Gene Symbol | Gene ID | Gene Info |
---|---|---|
Smad4
|
ENSMUSG00000024515.7 | Smad4 |
CRE | Gene | Distance | Association probability | Pearson corr. coef. | P-value | Plot |
---|---|---|---|---|---|---|
Smad4 | chr18_73703093_73703380 | 544 | 0.719673 | -0.25 | 7.0e-02 | Click! |
Smad4 | chr18_73703674_73704345 | 229 | 0.911588 | -0.20 | 1.3e-01 | Click! |
Smad4 | chr18_73699051_73699204 | 4653 | 0.171811 | -0.18 | 1.9e-01 | Click! |
Smad4 | chr18_73703387_73703614 | 280 | 0.885375 | 0.13 | 3.4e-01 | Click! |
Smad4 | chr18_73643144_73643295 | 656 | 0.675313 | -0.12 | 3.8e-01 | Click! |
Move your cursor over a bar to see sample name and corresponding Z-value.
Cis Regulatory Element (CRE) | Target Score | Top associated gene | Gene Info | Distance of CRE to TSS | CRE/Gene association probability |
---|---|---|---|---|---|
chr4_133557872_133558065 | 19.96 |
Gm23158 |
predicted gene, 23158 |
981 |
0.36 |
chr13_11959591_11960207 | 12.54 |
Gm26956 |
predicted gene, 26956 |
20341 |
0.23 |
chr6_103314591_103314746 | 11.55 |
Gm44295 |
predicted gene, 44295 |
34682 |
0.22 |
chr11_52350840_52351201 | 9.41 |
Vdac1 |
voltage-dependent anion channel 1 |
9840 |
0.17 |
chr7_109595199_109595528 | 8.01 |
Denn2b |
DENN domain containing 2B |
7302 |
0.17 |
chr11_31835746_31836021 | 7.62 |
Gm12107 |
predicted gene 12107 |
3223 |
0.25 |
chr11_98904631_98904915 | 7.12 |
Cdc6 |
cell division cycle 6 |
3028 |
0.15 |
chr5_111469989_111470140 | 6.63 |
Gm43119 |
predicted gene 43119 |
46475 |
0.12 |
chr4_124774236_124774426 | 6.00 |
Inpp5b |
inositol polyphosphate-5-phosphatase B |
5003 |
0.1 |
chr7_24852559_24852815 | 5.89 |
Gm18207 |
predicted gene, 18207 |
8259 |
0.09 |
chr1_73002843_73002994 | 5.68 |
1700027A15Rik |
RIKEN cDNA 1700027A15 gene |
12773 |
0.21 |
chr4_32177984_32178264 | 5.56 |
Gm11928 |
predicted gene 11928 |
28338 |
0.16 |
chr15_73211843_73212007 | 5.47 |
Ptk2 |
PTK2 protein tyrosine kinase 2 |
2434 |
0.27 |
chr8_94787524_94787757 | 5.40 |
Cx3cl1 |
chemokine (C-X3-C motif) ligand 1 |
15415 |
0.1 |
chr5_103741831_103742104 | 5.39 |
Aff1 |
AF4/FMR2 family, member 1 |
12195 |
0.2 |
chr8_120372171_120372550 | 4.89 |
Gm22715 |
predicted gene, 22715 |
71189 |
0.09 |
chr13_44839668_44840451 | 4.73 |
Jarid2 |
jumonji, AT rich interactive domain 2 |
632 |
0.7 |
chr13_59832086_59832378 | 4.71 |
Gm34961 |
predicted gene, 34961 |
8966 |
0.11 |
chr8_123980624_123981024 | 4.61 |
Abcb10 |
ATP-binding cassette, sub-family B (MDR/TAP), member 10 |
2298 |
0.17 |
chr11_78074361_78074827 | 4.57 |
Mir451b |
microRNA 451b |
1353 |
0.16 |
chr7_103811151_103811488 | 4.51 |
Hbb-bt |
hemoglobin, beta adult t chain |
2677 |
0.09 |
chr14_70466029_70466203 | 4.50 |
Phyhip |
phytanoyl-CoA hydroxylase interacting protein |
7593 |
0.1 |
chr12_88984947_88985118 | 4.44 |
Nrxn3 |
neurexin III |
31633 |
0.23 |
chr3_103130224_103130445 | 4.41 |
Dennd2c |
DENN/MADD domain containing 2C |
2778 |
0.18 |
chr12_79557815_79558259 | 4.40 |
Rad51b |
RAD51 paralog B |
230684 |
0.02 |
chr11_117838543_117838973 | 4.36 |
Afmid |
arylformamidase |
6485 |
0.09 |
chr19_4594702_4594853 | 4.28 |
Pcx |
pyruvate carboxylase |
369 |
0.79 |
chr5_118480054_118480344 | 4.24 |
Gm15754 |
predicted gene 15754 |
6768 |
0.21 |
chr19_55938421_55938984 | 4.20 |
Tcf7l2 |
transcription factor 7 like 2, T cell specific, HMG box |
40393 |
0.17 |
chr15_36323007_36323170 | 4.20 |
Rpl7a-ps3 |
ribosomal protein L7A, pseudogene 3 |
14144 |
0.12 |
chr8_123990766_123991076 | 4.17 |
Abcb10 |
ATP-binding cassette, sub-family B (MDR/TAP), member 10 |
7799 |
0.1 |
chr11_117797537_117797802 | 4.12 |
6030468B19Rik |
RIKEN cDNA 6030468B19 gene |
9 |
0.94 |
chr5_124605098_124605317 | 4.11 |
Tctn2 |
tectonic family member 2 |
6410 |
0.12 |
chr4_46407404_46407574 | 4.11 |
Hemgn |
hemogen |
3253 |
0.17 |
chr7_123366245_123366530 | 4.04 |
Lcmt1 |
leucine carboxyl methyltransferase 1 |
3397 |
0.21 |
chr11_11684707_11686418 | 4.03 |
Gm11999 |
predicted gene 11999 |
162 |
0.73 |
chr12_32104526_32104851 | 4.01 |
5430401H09Rik |
RIKEN cDNA 5430401H09 gene |
19014 |
0.16 |
chr16_20422984_20423160 | 4.00 |
Abcc5 |
ATP-binding cassette, sub-family C (CFTR/MRP), member 5 |
2914 |
0.19 |
chr5_15551399_15551801 | 3.97 |
Gm21190 |
predicted gene, 21190 |
22378 |
0.13 |
chr13_112747894_112748068 | 3.90 |
Slc38a9 |
solute carrier family 38, member 9 |
12371 |
0.15 |
chr17_24860211_24860389 | 3.86 |
Hagh |
hydroxyacyl glutathione hydrolase |
2099 |
0.14 |
chr7_75595425_75595576 | 3.82 |
Akap13 |
A kinase (PRKA) anchor protein 13 |
14539 |
0.19 |
chr7_34969107_34969361 | 3.80 |
Pepd |
peptidase D |
49 |
0.97 |
chr15_80801637_80802005 | 3.76 |
Tnrc6b |
trinucleotide repeat containing 6b |
3106 |
0.28 |
chr1_156073229_156073418 | 3.76 |
Tor1aip2 |
torsin A interacting protein 2 |
10110 |
0.17 |
chr5_137569933_137570501 | 3.72 |
Tfr2 |
transferrin receptor 2 |
348 |
0.69 |
chr9_65070584_65070992 | 3.66 |
Dpp8 |
dipeptidylpeptidase 8 |
4215 |
0.17 |
chr19_18644190_18644356 | 3.64 |
Nmrk1 |
nicotinamide riboside kinase 1 |
12275 |
0.15 |
chr8_14012983_14013140 | 3.57 |
Gm5907 |
predicted gene 5907 |
14121 |
0.15 |
chr4_126682159_126682310 | 3.56 |
Psmb2 |
proteasome (prosome, macropain) subunit, beta type 2 |
4530 |
0.16 |
chr2_158141595_158141856 | 3.56 |
Tgm2 |
transglutaminase 2, C polypeptide |
1989 |
0.27 |
chr11_115804754_115804993 | 3.51 |
Caskin2 |
CASK-interacting protein 2 |
3229 |
0.12 |
chr11_32250666_32250873 | 3.49 |
Nprl3 |
nitrogen permease regulator-like 3 |
491 |
0.67 |
chr5_23850355_23851323 | 3.48 |
2700038G22Rik |
RIKEN cDNA 2700038G22 gene |
238 |
0.81 |
chr15_97380017_97380182 | 3.47 |
Pced1b |
PC-esterase domain containing 1B |
18882 |
0.24 |
chr8_88298436_88298616 | 3.47 |
Adcy7 |
adenylate cyclase 7 |
1853 |
0.35 |
chr11_116104002_116104330 | 3.44 |
Trim47 |
tripartite motif-containing 47 |
2917 |
0.13 |
chr15_36648583_36648782 | 3.43 |
Gm6704 |
predicted gene 6704 |
18813 |
0.12 |
chr6_29697217_29697398 | 3.41 |
Tspan33 |
tetraspanin 33 |
3073 |
0.23 |
chr16_93130665_93130929 | 3.39 |
Gm28003 |
predicted gene, 28003 |
58042 |
0.15 |
chr4_134165911_134166062 | 3.38 |
Gm27619 |
predicted gene, 27619 |
1909 |
0.19 |
chr11_67527000_67527208 | 3.38 |
Gas7 |
growth arrest specific 7 |
20050 |
0.22 |
chr3_116865537_116865723 | 3.36 |
Frrs1 |
ferric-chelate reductase 1 |
6063 |
0.14 |
chr8_120293961_120294320 | 3.36 |
Gse1 |
genetic suppressor element 1, coiled-coil protein |
65684 |
0.09 |
chr10_81524029_81524513 | 3.36 |
Gna15 |
guanine nucleotide binding protein, alpha 15 |
46 |
0.91 |
chr19_24794396_24794754 | 3.35 |
Pgm5 |
phosphoglucomutase 5 |
31497 |
0.16 |
chr15_38543513_38543843 | 3.33 |
Azin1 |
antizyme inhibitor 1 |
24412 |
0.1 |
chr14_25855365_25855516 | 3.33 |
Anxa11 |
annexin A11 |
13257 |
0.12 |
chr3_115715875_115716079 | 3.33 |
Gm9889 |
predicted gene 9889 |
827 |
0.44 |
chr15_67121102_67121454 | 3.29 |
St3gal1 |
ST3 beta-galactoside alpha-2,3-sialyltransferase 1 |
7286 |
0.27 |
chr11_29815794_29815966 | 3.28 |
Eml6 |
echinoderm microtubule associated protein like 6 |
5782 |
0.17 |
chr9_42463752_42463922 | 3.28 |
Tbcel |
tubulin folding cofactor E-like |
2376 |
0.26 |
chr15_27497660_27497813 | 3.27 |
B230362B09Rik |
RIKEN cDNA B230362B09 gene |
6176 |
0.17 |
chr2_6263938_6264314 | 3.26 |
Gm13383 |
predicted gene 13383 |
6860 |
0.19 |
chr11_98583727_98583891 | 3.25 |
Ormdl3 |
ORM1-like 3 (S. cerevisiae) |
3559 |
0.13 |
chr11_115901591_115901903 | 3.23 |
Smim5 |
small integral membrane protein 5 |
1545 |
0.21 |
chr10_121569006_121569830 | 3.20 |
Tbk1 |
TANK-binding kinase 1 |
937 |
0.48 |
chr16_92475133_92475299 | 3.19 |
2410124H12Rik |
RIKEN cDNA 2410124H12 gene |
3526 |
0.17 |
chr15_103252776_103252951 | 3.19 |
Nfe2 |
nuclear factor, erythroid derived 2 |
53 |
0.95 |
chr10_14446020_14446199 | 3.17 |
Gm10335 |
predicted gene 10335 |
76969 |
0.08 |
chr14_21074009_21074288 | 3.17 |
Adk |
adenosine kinase |
2004 |
0.35 |
chr13_25189803_25190130 | 3.15 |
Dcdc2a |
doublecortin domain containing 2a |
2512 |
0.34 |
chr11_97440036_97440725 | 3.15 |
Arhgap23 |
Rho GTPase activating protein 23 |
4095 |
0.19 |
chr1_174171215_174171430 | 3.13 |
Spta1 |
spectrin alpha, erythrocytic 1 |
1454 |
0.23 |
chr4_118079198_118079529 | 3.13 |
St3gal3 |
ST3 beta-galactoside alpha-2,3-sialyltransferase 3 |
47481 |
0.11 |
chr11_87751706_87751911 | 3.12 |
Mir142hg |
Mir142 host gene (non-protein coding) |
3769 |
0.1 |
chr6_83312515_83312842 | 3.12 |
Mthfd2 |
methylenetetrahydrofolate dehydrogenase (NAD+ dependent), methenyltetrahydrofolate cyclohydrolase |
273 |
0.85 |
chr13_41236169_41236337 | 3.10 |
Gm32063 |
predicted gene, 32063 |
92 |
0.93 |
chr9_59285657_59285823 | 3.09 |
Adpgk |
ADP-dependent glucokinase |
5818 |
0.23 |
chr11_115911092_115911332 | 3.08 |
Smim6 |
small integral membrane protein 6 |
805 |
0.41 |
chr3_95267928_95268079 | 3.07 |
Prune1 |
prune exopolyphosphatase |
941 |
0.32 |
chr5_137530580_137532081 | 3.06 |
Gnb2 |
guanine nucleotide binding protein (G protein), beta 2 |
33 |
0.9 |
chr9_44580129_44580422 | 3.05 |
Gm47230 |
predicted gene, 47230 |
648 |
0.47 |
chr5_145640043_145640194 | 3.04 |
Cyp3a63-ps |
cytochrome P450, family 3, subfamily a, member 63, pseudogene |
6125 |
0.17 |
chr7_143314009_143314361 | 3.00 |
4933417O13Rik |
RIKEN cDNA 4933417O13 gene |
16465 |
0.12 |
chr8_71702154_71702388 | 3.00 |
B3gnt3 |
UDP-GlcNAc:betaGal beta-1,3-N-acetylglucosaminyltransferase 3 |
482 |
0.61 |
chr15_9489864_9490015 | 3.00 |
Gm50456 |
predicted gene, 50456 |
14437 |
0.2 |
chr17_71235603_71235900 | 3.00 |
Lpin2 |
lipin 2 |
2911 |
0.23 |
chr7_73574811_73574962 | 2.98 |
1810026B05Rik |
RIKEN cDNA 1810026B05 gene |
16491 |
0.1 |
chr13_21419246_21419407 | 2.97 |
Gm50481 |
predicted gene, 50481 |
7275 |
0.07 |
chr7_100467548_100467843 | 2.97 |
Gm10603 |
predicted gene 10603 |
505 |
0.62 |
chr4_101393109_101393260 | 2.96 |
Gm12798 |
predicted gene 12798 |
9897 |
0.12 |
chr13_75729670_75729828 | 2.96 |
Gm48302 |
predicted gene, 48302 |
2470 |
0.2 |
chr7_125632212_125632595 | 2.94 |
Gtf3c1 |
general transcription factor III C 1 |
17574 |
0.17 |
chr17_24225934_24226232 | 2.94 |
Ccnf |
cyclin F |
4640 |
0.09 |
chr7_45059162_45059688 | 2.92 |
Prrg2 |
proline-rich Gla (G-carboxyglutamic acid) polypeptide 2 |
2227 |
0.09 |
chr1_191855059_191855511 | 2.92 |
Nek2 |
NIMA (never in mitosis gene a)-related expressed kinase 2 |
28137 |
0.12 |
chr3_116389186_116389497 | 2.91 |
Cdc14a |
CDC14 cell division cycle 14A |
16147 |
0.15 |
chr1_167374719_167374895 | 2.90 |
Aldh9a1 |
aldehyde dehydrogenase 9, subfamily A1 |
10641 |
0.13 |
chr15_12306566_12306717 | 2.89 |
Golph3 |
golgi phosphoprotein 3 |
14809 |
0.15 |
chr13_73475366_73476070 | 2.89 |
Lpcat1 |
lysophosphatidylcholine acyltransferase 1 |
3967 |
0.26 |
chr16_36890595_36890747 | 2.88 |
Gm49600 |
predicted gene, 49600 |
3723 |
0.12 |
chr15_31573488_31573654 | 2.88 |
Cmbl |
carboxymethylenebutenolidase-like (Pseudomonas) |
1466 |
0.31 |
chr2_132695735_132696027 | 2.87 |
Shld1 |
shieldin complex subunit 1 |
2238 |
0.17 |
chr7_99822529_99822695 | 2.87 |
Neu3 |
neuraminidase 3 |
5805 |
0.13 |
chr4_118568737_118569073 | 2.86 |
Tmem125 |
transmembrane protein 125 |
24861 |
0.1 |
chr4_126260856_126261556 | 2.86 |
Trappc3 |
trafficking protein particle complex 3 |
1119 |
0.37 |
chr8_123156122_123156399 | 2.85 |
Sult5a1 |
sulfotransferase family 5A, member 1 |
1968 |
0.15 |
chr13_96993406_96993557 | 2.85 |
Gm48609 |
predicted gene, 48609 |
21818 |
0.14 |
chr7_127041904_127042275 | 2.85 |
Kif22 |
kinesin family member 22 |
317 |
0.68 |
chr2_170365296_170365488 | 2.84 |
Bcas1 |
breast carcinoma amplified sequence 1 |
8279 |
0.18 |
chr3_79721203_79721372 | 2.84 |
Rxfp1 |
relaxin/insulin-like family peptide receptor 1 |
16507 |
0.17 |
chr17_46160104_46160711 | 2.83 |
Gtpbp2 |
GTP binding protein 2 |
625 |
0.56 |
chr18_68230237_68230503 | 2.82 |
Ldlrad4 |
low density lipoprotein receptor class A domain containing 4 |
2303 |
0.29 |
chr16_90963967_90964135 | 2.81 |
Synj1 |
synaptojanin 1 |
5294 |
0.11 |
chr6_86079380_86079616 | 2.81 |
Add2 |
adducin 2 (beta) |
1414 |
0.32 |
chr10_127205782_127205964 | 2.80 |
Pip4k2c |
phosphatidylinositol-5-phosphate 4-kinase, type II, gamma |
5682 |
0.09 |
chr5_114558159_114558686 | 2.80 |
Gm13790 |
predicted gene 13790 |
7133 |
0.17 |
chr11_98911514_98911727 | 2.80 |
Cdc6 |
cell division cycle 6 |
3469 |
0.14 |
chr4_119189949_119190118 | 2.78 |
Ermap |
erythroblast membrane-associated protein |
22 |
0.95 |
chr11_53483659_53483860 | 2.78 |
Sowaha |
sosondowah ankyrin repeat domain family member A |
3485 |
0.1 |
chr3_108752227_108752422 | 2.77 |
Aknad1 |
AKNA domain containing 1 |
202 |
0.92 |
chr11_116572806_116573131 | 2.77 |
Ube2o |
ubiquitin-conjugating enzyme E2O |
8479 |
0.1 |
chr13_9120817_9120992 | 2.77 |
Larp4b |
La ribonucleoprotein domain family, member 4B |
15311 |
0.15 |
chr11_64801456_64801643 | 2.75 |
Gm12291 |
predicted gene 12291 |
41522 |
0.17 |
chr5_119331549_119331706 | 2.73 |
n-R5s175 |
nuclear encoded rRNA 5S 175 |
34382 |
0.21 |
chr2_73591985_73592312 | 2.72 |
Chn1os3 |
chimerin 1, opposite strand 3 |
4378 |
0.16 |
chr13_83382718_83382891 | 2.72 |
Mef2c |
myocyte enhancer factor 2C |
121230 |
0.06 |
chr3_79983938_79984154 | 2.72 |
A330069K06Rik |
RIKEN cDNA A330069K06 gene |
70846 |
0.09 |
chr1_185727743_185728079 | 2.72 |
Gm38093 |
predicted gene, 38093 |
16892 |
0.26 |
chr16_23029027_23029577 | 2.71 |
Kng2 |
kininogen 2 |
90 |
0.93 |
chr6_136473708_136473993 | 2.71 |
Gm6728 |
predicted gene 6728 |
13336 |
0.12 |
chr18_70563552_70563708 | 2.71 |
Mbd2 |
methyl-CpG binding domain protein 2 |
4559 |
0.21 |
chrX_48153604_48153772 | 2.69 |
Sash3 |
SAM and SH3 domain containing 3 |
7252 |
0.19 |
chr13_63097260_63097411 | 2.69 |
Aopep |
aminopeptidase O |
10187 |
0.17 |
chr2_160601993_160602158 | 2.69 |
Gm14221 |
predicted gene 14221 |
17896 |
0.16 |
chr18_32542304_32542816 | 2.69 |
Gypc |
glycophorin C |
7142 |
0.21 |
chr2_167866861_167867040 | 2.68 |
Gm14319 |
predicted gene 14319 |
8365 |
0.18 |
chr7_110920476_110920635 | 2.68 |
Mrvi1 |
MRV integration site 1 |
3148 |
0.23 |
chr10_83019507_83019831 | 2.68 |
Gm10773 |
predicted gene 10773 |
12026 |
0.19 |
chr5_23923860_23924147 | 2.68 |
Fam126a |
family with sequence similarity 126, member A |
1099 |
0.44 |
chr9_66896128_66896299 | 2.67 |
Rab8b |
RAB8B, member RAS oncogene family |
23474 |
0.14 |
chr14_53072544_53072722 | 2.67 |
Trav15d-3 |
T cell receptor alpha variable 15D-3 |
9721 |
0.15 |
chr5_137349031_137350198 | 2.66 |
Ephb4 |
Eph receptor B4 |
495 |
0.62 |
chr7_103870533_103870999 | 2.66 |
Olfr66 |
olfactory receptor 66 |
11475 |
0.06 |
chr16_38288529_38288680 | 2.65 |
Nr1i2 |
nuclear receptor subfamily 1, group I, member 2 |
6220 |
0.15 |
chr1_90650830_90651485 | 2.65 |
Gm9991 |
predicted gene 9991 |
24004 |
0.19 |
chr7_127768560_127769629 | 2.64 |
Orai3 |
ORAI calcium release-activated calcium modulator 3 |
721 |
0.4 |
chr15_62039091_62039260 | 2.64 |
Pvt1 |
Pvt1 oncogene |
82 |
0.98 |
chr12_69293975_69294295 | 2.63 |
Klhdc2 |
kelch domain containing 2 |
2546 |
0.16 |
chr4_109256140_109256309 | 2.63 |
Calr4 |
calreticulin 4 |
11642 |
0.19 |
chr13_99019329_99019480 | 2.62 |
A930014D07Rik |
RIKEN cDNA A930014D07 gene |
12305 |
0.12 |
chr1_175082553_175082856 | 2.61 |
Rgs7 |
regulator of G protein signaling 7 |
3279 |
0.38 |
chr18_41942850_41943121 | 2.59 |
Prelid2 |
PRELI domain containing 2 |
8209 |
0.21 |
chr7_48880950_48881793 | 2.59 |
Gm2788 |
predicted gene 2788 |
71 |
0.71 |
chr11_120353462_120354038 | 2.58 |
0610009L18Rik |
RIKEN cDNA 0610009L18 gene |
5072 |
0.09 |
chr3_14879873_14880124 | 2.58 |
Car2 |
carbonic anhydrase 2 |
6275 |
0.2 |
chr3_88363788_88364291 | 2.58 |
Paqr6 |
progestin and adipoQ receptor family member VI |
545 |
0.49 |
chr9_14363632_14363868 | 2.58 |
Endod1 |
endonuclease domain containing 1 |
17233 |
0.11 |
chr3_89879988_89880280 | 2.57 |
Gm42809 |
predicted gene 42809 |
32782 |
0.09 |
chr14_55824498_55825973 | 2.57 |
Nfatc4 |
nuclear factor of activated T cells, cytoplasmic, calcineurin dependent 4 |
198 |
0.87 |
chr6_120579566_120580923 | 2.57 |
Gm44124 |
predicted gene, 44124 |
68 |
0.96 |
chr13_20163704_20164022 | 2.56 |
Elmo1 |
engulfment and cell motility 1 |
21344 |
0.25 |
chr11_51847963_51848242 | 2.56 |
Jade2 |
jade family PHD finger 2 |
9023 |
0.18 |
chr19_56392212_56392420 | 2.56 |
Nrap |
nebulin-related anchoring protein |
2279 |
0.26 |
chr14_53362184_53362345 | 2.56 |
Trav15n-3 |
T cell receptor alpha variable 15N-3 |
12848 |
0.18 |
chr7_99216270_99216421 | 2.55 |
Gm45012 |
predicted gene 45012 |
13979 |
0.12 |
chr13_107101149_107101349 | 2.54 |
Gm31452 |
predicted gene, 31452 |
37554 |
0.14 |
chr5_57760763_57760931 | 2.54 |
Gm42481 |
predicted gene 42481 |
18026 |
0.12 |
chr12_17540197_17540353 | 2.54 |
Odc1 |
ornithine decarboxylase, structural 1 |
4519 |
0.16 |
chr2_104130216_104130396 | 2.54 |
A930018P22Rik |
RIKEN cDNA A930018P22 gene |
7537 |
0.14 |
chrX_136060875_136061032 | 2.53 |
Bex2 |
brain expressed X-linked 2 |
7283 |
0.13 |
chr4_129386351_129386502 | 2.53 |
Gm12980 |
predicted gene 12980 |
6582 |
0.12 |
chr17_56005037_56005465 | 2.53 |
Stap2 |
signal transducing adaptor family member 2 |
301 |
0.56 |
chr15_103253528_103253696 | 2.53 |
Nfe2 |
nuclear factor, erythroid derived 2 |
450 |
0.69 |
chr13_37965234_37965506 | 2.52 |
Rreb1 |
ras responsive element binding protein 1 |
18354 |
0.17 |
chr2_10128665_10128829 | 2.52 |
Itih2 |
inter-alpha trypsin inhibitor, heavy chain 2 |
1916 |
0.23 |
chr6_113690640_113690849 | 2.52 |
Irak2 |
interleukin-1 receptor-associated kinase 2 |
1 |
0.91 |
chr9_102406018_102406355 | 2.51 |
Gm22894 |
predicted gene, 22894 |
33068 |
0.14 |
chr11_120895491_120895765 | 2.51 |
Ccdc57 |
coiled-coil domain containing 57 |
9717 |
0.12 |
chr3_79144987_79146081 | 2.51 |
Rapgef2 |
Rap guanine nucleotide exchange factor (GEF) 2 |
341 |
0.91 |
chr19_46455103_46455625 | 2.51 |
Sufu |
SUFU negative regulator of hedgehog signaling |
2542 |
0.23 |
chr7_111179367_111179913 | 2.50 |
1700012D14Rik |
RIKEN cDNA 1700012D14 gene |
56956 |
0.11 |
chr5_122110993_122111277 | 2.50 |
Ccdc63 |
coiled-coil domain containing 63 |
22 |
0.97 |
chr16_36891318_36891486 | 2.49 |
Gm49600 |
predicted gene, 49600 |
2992 |
0.13 |
chr19_16482178_16482355 | 2.49 |
Gm8222 |
predicted gene 8222 |
8798 |
0.2 |
chr2_119155328_119155687 | 2.49 |
Rmdn3 |
regulator of microtubule dynamics 3 |
1317 |
0.28 |
chr1_185469514_185469706 | 2.49 |
Gm2061 |
predicted gene 2061 |
14042 |
0.12 |
chr19_24793862_24794038 | 2.47 |
Pgm5 |
phosphoglucomutase 5 |
30872 |
0.16 |
chr18_80219997_80220183 | 2.47 |
Txnl4a |
thioredoxin-like 4A |
4710 |
0.11 |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
1.5 | 4.6 | GO:0060375 | regulation of mast cell differentiation(GO:0060375) |
1.2 | 2.4 | GO:2000670 | positive regulation of dendritic cell apoptotic process(GO:2000670) |
1.1 | 4.4 | GO:0097460 | ferrous iron import into cell(GO:0097460) |
1.0 | 3.0 | GO:0071336 | regulation of hair follicle cell proliferation(GO:0071336) |
1.0 | 2.9 | GO:0009804 | coumarin metabolic process(GO:0009804) |
1.0 | 1.0 | GO:0045626 | negative regulation of T-helper 1 cell differentiation(GO:0045626) |
0.9 | 2.7 | GO:0018199 | peptidyl-glutamine modification(GO:0018199) |
0.9 | 5.2 | GO:0034242 | negative regulation of syncytium formation by plasma membrane fusion(GO:0034242) |
0.8 | 2.5 | GO:0035771 | interleukin-4-mediated signaling pathway(GO:0035771) |
0.8 | 5.8 | GO:0051574 | positive regulation of histone H3-K9 methylation(GO:0051574) |
0.8 | 2.4 | GO:0090259 | regulation of retinal ganglion cell axon guidance(GO:0090259) |
0.8 | 0.8 | GO:0070627 | ferrous iron import(GO:0070627) |
0.7 | 3.0 | GO:0070966 | nuclear-transcribed mRNA catabolic process, no-go decay(GO:0070966) |
0.7 | 3.6 | GO:0097459 | iron ion import into cell(GO:0097459) |
0.7 | 2.1 | GO:1900368 | regulation of RNA interference(GO:1900368) |
0.7 | 2.1 | GO:0090290 | positive regulation of osteoclast proliferation(GO:0090290) |
0.7 | 2.1 | GO:0010897 | negative regulation of triglyceride catabolic process(GO:0010897) |
0.7 | 2.0 | GO:0030538 | embryonic genitalia morphogenesis(GO:0030538) |
0.7 | 2.0 | GO:0021699 | cerebellar cortex maturation(GO:0021699) |
0.7 | 3.4 | GO:0010891 | negative regulation of sequestering of triglyceride(GO:0010891) |
0.7 | 2.6 | GO:0030309 | poly-N-acetyllactosamine metabolic process(GO:0030309) poly-N-acetyllactosamine biosynthetic process(GO:0030311) |
0.6 | 1.9 | GO:0046985 | positive regulation of hemoglobin biosynthetic process(GO:0046985) |
0.6 | 3.2 | GO:0044789 | modulation by host of viral release from host cell(GO:0044789) positive regulation by host of viral release from host cell(GO:0044791) |
0.6 | 2.5 | GO:0010989 | negative regulation of low-density lipoprotein particle clearance(GO:0010989) |
0.6 | 1.8 | GO:1902775 | mitochondrial large ribosomal subunit assembly(GO:1902775) |
0.6 | 1.8 | GO:0010481 | epidermal cell division(GO:0010481) regulation of epidermal cell division(GO:0010482) |
0.6 | 4.6 | GO:0032782 | bile acid secretion(GO:0032782) |
0.6 | 1.7 | GO:0061470 | T follicular helper cell differentiation(GO:0061470) |
0.5 | 1.6 | GO:1903690 | negative regulation of wound healing, spreading of epidermal cells(GO:1903690) |
0.5 | 2.7 | GO:0010612 | regulation of cardiac muscle adaptation(GO:0010612) regulation of cardiac muscle hypertrophy in response to stress(GO:1903242) |
0.5 | 1.5 | GO:2001245 | regulation of phosphatidylcholine biosynthetic process(GO:2001245) |
0.5 | 2.0 | GO:1990414 | replication-born double-strand break repair via sister chromatid exchange(GO:1990414) |
0.5 | 2.5 | GO:0009202 | deoxyribonucleoside triphosphate biosynthetic process(GO:0009202) |
0.5 | 1.5 | GO:1900169 | regulation of glucocorticoid mediated signaling pathway(GO:1900169) |
0.5 | 2.0 | GO:2000523 | regulation of T cell costimulation(GO:2000523) positive regulation of T cell costimulation(GO:2000525) |
0.5 | 1.0 | GO:0060374 | mast cell differentiation(GO:0060374) |
0.5 | 1.4 | GO:0006438 | valyl-tRNA aminoacylation(GO:0006438) |
0.5 | 1.4 | GO:0018197 | peptidyl-aspartic acid modification(GO:0018197) |
0.5 | 1.4 | GO:0097623 | potassium ion export across plasma membrane(GO:0097623) |
0.5 | 0.9 | GO:0042908 | xenobiotic transport(GO:0042908) |
0.5 | 1.4 | GO:1902309 | negative regulation of peptidyl-serine dephosphorylation(GO:1902309) |
0.5 | 1.4 | GO:0006768 | biotin metabolic process(GO:0006768) |
0.5 | 1.8 | GO:0001905 | activation of membrane attack complex(GO:0001905) regulation of activation of membrane attack complex(GO:0001969) |
0.5 | 1.4 | GO:0097195 | pilomotor reflex(GO:0097195) |
0.5 | 1.4 | GO:0045658 | regulation of neutrophil differentiation(GO:0045658) |
0.5 | 0.9 | GO:2000646 | positive regulation of receptor catabolic process(GO:2000646) |
0.4 | 1.8 | GO:0060591 | chondroblast differentiation(GO:0060591) |
0.4 | 1.3 | GO:0060978 | angiogenesis involved in coronary vascular morphogenesis(GO:0060978) |
0.4 | 3.0 | GO:0006265 | DNA topological change(GO:0006265) |
0.4 | 1.3 | GO:0045415 | negative regulation of interleukin-8 biosynthetic process(GO:0045415) |
0.4 | 3.0 | GO:0035562 | negative regulation of chromatin binding(GO:0035562) |
0.4 | 2.1 | GO:0072488 | ammonium transmembrane transport(GO:0072488) |
0.4 | 1.3 | GO:0019355 | nicotinamide nucleotide biosynthetic process from aspartate(GO:0019355) 'de novo' NAD biosynthetic process from aspartate(GO:0034628) |
0.4 | 2.1 | GO:0071313 | cellular response to caffeine(GO:0071313) cellular response to purine-containing compound(GO:0071415) |
0.4 | 1.2 | GO:0061511 | centriole elongation(GO:0061511) |
0.4 | 3.3 | GO:0032000 | positive regulation of fatty acid beta-oxidation(GO:0032000) |
0.4 | 1.6 | GO:0032264 | IMP salvage(GO:0032264) |
0.4 | 3.2 | GO:0046642 | negative regulation of alpha-beta T cell proliferation(GO:0046642) |
0.4 | 0.4 | GO:0002085 | inhibition of neuroepithelial cell differentiation(GO:0002085) negative regulation of auditory receptor cell differentiation(GO:0045608) negative regulation of mechanoreceptor differentiation(GO:0045632) negative regulation of inner ear receptor cell differentiation(GO:2000981) |
0.4 | 1.2 | GO:0006741 | NADP biosynthetic process(GO:0006741) |
0.4 | 1.1 | GO:0019371 | cyclooxygenase pathway(GO:0019371) |
0.4 | 1.1 | GO:0007290 | spermatid nucleus elongation(GO:0007290) |
0.4 | 1.1 | GO:0021847 | ventricular zone neuroblast division(GO:0021847) |
0.4 | 1.1 | GO:0055005 | ventricular cardiac myofibril assembly(GO:0055005) |
0.4 | 0.4 | GO:0097051 | establishment of protein localization to endoplasmic reticulum membrane(GO:0097051) |
0.4 | 1.1 | GO:1904706 | negative regulation of vascular smooth muscle cell proliferation(GO:1904706) |
0.4 | 1.1 | GO:0031914 | negative regulation of synaptic plasticity(GO:0031914) |
0.4 | 1.1 | GO:0035672 | oligopeptide transmembrane transport(GO:0035672) |
0.4 | 1.4 | GO:0097039 | protein linear polyubiquitination(GO:0097039) |
0.4 | 2.5 | GO:0003376 | sphingosine-1-phosphate signaling pathway(GO:0003376) |
0.4 | 1.1 | GO:0032485 | regulation of Ral protein signal transduction(GO:0032485) |
0.4 | 1.1 | GO:0019344 | cysteine biosynthetic process(GO:0019344) |
0.4 | 1.1 | GO:2001271 | negative regulation of cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:2001271) |
0.3 | 1.0 | GO:2000346 | negative regulation of hepatocyte proliferation(GO:2000346) |
0.3 | 1.0 | GO:0006481 | C-terminal protein methylation(GO:0006481) |
0.3 | 0.7 | GO:0034140 | negative regulation of toll-like receptor 3 signaling pathway(GO:0034140) |
0.3 | 0.7 | GO:0060448 | dichotomous subdivision of terminal units involved in lung branching(GO:0060448) |
0.3 | 0.3 | GO:0043096 | purine nucleobase salvage(GO:0043096) |
0.3 | 1.3 | GO:0022007 | neural plate elongation(GO:0014022) convergent extension involved in neural plate elongation(GO:0022007) |
0.3 | 1.3 | GO:0000972 | transcription-dependent tethering of RNA polymerase II gene DNA at nuclear periphery(GO:0000972) |
0.3 | 1.0 | GO:0033629 | negative regulation of cell adhesion mediated by integrin(GO:0033629) |
0.3 | 1.3 | GO:0035405 | histone-threonine phosphorylation(GO:0035405) |
0.3 | 1.6 | GO:0072656 | maintenance of protein location in mitochondrion(GO:0072656) |
0.3 | 1.3 | GO:0031581 | hemidesmosome assembly(GO:0031581) |
0.3 | 1.0 | GO:1900045 | negative regulation of protein K63-linked ubiquitination(GO:1900045) negative regulation of protein polyubiquitination(GO:1902915) |
0.3 | 2.2 | GO:2000766 | negative regulation of cytoplasmic translation(GO:2000766) |
0.3 | 3.2 | GO:0006851 | mitochondrial calcium ion transport(GO:0006851) |
0.3 | 7.3 | GO:0033014 | porphyrin-containing compound biosynthetic process(GO:0006779) tetrapyrrole biosynthetic process(GO:0033014) |
0.3 | 1.6 | GO:0015705 | iodide transport(GO:0015705) |
0.3 | 1.2 | GO:0050747 | positive regulation of lipoprotein metabolic process(GO:0050747) |
0.3 | 0.9 | GO:0010360 | negative regulation of anion channel activity(GO:0010360) |
0.3 | 1.2 | GO:0043097 | pyrimidine-containing compound salvage(GO:0008655) pyrimidine nucleoside salvage(GO:0043097) |
0.3 | 4.9 | GO:0040015 | negative regulation of multicellular organism growth(GO:0040015) |
0.3 | 0.9 | GO:0060800 | regulation of cell differentiation involved in embryonic placenta development(GO:0060800) |
0.3 | 1.5 | GO:0044539 | long-chain fatty acid import(GO:0044539) |
0.3 | 2.7 | GO:0060158 | phospholipase C-activating dopamine receptor signaling pathway(GO:0060158) |
0.3 | 0.6 | GO:0090210 | regulation of establishment of blood-brain barrier(GO:0090210) |
0.3 | 0.9 | GO:0035526 | retrograde transport, plasma membrane to Golgi(GO:0035526) |
0.3 | 1.2 | GO:0032237 | activation of store-operated calcium channel activity(GO:0032237) |
0.3 | 2.9 | GO:0009404 | toxin metabolic process(GO:0009404) |
0.3 | 1.7 | GO:0006307 | DNA dealkylation involved in DNA repair(GO:0006307) |
0.3 | 0.3 | GO:1904996 | positive regulation of leukocyte adhesion to vascular endothelial cell(GO:1904996) |
0.3 | 1.1 | GO:0008626 | granzyme-mediated apoptotic signaling pathway(GO:0008626) |
0.3 | 2.0 | GO:0021999 | neural plate anterior/posterior regionalization(GO:0021999) |
0.3 | 0.8 | GO:0098700 | aminergic neurotransmitter loading into synaptic vesicle(GO:0015842) neurotransmitter loading into synaptic vesicle(GO:0098700) |
0.3 | 0.6 | GO:0035461 | vitamin transmembrane transport(GO:0035461) |
0.3 | 0.3 | GO:0051599 | response to hydrostatic pressure(GO:0051599) |
0.3 | 0.8 | GO:0002432 | granuloma formation(GO:0002432) |
0.3 | 1.4 | GO:0051987 | positive regulation of attachment of spindle microtubules to kinetochore(GO:0051987) |
0.3 | 0.6 | GO:0021538 | epithalamus development(GO:0021538) habenula development(GO:0021986) |
0.3 | 5.0 | GO:0001574 | ganglioside biosynthetic process(GO:0001574) |
0.3 | 2.2 | GO:0000059 | protein import into nucleus, docking(GO:0000059) |
0.3 | 1.4 | GO:0090336 | positive regulation of brown fat cell differentiation(GO:0090336) |
0.3 | 0.8 | GO:0003289 | atrial septum primum morphogenesis(GO:0003289) |
0.3 | 1.4 | GO:0019695 | choline metabolic process(GO:0019695) |
0.3 | 1.1 | GO:2000483 | negative regulation of interleukin-8 secretion(GO:2000483) |
0.3 | 0.8 | GO:0019676 | ammonia assimilation cycle(GO:0019676) |
0.3 | 1.1 | GO:0006659 | phosphatidylserine biosynthetic process(GO:0006659) |
0.3 | 2.7 | GO:0060211 | regulation of nuclear-transcribed mRNA poly(A) tail shortening(GO:0060211) positive regulation of nuclear-transcribed mRNA poly(A) tail shortening(GO:0060213) |
0.3 | 1.6 | GO:0002349 | histamine production involved in inflammatory response(GO:0002349) histamine secretion involved in inflammatory response(GO:0002441) histamine secretion by mast cell(GO:0002553) |
0.3 | 0.5 | GO:0070268 | cornification(GO:0070268) |
0.3 | 3.3 | GO:0035879 | lactate transport(GO:0015727) lactate transmembrane transport(GO:0035873) plasma membrane lactate transport(GO:0035879) |
0.3 | 1.4 | GO:0010626 | negative regulation of Schwann cell proliferation(GO:0010626) |
0.3 | 0.5 | GO:1901252 | regulation of intracellular transport of viral material(GO:1901252) |
0.3 | 1.4 | GO:0032020 | ISG15-protein conjugation(GO:0032020) |
0.3 | 1.4 | GO:0015760 | hexose phosphate transport(GO:0015712) glucose-6-phosphate transport(GO:0015760) |
0.3 | 1.3 | GO:0048859 | formation of anatomical boundary(GO:0048859) |
0.3 | 1.3 | GO:0060696 | regulation of phospholipid catabolic process(GO:0060696) |
0.3 | 1.9 | GO:2000773 | negative regulation of cellular senescence(GO:2000773) |
0.3 | 0.3 | GO:1901896 | positive regulation of calcium-transporting ATPase activity(GO:1901896) |
0.3 | 0.3 | GO:0043173 | nucleotide salvage(GO:0043173) |
0.3 | 0.3 | GO:0035791 | platelet-derived growth factor receptor-beta signaling pathway(GO:0035791) |
0.3 | 1.0 | GO:0038165 | oncostatin-M-mediated signaling pathway(GO:0038165) |
0.3 | 0.5 | GO:1900425 | negative regulation of defense response to bacterium(GO:1900425) |
0.3 | 0.8 | GO:0010901 | regulation of very-low-density lipoprotein particle remodeling(GO:0010901) |
0.3 | 1.0 | GO:1903553 | positive regulation of extracellular exosome assembly(GO:1903553) |
0.3 | 0.8 | GO:0006382 | adenosine to inosine editing(GO:0006382) |
0.3 | 0.3 | GO:2000138 | positive regulation of cell proliferation involved in heart morphogenesis(GO:2000138) |
0.3 | 0.8 | GO:0010159 | specification of organ position(GO:0010159) |
0.3 | 1.0 | GO:1900194 | negative regulation of oocyte maturation(GO:1900194) |
0.3 | 1.3 | GO:0002457 | T cell antigen processing and presentation(GO:0002457) |
0.3 | 0.8 | GO:0002036 | regulation of L-glutamate transport(GO:0002036) |
0.3 | 1.3 | GO:0010886 | positive regulation of cholesterol storage(GO:0010886) |
0.3 | 0.5 | GO:0021615 | glossopharyngeal nerve morphogenesis(GO:0021615) |
0.3 | 0.8 | GO:0006543 | glutamine catabolic process(GO:0006543) |
0.2 | 1.5 | GO:0015682 | ferric iron transport(GO:0015682) trivalent inorganic cation transport(GO:0072512) |
0.2 | 1.7 | GO:0071318 | cellular response to ATP(GO:0071318) |
0.2 | 1.2 | GO:0045719 | negative regulation of glycogen biosynthetic process(GO:0045719) |
0.2 | 0.2 | GO:0031587 | positive regulation of inositol 1,4,5-trisphosphate-sensitive calcium-release channel activity(GO:0031587) |
0.2 | 1.0 | GO:0048549 | positive regulation of pinocytosis(GO:0048549) |
0.2 | 1.7 | GO:1904415 | regulation of xenophagy(GO:1904415) positive regulation of xenophagy(GO:1904417) |
0.2 | 1.7 | GO:0001842 | neural fold formation(GO:0001842) |
0.2 | 1.0 | GO:0044829 | positive regulation by host of viral genome replication(GO:0044829) |
0.2 | 0.7 | GO:0033387 | putrescine biosynthetic process from ornithine(GO:0033387) |
0.2 | 8.4 | GO:0033141 | positive regulation of peptidyl-serine phosphorylation of STAT protein(GO:0033141) |
0.2 | 1.4 | GO:0042905 | 9-cis-retinoic acid biosynthetic process(GO:0042904) 9-cis-retinoic acid metabolic process(GO:0042905) |
0.2 | 0.5 | GO:0000320 | re-entry into mitotic cell cycle(GO:0000320) |
0.2 | 0.7 | GO:0044027 | hypermethylation of CpG island(GO:0044027) |
0.2 | 0.9 | GO:0002636 | positive regulation of germinal center formation(GO:0002636) |
0.2 | 0.7 | GO:0070827 | chromatin maintenance(GO:0070827) |
0.2 | 0.9 | GO:1901741 | regulation of myoblast fusion(GO:1901739) positive regulation of myoblast fusion(GO:1901741) |
0.2 | 0.2 | GO:0006573 | valine metabolic process(GO:0006573) |
0.2 | 0.9 | GO:2000977 | regulation of forebrain neuron differentiation(GO:2000977) |
0.2 | 0.2 | GO:1903935 | response to sodium arsenite(GO:1903935) |
0.2 | 0.5 | GO:0046061 | dATP catabolic process(GO:0046061) |
0.2 | 1.4 | GO:0031274 | positive regulation of pseudopodium assembly(GO:0031274) |
0.2 | 0.5 | GO:0009446 | putrescine biosynthetic process(GO:0009446) |
0.2 | 2.0 | GO:0030644 | cellular chloride ion homeostasis(GO:0030644) |
0.2 | 0.5 | GO:1901187 | regulation of ephrin receptor signaling pathway(GO:1901187) |
0.2 | 0.7 | GO:0046104 | thymidine metabolic process(GO:0046104) |
0.2 | 2.9 | GO:0002693 | positive regulation of cellular extravasation(GO:0002693) |
0.2 | 0.9 | GO:0050882 | voluntary musculoskeletal movement(GO:0050882) |
0.2 | 0.4 | GO:0006776 | vitamin A metabolic process(GO:0006776) |
0.2 | 1.8 | GO:0070493 | thrombin receptor signaling pathway(GO:0070493) |
0.2 | 1.1 | GO:0070389 | chaperone cofactor-dependent protein refolding(GO:0070389) |
0.2 | 3.1 | GO:0070498 | interleukin-1-mediated signaling pathway(GO:0070498) |
0.2 | 0.9 | GO:0021779 | oligodendrocyte cell fate specification(GO:0021778) oligodendrocyte cell fate commitment(GO:0021779) glial cell fate specification(GO:0021780) |
0.2 | 0.2 | GO:0035166 | post-embryonic hemopoiesis(GO:0035166) |
0.2 | 1.1 | GO:0046602 | regulation of mitotic centrosome separation(GO:0046602) |
0.2 | 0.9 | GO:0030240 | skeletal muscle thin filament assembly(GO:0030240) |
0.2 | 0.2 | GO:0010700 | negative regulation of norepinephrine secretion(GO:0010700) |
0.2 | 0.9 | GO:0051461 | positive regulation of corticotropin secretion(GO:0051461) |
0.2 | 0.4 | GO:0007386 | compartment pattern specification(GO:0007386) |
0.2 | 2.4 | GO:0070935 | 3'-UTR-mediated mRNA stabilization(GO:0070935) |
0.2 | 0.2 | GO:0034137 | positive regulation of toll-like receptor 2 signaling pathway(GO:0034137) |
0.2 | 0.9 | GO:0060948 | cardiac vascular smooth muscle cell development(GO:0060948) |
0.2 | 0.2 | GO:0048807 | female genitalia morphogenesis(GO:0048807) |
0.2 | 0.6 | GO:0001555 | oocyte growth(GO:0001555) |
0.2 | 0.6 | GO:0071440 | regulation of histone H3-K14 acetylation(GO:0071440) positive regulation of histone H3-K14 acetylation(GO:0071442) |
0.2 | 0.6 | GO:0006295 | nucleotide-excision repair, DNA incision, 3'-to lesion(GO:0006295) |
0.2 | 0.6 | GO:2000418 | positive regulation of eosinophil migration(GO:2000418) |
0.2 | 0.4 | GO:0009092 | homoserine metabolic process(GO:0009092) transsulfuration(GO:0019346) |
0.2 | 1.7 | GO:0018026 | peptidyl-lysine monomethylation(GO:0018026) |
0.2 | 0.6 | GO:0035483 | gastric emptying(GO:0035483) |
0.2 | 1.7 | GO:0033262 | regulation of nuclear cell cycle DNA replication(GO:0033262) |
0.2 | 0.6 | GO:0061113 | pancreas morphogenesis(GO:0061113) |
0.2 | 0.2 | GO:0034627 | 'de novo' NAD biosynthetic process(GO:0034627) |
0.2 | 1.0 | GO:0070475 | rRNA base methylation(GO:0070475) |
0.2 | 0.4 | GO:0019065 | receptor-mediated endocytosis of virus by host cell(GO:0019065) endocytosis involved in viral entry into host cell(GO:0075509) |
0.2 | 0.6 | GO:0061625 | fructose catabolic process(GO:0006001) fructose catabolic process to hydroxyacetone phosphate and glyceraldehyde-3-phosphate(GO:0061624) glycolytic process through fructose-1-phosphate(GO:0061625) |
0.2 | 1.0 | GO:0071236 | cellular response to antibiotic(GO:0071236) |
0.2 | 1.0 | GO:0090315 | negative regulation of protein targeting to membrane(GO:0090315) |
0.2 | 0.8 | GO:0000820 | regulation of glutamine family amino acid metabolic process(GO:0000820) |
0.2 | 0.6 | GO:0061010 | gall bladder development(GO:0061010) |
0.2 | 0.6 | GO:2000169 | regulation of peptidyl-cysteine S-nitrosylation(GO:2000169) |
0.2 | 0.4 | GO:0090526 | regulation of gluconeogenesis involved in cellular glucose homeostasis(GO:0090526) |
0.2 | 0.4 | GO:0090271 | positive regulation of fibroblast growth factor production(GO:0090271) |
0.2 | 0.6 | GO:2000359 | regulation of binding of sperm to zona pellucida(GO:2000359) |
0.2 | 0.6 | GO:0070837 | dehydroascorbic acid transport(GO:0070837) |
0.2 | 0.6 | GO:0090219 | negative regulation of lipid kinase activity(GO:0090219) |
0.2 | 0.6 | GO:0060050 | positive regulation of protein glycosylation(GO:0060050) |
0.2 | 1.2 | GO:2000786 | positive regulation of autophagosome assembly(GO:2000786) |
0.2 | 0.2 | GO:0050923 | regulation of negative chemotaxis(GO:0050923) |
0.2 | 2.2 | GO:0046130 | purine nucleoside catabolic process(GO:0006152) purine ribonucleoside catabolic process(GO:0046130) |
0.2 | 2.0 | GO:0090161 | Golgi ribbon formation(GO:0090161) |
0.2 | 0.4 | GO:0098735 | positive regulation of the force of heart contraction(GO:0098735) |
0.2 | 0.8 | GO:0061304 | retinal blood vessel morphogenesis(GO:0061304) |
0.2 | 1.6 | GO:0032534 | regulation of microvillus assembly(GO:0032534) |
0.2 | 0.2 | GO:0051387 | negative regulation of neurotrophin TRK receptor signaling pathway(GO:0051387) |
0.2 | 0.8 | GO:0008228 | opsonization(GO:0008228) |
0.2 | 0.6 | GO:0000379 | tRNA-type intron splice site recognition and cleavage(GO:0000379) |
0.2 | 1.4 | GO:0048387 | negative regulation of retinoic acid receptor signaling pathway(GO:0048387) |
0.2 | 2.0 | GO:0035563 | positive regulation of chromatin binding(GO:0035563) |
0.2 | 1.0 | GO:0010889 | regulation of sequestering of triglyceride(GO:0010889) |
0.2 | 0.6 | GO:0010046 | response to mycotoxin(GO:0010046) |
0.2 | 0.4 | GO:0003331 | regulation of extracellular matrix constituent secretion(GO:0003330) positive regulation of extracellular matrix constituent secretion(GO:0003331) |
0.2 | 0.6 | GO:0018992 | germ-line sex determination(GO:0018992) |
0.2 | 0.6 | GO:2000051 | negative regulation of non-canonical Wnt signaling pathway(GO:2000051) |
0.2 | 1.4 | GO:0061032 | visceral serous pericardium development(GO:0061032) |
0.2 | 1.4 | GO:0070914 | UV-damage excision repair(GO:0070914) |
0.2 | 1.5 | GO:0009437 | carnitine metabolic process(GO:0009437) |
0.2 | 0.8 | GO:0090209 | negative regulation of triglyceride metabolic process(GO:0090209) |
0.2 | 0.8 | GO:0051791 | medium-chain fatty acid metabolic process(GO:0051791) |
0.2 | 0.8 | GO:2000973 | regulation of pro-B cell differentiation(GO:2000973) |
0.2 | 1.7 | GO:0070050 | neuron cellular homeostasis(GO:0070050) |
0.2 | 1.0 | GO:0035469 | determination of pancreatic left/right asymmetry(GO:0035469) |
0.2 | 0.8 | GO:0001957 | intramembranous ossification(GO:0001957) direct ossification(GO:0036072) |
0.2 | 1.5 | GO:0030449 | regulation of complement activation(GO:0030449) |
0.2 | 0.8 | GO:0010510 | regulation of acetyl-CoA biosynthetic process from pyruvate(GO:0010510) regulation of acyl-CoA biosynthetic process(GO:0050812) |
0.2 | 6.8 | GO:1900047 | negative regulation of blood coagulation(GO:0030195) negative regulation of hemostasis(GO:1900047) |
0.2 | 0.8 | GO:0019482 | beta-alanine metabolic process(GO:0019482) |
0.2 | 0.6 | GO:0031659 | positive regulation of cyclin-dependent protein serine/threonine kinase activity involved in G1/S transition of mitotic cell cycle(GO:0031659) |
0.2 | 1.5 | GO:0071578 | zinc II ion transmembrane import(GO:0071578) |
0.2 | 0.8 | GO:0039536 | negative regulation of RIG-I signaling pathway(GO:0039536) |
0.2 | 0.6 | GO:0090435 | protein localization to nuclear envelope(GO:0090435) |
0.2 | 0.6 | GO:1903800 | positive regulation of production of miRNAs involved in gene silencing by miRNA(GO:1903800) |
0.2 | 0.2 | GO:0034136 | negative regulation of toll-like receptor 2 signaling pathway(GO:0034136) |
0.2 | 0.6 | GO:0060154 | cellular process regulating host cell cycle in response to virus(GO:0060154) |
0.2 | 0.7 | GO:0010529 | regulation of transposition(GO:0010528) negative regulation of transposition(GO:0010529) |
0.2 | 0.6 | GO:0006562 | proline catabolic process(GO:0006562) |
0.2 | 1.9 | GO:0032460 | negative regulation of protein oligomerization(GO:0032460) |
0.2 | 1.3 | GO:0001867 | complement activation, lectin pathway(GO:0001867) |
0.2 | 0.4 | GO:1901339 | regulation of store-operated calcium channel activity(GO:1901339) |
0.2 | 0.2 | GO:0070278 | extracellular matrix constituent secretion(GO:0070278) |
0.2 | 1.1 | GO:0032287 | peripheral nervous system myelin maintenance(GO:0032287) |
0.2 | 0.5 | GO:1903999 | negative regulation of eating behavior(GO:1903999) |
0.2 | 0.5 | GO:0051684 | maintenance of Golgi location(GO:0051684) |
0.2 | 0.5 | GO:0015889 | cobalamin transport(GO:0015889) |
0.2 | 0.4 | GO:0038108 | negative regulation of appetite by leptin-mediated signaling pathway(GO:0038108) |
0.2 | 0.2 | GO:0035553 | oxidative RNA demethylation(GO:0035513) oxidative single-stranded RNA demethylation(GO:0035553) |
0.2 | 0.5 | GO:0045585 | regulation of cytotoxic T cell differentiation(GO:0045583) positive regulation of cytotoxic T cell differentiation(GO:0045585) |
0.2 | 0.7 | GO:0007023 | post-chaperonin tubulin folding pathway(GO:0007023) |
0.2 | 0.4 | GO:1902896 | terminal web assembly(GO:1902896) |
0.2 | 1.1 | GO:0031953 | negative regulation of protein autophosphorylation(GO:0031953) |
0.2 | 0.7 | GO:1904491 | protein localization to ciliary transition zone(GO:1904491) |
0.2 | 0.5 | GO:0048386 | positive regulation of retinoic acid receptor signaling pathway(GO:0048386) |
0.2 | 0.4 | GO:0014858 | positive regulation of skeletal muscle cell proliferation(GO:0014858) |
0.2 | 0.4 | GO:0001907 | killing by symbiont of host cells(GO:0001907) disruption by symbiont of host cell(GO:0044004) |
0.2 | 0.4 | GO:0006545 | glycine biosynthetic process(GO:0006545) |
0.2 | 0.5 | GO:1990928 | response to amino acid starvation(GO:1990928) |
0.2 | 0.5 | GO:0030886 | negative regulation of myeloid dendritic cell activation(GO:0030886) |
0.2 | 0.7 | GO:0006083 | acetate metabolic process(GO:0006083) |
0.2 | 1.1 | GO:1901621 | negative regulation of smoothened signaling pathway involved in dorsal/ventral neural tube patterning(GO:1901621) |
0.2 | 1.1 | GO:0000022 | mitotic spindle elongation(GO:0000022) mitotic spindle midzone assembly(GO:0051256) |
0.2 | 0.5 | GO:0060618 | nipple development(GO:0060618) |
0.2 | 0.2 | GO:1902965 | protein localization to early endosome(GO:1902946) regulation of protein localization to early endosome(GO:1902965) positive regulation of protein localization to early endosome(GO:1902966) |
0.2 | 0.2 | GO:1902947 | regulation of tau-protein kinase activity(GO:1902947) |
0.2 | 0.9 | GO:0051596 | methylglyoxal catabolic process to D-lactate via S-lactoyl-glutathione(GO:0019243) methylglyoxal catabolic process(GO:0051596) methylglyoxal catabolic process to lactate(GO:0061727) |
0.2 | 1.6 | GO:0010614 | negative regulation of cardiac muscle hypertrophy(GO:0010614) |
0.2 | 1.4 | GO:0035630 | bone mineralization involved in bone maturation(GO:0035630) |
0.2 | 0.9 | GO:0006534 | cysteine metabolic process(GO:0006534) |
0.2 | 1.0 | GO:0060352 | cell adhesion molecule production(GO:0060352) |
0.2 | 0.7 | GO:0006651 | diacylglycerol biosynthetic process(GO:0006651) |
0.2 | 0.7 | GO:0071447 | cellular response to hydroperoxide(GO:0071447) |
0.2 | 0.3 | GO:0010735 | positive regulation of transcription via serum response element binding(GO:0010735) |
0.2 | 1.2 | GO:0070365 | hepatocyte differentiation(GO:0070365) |
0.2 | 1.9 | GO:1902287 | semaphorin-plexin signaling pathway involved in axon guidance(GO:1902287) |
0.2 | 0.2 | GO:1903011 | negative regulation of bone development(GO:1903011) |
0.2 | 0.8 | GO:0052805 | histidine catabolic process(GO:0006548) imidazole-containing compound catabolic process(GO:0052805) |
0.2 | 0.3 | GO:1902219 | intrinsic apoptotic signaling pathway in response to osmotic stress(GO:0008627) regulation of intrinsic apoptotic signaling pathway in response to osmotic stress(GO:1902218) negative regulation of intrinsic apoptotic signaling pathway in response to osmotic stress(GO:1902219) |
0.2 | 4.1 | GO:0030574 | collagen catabolic process(GO:0030574) |
0.2 | 0.7 | GO:0042420 | dopamine catabolic process(GO:0042420) |
0.2 | 1.7 | GO:0045899 | positive regulation of RNA polymerase II transcriptional preinitiation complex assembly(GO:0045899) |
0.2 | 0.5 | GO:0047484 | regulation of response to osmotic stress(GO:0047484) |
0.2 | 0.8 | GO:0009052 | pentose-phosphate shunt, non-oxidative branch(GO:0009052) |
0.2 | 0.8 | GO:0090557 | establishment of endothelial intestinal barrier(GO:0090557) |
0.2 | 1.2 | GO:2000480 | negative regulation of cAMP-dependent protein kinase activity(GO:2000480) |
0.2 | 0.3 | GO:0044090 | positive regulation of vacuole organization(GO:0044090) |
0.2 | 0.3 | GO:1900044 | regulation of protein K63-linked ubiquitination(GO:1900044) |
0.2 | 0.2 | GO:0034134 | toll-like receptor 2 signaling pathway(GO:0034134) |
0.2 | 0.8 | GO:0061073 | ciliary body morphogenesis(GO:0061073) |
0.2 | 0.7 | GO:0061641 | CENP-A containing nucleosome assembly(GO:0034080) CENP-A containing chromatin organization(GO:0061641) |
0.2 | 0.5 | GO:0040016 | embryonic cleavage(GO:0040016) |
0.2 | 0.5 | GO:0015886 | heme transport(GO:0015886) |
0.2 | 0.2 | GO:0008588 | release of cytoplasmic sequestered NF-kappaB(GO:0008588) |
0.2 | 0.5 | GO:0033499 | galactose catabolic process via UDP-galactose(GO:0033499) glycolytic process from galactose(GO:0061623) |
0.2 | 2.7 | GO:0051497 | negative regulation of stress fiber assembly(GO:0051497) |
0.2 | 1.0 | GO:0009191 | ribonucleoside diphosphate catabolic process(GO:0009191) |
0.2 | 0.5 | GO:0030397 | membrane disassembly(GO:0030397) nuclear envelope disassembly(GO:0051081) |
0.2 | 0.8 | GO:1902751 | positive regulation of cell cycle G2/M phase transition(GO:1902751) |
0.2 | 0.5 | GO:0010536 | positive regulation of activation of Janus kinase activity(GO:0010536) |
0.2 | 0.5 | GO:0071462 | cellular response to water stimulus(GO:0071462) |
0.2 | 1.4 | GO:0045906 | negative regulation of vasoconstriction(GO:0045906) |
0.2 | 0.9 | GO:0019363 | pyridine nucleotide biosynthetic process(GO:0019363) |
0.2 | 1.1 | GO:0032933 | response to sterol depletion(GO:0006991) SREBP signaling pathway(GO:0032933) cellular response to sterol depletion(GO:0071501) |
0.2 | 0.6 | GO:0034374 | low-density lipoprotein particle remodeling(GO:0034374) |
0.2 | 0.3 | GO:1902255 | positive regulation of intrinsic apoptotic signaling pathway by p53 class mediator(GO:1902255) |
0.2 | 0.5 | GO:0071494 | cellular response to UV-C(GO:0071494) |
0.2 | 1.4 | GO:0061179 | negative regulation of insulin secretion involved in cellular response to glucose stimulus(GO:0061179) |
0.2 | 0.5 | GO:1902065 | response to L-glutamate(GO:1902065) |
0.2 | 0.3 | GO:0046726 | positive regulation by virus of viral protein levels in host cell(GO:0046726) |
0.2 | 0.2 | GO:0072125 | negative regulation of glomerular mesangial cell proliferation(GO:0072125) negative regulation of glomerulus development(GO:0090194) negative regulation of cell proliferation involved in kidney development(GO:1901723) |
0.2 | 0.3 | GO:0035795 | negative regulation of mitochondrial membrane permeability(GO:0035795) negative regulation of mitochondrial membrane permeability involved in apoptotic process(GO:1902109) |
0.2 | 1.2 | GO:0043983 | histone H4-K12 acetylation(GO:0043983) |
0.2 | 0.8 | GO:0010961 | cellular magnesium ion homeostasis(GO:0010961) |
0.2 | 0.5 | GO:0060261 | positive regulation of transcription initiation from RNA polymerase II promoter(GO:0060261) |
0.2 | 0.3 | GO:0045898 | regulation of RNA polymerase II transcriptional preinitiation complex assembly(GO:0045898) |
0.2 | 0.2 | GO:0044314 | protein K27-linked ubiquitination(GO:0044314) |
0.2 | 0.5 | GO:1900060 | negative regulation of ceramide biosynthetic process(GO:1900060) |
0.2 | 2.6 | GO:0000413 | protein peptidyl-prolyl isomerization(GO:0000413) |
0.2 | 0.3 | GO:0018171 | peptidyl-cysteine oxidation(GO:0018171) |
0.2 | 0.2 | GO:0000727 | double-strand break repair via break-induced replication(GO:0000727) |
0.2 | 2.1 | GO:0051016 | barbed-end actin filament capping(GO:0051016) |
0.1 | 3.6 | GO:0007080 | mitotic metaphase plate congression(GO:0007080) |
0.1 | 4.6 | GO:0006730 | one-carbon metabolic process(GO:0006730) |
0.1 | 0.7 | GO:0042511 | positive regulation of tyrosine phosphorylation of Stat1 protein(GO:0042511) |
0.1 | 0.6 | GO:0001915 | negative regulation of T cell mediated cytotoxicity(GO:0001915) |
0.1 | 0.7 | GO:0045084 | positive regulation of interleukin-12 biosynthetic process(GO:0045084) |
0.1 | 0.7 | GO:0006348 | chromatin silencing at telomere(GO:0006348) |
0.1 | 0.9 | GO:0032486 | Rap protein signal transduction(GO:0032486) |
0.1 | 0.3 | GO:0032466 | negative regulation of cytokinesis(GO:0032466) |
0.1 | 3.2 | GO:0034198 | cellular response to amino acid starvation(GO:0034198) |
0.1 | 0.7 | GO:0031946 | regulation of glucocorticoid biosynthetic process(GO:0031946) |
0.1 | 0.6 | GO:0016584 | nucleosome positioning(GO:0016584) |
0.1 | 0.7 | GO:0043619 | regulation of transcription from RNA polymerase II promoter in response to oxidative stress(GO:0043619) |
0.1 | 2.1 | GO:0032011 | ARF protein signal transduction(GO:0032011) regulation of ARF protein signal transduction(GO:0032012) |
0.1 | 0.4 | GO:0006114 | glycerol biosynthetic process(GO:0006114) |
0.1 | 0.3 | GO:1901563 | response to camptothecin(GO:1901563) |
0.1 | 0.8 | GO:0030033 | microvillus assembly(GO:0030033) |
0.1 | 1.0 | GO:0006689 | ganglioside catabolic process(GO:0006689) |
0.1 | 0.8 | GO:0000212 | meiotic spindle organization(GO:0000212) |
0.1 | 0.6 | GO:0007016 | cytoskeletal anchoring at plasma membrane(GO:0007016) |
0.1 | 3.2 | GO:0051125 | regulation of actin nucleation(GO:0051125) |
0.1 | 0.3 | GO:0003221 | right ventricular cardiac muscle tissue morphogenesis(GO:0003221) |
0.1 | 0.1 | GO:0035441 | cell migration involved in vasculogenesis(GO:0035441) |
0.1 | 0.4 | GO:0042376 | phylloquinone metabolic process(GO:0042374) phylloquinone catabolic process(GO:0042376) quinone catabolic process(GO:1901662) |
0.1 | 0.1 | GO:0036216 | response to stem cell factor(GO:0036215) cellular response to stem cell factor stimulus(GO:0036216) Kit signaling pathway(GO:0038109) |
0.1 | 1.0 | GO:0006833 | water transport(GO:0006833) |
0.1 | 0.3 | GO:0072361 | regulation of glycolytic process by regulation of transcription from RNA polymerase II promoter(GO:0072361) |
0.1 | 0.8 | GO:0031119 | tRNA pseudouridine synthesis(GO:0031119) |
0.1 | 3.0 | GO:0000470 | maturation of LSU-rRNA(GO:0000470) |
0.1 | 0.1 | GO:0042993 | positive regulation of transcription factor import into nucleus(GO:0042993) |
0.1 | 0.3 | GO:1903689 | regulation of wound healing, spreading of epidermal cells(GO:1903689) |
0.1 | 0.1 | GO:0010878 | cholesterol storage(GO:0010878) |
0.1 | 0.1 | GO:0006362 | transcription elongation from RNA polymerase I promoter(GO:0006362) |
0.1 | 0.7 | GO:0045654 | positive regulation of megakaryocyte differentiation(GO:0045654) |
0.1 | 1.9 | GO:0060716 | labyrinthine layer blood vessel development(GO:0060716) |
0.1 | 0.5 | GO:1902897 | regulation of postsynaptic density protein 95 clustering(GO:1902897) |
0.1 | 2.3 | GO:0045662 | negative regulation of myoblast differentiation(GO:0045662) |
0.1 | 1.4 | GO:0002115 | store-operated calcium entry(GO:0002115) |
0.1 | 0.9 | GO:0090026 | positive regulation of monocyte chemotaxis(GO:0090026) |
0.1 | 1.6 | GO:0031100 | organ regeneration(GO:0031100) |
0.1 | 1.6 | GO:1901798 | positive regulation of signal transduction by p53 class mediator(GO:1901798) |
0.1 | 0.3 | GO:0007253 | cytoplasmic sequestering of NF-kappaB(GO:0007253) |
0.1 | 0.4 | GO:0060744 | thelarche(GO:0042695) mammary gland branching involved in thelarche(GO:0060744) |
0.1 | 0.4 | GO:2000427 | positive regulation of apoptotic cell clearance(GO:2000427) |
0.1 | 1.1 | GO:0098911 | regulation of ventricular cardiac muscle cell action potential(GO:0098911) |
0.1 | 0.7 | GO:0006685 | sphingomyelin catabolic process(GO:0006685) |
0.1 | 0.7 | GO:0007199 | G-protein coupled receptor signaling pathway coupled to cGMP nucleotide second messenger(GO:0007199) |
0.1 | 1.5 | GO:0051770 | positive regulation of nitric-oxide synthase biosynthetic process(GO:0051770) |
0.1 | 0.4 | GO:0015772 | disaccharide transport(GO:0015766) sucrose transport(GO:0015770) oligosaccharide transport(GO:0015772) |
0.1 | 0.4 | GO:0072531 | pyrimidine-containing compound transmembrane transport(GO:0072531) |
0.1 | 1.6 | GO:0043248 | proteasome assembly(GO:0043248) |
0.1 | 0.4 | GO:1903334 | positive regulation of protein folding(GO:1903334) |
0.1 | 0.3 | GO:0072718 | response to cisplatin(GO:0072718) |
0.1 | 0.3 | GO:0007039 | protein catabolic process in the vacuole(GO:0007039) |
0.1 | 0.3 | GO:0010832 | negative regulation of myotube differentiation(GO:0010832) |
0.1 | 0.1 | GO:0046066 | purine deoxyribonucleoside diphosphate metabolic process(GO:0009182) dGDP metabolic process(GO:0046066) |
0.1 | 0.3 | GO:0071314 | cellular response to cocaine(GO:0071314) |
0.1 | 0.3 | GO:0090270 | fibroblast growth factor production(GO:0090269) regulation of fibroblast growth factor production(GO:0090270) |
0.1 | 0.8 | GO:0034383 | low-density lipoprotein particle clearance(GO:0034383) |
0.1 | 0.8 | GO:0097340 | inhibition of cysteine-type endopeptidase activity(GO:0097340) zymogen inhibition(GO:0097341) inhibition of cysteine-type endopeptidase activity involved in apoptotic process(GO:1990001) |
0.1 | 0.3 | GO:0042726 | flavin-containing compound metabolic process(GO:0042726) |
0.1 | 1.2 | GO:0046835 | carbohydrate phosphorylation(GO:0046835) |
0.1 | 0.4 | GO:0034729 | histone H3-K79 methylation(GO:0034729) |
0.1 | 0.3 | GO:1900740 | regulation of protein insertion into mitochondrial membrane involved in apoptotic signaling pathway(GO:1900739) positive regulation of protein insertion into mitochondrial membrane involved in apoptotic signaling pathway(GO:1900740) |
0.1 | 0.9 | GO:0034244 | negative regulation of transcription elongation from RNA polymerase II promoter(GO:0034244) |
0.1 | 0.5 | GO:0070072 | vacuolar proton-transporting V-type ATPase complex assembly(GO:0070072) |
0.1 | 0.4 | GO:2000189 | positive regulation of cholesterol homeostasis(GO:2000189) |
0.1 | 1.3 | GO:0035162 | embryonic hemopoiesis(GO:0035162) |
0.1 | 0.8 | GO:0007144 | female meiosis I(GO:0007144) |
0.1 | 0.8 | GO:0006477 | protein sulfation(GO:0006477) |
0.1 | 0.1 | GO:0048320 | axial mesoderm formation(GO:0048320) |
0.1 | 1.5 | GO:0031163 | iron-sulfur cluster assembly(GO:0016226) metallo-sulfur cluster assembly(GO:0031163) |
0.1 | 0.5 | GO:0006532 | aspartate biosynthetic process(GO:0006532) |
0.1 | 0.4 | GO:0006686 | sphingomyelin biosynthetic process(GO:0006686) |
0.1 | 0.6 | GO:0060770 | negative regulation of epithelial cell proliferation involved in prostate gland development(GO:0060770) |
0.1 | 0.9 | GO:0031936 | negative regulation of chromatin silencing(GO:0031936) |
0.1 | 1.0 | GO:0006607 | NLS-bearing protein import into nucleus(GO:0006607) |
0.1 | 0.6 | GO:0031053 | primary miRNA processing(GO:0031053) |
0.1 | 0.4 | GO:0032971 | regulation of muscle filament sliding(GO:0032971) |
0.1 | 1.1 | GO:0051984 | positive regulation of chromosome segregation(GO:0051984) |
0.1 | 0.6 | GO:0009263 | deoxyribonucleotide biosynthetic process(GO:0009263) |
0.1 | 2.6 | GO:0045109 | intermediate filament organization(GO:0045109) |
0.1 | 0.1 | GO:0060921 | sinoatrial node development(GO:0003163) sinoatrial node cell differentiation(GO:0060921) |
0.1 | 0.4 | GO:0019532 | oxalate transport(GO:0019532) |
0.1 | 0.2 | GO:0009219 | pyrimidine deoxyribonucleotide metabolic process(GO:0009219) |
0.1 | 0.4 | GO:0060623 | regulation of chromosome condensation(GO:0060623) |
0.1 | 0.7 | GO:0070970 | interleukin-2 secretion(GO:0070970) |
0.1 | 2.1 | GO:0070534 | protein K63-linked ubiquitination(GO:0070534) |
0.1 | 2.5 | GO:0031146 | SCF-dependent proteasomal ubiquitin-dependent protein catabolic process(GO:0031146) |
0.1 | 0.2 | GO:0002309 | T cell proliferation involved in immune response(GO:0002309) |
0.1 | 0.4 | GO:0036066 | protein O-linked fucosylation(GO:0036066) |
0.1 | 0.1 | GO:0000965 | mitochondrial RNA 3'-end processing(GO:0000965) |
0.1 | 0.5 | GO:0001712 | ectodermal cell fate commitment(GO:0001712) |
0.1 | 0.5 | GO:0046485 | ether lipid metabolic process(GO:0046485) |
0.1 | 0.5 | GO:0071763 | nuclear membrane organization(GO:0071763) |
0.1 | 1.2 | GO:0015816 | glycine transport(GO:0015816) |
0.1 | 0.5 | GO:2000643 | positive regulation of early endosome to late endosome transport(GO:2000643) |
0.1 | 2.3 | GO:0042832 | defense response to protozoan(GO:0042832) |
0.1 | 1.8 | GO:0055090 | acylglycerol homeostasis(GO:0055090) triglyceride homeostasis(GO:0070328) |
0.1 | 0.1 | GO:0085020 | protein K6-linked ubiquitination(GO:0085020) |
0.1 | 0.8 | GO:0042168 | heme metabolic process(GO:0042168) |
0.1 | 0.2 | GO:0051088 | PMA-inducible membrane protein ectodomain proteolysis(GO:0051088) |
0.1 | 0.4 | GO:0071712 | ER-associated misfolded protein catabolic process(GO:0071712) |
0.1 | 0.2 | GO:0051901 | positive regulation of mitochondrial depolarization(GO:0051901) |
0.1 | 0.3 | GO:0060068 | vagina development(GO:0060068) |
0.1 | 0.3 | GO:2000188 | regulation of cholesterol homeostasis(GO:2000188) |
0.1 | 0.2 | GO:0070294 | renal sodium ion transport(GO:0003096) renal sodium ion absorption(GO:0070294) |
0.1 | 0.3 | GO:0002414 | immunoglobulin transcytosis in epithelial cells(GO:0002414) |
0.1 | 0.7 | GO:1902222 | L-phenylalanine metabolic process(GO:0006558) L-phenylalanine catabolic process(GO:0006559) erythrose 4-phosphate/phosphoenolpyruvate family amino acid metabolic process(GO:1902221) erythrose 4-phosphate/phosphoenolpyruvate family amino acid catabolic process(GO:1902222) |
0.1 | 0.6 | GO:0032482 | Rab protein signal transduction(GO:0032482) |
0.1 | 0.3 | GO:0035435 | phosphate ion transmembrane transport(GO:0035435) |
0.1 | 0.3 | GO:2000210 | positive regulation of anoikis(GO:2000210) |
0.1 | 0.3 | GO:0043091 | L-arginine import(GO:0043091) arginine import(GO:0090467) L-arginine transport(GO:1902023) |
0.1 | 1.0 | GO:0040037 | negative regulation of fibroblast growth factor receptor signaling pathway(GO:0040037) |
0.1 | 0.6 | GO:0070922 | small RNA loading onto RISC(GO:0070922) |
0.1 | 0.1 | GO:1902445 | regulation of mitochondrial membrane permeability involved in programmed necrotic cell death(GO:1902445) |
0.1 | 0.5 | GO:0043117 | positive regulation of vascular permeability(GO:0043117) |
0.1 | 0.9 | GO:0046685 | response to arsenic-containing substance(GO:0046685) |
0.1 | 0.2 | GO:1903750 | regulation of intrinsic apoptotic signaling pathway in response to hydrogen peroxide(GO:1903750) negative regulation of intrinsic apoptotic signaling pathway in response to hydrogen peroxide(GO:1903751) |
0.1 | 0.1 | GO:0031943 | regulation of glucocorticoid metabolic process(GO:0031943) |
0.1 | 1.1 | GO:0043276 | anoikis(GO:0043276) |
0.1 | 0.1 | GO:0070459 | prolactin secretion(GO:0070459) |
0.1 | 0.2 | GO:0001996 | positive regulation of heart rate by epinephrine-norepinephrine(GO:0001996) |
0.1 | 0.3 | GO:0040009 | regulation of growth rate(GO:0040009) |
0.1 | 1.0 | GO:0015937 | coenzyme A biosynthetic process(GO:0015937) |
0.1 | 0.2 | GO:0009972 | cytidine catabolic process(GO:0006216) cytidine deamination(GO:0009972) cytidine metabolic process(GO:0046087) |
0.1 | 0.2 | GO:0050955 | thermoception(GO:0050955) |
0.1 | 0.3 | GO:0000389 | mRNA 3'-splice site recognition(GO:0000389) |
0.1 | 0.3 | GO:0033634 | positive regulation of cell-cell adhesion mediated by integrin(GO:0033634) |
0.1 | 1.2 | GO:0051601 | exocyst localization(GO:0051601) |
0.1 | 0.2 | GO:0032929 | negative regulation of superoxide anion generation(GO:0032929) |
0.1 | 0.2 | GO:2000504 | positive regulation of blood vessel remodeling(GO:2000504) |
0.1 | 0.1 | GO:2000909 | regulation of cholesterol import(GO:0060620) regulation of sterol import(GO:2000909) |
0.1 | 0.4 | GO:0061158 | 3'-UTR-mediated mRNA destabilization(GO:0061158) |
0.1 | 0.2 | GO:1903715 | regulation of aerobic respiration(GO:1903715) |
0.1 | 0.5 | GO:0033601 | positive regulation of mammary gland epithelial cell proliferation(GO:0033601) |
0.1 | 0.1 | GO:0010225 | response to UV-C(GO:0010225) |
0.1 | 0.3 | GO:0032474 | otolith morphogenesis(GO:0032474) |
0.1 | 0.9 | GO:0032968 | positive regulation of transcription elongation from RNA polymerase II promoter(GO:0032968) |
0.1 | 0.2 | GO:0002200 | somatic diversification of immune receptors(GO:0002200) |
0.1 | 0.1 | GO:0032290 | peripheral nervous system myelin formation(GO:0032290) |
0.1 | 1.2 | GO:0061014 | positive regulation of mRNA catabolic process(GO:0061014) |
0.1 | 0.3 | GO:0010804 | negative regulation of tumor necrosis factor-mediated signaling pathway(GO:0010804) |
0.1 | 0.1 | GO:2000508 | regulation of dendritic cell chemotaxis(GO:2000508) positive regulation of dendritic cell chemotaxis(GO:2000510) |
0.1 | 0.3 | GO:0032201 | telomere maintenance via semi-conservative replication(GO:0032201) mitotic telomere maintenance via semi-conservative replication(GO:1902990) |
0.1 | 1.7 | GO:2000785 | regulation of autophagosome assembly(GO:2000785) |
0.1 | 0.3 | GO:0014067 | negative regulation of phosphatidylinositol 3-kinase signaling(GO:0014067) |
0.1 | 0.3 | GO:0043578 | nuclear matrix organization(GO:0043578) nuclear matrix anchoring at nuclear membrane(GO:0090292) |
0.1 | 0.3 | GO:0005984 | disaccharide metabolic process(GO:0005984) |
0.1 | 1.6 | GO:0030488 | tRNA methylation(GO:0030488) |
0.1 | 0.3 | GO:0031034 | myosin filament assembly(GO:0031034) |
0.1 | 0.1 | GO:0060397 | JAK-STAT cascade involved in growth hormone signaling pathway(GO:0060397) |
0.1 | 0.3 | GO:0015838 | amino-acid betaine transport(GO:0015838) |
0.1 | 0.4 | GO:1903887 | motile primary cilium assembly(GO:1903887) |
0.1 | 0.1 | GO:0045079 | negative regulation of chemokine biosynthetic process(GO:0045079) |
0.1 | 0.8 | GO:0033148 | positive regulation of intracellular estrogen receptor signaling pathway(GO:0033148) |
0.1 | 0.6 | GO:0046512 | diol biosynthetic process(GO:0034312) sphingosine biosynthetic process(GO:0046512) |
0.1 | 0.1 | GO:0061314 | Notch signaling involved in heart development(GO:0061314) |
0.1 | 1.4 | GO:0036075 | endochondral ossification(GO:0001958) replacement ossification(GO:0036075) |
0.1 | 1.2 | GO:0042149 | cellular response to glucose starvation(GO:0042149) |
0.1 | 0.5 | GO:0071985 | multivesicular body sorting pathway(GO:0071985) |
0.1 | 0.1 | GO:0048633 | positive regulation of skeletal muscle tissue growth(GO:0048633) |
0.1 | 0.3 | GO:0070164 | negative regulation of adiponectin secretion(GO:0070164) |
0.1 | 2.1 | GO:0046854 | phosphatidylinositol phosphorylation(GO:0046854) |
0.1 | 0.1 | GO:0055015 | ventricular cardiac muscle cell development(GO:0055015) |
0.1 | 0.2 | GO:1990845 | diet induced thermogenesis(GO:0002024) adaptive thermogenesis(GO:1990845) |
0.1 | 0.7 | GO:0070131 | positive regulation of mitochondrial translation(GO:0070131) |
0.1 | 0.9 | GO:0043011 | myeloid dendritic cell differentiation(GO:0043011) |
0.1 | 1.4 | GO:0006465 | signal peptide processing(GO:0006465) |
0.1 | 0.6 | GO:0097284 | hepatocyte apoptotic process(GO:0097284) |
0.1 | 0.4 | GO:0098535 | de novo centriole assembly(GO:0098535) |
0.1 | 1.8 | GO:0006301 | postreplication repair(GO:0006301) |
0.1 | 0.3 | GO:0071926 | cannabinoid signaling pathway(GO:0038171) endocannabinoid signaling pathway(GO:0071926) |
0.1 | 0.8 | GO:0052697 | xenobiotic glucuronidation(GO:0052697) |
0.1 | 1.2 | GO:0046463 | triglyceride biosynthetic process(GO:0019432) neutral lipid biosynthetic process(GO:0046460) acylglycerol biosynthetic process(GO:0046463) |
0.1 | 0.5 | GO:0051310 | metaphase plate congression(GO:0051310) |
0.1 | 0.5 | GO:0031665 | negative regulation of lipopolysaccharide-mediated signaling pathway(GO:0031665) |
0.1 | 0.2 | GO:0070889 | platelet alpha granule organization(GO:0070889) |
0.1 | 0.2 | GO:0039689 | negative stranded viral RNA replication(GO:0039689) multi-organism biosynthetic process(GO:0044034) |
0.1 | 3.0 | GO:0045445 | myoblast differentiation(GO:0045445) |
0.1 | 0.7 | GO:0032695 | negative regulation of interleukin-12 production(GO:0032695) |
0.1 | 0.9 | GO:0001502 | cartilage condensation(GO:0001502) cell aggregation(GO:0098743) |
0.1 | 0.1 | GO:0006933 | negative regulation of cell adhesion involved in substrate-bound cell migration(GO:0006933) |
0.1 | 0.2 | GO:0006344 | maintenance of chromatin silencing(GO:0006344) |
0.1 | 0.1 | GO:0048340 | paraxial mesoderm morphogenesis(GO:0048340) |
0.1 | 0.2 | GO:0009730 | detection of carbohydrate stimulus(GO:0009730) detection of hexose stimulus(GO:0009732) detection of monosaccharide stimulus(GO:0034287) detection of glucose(GO:0051594) |
0.1 | 0.6 | GO:0019673 | GDP-mannose metabolic process(GO:0019673) |
0.1 | 0.1 | GO:1903525 | regulation of membrane tubulation(GO:1903525) |
0.1 | 0.4 | GO:0048819 | regulation of hair follicle maturation(GO:0048819) |
0.1 | 0.2 | GO:0036159 | inner dynein arm assembly(GO:0036159) |
0.1 | 0.1 | GO:2000836 | androgen secretion(GO:0035935) regulation of androgen secretion(GO:2000834) positive regulation of androgen secretion(GO:2000836) |
0.1 | 0.2 | GO:0044860 | protein localization to plasma membrane raft(GO:0044860) |
0.1 | 0.5 | GO:0043922 | negative regulation by host of viral transcription(GO:0043922) |
0.1 | 0.1 | GO:0071288 | cellular response to mercury ion(GO:0071288) |
0.1 | 0.2 | GO:0051709 | regulation of killing of cells of other organism(GO:0051709) |
0.1 | 0.7 | GO:0048563 | post-embryonic organ morphogenesis(GO:0048563) |
0.1 | 0.3 | GO:1903288 | regulation of potassium ion import(GO:1903286) positive regulation of potassium ion import(GO:1903288) |
0.1 | 0.4 | GO:0051001 | negative regulation of nitric-oxide synthase activity(GO:0051001) |
0.1 | 0.3 | GO:0043951 | negative regulation of cAMP-mediated signaling(GO:0043951) |
0.1 | 0.4 | GO:0018904 | ether metabolic process(GO:0018904) |
0.1 | 2.7 | GO:0010508 | positive regulation of autophagy(GO:0010508) |
0.1 | 0.5 | GO:0090051 | negative regulation of cell migration involved in sprouting angiogenesis(GO:0090051) |
0.1 | 0.2 | GO:0001806 | type IV hypersensitivity(GO:0001806) |
0.1 | 0.6 | GO:0010459 | negative regulation of heart rate(GO:0010459) |
0.1 | 0.2 | GO:0032696 | negative regulation of interleukin-13 production(GO:0032696) |
0.1 | 0.1 | GO:0036394 | amylase secretion(GO:0036394) |
0.1 | 0.5 | GO:0000289 | nuclear-transcribed mRNA poly(A) tail shortening(GO:0000289) |
0.1 | 0.7 | GO:0033617 | mitochondrial respiratory chain complex IV assembly(GO:0033617) mitochondrial respiratory chain complex IV biogenesis(GO:0097034) |
0.1 | 1.3 | GO:0042572 | retinol metabolic process(GO:0042572) |
0.1 | 0.7 | GO:0000338 | protein deneddylation(GO:0000338) cullin deneddylation(GO:0010388) |
0.1 | 0.2 | GO:1990086 | lens fiber cell apoptotic process(GO:1990086) |
0.1 | 0.2 | GO:0002921 | negative regulation of humoral immune response(GO:0002921) |
0.1 | 0.2 | GO:1901475 | pyruvate transport(GO:0006848) pyruvate transmembrane transport(GO:1901475) |
0.1 | 0.8 | GO:0071480 | cellular response to gamma radiation(GO:0071480) |
0.1 | 0.6 | GO:0006283 | transcription-coupled nucleotide-excision repair(GO:0006283) |
0.1 | 0.6 | GO:0014898 | muscle hypertrophy in response to stress(GO:0003299) cardiac muscle adaptation(GO:0014887) cardiac muscle hypertrophy in response to stress(GO:0014898) |
0.1 | 0.3 | GO:0007217 | tachykinin receptor signaling pathway(GO:0007217) |
0.1 | 1.2 | GO:0001833 | inner cell mass cell proliferation(GO:0001833) |
0.1 | 0.6 | GO:0070525 | tRNA threonylcarbamoyladenosine metabolic process(GO:0070525) |
0.1 | 0.3 | GO:0044872 | lipoprotein transport(GO:0042953) lipoprotein localization(GO:0044872) |
0.1 | 0.3 | GO:0051988 | regulation of attachment of spindle microtubules to kinetochore(GO:0051988) |
0.1 | 0.1 | GO:2000047 | regulation of cell-cell adhesion mediated by cadherin(GO:2000047) |
0.1 | 0.1 | GO:1901859 | regulation of mitochondrial DNA replication(GO:0090296) negative regulation of mitochondrial DNA metabolic process(GO:1901859) |
0.1 | 1.3 | GO:0006353 | DNA-templated transcription, termination(GO:0006353) |
0.1 | 0.3 | GO:0030330 | DNA damage response, signal transduction by p53 class mediator(GO:0030330) |
0.1 | 0.1 | GO:0009445 | putrescine metabolic process(GO:0009445) |
0.1 | 0.4 | GO:0044068 | modulation by symbiont of host cellular process(GO:0044068) |
0.1 | 0.1 | GO:0060058 | apoptotic process involved in mammary gland involution(GO:0060057) positive regulation of apoptotic process involved in mammary gland involution(GO:0060058) positive regulation of apoptotic process involved in morphogenesis(GO:1902339) regulation of mammary gland involution(GO:1903519) positive regulation of mammary gland involution(GO:1903521) positive regulation of apoptotic process involved in development(GO:1904747) |
0.1 | 1.6 | GO:0035458 | cellular response to interferon-beta(GO:0035458) |
0.1 | 0.4 | GO:0018214 | protein carboxylation(GO:0018214) |
0.1 | 0.3 | GO:0014894 | response to inactivity(GO:0014854) response to muscle inactivity(GO:0014870) response to muscle inactivity involved in regulation of muscle adaptation(GO:0014877) response to denervation involved in regulation of muscle adaptation(GO:0014894) |
0.1 | 0.5 | GO:0006384 | transcription initiation from RNA polymerase III promoter(GO:0006384) |
0.1 | 0.4 | GO:0000920 | cell separation after cytokinesis(GO:0000920) |
0.1 | 0.3 | GO:0072525 | pyridine-containing compound biosynthetic process(GO:0072525) |
0.1 | 0.3 | GO:0006116 | NADH oxidation(GO:0006116) |
0.1 | 0.8 | GO:0050901 | leukocyte tethering or rolling(GO:0050901) |
0.1 | 0.1 | GO:0042989 | sequestering of actin monomers(GO:0042989) |
0.1 | 0.4 | GO:0010801 | negative regulation of peptidyl-threonine phosphorylation(GO:0010801) |
0.1 | 0.3 | GO:0046909 | intermembrane transport(GO:0046909) |
0.1 | 1.7 | GO:0046627 | negative regulation of insulin receptor signaling pathway(GO:0046627) |
0.1 | 0.1 | GO:1904292 | regulation of ERAD pathway(GO:1904292) |
0.1 | 0.3 | GO:0019287 | isopentenyl diphosphate biosynthetic process(GO:0009240) isopentenyl diphosphate biosynthetic process, mevalonate pathway(GO:0019287) |
0.1 | 0.2 | GO:1904847 | cell chemotaxis to fibroblast growth factor(GO:0035766) endothelial cell chemotaxis to fibroblast growth factor(GO:0035768) regulation of cell chemotaxis to fibroblast growth factor(GO:1904847) regulation of endothelial cell chemotaxis to fibroblast growth factor(GO:2000544) |
0.1 | 1.5 | GO:0000460 | maturation of 5.8S rRNA(GO:0000460) |
0.1 | 0.3 | GO:0006654 | phosphatidic acid biosynthetic process(GO:0006654) phosphatidic acid metabolic process(GO:0046473) |
0.1 | 0.6 | GO:0009299 | mRNA transcription(GO:0009299) |
0.1 | 0.1 | GO:0042938 | dipeptide transport(GO:0042938) |
0.1 | 0.1 | GO:0046121 | deoxyribonucleoside catabolic process(GO:0046121) |
0.1 | 0.3 | GO:1901673 | regulation of mitotic spindle assembly(GO:1901673) |
0.1 | 0.2 | GO:0002326 | B cell lineage commitment(GO:0002326) |
0.1 | 0.4 | GO:0006398 | mRNA 3'-end processing by stem-loop binding and cleavage(GO:0006398) |
0.1 | 1.6 | GO:0006308 | DNA catabolic process(GO:0006308) |
0.1 | 1.3 | GO:0030322 | stabilization of membrane potential(GO:0030322) |
0.1 | 0.2 | GO:0036112 | medium-chain fatty-acyl-CoA metabolic process(GO:0036112) |
0.1 | 0.9 | GO:0043551 | regulation of phosphatidylinositol 3-kinase activity(GO:0043551) |
0.1 | 0.4 | GO:0042574 | retinal metabolic process(GO:0042574) |
0.1 | 0.3 | GO:0072386 | plus-end-directed vesicle transport along microtubule(GO:0072383) plus-end-directed organelle transport along microtubule(GO:0072386) |
0.1 | 1.0 | GO:0006828 | manganese ion transport(GO:0006828) |
0.1 | 1.9 | GO:0006360 | transcription from RNA polymerase I promoter(GO:0006360) |
0.1 | 0.1 | GO:0070947 | neutrophil mediated killing of fungus(GO:0070947) |
0.1 | 0.2 | GO:1904479 | negative regulation of intestinal absorption(GO:1904479) |
0.1 | 0.3 | GO:0060988 | lipid tube assembly(GO:0060988) |
0.1 | 0.2 | GO:0033030 | negative regulation of neutrophil apoptotic process(GO:0033030) |
0.1 | 0.2 | GO:1904262 | negative regulation of TORC1 signaling(GO:1904262) |
0.1 | 0.2 | GO:2001185 | regulation of CD8-positive, alpha-beta T cell activation(GO:2001185) |
0.1 | 0.1 | GO:1900077 | negative regulation of cellular response to insulin stimulus(GO:1900077) |
0.1 | 0.3 | GO:0000707 | meiotic DNA recombinase assembly(GO:0000707) |
0.1 | 0.2 | GO:1904683 | regulation of metalloendopeptidase activity(GO:1904683) |
0.1 | 0.1 | GO:0002741 | positive regulation of cytokine secretion involved in immune response(GO:0002741) |
0.1 | 0.2 | GO:0030853 | negative regulation of granulocyte differentiation(GO:0030853) |
0.1 | 0.1 | GO:0061343 | cell adhesion involved in heart morphogenesis(GO:0061343) |
0.1 | 0.2 | GO:0008295 | spermidine biosynthetic process(GO:0008295) |
0.1 | 0.1 | GO:0023021 | termination of signal transduction(GO:0023021) |
0.1 | 0.2 | GO:0002467 | germinal center formation(GO:0002467) |
0.1 | 0.2 | GO:0006772 | thiamine metabolic process(GO:0006772) thiamine-containing compound metabolic process(GO:0042723) |
0.1 | 0.2 | GO:0030578 | PML body organization(GO:0030578) |
0.1 | 0.1 | GO:0038145 | macrophage colony-stimulating factor signaling pathway(GO:0038145) |
0.1 | 0.5 | GO:1901978 | positive regulation of cell cycle checkpoint(GO:1901978) |
0.1 | 0.2 | GO:1900086 | positive regulation of peptidyl-tyrosine autophosphorylation(GO:1900086) |
0.1 | 0.2 | GO:0008298 | intracellular mRNA localization(GO:0008298) |
0.1 | 0.2 | GO:2000035 | regulation of stem cell division(GO:2000035) |
0.1 | 0.2 | GO:0042769 | DNA damage response, detection of DNA damage(GO:0042769) |
0.1 | 3.1 | GO:0006418 | tRNA aminoacylation for protein translation(GO:0006418) |
0.1 | 0.5 | GO:0006622 | protein targeting to lysosome(GO:0006622) protein localization to lysosome(GO:0061462) |
0.1 | 0.2 | GO:0002215 | defense response to nematode(GO:0002215) |
0.1 | 0.2 | GO:0036265 | RNA (guanine-N7)-methylation(GO:0036265) |
0.1 | 0.1 | GO:0031087 | nuclear-transcribed mRNA catabolic process, deadenylation-independent decay(GO:0031086) deadenylation-independent decapping of nuclear-transcribed mRNA(GO:0031087) |
0.1 | 0.1 | GO:0009130 | pyrimidine nucleoside monophosphate biosynthetic process(GO:0009130) |
0.1 | 0.5 | GO:1900745 | positive regulation of p38MAPK cascade(GO:1900745) |
0.1 | 0.4 | GO:0042447 | hormone catabolic process(GO:0042447) |
0.1 | 0.3 | GO:0051031 | tRNA transport(GO:0051031) |
0.1 | 0.3 | GO:0035456 | response to interferon-beta(GO:0035456) |
0.1 | 0.8 | GO:0010591 | regulation of lamellipodium assembly(GO:0010591) |
0.1 | 0.9 | GO:0055010 | ventricular cardiac muscle tissue morphogenesis(GO:0055010) |
0.1 | 0.4 | GO:0032815 | negative regulation of natural killer cell activation(GO:0032815) |
0.1 | 0.2 | GO:1902036 | regulation of hematopoietic stem cell differentiation(GO:1902036) |
0.1 | 0.2 | GO:0051344 | negative regulation of cyclic-nucleotide phosphodiesterase activity(GO:0051344) |
0.1 | 0.2 | GO:1902570 | protein localization to nucleolus(GO:1902570) |
0.1 | 0.1 | GO:0032439 | endosome localization(GO:0032439) |
0.1 | 0.4 | GO:0022027 | interkinetic nuclear migration(GO:0022027) |
0.1 | 0.6 | GO:0006027 | glycosaminoglycan catabolic process(GO:0006027) |
0.1 | 0.4 | GO:0051026 | chiasma assembly(GO:0051026) |
0.1 | 0.3 | GO:0043031 | negative regulation of macrophage activation(GO:0043031) |
0.1 | 0.5 | GO:0009303 | rRNA transcription(GO:0009303) |
0.1 | 0.1 | GO:1900126 | negative regulation of hyaluronan biosynthetic process(GO:1900126) |
0.1 | 0.1 | GO:0051142 | regulation of NK T cell proliferation(GO:0051140) positive regulation of NK T cell proliferation(GO:0051142) |
0.1 | 0.2 | GO:0030916 | otic vesicle formation(GO:0030916) |
0.1 | 0.5 | GO:0019800 | peptide cross-linking via chondroitin 4-sulfate glycosaminoglycan(GO:0019800) |
0.1 | 0.1 | GO:0070358 | actin polymerization-dependent cell motility(GO:0070358) |
0.1 | 0.3 | GO:0014043 | negative regulation of neuron maturation(GO:0014043) |
0.1 | 0.2 | GO:0021570 | rhombomere 4 development(GO:0021570) |
0.1 | 0.1 | GO:0031052 | programmed DNA elimination(GO:0031049) chromosome breakage(GO:0031052) |
0.1 | 0.2 | GO:0060613 | fat pad development(GO:0060613) |
0.1 | 0.1 | GO:0002572 | pro-T cell differentiation(GO:0002572) |
0.1 | 0.8 | GO:0016973 | poly(A)+ mRNA export from nucleus(GO:0016973) |
0.1 | 0.4 | GO:0035767 | endothelial cell chemotaxis(GO:0035767) |
0.1 | 0.1 | GO:1990036 | calcium ion import into sarcoplasmic reticulum(GO:1990036) |
0.1 | 0.1 | GO:0032202 | telomere assembly(GO:0032202) |
0.1 | 0.1 | GO:1901668 | regulation of superoxide dismutase activity(GO:1901668) |
0.1 | 0.1 | GO:2000468 | regulation of peroxidase activity(GO:2000468) |
0.1 | 0.5 | GO:0046461 | neutral lipid catabolic process(GO:0046461) acylglycerol catabolic process(GO:0046464) |
0.1 | 0.4 | GO:0010800 | positive regulation of peptidyl-threonine phosphorylation(GO:0010800) |
0.1 | 0.3 | GO:0010226 | response to lithium ion(GO:0010226) |
0.1 | 0.3 | GO:0002726 | positive regulation of T cell cytokine production(GO:0002726) |
0.1 | 0.4 | GO:0019934 | cGMP-mediated signaling(GO:0019934) |
0.1 | 0.2 | GO:0045448 | regulation of mitotic cell cycle, embryonic(GO:0009794) mitotic cell cycle, embryonic(GO:0045448) |
0.1 | 0.9 | GO:0055092 | cholesterol homeostasis(GO:0042632) sterol homeostasis(GO:0055092) |
0.1 | 0.9 | GO:0061099 | negative regulation of protein tyrosine kinase activity(GO:0061099) |
0.1 | 0.1 | GO:0070317 | negative regulation of G0 to G1 transition(GO:0070317) |
0.1 | 0.1 | GO:0035434 | copper ion transmembrane transport(GO:0035434) |
0.1 | 0.2 | GO:0034653 | diterpenoid catabolic process(GO:0016103) retinoic acid catabolic process(GO:0034653) |
0.1 | 0.3 | GO:0045653 | negative regulation of megakaryocyte differentiation(GO:0045653) |
0.1 | 0.4 | GO:0031167 | rRNA methylation(GO:0031167) |
0.1 | 1.2 | GO:0046329 | negative regulation of JNK cascade(GO:0046329) |
0.1 | 0.1 | GO:0046015 | regulation of transcription by glucose(GO:0046015) |
0.1 | 0.1 | GO:0002159 | desmosome assembly(GO:0002159) |
0.1 | 1.5 | GO:0043044 | ATP-dependent chromatin remodeling(GO:0043044) |
0.1 | 0.3 | GO:0009597 | detection of virus(GO:0009597) |
0.1 | 2.1 | GO:0006284 | base-excision repair(GO:0006284) |
0.1 | 0.1 | GO:0071787 | endoplasmic reticulum tubular network assembly(GO:0071787) |
0.1 | 0.3 | GO:0045649 | regulation of macrophage differentiation(GO:0045649) |
0.1 | 0.1 | GO:2001137 | positive regulation of endocytic recycling(GO:2001137) |
0.1 | 0.1 | GO:0019626 | short-chain fatty acid catabolic process(GO:0019626) |
0.1 | 0.2 | GO:0030223 | neutrophil differentiation(GO:0030223) |
0.1 | 1.1 | GO:0032008 | positive regulation of TOR signaling(GO:0032008) |
0.1 | 0.1 | GO:0045588 | positive regulation of gamma-delta T cell differentiation(GO:0045588) positive regulation of gamma-delta T cell activation(GO:0046645) |
0.1 | 0.1 | GO:0034441 | plasma lipoprotein particle oxidation(GO:0034441) |
0.1 | 0.3 | GO:0070126 | mitochondrial translational termination(GO:0070126) |
0.1 | 0.1 | GO:0021571 | rhombomere 5 development(GO:0021571) |
0.1 | 0.1 | GO:0090365 | regulation of mRNA modification(GO:0090365) |
0.1 | 0.2 | GO:0072321 | chaperone-mediated protein transport(GO:0072321) |
0.1 | 0.5 | GO:0034063 | stress granule assembly(GO:0034063) |
0.1 | 0.3 | GO:0043691 | reverse cholesterol transport(GO:0043691) |
0.1 | 0.5 | GO:2000178 | negative regulation of neural precursor cell proliferation(GO:2000178) |
0.1 | 0.3 | GO:0030575 | nuclear body organization(GO:0030575) |
0.1 | 0.3 | GO:0042436 | tryptophan catabolic process(GO:0006569) tryptophan catabolic process to kynurenine(GO:0019441) indole-containing compound catabolic process(GO:0042436) indolalkylamine catabolic process(GO:0046218) |
0.1 | 0.3 | GO:0018317 | protein C-linked glycosylation(GO:0018103) peptidyl-tryptophan modification(GO:0018211) protein C-linked glycosylation via tryptophan(GO:0018317) protein C-linked glycosylation via 2'-alpha-mannosyl-L-tryptophan(GO:0018406) |
0.1 | 0.2 | GO:0045048 | protein insertion into ER membrane(GO:0045048) tail-anchored membrane protein insertion into ER membrane(GO:0071816) |
0.1 | 0.1 | GO:1902402 | signal transduction involved in mitotic cell cycle checkpoint(GO:0072413) signal transduction involved in mitotic DNA damage checkpoint(GO:1902402) signal transduction involved in mitotic DNA integrity checkpoint(GO:1902403) |
0.1 | 0.3 | GO:0042635 | positive regulation of hair cycle(GO:0042635) |
0.1 | 0.1 | GO:0070303 | negative regulation of stress-activated MAPK cascade(GO:0032873) negative regulation of stress-activated protein kinase signaling cascade(GO:0070303) |
0.1 | 0.1 | GO:0090086 | negative regulation of protein deubiquitination(GO:0090086) |
0.1 | 0.7 | GO:0036158 | outer dynein arm assembly(GO:0036158) |
0.1 | 0.1 | GO:2000416 | regulation of eosinophil migration(GO:2000416) |
0.1 | 0.1 | GO:0035989 | tendon development(GO:0035989) |
0.1 | 0.1 | GO:0070813 | hydrogen sulfide metabolic process(GO:0070813) |
0.1 | 0.4 | GO:0042659 | regulation of cell fate specification(GO:0042659) |
0.1 | 0.3 | GO:1900016 | negative regulation of cytokine production involved in inflammatory response(GO:1900016) |
0.1 | 0.5 | GO:0044783 | G1 DNA damage checkpoint(GO:0044783) |
0.1 | 0.1 | GO:1904252 | negative regulation of bile acid biosynthetic process(GO:0070858) negative regulation of bile acid metabolic process(GO:1904252) |
0.1 | 0.1 | GO:2001044 | regulation of integrin-mediated signaling pathway(GO:2001044) |
0.1 | 0.1 | GO:0071895 | odontoblast differentiation(GO:0071895) |
0.1 | 0.3 | GO:0008594 | photoreceptor cell morphogenesis(GO:0008594) |
0.1 | 0.7 | GO:0043984 | histone H4-K16 acetylation(GO:0043984) |
0.1 | 0.2 | GO:0019627 | arginine biosynthetic process(GO:0006526) urea metabolic process(GO:0019627) |
0.1 | 0.1 | GO:1901873 | regulation of post-translational protein modification(GO:1901873) negative regulation of post-translational protein modification(GO:1901874) |
0.1 | 0.5 | GO:0030947 | regulation of vascular endothelial growth factor receptor signaling pathway(GO:0030947) |
0.1 | 0.4 | GO:0031145 | anaphase-promoting complex-dependent catabolic process(GO:0031145) |
0.1 | 0.4 | GO:0000042 | protein targeting to Golgi(GO:0000042) |
0.1 | 0.1 | GO:0033127 | regulation of histone phosphorylation(GO:0033127) |
0.1 | 1.7 | GO:0006956 | complement activation(GO:0006956) |
0.1 | 0.1 | GO:0060300 | regulation of cytokine activity(GO:0060300) |
0.1 | 0.2 | GO:0033615 | mitochondrial proton-transporting ATP synthase complex assembly(GO:0033615) |
0.1 | 0.1 | GO:0043400 | cortisol secretion(GO:0043400) regulation of cortisol secretion(GO:0051462) |
0.1 | 0.1 | GO:0008078 | mesodermal cell migration(GO:0008078) |
0.1 | 0.2 | GO:0035855 | megakaryocyte development(GO:0035855) |
0.1 | 1.4 | GO:0018345 | protein palmitoylation(GO:0018345) |
0.1 | 0.1 | GO:0046084 | adenine metabolic process(GO:0046083) adenine biosynthetic process(GO:0046084) |
0.1 | 0.1 | GO:0045075 | interleukin-12 biosynthetic process(GO:0042090) regulation of interleukin-12 biosynthetic process(GO:0045075) |
0.1 | 0.3 | GO:0035518 | histone H2A monoubiquitination(GO:0035518) |
0.1 | 0.1 | GO:0010668 | ectodermal cell differentiation(GO:0010668) |
0.1 | 0.2 | GO:0061087 | positive regulation of histone H3-K27 methylation(GO:0061087) |
0.1 | 0.3 | GO:0051450 | myoblast proliferation(GO:0051450) |
0.1 | 0.5 | GO:0032060 | bleb assembly(GO:0032060) |
0.1 | 0.1 | GO:0010523 | negative regulation of calcium ion transport into cytosol(GO:0010523) |
0.1 | 0.1 | GO:0033133 | positive regulation of glucokinase activity(GO:0033133) |
0.1 | 0.1 | GO:0045297 | mating plug formation(GO:0042628) single-organism reproductive behavior(GO:0044704) post-mating behavior(GO:0045297) |
0.1 | 0.1 | GO:0086011 | membrane repolarization during action potential(GO:0086011) |
0.1 | 0.3 | GO:0010032 | meiotic chromosome condensation(GO:0010032) |
0.1 | 0.1 | GO:0031284 | positive regulation of guanylate cyclase activity(GO:0031284) |
0.1 | 0.1 | GO:0071295 | cellular response to vitamin(GO:0071295) |
0.1 | 0.1 | GO:0072429 | response to intra-S DNA damage checkpoint signaling(GO:0072429) |
0.1 | 0.1 | GO:0043928 | exonucleolytic nuclear-transcribed mRNA catabolic process involved in deadenylation-dependent decay(GO:0043928) |
0.1 | 0.2 | GO:0043137 | DNA replication, removal of RNA primer(GO:0043137) |
0.1 | 0.1 | GO:0001951 | intestinal D-glucose absorption(GO:0001951) |
0.1 | 0.1 | GO:0050904 | diapedesis(GO:0050904) |
0.1 | 0.4 | GO:0003197 | endocardial cushion development(GO:0003197) |
0.1 | 0.4 | GO:0030859 | polarized epithelial cell differentiation(GO:0030859) |
0.1 | 0.2 | GO:0045792 | negative regulation of cell size(GO:0045792) |
0.1 | 0.5 | GO:0036342 | post-anal tail morphogenesis(GO:0036342) |
0.1 | 0.1 | GO:0051891 | positive regulation of cardioblast differentiation(GO:0051891) |
0.1 | 0.1 | GO:0048207 | vesicle targeting, rough ER to cis-Golgi(GO:0048207) COPII vesicle coating(GO:0048208) |
0.1 | 0.1 | GO:2000823 | regulation of androgen receptor activity(GO:2000823) |
0.1 | 0.1 | GO:0033686 | positive regulation of luteinizing hormone secretion(GO:0033686) |
0.1 | 0.3 | GO:0006620 | posttranslational protein targeting to membrane(GO:0006620) |
0.1 | 0.1 | GO:0006901 | vesicle coating(GO:0006901) |
0.1 | 0.3 | GO:0006750 | glutathione biosynthetic process(GO:0006750) |
0.1 | 0.5 | GO:0051974 | negative regulation of telomerase activity(GO:0051974) |
0.1 | 0.1 | GO:0035701 | hematopoietic stem cell migration(GO:0035701) |
0.1 | 0.6 | GO:0008272 | sulfate transport(GO:0008272) |
0.1 | 0.3 | GO:0046040 | IMP metabolic process(GO:0046040) |
0.1 | 0.2 | GO:0046415 | urate metabolic process(GO:0046415) |
0.1 | 0.3 | GO:0051044 | positive regulation of membrane protein ectodomain proteolysis(GO:0051044) |
0.1 | 0.1 | GO:0035872 | nucleotide-binding domain, leucine rich repeat containing receptor signaling pathway(GO:0035872) nucleotide-binding oligomerization domain containing signaling pathway(GO:0070423) nucleotide-binding oligomerization domain containing 2 signaling pathway(GO:0070431) |
0.1 | 0.6 | GO:0021889 | olfactory bulb interneuron differentiation(GO:0021889) |
0.1 | 0.1 | GO:0006449 | regulation of translational termination(GO:0006449) |
0.1 | 0.1 | GO:1900037 | regulation of cellular response to hypoxia(GO:1900037) |
0.1 | 0.2 | GO:0071651 | positive regulation of chemokine (C-C motif) ligand 5 production(GO:0071651) |
0.1 | 0.2 | GO:0060903 | positive regulation of meiosis I(GO:0060903) |
0.1 | 0.3 | GO:0001960 | negative regulation of cytokine-mediated signaling pathway(GO:0001960) |
0.1 | 0.6 | GO:0010569 | regulation of double-strand break repair via homologous recombination(GO:0010569) |
0.1 | 0.2 | GO:0060391 | positive regulation of SMAD protein import into nucleus(GO:0060391) |
0.1 | 0.2 | GO:2000628 | regulation of miRNA metabolic process(GO:2000628) |
0.1 | 0.1 | GO:0032464 | positive regulation of protein homooligomerization(GO:0032464) |
0.1 | 0.2 | GO:0033234 | negative regulation of protein sumoylation(GO:0033234) |
0.1 | 0.1 | GO:0036123 | histone H3-K9 dimethylation(GO:0036123) |
0.1 | 0.1 | GO:0098903 | regulation of membrane repolarization during action potential(GO:0098903) |
0.1 | 0.2 | GO:0048739 | cardiac muscle fiber development(GO:0048739) |
0.1 | 0.4 | GO:0007263 | nitric oxide mediated signal transduction(GO:0007263) |
0.1 | 0.6 | GO:0042771 | intrinsic apoptotic signaling pathway in response to DNA damage by p53 class mediator(GO:0042771) |
0.1 | 0.2 | GO:0071569 | protein ufmylation(GO:0071569) |
0.1 | 0.9 | GO:0008053 | mitochondrial fusion(GO:0008053) |
0.1 | 0.1 | GO:0032497 | detection of lipopolysaccharide(GO:0032497) |
0.1 | 0.1 | GO:0046125 | pyrimidine deoxyribonucleoside metabolic process(GO:0046125) |
0.1 | 0.2 | GO:0034145 | positive regulation of toll-like receptor 4 signaling pathway(GO:0034145) |
0.1 | 0.2 | GO:1902231 | positive regulation of intrinsic apoptotic signaling pathway in response to DNA damage(GO:1902231) |
0.1 | 0.2 | GO:0034501 | protein localization to kinetochore(GO:0034501) |
0.1 | 0.1 | GO:1902714 | negative regulation of interferon-gamma secretion(GO:1902714) |
0.1 | 0.1 | GO:0045541 | negative regulation of cholesterol biosynthetic process(GO:0045541) negative regulation of cholesterol metabolic process(GO:0090206) |
0.1 | 0.1 | GO:0045743 | positive regulation of fibroblast growth factor receptor signaling pathway(GO:0045743) |
0.1 | 0.2 | GO:0040033 | negative regulation of translation, ncRNA-mediated(GO:0040033) regulation of translation, ncRNA-mediated(GO:0045974) |
0.1 | 0.1 | GO:0070200 | establishment of protein localization to telomere(GO:0070200) |
0.1 | 1.4 | GO:0000184 | nuclear-transcribed mRNA catabolic process, nonsense-mediated decay(GO:0000184) |
0.1 | 0.5 | GO:0007614 | short-term memory(GO:0007614) |
0.1 | 0.1 | GO:0035948 | positive regulation of gluconeogenesis by positive regulation of transcription from RNA polymerase II promoter(GO:0035948) |
0.1 | 0.1 | GO:1902608 | regulation of large conductance calcium-activated potassium channel activity(GO:1902606) positive regulation of large conductance calcium-activated potassium channel activity(GO:1902608) |
0.1 | 0.5 | GO:2001241 | positive regulation of extrinsic apoptotic signaling pathway in absence of ligand(GO:2001241) |
0.1 | 0.1 | GO:0070828 | heterochromatin organization(GO:0070828) |
0.1 | 0.1 | GO:0070836 | caveola assembly(GO:0070836) |
0.1 | 0.3 | GO:1903012 | positive regulation of bone development(GO:1903012) |
0.1 | 0.9 | GO:1902017 | regulation of cilium assembly(GO:1902017) |
0.1 | 0.2 | GO:0015014 | heparan sulfate proteoglycan biosynthetic process, polysaccharide chain biosynthetic process(GO:0015014) |
0.1 | 0.2 | GO:1901164 | negative regulation of trophoblast cell migration(GO:1901164) |
0.1 | 0.1 | GO:0019388 | galactose catabolic process(GO:0019388) |
0.1 | 0.1 | GO:0048711 | positive regulation of astrocyte differentiation(GO:0048711) |
0.1 | 0.1 | GO:0032792 | negative regulation of CREB transcription factor activity(GO:0032792) |
0.1 | 0.2 | GO:0035457 | cellular response to interferon-alpha(GO:0035457) |
0.1 | 0.7 | GO:0016180 | snRNA processing(GO:0016180) |
0.1 | 0.2 | GO:0030579 | ubiquitin-dependent SMAD protein catabolic process(GO:0030579) |
0.1 | 0.4 | GO:1904031 | positive regulation of cyclin-dependent protein serine/threonine kinase activity(GO:0045737) positive regulation of cyclin-dependent protein kinase activity(GO:1904031) |
0.1 | 0.1 | GO:2001268 | negative regulation of cysteine-type endopeptidase activity involved in apoptotic signaling pathway(GO:2001268) |
0.1 | 0.4 | GO:0034498 | early endosome to Golgi transport(GO:0034498) |
0.1 | 0.5 | GO:1902808 | positive regulation of cell cycle G1/S phase transition(GO:1902808) |
0.1 | 0.7 | GO:0006383 | transcription from RNA polymerase III promoter(GO:0006383) |
0.1 | 0.3 | GO:0035751 | regulation of lysosomal lumen pH(GO:0035751) |
0.1 | 0.4 | GO:0032007 | negative regulation of TOR signaling(GO:0032007) |
0.1 | 0.1 | GO:0097155 | fasciculation of sensory neuron axon(GO:0097155) |
0.1 | 0.2 | GO:0070940 | dephosphorylation of RNA polymerase II C-terminal domain(GO:0070940) |
0.1 | 0.2 | GO:0060525 | prostate glandular acinus development(GO:0060525) |
0.1 | 0.3 | GO:0060330 | regulation of response to interferon-gamma(GO:0060330) |
0.1 | 0.3 | GO:0035313 | wound healing, spreading of epidermal cells(GO:0035313) |
0.1 | 0.2 | GO:1901722 | regulation of cell proliferation involved in kidney development(GO:1901722) |
0.1 | 0.1 | GO:0030908 | intein-mediated protein splicing(GO:0016539) protein splicing(GO:0030908) |
0.1 | 0.2 | GO:0090179 | planar cell polarity pathway involved in neural tube closure(GO:0090179) |
0.1 | 0.2 | GO:0017198 | N-terminal peptidyl-serine acetylation(GO:0017198) N-terminal peptidyl-glutamic acid acetylation(GO:0018002) peptidyl-serine acetylation(GO:0030920) |
0.1 | 0.1 | GO:0016114 | terpenoid biosynthetic process(GO:0016114) |
0.1 | 0.5 | GO:0070098 | chemokine-mediated signaling pathway(GO:0070098) |
0.1 | 0.3 | GO:0032836 | glomerular basement membrane development(GO:0032836) |
0.1 | 0.4 | GO:0035066 | positive regulation of histone acetylation(GO:0035066) |
0.1 | 0.1 | GO:0070640 | vitamin D3 metabolic process(GO:0070640) |
0.1 | 0.1 | GO:0006577 | amino-acid betaine metabolic process(GO:0006577) |
0.1 | 0.3 | GO:0000469 | cleavage involved in rRNA processing(GO:0000469) |
0.0 | 0.8 | GO:0035058 | nonmotile primary cilium assembly(GO:0035058) |
0.0 | 0.0 | GO:0009264 | deoxyribonucleotide catabolic process(GO:0009264) |
0.0 | 0.0 | GO:0036481 | intrinsic apoptotic signaling pathway in response to hydrogen peroxide(GO:0036481) |
0.0 | 0.6 | GO:0017144 | drug metabolic process(GO:0017144) |
0.0 | 0.1 | GO:0044805 | lysosomal microautophagy(GO:0016237) piecemeal microautophagy of nucleus(GO:0034727) late nucleophagy(GO:0044805) |
0.0 | 0.1 | GO:0038028 | insulin receptor signaling pathway via phosphatidylinositol 3-kinase(GO:0038028) |
0.0 | 0.0 | GO:0048861 | leukemia inhibitory factor signaling pathway(GO:0048861) |
0.0 | 0.1 | GO:0071218 | cellular response to misfolded protein(GO:0071218) |
0.0 | 0.5 | GO:0070816 | phosphorylation of RNA polymerase II C-terminal domain(GO:0070816) |
0.0 | 1.8 | GO:0071391 | cellular response to estrogen stimulus(GO:0071391) |
0.0 | 0.0 | GO:0019184 | nonribosomal peptide biosynthetic process(GO:0019184) |
0.0 | 0.5 | GO:0045116 | protein neddylation(GO:0045116) |
0.0 | 0.2 | GO:2000060 | positive regulation of protein ubiquitination involved in ubiquitin-dependent protein catabolic process(GO:2000060) |
0.0 | 1.3 | GO:0006414 | translational elongation(GO:0006414) |
0.0 | 0.1 | GO:0043247 | protection from non-homologous end joining at telomere(GO:0031848) telomere maintenance in response to DNA damage(GO:0043247) |
0.0 | 0.0 | GO:0002386 | immune response in mucosal-associated lymphoid tissue(GO:0002386) |
0.0 | 0.2 | GO:0000731 | DNA synthesis involved in DNA repair(GO:0000731) |
0.0 | 0.2 | GO:0032096 | negative regulation of response to food(GO:0032096) |
0.0 | 0.2 | GO:1902857 | positive regulation of nonmotile primary cilium assembly(GO:1902857) |
0.0 | 0.3 | GO:0032469 | endoplasmic reticulum calcium ion homeostasis(GO:0032469) |
0.0 | 1.6 | GO:0042273 | ribosomal large subunit biogenesis(GO:0042273) |
0.0 | 0.2 | GO:0052312 | modulation by host of viral transcription(GO:0043921) positive regulation by host of viral transcription(GO:0043923) modulation of transcription in other organism involved in symbiotic interaction(GO:0052312) modulation by host of symbiont transcription(GO:0052472) |
0.0 | 0.3 | GO:0017121 | phospholipid scrambling(GO:0017121) |
0.0 | 0.7 | GO:0019835 | cytolysis(GO:0019835) |
0.0 | 0.1 | GO:0042138 | meiotic DNA double-strand break formation(GO:0042138) |
0.0 | 0.1 | GO:0035455 | response to interferon-alpha(GO:0035455) |
0.0 | 0.4 | GO:0042744 | hydrogen peroxide catabolic process(GO:0042744) |
0.0 | 0.1 | GO:0018101 | protein citrullination(GO:0018101) |
0.0 | 0.1 | GO:0042541 | hemoglobin biosynthetic process(GO:0042541) |
0.0 | 0.0 | GO:1902415 | regulation of mRNA binding(GO:1902415) regulation of RNA binding(GO:1905214) |
0.0 | 0.2 | GO:0030828 | positive regulation of cGMP biosynthetic process(GO:0030828) |
0.0 | 0.0 | GO:0042148 | strand invasion(GO:0042148) |
0.0 | 0.2 | GO:0006388 | tRNA splicing, via endonucleolytic cleavage and ligation(GO:0006388) |
0.0 | 0.1 | GO:0097368 | establishment of Sertoli cell barrier(GO:0097368) |
0.0 | 1.7 | GO:0006338 | chromatin remodeling(GO:0006338) |
0.0 | 0.0 | GO:0043415 | positive regulation of skeletal muscle tissue regeneration(GO:0043415) |
0.0 | 0.3 | GO:0035988 | chondrocyte proliferation(GO:0035988) |
0.0 | 0.1 | GO:0070849 | response to epidermal growth factor(GO:0070849) |
0.0 | 0.1 | GO:1904526 | regulation of microtubule binding(GO:1904526) positive regulation of microtubule binding(GO:1904528) |
0.0 | 0.3 | GO:0051131 | chaperone-mediated protein complex assembly(GO:0051131) |
0.0 | 0.1 | GO:0061045 | negative regulation of wound healing(GO:0061045) |
0.0 | 0.2 | GO:0043330 | response to exogenous dsRNA(GO:0043330) |
0.0 | 0.0 | GO:0045627 | positive regulation of T-helper 1 cell differentiation(GO:0045627) |
0.0 | 0.0 | GO:0034146 | toll-like receptor 5 signaling pathway(GO:0034146) |
0.0 | 0.1 | GO:0045759 | negative regulation of action potential(GO:0045759) |
0.0 | 0.1 | GO:0032788 | saturated monocarboxylic acid metabolic process(GO:0032788) unsaturated monocarboxylic acid metabolic process(GO:0032789) |
0.0 | 0.1 | GO:0002525 | acute inflammatory response to non-antigenic stimulus(GO:0002525) |
0.0 | 0.4 | GO:0000305 | response to oxygen radical(GO:0000305) |
0.0 | 0.2 | GO:1903318 | negative regulation of protein processing(GO:0010955) negative regulation of protein maturation(GO:1903318) |
0.0 | 0.0 | GO:0032100 | positive regulation of response to food(GO:0032097) positive regulation of appetite(GO:0032100) |
0.0 | 0.2 | GO:0016264 | gap junction assembly(GO:0016264) |
0.0 | 0.0 | GO:0061622 | glycolytic process through glucose-1-phosphate(GO:0061622) |
0.0 | 0.0 | GO:0006391 | transcription initiation from mitochondrial promoter(GO:0006391) |
0.0 | 0.1 | GO:0035864 | response to potassium ion(GO:0035864) cellular response to potassium ion(GO:0035865) |
0.0 | 0.6 | GO:0015893 | drug transport(GO:0015893) |
0.0 | 0.1 | GO:0006564 | L-serine biosynthetic process(GO:0006564) |
0.0 | 0.1 | GO:2000354 | regulation of ovarian follicle development(GO:2000354) |
0.0 | 0.4 | GO:0006120 | mitochondrial electron transport, NADH to ubiquinone(GO:0006120) |
0.0 | 0.3 | GO:0015721 | bile acid and bile salt transport(GO:0015721) |
0.0 | 0.5 | GO:0010718 | positive regulation of epithelial to mesenchymal transition(GO:0010718) |
0.0 | 0.1 | GO:0006271 | DNA strand elongation involved in DNA replication(GO:0006271) |
0.0 | 0.4 | GO:0006228 | GTP biosynthetic process(GO:0006183) UTP biosynthetic process(GO:0006228) |
0.0 | 0.4 | GO:0070208 | protein heterotrimerization(GO:0070208) |
0.0 | 0.0 | GO:0051354 | negative regulation of oxidoreductase activity(GO:0051354) |
0.0 | 0.0 | GO:0021785 | branchiomotor neuron axon guidance(GO:0021785) |
0.0 | 0.1 | GO:0000722 | telomere maintenance via recombination(GO:0000722) |
0.0 | 0.1 | GO:0010155 | regulation of proton transport(GO:0010155) |
0.0 | 0.5 | GO:0045292 | mRNA cis splicing, via spliceosome(GO:0045292) |
0.0 | 0.1 | GO:0070129 | regulation of mitochondrial translation(GO:0070129) |
0.0 | 0.2 | GO:0015697 | quaternary ammonium group transport(GO:0015697) |
0.0 | 0.1 | GO:0032494 | response to peptidoglycan(GO:0032494) |
0.0 | 0.0 | GO:0071397 | cellular response to cholesterol(GO:0071397) |
0.0 | 0.1 | GO:0007035 | vacuolar acidification(GO:0007035) |
0.0 | 0.0 | GO:2000780 | negative regulation of DNA repair(GO:0045738) negative regulation of double-strand break repair(GO:2000780) |
0.0 | 0.0 | GO:0032986 | nucleosome disassembly(GO:0006337) protein-DNA complex disassembly(GO:0032986) |
0.0 | 0.1 | GO:0070230 | positive regulation of lymphocyte apoptotic process(GO:0070230) |
0.0 | 0.1 | GO:0035360 | positive regulation of peroxisome proliferator activated receptor signaling pathway(GO:0035360) |
0.0 | 0.1 | GO:2000286 | receptor internalization involved in canonical Wnt signaling pathway(GO:2000286) |
0.0 | 0.1 | GO:0036010 | protein localization to endosome(GO:0036010) |
0.0 | 0.0 | GO:0009750 | response to fructose(GO:0009750) |
0.0 | 0.5 | GO:0030150 | protein import into mitochondrial matrix(GO:0030150) |
0.0 | 0.2 | GO:0006336 | DNA replication-independent nucleosome assembly(GO:0006336) DNA replication-independent nucleosome organization(GO:0034724) |
0.0 | 1.2 | GO:0007339 | binding of sperm to zona pellucida(GO:0007339) |
0.0 | 0.0 | GO:0045578 | negative regulation of B cell differentiation(GO:0045578) |
0.0 | 0.3 | GO:0042448 | progesterone metabolic process(GO:0042448) |
0.0 | 0.1 | GO:0030049 | muscle filament sliding(GO:0030049) |
0.0 | 0.3 | GO:0032098 | regulation of appetite(GO:0032098) |
0.0 | 0.4 | GO:0071353 | cellular response to interleukin-4(GO:0071353) |
0.0 | 0.1 | GO:0018094 | protein polyglycylation(GO:0018094) |
0.0 | 0.3 | GO:0090162 | establishment of epithelial cell polarity(GO:0090162) |
0.0 | 0.2 | GO:0032897 | negative regulation of viral transcription(GO:0032897) |
0.0 | 0.3 | GO:0031958 | corticosteroid receptor signaling pathway(GO:0031958) |
0.0 | 1.7 | GO:2001020 | regulation of response to DNA damage stimulus(GO:2001020) |
0.0 | 0.0 | GO:0060729 | intestinal epithelial structure maintenance(GO:0060729) |
0.0 | 0.8 | GO:0031122 | cytoplasmic microtubule organization(GO:0031122) |
0.0 | 1.2 | GO:0030500 | regulation of bone mineralization(GO:0030500) |
0.0 | 0.0 | GO:0036015 | response to interleukin-3(GO:0036015) cellular response to interleukin-3(GO:0036016) |
0.0 | 0.5 | GO:0007190 | activation of adenylate cyclase activity(GO:0007190) |
0.0 | 0.2 | GO:0051024 | positive regulation of immunoglobulin secretion(GO:0051024) |
0.0 | 0.1 | GO:0002455 | humoral immune response mediated by circulating immunoglobulin(GO:0002455) |
0.0 | 0.2 | GO:0051382 | kinetochore assembly(GO:0051382) kinetochore organization(GO:0051383) |
0.0 | 0.1 | GO:1902683 | regulation of receptor localization to synapse(GO:1902683) |
0.0 | 0.1 | GO:0033211 | adiponectin-activated signaling pathway(GO:0033211) |
0.0 | 0.4 | GO:0001522 | pseudouridine synthesis(GO:0001522) |
0.0 | 0.1 | GO:0070986 | left/right axis specification(GO:0070986) |
0.0 | 0.3 | GO:2001239 | regulation of extrinsic apoptotic signaling pathway in absence of ligand(GO:2001239) |
0.0 | 0.0 | GO:0032058 | positive regulation of translational initiation in response to stress(GO:0032058) |
0.0 | 0.1 | GO:0052803 | histamine metabolic process(GO:0001692) imidazole-containing compound metabolic process(GO:0052803) |
0.0 | 0.8 | GO:0006334 | nucleosome assembly(GO:0006334) |
0.0 | 1.2 | GO:0006888 | ER to Golgi vesicle-mediated transport(GO:0006888) |
0.0 | 0.2 | GO:0043328 | late endosome to vacuole transport via multivesicular body sorting pathway(GO:0032511) protein targeting to vacuole involved in ubiquitin-dependent protein catabolic process via the multivesicular body sorting pathway(GO:0043328) |
0.0 | 0.0 | GO:0060546 | negative regulation of necroptotic process(GO:0060546) |
0.0 | 0.0 | GO:0050968 | detection of chemical stimulus involved in sensory perception of pain(GO:0050968) |
0.0 | 0.7 | GO:0070527 | platelet aggregation(GO:0070527) |
0.0 | 0.2 | GO:0071557 | histone H3-K27 demethylation(GO:0071557) |
0.0 | 0.6 | GO:0000266 | mitochondrial fission(GO:0000266) |
0.0 | 0.0 | GO:0035521 | monoubiquitinated histone deubiquitination(GO:0035521) monoubiquitinated histone H2A deubiquitination(GO:0035522) |
0.0 | 0.7 | GO:0016925 | protein sumoylation(GO:0016925) |
0.0 | 0.8 | GO:0071346 | cellular response to interferon-gamma(GO:0071346) |
0.0 | 0.0 | GO:0051444 | negative regulation of ubiquitin-protein transferase activity(GO:0051444) |
0.0 | 0.1 | GO:0033762 | response to glucagon(GO:0033762) |
0.0 | 0.4 | GO:0006144 | purine nucleobase metabolic process(GO:0006144) |
0.0 | 0.1 | GO:0046341 | CDP-diacylglycerol metabolic process(GO:0046341) |
0.0 | 0.2 | GO:0018202 | peptidyl-diphthamide metabolic process(GO:0017182) peptidyl-diphthamide biosynthetic process from peptidyl-histidine(GO:0017183) peptidyl-histidine modification(GO:0018202) |
0.0 | 0.1 | GO:0006704 | glucocorticoid biosynthetic process(GO:0006704) |
0.0 | 0.2 | GO:1901387 | positive regulation of voltage-gated calcium channel activity(GO:1901387) |
0.0 | 0.4 | GO:0009251 | glycogen catabolic process(GO:0005980) glucan catabolic process(GO:0009251) cellular polysaccharide catabolic process(GO:0044247) |
0.0 | 0.0 | GO:0016553 | base conversion or substitution editing(GO:0016553) |
0.0 | 0.2 | GO:0033327 | Leydig cell differentiation(GO:0033327) |
0.0 | 0.2 | GO:0048733 | sebaceous gland development(GO:0048733) |
0.0 | 0.0 | GO:2000272 | negative regulation of receptor activity(GO:2000272) |
0.0 | 0.1 | GO:1901374 | acetylcholine transport(GO:0015870) acetate ester transport(GO:1901374) |
0.0 | 0.1 | GO:0006499 | N-terminal protein lipidation(GO:0006498) N-terminal protein myristoylation(GO:0006499) |
0.0 | 0.0 | GO:2000049 | positive regulation of cell-cell adhesion mediated by cadherin(GO:2000049) |
0.0 | 0.2 | GO:0043457 | regulation of cellular respiration(GO:0043457) |
0.0 | 0.1 | GO:0042770 | signal transduction in response to DNA damage(GO:0042770) |
0.0 | 0.0 | GO:2000402 | negative regulation of lymphocyte migration(GO:2000402) |
0.0 | 0.1 | GO:0045839 | negative regulation of mitotic nuclear division(GO:0045839) |
0.0 | 0.4 | GO:0044804 | nucleophagy(GO:0044804) |
0.0 | 0.0 | GO:0001812 | positive regulation of type I hypersensitivity(GO:0001812) |
0.0 | 0.1 | GO:0090037 | positive regulation of protein kinase C signaling(GO:0090037) |
0.0 | 0.0 | GO:0002826 | negative regulation of T-helper 1 type immune response(GO:0002826) |
0.0 | 0.0 | GO:0010499 | proteasomal ubiquitin-independent protein catabolic process(GO:0010499) |
0.0 | 0.1 | GO:0072675 | multinuclear osteoclast differentiation(GO:0072674) osteoclast fusion(GO:0072675) |
0.0 | 0.0 | GO:0000291 | nuclear-transcribed mRNA catabolic process, exonucleolytic(GO:0000291) |
0.0 | 0.1 | GO:0002369 | T cell cytokine production(GO:0002369) |
0.0 | 0.0 | GO:0051683 | establishment of Golgi localization(GO:0051683) |
0.0 | 0.0 | GO:0014028 | notochord formation(GO:0014028) |
0.0 | 0.1 | GO:0042732 | D-xylose metabolic process(GO:0042732) |
0.0 | 0.2 | GO:0006691 | leukotriene metabolic process(GO:0006691) |
0.0 | 0.1 | GO:0007168 | receptor guanylyl cyclase signaling pathway(GO:0007168) |
0.0 | 0.1 | GO:1903232 | melanosome assembly(GO:1903232) |
0.0 | 0.8 | GO:0031424 | keratinization(GO:0031424) |
0.0 | 1.0 | GO:0032543 | mitochondrial translation(GO:0032543) |
0.0 | 0.3 | GO:0043489 | RNA stabilization(GO:0043489) |
0.0 | 0.2 | GO:0051569 | regulation of histone H3-K4 methylation(GO:0051569) |
0.0 | 0.1 | GO:0015781 | nucleotide-sugar transport(GO:0015780) pyrimidine nucleotide-sugar transport(GO:0015781) |
0.0 | 0.1 | GO:0046951 | ketone body biosynthetic process(GO:0046951) |
0.0 | 0.1 | GO:0061146 | Peyer's patch morphogenesis(GO:0061146) |
0.0 | 0.2 | GO:0075525 | viral translational termination-reinitiation(GO:0075525) |
0.0 | 0.0 | GO:0036462 | TRAIL-activated apoptotic signaling pathway(GO:0036462) |
0.0 | 0.1 | GO:0008065 | establishment of blood-nerve barrier(GO:0008065) |
0.0 | 0.1 | GO:0043116 | negative regulation of vascular permeability(GO:0043116) |
0.0 | 0.1 | GO:0070862 | negative regulation of protein exit from endoplasmic reticulum(GO:0070862) regulation of retrograde protein transport, ER to cytosol(GO:1904152) negative regulation of retrograde protein transport, ER to cytosol(GO:1904153) |
0.0 | 0.1 | GO:0016188 | synaptic vesicle maturation(GO:0016188) |
0.0 | 0.1 | GO:0006563 | L-serine metabolic process(GO:0006563) |
0.0 | 0.1 | GO:2001184 | positive regulation of interleukin-12 secretion(GO:2001184) |
0.0 | 0.0 | GO:0015884 | folic acid transport(GO:0015884) |
0.0 | 0.1 | GO:0043162 | ubiquitin-dependent protein catabolic process via the multivesicular body sorting pathway(GO:0043162) |
0.0 | 1.9 | GO:0016125 | sterol metabolic process(GO:0016125) |
0.0 | 0.2 | GO:0007141 | male meiosis I(GO:0007141) |
0.0 | 0.2 | GO:0010719 | negative regulation of epithelial to mesenchymal transition(GO:0010719) |
0.0 | 0.0 | GO:0033578 | protein glycosylation in Golgi(GO:0033578) |
0.0 | 0.6 | GO:0007274 | neuromuscular synaptic transmission(GO:0007274) |
0.0 | 0.3 | GO:0006474 | N-terminal protein amino acid acetylation(GO:0006474) |
0.0 | 0.1 | GO:0033273 | response to vitamin(GO:0033273) |
0.0 | 0.0 | GO:0050861 | positive regulation of B cell receptor signaling pathway(GO:0050861) |
0.0 | 0.0 | GO:0070995 | NADPH oxidation(GO:0070995) |
0.0 | 0.1 | GO:0006987 | activation of signaling protein activity involved in unfolded protein response(GO:0006987) |
0.0 | 0.0 | GO:0097501 | stress response to metal ion(GO:0097501) |
0.0 | 0.1 | GO:0002374 | cytokine secretion involved in immune response(GO:0002374) |
0.0 | 0.2 | GO:0006968 | cellular defense response(GO:0006968) |
0.0 | 0.1 | GO:1990168 | protein K29-linked deubiquitination(GO:0035523) protein K33-linked deubiquitination(GO:1990168) |
0.0 | 0.0 | GO:0061635 | regulation of protein complex stability(GO:0061635) |
0.0 | 0.1 | GO:0007184 | SMAD protein import into nucleus(GO:0007184) |
0.0 | 0.1 | GO:0048304 | positive regulation of isotype switching to IgG isotypes(GO:0048304) |
0.0 | 0.1 | GO:0051534 | negative regulation of NFAT protein import into nucleus(GO:0051534) |
0.0 | 0.1 | GO:0051151 | negative regulation of smooth muscle cell differentiation(GO:0051151) |
0.0 | 0.2 | GO:1990126 | retrograde transport, endosome to plasma membrane(GO:1990126) |
0.0 | 0.1 | GO:0034405 | response to fluid shear stress(GO:0034405) cellular response to fluid shear stress(GO:0071498) |
0.0 | 0.1 | GO:0008090 | retrograde axonal transport(GO:0008090) |
0.0 | 0.1 | GO:0046060 | dATP metabolic process(GO:0046060) |
0.0 | 0.5 | GO:0006406 | mRNA export from nucleus(GO:0006406) mRNA-containing ribonucleoprotein complex export from nucleus(GO:0071427) |
0.0 | 0.1 | GO:0045648 | positive regulation of erythrocyte differentiation(GO:0045648) |
0.0 | 0.4 | GO:0048524 | positive regulation of viral process(GO:0048524) |
0.0 | 0.1 | GO:0050651 | dermatan sulfate proteoglycan biosynthetic process(GO:0050651) |
0.0 | 0.0 | GO:0060544 | regulation of necroptotic process(GO:0060544) |
0.0 | 0.1 | GO:0046831 | regulation of RNA export from nucleus(GO:0046831) |
0.0 | 0.8 | GO:0032024 | positive regulation of insulin secretion(GO:0032024) |
0.0 | 0.1 | GO:0007256 | activation of JNKK activity(GO:0007256) |
0.0 | 0.3 | GO:0032355 | response to estradiol(GO:0032355) |
0.0 | 0.1 | GO:0070189 | kynurenine metabolic process(GO:0070189) |
0.0 | 0.0 | GO:0045003 | DNA recombinase assembly(GO:0000730) double-strand break repair via synthesis-dependent strand annealing(GO:0045003) |
0.0 | 0.1 | GO:0032722 | positive regulation of chemokine production(GO:0032722) |
0.0 | 0.1 | GO:0019276 | UDP-N-acetylgalactosamine metabolic process(GO:0019276) |
0.0 | 0.5 | GO:0014823 | response to activity(GO:0014823) |
0.0 | 0.1 | GO:0033210 | leptin-mediated signaling pathway(GO:0033210) |
0.0 | 0.0 | GO:2000698 | positive regulation of epithelial cell differentiation involved in kidney development(GO:2000698) |
0.0 | 0.1 | GO:0031639 | plasminogen activation(GO:0031639) |
0.0 | 0.4 | GO:0006953 | acute-phase response(GO:0006953) |
0.0 | 0.1 | GO:0001887 | selenium compound metabolic process(GO:0001887) |
0.0 | 0.2 | GO:0060712 | spongiotrophoblast layer development(GO:0060712) |
0.0 | 0.3 | GO:0030168 | platelet activation(GO:0030168) |
0.0 | 0.0 | GO:0015677 | copper ion import(GO:0015677) |
0.0 | 0.3 | GO:0070979 | protein K11-linked ubiquitination(GO:0070979) |
0.0 | 0.1 | GO:0046085 | adenosine metabolic process(GO:0046085) |
0.0 | 0.0 | GO:0032594 | protein transport within lipid bilayer(GO:0032594) |
0.0 | 0.0 | GO:0042670 | retinal cone cell differentiation(GO:0042670) |
0.0 | 0.1 | GO:0000087 | mitotic M phase(GO:0000087) |
0.0 | 0.2 | GO:2000353 | positive regulation of endothelial cell apoptotic process(GO:2000353) |
0.0 | 0.4 | GO:1901998 | toxin transport(GO:1901998) |
0.0 | 0.0 | GO:1904667 | negative regulation of ubiquitin protein ligase activity(GO:1904667) |
0.0 | 0.1 | GO:0016255 | attachment of GPI anchor to protein(GO:0016255) |
0.0 | 0.1 | GO:0006702 | androgen biosynthetic process(GO:0006702) |
0.0 | 0.3 | GO:0006513 | protein monoubiquitination(GO:0006513) |
0.0 | 0.1 | GO:0007549 | dosage compensation(GO:0007549) dosage compensation by inactivation of X chromosome(GO:0009048) |
0.0 | 0.1 | GO:1900264 | regulation of DNA-directed DNA polymerase activity(GO:1900262) positive regulation of DNA-directed DNA polymerase activity(GO:1900264) |
0.0 | 0.0 | GO:0048631 | regulation of skeletal muscle tissue growth(GO:0048631) |
0.0 | 0.1 | GO:1903677 | regulation of cap-independent translational initiation(GO:1903677) positive regulation of cap-independent translational initiation(GO:1903679) regulation of cytoplasmic translational initiation(GO:1904688) positive regulation of cytoplasmic translational initiation(GO:1904690) |
0.0 | 0.1 | GO:0006333 | chromatin assembly or disassembly(GO:0006333) |
0.0 | 0.4 | GO:0030968 | endoplasmic reticulum unfolded protein response(GO:0030968) |
0.0 | 0.2 | GO:0030011 | maintenance of cell polarity(GO:0030011) |
0.0 | 0.1 | GO:0006297 | nucleotide-excision repair, DNA gap filling(GO:0006297) |
0.0 | 0.0 | GO:0051004 | regulation of lipoprotein lipase activity(GO:0051004) |
0.0 | 0.1 | GO:0019230 | proprioception(GO:0019230) |
0.0 | 0.1 | GO:0060235 | lens induction in camera-type eye(GO:0060235) |
0.0 | 0.0 | GO:0042983 | amyloid precursor protein biosynthetic process(GO:0042983) regulation of amyloid precursor protein biosynthetic process(GO:0042984) |
0.0 | 0.2 | GO:0046185 | aldehyde catabolic process(GO:0046185) |
0.0 | 0.1 | GO:0033622 | integrin activation(GO:0033622) |
0.0 | 0.0 | GO:0048539 | bone marrow development(GO:0048539) |
0.0 | 0.1 | GO:0008595 | tripartite regional subdivision(GO:0007351) anterior/posterior axis specification, embryo(GO:0008595) |
0.0 | 0.1 | GO:0050820 | positive regulation of coagulation(GO:0050820) |
0.0 | 0.1 | GO:0002922 | positive regulation of humoral immune response(GO:0002922) |
0.0 | 0.1 | GO:0060416 | response to growth hormone(GO:0060416) |
0.0 | 0.0 | GO:0006667 | sphinganine metabolic process(GO:0006667) |
0.0 | 0.0 | GO:0090343 | positive regulation of cell aging(GO:0090343) |
0.0 | 0.1 | GO:0046146 | tetrahydrobiopterin metabolic process(GO:0046146) |
0.0 | 0.1 | GO:0044364 | killing of cells of other organism(GO:0031640) disruption of cells of other organism(GO:0044364) |
0.0 | 0.1 | GO:0036507 | protein deglycosylation involved in glycoprotein catabolic process(GO:0035977) protein demannosylation(GO:0036507) protein alpha-1,2-demannosylation(GO:0036508) glycoprotein ERAD pathway(GO:0097466) mannose trimming involved in glycoprotein ERAD pathway(GO:1904382) response to glycoprotein(GO:1904587) |
0.0 | 0.1 | GO:0045218 | zonula adherens maintenance(GO:0045218) |
0.0 | 0.3 | GO:0071356 | cellular response to tumor necrosis factor(GO:0071356) |
0.0 | 0.0 | GO:0051661 | maintenance of centrosome location(GO:0051661) |
0.0 | 0.0 | GO:0006407 | rRNA export from nucleus(GO:0006407) |
0.0 | 0.0 | GO:0035973 | aggrephagy(GO:0035973) |
0.0 | 0.0 | GO:0050765 | negative regulation of phagocytosis(GO:0050765) |
0.0 | 0.1 | GO:0051532 | regulation of NFAT protein import into nucleus(GO:0051532) |
0.0 | 0.6 | GO:0048144 | fibroblast proliferation(GO:0048144) |
0.0 | 0.1 | GO:0043950 | positive regulation of cAMP-mediated signaling(GO:0043950) |
0.0 | 0.0 | GO:0051315 | attachment of mitotic spindle microtubules to kinetochore(GO:0051315) |
0.0 | 0.1 | GO:0010561 | negative regulation of glycoprotein biosynthetic process(GO:0010561) |
0.0 | 0.0 | GO:0010165 | response to X-ray(GO:0010165) |
0.0 | 0.1 | GO:0006405 | RNA export from nucleus(GO:0006405) |
0.0 | 0.0 | GO:0060979 | vasculogenesis involved in coronary vascular morphogenesis(GO:0060979) |
0.0 | 0.0 | GO:0045065 | cytotoxic T cell differentiation(GO:0045065) |
0.0 | 0.2 | GO:1902235 | regulation of endoplasmic reticulum stress-induced intrinsic apoptotic signaling pathway(GO:1902235) |
0.0 | 0.0 | GO:0090187 | positive regulation of pancreatic juice secretion(GO:0090187) |
0.0 | 0.0 | GO:0008635 | activation of cysteine-type endopeptidase activity involved in apoptotic process by cytochrome c(GO:0008635) |
0.0 | 0.1 | GO:0000188 | inactivation of MAPK activity(GO:0000188) |
0.0 | 0.0 | GO:2000810 | regulation of bicellular tight junction assembly(GO:2000810) |
0.0 | 0.1 | GO:0036336 | dendritic cell migration(GO:0036336) |
0.0 | 0.0 | GO:0002249 | lymphocyte anergy(GO:0002249) regulation of T cell anergy(GO:0002667) T cell anergy(GO:0002870) regulation of lymphocyte anergy(GO:0002911) |
0.0 | 0.0 | GO:0033004 | negative regulation of mast cell activation(GO:0033004) |
0.0 | 0.0 | GO:0090239 | regulation of histone H4 acetylation(GO:0090239) |
0.0 | 0.1 | GO:0002385 | mucosal immune response(GO:0002385) |
0.0 | 0.0 | GO:0071459 | protein localization to chromosome, centromeric region(GO:0071459) |
0.0 | 0.1 | GO:0033344 | cholesterol efflux(GO:0033344) |
0.0 | 0.0 | GO:0015755 | fructose transport(GO:0015755) |
0.0 | 0.0 | GO:0043620 | regulation of DNA-templated transcription in response to stress(GO:0043620) |
0.0 | 1.5 | GO:0002244 | hematopoietic progenitor cell differentiation(GO:0002244) |
0.0 | 0.3 | GO:0010862 | positive regulation of pathway-restricted SMAD protein phosphorylation(GO:0010862) |
0.0 | 0.0 | GO:0060296 | regulation of cilium movement involved in cell motility(GO:0060295) regulation of cilium beat frequency involved in ciliary motility(GO:0060296) regulation of cilium-dependent cell motility(GO:1902019) |
0.0 | 0.2 | GO:0015693 | magnesium ion transport(GO:0015693) |
0.0 | 0.2 | GO:0007064 | mitotic sister chromatid cohesion(GO:0007064) |
0.0 | 0.1 | GO:0002327 | immature B cell differentiation(GO:0002327) |
0.0 | 0.1 | GO:0019348 | dolichol metabolic process(GO:0019348) |
0.0 | 0.0 | GO:0071025 | RNA surveillance(GO:0071025) nuclear RNA surveillance(GO:0071027) nuclear mRNA surveillance(GO:0071028) |
0.0 | 0.1 | GO:0002002 | regulation of angiotensin levels in blood(GO:0002002) |
0.0 | 0.0 | GO:0048478 | replication fork protection(GO:0048478) |
0.0 | 0.0 | GO:0061484 | hematopoietic stem cell homeostasis(GO:0061484) |
0.0 | 0.0 | GO:0038089 | positive regulation of cell migration by vascular endothelial growth factor signaling pathway(GO:0038089) |
0.0 | 0.0 | GO:0002426 | immunoglobulin production in mucosal tissue(GO:0002426) |
0.0 | 0.2 | GO:0032456 | endocytic recycling(GO:0032456) |
0.0 | 0.0 | GO:1905048 | regulation of metallopeptidase activity(GO:1905048) |
0.0 | 0.1 | GO:0006104 | succinyl-CoA metabolic process(GO:0006104) |
0.0 | 0.4 | GO:0000070 | mitotic sister chromatid segregation(GO:0000070) |
0.0 | 0.1 | GO:0045577 | regulation of B cell differentiation(GO:0045577) |
0.0 | 0.0 | GO:0002756 | MyD88-independent toll-like receptor signaling pathway(GO:0002756) |
0.0 | 0.0 | GO:0007181 | transforming growth factor beta receptor complex assembly(GO:0007181) |
0.0 | 0.1 | GO:1902093 | positive regulation of sperm motility(GO:1902093) |
0.0 | 0.5 | GO:0051028 | mRNA transport(GO:0051028) |
0.0 | 0.4 | GO:0030433 | ER-associated ubiquitin-dependent protein catabolic process(GO:0030433) |
0.0 | 0.1 | GO:0032212 | positive regulation of telomere maintenance via telomerase(GO:0032212) positive regulation of telomere maintenance via telomere lengthening(GO:1904358) |
0.0 | 0.0 | GO:0006107 | oxaloacetate metabolic process(GO:0006107) |
0.0 | 0.2 | GO:0002224 | toll-like receptor signaling pathway(GO:0002224) |
0.0 | 0.0 | GO:0043353 | enucleate erythrocyte differentiation(GO:0043353) |
0.0 | 0.1 | GO:0019731 | antibacterial humoral response(GO:0019731) |
0.0 | 0.0 | GO:0019068 | virion assembly(GO:0019068) |
0.0 | 0.0 | GO:0030656 | regulation of vitamin metabolic process(GO:0030656) |
0.0 | 0.1 | GO:0018065 | protein lipoylation(GO:0009249) protein-cofactor linkage(GO:0018065) |
0.0 | 0.0 | GO:0033600 | negative regulation of mammary gland epithelial cell proliferation(GO:0033600) |
0.0 | 0.0 | GO:0071312 | cellular response to alkaloid(GO:0071312) |
0.0 | 0.1 | GO:0043628 | ncRNA 3'-end processing(GO:0043628) |
0.0 | 0.0 | GO:0033599 | regulation of mammary gland epithelial cell proliferation(GO:0033599) |
0.0 | 0.2 | GO:0072332 | intrinsic apoptotic signaling pathway by p53 class mediator(GO:0072332) |
0.0 | 0.0 | GO:0046640 | regulation of alpha-beta T cell proliferation(GO:0046640) positive regulation of alpha-beta T cell proliferation(GO:0046641) |
0.0 | 0.0 | GO:0031440 | regulation of mRNA 3'-end processing(GO:0031440) |
0.0 | 0.4 | GO:0006446 | regulation of translational initiation(GO:0006446) |
0.0 | 0.1 | GO:0042534 | tumor necrosis factor biosynthetic process(GO:0042533) regulation of tumor necrosis factor biosynthetic process(GO:0042534) |
0.0 | 0.1 | GO:1904030 | negative regulation of cyclin-dependent protein serine/threonine kinase activity(GO:0045736) negative regulation of cyclin-dependent protein kinase activity(GO:1904030) |
0.0 | 0.1 | GO:0000244 | spliceosomal tri-snRNP complex assembly(GO:0000244) |
0.0 | 0.0 | GO:0002254 | kinin cascade(GO:0002254) |
0.0 | 0.0 | GO:0035898 | parathyroid hormone secretion(GO:0035898) |
0.0 | 0.1 | GO:0048312 | intracellular distribution of mitochondria(GO:0048312) |
0.0 | 0.1 | GO:0045063 | T-helper 1 cell differentiation(GO:0045063) |
0.0 | 0.1 | GO:0048227 | plasma membrane to endosome transport(GO:0048227) |
0.0 | 0.1 | GO:0002584 | negative regulation of antigen processing and presentation of peptide antigen(GO:0002584) |
0.0 | 0.1 | GO:0060294 | cilium movement involved in cell motility(GO:0060294) |
0.0 | 0.1 | GO:0042398 | cellular modified amino acid biosynthetic process(GO:0042398) |
0.0 | 0.0 | GO:0002278 | eosinophil activation involved in immune response(GO:0002278) eosinophil mediated immunity(GO:0002447) eosinophil degranulation(GO:0043308) |
0.0 | 0.1 | GO:0050710 | negative regulation of cytokine secretion(GO:0050710) |
0.0 | 0.0 | GO:0032513 | negative regulation of protein phosphatase type 2B activity(GO:0032513) |
0.0 | 0.0 | GO:0008211 | glucocorticoid metabolic process(GO:0008211) |
0.0 | 1.0 | GO:0007249 | I-kappaB kinase/NF-kappaB signaling(GO:0007249) |
0.0 | 0.1 | GO:0071157 | negative regulation of cell cycle arrest(GO:0071157) |
0.0 | 0.0 | GO:0009313 | oligosaccharide catabolic process(GO:0009313) |
0.0 | 0.0 | GO:0007161 | calcium-independent cell-matrix adhesion(GO:0007161) |
0.0 | 0.0 | GO:0006706 | steroid catabolic process(GO:0006706) |
0.0 | 0.0 | GO:1904037 | positive regulation of epithelial cell apoptotic process(GO:1904037) |
0.0 | 0.0 | GO:0040036 | regulation of fibroblast growth factor receptor signaling pathway(GO:0040036) |
0.0 | 0.1 | GO:0006541 | glutamine metabolic process(GO:0006541) |
0.0 | 0.0 | GO:0032808 | lacrimal gland development(GO:0032808) |
0.0 | 0.1 | GO:0060441 | epithelial tube branching involved in lung morphogenesis(GO:0060441) |
0.0 | 0.1 | GO:0034122 | negative regulation of toll-like receptor signaling pathway(GO:0034122) |
0.0 | 0.0 | GO:0042091 | interleukin-10 biosynthetic process(GO:0042091) regulation of interleukin-10 biosynthetic process(GO:0045074) |
0.0 | 0.0 | GO:0006266 | DNA ligation(GO:0006266) |
0.0 | 0.1 | GO:0090220 | chromosome localization to nuclear envelope involved in homologous chromosome segregation(GO:0090220) |
0.0 | 0.1 | GO:0046037 | GMP metabolic process(GO:0046037) |
0.0 | 0.1 | GO:0006734 | NADH metabolic process(GO:0006734) |
0.0 | 0.0 | GO:0071372 | cellular response to follicle-stimulating hormone stimulus(GO:0071372) |
0.0 | 0.0 | GO:0072318 | clathrin coat disassembly(GO:0072318) |
0.0 | 0.1 | GO:0016540 | protein autoprocessing(GO:0016540) |
0.0 | 0.1 | GO:0006561 | proline biosynthetic process(GO:0006561) |
0.0 | 0.6 | GO:0007030 | Golgi organization(GO:0007030) |
0.0 | 0.0 | GO:0015684 | ferrous iron transport(GO:0015684) |
0.0 | 0.1 | GO:0009072 | aromatic amino acid family metabolic process(GO:0009072) |
0.0 | 0.1 | GO:0034626 | fatty acid elongation, saturated fatty acid(GO:0019367) fatty acid elongation, unsaturated fatty acid(GO:0019368) fatty acid elongation, monounsaturated fatty acid(GO:0034625) fatty acid elongation, polyunsaturated fatty acid(GO:0034626) |
0.0 | 0.0 | GO:0043985 | histone H4-R3 methylation(GO:0043985) |
0.0 | 0.0 | GO:0044332 | Wnt signaling pathway involved in dorsal/ventral axis specification(GO:0044332) |
0.0 | 0.9 | GO:0016579 | protein deubiquitination(GO:0016579) |
0.0 | 0.0 | GO:0009134 | nucleoside diphosphate catabolic process(GO:0009134) |
0.0 | 0.1 | GO:0070173 | regulation of enamel mineralization(GO:0070173) |
0.0 | 0.0 | GO:0009112 | nucleobase metabolic process(GO:0009112) |
0.0 | 0.1 | GO:0071425 | hematopoietic stem cell proliferation(GO:0071425) |
0.0 | 0.0 | GO:0033685 | negative regulation of luteinizing hormone secretion(GO:0033685) |
0.0 | 0.4 | GO:0042462 | eye photoreceptor cell development(GO:0042462) |
0.0 | 0.0 | GO:0023035 | CD40 signaling pathway(GO:0023035) regulation of CD40 signaling pathway(GO:2000348) |
0.0 | 0.1 | GO:0090502 | RNA phosphodiester bond hydrolysis, endonucleolytic(GO:0090502) |
0.0 | 0.0 | GO:0035507 | regulation of myosin-light-chain-phosphatase activity(GO:0035507) |
0.0 | 0.0 | GO:1904431 | positive regulation of t-circle formation(GO:1904431) |
0.0 | 0.0 | GO:1903333 | negative regulation of protein folding(GO:1903333) |
0.0 | 0.1 | GO:0016926 | protein desumoylation(GO:0016926) |
0.0 | 0.0 | GO:0034311 | diol metabolic process(GO:0034311) |
0.0 | 0.1 | GO:0097062 | dendritic spine maintenance(GO:0097062) |
0.0 | 0.4 | GO:0018149 | peptide cross-linking(GO:0018149) |
0.0 | 0.0 | GO:0007529 | establishment of synaptic specificity at neuromuscular junction(GO:0007529) |
0.0 | 0.0 | GO:0007262 | STAT protein import into nucleus(GO:0007262) |
0.0 | 0.0 | GO:0046606 | negative regulation of centrosome duplication(GO:0010826) negative regulation of centrosome cycle(GO:0046606) |
0.0 | 0.1 | GO:0043968 | histone H2A acetylation(GO:0043968) |
0.0 | 0.0 | GO:0042226 | interleukin-6 biosynthetic process(GO:0042226) |
0.0 | 0.0 | GO:0033227 | dsRNA transport(GO:0033227) |
0.0 | 0.3 | GO:0006505 | GPI anchor metabolic process(GO:0006505) |
0.0 | 0.0 | GO:2001260 | regulation of semaphorin-plexin signaling pathway(GO:2001260) |
0.0 | 0.0 | GO:0050819 | negative regulation of coagulation(GO:0050819) |
0.0 | 0.0 | GO:0032642 | chemokine production(GO:0032602) regulation of chemokine production(GO:0032642) |
0.0 | 0.0 | GO:1904714 | regulation of chaperone-mediated autophagy(GO:1904714) |
0.0 | 0.0 | GO:0060179 | male mating behavior(GO:0060179) |
0.0 | 0.0 | GO:0034227 | tRNA thio-modification(GO:0034227) |
0.0 | 0.0 | GO:0071827 | plasma lipoprotein particle organization(GO:0071827) |
0.0 | 0.5 | GO:0006310 | DNA recombination(GO:0006310) |
0.0 | 0.0 | GO:0034508 | centromere complex assembly(GO:0034508) |
0.0 | 0.2 | GO:0043966 | histone H3 acetylation(GO:0043966) |
0.0 | 0.0 | GO:0048935 | peripheral nervous system neuron differentiation(GO:0048934) peripheral nervous system neuron development(GO:0048935) |
0.0 | 0.1 | GO:0015671 | oxygen transport(GO:0015671) |
0.0 | 0.0 | GO:0070305 | response to cGMP(GO:0070305) |
0.0 | 0.0 | GO:1901317 | regulation of sperm motility(GO:1901317) |
0.0 | 0.0 | GO:0046520 | sphingoid biosynthetic process(GO:0046520) |
0.0 | 0.0 | GO:0035188 | blastocyst hatching(GO:0001835) hatching(GO:0035188) organism emergence from protective structure(GO:0071684) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
1.0 | 4.9 | GO:1990712 | HFE-transferrin receptor complex(GO:1990712) |
0.8 | 2.3 | GO:0005944 | phosphatidylinositol 3-kinase complex, class IB(GO:0005944) |
0.7 | 1.5 | GO:0034993 | microtubule organizing center attachment site(GO:0034992) LINC complex(GO:0034993) |
0.6 | 3.1 | GO:0031298 | replication fork protection complex(GO:0031298) |
0.6 | 6.4 | GO:0065010 | extracellular membrane-bounded organelle(GO:0065010) |
0.6 | 2.3 | GO:0070545 | PeBoW complex(GO:0070545) |
0.5 | 2.2 | GO:1990130 | Iml1 complex(GO:1990130) |
0.5 | 1.8 | GO:0031465 | Cul4B-RING E3 ubiquitin ligase complex(GO:0031465) |
0.5 | 2.7 | GO:0014731 | spectrin-associated cytoskeleton(GO:0014731) |
0.4 | 1.3 | GO:0097629 | extrinsic component of omegasome membrane(GO:0097629) |
0.4 | 1.7 | GO:0005955 | calcineurin complex(GO:0005955) |
0.4 | 1.7 | GO:0044530 | supraspliceosomal complex(GO:0044530) |
0.4 | 1.2 | GO:0097443 | sorting endosome(GO:0097443) |
0.4 | 1.5 | GO:0034363 | intermediate-density lipoprotein particle(GO:0034363) |
0.4 | 1.1 | GO:0097418 | neurofibrillary tangle(GO:0097418) |
0.4 | 1.9 | GO:0045098 | type III intermediate filament(GO:0045098) |
0.4 | 1.1 | GO:0030981 | cortical microtubule cytoskeleton(GO:0030981) |
0.4 | 1.4 | GO:0031466 | Cul5-RING ubiquitin ligase complex(GO:0031466) |
0.3 | 4.4 | GO:0035098 | ESC/E(Z) complex(GO:0035098) |
0.3 | 3.4 | GO:0031010 | ISWI-type complex(GO:0031010) |
0.3 | 1.0 | GO:0005914 | spot adherens junction(GO:0005914) |
0.3 | 1.0 | GO:0031094 | platelet dense tubular network(GO:0031094) |
0.3 | 1.3 | GO:0097452 | GAIT complex(GO:0097452) |
0.3 | 3.2 | GO:0046581 | intercellular canaliculus(GO:0046581) |
0.3 | 2.1 | GO:0008290 | F-actin capping protein complex(GO:0008290) |
0.3 | 0.9 | GO:0097543 | ciliary inversin compartment(GO:0097543) |
0.3 | 0.9 | GO:0005967 | mitochondrial pyruvate dehydrogenase complex(GO:0005967) |
0.3 | 0.9 | GO:1990907 | beta-catenin-TCF complex(GO:1990907) |
0.3 | 1.3 | GO:0070937 | CRD-mediated mRNA stability complex(GO:0070937) |
0.3 | 1.9 | GO:0033256 | I-kappaB/NF-kappaB complex(GO:0033256) |
0.3 | 1.1 | GO:0032541 | cortical endoplasmic reticulum(GO:0032541) |
0.3 | 1.0 | GO:1990454 | L-type voltage-gated calcium channel complex(GO:1990454) |
0.3 | 2.5 | GO:0042582 | primary lysosome(GO:0005766) azurophil granule(GO:0042582) |
0.2 | 0.2 | GO:0070552 | BRISC complex(GO:0070552) |
0.2 | 1.7 | GO:0005833 | hemoglobin complex(GO:0005833) |
0.2 | 0.9 | GO:0097524 | sperm plasma membrane(GO:0097524) |
0.2 | 2.1 | GO:1990124 | messenger ribonucleoprotein complex(GO:1990124) |
0.2 | 0.5 | GO:1902555 | endoribonuclease complex(GO:1902555) |
0.2 | 2.1 | GO:0002116 | semaphorin receptor complex(GO:0002116) |
0.2 | 0.7 | GO:0036488 | CHOP-C/EBP complex(GO:0036488) |
0.2 | 3.1 | GO:0031901 | early endosome membrane(GO:0031901) |
0.2 | 1.7 | GO:1990909 | Wnt signalosome(GO:1990909) |
0.2 | 1.4 | GO:0005952 | cAMP-dependent protein kinase complex(GO:0005952) |
0.2 | 0.6 | GO:0030289 | protein phosphatase 4 complex(GO:0030289) |
0.2 | 1.0 | GO:0016461 | unconventional myosin complex(GO:0016461) |
0.2 | 0.4 | GO:0005850 | eukaryotic translation initiation factor 2 complex(GO:0005850) |
0.2 | 1.0 | GO:0030485 | smooth muscle contractile fiber(GO:0030485) |
0.2 | 0.6 | GO:0005971 | ribonucleoside-diphosphate reductase complex(GO:0005971) |
0.2 | 0.6 | GO:0005853 | eukaryotic translation elongation factor 1 complex(GO:0005853) |
0.2 | 1.0 | GO:0000120 | RNA polymerase I transcription factor complex(GO:0000120) |
0.2 | 1.2 | GO:0071782 | endoplasmic reticulum tubular network(GO:0071782) |
0.2 | 1.0 | GO:0005927 | muscle tendon junction(GO:0005927) |
0.2 | 0.8 | GO:1990726 | Lsm1-7-Pat1 complex(GO:1990726) |
0.2 | 0.6 | GO:0097413 | Lewy body(GO:0097413) |
0.2 | 3.1 | GO:0090545 | NuRD complex(GO:0016581) CHD-type complex(GO:0090545) |
0.2 | 1.9 | GO:0031254 | uropod(GO:0001931) cell trailing edge(GO:0031254) |
0.2 | 0.8 | GO:0000214 | tRNA-intron endonuclease complex(GO:0000214) |
0.2 | 2.0 | GO:0030061 | mitochondrial crista(GO:0030061) |
0.2 | 5.7 | GO:0005771 | multivesicular body(GO:0005771) |
0.2 | 0.5 | GO:0042827 | platelet dense granule(GO:0042827) |
0.2 | 0.2 | GO:0097451 | glial limiting end-foot(GO:0097451) |
0.2 | 0.9 | GO:0033093 | Weibel-Palade body(GO:0033093) |
0.2 | 0.7 | GO:0072487 | MSL complex(GO:0072487) |
0.2 | 6.2 | GO:0005834 | heterotrimeric G-protein complex(GO:0005834) |
0.2 | 0.9 | GO:0005827 | polar microtubule(GO:0005827) |
0.2 | 1.4 | GO:0044666 | MLL3/4 complex(GO:0044666) |
0.2 | 0.7 | GO:0005775 | vacuolar lumen(GO:0005775) |
0.2 | 0.5 | GO:0097136 | Bcl-2 family protein complex(GO:0097136) |
0.2 | 16.9 | GO:0072562 | blood microparticle(GO:0072562) |
0.2 | 1.0 | GO:0097208 | alveolar lamellar body(GO:0097208) |
0.2 | 3.0 | GO:0032588 | trans-Golgi network membrane(GO:0032588) |
0.2 | 2.2 | GO:0036038 | MKS complex(GO:0036038) |
0.2 | 1.6 | GO:1990023 | mitotic spindle midzone(GO:1990023) |
0.2 | 1.3 | GO:0097470 | ribbon synapse(GO:0097470) |
0.2 | 0.5 | GO:0005863 | striated muscle myosin thick filament(GO:0005863) |
0.2 | 0.5 | GO:0030130 | clathrin coat of trans-Golgi network vesicle(GO:0030130) |
0.2 | 1.4 | GO:0005916 | fascia adherens(GO:0005916) |
0.2 | 1.1 | GO:0030008 | TRAPP complex(GO:0030008) |
0.2 | 7.1 | GO:0005776 | autophagosome(GO:0005776) |
0.2 | 0.5 | GO:0030868 | smooth endoplasmic reticulum membrane(GO:0030868) smooth endoplasmic reticulum part(GO:0097425) |
0.2 | 1.2 | GO:0070578 | RISC-loading complex(GO:0070578) |
0.2 | 0.3 | GO:0033588 | Elongator holoenzyme complex(GO:0033588) |
0.2 | 0.3 | GO:0071439 | clathrin complex(GO:0071439) |
0.2 | 1.8 | GO:0030132 | clathrin coat of coated pit(GO:0030132) |
0.2 | 0.9 | GO:0030915 | Smc5-Smc6 complex(GO:0030915) |
0.2 | 0.2 | GO:0000110 | nucleotide-excision repair factor 1 complex(GO:0000110) |
0.1 | 0.7 | GO:0000220 | vacuolar proton-transporting V-type ATPase, V0 domain(GO:0000220) |
0.1 | 0.4 | GO:0005896 | interleukin-6 receptor complex(GO:0005896) |
0.1 | 1.5 | GO:0097539 | ciliary transition fiber(GO:0097539) |
0.1 | 1.3 | GO:0000815 | ESCRT III complex(GO:0000815) |
0.1 | 1.0 | GO:0000788 | nuclear nucleosome(GO:0000788) |
0.1 | 1.1 | GO:0030314 | junctional membrane complex(GO:0030314) |
0.1 | 4.0 | GO:0010494 | cytoplasmic stress granule(GO:0010494) |
0.1 | 1.1 | GO:0030056 | hemidesmosome(GO:0030056) |
0.1 | 1.4 | GO:0034709 | methylosome(GO:0034709) |
0.1 | 6.2 | GO:0030173 | integral component of Golgi membrane(GO:0030173) |
0.1 | 1.3 | GO:0034385 | very-low-density lipoprotein particle(GO:0034361) triglyceride-rich lipoprotein particle(GO:0034385) |
0.1 | 0.6 | GO:0031262 | Ndc80 complex(GO:0031262) |
0.1 | 3.9 | GO:0000118 | histone deacetylase complex(GO:0000118) |
0.1 | 0.4 | GO:1990923 | PET complex(GO:1990923) |
0.1 | 1.6 | GO:0046930 | pore complex(GO:0046930) |
0.1 | 0.8 | GO:0098642 | collagen type IV trimer(GO:0005587) network-forming collagen trimer(GO:0098642) collagen network(GO:0098645) basement membrane collagen trimer(GO:0098651) |
0.1 | 0.8 | GO:0071986 | Ragulator complex(GO:0071986) |
0.1 | 0.3 | GO:0044393 | microspike(GO:0044393) |
0.1 | 0.7 | GO:0032133 | chromosome passenger complex(GO:0032133) |
0.1 | 2.5 | GO:0031307 | integral component of mitochondrial outer membrane(GO:0031307) |
0.1 | 2.8 | GO:0035145 | exon-exon junction complex(GO:0035145) |
0.1 | 2.0 | GO:0005697 | telomerase holoenzyme complex(GO:0005697) |
0.1 | 0.3 | GO:0097149 | centralspindlin complex(GO:0097149) |
0.1 | 0.5 | GO:0035339 | SPOTS complex(GO:0035339) |
0.1 | 0.4 | GO:0045251 | mitochondrial electron transfer flavoprotein complex(GO:0017133) electron transfer flavoprotein complex(GO:0045251) |
0.1 | 0.5 | GO:0034362 | low-density lipoprotein particle(GO:0034362) |
0.1 | 0.2 | GO:0031228 | intrinsic component of Golgi membrane(GO:0031228) |
0.1 | 1.6 | GO:0051233 | spindle midzone(GO:0051233) |
0.1 | 2.2 | GO:0005666 | DNA-directed RNA polymerase III complex(GO:0005666) |
0.1 | 2.3 | GO:0001673 | male germ cell nucleus(GO:0001673) |
0.1 | 0.6 | GO:0016460 | myosin II complex(GO:0016460) |
0.1 | 0.5 | GO:0098536 | deuterosome(GO:0098536) |
0.1 | 1.0 | GO:0008385 | IkappaB kinase complex(GO:0008385) |
0.1 | 0.1 | GO:0043625 | delta DNA polymerase complex(GO:0043625) |
0.1 | 0.5 | GO:0016281 | eukaryotic translation initiation factor 4F complex(GO:0016281) |
0.1 | 0.1 | GO:0005899 | insulin receptor complex(GO:0005899) |
0.1 | 1.3 | GO:0035102 | PRC1 complex(GO:0035102) |
0.1 | 0.9 | GO:0036157 | outer dynein arm(GO:0036157) |
0.1 | 0.6 | GO:0071458 | integral component of cytoplasmic side of endoplasmic reticulum membrane(GO:0071458) integral component of lumenal side of endoplasmic reticulum membrane(GO:0071556) lumenal side of endoplasmic reticulum membrane(GO:0098553) |
0.1 | 1.2 | GO:0042589 | zymogen granule membrane(GO:0042589) |
0.1 | 0.2 | GO:0060053 | neurofilament cytoskeleton(GO:0060053) |
0.1 | 1.6 | GO:0030914 | STAGA complex(GO:0030914) |
0.1 | 4.9 | GO:0045178 | basal part of cell(GO:0045178) |
0.1 | 0.4 | GO:0042825 | TAP complex(GO:0042825) |
0.1 | 0.4 | GO:0031588 | nucleotide-activated protein kinase complex(GO:0031588) |
0.1 | 0.1 | GO:0030128 | clathrin coat of endocytic vesicle(GO:0030128) |
0.1 | 0.4 | GO:0042583 | chromaffin granule(GO:0042583) |
0.1 | 0.3 | GO:0005818 | aster(GO:0005818) |
0.1 | 1.2 | GO:0005675 | holo TFIIH complex(GO:0005675) |
0.1 | 1.0 | GO:0031143 | pseudopodium(GO:0031143) |
0.1 | 3.6 | GO:0008023 | transcription elongation factor complex(GO:0008023) |
0.1 | 0.9 | GO:0035859 | Seh1-associated complex(GO:0035859) |
0.1 | 1.6 | GO:0000177 | cytoplasmic exosome (RNase complex)(GO:0000177) |
0.1 | 1.6 | GO:0005844 | polysome(GO:0005844) |
0.1 | 6.0 | GO:0005795 | Golgi stack(GO:0005795) |
0.1 | 2.1 | GO:0090544 | BAF-type complex(GO:0090544) |
0.1 | 0.4 | GO:0030127 | COPII vesicle coat(GO:0030127) |
0.1 | 3.0 | GO:0000307 | cyclin-dependent protein kinase holoenzyme complex(GO:0000307) |
0.1 | 0.6 | GO:0016012 | sarcoglycan complex(GO:0016012) |
0.1 | 1.7 | GO:0034451 | centriolar satellite(GO:0034451) |
0.1 | 1.8 | GO:0080008 | Cul4-RING E3 ubiquitin ligase complex(GO:0080008) |
0.1 | 0.3 | GO:0043293 | apoptosome(GO:0043293) |
0.1 | 5.2 | GO:0017053 | transcriptional repressor complex(GO:0017053) |
0.1 | 0.7 | GO:0032593 | insulin-responsive compartment(GO:0032593) |
0.1 | 0.8 | GO:0042587 | glycogen granule(GO:0042587) |
0.1 | 0.1 | GO:0070522 | ERCC4-ERCC1 complex(GO:0070522) |
0.1 | 0.1 | GO:0001651 | dense fibrillar component(GO:0001651) |
0.1 | 0.4 | GO:0031315 | extrinsic component of mitochondrial outer membrane(GO:0031315) |
0.1 | 1.6 | GO:0005719 | nuclear euchromatin(GO:0005719) |
0.1 | 3.5 | GO:0005905 | clathrin-coated pit(GO:0005905) |
0.1 | 2.4 | GO:0016592 | mediator complex(GO:0016592) |
0.1 | 0.8 | GO:0031080 | nuclear pore outer ring(GO:0031080) |
0.1 | 2.5 | GO:0031672 | A band(GO:0031672) |
0.1 | 1.6 | GO:0031233 | intrinsic component of external side of plasma membrane(GO:0031233) |
0.1 | 0.3 | GO:0031232 | extrinsic component of external side of plasma membrane(GO:0031232) |
0.1 | 0.7 | GO:0036128 | CatSper complex(GO:0036128) |
0.1 | 2.9 | GO:0030286 | dynein complex(GO:0030286) |
0.1 | 0.2 | GO:0000835 | ER ubiquitin ligase complex(GO:0000835) Hrd1p ubiquitin ligase complex(GO:0000836) |
0.1 | 0.4 | GO:0000408 | EKC/KEOPS complex(GO:0000408) |
0.1 | 1.2 | GO:0030014 | CCR4-NOT complex(GO:0030014) |
0.1 | 1.0 | GO:0005942 | phosphatidylinositol 3-kinase complex(GO:0005942) |
0.1 | 2.3 | GO:0016591 | DNA-directed RNA polymerase II, holoenzyme(GO:0016591) |
0.1 | 0.3 | GO:0044194 | cytolytic granule(GO:0044194) |
0.1 | 0.6 | GO:0031931 | TORC1 complex(GO:0031931) |
0.1 | 0.3 | GO:0097512 | cardiac myofibril(GO:0097512) |
0.1 | 1.3 | GO:0030904 | retromer complex(GO:0030904) |
0.1 | 0.5 | GO:0034098 | VCP-NPL4-UFD1 AAA ATPase complex(GO:0034098) |
0.1 | 5.4 | GO:0090575 | RNA polymerase II transcription factor complex(GO:0090575) |
0.1 | 2.1 | GO:0015030 | Cajal body(GO:0015030) |
0.1 | 0.2 | GO:0033553 | rDNA heterochromatin(GO:0033553) |
0.1 | 1.2 | GO:0043034 | costamere(GO:0043034) |
0.1 | 0.3 | GO:0033063 | Rad51B-Rad51C-Rad51D-XRCC2 complex(GO:0033063) |
0.1 | 1.1 | GO:0005639 | integral component of nuclear inner membrane(GO:0005639) intrinsic component of nuclear inner membrane(GO:0031229) |
0.1 | 0.9 | GO:0002199 | zona pellucida receptor complex(GO:0002199) |
0.1 | 0.4 | GO:0070531 | BRCA1-A complex(GO:0070531) |
0.1 | 0.2 | GO:0048179 | activin receptor complex(GO:0048179) |
0.1 | 0.6 | GO:0051286 | cell tip(GO:0051286) |
0.1 | 0.6 | GO:0035631 | CD40 receptor complex(GO:0035631) |
0.1 | 1.1 | GO:0010008 | endosome membrane(GO:0010008) |
0.1 | 0.2 | GO:1990423 | RZZ complex(GO:1990423) |
0.1 | 0.4 | GO:0000803 | sex chromosome(GO:0000803) |
0.1 | 0.7 | GO:0000813 | ESCRT I complex(GO:0000813) |
0.1 | 0.5 | GO:0000812 | Swr1 complex(GO:0000812) |
0.1 | 0.2 | GO:0097057 | TRAF2-GSTP1 complex(GO:0097057) |
0.1 | 0.4 | GO:0042629 | mast cell granule(GO:0042629) |
0.1 | 0.2 | GO:0042585 | germinal vesicle(GO:0042585) |
0.1 | 0.2 | GO:0000242 | pericentriolar material(GO:0000242) |
0.1 | 0.6 | GO:0036513 | Derlin-1 retrotranslocation complex(GO:0036513) |
0.1 | 1.0 | GO:0000407 | pre-autophagosomal structure(GO:0000407) |
0.1 | 0.5 | GO:1904115 | axon cytoplasm(GO:1904115) |
0.1 | 0.3 | GO:0033179 | proton-transporting V-type ATPase, V0 domain(GO:0033179) |
0.1 | 1.0 | GO:0031231 | intrinsic component of peroxisomal membrane(GO:0031231) |
0.1 | 0.3 | GO:0048476 | Holliday junction resolvase complex(GO:0048476) |
0.1 | 1.3 | GO:0043218 | compact myelin(GO:0043218) |
0.1 | 0.4 | GO:0042599 | lamellar body(GO:0042599) |
0.1 | 4.0 | GO:0000922 | spindle pole(GO:0000922) |
0.1 | 0.9 | GO:0005847 | mRNA cleavage and polyadenylation specificity factor complex(GO:0005847) |
0.1 | 0.8 | GO:0000974 | Prp19 complex(GO:0000974) |
0.1 | 0.9 | GO:0005753 | mitochondrial proton-transporting ATP synthase complex(GO:0005753) |
0.1 | 0.6 | GO:0034464 | BBSome(GO:0034464) |
0.1 | 0.1 | GO:0055087 | Ski complex(GO:0055087) |
0.1 | 0.6 | GO:0045334 | clathrin-coated endocytic vesicle(GO:0045334) |
0.1 | 3.0 | GO:0005871 | kinesin complex(GO:0005871) |
0.1 | 1.2 | GO:0055037 | recycling endosome(GO:0055037) |
0.1 | 0.2 | GO:0030667 | secretory granule membrane(GO:0030667) |
0.1 | 0.5 | GO:0044292 | dendrite terminus(GO:0044292) |
0.1 | 0.2 | GO:0042719 | mitochondrial intermembrane space protein transporter complex(GO:0042719) |
0.1 | 1.8 | GO:0008180 | COP9 signalosome(GO:0008180) |
0.1 | 2.6 | GO:0005811 | lipid particle(GO:0005811) |
0.1 | 1.0 | GO:0005876 | spindle microtubule(GO:0005876) |
0.1 | 0.1 | GO:0071204 | histone pre-mRNA 3'end processing complex(GO:0071204) |
0.1 | 0.2 | GO:0072379 | BAT3 complex(GO:0071818) ER membrane insertion complex(GO:0072379) |
0.1 | 0.4 | GO:0000127 | transcription factor TFIIIC complex(GO:0000127) |
0.1 | 0.1 | GO:0031074 | nucleocytoplasmic shuttling complex(GO:0031074) |
0.1 | 0.9 | GO:0005721 | pericentric heterochromatin(GO:0005721) |
0.1 | 1.0 | GO:0000777 | condensed chromosome kinetochore(GO:0000777) |
0.1 | 5.0 | GO:0034399 | nuclear periphery(GO:0034399) |
0.1 | 2.8 | GO:0030863 | cortical cytoskeleton(GO:0030863) |
0.1 | 0.4 | GO:0071546 | pi-body(GO:0071546) |
0.1 | 0.1 | GO:0044453 | nuclear membrane part(GO:0044453) |
0.1 | 0.1 | GO:0000779 | condensed chromosome, centromeric region(GO:0000779) |
0.1 | 0.2 | GO:0032937 | SREBP-SCAP-Insig complex(GO:0032937) |
0.1 | 0.1 | GO:0070419 | nonhomologous end joining complex(GO:0070419) |
0.1 | 0.4 | GO:0030688 | preribosome, small subunit precursor(GO:0030688) |
0.1 | 3.0 | GO:0030496 | midbody(GO:0030496) |
0.1 | 1.3 | GO:0048770 | melanosome(GO:0042470) pigment granule(GO:0048770) |
0.1 | 7.5 | GO:0000790 | nuclear chromatin(GO:0000790) |
0.1 | 0.4 | GO:0017101 | aminoacyl-tRNA synthetase multienzyme complex(GO:0017101) |
0.1 | 0.4 | GO:0031595 | nuclear proteasome complex(GO:0031595) |
0.1 | 1.6 | GO:0031526 | brush border membrane(GO:0031526) |
0.1 | 5.9 | GO:0005741 | mitochondrial outer membrane(GO:0005741) |
0.1 | 0.2 | GO:0097542 | ciliary tip(GO:0097542) |
0.1 | 2.4 | GO:0005643 | nuclear pore(GO:0005643) |
0.1 | 0.3 | GO:0035327 | transcriptionally active chromatin(GO:0035327) |
0.1 | 12.1 | GO:0016324 | apical plasma membrane(GO:0016324) |
0.1 | 0.1 | GO:0000805 | X chromosome(GO:0000805) |
0.1 | 0.2 | GO:0097255 | R2TP complex(GO:0097255) |
0.1 | 0.1 | GO:0035867 | alphav-beta3 integrin-IGF-1-IGF1R complex(GO:0035867) |
0.1 | 0.5 | GO:0071004 | U2-type prespliceosome(GO:0071004) |
0.1 | 2.2 | GO:0042645 | nucleoid(GO:0009295) mitochondrial nucleoid(GO:0042645) |
0.1 | 0.3 | GO:0031415 | NatA complex(GO:0031415) |
0.1 | 0.1 | GO:0044448 | cell cortex part(GO:0044448) |
0.1 | 0.3 | GO:0005744 | mitochondrial inner membrane presequence translocase complex(GO:0005744) |
0.1 | 0.2 | GO:0042406 | extrinsic component of endoplasmic reticulum membrane(GO:0042406) |
0.1 | 0.3 | GO:1990111 | spermatoproteasome complex(GO:1990111) |
0.1 | 0.3 | GO:0042105 | alpha-beta T cell receptor complex(GO:0042105) |
0.1 | 0.7 | GO:0000145 | exocyst(GO:0000145) |
0.1 | 2.0 | GO:0005903 | brush border(GO:0005903) |
0.1 | 9.5 | GO:0005667 | transcription factor complex(GO:0005667) |
0.1 | 0.7 | GO:0005682 | U5 snRNP(GO:0005682) |
0.1 | 0.2 | GO:0001520 | outer dense fiber(GO:0001520) |
0.1 | 0.1 | GO:0005956 | protein kinase CK2 complex(GO:0005956) |
0.1 | 0.6 | GO:0016459 | myosin complex(GO:0016459) |
0.1 | 0.1 | GO:0005677 | chromatin silencing complex(GO:0005677) |
0.1 | 0.5 | GO:1990752 | microtubule end(GO:1990752) |
0.1 | 0.2 | GO:0031371 | ubiquitin conjugating enzyme complex(GO:0031371) |
0.1 | 0.5 | GO:0097225 | sperm midpiece(GO:0097225) |
0.1 | 0.2 | GO:0001650 | fibrillar center(GO:0001650) |
0.1 | 2.3 | GO:0016605 | PML body(GO:0016605) |
0.1 | 0.2 | GO:0000808 | origin recognition complex(GO:0000808) nuclear origin of replication recognition complex(GO:0005664) |
0.1 | 0.1 | GO:0070820 | tertiary granule(GO:0070820) |
0.1 | 1.2 | GO:0016529 | sarcoplasmic reticulum(GO:0016529) |
0.1 | 0.2 | GO:0002189 | ribose phosphate diphosphokinase complex(GO:0002189) |
0.1 | 0.1 | GO:0044316 | cone cell pedicle(GO:0044316) |
0.1 | 0.8 | GO:0055038 | recycling endosome membrane(GO:0055038) |
0.0 | 0.5 | GO:0031519 | PcG protein complex(GO:0031519) |
0.0 | 0.5 | GO:0030057 | desmosome(GO:0030057) |
0.0 | 0.8 | GO:0005892 | acetylcholine-gated channel complex(GO:0005892) |
0.0 | 0.1 | GO:0032299 | ribonuclease H2 complex(GO:0032299) |
0.0 | 0.1 | GO:0033596 | TSC1-TSC2 complex(GO:0033596) |
0.0 | 0.0 | GO:0071438 | invadopodium membrane(GO:0071438) |
0.0 | 0.3 | GO:0097197 | tetraspanin-enriched microdomain(GO:0097197) |
0.0 | 1.0 | GO:0005902 | microvillus(GO:0005902) |
0.0 | 0.1 | GO:0031084 | BLOC-2 complex(GO:0031084) |
0.0 | 0.4 | GO:0031501 | mannosyltransferase complex(GO:0031501) |
0.0 | 0.8 | GO:0005605 | basal lamina(GO:0005605) |
0.0 | 0.4 | GO:0034663 | endoplasmic reticulum chaperone complex(GO:0034663) |
0.0 | 0.6 | GO:0043196 | varicosity(GO:0043196) |
0.0 | 0.2 | GO:0032982 | myosin filament(GO:0032982) |
0.0 | 0.0 | GO:0070032 | synaptobrevin 2-SNAP-25-syntaxin-1a-complexin I complex(GO:0070032) |
0.0 | 0.1 | GO:0031428 | box C/D snoRNP complex(GO:0031428) |
0.0 | 0.2 | GO:0008541 | proteasome regulatory particle, lid subcomplex(GO:0008541) |
0.0 | 0.0 | GO:0005832 | chaperonin-containing T-complex(GO:0005832) |
0.0 | 0.1 | GO:0005686 | U2 snRNP(GO:0005686) |
0.0 | 0.1 | GO:0034673 | inhibin-betaglycan-ActRII complex(GO:0034673) |
0.0 | 0.1 | GO:0005658 | alpha DNA polymerase:primase complex(GO:0005658) |
0.0 | 0.1 | GO:0000243 | commitment complex(GO:0000243) |
0.0 | 0.1 | GO:0005849 | mRNA cleavage factor complex(GO:0005849) |
0.0 | 0.3 | GO:0060091 | kinocilium(GO:0060091) |
0.0 | 0.0 | GO:0044462 | cell outer membrane(GO:0009279) cell envelope(GO:0030313) external encapsulating structure part(GO:0044462) |
0.0 | 0.1 | GO:0030689 | Noc complex(GO:0030689) |
0.0 | 0.1 | GO:0036452 | ESCRT complex(GO:0036452) |
0.0 | 0.0 | GO:0044232 | organelle membrane contact site(GO:0044232) |
0.0 | 9.8 | GO:0005743 | mitochondrial inner membrane(GO:0005743) |
0.0 | 0.9 | GO:0044391 | ribosomal subunit(GO:0044391) |
0.0 | 0.3 | GO:0008074 | guanylate cyclase complex, soluble(GO:0008074) |
0.0 | 0.3 | GO:0048500 | signal recognition particle, endoplasmic reticulum targeting(GO:0005786) signal recognition particle(GO:0048500) |
0.0 | 0.1 | GO:0019815 | B cell receptor complex(GO:0019815) |
0.0 | 0.0 | GO:0072534 | perineuronal net(GO:0072534) |
0.0 | 0.1 | GO:0005745 | m-AAA complex(GO:0005745) |
0.0 | 0.3 | GO:0005861 | troponin complex(GO:0005861) |
0.0 | 0.1 | GO:0033270 | paranode region of axon(GO:0033270) |
0.0 | 0.1 | GO:0031597 | cytosolic proteasome complex(GO:0031597) |
0.0 | 5.4 | GO:0005759 | mitochondrial matrix(GO:0005759) |
0.0 | 2.1 | GO:0022625 | cytosolic large ribosomal subunit(GO:0022625) |
0.0 | 0.1 | GO:0022626 | cytosolic ribosome(GO:0022626) |
0.0 | 0.1 | GO:0005663 | DNA replication factor C complex(GO:0005663) |
0.0 | 0.0 | GO:0061689 | tricellular tight junction(GO:0061689) |
0.0 | 0.1 | GO:0005851 | eukaryotic translation initiation factor 2B complex(GO:0005851) |
0.0 | 1.7 | GO:0019005 | SCF ubiquitin ligase complex(GO:0019005) |
0.0 | 2.2 | GO:0016604 | nuclear body(GO:0016604) |
0.0 | 0.1 | GO:0005796 | Golgi lumen(GO:0005796) |
0.0 | 14.1 | GO:0005730 | nucleolus(GO:0005730) |
0.0 | 0.1 | GO:0070939 | Dsl1p complex(GO:0070939) |
0.0 | 0.0 | GO:0042613 | MHC class II protein complex(GO:0042613) |
0.0 | 0.2 | GO:0000346 | transcription export complex(GO:0000346) |
0.0 | 0.0 | GO:0030666 | endocytic vesicle membrane(GO:0030666) |
0.0 | 0.1 | GO:0000938 | GARP complex(GO:0000938) |
0.0 | 0.0 | GO:0061574 | ASAP complex(GO:0061574) |
0.0 | 2.1 | GO:0045111 | intermediate filament cytoskeleton(GO:0045111) |
0.0 | 0.1 | GO:0097169 | AIM2 inflammasome complex(GO:0097169) |
0.0 | 0.1 | GO:0031462 | Cul2-RING ubiquitin ligase complex(GO:0031462) |
0.0 | 0.4 | GO:0005637 | nuclear inner membrane(GO:0005637) |
0.0 | 0.7 | GO:0071013 | catalytic step 2 spliceosome(GO:0071013) |
0.0 | 0.0 | GO:0043203 | axon hillock(GO:0043203) |
0.0 | 0.1 | GO:0030687 | preribosome, large subunit precursor(GO:0030687) |
0.0 | 0.1 | GO:0045240 | dihydrolipoyl dehydrogenase complex(GO:0045240) |
0.0 | 0.1 | GO:0070688 | MLL5-L complex(GO:0070688) |
0.0 | 0.3 | GO:0002102 | podosome(GO:0002102) |
0.0 | 0.4 | GO:0002080 | acrosomal membrane(GO:0002080) |
0.0 | 0.1 | GO:0016528 | sarcoplasm(GO:0016528) |
0.0 | 1.0 | GO:0000775 | chromosome, centromeric region(GO:0000775) |
0.0 | 2.7 | GO:0035068 | micro-ribonucleoprotein complex(GO:0035068) |
0.0 | 0.1 | GO:0042765 | GPI-anchor transamidase complex(GO:0042765) |
0.0 | 0.5 | GO:0045335 | phagocytic vesicle(GO:0045335) |
0.0 | 0.8 | GO:0005581 | collagen trimer(GO:0005581) |
0.0 | 0.1 | GO:0031264 | death-inducing signaling complex(GO:0031264) |
0.0 | 0.4 | GO:0005839 | proteasome core complex(GO:0005839) |
0.0 | 0.5 | GO:0045171 | intercellular bridge(GO:0045171) |
0.0 | 0.1 | GO:0071256 | Sec61 translocon complex(GO:0005784) translocon complex(GO:0071256) |
0.0 | 1.9 | GO:0030133 | transport vesicle(GO:0030133) |
0.0 | 0.1 | GO:0038201 | TOR complex(GO:0038201) |
0.0 | 0.1 | GO:0005588 | collagen type V trimer(GO:0005588) |
0.0 | 0.5 | GO:0000795 | synaptonemal complex(GO:0000795) |
0.0 | 0.7 | GO:0005921 | gap junction(GO:0005921) |
0.0 | 1.9 | GO:0009898 | cytoplasmic side of plasma membrane(GO:0009898) |
0.0 | 0.1 | GO:0000794 | condensed nuclear chromosome(GO:0000794) |
0.0 | 0.3 | GO:0043240 | Fanconi anaemia nuclear complex(GO:0043240) |
0.0 | 19.2 | GO:0005654 | nucleoplasm(GO:0005654) |
0.0 | 0.1 | GO:0043020 | NADPH oxidase complex(GO:0043020) |
0.0 | 0.2 | GO:0034358 | plasma lipoprotein particle(GO:0034358) lipoprotein particle(GO:1990777) |
0.0 | 0.3 | GO:0005788 | endoplasmic reticulum lumen(GO:0005788) |
0.0 | 0.4 | GO:0005758 | mitochondrial intermembrane space(GO:0005758) |
0.0 | 3.1 | GO:0005764 | lytic vacuole(GO:0000323) lysosome(GO:0005764) |
0.0 | 0.0 | GO:0097450 | astrocyte end-foot(GO:0097450) |
0.0 | 0.1 | GO:0000506 | glycosylphosphatidylinositol-N-acetylglucosaminyltransferase (GPI-GnT) complex(GO:0000506) |
0.0 | 0.2 | GO:1990204 | oxidoreductase complex(GO:1990204) |
0.0 | 0.1 | GO:0005774 | vacuolar membrane(GO:0005774) |
0.0 | 26.7 | GO:0070062 | extracellular exosome(GO:0070062) |
0.0 | 0.1 | GO:0070971 | endoplasmic reticulum exit site(GO:0070971) |
0.0 | 0.0 | GO:0016442 | RISC complex(GO:0016442) RNAi effector complex(GO:0031332) |
0.0 | 0.1 | GO:0071797 | LUBAC complex(GO:0071797) |
0.0 | 0.0 | GO:0005968 | Rab-protein geranylgeranyltransferase complex(GO:0005968) |
0.0 | 2.5 | GO:0009897 | external side of plasma membrane(GO:0009897) |
0.0 | 0.1 | GO:0005732 | small nucleolar ribonucleoprotein complex(GO:0005732) |
0.0 | 0.0 | GO:0008282 | ATP-sensitive potassium channel complex(GO:0008282) |
0.0 | 0.0 | GO:0031983 | vesicle lumen(GO:0031983) |
0.0 | 7.5 | GO:0005829 | cytosol(GO:0005829) |
0.0 | 0.1 | GO:0031527 | filopodium membrane(GO:0031527) |
0.0 | 0.3 | GO:0005840 | ribosome(GO:0005840) |
0.0 | 0.0 | GO:0045120 | pronucleus(GO:0045120) |
0.0 | 0.1 | GO:0001772 | immunological synapse(GO:0001772) |
0.0 | 7.7 | GO:0005615 | extracellular space(GO:0005615) |
0.0 | 0.1 | GO:0030136 | clathrin-coated vesicle(GO:0030136) |
0.0 | 0.1 | GO:0017119 | Golgi transport complex(GO:0017119) |
0.0 | 0.0 | GO:1990604 | IRE1-TRAF2-ASK1 complex(GO:1990604) |
0.0 | 0.4 | GO:0001533 | cornified envelope(GO:0001533) |
0.0 | 0.2 | GO:0000781 | chromosome, telomeric region(GO:0000781) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
1.0 | 4.1 | GO:0009374 | biotin binding(GO:0009374) |
0.9 | 2.8 | GO:0004487 | methenyltetrahydrofolate cyclohydrolase activity(GO:0004477) methylenetetrahydrofolate dehydrogenase (NAD+) activity(GO:0004487) |
0.9 | 2.8 | GO:0102007 | lactonohydrolase activity(GO:0046573) acyl-L-homoserine-lactone lactonohydrolase activity(GO:0102007) |
0.9 | 6.4 | GO:0003836 | beta-galactoside (CMP) alpha-2,3-sialyltransferase activity(GO:0003836) |
0.8 | 0.8 | GO:0018423 | protein C-terminal leucine carboxyl O-methyltransferase activity(GO:0018423) |
0.8 | 2.4 | GO:0015205 | purine nucleobase transmembrane transporter activity(GO:0005345) pyrimidine nucleobase transmembrane transporter activity(GO:0005350) nucleobase transmembrane transporter activity(GO:0015205) |
0.8 | 2.3 | GO:0015111 | iodide transmembrane transporter activity(GO:0015111) |
0.7 | 2.9 | GO:0000293 | ferric-chelate reductase activity(GO:0000293) |
0.7 | 1.4 | GO:0000405 | bubble DNA binding(GO:0000405) |
0.7 | 2.7 | GO:0003917 | DNA topoisomerase type I activity(GO:0003917) |
0.7 | 2.0 | GO:0047276 | N-acetyllactosaminide 3-alpha-galactosyltransferase activity(GO:0047276) |
0.6 | 1.9 | GO:0001069 | regulatory region RNA binding(GO:0001069) |
0.6 | 2.5 | GO:0004095 | carnitine O-palmitoyltransferase activity(GO:0004095) |
0.6 | 3.1 | GO:0017034 | Rap guanyl-nucleotide exchange factor activity(GO:0017034) |
0.6 | 1.8 | GO:0052658 | inositol-1,4,5-trisphosphate 5-phosphatase activity(GO:0052658) |
0.6 | 1.7 | GO:0030519 | snoRNP binding(GO:0030519) |
0.6 | 1.7 | GO:0070644 | vitamin D response element binding(GO:0070644) |
0.5 | 1.6 | GO:0003876 | AMP deaminase activity(GO:0003876) adenosine-phosphate deaminase activity(GO:0047623) |
0.5 | 1.5 | GO:0003986 | acetyl-CoA hydrolase activity(GO:0003986) |
0.5 | 1.5 | GO:0008310 | single-stranded DNA 3'-5' exodeoxyribonuclease activity(GO:0008310) |
0.5 | 1.5 | GO:0004064 | arylesterase activity(GO:0004064) |
0.5 | 2.4 | GO:0051525 | NFAT protein binding(GO:0051525) |
0.5 | 1.4 | GO:0004832 | valine-tRNA ligase activity(GO:0004832) |
0.5 | 1.9 | GO:0031721 | hemoglobin alpha binding(GO:0031721) |
0.5 | 1.4 | GO:0046966 | thyroid hormone receptor binding(GO:0046966) |
0.5 | 1.4 | GO:0003726 | double-stranded RNA adenosine deaminase activity(GO:0003726) |
0.5 | 1.9 | GO:0008865 | fructokinase activity(GO:0008865) mannokinase activity(GO:0019158) |
0.5 | 1.4 | GO:1902282 | voltage-gated potassium channel activity involved in ventricular cardiac muscle cell action potential repolarization(GO:1902282) |
0.5 | 3.7 | GO:0003810 | protein-glutamine gamma-glutamyltransferase activity(GO:0003810) |
0.5 | 1.4 | GO:0047192 | 1-alkylglycerophosphocholine O-acetyltransferase activity(GO:0047192) |
0.5 | 1.4 | GO:0004104 | cholinesterase activity(GO:0004104) |
0.5 | 1.8 | GO:0097493 | structural molecule activity conferring elasticity(GO:0097493) |
0.5 | 1.8 | GO:0042731 | PH domain binding(GO:0042731) |
0.4 | 1.3 | GO:0060230 | lipoprotein lipase activator activity(GO:0060230) |
0.4 | 1.7 | GO:0046934 | phosphatidylinositol-4,5-bisphosphate 3-kinase activity(GO:0046934) |
0.4 | 1.3 | GO:0009041 | uridylate kinase activity(GO:0009041) |
0.4 | 1.7 | GO:0008532 | N-acetyllactosaminide beta-1,3-N-acetylglucosaminyltransferase activity(GO:0008532) |
0.4 | 1.3 | GO:0000309 | nicotinamide-nucleotide adenylyltransferase activity(GO:0000309) nicotinate-nucleotide adenylyltransferase activity(GO:0004515) |
0.4 | 2.9 | GO:0043140 | ATP-dependent 3'-5' DNA helicase activity(GO:0043140) |
0.4 | 1.6 | GO:0004035 | alkaline phosphatase activity(GO:0004035) |
0.4 | 1.2 | GO:0008503 | benzodiazepine receptor activity(GO:0008503) |
0.4 | 1.2 | GO:0045134 | uridine-diphosphatase activity(GO:0045134) |
0.4 | 2.0 | GO:0005007 | fibroblast growth factor-activated receptor activity(GO:0005007) |
0.4 | 1.2 | GO:0015526 | hexose phosphate transmembrane transporter activity(GO:0015119) organophosphate:inorganic phosphate antiporter activity(GO:0015315) hexose-phosphate:inorganic phosphate antiporter activity(GO:0015526) glucose 6-phosphate:inorganic phosphate antiporter activity(GO:0061513) |
0.4 | 1.2 | GO:0016309 | 1-phosphatidylinositol-5-phosphate 4-kinase activity(GO:0016309) |
0.4 | 3.0 | GO:0035014 | phosphatidylinositol 3-kinase regulator activity(GO:0035014) |
0.4 | 1.5 | GO:0004839 | ubiquitin activating enzyme activity(GO:0004839) |
0.4 | 1.1 | GO:0050220 | prostaglandin-E synthase activity(GO:0050220) |
0.4 | 1.4 | GO:0043515 | kinetochore binding(GO:0043515) |
0.4 | 1.1 | GO:0035175 | histone kinase activity (H3-S10 specific)(GO:0035175) |
0.4 | 2.5 | GO:0005384 | manganese ion transmembrane transporter activity(GO:0005384) |
0.4 | 1.1 | GO:0003829 | beta-1,3-galactosyl-O-glycosyl-glycoprotein beta-1,6-N-acetylglucosaminyltransferase activity(GO:0003829) |
0.3 | 1.4 | GO:0036374 | gamma-glutamyltransferase activity(GO:0003840) glutathione hydrolase activity(GO:0036374) |
0.3 | 1.0 | GO:0071535 | RING-like zinc finger domain binding(GO:0071535) |
0.3 | 1.4 | GO:0030911 | TPR domain binding(GO:0030911) |
0.3 | 1.4 | GO:0005332 | gamma-aminobutyric acid:sodium symporter activity(GO:0005332) |
0.3 | 2.0 | GO:0015288 | porin activity(GO:0015288) |
0.3 | 1.3 | GO:0033192 | calmodulin-dependent protein phosphatase activity(GO:0033192) |
0.3 | 1.0 | GO:0016262 | protein N-acetylglucosaminyltransferase activity(GO:0016262) |
0.3 | 2.3 | GO:0030346 | protein phosphatase 2B binding(GO:0030346) |
0.3 | 1.3 | GO:0019145 | aminobutyraldehyde dehydrogenase activity(GO:0019145) 4-trimethylammoniobutyraldehyde dehydrogenase activity(GO:0047105) |
0.3 | 1.2 | GO:0004849 | uridine kinase activity(GO:0004849) |
0.3 | 2.1 | GO:0005078 | MAP-kinase scaffold activity(GO:0005078) |
0.3 | 9.3 | GO:0005132 | type I interferon receptor binding(GO:0005132) |
0.3 | 0.6 | GO:0038181 | bile acid receptor activity(GO:0038181) |
0.3 | 1.2 | GO:0035615 | clathrin adaptor activity(GO:0035615) endocytic adaptor activity(GO:0098748) |
0.3 | 3.3 | GO:0015129 | lactate transmembrane transporter activity(GO:0015129) |
0.3 | 5.3 | GO:0042975 | peroxisome proliferator activated receptor binding(GO:0042975) |
0.3 | 0.9 | GO:0070698 | type I activin receptor binding(GO:0070698) |
0.3 | 1.7 | GO:0008199 | ferric iron binding(GO:0008199) |
0.3 | 1.1 | GO:0004046 | aminoacylase activity(GO:0004046) |
0.3 | 0.8 | GO:0000702 | oxidized base lesion DNA N-glycosylase activity(GO:0000702) |
0.3 | 1.4 | GO:0090482 | vitamin transmembrane transporter activity(GO:0090482) |
0.3 | 1.6 | GO:0008603 | cAMP-dependent protein kinase regulator activity(GO:0008603) |
0.3 | 4.1 | GO:0016805 | dipeptidase activity(GO:0016805) |
0.3 | 1.4 | GO:0017169 | CDP-alcohol phosphatidyltransferase activity(GO:0017169) |
0.3 | 2.2 | GO:0008430 | selenium binding(GO:0008430) |
0.3 | 1.1 | GO:0004704 | NF-kappaB-inducing kinase activity(GO:0004704) |
0.3 | 2.6 | GO:0004016 | adenylate cyclase activity(GO:0004016) |
0.3 | 1.0 | GO:0016997 | exo-alpha-sialidase activity(GO:0004308) alpha-sialidase activity(GO:0016997) exo-alpha-(2->3)-sialidase activity(GO:0052794) exo-alpha-(2->6)-sialidase activity(GO:0052795) exo-alpha-(2->8)-sialidase activity(GO:0052796) |
0.3 | 1.0 | GO:0000340 | RNA 7-methylguanosine cap binding(GO:0000340) |
0.3 | 0.8 | GO:0004359 | glutaminase activity(GO:0004359) |
0.3 | 1.0 | GO:0015232 | heme transporter activity(GO:0015232) |
0.3 | 0.8 | GO:0004939 | beta-adrenergic receptor activity(GO:0004939) |
0.2 | 1.5 | GO:0097322 | 7SK snRNA binding(GO:0097322) |
0.2 | 0.7 | GO:0030984 | kininogen binding(GO:0030984) |
0.2 | 0.7 | GO:0004366 | glycerol-3-phosphate O-acyltransferase activity(GO:0004366) |
0.2 | 1.4 | GO:0046624 | sphingolipid transporter activity(GO:0046624) |
0.2 | 0.7 | GO:0003987 | acetate-CoA ligase activity(GO:0003987) |
0.2 | 0.9 | GO:0004614 | phosphoglucomutase activity(GO:0004614) |
0.2 | 0.5 | GO:0070878 | primary miRNA binding(GO:0070878) |
0.2 | 1.2 | GO:0016922 | ligand-dependent nuclear receptor binding(GO:0016922) |
0.2 | 3.3 | GO:0016493 | C-C chemokine receptor activity(GO:0016493) |
0.2 | 0.9 | GO:0051022 | Rho GDP-dissociation inhibitor binding(GO:0051022) |
0.2 | 1.9 | GO:0008599 | protein phosphatase type 1 regulator activity(GO:0008599) |
0.2 | 2.1 | GO:0038191 | neuropilin binding(GO:0038191) |
0.2 | 0.7 | GO:0005519 | cytoskeletal regulatory protein binding(GO:0005519) |
0.2 | 4.3 | GO:0001848 | complement binding(GO:0001848) |
0.2 | 0.7 | GO:0004793 | threonine aldolase activity(GO:0004793) L-allo-threonine aldolase activity(GO:0008732) |
0.2 | 0.7 | GO:0047756 | chondroitin 4-sulfotransferase activity(GO:0047756) |
0.2 | 1.5 | GO:0005229 | intracellular calcium activated chloride channel activity(GO:0005229) |
0.2 | 2.2 | GO:0008432 | JUN kinase binding(GO:0008432) |
0.2 | 4.2 | GO:0003746 | translation elongation factor activity(GO:0003746) |
0.2 | 2.2 | GO:0034236 | protein kinase A catalytic subunit binding(GO:0034236) |
0.2 | 0.7 | GO:0004416 | hydroxyacylglutathione hydrolase activity(GO:0004416) |
0.2 | 1.7 | GO:0000900 | translation repressor activity, nucleic acid binding(GO:0000900) |
0.2 | 1.1 | GO:0052724 | inositol hexakisphosphate kinase activity(GO:0000828) inositol hexakisphosphate 5-kinase activity(GO:0000832) inositol hexakisphosphate 1-kinase activity(GO:0052723) inositol hexakisphosphate 3-kinase activity(GO:0052724) |
0.2 | 1.3 | GO:0050072 | m7G(5')pppN diphosphatase activity(GO:0050072) |
0.2 | 1.7 | GO:0008429 | phosphatidylethanolamine binding(GO:0008429) |
0.2 | 0.8 | GO:0015057 | thrombin receptor activity(GO:0015057) |
0.2 | 1.6 | GO:0042171 | lysophosphatidic acid acyltransferase activity(GO:0042171) |
0.2 | 1.8 | GO:0039706 | co-receptor binding(GO:0039706) |
0.2 | 0.6 | GO:0061731 | ribonucleoside-diphosphate reductase activity, thioredoxin disulfide as acceptor(GO:0004748) oxidoreductase activity, acting on CH or CH2 groups, disulfide as acceptor(GO:0016728) ribonucleoside-diphosphate reductase activity(GO:0061731) |
0.2 | 0.2 | GO:0008905 | mannose-phosphate guanylyltransferase activity(GO:0008905) |
0.2 | 0.8 | GO:0004090 | carbonyl reductase (NADPH) activity(GO:0004090) |
0.2 | 2.2 | GO:0005372 | water transmembrane transporter activity(GO:0005372) |
0.2 | 2.0 | GO:0034450 | ubiquitin-ubiquitin ligase activity(GO:0034450) |
0.2 | 3.2 | GO:0019206 | nucleoside kinase activity(GO:0019206) |
0.2 | 1.2 | GO:0005068 | transmembrane receptor protein tyrosine kinase adaptor activity(GO:0005068) |
0.2 | 0.2 | GO:0033677 | DNA/RNA helicase activity(GO:0033677) |
0.2 | 0.8 | GO:0004060 | arylamine N-acetyltransferase activity(GO:0004060) |
0.2 | 0.4 | GO:0019957 | C-C chemokine binding(GO:0019957) |
0.2 | 0.8 | GO:0055056 | D-glucose transmembrane transporter activity(GO:0055056) |
0.2 | 1.9 | GO:0017154 | semaphorin receptor activity(GO:0017154) |
0.2 | 9.7 | GO:0004869 | cysteine-type endopeptidase inhibitor activity(GO:0004869) |
0.2 | 0.8 | GO:0004740 | pyruvate dehydrogenase (acetyl-transferring) kinase activity(GO:0004740) |
0.2 | 0.6 | GO:0019770 | IgG receptor activity(GO:0019770) |
0.2 | 0.6 | GO:0008597 | calcium-dependent protein serine/threonine phosphatase regulator activity(GO:0008597) |
0.2 | 3.3 | GO:0031492 | nucleosomal DNA binding(GO:0031492) |
0.2 | 0.7 | GO:0070053 | thrombospondin receptor activity(GO:0070053) |
0.2 | 1.4 | GO:0001164 | RNA polymerase I regulatory region sequence-specific DNA binding(GO:0001163) RNA polymerase I CORE element sequence-specific DNA binding(GO:0001164) |
0.2 | 0.5 | GO:0097200 | cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:0097200) |
0.2 | 10.6 | GO:0000979 | RNA polymerase II core promoter sequence-specific DNA binding(GO:0000979) |
0.2 | 0.9 | GO:0070290 | N-acylphosphatidylethanolamine-specific phospholipase D activity(GO:0070290) |
0.2 | 0.7 | GO:0015016 | [heparan sulfate]-glucosamine N-sulfotransferase activity(GO:0015016) |
0.2 | 0.5 | GO:0004069 | L-aspartate:2-oxoglutarate aminotransferase activity(GO:0004069) |
0.2 | 0.7 | GO:0005134 | interleukin-2 receptor binding(GO:0005134) |
0.2 | 1.2 | GO:0051371 | muscle alpha-actinin binding(GO:0051371) |
0.2 | 1.5 | GO:0034823 | 3-oxo-2-(2'-pentenyl)cyclopentane-1-octanoic acid CoA ligase activity(GO:0010435) 3-isopropenyl-6-oxoheptanoyl-CoA synthetase activity(GO:0018854) 2-oxo-delta3-4,5,5-trimethylcyclopentenylacetyl-CoA synthetase activity(GO:0018855) benzoyl acetate-CoA ligase activity(GO:0018856) 2,4-dichlorobenzoate-CoA ligase activity(GO:0018857) pivalate-CoA ligase activity(GO:0034783) cyclopropanecarboxylate-CoA ligase activity(GO:0034793) adipate-CoA ligase activity(GO:0034796) citronellyl-CoA ligase activity(GO:0034823) mentha-1,3-dione-CoA ligase activity(GO:0034841) thiophene-2-carboxylate-CoA ligase activity(GO:0034842) 2,4,4-trimethylpentanoate-CoA ligase activity(GO:0034865) cis-2-methyl-5-isopropylhexa-2,5-dienoate-CoA ligase activity(GO:0034942) trans-2-methyl-5-isopropylhexa-2,5-dienoate-CoA ligase activity(GO:0034943) branched-chain acyl-CoA synthetase (ADP-forming) activity(GO:0043759) aryl-CoA synthetase (ADP-forming) activity(GO:0043762) 3-hydroxypropionyl-CoA synthetase activity(GO:0043955) perillic acid:CoA ligase (ADP-forming) activity(GO:0052685) perillic acid:CoA ligase (AMP-forming) activity(GO:0052686) (3R)-3-isopropenyl-6-oxoheptanoate:CoA ligase (ADP-forming) activity(GO:0052687) (3R)-3-isopropenyl-6-oxoheptanoate:CoA ligase (AMP-forming) activity(GO:0052688) pristanate-CoA ligase activity(GO:0070251) malonyl-CoA synthetase activity(GO:0090409) |
0.2 | 0.2 | GO:0034739 | histone deacetylase activity (H4-K16 specific)(GO:0034739) |
0.2 | 2.5 | GO:0017128 | phospholipid scramblase activity(GO:0017128) |
0.2 | 2.3 | GO:0015106 | bicarbonate transmembrane transporter activity(GO:0015106) |
0.2 | 0.7 | GO:0015199 | amino-acid betaine transmembrane transporter activity(GO:0015199) carnitine transmembrane transporter activity(GO:0015226) |
0.2 | 3.0 | GO:0005070 | SH3/SH2 adaptor activity(GO:0005070) |
0.2 | 1.3 | GO:0008301 | DNA binding, bending(GO:0008301) |
0.2 | 0.5 | GO:1990050 | phosphatidic acid transporter activity(GO:1990050) |
0.2 | 0.5 | GO:0003696 | satellite DNA binding(GO:0003696) |
0.2 | 1.6 | GO:0031702 | type 1 angiotensin receptor binding(GO:0031702) |
0.2 | 0.6 | GO:0003916 | DNA topoisomerase activity(GO:0003916) DNA topoisomerase type II (ATP-hydrolyzing) activity(GO:0003918) DNA topoisomerase II activity(GO:0061505) |
0.2 | 0.5 | GO:0050692 | DBD domain binding(GO:0050692) |
0.2 | 1.0 | GO:0001727 | lipid kinase activity(GO:0001727) |
0.2 | 0.5 | GO:0036033 | mediator complex binding(GO:0036033) |
0.2 | 1.3 | GO:0042299 | pivalyl-CoA mutase activity(GO:0034784) o-hydroxylaminobenzoate mutase activity(GO:0034951) lupeol synthase activity(GO:0042299) beta-amyrin synthase activity(GO:0042300) baruol synthase activity(GO:0080011) |
0.2 | 0.3 | GO:0019153 | protein-disulfide reductase (glutathione) activity(GO:0019153) |
0.2 | 3.3 | GO:0008139 | nuclear localization sequence binding(GO:0008139) |
0.2 | 3.0 | GO:0032452 | histone demethylase activity(GO:0032452) |
0.2 | 0.5 | GO:0016822 | hydrolase activity, acting on acid carbon-carbon bonds(GO:0016822) hydrolase activity, acting on acid carbon-carbon bonds, in ketonic substances(GO:0016823) |
0.2 | 0.8 | GO:0016936 | galactoside binding(GO:0016936) |
0.2 | 0.5 | GO:0004920 | interleukin-10 receptor activity(GO:0004920) |
0.2 | 3.2 | GO:0031683 | G-protein beta/gamma-subunit complex binding(GO:0031683) |
0.2 | 0.9 | GO:0003691 | double-stranded telomeric DNA binding(GO:0003691) |
0.2 | 0.3 | GO:0036435 | K48-linked polyubiquitin binding(GO:0036435) |
0.1 | 0.6 | GO:0000213 | tRNA-intron endonuclease activity(GO:0000213) |
0.1 | 0.6 | GO:0017162 | aryl hydrocarbon receptor binding(GO:0017162) |
0.1 | 1.0 | GO:0050291 | sphingosine N-acyltransferase activity(GO:0050291) |
0.1 | 0.4 | GO:0004505 | phenylalanine 4-monooxygenase activity(GO:0004505) |
0.1 | 0.7 | GO:0070324 | thyroid hormone binding(GO:0070324) |
0.1 | 0.7 | GO:0042015 | interleukin-20 binding(GO:0042015) |
0.1 | 1.3 | GO:0042974 | retinoic acid receptor binding(GO:0042974) |
0.1 | 0.4 | GO:0004311 | farnesyltranstransferase activity(GO:0004311) |
0.1 | 0.4 | GO:0016508 | long-chain-enoyl-CoA hydratase activity(GO:0016508) |
0.1 | 0.9 | GO:0031419 | cobalamin binding(GO:0031419) |
0.1 | 0.4 | GO:0042284 | sphingolipid delta-4 desaturase activity(GO:0042284) |
0.1 | 0.1 | GO:0070653 | high-density lipoprotein particle receptor binding(GO:0070653) |
0.1 | 0.7 | GO:0008526 | phosphatidylinositol transporter activity(GO:0008526) |
0.1 | 0.6 | GO:0004703 | G-protein coupled receptor kinase activity(GO:0004703) |
0.1 | 1.8 | GO:0005092 | GDP-dissociation inhibitor activity(GO:0005092) |
0.1 | 0.4 | GO:0033829 | O-fucosylpeptide 3-beta-N-acetylglucosaminyltransferase activity(GO:0033829) |
0.1 | 0.8 | GO:0031435 | mitogen-activated protein kinase kinase kinase binding(GO:0031435) |
0.1 | 0.6 | GO:0034548 | N-cyclopropylmelamine deaminase activity(GO:0034547) N-cyclopropylammeline deaminase activity(GO:0034548) N-cyclopropylammelide alkylamino hydrolase activity(GO:0034549) 2,5-diamino-6-ribitylamino-4(3H)-pyrimidinone 5'-phosphate deaminase activity(GO:0043723) tRNA-specific adenosine-37 deaminase activity(GO:0043829) archaeal-specific GTP cyclohydrolase activity(GO:0044682) tRNA-specific adenosine-34 deaminase activity(GO:0052717) |
0.1 | 0.3 | GO:0034040 | lipid-transporting ATPase activity(GO:0034040) |
0.1 | 1.9 | GO:0001671 | ATPase activator activity(GO:0001671) |
0.1 | 0.3 | GO:0031686 | A1 adenosine receptor binding(GO:0031686) |
0.1 | 1.2 | GO:0009931 | calcium-dependent protein serine/threonine kinase activity(GO:0009931) |
0.1 | 0.7 | GO:0004726 | non-membrane spanning protein tyrosine phosphatase activity(GO:0004726) |
0.1 | 0.3 | GO:0001224 | RNA polymerase II transcription cofactor binding(GO:0001224) RNA polymerase II transcription corepressor binding(GO:0001226) |
0.1 | 0.8 | GO:0008420 | CTD phosphatase activity(GO:0008420) |
0.1 | 1.2 | GO:0017127 | cholesterol transporter activity(GO:0017127) |
0.1 | 0.1 | GO:0032422 | purine-rich negative regulatory element binding(GO:0032422) |
0.1 | 1.7 | GO:0070577 | lysine-acetylated histone binding(GO:0070577) |
0.1 | 0.3 | GO:0019237 | centromeric DNA binding(GO:0019237) |
0.1 | 0.8 | GO:0031749 | D2 dopamine receptor binding(GO:0031749) |
0.1 | 0.4 | GO:0015157 | sucrose:proton symporter activity(GO:0008506) sucrose transmembrane transporter activity(GO:0008515) disaccharide transmembrane transporter activity(GO:0015154) oligosaccharide transmembrane transporter activity(GO:0015157) |
0.1 | 0.4 | GO:0000339 | RNA cap binding(GO:0000339) |
0.1 | 0.3 | GO:0043533 | inositol 1,3,4,5 tetrakisphosphate binding(GO:0043533) |
0.1 | 0.5 | GO:0004594 | pantothenate kinase activity(GO:0004594) |
0.1 | 3.7 | GO:0030507 | spectrin binding(GO:0030507) |
0.1 | 1.5 | GO:0043024 | ribosomal small subunit binding(GO:0043024) |
0.1 | 0.3 | GO:0036042 | long-chain fatty acyl-CoA binding(GO:0036042) |
0.1 | 2.1 | GO:0008307 | structural constituent of muscle(GO:0008307) |
0.1 | 1.0 | GO:0071933 | Arp2/3 complex binding(GO:0071933) |
0.1 | 0.1 | GO:0004676 | 3-phosphoinositide-dependent protein kinase activity(GO:0004676) |
0.1 | 0.4 | GO:0030957 | Tat protein binding(GO:0030957) |
0.1 | 1.2 | GO:0004499 | N,N-dimethylaniline monooxygenase activity(GO:0004499) |
0.1 | 0.4 | GO:0042030 | ATPase inhibitor activity(GO:0042030) |
0.1 | 0.6 | GO:0010853 | cyclase activator activity(GO:0010853) guanylate cyclase activator activity(GO:0030250) |
0.1 | 1.1 | GO:0015187 | glycine transmembrane transporter activity(GO:0015187) |
0.1 | 3.2 | GO:0070063 | RNA polymerase binding(GO:0070063) |
0.1 | 0.5 | GO:0004045 | aminoacyl-tRNA hydrolase activity(GO:0004045) |
0.1 | 0.4 | GO:0070137 | ubiquitin-like protein-specific endopeptidase activity(GO:0070137) SUMO-specific endopeptidase activity(GO:0070139) |
0.1 | 0.7 | GO:0038132 | neuregulin binding(GO:0038132) |
0.1 | 1.0 | GO:0035613 | RNA stem-loop binding(GO:0035613) |
0.1 | 0.4 | GO:0004461 | lactose synthase activity(GO:0004461) |
0.1 | 0.5 | GO:0005329 | dopamine transmembrane transporter activity(GO:0005329) |
0.1 | 2.2 | GO:0017025 | TBP-class protein binding(GO:0017025) |
0.1 | 1.1 | GO:0008656 | cysteine-type endopeptidase activator activity involved in apoptotic process(GO:0008656) |
0.1 | 0.5 | GO:0004566 | beta-glucuronidase activity(GO:0004566) |
0.1 | 0.1 | GO:0001025 | RNA polymerase III transcription factor binding(GO:0001025) |
0.1 | 0.6 | GO:0097642 | calcitonin family receptor activity(GO:0097642) |
0.1 | 0.1 | GO:0004549 | tRNA-specific ribonuclease activity(GO:0004549) |
0.1 | 2.2 | GO:0005527 | macrolide binding(GO:0005527) FK506 binding(GO:0005528) |
0.1 | 1.4 | GO:0008143 | poly(A) binding(GO:0008143) |
0.1 | 0.4 | GO:0005128 | erythropoietin receptor binding(GO:0005128) |
0.1 | 0.7 | GO:0036312 | phosphatidylinositol 3-kinase regulatory subunit binding(GO:0036312) |
0.1 | 0.5 | GO:0005072 | transforming growth factor beta receptor, cytoplasmic mediator activity(GO:0005072) |
0.1 | 0.4 | GO:0016176 | superoxide-generating NADPH oxidase activator activity(GO:0016176) |
0.1 | 0.5 | GO:0004792 | thiosulfate sulfurtransferase activity(GO:0004792) |
0.1 | 2.0 | GO:0001056 | RNA polymerase III activity(GO:0001056) |
0.1 | 0.1 | GO:0030375 | thyroid hormone receptor coactivator activity(GO:0030375) |
0.1 | 1.3 | GO:0035259 | glucocorticoid receptor binding(GO:0035259) |
0.1 | 0.5 | GO:0035925 | mRNA 3'-UTR AU-rich region binding(GO:0035925) |
0.1 | 0.7 | GO:0002054 | nucleobase binding(GO:0002054) |
0.1 | 0.1 | GO:0070538 | oleic acid binding(GO:0070538) |
0.1 | 0.7 | GO:1990381 | ubiquitin-specific protease binding(GO:1990381) |
0.1 | 1.0 | GO:0016634 | oxidoreductase activity, acting on the CH-CH group of donors, oxygen as acceptor(GO:0016634) |
0.1 | 1.5 | GO:0070567 | cytidylyltransferase activity(GO:0070567) |
0.1 | 1.8 | GO:0070064 | proline-rich region binding(GO:0070064) |
0.1 | 3.1 | GO:0001205 | transcriptional activator activity, RNA polymerase II distal enhancer sequence-specific binding(GO:0001205) |
0.1 | 0.7 | GO:0036122 | BMP binding(GO:0036122) |
0.1 | 2.1 | GO:0004198 | calcium-dependent cysteine-type endopeptidase activity(GO:0004198) |
0.1 | 0.6 | GO:0034452 | dynactin binding(GO:0034452) |
0.1 | 0.3 | GO:0016802 | adenosylhomocysteinase activity(GO:0004013) trialkylsulfonium hydrolase activity(GO:0016802) |
0.1 | 2.5 | GO:0005086 | ARF guanyl-nucleotide exchange factor activity(GO:0005086) |
0.1 | 2.4 | GO:0043531 | ADP binding(GO:0043531) |
0.1 | 0.3 | GO:0005220 | inositol 1,4,5-trisphosphate-sensitive calcium-release channel activity(GO:0005220) |
0.1 | 0.4 | GO:0042809 | vitamin D receptor binding(GO:0042809) |
0.1 | 2.0 | GO:0015035 | protein disulfide oxidoreductase activity(GO:0015035) |
0.1 | 0.8 | GO:0001206 | transcriptional repressor activity, RNA polymerase II distal enhancer sequence-specific binding(GO:0001206) |
0.1 | 0.4 | GO:0003846 | 2-acylglycerol O-acyltransferase activity(GO:0003846) |
0.1 | 0.4 | GO:0008349 | MAP kinase kinase kinase kinase activity(GO:0008349) |
0.1 | 0.3 | GO:0019862 | IgA binding(GO:0019862) |
0.1 | 0.4 | GO:0016744 | transferase activity, transferring aldehyde or ketonic groups(GO:0016744) |
0.1 | 2.7 | GO:0033613 | activating transcription factor binding(GO:0033613) |
0.1 | 0.3 | GO:0061676 | importin-alpha family protein binding(GO:0061676) |
0.1 | 0.3 | GO:0047631 | ADP-ribose diphosphatase activity(GO:0047631) |
0.1 | 0.9 | GO:0042500 | aspartic endopeptidase activity, intramembrane cleaving(GO:0042500) |
0.1 | 0.3 | GO:0046915 | transition metal ion transmembrane transporter activity(GO:0046915) |
0.1 | 0.2 | GO:1990715 | mRNA CDS binding(GO:1990715) |
0.1 | 3.4 | GO:0018024 | histone-lysine N-methyltransferase activity(GO:0018024) |
0.1 | 0.4 | GO:0001875 | lipopolysaccharide receptor activity(GO:0001875) |
0.1 | 1.1 | GO:0004312 | fatty acid synthase activity(GO:0004312) |
0.1 | 0.4 | GO:0031013 | troponin I binding(GO:0031013) |
0.1 | 0.3 | GO:0008401 | retinoic acid 4-hydroxylase activity(GO:0008401) |
0.1 | 0.1 | GO:0009008 | DNA-methyltransferase activity(GO:0009008) |
0.1 | 0.2 | GO:0005087 | Ran guanyl-nucleotide exchange factor activity(GO:0005087) |
0.1 | 1.5 | GO:0004708 | MAP kinase kinase activity(GO:0004708) |
0.1 | 1.0 | GO:0016888 | endodeoxyribonuclease activity, producing 5'-phosphomonoesters(GO:0016888) |
0.1 | 0.4 | GO:0015183 | L-aspartate transmembrane transporter activity(GO:0015183) |
0.1 | 1.9 | GO:0042162 | telomeric DNA binding(GO:0042162) |
0.1 | 1.9 | GO:0004745 | retinol dehydrogenase activity(GO:0004745) |
0.1 | 0.6 | GO:0016778 | diphosphotransferase activity(GO:0016778) |
0.1 | 0.9 | GO:0097602 | cullin family protein binding(GO:0097602) |
0.1 | 0.3 | GO:0046404 | ATP-dependent polydeoxyribonucleotide 5'-hydroxyl-kinase activity(GO:0046404) polydeoxyribonucleotide kinase activity(GO:0051733) |
0.1 | 0.4 | GO:0034584 | piRNA binding(GO:0034584) |
0.1 | 0.6 | GO:0005536 | glucose binding(GO:0005536) |
0.1 | 0.2 | GO:0051430 | corticotropin-releasing hormone receptor 1 binding(GO:0051430) |
0.1 | 0.5 | GO:0030274 | LIM domain binding(GO:0030274) |
0.1 | 0.4 | GO:0002162 | dystroglycan binding(GO:0002162) |
0.1 | 0.4 | GO:0019834 | phospholipase A2 inhibitor activity(GO:0019834) |
0.1 | 0.9 | GO:0046625 | sphingolipid binding(GO:0046625) |
0.1 | 0.4 | GO:0022833 | mechanically-gated ion channel activity(GO:0008381) mechanically gated channel activity(GO:0022833) |
0.1 | 0.3 | GO:0004514 | nicotinate-nucleotide diphosphorylase (carboxylating) activity(GO:0004514) |
0.1 | 0.3 | GO:0008427 | calcium-dependent protein kinase inhibitor activity(GO:0008427) |
0.1 | 5.6 | GO:0003725 | double-stranded RNA binding(GO:0003725) |
0.1 | 0.8 | GO:0008140 | cAMP response element binding protein binding(GO:0008140) |
0.1 | 1.1 | GO:0070628 | proteasome binding(GO:0070628) |
0.1 | 0.1 | GO:0070915 | lysophosphatidic acid receptor activity(GO:0070915) |
0.1 | 4.5 | GO:0003697 | single-stranded DNA binding(GO:0003697) |
0.1 | 0.3 | GO:1901612 | cardiolipin binding(GO:1901612) |
0.1 | 1.1 | GO:0023026 | MHC class II protein complex binding(GO:0023026) |
0.1 | 0.2 | GO:0030284 | estrogen receptor activity(GO:0030284) |
0.1 | 2.7 | GO:0004693 | cyclin-dependent protein serine/threonine kinase activity(GO:0004693) cyclin-dependent protein kinase activity(GO:0097472) |
0.1 | 0.5 | GO:0004826 | phenylalanine-tRNA ligase activity(GO:0004826) |
0.1 | 0.2 | GO:0050833 | pyruvate transmembrane transporter activity(GO:0050833) |
0.1 | 1.3 | GO:0019200 | carbohydrate kinase activity(GO:0019200) |
0.1 | 0.4 | GO:0030942 | endoplasmic reticulum signal peptide binding(GO:0030942) |
0.1 | 3.3 | GO:0003684 | damaged DNA binding(GO:0003684) |
0.1 | 0.5 | GO:0034522 | pinocarveol dehydrogenase activity(GO:0018446) chloral hydrate dehydrogenase activity(GO:0018447) hydroxymethylmethylsilanediol oxidase activity(GO:0018448) 1-phenylethanol dehydrogenase activity(GO:0018449) myrtenol dehydrogenase activity(GO:0018450) cis-1,2-dihydroxy-1,2-dihydro-8-carboxynaphthalene dehydrogenase activity(GO:0034522) 3-hydroxy-4-methyloctanoyl-CoA dehydrogenase activity(GO:0034582) 2-hydroxy-4-isopropenylcyclohexane-1-carboxyl-CoA dehydrogenase activity(GO:0034778) cis-9,10-dihydroanthracene-9,10-diol dehydrogenase activity(GO:0034817) citronellol dehydrogenase activity(GO:0034821) naphthyl-2-hydroxymethyl-succinyl-CoA dehydrogenase activity(GO:0034847) 2,4,4-trimethyl-1-pentanol dehydrogenase activity(GO:0034863) 2,4,4-trimethyl-3-hydroxypentanoyl-CoA dehydrogenase activity(GO:0034868) 1-hydroxy-4,4-dimethylpentan-3-one dehydrogenase activity(GO:0034871) endosulfan diol dehydrogenase activity(GO:0034891) endosulfan hydroxyether dehydrogenase activity(GO:0034901) 3-hydroxy-2-methylhexanoyl-CoA dehydrogenase activity(GO:0034918) 3-hydroxy-2,6-dimethyl-5-methylene-heptanoyl-CoA dehydrogenase activity(GO:0034944) versicolorin reductase activity(GO:0042469) ketoreductase activity(GO:0045703) |
0.1 | 0.4 | GO:0015379 | potassium:chloride symporter activity(GO:0015379) potassium ion symporter activity(GO:0022820) |
0.1 | 1.0 | GO:0070300 | phosphatidic acid binding(GO:0070300) |
0.1 | 1.2 | GO:0004089 | carbonate dehydratase activity(GO:0004089) |
0.1 | 2.7 | GO:0005484 | SNAP receptor activity(GO:0005484) |
0.1 | 0.4 | GO:0017151 | DEAD/H-box RNA helicase binding(GO:0017151) |
0.1 | 0.2 | GO:0005168 | neurotrophin TRKA receptor binding(GO:0005168) |
0.1 | 0.4 | GO:0004735 | pyrroline-5-carboxylate reductase activity(GO:0004735) |
0.1 | 5.1 | GO:0003777 | microtubule motor activity(GO:0003777) |
0.1 | 0.9 | GO:0035497 | cAMP response element binding(GO:0035497) |
0.1 | 0.1 | GO:0051723 | protein methylesterase activity(GO:0051723) |
0.1 | 0.1 | GO:0034191 | apolipoprotein A-I receptor binding(GO:0034191) |
0.1 | 0.3 | GO:0004445 | inositol-polyphosphate 5-phosphatase activity(GO:0004445) |
0.1 | 0.3 | GO:0051010 | microtubule plus-end binding(GO:0051010) |
0.1 | 6.1 | GO:0043130 | ubiquitin binding(GO:0043130) |
0.1 | 0.1 | GO:0042609 | CD4 receptor binding(GO:0042609) |
0.1 | 0.5 | GO:0048156 | tau protein binding(GO:0048156) |
0.1 | 0.4 | GO:0015165 | pyrimidine nucleotide-sugar transmembrane transporter activity(GO:0015165) |
0.1 | 4.1 | GO:0005200 | structural constituent of cytoskeleton(GO:0005200) |
0.1 | 3.2 | GO:0098811 | transcriptional activator activity, RNA polymerase II transcription factor binding(GO:0001190) transcriptional repressor activity, RNA polymerase II activating transcription factor binding(GO:0098811) |
0.1 | 0.1 | GO:0034190 | apolipoprotein receptor binding(GO:0034190) |
0.1 | 1.9 | GO:0001085 | RNA polymerase II transcription factor binding(GO:0001085) |
0.1 | 3.6 | GO:0003707 | steroid hormone receptor activity(GO:0003707) |
0.1 | 0.2 | GO:0030983 | mismatched DNA binding(GO:0030983) |
0.1 | 2.1 | GO:0019706 | protein-cysteine S-palmitoyltransferase activity(GO:0019706) |
0.1 | 0.3 | GO:0042301 | phosphate ion binding(GO:0042301) |
0.1 | 1.2 | GO:0005487 | nucleocytoplasmic transporter activity(GO:0005487) |
0.1 | 0.4 | GO:0032050 | clathrin heavy chain binding(GO:0032050) |
0.1 | 0.2 | GO:0008486 | diphosphoinositol-polyphosphate diphosphatase activity(GO:0008486) |
0.1 | 0.1 | GO:0000175 | 3'-5'-exoribonuclease activity(GO:0000175) exoribonuclease activity, producing 5'-phosphomonoesters(GO:0016896) |
0.1 | 1.4 | GO:0005031 | tumor necrosis factor-activated receptor activity(GO:0005031) death receptor activity(GO:0005035) |
0.1 | 0.3 | GO:0001055 | RNA polymerase II activity(GO:0001055) |
0.1 | 0.8 | GO:0004535 | poly(A)-specific ribonuclease activity(GO:0004535) |
0.1 | 0.6 | GO:0016803 | ether hydrolase activity(GO:0016803) |
0.1 | 0.2 | GO:0004616 | phosphogluconate dehydrogenase (decarboxylating) activity(GO:0004616) |
0.1 | 0.4 | GO:0002094 | polyprenyltransferase activity(GO:0002094) |
0.1 | 0.5 | GO:0004415 | hyalurononglucosaminidase activity(GO:0004415) |
0.1 | 0.9 | GO:0032451 | demethylase activity(GO:0032451) |
0.1 | 0.3 | GO:0008440 | inositol-1,4,5-trisphosphate 3-kinase activity(GO:0008440) |
0.1 | 0.5 | GO:0005000 | vasopressin receptor activity(GO:0005000) |
0.1 | 0.4 | GO:0018685 | alkane 1-monooxygenase activity(GO:0018685) |
0.1 | 0.5 | GO:0005024 | transforming growth factor beta-activated receptor activity(GO:0005024) |
0.1 | 0.5 | GO:0005138 | interleukin-6 receptor binding(GO:0005138) |
0.1 | 0.1 | GO:0001099 | basal transcription machinery binding(GO:0001098) basal RNA polymerase II transcription machinery binding(GO:0001099) |
0.1 | 0.1 | GO:0004942 | anaphylatoxin receptor activity(GO:0004942) |
0.1 | 1.1 | GO:0017049 | GTP-Rho binding(GO:0017049) |
0.1 | 1.0 | GO:0022841 | potassium ion leak channel activity(GO:0022841) |
0.1 | 1.0 | GO:0070273 | phosphatidylinositol-4-phosphate binding(GO:0070273) |
0.1 | 0.1 | GO:0017089 | glycolipid transporter activity(GO:0017089) |
0.1 | 0.2 | GO:0019784 | NEDD8-specific protease activity(GO:0019784) |
0.1 | 1.1 | GO:0008252 | nucleotidase activity(GO:0008252) |
0.1 | 0.2 | GO:0008147 | structural constituent of bone(GO:0008147) |
0.1 | 0.3 | GO:0005113 | patched binding(GO:0005113) |
0.1 | 0.3 | GO:0032027 | myosin light chain binding(GO:0032027) |
0.1 | 0.1 | GO:0008525 | phosphatidylcholine transporter activity(GO:0008525) |
0.1 | 1.9 | GO:0070491 | repressing transcription factor binding(GO:0070491) |
0.1 | 4.8 | GO:0016427 | tRNA (cytosine) methyltransferase activity(GO:0016427) tRNA (cytosine-5-)-methyltransferase activity(GO:0016428) |
0.1 | 0.1 | GO:0004706 | JUN kinase kinase kinase activity(GO:0004706) |
0.1 | 0.1 | GO:0089720 | caspase binding(GO:0089720) |
0.1 | 1.5 | GO:0005385 | zinc ion transmembrane transporter activity(GO:0005385) |
0.1 | 0.7 | GO:0019789 | SUMO transferase activity(GO:0019789) |
0.1 | 1.4 | GO:0001046 | core promoter sequence-specific DNA binding(GO:0001046) |
0.1 | 0.2 | GO:0004967 | glucagon receptor activity(GO:0004967) |
0.1 | 0.5 | GO:0019966 | interleukin-1 binding(GO:0019966) |
0.1 | 1.0 | GO:0016863 | intramolecular oxidoreductase activity, transposing C=C bonds(GO:0016863) |
0.1 | 2.8 | GO:0050840 | extracellular matrix binding(GO:0050840) |
0.1 | 0.1 | GO:0004771 | sterol esterase activity(GO:0004771) |
0.1 | 0.1 | GO:0008061 | chitin binding(GO:0008061) |
0.1 | 0.1 | GO:0051575 | 5'-deoxyribose-5-phosphate lyase activity(GO:0051575) |
0.1 | 4.5 | GO:0002020 | protease binding(GO:0002020) |
0.1 | 0.2 | GO:0072345 | NAADP-sensitive calcium-release channel activity(GO:0072345) |
0.1 | 0.1 | GO:0005338 | nucleotide-sugar transmembrane transporter activity(GO:0005338) |
0.1 | 0.3 | GO:0060229 | phospholipase activator activity(GO:0016004) lipase activator activity(GO:0060229) |
0.1 | 1.6 | GO:0043914 | NADPH:sulfur oxidoreductase activity(GO:0043914) |
0.1 | 0.2 | GO:0016842 | amidine-lyase activity(GO:0016842) |
0.1 | 0.4 | GO:1990405 | protein antigen binding(GO:1990405) |
0.1 | 0.2 | GO:0030621 | U4 snRNA binding(GO:0030621) |
0.1 | 0.9 | GO:0051059 | NF-kappaB binding(GO:0051059) |
0.1 | 0.8 | GO:0008157 | protein phosphatase 1 binding(GO:0008157) |
0.1 | 0.2 | GO:0004694 | eukaryotic translation initiation factor 2alpha kinase activity(GO:0004694) |
0.1 | 1.2 | GO:1901476 | carbohydrate transmembrane transporter activity(GO:0015144) carbohydrate transporter activity(GO:1901476) |
0.1 | 0.2 | GO:0004365 | glyceraldehyde-3-phosphate dehydrogenase (NAD+) (phosphorylating) activity(GO:0004365) glyceraldehyde-3-phosphate dehydrogenase (NAD(P)+) (phosphorylating) activity(GO:0043891) |
0.1 | 0.6 | GO:0008198 | ferrous iron binding(GO:0008198) |
0.1 | 0.3 | GO:0016812 | hydrolase activity, acting on carbon-nitrogen (but not peptide) bonds, in cyclic amides(GO:0016812) |
0.1 | 0.3 | GO:0017176 | phosphatidylinositol N-acetylglucosaminyltransferase activity(GO:0017176) |
0.1 | 0.1 | GO:0001223 | transcription coactivator binding(GO:0001223) |
0.1 | 0.1 | GO:0045504 | dynein heavy chain binding(GO:0045504) |
0.1 | 0.4 | GO:0004768 | stearoyl-CoA 9-desaturase activity(GO:0004768) |
0.1 | 0.2 | GO:0000400 | four-way junction DNA binding(GO:0000400) |
0.1 | 0.1 | GO:0043559 | insulin binding(GO:0043559) |
0.1 | 0.2 | GO:0008093 | cytoskeletal adaptor activity(GO:0008093) |
0.1 | 0.7 | GO:0008242 | omega peptidase activity(GO:0008242) |
0.1 | 0.4 | GO:0047760 | butyrate-CoA ligase activity(GO:0047760) |
0.1 | 0.1 | GO:1901611 | phosphatidylglycerol binding(GO:1901611) |
0.1 | 0.2 | GO:0010997 | anaphase-promoting complex binding(GO:0010997) |
0.1 | 2.6 | GO:0019003 | GDP binding(GO:0019003) |
0.1 | 0.2 | GO:0004966 | galanin receptor activity(GO:0004966) |
0.1 | 0.2 | GO:1904264 | ubiquitin protein ligase activity involved in ERAD pathway(GO:1904264) |
0.1 | 0.2 | GO:0001972 | retinoic acid binding(GO:0001972) |
0.1 | 0.1 | GO:0017098 | sulfonylurea receptor binding(GO:0017098) |
0.1 | 0.1 | GO:0034618 | arginine binding(GO:0034618) |
0.1 | 1.6 | GO:0048020 | CCR chemokine receptor binding(GO:0048020) |
0.1 | 0.8 | GO:0008519 | ammonium transmembrane transporter activity(GO:0008519) |
0.1 | 1.9 | GO:0004812 | aminoacyl-tRNA ligase activity(GO:0004812) |
0.1 | 0.2 | GO:0004346 | glucose-6-phosphatase activity(GO:0004346) sugar-terminal-phosphatase activity(GO:0050309) |
0.1 | 0.3 | GO:0016308 | 1-phosphatidylinositol-4-phosphate 5-kinase activity(GO:0016308) |
0.1 | 0.2 | GO:0070742 | C2H2 zinc finger domain binding(GO:0070742) |
0.1 | 0.3 | GO:0097153 | cysteine-type endopeptidase activity involved in apoptotic process(GO:0097153) |
0.1 | 0.3 | GO:0035256 | G-protein coupled glutamate receptor binding(GO:0035256) |
0.1 | 0.1 | GO:0070840 | dynein complex binding(GO:0070840) |
0.1 | 0.4 | GO:0004767 | sphingomyelin phosphodiesterase activity(GO:0004767) |
0.1 | 0.1 | GO:0004800 | thyroxine 5'-deiodinase activity(GO:0004800) |
0.1 | 1.3 | GO:0030374 | ligand-dependent nuclear receptor transcription coactivator activity(GO:0030374) |
0.1 | 2.0 | GO:0005160 | transforming growth factor beta receptor binding(GO:0005160) |
0.1 | 0.1 | GO:0034513 | box H/ACA snoRNA binding(GO:0034513) |
0.1 | 5.5 | GO:0017137 | Rab GTPase binding(GO:0017137) |
0.1 | 0.2 | GO:0015651 | quaternary ammonium group transmembrane transporter activity(GO:0015651) |
0.1 | 7.8 | GO:0061630 | ubiquitin protein ligase activity(GO:0061630) |
0.1 | 0.2 | GO:0001222 | transcription corepressor binding(GO:0001222) |
0.1 | 0.2 | GO:0043138 | 3'-5' DNA helicase activity(GO:0043138) |
0.1 | 0.4 | GO:0031491 | nucleosome binding(GO:0031491) |
0.1 | 0.2 | GO:0019211 | phosphatase activator activity(GO:0019211) |
0.1 | 0.2 | GO:0004565 | beta-galactosidase activity(GO:0004565) |
0.1 | 0.9 | GO:0003950 | NAD+ ADP-ribosyltransferase activity(GO:0003950) |
0.1 | 0.2 | GO:0035612 | AP-2 adaptor complex binding(GO:0035612) |
0.1 | 0.2 | GO:0035198 | miRNA binding(GO:0035198) |
0.1 | 3.6 | GO:0047485 | protein N-terminus binding(GO:0047485) |
0.1 | 0.5 | GO:0004438 | phosphatidylinositol-3-phosphatase activity(GO:0004438) |
0.1 | 0.1 | GO:0034186 | apolipoprotein A-I binding(GO:0034186) |
0.1 | 0.2 | GO:0048101 | calcium- and calmodulin-regulated 3',5'-cyclic-GMP phosphodiesterase activity(GO:0048101) |
0.1 | 0.1 | GO:0008184 | glycogen phosphorylase activity(GO:0008184) |
0.1 | 0.8 | GO:0016538 | cyclin-dependent protein serine/threonine kinase regulator activity(GO:0016538) |
0.1 | 0.7 | GO:0045502 | dynein binding(GO:0045502) |
0.1 | 0.2 | GO:1990189 | peptide-serine-N-acetyltransferase activity(GO:1990189) peptide-glutamate-N-acetyltransferase activity(GO:1990190) |
0.1 | 0.1 | GO:0005157 | macrophage colony-stimulating factor receptor binding(GO:0005157) |
0.1 | 0.1 | GO:1990825 | sequence-specific mRNA binding(GO:1990825) |
0.1 | 0.8 | GO:0032266 | phosphatidylinositol-3-phosphate binding(GO:0032266) |
0.1 | 0.2 | GO:0015116 | sulfate transmembrane transporter activity(GO:0015116) |
0.1 | 0.2 | GO:0097371 | MDM2/MDM4 family protein binding(GO:0097371) |
0.1 | 1.5 | GO:0003705 | transcription factor activity, RNA polymerase II distal enhancer sequence-specific binding(GO:0003705) |
0.0 | 0.2 | GO:0016742 | hydroxymethyl-, formyl- and related transferase activity(GO:0016742) |
0.0 | 1.0 | GO:0070003 | threonine-type endopeptidase activity(GO:0004298) threonine-type peptidase activity(GO:0070003) |
0.0 | 0.0 | GO:0008413 | 8-oxo-7,8-dihydroguanosine triphosphate pyrophosphatase activity(GO:0008413) |
0.0 | 0.2 | GO:1990932 | 5.8S rRNA binding(GO:1990932) |
0.0 | 0.3 | GO:0016175 | superoxide-generating NADPH oxidase activity(GO:0016175) |
0.0 | 0.1 | GO:0004645 | phosphorylase activity(GO:0004645) |
0.0 | 9.1 | GO:0003735 | structural constituent of ribosome(GO:0003735) |
0.0 | 0.7 | GO:0005003 | ephrin receptor activity(GO:0005003) |
0.0 | 0.1 | GO:0070548 | L-glutamine aminotransferase activity(GO:0070548) |
0.0 | 1.7 | GO:0003774 | motor activity(GO:0003774) |
0.0 | 0.4 | GO:0005247 | voltage-gated chloride channel activity(GO:0005247) |
0.0 | 0.4 | GO:0019841 | retinol binding(GO:0019841) |
0.0 | 1.3 | GO:0016831 | carboxy-lyase activity(GO:0016831) |
0.0 | 0.1 | GO:0071987 | WD40-repeat domain binding(GO:0071987) |
0.0 | 0.2 | GO:0102345 | 3-hydroxy-behenoyl-CoA dehydratase activity(GO:0102344) 3-hydroxy-lignoceroyl-CoA dehydratase activity(GO:0102345) |
0.0 | 0.7 | GO:0036002 | pre-mRNA binding(GO:0036002) |
0.0 | 0.1 | GO:0030235 | nitric-oxide synthase regulator activity(GO:0030235) |
0.0 | 0.2 | GO:0004523 | RNA-DNA hybrid ribonuclease activity(GO:0004523) |
0.0 | 0.2 | GO:0017040 | ceramidase activity(GO:0017040) |
0.0 | 0.2 | GO:0043008 | ATP-dependent protein binding(GO:0043008) |
0.0 | 0.1 | GO:0019961 | interferon binding(GO:0019961) |
0.0 | 0.4 | GO:0035035 | histone acetyltransferase binding(GO:0035035) |
0.0 | 0.4 | GO:0008796 | bis(5'-nucleosyl)-tetraphosphatase activity(GO:0008796) |
0.0 | 0.3 | GO:0050998 | nitric-oxide synthase binding(GO:0050998) |
0.0 | 0.8 | GO:0046961 | proton-transporting ATPase activity, rotational mechanism(GO:0046961) |
0.0 | 0.1 | GO:0003976 | UDP-N-acetylglucosamine-lysosomal-enzyme N-acetylglucosaminephosphotransferase activity(GO:0003976) |
0.0 | 0.1 | GO:0070492 | oligosaccharide binding(GO:0070492) |
0.0 | 0.0 | GO:0046848 | hydroxyapatite binding(GO:0046848) |
0.0 | 0.5 | GO:0008409 | 5'-3' exonuclease activity(GO:0008409) |
0.0 | 0.5 | GO:0030742 | GTP-dependent protein binding(GO:0030742) |
0.0 | 0.1 | GO:0017150 | tRNA dihydrouridine synthase activity(GO:0017150) |
0.0 | 0.2 | GO:0047035 | testosterone dehydrogenase (NAD+) activity(GO:0047035) |
0.0 | 0.1 | GO:0050508 | glucuronosyl-N-acetylglucosaminyl-proteoglycan 4-alpha-N-acetylglucosaminyltransferase activity(GO:0050508) |
0.0 | 0.3 | GO:0001618 | virus receptor activity(GO:0001618) |
0.0 | 0.3 | GO:0016646 | oxidoreductase activity, acting on the CH-NH group of donors, NAD or NADP as acceptor(GO:0016646) |
0.0 | 0.1 | GO:0015065 | uridine nucleotide receptor activity(GO:0015065) G-protein coupled pyrimidinergic nucleotide receptor activity(GO:0071553) |
0.0 | 0.3 | GO:0016494 | C-X-C chemokine receptor activity(GO:0016494) |
0.0 | 0.2 | GO:0003747 | translation release factor activity(GO:0003747) translation termination factor activity(GO:0008079) |
0.0 | 0.1 | GO:0016892 | endoribonuclease activity, producing 3'-phosphomonoesters(GO:0016892) |
0.0 | 0.1 | GO:0051434 | BH3 domain binding(GO:0051434) |
0.0 | 0.5 | GO:0005547 | phosphatidylinositol-3,4,5-trisphosphate binding(GO:0005547) |
0.0 | 0.2 | GO:0004000 | adenosine deaminase activity(GO:0004000) |
0.0 | 0.9 | GO:0005080 | protein kinase C binding(GO:0005080) |
0.0 | 0.2 | GO:0019203 | carbohydrate phosphatase activity(GO:0019203) |
0.0 | 1.1 | GO:0043022 | ribosome binding(GO:0043022) |
0.0 | 1.3 | GO:0042826 | histone deacetylase binding(GO:0042826) |
0.0 | 0.1 | GO:0004103 | choline kinase activity(GO:0004103) |
0.0 | 0.2 | GO:0030368 | interleukin-17 receptor activity(GO:0030368) |
0.0 | 0.6 | GO:0003755 | peptidyl-prolyl cis-trans isomerase activity(GO:0003755) |
0.0 | 0.1 | GO:0004075 | biotin carboxylase activity(GO:0004075) |
0.0 | 1.2 | GO:0004715 | non-membrane spanning protein tyrosine kinase activity(GO:0004715) |
0.0 | 0.2 | GO:0048407 | platelet-derived growth factor binding(GO:0048407) |
0.0 | 0.3 | GO:0050656 | 3'-phosphoadenosine 5'-phosphosulfate binding(GO:0050656) |
0.0 | 0.0 | GO:0019763 | immunoglobulin receptor activity(GO:0019763) |
0.0 | 0.2 | GO:0017166 | vinculin binding(GO:0017166) |
0.0 | 1.1 | GO:0004402 | histone acetyltransferase activity(GO:0004402) |
0.0 | 0.1 | GO:0043199 | sulfate binding(GO:0043199) |
0.0 | 0.4 | GO:0016813 | hydrolase activity, acting on carbon-nitrogen (but not peptide) bonds, in linear amidines(GO:0016813) |
0.0 | 0.3 | GO:0043325 | phosphatidylinositol-3,4-bisphosphate binding(GO:0043325) |
0.0 | 0.5 | GO:0008601 | protein phosphatase type 2A regulator activity(GO:0008601) |
0.0 | 0.9 | GO:0004177 | aminopeptidase activity(GO:0004177) |
0.0 | 0.2 | GO:0005159 | insulin-like growth factor receptor binding(GO:0005159) |
0.0 | 2.4 | GO:0101005 | thiol-dependent ubiquitinyl hydrolase activity(GO:0036459) ubiquitinyl hydrolase activity(GO:0101005) |
0.0 | 1.4 | GO:0005201 | extracellular matrix structural constituent(GO:0005201) |
0.0 | 0.1 | GO:0016715 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, reduced ascorbate as one donor, and incorporation of one atom of oxygen(GO:0016715) |
0.0 | 1.0 | GO:0003923 | GPI-anchor transamidase activity(GO:0003923) |
0.0 | 0.1 | GO:0008823 | cupric reductase activity(GO:0008823) ferric-chelate reductase (NADPH) activity(GO:0052851) |
0.0 | 0.5 | GO:0001530 | lipopolysaccharide binding(GO:0001530) |
0.0 | 0.1 | GO:0008898 | S-adenosylmethionine-homocysteine S-methyltransferase activity(GO:0008898) |
0.0 | 0.2 | GO:0051861 | glycolipid binding(GO:0051861) |
0.0 | 0.3 | GO:0004383 | guanylate cyclase activity(GO:0004383) |
0.0 | 0.0 | GO:0070180 | large ribosomal subunit rRNA binding(GO:0070180) |
0.0 | 0.6 | GO:0000049 | tRNA binding(GO:0000049) |
0.0 | 0.1 | GO:0052650 | NADP-retinol dehydrogenase activity(GO:0052650) |
0.0 | 0.5 | GO:0015238 | drug transmembrane transporter activity(GO:0015238) |
0.0 | 0.1 | GO:0048248 | CXCR3 chemokine receptor binding(GO:0048248) |
0.0 | 0.3 | GO:0008327 | methyl-CpG binding(GO:0008327) |
0.0 | 0.8 | GO:0016655 | oxidoreductase activity, acting on NAD(P)H, quinone or similar compound as acceptor(GO:0016655) |
0.0 | 0.6 | GO:0031369 | translation initiation factor binding(GO:0031369) |
0.0 | 0.1 | GO:0047238 | glucuronosyl-N-acetylgalactosaminyl-proteoglycan 4-beta-N-acetylgalactosaminyltransferase activity(GO:0047238) |
0.0 | 0.2 | GO:0033691 | sialic acid binding(GO:0033691) |
0.0 | 0.1 | GO:0032052 | bile acid binding(GO:0032052) |
0.0 | 0.1 | GO:0005166 | neurotrophin p75 receptor binding(GO:0005166) |
0.0 | 0.1 | GO:0070996 | type 1 melanocortin receptor binding(GO:0070996) |
0.0 | 0.2 | GO:0016886 | ligase activity, forming phosphoric ester bonds(GO:0016886) |
0.0 | 0.1 | GO:0008353 | RNA polymerase II carboxy-terminal domain kinase activity(GO:0008353) |
0.0 | 0.1 | GO:0000980 | RNA polymerase II distal enhancer sequence-specific DNA binding(GO:0000980) |
0.0 | 6.1 | GO:0004252 | serine-type endopeptidase activity(GO:0004252) |
0.0 | 0.1 | GO:0034511 | U3 snoRNA binding(GO:0034511) |
0.0 | 0.2 | GO:0050700 | CARD domain binding(GO:0050700) |
0.0 | 0.1 | GO:0005021 | vascular endothelial growth factor-activated receptor activity(GO:0005021) |
0.0 | 2.3 | GO:0001078 | transcriptional repressor activity, RNA polymerase II core promoter proximal region sequence-specific binding(GO:0001078) |
0.0 | 0.7 | GO:0005504 | fatty acid binding(GO:0005504) |
0.0 | 0.0 | GO:0035197 | siRNA binding(GO:0035197) unmethylated CpG binding(GO:0045322) |
0.0 | 0.1 | GO:0008312 | 7S RNA binding(GO:0008312) |
0.0 | 0.0 | GO:0030792 | methylarsonite methyltransferase activity(GO:0030792) |
0.0 | 0.4 | GO:0005149 | interleukin-1 receptor binding(GO:0005149) |
0.0 | 0.3 | GO:0022889 | L-serine transmembrane transporter activity(GO:0015194) serine transmembrane transporter activity(GO:0022889) |
0.0 | 0.8 | GO:0035064 | methylated histone binding(GO:0035064) |
0.0 | 0.1 | GO:0015198 | oligopeptide transporter activity(GO:0015198) |
0.0 | 1.3 | GO:0004896 | cytokine receptor activity(GO:0004896) |
0.0 | 0.3 | GO:0004865 | protein serine/threonine phosphatase inhibitor activity(GO:0004865) |
0.0 | 0.0 | GO:0046979 | TAP1 binding(GO:0046978) TAP2 binding(GO:0046979) |
0.0 | 0.1 | GO:0048185 | activin binding(GO:0048185) |
0.0 | 0.3 | GO:0048038 | quinone binding(GO:0048038) |
0.0 | 0.2 | GO:1990841 | promoter-specific chromatin binding(GO:1990841) |
0.0 | 0.2 | GO:0008454 | alpha-1,3-mannosylglycoprotein 4-beta-N-acetylglucosaminyltransferase activity(GO:0008454) |
0.0 | 0.1 | GO:0008970 | phosphatidylcholine 1-acylhydrolase activity(GO:0008970) |
0.0 | 0.1 | GO:1990460 | leptin receptor binding(GO:1990460) |
0.0 | 0.1 | GO:0005499 | vitamin D binding(GO:0005499) |
0.0 | 0.1 | GO:0032036 | myosin heavy chain binding(GO:0032036) |
0.0 | 0.2 | GO:0004977 | melanocortin receptor activity(GO:0004977) |
0.0 | 0.3 | GO:0005326 | neurotransmitter transporter activity(GO:0005326) |
0.0 | 0.1 | GO:0042054 | histone methyltransferase activity(GO:0042054) |
0.0 | 0.5 | GO:0015485 | cholesterol binding(GO:0015485) |
0.0 | 1.7 | GO:0004702 | receptor signaling protein serine/threonine kinase activity(GO:0004702) |
0.0 | 0.2 | GO:0005315 | inorganic phosphate transmembrane transporter activity(GO:0005315) |
0.0 | 0.2 | GO:0008121 | ubiquinol-cytochrome-c reductase activity(GO:0008121) oxidoreductase activity, acting on diphenols and related substances as donors, cytochrome as acceptor(GO:0016681) |
0.0 | 0.0 | GO:0071617 | lysophospholipid acyltransferase activity(GO:0071617) |
0.0 | 0.1 | GO:0030350 | iron-responsive element binding(GO:0030350) |
0.0 | 0.1 | GO:0004536 | deoxyribonuclease activity(GO:0004536) |
0.0 | 0.1 | GO:0046912 | transferase activity, transferring acyl groups, acyl groups converted into alkyl on transfer(GO:0046912) |
0.0 | 0.1 | GO:0050649 | testosterone 6-beta-hydroxylase activity(GO:0050649) |
0.0 | 0.1 | GO:0042134 | rRNA primary transcript binding(GO:0042134) |
0.0 | 0.2 | GO:0019213 | deacetylase activity(GO:0019213) |
0.0 | 0.1 | GO:0015252 | hydrogen ion channel activity(GO:0015252) |
0.0 | 0.2 | GO:0045236 | CXCR chemokine receptor binding(GO:0045236) |
0.0 | 0.6 | GO:0048365 | Rac GTPase binding(GO:0048365) |
0.0 | 0.1 | GO:0005105 | type 1 fibroblast growth factor receptor binding(GO:0005105) |
0.0 | 0.3 | GO:0070325 | lipoprotein particle receptor binding(GO:0070325) |
0.0 | 0.2 | GO:0031996 | thioesterase binding(GO:0031996) |
0.0 | 0.1 | GO:0004844 | uracil DNA N-glycosylase activity(GO:0004844) deaminated base DNA N-glycosylase activity(GO:0097506) |
0.0 | 0.1 | GO:0019864 | IgG binding(GO:0019864) |
0.0 | 0.5 | GO:0004521 | endoribonuclease activity(GO:0004521) |
0.0 | 2.4 | GO:0004867 | serine-type endopeptidase inhibitor activity(GO:0004867) |
0.0 | 1.3 | GO:0003713 | transcription coactivator activity(GO:0003713) |
0.0 | 0.0 | GO:0048406 | nerve growth factor binding(GO:0048406) |
0.0 | 0.8 | GO:0050253 | retinyl-palmitate esterase activity(GO:0050253) |
0.0 | 1.5 | GO:0000149 | SNARE binding(GO:0000149) |
0.0 | 0.1 | GO:0004859 | phospholipase inhibitor activity(GO:0004859) |
0.0 | 0.1 | GO:0016421 | CoA carboxylase activity(GO:0016421) |
0.0 | 0.0 | GO:0008308 | voltage-gated anion channel activity(GO:0008308) |
0.0 | 0.6 | GO:0016836 | hydro-lyase activity(GO:0016836) |
0.0 | 0.0 | GO:0070579 | methylcytosine dioxygenase activity(GO:0070579) |
0.0 | 0.1 | GO:0004582 | dolichyl-phosphate beta-D-mannosyltransferase activity(GO:0004582) |
0.0 | 0.8 | GO:0004722 | protein serine/threonine phosphatase activity(GO:0004722) |
0.0 | 0.0 | GO:0031432 | titin binding(GO:0031432) |
0.0 | 0.1 | GO:0008900 | hydrogen:potassium-exchanging ATPase activity(GO:0008900) |
0.0 | 0.2 | GO:0001786 | phosphatidylserine binding(GO:0001786) |
0.0 | 0.3 | GO:0016641 | oxidoreductase activity, acting on the CH-NH2 group of donors, oxygen as acceptor(GO:0016641) |
0.0 | 0.2 | GO:0016861 | intramolecular oxidoreductase activity, interconverting aldoses and ketoses(GO:0016861) |
0.0 | 0.1 | GO:0035381 | extracellular ATP-gated cation channel activity(GO:0004931) ATP-gated ion channel activity(GO:0035381) |
0.0 | 0.0 | GO:0045340 | mercury ion binding(GO:0045340) |
0.0 | 0.1 | GO:0044548 | S100 protein binding(GO:0044548) |
0.0 | 0.1 | GO:0005146 | leukemia inhibitory factor receptor binding(GO:0005146) |
0.0 | 0.2 | GO:0005521 | lamin binding(GO:0005521) |
0.0 | 0.1 | GO:0030291 | protein serine/threonine kinase inhibitor activity(GO:0030291) |
0.0 | 0.0 | GO:0004345 | glucose-6-phosphate dehydrogenase activity(GO:0004345) |
0.0 | 0.0 | GO:0004630 | phospholipase D activity(GO:0004630) |
0.0 | 1.8 | GO:0020037 | heme binding(GO:0020037) tetrapyrrole binding(GO:0046906) |
0.0 | 0.1 | GO:0070182 | DNA polymerase binding(GO:0070182) |
0.0 | 2.8 | GO:0016758 | transferase activity, transferring hexosyl groups(GO:0016758) |
0.0 | 0.0 | GO:0008193 | tRNA guanylyltransferase activity(GO:0008193) |
0.0 | 0.0 | GO:0080130 | L-phenylalanine:2-oxoglutarate aminotransferase activity(GO:0080130) |
0.0 | 0.5 | GO:0019208 | phosphatase regulator activity(GO:0019208) |
0.0 | 0.1 | GO:0030169 | low-density lipoprotein particle binding(GO:0030169) |
0.0 | 0.1 | GO:0016849 | phosphorus-oxygen lyase activity(GO:0016849) |
0.0 | 0.1 | GO:0019215 | intermediate filament binding(GO:0019215) |
0.0 | 0.2 | GO:0015279 | store-operated calcium channel activity(GO:0015279) |
0.0 | 1.2 | GO:0004519 | endonuclease activity(GO:0004519) |
0.0 | 0.1 | GO:0050733 | RS domain binding(GO:0050733) |
0.0 | 0.1 | GO:0030306 | ADP-ribosylation factor binding(GO:0030306) |
0.0 | 0.2 | GO:0015095 | magnesium ion transmembrane transporter activity(GO:0015095) |
0.0 | 1.2 | GO:0004553 | hydrolase activity, hydrolyzing O-glycosyl compounds(GO:0004553) |
0.0 | 0.1 | GO:0001054 | RNA polymerase I activity(GO:0001054) |
0.0 | 0.1 | GO:0016840 | carbon-nitrogen lyase activity(GO:0016840) |
0.0 | 0.2 | GO:0008484 | sulfuric ester hydrolase activity(GO:0008484) |
0.0 | 0.2 | GO:0030955 | potassium ion binding(GO:0030955) |
0.0 | 1.1 | GO:0051020 | GTPase binding(GO:0051020) |
0.0 | 0.3 | GO:0005507 | copper ion binding(GO:0005507) |
0.0 | 0.1 | GO:0003956 | NAD(P)+-protein-arginine ADP-ribosyltransferase activity(GO:0003956) |
0.0 | 0.0 | GO:0032404 | mismatch repair complex binding(GO:0032404) |
0.0 | 0.1 | GO:0051400 | BH domain binding(GO:0051400) |
0.0 | 0.0 | GO:0047045 | testosterone 17-beta-dehydrogenase (NADP+) activity(GO:0047045) |
0.0 | 0.0 | GO:0098518 | polynucleotide phosphatase activity(GO:0098518) |
0.0 | 0.3 | GO:0005212 | structural constituent of eye lens(GO:0005212) |
0.0 | 0.5 | GO:0042393 | histone binding(GO:0042393) |
0.0 | 0.1 | GO:0019865 | immunoglobulin binding(GO:0019865) |
0.0 | 0.7 | GO:0008234 | cysteine-type peptidase activity(GO:0008234) |
0.0 | 0.0 | GO:0015093 | ferrous iron transmembrane transporter activity(GO:0015093) |
0.0 | 0.0 | GO:0004949 | cannabinoid receptor activity(GO:0004949) |
0.0 | 0.0 | GO:0015321 | sodium-dependent phosphate transmembrane transporter activity(GO:0015321) |
0.0 | 0.0 | GO:0019002 | GMP binding(GO:0019002) |
0.0 | 0.0 | GO:0015248 | sterol transporter activity(GO:0015248) |
0.0 | 0.0 | GO:0043422 | protein kinase B binding(GO:0043422) |
0.0 | 0.1 | GO:0004028 | 3-chloroallyl aldehyde dehydrogenase activity(GO:0004028) |
0.0 | 0.0 | GO:0018556 | 2,3-dihydroxy DDT 1,2-dioxygenase activity(GO:0018542) phenanthrene dioxygenase activity(GO:0018555) 2,2',3-trihydroxybiphenyl dioxygenase activity(GO:0018556) 1,2-dihydroxyfluorene 1,1-alpha-dioxygenase activity(GO:0018557) 5,6-dihydroxy-3-methyl-2-oxo-1,2-dihydroquinoline dioxygenase activity(GO:0018558) 1,1-dichloro-2-(dihydroxy-4-chlorophenyl)-(4-chlorophenyl)ethene 1,2-dioxygenase activity(GO:0018559) protocatechuate 3,4-dioxygenase type II activity(GO:0018560) 2'-aminobiphenyl-2,3-diol 1,2-dioxygenase activity(GO:0018561) 3,4-dihydroxyfluorene 4,4-alpha-dioxygenase activity(GO:0018562) 2,3-dihydroxy-ethylbenzene 1,2-dioxygenase activity(GO:0018563) carbazole 1,9a-dioxygenase activity(GO:0018564) dihydroxydibenzothiophene dioxygenase activity(GO:0018565) 1,2-dihydroxynaphthalene-6-sulfonate 1,8a-dioxygenase activity(GO:0018566) styrene dioxygenase activity(GO:0018567) 3,4-dihydroxyphenanthrene dioxygenase activity(GO:0018568) hydroquinone 1,2-dioxygenase activity(GO:0018569) p-cumate 2,3-dioxygenase activity(GO:0018570) 2,3-dihydroxy-p-cumate dioxygenase activity(GO:0018571) 3,5-dichlorocatechol 1,2-dioxygenase activity(GO:0018572) 2-aminophenol 1,6-dioxygenase activity(GO:0018573) 2,6-dichloro-p-hydroquinone 1,2-dioxygenase activity(GO:0018574) chlorocatechol 1,2-dioxygenase activity(GO:0018575) catechol dioxygenase activity(GO:0019114) dihydroxyfluorene dioxygenase activity(GO:0019117) 5-aminosalicylate dioxygenase activity(GO:0034543) 3-hydroxy-2-naphthoate 2,3-dioxygenase activity(GO:0034803) benzo(a)pyrene 11,12-dioxygenase activity(GO:0034806) benzo(a)pyrene 4,5-dioxygenase activity(GO:0034808) 4,5-dihydroxybenzo(a)pyrene dioxygenase activity(GO:0034810) benzo(a)pyrene 9,10-dioxygenase activity(GO:0034811) 9,10-dihydroxybenzo(a)pyrene dioxygenase activity(GO:0034812) benzo(a)pyrene 7,8-dioxygenase activity(GO:0034813) 7,8-dihydroxy benzo(a)pyrene dioxygenase activity(GO:0034814) 1,2-dihydroxy-5,6,7,8-tetrahydronaphthalene extradiol dioxygenase activity(GO:0034827) 2-mercaptobenzothiazole dioxygenase activity(GO:0034834) pyridine-3,4-diol dioxygenase activity(GO:0034895) pyrene dioxygenase activity(GO:0034920) 4,5-dihydroxypyrene dioxygenase activity(GO:0034922) phenanthrene-4-carboxylate dioxygenase activity(GO:0034934) tetrachlorobenzene dioxygenase activity(GO:0034935) 4,6-dichloro-3-methylcatechol 1,2-dioxygenase activity(GO:0034936) 2,3-dihydroxydiphenyl ether dioxygenase activity(GO:0034955) diphenyl ether 1,2-dioxygenase activity(GO:0034956) arachidonate 8(S)-lipoxygenase activity(GO:0036403) 4-hydroxycatechol 1,2-dioxygenase activity(GO:0047074) |
0.0 | 0.0 | GO:0016971 | flavin-linked sulfhydryl oxidase activity(GO:0016971) |
0.0 | 0.0 | GO:0031871 | proteinase activated receptor binding(GO:0031871) |
0.0 | 0.1 | GO:0035325 | Toll-like receptor binding(GO:0035325) |
0.0 | 0.0 | GO:0016520 | growth hormone-releasing hormone receptor activity(GO:0016520) |
0.0 | 0.0 | GO:0001591 | dopamine neurotransmitter receptor activity, coupled via Gi/Go(GO:0001591) |
0.0 | 0.1 | GO:0001515 | opioid peptide activity(GO:0001515) |
0.0 | 0.1 | GO:0043023 | ribosomal large subunit binding(GO:0043023) |
0.0 | 0.1 | GO:0008467 | [heparan sulfate]-glucosamine 3-sulfotransferase 1 activity(GO:0008467) |
0.0 | 0.1 | GO:0033170 | DNA clamp loader activity(GO:0003689) protein-DNA loading ATPase activity(GO:0033170) |
0.0 | 0.0 | GO:0036137 | kynurenine-oxoglutarate transaminase activity(GO:0016212) kynurenine aminotransferase activity(GO:0036137) |
0.0 | 0.0 | GO:0048027 | mRNA 5'-UTR binding(GO:0048027) |
0.0 | 0.0 | GO:0051373 | FATZ binding(GO:0051373) |
0.0 | 0.0 | GO:0004663 | Rab geranylgeranyltransferase activity(GO:0004663) |
0.0 | 0.5 | GO:0008565 | protein transporter activity(GO:0008565) |
0.0 | 0.6 | GO:0015405 | primary active transmembrane transporter activity(GO:0015399) P-P-bond-hydrolysis-driven transmembrane transporter activity(GO:0015405) |
0.0 | 0.9 | GO:0005125 | cytokine activity(GO:0005125) |
0.0 | 0.0 | GO:0071209 | U7 snRNA binding(GO:0071209) |
0.0 | 0.0 | GO:0004974 | leukotriene receptor activity(GO:0004974) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.3 | 4.2 | PID IL5 PATHWAY | IL5-mediated signaling events |
0.3 | 5.4 | ST INTERLEUKIN 4 PATHWAY | Interleukin 4 (IL-4) Pathway |
0.3 | 2.5 | PID VEGF VEGFR PATHWAY | VEGF and VEGFR signaling network |
0.2 | 4.9 | PID S1P META PATHWAY | Sphingosine 1-phosphate (S1P) pathway |
0.2 | 3.7 | SA CASPASE CASCADE | Apoptosis is mediated by caspases, cysteine proteases arranged in a proteolytic cascade. |
0.2 | 2.9 | PID IL2 STAT5 PATHWAY | IL2 signaling events mediated by STAT5 |
0.2 | 8.4 | PID HNF3B PATHWAY | FOXA2 and FOXA3 transcription factor networks |
0.2 | 1.0 | PID NFKAPPAB ATYPICAL PATHWAY | Atypical NF-kappaB pathway |
0.2 | 4.6 | PID RXR VDR PATHWAY | RXR and RAR heterodimerization with other nuclear receptor |
0.2 | 0.6 | PID THROMBIN PAR1 PATHWAY | PAR1-mediated thrombin signaling events |
0.2 | 3.6 | PID INTEGRIN A9B1 PATHWAY | Alpha9 beta1 integrin signaling events |
0.2 | 2.0 | PID IL3 PATHWAY | IL3-mediated signaling events |
0.2 | 2.9 | PID IGF1 PATHWAY | IGF1 pathway |
0.2 | 2.9 | PID P38 MK2 PATHWAY | p38 signaling mediated by MAPKAP kinases |
0.2 | 0.3 | PID GMCSF PATHWAY | GMCSF-mediated signaling events |
0.2 | 4.2 | PID TOLL ENDOGENOUS PATHWAY | Endogenous TLR signaling |
0.2 | 2.6 | PID PDGFRA PATHWAY | PDGFR-alpha signaling pathway |
0.2 | 0.8 | PID TCR RAS PATHWAY | Ras signaling in the CD4+ TCR pathway |
0.2 | 2.9 | PID TCR CALCIUM PATHWAY | Calcium signaling in the CD4+ TCR pathway |
0.2 | 1.5 | PID P38 GAMMA DELTA PATHWAY | Signaling mediated by p38-gamma and p38-delta |
0.1 | 3.9 | PID ERBB2 ERBB3 PATHWAY | ErbB2/ErbB3 signaling events |
0.1 | 1.6 | SA REG CASCADE OF CYCLIN EXPR | Expression of cyclins regulates progression through the cell cycle by activating cyclin-dependent kinases. |
0.1 | 2.7 | ST WNT CA2 CYCLIC GMP PATHWAY | Wnt/Ca2+/cyclic GMP signaling. |
0.1 | 3.4 | PID INTEGRIN2 PATHWAY | Beta2 integrin cell surface interactions |
0.1 | 2.0 | PID EPO PATHWAY | EPO signaling pathway |
0.1 | 9.3 | PID PDGFRB PATHWAY | PDGFR-beta signaling pathway |
0.1 | 1.5 | PID IL2 PI3K PATHWAY | IL2 signaling events mediated by PI3K |
0.1 | 0.9 | PID IL2 1PATHWAY | IL2-mediated signaling events |
0.1 | 1.6 | PID AMB2 NEUTROPHILS PATHWAY | amb2 Integrin signaling |
0.1 | 0.2 | SA G2 AND M PHASES | Cdc25 activates the cdc2/cyclin B complex to induce the G2/M transition. |
0.1 | 2.5 | PID WNT NONCANONICAL PATHWAY | Noncanonical Wnt signaling pathway |
0.1 | 0.8 | PID AVB3 OPN PATHWAY | Osteopontin-mediated events |
0.1 | 1.2 | PID ALK2 PATHWAY | ALK2 signaling events |
0.1 | 3.8 | PID CASPASE PATHWAY | Caspase cascade in apoptosis |
0.1 | 6.3 | PID HDAC CLASSI PATHWAY | Signaling events mediated by HDAC Class I |
0.1 | 1.0 | PID RETINOIC ACID PATHWAY | Retinoic acid receptors-mediated signaling |
0.1 | 2.5 | PID HIF2PATHWAY | HIF-2-alpha transcription factor network |
0.1 | 2.1 | PID FCER1 PATHWAY | Fc-epsilon receptor I signaling in mast cells |
0.1 | 0.9 | ST PHOSPHOINOSITIDE 3 KINASE PATHWAY | PI3K Pathway |
0.1 | 0.7 | ST FAS SIGNALING PATHWAY | Fas Signaling Pathway |
0.1 | 2.6 | PID ATR PATHWAY | ATR signaling pathway |
0.1 | 3.9 | PID DELTA NP63 PATHWAY | Validated transcriptional targets of deltaNp63 isoforms |
0.1 | 1.9 | PID FOXM1 PATHWAY | FOXM1 transcription factor network |
0.1 | 0.2 | ST JAK STAT PATHWAY | Jak-STAT Pathway |
0.1 | 3.4 | PID PLK1 PATHWAY | PLK1 signaling events |
0.1 | 2.0 | PID ATF2 PATHWAY | ATF-2 transcription factor network |
0.1 | 0.8 | PID IFNG PATHWAY | IFN-gamma pathway |
0.1 | 0.3 | PID PI3KCI AKT PATHWAY | Class I PI3K signaling events mediated by Akt |
0.1 | 1.1 | PID FRA PATHWAY | Validated transcriptional targets of AP1 family members Fra1 and Fra2 |
0.1 | 2.5 | PID FGF PATHWAY | FGF signaling pathway |
0.1 | 0.7 | PID NEPHRIN NEPH1 PATHWAY | Nephrin/Neph1 signaling in the kidney podocyte |
0.1 | 0.4 | PID CD40 PATHWAY | CD40/CD40L signaling |
0.1 | 1.8 | PID AURORA B PATHWAY | Aurora B signaling |
0.1 | 1.5 | PID TNF PATHWAY | TNF receptor signaling pathway |
0.1 | 0.3 | PID HIF1A PATHWAY | Hypoxic and oxygen homeostasis regulation of HIF-1-alpha |
0.1 | 4.7 | PID MYC ACTIV PATHWAY | Validated targets of C-MYC transcriptional activation |
0.1 | 1.8 | PID INTEGRIN3 PATHWAY | Beta3 integrin cell surface interactions |
0.1 | 0.5 | PID FAK PATHWAY | Signaling events mediated by focal adhesion kinase |
0.1 | 1.3 | PID EPHB FWD PATHWAY | EPHB forward signaling |
0.1 | 0.5 | PID NFAT 3PATHWAY | Role of Calcineurin-dependent NFAT signaling in lymphocytes |
0.1 | 1.6 | PID AP1 PATHWAY | AP-1 transcription factor network |
0.1 | 0.5 | PID HDAC CLASSIII PATHWAY | Signaling events mediated by HDAC Class III |
0.1 | 0.7 | PID P38 MKK3 6PATHWAY | p38 MAPK signaling pathway |
0.1 | 2.2 | PID MTOR 4PATHWAY | mTOR signaling pathway |
0.1 | 0.6 | ST P38 MAPK PATHWAY | p38 MAPK Pathway |
0.1 | 1.9 | PID P53 REGULATION PATHWAY | p53 pathway |
0.1 | 0.7 | PID IL1 PATHWAY | IL1-mediated signaling events |
0.1 | 0.8 | PID RB 1PATHWAY | Regulation of retinoblastoma protein |
0.1 | 1.7 | PID CD8 TCR DOWNSTREAM PATHWAY | Downstream signaling in naïve CD8+ T cells |
0.1 | 2.6 | PID AR PATHWAY | Coregulation of Androgen receptor activity |
0.1 | 0.1 | SIG CD40PATHWAYMAP | Genes related to CD40 signaling |
0.1 | 1.1 | PID VEGFR1 2 PATHWAY | Signaling events mediated by VEGFR1 and VEGFR2 |
0.1 | 0.8 | PID LPA4 PATHWAY | LPA4-mediated signaling events |
0.1 | 0.1 | SA FAS SIGNALING | The TNF-type receptor Fas induces apoptosis on ligand binding. |
0.1 | 1.6 | PID REG GR PATHWAY | Glucocorticoid receptor regulatory network |
0.1 | 1.7 | PID P73PATHWAY | p73 transcription factor network |
0.1 | 2.4 | PID ERA GENOMIC PATHWAY | Validated nuclear estrogen receptor alpha network |
0.1 | 0.1 | PID EPHA2 FWD PATHWAY | EPHA2 forward signaling |
0.1 | 0.1 | SA G1 AND S PHASES | Cdk2, 4, and 6 bind cyclin D in G1, while cdk2/cyclin E promotes the G1/S transition. |
0.1 | 0.3 | PID FAS PATHWAY | FAS (CD95) signaling pathway |
0.1 | 0.5 | PID ANGIOPOIETIN RECEPTOR PATHWAY | Angiopoietin receptor Tie2-mediated signaling |
0.1 | 0.2 | ST B CELL ANTIGEN RECEPTOR | B Cell Antigen Receptor |
0.1 | 0.1 | PID S1P S1P3 PATHWAY | S1P3 pathway |
0.1 | 0.6 | ST GA13 PATHWAY | G alpha 13 Pathway |
0.1 | 0.5 | PID ERBB1 DOWNSTREAM PATHWAY | ErbB1 downstream signaling |
0.0 | 1.2 | PID BMP PATHWAY | BMP receptor signaling |
0.0 | 0.0 | PID P38 ALPHA BETA PATHWAY | Regulation of p38-alpha and p38-beta |
0.0 | 0.3 | SIG BCR SIGNALING PATHWAY | Members of the BCR signaling pathway |
0.0 | 0.1 | PID AR NONGENOMIC PATHWAY | Nongenotropic Androgen signaling |
0.0 | 1.3 | PID E2F PATHWAY | E2F transcription factor network |
0.0 | 1.5 | NABA PROTEOGLYCANS | Genes encoding proteoglycans |
0.0 | 0.6 | PID RAC1 PATHWAY | RAC1 signaling pathway |
0.0 | 0.6 | PID ATM PATHWAY | ATM pathway |
0.0 | 0.1 | SA B CELL RECEPTOR COMPLEXES | Antigen binding to B cell receptors activates protein tyrosine kinases, such as the Src family, which ultimate activate MAP kinases. |
0.0 | 0.9 | PID CONE PATHWAY | Visual signal transduction: Cones |
0.0 | 0.5 | PID ALPHA SYNUCLEIN PATHWAY | Alpha-synuclein signaling |
0.0 | 0.1 | PID CDC42 PATHWAY | CDC42 signaling events |
0.0 | 0.4 | PID CIRCADIAN PATHWAY | Circadian rhythm pathway |
0.0 | 0.1 | SA PTEN PATHWAY | PTEN is a tumor suppressor that dephosphorylates the lipid messenger phosphatidylinositol triphosphate. |
0.0 | 2.1 | PID P53 DOWNSTREAM PATHWAY | Direct p53 effectors |
0.0 | 0.6 | PID IL4 2PATHWAY | IL4-mediated signaling events |
0.0 | 0.4 | PID ARF6 PATHWAY | Arf6 signaling events |
0.0 | 0.5 | PID IL23 PATHWAY | IL23-mediated signaling events |
0.0 | 0.1 | ST GA12 PATHWAY | G alpha 12 Pathway |
0.0 | 0.2 | ST ERK1 ERK2 MAPK PATHWAY | ERK1/ERK2 MAPK Pathway |
0.0 | 0.2 | SA MMP CYTOKINE CONNECTION | Cytokines can induce activation of matrix metalloproteinases, which degrade extracellular matrix. |
0.0 | 0.3 | PID DNA PK PATHWAY | DNA-PK pathway in nonhomologous end joining |
0.0 | 0.7 | PID MYC REPRESS PATHWAY | Validated targets of C-MYC transcriptional repression |
0.0 | 0.2 | ST JNK MAPK PATHWAY | JNK MAPK Pathway |
0.0 | 0.2 | PID IL12 2PATHWAY | IL12-mediated signaling events |
0.0 | 0.0 | PID MYC PATHWAY | C-MYC pathway |
0.0 | 4.8 | NABA ECM REGULATORS | Genes encoding enzymes and their regulators involved in the remodeling of the extracellular matrix |
0.0 | 0.1 | PID A6B1 A6B4 INTEGRIN PATHWAY | a6b1 and a6b4 Integrin signaling |
0.0 | 0.1 | SIG PIP3 SIGNALING IN B LYMPHOCYTES | Genes related to PIP3 signaling in B lymphocytes |
0.0 | 0.1 | PID NFKAPPAB CANONICAL PATHWAY | Canonical NF-kappaB pathway |
0.0 | 0.0 | PID VEGFR1 PATHWAY | VEGFR1 specific signals |
0.0 | 0.4 | PID HIF1 TFPATHWAY | HIF-1-alpha transcription factor network |
0.0 | 0.2 | PID BCR 5PATHWAY | BCR signaling pathway |
0.0 | 0.0 | PID TRAIL PATHWAY | TRAIL signaling pathway |
0.0 | 0.1 | PID INTEGRIN A4B1 PATHWAY | Alpha4 beta1 integrin signaling events |
0.0 | 0.1 | PID SYNDECAN 4 PATHWAY | Syndecan-4-mediated signaling events |
0.0 | 0.2 | PID PI3KCI PATHWAY | Class I PI3K signaling events |
0.0 | 0.0 | ST TYPE I INTERFERON PATHWAY | Type I Interferon (alpha/beta IFN) Pathway |
0.0 | 0.1 | PID CERAMIDE PATHWAY | Ceramide signaling pathway |
0.0 | 0.1 | PID UPA UPAR PATHWAY | Urokinase-type plasminogen activator (uPA) and uPAR-mediated signaling |
0.0 | 0.2 | PID FANCONI PATHWAY | Fanconi anemia pathway |
0.0 | 0.0 | PID IL8 CXCR1 PATHWAY | IL8- and CXCR1-mediated signaling events |
0.0 | 0.0 | ST TUMOR NECROSIS FACTOR PATHWAY | Tumor Necrosis Factor Pathway. |
0.0 | 0.0 | PID ER NONGENOMIC PATHWAY | Plasma membrane estrogen receptor signaling |
0.0 | 0.0 | PID ERB GENOMIC PATHWAY | Validated nuclear estrogen receptor beta network |
0.0 | 0.2 | PID CDC42 REG PATHWAY | Regulation of CDC42 activity |
0.0 | 0.1 | PID KIT PATHWAY | Signaling events mediated by Stem cell factor receptor (c-Kit) |
0.0 | 0.1 | PID IL6 7 PATHWAY | IL6-mediated signaling events |
0.0 | 0.0 | PID TCR JNK PATHWAY | JNK signaling in the CD4+ TCR pathway |
0.0 | 0.1 | PID ERBB4 PATHWAY | ErbB4 signaling events |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.6 | 0.6 | REACTOME APC CDC20 MEDIATED DEGRADATION OF NEK2A | Genes involved in APC-Cdc20 mediated degradation of Nek2A |
0.5 | 3.6 | REACTOME IRAK2 MEDIATED ACTIVATION OF TAK1 COMPLEX UPON TLR7 8 OR 9 STIMULATION | Genes involved in IRAK2 mediated activation of TAK1 complex upon TLR7/8 or 9 stimulation |
0.4 | 4.3 | REACTOME IL 7 SIGNALING | Genes involved in Interleukin-7 signaling |
0.4 | 3.9 | REACTOME SYNTHESIS OF PE | Genes involved in Synthesis of PE |
0.4 | 3.7 | REACTOME PASSIVE TRANSPORT BY AQUAPORINS | Genes involved in Passive Transport by Aquaporins |
0.4 | 4.3 | REACTOME PURINE SALVAGE | Genes involved in Purine salvage |
0.3 | 1.0 | REACTOME INFLUENZA VIRAL RNA TRANSCRIPTION AND REPLICATION | Genes involved in Influenza Viral RNA Transcription and Replication |
0.3 | 4.9 | REACTOME CHYLOMICRON MEDIATED LIPID TRANSPORT | Genes involved in Chylomicron-mediated lipid transport |
0.3 | 7.0 | REACTOME KERATAN SULFATE BIOSYNTHESIS | Genes involved in Keratan sulfate biosynthesis |
0.3 | 2.6 | REACTOME VEGF LIGAND RECEPTOR INTERACTIONS | Genes involved in VEGF ligand-receptor interactions |
0.3 | 2.9 | REACTOME BILE SALT AND ORGANIC ANION SLC TRANSPORTERS | Genes involved in Bile salt and organic anion SLC transporters |
0.3 | 2.6 | REACTOME REGULATION OF INSULIN SECRETION BY ACETYLCHOLINE | Genes involved in Regulation of Insulin Secretion by Acetylcholine |
0.3 | 2.8 | REACTOME SYNTHESIS OF PC | Genes involved in Synthesis of PC |
0.3 | 5.8 | REACTOME RORA ACTIVATES CIRCADIAN EXPRESSION | Genes involved in RORA Activates Circadian Expression |
0.2 | 3.5 | REACTOME METABOLISM OF PORPHYRINS | Genes involved in Metabolism of porphyrins |
0.2 | 2.2 | REACTOME SYNTHESIS OF BILE ACIDS AND BILE SALTS VIA 24 HYDROXYCHOLESTEROL | Genes involved in Synthesis of bile acids and bile salts via 24-hydroxycholesterol |
0.2 | 1.2 | REACTOME RNA POL I PROMOTER OPENING | Genes involved in RNA Polymerase I Promoter Opening |
0.2 | 0.2 | REACTOME ADP SIGNALLING THROUGH P2RY1 | Genes involved in ADP signalling through P2Y purinoceptor 1 |
0.2 | 2.0 | REACTOME LIPOPROTEIN METABOLISM | Genes involved in Lipoprotein metabolism |
0.2 | 2.4 | REACTOME TRAF3 DEPENDENT IRF ACTIVATION PATHWAY | Genes involved in TRAF3-dependent IRF activation pathway |
0.2 | 3.2 | REACTOME INTRINSIC PATHWAY | Genes involved in Intrinsic Pathway |
0.2 | 18.0 | REACTOME FACTORS INVOLVED IN MEGAKARYOCYTE DEVELOPMENT AND PLATELET PRODUCTION | Genes involved in Factors involved in megakaryocyte development and platelet production |
0.2 | 2.0 | REACTOME ASSOCIATION OF LICENSING FACTORS WITH THE PRE REPLICATIVE COMPLEX | Genes involved in Association of licensing factors with the pre-replicative complex |
0.2 | 4.1 | REACTOME SMAD2 SMAD3 SMAD4 HETEROTRIMER REGULATES TRANSCRIPTION | Genes involved in SMAD2/SMAD3:SMAD4 heterotrimer regulates transcription |
0.2 | 1.6 | REACTOME PHOSPHORYLATION OF CD3 AND TCR ZETA CHAINS | Genes involved in Phosphorylation of CD3 and TCR zeta chains |
0.2 | 4.0 | REACTOME G1 PHASE | Genes involved in G1 Phase |
0.2 | 1.4 | REACTOME REGULATION OF MRNA STABILITY BY PROTEINS THAT BIND AU RICH ELEMENTS | Genes involved in Regulation of mRNA Stability by Proteins that Bind AU-rich Elements |
0.2 | 1.9 | REACTOME VITAMIN B5 PANTOTHENATE METABOLISM | Genes involved in Vitamin B5 (pantothenate) metabolism |
0.2 | 1.5 | REACTOME HORMONE SENSITIVE LIPASE HSL MEDIATED TRIACYLGLYCEROL HYDROLYSIS | Genes involved in Hormone-sensitive lipase (HSL)-mediated triacylglycerol hydrolysis |
0.2 | 6.1 | REACTOME INTERFERON ALPHA BETA SIGNALING | Genes involved in Interferon alpha/beta signaling |
0.2 | 1.2 | REACTOME SIGNAL REGULATORY PROTEIN SIRP FAMILY INTERACTIONS | Genes involved in Signal regulatory protein (SIRP) family interactions |
0.2 | 4.4 | REACTOME INTRINSIC PATHWAY FOR APOPTOSIS | Genes involved in Intrinsic Pathway for Apoptosis |
0.2 | 1.8 | REACTOME ACTIVATED TAK1 MEDIATES P38 MAPK ACTIVATION | Genes involved in activated TAK1 mediates p38 MAPK activation |
0.2 | 1.6 | REACTOME REGULATION OF COMPLEMENT CASCADE | Genes involved in Regulation of Complement cascade |
0.2 | 1.6 | REACTOME HYALURONAN UPTAKE AND DEGRADATION | Genes involved in Hyaluronan uptake and degradation |
0.2 | 1.4 | REACTOME CASPASE MEDIATED CLEAVAGE OF CYTOSKELETAL PROTEINS | Genes involved in Caspase-mediated cleavage of cytoskeletal proteins |
0.2 | 0.9 | REACTOME ETHANOL OXIDATION | Genes involved in Ethanol oxidation |
0.2 | 1.7 | REACTOME ACTIVATION OF GENES BY ATF4 | Genes involved in Activation of Genes by ATF4 |
0.2 | 1.2 | REACTOME REGULATION OF KIT SIGNALING | Genes involved in Regulation of KIT signaling |
0.1 | 3.9 | REACTOME SPHINGOLIPID DE NOVO BIOSYNTHESIS | Genes involved in Sphingolipid de novo biosynthesis |
0.1 | 1.4 | REACTOME DEPOSITION OF NEW CENPA CONTAINING NUCLEOSOMES AT THE CENTROMERE | Genes involved in Deposition of New CENPA-containing Nucleosomes at the Centromere |
0.1 | 1.2 | REACTOME RECEPTOR LIGAND BINDING INITIATES THE SECOND PROTEOLYTIC CLEAVAGE OF NOTCH RECEPTOR | Genes involved in Receptor-ligand binding initiates the second proteolytic cleavage of Notch receptor |
0.1 | 3.2 | REACTOME TRANSFERRIN ENDOCYTOSIS AND RECYCLING | Genes involved in Transferrin endocytosis and recycling |
0.1 | 3.2 | REACTOME G PROTEIN BETA GAMMA SIGNALLING | Genes involved in G-protein beta:gamma signalling |
0.1 | 1.6 | REACTOME SEMA3A PAK DEPENDENT AXON REPULSION | Genes involved in Sema3A PAK dependent Axon repulsion |
0.1 | 3.1 | REACTOME PYRIMIDINE METABOLISM | Genes involved in Pyrimidine metabolism |
0.1 | 1.6 | REACTOME TGF BETA RECEPTOR SIGNALING IN EMT EPITHELIAL TO MESENCHYMAL TRANSITION | Genes involved in TGF-beta receptor signaling in EMT (epithelial to mesenchymal transition) |
0.1 | 0.5 | REACTOME HYALURONAN METABOLISM | Genes involved in Hyaluronan metabolism |
0.1 | 2.7 | REACTOME REGULATORY RNA PATHWAYS | Genes involved in Regulatory RNA pathways |
0.1 | 0.4 | REACTOME IL 6 SIGNALING | Genes involved in Interleukin-6 signaling |
0.1 | 1.0 | REACTOME MTORC1 MEDIATED SIGNALLING | Genes involved in mTORC1-mediated signalling |
0.1 | 0.3 | REACTOME SPRY REGULATION OF FGF SIGNALING | Genes involved in Spry regulation of FGF signaling |
0.1 | 0.9 | REACTOME CREATION OF C4 AND C2 ACTIVATORS | Genes involved in Creation of C4 and C2 activators |
0.1 | 2.7 | REACTOME CYTOSOLIC TRNA AMINOACYLATION | Genes involved in Cytosolic tRNA aminoacylation |
0.1 | 2.1 | REACTOME DEADENYLATION OF MRNA | Genes involved in Deadenylation of mRNA |
0.1 | 1.9 | REACTOME ZINC TRANSPORTERS | Genes involved in Zinc transporters |
0.1 | 1.8 | REACTOME DESTABILIZATION OF MRNA BY TRISTETRAPROLIN TTP | Genes involved in Destabilization of mRNA by Tristetraprolin (TTP) |
0.1 | 1.2 | REACTOME SOS MEDIATED SIGNALLING | Genes involved in SOS-mediated signalling |
0.1 | 3.1 | REACTOME STRIATED MUSCLE CONTRACTION | Genes involved in Striated Muscle Contraction |
0.1 | 1.6 | REACTOME RNA POL I TRANSCRIPTION TERMINATION | Genes involved in RNA Polymerase I Transcription Termination |
0.1 | 1.9 | REACTOME NEGATIVE REGULATORS OF RIG I MDA5 SIGNALING | Genes involved in Negative regulators of RIG-I/MDA5 signaling |
0.1 | 0.5 | REACTOME ABACAVIR TRANSPORT AND METABOLISM | Genes involved in Abacavir transport and metabolism |
0.1 | 1.1 | REACTOME TIE2 SIGNALING | Genes involved in Tie2 Signaling |
0.1 | 0.2 | REACTOME PEPTIDE CHAIN ELONGATION | Genes involved in Peptide chain elongation |
0.1 | 1.1 | REACTOME CS DS DEGRADATION | Genes involved in CS/DS degradation |
0.1 | 1.0 | REACTOME G1 S SPECIFIC TRANSCRIPTION | Genes involved in G1/S-Specific Transcription |
0.1 | 2.8 | REACTOME SYNTHESIS OF PA | Genes involved in Synthesis of PA |
0.1 | 7.9 | REACTOME MITOTIC PROMETAPHASE | Genes involved in Mitotic Prometaphase |
0.1 | 1.9 | REACTOME SIGNALING BY BMP | Genes involved in Signaling by BMP |
0.1 | 0.5 | REACTOME CTNNB1 PHOSPHORYLATION CASCADE | Genes involved in Beta-catenin phosphorylation cascade |
0.1 | 1.3 | REACTOME SIGNALING BY FGFR1 FUSION MUTANTS | Genes involved in Signaling by FGFR1 fusion mutants |
0.1 | 0.1 | REACTOME THROMBOXANE SIGNALLING THROUGH TP RECEPTOR | Genes involved in Thromboxane signalling through TP receptor |
0.1 | 1.2 | REACTOME RETROGRADE NEUROTROPHIN SIGNALLING | Genes involved in Retrograde neurotrophin signalling |
0.1 | 0.1 | REACTOME MRNA DECAY BY 3 TO 5 EXORIBONUCLEASE | Genes involved in mRNA Decay by 3' to 5' Exoribonuclease |
0.1 | 1.9 | REACTOME RNA POL II TRANSCRIPTION PRE INITIATION AND PROMOTER OPENING | Genes involved in RNA Polymerase II Transcription Pre-Initiation And Promoter Opening |
0.1 | 4.4 | REACTOME NUCLEAR RECEPTOR TRANSCRIPTION PATHWAY | Genes involved in Nuclear Receptor transcription pathway |
0.1 | 0.4 | REACTOME SYNTHESIS OF BILE ACIDS AND BILE SALTS VIA 7ALPHA HYDROXYCHOLESTEROL | Genes involved in Synthesis of bile acids and bile salts via 7alpha-hydroxycholesterol |
0.1 | 1.1 | REACTOME GLUCOSE TRANSPORT | Genes involved in Glucose transport |
0.1 | 1.5 | REACTOME AMINE DERIVED HORMONES | Genes involved in Amine-derived hormones |
0.1 | 0.2 | REACTOME PROSTACYCLIN SIGNALLING THROUGH PROSTACYCLIN RECEPTOR | Genes involved in Prostacyclin signalling through prostacyclin receptor |
0.1 | 2.6 | REACTOME ABC FAMILY PROTEINS MEDIATED TRANSPORT | Genes involved in ABC-family proteins mediated transport |
0.1 | 0.7 | REACTOME APOPTOSIS INDUCED DNA FRAGMENTATION | Genes involved in Apoptosis induced DNA fragmentation |
0.1 | 0.9 | REACTOME APOPTOTIC CLEAVAGE OF CELL ADHESION PROTEINS | Genes involved in Apoptotic cleavage of cell adhesion proteins |
0.1 | 1.1 | REACTOME FORMATION OF INCISION COMPLEX IN GG NER | Genes involved in Formation of incision complex in GG-NER |
0.1 | 0.8 | REACTOME PROLONGED ERK ACTIVATION EVENTS | Genes involved in Prolonged ERK activation events |
0.1 | 3.0 | REACTOME GLYCEROPHOSPHOLIPID BIOSYNTHESIS | Genes involved in Glycerophospholipid biosynthesis |
0.1 | 0.8 | REACTOME REGULATED PROTEOLYSIS OF P75NTR | Genes involved in Regulated proteolysis of p75NTR |
0.1 | 0.1 | REACTOME TRANSLOCATION OF ZAP 70 TO IMMUNOLOGICAL SYNAPSE | Genes involved in Translocation of ZAP-70 to Immunological synapse |
0.1 | 0.4 | REACTOME PROLACTIN RECEPTOR SIGNALING | Genes involved in Prolactin receptor signaling |
0.1 | 1.3 | REACTOME CONVERSION FROM APC C CDC20 TO APC C CDH1 IN LATE ANAPHASE | Genes involved in Conversion from APC/C:Cdc20 to APC/C:Cdh1 in late anaphase |
0.1 | 1.3 | REACTOME SIGNALING BY SCF KIT | Genes involved in Signaling by SCF-KIT |
0.1 | 1.2 | REACTOME ADENYLATE CYCLASE INHIBITORY PATHWAY | Genes involved in Adenylate cyclase inhibitory pathway |
0.1 | 3.8 | REACTOME CHEMOKINE RECEPTORS BIND CHEMOKINES | Genes involved in Chemokine receptors bind chemokines |
0.1 | 0.9 | REACTOME BASE FREE SUGAR PHOSPHATE REMOVAL VIA THE SINGLE NUCLEOTIDE REPLACEMENT PATHWAY | Genes involved in Base-free sugar-phosphate removal via the single-nucleotide replacement pathway |
0.1 | 0.1 | REACTOME GLUCAGON SIGNALING IN METABOLIC REGULATION | Genes involved in Glucagon signaling in metabolic regulation |
0.1 | 0.8 | REACTOME COMMON PATHWAY | Genes involved in Common Pathway |
0.1 | 0.2 | REACTOME MRNA CAPPING | Genes involved in mRNA Capping |
0.1 | 1.6 | REACTOME BASIGIN INTERACTIONS | Genes involved in Basigin interactions |
0.1 | 0.2 | REACTOME KERATAN SULFATE DEGRADATION | Genes involved in Keratan sulfate degradation |
0.1 | 0.8 | REACTOME PRE NOTCH PROCESSING IN GOLGI | Genes involved in Pre-NOTCH Processing in Golgi |
0.1 | 1.6 | REACTOME MEIOTIC RECOMBINATION | Genes involved in Meiotic Recombination |
0.1 | 1.0 | REACTOME REGULATION OF HYPOXIA INDUCIBLE FACTOR HIF BY OXYGEN | Genes involved in Regulation of Hypoxia-inducible Factor (HIF) by Oxygen |
0.1 | 0.7 | REACTOME ALPHA LINOLENIC ACID ALA METABOLISM | Genes involved in alpha-linolenic acid (ALA) metabolism |
0.1 | 2.9 | REACTOME METABOLISM OF VITAMINS AND COFACTORS | Genes involved in Metabolism of vitamins and cofactors |
0.1 | 0.2 | REACTOME RESOLUTION OF AP SITES VIA THE SINGLE NUCLEOTIDE REPLACEMENT PATHWAY | Genes involved in Resolution of AP sites via the single-nucleotide replacement pathway |
0.1 | 1.7 | REACTOME DOWNSTREAM SIGNAL TRANSDUCTION | Genes involved in Downstream signal transduction |
0.1 | 0.2 | REACTOME TRAF6 MEDIATED IRF7 ACTIVATION | Genes involved in TRAF6 mediated IRF7 activation |
0.1 | 0.4 | REACTOME AKT PHOSPHORYLATES TARGETS IN THE CYTOSOL | Genes involved in AKT phosphorylates targets in the cytosol |
0.1 | 0.7 | REACTOME TRYPTOPHAN CATABOLISM | Genes involved in Tryptophan catabolism |
0.1 | 0.9 | REACTOME TANDEM PORE DOMAIN POTASSIUM CHANNELS | Genes involved in Tandem pore domain potassium channels |
0.1 | 1.3 | REACTOME RNA POL III TRANSCRIPTION INITIATION FROM TYPE 3 PROMOTER | Genes involved in RNA Polymerase III Transcription Initiation From Type 3 Promoter |
0.1 | 0.5 | REACTOME G PROTEIN ACTIVATION | Genes involved in G-protein activation |
0.1 | 2.3 | REACTOME ANTIVIRAL MECHANISM BY IFN STIMULATED GENES | Genes involved in Antiviral mechanism by IFN-stimulated genes |
0.1 | 1.9 | REACTOME ASSOCIATION OF TRIC CCT WITH TARGET PROTEINS DURING BIOSYNTHESIS | Genes involved in Association of TriC/CCT with target proteins during biosynthesis |
0.1 | 0.3 | REACTOME RNA POL I TRANSCRIPTION INITIATION | Genes involved in RNA Polymerase I Transcription Initiation |
0.1 | 0.5 | REACTOME GLUCURONIDATION | Genes involved in Glucuronidation |
0.1 | 0.5 | REACTOME THROMBIN SIGNALLING THROUGH PROTEINASE ACTIVATED RECEPTORS PARS | Genes involved in Thrombin signalling through proteinase activated receptors (PARs) |
0.1 | 0.8 | REACTOME ORGANIC CATION ANION ZWITTERION TRANSPORT | Genes involved in Organic cation/anion/zwitterion transport |
0.1 | 1.2 | REACTOME COSTIMULATION BY THE CD28 FAMILY | Genes involved in Costimulation by the CD28 family |
0.1 | 1.5 | REACTOME AMINO ACID TRANSPORT ACROSS THE PLASMA MEMBRANE | Genes involved in Amino acid transport across the plasma membrane |
0.1 | 2.1 | REACTOME PHASE1 FUNCTIONALIZATION OF COMPOUNDS | Genes involved in Phase 1 - Functionalization of compounds |
0.1 | 0.4 | REACTOME TRANSPORT OF MATURE MRNA DERIVED FROM AN INTRONLESS TRANSCRIPT | Genes involved in Transport of Mature mRNA Derived from an Intronless Transcript |
0.1 | 0.3 | REACTOME ERKS ARE INACTIVATED | Genes involved in ERKs are inactivated |
0.1 | 0.3 | REACTOME ER PHAGOSOME PATHWAY | Genes involved in ER-Phagosome pathway |
0.1 | 0.9 | REACTOME ANTIGEN ACTIVATES B CELL RECEPTOR LEADING TO GENERATION OF SECOND MESSENGERS | Genes involved in Antigen Activates B Cell Receptor Leading to Generation of Second Messengers |
0.1 | 1.1 | REACTOME POST CHAPERONIN TUBULIN FOLDING PATHWAY | Genes involved in Post-chaperonin tubulin folding pathway |
0.1 | 0.2 | REACTOME IRON UPTAKE AND TRANSPORT | Genes involved in Iron uptake and transport |
0.1 | 1.0 | REACTOME AMYLOIDS | Genes involved in Amyloids |
0.1 | 0.3 | REACTOME TETRAHYDROBIOPTERIN BH4 SYNTHESIS RECYCLING SALVAGE AND REGULATION | Genes involved in Tetrahydrobiopterin (BH4) synthesis, recycling, salvage and regulation |
0.1 | 0.9 | REACTOME AMINO ACID SYNTHESIS AND INTERCONVERSION TRANSAMINATION | Genes involved in Amino acid synthesis and interconversion (transamination) |
0.1 | 0.3 | REACTOME G2 M DNA DAMAGE CHECKPOINT | Genes involved in G2/M DNA damage checkpoint |
0.1 | 0.2 | REACTOME PERK REGULATED GENE EXPRESSION | Genes involved in PERK regulated gene expression |
0.1 | 0.2 | REACTOME RECYCLING OF BILE ACIDS AND SALTS | Genes involved in Recycling of bile acids and salts |
0.1 | 2.9 | REACTOME TRANSLATION | Genes involved in Translation |
0.1 | 0.1 | REACTOME SIGNALING BY FGFR3 MUTANTS | Genes involved in Signaling by FGFR3 mutants |
0.1 | 0.1 | REACTOME DESTABILIZATION OF MRNA BY KSRP | Genes involved in Destabilization of mRNA by KSRP |
0.1 | 0.5 | REACTOME LATENT INFECTION OF HOMO SAPIENS WITH MYCOBACTERIUM TUBERCULOSIS | Genes involved in Latent infection of Homo sapiens with Mycobacterium tuberculosis |
0.1 | 1.0 | REACTOME SYNTHESIS OF GLYCOSYLPHOSPHATIDYLINOSITOL GPI | Genes involved in Synthesis of glycosylphosphatidylinositol (GPI) |
0.1 | 2.1 | REACTOME O LINKED GLYCOSYLATION OF MUCINS | Genes involved in O-linked glycosylation of mucins |
0.1 | 0.1 | REACTOME APC C CDH1 MEDIATED DEGRADATION OF CDC20 AND OTHER APC C CDH1 TARGETED PROTEINS IN LATE MITOSIS EARLY G1 | Genes involved in APC/C:Cdh1 mediated degradation of Cdc20 and other APC/C:Cdh1 targeted proteins in late mitosis/early G1 |
0.1 | 0.7 | REACTOME CHONDROITIN SULFATE BIOSYNTHESIS | Genes involved in Chondroitin sulfate biosynthesis |
0.1 | 0.7 | REACTOME PRESYNAPTIC NICOTINIC ACETYLCHOLINE RECEPTORS | Genes involved in Presynaptic nicotinic acetylcholine receptors |
0.1 | 0.1 | REACTOME INITIAL TRIGGERING OF COMPLEMENT | Genes involved in Initial triggering of complement |
0.1 | 0.2 | REACTOME UNWINDING OF DNA | Genes involved in Unwinding of DNA |
0.1 | 0.6 | REACTOME REGULATION OF INSULIN SECRETION BY GLUCAGON LIKE PEPTIDE1 | Genes involved in Regulation of Insulin Secretion by Glucagon-like Peptide-1 |
0.1 | 0.3 | REACTOME SEMA3A PLEXIN REPULSION SIGNALING BY INHIBITING INTEGRIN ADHESION | Genes involved in SEMA3A-Plexin repulsion signaling by inhibiting Integrin adhesion |
0.1 | 0.5 | REACTOME NOD1 2 SIGNALING PATHWAY | Genes involved in NOD1/2 Signaling Pathway |
0.1 | 2.3 | REACTOME MITOCHONDRIAL PROTEIN IMPORT | Genes involved in Mitochondrial Protein Import |
0.1 | 0.1 | REACTOME CIRCADIAN REPRESSION OF EXPRESSION BY REV ERBA | Genes involved in Circadian Repression of Expression by REV-ERBA |
0.1 | 0.4 | REACTOME ACTIVATION OF RAC | Genes involved in Activation of Rac |
0.1 | 0.6 | REACTOME MRNA DECAY BY 5 TO 3 EXORIBONUCLEASE | Genes involved in mRNA Decay by 5' to 3' Exoribonuclease |
0.0 | 4.4 | REACTOME NONSENSE MEDIATED DECAY ENHANCED BY THE EXON JUNCTION COMPLEX | Genes involved in Nonsense Mediated Decay Enhanced by the Exon Junction Complex |
0.0 | 0.4 | REACTOME REGULATION OF RHEB GTPASE ACTIVITY BY AMPK | Genes involved in Regulation of Rheb GTPase activity by AMPK |
0.0 | 0.4 | REACTOME RECRUITMENT OF NUMA TO MITOTIC CENTROSOMES | Genes involved in Recruitment of NuMA to mitotic centrosomes |
0.0 | 0.3 | REACTOME ROLE OF DCC IN REGULATING APOPTOSIS | Genes involved in Role of DCC in regulating apoptosis |
0.0 | 3.3 | REACTOME RESPIRATORY ELECTRON TRANSPORT ATP SYNTHESIS BY CHEMIOSMOTIC COUPLING AND HEAT PRODUCTION BY UNCOUPLING PROTEINS | Genes involved in Respiratory electron transport, ATP synthesis by chemiosmotic coupling, and heat production by uncoupling proteins. |
0.0 | 0.1 | REACTOME SIGNALING BY ERBB2 | Genes involved in Signaling by ERBB2 |
0.0 | 0.2 | REACTOME GRB2 SOS PROVIDES LINKAGE TO MAPK SIGNALING FOR INTERGRINS | Genes involved in GRB2:SOS provides linkage to MAPK signaling for Intergrins |
0.0 | 0.3 | REACTOME METAL ION SLC TRANSPORTERS | Genes involved in Metal ion SLC transporters |
0.0 | 0.3 | REACTOME GENERATION OF SECOND MESSENGER MOLECULES | Genes involved in Generation of second messenger molecules |
0.0 | 0.0 | REACTOME ENDOSOMAL VACUOLAR PATHWAY | Genes involved in Endosomal/Vacuolar pathway |
0.0 | 1.1 | REACTOME BIOSYNTHESIS OF THE N GLYCAN PRECURSOR DOLICHOL LIPID LINKED OLIGOSACCHARIDE LLO AND TRANSFER TO A NASCENT PROTEIN | Genes involved in Biosynthesis of the N-glycan precursor (dolichol lipid-linked oligosaccharide, LLO) and transfer to a nascent protein |
0.0 | 0.4 | REACTOME PROCESSING OF INTRONLESS PRE MRNAS | Genes involved in Processing of Intronless Pre-mRNAs |
0.0 | 0.0 | REACTOME SYNTHESIS OF BILE ACIDS AND BILE SALTS | Genes involved in Synthesis of bile acids and bile salts |
0.0 | 0.4 | REACTOME NA CL DEPENDENT NEUROTRANSMITTER TRANSPORTERS | Genes involved in Na+/Cl- dependent neurotransmitter transporters |
0.0 | 0.6 | REACTOME ACTIVATION OF THE PRE REPLICATIVE COMPLEX | Genes involved in Activation of the pre-replicative complex |
0.0 | 1.1 | REACTOME ACTIVATION OF CHAPERONE GENES BY XBP1S | Genes involved in Activation of Chaperone Genes by XBP1(S) |
0.0 | 5.5 | REACTOME ANTIGEN PROCESSING UBIQUITINATION PROTEASOME DEGRADATION | Genes involved in Antigen processing: Ubiquitination & Proteasome degradation |
0.0 | 0.1 | REACTOME ELONGATION ARREST AND RECOVERY | Genes involved in Elongation arrest and recovery |
0.0 | 0.1 | REACTOME ACTIVATION OF CHAPERONES BY ATF6 ALPHA | Genes involved in Activation of Chaperones by ATF6-alpha |
0.0 | 0.3 | REACTOME COPI MEDIATED TRANSPORT | Genes involved in COPI Mediated Transport |
0.0 | 0.7 | REACTOME ENDOSOMAL SORTING COMPLEX REQUIRED FOR TRANSPORT ESCRT | Genes involved in Endosomal Sorting Complex Required For Transport (ESCRT) |
0.0 | 1.1 | REACTOME LOSS OF NLP FROM MITOTIC CENTROSOMES | Genes involved in Loss of Nlp from mitotic centrosomes |
0.0 | 0.1 | REACTOME GROWTH HORMONE RECEPTOR SIGNALING | Genes involved in Growth hormone receptor signaling |
0.0 | 0.1 | REACTOME FGFR1 LIGAND BINDING AND ACTIVATION | Genes involved in FGFR1 ligand binding and activation |
0.0 | 0.5 | REACTOME EXTENSION OF TELOMERES | Genes involved in Extension of Telomeres |
0.0 | 0.3 | REACTOME REGULATION OF PYRUVATE DEHYDROGENASE PDH COMPLEX | Genes involved in Regulation of pyruvate dehydrogenase (PDH) complex |
0.0 | 0.2 | REACTOME REGULATION OF IFNG SIGNALING | Genes involved in Regulation of IFNG signaling |
0.0 | 0.1 | REACTOME TRAF6 MEDIATED IRF7 ACTIVATION IN TLR7 8 OR 9 SIGNALING | Genes involved in TRAF6 mediated IRF7 activation in TLR7/8 or 9 signaling |
0.0 | 0.4 | REACTOME CELL CYCLE MITOTIC | Genes involved in Cell Cycle, Mitotic |
0.0 | 0.3 | REACTOME METABOLISM OF NON CODING RNA | Genes involved in Metabolism of non-coding RNA |
0.0 | 0.2 | REACTOME TRAFFICKING AND PROCESSING OF ENDOSOMAL TLR | Genes involved in Trafficking and processing of endosomal TLR |
0.0 | 0.1 | REACTOME YAP1 AND WWTR1 TAZ STIMULATED GENE EXPRESSION | Genes involved in YAP1- and WWTR1 (TAZ)-stimulated gene expression |
0.0 | 0.1 | REACTOME LATE PHASE OF HIV LIFE CYCLE | Genes involved in Late Phase of HIV Life Cycle |
0.0 | 0.1 | REACTOME REGULATION OF WATER BALANCE BY RENAL AQUAPORINS | Genes involved in Regulation of Water Balance by Renal Aquaporins |
0.0 | 0.5 | REACTOME CHOLESTEROL BIOSYNTHESIS | Genes involved in Cholesterol biosynthesis |
0.0 | 0.4 | REACTOME TRANSPORT OF MATURE TRANSCRIPT TO CYTOPLASM | Genes involved in Transport of Mature Transcript to Cytoplasm |
0.0 | 0.4 | REACTOME SMOOTH MUSCLE CONTRACTION | Genes involved in Smooth Muscle Contraction |
0.0 | 2.6 | REACTOME METABOLISM OF AMINO ACIDS AND DERIVATIVES | Genes involved in Metabolism of amino acids and derivatives |
0.0 | 0.3 | REACTOME PURINE RIBONUCLEOSIDE MONOPHOSPHATE BIOSYNTHESIS | Genes involved in Purine ribonucleoside monophosphate biosynthesis |
0.0 | 0.3 | REACTOME GLYCOGEN BREAKDOWN GLYCOGENOLYSIS | Genes involved in Glycogen breakdown (glycogenolysis) |
0.0 | 0.2 | REACTOME BMAL1 CLOCK NPAS2 ACTIVATES CIRCADIAN EXPRESSION | Genes involved in BMAL1:CLOCK/NPAS2 Activates Circadian Expression |
0.0 | 0.2 | REACTOME EXTRINSIC PATHWAY FOR APOPTOSIS | Genes involved in Extrinsic Pathway for Apoptosis |
0.0 | 0.3 | REACTOME FGFR2C LIGAND BINDING AND ACTIVATION | Genes involved in FGFR2c ligand binding and activation |
0.0 | 0.6 | REACTOME TRANSPORT OF VITAMINS NUCLEOSIDES AND RELATED MOLECULES | Genes involved in Transport of vitamins, nucleosides, and related molecules |
0.0 | 0.4 | REACTOME METABOLISM OF STEROID HORMONES AND VITAMINS A AND D | Genes involved in Metabolism of steroid hormones and vitamins A and D |
0.0 | 0.0 | REACTOME FORMATION OF TRANSCRIPTION COUPLED NER TC NER REPAIR COMPLEX | Genes involved in Formation of transcription-coupled NER (TC-NER) repair complex |
0.0 | 0.4 | REACTOME GLYCOLYSIS | Genes involved in Glycolysis |
0.0 | 0.0 | REACTOME PECAM1 INTERACTIONS | Genes involved in PECAM1 interactions |
0.0 | 0.5 | REACTOME TIGHT JUNCTION INTERACTIONS | Genes involved in Tight junction interactions |
0.0 | 0.1 | REACTOME SYNTHESIS SECRETION AND DEACYLATION OF GHRELIN | Genes involved in Synthesis, Secretion, and Deacylation of Ghrelin |
0.0 | 0.1 | REACTOME ENOS ACTIVATION AND REGULATION | Genes involved in eNOS activation and regulation |
0.0 | 0.8 | REACTOME GASTRIN CREB SIGNALLING PATHWAY VIA PKC AND MAPK | Genes involved in Gastrin-CREB signalling pathway via PKC and MAPK |
0.0 | 0.5 | REACTOME IMMUNOREGULATORY INTERACTIONS BETWEEN A LYMPHOID AND A NON LYMPHOID CELL | Genes involved in Immunoregulatory interactions between a Lymphoid and a non-Lymphoid cell |
0.0 | 1.0 | REACTOME MRNA SPLICING | Genes involved in mRNA Splicing |
0.0 | 0.2 | REACTOME LYSOSOME VESICLE BIOGENESIS | Genes involved in Lysosome Vesicle Biogenesis |
0.0 | 0.1 | REACTOME P38MAPK EVENTS | Genes involved in p38MAPK events |
0.0 | 0.1 | REACTOME TRANSCRIPTIONAL ACTIVITY OF SMAD2 SMAD3 SMAD4 HETEROTRIMER | Genes involved in Transcriptional activity of SMAD2/SMAD3:SMAD4 heterotrimer |
0.0 | 0.0 | REACTOME NRIF SIGNALS CELL DEATH FROM THE NUCLEUS | Genes involved in NRIF signals cell death from the nucleus |
0.0 | 0.2 | REACTOME MITOCHONDRIAL FATTY ACID BETA OXIDATION | Genes involved in Mitochondrial Fatty Acid Beta-Oxidation |
0.0 | 0.2 | REACTOME SIGNALING BY HIPPO | Genes involved in Signaling by Hippo |
0.0 | 0.0 | REACTOME RNA POL II TRANSCRIPTION | Genes involved in RNA Polymerase II Transcription |
0.0 | 0.7 | REACTOME TRANSCRIPTIONAL REGULATION OF WHITE ADIPOCYTE DIFFERENTIATION | Genes involved in Transcriptional Regulation of White Adipocyte Differentiation |
0.0 | 0.1 | REACTOME NUCLEAR EVENTS KINASE AND TRANSCRIPTION FACTOR ACTIVATION | Genes involved in Nuclear Events (kinase and transcription factor activation) |
0.0 | 0.2 | REACTOME TCA CYCLE AND RESPIRATORY ELECTRON TRANSPORT | Genes involved in The citric acid (TCA) cycle and respiratory electron transport |
0.0 | 0.1 | REACTOME RECYCLING PATHWAY OF L1 | Genes involved in Recycling pathway of L1 |
0.0 | 0.1 | REACTOME SIGNAL TRANSDUCTION BY L1 | Genes involved in Signal transduction by L1 |
0.0 | 0.1 | REACTOME PREFOLDIN MEDIATED TRANSFER OF SUBSTRATE TO CCT TRIC | Genes involved in Prefoldin mediated transfer of substrate to CCT/TriC |
0.0 | 1.0 | REACTOME METABOLISM OF CARBOHYDRATES | Genes involved in Metabolism of carbohydrates |
0.0 | 0.1 | REACTOME MRNA PROCESSING | Genes involved in mRNA Processing |
0.0 | 0.2 | REACTOME GLUTATHIONE CONJUGATION | Genes involved in Glutathione conjugation |
0.0 | 0.1 | REACTOME ACTIVATED AMPK STIMULATES FATTY ACID OXIDATION IN MUSCLE | Genes involved in Activated AMPK stimulates fatty-acid oxidation in muscle |
0.0 | 0.2 | REACTOME PTM GAMMA CARBOXYLATION HYPUSINE FORMATION AND ARYLSULFATASE ACTIVATION | Genes involved in PTM: gamma carboxylation, hypusine formation and arylsulfatase activation |
0.0 | 0.3 | REACTOME ION TRANSPORT BY P TYPE ATPASES | Genes involved in Ion transport by P-type ATPases |
0.0 | 0.0 | REACTOME CELL CYCLE CHECKPOINTS | Genes involved in Cell Cycle Checkpoints |