| Gene Symbol | Gene ID | Gene Info |
|---|---|---|
|
Arid5b
|
ENSMUSG00000019947.9 | AT rich interactive domain 5B (MRF1-like) |
| CRE | Gene | Distance | Association probability | Pearson corr. coef. | P-value | Plot |
|---|---|---|---|---|---|---|
| chr10_68125327_68125534 | Arid5b | 11196 | 0.248301 | 0.99 | 8.1e-05 | Click! |
| chr10_68134623_68135230 | Arid5b | 1700 | 0.465111 | 0.98 | 6.0e-04 | Click! |
| chr10_68263414_68263619 | Arid5b | 15205 | 0.220690 | -0.98 | 6.0e-04 | Click! |
| chr10_68125559_68125710 | Arid5b | 10992 | 0.248981 | 0.97 | 1.1e-03 | Click! |
| chr10_68283185_68283353 | Arid5b | 4529 | 0.244694 | -0.97 | 1.6e-03 | Click! |
Move your cursor over a bar to see sample name and corresponding Z-value.
| Cis Regulatory Element (CRE) | Target Score | Top associated gene | Gene Info | Distance of CRE to TSS | CRE/Gene association probability |
|---|---|---|---|---|---|
| chr12_104084891_104085073 | 4.05 |
Serpina4-ps1 |
serine (or cysteine) peptidase inhibitor, clade A, member 4, pseudogene 1 |
4333 |
0.12 |
| chr5_77314693_77314994 | 4.03 |
Gm42758 |
predicted gene 42758 |
3812 |
0.15 |
| chr2_5839502_5839908 | 3.97 |
Cdc123 |
cell division cycle 123 |
5146 |
0.16 |
| chr1_21260733_21261242 | 3.00 |
Gsta3 |
glutathione S-transferase, alpha 3 |
7466 |
0.11 |
| chr12_104345688_104345839 | 2.78 |
Serpina3k |
serine (or cysteine) peptidase inhibitor, clade A, member 3K |
7277 |
0.12 |
| chr9_48724021_48724519 | 2.67 |
Zbtb16 |
zinc finger and BTB domain containing 16 |
111675 |
0.06 |
| chr5_49060180_49060366 | 2.35 |
Gm43047 |
predicted gene 43047 |
9730 |
0.1 |
| chr19_44398583_44398737 | 2.32 |
Scd1 |
stearoyl-Coenzyme A desaturase 1 |
8030 |
0.15 |
| chr1_21263882_21264033 | 2.29 |
Gm28836 |
predicted gene 28836 |
7636 |
0.11 |
| chr8_3046150_3046544 | 2.18 |
Gm44634 |
predicted gene 44634 |
9947 |
0.2 |
| chr17_34855282_34855491 | 2.11 |
Nelfe |
negative elongation factor complex member E, Rdbp |
1130 |
0.17 |
| chr5_144941475_144941626 | 1.96 |
Smurf1 |
SMAD specific E3 ubiquitin protein ligase 1 |
24289 |
0.13 |
| chr6_31260055_31260233 | 1.89 |
2210408F21Rik |
RIKEN cDNA 2210408F21 gene |
17704 |
0.15 |
| chr9_46197938_46198202 | 1.83 |
Sik3 |
SIK family kinase 3 |
21501 |
0.1 |
| chr5_130017966_130018117 | 1.81 |
Asl |
argininosuccinate lyase |
3319 |
0.15 |
| chr5_101859462_101859644 | 1.81 |
Wdfy3 |
WD repeat and FYVE domain containing 3 |
8040 |
0.18 |
| chr18_55182860_55183019 | 1.77 |
Gm22597 |
predicted gene, 22597 |
3099 |
0.29 |
| chr11_120820263_120820477 | 1.77 |
Fasn |
fatty acid synthase |
3410 |
0.12 |
| chr2_5839169_5839320 | 1.72 |
Cdc123 |
cell division cycle 123 |
5566 |
0.16 |
| chr1_88122933_88123203 | 1.71 |
Gm15372 |
predicted gene 15372 |
3708 |
0.08 |
| chr8_93173439_93173590 | 1.70 |
Ces1d |
carboxylesterase 1D |
1775 |
0.27 |
| chr13_101685356_101685507 | 1.69 |
Pik3r1 |
phosphoinositide-3-kinase regulatory subunit 1 |
6912 |
0.24 |
| chr11_19991125_19991324 | 1.69 |
Spred2 |
sprouty-related EVH1 domain containing 2 |
36654 |
0.19 |
| chr12_104083020_104083260 | 1.68 |
Serpina4-ps1 |
serine (or cysteine) peptidase inhibitor, clade A, member 4, pseudogene 1 |
2491 |
0.16 |
| chr6_6243682_6243834 | 1.65 |
Gm20619 |
predicted gene 20619 |
4901 |
0.24 |
| chr15_3536892_3537043 | 1.65 |
Ghr |
growth hormone receptor |
44875 |
0.17 |
| chr11_16770578_16770859 | 1.62 |
Egfr |
epidermal growth factor receptor |
18488 |
0.19 |
| chr17_72829234_72829476 | 1.60 |
Ypel5 |
yippee like 5 |
7098 |
0.28 |
| chr2_67881464_67881701 | 1.59 |
Gm37964 |
predicted gene, 37964 |
17014 |
0.24 |
| chr9_35162145_35162296 | 1.55 |
Dcps |
decapping enzyme, scavenger |
13773 |
0.1 |
| chr8_94399242_94399642 | 1.54 |
Ap3s1-ps2 |
adaptor-related protein complex 3, sigma 1 subunit, pseudogene 2 |
5769 |
0.11 |
| chr11_50312756_50312907 | 1.54 |
Canx |
calnexin |
11841 |
0.12 |
| chr2_160362286_160362456 | 1.51 |
Mafb |
v-maf musculoaponeurotic fibrosarcoma oncogene family, protein B (avian) |
4694 |
0.28 |
| chr4_129332605_129332774 | 1.49 |
Rbbp4 |
retinoblastoma binding protein 4, chromatin remodeling factor |
1955 |
0.21 |
| chr1_97770980_97771325 | 1.46 |
Ppip5k2 |
diphosphoinositol pentakisphosphate kinase 2 |
741 |
0.49 |
| chr8_84761164_84761339 | 1.46 |
Nfix |
nuclear factor I/X |
12145 |
0.11 |
| chr1_162891903_162892071 | 1.44 |
Fmo2 |
flavin containing monooxygenase 2 |
5472 |
0.19 |
| chr19_44398143_44398357 | 1.43 |
Scd1 |
stearoyl-Coenzyme A desaturase 1 |
8440 |
0.15 |
| chr7_101085910_101086353 | 1.42 |
Fchsd2 |
FCH and double SH3 domains 2 |
6732 |
0.17 |
| chr18_9503676_9503906 | 1.40 |
Gm7527 |
predicted gene 7527 |
8170 |
0.15 |
| chr4_95640924_95641095 | 1.39 |
Fggy |
FGGY carbohydrate kinase domain containing |
4122 |
0.3 |
| chr12_104341895_104342090 | 1.39 |
Serpina3k |
serine (or cysteine) peptidase inhibitor, clade A, member 3K |
3506 |
0.14 |
| chr1_21246529_21246960 | 1.39 |
Gsta3 |
glutathione S-transferase, alpha 3 |
6115 |
0.12 |
| chr19_40184875_40185171 | 1.36 |
Cyp2c70 |
cytochrome P450, family 2, subfamily c, polypeptide 70 |
2263 |
0.24 |
| chr1_67205130_67205471 | 1.35 |
Gm15668 |
predicted gene 15668 |
43900 |
0.15 |
| chr7_99139312_99140124 | 1.33 |
Uvrag |
UV radiation resistance associated gene |
1400 |
0.28 |
| chr8_126424586_126424905 | 1.33 |
Coa6 |
cytochrome c oxidase assembly factor 6 |
2217 |
0.35 |
| chr5_114528485_114528658 | 1.32 |
Gm13790 |
predicted gene 13790 |
22718 |
0.14 |
| chr10_69214299_69214646 | 1.31 |
Rhobtb1 |
Rho-related BTB domain containing 1 |
830 |
0.51 |
| chr6_99280984_99281139 | 1.31 |
Foxp1 |
forkhead box P1 |
14529 |
0.27 |
| chr16_25221904_25222082 | 1.30 |
Tprg |
transformation related protein 63 regulated |
64824 |
0.14 |
| chr5_130025623_130025882 | 1.29 |
Asl |
argininosuccinate lyase |
733 |
0.53 |
| chr16_43321539_43321818 | 1.28 |
Gm15711 |
predicted gene 15711 |
9084 |
0.18 |
| chr12_104347211_104347391 | 1.27 |
Serpina3k |
serine (or cysteine) peptidase inhibitor, clade A, member 3K |
8815 |
0.12 |
| chr11_7816093_7816451 | 1.27 |
Gm27393 |
predicted gene, 27393 |
70233 |
0.13 |
| chr16_37902225_37902391 | 1.26 |
Gpr156 |
G protein-coupled receptor 156 |
14188 |
0.14 |
| chr3_149318468_149318647 | 1.26 |
Gm30382 |
predicted gene, 30382 |
5317 |
0.21 |
| chr6_71990061_71990254 | 1.25 |
Gm26628 |
predicted gene, 26628 |
26382 |
0.11 |
| chr3_51230467_51230865 | 1.25 |
Gm38357 |
predicted gene, 38357 |
1251 |
0.37 |
| chr17_28519046_28519420 | 1.25 |
Gm49861 |
predicted gene, 49861 |
775 |
0.35 |
| chr11_28689224_28689493 | 1.24 |
2810471M01Rik |
RIKEN cDNA 2810471M01 gene |
7794 |
0.19 |
| chr9_122864088_122864252 | 1.24 |
Zfp445 |
zinc finger protein 445 |
1764 |
0.21 |
| chr5_38117047_38117323 | 1.23 |
Stx18 |
syntaxin 18 |
3724 |
0.2 |
| chr5_36630320_36630829 | 1.23 |
D5Ertd579e |
DNA segment, Chr 5, ERATO Doi 579, expressed |
9319 |
0.13 |
| chr2_134928284_134928464 | 1.22 |
Gm14036 |
predicted gene 14036 |
124425 |
0.06 |
| chr15_62644818_62645021 | 1.22 |
Gm24810 |
predicted gene, 24810 |
8085 |
0.29 |
| chr14_64701102_64701308 | 1.21 |
Kif13b |
kinesin family member 13B |
48603 |
0.12 |
| chr11_16811935_16812291 | 1.21 |
Egfros |
epidermal growth factor receptor, opposite strand |
18589 |
0.2 |
| chr8_24397781_24398404 | 1.20 |
Gm30692 |
predicted gene, 30692 |
14087 |
0.15 |
| chr8_5030377_5030626 | 1.19 |
n-R5s93 |
nuclear encoded rRNA 5S 93 |
38876 |
0.14 |
| chr2_8124945_8125169 | 1.18 |
Gm13254 |
predicted gene 13254 |
22808 |
0.29 |
| chr2_90561333_90561502 | 1.18 |
Ptprj |
protein tyrosine phosphatase, receptor type, J |
19230 |
0.2 |
| chr3_149240996_149241147 | 1.16 |
Gm10287 |
predicted gene 10287 |
15326 |
0.2 |
| chr1_84057474_84057625 | 1.16 |
Pid1 |
phosphotyrosine interaction domain containing 1 |
4296 |
0.3 |
| chr10_67100073_67100416 | 1.14 |
Reep3 |
receptor accessory protein 3 |
3299 |
0.24 |
| chr7_16417815_16417966 | 1.14 |
Gm45510 |
predicted gene 45510 |
1269 |
0.27 |
| chr17_86772642_86772798 | 1.14 |
Gm50008 |
predicted gene, 50008 |
550 |
0.76 |
| chr7_98355809_98355960 | 1.13 |
Tsku |
tsukushi, small leucine rich proteoglycan |
4195 |
0.2 |
| chr17_71190976_71191127 | 1.12 |
Lpin2 |
lipin 2 |
7073 |
0.17 |
| chrX_140540252_140540544 | 1.12 |
Tsc22d3 |
TSC22 domain family, member 3 |
2270 |
0.32 |
| chr4_102558090_102558267 | 1.11 |
Pde4b |
phosphodiesterase 4B, cAMP specific |
11917 |
0.3 |
| chr4_144893643_144894186 | 1.11 |
Dhrs3 |
dehydrogenase/reductase (SDR family) member 3 |
695 |
0.72 |
| chr15_79682408_79682594 | 1.10 |
Gm49520 |
predicted gene, 49520 |
1179 |
0.26 |
| chr2_67724321_67724535 | 1.10 |
Gm13604 |
predicted gene 13604 |
16657 |
0.15 |
| chr17_12927616_12927852 | 1.10 |
Acat3 |
acetyl-Coenzyme A acetyltransferase 3 |
52 |
0.93 |
| chr6_149150480_149150842 | 1.09 |
Etfbkmt |
electron transfer flavoprotein beta subunit lysine methyltransferase |
9015 |
0.13 |
| chr11_16762531_16762682 | 1.08 |
Egfr |
epidermal growth factor receptor |
10376 |
0.2 |
| chr14_55724403_55725378 | 1.08 |
Rabggta |
Rab geranylgeranyl transferase, a subunit |
2627 |
0.1 |
| chr6_72359339_72359501 | 1.07 |
Rnf181 |
ring finger protein 181 |
1647 |
0.2 |
| chr1_136629198_136629381 | 1.07 |
Zfp281 |
zinc finger protein 281 |
4388 |
0.14 |
| chr1_21261382_21261702 | 1.07 |
Gsta3 |
glutathione S-transferase, alpha 3 |
8021 |
0.11 |
| chr16_26754580_26754747 | 1.07 |
Gm20319 |
predicted gene, 20319 |
828 |
0.71 |
| chr3_115819460_115819665 | 1.06 |
Dph5 |
diphthamide biosynthesis 5 |
68275 |
0.07 |
| chr10_67192820_67193057 | 1.06 |
Jmjd1c |
jumonji domain containing 1C |
7185 |
0.22 |
| chr8_110621328_110621479 | 1.05 |
Vac14 |
Vac14 homolog (S. cerevisiae) |
2791 |
0.29 |
| chr11_51765883_51766034 | 1.05 |
Sar1b |
secretion associated Ras related GTPase 1B |
2264 |
0.22 |
| chr11_73048007_73048735 | 1.05 |
Ncbp3 |
nuclear cap binding subunit 3 |
498 |
0.7 |
| chr10_86689713_86689885 | 1.04 |
Gm15344 |
predicted gene 15344 |
3296 |
0.09 |
| chr11_46695519_46695670 | 1.04 |
Timd2 |
T cell immunoglobulin and mucin domain containing 2 |
3368 |
0.19 |
| chr5_112277647_112277931 | 1.04 |
Tpst2 |
protein-tyrosine sulfotransferase 2 |
1082 |
0.38 |
| chr11_70982116_70982279 | 1.04 |
C1qbp |
complement component 1, q subcomponent binding protein |
810 |
0.43 |
| chr13_51089168_51089510 | 1.04 |
Spin1 |
spindlin 1 |
11541 |
0.24 |
| chr4_40734196_40734495 | 1.04 |
Dnaja1 |
DnaJ heat shock protein family (Hsp40) member A1 |
10296 |
0.11 |
| chr7_99175280_99175534 | 1.04 |
Dgat2 |
diacylglycerol O-acyltransferase 2 |
4886 |
0.15 |
| chr7_63680224_63680375 | 1.03 |
Otud7a |
OTU domain containing 7A |
29484 |
0.17 |
| chr5_36558638_36558805 | 1.03 |
Tbc1d14 |
TBC1 domain family, member 14 |
5335 |
0.18 |
| chr2_177902871_177903175 | 1.02 |
Gm14327 |
predicted gene 14327 |
1262 |
0.38 |
| chr3_21371390_21371542 | 1.02 |
Gm29137 |
predicted gene 29137 |
102376 |
0.08 |
| chr3_126668968_126669137 | 1.02 |
Gm15551 |
predicted gene 15551 |
8 |
0.96 |
| chr13_101936338_101936720 | 1.02 |
Gm17832 |
predicted gene, 17832 |
16109 |
0.24 |
| chr9_74893395_74893777 | 1.02 |
Onecut1 |
one cut domain, family member 1 |
27102 |
0.13 |
| chr7_87371791_87371944 | 1.02 |
Tyr |
tyrosinase |
121525 |
0.05 |
| chr12_34997914_34998088 | 1.02 |
Prps1l1 |
phosphoribosyl pyrophosphate synthetase 1-like 1 |
13240 |
0.2 |
| chr17_24868993_24869535 | 1.01 |
Igfals |
insulin-like growth factor binding protein, acid labile subunit |
3267 |
0.1 |
| chr1_130734318_130734676 | 1.00 |
AA986860 |
expressed sequence AA986860 |
2387 |
0.14 |
| chr2_147988968_147989235 | 1.00 |
9030622O22Rik |
RIKEN cDNA 9030622O22 gene |
12916 |
0.21 |
| chr2_177471886_177472177 | 1.00 |
Zfp970 |
zinc finger protein 970 |
7185 |
0.16 |
| chr6_28587807_28587958 | 0.99 |
Gm37978 |
predicted gene, 37978 |
19810 |
0.16 |
| chr11_120813788_120814608 | 0.99 |
Fasn |
fatty acid synthase |
1257 |
0.26 |
| chr13_24325258_24325614 | 0.99 |
Cmah |
cytidine monophospho-N-acetylneuraminic acid hydroxylase |
1968 |
0.19 |
| chr10_111367147_111367312 | 0.99 |
Gm40761 |
predicted gene, 40761 |
30105 |
0.16 |
| chr14_121934790_121934977 | 0.98 |
Ubac2 |
ubiquitin associated domain containing 2 |
11431 |
0.16 |
| chr10_87865511_87865999 | 0.98 |
Igf1os |
insulin-like growth factor 1, opposite strand |
2374 |
0.3 |
| chr3_9751433_9751584 | 0.98 |
Gm16337 |
predicted gene 16337 |
6099 |
0.23 |
| chr13_4203084_4203283 | 0.98 |
Akr1c13 |
aldo-keto reductase family 1, member C13 |
9325 |
0.13 |
| chr15_6709626_6709854 | 0.98 |
Rictor |
RPTOR independent companion of MTOR, complex 2 |
1357 |
0.47 |
| chr5_100419251_100419681 | 0.97 |
Sec31a |
Sec31 homolog A (S. cerevisiae) |
3232 |
0.18 |
| chr2_113503558_113503726 | 0.97 |
Gm13964 |
predicted gene 13964 |
392 |
0.86 |
| chr4_108038935_108039198 | 0.97 |
Gm23354 |
predicted gene, 23354 |
2734 |
0.18 |
| chr2_58768981_58769132 | 0.97 |
Upp2 |
uridine phosphorylase 2 |
3731 |
0.25 |
| chr4_33033624_33033916 | 0.96 |
Ube2j1 |
ubiquitin-conjugating enzyme E2J 1 |
2242 |
0.18 |
| chr6_15930296_15930597 | 0.96 |
Gm43990 |
predicted gene, 43990 |
94357 |
0.08 |
| chr5_90330910_90331061 | 0.96 |
Ankrd17 |
ankyrin repeat domain 17 |
8758 |
0.21 |
| chr2_128972020_128972207 | 0.96 |
Gm10762 |
predicted gene 10762 |
4069 |
0.12 |
| chr8_66861621_66861772 | 0.96 |
Naf1 |
nuclear assembly factor 1 ribonucleoprotein |
739 |
0.66 |
| chr10_89485404_89485555 | 0.96 |
Nr1h4 |
nuclear receptor subfamily 1, group H, member 4 |
21170 |
0.2 |
| chr19_39346810_39347020 | 0.96 |
Cyp2c72-ps |
cytochrome P450, family 2, subfamily c, polypeptide 72, pseudogene |
452 |
0.87 |
| chr15_81351393_81351548 | 0.95 |
Slc25a17 |
solute carrier family 25 (mitochondrial carrier, peroxisomal membrane protein), member 17 |
7313 |
0.15 |
| chr19_8139105_8139256 | 0.95 |
Slc22a28 |
solute carrier family 22, member 28 |
7198 |
0.21 |
| chr9_122148667_122148818 | 0.95 |
Gm47121 |
predicted gene, 47121 |
6293 |
0.13 |
| chr13_13609505_13609656 | 0.95 |
Lyst |
lysosomal trafficking regulator |
19171 |
0.2 |
| chr13_82200374_82200525 | 0.95 |
Gm48155 |
predicted gene, 48155 |
110692 |
0.07 |
| chr9_122848915_122849207 | 0.95 |
Gm47140 |
predicted gene, 47140 |
643 |
0.55 |
| chr10_69213758_69213931 | 0.95 |
Rhobtb1 |
Rho-related BTB domain containing 1 |
650 |
0.47 |
| chr13_48539306_48539474 | 0.95 |
Mirlet7a-1 |
microRNA let7a-1 |
1118 |
0.23 |
| chr9_106265745_106266139 | 0.95 |
Poc1a |
POC1 centriolar protein A |
15119 |
0.1 |
| chr6_100430446_100430622 | 0.95 |
Gm23234 |
predicted gene, 23234 |
64280 |
0.1 |
| chr8_105087916_105088199 | 0.94 |
Ces3b |
carboxylesterase 3B |
562 |
0.61 |
| chr3_60523656_60523949 | 0.94 |
Mbnl1 |
muscleblind like splicing factor 1 |
4326 |
0.25 |
| chr17_16950900_16951058 | 0.94 |
BC002059 |
cDNA sequence BC002059 |
560 |
0.8 |
| chr3_51238020_51238171 | 0.94 |
Noct |
nocturnin |
2111 |
0.23 |
| chr3_130634058_130634674 | 0.94 |
Etnppl |
ethanolamine phosphate phospholyase |
7846 |
0.17 |
| chr17_81385422_81385814 | 0.93 |
Gm50044 |
predicted gene, 50044 |
14785 |
0.24 |
| chr4_48271806_48271957 | 0.93 |
Erp44 |
endoplasmic reticulum protein 44 |
7571 |
0.2 |
| chr12_102327592_102327745 | 0.93 |
Rin3 |
Ras and Rab interactor 3 |
27077 |
0.18 |
| chr16_30262069_30262220 | 0.93 |
Cpn2 |
carboxypeptidase N, polypeptide 2 |
5355 |
0.15 |
| chr7_63903236_63903698 | 0.93 |
Gm27252 |
predicted gene 27252 |
5493 |
0.15 |
| chr2_31519719_31520357 | 0.93 |
Ass1 |
argininosuccinate synthetase 1 |
1548 |
0.36 |
| chr7_119960819_119960970 | 0.92 |
Dnah3 |
dynein, axonemal, heavy chain 3 |
6948 |
0.16 |
| chr10_127412071_127412654 | 0.92 |
Gm23819 |
predicted gene, 23819 |
7970 |
0.11 |
| chr15_56746775_56746946 | 0.92 |
Has2os |
hyaluronan synthase 2, opposite strand |
18600 |
0.21 |
| chr11_16848480_16848912 | 0.92 |
Egfros |
epidermal growth factor receptor, opposite strand |
17994 |
0.19 |
| chr1_151121601_151121803 | 0.92 |
Gm19087 |
predicted gene, 19087 |
13787 |
0.12 |
| chr14_21106159_21106317 | 0.92 |
Adk |
adenosine kinase |
30086 |
0.19 |
| chr8_26351792_26351988 | 0.92 |
Gm31784 |
predicted gene, 31784 |
39556 |
0.12 |
| chr3_85271874_85272035 | 0.92 |
1700036G14Rik |
RIKEN cDNA 1700036G14 gene |
45565 |
0.16 |
| chr15_3425583_3425780 | 0.92 |
Ghr |
growth hormone receptor |
45963 |
0.17 |
| chr4_131882434_131882585 | 0.91 |
Srsf4 |
serine and arginine-rich splicing factor 4 |
1786 |
0.21 |
| chr10_68092838_68093042 | 0.91 |
Arid5b |
AT rich interactive domain 5B (MRF1-like) |
43686 |
0.14 |
| chr16_96362087_96362478 | 0.91 |
Igsf5 |
immunoglobulin superfamily, member 5 |
488 |
0.45 |
| chr15_7175278_7175429 | 0.91 |
Lifr |
LIF receptor alpha |
21000 |
0.23 |
| chr1_45907829_45907980 | 0.91 |
Gm18303 |
predicted gene, 18303 |
2281 |
0.22 |
| chr12_104342354_104343298 | 0.91 |
Serpina3k |
serine (or cysteine) peptidase inhibitor, clade A, member 3K |
4340 |
0.13 |
| chr13_4270977_4271134 | 0.90 |
Akr1c12 |
aldo-keto reductase family 1, member C12 |
8378 |
0.15 |
| chr2_72151628_72151779 | 0.90 |
Rapgef4os1 |
Rap guanine nucleotide exchange factor (GEF) 4, opposite strand 1 |
2907 |
0.27 |
| chr19_34328198_34328384 | 0.90 |
Fas |
Fas (TNF receptor superfamily member 6) |
28216 |
0.14 |
| chr2_58792449_58792713 | 0.90 |
Upp2 |
uridine phosphorylase 2 |
27256 |
0.17 |
| chrX_129413614_129413812 | 0.90 |
Gm14986 |
predicted gene 14986 |
104813 |
0.07 |
| chr9_122125893_122126094 | 0.89 |
4632418H02Rik |
RIKEN cDNA 4632418H02 gene |
1301 |
0.32 |
| chr9_55322341_55322520 | 0.89 |
Nrg4 |
neuregulin 4 |
2757 |
0.24 |
| chr9_74884159_74884330 | 0.89 |
Onecut1 |
one cut domain, family member 1 |
17760 |
0.15 |
| chr18_31704198_31704968 | 0.89 |
Gm50060 |
predicted gene, 50060 |
34132 |
0.13 |
| chr2_77155937_77156088 | 0.89 |
Ccdc141 |
coiled-coil domain containing 141 |
14564 |
0.21 |
| chr18_39437876_39438027 | 0.89 |
Gm15337 |
predicted gene 15337 |
48526 |
0.13 |
| chr3_121808114_121808423 | 0.89 |
Abcd3 |
ATP-binding cassette, sub-family D (ALD), member 3 |
6641 |
0.13 |
| chr16_26563195_26563349 | 0.89 |
Il1rap |
interleukin 1 receptor accessory protein |
18432 |
0.23 |
| chr5_29195067_29195459 | 0.89 |
Rnf32 |
ring finger protein 32 |
729 |
0.71 |
| chr4_53218925_53219106 | 0.89 |
4930412L05Rik |
RIKEN cDNA 4930412L05 gene |
1158 |
0.48 |
| chr11_16850729_16850984 | 0.88 |
Egfros |
epidermal growth factor receptor, opposite strand |
20154 |
0.18 |
| chr14_70701538_70701706 | 0.88 |
Xpo7 |
exportin 7 |
6413 |
0.16 |
| chrX_142478453_142478626 | 0.88 |
Gm25915 |
predicted gene, 25915 |
6908 |
0.19 |
| chr14_25508473_25508633 | 0.88 |
Zmiz1 |
zinc finger, MIZ-type containing 1 |
5898 |
0.16 |
| chr3_116513691_116513879 | 0.87 |
Dbt |
dihydrolipoamide branched chain transacylase E2 |
657 |
0.53 |
| chr19_8412223_8412408 | 0.87 |
Slc22a30 |
solute carrier family 22, member 30 |
7204 |
0.21 |
| chr11_16860736_16860887 | 0.87 |
Egfr |
epidermal growth factor receptor |
17339 |
0.19 |
| chr13_16761081_16761364 | 0.87 |
Gm7537 |
predicted gene 7537 |
121732 |
0.06 |
| chr8_35390018_35390398 | 0.87 |
Ppp1r3b |
protein phosphatase 1, regulatory subunit 3B |
13548 |
0.15 |
| chr18_76245200_76245359 | 0.86 |
Smad2 |
SMAD family member 2 |
3105 |
0.24 |
| chr3_138444072_138444223 | 0.86 |
Adh5 |
alcohol dehydrogenase 5 (class III), chi polypeptide |
966 |
0.45 |
| chr17_5178098_5178428 | 0.86 |
Gm15599 |
predicted gene 15599 |
66153 |
0.13 |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 1.1 | 3.3 | GO:1903800 | positive regulation of production of miRNAs involved in gene silencing by miRNA(GO:1903800) |
| 0.8 | 4.6 | GO:0006526 | arginine biosynthetic process(GO:0006526) |
| 0.6 | 1.9 | GO:0019626 | short-chain fatty acid catabolic process(GO:0019626) |
| 0.4 | 0.9 | GO:0019676 | ammonia assimilation cycle(GO:0019676) |
| 0.4 | 1.7 | GO:0072338 | creatinine metabolic process(GO:0046449) cellular lactam metabolic process(GO:0072338) |
| 0.4 | 1.3 | GO:1901078 | negative regulation of relaxation of muscle(GO:1901078) |
| 0.4 | 1.6 | GO:2001013 | epithelial cell proliferation involved in renal tubule morphogenesis(GO:2001013) |
| 0.4 | 1.1 | GO:0006701 | progesterone biosynthetic process(GO:0006701) |
| 0.4 | 1.1 | GO:0032474 | otolith morphogenesis(GO:0032474) |
| 0.4 | 1.1 | GO:0043490 | malate-aspartate shuttle(GO:0043490) |
| 0.4 | 1.1 | GO:0001732 | formation of cytoplasmic translation initiation complex(GO:0001732) |
| 0.4 | 1.8 | GO:0009202 | deoxyribonucleoside triphosphate biosynthetic process(GO:0009202) |
| 0.3 | 1.4 | GO:1903964 | monounsaturated fatty acid metabolic process(GO:1903964) monounsaturated fatty acid biosynthetic process(GO:1903966) |
| 0.3 | 1.0 | GO:0002282 | microglial cell activation involved in immune response(GO:0002282) |
| 0.3 | 1.0 | GO:0006068 | ethanol catabolic process(GO:0006068) |
| 0.3 | 1.0 | GO:0060468 | prevention of polyspermy(GO:0060468) |
| 0.3 | 1.3 | GO:0006537 | glutamate biosynthetic process(GO:0006537) |
| 0.3 | 0.6 | GO:1904192 | cholangiocyte apoptotic process(GO:1902488) regulation of cholangiocyte apoptotic process(GO:1904192) negative regulation of cholangiocyte apoptotic process(GO:1904193) |
| 0.3 | 0.9 | GO:0070346 | positive regulation of fat cell proliferation(GO:0070346) |
| 0.3 | 3.1 | GO:0009404 | toxin metabolic process(GO:0009404) |
| 0.3 | 0.8 | GO:1900169 | regulation of glucocorticoid mediated signaling pathway(GO:1900169) |
| 0.3 | 0.8 | GO:0035284 | central nervous system segmentation(GO:0035283) brain segmentation(GO:0035284) |
| 0.3 | 1.8 | GO:0097105 | presynaptic membrane assembly(GO:0097105) |
| 0.2 | 1.5 | GO:0030638 | polyketide metabolic process(GO:0030638) aminoglycoside antibiotic metabolic process(GO:0030647) daunorubicin metabolic process(GO:0044597) doxorubicin metabolic process(GO:0044598) |
| 0.2 | 1.2 | GO:0072602 | interleukin-4 secretion(GO:0072602) |
| 0.2 | 0.7 | GO:0089700 | protein kinase D signaling(GO:0089700) |
| 0.2 | 0.7 | GO:0055099 | response to high density lipoprotein particle(GO:0055099) |
| 0.2 | 2.1 | GO:0052697 | xenobiotic glucuronidation(GO:0052697) |
| 0.2 | 0.5 | GO:2000611 | positive regulation of thyroid hormone generation(GO:2000611) |
| 0.2 | 0.9 | GO:0003383 | apical constriction(GO:0003383) |
| 0.2 | 0.7 | GO:0051594 | detection of carbohydrate stimulus(GO:0009730) detection of hexose stimulus(GO:0009732) detection of monosaccharide stimulus(GO:0034287) detection of glucose(GO:0051594) |
| 0.2 | 1.1 | GO:0050882 | voluntary musculoskeletal movement(GO:0050882) |
| 0.2 | 0.2 | GO:0034310 | primary alcohol catabolic process(GO:0034310) |
| 0.2 | 0.6 | GO:0016554 | cytidine to uridine editing(GO:0016554) |
| 0.2 | 0.6 | GO:1901165 | positive regulation of trophoblast cell migration(GO:1901165) |
| 0.2 | 0.6 | GO:1903659 | regulation of complement-dependent cytotoxicity(GO:1903659) negative regulation of complement-dependent cytotoxicity(GO:1903660) |
| 0.2 | 0.8 | GO:0060528 | secretory columnal luminar epithelial cell differentiation involved in prostate glandular acinus development(GO:0060528) |
| 0.2 | 0.6 | GO:0097680 | double-strand break repair via classical nonhomologous end joining(GO:0097680) |
| 0.2 | 0.2 | GO:0042851 | L-alanine metabolic process(GO:0042851) |
| 0.2 | 0.8 | GO:0090219 | negative regulation of lipid kinase activity(GO:0090219) |
| 0.2 | 0.8 | GO:0061073 | ciliary body morphogenesis(GO:0061073) |
| 0.2 | 0.7 | GO:0006987 | activation of signaling protein activity involved in unfolded protein response(GO:0006987) |
| 0.2 | 0.4 | GO:0003162 | atrioventricular node development(GO:0003162) |
| 0.2 | 0.5 | GO:0032483 | regulation of Rab protein signal transduction(GO:0032483) |
| 0.2 | 0.3 | GO:1901097 | negative regulation of autophagosome maturation(GO:1901097) |
| 0.2 | 0.7 | GO:0060956 | endocardial cell differentiation(GO:0060956) |
| 0.2 | 0.5 | GO:1903690 | negative regulation of wound healing, spreading of epidermal cells(GO:1903690) |
| 0.2 | 0.5 | GO:0061470 | T follicular helper cell differentiation(GO:0061470) |
| 0.2 | 0.5 | GO:0060523 | prostate epithelial cord elongation(GO:0060523) |
| 0.2 | 0.7 | GO:1902953 | positive regulation of ER to Golgi vesicle-mediated transport(GO:1902953) |
| 0.2 | 0.5 | GO:0046487 | glyoxylate metabolic process(GO:0046487) |
| 0.2 | 0.5 | GO:0031087 | nuclear-transcribed mRNA catabolic process, deadenylation-independent decay(GO:0031086) deadenylation-independent decapping of nuclear-transcribed mRNA(GO:0031087) |
| 0.2 | 0.5 | GO:1903334 | positive regulation of protein folding(GO:1903334) |
| 0.2 | 0.5 | GO:0042998 | positive regulation of Golgi to plasma membrane protein transport(GO:0042998) |
| 0.2 | 0.8 | GO:0031293 | membrane protein intracellular domain proteolysis(GO:0031293) |
| 0.2 | 1.1 | GO:1900103 | positive regulation of endoplasmic reticulum unfolded protein response(GO:1900103) |
| 0.2 | 1.0 | GO:0015074 | DNA integration(GO:0015074) |
| 0.2 | 1.0 | GO:0071763 | nuclear membrane organization(GO:0071763) |
| 0.2 | 0.5 | GO:2000370 | positive regulation of clathrin-mediated endocytosis(GO:2000370) |
| 0.2 | 0.6 | GO:0061641 | CENP-A containing nucleosome assembly(GO:0034080) CENP-A containing chromatin organization(GO:0061641) |
| 0.2 | 0.9 | GO:0070857 | regulation of bile acid biosynthetic process(GO:0070857) |
| 0.2 | 0.8 | GO:0070236 | negative regulation of activation-induced cell death of T cells(GO:0070236) |
| 0.2 | 0.5 | GO:0006015 | 5-phosphoribose 1-diphosphate biosynthetic process(GO:0006015) 5-phosphoribose 1-diphosphate metabolic process(GO:0046391) |
| 0.2 | 0.3 | GO:0048865 | stem cell fate commitment(GO:0048865) |
| 0.1 | 0.7 | GO:0045719 | negative regulation of glycogen biosynthetic process(GO:0045719) |
| 0.1 | 0.3 | GO:2000809 | positive regulation of synaptic vesicle clustering(GO:2000809) |
| 0.1 | 0.4 | GO:0006553 | lysine metabolic process(GO:0006553) |
| 0.1 | 1.2 | GO:0009191 | ribonucleoside diphosphate catabolic process(GO:0009191) |
| 0.1 | 0.7 | GO:0000395 | mRNA 5'-splice site recognition(GO:0000395) |
| 0.1 | 0.6 | GO:0018406 | protein C-linked glycosylation(GO:0018103) peptidyl-tryptophan modification(GO:0018211) protein C-linked glycosylation via tryptophan(GO:0018317) protein C-linked glycosylation via 2'-alpha-mannosyl-L-tryptophan(GO:0018406) |
| 0.1 | 0.4 | GO:1904016 | response to Thyroglobulin triiodothyronine(GO:1904016) cellular response to Thyroglobulin triiodothyronine(GO:1904017) |
| 0.1 | 0.4 | GO:0003062 | regulation of heart rate by chemical signal(GO:0003062) |
| 0.1 | 0.6 | GO:0016553 | base conversion or substitution editing(GO:0016553) |
| 0.1 | 0.3 | GO:0002439 | chronic inflammatory response to antigenic stimulus(GO:0002439) |
| 0.1 | 0.4 | GO:0016237 | lysosomal microautophagy(GO:0016237) piecemeal microautophagy of nucleus(GO:0034727) late nucleophagy(GO:0044805) |
| 0.1 | 0.9 | GO:0046146 | tetrahydrobiopterin metabolic process(GO:0046146) |
| 0.1 | 0.1 | GO:0046490 | isopentenyl diphosphate metabolic process(GO:0046490) |
| 0.1 | 0.4 | GO:0021823 | cerebral cortex tangential migration using cell-cell interactions(GO:0021823) postnatal olfactory bulb interneuron migration(GO:0021827) |
| 0.1 | 0.3 | GO:0048696 | regulation of collateral sprouting in absence of injury(GO:0048696) |
| 0.1 | 0.4 | GO:0071926 | cannabinoid signaling pathway(GO:0038171) endocannabinoid signaling pathway(GO:0071926) |
| 0.1 | 0.4 | GO:0070947 | neutrophil mediated killing of fungus(GO:0070947) |
| 0.1 | 0.5 | GO:0032819 | positive regulation of natural killer cell proliferation(GO:0032819) |
| 0.1 | 0.5 | GO:0044704 | single-organism reproductive behavior(GO:0044704) |
| 0.1 | 0.5 | GO:0030035 | microspike assembly(GO:0030035) |
| 0.1 | 0.4 | GO:0060300 | regulation of cytokine activity(GO:0060300) |
| 0.1 | 0.1 | GO:0060125 | negative regulation of growth hormone secretion(GO:0060125) |
| 0.1 | 0.1 | GO:0070672 | response to interleukin-15(GO:0070672) |
| 0.1 | 0.7 | GO:0097411 | hypoxia-inducible factor-1alpha signaling pathway(GO:0097411) |
| 0.1 | 0.4 | GO:0015014 | heparan sulfate proteoglycan biosynthetic process, polysaccharide chain biosynthetic process(GO:0015014) |
| 0.1 | 0.1 | GO:0070343 | white fat cell proliferation(GO:0070343) regulation of white fat cell proliferation(GO:0070350) |
| 0.1 | 0.4 | GO:0015747 | urate transport(GO:0015747) |
| 0.1 | 0.7 | GO:0010572 | positive regulation of platelet activation(GO:0010572) |
| 0.1 | 0.6 | GO:0035356 | cellular triglyceride homeostasis(GO:0035356) |
| 0.1 | 0.4 | GO:0017187 | peptidyl-glutamic acid carboxylation(GO:0017187) |
| 0.1 | 0.6 | GO:0015722 | canalicular bile acid transport(GO:0015722) |
| 0.1 | 0.1 | GO:1990705 | cholangiocyte proliferation(GO:1990705) |
| 0.1 | 0.6 | GO:0090188 | negative regulation of pancreatic juice secretion(GO:0090188) |
| 0.1 | 0.2 | GO:0035511 | oxidative DNA demethylation(GO:0035511) |
| 0.1 | 0.3 | GO:1901301 | regulation of cargo loading into COPII-coated vesicle(GO:1901301) |
| 0.1 | 0.2 | GO:0072361 | regulation of glycolytic process by regulation of transcription from RNA polymerase II promoter(GO:0072361) |
| 0.1 | 0.3 | GO:0007084 | mitotic nuclear envelope reassembly(GO:0007084) |
| 0.1 | 0.1 | GO:0006067 | ethanol metabolic process(GO:0006067) ethanol oxidation(GO:0006069) |
| 0.1 | 0.6 | GO:0045359 | positive regulation of interferon-beta biosynthetic process(GO:0045359) |
| 0.1 | 0.4 | GO:0035627 | ceramide transport(GO:0035627) |
| 0.1 | 0.3 | GO:0035459 | cargo loading into vesicle(GO:0035459) |
| 0.1 | 0.8 | GO:0021942 | radial glia guided migration of Purkinje cell(GO:0021942) |
| 0.1 | 0.4 | GO:0007621 | negative regulation of female receptivity(GO:0007621) |
| 0.1 | 1.1 | GO:0006699 | bile acid biosynthetic process(GO:0006699) |
| 0.1 | 0.4 | GO:0042518 | negative regulation of tyrosine phosphorylation of Stat3 protein(GO:0042518) |
| 0.1 | 0.3 | GO:0009957 | epidermal cell fate specification(GO:0009957) |
| 0.1 | 1.2 | GO:0045738 | negative regulation of DNA repair(GO:0045738) |
| 0.1 | 0.2 | GO:0035790 | platelet-derived growth factor receptor-alpha signaling pathway(GO:0035790) |
| 0.1 | 0.1 | GO:0070973 | protein localization to endoplasmic reticulum exit site(GO:0070973) |
| 0.1 | 0.4 | GO:0046959 | habituation(GO:0046959) |
| 0.1 | 0.7 | GO:0006370 | 7-methylguanosine mRNA capping(GO:0006370) |
| 0.1 | 0.3 | GO:1990928 | response to amino acid starvation(GO:1990928) |
| 0.1 | 0.2 | GO:0070447 | positive regulation of oligodendrocyte progenitor proliferation(GO:0070447) |
| 0.1 | 0.3 | GO:0030210 | heparin biosynthetic process(GO:0030210) |
| 0.1 | 0.2 | GO:2000670 | positive regulation of dendritic cell apoptotic process(GO:2000670) |
| 0.1 | 0.5 | GO:0006901 | vesicle coating(GO:0006901) |
| 0.1 | 0.3 | GO:2000259 | positive regulation of complement activation(GO:0045917) positive regulation of protein activation cascade(GO:2000259) |
| 0.1 | 0.3 | GO:0002036 | regulation of L-glutamate transport(GO:0002036) |
| 0.1 | 0.3 | GO:0000733 | DNA strand renaturation(GO:0000733) |
| 0.1 | 0.2 | GO:1902965 | regulation of protein localization to early endosome(GO:1902965) positive regulation of protein localization to early endosome(GO:1902966) |
| 0.1 | 0.2 | GO:0071394 | cellular response to testosterone stimulus(GO:0071394) |
| 0.1 | 0.3 | GO:0033092 | positive regulation of immature T cell proliferation in thymus(GO:0033092) |
| 0.1 | 0.5 | GO:0045647 | negative regulation of erythrocyte differentiation(GO:0045647) |
| 0.1 | 0.8 | GO:0048387 | negative regulation of retinoic acid receptor signaling pathway(GO:0048387) |
| 0.1 | 0.6 | GO:0033211 | adiponectin-activated signaling pathway(GO:0033211) |
| 0.1 | 0.3 | GO:1900041 | negative regulation of interleukin-2 secretion(GO:1900041) |
| 0.1 | 0.3 | GO:0035973 | aggrephagy(GO:0035973) |
| 0.1 | 0.2 | GO:1904339 | negative regulation of dopaminergic neuron differentiation(GO:1904339) |
| 0.1 | 0.2 | GO:2000302 | positive regulation of synaptic vesicle exocytosis(GO:2000302) |
| 0.1 | 0.2 | GO:0072553 | terminal button organization(GO:0072553) |
| 0.1 | 0.6 | GO:0001547 | antral ovarian follicle growth(GO:0001547) |
| 0.1 | 0.1 | GO:1903689 | regulation of wound healing, spreading of epidermal cells(GO:1903689) |
| 0.1 | 0.1 | GO:0072364 | regulation of cellular ketone metabolic process by regulation of transcription from RNA polymerase II promoter(GO:0072364) |
| 0.1 | 0.5 | GO:0031585 | regulation of inositol 1,4,5-trisphosphate-sensitive calcium-release channel activity(GO:0031585) |
| 0.1 | 0.2 | GO:0031296 | B cell costimulation(GO:0031296) |
| 0.1 | 0.3 | GO:0000715 | nucleotide-excision repair, DNA damage recognition(GO:0000715) |
| 0.1 | 0.5 | GO:0042078 | germ-line stem cell division(GO:0042078) male germ-line stem cell asymmetric division(GO:0048133) germline stem cell asymmetric division(GO:0098728) |
| 0.1 | 0.2 | GO:0043651 | linoleic acid metabolic process(GO:0043651) |
| 0.1 | 0.4 | GO:0015819 | lysine transport(GO:0015819) |
| 0.1 | 0.3 | GO:0015766 | disaccharide transport(GO:0015766) sucrose transport(GO:0015770) oligosaccharide transport(GO:0015772) |
| 0.1 | 0.9 | GO:0070050 | neuron cellular homeostasis(GO:0070050) |
| 0.1 | 0.5 | GO:0042866 | pyruvate biosynthetic process(GO:0042866) |
| 0.1 | 0.3 | GO:0014835 | myoblast differentiation involved in skeletal muscle regeneration(GO:0014835) |
| 0.1 | 0.2 | GO:0046098 | guanine metabolic process(GO:0046098) |
| 0.1 | 2.5 | GO:0019373 | epoxygenase P450 pathway(GO:0019373) |
| 0.1 | 0.4 | GO:0090527 | actin filament reorganization(GO:0090527) |
| 0.1 | 0.3 | GO:0006982 | response to lipid hydroperoxide(GO:0006982) |
| 0.1 | 0.4 | GO:0042448 | progesterone metabolic process(GO:0042448) |
| 0.1 | 0.2 | GO:0003406 | retinal pigment epithelium development(GO:0003406) |
| 0.1 | 0.4 | GO:0006627 | protein processing involved in protein targeting to mitochondrion(GO:0006627) |
| 0.1 | 0.3 | GO:0030950 | establishment or maintenance of actin cytoskeleton polarity(GO:0030950) |
| 0.1 | 0.3 | GO:0035887 | aortic smooth muscle cell differentiation(GO:0035887) |
| 0.1 | 0.3 | GO:1900095 | regulation of dosage compensation by inactivation of X chromosome(GO:1900095) |
| 0.1 | 0.3 | GO:0043321 | regulation of natural killer cell degranulation(GO:0043321) |
| 0.1 | 1.2 | GO:0015693 | magnesium ion transport(GO:0015693) |
| 0.1 | 0.2 | GO:1904380 | endoplasmic reticulum mannose trimming(GO:1904380) |
| 0.1 | 0.2 | GO:2000609 | regulation of thyroid hormone generation(GO:2000609) |
| 0.1 | 0.4 | GO:0031053 | primary miRNA processing(GO:0031053) |
| 0.1 | 0.6 | GO:0045721 | negative regulation of gluconeogenesis(GO:0045721) |
| 0.1 | 0.1 | GO:0048312 | intracellular distribution of mitochondria(GO:0048312) |
| 0.1 | 0.4 | GO:0031999 | negative regulation of fatty acid beta-oxidation(GO:0031999) |
| 0.1 | 0.6 | GO:0010801 | negative regulation of peptidyl-threonine phosphorylation(GO:0010801) |
| 0.1 | 0.2 | GO:1990168 | protein K29-linked deubiquitination(GO:0035523) protein K33-linked deubiquitination(GO:1990168) |
| 0.1 | 0.8 | GO:0070933 | histone H4 deacetylation(GO:0070933) |
| 0.1 | 1.4 | GO:0015985 | energy coupled proton transport, down electrochemical gradient(GO:0015985) ATP synthesis coupled proton transport(GO:0015986) |
| 0.1 | 0.1 | GO:0045764 | positive regulation of cellular amino acid metabolic process(GO:0045764) |
| 0.1 | 0.6 | GO:0021684 | cerebellar granular layer formation(GO:0021684) cerebellar granule cell differentiation(GO:0021707) |
| 0.1 | 0.8 | GO:0006957 | complement activation, alternative pathway(GO:0006957) |
| 0.1 | 0.1 | GO:1900157 | regulation of bone mineralization involved in bone maturation(GO:1900157) |
| 0.1 | 0.3 | GO:0010288 | response to lead ion(GO:0010288) |
| 0.1 | 0.5 | GO:0070493 | thrombin receptor signaling pathway(GO:0070493) |
| 0.1 | 1.1 | GO:0099517 | anterograde synaptic vesicle transport(GO:0048490) synaptic vesicle cytoskeletal transport(GO:0099514) synaptic vesicle transport along microtubule(GO:0099517) |
| 0.1 | 0.2 | GO:1904694 | negative regulation of vascular smooth muscle contraction(GO:1904694) |
| 0.1 | 0.2 | GO:0010387 | COP9 signalosome assembly(GO:0010387) |
| 0.1 | 0.2 | GO:1903223 | positive regulation of oxidative stress-induced neuron death(GO:1903223) |
| 0.1 | 0.9 | GO:0006120 | mitochondrial electron transport, NADH to ubiquinone(GO:0006120) |
| 0.1 | 0.2 | GO:0009169 | ribonucleoside monophosphate catabolic process(GO:0009158) purine ribonucleoside monophosphate catabolic process(GO:0009169) |
| 0.1 | 0.6 | GO:0000290 | deadenylation-dependent decapping of nuclear-transcribed mRNA(GO:0000290) |
| 0.1 | 0.3 | GO:2000002 | negative regulation of DNA damage checkpoint(GO:2000002) |
| 0.1 | 0.1 | GO:2000828 | regulation of parathyroid hormone secretion(GO:2000828) |
| 0.1 | 0.4 | GO:0045714 | regulation of low-density lipoprotein particle receptor biosynthetic process(GO:0045714) |
| 0.1 | 0.1 | GO:0044034 | negative stranded viral RNA replication(GO:0039689) multi-organism biosynthetic process(GO:0044034) |
| 0.1 | 0.2 | GO:0061535 | glutamate secretion, neurotransmission(GO:0061535) |
| 0.1 | 0.3 | GO:0038165 | oncostatin-M-mediated signaling pathway(GO:0038165) |
| 0.1 | 0.2 | GO:0034421 | post-translational protein acetylation(GO:0034421) |
| 0.1 | 1.6 | GO:0006084 | acetyl-CoA metabolic process(GO:0006084) |
| 0.1 | 0.1 | GO:0000720 | pyrimidine dimer repair by nucleotide-excision repair(GO:0000720) |
| 0.1 | 0.1 | GO:0034137 | positive regulation of toll-like receptor 2 signaling pathway(GO:0034137) |
| 0.1 | 0.3 | GO:1900086 | positive regulation of peptidyl-tyrosine autophosphorylation(GO:1900086) |
| 0.1 | 0.5 | GO:0006569 | tryptophan catabolic process(GO:0006569) tryptophan catabolic process to kynurenine(GO:0019441) indole-containing compound catabolic process(GO:0042436) indolalkylamine catabolic process(GO:0046218) |
| 0.1 | 0.4 | GO:0070389 | chaperone cofactor-dependent protein refolding(GO:0070389) |
| 0.1 | 0.4 | GO:0015867 | ATP transport(GO:0015867) |
| 0.1 | 0.2 | GO:0045875 | negative regulation of sister chromatid cohesion(GO:0045875) |
| 0.1 | 0.4 | GO:0042760 | very long-chain fatty acid catabolic process(GO:0042760) |
| 0.1 | 0.2 | GO:0010040 | response to iron(II) ion(GO:0010040) |
| 0.1 | 0.3 | GO:0035405 | histone-threonine phosphorylation(GO:0035405) |
| 0.1 | 0.1 | GO:0048807 | female genitalia morphogenesis(GO:0048807) |
| 0.1 | 0.4 | GO:0090209 | negative regulation of triglyceride metabolic process(GO:0090209) |
| 0.1 | 0.2 | GO:2000870 | regulation of progesterone secretion(GO:2000870) |
| 0.1 | 0.1 | GO:0007597 | blood coagulation, intrinsic pathway(GO:0007597) |
| 0.1 | 0.2 | GO:0007296 | vitellogenesis(GO:0007296) |
| 0.1 | 0.4 | GO:0051770 | positive regulation of nitric-oxide synthase biosynthetic process(GO:0051770) |
| 0.1 | 0.3 | GO:0051964 | negative regulation of synapse assembly(GO:0051964) |
| 0.1 | 1.5 | GO:0032728 | positive regulation of interferon-beta production(GO:0032728) |
| 0.1 | 0.2 | GO:0042276 | error-prone translesion synthesis(GO:0042276) |
| 0.1 | 1.0 | GO:0019184 | nonribosomal peptide biosynthetic process(GO:0019184) |
| 0.1 | 0.1 | GO:0060339 | negative regulation of type I interferon-mediated signaling pathway(GO:0060339) |
| 0.1 | 0.1 | GO:1901740 | negative regulation of myoblast fusion(GO:1901740) |
| 0.1 | 0.2 | GO:0002069 | columnar/cuboidal epithelial cell maturation(GO:0002069) glandular epithelial cell maturation(GO:0002071) |
| 0.1 | 0.4 | GO:0045040 | protein import into mitochondrial outer membrane(GO:0045040) |
| 0.1 | 0.3 | GO:0032237 | activation of store-operated calcium channel activity(GO:0032237) |
| 0.1 | 0.1 | GO:0010909 | regulation of heparan sulfate proteoglycan biosynthetic process(GO:0010908) positive regulation of heparan sulfate proteoglycan biosynthetic process(GO:0010909) positive regulation of proteoglycan biosynthetic process(GO:1902730) |
| 0.1 | 0.2 | GO:0090206 | negative regulation of cholesterol biosynthetic process(GO:0045541) negative regulation of cholesterol metabolic process(GO:0090206) |
| 0.1 | 0.5 | GO:1900364 | negative regulation of mRNA polyadenylation(GO:1900364) |
| 0.1 | 0.2 | GO:1903232 | melanosome assembly(GO:1903232) |
| 0.1 | 0.3 | GO:1900127 | positive regulation of hyaluronan biosynthetic process(GO:1900127) |
| 0.1 | 0.1 | GO:0038027 | apolipoprotein A-I-mediated signaling pathway(GO:0038027) |
| 0.1 | 0.6 | GO:0032438 | melanosome organization(GO:0032438) |
| 0.1 | 0.1 | GO:0044314 | protein K27-linked ubiquitination(GO:0044314) |
| 0.1 | 0.3 | GO:0007440 | foregut morphogenesis(GO:0007440) embryonic foregut morphogenesis(GO:0048617) |
| 0.1 | 0.1 | GO:1903753 | negative regulation of p38MAPK cascade(GO:1903753) |
| 0.1 | 0.3 | GO:0048478 | replication fork protection(GO:0048478) |
| 0.1 | 0.1 | GO:0009182 | purine deoxyribonucleoside diphosphate metabolic process(GO:0009182) dGDP metabolic process(GO:0046066) |
| 0.1 | 0.2 | GO:1902268 | negative regulation of polyamine transmembrane transport(GO:1902268) |
| 0.1 | 0.6 | GO:0001731 | formation of translation preinitiation complex(GO:0001731) |
| 0.1 | 0.3 | GO:0034755 | iron ion transmembrane transport(GO:0034755) |
| 0.1 | 0.6 | GO:0000463 | maturation of LSU-rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000463) |
| 0.1 | 0.1 | GO:0048369 | lateral mesoderm morphogenesis(GO:0048369) lateral mesoderm formation(GO:0048370) lateral mesodermal cell differentiation(GO:0048371) |
| 0.1 | 0.2 | GO:0038180 | nerve growth factor signaling pathway(GO:0038180) |
| 0.1 | 0.2 | GO:0089711 | L-glutamate transmembrane transport(GO:0089711) |
| 0.1 | 0.2 | GO:0070966 | nuclear-transcribed mRNA catabolic process, no-go decay(GO:0070966) |
| 0.1 | 0.7 | GO:0090136 | epithelial cell-cell adhesion(GO:0090136) |
| 0.1 | 0.7 | GO:0045116 | protein neddylation(GO:0045116) |
| 0.1 | 0.2 | GO:0036022 | limb joint morphogenesis(GO:0036022) embryonic skeletal limb joint morphogenesis(GO:0036023) |
| 0.1 | 0.1 | GO:0035977 | protein deglycosylation involved in glycoprotein catabolic process(GO:0035977) protein demannosylation(GO:0036507) protein alpha-1,2-demannosylation(GO:0036508) mannose trimming involved in glycoprotein ERAD pathway(GO:1904382) |
| 0.1 | 0.2 | GO:1902774 | late endosome to lysosome transport(GO:1902774) |
| 0.1 | 0.2 | GO:0060178 | regulation of exocyst localization(GO:0060178) |
| 0.1 | 0.6 | GO:0045793 | positive regulation of cell size(GO:0045793) |
| 0.1 | 1.1 | GO:0008053 | mitochondrial fusion(GO:0008053) |
| 0.1 | 0.2 | GO:1903071 | positive regulation of ER-associated ubiquitin-dependent protein catabolic process(GO:1903071) |
| 0.1 | 0.4 | GO:0009264 | deoxyribonucleotide catabolic process(GO:0009264) |
| 0.1 | 0.3 | GO:0033133 | positive regulation of glucokinase activity(GO:0033133) |
| 0.1 | 0.1 | GO:0061502 | early endosome to recycling endosome transport(GO:0061502) |
| 0.1 | 0.8 | GO:0009812 | flavonoid metabolic process(GO:0009812) |
| 0.1 | 0.2 | GO:0015959 | diadenosine polyphosphate metabolic process(GO:0015959) |
| 0.1 | 0.1 | GO:0048850 | hypophysis morphogenesis(GO:0048850) |
| 0.1 | 0.4 | GO:0035520 | monoubiquitinated protein deubiquitination(GO:0035520) |
| 0.1 | 0.2 | GO:0008272 | sulfate transport(GO:0008272) |
| 0.1 | 0.2 | GO:1904491 | protein localization to ciliary transition zone(GO:1904491) |
| 0.1 | 0.4 | GO:0007000 | nucleolus organization(GO:0007000) |
| 0.1 | 0.1 | GO:1990414 | replication-born double-strand break repair via sister chromatid exchange(GO:1990414) |
| 0.1 | 1.1 | GO:0030488 | tRNA methylation(GO:0030488) |
| 0.1 | 0.4 | GO:0006517 | protein deglycosylation(GO:0006517) |
| 0.1 | 0.1 | GO:1901252 | regulation of intracellular transport of viral material(GO:1901252) |
| 0.1 | 0.1 | GO:1900125 | regulation of hyaluronan biosynthetic process(GO:1900125) negative regulation of hyaluronan biosynthetic process(GO:1900126) |
| 0.1 | 0.4 | GO:0045722 | positive regulation of gluconeogenesis(GO:0045722) |
| 0.1 | 0.6 | GO:0015721 | bile acid and bile salt transport(GO:0015721) |
| 0.1 | 0.6 | GO:0070816 | phosphorylation of RNA polymerase II C-terminal domain(GO:0070816) |
| 0.1 | 0.2 | GO:2000622 | regulation of nuclear-transcribed mRNA catabolic process, nonsense-mediated decay(GO:2000622) negative regulation of nuclear-transcribed mRNA catabolic process, nonsense-mediated decay(GO:2000623) |
| 0.1 | 0.2 | GO:0006393 | termination of mitochondrial transcription(GO:0006393) |
| 0.1 | 0.1 | GO:0009092 | homoserine metabolic process(GO:0009092) transsulfuration(GO:0019346) |
| 0.1 | 0.2 | GO:1904263 | positive regulation of TORC1 signaling(GO:1904263) |
| 0.1 | 0.2 | GO:0070126 | mitochondrial translational termination(GO:0070126) |
| 0.1 | 0.3 | GO:0015919 | peroxisomal membrane transport(GO:0015919) protein import into peroxisome membrane(GO:0045046) |
| 0.1 | 0.1 | GO:0061724 | lipophagy(GO:0061724) |
| 0.1 | 0.2 | GO:0006562 | proline catabolic process(GO:0006562) |
| 0.1 | 0.2 | GO:0010499 | proteasomal ubiquitin-independent protein catabolic process(GO:0010499) |
| 0.1 | 0.1 | GO:0090148 | membrane fission(GO:0090148) |
| 0.1 | 0.4 | GO:0030432 | peristalsis(GO:0030432) |
| 0.1 | 0.8 | GO:0031954 | positive regulation of protein autophosphorylation(GO:0031954) |
| 0.1 | 0.5 | GO:0046855 | inositol phosphate dephosphorylation(GO:0046855) |
| 0.1 | 0.2 | GO:0070682 | proteasome regulatory particle assembly(GO:0070682) |
| 0.1 | 0.9 | GO:0001522 | pseudouridine synthesis(GO:0001522) |
| 0.1 | 0.5 | GO:0030854 | positive regulation of granulocyte differentiation(GO:0030854) |
| 0.1 | 0.2 | GO:0006458 | 'de novo' protein folding(GO:0006458) 'de novo' posttranslational protein folding(GO:0051084) |
| 0.1 | 0.1 | GO:0001831 | trophectodermal cellular morphogenesis(GO:0001831) |
| 0.1 | 0.2 | GO:0006307 | DNA dealkylation involved in DNA repair(GO:0006307) |
| 0.1 | 0.1 | GO:0060467 | negative regulation of fertilization(GO:0060467) |
| 0.1 | 0.1 | GO:0032907 | transforming growth factor beta3 production(GO:0032907) regulation of transforming growth factor beta3 production(GO:0032910) |
| 0.1 | 1.2 | GO:0043252 | sodium-independent organic anion transport(GO:0043252) |
| 0.1 | 0.2 | GO:0006651 | diacylglycerol biosynthetic process(GO:0006651) |
| 0.1 | 0.1 | GO:0042505 | tyrosine phosphorylation of Stat6 protein(GO:0042505) regulation of tyrosine phosphorylation of Stat6 protein(GO:0042525) |
| 0.1 | 0.5 | GO:0048541 | mucosal-associated lymphoid tissue development(GO:0048537) Peyer's patch development(GO:0048541) |
| 0.1 | 0.2 | GO:0061684 | chaperone-mediated autophagy(GO:0061684) |
| 0.1 | 0.2 | GO:0044860 | protein localization to plasma membrane raft(GO:0044860) |
| 0.1 | 0.1 | GO:0002536 | respiratory burst involved in inflammatory response(GO:0002536) |
| 0.1 | 0.1 | GO:0033668 | negative regulation by symbiont of host apoptotic process(GO:0033668) negative regulation by symbiont of host programmed cell death(GO:0052041) negative regulation by organism of programmed cell death in other organism involved in symbiotic interaction(GO:0052490) |
| 0.1 | 0.2 | GO:0051549 | regulation of keratinocyte migration(GO:0051547) positive regulation of keratinocyte migration(GO:0051549) |
| 0.1 | 0.1 | GO:0061738 | late endosomal microautophagy(GO:0061738) |
| 0.1 | 0.2 | GO:0006177 | GMP biosynthetic process(GO:0006177) |
| 0.1 | 0.2 | GO:2000074 | regulation of type B pancreatic cell development(GO:2000074) |
| 0.1 | 0.9 | GO:0003301 | physiological muscle hypertrophy(GO:0003298) physiological cardiac muscle hypertrophy(GO:0003301) cell growth involved in cardiac muscle cell development(GO:0061049) |
| 0.1 | 0.1 | GO:0019482 | beta-alanine metabolic process(GO:0019482) |
| 0.1 | 0.1 | GO:0019532 | oxalate transport(GO:0019532) |
| 0.1 | 1.7 | GO:0061077 | chaperone-mediated protein folding(GO:0061077) |
| 0.0 | 0.1 | GO:0016074 | snoRNA metabolic process(GO:0016074) |
| 0.0 | 0.1 | GO:0048669 | collateral sprouting in absence of injury(GO:0048669) |
| 0.0 | 0.2 | GO:1902857 | positive regulation of nonmotile primary cilium assembly(GO:1902857) |
| 0.0 | 0.1 | GO:0061152 | trachea submucosa development(GO:0061152) trachea gland development(GO:0061153) |
| 0.0 | 0.2 | GO:0032226 | positive regulation of synaptic transmission, dopaminergic(GO:0032226) |
| 0.0 | 0.2 | GO:0006407 | rRNA export from nucleus(GO:0006407) |
| 0.0 | 0.3 | GO:0045176 | apical protein localization(GO:0045176) |
| 0.0 | 0.4 | GO:1904153 | negative regulation of protein exit from endoplasmic reticulum(GO:0070862) regulation of retrograde protein transport, ER to cytosol(GO:1904152) negative regulation of retrograde protein transport, ER to cytosol(GO:1904153) |
| 0.0 | 0.5 | GO:0042759 | long-chain fatty acid biosynthetic process(GO:0042759) |
| 0.0 | 0.0 | GO:0060684 | epithelial-mesenchymal cell signaling(GO:0060684) |
| 0.0 | 0.0 | GO:0048769 | sarcomerogenesis(GO:0048769) |
| 0.0 | 0.1 | GO:0044339 | canonical Wnt signaling pathway involved in osteoblast differentiation(GO:0044339) |
| 0.0 | 0.1 | GO:0006285 | base-excision repair, AP site formation(GO:0006285) |
| 0.0 | 0.1 | GO:0036515 | serotonergic neuron axon guidance(GO:0036515) |
| 0.0 | 0.4 | GO:0098734 | protein depalmitoylation(GO:0002084) macromolecule depalmitoylation(GO:0098734) |
| 0.0 | 0.1 | GO:0009157 | deoxyribonucleoside monophosphate biosynthetic process(GO:0009157) pyrimidine deoxyribonucleoside monophosphate biosynthetic process(GO:0009177) |
| 0.0 | 0.0 | GO:1903069 | regulation of ER-associated ubiquitin-dependent protein catabolic process(GO:1903069) |
| 0.0 | 0.2 | GO:0070940 | dephosphorylation of RNA polymerase II C-terminal domain(GO:0070940) |
| 0.0 | 0.2 | GO:0006573 | valine metabolic process(GO:0006573) |
| 0.0 | 0.4 | GO:0033129 | positive regulation of histone phosphorylation(GO:0033129) |
| 0.0 | 0.2 | GO:0046784 | viral mRNA export from host cell nucleus(GO:0046784) |
| 0.0 | 0.2 | GO:0000056 | ribosomal small subunit export from nucleus(GO:0000056) |
| 0.0 | 0.3 | GO:0098908 | regulation of neuronal action potential(GO:0098908) |
| 0.0 | 0.5 | GO:0030970 | retrograde protein transport, ER to cytosol(GO:0030970) |
| 0.0 | 0.0 | GO:0060266 | negative regulation of respiratory burst involved in inflammatory response(GO:0060266) |
| 0.0 | 0.1 | GO:2000598 | regulation of cyclin catabolic process(GO:2000598) negative regulation of cyclin catabolic process(GO:2000599) |
| 0.0 | 0.1 | GO:0018197 | peptidyl-aspartic acid modification(GO:0018197) |
| 0.0 | 0.2 | GO:0070245 | positive regulation of thymocyte apoptotic process(GO:0070245) |
| 0.0 | 0.2 | GO:0034382 | chylomicron remnant clearance(GO:0034382) triglyceride-rich lipoprotein particle clearance(GO:0071830) |
| 0.0 | 0.1 | GO:0071895 | odontoblast differentiation(GO:0071895) |
| 0.0 | 0.0 | GO:2000347 | positive regulation of hepatocyte proliferation(GO:2000347) |
| 0.0 | 0.4 | GO:0035584 | calcium-mediated signaling using intracellular calcium source(GO:0035584) |
| 0.0 | 0.2 | GO:0032488 | Cdc42 protein signal transduction(GO:0032488) |
| 0.0 | 0.2 | GO:0060267 | positive regulation of respiratory burst(GO:0060267) |
| 0.0 | 0.2 | GO:2000210 | positive regulation of anoikis(GO:2000210) |
| 0.0 | 0.2 | GO:0070127 | tRNA aminoacylation for mitochondrial protein translation(GO:0070127) |
| 0.0 | 0.2 | GO:0043415 | positive regulation of skeletal muscle tissue regeneration(GO:0043415) |
| 0.0 | 0.5 | GO:0006335 | DNA replication-dependent nucleosome assembly(GO:0006335) DNA replication-dependent nucleosome organization(GO:0034723) |
| 0.0 | 0.1 | GO:0003331 | regulation of extracellular matrix constituent secretion(GO:0003330) positive regulation of extracellular matrix constituent secretion(GO:0003331) |
| 0.0 | 0.1 | GO:0006481 | C-terminal protein methylation(GO:0006481) |
| 0.0 | 0.1 | GO:1902253 | regulation of intrinsic apoptotic signaling pathway by p53 class mediator(GO:1902253) |
| 0.0 | 0.3 | GO:0030718 | germ-line stem cell population maintenance(GO:0030718) |
| 0.0 | 0.2 | GO:0034770 | histone H4-K20 methylation(GO:0034770) |
| 0.0 | 0.4 | GO:0060539 | diaphragm development(GO:0060539) |
| 0.0 | 0.3 | GO:0055089 | fatty acid homeostasis(GO:0055089) |
| 0.0 | 0.1 | GO:0021938 | smoothened signaling pathway involved in regulation of cerebellar granule cell precursor cell proliferation(GO:0021938) |
| 0.0 | 0.0 | GO:0019344 | cysteine biosynthetic process(GO:0019344) |
| 0.0 | 0.1 | GO:1903774 | positive regulation of viral budding via host ESCRT complex(GO:1903774) |
| 0.0 | 0.1 | GO:0036394 | amylase secretion(GO:0036394) |
| 0.0 | 0.1 | GO:0010835 | regulation of protein ADP-ribosylation(GO:0010835) |
| 0.0 | 0.3 | GO:0002072 | optic cup morphogenesis involved in camera-type eye development(GO:0002072) |
| 0.0 | 0.2 | GO:0051151 | negative regulation of smooth muscle cell differentiation(GO:0051151) |
| 0.0 | 0.3 | GO:0048752 | semicircular canal morphogenesis(GO:0048752) |
| 0.0 | 0.2 | GO:0070995 | NADPH oxidation(GO:0070995) |
| 0.0 | 0.4 | GO:0043206 | extracellular fibril organization(GO:0043206) |
| 0.0 | 0.3 | GO:0051694 | pointed-end actin filament capping(GO:0051694) |
| 0.0 | 0.2 | GO:0006384 | transcription initiation from RNA polymerase III promoter(GO:0006384) |
| 0.0 | 0.0 | GO:0071360 | cellular response to exogenous dsRNA(GO:0071360) |
| 0.0 | 0.2 | GO:0098535 | de novo centriole assembly(GO:0098535) |
| 0.0 | 0.0 | GO:2000686 | regulation of rubidium ion transmembrane transporter activity(GO:2000686) |
| 0.0 | 0.3 | GO:0006048 | UDP-N-acetylglucosamine biosynthetic process(GO:0006048) |
| 0.0 | 0.1 | GO:0021780 | oligodendrocyte cell fate specification(GO:0021778) oligodendrocyte cell fate commitment(GO:0021779) glial cell fate specification(GO:0021780) |
| 0.0 | 0.1 | GO:0036295 | cellular response to increased oxygen levels(GO:0036295) cellular response to hyperoxia(GO:0071455) |
| 0.0 | 0.8 | GO:0006376 | mRNA splice site selection(GO:0006376) |
| 0.0 | 0.0 | GO:1903208 | neuron death in response to hydrogen peroxide(GO:0036476) regulation of hydrogen peroxide-induced neuron death(GO:1903207) negative regulation of hydrogen peroxide-induced neuron death(GO:1903208) |
| 0.0 | 0.6 | GO:0016082 | synaptic vesicle priming(GO:0016082) |
| 0.0 | 0.1 | GO:0032482 | Rab protein signal transduction(GO:0032482) |
| 0.0 | 0.2 | GO:2000601 | positive regulation of Arp2/3 complex-mediated actin nucleation(GO:2000601) |
| 0.0 | 0.1 | GO:0010958 | regulation of amino acid import(GO:0010958) |
| 0.0 | 0.0 | GO:1900368 | regulation of RNA interference(GO:1900368) |
| 0.0 | 0.6 | GO:0009303 | rRNA transcription(GO:0009303) |
| 0.0 | 0.2 | GO:0060414 | aorta smooth muscle tissue morphogenesis(GO:0060414) |
| 0.0 | 0.1 | GO:0045590 | negative regulation of regulatory T cell differentiation(GO:0045590) |
| 0.0 | 0.2 | GO:0072488 | ammonium transmembrane transport(GO:0072488) |
| 0.0 | 0.1 | GO:0072319 | clathrin coat disassembly(GO:0072318) vesicle uncoating(GO:0072319) |
| 0.0 | 0.2 | GO:0071043 | CUT catabolic process(GO:0071034) CUT metabolic process(GO:0071043) |
| 0.0 | 0.2 | GO:0018343 | protein farnesylation(GO:0018343) |
| 0.0 | 0.5 | GO:0006855 | drug transmembrane transport(GO:0006855) |
| 0.0 | 0.5 | GO:0010569 | regulation of double-strand break repair via homologous recombination(GO:0010569) |
| 0.0 | 0.2 | GO:0009256 | 10-formyltetrahydrofolate metabolic process(GO:0009256) |
| 0.0 | 0.1 | GO:2000286 | receptor internalization involved in canonical Wnt signaling pathway(GO:2000286) |
| 0.0 | 0.0 | GO:0060166 | olfactory pit development(GO:0060166) |
| 0.0 | 0.1 | GO:1901096 | regulation of autophagosome maturation(GO:1901096) |
| 0.0 | 0.1 | GO:0010804 | negative regulation of tumor necrosis factor-mediated signaling pathway(GO:0010804) |
| 0.0 | 0.1 | GO:1901509 | regulation of endothelial tube morphogenesis(GO:1901509) |
| 0.0 | 0.0 | GO:0046005 | positive regulation of circadian sleep/wake cycle, REM sleep(GO:0046005) |
| 0.0 | 0.1 | GO:0060971 | embryonic heart tube left/right pattern formation(GO:0060971) |
| 0.0 | 0.3 | GO:0060158 | phospholipase C-activating dopamine receptor signaling pathway(GO:0060158) |
| 0.0 | 0.1 | GO:0001880 | Mullerian duct regression(GO:0001880) |
| 0.0 | 0.3 | GO:0002176 | male germ cell proliferation(GO:0002176) |
| 0.0 | 0.2 | GO:0035519 | protein K29-linked ubiquitination(GO:0035519) |
| 0.0 | 0.3 | GO:0007253 | cytoplasmic sequestering of NF-kappaB(GO:0007253) |
| 0.0 | 0.0 | GO:0048859 | formation of anatomical boundary(GO:0048859) |
| 0.0 | 0.1 | GO:0098904 | regulation of AV node cell action potential(GO:0098904) |
| 0.0 | 0.2 | GO:0001920 | negative regulation of receptor recycling(GO:0001920) |
| 0.0 | 0.2 | GO:0035331 | negative regulation of hippo signaling(GO:0035331) |
| 0.0 | 0.0 | GO:0090258 | negative regulation of mitochondrial fission(GO:0090258) |
| 0.0 | 0.0 | GO:1901187 | regulation of ephrin receptor signaling pathway(GO:1901187) |
| 0.0 | 0.0 | GO:0090091 | positive regulation of extracellular matrix disassembly(GO:0090091) |
| 0.0 | 0.1 | GO:0038128 | ERBB2 signaling pathway(GO:0038128) |
| 0.0 | 0.1 | GO:1902855 | regulation of nonmotile primary cilium assembly(GO:1902855) |
| 0.0 | 0.1 | GO:0033387 | putrescine biosynthetic process from ornithine(GO:0033387) |
| 0.0 | 0.1 | GO:0046469 | platelet activating factor biosynthetic process(GO:0006663) platelet activating factor metabolic process(GO:0046469) |
| 0.0 | 0.0 | GO:0072367 | regulation of lipid transport by regulation of transcription from RNA polymerase II promoter(GO:0072367) |
| 0.0 | 0.1 | GO:0032383 | regulation of intracellular lipid transport(GO:0032377) regulation of intracellular sterol transport(GO:0032380) regulation of intracellular cholesterol transport(GO:0032383) |
| 0.0 | 0.2 | GO:0016266 | O-glycan processing(GO:0016266) |
| 0.0 | 0.2 | GO:0008354 | germ cell migration(GO:0008354) |
| 0.0 | 0.0 | GO:1902915 | negative regulation of protein K63-linked ubiquitination(GO:1900045) negative regulation of protein polyubiquitination(GO:1902915) |
| 0.0 | 0.2 | GO:0060426 | lung vasculature development(GO:0060426) |
| 0.0 | 0.2 | GO:0019230 | proprioception(GO:0019230) |
| 0.0 | 0.2 | GO:0010766 | negative regulation of sodium ion transport(GO:0010766) |
| 0.0 | 0.1 | GO:2000483 | negative regulation of interleukin-8 secretion(GO:2000483) |
| 0.0 | 0.0 | GO:0070235 | regulation of activation-induced cell death of T cells(GO:0070235) |
| 0.0 | 0.1 | GO:0071376 | response to corticotropin-releasing hormone(GO:0043435) cellular response to corticotropin-releasing hormone stimulus(GO:0071376) |
| 0.0 | 0.1 | GO:1903587 | regulation of blood vessel endothelial cell proliferation involved in sprouting angiogenesis(GO:1903587) |
| 0.0 | 0.1 | GO:0060836 | lymphatic endothelial cell differentiation(GO:0060836) |
| 0.0 | 0.2 | GO:1902916 | positive regulation of protein polyubiquitination(GO:1902916) |
| 0.0 | 0.1 | GO:0006297 | nucleotide-excision repair, DNA gap filling(GO:0006297) |
| 0.0 | 0.1 | GO:0051005 | negative regulation of lipoprotein lipase activity(GO:0051005) |
| 0.0 | 0.1 | GO:2000427 | positive regulation of apoptotic cell clearance(GO:2000427) |
| 0.0 | 0.1 | GO:1900109 | regulation of histone H3-K9 dimethylation(GO:1900109) |
| 0.0 | 0.1 | GO:0036260 | 7-methylguanosine RNA capping(GO:0009452) RNA capping(GO:0036260) |
| 0.0 | 0.1 | GO:1903121 | regulation of TRAIL-activated apoptotic signaling pathway(GO:1903121) |
| 0.0 | 0.1 | GO:0032849 | positive regulation of cellular pH reduction(GO:0032849) |
| 0.0 | 0.0 | GO:0060664 | epithelial cell proliferation involved in salivary gland morphogenesis(GO:0060664) |
| 0.0 | 0.1 | GO:1903361 | protein localization to basolateral plasma membrane(GO:1903361) |
| 0.0 | 0.7 | GO:0006805 | xenobiotic metabolic process(GO:0006805) |
| 0.0 | 0.2 | GO:0051127 | positive regulation of actin nucleation(GO:0051127) |
| 0.0 | 0.5 | GO:0006613 | cotranslational protein targeting to membrane(GO:0006613) |
| 0.0 | 0.1 | GO:0007089 | traversing start control point of mitotic cell cycle(GO:0007089) |
| 0.0 | 0.1 | GO:0046726 | positive regulation by virus of viral protein levels in host cell(GO:0046726) |
| 0.0 | 0.3 | GO:0015677 | copper ion import(GO:0015677) |
| 0.0 | 0.1 | GO:2000301 | negative regulation of synaptic vesicle exocytosis(GO:2000301) |
| 0.0 | 0.2 | GO:0015780 | nucleotide-sugar transport(GO:0015780) pyrimidine nucleotide-sugar transport(GO:0015781) |
| 0.0 | 0.1 | GO:0046341 | CDP-diacylglycerol metabolic process(GO:0046341) |
| 0.0 | 0.1 | GO:0060763 | mammary duct terminal end bud growth(GO:0060763) |
| 0.0 | 0.2 | GO:0050667 | homocysteine metabolic process(GO:0050667) |
| 0.0 | 0.1 | GO:2000354 | regulation of ovarian follicle development(GO:2000354) |
| 0.0 | 0.1 | GO:0070318 | positive regulation of G0 to G1 transition(GO:0070318) |
| 0.0 | 0.1 | GO:0042732 | D-xylose metabolic process(GO:0042732) |
| 0.0 | 0.3 | GO:0000244 | spliceosomal tri-snRNP complex assembly(GO:0000244) |
| 0.0 | 0.0 | GO:0072069 | distal convoluted tubule development(GO:0072025) DCT cell differentiation(GO:0072069) metanephric distal convoluted tubule development(GO:0072221) metanephric distal tubule development(GO:0072235) metanephric DCT cell differentiation(GO:0072240) |
| 0.0 | 0.1 | GO:0045723 | positive regulation of fatty acid biosynthetic process(GO:0045723) |
| 0.0 | 0.1 | GO:0072429 | response to intra-S DNA damage checkpoint signaling(GO:0072429) |
| 0.0 | 0.2 | GO:1902101 | positive regulation of mitotic metaphase/anaphase transition(GO:0045842) positive regulation of metaphase/anaphase transition of cell cycle(GO:1902101) |
| 0.0 | 0.1 | GO:0070475 | rRNA base methylation(GO:0070475) |
| 0.0 | 0.1 | GO:0048199 | vesicle targeting, to, from or within Golgi(GO:0048199) |
| 0.0 | 0.7 | GO:0098534 | centriole assembly(GO:0098534) |
| 0.0 | 0.2 | GO:0051095 | regulation of helicase activity(GO:0051095) positive regulation of helicase activity(GO:0051096) |
| 0.0 | 0.2 | GO:0031033 | myosin filament organization(GO:0031033) |
| 0.0 | 0.0 | GO:1902513 | regulation of organelle transport along microtubule(GO:1902513) |
| 0.0 | 0.2 | GO:0051131 | chaperone-mediated protein complex assembly(GO:0051131) |
| 0.0 | 0.2 | GO:0010992 | ubiquitin homeostasis(GO:0010992) |
| 0.0 | 0.1 | GO:0010832 | negative regulation of myotube differentiation(GO:0010832) |
| 0.0 | 0.1 | GO:2000727 | positive regulation of cardiac muscle cell differentiation(GO:2000727) |
| 0.0 | 0.3 | GO:0009312 | oligosaccharide biosynthetic process(GO:0009312) |
| 0.0 | 0.2 | GO:0060628 | regulation of ER to Golgi vesicle-mediated transport(GO:0060628) |
| 0.0 | 0.2 | GO:0018344 | protein geranylgeranylation(GO:0018344) |
| 0.0 | 0.1 | GO:0033564 | anterior/posterior axon guidance(GO:0033564) |
| 0.0 | 0.0 | GO:0070368 | positive regulation of hepatocyte differentiation(GO:0070368) |
| 0.0 | 0.1 | GO:0002386 | immune response in mucosal-associated lymphoid tissue(GO:0002386) |
| 0.0 | 0.1 | GO:2001027 | negative regulation of endothelial cell chemotaxis(GO:2001027) |
| 0.0 | 1.5 | GO:0032543 | mitochondrial translation(GO:0032543) |
| 0.0 | 0.1 | GO:0051534 | negative regulation of NFAT protein import into nucleus(GO:0051534) |
| 0.0 | 0.0 | GO:0075509 | receptor-mediated endocytosis of virus by host cell(GO:0019065) endocytosis involved in viral entry into host cell(GO:0075509) |
| 0.0 | 0.1 | GO:0042447 | hormone catabolic process(GO:0042447) |
| 0.0 | 0.0 | GO:0072173 | metanephric tubule morphogenesis(GO:0072173) |
| 0.0 | 0.8 | GO:0046329 | negative regulation of JNK cascade(GO:0046329) |
| 0.0 | 0.0 | GO:1900019 | regulation of protein kinase C activity(GO:1900019) positive regulation of protein kinase C activity(GO:1900020) |
| 0.0 | 0.1 | GO:0006983 | ER overload response(GO:0006983) |
| 0.0 | 0.3 | GO:1902254 | negative regulation of intrinsic apoptotic signaling pathway by p53 class mediator(GO:1902254) |
| 0.0 | 0.8 | GO:0048240 | sperm capacitation(GO:0048240) |
| 0.0 | 0.1 | GO:0051004 | regulation of lipoprotein lipase activity(GO:0051004) |
| 0.0 | 0.0 | GO:0055005 | ventricular cardiac myofibril assembly(GO:0055005) |
| 0.0 | 0.1 | GO:0060355 | positive regulation of cell adhesion molecule production(GO:0060355) |
| 0.0 | 0.3 | GO:0034312 | diol biosynthetic process(GO:0034312) sphingosine biosynthetic process(GO:0046512) |
| 0.0 | 0.0 | GO:0070640 | vitamin D3 metabolic process(GO:0070640) |
| 0.0 | 0.2 | GO:2000676 | positive regulation of type B pancreatic cell apoptotic process(GO:2000676) |
| 0.0 | 1.1 | GO:0001938 | positive regulation of endothelial cell proliferation(GO:0001938) |
| 0.0 | 0.1 | GO:0019853 | L-ascorbic acid biosynthetic process(GO:0019853) |
| 0.0 | 0.1 | GO:0090156 | negative regulation of sphingolipid biosynthetic process(GO:0090155) cellular sphingolipid homeostasis(GO:0090156) negative regulation of ceramide biosynthetic process(GO:1900060) |
| 0.0 | 0.0 | GO:0048143 | astrocyte activation(GO:0048143) |
| 0.0 | 0.1 | GO:0007529 | establishment of synaptic specificity at neuromuscular junction(GO:0007529) |
| 0.0 | 0.3 | GO:0000083 | regulation of transcription involved in G1/S transition of mitotic cell cycle(GO:0000083) |
| 0.0 | 0.2 | GO:1901077 | regulation of relaxation of muscle(GO:1901077) |
| 0.0 | 0.1 | GO:0010841 | positive regulation of circadian sleep/wake cycle, wakefulness(GO:0010841) |
| 0.0 | 0.1 | GO:0003431 | growth plate cartilage chondrocyte development(GO:0003431) |
| 0.0 | 0.4 | GO:0006999 | nuclear pore organization(GO:0006999) |
| 0.0 | 0.2 | GO:0006107 | oxaloacetate metabolic process(GO:0006107) |
| 0.0 | 0.2 | GO:0097286 | iron ion import(GO:0097286) |
| 0.0 | 0.1 | GO:0018243 | protein O-linked glycosylation via threonine(GO:0018243) |
| 0.0 | 0.0 | GO:0006591 | ornithine metabolic process(GO:0006591) |
| 0.0 | 0.1 | GO:0021540 | corpus callosum morphogenesis(GO:0021540) |
| 0.0 | 0.1 | GO:0030576 | Cajal body organization(GO:0030576) |
| 0.0 | 0.3 | GO:0006490 | oligosaccharide-lipid intermediate biosynthetic process(GO:0006490) |
| 0.0 | 0.1 | GO:0003348 | cardiac endothelial cell differentiation(GO:0003348) |
| 0.0 | 0.0 | GO:0001834 | trophectodermal cell proliferation(GO:0001834) |
| 0.0 | 0.4 | GO:0007096 | regulation of exit from mitosis(GO:0007096) |
| 0.0 | 0.0 | GO:0021683 | cerebellar granular layer morphogenesis(GO:0021683) |
| 0.0 | 0.0 | GO:0043987 | histone H3-S10 phosphorylation(GO:0043987) |
| 0.0 | 0.2 | GO:0051533 | positive regulation of NFAT protein import into nucleus(GO:0051533) |
| 0.0 | 0.1 | GO:1902083 | negative regulation of peptidyl-cysteine S-nitrosylation(GO:1902083) |
| 0.0 | 0.0 | GO:0043382 | positive regulation of memory T cell differentiation(GO:0043382) |
| 0.0 | 0.1 | GO:0018125 | peptidyl-cysteine methylation(GO:0018125) |
| 0.0 | 1.3 | GO:0045454 | cell redox homeostasis(GO:0045454) |
| 0.0 | 0.3 | GO:0015816 | glycine transport(GO:0015816) |
| 0.0 | 0.1 | GO:0030327 | prenylated protein catabolic process(GO:0030327) |
| 0.0 | 0.5 | GO:0019432 | triglyceride biosynthetic process(GO:0019432) |
| 0.0 | 0.1 | GO:1902570 | protein localization to nucleolus(GO:1902570) regulation of protein localization to nucleolus(GO:1904749) positive regulation of protein localization to nucleolus(GO:1904751) |
| 0.0 | 0.1 | GO:0006420 | arginyl-tRNA aminoacylation(GO:0006420) |
| 0.0 | 0.1 | GO:1990036 | calcium ion import into sarcoplasmic reticulum(GO:1990036) |
| 0.0 | 0.2 | GO:0034434 | steroid esterification(GO:0034433) sterol esterification(GO:0034434) cholesterol esterification(GO:0034435) |
| 0.0 | 0.1 | GO:0032959 | inositol trisphosphate biosynthetic process(GO:0032959) |
| 0.0 | 0.3 | GO:0007183 | SMAD protein complex assembly(GO:0007183) |
| 0.0 | 0.1 | GO:0002087 | regulation of respiratory gaseous exchange by neurological system process(GO:0002087) |
| 0.0 | 0.1 | GO:1901536 | regulation of DNA demethylation(GO:1901535) negative regulation of DNA demethylation(GO:1901536) |
| 0.0 | 0.1 | GO:0031145 | anaphase-promoting complex-dependent catabolic process(GO:0031145) |
| 0.0 | 0.1 | GO:0060399 | positive regulation of growth hormone receptor signaling pathway(GO:0060399) |
| 0.0 | 0.3 | GO:0060294 | cilium movement involved in cell motility(GO:0060294) |
| 0.0 | 0.1 | GO:2000973 | regulation of pro-B cell differentiation(GO:2000973) |
| 0.0 | 0.1 | GO:0032286 | central nervous system myelin maintenance(GO:0032286) |
| 0.0 | 0.1 | GO:0071498 | cellular response to fluid shear stress(GO:0071498) |
| 0.0 | 0.1 | GO:0034047 | regulation of protein phosphatase type 2A activity(GO:0034047) |
| 0.0 | 0.1 | GO:0060283 | negative regulation of oocyte development(GO:0060283) |
| 0.0 | 0.9 | GO:0031018 | endocrine pancreas development(GO:0031018) |
| 0.0 | 0.1 | GO:0032906 | transforming growth factor beta2 production(GO:0032906) regulation of transforming growth factor beta2 production(GO:0032909) |
| 0.0 | 0.1 | GO:0060672 | epithelial cell differentiation involved in embryonic placenta development(GO:0060671) epithelial cell morphogenesis involved in placental branching(GO:0060672) |
| 0.0 | 0.3 | GO:0048643 | positive regulation of skeletal muscle tissue development(GO:0048643) |
| 0.0 | 0.4 | GO:0071539 | protein localization to centrosome(GO:0071539) |
| 0.0 | 0.2 | GO:0033147 | negative regulation of intracellular estrogen receptor signaling pathway(GO:0033147) |
| 0.0 | 0.2 | GO:2000757 | negative regulation of peptidyl-lysine acetylation(GO:2000757) |
| 0.0 | 0.1 | GO:0060263 | regulation of respiratory burst(GO:0060263) |
| 0.0 | 0.1 | GO:0033058 | directional locomotion(GO:0033058) |
| 0.0 | 0.1 | GO:1990564 | protein polyufmylation(GO:1990564) protein K69-linked ufmylation(GO:1990592) |
| 0.0 | 0.2 | GO:0006122 | mitochondrial electron transport, ubiquinol to cytochrome c(GO:0006122) |
| 0.0 | 0.1 | GO:2000679 | positive regulation of transcription regulatory region DNA binding(GO:2000679) |
| 0.0 | 0.1 | GO:1900736 | regulation of phospholipase C-activating G-protein coupled receptor signaling pathway(GO:1900736) |
| 0.0 | 0.1 | GO:0042270 | protection from natural killer cell mediated cytotoxicity(GO:0042270) |
| 0.0 | 0.0 | GO:0032430 | positive regulation of phospholipase A2 activity(GO:0032430) |
| 0.0 | 0.1 | GO:0051204 | protein insertion into mitochondrial membrane(GO:0051204) |
| 0.0 | 0.1 | GO:0035935 | androgen secretion(GO:0035935) regulation of androgen secretion(GO:2000834) positive regulation of androgen secretion(GO:2000836) |
| 0.0 | 0.1 | GO:0035437 | protein retention in ER lumen(GO:0006621) maintenance of protein localization in endoplasmic reticulum(GO:0035437) |
| 0.0 | 0.1 | GO:0007008 | outer mitochondrial membrane organization(GO:0007008) |
| 0.0 | 0.1 | GO:0000103 | sulfate assimilation(GO:0000103) |
| 0.0 | 0.9 | GO:0046426 | negative regulation of JAK-STAT cascade(GO:0046426) negative regulation of STAT cascade(GO:1904893) |
| 0.0 | 0.1 | GO:0090427 | activation of meiosis(GO:0090427) |
| 0.0 | 0.4 | GO:0021952 | central nervous system projection neuron axonogenesis(GO:0021952) |
| 0.0 | 0.2 | GO:0007379 | segment specification(GO:0007379) |
| 0.0 | 0.2 | GO:0006283 | transcription-coupled nucleotide-excision repair(GO:0006283) |
| 0.0 | 0.2 | GO:0006388 | tRNA splicing, via endonucleolytic cleavage and ligation(GO:0006388) |
| 0.0 | 0.1 | GO:0009838 | abscission(GO:0009838) |
| 0.0 | 0.1 | GO:0019509 | L-methionine biosynthetic process from methylthioadenosine(GO:0019509) |
| 0.0 | 0.1 | GO:1903265 | positive regulation of tumor necrosis factor-mediated signaling pathway(GO:1903265) |
| 0.0 | 0.1 | GO:0048852 | diencephalon morphogenesis(GO:0048852) |
| 0.0 | 0.1 | GO:1900620 | acetylcholine biosynthetic process(GO:0008292) acetate ester biosynthetic process(GO:1900620) |
| 0.0 | 0.1 | GO:0035845 | photoreceptor cell outer segment organization(GO:0035845) |
| 0.0 | 0.0 | GO:2000211 | regulation of glutamate metabolic process(GO:2000211) |
| 0.0 | 0.1 | GO:0032927 | positive regulation of activin receptor signaling pathway(GO:0032927) |
| 0.0 | 0.0 | GO:0021747 | cochlear nucleus development(GO:0021747) |
| 0.0 | 0.0 | GO:0042908 | xenobiotic transport(GO:0042908) |
| 0.0 | 0.1 | GO:0032227 | negative regulation of synaptic transmission, dopaminergic(GO:0032227) |
| 0.0 | 0.0 | GO:0070949 | regulation of neutrophil mediated cytotoxicity(GO:0070948) regulation of neutrophil mediated killing of symbiont cell(GO:0070949) |
| 0.0 | 0.0 | GO:0036112 | medium-chain fatty-acyl-CoA metabolic process(GO:0036112) |
| 0.0 | 0.2 | GO:0001921 | positive regulation of receptor recycling(GO:0001921) |
| 0.0 | 0.0 | GO:0042364 | water-soluble vitamin biosynthetic process(GO:0042364) |
| 0.0 | 0.0 | GO:0002215 | defense response to nematode(GO:0002215) |
| 0.0 | 0.1 | GO:0019800 | peptide cross-linking via chondroitin 4-sulfate glycosaminoglycan(GO:0019800) |
| 0.0 | 0.1 | GO:0019471 | 4-hydroxyproline metabolic process(GO:0019471) |
| 0.0 | 0.5 | GO:0042771 | intrinsic apoptotic signaling pathway in response to DNA damage by p53 class mediator(GO:0042771) |
| 0.0 | 0.0 | GO:0010701 | positive regulation of norepinephrine secretion(GO:0010701) |
| 0.0 | 0.0 | GO:0021698 | cerebellar cortex structural organization(GO:0021698) |
| 0.0 | 0.0 | GO:0033566 | gamma-tubulin complex localization(GO:0033566) |
| 0.0 | 0.0 | GO:0070072 | vacuolar proton-transporting V-type ATPase complex assembly(GO:0070072) |
| 0.0 | 0.1 | GO:0043653 | mitochondrial fragmentation involved in apoptotic process(GO:0043653) |
| 0.0 | 0.0 | GO:0018364 | peptidyl-glutamine methylation(GO:0018364) |
| 0.0 | 0.0 | GO:0006533 | aspartate catabolic process(GO:0006533) |
| 0.0 | 0.0 | GO:1902309 | negative regulation of peptidyl-serine dephosphorylation(GO:1902309) |
| 0.0 | 0.2 | GO:0048339 | paraxial mesoderm development(GO:0048339) |
| 0.0 | 0.2 | GO:0097120 | receptor localization to synapse(GO:0097120) |
| 0.0 | 0.3 | GO:0035162 | embryonic hemopoiesis(GO:0035162) |
| 0.0 | 0.1 | GO:0036135 | Schwann cell migration(GO:0036135) regulation of Schwann cell migration(GO:1900147) |
| 0.0 | 0.2 | GO:0006266 | DNA ligation(GO:0006266) |
| 0.0 | 0.2 | GO:0006622 | protein targeting to lysosome(GO:0006622) |
| 0.0 | 0.2 | GO:0010838 | positive regulation of keratinocyte proliferation(GO:0010838) |
| 0.0 | 0.0 | GO:0002538 | arachidonic acid metabolite production involved in inflammatory response(GO:0002538) |
| 0.0 | 0.3 | GO:0000470 | maturation of LSU-rRNA(GO:0000470) |
| 0.0 | 0.0 | GO:0036016 | response to interleukin-3(GO:0036015) cellular response to interleukin-3(GO:0036016) |
| 0.0 | 0.0 | GO:0009162 | deoxyribonucleoside monophosphate metabolic process(GO:0009162) |
| 0.0 | 0.2 | GO:0005981 | regulation of glycogen catabolic process(GO:0005981) |
| 0.0 | 0.1 | GO:0015871 | choline transport(GO:0015871) |
| 0.0 | 0.0 | GO:0014043 | negative regulation of neuron maturation(GO:0014043) |
| 0.0 | 0.1 | GO:0098789 | pre-mRNA cleavage required for polyadenylation(GO:0098789) |
| 0.0 | 0.1 | GO:0042780 | tRNA 3'-end processing(GO:0042780) |
| 0.0 | 0.1 | GO:0015889 | cobalamin transport(GO:0015889) |
| 0.0 | 0.1 | GO:0060285 | cilium or flagellum-dependent cell motility(GO:0001539) cilium-dependent cell motility(GO:0060285) |
| 0.0 | 0.3 | GO:0016578 | histone deubiquitination(GO:0016578) |
| 0.0 | 0.1 | GO:0040016 | embryonic cleavage(GO:0040016) |
| 0.0 | 0.0 | GO:0060005 | vestibular reflex(GO:0060005) |
| 0.0 | 0.0 | GO:0048597 | post-embryonic camera-type eye morphogenesis(GO:0048597) |
| 0.0 | 0.5 | GO:0006270 | DNA replication initiation(GO:0006270) |
| 0.0 | 0.1 | GO:0048671 | negative regulation of collateral sprouting(GO:0048671) |
| 0.0 | 1.0 | GO:0051965 | positive regulation of synapse assembly(GO:0051965) |
| 0.0 | 0.1 | GO:0015813 | L-glutamate transport(GO:0015813) |
| 0.0 | 0.1 | GO:0050748 | negative regulation of lipoprotein metabolic process(GO:0050748) |
| 0.0 | 0.1 | GO:0006207 | 'de novo' pyrimidine nucleobase biosynthetic process(GO:0006207) pyrimidine nucleobase biosynthetic process(GO:0019856) |
| 0.0 | 0.2 | GO:0017144 | drug metabolic process(GO:0017144) |
| 0.0 | 0.0 | GO:1903416 | response to glycoside(GO:1903416) |
| 0.0 | 0.0 | GO:0060440 | trachea formation(GO:0060440) |
| 0.0 | 0.1 | GO:0090435 | protein localization to nuclear envelope(GO:0090435) |
| 0.0 | 0.1 | GO:0046007 | negative regulation of activated T cell proliferation(GO:0046007) |
| 0.0 | 0.1 | GO:0061370 | testosterone biosynthetic process(GO:0061370) |
| 0.0 | 0.1 | GO:0048102 | autophagic cell death(GO:0048102) |
| 0.0 | 0.0 | GO:0019086 | late viral transcription(GO:0019086) |
| 0.0 | 0.1 | GO:0080182 | histone H3-K4 trimethylation(GO:0080182) |
| 0.0 | 0.0 | GO:0034427 | nuclear-transcribed mRNA catabolic process, exonucleolytic, 3'-5'(GO:0034427) |
| 0.0 | 0.0 | GO:0090205 | positive regulation of cholesterol biosynthetic process(GO:0045542) positive regulation of cholesterol metabolic process(GO:0090205) |
| 0.0 | 0.0 | GO:0006543 | glutamine catabolic process(GO:0006543) |
| 0.0 | 0.0 | GO:0045658 | regulation of neutrophil differentiation(GO:0045658) |
| 0.0 | 0.1 | GO:0006842 | tricarboxylic acid transport(GO:0006842) citrate transport(GO:0015746) |
| 0.0 | 0.1 | GO:0001516 | prostaglandin biosynthetic process(GO:0001516) prostanoid biosynthetic process(GO:0046457) |
| 0.0 | 0.0 | GO:0051031 | tRNA transport(GO:0051031) |
| 0.0 | 0.0 | GO:0001698 | gastrin-induced gastric acid secretion(GO:0001698) |
| 0.0 | 0.1 | GO:0000059 | protein import into nucleus, docking(GO:0000059) |
| 0.0 | 0.0 | GO:0032497 | detection of lipopolysaccharide(GO:0032497) |
| 0.0 | 0.1 | GO:0090166 | Golgi disassembly(GO:0090166) |
| 0.0 | 0.1 | GO:0045657 | positive regulation of monocyte differentiation(GO:0045657) |
| 0.0 | 0.0 | GO:1903797 | positive regulation of inorganic anion transmembrane transport(GO:1903797) |
| 0.0 | 0.2 | GO:0045948 | positive regulation of translational initiation(GO:0045948) |
| 0.0 | 0.0 | GO:0070487 | monocyte aggregation(GO:0070487) |
| 0.0 | 0.2 | GO:0032525 | somite rostral/caudal axis specification(GO:0032525) |
| 0.0 | 0.0 | GO:0032066 | nucleolus to nucleoplasm transport(GO:0032066) |
| 0.0 | 0.3 | GO:0070536 | protein K63-linked deubiquitination(GO:0070536) |
| 0.0 | 0.0 | GO:0001828 | inner cell mass cell fate commitment(GO:0001827) inner cell mass cellular morphogenesis(GO:0001828) |
| 0.0 | 0.1 | GO:0098700 | aminergic neurotransmitter loading into synaptic vesicle(GO:0015842) neurotransmitter loading into synaptic vesicle(GO:0098700) |
| 0.0 | 0.1 | GO:0014067 | negative regulation of phosphatidylinositol 3-kinase signaling(GO:0014067) |
| 0.0 | 0.1 | GO:0031468 | nuclear envelope reassembly(GO:0031468) |
| 0.0 | 0.1 | GO:0017183 | peptidyl-diphthamide metabolic process(GO:0017182) peptidyl-diphthamide biosynthetic process from peptidyl-histidine(GO:0017183) |
| 0.0 | 0.0 | GO:0010749 | regulation of nitric oxide mediated signal transduction(GO:0010749) |
| 0.0 | 0.1 | GO:2000270 | negative regulation of fibroblast apoptotic process(GO:2000270) |
| 0.0 | 0.1 | GO:0071280 | cellular response to copper ion(GO:0071280) |
| 0.0 | 0.2 | GO:0033235 | positive regulation of protein sumoylation(GO:0033235) |
| 0.0 | 0.2 | GO:0045737 | positive regulation of cyclin-dependent protein serine/threonine kinase activity(GO:0045737) |
| 0.0 | 0.0 | GO:0042660 | positive regulation of cell fate specification(GO:0042660) |
| 0.0 | 0.0 | GO:0086064 | cell communication by electrical coupling involved in cardiac conduction(GO:0086064) |
| 0.0 | 0.1 | GO:0072697 | protein localization to cell cortex(GO:0072697) |
| 0.0 | 0.1 | GO:0042045 | epithelial fluid transport(GO:0042045) |
| 0.0 | 0.1 | GO:0042711 | maternal behavior(GO:0042711) |
| 0.0 | 0.0 | GO:0003241 | growth involved in heart morphogenesis(GO:0003241) |
| 0.0 | 0.1 | GO:0006857 | oligopeptide transport(GO:0006857) |
| 0.0 | 0.1 | GO:0035810 | positive regulation of urine volume(GO:0035810) |
| 0.0 | 0.2 | GO:0010623 | programmed cell death involved in cell development(GO:0010623) |
| 0.0 | 0.2 | GO:0021542 | dentate gyrus development(GO:0021542) |
| 0.0 | 0.1 | GO:0050915 | sensory perception of sour taste(GO:0050915) |
| 0.0 | 0.2 | GO:0043984 | histone H4-K16 acetylation(GO:0043984) |
| 0.0 | 0.3 | GO:0034198 | cellular response to amino acid starvation(GO:0034198) |
| 0.0 | 0.1 | GO:0019511 | peptidyl-proline hydroxylation(GO:0019511) |
| 0.0 | 0.1 | GO:0086046 | membrane depolarization during SA node cell action potential(GO:0086046) |
| 0.0 | 0.1 | GO:0051029 | rRNA transport(GO:0051029) |
| 0.0 | 0.0 | GO:0003433 | chondrocyte development involved in endochondral bone morphogenesis(GO:0003433) |
| 0.0 | 0.2 | GO:0043162 | ubiquitin-dependent protein catabolic process via the multivesicular body sorting pathway(GO:0043162) |
| 0.0 | 0.0 | GO:1903261 | regulation of serine phosphorylation of STAT3 protein(GO:1903261) |
| 0.0 | 0.0 | GO:0033031 | positive regulation of neutrophil apoptotic process(GO:0033031) |
| 0.0 | 0.1 | GO:0060017 | parathyroid gland development(GO:0060017) |
| 0.0 | 0.2 | GO:0015012 | heparan sulfate proteoglycan biosynthetic process(GO:0015012) |
| 0.0 | 0.0 | GO:0021937 | cerebellar Purkinje cell-granule cell precursor cell signaling involved in regulation of granule cell precursor cell proliferation(GO:0021937) |
| 0.0 | 0.1 | GO:0007468 | regulation of rhodopsin gene expression(GO:0007468) |
| 0.0 | 0.0 | GO:0000966 | RNA 5'-end processing(GO:0000966) |
| 0.0 | 0.1 | GO:0043403 | skeletal muscle tissue regeneration(GO:0043403) |
| 0.0 | 0.0 | GO:0015744 | succinate transport(GO:0015744) |
| 0.0 | 0.2 | GO:0003416 | endochondral bone growth(GO:0003416) |
| 0.0 | 0.0 | GO:1903887 | motile primary cilium assembly(GO:1903887) |
| 0.0 | 0.0 | GO:0071712 | ER-associated misfolded protein catabolic process(GO:0071712) |
| 0.0 | 0.0 | GO:0071727 | response to triacyl bacterial lipopeptide(GO:0071725) cellular response to triacyl bacterial lipopeptide(GO:0071727) |
| 0.0 | 0.8 | GO:0006970 | response to osmotic stress(GO:0006970) |
| 0.0 | 0.0 | GO:0034441 | plasma lipoprotein particle oxidation(GO:0034441) |
| 0.0 | 0.1 | GO:0036092 | phosphatidylinositol-3-phosphate biosynthetic process(GO:0036092) |
| 0.0 | 0.0 | GO:0002679 | respiratory burst involved in defense response(GO:0002679) |
| 0.0 | 0.2 | GO:0097352 | autophagosome maturation(GO:0097352) |
| 0.0 | 0.1 | GO:0006903 | vesicle targeting(GO:0006903) |
| 0.0 | 0.0 | GO:0033563 | dorsal/ventral axon guidance(GO:0033563) |
| 0.0 | 0.1 | GO:1900107 | regulation of nodal signaling pathway(GO:1900107) |
| 0.0 | 0.3 | GO:0009225 | nucleotide-sugar metabolic process(GO:0009225) |
| 0.0 | 0.0 | GO:0045085 | negative regulation of interleukin-2 biosynthetic process(GO:0045085) |
| 0.0 | 0.4 | GO:2000785 | regulation of autophagosome assembly(GO:2000785) |
| 0.0 | 0.1 | GO:0010172 | embryonic body morphogenesis(GO:0010172) |
| 0.0 | 0.1 | GO:0002759 | regulation of antimicrobial humoral response(GO:0002759) |
| 0.0 | 0.1 | GO:0000467 | exonucleolytic trimming involved in rRNA processing(GO:0000459) exonucleolytic trimming to generate mature 3'-end of 5.8S rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000467) |
| 0.0 | 0.1 | GO:1990126 | retrograde transport, endosome to plasma membrane(GO:1990126) |
| 0.0 | 0.0 | GO:0071787 | endoplasmic reticulum tubular network assembly(GO:0071787) |
| 0.0 | 0.0 | GO:0043485 | endosome to melanosome transport(GO:0035646) cellular pigment accumulation(GO:0043482) endosome to pigment granule transport(GO:0043485) pigment granule maturation(GO:0048757) |
| 0.0 | 0.1 | GO:0001672 | regulation of chromatin assembly or disassembly(GO:0001672) |
| 0.0 | 0.0 | GO:2000587 | regulation of platelet-derived growth factor receptor-beta signaling pathway(GO:2000586) negative regulation of platelet-derived growth factor receptor-beta signaling pathway(GO:2000587) |
| 0.0 | 0.4 | GO:0000184 | nuclear-transcribed mRNA catabolic process, nonsense-mediated decay(GO:0000184) |
| 0.0 | 0.0 | GO:0045585 | regulation of cytotoxic T cell differentiation(GO:0045583) positive regulation of cytotoxic T cell differentiation(GO:0045585) |
| 0.0 | 0.0 | GO:0014901 | regulation of satellite cell activation involved in skeletal muscle regeneration(GO:0014717) satellite cell activation involved in skeletal muscle regeneration(GO:0014901) |
| 0.0 | 0.1 | GO:0051126 | negative regulation of Arp2/3 complex-mediated actin nucleation(GO:0034316) negative regulation of actin nucleation(GO:0051126) |
| 0.0 | 0.0 | GO:1902036 | regulation of hematopoietic stem cell differentiation(GO:1902036) |
| 0.0 | 0.0 | GO:0002678 | positive regulation of chronic inflammatory response(GO:0002678) |
| 0.0 | 0.1 | GO:0044821 | telomere tethering at nuclear periphery(GO:0034398) meiotic telomere tethering at nuclear periphery(GO:0044821) meiotic attachment of telomere to nuclear envelope(GO:0070197) chromosome attachment to the nuclear envelope(GO:0097240) |
| 0.0 | 0.1 | GO:0070417 | cellular response to cold(GO:0070417) |
| 0.0 | 0.0 | GO:0006059 | hexitol metabolic process(GO:0006059) |
| 0.0 | 0.1 | GO:0035188 | blastocyst hatching(GO:0001835) hatching(GO:0035188) organism emergence from protective structure(GO:0071684) |
| 0.0 | 0.0 | GO:0019348 | dolichol metabolic process(GO:0019348) |
| 0.0 | 0.2 | GO:0007076 | mitotic chromosome condensation(GO:0007076) |
| 0.0 | 0.1 | GO:0001514 | selenocysteine incorporation(GO:0001514) translational readthrough(GO:0006451) |
| 0.0 | 0.0 | GO:0061031 | endodermal digestive tract morphogenesis(GO:0061031) |
| 0.0 | 0.1 | GO:0003091 | renal water homeostasis(GO:0003091) |
| 0.0 | 0.0 | GO:0009068 | aspartate family amino acid catabolic process(GO:0009068) |
| 0.0 | 0.0 | GO:0080009 | mRNA methylation(GO:0080009) |
| 0.0 | 0.0 | GO:0019805 | quinolinate biosynthetic process(GO:0019805) |
| 0.0 | 0.2 | GO:0006491 | N-glycan processing(GO:0006491) |
| 0.0 | 0.0 | GO:0035336 | long-chain fatty-acyl-CoA metabolic process(GO:0035336) |
| 0.0 | 0.0 | GO:0050955 | thermoception(GO:0050955) |
| 0.0 | 0.1 | GO:0007028 | cytoplasm organization(GO:0007028) |
| 0.0 | 0.1 | GO:0019886 | antigen processing and presentation of exogenous peptide antigen via MHC class II(GO:0019886) |
| 0.0 | 0.0 | GO:0071494 | cellular response to UV-C(GO:0071494) |
| 0.0 | 0.0 | GO:0036438 | maintenance of lens transparency(GO:0036438) |
| 0.0 | 0.1 | GO:0090073 | positive regulation of protein homodimerization activity(GO:0090073) |
| 0.0 | 0.2 | GO:0006474 | N-terminal protein amino acid acetylation(GO:0006474) |
| 0.0 | 0.0 | GO:0021882 | regulation of transcription from RNA polymerase II promoter involved in forebrain neuron fate commitment(GO:0021882) |
| 0.0 | 0.2 | GO:0061036 | positive regulation of cartilage development(GO:0061036) |
| 0.0 | 0.1 | GO:0023019 | signal transduction involved in regulation of gene expression(GO:0023019) |
| 0.0 | 0.0 | GO:0006714 | sesquiterpenoid metabolic process(GO:0006714) |
| 0.0 | 0.0 | GO:1904262 | negative regulation of TORC1 signaling(GO:1904262) |
| 0.0 | 1.1 | GO:0006821 | chloride transport(GO:0006821) |
| 0.0 | 0.0 | GO:0038095 | Fc-epsilon receptor signaling pathway(GO:0038095) |
| 0.0 | 0.3 | GO:0006182 | cGMP biosynthetic process(GO:0006182) |
| 0.0 | 0.1 | GO:0035881 | amacrine cell differentiation(GO:0035881) |
| 0.0 | 0.0 | GO:0019896 | axonal transport of mitochondrion(GO:0019896) |
| 0.0 | 0.0 | GO:0035822 | meiotic gene conversion(GO:0006311) gene conversion(GO:0035822) |
| 0.0 | 0.0 | GO:1903999 | negative regulation of eating behavior(GO:1903999) |
| 0.0 | 0.1 | GO:0032229 | negative regulation of synaptic transmission, GABAergic(GO:0032229) |
| 0.0 | 0.0 | GO:0035090 | maintenance of apical/basal cell polarity(GO:0035090) |
| 0.0 | 0.0 | GO:0070989 | oxidative demethylation(GO:0070989) |
| 0.0 | 0.0 | GO:0030382 | sperm mitochondrion organization(GO:0030382) |
| 0.0 | 0.1 | GO:2001206 | positive regulation of osteoclast development(GO:2001206) |
| 0.0 | 0.1 | GO:0021796 | cerebral cortex regionalization(GO:0021796) |
| 0.0 | 0.1 | GO:1904322 | response to forskolin(GO:1904321) cellular response to forskolin(GO:1904322) |
| 0.0 | 0.0 | GO:0045112 | integrin biosynthetic process(GO:0045112) |
| 0.0 | 0.1 | GO:0070986 | left/right axis specification(GO:0070986) |
| 0.0 | 0.1 | GO:0006662 | glycerol ether metabolic process(GO:0006662) ether lipid metabolic process(GO:0046485) |
| 0.0 | 0.0 | GO:1902626 | assembly of large subunit precursor of preribosome(GO:1902626) |
| 0.0 | 2.0 | GO:0010466 | negative regulation of peptidase activity(GO:0010466) |
| 0.0 | 0.1 | GO:0030325 | adrenal gland development(GO:0030325) |
| 0.0 | 0.0 | GO:0002727 | natural killer cell cytokine production(GO:0002370) regulation of natural killer cell cytokine production(GO:0002727) |
| 0.0 | 0.0 | GO:0070164 | negative regulation of adiponectin secretion(GO:0070164) |
| 0.0 | 0.1 | GO:0097150 | neuronal stem cell population maintenance(GO:0097150) |
| 0.0 | 0.1 | GO:0090385 | phagosome-lysosome fusion(GO:0090385) |
| 0.0 | 0.2 | GO:0016226 | iron-sulfur cluster assembly(GO:0016226) metallo-sulfur cluster assembly(GO:0031163) |
| 0.0 | 0.1 | GO:0046133 | pyrimidine ribonucleoside catabolic process(GO:0046133) |
| 0.0 | 0.0 | GO:0032792 | negative regulation of CREB transcription factor activity(GO:0032792) |
| 0.0 | 0.1 | GO:0006678 | glucosylceramide metabolic process(GO:0006678) |
| 0.0 | 0.0 | GO:0002752 | cell surface pattern recognition receptor signaling pathway(GO:0002752) |
| 0.0 | 0.0 | GO:2000653 | regulation of genetic imprinting(GO:2000653) |
| 0.0 | 0.1 | GO:0007210 | serotonin receptor signaling pathway(GO:0007210) |
| 0.0 | 0.0 | GO:0014742 | positive regulation of cardiac muscle hypertrophy(GO:0010613) positive regulation of muscle hypertrophy(GO:0014742) |
| 0.0 | 0.1 | GO:0045187 | regulation of circadian sleep/wake cycle(GO:0042749) regulation of circadian sleep/wake cycle, sleep(GO:0045187) |
| 0.0 | 0.1 | GO:0060052 | neurofilament cytoskeleton organization(GO:0060052) |
| 0.0 | 0.0 | GO:1904479 | negative regulation of intestinal absorption(GO:1904479) |
| 0.0 | 0.1 | GO:0035269 | protein O-linked mannosylation(GO:0035269) |
| 0.0 | 0.0 | GO:0045578 | negative regulation of B cell differentiation(GO:0045578) |
| 0.0 | 0.1 | GO:0042438 | melanin biosynthetic process(GO:0042438) |
| 0.0 | 0.0 | GO:0070189 | kynurenine metabolic process(GO:0070189) |
| 0.0 | 0.0 | GO:0015803 | branched-chain amino acid transport(GO:0015803) leucine transport(GO:0015820) |
| 0.0 | 0.0 | GO:0090071 | negative regulation of ribosome biogenesis(GO:0090071) |
| 0.0 | 0.3 | GO:0006829 | zinc II ion transport(GO:0006829) |
| 0.0 | 0.0 | GO:0051140 | regulation of NK T cell proliferation(GO:0051140) positive regulation of NK T cell proliferation(GO:0051142) |
| 0.0 | 0.0 | GO:0006477 | protein sulfation(GO:0006477) |
| 0.0 | 0.0 | GO:0072566 | chemokine (C-X-C motif) ligand 1 production(GO:0072566) regulation of chemokine (C-X-C motif) ligand 1 production(GO:2000338) |
| 0.0 | 0.0 | GO:0031915 | positive regulation of synaptic plasticity(GO:0031915) |
| 0.0 | 0.0 | GO:0018094 | protein polyglycylation(GO:0018094) |
| 0.0 | 0.0 | GO:0060449 | bud elongation involved in lung branching(GO:0060449) |
| 0.0 | 0.1 | GO:0090520 | sphingolipid mediated signaling pathway(GO:0090520) |
| 0.0 | 0.1 | GO:0014002 | astrocyte development(GO:0014002) |
| 0.0 | 0.0 | GO:0072007 | mesangial cell differentiation(GO:0072007) kidney interstitial fibroblast differentiation(GO:0072071) renal interstitial fibroblast development(GO:0072141) mesangial cell development(GO:0072143) |
| 0.0 | 0.1 | GO:0046085 | adenosine metabolic process(GO:0046085) |
| 0.0 | 0.0 | GO:0010528 | regulation of transposition(GO:0010528) negative regulation of transposition(GO:0010529) |
| 0.0 | 0.2 | GO:0006749 | glutathione metabolic process(GO:0006749) |
| 0.0 | 0.0 | GO:0033234 | negative regulation of protein sumoylation(GO:0033234) |
| 0.0 | 0.1 | GO:0000160 | phosphorelay signal transduction system(GO:0000160) |
| 0.0 | 0.1 | GO:0010388 | protein deneddylation(GO:0000338) cullin deneddylation(GO:0010388) |
| 0.0 | 0.1 | GO:0003334 | keratinocyte development(GO:0003334) |
| 0.0 | 0.2 | GO:0016180 | snRNA processing(GO:0016180) |
| 0.0 | 0.0 | GO:0033700 | phospholipid efflux(GO:0033700) |
| 0.0 | 0.0 | GO:0071864 | positive regulation of cell proliferation in bone marrow(GO:0071864) |
| 0.0 | 0.0 | GO:0034633 | retinol transport(GO:0034633) isoprenoid transport(GO:0046864) terpenoid transport(GO:0046865) |
| 0.0 | 0.0 | GO:0046654 | tetrahydrofolate biosynthetic process(GO:0046654) |
| 0.0 | 0.1 | GO:0003338 | metanephros morphogenesis(GO:0003338) |
| 0.0 | 0.0 | GO:0090074 | negative regulation of protein homodimerization activity(GO:0090074) |
| 0.0 | 0.0 | GO:0019336 | phenol-containing compound catabolic process(GO:0019336) |
| 0.0 | 0.1 | GO:0005980 | glycogen catabolic process(GO:0005980) glucan catabolic process(GO:0009251) cellular polysaccharide catabolic process(GO:0044247) |
| 0.0 | 0.3 | GO:0006334 | nucleosome assembly(GO:0006334) |
| 0.0 | 0.0 | GO:0009134 | nucleoside diphosphate catabolic process(GO:0009134) |
| 0.0 | 0.1 | GO:0006493 | protein O-linked glycosylation(GO:0006493) |
| 0.0 | 0.1 | GO:0050962 | detection of light stimulus involved in visual perception(GO:0050908) detection of light stimulus involved in sensory perception(GO:0050962) |
| 0.0 | 0.0 | GO:1902402 | signal transduction involved in mitotic cell cycle checkpoint(GO:0072413) signal transduction involved in mitotic DNA damage checkpoint(GO:1902402) signal transduction involved in mitotic DNA integrity checkpoint(GO:1902403) |
| 0.0 | 0.1 | GO:0001675 | acrosome assembly(GO:0001675) |
| 0.0 | 0.1 | GO:0007252 | I-kappaB phosphorylation(GO:0007252) |
| 0.0 | 0.0 | GO:0002778 | antimicrobial peptide production(GO:0002775) antibacterial peptide production(GO:0002778) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 1.1 | 3.3 | GO:0097487 | multivesicular body, internal vesicle(GO:0097487) |
| 0.3 | 0.9 | GO:0005967 | mitochondrial pyruvate dehydrogenase complex(GO:0005967) |
| 0.3 | 1.4 | GO:0031094 | platelet dense tubular network(GO:0031094) |
| 0.3 | 0.8 | GO:0030981 | cortical microtubule cytoskeleton(GO:0030981) |
| 0.2 | 0.9 | GO:0033269 | internode region of axon(GO:0033269) |
| 0.2 | 1.1 | GO:0045098 | type III intermediate filament(GO:0045098) |
| 0.2 | 0.7 | GO:0046691 | intracellular canaliculus(GO:0046691) |
| 0.2 | 0.7 | GO:0032444 | activin responsive factor complex(GO:0032444) |
| 0.2 | 2.4 | GO:0070852 | cell body fiber(GO:0070852) |
| 0.2 | 1.5 | GO:0042587 | glycogen granule(GO:0042587) |
| 0.2 | 0.9 | GO:0031315 | extrinsic component of mitochondrial outer membrane(GO:0031315) |
| 0.2 | 0.7 | GO:0030127 | COPII vesicle coat(GO:0030127) |
| 0.2 | 0.5 | GO:0097441 | basilar dendrite(GO:0097441) |
| 0.2 | 0.7 | GO:0044316 | cone cell pedicle(GO:0044316) |
| 0.2 | 0.7 | GO:0097524 | sperm plasma membrane(GO:0097524) |
| 0.2 | 0.6 | GO:0035867 | alphav-beta3 integrin-IGF-1-IGF1R complex(GO:0035867) |
| 0.2 | 1.4 | GO:0045263 | proton-transporting ATP synthase complex, coupling factor F(o)(GO:0045263) |
| 0.2 | 0.6 | GO:0097452 | GAIT complex(GO:0097452) |
| 0.2 | 0.5 | GO:0071942 | XPC complex(GO:0071942) |
| 0.1 | 0.7 | GO:0097433 | dense body(GO:0097433) |
| 0.1 | 0.4 | GO:0005879 | axonemal microtubule(GO:0005879) |
| 0.1 | 0.5 | GO:0045293 | mRNA editing complex(GO:0045293) |
| 0.1 | 0.4 | GO:0048179 | activin receptor complex(GO:0048179) |
| 0.1 | 0.5 | GO:0044615 | nuclear pore nuclear basket(GO:0044615) |
| 0.1 | 0.8 | GO:0000306 | extrinsic component of vacuolar membrane(GO:0000306) |
| 0.1 | 0.4 | GO:0033186 | CAF-1 complex(GO:0033186) |
| 0.1 | 0.3 | GO:0097504 | Gemini of coiled bodies(GO:0097504) |
| 0.1 | 1.4 | GO:0034663 | endoplasmic reticulum chaperone complex(GO:0034663) |
| 0.1 | 1.7 | GO:0000930 | gamma-tubulin complex(GO:0000930) |
| 0.1 | 0.3 | GO:0005955 | calcineurin complex(GO:0005955) |
| 0.1 | 0.5 | GO:0031298 | replication fork protection complex(GO:0031298) |
| 0.1 | 0.5 | GO:0070688 | MLL5-L complex(GO:0070688) |
| 0.1 | 0.6 | GO:0070776 | H3 histone acetyltransferase complex(GO:0070775) MOZ/MORF histone acetyltransferase complex(GO:0070776) |
| 0.1 | 0.5 | GO:0042824 | MHC class I peptide loading complex(GO:0042824) |
| 0.1 | 0.6 | GO:0005915 | zonula adherens(GO:0005915) |
| 0.1 | 0.5 | GO:0031314 | extrinsic component of mitochondrial inner membrane(GO:0031314) |
| 0.1 | 0.3 | GO:0002193 | MAML1-RBP-Jkappa- ICN1 complex(GO:0002193) |
| 0.1 | 0.1 | GO:0055087 | Ski complex(GO:0055087) |
| 0.1 | 0.3 | GO:0005899 | insulin receptor complex(GO:0005899) |
| 0.1 | 0.7 | GO:0042788 | polysomal ribosome(GO:0042788) |
| 0.1 | 0.3 | GO:0032021 | NELF complex(GO:0032021) |
| 0.1 | 0.3 | GO:0070545 | PeBoW complex(GO:0070545) |
| 0.1 | 0.5 | GO:0000347 | THO complex(GO:0000347) THO complex part of transcription export complex(GO:0000445) |
| 0.1 | 0.6 | GO:0098576 | lumenal side of membrane(GO:0098576) |
| 0.1 | 0.2 | GO:1990597 | AIP1-IRE1 complex(GO:1990597) |
| 0.1 | 0.5 | GO:0044233 | ER-mitochondrion membrane contact site(GO:0044233) |
| 0.1 | 0.7 | GO:0008250 | oligosaccharyltransferase complex(GO:0008250) |
| 0.1 | 0.4 | GO:0043202 | lysosomal lumen(GO:0043202) |
| 0.1 | 1.4 | GO:0005942 | phosphatidylinositol 3-kinase complex(GO:0005942) |
| 0.1 | 0.3 | GO:1990131 | EGO complex(GO:0034448) Gtr1-Gtr2 GTPase complex(GO:1990131) |
| 0.1 | 0.2 | GO:0097025 | MPP7-DLG1-LIN7 complex(GO:0097025) |
| 0.1 | 0.2 | GO:0097543 | ciliary inversin compartment(GO:0097543) |
| 0.1 | 0.2 | GO:0005850 | eukaryotic translation initiation factor 2 complex(GO:0005850) |
| 0.1 | 0.3 | GO:0016602 | CCAAT-binding factor complex(GO:0016602) |
| 0.1 | 0.4 | GO:0000275 | mitochondrial proton-transporting ATP synthase complex, catalytic core F(1)(GO:0000275) proton-transporting ATP synthase complex, catalytic core F(1)(GO:0045261) |
| 0.1 | 0.5 | GO:0033116 | endoplasmic reticulum-Golgi intermediate compartment membrane(GO:0033116) |
| 0.1 | 0.2 | GO:0014701 | junctional sarcoplasmic reticulum membrane(GO:0014701) |
| 0.1 | 0.1 | GO:0000125 | PCAF complex(GO:0000125) |
| 0.1 | 3.8 | GO:0005811 | lipid particle(GO:0005811) |
| 0.1 | 0.8 | GO:0031083 | BLOC-1 complex(GO:0031083) |
| 0.1 | 0.3 | GO:0005968 | Rab-protein geranylgeranyltransferase complex(GO:0005968) |
| 0.1 | 0.2 | GO:0097413 | Lewy body(GO:0097413) |
| 0.1 | 0.7 | GO:0005665 | DNA-directed RNA polymerase II, core complex(GO:0005665) |
| 0.1 | 0.7 | GO:0031235 | intrinsic component of the cytoplasmic side of the plasma membrane(GO:0031235) |
| 0.1 | 0.8 | GO:0005736 | DNA-directed RNA polymerase I complex(GO:0005736) |
| 0.1 | 0.2 | GO:0071203 | WASH complex(GO:0071203) |
| 0.1 | 0.9 | GO:0030134 | ER to Golgi transport vesicle(GO:0030134) |
| 0.1 | 0.2 | GO:0030478 | actin cap(GO:0030478) |
| 0.1 | 0.2 | GO:0032541 | cortical endoplasmic reticulum(GO:0032541) |
| 0.1 | 0.4 | GO:0034518 | mRNA cap binding complex(GO:0005845) RNA cap binding complex(GO:0034518) |
| 0.1 | 0.1 | GO:0097512 | cardiac myofibril(GO:0097512) |
| 0.1 | 0.2 | GO:0044354 | pinosome(GO:0044352) macropinosome(GO:0044354) |
| 0.1 | 0.4 | GO:0071541 | eukaryotic translation initiation factor 3 complex, eIF3m(GO:0071541) |
| 0.1 | 0.3 | GO:0071598 | neuronal ribonucleoprotein granule(GO:0071598) |
| 0.1 | 0.5 | GO:0032045 | guanyl-nucleotide exchange factor complex(GO:0032045) |
| 0.1 | 0.5 | GO:0036128 | CatSper complex(GO:0036128) |
| 0.1 | 0.3 | GO:0031467 | Cul7-RING ubiquitin ligase complex(GO:0031467) |
| 0.1 | 0.5 | GO:0032593 | insulin-responsive compartment(GO:0032593) |
| 0.1 | 0.3 | GO:0044326 | dendritic spine neck(GO:0044326) |
| 0.1 | 0.2 | GO:0031618 | nuclear pericentric heterochromatin(GO:0031618) |
| 0.1 | 0.1 | GO:0030056 | hemidesmosome(GO:0030056) |
| 0.1 | 0.4 | GO:1904115 | axon cytoplasm(GO:1904115) |
| 0.1 | 0.2 | GO:0070552 | BRISC complex(GO:0070552) |
| 0.1 | 0.2 | GO:0097418 | neurofibrillary tangle(GO:0097418) |
| 0.1 | 0.2 | GO:0031074 | nucleocytoplasmic shuttling complex(GO:0031074) |
| 0.0 | 0.1 | GO:0005785 | signal recognition particle receptor complex(GO:0005785) |
| 0.0 | 0.2 | GO:0016342 | catenin complex(GO:0016342) |
| 0.0 | 0.1 | GO:1990316 | ATG1/ULK1 kinase complex(GO:1990316) |
| 0.0 | 0.9 | GO:0043034 | costamere(GO:0043034) |
| 0.0 | 0.3 | GO:0051286 | cell tip(GO:0051286) |
| 0.0 | 1.5 | GO:0000307 | cyclin-dependent protein kinase holoenzyme complex(GO:0000307) |
| 0.0 | 0.4 | GO:0071437 | invadopodium(GO:0071437) |
| 0.0 | 0.1 | GO:0071008 | U2-type post-mRNA release spliceosomal complex(GO:0071008) |
| 0.0 | 1.9 | GO:0042645 | nucleoid(GO:0009295) mitochondrial nucleoid(GO:0042645) |
| 0.0 | 0.4 | GO:0005652 | nuclear lamina(GO:0005652) |
| 0.0 | 1.1 | GO:0005763 | organellar small ribosomal subunit(GO:0000314) mitochondrial small ribosomal subunit(GO:0005763) |
| 0.0 | 0.1 | GO:0005827 | polar microtubule(GO:0005827) |
| 0.0 | 0.5 | GO:0031588 | nucleotide-activated protein kinase complex(GO:0031588) |
| 0.0 | 0.3 | GO:0097342 | ripoptosome(GO:0097342) |
| 0.0 | 0.3 | GO:0072669 | tRNA-splicing ligase complex(GO:0072669) |
| 0.0 | 0.2 | GO:0097136 | Bcl-2 family protein complex(GO:0097136) |
| 0.0 | 0.0 | GO:0031265 | CD95 death-inducing signaling complex(GO:0031265) |
| 0.0 | 1.6 | GO:0030964 | mitochondrial respiratory chain complex I(GO:0005747) NADH dehydrogenase complex(GO:0030964) respiratory chain complex I(GO:0045271) |
| 0.0 | 0.5 | GO:0032426 | stereocilium tip(GO:0032426) |
| 0.0 | 0.5 | GO:0030914 | STAGA complex(GO:0030914) |
| 0.0 | 0.4 | GO:0042575 | DNA polymerase complex(GO:0042575) |
| 0.0 | 0.2 | GO:0045252 | oxoglutarate dehydrogenase complex(GO:0045252) |
| 0.0 | 0.3 | GO:0008074 | guanylate cyclase complex, soluble(GO:0008074) |
| 0.0 | 0.1 | GO:0070044 | synaptobrevin 2-SNAP-25-syntaxin-1a complex(GO:0070044) |
| 0.0 | 0.3 | GO:0036513 | Derlin-1 retrotranslocation complex(GO:0036513) |
| 0.0 | 0.8 | GO:0005719 | nuclear euchromatin(GO:0005719) |
| 0.0 | 0.1 | GO:0002189 | ribose phosphate diphosphokinase complex(GO:0002189) |
| 0.0 | 0.2 | GO:0005964 | phosphorylase kinase complex(GO:0005964) |
| 0.0 | 0.3 | GO:0071439 | clathrin complex(GO:0071439) |
| 0.0 | 0.2 | GO:0030122 | AP-2 adaptor complex(GO:0030122) |
| 0.0 | 0.3 | GO:0005750 | mitochondrial respiratory chain complex III(GO:0005750) respiratory chain complex III(GO:0045275) |
| 0.0 | 0.2 | GO:0097208 | alveolar lamellar body(GO:0097208) |
| 0.0 | 0.2 | GO:0036057 | filtration diaphragm(GO:0036056) slit diaphragm(GO:0036057) |
| 0.0 | 0.1 | GO:0034098 | VCP-NPL4-UFD1 AAA ATPase complex(GO:0034098) |
| 0.0 | 0.3 | GO:0000813 | ESCRT I complex(GO:0000813) |
| 0.0 | 0.1 | GO:0043527 | tRNA methyltransferase complex(GO:0043527) |
| 0.0 | 0.7 | GO:1902554 | serine/threonine protein kinase complex(GO:1902554) |
| 0.0 | 0.1 | GO:0046696 | lipopolysaccharide receptor complex(GO:0046696) |
| 0.0 | 0.0 | GO:0031264 | death-inducing signaling complex(GO:0031264) |
| 0.0 | 0.1 | GO:0031262 | Ndc80 complex(GO:0031262) |
| 0.0 | 0.3 | GO:0031932 | TORC2 complex(GO:0031932) |
| 0.0 | 0.4 | GO:0005779 | integral component of peroxisomal membrane(GO:0005779) |
| 0.0 | 0.5 | GO:0000159 | protein phosphatase type 2A complex(GO:0000159) |
| 0.0 | 0.1 | GO:0048476 | Holliday junction resolvase complex(GO:0048476) |
| 0.0 | 1.0 | GO:0000315 | organellar large ribosomal subunit(GO:0000315) mitochondrial large ribosomal subunit(GO:0005762) |
| 0.0 | 0.3 | GO:0098799 | outer mitochondrial membrane protein complex(GO:0098799) |
| 0.0 | 0.1 | GO:0001940 | male pronucleus(GO:0001940) |
| 0.0 | 0.2 | GO:0044666 | MLL3/4 complex(GO:0044666) |
| 0.0 | 0.3 | GO:0030877 | beta-catenin destruction complex(GO:0030877) |
| 0.0 | 0.1 | GO:0005726 | perichromatin fibrils(GO:0005726) |
| 0.0 | 0.1 | GO:0097149 | centralspindlin complex(GO:0097149) |
| 0.0 | 0.3 | GO:0005583 | fibrillar collagen trimer(GO:0005583) banded collagen fibril(GO:0098643) |
| 0.0 | 0.5 | GO:0032588 | trans-Golgi network membrane(GO:0032588) |
| 0.0 | 0.1 | GO:0033276 | transcription factor TFTC complex(GO:0033276) |
| 0.0 | 0.2 | GO:0042613 | MHC class II protein complex(GO:0042613) |
| 0.0 | 0.3 | GO:0043240 | Fanconi anaemia nuclear complex(GO:0043240) |
| 0.0 | 0.5 | GO:0035861 | site of double-strand break(GO:0035861) |
| 0.0 | 0.1 | GO:0031428 | box C/D snoRNP complex(GO:0031428) |
| 0.0 | 0.5 | GO:0044665 | MLL1/2 complex(GO:0044665) MLL1 complex(GO:0071339) |
| 0.0 | 0.1 | GO:1990716 | axonemal central apparatus(GO:1990716) |
| 0.0 | 0.3 | GO:0016460 | myosin II complex(GO:0016460) |
| 0.0 | 0.1 | GO:0071204 | histone pre-mRNA 3'end processing complex(GO:0071204) |
| 0.0 | 0.1 | GO:0016593 | Cdc73/Paf1 complex(GO:0016593) |
| 0.0 | 0.1 | GO:1990712 | HFE-transferrin receptor complex(GO:1990712) |
| 0.0 | 0.2 | GO:0043020 | NADPH oxidase complex(GO:0043020) |
| 0.0 | 0.2 | GO:0031512 | motile primary cilium(GO:0031512) |
| 0.0 | 0.4 | GO:0005868 | cytoplasmic dynein complex(GO:0005868) |
| 0.0 | 0.2 | GO:0005664 | origin recognition complex(GO:0000808) nuclear origin of replication recognition complex(GO:0005664) |
| 0.0 | 0.1 | GO:0016589 | NURF complex(GO:0016589) |
| 0.0 | 0.1 | GO:0005863 | striated muscle myosin thick filament(GO:0005863) |
| 0.0 | 0.2 | GO:0000164 | protein phosphatase type 1 complex(GO:0000164) |
| 0.0 | 0.1 | GO:0071001 | U4/U6 snRNP(GO:0071001) |
| 0.0 | 0.1 | GO:0035339 | SPOTS complex(GO:0035339) |
| 0.0 | 0.2 | GO:0070578 | RISC-loading complex(GO:0070578) |
| 0.0 | 0.7 | GO:0031672 | A band(GO:0031672) |
| 0.0 | 1.9 | GO:0030176 | integral component of endoplasmic reticulum membrane(GO:0030176) |
| 0.0 | 0.2 | GO:1990124 | messenger ribonucleoprotein complex(GO:1990124) |
| 0.0 | 0.1 | GO:0098536 | deuterosome(GO:0098536) |
| 0.0 | 0.1 | GO:0000796 | condensin complex(GO:0000796) |
| 0.0 | 0.1 | GO:0032983 | kainate selective glutamate receptor complex(GO:0032983) |
| 0.0 | 0.1 | GO:0036449 | microtubule minus-end(GO:0036449) |
| 0.0 | 0.3 | GO:0035686 | sperm fibrous sheath(GO:0035686) |
| 0.0 | 0.1 | GO:0005828 | kinetochore microtubule(GO:0005828) |
| 0.0 | 0.1 | GO:0033180 | proton-transporting V-type ATPase, V1 domain(GO:0033180) |
| 0.0 | 0.0 | GO:0001939 | female pronucleus(GO:0001939) |
| 0.0 | 1.9 | GO:0005759 | mitochondrial matrix(GO:0005759) |
| 0.0 | 0.1 | GO:0000798 | nuclear cohesin complex(GO:0000798) |
| 0.0 | 0.1 | GO:0060091 | kinocilium(GO:0060091) |
| 0.0 | 0.3 | GO:0071012 | catalytic step 1 spliceosome(GO:0071012) |
| 0.0 | 0.1 | GO:0030891 | VCB complex(GO:0030891) |
| 0.0 | 0.0 | GO:0090498 | extrinsic component of Golgi membrane(GO:0090498) |
| 0.0 | 0.1 | GO:0017101 | aminoacyl-tRNA synthetase multienzyme complex(GO:0017101) |
| 0.0 | 0.4 | GO:0005790 | smooth endoplasmic reticulum(GO:0005790) |
| 0.0 | 0.1 | GO:0031415 | NatA complex(GO:0031415) |
| 0.0 | 0.6 | GO:0031903 | peroxisomal membrane(GO:0005778) microbody membrane(GO:0031903) |
| 0.0 | 0.6 | GO:0005801 | cis-Golgi network(GO:0005801) |
| 0.0 | 0.0 | GO:0033648 | host intracellular organelle(GO:0033647) host intracellular membrane-bounded organelle(GO:0033648) |
| 0.0 | 0.1 | GO:0031227 | intrinsic component of endoplasmic reticulum membrane(GO:0031227) |
| 0.0 | 0.2 | GO:0070069 | cytochrome complex(GO:0070069) |
| 0.0 | 1.7 | GO:0005604 | basement membrane(GO:0005604) |
| 0.0 | 0.1 | GO:0097542 | ciliary tip(GO:0097542) |
| 0.0 | 0.2 | GO:0001527 | microfibril(GO:0001527) |
| 0.0 | 0.5 | GO:0005793 | endoplasmic reticulum-Golgi intermediate compartment(GO:0005793) |
| 0.0 | 0.1 | GO:0098827 | endoplasmic reticulum subcompartment(GO:0098827) |
| 0.0 | 0.1 | GO:0005579 | membrane attack complex(GO:0005579) |
| 0.0 | 0.1 | GO:0005594 | collagen type IX trimer(GO:0005594) |
| 0.0 | 0.1 | GO:0042406 | extrinsic component of endoplasmic reticulum membrane(GO:0042406) |
| 0.0 | 1.0 | GO:0016605 | PML body(GO:0016605) |
| 0.0 | 0.1 | GO:0030061 | mitochondrial crista(GO:0030061) |
| 0.0 | 0.2 | GO:0010369 | chromocenter(GO:0010369) |
| 0.0 | 0.1 | GO:0000444 | MIS12/MIND type complex(GO:0000444) |
| 0.0 | 0.3 | GO:0008023 | transcription elongation factor complex(GO:0008023) |
| 0.0 | 0.1 | GO:0005744 | mitochondrial inner membrane presequence translocase complex(GO:0005744) |
| 0.0 | 0.2 | GO:0097431 | mitotic spindle pole(GO:0097431) |
| 0.0 | 0.1 | GO:0070876 | SOSS complex(GO:0070876) |
| 0.0 | 0.1 | GO:0070419 | nonhomologous end joining complex(GO:0070419) |
| 0.0 | 0.0 | GO:0000835 | ER ubiquitin ligase complex(GO:0000835) Hrd1p ubiquitin ligase complex(GO:0000836) |
| 0.0 | 0.3 | GO:0097610 | cleavage furrow(GO:0032154) cell surface furrow(GO:0097610) |
| 0.0 | 0.1 | GO:0035327 | transcriptionally active chromatin(GO:0035327) |
| 0.0 | 1.0 | GO:0097014 | axoneme(GO:0005930) ciliary plasm(GO:0097014) |
| 0.0 | 0.4 | GO:0001772 | immunological synapse(GO:0001772) |
| 0.0 | 0.3 | GO:0030118 | clathrin coat(GO:0030118) |
| 0.0 | 0.0 | GO:0070032 | synaptobrevin 2-SNAP-25-syntaxin-1a-complexin I complex(GO:0070032) |
| 0.0 | 0.0 | GO:0070939 | Dsl1p complex(GO:0070939) |
| 0.0 | 0.1 | GO:0070847 | core mediator complex(GO:0070847) |
| 0.0 | 0.1 | GO:0046581 | intercellular canaliculus(GO:0046581) |
| 0.0 | 0.1 | GO:0032777 | Piccolo NuA4 histone acetyltransferase complex(GO:0032777) |
| 0.0 | 0.1 | GO:0005885 | Arp2/3 protein complex(GO:0005885) |
| 0.0 | 0.6 | GO:0034707 | chloride channel complex(GO:0034707) |
| 0.0 | 0.0 | GO:0097427 | microtubule bundle(GO:0097427) |
| 0.0 | 0.1 | GO:0090571 | RNA polymerase II transcription repressor complex(GO:0090571) |
| 0.0 | 0.0 | GO:0000802 | transverse filament(GO:0000802) |
| 0.0 | 0.1 | GO:0000346 | transcription export complex(GO:0000346) |
| 0.0 | 0.3 | GO:0030662 | coated vesicle membrane(GO:0030662) |
| 0.0 | 0.0 | GO:0097422 | tubular endosome(GO:0097422) |
| 0.0 | 0.3 | GO:0016235 | aggresome(GO:0016235) |
| 0.0 | 0.0 | GO:0033553 | rDNA heterochromatin(GO:0033553) |
| 0.0 | 0.0 | GO:0005672 | transcription factor TFIIA complex(GO:0005672) |
| 0.0 | 0.0 | GO:0000938 | GARP complex(GO:0000938) |
| 0.0 | 0.0 | GO:0016222 | procollagen-proline 4-dioxygenase complex(GO:0016222) |
| 0.0 | 0.2 | GO:0048786 | presynaptic active zone(GO:0048786) |
| 0.0 | 0.1 | GO:0032039 | integrator complex(GO:0032039) |
| 0.0 | 0.7 | GO:0005814 | centriole(GO:0005814) |
| 0.0 | 0.1 | GO:0000177 | cytoplasmic exosome (RNase complex)(GO:0000177) |
| 0.0 | 0.0 | GO:0016281 | eukaryotic translation initiation factor 4F complex(GO:0016281) |
| 0.0 | 0.0 | GO:0005956 | protein kinase CK2 complex(GO:0005956) |
| 0.0 | 0.4 | GO:0005758 | mitochondrial intermembrane space(GO:0005758) |
| 0.0 | 0.0 | GO:0030896 | checkpoint clamp complex(GO:0030896) |
| 0.0 | 1.7 | GO:0045211 | postsynaptic membrane(GO:0045211) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 1.1 | 3.3 | GO:0005006 | epidermal growth factor-activated receptor activity(GO:0005006) |
| 0.7 | 2.0 | GO:0016743 | carboxyl- or carbamoyltransferase activity(GO:0016743) |
| 0.7 | 1.3 | GO:0043125 | ErbB-3 class receptor binding(GO:0043125) |
| 0.5 | 2.0 | GO:0047023 | androsterone dehydrogenase activity(GO:0047023) |
| 0.5 | 1.4 | GO:0004771 | sterol esterase activity(GO:0004771) |
| 0.4 | 1.2 | GO:0016842 | amidine-lyase activity(GO:0016842) |
| 0.4 | 0.8 | GO:0038181 | bile acid receptor activity(GO:0038181) |
| 0.4 | 1.1 | GO:0070644 | vitamin D response element binding(GO:0070644) |
| 0.3 | 1.4 | GO:0032896 | palmitoyl-CoA 9-desaturase activity(GO:0032896) |
| 0.3 | 1.0 | GO:0036042 | long-chain fatty acyl-CoA binding(GO:0036042) |
| 0.3 | 1.0 | GO:0001069 | regulatory region RNA binding(GO:0001069) |
| 0.3 | 0.9 | GO:0032190 | acrosin binding(GO:0032190) |
| 0.3 | 0.8 | GO:0004505 | phenylalanine 4-monooxygenase activity(GO:0004505) |
| 0.3 | 1.1 | GO:0015183 | L-aspartate transmembrane transporter activity(GO:0015183) |
| 0.3 | 0.8 | GO:0000340 | RNA 7-methylguanosine cap binding(GO:0000340) |
| 0.2 | 2.0 | GO:0050072 | m7G(5')pppN diphosphatase activity(GO:0050072) |
| 0.2 | 0.7 | GO:0002134 | UTP binding(GO:0002134) pyrimidine ribonucleoside binding(GO:0032551) |
| 0.2 | 0.7 | GO:0018479 | benzaldehyde dehydrogenase (NAD+) activity(GO:0018479) |
| 0.2 | 0.9 | GO:0016453 | acetyl-CoA C-acetyltransferase activity(GO:0003985) C-acetyltransferase activity(GO:0016453) |
| 0.2 | 0.9 | GO:0009374 | biotin binding(GO:0009374) |
| 0.2 | 0.4 | GO:0031697 | beta-1 adrenergic receptor binding(GO:0031697) |
| 0.2 | 1.3 | GO:0047760 | butyrate-CoA ligase activity(GO:0047760) |
| 0.2 | 1.0 | GO:0004022 | alcohol dehydrogenase (NAD) activity(GO:0004022) |
| 0.2 | 0.8 | GO:0003846 | 2-acylglycerol O-acyltransferase activity(GO:0003846) |
| 0.2 | 1.2 | GO:0034875 | oxidoreductase activity, acting on CH or CH2 groups, quinone or similar compound as acceptor(GO:0033695) caffeine oxidase activity(GO:0034875) |
| 0.2 | 1.0 | GO:0000828 | inositol hexakisphosphate kinase activity(GO:0000828) inositol hexakisphosphate 5-kinase activity(GO:0000832) inositol hexakisphosphate 1-kinase activity(GO:0052723) inositol hexakisphosphate 3-kinase activity(GO:0052724) |
| 0.2 | 1.7 | GO:0004499 | N,N-dimethylaniline monooxygenase activity(GO:0004499) |
| 0.2 | 0.6 | GO:0016716 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, another compound as one donor, and incorporation of one atom of oxygen(GO:0016716) |
| 0.2 | 0.6 | GO:0097109 | neuroligin family protein binding(GO:0097109) |
| 0.2 | 0.6 | GO:0003941 | L-serine ammonia-lyase activity(GO:0003941) |
| 0.2 | 0.7 | GO:1900750 | glutathione binding(GO:0043295) oligopeptide binding(GO:1900750) |
| 0.2 | 0.5 | GO:0034186 | apolipoprotein A-I binding(GO:0034186) |
| 0.2 | 0.5 | GO:0005220 | inositol 1,4,5-trisphosphate-sensitive calcium-release channel activity(GO:0005220) |
| 0.2 | 0.5 | GO:0004366 | glycerol-3-phosphate O-acyltransferase activity(GO:0004366) |
| 0.2 | 0.2 | GO:0030911 | TPR domain binding(GO:0030911) |
| 0.2 | 0.7 | GO:0004062 | aryl sulfotransferase activity(GO:0004062) |
| 0.2 | 1.1 | GO:0004908 | interleukin-1 receptor activity(GO:0004908) |
| 0.2 | 0.5 | GO:0003726 | double-stranded RNA adenosine deaminase activity(GO:0003726) |
| 0.2 | 0.5 | GO:0008384 | IkappaB kinase activity(GO:0008384) |
| 0.1 | 1.3 | GO:0002162 | dystroglycan binding(GO:0002162) |
| 0.1 | 0.1 | GO:0050051 | leukotriene-B4 20-monooxygenase activity(GO:0050051) |
| 0.1 | 0.9 | GO:0043184 | vascular endothelial growth factor receptor 2 binding(GO:0043184) |
| 0.1 | 0.4 | GO:0005119 | smoothened binding(GO:0005119) |
| 0.1 | 0.6 | GO:0052650 | NADP-retinol dehydrogenase activity(GO:0052650) |
| 0.1 | 0.7 | GO:0003831 | beta-N-acetylglucosaminylglycopeptide beta-1,4-galactosyltransferase activity(GO:0003831) |
| 0.1 | 0.6 | GO:0001055 | RNA polymerase II activity(GO:0001055) |
| 0.1 | 0.4 | GO:0016838 | carbon-oxygen lyase activity, acting on phosphates(GO:0016838) |
| 0.1 | 0.4 | GO:0031826 | type 2A serotonin receptor binding(GO:0031826) |
| 0.1 | 0.7 | GO:0051525 | NFAT protein binding(GO:0051525) |
| 0.1 | 0.4 | GO:0005347 | ATP transmembrane transporter activity(GO:0005347) |
| 0.1 | 0.7 | GO:0070728 | leucine binding(GO:0070728) |
| 0.1 | 1.8 | GO:0070402 | NADPH binding(GO:0070402) |
| 0.1 | 0.7 | GO:0004556 | alpha-amylase activity(GO:0004556) |
| 0.1 | 0.5 | GO:0033142 | progesterone receptor binding(GO:0033142) |
| 0.1 | 0.4 | GO:0055100 | adiponectin binding(GO:0055100) |
| 0.1 | 0.5 | GO:0034056 | estrogen response element binding(GO:0034056) |
| 0.1 | 0.7 | GO:0050733 | RS domain binding(GO:0050733) |
| 0.1 | 1.6 | GO:0015643 | toxic substance binding(GO:0015643) |
| 0.1 | 0.5 | GO:0052832 | inositol monophosphate 1-phosphatase activity(GO:0008934) inositol monophosphate 3-phosphatase activity(GO:0052832) inositol monophosphate 4-phosphatase activity(GO:0052833) inositol monophosphate phosphatase activity(GO:0052834) |
| 0.1 | 0.4 | GO:0034955 | 2,3-dihydroxy DDT 1,2-dioxygenase activity(GO:0018542) phenanthrene dioxygenase activity(GO:0018555) 2,2',3-trihydroxybiphenyl dioxygenase activity(GO:0018556) 1,2-dihydroxyfluorene 1,1-alpha-dioxygenase activity(GO:0018557) 5,6-dihydroxy-3-methyl-2-oxo-1,2-dihydroquinoline dioxygenase activity(GO:0018558) 1,1-dichloro-2-(dihydroxy-4-chlorophenyl)-(4-chlorophenyl)ethene 1,2-dioxygenase activity(GO:0018559) protocatechuate 3,4-dioxygenase type II activity(GO:0018560) 2'-aminobiphenyl-2,3-diol 1,2-dioxygenase activity(GO:0018561) 3,4-dihydroxyfluorene 4,4-alpha-dioxygenase activity(GO:0018562) 2,3-dihydroxy-ethylbenzene 1,2-dioxygenase activity(GO:0018563) carbazole 1,9a-dioxygenase activity(GO:0018564) dihydroxydibenzothiophene dioxygenase activity(GO:0018565) 1,2-dihydroxynaphthalene-6-sulfonate 1,8a-dioxygenase activity(GO:0018566) styrene dioxygenase activity(GO:0018567) 3,4-dihydroxyphenanthrene dioxygenase activity(GO:0018568) hydroquinone 1,2-dioxygenase activity(GO:0018569) p-cumate 2,3-dioxygenase activity(GO:0018570) 2,3-dihydroxy-p-cumate dioxygenase activity(GO:0018571) 3,5-dichlorocatechol 1,2-dioxygenase activity(GO:0018572) 2-aminophenol 1,6-dioxygenase activity(GO:0018573) 2,6-dichloro-p-hydroquinone 1,2-dioxygenase activity(GO:0018574) chlorocatechol 1,2-dioxygenase activity(GO:0018575) catechol dioxygenase activity(GO:0019114) dihydroxyfluorene dioxygenase activity(GO:0019117) 5-aminosalicylate dioxygenase activity(GO:0034543) 3-hydroxy-2-naphthoate 2,3-dioxygenase activity(GO:0034803) benzo(a)pyrene 11,12-dioxygenase activity(GO:0034806) benzo(a)pyrene 4,5-dioxygenase activity(GO:0034808) 4,5-dihydroxybenzo(a)pyrene dioxygenase activity(GO:0034810) benzo(a)pyrene 9,10-dioxygenase activity(GO:0034811) 9,10-dihydroxybenzo(a)pyrene dioxygenase activity(GO:0034812) benzo(a)pyrene 7,8-dioxygenase activity(GO:0034813) 7,8-dihydroxy benzo(a)pyrene dioxygenase activity(GO:0034814) 1,2-dihydroxy-5,6,7,8-tetrahydronaphthalene extradiol dioxygenase activity(GO:0034827) 2-mercaptobenzothiazole dioxygenase activity(GO:0034834) pyridine-3,4-diol dioxygenase activity(GO:0034895) pyrene dioxygenase activity(GO:0034920) 4,5-dihydroxypyrene dioxygenase activity(GO:0034922) phenanthrene-4-carboxylate dioxygenase activity(GO:0034934) tetrachlorobenzene dioxygenase activity(GO:0034935) 4,6-dichloro-3-methylcatechol 1,2-dioxygenase activity(GO:0034936) 2,3-dihydroxydiphenyl ether dioxygenase activity(GO:0034955) diphenyl ether 1,2-dioxygenase activity(GO:0034956) arachidonate 8(S)-lipoxygenase activity(GO:0036403) 4-hydroxycatechol 1,2-dioxygenase activity(GO:0047074) |
| 0.1 | 0.8 | GO:0005381 | iron ion transmembrane transporter activity(GO:0005381) |
| 0.1 | 0.4 | GO:0030160 | GKAP/Homer scaffold activity(GO:0030160) |
| 0.1 | 0.4 | GO:0035514 | DNA demethylase activity(GO:0035514) |
| 0.1 | 0.4 | GO:0050816 | phosphothreonine binding(GO:0050816) |
| 0.1 | 0.2 | GO:0042281 | dolichyl pyrophosphate Man9GlcNAc2 alpha-1,3-glucosyltransferase activity(GO:0042281) |
| 0.1 | 0.5 | GO:0097001 | ceramide binding(GO:0097001) |
| 0.1 | 0.8 | GO:0005078 | MAP-kinase scaffold activity(GO:0005078) |
| 0.1 | 0.9 | GO:0046933 | proton-transporting ATP synthase activity, rotational mechanism(GO:0046933) |
| 0.1 | 0.4 | GO:0019788 | NEDD8 transferase activity(GO:0019788) |
| 0.1 | 0.1 | GO:0018423 | protein C-terminal leucine carboxyl O-methyltransferase activity(GO:0018423) |
| 0.1 | 0.3 | GO:0003987 | acetate-CoA ligase activity(GO:0003987) |
| 0.1 | 0.2 | GO:0032564 | dATP binding(GO:0032564) |
| 0.1 | 0.4 | GO:0004566 | beta-glucuronidase activity(GO:0004566) |
| 0.1 | 0.1 | GO:0032557 | pyrimidine ribonucleotide binding(GO:0032557) |
| 0.1 | 0.3 | GO:0050508 | glucuronosyl-N-acetylglucosaminyl-proteoglycan 4-alpha-N-acetylglucosaminyltransferase activity(GO:0050508) |
| 0.1 | 1.0 | GO:0003854 | 3-beta-hydroxy-delta5-steroid dehydrogenase activity(GO:0003854) |
| 0.1 | 1.2 | GO:0052811 | cobinamide kinase activity(GO:0008819) phytol kinase activity(GO:0010276) phenol kinase activity(GO:0018720) cyclin-dependent protein kinase activating kinase regulator activity(GO:0019914) inositol tetrakisphosphate 2-kinase activity(GO:0032942) heptose 7-phosphate kinase activity(GO:0033785) aminoglycoside phosphotransferase activity(GO:0034071) eukaryotic elongation factor-2 kinase regulator activity(GO:0042556) eukaryotic elongation factor-2 kinase activator activity(GO:0042557) LPPG:FO 2-phospho-L-lactate transferase activity(GO:0043743) cytidine kinase activity(GO:0043771) glycerate 2-kinase activity(GO:0043798) (S)-lactate 2-kinase activity(GO:0043841) phosphoserine:homoserine phosphotransferase activity(GO:0043899) L-seryl-tRNA(Sec) kinase activity(GO:0043915) phosphocholine transferase activity(GO:0044605) GTP-dependent polynucleotide kinase activity(GO:0051735) farnesol kinase activity(GO:0052668) CTP:2-trans,-6-trans-farnesol kinase activity(GO:0052669) geraniol kinase activity(GO:0052670) geranylgeraniol kinase activity(GO:0052671) CTP:geranylgeraniol kinase activity(GO:0052672) prenol kinase activity(GO:0052673) 1-phosphatidylinositol-5-kinase activity(GO:0052810) 1-phosphatidylinositol-3-phosphate 4-kinase activity(GO:0052811) phosphatidylinositol-3,4-bisphosphate 5-kinase activity(GO:0052812) inositol-3,4,6-trisphosphate 1-kinase activity(GO:0052835) inositol 5-diphosphate pentakisphosphate 5-kinase activity(GO:0052836) inositol diphosphate tetrakisphosphate kinase activity(GO:0052839) |
| 0.1 | 0.4 | GO:0005025 | transforming growth factor beta receptor activity, type I(GO:0005025) |
| 0.1 | 0.7 | GO:0046790 | virion binding(GO:0046790) |
| 0.1 | 0.4 | GO:0004035 | alkaline phosphatase activity(GO:0004035) |
| 0.1 | 0.4 | GO:0015173 | aromatic amino acid transmembrane transporter activity(GO:0015173) |
| 0.1 | 0.3 | GO:0004359 | glutaminase activity(GO:0004359) |
| 0.1 | 0.6 | GO:0005072 | transforming growth factor beta receptor, cytoplasmic mediator activity(GO:0005072) |
| 0.1 | 2.3 | GO:0030552 | cAMP binding(GO:0030552) |
| 0.1 | 0.5 | GO:0005007 | fibroblast growth factor-activated receptor activity(GO:0005007) |
| 0.1 | 1.2 | GO:0019206 | nucleoside kinase activity(GO:0019206) |
| 0.1 | 1.1 | GO:0051787 | misfolded protein binding(GO:0051787) |
| 0.1 | 0.4 | GO:0003840 | gamma-glutamyltransferase activity(GO:0003840) glutathione hydrolase activity(GO:0036374) |
| 0.1 | 0.4 | GO:0005173 | stem cell factor receptor binding(GO:0005173) |
| 0.1 | 0.3 | GO:0015157 | sucrose:proton symporter activity(GO:0008506) sucrose transmembrane transporter activity(GO:0008515) disaccharide transmembrane transporter activity(GO:0015154) oligosaccharide transmembrane transporter activity(GO:0015157) |
| 0.1 | 0.3 | GO:0017034 | Rap guanyl-nucleotide exchange factor activity(GO:0017034) |
| 0.1 | 1.7 | GO:0016864 | protein disulfide isomerase activity(GO:0003756) intramolecular oxidoreductase activity, transposing S-S bonds(GO:0016864) |
| 0.1 | 0.3 | GO:0004924 | oncostatin-M receptor activity(GO:0004924) |
| 0.1 | 0.8 | GO:0070513 | death domain binding(GO:0070513) |
| 0.1 | 0.3 | GO:0016802 | adenosylhomocysteinase activity(GO:0004013) trialkylsulfonium hydrolase activity(GO:0016802) |
| 0.1 | 0.4 | GO:0004726 | non-membrane spanning protein tyrosine phosphatase activity(GO:0004726) |
| 0.1 | 0.4 | GO:0001025 | RNA polymerase III transcription factor binding(GO:0001025) |
| 0.1 | 0.9 | GO:0016832 | aldehyde-lyase activity(GO:0016832) |
| 0.1 | 0.9 | GO:0008195 | phosphatidate phosphatase activity(GO:0008195) |
| 0.1 | 2.7 | GO:0080031 | prenylcysteine methylesterase activity(GO:0010296) 1-oxa-2-oxocycloheptane lactonase activity(GO:0018731) sulfolactone hydrolase activity(GO:0018732) butyrolactone hydrolase activity(GO:0018734) endosulfan lactone lactonase activity(GO:0034892) L-ascorbate 6-phosphate lactonase activity(GO:0035460) Ser-tRNA(Thr) hydrolase activity(GO:0043905) Ala-tRNA(Pro) hydrolase activity(GO:0043906) Cys-tRNA(Pro) hydrolase activity(GO:0043907) Ser(Gly)-tRNA(Ala) hydrolase activity(GO:0043908) all-trans-retinyl-palmitate hydrolase, all-trans-retinol forming activity(GO:0047376) mannosyl-oligosaccharide 1,6-alpha-mannosidase activity(GO:0052767) mannosyl-oligosaccharide 1,3-alpha-mannosidase activity(GO:0052768) methyl indole-3-acetate esterase activity(GO:0080030) methyl salicylate esterase activity(GO:0080031) methyl jasmonate esterase activity(GO:0080032) |
| 0.1 | 0.4 | GO:0004468 | lysine N-acetyltransferase activity, acting on acetyl phosphate as donor(GO:0004468) |
| 0.1 | 0.2 | GO:0015143 | urate transmembrane transporter activity(GO:0015143) salt transmembrane transporter activity(GO:1901702) |
| 0.1 | 0.3 | GO:0071987 | WD40-repeat domain binding(GO:0071987) |
| 0.1 | 0.1 | GO:0008379 | thioredoxin peroxidase activity(GO:0008379) |
| 0.1 | 0.5 | GO:0071933 | Arp2/3 complex binding(GO:0071933) |
| 0.1 | 0.4 | GO:0015189 | arginine transmembrane transporter activity(GO:0015181) L-lysine transmembrane transporter activity(GO:0015189) |
| 0.1 | 0.2 | GO:1990825 | sequence-specific mRNA binding(GO:1990825) |
| 0.1 | 0.6 | GO:0070097 | delta-catenin binding(GO:0070097) |
| 0.1 | 0.3 | GO:0001602 | pancreatic polypeptide receptor activity(GO:0001602) |
| 0.1 | 0.2 | GO:0033829 | O-fucosylpeptide 3-beta-N-acetylglucosaminyltransferase activity(GO:0033829) |
| 0.1 | 0.4 | GO:0016215 | acyl-CoA desaturase activity(GO:0016215) |
| 0.1 | 0.3 | GO:0016286 | small conductance calcium-activated potassium channel activity(GO:0016286) |
| 0.1 | 0.3 | GO:0031781 | melanocortin receptor binding(GO:0031779) type 3 melanocortin receptor binding(GO:0031781) type 4 melanocortin receptor binding(GO:0031782) |
| 0.1 | 0.4 | GO:0016174 | NAD(P)H oxidase activity(GO:0016174) |
| 0.1 | 0.2 | GO:0071532 | ankyrin repeat binding(GO:0071532) |
| 0.1 | 0.2 | GO:0000702 | oxidized base lesion DNA N-glycosylase activity(GO:0000702) |
| 0.1 | 1.0 | GO:0005545 | 1-phosphatidylinositol binding(GO:0005545) |
| 0.1 | 0.4 | GO:0008508 | bile acid:sodium symporter activity(GO:0008508) |
| 0.1 | 1.3 | GO:0005528 | macrolide binding(GO:0005527) FK506 binding(GO:0005528) |
| 0.1 | 0.6 | GO:0019869 | chloride channel inhibitor activity(GO:0019869) |
| 0.1 | 0.2 | GO:0004605 | phosphatidate cytidylyltransferase activity(GO:0004605) |
| 0.1 | 0.3 | GO:0017150 | tRNA dihydrouridine synthase activity(GO:0017150) |
| 0.1 | 1.1 | GO:0015095 | magnesium ion transmembrane transporter activity(GO:0015095) |
| 0.1 | 0.1 | GO:0061629 | RNA polymerase II sequence-specific DNA binding transcription factor binding(GO:0061629) |
| 0.1 | 0.2 | GO:0017002 | activin-activated receptor activity(GO:0017002) |
| 0.1 | 0.1 | GO:0034040 | lipid-transporting ATPase activity(GO:0034040) |
| 0.1 | 0.8 | GO:0001054 | RNA polymerase I activity(GO:0001054) |
| 0.1 | 0.3 | GO:0032051 | clathrin light chain binding(GO:0032051) |
| 0.1 | 0.3 | GO:0016899 | oxidoreductase activity, acting on the CH-OH group of donors, oxygen as acceptor(GO:0016899) |
| 0.1 | 0.9 | GO:0045236 | CXCR chemokine receptor binding(GO:0045236) |
| 0.1 | 0.3 | GO:0030984 | kininogen binding(GO:0030984) |
| 0.1 | 0.2 | GO:0030621 | U4 snRNA binding(GO:0030621) |
| 0.1 | 0.3 | GO:0042285 | UDP-xylosyltransferase activity(GO:0035252) xylosyltransferase activity(GO:0042285) |
| 0.1 | 0.3 | GO:0008499 | UDP-galactose:beta-N-acetylglucosamine beta-1,3-galactosyltransferase activity(GO:0008499) |
| 0.1 | 0.4 | GO:0016679 | oxidoreductase activity, acting on diphenols and related substances as donors(GO:0016679) |
| 0.1 | 0.6 | GO:0042043 | neurexin family protein binding(GO:0042043) |
| 0.1 | 0.4 | GO:0003688 | DNA replication origin binding(GO:0003688) |
| 0.1 | 0.5 | GO:0036310 | annealing helicase activity(GO:0036310) |
| 0.1 | 0.3 | GO:0003873 | 6-phosphofructo-2-kinase activity(GO:0003873) |
| 0.1 | 0.2 | GO:0097016 | L27 domain binding(GO:0097016) |
| 0.1 | 0.2 | GO:0016149 | translation release factor activity, codon specific(GO:0016149) |
| 0.1 | 0.4 | GO:0005049 | nuclear export signal receptor activity(GO:0005049) |
| 0.1 | 0.2 | GO:0008349 | MAP kinase kinase kinase kinase activity(GO:0008349) |
| 0.1 | 0.2 | GO:0071614 | linoleic acid epoxygenase activity(GO:0071614) |
| 0.1 | 0.2 | GO:0004090 | carbonyl reductase (NADPH) activity(GO:0004090) |
| 0.1 | 0.7 | GO:0015125 | bile acid transmembrane transporter activity(GO:0015125) |
| 0.1 | 0.2 | GO:0004687 | myosin light chain kinase activity(GO:0004687) |
| 0.1 | 0.5 | GO:0004033 | aldo-keto reductase (NADP) activity(GO:0004033) |
| 0.1 | 0.1 | GO:0005157 | macrophage colony-stimulating factor receptor binding(GO:0005157) |
| 0.1 | 0.3 | GO:0017040 | ceramidase activity(GO:0017040) |
| 0.1 | 0.1 | GO:0098821 | BMP receptor activity(GO:0098821) |
| 0.1 | 0.2 | GO:0004740 | pyruvate dehydrogenase (acetyl-transferring) kinase activity(GO:0004740) |
| 0.1 | 0.3 | GO:0036122 | BMP binding(GO:0036122) |
| 0.1 | 0.4 | GO:0004679 | AMP-activated protein kinase activity(GO:0004679) |
| 0.1 | 0.1 | GO:0050145 | nucleoside phosphate kinase activity(GO:0050145) |
| 0.1 | 0.4 | GO:0004571 | mannosyl-oligosaccharide 1,2-alpha-mannosidase activity(GO:0004571) |
| 0.1 | 1.2 | GO:0035255 | ionotropic glutamate receptor binding(GO:0035255) |
| 0.1 | 0.5 | GO:0102391 | decanoate--CoA ligase activity(GO:0102391) |
| 0.1 | 1.0 | GO:0005112 | Notch binding(GO:0005112) |
| 0.1 | 0.1 | GO:0030792 | methylarsonite methyltransferase activity(GO:0030792) |
| 0.1 | 0.3 | GO:0035312 | 5'-3' exodeoxyribonuclease activity(GO:0035312) |
| 0.1 | 0.5 | GO:0070569 | uridylyltransferase activity(GO:0070569) |
| 0.1 | 0.3 | GO:0055131 | C3HC4-type RING finger domain binding(GO:0055131) |
| 0.1 | 0.5 | GO:0008474 | palmitoyl-(protein) hydrolase activity(GO:0008474) palmitoyl hydrolase activity(GO:0098599) |
| 0.1 | 0.5 | GO:0016888 | endodeoxyribonuclease activity, producing 5'-phosphomonoesters(GO:0016888) |
| 0.1 | 0.3 | GO:0005324 | long-chain fatty acid transporter activity(GO:0005324) |
| 0.1 | 0.1 | GO:0004075 | biotin carboxylase activity(GO:0004075) |
| 0.1 | 0.1 | GO:0008607 | phosphorylase kinase regulator activity(GO:0008607) |
| 0.1 | 0.3 | GO:0051021 | GDP-dissociation inhibitor binding(GO:0051021) |
| 0.1 | 0.2 | GO:0047961 | glycine N-acyltransferase activity(GO:0047961) |
| 0.1 | 1.2 | GO:0005227 | calcium activated cation channel activity(GO:0005227) |
| 0.1 | 0.1 | GO:0031752 | D5 dopamine receptor binding(GO:0031752) |
| 0.1 | 0.7 | GO:0016646 | oxidoreductase activity, acting on the CH-NH group of donors, NAD or NADP as acceptor(GO:0016646) |
| 0.1 | 0.5 | GO:0097602 | cullin family protein binding(GO:0097602) |
| 0.0 | 0.1 | GO:0005483 | soluble NSF attachment protein activity(GO:0005483) |
| 0.0 | 0.5 | GO:0008641 | small protein activating enzyme activity(GO:0008641) |
| 0.0 | 0.1 | GO:0001075 | transcription factor activity, RNA polymerase II core promoter sequence-specific binding involved in preinitiation complex assembly(GO:0001075) |
| 0.0 | 0.1 | GO:0070653 | high-density lipoprotein particle receptor binding(GO:0070653) |
| 0.0 | 1.0 | GO:0050136 | NADH dehydrogenase (ubiquinone) activity(GO:0008137) NADH dehydrogenase (quinone) activity(GO:0050136) |
| 0.0 | 0.4 | GO:0097027 | ubiquitin-protein transferase activator activity(GO:0097027) |
| 0.0 | 0.1 | GO:0046974 | histone methyltransferase activity (H3-K9 specific)(GO:0046974) |
| 0.0 | 0.1 | GO:0016655 | oxidoreductase activity, acting on NAD(P)H, quinone or similar compound as acceptor(GO:0016655) |
| 0.0 | 0.2 | GO:0035184 | histone threonine kinase activity(GO:0035184) |
| 0.0 | 0.1 | GO:0019862 | IgA binding(GO:0019862) |
| 0.0 | 0.6 | GO:0004602 | glutathione peroxidase activity(GO:0004602) |
| 0.0 | 0.1 | GO:0018685 | alkane 1-monooxygenase activity(GO:0018685) |
| 0.0 | 0.2 | GO:0004126 | cytidine deaminase activity(GO:0004126) |
| 0.0 | 0.1 | GO:0002151 | G-quadruplex RNA binding(GO:0002151) |
| 0.0 | 0.2 | GO:0016151 | nickel cation binding(GO:0016151) |
| 0.0 | 0.1 | GO:0003976 | UDP-N-acetylglucosamine-lysosomal-enzyme N-acetylglucosaminephosphotransferase activity(GO:0003976) |
| 0.0 | 0.1 | GO:0015216 | adenine nucleotide transmembrane transporter activity(GO:0000295) purine ribonucleotide transmembrane transporter activity(GO:0005346) purine nucleotide transmembrane transporter activity(GO:0015216) |
| 0.0 | 0.4 | GO:0032036 | myosin heavy chain binding(GO:0032036) |
| 0.0 | 0.0 | GO:0000009 | alpha-1,6-mannosyltransferase activity(GO:0000009) |
| 0.0 | 1.2 | GO:0001205 | transcriptional activator activity, RNA polymerase II distal enhancer sequence-specific binding(GO:0001205) |
| 0.0 | 0.8 | GO:0015347 | sodium-independent organic anion transmembrane transporter activity(GO:0015347) |
| 0.0 | 0.1 | GO:0004813 | alanine-tRNA ligase activity(GO:0004813) |
| 0.0 | 0.1 | GO:0045134 | uridine-diphosphatase activity(GO:0045134) |
| 0.0 | 0.3 | GO:0004952 | dopamine neurotransmitter receptor activity, coupled via Gs(GO:0001588) dopamine neurotransmitter receptor activity(GO:0004952) |
| 0.0 | 0.0 | GO:0016662 | oxidoreductase activity, acting on other nitrogenous compounds as donors, cytochrome as acceptor(GO:0016662) |
| 0.0 | 0.4 | GO:0001162 | RNA polymerase II intronic transcription regulatory region sequence-specific DNA binding(GO:0001162) |
| 0.0 | 0.1 | GO:0042030 | ATPase inhibitor activity(GO:0042030) |
| 0.0 | 0.4 | GO:0003857 | 3-hydroxyacyl-CoA dehydrogenase activity(GO:0003857) |
| 0.0 | 0.4 | GO:0008046 | axon guidance receptor activity(GO:0008046) |
| 0.0 | 0.2 | GO:0003828 | alpha-N-acetylneuraminate alpha-2,8-sialyltransferase activity(GO:0003828) |
| 0.0 | 0.3 | GO:0004383 | guanylate cyclase activity(GO:0004383) |
| 0.0 | 0.1 | GO:0008597 | calcium-dependent protein serine/threonine phosphatase regulator activity(GO:0008597) |
| 0.0 | 0.1 | GO:0004416 | hydroxyacylglutathione hydrolase activity(GO:0004416) |
| 0.0 | 0.2 | GO:0004594 | pantothenate kinase activity(GO:0004594) |
| 0.0 | 1.7 | GO:0017046 | peptide hormone binding(GO:0017046) |
| 0.0 | 0.2 | GO:1904288 | BAT3 complex binding(GO:1904288) |
| 0.0 | 0.2 | GO:1990380 | Lys48-specific deubiquitinase activity(GO:1990380) |
| 0.0 | 0.7 | GO:0050681 | androgen receptor binding(GO:0050681) |
| 0.0 | 0.2 | GO:1990226 | histone methyltransferase binding(GO:1990226) |
| 0.0 | 0.1 | GO:0032052 | bile acid binding(GO:0032052) |
| 0.0 | 0.1 | GO:0010997 | anaphase-promoting complex binding(GO:0010997) |
| 0.0 | 0.1 | GO:0031698 | beta-2 adrenergic receptor binding(GO:0031698) |
| 0.0 | 0.1 | GO:0070548 | L-glutamine aminotransferase activity(GO:0070548) |
| 0.0 | 0.2 | GO:0043495 | protein anchor(GO:0043495) |
| 0.0 | 3.2 | GO:0015020 | glucuronosyltransferase activity(GO:0015020) |
| 0.0 | 0.9 | GO:0015002 | cytochrome-c oxidase activity(GO:0004129) heme-copper terminal oxidase activity(GO:0015002) oxidoreductase activity, acting on a heme group of donors, oxygen as acceptor(GO:0016676) |
| 0.0 | 0.2 | GO:0043140 | ATP-dependent 3'-5' DNA helicase activity(GO:0043140) |
| 0.0 | 0.2 | GO:0016443 | bidentate ribonuclease III activity(GO:0016443) |
| 0.0 | 0.2 | GO:0008948 | oxaloacetate decarboxylase activity(GO:0008948) |
| 0.0 | 0.1 | GO:0015065 | uridine nucleotide receptor activity(GO:0015065) G-protein coupled pyrimidinergic nucleotide receptor activity(GO:0071553) |
| 0.0 | 0.4 | GO:0008568 | microtubule-severing ATPase activity(GO:0008568) |
| 0.0 | 0.2 | GO:0019960 | C-X3-C chemokine binding(GO:0019960) |
| 0.0 | 0.2 | GO:0061665 | SUMO ligase activity(GO:0061665) |
| 0.0 | 0.1 | GO:0016530 | metallochaperone activity(GO:0016530) |
| 0.0 | 0.3 | GO:0010521 | telomerase inhibitor activity(GO:0010521) |
| 0.0 | 0.2 | GO:0097642 | calcitonin family receptor activity(GO:0097642) |
| 0.0 | 0.3 | GO:0042500 | aspartic endopeptidase activity, intramembrane cleaving(GO:0042500) |
| 0.0 | 0.5 | GO:0008266 | poly(U) RNA binding(GO:0008266) |
| 0.0 | 0.3 | GO:0015172 | acidic amino acid transmembrane transporter activity(GO:0015172) |
| 0.0 | 0.5 | GO:0005523 | tropomyosin binding(GO:0005523) |
| 0.0 | 0.1 | GO:0070567 | cytidylyltransferase activity(GO:0070567) |
| 0.0 | 0.7 | GO:0030332 | cyclin binding(GO:0030332) |
| 0.0 | 4.3 | GO:0004867 | serine-type endopeptidase inhibitor activity(GO:0004867) |
| 0.0 | 0.1 | GO:0005047 | signal recognition particle binding(GO:0005047) |
| 0.0 | 0.1 | GO:0004376 | glycolipid mannosyltransferase activity(GO:0004376) |
| 0.0 | 0.1 | GO:0035663 | Toll-like receptor 2 binding(GO:0035663) |
| 0.0 | 0.7 | GO:0005070 | SH3/SH2 adaptor activity(GO:0005070) |
| 0.0 | 0.2 | GO:0005375 | copper ion transmembrane transporter activity(GO:0005375) |
| 0.0 | 0.1 | GO:0098505 | G-rich strand telomeric DNA binding(GO:0098505) |
| 0.0 | 0.4 | GO:0004535 | poly(A)-specific ribonuclease activity(GO:0004535) |
| 0.0 | 0.1 | GO:0008073 | ornithine decarboxylase inhibitor activity(GO:0008073) |
| 0.0 | 0.3 | GO:0043996 | histone acetyltransferase activity (H4-K5 specific)(GO:0043995) histone acetyltransferase activity (H4-K8 specific)(GO:0043996) histone acetyltransferase activity (H4-K16 specific)(GO:0046972) |
| 0.0 | 0.6 | GO:0070530 | K63-linked polyubiquitin binding(GO:0070530) |
| 0.0 | 0.2 | GO:0090599 | alpha-glucosidase activity(GO:0090599) |
| 0.0 | 0.1 | GO:0004591 | oxoglutarate dehydrogenase (succinyl-transferring) activity(GO:0004591) |
| 0.0 | 0.1 | GO:0004749 | ribose phosphate diphosphokinase activity(GO:0004749) |
| 0.0 | 0.2 | GO:0031702 | type 1 angiotensin receptor binding(GO:0031702) |
| 0.0 | 0.2 | GO:0004689 | phosphorylase kinase activity(GO:0004689) |
| 0.0 | 0.6 | GO:0051990 | (R)-2-hydroxyglutarate dehydrogenase activity(GO:0051990) |
| 0.0 | 0.1 | GO:0033765 | steroid dehydrogenase activity, acting on the CH-CH group of donors(GO:0033765) |
| 0.0 | 0.1 | GO:0000293 | ferric-chelate reductase activity(GO:0000293) |
| 0.0 | 0.2 | GO:0001515 | opioid peptide activity(GO:0001515) |
| 0.0 | 0.1 | GO:0008079 | translation release factor activity(GO:0003747) translation termination factor activity(GO:0008079) |
| 0.0 | 0.1 | GO:0015220 | choline transmembrane transporter activity(GO:0015220) |
| 0.0 | 0.3 | GO:0008432 | JUN kinase binding(GO:0008432) |
| 0.0 | 0.1 | GO:0070324 | thyroid hormone binding(GO:0070324) |
| 0.0 | 0.1 | GO:0046624 | sphingolipid transporter activity(GO:0046624) |
| 0.0 | 0.3 | GO:0008430 | selenium binding(GO:0008430) |
| 0.0 | 0.2 | GO:0016713 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, reduced iron-sulfur protein as one donor, and incorporation of one atom of oxygen(GO:0016713) |
| 0.0 | 0.3 | GO:0005159 | insulin-like growth factor receptor binding(GO:0005159) |
| 0.0 | 0.1 | GO:0005042 | netrin receptor activity(GO:0005042) |
| 0.0 | 0.2 | GO:0102338 | fatty acid elongase activity(GO:0009922) 3-oxo-arachidoyl-CoA synthase activity(GO:0102336) 3-oxo-cerotoyl-CoA synthase activity(GO:0102337) 3-oxo-lignoceronyl-CoA synthase activity(GO:0102338) |
| 0.0 | 0.6 | GO:0016922 | ligand-dependent nuclear receptor binding(GO:0016922) |
| 0.0 | 0.1 | GO:0097322 | 7SK snRNA binding(GO:0097322) |
| 0.0 | 0.0 | GO:0016262 | protein N-acetylglucosaminyltransferase activity(GO:0016262) |
| 0.0 | 0.1 | GO:2001070 | starch binding(GO:2001070) |
| 0.0 | 0.5 | GO:0015295 | solute:proton symporter activity(GO:0015295) |
| 0.0 | 0.1 | GO:0004616 | phosphogluconate dehydrogenase (decarboxylating) activity(GO:0004616) |
| 0.0 | 0.4 | GO:0015271 | outward rectifier potassium channel activity(GO:0015271) |
| 0.0 | 1.3 | GO:0043022 | ribosome binding(GO:0043022) |
| 0.0 | 0.2 | GO:0004994 | somatostatin receptor activity(GO:0004994) |
| 0.0 | 0.1 | GO:0015165 | pyrimidine nucleotide-sugar transmembrane transporter activity(GO:0015165) |
| 0.0 | 0.2 | GO:0015277 | kainate selective glutamate receptor activity(GO:0015277) |
| 0.0 | 0.3 | GO:0004176 | ATP-dependent peptidase activity(GO:0004176) |
| 0.0 | 0.5 | GO:0015923 | mannosidase activity(GO:0015923) |
| 0.0 | 0.1 | GO:0004677 | DNA-dependent protein kinase activity(GO:0004677) |
| 0.0 | 0.1 | GO:0004663 | Rab geranylgeranyltransferase activity(GO:0004663) |
| 0.0 | 0.2 | GO:0004690 | cyclic nucleotide-dependent protein kinase activity(GO:0004690) |
| 0.0 | 0.1 | GO:0015252 | hydrogen ion channel activity(GO:0015252) |
| 0.0 | 0.2 | GO:0016004 | phospholipase activator activity(GO:0016004) |
| 0.0 | 0.0 | GO:0048018 | receptor agonist activity(GO:0048018) |
| 0.0 | 0.1 | GO:0004974 | leukotriene receptor activity(GO:0004974) |
| 0.0 | 0.2 | GO:0008933 | lytic endotransglycosylase activity(GO:0008932) lytic transglycosylase activity(GO:0008933) |
| 0.0 | 0.3 | GO:0001223 | transcription coactivator binding(GO:0001223) |
| 0.0 | 0.1 | GO:0008526 | phosphatidylinositol transporter activity(GO:0008526) |
| 0.0 | 0.1 | GO:0034618 | arginine binding(GO:0034618) |
| 0.0 | 0.1 | GO:0004792 | thiosulfate sulfurtransferase activity(GO:0004792) |
| 0.0 | 0.1 | GO:0030284 | estrogen receptor activity(GO:0030284) |
| 0.0 | 0.1 | GO:0052813 | phosphatidylinositol bisphosphate kinase activity(GO:0052813) |
| 0.0 | 0.1 | GO:0043398 | HLH domain binding(GO:0043398) |
| 0.0 | 0.5 | GO:0004708 | MAP kinase kinase activity(GO:0004708) |
| 0.0 | 0.1 | GO:0015137 | citrate transmembrane transporter activity(GO:0015137) tricarboxylic acid transmembrane transporter activity(GO:0015142) |
| 0.0 | 0.1 | GO:0043426 | MRF binding(GO:0043426) |
| 0.0 | 0.1 | GO:0035197 | siRNA binding(GO:0035197) |
| 0.0 | 0.1 | GO:0032027 | myosin light chain binding(GO:0032027) |
| 0.0 | 0.0 | GO:0035851 | Krueppel-associated box domain binding(GO:0035851) |
| 0.0 | 0.1 | GO:0004060 | arylamine N-acetyltransferase activity(GO:0004060) |
| 0.0 | 0.1 | GO:0071253 | connexin binding(GO:0071253) |
| 0.0 | 0.1 | GO:0008174 | mRNA methyltransferase activity(GO:0008174) |
| 0.0 | 0.5 | GO:0003785 | actin monomer binding(GO:0003785) |
| 0.0 | 0.9 | GO:0004402 | histone acetyltransferase activity(GO:0004402) |
| 0.0 | 1.0 | GO:0008392 | arachidonic acid epoxygenase activity(GO:0008392) |
| 0.0 | 0.2 | GO:0003964 | telomerase activity(GO:0003720) RNA-directed DNA polymerase activity(GO:0003964) |
| 0.0 | 0.1 | GO:0005105 | type 1 fibroblast growth factor receptor binding(GO:0005105) |
| 0.0 | 0.2 | GO:0008097 | 5S rRNA binding(GO:0008097) |
| 0.0 | 0.8 | GO:0005484 | SNAP receptor activity(GO:0005484) |
| 0.0 | 0.1 | GO:0019784 | NEDD8-specific protease activity(GO:0019784) |
| 0.0 | 0.5 | GO:0043014 | alpha-tubulin binding(GO:0043014) |
| 0.0 | 0.1 | GO:0004859 | phospholipase inhibitor activity(GO:0004859) |
| 0.0 | 0.1 | GO:0051032 | nucleic acid transmembrane transporter activity(GO:0051032) RNA transmembrane transporter activity(GO:0051033) |
| 0.0 | 0.3 | GO:0000146 | microfilament motor activity(GO:0000146) |
| 0.0 | 0.3 | GO:0009982 | pseudouridine synthase activity(GO:0009982) |
| 0.0 | 0.1 | GO:0000403 | Y-form DNA binding(GO:0000403) |
| 0.0 | 0.0 | GO:0030899 | calcium-dependent ATPase activity(GO:0030899) |
| 0.0 | 0.1 | GO:0031849 | olfactory receptor binding(GO:0031849) |
| 0.0 | 0.3 | GO:0008353 | RNA polymerase II carboxy-terminal domain kinase activity(GO:0008353) |
| 0.0 | 0.1 | GO:0004534 | 5'-3' exoribonuclease activity(GO:0004534) |
| 0.0 | 0.2 | GO:0001206 | transcriptional repressor activity, RNA polymerase II distal enhancer sequence-specific binding(GO:0001206) |
| 0.0 | 0.0 | GO:0004939 | beta-adrenergic receptor activity(GO:0004939) |
| 0.0 | 0.1 | GO:1990405 | protein antigen binding(GO:1990405) |
| 0.0 | 0.5 | GO:0031492 | nucleosomal DNA binding(GO:0031492) |
| 0.0 | 0.1 | GO:0015222 | serotonin transmembrane transporter activity(GO:0015222) |
| 0.0 | 0.1 | GO:0005005 | transmembrane-ephrin receptor activity(GO:0005005) |
| 0.0 | 0.0 | GO:0070698 | type I activin receptor binding(GO:0070698) |
| 0.0 | 0.2 | GO:0070628 | proteasome binding(GO:0070628) |
| 0.0 | 0.3 | GO:0000993 | RNA polymerase II core binding(GO:0000993) |
| 0.0 | 0.2 | GO:0016500 | protein-hormone receptor activity(GO:0016500) |
| 0.0 | 2.0 | GO:0008175 | tRNA methyltransferase activity(GO:0008175) |
| 0.0 | 0.2 | GO:0008093 | cytoskeletal adaptor activity(GO:0008093) |
| 0.0 | 0.9 | GO:0003743 | translation initiation factor activity(GO:0003743) |
| 0.0 | 0.1 | GO:1990239 | steroid hormone binding(GO:1990239) |
| 0.0 | 0.8 | GO:0035064 | methylated histone binding(GO:0035064) |
| 0.0 | 0.1 | GO:0038100 | nodal binding(GO:0038100) |
| 0.0 | 0.2 | GO:0015279 | store-operated calcium channel activity(GO:0015279) |
| 0.0 | 0.5 | GO:0004364 | glutathione transferase activity(GO:0004364) |
| 0.0 | 0.0 | GO:0008142 | oxysterol binding(GO:0008142) |
| 0.0 | 0.1 | GO:0031545 | peptidyl-proline 4-dioxygenase activity(GO:0031545) |
| 0.0 | 0.1 | GO:0017128 | phospholipid scramblase activity(GO:0017128) |
| 0.0 | 0.1 | GO:0070883 | pre-miRNA binding(GO:0070883) |
| 0.0 | 0.2 | GO:0071949 | FAD binding(GO:0071949) |
| 0.0 | 0.1 | GO:0030346 | protein phosphatase 2B binding(GO:0030346) |
| 0.0 | 0.3 | GO:0016538 | cyclin-dependent protein serine/threonine kinase regulator activity(GO:0016538) |
| 0.0 | 0.1 | GO:0048019 | receptor antagonist activity(GO:0048019) |
| 0.0 | 0.0 | GO:0015038 | glutathione disulfide oxidoreductase activity(GO:0015038) |
| 0.0 | 1.0 | GO:0005518 | collagen binding(GO:0005518) |
| 0.0 | 0.2 | GO:0043422 | protein kinase B binding(GO:0043422) |
| 0.0 | 0.1 | GO:0008823 | cupric reductase activity(GO:0008823) ferric-chelate reductase (NADPH) activity(GO:0052851) |
| 0.0 | 0.1 | GO:0016212 | kynurenine-oxoglutarate transaminase activity(GO:0016212) kynurenine aminotransferase activity(GO:0036137) |
| 0.0 | 0.5 | GO:0043734 | DNA-N1-methyladenine dioxygenase activity(GO:0043734) |
| 0.0 | 0.1 | GO:0103116 | alpha-D-galactofuranose transporter activity(GO:0103116) |
| 0.0 | 0.1 | GO:0050815 | phosphoserine binding(GO:0050815) |
| 0.0 | 0.1 | GO:0003917 | DNA topoisomerase type I activity(GO:0003917) |
| 0.0 | 0.0 | GO:0008427 | calcium-dependent protein kinase inhibitor activity(GO:0008427) |
| 0.0 | 0.1 | GO:0004045 | aminoacyl-tRNA hydrolase activity(GO:0004045) |
| 0.0 | 0.0 | GO:0015141 | succinate transmembrane transporter activity(GO:0015141) |
| 0.0 | 0.3 | GO:0019104 | DNA N-glycosylase activity(GO:0019104) |
| 0.0 | 0.1 | GO:0030250 | cyclase activator activity(GO:0010853) guanylate cyclase activator activity(GO:0030250) |
| 0.0 | 0.1 | GO:0004711 | ribosomal protein S6 kinase activity(GO:0004711) |
| 0.0 | 1.6 | GO:0004222 | metalloendopeptidase activity(GO:0004222) |
| 0.0 | 0.0 | GO:0033677 | DNA/RNA helicase activity(GO:0033677) |
| 0.0 | 0.7 | GO:0019209 | kinase activator activity(GO:0019209) |
| 0.0 | 0.0 | GO:0018498 | enoyl-[acyl-carrier-protein] reductase activity(GO:0016631) 2,3-dihydroxy-2,3-dihydro-phenylpropionate dehydrogenase activity(GO:0018498) cis-2,3-dihydrodiol DDT dehydrogenase activity(GO:0018499) trans-9R,10R-dihydrodiolphenanthrene dehydrogenase activity(GO:0018500) cis-chlorobenzene dihydrodiol dehydrogenase activity(GO:0018501) 2,5-dichloro-2,5-cyclohexadiene-1,4-diol dehydrogenase activity(GO:0018502) trans-1,2-dihydrodiolphenanthrene dehydrogenase activity(GO:0018503) 3,4-dihydroxy-3,4-dihydrofluorene dehydrogenase activity(GO:0034790) benzo(a)pyrene-trans-11,12-dihydrodiol dehydrogenase activity(GO:0034805) benzo(a)pyrene-cis-4,5-dihydrodiol dehydrogenase activity(GO:0034809) citronellyl-CoA dehydrogenase activity(GO:0034824) menthone dehydrogenase activity(GO:0034838) phthalate 3,4-cis-dihydrodiol dehydrogenase activity(GO:0034912) cinnamate reductase activity(GO:0043786) NADPH-dependent curcumin reductase activity(GO:0052849) NADPH-dependent dihydrocurcumin reductase activity(GO:0052850) |
| 0.0 | 0.1 | GO:0030572 | cardiolipin synthase activity(GO:0008808) phosphatidyltransferase activity(GO:0030572) |
| 0.0 | 0.5 | GO:0032266 | phosphatidylinositol-3-phosphate binding(GO:0032266) |
| 0.0 | 0.2 | GO:0048038 | quinone binding(GO:0048038) |
| 0.0 | 0.1 | GO:0016721 | superoxide dismutase activity(GO:0004784) oxidoreductase activity, acting on superoxide radicals as acceptor(GO:0016721) |
| 0.0 | 0.3 | GO:0016709 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, NAD(P)H as one donor, and incorporation of one atom of oxygen(GO:0016709) |
| 0.0 | 0.1 | GO:0035877 | death effector domain binding(GO:0035877) |
| 0.0 | 0.2 | GO:0004435 | phosphatidylinositol phospholipase C activity(GO:0004435) |
| 0.0 | 0.0 | GO:0098847 | sequence-specific single stranded DNA binding(GO:0098847) |
| 0.0 | 0.1 | GO:0015377 | cation:chloride symporter activity(GO:0015377) |
| 0.0 | 0.0 | GO:0030943 | mitochondrion targeting sequence binding(GO:0030943) |
| 0.0 | 0.1 | GO:0003993 | acid phosphatase activity(GO:0003993) |
| 0.0 | 0.1 | GO:0035251 | UDP-glucosyltransferase activity(GO:0035251) |
| 0.0 | 0.2 | GO:0015254 | glycerol transmembrane transporter activity(GO:0015168) glycerol channel activity(GO:0015254) |
| 0.0 | 0.1 | GO:0004634 | phosphopyruvate hydratase activity(GO:0004634) |
| 0.0 | 0.6 | GO:0016763 | transferase activity, transferring pentosyl groups(GO:0016763) |
| 0.0 | 0.1 | GO:0019871 | sodium channel inhibitor activity(GO:0019871) |
| 0.0 | 0.0 | GO:0008532 | N-acetyllactosaminide beta-1,3-N-acetylglucosaminyltransferase activity(GO:0008532) |
| 0.0 | 0.1 | GO:0033192 | calmodulin-dependent protein phosphatase activity(GO:0033192) |
| 0.0 | 0.1 | GO:0004716 | receptor signaling protein tyrosine kinase activity(GO:0004716) |
| 0.0 | 0.1 | GO:0047184 | 1-acylglycerophosphocholine O-acyltransferase activity(GO:0047184) |
| 0.0 | 0.1 | GO:0048027 | mRNA 5'-UTR binding(GO:0048027) |
| 0.0 | 0.4 | GO:0016749 | N-succinyltransferase activity(GO:0016749) |
| 0.0 | 0.4 | GO:0052770 | coenzyme F390-A hydrolase activity(GO:0052770) coenzyme F390-G hydrolase activity(GO:0052771) |
| 0.0 | 0.1 | GO:0005172 | vascular endothelial growth factor receptor binding(GO:0005172) |
| 0.0 | 0.2 | GO:0008601 | protein phosphatase type 2A regulator activity(GO:0008601) |
| 0.0 | 0.1 | GO:0044466 | 2-oxoglutaryl-CoA thioesterase activity(GO:0034843) 2,4,4-trimethyl-3-oxopentanoyl-CoA thioesterase activity(GO:0034869) 3-isopropylbut-3-enoyl-CoA thioesterase activity(GO:0034946) glutaryl-CoA hydrolase activity(GO:0044466) |
| 0.0 | 0.1 | GO:0050811 | GABA receptor binding(GO:0050811) |
| 0.0 | 0.1 | GO:0031628 | opioid receptor binding(GO:0031628) |
| 0.0 | 0.1 | GO:0005222 | intracellular cAMP activated cation channel activity(GO:0005222) |
| 0.0 | 0.0 | GO:0004723 | calcium-dependent protein serine/threonine phosphatase activity(GO:0004723) |
| 0.0 | 0.0 | GO:0043262 | adenosine-diphosphatase activity(GO:0043262) |
| 0.0 | 0.2 | GO:0017134 | fibroblast growth factor binding(GO:0017134) |
| 0.0 | 0.2 | GO:0005522 | profilin binding(GO:0005522) |
| 0.0 | 0.1 | GO:0005432 | calcium:sodium antiporter activity(GO:0005432) |
| 0.0 | 0.2 | GO:0042800 | histone methyltransferase activity (H3-K4 specific)(GO:0042800) |
| 0.0 | 0.1 | GO:0000155 | phosphorelay sensor kinase activity(GO:0000155) |
| 0.0 | 0.0 | GO:0005275 | amine transmembrane transporter activity(GO:0005275) |
| 0.0 | 0.3 | GO:0070888 | E-box binding(GO:0070888) |
| 0.0 | 0.1 | GO:0046923 | ER retention sequence binding(GO:0046923) |
| 0.0 | 0.1 | GO:0004308 | exo-alpha-sialidase activity(GO:0004308) alpha-sialidase activity(GO:0016997) exo-alpha-(2->3)-sialidase activity(GO:0052794) exo-alpha-(2->6)-sialidase activity(GO:0052795) exo-alpha-(2->8)-sialidase activity(GO:0052796) |
| 0.0 | 0.0 | GO:0008310 | single-stranded DNA 3'-5' exodeoxyribonuclease activity(GO:0008310) |
| 0.0 | 0.0 | GO:0070181 | small ribosomal subunit rRNA binding(GO:0070181) |
| 0.0 | 0.2 | GO:0043027 | cysteine-type endopeptidase inhibitor activity involved in apoptotic process(GO:0043027) |
| 0.0 | 0.3 | GO:0005212 | structural constituent of eye lens(GO:0005212) |
| 0.0 | 0.8 | GO:0005254 | chloride channel activity(GO:0005254) |
| 0.0 | 0.1 | GO:0001609 | G-protein coupled adenosine receptor activity(GO:0001609) |
| 0.0 | 0.1 | GO:0008253 | 5'-nucleotidase activity(GO:0008253) |
| 0.0 | 0.3 | GO:0003887 | DNA-directed DNA polymerase activity(GO:0003887) |
| 0.0 | 0.0 | GO:0003909 | DNA ligase activity(GO:0003909) DNA ligase (ATP) activity(GO:0003910) |
| 0.0 | 0.1 | GO:0042171 | lysophosphatidic acid acyltransferase activity(GO:0042171) |
| 0.0 | 0.0 | GO:0071074 | eukaryotic initiation factor eIF2 binding(GO:0071074) |
| 0.0 | 0.1 | GO:0050664 | superoxide-generating NADPH oxidase activity(GO:0016175) oxidoreductase activity, acting on NAD(P)H, oxygen as acceptor(GO:0050664) |
| 0.0 | 0.1 | GO:0005451 | monovalent cation:proton antiporter activity(GO:0005451) |
| 0.0 | 0.2 | GO:0043395 | heparan sulfate proteoglycan binding(GO:0043395) |
| 0.0 | 0.0 | GO:0086007 | voltage-gated calcium channel activity involved in cardiac muscle cell action potential(GO:0086007) |
| 0.0 | 0.2 | GO:0004889 | acetylcholine-activated cation-selective channel activity(GO:0004889) |
| 0.0 | 0.2 | GO:0031683 | G-protein beta/gamma-subunit complex binding(GO:0031683) |
| 0.0 | 0.1 | GO:0008889 | glycerophosphodiester phosphodiesterase activity(GO:0008889) |
| 0.0 | 0.1 | GO:0001640 | adenylate cyclase inhibiting G-protein coupled glutamate receptor activity(GO:0001640) |
| 0.0 | 0.0 | GO:0031749 | D2 dopamine receptor binding(GO:0031749) |
| 0.0 | 0.0 | GO:0061676 | importin-alpha family protein binding(GO:0061676) |
| 0.0 | 0.0 | GO:0016774 | phosphotransferase activity, carboxyl group as acceptor(GO:0016774) |
| 0.0 | 0.2 | GO:0005540 | hyaluronic acid binding(GO:0005540) |
| 0.0 | 0.0 | GO:0008131 | primary amine oxidase activity(GO:0008131) |
| 0.0 | 0.0 | GO:0016015 | morphogen activity(GO:0016015) |
| 0.0 | 0.0 | GO:0035014 | phosphatidylinositol 3-kinase regulator activity(GO:0035014) |
| 0.0 | 0.1 | GO:0015116 | sulfate transmembrane transporter activity(GO:0015116) |
| 0.0 | 0.0 | GO:0080130 | L-phenylalanine:2-oxoglutarate aminotransferase activity(GO:0080130) |
| 0.0 | 0.0 | GO:0001875 | lipopolysaccharide receptor activity(GO:0001875) |
| 0.0 | 0.0 | GO:0004673 | protein histidine kinase activity(GO:0004673) |
| 0.0 | 0.1 | GO:0004972 | NMDA glutamate receptor activity(GO:0004972) |
| 0.0 | 0.4 | GO:0005109 | frizzled binding(GO:0005109) |
| 0.0 | 0.0 | GO:0008454 | alpha-1,3-mannosylglycoprotein 4-beta-N-acetylglucosaminyltransferase activity(GO:0008454) |
| 0.0 | 0.0 | GO:0097493 | structural molecule activity conferring elasticity(GO:0097493) |
| 0.0 | 0.0 | GO:0031543 | procollagen-proline dioxygenase activity(GO:0019798) peptidyl-proline dioxygenase activity(GO:0031543) |
| 0.0 | 0.1 | GO:0008320 | protein transmembrane transporter activity(GO:0008320) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.3 | 4.4 | PID ERBB NETWORK PATHWAY | ErbB receptor signaling network |
| 0.1 | 3.6 | PID RXR VDR PATHWAY | RXR and RAR heterodimerization with other nuclear receptor |
| 0.1 | 1.3 | PID P38 GAMMA DELTA PATHWAY | Signaling mediated by p38-gamma and p38-delta |
| 0.1 | 3.0 | ST ADRENERGIC | Adrenergic Pathway |
| 0.1 | 3.1 | PID DELTA NP63 PATHWAY | Validated transcriptional targets of deltaNp63 isoforms |
| 0.1 | 0.7 | PID ALK2 PATHWAY | ALK2 signaling events |
| 0.1 | 0.8 | PID S1P S1P1 PATHWAY | S1P1 pathway |
| 0.1 | 0.9 | PID RET PATHWAY | Signaling events regulated by Ret tyrosine kinase |
| 0.1 | 2.3 | PID HEDGEHOG GLI PATHWAY | Hedgehog signaling events mediated by Gli proteins |
| 0.0 | 1.7 | PID ECADHERIN STABILIZATION PATHWAY | Stabilization and expansion of the E-cadherin adherens junction |
| 0.0 | 0.4 | PID ANTHRAX PATHWAY | Cellular roles of Anthrax toxin |
| 0.0 | 0.8 | PID HDAC CLASSIII PATHWAY | Signaling events mediated by HDAC Class III |
| 0.0 | 1.6 | PID HES HEY PATHWAY | Notch-mediated HES/HEY network |
| 0.0 | 0.2 | PID THROMBIN PAR4 PATHWAY | PAR4-mediated thrombin signaling events |
| 0.0 | 0.4 | PID ATR PATHWAY | ATR signaling pathway |
| 0.0 | 0.5 | PID SMAD2 3PATHWAY | Regulation of cytoplasmic and nuclear SMAD2/3 signaling |
| 0.0 | 0.5 | PID SYNDECAN 3 PATHWAY | Syndecan-3-mediated signaling events |
| 0.0 | 0.4 | PID HIF1A PATHWAY | Hypoxic and oxygen homeostasis regulation of HIF-1-alpha |
| 0.0 | 0.2 | PID S1P S1P4 PATHWAY | S1P4 pathway |
| 0.0 | 1.2 | NABA PROTEOGLYCANS | Genes encoding proteoglycans |
| 0.0 | 0.3 | SA REG CASCADE OF CYCLIN EXPR | Expression of cyclins regulates progression through the cell cycle by activating cyclin-dependent kinases. |
| 0.0 | 1.6 | PID P73PATHWAY | p73 transcription factor network |
| 0.0 | 0.2 | ST INTERFERON GAMMA PATHWAY | Interferon gamma pathway. |
| 0.0 | 0.3 | ST G ALPHA S PATHWAY | G alpha s Pathway |
| 0.0 | 0.7 | PID CXCR3 PATHWAY | CXCR3-mediated signaling events |
| 0.0 | 0.1 | SA G2 AND M PHASES | Cdc25 activates the cdc2/cyclin B complex to induce the G2/M transition. |
| 0.0 | 0.2 | PID EPHA2 FWD PATHWAY | EPHA2 forward signaling |
| 0.0 | 0.2 | PID AR NONGENOMIC PATHWAY | Nongenotropic Androgen signaling |
| 0.0 | 0.2 | PID WNT CANONICAL PATHWAY | Canonical Wnt signaling pathway |
| 0.0 | 0.1 | ST G ALPHA I PATHWAY | G alpha i Pathway |
| 0.0 | 0.3 | PID TCR PATHWAY | TCR signaling in naïve CD4+ T cells |
| 0.0 | 0.2 | PID IL2 1PATHWAY | IL2-mediated signaling events |
| 0.0 | 0.0 | PID IL8 CXCR2 PATHWAY | IL8- and CXCR2-mediated signaling events |
| 0.0 | 0.0 | SIG IL4RECEPTOR IN B LYPHOCYTES | Genes related to IL4 rceptor signaling in B lymphocytes |
| 0.0 | 0.2 | PID TCPTP PATHWAY | Signaling events mediated by TCPTP |
| 0.0 | 0.4 | PID DNA PK PATHWAY | DNA-PK pathway in nonhomologous end joining |
| 0.0 | 0.1 | ST MYOCYTE AD PATHWAY | Myocyte Adrenergic Pathway is a specific case of the generalized Adrenergic Pathway. |
| 0.0 | 0.5 | PID FOXM1 PATHWAY | FOXM1 transcription factor network |
| 0.0 | 0.9 | PID MTOR 4PATHWAY | mTOR signaling pathway |
| 0.0 | 0.5 | PID TAP63 PATHWAY | Validated transcriptional targets of TAp63 isoforms |
| 0.0 | 0.6 | SIG REGULATION OF THE ACTIN CYTOSKELETON BY RHO GTPASES | Genes related to regulation of the actin cytoskeleton |
| 0.0 | 0.2 | PID HIF2PATHWAY | HIF-2-alpha transcription factor network |
| 0.0 | 0.4 | SIG INSULIN RECEPTOR PATHWAY IN CARDIAC MYOCYTES | Genes related to the insulin receptor pathway |
| 0.0 | 0.2 | PID PDGFRA PATHWAY | PDGFR-alpha signaling pathway |
| 0.0 | 0.2 | PID PRL SIGNALING EVENTS PATHWAY | Signaling events mediated by PRL |
| 0.0 | 0.0 | SIG PIP3 SIGNALING IN B LYMPHOCYTES | Genes related to PIP3 signaling in B lymphocytes |
| 0.0 | 0.4 | PID TOLL ENDOGENOUS PATHWAY | Endogenous TLR signaling |
| 0.0 | 0.0 | PID ARF6 DOWNSTREAM PATHWAY | Arf6 downstream pathway |
| 0.0 | 0.4 | PID NCADHERIN PATHWAY | N-cadherin signaling events |
| 0.0 | 0.7 | PID HIF1 TFPATHWAY | HIF-1-alpha transcription factor network |
| 0.0 | 0.8 | PID MYC ACTIV PATHWAY | Validated targets of C-MYC transcriptional activation |
| 0.0 | 1.1 | WNT SIGNALING | Genes related to Wnt-mediated signal transduction |
| 0.0 | 0.1 | PID IL27 PATHWAY | IL27-mediated signaling events |
| 0.0 | 0.2 | PID THROMBIN PAR1 PATHWAY | PAR1-mediated thrombin signaling events |
| 0.0 | 0.4 | PID P53 REGULATION PATHWAY | p53 pathway |
| 0.0 | 0.1 | PID ALK1 PATHWAY | ALK1 signaling events |
| 0.0 | 0.5 | PID FANCONI PATHWAY | Fanconi anemia pathway |
| 0.0 | 0.2 | ST GA13 PATHWAY | G alpha 13 Pathway |
| 0.0 | 0.1 | PID AVB3 OPN PATHWAY | Osteopontin-mediated events |
| 0.0 | 0.0 | PID NFAT 3PATHWAY | Role of Calcineurin-dependent NFAT signaling in lymphocytes |
| 0.0 | 0.1 | PID HEDGEHOG 2PATHWAY | Signaling events mediated by the Hedgehog family |
| 0.0 | 0.0 | PID NFKAPPAB CANONICAL PATHWAY | Canonical NF-kappaB pathway |
| 0.0 | 0.3 | PID TNF PATHWAY | TNF receptor signaling pathway |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.3 | 0.8 | REACTOME XENOBIOTICS | Genes involved in Xenobiotics |
| 0.2 | 4.2 | REACTOME SIGNALING BY CONSTITUTIVELY ACTIVE EGFR | Genes involved in Signaling by constitutively active EGFR |
| 0.2 | 3.1 | REACTOME ANTIGEN PRESENTATION FOLDING ASSEMBLY AND PEPTIDE LOADING OF CLASS I MHC | Genes involved in Antigen Presentation: Folding, assembly and peptide loading of class I MHC |
| 0.2 | 2.9 | REACTOME SYNTHESIS OF BILE ACIDS AND BILE SALTS | Genes involved in Synthesis of bile acids and bile salts |
| 0.2 | 2.8 | REACTOME FATTY ACYL COA BIOSYNTHESIS | Genes involved in Fatty Acyl-CoA Biosynthesis |
| 0.1 | 1.1 | REACTOME GLUCURONIDATION | Genes involved in Glucuronidation |
| 0.1 | 0.7 | REACTOME ETHANOL OXIDATION | Genes involved in Ethanol oxidation |
| 0.1 | 0.5 | REACTOME RECYCLING OF BILE ACIDS AND SALTS | Genes involved in Recycling of bile acids and salts |
| 0.1 | 1.0 | REACTOME PROLACTIN RECEPTOR SIGNALING | Genes involved in Prolactin receptor signaling |
| 0.1 | 1.0 | REACTOME FORMATION OF ATP BY CHEMIOSMOTIC COUPLING | Genes involved in Formation of ATP by chemiosmotic coupling |
| 0.1 | 1.0 | REACTOME PYRIMIDINE CATABOLISM | Genes involved in Pyrimidine catabolism |
| 0.1 | 0.2 | REACTOME GAB1 SIGNALOSOME | Genes involved in GAB1 signalosome |
| 0.1 | 1.2 | REACTOME AMINO ACID SYNTHESIS AND INTERCONVERSION TRANSAMINATION | Genes involved in Amino acid synthesis and interconversion (transamination) |
| 0.1 | 0.7 | REACTOME SIGNAL REGULATORY PROTEIN SIRP FAMILY INTERACTIONS | Genes involved in Signal regulatory protein (SIRP) family interactions |
| 0.1 | 1.7 | REACTOME RORA ACTIVATES CIRCADIAN EXPRESSION | Genes involved in RORA Activates Circadian Expression |
| 0.1 | 0.7 | REACTOME REGULATION OF COMPLEMENT CASCADE | Genes involved in Regulation of Complement cascade |
| 0.1 | 0.7 | REACTOME SYNTHESIS OF PIPS AT THE LATE ENDOSOME MEMBRANE | Genes involved in Synthesis of PIPs at the late endosome membrane |
| 0.1 | 0.6 | REACTOME SIGNAL ATTENUATION | Genes involved in Signal attenuation |
| 0.1 | 1.2 | REACTOME TRIGLYCERIDE BIOSYNTHESIS | Genes involved in Triglyceride Biosynthesis |
| 0.1 | 0.7 | REACTOME REGULATION OF RHEB GTPASE ACTIVITY BY AMPK | Genes involved in Regulation of Rheb GTPase activity by AMPK |
| 0.1 | 0.7 | REACTOME ACTIVATION OF IRF3 IRF7 MEDIATED BY TBK1 IKK EPSILON | Genes involved in Activation of IRF3/IRF7 mediated by TBK1/IKK epsilon |
| 0.1 | 0.6 | REACTOME ACTIVATED AMPK STIMULATES FATTY ACID OXIDATION IN MUSCLE | Genes involved in Activated AMPK stimulates fatty-acid oxidation in muscle |
| 0.1 | 0.8 | REACTOME PURINE SALVAGE | Genes involved in Purine salvage |
| 0.1 | 1.1 | REACTOME SIGNALING BY NODAL | Genes involved in Signaling by NODAL |
| 0.1 | 0.6 | REACTOME TRYPTOPHAN CATABOLISM | Genes involved in Tryptophan catabolism |
| 0.1 | 1.2 | REACTOME SMOOTH MUSCLE CONTRACTION | Genes involved in Smooth Muscle Contraction |
| 0.1 | 0.4 | REACTOME ARMS MEDIATED ACTIVATION | Genes involved in ARMS-mediated activation |
| 0.1 | 0.8 | REACTOME HDL MEDIATED LIPID TRANSPORT | Genes involved in HDL-mediated lipid transport |
| 0.1 | 0.6 | REACTOME CTNNB1 PHOSPHORYLATION CASCADE | Genes involved in Beta-catenin phosphorylation cascade |
| 0.1 | 0.6 | REACTOME IONOTROPIC ACTIVITY OF KAINATE RECEPTORS | Genes involved in Ionotropic activity of Kainate Receptors |
| 0.1 | 0.7 | REACTOME SHC1 EVENTS IN ERBB4 SIGNALING | Genes involved in SHC1 events in ERBB4 signaling |
| 0.1 | 1.2 | REACTOME GLUTATHIONE CONJUGATION | Genes involved in Glutathione conjugation |
| 0.1 | 0.6 | REACTOME DSCAM INTERACTIONS | Genes involved in DSCAM interactions |
| 0.1 | 0.6 | REACTOME GLYCOGEN BREAKDOWN GLYCOGENOLYSIS | Genes involved in Glycogen breakdown (glycogenolysis) |
| 0.1 | 0.2 | REACTOME PI3K AKT ACTIVATION | Genes involved in PI3K/AKT activation |
| 0.1 | 0.1 | REACTOME VIF MEDIATED DEGRADATION OF APOBEC3G | Genes involved in Vif-mediated degradation of APOBEC3G |
| 0.1 | 0.6 | REACTOME SIGNALING BY ACTIVATED POINT MUTANTS OF FGFR1 | Genes involved in Signaling by activated point mutants of FGFR1 |
| 0.0 | 0.8 | REACTOME FANCONI ANEMIA PATHWAY | Genes involved in Fanconi Anemia pathway |
| 0.0 | 0.3 | REACTOME ENDOGENOUS STEROLS | Genes involved in Endogenous sterols |
| 0.0 | 0.7 | REACTOME VIRAL MESSENGER RNA SYNTHESIS | Genes involved in Viral Messenger RNA Synthesis |
| 0.0 | 2.0 | REACTOME MITOCHONDRIAL PROTEIN IMPORT | Genes involved in Mitochondrial Protein Import |
| 0.0 | 0.6 | REACTOME NONSENSE MEDIATED DECAY ENHANCED BY THE EXON JUNCTION COMPLEX | Genes involved in Nonsense Mediated Decay Enhanced by the Exon Junction Complex |
| 0.0 | 0.4 | REACTOME DOWNREGULATION OF TGF BETA RECEPTOR SIGNALING | Genes involved in Downregulation of TGF-beta receptor signaling |
| 0.0 | 0.3 | REACTOME G2 M DNA DAMAGE CHECKPOINT | Genes involved in G2/M DNA damage checkpoint |
| 0.0 | 0.5 | REACTOME PYRIMIDINE METABOLISM | Genes involved in Pyrimidine metabolism |
| 0.0 | 0.4 | REACTOME PKB MEDIATED EVENTS | Genes involved in PKB-mediated events |
| 0.0 | 0.4 | REACTOME TRAFFICKING AND PROCESSING OF ENDOSOMAL TLR | Genes involved in Trafficking and processing of endosomal TLR |
| 0.0 | 0.8 | REACTOME DARPP 32 EVENTS | Genes involved in DARPP-32 events |
| 0.0 | 0.8 | REACTOME HS GAG DEGRADATION | Genes involved in HS-GAG degradation |
| 0.0 | 0.8 | REACTOME DEPOSITION OF NEW CENPA CONTAINING NUCLEOSOMES AT THE CENTROMERE | Genes involved in Deposition of New CENPA-containing Nucleosomes at the Centromere |
| 0.0 | 0.4 | REACTOME RAP1 SIGNALLING | Genes involved in Rap1 signalling |
| 0.0 | 0.3 | REACTOME VEGF LIGAND RECEPTOR INTERACTIONS | Genes involved in VEGF ligand-receptor interactions |
| 0.0 | 0.3 | REACTOME CALNEXIN CALRETICULIN CYCLE | Genes involved in Calnexin/calreticulin cycle |
| 0.0 | 0.4 | REACTOME THE NLRP3 INFLAMMASOME | Genes involved in The NLRP3 inflammasome |
| 0.0 | 1.1 | REACTOME REGULATION OF BETA CELL DEVELOPMENT | Genes involved in Regulation of beta-cell development |
| 0.0 | 0.9 | REACTOME ASSOCIATION OF TRIC CCT WITH TARGET PROTEINS DURING BIOSYNTHESIS | Genes involved in Association of TriC/CCT with target proteins during biosynthesis |
| 0.0 | 0.4 | REACTOME BILE SALT AND ORGANIC ANION SLC TRANSPORTERS | Genes involved in Bile salt and organic anion SLC transporters |
| 0.0 | 0.2 | REACTOME SIGNALING BY PDGF | Genes involved in Signaling by PDGF |
| 0.0 | 1.2 | REACTOME IL1 SIGNALING | Genes involved in Interleukin-1 signaling |
| 0.0 | 0.1 | REACTOME INFLUENZA VIRAL RNA TRANSCRIPTION AND REPLICATION | Genes involved in Influenza Viral RNA Transcription and Replication |
| 0.0 | 0.1 | REACTOME OPIOID SIGNALLING | Genes involved in Opioid Signalling |
| 0.0 | 0.6 | REACTOME MITOCHONDRIAL TRNA AMINOACYLATION | Genes involved in Mitochondrial tRNA aminoacylation |
| 0.0 | 0.5 | REACTOME NUCLEAR SIGNALING BY ERBB4 | Genes involved in Nuclear signaling by ERBB4 |
| 0.0 | 0.1 | REACTOME CD28 DEPENDENT VAV1 PATHWAY | Genes involved in CD28 dependent Vav1 pathway |
| 0.0 | 0.0 | REACTOME ACTIVATION OF NMDA RECEPTOR UPON GLUTAMATE BINDING AND POSTSYNAPTIC EVENTS | Genes involved in Activation of NMDA receptor upon glutamate binding and postsynaptic events |
| 0.0 | 0.7 | REACTOME SIGNALING BY ERBB4 | Genes involved in Signaling by ERBB4 |
| 0.0 | 0.4 | REACTOME A TETRASACCHARIDE LINKER SEQUENCE IS REQUIRED FOR GAG SYNTHESIS | Genes involved in A tetrasaccharide linker sequence is required for GAG synthesis |
| 0.0 | 0.1 | REACTOME FORMATION OF TRANSCRIPTION COUPLED NER TC NER REPAIR COMPLEX | Genes involved in Formation of transcription-coupled NER (TC-NER) repair complex |
| 0.0 | 0.6 | REACTOME LYSOSOME VESICLE BIOGENESIS | Genes involved in Lysosome Vesicle Biogenesis |
| 0.0 | 0.3 | REACTOME BMAL1 CLOCK NPAS2 ACTIVATES CIRCADIAN EXPRESSION | Genes involved in BMAL1:CLOCK/NPAS2 Activates Circadian Expression |
| 0.0 | 0.4 | REACTOME DEADENYLATION OF MRNA | Genes involved in Deadenylation of mRNA |
| 0.0 | 0.4 | REACTOME SIGNALING BY BMP | Genes involved in Signaling by BMP |
| 0.0 | 0.3 | REACTOME PURINE RIBONUCLEOSIDE MONOPHOSPHATE BIOSYNTHESIS | Genes involved in Purine ribonucleoside monophosphate biosynthesis |
| 0.0 | 0.0 | REACTOME TGF BETA RECEPTOR SIGNALING IN EMT EPITHELIAL TO MESENCHYMAL TRANSITION | Genes involved in TGF-beta receptor signaling in EMT (epithelial to mesenchymal transition) |
| 0.0 | 0.2 | REACTOME HORMONE SENSITIVE LIPASE HSL MEDIATED TRIACYLGLYCEROL HYDROLYSIS | Genes involved in Hormone-sensitive lipase (HSL)-mediated triacylglycerol hydrolysis |
| 0.0 | 0.5 | REACTOME HS GAG BIOSYNTHESIS | Genes involved in HS-GAG biosynthesis |
| 0.0 | 0.1 | REACTOME CTLA4 INHIBITORY SIGNALING | Genes involved in CTLA4 inhibitory signaling |
| 0.0 | 0.2 | REACTOME E2F ENABLED INHIBITION OF PRE REPLICATION COMPLEX FORMATION | Genes involved in E2F-enabled inhibition of pre-replication complex formation |
| 0.0 | 0.0 | REACTOME FORMATION OF TUBULIN FOLDING INTERMEDIATES BY CCT TRIC | Genes involved in Formation of tubulin folding intermediates by CCT/TriC |
| 0.0 | 0.0 | REACTOME INFLUENZA LIFE CYCLE | Genes involved in Influenza Life Cycle |
| 0.0 | 0.4 | REACTOME INSULIN SYNTHESIS AND PROCESSING | Genes involved in Insulin Synthesis and Processing |
| 0.0 | 0.0 | REACTOME THROMBIN SIGNALLING THROUGH PROTEINASE ACTIVATED RECEPTORS PARS | Genes involved in Thrombin signalling through proteinase activated receptors (PARs) |
| 0.0 | 0.7 | REACTOME NOTCH1 INTRACELLULAR DOMAIN REGULATES TRANSCRIPTION | Genes involved in NOTCH1 Intracellular Domain Regulates Transcription |
| 0.0 | 0.2 | REACTOME CYCLIN A B1 ASSOCIATED EVENTS DURING G2 M TRANSITION | Genes involved in Cyclin A/B1 associated events during G2/M transition |
| 0.0 | 0.6 | REACTOME SIGNALING BY ROBO RECEPTOR | Genes involved in Signaling by Robo receptor |
| 0.0 | 0.1 | REACTOME INTERACTIONS OF VPR WITH HOST CELLULAR PROTEINS | Genes involved in Interactions of Vpr with host cellular proteins |
| 0.0 | 0.5 | REACTOME G1 PHASE | Genes involved in G1 Phase |
| 0.0 | 1.4 | REACTOME RESPIRATORY ELECTRON TRANSPORT | Genes involved in Respiratory electron transport |
| 0.0 | 0.2 | REACTOME METABOLISM OF POLYAMINES | Genes involved in Metabolism of polyamines |
| 0.0 | 0.1 | REACTOME INFLAMMASOMES | Genes involved in Inflammasomes |
| 0.0 | 0.4 | REACTOME RNA POL I TRANSCRIPTION INITIATION | Genes involved in RNA Polymerase I Transcription Initiation |
| 0.0 | 0.1 | REACTOME EICOSANOID LIGAND BINDING RECEPTORS | Genes involved in Eicosanoid ligand-binding receptors |
| 0.0 | 0.4 | REACTOME RECYCLING PATHWAY OF L1 | Genes involved in Recycling pathway of L1 |
| 0.0 | 0.1 | REACTOME ASSOCIATION OF LICENSING FACTORS WITH THE PRE REPLICATIVE COMPLEX | Genes involved in Association of licensing factors with the pre-replicative complex |
| 0.0 | 0.3 | REACTOME MRNA DECAY BY 5 TO 3 EXORIBONUCLEASE | Genes involved in mRNA Decay by 5' to 3' Exoribonuclease |
| 0.0 | 0.2 | REACTOME FORMATION OF RNA POL II ELONGATION COMPLEX | Genes involved in Formation of RNA Pol II elongation complex |
| 0.0 | 0.2 | REACTOME PEROXISOMAL LIPID METABOLISM | Genes involved in Peroxisomal lipid metabolism |
| 0.0 | 0.2 | REACTOME ABCA TRANSPORTERS IN LIPID HOMEOSTASIS | Genes involved in ABCA transporters in lipid homeostasis |
| 0.0 | 0.0 | REACTOME HOST INTERACTIONS OF HIV FACTORS | Genes involved in Host Interactions of HIV factors |
| 0.0 | 0.1 | REACTOME HORMONE LIGAND BINDING RECEPTORS | Genes involved in Hormone ligand-binding receptors |
| 0.0 | 2.2 | REACTOME TRANSLATION | Genes involved in Translation |
| 0.0 | 0.1 | REACTOME G BETA GAMMA SIGNALLING THROUGH PI3KGAMMA | Genes involved in G beta:gamma signalling through PI3Kgamma |
| 0.0 | 0.8 | REACTOME TRANSPORT OF MATURE TRANSCRIPT TO CYTOPLASM | Genes involved in Transport of Mature Transcript to Cytoplasm |
| 0.0 | 0.2 | REACTOME ABC FAMILY PROTEINS MEDIATED TRANSPORT | Genes involved in ABC-family proteins mediated transport |
| 0.0 | 0.2 | REACTOME HYALURONAN METABOLISM | Genes involved in Hyaluronan metabolism |
| 0.0 | 0.1 | REACTOME G ALPHA S SIGNALLING EVENTS | Genes involved in G alpha (s) signalling events |
| 0.0 | 0.3 | REACTOME BRANCHED CHAIN AMINO ACID CATABOLISM | Genes involved in Branched-chain amino acid catabolism |
| 0.0 | 0.1 | REACTOME KERATAN SULFATE DEGRADATION | Genes involved in Keratan sulfate degradation |
| 0.0 | 0.2 | REACTOME PASSIVE TRANSPORT BY AQUAPORINS | Genes involved in Passive Transport by Aquaporins |
| 0.0 | 0.1 | REACTOME CELL CYCLE CHECKPOINTS | Genes involved in Cell Cycle Checkpoints |
| 0.0 | 0.0 | REACTOME SYNTHESIS OF PIPS AT THE EARLY ENDOSOME MEMBRANE | Genes involved in Synthesis of PIPs at the early endosome membrane |
| 0.0 | 0.0 | REACTOME RNA POL I TRANSCRIPTION | Genes involved in RNA Polymerase I Transcription |
| 0.0 | 0.1 | REACTOME CIRCADIAN CLOCK | Genes involved in Circadian Clock |
| 0.0 | 0.2 | REACTOME STEROID HORMONES | Genes involved in Steroid hormones |
| 0.0 | 0.3 | REACTOME LIGAND GATED ION CHANNEL TRANSPORT | Genes involved in Ligand-gated ion channel transport |
| 0.0 | 0.3 | REACTOME GLYCOLYSIS | Genes involved in Glycolysis |
| 0.0 | 0.0 | REACTOME IL 6 SIGNALING | Genes involved in Interleukin-6 signaling |
| 0.0 | 1.7 | REACTOME METABOLISM OF AMINO ACIDS AND DERIVATIVES | Genes involved in Metabolism of amino acids and derivatives |
| 0.0 | 0.2 | REACTOME RAS ACTIVATION UOPN CA2 INFUX THROUGH NMDA RECEPTOR | Genes involved in Ras activation uopn Ca2+ infux through NMDA receptor |
| 0.0 | 0.1 | REACTOME SYNTHESIS SECRETION AND INACTIVATION OF GIP | Genes involved in Synthesis, Secretion, and Inactivation of Glucose-dependent Insulinotropic Polypeptide (GIP) |
| 0.0 | 0.0 | REACTOME CROSS PRESENTATION OF SOLUBLE EXOGENOUS ANTIGENS ENDOSOMES | Genes involved in Cross-presentation of soluble exogenous antigens (endosomes) |
| 0.0 | 0.2 | REACTOME SYNTHESIS AND INTERCONVERSION OF NUCLEOTIDE DI AND TRIPHOSPHATES | Genes involved in Synthesis and interconversion of nucleotide di- and triphosphates |
| 0.0 | 0.3 | REACTOME PHASE1 FUNCTIONALIZATION OF COMPOUNDS | Genes involved in Phase 1 - Functionalization of compounds |
| 0.0 | 0.1 | REACTOME HIGHLY CALCIUM PERMEABLE POSTSYNAPTIC NICOTINIC ACETYLCHOLINE RECEPTORS | Genes involved in Highly calcium permeable postsynaptic nicotinic acetylcholine receptors |
| 0.0 | 0.0 | REACTOME DESTABILIZATION OF MRNA BY KSRP | Genes involved in Destabilization of mRNA by KSRP |
| 0.0 | 0.0 | REACTOME THE ROLE OF NEF IN HIV1 REPLICATION AND DISEASE PATHOGENESIS | Genes involved in The role of Nef in HIV-1 replication and disease pathogenesis |
| 0.0 | 0.0 | REACTOME SIGNAL AMPLIFICATION | Genes involved in Signal amplification |
| 0.0 | 0.0 | REACTOME N GLYCAN TRIMMING IN THE ER AND CALNEXIN CALRETICULIN CYCLE | Genes involved in N-glycan trimming in the ER and Calnexin/Calreticulin cycle |
| 0.0 | 0.1 | REACTOME TRAF3 DEPENDENT IRF ACTIVATION PATHWAY | Genes involved in TRAF3-dependent IRF activation pathway |
| 0.0 | 0.1 | REACTOME MEMBRANE BINDING AND TARGETTING OF GAG PROTEINS | Genes involved in Membrane binding and targetting of GAG proteins |
| 0.0 | 0.1 | REACTOME MRNA DECAY BY 3 TO 5 EXORIBONUCLEASE | Genes involved in mRNA Decay by 3' to 5' Exoribonuclease |
| 0.0 | 0.1 | REACTOME CASPASE MEDIATED CLEAVAGE OF CYTOSKELETAL PROTEINS | Genes involved in Caspase-mediated cleavage of cytoskeletal proteins |
| 0.0 | 0.5 | REACTOME LOSS OF NLP FROM MITOTIC CENTROSOMES | Genes involved in Loss of Nlp from mitotic centrosomes |
| 0.0 | 0.1 | REACTOME GLUCOSE METABOLISM | Genes involved in Glucose metabolism |
| 0.0 | 0.2 | REACTOME CHOLESTEROL BIOSYNTHESIS | Genes involved in Cholesterol biosynthesis |
| 0.0 | 0.1 | REACTOME REMOVAL OF THE FLAP INTERMEDIATE FROM THE C STRAND | Genes involved in Removal of the Flap Intermediate from the C-strand |
| 0.0 | 0.0 | REACTOME P53 DEPENDENT G1 DNA DAMAGE RESPONSE | Genes involved in p53-Dependent G1 DNA Damage Response |
| 0.0 | 0.0 | REACTOME FGFR4 LIGAND BINDING AND ACTIVATION | Genes involved in FGFR4 ligand binding and activation |