Gene Symbol | Gene ID | Gene Info |
---|---|---|
Zscan4c
|
ENSMUSG00000054272.5 | Zscan4c |
Move your cursor over a bar to see sample name and corresponding Z-value.
Cis Regulatory Element (CRE) | Target Score | Top associated gene | Gene Info | Distance of CRE to TSS | CRE/Gene association probability |
---|---|---|---|---|---|
chr1_180791165_180791465 | 4.91 |
H3f3a |
H3.3 histone A |
22219 |
0.09 |
chr8_46888575_46888943 | 2.66 |
Gm45481 |
predicted gene 45481 |
54847 |
0.1 |
chr9_45518032_45518183 | 2.27 |
4833428L15Rik |
RIKEN cDNA 4833428L15 gene |
86377 |
0.06 |
chr8_88576435_88576685 | 2.00 |
Nkd1 |
naked cuticle 1 |
6245 |
0.2 |
chr13_59468299_59468459 | 1.96 |
Agtpbp1 |
ATP/GTP binding protein 1 |
3091 |
0.23 |
chr15_6861727_6861911 | 1.90 |
Osmr |
oncostatin M receptor |
12438 |
0.28 |
chr9_26519987_26520600 | 1.89 |
Gm30313 |
predicted gene, 30313 |
29660 |
0.23 |
chr11_58193435_58193586 | 1.88 |
Gm12250 |
predicted gene 12250 |
5771 |
0.1 |
chr2_166154990_166155581 | 1.87 |
Sulf2 |
sulfatase 2 |
0 |
0.98 |
chr1_87785802_87786097 | 1.76 |
Scarna6 |
small Cajal body-specific RNA 6 |
1393 |
0.3 |
chr10_118102987_118104071 | 1.71 |
5330439M10Rik |
RIKEN cDNA 5330439M10 gene |
8988 |
0.17 |
chr11_65366075_65366410 | 1.66 |
Gm12295 |
predicted gene 12295 |
444 |
0.89 |
chr13_58807415_58808021 | 1.64 |
Ntrk2 |
neurotrophic tyrosine kinase, receptor, type 2 |
21 |
0.96 |
chr4_97787662_97787826 | 1.63 |
E130114P18Rik |
RIKEN cDNA E130114P18 gene |
9666 |
0.2 |
chr9_61655467_61655652 | 1.61 |
Gm47241 |
predicted gene, 47241 |
107525 |
0.06 |
chr16_38672522_38672738 | 1.61 |
Gm15530 |
predicted gene 15530 |
13239 |
0.16 |
chr3_28264071_28264435 | 1.61 |
Tnik |
TRAF2 and NCK interacting kinase |
610 |
0.76 |
chr15_83997523_83997901 | 1.55 |
Efcab6 |
EF-hand calcium binding domain 6 |
8730 |
0.2 |
chr4_98221583_98221905 | 1.53 |
Gm12692 |
predicted gene 12692 |
13546 |
0.21 |
chr4_49585847_49586069 | 1.41 |
Tmem246 |
transmembrane protein 246 |
7932 |
0.16 |
chr13_53262691_53263037 | 1.40 |
Ror2 |
receptor tyrosine kinase-like orphan receptor 2 |
12794 |
0.26 |
chr7_142457581_142457758 | 1.39 |
Lsp1 |
lymphocyte specific 1 |
3140 |
0.13 |
chr2_120000952_120001118 | 1.38 |
Mapkbp1 |
mitogen-activated protein kinase binding protein 1 |
10652 |
0.11 |
chr10_42464243_42464405 | 1.37 |
Afg1l |
AFG1 like ATPase |
13956 |
0.18 |
chr8_11262349_11262500 | 1.33 |
Col4a1 |
collagen, type IV, alpha 1 |
16819 |
0.16 |
chr11_117276070_117276221 | 1.33 |
Septin9 |
septin 9 |
9899 |
0.18 |
chr6_32586535_32586712 | 1.33 |
Plxna4 |
plexin A4 |
1569 |
0.44 |
chr8_77444256_77444443 | 1.33 |
Gm45407 |
predicted gene 45407 |
71833 |
0.08 |
chr18_32153569_32153751 | 1.32 |
Gm26717 |
predicted gene, 26717 |
184 |
0.91 |
chr3_84952102_84952412 | 1.30 |
Fbxw7 |
F-box and WD-40 domain protein 7 |
111 |
0.98 |
chr13_44128711_44128862 | 1.28 |
Gm5083 |
predicted gene 5083 |
7492 |
0.18 |
chr8_72295220_72295373 | 1.28 |
Gm10282 |
predicted pseudogene 10282 |
9964 |
0.11 |
chr11_117936123_117936318 | 1.26 |
Gm11726 |
predicted gene 11726 |
14315 |
0.12 |
chr5_65181243_65181407 | 1.26 |
Wdr19 |
WD repeat domain 19 |
18371 |
0.15 |
chr11_119215012_119215959 | 1.26 |
Gm11752 |
predicted gene 11752 |
4675 |
0.13 |
chr9_48638554_48638705 | 1.26 |
Nnmt |
nicotinamide N-methyltransferase |
33476 |
0.19 |
chr13_24477731_24477908 | 1.24 |
Gm22013 |
predicted gene, 22013 |
8945 |
0.17 |
chr2_26324039_26324199 | 1.21 |
Gpsm1 |
G-protein signalling modulator 1 (AGS3-like, C. elegans) |
528 |
0.62 |
chr14_47958361_47958521 | 1.20 |
Gm49303 |
predicted gene, 49303 |
1578 |
0.35 |
chr17_73204057_73204245 | 1.19 |
Lclat1 |
lysocardiolipin acyltransferase 1 |
1 |
0.98 |
chr13_38170673_38170865 | 1.17 |
Dsp |
desmoplakin |
7598 |
0.17 |
chr1_51289041_51289589 | 1.17 |
Cavin2 |
caveolae associated 2 |
189 |
0.95 |
chr12_81862462_81862808 | 1.17 |
Pcnx |
pecanex homolog |
2294 |
0.32 |
chr12_24912411_24912562 | 1.15 |
Kidins220 |
kinase D-interacting substrate 220 |
62439 |
0.09 |
chr16_22151782_22152061 | 1.15 |
Igf2bp2 |
insulin-like growth factor 2 mRNA binding protein 2 |
9529 |
0.18 |
chr15_62230752_62231120 | 1.15 |
Pvt1 |
Pvt1 oncogene |
8333 |
0.25 |
chr7_19800658_19801013 | 1.13 |
Cblc |
Casitas B-lineage lymphoma c |
4026 |
0.09 |
chr7_51775988_51776283 | 1.13 |
Gm29296 |
predicted gene 29296 |
3409 |
0.23 |
chr18_21109286_21109437 | 1.13 |
Gm6378 |
predicted pseudogene 6378 |
32252 |
0.17 |
chr9_21762154_21762705 | 1.12 |
Spc24 |
SPC24, NDC80 kinetochore complex component, homolog (S. cerevisiae) |
2126 |
0.2 |
chr2_93797553_93797728 | 1.12 |
Ext2 |
exostosin glycosyltransferase 2 |
1651 |
0.33 |
chr18_84368955_84369471 | 1.10 |
Gm37216 |
predicted gene, 37216 |
6933 |
0.26 |
chr9_96732055_96732515 | 1.09 |
Zbtb38 |
zinc finger and BTB domain containing 38 |
384 |
0.84 |
chr5_36075205_36075521 | 1.09 |
Afap1 |
actin filament associated protein 1 |
88358 |
0.08 |
chr1_182763880_182764492 | 1.08 |
Susd4 |
sushi domain containing 4 |
174 |
0.95 |
chr16_90405274_90405425 | 1.07 |
Hunk |
hormonally upregulated Neu-associated kinase |
4805 |
0.2 |
chr18_10946788_10946939 | 1.07 |
Gm7575 |
predicted gene 7575 |
17979 |
0.21 |
chr4_102608098_102608249 | 1.07 |
Pde4b |
phosphodiesterase 4B, cAMP specific |
18330 |
0.27 |
chr13_98117808_98118060 | 1.06 |
Arhgef28 |
Rho guanine nucleotide exchange factor (GEF) 28 |
58053 |
0.13 |
chr9_58487820_58488921 | 1.06 |
Insyn1 |
inhibitory synaptic factor 1 |
233 |
0.93 |
chr9_48670478_48670629 | 1.05 |
Nnmt |
nicotinamide N-methyltransferase |
65400 |
0.12 |
chr14_21986797_21986954 | 1.05 |
Zfp503 |
zinc finger protein 503 |
2726 |
0.2 |
chr12_108689235_108689960 | 1.03 |
Degs2 |
delta(4)-desaturase, sphingolipid 2 |
2586 |
0.17 |
chr10_60830970_60831796 | 1.02 |
Unc5b |
unc-5 netrin receptor B |
1 |
0.98 |
chr2_76435770_76435958 | 1.02 |
Osbpl6 |
oxysterol binding protein-like 6 |
29303 |
0.16 |
chr3_30977085_30977719 | 1.02 |
Gm2979 |
predicted gene 2979 |
2753 |
0.2 |
chr5_125072558_125072786 | 1.01 |
Gm42839 |
predicted gene 42839 |
14169 |
0.16 |
chr14_67135210_67135567 | 0.99 |
Gm30806 |
predicted gene, 30806 |
34200 |
0.14 |
chr19_38398943_38399521 | 0.99 |
Slc35g1 |
solute carrier family 35, member G1 |
3191 |
0.2 |
chr16_16485604_16485955 | 0.99 |
Fgd4 |
FYVE, RhoGEF and PH domain containing 4 |
18443 |
0.18 |
chr17_44230130_44230445 | 0.98 |
Clic5 |
chloride intracellular channel 5 |
6819 |
0.3 |
chr7_44443191_44443771 | 0.98 |
Lrrc4b |
leucine rich repeat containing 4B |
744 |
0.4 |
chr19_40395363_40395651 | 0.97 |
Sorbs1 |
sorbin and SH3 domain containing 1 |
6760 |
0.24 |
chr1_44216808_44216982 | 0.97 |
Mettl21e |
methyltransferase like 21E |
2018 |
0.29 |
chr11_63028190_63028341 | 0.97 |
Cdrt4os1 |
CMT1A duplicated region transcript 4, opposite strand 1 |
24131 |
0.15 |
chr4_135565417_135565609 | 0.96 |
Grhl3 |
grainyhead like transcription factor 3 |
8117 |
0.14 |
chr11_52623013_52623164 | 0.95 |
Gm12210 |
predicted gene 12210 |
135778 |
0.04 |
chr15_77306554_77306720 | 0.95 |
Rbfox2 |
RNA binding protein, fox-1 homolog (C. elegans) 2 |
32 |
0.97 |
chr2_91361288_91361455 | 0.95 |
Gm13787 |
predicted gene 13787 |
17182 |
0.16 |
chr9_70070038_70070189 | 0.95 |
Gm47233 |
predicted gene, 47233 |
246 |
0.89 |
chr18_34209057_34209208 | 0.93 |
Gm10548 |
predicted gene 10548 |
938 |
0.53 |
chr13_98699446_98699752 | 0.92 |
Tmem171 |
transmembrane protein 171 |
4765 |
0.15 |
chr17_49672194_49672362 | 0.92 |
Kif6 |
kinesin family member 6 |
41832 |
0.18 |
chr9_41918970_41919408 | 0.92 |
Gm40513 |
predicted gene, 40513 |
28585 |
0.14 |
chr12_85879727_85879928 | 0.91 |
Ttll5 |
tubulin tyrosine ligase-like family, member 5 |
841 |
0.65 |
chr6_66340941_66341095 | 0.91 |
Gm31520 |
predicted gene, 31520 |
57511 |
0.1 |
chr11_101885850_101886001 | 0.90 |
Gm11551 |
predicted gene 11551 |
312 |
0.85 |
chr8_54393544_54393765 | 0.90 |
Gm45553 |
predicted gene 45553 |
120496 |
0.06 |
chr2_180223297_180223448 | 0.90 |
Lama5 |
laminin, alpha 5 |
2487 |
0.19 |
chr2_103592239_103592603 | 0.90 |
Abtb2 |
ankyrin repeat and BTB (POZ) domain containing 2 |
26111 |
0.17 |
chr14_25197235_25197386 | 0.90 |
4930572O13Rik |
RIKEN cDNA 4930572O13 gene |
54069 |
0.12 |
chr2_94246412_94247550 | 0.90 |
Mir670hg |
MIR670 host gene (non-protein coding) |
3643 |
0.17 |
chr3_134190027_134190342 | 0.90 |
Gm43193 |
predicted gene 43193 |
9273 |
0.14 |
chr7_43448363_43448514 | 0.89 |
Gm44816 |
predicted gene 44816 |
365 |
0.65 |
chr17_12724917_12725682 | 0.88 |
Airn |
antisense Igf2r RNA |
16012 |
0.13 |
chr9_83023910_83024061 | 0.88 |
Gm39383 |
predicted gene, 39383 |
15382 |
0.18 |
chr9_117298216_117298380 | 0.88 |
Gm17396 |
predicted gene, 17396 |
45762 |
0.16 |
chr2_32628138_32628539 | 0.88 |
Ak1 |
adenylate kinase 1 |
52 |
0.93 |
chr12_54459580_54460031 | 0.87 |
Gm7557 |
predicted gene 7557 |
29407 |
0.13 |
chr13_60009589_60009740 | 0.86 |
A530065N20Rik |
RIKEN cDNA A530046M15 gene |
20047 |
0.16 |
chr13_110280472_110281172 | 0.86 |
Rab3c |
RAB3C, member RAS oncogene family |
79 |
0.98 |
chr14_99578677_99578828 | 0.86 |
Gm49225 |
predicted gene, 49225 |
41264 |
0.14 |
chr17_35638884_35639198 | 0.86 |
Mucl3 |
mucin like 3 |
4654 |
0.09 |
chr5_52115830_52115992 | 0.85 |
Gm43177 |
predicted gene 43177 |
1401 |
0.33 |
chr11_119053712_119054093 | 0.85 |
Cbx8 |
chromobox 8 |
12933 |
0.14 |
chr15_81248050_81248232 | 0.85 |
8430426J06Rik |
RIKEN cDNA 8430426J06 gene |
173 |
0.94 |
chr14_101883926_101884087 | 0.84 |
Lmo7 |
LIM domain only 7 |
81 |
0.98 |
chr9_73968917_73969081 | 0.84 |
Unc13c |
unc-13 homolog C |
33 |
0.99 |
chr9_58308472_58308798 | 0.83 |
Loxl1 |
lysyl oxidase-like 1 |
4551 |
0.18 |
chr4_152272187_152272409 | 0.83 |
Gpr153 |
G protein-coupled receptor 153 |
1934 |
0.23 |
chr5_115493563_115494012 | 0.83 |
Gm13836 |
predicted gene 13836 |
1332 |
0.21 |
chr13_28959420_28960032 | 0.83 |
Sox4 |
SRY (sex determining region Y)-box 4 |
6013 |
0.23 |
chr10_62049757_62049970 | 0.82 |
Gm5424 |
predicted gene 5424 |
21260 |
0.15 |
chr13_51328390_51328647 | 0.82 |
Gm6056 |
predicted gene 6056 |
10403 |
0.19 |
chr13_60665086_60665237 | 0.81 |
Gm48583 |
predicted gene, 48583 |
23371 |
0.15 |
chr11_62821213_62821364 | 0.81 |
Trim16 |
tripartite motif-containing 16 |
819 |
0.49 |
chr16_24487648_24487799 | 0.81 |
Lpp |
LIM domain containing preferred translocation partner in lipoma |
39632 |
0.15 |
chr11_11993846_11993997 | 0.81 |
Grb10 |
growth factor receptor bound protein 10 |
23279 |
0.19 |
chr13_53267968_53268146 | 0.81 |
Ror2 |
receptor tyrosine kinase-like orphan receptor 2 |
7601 |
0.27 |
chr2_3742757_3742915 | 0.81 |
Gm13185 |
predicted gene 13185 |
12341 |
0.18 |
chr11_98871012_98871163 | 0.80 |
Gm23640 |
predicted gene, 23640 |
588 |
0.6 |
chr2_55435745_55435961 | 0.80 |
Kcnj3 |
potassium inwardly-rectifying channel, subfamily J, member 3 |
117 |
0.98 |
chr9_44456821_44456985 | 0.80 |
Upk2 |
uroplakin 2 |
1927 |
0.12 |
chr1_88757191_88757377 | 0.80 |
Platr5 |
pluripotency associated transcript 5 |
2330 |
0.3 |
chr14_105404358_105404527 | 0.80 |
5430440P10Rik |
RIKEN cDNA 5430440P10 gene |
23117 |
0.19 |
chr3_122471015_122471269 | 0.79 |
Gm25153 |
predicted gene, 25153 |
6415 |
0.15 |
chr6_36387865_36388284 | 0.79 |
Chrm2 |
cholinergic receptor, muscarinic 2, cardiac |
10 |
0.5 |
chr5_134014531_134015255 | 0.79 |
1700030N18Rik |
RIKEN cDNA 1700030N18 gene |
76558 |
0.08 |
chr3_107483184_107483550 | 0.79 |
Slc6a17 |
solute carrier family 6 (neurotransmitter transporter), member 17 |
9829 |
0.18 |
chr19_3668624_3668775 | 0.79 |
Lrp5 |
low density lipoprotein receptor-related protein 5 |
17857 |
0.12 |
chr6_52165009_52165376 | 0.78 |
Hoxa2 |
homeobox A2 |
361 |
0.46 |
chr11_97531721_97532225 | 0.78 |
Srcin1 |
SRC kinase signaling inhibitor 1 |
4972 |
0.14 |
chr6_29178869_29179092 | 0.78 |
Prrt4 |
proline-rich transmembrane protein 4 |
604 |
0.64 |
chr14_121082412_121082567 | 0.78 |
Farp1 |
FERM, RhoGEF (Arhgef) and pleckstrin domain protein 1 (chondrocyte-derived) |
19590 |
0.26 |
chr8_105317978_105318129 | 0.78 |
Lrrc29 |
leucine rich repeat containing 29 |
8206 |
0.06 |
chr7_49558398_49558734 | 0.78 |
Nav2 |
neuron navigator 2 |
4674 |
0.29 |
chr9_63678241_63678409 | 0.78 |
Smad3 |
SMAD family member 3 |
11778 |
0.21 |
chr2_76928684_76928855 | 0.77 |
Ttn |
titin |
3471 |
0.33 |
chr11_61617101_61617252 | 0.77 |
Grap |
GRB2-related adaptor protein |
36089 |
0.12 |
chr7_67515000_67515184 | 0.77 |
Lrrc28 |
leucine rich repeat containing 28 |
20305 |
0.17 |
chr16_38781264_38781423 | 0.76 |
Upk1b |
uroplakin 1B |
1000 |
0.45 |
chr18_67938447_67938598 | 0.75 |
Ldlrad4 |
low density lipoprotein receptor class A domain containing 4 |
5265 |
0.23 |
chr9_48674437_48674588 | 0.75 |
Nnmt |
nicotinamide N-methyltransferase |
69359 |
0.11 |
chr1_135083513_135083778 | 0.75 |
Lgr6 |
leucine-rich repeat-containing G protein-coupled receptor 6 |
21631 |
0.11 |
chr14_47096378_47096773 | 0.75 |
Samd4 |
sterile alpha motif domain containing 4 |
9440 |
0.13 |
chr18_44580240_44581025 | 0.75 |
Mcc |
mutated in colorectal cancers |
61116 |
0.13 |
chr19_24046486_24046637 | 0.75 |
Fam189a2 |
family with sequence similarity 189, member A2 |
15542 |
0.16 |
chr18_77181220_77181592 | 0.74 |
St8sia5 |
ST8 alpha-N-acetyl-neuraminide alpha-2,8-sialyltransferase 5 |
4433 |
0.2 |
chr15_85687649_85687826 | 0.74 |
Lncppara |
long noncoding RNA near Ppara |
16036 |
0.13 |
chr6_138708837_138709296 | 0.74 |
Igbp1b |
immunoglobulin (CD79A) binding protein 1b |
50522 |
0.16 |
chr7_88321051_88321241 | 0.73 |
Gm44751 |
predicted gene 44751 |
9668 |
0.19 |
chr7_49064897_49065191 | 0.72 |
Gm45207 |
predicted gene 45207 |
2463 |
0.29 |
chr15_59649744_59650083 | 0.72 |
Trib1 |
tribbles pseudokinase 1 |
1260 |
0.49 |
chr1_43239783_43240180 | 0.72 |
Gm29610 |
predicted gene 29610 |
30702 |
0.14 |
chr14_54415750_54416010 | 0.72 |
Slc7a7 |
solute carrier family 7 (cationic amino acid transporter, y+ system), member 7 |
1799 |
0.18 |
chr4_130792457_130793299 | 0.72 |
Sdc3 |
syndecan 3 |
174 |
0.91 |
chr9_62526297_62526844 | 0.72 |
Coro2b |
coronin, actin binding protein, 2B |
6134 |
0.23 |
chr3_9123123_9123446 | 0.72 |
Gm8860 |
predicted gene 8860 |
50517 |
0.13 |
chr1_89455544_89456160 | 0.72 |
Agap1 |
ArfGAP with GTPase domain, ankyrin repeat and PH domain 1 |
596 |
0.76 |
chr8_123715899_123716275 | 0.72 |
6030466F02Rik |
RIKEN cDNA 6030466F02 gene |
17871 |
0.06 |
chr19_44064831_44064982 | 0.71 |
Erlin1 |
ER lipid raft associated 1 |
2777 |
0.19 |
chr6_54461357_54461636 | 0.71 |
Wipf3 |
WAS/WASL interacting protein family, member 3 |
8613 |
0.17 |
chr5_149584460_149584611 | 0.71 |
Wdr95 |
WD40 repeat domain 95 |
2757 |
0.22 |
chrX_75834356_75834507 | 0.71 |
Pls3 |
plastin 3 (T-isoform) |
7478 |
0.2 |
chr7_70361365_70362023 | 0.71 |
Nr2f2 |
nuclear receptor subfamily 2, group F, member 2 |
1101 |
0.37 |
chr16_77500620_77500809 | 0.71 |
Mir99ahg |
Mir99a and Mirlet7c-1 host gene (non-protein coding) |
330 |
0.83 |
chr18_61628161_61628546 | 0.70 |
Bvht |
braveheart long non-coding RNA |
11189 |
0.12 |
chr11_70563564_70563928 | 0.70 |
Mink1 |
misshapen-like kinase 1 (zebrafish) |
676 |
0.43 |
chr8_121108241_121108647 | 0.70 |
Mthfsd |
methenyltetrahydrofolate synthetase domain containing |
52 |
0.96 |
chr7_37361799_37362152 | 0.70 |
6720469O03Rik |
RIKEN cDNA 6720469O03 gene |
4655 |
0.28 |
chr4_139386785_139387002 | 0.70 |
Ubr4 |
ubiquitin protein ligase E3 component n-recognin 4 |
6224 |
0.12 |
chr13_96130906_96131482 | 0.69 |
Sv2c |
synaptic vesicle glycoprotein 2c |
1383 |
0.35 |
chr3_20147002_20147153 | 0.69 |
Gyg |
glycogenin |
7992 |
0.2 |
chr3_101667532_101667878 | 0.69 |
Gm43135 |
predicted gene 43135 |
24084 |
0.18 |
chr12_21290033_21290184 | 0.69 |
Cpsf3 |
cleavage and polyadenylation specificity factor 3 |
1678 |
0.22 |
chr17_30197057_30197248 | 0.69 |
Zfand3 |
zinc finger, AN1-type domain 3 |
424 |
0.83 |
chr11_116109532_116109940 | 0.69 |
Trim47 |
tripartite motif-containing 47 |
501 |
0.64 |
chr4_120191798_120191997 | 0.69 |
Edn2 |
endothelin 2 |
30691 |
0.19 |
chr4_46065855_46066006 | 0.69 |
Tmod1 |
tropomodulin 1 |
11197 |
0.19 |
chr11_98363985_98364136 | 0.68 |
Stard3 |
START domain containing 3 |
5616 |
0.09 |
chr15_31212049_31212203 | 0.68 |
Dap |
death-associated protein |
12188 |
0.18 |
chr10_83871819_83871981 | 0.68 |
Gm47247 |
predicted gene, 47247 |
29952 |
0.19 |
chr10_94829732_94830039 | 0.68 |
Plxnc1 |
plexin C1 |
339 |
0.87 |
chr7_15934046_15934274 | 0.68 |
Snord23 |
small nucleolar RNA, C/D box 23 |
4710 |
0.11 |
chr8_45452210_45452361 | 0.68 |
Tlr3 |
toll-like receptor 3 |
41205 |
0.11 |
chr11_88849861_88850082 | 0.67 |
Akap1 |
A kinase (PRKA) anchor protein 1 |
1532 |
0.29 |
chr7_64451519_64451788 | 0.67 |
Apba2 |
amyloid beta (A4) precursor protein-binding, family A, member 2 |
50053 |
0.1 |
chr3_102085887_102086042 | 0.67 |
Casq2 |
calsequestrin 2 |
451 |
0.77 |
chr10_94991252_94991474 | 0.67 |
Gm48867 |
predicted gene, 48867 |
8079 |
0.22 |
chr14_101946806_101946968 | 0.66 |
Lmo7 |
LIM domain only 7 |
17626 |
0.23 |
chr7_34570196_34571084 | 0.66 |
Gm12784 |
predicted gene 12784 |
23434 |
0.15 |
chr8_73930397_73930548 | 0.66 |
Gm7948 |
predicted gene 7948 |
58779 |
0.16 |
chr19_44881169_44881364 | 0.66 |
Gm5246 |
predicted gene 5246 |
30257 |
0.11 |
chr9_79919838_79920158 | 0.66 |
Gm3211 |
predicted gene 3211 |
6798 |
0.21 |
chr5_148272809_148272996 | 0.66 |
Mtus2 |
microtubule associated tumor suppressor candidate 2 |
7557 |
0.24 |
chr18_36031459_36031610 | 0.66 |
Nrg2 |
neuregulin 2 |
407 |
0.84 |
chr11_5999883_6001220 | 0.66 |
Camk2b |
calcium/calmodulin-dependent protein kinase II, beta |
103 |
0.96 |
chr14_46951144_46951295 | 0.66 |
Mir378c |
microRNA 378c |
3709 |
0.17 |
chr6_89613728_89614091 | 0.66 |
Chchd6 |
coiled-coil-helix-coiled-coil-helix domain containing 6 |
18257 |
0.17 |
chr1_55201883_55202252 | 0.65 |
Rftn2 |
raftlin family member 2 |
4422 |
0.16 |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.6 | 1.8 | GO:0035860 | glial cell-derived neurotrophic factor receptor signaling pathway(GO:0035860) |
0.5 | 1.6 | GO:1903223 | positive regulation of oxidative stress-induced neuron death(GO:1903223) |
0.4 | 1.1 | GO:0021564 | vagus nerve development(GO:0021564) |
0.4 | 1.1 | GO:0006172 | ADP biosynthetic process(GO:0006172) |
0.3 | 1.2 | GO:0002924 | negative regulation of humoral immune response mediated by circulating immunoglobulin(GO:0002924) |
0.3 | 1.7 | GO:0031547 | brain-derived neurotrophic factor receptor signaling pathway(GO:0031547) |
0.3 | 1.4 | GO:0007256 | activation of JNKK activity(GO:0007256) |
0.3 | 0.8 | GO:0061642 | chemoattraction of axon(GO:0061642) |
0.3 | 1.3 | GO:0033564 | anterior/posterior axon guidance(GO:0033564) |
0.2 | 0.9 | GO:0010724 | regulation of definitive erythrocyte differentiation(GO:0010724) |
0.2 | 0.7 | GO:0007525 | somatic muscle development(GO:0007525) |
0.2 | 0.7 | GO:1902564 | negative regulation of neutrophil activation(GO:1902564) |
0.2 | 0.6 | GO:0061470 | T follicular helper cell differentiation(GO:0061470) |
0.2 | 0.6 | GO:0007223 | Wnt signaling pathway, calcium modulating pathway(GO:0007223) |
0.2 | 0.6 | GO:0086046 | membrane depolarization during SA node cell action potential(GO:0086046) |
0.2 | 0.5 | GO:0021593 | rhombomere morphogenesis(GO:0021593) |
0.2 | 0.7 | GO:0090427 | activation of meiosis(GO:0090427) |
0.2 | 0.2 | GO:1905005 | regulation of epithelial to mesenchymal transition involved in endocardial cushion formation(GO:1905005) |
0.2 | 0.5 | GO:0030241 | skeletal muscle myosin thick filament assembly(GO:0030241) striated muscle myosin thick filament assembly(GO:0071688) |
0.2 | 0.5 | GO:0006701 | progesterone biosynthetic process(GO:0006701) |
0.1 | 0.4 | GO:0003289 | atrial septum primum morphogenesis(GO:0003289) |
0.1 | 0.4 | GO:0045218 | zonula adherens maintenance(GO:0045218) |
0.1 | 0.6 | GO:0038165 | oncostatin-M-mediated signaling pathway(GO:0038165) |
0.1 | 0.4 | GO:2000097 | regulation of smooth muscle cell-matrix adhesion(GO:2000097) |
0.1 | 0.6 | GO:0070779 | D-aspartate transport(GO:0070777) D-aspartate import(GO:0070779) |
0.1 | 0.4 | GO:0015014 | heparan sulfate proteoglycan biosynthetic process, polysaccharide chain biosynthetic process(GO:0015014) |
0.1 | 0.4 | GO:0051182 | coenzyme transport(GO:0051182) |
0.1 | 0.4 | GO:0098735 | positive regulation of the force of heart contraction(GO:0098735) |
0.1 | 0.4 | GO:1903984 | positive regulation of TRAIL-activated apoptotic signaling pathway(GO:1903984) |
0.1 | 0.6 | GO:0048386 | positive regulation of retinoic acid receptor signaling pathway(GO:0048386) |
0.1 | 0.4 | GO:1990034 | calcium ion export from cell(GO:1990034) |
0.1 | 0.6 | GO:0071415 | cellular response to caffeine(GO:0071313) cellular response to purine-containing compound(GO:0071415) |
0.1 | 0.5 | GO:0031508 | pericentric heterochromatin assembly(GO:0031508) |
0.1 | 0.3 | GO:2000721 | positive regulation of transcription from RNA polymerase II promoter involved in smooth muscle cell differentiation(GO:2000721) |
0.1 | 0.3 | GO:0097155 | fasciculation of sensory neuron axon(GO:0097155) |
0.1 | 0.3 | GO:0048682 | axon extension involved in regeneration(GO:0048677) sprouting of injured axon(GO:0048682) |
0.1 | 0.3 | GO:0001831 | trophectodermal cellular morphogenesis(GO:0001831) |
0.1 | 0.3 | GO:2000599 | regulation of cyclin catabolic process(GO:2000598) negative regulation of cyclin catabolic process(GO:2000599) |
0.1 | 0.3 | GO:2000302 | positive regulation of synaptic vesicle exocytosis(GO:2000302) |
0.1 | 0.6 | GO:0061304 | retinal blood vessel morphogenesis(GO:0061304) |
0.1 | 0.1 | GO:1902996 | neurofibrillary tangle assembly(GO:1902988) regulation of neurofibrillary tangle assembly(GO:1902996) |
0.1 | 0.3 | GO:0021773 | striatal medium spiny neuron differentiation(GO:0021773) |
0.1 | 0.3 | GO:0072137 | condensed mesenchymal cell proliferation(GO:0072137) |
0.1 | 0.3 | GO:0006667 | sphinganine metabolic process(GO:0006667) |
0.1 | 0.6 | GO:0060718 | chorionic trophoblast cell differentiation(GO:0060718) |
0.1 | 0.4 | GO:0035021 | negative regulation of Rac protein signal transduction(GO:0035021) |
0.1 | 0.6 | GO:0000820 | regulation of glutamine family amino acid metabolic process(GO:0000820) |
0.1 | 0.3 | GO:0060585 | regulation of prostaglandin-endoperoxide synthase activity(GO:0060584) positive regulation of prostaglandin-endoperoxide synthase activity(GO:0060585) |
0.1 | 0.4 | GO:1903966 | monounsaturated fatty acid metabolic process(GO:1903964) monounsaturated fatty acid biosynthetic process(GO:1903966) |
0.1 | 0.3 | GO:1902263 | apoptotic process involved in embryonic digit morphogenesis(GO:1902263) |
0.1 | 0.3 | GO:0032439 | endosome localization(GO:0032439) |
0.1 | 0.3 | GO:0051891 | positive regulation of cardioblast differentiation(GO:0051891) |
0.1 | 0.3 | GO:0035609 | C-terminal protein deglutamylation(GO:0035609) |
0.1 | 0.4 | GO:0046499 | S-adenosylmethioninamine metabolic process(GO:0046499) |
0.1 | 0.6 | GO:0007207 | adenylate cyclase-inhibiting G-protein coupled acetylcholine receptor signaling pathway(GO:0007197) phospholipase C-activating G-protein coupled acetylcholine receptor signaling pathway(GO:0007207) |
0.1 | 0.3 | GO:0032474 | otolith morphogenesis(GO:0032474) |
0.1 | 0.3 | GO:0097503 | sialylation(GO:0097503) |
0.1 | 0.8 | GO:0097062 | dendritic spine maintenance(GO:0097062) |
0.1 | 0.7 | GO:0018095 | protein polyglutamylation(GO:0018095) |
0.1 | 0.3 | GO:0003062 | regulation of heart rate by chemical signal(GO:0003062) |
0.1 | 0.3 | GO:2000546 | positive regulation of cell chemotaxis to fibroblast growth factor(GO:1904849) positive regulation of endothelial cell chemotaxis to fibroblast growth factor(GO:2000546) |
0.1 | 0.3 | GO:2001286 | regulation of caveolin-mediated endocytosis(GO:2001286) |
0.1 | 0.3 | GO:0030035 | microspike assembly(GO:0030035) |
0.1 | 0.2 | GO:0070100 | negative regulation of chemokine-mediated signaling pathway(GO:0070100) |
0.1 | 0.4 | GO:0097105 | presynaptic membrane assembly(GO:0097105) |
0.1 | 0.7 | GO:0021785 | branchiomotor neuron axon guidance(GO:0021785) |
0.1 | 0.3 | GO:1902534 | single-organism membrane invagination(GO:1902534) |
0.1 | 0.2 | GO:0033058 | directional locomotion(GO:0033058) |
0.1 | 0.5 | GO:0021869 | forebrain ventricular zone progenitor cell division(GO:0021869) |
0.1 | 0.4 | GO:0061042 | vascular wound healing(GO:0061042) |
0.1 | 0.2 | GO:0010847 | regulation of chromatin assembly(GO:0010847) |
0.1 | 0.4 | GO:0060762 | regulation of branching involved in mammary gland duct morphogenesis(GO:0060762) |
0.1 | 0.2 | GO:0061092 | regulation of phospholipid translocation(GO:0061091) positive regulation of phospholipid translocation(GO:0061092) |
0.1 | 0.5 | GO:0060509 | Type I pneumocyte differentiation(GO:0060509) |
0.1 | 0.5 | GO:0010944 | negative regulation of transcription by competitive promoter binding(GO:0010944) |
0.1 | 0.2 | GO:0032289 | central nervous system myelin formation(GO:0032289) |
0.1 | 0.3 | GO:0006549 | isoleucine metabolic process(GO:0006549) |
0.1 | 0.2 | GO:1903416 | response to glycoside(GO:1903416) |
0.1 | 0.2 | GO:0014734 | skeletal muscle hypertrophy(GO:0014734) |
0.1 | 0.1 | GO:0061643 | chemorepulsion of axon(GO:0061643) |
0.1 | 0.2 | GO:0035887 | aortic smooth muscle cell differentiation(GO:0035887) |
0.1 | 0.2 | GO:0000350 | generation of catalytic spliceosome for second transesterification step(GO:0000350) |
0.1 | 0.5 | GO:1901841 | regulation of high voltage-gated calcium channel activity(GO:1901841) |
0.1 | 0.2 | GO:0007228 | positive regulation of hh target transcription factor activity(GO:0007228) |
0.1 | 0.3 | GO:0060414 | aorta smooth muscle tissue morphogenesis(GO:0060414) |
0.1 | 0.1 | GO:1902488 | cholangiocyte apoptotic process(GO:1902488) regulation of cholangiocyte apoptotic process(GO:1904192) negative regulation of cholangiocyte apoptotic process(GO:1904193) |
0.1 | 0.3 | GO:0098915 | membrane repolarization during ventricular cardiac muscle cell action potential(GO:0098915) |
0.1 | 0.4 | GO:0090557 | establishment of endothelial intestinal barrier(GO:0090557) |
0.1 | 0.2 | GO:0071896 | protein localization to adherens junction(GO:0071896) |
0.1 | 0.2 | GO:0070120 | ciliary neurotrophic factor-mediated signaling pathway(GO:0070120) |
0.1 | 0.2 | GO:2000741 | positive regulation of mesenchymal stem cell differentiation(GO:2000741) |
0.1 | 0.3 | GO:0060839 | endothelial cell fate commitment(GO:0060839) |
0.1 | 0.2 | GO:2001025 | positive regulation of response to drug(GO:2001025) |
0.1 | 0.2 | GO:0046600 | negative regulation of centriole replication(GO:0046600) |
0.1 | 0.4 | GO:0060028 | convergent extension involved in axis elongation(GO:0060028) |
0.1 | 0.1 | GO:0098904 | regulation of AV node cell action potential(GO:0098904) |
0.1 | 0.3 | GO:0051534 | negative regulation of NFAT protein import into nucleus(GO:0051534) |
0.1 | 0.2 | GO:0002175 | protein localization to paranode region of axon(GO:0002175) |
0.1 | 0.2 | GO:0021882 | regulation of transcription from RNA polymerase II promoter involved in forebrain neuron fate commitment(GO:0021882) |
0.1 | 1.2 | GO:0010107 | potassium ion import(GO:0010107) |
0.1 | 0.2 | GO:0039689 | negative stranded viral RNA replication(GO:0039689) multi-organism biosynthetic process(GO:0044034) |
0.1 | 0.2 | GO:0090135 | actin filament branching(GO:0090135) |
0.1 | 0.4 | GO:0038063 | collagen-activated tyrosine kinase receptor signaling pathway(GO:0038063) |
0.1 | 0.1 | GO:0010248 | establishment or maintenance of transmembrane electrochemical gradient(GO:0010248) |
0.1 | 0.1 | GO:0048382 | mesendoderm development(GO:0048382) |
0.1 | 0.4 | GO:0048312 | intracellular distribution of mitochondria(GO:0048312) |
0.0 | 0.4 | GO:0035733 | hepatic stellate cell activation(GO:0035733) regulation of hepatic stellate cell activation(GO:2000489) |
0.0 | 0.0 | GO:0039663 | fusion of virus membrane with host plasma membrane(GO:0019064) membrane fusion involved in viral entry into host cell(GO:0039663) multi-organism membrane fusion(GO:0044800) |
0.0 | 0.3 | GO:0006654 | phosphatidic acid biosynthetic process(GO:0006654) |
0.0 | 0.1 | GO:0042091 | interleukin-10 biosynthetic process(GO:0042091) regulation of interleukin-10 biosynthetic process(GO:0045074) |
0.0 | 0.5 | GO:0003148 | outflow tract septum morphogenesis(GO:0003148) |
0.0 | 0.0 | GO:0090154 | positive regulation of sphingolipid biosynthetic process(GO:0090154) positive regulation of ceramide biosynthetic process(GO:2000304) |
0.0 | 0.1 | GO:2000346 | negative regulation of hepatocyte proliferation(GO:2000346) |
0.0 | 0.2 | GO:0023041 | neuronal signal transduction(GO:0023041) |
0.0 | 0.2 | GO:0016081 | synaptic vesicle docking(GO:0016081) |
0.0 | 0.2 | GO:0019478 | D-amino acid catabolic process(GO:0019478) |
0.0 | 0.1 | GO:0015820 | branched-chain amino acid transport(GO:0015803) leucine transport(GO:0015820) |
0.0 | 0.0 | GO:1901187 | regulation of ephrin receptor signaling pathway(GO:1901187) |
0.0 | 0.1 | GO:0060319 | primitive erythrocyte differentiation(GO:0060319) |
0.0 | 0.4 | GO:0031274 | positive regulation of pseudopodium assembly(GO:0031274) |
0.0 | 0.2 | GO:0061055 | myotome development(GO:0061055) |
0.0 | 0.3 | GO:2001214 | positive regulation of vasculogenesis(GO:2001214) |
0.0 | 0.5 | GO:0003334 | keratinocyte development(GO:0003334) |
0.0 | 0.2 | GO:0031507 | heterochromatin assembly(GO:0031507) |
0.0 | 0.1 | GO:0003431 | growth plate cartilage chondrocyte development(GO:0003431) |
0.0 | 0.1 | GO:0007621 | negative regulation of female receptivity(GO:0007621) |
0.0 | 0.1 | GO:0030222 | eosinophil differentiation(GO:0030222) |
0.0 | 0.1 | GO:1900825 | regulation of membrane depolarization during cardiac muscle cell action potential(GO:1900825) |
0.0 | 0.0 | GO:0097168 | mesenchymal stem cell proliferation(GO:0097168) |
0.0 | 0.3 | GO:0070314 | G1 to G0 transition(GO:0070314) |
0.0 | 0.6 | GO:0090036 | regulation of protein kinase C signaling(GO:0090036) |
0.0 | 0.0 | GO:0033088 | negative regulation of immature T cell proliferation in thymus(GO:0033088) |
0.0 | 0.1 | GO:0010757 | negative regulation of plasminogen activation(GO:0010757) |
0.0 | 0.1 | GO:0060454 | positive regulation of gastric acid secretion(GO:0060454) |
0.0 | 0.2 | GO:2000574 | regulation of microtubule motor activity(GO:2000574) |
0.0 | 0.2 | GO:0030578 | PML body organization(GO:0030578) |
0.0 | 0.1 | GO:0006663 | platelet activating factor biosynthetic process(GO:0006663) platelet activating factor metabolic process(GO:0046469) |
0.0 | 0.1 | GO:1903336 | negative regulation of vacuolar transport(GO:1903336) |
0.0 | 0.3 | GO:0001778 | plasma membrane repair(GO:0001778) |
0.0 | 0.3 | GO:0048012 | hepatocyte growth factor receptor signaling pathway(GO:0048012) |
0.0 | 0.1 | GO:0048294 | negative regulation of isotype switching to IgE isotypes(GO:0048294) |
0.0 | 0.2 | GO:1900454 | positive regulation of long term synaptic depression(GO:1900454) |
0.0 | 0.3 | GO:0021796 | cerebral cortex regionalization(GO:0021796) |
0.0 | 0.0 | GO:0086045 | membrane depolarization during AV node cell action potential(GO:0086045) |
0.0 | 0.4 | GO:0042492 | gamma-delta T cell differentiation(GO:0042492) |
0.0 | 0.1 | GO:0032687 | negative regulation of interferon-alpha production(GO:0032687) |
0.0 | 0.1 | GO:0035993 | deltoid tuberosity development(GO:0035993) |
0.0 | 0.6 | GO:0061099 | negative regulation of protein tyrosine kinase activity(GO:0061099) |
0.0 | 0.1 | GO:0015015 | heparan sulfate proteoglycan biosynthetic process, enzymatic modification(GO:0015015) |
0.0 | 0.1 | GO:0021873 | forebrain neuroblast division(GO:0021873) |
0.0 | 0.1 | GO:0071727 | response to triacyl bacterial lipopeptide(GO:0071725) cellular response to triacyl bacterial lipopeptide(GO:0071727) |
0.0 | 0.1 | GO:0010991 | negative regulation of SMAD protein complex assembly(GO:0010991) |
0.0 | 0.0 | GO:0032286 | central nervous system myelin maintenance(GO:0032286) |
0.0 | 0.1 | GO:1902805 | positive regulation of synaptic vesicle transport(GO:1902805) |
0.0 | 0.3 | GO:0090136 | epithelial cell-cell adhesion(GO:0090136) |
0.0 | 0.5 | GO:0016082 | synaptic vesicle priming(GO:0016082) |
0.0 | 0.1 | GO:0033227 | dsRNA transport(GO:0033227) |
0.0 | 0.0 | GO:0046098 | guanine metabolic process(GO:0046098) |
0.0 | 0.5 | GO:0045725 | positive regulation of glycogen biosynthetic process(GO:0045725) |
0.0 | 0.2 | GO:2000394 | positive regulation of lamellipodium morphogenesis(GO:2000394) |
0.0 | 0.2 | GO:0032792 | negative regulation of CREB transcription factor activity(GO:0032792) |
0.0 | 0.0 | GO:0032079 | positive regulation of endodeoxyribonuclease activity(GO:0032079) |
0.0 | 0.2 | GO:0090179 | planar cell polarity pathway involved in neural tube closure(GO:0090179) |
0.0 | 0.1 | GO:0007494 | midgut development(GO:0007494) |
0.0 | 0.2 | GO:0043568 | positive regulation of insulin-like growth factor receptor signaling pathway(GO:0043568) |
0.0 | 0.2 | GO:0034351 | negative regulation of glial cell apoptotic process(GO:0034351) |
0.0 | 0.1 | GO:0051835 | positive regulation of synapse structural plasticity(GO:0051835) |
0.0 | 0.2 | GO:1900028 | negative regulation of ruffle assembly(GO:1900028) |
0.0 | 0.1 | GO:0046533 | negative regulation of photoreceptor cell differentiation(GO:0046533) |
0.0 | 0.1 | GO:0071372 | cellular response to follicle-stimulating hormone stimulus(GO:0071372) |
0.0 | 0.1 | GO:0060696 | regulation of phospholipid catabolic process(GO:0060696) |
0.0 | 0.2 | GO:0006620 | posttranslational protein targeting to membrane(GO:0006620) |
0.0 | 0.1 | GO:0071926 | cannabinoid signaling pathway(GO:0038171) endocannabinoid signaling pathway(GO:0071926) |
0.0 | 0.1 | GO:0044336 | canonical Wnt signaling pathway involved in negative regulation of apoptotic process(GO:0044336) |
0.0 | 0.2 | GO:0060481 | lobar bronchus epithelium development(GO:0060481) |
0.0 | 0.1 | GO:0048818 | positive regulation of hair follicle maturation(GO:0048818) |
0.0 | 0.0 | GO:0010990 | regulation of SMAD protein complex assembly(GO:0010990) |
0.0 | 0.3 | GO:0033327 | Leydig cell differentiation(GO:0033327) |
0.0 | 0.3 | GO:0016322 | neuron remodeling(GO:0016322) |
0.0 | 0.1 | GO:0031034 | myosin filament assembly(GO:0031034) |
0.0 | 0.2 | GO:0048733 | sebaceous gland development(GO:0048733) |
0.0 | 0.1 | GO:0080154 | regulation of fertilization(GO:0080154) |
0.0 | 0.1 | GO:0042360 | vitamin E metabolic process(GO:0042360) |
0.0 | 0.3 | GO:0045060 | negative thymic T cell selection(GO:0045060) |
0.0 | 0.1 | GO:0035521 | monoubiquitinated histone deubiquitination(GO:0035521) monoubiquitinated histone H2A deubiquitination(GO:0035522) |
0.0 | 0.5 | GO:0021895 | cerebral cortex neuron differentiation(GO:0021895) |
0.0 | 0.1 | GO:0045759 | negative regulation of action potential(GO:0045759) |
0.0 | 0.1 | GO:1900020 | regulation of protein kinase C activity(GO:1900019) positive regulation of protein kinase C activity(GO:1900020) |
0.0 | 0.2 | GO:0021631 | optic nerve morphogenesis(GO:0021631) |
0.0 | 0.0 | GO:1902262 | apoptotic process involved in patterning of blood vessels(GO:1902262) |
0.0 | 0.1 | GO:1901387 | positive regulation of voltage-gated calcium channel activity(GO:1901387) |
0.0 | 0.1 | GO:0090526 | regulation of gluconeogenesis involved in cellular glucose homeostasis(GO:0090526) |
0.0 | 0.1 | GO:0014877 | response to inactivity(GO:0014854) response to muscle inactivity(GO:0014870) response to muscle inactivity involved in regulation of muscle adaptation(GO:0014877) response to denervation involved in regulation of muscle adaptation(GO:0014894) |
0.0 | 0.0 | GO:0060978 | angiogenesis involved in coronary vascular morphogenesis(GO:0060978) |
0.0 | 0.1 | GO:0055118 | negative regulation of cardiac muscle contraction(GO:0055118) |
0.0 | 0.1 | GO:0045901 | positive regulation of translational elongation(GO:0045901) |
0.0 | 0.1 | GO:0019919 | peptidyl-arginine methylation, to asymmetrical-dimethyl arginine(GO:0019919) |
0.0 | 0.1 | GO:0030950 | establishment or maintenance of actin cytoskeleton polarity(GO:0030950) |
0.0 | 0.0 | GO:0090394 | negative regulation of excitatory postsynaptic potential(GO:0090394) |
0.0 | 0.4 | GO:0007614 | short-term memory(GO:0007614) |
0.0 | 0.0 | GO:0007403 | glial cell fate determination(GO:0007403) |
0.0 | 0.1 | GO:0060681 | branch elongation involved in ureteric bud branching(GO:0060681) |
0.0 | 0.1 | GO:0010446 | response to alkaline pH(GO:0010446) |
0.0 | 0.1 | GO:0035469 | determination of pancreatic left/right asymmetry(GO:0035469) |
0.0 | 0.1 | GO:0006113 | fermentation(GO:0006113) glucose catabolic process to lactate(GO:0019659) glycolytic fermentation(GO:0019660) glucose catabolic process to lactate via pyruvate(GO:0019661) |
0.0 | 0.1 | GO:1903261 | regulation of serine phosphorylation of STAT3 protein(GO:1903261) |
0.0 | 0.1 | GO:0007195 | adenylate cyclase-inhibiting dopamine receptor signaling pathway(GO:0007195) |
0.0 | 0.3 | GO:0001765 | membrane raft assembly(GO:0001765) |
0.0 | 0.2 | GO:0031290 | retinal ganglion cell axon guidance(GO:0031290) |
0.0 | 0.4 | GO:0006044 | N-acetylglucosamine metabolic process(GO:0006044) |
0.0 | 0.0 | GO:0032763 | regulation of mast cell cytokine production(GO:0032763) |
0.0 | 0.0 | GO:0002442 | serotonin production involved in inflammatory response(GO:0002351) serotonin secretion involved in inflammatory response(GO:0002442) serotonin secretion by platelet(GO:0002554) |
0.0 | 0.2 | GO:2000105 | positive regulation of DNA-dependent DNA replication(GO:2000105) |
0.0 | 0.1 | GO:0001560 | regulation of cell growth by extracellular stimulus(GO:0001560) |
0.0 | 0.1 | GO:0060744 | thelarche(GO:0042695) mammary gland branching involved in thelarche(GO:0060744) |
0.0 | 0.2 | GO:0072673 | lamellipodium morphogenesis(GO:0072673) |
0.0 | 0.0 | GO:0055005 | ventricular cardiac myofibril assembly(GO:0055005) |
0.0 | 0.2 | GO:0071420 | response to histamine(GO:0034776) cellular response to histamine(GO:0071420) |
0.0 | 0.1 | GO:0051387 | negative regulation of neurotrophin TRK receptor signaling pathway(GO:0051387) |
0.0 | 0.2 | GO:0034501 | protein localization to kinetochore(GO:0034501) |
0.0 | 0.1 | GO:0035582 | sequestering of BMP in extracellular matrix(GO:0035582) |
0.0 | 0.2 | GO:0034058 | endosomal vesicle fusion(GO:0034058) |
0.0 | 0.1 | GO:0019344 | cysteine biosynthetic process(GO:0019344) |
0.0 | 0.1 | GO:0002282 | microglial cell activation involved in immune response(GO:0002282) |
0.0 | 0.1 | GO:0021521 | ventral spinal cord interneuron specification(GO:0021521) cell fate specification involved in pattern specification(GO:0060573) |
0.0 | 0.1 | GO:1903753 | negative regulation of p38MAPK cascade(GO:1903753) |
0.0 | 0.1 | GO:0016198 | axon choice point recognition(GO:0016198) |
0.0 | 0.0 | GO:1903799 | negative regulation of production of miRNAs involved in gene silencing by miRNA(GO:1903799) |
0.0 | 0.0 | GO:0014735 | regulation of muscle atrophy(GO:0014735) |
0.0 | 0.0 | GO:0019371 | cyclooxygenase pathway(GO:0019371) |
0.0 | 0.1 | GO:1901420 | negative regulation of response to alcohol(GO:1901420) |
0.0 | 1.1 | GO:0050885 | neuromuscular process controlling balance(GO:0050885) |
0.0 | 0.1 | GO:0072385 | minus-end-directed organelle transport along microtubule(GO:0072385) |
0.0 | 0.0 | GO:0021775 | smoothened signaling pathway involved in ventral spinal cord interneuron specification(GO:0021775) smoothened signaling pathway involved in spinal cord motor neuron cell fate specification(GO:0021776) |
0.0 | 0.1 | GO:0021902 | commitment of neuronal cell to specific neuron type in forebrain(GO:0021902) |
0.0 | 0.0 | GO:0072180 | mesonephric duct development(GO:0072177) mesonephric duct morphogenesis(GO:0072180) |
0.0 | 0.1 | GO:0003180 | aortic valve development(GO:0003176) aortic valve morphogenesis(GO:0003180) |
0.0 | 0.1 | GO:0002051 | osteoblast fate commitment(GO:0002051) |
0.0 | 0.1 | GO:0006398 | mRNA 3'-end processing by stem-loop binding and cleavage(GO:0006398) |
0.0 | 0.1 | GO:2000382 | positive regulation of mesoderm development(GO:2000382) |
0.0 | 0.1 | GO:0033184 | positive regulation of histone ubiquitination(GO:0033184) |
0.0 | 0.3 | GO:0048745 | smooth muscle tissue development(GO:0048745) |
0.0 | 0.1 | GO:0034975 | protein folding in endoplasmic reticulum(GO:0034975) |
0.0 | 0.2 | GO:0060670 | branching involved in labyrinthine layer morphogenesis(GO:0060670) |
0.0 | 0.1 | GO:0060468 | prevention of polyspermy(GO:0060468) |
0.0 | 0.0 | GO:0032417 | positive regulation of sodium:proton antiporter activity(GO:0032417) |
0.0 | 0.0 | GO:0070294 | renal sodium ion absorption(GO:0070294) |
0.0 | 0.3 | GO:0060074 | synapse maturation(GO:0060074) |
0.0 | 0.1 | GO:0042414 | epinephrine metabolic process(GO:0042414) |
0.0 | 0.1 | GO:0021860 | pyramidal neuron development(GO:0021860) |
0.0 | 0.1 | GO:0051964 | negative regulation of synapse assembly(GO:0051964) |
0.0 | 0.1 | GO:0048702 | embryonic neurocranium morphogenesis(GO:0048702) |
0.0 | 0.0 | GO:0010735 | positive regulation of transcription via serum response element binding(GO:0010735) |
0.0 | 0.1 | GO:0015744 | succinate transport(GO:0015744) |
0.0 | 0.1 | GO:0061366 | behavioral response to chemical pain(GO:0061366) behavioral response to formalin induced pain(GO:0061368) |
0.0 | 0.0 | GO:1902075 | cellular response to salt(GO:1902075) |
0.0 | 0.2 | GO:0045717 | negative regulation of fatty acid biosynthetic process(GO:0045717) |
0.0 | 0.0 | GO:0001757 | somite specification(GO:0001757) |
0.0 | 0.1 | GO:0035372 | protein localization to microtubule(GO:0035372) |
0.0 | 0.1 | GO:0071493 | cellular response to UV-B(GO:0071493) |
0.0 | 0.1 | GO:0042760 | very long-chain fatty acid catabolic process(GO:0042760) |
0.0 | 0.6 | GO:0043252 | sodium-independent organic anion transport(GO:0043252) |
0.0 | 0.1 | GO:0090336 | positive regulation of brown fat cell differentiation(GO:0090336) |
0.0 | 0.1 | GO:0019800 | peptide cross-linking via chondroitin 4-sulfate glycosaminoglycan(GO:0019800) |
0.0 | 0.3 | GO:0051127 | positive regulation of actin nucleation(GO:0051127) |
0.0 | 0.2 | GO:0006013 | mannose metabolic process(GO:0006013) |
0.0 | 0.4 | GO:0050901 | leukocyte tethering or rolling(GO:0050901) |
0.0 | 0.0 | GO:0048550 | negative regulation of pinocytosis(GO:0048550) |
0.0 | 0.1 | GO:1902415 | regulation of mRNA binding(GO:1902415) regulation of RNA binding(GO:1905214) |
0.0 | 0.2 | GO:0016338 | calcium-independent cell-cell adhesion via plasma membrane cell-adhesion molecules(GO:0016338) |
0.0 | 0.3 | GO:0021955 | central nervous system neuron axonogenesis(GO:0021955) |
0.0 | 0.1 | GO:0035507 | regulation of myosin-light-chain-phosphatase activity(GO:0035507) |
0.0 | 0.0 | GO:1990086 | lens fiber cell apoptotic process(GO:1990086) |
0.0 | 0.1 | GO:0045852 | pH elevation(GO:0045852) intracellular pH elevation(GO:0051454) |
0.0 | 0.0 | GO:0060266 | negative regulation of respiratory burst involved in inflammatory response(GO:0060266) |
0.0 | 0.1 | GO:0090043 | regulation of tubulin deacetylation(GO:0090043) |
0.0 | 0.1 | GO:0051045 | negative regulation of membrane protein ectodomain proteolysis(GO:0051045) |
0.0 | 0.0 | GO:0035246 | peptidyl-arginine N-methylation(GO:0035246) |
0.0 | 0.0 | GO:0021913 | regulation of transcription from RNA polymerase II promoter involved in ventral spinal cord interneuron specification(GO:0021913) |
0.0 | 0.1 | GO:0043312 | neutrophil degranulation(GO:0043312) |
0.0 | 0.2 | GO:0097320 | membrane tubulation(GO:0097320) |
0.0 | 0.2 | GO:0044342 | type B pancreatic cell proliferation(GO:0044342) |
0.0 | 0.0 | GO:0000101 | sulfur amino acid transport(GO:0000101) |
0.0 | 0.2 | GO:0035235 | ionotropic glutamate receptor signaling pathway(GO:0035235) |
0.0 | 0.1 | GO:0001905 | activation of membrane attack complex(GO:0001905) regulation of activation of membrane attack complex(GO:0001969) |
0.0 | 0.0 | GO:0050847 | progesterone receptor signaling pathway(GO:0050847) |
0.0 | 0.0 | GO:0014826 | vein smooth muscle contraction(GO:0014826) |
0.0 | 0.1 | GO:0007296 | vitellogenesis(GO:0007296) |
0.0 | 0.1 | GO:2000650 | negative regulation of sodium ion transmembrane transporter activity(GO:2000650) |
0.0 | 0.0 | GO:1904938 | dopaminergic neuron axon guidance(GO:0036514) planar cell polarity pathway involved in axon guidance(GO:1904938) |
0.0 | 0.1 | GO:0015819 | lysine transport(GO:0015819) |
0.0 | 0.1 | GO:0019482 | beta-alanine metabolic process(GO:0019482) |
0.0 | 0.0 | GO:0003344 | pericardium morphogenesis(GO:0003344) |
0.0 | 0.1 | GO:0006561 | proline biosynthetic process(GO:0006561) |
0.0 | 0.1 | GO:0046881 | positive regulation of follicle-stimulating hormone secretion(GO:0046881) |
0.0 | 0.1 | GO:1902309 | negative regulation of peptidyl-serine dephosphorylation(GO:1902309) |
0.0 | 0.1 | GO:0001771 | immunological synapse formation(GO:0001771) |
0.0 | 0.1 | GO:0032713 | negative regulation of interleukin-4 production(GO:0032713) |
0.0 | 0.0 | GO:0030050 | vesicle transport along actin filament(GO:0030050) |
0.0 | 0.1 | GO:0051764 | actin crosslink formation(GO:0051764) |
0.0 | 0.0 | GO:0072048 | pattern specification involved in kidney development(GO:0061004) renal system pattern specification(GO:0072048) |
0.0 | 0.2 | GO:0008045 | motor neuron axon guidance(GO:0008045) |
0.0 | 0.1 | GO:0007252 | I-kappaB phosphorylation(GO:0007252) |
0.0 | 0.1 | GO:0031666 | positive regulation of lipopolysaccharide-mediated signaling pathway(GO:0031666) |
0.0 | 0.1 | GO:0000733 | DNA strand renaturation(GO:0000733) |
0.0 | 0.1 | GO:0071947 | protein deubiquitination involved in ubiquitin-dependent protein catabolic process(GO:0071947) |
0.0 | 0.1 | GO:0033030 | negative regulation of neutrophil apoptotic process(GO:0033030) |
0.0 | 0.1 | GO:0001957 | intramembranous ossification(GO:0001957) direct ossification(GO:0036072) |
0.0 | 0.1 | GO:0060066 | oviduct development(GO:0060066) |
0.0 | 0.0 | GO:0072061 | inner medullary collecting duct development(GO:0072061) |
0.0 | 0.1 | GO:0044598 | polyketide metabolic process(GO:0030638) aminoglycoside antibiotic metabolic process(GO:0030647) daunorubicin metabolic process(GO:0044597) doxorubicin metabolic process(GO:0044598) |
0.0 | 0.1 | GO:0046341 | CDP-diacylglycerol metabolic process(GO:0046341) |
0.0 | 0.1 | GO:0097369 | sodium ion import(GO:0097369) sodium ion import across plasma membrane(GO:0098719) sodium ion import into cell(GO:1990118) |
0.0 | 0.0 | GO:0038145 | macrophage colony-stimulating factor signaling pathway(GO:0038145) |
0.0 | 0.3 | GO:1901016 | regulation of potassium ion transmembrane transporter activity(GO:1901016) |
0.0 | 0.0 | GO:0003433 | chondrocyte development involved in endochondral bone morphogenesis(GO:0003433) |
0.0 | 0.0 | GO:0051660 | establishment of centrosome localization(GO:0051660) |
0.0 | 0.1 | GO:2000686 | regulation of rubidium ion transmembrane transporter activity(GO:2000686) |
0.0 | 0.1 | GO:0051967 | negative regulation of synaptic transmission, glutamatergic(GO:0051967) |
0.0 | 0.1 | GO:0071404 | cellular response to low-density lipoprotein particle stimulus(GO:0071404) |
0.0 | 0.1 | GO:0060907 | positive regulation of macrophage cytokine production(GO:0060907) |
0.0 | 0.1 | GO:1903059 | regulation of protein lipidation(GO:1903059) |
0.0 | 0.0 | GO:0002378 | immunoglobulin biosynthetic process(GO:0002378) |
0.0 | 0.0 | GO:0046655 | folic acid metabolic process(GO:0046655) |
0.0 | 0.1 | GO:0001927 | exocyst assembly(GO:0001927) |
0.0 | 0.1 | GO:1901550 | regulation of endothelial cell development(GO:1901550) regulation of establishment of endothelial barrier(GO:1903140) |
0.0 | 0.0 | GO:1904017 | response to Thyroglobulin triiodothyronine(GO:1904016) cellular response to Thyroglobulin triiodothyronine(GO:1904017) |
0.0 | 0.3 | GO:0000301 | retrograde transport, vesicle recycling within Golgi(GO:0000301) |
0.0 | 0.1 | GO:0005984 | disaccharide metabolic process(GO:0005984) |
0.0 | 0.0 | GO:0072008 | glomerular mesangial cell differentiation(GO:0072008) glomerular mesangial cell development(GO:0072144) |
0.0 | 0.1 | GO:0021702 | cerebellar Purkinje cell differentiation(GO:0021702) |
0.0 | 0.0 | GO:0038128 | ERBB2 signaling pathway(GO:0038128) |
0.0 | 0.2 | GO:0042407 | cristae formation(GO:0042407) |
0.0 | 0.0 | GO:0007290 | spermatid nucleus elongation(GO:0007290) |
0.0 | 0.1 | GO:0032570 | response to progesterone(GO:0032570) |
0.0 | 0.3 | GO:0002089 | lens morphogenesis in camera-type eye(GO:0002089) |
0.0 | 0.0 | GO:0045897 | regulation of transcription during mitosis(GO:0045896) positive regulation of transcription during mitosis(GO:0045897) |
0.0 | 0.1 | GO:0050915 | sensory perception of sour taste(GO:0050915) |
0.0 | 0.0 | GO:0019230 | proprioception(GO:0019230) |
0.0 | 0.1 | GO:0001547 | antral ovarian follicle growth(GO:0001547) |
0.0 | 0.1 | GO:0014054 | positive regulation of gamma-aminobutyric acid secretion(GO:0014054) |
0.0 | 0.1 | GO:0035563 | positive regulation of chromatin binding(GO:0035563) |
0.0 | 0.2 | GO:0046697 | decidualization(GO:0046697) |
0.0 | 0.3 | GO:0030865 | cortical cytoskeleton organization(GO:0030865) |
0.0 | 0.1 | GO:0060669 | embryonic placenta morphogenesis(GO:0060669) |
0.0 | 0.0 | GO:0030327 | prenylated protein catabolic process(GO:0030327) |
0.0 | 0.1 | GO:0014028 | notochord formation(GO:0014028) |
0.0 | 0.0 | GO:1900108 | negative regulation of nodal signaling pathway(GO:1900108) |
0.0 | 0.2 | GO:0043153 | entrainment of circadian clock by photoperiod(GO:0043153) |
0.0 | 0.2 | GO:0051000 | positive regulation of nitric-oxide synthase activity(GO:0051000) |
0.0 | 0.1 | GO:0070528 | protein kinase C signaling(GO:0070528) |
0.0 | 0.2 | GO:1902230 | negative regulation of intrinsic apoptotic signaling pathway in response to DNA damage(GO:1902230) |
0.0 | 0.1 | GO:0007406 | negative regulation of neuroblast proliferation(GO:0007406) |
0.0 | 0.1 | GO:0001675 | acrosome assembly(GO:0001675) |
0.0 | 0.0 | GO:0072051 | juxtaglomerular apparatus development(GO:0072051) |
0.0 | 0.0 | GO:0035694 | mitochondrial protein catabolic process(GO:0035694) |
0.0 | 0.1 | GO:0042473 | outer ear morphogenesis(GO:0042473) |
0.0 | 0.0 | GO:0060923 | cardiac muscle cell fate commitment(GO:0060923) |
0.0 | 0.1 | GO:0015074 | DNA integration(GO:0015074) |
0.0 | 0.5 | GO:0048286 | lung alveolus development(GO:0048286) |
0.0 | 0.1 | GO:0035646 | endosome to melanosome transport(GO:0035646) cellular pigment accumulation(GO:0043482) endosome to pigment granule transport(GO:0043485) pigment granule maturation(GO:0048757) |
0.0 | 0.0 | GO:0035461 | vitamin transmembrane transport(GO:0035461) |
0.0 | 0.1 | GO:0035435 | phosphate ion transmembrane transport(GO:0035435) |
0.0 | 0.0 | GO:0006562 | proline catabolic process(GO:0006562) |
0.0 | 0.0 | GO:0001923 | B-1 B cell differentiation(GO:0001923) |
0.0 | 0.1 | GO:0031581 | hemidesmosome assembly(GO:0031581) |
0.0 | 0.1 | GO:0032196 | transposition(GO:0032196) |
0.0 | 0.0 | GO:1903849 | regulation of aorta morphogenesis(GO:1903847) positive regulation of aorta morphogenesis(GO:1903849) |
0.0 | 0.2 | GO:0016601 | Rac protein signal transduction(GO:0016601) |
0.0 | 0.2 | GO:0034724 | DNA replication-independent nucleosome assembly(GO:0006336) DNA replication-independent nucleosome organization(GO:0034724) |
0.0 | 0.0 | GO:0098908 | regulation of neuronal action potential(GO:0098908) |
0.0 | 0.0 | GO:0006933 | negative regulation of cell adhesion involved in substrate-bound cell migration(GO:0006933) |
0.0 | 0.0 | GO:0043578 | nuclear matrix organization(GO:0043578) nuclear matrix anchoring at nuclear membrane(GO:0090292) |
0.0 | 0.0 | GO:1903298 | regulation of hypoxia-induced intrinsic apoptotic signaling pathway(GO:1903297) negative regulation of hypoxia-induced intrinsic apoptotic signaling pathway(GO:1903298) |
0.0 | 0.1 | GO:0098789 | pre-mRNA cleavage required for polyadenylation(GO:0098789) |
0.0 | 0.0 | GO:0021825 | substrate-dependent cerebral cortex tangential migration(GO:0021825) |
0.0 | 0.1 | GO:0042482 | positive regulation of odontogenesis(GO:0042482) |
0.0 | 0.1 | GO:0033683 | nucleotide-excision repair, DNA incision(GO:0033683) |
0.0 | 0.1 | GO:0007221 | positive regulation of transcription of Notch receptor target(GO:0007221) |
0.0 | 0.1 | GO:0051152 | positive regulation of smooth muscle cell differentiation(GO:0051152) |
0.0 | 0.1 | GO:0006020 | inositol metabolic process(GO:0006020) |
0.0 | 0.1 | GO:0007210 | serotonin receptor signaling pathway(GO:0007210) |
0.0 | 0.1 | GO:0043353 | enucleate erythrocyte differentiation(GO:0043353) |
0.0 | 0.1 | GO:0071243 | cellular response to arsenic-containing substance(GO:0071243) |
0.0 | 0.0 | GO:0061669 | spontaneous neurotransmitter secretion(GO:0061669) spontaneous synaptic transmission(GO:0098814) |
0.0 | 0.0 | GO:0003199 | heart valve formation(GO:0003188) endocardial cushion to mesenchymal transition involved in heart valve formation(GO:0003199) |
0.0 | 0.0 | GO:0055099 | response to high density lipoprotein particle(GO:0055099) |
0.0 | 0.1 | GO:0010666 | positive regulation of striated muscle cell apoptotic process(GO:0010663) positive regulation of cardiac muscle cell apoptotic process(GO:0010666) |
0.0 | 0.0 | GO:0016554 | cytidine to uridine editing(GO:0016554) |
0.0 | 0.1 | GO:0000270 | peptidoglycan metabolic process(GO:0000270) peptidoglycan catabolic process(GO:0009253) |
0.0 | 0.0 | GO:0019249 | lactate biosynthetic process from pyruvate(GO:0019244) lactate biosynthetic process(GO:0019249) |
0.0 | 0.0 | GO:0061325 | cell proliferation involved in outflow tract morphogenesis(GO:0061325) |
0.0 | 0.0 | GO:0089700 | protein kinase D signaling(GO:0089700) |
0.0 | 0.0 | GO:0034316 | negative regulation of Arp2/3 complex-mediated actin nucleation(GO:0034316) |
0.0 | 0.1 | GO:0051197 | positive regulation of glycolytic process(GO:0045821) positive regulation of cofactor metabolic process(GO:0051194) positive regulation of coenzyme metabolic process(GO:0051197) |
0.0 | 0.0 | GO:1904468 | negative regulation of tumor necrosis factor secretion(GO:1904468) |
0.0 | 0.1 | GO:0032836 | glomerular basement membrane development(GO:0032836) |
0.0 | 0.0 | GO:0035524 | proline transmembrane transport(GO:0035524) |
0.0 | 0.0 | GO:0044828 | negative regulation by host of viral genome replication(GO:0044828) |
0.0 | 0.1 | GO:0034047 | regulation of protein phosphatase type 2A activity(GO:0034047) |
0.0 | 0.0 | GO:0019087 | transformation of host cell by virus(GO:0019087) |
0.0 | 0.0 | GO:0033499 | galactose catabolic process via UDP-galactose(GO:0033499) glycolytic process from galactose(GO:0061623) |
0.0 | 0.0 | GO:0035483 | gastric emptying(GO:0035483) |
0.0 | 0.0 | GO:0002018 | renin-angiotensin regulation of aldosterone production(GO:0002018) |
0.0 | 0.1 | GO:0035988 | chondrocyte proliferation(GO:0035988) |
0.0 | 0.0 | GO:0042769 | DNA damage response, detection of DNA damage(GO:0042769) |
0.0 | 0.0 | GO:0090156 | negative regulation of sphingolipid biosynthetic process(GO:0090155) cellular sphingolipid homeostasis(GO:0090156) negative regulation of ceramide biosynthetic process(GO:1900060) |
0.0 | 0.2 | GO:2001222 | regulation of neuron migration(GO:2001222) |
0.0 | 0.1 | GO:0071340 | skeletal muscle acetylcholine-gated channel clustering(GO:0071340) |
0.0 | 0.2 | GO:0070286 | axonemal dynein complex assembly(GO:0070286) |
0.0 | 0.0 | GO:2000427 | positive regulation of apoptotic cell clearance(GO:2000427) |
0.0 | 0.0 | GO:0040031 | snRNA modification(GO:0040031) |
0.0 | 0.2 | GO:0048791 | calcium ion-regulated exocytosis of neurotransmitter(GO:0048791) |
0.0 | 0.0 | GO:0097113 | AMPA glutamate receptor clustering(GO:0097113) glutamate receptor clustering(GO:0097688) |
0.0 | 0.0 | GO:0032071 | regulation of endodeoxyribonuclease activity(GO:0032071) |
0.0 | 0.0 | GO:0035826 | rubidium ion transport(GO:0035826) |
0.0 | 0.0 | GO:2001212 | regulation of vasculogenesis(GO:2001212) |
0.0 | 0.1 | GO:0015871 | choline transport(GO:0015871) |
0.0 | 0.0 | GO:0051771 | negative regulation of nitric-oxide synthase biosynthetic process(GO:0051771) |
0.0 | 0.0 | GO:1904180 | negative regulation of mitochondrial depolarization(GO:0051902) negative regulation of membrane depolarization(GO:1904180) |
0.0 | 0.0 | GO:0072240 | distal convoluted tubule development(GO:0072025) DCT cell differentiation(GO:0072069) metanephric distal convoluted tubule development(GO:0072221) metanephric distal tubule development(GO:0072235) metanephric DCT cell differentiation(GO:0072240) |
0.0 | 0.1 | GO:0032780 | negative regulation of ATPase activity(GO:0032780) |
0.0 | 0.1 | GO:0010954 | positive regulation of protein processing(GO:0010954) |
0.0 | 0.1 | GO:0010669 | epithelial structure maintenance(GO:0010669) |
0.0 | 0.0 | GO:2000053 | regulation of Wnt signaling pathway involved in dorsal/ventral axis specification(GO:2000053) |
0.0 | 0.1 | GO:0009052 | pentose-phosphate shunt, non-oxidative branch(GO:0009052) |
0.0 | 0.0 | GO:0070086 | ubiquitin-dependent endocytosis(GO:0070086) |
0.0 | 0.0 | GO:0034312 | diol biosynthetic process(GO:0034312) sphingosine biosynthetic process(GO:0046512) |
0.0 | 0.0 | GO:0001732 | formation of cytoplasmic translation initiation complex(GO:0001732) |
0.0 | 0.0 | GO:0090091 | positive regulation of extracellular matrix disassembly(GO:0090091) |
0.0 | 0.1 | GO:0060742 | epithelial cell differentiation involved in prostate gland development(GO:0060742) |
0.0 | 0.0 | GO:1990314 | cellular response to insulin-like growth factor stimulus(GO:1990314) |
0.0 | 0.0 | GO:0060373 | regulation of ventricular cardiac muscle cell membrane depolarization(GO:0060373) |
0.0 | 0.0 | GO:0060059 | embryonic retina morphogenesis in camera-type eye(GO:0060059) |
0.0 | 0.2 | GO:0007405 | neuroblast proliferation(GO:0007405) |
0.0 | 0.1 | GO:0006685 | sphingomyelin catabolic process(GO:0006685) |
0.0 | 0.1 | GO:0051570 | regulation of histone H3-K9 methylation(GO:0051570) |
0.0 | 0.0 | GO:0016553 | adenosine to inosine editing(GO:0006382) base conversion or substitution editing(GO:0016553) |
0.0 | 0.0 | GO:0090230 | regulation of centromere complex assembly(GO:0090230) |
0.0 | 0.0 | GO:1901727 | positive regulation of histone deacetylase activity(GO:1901727) |
0.0 | 0.0 | GO:0008054 | negative regulation of cyclin-dependent protein serine/threonine kinase by cyclin degradation(GO:0008054) |
0.0 | 0.0 | GO:1903333 | negative regulation of protein folding(GO:1903333) |
0.0 | 0.0 | GO:0072393 | microtubule anchoring at microtubule organizing center(GO:0072393) |
0.0 | 0.1 | GO:0021954 | central nervous system neuron development(GO:0021954) |
0.0 | 0.3 | GO:0045739 | positive regulation of DNA repair(GO:0045739) |
0.0 | 0.0 | GO:0060068 | vagina development(GO:0060068) |
0.0 | 0.0 | GO:0034628 | nicotinamide nucleotide biosynthetic process from aspartate(GO:0019355) 'de novo' NAD biosynthetic process from aspartate(GO:0034628) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.2 | 1.5 | GO:0002116 | semaphorin receptor complex(GO:0002116) |
0.1 | 1.1 | GO:0001520 | outer dense fiber(GO:0001520) |
0.1 | 0.9 | GO:0044300 | cerebellar mossy fiber(GO:0044300) |
0.1 | 0.8 | GO:0098645 | collagen type IV trimer(GO:0005587) network-forming collagen trimer(GO:0098642) collagen network(GO:0098645) basement membrane collagen trimer(GO:0098651) |
0.1 | 0.6 | GO:0048787 | presynaptic active zone membrane(GO:0048787) |
0.1 | 0.3 | GO:0005914 | spot adherens junction(GO:0005914) |
0.1 | 0.3 | GO:0005899 | insulin receptor complex(GO:0005899) |
0.1 | 0.8 | GO:0030314 | junctional membrane complex(GO:0030314) |
0.1 | 0.4 | GO:0042583 | chromaffin granule(GO:0042583) |
0.1 | 0.6 | GO:0005915 | zonula adherens(GO:0005915) |
0.1 | 0.3 | GO:0060053 | neurofilament cytoskeleton(GO:0060053) |
0.1 | 0.4 | GO:0031466 | Cul5-RING ubiquitin ligase complex(GO:0031466) |
0.1 | 0.3 | GO:1990812 | growth cone filopodium(GO:1990812) |
0.1 | 0.2 | GO:0097441 | basilar dendrite(GO:0097441) |
0.1 | 0.4 | GO:0000805 | X chromosome(GO:0000805) |
0.1 | 0.2 | GO:0070110 | ciliary neurotrophic factor receptor complex(GO:0070110) |
0.1 | 0.3 | GO:0031262 | Ndc80 complex(GO:0031262) |
0.1 | 0.3 | GO:0005610 | laminin-5 complex(GO:0005610) |
0.1 | 1.5 | GO:0048786 | presynaptic active zone(GO:0048786) |
0.1 | 0.3 | GO:0030485 | smooth muscle contractile fiber(GO:0030485) |
0.1 | 0.2 | GO:1990635 | proximal dendrite(GO:1990635) |
0.1 | 0.2 | GO:0097136 | Bcl-2 family protein complex(GO:0097136) |
0.1 | 0.6 | GO:0070938 | contractile ring(GO:0070938) |
0.1 | 0.2 | GO:0097451 | glial limiting end-foot(GO:0097451) |
0.1 | 0.2 | GO:0045298 | tubulin complex(GO:0045298) |
0.1 | 0.2 | GO:0005785 | signal recognition particle receptor complex(GO:0005785) |
0.0 | 2.7 | GO:0030315 | T-tubule(GO:0030315) |
0.0 | 0.2 | GO:0032279 | asymmetric synapse(GO:0032279) |
0.0 | 0.2 | GO:0071953 | elastic fiber(GO:0071953) |
0.0 | 2.3 | GO:0043198 | dendritic shaft(GO:0043198) |
0.0 | 0.3 | GO:0005859 | muscle myosin complex(GO:0005859) |
0.0 | 0.1 | GO:0034750 | Scrib-APC-beta-catenin complex(GO:0034750) |
0.0 | 0.3 | GO:0032009 | early phagosome(GO:0032009) |
0.0 | 0.2 | GO:0005964 | phosphorylase kinase complex(GO:0005964) |
0.0 | 0.3 | GO:0045179 | apical cortex(GO:0045179) |
0.0 | 0.5 | GO:0097431 | mitotic spindle pole(GO:0097431) |
0.0 | 0.2 | GO:0071203 | WASH complex(GO:0071203) |
0.0 | 0.1 | GO:0097427 | microtubule bundle(GO:0097427) |
0.0 | 0.2 | GO:0005642 | annulate lamellae(GO:0005642) |
0.0 | 0.1 | GO:0044393 | microspike(GO:0044393) |
0.0 | 0.1 | GO:0016600 | flotillin complex(GO:0016600) |
0.0 | 0.1 | GO:0042567 | insulin-like growth factor binding protein complex(GO:0016942) growth factor complex(GO:0036454) insulin-like growth factor ternary complex(GO:0042567) |
0.0 | 0.3 | GO:0020003 | symbiont-containing vacuole(GO:0020003) |
0.0 | 0.6 | GO:0000159 | protein phosphatase type 2A complex(GO:0000159) |
0.0 | 0.3 | GO:0005641 | nuclear envelope lumen(GO:0005641) |
0.0 | 0.1 | GO:0035339 | SPOTS complex(GO:0035339) |
0.0 | 0.2 | GO:0097470 | ribbon synapse(GO:0097470) |
0.0 | 0.2 | GO:0016342 | catenin complex(GO:0016342) |
0.0 | 0.2 | GO:0061617 | MICOS complex(GO:0061617) |
0.0 | 0.7 | GO:0031941 | filamentous actin(GO:0031941) |
0.0 | 0.3 | GO:0035102 | PRC1 complex(GO:0035102) |
0.0 | 0.4 | GO:0043240 | Fanconi anaemia nuclear complex(GO:0043240) |
0.0 | 1.5 | GO:0019005 | SCF ubiquitin ligase complex(GO:0019005) |
0.0 | 0.2 | GO:0005861 | troponin complex(GO:0005861) |
0.0 | 0.1 | GO:0009331 | glycerol-3-phosphate dehydrogenase complex(GO:0009331) |
0.0 | 0.1 | GO:0005927 | muscle tendon junction(GO:0005927) |
0.0 | 0.1 | GO:0034457 | Mpp10 complex(GO:0034457) |
0.0 | 1.6 | GO:0042641 | actomyosin(GO:0042641) |
0.0 | 0.3 | GO:0005916 | fascia adherens(GO:0005916) |
0.0 | 0.9 | GO:0031901 | early endosome membrane(GO:0031901) |
0.0 | 0.2 | GO:0005677 | chromatin silencing complex(GO:0005677) |
0.0 | 1.2 | GO:0031594 | neuromuscular junction(GO:0031594) |
0.0 | 0.8 | GO:0005913 | cell-cell adherens junction(GO:0005913) |
0.0 | 0.1 | GO:0043259 | laminin-10 complex(GO:0043259) |
0.0 | 0.0 | GO:0043219 | lateral loop(GO:0043219) |
0.0 | 0.1 | GO:0031315 | extrinsic component of mitochondrial outer membrane(GO:0031315) |
0.0 | 0.0 | GO:0044316 | cone cell pedicle(GO:0044316) |
0.0 | 0.0 | GO:0097487 | multivesicular body, internal vesicle(GO:0097487) |
0.0 | 0.1 | GO:0033503 | HULC complex(GO:0033503) |
0.0 | 0.3 | GO:0071564 | npBAF complex(GO:0071564) |
0.0 | 0.1 | GO:0044354 | pinosome(GO:0044352) macropinosome(GO:0044354) |
0.0 | 0.1 | GO:0036057 | filtration diaphragm(GO:0036056) slit diaphragm(GO:0036057) |
0.0 | 0.2 | GO:0044224 | juxtaparanode region of axon(GO:0044224) |
0.0 | 0.3 | GO:0000930 | gamma-tubulin complex(GO:0000930) |
0.0 | 0.5 | GO:0055038 | recycling endosome membrane(GO:0055038) |
0.0 | 0.2 | GO:0031235 | intrinsic component of the cytoplasmic side of the plasma membrane(GO:0031235) |
0.0 | 0.1 | GO:0043034 | costamere(GO:0043034) |
0.0 | 0.2 | GO:0005847 | mRNA cleavage and polyadenylation specificity factor complex(GO:0005847) |
0.0 | 0.0 | GO:1990393 | 3M complex(GO:1990393) |
0.0 | 0.1 | GO:0043511 | inhibin complex(GO:0043511) |
0.0 | 0.0 | GO:0097454 | Schwann cell microvillus(GO:0097454) |
0.0 | 0.2 | GO:0017146 | NMDA selective glutamate receptor complex(GO:0017146) |
0.0 | 0.1 | GO:0009279 | cell outer membrane(GO:0009279) cell envelope(GO:0030313) external encapsulating structure part(GO:0044462) |
0.0 | 0.1 | GO:0035363 | histone locus body(GO:0035363) |
0.0 | 0.1 | GO:0000110 | nucleotide-excision repair factor 1 complex(GO:0000110) |
0.0 | 0.2 | GO:0043218 | compact myelin(GO:0043218) |
0.0 | 0.1 | GO:0032426 | stereocilium tip(GO:0032426) |
0.0 | 0.2 | GO:0005583 | fibrillar collagen trimer(GO:0005583) banded collagen fibril(GO:0098643) |
0.0 | 0.4 | GO:0000314 | organellar small ribosomal subunit(GO:0000314) mitochondrial small ribosomal subunit(GO:0005763) |
0.0 | 0.1 | GO:0031209 | SCAR complex(GO:0031209) |
0.0 | 0.2 | GO:0005671 | Ada2/Gcn5/Ada3 transcription activator complex(GO:0005671) |
0.0 | 0.1 | GO:0000137 | Golgi cis cisterna(GO:0000137) |
0.0 | 0.0 | GO:0097058 | CRLF-CLCF1 complex(GO:0097058) |
0.0 | 0.0 | GO:0048179 | activin receptor complex(GO:0048179) |
0.0 | 0.2 | GO:0031362 | anchored component of external side of plasma membrane(GO:0031362) |
0.0 | 0.0 | GO:0036195 | muscle cell projection(GO:0036194) muscle cell projection membrane(GO:0036195) |
0.0 | 0.0 | GO:0031084 | BLOC-2 complex(GO:0031084) |
0.0 | 0.2 | GO:1902710 | GABA receptor complex(GO:1902710) GABA-A receptor complex(GO:1902711) |
0.0 | 0.1 | GO:0030056 | hemidesmosome(GO:0030056) |
0.0 | 0.1 | GO:0090571 | RNA polymerase II transcription repressor complex(GO:0090571) |
0.0 | 0.1 | GO:0008385 | IkappaB kinase complex(GO:0008385) |
0.0 | 0.1 | GO:0032045 | guanyl-nucleotide exchange factor complex(GO:0032045) |
0.0 | 0.2 | GO:0001673 | male germ cell nucleus(GO:0001673) |
0.0 | 0.1 | GO:0000439 | core TFIIH complex(GO:0000439) |
0.0 | 0.0 | GO:1990923 | PET complex(GO:1990923) |
0.0 | 0.1 | GO:0097208 | alveolar lamellar body(GO:0097208) |
0.0 | 0.1 | GO:0072546 | ER membrane protein complex(GO:0072546) |
0.0 | 0.9 | GO:0005604 | basement membrane(GO:0005604) |
0.0 | 0.2 | GO:0010369 | chromocenter(GO:0010369) |
0.0 | 0.0 | GO:0045098 | type III intermediate filament(GO:0045098) |
0.0 | 0.0 | GO:0034673 | inhibin-betaglycan-ActRII complex(GO:0034673) |
0.0 | 0.4 | GO:0016459 | myosin complex(GO:0016459) |
0.0 | 0.6 | GO:0034705 | potassium channel complex(GO:0034705) |
0.0 | 0.1 | GO:0000242 | pericentriolar material(GO:0000242) |
0.0 | 0.1 | GO:0036157 | outer dynein arm(GO:0036157) |
0.0 | 0.1 | GO:0042788 | polysomal ribosome(GO:0042788) |
0.0 | 0.2 | GO:0042101 | T cell receptor complex(GO:0042101) |
0.0 | 0.4 | GO:0045095 | keratin filament(GO:0045095) |
0.0 | 0.0 | GO:0090661 | box H/ACA telomerase RNP complex(GO:0090661) |
0.0 | 0.0 | GO:0071797 | LUBAC complex(GO:0071797) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.6 | 1.8 | GO:0008449 | N-acetylglucosamine-6-sulfatase activity(GO:0008449) |
0.5 | 1.5 | GO:0050816 | phosphothreonine binding(GO:0050816) |
0.5 | 1.9 | GO:0005030 | neurotrophin receptor activity(GO:0005030) |
0.3 | 1.1 | GO:0005042 | netrin receptor activity(GO:0005042) |
0.2 | 0.6 | GO:0004924 | oncostatin-M receptor activity(GO:0004924) |
0.2 | 1.4 | GO:0019992 | diacylglycerol binding(GO:0019992) |
0.2 | 0.8 | GO:0015467 | G-protein activated inward rectifier potassium channel activity(GO:0015467) |
0.2 | 1.4 | GO:0003841 | 1-acylglycerol-3-phosphate O-acyltransferase activity(GO:0003841) |
0.2 | 0.5 | GO:0005006 | epidermal growth factor-activated receptor activity(GO:0005006) |
0.1 | 1.5 | GO:0017154 | semaphorin receptor activity(GO:0017154) |
0.1 | 0.4 | GO:0050508 | glucuronosyl-N-acetylglucosaminyl-proteoglycan 4-alpha-N-acetylglucosaminyltransferase activity(GO:0050508) |
0.1 | 1.0 | GO:0004017 | adenylate kinase activity(GO:0004017) |
0.1 | 0.5 | GO:0044323 | retinoic acid-responsive element binding(GO:0044323) |
0.1 | 0.3 | GO:0051718 | DNA (cytosine-5-)-methyltransferase activity(GO:0003886) DNA (cytosine-5-)-methyltransferase activity, acting on CpG substrates(GO:0051718) |
0.1 | 0.4 | GO:0032896 | palmitoyl-CoA 9-desaturase activity(GO:0032896) |
0.1 | 0.4 | GO:0004614 | phosphoglucomutase activity(GO:0004614) |
0.1 | 0.6 | GO:0016907 | G-protein coupled acetylcholine receptor activity(GO:0016907) |
0.1 | 0.2 | GO:0004897 | ciliary neurotrophic factor receptor activity(GO:0004897) |
0.1 | 0.5 | GO:0086006 | voltage-gated sodium channel activity involved in cardiac muscle cell action potential(GO:0086006) |
0.1 | 0.5 | GO:0030274 | LIM domain binding(GO:0030274) |
0.1 | 0.3 | GO:0004096 | catalase activity(GO:0004096) |
0.1 | 0.4 | GO:0051185 | coenzyme transporter activity(GO:0051185) |
0.1 | 0.3 | GO:0019871 | sodium channel inhibitor activity(GO:0019871) |
0.1 | 0.3 | GO:0097493 | structural molecule activity conferring elasticity(GO:0097493) |
0.1 | 0.9 | GO:0017166 | vinculin binding(GO:0017166) |
0.1 | 0.2 | GO:0042284 | sphingolipid delta-4 desaturase activity(GO:0042284) |
0.1 | 0.5 | GO:0043426 | MRF binding(GO:0043426) |
0.1 | 0.4 | GO:0015277 | kainate selective glutamate receptor activity(GO:0015277) |
0.1 | 0.2 | GO:1902282 | voltage-gated potassium channel activity involved in ventricular cardiac muscle cell action potential repolarization(GO:1902282) |
0.1 | 0.3 | GO:0003828 | alpha-N-acetylneuraminate alpha-2,8-sialyltransferase activity(GO:0003828) |
0.1 | 0.2 | GO:0031708 | endothelin B receptor binding(GO:0031708) |
0.1 | 0.3 | GO:0005004 | GPI-linked ephrin receptor activity(GO:0005004) |
0.1 | 0.3 | GO:0035662 | Toll-like receptor 4 binding(GO:0035662) |
0.1 | 0.5 | GO:0031995 | insulin-like growth factor II binding(GO:0031995) |
0.1 | 0.2 | GO:0004427 | inorganic diphosphatase activity(GO:0004427) |
0.1 | 0.2 | GO:0031826 | type 2A serotonin receptor binding(GO:0031826) |
0.1 | 0.7 | GO:0070411 | I-SMAD binding(GO:0070411) |
0.1 | 0.4 | GO:0019966 | interleukin-1 binding(GO:0019966) |
0.1 | 0.4 | GO:0008430 | selenium binding(GO:0008430) |
0.1 | 0.2 | GO:1990715 | mRNA CDS binding(GO:1990715) |
0.1 | 0.2 | GO:0000386 | second spliceosomal transesterification activity(GO:0000386) |
0.1 | 0.6 | GO:0005283 | sodium:amino acid symporter activity(GO:0005283) |
0.1 | 1.1 | GO:0030742 | GTP-dependent protein binding(GO:0030742) |
0.1 | 0.2 | GO:0004999 | vasoactive intestinal polypeptide receptor activity(GO:0004999) |
0.1 | 0.2 | GO:0005502 | 11-cis retinal binding(GO:0005502) |
0.1 | 0.2 | GO:0005001 | transmembrane receptor protein tyrosine phosphatase activity(GO:0005001) |
0.1 | 0.2 | GO:0015220 | choline transmembrane transporter activity(GO:0015220) |
0.0 | 0.2 | GO:0015252 | hydrogen ion channel activity(GO:0015252) |
0.0 | 1.4 | GO:0042805 | actinin binding(GO:0042805) |
0.0 | 0.7 | GO:0005520 | insulin-like growth factor binding(GO:0005520) |
0.0 | 0.8 | GO:0008327 | methyl-CpG binding(GO:0008327) |
0.0 | 0.1 | GO:0004605 | phosphatidate cytidylyltransferase activity(GO:0004605) |
0.0 | 0.2 | GO:0002046 | opsin binding(GO:0002046) |
0.0 | 0.0 | GO:0034211 | GTP-dependent protein kinase activity(GO:0034211) |
0.0 | 0.5 | GO:0031005 | filamin binding(GO:0031005) |
0.0 | 0.2 | GO:0019958 | C-X-C chemokine binding(GO:0019958) |
0.0 | 0.2 | GO:0031694 | alpha-2A adrenergic receptor binding(GO:0031694) |
0.0 | 0.2 | GO:0051525 | NFAT protein binding(GO:0051525) |
0.0 | 0.2 | GO:0004689 | phosphorylase kinase activity(GO:0004689) |
0.0 | 0.4 | GO:0103116 | alpha-D-galactofuranose transporter activity(GO:0103116) |
0.0 | 0.1 | GO:0031752 | D5 dopamine receptor binding(GO:0031752) |
0.0 | 0.5 | GO:0005092 | GDP-dissociation inhibitor activity(GO:0005092) |
0.0 | 0.1 | GO:0034988 | Fc-gamma receptor I complex binding(GO:0034988) |
0.0 | 0.1 | GO:0008384 | IkappaB kinase activity(GO:0008384) |
0.0 | 0.7 | GO:0005112 | Notch binding(GO:0005112) |
0.0 | 0.1 | GO:0051425 | PTB domain binding(GO:0051425) |
0.0 | 0.3 | GO:0035612 | AP-2 adaptor complex binding(GO:0035612) |
0.0 | 0.3 | GO:0008889 | glycerophosphodiester phosphodiesterase activity(GO:0008889) |
0.0 | 0.2 | GO:0034714 | type III transforming growth factor beta receptor binding(GO:0034714) |
0.0 | 0.6 | GO:0004012 | phospholipid-translocating ATPase activity(GO:0004012) |
0.0 | 0.1 | GO:0004699 | calcium-independent protein kinase C activity(GO:0004699) |
0.0 | 0.1 | GO:0016941 | natriuretic peptide receptor activity(GO:0016941) |
0.0 | 0.1 | GO:0051373 | FATZ binding(GO:0051373) |
0.0 | 0.2 | GO:0004791 | thioredoxin-disulfide reductase activity(GO:0004791) |
0.0 | 0.2 | GO:0016901 | oxidoreductase activity, acting on the CH-OH group of donors, quinone or similar compound as acceptor(GO:0016901) |
0.0 | 0.3 | GO:0019912 | cyclin-dependent protein kinase activating kinase activity(GO:0019912) |
0.0 | 0.1 | GO:0031697 | beta-1 adrenergic receptor binding(GO:0031697) |
0.0 | 0.1 | GO:0019153 | protein-disulfide reductase (glutathione) activity(GO:0019153) |
0.0 | 0.1 | GO:0031014 | troponin T binding(GO:0031014) |
0.0 | 0.3 | GO:0008140 | cAMP response element binding protein binding(GO:0008140) |
0.0 | 0.5 | GO:0043274 | phospholipase binding(GO:0043274) |
0.0 | 0.3 | GO:0048027 | mRNA 5'-UTR binding(GO:0048027) |
0.0 | 0.1 | GO:0003945 | N-acetyllactosamine synthase activity(GO:0003945) |
0.0 | 0.0 | GO:0038064 | collagen receptor activity(GO:0038064) |
0.0 | 0.4 | GO:0008191 | metalloendopeptidase inhibitor activity(GO:0008191) |
0.0 | 0.8 | GO:0042056 | chemoattractant activity(GO:0042056) |
0.0 | 1.4 | GO:0004714 | transmembrane receptor protein tyrosine kinase activity(GO:0004714) |
0.0 | 0.1 | GO:0015016 | [heparan sulfate]-glucosamine N-sulfotransferase activity(GO:0015016) |
0.0 | 0.5 | GO:1990939 | ATP-dependent microtubule motor activity(GO:1990939) |
0.0 | 0.2 | GO:0047498 | calcium-dependent phospholipase A2 activity(GO:0047498) |
0.0 | 0.2 | GO:0050700 | CARD domain binding(GO:0050700) |
0.0 | 0.1 | GO:0035727 | lysophosphatidic acid binding(GO:0035727) |
0.0 | 0.4 | GO:0005242 | inward rectifier potassium channel activity(GO:0005242) |
0.0 | 0.1 | GO:0004704 | NF-kappaB-inducing kinase activity(GO:0004704) |
0.0 | 0.1 | GO:0035033 | histone deacetylase regulator activity(GO:0035033) |
0.0 | 0.1 | GO:0030172 | troponin C binding(GO:0030172) |
0.0 | 0.1 | GO:0005111 | type 2 fibroblast growth factor receptor binding(GO:0005111) |
0.0 | 0.4 | GO:0055106 | ubiquitin-protein transferase regulator activity(GO:0055106) |
0.0 | 0.1 | GO:0005329 | dopamine transmembrane transporter activity(GO:0005329) |
0.0 | 0.1 | GO:0001515 | opioid peptide activity(GO:0001515) |
0.0 | 0.1 | GO:0043120 | tumor necrosis factor binding(GO:0043120) |
0.0 | 0.1 | GO:0070290 | N-acylphosphatidylethanolamine-specific phospholipase D activity(GO:0070290) |
0.0 | 0.4 | GO:0034237 | protein kinase A regulatory subunit binding(GO:0034237) |
0.0 | 0.1 | GO:0001025 | RNA polymerase III transcription factor binding(GO:0001025) |
0.0 | 0.2 | GO:0005452 | inorganic anion exchanger activity(GO:0005452) |
0.0 | 0.1 | GO:0008597 | calcium-dependent protein serine/threonine phosphatase regulator activity(GO:0008597) |
0.0 | 0.6 | GO:0016922 | ligand-dependent nuclear receptor binding(GO:0016922) |
0.0 | 0.5 | GO:0031435 | mitogen-activated protein kinase kinase kinase binding(GO:0031435) |
0.0 | 0.1 | GO:0070052 | collagen V binding(GO:0070052) |
0.0 | 0.1 | GO:0031800 | type 3 metabotropic glutamate receptor binding(GO:0031800) |
0.0 | 0.1 | GO:0001224 | RNA polymerase II transcription cofactor binding(GO:0001224) |
0.0 | 0.3 | GO:0016595 | glutamate binding(GO:0016595) |
0.0 | 0.0 | GO:0016494 | C-X-C chemokine receptor activity(GO:0016494) |
0.0 | 0.2 | GO:0005237 | inhibitory extracellular ligand-gated ion channel activity(GO:0005237) |
0.0 | 0.1 | GO:1990460 | leptin receptor binding(GO:1990460) |
0.0 | 0.1 | GO:0045322 | unmethylated CpG binding(GO:0045322) |
0.0 | 0.6 | GO:0030552 | cAMP binding(GO:0030552) |
0.0 | 0.2 | GO:0017070 | U6 snRNA binding(GO:0017070) |
0.0 | 0.3 | GO:0001972 | retinoic acid binding(GO:0001972) |
0.0 | 0.0 | GO:0000339 | RNA cap binding(GO:0000339) |
0.0 | 0.1 | GO:0030229 | very-low-density lipoprotein particle receptor activity(GO:0030229) |
0.0 | 0.0 | GO:0032422 | purine-rich negative regulatory element binding(GO:0032422) |
0.0 | 0.1 | GO:0008142 | oxysterol binding(GO:0008142) |
0.0 | 0.1 | GO:0005432 | calcium:sodium antiporter activity(GO:0005432) |
0.0 | 0.1 | GO:0004985 | opioid receptor activity(GO:0004985) |
0.0 | 0.1 | GO:0042609 | CD4 receptor binding(GO:0042609) |
0.0 | 0.1 | GO:0015141 | succinate transmembrane transporter activity(GO:0015141) |
0.0 | 0.1 | GO:0016716 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, another compound as one donor, and incorporation of one atom of oxygen(GO:0016716) |
0.0 | 0.1 | GO:0046912 | transferase activity, transferring acyl groups, acyl groups converted into alkyl on transfer(GO:0046912) |
0.0 | 0.3 | GO:0019789 | SUMO transferase activity(GO:0019789) |
0.0 | 0.6 | GO:0015347 | sodium-independent organic anion transmembrane transporter activity(GO:0015347) |
0.0 | 0.2 | GO:0004861 | cyclin-dependent protein serine/threonine kinase inhibitor activity(GO:0004861) |
0.0 | 0.1 | GO:0030160 | GKAP/Homer scaffold activity(GO:0030160) |
0.0 | 0.1 | GO:0008469 | histone-arginine N-methyltransferase activity(GO:0008469) protein-arginine omega-N asymmetric methyltransferase activity(GO:0035242) |
0.0 | 0.1 | GO:0015288 | porin activity(GO:0015288) |
0.0 | 0.3 | GO:0016805 | dipeptidase activity(GO:0016805) |
0.0 | 0.0 | GO:0086007 | voltage-gated calcium channel activity involved in cardiac muscle cell action potential(GO:0086007) |
0.0 | 0.2 | GO:0015174 | basic amino acid transmembrane transporter activity(GO:0015174) |
0.0 | 0.0 | GO:0004706 | JUN kinase kinase kinase activity(GO:0004706) |
0.0 | 0.2 | GO:0038191 | neuropilin binding(GO:0038191) |
0.0 | 0.0 | GO:0015185 | gamma-aminobutyric acid transmembrane transporter activity(GO:0015185) |
0.0 | 0.8 | GO:0005201 | extracellular matrix structural constituent(GO:0005201) |
0.0 | 1.5 | GO:0005178 | integrin binding(GO:0005178) |
0.0 | 0.1 | GO:0004558 | alpha-1,4-glucosidase activity(GO:0004558) |
0.0 | 0.1 | GO:0016015 | morphogen activity(GO:0016015) |
0.0 | 0.1 | GO:0004739 | pyruvate dehydrogenase (acetyl-transferring) activity(GO:0004739) |
0.0 | 1.2 | GO:0017048 | Rho GTPase binding(GO:0017048) |
0.0 | 0.4 | GO:0031492 | nucleosomal DNA binding(GO:0031492) |
0.0 | 0.2 | GO:0004445 | inositol-polyphosphate 5-phosphatase activity(GO:0004445) |
0.0 | 0.1 | GO:0008321 | Ral guanyl-nucleotide exchange factor activity(GO:0008321) |
0.0 | 0.0 | GO:0030899 | calcium-dependent ATPase activity(GO:0030899) |
0.0 | 1.3 | GO:0005089 | Rho guanyl-nucleotide exchange factor activity(GO:0005089) |
0.0 | 0.2 | GO:0070180 | large ribosomal subunit rRNA binding(GO:0070180) |
0.0 | 0.1 | GO:0008294 | calcium- and calmodulin-responsive adenylate cyclase activity(GO:0008294) |
0.0 | 0.1 | GO:0016174 | NAD(P)H oxidase activity(GO:0016174) |
0.0 | 0.4 | GO:0035035 | histone acetyltransferase binding(GO:0035035) |
0.0 | 0.2 | GO:0001784 | phosphotyrosine binding(GO:0001784) |
0.0 | 0.0 | GO:0004698 | calcium-dependent protein kinase C activity(GO:0004698) |
0.0 | 0.1 | GO:0004565 | beta-galactosidase activity(GO:0004565) |
0.0 | 0.5 | GO:0005251 | delayed rectifier potassium channel activity(GO:0005251) |
0.0 | 0.3 | GO:0043325 | phosphatidylinositol-3,4-bisphosphate binding(GO:0043325) |
0.0 | 0.1 | GO:0016744 | transferase activity, transferring aldehyde or ketonic groups(GO:0016744) |
0.0 | 0.2 | GO:0005523 | tropomyosin binding(GO:0005523) |
0.0 | 0.1 | GO:0017108 | 5'-flap endonuclease activity(GO:0017108) |
0.0 | 0.3 | GO:0005070 | SH3/SH2 adaptor activity(GO:0005070) |
0.0 | 0.3 | GO:0004198 | calcium-dependent cysteine-type endopeptidase activity(GO:0004198) |
0.0 | 0.0 | GO:0097603 | temperature-gated ion channel activity(GO:0097603) |
0.0 | 0.1 | GO:0004735 | pyrroline-5-carboxylate reductase activity(GO:0004735) |
0.0 | 0.0 | GO:0004461 | lactose synthase activity(GO:0004461) |
0.0 | 0.1 | GO:0043912 | D-lysine oxidase activity(GO:0043912) |
0.0 | 0.1 | GO:0030306 | ADP-ribosylation factor binding(GO:0030306) |
0.0 | 1.1 | GO:0004702 | receptor signaling protein serine/threonine kinase activity(GO:0004702) |
0.0 | 0.0 | GO:0070698 | type I activin receptor binding(GO:0070698) |
0.0 | 0.0 | GO:0000702 | oxidized base lesion DNA N-glycosylase activity(GO:0000702) |
0.0 | 0.1 | GO:0033743 | peptide-methionine (R)-S-oxide reductase activity(GO:0033743) |
0.0 | 0.2 | GO:0005451 | monovalent cation:proton antiporter activity(GO:0005451) |
0.0 | 0.0 | GO:0038100 | nodal binding(GO:0038100) |
0.0 | 0.0 | GO:0055100 | adiponectin binding(GO:0055100) |
0.0 | 0.0 | GO:0003726 | double-stranded RNA adenosine deaminase activity(GO:0003726) |
0.0 | 0.1 | GO:0004887 | thyroid hormone receptor activity(GO:0004887) |
0.0 | 0.1 | GO:0015280 | ligand-gated sodium channel activity(GO:0015280) |
0.0 | 0.3 | GO:0046875 | ephrin receptor binding(GO:0046875) |
0.0 | 0.0 | GO:0016880 | acid-ammonia (or amide) ligase activity(GO:0016880) |
0.0 | 0.0 | GO:0030519 | snoRNP binding(GO:0030519) |
0.0 | 0.0 | GO:0004833 | tryptophan 2,3-dioxygenase activity(GO:0004833) |
0.0 | 0.0 | GO:0003884 | D-amino-acid oxidase activity(GO:0003884) |
0.0 | 0.1 | GO:0004385 | guanylate kinase activity(GO:0004385) |
0.0 | 0.0 | GO:0015018 | galactosylgalactosylxylosylprotein 3-beta-glucuronosyltransferase activity(GO:0015018) |
0.0 | 0.0 | GO:0005157 | macrophage colony-stimulating factor receptor binding(GO:0005157) |
0.0 | 0.0 | GO:0004630 | phospholipase D activity(GO:0004630) |
0.0 | 0.0 | GO:0070326 | very-low-density lipoprotein particle receptor binding(GO:0070326) |
0.0 | 0.5 | GO:0019212 | phosphatase inhibitor activity(GO:0019212) |
0.0 | 0.1 | GO:0036374 | gamma-glutamyltransferase activity(GO:0003840) glutathione hydrolase activity(GO:0036374) |
0.0 | 0.2 | GO:0070530 | K63-linked polyubiquitin binding(GO:0070530) |
0.0 | 0.4 | GO:0005080 | protein kinase C binding(GO:0005080) |
0.0 | 0.1 | GO:0017169 | CDP-alcohol phosphatidyltransferase activity(GO:0017169) |
0.0 | 0.1 | GO:0031727 | CCR2 chemokine receptor binding(GO:0031727) |
0.0 | 0.1 | GO:0004083 | bisphosphoglycerate 2-phosphatase activity(GO:0004083) |
0.0 | 0.1 | GO:0004697 | protein kinase C activity(GO:0004697) |
0.0 | 0.1 | GO:0001727 | lipid kinase activity(GO:0001727) |
0.0 | 0.1 | GO:0034711 | inhibin binding(GO:0034711) |
0.0 | 0.1 | GO:0004499 | N,N-dimethylaniline monooxygenase activity(GO:0004499) |
0.0 | 0.0 | GO:0070579 | methylcytosine dioxygenase activity(GO:0070579) |
0.0 | 0.0 | GO:0000099 | sulfur amino acid transmembrane transporter activity(GO:0000099) |
0.0 | 0.3 | GO:0004181 | metallocarboxypeptidase activity(GO:0004181) |
0.0 | 0.1 | GO:0019784 | NEDD8-specific protease activity(GO:0019784) |
0.0 | 0.1 | GO:0016176 | superoxide-generating NADPH oxidase activator activity(GO:0016176) |
0.0 | 0.0 | GO:0031893 | vasopressin receptor binding(GO:0031893) |
0.0 | 0.1 | GO:0005328 | neurotransmitter:sodium symporter activity(GO:0005328) |
0.0 | 0.2 | GO:0008601 | protein phosphatase type 2A regulator activity(GO:0008601) |
0.0 | 0.1 | GO:0004459 | L-lactate dehydrogenase activity(GO:0004459) |
0.0 | 0.1 | GO:0046923 | ER retention sequence binding(GO:0046923) |
0.0 | 0.0 | GO:1990459 | transferrin receptor binding(GO:1990459) |
0.0 | 0.0 | GO:0000774 | adenyl-nucleotide exchange factor activity(GO:0000774) |
0.0 | 0.1 | GO:0017151 | DEAD/H-box RNA helicase binding(GO:0017151) |
0.0 | 0.1 | GO:0019531 | oxalate transmembrane transporter activity(GO:0019531) |
0.0 | 1.8 | GO:0003729 | mRNA binding(GO:0003729) |
0.0 | 0.1 | GO:0004767 | sphingomyelin phosphodiesterase activity(GO:0004767) |
0.0 | 1.1 | GO:0051015 | actin filament binding(GO:0051015) |
0.0 | 0.0 | GO:0047276 | N-acetyllactosaminide 3-alpha-galactosyltransferase activity(GO:0047276) |
0.0 | 2.2 | GO:0003779 | actin binding(GO:0003779) |
0.0 | 0.0 | GO:0019788 | NEDD8 transferase activity(GO:0019788) |
0.0 | 0.1 | GO:0070891 | lipoteichoic acid binding(GO:0070891) |
0.0 | 0.1 | GO:0016936 | galactoside binding(GO:0016936) |
0.0 | 0.1 | GO:1990446 | U1 snRNP binding(GO:1990446) |
0.0 | 0.0 | GO:0005127 | ciliary neurotrophic factor receptor binding(GO:0005127) |
0.0 | 0.2 | GO:0015927 | trehalase activity(GO:0015927) |
0.0 | 0.0 | GO:0004346 | glucose-6-phosphatase activity(GO:0004346) sugar-terminal-phosphatase activity(GO:0050309) |
0.0 | 0.1 | GO:0030506 | ankyrin binding(GO:0030506) |
0.0 | 0.0 | GO:0035651 | AP-3 adaptor complex binding(GO:0035651) |
0.0 | 0.0 | GO:0017150 | tRNA dihydrouridine synthase activity(GO:0017150) |
0.0 | 0.0 | GO:0051959 | dynein light intermediate chain binding(GO:0051959) |
0.0 | 0.0 | GO:0034513 | box H/ACA snoRNA binding(GO:0034513) |
0.0 | 0.1 | GO:0004758 | serine C-palmitoyltransferase activity(GO:0004758) |
0.0 | 0.0 | GO:0000309 | nicotinamide-nucleotide adenylyltransferase activity(GO:0000309) nicotinate-nucleotide adenylyltransferase activity(GO:0004515) |
0.0 | 0.0 | GO:0016774 | phosphotransferase activity, carboxyl group as acceptor(GO:0016774) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.1 | 0.1 | ST GAQ PATHWAY | G alpha q Pathway |
0.1 | 1.5 | PID MYC PATHWAY | C-MYC pathway |
0.1 | 1.5 | PID WNT SIGNALING PATHWAY | Wnt signaling network |
0.0 | 0.6 | PID SYNDECAN 3 PATHWAY | Syndecan-3-mediated signaling events |
0.0 | 1.4 | PID NETRIN PATHWAY | Netrin-mediated signaling events |
0.0 | 0.8 | PID NCADHERIN PATHWAY | N-cadherin signaling events |
0.0 | 1.7 | PID AJDISS 2PATHWAY | Posttranslational regulation of adherens junction stability and dissassembly |
0.0 | 0.6 | PID ERBB NETWORK PATHWAY | ErbB receptor signaling network |
0.0 | 0.3 | ST PAC1 RECEPTOR PATHWAY | PAC1 Receptor Pathway |
0.0 | 0.3 | PID ECADHERIN NASCENT AJ PATHWAY | E-cadherin signaling in the nascent adherens junction |
0.0 | 1.2 | PID ILK PATHWAY | Integrin-linked kinase signaling |
0.0 | 1.3 | NABA BASEMENT MEMBRANES | Genes encoding structural components of basement membranes |
0.0 | 0.9 | PID RAS PATHWAY | Regulation of Ras family activation |
0.0 | 0.7 | PID HDAC CLASSIII PATHWAY | Signaling events mediated by HDAC Class III |
0.0 | 0.6 | PID EPHB FWD PATHWAY | EPHB forward signaling |
0.0 | 0.5 | ST MYOCYTE AD PATHWAY | Myocyte Adrenergic Pathway is a specific case of the generalized Adrenergic Pathway. |
0.0 | 0.1 | PID TXA2PATHWAY | Thromboxane A2 receptor signaling |
0.0 | 0.3 | SA PROGRAMMED CELL DEATH | Programmed cell death, or apoptosis, eliminates damaged or unneeded cells. |
0.0 | 0.6 | PID RETINOIC ACID PATHWAY | Retinoic acid receptors-mediated signaling |
0.0 | 0.1 | PID CERAMIDE PATHWAY | Ceramide signaling pathway |
0.0 | 0.1 | PID ARF6 DOWNSTREAM PATHWAY | Arf6 downstream pathway |
0.0 | 0.2 | PID BCR 5PATHWAY | BCR signaling pathway |
0.0 | 0.1 | PID FAK PATHWAY | Signaling events mediated by focal adhesion kinase |
0.0 | 0.3 | PID INTEGRIN5 PATHWAY | Beta5 beta6 beta7 and beta8 integrin cell surface interactions |
0.0 | 0.4 | PID REELIN PATHWAY | Reelin signaling pathway |
0.0 | 0.4 | PID PI3KCI PATHWAY | Class I PI3K signaling events |
0.0 | 0.9 | PID TGFBR PATHWAY | TGF-beta receptor signaling |
0.0 | 0.4 | PID EPHA FWDPATHWAY | EPHA forward signaling |
0.0 | 3.9 | NABA ECM REGULATORS | Genes encoding enzymes and their regulators involved in the remodeling of the extracellular matrix |
0.0 | 0.0 | PID INTEGRIN4 PATHWAY | Alpha6 beta4 integrin-ligand interactions |
0.0 | 0.2 | PID ERBB4 PATHWAY | ErbB4 signaling events |
0.0 | 0.2 | SA B CELL RECEPTOR COMPLEXES | Antigen binding to B cell receptors activates protein tyrosine kinases, such as the Src family, which ultimate activate MAP kinases. |
0.0 | 0.3 | PID PS1 PATHWAY | Presenilin action in Notch and Wnt signaling |
0.0 | 0.2 | PID NFKAPPAB CANONICAL PATHWAY | Canonical NF-kappaB pathway |
0.0 | 0.1 | PID TCR RAS PATHWAY | Ras signaling in the CD4+ TCR pathway |
0.0 | 0.3 | PID ECADHERIN STABILIZATION PATHWAY | Stabilization and expansion of the E-cadherin adherens junction |
0.0 | 0.3 | PID INSULIN PATHWAY | Insulin Pathway |
0.0 | 0.1 | PID RANBP2 PATHWAY | Sumoylation by RanBP2 regulates transcriptional repression |
0.0 | 0.2 | PID TRKR PATHWAY | Neurotrophic factor-mediated Trk receptor signaling |
0.0 | 0.2 | PID ALK1 PATHWAY | ALK1 signaling events |
0.0 | 0.1 | PID FAS PATHWAY | FAS (CD95) signaling pathway |
0.0 | 0.5 | NABA PROTEOGLYCANS | Genes encoding proteoglycans |
0.0 | 0.1 | PID NFAT 3PATHWAY | Role of Calcineurin-dependent NFAT signaling in lymphocytes |
0.0 | 0.1 | ST GRANULE CELL SURVIVAL PATHWAY | Granule Cell Survival Pathway is a specific case of more general PAC1 Receptor Pathway. |
0.0 | 0.5 | PID HES HEY PATHWAY | Notch-mediated HES/HEY network |
0.0 | 0.1 | PID PI3K PLC TRK PATHWAY | Trk receptor signaling mediated by PI3K and PLC-gamma |
0.0 | 0.1 | PID A6B1 A6B4 INTEGRIN PATHWAY | a6b1 and a6b4 Integrin signaling |
0.0 | 0.2 | PID ENDOTHELIN PATHWAY | Endothelins |
0.0 | 0.2 | PID CD40 PATHWAY | CD40/CD40L signaling |
0.0 | 0.2 | PID RXR VDR PATHWAY | RXR and RAR heterodimerization with other nuclear receptor |
0.0 | 0.2 | ST JNK MAPK PATHWAY | JNK MAPK Pathway |
0.0 | 1.7 | NABA ECM AFFILIATED | Genes encoding proteins affiliated structurally or functionally to extracellular matrix proteins |
0.0 | 0.1 | PID NFKAPPAB ATYPICAL PATHWAY | Atypical NF-kappaB pathway |
0.0 | 0.2 | PID PTP1B PATHWAY | Signaling events mediated by PTP1B |
0.0 | 0.3 | PID NOTCH PATHWAY | Notch signaling pathway |
0.0 | 0.3 | PID TNF PATHWAY | TNF receptor signaling pathway |
0.0 | 0.1 | PID INTEGRIN A9B1 PATHWAY | Alpha9 beta1 integrin signaling events |
0.0 | 0.1 | PID CDC42 PATHWAY | CDC42 signaling events |
0.0 | 0.1 | ST DIFFERENTIATION PATHWAY IN PC12 CELLS | Differentiation Pathway in PC12 Cells; this is a specific case of PAC1 Receptor Pathway. |
0.0 | 0.2 | PID INTEGRIN2 PATHWAY | Beta2 integrin cell surface interactions |
0.0 | 0.0 | PID TRAIL PATHWAY | TRAIL signaling pathway |
0.0 | 0.2 | PID RHODOPSIN PATHWAY | Visual signal transduction: Rods |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.2 | 0.3 | REACTOME SIGNALING BY EGFR IN CANCER | Genes involved in Signaling by EGFR in Cancer |
0.1 | 0.3 | REACTOME AQUAPORIN MEDIATED TRANSPORT | Genes involved in Aquaporin-mediated transport |
0.1 | 0.6 | REACTOME G BETA GAMMA SIGNALLING THROUGH PLC BETA | Genes involved in G beta:gamma signalling through PLC beta |
0.1 | 0.4 | REACTOME RNA POL I PROMOTER OPENING | Genes involved in RNA Polymerase I Promoter Opening |
0.1 | 0.8 | REACTOME ROLE OF DCC IN REGULATING APOPTOSIS | Genes involved in Role of DCC in regulating apoptosis |
0.1 | 1.1 | REACTOME DCC MEDIATED ATTRACTIVE SIGNALING | Genes involved in DCC mediated attractive signaling |
0.1 | 0.1 | REACTOME SIGNALING BY ERBB2 | Genes involved in Signaling by ERBB2 |
0.1 | 1.2 | REACTOME UNBLOCKING OF NMDA RECEPTOR GLUTAMATE BINDING AND ACTIVATION | Genes involved in Unblocking of NMDA receptor, glutamate binding and activation |
0.1 | 2.0 | REACTOME ASSOCIATION OF TRIC CCT WITH TARGET PROTEINS DURING BIOSYNTHESIS | Genes involved in Association of TriC/CCT with target proteins during biosynthesis |
0.1 | 0.5 | REACTOME APOPTOTIC CLEAVAGE OF CELL ADHESION PROTEINS | Genes involved in Apoptotic cleavage of cell adhesion proteins |
0.1 | 0.7 | REACTOME OTHER SEMAPHORIN INTERACTIONS | Genes involved in Other semaphorin interactions |
0.1 | 0.7 | REACTOME CRMPS IN SEMA3A SIGNALING | Genes involved in CRMPs in Sema3A signaling |
0.0 | 0.1 | REACTOME P53 DEPENDENT G1 DNA DAMAGE RESPONSE | Genes involved in p53-Dependent G1 DNA Damage Response |
0.0 | 0.0 | REACTOME CDC6 ASSOCIATION WITH THE ORC ORIGIN COMPLEX | Genes involved in CDC6 association with the ORC:origin complex |
0.0 | 1.1 | REACTOME STRIATED MUSCLE CONTRACTION | Genes involved in Striated Muscle Contraction |
0.0 | 1.2 | REACTOME HS GAG BIOSYNTHESIS | Genes involved in HS-GAG biosynthesis |
0.0 | 1.0 | REACTOME SYNTHESIS OF PA | Genes involved in Synthesis of PA |
0.0 | 1.3 | REACTOME BMAL1 CLOCK NPAS2 ACTIVATES CIRCADIAN EXPRESSION | Genes involved in BMAL1:CLOCK/NPAS2 Activates Circadian Expression |
0.0 | 0.8 | REACTOME SIGNALING BY BMP | Genes involved in Signaling by BMP |
0.0 | 1.5 | REACTOME NRAGE SIGNALS DEATH THROUGH JNK | Genes involved in NRAGE signals death through JNK |
0.0 | 0.3 | REACTOME IONOTROPIC ACTIVITY OF KAINATE RECEPTORS | Genes involved in Ionotropic activity of Kainate Receptors |
0.0 | 0.5 | REACTOME REGULATION OF INSULIN LIKE GROWTH FACTOR IGF ACTIVITY BY INSULIN LIKE GROWTH FACTOR BINDING PROTEINS IGFBPS | Genes involved in Regulation of Insulin-like Growth Factor (IGF) Activity by Insulin-like Growth Factor Binding Proteins (IGFBPs) |
0.0 | 0.6 | REACTOME SYNTHESIS AND INTERCONVERSION OF NUCLEOTIDE DI AND TRIPHOSPHATES | Genes involved in Synthesis and interconversion of nucleotide di- and triphosphates |
0.0 | 0.6 | REACTOME SMOOTH MUSCLE CONTRACTION | Genes involved in Smooth Muscle Contraction |
0.0 | 0.8 | REACTOME INHIBITION OF VOLTAGE GATED CA2 CHANNELS VIA GBETA GAMMA SUBUNITS | Genes involved in Inhibition of voltage gated Ca2+ channels via Gbeta/gamma subunits |
0.0 | 1.0 | REACTOME TRANSPORT TO THE GOLGI AND SUBSEQUENT MODIFICATION | Genes involved in Transport to the Golgi and subsequent modification |
0.0 | 0.3 | REACTOME P130CAS LINKAGE TO MAPK SIGNALING FOR INTEGRINS | Genes involved in p130Cas linkage to MAPK signaling for integrins |
0.0 | 0.3 | REACTOME SYNTHESIS SECRETION AND INACTIVATION OF GIP | Genes involved in Synthesis, Secretion, and Inactivation of Glucose-dependent Insulinotropic Polypeptide (GIP) |
0.0 | 0.3 | REACTOME CASPASE MEDIATED CLEAVAGE OF CYTOSKELETAL PROTEINS | Genes involved in Caspase-mediated cleavage of cytoskeletal proteins |
0.0 | 0.2 | REACTOME P38MAPK EVENTS | Genes involved in p38MAPK events |
0.0 | 0.5 | REACTOME SHC1 EVENTS IN ERBB4 SIGNALING | Genes involved in SHC1 events in ERBB4 signaling |
0.0 | 0.3 | REACTOME YAP1 AND WWTR1 TAZ STIMULATED GENE EXPRESSION | Genes involved in YAP1- and WWTR1 (TAZ)-stimulated gene expression |
0.0 | 0.0 | REACTOME SHC MEDIATED SIGNALLING | Genes involved in SHC-mediated signalling |
0.0 | 0.2 | REACTOME IKK COMPLEX RECRUITMENT MEDIATED BY RIP1 | Genes involved in IKK complex recruitment mediated by RIP1 |
0.0 | 0.8 | REACTOME NCAM1 INTERACTIONS | Genes involved in NCAM1 interactions |
0.0 | 0.3 | REACTOME GLUTAMATE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Glutamate Neurotransmitter Release Cycle |
0.0 | 0.2 | REACTOME HORMONE SENSITIVE LIPASE HSL MEDIATED TRIACYLGLYCEROL HYDROLYSIS | Genes involved in Hormone-sensitive lipase (HSL)-mediated triacylglycerol hydrolysis |
0.0 | 0.4 | REACTOME GLUTATHIONE CONJUGATION | Genes involved in Glutathione conjugation |
0.0 | 0.4 | REACTOME MITOCHONDRIAL TRNA AMINOACYLATION | Genes involved in Mitochondrial tRNA aminoacylation |
0.0 | 0.2 | REACTOME PROLACTIN RECEPTOR SIGNALING | Genes involved in Prolactin receptor signaling |
0.0 | 0.2 | REACTOME GABA A RECEPTOR ACTIVATION | Genes involved in GABA A receptor activation |
0.0 | 0.1 | REACTOME GLUCURONIDATION | Genes involved in Glucuronidation |
0.0 | 0.2 | REACTOME GLYCOGEN BREAKDOWN GLYCOGENOLYSIS | Genes involved in Glycogen breakdown (glycogenolysis) |
0.0 | 0.0 | REACTOME REGULATION OF INSULIN SECRETION BY GLUCAGON LIKE PEPTIDE1 | Genes involved in Regulation of Insulin Secretion by Glucagon-like Peptide-1 |
0.0 | 0.2 | REACTOME A TETRASACCHARIDE LINKER SEQUENCE IS REQUIRED FOR GAG SYNTHESIS | Genes involved in A tetrasaccharide linker sequence is required for GAG synthesis |
0.0 | 0.1 | REACTOME CREATION OF C4 AND C2 ACTIVATORS | Genes involved in Creation of C4 and C2 activators |
0.0 | 0.7 | REACTOME NUCLEAR RECEPTOR TRANSCRIPTION PATHWAY | Genes involved in Nuclear Receptor transcription pathway |
0.0 | 0.2 | REACTOME RECEPTOR LIGAND BINDING INITIATES THE SECOND PROTEOLYTIC CLEAVAGE OF NOTCH RECEPTOR | Genes involved in Receptor-ligand binding initiates the second proteolytic cleavage of Notch receptor |
0.0 | 0.1 | REACTOME THE NLRP3 INFLAMMASOME | Genes involved in The NLRP3 inflammasome |
0.0 | 0.0 | REACTOME NOREPINEPHRINE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Norepinephrine Neurotransmitter Release Cycle |
0.0 | 0.3 | REACTOME PHASE II CONJUGATION | Genes involved in Phase II conjugation |
0.0 | 0.2 | REACTOME BILE SALT AND ORGANIC ANION SLC TRANSPORTERS | Genes involved in Bile salt and organic anion SLC transporters |
0.0 | 0.3 | REACTOME TRAFFICKING OF AMPA RECEPTORS | Genes involved in Trafficking of AMPA receptors |
0.0 | 0.2 | REACTOME SIGNALING BY NODAL | Genes involved in Signaling by NODAL |
0.0 | 0.1 | REACTOME NUCLEAR SIGNALING BY ERBB4 | Genes involved in Nuclear signaling by ERBB4 |
0.0 | 0.0 | REACTOME FGFR4 LIGAND BINDING AND ACTIVATION | Genes involved in FGFR4 ligand binding and activation |
0.0 | 0.1 | REACTOME RAP1 SIGNALLING | Genes involved in Rap1 signalling |
0.0 | 0.3 | REACTOME INTERACTION BETWEEN L1 AND ANKYRINS | Genes involved in Interaction between L1 and Ankyrins |
0.0 | 0.1 | REACTOME DOPAMINE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Dopamine Neurotransmitter Release Cycle |
0.0 | 0.1 | REACTOME LIPOPROTEIN METABOLISM | Genes involved in Lipoprotein metabolism |
0.0 | 0.1 | REACTOME REMOVAL OF THE FLAP INTERMEDIATE FROM THE C STRAND | Genes involved in Removal of the Flap Intermediate from the C-strand |
0.0 | 0.1 | REACTOME ACYL CHAIN REMODELLING OF PC | Genes involved in Acyl chain remodelling of PC |
0.0 | 0.0 | REACTOME ACTIVATION OF THE AP1 FAMILY OF TRANSCRIPTION FACTORS | Genes involved in Activation of the AP-1 family of transcription factors |
0.0 | 0.1 | REACTOME KERATAN SULFATE DEGRADATION | Genes involved in Keratan sulfate degradation |
0.0 | 0.1 | REACTOME JNK C JUN KINASES PHOSPHORYLATION AND ACTIVATION MEDIATED BY ACTIVATED HUMAN TAK1 | Genes involved in JNK (c-Jun kinases) phosphorylation and activation mediated by activated human TAK1 |
0.0 | 0.1 | REACTOME ACTIVATION OF NF KAPPAB IN B CELLS | Genes involved in Activation of NF-kappaB in B Cells |
0.0 | 0.1 | REACTOME VEGF LIGAND RECEPTOR INTERACTIONS | Genes involved in VEGF ligand-receptor interactions |
0.0 | 0.2 | REACTOME BASIGIN INTERACTIONS | Genes involved in Basigin interactions |
0.0 | 0.1 | REACTOME RECYCLING OF BILE ACIDS AND SALTS | Genes involved in Recycling of bile acids and salts |
0.0 | 0.1 | REACTOME TANDEM PORE DOMAIN POTASSIUM CHANNELS | Genes involved in Tandem pore domain potassium channels |
0.0 | 0.1 | REACTOME INHIBITION OF INSULIN SECRETION BY ADRENALINE NORADRENALINE | Genes involved in Inhibition of Insulin Secretion by Adrenaline/Noradrenaline |
0.0 | 0.0 | REACTOME ARMS MEDIATED ACTIVATION | Genes involved in ARMS-mediated activation |