Gene Symbol | Gene ID | Gene Info |
---|---|---|
Alx4
|
ENSMUSG00000040310.6 | Alx4 |
Gene | Promoter | Distance | Association probability | Pearson corr. coef. | P-value | Plot |
---|---|---|---|---|---|---|
Alx4 | chr2_93613130_93613306 | 29166 | 0.199582 | 0.89 | 1.8e-02 | Click! |
Alx4 | chr2_93646047_93646216 | 3743 | 0.292225 | -0.64 | 1.7e-01 | Click! |
Alx4 | chr2_93659126_93659294 | 16822 | 0.215802 | -0.59 | 2.2e-01 | Click! |
Alx4 | chr2_93599858_93600026 | 42442 | 0.162549 | 0.42 | 4.1e-01 | Click! |
Alx4 | chr2_93666246_93666420 | 23945 | 0.193686 | 0.28 | 6.0e-01 | Click! |
Move your cursor over a bar to see sample name and corresponding Z-value.
Cis Regulatory Element (CRE) | Target Score | Top associated gene | Gene Info | Distance of CRE to TSS | CRE/Gene association probability |
---|---|---|---|---|---|
chr9_105878487_105878719 | 3.23 |
Col6a5 |
collagen, type VI, alpha 5 |
3203 |
0.27 |
chr1_24612181_24612351 | 1.79 |
Gm28439 |
predicted gene 28439 |
144 |
0.72 |
chr19_43971247_43971535 | 1.68 |
Cpn1 |
carboxypeptidase N, polypeptide 1 |
2698 |
0.21 |
chr2_22589828_22590052 | 1.64 |
Gm13340 |
predicted gene 13340 |
293 |
0.68 |
chr2_12019756_12019966 | 1.46 |
Gm13310 |
predicted gene 13310 |
64131 |
0.11 |
chr6_35874026_35874908 | 1.42 |
Gm43442 |
predicted gene 43442 |
52244 |
0.17 |
chr14_60635934_60636102 | 1.35 |
Spata13 |
spermatogenesis associated 13 |
1263 |
0.52 |
chr13_58058115_58058280 | 1.22 |
Mir874 |
microRNA 874 |
34997 |
0.13 |
chr15_25942169_25942359 | 1.22 |
Retreg1 |
reticulophagy regulator 1 |
415 |
0.85 |
chr12_21142640_21142894 | 1.21 |
Asap2 |
ArfGAP with SH3 domain, ankyrin repeat and PH domain 2 |
30813 |
0.16 |
chr10_71332846_71333050 | 1.20 |
Cisd1 |
CDGSH iron sulfur domain 1 |
12006 |
0.12 |
chr13_101967419_101967852 | 1.19 |
Gm17832 |
predicted gene, 17832 |
47215 |
0.17 |
chr18_46336206_46336490 | 1.17 |
4930415P13Rik |
RIKEN cDNA 4930415P13 gene |
4081 |
0.17 |
chr6_117577757_117577908 | 1.16 |
Gm9946 |
predicted gene 9946 |
10160 |
0.2 |
chr13_80895235_80895839 | 1.15 |
Arrdc3 |
arrestin domain containing 3 |
5019 |
0.18 |
chr1_66862471_66862695 | 1.15 |
Acadl |
acyl-Coenzyme A dehydrogenase, long-chain |
694 |
0.5 |
chr5_75046920_75047087 | 1.15 |
Gm18593 |
predicted gene, 18593 |
1476 |
0.27 |
chr5_118294350_118294584 | 1.11 |
Gm25076 |
predicted gene, 25076 |
28018 |
0.15 |
chr4_132129267_132129447 | 1.10 |
Oprd1 |
opioid receptor, delta 1 |
15129 |
0.1 |
chr9_33001470_33001748 | 1.09 |
Gm27166 |
predicted gene 27166 |
30182 |
0.17 |
chr3_69094579_69094744 | 1.09 |
Gm22009 |
predicted gene, 22009 |
9214 |
0.13 |
chr9_30613779_30614132 | 1.08 |
Gm47716 |
predicted gene, 47716 |
18632 |
0.24 |
chr11_116021292_116021891 | 1.08 |
H3f3b |
H3.3 histone B |
2882 |
0.14 |
chr7_101491003_101491309 | 1.08 |
Pde2a |
phosphodiesterase 2A, cGMP-stimulated |
9871 |
0.14 |
chr5_117979162_117979338 | 1.07 |
Fbxo21 |
F-box protein 21 |
74 |
0.96 |
chr5_12476907_12477068 | 1.07 |
Gm8925 |
predicted gene 8925 |
2641 |
0.3 |
chr2_61138777_61138928 | 1.04 |
Gm13581 |
predicted gene 13581 |
85940 |
0.09 |
chr15_31279226_31279377 | 1.02 |
Gm49296 |
predicted gene, 49296 |
2788 |
0.19 |
chr15_79690269_79690868 | 1.02 |
Gtpbp1 |
GTP binding protein 1 |
277 |
0.78 |
chr13_28718314_28718531 | 1.01 |
Mir6368 |
microRNA 6368 |
7549 |
0.28 |
chr16_90402615_90402775 | 1.00 |
Hunk |
hormonally upregulated Neu-associated kinase |
2151 |
0.29 |
chr7_34485188_34485527 | 1.00 |
Gm12780 |
predicted gene 12780 |
10708 |
0.16 |
chr2_156204536_156204687 | 0.99 |
Phf20 |
PHD finger protein 20 |
7855 |
0.13 |
chr2_28401752_28401907 | 0.99 |
Ppp1r26 |
protein phosphatase 1, regulatory subunit 26 |
44971 |
0.1 |
chr12_8643417_8643595 | 0.98 |
Pum2 |
pumilio RNA-binding family member 2 |
30628 |
0.17 |
chr9_118689127_118689278 | 0.97 |
Itga9 |
integrin alpha 9 |
3367 |
0.3 |
chr10_75047035_75047323 | 0.97 |
Rab36 |
RAB36, member RAS oncogene family |
8956 |
0.15 |
chr5_60042871_60043030 | 0.96 |
Gm43393 |
predicted gene 43393 |
17067 |
0.17 |
chr13_8591659_8591833 | 0.96 |
Gm48262 |
predicted gene, 48262 |
38726 |
0.19 |
chr18_38390855_38391358 | 0.95 |
Ndfip1 |
Nedd4 family interacting protein 1 |
19290 |
0.12 |
chr10_115337191_115337351 | 0.95 |
Tmem19 |
transmembrane protein 19 |
11793 |
0.14 |
chr13_104035617_104035778 | 0.94 |
Nln |
neurolysin (metallopeptidase M3 family) |
870 |
0.63 |
chr5_22266775_22266964 | 0.93 |
Gm16113 |
predicted gene 16113 |
14713 |
0.18 |
chr8_77961865_77962061 | 0.93 |
Gm29895 |
predicted gene, 29895 |
82047 |
0.09 |
chr2_136986571_136986744 | 0.93 |
Slx4ip |
SLX4 interacting protein |
81114 |
0.08 |
chr7_122666197_122666401 | 0.92 |
Cacng3 |
calcium channel, voltage-dependent, gamma subunit 3 |
4193 |
0.22 |
chr18_61374295_61374476 | 0.91 |
Gm25301 |
predicted gene, 25301 |
23428 |
0.12 |
chr2_63580816_63581021 | 0.90 |
Gm23503 |
predicted gene, 23503 |
148724 |
0.05 |
chr15_75994277_75994580 | 0.89 |
Mapk15 |
mitogen-activated protein kinase 15 |
659 |
0.46 |
chr8_34502888_34503193 | 0.89 |
Gm8268 |
predicted gene 8268 |
4167 |
0.2 |
chr7_100042239_100042447 | 0.88 |
Chrdl2 |
chordin-like 2 |
20244 |
0.14 |
chr5_8849350_8849972 | 0.88 |
Abcb1b |
ATP-binding cassette, sub-family B (MDR/TAP), member 1B |
328 |
0.86 |
chr17_73839522_73839982 | 0.87 |
Gm4948 |
predicted gene 4948 |
31598 |
0.14 |
chr7_139559759_139559933 | 0.87 |
Nkx6-2 |
NK6 homeobox 2 |
22944 |
0.17 |
chr4_117190012_117190473 | 0.86 |
Gm25099 |
predicted gene, 25099 |
300 |
0.73 |
chr2_132654710_132655013 | 0.85 |
Rpl23a-ps4 |
ribosomal protein L23A, pseudogene 4 |
7381 |
0.12 |
chr3_98020663_98020830 | 0.85 |
Notch2 |
notch 2 |
7208 |
0.19 |
chr4_116695063_116695819 | 0.85 |
Prdx1 |
peroxiredoxin 1 |
8129 |
0.1 |
chr15_38661347_38661720 | 0.85 |
Atp6v1c1 |
ATPase, H+ transporting, lysosomal V1 subunit C1 |
400 |
0.79 |
chr19_38356216_38356572 | 0.84 |
Gm50150 |
predicted gene, 50150 |
13780 |
0.14 |
chr2_6611640_6611812 | 0.84 |
Celf2 |
CUGBP, Elav-like family member 2 |
4454 |
0.32 |
chr11_70713419_70713657 | 0.83 |
Mir6925 |
microRNA 6925 |
7548 |
0.08 |
chr15_54947760_54948020 | 0.83 |
Gm26684 |
predicted gene, 26684 |
4180 |
0.19 |
chr12_21173493_21173670 | 0.82 |
Asap2 |
ArfGAP with SH3 domain, ankyrin repeat and PH domain 2 |
61627 |
0.09 |
chr14_20319722_20320198 | 0.82 |
Nudt13 |
nudix (nucleoside diphosphate linked moiety X)-type motif 13 |
8531 |
0.12 |
chr8_34506104_34506386 | 0.82 |
Gm8268 |
predicted gene 8268 |
962 |
0.54 |
chr16_18711808_18711969 | 0.81 |
Rps2-ps7 |
ribosomal protein S2, pseudogene 7 |
29672 |
0.13 |
chr5_63897626_63897962 | 0.81 |
0610040J01Rik |
RIKEN cDNA 0610040J01 gene |
20318 |
0.15 |
chr7_140776294_140776445 | 0.81 |
Gm29799 |
predicted gene, 29799 |
8146 |
0.09 |
chr12_62877016_62877197 | 0.81 |
Gm7763 |
predicted gene 7763 |
6176 |
0.25 |
chr6_57544936_57545297 | 0.80 |
Ppm1k |
protein phosphatase 1K (PP2C domain containing) |
9648 |
0.15 |
chr8_36692402_36692571 | 0.80 |
Dlc1 |
deleted in liver cancer 1 |
40568 |
0.2 |
chr15_82290409_82290560 | 0.80 |
Septin3 |
septin 3 |
6054 |
0.09 |
chr12_8643213_8643385 | 0.79 |
Pum2 |
pumilio RNA-binding family member 2 |
30835 |
0.16 |
chr13_64229004_64229155 | 0.79 |
Cdc14b |
CDC14 cell division cycle 14B |
16797 |
0.1 |
chr3_98044919_98045386 | 0.78 |
Gm42819 |
predicted gene 42819 |
14465 |
0.18 |
chr2_22587699_22587875 | 0.78 |
Gm13341 |
predicted gene 13341 |
175 |
0.91 |
chr8_17603352_17603521 | 0.78 |
Csmd1 |
CUB and Sushi multiple domains 1 |
67850 |
0.15 |
chr13_14192509_14192814 | 0.78 |
Arid4b |
AT rich interactive domain 4B (RBP1-like) |
1484 |
0.37 |
chr1_34439675_34439854 | 0.77 |
Imp4 |
IMP4, U3 small nucleolar ribonucleoprotein |
87 |
0.49 |
chr11_111605518_111605669 | 0.77 |
Gm11676 |
predicted gene 11676 |
7713 |
0.32 |
chr7_130015298_130015740 | 0.77 |
Gm23847 |
predicted gene, 23847 |
19575 |
0.24 |
chr15_83454522_83454702 | 0.77 |
Pacsin2 |
protein kinase C and casein kinase substrate in neurons 2 |
9940 |
0.15 |
chr6_50369010_50369173 | 0.77 |
Osbpl3 |
oxysterol binding protein-like 3 |
1124 |
0.6 |
chr12_80909548_80909699 | 0.76 |
Gm23298 |
predicted gene, 23298 |
1854 |
0.26 |
chr19_44027305_44027461 | 0.76 |
Cyp2c23 |
cytochrome P450, family 2, subfamily c, polypeptide 23 |
1816 |
0.28 |
chr1_40117818_40118037 | 0.76 |
Gm37347 |
predicted gene, 37347 |
29416 |
0.14 |
chr9_102516246_102516552 | 0.76 |
Ky |
kyphoscoliosis peptidase |
4937 |
0.14 |
chr7_16604272_16604437 | 0.76 |
Gm29443 |
predicted gene 29443 |
9470 |
0.09 |
chr10_118705843_118706313 | 0.75 |
Gm33337 |
predicted gene, 33337 |
9648 |
0.19 |
chr9_123107320_123107472 | 0.75 |
Zdhhc3 |
zinc finger, DHHC domain containing 3 |
5436 |
0.12 |
chr5_138106488_138106739 | 0.75 |
Gm43493 |
predicted gene 43493 |
294 |
0.77 |
chr4_6539560_6539735 | 0.75 |
Gm11801 |
predicted gene 11801 |
86 |
0.98 |
chr6_89235641_89235792 | 0.75 |
Gm25961 |
predicted gene, 25961 |
13886 |
0.12 |
chr2_165559022_165559181 | 0.75 |
Eya2 |
EYA transcriptional coactivator and phosphatase 2 |
35931 |
0.12 |
chr6_59052402_59052674 | 0.73 |
Gm19165 |
predicted gene, 19165 |
15649 |
0.17 |
chr3_118507933_118508602 | 0.73 |
Gm37773 |
predicted gene, 37773 |
17884 |
0.14 |
chr3_10211563_10211714 | 0.72 |
Fabp4 |
fatty acid binding protein 4, adipocyte |
3062 |
0.13 |
chr5_45476407_45476609 | 0.72 |
Lap3 |
leucine aminopeptidase 3 |
16866 |
0.11 |
chr3_81676672_81676850 | 0.72 |
Gm43346 |
predicted gene 43346 |
44915 |
0.18 |
chr11_100330372_100330542 | 0.71 |
Gast |
gastrin |
3950 |
0.09 |
chr4_63738674_63738850 | 0.71 |
Tnfsf15 |
tumor necrosis factor (ligand) superfamily, member 15 |
6351 |
0.22 |
chr10_108074024_108074345 | 0.71 |
Gm47999 |
predicted gene, 47999 |
68248 |
0.12 |
chr19_29131769_29132065 | 0.70 |
Mir101b |
microRNA 101b |
3362 |
0.18 |
chr7_37215088_37215614 | 0.70 |
Gm28075 |
predicted gene 28075 |
74810 |
0.09 |
chr11_75351165_75351364 | 0.70 |
Smyd4 |
SET and MYND domain containing 4 |
2769 |
0.17 |
chr15_75803070_75803233 | 0.70 |
Zc3h3 |
zinc finger CCCH type containing 3 |
9708 |
0.12 |
chr14_51104556_51104707 | 0.70 |
Rnase4 |
ribonuclease, RNase A family 4 |
8272 |
0.08 |
chr18_38524013_38524201 | 0.69 |
Gm50349 |
predicted gene, 50349 |
42804 |
0.11 |
chr8_108101452_108101603 | 0.69 |
Zfhx3 |
zinc finger homeobox 3 |
106968 |
0.07 |
chr6_121878156_121878361 | 0.69 |
Mug1 |
murinoglobulin 1 |
7319 |
0.2 |
chr16_24394028_24394581 | 0.69 |
Lpp |
LIM domain containing preferred translocation partner in lipoma |
566 |
0.73 |
chr1_185836743_185836921 | 0.69 |
Gm9722 |
predicted gene 9722 |
42053 |
0.18 |
chr19_10188246_10188628 | 0.69 |
Mir6993 |
microRNA 6993 |
2938 |
0.13 |
chr19_49301629_49301801 | 0.68 |
Gm50442 |
predicted gene, 50442 |
211042 |
0.02 |
chr1_66895610_66896410 | 0.68 |
Gm25832 |
predicted gene, 25832 |
29213 |
0.09 |
chr7_89423464_89423896 | 0.68 |
AI314278 |
expressed sequence AI314278 |
2626 |
0.22 |
chr18_56974912_56975237 | 0.68 |
C330018D20Rik |
RIKEN cDNA C330018D20 gene |
172 |
0.96 |
chr10_43378887_43379063 | 0.68 |
Rps19-ps11 |
ribosomal protein S19, pseudogene 11 |
5055 |
0.15 |
chr13_106525577_106525787 | 0.68 |
Gm48216 |
predicted gene, 48216 |
6135 |
0.23 |
chr6_120592373_120592569 | 0.68 |
Gm44124 |
predicted gene, 44124 |
12295 |
0.14 |
chr5_145464782_145464950 | 0.67 |
Cyp3a16 |
cytochrome P450, family 3, subfamily a, polypeptide 16 |
4857 |
0.19 |
chr5_66979311_66979467 | 0.67 |
Limch1 |
LIM and calponin homology domains 1 |
2371 |
0.2 |
chrX_48193537_48193988 | 0.67 |
Zdhhc9 |
zinc finger, DHHC domain containing 9 |
14566 |
0.16 |
chr14_103099863_103100150 | 0.67 |
Fbxl3 |
F-box and leucine-rich repeat protein 3 |
440 |
0.8 |
chr2_69911096_69911271 | 0.67 |
Ubr3 |
ubiquitin protein ligase E3 component n-recognin 3 |
13880 |
0.13 |
chr1_52597389_52597548 | 0.67 |
Gm5527 |
predicted gene 5527 |
12950 |
0.13 |
chr8_13160592_13160981 | 0.67 |
Lamp1 |
lysosomal-associated membrane protein 1 |
1625 |
0.22 |
chr1_93723491_93723642 | 0.67 |
Gm10550 |
predicted gene 10550 |
7538 |
0.13 |
chr3_131336698_131337069 | 0.66 |
Sgms2 |
sphingomyelin synthase 2 |
8050 |
0.16 |
chr4_136452351_136452618 | 0.66 |
6030445D17Rik |
RIKEN cDNA 6030445D17 gene |
9766 |
0.15 |
chr11_60537500_60537667 | 0.66 |
Alkbh5 |
alkB homolog 5, RNA demethylase |
395 |
0.72 |
chr6_92922025_92922180 | 0.66 |
9530026P05Rik |
RIKEN cDNA 9530026P05 gene |
18227 |
0.19 |
chr6_86699596_86699790 | 0.66 |
Gm44214 |
predicted gene, 44214 |
11265 |
0.1 |
chr8_45280986_45281163 | 0.66 |
Klkb1 |
kallikrein B, plasma 1 |
13785 |
0.15 |
chr7_84171490_84171660 | 0.66 |
Gm22177 |
predicted gene, 22177 |
1010 |
0.47 |
chr4_116720481_116720689 | 0.66 |
Tesk2 |
testis-specific kinase 2 |
363 |
0.78 |
chr13_56692137_56692672 | 0.66 |
Smad5 |
SMAD family member 5 |
10606 |
0.22 |
chr2_93452649_93452834 | 0.66 |
Cd82 |
CD82 antigen |
58 |
0.52 |
chr8_124156032_124156199 | 0.65 |
Gm3889 |
predicted gene 3889 |
3958 |
0.23 |
chr5_105830536_105830687 | 0.65 |
Lrrc8d |
leucine rich repeat containing 8D |
6100 |
0.14 |
chr16_31188294_31188445 | 0.65 |
Acap2 |
ArfGAP with coiled-coil, ankyrin repeat and PH domains 2 |
12622 |
0.15 |
chr8_13036629_13036799 | 0.65 |
F10 |
coagulation factor X |
594 |
0.57 |
chr13_34814605_34814934 | 0.65 |
Gm47157 |
predicted gene, 47157 |
225 |
0.91 |
chr11_81374417_81374616 | 0.64 |
4930527B05Rik |
RIKEN cDNA 4930527B05 gene |
10497 |
0.3 |
chr6_145469440_145469652 | 0.64 |
Gm25373 |
predicted gene, 25373 |
5357 |
0.18 |
chr9_123530850_123531001 | 0.64 |
Sacm1l |
SAC1 suppressor of actin mutations 1-like (yeast) |
1043 |
0.5 |
chr6_134961877_134962233 | 0.64 |
Apold1 |
apolipoprotein L domain containing 1 |
19663 |
0.11 |
chr6_9061261_9061827 | 0.64 |
Gm35736 |
predicted gene, 35736 |
85222 |
0.1 |
chr2_158358589_158358740 | 0.64 |
Gm26003 |
predicted gene, 26003 |
192 |
0.47 |
chr8_128687947_128688299 | 0.64 |
Itgb1 |
integrin beta 1 (fibronectin receptor beta) |
2253 |
0.29 |
chr19_43767883_43768034 | 0.64 |
Cutc |
cutC copper transporter |
3085 |
0.18 |
chr9_67604985_67605321 | 0.64 |
Tln2 |
talin 2 |
45450 |
0.15 |
chr8_128654178_128654469 | 0.64 |
Gm45746 |
predicted gene 45746 |
10 |
0.97 |
chr2_75202592_75202875 | 0.64 |
Gm13653 |
predicted gene 13653 |
10456 |
0.15 |
chr6_28891682_28891856 | 0.64 |
Snd1 |
staphylococcal nuclease and tudor domain containing 1 |
11726 |
0.21 |
chr6_108662475_108662641 | 0.63 |
Bhlhe40 |
basic helix-loop-helix family, member e40 |
488 |
0.72 |
chr6_5496841_5497314 | 0.63 |
Pdk4 |
pyruvate dehydrogenase kinase, isoenzyme 4 |
768 |
0.76 |
chr1_39869838_39870141 | 0.63 |
1700066B17Rik |
RIKEN cDNA 1700066B17 gene |
22655 |
0.18 |
chr1_72293871_72294177 | 0.63 |
Tmem169 |
transmembrane protein 169 |
9629 |
0.13 |
chr3_116080235_116080422 | 0.63 |
Gm26344 |
predicted gene, 26344 |
14409 |
0.14 |
chr6_93395998_93396170 | 0.63 |
Gm44181 |
predicted gene, 44181 |
59473 |
0.12 |
chr6_113640294_113640463 | 0.63 |
Gm43964 |
predicted gene, 43964 |
1143 |
0.23 |
chr9_79213455_79213848 | 0.63 |
Gm47499 |
predicted gene, 47499 |
11644 |
0.17 |
chr11_3208642_3208934 | 0.62 |
Eif4enif1 |
eukaryotic translation initiation factor 4E nuclear import factor 1 |
5158 |
0.13 |
chr8_4313834_4314030 | 0.62 |
Elavl1 |
ELAV (embryonic lethal, abnormal vision)-like 1 (Hu antigen R) |
1313 |
0.29 |
chr6_121891225_121891413 | 0.62 |
Mug1 |
murinoglobulin 1 |
5742 |
0.2 |
chr10_108350464_108350766 | 0.62 |
Gm23105 |
predicted gene, 23105 |
13050 |
0.19 |
chr6_31090797_31090948 | 0.62 |
Lncpint |
long non-protein coding RNA, Trp53 induced transcript |
2401 |
0.18 |
chr4_62508801_62509208 | 0.62 |
Hdhd3 |
haloacid dehalogenase-like hydrolase domain containing 3 |
5537 |
0.12 |
chr14_30184944_30185295 | 0.62 |
Cacna1d |
calcium channel, voltage-dependent, L type, alpha 1D subunit |
9728 |
0.2 |
chr12_99366132_99366283 | 0.61 |
Gm47138 |
predicted gene, 47138 |
3706 |
0.15 |
chr3_133534210_133534372 | 0.61 |
Tet2 |
tet methylcytosine dioxygenase 2 |
9995 |
0.17 |
chr3_97337526_97337699 | 0.61 |
Bcl9 |
B cell CLL/lymphoma 9 |
39695 |
0.14 |
chr18_55095856_55096021 | 0.61 |
AC163347.1 |
novel transcript |
422 |
0.83 |
chr18_12202319_12202472 | 0.61 |
Npc1 |
NPC intracellular cholesterol transporter 1 |
6988 |
0.14 |
chr3_94338287_94338715 | 0.61 |
Gm43743 |
predicted gene 43743 |
3169 |
0.1 |
chr18_34328570_34328733 | 0.61 |
Srp19 |
signal recognition particle 19 |
2196 |
0.29 |
chr4_44172816_44172976 | 0.61 |
Rnf38 |
ring finger protein 38 |
4557 |
0.2 |
chr2_44105283_44105434 | 0.61 |
Arhgap15os |
Rho GTPase activating protein 15, opposite strand |
40034 |
0.19 |
chr13_3635068_3635349 | 0.61 |
Asb13 |
ankyrin repeat and SOCS box-containing 13 |
1109 |
0.45 |
chr8_24445565_24445716 | 0.61 |
Gm44620 |
predicted gene 44620 |
1457 |
0.34 |
chr6_50981986_50982138 | 0.61 |
Gm44402 |
predicted gene, 44402 |
14794 |
0.23 |
chr5_87019691_87019873 | 0.60 |
Gm18635 |
predicted gene, 18635 |
5622 |
0.12 |
chr13_59875722_59876043 | 0.60 |
Gm48384 |
predicted gene, 48384 |
2240 |
0.23 |
chr2_179292139_179292587 | 0.60 |
Gm14293 |
predicted gene 14293 |
51873 |
0.14 |
chr17_47909678_47909861 | 0.60 |
Gm15556 |
predicted gene 15556 |
12609 |
0.13 |
chr6_72216295_72216489 | 0.60 |
Atoh8 |
atonal bHLH transcription factor 8 |
18145 |
0.15 |
chr15_77746128_77746463 | 0.60 |
Gm49410 |
predicted gene, 49410 |
5534 |
0.11 |
chr10_95426797_95427022 | 0.60 |
5730420D15Rik |
RIKEN cDNA 5730420D15 gene |
9534 |
0.12 |
chr10_70924491_70924642 | 0.60 |
Bicc1 |
BicC family RNA binding protein 1 |
23923 |
0.12 |
chr9_50723728_50723879 | 0.60 |
Dixdc1 |
DIX domain containing 1 |
4135 |
0.13 |
chr5_89416345_89416742 | 0.60 |
Gc |
vitamin D binding protein |
19085 |
0.24 |
chr1_119189619_119189770 | 0.59 |
Gm8321 |
predicted gene 8321 |
32108 |
0.17 |
chr2_178711802_178711999 | 0.59 |
Cdh26 |
cadherin-like 26 |
251270 |
0.02 |
chr11_62554297_62554580 | 0.59 |
Ubb |
ubiquitin B |
2762 |
0.12 |
chr18_57551026_57551308 | 0.59 |
4930511M06Rik |
RIKEN cDNA 4930511M06 gene |
609 |
0.7 |
chr4_34421112_34421263 | 0.59 |
Gm12754 |
predicted gene 12754 |
31340 |
0.14 |
chr18_54990868_54991280 | 0.59 |
Gm4221 |
predicted gene 4221 |
764 |
0.47 |
chr7_45480279_45480444 | 0.59 |
Dhdh |
dihydrodiol dehydrogenase (dimeric) |
430 |
0.52 |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.3 | 0.6 | GO:0010735 | positive regulation of transcription via serum response element binding(GO:0010735) |
0.2 | 0.9 | GO:0003166 | bundle of His development(GO:0003166) |
0.2 | 0.6 | GO:0019254 | carnitine metabolic process, CoA-linked(GO:0019254) |
0.2 | 1.0 | GO:0009115 | xanthine catabolic process(GO:0009115) |
0.2 | 1.4 | GO:0002489 | antigen processing and presentation of endogenous peptide antigen via MHC class Ib via ER pathway(GO:0002488) antigen processing and presentation of endogenous peptide antigen via MHC class Ib via ER pathway, TAP-dependent(GO:0002489) |
0.2 | 0.5 | GO:0090230 | regulation of centromere complex assembly(GO:0090230) |
0.2 | 0.8 | GO:0015722 | canalicular bile acid transport(GO:0015722) |
0.2 | 0.5 | GO:0007161 | calcium-independent cell-matrix adhesion(GO:0007161) |
0.2 | 0.6 | GO:0007023 | post-chaperonin tubulin folding pathway(GO:0007023) |
0.1 | 0.4 | GO:0035553 | oxidative RNA demethylation(GO:0035513) oxidative single-stranded RNA demethylation(GO:0035553) |
0.1 | 0.4 | GO:0090259 | regulation of retinal ganglion cell axon guidance(GO:0090259) |
0.1 | 0.4 | GO:1902809 | regulation of skeletal muscle fiber differentiation(GO:1902809) |
0.1 | 0.4 | GO:0060300 | regulation of cytokine activity(GO:0060300) |
0.1 | 0.4 | GO:1990705 | cholangiocyte proliferation(GO:1990705) |
0.1 | 0.5 | GO:0010510 | regulation of acetyl-CoA biosynthetic process from pyruvate(GO:0010510) |
0.1 | 0.5 | GO:0016479 | negative regulation of transcription from RNA polymerase I promoter(GO:0016479) |
0.1 | 0.4 | GO:0035564 | regulation of kidney size(GO:0035564) |
0.1 | 0.4 | GO:0006435 | threonyl-tRNA aminoacylation(GO:0006435) |
0.1 | 0.4 | GO:1902498 | regulation of protein autoubiquitination(GO:1902498) |
0.1 | 0.4 | GO:0006556 | S-adenosylmethionine biosynthetic process(GO:0006556) |
0.1 | 0.4 | GO:1900825 | regulation of membrane depolarization during cardiac muscle cell action potential(GO:1900825) |
0.1 | 0.4 | GO:0032474 | otolith morphogenesis(GO:0032474) |
0.1 | 0.6 | GO:0038161 | prolactin signaling pathway(GO:0038161) |
0.1 | 0.8 | GO:0060613 | fat pad development(GO:0060613) |
0.1 | 0.5 | GO:0045636 | positive regulation of melanocyte differentiation(GO:0045636) |
0.1 | 0.4 | GO:0032430 | positive regulation of phospholipase A2 activity(GO:0032430) |
0.1 | 0.6 | GO:0007016 | cytoskeletal anchoring at plasma membrane(GO:0007016) |
0.1 | 0.4 | GO:0051919 | positive regulation of fibrinolysis(GO:0051919) |
0.1 | 0.3 | GO:1901856 | negative regulation of cellular respiration(GO:1901856) |
0.1 | 1.4 | GO:0051895 | negative regulation of focal adhesion assembly(GO:0051895) |
0.1 | 0.5 | GO:0052805 | histidine catabolic process(GO:0006548) imidazole-containing compound catabolic process(GO:0052805) |
0.1 | 0.2 | GO:0003162 | atrioventricular node development(GO:0003162) |
0.1 | 0.3 | GO:0042732 | D-xylose metabolic process(GO:0042732) |
0.1 | 0.3 | GO:0061502 | early endosome to recycling endosome transport(GO:0061502) |
0.1 | 0.3 | GO:0048294 | negative regulation of isotype switching to IgE isotypes(GO:0048294) |
0.1 | 0.3 | GO:0070681 | glutaminyl-tRNAGln biosynthesis via transamidation(GO:0070681) |
0.1 | 0.3 | GO:0021524 | visceral motor neuron differentiation(GO:0021524) |
0.1 | 0.3 | GO:0010482 | epidermal cell division(GO:0010481) regulation of epidermal cell division(GO:0010482) |
0.1 | 0.2 | GO:1902730 | regulation of heparan sulfate proteoglycan biosynthetic process(GO:0010908) positive regulation of heparan sulfate proteoglycan biosynthetic process(GO:0010909) positive regulation of proteoglycan biosynthetic process(GO:1902730) |
0.1 | 0.3 | GO:0032417 | positive regulation of sodium:proton antiporter activity(GO:0032417) |
0.1 | 0.3 | GO:0070827 | chromatin maintenance(GO:0070827) |
0.1 | 0.2 | GO:0097212 | lysosomal membrane organization(GO:0097212) |
0.1 | 0.2 | GO:1902953 | positive regulation of ER to Golgi vesicle-mediated transport(GO:1902953) |
0.1 | 0.4 | GO:0006686 | sphingomyelin biosynthetic process(GO:0006686) |
0.1 | 0.3 | GO:0030091 | protein repair(GO:0030091) |
0.1 | 0.2 | GO:0001543 | ovarian follicle rupture(GO:0001543) |
0.1 | 0.3 | GO:0000707 | meiotic DNA recombinase assembly(GO:0000707) |
0.1 | 0.3 | GO:0046499 | S-adenosylmethioninamine metabolic process(GO:0046499) |
0.1 | 0.2 | GO:0090365 | regulation of mRNA modification(GO:0090365) |
0.1 | 0.5 | GO:0060159 | regulation of dopamine receptor signaling pathway(GO:0060159) |
0.1 | 0.1 | GO:0010911 | regulation of isomerase activity(GO:0010911) positive regulation of isomerase activity(GO:0010912) |
0.1 | 0.3 | GO:2000659 | regulation of interleukin-1-mediated signaling pathway(GO:2000659) |
0.1 | 0.2 | GO:0015817 | histidine transport(GO:0015817) |
0.1 | 0.2 | GO:0030997 | regulation of centriole-centriole cohesion(GO:0030997) |
0.1 | 0.2 | GO:0002314 | germinal center B cell differentiation(GO:0002314) |
0.1 | 0.2 | GO:0051387 | negative regulation of neurotrophin TRK receptor signaling pathway(GO:0051387) |
0.1 | 0.1 | GO:1902071 | regulation of hypoxia-inducible factor-1alpha signaling pathway(GO:1902071) |
0.1 | 0.2 | GO:0045626 | negative regulation of T-helper 1 cell differentiation(GO:0045626) |
0.1 | 0.2 | GO:0061470 | T follicular helper cell differentiation(GO:0061470) |
0.1 | 0.3 | GO:0006681 | galactosylceramide metabolic process(GO:0006681) |
0.1 | 0.2 | GO:0086046 | membrane depolarization during SA node cell action potential(GO:0086046) |
0.1 | 0.3 | GO:0046533 | negative regulation of photoreceptor cell differentiation(GO:0046533) |
0.1 | 1.1 | GO:0043153 | entrainment of circadian clock by photoperiod(GO:0043153) |
0.1 | 0.1 | GO:0003347 | epicardial cell to mesenchymal cell transition(GO:0003347) |
0.1 | 0.2 | GO:0070836 | caveola assembly(GO:0070836) |
0.1 | 0.3 | GO:0070601 | centromeric sister chromatid cohesion(GO:0070601) |
0.1 | 0.2 | GO:1900095 | regulation of dosage compensation by inactivation of X chromosome(GO:1900095) |
0.1 | 0.4 | GO:0010815 | bradykinin catabolic process(GO:0010815) |
0.1 | 0.3 | GO:0034638 | phosphatidylcholine catabolic process(GO:0034638) |
0.1 | 0.2 | GO:0006842 | tricarboxylic acid transport(GO:0006842) citrate transport(GO:0015746) |
0.1 | 0.3 | GO:0046487 | glyoxylate metabolic process(GO:0046487) |
0.1 | 0.5 | GO:2001214 | positive regulation of vasculogenesis(GO:2001214) |
0.1 | 0.3 | GO:0006566 | threonine metabolic process(GO:0006566) |
0.1 | 0.2 | GO:1903416 | response to glycoside(GO:1903416) |
0.1 | 0.5 | GO:0043983 | histone H4-K12 acetylation(GO:0043983) |
0.1 | 0.2 | GO:0003419 | growth plate cartilage chondrocyte proliferation(GO:0003419) |
0.1 | 0.2 | GO:0051365 | cellular response to potassium ion starvation(GO:0051365) |
0.1 | 0.7 | GO:0051014 | actin filament severing(GO:0051014) |
0.1 | 0.2 | GO:0097106 | postsynaptic density organization(GO:0097106) postsynaptic density assembly(GO:0097107) |
0.1 | 0.2 | GO:0036444 | calcium ion transmembrane import into mitochondrion(GO:0036444) |
0.1 | 0.2 | GO:0010724 | regulation of definitive erythrocyte differentiation(GO:0010724) |
0.1 | 0.8 | GO:0035278 | miRNA mediated inhibition of translation(GO:0035278) |
0.1 | 0.2 | GO:0061073 | ciliary body morphogenesis(GO:0061073) |
0.1 | 0.1 | GO:0071503 | response to heparin(GO:0071503) cellular response to heparin(GO:0071504) |
0.1 | 0.2 | GO:0097503 | sialylation(GO:0097503) |
0.1 | 0.2 | GO:0048208 | vesicle targeting, rough ER to cis-Golgi(GO:0048207) COPII vesicle coating(GO:0048208) |
0.1 | 0.6 | GO:0034063 | stress granule assembly(GO:0034063) |
0.1 | 0.2 | GO:0010528 | regulation of transposition(GO:0010528) negative regulation of transposition(GO:0010529) |
0.1 | 0.4 | GO:0010886 | positive regulation of cholesterol storage(GO:0010886) |
0.1 | 0.1 | GO:0072679 | thymocyte migration(GO:0072679) regulation of thymocyte migration(GO:2000410) positive regulation of thymocyte migration(GO:2000412) |
0.1 | 0.1 | GO:0098902 | regulation of membrane depolarization during action potential(GO:0098902) |
0.1 | 0.2 | GO:0036215 | response to stem cell factor(GO:0036215) cellular response to stem cell factor stimulus(GO:0036216) Kit signaling pathway(GO:0038109) |
0.1 | 0.2 | GO:0032483 | regulation of Rab protein signal transduction(GO:0032483) |
0.1 | 0.5 | GO:0032000 | positive regulation of fatty acid beta-oxidation(GO:0032000) |
0.1 | 0.3 | GO:1902894 | negative regulation of pri-miRNA transcription from RNA polymerase II promoter(GO:1902894) |
0.1 | 0.3 | GO:0097368 | establishment of Sertoli cell barrier(GO:0097368) |
0.1 | 0.2 | GO:1903553 | positive regulation of extracellular exosome assembly(GO:1903553) |
0.1 | 0.2 | GO:0051106 | regulation of DNA ligation(GO:0051105) positive regulation of DNA ligation(GO:0051106) |
0.1 | 0.2 | GO:2000346 | negative regulation of hepatocyte proliferation(GO:2000346) |
0.1 | 0.1 | GO:1902564 | negative regulation of neutrophil activation(GO:1902564) |
0.1 | 0.4 | GO:1901317 | regulation of sperm motility(GO:1901317) |
0.1 | 0.2 | GO:0061000 | negative regulation of dendritic spine development(GO:0061000) |
0.1 | 0.1 | GO:0009756 | carbohydrate mediated signaling(GO:0009756) hexose mediated signaling(GO:0009757) sugar mediated signaling pathway(GO:0010182) glucose mediated signaling pathway(GO:0010255) |
0.1 | 0.2 | GO:0043134 | hindgut contraction(GO:0043133) regulation of hindgut contraction(GO:0043134) |
0.1 | 0.2 | GO:0043379 | memory T cell differentiation(GO:0043379) |
0.1 | 0.2 | GO:0034395 | regulation of transcription from RNA polymerase II promoter in response to iron(GO:0034395) |
0.1 | 0.2 | GO:0035434 | copper ion transmembrane transport(GO:0035434) |
0.1 | 0.2 | GO:0007221 | positive regulation of transcription of Notch receptor target(GO:0007221) |
0.1 | 0.3 | GO:0050916 | sensory perception of sweet taste(GO:0050916) |
0.1 | 0.4 | GO:0071404 | cellular response to low-density lipoprotein particle stimulus(GO:0071404) |
0.1 | 0.3 | GO:0016078 | tRNA catabolic process(GO:0016078) |
0.1 | 0.3 | GO:0072675 | osteoclast fusion(GO:0072675) |
0.1 | 0.4 | GO:0072378 | blood coagulation, fibrin clot formation(GO:0072378) |
0.1 | 0.2 | GO:0036091 | positive regulation of transcription from RNA polymerase II promoter in response to oxidative stress(GO:0036091) |
0.1 | 0.2 | GO:0006933 | negative regulation of cell adhesion involved in substrate-bound cell migration(GO:0006933) |
0.0 | 0.4 | GO:0071257 | cellular response to electrical stimulus(GO:0071257) |
0.0 | 0.1 | GO:0002378 | immunoglobulin biosynthetic process(GO:0002378) |
0.0 | 0.1 | GO:0036092 | phosphatidylinositol-3-phosphate biosynthetic process(GO:0036092) |
0.0 | 0.2 | GO:1902513 | regulation of organelle transport along microtubule(GO:1902513) |
0.0 | 0.2 | GO:0014063 | negative regulation of serotonin secretion(GO:0014063) |
0.0 | 0.5 | GO:0006857 | oligopeptide transport(GO:0006857) |
0.0 | 0.1 | GO:0021912 | regulation of transcription from RNA polymerase II promoter involved in spinal cord motor neuron fate specification(GO:0021912) |
0.0 | 0.2 | GO:0071321 | cellular response to cGMP(GO:0071321) |
0.0 | 0.3 | GO:0019852 | L-ascorbic acid metabolic process(GO:0019852) |
0.0 | 0.1 | GO:0007386 | compartment pattern specification(GO:0007386) |
0.0 | 0.1 | GO:0038180 | nerve growth factor signaling pathway(GO:0038180) |
0.0 | 0.2 | GO:0010694 | positive regulation of alkaline phosphatase activity(GO:0010694) |
0.0 | 0.2 | GO:0042663 | regulation of endodermal cell fate specification(GO:0042663) |
0.0 | 0.1 | GO:0006578 | amino-acid betaine biosynthetic process(GO:0006578) |
0.0 | 0.1 | GO:0035405 | histone-threonine phosphorylation(GO:0035405) |
0.0 | 0.3 | GO:0044332 | Wnt signaling pathway involved in dorsal/ventral axis specification(GO:0044332) |
0.0 | 0.1 | GO:0070294 | renal sodium ion transport(GO:0003096) renal sodium ion absorption(GO:0070294) |
0.0 | 0.1 | GO:0071286 | cellular response to magnesium ion(GO:0071286) |
0.0 | 0.1 | GO:0051964 | negative regulation of synapse assembly(GO:0051964) |
0.0 | 0.2 | GO:0060449 | bud elongation involved in lung branching(GO:0060449) |
0.0 | 0.1 | GO:0032074 | negative regulation of nuclease activity(GO:0032074) |
0.0 | 0.1 | GO:1903237 | negative regulation of leukocyte tethering or rolling(GO:1903237) |
0.0 | 0.2 | GO:0015760 | hexose phosphate transport(GO:0015712) glucose-6-phosphate transport(GO:0015760) |
0.0 | 0.1 | GO:0061623 | galactose catabolic process via UDP-galactose(GO:0033499) glycolytic process from galactose(GO:0061623) |
0.0 | 0.4 | GO:0070493 | thrombin receptor signaling pathway(GO:0070493) |
0.0 | 0.1 | GO:0006547 | histidine metabolic process(GO:0006547) |
0.0 | 0.3 | GO:0009437 | carnitine metabolic process(GO:0009437) |
0.0 | 0.1 | GO:0030950 | establishment or maintenance of actin cytoskeleton polarity(GO:0030950) |
0.0 | 0.2 | GO:0007042 | lysosomal lumen acidification(GO:0007042) |
0.0 | 0.2 | GO:0048935 | peripheral nervous system neuron differentiation(GO:0048934) peripheral nervous system neuron development(GO:0048935) |
0.0 | 0.2 | GO:0018076 | N-terminal peptidyl-lysine acetylation(GO:0018076) |
0.0 | 0.1 | GO:0035435 | phosphate ion transmembrane transport(GO:0035435) |
0.0 | 0.3 | GO:0090166 | Golgi disassembly(GO:0090166) |
0.0 | 0.3 | GO:0046337 | phosphatidylethanolamine metabolic process(GO:0046337) |
0.0 | 0.1 | GO:0097029 | mature conventional dendritic cell differentiation(GO:0097029) |
0.0 | 0.2 | GO:0042713 | sperm ejaculation(GO:0042713) |
0.0 | 0.1 | GO:1902309 | negative regulation of peptidyl-serine dephosphorylation(GO:1902309) |
0.0 | 0.0 | GO:0002018 | renin-angiotensin regulation of aldosterone production(GO:0002018) |
0.0 | 0.1 | GO:2000323 | negative regulation of glucocorticoid receptor signaling pathway(GO:2000323) |
0.0 | 0.3 | GO:0006501 | C-terminal protein lipidation(GO:0006501) |
0.0 | 0.2 | GO:0048669 | collateral sprouting in absence of injury(GO:0048669) |
0.0 | 0.3 | GO:0071578 | zinc II ion transmembrane import(GO:0071578) |
0.0 | 0.1 | GO:0061158 | 3'-UTR-mediated mRNA destabilization(GO:0061158) |
0.0 | 0.2 | GO:0051386 | regulation of neurotrophin TRK receptor signaling pathway(GO:0051386) |
0.0 | 0.2 | GO:2000766 | negative regulation of cytoplasmic translation(GO:2000766) |
0.0 | 0.1 | GO:0003062 | regulation of heart rate by chemical signal(GO:0003062) |
0.0 | 0.1 | GO:0035523 | protein K29-linked deubiquitination(GO:0035523) protein K33-linked deubiquitination(GO:1990168) |
0.0 | 0.3 | GO:0046146 | tetrahydrobiopterin metabolic process(GO:0046146) |
0.0 | 0.1 | GO:1901475 | pyruvate transmembrane transport(GO:1901475) |
0.0 | 0.0 | GO:0043622 | cortical microtubule organization(GO:0043622) |
0.0 | 0.1 | GO:0001768 | establishment of lymphocyte polarity(GO:0001767) establishment of T cell polarity(GO:0001768) |
0.0 | 0.1 | GO:2000384 | regulation of ectoderm development(GO:2000383) negative regulation of ectoderm development(GO:2000384) |
0.0 | 0.1 | GO:1905098 | negative regulation of guanyl-nucleotide exchange factor activity(GO:1905098) |
0.0 | 0.1 | GO:0070366 | regulation of hepatocyte differentiation(GO:0070366) |
0.0 | 0.0 | GO:0061304 | retinal blood vessel morphogenesis(GO:0061304) |
0.0 | 0.2 | GO:0019244 | lactate biosynthetic process from pyruvate(GO:0019244) lactate biosynthetic process(GO:0019249) |
0.0 | 0.2 | GO:0006776 | vitamin A metabolic process(GO:0006776) |
0.0 | 0.4 | GO:0001553 | luteinization(GO:0001553) |
0.0 | 0.1 | GO:0061366 | behavioral response to chemical pain(GO:0061366) behavioral response to formalin induced pain(GO:0061368) |
0.0 | 0.2 | GO:0031119 | tRNA pseudouridine synthesis(GO:0031119) |
0.0 | 0.2 | GO:0032876 | negative regulation of DNA endoreduplication(GO:0032876) |
0.0 | 0.1 | GO:0051088 | PMA-inducible membrane protein ectodomain proteolysis(GO:0051088) |
0.0 | 0.4 | GO:0072673 | lamellipodium morphogenesis(GO:0072673) |
0.0 | 0.2 | GO:0045409 | negative regulation of interleukin-6 biosynthetic process(GO:0045409) |
0.0 | 0.3 | GO:0015825 | L-serine transport(GO:0015825) |
0.0 | 0.1 | GO:2000721 | positive regulation of transcription from RNA polymerase II promoter involved in smooth muscle cell differentiation(GO:2000721) |
0.0 | 0.0 | GO:0072566 | chemokine (C-X-C motif) ligand 1 production(GO:0072566) regulation of chemokine (C-X-C motif) ligand 1 production(GO:2000338) |
0.0 | 0.0 | GO:0072718 | response to cisplatin(GO:0072718) |
0.0 | 1.5 | GO:0007045 | cell-substrate adherens junction assembly(GO:0007045) focal adhesion assembly(GO:0048041) |
0.0 | 0.1 | GO:2000834 | androgen secretion(GO:0035935) regulation of androgen secretion(GO:2000834) positive regulation of androgen secretion(GO:2000836) |
0.0 | 0.1 | GO:0035021 | negative regulation of Rac protein signal transduction(GO:0035021) |
0.0 | 0.1 | GO:0009158 | ribonucleoside monophosphate catabolic process(GO:0009158) purine ribonucleoside monophosphate catabolic process(GO:0009169) |
0.0 | 0.0 | GO:0035989 | tendon development(GO:0035989) |
0.0 | 0.3 | GO:0046010 | positive regulation of circadian sleep/wake cycle, non-REM sleep(GO:0046010) |
0.0 | 0.1 | GO:0014873 | response to muscle activity involved in regulation of muscle adaptation(GO:0014873) |
0.0 | 0.0 | GO:0072674 | multinuclear osteoclast differentiation(GO:0072674) |
0.0 | 0.0 | GO:2001137 | positive regulation of endocytic recycling(GO:2001137) |
0.0 | 0.2 | GO:0010917 | negative regulation of mitochondrial membrane potential(GO:0010917) |
0.0 | 0.1 | GO:0097062 | dendritic spine maintenance(GO:0097062) |
0.0 | 0.1 | GO:0071351 | cellular response to interleukin-18(GO:0071351) |
0.0 | 0.1 | GO:0042536 | negative regulation of tumor necrosis factor biosynthetic process(GO:0042536) |
0.0 | 0.1 | GO:2000049 | positive regulation of cell-cell adhesion mediated by cadherin(GO:2000049) |
0.0 | 0.3 | GO:0035584 | calcium-mediated signaling using intracellular calcium source(GO:0035584) |
0.0 | 0.1 | GO:0051572 | negative regulation of histone H3-K4 methylation(GO:0051572) |
0.0 | 0.1 | GO:1905214 | regulation of mRNA binding(GO:1902415) positive regulation of mRNA binding(GO:1902416) regulation of RNA binding(GO:1905214) positive regulation of RNA binding(GO:1905216) |
0.0 | 0.2 | GO:0097264 | self proteolysis(GO:0097264) |
0.0 | 0.1 | GO:1904706 | negative regulation of vascular smooth muscle cell proliferation(GO:1904706) |
0.0 | 0.1 | GO:0003032 | detection of oxygen(GO:0003032) |
0.0 | 0.1 | GO:0016259 | selenocysteine metabolic process(GO:0016259) |
0.0 | 0.1 | GO:0045590 | negative regulation of regulatory T cell differentiation(GO:0045590) |
0.0 | 0.1 | GO:0070375 | ERK5 cascade(GO:0070375) |
0.0 | 0.1 | GO:0055098 | response to low-density lipoprotein particle(GO:0055098) |
0.0 | 0.1 | GO:1903061 | positive regulation of protein lipidation(GO:1903061) |
0.0 | 0.1 | GO:0016576 | histone dephosphorylation(GO:0016576) |
0.0 | 0.1 | GO:0015888 | thiamine transport(GO:0015888) |
0.0 | 0.4 | GO:0070935 | 3'-UTR-mediated mRNA stabilization(GO:0070935) |
0.0 | 0.1 | GO:0060830 | ciliary receptor clustering involved in smoothened signaling pathway(GO:0060830) |
0.0 | 0.1 | GO:0034499 | late endosome to Golgi transport(GO:0034499) |
0.0 | 0.0 | GO:2001271 | regulation of cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:2001270) negative regulation of cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:2001271) |
0.0 | 0.3 | GO:1902547 | regulation of cellular response to vascular endothelial growth factor stimulus(GO:1902547) |
0.0 | 0.2 | GO:0071501 | response to sterol depletion(GO:0006991) SREBP signaling pathway(GO:0032933) cellular response to sterol depletion(GO:0071501) |
0.0 | 0.1 | GO:0035290 | trunk segmentation(GO:0035290) trunk neural crest cell migration(GO:0036484) ventral trunk neural crest cell migration(GO:0036486) sympathetic neuron projection extension(GO:0097490) sympathetic neuron projection guidance(GO:0097491) |
0.0 | 0.1 | GO:0033762 | response to glucagon(GO:0033762) |
0.0 | 0.1 | GO:0090032 | negative regulation of steroid hormone biosynthetic process(GO:0090032) |
0.0 | 0.1 | GO:0031860 | telomeric 3' overhang formation(GO:0031860) |
0.0 | 0.3 | GO:0045603 | positive regulation of endothelial cell differentiation(GO:0045603) |
0.0 | 0.1 | GO:0051466 | positive regulation of corticotropin-releasing hormone secretion(GO:0051466) |
0.0 | 0.1 | GO:0021747 | cochlear nucleus development(GO:0021747) |
0.0 | 0.1 | GO:0060585 | regulation of prostaglandin-endoperoxide synthase activity(GO:0060584) positive regulation of prostaglandin-endoperoxide synthase activity(GO:0060585) |
0.0 | 0.3 | GO:0046548 | retinal rod cell development(GO:0046548) |
0.0 | 0.1 | GO:0048254 | snoRNA localization(GO:0048254) |
0.0 | 0.1 | GO:0051684 | maintenance of Golgi location(GO:0051684) |
0.0 | 0.1 | GO:0090210 | regulation of establishment of blood-brain barrier(GO:0090210) |
0.0 | 0.1 | GO:0015014 | heparan sulfate proteoglycan biosynthetic process, polysaccharide chain biosynthetic process(GO:0015014) |
0.0 | 0.1 | GO:0097501 | stress response to metal ion(GO:0097501) |
0.0 | 0.1 | GO:0010587 | miRNA catabolic process(GO:0010587) |
0.0 | 0.1 | GO:0070837 | dehydroascorbic acid transport(GO:0070837) |
0.0 | 0.1 | GO:0090074 | negative regulation of protein homodimerization activity(GO:0090074) |
0.0 | 0.1 | GO:1904430 | negative regulation of t-circle formation(GO:1904430) |
0.0 | 0.1 | GO:0036233 | glycine import(GO:0036233) |
0.0 | 0.1 | GO:0046100 | hypoxanthine metabolic process(GO:0046100) hypoxanthine biosynthetic process(GO:0046101) |
0.0 | 1.3 | GO:0046847 | filopodium assembly(GO:0046847) |
0.0 | 0.1 | GO:0016344 | meiotic chromosome movement towards spindle pole(GO:0016344) |
0.0 | 0.6 | GO:0061014 | positive regulation of mRNA catabolic process(GO:0061014) |
0.0 | 0.1 | GO:0051791 | medium-chain fatty acid metabolic process(GO:0051791) |
0.0 | 0.1 | GO:1903265 | positive regulation of tumor necrosis factor-mediated signaling pathway(GO:1903265) |
0.0 | 0.1 | GO:0009448 | gamma-aminobutyric acid metabolic process(GO:0009448) |
0.0 | 0.1 | GO:0048633 | positive regulation of skeletal muscle tissue growth(GO:0048633) |
0.0 | 0.1 | GO:1904668 | positive regulation of ubiquitin protein ligase activity(GO:1904668) |
0.0 | 0.0 | GO:0010715 | regulation of extracellular matrix disassembly(GO:0010715) |
0.0 | 0.0 | GO:1903140 | regulation of endothelial cell development(GO:1901550) regulation of establishment of endothelial barrier(GO:1903140) |
0.0 | 0.1 | GO:0010796 | regulation of multivesicular body size(GO:0010796) |
0.0 | 0.4 | GO:0043968 | histone H2A acetylation(GO:0043968) |
0.0 | 0.4 | GO:0007250 | activation of NF-kappaB-inducing kinase activity(GO:0007250) |
0.0 | 0.3 | GO:0046838 | phosphorylated carbohydrate dephosphorylation(GO:0046838) |
0.0 | 0.1 | GO:0046167 | glycerol-3-phosphate biosynthetic process(GO:0046167) |
0.0 | 0.3 | GO:0051292 | nuclear pore complex assembly(GO:0051292) |
0.0 | 0.3 | GO:0032516 | positive regulation of phosphoprotein phosphatase activity(GO:0032516) |
0.0 | 0.1 | GO:2001168 | regulation of histone H2B ubiquitination(GO:2001166) positive regulation of histone H2B ubiquitination(GO:2001168) |
0.0 | 0.1 | GO:0038128 | ERBB2 signaling pathway(GO:0038128) |
0.0 | 0.1 | GO:0052055 | modulation by symbiont of host molecular function(GO:0052055) modulation of catalytic activity in other organism involved in symbiotic interaction(GO:0052203) modulation by host of symbiont catalytic activity(GO:0052422) |
0.0 | 0.1 | GO:0002430 | complement receptor mediated signaling pathway(GO:0002430) |
0.0 | 0.1 | GO:0046501 | protoporphyrinogen IX metabolic process(GO:0046501) |
0.0 | 0.3 | GO:0045943 | positive regulation of transcription from RNA polymerase I promoter(GO:0045943) |
0.0 | 0.1 | GO:0021775 | smoothened signaling pathway involved in ventral spinal cord interneuron specification(GO:0021775) smoothened signaling pathway involved in spinal cord motor neuron cell fate specification(GO:0021776) |
0.0 | 0.4 | GO:2000311 | regulation of alpha-amino-3-hydroxy-5-methyl-4-isoxazole propionate selective glutamate receptor activity(GO:2000311) |
0.0 | 0.0 | GO:0007195 | adenylate cyclase-inhibiting dopamine receptor signaling pathway(GO:0007195) |
0.0 | 0.2 | GO:2000643 | positive regulation of early endosome to late endosome transport(GO:2000643) |
0.0 | 0.1 | GO:0070314 | G1 to G0 transition(GO:0070314) |
0.0 | 0.1 | GO:0072531 | pyrimidine-containing compound transmembrane transport(GO:0072531) |
0.0 | 0.1 | GO:1903377 | negative regulation of oxidative stress-induced neuron intrinsic apoptotic signaling pathway(GO:1903377) |
0.0 | 0.6 | GO:0090162 | establishment of epithelial cell polarity(GO:0090162) |
0.0 | 0.1 | GO:0010994 | regulation of ubiquitin homeostasis(GO:0010993) free ubiquitin chain polymerization(GO:0010994) |
0.0 | 0.1 | GO:0050847 | progesterone receptor signaling pathway(GO:0050847) |
0.0 | 0.1 | GO:0034351 | negative regulation of glial cell apoptotic process(GO:0034351) |
0.0 | 0.1 | GO:0070537 | histone H2A K63-linked deubiquitination(GO:0070537) |
0.0 | 0.1 | GO:0010940 | positive regulation of necrotic cell death(GO:0010940) |
0.0 | 0.1 | GO:0034628 | nicotinamide nucleotide biosynthetic process from aspartate(GO:0019355) 'de novo' NAD biosynthetic process from aspartate(GO:0034628) |
0.0 | 0.1 | GO:2000676 | positive regulation of type B pancreatic cell apoptotic process(GO:2000676) |
0.0 | 0.3 | GO:0000188 | inactivation of MAPK activity(GO:0000188) |
0.0 | 0.1 | GO:2000051 | negative regulation of non-canonical Wnt signaling pathway(GO:2000051) |
0.0 | 0.2 | GO:0048387 | negative regulation of retinoic acid receptor signaling pathway(GO:0048387) |
0.0 | 0.1 | GO:0018916 | nitrobenzene metabolic process(GO:0018916) |
0.0 | 0.3 | GO:0015727 | lactate transport(GO:0015727) lactate transmembrane transport(GO:0035873) plasma membrane lactate transport(GO:0035879) |
0.0 | 0.2 | GO:0006144 | purine nucleobase metabolic process(GO:0006144) |
0.0 | 0.0 | GO:1902202 | regulation of hepatocyte growth factor receptor signaling pathway(GO:1902202) |
0.0 | 0.1 | GO:0072161 | mesenchymal cell differentiation involved in kidney development(GO:0072161) mesenchymal cell differentiation involved in renal system development(GO:2001012) |
0.0 | 0.3 | GO:0034389 | lipid particle organization(GO:0034389) |
0.0 | 0.1 | GO:2000418 | positive regulation of eosinophil migration(GO:2000418) |
0.0 | 0.0 | GO:0003383 | apical constriction(GO:0003383) |
0.0 | 0.1 | GO:0006545 | glycine biosynthetic process(GO:0006545) |
0.0 | 0.1 | GO:1901668 | regulation of superoxide dismutase activity(GO:1901668) |
0.0 | 0.2 | GO:0090232 | positive regulation of spindle checkpoint(GO:0090232) |
0.0 | 0.2 | GO:0019367 | fatty acid elongation, saturated fatty acid(GO:0019367) fatty acid elongation, unsaturated fatty acid(GO:0019368) fatty acid elongation, monounsaturated fatty acid(GO:0034625) fatty acid elongation, polyunsaturated fatty acid(GO:0034626) |
0.0 | 0.2 | GO:0001867 | complement activation, lectin pathway(GO:0001867) |
0.0 | 0.0 | GO:0007021 | tubulin complex assembly(GO:0007021) |
0.0 | 0.1 | GO:0048496 | maintenance of organ identity(GO:0048496) |
0.0 | 0.1 | GO:0086073 | bundle of His cell-Purkinje myocyte adhesion involved in cell communication(GO:0086073) |
0.0 | 0.1 | GO:0036289 | peptidyl-serine autophosphorylation(GO:0036289) |
0.0 | 0.1 | GO:0002318 | myeloid progenitor cell differentiation(GO:0002318) |
0.0 | 0.1 | GO:0002759 | regulation of antimicrobial humoral response(GO:0002759) |
0.0 | 0.1 | GO:0050923 | regulation of negative chemotaxis(GO:0050923) |
0.0 | 0.1 | GO:0071285 | cellular response to lithium ion(GO:0071285) |
0.0 | 0.1 | GO:0060971 | embryonic heart tube left/right pattern formation(GO:0060971) |
0.0 | 0.0 | GO:0036394 | amylase secretion(GO:0036394) |
0.0 | 0.0 | GO:0038033 | positive regulation of endothelial cell chemotaxis by VEGF-activated vascular endothelial growth factor receptor signaling pathway(GO:0038033) |
0.0 | 0.1 | GO:1903054 | negative regulation of extracellular matrix organization(GO:1903054) |
0.0 | 0.1 | GO:0032788 | saturated monocarboxylic acid metabolic process(GO:0032788) unsaturated monocarboxylic acid metabolic process(GO:0032789) |
0.0 | 0.2 | GO:0042359 | vitamin D metabolic process(GO:0042359) |
0.0 | 0.1 | GO:0001880 | Mullerian duct regression(GO:0001880) |
0.0 | 0.5 | GO:0048843 | negative regulation of axon extension involved in axon guidance(GO:0048843) negative regulation of axon guidance(GO:1902668) |
0.0 | 0.1 | GO:0006391 | transcription initiation from mitochondrial promoter(GO:0006391) |
0.0 | 0.1 | GO:1900108 | negative regulation of nodal signaling pathway(GO:1900108) |
0.0 | 0.0 | GO:0045715 | negative regulation of low-density lipoprotein particle receptor biosynthetic process(GO:0045715) |
0.0 | 0.1 | GO:0070889 | platelet alpha granule organization(GO:0070889) |
0.0 | 0.1 | GO:0015886 | heme transport(GO:0015886) |
0.0 | 1.1 | GO:0007566 | embryo implantation(GO:0007566) |
0.0 | 0.1 | GO:0035633 | maintenance of blood-brain barrier(GO:0035633) |
0.0 | 0.0 | GO:0090245 | axis elongation involved in somitogenesis(GO:0090245) |
0.0 | 0.3 | GO:1904355 | positive regulation of telomere capping(GO:1904355) |
0.0 | 0.1 | GO:0006398 | mRNA 3'-end processing by stem-loop binding and cleavage(GO:0006398) |
0.0 | 0.1 | GO:0006072 | glycerol-3-phosphate metabolic process(GO:0006072) |
0.0 | 0.2 | GO:0006183 | GTP biosynthetic process(GO:0006183) |
0.0 | 0.1 | GO:0030579 | ubiquitin-dependent SMAD protein catabolic process(GO:0030579) |
0.0 | 0.1 | GO:1904415 | regulation of xenophagy(GO:1904415) positive regulation of xenophagy(GO:1904417) |
0.0 | 0.0 | GO:0046877 | regulation of saliva secretion(GO:0046877) |
0.0 | 0.3 | GO:0014733 | regulation of skeletal muscle adaptation(GO:0014733) |
0.0 | 0.2 | GO:0046040 | IMP metabolic process(GO:0046040) |
0.0 | 0.1 | GO:0045792 | negative regulation of cell size(GO:0045792) |
0.0 | 0.2 | GO:0072502 | cellular phosphate ion homeostasis(GO:0030643) cellular trivalent inorganic anion homeostasis(GO:0072502) |
0.0 | 0.1 | GO:0007525 | somatic muscle development(GO:0007525) |
0.0 | 0.1 | GO:0000022 | mitotic spindle elongation(GO:0000022) mitotic spindle midzone assembly(GO:0051256) |
0.0 | 0.0 | GO:0060385 | axonogenesis involved in innervation(GO:0060385) |
0.0 | 0.0 | GO:0010746 | regulation of plasma membrane long-chain fatty acid transport(GO:0010746) |
0.0 | 0.1 | GO:0072386 | plus-end-directed vesicle transport along microtubule(GO:0072383) plus-end-directed organelle transport along microtubule(GO:0072386) |
0.0 | 0.1 | GO:0021800 | cerebral cortex tangential migration(GO:0021800) |
0.0 | 0.0 | GO:0072141 | mesangial cell differentiation(GO:0072007) glomerular mesangial cell differentiation(GO:0072008) kidney interstitial fibroblast differentiation(GO:0072071) renal interstitial fibroblast development(GO:0072141) mesangial cell development(GO:0072143) glomerular mesangial cell development(GO:0072144) pericyte cell differentiation(GO:1904238) |
0.0 | 0.1 | GO:0071883 | activation of MAPK activity by adrenergic receptor signaling pathway(GO:0071883) |
0.0 | 0.0 | GO:0009946 | proximal/distal axis specification(GO:0009946) |
0.0 | 0.1 | GO:0038108 | negative regulation of appetite by leptin-mediated signaling pathway(GO:0038108) |
0.0 | 0.1 | GO:0014820 | tonic smooth muscle contraction(GO:0014820) |
0.0 | 0.1 | GO:0006046 | N-acetylglucosamine catabolic process(GO:0006046) |
0.0 | 0.1 | GO:0003192 | mitral valve formation(GO:0003192) |
0.0 | 0.1 | GO:0006449 | regulation of translational termination(GO:0006449) |
0.0 | 0.1 | GO:0021785 | branchiomotor neuron axon guidance(GO:0021785) |
0.0 | 0.1 | GO:0006348 | chromatin silencing at telomere(GO:0006348) |
0.0 | 0.0 | GO:0034141 | positive regulation of toll-like receptor 3 signaling pathway(GO:0034141) |
0.0 | 0.1 | GO:0021798 | forebrain dorsal/ventral pattern formation(GO:0021798) |
0.0 | 0.2 | GO:0060670 | branching involved in labyrinthine layer morphogenesis(GO:0060670) |
0.0 | 0.0 | GO:0034627 | 'de novo' NAD biosynthetic process(GO:0034627) |
0.0 | 0.1 | GO:0047497 | establishment of mitochondrion localization, microtubule-mediated(GO:0034643) mitochondrion transport along microtubule(GO:0047497) |
0.0 | 0.4 | GO:0002089 | lens morphogenesis in camera-type eye(GO:0002089) |
0.0 | 0.1 | GO:1904738 | vascular associated smooth muscle cell migration(GO:1904738) regulation of vascular associated smooth muscle cell migration(GO:1904752) positive regulation of vascular associated smooth muscle cell migration(GO:1904754) |
0.0 | 0.1 | GO:0051026 | chiasma assembly(GO:0051026) |
0.0 | 0.1 | GO:0060124 | positive regulation of growth hormone secretion(GO:0060124) |
0.0 | 0.1 | GO:0033578 | protein glycosylation in Golgi(GO:0033578) |
0.0 | 0.1 | GO:0038003 | opioid receptor signaling pathway(GO:0038003) |
0.0 | 0.1 | GO:0060480 | lung goblet cell differentiation(GO:0060480) |
0.0 | 0.0 | GO:1900126 | negative regulation of hyaluronan biosynthetic process(GO:1900126) |
0.0 | 0.1 | GO:0045162 | clustering of voltage-gated sodium channels(GO:0045162) |
0.0 | 0.0 | GO:1903935 | response to sodium arsenite(GO:1903935) |
0.0 | 0.0 | GO:0021861 | forebrain radial glial cell differentiation(GO:0021861) |
0.0 | 0.0 | GO:1900377 | negative regulation of melanin biosynthetic process(GO:0048022) negative regulation of secondary metabolite biosynthetic process(GO:1900377) |
0.0 | 0.1 | GO:0009786 | regulation of asymmetric cell division(GO:0009786) |
0.0 | 0.1 | GO:0021914 | negative regulation of smoothened signaling pathway involved in ventral spinal cord patterning(GO:0021914) |
0.0 | 0.1 | GO:0015781 | nucleotide-sugar transport(GO:0015780) pyrimidine nucleotide-sugar transport(GO:0015781) |
0.0 | 0.1 | GO:0008090 | retrograde axonal transport(GO:0008090) |
0.0 | 0.1 | GO:0042271 | susceptibility to natural killer cell mediated cytotoxicity(GO:0042271) |
0.0 | 0.1 | GO:0048102 | autophagic cell death(GO:0048102) |
0.0 | 0.1 | GO:0060665 | regulation of branching involved in salivary gland morphogenesis by mesenchymal-epithelial signaling(GO:0060665) |
0.0 | 0.1 | GO:0006561 | proline biosynthetic process(GO:0006561) |
0.0 | 0.1 | GO:0045602 | negative regulation of endothelial cell differentiation(GO:0045602) |
0.0 | 0.1 | GO:0010637 | negative regulation of mitochondrial fusion(GO:0010637) |
0.0 | 0.0 | GO:0023021 | termination of signal transduction(GO:0023021) |
0.0 | 0.1 | GO:0006384 | transcription initiation from RNA polymerase III promoter(GO:0006384) |
0.0 | 0.1 | GO:0060455 | negative regulation of gastric acid secretion(GO:0060455) |
0.0 | 0.1 | GO:0071442 | positive regulation of histone H3-K14 acetylation(GO:0071442) |
0.0 | 0.0 | GO:1900157 | regulation of bone mineralization involved in bone maturation(GO:1900157) |
0.0 | 0.0 | GO:0032196 | transposition(GO:0032196) |
0.0 | 0.1 | GO:0018095 | protein polyglutamylation(GO:0018095) |
0.0 | 0.1 | GO:0097428 | protein maturation by iron-sulfur cluster transfer(GO:0097428) |
0.0 | 0.1 | GO:0070940 | dephosphorylation of RNA polymerase II C-terminal domain(GO:0070940) |
0.0 | 0.0 | GO:0009750 | response to fructose(GO:0009750) |
0.0 | 0.1 | GO:0070327 | thyroid hormone transport(GO:0070327) |
0.0 | 0.0 | GO:0031547 | brain-derived neurotrophic factor receptor signaling pathway(GO:0031547) |
0.0 | 0.1 | GO:0035428 | hexose transmembrane transport(GO:0035428) |
0.0 | 0.0 | GO:2001025 | positive regulation of response to drug(GO:2001025) |
0.0 | 0.0 | GO:0035934 | corticosterone secretion(GO:0035934) regulation of corticosterone secretion(GO:2000852) |
0.0 | 0.1 | GO:2001241 | positive regulation of extrinsic apoptotic signaling pathway in absence of ligand(GO:2001241) |
0.0 | 0.0 | GO:0051918 | regulation of fibrinolysis(GO:0051917) negative regulation of fibrinolysis(GO:0051918) |
0.0 | 0.0 | GO:0072224 | metanephric glomerulus development(GO:0072224) |
0.0 | 0.1 | GO:0007258 | JUN phosphorylation(GO:0007258) |
0.0 | 0.1 | GO:0048539 | bone marrow development(GO:0048539) |
0.0 | 0.0 | GO:0045634 | regulation of melanocyte differentiation(GO:0045634) |
0.0 | 0.1 | GO:1902445 | regulation of mitochondrial membrane permeability involved in programmed necrotic cell death(GO:1902445) |
0.0 | 0.1 | GO:0090286 | cytoskeletal anchoring at nuclear membrane(GO:0090286) |
0.0 | 0.1 | GO:0006382 | adenosine to inosine editing(GO:0006382) |
0.0 | 0.0 | GO:0006362 | transcription elongation from RNA polymerase I promoter(GO:0006362) |
0.0 | 0.1 | GO:0042473 | outer ear morphogenesis(GO:0042473) |
0.0 | 0.0 | GO:0051612 | negative regulation of neurotransmitter uptake(GO:0051581) regulation of serotonin uptake(GO:0051611) negative regulation of serotonin uptake(GO:0051612) |
0.0 | 0.0 | GO:0002525 | acute inflammatory response to non-antigenic stimulus(GO:0002525) |
0.0 | 0.1 | GO:0007343 | egg activation(GO:0007343) |
0.0 | 0.0 | GO:0075509 | receptor-mediated endocytosis of virus by host cell(GO:0019065) endocytosis involved in viral entry into host cell(GO:0075509) |
0.0 | 0.1 | GO:0030242 | pexophagy(GO:0030242) |
0.0 | 0.1 | GO:2000667 | positive regulation of interleukin-5 secretion(GO:2000664) positive regulation of interleukin-13 secretion(GO:2000667) |
0.0 | 0.0 | GO:0072239 | metanephric glomerulus vasculature development(GO:0072239) |
0.0 | 0.0 | GO:0043173 | nucleotide salvage(GO:0043173) |
0.0 | 0.1 | GO:0000350 | generation of catalytic spliceosome for second transesterification step(GO:0000350) |
0.0 | 0.0 | GO:0060594 | mammary gland specification(GO:0060594) |
0.0 | 0.1 | GO:0043951 | negative regulation of cAMP-mediated signaling(GO:0043951) |
0.0 | 0.1 | GO:1901621 | negative regulation of smoothened signaling pathway involved in dorsal/ventral neural tube patterning(GO:1901621) |
0.0 | 0.1 | GO:0030497 | fatty acid elongation(GO:0030497) |
0.0 | 0.0 | GO:0071677 | positive regulation of mononuclear cell migration(GO:0071677) |
0.0 | 0.1 | GO:1904424 | regulation of GTP binding(GO:1904424) |
0.0 | 0.1 | GO:0034312 | diol biosynthetic process(GO:0034312) sphingosine biosynthetic process(GO:0046512) |
0.0 | 0.3 | GO:0044458 | motile cilium assembly(GO:0044458) |
0.0 | 0.1 | GO:0043383 | negative T cell selection(GO:0043383) |
0.0 | 0.1 | GO:0060023 | soft palate development(GO:0060023) |
0.0 | 0.1 | GO:0043518 | negative regulation of DNA damage response, signal transduction by p53 class mediator(GO:0043518) |
0.0 | 0.1 | GO:0071670 | smooth muscle cell chemotaxis(GO:0071670) |
0.0 | 0.0 | GO:1902109 | negative regulation of mitochondrial membrane permeability involved in apoptotic process(GO:1902109) |
0.0 | 0.1 | GO:1904707 | positive regulation of vascular smooth muscle cell proliferation(GO:1904707) |
0.0 | 0.1 | GO:0061050 | regulation of cell growth involved in cardiac muscle cell development(GO:0061050) |
0.0 | 0.1 | GO:0035811 | negative regulation of urine volume(GO:0035811) |
0.0 | 0.0 | GO:0000733 | DNA strand renaturation(GO:0000733) |
0.0 | 0.4 | GO:0006220 | pyrimidine nucleotide metabolic process(GO:0006220) |
0.0 | 0.1 | GO:0046069 | cGMP catabolic process(GO:0046069) |
0.0 | 0.3 | GO:0016180 | snRNA processing(GO:0016180) |
0.0 | 0.1 | GO:0042997 | negative regulation of Golgi to plasma membrane protein transport(GO:0042997) |
0.0 | 0.0 | GO:1903525 | regulation of membrane tubulation(GO:1903525) |
0.0 | 0.0 | GO:2000510 | positive regulation of dendritic cell chemotaxis(GO:2000510) |
0.0 | 0.1 | GO:0000244 | spliceosomal tri-snRNP complex assembly(GO:0000244) |
0.0 | 0.1 | GO:0031274 | positive regulation of pseudopodium assembly(GO:0031274) |
0.0 | 0.1 | GO:0006297 | nucleotide-excision repair, DNA gap filling(GO:0006297) |
0.0 | 0.3 | GO:0010762 | regulation of fibroblast migration(GO:0010762) |
0.0 | 0.1 | GO:0051967 | negative regulation of synaptic transmission, glutamatergic(GO:0051967) |
0.0 | 0.2 | GO:0003351 | epithelial cilium movement(GO:0003351) |
0.0 | 0.0 | GO:0071971 | extracellular exosome assembly(GO:0071971) regulation of extracellular exosome assembly(GO:1903551) |
0.0 | 0.2 | GO:0008211 | glucocorticoid metabolic process(GO:0008211) |
0.0 | 0.1 | GO:0052646 | alditol phosphate metabolic process(GO:0052646) |
0.0 | 0.0 | GO:0050904 | diapedesis(GO:0050904) |
0.0 | 0.1 | GO:0070571 | negative regulation of neuron projection regeneration(GO:0070571) |
0.0 | 0.0 | GO:0002023 | reduction of food intake in response to dietary excess(GO:0002023) |
0.0 | 0.0 | GO:0034163 | regulation of toll-like receptor 9 signaling pathway(GO:0034163) |
0.0 | 0.3 | GO:0097031 | NADH dehydrogenase complex assembly(GO:0010257) mitochondrial respiratory chain complex I assembly(GO:0032981) mitochondrial respiratory chain complex I biogenesis(GO:0097031) |
0.0 | 0.1 | GO:1990403 | embryonic brain development(GO:1990403) |
0.0 | 0.1 | GO:0098763 | mitotic cell cycle phase(GO:0098763) |
0.0 | 0.2 | GO:0051205 | protein insertion into membrane(GO:0051205) |
0.0 | 0.1 | GO:0060710 | chorio-allantoic fusion(GO:0060710) |
0.0 | 0.0 | GO:0034136 | negative regulation of toll-like receptor 2 signaling pathway(GO:0034136) |
0.0 | 0.1 | GO:0016139 | glycoside catabolic process(GO:0016139) |
0.0 | 0.0 | GO:0060355 | positive regulation of cell adhesion molecule production(GO:0060355) |
0.0 | 0.0 | GO:0051461 | positive regulation of corticotropin secretion(GO:0051461) |
0.0 | 0.0 | GO:0061635 | regulation of protein complex stability(GO:0061635) |
0.0 | 0.0 | GO:2001269 | positive regulation of cysteine-type endopeptidase activity involved in apoptotic signaling pathway(GO:2001269) |
0.0 | 0.1 | GO:0032793 | positive regulation of CREB transcription factor activity(GO:0032793) |
0.0 | 0.2 | GO:0009954 | proximal/distal pattern formation(GO:0009954) |
0.0 | 0.0 | GO:0035983 | response to trichostatin A(GO:0035983) cellular response to trichostatin A(GO:0035984) |
0.0 | 0.1 | GO:1902916 | positive regulation of protein polyubiquitination(GO:1902916) |
0.0 | 0.0 | GO:0010025 | wax biosynthetic process(GO:0010025) wax metabolic process(GO:0010166) |
0.0 | 0.6 | GO:0007229 | integrin-mediated signaling pathway(GO:0007229) |
0.0 | 0.0 | GO:0014744 | positive regulation of muscle adaptation(GO:0014744) |
0.0 | 0.0 | GO:0071926 | cannabinoid signaling pathway(GO:0038171) endocannabinoid signaling pathway(GO:0071926) |
0.0 | 0.1 | GO:0014028 | notochord formation(GO:0014028) |
0.0 | 0.1 | GO:0033689 | negative regulation of osteoblast proliferation(GO:0033689) |
0.0 | 0.0 | GO:0015747 | urate transport(GO:0015747) |
0.0 | 0.1 | GO:0038166 | angiotensin-activated signaling pathway(GO:0038166) |
0.0 | 0.0 | GO:1900016 | negative regulation of cytokine production involved in inflammatory response(GO:1900016) |
0.0 | 0.1 | GO:2000344 | positive regulation of acrosome reaction(GO:2000344) |
0.0 | 0.0 | GO:0010446 | response to alkaline pH(GO:0010446) |
0.0 | 0.0 | GO:0007256 | activation of JNKK activity(GO:0007256) |
0.0 | 0.1 | GO:0032464 | positive regulation of protein homooligomerization(GO:0032464) |
0.0 | 0.0 | GO:0032831 | regulation of CD4-positive, CD25-positive, alpha-beta regulatory T cell differentiation(GO:0032829) positive regulation of CD4-positive, CD25-positive, alpha-beta regulatory T cell differentiation(GO:0032831) |
0.0 | 0.1 | GO:0006689 | ganglioside catabolic process(GO:0006689) |
0.0 | 0.0 | GO:1900242 | regulation of synaptic vesicle endocytosis(GO:1900242) |
0.0 | 0.1 | GO:0016266 | O-glycan processing(GO:0016266) |
0.0 | 0.0 | GO:0072697 | protein localization to cell cortex(GO:0072697) |
0.0 | 0.1 | GO:0007168 | receptor guanylyl cyclase signaling pathway(GO:0007168) |
0.0 | 0.2 | GO:0002347 | response to tumor cell(GO:0002347) |
0.0 | 0.1 | GO:1990440 | positive regulation of transcription from RNA polymerase II promoter in response to endoplasmic reticulum stress(GO:1990440) |
0.0 | 0.0 | GO:0014707 | branchiomeric skeletal muscle development(GO:0014707) |
0.0 | 0.0 | GO:0046909 | intermembrane transport(GO:0046909) |
0.0 | 0.0 | GO:0060050 | positive regulation of protein glycosylation(GO:0060050) |
0.0 | 0.2 | GO:0043248 | proteasome assembly(GO:0043248) |
0.0 | 0.1 | GO:0002329 | pre-B cell differentiation(GO:0002329) |
0.0 | 0.0 | GO:0002904 | positive regulation of B cell apoptotic process(GO:0002904) |
0.0 | 0.1 | GO:0050860 | negative regulation of T cell receptor signaling pathway(GO:0050860) |
0.0 | 0.1 | GO:0051775 | response to redox state(GO:0051775) |
0.0 | 0.0 | GO:1901656 | glycoside transport(GO:1901656) |
0.0 | 0.1 | GO:0030259 | lipid glycosylation(GO:0030259) |
0.0 | 0.1 | GO:0030157 | pancreatic juice secretion(GO:0030157) |
0.0 | 0.0 | GO:0009298 | GDP-mannose biosynthetic process(GO:0009298) |
0.0 | 0.1 | GO:0097094 | craniofacial suture morphogenesis(GO:0097094) |
0.0 | 0.1 | GO:0000447 | endonucleolytic cleavage in ITS1 to separate SSU-rRNA from 5.8S rRNA and LSU-rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000447) |
0.0 | 0.0 | GO:1900041 | negative regulation of interleukin-2 secretion(GO:1900041) |
0.0 | 0.1 | GO:0048266 | behavioral response to pain(GO:0048266) |
0.0 | 0.1 | GO:0045019 | negative regulation of nitric oxide biosynthetic process(GO:0045019) negative regulation of nitric oxide metabolic process(GO:1904406) |
0.0 | 0.0 | GO:0071895 | odontoblast differentiation(GO:0071895) |
0.0 | 0.0 | GO:0030886 | negative regulation of myeloid dendritic cell activation(GO:0030886) |
0.0 | 0.0 | GO:0071732 | cellular response to nitric oxide(GO:0071732) |
0.0 | 0.0 | GO:0042231 | interleukin-13 biosynthetic process(GO:0042231) |
0.0 | 0.1 | GO:0097320 | membrane tubulation(GO:0097320) |
0.0 | 0.1 | GO:0008535 | respiratory chain complex IV assembly(GO:0008535) |
0.0 | 0.0 | GO:0035441 | cell migration involved in vasculogenesis(GO:0035441) |
0.0 | 0.0 | GO:0010847 | regulation of chromatin assembly(GO:0010847) |
0.0 | 0.1 | GO:0036120 | cellular response to platelet-derived growth factor stimulus(GO:0036120) |
0.0 | 0.0 | GO:0035962 | response to interleukin-13(GO:0035962) cellular response to interleukin-13(GO:0035963) |
0.0 | 0.1 | GO:0048386 | positive regulation of retinoic acid receptor signaling pathway(GO:0048386) |
0.0 | 0.0 | GO:0034443 | regulation of lipoprotein oxidation(GO:0034442) negative regulation of lipoprotein oxidation(GO:0034443) |
0.0 | 0.1 | GO:0071557 | histone H3-K27 demethylation(GO:0071557) |
0.0 | 0.0 | GO:0043974 | histone H3-K27 acetylation(GO:0043974) regulation of histone H3-K27 acetylation(GO:1901674) |
0.0 | 0.0 | GO:0046208 | spermine catabolic process(GO:0046208) |
0.0 | 0.1 | GO:0044828 | negative regulation by host of viral genome replication(GO:0044828) |
0.0 | 0.0 | GO:0034214 | protein hexamerization(GO:0034214) |
0.0 | 0.0 | GO:1902626 | assembly of large subunit precursor of preribosome(GO:1902626) |
0.0 | 0.0 | GO:0031587 | positive regulation of inositol 1,4,5-trisphosphate-sensitive calcium-release channel activity(GO:0031587) |
0.0 | 0.0 | GO:1902512 | positive regulation of apoptotic DNA fragmentation(GO:1902512) positive regulation of DNA catabolic process(GO:1903626) |
0.0 | 0.0 | GO:0000972 | transcription-dependent tethering of RNA polymerase II gene DNA at nuclear periphery(GO:0000972) |
0.0 | 0.0 | GO:0010870 | positive regulation of receptor biosynthetic process(GO:0010870) |
0.0 | 0.1 | GO:0070050 | neuron cellular homeostasis(GO:0070050) |
0.0 | 0.1 | GO:0042559 | pteridine-containing compound biosynthetic process(GO:0042559) |
0.0 | 0.0 | GO:0014901 | regulation of satellite cell activation involved in skeletal muscle regeneration(GO:0014717) satellite cell activation involved in skeletal muscle regeneration(GO:0014901) |
0.0 | 0.4 | GO:0043507 | positive regulation of JUN kinase activity(GO:0043507) |
0.0 | 0.1 | GO:0007614 | short-term memory(GO:0007614) |
0.0 | 0.1 | GO:0090557 | establishment of endothelial intestinal barrier(GO:0090557) |
0.0 | 0.1 | GO:0033008 | positive regulation of mast cell activation involved in immune response(GO:0033008) positive regulation of mast cell degranulation(GO:0043306) |
0.0 | 0.1 | GO:1990090 | response to nerve growth factor(GO:1990089) cellular response to nerve growth factor stimulus(GO:1990090) |
0.0 | 0.0 | GO:0016103 | diterpenoid catabolic process(GO:0016103) retinoic acid catabolic process(GO:0034653) |
0.0 | 0.0 | GO:0001777 | T cell homeostatic proliferation(GO:0001777) regulation of T cell homeostatic proliferation(GO:0046013) |
0.0 | 0.2 | GO:0009409 | response to cold(GO:0009409) |
0.0 | 0.0 | GO:0030222 | eosinophil differentiation(GO:0030222) |
0.0 | 0.1 | GO:0000103 | sulfate assimilation(GO:0000103) |
0.0 | 0.1 | GO:0006104 | succinyl-CoA metabolic process(GO:0006104) |
0.0 | 0.0 | GO:0002934 | desmosome organization(GO:0002934) |
0.0 | 0.0 | GO:0043922 | negative regulation by host of viral transcription(GO:0043922) |
0.0 | 0.0 | GO:0000710 | meiotic mismatch repair(GO:0000710) |
0.0 | 0.0 | GO:0019230 | proprioception(GO:0019230) |
0.0 | 0.0 | GO:0031999 | negative regulation of fatty acid beta-oxidation(GO:0031999) |
0.0 | 0.0 | GO:0045410 | positive regulation of interleukin-6 biosynthetic process(GO:0045410) |
0.0 | 0.0 | GO:0006678 | glucosylceramide metabolic process(GO:0006678) |
0.0 | 0.0 | GO:2000169 | regulation of peptidyl-cysteine S-nitrosylation(GO:2000169) |
0.0 | 0.1 | GO:1900026 | positive regulation of substrate adhesion-dependent cell spreading(GO:1900026) |
0.0 | 0.0 | GO:2000483 | negative regulation of interleukin-8 secretion(GO:2000483) |
0.0 | 0.1 | GO:0032094 | response to food(GO:0032094) |
0.0 | 0.1 | GO:0051152 | positive regulation of smooth muscle cell differentiation(GO:0051152) |
0.0 | 0.1 | GO:0046697 | decidualization(GO:0046697) |
0.0 | 0.0 | GO:0072015 | glomerular visceral epithelial cell development(GO:0072015) glomerular epithelial cell development(GO:0072310) |
0.0 | 0.1 | GO:0009226 | nucleotide-sugar biosynthetic process(GO:0009226) |
0.0 | 0.0 | GO:0032286 | central nervous system myelin maintenance(GO:0032286) |
0.0 | 0.1 | GO:0021942 | radial glia guided migration of Purkinje cell(GO:0021942) |
0.0 | 0.0 | GO:0006083 | acetate metabolic process(GO:0006083) |
0.0 | 0.1 | GO:0015812 | gamma-aminobutyric acid transport(GO:0015812) |
0.0 | 0.1 | GO:0044065 | regulation of respiratory system process(GO:0044065) |
0.0 | 0.1 | GO:0090314 | positive regulation of protein targeting to membrane(GO:0090314) |
0.0 | 0.0 | GO:2000121 | regulation of removal of superoxide radicals(GO:2000121) |
0.0 | 0.1 | GO:0035845 | photoreceptor cell outer segment organization(GO:0035845) |
0.0 | 0.0 | GO:0032782 | bile acid secretion(GO:0032782) |
0.0 | 0.0 | GO:0071288 | cellular response to mercury ion(GO:0071288) |
0.0 | 0.0 | GO:0042256 | mature ribosome assembly(GO:0042256) |
0.0 | 0.0 | GO:0032026 | response to magnesium ion(GO:0032026) |
0.0 | 0.0 | GO:0034047 | regulation of protein phosphatase type 2A activity(GO:0034047) |
0.0 | 0.1 | GO:0032967 | positive regulation of collagen metabolic process(GO:0010714) positive regulation of collagen biosynthetic process(GO:0032967) positive regulation of multicellular organismal metabolic process(GO:0044253) |
0.0 | 0.0 | GO:0015803 | branched-chain amino acid transport(GO:0015803) leucine transport(GO:0015820) |
0.0 | 0.0 | GO:0031998 | regulation of fatty acid beta-oxidation(GO:0031998) |
0.0 | 0.0 | GO:0002175 | protein localization to paranode region of axon(GO:0002175) |
0.0 | 0.0 | GO:0001302 | replicative cell aging(GO:0001302) |
0.0 | 0.1 | GO:0035306 | positive regulation of dephosphorylation(GO:0035306) |
0.0 | 0.0 | GO:0071502 | cellular response to temperature stimulus(GO:0071502) |
0.0 | 0.2 | GO:0043666 | regulation of phosphoprotein phosphatase activity(GO:0043666) |
0.0 | 0.1 | GO:0034030 | nucleoside bisphosphate biosynthetic process(GO:0033866) ribonucleoside bisphosphate biosynthetic process(GO:0034030) purine nucleoside bisphosphate biosynthetic process(GO:0034033) |
0.0 | 0.0 | GO:0060605 | tube lumen cavitation(GO:0060605) salivary gland cavitation(GO:0060662) |
0.0 | 0.0 | GO:0060800 | regulation of cell differentiation involved in embryonic placenta development(GO:0060800) |
0.0 | 0.0 | GO:1902915 | negative regulation of protein K63-linked ubiquitination(GO:1900045) negative regulation of protein polyubiquitination(GO:1902915) |
0.0 | 0.3 | GO:0030199 | collagen fibril organization(GO:0030199) |
0.0 | 0.0 | GO:0006524 | alanine catabolic process(GO:0006524) pyruvate family amino acid catabolic process(GO:0009080) |
0.0 | 0.2 | GO:0006182 | cGMP biosynthetic process(GO:0006182) |
0.0 | 0.0 | GO:0035928 | rRNA import into mitochondrion(GO:0035928) |
0.0 | 0.1 | GO:0021702 | cerebellar Purkinje cell differentiation(GO:0021702) |
0.0 | 0.1 | GO:0010032 | meiotic chromosome condensation(GO:0010032) |
0.0 | 0.0 | GO:0043137 | DNA replication, removal of RNA primer(GO:0043137) |
0.0 | 0.1 | GO:0016226 | iron-sulfur cluster assembly(GO:0016226) metallo-sulfur cluster assembly(GO:0031163) |
0.0 | 0.0 | GO:0042160 | lipoprotein modification(GO:0042160) lipoprotein oxidation(GO:0042161) |
0.0 | 0.1 | GO:0006309 | apoptotic DNA fragmentation(GO:0006309) |
0.0 | 0.1 | GO:0010586 | miRNA metabolic process(GO:0010586) |
0.0 | 0.0 | GO:0071888 | macrophage apoptotic process(GO:0071888) regulation of macrophage apoptotic process(GO:2000109) |
0.0 | 0.1 | GO:0042760 | very long-chain fatty acid catabolic process(GO:0042760) |
0.0 | 0.0 | GO:0060339 | negative regulation of type I interferon-mediated signaling pathway(GO:0060339) |
0.0 | 0.0 | GO:0031340 | positive regulation of vesicle fusion(GO:0031340) |
0.0 | 0.0 | GO:0015879 | carnitine transport(GO:0015879) |
0.0 | 0.0 | GO:0045654 | positive regulation of megakaryocyte differentiation(GO:0045654) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.2 | 0.5 | GO:0034679 | integrin alpha9-beta1 complex(GO:0034679) |
0.2 | 0.5 | GO:0031523 | Myb complex(GO:0031523) |
0.1 | 0.5 | GO:0031466 | Cul5-RING ubiquitin ligase complex(GO:0031466) |
0.1 | 0.4 | GO:0034457 | Mpp10 complex(GO:0034457) |
0.1 | 1.2 | GO:0046581 | intercellular canaliculus(GO:0046581) |
0.1 | 0.3 | GO:0000172 | ribonuclease MRP complex(GO:0000172) |
0.1 | 0.3 | GO:0030956 | glutamyl-tRNA(Gln) amidotransferase complex(GO:0030956) |
0.1 | 0.3 | GO:0005899 | insulin receptor complex(GO:0005899) |
0.1 | 0.3 | GO:0010009 | cytoplasmic side of endosome membrane(GO:0010009) |
0.1 | 0.5 | GO:0000138 | Golgi trans cisterna(GO:0000138) |
0.1 | 0.2 | GO:0008282 | ATP-sensitive potassium channel complex(GO:0008282) |
0.1 | 0.2 | GO:0097443 | sorting endosome(GO:0097443) |
0.1 | 0.6 | GO:0033180 | proton-transporting V-type ATPase, V1 domain(GO:0033180) |
0.1 | 0.2 | GO:0035838 | growing cell tip(GO:0035838) |
0.1 | 0.5 | GO:0005577 | fibrinogen complex(GO:0005577) |
0.1 | 0.4 | GO:0042406 | extrinsic component of endoplasmic reticulum membrane(GO:0042406) |
0.1 | 0.2 | GO:0034673 | inhibin-betaglycan-ActRII complex(GO:0034673) |
0.1 | 0.6 | GO:0042587 | glycogen granule(GO:0042587) |
0.1 | 0.2 | GO:0097629 | extrinsic component of omegasome membrane(GO:0097629) |
0.1 | 0.3 | GO:0033063 | Rad51B-Rad51C-Rad51D-XRCC2 complex(GO:0033063) |
0.1 | 0.2 | GO:0002193 | MAML1-RBP-Jkappa- ICN1 complex(GO:0002193) |
0.1 | 0.2 | GO:0033596 | TSC1-TSC2 complex(GO:0033596) |
0.1 | 0.9 | GO:0000177 | cytoplasmic exosome (RNase complex)(GO:0000177) |
0.1 | 0.2 | GO:0071664 | catenin-TCF7L2 complex(GO:0071664) |
0.1 | 0.2 | GO:0097513 | myosin II filament(GO:0097513) |
0.1 | 0.2 | GO:0031092 | platelet alpha granule membrane(GO:0031092) |
0.1 | 0.4 | GO:0044327 | dendritic spine head(GO:0044327) |
0.0 | 0.1 | GO:0031084 | BLOC-2 complex(GO:0031084) |
0.0 | 0.1 | GO:0032010 | phagolysosome(GO:0032010) |
0.0 | 0.1 | GO:0030981 | cortical microtubule cytoskeleton(GO:0030981) |
0.0 | 0.1 | GO:0005767 | secondary lysosome(GO:0005767) |
0.0 | 0.2 | GO:0002142 | stereocilia ankle link complex(GO:0002142) |
0.0 | 0.4 | GO:0031209 | SCAR complex(GO:0031209) |
0.0 | 0.3 | GO:0032591 | dendritic spine membrane(GO:0032591) |
0.0 | 0.1 | GO:1990357 | terminal web(GO:1990357) |
0.0 | 0.1 | GO:0060053 | neurofilament cytoskeleton(GO:0060053) |
0.0 | 0.2 | GO:0071203 | WASH complex(GO:0071203) |
0.0 | 0.4 | GO:0008074 | guanylate cyclase complex, soluble(GO:0008074) |
0.0 | 1.1 | GO:0031941 | filamentous actin(GO:0031941) |
0.0 | 0.4 | GO:0036513 | Derlin-1 retrotranslocation complex(GO:0036513) |
0.0 | 0.1 | GO:0020016 | ciliary pocket(GO:0020016) ciliary pocket membrane(GO:0020018) |
0.0 | 0.3 | GO:0000800 | lateral element(GO:0000800) |
0.0 | 0.5 | GO:0002102 | podosome(GO:0002102) |
0.0 | 0.1 | GO:0097058 | CRLF-CLCF1 complex(GO:0097058) |
0.0 | 0.2 | GO:0031258 | lamellipodium membrane(GO:0031258) |
0.0 | 0.2 | GO:0014731 | spectrin-associated cytoskeleton(GO:0014731) |
0.0 | 0.4 | GO:0032797 | SMN complex(GO:0032797) |
0.0 | 0.1 | GO:0044611 | nuclear pore inner ring(GO:0044611) |
0.0 | 0.1 | GO:0031088 | platelet dense granule membrane(GO:0031088) |
0.0 | 0.1 | GO:1990597 | AIP1-IRE1 complex(GO:1990597) |
0.0 | 0.1 | GO:0072558 | NLRP1 inflammasome complex(GO:0072558) |
0.0 | 0.4 | GO:0042612 | MHC class I protein complex(GO:0042612) |
0.0 | 0.1 | GO:0034388 | Pwp2p-containing subcomplex of 90S preribosome(GO:0034388) |
0.0 | 0.1 | GO:0097255 | R2TP complex(GO:0097255) |
0.0 | 0.0 | GO:0035061 | interchromatin granule(GO:0035061) |
0.0 | 0.2 | GO:0034991 | nuclear meiotic cohesin complex(GO:0034991) |
0.0 | 0.3 | GO:0031932 | TORC2 complex(GO:0031932) |
0.0 | 0.2 | GO:0033256 | I-kappaB/NF-kappaB complex(GO:0033256) |
0.0 | 0.2 | GO:0070419 | nonhomologous end joining complex(GO:0070419) |
0.0 | 0.1 | GO:0033093 | Weibel-Palade body(GO:0033093) |
0.0 | 0.2 | GO:0016600 | flotillin complex(GO:0016600) |
0.0 | 0.1 | GO:0008541 | proteasome regulatory particle, lid subcomplex(GO:0008541) |
0.0 | 0.1 | GO:0009331 | glycerol-3-phosphate dehydrogenase complex(GO:0009331) |
0.0 | 0.1 | GO:0001652 | granular component(GO:0001652) |
0.0 | 0.1 | GO:0005658 | alpha DNA polymerase:primase complex(GO:0005658) |
0.0 | 0.3 | GO:0032039 | integrator complex(GO:0032039) |
0.0 | 0.0 | GO:0034750 | Scrib-APC-beta-catenin complex(GO:0034750) |
0.0 | 0.3 | GO:0000974 | Prp19 complex(GO:0000974) |
0.0 | 0.1 | GO:1990851 | Wnt-Frizzled-LRP5/6 complex(GO:1990851) |
0.0 | 0.1 | GO:0005869 | dynactin complex(GO:0005869) |
0.0 | 0.1 | GO:0070531 | BRCA1-A complex(GO:0070531) |
0.0 | 0.1 | GO:0042585 | germinal vesicle(GO:0042585) |
0.0 | 0.1 | GO:0005850 | eukaryotic translation initiation factor 2 complex(GO:0005850) |
0.0 | 0.3 | GO:0005665 | DNA-directed RNA polymerase II, core complex(GO:0005665) |
0.0 | 0.1 | GO:1990454 | L-type voltage-gated calcium channel complex(GO:1990454) |
0.0 | 0.0 | GO:1990812 | growth cone filopodium(GO:1990812) |
0.0 | 0.2 | GO:0016272 | prefoldin complex(GO:0016272) |
0.0 | 0.1 | GO:0030130 | clathrin coat of trans-Golgi network vesicle(GO:0030130) |
0.0 | 0.1 | GO:0097512 | cardiac myofibril(GO:0097512) |
0.0 | 0.1 | GO:0045179 | apical cortex(GO:0045179) |
0.0 | 0.9 | GO:0030286 | dynein complex(GO:0030286) |
0.0 | 0.7 | GO:0010494 | cytoplasmic stress granule(GO:0010494) |
0.0 | 0.1 | GO:0097025 | MPP7-DLG1-LIN7 complex(GO:0097025) |
0.0 | 0.1 | GO:0097543 | ciliary inversin compartment(GO:0097543) |
0.0 | 0.3 | GO:0001741 | XY body(GO:0001741) |
0.0 | 0.1 | GO:0031262 | Ndc80 complex(GO:0031262) |
0.0 | 0.3 | GO:0016514 | SWI/SNF complex(GO:0016514) |
0.0 | 0.1 | GO:0071001 | U4/U6 snRNP(GO:0071001) |
0.0 | 0.3 | GO:0043189 | NuA4 histone acetyltransferase complex(GO:0035267) H4/H2A histone acetyltransferase complex(GO:0043189) H4 histone acetyltransferase complex(GO:1902562) |
0.0 | 0.1 | GO:0044194 | cytolytic granule(GO:0044194) |
0.0 | 0.1 | GO:0055087 | Ski complex(GO:0055087) |
0.0 | 0.2 | GO:0033276 | transcription factor TFTC complex(GO:0033276) |
0.0 | 0.1 | GO:0033178 | proton-transporting two-sector ATPase complex, catalytic domain(GO:0033178) |
0.0 | 0.1 | GO:0031417 | NatC complex(GO:0031417) |
0.0 | 0.1 | GO:0044322 | endoplasmic reticulum quality control compartment(GO:0044322) |
0.0 | 0.1 | GO:0071439 | clathrin complex(GO:0071439) |
0.0 | 0.2 | GO:0030123 | AP-3 adaptor complex(GO:0030123) |
0.0 | 0.1 | GO:0005745 | m-AAA complex(GO:0005745) |
0.0 | 0.1 | GO:0030897 | HOPS complex(GO:0030897) |
0.0 | 0.4 | GO:0030057 | desmosome(GO:0030057) |
0.0 | 0.5 | GO:0032281 | AMPA glutamate receptor complex(GO:0032281) |
0.0 | 0.1 | GO:0030914 | STAGA complex(GO:0030914) |
0.0 | 0.3 | GO:0032154 | cleavage furrow(GO:0032154) cell surface furrow(GO:0097610) |
0.0 | 0.1 | GO:0031465 | Cul4B-RING E3 ubiquitin ligase complex(GO:0031465) |
0.0 | 0.6 | GO:0005834 | heterotrimeric G-protein complex(GO:0005834) |
0.0 | 0.2 | GO:0065010 | extracellular membrane-bounded organelle(GO:0065010) |
0.0 | 0.1 | GO:0033503 | HULC complex(GO:0033503) |
0.0 | 0.3 | GO:0045120 | pronucleus(GO:0045120) |
0.0 | 0.0 | GO:0051286 | cell tip(GO:0051286) |
0.0 | 0.1 | GO:0072559 | NLRP3 inflammasome complex(GO:0072559) |
0.0 | 0.1 | GO:0000788 | nuclear nucleosome(GO:0000788) |
0.0 | 0.1 | GO:0017071 | intracellular cyclic nucleotide activated cation channel complex(GO:0017071) |
0.0 | 0.1 | GO:0043219 | lateral loop(GO:0043219) |
0.0 | 0.1 | GO:0030891 | VCB complex(GO:0030891) |
0.0 | 0.8 | GO:0032587 | ruffle membrane(GO:0032587) |
0.0 | 0.2 | GO:1990023 | mitotic spindle midzone(GO:1990023) |
0.0 | 0.1 | GO:0000801 | central element(GO:0000801) |
0.0 | 0.0 | GO:0044352 | pinosome(GO:0044352) macropinosome(GO:0044354) |
0.0 | 0.1 | GO:0034098 | VCP-NPL4-UFD1 AAA ATPase complex(GO:0034098) |
0.0 | 0.0 | GO:1990712 | HFE-transferrin receptor complex(GO:1990712) |
0.0 | 0.8 | GO:0019005 | SCF ubiquitin ligase complex(GO:0019005) |
0.0 | 0.0 | GO:0071437 | invadopodium(GO:0071437) |
0.0 | 0.1 | GO:0008622 | epsilon DNA polymerase complex(GO:0008622) |
0.0 | 0.1 | GO:0005796 | Golgi lumen(GO:0005796) |
0.0 | 0.3 | GO:0005922 | connexon complex(GO:0005922) |
0.0 | 0.0 | GO:0000176 | nuclear exosome (RNase complex)(GO:0000176) |
0.0 | 0.1 | GO:0072687 | meiotic spindle(GO:0072687) |
0.0 | 0.1 | GO:0097433 | dense body(GO:0097433) |
0.0 | 0.0 | GO:0071953 | elastic fiber(GO:0071953) |
0.0 | 0.0 | GO:0036396 | MIS complex(GO:0036396) |
0.0 | 0.2 | GO:0031235 | intrinsic component of the cytoplasmic side of the plasma membrane(GO:0031235) |
0.0 | 0.4 | GO:0098636 | protein complex involved in cell adhesion(GO:0098636) |
0.0 | 0.0 | GO:0035985 | senescence-associated heterochromatin focus(GO:0035985) |
0.0 | 0.1 | GO:0032433 | filopodium tip(GO:0032433) |
0.0 | 0.1 | GO:0061574 | ASAP complex(GO:0061574) |
0.0 | 0.2 | GO:0005640 | nuclear outer membrane(GO:0005640) |
0.0 | 0.0 | GO:0000942 | condensed nuclear chromosome outer kinetochore(GO:0000942) |
0.0 | 0.2 | GO:0030137 | COPI-coated vesicle(GO:0030137) |
0.0 | 0.0 | GO:0005828 | kinetochore microtubule(GO:0005828) |
0.0 | 0.1 | GO:0001931 | uropod(GO:0001931) cell trailing edge(GO:0031254) |
0.0 | 0.1 | GO:0001527 | microfibril(GO:0001527) |
0.0 | 0.0 | GO:0000322 | storage vacuole(GO:0000322) |
0.0 | 0.0 | GO:0034365 | discoidal high-density lipoprotein particle(GO:0034365) |
0.0 | 0.0 | GO:0043511 | inhibin complex(GO:0043511) |
0.0 | 0.2 | GO:0016581 | NuRD complex(GO:0016581) CHD-type complex(GO:0090545) |
0.0 | 0.3 | GO:0055038 | recycling endosome membrane(GO:0055038) |
0.0 | 0.3 | GO:0009925 | basal plasma membrane(GO:0009925) |
0.0 | 0.1 | GO:0002116 | semaphorin receptor complex(GO:0002116) |
0.0 | 0.2 | GO:0032580 | Golgi cisterna membrane(GO:0032580) |
0.0 | 0.0 | GO:0071797 | LUBAC complex(GO:0071797) |
0.0 | 0.0 | GO:0072534 | perineuronal net(GO:0072534) |
0.0 | 0.4 | GO:0016592 | mediator complex(GO:0016592) |
0.0 | 0.1 | GO:0042405 | nuclear inclusion body(GO:0042405) |
0.0 | 0.2 | GO:0097038 | perinuclear endoplasmic reticulum(GO:0097038) |
0.0 | 0.6 | GO:0001726 | ruffle(GO:0001726) |
0.0 | 0.0 | GO:0030015 | CCR4-NOT core complex(GO:0030015) |
0.0 | 0.0 | GO:0071942 | XPC complex(GO:0071942) |
0.0 | 0.1 | GO:0005847 | mRNA cleavage and polyadenylation specificity factor complex(GO:0005847) |
0.0 | 0.1 | GO:0005671 | Ada2/Gcn5/Ada3 transcription activator complex(GO:0005671) |
0.0 | 0.9 | GO:0005581 | collagen trimer(GO:0005581) |
0.0 | 0.0 | GO:1990635 | proximal dendrite(GO:1990635) |
0.0 | 0.1 | GO:0030008 | TRAPP complex(GO:0030008) |
0.0 | 0.4 | GO:0016328 | lateral plasma membrane(GO:0016328) |
0.0 | 0.0 | GO:0000796 | condensin complex(GO:0000796) |
0.0 | 0.0 | GO:0043259 | laminin-10 complex(GO:0043259) |
0.0 | 0.1 | GO:0031010 | ISWI-type complex(GO:0031010) |
0.0 | 0.0 | GO:0034363 | intermediate-density lipoprotein particle(GO:0034363) |
0.0 | 0.1 | GO:0097542 | ciliary tip(GO:0097542) |
0.0 | 0.2 | GO:0035861 | site of double-strand break(GO:0035861) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.2 | 1.0 | GO:0004854 | xanthine dehydrogenase activity(GO:0004854) oxidoreductase activity, acting on CH or CH2 groups, NAD or NADP as acceptor(GO:0016726) |
0.2 | 0.5 | GO:0005345 | purine nucleobase transmembrane transporter activity(GO:0005345) pyrimidine nucleobase transmembrane transporter activity(GO:0005350) nucleobase transmembrane transporter activity(GO:0015205) |
0.2 | 0.5 | GO:0034988 | Fc-gamma receptor I complex binding(GO:0034988) |
0.1 | 0.4 | GO:0035515 | oxidative RNA demethylase activity(GO:0035515) |
0.1 | 0.4 | GO:0015143 | urate transmembrane transporter activity(GO:0015143) salt transmembrane transporter activity(GO:1901702) |
0.1 | 0.5 | GO:0016401 | palmitoyl-CoA oxidase activity(GO:0016401) |
0.1 | 0.5 | GO:0004740 | pyruvate dehydrogenase (acetyl-transferring) kinase activity(GO:0004740) |
0.1 | 0.8 | GO:0008559 | xenobiotic-transporting ATPase activity(GO:0008559) |
0.1 | 0.4 | GO:0004829 | threonine-tRNA ligase activity(GO:0004829) |
0.1 | 0.8 | GO:0034785 | 3-(3-hydroxyphenyl)propionate hydroxylase activity(GO:0008688) 4-chlorobenzaldehyde oxidase activity(GO:0018471) 3,5-xylenol methylhydroxylase activity(GO:0018630) phenylacetate hydroxylase activity(GO:0018631) 4-nitrophenol 4-monooxygenase activity(GO:0018632) dimethyl sulfide monooxygenase activity(GO:0018633) alpha-pinene monooxygenase [NADH] activity(GO:0018634) 1-hydroxy-2-naphthoate hydroxylase activity(GO:0018637) toluene 4-monooxygenase activity(GO:0018638) xylene monooxygenase activity(GO:0018639) dibenzothiophene monooxygenase activity(GO:0018640) 6-hydroxy-3-methyl-2-oxo-1,2-dihydroquinoline 6-monooxygenase activity(GO:0018641) chlorophenol 4-monooxygenase activity(GO:0018642) carbon disulfide oxygenase activity(GO:0018643) toluene 2-monooxygenase activity(GO:0018644) 1-hydroxy-2-oxolimonene 1,2-monooxygenase activity(GO:0018646) phenanthrene 1,2-monooxygenase activity(GO:0018647) tetrahydrofuran hydroxylase activity(GO:0018649) styrene monooxygenase activity(GO:0018650) toluene-4-sulfonate monooxygenase activity(GO:0018651) toluene-sulfonate methyl-monooxygenase activity(GO:0018652) 3-methyl-2-oxo-1,2-dihydroquinoline 6-monooxygenase activity(GO:0018653) 2-hydroxy-phenylacetate hydroxylase activity(GO:0018654) 2-oxo-delta3-4,5,5-trimethylcyclopentenylacetyl-CoA 1,2-monooxygenase activity(GO:0018655) phenanthrene 3,4-monooxygenase activity(GO:0018656) toluene 3-monooxygenase activity(GO:0018657) 4-hydroxyphenylacetate,NADH:oxygen oxidoreductase (3-hydroxylating) activity(GO:0018660) limonene monooxygenase activity(GO:0019113) 2-methylnaphthalene hydroxylase activity(GO:0034526) 1-methylnaphthalene hydroxylase activity(GO:0034534) bisphenol A hydroxylase A activity(GO:0034560) salicylate 5-hydroxylase activity(GO:0034785) isobutylamine N-hydroxylase activity(GO:0034791) branched-chain dodecylbenzene sulfonate monooxygenase activity(GO:0034802) 3-HSA hydroxylase activity(GO:0034819) 4-hydroxypyridine-3-hydroxylase activity(GO:0034894) 2-octaprenyl-3-methyl-6-methoxy-1,4-benzoquinol hydroxylase activity(GO:0043719) 6-hydroxynicotinate 3-monooxygenase activity(GO:0043731) thalianol hydroxylase activity(GO:0080014) |
0.1 | 0.4 | GO:0030519 | snoRNP binding(GO:0030519) |
0.1 | 0.6 | GO:0015198 | oligopeptide transporter activity(GO:0015198) |
0.1 | 0.3 | GO:1990460 | leptin receptor binding(GO:1990460) |
0.1 | 0.4 | GO:0003696 | satellite DNA binding(GO:0003696) |
0.1 | 0.3 | GO:0003886 | DNA (cytosine-5-)-methyltransferase activity(GO:0003886) DNA (cytosine-5-)-methyltransferase activity, acting on CpG substrates(GO:0051718) |
0.1 | 0.4 | GO:0045340 | mercury ion binding(GO:0045340) |
0.1 | 0.3 | GO:0000171 | ribonuclease MRP activity(GO:0000171) |
0.1 | 0.4 | GO:0016286 | small conductance calcium-activated potassium channel activity(GO:0016286) |
0.1 | 0.4 | GO:0005290 | L-histidine transmembrane transporter activity(GO:0005290) |
0.1 | 0.4 | GO:0004945 | angiotensin type II receptor activity(GO:0004945) |
0.1 | 0.3 | GO:0050567 | glutaminyl-tRNA synthase (glutamine-hydrolyzing) activity(GO:0050567) |
0.1 | 0.4 | GO:0050051 | leukotriene-B4 20-monooxygenase activity(GO:0050051) |
0.1 | 0.1 | GO:0042392 | sphingosine-1-phosphate phosphatase activity(GO:0042392) |
0.1 | 0.4 | GO:0090482 | vitamin transmembrane transporter activity(GO:0090482) |
0.1 | 0.2 | GO:0070905 | serine binding(GO:0070905) |
0.1 | 0.5 | GO:0043426 | MRF binding(GO:0043426) |
0.1 | 0.7 | GO:0038191 | neuropilin binding(GO:0038191) |
0.1 | 0.2 | GO:0032767 | copper-dependent protein binding(GO:0032767) |
0.1 | 0.9 | GO:0030676 | Rac guanyl-nucleotide exchange factor activity(GO:0030676) |
0.1 | 0.2 | GO:0017153 | sodium:dicarboxylate symporter activity(GO:0017153) |
0.1 | 0.4 | GO:0035473 | lipase binding(GO:0035473) |
0.1 | 0.3 | GO:0015093 | ferrous iron transmembrane transporter activity(GO:0015093) |
0.1 | 0.5 | GO:0000150 | recombinase activity(GO:0000150) |
0.1 | 0.2 | GO:0031800 | type 3 metabotropic glutamate receptor binding(GO:0031800) |
0.1 | 0.2 | GO:0004699 | calcium-independent protein kinase C activity(GO:0004699) |
0.1 | 0.3 | GO:0048403 | brain-derived neurotrophic factor binding(GO:0048403) |
0.1 | 0.2 | GO:0050252 | retinol O-fatty-acyltransferase activity(GO:0050252) |
0.1 | 0.2 | GO:0031752 | D5 dopamine receptor binding(GO:0031752) |
0.1 | 0.2 | GO:0031750 | D3 dopamine receptor binding(GO:0031750) |
0.1 | 0.2 | GO:0080084 | RNA polymerase III type 1 promoter DNA binding(GO:0001030) RNA polymerase III type 2 promoter DNA binding(GO:0001031) RNA polymerase III type 3 promoter DNA binding(GO:0001032) 5S rDNA binding(GO:0080084) |
0.1 | 0.2 | GO:0004346 | glucose-6-phosphatase activity(GO:0004346) sugar-terminal-phosphatase activity(GO:0050309) |
0.1 | 0.5 | GO:0050649 | testosterone 6-beta-hydroxylase activity(GO:0050649) |
0.1 | 0.1 | GO:0031821 | G-protein coupled serotonin receptor binding(GO:0031821) |
0.1 | 0.3 | GO:0004128 | cytochrome-b5 reductase activity, acting on NAD(P)H(GO:0004128) |
0.1 | 0.4 | GO:0071933 | Arp2/3 complex binding(GO:0071933) |
0.1 | 0.4 | GO:0036122 | BMP binding(GO:0036122) |
0.1 | 0.3 | GO:0038085 | vascular endothelial growth factor binding(GO:0038085) |
0.1 | 0.3 | GO:0031849 | olfactory receptor binding(GO:0031849) |
0.1 | 0.2 | GO:0015252 | hydrogen ion channel activity(GO:0015252) |
0.1 | 0.2 | GO:0004370 | glycerol kinase activity(GO:0004370) |
0.1 | 0.7 | GO:0008553 | hydrogen-exporting ATPase activity, phosphorylative mechanism(GO:0008553) |
0.1 | 0.2 | GO:0016661 | oxidoreductase activity, acting on other nitrogenous compounds as donors(GO:0016661) |
0.0 | 0.3 | GO:0004908 | interleukin-1 receptor activity(GO:0004908) |
0.0 | 0.1 | GO:0005001 | transmembrane receptor protein tyrosine phosphatase activity(GO:0005001) |
0.0 | 0.2 | GO:0019960 | C-X3-C chemokine binding(GO:0019960) |
0.0 | 0.1 | GO:0050816 | phosphothreonine binding(GO:0050816) |
0.0 | 0.1 | GO:0031686 | A1 adenosine receptor binding(GO:0031686) |
0.0 | 0.3 | GO:0005499 | vitamin D binding(GO:0005499) |
0.0 | 0.2 | GO:0030911 | TPR domain binding(GO:0030911) |
0.0 | 0.1 | GO:0030350 | iron-responsive element binding(GO:0030350) |
0.0 | 0.3 | GO:0008131 | primary amine oxidase activity(GO:0008131) |
0.0 | 0.7 | GO:0004622 | lysophospholipase activity(GO:0004622) |
0.0 | 0.2 | GO:0008410 | CoA-transferase activity(GO:0008410) |
0.0 | 0.1 | GO:0050815 | phosphoserine binding(GO:0050815) |
0.0 | 0.4 | GO:0001091 | RNA polymerase II basal transcription factor binding(GO:0001091) |
0.0 | 0.4 | GO:0008113 | peptide-methionine (S)-S-oxide reductase activity(GO:0008113) |
0.0 | 0.2 | GO:0003854 | 3-beta-hydroxy-delta5-steroid dehydrogenase activity(GO:0003854) |
0.0 | 0.1 | GO:0001075 | transcription factor activity, RNA polymerase II core promoter sequence-specific binding involved in preinitiation complex assembly(GO:0001075) |
0.0 | 0.1 | GO:0015562 | efflux transmembrane transporter activity(GO:0015562) |
0.0 | 0.5 | GO:0046703 | natural killer cell lectin-like receptor binding(GO:0046703) |
0.0 | 0.4 | GO:0004438 | phosphatidylinositol-3-phosphatase activity(GO:0004438) |
0.0 | 0.2 | GO:1990715 | mRNA CDS binding(GO:1990715) |
0.0 | 0.1 | GO:0015119 | hexose phosphate transmembrane transporter activity(GO:0015119) organophosphate:inorganic phosphate antiporter activity(GO:0015315) hexose-phosphate:inorganic phosphate antiporter activity(GO:0015526) glucose 6-phosphate:inorganic phosphate antiporter activity(GO:0061513) |
0.0 | 0.2 | GO:0004459 | L-lactate dehydrogenase activity(GO:0004459) |
0.0 | 0.1 | GO:0050692 | DBD domain binding(GO:0050692) |
0.0 | 0.1 | GO:0004793 | threonine aldolase activity(GO:0004793) L-allo-threonine aldolase activity(GO:0008732) |
0.0 | 0.2 | GO:0005324 | long-chain fatty acid transporter activity(GO:0005324) |
0.0 | 0.1 | GO:0050833 | pyruvate transmembrane transporter activity(GO:0050833) |
0.0 | 0.2 | GO:0015375 | glycine:sodium symporter activity(GO:0015375) |
0.0 | 0.4 | GO:0004383 | guanylate cyclase activity(GO:0004383) |
0.0 | 0.5 | GO:0004185 | serine-type carboxypeptidase activity(GO:0004185) |
0.0 | 0.2 | GO:0015272 | ATP-activated inward rectifier potassium channel activity(GO:0015272) |
0.0 | 0.1 | GO:0033829 | O-fucosylpeptide 3-beta-N-acetylglucosaminyltransferase activity(GO:0033829) |
0.0 | 0.2 | GO:0086007 | voltage-gated calcium channel activity involved in cardiac muscle cell action potential(GO:0086007) |
0.0 | 0.1 | GO:0033300 | dehydroascorbic acid transporter activity(GO:0033300) |
0.0 | 0.6 | GO:0016646 | oxidoreductase activity, acting on the CH-NH group of donors, NAD or NADP as acceptor(GO:0016646) |
0.0 | 0.2 | GO:0005332 | gamma-aminobutyric acid:sodium symporter activity(GO:0005332) |
0.0 | 0.1 | GO:0042731 | PH domain binding(GO:0042731) |
0.0 | 0.4 | GO:0004312 | fatty acid synthase activity(GO:0004312) |
0.0 | 0.3 | GO:0043495 | protein anchor(GO:0043495) |
0.0 | 0.2 | GO:0008294 | calcium- and calmodulin-responsive adenylate cyclase activity(GO:0008294) |
0.0 | 0.1 | GO:0047105 | aminobutyraldehyde dehydrogenase activity(GO:0019145) 4-trimethylammoniobutyraldehyde dehydrogenase activity(GO:0047105) |
0.0 | 0.1 | GO:0015199 | amino-acid betaine transmembrane transporter activity(GO:0015199) carnitine transmembrane transporter activity(GO:0015226) |
0.0 | 0.1 | GO:0102007 | lactonohydrolase activity(GO:0046573) acyl-L-homoserine-lactone lactonohydrolase activity(GO:0102007) |
0.0 | 0.1 | GO:0005534 | galactose binding(GO:0005534) |
0.0 | 0.2 | GO:0016841 | ammonia-lyase activity(GO:0016841) |
0.0 | 0.1 | GO:0098821 | BMP receptor activity(GO:0098821) |
0.0 | 0.1 | GO:0004611 | phosphoenolpyruvate carboxykinase activity(GO:0004611) |
0.0 | 0.1 | GO:0019776 | Atg8 ligase activity(GO:0019776) |
0.0 | 0.2 | GO:0004016 | adenylate cyclase activity(GO:0004016) |
0.0 | 0.2 | GO:0016176 | superoxide-generating NADPH oxidase activator activity(GO:0016176) |
0.0 | 0.1 | GO:0035184 | histone threonine kinase activity(GO:0035184) |
0.0 | 0.2 | GO:0004645 | phosphorylase activity(GO:0004645) |
0.0 | 0.2 | GO:0016892 | endoribonuclease activity, producing 3'-phosphomonoesters(GO:0016892) |
0.0 | 0.2 | GO:0004111 | creatine kinase activity(GO:0004111) |
0.0 | 0.1 | GO:0030158 | protein xylosyltransferase activity(GO:0030158) |
0.0 | 0.2 | GO:0034951 | pivalyl-CoA mutase activity(GO:0034784) o-hydroxylaminobenzoate mutase activity(GO:0034951) lupeol synthase activity(GO:0042299) beta-amyrin synthase activity(GO:0042300) baruol synthase activity(GO:0080011) |
0.0 | 0.1 | GO:0009975 | cyclase activity(GO:0009975) |
0.0 | 0.2 | GO:0070492 | oligosaccharide binding(GO:0070492) |
0.0 | 0.1 | GO:0019166 | trans-2-enoyl-CoA reductase (NADPH) activity(GO:0019166) |
0.0 | 0.4 | GO:0008253 | 5'-nucleotidase activity(GO:0008253) |
0.0 | 0.1 | GO:0008503 | benzodiazepine receptor activity(GO:0008503) |
0.0 | 0.1 | GO:0050508 | glucuronosyl-N-acetylglucosaminyl-proteoglycan 4-alpha-N-acetylglucosaminyltransferase activity(GO:0050508) |
0.0 | 0.2 | GO:0015194 | L-serine transmembrane transporter activity(GO:0015194) serine transmembrane transporter activity(GO:0022889) |
0.0 | 0.1 | GO:0070137 | ubiquitin-like protein-specific endopeptidase activity(GO:0070137) SUMO-specific endopeptidase activity(GO:0070139) |
0.0 | 0.1 | GO:0008312 | 7S RNA binding(GO:0008312) |
0.0 | 0.1 | GO:0004839 | ubiquitin activating enzyme activity(GO:0004839) |
0.0 | 0.1 | GO:0031871 | proteinase activated receptor binding(GO:0031871) |
0.0 | 0.3 | GO:0003993 | acid phosphatase activity(GO:0003993) |
0.0 | 0.1 | GO:0002046 | opsin binding(GO:0002046) |
0.0 | 0.1 | GO:0004165 | dodecenoyl-CoA delta-isomerase activity(GO:0004165) |
0.0 | 0.1 | GO:0042285 | UDP-xylosyltransferase activity(GO:0035252) xylosyltransferase activity(GO:0042285) |
0.0 | 0.2 | GO:0005078 | MAP-kinase scaffold activity(GO:0005078) |
0.0 | 0.1 | GO:0016742 | hydroxymethyl-, formyl- and related transferase activity(GO:0016742) |
0.0 | 0.5 | GO:0003746 | translation elongation factor activity(GO:0003746) |
0.0 | 0.9 | GO:0048365 | Rac GTPase binding(GO:0048365) |
0.0 | 0.1 | GO:0031697 | beta-1 adrenergic receptor binding(GO:0031697) |
0.0 | 0.3 | GO:0015129 | lactate transmembrane transporter activity(GO:0015129) |
0.0 | 0.2 | GO:0015238 | drug transmembrane transporter activity(GO:0015238) |
0.0 | 0.0 | GO:0046870 | cadmium ion binding(GO:0046870) |
0.0 | 0.1 | GO:0000309 | nicotinamide-nucleotide adenylyltransferase activity(GO:0000309) nicotinate-nucleotide adenylyltransferase activity(GO:0004515) |
0.0 | 0.1 | GO:0004046 | aminoacylase activity(GO:0004046) |
0.0 | 0.2 | GO:1990247 | N6-methyladenosine-containing RNA binding(GO:1990247) |
0.0 | 0.1 | GO:0048045 | 4-hydroxybenzoate octaprenyltransferase activity(GO:0008412) protoheme IX farnesyltransferase activity(GO:0008495) (S)-2,3-di-O-geranylgeranylglyceryl phosphate synthase activity(GO:0043888) cadaverine aminopropyltransferase activity(GO:0043918) agmatine aminopropyltransferase activity(GO:0043919) 1,4-dihydroxy-2-naphthoate octaprenyltransferase activity(GO:0046428) trans-pentaprenyltranstransferase activity(GO:0048045) ATP dimethylallyltransferase activity(GO:0052622) ADP dimethylallyltransferase activity(GO:0052623) |
0.0 | 0.1 | GO:0001226 | RNA polymerase II transcription corepressor binding(GO:0001226) |
0.0 | 0.1 | GO:0030151 | molybdenum ion binding(GO:0030151) |
0.0 | 0.4 | GO:0033613 | activating transcription factor binding(GO:0033613) |
0.0 | 0.5 | GO:0042813 | Wnt-activated receptor activity(GO:0042813) |
0.0 | 0.1 | GO:0004367 | glycerol-3-phosphate dehydrogenase [NAD+] activity(GO:0004367) |
0.0 | 0.1 | GO:0004741 | [pyruvate dehydrogenase (lipoamide)] phosphatase activity(GO:0004741) |
0.0 | 0.2 | GO:0031994 | insulin-like growth factor I binding(GO:0031994) |
0.0 | 0.4 | GO:0043274 | phospholipase binding(GO:0043274) |
0.0 | 0.3 | GO:0004861 | cyclin-dependent protein serine/threonine kinase inhibitor activity(GO:0004861) |
0.0 | 0.1 | GO:0032184 | SUMO polymer binding(GO:0032184) |
0.0 | 0.2 | GO:0016861 | intramolecular oxidoreductase activity, interconverting aldoses and ketoses(GO:0016861) |
0.0 | 0.2 | GO:0032795 | heterotrimeric G-protein binding(GO:0032795) |
0.0 | 0.1 | GO:0004985 | opioid receptor activity(GO:0004985) |
0.0 | 0.4 | GO:0035259 | glucocorticoid receptor binding(GO:0035259) |
0.0 | 0.7 | GO:0001105 | RNA polymerase II transcription coactivator activity(GO:0001105) |
0.0 | 0.1 | GO:0034916 | 4-methyloctanoyl-CoA dehydrogenase activity(GO:0034580) naphthyl-2-methyl-succinyl-CoA dehydrogenase activity(GO:0034845) 2-methylhexanoyl-CoA dehydrogenase activity(GO:0034916) propionyl-CoA dehydrogenase activity(GO:0043820) thiol-driven fumarate reductase activity(GO:0043830) coenzyme F420-dependent 2,4,6-trinitrophenol reductase activity(GO:0052758) coenzyme F420-dependent 2,4,6-trinitrophenol hydride reductase activity(GO:0052759) coenzyme F420-dependent 2,4-dinitrophenol reductase activity(GO:0052760) |
0.0 | 0.1 | GO:0004920 | interleukin-10 receptor activity(GO:0004920) |
0.0 | 0.8 | GO:0001102 | RNA polymerase II activating transcription factor binding(GO:0001102) |
0.0 | 0.3 | GO:0045295 | gamma-catenin binding(GO:0045295) |
0.0 | 0.1 | GO:0016520 | growth hormone-releasing hormone receptor activity(GO:0016520) |
0.0 | 0.4 | GO:0005452 | inorganic anion exchanger activity(GO:0005452) |
0.0 | 0.1 | GO:0008273 | calcium, potassium:sodium antiporter activity(GO:0008273) |
0.0 | 0.2 | GO:0005388 | calcium-transporting ATPase activity(GO:0005388) |
0.0 | 1.2 | GO:0005089 | Rho guanyl-nucleotide exchange factor activity(GO:0005089) |
0.0 | 0.1 | GO:0008898 | S-adenosylmethionine-homocysteine S-methyltransferase activity(GO:0008898) |
0.0 | 0.3 | GO:0051765 | inositol tetrakisphosphate kinase activity(GO:0051765) |
0.0 | 0.4 | GO:0016780 | phosphotransferase activity, for other substituted phosphate groups(GO:0016780) |
0.0 | 0.1 | GO:0003828 | alpha-N-acetylneuraminate alpha-2,8-sialyltransferase activity(GO:0003828) |
0.0 | 0.7 | GO:0030507 | spectrin binding(GO:0030507) |
0.0 | 1.0 | GO:0032947 | protein complex scaffold(GO:0032947) |
0.0 | 0.1 | GO:0015165 | pyrimidine nucleotide-sugar transmembrane transporter activity(GO:0015165) |
0.0 | 0.1 | GO:0016894 | endonuclease activity, active with either ribo- or deoxyribonucleic acids and producing 3'-phosphomonoesters(GO:0016894) |
0.0 | 0.1 | GO:0017162 | aryl hydrocarbon receptor binding(GO:0017162) |
0.0 | 0.1 | GO:0004731 | purine-nucleoside phosphorylase activity(GO:0004731) |
0.0 | 0.1 | GO:0005536 | glucose binding(GO:0005536) |
0.0 | 0.2 | GO:0004176 | ATP-dependent peptidase activity(GO:0004176) |
0.0 | 0.0 | GO:0016530 | metallochaperone activity(GO:0016530) |
0.0 | 0.3 | GO:0005355 | glucose transmembrane transporter activity(GO:0005355) |
0.0 | 0.2 | GO:0016929 | SUMO-specific protease activity(GO:0016929) |
0.0 | 0.1 | GO:0050897 | cobalt ion binding(GO:0050897) |
0.0 | 0.1 | GO:0052796 | exo-alpha-sialidase activity(GO:0004308) alpha-sialidase activity(GO:0016997) exo-alpha-(2->3)-sialidase activity(GO:0052794) exo-alpha-(2->6)-sialidase activity(GO:0052795) exo-alpha-(2->8)-sialidase activity(GO:0052796) |
0.0 | 0.1 | GO:0004385 | guanylate kinase activity(GO:0004385) |
0.0 | 0.1 | GO:0008889 | glycerophosphodiester phosphodiesterase activity(GO:0008889) |
0.0 | 0.9 | GO:0003730 | mRNA 3'-UTR binding(GO:0003730) |
0.0 | 0.1 | GO:0008035 | high-density lipoprotein particle binding(GO:0008035) |
0.0 | 0.1 | GO:0016443 | bidentate ribonuclease III activity(GO:0016443) |
0.0 | 0.4 | GO:0035035 | histone acetyltransferase binding(GO:0035035) |
0.0 | 0.2 | GO:0017091 | AU-rich element binding(GO:0017091) |
0.0 | 0.2 | GO:0015114 | phosphate ion transmembrane transporter activity(GO:0015114) |
0.0 | 0.0 | GO:0031826 | type 2A serotonin receptor binding(GO:0031826) |
0.0 | 0.1 | GO:0004687 | myosin light chain kinase activity(GO:0004687) |
0.0 | 0.5 | GO:0017112 | Rab guanyl-nucleotide exchange factor activity(GO:0017112) |
0.0 | 0.1 | GO:0017108 | 5'-flap endonuclease activity(GO:0017108) |
0.0 | 0.1 | GO:0008934 | inositol monophosphate 1-phosphatase activity(GO:0008934) inositol monophosphate 3-phosphatase activity(GO:0052832) inositol monophosphate 4-phosphatase activity(GO:0052833) inositol monophosphate phosphatase activity(GO:0052834) |
0.0 | 0.1 | GO:0098632 | protein binding involved in cell-cell adhesion(GO:0098632) |
0.0 | 0.5 | GO:0050699 | WW domain binding(GO:0050699) |
0.0 | 0.3 | GO:0030332 | cyclin binding(GO:0030332) |
0.0 | 0.0 | GO:0043120 | tumor necrosis factor binding(GO:0043120) |
0.0 | 0.1 | GO:0010861 | thyroid hormone receptor activator activity(GO:0010861) |
0.0 | 0.1 | GO:0005483 | soluble NSF attachment protein activity(GO:0005483) |
0.0 | 0.2 | GO:0005068 | transmembrane receptor protein tyrosine kinase adaptor activity(GO:0005068) |
0.0 | 0.0 | GO:0060230 | lipoprotein lipase activator activity(GO:0060230) |
0.0 | 0.1 | GO:0034046 | poly(G) binding(GO:0034046) |
0.0 | 0.2 | GO:0051400 | BH domain binding(GO:0051400) |
0.0 | 0.0 | GO:0017116 | single-stranded DNA-dependent ATP-dependent DNA helicase activity(GO:0017116) |
0.0 | 0.1 | GO:0070095 | fructose-6-phosphate binding(GO:0070095) |
0.0 | 0.0 | GO:0019976 | interleukin-2 binding(GO:0019976) |
0.0 | 0.1 | GO:0003953 | NAD+ nucleosidase activity(GO:0003953) |
0.0 | 0.1 | GO:0008046 | axon guidance receptor activity(GO:0008046) |
0.0 | 0.0 | GO:0004942 | anaphylatoxin receptor activity(GO:0004942) |
0.0 | 0.1 | GO:0005225 | volume-sensitive anion channel activity(GO:0005225) |
0.0 | 0.1 | GO:0016308 | 1-phosphatidylinositol-4-phosphate 5-kinase activity(GO:0016308) |
0.0 | 0.1 | GO:0008420 | CTD phosphatase activity(GO:0008420) |
0.0 | 0.2 | GO:0070412 | R-SMAD binding(GO:0070412) |
0.0 | 0.1 | GO:0016018 | cyclosporin A binding(GO:0016018) |
0.0 | 0.1 | GO:0000014 | single-stranded DNA endodeoxyribonuclease activity(GO:0000014) |
0.0 | 0.1 | GO:0043140 | ATP-dependent 3'-5' DNA helicase activity(GO:0043140) |
0.0 | 0.0 | GO:0016004 | phospholipase activator activity(GO:0016004) |
0.0 | 0.0 | GO:0030621 | U4 snRNA binding(GO:0030621) |
0.0 | 0.0 | GO:0004691 | cAMP-dependent protein kinase activity(GO:0004691) |
0.0 | 0.2 | GO:0010181 | FMN binding(GO:0010181) |
0.0 | 0.1 | GO:0004769 | steroid delta-isomerase activity(GO:0004769) |
0.0 | 0.1 | GO:1904264 | ubiquitin protein ligase activity involved in ERAD pathway(GO:1904264) |
0.0 | 0.0 | GO:0061665 | SUMO ligase activity(GO:0061665) |
0.0 | 0.0 | GO:0070991 | medium-chain-acyl-CoA dehydrogenase activity(GO:0070991) |
0.0 | 0.0 | GO:0032357 | oxidized DNA binding(GO:0032356) oxidized purine DNA binding(GO:0032357) |
0.0 | 0.1 | GO:0004784 | superoxide dismutase activity(GO:0004784) oxidoreductase activity, acting on superoxide radicals as acceptor(GO:0016721) |
0.0 | 0.1 | GO:0008641 | small protein activating enzyme activity(GO:0008641) |
0.0 | 0.4 | GO:0017017 | MAP kinase tyrosine/serine/threonine phosphatase activity(GO:0017017) |
0.0 | 0.1 | GO:0030368 | interleukin-17 receptor activity(GO:0030368) |
0.0 | 0.2 | GO:0043024 | ribosomal small subunit binding(GO:0043024) |
0.0 | 0.0 | GO:0015280 | ligand-gated sodium channel activity(GO:0015280) |
0.0 | 0.1 | GO:0000386 | second spliceosomal transesterification activity(GO:0000386) |
0.0 | 0.1 | GO:0030983 | mismatched DNA binding(GO:0030983) |
0.0 | 0.1 | GO:0001222 | transcription corepressor binding(GO:0001222) |
0.0 | 0.2 | GO:0032794 | GTPase activating protein binding(GO:0032794) |
0.0 | 0.1 | GO:0050291 | sphingosine N-acyltransferase activity(GO:0050291) |
0.0 | 0.5 | GO:0004177 | aminopeptidase activity(GO:0004177) |
0.0 | 0.0 | GO:0070996 | type 1 melanocortin receptor binding(GO:0070996) |
0.0 | 0.1 | GO:0019808 | polyamine binding(GO:0019808) |
0.0 | 0.0 | GO:0004514 | nicotinate-nucleotide diphosphorylase (carboxylating) activity(GO:0004514) |
0.0 | 0.1 | GO:0047035 | testosterone dehydrogenase (NAD+) activity(GO:0047035) |
0.0 | 0.0 | GO:0019770 | IgG receptor activity(GO:0019770) |
0.0 | 0.1 | GO:1990254 | keratin filament binding(GO:1990254) |
0.0 | 0.0 | GO:0015232 | heme transporter activity(GO:0015232) |
0.0 | 0.0 | GO:0008321 | Ral guanyl-nucleotide exchange factor activity(GO:0008321) |
0.0 | 0.1 | GO:0031005 | filamin binding(GO:0031005) |
0.0 | 0.0 | GO:0042030 | ATPase inhibitor activity(GO:0042030) |
0.0 | 0.2 | GO:0005123 | death receptor binding(GO:0005123) |
0.0 | 0.2 | GO:0015095 | magnesium ion transmembrane transporter activity(GO:0015095) |
0.0 | 0.0 | GO:0015057 | thrombin receptor activity(GO:0015057) |
0.0 | 0.2 | GO:0008157 | protein phosphatase 1 binding(GO:0008157) |
0.0 | 0.1 | GO:0051021 | GDP-dissociation inhibitor binding(GO:0051021) |
0.0 | 0.1 | GO:0008467 | [heparan sulfate]-glucosamine 3-sulfotransferase 1 activity(GO:0008467) |
0.0 | 0.0 | GO:0047276 | N-acetyllactosaminide 3-alpha-galactosyltransferase activity(GO:0047276) |
0.0 | 0.2 | GO:0017049 | GTP-Rho binding(GO:0017049) |
0.0 | 0.0 | GO:1904288 | BAT3 complex binding(GO:1904288) |
0.0 | 0.1 | GO:0015349 | thyroid hormone transmembrane transporter activity(GO:0015349) |
0.0 | 0.1 | GO:0003933 | GTP cyclohydrolase activity(GO:0003933) |
0.0 | 0.1 | GO:0038036 | sphingosine-1-phosphate receptor activity(GO:0038036) |
0.0 | 0.0 | GO:0008545 | JUN kinase kinase activity(GO:0008545) |
0.0 | 0.1 | GO:0032041 | histone deacetylase activity (H3-K14 specific)(GO:0031078) NAD-dependent histone deacetylase activity (H3-K14 specific)(GO:0032041) |
0.0 | 0.1 | GO:0047631 | ADP-ribose diphosphatase activity(GO:0047631) |
0.0 | 0.0 | GO:0043199 | sulfate binding(GO:0043199) |
0.0 | 0.0 | GO:0016647 | oxidoreductase activity, acting on the CH-NH group of donors, oxygen as acceptor(GO:0016647) |
0.0 | 0.0 | GO:0004095 | carnitine O-palmitoyltransferase activity(GO:0004095) |
0.0 | 0.1 | GO:0016208 | AMP binding(GO:0016208) |
0.0 | 0.1 | GO:0017154 | semaphorin receptor activity(GO:0017154) |
0.0 | 0.1 | GO:0044213 | intronic transcription regulatory region DNA binding(GO:0044213) |
0.0 | 0.0 | GO:0008853 | exodeoxyribonuclease III activity(GO:0008853) |
0.0 | 0.0 | GO:0051731 | polynucleotide 5'-hydroxyl-kinase activity(GO:0051731) ATP-dependent polynucleotide kinase activity(GO:0051734) |
0.0 | 0.2 | GO:0051879 | Hsp90 protein binding(GO:0051879) |
0.0 | 0.0 | GO:0004619 | bisphosphoglycerate mutase activity(GO:0004082) phosphoglycerate mutase activity(GO:0004619) 2,3-bisphosphoglycerate-dependent phosphoglycerate mutase activity(GO:0046538) |
0.0 | 0.1 | GO:0016918 | retinal binding(GO:0016918) |
0.0 | 0.0 | GO:0017089 | glycolipid transporter activity(GO:0017089) |
0.0 | 0.3 | GO:0004712 | protein serine/threonine/tyrosine kinase activity(GO:0004712) |
0.0 | 0.0 | GO:0046976 | histone methyltransferase activity (H3-K27 specific)(GO:0046976) |
0.0 | 0.2 | GO:0008138 | protein tyrosine/serine/threonine phosphatase activity(GO:0008138) |
0.0 | 0.3 | GO:0051721 | protein phosphatase 2A binding(GO:0051721) |
0.0 | 0.0 | GO:0016653 | oxidoreductase activity, acting on NAD(P)H, heme protein as acceptor(GO:0016653) |
0.0 | 0.1 | GO:0003747 | translation release factor activity(GO:0003747) translation termination factor activity(GO:0008079) |
0.0 | 0.1 | GO:0004000 | adenosine deaminase activity(GO:0004000) |
0.0 | 0.0 | GO:0018600 | mono-butyltin dioxygenase activity(GO:0018586) tri-n-butyltin dioxygenase activity(GO:0018588) di-n-butyltin dioxygenase activity(GO:0018589) methylsilanetriol hydroxylase activity(GO:0018590) methyl tertiary butyl ether 3-monooxygenase activity(GO:0018591) 4-nitrocatechol 4-monooxygenase activity(GO:0018592) 4-chlorophenoxyacetate monooxygenase activity(GO:0018593) tert-butanol 2-monooxygenase activity(GO:0018594) alpha-pinene monooxygenase activity(GO:0018595) dimethylsilanediol hydroxylase activity(GO:0018596) ammonia monooxygenase activity(GO:0018597) hydroxymethylsilanetriol oxidase activity(GO:0018598) 2-hydroxyisobutyrate 3-monooxygenase activity(GO:0018599) alpha-pinene dehydrogenase activity(GO:0018600) bisphenol A hydroxylase B activity(GO:0034559) 2,2-bis(4-hydroxyphenyl)-1-propanol hydroxylase activity(GO:0034562) 9-fluorenone-3,4-dioxygenase activity(GO:0034786) anthracene 9,10-dioxygenase activity(GO:0034816) 2-(methylthio)benzothiazole monooxygenase activity(GO:0034857) 2-hydroxybenzothiazole monooxygenase activity(GO:0034858) benzothiazole monooxygenase activity(GO:0034859) 2,6-dihydroxybenzothiazole monooxygenase activity(GO:0034862) pinacolone 5-monooxygenase activity(GO:0034870) thioacetamide S-oxygenase activity(GO:0034873) thioacetamide S-oxide S-oxygenase activity(GO:0034874) endosulfan monooxygenase I activity(GO:0034888) N-nitrodimethylamine hydroxylase activity(GO:0034893) 4-(1-ethyl-1,4-dimethyl-pentyl)phenol monoxygenase activity(GO:0034897) endosulfan ether monooxygenase activity(GO:0034903) pyrene 4,5-monooxygenase activity(GO:0034925) pyrene 1,2-monooxygenase activity(GO:0034927) 1-hydroxypyrene 6,7-monooxygenase activity(GO:0034928) 1-hydroxypyrene 7,8-monooxygenase activity(GO:0034929) phenylboronic acid monooxygenase activity(GO:0034950) spheroidene monooxygenase activity(GO:0043823) |
0.0 | 0.0 | GO:0019961 | interferon binding(GO:0019961) |
0.0 | 0.1 | GO:0048495 | Roundabout binding(GO:0048495) |
0.0 | 1.9 | GO:0005096 | GTPase activator activity(GO:0005096) |
0.0 | 0.1 | GO:0005223 | intracellular cGMP activated cation channel activity(GO:0005223) |
0.0 | 0.0 | GO:0004466 | long-chain-acyl-CoA dehydrogenase activity(GO:0004466) |
0.0 | 0.1 | GO:0030215 | semaphorin receptor binding(GO:0030215) |
0.0 | 0.0 | GO:0003680 | AT DNA binding(GO:0003680) |
0.0 | 0.2 | GO:0001103 | RNA polymerase II repressing transcription factor binding(GO:0001103) |
0.0 | 0.1 | GO:0016775 | phosphotransferase activity, nitrogenous group as acceptor(GO:0016775) |
0.0 | 0.0 | GO:1990239 | steroid hormone binding(GO:1990239) |
0.0 | 0.2 | GO:0004707 | MAP kinase activity(GO:0004707) |
0.0 | 0.0 | GO:0015222 | serotonin transmembrane transporter activity(GO:0015222) |
0.0 | 0.1 | GO:0047555 | 3',5'-cyclic-GMP phosphodiesterase activity(GO:0047555) |
0.0 | 0.1 | GO:0071558 | histone demethylase activity (H3-K27 specific)(GO:0071558) |
0.0 | 0.1 | GO:0004774 | succinate-CoA ligase activity(GO:0004774) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.1 | 0.2 | PID IL2 PI3K PATHWAY | IL2 signaling events mediated by PI3K |
0.1 | 0.1 | ST B CELL ANTIGEN RECEPTOR | B Cell Antigen Receptor |
0.1 | 0.1 | PID ERBB4 PATHWAY | ErbB4 signaling events |
0.1 | 0.8 | PID CIRCADIAN PATHWAY | Circadian rhythm pathway |
0.1 | 0.5 | PID VEGF VEGFR PATHWAY | VEGF and VEGFR signaling network |
0.1 | 0.3 | PID FOXM1 PATHWAY | FOXM1 transcription factor network |
0.0 | 1.4 | PID CDC42 REG PATHWAY | Regulation of CDC42 activity |
0.0 | 0.3 | SA G2 AND M PHASES | Cdc25 activates the cdc2/cyclin B complex to induce the G2/M transition. |
0.0 | 0.3 | PID INTEGRIN5 PATHWAY | Beta5 beta6 beta7 and beta8 integrin cell surface interactions |
0.0 | 1.5 | PID RHOA REG PATHWAY | Regulation of RhoA activity |
0.0 | 1.0 | PID INTEGRIN CS PATHWAY | Integrin family cell surface interactions |
0.0 | 0.7 | PID INTEGRIN2 PATHWAY | Beta2 integrin cell surface interactions |
0.0 | 1.0 | PID WNT NONCANONICAL PATHWAY | Noncanonical Wnt signaling pathway |
0.0 | 0.0 | PID RANBP2 PATHWAY | Sumoylation by RanBP2 regulates transcriptional repression |
0.0 | 0.4 | PID LPA4 PATHWAY | LPA4-mediated signaling events |
0.0 | 0.8 | ST JNK MAPK PATHWAY | JNK MAPK Pathway |
0.0 | 0.3 | PID EPHB FWD PATHWAY | EPHB forward signaling |
0.0 | 0.1 | PID HDAC CLASSII PATHWAY | Signaling events mediated by HDAC Class II |
0.0 | 0.0 | ST T CELL SIGNAL TRANSDUCTION | T Cell Signal Transduction |
0.0 | 1.0 | NABA COLLAGENS | Genes encoding collagen proteins |
0.0 | 0.2 | PID IL5 PATHWAY | IL5-mediated signaling events |
0.0 | 0.4 | PID ARF 3PATHWAY | Arf1 pathway |
0.0 | 0.2 | PID NECTIN PATHWAY | Nectin adhesion pathway |
0.0 | 0.1 | PID FOXO PATHWAY | FoxO family signaling |
0.0 | 0.2 | PID PS1 PATHWAY | Presenilin action in Notch and Wnt signaling |
0.0 | 0.0 | PID CD40 PATHWAY | CD40/CD40L signaling |
0.0 | 0.4 | SIG INSULIN RECEPTOR PATHWAY IN CARDIAC MYOCYTES | Genes related to the insulin receptor pathway |
0.0 | 0.2 | PID AP1 PATHWAY | AP-1 transcription factor network |
0.0 | 0.2 | PID S1P S1P4 PATHWAY | S1P4 pathway |
0.0 | 0.5 | PID AMB2 NEUTROPHILS PATHWAY | amb2 Integrin signaling |
0.0 | 0.0 | PID PI3KCI AKT PATHWAY | Class I PI3K signaling events mediated by Akt |
0.0 | 0.1 | ST PAC1 RECEPTOR PATHWAY | PAC1 Receptor Pathway |
0.0 | 0.2 | PID ENDOTHELIN PATHWAY | Endothelins |
0.0 | 0.5 | PID RAS PATHWAY | Regulation of Ras family activation |
0.0 | 0.5 | PID MET PATHWAY | Signaling events mediated by Hepatocyte Growth Factor Receptor (c-Met) |
0.0 | 0.0 | ST IL 13 PATHWAY | Interleukin 13 (IL-13) Pathway |
0.0 | 0.1 | PID GMCSF PATHWAY | GMCSF-mediated signaling events |
0.0 | 0.1 | ST G ALPHA S PATHWAY | G alpha s Pathway |
0.0 | 0.0 | PID ERBB1 RECEPTOR PROXIMAL PATHWAY | EGF receptor (ErbB1) signaling pathway |
0.0 | 0.0 | PID S1P S1P3 PATHWAY | S1P3 pathway |
0.0 | 0.0 | PID PI3K PLC TRK PATHWAY | Trk receptor signaling mediated by PI3K and PLC-gamma |
0.0 | 0.2 | PID REELIN PATHWAY | Reelin signaling pathway |
0.0 | 0.2 | PID ECADHERIN NASCENT AJ PATHWAY | E-cadherin signaling in the nascent adherens junction |
0.0 | 0.1 | PID TCR CALCIUM PATHWAY | Calcium signaling in the CD4+ TCR pathway |
0.0 | 0.0 | PID NFKAPPAB ATYPICAL PATHWAY | Atypical NF-kappaB pathway |
0.0 | 0.0 | PID ER NONGENOMIC PATHWAY | Plasma membrane estrogen receptor signaling |
0.0 | 0.3 | ST ERK1 ERK2 MAPK PATHWAY | ERK1/ERK2 MAPK Pathway |
0.0 | 0.3 | PID WNT SIGNALING PATHWAY | Wnt signaling network |
0.0 | 0.1 | PID P38 MKK3 6PATHWAY | p38 MAPK signaling pathway |
0.0 | 0.0 | PID EPHRINB REV PATHWAY | Ephrin B reverse signaling |
0.0 | 0.0 | PID TCPTP PATHWAY | Signaling events mediated by TCPTP |
0.0 | 0.4 | PID NFAT TFPATHWAY | Calcineurin-regulated NFAT-dependent transcription in lymphocytes |
0.0 | 0.2 | PID ERBB1 INTERNALIZATION PATHWAY | Internalization of ErbB1 |
0.0 | 0.0 | SA CASPASE CASCADE | Apoptosis is mediated by caspases, cysteine proteases arranged in a proteolytic cascade. |
0.0 | 1.4 | NABA ECM AFFILIATED | Genes encoding proteins affiliated structurally or functionally to extracellular matrix proteins |
0.0 | 0.4 | PID PLK1 PATHWAY | PLK1 signaling events |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.1 | 0.4 | REACTOME GAP JUNCTION DEGRADATION | Genes involved in Gap junction degradation |
0.1 | 0.1 | REACTOME ABORTIVE ELONGATION OF HIV1 TRANSCRIPT IN THE ABSENCE OF TAT | Genes involved in Abortive elongation of HIV-1 transcript in the absence of Tat |
0.1 | 0.1 | REACTOME CONVERSION FROM APC C CDC20 TO APC C CDH1 IN LATE ANAPHASE | Genes involved in Conversion from APC/C:Cdc20 to APC/C:Cdh1 in late anaphase |
0.1 | 0.1 | REACTOME SIGNALING BY THE B CELL RECEPTOR BCR | Genes involved in Signaling by the B Cell Receptor (BCR) |
0.1 | 0.1 | REACTOME TRANSPORT OF MATURE MRNA DERIVED FROM AN INTRONLESS TRANSCRIPT | Genes involved in Transport of Mature mRNA Derived from an Intronless Transcript |
0.1 | 0.2 | REACTOME GLUCURONIDATION | Genes involved in Glucuronidation |
0.1 | 0.7 | REACTOME RECEPTOR LIGAND BINDING INITIATES THE SECOND PROTEOLYTIC CLEAVAGE OF NOTCH RECEPTOR | Genes involved in Receptor-ligand binding initiates the second proteolytic cleavage of Notch receptor |
0.1 | 0.5 | REACTOME VEGF LIGAND RECEPTOR INTERACTIONS | Genes involved in VEGF ligand-receptor interactions |
0.1 | 0.8 | REACTOME COMMON PATHWAY | Genes involved in Common Pathway |
0.1 | 0.7 | REACTOME ERKS ARE INACTIVATED | Genes involved in ERKs are inactivated |
0.1 | 0.6 | REACTOME FACILITATIVE NA INDEPENDENT GLUCOSE TRANSPORTERS | Genes involved in Facilitative Na+-independent glucose transporters |
0.1 | 0.6 | REACTOME PASSIVE TRANSPORT BY AQUAPORINS | Genes involved in Passive Transport by Aquaporins |
0.0 | 0.9 | REACTOME PRE NOTCH TRANSCRIPTION AND TRANSLATION | Genes involved in Pre-NOTCH Transcription and Translation |
0.0 | 0.6 | REACTOME REGULATION OF PYRUVATE DEHYDROGENASE PDH COMPLEX | Genes involved in Regulation of pyruvate dehydrogenase (PDH) complex |
0.0 | 0.5 | REACTOME PURINE CATABOLISM | Genes involved in Purine catabolism |
0.0 | 0.1 | REACTOME NGF SIGNALLING VIA TRKA FROM THE PLASMA MEMBRANE | Genes involved in NGF signalling via TRKA from the plasma membrane |
0.0 | 0.0 | REACTOME CTLA4 INHIBITORY SIGNALING | Genes involved in CTLA4 inhibitory signaling |
0.0 | 0.6 | REACTOME MITOCHONDRIAL FATTY ACID BETA OXIDATION | Genes involved in Mitochondrial Fatty Acid Beta-Oxidation |
0.0 | 0.0 | REACTOME APC C CDC20 MEDIATED DEGRADATION OF MITOTIC PROTEINS | Genes involved in APC/C:Cdc20 mediated degradation of mitotic proteins |
0.0 | 0.2 | REACTOME IRAK2 MEDIATED ACTIVATION OF TAK1 COMPLEX UPON TLR7 8 OR 9 STIMULATION | Genes involved in IRAK2 mediated activation of TAK1 complex upon TLR7/8 or 9 stimulation |
0.0 | 0.2 | REACTOME CIRCADIAN REPRESSION OF EXPRESSION BY REV ERBA | Genes involved in Circadian Repression of Expression by REV-ERBA |
0.0 | 0.3 | REACTOME PLATELET ADHESION TO EXPOSED COLLAGEN | Genes involved in Platelet Adhesion to exposed collagen |
0.0 | 0.5 | REACTOME RETROGRADE NEUROTROPHIN SIGNALLING | Genes involved in Retrograde neurotrophin signalling |
0.0 | 0.4 | REACTOME G2 M DNA DAMAGE CHECKPOINT | Genes involved in G2/M DNA damage checkpoint |
0.0 | 0.0 | REACTOME CDT1 ASSOCIATION WITH THE CDC6 ORC ORIGIN COMPLEX | Genes involved in CDT1 association with the CDC6:ORC:origin complex |
0.0 | 0.1 | REACTOME SOS MEDIATED SIGNALLING | Genes involved in SOS-mediated signalling |
0.0 | 0.3 | REACTOME YAP1 AND WWTR1 TAZ STIMULATED GENE EXPRESSION | Genes involved in YAP1- and WWTR1 (TAZ)-stimulated gene expression |
0.0 | 0.6 | REACTOME POST CHAPERONIN TUBULIN FOLDING PATHWAY | Genes involved in Post-chaperonin tubulin folding pathway |
0.0 | 0.3 | REACTOME BMAL1 CLOCK NPAS2 ACTIVATES CIRCADIAN EXPRESSION | Genes involved in BMAL1:CLOCK/NPAS2 Activates Circadian Expression |
0.0 | 0.2 | REACTOME GAMMA CARBOXYLATION TRANSPORT AND AMINO TERMINAL CLEAVAGE OF PROTEINS | Genes involved in Gamma-carboxylation, transport, and amino-terminal cleavage of proteins |
0.0 | 0.6 | REACTOME HS GAG DEGRADATION | Genes involved in HS-GAG degradation |
0.0 | 0.4 | REACTOME HOMOLOGOUS RECOMBINATION REPAIR OF REPLICATION INDEPENDENT DOUBLE STRAND BREAKS | Genes involved in Homologous recombination repair of replication-independent double-strand breaks |
0.0 | 0.9 | REACTOME ABC FAMILY PROTEINS MEDIATED TRANSPORT | Genes involved in ABC-family proteins mediated transport |
0.0 | 0.1 | REACTOME CROSS PRESENTATION OF SOLUBLE EXOGENOUS ANTIGENS ENDOSOMES | Genes involved in Cross-presentation of soluble exogenous antigens (endosomes) |
0.0 | 0.1 | REACTOME ENOS ACTIVATION AND REGULATION | Genes involved in eNOS activation and regulation |
0.0 | 1.2 | REACTOME METABOLISM OF VITAMINS AND COFACTORS | Genes involved in Metabolism of vitamins and cofactors |
0.0 | 0.1 | REACTOME SYNTHESIS OF BILE ACIDS AND BILE SALTS VIA 7ALPHA HYDROXYCHOLESTEROL | Genes involved in Synthesis of bile acids and bile salts via 7alpha-hydroxycholesterol |
0.0 | 0.0 | REACTOME RORA ACTIVATES CIRCADIAN EXPRESSION | Genes involved in RORA Activates Circadian Expression |
0.0 | 0.6 | REACTOME TRANSFERRIN ENDOCYTOSIS AND RECYCLING | Genes involved in Transferrin endocytosis and recycling |
0.0 | 0.2 | REACTOME ADENYLATE CYCLASE ACTIVATING PATHWAY | Genes involved in Adenylate cyclase activating pathway |
0.0 | 0.3 | REACTOME TETRAHYDROBIOPTERIN BH4 SYNTHESIS RECYCLING SALVAGE AND REGULATION | Genes involved in Tetrahydrobiopterin (BH4) synthesis, recycling, salvage and regulation |
0.0 | 0.3 | REACTOME INTRINSIC PATHWAY | Genes involved in Intrinsic Pathway |
0.0 | 0.1 | REACTOME PYRUVATE METABOLISM | Genes involved in Pyruvate metabolism |
0.0 | 0.2 | REACTOME GRB2 SOS PROVIDES LINKAGE TO MAPK SIGNALING FOR INTERGRINS | Genes involved in GRB2:SOS provides linkage to MAPK signaling for Intergrins |
0.0 | 0.0 | REACTOME PLATELET ACTIVATION SIGNALING AND AGGREGATION | Genes involved in Platelet activation, signaling and aggregation |
0.0 | 0.3 | REACTOME PRE NOTCH EXPRESSION AND PROCESSING | Genes involved in Pre-NOTCH Expression and Processing |
0.0 | 0.5 | REACTOME PYRUVATE METABOLISM AND CITRIC ACID TCA CYCLE | Genes involved in Pyruvate metabolism and Citric Acid (TCA) cycle |
0.0 | 0.1 | REACTOME ROLE OF DCC IN REGULATING APOPTOSIS | Genes involved in Role of DCC in regulating apoptosis |
0.0 | 0.2 | REACTOME GLYCOPROTEIN HORMONES | Genes involved in Glycoprotein hormones |
0.0 | 0.6 | REACTOME SEMA4D IN SEMAPHORIN SIGNALING | Genes involved in Sema4D in semaphorin signaling |
0.0 | 0.1 | REACTOME PECAM1 INTERACTIONS | Genes involved in PECAM1 interactions |
0.0 | 0.0 | REACTOME PEPTIDE HORMONE BIOSYNTHESIS | Genes involved in Peptide hormone biosynthesis |
0.0 | 0.1 | REACTOME REMOVAL OF THE FLAP INTERMEDIATE FROM THE C STRAND | Genes involved in Removal of the Flap Intermediate from the C-strand |
0.0 | 0.3 | REACTOME GAP JUNCTION ASSEMBLY | Genes involved in Gap junction assembly |
0.0 | 0.3 | REACTOME SMOOTH MUSCLE CONTRACTION | Genes involved in Smooth Muscle Contraction |
0.0 | 0.0 | REACTOME SIGNALING BY FGFR | Genes involved in Signaling by FGFR |
0.0 | 0.3 | REACTOME REGULATION OF INSULIN LIKE GROWTH FACTOR IGF ACTIVITY BY INSULIN LIKE GROWTH FACTOR BINDING PROTEINS IGFBPS | Genes involved in Regulation of Insulin-like Growth Factor (IGF) Activity by Insulin-like Growth Factor Binding Proteins (IGFBPs) |
0.0 | 0.4 | REACTOME AMYLOIDS | Genes involved in Amyloids |
0.0 | 0.2 | REACTOME GLUCOSE TRANSPORT | Genes involved in Glucose transport |
0.0 | 0.2 | REACTOME TRANSPORT OF ORGANIC ANIONS | Genes involved in Transport of organic anions |
0.0 | 0.1 | REACTOME REGULATION OF COMPLEMENT CASCADE | Genes involved in Regulation of Complement cascade |
0.0 | 0.1 | REACTOME NA CL DEPENDENT NEUROTRANSMITTER TRANSPORTERS | Genes involved in Na+/Cl- dependent neurotransmitter transporters |
0.0 | 0.1 | REACTOME TIE2 SIGNALING | Genes involved in Tie2 Signaling |
0.0 | 0.1 | REACTOME DCC MEDIATED ATTRACTIVE SIGNALING | Genes involved in DCC mediated attractive signaling |
0.0 | 0.1 | REACTOME SEMA3A PLEXIN REPULSION SIGNALING BY INHIBITING INTEGRIN ADHESION | Genes involved in SEMA3A-Plexin repulsion signaling by inhibiting Integrin adhesion |
0.0 | 0.4 | REACTOME TRAFFICKING OF AMPA RECEPTORS | Genes involved in Trafficking of AMPA receptors |
0.0 | 0.1 | REACTOME PROSTANOID LIGAND RECEPTORS | Genes involved in Prostanoid ligand receptors |
0.0 | 0.3 | REACTOME GABA SYNTHESIS RELEASE REUPTAKE AND DEGRADATION | Genes involved in GABA synthesis, release, reuptake and degradation |
0.0 | 0.2 | REACTOME N GLYCAN ANTENNAE ELONGATION | Genes involved in N-Glycan antennae elongation |
0.0 | 0.4 | REACTOME SIGNALING BY ROBO RECEPTOR | Genes involved in Signaling by Robo receptor |
0.0 | 0.3 | REACTOME NETRIN1 SIGNALING | Genes involved in Netrin-1 signaling |
0.0 | 0.2 | REACTOME ORGANIC CATION ANION ZWITTERION TRANSPORT | Genes involved in Organic cation/anion/zwitterion transport |
0.0 | 0.2 | REACTOME JNK C JUN KINASES PHOSPHORYLATION AND ACTIVATION MEDIATED BY ACTIVATED HUMAN TAK1 | Genes involved in JNK (c-Jun kinases) phosphorylation and activation mediated by activated human TAK1 |
0.0 | 0.1 | REACTOME CD28 DEPENDENT VAV1 PATHWAY | Genes involved in CD28 dependent Vav1 pathway |
0.0 | 0.3 | REACTOME SYNTHESIS AND INTERCONVERSION OF NUCLEOTIDE DI AND TRIPHOSPHATES | Genes involved in Synthesis and interconversion of nucleotide di- and triphosphates |
0.0 | 0.5 | REACTOME GLYCOSPHINGOLIPID METABOLISM | Genes involved in Glycosphingolipid metabolism |
0.0 | 0.1 | REACTOME BILE SALT AND ORGANIC ANION SLC TRANSPORTERS | Genes involved in Bile salt and organic anion SLC transporters |
0.0 | 0.1 | REACTOME CRMPS IN SEMA3A SIGNALING | Genes involved in CRMPs in Sema3A signaling |
0.0 | 0.1 | REACTOME PTM GAMMA CARBOXYLATION HYPUSINE FORMATION AND ARYLSULFATASE ACTIVATION | Genes involved in PTM: gamma carboxylation, hypusine formation and arylsulfatase activation |
0.0 | 0.0 | REACTOME OLFACTORY SIGNALING PATHWAY | Genes involved in Olfactory Signaling Pathway |
0.0 | 0.1 | REACTOME AKT PHOSPHORYLATES TARGETS IN THE CYTOSOL | Genes involved in AKT phosphorylates targets in the cytosol |
0.0 | 0.3 | REACTOME APC CDC20 MEDIATED DEGRADATION OF NEK2A | Genes involved in APC-Cdc20 mediated degradation of Nek2A |
0.0 | 0.1 | REACTOME THE NLRP3 INFLAMMASOME | Genes involved in The NLRP3 inflammasome |
0.0 | 0.2 | REACTOME CHYLOMICRON MEDIATED LIPID TRANSPORT | Genes involved in Chylomicron-mediated lipid transport |
0.0 | 0.1 | REACTOME G PROTEIN ACTIVATION | Genes involved in G-protein activation |
0.0 | 0.0 | REACTOME MRNA CAPPING | Genes involved in mRNA Capping |
0.0 | 0.0 | REACTOME XENOBIOTICS | Genes involved in Xenobiotics |
0.0 | 0.1 | REACTOME ACTIVATION OF BH3 ONLY PROTEINS | Genes involved in Activation of BH3-only proteins |
0.0 | 0.3 | REACTOME SULFUR AMINO ACID METABOLISM | Genes involved in Sulfur amino acid metabolism |
0.0 | 0.0 | REACTOME MEMBRANE BINDING AND TARGETTING OF GAG PROTEINS | Genes involved in Membrane binding and targetting of GAG proteins |
0.0 | 0.1 | REACTOME ACTIVATION OF IRF3 IRF7 MEDIATED BY TBK1 IKK EPSILON | Genes involved in Activation of IRF3/IRF7 mediated by TBK1/IKK epsilon |
0.0 | 0.3 | REACTOME MEIOTIC SYNAPSIS | Genes involved in Meiotic Synapsis |
0.0 | 0.1 | REACTOME MTORC1 MEDIATED SIGNALLING | Genes involved in mTORC1-mediated signalling |
0.0 | 0.1 | REACTOME HORMONE SENSITIVE LIPASE HSL MEDIATED TRIACYLGLYCEROL HYDROLYSIS | Genes involved in Hormone-sensitive lipase (HSL)-mediated triacylglycerol hydrolysis |
0.0 | 0.3 | REACTOME ASSOCIATION OF TRIC CCT WITH TARGET PROTEINS DURING BIOSYNTHESIS | Genes involved in Association of TriC/CCT with target proteins during biosynthesis |
0.0 | 0.0 | REACTOME TRIGLYCERIDE BIOSYNTHESIS | Genes involved in Triglyceride Biosynthesis |
0.0 | 0.1 | REACTOME ADVANCED GLYCOSYLATION ENDPRODUCT RECEPTOR SIGNALING | Genes involved in Advanced glycosylation endproduct receptor signaling |