Gene Symbol | Gene ID | Gene Info |
---|---|---|
Atf5
|
ENSMUSG00000038539.8 | Atf5 |
Gene | Promoter | Distance | Association probability | Pearson corr. coef. | P-value | Plot |
---|---|---|---|---|---|---|
Atf5 | chr7_44815741_44815908 | 166 | 0.546369 | -0.61 | 2.0e-01 | Click! |
Atf5 | chr7_44814175_44814338 | 1402 | 0.172855 | -0.53 | 2.8e-01 | Click! |
Atf5 | chr7_44816552_44816741 | 12 | 0.633628 | -0.52 | 2.9e-01 | Click! |
Atf5 | chr7_44810745_44811033 | 4769 | 0.081560 | -0.42 | 4.1e-01 | Click! |
Atf5 | chr7_44811514_44811667 | 4068 | 0.085515 | -0.38 | 4.6e-01 | Click! |
Move your cursor over a bar to see sample name and corresponding Z-value.
Cis Regulatory Element (CRE) | Target Score | Top associated gene | Gene Info | Distance of CRE to TSS | CRE/Gene association probability |
---|---|---|---|---|---|
chr10_42268518_42268885 | 2.13 |
Foxo3 |
forkhead box O3 |
7995 |
0.26 |
chr2_113503793_113503980 | 1.98 |
Gm13964 |
predicted gene 13964 |
148 |
0.96 |
chr5_24482719_24483670 | 1.94 |
Agap3 |
ArfGAP with GTPase domain, ankyrin repeat and PH domain 3 |
3022 |
0.12 |
chr1_67215139_67215608 | 1.79 |
Gm15668 |
predicted gene 15668 |
33827 |
0.17 |
chr14_75054421_75054590 | 1.76 |
Rubcnl |
RUN and cysteine rich domain containing beclin 1 interacting protein like |
17883 |
0.18 |
chr8_90839769_90839953 | 1.73 |
Chd9 |
chromodomain helicase DNA binding protein 9 |
9806 |
0.13 |
chr3_5346748_5346907 | 1.67 |
Zfhx4 |
zinc finger homeodomain 4 |
105155 |
0.07 |
chr19_46628011_46628401 | 1.63 |
Wbp1l |
WW domain binding protein 1 like |
4805 |
0.15 |
chr15_61308920_61309236 | 1.61 |
Gm29904 |
predicted gene, 29904 |
20448 |
0.23 |
chr4_88893074_88893256 | 1.58 |
Ifne |
interferon epsilon |
12964 |
0.08 |
chr3_94702618_94702790 | 1.57 |
Selenbp2 |
selenium binding protein 2 |
9045 |
0.11 |
chr19_40155227_40155577 | 1.56 |
Cyp2c70 |
cytochrome P450, family 2, subfamily c, polypeptide 70 |
31884 |
0.13 |
chr4_131722484_131723038 | 1.56 |
Gm16080 |
predicted gene 16080 |
12253 |
0.19 |
chr6_108665497_108666008 | 1.54 |
Bhlhe40 |
basic helix-loop-helix family, member e40 |
2706 |
0.23 |
chr11_74715963_74716114 | 1.47 |
Pafah1b1 |
platelet-activating factor acetylhydrolase, isoform 1b, subunit 1 |
7133 |
0.14 |
chr4_60245923_60246074 | 1.47 |
Mup-ps3 |
major urinary protein, pseudogene 3 |
8653 |
0.19 |
chr2_58766481_58766674 | 1.45 |
Upp2 |
uridine phosphorylase 2 |
1252 |
0.49 |
chr11_95387473_95387807 | 1.44 |
Slc35b1 |
solute carrier family 35, member B1 |
2345 |
0.19 |
chr19_8386372_8386709 | 1.42 |
Slc22a30 |
solute carrier family 22, member 30 |
18520 |
0.19 |
chr11_60782221_60782394 | 1.39 |
Smcr8 |
Smith-Magenis syndrome chromosome region, candidate 8 homolog (human) |
4782 |
0.09 |
chr17_64666151_64666321 | 1.38 |
Man2a1 |
mannosidase 2, alpha 1 |
47184 |
0.15 |
chr7_75667618_75667783 | 1.36 |
Gm25282 |
predicted gene, 25282 |
1173 |
0.48 |
chr1_177441281_177441460 | 1.35 |
Zbtb18 |
zinc finger and BTB domain containing 18 |
981 |
0.45 |
chr1_21258115_21258471 | 1.31 |
Gsta3 |
glutathione S-transferase, alpha 3 |
4772 |
0.12 |
chr1_188652846_188653036 | 1.31 |
Gm25095 |
predicted gene, 25095 |
29888 |
0.23 |
chr7_98353742_98354050 | 1.30 |
Tsku |
tsukushi, small leucine rich proteoglycan |
6183 |
0.18 |
chr10_89529855_89530073 | 1.27 |
Nr1h4 |
nuclear receptor subfamily 1, group H, member 4 |
3621 |
0.25 |
chr10_111597521_111597672 | 1.26 |
Gm30262 |
predicted gene, 30262 |
1581 |
0.33 |
chr13_69526450_69526653 | 1.24 |
Tent4a |
terminal nucleotidyltransferase 4A |
5881 |
0.14 |
chr7_67655501_67655709 | 1.22 |
Ttc23 |
tetratricopeptide repeat domain 23 |
158 |
0.93 |
chr9_44078514_44078710 | 1.21 |
Usp2 |
ubiquitin specific peptidase 2 |
6327 |
0.07 |
chr15_77397388_77398212 | 1.20 |
Apol7a |
apolipoprotein L 7a |
651 |
0.53 |
chr10_87925375_87925612 | 1.20 |
Tyms-ps |
thymidylate synthase, pseudogene |
41354 |
0.13 |
chr9_74318679_74318830 | 1.18 |
Gm24141 |
predicted gene, 24141 |
43856 |
0.14 |
chr2_29639167_29639331 | 1.17 |
Rapgef1 |
Rap guanine nucleotide exchange factor (GEF) 1 |
4566 |
0.23 |
chr1_67139611_67139949 | 1.16 |
Cps1 |
carbamoyl-phosphate synthetase 1 |
16754 |
0.23 |
chr14_121147880_121148031 | 1.16 |
Farp1 |
FERM, RhoGEF (Arhgef) and pleckstrin domain protein 1 (chondrocyte-derived) |
45876 |
0.17 |
chr6_72628926_72629104 | 1.15 |
Gm15401 |
predicted gene 15401 |
273 |
0.76 |
chr6_47836032_47836656 | 1.14 |
Zfp398 |
zinc finger protein 398 |
649 |
0.55 |
chr3_5221766_5221937 | 1.14 |
Zfhx4 |
zinc finger homeodomain 4 |
346 |
0.79 |
chr17_26512736_26512906 | 1.12 |
Dusp1 |
dual specificity phosphatase 1 |
4302 |
0.12 |
chr5_107987814_107988192 | 1.10 |
Dipk1a |
divergent protein kinase domain 1A |
918 |
0.49 |
chr6_121268942_121269144 | 1.09 |
Usp18 |
ubiquitin specific peptidase 18 |
494 |
0.71 |
chr14_59444318_59444480 | 1.08 |
Cab39l |
calcium binding protein 39-like |
3418 |
0.19 |
chr2_160713990_160714141 | 1.06 |
Top1 |
topoisomerase (DNA) I |
3404 |
0.22 |
chr1_36781526_36781677 | 1.05 |
Zap70 |
zeta-chain (TCR) associated protein kinase |
2617 |
0.18 |
chr11_28694241_28694518 | 1.03 |
2810471M01Rik |
RIKEN cDNA 2810471M01 gene |
12815 |
0.17 |
chr2_160715258_160715427 | 1.02 |
Top1 |
topoisomerase (DNA) I |
2127 |
0.29 |
chr10_18527476_18527627 | 1.02 |
Hebp2 |
heme binding protein 2 |
18336 |
0.2 |
chr19_55123841_55124054 | 1.01 |
Gpam |
glycerol-3-phosphate acyltransferase, mitochondrial |
3256 |
0.26 |
chr10_87869030_87869196 | 1.00 |
Igf1os |
insulin-like growth factor 1, opposite strand |
5732 |
0.22 |
chr7_98419666_98419845 | 1.00 |
Gm44507 |
predicted gene 44507 |
4131 |
0.15 |
chrX_163957889_163958321 | 0.99 |
Zrsr2 |
zinc finger (CCCH type), RNA binding motif and serine/arginine rich 2 |
57 |
0.98 |
chr3_122246297_122246485 | 0.99 |
Gclm |
glutamate-cysteine ligase, modifier subunit |
310 |
0.79 |
chr9_71137399_71137561 | 0.98 |
Gm47268 |
predicted gene, 47268 |
10638 |
0.19 |
chr17_62789514_62789722 | 0.98 |
Efna5 |
ephrin A5 |
91526 |
0.1 |
chr13_101691110_101691326 | 0.97 |
Pik3r1 |
phosphoinositide-3-kinase regulatory subunit 1 |
1125 |
0.57 |
chr17_64746312_64746463 | 0.96 |
Gm17133 |
predicted gene 17133 |
7709 |
0.2 |
chr10_81417158_81417470 | 0.96 |
Mir1191b |
microRNA 1191b |
1017 |
0.25 |
chr10_80741113_80741485 | 0.95 |
Ap3d1 |
adaptor-related protein complex 3, delta 1 subunit |
672 |
0.49 |
chr10_40053644_40053795 | 0.95 |
Slc16a10 |
solute carrier family 16 (monocarboxylic acid transporters), member 10 |
22886 |
0.11 |
chr8_105084499_105084664 | 0.94 |
Ces3b |
carboxylesterase 3B |
818 |
0.45 |
chr11_60076538_60076689 | 0.93 |
Rai1 |
retinoic acid induced 1 |
28400 |
0.12 |
chr2_130908138_130908309 | 0.93 |
Atrn |
attractin |
1292 |
0.28 |
chr15_85716353_85716695 | 0.93 |
Mirlet7b |
microRNA let7b |
9205 |
0.13 |
chr11_16819306_16819457 | 0.92 |
Egfros |
epidermal growth factor receptor, opposite strand |
11321 |
0.22 |
chr15_22791062_22791223 | 0.92 |
Hnrnpa1l2-ps2 |
heterogeneous nuclear ribonucleoprotein A1-like 2, pseudogene 2 |
76312 |
0.12 |
chr4_45505286_45505685 | 0.92 |
Gm22518 |
predicted gene, 22518 |
4933 |
0.17 |
chr5_40572827_40572996 | 0.91 |
Gm23022 |
predicted gene, 23022 |
166982 |
0.04 |
chr11_65787387_65787891 | 0.91 |
Map2k4 |
mitogen-activated protein kinase kinase 4 |
646 |
0.74 |
chr1_67140900_67141469 | 0.91 |
Cps1 |
carbamoyl-phosphate synthetase 1 |
18158 |
0.22 |
chr9_122027805_122027998 | 0.89 |
Gm47117 |
predicted gene, 47117 |
15761 |
0.1 |
chr16_91010005_91010156 | 0.89 |
Synj1 |
synaptojanin 1 |
981 |
0.31 |
chr11_22838304_22838455 | 0.88 |
Gm20456 |
predicted gene 20456 |
920 |
0.45 |
chr4_104768550_104768721 | 0.88 |
C8b |
complement component 8, beta polypeptide |
2240 |
0.4 |
chr4_6271332_6271765 | 0.87 |
Cyp7a1 |
cytochrome P450, family 7, subfamily a, polypeptide 1 |
4083 |
0.23 |
chrX_98052078_98052255 | 0.86 |
Gm14802 |
predicted gene 14802 |
11791 |
0.3 |
chr15_98925214_98925388 | 0.86 |
Lmbr1l |
limb region 1 like |
7070 |
0.07 |
chr1_75045469_75045620 | 0.86 |
Nhej1 |
non-homologous end joining factor 1 |
1095 |
0.44 |
chr14_57105897_57106164 | 0.86 |
Gjb2 |
gap junction protein, beta 2 |
1328 |
0.37 |
chr14_29009784_29010127 | 0.85 |
Gm23999 |
predicted gene, 23999 |
156 |
0.96 |
chr14_55671605_55671777 | 0.84 |
Nedd8 |
neural precursor cell expressed, developmentally down-regulated gene 8 |
182 |
0.53 |
chr6_71993557_71993708 | 0.83 |
Gm26628 |
predicted gene, 26628 |
29857 |
0.11 |
chr7_98389139_98389290 | 0.83 |
Gm44507 |
predicted gene 44507 |
26410 |
0.12 |
chr13_52736115_52736276 | 0.83 |
BB123696 |
expressed sequence BB123696 |
587 |
0.84 |
chr5_45437394_45437584 | 0.83 |
Gm42413 |
predicted gene, 42413 |
3100 |
0.17 |
chr13_31506338_31507020 | 0.82 |
Foxq1 |
forkhead box Q1 |
49455 |
0.1 |
chr18_7692809_7692996 | 0.82 |
Gm18763 |
predicted gene, 18763 |
176 |
0.96 |
chr12_103992655_103992974 | 0.82 |
Serpina11 |
serine (or cysteine) peptidase inhibitor, clade A (alpha-1 antiproteinase, antitrypsin), member 11 |
2857 |
0.14 |
chr8_81378490_81378647 | 0.81 |
Inpp4b |
inositol polyphosphate-4-phosphatase, type II |
36006 |
0.19 |
chr7_99970177_99970350 | 0.81 |
Rnf169 |
ring finger protein 169 |
4529 |
0.15 |
chr6_84225136_84225617 | 0.80 |
Gm44127 |
predicted gene, 44127 |
124 |
0.97 |
chr18_59092890_59093288 | 0.80 |
Minar2 |
membrane integral NOTCH2 associated receptor 2 |
30578 |
0.22 |
chr8_76148232_76148470 | 0.80 |
Gm45742 |
predicted gene 45742 |
31324 |
0.21 |
chr11_63882356_63882507 | 0.80 |
Hmgb1-ps3 |
high mobility group box 1, pseudogene 3 |
35613 |
0.15 |
chr8_117706198_117706405 | 0.79 |
Hsd17b2 |
hydroxysteroid (17-beta) dehydrogenase 2 |
4214 |
0.16 |
chr2_18080135_18080286 | 0.79 |
Mllt10 |
myeloid/lymphoid or mixed-lineage leukemia; translocated to, 10 |
15369 |
0.11 |
chr4_122945294_122945445 | 0.79 |
Mfsd2a |
major facilitator superfamily domain containing 2A |
14621 |
0.13 |
chr4_106769462_106769630 | 0.79 |
Acot11 |
acyl-CoA thioesterase 11 |
2010 |
0.25 |
chr14_27298945_27299301 | 0.79 |
Arhgef3 |
Rho guanine nucleotide exchange factor (GEF) 3 |
36943 |
0.16 |
chr1_60611962_60612336 | 0.79 |
Gm23762 |
predicted gene, 23762 |
1654 |
0.29 |
chr10_68057448_68057599 | 0.78 |
Rtkn2 |
rhotekin 2 |
13555 |
0.2 |
chr11_20830111_20830478 | 0.78 |
Lgalsl |
lectin, galactoside binding-like |
461 |
0.73 |
chr6_144710079_144710270 | 0.78 |
Sox5os4 |
SRY (sex determining region Y)-box 5, opposite strand 4 |
10737 |
0.16 |
chr5_28463981_28464172 | 0.78 |
9530036O11Rik |
RIKEN cDNA 9530036O11Rik |
2908 |
0.25 |
chr2_52613475_52613626 | 0.78 |
Bloc1s2-ps |
biogenesis of lysosomal organelles complex-1, subunit 2, pseudogene |
6204 |
0.24 |
chr14_66279629_66279835 | 0.78 |
Ptk2b |
PTK2 protein tyrosine kinase 2 beta |
1250 |
0.42 |
chr15_78548274_78548425 | 0.77 |
Sstr3 |
somatostatin receptor 3 |
3664 |
0.12 |
chr4_118620306_118620678 | 0.77 |
Cfap57 |
cilia and flagella associated protein 57 |
87 |
0.76 |
chr2_32775126_32775277 | 0.77 |
Ttc16 |
tetratricopeptide repeat domain 16 |
129 |
0.82 |
chr13_101700034_101700185 | 0.77 |
Pik3r1 |
phosphoinositide-3-kinase regulatory subunit 1 |
1995 |
0.38 |
chr1_85959468_85960001 | 0.76 |
Gpr55 |
G protein-coupled receptor 55 |
1273 |
0.33 |
chr9_101114711_101114869 | 0.76 |
Gm37962 |
predicted gene, 37962 |
985 |
0.37 |
chr11_120817696_120817936 | 0.76 |
Fasn |
fatty acid synthase |
2361 |
0.15 |
chr8_34941364_34941583 | 0.75 |
Tnks |
tankyrase, TRF1-interacting ankyrin-related ADP-ribose polymerase |
22705 |
0.16 |
chr3_144110073_144110233 | 0.75 |
Gm34078 |
predicted gene, 34078 |
25601 |
0.2 |
chr19_31900226_31900377 | 0.75 |
Gm19241 |
predicted gene, 19241 |
13343 |
0.21 |
chr11_94321337_94321604 | 0.75 |
Luc7l3 |
LUC7-like 3 (S. cerevisiae) |
425 |
0.79 |
chr1_135821769_135822222 | 0.74 |
Lad1 |
ladinin |
3397 |
0.17 |
chr9_111147421_111147572 | 0.74 |
Lrrfip2 |
leucine rich repeat (in FLII) interacting protein 2 |
13807 |
0.16 |
chr5_114773728_114774141 | 0.74 |
Git2 |
GIT ArfGAP 2 |
439 |
0.5 |
chr18_66458137_66458288 | 0.74 |
Pmaip1 |
phorbol-12-myristate-13-acetate-induced protein 1 |
321 |
0.83 |
chr4_117303634_117303831 | 0.74 |
Rnf220 |
ring finger protein 220 |
3704 |
0.16 |
chr12_110221880_110222031 | 0.74 |
Gm40576 |
predicted gene, 40576 |
14407 |
0.11 |
chr14_55724403_55725378 | 0.74 |
Rabggta |
Rab geranylgeranyl transferase, a subunit |
2627 |
0.1 |
chr6_144071228_144071403 | 0.74 |
Sox5os1 |
SRY (sex determining region Y)-box 5, opposite strand 1 |
49407 |
0.17 |
chr2_94144685_94145031 | 0.73 |
Hsd17b12 |
hydroxysteroid (17-beta) dehydrogenase 12 |
13035 |
0.17 |
chr9_52055276_52055477 | 0.73 |
Rdx |
radixin |
7105 |
0.2 |
chr15_58991394_58991639 | 0.73 |
4930544F09Rik |
RIKEN cDNA 4930544F09 gene |
7380 |
0.18 |
chr9_57065617_57065768 | 0.73 |
Gm10658 |
predicted gene 10658 |
6115 |
0.13 |
chr6_83774498_83774690 | 0.73 |
Tex261 |
testis expressed gene 261 |
1164 |
0.27 |
chr10_111299922_111300149 | 0.73 |
Bbs10 |
Bardet-Biedl syndrome 10 (human) |
1356 |
0.44 |
chr9_103217995_103218146 | 0.72 |
Trf |
transferrin |
1796 |
0.31 |
chr1_67138759_67139000 | 0.72 |
Cps1 |
carbamoyl-phosphate synthetase 1 |
15853 |
0.23 |
chr4_136249531_136249688 | 0.72 |
Tcea3 |
transcription elongation factor A (SII), 3 |
1636 |
0.31 |
chr11_120352645_120353136 | 0.71 |
0610009L18Rik |
RIKEN cDNA 0610009L18 gene |
4212 |
0.09 |
chr5_134989639_134990033 | 0.71 |
Cldn3 |
claudin 3 |
3622 |
0.09 |
chr1_67172096_67172314 | 0.71 |
Cps1 |
carbamoyl-phosphate synthetase 1 |
49179 |
0.14 |
chr17_35816298_35816449 | 0.71 |
Ier3 |
immediate early response 3 |
5311 |
0.08 |
chr7_90129909_90130310 | 0.71 |
Picalm |
phosphatidylinositol binding clathrin assembly protein |
104 |
0.52 |
chr16_24240369_24240709 | 0.71 |
Gm31814 |
predicted gene, 31814 |
22620 |
0.19 |
chr5_65431249_65431409 | 0.70 |
Gm43289 |
predicted gene 43289 |
251 |
0.83 |
chr4_129696495_129696668 | 0.70 |
Tmem39b |
transmembrane protein 39b |
39 |
0.95 |
chr5_151105228_151105402 | 0.70 |
Stard13 |
StAR-related lipid transfer (START) domain containing 13 |
3420 |
0.32 |
chr12_116262515_116262838 | 0.70 |
Wdr60 |
WD repeat domain 60 |
298 |
0.84 |
chr13_20405505_20405719 | 0.70 |
Elmo1 |
engulfment and cell motility 1 |
67114 |
0.1 |
chr2_127371079_127371425 | 0.70 |
Adra2b |
adrenergic receptor, alpha 2b |
7966 |
0.14 |
chr9_74304589_74304740 | 0.69 |
Wdr72 |
WD repeat domain 72 |
30530 |
0.19 |
chr4_122980856_122981253 | 0.69 |
Mycl |
v-myc avian myelocytomatosis viral oncogene lung carcinoma derived |
14598 |
0.13 |
chr2_122143044_122143518 | 0.69 |
B2m |
beta-2 microglobulin |
4405 |
0.14 |
chr9_110732604_110733116 | 0.68 |
Myl3 |
myosin, light polypeptide 3 |
9001 |
0.11 |
chr12_40477396_40477555 | 0.68 |
Dock4 |
dedicator of cytokinesis 4 |
31139 |
0.19 |
chr3_120192792_120192955 | 0.67 |
Gm23733 |
predicted gene, 23733 |
125116 |
0.06 |
chr14_9588327_9588480 | 0.67 |
Gm48371 |
predicted gene, 48371 |
118848 |
0.06 |
chr9_32244199_32244529 | 0.67 |
Arhgap32 |
Rho GTPase activating protein 32 |
800 |
0.68 |
chr9_74796059_74796419 | 0.66 |
Gm22315 |
predicted gene, 22315 |
14169 |
0.17 |
chr15_3504126_3504331 | 0.65 |
Ghr |
growth hormone receptor |
32584 |
0.22 |
chr3_89901254_89901439 | 0.65 |
Gm42809 |
predicted gene 42809 |
11570 |
0.11 |
chr12_75475484_75475700 | 0.65 |
Gm47690 |
predicted gene, 47690 |
33153 |
0.17 |
chr4_115904359_115904534 | 0.65 |
6430628N08Rik |
RIKEN cDNA 6430628N08 gene |
13780 |
0.11 |
chr11_5525096_5525390 | 0.65 |
Xbp1 |
X-box binding protein 1 |
3320 |
0.17 |
chr15_77917689_77917840 | 0.64 |
Txn2 |
thioredoxin 2 |
2064 |
0.26 |
chr5_104033018_104033412 | 0.64 |
Hsd17b11 |
hydroxysteroid (17-beta) dehydrogenase 11 |
11296 |
0.1 |
chr10_22149005_22149562 | 0.64 |
E030030I06Rik |
RIKEN cDNA E030030I06 gene |
13 |
0.95 |
chr4_61248201_61248394 | 0.64 |
Mup-ps10 |
major urinary protein, pseudogene 10 |
4720 |
0.21 |
chr16_18187141_18187312 | 0.64 |
Mir6366 |
microRNA 6366 |
22056 |
0.08 |
chr3_100684617_100684891 | 0.64 |
Man1a2 |
mannosidase, alpha, class 1A, member 2 |
141 |
0.94 |
chr11_77892936_77893275 | 0.64 |
Pipox |
pipecolic acid oxidase |
991 |
0.46 |
chr4_86748368_86748674 | 0.63 |
Dennd4c |
DENN/MADD domain containing 4C |
34 |
0.98 |
chr16_43072275_43072481 | 0.63 |
Gm25873 |
predicted gene, 25873 |
53855 |
0.14 |
chr14_70057055_70057399 | 0.63 |
Gm33524 |
predicted gene, 33524 |
140 |
0.95 |
chr19_43766346_43766539 | 0.63 |
Cutc |
cutC copper transporter |
1569 |
0.3 |
chr6_117828394_117828571 | 0.63 |
Zfp637 |
zinc finger protein 637 |
12698 |
0.14 |
chr6_143857686_143858000 | 0.63 |
Sox5 |
SRY (sex determining region Y)-box 5 |
89245 |
0.09 |
chr8_93181874_93182111 | 0.63 |
Ces1d |
carboxylesterase 1D |
6703 |
0.14 |
chr8_22893346_22893646 | 0.62 |
Gm45555 |
predicted gene 45555 |
19907 |
0.14 |
chr11_106267873_106268160 | 0.62 |
Smarcd2 |
SWI/SNF related, matrix associated, actin dependent regulator of chromatin, subfamily d, member 2 |
217 |
0.85 |
chr13_42589725_42589886 | 0.62 |
Gm47125 |
predicted gene, 47125 |
20342 |
0.21 |
chr8_24435531_24435682 | 0.62 |
Tcim |
transcriptional and immune response regulator |
3378 |
0.19 |
chr9_31963285_31963440 | 0.62 |
Tpi-rs4 |
triosephosphate isomerase related sequence 4 |
15016 |
0.15 |
chr2_121439577_121439771 | 0.62 |
Ell3 |
elongation factor RNA polymerase II-like 3 |
1477 |
0.18 |
chr2_167345633_167345808 | 0.62 |
B4galt5 |
UDP-Gal:betaGlcNAc beta 1,4-galactosyltransferase, polypeptide 5 |
3463 |
0.24 |
chr15_7145941_7146124 | 0.62 |
Lifr |
LIF receptor alpha |
5483 |
0.3 |
chr1_119646750_119646988 | 0.62 |
Epb41l5 |
erythrocyte membrane protein band 4.1 like 5 |
1748 |
0.32 |
chr11_117617986_117618159 | 0.61 |
2900041M22Rik |
RIKEN cDNA 2900041M22 gene |
6825 |
0.19 |
chr15_51795613_51795825 | 0.61 |
Eif3h |
eukaryotic translation initiation factor 3, subunit H |
5170 |
0.27 |
chr13_81328752_81329212 | 0.61 |
Adgrv1 |
adhesion G protein-coupled receptor V1 |
13854 |
0.26 |
chr4_61167643_61167862 | 0.61 |
Mup-ps9 |
major urinary protein, pseudogene 9 |
4689 |
0.27 |
chr4_82390941_82391098 | 0.61 |
n-R5s188 |
nuclear encoded rRNA 5S 188 |
48391 |
0.17 |
chr12_104089620_104089844 | 0.61 |
Serpina4-ps1 |
serine (or cysteine) peptidase inhibitor, clade A, member 4, pseudogene 1 |
9083 |
0.1 |
chr19_40222650_40222869 | 0.61 |
Pdlim1 |
PDZ and LIM domain 1 (elfin) |
597 |
0.68 |
chr3_18243229_18243527 | 0.60 |
Cyp7b1 |
cytochrome P450, family 7, subfamily b, polypeptide 1 |
40 |
0.98 |
chr11_94629386_94629563 | 0.60 |
Lrrc59 |
leucine rich repeat containing 59 |
293 |
0.82 |
chr15_77824590_77824768 | 0.60 |
Myh9 |
myosin, heavy polypeptide 9, non-muscle |
11448 |
0.14 |
chr6_136920490_136920850 | 0.60 |
Erp27 |
endoplasmic reticulum protein 27 |
1470 |
0.28 |
chr3_18191138_18191313 | 0.60 |
Gm23686 |
predicted gene, 23686 |
13600 |
0.23 |
chr19_47248836_47249009 | 0.60 |
AC132288.1 |
TEC |
3321 |
0.16 |
chr4_122971820_122972064 | 0.60 |
4933421A08Rik |
RIKEN cDNA 4933421A08 gene |
10633 |
0.13 |
chr14_25746983_25747134 | 0.59 |
Zcchc24 |
zinc finger, CCHC domain containing 24 |
21981 |
0.13 |
chr11_70649253_70649602 | 0.59 |
Rnf167 |
ring finger protein 167 |
305 |
0.69 |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.2 | 0.7 | GO:0071492 | cellular response to UV-A(GO:0071492) |
0.2 | 0.6 | GO:1900740 | regulation of protein insertion into mitochondrial membrane involved in apoptotic signaling pathway(GO:1900739) positive regulation of protein insertion into mitochondrial membrane involved in apoptotic signaling pathway(GO:1900740) |
0.2 | 0.6 | GO:1901078 | negative regulation of relaxation of muscle(GO:1901078) |
0.2 | 0.9 | GO:0060283 | negative regulation of oocyte development(GO:0060283) |
0.2 | 0.4 | GO:0019676 | ammonia assimilation cycle(GO:0019676) |
0.2 | 0.3 | GO:0034756 | regulation of iron ion transport(GO:0034756) |
0.2 | 0.5 | GO:1904742 | regulation of telomeric DNA binding(GO:1904742) |
0.1 | 0.6 | GO:0043622 | cortical microtubule organization(GO:0043622) |
0.1 | 0.6 | GO:0097460 | ferrous iron import into cell(GO:0097460) |
0.1 | 0.9 | GO:0006526 | arginine biosynthetic process(GO:0006526) |
0.1 | 0.4 | GO:2000611 | positive regulation of thyroid hormone generation(GO:2000611) |
0.1 | 0.7 | GO:0009115 | xanthine catabolic process(GO:0009115) |
0.1 | 0.4 | GO:0003062 | regulation of heart rate by chemical signal(GO:0003062) |
0.1 | 0.5 | GO:1905206 | positive regulation of hydrogen peroxide-mediated programmed cell death(GO:1901300) positive regulation of hydrogen peroxide-induced cell death(GO:1905206) |
0.1 | 0.4 | GO:0021553 | olfactory nerve development(GO:0021553) |
0.1 | 0.4 | GO:2000286 | receptor internalization involved in canonical Wnt signaling pathway(GO:2000286) |
0.1 | 1.0 | GO:1900103 | positive regulation of endoplasmic reticulum unfolded protein response(GO:1900103) |
0.1 | 0.8 | GO:0051409 | response to nitrosative stress(GO:0051409) |
0.1 | 0.5 | GO:0035754 | B cell chemotaxis(GO:0035754) |
0.1 | 0.5 | GO:1903423 | positive regulation of synaptic vesicle recycling(GO:1903423) |
0.1 | 0.5 | GO:0048003 | antigen processing and presentation of lipid antigen via MHC class Ib(GO:0048003) antigen processing and presentation, exogenous lipid antigen via MHC class Ib(GO:0048007) |
0.1 | 0.3 | GO:0007525 | somatic muscle development(GO:0007525) |
0.1 | 0.3 | GO:1903800 | positive regulation of production of miRNAs involved in gene silencing by miRNA(GO:1903800) |
0.1 | 0.5 | GO:0031508 | pericentric heterochromatin assembly(GO:0031508) |
0.1 | 0.7 | GO:2000672 | negative regulation of motor neuron apoptotic process(GO:2000672) |
0.1 | 0.3 | GO:0019626 | short-chain fatty acid catabolic process(GO:0019626) |
0.1 | 0.3 | GO:0042851 | L-alanine metabolic process(GO:0042851) |
0.1 | 0.5 | GO:0070236 | negative regulation of activation-induced cell death of T cells(GO:0070236) |
0.1 | 0.4 | GO:1903142 | positive regulation of endothelial cell development(GO:1901552) positive regulation of establishment of endothelial barrier(GO:1903142) |
0.1 | 0.6 | GO:0010739 | positive regulation of protein kinase A signaling(GO:0010739) |
0.1 | 0.3 | GO:1904017 | response to Thyroglobulin triiodothyronine(GO:1904016) cellular response to Thyroglobulin triiodothyronine(GO:1904017) |
0.1 | 0.3 | GO:0032485 | regulation of Ral protein signal transduction(GO:0032485) |
0.1 | 0.5 | GO:0051596 | methylglyoxal catabolic process to D-lactate via S-lactoyl-glutathione(GO:0019243) methylglyoxal catabolic process(GO:0051596) methylglyoxal catabolic process to lactate(GO:0061727) |
0.1 | 0.7 | GO:0006265 | DNA topological change(GO:0006265) |
0.1 | 0.4 | GO:0009169 | ribonucleoside monophosphate catabolic process(GO:0009158) purine ribonucleoside monophosphate catabolic process(GO:0009169) |
0.1 | 0.3 | GO:0006553 | lysine metabolic process(GO:0006553) |
0.1 | 0.5 | GO:0097459 | iron ion import into cell(GO:0097459) |
0.1 | 0.3 | GO:0035284 | central nervous system segmentation(GO:0035283) brain segmentation(GO:0035284) |
0.1 | 0.3 | GO:0030908 | intein-mediated protein splicing(GO:0016539) protein splicing(GO:0030908) |
0.1 | 0.3 | GO:0009106 | lipoate metabolic process(GO:0009106) |
0.1 | 0.4 | GO:0003383 | apical constriction(GO:0003383) |
0.1 | 0.2 | GO:0042524 | negative regulation of tyrosine phosphorylation of Stat5 protein(GO:0042524) |
0.1 | 0.3 | GO:0072531 | pyrimidine-containing compound transmembrane transport(GO:0072531) |
0.1 | 0.2 | GO:2000698 | positive regulation of epithelial cell differentiation involved in kidney development(GO:2000698) |
0.1 | 0.3 | GO:2000097 | regulation of smooth muscle cell-matrix adhesion(GO:2000097) |
0.1 | 0.3 | GO:0010887 | negative regulation of cholesterol storage(GO:0010887) |
0.1 | 0.3 | GO:0071672 | negative regulation of smooth muscle cell chemotaxis(GO:0071672) |
0.1 | 0.3 | GO:0018894 | dibenzo-p-dioxin metabolic process(GO:0018894) |
0.1 | 0.2 | GO:2001271 | negative regulation of cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:2001271) |
0.1 | 0.5 | GO:0021960 | anterior commissure morphogenesis(GO:0021960) |
0.1 | 0.2 | GO:0006106 | fumarate metabolic process(GO:0006106) |
0.1 | 0.4 | GO:0030259 | lipid glycosylation(GO:0030259) |
0.1 | 0.4 | GO:0070120 | ciliary neurotrophic factor-mediated signaling pathway(GO:0070120) |
0.1 | 0.2 | GO:0048371 | lateral mesoderm morphogenesis(GO:0048369) lateral mesoderm formation(GO:0048370) lateral mesodermal cell differentiation(GO:0048371) |
0.1 | 0.4 | GO:0051694 | pointed-end actin filament capping(GO:0051694) |
0.1 | 0.3 | GO:0042997 | negative regulation of Golgi to plasma membrane protein transport(GO:0042997) |
0.1 | 0.4 | GO:0045542 | positive regulation of cholesterol biosynthetic process(GO:0045542) positive regulation of cholesterol metabolic process(GO:0090205) |
0.1 | 0.2 | GO:0015770 | disaccharide transport(GO:0015766) sucrose transport(GO:0015770) oligosaccharide transport(GO:0015772) |
0.1 | 0.4 | GO:1902237 | positive regulation of endoplasmic reticulum stress-induced intrinsic apoptotic signaling pathway(GO:1902237) |
0.1 | 0.3 | GO:1902969 | mitotic DNA replication(GO:1902969) |
0.1 | 0.2 | GO:0002071 | glandular epithelial cell maturation(GO:0002071) |
0.1 | 0.3 | GO:0036462 | TRAIL-activated apoptotic signaling pathway(GO:0036462) |
0.1 | 0.2 | GO:0009597 | detection of virus(GO:0009597) |
0.1 | 0.2 | GO:0043366 | beta selection(GO:0043366) |
0.1 | 0.2 | GO:0071883 | activation of MAPK activity by adrenergic receptor signaling pathway(GO:0071883) |
0.1 | 0.2 | GO:1902897 | regulation of postsynaptic density protein 95 clustering(GO:1902897) |
0.1 | 0.1 | GO:0050968 | detection of chemical stimulus involved in sensory perception of pain(GO:0050968) |
0.1 | 0.4 | GO:0032464 | positive regulation of protein homooligomerization(GO:0032464) |
0.1 | 0.1 | GO:0048807 | female genitalia morphogenesis(GO:0048807) |
0.1 | 0.2 | GO:0002282 | microglial cell activation involved in immune response(GO:0002282) |
0.1 | 0.6 | GO:0033147 | negative regulation of intracellular estrogen receptor signaling pathway(GO:0033147) |
0.1 | 0.2 | GO:0071499 | response to laminar fluid shear stress(GO:0034616) cellular response to laminar fluid shear stress(GO:0071499) |
0.1 | 0.2 | GO:0010724 | regulation of definitive erythrocyte differentiation(GO:0010724) |
0.1 | 0.5 | GO:1901339 | regulation of store-operated calcium channel activity(GO:1901339) |
0.1 | 0.2 | GO:0018406 | protein C-linked glycosylation(GO:0018103) peptidyl-tryptophan modification(GO:0018211) protein C-linked glycosylation via tryptophan(GO:0018317) protein C-linked glycosylation via 2'-alpha-mannosyl-L-tryptophan(GO:0018406) |
0.1 | 0.3 | GO:0070345 | negative regulation of fat cell proliferation(GO:0070345) |
0.1 | 0.2 | GO:0090155 | negative regulation of sphingolipid biosynthetic process(GO:0090155) cellular sphingolipid homeostasis(GO:0090156) |
0.1 | 0.2 | GO:0006438 | valyl-tRNA aminoacylation(GO:0006438) |
0.1 | 0.2 | GO:1904469 | positive regulation of tumor necrosis factor secretion(GO:1904469) |
0.1 | 0.6 | GO:1900025 | negative regulation of substrate adhesion-dependent cell spreading(GO:1900025) |
0.1 | 0.2 | GO:0043308 | eosinophil activation involved in immune response(GO:0002278) eosinophil mediated immunity(GO:0002447) eosinophil degranulation(GO:0043308) |
0.1 | 0.2 | GO:0090360 | platelet-derived growth factor production(GO:0090360) regulation of platelet-derived growth factor production(GO:0090361) |
0.0 | 0.2 | GO:2000271 | positive regulation of fibroblast apoptotic process(GO:2000271) |
0.0 | 0.4 | GO:0043651 | linoleic acid metabolic process(GO:0043651) |
0.0 | 0.1 | GO:0070889 | platelet alpha granule organization(GO:0070889) |
0.0 | 0.0 | GO:0015868 | purine ribonucleotide transport(GO:0015868) |
0.0 | 0.2 | GO:0048619 | embryonic hindgut morphogenesis(GO:0048619) |
0.0 | 0.3 | GO:0071447 | cellular response to hydroperoxide(GO:0071447) |
0.0 | 0.1 | GO:0046449 | creatinine metabolic process(GO:0046449) cellular lactam metabolic process(GO:0072338) |
0.0 | 0.4 | GO:0006013 | mannose metabolic process(GO:0006013) |
0.0 | 0.1 | GO:0000379 | tRNA-type intron splice site recognition and cleavage(GO:0000379) |
0.0 | 0.5 | GO:0006957 | complement activation, alternative pathway(GO:0006957) |
0.0 | 0.0 | GO:0009438 | methylglyoxal metabolic process(GO:0009438) |
0.0 | 0.4 | GO:0043517 | positive regulation of DNA damage response, signal transduction by p53 class mediator(GO:0043517) |
0.0 | 0.6 | GO:0045116 | protein neddylation(GO:0045116) |
0.0 | 0.1 | GO:0050427 | 3'-phosphoadenosine 5'-phosphosulfate metabolic process(GO:0050427) |
0.0 | 0.1 | GO:2000370 | positive regulation of clathrin-mediated endocytosis(GO:2000370) |
0.0 | 0.3 | GO:0070131 | positive regulation of mitochondrial translation(GO:0070131) |
0.0 | 0.1 | GO:1903334 | positive regulation of protein folding(GO:1903334) |
0.0 | 0.1 | GO:0070973 | protein localization to endoplasmic reticulum exit site(GO:0070973) |
0.0 | 0.1 | GO:0006208 | pyrimidine nucleobase catabolic process(GO:0006208) thymine catabolic process(GO:0006210) thymine metabolic process(GO:0019859) |
0.0 | 0.1 | GO:0071596 | ubiquitin-dependent protein catabolic process via the N-end rule pathway(GO:0071596) |
0.0 | 0.7 | GO:0015721 | bile acid and bile salt transport(GO:0015721) |
0.0 | 0.1 | GO:0002949 | tRNA threonylcarbamoyladenosine modification(GO:0002949) |
0.0 | 0.1 | GO:2000562 | negative regulation of CD4-positive, alpha-beta T cell proliferation(GO:2000562) |
0.0 | 0.0 | GO:0090168 | Golgi reassembly(GO:0090168) |
0.0 | 0.4 | GO:1903392 | negative regulation of adherens junction organization(GO:1903392) |
0.0 | 0.3 | GO:0000338 | protein deneddylation(GO:0000338) cullin deneddylation(GO:0010388) |
0.0 | 0.3 | GO:0009404 | toxin metabolic process(GO:0009404) |
0.0 | 0.2 | GO:0001561 | fatty acid alpha-oxidation(GO:0001561) |
0.0 | 0.0 | GO:0046005 | positive regulation of circadian sleep/wake cycle, REM sleep(GO:0046005) |
0.0 | 0.0 | GO:0000480 | endonucleolytic cleavage in 5'-ETS of tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000480) |
0.0 | 0.1 | GO:0036092 | phosphatidylinositol-3-phosphate biosynthetic process(GO:0036092) |
0.0 | 0.2 | GO:0046959 | habituation(GO:0046959) |
0.0 | 0.3 | GO:0038180 | nerve growth factor signaling pathway(GO:0038180) |
0.0 | 0.1 | GO:0035793 | cell migration involved in metanephros development(GO:0035788) metanephric mesenchymal cell migration(GO:0035789) positive regulation of metanephric mesenchymal cell migration by platelet-derived growth factor receptor-beta signaling pathway(GO:0035793) regulation of metanephric mesenchymal cell migration by platelet-derived growth factor receptor-beta signaling pathway(GO:1900238) regulation of metanephric mesenchymal cell migration(GO:2000589) positive regulation of metanephric mesenchymal cell migration(GO:2000591) |
0.0 | 0.6 | GO:0045671 | negative regulation of osteoclast differentiation(GO:0045671) |
0.0 | 0.3 | GO:0097062 | dendritic spine maintenance(GO:0097062) |
0.0 | 1.5 | GO:0000245 | spliceosomal complex assembly(GO:0000245) |
0.0 | 0.1 | GO:0051176 | positive regulation of sulfur metabolic process(GO:0051176) |
0.0 | 0.1 | GO:2000384 | regulation of ectoderm development(GO:2000383) negative regulation of ectoderm development(GO:2000384) |
0.0 | 0.3 | GO:0046784 | viral mRNA export from host cell nucleus(GO:0046784) |
0.0 | 0.1 | GO:0036438 | maintenance of lens transparency(GO:0036438) |
0.0 | 0.0 | GO:0070103 | regulation of interleukin-6-mediated signaling pathway(GO:0070103) |
0.0 | 0.1 | GO:1904491 | protein localization to ciliary transition zone(GO:1904491) |
0.0 | 0.4 | GO:0006337 | nucleosome disassembly(GO:0006337) protein-DNA complex disassembly(GO:0032986) |
0.0 | 0.2 | GO:0042118 | endothelial cell activation(GO:0042118) |
0.0 | 0.3 | GO:0042795 | snRNA transcription from RNA polymerase II promoter(GO:0042795) |
0.0 | 0.4 | GO:0008535 | respiratory chain complex IV assembly(GO:0008535) |
0.0 | 0.1 | GO:0071896 | protein localization to adherens junction(GO:0071896) |
0.0 | 0.2 | GO:0048341 | paraxial mesoderm formation(GO:0048341) |
0.0 | 0.1 | GO:0009113 | purine nucleobase biosynthetic process(GO:0009113) |
0.0 | 0.1 | GO:0048696 | regulation of collateral sprouting in absence of injury(GO:0048696) |
0.0 | 0.1 | GO:0050955 | thermoception(GO:0050955) |
0.0 | 0.1 | GO:0046121 | deoxyribonucleoside catabolic process(GO:0046121) |
0.0 | 0.1 | GO:0030311 | poly-N-acetyllactosamine metabolic process(GO:0030309) poly-N-acetyllactosamine biosynthetic process(GO:0030311) |
0.0 | 0.2 | GO:1904424 | regulation of GTP binding(GO:1904424) |
0.0 | 0.2 | GO:0061684 | chaperone-mediated autophagy(GO:0061684) |
0.0 | 0.4 | GO:0060856 | establishment of blood-brain barrier(GO:0060856) |
0.0 | 0.6 | GO:0043153 | entrainment of circadian clock by photoperiod(GO:0043153) |
0.0 | 0.2 | GO:0008298 | intracellular mRNA localization(GO:0008298) |
0.0 | 0.1 | GO:2000741 | positive regulation of mesenchymal stem cell differentiation(GO:2000741) |
0.0 | 0.7 | GO:0006491 | N-glycan processing(GO:0006491) |
0.0 | 0.1 | GO:0070350 | white fat cell proliferation(GO:0070343) regulation of white fat cell proliferation(GO:0070350) |
0.0 | 0.3 | GO:0030853 | negative regulation of granulocyte differentiation(GO:0030853) |
0.0 | 0.2 | GO:0010940 | positive regulation of necrotic cell death(GO:0010940) |
0.0 | 0.4 | GO:0070166 | enamel mineralization(GO:0070166) |
0.0 | 0.4 | GO:0070816 | phosphorylation of RNA polymerase II C-terminal domain(GO:0070816) |
0.0 | 0.1 | GO:0031339 | negative regulation of vesicle fusion(GO:0031339) |
0.0 | 0.2 | GO:0017196 | N-terminal peptidyl-methionine acetylation(GO:0017196) |
0.0 | 0.2 | GO:0035435 | phosphate ion transmembrane transport(GO:0035435) |
0.0 | 0.2 | GO:0002072 | optic cup morphogenesis involved in camera-type eye development(GO:0002072) |
0.0 | 0.1 | GO:0006166 | purine ribonucleoside salvage(GO:0006166) |
0.0 | 0.1 | GO:0010841 | positive regulation of circadian sleep/wake cycle, wakefulness(GO:0010841) |
0.0 | 0.4 | GO:0060670 | branching involved in labyrinthine layer morphogenesis(GO:0060670) |
0.0 | 0.1 | GO:0030327 | prenylated protein catabolic process(GO:0030327) |
0.0 | 0.1 | GO:1903964 | monounsaturated fatty acid metabolic process(GO:1903964) monounsaturated fatty acid biosynthetic process(GO:1903966) |
0.0 | 0.1 | GO:0030578 | PML body organization(GO:0030578) |
0.0 | 0.2 | GO:0061154 | endothelial tube morphogenesis(GO:0061154) |
0.0 | 0.1 | GO:0010986 | positive regulation of lipoprotein particle clearance(GO:0010986) |
0.0 | 0.1 | GO:0032474 | otolith morphogenesis(GO:0032474) |
0.0 | 0.1 | GO:0002121 | inter-male aggressive behavior(GO:0002121) |
0.0 | 0.0 | GO:0090154 | positive regulation of sphingolipid biosynthetic process(GO:0090154) positive regulation of ceramide biosynthetic process(GO:2000304) |
0.0 | 0.1 | GO:2000659 | regulation of interleukin-1-mediated signaling pathway(GO:2000659) |
0.0 | 0.0 | GO:0072235 | distal convoluted tubule development(GO:0072025) DCT cell differentiation(GO:0072069) metanephric distal convoluted tubule development(GO:0072221) metanephric distal tubule development(GO:0072235) metanephric DCT cell differentiation(GO:0072240) |
0.0 | 0.1 | GO:0010288 | response to lead ion(GO:0010288) |
0.0 | 0.1 | GO:2001013 | epithelial cell proliferation involved in renal tubule morphogenesis(GO:2001013) |
0.0 | 0.1 | GO:1902498 | regulation of protein autoubiquitination(GO:1902498) |
0.0 | 0.1 | GO:0043328 | late endosome to vacuole transport via multivesicular body sorting pathway(GO:0032511) protein targeting to vacuole involved in ubiquitin-dependent protein catabolic process via the multivesicular body sorting pathway(GO:0043328) |
0.0 | 0.1 | GO:0060510 | Type II pneumocyte differentiation(GO:0060510) |
0.0 | 0.1 | GO:0050747 | positive regulation of lipoprotein metabolic process(GO:0050747) |
0.0 | 0.1 | GO:2000609 | regulation of thyroid hormone generation(GO:2000609) |
0.0 | 0.1 | GO:0072602 | interleukin-4 secretion(GO:0072602) |
0.0 | 0.2 | GO:0046146 | tetrahydrobiopterin metabolic process(GO:0046146) |
0.0 | 0.1 | GO:0045726 | positive regulation of integrin biosynthetic process(GO:0045726) |
0.0 | 0.1 | GO:0006768 | biotin metabolic process(GO:0006768) |
0.0 | 0.2 | GO:0060340 | positive regulation of type I interferon-mediated signaling pathway(GO:0060340) |
0.0 | 0.2 | GO:0006104 | succinyl-CoA metabolic process(GO:0006104) |
0.0 | 0.2 | GO:0045631 | regulation of auditory receptor cell differentiation(GO:0045607) regulation of mechanoreceptor differentiation(GO:0045631) regulation of inner ear receptor cell differentiation(GO:2000980) |
0.0 | 0.0 | GO:0007354 | zygotic determination of anterior/posterior axis, embryo(GO:0007354) |
0.0 | 0.1 | GO:0019464 | glycine catabolic process(GO:0006546) glycine decarboxylation via glycine cleavage system(GO:0019464) |
0.0 | 0.0 | GO:0060279 | positive regulation of ovulation(GO:0060279) |
0.0 | 0.3 | GO:0043248 | proteasome assembly(GO:0043248) |
0.0 | 0.3 | GO:0045075 | interleukin-12 biosynthetic process(GO:0042090) regulation of interleukin-12 biosynthetic process(GO:0045075) |
0.0 | 0.1 | GO:0009256 | 10-formyltetrahydrofolate metabolic process(GO:0009256) |
0.0 | 0.1 | GO:0009730 | detection of carbohydrate stimulus(GO:0009730) detection of hexose stimulus(GO:0009732) detection of monosaccharide stimulus(GO:0034287) detection of glucose(GO:0051594) |
0.0 | 0.2 | GO:0036089 | cleavage furrow formation(GO:0036089) |
0.0 | 0.1 | GO:0006391 | transcription initiation from mitochondrial promoter(GO:0006391) |
0.0 | 0.0 | GO:0014738 | regulation of muscle hyperplasia(GO:0014738) muscle hyperplasia(GO:0014900) |
0.0 | 0.3 | GO:0035721 | intraciliary retrograde transport(GO:0035721) |
0.0 | 0.1 | GO:2000049 | positive regulation of cell-cell adhesion mediated by cadherin(GO:2000049) |
0.0 | 0.1 | GO:0031914 | negative regulation of synaptic plasticity(GO:0031914) |
0.0 | 0.2 | GO:0014883 | transition between fast and slow fiber(GO:0014883) |
0.0 | 0.2 | GO:0071397 | cellular response to cholesterol(GO:0071397) |
0.0 | 0.1 | GO:0070358 | actin polymerization-dependent cell motility(GO:0070358) |
0.0 | 0.3 | GO:0015858 | nucleoside transport(GO:0015858) |
0.0 | 0.0 | GO:0044805 | lysosomal microautophagy(GO:0016237) piecemeal microautophagy of nucleus(GO:0034727) late nucleophagy(GO:0044805) |
0.0 | 0.8 | GO:0033141 | positive regulation of peptidyl-serine phosphorylation of STAT protein(GO:0033141) |
0.0 | 0.1 | GO:0021775 | smoothened signaling pathway involved in ventral spinal cord interneuron specification(GO:0021775) smoothened signaling pathway involved in spinal cord motor neuron cell fate specification(GO:0021776) |
0.0 | 0.1 | GO:0060528 | secretory columnal luminar epithelial cell differentiation involved in prostate glandular acinus development(GO:0060528) |
0.0 | 0.1 | GO:0032439 | endosome localization(GO:0032439) |
0.0 | 0.0 | GO:0071233 | response to leucine(GO:0043201) cellular response to leucine(GO:0071233) |
0.0 | 0.0 | GO:0032971 | regulation of muscle filament sliding(GO:0032971) |
0.0 | 0.4 | GO:0048266 | behavioral response to pain(GO:0048266) |
0.0 | 0.1 | GO:0006654 | phosphatidic acid biosynthetic process(GO:0006654) |
0.0 | 0.1 | GO:0051987 | positive regulation of attachment of spindle microtubules to kinetochore(GO:0051987) |
0.0 | 0.0 | GO:0046533 | negative regulation of photoreceptor cell differentiation(GO:0046533) |
0.0 | 0.0 | GO:0035799 | ureter maturation(GO:0035799) |
0.0 | 0.1 | GO:0010606 | positive regulation of cytoplasmic mRNA processing body assembly(GO:0010606) |
0.0 | 0.1 | GO:0019230 | proprioception(GO:0019230) |
0.0 | 0.1 | GO:0015074 | DNA integration(GO:0015074) |
0.0 | 0.2 | GO:2000780 | negative regulation of double-strand break repair(GO:2000780) |
0.0 | 0.1 | GO:2000601 | positive regulation of Arp2/3 complex-mediated actin nucleation(GO:2000601) |
0.0 | 0.1 | GO:0050882 | voluntary musculoskeletal movement(GO:0050882) |
0.0 | 0.2 | GO:0000055 | ribosomal large subunit export from nucleus(GO:0000055) |
0.0 | 0.1 | GO:0006067 | ethanol metabolic process(GO:0006067) ethanol oxidation(GO:0006069) |
0.0 | 0.1 | GO:0010891 | negative regulation of sequestering of triglyceride(GO:0010891) |
0.0 | 0.2 | GO:0046069 | cGMP catabolic process(GO:0046069) |
0.0 | 0.0 | GO:2000645 | negative regulation of receptor catabolic process(GO:2000645) |
0.0 | 0.0 | GO:0006419 | alanyl-tRNA aminoacylation(GO:0006419) |
0.0 | 0.0 | GO:0030050 | vesicle transport along actin filament(GO:0030050) |
0.0 | 0.1 | GO:0009838 | abscission(GO:0009838) |
0.0 | 0.0 | GO:0071930 | negative regulation of transcription involved in G1/S transition of mitotic cell cycle(GO:0071930) |
0.0 | 0.1 | GO:0048133 | germ-line stem cell division(GO:0042078) male germ-line stem cell asymmetric division(GO:0048133) germline stem cell asymmetric division(GO:0098728) |
0.0 | 0.0 | GO:0071895 | odontoblast differentiation(GO:0071895) |
0.0 | 0.1 | GO:1903054 | negative regulation of extracellular matrix organization(GO:1903054) |
0.0 | 0.1 | GO:0043490 | malate-aspartate shuttle(GO:0043490) |
0.0 | 0.0 | GO:0000429 | carbon catabolite regulation of transcription from RNA polymerase II promoter(GO:0000429) carbon catabolite activation of transcription from RNA polymerase II promoter(GO:0000436) |
0.0 | 0.0 | GO:0015817 | histidine transport(GO:0015817) |
0.0 | 0.2 | GO:0046007 | negative regulation of activated T cell proliferation(GO:0046007) |
0.0 | 0.1 | GO:1904528 | regulation of microtubule binding(GO:1904526) positive regulation of microtubule binding(GO:1904528) |
0.0 | 0.3 | GO:0001522 | pseudouridine synthesis(GO:0001522) |
0.0 | 0.0 | GO:0048549 | positive regulation of pinocytosis(GO:0048549) |
0.0 | 0.3 | GO:0048025 | negative regulation of mRNA splicing, via spliceosome(GO:0048025) |
0.0 | 0.2 | GO:0090136 | epithelial cell-cell adhesion(GO:0090136) |
0.0 | 0.1 | GO:0072502 | cellular phosphate ion homeostasis(GO:0030643) cellular trivalent inorganic anion homeostasis(GO:0072502) |
0.0 | 0.1 | GO:2000297 | negative regulation of synapse maturation(GO:2000297) |
0.0 | 0.1 | GO:1990034 | calcium ion export from cell(GO:1990034) |
0.0 | 0.4 | GO:0006303 | double-strand break repair via nonhomologous end joining(GO:0006303) |
0.0 | 0.2 | GO:0000729 | DNA double-strand break processing(GO:0000729) |
0.0 | 0.1 | GO:0000022 | mitotic spindle elongation(GO:0000022) mitotic spindle midzone assembly(GO:0051256) |
0.0 | 0.0 | GO:0035622 | intrahepatic bile duct development(GO:0035622) |
0.0 | 0.0 | GO:0048850 | hypophysis morphogenesis(GO:0048850) |
0.0 | 0.1 | GO:1990086 | lens fiber cell apoptotic process(GO:1990086) |
0.0 | 0.1 | GO:0043144 | snoRNA processing(GO:0043144) |
0.0 | 0.1 | GO:0044821 | meiotic telomere tethering at nuclear periphery(GO:0044821) meiotic attachment of telomere to nuclear envelope(GO:0070197) chromosome attachment to the nuclear envelope(GO:0097240) |
0.0 | 0.1 | GO:0033689 | negative regulation of osteoblast proliferation(GO:0033689) |
0.0 | 0.1 | GO:0045908 | negative regulation of vasodilation(GO:0045908) |
0.0 | 0.1 | GO:0034454 | microtubule anchoring at centrosome(GO:0034454) |
0.0 | 0.1 | GO:0090309 | positive regulation of methylation-dependent chromatin silencing(GO:0090309) |
0.0 | 0.1 | GO:0006528 | asparagine metabolic process(GO:0006528) |
0.0 | 0.1 | GO:0090166 | Golgi disassembly(GO:0090166) |
0.0 | 0.1 | GO:0000050 | urea cycle(GO:0000050) |
0.0 | 0.0 | GO:0009756 | carbohydrate mediated signaling(GO:0009756) hexose mediated signaling(GO:0009757) sugar mediated signaling pathway(GO:0010182) glucose mediated signaling pathway(GO:0010255) |
0.0 | 0.1 | GO:0006059 | hexitol metabolic process(GO:0006059) |
0.0 | 0.1 | GO:0035360 | positive regulation of peroxisome proliferator activated receptor signaling pathway(GO:0035360) |
0.0 | 0.2 | GO:0042659 | regulation of cell fate specification(GO:0042659) |
0.0 | 0.1 | GO:0018026 | peptidyl-lysine monomethylation(GO:0018026) |
0.0 | 0.1 | GO:0034421 | post-translational protein acetylation(GO:0034421) |
0.0 | 0.2 | GO:0051131 | chaperone-mediated protein complex assembly(GO:0051131) |
0.0 | 0.0 | GO:0048550 | negative regulation of pinocytosis(GO:0048550) |
0.0 | 0.0 | GO:0046985 | positive regulation of hemoglobin biosynthetic process(GO:0046985) |
0.0 | 0.1 | GO:0015842 | aminergic neurotransmitter loading into synaptic vesicle(GO:0015842) neurotransmitter loading into synaptic vesicle(GO:0098700) |
0.0 | 0.0 | GO:0046878 | positive regulation of saliva secretion(GO:0046878) |
0.0 | 0.3 | GO:0000154 | rRNA modification(GO:0000154) |
0.0 | 0.0 | GO:1904694 | negative regulation of vascular smooth muscle contraction(GO:1904694) |
0.0 | 0.1 | GO:0033169 | histone H3-K9 demethylation(GO:0033169) |
0.0 | 0.3 | GO:0046854 | phosphatidylinositol phosphorylation(GO:0046854) |
0.0 | 0.0 | GO:0044860 | protein localization to plasma membrane raft(GO:0044860) |
0.0 | 0.1 | GO:0090370 | negative regulation of cholesterol efflux(GO:0090370) |
0.0 | 0.1 | GO:0044539 | long-chain fatty acid import(GO:0044539) |
0.0 | 0.1 | GO:0006398 | mRNA 3'-end processing by stem-loop binding and cleavage(GO:0006398) |
0.0 | 0.1 | GO:0006610 | ribosomal protein import into nucleus(GO:0006610) |
0.0 | 0.1 | GO:0000212 | meiotic spindle organization(GO:0000212) |
0.0 | 0.1 | GO:1902373 | negative regulation of mRNA catabolic process(GO:1902373) |
0.0 | 0.1 | GO:0021873 | forebrain neuroblast division(GO:0021873) |
0.0 | 0.1 | GO:0042637 | catagen(GO:0042637) |
0.0 | 0.1 | GO:0030953 | astral microtubule organization(GO:0030953) |
0.0 | 0.0 | GO:0002017 | regulation of blood volume by renal aldosterone(GO:0002017) |
0.0 | 0.0 | GO:0070544 | histone H3-K36 demethylation(GO:0070544) |
0.0 | 0.0 | GO:0010040 | response to iron(II) ion(GO:0010040) |
0.0 | 0.0 | GO:0032776 | DNA methylation on cytosine within a CG sequence(GO:0010424) DNA methylation on cytosine(GO:0032776) |
0.0 | 0.0 | GO:0006543 | glutamine catabolic process(GO:0006543) |
0.0 | 0.1 | GO:0051031 | tRNA transport(GO:0051031) |
0.0 | 0.0 | GO:0045917 | positive regulation of complement activation(GO:0045917) positive regulation of protein activation cascade(GO:2000259) |
0.0 | 0.1 | GO:0015822 | ornithine transport(GO:0015822) L-ornithine transmembrane transport(GO:1903352) |
0.0 | 0.3 | GO:0071353 | cellular response to interleukin-4(GO:0071353) |
0.0 | 0.1 | GO:0046085 | adenosine metabolic process(GO:0046085) |
0.0 | 0.0 | GO:0010603 | regulation of cytoplasmic mRNA processing body assembly(GO:0010603) |
0.0 | 0.1 | GO:0018401 | peptidyl-proline hydroxylation to 4-hydroxy-L-proline(GO:0018401) |
0.0 | 0.2 | GO:0060009 | Sertoli cell development(GO:0060009) |
0.0 | 0.1 | GO:0006450 | regulation of translational fidelity(GO:0006450) |
0.0 | 0.1 | GO:0008626 | granzyme-mediated apoptotic signaling pathway(GO:0008626) |
0.0 | 0.1 | GO:0042760 | very long-chain fatty acid catabolic process(GO:0042760) |
0.0 | 0.3 | GO:0006182 | cGMP biosynthetic process(GO:0006182) |
0.0 | 0.1 | GO:0007221 | positive regulation of transcription of Notch receptor target(GO:0007221) |
0.0 | 0.1 | GO:0006102 | isocitrate metabolic process(GO:0006102) |
0.0 | 0.1 | GO:0061087 | positive regulation of histone H3-K27 methylation(GO:0061087) |
0.0 | 0.0 | GO:0007529 | establishment of synaptic specificity at neuromuscular junction(GO:0007529) |
0.0 | 0.0 | GO:0019254 | carnitine metabolic process, CoA-linked(GO:0019254) |
0.0 | 0.0 | GO:1990168 | protein K29-linked deubiquitination(GO:0035523) protein K33-linked deubiquitination(GO:1990168) |
0.0 | 0.3 | GO:1901385 | regulation of voltage-gated calcium channel activity(GO:1901385) |
0.0 | 0.0 | GO:2000394 | positive regulation of lamellipodium morphogenesis(GO:2000394) |
0.0 | 0.1 | GO:0008343 | adult feeding behavior(GO:0008343) |
0.0 | 0.1 | GO:0043568 | positive regulation of insulin-like growth factor receptor signaling pathway(GO:0043568) |
0.0 | 0.0 | GO:0034729 | histone H3-K79 methylation(GO:0034729) |
0.0 | 0.1 | GO:0015808 | L-alanine transport(GO:0015808) |
0.0 | 0.0 | GO:0061428 | negative regulation of transcription from RNA polymerase II promoter in response to hypoxia(GO:0061428) |
0.0 | 0.0 | GO:0034628 | nicotinamide nucleotide biosynthetic process from aspartate(GO:0019355) 'de novo' NAD biosynthetic process from aspartate(GO:0034628) |
0.0 | 0.0 | GO:0036091 | positive regulation of transcription from RNA polymerase II promoter in response to oxidative stress(GO:0036091) |
0.0 | 0.0 | GO:0010888 | negative regulation of lipid storage(GO:0010888) |
0.0 | 0.3 | GO:0000460 | maturation of 5.8S rRNA(GO:0000460) |
0.0 | 0.1 | GO:0051798 | positive regulation of hair follicle development(GO:0051798) |
0.0 | 0.0 | GO:1903336 | negative regulation of vacuolar transport(GO:1903336) |
0.0 | 0.2 | GO:0009251 | glycogen catabolic process(GO:0005980) glucan catabolic process(GO:0009251) cellular polysaccharide catabolic process(GO:0044247) |
0.0 | 0.0 | GO:0044340 | canonical Wnt signaling pathway involved in regulation of cell proliferation(GO:0044340) |
0.0 | 0.1 | GO:0035331 | negative regulation of hippo signaling(GO:0035331) |
0.0 | 0.2 | GO:0003416 | endochondral bone growth(GO:0003416) |
0.0 | 0.0 | GO:2001197 | regulation of basement membrane assembly involved in embryonic body morphogenesis(GO:1904259) positive regulation of basement membrane assembly involved in embryonic body morphogenesis(GO:1904261) basement membrane assembly involved in embryonic body morphogenesis(GO:2001197) |
0.0 | 0.0 | GO:0021698 | cerebellar cortex structural organization(GO:0021698) |
0.0 | 0.1 | GO:0007549 | dosage compensation(GO:0007549) dosage compensation by inactivation of X chromosome(GO:0009048) |
0.0 | 0.1 | GO:0030644 | cellular chloride ion homeostasis(GO:0030644) |
0.0 | 0.0 | GO:0033034 | positive regulation of neutrophil apoptotic process(GO:0033031) positive regulation of myeloid cell apoptotic process(GO:0033034) |
0.0 | 0.0 | GO:0070669 | response to interleukin-2(GO:0070669) |
0.0 | 0.0 | GO:0090074 | negative regulation of protein homodimerization activity(GO:0090074) |
0.0 | 0.1 | GO:0051085 | chaperone mediated protein folding requiring cofactor(GO:0051085) |
0.0 | 0.1 | GO:0051683 | establishment of Golgi localization(GO:0051683) |
0.0 | 0.0 | GO:0006624 | vacuolar protein processing(GO:0006624) |
0.0 | 0.0 | GO:1902302 | regulation of potassium ion export(GO:1902302) |
0.0 | 0.1 | GO:0043415 | positive regulation of skeletal muscle tissue regeneration(GO:0043415) |
0.0 | 0.0 | GO:0006369 | termination of RNA polymerase II transcription(GO:0006369) |
0.0 | 0.0 | GO:0033088 | negative regulation of immature T cell proliferation in thymus(GO:0033088) |
0.0 | 0.0 | GO:0042723 | thiamine metabolic process(GO:0006772) thiamine-containing compound metabolic process(GO:0042723) |
0.0 | 0.0 | GO:0006930 | substrate-dependent cell migration, cell extension(GO:0006930) |
0.0 | 0.1 | GO:0072520 | seminiferous tubule development(GO:0072520) |
0.0 | 0.0 | GO:2000210 | positive regulation of anoikis(GO:2000210) |
0.0 | 0.0 | GO:1990705 | cholangiocyte proliferation(GO:1990705) |
0.0 | 0.0 | GO:0030951 | establishment or maintenance of microtubule cytoskeleton polarity(GO:0030951) |
0.0 | 0.0 | GO:0018125 | peptidyl-cysteine methylation(GO:0018125) |
0.0 | 0.2 | GO:0030488 | tRNA methylation(GO:0030488) |
0.0 | 0.0 | GO:0032513 | negative regulation of protein phosphatase type 2B activity(GO:0032513) |
0.0 | 0.1 | GO:1900121 | negative regulation of receptor binding(GO:1900121) |
0.0 | 0.1 | GO:0060484 | lung-associated mesenchyme development(GO:0060484) |
0.0 | 0.0 | GO:1990928 | response to amino acid starvation(GO:1990928) |
0.0 | 0.0 | GO:0090343 | positive regulation of cell aging(GO:0090343) positive regulation of cellular senescence(GO:2000774) |
0.0 | 0.0 | GO:0000707 | meiotic DNA recombinase assembly(GO:0000707) |
0.0 | 0.1 | GO:0010919 | regulation of inositol phosphate biosynthetic process(GO:0010919) |
0.0 | 0.1 | GO:0033146 | regulation of intracellular estrogen receptor signaling pathway(GO:0033146) |
0.0 | 0.3 | GO:0019373 | epoxygenase P450 pathway(GO:0019373) |
0.0 | 0.0 | GO:0032202 | telomere assembly(GO:0032202) |
0.0 | 0.0 | GO:1900147 | Schwann cell migration(GO:0036135) regulation of Schwann cell migration(GO:1900147) |
0.0 | 0.1 | GO:0046602 | regulation of mitotic centrosome separation(GO:0046602) |
0.0 | 0.1 | GO:0040015 | negative regulation of multicellular organism growth(GO:0040015) |
0.0 | 0.0 | GO:0060623 | regulation of chromosome condensation(GO:0060623) |
0.0 | 0.1 | GO:0035459 | cargo loading into vesicle(GO:0035459) |
0.0 | 0.0 | GO:0090135 | actin filament branching(GO:0090135) |
0.0 | 0.2 | GO:0051567 | histone H3-K9 methylation(GO:0051567) |
0.0 | 0.0 | GO:0086046 | membrane depolarization during SA node cell action potential(GO:0086046) |
0.0 | 0.0 | GO:0032876 | negative regulation of DNA endoreduplication(GO:0032876) |
0.0 | 0.1 | GO:0046218 | tryptophan catabolic process(GO:0006569) tryptophan catabolic process to kynurenine(GO:0019441) indole-containing compound catabolic process(GO:0042436) indolalkylamine catabolic process(GO:0046218) |
0.0 | 0.0 | GO:0030091 | protein repair(GO:0030091) |
0.0 | 0.0 | GO:0018027 | peptidyl-lysine dimethylation(GO:0018027) |
0.0 | 0.0 | GO:0097039 | protein linear polyubiquitination(GO:0097039) |
0.0 | 0.0 | GO:0042231 | interleukin-13 biosynthetic process(GO:0042231) |
0.0 | 0.0 | GO:0045356 | positive regulation of interferon-alpha biosynthetic process(GO:0045356) |
0.0 | 0.0 | GO:0034635 | glutathione transport(GO:0034635) tripeptide transport(GO:0042939) |
0.0 | 0.0 | GO:0010956 | negative regulation of calcidiol 1-monooxygenase activity(GO:0010956) |
0.0 | 0.0 | GO:0048625 | myoblast fate commitment(GO:0048625) |
0.0 | 0.0 | GO:0048069 | eye pigmentation(GO:0048069) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.2 | 1.1 | GO:0045098 | type III intermediate filament(GO:0045098) |
0.2 | 1.0 | GO:0089701 | U2AF(GO:0089701) |
0.2 | 0.5 | GO:0097025 | MPP7-DLG1-LIN7 complex(GO:0097025) |
0.1 | 0.6 | GO:0031298 | replication fork protection complex(GO:0031298) |
0.1 | 0.5 | GO:0042567 | insulin-like growth factor binding protein complex(GO:0016942) growth factor complex(GO:0036454) insulin-like growth factor ternary complex(GO:0042567) |
0.1 | 0.6 | GO:1990712 | HFE-transferrin receptor complex(GO:1990712) |
0.1 | 0.5 | GO:0005579 | membrane attack complex(GO:0005579) |
0.1 | 0.3 | GO:0097487 | multivesicular body, internal vesicle(GO:0097487) |
0.1 | 0.3 | GO:0097418 | neurofibrillary tangle(GO:0097418) |
0.1 | 0.3 | GO:0031088 | platelet dense granule membrane(GO:0031088) |
0.1 | 0.2 | GO:0097427 | microtubule bundle(GO:0097427) |
0.1 | 0.2 | GO:0010009 | cytoplasmic side of endosome membrane(GO:0010009) |
0.1 | 0.3 | GO:0043159 | acrosomal matrix(GO:0043159) |
0.1 | 1.4 | GO:0005942 | phosphatidylinositol 3-kinase complex(GO:0005942) |
0.1 | 0.6 | GO:0032593 | insulin-responsive compartment(GO:0032593) |
0.1 | 0.3 | GO:0031262 | Ndc80 complex(GO:0031262) |
0.1 | 0.3 | GO:0031265 | CD95 death-inducing signaling complex(GO:0031265) |
0.1 | 0.2 | GO:0036449 | microtubule minus-end(GO:0036449) |
0.1 | 0.3 | GO:0031428 | box C/D snoRNP complex(GO:0031428) |
0.1 | 0.4 | GO:0070419 | nonhomologous end joining complex(GO:0070419) |
0.1 | 0.2 | GO:0070110 | ciliary neurotrophic factor receptor complex(GO:0070110) |
0.1 | 0.2 | GO:0032299 | ribonuclease H2 complex(GO:0032299) |
0.1 | 0.2 | GO:0032021 | NELF complex(GO:0032021) |
0.0 | 0.2 | GO:0070032 | synaptobrevin 2-SNAP-25-syntaxin-1a-complexin I complex(GO:0070032) |
0.0 | 0.4 | GO:0008074 | guanylate cyclase complex, soluble(GO:0008074) |
0.0 | 0.1 | GO:0097441 | basilar dendrite(GO:0097441) |
0.0 | 0.3 | GO:0031464 | Cul4A-RING E3 ubiquitin ligase complex(GO:0031464) |
0.0 | 0.4 | GO:0031211 | serine C-palmitoyltransferase complex(GO:0017059) endoplasmic reticulum palmitoyltransferase complex(GO:0031211) |
0.0 | 0.6 | GO:0030123 | AP-3 adaptor complex(GO:0030123) |
0.0 | 0.6 | GO:0071004 | U2-type prespliceosome(GO:0071004) |
0.0 | 1.4 | GO:0008180 | COP9 signalosome(GO:0008180) |
0.0 | 0.3 | GO:0000439 | core TFIIH complex(GO:0000439) |
0.0 | 0.2 | GO:0042583 | chromaffin granule(GO:0042583) |
0.0 | 0.3 | GO:0070578 | RISC-loading complex(GO:0070578) |
0.0 | 0.3 | GO:0030062 | mitochondrial tricarboxylic acid cycle enzyme complex(GO:0030062) |
0.0 | 0.2 | GO:0045239 | tricarboxylic acid cycle enzyme complex(GO:0045239) |
0.0 | 0.2 | GO:0097433 | dense body(GO:0097433) |
0.0 | 0.2 | GO:0042406 | extrinsic component of endoplasmic reticulum membrane(GO:0042406) |
0.0 | 0.2 | GO:0000445 | THO complex(GO:0000347) THO complex part of transcription export complex(GO:0000445) |
0.0 | 0.1 | GO:0000814 | ESCRT II complex(GO:0000814) |
0.0 | 0.2 | GO:0033269 | internode region of axon(GO:0033269) |
0.0 | 0.2 | GO:0000235 | astral microtubule(GO:0000235) |
0.0 | 0.1 | GO:0071664 | catenin-TCF7L2 complex(GO:0071664) |
0.0 | 0.3 | GO:0032584 | growth cone membrane(GO:0032584) |
0.0 | 0.2 | GO:0045180 | basal cortex(GO:0045180) |
0.0 | 0.2 | GO:0031315 | extrinsic component of mitochondrial outer membrane(GO:0031315) |
0.0 | 0.4 | GO:0017146 | NMDA selective glutamate receptor complex(GO:0017146) |
0.0 | 0.1 | GO:0000214 | tRNA-intron endonuclease complex(GO:0000214) |
0.0 | 0.5 | GO:0000930 | gamma-tubulin complex(GO:0000930) |
0.0 | 0.1 | GO:0016222 | procollagen-proline 4-dioxygenase complex(GO:0016222) |
0.0 | 0.1 | GO:0000408 | EKC/KEOPS complex(GO:0000408) |
0.0 | 0.2 | GO:0070775 | H3 histone acetyltransferase complex(GO:0070775) MOZ/MORF histone acetyltransferase complex(GO:0070776) |
0.0 | 0.2 | GO:1904115 | axon cytoplasm(GO:1904115) |
0.0 | 0.5 | GO:0005721 | pericentric heterochromatin(GO:0005721) |
0.0 | 0.3 | GO:0051286 | cell tip(GO:0051286) |
0.0 | 0.1 | GO:0005606 | laminin-1 complex(GO:0005606) |
0.0 | 0.1 | GO:0045293 | mRNA editing complex(GO:0045293) |
0.0 | 0.2 | GO:0042587 | glycogen granule(GO:0042587) |
0.0 | 0.1 | GO:0030897 | HOPS complex(GO:0030897) |
0.0 | 0.1 | GO:0016533 | cyclin-dependent protein kinase 5 holoenzyme complex(GO:0016533) |
0.0 | 0.1 | GO:0046696 | lipopolysaccharide receptor complex(GO:0046696) |
0.0 | 0.3 | GO:0005583 | fibrillar collagen trimer(GO:0005583) banded collagen fibril(GO:0098643) |
0.0 | 0.3 | GO:0031362 | anchored component of external side of plasma membrane(GO:0031362) |
0.0 | 0.4 | GO:0032839 | dendrite cytoplasm(GO:0032839) |
0.0 | 0.1 | GO:0005827 | polar microtubule(GO:0005827) |
0.0 | 0.1 | GO:0044233 | ER-mitochondrion membrane contact site(GO:0044233) |
0.0 | 0.1 | GO:0055087 | Ski complex(GO:0055087) |
0.0 | 0.5 | GO:0005865 | striated muscle thin filament(GO:0005865) |
0.0 | 0.2 | GO:0034098 | VCP-NPL4-UFD1 AAA ATPase complex(GO:0034098) |
0.0 | 0.1 | GO:0031074 | nucleocytoplasmic shuttling complex(GO:0031074) |
0.0 | 0.4 | GO:0005922 | connexon complex(GO:0005922) |
0.0 | 0.1 | GO:0002142 | stereocilia ankle link complex(GO:0002142) |
0.0 | 0.3 | GO:0031527 | filopodium membrane(GO:0031527) |
0.0 | 0.1 | GO:0005955 | calcineurin complex(GO:0005955) |
0.0 | 0.5 | GO:0030687 | preribosome, large subunit precursor(GO:0030687) |
0.0 | 0.1 | GO:0031417 | NatC complex(GO:0031417) |
0.0 | 0.4 | GO:0043034 | costamere(GO:0043034) |
0.0 | 0.2 | GO:0071541 | eukaryotic translation initiation factor 3 complex, eIF3m(GO:0071541) |
0.0 | 0.2 | GO:0030132 | clathrin coat of coated pit(GO:0030132) |
0.0 | 0.1 | GO:0005712 | chiasma(GO:0005712) |
0.0 | 0.1 | GO:0031414 | N-terminal protein acetyltransferase complex(GO:0031414) |
0.0 | 0.1 | GO:0035363 | histone locus body(GO:0035363) |
0.0 | 0.1 | GO:0048476 | Holliday junction resolvase complex(GO:0048476) |
0.0 | 0.1 | GO:0031209 | SCAR complex(GO:0031209) |
0.0 | 0.1 | GO:0032541 | cortical endoplasmic reticulum(GO:0032541) |
0.0 | 0.2 | GO:0042612 | MHC class I protein complex(GO:0042612) |
0.0 | 0.1 | GO:0030015 | CCR4-NOT core complex(GO:0030015) |
0.0 | 0.2 | GO:0042101 | T cell receptor complex(GO:0042101) |
0.0 | 0.6 | GO:0045171 | intercellular bridge(GO:0045171) |
0.0 | 0.0 | GO:0005945 | 6-phosphofructokinase complex(GO:0005945) |
0.0 | 0.1 | GO:1990124 | messenger ribonucleoprotein complex(GO:1990124) |
0.0 | 0.2 | GO:0070852 | cell body fiber(GO:0070852) |
0.0 | 0.0 | GO:0034457 | Mpp10 complex(GO:0034457) |
0.0 | 0.6 | GO:0009295 | nucleoid(GO:0009295) mitochondrial nucleoid(GO:0042645) |
0.0 | 0.0 | GO:1990597 | AIP1-IRE1 complex(GO:1990597) |
0.0 | 0.0 | GO:0030430 | host cell cytoplasm(GO:0030430) host cell cytoplasm part(GO:0033655) |
0.0 | 0.0 | GO:0033263 | CORVET complex(GO:0033263) |
0.0 | 0.6 | GO:0030173 | integral component of Golgi membrane(GO:0030173) |
0.0 | 0.0 | GO:0005850 | eukaryotic translation initiation factor 2 complex(GO:0005850) |
0.0 | 0.1 | GO:0035749 | myelin sheath adaxonal region(GO:0035749) |
0.0 | 0.2 | GO:0000159 | protein phosphatase type 2A complex(GO:0000159) |
0.0 | 0.1 | GO:0000778 | condensed nuclear chromosome kinetochore(GO:0000778) |
0.0 | 0.0 | GO:0071797 | LUBAC complex(GO:0071797) |
0.0 | 0.7 | GO:0016529 | sarcoplasmic reticulum(GO:0016529) |
0.0 | 0.1 | GO:0031143 | pseudopodium(GO:0031143) |
0.0 | 0.0 | GO:0033063 | Rad51B-Rad51C-Rad51D-XRCC2 complex(GO:0033063) |
0.0 | 0.0 | GO:0032437 | cuticular plate(GO:0032437) |
0.0 | 0.0 | GO:0031094 | platelet dense tubular network(GO:0031094) |
0.0 | 0.6 | GO:0019005 | SCF ubiquitin ligase complex(GO:0019005) |
0.0 | 0.1 | GO:0032580 | Golgi cisterna membrane(GO:0032580) |
0.0 | 0.1 | GO:0044300 | cerebellar mossy fiber(GO:0044300) |
0.0 | 0.1 | GO:0090571 | RNA polymerase II transcription repressor complex(GO:0090571) |
0.0 | 0.1 | GO:0065010 | extracellular membrane-bounded organelle(GO:0065010) |
0.0 | 0.1 | GO:0042629 | mast cell granule(GO:0042629) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.3 | 0.9 | GO:0043125 | ErbB-3 class receptor binding(GO:0043125) |
0.3 | 0.8 | GO:0004366 | glycerol-3-phosphate O-acyltransferase activity(GO:0004366) |
0.2 | 1.0 | GO:0030628 | pre-mRNA 3'-splice site binding(GO:0030628) |
0.2 | 0.7 | GO:0016743 | carboxyl- or carbamoyltransferase activity(GO:0016743) |
0.2 | 0.7 | GO:0003917 | DNA topoisomerase type I activity(GO:0003917) |
0.2 | 1.1 | GO:0005167 | neurotrophin TRK receptor binding(GO:0005167) |
0.2 | 0.3 | GO:0005006 | epidermal growth factor-activated receptor activity(GO:0005006) |
0.2 | 0.5 | GO:0043423 | 3-phosphoinositide-dependent protein kinase binding(GO:0043423) |
0.1 | 0.4 | GO:0004980 | melanocyte-stimulating hormone receptor activity(GO:0004980) |
0.1 | 0.4 | GO:0043546 | molybdopterin cofactor binding(GO:0043546) |
0.1 | 0.4 | GO:0038181 | bile acid receptor activity(GO:0038181) |
0.1 | 0.3 | GO:0097016 | L27 domain binding(GO:0097016) |
0.1 | 0.3 | GO:0035877 | death effector domain binding(GO:0035877) |
0.1 | 0.4 | GO:0035615 | clathrin adaptor activity(GO:0035615) endocytic adaptor activity(GO:0098748) |
0.1 | 0.3 | GO:0016647 | oxidoreductase activity, acting on the CH-NH group of donors, oxygen as acceptor(GO:0016647) |
0.1 | 0.3 | GO:0016726 | xanthine dehydrogenase activity(GO:0004854) oxidoreductase activity, acting on CH or CH2 groups, NAD or NADP as acceptor(GO:0016726) |
0.1 | 0.3 | GO:0004897 | ciliary neurotrophic factor receptor activity(GO:0004897) |
0.1 | 0.3 | GO:0004949 | cannabinoid receptor activity(GO:0004949) |
0.1 | 0.2 | GO:0018479 | benzaldehyde dehydrogenase (NAD+) activity(GO:0018479) |
0.1 | 0.2 | GO:0043295 | glutathione binding(GO:0043295) oligopeptide binding(GO:1900750) |
0.1 | 0.6 | GO:0051011 | microtubule minus-end binding(GO:0051011) |
0.1 | 0.1 | GO:0050253 | retinyl-palmitate esterase activity(GO:0050253) |
0.1 | 0.7 | GO:0016920 | pyroglutamyl-peptidase activity(GO:0016920) |
0.1 | 0.2 | GO:0004416 | hydroxyacylglutathione hydrolase activity(GO:0004416) |
0.1 | 0.6 | GO:0004571 | mannosyl-oligosaccharide 1,2-alpha-mannosidase activity(GO:0004571) |
0.1 | 0.3 | GO:0033142 | progesterone receptor binding(GO:0033142) |
0.1 | 0.5 | GO:0035005 | 1-phosphatidylinositol-4-phosphate 3-kinase activity(GO:0035005) |
0.1 | 0.2 | GO:0008310 | single-stranded DNA 3'-5' exodeoxyribonuclease activity(GO:0008310) |
0.1 | 0.7 | GO:0008545 | JUN kinase kinase activity(GO:0008545) |
0.1 | 0.2 | GO:0008515 | sucrose:proton symporter activity(GO:0008506) sucrose transmembrane transporter activity(GO:0008515) disaccharide transmembrane transporter activity(GO:0015154) oligosaccharide transmembrane transporter activity(GO:0015157) |
0.1 | 0.4 | GO:0008508 | bile acid:sodium symporter activity(GO:0008508) |
0.1 | 0.3 | GO:1990226 | histone methyltransferase binding(GO:1990226) |
0.1 | 0.2 | GO:0070137 | ubiquitin-like protein-specific endopeptidase activity(GO:0070137) SUMO-specific endopeptidase activity(GO:0070139) |
0.1 | 0.3 | GO:0071614 | linoleic acid epoxygenase activity(GO:0071614) |
0.1 | 0.3 | GO:0016018 | cyclosporin A binding(GO:0016018) |
0.1 | 0.2 | GO:0008532 | N-acetyllactosaminide beta-1,3-N-acetylglucosaminyltransferase activity(GO:0008532) |
0.1 | 0.2 | GO:2001070 | starch binding(GO:2001070) |
0.1 | 0.2 | GO:0070538 | oleic acid binding(GO:0070538) |
0.1 | 0.2 | GO:0004771 | sterol esterase activity(GO:0004771) |
0.1 | 0.3 | GO:0005049 | nuclear export signal receptor activity(GO:0005049) |
0.1 | 0.3 | GO:0008199 | ferric iron binding(GO:0008199) |
0.1 | 0.3 | GO:0015165 | pyrimidine nucleotide-sugar transmembrane transporter activity(GO:0015165) |
0.1 | 0.2 | GO:0004832 | valine-tRNA ligase activity(GO:0004832) |
0.1 | 0.2 | GO:0015119 | hexose phosphate transmembrane transporter activity(GO:0015119) organophosphate:inorganic phosphate antiporter activity(GO:0015315) hexose-phosphate:inorganic phosphate antiporter activity(GO:0015526) glucose 6-phosphate:inorganic phosphate antiporter activity(GO:0061513) |
0.1 | 0.3 | GO:0004652 | polynucleotide adenylyltransferase activity(GO:0004652) |
0.1 | 0.2 | GO:0003726 | double-stranded RNA adenosine deaminase activity(GO:0003726) |
0.1 | 0.2 | GO:0015173 | aromatic amino acid transmembrane transporter activity(GO:0015173) |
0.1 | 0.3 | GO:0017034 | Rap guanyl-nucleotide exchange factor activity(GO:0017034) |
0.1 | 0.5 | GO:0005159 | insulin-like growth factor receptor binding(GO:0005159) |
0.0 | 0.1 | GO:0016941 | natriuretic peptide receptor activity(GO:0016941) |
0.0 | 0.2 | GO:0097493 | structural molecule activity conferring elasticity(GO:0097493) |
0.0 | 0.1 | GO:0004938 | alpha2-adrenergic receptor activity(GO:0004938) |
0.0 | 0.7 | GO:0016290 | palmitoyl-CoA hydrolase activity(GO:0016290) |
0.0 | 0.3 | GO:0004439 | phosphatidylinositol-4,5-bisphosphate 5-phosphatase activity(GO:0004439) |
0.0 | 0.2 | GO:0004758 | serine C-palmitoyltransferase activity(GO:0004758) |
0.0 | 0.1 | GO:1990825 | sequence-specific mRNA binding(GO:1990825) |
0.0 | 0.4 | GO:0044466 | 2-oxoglutaryl-CoA thioesterase activity(GO:0034843) 2,4,4-trimethyl-3-oxopentanoyl-CoA thioesterase activity(GO:0034869) 3-isopropylbut-3-enoyl-CoA thioesterase activity(GO:0034946) glutaryl-CoA hydrolase activity(GO:0044466) |
0.0 | 0.1 | GO:0015205 | purine nucleobase transmembrane transporter activity(GO:0005345) pyrimidine nucleobase transmembrane transporter activity(GO:0005350) nucleobase transmembrane transporter activity(GO:0015205) |
0.0 | 0.1 | GO:0070644 | vitamin D response element binding(GO:0070644) |
0.0 | 0.3 | GO:0005113 | patched binding(GO:0005113) |
0.0 | 0.3 | GO:0071933 | Arp2/3 complex binding(GO:0071933) |
0.0 | 0.2 | GO:0046974 | histone methyltransferase activity (H3-K9 specific)(GO:0046974) |
0.0 | 0.3 | GO:0004383 | guanylate cyclase activity(GO:0004383) |
0.0 | 0.1 | GO:0004477 | methenyltetrahydrofolate cyclohydrolase activity(GO:0004477) methylenetetrahydrofolate dehydrogenase (NAD+) activity(GO:0004487) |
0.0 | 0.2 | GO:0004075 | biotin carboxylase activity(GO:0004075) |
0.0 | 0.4 | GO:0016725 | oxidoreductase activity, acting on CH or CH2 groups(GO:0016725) |
0.0 | 0.2 | GO:0004523 | RNA-DNA hybrid ribonuclease activity(GO:0004523) |
0.0 | 0.5 | GO:0047555 | 3',5'-cyclic-GMP phosphodiesterase activity(GO:0047555) |
0.0 | 0.1 | GO:0034617 | tetrahydrobiopterin binding(GO:0034617) |
0.0 | 0.3 | GO:0016668 | oxidoreductase activity, acting on a sulfur group of donors, NAD(P) as acceptor(GO:0016668) |
0.0 | 0.6 | GO:0004119 | calmodulin-dependent cyclic-nucleotide phosphodiesterase activity(GO:0004117) cGMP-stimulated cyclic-nucleotide phosphodiesterase activity(GO:0004118) cGMP-inhibited cyclic-nucleotide phosphodiesterase activity(GO:0004119) photoreceptor cyclic-nucleotide phosphodiesterase activity(GO:0004120) 7,8-dihydro-D-neopterin 2',3'-cyclic phosphate phosphodiesterase activity(GO:0044688) inositol phosphosphingolipid phospholipase activity(GO:0052712) inositol phosphorylceramide phospholipase activity(GO:0052713) mannosyl-inositol phosphorylceramide phospholipase activity(GO:0052714) mannosyl-diinositol phosphorylceramide phospholipase activity(GO:0052715) |
0.0 | 0.2 | GO:0004908 | interleukin-1 receptor activity(GO:0004908) |
0.0 | 0.2 | GO:0005078 | MAP-kinase scaffold activity(GO:0005078) |
0.0 | 0.2 | GO:0045505 | dynein intermediate chain binding(GO:0045505) |
0.0 | 0.2 | GO:0004768 | stearoyl-CoA 9-desaturase activity(GO:0004768) |
0.0 | 0.1 | GO:0004035 | alkaline phosphatase activity(GO:0004035) |
0.0 | 0.3 | GO:0005337 | nucleoside transmembrane transporter activity(GO:0005337) |
0.0 | 0.1 | GO:0004505 | phenylalanine 4-monooxygenase activity(GO:0004505) |
0.0 | 0.4 | GO:1990841 | promoter-specific chromatin binding(GO:1990841) |
0.0 | 0.2 | GO:0010521 | telomerase inhibitor activity(GO:0010521) |
0.0 | 0.2 | GO:0051021 | GDP-dissociation inhibitor binding(GO:0051021) |
0.0 | 0.2 | GO:0016936 | galactoside binding(GO:0016936) |
0.0 | 0.1 | GO:0070905 | serine binding(GO:0070905) |
0.0 | 0.1 | GO:0005001 | transmembrane receptor protein tyrosine phosphatase activity(GO:0005001) |
0.0 | 0.1 | GO:0008823 | cupric reductase activity(GO:0008823) ferric-chelate reductase (NADPH) activity(GO:0052851) |
0.0 | 0.1 | GO:0003986 | acetyl-CoA hydrolase activity(GO:0003986) |
0.0 | 0.1 | GO:0051525 | NFAT protein binding(GO:0051525) |
0.0 | 0.1 | GO:0050510 | N-acetylgalactosaminyl-proteoglycan 3-beta-glucuronosyltransferase activity(GO:0050510) |
0.0 | 0.1 | GO:0043559 | insulin binding(GO:0043559) |
0.0 | 0.5 | GO:0070008 | serine-type exopeptidase activity(GO:0070008) |
0.0 | 0.1 | GO:0000213 | tRNA-intron endonuclease activity(GO:0000213) |
0.0 | 0.3 | GO:0015643 | toxic substance binding(GO:0015643) |
0.0 | 0.4 | GO:0005243 | gap junction channel activity(GO:0005243) |
0.0 | 0.8 | GO:0005132 | type I interferon receptor binding(GO:0005132) |
0.0 | 0.3 | GO:0004774 | succinate-CoA ligase activity(GO:0004774) |
0.0 | 0.1 | GO:0004022 | alcohol dehydrogenase (NAD) activity(GO:0004022) |
0.0 | 0.1 | GO:0004694 | eukaryotic translation initiation factor 2alpha kinase activity(GO:0004694) |
0.0 | 0.9 | GO:0016709 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, NAD(P)H as one donor, and incorporation of one atom of oxygen(GO:0016709) |
0.0 | 0.1 | GO:0003958 | NADPH-hemoprotein reductase activity(GO:0003958) |
0.0 | 0.1 | GO:0035671 | enone reductase activity(GO:0035671) |
0.0 | 0.1 | GO:0098821 | BMP receptor activity(GO:0098821) |
0.0 | 0.1 | GO:0016812 | hydrolase activity, acting on carbon-nitrogen (but not peptide) bonds, in cyclic amides(GO:0016812) |
0.0 | 0.1 | GO:0030943 | mitochondrion targeting sequence binding(GO:0030943) |
0.0 | 0.1 | GO:0016713 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, reduced iron-sulfur protein as one donor, and incorporation of one atom of oxygen(GO:0016713) |
0.0 | 0.1 | GO:0005047 | signal recognition particle binding(GO:0005047) |
0.0 | 0.1 | GO:0034889 | alkyl sulfatase activity(GO:0018741) endosulfan hemisulfate sulfatase activity(GO:0034889) endosulfan sulfate hydrolase activity(GO:0034902) |
0.0 | 0.1 | GO:0052623 | 4-hydroxybenzoate octaprenyltransferase activity(GO:0008412) protoheme IX farnesyltransferase activity(GO:0008495) (S)-2,3-di-O-geranylgeranylglyceryl phosphate synthase activity(GO:0043888) cadaverine aminopropyltransferase activity(GO:0043918) agmatine aminopropyltransferase activity(GO:0043919) 1,4-dihydroxy-2-naphthoate octaprenyltransferase activity(GO:0046428) trans-pentaprenyltranstransferase activity(GO:0048045) ATP dimethylallyltransferase activity(GO:0052622) ADP dimethylallyltransferase activity(GO:0052623) |
0.0 | 0.1 | GO:0004656 | procollagen-proline 4-dioxygenase activity(GO:0004656) |
0.0 | 0.1 | GO:0032190 | acrosin binding(GO:0032190) |
0.0 | 0.1 | GO:0004528 | phosphodiesterase I activity(GO:0004528) |
0.0 | 0.7 | GO:0001221 | transcription cofactor binding(GO:0001221) |
0.0 | 0.1 | GO:0017151 | DEAD/H-box RNA helicase binding(GO:0017151) |
0.0 | 0.3 | GO:0017160 | Ral GTPase binding(GO:0017160) |
0.0 | 0.1 | GO:0004062 | aryl sulfotransferase activity(GO:0004062) |
0.0 | 0.1 | GO:0090599 | alpha-glucosidase activity(GO:0090599) |
0.0 | 0.3 | GO:0070402 | NADPH binding(GO:0070402) |
0.0 | 0.4 | GO:0031492 | nucleosomal DNA binding(GO:0031492) |
0.0 | 1.1 | GO:0016763 | transferase activity, transferring pentosyl groups(GO:0016763) |
0.0 | 0.1 | GO:0004994 | somatostatin receptor activity(GO:0004994) |
0.0 | 0.2 | GO:0050291 | sphingosine N-acyltransferase activity(GO:0050291) |
0.0 | 0.1 | GO:0036435 | K48-linked polyubiquitin binding(GO:0036435) |
0.0 | 1.0 | GO:0015924 | mannosyl-oligosaccharide mannosidase activity(GO:0015924) |
0.0 | 0.1 | GO:0017040 | ceramidase activity(GO:0017040) |
0.0 | 0.1 | GO:0004663 | Rab geranylgeranyltransferase activity(GO:0004663) |
0.0 | 0.2 | GO:0008429 | phosphatidylethanolamine binding(GO:0008429) |
0.0 | 0.1 | GO:0000832 | inositol hexakisphosphate kinase activity(GO:0000828) inositol hexakisphosphate 5-kinase activity(GO:0000832) inositol hexakisphosphate 1-kinase activity(GO:0052723) inositol hexakisphosphate 3-kinase activity(GO:0052724) |
0.0 | 0.4 | GO:0005070 | SH3/SH2 adaptor activity(GO:0005070) |
0.0 | 0.1 | GO:0051032 | nucleic acid transmembrane transporter activity(GO:0051032) RNA transmembrane transporter activity(GO:0051033) |
0.0 | 0.1 | GO:0005220 | inositol 1,4,5-trisphosphate-sensitive calcium-release channel activity(GO:0005220) |
0.0 | 0.3 | GO:0009982 | pseudouridine synthase activity(GO:0009982) |
0.0 | 0.0 | GO:0051718 | DNA (cytosine-5-)-methyltransferase activity(GO:0003886) DNA (cytosine-5-)-methyltransferase activity, acting on CpG substrates(GO:0051718) |
0.0 | 0.0 | GO:0015252 | hydrogen ion channel activity(GO:0015252) |
0.0 | 0.1 | GO:0034582 | pinocarveol dehydrogenase activity(GO:0018446) chloral hydrate dehydrogenase activity(GO:0018447) hydroxymethylmethylsilanediol oxidase activity(GO:0018448) 1-phenylethanol dehydrogenase activity(GO:0018449) myrtenol dehydrogenase activity(GO:0018450) cis-1,2-dihydroxy-1,2-dihydro-8-carboxynaphthalene dehydrogenase activity(GO:0034522) 3-hydroxy-4-methyloctanoyl-CoA dehydrogenase activity(GO:0034582) 2-hydroxy-4-isopropenylcyclohexane-1-carboxyl-CoA dehydrogenase activity(GO:0034778) cis-9,10-dihydroanthracene-9,10-diol dehydrogenase activity(GO:0034817) citronellol dehydrogenase activity(GO:0034821) naphthyl-2-hydroxymethyl-succinyl-CoA dehydrogenase activity(GO:0034847) 2,4,4-trimethyl-1-pentanol dehydrogenase activity(GO:0034863) 2,4,4-trimethyl-3-hydroxypentanoyl-CoA dehydrogenase activity(GO:0034868) 1-hydroxy-4,4-dimethylpentan-3-one dehydrogenase activity(GO:0034871) endosulfan diol dehydrogenase activity(GO:0034891) endosulfan hydroxyether dehydrogenase activity(GO:0034901) 3-hydroxy-2-methylhexanoyl-CoA dehydrogenase activity(GO:0034918) 3-hydroxy-2,6-dimethyl-5-methylene-heptanoyl-CoA dehydrogenase activity(GO:0034944) versicolorin reductase activity(GO:0042469) ketoreductase activity(GO:0045703) |
0.0 | 0.5 | GO:0001103 | RNA polymerase II repressing transcription factor binding(GO:0001103) |
0.0 | 0.0 | GO:0004337 | geranyltranstransferase activity(GO:0004337) |
0.0 | 0.3 | GO:0008353 | RNA polymerase II carboxy-terminal domain kinase activity(GO:0008353) |
0.0 | 0.1 | GO:0003829 | beta-1,3-galactosyl-O-glycosyl-glycoprotein beta-1,6-N-acetylglucosaminyltransferase activity(GO:0003829) |
0.0 | 0.1 | GO:0005166 | neurotrophin p75 receptor binding(GO:0005166) |
0.0 | 0.1 | GO:1990715 | mRNA CDS binding(GO:1990715) |
0.0 | 0.1 | GO:0015183 | L-aspartate transmembrane transporter activity(GO:0015183) |
0.0 | 0.2 | GO:0004596 | peptide alpha-N-acetyltransferase activity(GO:0004596) |
0.0 | 0.2 | GO:0008430 | selenium binding(GO:0008430) |
0.0 | 0.7 | GO:0030374 | ligand-dependent nuclear receptor transcription coactivator activity(GO:0030374) |
0.0 | 0.1 | GO:0030172 | troponin C binding(GO:0030172) |
0.0 | 0.3 | GO:0005452 | inorganic anion exchanger activity(GO:0005452) |
0.0 | 0.1 | GO:0055056 | D-glucose transmembrane transporter activity(GO:0055056) |
0.0 | 0.4 | GO:0017075 | syntaxin-1 binding(GO:0017075) |
0.0 | 0.1 | GO:0004974 | leukotriene receptor activity(GO:0004974) |
0.0 | 0.0 | GO:0008449 | N-acetylglucosamine-6-sulfatase activity(GO:0008449) |
0.0 | 0.1 | GO:0008332 | low voltage-gated calcium channel activity(GO:0008332) |
0.0 | 0.0 | GO:0032564 | dATP binding(GO:0032564) |
0.0 | 0.2 | GO:0008242 | omega peptidase activity(GO:0008242) |
0.0 | 0.2 | GO:0046977 | TAP binding(GO:0046977) |
0.0 | 0.2 | GO:0051787 | misfolded protein binding(GO:0051787) |
0.0 | 0.1 | GO:0004833 | tryptophan 2,3-dioxygenase activity(GO:0004833) |
0.0 | 0.1 | GO:0030984 | kininogen binding(GO:0030984) |
0.0 | 0.2 | GO:0048185 | activin binding(GO:0048185) |
0.0 | 0.0 | GO:0004800 | thyroxine 5'-deiodinase activity(GO:0004800) |
0.0 | 0.1 | GO:0097109 | neuroligin family protein binding(GO:0097109) |
0.0 | 0.2 | GO:0004983 | neuropeptide Y receptor activity(GO:0004983) |
0.0 | 0.1 | GO:0003847 | 1-alkyl-2-acetylglycerophosphocholine esterase activity(GO:0003847) |
0.0 | 0.2 | GO:0015174 | basic amino acid transmembrane transporter activity(GO:0015174) |
0.0 | 0.5 | GO:0004364 | glutathione transferase activity(GO:0004364) |
0.0 | 0.1 | GO:0004045 | aminoacyl-tRNA hydrolase activity(GO:0004045) |
0.0 | 0.0 | GO:0003910 | DNA ligase activity(GO:0003909) DNA ligase (ATP) activity(GO:0003910) |
0.0 | 0.0 | GO:1902282 | voltage-gated potassium channel activity involved in ventricular cardiac muscle cell action potential repolarization(GO:1902282) |
0.0 | 0.0 | GO:0018571 | 2,3-dihydroxy DDT 1,2-dioxygenase activity(GO:0018542) phenanthrene dioxygenase activity(GO:0018555) 2,2',3-trihydroxybiphenyl dioxygenase activity(GO:0018556) 1,2-dihydroxyfluorene 1,1-alpha-dioxygenase activity(GO:0018557) 5,6-dihydroxy-3-methyl-2-oxo-1,2-dihydroquinoline dioxygenase activity(GO:0018558) 1,1-dichloro-2-(dihydroxy-4-chlorophenyl)-(4-chlorophenyl)ethene 1,2-dioxygenase activity(GO:0018559) protocatechuate 3,4-dioxygenase type II activity(GO:0018560) 2'-aminobiphenyl-2,3-diol 1,2-dioxygenase activity(GO:0018561) 3,4-dihydroxyfluorene 4,4-alpha-dioxygenase activity(GO:0018562) 2,3-dihydroxy-ethylbenzene 1,2-dioxygenase activity(GO:0018563) carbazole 1,9a-dioxygenase activity(GO:0018564) dihydroxydibenzothiophene dioxygenase activity(GO:0018565) 1,2-dihydroxynaphthalene-6-sulfonate 1,8a-dioxygenase activity(GO:0018566) styrene dioxygenase activity(GO:0018567) 3,4-dihydroxyphenanthrene dioxygenase activity(GO:0018568) hydroquinone 1,2-dioxygenase activity(GO:0018569) p-cumate 2,3-dioxygenase activity(GO:0018570) 2,3-dihydroxy-p-cumate dioxygenase activity(GO:0018571) 3,5-dichlorocatechol 1,2-dioxygenase activity(GO:0018572) 2-aminophenol 1,6-dioxygenase activity(GO:0018573) 2,6-dichloro-p-hydroquinone 1,2-dioxygenase activity(GO:0018574) chlorocatechol 1,2-dioxygenase activity(GO:0018575) catechol dioxygenase activity(GO:0019114) dihydroxyfluorene dioxygenase activity(GO:0019117) 5-aminosalicylate dioxygenase activity(GO:0034543) 3-hydroxy-2-naphthoate 2,3-dioxygenase activity(GO:0034803) benzo(a)pyrene 11,12-dioxygenase activity(GO:0034806) benzo(a)pyrene 4,5-dioxygenase activity(GO:0034808) 4,5-dihydroxybenzo(a)pyrene dioxygenase activity(GO:0034810) benzo(a)pyrene 9,10-dioxygenase activity(GO:0034811) 9,10-dihydroxybenzo(a)pyrene dioxygenase activity(GO:0034812) benzo(a)pyrene 7,8-dioxygenase activity(GO:0034813) 7,8-dihydroxy benzo(a)pyrene dioxygenase activity(GO:0034814) 1,2-dihydroxy-5,6,7,8-tetrahydronaphthalene extradiol dioxygenase activity(GO:0034827) 2-mercaptobenzothiazole dioxygenase activity(GO:0034834) pyridine-3,4-diol dioxygenase activity(GO:0034895) pyrene dioxygenase activity(GO:0034920) 4,5-dihydroxypyrene dioxygenase activity(GO:0034922) phenanthrene-4-carboxylate dioxygenase activity(GO:0034934) tetrachlorobenzene dioxygenase activity(GO:0034935) 4,6-dichloro-3-methylcatechol 1,2-dioxygenase activity(GO:0034936) 2,3-dihydroxydiphenyl ether dioxygenase activity(GO:0034955) diphenyl ether 1,2-dioxygenase activity(GO:0034956) arachidonate 8(S)-lipoxygenase activity(GO:0036403) 4-hydroxycatechol 1,2-dioxygenase activity(GO:0047074) |
0.0 | 0.1 | GO:0039706 | co-receptor binding(GO:0039706) |
0.0 | 0.4 | GO:0017112 | Rab guanyl-nucleotide exchange factor activity(GO:0017112) |
0.0 | 0.1 | GO:0000104 | succinate dehydrogenase activity(GO:0000104) |
0.0 | 0.0 | GO:0016174 | NAD(P)H oxidase activity(GO:0016174) |
0.0 | 0.1 | GO:0044548 | S100 protein binding(GO:0044548) |
0.0 | 0.0 | GO:0003872 | 6-phosphofructokinase activity(GO:0003872) |
0.0 | 0.1 | GO:0005007 | fibroblast growth factor-activated receptor activity(GO:0005007) |
0.0 | 0.0 | GO:0004096 | catalase activity(GO:0004096) |
0.0 | 0.1 | GO:0001784 | phosphotyrosine binding(GO:0001784) |
0.0 | 0.1 | GO:0070883 | pre-miRNA binding(GO:0070883) |
0.0 | 0.5 | GO:0048365 | Rac GTPase binding(GO:0048365) |
0.0 | 0.1 | GO:0034235 | GPI anchor binding(GO:0034235) |
0.0 | 0.4 | GO:0051019 | mitogen-activated protein kinase binding(GO:0051019) |
0.0 | 0.4 | GO:0008392 | arachidonic acid monooxygenase activity(GO:0008391) arachidonic acid epoxygenase activity(GO:0008392) |
0.0 | 0.1 | GO:0001135 | transcription factor activity, RNA polymerase II transcription factor recruiting(GO:0001135) |
0.0 | 0.1 | GO:0015386 | sodium:proton antiporter activity(GO:0015385) potassium:proton antiporter activity(GO:0015386) |
0.0 | 0.0 | GO:0071553 | uridine nucleotide receptor activity(GO:0015065) G-protein coupled pyrimidinergic nucleotide receptor activity(GO:0071553) |
0.0 | 0.1 | GO:0010997 | anaphase-promoting complex binding(GO:0010997) |
0.0 | 0.0 | GO:0004515 | nicotinamide-nucleotide adenylyltransferase activity(GO:0000309) nicotinate-nucleotide adenylyltransferase activity(GO:0004515) |
0.0 | 0.0 | GO:0004813 | alanine-tRNA ligase activity(GO:0004813) |
0.0 | 0.2 | GO:0015279 | store-operated calcium channel activity(GO:0015279) |
0.0 | 0.1 | GO:0070097 | delta-catenin binding(GO:0070097) |
0.0 | 0.0 | GO:0033829 | O-fucosylpeptide 3-beta-N-acetylglucosaminyltransferase activity(GO:0033829) |
0.0 | 0.1 | GO:0005315 | inorganic phosphate transmembrane transporter activity(GO:0005315) |
0.0 | 0.0 | GO:0016532 | superoxide dismutase copper chaperone activity(GO:0016532) |
0.0 | 0.1 | GO:0004708 | MAP kinase kinase activity(GO:0004708) |
0.0 | 0.1 | GO:0038036 | sphingosine-1-phosphate receptor activity(GO:0038036) |
0.0 | 0.0 | GO:0008597 | calcium-dependent protein serine/threonine phosphatase regulator activity(GO:0008597) |
0.0 | 0.1 | GO:1990239 | steroid hormone binding(GO:1990239) |
0.0 | 0.0 | GO:0004724 | magnesium-dependent protein serine/threonine phosphatase activity(GO:0004724) |
0.0 | 0.0 | GO:0004726 | non-membrane spanning protein tyrosine phosphatase activity(GO:0004726) |
0.0 | 0.1 | GO:0002151 | G-quadruplex RNA binding(GO:0002151) |
0.0 | 0.0 | GO:0022858 | L-alanine transmembrane transporter activity(GO:0015180) alanine transmembrane transporter activity(GO:0022858) |
0.0 | 0.0 | GO:0033192 | calmodulin-dependent protein phosphatase activity(GO:0033192) |
0.0 | 0.1 | GO:0097157 | pre-mRNA intronic binding(GO:0097157) |
0.0 | 0.0 | GO:0019153 | protein-disulfide reductase (glutathione) activity(GO:0019153) |
0.0 | 0.1 | GO:0004679 | AMP-activated protein kinase activity(GO:0004679) |
0.0 | 0.1 | GO:0030976 | thiamine pyrophosphate binding(GO:0030976) |
0.0 | 0.1 | GO:0008195 | phosphatidate phosphatase activity(GO:0008195) |
0.0 | 0.1 | GO:0047631 | ADP-ribose diphosphatase activity(GO:0047631) |
0.0 | 0.2 | GO:0034237 | protein kinase A regulatory subunit binding(GO:0034237) |
0.0 | 0.0 | GO:0004677 | DNA-dependent protein kinase activity(GO:0004677) |
0.0 | 0.0 | GO:0004090 | carbonyl reductase (NADPH) activity(GO:0004090) |
0.0 | 0.1 | GO:0050733 | RS domain binding(GO:0050733) |
0.0 | 0.1 | GO:0016624 | oxidoreductase activity, acting on the aldehyde or oxo group of donors, disulfide as acceptor(GO:0016624) |
0.0 | 0.1 | GO:0070728 | leucine binding(GO:0070728) |
0.0 | 0.1 | GO:0003688 | DNA replication origin binding(GO:0003688) |
0.0 | 0.1 | GO:0047760 | butyrate-CoA ligase activity(GO:0047760) |
0.0 | 0.3 | GO:0031593 | polyubiquitin binding(GO:0031593) |
0.0 | 0.0 | GO:0031750 | D3 dopamine receptor binding(GO:0031750) |
0.0 | 0.1 | GO:0003836 | beta-galactoside (CMP) alpha-2,3-sialyltransferase activity(GO:0003836) |
0.0 | 0.1 | GO:0008553 | hydrogen-exporting ATPase activity, phosphorylative mechanism(GO:0008553) |
0.0 | 0.0 | GO:0089720 | caspase binding(GO:0089720) |
0.0 | 0.0 | GO:0016885 | ligase activity, forming carbon-carbon bonds(GO:0016885) |
0.0 | 0.0 | GO:0016520 | growth hormone-releasing hormone receptor activity(GO:0016520) |
0.0 | 0.1 | GO:0046624 | sphingolipid transporter activity(GO:0046624) |
0.0 | 0.1 | GO:0043023 | ribosomal large subunit binding(GO:0043023) |
0.0 | 0.1 | GO:0001671 | ATPase activator activity(GO:0001671) |
0.0 | 0.1 | GO:0046975 | histone methyltransferase activity (H3-K36 specific)(GO:0046975) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.1 | 2.2 | PID PDGFRA PATHWAY | PDGFR-alpha signaling pathway |
0.1 | 0.1 | PID PI3KCI AKT PATHWAY | Class I PI3K signaling events mediated by Akt |
0.1 | 0.6 | PID TCR JNK PATHWAY | JNK signaling in the CD4+ TCR pathway |
0.1 | 0.7 | PID ERB GENOMIC PATHWAY | Validated nuclear estrogen receptor beta network |
0.1 | 0.5 | PID HEDGEHOG GLI PATHWAY | Hedgehog signaling events mediated by Gli proteins |
0.0 | 0.2 | SIG INSULIN RECEPTOR PATHWAY IN CARDIAC MYOCYTES | Genes related to the insulin receptor pathway |
0.0 | 0.1 | PID INSULIN GLUCOSE PATHWAY | Insulin-mediated glucose transport |
0.0 | 0.4 | SA PTEN PATHWAY | PTEN is a tumor suppressor that dephosphorylates the lipid messenger phosphatidylinositol triphosphate. |
0.0 | 0.5 | SA CASPASE CASCADE | Apoptosis is mediated by caspases, cysteine proteases arranged in a proteolytic cascade. |
0.0 | 0.2 | ST TYPE I INTERFERON PATHWAY | Type I Interferon (alpha/beta IFN) Pathway |
0.0 | 0.4 | PID ERBB NETWORK PATHWAY | ErbB receptor signaling network |
0.0 | 0.3 | PID IGF1 PATHWAY | IGF1 pathway |
0.0 | 0.4 | PID CONE PATHWAY | Visual signal transduction: Cones |
0.0 | 0.5 | PID ATM PATHWAY | ATM pathway |
0.0 | 0.0 | PID NFAT 3PATHWAY | Role of Calcineurin-dependent NFAT signaling in lymphocytes |
0.0 | 0.5 | PID EPHB FWD PATHWAY | EPHB forward signaling |
0.0 | 0.5 | PID FAK PATHWAY | Signaling events mediated by focal adhesion kinase |
0.0 | 0.4 | PID HIF2PATHWAY | HIF-2-alpha transcription factor network |
0.0 | 0.3 | PID DNA PK PATHWAY | DNA-PK pathway in nonhomologous end joining |
0.0 | 0.6 | PID INSULIN PATHWAY | Insulin Pathway |
0.0 | 0.4 | PID WNT NONCANONICAL PATHWAY | Noncanonical Wnt signaling pathway |
0.0 | 0.1 | SA REG CASCADE OF CYCLIN EXPR | Expression of cyclins regulates progression through the cell cycle by activating cyclin-dependent kinases. |
0.0 | 0.0 | SA TRKA RECEPTOR | The TrkA receptor binds nerve growth factor to activate MAP kinase pathways and promote cell growth. |
0.0 | 0.0 | PID IL8 CXCR2 PATHWAY | IL8- and CXCR2-mediated signaling events |
0.0 | 0.1 | PID S1P S1P2 PATHWAY | S1P2 pathway |
0.0 | 1.1 | PID MYC ACTIV PATHWAY | Validated targets of C-MYC transcriptional activation |
0.0 | 0.5 | PID TRKR PATHWAY | Neurotrophic factor-mediated Trk receptor signaling |
0.0 | 0.2 | PID RAC1 REG PATHWAY | Regulation of RAC1 activity |
0.0 | 0.0 | PID PS1 PATHWAY | Presenilin action in Notch and Wnt signaling |
0.0 | 0.1 | PID AVB3 INTEGRIN PATHWAY | Integrins in angiogenesis |
0.0 | 0.3 | SIG CD40PATHWAYMAP | Genes related to CD40 signaling |
0.0 | 0.1 | PID GLYPICAN 1PATHWAY | Glypican 1 network |
0.0 | 0.3 | ST DIFFERENTIATION PATHWAY IN PC12 CELLS | Differentiation Pathway in PC12 Cells; this is a specific case of PAC1 Receptor Pathway. |
0.0 | 0.0 | PID MYC PATHWAY | C-MYC pathway |
0.0 | 0.1 | SA G2 AND M PHASES | Cdc25 activates the cdc2/cyclin B complex to induce the G2/M transition. |
0.0 | 0.1 | PID ARF6 TRAFFICKING PATHWAY | Arf6 trafficking events |
0.0 | 0.3 | PID ARF6 PATHWAY | Arf6 signaling events |
0.0 | 0.3 | PID CASPASE PATHWAY | Caspase cascade in apoptosis |
0.0 | 0.3 | PID MET PATHWAY | Signaling events mediated by Hepatocyte Growth Factor Receptor (c-Met) |
0.0 | 0.0 | ST P38 MAPK PATHWAY | p38 MAPK Pathway |
0.0 | 0.1 | PID ANTHRAX PATHWAY | Cellular roles of Anthrax toxin |
0.0 | 0.2 | PID IL6 7 PATHWAY | IL6-mediated signaling events |
0.0 | 0.2 | PID LIS1 PATHWAY | Lissencephaly gene (LIS1) in neuronal migration and development |
0.0 | 0.3 | PID TELOMERASE PATHWAY | Regulation of Telomerase |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.1 | 2.0 | REACTOME SIGNALING BY CONSTITUTIVELY ACTIVE EGFR | Genes involved in Signaling by constitutively active EGFR |
0.1 | 1.7 | REACTOME BILE ACID AND BILE SALT METABOLISM | Genes involved in Bile acid and bile salt metabolism |
0.1 | 1.1 | REACTOME ACTIVATION OF BH3 ONLY PROTEINS | Genes involved in Activation of BH3-only proteins |
0.1 | 0.2 | REACTOME XENOBIOTICS | Genes involved in Xenobiotics |
0.1 | 1.0 | REACTOME REGULATION OF IFNA SIGNALING | Genes involved in Regulation of IFNA signaling |
0.1 | 0.5 | REACTOME SIGNAL REGULATORY PROTEIN SIRP FAMILY INTERACTIONS | Genes involved in Signal regulatory protein (SIRP) family interactions |
0.0 | 0.5 | REACTOME PURINE CATABOLISM | Genes involved in Purine catabolism |
0.0 | 0.3 | REACTOME ETHANOL OXIDATION | Genes involved in Ethanol oxidation |
0.0 | 1.0 | REACTOME GLUTATHIONE CONJUGATION | Genes involved in Glutathione conjugation |
0.0 | 0.8 | REACTOME SIGNALING BY NODAL | Genes involved in Signaling by NODAL |
0.0 | 0.4 | REACTOME NFKB ACTIVATION THROUGH FADD RIP1 PATHWAY MEDIATED BY CASPASE 8 AND10 | Genes involved in NF-kB activation through FADD/RIP-1 pathway mediated by caspase-8 and -10 |
0.0 | 0.3 | REACTOME G2 M DNA DAMAGE CHECKPOINT | Genes involved in G2/M DNA damage checkpoint |
0.0 | 0.4 | REACTOME CDC6 ASSOCIATION WITH THE ORC ORIGIN COMPLEX | Genes involved in CDC6 association with the ORC:origin complex |
0.0 | 1.2 | REACTOME TRANSPORT TO THE GOLGI AND SUBSEQUENT MODIFICATION | Genes involved in Transport to the Golgi and subsequent modification |
0.0 | 0.1 | REACTOME SCF BETA TRCP MEDIATED DEGRADATION OF EMI1 | Genes involved in SCF-beta-TrCP mediated degradation of Emi1 |
0.0 | 0.4 | REACTOME PURINE SALVAGE | Genes involved in Purine salvage |
0.0 | 0.9 | REACTOME SYNTHESIS OF PIPS AT THE PLASMA MEMBRANE | Genes involved in Synthesis of PIPs at the plasma membrane |
0.0 | 0.4 | REACTOME TGF BETA RECEPTOR SIGNALING IN EMT EPITHELIAL TO MESENCHYMAL TRANSITION | Genes involved in TGF-beta receptor signaling in EMT (epithelial to mesenchymal transition) |
0.0 | 0.1 | REACTOME DARPP 32 EVENTS | Genes involved in DARPP-32 events |
0.0 | 0.3 | REACTOME ARMS MEDIATED ACTIVATION | Genes involved in ARMS-mediated activation |
0.0 | 0.5 | REACTOME CITRIC ACID CYCLE TCA CYCLE | Genes involved in Citric acid cycle (TCA cycle) |
0.0 | 0.7 | REACTOME TRANSPORT OF VITAMINS NUCLEOSIDES AND RELATED MOLECULES | Genes involved in Transport of vitamins, nucleosides, and related molecules |
0.0 | 0.3 | REACTOME SIGNALING BY ACTIVATED POINT MUTANTS OF FGFR1 | Genes involved in Signaling by activated point mutants of FGFR1 |
0.0 | 0.2 | REACTOME TRANSLOCATION OF ZAP 70 TO IMMUNOLOGICAL SYNAPSE | Genes involved in Translocation of ZAP-70 to Immunological synapse |
0.0 | 0.4 | REACTOME GAP JUNCTION ASSEMBLY | Genes involved in Gap junction assembly |
0.0 | 0.5 | REACTOME INSULIN SYNTHESIS AND PROCESSING | Genes involved in Insulin Synthesis and Processing |
0.0 | 0.3 | REACTOME JNK C JUN KINASES PHOSPHORYLATION AND ACTIVATION MEDIATED BY ACTIVATED HUMAN TAK1 | Genes involved in JNK (c-Jun kinases) phosphorylation and activation mediated by activated human TAK1 |
0.0 | 0.0 | REACTOME GAP JUNCTION DEGRADATION | Genes involved in Gap junction degradation |
0.0 | 0.7 | REACTOME AMINO ACID TRANSPORT ACROSS THE PLASMA MEMBRANE | Genes involved in Amino acid transport across the plasma membrane |
0.0 | 0.3 | REACTOME REGULATION OF AMPK ACTIVITY VIA LKB1 | Genes involved in Regulation of AMPK activity via LKB1 |
0.0 | 0.4 | REACTOME REGULATION OF GENE EXPRESSION IN BETA CELLS | Genes involved in Regulation of gene expression in beta cells |
0.0 | 0.5 | REACTOME COMPLEMENT CASCADE | Genes involved in Complement cascade |
0.0 | 0.2 | REACTOME THE ACTIVATION OF ARYLSULFATASES | Genes involved in The activation of arylsulfatases |
0.0 | 0.2 | REACTOME CYTOSOLIC SULFONATION OF SMALL MOLECULES | Genes involved in Cytosolic sulfonation of small molecules |
0.0 | 0.2 | REACTOME ANTIGEN PRESENTATION FOLDING ASSEMBLY AND PEPTIDE LOADING OF CLASS I MHC | Genes involved in Antigen Presentation: Folding, assembly and peptide loading of class I MHC |
0.0 | 0.5 | REACTOME SYNTHESIS OF PA | Genes involved in Synthesis of PA |
0.0 | 0.2 | REACTOME PEROXISOMAL LIPID METABOLISM | Genes involved in Peroxisomal lipid metabolism |
0.0 | 0.0 | REACTOME APC CDC20 MEDIATED DEGRADATION OF NEK2A | Genes involved in APC-Cdc20 mediated degradation of Nek2A |
0.0 | 0.3 | REACTOME FORMATION OF INCISION COMPLEX IN GG NER | Genes involved in Formation of incision complex in GG-NER |
0.0 | 0.0 | REACTOME NEF MEDIATED DOWNREGULATION OF MHC CLASS I COMPLEX CELL SURFACE EXPRESSION | Genes involved in Nef mediated downregulation of MHC class I complex cell surface expression |
0.0 | 0.3 | REACTOME CHONDROITIN SULFATE BIOSYNTHESIS | Genes involved in Chondroitin sulfate biosynthesis |
0.0 | 0.1 | REACTOME MICRORNA MIRNA BIOGENESIS | Genes involved in MicroRNA (miRNA) Biogenesis |
0.0 | 0.3 | REACTOME SYNTHESIS OF PC | Genes involved in Synthesis of PC |
0.0 | 0.2 | REACTOME FORMATION OF THE TERNARY COMPLEX AND SUBSEQUENTLY THE 43S COMPLEX | Genes involved in Formation of the ternary complex, and subsequently, the 43S complex |
0.0 | 0.0 | REACTOME VIF MEDIATED DEGRADATION OF APOBEC3G | Genes involved in Vif-mediated degradation of APOBEC3G |
0.0 | 0.1 | REACTOME SYNTHESIS OF PIPS AT THE EARLY ENDOSOME MEMBRANE | Genes involved in Synthesis of PIPs at the early endosome membrane |
0.0 | 0.0 | REACTOME CROSS PRESENTATION OF SOLUBLE EXOGENOUS ANTIGENS ENDOSOMES | Genes involved in Cross-presentation of soluble exogenous antigens (endosomes) |
0.0 | 0.4 | REACTOME TRAFFICKING OF AMPA RECEPTORS | Genes involved in Trafficking of AMPA receptors |
0.0 | 0.2 | REACTOME RECYCLING PATHWAY OF L1 | Genes involved in Recycling pathway of L1 |
0.0 | 0.0 | REACTOME NRAGE SIGNALS DEATH THROUGH JNK | Genes involved in NRAGE signals death through JNK |
0.0 | 0.1 | REACTOME ACTIVATION OF NF KAPPAB IN B CELLS | Genes involved in Activation of NF-kappaB in B Cells |
0.0 | 0.2 | REACTOME MEIOTIC RECOMBINATION | Genes involved in Meiotic Recombination |
0.0 | 0.4 | REACTOME CLASS B 2 SECRETIN FAMILY RECEPTORS | Genes involved in Class B/2 (Secretin family receptors) |
0.0 | 0.3 | REACTOME NITRIC OXIDE STIMULATES GUANYLATE CYCLASE | Genes involved in Nitric oxide stimulates guanylate cyclase |
0.0 | 0.3 | REACTOME CYTOSOLIC TRNA AMINOACYLATION | Genes involved in Cytosolic tRNA aminoacylation |
0.0 | 0.0 | REACTOME LATENT INFECTION OF HOMO SAPIENS WITH MYCOBACTERIUM TUBERCULOSIS | Genes involved in Latent infection of Homo sapiens with Mycobacterium tuberculosis |
0.0 | 0.1 | REACTOME ENDOGENOUS STEROLS | Genes involved in Endogenous sterols |
0.0 | 1.1 | REACTOME SRP DEPENDENT COTRANSLATIONAL PROTEIN TARGETING TO MEMBRANE | Genes involved in SRP-dependent cotranslational protein targeting to membrane |
0.0 | 0.0 | REACTOME ACYL CHAIN REMODELLING OF PI | Genes involved in Acyl chain remodelling of PI |
0.0 | 0.1 | REACTOME RAP1 SIGNALLING | Genes involved in Rap1 signalling |
0.0 | 0.0 | REACTOME OPIOID SIGNALLING | Genes involved in Opioid Signalling |
0.0 | 0.2 | REACTOME SEMA4D INDUCED CELL MIGRATION AND GROWTH CONE COLLAPSE | Genes involved in Sema4D induced cell migration and growth-cone collapse |
0.0 | 0.1 | REACTOME GLUCOSE TRANSPORT | Genes involved in Glucose transport |
0.0 | 0.0 | REACTOME SIGNALING BY FGFR | Genes involved in Signaling by FGFR |