36 |
Gm48631 |
predicted gene, 48631 |
10051 |
0.12 |
chr9_38744701_38744880 | 13.31 |
Olfr920 |
olfactory receptor 920 |
7509 |
0.08 |
chr7_35167963_35168328 | 13.27 |
Slc7a10 |
solute carrier family 7 (cationic amino acid transporter, y+ system), member 10 |
18240 |
0.1 |
chrX_36142353_36142504 | 13.22 |
Il13ra1 |
interleukin 13 receptor, alpha 1 |
30318 |
0.15 |
chr9_98299649_98299823 | 13.19 |
Gm28530 |
predicted gene 28530 |
1914 |
0.34 |
chr2_125901161_125901325 | 13.14 |
Galk2 |
galactokinase 2 |
34975 |
0.17 |
chr1_171204349_171204514 | 13.05 |
Pcp4l1 |
Purkinje cell protein 4-like 1 |
8163 |
0.08 |
chr11_89003182_89003345 | 13.02 |
Trim25 |
tripartite motif-containing 25 |
3887 |
0.13 |
chr5_93290268_93290448 | 13.02 |
Ccng2 |
cyclin G2 |
21650 |
0.17 |
chr17_86601244_86601425 | 13.00 |
Gm18832 |
predicted gene, 18832 |
84162 |
0.08 |
chr2_84627086_84627264 | 12.99 |
Ctnnd1 |
catenin (cadherin associated protein), delta 1 |
10930 |
0.1 |
chr11_54249024_54249175 | 12.97 |
Csf2 |
colony stimulating factor 2 (granulocyte-macrophage) |
568 |
0.6 |
chr7_98119163_98119341 | 12.96 |
Myo7a |
myosin VIIA |
240 |
0.92 |
chr2_132103564_132103754 | 12.92 |
Gm14052 |
predicted gene 14052 |
3790 |
0.2 |
chr7_143419824_143420081 | 12.84 |
Cdkn1c |
cyclin-dependent kinase inhibitor 1C (P57) |
39359 |
0.09 |
chr11_102316544_102317735 | 12.79 |
Ubtf |
upstream binding transcription factor, RNA polymerase I |
148 |
0.92 |
chr17_45767553_45767750 | 12.77 |
F630040K05Rik |
RIKEN cDNA F630040K05 gene |
456 |
0.78 |
chr17_56287885_56288088 | 12.76 |
Plin3 |
perilipin 3 |
2525 |
0.14 |
chrX_140506076_140506481 | 12.70 |
Tsc22d3 |
TSC22 domain family, member 3 |
36390 |
0.14 |
chr5_145222933_145223234 | 12.67 |
Zfp655 |
zinc finger protein 655 |
8632 |
0.1 |
chr1_125482142_125482297 | 12.67 |
Gm28706 |
predicted gene 28706 |
37652 |
0.17 |
chr13_98944656_98944815 | 12.63 |
Gm35215 |
predicted gene, 35215 |
1181 |
0.37 |
chr17_28437975_28438272 | 12.61 |
Fkbp5 |
FK506 binding protein 5 |
2887 |
0.14 |
chr6_52486232_52486466 | 12.58 |
1700094M24Rik |
RIKEN cDNA 1700094M24 gene |
6102 |
0.17 |
chr7_46833351_46833657 | 12.58 |
Gm45308 |
predicted gene 45308 |
1040 |
0.32 |
chr8_31859301_31859475 | 12.57 |
Nrg1 |
neuregulin 1 |
10013 |
0.27 |
chr4_154020712_154021162 | 12.56 |
Lrrc47 |
leucine rich repeat containing 47 |
1298 |
0.27 |
chr9_22131307_22131532 | 12.53 |
Acp5 |
acid phosphatase 5, tartrate resistant |
234 |
0.81 |
chr10_62425411_62425870 | 12.50 |
Hkdc1 |
hexokinase domain containing 1 |
3149 |
0.18 |
chr5_147546034_147546222 | 12.50 |
Pan3 |
PAN3 poly(A) specific ribonuclease subunit |
6851 |
0.21 |
chr9_78217062_78217474 | 12.48 |
Gm3126 |
predicted gene 3126 |
2423 |
0.16 |
chr6_119395748_119395980 | 12.48 |
Adipor2 |
adiponectin receptor 2 |
5616 |
0.23 |
chr9_108005208_108005399 | 12.46 |
Ip6k1 |
inositol hexaphosphate kinase 1 |
2632 |
0.08 |
chr17_80558626_80558849 | 12.46 |
Cdkl4 |
cyclin-dependent kinase-like 4 |
5097 |
0.19 |
chr4_132483027_132483198 | 12.45 |
Med18 |
mediator complex subunit 18 |
19191 |
0.09 |
chr9_15245406_15245599 | 12.45 |
Vstm5 |
V-set and transmembrane domain containing 5 |
6457 |
0.09 |
chr14_46277910_46278097 | 12.44 |
Gm15217 |
predicted gene 15217 |
101411 |
0.06 |
chr1_136895970_136896122 | 12.39 |
Nr5a2 |
nuclear receptor subfamily 5, group A, member 2 |
44537 |
0.14 |
chr11_22847468_22847655 | 12.37 |
Gm23772 |
predicted gene, 23772 |
693 |
0.56 |
chr8_106134810_106135562 | 12.36 |
Esrp2 |
epithelial splicing regulatory protein 2 |
90 |
0.67 |
chr14_7952438_7953164 | 12.32 |
Gm45521 |
predicted gene 45521 |
4487 |
0.21 |
chr14_7829302_7829468 | 12.30 |
Flnb |
filamin, beta |
11428 |
0.16 |
chr8_45342043_45342237 | 12.29 |
Cyp4v3 |
cytochrome P450, family 4, subfamily v, polypeptide 3 |
8924 |
0.15 |
chr4_95939014_95939165 | 12.27 |
9530080O11Rik |
RIKEN cDNA 9530080O11 gene |
27946 |
0.17 |
chr2_160619035_160619209 | 12.27 |
Gm14221 |
predicted gene 14221 |
849 |
0.57 |
chr12_25145398_25145549 | 12.24 |
Gm36287 |
predicted gene, 36287 |
5442 |
0.18 |
chr5_34924526_34924867 | 12.22 |
Msantd1 |
Myb/SANT-like DNA-binding domain containing 1 |
7157 |
0.18 |
chr1_162814987_162815385 | 12.20 |
Fmo4 |
flavin containing monooxygenase 4 |
1214 |
0.46 |
chr13_31179382_31179594 | 12.19 |
Gm11372 |
predicted gene 11372 |
19598 |
0.21 |
chr11_101364463_101364614 | 12.18 |
AL590969.1 |
glucose-6-phosphatase, catalytic (G6pc) pseudogene |
2175 |
0.1 |
chr17_29554301_29554452 | 12.17 |
Tmem217 |
transmembrane protein 217 |
1991 |
0.17 |
chr12_40114119_40114279 | 12.16 |
Scin |
scinderin |
19984 |
0.16 |
chr11_115448120_115448406 | 12.15 |
Mir3968 |
microRNA 3968 |
203 |
0.84 |
chr7_135986155_135986329 | 12.15 |
Gm9341 |
predicted gene 9341 |
33444 |
0.18 |
chr9_50924434_50924623 | 12.10 |
Gm25558 |
predicted gene, 25558 |
36578 |
0.13 |
chr1_190042373_190042562 | 12.09 |
Smyd2 |
SET and MYND domain containing 2 |
120104 |
0.05 |
chr16_23463755_23463923 | 12.06 |
Rtp1 |
receptor transporter protein 1 |
34706 |
0.11 |
chr8_125930402_125930585 | 12.02 |
Map3k21 |
mitogen-activated protein kinase kinase kinase 21 |
20043 |
0.17 |
chr5_146757390_146757596 | 12.02 |
Usp12 |
ubiquitin specific peptidase 12 |
955 |
0.52 |
chr8_117334022_117334408 | 12.01 |
Cmip |
c-Maf inducing protein |
14955 |
0.24 |
chr17_36897031_36897328 | 12.00 |
Trim31 |
tripartite motif-containing 31 |
939 |
0.33 |
chr5_93296336_93296489 | 12.00 |
Ccng2 |
cyclin G2 |
27704 |
0.16 |
chr9_5286578_5286831 | 11.99 |
Casp1 |
caspase 1 |
11804 |
0.22 |
chr11_120852104_120852370 | 11.99 |
Gm11773 |
predicted gene 11773 |
21208 |
0.09 |
chr1_127275685_127275849 | 11.93 |
Gm37510 |
predicted gene, 37510 |
5243 |
0.17 |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
10.1 | 40.2 | GO:0006114 | glycerol biosynthetic process(GO:0006114) |
7.2 | 21.6 | GO:0048769 | sarcomerogenesis(GO:0048769) |
5.8 | 17.4 | GO:0072361 | regulation of glycolytic process by regulation of transcription from RNA polymerase II promoter(GO:0072361) |
5.6 | 16.9 | GO:0010916 | regulation of very-low-density lipoprotein particle clearance(GO:0010915) negative regulation of very-low-density lipoprotein particle clearance(GO:0010916) |
5.0 | 30.0 | GO:0042737 | drug catabolic process(GO:0042737) |
4.5 | 22.6 | GO:0015722 | canalicular bile acid transport(GO:0015722) |
4.4 | 4.4 | GO:0035995 | detection of muscle stretch(GO:0035995) |
3.7 | 11.2 | GO:0019448 | cysteine catabolic process(GO:0009093) L-cysteine catabolic process(GO:0019448) L-cysteine metabolic process(GO:0046439) |
3.7 | 3.7 | GO:0071688 | skeletal muscle myosin thick filament assembly(GO:0030241) striated muscle myosin thick filament assembly(GO:0071688) |
3.4 | 30.4 | GO:0032000 | positive regulation of fatty acid beta-oxidation(GO:0032000) |
3.3 | 10.0 | GO:0035973 | aggrephagy(GO:0035973) |
3.2 | 19.5 | GO:0070327 | thyroid hormone transport(GO:0070327) |
2.9 | 8.8 | GO:0008050 | female courtship behavior(GO:0008050) |
2.9 | 14.7 | GO:0070627 | ferrous iron import(GO:0070627) |
2.9 | 17.5 | GO:0000820 | regulation of glutamine family amino acid metabolic process(GO:0000820) |
2.9 | 2.9 | GO:0002018 | renin-angiotensin regulation of aldosterone production(GO:0002018) |
2.9 | 14.3 | GO:0045918 | negative regulation of cytolysis(GO:0045918) |
2.9 | 5.7 | GO:1903598 | positive regulation of gap junction assembly(GO:1903598) |
2.7 | 10.8 | GO:0006564 | L-serine biosynthetic process(GO:0006564) |
2.7 | 10.7 | GO:0061113 | pancreas morphogenesis(GO:0061113) |
2.7 | 8.0 | GO:1900825 | regulation of membrane depolarization during cardiac muscle cell action potential(GO:1900825) |
2.6 | 23.4 | GO:0070269 | pyroptosis(GO:0070269) |
2.6 | 10.4 | GO:0006362 | transcription elongation from RNA polymerase I promoter(GO:0006362) |
2.6 | 10.3 | GO:0001712 | ectodermal cell fate commitment(GO:0001712) |
2.6 | 10.3 | GO:0032929 | negative regulation of superoxide anion generation(GO:0032929) |
2.6 | 7.7 | GO:0035694 | mitochondrial protein catabolic process(GO:0035694) |
2.5 | 7.5 | GO:1901844 | regulation of cell communication by electrical coupling involved in cardiac conduction(GO:1901844) |
2.5 | 12.5 | GO:0006686 | sphingomyelin biosynthetic process(GO:0006686) |
2.4 | 12.0 | GO:0048386 | positive regulation of retinoic acid receptor signaling pathway(GO:0048386) |
2.4 | 7.2 | GO:0090230 | regulation of centromere complex assembly(GO:0090230) |
2.4 | 7.1 | GO:0034441 | plasma lipoprotein particle oxidation(GO:0034441) |
2.3 | 6.8 | GO:0032789 | saturated monocarboxylic acid metabolic process(GO:0032788) unsaturated monocarboxylic acid metabolic process(GO:0032789) |
2.3 | 6.8 | GO:1902990 | mitotic telomere maintenance via semi-conservative replication(GO:1902990) |
2.2 | 2.2 | GO:0018894 | dibenzo-p-dioxin metabolic process(GO:0018894) |
2.2 | 19.8 | GO:0007175 | negative regulation of epidermal growth factor-activated receptor activity(GO:0007175) |
2.2 | 6.6 | GO:2000189 | positive regulation of cholesterol homeostasis(GO:2000189) |
2.2 | 8.7 | GO:0009756 | carbohydrate mediated signaling(GO:0009756) hexose mediated signaling(GO:0009757) sugar mediated signaling pathway(GO:0010182) glucose mediated signaling pathway(GO:0010255) |
2.2 | 10.8 | GO:0009446 | putrescine biosynthetic process(GO:0009446) |
2.1 | 14.8 | GO:0060763 | mammary duct terminal end bud growth(GO:0060763) |
2.1 | 6.3 | GO:0050427 | 3'-phosphoadenosine 5'-phosphosulfate metabolic process(GO:0050427) |
2.1 | 16.6 | GO:0050957 | equilibrioception(GO:0050957) |
2.1 | 6.2 | GO:0060523 | prostate epithelial cord elongation(GO:0060523) |
2.0 | 8.0 | GO:0086045 | membrane depolarization during AV node cell action potential(GO:0086045) |
2.0 | 6.0 | GO:1904672 | regulation of mesenchymal cell apoptotic process involved in nephron morphogenesis(GO:0072039) negative regulation of mesenchymal cell apoptotic process involved in nephron morphogenesis(GO:0072040) mesenchymal cell apoptotic process involved in nephron morphogenesis(GO:1901145) regulation of somatic stem cell population maintenance(GO:1904672) negative regulation of somatic stem cell population maintenance(GO:1904673) |
1.9 | 19.3 | GO:0034063 | stress granule assembly(GO:0034063) |
1.9 | 3.8 | GO:0072718 | response to cisplatin(GO:0072718) |
1.9 | 5.6 | GO:0019464 | glycine catabolic process(GO:0006546) glycine decarboxylation via glycine cleavage system(GO:0019464) |
1.9 | 15.0 | GO:0032933 | response to sterol depletion(GO:0006991) SREBP signaling pathway(GO:0032933) cellular response to sterol depletion(GO:0071501) |
1.9 | 1.9 | GO:0002019 | regulation of renal output by angiotensin(GO:0002019) |
1.8 | 5.5 | GO:0016554 | cytidine to uridine editing(GO:0016554) |
1.8 | 5.5 | GO:0006438 | valyl-tRNA aminoacylation(GO:0006438) |
1.8 | 3.7 | GO:2000670 | positive regulation of dendritic cell apoptotic process(GO:2000670) |
1.8 | 12.8 | GO:0044539 | long-chain fatty acid import(GO:0044539) |
1.8 | 1.8 | GO:0032252 | secretory granule localization(GO:0032252) |
1.8 | 5.3 | GO:1900740 | regulation of protein insertion into mitochondrial membrane involved in apoptotic signaling pathway(GO:1900739) positive regulation of protein insertion into mitochondrial membrane involved in apoptotic signaling pathway(GO:1900740) |
1.8 | 10.5 | GO:0031119 | tRNA pseudouridine synthesis(GO:0031119) |
1.7 | 8.7 | GO:0052805 | histidine catabolic process(GO:0006548) imidazole-containing compound catabolic process(GO:0052805) |
1.7 | 24.3 | GO:0042416 | dopamine biosynthetic process(GO:0042416) |
1.7 | 1.7 | GO:0009298 | GDP-mannose biosynthetic process(GO:0009298) |
1.7 | 10.3 | GO:0006591 | ornithine metabolic process(GO:0006591) |
1.7 | 3.4 | GO:0035771 | interleukin-4-mediated signaling pathway(GO:0035771) |
1.7 | 3.4 | GO:1900104 | hyaluranon cable assembly(GO:0036118) regulation of hyaluranon cable assembly(GO:1900104) positive regulation of hyaluranon cable assembly(GO:1900106) |
1.7 | 5.1 | GO:2000587 | regulation of platelet-derived growth factor receptor-beta signaling pathway(GO:2000586) negative regulation of platelet-derived growth factor receptor-beta signaling pathway(GO:2000587) |
1.7 | 5.0 | GO:0003383 | apical constriction(GO:0003383) |
1.7 | 6.7 | GO:2001184 | positive regulation of interleukin-12 secretion(GO:2001184) |
1.7 | 6.7 | GO:0034627 | 'de novo' NAD biosynthetic process(GO:0034627) |
1.7 | 1.7 | GO:2001182 | regulation of interleukin-12 secretion(GO:2001182) |
1.7 | 6.7 | GO:1902897 | regulation of postsynaptic density protein 95 clustering(GO:1902897) |
1.6 | 4.9 | GO:0021699 | cerebellar cortex maturation(GO:0021699) |
1.6 | 4.9 | GO:1903347 | negative regulation of bicellular tight junction assembly(GO:1903347) |
1.6 | 4.9 | GO:2000346 | negative regulation of hepatocyte proliferation(GO:2000346) |
1.6 | 4.9 | GO:0010989 | negative regulation of low-density lipoprotein particle clearance(GO:0010989) |
1.6 | 3.2 | GO:2000909 | regulation of cholesterol import(GO:0060620) regulation of sterol import(GO:2000909) |
1.6 | 4.9 | GO:0002036 | regulation of L-glutamate transport(GO:0002036) |
1.6 | 12.9 | GO:2000480 | negative regulation of cAMP-dependent protein kinase activity(GO:2000480) |
1.6 | 4.7 | GO:0019532 | oxalate transport(GO:0019532) |
1.6 | 3.1 | GO:0035469 | determination of pancreatic left/right asymmetry(GO:0035469) |
1.6 | 6.2 | GO:0090148 | membrane fission(GO:0090148) |
1.5 | 7.7 | GO:0010991 | negative regulation of SMAD protein complex assembly(GO:0010991) |
1.5 | 7.7 | GO:0015760 | hexose phosphate transport(GO:0015712) glucose-6-phosphate transport(GO:0015760) |
1.5 | 10.8 | GO:0015825 | L-serine transport(GO:0015825) |
1.5 | 4.6 | GO:0010724 | regulation of definitive erythrocyte differentiation(GO:0010724) |
1.5 | 7.6 | GO:0035356 | cellular triglyceride homeostasis(GO:0035356) |
1.5 | 4.5 | GO:0034421 | post-translational protein acetylation(GO:0034421) |
1.5 | 6.0 | GO:0006933 | negative regulation of cell adhesion involved in substrate-bound cell migration(GO:0006933) |
1.5 | 3.0 | GO:0072592 | oxygen metabolic process(GO:0072592) |
1.5 | 1.5 | GO:0006667 | sphinganine metabolic process(GO:0006667) |
1.4 | 5.7 | GO:0032763 | regulation of mast cell cytokine production(GO:0032763) |
1.4 | 8.5 | GO:0006776 | vitamin A metabolic process(GO:0006776) |
1.4 | 8.4 | GO:0045852 | pH elevation(GO:0045852) intracellular pH elevation(GO:0051454) |
1.4 | 16.7 | GO:0015721 | bile acid and bile salt transport(GO:0015721) |
1.4 | 5.5 | GO:0072697 | protein localization to cell cortex(GO:0072697) |
1.4 | 4.2 | GO:0035609 | C-terminal protein deglutamylation(GO:0035609) |
1.4 | 4.1 | GO:0032439 | endosome localization(GO:0032439) |
1.4 | 25.8 | GO:0070328 | acylglycerol homeostasis(GO:0055090) triglyceride homeostasis(GO:0070328) |
1.4 | 4.1 | GO:2001271 | negative regulation of cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:2001271) |
1.4 | 4.1 | GO:0002282 | microglial cell activation involved in immune response(GO:0002282) |
1.3 | 5.4 | GO:0071681 | response to indole-3-methanol(GO:0071680) cellular response to indole-3-methanol(GO:0071681) |
1.3 | 6.7 | GO:0048069 | eye pigmentation(GO:0048069) |
1.3 | 8.0 | GO:0006621 | protein retention in ER lumen(GO:0006621) |
1.3 | 4.0 | GO:1901509 | regulation of endothelial tube morphogenesis(GO:1901509) |
1.3 | 4.0 | GO:0006566 | threonine metabolic process(GO:0006566) |
1.3 | 5.3 | GO:0001887 | selenium compound metabolic process(GO:0001887) |
1.3 | 2.6 | GO:0035962 | response to interleukin-13(GO:0035962) cellular response to interleukin-13(GO:0035963) |
1.3 | 7.7 | GO:0034770 | histone H4-K20 methylation(GO:0034770) |
1.3 | 3.9 | GO:0038094 | Fc-gamma receptor signaling pathway(GO:0038094) |
1.3 | 5.1 | GO:1902255 | positive regulation of intrinsic apoptotic signaling pathway by p53 class mediator(GO:1902255) |
1.3 | 1.3 | GO:2001245 | regulation of phosphatidylcholine biosynthetic process(GO:2001245) |
1.3 | 15.2 | GO:0090136 | epithelial cell-cell adhesion(GO:0090136) |
1.3 | 31.6 | GO:0048821 | erythrocyte development(GO:0048821) |
1.3 | 1.3 | GO:0060300 | regulation of cytokine activity(GO:0060300) |
1.3 | 3.8 | GO:0045041 | protein import into mitochondrial intermembrane space(GO:0045041) |
1.2 | 1.2 | GO:0090365 | regulation of mRNA modification(GO:0090365) |
1.2 | 3.7 | GO:0035483 | gastric emptying(GO:0035483) |
1.2 | 2.5 | GO:0010908 | regulation of heparan sulfate proteoglycan biosynthetic process(GO:0010908) positive regulation of heparan sulfate proteoglycan biosynthetic process(GO:0010909) positive regulation of proteoglycan biosynthetic process(GO:1902730) |
1.2 | 2.4 | GO:1902894 | negative regulation of pri-miRNA transcription from RNA polymerase II promoter(GO:1902894) |
1.2 | 3.7 | GO:1900126 | negative regulation of hyaluronan biosynthetic process(GO:1900126) |
1.2 | 2.4 | GO:0045908 | negative regulation of vasodilation(GO:0045908) |
1.2 | 3.6 | GO:0061511 | centriole elongation(GO:0061511) |
1.2 | 3.6 | GO:0030242 | pexophagy(GO:0030242) |
1.2 | 7.1 | GO:0045213 | neurotransmitter receptor metabolic process(GO:0045213) |
1.2 | 4.7 | GO:0021555 | midbrain-hindbrain boundary morphogenesis(GO:0021555) |
1.2 | 8.3 | GO:0006007 | glucose catabolic process(GO:0006007) |
1.2 | 4.7 | GO:0051919 | positive regulation of fibrinolysis(GO:0051919) |
1.2 | 11.8 | GO:0034033 | nucleoside bisphosphate biosynthetic process(GO:0033866) ribonucleoside bisphosphate biosynthetic process(GO:0034030) purine nucleoside bisphosphate biosynthetic process(GO:0034033) |
1.2 | 3.5 | GO:0070278 | extracellular matrix constituent secretion(GO:0070278) |
1.2 | 1.2 | GO:2000416 | regulation of eosinophil migration(GO:2000416) |
1.1 | 11.5 | GO:0030853 | negative regulation of granulocyte differentiation(GO:0030853) |
1.1 | 2.3 | GO:1900625 | regulation of monocyte aggregation(GO:1900623) positive regulation of monocyte aggregation(GO:1900625) |
1.1 | 5.7 | GO:0015871 | choline transport(GO:0015871) |
1.1 | 3.4 | GO:0098904 | regulation of AV node cell action potential(GO:0098904) |
1.1 | 5.7 | GO:0070475 | rRNA base methylation(GO:0070475) |
1.1 | 1.1 | GO:0021938 | smoothened signaling pathway involved in regulation of cerebellar granule cell precursor cell proliferation(GO:0021938) |
1.1 | 7.9 | GO:0071635 | negative regulation of transforming growth factor beta production(GO:0071635) |
1.1 | 3.4 | GO:0070966 | nuclear-transcribed mRNA catabolic process, no-go decay(GO:0070966) |
1.1 | 4.5 | GO:0033353 | S-adenosylmethionine cycle(GO:0033353) |
1.1 | 3.3 | GO:0033211 | adiponectin-activated signaling pathway(GO:0033211) |
1.1 | 11.0 | GO:0060391 | positive regulation of SMAD protein import into nucleus(GO:0060391) |
1.1 | 2.2 | GO:1903423 | positive regulation of synaptic vesicle recycling(GO:1903423) |
1.1 | 8.7 | GO:0009650 | UV protection(GO:0009650) |
1.1 | 9.7 | GO:0046500 | S-adenosylmethionine metabolic process(GO:0046500) |
1.1 | 7.5 | GO:0000103 | sulfate assimilation(GO:0000103) |
1.1 | 5.4 | GO:0031293 | membrane protein intracellular domain proteolysis(GO:0031293) |
1.1 | 4.3 | GO:0071280 | cellular response to copper ion(GO:0071280) |
1.1 | 2.1 | GO:2000978 | negative regulation of forebrain neuron differentiation(GO:2000978) |
1.1 | 4.3 | GO:0002317 | plasma cell differentiation(GO:0002317) |
1.1 | 5.3 | GO:0032020 | ISG15-protein conjugation(GO:0032020) |
1.1 | 1.1 | GO:0043096 | purine nucleobase salvage(GO:0043096) |
1.1 | 3.2 | GO:0034499 | late endosome to Golgi transport(GO:0034499) |
1.1 | 6.3 | GO:0015936 | coenzyme A metabolic process(GO:0015936) |
1.1 | 1.1 | GO:0038145 | macrophage colony-stimulating factor signaling pathway(GO:0038145) |
1.1 | 1.1 | GO:0072133 | kidney mesenchyme morphogenesis(GO:0072131) metanephric mesenchyme morphogenesis(GO:0072133) |
1.1 | 3.2 | GO:0000965 | mitochondrial RNA 3'-end processing(GO:0000965) |
1.1 | 6.3 | GO:0006646 | phosphatidylethanolamine biosynthetic process(GO:0006646) |
1.1 | 3.2 | GO:2000566 | positive regulation of CD8-positive, alpha-beta T cell proliferation(GO:2000566) |
1.0 | 12.6 | GO:0003356 | regulation of cilium beat frequency(GO:0003356) |
1.0 | 1.0 | GO:0035672 | oligopeptide transmembrane transport(GO:0035672) |
1.0 | 1.0 | GO:0043633 | polyadenylation-dependent RNA catabolic process(GO:0043633) polyadenylation-dependent ncRNA catabolic process(GO:0043634) nuclear ncRNA surveillance(GO:0071029) nuclear polyadenylation-dependent rRNA catabolic process(GO:0071035) nuclear polyadenylation-dependent ncRNA catabolic process(GO:0071046) |
1.0 | 3.1 | GO:1900122 | positive regulation of receptor binding(GO:1900122) |
1.0 | 3.1 | GO:0015766 | disaccharide transport(GO:0015766) sucrose transport(GO:0015770) oligosaccharide transport(GO:0015772) |
1.0 | 8.3 | GO:1990001 | inhibition of cysteine-type endopeptidase activity(GO:0097340) zymogen inhibition(GO:0097341) inhibition of cysteine-type endopeptidase activity involved in apoptotic process(GO:1990001) |
1.0 | 2.1 | GO:0010897 | negative regulation of triglyceride catabolic process(GO:0010897) |
1.0 | 3.1 | GO:1900738 | regulation of phospholipase C-activating G-protein coupled receptor signaling pathway(GO:1900736) positive regulation of phospholipase C-activating G-protein coupled receptor signaling pathway(GO:1900738) |
1.0 | 3.0 | GO:0000087 | mitotic M phase(GO:0000087) |
1.0 | 3.0 | GO:0045964 | positive regulation of catecholamine metabolic process(GO:0045915) positive regulation of dopamine metabolic process(GO:0045964) |
1.0 | 4.0 | GO:0042695 | thelarche(GO:0042695) mammary gland branching involved in thelarche(GO:0060744) |
1.0 | 2.0 | GO:0034197 | acylglycerol transport(GO:0034196) triglyceride transport(GO:0034197) |
1.0 | 6.0 | GO:0090557 | establishment of endothelial intestinal barrier(GO:0090557) |
1.0 | 2.0 | GO:0018992 | germ-line sex determination(GO:0018992) |
1.0 | 1.0 | GO:0045626 | negative regulation of T-helper 1 cell differentiation(GO:0045626) |
1.0 | 2.0 | GO:2000383 | regulation of ectoderm development(GO:2000383) negative regulation of ectoderm development(GO:2000384) |
1.0 | 7.0 | GO:0032534 | regulation of microvillus assembly(GO:0032534) |
1.0 | 3.0 | GO:0060468 | prevention of polyspermy(GO:0060468) |
1.0 | 3.0 | GO:0006285 | base-excision repair, AP site formation(GO:0006285) |
1.0 | 1.0 | GO:0001705 | ectoderm formation(GO:0001705) |
1.0 | 9.8 | GO:0000042 | protein targeting to Golgi(GO:0000042) |
1.0 | 9.7 | GO:0061088 | sequestering of zinc ion(GO:0032119) regulation of sequestering of zinc ion(GO:0061088) |
1.0 | 1.9 | GO:0060336 | negative regulation of response to interferon-gamma(GO:0060331) negative regulation of interferon-gamma-mediated signaling pathway(GO:0060336) |
1.0 | 3.9 | GO:2000370 | positive regulation of clathrin-mediated endocytosis(GO:2000370) |
1.0 | 2.9 | GO:0006216 | cytidine catabolic process(GO:0006216) cytidine deamination(GO:0009972) cytidine metabolic process(GO:0046087) |
1.0 | 2.9 | GO:0046951 | ketone body biosynthetic process(GO:0046951) |
1.0 | 3.8 | GO:1903553 | positive regulation of extracellular exosome assembly(GO:1903553) |
1.0 | 6.7 | GO:1904754 | positive regulation of vascular associated smooth muscle cell migration(GO:1904754) |
1.0 | 2.9 | GO:1901525 | negative regulation of macromitophagy(GO:1901525) |
0.9 | 6.6 | GO:0034383 | low-density lipoprotein particle clearance(GO:0034383) |
0.9 | 5.6 | GO:0042904 | 9-cis-retinoic acid biosynthetic process(GO:0042904) 9-cis-retinoic acid metabolic process(GO:0042905) |
0.9 | 2.8 | GO:0006481 | C-terminal protein methylation(GO:0006481) |
0.9 | 2.8 | GO:0006172 | ADP biosynthetic process(GO:0006172) |
0.9 | 0.9 | GO:0001951 | intestinal D-glucose absorption(GO:0001951) |
0.9 | 2.8 | GO:0038171 | cannabinoid signaling pathway(GO:0038171) endocannabinoid signaling pathway(GO:0071926) |
0.9 | 2.8 | GO:0097680 | double-strand break repair via classical nonhomologous end joining(GO:0097680) |
0.9 | 2.8 | GO:0015889 | cobalamin transport(GO:0015889) |
0.9 | 1.8 | GO:0033686 | positive regulation of luteinizing hormone secretion(GO:0033686) |
0.9 | 0.9 | GO:0090370 | negative regulation of cholesterol efflux(GO:0090370) |
0.9 | 2.8 | GO:0060454 | positive regulation of gastric acid secretion(GO:0060454) |
0.9 | 1.8 | GO:0060916 | mesenchymal cell proliferation involved in lung development(GO:0060916) |
0.9 | 3.6 | GO:0019805 | quinolinate biosynthetic process(GO:0019805) |
0.9 | 0.9 | GO:0045080 | positive regulation of chemokine biosynthetic process(GO:0045080) |
0.9 | 1.8 | GO:0070350 | white fat cell proliferation(GO:0070343) regulation of white fat cell proliferation(GO:0070350) |
0.9 | 1.8 | GO:0060167 | regulation of adenosine receptor signaling pathway(GO:0060167) |
0.9 | 2.7 | GO:0071651 | positive regulation of chemokine (C-C motif) ligand 5 production(GO:0071651) |
0.9 | 1.8 | GO:0042659 | regulation of cell fate specification(GO:0042659) |
0.9 | 5.3 | GO:0016266 | O-glycan processing(GO:0016266) |
0.9 | 9.7 | GO:0046838 | phosphorylated carbohydrate dephosphorylation(GO:0046838) inositol phosphate dephosphorylation(GO:0046855) |
0.9 | 4.4 | GO:0006572 | tyrosine catabolic process(GO:0006572) |
0.9 | 3.5 | GO:0090074 | negative regulation of protein homodimerization activity(GO:0090074) |
0.9 | 5.3 | GO:0046642 | negative regulation of alpha-beta T cell proliferation(GO:0046642) |
0.9 | 1.7 | GO:0031585 | regulation of inositol 1,4,5-trisphosphate-sensitive calcium-release channel activity(GO:0031585) |
0.9 | 4.4 | GO:0044828 | negative regulation by host of viral genome replication(GO:0044828) |
0.9 | 13.9 | GO:0070498 | interleukin-1-mediated signaling pathway(GO:0070498) |
0.9 | 1.7 | GO:0032910 | transforming growth factor beta3 production(GO:0032907) regulation of transforming growth factor beta3 production(GO:0032910) |
0.9 | 3.5 | GO:0010994 | regulation of ubiquitin homeostasis(GO:0010993) free ubiquitin chain polymerization(GO:0010994) |
0.9 | 2.6 | GO:0035795 | negative regulation of mitochondrial membrane permeability(GO:0035795) |
0.9 | 3.4 | GO:2000418 | positive regulation of eosinophil migration(GO:2000418) |
0.9 | 4.3 | GO:0070236 | negative regulation of activation-induced cell death of T cells(GO:0070236) |
0.9 | 3.4 | GO:0035106 | operant conditioning(GO:0035106) |
0.9 | 1.7 | GO:1902075 | cellular response to salt(GO:1902075) |
0.9 | 9.4 | GO:0070935 | 3'-UTR-mediated mRNA stabilization(GO:0070935) |
0.9 | 2.6 | GO:0048207 | vesicle targeting, rough ER to cis-Golgi(GO:0048207) COPII vesicle coating(GO:0048208) |
0.8 | 2.5 | GO:0003062 | regulation of heart rate by chemical signal(GO:0003062) |
0.8 | 3.4 | GO:0070837 | dehydroascorbic acid transport(GO:0070837) |
0.8 | 2.5 | GO:0007023 | post-chaperonin tubulin folding pathway(GO:0007023) |
0.8 | 2.5 | GO:0006681 | galactosylceramide metabolic process(GO:0006681) |
0.8 | 4.2 | GO:1903689 | regulation of wound healing, spreading of epidermal cells(GO:1903689) |
0.8 | 1.7 | GO:0046100 | hypoxanthine metabolic process(GO:0046100) hypoxanthine biosynthetic process(GO:0046101) |
0.8 | 2.5 | GO:0035283 | central nervous system segmentation(GO:0035283) brain segmentation(GO:0035284) |
0.8 | 2.5 | GO:0060988 | lipid tube assembly(GO:0060988) |
0.8 | 0.8 | GO:0002826 | negative regulation of T-helper 1 type immune response(GO:0002826) |
0.8 | 0.8 | GO:0034374 | low-density lipoprotein particle remodeling(GO:0034374) |
0.8 | 3.3 | GO:1990414 | replication-born double-strand break repair via sister chromatid exchange(GO:1990414) |
0.8 | 2.5 | GO:0034729 | histone H3-K79 methylation(GO:0034729) |
0.8 | 3.3 | GO:0060623 | regulation of chromosome condensation(GO:0060623) |
0.8 | 1.6 | GO:0048936 | peripheral nervous system neuron axonogenesis(GO:0048936) |
0.8 | 0.8 | GO:0021553 | olfactory nerve development(GO:0021553) |
0.8 | 0.8 | GO:0019530 | taurine metabolic process(GO:0019530) |
0.8 | 1.6 | GO:0010040 | response to iron(II) ion(GO:0010040) |
0.8 | 3.3 | GO:0060126 | somatotropin secreting cell differentiation(GO:0060126) |
0.8 | 3.3 | GO:1904970 | brush border assembly(GO:1904970) |
0.8 | 2.4 | GO:1901300 | positive regulation of response to reactive oxygen species(GO:1901033) positive regulation of hydrogen peroxide-mediated programmed cell death(GO:1901300) positive regulation of hydrogen peroxide-induced cell death(GO:1905206) |
0.8 | 4.9 | GO:0099515 | actin filament-based transport(GO:0099515) |
0.8 | 0.8 | GO:2000564 | regulation of CD8-positive, alpha-beta T cell proliferation(GO:2000564) |
0.8 | 5.7 | GO:0061099 | negative regulation of protein tyrosine kinase activity(GO:0061099) |
0.8 | 4.1 | GO:0080009 | mRNA methylation(GO:0080009) |
0.8 | 4.0 | GO:0061635 | regulation of protein complex stability(GO:0061635) |
0.8 | 2.4 | GO:0000101 | sulfur amino acid transport(GO:0000101) |
0.8 | 2.4 | GO:0060315 | negative regulation of ryanodine-sensitive calcium-release channel activity(GO:0060315) |
0.8 | 2.4 | GO:0030916 | otic vesicle formation(GO:0030916) |
0.8 | 0.8 | GO:0048850 | hypophysis morphogenesis(GO:0048850) |
0.8 | 2.4 | GO:0070268 | cornification(GO:0070268) |
0.8 | 4.8 | GO:0010764 | negative regulation of fibroblast migration(GO:0010764) |
0.8 | 0.8 | GO:0072262 | metanephric glomerular mesangium development(GO:0072223) metanephric glomerular mesangial cell proliferation involved in metanephros development(GO:0072262) |
0.8 | 4.0 | GO:0030213 | hyaluronan biosynthetic process(GO:0030213) |
0.8 | 3.2 | GO:0010606 | positive regulation of cytoplasmic mRNA processing body assembly(GO:0010606) |
0.8 | 0.8 | GO:2000483 | negative regulation of interleukin-8 secretion(GO:2000483) |
0.8 | 0.8 | GO:0045658 | regulation of neutrophil differentiation(GO:0045658) |
0.8 | 7.1 | GO:0001867 | complement activation, lectin pathway(GO:0001867) |
0.8 | 2.4 | GO:0072402 | response to cell cycle checkpoint signaling(GO:0072396) response to DNA integrity checkpoint signaling(GO:0072402) response to DNA damage checkpoint signaling(GO:0072423) response to intra-S DNA damage checkpoint signaling(GO:0072429) |
0.8 | 3.2 | GO:2000002 | negative regulation of DNA damage checkpoint(GO:2000002) |
0.8 | 6.3 | GO:0032594 | protein transport within lipid bilayer(GO:0032594) |
0.8 | 1.6 | GO:0038093 | Fc receptor signaling pathway(GO:0038093) |
0.8 | 5.5 | GO:0009404 | toxin metabolic process(GO:0009404) |
0.8 | 1.6 | GO:0042117 | monocyte activation(GO:0042117) |
0.8 | 2.3 | GO:0051549 | regulation of keratinocyte migration(GO:0051547) positive regulation of keratinocyte migration(GO:0051549) |
0.8 | 7.0 | GO:0030212 | hyaluronan metabolic process(GO:0030212) |
0.8 | 2.3 | GO:0010760 | negative regulation of macrophage chemotaxis(GO:0010760) |
0.8 | 1.6 | GO:0051581 | negative regulation of neurotransmitter uptake(GO:0051581) regulation of serotonin uptake(GO:0051611) negative regulation of serotonin uptake(GO:0051612) |
0.8 | 3.1 | GO:0045039 | protein import into mitochondrial inner membrane(GO:0045039) |
0.8 | 2.3 | GO:0032430 | positive regulation of phospholipase A2 activity(GO:0032430) |
0.8 | 2.3 | GO:0097477 | lateral motor column neuron migration(GO:0097477) |
0.8 | 1.5 | GO:0030210 | heparin biosynthetic process(GO:0030210) |
0.8 | 0.8 | GO:0009071 | serine family amino acid catabolic process(GO:0009071) |
0.8 | 2.3 | GO:1903336 | negative regulation of vacuolar transport(GO:1903336) |
0.8 | 11.4 | GO:0008299 | isoprenoid biosynthetic process(GO:0008299) |
0.8 | 2.3 | GO:0007525 | somatic muscle development(GO:0007525) |
0.8 | 9.8 | GO:0030277 | maintenance of gastrointestinal epithelium(GO:0030277) |
0.8 | 0.8 | GO:2001170 | negative regulation of ATP biosynthetic process(GO:2001170) |
0.7 | 2.2 | GO:2000327 | regulation of ligand-dependent nuclear receptor transcription coactivator activity(GO:2000325) positive regulation of ligand-dependent nuclear receptor transcription coactivator activity(GO:2000327) |
0.7 | 2.2 | GO:0043152 | induction of bacterial agglutination(GO:0043152) |
0.7 | 1.5 | GO:0060139 | induction of programmed cell death(GO:0012502) positive regulation of apoptotic process in other organism(GO:0044533) positive regulation by symbiont of host programmed cell death(GO:0052042) positive regulation by symbiont of host apoptotic process(GO:0052151) positive regulation by organism of programmed cell death in other organism involved in symbiotic interaction(GO:0052330) positive regulation by organism of apoptotic process in other organism involved in symbiotic interaction(GO:0052501) positive regulation of apoptotic process by virus(GO:0060139) |
0.7 | 3.0 | GO:0045348 | positive regulation of MHC class II biosynthetic process(GO:0045348) |
0.7 | 1.5 | GO:0032058 | positive regulation of translational initiation in response to stress(GO:0032058) |
0.7 | 3.0 | GO:0060264 | regulation of respiratory burst involved in inflammatory response(GO:0060264) |
0.7 | 2.2 | GO:0090283 | regulation of protein glycosylation in Golgi(GO:0090283) |
0.7 | 1.5 | GO:0030223 | neutrophil differentiation(GO:0030223) |
0.7 | 2.9 | GO:2000301 | negative regulation of synaptic vesicle exocytosis(GO:2000301) |
0.7 | 1.5 | GO:0036216 | response to stem cell factor(GO:0036215) cellular response to stem cell factor stimulus(GO:0036216) Kit signaling pathway(GO:0038109) |
0.7 | 2.9 | GO:0048633 | positive regulation of skeletal muscle tissue growth(GO:0048633) |
0.7 | 2.2 | GO:0060164 | regulation of timing of neuron differentiation(GO:0060164) |
0.7 | 5.1 | GO:0071285 | cellular response to lithium ion(GO:0071285) |
0.7 | 2.9 | GO:0000707 | meiotic DNA recombinase assembly(GO:0000707) |
0.7 | 6.6 | GO:0042574 | retinal metabolic process(GO:0042574) |
0.7 | 0.7 | GO:1903301 | positive regulation of hexokinase activity(GO:1903301) |
0.7 | 2.2 | GO:0060745 | mammary gland branching involved in pregnancy(GO:0060745) |
0.7 | 1.5 | GO:0048793 | limb joint morphogenesis(GO:0036022) embryonic skeletal limb joint morphogenesis(GO:0036023) pronephros development(GO:0048793) |
0.7 | 2.2 | GO:0046104 | thymidine metabolic process(GO:0046104) |
0.7 | 2.2 | GO:0046600 | negative regulation of centriole replication(GO:0046600) |
0.7 | 4.4 | GO:0000972 | transcription-dependent tethering of RNA polymerase II gene DNA at nuclear periphery(GO:0000972) |
0.7 | 2.9 | GO:0006116 | NADH oxidation(GO:0006116) |
0.7 | 3.6 | GO:0016255 | attachment of GPI anchor to protein(GO:0016255) |
0.7 | 4.3 | GO:0006703 | estrogen biosynthetic process(GO:0006703) |
0.7 | 0.7 | GO:1902947 | regulation of tau-protein kinase activity(GO:1902947) neurofibrillary tangle assembly(GO:1902988) regulation of neurofibrillary tangle assembly(GO:1902996) |
0.7 | 1.4 | GO:0007529 | establishment of synaptic specificity at neuromuscular junction(GO:0007529) |
0.7 | 3.6 | GO:0047484 | regulation of response to osmotic stress(GO:0047484) |
0.7 | 3.6 | GO:0060394 | negative regulation of pathway-restricted SMAD protein phosphorylation(GO:0060394) |
0.7 | 4.3 | GO:0001866 | NK T cell proliferation(GO:0001866) |
0.7 | 4.3 | GO:0060708 | spongiotrophoblast differentiation(GO:0060708) |
0.7 | 2.9 | GO:0031033 | myosin filament organization(GO:0031033) |
0.7 | 0.7 | GO:0072367 | regulation of lipid transport by regulation of transcription from RNA polymerase II promoter(GO:0072367) |
0.7 | 6.4 | GO:0006855 | drug transmembrane transport(GO:0006855) |
0.7 | 2.1 | GO:0061366 | behavioral response to chemical pain(GO:0061366) behavioral response to formalin induced pain(GO:0061368) |
0.7 | 4.9 | GO:0051451 | myoblast migration(GO:0051451) |
0.7 | 2.1 | GO:0007084 | mitotic nuclear envelope reassembly(GO:0007084) |
0.7 | 2.8 | GO:1903894 | regulation of IRE1-mediated unfolded protein response(GO:1903894) |
0.7 | 5.6 | GO:0000338 | protein deneddylation(GO:0000338) cullin deneddylation(GO:0010388) |
0.7 | 0.7 | GO:0060316 | positive regulation of ryanodine-sensitive calcium-release channel activity(GO:0060316) |
0.7 | 0.7 | GO:0060447 | bud outgrowth involved in lung branching(GO:0060447) |
0.7 | 2.8 | GO:0070601 | centromeric sister chromatid cohesion(GO:0070601) |
0.7 | 2.1 | GO:0045896 | regulation of transcription during mitosis(GO:0045896) positive regulation of transcription during mitosis(GO:0045897) |
0.7 | 2.1 | GO:0002159 | desmosome assembly(GO:0002159) |
0.7 | 4.9 | GO:0016338 | calcium-independent cell-cell adhesion via plasma membrane cell-adhesion molecules(GO:0016338) |
0.7 | 1.4 | GO:1901859 | negative regulation of mitochondrial DNA metabolic process(GO:1901859) |
0.7 | 1.4 | GO:0010912 | regulation of isomerase activity(GO:0010911) positive regulation of isomerase activity(GO:0010912) |
0.7 | 2.1 | GO:1901856 | negative regulation of cellular respiration(GO:1901856) |
0.7 | 4.1 | GO:0060903 | positive regulation of meiosis I(GO:0060903) |
0.7 | 8.2 | GO:0046685 | response to arsenic-containing substance(GO:0046685) |
0.7 | 2.1 | GO:0042780 | tRNA 3'-end processing(GO:0042780) |
0.7 | 2.1 | GO:0051790 | short-chain fatty acid biosynthetic process(GO:0051790) |
0.7 | 2.1 | GO:0002071 | glandular epithelial cell maturation(GO:0002071) |
0.7 | 2.7 | GO:0010694 | positive regulation of alkaline phosphatase activity(GO:0010694) |
0.7 | 3.4 | GO:0030174 | regulation of DNA-dependent DNA replication initiation(GO:0030174) |
0.7 | 2.7 | GO:0019852 | L-ascorbic acid metabolic process(GO:0019852) |
0.7 | 1.4 | GO:0006741 | NADP biosynthetic process(GO:0006741) |
0.7 | 4.1 | GO:1900262 | regulation of DNA-directed DNA polymerase activity(GO:1900262) positive regulation of DNA-directed DNA polymerase activity(GO:1900264) |
0.7 | 2.0 | GO:0006391 | transcription initiation from mitochondrial promoter(GO:0006391) |
0.7 | 2.0 | GO:2001181 | positive regulation of interleukin-10 secretion(GO:2001181) |
0.7 | 2.0 | GO:0039689 | negative stranded viral RNA replication(GO:0039689) multi-organism biosynthetic process(GO:0044034) |
0.7 | 2.0 | GO:0006651 | diacylglycerol biosynthetic process(GO:0006651) |
0.7 | 2.7 | GO:0048014 | Tie signaling pathway(GO:0048014) |
0.7 | 10.0 | GO:0000737 | DNA catabolic process, endonucleolytic(GO:0000737) |
0.7 | 0.7 | GO:0033088 | negative regulation of immature T cell proliferation in thymus(GO:0033088) |
0.7 | 7.9 | GO:0060009 | Sertoli cell development(GO:0060009) |
0.7 | 2.0 | GO:0035054 | embryonic heart tube anterior/posterior pattern specification(GO:0035054) |
0.7 | 0.7 | GO:0002227 | innate immune response in mucosa(GO:0002227) |
0.7 | 2.6 | GO:1901679 | nucleotide transmembrane transport(GO:1901679) |
0.7 | 3.3 | GO:0018230 | peptidyl-L-cysteine S-palmitoylation(GO:0018230) peptidyl-S-diacylglycerol-L-cysteine biosynthetic process from peptidyl-cysteine(GO:0018231) |
0.7 | 1.3 | GO:0046208 | spermine catabolic process(GO:0046208) |
0.7 | 2.6 | GO:1900194 | negative regulation of oocyte maturation(GO:1900194) |
0.7 | 2.0 | GO:0015744 | succinate transport(GO:0015744) |
0.7 | 5.9 | GO:0006183 | GTP biosynthetic process(GO:0006183) |
0.6 | 0.6 | GO:0090324 | negative regulation of oxidative phosphorylation(GO:0090324) |
0.6 | 1.9 | GO:0042732 | D-xylose metabolic process(GO:0042732) |
0.6 | 5.1 | GO:0006013 | mannose metabolic process(GO:0006013) |
0.6 | 0.6 | GO:0070368 | positive regulation of hepatocyte differentiation(GO:0070368) |
0.6 | 17.2 | GO:0006958 | complement activation, classical pathway(GO:0006958) |
0.6 | 12.1 | GO:0000413 | protein peptidyl-prolyl isomerization(GO:0000413) |
0.6 | 3.8 | GO:0006777 | Mo-molybdopterin cofactor biosynthetic process(GO:0006777) Mo-molybdopterin cofactor metabolic process(GO:0019720) molybdopterin cofactor biosynthetic process(GO:0032324) molybdopterin cofactor metabolic process(GO:0043545) prosthetic group metabolic process(GO:0051189) |
0.6 | 4.5 | GO:0010561 | negative regulation of glycoprotein biosynthetic process(GO:0010561) |
0.6 | 5.7 | GO:1901663 | quinone biosynthetic process(GO:1901663) |
0.6 | 3.8 | GO:0045654 | positive regulation of megakaryocyte differentiation(GO:0045654) |
0.6 | 1.3 | GO:0030538 | embryonic genitalia morphogenesis(GO:0030538) |
0.6 | 16.4 | GO:0006730 | one-carbon metabolic process(GO:0006730) |
0.6 | 1.3 | GO:0006068 | ethanol catabolic process(GO:0006068) |
0.6 | 3.7 | GO:0045586 | regulation of gamma-delta T cell differentiation(GO:0045586) regulation of gamma-delta T cell activation(GO:0046643) |
0.6 | 3.1 | GO:0016576 | histone dephosphorylation(GO:0016576) |
0.6 | 0.6 | GO:0070827 | chromatin maintenance(GO:0070827) |
0.6 | 1.2 | GO:0071895 | odontoblast differentiation(GO:0071895) |
0.6 | 2.5 | GO:0031581 | hemidesmosome assembly(GO:0031581) |
0.6 | 0.6 | GO:0046874 | quinolinate metabolic process(GO:0046874) |
0.6 | 0.6 | GO:0046340 | diacylglycerol catabolic process(GO:0046340) |
0.6 | 1.8 | GO:0002291 | T cell activation via T cell receptor contact with antigen bound to MHC molecule on antigen presenting cell(GO:0002291) |
0.6 | 3.1 | GO:0048387 | negative regulation of retinoic acid receptor signaling pathway(GO:0048387) |
0.6 | 1.8 | GO:0002331 | pre-B cell allelic exclusion(GO:0002331) |
0.6 | 10.3 | GO:0046597 | negative regulation of viral entry into host cell(GO:0046597) |
0.6 | 1.8 | GO:0042663 | regulation of endodermal cell fate specification(GO:0042663) |
0.6 | 3.6 | GO:0090080 | positive regulation of MAPKKK cascade by fibroblast growth factor receptor signaling pathway(GO:0090080) |
0.6 | 1.8 | GO:0021776 | smoothened signaling pathway involved in ventral spinal cord interneuron specification(GO:0021775) smoothened signaling pathway involved in spinal cord motor neuron cell fate specification(GO:0021776) |
0.6 | 1.2 | GO:0018242 | protein O-linked glycosylation via serine(GO:0018242) |
0.6 | 4.2 | GO:0097264 | self proteolysis(GO:0097264) |
0.6 | 1.2 | GO:2000609 | regulation of thyroid hormone generation(GO:2000609) |
0.6 | 0.6 | GO:0046490 | isopentenyl diphosphate metabolic process(GO:0046490) |
0.6 | 1.2 | GO:2001225 | regulation of chloride transport(GO:2001225) |
0.6 | 3.6 | GO:0035970 | peptidyl-threonine dephosphorylation(GO:0035970) |
0.6 | 3.6 | GO:0006102 | isocitrate metabolic process(GO:0006102) |
0.6 | 8.4 | GO:0006144 | purine nucleobase metabolic process(GO:0006144) |
0.6 | 1.8 | GO:0006269 | DNA replication, synthesis of RNA primer(GO:0006269) |
0.6 | 1.2 | GO:0035928 | rRNA import into mitochondrion(GO:0035928) |
0.6 | 1.2 | GO:0030423 | targeting of mRNA for destruction involved in RNA interference(GO:0030423) |
0.6 | 8.3 | GO:0031442 | positive regulation of mRNA 3'-end processing(GO:0031442) |
0.6 | 0.6 | GO:0044314 | protein K27-linked ubiquitination(GO:0044314) |
0.6 | 1.2 | GO:0009946 | proximal/distal axis specification(GO:0009946) |
0.6 | 4.1 | GO:0019368 | fatty acid elongation, saturated fatty acid(GO:0019367) fatty acid elongation, unsaturated fatty acid(GO:0019368) fatty acid elongation, monounsaturated fatty acid(GO:0034625) fatty acid elongation, polyunsaturated fatty acid(GO:0034626) |
0.6 | 2.3 | GO:0070213 | protein auto-ADP-ribosylation(GO:0070213) |
0.6 | 7.0 | GO:0046852 | positive regulation of bone resorption(GO:0045780) positive regulation of bone remodeling(GO:0046852) |
0.6 | 4.1 | GO:0042447 | hormone catabolic process(GO:0042447) |
0.6 | 1.2 | GO:2001286 | regulation of caveolin-mediated endocytosis(GO:2001286) |
0.6 | 5.8 | GO:0090503 | RNA phosphodiester bond hydrolysis, exonucleolytic(GO:0090503) |
0.6 | 4.7 | GO:0006012 | galactose metabolic process(GO:0006012) |
0.6 | 2.9 | GO:0006348 | chromatin silencing at telomere(GO:0006348) |
0.6 | 0.6 | GO:0061343 | cell adhesion involved in heart morphogenesis(GO:0061343) |
0.6 | 1.7 | GO:1902566 | regulation of eosinophil degranulation(GO:0043309) regulation of eosinophil activation(GO:1902566) |
0.6 | 5.2 | GO:2001241 | positive regulation of extrinsic apoptotic signaling pathway in absence of ligand(GO:2001241) |
0.6 | 1.7 | GO:0048023 | positive regulation of melanin biosynthetic process(GO:0048023) positive regulation of secondary metabolite biosynthetic process(GO:1900378) |
0.6 | 6.3 | GO:0007028 | cytoplasm organization(GO:0007028) |
0.6 | 1.2 | GO:0051204 | protein insertion into mitochondrial membrane(GO:0051204) |
0.6 | 0.6 | GO:0034436 | glycoprotein transport(GO:0034436) |
0.6 | 6.3 | GO:0002031 | G-protein coupled receptor internalization(GO:0002031) |
0.6 | 2.3 | GO:0010510 | regulation of acetyl-CoA biosynthetic process from pyruvate(GO:0010510) regulation of acyl-CoA biosynthetic process(GO:0050812) |
0.6 | 1.7 | GO:0010891 | negative regulation of sequestering of triglyceride(GO:0010891) |
0.6 | 0.6 | GO:1904706 | negative regulation of vascular smooth muscle cell proliferation(GO:1904706) |
0.6 | 2.8 | GO:0006451 | selenocysteine incorporation(GO:0001514) translational readthrough(GO:0006451) |
0.6 | 1.1 | GO:0016264 | gap junction assembly(GO:0016264) |
0.6 | 2.8 | GO:0006656 | phosphatidylcholine biosynthetic process(GO:0006656) |
0.6 | 12.3 | GO:0014823 | response to activity(GO:0014823) |
0.6 | 0.6 | GO:0060556 | vitamin D biosynthetic process(GO:0042368) regulation of vitamin D biosynthetic process(GO:0060556) |
0.6 | 1.7 | GO:0031087 | nuclear-transcribed mRNA catabolic process, deadenylation-independent decay(GO:0031086) deadenylation-independent decapping of nuclear-transcribed mRNA(GO:0031087) |
0.6 | 1.1 | GO:0043321 | regulation of natural killer cell degranulation(GO:0043321) |
0.6 | 1.1 | GO:0043928 | exonucleolytic nuclear-transcribed mRNA catabolic process involved in deadenylation-dependent decay(GO:0043928) |
0.6 | 1.1 | GO:0035262 | gonad morphogenesis(GO:0035262) |
0.6 | 0.6 | GO:0042161 | regulation of lipoprotein oxidation(GO:0034442) negative regulation of lipoprotein oxidation(GO:0034443) lipoprotein modification(GO:0042160) lipoprotein oxidation(GO:0042161) |
0.5 | 2.2 | GO:0006549 | isoleucine metabolic process(GO:0006549) |
0.5 | 0.5 | GO:0032790 | ribosome disassembly(GO:0032790) |
0.5 | 4.3 | GO:0060055 | angiogenesis involved in wound healing(GO:0060055) |
0.5 | 2.2 | GO:0009642 | response to light intensity(GO:0009642) |
0.5 | 1.6 | GO:0043490 | malate-aspartate shuttle(GO:0043490) |
0.5 | 0.5 | GO:0010603 | regulation of cytoplasmic mRNA processing body assembly(GO:0010603) |
0.5 | 1.1 | GO:0001920 | negative regulation of receptor recycling(GO:0001920) |
0.5 | 0.5 | GO:1904431 | positive regulation of t-circle formation(GO:1904431) |
0.5 | 1.6 | GO:1900103 | positive regulation of endoplasmic reticulum unfolded protein response(GO:1900103) |
0.5 | 2.1 | GO:1902474 | positive regulation of protein localization to synapse(GO:1902474) |
0.5 | 0.5 | GO:2000173 | negative regulation of branching morphogenesis of a nerve(GO:2000173) |
0.5 | 1.0 | GO:0015808 | L-alanine transport(GO:0015808) |
0.5 | 1.0 | GO:0060510 | Type II pneumocyte differentiation(GO:0060510) |
0.5 | 1.6 | GO:0090038 | negative regulation of protein kinase C signaling(GO:0090038) |
0.5 | 8.3 | GO:0060445 | branching involved in salivary gland morphogenesis(GO:0060445) |
0.5 | 1.6 | GO:1902775 | mitochondrial large ribosomal subunit assembly(GO:1902775) |
0.5 | 1.6 | GO:0046341 | CDP-diacylglycerol metabolic process(GO:0046341) |
0.5 | 1.5 | GO:0060050 | positive regulation of protein glycosylation(GO:0060050) |
0.5 | 1.5 | GO:0044704 | mating plug formation(GO:0042628) single-organism reproductive behavior(GO:0044704) post-mating behavior(GO:0045297) |
0.5 | 5.2 | GO:0000463 | maturation of LSU-rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000463) |
0.5 | 1.0 | GO:0042364 | water-soluble vitamin biosynthetic process(GO:0042364) |
0.5 | 0.5 | GO:0006701 | progesterone biosynthetic process(GO:0006701) |
0.5 | 1.5 | GO:0097105 | presynaptic membrane assembly(GO:0097105) |
0.5 | 1.0 | GO:0045629 | negative regulation of T-helper 2 cell differentiation(GO:0045629) |
0.5 | 1.5 | GO:0009106 | lipoate metabolic process(GO:0009106) |
0.5 | 4.6 | GO:0032957 | inositol trisphosphate metabolic process(GO:0032957) |
0.5 | 2.0 | GO:0040015 | negative regulation of multicellular organism growth(GO:0040015) |
0.5 | 1.0 | GO:0006059 | hexitol metabolic process(GO:0006059) |
0.5 | 1.0 | GO:0007597 | blood coagulation, intrinsic pathway(GO:0007597) |
0.5 | 3.0 | GO:0006384 | transcription initiation from RNA polymerase III promoter(GO:0006384) |
0.5 | 1.5 | GO:0003431 | growth plate cartilage chondrocyte development(GO:0003431) |
0.5 | 5.6 | GO:0015727 | lactate transport(GO:0015727) lactate transmembrane transport(GO:0035873) plasma membrane lactate transport(GO:0035879) |
0.5 | 1.5 | GO:1900425 | negative regulation of defense response to bacterium(GO:1900425) |
0.5 | 3.0 | GO:0006283 | transcription-coupled nucleotide-excision repair(GO:0006283) |
0.5 | 0.5 | GO:0035630 | bone mineralization involved in bone maturation(GO:0035630) |
0.5 | 0.5 | GO:0006598 | polyamine catabolic process(GO:0006598) |
0.5 | 1.5 | GO:0090069 | regulation of ribosome biogenesis(GO:0090069) |
0.5 | 3.5 | GO:0048096 | chromatin-mediated maintenance of transcription(GO:0048096) |
0.5 | 3.0 | GO:0008090 | retrograde axonal transport(GO:0008090) |
0.5 | 4.5 | GO:0048280 | vesicle fusion with Golgi apparatus(GO:0048280) |
0.5 | 1.0 | GO:0006848 | pyruvate transport(GO:0006848) |
0.5 | 1.5 | GO:0033634 | positive regulation of cell-cell adhesion mediated by integrin(GO:0033634) |
0.5 | 2.5 | GO:0032460 | negative regulation of protein oligomerization(GO:0032460) |
0.5 | 0.5 | GO:0046337 | phosphatidylethanolamine metabolic process(GO:0046337) |
0.5 | 0.5 | GO:0034241 | positive regulation of macrophage fusion(GO:0034241) |
0.5 | 2.0 | GO:0032785 | negative regulation of DNA-templated transcription, elongation(GO:0032785) negative regulation of transcription elongation from RNA polymerase II promoter(GO:0034244) |
0.5 | 2.0 | GO:0009181 | purine nucleoside diphosphate catabolic process(GO:0009137) purine ribonucleoside diphosphate catabolic process(GO:0009181) |
0.5 | 5.4 | GO:0006084 | acetyl-CoA metabolic process(GO:0006084) |
0.5 | 4.9 | GO:0006032 | chitin metabolic process(GO:0006030) chitin catabolic process(GO:0006032) |
0.5 | 1.0 | GO:0097343 | ripoptosome assembly(GO:0097343) ripoptosome assembly involved in necroptotic process(GO:1901026) |
0.5 | 1.9 | GO:0006369 | termination of RNA polymerase II transcription(GO:0006369) |
0.5 | 1.4 | GO:0098532 | histone H3-K27 trimethylation(GO:0098532) |
0.5 | 1.0 | GO:0060075 | regulation of resting membrane potential(GO:0060075) |
0.5 | 1.0 | GO:0042373 | vitamin K metabolic process(GO:0042373) |
0.5 | 10.1 | GO:0009812 | flavonoid metabolic process(GO:0009812) |
0.5 | 1.4 | GO:0018094 | protein polyglycylation(GO:0018094) |
0.5 | 1.0 | GO:0097360 | chorionic trophoblast cell proliferation(GO:0097360) regulation of chorionic trophoblast cell proliferation(GO:1901382) |
0.5 | 0.5 | GO:0009110 | vitamin biosynthetic process(GO:0009110) |
0.5 | 1.9 | GO:0042402 | amine catabolic process(GO:0009310) cellular biogenic amine catabolic process(GO:0042402) |
0.5 | 1.4 | GO:0010792 | DNA double-strand break processing involved in repair via single-strand annealing(GO:0010792) |
0.5 | 3.8 | GO:0061000 | negative regulation of dendritic spine development(GO:0061000) |
0.5 | 6.2 | GO:2000251 | positive regulation of actin cytoskeleton reorganization(GO:2000251) |
0.5 | 4.3 | GO:0030033 | microvillus assembly(GO:0030033) |
0.5 | 6.2 | GO:1904376 | negative regulation of protein localization to plasma membrane(GO:1903077) negative regulation of protein localization to cell periphery(GO:1904376) |
0.5 | 1.4 | GO:0097067 | cellular response to thyroid hormone stimulus(GO:0097067) |
0.5 | 0.5 | GO:0006982 | response to lipid hydroperoxide(GO:0006982) |
0.5 | 0.5 | GO:1903659 | regulation of complement-dependent cytotoxicity(GO:1903659) negative regulation of complement-dependent cytotoxicity(GO:1903660) |
0.5 | 0.9 | GO:1904714 | regulation of chaperone-mediated autophagy(GO:1904714) |
0.5 | 5.2 | GO:0007095 | mitotic G2 DNA damage checkpoint(GO:0007095) |
0.5 | 0.9 | GO:0044336 | canonical Wnt signaling pathway involved in negative regulation of apoptotic process(GO:0044336) |
0.5 | 7.0 | GO:0043981 | histone H4-K5 acetylation(GO:0043981) histone H4-K8 acetylation(GO:0043982) |
0.5 | 1.4 | GO:0031145 | anaphase-promoting complex-dependent catabolic process(GO:0031145) |
0.5 | 0.5 | GO:0003223 | ventricular compact myocardium morphogenesis(GO:0003223) |
0.5 | 1.4 | GO:0018101 | protein citrullination(GO:0018101) |
0.5 | 3.3 | GO:0061179 | negative regulation of insulin secretion involved in cellular response to glucose stimulus(GO:0061179) |
0.5 | 4.2 | GO:0000188 | inactivation of MAPK activity(GO:0000188) |
0.5 | 0.5 | GO:0071545 | inositol phosphate catabolic process(GO:0071545) |
0.5 | 2.3 | GO:1904668 | positive regulation of ubiquitin protein ligase activity(GO:1904668) |
0.5 | 0.9 | GO:0002326 | B cell lineage commitment(GO:0002326) |
0.5 | 0.9 | GO:1905216 | positive regulation of mRNA binding(GO:1902416) positive regulation of RNA binding(GO:1905216) |
0.5 | 3.2 | GO:0051205 | protein insertion into membrane(GO:0051205) |
0.5 | 6.0 | GO:0032438 | melanosome organization(GO:0032438) |
0.5 | 2.8 | GO:0070572 | positive regulation of axon regeneration(GO:0048680) positive regulation of neuron projection regeneration(GO:0070572) |
0.5 | 1.8 | GO:0071404 | cellular response to low-density lipoprotein particle stimulus(GO:0071404) |
0.5 | 0.9 | GO:0006166 | purine ribonucleoside salvage(GO:0006166) |
0.5 | 0.5 | GO:0071351 | cellular response to interleukin-18(GO:0071351) |
0.5 | 0.9 | GO:1900186 | negative regulation of clathrin-mediated endocytosis(GO:1900186) |
0.5 | 1.4 | GO:2000467 | positive regulation of glycogen (starch) synthase activity(GO:2000467) |
0.5 | 0.5 | GO:0021937 | cerebellar Purkinje cell-granule cell precursor cell signaling involved in regulation of granule cell precursor cell proliferation(GO:0021937) |
0.5 | 3.2 | GO:0006103 | 2-oxoglutarate metabolic process(GO:0006103) |
0.5 | 0.5 | GO:0015819 | lysine transport(GO:0015819) |
0.4 | 1.8 | GO:0043101 | purine-containing compound salvage(GO:0043101) |
0.4 | 0.9 | GO:0070836 | caveola assembly(GO:0070836) |
0.4 | 1.3 | GO:0042376 | phylloquinone metabolic process(GO:0042374) phylloquinone catabolic process(GO:0042376) quinone catabolic process(GO:1901662) |
0.4 | 0.4 | GO:0098902 | regulation of membrane depolarization during action potential(GO:0098902) |
0.4 | 0.4 | GO:0002072 | optic cup morphogenesis involved in camera-type eye development(GO:0002072) |
0.4 | 0.4 | GO:0033625 | positive regulation of integrin activation(GO:0033625) |
0.4 | 1.3 | GO:0006048 | UDP-N-acetylglucosamine biosynthetic process(GO:0006048) |
0.4 | 0.4 | GO:2000504 | positive regulation of blood vessel remodeling(GO:2000504) |
0.4 | 1.8 | GO:0000414 | regulation of histone H3-K36 methylation(GO:0000414) |
0.4 | 1.3 | GO:0006768 | biotin metabolic process(GO:0006768) |
0.4 | 0.4 | GO:0060267 | positive regulation of respiratory burst(GO:0060267) |
0.4 | 2.2 | GO:0009312 | oligosaccharide biosynthetic process(GO:0009312) |
0.4 | 0.9 | GO:0032696 | negative regulation of interleukin-13 production(GO:0032696) |
0.4 | 0.4 | GO:0090309 | positive regulation of methylation-dependent chromatin silencing(GO:0090309) |
0.4 | 0.4 | GO:0060318 | definitive erythrocyte differentiation(GO:0060318) |
0.4 | 2.6 | GO:0046037 | GMP metabolic process(GO:0046037) |
0.4 | 2.6 | GO:0008300 | isoprenoid catabolic process(GO:0008300) |
0.4 | 11.3 | GO:0003333 | amino acid transmembrane transport(GO:0003333) |
0.4 | 1.3 | GO:0030576 | Cajal body organization(GO:0030576) |
0.4 | 1.3 | GO:0072675 | osteoclast fusion(GO:0072675) |
0.4 | 1.3 | GO:0018916 | nitrobenzene metabolic process(GO:0018916) |
0.4 | 1.3 | GO:0035523 | protein K29-linked deubiquitination(GO:0035523) protein K33-linked deubiquitination(GO:1990168) |
0.4 | 2.1 | GO:0060087 | relaxation of vascular smooth muscle(GO:0060087) |
0.4 | 4.7 | GO:0032801 | receptor catabolic process(GO:0032801) |
0.4 | 2.6 | GO:0051639 | actin filament network formation(GO:0051639) |
0.4 | 1.3 | GO:0045003 | DNA recombinase assembly(GO:0000730) double-strand break repair via synthesis-dependent strand annealing(GO:0045003) |
0.4 | 3.8 | GO:0097034 | mitochondrial respiratory chain complex IV assembly(GO:0033617) mitochondrial respiratory chain complex IV biogenesis(GO:0097034) |
0.4 | 0.8 | GO:0061073 | ciliary body morphogenesis(GO:0061073) |
0.4 | 2.5 | GO:0035814 | negative regulation of renal sodium excretion(GO:0035814) |
0.4 | 0.8 | GO:0035092 | sperm chromatin condensation(GO:0035092) |
0.4 | 1.3 | GO:0051409 | response to nitrosative stress(GO:0051409) |
0.4 | 5.5 | GO:0015807 | L-amino acid transport(GO:0015807) |
0.4 | 1.7 | GO:1900153 | regulation of nuclear-transcribed mRNA catabolic process, deadenylation-dependent decay(GO:1900151) positive regulation of nuclear-transcribed mRNA catabolic process, deadenylation-dependent decay(GO:1900153) |
0.4 | 6.3 | GO:0051569 | regulation of histone H3-K4 methylation(GO:0051569) |
0.4 | 0.8 | GO:1901674 | histone H3-K27 acetylation(GO:0043974) regulation of histone H3-K27 acetylation(GO:1901674) |
0.4 | 1.7 | GO:0032099 | negative regulation of appetite(GO:0032099) |
0.4 | 0.8 | GO:1903376 | neuron intrinsic apoptotic signaling pathway in response to oxidative stress(GO:0036480) regulation of oxidative stress-induced neuron intrinsic apoptotic signaling pathway(GO:1903376) |
0.4 | 0.8 | GO:0035358 | regulation of peroxisome proliferator activated receptor signaling pathway(GO:0035358) |
0.4 | 0.8 | GO:0006578 | amino-acid betaine biosynthetic process(GO:0006578) |
0.4 | 0.8 | GO:0090209 | negative regulation of triglyceride metabolic process(GO:0090209) |
0.4 | 2.1 | GO:0006488 | dolichol-linked oligosaccharide biosynthetic process(GO:0006488) |
0.4 | 1.3 | GO:1904380 | endoplasmic reticulum mannose trimming(GO:1904380) |
0.4 | 1.3 | GO:0009173 | UMP biosynthetic process(GO:0006222) pyrimidine ribonucleoside monophosphate metabolic process(GO:0009173) pyrimidine ribonucleoside monophosphate biosynthetic process(GO:0009174) UMP metabolic process(GO:0046049) |
0.4 | 0.8 | GO:1904059 | regulation of locomotor rhythm(GO:1904059) |
0.4 | 2.1 | GO:0045063 | T-helper 1 cell differentiation(GO:0045063) |
0.4 | 9.2 | GO:0030574 | collagen catabolic process(GO:0030574) |
0.4 | 1.3 | GO:0010587 | miRNA catabolic process(GO:0010587) |
0.4 | 4.6 | GO:0070200 | establishment of protein localization to telomere(GO:0070200) |
0.4 | 0.8 | GO:0071071 | regulation of phospholipid biosynthetic process(GO:0071071) |
0.4 | 1.2 | GO:0010727 | negative regulation of hydrogen peroxide metabolic process(GO:0010727) |
0.4 | 22.7 | GO:0019369 | arachidonic acid metabolic process(GO:0019369) |
0.4 | 2.1 | GO:0043353 | enucleate erythrocyte differentiation(GO:0043353) |
0.4 | 0.4 | GO:0019676 | ammonia assimilation cycle(GO:0019676) |
0.4 | 3.7 | GO:0046835 | carbohydrate phosphorylation(GO:0046835) |
0.4 | 1.2 | GO:0000379 | tRNA-type intron splice site recognition and cleavage(GO:0000379) |
0.4 | 0.8 | GO:1903237 | negative regulation of leukocyte tethering or rolling(GO:1903237) |
0.4 | 0.4 | GO:0061668 | mitochondrial ribosome assembly(GO:0061668) |
0.4 | 1.2 | GO:0033600 | negative regulation of mammary gland epithelial cell proliferation(GO:0033600) |
0.4 | 2.0 | GO:0050917 | sensory perception of umami taste(GO:0050917) |
0.4 | 2.4 | GO:0045540 | regulation of cholesterol biosynthetic process(GO:0045540) |
0.4 | 2.4 | GO:0071985 | multivesicular body sorting pathway(GO:0071985) |
0.4 | 1.6 | GO:0042136 | neurotransmitter biosynthetic process(GO:0042136) |
0.4 | 2.0 | GO:0046040 | IMP metabolic process(GO:0046040) |
0.4 | 1.2 | GO:0051546 | keratinocyte migration(GO:0051546) |
0.4 | 0.8 | GO:0050847 | progesterone receptor signaling pathway(GO:0050847) |
0.4 | 1.2 | GO:0045359 | positive regulation of interferon-beta biosynthetic process(GO:0045359) |
0.4 | 0.8 | GO:0045064 | T-helper 2 cell differentiation(GO:0045064) |
0.4 | 6.7 | GO:0070979 | protein K11-linked ubiquitination(GO:0070979) |
0.4 | 7.4 | GO:0034198 | cellular response to amino acid starvation(GO:0034198) |
0.4 | 1.2 | GO:0072015 | glomerular visceral epithelial cell development(GO:0072015) glomerular epithelial cell development(GO:0072310) |
0.4 | 0.4 | GO:0021558 | trochlear nerve development(GO:0021558) |
0.4 | 1.2 | GO:0015781 | nucleotide-sugar transport(GO:0015780) pyrimidine nucleotide-sugar transport(GO:0015781) |
0.4 | 2.7 | GO:0051014 | actin filament severing(GO:0051014) |
0.4 | 0.8 | GO:1903147 | negative regulation of mitophagy(GO:1903147) |
0.4 | 3.8 | GO:0009083 | branched-chain amino acid catabolic process(GO:0009083) |
0.4 | 0.8 | GO:0090272 | negative regulation of fibroblast growth factor production(GO:0090272) |
0.4 | 0.8 | GO:0035357 | peroxisome proliferator activated receptor signaling pathway(GO:0035357) |
0.4 | 0.4 | GO:0060024 | rhythmic synaptic transmission(GO:0060024) |
0.4 | 0.8 | GO:0014012 | peripheral nervous system axon regeneration(GO:0014012) |
0.4 | 1.9 | GO:0070493 | thrombin receptor signaling pathway(GO:0070493) |
0.4 | 0.7 | GO:0032825 | positive regulation of natural killer cell differentiation(GO:0032825) |
0.4 | 1.9 | GO:0045792 | negative regulation of cell size(GO:0045792) |
0.4 | 9.3 | GO:0003009 | skeletal muscle contraction(GO:0003009) |
0.4 | 3.3 | GO:0008272 | sulfate transport(GO:0008272) |
0.4 | 0.4 | GO:0034032 | nucleoside bisphosphate metabolic process(GO:0033865) ribonucleoside bisphosphate metabolic process(GO:0033875) purine nucleoside bisphosphate metabolic process(GO:0034032) |
0.4 | 2.6 | GO:0043569 | negative regulation of insulin-like growth factor receptor signaling pathway(GO:0043569) |
0.4 | 1.8 | GO:0015838 | amino-acid betaine transport(GO:0015838) |
0.4 | 0.4 | GO:0046321 | positive regulation of fatty acid oxidation(GO:0046321) |
0.4 | 1.5 | GO:0031659 | regulation of cyclin-dependent protein serine/threonine kinase activity involved in G1/S transition of mitotic cell cycle(GO:0031657) positive regulation of cyclin-dependent protein serine/threonine kinase activity involved in G1/S transition of mitotic cell cycle(GO:0031659) |
0.4 | 2.2 | GO:0061014 | positive regulation of mRNA catabolic process(GO:0061014) |
0.4 | 11.0 | GO:0007029 | endoplasmic reticulum organization(GO:0007029) |
0.4 | 0.7 | GO:0034390 | smooth muscle cell apoptotic process(GO:0034390) regulation of smooth muscle cell apoptotic process(GO:0034391) |
0.4 | 1.1 | GO:0070314 | G1 to G0 transition(GO:0070314) |
0.4 | 0.7 | GO:0060677 | ureteric bud elongation(GO:0060677) |
0.4 | 1.8 | GO:0051461 | positive regulation of corticotropin secretion(GO:0051461) |
0.4 | 0.7 | GO:0035927 | RNA import into mitochondrion(GO:0035927) |
0.4 | 7.6 | GO:0000186 | activation of MAPKK activity(GO:0000186) |
0.4 | 0.7 | GO:0006534 | cysteine metabolic process(GO:0006534) |
0.4 | 2.9 | GO:0007176 | regulation of epidermal growth factor-activated receptor activity(GO:0007176) |
0.4 | 1.1 | GO:0032971 | regulation of muscle filament sliding(GO:0032971) |
0.4 | 0.4 | GO:0050916 | sensory perception of sweet taste(GO:0050916) |
0.4 | 4.0 | GO:0051974 | negative regulation of telomerase activity(GO:0051974) |
0.4 | 1.4 | GO:0010739 | positive regulation of protein kinase A signaling(GO:0010739) |
0.4 | 1.4 | GO:2000210 | positive regulation of anoikis(GO:2000210) |
0.4 | 1.4 | GO:0098535 | de novo centriole assembly(GO:0098535) |
0.4 | 0.4 | GO:0035434 | copper ion transmembrane transport(GO:0035434) |
0.4 | 2.5 | GO:0045292 | mRNA cis splicing, via spliceosome(GO:0045292) |
0.4 | 0.7 | GO:0061092 | regulation of phospholipid translocation(GO:0061091) positive regulation of phospholipid translocation(GO:0061092) |
0.4 | 2.1 | GO:0010225 | response to UV-C(GO:0010225) |
0.4 | 0.4 | GO:0001907 | killing by symbiont of host cells(GO:0001907) disruption by symbiont of host cell(GO:0044004) |
0.4 | 0.7 | GO:2001166 | regulation of histone H2B ubiquitination(GO:2001166) positive regulation of histone H2B ubiquitination(GO:2001168) |
0.4 | 1.1 | GO:0032485 | regulation of Ral protein signal transduction(GO:0032485) |
0.4 | 0.7 | GO:0060159 | regulation of dopamine receptor signaling pathway(GO:0060159) |
0.4 | 0.4 | GO:0045900 | negative regulation of translational elongation(GO:0045900) |
0.4 | 0.7 | GO:2000074 | regulation of type B pancreatic cell development(GO:2000074) |
0.4 | 1.1 | GO:0016480 | negative regulation of transcription from RNA polymerase III promoter(GO:0016480) |
0.4 | 1.1 | GO:0048388 | endosomal lumen acidification(GO:0048388) |
0.4 | 2.1 | GO:0045943 | positive regulation of transcription from RNA polymerase I promoter(GO:0045943) |
0.4 | 2.1 | GO:0097094 | craniofacial suture morphogenesis(GO:0097094) |
0.3 | 1.0 | GO:1903026 | negative regulation of RNA polymerase II regulatory region sequence-specific DNA binding(GO:1903026) |
0.3 | 0.7 | GO:0042414 | epinephrine metabolic process(GO:0042414) |
0.3 | 2.1 | GO:0043567 | regulation of insulin-like growth factor receptor signaling pathway(GO:0043567) |
0.3 | 9.4 | GO:0006506 | GPI anchor biosynthetic process(GO:0006506) |
0.3 | 1.0 | GO:0006527 | arginine catabolic process(GO:0006527) |
0.3 | 1.0 | GO:1902036 | regulation of hematopoietic stem cell differentiation(GO:1902036) |
0.3 | 2.4 | GO:0031297 | replication fork processing(GO:0031297) |
0.3 | 0.7 | GO:0061153 | trachea submucosa development(GO:0061152) trachea gland development(GO:0061153) |
0.3 | 0.3 | GO:0061052 | negative regulation of cell growth involved in cardiac muscle cell development(GO:0061052) |
0.3 | 0.7 | GO:0038165 | oncostatin-M-mediated signaling pathway(GO:0038165) |
0.3 | 1.7 | GO:0015868 | purine ribonucleotide transport(GO:0015868) |
0.3 | 3.1 | GO:0032469 | endoplasmic reticulum calcium ion homeostasis(GO:0032469) |
0.3 | 1.0 | GO:0036233 | glycine import(GO:0036233) |
0.3 | 0.7 | GO:0051031 | tRNA transport(GO:0051031) |
0.3 | 1.0 | GO:1903054 | negative regulation of extracellular matrix organization(GO:1903054) |
0.3 | 0.7 | GO:2000973 | regulation of pro-B cell differentiation(GO:2000973) |
0.3 | 1.0 | GO:0009838 | abscission(GO:0009838) |
0.3 | 1.0 | GO:0040009 | regulation of growth rate(GO:0040009) |
0.3 | 0.3 | GO:0008291 | acetylcholine metabolic process(GO:0008291) acetate ester metabolic process(GO:1900619) |
0.3 | 3.4 | GO:0031639 | plasminogen activation(GO:0031639) |
0.3 | 1.0 | GO:0071896 | protein localization to adherens junction(GO:0071896) |
0.3 | 0.3 | GO:0010819 | regulation of T cell chemotaxis(GO:0010819) |
0.3 | 1.3 | GO:0007183 | SMAD protein complex assembly(GO:0007183) |
0.3 | 1.0 | GO:0086073 | bundle of His cell-Purkinje myocyte adhesion involved in cell communication(GO:0086073) |
0.3 | 1.0 | GO:0036444 | calcium ion transmembrane import into mitochondrion(GO:0036444) |
0.3 | 1.3 | GO:0007217 | tachykinin receptor signaling pathway(GO:0007217) |
0.3 | 1.3 | GO:0034975 | protein folding in endoplasmic reticulum(GO:0034975) |
0.3 | 0.3 | GO:0019374 | galactolipid metabolic process(GO:0019374) |
0.3 | 0.7 | GO:0051315 | attachment of mitotic spindle microtubules to kinetochore(GO:0051315) |
0.3 | 0.7 | GO:1990705 | cholangiocyte proliferation(GO:1990705) |
0.3 | 0.3 | GO:0051182 | coenzyme transport(GO:0051182) |
0.3 | 1.0 | GO:0032486 | Rap protein signal transduction(GO:0032486) |
0.3 | 1.3 | GO:0010701 | positive regulation of norepinephrine secretion(GO:0010701) |
0.3 | 0.3 | GO:0045351 | type I interferon biosynthetic process(GO:0045351) |
0.3 | 0.3 | GO:1901301 | regulation of cargo loading into COPII-coated vesicle(GO:1901301) |
0.3 | 0.3 | GO:0014735 | regulation of muscle atrophy(GO:0014735) |
0.3 | 1.6 | GO:0060836 | lymphatic endothelial cell differentiation(GO:0060836) |
0.3 | 5.8 | GO:0055092 | cholesterol homeostasis(GO:0042632) sterol homeostasis(GO:0055092) |
0.3 | 1.9 | GO:0030643 | cellular phosphate ion homeostasis(GO:0030643) cellular trivalent inorganic anion homeostasis(GO:0072502) |
0.3 | 0.3 | GO:0043320 | natural killer cell degranulation(GO:0043320) |
0.3 | 0.6 | GO:0044827 | modulation by host of viral genome replication(GO:0044827) |
0.3 | 0.3 | GO:0032096 | negative regulation of response to food(GO:0032096) |
0.3 | 0.3 | GO:0033184 | positive regulation of histone ubiquitination(GO:0033184) |
0.3 | 0.6 | GO:0090214 | spongiotrophoblast layer developmental growth(GO:0090214) |
0.3 | 0.3 | GO:0008295 | spermidine biosynthetic process(GO:0008295) |
0.3 | 1.0 | GO:0009249 | protein lipoylation(GO:0009249) |
0.3 | 1.0 | GO:0015697 | quaternary ammonium group transport(GO:0015697) |
0.3 | 3.2 | GO:0010800 | positive regulation of peptidyl-threonine phosphorylation(GO:0010800) |
0.3 | 2.9 | GO:0051984 | positive regulation of chromosome segregation(GO:0051984) |
0.3 | 1.9 | GO:1901317 | regulation of sperm motility(GO:1901317) |
0.3 | 0.3 | GO:0052173 | response to defenses of other organism involved in symbiotic interaction(GO:0052173) response to host defenses(GO:0052200) response to host(GO:0075136) |
0.3 | 1.0 | GO:2000766 | negative regulation of cytoplasmic translation(GO:2000766) |
0.3 | 1.0 | GO:0048861 | leukemia inhibitory factor signaling pathway(GO:0048861) |
0.3 | 0.6 | GO:0070934 | CRD-mediated mRNA stabilization(GO:0070934) |
0.3 | 0.9 | GO:0030382 | sperm mitochondrion organization(GO:0030382) |
0.3 | 1.3 | GO:0031053 | primary miRNA processing(GO:0031053) |
0.3 | 0.3 | GO:2001185 | regulation of CD8-positive, alpha-beta T cell activation(GO:2001185) |
0.3 | 2.8 | GO:0090026 | positive regulation of monocyte chemotaxis(GO:0090026) |
0.3 | 0.6 | GO:0010818 | T cell chemotaxis(GO:0010818) |
0.3 | 0.3 | GO:0044793 | negative regulation by host of viral process(GO:0044793) |
0.3 | 1.3 | GO:0009191 | ribonucleoside diphosphate catabolic process(GO:0009191) |
0.3 | 0.6 | GO:0036258 | multivesicular body assembly(GO:0036258) |
0.3 | 0.3 | GO:0008078 | mesodermal cell migration(GO:0008078) |
0.3 | 1.2 | GO:0051126 | negative regulation of actin nucleation(GO:0051126) |
0.3 | 0.3 | GO:2000832 | negative regulation of steroid hormone secretion(GO:2000832) negative regulation of corticosteroid hormone secretion(GO:2000847) negative regulation of glucocorticoid secretion(GO:2000850) |
0.3 | 1.9 | GO:0006265 | DNA topological change(GO:0006265) |
0.3 | 0.9 | GO:0044130 | negative regulation of growth of symbiont in host(GO:0044130) negative regulation of growth of symbiont involved in interaction with host(GO:0044146) |
0.3 | 0.6 | GO:0033262 | regulation of nuclear cell cycle DNA replication(GO:0033262) |
0.3 | 1.9 | GO:2000628 | regulation of miRNA metabolic process(GO:2000628) |
0.3 | 0.6 | GO:1903224 | regulation of endodermal cell differentiation(GO:1903224) |
0.3 | 0.3 | GO:0042524 | negative regulation of tyrosine phosphorylation of Stat5 protein(GO:0042524) |
0.3 | 0.3 | GO:0090382 | phagosome maturation(GO:0090382) |
0.3 | 0.6 | GO:0042998 | positive regulation of Golgi to plasma membrane protein transport(GO:0042998) |
0.3 | 1.2 | GO:0034393 | positive regulation of smooth muscle cell apoptotic process(GO:0034393) |
0.3 | 0.9 | GO:0070294 | renal sodium ion absorption(GO:0070294) |
0.3 | 1.8 | GO:0031274 | positive regulation of pseudopodium assembly(GO:0031274) |
0.3 | 0.9 | GO:0034134 | toll-like receptor 2 signaling pathway(GO:0034134) |
0.3 | 0.9 | GO:0008588 | release of cytoplasmic sequestered NF-kappaB(GO:0008588) |
0.3 | 2.1 | GO:2000060 | positive regulation of protein ubiquitination involved in ubiquitin-dependent protein catabolic process(GO:2000060) |
0.3 | 0.6 | GO:0035461 | vitamin transmembrane transport(GO:0035461) |
0.3 | 0.3 | GO:0071314 | cellular response to cocaine(GO:0071314) |
0.3 | 1.5 | GO:1900028 | negative regulation of ruffle assembly(GO:1900028) |
0.3 | 0.3 | GO:0035887 | aortic smooth muscle cell differentiation(GO:0035887) |
0.3 | 1.5 | GO:0007435 | salivary gland morphogenesis(GO:0007435) |
0.3 | 0.3 | GO:0043366 | beta selection(GO:0043366) |
0.3 | 0.3 | GO:0035932 | mineralocorticoid secretion(GO:0035931) aldosterone secretion(GO:0035932) regulation of mineralocorticoid secretion(GO:2000855) regulation of aldosterone secretion(GO:2000858) |
0.3 | 0.3 | GO:2000054 | negative regulation of Wnt signaling pathway involved in dorsal/ventral axis specification(GO:2000054) |
0.3 | 0.6 | GO:0036438 | maintenance of lens transparency(GO:0036438) |
0.3 | 0.9 | GO:0090237 | regulation of arachidonic acid secretion(GO:0090237) |
0.3 | 0.9 | GO:1901534 | positive regulation of hematopoietic progenitor cell differentiation(GO:1901534) |
0.3 | 0.3 | GO:0007135 | meiosis II(GO:0007135) |
0.3 | 0.6 | GO:0032074 | negative regulation of nuclease activity(GO:0032074) |
0.3 | 1.2 | GO:0031282 | regulation of guanylate cyclase activity(GO:0031282) |
0.3 | 6.2 | GO:0051452 | intracellular pH reduction(GO:0051452) |
0.3 | 1.5 | GO:2000653 | regulation of genetic imprinting(GO:2000653) |
0.3 | 6.7 | GO:0005978 | glycogen biosynthetic process(GO:0005978) glucan biosynthetic process(GO:0009250) |
0.3 | 11.1 | GO:0051865 | protein autoubiquitination(GO:0051865) |
0.3 | 0.3 | GO:0006563 | L-serine metabolic process(GO:0006563) |
0.3 | 0.9 | GO:0060839 | endothelial cell fate commitment(GO:0060839) |
0.3 | 0.9 | GO:0015705 | iodide transport(GO:0015705) |
0.3 | 0.9 | GO:1902992 | negative regulation of amyloid precursor protein catabolic process(GO:1902992) |
0.3 | 1.7 | GO:0043312 | neutrophil degranulation(GO:0043312) |
0.3 | 0.6 | GO:0042758 | long-chain fatty acid catabolic process(GO:0042758) |
0.3 | 0.6 | GO:0070668 | negative regulation of mast cell apoptotic process(GO:0033026) mast cell proliferation(GO:0070662) regulation of mast cell proliferation(GO:0070666) positive regulation of mast cell proliferation(GO:0070668) |
0.3 | 2.0 | GO:0000059 | protein import into nucleus, docking(GO:0000059) |
0.3 | 0.9 | GO:0030208 | dermatan sulfate biosynthetic process(GO:0030208) |
0.3 | 1.4 | GO:0046836 | glycolipid transport(GO:0046836) |
0.3 | 1.2 | GO:0060052 | neurofilament cytoskeleton organization(GO:0060052) |
0.3 | 0.9 | GO:0061084 | regulation of protein refolding(GO:0061083) negative regulation of protein refolding(GO:0061084) |
0.3 | 0.3 | GO:1905039 | organic acid transmembrane transport(GO:1903825) carboxylic acid transmembrane transport(GO:1905039) |
0.3 | 0.3 | GO:0019276 | UDP-N-acetylgalactosamine metabolic process(GO:0019276) |
0.3 | 0.9 | GO:0043402 | glucocorticoid mediated signaling pathway(GO:0043402) |
0.3 | 2.8 | GO:0000478 | endonucleolytic cleavage involved in rRNA processing(GO:0000478) |
0.3 | 0.9 | GO:0000715 | nucleotide-excision repair, DNA damage recognition(GO:0000715) |
0.3 | 0.6 | GO:1903774 | positive regulation of viral budding via host ESCRT complex(GO:1903774) |
0.3 | 0.3 | GO:0032898 | neurotrophin production(GO:0032898) |
0.3 | 1.1 | GO:0033623 | regulation of integrin activation(GO:0033623) |
0.3 | 10.6 | GO:0000245 | spliceosomal complex assembly(GO:0000245) |
0.3 | 1.4 | GO:0070940 | dephosphorylation of RNA polymerase II C-terminal domain(GO:0070940) |
0.3 | 0.8 | GO:0007288 | sperm axoneme assembly(GO:0007288) |
0.3 | 0.3 | GO:0060449 | bud elongation involved in lung branching(GO:0060449) |
0.3 | 3.0 | GO:0006661 | phosphatidylinositol biosynthetic process(GO:0006661) |
0.3 | 1.1 | GO:0033630 | positive regulation of cell adhesion mediated by integrin(GO:0033630) |
0.3 | 1.1 | GO:0034755 | iron ion transmembrane transport(GO:0034755) |
0.3 | 1.6 | GO:0071318 | cellular response to ATP(GO:0071318) |
0.3 | 1.6 | GO:0035278 | miRNA mediated inhibition of translation(GO:0035278) |
0.3 | 0.5 | GO:0031268 | pseudopodium organization(GO:0031268) |
0.3 | 1.4 | GO:0045986 | negative regulation of smooth muscle contraction(GO:0045986) |
0.3 | 1.1 | GO:0002759 | regulation of antimicrobial humoral response(GO:0002759) |
0.3 | 0.5 | GO:0033299 | secretion of lysosomal enzymes(GO:0033299) |
0.3 | 1.9 | GO:0032897 | negative regulation of viral transcription(GO:0032897) |
0.3 | 2.4 | GO:1990118 | sodium ion import across plasma membrane(GO:0098719) sodium ion import into cell(GO:1990118) |
0.3 | 1.4 | GO:0060340 | positive regulation of type I interferon-mediated signaling pathway(GO:0060340) |
0.3 | 1.1 | GO:0006971 | hypotonic response(GO:0006971) cellular hypotonic response(GO:0071476) |
0.3 | 0.8 | GO:1901097 | negative regulation of autophagosome maturation(GO:1901097) |
0.3 | 1.1 | GO:0042590 | antigen processing and presentation of exogenous peptide antigen via MHC class I(GO:0042590) |
0.3 | 0.3 | GO:0070813 | hydrogen sulfide metabolic process(GO:0070813) |
0.3 | 1.9 | GO:1901678 | iron coordination entity transport(GO:1901678) |
0.3 | 3.8 | GO:0031648 | protein destabilization(GO:0031648) |
0.3 | 0.3 | GO:0032148 | activation of protein kinase B activity(GO:0032148) |
0.3 | 0.5 | GO:0000711 | meiotic DNA repair synthesis(GO:0000711) |
0.3 | 0.8 | GO:0017198 | N-terminal peptidyl-serine acetylation(GO:0017198) N-terminal peptidyl-glutamic acid acetylation(GO:0018002) peptidyl-serine acetylation(GO:0030920) |
0.3 | 0.3 | GO:0051594 | detection of carbohydrate stimulus(GO:0009730) detection of hexose stimulus(GO:0009732) detection of monosaccharide stimulus(GO:0034287) detection of glucose(GO:0051594) |
0.3 | 1.1 | GO:0032780 | negative regulation of ATPase activity(GO:0032780) |
0.3 | 0.5 | GO:0001302 | replicative cell aging(GO:0001302) |
0.3 | 0.3 | GO:0007168 | receptor guanylyl cyclase signaling pathway(GO:0007168) |
0.3 | 0.5 | GO:0010572 | positive regulation of platelet activation(GO:0010572) |
0.3 | 0.3 | GO:1901228 | positive regulation of transcription from RNA polymerase II promoter involved in myocardial precursor cell differentiation(GO:0003257) positive regulation of transcription from RNA polymerase II promoter involved in heart development(GO:1901228) |
0.3 | 3.6 | GO:0008089 | anterograde axonal transport(GO:0008089) |
0.3 | 1.6 | GO:0019262 | N-acetylneuraminate catabolic process(GO:0019262) |
0.3 | 4.4 | GO:0006284 | base-excision repair(GO:0006284) |
0.3 | 5.4 | GO:0006688 | glycosphingolipid biosynthetic process(GO:0006688) |
0.3 | 1.3 | GO:0046007 | negative regulation of activated T cell proliferation(GO:0046007) |
0.3 | 0.8 | GO:0034379 | very-low-density lipoprotein particle assembly(GO:0034379) |
0.3 | 0.5 | GO:0048630 | skeletal muscle tissue growth(GO:0048630) |
0.3 | 1.3 | GO:1901223 | negative regulation of NIK/NF-kappaB signaling(GO:1901223) |
0.3 | 0.8 | GO:0061687 | detoxification of inorganic compound(GO:0061687) |
0.3 | 1.3 | GO:0000301 | retrograde transport, vesicle recycling within Golgi(GO:0000301) |
0.3 | 0.3 | GO:0014734 | skeletal muscle hypertrophy(GO:0014734) |
0.3 | 1.0 | GO:0035902 | response to immobilization stress(GO:0035902) |
0.3 | 2.5 | GO:0031572 | G2 DNA damage checkpoint(GO:0031572) |
0.3 | 0.5 | GO:0006536 | glutamate metabolic process(GO:0006536) |
0.3 | 0.8 | GO:0045217 | cell-cell junction maintenance(GO:0045217) |
0.3 | 1.8 | GO:0006020 | inositol metabolic process(GO:0006020) |
0.2 | 8.7 | GO:0071391 | cellular response to estrogen stimulus(GO:0071391) |
0.2 | 5.7 | GO:0090662 | energy coupled proton transmembrane transport, against electrochemical gradient(GO:0015988) ATP hydrolysis coupled proton transport(GO:0015991) ATP hydrolysis coupled transmembrane transport(GO:0090662) |
0.2 | 0.2 | GO:0060463 | lung lobe development(GO:0060462) lung lobe morphogenesis(GO:0060463) |
0.2 | 2.7 | GO:0043486 | histone exchange(GO:0043486) |
0.2 | 0.5 | GO:0006543 | glutamine catabolic process(GO:0006543) |
0.2 | 8.6 | GO:0043966 | histone H3 acetylation(GO:0043966) |
0.2 | 0.7 | GO:0036265 | RNA (guanine-N7)-methylation(GO:0036265) |
0.2 | 0.2 | GO:0061030 | epithelial cell differentiation involved in mammary gland alveolus development(GO:0061030) |
0.2 | 0.2 | GO:1904816 | positive regulation of protein localization to chromosome, telomeric region(GO:1904816) |
0.2 | 0.2 | GO:0021603 | cranial nerve formation(GO:0021603) |
0.2 | 3.7 | GO:0002089 | lens morphogenesis in camera-type eye(GO:0002089) |
0.2 | 0.5 | GO:0000055 | ribosomal large subunit export from nucleus(GO:0000055) |
0.2 | 1.5 | GO:0070234 | positive regulation of T cell apoptotic process(GO:0070234) |
0.2 | 3.6 | GO:0051294 | establishment of spindle orientation(GO:0051294) |
0.2 | 0.2 | GO:0098763 | mitotic cell cycle phase(GO:0098763) |
0.2 | 1.0 | GO:0032754 | positive regulation of interleukin-5 production(GO:0032754) |
0.2 | 0.7 | GO:0035279 | mRNA cleavage involved in gene silencing by miRNA(GO:0035279) mRNA cleavage involved in gene silencing(GO:0098795) |
0.2 | 0.5 | GO:0034145 | positive regulation of toll-like receptor 4 signaling pathway(GO:0034145) |
0.2 | 1.0 | GO:0001672 | regulation of chromatin assembly or disassembly(GO:0001672) |
0.2 | 0.2 | GO:0061144 | alveolar secondary septum development(GO:0061144) |
0.2 | 0.5 | GO:0002414 | immunoglobulin transcytosis in epithelial cells(GO:0002414) |
0.2 | 0.5 | GO:0051197 | positive regulation of cofactor metabolic process(GO:0051194) positive regulation of coenzyme metabolic process(GO:0051197) |
0.2 | 0.2 | GO:0070244 | negative regulation of thymocyte apoptotic process(GO:0070244) |
0.2 | 0.7 | GO:1904659 | glucose transmembrane transport(GO:1904659) |
0.2 | 0.9 | GO:0034312 | diol biosynthetic process(GO:0034312) sphingosine biosynthetic process(GO:0046512) |
0.2 | 0.7 | GO:0030644 | cellular chloride ion homeostasis(GO:0030644) |
0.2 | 0.7 | GO:0046292 | formaldehyde metabolic process(GO:0046292) |
0.2 | 8.8 | GO:0045454 | cell redox homeostasis(GO:0045454) |
0.2 | 1.2 | GO:0051967 | negative regulation of synaptic transmission, glutamatergic(GO:0051967) |
0.2 | 2.8 | GO:0001967 | suckling behavior(GO:0001967) |
0.2 | 1.4 | GO:0032401 | establishment of melanosome localization(GO:0032401) melanosome transport(GO:0032402) |
0.2 | 0.2 | GO:0043504 | mitochondrial DNA repair(GO:0043504) |
0.2 | 1.2 | GO:0060088 | auditory receptor cell stereocilium organization(GO:0060088) |
0.2 | 2.8 | GO:0019731 | antibacterial humoral response(GO:0019731) |
0.2 | 0.7 | GO:0030321 | transepithelial chloride transport(GO:0030321) |
0.2 | 0.7 | GO:0035188 | blastocyst hatching(GO:0001835) hatching(GO:0035188) organism emergence from protective structure(GO:0071684) |
0.2 | 0.9 | GO:0016556 | mRNA modification(GO:0016556) |
0.2 | 0.7 | GO:0001561 | fatty acid alpha-oxidation(GO:0001561) |
0.2 | 0.9 | GO:2001275 | positive regulation of glucose import in response to insulin stimulus(GO:2001275) |
0.2 | 0.9 | GO:0018401 | peptidyl-proline hydroxylation to 4-hydroxy-L-proline(GO:0018401) |
0.2 | 0.2 | GO:2000698 | positive regulation of epithelial cell differentiation involved in kidney development(GO:2000698) |
0.2 | 0.2 | GO:0042940 | D-amino acid transport(GO:0042940) |
0.2 | 0.2 | GO:0051794 | regulation of catagen(GO:0051794) |
0.2 | 1.1 | GO:0006398 | mRNA 3'-end processing by stem-loop binding and cleavage(GO:0006398) |
0.2 | 1.4 | GO:0021692 | cerebellar Purkinje cell layer morphogenesis(GO:0021692) |
0.2 | 1.1 | GO:0007603 | phototransduction, visible light(GO:0007603) |
0.2 | 0.2 | GO:0006842 | tricarboxylic acid transport(GO:0006842) citrate transport(GO:0015746) |
0.2 | 2.3 | GO:0050832 | defense response to fungus(GO:0050832) |
0.2 | 0.5 | GO:0033030 | negative regulation of neutrophil apoptotic process(GO:0033030) |
0.2 | 0.2 | GO:2000399 | negative regulation of thymocyte aggregation(GO:2000399) |
0.2 | 0.2 | GO:0055093 | cellular response to increased oxygen levels(GO:0036295) response to increased oxygen levels(GO:0036296) response to hyperoxia(GO:0055093) cellular response to hyperoxia(GO:0071455) |
0.2 | 1.1 | GO:0097070 | ductus arteriosus closure(GO:0097070) |
0.2 | 0.4 | GO:0043984 | histone H4-K16 acetylation(GO:0043984) |
0.2 | 0.2 | GO:0033034 | positive regulation of myeloid cell apoptotic process(GO:0033034) |
0.2 | 0.7 | GO:2000354 | regulation of ovarian follicle development(GO:2000354) |
0.2 | 0.7 | GO:0030579 | ubiquitin-dependent SMAD protein catabolic process(GO:0030579) |
0.2 | 0.2 | GO:1901978 | positive regulation of cell cycle checkpoint(GO:1901978) |
0.2 | 1.1 | GO:0001845 | phagolysosome assembly(GO:0001845) |
0.2 | 2.0 | GO:0009143 | nucleoside triphosphate catabolic process(GO:0009143) |
0.2 | 0.2 | GO:0033129 | positive regulation of histone phosphorylation(GO:0033129) |
0.2 | 0.4 | GO:2001137 | positive regulation of endocytic recycling(GO:2001137) |
0.2 | 0.9 | GO:0000289 | nuclear-transcribed mRNA poly(A) tail shortening(GO:0000289) |
0.2 | 0.2 | GO:0072553 | terminal button organization(GO:0072553) |
0.2 | 0.4 | GO:0061589 | calcium activated phosphatidylserine scrambling(GO:0061589) |
0.2 | 0.4 | GO:1901894 | regulation of calcium-transporting ATPase activity(GO:1901894) |
0.2 | 1.5 | GO:0015893 | drug transport(GO:0015893) |
0.2 | 1.1 | GO:0051013 | microtubule severing(GO:0051013) |
0.2 | 0.9 | GO:0060710 | chorio-allantoic fusion(GO:0060710) |
0.2 | 0.4 | GO:0046628 | positive regulation of insulin receptor signaling pathway(GO:0046628) |
0.2 | 0.2 | GO:1902074 | response to salt(GO:1902074) |
0.2 | 0.7 | GO:1900108 | negative regulation of nodal signaling pathway(GO:1900108) |
0.2 | 0.7 | GO:0001732 | formation of cytoplasmic translation initiation complex(GO:0001732) |
0.2 | 0.2 | GO:0035509 | negative regulation of myosin-light-chain-phosphatase activity(GO:0035509) |
0.2 | 1.1 | GO:0048935 | peripheral nervous system neuron differentiation(GO:0048934) peripheral nervous system neuron development(GO:0048935) |
0.2 | 0.4 | GO:2000523 | regulation of T cell costimulation(GO:2000523) positive regulation of T cell costimulation(GO:2000525) |
0.2 | 0.6 | GO:2001199 | negative regulation of dendritic cell differentiation(GO:2001199) |
0.2 | 0.4 | GO:0031584 | activation of phospholipase D activity(GO:0031584) |
0.2 | 0.2 | GO:1903071 | positive regulation of ER-associated ubiquitin-dependent protein catabolic process(GO:1903071) |
0.2 | 2.8 | GO:0034587 | piRNA metabolic process(GO:0034587) |
0.2 | 0.2 | GO:0008535 | respiratory chain complex IV assembly(GO:0008535) |
0.2 | 0.2 | GO:1902608 | regulation of large conductance calcium-activated potassium channel activity(GO:1902606) positive regulation of large conductance calcium-activated potassium channel activity(GO:1902608) |
0.2 | 0.2 | GO:0048808 | male genitalia morphogenesis(GO:0048808) male anatomical structure morphogenesis(GO:0090598) |
0.2 | 0.4 | GO:0060084 | synaptic transmission involved in micturition(GO:0060084) |
0.2 | 0.2 | GO:0033158 | regulation of protein import into nucleus, translocation(GO:0033158) |
0.2 | 0.8 | GO:0030388 | fructose 1,6-bisphosphate metabolic process(GO:0030388) |
0.2 | 1.1 | GO:0000056 | ribosomal small subunit export from nucleus(GO:0000056) |
0.2 | 0.4 | GO:0018364 | peptidyl-glutamine methylation(GO:0018364) |
0.2 | 0.2 | GO:0003344 | pericardium morphogenesis(GO:0003344) |
0.2 | 0.2 | GO:1902774 | late endosome to lysosome transport(GO:1902774) |
0.2 | 1.0 | GO:0007097 | nuclear migration(GO:0007097) |
0.2 | 1.7 | GO:0032418 | lysosome localization(GO:0032418) |
0.2 | 0.6 | GO:0018343 | protein farnesylation(GO:0018343) |
0.2 | 0.2 | GO:0014745 | negative regulation of muscle adaptation(GO:0014745) |
0.2 | 0.2 | GO:0016561 | protein import into peroxisome matrix, translocation(GO:0016561) |
0.2 | 0.2 | GO:0050667 | homocysteine metabolic process(GO:0050667) |
0.2 | 0.2 | GO:0003415 | chondrocyte hypertrophy(GO:0003415) |
0.2 | 0.6 | GO:0006597 | spermine biosynthetic process(GO:0006597) |
0.2 | 1.0 | GO:0035878 | nail development(GO:0035878) |
0.2 | 1.2 | GO:0034243 | regulation of transcription elongation from RNA polymerase II promoter(GO:0034243) |
0.2 | 1.4 | GO:0071578 | zinc II ion transmembrane import(GO:0071578) |
0.2 | 0.6 | GO:0006924 | activation-induced cell death of T cells(GO:0006924) |
0.2 | 0.6 | GO:0006057 | cell wall mannoprotein biosynthetic process(GO:0000032) mannoprotein metabolic process(GO:0006056) mannoprotein biosynthetic process(GO:0006057) cell wall glycoprotein biosynthetic process(GO:0031506) cell wall biogenesis(GO:0042546) cell wall macromolecule biosynthetic process(GO:0044038) chain elongation of O-linked mannose residue(GO:0044845) cellular component macromolecule biosynthetic process(GO:0070589) |
0.2 | 0.6 | GO:0035414 | negative regulation of catenin import into nucleus(GO:0035414) |
0.2 | 0.2 | GO:0002069 | columnar/cuboidal epithelial cell maturation(GO:0002069) |
0.2 | 0.6 | GO:0006775 | fat-soluble vitamin metabolic process(GO:0006775) |
0.2 | 0.8 | GO:0046501 | protoporphyrinogen IX metabolic process(GO:0046501) |
0.2 | 0.6 | GO:2000774 | positive regulation of cellular senescence(GO:2000774) |
0.2 | 0.2 | GO:0071609 | chemokine (C-C motif) ligand 5 production(GO:0071609) |
0.2 | 1.8 | GO:0051457 | maintenance of protein location in nucleus(GO:0051457) |
0.2 | 0.8 | GO:0006561 | proline biosynthetic process(GO:0006561) |
0.2 | 0.2 | GO:0045079 | negative regulation of chemokine biosynthetic process(GO:0045079) |
0.2 | 0.2 | GO:0007621 | negative regulation of female receptivity(GO:0007621) |
0.2 | 0.2 | GO:0006344 | maintenance of chromatin silencing(GO:0006344) |
0.2 | 2.8 | GO:0045744 | negative regulation of G-protein coupled receptor protein signaling pathway(GO:0045744) |
0.2 | 0.6 | GO:0032466 | negative regulation of cytokinesis(GO:0032466) |
0.2 | 0.4 | GO:0046726 | positive regulation by virus of viral protein levels in host cell(GO:0046726) |
0.2 | 0.8 | GO:1901673 | regulation of spindle assembly(GO:0090169) regulation of mitotic spindle assembly(GO:1901673) |
0.2 | 0.6 | GO:0060037 | pharyngeal system development(GO:0060037) |
0.2 | 0.2 | GO:0035898 | parathyroid hormone secretion(GO:0035898) |
0.2 | 1.0 | GO:0018095 | protein polyglutamylation(GO:0018095) |
0.2 | 0.4 | GO:0090435 | protein localization to nuclear envelope(GO:0090435) |
0.2 | 0.2 | GO:0035740 | CD8-positive, alpha-beta T cell proliferation(GO:0035740) |
0.2 | 0.6 | GO:0021798 | forebrain dorsal/ventral pattern formation(GO:0021798) |
0.2 | 0.6 | GO:0070682 | proteasome regulatory particle assembly(GO:0070682) |
0.2 | 0.2 | GO:0043988 | histone H3-S28 phosphorylation(GO:0043988) |
0.2 | 5.1 | GO:0001895 | retina homeostasis(GO:0001895) |
0.2 | 0.4 | GO:0002838 | negative regulation of response to tumor cell(GO:0002835) negative regulation of immune response to tumor cell(GO:0002838) |
0.2 | 1.0 | GO:0031440 | regulation of mRNA 3'-end processing(GO:0031440) |
0.2 | 0.4 | GO:0001555 | oocyte growth(GO:0001555) |
0.2 | 1.2 | GO:0007379 | segment specification(GO:0007379) |
0.2 | 0.4 | GO:1990086 | lens fiber cell apoptotic process(GO:1990086) |
0.2 | 0.4 | GO:0051024 | positive regulation of immunoglobulin secretion(GO:0051024) |
0.2 | 0.4 | GO:0007351 | tripartite regional subdivision(GO:0007351) anterior/posterior axis specification, embryo(GO:0008595) |
0.2 | 0.4 | GO:0033483 | gas homeostasis(GO:0033483) |
0.2 | 1.7 | GO:0017144 | drug metabolic process(GO:0017144) |
0.2 | 0.4 | GO:0009597 | detection of virus(GO:0009597) |
0.2 | 0.8 | GO:0071712 | ER-associated misfolded protein catabolic process(GO:0071712) |
0.2 | 0.6 | GO:0048539 | bone marrow development(GO:0048539) |
0.2 | 0.2 | GO:0071223 | response to lipoteichoic acid(GO:0070391) cellular response to lipoteichoic acid(GO:0071223) |
0.2 | 4.4 | GO:0007339 | binding of sperm to zona pellucida(GO:0007339) |
0.2 | 3.8 | GO:0044380 | protein localization to cytoskeleton(GO:0044380) |
0.2 | 1.9 | GO:0006465 | signal peptide processing(GO:0006465) |
0.2 | 0.4 | GO:2000035 | regulation of stem cell division(GO:2000035) |
0.2 | 0.2 | GO:0051025 | negative regulation of immunoglobulin secretion(GO:0051025) |
0.2 | 0.4 | GO:0001957 | intramembranous ossification(GO:0001957) direct ossification(GO:0036072) |
0.2 | 0.4 | GO:0045940 | positive regulation of steroid metabolic process(GO:0045940) |
0.2 | 0.9 | GO:0038166 | angiotensin-activated signaling pathway(GO:0038166) |
0.2 | 2.8 | GO:0051497 | negative regulation of stress fiber assembly(GO:0051497) |
0.2 | 0.2 | GO:0046886 | positive regulation of hormone biosynthetic process(GO:0046886) |
0.2 | 2.8 | GO:0045747 | positive regulation of Notch signaling pathway(GO:0045747) |
0.2 | 0.4 | GO:0060157 | urinary bladder development(GO:0060157) |
0.2 | 0.2 | GO:0070857 | regulation of bile acid biosynthetic process(GO:0070857) |
0.2 | 0.4 | GO:0010867 | positive regulation of triglyceride biosynthetic process(GO:0010867) |
0.2 | 0.4 | GO:1904294 | positive regulation of ERAD pathway(GO:1904294) |
0.2 | 0.2 | GO:0071233 | response to leucine(GO:0043201) cellular response to leucine(GO:0071233) |
0.2 | 2.2 | GO:0051127 | positive regulation of actin nucleation(GO:0051127) |
0.2 | 0.4 | GO:0002576 | platelet degranulation(GO:0002576) |
0.2 | 0.4 | GO:0002525 | acute inflammatory response to non-antigenic stimulus(GO:0002525) |
0.2 | 0.2 | GO:0060330 | regulation of response to interferon-gamma(GO:0060330) |
0.2 | 0.6 | GO:0006734 | NADH metabolic process(GO:0006734) |
0.2 | 0.4 | GO:0032988 | ribonucleoprotein complex disassembly(GO:0032988) |
0.2 | 9.9 | GO:1903749 | positive regulation of establishment of protein localization to mitochondrion(GO:1903749) positive regulation of protein targeting to mitochondrion(GO:1903955) |
0.2 | 3.3 | GO:0018345 | protein palmitoylation(GO:0018345) |
0.2 | 0.5 | GO:0051151 | negative regulation of smooth muscle cell differentiation(GO:0051151) |
0.2 | 0.7 | GO:0050482 | arachidonic acid secretion(GO:0050482) arachidonate transport(GO:1903963) |
0.2 | 0.4 | GO:0035526 | retrograde transport, plasma membrane to Golgi(GO:0035526) |
0.2 | 0.4 | GO:1902231 | positive regulation of intrinsic apoptotic signaling pathway in response to DNA damage(GO:1902231) |
0.2 | 0.4 | GO:0055059 | asymmetric neuroblast division(GO:0055059) |
0.2 | 0.9 | GO:1903608 | protein localization to cytoplasmic stress granule(GO:1903608) |
0.2 | 0.4 | GO:0002408 | myeloid dendritic cell chemotaxis(GO:0002408) |
0.2 | 0.2 | GO:0032287 | peripheral nervous system myelin maintenance(GO:0032287) |
0.2 | 0.5 | GO:0035336 | long-chain fatty-acyl-CoA metabolic process(GO:0035336) |
0.2 | 0.7 | GO:0015074 | DNA integration(GO:0015074) |
0.2 | 0.2 | GO:0071312 | cellular response to alkaloid(GO:0071312) |
0.2 | 0.5 | GO:0035589 | G-protein coupled purinergic nucleotide receptor signaling pathway(GO:0035589) |
0.2 | 3.0 | GO:0046513 | ceramide biosynthetic process(GO:0046513) |
0.2 | 0.7 | GO:0021631 | optic nerve morphogenesis(GO:0021631) |
0.2 | 0.5 | GO:0007021 | tubulin complex assembly(GO:0007021) |
0.2 | 0.2 | GO:0045974 | negative regulation of translation, ncRNA-mediated(GO:0040033) regulation of translation, ncRNA-mediated(GO:0045974) |
0.2 | 0.5 | GO:0008340 | determination of adult lifespan(GO:0008340) |
0.2 | 0.7 | GO:0046931 | pore complex assembly(GO:0046931) nuclear pore complex assembly(GO:0051292) |
0.2 | 1.9 | GO:0060669 | embryonic placenta morphogenesis(GO:0060669) |
0.2 | 0.9 | GO:0045141 | meiotic telomere clustering(GO:0045141) |
0.2 | 2.1 | GO:0006826 | iron ion transport(GO:0006826) |
0.2 | 0.4 | GO:0071763 | nuclear membrane organization(GO:0071763) |
0.2 | 0.2 | GO:0046655 | folic acid metabolic process(GO:0046655) |
0.2 | 0.7 | GO:0015909 | long-chain fatty acid transport(GO:0015909) |
0.2 | 0.4 | GO:0030886 | negative regulation of myeloid dendritic cell activation(GO:0030886) |
0.2 | 0.2 | GO:0071462 | cellular response to water stimulus(GO:0071462) |
0.2 | 0.3 | GO:0033160 | positive regulation of protein import into nucleus, translocation(GO:0033160) |
0.2 | 1.0 | GO:0050860 | negative regulation of T cell receptor signaling pathway(GO:0050860) |
0.2 | 1.6 | GO:0007190 | activation of adenylate cyclase activity(GO:0007190) |
0.2 | 0.7 | GO:0039694 | viral RNA genome replication(GO:0039694) RNA replication(GO:0039703) |
0.2 | 0.2 | GO:0090027 | negative regulation of monocyte chemotaxis(GO:0090027) |
0.2 | 0.5 | GO:0006419 | alanyl-tRNA aminoacylation(GO:0006419) |
0.2 | 2.6 | GO:0090003 | regulation of establishment of protein localization to plasma membrane(GO:0090003) |
0.2 | 1.9 | GO:0043968 | histone H2A acetylation(GO:0043968) |
0.2 | 0.7 | GO:0010002 | cardioblast differentiation(GO:0010002) |
0.2 | 0.2 | GO:0070842 | aggresome assembly(GO:0070842) |
0.2 | 0.5 | GO:1902237 | positive regulation of endoplasmic reticulum stress-induced intrinsic apoptotic signaling pathway(GO:1902237) |
0.2 | 0.7 | GO:0050765 | negative regulation of phagocytosis(GO:0050765) |
0.2 | 0.7 | GO:1990440 | positive regulation of transcription from RNA polymerase II promoter in response to endoplasmic reticulum stress(GO:1990440) |
0.2 | 0.3 | GO:0033615 | mitochondrial proton-transporting ATP synthase complex assembly(GO:0033615) |
0.2 | 7.6 | GO:0032543 | mitochondrial translation(GO:0032543) |
0.2 | 0.8 | GO:0021534 | cell proliferation in hindbrain(GO:0021534) |
0.2 | 0.3 | GO:0060390 | regulation of SMAD protein import into nucleus(GO:0060390) |
0.2 | 2.0 | GO:0006779 | porphyrin-containing compound biosynthetic process(GO:0006779) tetrapyrrole biosynthetic process(GO:0033014) |
0.2 | 2.0 | GO:0061036 | positive regulation of cartilage development(GO:0061036) |
0.2 | 0.3 | GO:0010159 | specification of organ position(GO:0010159) |
0.2 | 0.2 | GO:0000733 | DNA strand renaturation(GO:0000733) |
0.2 | 1.0 | GO:0071257 | cellular response to electrical stimulus(GO:0071257) |
0.2 | 3.5 | GO:0045103 | intermediate filament-based process(GO:0045103) |
0.2 | 0.8 | GO:0033622 | integrin activation(GO:0033622) |
0.2 | 0.5 | GO:0021785 | branchiomotor neuron axon guidance(GO:0021785) |
0.2 | 0.5 | GO:0071378 | growth hormone receptor signaling pathway(GO:0060396) cellular response to growth hormone stimulus(GO:0071378) |
0.2 | 0.3 | GO:1904354 | negative regulation of telomere capping(GO:1904354) |
0.2 | 1.1 | GO:0090231 | regulation of spindle checkpoint(GO:0090231) |
0.2 | 0.2 | GO:1902414 | protein localization to cell junction(GO:1902414) |
0.2 | 0.5 | GO:0050872 | white fat cell differentiation(GO:0050872) |
0.2 | 1.6 | GO:0016226 | iron-sulfur cluster assembly(GO:0016226) metallo-sulfur cluster assembly(GO:0031163) |
0.2 | 0.3 | GO:0002016 | regulation of blood volume by renin-angiotensin(GO:0002016) |
0.2 | 0.7 | GO:0048227 | plasma membrane to endosome transport(GO:0048227) |
0.2 | 0.2 | GO:0009629 | response to gravity(GO:0009629) |
0.2 | 0.3 | GO:1902035 | positive regulation of hematopoietic stem cell proliferation(GO:1902035) |
0.2 | 3.2 | GO:0007062 | sister chromatid cohesion(GO:0007062) |
0.2 | 1.1 | GO:0031100 | organ regeneration(GO:0031100) |
0.2 | 0.3 | GO:0042523 | positive regulation of tyrosine phosphorylation of Stat5 protein(GO:0042523) |
0.2 | 0.3 | GO:0003348 | cardiac endothelial cell differentiation(GO:0003348) |
0.2 | 0.2 | GO:0060335 | positive regulation of response to interferon-gamma(GO:0060332) positive regulation of interferon-gamma-mediated signaling pathway(GO:0060335) |
0.2 | 0.5 | GO:2001256 | regulation of store-operated calcium entry(GO:2001256) |
0.2 | 0.3 | GO:0006420 | arginyl-tRNA aminoacylation(GO:0006420) |
0.2 | 1.1 | GO:1901984 | negative regulation of protein acetylation(GO:1901984) negative regulation of peptidyl-lysine acetylation(GO:2000757) |
0.2 | 0.6 | GO:0000022 | mitotic spindle elongation(GO:0000022) spindle elongation(GO:0051231) spindle midzone assembly(GO:0051255) mitotic spindle midzone assembly(GO:0051256) |
0.2 | 0.2 | GO:0032071 | regulation of endodeoxyribonuclease activity(GO:0032071) |
0.2 | 0.3 | GO:0033058 | directional locomotion(GO:0033058) |
0.2 | 1.4 | GO:0001523 | retinoid metabolic process(GO:0001523) |
0.2 | 0.2 | GO:0021524 | visceral motor neuron differentiation(GO:0021524) |
0.2 | 0.3 | GO:1900165 | negative regulation of interleukin-6 secretion(GO:1900165) |
0.2 | 0.6 | GO:0090084 | negative regulation of inclusion body assembly(GO:0090084) |
0.2 | 2.9 | GO:0000387 | spliceosomal snRNP assembly(GO:0000387) |
0.2 | 0.9 | GO:1903671 | negative regulation of cell migration involved in sprouting angiogenesis(GO:0090051) negative regulation of sprouting angiogenesis(GO:1903671) |
0.2 | 0.8 | GO:0033136 | serine phosphorylation of STAT3 protein(GO:0033136) |
0.2 | 0.2 | GO:0019042 | viral latency(GO:0019042) |
0.2 | 2.8 | GO:0050919 | negative chemotaxis(GO:0050919) |
0.2 | 0.2 | GO:0070072 | vacuolar proton-transporting V-type ATPase complex assembly(GO:0070072) |
0.2 | 0.3 | GO:0035511 | oxidative DNA demethylation(GO:0035511) |
0.2 | 0.3 | GO:0042640 | anagen(GO:0042640) |
0.2 | 0.2 | GO:0065005 | protein-lipid complex assembly(GO:0065005) |
0.2 | 1.1 | GO:0035518 | histone H2A monoubiquitination(GO:0035518) |
0.2 | 0.2 | GO:1903726 | negative regulation of phospholipid metabolic process(GO:1903726) |
0.2 | 1.5 | GO:0070534 | protein K63-linked ubiquitination(GO:0070534) |
0.2 | 0.8 | GO:0061029 | eyelid development in camera-type eye(GO:0061029) |
0.2 | 1.7 | GO:0006415 | translational termination(GO:0006415) |
0.2 | 0.2 | GO:0009415 | response to water(GO:0009415) |
0.2 | 0.8 | GO:0051044 | positive regulation of membrane protein ectodomain proteolysis(GO:0051044) |
0.2 | 0.2 | GO:0070535 | histone H2A K63-linked ubiquitination(GO:0070535) |
0.2 | 0.2 | GO:2000508 | regulation of dendritic cell chemotaxis(GO:2000508) |
0.2 | 0.2 | GO:1905214 | growth plate cartilage chondrocyte proliferation(GO:0003419) regulation of mRNA binding(GO:1902415) regulation of RNA binding(GO:1905214) |
0.1 | 0.1 | GO:1900368 | regulation of RNA interference(GO:1900368) |
0.1 | 1.3 | GO:0051568 | histone H3-K4 methylation(GO:0051568) |
0.1 | 0.4 | GO:0016188 | synaptic vesicle maturation(GO:0016188) |
0.1 | 0.7 | GO:0030575 | nuclear body organization(GO:0030575) |
0.1 | 0.4 | GO:1900095 | regulation of dosage compensation by inactivation of X chromosome(GO:1900095) |
0.1 | 6.5 | GO:0000724 | double-strand break repair via homologous recombination(GO:0000724) recombinational repair(GO:0000725) |
0.1 | 0.1 | GO:2000516 | positive regulation of CD4-positive, alpha-beta T cell activation(GO:2000516) |
0.1 | 0.1 | GO:1902202 | regulation of hepatocyte growth factor receptor signaling pathway(GO:1902202) |
0.1 | 0.6 | GO:0006450 | regulation of translational fidelity(GO:0006450) |
0.1 | 0.3 | GO:0002949 | tRNA threonylcarbamoyladenosine modification(GO:0002949) |
0.1 | 0.1 | GO:0032714 | negative regulation of interleukin-5 production(GO:0032714) |
0.1 | 0.3 | GO:1901252 | regulation of intracellular transport of viral material(GO:1901252) |
0.1 | 0.3 | GO:0007290 | spermatid nucleus elongation(GO:0007290) |
0.1 | 0.6 | GO:0051694 | pointed-end actin filament capping(GO:0051694) |
0.1 | 1.3 | GO:0001937 | negative regulation of endothelial cell proliferation(GO:0001937) |
0.1 | 0.1 | GO:0032667 | interleukin-23 production(GO:0032627) regulation of interleukin-23 production(GO:0032667) |
0.1 | 4.0 | GO:0043039 | tRNA aminoacylation for protein translation(GO:0006418) tRNA aminoacylation(GO:0043039) |
0.1 | 0.7 | GO:0002084 | protein depalmitoylation(GO:0002084) macromolecule depalmitoylation(GO:0098734) |
0.1 | 1.4 | GO:0034340 | response to type I interferon(GO:0034340) |
0.1 | 0.1 | GO:0097475 | motor neuron migration(GO:0097475) spinal cord motor neuron migration(GO:0097476) |
0.1 | 0.7 | GO:0072520 | seminiferous tubule development(GO:0072520) |
0.1 | 0.3 | GO:0010815 | bradykinin catabolic process(GO:0010815) |
0.1 | 1.6 | GO:0033003 | regulation of mast cell activation(GO:0033003) |
0.1 | 1.4 | GO:0072661 | protein targeting to plasma membrane(GO:0072661) |
0.1 | 1.4 | GO:0046827 | positive regulation of protein export from nucleus(GO:0046827) |
0.1 | 0.4 | GO:0015014 | heparan sulfate proteoglycan biosynthetic process, polysaccharide chain biosynthetic process(GO:0015014) |
0.1 | 1.7 | GO:0016339 | calcium-dependent cell-cell adhesion via plasma membrane cell adhesion molecules(GO:0016339) |
0.1 | 0.4 | GO:0007262 | STAT protein import into nucleus(GO:0007262) |
0.1 | 0.1 | GO:0002679 | respiratory burst involved in defense response(GO:0002679) |
0.1 | 1.0 | GO:0006968 | cellular defense response(GO:0006968) |
0.1 | 0.6 | GO:0045745 | positive regulation of G-protein coupled receptor protein signaling pathway(GO:0045745) |
0.1 | 0.3 | GO:0002093 | auditory receptor cell morphogenesis(GO:0002093) |
0.1 | 0.3 | GO:0003433 | chondrocyte development involved in endochondral bone morphogenesis(GO:0003433) |
0.1 | 0.3 | GO:2000810 | regulation of bicellular tight junction assembly(GO:2000810) |
0.1 | 0.3 | GO:0046386 | deoxyribose phosphate catabolic process(GO:0046386) |
0.1 | 0.9 | GO:0016926 | protein desumoylation(GO:0016926) |
0.1 | 0.5 | GO:0050861 | positive regulation of B cell receptor signaling pathway(GO:0050861) |
0.1 | 0.3 | GO:0051799 | negative regulation of hair follicle development(GO:0051799) |
0.1 | 2.0 | GO:0019835 | cytolysis(GO:0019835) |
0.1 | 0.7 | GO:0043562 | cellular response to nitrogen starvation(GO:0006995) cellular response to nitrogen levels(GO:0043562) |
0.1 | 0.3 | GO:0015884 | folic acid transport(GO:0015884) |
0.1 | 0.1 | GO:0045005 | DNA-dependent DNA replication maintenance of fidelity(GO:0045005) |
0.1 | 0.1 | GO:0002314 | germinal center B cell differentiation(GO:0002314) |
0.1 | 0.3 | GO:0032095 | regulation of response to food(GO:0032095) |
0.1 | 0.4 | GO:0061484 | hematopoietic stem cell homeostasis(GO:0061484) |
0.1 | 1.2 | GO:0006691 | leukotriene metabolic process(GO:0006691) |
0.1 | 0.7 | GO:0032105 | negative regulation of response to extracellular stimulus(GO:0032105) negative regulation of response to nutrient levels(GO:0032108) |
0.1 | 0.7 | GO:2000369 | regulation of clathrin-mediated endocytosis(GO:2000369) |
0.1 | 0.9 | GO:0018026 | peptidyl-lysine monomethylation(GO:0018026) |
0.1 | 0.5 | GO:0030540 | female genitalia development(GO:0030540) |
0.1 | 0.6 | GO:0006750 | glutathione biosynthetic process(GO:0006750) |
0.1 | 0.3 | GO:1902373 | negative regulation of mRNA catabolic process(GO:1902373) |
0.1 | 0.5 | GO:0042059 | negative regulation of epidermal growth factor receptor signaling pathway(GO:0042059) |
0.1 | 0.3 | GO:0048009 | insulin-like growth factor receptor signaling pathway(GO:0048009) |
0.1 | 0.5 | GO:0045579 | positive regulation of B cell differentiation(GO:0045579) |
0.1 | 0.1 | GO:0097709 | connective tissue replacement involved in inflammatory response wound healing(GO:0002248) connective tissue replacement(GO:0097709) |
0.1 | 0.5 | GO:0070306 | lens fiber cell differentiation(GO:0070306) |
0.1 | 0.1 | GO:0071907 | determination of digestive tract left/right asymmetry(GO:0071907) |
0.1 | 0.9 | GO:0006335 | DNA replication-dependent nucleosome assembly(GO:0006335) DNA replication-dependent nucleosome organization(GO:0034723) |
0.1 | 0.3 | GO:0060017 | parathyroid gland development(GO:0060017) |
0.1 | 0.1 | GO:2000489 | regulation of hepatic stellate cell activation(GO:2000489) |
0.1 | 0.8 | GO:0000083 | regulation of transcription involved in G1/S transition of mitotic cell cycle(GO:0000083) |
0.1 | 0.3 | GO:0010804 | negative regulation of tumor necrosis factor-mediated signaling pathway(GO:0010804) |
0.1 | 1.3 | GO:0046856 | phosphatidylinositol dephosphorylation(GO:0046856) |
0.1 | 0.3 | GO:0071554 | cell wall macromolecule metabolic process(GO:0044036) cell wall organization or biogenesis(GO:0071554) |
0.1 | 0.3 | GO:0051901 | positive regulation of mitochondrial depolarization(GO:0051901) |
0.1 | 0.1 | GO:0048241 | epinephrine transport(GO:0048241) |
0.1 | 0.4 | GO:2001214 | positive regulation of vasculogenesis(GO:2001214) |
0.1 | 0.1 | GO:0036016 | response to interleukin-3(GO:0036015) cellular response to interleukin-3(GO:0036016) |
0.1 | 0.4 | GO:0010874 | regulation of cholesterol efflux(GO:0010874) |
0.1 | 0.1 | GO:0060059 | embryonic retina morphogenesis in camera-type eye(GO:0060059) |
0.1 | 0.4 | GO:0070886 | positive regulation of calcineurin-NFAT signaling cascade(GO:0070886) |
0.1 | 0.4 | GO:1903146 | regulation of mitophagy(GO:1903146) |
0.1 | 0.5 | GO:0042554 | superoxide anion generation(GO:0042554) |
0.1 | 0.9 | GO:0042503 | tyrosine phosphorylation of Stat3 protein(GO:0042503) |
0.1 | 0.2 | GO:0097466 | glycoprotein ERAD pathway(GO:0097466) response to glycoprotein(GO:1904587) |
0.1 | 0.6 | GO:0033004 | negative regulation of mast cell activation(GO:0033004) |
0.1 | 0.4 | GO:2000651 | positive regulation of sodium ion transmembrane transporter activity(GO:2000651) |
0.1 | 1.1 | GO:0021889 | olfactory bulb interneuron differentiation(GO:0021889) |
0.1 | 0.6 | GO:0051382 | kinetochore assembly(GO:0051382) |
0.1 | 0.1 | GO:0042726 | flavin-containing compound metabolic process(GO:0042726) |
0.1 | 1.1 | GO:0007140 | male meiosis(GO:0007140) |
0.1 | 0.2 | GO:0042789 | mRNA transcription from RNA polymerase II promoter(GO:0042789) |
0.1 | 0.2 | GO:0060056 | mammary gland involution(GO:0060056) |
0.1 | 0.2 | GO:0010390 | histone monoubiquitination(GO:0010390) |
0.1 | 0.5 | GO:1902018 | negative regulation of cilium assembly(GO:1902018) |
0.1 | 0.1 | GO:0086046 | membrane depolarization during SA node cell action potential(GO:0086046) |
0.1 | 0.7 | GO:0048535 | lymph node development(GO:0048535) |
0.1 | 0.1 | GO:0035992 | tendon cell differentiation(GO:0035990) tendon formation(GO:0035992) |
0.1 | 0.1 | GO:0007619 | courtship behavior(GO:0007619) |
0.1 | 1.4 | GO:0015812 | gamma-aminobutyric acid transport(GO:0015812) |
0.1 | 0.2 | GO:0051771 | negative regulation of nitric-oxide synthase biosynthetic process(GO:0051771) |
0.1 | 0.2 | GO:0070318 | positive regulation of G0 to G1 transition(GO:0070318) |
0.1 | 0.6 | GO:0003301 | physiological muscle hypertrophy(GO:0003298) physiological cardiac muscle hypertrophy(GO:0003301) cell growth involved in cardiac muscle cell development(GO:0061049) |
0.1 | 0.1 | GO:0045738 | negative regulation of DNA repair(GO:0045738) |
0.1 | 0.4 | GO:0060023 | soft palate development(GO:0060023) |
0.1 | 0.1 | GO:0035622 | intrahepatic bile duct development(GO:0035622) |
0.1 | 0.2 | GO:0006167 | AMP biosynthetic process(GO:0006167) |
0.1 | 0.2 | GO:1903299 | regulation of glucokinase activity(GO:0033131) regulation of hexokinase activity(GO:1903299) |
0.1 | 0.1 | GO:0010840 | regulation of circadian sleep/wake cycle, wakefulness(GO:0010840) circadian sleep/wake cycle, wakefulness(GO:0042746) |
0.1 | 0.3 | GO:0042448 | progesterone metabolic process(GO:0042448) |
0.1 | 1.1 | GO:0043552 | positive regulation of phosphatidylinositol 3-kinase activity(GO:0043552) |
0.1 | 0.2 | GO:0031296 | B cell costimulation(GO:0031296) |
0.1 | 1.7 | GO:0051438 | regulation of ubiquitin-protein transferase activity(GO:0051438) |
0.1 | 0.8 | GO:1901071 | glucosamine-containing compound metabolic process(GO:1901071) |
0.1 | 0.5 | GO:0007549 | dosage compensation(GO:0007549) dosage compensation by inactivation of X chromosome(GO:0009048) |
0.1 | 0.6 | GO:0010613 | positive regulation of cardiac muscle hypertrophy(GO:0010613) positive regulation of muscle hypertrophy(GO:0014742) |
0.1 | 0.3 | GO:0007343 | egg activation(GO:0007343) |
0.1 | 0.1 | GO:0061086 | negative regulation of histone H3-K27 methylation(GO:0061086) |
0.1 | 0.3 | GO:0060290 | transdifferentiation(GO:0060290) |
0.1 | 0.2 | GO:2000826 | regulation of heart morphogenesis(GO:2000826) |
0.1 | 0.4 | GO:0061098 | positive regulation of protein tyrosine kinase activity(GO:0061098) |
0.1 | 0.6 | GO:0009235 | cobalamin metabolic process(GO:0009235) |
0.1 | 1.9 | GO:0006893 | Golgi to plasma membrane transport(GO:0006893) |
0.1 | 0.2 | GO:0018065 | protein-cofactor linkage(GO:0018065) |
0.1 | 2.1 | GO:0002437 | inflammatory response to antigenic stimulus(GO:0002437) |
0.1 | 0.1 | GO:1990144 | intrinsic apoptotic signaling pathway in response to hypoxia(GO:1990144) |
0.1 | 0.7 | GO:0043508 | negative regulation of JUN kinase activity(GO:0043508) |
0.1 | 0.2 | GO:0042138 | meiotic DNA double-strand break formation(GO:0042138) |
0.1 | 0.3 | GO:0006513 | protein monoubiquitination(GO:0006513) |
0.1 | 0.1 | GO:0019673 | GDP-mannose metabolic process(GO:0019673) |
0.1 | 0.2 | GO:0060060 | post-embryonic retina morphogenesis in camera-type eye(GO:0060060) |
0.1 | 1.3 | GO:0019915 | lipid storage(GO:0019915) |
0.1 | 0.3 | GO:1903887 | motile primary cilium assembly(GO:1903887) |
0.1 | 0.3 | GO:0070345 | negative regulation of fat cell proliferation(GO:0070345) |
0.1 | 0.2 | GO:0006553 | lysine metabolic process(GO:0006553) |
0.1 | 0.2 | GO:1900748 | positive regulation of vascular endothelial growth factor signaling pathway(GO:1900748) |
0.1 | 0.4 | GO:0033148 | positive regulation of intracellular estrogen receptor signaling pathway(GO:0033148) |
0.1 | 2.0 | GO:0051591 | response to cAMP(GO:0051591) |
0.1 | 0.1 | GO:0051029 | rRNA export from nucleus(GO:0006407) rRNA transport(GO:0051029) |
0.1 | 0.8 | GO:0051570 | regulation of histone H3-K9 methylation(GO:0051570) |
0.1 | 0.2 | GO:0070488 | neutrophil aggregation(GO:0070488) |
0.1 | 2.3 | GO:0031424 | keratinization(GO:0031424) |
0.1 | 0.1 | GO:0045723 | positive regulation of fatty acid biosynthetic process(GO:0045723) |
0.1 | 0.2 | GO:0061085 | regulation of histone H3-K27 methylation(GO:0061085) positive regulation of histone H3-K27 methylation(GO:0061087) |
0.1 | 0.2 | GO:0032227 | negative regulation of synaptic transmission, dopaminergic(GO:0032227) |
0.1 | 0.1 | GO:0003162 | atrioventricular node development(GO:0003162) |
0.1 | 0.8 | GO:0032515 | negative regulation of phosphoprotein phosphatase activity(GO:0032515) |
0.1 | 0.3 | GO:0044068 | modulation by symbiont of host cellular process(GO:0044068) |
0.1 | 0.2 | GO:0000491 | small nucleolar ribonucleoprotein complex assembly(GO:0000491) box C/D snoRNP assembly(GO:0000492) |
0.1 | 0.6 | GO:2001244 | positive regulation of intrinsic apoptotic signaling pathway(GO:2001244) |
0.1 | 0.1 | GO:0007228 | positive regulation of hh target transcription factor activity(GO:0007228) |
0.1 | 0.3 | GO:0035066 | positive regulation of histone acetylation(GO:0035066) |
0.1 | 1.3 | GO:1990403 | embryonic brain development(GO:1990403) |
0.1 | 0.3 | GO:0034724 | DNA replication-independent nucleosome assembly(GO:0006336) DNA replication-independent nucleosome organization(GO:0034724) |
0.1 | 0.1 | GO:0046102 | inosine metabolic process(GO:0046102) |
0.1 | 0.1 | GO:0051095 | regulation of helicase activity(GO:0051095) |
0.1 | 0.2 | GO:1900119 | positive regulation of execution phase of apoptosis(GO:1900119) |
0.1 | 0.4 | GO:0021942 | radial glia guided migration of Purkinje cell(GO:0021942) |
0.1 | 0.4 | GO:0000185 | activation of MAPKKK activity(GO:0000185) |
0.1 | 1.1 | GO:0007602 | phototransduction(GO:0007602) |
0.1 | 0.1 | GO:0090197 | positive regulation of chemokine secretion(GO:0090197) |
0.1 | 0.1 | GO:0090210 | regulation of establishment of blood-brain barrier(GO:0090210) |
0.1 | 0.5 | GO:0034508 | centromere complex assembly(GO:0034508) |
0.1 | 0.1 | GO:0042421 | norepinephrine biosynthetic process(GO:0042421) |
0.1 | 0.5 | GO:0042168 | heme metabolic process(GO:0042168) |
0.1 | 0.1 | GO:1903580 | positive regulation of nucleoside metabolic process(GO:0045979) positive regulation of ATP metabolic process(GO:1903580) |
0.1 | 0.2 | GO:0043174 | nucleoside salvage(GO:0043174) |
0.1 | 0.3 | GO:0097500 | receptor localization to nonmotile primary cilium(GO:0097500) |
0.1 | 3.9 | GO:0031338 | regulation of vesicle fusion(GO:0031338) |
0.1 | 0.9 | GO:0006614 | SRP-dependent cotranslational protein targeting to membrane(GO:0006614) |
0.1 | 0.1 | GO:0060700 | regulation of ribonuclease activity(GO:0060700) |
0.1 | 0.2 | GO:0042271 | susceptibility to natural killer cell mediated cytotoxicity(GO:0042271) |
0.1 | 0.3 | GO:0031936 | negative regulation of chromatin silencing(GO:0031936) |
0.1 | 1.4 | GO:0016180 | snRNA processing(GO:0016180) |
0.1 | 0.1 | GO:0007039 | protein catabolic process in the vacuole(GO:0007039) |
0.1 | 0.1 | GO:0043090 | amino acid import(GO:0043090) |
0.1 | 0.4 | GO:0090344 | negative regulation of cell aging(GO:0090344) |
0.1 | 0.2 | GO:0030951 | establishment or maintenance of microtubule cytoskeleton polarity(GO:0030951) |
0.1 | 0.3 | GO:0035608 | protein deglutamylation(GO:0035608) |
0.1 | 0.7 | GO:0006607 | NLS-bearing protein import into nucleus(GO:0006607) |
0.1 | 0.2 | GO:1990182 | exosomal secretion(GO:1990182) |
0.1 | 1.0 | GO:0002088 | lens development in camera-type eye(GO:0002088) |
0.1 | 0.9 | GO:0009649 | entrainment of circadian clock(GO:0009649) |
0.1 | 0.2 | GO:0002426 | immunoglobulin production in mucosal tissue(GO:0002426) |
0.1 | 0.1 | GO:0061047 | foregut regionalization(GO:0060423) lung field specification(GO:0060424) lung induction(GO:0060492) positive regulation of branching involved in lung morphogenesis(GO:0061047) |
0.1 | 0.2 | GO:0006760 | folic acid-containing compound metabolic process(GO:0006760) |
0.1 | 0.4 | GO:0045075 | interleukin-12 biosynthetic process(GO:0042090) regulation of interleukin-12 biosynthetic process(GO:0045075) |
0.1 | 0.4 | GO:0010838 | positive regulation of keratinocyte proliferation(GO:0010838) |
0.1 | 0.4 | GO:0002385 | mucosal immune response(GO:0002385) |
0.1 | 0.2 | GO:0014067 | negative regulation of phosphatidylinositol 3-kinase signaling(GO:0014067) |
0.1 | 0.1 | GO:0010936 | negative regulation of macrophage cytokine production(GO:0010936) |
0.1 | 0.3 | GO:0046686 | response to cadmium ion(GO:0046686) |
0.1 | 0.3 | GO:0048333 | mesodermal cell differentiation(GO:0048333) |
0.1 | 0.5 | GO:0014807 | regulation of somitogenesis(GO:0014807) |
0.1 | 0.2 | GO:0001916 | positive regulation of T cell mediated cytotoxicity(GO:0001916) |
0.1 | 0.3 | GO:0042074 | cell migration involved in gastrulation(GO:0042074) |
0.1 | 1.0 | GO:0045761 | regulation of adenylate cyclase activity(GO:0045761) |
0.1 | 0.1 | GO:0042866 | pyruvate biosynthetic process(GO:0042866) |
0.1 | 0.2 | GO:0007468 | regulation of rhodopsin gene expression(GO:0007468) |
0.1 | 0.1 | GO:0008594 | photoreceptor cell morphogenesis(GO:0008594) |
0.1 | 0.3 | GO:0090151 | establishment of protein localization to mitochondrial membrane(GO:0090151) |
0.1 | 0.1 | GO:0060373 | regulation of ventricular cardiac muscle cell membrane depolarization(GO:0060373) |
0.1 | 0.1 | GO:0032753 | positive regulation of interleukin-4 production(GO:0032753) |
0.1 | 0.2 | GO:0010637 | negative regulation of mitochondrial fusion(GO:0010637) |
0.1 | 0.5 | GO:0043248 | proteasome assembly(GO:0043248) |
0.1 | 0.1 | GO:1903677 | regulation of cap-independent translational initiation(GO:1903677) positive regulation of cap-independent translational initiation(GO:1903679) regulation of cytoplasmic translational initiation(GO:1904688) positive regulation of cytoplasmic translational initiation(GO:1904690) |
0.1 | 0.2 | GO:0090244 | Wnt signaling pathway involved in somitogenesis(GO:0090244) |
0.1 | 0.1 | GO:0032400 | melanosome localization(GO:0032400) |
0.1 | 4.5 | GO:0050691 | regulation of defense response to virus by host(GO:0050691) |
0.1 | 0.4 | GO:0032815 | negative regulation of natural killer cell activation(GO:0032815) |
0.1 | 0.1 | GO:0072602 | interleukin-4 secretion(GO:0072602) |
0.1 | 1.0 | GO:0030521 | androgen receptor signaling pathway(GO:0030521) |
0.1 | 0.2 | GO:0031062 | positive regulation of histone methylation(GO:0031062) |
0.1 | 0.1 | GO:0070782 | phosphatidylserine exposure on apoptotic cell surface(GO:0070782) |
0.1 | 0.9 | GO:0070098 | chemokine-mediated signaling pathway(GO:0070098) |
0.1 | 0.1 | GO:0046909 | intermembrane transport(GO:0046909) |
0.1 | 0.5 | GO:0031629 | synaptic vesicle fusion to presynaptic active zone membrane(GO:0031629) vesicle fusion to plasma membrane(GO:0099500) |
0.1 | 0.2 | GO:0032222 | regulation of synaptic transmission, cholinergic(GO:0032222) |
0.1 | 0.2 | GO:0042424 | catechol-containing compound catabolic process(GO:0019614) catecholamine catabolic process(GO:0042424) |
0.1 | 0.1 | GO:0030656 | regulation of vitamin metabolic process(GO:0030656) |
0.1 | 0.2 | GO:0043457 | regulation of cellular respiration(GO:0043457) |
0.1 | 0.3 | GO:0070633 | transepithelial transport(GO:0070633) |
0.1 | 0.1 | GO:0060751 | branch elongation involved in mammary gland duct branching(GO:0060751) |
0.1 | 0.2 | GO:0070164 | negative regulation of adiponectin secretion(GO:0070164) |
0.1 | 0.1 | GO:0002215 | defense response to nematode(GO:0002215) |
0.1 | 2.8 | GO:0002286 | T cell activation involved in immune response(GO:0002286) |
0.1 | 0.2 | GO:0042276 | error-prone translesion synthesis(GO:0042276) |
0.1 | 0.7 | GO:0048268 | clathrin coat assembly(GO:0048268) |
0.1 | 0.1 | GO:0018243 | protein O-linked glycosylation via threonine(GO:0018243) |
0.1 | 0.3 | GO:0019432 | triglyceride biosynthetic process(GO:0019432) |
0.1 | 1.4 | GO:0034605 | cellular response to heat(GO:0034605) |
0.1 | 0.3 | GO:0050915 | sensory perception of sour taste(GO:0050915) |
0.1 | 0.1 | GO:0002082 | regulation of oxidative phosphorylation(GO:0002082) |
0.1 | 0.1 | GO:1902969 | mitotic DNA replication(GO:1902969) |
0.1 | 0.4 | GO:0000060 | protein import into nucleus, translocation(GO:0000060) |
0.1 | 0.2 | GO:0046167 | glycerol-3-phosphate biosynthetic process(GO:0046167) |
0.1 | 0.1 | GO:0048318 | axial mesoderm development(GO:0048318) |
0.1 | 0.1 | GO:0098735 | positive regulation of the force of heart contraction(GO:0098735) |
0.1 | 0.1 | GO:0009886 | post-embryonic morphogenesis(GO:0009886) |
0.1 | 0.5 | GO:0045776 | negative regulation of blood pressure(GO:0045776) |
0.1 | 0.1 | GO:0009264 | deoxyribonucleotide catabolic process(GO:0009264) |
0.1 | 0.2 | GO:1904491 | protein localization to ciliary transition zone(GO:1904491) |
0.1 | 0.1 | GO:0044144 | regulation of growth of symbiont in host(GO:0044126) modulation of growth of symbiont involved in interaction with host(GO:0044144) |
0.1 | 0.1 | GO:0044786 | cell cycle DNA replication(GO:0044786) |
0.1 | 0.2 | GO:2000194 | regulation of female gonad development(GO:2000194) |
0.1 | 0.3 | GO:0007263 | nitric oxide mediated signal transduction(GO:0007263) |
0.1 | 0.1 | GO:0010039 | response to iron ion(GO:0010039) |
0.1 | 0.3 | GO:0034058 | endosomal vesicle fusion(GO:0034058) |
0.1 | 0.3 | GO:0051447 | negative regulation of meiotic cell cycle(GO:0051447) |
0.1 | 0.1 | GO:0045347 | negative regulation of MHC class II biosynthetic process(GO:0045347) |
0.1 | 0.1 | GO:0000098 | sulfur amino acid catabolic process(GO:0000098) |
0.1 | 0.1 | GO:0007199 | G-protein coupled receptor signaling pathway coupled to cGMP nucleotide second messenger(GO:0007199) |
0.1 | 0.2 | GO:2001224 | positive regulation of neuron migration(GO:2001224) |
0.1 | 0.3 | GO:0031987 | locomotion involved in locomotory behavior(GO:0031987) |
0.1 | 0.3 | GO:2000270 | negative regulation of fibroblast apoptotic process(GO:2000270) |
0.1 | 0.3 | GO:0043496 | regulation of protein homodimerization activity(GO:0043496) |
0.1 | 0.2 | GO:0002523 | leukocyte migration involved in inflammatory response(GO:0002523) |
0.1 | 0.1 | GO:2000172 | regulation of branching morphogenesis of a nerve(GO:2000172) |
0.1 | 1.6 | GO:0042035 | regulation of cytokine biosynthetic process(GO:0042035) |
0.1 | 0.1 | GO:0051882 | mitochondrial depolarization(GO:0051882) |
0.1 | 0.2 | GO:0071425 | hematopoietic stem cell proliferation(GO:0071425) |
0.1 | 0.1 | GO:0000722 | telomere maintenance via recombination(GO:0000722) |
0.1 | 0.1 | GO:0070071 | proton-transporting two-sector ATPase complex assembly(GO:0070071) |
0.1 | 0.1 | GO:0071397 | cellular response to sterol(GO:0036315) cellular response to cholesterol(GO:0071397) |
0.1 | 1.6 | GO:0071356 | cellular response to tumor necrosis factor(GO:0071356) |
0.1 | 0.1 | GO:0097499 | protein localization to nonmotile primary cilium(GO:0097499) |
0.1 | 0.2 | GO:0036260 | 7-methylguanosine RNA capping(GO:0009452) RNA capping(GO:0036260) |
0.1 | 0.1 | GO:0022030 | cerebral cortex radial glia guided migration(GO:0021801) telencephalon glial cell migration(GO:0022030) |
0.1 | 0.1 | GO:0008611 | ether lipid biosynthetic process(GO:0008611) glycerol ether biosynthetic process(GO:0046504) cellular lipid biosynthetic process(GO:0097384) ether biosynthetic process(GO:1901503) |
0.1 | 0.1 | GO:0030327 | prenylated protein catabolic process(GO:0030327) |
0.1 | 0.1 | GO:0006505 | GPI anchor metabolic process(GO:0006505) |
0.1 | 0.2 | GO:2000253 | positive regulation of feeding behavior(GO:2000253) |
0.1 | 0.1 | GO:0002322 | B cell proliferation involved in immune response(GO:0002322) |
0.1 | 0.1 | GO:1990928 | response to amino acid starvation(GO:1990928) |
0.1 | 0.3 | GO:0030101 | natural killer cell activation(GO:0030101) |
0.1 | 0.1 | GO:0009624 | response to nematode(GO:0009624) |
0.1 | 0.1 | GO:0060279 | positive regulation of ovulation(GO:0060279) |
0.1 | 0.2 | GO:0045589 | regulation of regulatory T cell differentiation(GO:0045589) |
0.1 | 0.3 | GO:0045948 | positive regulation of translational initiation(GO:0045948) |
0.1 | 0.5 | GO:1902572 | regulation of serine-type endopeptidase activity(GO:1900003) negative regulation of serine-type endopeptidase activity(GO:1900004) regulation of serine-type peptidase activity(GO:1902571) negative regulation of serine-type peptidase activity(GO:1902572) |
0.1 | 0.1 | GO:1904528 | regulation of microtubule binding(GO:1904526) positive regulation of microtubule binding(GO:1904528) |
0.1 | 1.3 | GO:0032436 | positive regulation of proteasomal ubiquitin-dependent protein catabolic process(GO:0032436) |
0.1 | 0.1 | GO:0042219 | cellular modified amino acid catabolic process(GO:0042219) |
0.1 | 0.4 | GO:0006308 | DNA catabolic process(GO:0006308) |
0.1 | 0.3 | GO:0006528 | asparagine metabolic process(GO:0006528) |
0.1 | 0.1 | GO:0021571 | rhombomere 5 development(GO:0021571) |
0.1 | 0.2 | GO:0018377 | protein myristoylation(GO:0018377) |
0.1 | 0.1 | GO:0060648 | mammary gland bud morphogenesis(GO:0060648) |
0.1 | 0.2 | GO:0051026 | chiasma assembly(GO:0051026) |
0.1 | 0.6 | GO:0001731 | formation of translation preinitiation complex(GO:0001731) |
0.1 | 0.1 | GO:0006610 | ribosomal protein import into nucleus(GO:0006610) |
0.1 | 0.1 | GO:0070243 | regulation of thymocyte apoptotic process(GO:0070243) |
0.1 | 0.1 | GO:0006363 | termination of RNA polymerase I transcription(GO:0006363) |
0.1 | 2.3 | GO:0010923 | negative regulation of phosphatase activity(GO:0010923) |
0.1 | 0.1 | GO:0010482 | epidermal cell division(GO:0010481) regulation of epidermal cell division(GO:0010482) |
0.1 | 0.2 | GO:0001779 | natural killer cell differentiation(GO:0001779) |
0.1 | 0.1 | GO:0036314 | response to sterol(GO:0036314) response to cholesterol(GO:0070723) |
0.1 | 0.1 | GO:1901491 | negative regulation of lymphangiogenesis(GO:1901491) |
0.1 | 0.3 | GO:0031643 | positive regulation of myelination(GO:0031643) |
0.1 | 0.2 | GO:0033147 | negative regulation of intracellular estrogen receptor signaling pathway(GO:0033147) |
0.1 | 0.1 | GO:0035235 | ionotropic glutamate receptor signaling pathway(GO:0035235) |
0.1 | 0.1 | GO:0021561 | facial nerve development(GO:0021561) facial nerve morphogenesis(GO:0021610) |
0.1 | 0.1 | GO:0019230 | proprioception(GO:0019230) |
0.1 | 0.6 | GO:0016578 | histone deubiquitination(GO:0016578) |
0.1 | 0.1 | GO:0036112 | medium-chain fatty-acyl-CoA metabolic process(GO:0036112) |
0.1 | 0.1 | GO:0021546 | rhombomere development(GO:0021546) |
0.1 | 0.2 | GO:0060216 | definitive hemopoiesis(GO:0060216) |
0.1 | 0.1 | GO:0018125 | peptidyl-cysteine methylation(GO:0018125) |
0.1 | 0.1 | GO:0030240 | skeletal muscle thin filament assembly(GO:0030240) |
0.1 | 0.1 | GO:0060022 | hard palate development(GO:0060022) |
0.1 | 0.1 | GO:0036462 | TRAIL-activated apoptotic signaling pathway(GO:0036462) |
0.1 | 2.2 | GO:0050909 | sensory perception of taste(GO:0050909) |
0.1 | 0.2 | GO:0002686 | negative regulation of leukocyte migration(GO:0002686) |
0.0 | 0.2 | GO:0016075 | rRNA catabolic process(GO:0016075) |
0.0 | 0.2 | GO:0006047 | UDP-N-acetylglucosamine metabolic process(GO:0006047) |
0.0 | 0.1 | GO:0031914 | negative regulation of synaptic plasticity(GO:0031914) |
0.0 | 0.0 | GO:0008216 | spermidine metabolic process(GO:0008216) |
0.0 | 0.3 | GO:0048664 | neuron fate determination(GO:0048664) |
0.0 | 0.1 | GO:0034311 | diol metabolic process(GO:0034311) |
0.0 | 0.0 | GO:0010940 | positive regulation of necrotic cell death(GO:0010940) |
0.0 | 0.1 | GO:0050798 | activated T cell proliferation(GO:0050798) |
0.0 | 0.6 | GO:0032012 | ARF protein signal transduction(GO:0032011) regulation of ARF protein signal transduction(GO:0032012) |
0.0 | 0.2 | GO:0070828 | heterochromatin organization(GO:0070828) |
0.0 | 0.1 | GO:0051125 | regulation of actin nucleation(GO:0051125) |
0.0 | 0.0 | GO:0010866 | regulation of triglyceride biosynthetic process(GO:0010866) |
0.0 | 0.3 | GO:0097028 | dendritic cell differentiation(GO:0097028) |
0.0 | 0.1 | GO:0003156 | regulation of organ formation(GO:0003156) |
0.0 | 0.4 | GO:0006829 | zinc II ion transport(GO:0006829) |
0.0 | 0.0 | GO:0045065 | cytotoxic T cell differentiation(GO:0045065) |
0.0 | 0.0 | GO:0032066 | nucleolus to nucleoplasm transport(GO:0032066) |
0.0 | 0.1 | GO:0032620 | interleukin-17 production(GO:0032620) |
0.0 | 0.0 | GO:0070444 | oligodendrocyte progenitor proliferation(GO:0070444) regulation of oligodendrocyte progenitor proliferation(GO:0070445) |
0.0 | 2.3 | GO:0043484 | regulation of RNA splicing(GO:0043484) |
0.0 | 0.1 | GO:0001865 | NK T cell differentiation(GO:0001865) |
0.0 | 0.2 | GO:0000160 | phosphorelay signal transduction system(GO:0000160) |
0.0 | 0.5 | GO:0060218 | hematopoietic stem cell differentiation(GO:0060218) |
0.0 | 0.1 | GO:0035234 | ectopic germ cell programmed cell death(GO:0035234) |
0.0 | 0.0 | GO:0006106 | fumarate metabolic process(GO:0006106) |
0.0 | 0.1 | GO:1903142 | positive regulation of endothelial cell development(GO:1901552) positive regulation of establishment of endothelial barrier(GO:1903142) |
0.0 | 0.1 | GO:0042126 | nitrate metabolic process(GO:0042126) |
0.0 | 0.1 | GO:2000143 | negative regulation of transcription initiation from RNA polymerase II promoter(GO:0060633) negative regulation of DNA-templated transcription, initiation(GO:2000143) |
0.0 | 0.1 | GO:0021527 | spinal cord association neuron differentiation(GO:0021527) |
0.0 | 0.0 | GO:0008355 | olfactory learning(GO:0008355) |
0.0 | 0.1 | GO:0090527 | actin filament reorganization(GO:0090527) |
0.0 | 0.0 | GO:0045023 | G0 to G1 transition(GO:0045023) regulation of G0 to G1 transition(GO:0070316) negative regulation of G0 to G1 transition(GO:0070317) |
0.0 | 0.1 | GO:0010807 | regulation of synaptic vesicle priming(GO:0010807) |
0.0 | 0.0 | GO:1905209 | positive regulation of cardiocyte differentiation(GO:1905209) |
0.0 | 0.9 | GO:0000027 | ribosomal large subunit assembly(GO:0000027) |
0.0 | 0.1 | GO:0051045 | negative regulation of membrane protein ectodomain proteolysis(GO:0051045) |
0.0 | 0.9 | GO:0046488 | phosphatidylinositol metabolic process(GO:0046488) |
0.0 | 0.0 | GO:0033684 | regulation of luteinizing hormone secretion(GO:0033684) |
0.0 | 0.1 | GO:1901164 | negative regulation of trophoblast cell migration(GO:1901164) |
0.0 | 0.1 | GO:0042756 | drinking behavior(GO:0042756) |
0.0 | 0.1 | GO:1902857 | positive regulation of nonmotile primary cilium assembly(GO:1902857) |
0.0 | 0.5 | GO:0050829 | defense response to Gram-negative bacterium(GO:0050829) |
0.0 | 0.2 | GO:0046718 | viral entry into host cell(GO:0046718) |
0.0 | 1.5 | GO:0017156 | calcium ion regulated exocytosis(GO:0017156) |
0.0 | 0.0 | GO:0051365 | cellular response to potassium ion starvation(GO:0051365) |
0.0 | 0.2 | GO:0070173 | regulation of enamel mineralization(GO:0070173) |
0.0 | 0.1 | GO:0075525 | viral translational termination-reinitiation(GO:0075525) |
0.0 | 0.2 | GO:0042403 | thyroid hormone metabolic process(GO:0042403) |
0.0 | 0.2 | GO:0045921 | positive regulation of exocytosis(GO:0045921) |
0.0 | 0.2 | GO:0035455 | response to interferon-alpha(GO:0035455) |
0.0 | 0.0 | GO:0035751 | regulation of lysosomal lumen pH(GO:0035751) |
0.0 | 0.0 | GO:0032621 | interleukin-18 production(GO:0032621) |
0.0 | 0.0 | GO:2000297 | negative regulation of synapse maturation(GO:2000297) |
0.0 | 0.1 | GO:0061303 | cornea development in camera-type eye(GO:0061303) |
0.0 | 0.0 | GO:0006624 | vacuolar protein processing(GO:0006624) |
0.0 | 0.1 | GO:0008635 | activation of cysteine-type endopeptidase activity involved in apoptotic process by cytochrome c(GO:0008635) |
0.0 | 0.0 | GO:0007341 | penetration of zona pellucida(GO:0007341) |
0.0 | 0.0 | GO:0033629 | negative regulation of cell adhesion mediated by integrin(GO:0033629) |
0.0 | 0.0 | GO:0046349 | amino sugar biosynthetic process(GO:0046349) |
0.0 | 0.3 | GO:1903859 | regulation of dendrite extension(GO:1903859) positive regulation of dendrite extension(GO:1903861) |
0.0 | 0.0 | GO:2001138 | regulation of phospholipid transport(GO:2001138) positive regulation of phospholipid transport(GO:2001140) |
0.0 | 0.1 | GO:0006684 | sphingomyelin metabolic process(GO:0006684) |
0.0 | 0.1 | GO:0030262 | cellular component disassembly involved in execution phase of apoptosis(GO:0006921) apoptotic nuclear changes(GO:0030262) |
0.0 | 0.0 | GO:0000966 | RNA 5'-end processing(GO:0000966) |
0.0 | 0.1 | GO:0050961 | detection of temperature stimulus involved in sensory perception(GO:0050961) detection of temperature stimulus involved in sensory perception of pain(GO:0050965) |
0.0 | 0.1 | GO:0052646 | alditol phosphate metabolic process(GO:0052646) |
0.0 | 0.1 | GO:0015747 | urate transport(GO:0015747) |
0.0 | 0.0 | GO:0060743 | epithelial cell maturation involved in prostate gland development(GO:0060743) |
0.0 | 0.0 | GO:1900120 | regulation of receptor binding(GO:1900120) |
0.0 | 0.0 | GO:0006600 | creatine metabolic process(GO:0006600) |
0.0 | 0.1 | GO:0072678 | T cell migration(GO:0072678) |
0.0 | 0.0 | GO:0006868 | glutamine transport(GO:0006868) |
0.0 | 0.1 | GO:0002017 | regulation of blood volume by renal aldosterone(GO:0002017) |
0.0 | 0.0 | GO:0033628 | regulation of cell adhesion mediated by integrin(GO:0033628) |
0.0 | 0.1 | GO:0071294 | cellular response to zinc ion(GO:0071294) |
0.0 | 0.1 | GO:0000394 | RNA splicing, via endonucleolytic cleavage and ligation(GO:0000394) tRNA splicing, via endonucleolytic cleavage and ligation(GO:0006388) |
0.0 | 0.3 | GO:0030641 | regulation of cellular pH(GO:0030641) |
0.0 | 0.3 | GO:0031146 | SCF-dependent proteasomal ubiquitin-dependent protein catabolic process(GO:0031146) |
0.0 | 0.1 | GO:0022010 | central nervous system myelination(GO:0022010) axon ensheathment in central nervous system(GO:0032291) |
0.0 | 0.0 | GO:0072366 | regulation of cellular ketone metabolic process by positive regulation of transcription from RNA polymerase II promoter(GO:0072366) |
0.0 | 0.0 | GO:0001992 | regulation of systemic arterial blood pressure by vasopressin(GO:0001992) |
0.0 | 0.0 | GO:0044818 | mitotic G2/M transition checkpoint(GO:0044818) |
0.0 | 6.8 | GO:0050907 | detection of chemical stimulus involved in sensory perception(GO:0050907) |
0.0 | 0.0 | GO:0042222 | interleukin-1 biosynthetic process(GO:0042222) |
0.0 | 0.1 | GO:0061146 | Peyer's patch morphogenesis(GO:0061146) |
0.0 | 0.1 | GO:0070389 | chaperone cofactor-dependent protein refolding(GO:0070389) |
0.0 | 0.0 | GO:0048254 | snoRNA localization(GO:0048254) |
0.0 | 0.1 | GO:0048853 | forebrain morphogenesis(GO:0048853) |
0.0 | 0.1 | GO:0046016 | positive regulation of transcription by glucose(GO:0046016) |
0.0 | 0.0 | GO:0046640 | regulation of alpha-beta T cell proliferation(GO:0046640) |
0.0 | 0.1 | GO:0072385 | minus-end-directed organelle transport along microtubule(GO:0072385) |
0.0 | 0.2 | GO:0044406 | adhesion of symbiont to host(GO:0044406) |
0.0 | 0.1 | GO:0017121 | phospholipid scrambling(GO:0017121) |
0.0 | 0.0 | GO:0045721 | negative regulation of gluconeogenesis(GO:0045721) |
0.0 | 0.0 | GO:0035582 | sequestering of BMP in extracellular matrix(GO:0035582) |
0.0 | 0.0 | GO:0032906 | transforming growth factor beta2 production(GO:0032906) regulation of transforming growth factor beta2 production(GO:0032909) |
0.0 | 0.0 | GO:1904263 | positive regulation of TORC1 signaling(GO:1904263) |
0.0 | 0.0 | GO:0060528 | secretory columnal luminar epithelial cell differentiation involved in prostate glandular acinus development(GO:0060528) |
0.0 | 0.1 | GO:0006301 | postreplication repair(GO:0006301) |
0.0 | 0.2 | GO:0006122 | mitochondrial electron transport, ubiquinol to cytochrome c(GO:0006122) |
0.0 | 0.0 | GO:0071428 | rRNA-containing ribonucleoprotein complex export from nucleus(GO:0071428) |
0.0 | 0.3 | GO:0006491 | N-glycan processing(GO:0006491) |
0.0 | 0.1 | GO:0002717 | positive regulation of natural killer cell mediated immunity(GO:0002717) |
0.0 | 0.4 | GO:0006024 | glycosaminoglycan biosynthetic process(GO:0006024) |
0.0 | 0.1 | GO:0000380 | alternative mRNA splicing, via spliceosome(GO:0000380) |
0.0 | 0.0 | GO:0071218 | cellular response to misfolded protein(GO:0071218) |
0.0 | 0.0 | GO:0061032 | visceral serous pericardium development(GO:0061032) |
0.0 | 0.1 | GO:0006957 | complement activation, alternative pathway(GO:0006957) |
0.0 | 0.1 | GO:0003376 | sphingosine-1-phosphate signaling pathway(GO:0003376) |
0.0 | 0.0 | GO:0007220 | Notch receptor processing(GO:0007220) |
0.0 | 0.0 | GO:0030260 | entry into host cell(GO:0030260) entry into host(GO:0044409) entry into cell of other organism involved in symbiotic interaction(GO:0051806) entry into other organism involved in symbiotic interaction(GO:0051828) |
0.0 | 0.0 | GO:0010499 | proteasomal ubiquitin-independent protein catabolic process(GO:0010499) |
0.0 | 0.1 | GO:0000920 | cell separation after cytokinesis(GO:0000920) |
0.0 | 0.0 | GO:0042119 | neutrophil activation(GO:0042119) |
0.0 | 2.2 | GO:0019236 | response to pheromone(GO:0019236) |
0.0 | 0.0 | GO:0060416 | response to growth hormone(GO:0060416) |
0.0 | 0.1 | GO:0051180 | vitamin transport(GO:0051180) |
0.0 | 0.1 | GO:0015670 | carbon dioxide transport(GO:0015670) |
0.0 | 0.3 | GO:0008277 | regulation of G-protein coupled receptor protein signaling pathway(GO:0008277) |
0.0 | 0.1 | GO:0032695 | negative regulation of interleukin-12 production(GO:0032695) |
0.0 | 0.2 | GO:0043297 | apical junction assembly(GO:0043297) |
0.0 | 0.0 | GO:2000598 | regulation of cyclin catabolic process(GO:2000598) negative regulation of cyclin catabolic process(GO:2000599) |
0.0 | 0.3 | GO:0006182 | cGMP biosynthetic process(GO:0006182) |
0.0 | 0.0 | GO:0046469 | platelet activating factor biosynthetic process(GO:0006663) platelet activating factor metabolic process(GO:0046469) |
0.0 | 0.1 | GO:0015671 | oxygen transport(GO:0015671) |
0.0 | 0.0 | GO:0032497 | detection of lipopolysaccharide(GO:0032497) |
0.0 | 0.1 | GO:0090400 | stress-induced premature senescence(GO:0090400) |
0.0 | 0.5 | GO:0002474 | antigen processing and presentation of peptide antigen via MHC class I(GO:0002474) |
0.0 | 0.0 | GO:0051388 | positive regulation of neurotrophin TRK receptor signaling pathway(GO:0051388) |
0.0 | 0.0 | GO:0043584 | nose development(GO:0043584) |
0.0 | 0.0 | GO:0006655 | phosphatidylglycerol biosynthetic process(GO:0006655) |
0.0 | 0.0 | GO:0002934 | desmosome organization(GO:0002934) |
0.0 | 0.0 | GO:0006517 | protein deglycosylation(GO:0006517) |
0.0 | 0.0 | GO:0044791 | modulation by host of viral release from host cell(GO:0044789) positive regulation by host of viral release from host cell(GO:0044791) |
0.0 | 0.0 | GO:1903525 | regulation of membrane tubulation(GO:1903525) |
0.0 | 0.0 | GO:0060177 | regulation of angiotensin metabolic process(GO:0060177) |
0.0 | 0.1 | GO:0035825 | reciprocal meiotic recombination(GO:0007131) reciprocal DNA recombination(GO:0035825) |
0.0 | 0.0 | GO:0021781 | glial cell fate commitment(GO:0021781) |
0.0 | 0.0 | GO:0007398 | ectoderm development(GO:0007398) |
0.0 | 0.0 | GO:0060586 | multicellular organismal iron ion homeostasis(GO:0060586) |
0.0 | 0.1 | GO:0034720 | histone H3-K4 demethylation(GO:0034720) |
0.0 | 0.0 | GO:0006361 | transcription initiation from RNA polymerase I promoter(GO:0006361) |
0.0 | 0.0 | GO:0071873 | response to norepinephrine(GO:0071873) |
0.0 | 0.0 | GO:1901419 | regulation of response to alcohol(GO:1901419) |
0.0 | 0.3 | GO:0008654 | phospholipid biosynthetic process(GO:0008654) |
0.0 | 0.0 | GO:0036037 | CD8-positive, alpha-beta T cell activation(GO:0036037) |
0.0 | 0.0 | GO:0014827 | intestine smooth muscle contraction(GO:0014827) |
0.0 | 0.0 | GO:2000574 | regulation of microtubule motor activity(GO:2000574) |
0.0 | 0.0 | GO:0032786 | positive regulation of DNA-templated transcription, elongation(GO:0032786) |
0.0 | 0.0 | GO:0060707 | trophoblast giant cell differentiation(GO:0060707) |
0.0 | 0.0 | GO:0031573 | intra-S DNA damage checkpoint(GO:0031573) |
0.0 | 0.0 | GO:0030035 | microspike assembly(GO:0030035) |
0.0 | 0.0 | GO:0070233 | negative regulation of T cell apoptotic process(GO:0070233) |
0.0 | 0.1 | GO:0060575 | intestinal epithelial cell differentiation(GO:0060575) |
0.0 | 0.0 | GO:0010661 | positive regulation of muscle cell apoptotic process(GO:0010661) |
0.0 | 0.0 | GO:2000834 | androgen secretion(GO:0035935) regulation of androgen secretion(GO:2000834) positive regulation of androgen secretion(GO:2000836) |
0.0 | 0.0 | GO:0014835 | myoblast differentiation involved in skeletal muscle regeneration(GO:0014835) |
0.0 | 0.2 | GO:0043252 | sodium-independent organic anion transport(GO:0043252) |
0.0 | 0.0 | GO:0071480 | cellular response to gamma radiation(GO:0071480) |
0.0 | 0.0 | GO:1901187 | regulation of ephrin receptor signaling pathway(GO:1901187) |
0.0 | 0.0 | GO:0070365 | hepatocyte differentiation(GO:0070365) |
0.0 | 0.0 | GO:0043650 | dicarboxylic acid biosynthetic process(GO:0043650) |
0.0 | 0.0 | GO:0097211 | response to gonadotropin-releasing hormone(GO:0097210) cellular response to gonadotropin-releasing hormone(GO:0097211) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
4.5 | 18.1 | GO:0034363 | intermediate-density lipoprotein particle(GO:0034363) |
4.3 | 21.7 | GO:0031838 | haptoglobin-hemoglobin complex(GO:0031838) |
3.9 | 23.6 | GO:0072557 | IPAF inflammasome complex(GO:0072557) |
3.5 | 27.7 | GO:0045179 | apical cortex(GO:0045179) |
3.3 | 6.6 | GO:0034365 | discoidal high-density lipoprotein particle(GO:0034365) |
3.1 | 15.5 | GO:0016461 | unconventional myosin complex(GO:0016461) |
3.0 | 30.3 | GO:0046581 | intercellular canaliculus(GO:0046581) |
2.9 | 8.8 | GO:0043198 | dendritic shaft(GO:0043198) |
2.5 | 15.0 | GO:0070775 | H3 histone acetyltransferase complex(GO:0070775) MOZ/MORF histone acetyltransferase complex(GO:0070776) |
2.0 | 5.9 | GO:0070552 | BRISC complex(GO:0070552) |
1.9 | 15.2 | GO:0001650 | fibrillar center(GO:0001650) |
1.7 | 8.3 | GO:0031315 | extrinsic component of mitochondrial outer membrane(GO:0031315) |
1.6 | 4.8 | GO:0071664 | catenin-TCF7L2 complex(GO:0071664) |
1.6 | 6.4 | GO:0000836 | ER ubiquitin ligase complex(GO:0000835) Hrd1p ubiquitin ligase complex(GO:0000836) |
1.6 | 7.8 | GO:1990712 | HFE-transferrin receptor complex(GO:1990712) |
1.5 | 4.5 | GO:0044393 | microspike(GO:0044393) |
1.5 | 4.5 | GO:0036396 | MIS complex(GO:0036396) |
1.4 | 4.1 | GO:0005745 | m-AAA complex(GO:0005745) |
1.3 | 5.3 | GO:0030868 | smooth endoplasmic reticulum membrane(GO:0030868) smooth endoplasmic reticulum part(GO:0097425) |
1.3 | 6.3 | GO:0000275 | mitochondrial proton-transporting ATP synthase complex, catalytic core F(1)(GO:0000275) proton-transporting ATP synthase complex, catalytic core F(1)(GO:0045261) |
1.3 | 3.8 | GO:0031523 | Myb complex(GO:0031523) |
1.2 | 6.1 | GO:0005663 | DNA replication factor C complex(GO:0005663) |
1.2 | 10.6 | GO:0097470 | ribbon synapse(GO:0097470) |
1.2 | 4.7 | GO:0071256 | Sec61 translocon complex(GO:0005784) translocon complex(GO:0071256) |
1.1 | 3.4 | GO:0042612 | MHC class I protein complex(GO:0042612) |
1.1 | 4.5 | GO:0072487 | MSL complex(GO:0072487) |
1.1 | 7.9 | GO:0043219 | lateral loop(GO:0043219) |
1.1 | 4.3 | GO:0070937 | CRD-mediated mRNA stability complex(GO:0070937) |
1.1 | 2.1 | GO:0031313 | extrinsic component of endosome membrane(GO:0031313) |
1.1 | 3.2 | GO:0036488 | CHOP-C/EBP complex(GO:0036488) |
1.0 | 4.0 | GO:1990316 | ATG1/ULK1 kinase complex(GO:1990316) |
1.0 | 4.0 | GO:0031618 | nuclear pericentric heterochromatin(GO:0031618) |
1.0 | 2.0 | GO:0000813 | ESCRT I complex(GO:0000813) |
1.0 | 7.8 | GO:0030056 | hemidesmosome(GO:0030056) |
0.9 | 2.8 | GO:0097543 | ciliary inversin compartment(GO:0097543) |
0.9 | 3.7 | GO:1990130 | Iml1 complex(GO:1990130) |
0.9 | 2.7 | GO:0032127 | dense core granule membrane(GO:0032127) |
0.9 | 1.8 | GO:0032133 | chromosome passenger complex(GO:0032133) |
0.9 | 1.8 | GO:0002102 | podosome(GO:0002102) |
0.9 | 5.2 | GO:1990454 | L-type voltage-gated calcium channel complex(GO:1990454) |
0.9 | 2.6 | GO:0005967 | mitochondrial pyruvate dehydrogenase complex(GO:0005967) |
0.9 | 2.6 | GO:0000110 | nucleotide-excision repair factor 1 complex(GO:0000110) |
0.9 | 2.6 | GO:0097418 | neurofibrillary tangle(GO:0097418) |
0.8 | 5.9 | GO:0000788 | nuclear nucleosome(GO:0000788) |
0.8 | 5.8 | GO:0036056 | filtration diaphragm(GO:0036056) slit diaphragm(GO:0036057) |
0.8 | 0.8 | GO:0070522 | ERCC4-ERCC1 complex(GO:0070522) |
0.8 | 18.5 | GO:0000407 | pre-autophagosomal structure(GO:0000407) |
0.8 | 3.2 | GO:0044462 | cell outer membrane(GO:0009279) cell envelope(GO:0030313) external encapsulating structure part(GO:0044462) |
0.8 | 5.6 | GO:0097197 | tetraspanin-enriched microdomain(GO:0097197) |
0.8 | 3.2 | GO:0030121 | AP-1 adaptor complex(GO:0030121) |
0.8 | 2.4 | GO:0030981 | cortical microtubule cytoskeleton(GO:0030981) |
0.8 | 3.9 | GO:0033093 | Weibel-Palade body(GO:0033093) |
0.8 | 3.9 | GO:0005927 | muscle tendon junction(GO:0005927) |
0.8 | 3.9 | GO:0005579 | membrane attack complex(GO:0005579) |
0.8 | 3.1 | GO:0070876 | SOSS complex(GO:0070876) |
0.8 | 2.3 | GO:0042719 | mitochondrial intermembrane space protein transporter complex(GO:0042719) |
0.7 | 24.6 | GO:0010494 | cytoplasmic stress granule(GO:0010494) |
0.7 | 4.5 | GO:0005915 | zonula adherens(GO:0005915) |
0.7 | 3.0 | GO:0005947 | mitochondrial alpha-ketoglutarate dehydrogenase complex(GO:0005947) |
0.7 | 2.2 | GO:1990923 | PET complex(GO:1990923) |
0.7 | 1.5 | GO:0034666 | integrin alpha2-beta1 complex(GO:0034666) |
0.7 | 11.0 | GO:0070971 | endoplasmic reticulum exit site(GO:0070971) |
0.7 | 4.4 | GO:0030134 | ER to Golgi transport vesicle(GO:0030134) |
0.7 | 2.2 | GO:0044316 | cone cell pedicle(GO:0044316) |
0.7 | 2.2 | GO:0001651 | dense fibrillar component(GO:0001651) |
0.7 | 3.6 | GO:0042765 | GPI-anchor transamidase complex(GO:0042765) |
0.7 | 10.8 | GO:0000177 | cytoplasmic exosome (RNase complex)(GO:0000177) |
0.7 | 3.6 | GO:0033063 | Rad51B-Rad51C-Rad51D-XRCC2 complex(GO:0033063) |
0.7 | 5.0 | GO:0016363 | nuclear matrix(GO:0016363) |
0.7 | 0.7 | GO:0005833 | hemoglobin complex(GO:0005833) |
0.7 | 2.1 | GO:0005658 | alpha DNA polymerase:primase complex(GO:0005658) |
0.7 | 1.4 | GO:0097513 | myosin II filament(GO:0097513) |
0.7 | 4.2 | GO:0031415 | NatA complex(GO:0031415) |
0.7 | 1.4 | GO:0097451 | glial limiting end-foot(GO:0097451) |
0.7 | 2.1 | GO:0097648 | G-protein coupled receptor dimeric complex(GO:0038037) G-protein coupled receptor complex(GO:0097648) |
0.7 | 4.1 | GO:0014731 | spectrin-associated cytoskeleton(GO:0014731) |
0.7 | 4.7 | GO:0005688 | U6 snRNP(GO:0005688) |
0.7 | 4.7 | GO:0042627 | chylomicron(GO:0042627) |
0.7 | 2.0 | GO:0032937 | SREBP-SCAP-Insig complex(GO:0032937) |
0.7 | 5.3 | GO:0000506 | glycosylphosphatidylinositol-N-acetylglucosaminyltransferase (GPI-GnT) complex(GO:0000506) |
0.7 | 3.9 | GO:0042587 | glycogen granule(GO:0042587) |
0.6 | 1.9 | GO:0030891 | VCB complex(GO:0030891) |
0.6 | 11.6 | GO:0030904 | retromer complex(GO:0030904) |
0.6 | 4.5 | GO:0000439 | core TFIIH complex(GO:0000439) |
0.6 | 2.6 | GO:0031254 | uropod(GO:0001931) cell trailing edge(GO:0031254) |
0.6 | 1.3 | GO:0072558 | NLRP1 inflammasome complex(GO:0072558) |
0.6 | 15.2 | GO:0008305 | integrin complex(GO:0008305) |
0.6 | 1.2 | GO:0030062 | mitochondrial tricarboxylic acid cycle enzyme complex(GO:0030062) |
0.6 | 3.1 | GO:0031232 | extrinsic component of external side of plasma membrane(GO:0031232) |
0.6 | 1.9 | GO:0097504 | Gemini of coiled bodies(GO:0097504) |
0.6 | 3.1 | GO:0005683 | U7 snRNP(GO:0005683) |
0.6 | 9.2 | GO:0043218 | compact myelin(GO:0043218) |
0.6 | 1.2 | GO:0030119 | AP-type membrane coat adaptor complex(GO:0030119) |
0.6 | 2.4 | GO:0032541 | cortical endoplasmic reticulum(GO:0032541) |
0.6 | 6.0 | GO:0002178 | palmitoyltransferase complex(GO:0002178) |
0.6 | 5.4 | GO:0044327 | dendritic spine head(GO:0044327) |
0.6 | 2.4 | GO:0071141 | SMAD protein complex(GO:0071141) |
0.6 | 4.2 | GO:0008290 | F-actin capping protein complex(GO:0008290) |
0.6 | 7.7 | GO:0031430 | M band(GO:0031430) |
0.6 | 10.0 | GO:0043034 | costamere(GO:0043034) |
0.6 | 5.3 | GO:0031143 | pseudopodium(GO:0031143) |
0.6 | 1.8 | GO:0043259 | laminin-10 complex(GO:0043259) |
0.6 | 5.8 | GO:0031512 | motile primary cilium(GO:0031512) |
0.6 | 1.7 | GO:1990635 | proximal dendrite(GO:1990635) |
0.6 | 4.6 | GO:0008385 | IkappaB kinase complex(GO:0008385) |
0.6 | 4.6 | GO:0012507 | ER to Golgi transport vesicle membrane(GO:0012507) |
0.6 | 2.2 | GO:0002189 | ribose phosphate diphosphokinase complex(GO:0002189) |
0.6 | 1.1 | GO:0005770 | late endosome(GO:0005770) |
0.6 | 8.9 | GO:0097225 | sperm midpiece(GO:0097225) |
0.6 | 0.6 | GO:0097413 | Lewy body(GO:0097413) |
0.6 | 1.7 | GO:0048476 | Holliday junction resolvase complex(GO:0048476) |
0.6 | 1.7 | GO:0043202 | lysosomal lumen(GO:0043202) |
0.5 | 3.3 | GO:0098553 | integral component of cytoplasmic side of endoplasmic reticulum membrane(GO:0071458) integral component of lumenal side of endoplasmic reticulum membrane(GO:0071556) lumenal side of endoplasmic reticulum membrane(GO:0098553) |
0.5 | 23.4 | GO:0030173 | integral component of Golgi membrane(GO:0030173) intrinsic component of Golgi membrane(GO:0031228) |
0.5 | 1.6 | GO:0031092 | platelet alpha granule membrane(GO:0031092) |
0.5 | 2.6 | GO:0005638 | lamin filament(GO:0005638) |
0.5 | 2.1 | GO:0008622 | epsilon DNA polymerase complex(GO:0008622) |
0.5 | 3.1 | GO:0070688 | MLL5-L complex(GO:0070688) |
0.5 | 2.0 | GO:0000214 | tRNA-intron endonuclease complex(GO:0000214) |
0.5 | 0.5 | GO:0020016 | ciliary pocket(GO:0020016) ciliary pocket membrane(GO:0020018) |
0.5 | 4.1 | GO:0097208 | alveolar lamellar body(GO:0097208) |
0.5 | 2.0 | GO:1990716 | axonemal central apparatus(GO:1990716) |
0.5 | 0.5 | GO:0030662 | coated vesicle membrane(GO:0030662) |
0.5 | 1.5 | GO:0030670 | phagocytic vesicle membrane(GO:0030670) |
0.5 | 0.5 | GO:0005832 | chaperonin-containing T-complex(GO:0005832) |
0.5 | 3.4 | GO:0016600 | flotillin complex(GO:0016600) |
0.5 | 4.9 | GO:0048188 | Set1C/COMPASS complex(GO:0048188) |
0.5 | 3.4 | GO:0016593 | Cdc73/Paf1 complex(GO:0016593) |
0.5 | 0.5 | GO:0043194 | axon initial segment(GO:0043194) axon hillock(GO:0043203) |
0.5 | 6.3 | GO:0005640 | nuclear outer membrane(GO:0005640) |
0.5 | 2.9 | GO:0070847 | core mediator complex(GO:0070847) |
0.5 | 2.4 | GO:0005675 | holo TFIIH complex(GO:0005675) |
0.5 | 1.4 | GO:0005742 | mitochondrial outer membrane translocase complex(GO:0005742) |
0.5 | 3.3 | GO:0031588 | nucleotide-activated protein kinase complex(GO:0031588) |
0.5 | 1.9 | GO:0033553 | rDNA heterochromatin(GO:0033553) |
0.5 | 1.9 | GO:0030015 | CCR4-NOT core complex(GO:0030015) |
0.5 | 42.1 | GO:0072562 | blood microparticle(GO:0072562) |
0.5 | 6.4 | GO:0016327 | apicolateral plasma membrane(GO:0016327) |
0.5 | 2.7 | GO:0005885 | Arp2/3 protein complex(GO:0005885) |
0.4 | 1.3 | GO:0033186 | CAF-1 complex(GO:0033186) |
0.4 | 1.3 | GO:0060091 | kinocilium(GO:0060091) |
0.4 | 3.1 | GO:0033180 | proton-transporting V-type ATPase, V1 domain(GO:0033180) |
0.4 | 1.3 | GO:0000176 | nuclear exosome (RNase complex)(GO:0000176) |
0.4 | 0.4 | GO:0043293 | apoptosome(GO:0043293) |
0.4 | 2.2 | GO:0012510 | trans-Golgi network transport vesicle membrane(GO:0012510) |
0.4 | 1.7 | GO:1990604 | IRE1-TRAF2-ASK1 complex(GO:1990604) |
0.4 | 8.1 | GO:0030660 | Golgi-associated vesicle membrane(GO:0030660) |
0.4 | 4.7 | GO:0030014 | CCR4-NOT complex(GO:0030014) |
0.4 | 2.1 | GO:0034388 | Pwp2p-containing subcomplex of 90S preribosome(GO:0034388) |
0.4 | 10.2 | GO:0005637 | nuclear inner membrane(GO:0005637) |
0.4 | 1.6 | GO:0034992 | microtubule organizing center attachment site(GO:0034992) LINC complex(GO:0034993) |
0.4 | 16.6 | GO:0005657 | replication fork(GO:0005657) |
0.4 | 1.6 | GO:0031094 | platelet dense tubular network(GO:0031094) |
0.4 | 10.4 | GO:0005891 | voltage-gated calcium channel complex(GO:0005891) |
0.4 | 5.1 | GO:0036038 | MKS complex(GO:0036038) |
0.4 | 5.5 | GO:0071565 | nBAF complex(GO:0071565) |
0.4 | 1.5 | GO:0098536 | deuterosome(GO:0098536) |
0.4 | 8.5 | GO:0009925 | basal plasma membrane(GO:0009925) |
0.4 | 1.2 | GO:0097542 | ciliary tip(GO:0097542) |
0.4 | 5.7 | GO:0043196 | varicosity(GO:0043196) |
0.4 | 0.8 | GO:0071439 | clathrin complex(GO:0071439) |
0.4 | 6.8 | GO:0000932 | cytoplasmic mRNA processing body(GO:0000932) |
0.4 | 1.9 | GO:0097546 | ciliary base(GO:0097546) |
0.4 | 3.0 | GO:0005869 | dynactin complex(GO:0005869) |
0.4 | 7.5 | GO:0005680 | anaphase-promoting complex(GO:0005680) |
0.4 | 2.2 | GO:0030057 | desmosome(GO:0030057) |
0.4 | 4.4 | GO:0031616 | spindle pole centrosome(GO:0031616) |
0.4 | 2.9 | GO:0036156 | inner dynein arm(GO:0036156) |
0.4 | 1.4 | GO:0033162 | melanosome membrane(GO:0033162) chitosome(GO:0045009) |
0.4 | 1.4 | GO:0071598 | neuronal ribonucleoprotein granule(GO:0071598) |
0.4 | 3.2 | GO:0000974 | Prp19 complex(GO:0000974) |
0.4 | 4.3 | GO:0010008 | endosome membrane(GO:0010008) |
0.4 | 6.1 | GO:0005782 | peroxisomal matrix(GO:0005782) microbody lumen(GO:0031907) |
0.4 | 1.1 | GO:0044322 | endoplasmic reticulum quality control compartment(GO:0044322) |
0.4 | 0.7 | GO:0005914 | spot adherens junction(GO:0005914) |
0.4 | 0.4 | GO:0000125 | PCAF complex(GO:0000125) |
0.4 | 3.2 | GO:0031528 | microvillus membrane(GO:0031528) |
0.4 | 7.4 | GO:0005865 | striated muscle thin filament(GO:0005865) |
0.4 | 0.7 | GO:0048179 | activin receptor complex(GO:0048179) |
0.4 | 2.8 | GO:0000242 | pericentriolar material(GO:0000242) |
0.4 | 1.1 | GO:0034362 | low-density lipoprotein particle(GO:0034362) |
0.3 | 1.4 | GO:0045298 | tubulin complex(GO:0045298) |
0.3 | 0.7 | GO:0097025 | MPP7-DLG1-LIN7 complex(GO:0097025) |
0.3 | 2.7 | GO:0032797 | SMN complex(GO:0032797) |
0.3 | 2.4 | GO:0031045 | dense core granule(GO:0031045) |
0.3 | 2.4 | GO:0005883 | neurofilament(GO:0005883) |
0.3 | 1.4 | GO:0042406 | extrinsic component of endoplasmic reticulum membrane(GO:0042406) |
0.3 | 1.0 | GO:0031258 | lamellipodium membrane(GO:0031258) |
0.3 | 1.3 | GO:0036454 | insulin-like growth factor binding protein complex(GO:0016942) growth factor complex(GO:0036454) insulin-like growth factor ternary complex(GO:0042567) |
0.3 | 4.0 | GO:0060293 | P granule(GO:0043186) pole plasm(GO:0045495) germ plasm(GO:0060293) |
0.3 | 0.7 | GO:0005687 | U4 snRNP(GO:0005687) |
0.3 | 20.0 | GO:0030136 | clathrin-coated vesicle(GO:0030136) |
0.3 | 1.9 | GO:0005952 | cAMP-dependent protein kinase complex(GO:0005952) |
0.3 | 3.2 | GO:0000783 | telomere cap complex(GO:0000782) nuclear telomere cap complex(GO:0000783) |
0.3 | 38.0 | GO:0042579 | peroxisome(GO:0005777) microbody(GO:0042579) |
0.3 | 8.3 | GO:0005788 | endoplasmic reticulum lumen(GO:0005788) |
0.3 | 0.9 | GO:0036194 | muscle cell projection(GO:0036194) muscle cell projection membrane(GO:0036195) |
0.3 | 9.1 | GO:0016328 | lateral plasma membrane(GO:0016328) |
0.3 | 3.7 | GO:0031083 | BLOC-1 complex(GO:0031083) |
0.3 | 1.5 | GO:0035327 | transcriptionally active chromatin(GO:0035327) |
0.3 | 0.6 | GO:0000220 | vacuolar proton-transporting V-type ATPase, V0 domain(GO:0000220) |
0.3 | 1.2 | GO:0097209 | epidermal lamellar body(GO:0097209) |
0.3 | 14.8 | GO:0005811 | lipid particle(GO:0005811) |
0.3 | 3.0 | GO:0065010 | extracellular membrane-bounded organelle(GO:0065010) |
0.3 | 3.9 | GO:0001891 | phagocytic cup(GO:0001891) |
0.3 | 14.0 | GO:0030863 | cortical cytoskeleton(GO:0030863) |
0.3 | 6.8 | GO:0055038 | recycling endosome membrane(GO:0055038) |
0.3 | 3.2 | GO:0071004 | U2-type prespliceosome(GO:0071004) |
0.3 | 2.3 | GO:0000812 | Swr1 complex(GO:0000812) |
0.3 | 0.6 | GO:0044352 | pinosome(GO:0044352) macropinosome(GO:0044354) |
0.3 | 2.9 | GO:0032039 | integrator complex(GO:0032039) |
0.3 | 3.8 | GO:0035371 | microtubule plus-end(GO:0035371) |
0.3 | 2.3 | GO:0042589 | zymogen granule membrane(GO:0042589) |
0.3 | 4.3 | GO:0005719 | nuclear euchromatin(GO:0005719) |
0.3 | 2.0 | GO:1904115 | axon cytoplasm(GO:1904115) |
0.3 | 1.7 | GO:1990909 | Wnt signalosome(GO:1990909) |
0.3 | 1.7 | GO:0001520 | outer dense fiber(GO:0001520) |
0.3 | 1.1 | GO:0035032 | phosphatidylinositol 3-kinase complex, class III(GO:0035032) |
0.3 | 0.6 | GO:0008540 | proteasome regulatory particle, base subcomplex(GO:0008540) |
0.3 | 4.8 | GO:0005793 | endoplasmic reticulum-Golgi intermediate compartment(GO:0005793) |
0.3 | 0.8 | GO:0097539 | ciliary transition fiber(GO:0097539) |
0.3 | 10.3 | GO:0005913 | cell-cell adherens junction(GO:0005913) |
0.3 | 0.3 | GO:0030870 | Mre11 complex(GO:0030870) |
0.3 | 0.8 | GO:0031390 | Ctf18 RFC-like complex(GO:0031390) |
0.3 | 1.1 | GO:0005798 | Golgi-associated vesicle(GO:0005798) |
0.3 | 1.1 | GO:0031465 | Cul4B-RING E3 ubiquitin ligase complex(GO:0031465) |
0.3 | 0.5 | GO:0033061 | DNA recombinase mediator complex(GO:0033061) |
0.3 | 0.3 | GO:0034464 | BBSome(GO:0034464) |
0.3 | 1.1 | GO:0031082 | BLOC complex(GO:0031082) |
0.3 | 2.4 | GO:0042582 | primary lysosome(GO:0005766) azurophil granule(GO:0042582) |
0.3 | 0.3 | GO:0031088 | platelet dense granule membrane(GO:0031088) |
0.3 | 0.3 | GO:0000137 | Golgi cis cisterna(GO:0000137) |
0.3 | 2.6 | GO:0031080 | nuclear pore outer ring(GO:0031080) |
0.3 | 3.4 | GO:0000145 | exocyst(GO:0000145) |
0.3 | 1.0 | GO:0000938 | GARP complex(GO:0000938) |
0.3 | 3.1 | GO:0005942 | phosphatidylinositol 3-kinase complex(GO:0005942) |
0.3 | 1.3 | GO:0002141 | stereocilia ankle link(GO:0002141) |
0.3 | 0.8 | GO:0071818 | BAT3 complex(GO:0071818) ER membrane insertion complex(GO:0072379) |
0.3 | 0.8 | GO:0046691 | intracellular canaliculus(GO:0046691) |
0.3 | 0.3 | GO:0032839 | dendrite cytoplasm(GO:0032839) |
0.3 | 1.0 | GO:0005682 | U5 snRNP(GO:0005682) |
0.3 | 0.8 | GO:0030915 | Smc5-Smc6 complex(GO:0030915) |
0.2 | 1.2 | GO:0005827 | polar microtubule(GO:0005827) |
0.2 | 0.5 | GO:0005774 | vacuolar membrane(GO:0005774) |
0.2 | 1.0 | GO:0000942 | condensed nuclear chromosome outer kinetochore(GO:0000942) |
0.2 | 2.2 | GO:0042622 | photoreceptor outer segment membrane(GO:0042622) |
0.2 | 0.5 | GO:0042583 | chromaffin granule(GO:0042583) |
0.2 | 4.4 | GO:0005666 | DNA-directed RNA polymerase III complex(GO:0005666) |
0.2 | 1.0 | GO:0016589 | NURF complex(GO:0016589) |
0.2 | 19.8 | GO:0005903 | brush border(GO:0005903) |
0.2 | 1.9 | GO:0030314 | junctional membrane complex(GO:0030314) |
0.2 | 2.4 | GO:0008278 | cohesin complex(GO:0008278) |
0.2 | 1.2 | GO:1990124 | messenger ribonucleoprotein complex(GO:1990124) |
0.2 | 2.6 | GO:0055037 | recycling endosome(GO:0055037) |
0.2 | 0.9 | GO:0000243 | commitment complex(GO:0000243) |
0.2 | 1.9 | GO:0005847 | mRNA cleavage and polyadenylation specificity factor complex(GO:0005847) |
0.2 | 0.2 | GO:1990023 | mitotic spindle midzone(GO:1990023) |
0.2 | 6.1 | GO:0005776 | autophagosome(GO:0005776) |
0.2 | 2.5 | GO:0097431 | mitotic spindle pole(GO:0097431) |
0.2 | 4.8 | GO:0005902 | microvillus(GO:0005902) |
0.2 | 0.9 | GO:0099501 | synaptic vesicle membrane(GO:0030672) exocytic vesicle membrane(GO:0099501) |
0.2 | 0.9 | GO:1990246 | uniplex complex(GO:1990246) |
0.2 | 2.0 | GO:0032426 | stereocilium tip(GO:0032426) |
0.2 | 0.5 | GO:0016939 | kinesin II complex(GO:0016939) |
0.2 | 4.5 | GO:0005801 | cis-Golgi network(GO:0005801) |
0.2 | 1.8 | GO:0035253 | ciliary rootlet(GO:0035253) |
0.2 | 0.4 | GO:0097440 | apical dendrite(GO:0097440) |
0.2 | 3.5 | GO:0000118 | histone deacetylase complex(GO:0000118) |
0.2 | 0.9 | GO:0042825 | TAP complex(GO:0042825) |
0.2 | 1.8 | GO:1902562 | NuA4 histone acetyltransferase complex(GO:0035267) H4/H2A histone acetyltransferase complex(GO:0043189) H4 histone acetyltransferase complex(GO:1902562) |
0.2 | 0.9 | GO:0031983 | vesicle lumen(GO:0031983) |
0.2 | 0.4 | GO:0097452 | GAIT complex(GO:0097452) |
0.2 | 0.6 | GO:0005945 | 6-phosphofructokinase complex(GO:0005945) |
0.2 | 1.5 | GO:0000815 | ESCRT III complex(GO:0000815) |
0.2 | 0.2 | GO:0009331 | glycerol-3-phosphate dehydrogenase complex(GO:0009331) |
0.2 | 31.7 | GO:0016324 | apical plasma membrane(GO:0016324) |
0.2 | 1.7 | GO:0019773 | proteasome core complex, alpha-subunit complex(GO:0019773) |
0.2 | 0.2 | GO:0000322 | storage vacuole(GO:0000322) |
0.2 | 8.2 | GO:0030018 | Z disc(GO:0030018) |
0.2 | 60.0 | GO:0005764 | lytic vacuole(GO:0000323) lysosome(GO:0005764) |
0.2 | 0.4 | GO:0000803 | sex chromosome(GO:0000803) |
0.2 | 0.6 | GO:0005588 | collagen type V trimer(GO:0005588) |
0.2 | 6.2 | GO:0005834 | heterotrimeric G-protein complex(GO:0005834) |
0.2 | 1.2 | GO:0031209 | SCAR complex(GO:0031209) |
0.2 | 0.8 | GO:0000120 | RNA polymerase I transcription factor complex(GO:0000120) |
0.2 | 0.6 | GO:0033391 | chromatoid body(GO:0033391) |
0.2 | 0.6 | GO:0005818 | aster(GO:0005818) |
0.2 | 7.2 | GO:0016529 | sarcoplasmic reticulum(GO:0016529) |
0.2 | 0.4 | GO:0034715 | pICln-Sm protein complex(GO:0034715) |
0.2 | 0.4 | GO:0000814 | ESCRT II complex(GO:0000814) |
0.2 | 0.4 | GO:0016281 | eukaryotic translation initiation factor 4F complex(GO:0016281) |
0.2 | 2.0 | GO:0032420 | stereocilium(GO:0032420) |
0.2 | 2.2 | GO:0031235 | intrinsic component of the cytoplasmic side of the plasma membrane(GO:0031235) |
0.2 | 1.2 | GO:0030123 | AP-3 adaptor complex(GO:0030123) |
0.2 | 1.2 | GO:0001739 | sex chromatin(GO:0001739) |
0.2 | 3.8 | GO:0031307 | integral component of mitochondrial outer membrane(GO:0031307) |
0.2 | 4.2 | GO:0005771 | multivesicular body(GO:0005771) |
0.2 | 6.0 | GO:0001750 | photoreceptor outer segment(GO:0001750) |
0.2 | 2.2 | GO:0017119 | Golgi transport complex(GO:0017119) |
0.2 | 1.0 | GO:0032433 | filopodium tip(GO:0032433) |
0.2 | 0.8 | GO:0097136 | Bcl-2 family protein complex(GO:0097136) |
0.2 | 1.4 | GO:0034518 | mRNA cap binding complex(GO:0005845) RNA cap binding complex(GO:0034518) |
0.2 | 5.5 | GO:0016592 | mediator complex(GO:0016592) |
0.2 | 0.6 | GO:0002199 | zona pellucida receptor complex(GO:0002199) |
0.2 | 0.8 | GO:0032993 | protein-DNA complex(GO:0032993) |
0.2 | 0.6 | GO:0016222 | procollagen-proline 4-dioxygenase complex(GO:0016222) |
0.2 | 0.9 | GO:0035631 | CD40 receptor complex(GO:0035631) |
0.2 | 1.9 | GO:0010369 | chromocenter(GO:0010369) |
0.2 | 0.9 | GO:0090543 | Flemming body(GO:0090543) |
0.2 | 5.7 | GO:0045111 | intermediate filament cytoskeleton(GO:0045111) |
0.2 | 0.6 | GO:0071001 | U4/U6 snRNP(GO:0071001) |
0.2 | 1.3 | GO:0000777 | condensed chromosome kinetochore(GO:0000777) |
0.2 | 1.5 | GO:0000124 | SAGA complex(GO:0000124) |
0.2 | 1.1 | GO:0033256 | I-kappaB/NF-kappaB complex(GO:0033256) |
0.2 | 0.7 | GO:0000408 | EKC/KEOPS complex(GO:0000408) |
0.2 | 13.1 | GO:0036064 | ciliary basal body(GO:0036064) |
0.2 | 1.1 | GO:0072669 | tRNA-splicing ligase complex(GO:0072669) |
0.2 | 9.7 | GO:0016605 | PML body(GO:0016605) |
0.2 | 2.1 | GO:0033202 | DNA helicase complex(GO:0033202) |
0.2 | 1.4 | GO:0008250 | oligosaccharyltransferase complex(GO:0008250) |
0.2 | 3.4 | GO:0005769 | early endosome(GO:0005769) |
0.2 | 0.3 | GO:0045098 | type III intermediate filament(GO:0045098) |
0.2 | 4.0 | GO:0000795 | synaptonemal complex(GO:0000795) |
0.2 | 3.6 | GO:1990391 | DNA repair complex(GO:1990391) |
0.2 | 0.5 | GO:1990423 | RZZ complex(GO:1990423) |
0.2 | 0.7 | GO:0090571 | RNA polymerase II transcription repressor complex(GO:0090571) |
0.2 | 16.7 | GO:0035068 | micro-ribonucleoprotein complex(GO:0035068) |
0.2 | 10.3 | GO:0022625 | cytosolic large ribosomal subunit(GO:0022625) |
0.2 | 3.9 | GO:0030667 | secretory granule membrane(GO:0030667) |
0.2 | 35.7 | GO:0005789 | endoplasmic reticulum membrane(GO:0005789) |
0.2 | 0.6 | GO:0034663 | endoplasmic reticulum chaperone complex(GO:0034663) |
0.2 | 0.9 | GO:0051233 | spindle midzone(GO:0051233) |
0.2 | 0.3 | GO:0033179 | proton-transporting V-type ATPase, V0 domain(GO:0033179) |
0.2 | 4.5 | GO:0005802 | trans-Golgi network(GO:0005802) |
0.2 | 1.8 | GO:0000307 | cyclin-dependent protein kinase holoenzyme complex(GO:0000307) |
0.2 | 2.6 | GO:0005922 | connexon complex(GO:0005922) |
0.1 | 0.4 | GO:0030991 | intraciliary transport particle A(GO:0030991) |
0.1 | 0.4 | GO:0070044 | synaptobrevin 2-SNAP-25-syntaxin-1a complex(GO:0070044) |
0.1 | 0.4 | GO:0032299 | ribonuclease H2 complex(GO:0032299) |
0.1 | 3.0 | GO:0005884 | actin filament(GO:0005884) |
0.1 | 2.8 | GO:0035145 | exon-exon junction complex(GO:0035145) |
0.1 | 3.5 | GO:0032040 | small-subunit processome(GO:0032040) |
0.1 | 13.0 | GO:0005882 | intermediate filament(GO:0005882) |
0.1 | 0.6 | GO:0033503 | HULC complex(GO:0033503) |
0.1 | 0.3 | GO:0034673 | inhibin-betaglycan-ActRII complex(GO:0034673) |
0.1 | 3.1 | GO:0031519 | PcG protein complex(GO:0031519) |
0.1 | 0.8 | GO:0005721 | pericentric heterochromatin(GO:0005721) |
0.1 | 2.0 | GO:0005892 | acetylcholine-gated channel complex(GO:0005892) |
0.1 | 0.3 | GO:0005839 | proteasome core complex(GO:0005839) |
0.1 | 4.6 | GO:0035097 | histone methyltransferase complex(GO:0035097) |
0.1 | 0.6 | GO:0000444 | MIS12/MIND type complex(GO:0000444) |
0.1 | 0.1 | GO:0034709 | methylosome(GO:0034709) |
0.1 | 0.4 | GO:0044613 | nuclear pore central transport channel(GO:0044613) |
0.1 | 0.4 | GO:0031074 | nucleocytoplasmic shuttling complex(GO:0031074) |
0.1 | 15.7 | GO:0031225 | anchored component of membrane(GO:0031225) |
0.1 | 0.3 | GO:0005664 | origin recognition complex(GO:0000808) nuclear origin of replication recognition complex(GO:0005664) |
0.1 | 4.7 | GO:0000315 | organellar large ribosomal subunit(GO:0000315) mitochondrial large ribosomal subunit(GO:0005762) |
0.1 | 0.4 | GO:0097255 | R2TP complex(GO:0097255) |
0.1 | 0.4 | GO:0005642 | annulate lamellae(GO:0005642) |
0.1 | 0.7 | GO:0017101 | aminoacyl-tRNA synthetase multienzyme complex(GO:0017101) |
0.1 | 1.4 | GO:0071011 | precatalytic spliceosome(GO:0071011) |
0.1 | 7.6 | GO:0090575 | RNA polymerase II transcription factor complex(GO:0090575) |
0.1 | 22.6 | GO:0000151 | ubiquitin ligase complex(GO:0000151) |
0.1 | 0.5 | GO:0035859 | Seh1-associated complex(GO:0035859) |
0.1 | 0.4 | GO:0042581 | specific granule(GO:0042581) |
0.1 | 2.4 | GO:0005876 | spindle microtubule(GO:0005876) |
0.1 | 0.5 | GO:0012506 | vesicle membrane(GO:0012506) |
0.1 | 0.4 | GO:0045335 | phagocytic vesicle(GO:0045335) |
0.1 | 20.6 | GO:0005924 | cell-substrate adherens junction(GO:0005924) |
0.1 | 0.5 | GO:0000502 | proteasome complex(GO:0000502) |
0.1 | 0.4 | GO:0030289 | protein phosphatase 4 complex(GO:0030289) |
0.1 | 0.4 | GO:0034385 | very-low-density lipoprotein particle(GO:0034361) triglyceride-rich lipoprotein particle(GO:0034385) |
0.1 | 0.2 | GO:0070939 | Dsl1p complex(GO:0070939) |
0.1 | 0.1 | GO:0005850 | eukaryotic translation initiation factor 2 complex(GO:0005850) |
0.1 | 15.4 | GO:0009897 | external side of plasma membrane(GO:0009897) |
0.1 | 1.3 | GO:0005689 | U12-type spliceosomal complex(GO:0005689) |
0.1 | 0.5 | GO:0005797 | Golgi medial cisterna(GO:0005797) |
0.1 | 0.2 | GO:0070938 | contractile ring(GO:0070938) |
0.1 | 0.3 | GO:0000805 | X chromosome(GO:0000805) |
0.1 | 2.5 | GO:0000123 | histone acetyltransferase complex(GO:0000123) |
0.1 | 22.8 | GO:0005783 | endoplasmic reticulum(GO:0005783) |
0.1 | 1.2 | GO:0005614 | interstitial matrix(GO:0005614) |
0.1 | 10.0 | GO:0016604 | nuclear body(GO:0016604) |
0.1 | 0.3 | GO:0042575 | DNA polymerase complex(GO:0042575) |
0.1 | 0.2 | GO:0032591 | dendritic spine membrane(GO:0032591) |
0.1 | 0.7 | GO:0016580 | Sin3 complex(GO:0016580) |
0.1 | 2.3 | GO:0005844 | polysome(GO:0005844) |
0.1 | 0.4 | GO:0016460 | myosin II complex(GO:0016460) |
0.1 | 3.8 | GO:0017053 | transcriptional repressor complex(GO:0017053) |
0.1 | 0.2 | GO:0070761 | pre-snoRNP complex(GO:0070761) |
0.1 | 0.1 | GO:0045293 | mRNA editing complex(GO:0045293) |
0.1 | 0.6 | GO:0005736 | DNA-directed RNA polymerase I complex(GO:0005736) |
0.1 | 0.6 | GO:0005744 | mitochondrial inner membrane presequence translocase complex(GO:0005744) |
0.1 | 0.2 | GO:0097057 | TRAF2-GSTP1 complex(GO:0097057) |
0.1 | 0.5 | GO:0016272 | prefoldin complex(GO:0016272) |
0.1 | 0.1 | GO:0042175 | nuclear outer membrane-endoplasmic reticulum membrane network(GO:0042175) |
0.1 | 37.9 | GO:0005730 | nucleolus(GO:0005730) |
0.1 | 2.3 | GO:0005871 | kinesin complex(GO:0005871) |
0.1 | 0.3 | GO:0098827 | endoplasmic reticulum subcompartment(GO:0098827) |
0.1 | 0.2 | GO:0097441 | basilar dendrite(GO:0097441) |
0.1 | 20.2 | GO:0005667 | transcription factor complex(GO:0005667) |
0.1 | 1.3 | GO:0000786 | nucleosome(GO:0000786) |
0.1 | 0.9 | GO:0038201 | TOR complex(GO:0038201) |
0.1 | 130.1 | GO:0070062 | extracellular exosome(GO:0070062) |
0.1 | 0.1 | GO:0005971 | ribonucleoside-diphosphate reductase complex(GO:0005971) |
0.1 | 0.2 | GO:0000792 | heterochromatin(GO:0000792) |
0.1 | 0.1 | GO:0005786 | signal recognition particle, endoplasmic reticulum targeting(GO:0005786) signal recognition particle(GO:0048500) |
0.1 | 0.1 | GO:0097512 | cardiac myofibril(GO:0097512) |
0.1 | 2.2 | GO:0005881 | cytoplasmic microtubule(GO:0005881) |
0.1 | 0.2 | GO:0016471 | vacuolar proton-transporting V-type ATPase complex(GO:0016471) |
0.1 | 0.2 | GO:0005849 | mRNA cleavage factor complex(GO:0005849) |
0.1 | 1.9 | GO:0061695 | transferase complex, transferring phosphorus-containing groups(GO:0061695) |
0.1 | 0.1 | GO:0044291 | cell-cell contact zone(GO:0044291) |
0.1 | 1.2 | GO:0016459 | myosin complex(GO:0016459) |
0.1 | 37.8 | GO:0005829 | cytosol(GO:0005829) |
0.1 | 0.1 | GO:0000811 | GINS complex(GO:0000811) |
0.1 | 0.7 | GO:0022627 | cytosolic small ribosomal subunit(GO:0022627) |
0.1 | 0.1 | GO:0031261 | DNA replication preinitiation complex(GO:0031261) |
0.1 | 1.9 | GO:0005761 | organellar ribosome(GO:0000313) mitochondrial ribosome(GO:0005761) |
0.1 | 0.2 | GO:0005751 | mitochondrial respiratory chain complex IV(GO:0005751) |
0.1 | 0.2 | GO:0042105 | alpha-beta T cell receptor complex(GO:0042105) |
0.1 | 50.7 | GO:0005654 | nucleoplasm(GO:0005654) |
0.1 | 0.1 | GO:1902555 | endoribonuclease complex(GO:1902555) |
0.1 | 0.1 | GO:0089717 | spanning component of plasma membrane(GO:0044214) spanning component of membrane(GO:0089717) |
0.1 | 0.1 | GO:0044292 | dendrite terminus(GO:0044292) |
0.1 | 0.2 | GO:0031010 | ISWI-type complex(GO:0031010) |
0.1 | 0.4 | GO:0032587 | ruffle membrane(GO:0032587) |
0.1 | 0.1 | GO:0033178 | proton-transporting two-sector ATPase complex, catalytic domain(GO:0033178) |
0.1 | 0.3 | GO:0001673 | male germ cell nucleus(GO:0001673) |
0.1 | 0.1 | GO:0089701 | U2AF(GO:0089701) |
0.1 | 0.1 | GO:0030688 | preribosome, small subunit precursor(GO:0030688) |
0.1 | 0.4 | GO:0034451 | centriolar satellite(GO:0034451) |
0.0 | 0.8 | GO:0032809 | neuronal cell body membrane(GO:0032809) |
0.0 | 0.0 | GO:0005686 | U2 snRNP(GO:0005686) |
0.0 | 0.5 | GO:0030016 | myofibril(GO:0030016) |
0.0 | 167.6 | GO:0031224 | intrinsic component of membrane(GO:0031224) |
0.0 | 0.0 | GO:0070033 | synaptobrevin 2-SNAP-25-syntaxin-1a-complexin II complex(GO:0070033) |
0.0 | 0.1 | GO:0031091 | platelet alpha granule(GO:0031091) |
0.0 | 0.1 | GO:0043527 | tRNA methyltransferase complex(GO:0043527) |
0.0 | 0.0 | GO:0005677 | chromatin silencing complex(GO:0005677) |
0.0 | 0.0 | GO:0044614 | nuclear pore cytoplasmic filaments(GO:0044614) |
0.0 | 0.1 | GO:0030956 | glutamyl-tRNA(Gln) amidotransferase complex(GO:0030956) |
0.0 | 1.7 | GO:0005759 | mitochondrial matrix(GO:0005759) |
0.0 | 0.3 | GO:0072372 | primary cilium(GO:0072372) |
0.0 | 0.0 | GO:0098799 | outer mitochondrial membrane protein complex(GO:0098799) |
0.0 | 0.0 | GO:0035770 | ribonucleoprotein granule(GO:0035770) |
0.0 | 0.0 | GO:0072534 | perineuronal net(GO:0072534) |
0.0 | 0.0 | GO:1902710 | GABA receptor complex(GO:1902710) GABA-A receptor complex(GO:1902711) |
0.0 | 0.0 | GO:0044295 | axonal growth cone(GO:0044295) |
0.0 | 0.0 | GO:0044815 | condensin complex(GO:0000796) DNA packaging complex(GO:0044815) |
0.0 | 0.0 | GO:0097386 | glial cell projection(GO:0097386) |
0.0 | 0.0 | GO:0030896 | checkpoint clamp complex(GO:0030896) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
13.3 | 39.9 | GO:0004611 | phosphoenolpyruvate carboxykinase activity(GO:0004611) |
6.8 | 20.4 | GO:0004687 | myosin light chain kinase activity(GO:0004687) |
5.3 | 21.3 | GO:0031720 | haptoglobin binding(GO:0031720) |
5.0 | 14.9 | GO:0060230 | lipoprotein lipase activator activity(GO:0060230) |
5.0 | 24.8 | GO:0051525 | NFAT protein binding(GO:0051525) |
4.1 | 24.8 | GO:0005324 | long-chain fatty acid transporter activity(GO:0005324) |
3.3 | 19.9 | GO:0034889 | alkyl sulfatase activity(GO:0018741) endosulfan hemisulfate sulfatase activity(GO:0034889) endosulfan sulfate hydrolase activity(GO:0034902) |
3.3 | 9.8 | GO:0015205 | purine nucleobase transmembrane transporter activity(GO:0005345) pyrimidine nucleobase transmembrane transporter activity(GO:0005350) nucleobase transmembrane transporter activity(GO:0015205) |
3.0 | 14.9 | GO:0004887 | thyroid hormone receptor activity(GO:0004887) |
2.7 | 8.1 | GO:0086056 | voltage-gated calcium channel activity involved in AV node cell action potential(GO:0086056) |
2.6 | 7.7 | GO:0015087 | cobalt ion transmembrane transporter activity(GO:0015087) |
2.5 | 7.5 | GO:0003986 | acetyl-CoA hydrolase activity(GO:0003986) |
2.3 | 21.1 | GO:0001013 | RNA polymerase I regulatory region DNA binding(GO:0001013) |
2.3 | 20.3 | GO:0004499 | N,N-dimethylaniline monooxygenase activity(GO:0004499) |
2.2 | 6.7 | GO:0008732 | threonine aldolase activity(GO:0004793) L-allo-threonine aldolase activity(GO:0008732) |
2.2 | 6.7 | GO:0070653 | high-density lipoprotein particle receptor binding(GO:0070653) |
2.2 | 8.9 | GO:0008865 | fructokinase activity(GO:0008865) mannokinase activity(GO:0019158) |
2.2 | 6.6 | GO:0004103 | choline kinase activity(GO:0004103) |
2.2 | 6.5 | GO:0004096 | catalase activity(GO:0004096) |
2.1 | 10.3 | GO:0046912 | transferase activity, transferring acyl groups, acyl groups converted into alkyl on transfer(GO:0046912) |
2.0 | 16.0 | GO:0102391 | decanoate--CoA ligase activity(GO:0102391) |
2.0 | 15.9 | GO:0004862 | cAMP-dependent protein kinase inhibitor activity(GO:0004862) |
1.8 | 5.5 | GO:0004832 | valine-tRNA ligase activity(GO:0004832) |
1.8 | 14.5 | GO:0052836 | cobinamide kinase activity(GO:0008819) phytol kinase activity(GO:0010276) phenol kinase activity(GO:0018720) cyclin-dependent protein kinase activating kinase regulator activity(GO:0019914) inositol tetrakisphosphate 2-kinase activity(GO:0032942) heptose 7-phosphate kinase activity(GO:0033785) aminoglycoside phosphotransferase activity(GO:0034071) eukaryotic elongation factor-2 kinase regulator activity(GO:0042556) eukaryotic elongation factor-2 kinase activator activity(GO:0042557) LPPG:FO 2-phospho-L-lactate transferase activity(GO:0043743) cytidine kinase activity(GO:0043771) glycerate 2-kinase activity(GO:0043798) (S)-lactate 2-kinase activity(GO:0043841) phosphoserine:homoserine phosphotransferase activity(GO:0043899) L-seryl-tRNA(Sec) kinase activity(GO:0043915) phosphocholine transferase activity(GO:0044605) GTP-dependent polynucleotide kinase activity(GO:0051735) farnesol kinase activity(GO:0052668) CTP:2-trans,-6-trans-farnesol kinase activity(GO:0052669) geraniol kinase activity(GO:0052670) geranylgeraniol kinase activity(GO:0052671) CTP:geranylgeraniol kinase activity(GO:0052672) prenol kinase activity(GO:0052673) 1-phosphatidylinositol-5-kinase activity(GO:0052810) 1-phosphatidylinositol-3-phosphate 4-kinase activity(GO:0052811) phosphatidylinositol-3,4-bisphosphate 5-kinase activity(GO:0052812) inositol-3,4,6-trisphosphate 1-kinase activity(GO:0052835) inositol 5-diphosphate pentakisphosphate 5-kinase activity(GO:0052836) inositol diphosphate tetrakisphosphate kinase activity(GO:0052839) |
1.8 | 8.9 | GO:0004075 | biotin carboxylase activity(GO:0004075) |
1.8 | 3.5 | GO:0004104 | cholinesterase activity(GO:0004104) |
1.8 | 7.1 | GO:0015183 | L-aspartate transmembrane transporter activity(GO:0015183) |
1.7 | 5.2 | GO:0016743 | carboxyl- or carbamoyltransferase activity(GO:0016743) |
1.7 | 5.2 | GO:0015119 | hexose phosphate transmembrane transporter activity(GO:0015119) organophosphate:inorganic phosphate antiporter activity(GO:0015315) hexose-phosphate:inorganic phosphate antiporter activity(GO:0015526) glucose 6-phosphate:inorganic phosphate antiporter activity(GO:0061513) |
1.7 | 5.1 | GO:0061629 | RNA polymerase II sequence-specific DNA binding transcription factor binding(GO:0061629) |
1.7 | 3.4 | GO:0004345 | glucose-6-phosphate dehydrogenase activity(GO:0004345) |
1.7 | 13.3 | GO:0050649 | testosterone 6-beta-hydroxylase activity(GO:0050649) |
1.7 | 8.3 | GO:0008559 | xenobiotic-transporting ATPase activity(GO:0008559) |
1.6 | 6.5 | GO:0016401 | palmitoyl-CoA oxidase activity(GO:0016401) |
1.6 | 14.2 | GO:0015174 | basic amino acid transmembrane transporter activity(GO:0015174) |
1.5 | 12.3 | GO:0042299 | pivalyl-CoA mutase activity(GO:0034784) o-hydroxylaminobenzoate mutase activity(GO:0034951) lupeol synthase activity(GO:0042299) beta-amyrin synthase activity(GO:0042300) baruol synthase activity(GO:0080011) |
1.5 | 16.6 | GO:0030898 | actin-dependent ATPase activity(GO:0030898) |
1.5 | 13.5 | GO:0042500 | aspartic endopeptidase activity, intramembrane cleaving(GO:0042500) |
1.5 | 4.5 | GO:0016802 | adenosylhomocysteinase activity(GO:0004013) trialkylsulfonium hydrolase activity(GO:0016802) |
1.5 | 8.9 | GO:0005072 | transforming growth factor beta receptor, cytoplasmic mediator activity(GO:0005072) |
1.5 | 7.4 | GO:0000405 | bubble DNA binding(GO:0000405) |
1.5 | 4.4 | GO:0042284 | sphingolipid delta-4 desaturase activity(GO:0042284) |
1.5 | 5.9 | GO:0016812 | hydrolase activity, acting on carbon-nitrogen (but not peptide) bonds, in cyclic amides(GO:0016812) |
1.5 | 17.5 | GO:0015238 | drug transmembrane transporter activity(GO:0015238) |
1.5 | 16.0 | GO:0019531 | oxalate transmembrane transporter activity(GO:0019531) |
1.5 | 5.8 | GO:1904288 | BAT3 complex binding(GO:1904288) |
1.5 | 8.7 | GO:0005499 | vitamin D binding(GO:0005499) |
1.4 | 1.4 | GO:0031559 | oxidosqualene cyclase activity(GO:0031559) |
1.4 | 7.1 | GO:0004826 | phenylalanine-tRNA ligase activity(GO:0004826) |
1.4 | 2.8 | GO:0070538 | oleic acid binding(GO:0070538) |
1.4 | 4.2 | GO:0047276 | N-acetyllactosaminide 3-alpha-galactosyltransferase activity(GO:0047276) |
1.4 | 4.2 | GO:0055056 | D-glucose transmembrane transporter activity(GO:0055056) |
1.4 | 6.9 | GO:0046624 | sphingolipid transporter activity(GO:0046624) |
1.4 | 4.1 | GO:0050692 | DBD domain binding(GO:0050692) |
1.4 | 9.5 | GO:0005536 | glucose binding(GO:0005536) |
1.4 | 5.4 | GO:0005329 | dopamine transmembrane transporter activity(GO:0005329) |
1.3 | 10.8 | GO:0022889 | L-serine transmembrane transporter activity(GO:0015194) serine transmembrane transporter activity(GO:0022889) |
1.3 | 5.4 | GO:0003958 | NADPH-hemoprotein reductase activity(GO:0003958) |
1.3 | 13.0 | GO:0003993 | acid phosphatase activity(GO:0003993) |
1.3 | 6.5 | GO:0016841 | ammonia-lyase activity(GO:0016841) |
1.3 | 1.3 | GO:0015556 | C4-dicarboxylate transmembrane transporter activity(GO:0015556) |
1.3 | 3.8 | GO:0004948 | calcitonin receptor activity(GO:0004948) |
1.3 | 5.1 | GO:0000293 | ferric-chelate reductase activity(GO:0000293) |
1.3 | 5.1 | GO:0097493 | structural molecule activity conferring elasticity(GO:0097493) |
1.3 | 1.3 | GO:0000064 | L-ornithine transmembrane transporter activity(GO:0000064) |
1.3 | 1.3 | GO:0016712 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, reduced flavin or flavoprotein as one donor, and incorporation of one atom of oxygen(GO:0016712) |
1.3 | 5.0 | GO:0016833 | oxo-acid-lyase activity(GO:0016833) |
1.3 | 5.0 | GO:0003846 | 2-acylglycerol O-acyltransferase activity(GO:0003846) |
1.2 | 6.1 | GO:0017034 | Rap guanyl-nucleotide exchange factor activity(GO:0017034) |
1.2 | 2.4 | GO:0051765 | inositol tetrakisphosphate kinase activity(GO:0051765) |
1.2 | 6.0 | GO:0003847 | 1-alkyl-2-acetylglycerophosphocholine esterase activity(GO:0003847) |
1.2 | 3.5 | GO:0005176 | ErbB-2 class receptor binding(GO:0005176) |
1.2 | 5.8 | GO:0030292 | protein tyrosine kinase inhibitor activity(GO:0030292) |
1.2 | 16.1 | GO:0016290 | palmitoyl-CoA hydrolase activity(GO:0016290) |
1.2 | 15.0 | GO:0008432 | JUN kinase binding(GO:0008432) |
1.1 | 3.4 | GO:0019770 | IgG receptor activity(GO:0019770) |
1.1 | 5.7 | GO:0071253 | connexin binding(GO:0071253) |
1.1 | 11.3 | GO:0034236 | protein kinase A catalytic subunit binding(GO:0034236) |
1.1 | 3.3 | GO:0055100 | adiponectin binding(GO:0055100) |
1.1 | 4.3 | GO:0033192 | calmodulin-dependent protein phosphatase activity(GO:0033192) |
1.1 | 1.1 | GO:0000009 | alpha-1,6-mannosyltransferase activity(GO:0000009) |
1.1 | 3.2 | GO:0034648 | histone demethylase activity (H3-dimethyl-K4 specific)(GO:0034648) |
1.0 | 4.2 | GO:0017150 | tRNA dihydrouridine synthase activity(GO:0017150) |
1.0 | 3.1 | GO:0004515 | nicotinamide-nucleotide adenylyltransferase activity(GO:0000309) nicotinate-nucleotide adenylyltransferase activity(GO:0004515) |
1.0 | 4.2 | GO:0019145 | aminobutyraldehyde dehydrogenase activity(GO:0019145) 4-trimethylammoniobutyraldehyde dehydrogenase activity(GO:0047105) |
1.0 | 3.1 | GO:0019959 | interleukin-8 binding(GO:0019959) |
1.0 | 3.1 | GO:0008506 | sucrose:proton symporter activity(GO:0008506) sucrose transmembrane transporter activity(GO:0008515) disaccharide transmembrane transporter activity(GO:0015154) oligosaccharide transmembrane transporter activity(GO:0015157) |
1.0 | 15.6 | GO:0030228 | lipoprotein particle receptor activity(GO:0030228) |
1.0 | 3.1 | GO:0070139 | ubiquitin-like protein-specific endopeptidase activity(GO:0070137) SUMO-specific endopeptidase activity(GO:0070139) |
1.0 | 5.1 | GO:0035473 | lipase binding(GO:0035473) |
1.0 | 5.1 | GO:0016174 | NAD(P)H oxidase activity(GO:0016174) |
1.0 | 5.1 | GO:0005381 | iron ion transmembrane transporter activity(GO:0005381) |
1.0 | 9.1 | GO:0008093 | cytoskeletal adaptor activity(GO:0008093) |
1.0 | 3.0 | GO:0005483 | soluble NSF attachment protein activity(GO:0005483) |
1.0 | 8.1 | GO:0004779 | sulfate adenylyltransferase activity(GO:0004779) |
1.0 | 5.0 | GO:0005007 | fibroblast growth factor-activated receptor activity(GO:0005007) |
1.0 | 2.0 | GO:0017153 | sodium:dicarboxylate symporter activity(GO:0017153) |
1.0 | 29.1 | GO:0070330 | aromatase activity(GO:0070330) |
1.0 | 3.0 | GO:0010521 | telomerase inhibitor activity(GO:0010521) |
1.0 | 2.9 | GO:0016453 | acetyl-CoA C-acetyltransferase activity(GO:0003985) C-acetyltransferase activity(GO:0016453) |
1.0 | 3.9 | GO:0070324 | thyroid hormone binding(GO:0070324) |
1.0 | 2.0 | GO:0070905 | serine binding(GO:0070905) |
1.0 | 16.6 | GO:0001784 | phosphotyrosine binding(GO:0001784) |
1.0 | 2.9 | GO:0004711 | ribosomal protein S6 kinase activity(GO:0004711) |
1.0 | 4.8 | GO:0032558 | adenyl deoxyribonucleotide binding(GO:0032558) |
1.0 | 2.9 | GO:2001070 | starch binding(GO:2001070) |
1.0 | 2.9 | GO:0004724 | magnesium-dependent protein serine/threonine phosphatase activity(GO:0004724) |
1.0 | 2.9 | GO:0030621 | U4 snRNA binding(GO:0030621) |
1.0 | 13.3 | GO:0019215 | intermediate filament binding(GO:0019215) |
0.9 | 2.8 | GO:0004920 | interleukin-10 receptor activity(GO:0004920) |
0.9 | 6.5 | GO:0048531 | beta-1,3-galactosyltransferase activity(GO:0048531) |
0.9 | 2.8 | GO:0032190 | acrosin binding(GO:0032190) |
0.9 | 2.7 | GO:0042296 | ISG15 transferase activity(GO:0042296) |
0.9 | 3.6 | GO:0004594 | pantothenate kinase activity(GO:0004594) |
0.9 | 3.6 | GO:0032051 | clathrin light chain binding(GO:0032051) |
0.9 | 2.6 | GO:0047961 | glycine N-acyltransferase activity(GO:0047961) |
0.9 | 2.6 | GO:0089720 | caspase binding(GO:0089720) |
0.9 | 1.7 | GO:0004698 | calcium-dependent protein kinase C activity(GO:0004698) |
0.9 | 2.6 | GO:0016520 | growth hormone-releasing hormone receptor activity(GO:0016520) |
0.9 | 3.4 | GO:0050501 | hyaluronan synthase activity(GO:0050501) |
0.8 | 0.8 | GO:0035251 | UDP-glucosyltransferase activity(GO:0035251) |
0.8 | 8.5 | GO:0004176 | ATP-dependent peptidase activity(GO:0004176) |
0.8 | 3.4 | GO:0004558 | alpha-1,4-glucosidase activity(GO:0004558) |
0.8 | 2.5 | GO:0004346 | glucose-6-phosphatase activity(GO:0004346) sugar-terminal-phosphatase activity(GO:0050309) |
0.8 | 1.7 | GO:0070644 | vitamin D response element binding(GO:0070644) |
0.8 | 5.0 | GO:0008131 | primary amine oxidase activity(GO:0008131) |
0.8 | 2.5 | GO:0030144 | alpha-1,6-mannosylglycoprotein 6-beta-N-acetylglucosaminyltransferase activity(GO:0030144) |
0.8 | 2.5 | GO:0050220 | prostaglandin-E synthase activity(GO:0050220) |
0.8 | 3.3 | GO:0004062 | aryl sulfotransferase activity(GO:0004062) |
0.8 | 1.6 | GO:0016880 | acid-ammonia (or amide) ligase activity(GO:0016880) |
0.8 | 0.8 | GO:0048273 | mitogen-activated protein kinase p38 binding(GO:0048273) |
0.8 | 6.4 | GO:0008429 | phosphatidylethanolamine binding(GO:0008429) |
0.8 | 7.2 | GO:0003689 | DNA clamp loader activity(GO:0003689) protein-DNA loading ATPase activity(GO:0033170) |
0.8 | 2.4 | GO:0003726 | double-stranded RNA adenosine deaminase activity(GO:0003726) |
0.8 | 3.2 | GO:0015106 | bicarbonate transmembrane transporter activity(GO:0015106) |
0.8 | 1.6 | GO:0001846 | opsonin binding(GO:0001846) |
0.8 | 3.9 | GO:0004758 | serine C-palmitoyltransferase activity(GO:0004758) |
0.8 | 0.8 | GO:0004583 | dolichyl-phosphate-glucose-glycolipid alpha-glucosyltransferase activity(GO:0004583) |
0.8 | 4.7 | GO:0003918 | DNA topoisomerase type II (ATP-hydrolyzing) activity(GO:0003918) DNA topoisomerase II activity(GO:0061505) |
0.8 | 14.1 | GO:0005070 | SH3/SH2 adaptor activity(GO:0005070) |
0.8 | 24.2 | GO:0016831 | carboxy-lyase activity(GO:0016831) |
0.8 | 6.2 | GO:0071933 | Arp2/3 complex binding(GO:0071933) |
0.8 | 3.9 | GO:0004468 | lysine N-acetyltransferase activity, acting on acetyl phosphate as donor(GO:0004468) |
0.8 | 8.4 | GO:0016813 | hydrolase activity, acting on carbon-nitrogen (but not peptide) bonds, in linear amidines(GO:0016813) |
0.8 | 3.0 | GO:0008526 | phosphatidylinositol transporter activity(GO:0008526) |
0.8 | 11.4 | GO:0001594 | trace-amine receptor activity(GO:0001594) |
0.8 | 9.0 | GO:0019841 | retinol binding(GO:0019841) |
0.8 | 11.3 | GO:0016805 | dipeptidase activity(GO:0016805) |
0.7 | 2.2 | GO:0016971 | flavin-linked sulfhydryl oxidase activity(GO:0016971) |
0.7 | 2.2 | GO:0090482 | vitamin transmembrane transporter activity(GO:0090482) |
0.7 | 5.2 | GO:0008494 | translation activator activity(GO:0008494) |
0.7 | 5.2 | GO:0070182 | DNA polymerase binding(GO:0070182) |
0.7 | 2.2 | GO:0004965 | G-protein coupled GABA receptor activity(GO:0004965) |
0.7 | 2.2 | GO:0030350 | iron-responsive element binding(GO:0030350) |
0.7 | 8.1 | GO:0034185 | apolipoprotein binding(GO:0034185) |
0.7 | 2.2 | GO:0017116 | single-stranded DNA-dependent ATP-dependent DNA helicase activity(GO:0017116) |
0.7 | 5.7 | GO:0004571 | mannosyl-oligosaccharide 1,2-alpha-mannosidase activity(GO:0004571) |
0.7 | 2.9 | GO:0015057 | thrombin receptor activity(GO:0015057) |
0.7 | 2.9 | GO:0004332 | fructose-bisphosphate aldolase activity(GO:0004332) |
0.7 | 7.1 | GO:0045294 | alpha-catenin binding(GO:0045294) |
0.7 | 2.8 | GO:0000104 | succinate dehydrogenase activity(GO:0000104) |
0.7 | 2.1 | GO:0001226 | RNA polymerase II transcription corepressor binding(GO:0001226) |
0.7 | 2.1 | GO:0035514 | DNA demethylase activity(GO:0035514) |
0.7 | 0.7 | GO:0098748 | clathrin adaptor activity(GO:0035615) endocytic adaptor activity(GO:0098748) |
0.7 | 5.6 | GO:0004534 | 5'-3' exoribonuclease activity(GO:0004534) |
0.7 | 2.8 | GO:0004126 | cytidine deaminase activity(GO:0004126) |
0.7 | 2.8 | GO:0019834 | phospholipase A2 inhibitor activity(GO:0019834) |
0.7 | 2.1 | GO:0004300 | enoyl-CoA hydratase activity(GO:0004300) |
0.7 | 10.3 | GO:0004089 | carbonate dehydratase activity(GO:0004089) |
0.7 | 2.7 | GO:0004449 | isocitrate dehydrogenase (NAD+) activity(GO:0004449) |
0.7 | 12.3 | GO:0001848 | complement binding(GO:0001848) |
0.7 | 4.1 | GO:0031749 | D2 dopamine receptor binding(GO:0031749) |
0.7 | 2.7 | GO:0004090 | carbonyl reductase (NADPH) activity(GO:0004090) |
0.7 | 3.4 | GO:0015216 | adenine nucleotide transmembrane transporter activity(GO:0000295) purine ribonucleotide transmembrane transporter activity(GO:0005346) purine nucleotide transmembrane transporter activity(GO:0015216) |
0.7 | 9.5 | GO:0008143 | poly(A) binding(GO:0008143) |
0.7 | 5.4 | GO:0003810 | protein-glutamine gamma-glutamyltransferase activity(GO:0003810) |
0.7 | 2.0 | GO:0015220 | choline transmembrane transporter activity(GO:0015220) |
0.7 | 15.5 | GO:0004623 | phospholipase A2 activity(GO:0004623) |
0.7 | 0.7 | GO:0016418 | S-acetyltransferase activity(GO:0016418) |
0.7 | 1.3 | GO:0097642 | calcitonin family receptor activity(GO:0097642) |
0.7 | 2.0 | GO:0016149 | translation release factor activity, codon specific(GO:0016149) |
0.7 | 2.6 | GO:0016531 | copper chaperone activity(GO:0016531) |
0.7 | 2.6 | GO:0019763 | immunoglobulin receptor activity(GO:0019763) |
0.7 | 2.6 | GO:0004064 | arylesterase activity(GO:0004064) |
0.7 | 3.9 | GO:0000182 | rDNA binding(GO:0000182) |
0.6 | 4.5 | GO:0019957 | C-C chemokine binding(GO:0019957) |
0.6 | 1.9 | GO:0016774 | phosphotransferase activity, carboxyl group as acceptor(GO:0016774) |
0.6 | 3.2 | GO:0042015 | interleukin-20 binding(GO:0042015) |
0.6 | 1.9 | GO:0004652 | polynucleotide adenylyltransferase activity(GO:0004652) |
0.6 | 2.5 | GO:0004430 | 1-phosphatidylinositol 4-kinase activity(GO:0004430) |
0.6 | 18.5 | GO:0008391 | arachidonic acid monooxygenase activity(GO:0008391) |
0.6 | 1.9 | GO:0032552 | deoxyribonucleotide binding(GO:0032552) |
0.6 | 1.9 | GO:0004366 | glycerol-3-phosphate O-acyltransferase activity(GO:0004366) |
0.6 | 1.9 | GO:0003987 | acetate-CoA ligase activity(GO:0003987) |
0.6 | 0.6 | GO:0008193 | tRNA guanylyltransferase activity(GO:0008193) |
0.6 | 0.6 | GO:0004024 | alcohol dehydrogenase activity, zinc-dependent(GO:0004024) |
0.6 | 2.5 | GO:0097602 | cullin family protein binding(GO:0097602) |
0.6 | 5.5 | GO:0043996 | histone acetyltransferase activity (H4-K5 specific)(GO:0043995) histone acetyltransferase activity (H4-K8 specific)(GO:0043996) histone acetyltransferase activity (H4-K16 specific)(GO:0046972) |
0.6 | 8.6 | GO:0008353 | RNA polymerase II carboxy-terminal domain kinase activity(GO:0008353) |
0.6 | 7.3 | GO:0035259 | glucocorticoid receptor binding(GO:0035259) |
0.6 | 1.2 | GO:0008271 | secondary active sulfate transmembrane transporter activity(GO:0008271) |
0.6 | 1.8 | GO:0072345 | NAADP-sensitive calcium-release channel activity(GO:0072345) |
0.6 | 3.0 | GO:0098639 | collagen binding involved in cell-matrix adhesion(GO:0098639) |
0.6 | 1.2 | GO:0019808 | polyamine binding(GO:0019808) |
0.6 | 1.8 | GO:0016309 | 1-phosphatidylinositol-5-phosphate 4-kinase activity(GO:0016309) |
0.6 | 4.2 | GO:0051864 | histone demethylase activity (H3-K36 specific)(GO:0051864) |
0.6 | 10.6 | GO:0016780 | phosphotransferase activity, for other substituted phosphate groups(GO:0016780) |
0.6 | 1.8 | GO:0005146 | leukemia inhibitory factor receptor binding(GO:0005146) |
0.6 | 4.1 | GO:0009922 | fatty acid elongase activity(GO:0009922) 3-oxo-arachidoyl-CoA synthase activity(GO:0102336) 3-oxo-cerotoyl-CoA synthase activity(GO:0102337) 3-oxo-lignoceronyl-CoA synthase activity(GO:0102338) |
0.6 | 2.3 | GO:0016830 | carbon-carbon lyase activity(GO:0016830) |
0.6 | 1.2 | GO:0060228 | phosphatidylcholine-sterol O-acyltransferase activator activity(GO:0060228) |
0.6 | 2.3 | GO:0004740 | pyruvate dehydrogenase (acetyl-transferring) kinase activity(GO:0004740) |
0.6 | 1.7 | GO:0030911 | TPR domain binding(GO:0030911) |
0.6 | 5.1 | GO:0016920 | pyroglutamyl-peptidase activity(GO:0016920) |
0.6 | 6.7 | GO:0005523 | tropomyosin binding(GO:0005523) |
0.6 | 2.2 | GO:0035368 | selenocysteine insertion sequence binding(GO:0035368) |
0.6 | 1.7 | GO:0016716 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, another compound as one donor, and incorporation of one atom of oxygen(GO:0016716) |
0.6 | 3.9 | GO:0098505 | G-rich strand telomeric DNA binding(GO:0098505) |
0.6 | 4.5 | GO:0016889 | endodeoxyribonuclease activity, producing 3'-phosphomonoesters(GO:0016889) |
0.6 | 2.2 | GO:0004749 | ribose phosphate diphosphokinase activity(GO:0004749) |
0.6 | 2.2 | GO:0004312 | fatty acid synthase activity(GO:0004312) |
0.6 | 2.8 | GO:1990380 | Lys48-specific deubiquitinase activity(GO:1990380) |
0.5 | 3.8 | GO:0035005 | 1-phosphatidylinositol-4-phosphate 3-kinase activity(GO:0035005) |
0.5 | 6.0 | GO:0099604 | calcium-release channel activity(GO:0015278) ligand-gated calcium channel activity(GO:0099604) |
0.5 | 5.4 | GO:0036312 | phosphatidylinositol 3-kinase regulatory subunit binding(GO:0036312) |
0.5 | 2.7 | GO:0061133 | endopeptidase activator activity(GO:0061133) |
0.5 | 2.7 | GO:0034916 | 4-methyloctanoyl-CoA dehydrogenase activity(GO:0034580) naphthyl-2-methyl-succinyl-CoA dehydrogenase activity(GO:0034845) 2-methylhexanoyl-CoA dehydrogenase activity(GO:0034916) propionyl-CoA dehydrogenase activity(GO:0043820) thiol-driven fumarate reductase activity(GO:0043830) coenzyme F420-dependent 2,4,6-trinitrophenol reductase activity(GO:0052758) coenzyme F420-dependent 2,4,6-trinitrophenol hydride reductase activity(GO:0052759) coenzyme F420-dependent 2,4-dinitrophenol reductase activity(GO:0052760) |
0.5 | 2.2 | GO:0004792 | thiosulfate sulfurtransferase activity(GO:0004792) |
0.5 | 6.4 | GO:0050811 | GABA receptor binding(GO:0050811) |
0.5 | 3.2 | GO:0030274 | LIM domain binding(GO:0030274) |
0.5 | 3.2 | GO:0017070 | U6 snRNA binding(GO:0017070) |
0.5 | 3.7 | GO:0015651 | quaternary ammonium group transmembrane transporter activity(GO:0015651) |
0.5 | 2.7 | GO:0070290 | N-acylphosphatidylethanolamine-specific phospholipase D activity(GO:0070290) |
0.5 | 6.4 | GO:0031701 | angiotensin receptor binding(GO:0031701) |
0.5 | 0.5 | GO:0004676 | 3-phosphoinositide-dependent protein kinase activity(GO:0004676) |
0.5 | 2.6 | GO:0000150 | recombinase activity(GO:0000150) |
0.5 | 5.7 | GO:0004535 | poly(A)-specific ribonuclease activity(GO:0004535) |
0.5 | 1.6 | GO:0004605 | phosphatidate cytidylyltransferase activity(GO:0004605) |
0.5 | 3.1 | GO:0031419 | cobalamin binding(GO:0031419) |
0.5 | 2.1 | GO:0043426 | MRF binding(GO:0043426) |
0.5 | 1.0 | GO:1990188 | euchromatin binding(GO:1990188) |
0.5 | 5.7 | GO:0015129 | lactate transmembrane transporter activity(GO:0015129) |
0.5 | 4.6 | GO:0004445 | inositol-polyphosphate 5-phosphatase activity(GO:0004445) |
0.5 | 1.5 | GO:0019862 | IgA binding(GO:0019862) |
0.5 | 1.5 | GO:0004949 | cannabinoid receptor activity(GO:0004949) |
0.5 | 0.5 | GO:1990715 | mRNA CDS binding(GO:1990715) |
0.5 | 1.0 | GO:0003997 | acyl-CoA oxidase activity(GO:0003997) |
0.5 | 3.0 | GO:0070097 | delta-catenin binding(GO:0070097) |
0.5 | 8.0 | GO:0001871 | pattern binding(GO:0001871) polysaccharide binding(GO:0030247) |
0.5 | 10.5 | GO:0005385 | zinc ion transmembrane transporter activity(GO:0005385) |
0.5 | 1.5 | GO:0016176 | superoxide-generating NADPH oxidase activator activity(GO:0016176) |
0.5 | 2.0 | GO:0004791 | thioredoxin-disulfide reductase activity(GO:0004791) |
0.5 | 8.4 | GO:0004709 | MAP kinase kinase kinase activity(GO:0004709) |
0.5 | 1.0 | GO:0050833 | pyruvate transmembrane transporter activity(GO:0050833) |
0.5 | 2.0 | GO:0047023 | androsterone dehydrogenase activity(GO:0047023) |
0.5 | 2.0 | GO:0010858 | calcium-dependent protein kinase regulator activity(GO:0010858) |
0.5 | 5.9 | GO:0008349 | MAP kinase kinase kinase kinase activity(GO:0008349) |
0.5 | 15.2 | GO:0031624 | ubiquitin conjugating enzyme binding(GO:0031624) |
0.5 | 1.0 | GO:0008379 | thioredoxin peroxidase activity(GO:0008379) |
0.5 | 0.5 | GO:0008905 | mannose-phosphate guanylyltransferase activity(GO:0008905) |
0.5 | 4.9 | GO:0004568 | chitinase activity(GO:0004568) |
0.5 | 1.9 | GO:0002060 | purine nucleobase binding(GO:0002060) |
0.5 | 1.4 | GO:0048027 | mRNA 5'-UTR binding(GO:0048027) |
0.5 | 5.7 | GO:0019206 | nucleoside kinase activity(GO:0019206) |
0.5 | 1.9 | GO:0005078 | MAP-kinase scaffold activity(GO:0005078) |
0.5 | 1.4 | GO:0004995 | tachykinin receptor activity(GO:0004995) |
0.5 | 0.5 | GO:0019912 | cyclin-dependent protein kinase activating kinase activity(GO:0019912) |
0.5 | 2.4 | GO:0030250 | cyclase activator activity(GO:0010853) guanylate cyclase activator activity(GO:0030250) |
0.5 | 3.8 | GO:0002162 | dystroglycan binding(GO:0002162) |
0.5 | 2.4 | GO:0001223 | transcription coactivator binding(GO:0001223) |
0.5 | 1.4 | GO:0071209 | U7 snRNA binding(GO:0071209) |
0.5 | 2.8 | GO:0035925 | mRNA 3'-UTR AU-rich region binding(GO:0035925) |
0.5 | 0.9 | GO:0043047 | single-stranded telomeric DNA binding(GO:0043047) |
0.5 | 2.8 | GO:0019966 | interleukin-1 binding(GO:0019966) |
0.5 | 6.6 | GO:0004745 | retinol dehydrogenase activity(GO:0004745) |
0.5 | 3.8 | GO:0008327 | methyl-CpG binding(GO:0008327) |
0.5 | 1.4 | GO:0005168 | neurotrophin TRKA receptor binding(GO:0005168) |
0.5 | 0.5 | GO:0032052 | bile acid binding(GO:0032052) |
0.5 | 3.3 | GO:0000900 | translation repressor activity, nucleic acid binding(GO:0000900) |
0.5 | 0.5 | GO:0005001 | transmembrane receptor protein tyrosine phosphatase activity(GO:0005001) |
0.5 | 9.2 | GO:0004879 | RNA polymerase II transcription factor activity, ligand-activated sequence-specific DNA binding(GO:0004879) transcription factor activity, direct ligand regulated sequence-specific DNA binding(GO:0098531) |
0.5 | 2.8 | GO:0004311 | farnesyltranstransferase activity(GO:0004311) |
0.5 | 2.7 | GO:0044548 | S100 protein binding(GO:0044548) |
0.5 | 1.8 | GO:0043140 | ATP-dependent 3'-5' DNA helicase activity(GO:0043140) |
0.5 | 2.3 | GO:0031849 | olfactory receptor binding(GO:0031849) |
0.5 | 1.4 | GO:0072542 | protein phosphatase activator activity(GO:0072542) |
0.4 | 0.9 | GO:0015111 | iodide transmembrane transporter activity(GO:0015111) |
0.4 | 1.3 | GO:0031685 | adenosine receptor binding(GO:0031685) |
0.4 | 1.3 | GO:0000832 | inositol hexakisphosphate kinase activity(GO:0000828) inositol hexakisphosphate 5-kinase activity(GO:0000832) inositol hexakisphosphate 1-kinase activity(GO:0052723) inositol hexakisphosphate 3-kinase activity(GO:0052724) |
0.4 | 7.1 | GO:0015035 | protein disulfide oxidoreductase activity(GO:0015035) |
0.4 | 4.0 | GO:0034450 | ubiquitin-ubiquitin ligase activity(GO:0034450) |
0.4 | 1.8 | GO:0003988 | acetyl-CoA C-acyltransferase activity(GO:0003988) |
0.4 | 4.9 | GO:0005388 | calcium-transporting ATPase activity(GO:0005388) |
0.4 | 1.3 | GO:0016661 | oxidoreductase activity, acting on other nitrogenous compounds as donors(GO:0016661) |
0.4 | 0.9 | GO:0004565 | beta-galactosidase activity(GO:0004565) |
0.4 | 6.5 | GO:0000993 | RNA polymerase II core binding(GO:0000993) |
0.4 | 2.6 | GO:0005114 | type II transforming growth factor beta receptor binding(GO:0005114) |
0.4 | 0.9 | GO:0005159 | insulin-like growth factor receptor binding(GO:0005159) |
0.4 | 1.3 | GO:0047192 | 1-alkylglycerophosphocholine O-acetyltransferase activity(GO:0047192) |
0.4 | 1.7 | GO:0051431 | corticotropin-releasing hormone receptor 2 binding(GO:0051431) |
0.4 | 1.7 | GO:0004566 | beta-glucuronidase activity(GO:0004566) |
0.4 | 1.7 | GO:0005326 | neurotransmitter transporter activity(GO:0005326) |
0.4 | 2.6 | GO:0047035 | testosterone dehydrogenase (NAD+) activity(GO:0047035) |
0.4 | 2.1 | GO:0030275 | LRR domain binding(GO:0030275) |
0.4 | 2.9 | GO:0010485 | H4 histone acetyltransferase activity(GO:0010485) |
0.4 | 2.9 | GO:0047372 | acylglycerol lipase activity(GO:0047372) |
0.4 | 10.3 | GO:0004032 | alditol:NADP+ 1-oxidoreductase activity(GO:0004032) |
0.4 | 1.2 | GO:0050693 | LBD domain binding(GO:0050693) |
0.4 | 3.7 | GO:0001161 | intronic transcription regulatory region sequence-specific DNA binding(GO:0001161) |
0.4 | 1.2 | GO:0070411 | I-SMAD binding(GO:0070411) |
0.4 | 0.4 | GO:1990829 | C-rich single-stranded DNA binding(GO:1990829) |
0.4 | 5.7 | GO:0008308 | voltage-gated anion channel activity(GO:0008308) |
0.4 | 1.2 | GO:0043262 | adenosine-diphosphatase activity(GO:0043262) |
0.4 | 2.4 | GO:0070891 | lipoteichoic acid binding(GO:0070891) |
0.4 | 1.6 | GO:0005173 | stem cell factor receptor binding(GO:0005173) |
0.4 | 1.2 | GO:0003876 | AMP deaminase activity(GO:0003876) adenosine-phosphate deaminase activity(GO:0047623) |
0.4 | 0.8 | GO:0002161 | aminoacyl-tRNA editing activity(GO:0002161) |
0.4 | 0.4 | GO:0015173 | aromatic amino acid transmembrane transporter activity(GO:0015173) |
0.4 | 1.2 | GO:0047756 | chondroitin 4-sulfotransferase activity(GO:0047756) |
0.4 | 1.2 | GO:0004800 | thyroxine 5'-deiodinase activity(GO:0004800) |
0.4 | 14.8 | GO:0003755 | peptidyl-prolyl cis-trans isomerase activity(GO:0003755) |
0.4 | 1.6 | GO:0003696 | satellite DNA binding(GO:0003696) |
0.4 | 2.4 | GO:0050897 | cobalt ion binding(GO:0050897) |
0.4 | 0.8 | GO:0043175 | RNA polymerase core enzyme binding(GO:0043175) |
0.4 | 1.2 | GO:0045134 | uridine-diphosphatase activity(GO:0045134) |
0.4 | 2.7 | GO:0003884 | D-amino-acid oxidase activity(GO:0003884) |
0.4 | 2.0 | GO:0030957 | Tat protein binding(GO:0030957) |
0.4 | 1.6 | GO:0004045 | aminoacyl-tRNA hydrolase activity(GO:0004045) |
0.4 | 1.6 | GO:0071074 | eukaryotic initiation factor eIF2 binding(GO:0071074) |
0.4 | 0.4 | GO:0051425 | PTB domain binding(GO:0051425) |
0.4 | 5.0 | GO:0043274 | phospholipase binding(GO:0043274) |
0.4 | 0.4 | GO:0098847 | sequence-specific single stranded DNA binding(GO:0098847) |
0.4 | 3.9 | GO:0045295 | gamma-catenin binding(GO:0045295) |
0.4 | 5.0 | GO:0016594 | glycine binding(GO:0016594) |
0.4 | 0.8 | GO:0004677 | DNA-dependent protein kinase activity(GO:0004677) |
0.4 | 1.5 | GO:0097157 | pre-mRNA intronic binding(GO:0097157) |
0.4 | 0.4 | GO:0052650 | NADP-retinol dehydrogenase activity(GO:0052650) |
0.4 | 0.4 | GO:0016635 | oxidoreductase activity, acting on the CH-CH group of donors, quinone or related compound as acceptor(GO:0016635) |
0.4 | 0.8 | GO:0042030 | ATPase inhibitor activity(GO:0042030) |
0.4 | 1.5 | GO:0005095 | GTPase inhibitor activity(GO:0005095) |
0.4 | 0.8 | GO:0004536 | deoxyribonuclease activity(GO:0004536) |
0.4 | 1.9 | GO:0016308 | 1-phosphatidylinositol-4-phosphate 5-kinase activity(GO:0016308) |
0.4 | 0.4 | GO:0031752 | D5 dopamine receptor binding(GO:0031752) |
0.4 | 11.2 | GO:0004364 | glutathione transferase activity(GO:0004364) |
0.4 | 1.9 | GO:0004957 | prostaglandin E receptor activity(GO:0004957) |
0.4 | 6.7 | GO:0070412 | R-SMAD binding(GO:0070412) |
0.4 | 1.8 | GO:0017040 | ceramidase activity(GO:0017040) |
0.4 | 2.2 | GO:0016443 | bidentate ribonuclease III activity(GO:0016443) |
0.4 | 1.8 | GO:0016783 | sulfurtransferase activity(GO:0016783) |
0.4 | 5.9 | GO:0019104 | DNA N-glycosylase activity(GO:0019104) |
0.4 | 4.7 | GO:0019789 | SUMO transferase activity(GO:0019789) |
0.4 | 1.8 | GO:0000774 | adenyl-nucleotide exchange factor activity(GO:0000774) |
0.4 | 2.9 | GO:0043024 | ribosomal small subunit binding(GO:0043024) |
0.4 | 1.1 | GO:0030284 | estrogen receptor activity(GO:0030284) |
0.4 | 10.8 | GO:0030374 | ligand-dependent nuclear receptor transcription coactivator activity(GO:0030374) |
0.4 | 9.0 | GO:0042974 | retinoic acid receptor binding(GO:0042974) |
0.4 | 16.5 | GO:0000979 | RNA polymerase II core promoter sequence-specific DNA binding(GO:0000979) |
0.4 | 0.7 | GO:0070051 | fibrinogen binding(GO:0070051) |
0.4 | 2.1 | GO:0001091 | RNA polymerase II basal transcription factor binding(GO:0001091) |
0.4 | 2.1 | GO:0030368 | interleukin-17 receptor activity(GO:0030368) |
0.4 | 2.1 | GO:0036122 | BMP binding(GO:0036122) |
0.4 | 8.8 | GO:0019706 | protein-cysteine S-palmitoyltransferase activity(GO:0019706) |
0.3 | 0.7 | GO:0048248 | CXCR3 chemokine receptor binding(GO:0048248) |
0.3 | 1.7 | GO:0005412 | glucose:sodium symporter activity(GO:0005412) |
0.3 | 1.0 | GO:0061676 | importin-alpha family protein binding(GO:0061676) |
0.3 | 4.2 | GO:0030881 | beta-2-microglobulin binding(GO:0030881) |
0.3 | 1.7 | GO:0000339 | RNA cap binding(GO:0000339) |
0.3 | 1.7 | GO:0016846 | carbon-sulfur lyase activity(GO:0016846) |
0.3 | 3.1 | GO:0061631 | ubiquitin conjugating enzyme activity(GO:0061631) |
0.3 | 1.4 | GO:0004614 | phosphoglucomutase activity(GO:0004614) |
0.3 | 2.1 | GO:0034046 | poly(G) binding(GO:0034046) |
0.3 | 4.4 | GO:0042800 | histone methyltransferase activity (H3-K4 specific)(GO:0042800) |
0.3 | 12.8 | GO:1990782 | protein tyrosine kinase binding(GO:1990782) |
0.3 | 4.4 | GO:0019825 | oxygen binding(GO:0019825) |
0.3 | 9.1 | GO:0015485 | cholesterol binding(GO:0015485) |
0.3 | 1.0 | GO:0003945 | N-acetyllactosamine synthase activity(GO:0003945) |
0.3 | 0.7 | GO:0005128 | erythropoietin receptor binding(GO:0005128) |
0.3 | 5.0 | GO:0004012 | phospholipid-translocating ATPase activity(GO:0004012) |
0.3 | 5.0 | GO:0070001 | aspartic-type endopeptidase activity(GO:0004190) aspartic-type peptidase activity(GO:0070001) |
0.3 | 2.3 | GO:0005223 | intracellular cGMP activated cation channel activity(GO:0005223) |
0.3 | 4.0 | GO:0016854 | racemase and epimerase activity(GO:0016854) |
0.3 | 0.3 | GO:0016838 | carbon-oxygen lyase activity, acting on phosphates(GO:0016838) |
0.3 | 2.3 | GO:0003836 | beta-galactoside (CMP) alpha-2,3-sialyltransferase activity(GO:0003836) |
0.3 | 6.6 | GO:0008483 | transaminase activity(GO:0008483) |
0.3 | 0.3 | GO:1901682 | sulfur compound transmembrane transporter activity(GO:1901682) |
0.3 | 6.5 | GO:0042169 | SH2 domain binding(GO:0042169) |
0.3 | 5.8 | GO:0017134 | fibroblast growth factor binding(GO:0017134) |
0.3 | 22.8 | GO:0004197 | cysteine-type endopeptidase activity(GO:0004197) |
0.3 | 0.6 | GO:0002094 | polyprenyltransferase activity(GO:0002094) |
0.3 | 1.9 | GO:0048406 | nerve growth factor binding(GO:0048406) |
0.3 | 1.3 | GO:0042979 | ornithine decarboxylase regulator activity(GO:0042979) |
0.3 | 1.3 | GO:0034235 | GPI anchor binding(GO:0034235) |
0.3 | 5.7 | GO:0005035 | tumor necrosis factor-activated receptor activity(GO:0005031) death receptor activity(GO:0005035) |
0.3 | 0.6 | GO:0008545 | JUN kinase kinase activity(GO:0008545) |
0.3 | 0.3 | GO:0001069 | regulatory region RNA binding(GO:0001069) |
0.3 | 13.6 | GO:0004559 | alpha-mannosidase activity(GO:0004559) |
0.3 | 1.6 | GO:0004111 | creatine kinase activity(GO:0004111) |
0.3 | 0.3 | GO:0015440 | peptide-transporting ATPase activity(GO:0015440) |
0.3 | 2.8 | GO:0015145 | monosaccharide transmembrane transporter activity(GO:0015145) |
0.3 | 0.3 | GO:0008525 | phosphatidylcholine transporter activity(GO:0008525) |
0.3 | 1.5 | GO:0004634 | phosphopyruvate hydratase activity(GO:0004634) |
0.3 | 3.1 | GO:0016922 | ligand-dependent nuclear receptor binding(GO:0016922) |
0.3 | 1.8 | GO:0019865 | immunoglobulin binding(GO:0019865) |
0.3 | 1.5 | GO:0004908 | interleukin-1 receptor activity(GO:0004908) |
0.3 | 0.9 | GO:0051734 | polynucleotide 5'-hydroxyl-kinase activity(GO:0051731) ATP-dependent polynucleotide kinase activity(GO:0051734) |
0.3 | 0.9 | GO:0004704 | NF-kappaB-inducing kinase activity(GO:0004704) |
0.3 | 2.1 | GO:0009931 | calcium-dependent protein serine/threonine kinase activity(GO:0009931) |
0.3 | 0.9 | GO:0033829 | O-fucosylpeptide 3-beta-N-acetylglucosaminyltransferase activity(GO:0033829) |
0.3 | 0.6 | GO:0004477 | methenyltetrahydrofolate cyclohydrolase activity(GO:0004477) methylenetetrahydrofolate dehydrogenase (NAD+) activity(GO:0004487) |
0.3 | 0.9 | GO:0003909 | DNA ligase activity(GO:0003909) DNA ligase (ATP) activity(GO:0003910) |
0.3 | 5.4 | GO:0043027 | cysteine-type endopeptidase inhibitor activity involved in apoptotic process(GO:0043027) |
0.3 | 0.6 | GO:0015928 | fucosidase activity(GO:0015928) |
0.3 | 1.8 | GO:0004768 | stearoyl-CoA 9-desaturase activity(GO:0004768) |
0.3 | 6.8 | GO:0045502 | dynein binding(GO:0045502) |
0.3 | 7.1 | GO:0015175 | neutral amino acid transmembrane transporter activity(GO:0015175) |
0.3 | 2.9 | GO:0070180 | large ribosomal subunit rRNA binding(GO:0070180) |
0.3 | 2.0 | GO:0008889 | glycerophosphodiester phosphodiesterase activity(GO:0008889) |
0.3 | 0.9 | GO:0001075 | transcription factor activity, RNA polymerase II core promoter sequence-specific binding involved in preinitiation complex assembly(GO:0001075) |
0.3 | 2.3 | GO:0004861 | cyclin-dependent protein serine/threonine kinase inhibitor activity(GO:0004861) |
0.3 | 1.4 | GO:0008454 | alpha-1,3-mannosylglycoprotein 4-beta-N-acetylglucosaminyltransferase activity(GO:0008454) |
0.3 | 10.1 | GO:0048487 | beta-tubulin binding(GO:0048487) |
0.3 | 0.9 | GO:0003829 | beta-1,3-galactosyl-O-glycosyl-glycoprotein beta-1,6-N-acetylglucosaminyltransferase activity(GO:0003829) |
0.3 | 0.3 | GO:0098821 | BMP receptor activity(GO:0098821) |
0.3 | 0.9 | GO:0046977 | TAP binding(GO:0046977) |
0.3 | 2.8 | GO:0005243 | gap junction channel activity(GO:0005243) |
0.3 | 0.3 | GO:0034713 | type I transforming growth factor beta receptor binding(GO:0034713) |
0.3 | 0.3 | GO:0005131 | growth hormone receptor binding(GO:0005131) |
0.3 | 1.1 | GO:0015185 | gamma-aminobutyric acid transmembrane transporter activity(GO:0015185) |
0.3 | 1.1 | GO:0001968 | fibronectin binding(GO:0001968) |
0.3 | 0.3 | GO:0008970 | phosphatidylcholine 1-acylhydrolase activity(GO:0008970) |
0.3 | 2.8 | GO:0034882 | protein-N-terminal asparagine amidohydrolase activity(GO:0008418) UDP-3-O-[3-hydroxymyristoyl] N-acetylglucosamine deacetylase activity(GO:0008759) iprodione amidohydrolase activity(GO:0018748) (3,5-dichlorophenylurea)acetate amidohydrolase activity(GO:0018749) 4'-(2-hydroxyisopropyl)phenylurea amidohydrolase activity(GO:0034571) didemethylisoproturon amidohydrolase activity(GO:0034573) N-isopropylacetanilide amidohydrolase activity(GO:0034576) N-cyclohexylformamide amidohydrolase activity(GO:0034781) isonicotinic acid hydrazide hydrolase activity(GO:0034876) cis-aconitamide amidase activity(GO:0034882) gamma-N-formylaminovinylacetate hydrolase activity(GO:0034885) N2-acetyl-L-lysine deacetylase activity(GO:0043747) O-succinylbenzoate synthase activity(GO:0043748) indoleacetamide hydrolase activity(GO:0043864) N-acetylcitrulline deacetylase activity(GO:0043909) N-acetylgalactosamine-6-phosphate deacetylase activity(GO:0047419) diacetylchitobiose deacetylase activity(GO:0052773) chitooligosaccharide deacetylase activity(GO:0052790) |
0.3 | 0.8 | GO:0015929 | hexosaminidase activity(GO:0015929) |
0.3 | 0.8 | GO:0019976 | interleukin-2 binding(GO:0019976) |
0.3 | 0.8 | GO:0005025 | transforming growth factor beta receptor activity, type I(GO:0005025) |
0.3 | 2.8 | GO:0015385 | sodium:proton antiporter activity(GO:0015385) potassium:proton antiporter activity(GO:0015386) |
0.3 | 1.9 | GO:0004540 | ribonuclease activity(GO:0004540) |
0.3 | 0.5 | GO:0004771 | sterol esterase activity(GO:0004771) |
0.3 | 0.8 | GO:0004616 | phosphogluconate dehydrogenase (decarboxylating) activity(GO:0004616) |
0.3 | 2.7 | GO:0034869 | 2-oxoglutaryl-CoA thioesterase activity(GO:0034843) 2,4,4-trimethyl-3-oxopentanoyl-CoA thioesterase activity(GO:0034869) 3-isopropylbut-3-enoyl-CoA thioesterase activity(GO:0034946) glutaryl-CoA hydrolase activity(GO:0044466) |
0.3 | 8.9 | GO:0004715 | non-membrane spanning protein tyrosine kinase activity(GO:0004715) |
0.3 | 0.3 | GO:0017151 | DEAD/H-box RNA helicase binding(GO:0017151) |
0.3 | 1.1 | GO:0052834 | inositol monophosphate 1-phosphatase activity(GO:0008934) inositol monophosphate 3-phosphatase activity(GO:0052832) inositol monophosphate 4-phosphatase activity(GO:0052833) inositol monophosphate phosphatase activity(GO:0052834) |
0.3 | 5.9 | GO:0005246 | calcium channel regulator activity(GO:0005246) |
0.3 | 7.0 | GO:0015171 | amino acid transmembrane transporter activity(GO:0015171) |
0.3 | 0.8 | GO:1990189 | peptide-serine-N-acetyltransferase activity(GO:1990189) peptide-glutamate-N-acetyltransferase activity(GO:1990190) |
0.3 | 0.3 | GO:0019187 | beta-1,4-mannosyltransferase activity(GO:0019187) |
0.3 | 1.1 | GO:0000213 | tRNA-intron endonuclease activity(GO:0000213) |
0.3 | 0.3 | GO:0030249 | cyclase regulator activity(GO:0010851) guanylate cyclase regulator activity(GO:0030249) |
0.3 | 1.0 | GO:0031779 | melanocortin receptor binding(GO:0031779) type 3 melanocortin receptor binding(GO:0031781) type 4 melanocortin receptor binding(GO:0031782) |
0.3 | 0.8 | GO:0016742 | hydroxymethyl-, formyl- and related transferase activity(GO:0016742) |
0.3 | 0.8 | GO:0071553 | uridine nucleotide receptor activity(GO:0015065) G-protein coupled pyrimidinergic nucleotide receptor activity(GO:0071553) |
0.3 | 1.3 | GO:0042301 | phosphate ion binding(GO:0042301) |
0.3 | 2.6 | GO:0004016 | adenylate cyclase activity(GO:0004016) |
0.3 | 0.3 | GO:0004942 | anaphylatoxin receptor activity(GO:0004942) |
0.3 | 0.8 | GO:0031802 | type 5 metabotropic glutamate receptor binding(GO:0031802) |
0.3 | 0.5 | GO:0004630 | phospholipase D activity(GO:0004630) |
0.3 | 6.7 | GO:0032266 | phosphatidylinositol-3-phosphate binding(GO:0032266) |
0.3 | 4.7 | GO:0016836 | hydro-lyase activity(GO:0016836) |
0.3 | 1.5 | GO:0035612 | AP-2 adaptor complex binding(GO:0035612) |
0.3 | 0.8 | GO:0004060 | arylamine N-acetyltransferase activity(GO:0004060) |
0.3 | 0.3 | GO:0051723 | protein methylesterase activity(GO:0051723) |
0.3 | 0.5 | GO:0030620 | U2 snRNA binding(GO:0030620) |
0.3 | 0.8 | GO:0046976 | histone methyltransferase activity (H3-K27 specific)(GO:0046976) |
0.2 | 2.7 | GO:0035497 | cAMP response element binding(GO:0035497) |
0.2 | 0.7 | GO:0008381 | mechanically-gated ion channel activity(GO:0008381) mechanically gated channel activity(GO:0022833) |
0.2 | 1.2 | GO:0070008 | serine-type exopeptidase activity(GO:0070008) |
0.2 | 1.0 | GO:0051022 | Rho GDP-dissociation inhibitor binding(GO:0051022) |
0.2 | 1.2 | GO:0070728 | leucine binding(GO:0070728) |
0.2 | 1.0 | GO:0004128 | cytochrome-b5 reductase activity, acting on NAD(P)H(GO:0004128) |
0.2 | 0.5 | GO:0031014 | troponin T binding(GO:0031014) |
0.2 | 2.4 | GO:0008307 | structural constituent of muscle(GO:0008307) |
0.2 | 5.3 | GO:0001105 | RNA polymerase II transcription coactivator activity(GO:0001105) |
0.2 | 0.7 | GO:1990932 | 5.8S rRNA binding(GO:1990932) |
0.2 | 0.7 | GO:0017089 | glycolipid transporter activity(GO:0017089) |
0.2 | 0.7 | GO:0001875 | lipopolysaccharide receptor activity(GO:0001875) |
0.2 | 4.9 | GO:0005154 | epidermal growth factor receptor binding(GO:0005154) |
0.2 | 0.5 | GO:0019961 | interferon binding(GO:0019961) |
0.2 | 1.1 | GO:0022820 | potassium:chloride symporter activity(GO:0015379) potassium ion symporter activity(GO:0022820) |
0.2 | 1.1 | GO:0003956 | NAD(P)+-protein-arginine ADP-ribosyltransferase activity(GO:0003956) |
0.2 | 3.9 | GO:0001056 | RNA polymerase III activity(GO:0001056) |
0.2 | 1.4 | GO:0016868 | intramolecular transferase activity, phosphotransferases(GO:0016868) |
0.2 | 0.7 | GO:0031127 | galactoside 2-alpha-L-fucosyltransferase activity(GO:0008107) alpha-(1,2)-fucosyltransferase activity(GO:0031127) |
0.2 | 4.5 | GO:0008139 | nuclear localization sequence binding(GO:0008139) |
0.2 | 0.2 | GO:0015137 | citrate transmembrane transporter activity(GO:0015137) tricarboxylic acid transmembrane transporter activity(GO:0015142) |
0.2 | 0.7 | GO:0030943 | mitochondrion targeting sequence binding(GO:0030943) |
0.2 | 0.7 | GO:0016899 | oxidoreductase activity, acting on the CH-OH group of donors, oxygen as acceptor(GO:0016899) |
0.2 | 3.6 | GO:0005520 | insulin-like growth factor binding(GO:0005520) |
0.2 | 1.3 | GO:0070273 | phosphatidylinositol-4-phosphate binding(GO:0070273) |
0.2 | 0.7 | GO:0015319 | sodium:inorganic phosphate symporter activity(GO:0015319) |
0.2 | 0.4 | GO:0043515 | kinetochore binding(GO:0043515) |
0.2 | 5.1 | GO:0042805 | actinin binding(GO:0042805) |
0.2 | 0.7 | GO:0052629 | phosphatidylinositol-3,5-bisphosphate 3-phosphatase activity(GO:0052629) |
0.2 | 5.3 | GO:0052745 | inositol phosphate phosphatase activity(GO:0052745) |
0.2 | 6.2 | GO:0004180 | carboxypeptidase activity(GO:0004180) |
0.2 | 0.2 | GO:0048020 | CCR chemokine receptor binding(GO:0048020) |
0.2 | 3.3 | GO:0004029 | aldehyde dehydrogenase (NAD) activity(GO:0004029) |
0.2 | 1.3 | GO:0019869 | chloride channel inhibitor activity(GO:0019869) |
0.2 | 0.6 | GO:0003872 | 6-phosphofructokinase activity(GO:0003872) |
0.2 | 0.2 | GO:0016653 | oxidoreductase activity, acting on NAD(P)H, heme protein as acceptor(GO:0016653) |
0.2 | 4.3 | GO:0038024 | cargo receptor activity(GO:0038024) |
0.2 | 1.1 | GO:0043008 | ATP-dependent protein binding(GO:0043008) |
0.2 | 3.8 | GO:0031489 | myosin V binding(GO:0031489) |
0.2 | 0.2 | GO:0010857 | calcium-dependent protein kinase activity(GO:0010857) |
0.2 | 0.6 | GO:0043422 | protein kinase B binding(GO:0043422) |
0.2 | 1.3 | GO:0004806 | triglyceride lipase activity(GO:0004806) |
0.2 | 2.5 | GO:0005521 | lamin binding(GO:0005521) |
0.2 | 0.4 | GO:0016634 | oxidoreductase activity, acting on the CH-CH group of donors, oxygen as acceptor(GO:0016634) |
0.2 | 1.3 | GO:0010181 | FMN binding(GO:0010181) |
0.2 | 0.6 | GO:0047184 | 1-acylglycerophosphocholine O-acyltransferase activity(GO:0047184) |
0.2 | 2.7 | GO:0017049 | GTP-Rho binding(GO:0017049) |
0.2 | 38.2 | GO:0008236 | serine-type peptidase activity(GO:0008236) serine hydrolase activity(GO:0017171) |
0.2 | 0.8 | GO:0017166 | vinculin binding(GO:0017166) |
0.2 | 0.2 | GO:0038181 | bile acid receptor activity(GO:0038181) |
0.2 | 2.3 | GO:0008574 | ATP-dependent microtubule motor activity, plus-end-directed(GO:0008574) |
0.2 | 14.5 | GO:0047485 | protein N-terminus binding(GO:0047485) |
0.2 | 8.9 | GO:0004860 | protein kinase inhibitor activity(GO:0004860) |
0.2 | 0.4 | GO:0031711 | bradykinin receptor binding(GO:0031711) |
0.2 | 0.8 | GO:0034618 | arginine binding(GO:0034618) |
0.2 | 20.2 | GO:0017137 | Rab GTPase binding(GO:0017137) |
0.2 | 0.6 | GO:0030158 | protein xylosyltransferase activity(GO:0030158) |
0.2 | 0.2 | GO:0050816 | phosphothreonine binding(GO:0050816) |
0.2 | 0.8 | GO:1990226 | histone methyltransferase binding(GO:1990226) |
0.2 | 0.2 | GO:0035197 | siRNA binding(GO:0035197) |
0.2 | 0.6 | GO:0004514 | nicotinate-nucleotide diphosphorylase (carboxylating) activity(GO:0004514) |
0.2 | 0.8 | GO:0031493 | nucleosomal histone binding(GO:0031493) |
0.2 | 0.4 | GO:0070698 | type I activin receptor binding(GO:0070698) |
0.2 | 0.2 | GO:0098518 | polynucleotide phosphatase activity(GO:0098518) |
0.2 | 0.8 | GO:0031435 | mitogen-activated protein kinase kinase kinase binding(GO:0031435) |
0.2 | 0.2 | GO:0017098 | sulfonylurea receptor binding(GO:0017098) |
0.2 | 1.4 | GO:0005123 | death receptor binding(GO:0005123) |
0.2 | 4.4 | GO:0016414 | O-octanoyltransferase activity(GO:0016414) |
0.2 | 0.2 | GO:0061134 | peptidase regulator activity(GO:0061134) |
0.2 | 0.6 | GO:0004924 | oncostatin-M receptor activity(GO:0004924) |
0.2 | 0.6 | GO:0050681 | androgen receptor binding(GO:0050681) |
0.2 | 1.3 | GO:0017160 | Ral GTPase binding(GO:0017160) |
0.2 | 0.6 | GO:0004946 | bombesin receptor activity(GO:0004946) |
0.2 | 1.9 | GO:0045236 | CXCR chemokine receptor binding(GO:0045236) |
0.2 | 2.8 | GO:0004653 | polypeptide N-acetylgalactosaminyltransferase activity(GO:0004653) |
0.2 | 0.2 | GO:0044390 | ubiquitin-like protein conjugating enzyme binding(GO:0044390) |
0.2 | 20.0 | GO:0004867 | serine-type endopeptidase inhibitor activity(GO:0004867) |
0.2 | 0.4 | GO:0031545 | peptidyl-proline 4-dioxygenase activity(GO:0031545) |
0.2 | 0.4 | GO:0005087 | Ran guanyl-nucleotide exchange factor activity(GO:0005087) |
0.2 | 0.2 | GO:0070679 | inositol 1,4,5 trisphosphate binding(GO:0070679) |
0.2 | 0.5 | GO:0008503 | benzodiazepine receptor activity(GO:0008503) |
0.2 | 1.8 | GO:0030332 | cyclin binding(GO:0030332) |
0.2 | 7.2 | GO:0016628 | oxidoreductase activity, acting on the CH-CH group of donors, NAD or NADP as acceptor(GO:0016628) |
0.2 | 2.3 | GO:0018024 | histone-lysine N-methyltransferase activity(GO:0018024) |
0.2 | 0.9 | GO:0008273 | calcium, potassium:sodium antiporter activity(GO:0008273) |
0.2 | 0.7 | GO:0017075 | syntaxin-1 binding(GO:0017075) |
0.2 | 0.4 | GO:0042134 | rRNA primary transcript binding(GO:0042134) |
0.2 | 0.2 | GO:0004723 | calcium-dependent protein serine/threonine phosphatase activity(GO:0004723) |
0.2 | 1.8 | GO:0046966 | thyroid hormone receptor binding(GO:0046966) |
0.2 | 3.0 | GO:0046961 | proton-transporting ATPase activity, rotational mechanism(GO:0046961) |
0.2 | 15.4 | GO:0004222 | metalloendopeptidase activity(GO:0004222) |
0.2 | 0.4 | GO:1904680 | peptide transmembrane transporter activity(GO:1904680) |
0.2 | 1.1 | GO:0042043 | neurexin family protein binding(GO:0042043) |
0.2 | 2.3 | GO:0005149 | interleukin-1 receptor binding(GO:0005149) |
0.2 | 1.0 | GO:0004169 | dolichyl-phosphate-mannose-protein mannosyltransferase activity(GO:0004169) |
0.2 | 1.6 | GO:0070700 | BMP receptor binding(GO:0070700) |
0.2 | 0.2 | GO:0019960 | C-X3-C chemokine binding(GO:0019960) |
0.2 | 0.5 | GO:0000983 | transcription factor activity, RNA polymerase II core promoter sequence-specific(GO:0000983) |
0.2 | 2.2 | GO:0003756 | protein disulfide isomerase activity(GO:0003756) intramolecular oxidoreductase activity, transposing S-S bonds(GO:0016864) |
0.2 | 0.9 | GO:0032036 | myosin heavy chain binding(GO:0032036) |
0.2 | 1.2 | GO:0008253 | 5'-nucleotidase activity(GO:0008253) |
0.2 | 1.2 | GO:0001595 | angiotensin receptor activity(GO:0001595) |
0.2 | 0.5 | GO:0004813 | alanine-tRNA ligase activity(GO:0004813) |
0.2 | 0.7 | GO:0004563 | beta-N-acetylhexosaminidase activity(GO:0004563) |
0.2 | 0.3 | GO:0048403 | brain-derived neurotrophic factor binding(GO:0048403) |
0.2 | 0.3 | GO:0004359 | glutaminase activity(GO:0004359) |
0.2 | 0.7 | GO:0004035 | alkaline phosphatase activity(GO:0004035) |
0.2 | 0.7 | GO:0004656 | procollagen-proline 4-dioxygenase activity(GO:0004656) |
0.2 | 0.3 | GO:0016615 | malate dehydrogenase activity(GO:0016615) |
0.2 | 0.8 | GO:0005021 | vascular endothelial growth factor-activated receptor activity(GO:0005021) |
0.2 | 0.5 | GO:0015377 | cation:chloride symporter activity(GO:0015377) |
0.2 | 0.7 | GO:0016286 | small conductance calcium-activated potassium channel activity(GO:0016286) |
0.2 | 0.3 | GO:0071558 | histone demethylase activity (H3-K27 specific)(GO:0071558) |
0.2 | 0.2 | GO:0042379 | chemokine receptor binding(GO:0042379) |
0.2 | 2.6 | GO:0016765 | transferase activity, transferring alkyl or aryl (other than methyl) groups(GO:0016765) |
0.2 | 2.3 | GO:0003725 | double-stranded RNA binding(GO:0003725) |
0.2 | 1.3 | GO:0016929 | SUMO-specific protease activity(GO:0016929) |
0.2 | 0.2 | GO:0019210 | kinase inhibitor activity(GO:0019210) |
0.2 | 0.7 | GO:0005047 | signal recognition particle binding(GO:0005047) |
0.2 | 4.9 | GO:0004812 | aminoacyl-tRNA ligase activity(GO:0004812) |
0.2 | 0.3 | GO:0005157 | macrophage colony-stimulating factor receptor binding(GO:0005157) |
0.2 | 0.3 | GO:0004972 | NMDA glutamate receptor activity(GO:0004972) |
0.2 | 0.8 | GO:0032050 | clathrin heavy chain binding(GO:0032050) |
0.2 | 0.3 | GO:0031735 | CCR10 chemokine receptor binding(GO:0031735) |
0.2 | 0.6 | GO:1904264 | ubiquitin protein ligase activity involved in ERAD pathway(GO:1904264) |
0.2 | 0.6 | GO:0004839 | ubiquitin activating enzyme activity(GO:0004839) |
0.2 | 1.1 | GO:0042054 | histone methyltransferase activity(GO:0042054) |
0.2 | 0.3 | GO:0016778 | diphosphotransferase activity(GO:0016778) |
0.2 | 1.2 | GO:0030296 | protein tyrosine kinase activator activity(GO:0030296) |
0.2 | 0.5 | GO:0008422 | beta-glucosidase activity(GO:0008422) |
0.2 | 0.8 | GO:0004000 | adenosine deaminase activity(GO:0004000) |
0.2 | 5.6 | GO:0005518 | collagen binding(GO:0005518) |
0.2 | 0.9 | GO:0008420 | CTD phosphatase activity(GO:0008420) |
0.2 | 15.5 | GO:0004519 | endonuclease activity(GO:0004519) |
0.2 | 4.2 | GO:0005109 | frizzled binding(GO:0005109) |
0.2 | 0.2 | GO:0008297 | single-stranded DNA exodeoxyribonuclease activity(GO:0008297) |
0.2 | 0.9 | GO:0008508 | bile acid:sodium symporter activity(GO:0008508) |
0.2 | 1.5 | GO:0008408 | 3'-5' exonuclease activity(GO:0008408) |
0.2 | 0.3 | GO:0016842 | amidine-lyase activity(GO:0016842) |
0.1 | 0.3 | GO:0004582 | dolichyl-phosphate beta-D-mannosyltransferase activity(GO:0004582) |
0.1 | 1.3 | GO:0003785 | actin monomer binding(GO:0003785) |
0.1 | 0.3 | GO:0004735 | pyrroline-5-carboxylate reductase activity(GO:0004735) |
0.1 | 0.4 | GO:0051870 | methotrexate binding(GO:0051870) |
0.1 | 0.7 | GO:0004415 | hyalurononglucosaminidase activity(GO:0004415) |
0.1 | 0.9 | GO:0034522 | pinocarveol dehydrogenase activity(GO:0018446) chloral hydrate dehydrogenase activity(GO:0018447) hydroxymethylmethylsilanediol oxidase activity(GO:0018448) 1-phenylethanol dehydrogenase activity(GO:0018449) myrtenol dehydrogenase activity(GO:0018450) cis-1,2-dihydroxy-1,2-dihydro-8-carboxynaphthalene dehydrogenase activity(GO:0034522) 3-hydroxy-4-methyloctanoyl-CoA dehydrogenase activity(GO:0034582) 2-hydroxy-4-isopropenylcyclohexane-1-carboxyl-CoA dehydrogenase activity(GO:0034778) cis-9,10-dihydroanthracene-9,10-diol dehydrogenase activity(GO:0034817) citronellol dehydrogenase activity(GO:0034821) naphthyl-2-hydroxymethyl-succinyl-CoA dehydrogenase activity(GO:0034847) 2,4,4-trimethyl-1-pentanol dehydrogenase activity(GO:0034863) 2,4,4-trimethyl-3-hydroxypentanoyl-CoA dehydrogenase activity(GO:0034868) 1-hydroxy-4,4-dimethylpentan-3-one dehydrogenase activity(GO:0034871) endosulfan diol dehydrogenase activity(GO:0034891) endosulfan hydroxyether dehydrogenase activity(GO:0034901) 3-hydroxy-2-methylhexanoyl-CoA dehydrogenase activity(GO:0034918) 3-hydroxy-2,6-dimethyl-5-methylene-heptanoyl-CoA dehydrogenase activity(GO:0034944) versicolorin reductase activity(GO:0042469) ketoreductase activity(GO:0045703) |
0.1 | 1.6 | GO:0030551 | cyclic nucleotide binding(GO:0030551) |
0.1 | 2.2 | GO:0031491 | nucleosome binding(GO:0031491) |
0.1 | 0.7 | GO:0019911 | structural constituent of myelin sheath(GO:0019911) |
0.1 | 1.8 | GO:0035326 | enhancer binding(GO:0035326) |
0.1 | 0.8 | GO:0008933 | lytic transglycosylase activity(GO:0008933) |
0.1 | 0.8 | GO:0047760 | butyrate-CoA ligase activity(GO:0047760) |
0.1 | 1.1 | GO:0015125 | bile acid transmembrane transporter activity(GO:0015125) |
0.1 | 0.5 | GO:0017176 | phosphatidylinositol N-acetylglucosaminyltransferase activity(GO:0017176) |
0.1 | 0.1 | GO:0008504 | monoamine transmembrane transporter activity(GO:0008504) |
0.1 | 1.2 | GO:0042162 | telomeric DNA binding(GO:0042162) |
0.1 | 1.0 | GO:1990446 | U1 snRNP binding(GO:1990446) |
0.1 | 0.3 | GO:0004448 | isocitrate dehydrogenase activity(GO:0004448) |
0.1 | 2.6 | GO:0030215 | semaphorin receptor binding(GO:0030215) |
0.1 | 1.1 | GO:0103116 | alpha-D-galactofuranose transporter activity(GO:0103116) |
0.1 | 1.2 | GO:0016493 | C-C chemokine receptor activity(GO:0016493) |
0.1 | 7.3 | GO:0070851 | growth factor receptor binding(GO:0070851) |
0.1 | 0.1 | GO:0042809 | vitamin D receptor binding(GO:0042809) |
0.1 | 1.7 | GO:0003707 | steroid hormone receptor activity(GO:0003707) |
0.1 | 2.9 | GO:0001205 | transcriptional activator activity, RNA polymerase II distal enhancer sequence-specific binding(GO:0001205) |
0.1 | 0.1 | GO:0097001 | ceramide binding(GO:0097001) |
0.1 | 0.3 | GO:0097322 | 7SK snRNA binding(GO:0097322) |
0.1 | 0.3 | GO:0034452 | dynactin binding(GO:0034452) |
0.1 | 0.3 | GO:0042285 | UDP-xylosyltransferase activity(GO:0035252) xylosyltransferase activity(GO:0042285) |
0.1 | 0.6 | GO:1990405 | protein antigen binding(GO:1990405) |
0.1 | 10.1 | GO:0005506 | iron ion binding(GO:0005506) |
0.1 | 0.3 | GO:0016262 | protein N-acetylglucosaminyltransferase activity(GO:0016262) |
0.1 | 2.8 | GO:0005212 | structural constituent of eye lens(GO:0005212) |
0.1 | 0.9 | GO:0001134 | transcription factor activity, transcription factor recruiting(GO:0001134) |
0.1 | 0.8 | GO:0099602 | acetylcholine receptor regulator activity(GO:0030548) neurotransmitter receptor regulator activity(GO:0099602) |
0.1 | 0.4 | GO:0042975 | peroxisome proliferator activated receptor binding(GO:0042975) |
0.1 | 9.5 | GO:0001078 | transcriptional repressor activity, RNA polymerase II core promoter proximal region sequence-specific binding(GO:0001078) |
0.1 | 0.4 | GO:0019002 | GMP binding(GO:0019002) |
0.1 | 0.2 | GO:0016715 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, reduced ascorbate as one donor, and incorporation of one atom of oxygen(GO:0016715) |
0.1 | 0.1 | GO:0048156 | tau protein binding(GO:0048156) |
0.1 | 0.6 | GO:0019784 | NEDD8-specific protease activity(GO:0019784) |
0.1 | 20.8 | GO:0003735 | structural constituent of ribosome(GO:0003735) |
0.1 | 1.8 | GO:0005540 | hyaluronic acid binding(GO:0005540) |
0.1 | 0.2 | GO:0038100 | nodal binding(GO:0038100) |
0.1 | 0.3 | GO:0004999 | vasoactive intestinal polypeptide receptor activity(GO:0004999) |
0.1 | 0.9 | GO:0050321 | tau-protein kinase activity(GO:0050321) |
0.1 | 3.1 | GO:0005546 | phosphatidylinositol-4,5-bisphosphate binding(GO:0005546) |
0.1 | 0.7 | GO:0008140 | cAMP response element binding protein binding(GO:0008140) |
0.1 | 0.5 | GO:0016505 | peptidase activator activity involved in apoptotic process(GO:0016505) |
0.1 | 0.2 | GO:0000268 | peroxisome targeting sequence binding(GO:0000268) |
0.1 | 0.2 | GO:0031730 | CCR5 chemokine receptor binding(GO:0031730) |
0.1 | 5.1 | GO:0003777 | microtubule motor activity(GO:0003777) |
0.1 | 0.8 | GO:0015279 | store-operated calcium channel activity(GO:0015279) |
0.1 | 0.7 | GO:0050786 | RAGE receptor binding(GO:0050786) |
0.1 | 0.2 | GO:0051429 | corticotropin-releasing hormone receptor binding(GO:0051429) corticotropin-releasing hormone receptor 1 binding(GO:0051430) |
0.1 | 0.1 | GO:0018575 | tryptophan 2,3-dioxygenase activity(GO:0004833) 2,3-dihydroxy DDT 1,2-dioxygenase activity(GO:0018542) phenanthrene dioxygenase activity(GO:0018555) 2,2',3-trihydroxybiphenyl dioxygenase activity(GO:0018556) 1,2-dihydroxyfluorene 1,1-alpha-dioxygenase activity(GO:0018557) 5,6-dihydroxy-3-methyl-2-oxo-1,2-dihydroquinoline dioxygenase activity(GO:0018558) 1,1-dichloro-2-(dihydroxy-4-chlorophenyl)-(4-chlorophenyl)ethene 1,2-dioxygenase activity(GO:0018559) protocatechuate 3,4-dioxygenase type II activity(GO:0018560) 2'-aminobiphenyl-2,3-diol 1,2-dioxygenase activity(GO:0018561) 3,4-dihydroxyfluorene 4,4-alpha-dioxygenase activity(GO:0018562) 2,3-dihydroxy-ethylbenzene 1,2-dioxygenase activity(GO:0018563) carbazole 1,9a-dioxygenase activity(GO:0018564) dihydroxydibenzothiophene dioxygenase activity(GO:0018565) 1,2-dihydroxynaphthalene-6-sulfonate 1,8a-dioxygenase activity(GO:0018566) styrene dioxygenase activity(GO:0018567) 3,4-dihydroxyphenanthrene dioxygenase activity(GO:0018568) hydroquinone 1,2-dioxygenase activity(GO:0018569) p-cumate 2,3-dioxygenase activity(GO:0018570) 2,3-dihydroxy-p-cumate dioxygenase activity(GO:0018571) 3,5-dichlorocatechol 1,2-dioxygenase activity(GO:0018572) 2-aminophenol 1,6-dioxygenase activity(GO:0018573) 2,6-dichloro-p-hydroquinone 1,2-dioxygenase activity(GO:0018574) chlorocatechol 1,2-dioxygenase activity(GO:0018575) catechol dioxygenase activity(GO:0019114) dihydroxyfluorene dioxygenase activity(GO:0019117) 5-aminosalicylate dioxygenase activity(GO:0034543) 3-hydroxy-2-naphthoate 2,3-dioxygenase activity(GO:0034803) benzo(a)pyrene 11,12-dioxygenase activity(GO:0034806) benzo(a)pyrene 4,5-dioxygenase activity(GO:0034808) 4,5-dihydroxybenzo(a)pyrene dioxygenase activity(GO:0034810) benzo(a)pyrene 9,10-dioxygenase activity(GO:0034811) 9,10-dihydroxybenzo(a)pyrene dioxygenase activity(GO:0034812) benzo(a)pyrene 7,8-dioxygenase activity(GO:0034813) 7,8-dihydroxy benzo(a)pyrene dioxygenase activity(GO:0034814) 1,2-dihydroxy-5,6,7,8-tetrahydronaphthalene extradiol dioxygenase activity(GO:0034827) 2-mercaptobenzothiazole dioxygenase activity(GO:0034834) pyridine-3,4-diol dioxygenase activity(GO:0034895) pyrene dioxygenase activity(GO:0034920) 4,5-dihydroxypyrene dioxygenase activity(GO:0034922) phenanthrene-4-carboxylate dioxygenase activity(GO:0034934) tetrachlorobenzene dioxygenase activity(GO:0034935) 4,6-dichloro-3-methylcatechol 1,2-dioxygenase activity(GO:0034936) 2,3-dihydroxydiphenyl ether dioxygenase activity(GO:0034955) diphenyl ether 1,2-dioxygenase activity(GO:0034956) arachidonate 8(S)-lipoxygenase activity(GO:0036403) 4-hydroxycatechol 1,2-dioxygenase activity(GO:0047074) |
0.1 | 0.5 | GO:0001055 | RNA polymerase II activity(GO:0001055) |
0.1 | 0.4 | GO:0048185 | activin binding(GO:0048185) |
0.1 | 0.3 | GO:0008641 | small protein activating enzyme activity(GO:0008641) |
0.1 | 0.6 | GO:0019238 | cyclohydrolase activity(GO:0019238) |
0.1 | 0.1 | GO:0038191 | neuropilin binding(GO:0038191) |
0.1 | 0.3 | GO:0034511 | U3 snoRNA binding(GO:0034511) |
0.1 | 3.8 | GO:0008013 | beta-catenin binding(GO:0008013) |
0.1 | 0.1 | GO:0070840 | dynein complex binding(GO:0070840) |
0.1 | 0.9 | GO:0005542 | folic acid binding(GO:0005542) |
0.1 | 0.5 | GO:0050664 | oxidoreductase activity, acting on NAD(P)H, oxygen as acceptor(GO:0050664) |
0.1 | 3.6 | GO:0008138 | protein tyrosine/serine/threonine phosphatase activity(GO:0008138) |
0.1 | 0.1 | GO:0016015 | morphogen activity(GO:0016015) |
0.1 | 0.9 | GO:0043548 | phosphatidylinositol 3-kinase binding(GO:0043548) |
0.1 | 0.2 | GO:0034481 | chondroitin sulfotransferase activity(GO:0034481) |
0.1 | 0.3 | GO:0004967 | glucagon receptor activity(GO:0004967) |
0.1 | 1.2 | GO:0015026 | coreceptor activity(GO:0015026) |
0.1 | 0.2 | GO:0003720 | telomerase activity(GO:0003720) RNA-directed DNA polymerase activity(GO:0003964) |
0.1 | 1.8 | GO:0016706 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, 2-oxoglutarate as one donor, and incorporation of one atom each of oxygen into both donors(GO:0016706) |
0.1 | 15.0 | GO:0005125 | cytokine activity(GO:0005125) |
0.1 | 0.1 | GO:0004694 | eukaryotic translation initiation factor 2alpha kinase activity(GO:0004694) |
0.1 | 0.2 | GO:0016713 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, reduced iron-sulfur protein as one donor, and incorporation of one atom of oxygen(GO:0016713) |
0.1 | 0.5 | GO:0001054 | RNA polymerase I activity(GO:0001054) |
0.1 | 0.2 | GO:0055102 | lipase inhibitor activity(GO:0055102) |
0.1 | 0.2 | GO:0070883 | pre-miRNA binding(GO:0070883) |
0.1 | 0.1 | GO:0015211 | purine nucleoside transmembrane transporter activity(GO:0015211) |
0.1 | 0.9 | GO:0001671 | ATPase activator activity(GO:0001671) |
0.1 | 0.4 | GO:0004966 | galanin receptor activity(GO:0004966) |
0.1 | 0.9 | GO:0004774 | succinate-CoA ligase activity(GO:0004774) |
0.1 | 1.3 | GO:0008157 | protein phosphatase 1 binding(GO:0008157) |
0.1 | 0.2 | GO:0008384 | IkappaB kinase activity(GO:0008384) |
0.1 | 1.7 | GO:0019894 | kinesin binding(GO:0019894) |
0.1 | 0.7 | GO:0036442 | hydrogen-exporting ATPase activity(GO:0036442) |
0.1 | 0.8 | GO:0070063 | RNA polymerase binding(GO:0070063) |
0.1 | 0.4 | GO:0008486 | diphosphoinositol-polyphosphate diphosphatase activity(GO:0008486) |
0.1 | 2.0 | GO:0097472 | cyclin-dependent protein serine/threonine kinase activity(GO:0004693) cyclin-dependent protein kinase activity(GO:0097472) |
0.1 | 0.3 | GO:0008321 | Ral guanyl-nucleotide exchange factor activity(GO:0008321) |
0.1 | 0.4 | GO:0001222 | transcription corepressor binding(GO:0001222) |
0.1 | 0.7 | GO:0043014 | alpha-tubulin binding(GO:0043014) |
0.1 | 0.3 | GO:0004518 | nuclease activity(GO:0004518) |
0.1 | 1.9 | GO:0000049 | tRNA binding(GO:0000049) |
0.1 | 7.7 | GO:0050839 | cell adhesion molecule binding(GO:0050839) |
0.1 | 0.5 | GO:0003854 | 3-beta-hydroxy-delta5-steroid dehydrogenase activity(GO:0003854) |
0.1 | 0.2 | GO:0004691 | cAMP-dependent protein kinase activity(GO:0004691) |
0.1 | 0.9 | GO:0004402 | histone acetyltransferase activity(GO:0004402) |
0.1 | 0.5 | GO:0001665 | alpha-N-acetylgalactosaminide alpha-2,6-sialyltransferase activity(GO:0001665) |
0.1 | 0.1 | GO:0043559 | insulin binding(GO:0043559) |
0.1 | 0.5 | GO:0033691 | sialic acid binding(GO:0033691) |
0.1 | 0.9 | GO:0008186 | RNA helicase activity(GO:0003724) ATP-dependent RNA helicase activity(GO:0004004) RNA-dependent ATPase activity(GO:0008186) |
0.1 | 0.3 | GO:0016647 | oxidoreductase activity, acting on the CH-NH group of donors, oxygen as acceptor(GO:0016647) |
0.1 | 0.4 | GO:0032184 | SUMO polymer binding(GO:0032184) |
0.1 | 0.6 | GO:0050291 | sphingosine N-acyltransferase activity(GO:0050291) |
0.1 | 0.4 | GO:0034584 | piRNA binding(GO:0034584) |
0.1 | 0.3 | GO:0030628 | pre-mRNA 3'-splice site binding(GO:0030628) |
0.1 | 0.3 | GO:0051766 | inositol trisphosphate kinase activity(GO:0051766) |
0.1 | 1.0 | GO:0001730 | 2'-5'-oligoadenylate synthetase activity(GO:0001730) |
0.1 | 0.1 | GO:0008061 | chitin binding(GO:0008061) |
0.1 | 11.2 | GO:0030246 | carbohydrate binding(GO:0030246) |
0.1 | 12.2 | GO:0005096 | GTPase activator activity(GO:0005096) |
0.1 | 0.2 | GO:0004065 | arylsulfatase activity(GO:0004065) |
0.1 | 0.3 | GO:0016641 | oxidoreductase activity, acting on the CH-NH2 group of donors, oxygen as acceptor(GO:0016641) |
0.1 | 0.3 | GO:0070566 | adenylyltransferase activity(GO:0070566) |
0.1 | 0.3 | GO:0036310 | annealing helicase activity(GO:0036310) |
0.1 | 0.2 | GO:0004726 | non-membrane spanning protein tyrosine phosphatase activity(GO:0004726) |
0.1 | 0.2 | GO:0043237 | laminin-1 binding(GO:0043237) |
0.1 | 0.5 | GO:0043023 | ribosomal large subunit binding(GO:0043023) |
0.1 | 0.2 | GO:0016668 | oxidoreductase activity, acting on a sulfur group of donors, NAD(P) as acceptor(GO:0016668) |
0.1 | 0.2 | GO:0050508 | glucuronosyl-N-acetylglucosaminyl-proteoglycan 4-alpha-N-acetylglucosaminyltransferase activity(GO:0050508) |
0.1 | 0.2 | GO:0030983 | mismatched DNA binding(GO:0030983) |
0.1 | 0.2 | GO:0030280 | structural constituent of epidermis(GO:0030280) |
0.1 | 0.2 | GO:0035256 | G-protein coupled glutamate receptor binding(GO:0035256) |
0.1 | 0.6 | GO:0070577 | lysine-acetylated histone binding(GO:0070577) |
0.1 | 0.5 | GO:0016681 | ubiquinol-cytochrome-c reductase activity(GO:0008121) oxidoreductase activity, acting on diphenols and related substances as donors, cytochrome as acceptor(GO:0016681) |
0.1 | 6.8 | GO:0003713 | transcription coactivator activity(GO:0003713) |
0.1 | 0.3 | GO:0015368 | calcium:sodium antiporter activity(GO:0005432) calcium:cation antiporter activity(GO:0015368) |
0.1 | 0.4 | GO:0005113 | patched binding(GO:0005113) |
0.1 | 0.7 | GO:0016701 | oxidoreductase activity, acting on single donors with incorporation of molecular oxygen(GO:0016701) |
0.1 | 0.7 | GO:0001102 | RNA polymerase II activating transcription factor binding(GO:0001102) |
0.1 | 1.9 | GO:0001085 | RNA polymerase II transcription factor binding(GO:0001085) |
0.1 | 0.4 | GO:0015301 | anion:anion antiporter activity(GO:0015301) |
0.1 | 0.5 | GO:0016884 | carbon-nitrogen ligase activity, with glutamine as amido-N-donor(GO:0016884) |
0.1 | 1.0 | GO:0017091 | AU-rich element binding(GO:0017091) |
0.1 | 0.1 | GO:0019843 | rRNA binding(GO:0019843) |
0.1 | 0.2 | GO:0030371 | translation repressor activity(GO:0030371) |
0.1 | 1.8 | GO:0048306 | calcium-dependent protein binding(GO:0048306) |
0.1 | 0.3 | GO:0071837 | HMG box domain binding(GO:0071837) |
0.1 | 0.1 | GO:0016885 | ligase activity, forming carbon-carbon bonds(GO:0016885) |
0.1 | 0.5 | GO:0001608 | G-protein coupled nucleotide receptor activity(GO:0001608) G-protein coupled purinergic nucleotide receptor activity(GO:0045028) |
0.1 | 0.6 | GO:0005522 | profilin binding(GO:0005522) |
0.1 | 1.5 | GO:0004114 | 3',5'-cyclic-nucleotide phosphodiesterase activity(GO:0004114) |
0.1 | 2.3 | GO:0008527 | taste receptor activity(GO:0008527) |
0.1 | 0.2 | GO:0046923 | ER retention sequence binding(GO:0046923) |
0.1 | 0.1 | GO:0016289 | CoA hydrolase activity(GO:0016289) |
0.1 | 0.1 | GO:0004703 | G-protein coupled receptor kinase activity(GO:0004703) |
0.1 | 0.6 | GO:0016500 | protein-hormone receptor activity(GO:0016500) |
0.1 | 1.1 | GO:0001046 | core promoter sequence-specific DNA binding(GO:0001046) |
0.1 | 0.9 | GO:0005229 | intracellular calcium activated chloride channel activity(GO:0005229) |
0.1 | 0.1 | GO:0070990 | snRNP binding(GO:0070990) |
0.1 | 0.1 | GO:0046933 | proton-transporting ATP synthase activity, rotational mechanism(GO:0046933) |
0.1 | 0.1 | GO:0016415 | octanoyltransferase activity(GO:0016415) |
0.1 | 0.1 | GO:0047045 | testosterone 17-beta-dehydrogenase (NADP+) activity(GO:0047045) |
0.1 | 0.4 | GO:0003796 | lysozyme activity(GO:0003796) |
0.1 | 0.5 | GO:0030276 | clathrin binding(GO:0030276) |
0.1 | 0.2 | GO:0004689 | phosphorylase kinase activity(GO:0004689) |
0.1 | 0.1 | GO:0003916 | DNA topoisomerase activity(GO:0003916) |
0.1 | 0.1 | GO:0019237 | centromeric DNA binding(GO:0019237) |
0.1 | 0.1 | GO:0004741 | [pyruvate dehydrogenase (lipoamide)] phosphatase activity(GO:0004741) |
0.1 | 0.9 | GO:0003887 | DNA-directed DNA polymerase activity(GO:0003887) |
0.1 | 0.1 | GO:0001962 | alpha-1,3-galactosyltransferase activity(GO:0001962) |
0.1 | 0.1 | GO:0004438 | phosphatidylinositol-3-phosphatase activity(GO:0004438) |
0.1 | 0.3 | GO:0004977 | melanocortin receptor activity(GO:0004977) |
0.0 | 0.1 | GO:0042608 | T cell receptor binding(GO:0042608) |
0.0 | 0.4 | GO:0015250 | water channel activity(GO:0015250) |
0.0 | 0.1 | GO:0016670 | oxidoreductase activity, acting on a sulfur group of donors, oxygen as acceptor(GO:0016670) |
0.0 | 0.1 | GO:0005484 | SNAP receptor activity(GO:0005484) |
0.0 | 1.3 | GO:0003705 | transcription factor activity, RNA polymerase II distal enhancer sequence-specific binding(GO:0003705) |
0.0 | 0.7 | GO:0003950 | NAD+ ADP-ribosyltransferase activity(GO:0003950) |
0.0 | 0.1 | GO:0004301 | epoxide hydrolase activity(GO:0004301) |
0.0 | 0.5 | GO:0004683 | calmodulin-dependent protein kinase activity(GO:0004683) |
0.0 | 0.3 | GO:0003688 | DNA replication origin binding(GO:0003688) |
0.0 | 0.2 | GO:1990247 | N6-methyladenosine-containing RNA binding(GO:1990247) |
0.0 | 2.8 | GO:0015020 | glucuronosyltransferase activity(GO:0015020) |
0.0 | 0.2 | GO:0004370 | glycerol kinase activity(GO:0004370) |
0.0 | 0.0 | GO:0016724 | ferroxidase activity(GO:0004322) oxidoreductase activity, oxidizing metal ions, oxygen as acceptor(GO:0016724) |
0.0 | 0.0 | GO:0070034 | telomerase RNA binding(GO:0070034) |
0.0 | 0.3 | GO:0019840 | isoprenoid binding(GO:0019840) |
0.0 | 0.3 | GO:1990841 | promoter-specific chromatin binding(GO:1990841) |
0.0 | 2.4 | GO:0051015 | actin filament binding(GO:0051015) |
0.0 | 0.0 | GO:0032452 | histone demethylase activity(GO:0032452) |
0.0 | 0.1 | GO:0031628 | opioid receptor binding(GO:0031628) |
0.0 | 0.2 | GO:0008410 | CoA-transferase activity(GO:0008410) |
0.0 | 0.4 | GO:0009881 | photoreceptor activity(GO:0009881) |
0.0 | 0.2 | GO:0034237 | protein kinase A regulatory subunit binding(GO:0034237) |
0.0 | 0.1 | GO:0015450 | P-P-bond-hydrolysis-driven protein transmembrane transporter activity(GO:0015450) |
0.0 | 0.2 | GO:0004767 | sphingomyelin phosphodiesterase activity(GO:0004767) |
0.0 | 0.4 | GO:0043531 | ADP binding(GO:0043531) |
0.0 | 0.1 | GO:0019870 | potassium channel inhibitor activity(GO:0019870) |
0.0 | 0.1 | GO:0004719 | protein-L-isoaspartate (D-aspartate) O-methyltransferase activity(GO:0004719) |
0.0 | 0.2 | GO:0016901 | oxidoreductase activity, acting on the CH-OH group of donors, quinone or similar compound as acceptor(GO:0016901) |
0.0 | 0.2 | GO:0001727 | lipid kinase activity(GO:0001727) |
0.0 | 0.1 | GO:0004974 | leukotriene receptor activity(GO:0004974) |
0.0 | 0.4 | GO:0005452 | inorganic anion exchanger activity(GO:0005452) |
0.0 | 0.3 | GO:0030515 | snoRNA binding(GO:0030515) |
0.0 | 0.6 | GO:0003684 | damaged DNA binding(GO:0003684) |
0.0 | 4.0 | GO:0061630 | ubiquitin protein ligase activity(GO:0061630) |
0.0 | 0.1 | GO:0003873 | 6-phosphofructo-2-kinase activity(GO:0003873) |
0.0 | 0.1 | GO:0051185 | coenzyme transporter activity(GO:0051185) |
0.0 | 0.1 | GO:0008266 | poly(U) RNA binding(GO:0008266) |
0.0 | 0.2 | GO:0031386 | protein tag(GO:0031386) |
0.0 | 0.2 | GO:0051537 | 2 iron, 2 sulfur cluster binding(GO:0051537) |
0.0 | 1.3 | GO:0001227 | transcriptional repressor activity, RNA polymerase II transcription regulatory region sequence-specific binding(GO:0001227) |
0.0 | 14.2 | GO:0005549 | odorant binding(GO:0005549) |
0.0 | 1.2 | GO:0030414 | peptidase inhibitor activity(GO:0030414) |
0.0 | 0.1 | GO:0055131 | C3HC4-type RING finger domain binding(GO:0055131) |
0.0 | 0.1 | GO:0019107 | myristoyltransferase activity(GO:0019107) |
0.0 | 0.5 | GO:0070003 | threonine-type endopeptidase activity(GO:0004298) threonine-type peptidase activity(GO:0070003) |
0.0 | 0.1 | GO:0000146 | microfilament motor activity(GO:0000146) |
0.0 | 0.2 | GO:0042056 | chemoattractant activity(GO:0042056) |
0.0 | 14.9 | GO:0044822 | poly(A) RNA binding(GO:0044822) |
0.0 | 0.0 | GO:0034596 | phosphatidylinositol phosphate 4-phosphatase activity(GO:0034596) |
0.0 | 0.0 | GO:0090484 | drug transporter activity(GO:0090484) |
0.0 | 0.5 | GO:0042605 | peptide antigen binding(GO:0042605) |
0.0 | 6.3 | GO:0004672 | protein kinase activity(GO:0004672) |
0.0 | 0.0 | GO:0004033 | aldo-keto reductase (NADP) activity(GO:0004033) |
0.0 | 1.4 | GO:0000149 | SNARE binding(GO:0000149) |
0.0 | 0.1 | GO:0005000 | vasopressin receptor activity(GO:0005000) |
0.0 | 0.0 | GO:0036002 | pre-mRNA binding(GO:0036002) |
0.0 | 0.4 | GO:0005184 | neuropeptide hormone activity(GO:0005184) |
0.0 | 0.0 | GO:0030545 | receptor regulator activity(GO:0030545) |
0.0 | 1.0 | GO:0042393 | histone binding(GO:0042393) |
0.0 | 0.1 | GO:0015036 | disulfide oxidoreductase activity(GO:0015036) |
0.0 | 0.0 | GO:1990381 | ubiquitin-specific protease binding(GO:1990381) |
0.0 | 0.0 | GO:0016822 | hydrolase activity, acting on acid carbon-carbon bonds(GO:0016822) hydrolase activity, acting on acid carbon-carbon bonds, in ketonic substances(GO:0016823) |
0.0 | 0.0 | GO:0001099 | basal transcription machinery binding(GO:0001098) basal RNA polymerase II transcription machinery binding(GO:0001099) |
0.0 | 0.0 | GO:0051920 | peroxiredoxin activity(GO:0051920) |
0.0 | 0.0 | GO:0004645 | phosphorylase activity(GO:0004645) |
0.0 | 0.0 | GO:0016019 | N-acetylmuramoyl-L-alanine amidase activity(GO:0008745) peptidoglycan receptor activity(GO:0016019) |
0.0 | 0.0 | GO:0008395 | steroid hydroxylase activity(GO:0008395) |
0.0 | 0.0 | GO:0051010 | microtubule plus-end binding(GO:0051010) |
0.0 | 0.0 | GO:0019958 | C-X-C chemokine binding(GO:0019958) |
0.0 | 0.2 | GO:0005186 | pheromone activity(GO:0005186) |
0.0 | 0.0 | GO:0004969 | histamine receptor activity(GO:0004969) |
0.0 | 0.1 | GO:0051400 | BH domain binding(GO:0051400) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
1.4 | 22.1 | SA CASPASE CASCADE | Apoptosis is mediated by caspases, cysteine proteases arranged in a proteolytic cascade. |
1.3 | 59.2 | PID HNF3B PATHWAY | FOXA2 and FOXA3 transcription factor networks |
1.3 | 34.5 | PID RXR VDR PATHWAY | RXR and RAR heterodimerization with other nuclear receptor |
1.0 | 3.1 | PID AVB3 INTEGRIN PATHWAY | Integrins in angiogenesis |
1.0 | 13.1 | PID AJDISS 2PATHWAY | Posttranslational regulation of adherens junction stability and dissassembly |
1.0 | 25.3 | PID NECTIN PATHWAY | Nectin adhesion pathway |
0.9 | 2.7 | ST IL 13 PATHWAY | Interleukin 13 (IL-13) Pathway |
0.9 | 41.9 | PID FAK PATHWAY | Signaling events mediated by focal adhesion kinase |
0.8 | 21.3 | PID AMB2 NEUTROPHILS PATHWAY | amb2 Integrin signaling |
0.7 | 17.5 | PID P38 MKK3 6PATHWAY | p38 MAPK signaling pathway |
0.7 | 1.5 | PID THROMBIN PAR1 PATHWAY | PAR1-mediated thrombin signaling events |
0.7 | 11.5 | PID PRL SIGNALING EVENTS PATHWAY | Signaling events mediated by PRL |
0.7 | 7.8 | PID ARF6 DOWNSTREAM PATHWAY | Arf6 downstream pathway |
0.7 | 5.7 | SA G2 AND M PHASES | Cdc25 activates the cdc2/cyclin B complex to induce the G2/M transition. |
0.7 | 11.5 | PID IFNG PATHWAY | IFN-gamma pathway |
0.7 | 5.3 | ST TUMOR NECROSIS FACTOR PATHWAY | Tumor Necrosis Factor Pathway. |
0.7 | 33.0 | PID RB 1PATHWAY | Regulation of retinoblastoma protein |
0.6 | 9.6 | PID ERBB NETWORK PATHWAY | ErbB receptor signaling network |
0.6 | 8.5 | PID SMAD2 3PATHWAY | Regulation of cytoplasmic and nuclear SMAD2/3 signaling |
0.6 | 8.7 | PID IL2 PI3K PATHWAY | IL2 signaling events mediated by PI3K |
0.5 | 16.5 | PID IL6 7 PATHWAY | IL6-mediated signaling events |
0.5 | 3.7 | PID RETINOIC ACID PATHWAY | Retinoic acid receptors-mediated signaling |
0.5 | 4.7 | PID AVB3 OPN PATHWAY | Osteopontin-mediated events |
0.5 | 18.2 | PID AR PATHWAY | Coregulation of Androgen receptor activity |
0.5 | 3.0 | PID CD40 PATHWAY | CD40/CD40L signaling |
0.5 | 4.0 | SIG CD40PATHWAYMAP | Genes related to CD40 signaling |
0.5 | 10.9 | PID TOLL ENDOGENOUS PATHWAY | Endogenous TLR signaling |
0.5 | 4.3 | PID TCPTP PATHWAY | Signaling events mediated by TCPTP |
0.5 | 7.5 | PID FAS PATHWAY | FAS (CD95) signaling pathway |
0.5 | 2.3 | PID CDC42 PATHWAY | CDC42 signaling events |
0.5 | 3.7 | PID IL5 PATHWAY | IL5-mediated signaling events |
0.5 | 9.1 | PID LIS1 PATHWAY | Lissencephaly gene (LIS1) in neuronal migration and development |
0.5 | 7.7 | PID ALPHA SYNUCLEIN PATHWAY | Alpha-synuclein signaling |
0.5 | 9.0 | PID TNF PATHWAY | TNF receptor signaling pathway |
0.4 | 8.4 | PID WNT CANONICAL PATHWAY | Canonical Wnt signaling pathway |
0.4 | 1.7 | PID WNT NONCANONICAL PATHWAY | Noncanonical Wnt signaling pathway |
0.4 | 6.9 | PID INTEGRIN2 PATHWAY | Beta2 integrin cell surface interactions |
0.4 | 2.6 | PID HIF1A PATHWAY | Hypoxic and oxygen homeostasis regulation of HIF-1-alpha |
0.4 | 6.4 | ST WNT CA2 CYCLIC GMP PATHWAY | Wnt/Ca2+/cyclic GMP signaling. |
0.4 | 2.1 | PID PDGFRA PATHWAY | PDGFR-alpha signaling pathway |
0.4 | 3.7 | PID EPHRINB REV PATHWAY | Ephrin B reverse signaling |
0.4 | 10.5 | PID FGF PATHWAY | FGF signaling pathway |
0.4 | 14.5 | PID P53 REGULATION PATHWAY | p53 pathway |
0.4 | 4.4 | PID PTP1B PATHWAY | Signaling events mediated by PTP1B |
0.4 | 10.3 | PID HIF2PATHWAY | HIF-2-alpha transcription factor network |
0.4 | 5.4 | PID TCR CALCIUM PATHWAY | Calcium signaling in the CD4+ TCR pathway |
0.4 | 6.6 | PID AR TF PATHWAY | Regulation of Androgen receptor activity |
0.4 | 9.6 | PID ATF2 PATHWAY | ATF-2 transcription factor network |
0.4 | 8.8 | PID CASPASE PATHWAY | Caspase cascade in apoptosis |
0.4 | 15.8 | PID P73PATHWAY | p73 transcription factor network |
0.4 | 10.9 | PID HIF1 TFPATHWAY | HIF-1-alpha transcription factor network |
0.4 | 2.1 | PID HDAC CLASSIII PATHWAY | Signaling events mediated by HDAC Class III |
0.4 | 8.5 | PID REG GR PATHWAY | Glucocorticoid receptor regulatory network |
0.3 | 3.1 | PID ALK2 PATHWAY | ALK2 signaling events |
0.3 | 7.2 | SIG INSULIN RECEPTOR PATHWAY IN CARDIAC MYOCYTES | Genes related to the insulin receptor pathway |
0.3 | 3.0 | PID EPO PATHWAY | EPO signaling pathway |
0.3 | 1.3 | PID GLYPICAN 1PATHWAY | Glypican 1 network |
0.3 | 1.0 | PID ALK1 PATHWAY | ALK1 signaling events |
0.3 | 0.6 | SIG IL4RECEPTOR IN B LYPHOCYTES | Genes related to IL4 rceptor signaling in B lymphocytes |
0.3 | 1.0 | PID BARD1 PATHWAY | BARD1 signaling events |
0.3 | 2.2 | PID ERBB1 DOWNSTREAM PATHWAY | ErbB1 downstream signaling |
0.3 | 1.8 | PID CERAMIDE PATHWAY | Ceramide signaling pathway |
0.3 | 4.8 | PID AURORA A PATHWAY | Aurora A signaling |
0.3 | 11.3 | PID CMYB PATHWAY | C-MYB transcription factor network |
0.3 | 3.0 | PID ERBB2 ERBB3 PATHWAY | ErbB2/ErbB3 signaling events |
0.3 | 0.6 | SA B CELL RECEPTOR COMPLEXES | Antigen binding to B cell receptors activates protein tyrosine kinases, such as the Src family, which ultimate activate MAP kinases. |
0.3 | 6.2 | PID IL4 2PATHWAY | IL4-mediated signaling events |
0.3 | 7.8 | PID ATR PATHWAY | ATR signaling pathway |
0.3 | 6.6 | PID BMP PATHWAY | BMP receptor signaling |
0.3 | 4.7 | PID A6B1 A6B4 INTEGRIN PATHWAY | a6b1 and a6b4 Integrin signaling |
0.3 | 3.7 | ST FAS SIGNALING PATHWAY | Fas Signaling Pathway |
0.3 | 1.3 | PID ECADHERIN KERATINOCYTE PATHWAY | E-cadherin signaling in keratinocytes |
0.3 | 6.8 | PID DELTA NP63 PATHWAY | Validated transcriptional targets of deltaNp63 isoforms |
0.3 | 6.0 | PID IL12 2PATHWAY | IL12-mediated signaling events |
0.2 | 1.5 | PID NEPHRIN NEPH1 PATHWAY | Nephrin/Neph1 signaling in the kidney podocyte |
0.2 | 3.3 | PID AP1 PATHWAY | AP-1 transcription factor network |
0.2 | 2.3 | PID NCADHERIN PATHWAY | N-cadherin signaling events |
0.2 | 1.5 | PID SYNDECAN 4 PATHWAY | Syndecan-4-mediated signaling events |
0.2 | 2.8 | PID ATM PATHWAY | ATM pathway |
0.2 | 42.1 | NABA ECM REGULATORS | Genes encoding enzymes and their regulators involved in the remodeling of the extracellular matrix |
0.2 | 0.4 | SA FAS SIGNALING | The TNF-type receptor Fas induces apoptosis on ligand binding. |
0.2 | 2.0 | PID ECADHERIN NASCENT AJ PATHWAY | E-cadherin signaling in the nascent adherens junction |
0.2 | 3.7 | PID P38 ALPHA BETA DOWNSTREAM PATHWAY | Signaling mediated by p38-alpha and p38-beta |
0.2 | 25.8 | NABA ECM AFFILIATED | Genes encoding proteins affiliated structurally or functionally to extracellular matrix proteins |
0.2 | 0.4 | SA PTEN PATHWAY | PTEN is a tumor suppressor that dephosphorylates the lipid messenger phosphatidylinositol triphosphate. |
0.2 | 7.8 | PID MYC ACTIV PATHWAY | Validated targets of C-MYC transcriptional activation |
0.2 | 0.2 | ST GA13 PATHWAY | G alpha 13 Pathway |
0.2 | 1.1 | PID NFAT 3PATHWAY | Role of Calcineurin-dependent NFAT signaling in lymphocytes |
0.2 | 1.4 | PID IL23 PATHWAY | IL23-mediated signaling events |
0.2 | 2.4 | PID ECADHERIN STABILIZATION PATHWAY | Stabilization and expansion of the E-cadherin adherens junction |
0.2 | 2.4 | PID TGFBR PATHWAY | TGF-beta receptor signaling |
0.2 | 0.5 | ST PAC1 RECEPTOR PATHWAY | PAC1 Receptor Pathway |
0.2 | 1.4 | PID CXCR4 PATHWAY | CXCR4-mediated signaling events |
0.2 | 0.2 | PID NFKAPPAB ATYPICAL PATHWAY | Atypical NF-kappaB pathway |
0.2 | 3.0 | PID RHODOPSIN PATHWAY | Visual signal transduction: Rods |
0.2 | 8.4 | PID P53 DOWNSTREAM PATHWAY | Direct p53 effectors |
0.1 | 0.3 | PID IGF1 PATHWAY | IGF1 pathway |
0.1 | 3.9 | PID LKB1 PATHWAY | LKB1 signaling events |
0.1 | 3.4 | PID PLK1 PATHWAY | PLK1 signaling events |
0.1 | 1.3 | PID INTEGRIN CS PATHWAY | Integrin family cell surface interactions |
0.1 | 3.0 | PID AURORA B PATHWAY | Aurora B signaling |
0.1 | 0.1 | PID EPHA2 FWD PATHWAY | EPHA2 forward signaling |
0.1 | 1.4 | PID CD8 TCR PATHWAY | TCR signaling in naïve CD8+ T cells |
0.1 | 1.3 | ST JNK MAPK PATHWAY | JNK MAPK Pathway |
0.1 | 0.1 | PID TRAIL PATHWAY | TRAIL signaling pathway |
0.1 | 1.6 | PID NFAT TFPATHWAY | Calcineurin-regulated NFAT-dependent transcription in lymphocytes |
0.1 | 0.3 | PID PI3K PLC TRK PATHWAY | Trk receptor signaling mediated by PI3K and PLC-gamma |
0.1 | 0.6 | SA MMP CYTOKINE CONNECTION | Cytokines can induce activation of matrix metalloproteinases, which degrade extracellular matrix. |
0.1 | 1.9 | PID CD8 TCR DOWNSTREAM PATHWAY | Downstream signaling in naïve CD8+ T cells |
0.1 | 0.8 | SIG REGULATION OF THE ACTIN CYTOSKELETON BY RHO GTPASES | Genes related to regulation of the actin cytoskeleton |
0.1 | 0.7 | ST GA12 PATHWAY | G alpha 12 Pathway |
0.1 | 2.8 | PID BETA CATENIN NUC PATHWAY | Regulation of nuclear beta catenin signaling and target gene transcription |
0.1 | 0.2 | PID REELIN PATHWAY | Reelin signaling pathway |
0.1 | 1.4 | PID TRKR PATHWAY | Neurotrophic factor-mediated Trk receptor signaling |
0.1 | 2.7 | PID NOTCH PATHWAY | Notch signaling pathway |
0.1 | 0.7 | PID WNT SIGNALING PATHWAY | Wnt signaling network |
0.1 | 0.6 | PID VEGFR1 PATHWAY | VEGFR1 specific signals |
0.1 | 1.7 | PID ARF6 TRAFFICKING PATHWAY | Arf6 trafficking events |
0.1 | 0.2 | PID PI3KCI AKT PATHWAY | Class I PI3K signaling events mediated by Akt |
0.1 | 0.9 | PID FCER1 PATHWAY | Fc-epsilon receptor I signaling in mast cells |
0.1 | 0.5 | PID IL1 PATHWAY | IL1-mediated signaling events |
0.1 | 0.6 | PID KIT PATHWAY | Signaling events mediated by Stem cell factor receptor (c-Kit) |
0.1 | 0.5 | PID CONE PATHWAY | Visual signal transduction: Cones |
0.1 | 1.6 | PID RAC1 PATHWAY | RAC1 signaling pathway |
0.1 | 0.2 | ST PHOSPHOINOSITIDE 3 KINASE PATHWAY | PI3K Pathway |
0.1 | 0.1 | ST DIFFERENTIATION PATHWAY IN PC12 CELLS | Differentiation Pathway in PC12 Cells; this is a specific case of PAC1 Receptor Pathway. |
0.1 | 0.2 | PID ANTHRAX PATHWAY | Cellular roles of Anthrax toxin |
0.1 | 0.7 | SIG CHEMOTAXIS | Genes related to chemotaxis |
0.1 | 0.7 | PID HES HEY PATHWAY | Notch-mediated HES/HEY network |
0.1 | 0.1 | ST B CELL ANTIGEN RECEPTOR | B Cell Antigen Receptor |
0.0 | 0.1 | SA TRKA RECEPTOR | The TrkA receptor binds nerve growth factor to activate MAP kinase pathways and promote cell growth. |
0.0 | 1.0 | PID E2F PATHWAY | E2F transcription factor network |
0.0 | 0.4 | PID VEGFR1 2 PATHWAY | Signaling events mediated by VEGFR1 and VEGFR2 |
0.0 | 0.9 | PID TELOMERASE PATHWAY | Regulation of Telomerase |
0.0 | 0.7 | PID CDC42 REG PATHWAY | Regulation of CDC42 activity |
0.0 | 0.0 | PID S1P S1P1 PATHWAY | S1P1 pathway |
0.0 | 0.1 | ST G ALPHA S PATHWAY | G alpha s Pathway |
0.0 | 0.2 | PID ENDOTHELIN PATHWAY | Endothelins |
0.0 | 0.2 | PID LPA4 PATHWAY | LPA4-mediated signaling events |
0.0 | 0.0 | PID CXCR3 PATHWAY | CXCR3-mediated signaling events |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
5.5 | 44.3 | REACTOME ABACAVIR TRANSPORT AND METABOLISM | Genes involved in Abacavir transport and metabolism |
2.6 | 13.2 | REACTOME RNA POL I PROMOTER OPENING | Genes involved in RNA Polymerase I Promoter Opening |
2.5 | 20.1 | REACTOME THE ACTIVATION OF ARYLSULFATASES | Genes involved in The activation of arylsulfatases |
2.0 | 4.0 | REACTOME REGULATION OF AMPK ACTIVITY VIA LKB1 | Genes involved in Regulation of AMPK activity via LKB1 |
1.9 | 1.9 | REACTOME VIF MEDIATED DEGRADATION OF APOBEC3G | Genes involved in Vif-mediated degradation of APOBEC3G |
1.9 | 24.1 | REACTOME HDL MEDIATED LIPID TRANSPORT | Genes involved in HDL-mediated lipid transport |
1.8 | 14.4 | REACTOME RECYCLING OF BILE ACIDS AND SALTS | Genes involved in Recycling of bile acids and salts |
1.8 | 17.9 | REACTOME ALPHA LINOLENIC ACID ALA METABOLISM | Genes involved in alpha-linolenic acid (ALA) metabolism |
1.6 | 13.0 | REACTOME IRAK2 MEDIATED ACTIVATION OF TAK1 COMPLEX UPON TLR7 8 OR 9 STIMULATION | Genes involved in IRAK2 mediated activation of TAK1 complex upon TLR7/8 or 9 stimulation |
1.6 | 4.7 | REACTOME XENOBIOTICS | Genes involved in Xenobiotics |
1.4 | 41.1 | REACTOME AMINO ACID TRANSPORT ACROSS THE PLASMA MEMBRANE | Genes involved in Amino acid transport across the plasma membrane |
1.4 | 13.7 | REACTOME HYALURONAN UPTAKE AND DEGRADATION | Genes involved in Hyaluronan uptake and degradation |
1.1 | 1.1 | REACTOME PECAM1 INTERACTIONS | Genes involved in PECAM1 interactions |
1.1 | 11.0 | REACTOME PASSIVE TRANSPORT BY AQUAPORINS | Genes involved in Passive Transport by Aquaporins |
1.0 | 2.1 | REACTOME FATTY ACYL COA BIOSYNTHESIS | Genes involved in Fatty Acyl-CoA Biosynthesis |
1.0 | 9.8 | REACTOME CYTOSOLIC SULFONATION OF SMALL MOLECULES | Genes involved in Cytosolic sulfonation of small molecules |
1.0 | 15.7 | REACTOME PLATELET SENSITIZATION BY LDL | Genes involved in Platelet sensitization by LDL |
1.0 | 8.7 | REACTOME REGULATED PROTEOLYSIS OF P75NTR | Genes involved in Regulated proteolysis of p75NTR |
0.9 | 44.3 | REACTOME NUCLEAR RECEPTOR TRANSCRIPTION PATHWAY | Genes involved in Nuclear Receptor transcription pathway |
0.9 | 25.9 | REACTOME TIGHT JUNCTION INTERACTIONS | Genes involved in Tight junction interactions |
0.9 | 16.6 | REACTOME SYNTHESIS OF PC | Genes involved in Synthesis of PC |
0.9 | 16.5 | REACTOME SMAD2 SMAD3 SMAD4 HETEROTRIMER REGULATES TRANSCRIPTION | Genes involved in SMAD2/SMAD3:SMAD4 heterotrimer regulates transcription |
0.9 | 12.3 | REACTOME PEROXISOMAL LIPID METABOLISM | Genes involved in Peroxisomal lipid metabolism |
0.9 | 12.9 | REACTOME AMINO ACID SYNTHESIS AND INTERCONVERSION TRANSAMINATION | Genes involved in Amino acid synthesis and interconversion (transamination) |
0.9 | 23.0 | REACTOME SPHINGOLIPID DE NOVO BIOSYNTHESIS | Genes involved in Sphingolipid de novo biosynthesis |
0.8 | 1.7 | REACTOME TRAF6 MEDIATED NFKB ACTIVATION | Genes involved in TRAF6 mediated NF-kB activation |
0.8 | 8.9 | REACTOME CHYLOMICRON MEDIATED LIPID TRANSPORT | Genes involved in Chylomicron-mediated lipid transport |
0.8 | 1.6 | REACTOME DESTABILIZATION OF MRNA BY TRISTETRAPROLIN TTP | Genes involved in Destabilization of mRNA by Tristetraprolin (TTP) |
0.8 | 7.2 | REACTOME TRYPTOPHAN CATABOLISM | Genes involved in Tryptophan catabolism |
0.8 | 13.3 | REACTOME TIE2 SIGNALING | Genes involved in Tie2 Signaling |
0.8 | 0.8 | REACTOME DESTABILIZATION OF MRNA BY KSRP | Genes involved in Destabilization of mRNA by KSRP |
0.8 | 8.5 | REACTOME SYNTHESIS OF VERY LONG CHAIN FATTY ACYL COAS | Genes involved in Synthesis of very long-chain fatty acyl-CoAs |
0.8 | 10.6 | REACTOME REGULATION OF INSULIN LIKE GROWTH FACTOR IGF ACTIVITY BY INSULIN LIKE GROWTH FACTOR BINDING PROTEINS IGFBPS | Genes involved in Regulation of Insulin-like Growth Factor (IGF) Activity by Insulin-like Growth Factor Binding Proteins (IGFBPs) |
0.8 | 8.3 | REACTOME VITAMIN B5 PANTOTHENATE METABOLISM | Genes involved in Vitamin B5 (pantothenate) metabolism |
0.7 | 17.2 | REACTOME G0 AND EARLY G1 | Genes involved in G0 and Early G1 |
0.7 | 12.6 | REACTOME SULFUR AMINO ACID METABOLISM | Genes involved in Sulfur amino acid metabolism |
0.7 | 12.6 | REACTOME TERMINATION OF O GLYCAN BIOSYNTHESIS | Genes involved in Termination of O-glycan biosynthesis |
0.7 | 0.7 | REACTOME DESTABILIZATION OF MRNA BY BRF1 | Genes involved in Destabilization of mRNA by Butyrate Response Factor 1 (BRF1) |
0.7 | 7.8 | REACTOME BILE SALT AND ORGANIC ANION SLC TRANSPORTERS | Genes involved in Bile salt and organic anion SLC transporters |
0.7 | 18.3 | REACTOME NEGATIVE REGULATORS OF RIG I MDA5 SIGNALING | Genes involved in Negative regulators of RIG-I/MDA5 signaling |
0.7 | 16.1 | REACTOME SMOOTH MUSCLE CONTRACTION | Genes involved in Smooth Muscle Contraction |
0.7 | 9.0 | REACTOME METABOLISM OF POLYAMINES | Genes involved in Metabolism of polyamines |
0.7 | 12.9 | REACTOME PROSTACYCLIN SIGNALLING THROUGH PROSTACYCLIN RECEPTOR | Genes involved in Prostacyclin signalling through prostacyclin receptor |
0.7 | 8.8 | REACTOME CELL EXTRACELLULAR MATRIX INTERACTIONS | Genes involved in Cell-extracellular matrix interactions |
0.7 | 4.0 | REACTOME ETHANOL OXIDATION | Genes involved in Ethanol oxidation |
0.7 | 11.2 | REACTOME N GLYCAN ANTENNAE ELONGATION IN THE MEDIAL TRANS GOLGI | Genes involved in N-glycan antennae elongation in the medial/trans-Golgi |
0.7 | 4.6 | REACTOME ARMS MEDIATED ACTIVATION | Genes involved in ARMS-mediated activation |
0.7 | 9.8 | REACTOME ZINC TRANSPORTERS | Genes involved in Zinc transporters |
0.7 | 7.8 | REACTOME SHC1 EVENTS IN ERBB4 SIGNALING | Genes involved in SHC1 events in ERBB4 signaling |
0.7 | 9.8 | REACTOME APC C CDC20 MEDIATED DEGRADATION OF CYCLIN B | Genes involved in APC/C:Cdc20 mediated degradation of Cyclin B |
0.7 | 7.8 | REACTOME REGULATION OF IFNG SIGNALING | Genes involved in Regulation of IFNG signaling |
0.6 | 15.9 | REACTOME ABC FAMILY PROTEINS MEDIATED TRANSPORT | Genes involved in ABC-family proteins mediated transport |
0.6 | 1.9 | REACTOME METAL ION SLC TRANSPORTERS | Genes involved in Metal ion SLC transporters |
0.6 | 1.9 | REACTOME SYNTHESIS OF PE | Genes involved in Synthesis of PE |
0.6 | 3.0 | REACTOME ACYL CHAIN REMODELLING OF PG | Genes involved in Acyl chain remodelling of PG |
0.6 | 1.2 | REACTOME PROLONGED ERK ACTIVATION EVENTS | Genes involved in Prolonged ERK activation events |
0.6 | 5.3 | REACTOME GAP JUNCTION DEGRADATION | Genes involved in Gap junction degradation |
0.6 | 2.3 | REACTOME NFKB IS ACTIVATED AND SIGNALS SURVIVAL | Genes involved in NF-kB is activated and signals survival |
0.6 | 5.8 | REACTOME GRB2 SOS PROVIDES LINKAGE TO MAPK SIGNALING FOR INTERGRINS | Genes involved in GRB2:SOS provides linkage to MAPK signaling for Intergrins |
0.6 | 5.7 | REACTOME APOPTOTIC CLEAVAGE OF CELL ADHESION PROTEINS | Genes involved in Apoptotic cleavage of cell adhesion proteins |
0.6 | 5.7 | REACTOME ACTIVATED AMPK STIMULATES FATTY ACID OXIDATION IN MUSCLE | Genes involved in Activated AMPK stimulates fatty-acid oxidation in muscle |
0.6 | 6.2 | REACTOME REGULATION OF KIT SIGNALING | Genes involved in Regulation of KIT signaling |
0.5 | 1.1 | REACTOME ACTIVATION OF GENES BY ATF4 | Genes involved in Activation of Genes by ATF4 |
0.5 | 4.8 | REACTOME PURINE CATABOLISM | Genes involved in Purine catabolism |
0.5 | 0.5 | REACTOME G BETA GAMMA SIGNALLING THROUGH PI3KGAMMA | Genes involved in G beta:gamma signalling through PI3Kgamma |
0.5 | 4.7 | REACTOME PD1 SIGNALING | Genes involved in PD-1 signaling |
0.5 | 11.3 | REACTOME FRS2 MEDIATED CASCADE | Genes involved in FRS2-mediated cascade |
0.5 | 1.5 | REACTOME GAMMA CARBOXYLATION TRANSPORT AND AMINO TERMINAL CLEAVAGE OF PROTEINS | Genes involved in Gamma-carboxylation, transport, and amino-terminal cleavage of proteins |
0.5 | 4.8 | REACTOME REGULATION OF RHEB GTPASE ACTIVITY BY AMPK | Genes involved in Regulation of Rheb GTPase activity by AMPK |
0.5 | 8.7 | REACTOME CITRIC ACID CYCLE TCA CYCLE | Genes involved in Citric acid cycle (TCA cycle) |
0.5 | 3.8 | REACTOME PLATELET ADHESION TO EXPOSED COLLAGEN | Genes involved in Platelet Adhesion to exposed collagen |
0.5 | 0.5 | REACTOME MITOTIC G1 G1 S PHASES | Genes involved in Mitotic G1-G1/S phases |
0.5 | 11.7 | REACTOME SEMA4D IN SEMAPHORIN SIGNALING | Genes involved in Sema4D in semaphorin signaling |
0.5 | 4.6 | REACTOME INTRINSIC PATHWAY | Genes involved in Intrinsic Pathway |
0.5 | 4.5 | REACTOME BMAL1 CLOCK NPAS2 ACTIVATES CIRCADIAN EXPRESSION | Genes involved in BMAL1:CLOCK/NPAS2 Activates Circadian Expression |
0.4 | 10.2 | REACTOME TRANSFERRIN ENDOCYTOSIS AND RECYCLING | Genes involved in Transferrin endocytosis and recycling |
0.4 | 8.9 | REACTOME FORMATION OF INCISION COMPLEX IN GG NER | Genes involved in Formation of incision complex in GG-NER |
0.4 | 4.0 | REACTOME ASSOCIATION OF LICENSING FACTORS WITH THE PRE REPLICATIVE COMPLEX | Genes involved in Association of licensing factors with the pre-replicative complex |
0.4 | 3.9 | REACTOME NA CL DEPENDENT NEUROTRANSMITTER TRANSPORTERS | Genes involved in Na+/Cl- dependent neurotransmitter transporters |
0.4 | 1.3 | REACTOME UNFOLDED PROTEIN RESPONSE | Genes involved in Unfolded Protein Response |
0.4 | 6.0 | REACTOME RIP MEDIATED NFKB ACTIVATION VIA DAI | Genes involved in RIP-mediated NFkB activation via DAI |
0.4 | 11.1 | REACTOME SYNTHESIS OF PIPS AT THE PLASMA MEMBRANE | Genes involved in Synthesis of PIPs at the plasma membrane |
0.4 | 6.4 | REACTOME DARPP 32 EVENTS | Genes involved in DARPP-32 events |
0.4 | 2.9 | REACTOME CYCLIN A B1 ASSOCIATED EVENTS DURING G2 M TRANSITION | Genes involved in Cyclin A/B1 associated events during G2/M transition |
0.4 | 13.3 | REACTOME PHASE1 FUNCTIONALIZATION OF COMPOUNDS | Genes involved in Phase 1 - Functionalization of compounds |
0.4 | 4.9 | REACTOME REGULATION OF INSULIN SECRETION BY GLUCAGON LIKE PEPTIDE1 | Genes involved in Regulation of Insulin Secretion by Glucagon-like Peptide-1 |
0.4 | 32.0 | REACTOME PPARA ACTIVATES GENE EXPRESSION | Genes involved in PPARA Activates Gene Expression |
0.4 | 6.9 | REACTOME SYNTHESIS OF GLYCOSYLPHOSPHATIDYLINOSITOL GPI | Genes involved in Synthesis of glycosylphosphatidylinositol (GPI) |
0.4 | 1.6 | REACTOME DIGESTION OF DIETARY CARBOHYDRATE | Genes involved in Digestion of dietary carbohydrate |
0.4 | 15.2 | REACTOME GLUCOSE TRANSPORT | Genes involved in Glucose transport |
0.4 | 4.0 | REACTOME PURINE SALVAGE | Genes involved in Purine salvage |
0.4 | 4.8 | REACTOME INITIAL TRIGGERING OF COMPLEMENT | Genes involved in Initial triggering of complement |
0.4 | 0.8 | REACTOME TGF BETA RECEPTOR SIGNALING IN EMT EPITHELIAL TO MESENCHYMAL TRANSITION | Genes involved in TGF-beta receptor signaling in EMT (epithelial to mesenchymal transition) |
0.4 | 5.4 | REACTOME PROCESSING OF INTRONLESS PRE MRNAS | Genes involved in Processing of Intronless Pre-mRNAs |
0.4 | 4.9 | REACTOME METABOLISM OF PORPHYRINS | Genes involved in Metabolism of porphyrins |
0.4 | 6.0 | REACTOME POST CHAPERONIN TUBULIN FOLDING PATHWAY | Genes involved in Post-chaperonin tubulin folding pathway |
0.4 | 8.9 | REACTOME ANTIVIRAL MECHANISM BY IFN STIMULATED GENES | Genes involved in Antiviral mechanism by IFN-stimulated genes |
0.4 | 4.7 | REACTOME SYNTHESIS SECRETION AND INACTIVATION OF GIP | Genes involved in Synthesis, Secretion, and Inactivation of Glucose-dependent Insulinotropic Polypeptide (GIP) |
0.4 | 2.9 | REACTOME PROCESSING OF CAPPED INTRONLESS PRE MRNA | Genes involved in Processing of Capped Intronless Pre-mRNA |
0.4 | 3.6 | REACTOME REPAIR SYNTHESIS FOR GAP FILLING BY DNA POL IN TC NER | Genes involved in Repair synthesis for gap-filling by DNA polymerase in TC-NER |
0.4 | 6.8 | REACTOME GLUTATHIONE CONJUGATION | Genes involved in Glutathione conjugation |
0.4 | 20.9 | REACTOME TRANSPORT OF INORGANIC CATIONS ANIONS AND AMINO ACIDS OLIGOPEPTIDES | Genes involved in Transport of inorganic cations/anions and amino acids/oligopeptides |
0.4 | 6.0 | REACTOME FATTY ACID TRIACYLGLYCEROL AND KETONE BODY METABOLISM | Genes involved in Fatty acid, triacylglycerol, and ketone body metabolism |
0.4 | 4.6 | REACTOME REGULATION OF WATER BALANCE BY RENAL AQUAPORINS | Genes involved in Regulation of Water Balance by Renal Aquaporins |
0.4 | 3.2 | REACTOME ROLE OF DCC IN REGULATING APOPTOSIS | Genes involved in Role of DCC in regulating apoptosis |
0.4 | 5.3 | REACTOME SIGNALING BY NODAL | Genes involved in Signaling by NODAL |
0.4 | 4.9 | REACTOME AMINE DERIVED HORMONES | Genes involved in Amine-derived hormones |
0.3 | 5.6 | REACTOME ACTIVATED NOTCH1 TRANSMITS SIGNAL TO THE NUCLEUS | Genes involved in Activated NOTCH1 Transmits Signal to the Nucleus |
0.3 | 4.5 | REACTOME ACYL CHAIN REMODELLING OF PI | Genes involved in Acyl chain remodelling of PI |
0.3 | 0.3 | REACTOME GLUCAGON SIGNALING IN METABOLIC REGULATION | Genes involved in Glucagon signaling in metabolic regulation |
0.3 | 3.0 | REACTOME OXYGEN DEPENDENT PROLINE HYDROXYLATION OF HYPOXIA INDUCIBLE FACTOR ALPHA | Genes involved in Oxygen-dependent Proline Hydroxylation of Hypoxia-inducible Factor Alpha |
0.3 | 1.7 | REACTOME G2 M DNA DAMAGE CHECKPOINT | Genes involved in G2/M DNA damage checkpoint |
0.3 | 3.6 | REACTOME ACTIVATION OF RAC | Genes involved in Activation of Rac |
0.3 | 6.6 | REACTOME PYRIMIDINE METABOLISM | Genes involved in Pyrimidine metabolism |
0.3 | 2.0 | REACTOME GLUCURONIDATION | Genes involved in Glucuronidation |
0.3 | 0.6 | REACTOME SOS MEDIATED SIGNALLING | Genes involved in SOS-mediated signalling |
0.3 | 0.9 | REACTOME DOWNREGULATION OF ERBB2 ERBB3 SIGNALING | Genes involved in Downregulation of ERBB2:ERBB3 signaling |
0.3 | 2.8 | REACTOME COSTIMULATION BY THE CD28 FAMILY | Genes involved in Costimulation by the CD28 family |
0.3 | 1.8 | REACTOME BIOLOGICAL OXIDATIONS | Genes involved in Biological oxidations |
0.3 | 2.5 | REACTOME ACTIVATION OF CHAPERONES BY ATF6 ALPHA | Genes involved in Activation of Chaperones by ATF6-alpha |
0.3 | 0.3 | REACTOME TRANSLOCATION OF ZAP 70 TO IMMUNOLOGICAL SYNAPSE | Genes involved in Translocation of ZAP-70 to Immunological synapse |
0.3 | 1.5 | REACTOME BETA DEFENSINS | Genes involved in Beta defensins |
0.3 | 4.2 | REACTOME TGF BETA RECEPTOR SIGNALING ACTIVATES SMADS | Genes involved in TGF-beta receptor signaling activates SMADs |
0.3 | 1.1 | REACTOME APOBEC3G MEDIATED RESISTANCE TO HIV1 INFECTION | Genes involved in APOBEC3G mediated resistance to HIV-1 infection |
0.3 | 6.3 | REACTOME MUSCLE CONTRACTION | Genes involved in Muscle contraction |
0.3 | 4.5 | REACTOME RNA POL III CHAIN ELONGATION | Genes involved in RNA Polymerase III Chain Elongation |
0.3 | 2.4 | REACTOME FORMATION OF FIBRIN CLOT CLOTTING CASCADE | Genes involved in Formation of Fibrin Clot (Clotting Cascade) |
0.3 | 2.3 | REACTOME POST TRANSLATIONAL MODIFICATION SYNTHESIS OF GPI ANCHORED PROTEINS | Genes involved in Post-translational modification: synthesis of GPI-anchored proteins |
0.2 | 2.2 | REACTOME THROMBIN SIGNALLING THROUGH PROTEINASE ACTIVATED RECEPTORS PARS | Genes involved in Thrombin signalling through proteinase activated receptors (PARs) |
0.2 | 10.4 | REACTOME CHEMOKINE RECEPTORS BIND CHEMOKINES | Genes involved in Chemokine receptors bind chemokines |
0.2 | 9.3 | REACTOME RESPONSE TO ELEVATED PLATELET CYTOSOLIC CA2 | Genes involved in Response to elevated platelet cytosolic Ca2+ |
0.2 | 2.6 | REACTOME REGULATION OF PYRUVATE DEHYDROGENASE PDH COMPLEX | Genes involved in Regulation of pyruvate dehydrogenase (PDH) complex |
0.2 | 0.7 | REACTOME ENDOSOMAL VACUOLAR PATHWAY | Genes involved in Endosomal/Vacuolar pathway |
0.2 | 6.3 | REACTOME MEIOTIC SYNAPSIS | Genes involved in Meiotic Synapsis |
0.2 | 1.9 | REACTOME CIRCADIAN CLOCK | Genes involved in Circadian Clock |
0.2 | 3.3 | REACTOME G1 PHASE | Genes involved in G1 Phase |
0.2 | 4.9 | REACTOME TRAFFICKING OF AMPA RECEPTORS | Genes involved in Trafficking of AMPA receptors |
0.2 | 2.5 | REACTOME DEADENYLATION OF MRNA | Genes involved in Deadenylation of mRNA |
0.2 | 8.5 | REACTOME GLYCEROPHOSPHOLIPID BIOSYNTHESIS | Genes involved in Glycerophospholipid biosynthesis |
0.2 | 2.0 | REACTOME NUCLEAR SIGNALING BY ERBB4 | Genes involved in Nuclear signaling by ERBB4 |
0.2 | 0.7 | REACTOME G PROTEIN ACTIVATION | Genes involved in G-protein activation |
0.2 | 4.2 | REACTOME MEIOTIC RECOMBINATION | Genes involved in Meiotic Recombination |
0.2 | 0.7 | REACTOME AKT PHOSPHORYLATES TARGETS IN THE CYTOSOL | Genes involved in AKT phosphorylates targets in the cytosol |
0.2 | 4.5 | REACTOME MITOCHONDRIAL TRNA AMINOACYLATION | Genes involved in Mitochondrial tRNA aminoacylation |
0.2 | 3.3 | REACTOME SYNTHESIS AND INTERCONVERSION OF NUCLEOTIDE DI AND TRIPHOSPHATES | Genes involved in Synthesis and interconversion of nucleotide di- and triphosphates |
0.2 | 9.1 | REACTOME GLUCOSE METABOLISM | Genes involved in Glucose metabolism |
0.2 | 2.6 | REACTOME AMYLOIDS | Genes involved in Amyloids |
0.2 | 3.0 | REACTOME CLASS C 3 METABOTROPIC GLUTAMATE PHEROMONE RECEPTORS | Genes involved in Class C/3 (Metabotropic glutamate/pheromone receptors) |
0.2 | 2.3 | REACTOME FORMATION OF ATP BY CHEMIOSMOTIC COUPLING | Genes involved in Formation of ATP by chemiosmotic coupling |
0.2 | 1.5 | REACTOME GLYCOPROTEIN HORMONES | Genes involved in Glycoprotein hormones |
0.2 | 4.4 | REACTOME REGULATION OF BETA CELL DEVELOPMENT | Genes involved in Regulation of beta-cell development |
0.2 | 2.5 | REACTOME RESOLUTION OF AP SITES VIA THE SINGLE NUCLEOTIDE REPLACEMENT PATHWAY | Genes involved in Resolution of AP sites via the single-nucleotide replacement pathway |
0.2 | 2.2 | REACTOME SIGNALING BY FGFR1 MUTANTS | Genes involved in Signaling by FGFR1 mutants |
0.2 | 0.2 | REACTOME TRIGLYCERIDE BIOSYNTHESIS | Genes involved in Triglyceride Biosynthesis |
0.2 | 3.1 | REACTOME PREFOLDIN MEDIATED TRANSFER OF SUBSTRATE TO CCT TRIC | Genes involved in Prefoldin mediated transfer of substrate to CCT/TriC |
0.2 | 1.2 | REACTOME DOWNSTREAM SIGNAL TRANSDUCTION | Genes involved in Downstream signal transduction |
0.2 | 0.2 | REACTOME NEP NS2 INTERACTS WITH THE CELLULAR EXPORT MACHINERY | Genes involved in NEP/NS2 Interacts with the Cellular Export Machinery |
0.2 | 4.2 | REACTOME KINESINS | Genes involved in Kinesins |
0.2 | 1.2 | REACTOME SYNTHESIS SECRETION AND DEACYLATION OF GHRELIN | Genes involved in Synthesis, Secretion, and Deacylation of Ghrelin |
0.2 | 0.2 | REACTOME ADENYLATE CYCLASE ACTIVATING PATHWAY | Genes involved in Adenylate cyclase activating pathway |
0.2 | 3.6 | REACTOME CYTOSOLIC TRNA AMINOACYLATION | Genes involved in Cytosolic tRNA aminoacylation |
0.2 | 0.4 | REACTOME INCRETIN SYNTHESIS SECRETION AND INACTIVATION | Genes involved in Incretin Synthesis, Secretion, and Inactivation |
0.2 | 0.4 | REACTOME P75NTR RECRUITS SIGNALLING COMPLEXES | Genes involved in p75NTR recruits signalling complexes |
0.2 | 6.0 | REACTOME METABOLISM OF VITAMINS AND COFACTORS | Genes involved in Metabolism of vitamins and cofactors |
0.2 | 4.3 | REACTOME INTERFERON GAMMA SIGNALING | Genes involved in Interferon gamma signaling |
0.2 | 2.9 | REACTOME ASSOCIATION OF TRIC CCT WITH TARGET PROTEINS DURING BIOSYNTHESIS | Genes involved in Association of TriC/CCT with target proteins during biosynthesis |
0.2 | 6.1 | REACTOME ACTIVATION OF CHAPERONE GENES BY XBP1S | Genes involved in Activation of Chaperone Genes by XBP1(S) |
0.2 | 2.7 | REACTOME SRP DEPENDENT COTRANSLATIONAL PROTEIN TARGETING TO MEMBRANE | Genes involved in SRP-dependent cotranslational protein targeting to membrane |
0.2 | 4.6 | REACTOME INTERFERON SIGNALING | Genes involved in Interferon Signaling |
0.2 | 2.5 | REACTOME GAP JUNCTION ASSEMBLY | Genes involved in Gap junction assembly |
0.2 | 2.3 | REACTOME METABOLISM OF NON CODING RNA | Genes involved in Metabolism of non-coding RNA |
0.2 | 1.8 | REACTOME METABOLISM OF NUCLEOTIDES | Genes involved in Metabolism of nucleotides |
0.2 | 2.5 | REACTOME INTEGRIN CELL SURFACE INTERACTIONS | Genes involved in Integrin cell surface interactions |
0.2 | 8.3 | REACTOME MITOTIC PROMETAPHASE | Genes involved in Mitotic Prometaphase |
0.2 | 3.2 | REACTOME INTRINSIC PATHWAY FOR APOPTOSIS | Genes involved in Intrinsic Pathway for Apoptosis |
0.2 | 1.1 | REACTOME NOREPINEPHRINE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Norepinephrine Neurotransmitter Release Cycle |
0.2 | 3.6 | REACTOME ENDOSOMAL SORTING COMPLEX REQUIRED FOR TRANSPORT ESCRT | Genes involved in Endosomal Sorting Complex Required For Transport (ESCRT) |
0.1 | 6.4 | REACTOME FACTORS INVOLVED IN MEGAKARYOCYTE DEVELOPMENT AND PLATELET PRODUCTION | Genes involved in Factors involved in megakaryocyte development and platelet production |
0.1 | 0.4 | REACTOME REGULATION OF HYPOXIA INDUCIBLE FACTOR HIF BY OXYGEN | Genes involved in Regulation of Hypoxia-inducible Factor (HIF) by Oxygen |
0.1 | 1.2 | REACTOME LIPID DIGESTION MOBILIZATION AND TRANSPORT | Genes involved in Lipid digestion, mobilization, and transport |
0.1 | 13.1 | REACTOME NONSENSE MEDIATED DECAY ENHANCED BY THE EXON JUNCTION COMPLEX | Genes involved in Nonsense Mediated Decay Enhanced by the Exon Junction Complex |
0.1 | 4.1 | REACTOME IMMUNOREGULATORY INTERACTIONS BETWEEN A LYMPHOID AND A NON LYMPHOID CELL | Genes involved in Immunoregulatory interactions between a Lymphoid and a non-Lymphoid cell |
0.1 | 0.8 | REACTOME VEGF LIGAND RECEPTOR INTERACTIONS | Genes involved in VEGF ligand-receptor interactions |
0.1 | 0.3 | REACTOME E2F ENABLED INHIBITION OF PRE REPLICATION COMPLEX FORMATION | Genes involved in E2F-enabled inhibition of pre-replication complex formation |
0.1 | 0.3 | REACTOME DESTABILIZATION OF MRNA BY AUF1 HNRNP D0 | Genes involved in Destabilization of mRNA by AUF1 (hnRNP D0) |
0.1 | 1.2 | REACTOME IL1 SIGNALING | Genes involved in Interleukin-1 signaling |
0.1 | 0.9 | REACTOME SYNTHESIS OF PIPS AT THE LATE ENDOSOME MEMBRANE | Genes involved in Synthesis of PIPs at the late endosome membrane |
0.1 | 1.0 | REACTOME TRAFFICKING AND PROCESSING OF ENDOSOMAL TLR | Genes involved in Trafficking and processing of endosomal TLR |
0.1 | 0.1 | REACTOME APC C CDC20 MEDIATED DEGRADATION OF MITOTIC PROTEINS | Genes involved in APC/C:Cdc20 mediated degradation of mitotic proteins |
0.1 | 0.8 | REACTOME ELEVATION OF CYTOSOLIC CA2 LEVELS | Genes involved in Elevation of cytosolic Ca2+ levels |
0.1 | 1.9 | REACTOME APOPTOTIC CLEAVAGE OF CELLULAR PROTEINS | Genes involved in Apoptotic cleavage of cellular proteins |
0.1 | 0.2 | REACTOME REMOVAL OF THE FLAP INTERMEDIATE FROM THE C STRAND | Genes involved in Removal of the Flap Intermediate from the C-strand |
0.1 | 0.5 | REACTOME APOPTOSIS INDUCED DNA FRAGMENTATION | Genes involved in Apoptosis induced DNA fragmentation |
0.1 | 0.2 | REACTOME RNA POL III TRANSCRIPTION TERMINATION | Genes involved in RNA Polymerase III Transcription Termination |
0.1 | 0.5 | REACTOME INHIBITION OF REPLICATION INITIATION OF DAMAGED DNA BY RB1 E2F1 | Genes involved in Inhibition of replication initiation of damaged DNA by RB1/E2F1 |
0.1 | 0.7 | REACTOME IRON UPTAKE AND TRANSPORT | Genes involved in Iron uptake and transport |
0.1 | 1.6 | REACTOME HS GAG DEGRADATION | Genes involved in HS-GAG degradation |
0.1 | 0.5 | REACTOME RNA POL I TRANSCRIPTION TERMINATION | Genes involved in RNA Polymerase I Transcription Termination |
0.1 | 0.3 | REACTOME CROSS PRESENTATION OF SOLUBLE EXOGENOUS ANTIGENS ENDOSOMES | Genes involved in Cross-presentation of soluble exogenous antigens (endosomes) |
0.1 | 9.8 | REACTOME SIGNALING BY RHO GTPASES | Genes involved in Signaling by Rho GTPases |
0.1 | 1.2 | REACTOME ENOS ACTIVATION AND REGULATION | Genes involved in eNOS activation and regulation |
0.1 | 0.2 | REACTOME E2F MEDIATED REGULATION OF DNA REPLICATION | Genes involved in E2F mediated regulation of DNA replication |
0.1 | 1.1 | REACTOME COMPLEMENT CASCADE | Genes involved in Complement cascade |
0.1 | 0.5 | REACTOME DSCAM INTERACTIONS | Genes involved in DSCAM interactions |
0.1 | 0.7 | REACTOME LATENT INFECTION OF HOMO SAPIENS WITH MYCOBACTERIUM TUBERCULOSIS | Genes involved in Latent infection of Homo sapiens with Mycobacterium tuberculosis |
0.1 | 0.8 | REACTOME ORGANIC CATION ANION ZWITTERION TRANSPORT | Genes involved in Organic cation/anion/zwitterion transport |
0.1 | 1.7 | REACTOME CELL CELL JUNCTION ORGANIZATION | Genes involved in Cell-cell junction organization |
0.1 | 0.2 | REACTOME SEROTONIN RECEPTORS | Genes involved in Serotonin receptors |
0.1 | 0.2 | REACTOME GROWTH HORMONE RECEPTOR SIGNALING | Genes involved in Growth hormone receptor signaling |
0.1 | 0.7 | REACTOME BASIGIN INTERACTIONS | Genes involved in Basigin interactions |
0.1 | 2.0 | REACTOME PRE NOTCH EXPRESSION AND PROCESSING | Genes involved in Pre-NOTCH Expression and Processing |
0.1 | 0.9 | REACTOME SIGNALING BY SCF KIT | Genes involved in Signaling by SCF-KIT |
0.1 | 0.6 | REACTOME DEPOSITION OF NEW CENPA CONTAINING NUCLEOSOMES AT THE CENTROMERE | Genes involved in Deposition of New CENPA-containing Nucleosomes at the Centromere |
0.1 | 0.2 | REACTOME REGULATION OF THE FANCONI ANEMIA PATHWAY | Genes involved in Regulation of the Fanconi anemia pathway |
0.1 | 0.7 | REACTOME CREB PHOSPHORYLATION THROUGH THE ACTIVATION OF RAS | Genes involved in CREB phosphorylation through the activation of Ras |
0.1 | 0.7 | REACTOME P2Y RECEPTORS | Genes involved in P2Y receptors |
0.1 | 0.7 | REACTOME MRNA CAPPING | Genes involved in mRNA Capping |
0.1 | 1.2 | REACTOME DEGRADATION OF THE EXTRACELLULAR MATRIX | Genes involved in Degradation of the extracellular matrix |
0.1 | 0.2 | REACTOME ROLE OF SECOND MESSENGERS IN NETRIN1 SIGNALING | Genes involved in Role of second messengers in netrin-1 signaling |
0.1 | 1.2 | REACTOME SPHINGOLIPID METABOLISM | Genes involved in Sphingolipid metabolism |
0.1 | 0.7 | REACTOME SIGNALING BY BMP | Genes involved in Signaling by BMP |
0.1 | 0.5 | REACTOME RNA POL III TRANSCRIPTION INITIATION FROM TYPE 3 PROMOTER | Genes involved in RNA Polymerase III Transcription Initiation From Type 3 Promoter |
0.1 | 0.2 | REACTOME TRAF6 MEDIATED INDUCTION OF TAK1 COMPLEX | Genes involved in TRAF6 mediated induction of TAK1 complex |
0.1 | 0.8 | REACTOME NCAM SIGNALING FOR NEURITE OUT GROWTH | Genes involved in NCAM signaling for neurite out-growth |
0.1 | 0.1 | REACTOME MEMBRANE BINDING AND TARGETTING OF GAG PROTEINS | Genes involved in Membrane binding and targetting of GAG proteins |
0.1 | 0.1 | REACTOME SPRY REGULATION OF FGF SIGNALING | Genes involved in Spry regulation of FGF signaling |
0.0 | 0.2 | REACTOME CTNNB1 PHOSPHORYLATION CASCADE | Genes involved in Beta-catenin phosphorylation cascade |
0.0 | 0.2 | REACTOME HOMOLOGOUS RECOMBINATION REPAIR OF REPLICATION INDEPENDENT DOUBLE STRAND BREAKS | Genes involved in Homologous recombination repair of replication-independent double-strand breaks |
0.0 | 0.5 | REACTOME GLUCAGON TYPE LIGAND RECEPTORS | Genes involved in Glucagon-type ligand receptors |
0.0 | 0.2 | REACTOME REGULATION OF SIGNALING BY CBL | Genes involved in Regulation of signaling by CBL |
0.0 | 0.4 | REACTOME DNA REPAIR | Genes involved in DNA Repair |
0.0 | 0.1 | REACTOME CELL DEATH SIGNALLING VIA NRAGE NRIF AND NADE | Genes involved in Cell death signalling via NRAGE, NRIF and NADE |
0.0 | 0.8 | REACTOME GENERIC TRANSCRIPTION PATHWAY | Genes involved in Generic Transcription Pathway |
0.0 | 0.0 | REACTOME NEF MEDIATES DOWN MODULATION OF CELL SURFACE RECEPTORS BY RECRUITING THEM TO CLATHRIN ADAPTERS | Genes involved in Nef-mediates down modulation of cell surface receptors by recruiting them to clathrin adapters |
0.0 | 0.0 | REACTOME APOPTOTIC EXECUTION PHASE | Genes involved in Apoptotic execution phase |
0.0 | 0.5 | REACTOME INWARDLY RECTIFYING K CHANNELS | Genes involved in Inwardly rectifying K+ channels |
0.0 | 3.7 | REACTOME PEPTIDE LIGAND BINDING RECEPTORS | Genes involved in Peptide ligand-binding receptors |
0.0 | 0.1 | REACTOME ACTIVATION OF NMDA RECEPTOR UPON GLUTAMATE BINDING AND POSTSYNAPTIC EVENTS | Genes involved in Activation of NMDA receptor upon glutamate binding and postsynaptic events |
0.0 | 0.2 | REACTOME CALNEXIN CALRETICULIN CYCLE | Genes involved in Calnexin/calreticulin cycle |
0.0 | 0.2 | REACTOME HORMONE LIGAND BINDING RECEPTORS | Genes involved in Hormone ligand-binding receptors |
0.0 | 0.3 | REACTOME THE NLRP3 INFLAMMASOME | Genes involved in The NLRP3 inflammasome |
0.0 | 0.2 | REACTOME RAP1 SIGNALLING | Genes involved in Rap1 signalling |
0.0 | 0.1 | REACTOME SIGNALLING TO P38 VIA RIT AND RIN | Genes involved in Signalling to p38 via RIT and RIN |
0.0 | 0.4 | REACTOME INTEGRATION OF ENERGY METABOLISM | Genes involved in Integration of energy metabolism |
0.0 | 0.1 | REACTOME PKB MEDIATED EVENTS | Genes involved in PKB-mediated events |
0.0 | 0.1 | REACTOME HYALURONAN METABOLISM | Genes involved in Hyaluronan metabolism |
0.0 | 0.0 | REACTOME CLASS I MHC MEDIATED ANTIGEN PROCESSING PRESENTATION | Genes involved in Class I MHC mediated antigen processing & presentation |
0.0 | 1.8 | REACTOME ANTIGEN PROCESSING UBIQUITINATION PROTEASOME DEGRADATION | Genes involved in Antigen processing: Ubiquitination & Proteasome degradation |
0.0 | 0.0 | REACTOME TRAF3 DEPENDENT IRF ACTIVATION PATHWAY | Genes involved in TRAF3-dependent IRF activation pathway |
0.0 | 0.3 | REACTOME BIOSYNTHESIS OF THE N GLYCAN PRECURSOR DOLICHOL LIPID LINKED OLIGOSACCHARIDE LLO AND TRANSFER TO A NASCENT PROTEIN | Genes involved in Biosynthesis of the N-glycan precursor (dolichol lipid-linked oligosaccharide, LLO) and transfer to a nascent protein |
0.0 | 0.0 | REACTOME DEFENSINS | Genes involved in Defensins |
0.0 | 0.0 | REACTOME NFKB ACTIVATION THROUGH FADD RIP1 PATHWAY MEDIATED BY CASPASE 8 AND10 | Genes involved in NF-kB activation through FADD/RIP-1 pathway mediated by caspase-8 and -10 |
0.0 | 0.0 | REACTOME IL 6 SIGNALING | Genes involved in Interleukin-6 signaling |