Gene Symbol | Gene ID | Gene Info |
---|---|---|
Cebpb
|
ENSMUSG00000056501.3 | Cebpb |
Gene | Promoter | Distance | Association probability | Pearson corr. coef. | P-value | Plot |
---|---|---|---|---|---|---|
Cebpb | chr2_167681521_167681676 | 7317 | 0.108665 | 0.93 | 8.0e-03 | Click! |
Cebpb | chr2_167686580_167686731 | 2260 | 0.170967 | 0.84 | 3.6e-02 | Click! |
Cebpb | chr2_167687731_167687899 | 1100 | 0.319631 | 0.81 | 5.0e-02 | Click! |
Cebpb | chr2_167685491_167685671 | 3334 | 0.136490 | -0.80 | 5.4e-02 | Click! |
Cebpb | chr2_167688062_167688222 | 773 | 0.441379 | -0.70 | 1.2e-01 | Click! |
Move your cursor over a bar to see sample name and corresponding Z-value.
Cis Regulatory Element (CRE) | Target Score | Top associated gene | Gene Info | Distance of CRE to TSS | CRE/Gene association probability |
---|---|---|---|---|---|
chr16_22918762_22918945 | 8.25 |
Fetub |
fetuin beta |
354 |
0.8 |
chr13_52985802_52985979 | 7.03 |
Nfil3 |
nuclear factor, interleukin 3, regulated |
4817 |
0.2 |
chr19_61052885_61053046 | 6.28 |
Gm22520 |
predicted gene, 22520 |
39420 |
0.13 |
chr4_126017743_126017905 | 6.07 |
Csf3r |
colony stimulating factor 3 receptor (granulocyte) |
6726 |
0.16 |
chr4_34495112_34495276 | 5.49 |
Gm12350 |
predicted gene 12350 |
9362 |
0.19 |
chr8_119418852_119419003 | 5.44 |
Osgin1 |
oxidative stress induced growth inhibitor 1 |
15197 |
0.14 |
chr4_95781475_95781629 | 5.21 |
Fggy |
FGGY carbohydrate kinase domain containing |
12043 |
0.28 |
chr13_37290811_37290962 | 5.09 |
Gm47711 |
predicted gene, 47711 |
35580 |
0.12 |
chr7_112202260_112202451 | 4.88 |
Mical2 |
microtubule associated monooxygenase, calponin and LIM domain containing 2 |
23501 |
0.22 |
chr18_21375385_21375573 | 4.85 |
Gm22886 |
predicted gene, 22886 |
5452 |
0.22 |
chr4_139798704_139798855 | 4.68 |
Pax7 |
paired box 7 |
34228 |
0.17 |
chr12_25265027_25265397 | 4.60 |
Gm19340 |
predicted gene, 19340 |
17383 |
0.18 |
chr4_147084058_147084372 | 4.42 |
Gm13160 |
predicted gene 13160 |
2769 |
0.16 |
chr11_115188803_115189002 | 4.40 |
Nat9 |
N-acetyltransferase 9 (GCN5-related, putative) |
1043 |
0.32 |
chr11_99081665_99081816 | 4.34 |
Tns4 |
tensin 4 |
6399 |
0.15 |
chr6_136475293_136475468 | 4.30 |
Gm6728 |
predicted gene 6728 |
11806 |
0.12 |
chr4_115607059_115607329 | 4.16 |
Cyp4a32 |
cytochrome P450, family 4, subfamily a, polypeptide 32 |
6219 |
0.14 |
chr4_58149311_58149475 | 4.01 |
Svep1 |
sushi, von Willebrand factor type A, EGF and pentraxin domain containing 1 |
57203 |
0.14 |
chr5_53003609_53003777 | 4.01 |
5033403H07Rik |
RIKEN cDNA 5033403H07 gene |
9257 |
0.15 |
chr5_148674254_148674405 | 4.00 |
Gm36186 |
predicted gene, 36186 |
37137 |
0.13 |
chr5_115491812_115492014 | 3.98 |
Gm13836 |
predicted gene 13836 |
542 |
0.51 |
chr19_23120450_23120606 | 3.98 |
2410080I02Rik |
RIKEN cDNA 2410080I02 gene |
14372 |
0.15 |
chr2_167886467_167886618 | 3.94 |
Gm14319 |
predicted gene 14319 |
27957 |
0.14 |
chr4_148513774_148513956 | 3.94 |
Angptl7 |
angiopoietin-like 7 |
13405 |
0.11 |
chr2_22810952_22811103 | 3.91 |
Apbb1ip |
amyloid beta (A4) precursor protein-binding, family B, member 1 interacting protein |
36582 |
0.12 |
chr11_3404843_3404996 | 3.85 |
Limk2 |
LIM motif-containing protein kinase 2 |
4255 |
0.14 |
chr5_119156694_119156864 | 3.83 |
Gm7538 |
predicted gene 7538 |
43239 |
0.16 |
chr5_120514188_120514356 | 3.80 |
Slc8b1 |
solute carrier family 8 (sodium/lithium/calcium exchanger), member B1 |
1129 |
0.34 |
chr11_86613913_86614288 | 3.77 |
Vmp1 |
vacuole membrane protein 1 |
11805 |
0.15 |
chr15_25940308_25940999 | 3.74 |
Retreg1 |
reticulophagy regulator 1 |
49 |
0.98 |
chr1_170491250_170491416 | 3.72 |
Nos1ap |
nitric oxide synthase 1 (neuronal) adaptor protein |
36419 |
0.18 |
chr13_102860228_102860379 | 3.64 |
Mast4 |
microtubule associated serine/threonine kinase family member 4 |
45483 |
0.17 |
chr6_128518176_128518418 | 3.63 |
Pzp |
PZP, alpha-2-macroglobulin like |
8406 |
0.09 |
chr13_43233447_43233620 | 3.52 |
Tbc1d7 |
TBC1 domain family, member 7 |
62032 |
0.1 |
chr5_51868255_51868430 | 3.52 |
Gm43606 |
predicted gene 43606 |
9567 |
0.17 |
chr10_59236538_59236707 | 3.50 |
Sowahc |
sosondowah ankyrin repeat domain family member C |
14669 |
0.15 |
chr7_143482676_143482827 | 3.47 |
Slc22a18 |
solute carrier family 22 (organic cation transporter), member 18 |
7650 |
0.12 |
chr3_63073216_63073369 | 3.44 |
Gm22433 |
predicted gene, 22433 |
78925 |
0.1 |
chr14_31188813_31189006 | 3.42 |
Nisch |
nischarin |
1457 |
0.26 |
chr1_133953323_133953489 | 3.41 |
Gm1627 |
predicted gene 1627 |
8756 |
0.15 |
chr2_64466601_64466868 | 3.39 |
Gm13577 |
predicted gene 13577 |
8215 |
0.29 |
chr6_124279510_124279661 | 3.37 |
Gm43971 |
predicted gene, 43971 |
100 |
0.94 |
chr6_138826322_138826478 | 3.37 |
Gm9038 |
predicted gene 9038 |
33724 |
0.23 |
chr5_135741186_135741337 | 3.32 |
Tmem120a |
transmembrane protein 120A |
1138 |
0.32 |
chr19_21461372_21461542 | 3.30 |
Gda |
guanine deaminase |
11131 |
0.25 |
chr5_64712724_64712894 | 3.28 |
Gm20033 |
predicted gene, 20033 |
1640 |
0.32 |
chr10_18237308_18237472 | 3.28 |
Gm10827 |
predicted gene 10827 |
2024 |
0.26 |
chr13_12408792_12408973 | 3.28 |
Heatr1 |
HEAT repeat containing 1 |
3324 |
0.19 |
chrX_101769621_101769797 | 3.28 |
Tpt1-ps6 |
tumor protein, translationally-controlled, pseudogene 6 |
1174 |
0.32 |
chr13_10264001_10264320 | 3.26 |
Gm47404 |
predicted gene, 47404 |
83353 |
0.08 |
chr2_7267288_7267450 | 3.25 |
Gm24340 |
predicted gene, 24340 |
82728 |
0.1 |
chr15_33305735_33305892 | 3.25 |
1700084J12Rik |
RIKEN cDNA 1700084J12 gene |
100126 |
0.08 |
chr11_65137336_65137502 | 3.23 |
1700086D15Rik |
RIKEN cDNA 1700086D15 gene |
22471 |
0.13 |
chr13_43209141_43209440 | 3.22 |
Tbc1d7 |
TBC1 domain family, member 7 |
37789 |
0.16 |
chr15_67048278_67048448 | 3.22 |
Gm31342 |
predicted gene, 31342 |
8305 |
0.23 |
chr10_127945677_127945888 | 3.21 |
Gm15900 |
predicted gene 15900 |
2778 |
0.13 |
chr13_4615952_4616121 | 3.20 |
Rpl29-ps2 |
ribosomal protein L29, pseudogene 2 |
1854 |
0.3 |
chr19_3345318_3345493 | 3.19 |
Cpt1a |
carnitine palmitoyltransferase 1a, liver |
3778 |
0.16 |
chr8_125127777_125127928 | 3.19 |
Disc1 |
disrupted in schizophrenia 1 |
39865 |
0.15 |
chr13_34814605_34814934 | 3.19 |
Gm47157 |
predicted gene, 47157 |
225 |
0.91 |
chr2_103867341_103867506 | 3.17 |
Gm13876 |
predicted gene 13876 |
20901 |
0.08 |
chr1_93692027_93692178 | 3.13 |
Bok |
BCL2-related ovarian killer |
1715 |
0.28 |
chr8_21776372_21776703 | 3.13 |
Defb1 |
defensin beta 1 |
62 |
0.95 |
chr6_128482999_128483184 | 3.13 |
Pzp |
PZP, alpha-2-macroglobulin like |
4764 |
0.1 |
chr12_98375326_98375477 | 3.12 |
5330409N07Rik |
RIKEN cDNA 5330409N07 gene |
72933 |
0.08 |
chr4_117202615_117202782 | 3.11 |
Gm23143 |
predicted gene, 23143 |
170 |
0.86 |
chrX_38313041_38313214 | 3.10 |
Atp1b4 |
ATPase, (Na+)/K+ transporting, beta 4 polypeptide |
3057 |
0.21 |
chr16_22681359_22681510 | 3.09 |
Gm8118 |
predicted gene 8118 |
4760 |
0.2 |
chr16_30721337_30721503 | 3.07 |
Gm49754 |
predicted gene, 49754 |
71835 |
0.09 |
chr18_46614972_46615447 | 3.05 |
Gm3734 |
predicted gene 3734 |
15598 |
0.13 |
chr12_99417868_99418197 | 3.04 |
Foxn3 |
forkhead box N3 |
5427 |
0.19 |
chr8_12779654_12779811 | 3.03 |
Atp11a |
ATPase, class VI, type 11A |
22663 |
0.14 |
chr3_30421777_30421938 | 3.03 |
Gm37024 |
predicted gene, 37024 |
66569 |
0.09 |
chr12_102453488_102453639 | 3.01 |
Gm30198 |
predicted gene, 30198 |
6235 |
0.17 |
chr11_76849502_76849693 | 3.00 |
Cpd |
carboxypeptidase D |
2579 |
0.29 |
chr4_139964484_139964679 | 2.97 |
Mir2139 |
microRNA 2139 |
3039 |
0.2 |
chr8_10899757_10899923 | 2.97 |
4833411C07Rik |
RIKEN cDNA 4833411C07 gene |
82 |
0.9 |
chr2_149319329_149319489 | 2.95 |
Gm14132 |
predicted gene 14132 |
15380 |
0.21 |
chr9_115477359_115477532 | 2.95 |
Gm5921 |
predicted gene 5921 |
38864 |
0.14 |
chr11_68656972_68657153 | 2.94 |
Myh10 |
myosin, heavy polypeptide 10, non-muscle |
34497 |
0.15 |
chr4_136362592_136362743 | 2.94 |
Hnrnpr |
heterogeneous nuclear ribonucleoprotein R |
6893 |
0.16 |
chr7_130002136_130002297 | 2.93 |
Gm23847 |
predicted gene, 23847 |
32878 |
0.19 |
chr7_49358786_49358938 | 2.93 |
Nav2 |
neuron navigator 2 |
5859 |
0.24 |
chr6_133960296_133960447 | 2.91 |
Gm8956 |
predicted gene 8956 |
27962 |
0.17 |
chr19_6273750_6273958 | 2.90 |
Gm14963 |
predicted gene 14963 |
2751 |
0.1 |
chr7_28862945_28863096 | 2.89 |
Lgals7 |
lectin, galactose binding, soluble 7 |
833 |
0.39 |
chr3_136426638_136426807 | 2.89 |
1700030L20Rik |
RIKEN cDNA 1700030L20 gene |
22627 |
0.22 |
chr11_119936702_119936872 | 2.89 |
Gm11766 |
predicted gene 11766 |
1724 |
0.24 |
chr12_108359338_108359496 | 2.88 |
Cyp46a1 |
cytochrome P450, family 46, subfamily a, polypeptide 1 |
7193 |
0.17 |
chr8_10859650_10859809 | 2.87 |
Gm32540 |
predicted gene, 32540 |
6457 |
0.13 |
chr3_84602850_84603001 | 2.83 |
Tigd4 |
tigger transposable element derived 4 |
9351 |
0.18 |
chr6_28687920_28688071 | 2.83 |
Snd1 |
staphylococcal nuclease and tudor domain containing 1 |
16914 |
0.23 |
chr1_75660295_75660569 | 2.83 |
Gm5257 |
predicted gene 5257 |
24042 |
0.16 |
chr2_101979917_101980215 | 2.83 |
Gm13919 |
predicted gene 13919 |
59563 |
0.11 |
chr14_51091523_51091694 | 2.83 |
Ang |
angiogenin, ribonuclease, RNase A family, 5 |
458 |
0.43 |
chr13_79286283_79286457 | 2.80 |
Gm29318 |
predicted gene 29318 |
658 |
0.76 |
chr16_88583440_88583620 | 2.78 |
Cldn8 |
claudin 8 |
20347 |
0.11 |
chr1_82858363_82858708 | 2.78 |
Agfg1 |
ArfGAP with FG repeats 1 |
18462 |
0.09 |
chr19_28678213_28678398 | 2.77 |
D930032P07Rik |
RIKEN cDNA D930032P07 gene |
77 |
0.84 |
chr19_23028352_23028509 | 2.77 |
Gm50136 |
predicted gene, 50136 |
33024 |
0.17 |
chr3_131371095_131371256 | 2.75 |
Gm43116 |
predicted gene 43116 |
10619 |
0.19 |
chr5_113041682_113041833 | 2.74 |
Gm22740 |
predicted gene, 22740 |
2387 |
0.2 |
chr13_80885021_80885448 | 2.73 |
1700023H06Rik |
RIKEN cDNA 1700023H06 gene |
290 |
0.8 |
chr9_121902284_121902463 | 2.72 |
Ackr2 |
atypical chemokine receptor 2 |
3791 |
0.11 |
chr3_81659831_81660001 | 2.72 |
Gm43346 |
predicted gene 43346 |
61760 |
0.13 |
chr2_115736424_115736575 | 2.72 |
Mir1951 |
microRNA 1951 |
97774 |
0.08 |
chr2_155386566_155386746 | 2.70 |
Trp53inp2 |
transformation related protein 53 inducible nuclear protein 2 |
4454 |
0.15 |
chr2_117776187_117776382 | 2.69 |
Gm28183 |
predicted gene 28183 |
27380 |
0.18 |
chr12_76009151_76009311 | 2.69 |
Syne2 |
spectrin repeat containing, nuclear envelope 2 |
13069 |
0.25 |
chr12_76311349_76311507 | 2.68 |
Mthfd1 |
methylenetetrahydrofolate dehydrogenase (NADP+ dependent), methenyltetrahydrofolate cyclohydrolase, formyltetrahydrofolate synthase |
4362 |
0.12 |
chr8_89311386_89311545 | 2.67 |
Gm5356 |
predicted pseudogene 5356 |
123905 |
0.06 |
chr3_98024312_98024666 | 2.67 |
Gm42819 |
predicted gene 42819 |
6198 |
0.19 |
chr13_36606833_36607007 | 2.65 |
Gm46409 |
predicted gene, 46409 |
5896 |
0.16 |
chr4_55732105_55732256 | 2.64 |
Gm12506 |
predicted gene 12506 |
127031 |
0.05 |
chr4_65548543_65548702 | 2.64 |
Trim32 |
tripartite motif-containing 32 |
56364 |
0.18 |
chr11_109502246_109502399 | 2.62 |
Gm22378 |
predicted gene, 22378 |
2498 |
0.21 |
chr18_10904539_10904690 | 2.62 |
Gm7575 |
predicted gene 7575 |
24270 |
0.17 |
chr1_184536525_184536721 | 2.62 |
1700112H15Rik |
RIKEN cDNA 1700112H15 gene |
21068 |
0.17 |
chr5_45476407_45476609 | 2.62 |
Lap3 |
leucine aminopeptidase 3 |
16866 |
0.11 |
chr1_13103635_13103786 | 2.61 |
Prdm14 |
PR domain containing 14 |
23453 |
0.13 |
chr6_54008896_54009047 | 2.61 |
4921529L05Rik |
RIKEN cDNA 4921529L05 gene |
741 |
0.68 |
chr3_83002849_83003457 | 2.59 |
Fgg |
fibrinogen gamma chain |
4571 |
0.17 |
chr7_142391228_142391385 | 2.57 |
Ctsd |
cathepsin D |
3268 |
0.13 |
chr4_89485975_89486344 | 2.57 |
Gm12608 |
predicted gene 12608 |
41515 |
0.16 |
chr14_20298249_20298415 | 2.56 |
Nudt13 |
nudix (nucleoside diphosphate linked moiety X)-type motif 13 |
2170 |
0.22 |
chr18_38298080_38298261 | 2.55 |
Gm23205 |
predicted gene, 23205 |
231 |
0.82 |
chr2_38279594_38279785 | 2.55 |
Gm13556 |
predicted gene 13556 |
5618 |
0.17 |
chr12_110002868_110003036 | 2.54 |
Gm34667 |
predicted gene, 34667 |
20921 |
0.12 |
chr17_82445753_82445904 | 2.54 |
Rpsa-ps7 |
ribosomal protein SA, pseudogene 7 |
35009 |
0.2 |
chr17_32611100_32611267 | 2.54 |
Gm50038 |
predicted gene, 50038 |
8709 |
0.11 |
chr3_123446764_123446921 | 2.53 |
Prss12 |
protease, serine 12 neurotrypsin (motopsin) |
71 |
0.9 |
chr15_83076024_83076192 | 2.53 |
Serhl |
serine hydrolase-like |
13398 |
0.12 |
chr6_129350007_129350221 | 2.53 |
Clec12a |
C-type lectin domain family 12, member a |
150 |
0.93 |
chr11_72280581_72280745 | 2.52 |
n-R5s70 |
nuclear encoded rRNA 5S 70 |
353 |
0.79 |
chr11_101256227_101256400 | 2.52 |
Vps25 |
vacuolar protein sorting 25 |
2549 |
0.1 |
chr5_89033271_89033463 | 2.51 |
Slc4a4 |
solute carrier family 4 (anion exchanger), member 4 |
5275 |
0.32 |
chr5_122541967_122542146 | 2.50 |
Ift81 |
intraflagellar transport 81 |
18785 |
0.1 |
chr10_43235860_43236020 | 2.50 |
Pdss2 |
prenyl (solanesyl) diphosphate synthase, subunit 2 |
14204 |
0.17 |
chr9_96391992_96392163 | 2.49 |
Atp1b3 |
ATPase, Na+/K+ transporting, beta 3 polypeptide |
27635 |
0.14 |
chr2_84732545_84732696 | 2.49 |
Ypel4 |
yippee like 4 |
1438 |
0.2 |
chr5_18217954_18218123 | 2.49 |
Gm3527 |
predicted gene 3527 |
132310 |
0.05 |
chr2_33444417_33444586 | 2.49 |
Gm13536 |
predicted gene 13536 |
2301 |
0.24 |
chr11_19972101_19972262 | 2.48 |
Spred2 |
sprouty-related EVH1 domain containing 2 |
17611 |
0.25 |
chr3_100201640_100202182 | 2.48 |
Gdap2 |
ganglioside-induced differentiation-associated-protein 2 |
1224 |
0.52 |
chr18_3480851_3481021 | 2.48 |
Gm50089 |
predicted gene, 50089 |
3282 |
0.17 |
chr2_48766708_48766859 | 2.47 |
Gm13489 |
predicted gene 13489 |
43772 |
0.17 |
chr9_120049548_120049714 | 2.47 |
Cx3cr1 |
chemokine (C-X3-C motif) receptor 1 |
18652 |
0.08 |
chr11_109733399_109733703 | 2.47 |
Fam20a |
family with sequence similarity 20, member A |
11272 |
0.17 |
chr18_56978156_56978329 | 2.47 |
C330018D20Rik |
RIKEN cDNA C330018D20 gene |
2874 |
0.3 |
chr7_48883645_48884044 | 2.46 |
E2f8 |
E2F transcription factor 8 |
2248 |
0.2 |
chr7_113228562_113228716 | 2.45 |
Arntl |
aryl hydrocarbon receptor nuclear translocator-like |
5984 |
0.23 |
chr8_36722464_36722629 | 2.45 |
Dlc1 |
deleted in liver cancer 1 |
10508 |
0.29 |
chr1_133886464_133886645 | 2.45 |
Optc |
opticin |
14773 |
0.13 |
chr7_100996933_100997084 | 2.45 |
P2ry2 |
purinergic receptor P2Y, G-protein coupled 2 |
6879 |
0.14 |
chr2_8925120_8925327 | 2.44 |
Gm13217 |
predicted gene 13217 |
117261 |
0.07 |
chr10_82221209_82221514 | 2.43 |
Zfp938 |
zinc finger protein 938 |
19912 |
0.13 |
chr16_24083523_24083833 | 2.43 |
Gm46545 |
predicted gene, 46545 |
988 |
0.52 |
chr9_54308082_54308260 | 2.43 |
Gldnos |
gliomedin, opposite strand |
6601 |
0.2 |
chr13_20116969_20117144 | 2.43 |
Elmo1 |
engulfment and cell motility 1 |
5544 |
0.31 |
chr12_82914756_82914931 | 2.42 |
1700085C21Rik |
RIKEN cDNA 1700085C21 gene |
24312 |
0.21 |
chr9_74528700_74528872 | 2.42 |
Gm28622 |
predicted gene 28622 |
32592 |
0.18 |
chr5_138783658_138783838 | 2.41 |
Fam20c |
family with sequence similarity 20, member C |
2752 |
0.27 |
chr9_102967272_102967449 | 2.41 |
Slco2a1 |
solute carrier organic anion transporter family, member 2a1 |
21352 |
0.15 |
chr7_97211249_97211431 | 2.41 |
Usp35 |
ubiquitin specific peptidase 35 |
103685 |
0.06 |
chr2_28188507_28188690 | 2.41 |
Olfm1 |
olfactomedin 1 |
4394 |
0.26 |
chr6_39230771_39230922 | 2.40 |
Gm43479 |
predicted gene 43479 |
9268 |
0.15 |
chr10_68444437_68444605 | 2.40 |
Cabcoco1 |
ciliary associated calcium binding coiled-coil 1 |
81246 |
0.09 |
chr4_95316332_95316483 | 2.40 |
Gm29064 |
predicted gene 29064 |
86383 |
0.08 |
chr8_25040561_25040723 | 2.40 |
Htra4 |
HtrA serine peptidase 4 |
1680 |
0.25 |
chr7_67368455_67368853 | 2.39 |
Gm44668 |
predicted gene 44668 |
2326 |
0.28 |
chr4_53318322_53318484 | 2.39 |
Gm12495 |
predicted gene 12495 |
10177 |
0.2 |
chr1_151245234_151245414 | 2.38 |
Gm24402 |
predicted gene, 24402 |
15590 |
0.13 |
chr16_32645465_32645635 | 2.37 |
Tnk2 |
tyrosine kinase, non-receptor, 2 |
591 |
0.68 |
chr13_118829008_118829159 | 2.37 |
Gm47335 |
predicted gene, 47335 |
29331 |
0.22 |
chr8_106559910_106560126 | 2.37 |
Gm10073 |
predicted pseudogene 10073 |
13332 |
0.16 |
chr15_35268847_35269014 | 2.37 |
Osr2 |
odd-skipped related 2 |
27168 |
0.17 |
chr5_17880008_17880159 | 2.36 |
Cd36 |
CD36 molecule |
8664 |
0.3 |
chr8_11249894_11250051 | 2.36 |
Col4a1 |
collagen, type IV, alpha 1 |
4367 |
0.21 |
chr10_24777725_24777876 | 2.36 |
Enpp3 |
ectonucleotide pyrophosphatase/phosphodiesterase 3 |
7205 |
0.23 |
chr14_46143429_46143580 | 2.36 |
Ubb-ps |
ubiquitin B, pseudogene |
59376 |
0.11 |
chr13_111992176_111992346 | 2.35 |
Gm15322 |
predicted gene 15322 |
795 |
0.65 |
chrX_129698555_129698713 | 2.35 |
Diaph2 |
diaphanous related formin 2 |
51108 |
0.17 |
chr10_128961226_128961428 | 2.35 |
Mettl7b |
methyltransferase like 7B |
339 |
0.74 |
chr15_77251769_77252001 | 2.35 |
Rbfox2 |
RNA binding protein, fox-1 homolog (C. elegans) 2 |
6299 |
0.17 |
chr8_47652783_47652989 | 2.34 |
Gm8623 |
predicted gene 8623 |
20122 |
0.1 |
chr1_125470966_125471117 | 2.34 |
Gm28706 |
predicted gene 28706 |
26474 |
0.2 |
chr8_45071090_45071241 | 2.34 |
Mtnr1a |
melatonin receptor 1A |
1791 |
0.29 |
chr7_66141417_66141570 | 2.33 |
Gm18988 |
predicted gene, 18988 |
13794 |
0.12 |
chr3_132863960_132864140 | 2.33 |
Gm29811 |
predicted gene, 29811 |
14546 |
0.14 |
chr1_121290030_121290210 | 2.31 |
Gm38283 |
predicted gene, 38283 |
10711 |
0.17 |
chrX_70793466_70793617 | 2.31 |
Gm8410 |
predicted gene 8410 |
22674 |
0.21 |
chr8_79683107_79683271 | 2.30 |
Tpd52-ps |
tumor protein D52, pseudogene |
2383 |
0.21 |
chr3_85819447_85819620 | 2.30 |
Fam160a1 |
family with sequence similarity 160, member A1 |
2242 |
0.29 |
chr1_44142851_44143013 | 2.30 |
Ercc5 |
excision repair cross-complementing rodent repair deficiency, complementation group 5 |
4812 |
0.15 |
chr18_39196691_39196865 | 2.30 |
Arhgap26 |
Rho GTPase activating protein 26 |
30590 |
0.22 |
chr9_30448539_30448744 | 2.30 |
Snx19 |
sorting nexin 19 |
12784 |
0.19 |
chr12_28905051_28905477 | 2.29 |
Gm31508 |
predicted gene, 31508 |
4965 |
0.21 |
chr2_71763129_71763284 | 2.29 |
Gm13739 |
predicted gene 13739 |
439 |
0.76 |
chr13_97175811_97175980 | 2.29 |
Gfm2 |
G elongation factor, mitochondrial 2 |
4446 |
0.17 |
chr4_115519219_115519397 | 2.29 |
Cyp4a10 |
cytochrome P450, family 4, subfamily a, polypeptide 10 |
1020 |
0.41 |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
1.1 | 3.4 | GO:0006556 | S-adenosylmethionine biosynthetic process(GO:0006556) |
1.0 | 3.1 | GO:0010735 | positive regulation of transcription via serum response element binding(GO:0010735) |
0.9 | 6.4 | GO:0072378 | blood coagulation, fibrin clot formation(GO:0072378) |
0.9 | 2.7 | GO:0002086 | diaphragm contraction(GO:0002086) |
0.9 | 4.4 | GO:0034638 | phosphatidylcholine catabolic process(GO:0034638) |
0.8 | 2.4 | GO:0097296 | activation of cysteine-type endopeptidase activity involved in apoptotic signaling pathway(GO:0097296) |
0.8 | 2.4 | GO:0097503 | sialylation(GO:0097503) |
0.8 | 2.4 | GO:0045658 | regulation of neutrophil differentiation(GO:0045658) |
0.8 | 2.3 | GO:0007084 | mitotic nuclear envelope reassembly(GO:0007084) |
0.7 | 2.2 | GO:0032474 | otolith morphogenesis(GO:0032474) |
0.7 | 2.2 | GO:0060397 | JAK-STAT cascade involved in growth hormone signaling pathway(GO:0060397) |
0.7 | 2.1 | GO:0038161 | prolactin signaling pathway(GO:0038161) |
0.7 | 0.7 | GO:0055005 | ventricular cardiac myofibril assembly(GO:0055005) |
0.7 | 3.3 | GO:0006548 | histidine catabolic process(GO:0006548) imidazole-containing compound catabolic process(GO:0052805) |
0.6 | 1.9 | GO:0048294 | negative regulation of isotype switching to IgE isotypes(GO:0048294) |
0.6 | 2.5 | GO:0061113 | pancreas morphogenesis(GO:0061113) |
0.6 | 3.0 | GO:0009115 | xanthine catabolic process(GO:0009115) |
0.6 | 2.3 | GO:0089711 | L-glutamate transmembrane transport(GO:0089711) |
0.5 | 1.1 | GO:2000586 | regulation of platelet-derived growth factor receptor-beta signaling pathway(GO:2000586) negative regulation of platelet-derived growth factor receptor-beta signaling pathway(GO:2000587) |
0.5 | 2.2 | GO:0006651 | diacylglycerol biosynthetic process(GO:0006651) |
0.5 | 2.6 | GO:0014816 | skeletal muscle satellite cell differentiation(GO:0014816) |
0.5 | 3.6 | GO:0090232 | positive regulation of spindle checkpoint(GO:0090232) |
0.5 | 2.0 | GO:0038165 | oncostatin-M-mediated signaling pathway(GO:0038165) |
0.5 | 3.0 | GO:0051918 | negative regulation of fibrinolysis(GO:0051918) |
0.5 | 1.5 | GO:1902894 | negative regulation of pri-miRNA transcription from RNA polymerase II promoter(GO:1902894) |
0.5 | 1.0 | GO:0014878 | response to electrical stimulus involved in regulation of muscle adaptation(GO:0014878) |
0.5 | 2.4 | GO:0032020 | ISG15-protein conjugation(GO:0032020) |
0.5 | 1.4 | GO:2000321 | positive regulation of T-helper 17 cell differentiation(GO:2000321) |
0.5 | 1.4 | GO:0007525 | somatic muscle development(GO:0007525) |
0.5 | 2.3 | GO:0010612 | regulation of cardiac muscle adaptation(GO:0010612) regulation of cardiac muscle hypertrophy in response to stress(GO:1903242) |
0.5 | 1.8 | GO:2000065 | negative regulation of aldosterone metabolic process(GO:0032345) negative regulation of aldosterone biosynthetic process(GO:0032348) negative regulation of cortisol biosynthetic process(GO:2000065) |
0.5 | 1.4 | GO:0015888 | thiamine transport(GO:0015888) |
0.5 | 0.5 | GO:0014858 | positive regulation of skeletal muscle cell proliferation(GO:0014858) |
0.4 | 1.3 | GO:0003431 | growth plate cartilage chondrocyte development(GO:0003431) |
0.4 | 0.4 | GO:1903975 | regulation of glial cell migration(GO:1903975) |
0.4 | 5.7 | GO:0097094 | craniofacial suture morphogenesis(GO:0097094) |
0.4 | 1.3 | GO:0060300 | regulation of cytokine activity(GO:0060300) |
0.4 | 1.3 | GO:0090038 | negative regulation of protein kinase C signaling(GO:0090038) |
0.4 | 3.0 | GO:1902018 | negative regulation of cilium assembly(GO:1902018) |
0.4 | 0.9 | GO:0021775 | smoothened signaling pathway involved in ventral spinal cord interneuron specification(GO:0021775) smoothened signaling pathway involved in spinal cord motor neuron cell fate specification(GO:0021776) |
0.4 | 1.3 | GO:0034499 | late endosome to Golgi transport(GO:0034499) |
0.4 | 1.7 | GO:0002445 | type IIa hypersensitivity(GO:0001794) regulation of type IIa hypersensitivity(GO:0001796) positive regulation of type IIa hypersensitivity(GO:0001798) type II hypersensitivity(GO:0002445) regulation of type II hypersensitivity(GO:0002892) positive regulation of type II hypersensitivity(GO:0002894) |
0.4 | 0.9 | GO:0002019 | regulation of renal output by angiotensin(GO:0002019) |
0.4 | 1.3 | GO:0016259 | selenocysteine metabolic process(GO:0016259) |
0.4 | 1.3 | GO:0071879 | positive regulation of adrenergic receptor signaling pathway(GO:0071879) |
0.4 | 3.4 | GO:0032000 | positive regulation of fatty acid beta-oxidation(GO:0032000) |
0.4 | 0.8 | GO:1901492 | positive regulation of lymphangiogenesis(GO:1901492) |
0.4 | 1.3 | GO:0038028 | insulin receptor signaling pathway via phosphatidylinositol 3-kinase(GO:0038028) |
0.4 | 1.2 | GO:0060971 | embryonic heart tube left/right pattern formation(GO:0060971) |
0.4 | 1.2 | GO:0015766 | disaccharide transport(GO:0015766) sucrose transport(GO:0015770) oligosaccharide transport(GO:0015772) |
0.4 | 1.2 | GO:0006106 | fumarate metabolic process(GO:0006106) |
0.4 | 1.2 | GO:1902202 | regulation of hepatocyte growth factor receptor signaling pathway(GO:1902202) |
0.4 | 2.4 | GO:1900028 | negative regulation of ruffle assembly(GO:1900028) |
0.4 | 1.2 | GO:0090292 | nuclear matrix organization(GO:0043578) nuclear matrix anchoring at nuclear membrane(GO:0090292) |
0.4 | 2.0 | GO:0071476 | cellular hypotonic response(GO:0071476) |
0.4 | 1.9 | GO:0034154 | toll-like receptor 7 signaling pathway(GO:0034154) |
0.4 | 0.8 | GO:2000651 | positive regulation of sodium ion transmembrane transporter activity(GO:2000651) |
0.4 | 1.2 | GO:0006624 | vacuolar protein processing(GO:0006624) |
0.4 | 1.2 | GO:0061091 | regulation of phospholipid translocation(GO:0061091) positive regulation of phospholipid translocation(GO:0061092) |
0.4 | 1.1 | GO:1990705 | cholangiocyte proliferation(GO:1990705) |
0.4 | 1.5 | GO:0032898 | neurotrophin production(GO:0032898) |
0.4 | 3.3 | GO:0001867 | complement activation, lectin pathway(GO:0001867) |
0.4 | 1.8 | GO:2000392 | regulation of lamellipodium morphogenesis(GO:2000392) |
0.4 | 1.1 | GO:0016480 | negative regulation of transcription from RNA polymerase III promoter(GO:0016480) |
0.4 | 0.4 | GO:0060154 | cellular process regulating host cell cycle in response to virus(GO:0060154) |
0.4 | 3.9 | GO:0071285 | cellular response to lithium ion(GO:0071285) |
0.4 | 1.1 | GO:0034476 | U1 snRNA 3'-end processing(GO:0034473) U5 snRNA 3'-end processing(GO:0034476) |
0.4 | 1.1 | GO:0046439 | cysteine catabolic process(GO:0009093) L-cysteine catabolic process(GO:0019448) L-cysteine metabolic process(GO:0046439) |
0.4 | 2.8 | GO:0006527 | arginine catabolic process(GO:0006527) |
0.4 | 3.2 | GO:0048199 | vesicle targeting, to, from or within Golgi(GO:0048199) |
0.3 | 0.3 | GO:0061502 | early endosome to recycling endosome transport(GO:0061502) |
0.3 | 1.7 | GO:2001286 | regulation of caveolin-mediated endocytosis(GO:2001286) |
0.3 | 1.7 | GO:0002291 | T cell activation via T cell receptor contact with antigen bound to MHC molecule on antigen presenting cell(GO:0002291) |
0.3 | 1.7 | GO:0019695 | choline metabolic process(GO:0019695) |
0.3 | 1.0 | GO:0035441 | cell migration involved in vasculogenesis(GO:0035441) |
0.3 | 1.3 | GO:0023041 | neuronal signal transduction(GO:0023041) |
0.3 | 1.0 | GO:0036444 | calcium ion transmembrane import into mitochondrion(GO:0036444) |
0.3 | 0.7 | GO:0009051 | pentose-phosphate shunt, oxidative branch(GO:0009051) |
0.3 | 0.3 | GO:2000252 | regulation of eating behavior(GO:1903998) negative regulation of eating behavior(GO:1903999) negative regulation of feeding behavior(GO:2000252) |
0.3 | 1.3 | GO:0045629 | negative regulation of T-helper 2 cell differentiation(GO:0045629) |
0.3 | 1.0 | GO:0016344 | meiotic chromosome movement towards spindle pole(GO:0016344) |
0.3 | 0.3 | GO:2000696 | regulation of epithelial cell differentiation involved in kidney development(GO:2000696) |
0.3 | 0.3 | GO:1903525 | regulation of membrane tubulation(GO:1903525) |
0.3 | 1.0 | GO:0010760 | negative regulation of macrophage chemotaxis(GO:0010760) |
0.3 | 1.3 | GO:2000659 | regulation of interleukin-1-mediated signaling pathway(GO:2000659) |
0.3 | 1.9 | GO:0051547 | regulation of keratinocyte migration(GO:0051547) positive regulation of keratinocyte migration(GO:0051549) |
0.3 | 0.9 | GO:0000707 | meiotic DNA recombinase assembly(GO:0000707) |
0.3 | 0.6 | GO:0070384 | Harderian gland development(GO:0070384) |
0.3 | 1.2 | GO:0010727 | negative regulation of hydrogen peroxide metabolic process(GO:0010727) |
0.3 | 1.5 | GO:0071918 | urea transmembrane transport(GO:0071918) |
0.3 | 1.5 | GO:0007217 | tachykinin receptor signaling pathway(GO:0007217) |
0.3 | 0.6 | GO:1903223 | positive regulation of oxidative stress-induced neuron death(GO:1903223) |
0.3 | 0.9 | GO:0060137 | maternal process involved in parturition(GO:0060137) |
0.3 | 0.9 | GO:0033031 | positive regulation of neutrophil apoptotic process(GO:0033031) |
0.3 | 1.2 | GO:0001907 | killing by symbiont of host cells(GO:0001907) disruption by symbiont of host cell(GO:0044004) |
0.3 | 0.9 | GO:0019254 | carnitine metabolic process, CoA-linked(GO:0019254) |
0.3 | 2.7 | GO:0070257 | positive regulation of mucus secretion(GO:0070257) |
0.3 | 2.1 | GO:0006851 | mitochondrial calcium ion transport(GO:0006851) |
0.3 | 0.9 | GO:0042360 | vitamin E metabolic process(GO:0042360) |
0.3 | 1.8 | GO:0070544 | histone H3-K36 demethylation(GO:0070544) |
0.3 | 0.3 | GO:0070343 | white fat cell proliferation(GO:0070343) regulation of white fat cell proliferation(GO:0070350) |
0.3 | 3.8 | GO:0000188 | inactivation of MAPK activity(GO:0000188) |
0.3 | 1.8 | GO:0033211 | adiponectin-activated signaling pathway(GO:0033211) |
0.3 | 0.3 | GO:2000507 | positive regulation of energy homeostasis(GO:2000507) |
0.3 | 0.3 | GO:0070498 | interleukin-1-mediated signaling pathway(GO:0070498) |
0.3 | 0.9 | GO:0035995 | detection of muscle stretch(GO:0035995) |
0.3 | 2.0 | GO:2000480 | negative regulation of cAMP-dependent protein kinase activity(GO:2000480) |
0.3 | 0.6 | GO:2000346 | negative regulation of hepatocyte proliferation(GO:2000346) |
0.3 | 0.6 | GO:2000271 | positive regulation of fibroblast apoptotic process(GO:2000271) |
0.3 | 0.6 | GO:0042851 | L-alanine metabolic process(GO:0042851) |
0.3 | 0.9 | GO:0000820 | regulation of glutamine family amino acid metabolic process(GO:0000820) |
0.3 | 1.7 | GO:0050861 | positive regulation of B cell receptor signaling pathway(GO:0050861) |
0.3 | 1.7 | GO:0061304 | retinal blood vessel morphogenesis(GO:0061304) |
0.3 | 0.9 | GO:0071896 | protein localization to adherens junction(GO:0071896) |
0.3 | 2.0 | GO:0015838 | amino-acid betaine transport(GO:0015838) |
0.3 | 2.0 | GO:0043951 | negative regulation of cAMP-mediated signaling(GO:0043951) |
0.3 | 2.3 | GO:0010216 | maintenance of DNA methylation(GO:0010216) |
0.3 | 0.9 | GO:2000504 | positive regulation of blood vessel remodeling(GO:2000504) |
0.3 | 1.1 | GO:0050703 | interleukin-1 alpha secretion(GO:0050703) |
0.3 | 0.3 | GO:0098902 | regulation of membrane depolarization during action potential(GO:0098902) |
0.3 | 0.8 | GO:0030242 | pexophagy(GO:0030242) |
0.3 | 0.3 | GO:0016078 | tRNA catabolic process(GO:0016078) |
0.3 | 1.4 | GO:0090286 | cytoskeletal anchoring at nuclear membrane(GO:0090286) |
0.3 | 0.3 | GO:0048289 | isotype switching to IgE isotypes(GO:0048289) regulation of isotype switching to IgE isotypes(GO:0048293) |
0.3 | 1.9 | GO:1904754 | positive regulation of vascular associated smooth muscle cell migration(GO:1904754) |
0.3 | 1.1 | GO:0032929 | negative regulation of superoxide anion generation(GO:0032929) |
0.3 | 2.7 | GO:0070050 | neuron cellular homeostasis(GO:0070050) |
0.3 | 0.8 | GO:0000379 | tRNA-type intron splice site recognition and cleavage(GO:0000379) |
0.3 | 0.5 | GO:0051344 | negative regulation of cyclic-nucleotide phosphodiesterase activity(GO:0051344) |
0.3 | 0.8 | GO:2000721 | positive regulation of transcription from RNA polymerase II promoter involved in smooth muscle cell differentiation(GO:2000721) |
0.3 | 0.3 | GO:0051639 | actin filament network formation(GO:0051639) |
0.3 | 1.6 | GO:0032464 | positive regulation of protein homooligomerization(GO:0032464) |
0.3 | 0.5 | GO:1902075 | cellular response to salt(GO:1902075) |
0.3 | 1.3 | GO:0045409 | negative regulation of interleukin-6 biosynthetic process(GO:0045409) |
0.3 | 1.1 | GO:0035522 | monoubiquitinated histone deubiquitination(GO:0035521) monoubiquitinated histone H2A deubiquitination(GO:0035522) |
0.3 | 1.6 | GO:0030913 | paranodal junction assembly(GO:0030913) |
0.3 | 0.8 | GO:0018197 | peptidyl-aspartic acid modification(GO:0018197) |
0.3 | 0.5 | GO:0044375 | regulation of peroxisome size(GO:0044375) |
0.3 | 0.8 | GO:0072282 | metanephric nephron tubule morphogenesis(GO:0072282) |
0.3 | 0.8 | GO:1903286 | regulation of potassium ion import(GO:1903286) positive regulation of potassium ion import(GO:1903288) |
0.3 | 0.5 | GO:0003273 | cell migration involved in endocardial cushion formation(GO:0003273) |
0.3 | 0.8 | GO:0051665 | membrane raft localization(GO:0051665) |
0.3 | 1.3 | GO:0006686 | sphingomyelin biosynthetic process(GO:0006686) |
0.3 | 3.1 | GO:2000811 | negative regulation of anoikis(GO:2000811) |
0.3 | 0.8 | GO:0006741 | NADP biosynthetic process(GO:0006741) |
0.3 | 0.8 | GO:0035526 | retrograde transport, plasma membrane to Golgi(GO:0035526) |
0.3 | 1.3 | GO:0046070 | dGTP metabolic process(GO:0046070) |
0.3 | 0.5 | GO:1902548 | negative regulation of cellular response to vascular endothelial growth factor stimulus(GO:1902548) |
0.3 | 0.8 | GO:0051794 | regulation of catagen(GO:0051794) |
0.3 | 1.6 | GO:0086073 | bundle of His cell-Purkinje myocyte adhesion involved in cell communication(GO:0086073) |
0.3 | 3.1 | GO:1903392 | negative regulation of adherens junction organization(GO:1903392) |
0.3 | 0.5 | GO:0097195 | pilomotor reflex(GO:0097195) |
0.3 | 1.0 | GO:0019482 | beta-alanine metabolic process(GO:0019482) |
0.3 | 0.8 | GO:0071895 | odontoblast differentiation(GO:0071895) |
0.3 | 0.3 | GO:0036092 | phosphatidylinositol-3-phosphate biosynthetic process(GO:0036092) |
0.3 | 1.5 | GO:0035356 | cellular triglyceride homeostasis(GO:0035356) |
0.3 | 0.5 | GO:0007571 | age-dependent response to oxidative stress(GO:0001306) age-dependent general metabolic decline(GO:0007571) |
0.3 | 0.5 | GO:0009233 | menaquinone metabolic process(GO:0009233) |
0.3 | 0.3 | GO:0021555 | midbrain-hindbrain boundary morphogenesis(GO:0021555) |
0.3 | 1.0 | GO:0001923 | B-1 B cell differentiation(GO:0001923) |
0.3 | 1.0 | GO:0070561 | vitamin D receptor signaling pathway(GO:0070561) |
0.3 | 1.0 | GO:0051031 | tRNA transport(GO:0051031) |
0.3 | 0.8 | GO:0031296 | B cell costimulation(GO:0031296) |
0.2 | 0.5 | GO:0071332 | cellular response to fructose stimulus(GO:0071332) |
0.2 | 0.5 | GO:1903026 | negative regulation of RNA polymerase II regulatory region sequence-specific DNA binding(GO:1903026) |
0.2 | 1.2 | GO:0046654 | tetrahydrofolate biosynthetic process(GO:0046654) |
0.2 | 1.7 | GO:1904417 | regulation of xenophagy(GO:1904415) positive regulation of xenophagy(GO:1904417) |
0.2 | 1.7 | GO:0071578 | zinc II ion transmembrane import(GO:0071578) |
0.2 | 0.2 | GO:0002513 | tolerance induction to self antigen(GO:0002513) |
0.2 | 1.2 | GO:0072675 | osteoclast fusion(GO:0072675) |
0.2 | 0.5 | GO:1902498 | regulation of protein autoubiquitination(GO:1902498) |
0.2 | 0.7 | GO:0006768 | biotin metabolic process(GO:0006768) |
0.2 | 0.5 | GO:0035860 | glial cell-derived neurotrophic factor receptor signaling pathway(GO:0035860) |
0.2 | 2.7 | GO:0046716 | muscle cell cellular homeostasis(GO:0046716) |
0.2 | 1.0 | GO:2000667 | positive regulation of interleukin-5 secretion(GO:2000664) positive regulation of interleukin-13 secretion(GO:2000667) |
0.2 | 1.4 | GO:1901678 | iron coordination entity transport(GO:1901678) |
0.2 | 0.2 | GO:0010693 | negative regulation of alkaline phosphatase activity(GO:0010693) |
0.2 | 8.2 | GO:0007339 | binding of sperm to zona pellucida(GO:0007339) |
0.2 | 0.7 | GO:0050427 | 3'-phosphoadenosine 5'-phosphosulfate metabolic process(GO:0050427) |
0.2 | 0.5 | GO:0060018 | astrocyte fate commitment(GO:0060018) |
0.2 | 0.7 | GO:0043321 | regulation of natural killer cell degranulation(GO:0043321) |
0.2 | 1.4 | GO:0043545 | Mo-molybdopterin cofactor biosynthetic process(GO:0006777) Mo-molybdopterin cofactor metabolic process(GO:0019720) molybdopterin cofactor biosynthetic process(GO:0032324) molybdopterin cofactor metabolic process(GO:0043545) prosthetic group metabolic process(GO:0051189) |
0.2 | 1.2 | GO:0006702 | androgen biosynthetic process(GO:0006702) |
0.2 | 1.2 | GO:0006703 | estrogen biosynthetic process(GO:0006703) |
0.2 | 1.4 | GO:0060718 | chorionic trophoblast cell differentiation(GO:0060718) |
0.2 | 0.2 | GO:0040016 | embryonic cleavage(GO:0040016) |
0.2 | 1.2 | GO:0000301 | retrograde transport, vesicle recycling within Golgi(GO:0000301) |
0.2 | 0.9 | GO:0033483 | gas homeostasis(GO:0033483) |
0.2 | 0.7 | GO:0006172 | ADP biosynthetic process(GO:0006172) |
0.2 | 0.7 | GO:0003219 | cardiac right ventricle formation(GO:0003219) |
0.2 | 0.5 | GO:1903215 | negative regulation of protein targeting to mitochondrion(GO:1903215) |
0.2 | 1.1 | GO:0070345 | negative regulation of fat cell proliferation(GO:0070345) |
0.2 | 0.5 | GO:1902809 | regulation of skeletal muscle fiber differentiation(GO:1902809) |
0.2 | 0.9 | GO:0016557 | peroxisome membrane biogenesis(GO:0016557) |
0.2 | 0.9 | GO:0051661 | maintenance of centrosome location(GO:0051661) |
0.2 | 0.9 | GO:0032836 | glomerular basement membrane development(GO:0032836) |
0.2 | 3.6 | GO:0001574 | ganglioside biosynthetic process(GO:0001574) |
0.2 | 0.9 | GO:2000169 | regulation of peptidyl-cysteine S-nitrosylation(GO:2000169) |
0.2 | 0.7 | GO:0021564 | vagus nerve development(GO:0021564) |
0.2 | 0.2 | GO:0061724 | lipophagy(GO:0061724) |
0.2 | 0.7 | GO:0097680 | double-strand break repair via classical nonhomologous end joining(GO:0097680) |
0.2 | 0.7 | GO:0006295 | nucleotide-excision repair, DNA incision, 3'-to lesion(GO:0006295) |
0.2 | 1.6 | GO:0048702 | embryonic neurocranium morphogenesis(GO:0048702) |
0.2 | 2.0 | GO:0060670 | branching involved in labyrinthine layer morphogenesis(GO:0060670) |
0.2 | 0.7 | GO:0006435 | threonyl-tRNA aminoacylation(GO:0006435) |
0.2 | 0.2 | GO:0002677 | negative regulation of chronic inflammatory response(GO:0002677) |
0.2 | 0.2 | GO:0030656 | regulation of vitamin metabolic process(GO:0030656) |
0.2 | 0.4 | GO:0008611 | ether lipid biosynthetic process(GO:0008611) glycerol ether biosynthetic process(GO:0046504) cellular lipid biosynthetic process(GO:0097384) ether biosynthetic process(GO:1901503) |
0.2 | 0.4 | GO:0070460 | thyroid-stimulating hormone secretion(GO:0070460) |
0.2 | 0.7 | GO:0061470 | T follicular helper cell differentiation(GO:0061470) |
0.2 | 0.7 | GO:0016554 | cytidine to uridine editing(GO:0016554) |
0.2 | 0.9 | GO:0097048 | dendritic cell apoptotic process(GO:0097048) regulation of dendritic cell apoptotic process(GO:2000668) |
0.2 | 1.1 | GO:0046337 | phosphatidylethanolamine metabolic process(GO:0046337) |
0.2 | 0.7 | GO:0000098 | sulfur amino acid catabolic process(GO:0000098) |
0.2 | 0.2 | GO:0010958 | regulation of amino acid import(GO:0010958) |
0.2 | 1.5 | GO:0042904 | 9-cis-retinoic acid biosynthetic process(GO:0042904) 9-cis-retinoic acid metabolic process(GO:0042905) |
0.2 | 0.4 | GO:0090360 | platelet-derived growth factor production(GO:0090360) regulation of platelet-derived growth factor production(GO:0090361) |
0.2 | 0.6 | GO:0010042 | response to manganese ion(GO:0010042) |
0.2 | 0.6 | GO:0070673 | response to interleukin-18(GO:0070673) cellular response to interleukin-18(GO:0071351) |
0.2 | 0.9 | GO:0006572 | tyrosine catabolic process(GO:0006572) |
0.2 | 1.1 | GO:0016576 | histone dephosphorylation(GO:0016576) |
0.2 | 1.3 | GO:0017196 | N-terminal peptidyl-methionine acetylation(GO:0017196) |
0.2 | 0.6 | GO:0018879 | biphenyl metabolic process(GO:0018879) |
0.2 | 0.4 | GO:0060435 | bronchiole development(GO:0060435) |
0.2 | 0.6 | GO:0030208 | dermatan sulfate biosynthetic process(GO:0030208) |
0.2 | 0.6 | GO:0051890 | regulation of cardioblast differentiation(GO:0051890) |
0.2 | 0.6 | GO:0042126 | nitrate metabolic process(GO:0042126) |
0.2 | 0.6 | GO:0021603 | cranial nerve formation(GO:0021603) |
0.2 | 0.6 | GO:0034315 | regulation of Arp2/3 complex-mediated actin nucleation(GO:0034315) |
0.2 | 0.8 | GO:0003406 | retinal pigment epithelium development(GO:0003406) |
0.2 | 0.8 | GO:0007171 | activation of transmembrane receptor protein tyrosine kinase activity(GO:0007171) |
0.2 | 0.8 | GO:1902093 | positive regulation of sperm motility(GO:1902093) |
0.2 | 0.2 | GO:0032077 | positive regulation of deoxyribonuclease activity(GO:0032077) |
0.2 | 0.2 | GO:0097694 | establishment of RNA localization to telomere(GO:0097694) |
0.2 | 0.2 | GO:0036216 | response to stem cell factor(GO:0036215) cellular response to stem cell factor stimulus(GO:0036216) Kit signaling pathway(GO:0038109) |
0.2 | 1.0 | GO:0070431 | nucleotide-binding oligomerization domain containing signaling pathway(GO:0070423) nucleotide-binding oligomerization domain containing 2 signaling pathway(GO:0070431) |
0.2 | 0.4 | GO:0003221 | right ventricular cardiac muscle tissue morphogenesis(GO:0003221) |
0.2 | 0.6 | GO:0032074 | negative regulation of nuclease activity(GO:0032074) |
0.2 | 1.6 | GO:0043983 | histone H4-K12 acetylation(GO:0043983) |
0.2 | 0.4 | GO:0071233 | response to leucine(GO:0043201) cellular response to leucine(GO:0071233) |
0.2 | 0.6 | GO:0002432 | granuloma formation(GO:0002432) |
0.2 | 0.6 | GO:0000715 | nucleotide-excision repair, DNA damage recognition(GO:0000715) |
0.2 | 0.4 | GO:0071677 | positive regulation of mononuclear cell migration(GO:0071677) |
0.2 | 0.6 | GO:2000479 | regulation of cAMP-dependent protein kinase activity(GO:2000479) |
0.2 | 1.4 | GO:0000185 | activation of MAPKKK activity(GO:0000185) |
0.2 | 0.2 | GO:0045590 | negative regulation of regulatory T cell differentiation(GO:0045590) |
0.2 | 0.8 | GO:0035701 | hematopoietic stem cell migration(GO:0035701) |
0.2 | 1.0 | GO:0015697 | quaternary ammonium group transport(GO:0015697) |
0.2 | 0.4 | GO:0030262 | cellular component disassembly involved in execution phase of apoptosis(GO:0006921) apoptotic nuclear changes(GO:0030262) |
0.2 | 0.8 | GO:0035633 | maintenance of blood-brain barrier(GO:0035633) |
0.2 | 1.0 | GO:0044336 | canonical Wnt signaling pathway involved in negative regulation of apoptotic process(GO:0044336) |
0.2 | 0.8 | GO:0010792 | DNA double-strand break processing involved in repair via single-strand annealing(GO:0010792) |
0.2 | 1.2 | GO:0090324 | negative regulation of oxidative phosphorylation(GO:0090324) |
0.2 | 0.4 | GO:0045054 | constitutive secretory pathway(GO:0045054) |
0.2 | 0.4 | GO:1901301 | regulation of cargo loading into COPII-coated vesicle(GO:1901301) |
0.2 | 3.7 | GO:0071353 | cellular response to interleukin-4(GO:0071353) |
0.2 | 0.6 | GO:0060830 | ciliary receptor clustering involved in smoothened signaling pathway(GO:0060830) |
0.2 | 0.6 | GO:0002884 | negative regulation of hypersensitivity(GO:0002884) |
0.2 | 0.4 | GO:0002025 | vasodilation by norepinephrine-epinephrine involved in regulation of systemic arterial blood pressure(GO:0002025) |
0.2 | 0.4 | GO:0044804 | nucleophagy(GO:0044804) |
0.2 | 0.4 | GO:2001137 | positive regulation of endocytic recycling(GO:2001137) |
0.2 | 0.8 | GO:0034145 | positive regulation of toll-like receptor 4 signaling pathway(GO:0034145) |
0.2 | 0.8 | GO:0090168 | Golgi reassembly(GO:0090168) |
0.2 | 1.3 | GO:0032790 | ribosome disassembly(GO:0032790) |
0.2 | 0.4 | GO:0061055 | myotome development(GO:0061055) |
0.2 | 0.2 | GO:0097067 | cellular response to thyroid hormone stimulus(GO:0097067) |
0.2 | 0.4 | GO:0033058 | directional locomotion(GO:0033058) |
0.2 | 0.2 | GO:0048318 | axial mesoderm development(GO:0048318) |
0.2 | 0.2 | GO:0042536 | negative regulation of tumor necrosis factor biosynthetic process(GO:0042536) |
0.2 | 0.9 | GO:0044341 | sodium-dependent phosphate transport(GO:0044341) |
0.2 | 0.6 | GO:0006842 | tricarboxylic acid transport(GO:0006842) citrate transport(GO:0015746) |
0.2 | 0.6 | GO:0006546 | glycine catabolic process(GO:0006546) glycine decarboxylation via glycine cleavage system(GO:0019464) |
0.2 | 0.6 | GO:0035694 | mitochondrial protein catabolic process(GO:0035694) |
0.2 | 2.4 | GO:0030502 | negative regulation of bone mineralization(GO:0030502) |
0.2 | 2.2 | GO:0042359 | vitamin D metabolic process(GO:0042359) |
0.2 | 0.6 | GO:1903818 | positive regulation of delayed rectifier potassium channel activity(GO:1902261) positive regulation of voltage-gated potassium channel activity(GO:1903818) |
0.2 | 0.4 | GO:0035905 | ascending aorta development(GO:0035905) ascending aorta morphogenesis(GO:0035910) |
0.2 | 0.9 | GO:0006776 | vitamin A metabolic process(GO:0006776) |
0.2 | 0.4 | GO:0035553 | oxidative RNA demethylation(GO:0035513) oxidative single-stranded RNA demethylation(GO:0035553) |
0.2 | 0.6 | GO:1903774 | positive regulation of viral budding via host ESCRT complex(GO:1903774) |
0.2 | 0.7 | GO:0060164 | regulation of timing of neuron differentiation(GO:0060164) |
0.2 | 0.6 | GO:0045448 | regulation of mitotic cell cycle, embryonic(GO:0009794) mitotic cell cycle, embryonic(GO:0045448) |
0.2 | 3.7 | GO:0055090 | acylglycerol homeostasis(GO:0055090) triglyceride homeostasis(GO:0070328) |
0.2 | 0.4 | GO:0050746 | regulation of lipoprotein metabolic process(GO:0050746) positive regulation of lipoprotein metabolic process(GO:0050747) regulation of protein lipidation(GO:1903059) positive regulation of protein lipidation(GO:1903061) |
0.2 | 0.2 | GO:2000705 | regulation of dense core granule biogenesis(GO:2000705) |
0.2 | 0.5 | GO:0042723 | thiamine metabolic process(GO:0006772) thiamine-containing compound metabolic process(GO:0042723) |
0.2 | 0.4 | GO:0030997 | regulation of centriole-centriole cohesion(GO:0030997) |
0.2 | 0.9 | GO:0042760 | very long-chain fatty acid catabolic process(GO:0042760) |
0.2 | 1.3 | GO:0045717 | negative regulation of fatty acid biosynthetic process(GO:0045717) |
0.2 | 0.7 | GO:0003241 | growth involved in heart morphogenesis(GO:0003241) |
0.2 | 0.4 | GO:0090154 | positive regulation of sphingolipid biosynthetic process(GO:0090154) positive regulation of ceramide biosynthetic process(GO:2000304) |
0.2 | 0.7 | GO:0018916 | nitrobenzene metabolic process(GO:0018916) |
0.2 | 2.7 | GO:0051205 | protein insertion into membrane(GO:0051205) |
0.2 | 0.2 | GO:1900122 | positive regulation of receptor binding(GO:1900122) |
0.2 | 1.1 | GO:0035735 | intraciliary transport involved in cilium morphogenesis(GO:0035735) |
0.2 | 1.1 | GO:0045922 | negative regulation of fatty acid metabolic process(GO:0045922) |
0.2 | 0.7 | GO:0048312 | intracellular distribution of mitochondria(GO:0048312) |
0.2 | 1.2 | GO:0022027 | interkinetic nuclear migration(GO:0022027) |
0.2 | 1.2 | GO:2000254 | regulation of male germ cell proliferation(GO:2000254) |
0.2 | 0.5 | GO:0050955 | thermoception(GO:0050955) |
0.2 | 0.2 | GO:0030950 | establishment or maintenance of actin cytoskeleton polarity(GO:0030950) |
0.2 | 1.0 | GO:0043653 | mitochondrial fragmentation involved in apoptotic process(GO:0043653) |
0.2 | 0.9 | GO:0006501 | C-terminal protein lipidation(GO:0006501) |
0.2 | 1.2 | GO:0018904 | ether metabolic process(GO:0018904) |
0.2 | 0.2 | GO:0006667 | sphinganine metabolic process(GO:0006667) |
0.2 | 0.3 | GO:0034140 | negative regulation of toll-like receptor 3 signaling pathway(GO:0034140) |
0.2 | 0.9 | GO:0006348 | chromatin silencing at telomere(GO:0006348) |
0.2 | 0.5 | GO:0060060 | post-embryonic retina morphogenesis in camera-type eye(GO:0060060) |
0.2 | 1.0 | GO:0019852 | L-ascorbic acid metabolic process(GO:0019852) |
0.2 | 0.2 | GO:0043309 | regulation of eosinophil degranulation(GO:0043309) |
0.2 | 0.5 | GO:2001271 | negative regulation of cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:2001271) |
0.2 | 2.5 | GO:0015936 | coenzyme A metabolic process(GO:0015936) |
0.2 | 0.5 | GO:1990036 | calcium ion import into sarcoplasmic reticulum(GO:1990036) |
0.2 | 2.8 | GO:0030212 | hyaluronan metabolic process(GO:0030212) |
0.2 | 0.5 | GO:0043116 | negative regulation of vascular permeability(GO:0043116) |
0.2 | 0.5 | GO:1900113 | negative regulation of histone H3-K9 trimethylation(GO:1900113) |
0.2 | 0.3 | GO:0042117 | monocyte activation(GO:0042117) |
0.2 | 1.0 | GO:0060644 | mammary gland epithelial cell differentiation(GO:0060644) |
0.2 | 0.2 | GO:1903334 | positive regulation of protein folding(GO:1903334) |
0.2 | 0.5 | GO:0051799 | negative regulation of hair follicle development(GO:0051799) |
0.2 | 0.5 | GO:0045908 | negative regulation of vasodilation(GO:0045908) |
0.2 | 0.8 | GO:0090385 | phagosome-lysosome fusion(GO:0090385) |
0.2 | 0.7 | GO:0048069 | eye pigmentation(GO:0048069) |
0.2 | 0.5 | GO:0021636 | trigeminal nerve morphogenesis(GO:0021636) trigeminal nerve structural organization(GO:0021637) |
0.2 | 0.3 | GO:0072566 | chemokine (C-X-C motif) ligand 1 production(GO:0072566) regulation of chemokine (C-X-C motif) ligand 1 production(GO:2000338) |
0.2 | 0.5 | GO:0051917 | regulation of fibrinolysis(GO:0051917) |
0.2 | 0.6 | GO:0060155 | platelet dense granule organization(GO:0060155) |
0.2 | 0.2 | GO:0002667 | lymphocyte anergy(GO:0002249) regulation of T cell anergy(GO:0002667) T cell anergy(GO:0002870) regulation of lymphocyte anergy(GO:0002911) |
0.2 | 0.2 | GO:0045472 | response to ether(GO:0045472) |
0.2 | 1.0 | GO:0006384 | transcription initiation from RNA polymerase III promoter(GO:0006384) |
0.2 | 0.8 | GO:0009446 | putrescine biosynthetic process(GO:0009446) |
0.2 | 0.3 | GO:1903599 | positive regulation of mitophagy(GO:1903599) |
0.2 | 1.1 | GO:0071318 | cellular response to ATP(GO:0071318) |
0.2 | 0.6 | GO:0000711 | meiotic DNA repair synthesis(GO:0000711) |
0.2 | 0.3 | GO:0090271 | positive regulation of fibroblast growth factor production(GO:0090271) |
0.2 | 0.5 | GO:2000503 | positive regulation of natural killer cell chemotaxis(GO:2000503) |
0.2 | 0.3 | GO:0070949 | regulation of neutrophil mediated cytotoxicity(GO:0070948) regulation of neutrophil mediated killing of symbiont cell(GO:0070949) |
0.2 | 1.4 | GO:0001675 | acrosome assembly(GO:0001675) |
0.2 | 0.5 | GO:0031666 | positive regulation of lipopolysaccharide-mediated signaling pathway(GO:0031666) |
0.2 | 0.3 | GO:0043320 | natural killer cell degranulation(GO:0043320) |
0.2 | 0.5 | GO:0042271 | susceptibility to natural killer cell mediated cytotoxicity(GO:0042271) |
0.2 | 0.9 | GO:0042635 | positive regulation of hair cycle(GO:0042635) positive regulation of hair follicle development(GO:0051798) |
0.2 | 0.3 | GO:0051121 | hepoxilin metabolic process(GO:0051121) hepoxilin biosynthetic process(GO:0051122) |
0.2 | 1.8 | GO:0051601 | exocyst localization(GO:0051601) |
0.2 | 0.3 | GO:0035461 | vitamin transmembrane transport(GO:0035461) |
0.2 | 0.2 | GO:2000828 | regulation of parathyroid hormone secretion(GO:2000828) |
0.2 | 0.6 | GO:0002051 | osteoblast fate commitment(GO:0002051) |
0.2 | 0.6 | GO:0035087 | siRNA loading onto RISC involved in RNA interference(GO:0035087) |
0.2 | 0.3 | GO:0060480 | lung goblet cell differentiation(GO:0060480) |
0.2 | 0.5 | GO:0034421 | post-translational protein acetylation(GO:0034421) |
0.1 | 0.6 | GO:0010626 | negative regulation of Schwann cell proliferation(GO:0010626) |
0.1 | 0.3 | GO:0071139 | resolution of recombination intermediates(GO:0071139) |
0.1 | 0.6 | GO:0033762 | response to glucagon(GO:0033762) |
0.1 | 0.7 | GO:2001214 | positive regulation of vasculogenesis(GO:2001214) |
0.1 | 0.9 | GO:0001778 | plasma membrane repair(GO:0001778) |
0.1 | 0.9 | GO:0009083 | branched-chain amino acid catabolic process(GO:0009083) |
0.1 | 1.0 | GO:0060394 | negative regulation of pathway-restricted SMAD protein phosphorylation(GO:0060394) |
0.1 | 0.3 | GO:0002378 | immunoglobulin biosynthetic process(GO:0002378) |
0.1 | 1.0 | GO:0043508 | negative regulation of JUN kinase activity(GO:0043508) |
0.1 | 0.6 | GO:0051365 | cellular response to potassium ion starvation(GO:0051365) |
0.1 | 0.3 | GO:0001560 | regulation of cell growth by extracellular stimulus(GO:0001560) |
0.1 | 0.4 | GO:0015889 | cobalamin transport(GO:0015889) |
0.1 | 0.4 | GO:0040031 | snRNA modification(GO:0040031) |
0.1 | 0.3 | GO:0021910 | smoothened signaling pathway involved in ventral spinal cord patterning(GO:0021910) |
0.1 | 0.6 | GO:0009211 | pyrimidine deoxyribonucleoside triphosphate metabolic process(GO:0009211) |
0.1 | 0.1 | GO:0060948 | cardiac vascular smooth muscle cell development(GO:0060948) |
0.1 | 0.1 | GO:0032876 | negative regulation of DNA endoreduplication(GO:0032876) |
0.1 | 1.4 | GO:0072010 | renal filtration cell differentiation(GO:0061318) glomerular epithelium development(GO:0072010) glomerular visceral epithelial cell differentiation(GO:0072112) glomerular epithelial cell differentiation(GO:0072311) |
0.1 | 0.4 | GO:2000019 | negative regulation of male gonad development(GO:2000019) |
0.1 | 0.4 | GO:0045332 | phospholipid translocation(GO:0045332) |
0.1 | 0.3 | GO:0036023 | limb joint morphogenesis(GO:0036022) embryonic skeletal limb joint morphogenesis(GO:0036023) |
0.1 | 0.1 | GO:0060693 | regulation of branching involved in salivary gland morphogenesis(GO:0060693) |
0.1 | 0.1 | GO:0034204 | lipid translocation(GO:0034204) |
0.1 | 1.4 | GO:0061000 | negative regulation of dendritic spine development(GO:0061000) |
0.1 | 0.6 | GO:0010571 | positive regulation of nuclear cell cycle DNA replication(GO:0010571) |
0.1 | 0.7 | GO:0038089 | positive regulation of cell migration by vascular endothelial growth factor signaling pathway(GO:0038089) |
0.1 | 0.3 | GO:0045080 | positive regulation of chemokine biosynthetic process(GO:0045080) |
0.1 | 0.1 | GO:2000974 | negative regulation of pro-B cell differentiation(GO:2000974) |
0.1 | 0.3 | GO:0060282 | positive regulation of oocyte development(GO:0060282) |
0.1 | 0.1 | GO:0035511 | oxidative DNA demethylation(GO:0035511) |
0.1 | 0.4 | GO:1902512 | positive regulation of apoptotic DNA fragmentation(GO:1902512) positive regulation of DNA catabolic process(GO:1903626) |
0.1 | 0.4 | GO:0071501 | response to sterol depletion(GO:0006991) SREBP signaling pathway(GO:0032933) cellular response to sterol depletion(GO:0071501) |
0.1 | 0.3 | GO:0015808 | L-alanine transport(GO:0015808) |
0.1 | 0.1 | GO:0045988 | negative regulation of striated muscle contraction(GO:0045988) |
0.1 | 0.1 | GO:0032055 | negative regulation of translation in response to stress(GO:0032055) |
0.1 | 0.4 | GO:0009298 | GDP-mannose biosynthetic process(GO:0009298) |
0.1 | 0.1 | GO:0071224 | cellular response to peptidoglycan(GO:0071224) |
0.1 | 0.7 | GO:1903551 | regulation of extracellular exosome assembly(GO:1903551) |
0.1 | 0.7 | GO:0016255 | attachment of GPI anchor to protein(GO:0016255) |
0.1 | 0.3 | GO:0048807 | female genitalia morphogenesis(GO:0048807) |
0.1 | 0.7 | GO:0018401 | peptidyl-proline hydroxylation to 4-hydroxy-L-proline(GO:0018401) |
0.1 | 0.4 | GO:0033129 | positive regulation of histone phosphorylation(GO:0033129) |
0.1 | 0.7 | GO:0097011 | cellular response to granulocyte macrophage colony-stimulating factor stimulus(GO:0097011) response to granulocyte macrophage colony-stimulating factor(GO:0097012) |
0.1 | 0.9 | GO:0042790 | transcription of nuclear large rRNA transcript from RNA polymerase I promoter(GO:0042790) |
0.1 | 0.4 | GO:1904430 | negative regulation of t-circle formation(GO:1904430) |
0.1 | 0.4 | GO:0060087 | relaxation of vascular smooth muscle(GO:0060087) |
0.1 | 1.1 | GO:0008300 | isoprenoid catabolic process(GO:0008300) |
0.1 | 3.3 | GO:0030195 | negative regulation of blood coagulation(GO:0030195) negative regulation of hemostasis(GO:1900047) |
0.1 | 0.4 | GO:0035507 | regulation of myosin-light-chain-phosphatase activity(GO:0035507) |
0.1 | 0.3 | GO:0044332 | Wnt signaling pathway involved in dorsal/ventral axis specification(GO:0044332) |
0.1 | 0.3 | GO:1903232 | melanosome assembly(GO:1903232) |
0.1 | 0.8 | GO:2000676 | positive regulation of type B pancreatic cell apoptotic process(GO:2000676) |
0.1 | 0.3 | GO:0031584 | activation of phospholipase D activity(GO:0031584) |
0.1 | 0.1 | GO:0009826 | unidimensional cell growth(GO:0009826) |
0.1 | 0.3 | GO:0010982 | regulation of high-density lipoprotein particle clearance(GO:0010982) positive regulation of lipoprotein particle clearance(GO:0010986) |
0.1 | 0.7 | GO:0042866 | pyruvate biosynthetic process(GO:0042866) |
0.1 | 1.3 | GO:0032986 | nucleosome disassembly(GO:0006337) protein-DNA complex disassembly(GO:0032986) |
0.1 | 2.8 | GO:0046854 | phosphatidylinositol phosphorylation(GO:0046854) |
0.1 | 1.6 | GO:0010667 | negative regulation of cardiac muscle cell apoptotic process(GO:0010667) |
0.1 | 0.9 | GO:0015825 | L-serine transport(GO:0015825) |
0.1 | 0.4 | GO:0030035 | microspike assembly(GO:0030035) |
0.1 | 0.9 | GO:0007100 | mitotic centrosome separation(GO:0007100) |
0.1 | 3.3 | GO:0033344 | cholesterol efflux(GO:0033344) |
0.1 | 0.4 | GO:0035021 | negative regulation of Rac protein signal transduction(GO:0035021) |
0.1 | 0.3 | GO:0010940 | positive regulation of necrotic cell death(GO:0010940) |
0.1 | 0.4 | GO:0002322 | B cell proliferation involved in immune response(GO:0002322) |
0.1 | 0.5 | GO:0002826 | negative regulation of T-helper 1 type immune response(GO:0002826) |
0.1 | 0.3 | GO:0070314 | G1 to G0 transition(GO:0070314) |
0.1 | 0.5 | GO:0070254 | mucus secretion(GO:0070254) |
0.1 | 0.9 | GO:0007197 | adenylate cyclase-inhibiting G-protein coupled acetylcholine receptor signaling pathway(GO:0007197) phospholipase C-activating G-protein coupled acetylcholine receptor signaling pathway(GO:0007207) |
0.1 | 0.4 | GO:0090219 | negative regulation of lipid kinase activity(GO:0090219) |
0.1 | 0.4 | GO:0050857 | positive regulation of antigen receptor-mediated signaling pathway(GO:0050857) |
0.1 | 0.5 | GO:0051387 | negative regulation of neurotrophin TRK receptor signaling pathway(GO:0051387) |
0.1 | 0.5 | GO:0048007 | antigen processing and presentation of lipid antigen via MHC class Ib(GO:0048003) antigen processing and presentation, exogenous lipid antigen via MHC class Ib(GO:0048007) |
0.1 | 0.1 | GO:0097581 | lamellipodium organization(GO:0097581) |
0.1 | 0.5 | GO:0050847 | progesterone receptor signaling pathway(GO:0050847) |
0.1 | 0.3 | GO:0046628 | positive regulation of insulin receptor signaling pathway(GO:0046628) |
0.1 | 0.5 | GO:1900165 | negative regulation of interleukin-6 secretion(GO:1900165) |
0.1 | 0.9 | GO:0006544 | glycine metabolic process(GO:0006544) |
0.1 | 0.5 | GO:0042997 | negative regulation of Golgi to plasma membrane protein transport(GO:0042997) |
0.1 | 0.3 | GO:0032261 | purine nucleotide salvage(GO:0032261) IMP salvage(GO:0032264) |
0.1 | 0.3 | GO:0019511 | peptidyl-proline hydroxylation(GO:0019511) |
0.1 | 0.4 | GO:0036066 | protein O-linked fucosylation(GO:0036066) |
0.1 | 0.4 | GO:0070681 | glutaminyl-tRNAGln biosynthesis via transamidation(GO:0070681) |
0.1 | 0.1 | GO:0002018 | renin-angiotensin regulation of aldosterone production(GO:0002018) |
0.1 | 0.4 | GO:0034729 | histone H3-K79 methylation(GO:0034729) |
0.1 | 0.3 | GO:0060800 | regulation of cell differentiation involved in embryonic placenta development(GO:0060800) |
0.1 | 0.3 | GO:0002031 | G-protein coupled receptor internalization(GO:0002031) |
0.1 | 0.3 | GO:0042998 | positive regulation of Golgi to plasma membrane protein transport(GO:0042998) |
0.1 | 0.6 | GO:0060623 | regulation of chromosome condensation(GO:0060623) |
0.1 | 0.6 | GO:0071361 | cellular response to ethanol(GO:0071361) |
0.1 | 1.0 | GO:0006474 | N-terminal protein amino acid acetylation(GO:0006474) |
0.1 | 0.4 | GO:0002669 | positive regulation of T cell anergy(GO:0002669) positive regulation of lymphocyte anergy(GO:0002913) |
0.1 | 0.1 | GO:0007403 | glial cell fate determination(GO:0007403) |
0.1 | 0.4 | GO:0046066 | purine deoxyribonucleoside diphosphate metabolic process(GO:0009182) dGDP metabolic process(GO:0046066) |
0.1 | 0.7 | GO:0046069 | cGMP catabolic process(GO:0046069) |
0.1 | 0.4 | GO:0006983 | ER overload response(GO:0006983) |
0.1 | 0.2 | GO:0021538 | epithalamus development(GO:0021538) habenula development(GO:0021986) |
0.1 | 0.4 | GO:1902474 | positive regulation of protein localization to synapse(GO:1902474) |
0.1 | 0.5 | GO:0034773 | histone H4-K20 trimethylation(GO:0034773) |
0.1 | 0.1 | GO:0097029 | mature conventional dendritic cell differentiation(GO:0097029) |
0.1 | 1.1 | GO:2000257 | regulation of complement activation(GO:0030449) regulation of protein activation cascade(GO:2000257) |
0.1 | 0.2 | GO:0043504 | mitochondrial DNA repair(GO:0043504) |
0.1 | 0.8 | GO:0051560 | mitochondrial calcium ion homeostasis(GO:0051560) |
0.1 | 1.1 | GO:1900119 | positive regulation of execution phase of apoptosis(GO:1900119) |
0.1 | 0.2 | GO:0002468 | dendritic cell antigen processing and presentation(GO:0002468) regulation of dendritic cell antigen processing and presentation(GO:0002604) |
0.1 | 0.1 | GO:0071930 | negative regulation of transcription involved in G1/S transition of mitotic cell cycle(GO:0071930) |
0.1 | 0.5 | GO:2000059 | negative regulation of protein ubiquitination involved in ubiquitin-dependent protein catabolic process(GO:2000059) |
0.1 | 0.4 | GO:0009838 | abscission(GO:0009838) |
0.1 | 0.5 | GO:0015705 | iodide transport(GO:0015705) |
0.1 | 0.5 | GO:0090009 | primitive streak formation(GO:0090009) |
0.1 | 0.6 | GO:0035331 | negative regulation of hippo signaling(GO:0035331) |
0.1 | 0.8 | GO:2000051 | negative regulation of non-canonical Wnt signaling pathway(GO:2000051) |
0.1 | 0.7 | GO:0043923 | positive regulation by host of viral transcription(GO:0043923) |
0.1 | 0.2 | GO:0070317 | negative regulation of G0 to G1 transition(GO:0070317) |
0.1 | 0.1 | GO:0051342 | regulation of cyclic-nucleotide phosphodiesterase activity(GO:0051342) |
0.1 | 0.2 | GO:0010692 | regulation of alkaline phosphatase activity(GO:0010692) |
0.1 | 0.2 | GO:0002138 | retinoic acid biosynthetic process(GO:0002138) diterpenoid biosynthetic process(GO:0016102) |
0.1 | 0.4 | GO:0035582 | sequestering of BMP in extracellular matrix(GO:0035582) |
0.1 | 0.1 | GO:0045415 | negative regulation of interleukin-8 biosynthetic process(GO:0045415) |
0.1 | 0.1 | GO:0032910 | transforming growth factor beta3 production(GO:0032907) regulation of transforming growth factor beta3 production(GO:0032910) |
0.1 | 0.4 | GO:0045624 | positive regulation of T-helper cell differentiation(GO:0045624) |
0.1 | 0.6 | GO:0051151 | negative regulation of smooth muscle cell differentiation(GO:0051151) |
0.1 | 0.6 | GO:0030263 | apoptotic chromosome condensation(GO:0030263) |
0.1 | 0.3 | GO:0006598 | polyamine catabolic process(GO:0006598) |
0.1 | 0.5 | GO:0043372 | positive regulation of CD4-positive, alpha-beta T cell differentiation(GO:0043372) |
0.1 | 0.5 | GO:0070586 | cell-cell adhesion involved in gastrulation(GO:0070586) |
0.1 | 0.6 | GO:0016139 | glycoside catabolic process(GO:0016139) |
0.1 | 0.2 | GO:0043096 | purine nucleobase salvage(GO:0043096) |
0.1 | 0.2 | GO:0014707 | branchiomeric skeletal muscle development(GO:0014707) |
0.1 | 0.3 | GO:0006532 | aspartate biosynthetic process(GO:0006532) |
0.1 | 0.1 | GO:0035963 | response to interleukin-13(GO:0035962) cellular response to interleukin-13(GO:0035963) |
0.1 | 0.6 | GO:0044351 | macropinocytosis(GO:0044351) |
0.1 | 0.2 | GO:0060445 | branching involved in salivary gland morphogenesis(GO:0060445) |
0.1 | 0.8 | GO:1900452 | regulation of long term synaptic depression(GO:1900452) |
0.1 | 0.2 | GO:0060414 | aorta smooth muscle tissue morphogenesis(GO:0060414) |
0.1 | 1.7 | GO:0010762 | regulation of fibroblast migration(GO:0010762) |
0.1 | 0.2 | GO:2000048 | negative regulation of cell-cell adhesion mediated by cadherin(GO:2000048) |
0.1 | 0.7 | GO:0000729 | DNA double-strand break processing(GO:0000729) |
0.1 | 0.1 | GO:0010994 | regulation of ubiquitin homeostasis(GO:0010993) free ubiquitin chain polymerization(GO:0010994) |
0.1 | 0.1 | GO:0010746 | regulation of plasma membrane long-chain fatty acid transport(GO:0010746) |
0.1 | 2.5 | GO:0034067 | protein localization to Golgi apparatus(GO:0034067) |
0.1 | 0.3 | GO:0009186 | deoxyribonucleoside diphosphate metabolic process(GO:0009186) |
0.1 | 0.3 | GO:0070294 | renal sodium ion absorption(GO:0070294) |
0.1 | 1.2 | GO:0031115 | negative regulation of microtubule polymerization(GO:0031115) |
0.1 | 0.4 | GO:0002578 | negative regulation of antigen processing and presentation(GO:0002578) negative regulation of antigen processing and presentation of peptide antigen(GO:0002584) |
0.1 | 0.4 | GO:0031581 | hemidesmosome assembly(GO:0031581) |
0.1 | 0.4 | GO:0060484 | lung-associated mesenchyme development(GO:0060484) |
0.1 | 0.4 | GO:0043137 | DNA replication, removal of RNA primer(GO:0043137) |
0.1 | 0.6 | GO:0045162 | clustering of voltage-gated sodium channels(GO:0045162) |
0.1 | 0.4 | GO:0045039 | protein import into mitochondrial inner membrane(GO:0045039) |
0.1 | 0.5 | GO:0044362 | modulation of molecular function in other organism(GO:0044359) negative regulation of molecular function in other organism(GO:0044362) negative regulation of molecular function in other organism involved in symbiotic interaction(GO:0052204) modulation of molecular function in other organism involved in symbiotic interaction(GO:0052205) |
0.1 | 0.1 | GO:0072095 | regulation of branch elongation involved in ureteric bud branching(GO:0072095) |
0.1 | 0.5 | GO:1901660 | calcium ion export(GO:1901660) |
0.1 | 0.4 | GO:0042640 | anagen(GO:0042640) |
0.1 | 0.3 | GO:0048549 | positive regulation of pinocytosis(GO:0048549) |
0.1 | 2.1 | GO:0015701 | bicarbonate transport(GO:0015701) |
0.1 | 0.1 | GO:0048320 | axial mesoderm formation(GO:0048320) |
0.1 | 1.5 | GO:1900087 | positive regulation of G1/S transition of mitotic cell cycle(GO:1900087) |
0.1 | 0.2 | GO:0098911 | regulation of ventricular cardiac muscle cell action potential(GO:0098911) |
0.1 | 0.1 | GO:0097477 | lateral motor column neuron migration(GO:0097477) |
0.1 | 1.3 | GO:0035278 | miRNA mediated inhibition of translation(GO:0035278) |
0.1 | 0.6 | GO:0071073 | positive regulation of phospholipid biosynthetic process(GO:0071073) |
0.1 | 0.7 | GO:0009143 | nucleoside triphosphate catabolic process(GO:0009143) |
0.1 | 0.2 | GO:0021527 | spinal cord association neuron differentiation(GO:0021527) |
0.1 | 0.3 | GO:0035927 | RNA import into mitochondrion(GO:0035927) rRNA import into mitochondrion(GO:0035928) |
0.1 | 0.3 | GO:0006391 | transcription initiation from mitochondrial promoter(GO:0006391) |
0.1 | 0.1 | GO:0070922 | small RNA loading onto RISC(GO:0070922) |
0.1 | 0.4 | GO:0070934 | CRD-mediated mRNA stabilization(GO:0070934) |
0.1 | 0.4 | GO:0097039 | protein linear polyubiquitination(GO:0097039) |
0.1 | 0.3 | GO:1901873 | regulation of post-translational protein modification(GO:1901873) negative regulation of post-translational protein modification(GO:1901874) |
0.1 | 0.3 | GO:0003150 | muscular septum morphogenesis(GO:0003150) |
0.1 | 0.2 | GO:2000409 | positive regulation of T cell extravasation(GO:2000409) |
0.1 | 0.1 | GO:0060167 | regulation of adenosine receptor signaling pathway(GO:0060167) |
0.1 | 0.2 | GO:0090559 | regulation of membrane permeability(GO:0090559) |
0.1 | 0.1 | GO:0019401 | alditol biosynthetic process(GO:0019401) |
0.1 | 0.3 | GO:0008594 | photoreceptor cell morphogenesis(GO:0008594) |
0.1 | 0.1 | GO:0008078 | mesodermal cell migration(GO:0008078) |
0.1 | 0.1 | GO:0072179 | nephric duct formation(GO:0072179) |
0.1 | 0.3 | GO:0097343 | ripoptosome assembly(GO:0097343) ripoptosome assembly involved in necroptotic process(GO:1901026) |
0.1 | 0.2 | GO:0061073 | ciliary body morphogenesis(GO:0061073) |
0.1 | 0.5 | GO:0005981 | regulation of glycogen catabolic process(GO:0005981) |
0.1 | 0.2 | GO:0048254 | snoRNA localization(GO:0048254) |
0.1 | 0.2 | GO:0002314 | germinal center B cell differentiation(GO:0002314) |
0.1 | 0.3 | GO:0010715 | regulation of extracellular matrix disassembly(GO:0010715) |
0.1 | 0.7 | GO:0030828 | positive regulation of cGMP biosynthetic process(GO:0030828) |
0.1 | 0.2 | GO:0030948 | negative regulation of vascular endothelial growth factor receptor signaling pathway(GO:0030948) |
0.1 | 0.6 | GO:0090084 | negative regulation of inclusion body assembly(GO:0090084) |
0.1 | 0.1 | GO:0016559 | peroxisome fission(GO:0016559) |
0.1 | 0.2 | GO:0030222 | eosinophil differentiation(GO:0030222) |
0.1 | 0.7 | GO:0070131 | positive regulation of mitochondrial translation(GO:0070131) |
0.1 | 0.1 | GO:0043366 | beta selection(GO:0043366) |
0.1 | 0.2 | GO:0010040 | response to iron(II) ion(GO:0010040) |
0.1 | 1.0 | GO:2000251 | positive regulation of actin cytoskeleton reorganization(GO:2000251) |
0.1 | 0.4 | GO:0060770 | negative regulation of epithelial cell proliferation involved in prostate gland development(GO:0060770) |
0.1 | 0.2 | GO:0044650 | virion attachment to host cell(GO:0019062) adhesion of symbiont to host cell(GO:0044650) |
0.1 | 0.9 | GO:0043249 | erythrocyte maturation(GO:0043249) |
0.1 | 0.1 | GO:0045578 | negative regulation of B cell differentiation(GO:0045578) |
0.1 | 0.8 | GO:0002098 | tRNA wobble uridine modification(GO:0002098) |
0.1 | 0.1 | GO:0070278 | extracellular matrix constituent secretion(GO:0070278) |
0.1 | 1.0 | GO:0019184 | nonribosomal peptide biosynthetic process(GO:0019184) |
0.1 | 0.4 | GO:0016264 | gap junction assembly(GO:0016264) |
0.1 | 1.3 | GO:0051294 | establishment of spindle orientation(GO:0051294) |
0.1 | 0.3 | GO:0070885 | negative regulation of calcineurin-NFAT signaling cascade(GO:0070885) |
0.1 | 0.2 | GO:1902230 | negative regulation of intrinsic apoptotic signaling pathway in response to DNA damage(GO:1902230) |
0.1 | 0.2 | GO:0035426 | extracellular matrix-cell signaling(GO:0035426) |
0.1 | 0.8 | GO:1903053 | regulation of extracellular matrix organization(GO:1903053) |
0.1 | 0.5 | GO:0071670 | smooth muscle cell chemotaxis(GO:0071670) |
0.1 | 0.6 | GO:0071294 | cellular response to zinc ion(GO:0071294) |
0.1 | 0.3 | GO:0043615 | astrocyte cell migration(GO:0043615) |
0.1 | 2.1 | GO:1901998 | toxin transport(GO:1901998) |
0.1 | 1.6 | GO:0033539 | fatty acid beta-oxidation using acyl-CoA dehydrogenase(GO:0033539) |
0.1 | 0.4 | GO:0018230 | peptidyl-L-cysteine S-palmitoylation(GO:0018230) peptidyl-S-diacylglycerol-L-cysteine biosynthetic process from peptidyl-cysteine(GO:0018231) |
0.1 | 0.1 | GO:1901317 | regulation of sperm motility(GO:1901317) |
0.1 | 0.7 | GO:0034497 | protein localization to pre-autophagosomal structure(GO:0034497) |
0.1 | 0.2 | GO:0044034 | negative stranded viral RNA replication(GO:0039689) multi-organism biosynthetic process(GO:0044034) |
0.1 | 0.2 | GO:0001983 | baroreceptor response to increased systemic arterial blood pressure(GO:0001983) |
0.1 | 0.4 | GO:0071033 | nuclear retention of pre-mRNA at the site of transcription(GO:0071033) |
0.1 | 0.3 | GO:0072718 | response to cisplatin(GO:0072718) |
0.1 | 0.3 | GO:1903504 | regulation of mitotic cell cycle spindle assembly checkpoint(GO:0090266) regulation of mitotic spindle checkpoint(GO:1903504) |
0.1 | 0.3 | GO:0071873 | response to norepinephrine(GO:0071873) |
0.1 | 0.5 | GO:0018101 | protein citrullination(GO:0018101) |
0.1 | 2.0 | GO:0001913 | T cell mediated cytotoxicity(GO:0001913) |
0.1 | 0.1 | GO:0051255 | spindle midzone assembly(GO:0051255) |
0.1 | 0.1 | GO:0032290 | peripheral nervous system myelin formation(GO:0032290) |
0.1 | 0.3 | GO:1900451 | positive regulation of glutamate receptor signaling pathway(GO:1900451) positive regulation of alpha-amino-3-hydroxy-5-methyl-4-isoxazole propionate selective glutamate receptor activity(GO:2000969) |
0.1 | 0.9 | GO:2001241 | positive regulation of extrinsic apoptotic signaling pathway in absence of ligand(GO:2001241) |
0.1 | 0.4 | GO:0046984 | regulation of hemoglobin biosynthetic process(GO:0046984) |
0.1 | 0.4 | GO:0021797 | forebrain anterior/posterior pattern specification(GO:0021797) |
0.1 | 0.3 | GO:0042416 | dopamine biosynthetic process(GO:0042416) |
0.1 | 0.3 | GO:0045585 | regulation of cytotoxic T cell differentiation(GO:0045583) positive regulation of cytotoxic T cell differentiation(GO:0045585) |
0.1 | 0.2 | GO:1900118 | negative regulation of execution phase of apoptosis(GO:1900118) |
0.1 | 0.3 | GO:0019244 | lactate biosynthetic process from pyruvate(GO:0019244) lactate biosynthetic process(GO:0019249) |
0.1 | 0.3 | GO:1904705 | regulation of vascular smooth muscle cell proliferation(GO:1904705) vascular smooth muscle cell proliferation(GO:1990874) |
0.1 | 0.2 | GO:0002739 | regulation of cytokine secretion involved in immune response(GO:0002739) |
0.1 | 0.1 | GO:0015840 | urea transport(GO:0015840) |
0.1 | 0.9 | GO:0071549 | response to dexamethasone(GO:0071548) cellular response to dexamethasone stimulus(GO:0071549) |
0.1 | 0.3 | GO:0046167 | glycerol-3-phosphate biosynthetic process(GO:0046167) |
0.1 | 0.3 | GO:0086046 | membrane depolarization during SA node cell action potential(GO:0086046) |
0.1 | 1.1 | GO:0048268 | clathrin coat assembly(GO:0048268) |
0.1 | 1.9 | GO:0048843 | negative regulation of axon extension involved in axon guidance(GO:0048843) negative regulation of axon guidance(GO:1902668) |
0.1 | 0.8 | GO:0036159 | inner dynein arm assembly(GO:0036159) |
0.1 | 0.3 | GO:0000492 | small nucleolar ribonucleoprotein complex assembly(GO:0000491) box C/D snoRNP assembly(GO:0000492) |
0.1 | 0.7 | GO:0030206 | chondroitin sulfate biosynthetic process(GO:0030206) |
0.1 | 0.3 | GO:0010890 | positive regulation of sequestering of triglyceride(GO:0010890) |
0.1 | 0.7 | GO:0045943 | positive regulation of transcription from RNA polymerase I promoter(GO:0045943) |
0.1 | 0.2 | GO:1990928 | response to amino acid starvation(GO:1990928) |
0.1 | 0.7 | GO:0006895 | Golgi to endosome transport(GO:0006895) |
0.1 | 0.2 | GO:0010992 | ubiquitin homeostasis(GO:0010992) |
0.1 | 0.3 | GO:0043974 | histone H3-K27 acetylation(GO:0043974) regulation of histone H3-K27 acetylation(GO:1901674) |
0.1 | 0.2 | GO:0045110 | intermediate filament bundle assembly(GO:0045110) |
0.1 | 1.2 | GO:0031294 | lymphocyte costimulation(GO:0031294) |
0.1 | 0.4 | GO:0006072 | glycerol-3-phosphate metabolic process(GO:0006072) |
0.1 | 0.5 | GO:0021999 | neural plate anterior/posterior regionalization(GO:0021999) |
0.1 | 0.3 | GO:0010755 | regulation of plasminogen activation(GO:0010755) positive regulation of plasminogen activation(GO:0010756) |
0.1 | 0.2 | GO:0090069 | regulation of ribosome biogenesis(GO:0090069) |
0.1 | 0.6 | GO:0019800 | peptide cross-linking via chondroitin 4-sulfate glycosaminoglycan(GO:0019800) |
0.1 | 0.3 | GO:0072257 | metanephric nephron tubule epithelial cell differentiation(GO:0072257) regulation of metanephric nephron tubule epithelial cell differentiation(GO:0072307) |
0.1 | 0.4 | GO:0038063 | collagen-activated tyrosine kinase receptor signaling pathway(GO:0038063) |
0.1 | 0.1 | GO:0006824 | cobalt ion transport(GO:0006824) |
0.1 | 0.2 | GO:0002689 | negative regulation of leukocyte chemotaxis(GO:0002689) |
0.1 | 0.3 | GO:0060051 | negative regulation of protein glycosylation(GO:0060051) |
0.1 | 0.1 | GO:1903391 | regulation of adherens junction organization(GO:1903391) |
0.1 | 0.4 | GO:0033523 | histone H2B ubiquitination(GO:0033523) |
0.1 | 0.3 | GO:0071947 | protein deubiquitination involved in ubiquitin-dependent protein catabolic process(GO:0071947) |
0.1 | 0.3 | GO:0061622 | glycolytic process through glucose-1-phosphate(GO:0061622) |
0.1 | 0.1 | GO:0042713 | sperm ejaculation(GO:0042713) |
0.1 | 0.1 | GO:0090037 | positive regulation of protein kinase C signaling(GO:0090037) |
0.1 | 0.4 | GO:0060052 | neurofilament cytoskeleton organization(GO:0060052) |
0.1 | 1.6 | GO:0006301 | postreplication repair(GO:0006301) |
0.1 | 0.3 | GO:0001866 | NK T cell proliferation(GO:0001866) |
0.1 | 0.5 | GO:0090025 | regulation of monocyte chemotaxis(GO:0090025) |
0.1 | 0.7 | GO:0032211 | negative regulation of telomere maintenance via telomerase(GO:0032211) |
0.1 | 0.3 | GO:0002414 | immunoglobulin transcytosis in epithelial cells(GO:0002414) |
0.1 | 0.3 | GO:0061668 | mitochondrial ribosome assembly(GO:0061668) |
0.1 | 0.7 | GO:0001553 | luteinization(GO:0001553) |
0.1 | 0.8 | GO:1902260 | negative regulation of delayed rectifier potassium channel activity(GO:1902260) negative regulation of voltage-gated potassium channel activity(GO:1903817) |
0.1 | 0.8 | GO:0022617 | extracellular matrix disassembly(GO:0022617) |
0.1 | 0.3 | GO:0010796 | regulation of multivesicular body size(GO:0010796) |
0.1 | 0.4 | GO:0031665 | negative regulation of lipopolysaccharide-mediated signaling pathway(GO:0031665) |
0.1 | 0.5 | GO:1902715 | positive regulation of interferon-gamma secretion(GO:1902715) |
0.1 | 1.5 | GO:0043392 | negative regulation of DNA binding(GO:0043392) |
0.1 | 0.5 | GO:0033313 | meiotic cell cycle checkpoint(GO:0033313) |
0.1 | 2.1 | GO:0007045 | cell-substrate adherens junction assembly(GO:0007045) focal adhesion assembly(GO:0048041) |
0.1 | 0.3 | GO:0048539 | bone marrow development(GO:0048539) |
0.1 | 0.2 | GO:0050651 | dermatan sulfate proteoglycan biosynthetic process(GO:0050651) |
0.1 | 0.3 | GO:0010637 | negative regulation of mitochondrial fusion(GO:0010637) |
0.1 | 0.1 | GO:0060585 | regulation of prostaglandin-endoperoxide synthase activity(GO:0060584) positive regulation of prostaglandin-endoperoxide synthase activity(GO:0060585) |
0.1 | 2.1 | GO:0051058 | negative regulation of Ras protein signal transduction(GO:0046580) negative regulation of small GTPase mediated signal transduction(GO:0051058) |
0.1 | 0.2 | GO:0031622 | positive regulation of fever generation(GO:0031622) |
0.1 | 1.1 | GO:0007095 | mitotic G2 DNA damage checkpoint(GO:0007095) |
0.1 | 0.1 | GO:0001805 | type III hypersensitivity(GO:0001802) regulation of type III hypersensitivity(GO:0001803) positive regulation of type III hypersensitivity(GO:0001805) |
0.1 | 0.1 | GO:0035524 | proline transmembrane transport(GO:0035524) |
0.1 | 0.3 | GO:0051610 | serotonin uptake(GO:0051610) |
0.1 | 1.6 | GO:0032007 | negative regulation of TOR signaling(GO:0032007) |
0.1 | 0.1 | GO:0046552 | eye photoreceptor cell fate commitment(GO:0042706) photoreceptor cell fate commitment(GO:0046552) |
0.1 | 0.3 | GO:0070162 | adiponectin secretion(GO:0070162) regulation of adiponectin secretion(GO:0070163) |
0.1 | 0.3 | GO:0043415 | positive regulation of skeletal muscle tissue regeneration(GO:0043415) |
0.1 | 0.2 | GO:0033136 | serine phosphorylation of STAT3 protein(GO:0033136) |
0.1 | 0.8 | GO:0021702 | cerebellar Purkinje cell differentiation(GO:0021702) |
0.1 | 0.2 | GO:0045085 | negative regulation of interleukin-2 biosynthetic process(GO:0045085) |
0.1 | 0.3 | GO:0006987 | activation of signaling protein activity involved in unfolded protein response(GO:0006987) |
0.1 | 0.5 | GO:0051967 | negative regulation of synaptic transmission, glutamatergic(GO:0051967) |
0.1 | 0.3 | GO:0003344 | pericardium morphogenesis(GO:0003344) |
0.1 | 0.2 | GO:0010025 | wax biosynthetic process(GO:0010025) wax metabolic process(GO:0010166) |
0.1 | 0.3 | GO:0008228 | opsonization(GO:0008228) |
0.1 | 0.1 | GO:0043091 | L-arginine import(GO:0043091) arginine import(GO:0090467) L-arginine transport(GO:1902023) |
0.1 | 0.3 | GO:0031145 | anaphase-promoting complex-dependent catabolic process(GO:0031145) |
0.1 | 0.1 | GO:0035330 | regulation of hippo signaling(GO:0035330) |
0.1 | 0.7 | GO:0070166 | enamel mineralization(GO:0070166) |
0.1 | 0.6 | GO:0010758 | regulation of macrophage chemotaxis(GO:0010758) |
0.1 | 0.1 | GO:0070831 | basement membrane assembly(GO:0070831) |
0.1 | 1.5 | GO:0003333 | amino acid transmembrane transport(GO:0003333) |
0.1 | 0.2 | GO:0040009 | regulation of growth rate(GO:0040009) |
0.1 | 0.3 | GO:0022605 | oogenesis stage(GO:0022605) |
0.1 | 0.5 | GO:0060628 | regulation of ER to Golgi vesicle-mediated transport(GO:0060628) |
0.1 | 0.1 | GO:0035729 | response to hepatocyte growth factor(GO:0035728) cellular response to hepatocyte growth factor stimulus(GO:0035729) |
0.1 | 0.2 | GO:0032418 | lysosome localization(GO:0032418) |
0.1 | 0.2 | GO:0043383 | negative T cell selection(GO:0043383) |
0.1 | 0.7 | GO:0006054 | N-acetylneuraminate metabolic process(GO:0006054) |
0.1 | 0.2 | GO:0044154 | histone H3-K14 acetylation(GO:0044154) positive regulation of histone H3-K14 acetylation(GO:0071442) |
0.1 | 0.6 | GO:0006123 | mitochondrial electron transport, cytochrome c to oxygen(GO:0006123) |
0.1 | 0.2 | GO:0071800 | podosome assembly(GO:0071800) |
0.1 | 1.1 | GO:0006825 | copper ion transport(GO:0006825) |
0.1 | 0.4 | GO:0051127 | positive regulation of actin nucleation(GO:0051127) |
0.1 | 0.1 | GO:0090086 | negative regulation of protein deubiquitination(GO:0090086) |
0.1 | 0.1 | GO:0070601 | centromeric sister chromatid cohesion(GO:0070601) |
0.1 | 0.2 | GO:0071494 | cellular response to UV-C(GO:0071494) |
0.1 | 0.4 | GO:0051533 | positive regulation of NFAT protein import into nucleus(GO:0051533) |
0.1 | 0.1 | GO:0071374 | cellular response to parathyroid hormone stimulus(GO:0071374) |
0.1 | 0.6 | GO:0034643 | establishment of mitochondrion localization, microtubule-mediated(GO:0034643) mitochondrion transport along microtubule(GO:0047497) |
0.1 | 0.2 | GO:0002017 | regulation of blood volume by renal aldosterone(GO:0002017) |
0.1 | 0.4 | GO:0042748 | circadian sleep/wake cycle, non-REM sleep(GO:0042748) |
0.1 | 0.6 | GO:0050957 | equilibrioception(GO:0050957) |
0.1 | 0.2 | GO:0032485 | regulation of Ral protein signal transduction(GO:0032485) |
0.1 | 1.8 | GO:0006958 | complement activation, classical pathway(GO:0006958) |
0.1 | 0.1 | GO:0042758 | long-chain fatty acid catabolic process(GO:0042758) |
0.1 | 1.1 | GO:0030322 | stabilization of membrane potential(GO:0030322) |
0.1 | 0.5 | GO:0071267 | amino acid salvage(GO:0043102) L-methionine biosynthetic process(GO:0071265) L-methionine salvage(GO:0071267) |
0.1 | 0.2 | GO:0002566 | somatic diversification of immune receptors via somatic mutation(GO:0002566) |
0.1 | 1.2 | GO:0007026 | negative regulation of microtubule depolymerization(GO:0007026) |
0.1 | 1.0 | GO:0032781 | positive regulation of ATPase activity(GO:0032781) |
0.1 | 0.2 | GO:0033615 | mitochondrial proton-transporting ATP synthase complex assembly(GO:0033615) |
0.1 | 0.2 | GO:0072575 | hepatocyte proliferation(GO:0072574) epithelial cell proliferation involved in liver morphogenesis(GO:0072575) |
0.1 | 0.2 | GO:0032788 | saturated monocarboxylic acid metabolic process(GO:0032788) unsaturated monocarboxylic acid metabolic process(GO:0032789) |
0.1 | 0.5 | GO:0048251 | elastic fiber assembly(GO:0048251) |
0.1 | 0.1 | GO:0033602 | negative regulation of dopamine secretion(GO:0033602) |
0.1 | 0.4 | GO:0036297 | interstrand cross-link repair(GO:0036297) |
0.1 | 0.2 | GO:0042138 | meiotic DNA double-strand break formation(GO:0042138) |
0.1 | 0.3 | GO:0070125 | mitochondrial translational elongation(GO:0070125) |
0.1 | 0.5 | GO:0006744 | ubiquinone metabolic process(GO:0006743) ubiquinone biosynthetic process(GO:0006744) |
0.1 | 0.3 | GO:0032287 | peripheral nervous system myelin maintenance(GO:0032287) |
0.1 | 0.1 | GO:0090309 | positive regulation of methylation-dependent chromatin silencing(GO:0090309) |
0.1 | 0.2 | GO:1902416 | positive regulation of mRNA binding(GO:1902416) positive regulation of RNA binding(GO:1905216) |
0.1 | 1.4 | GO:0060218 | hematopoietic stem cell differentiation(GO:0060218) |
0.1 | 0.2 | GO:0019230 | proprioception(GO:0019230) |
0.1 | 1.0 | GO:0032094 | response to food(GO:0032094) |
0.1 | 0.4 | GO:0035313 | wound healing, spreading of epidermal cells(GO:0035313) |
0.1 | 0.2 | GO:0006216 | cytidine catabolic process(GO:0006216) cytidine deamination(GO:0009972) cytidine metabolic process(GO:0046087) |
0.1 | 0.4 | GO:0036158 | outer dynein arm assembly(GO:0036158) |
0.1 | 0.1 | GO:2000020 | positive regulation of male gonad development(GO:2000020) |
0.1 | 0.1 | GO:0060315 | negative regulation of ryanodine-sensitive calcium-release channel activity(GO:0060315) |
0.1 | 0.1 | GO:0090261 | positive regulation of inclusion body assembly(GO:0090261) |
0.1 | 0.3 | GO:0035435 | phosphate ion transmembrane transport(GO:0035435) |
0.1 | 0.6 | GO:0002888 | positive regulation of myeloid leukocyte mediated immunity(GO:0002888) |
0.1 | 0.3 | GO:2000781 | positive regulation of double-strand break repair(GO:2000781) |
0.1 | 0.2 | GO:0003413 | chondrocyte differentiation involved in endochondral bone morphogenesis(GO:0003413) |
0.1 | 0.1 | GO:0070666 | mast cell proliferation(GO:0070662) regulation of mast cell proliferation(GO:0070666) positive regulation of mast cell proliferation(GO:0070668) |
0.1 | 0.1 | GO:0002374 | cytokine secretion involved in immune response(GO:0002374) |
0.1 | 0.2 | GO:0044849 | estrous cycle(GO:0044849) |
0.1 | 0.2 | GO:0019276 | UDP-N-acetylgalactosamine metabolic process(GO:0019276) |
0.1 | 0.4 | GO:0031274 | positive regulation of pseudopodium assembly(GO:0031274) |
0.1 | 0.9 | GO:0070306 | lens fiber cell differentiation(GO:0070306) |
0.1 | 0.3 | GO:0043562 | cellular response to nitrogen starvation(GO:0006995) cellular response to nitrogen levels(GO:0043562) |
0.1 | 0.3 | GO:0032494 | response to peptidoglycan(GO:0032494) |
0.1 | 0.5 | GO:0006071 | glycerol metabolic process(GO:0006071) |
0.1 | 0.1 | GO:0031269 | pseudopodium assembly(GO:0031269) |
0.1 | 0.4 | GO:1901387 | positive regulation of voltage-gated calcium channel activity(GO:1901387) |
0.1 | 0.1 | GO:0090196 | chemokine secretion(GO:0090195) regulation of chemokine secretion(GO:0090196) |
0.1 | 0.1 | GO:0050904 | diapedesis(GO:0050904) |
0.1 | 0.2 | GO:1902003 | regulation of beta-amyloid formation(GO:1902003) |
0.1 | 0.3 | GO:0048012 | hepatocyte growth factor receptor signaling pathway(GO:0048012) |
0.1 | 1.1 | GO:0006891 | intra-Golgi vesicle-mediated transport(GO:0006891) |
0.1 | 0.3 | GO:0010561 | negative regulation of glycoprotein biosynthetic process(GO:0010561) |
0.1 | 0.4 | GO:0006309 | apoptotic DNA fragmentation(GO:0006309) |
0.1 | 0.1 | GO:0048936 | peripheral nervous system neuron axonogenesis(GO:0048936) |
0.1 | 0.1 | GO:0075509 | receptor-mediated endocytosis of virus by host cell(GO:0019065) endocytosis involved in viral entry into host cell(GO:0075509) |
0.1 | 0.1 | GO:0033033 | negative regulation of myeloid cell apoptotic process(GO:0033033) |
0.1 | 0.8 | GO:0016973 | poly(A)+ mRNA export from nucleus(GO:0016973) |
0.1 | 0.3 | GO:0048387 | negative regulation of retinoic acid receptor signaling pathway(GO:0048387) |
0.1 | 0.6 | GO:0070571 | negative regulation of neuron projection regeneration(GO:0070571) |
0.1 | 0.1 | GO:1902902 | negative regulation of autophagosome assembly(GO:1902902) |
0.1 | 0.1 | GO:0007223 | Wnt signaling pathway, calcium modulating pathway(GO:0007223) |
0.1 | 0.1 | GO:0008355 | olfactory learning(GO:0008355) |
0.1 | 0.1 | GO:0090383 | phagosome acidification(GO:0090383) |
0.1 | 0.1 | GO:0045416 | positive regulation of interleukin-8 biosynthetic process(GO:0045416) |
0.1 | 0.1 | GO:0002457 | T cell antigen processing and presentation(GO:0002457) |
0.1 | 0.3 | GO:2001224 | positive regulation of neuron migration(GO:2001224) |
0.1 | 0.5 | GO:0048570 | notochord morphogenesis(GO:0048570) |
0.1 | 0.8 | GO:0001958 | endochondral ossification(GO:0001958) replacement ossification(GO:0036075) |
0.1 | 0.1 | GO:0010766 | negative regulation of sodium ion transport(GO:0010766) |
0.1 | 0.3 | GO:1902259 | regulation of delayed rectifier potassium channel activity(GO:1902259) |
0.1 | 0.2 | GO:0039702 | viral budding via host ESCRT complex(GO:0039702) |
0.1 | 0.2 | GO:0046909 | intermembrane transport(GO:0046909) |
0.1 | 0.1 | GO:0034114 | regulation of heterotypic cell-cell adhesion(GO:0034114) |
0.1 | 0.3 | GO:0061087 | positive regulation of histone H3-K27 methylation(GO:0061087) |
0.1 | 0.3 | GO:0006290 | pyrimidine dimer repair(GO:0006290) |
0.1 | 0.3 | GO:0033363 | secretory granule organization(GO:0033363) |
0.1 | 0.2 | GO:0045347 | negative regulation of MHC class II biosynthetic process(GO:0045347) |
0.1 | 0.2 | GO:0048743 | positive regulation of skeletal muscle fiber development(GO:0048743) |
0.1 | 0.3 | GO:0006528 | asparagine metabolic process(GO:0006528) |
0.1 | 0.1 | GO:0008626 | granzyme-mediated apoptotic signaling pathway(GO:0008626) |
0.1 | 0.1 | GO:1902992 | negative regulation of amyloid precursor protein catabolic process(GO:1902992) |
0.1 | 0.4 | GO:0042796 | snRNA transcription from RNA polymerase III promoter(GO:0042796) |
0.1 | 0.1 | GO:0034380 | high-density lipoprotein particle assembly(GO:0034380) |
0.1 | 0.1 | GO:0060947 | cardiac vascular smooth muscle cell differentiation(GO:0060947) |
0.1 | 0.1 | GO:0030210 | heparin biosynthetic process(GO:0030210) |
0.1 | 0.3 | GO:2000672 | negative regulation of motor neuron apoptotic process(GO:2000672) |
0.1 | 0.2 | GO:0060618 | nipple development(GO:0060618) |
0.1 | 0.1 | GO:1904729 | regulation of intestinal lipid absorption(GO:1904729) |
0.1 | 0.3 | GO:1901223 | negative regulation of NIK/NF-kappaB signaling(GO:1901223) |
0.1 | 0.1 | GO:0010155 | regulation of proton transport(GO:0010155) |
0.1 | 0.1 | GO:0051599 | response to hydrostatic pressure(GO:0051599) |
0.1 | 0.2 | GO:0015791 | polyol transport(GO:0015791) |
0.1 | 0.9 | GO:0034587 | piRNA metabolic process(GO:0034587) |
0.1 | 0.3 | GO:0036265 | RNA (guanine-N7)-methylation(GO:0036265) |
0.1 | 0.4 | GO:1904668 | positive regulation of ubiquitin protein ligase activity(GO:1904668) |
0.1 | 1.1 | GO:0018345 | protein palmitoylation(GO:0018345) |
0.1 | 0.3 | GO:0055003 | cardiac myofibril assembly(GO:0055003) |
0.1 | 0.3 | GO:0097240 | meiotic telomere tethering at nuclear periphery(GO:0044821) meiotic attachment of telomere to nuclear envelope(GO:0070197) chromosome attachment to the nuclear envelope(GO:0097240) |
0.1 | 0.1 | GO:2000516 | positive regulation of CD4-positive, alpha-beta T cell activation(GO:2000516) |
0.1 | 0.1 | GO:2000318 | positive regulation of T-helper 17 type immune response(GO:2000318) |
0.1 | 0.1 | GO:0061152 | trachea submucosa development(GO:0061152) trachea gland development(GO:0061153) |
0.1 | 0.1 | GO:0002725 | negative regulation of T cell cytokine production(GO:0002725) |
0.1 | 0.3 | GO:0072386 | plus-end-directed vesicle transport along microtubule(GO:0072383) plus-end-directed organelle transport along microtubule(GO:0072386) |
0.1 | 0.4 | GO:0006977 | DNA damage response, signal transduction by p53 class mediator resulting in cell cycle arrest(GO:0006977) |
0.1 | 0.2 | GO:0008063 | Toll signaling pathway(GO:0008063) |
0.1 | 0.1 | GO:0006610 | ribosomal protein import into nucleus(GO:0006610) |
0.1 | 0.1 | GO:1902109 | negative regulation of mitochondrial membrane permeability involved in apoptotic process(GO:1902109) |
0.1 | 0.1 | GO:0034058 | endosomal vesicle fusion(GO:0034058) |
0.1 | 0.2 | GO:0015846 | polyamine transport(GO:0015846) |
0.1 | 0.6 | GO:1903556 | negative regulation of tumor necrosis factor superfamily cytokine production(GO:1903556) |
0.1 | 0.9 | GO:0001782 | B cell homeostasis(GO:0001782) |
0.1 | 0.3 | GO:0071468 | cellular response to acidic pH(GO:0071468) |
0.1 | 0.3 | GO:0006450 | regulation of translational fidelity(GO:0006450) |
0.1 | 0.2 | GO:0061635 | regulation of protein complex stability(GO:0061635) |
0.1 | 0.1 | GO:0010225 | response to UV-C(GO:0010225) |
0.1 | 1.8 | GO:0098661 | inorganic anion transmembrane transport(GO:0098661) |
0.1 | 0.1 | GO:0030241 | skeletal muscle myosin thick filament assembly(GO:0030241) striated muscle myosin thick filament assembly(GO:0071688) |
0.1 | 0.6 | GO:0016558 | protein import into peroxisome matrix(GO:0016558) |
0.1 | 0.1 | GO:0002949 | tRNA threonylcarbamoyladenosine modification(GO:0002949) |
0.1 | 0.1 | GO:0009221 | pyrimidine deoxyribonucleotide biosynthetic process(GO:0009221) |
0.1 | 0.1 | GO:1904395 | positive regulation of receptor clustering(GO:1903911) regulation of skeletal muscle acetylcholine-gated channel clustering(GO:1904393) positive regulation of skeletal muscle acetylcholine-gated channel clustering(GO:1904395) |
0.1 | 0.1 | GO:2000535 | entry of bacterium into host cell(GO:0035635) regulation of entry of bacterium into host cell(GO:2000535) |
0.1 | 0.3 | GO:0034720 | histone H3-K4 demethylation(GO:0034720) |
0.1 | 0.1 | GO:0072048 | pattern specification involved in kidney development(GO:0061004) renal system pattern specification(GO:0072048) |
0.1 | 0.2 | GO:0098532 | histone H3-K27 trimethylation(GO:0098532) |
0.1 | 0.1 | GO:0052200 | response to defenses of other organism involved in symbiotic interaction(GO:0052173) response to host defenses(GO:0052200) response to host(GO:0075136) |
0.1 | 0.4 | GO:0002820 | negative regulation of adaptive immune response(GO:0002820) |
0.1 | 0.3 | GO:0035988 | chondrocyte proliferation(GO:0035988) |
0.1 | 0.3 | GO:0070874 | negative regulation of glycogen metabolic process(GO:0070874) |
0.1 | 0.2 | GO:0030643 | cellular phosphate ion homeostasis(GO:0030643) cellular trivalent inorganic anion homeostasis(GO:0072502) |
0.1 | 0.4 | GO:1902287 | semaphorin-plexin signaling pathway involved in axon guidance(GO:1902287) |
0.1 | 0.1 | GO:0031133 | regulation of axon diameter(GO:0031133) |
0.1 | 0.1 | GO:0045620 | negative regulation of lymphocyte differentiation(GO:0045620) |
0.1 | 0.1 | GO:0000966 | RNA 5'-end processing(GO:0000966) |
0.1 | 0.2 | GO:0045198 | establishment of epithelial cell apical/basal polarity(GO:0045198) |
0.1 | 0.4 | GO:0071236 | cellular response to antibiotic(GO:0071236) |
0.1 | 0.1 | GO:0097527 | necroptotic signaling pathway(GO:0097527) |
0.1 | 0.3 | GO:0031507 | heterochromatin assembly(GO:0031507) |
0.1 | 0.2 | GO:0007097 | nuclear migration(GO:0007097) |
0.1 | 0.1 | GO:0072318 | clathrin coat disassembly(GO:0072318) |
0.1 | 0.1 | GO:0031642 | negative regulation of myelination(GO:0031642) |
0.1 | 0.1 | GO:1902570 | protein localization to nucleolus(GO:1902570) |
0.1 | 1.0 | GO:0019835 | cytolysis(GO:0019835) |
0.1 | 0.1 | GO:0010536 | positive regulation of activation of Janus kinase activity(GO:0010536) |
0.1 | 0.5 | GO:0006767 | water-soluble vitamin metabolic process(GO:0006767) |
0.1 | 0.4 | GO:2000369 | regulation of clathrin-mediated endocytosis(GO:2000369) |
0.1 | 0.6 | GO:0033273 | response to vitamin(GO:0033273) |
0.1 | 0.7 | GO:0061099 | negative regulation of protein tyrosine kinase activity(GO:0061099) |
0.1 | 0.2 | GO:0097035 | regulation of membrane lipid distribution(GO:0097035) |
0.1 | 0.2 | GO:0043046 | DNA methylation involved in gamete generation(GO:0043046) |
0.1 | 0.1 | GO:2001185 | regulation of CD8-positive, alpha-beta T cell activation(GO:2001185) |
0.1 | 0.7 | GO:0006458 | 'de novo' protein folding(GO:0006458) 'de novo' posttranslational protein folding(GO:0051084) |
0.1 | 0.2 | GO:0000712 | resolution of meiotic recombination intermediates(GO:0000712) |
0.1 | 0.1 | GO:0070358 | actin polymerization-dependent cell motility(GO:0070358) |
0.1 | 0.2 | GO:0007063 | regulation of sister chromatid cohesion(GO:0007063) |
0.1 | 0.4 | GO:0031441 | negative regulation of mRNA 3'-end processing(GO:0031441) |
0.1 | 0.4 | GO:0043518 | negative regulation of DNA damage response, signal transduction by p53 class mediator(GO:0043518) |
0.1 | 0.7 | GO:0007064 | mitotic sister chromatid cohesion(GO:0007064) |
0.1 | 0.2 | GO:0000414 | regulation of histone H3-K36 methylation(GO:0000414) |
0.1 | 0.5 | GO:0033617 | mitochondrial respiratory chain complex IV assembly(GO:0033617) mitochondrial respiratory chain complex IV biogenesis(GO:0097034) |
0.1 | 0.5 | GO:0043981 | histone H4-K5 acetylation(GO:0043981) histone H4-K8 acetylation(GO:0043982) |
0.1 | 0.1 | GO:0031282 | regulation of guanylate cyclase activity(GO:0031282) |
0.1 | 0.2 | GO:0042511 | positive regulation of tyrosine phosphorylation of Stat1 protein(GO:0042511) |
0.1 | 0.1 | GO:0006538 | glutamate catabolic process(GO:0006538) |
0.1 | 0.4 | GO:0061088 | sequestering of zinc ion(GO:0032119) regulation of sequestering of zinc ion(GO:0061088) |
0.1 | 0.2 | GO:0060242 | contact inhibition(GO:0060242) |
0.1 | 1.0 | GO:0046839 | phospholipid dephosphorylation(GO:0046839) |
0.1 | 0.6 | GO:0030199 | collagen fibril organization(GO:0030199) |
0.1 | 0.1 | GO:0035092 | sperm chromatin condensation(GO:0035092) |
0.1 | 0.1 | GO:0010936 | negative regulation of macrophage cytokine production(GO:0010936) |
0.1 | 0.3 | GO:0006884 | cell volume homeostasis(GO:0006884) |
0.1 | 0.1 | GO:0051388 | positive regulation of neurotrophin TRK receptor signaling pathway(GO:0051388) |
0.1 | 0.2 | GO:0051045 | negative regulation of membrane protein ectodomain proteolysis(GO:0051045) |
0.1 | 0.1 | GO:0010482 | epidermal cell division(GO:0010481) regulation of epidermal cell division(GO:0010482) |
0.1 | 0.2 | GO:0045581 | negative regulation of T cell differentiation(GO:0045581) |
0.1 | 0.1 | GO:0060112 | generation of ovulation cycle rhythm(GO:0060112) |
0.1 | 1.5 | GO:0071277 | cellular response to calcium ion(GO:0071277) |
0.1 | 0.7 | GO:0051496 | positive regulation of stress fiber assembly(GO:0051496) |
0.1 | 0.3 | GO:1990126 | retrograde transport, endosome to plasma membrane(GO:1990126) |
0.1 | 0.1 | GO:0051088 | PMA-inducible membrane protein ectodomain proteolysis(GO:0051088) |
0.1 | 0.2 | GO:0038094 | Fc-gamma receptor signaling pathway(GO:0038094) |
0.1 | 0.2 | GO:0070475 | rRNA base methylation(GO:0070475) |
0.1 | 0.4 | GO:0003356 | regulation of cilium beat frequency(GO:0003356) |
0.1 | 0.4 | GO:1900026 | positive regulation of substrate adhesion-dependent cell spreading(GO:1900026) |
0.1 | 0.3 | GO:0019370 | leukotriene biosynthetic process(GO:0019370) |
0.1 | 0.2 | GO:0051315 | attachment of mitotic spindle microtubules to kinetochore(GO:0051315) |
0.1 | 0.3 | GO:0003299 | muscle hypertrophy in response to stress(GO:0003299) cardiac muscle adaptation(GO:0014887) cardiac muscle hypertrophy in response to stress(GO:0014898) |
0.1 | 0.2 | GO:0032825 | positive regulation of natural killer cell differentiation(GO:0032825) |
0.1 | 0.3 | GO:0046040 | IMP metabolic process(GO:0046040) |
0.1 | 0.2 | GO:0009106 | lipoate metabolic process(GO:0009106) |
0.1 | 1.6 | GO:0002474 | antigen processing and presentation of peptide antigen via MHC class I(GO:0002474) |
0.1 | 0.1 | GO:0071865 | apoptotic process in bone marrow(GO:0071839) regulation of apoptotic process in bone marrow(GO:0071865) negative regulation of apoptotic process in bone marrow(GO:0071866) |
0.1 | 0.1 | GO:0070244 | negative regulation of thymocyte apoptotic process(GO:0070244) |
0.1 | 0.1 | GO:0000965 | mitochondrial RNA 3'-end processing(GO:0000965) |
0.1 | 0.2 | GO:0002091 | negative regulation of receptor internalization(GO:0002091) |
0.1 | 0.3 | GO:0007288 | sperm axoneme assembly(GO:0007288) |
0.1 | 0.1 | GO:0048388 | endosomal lumen acidification(GO:0048388) |
0.1 | 0.2 | GO:0042148 | strand invasion(GO:0042148) |
0.1 | 0.3 | GO:0098870 | neuronal action potential propagation(GO:0019227) action potential propagation(GO:0098870) |
0.1 | 0.1 | GO:2000383 | regulation of ectoderm development(GO:2000383) negative regulation of ectoderm development(GO:2000384) |
0.1 | 0.2 | GO:0010572 | positive regulation of platelet activation(GO:0010572) |
0.1 | 0.1 | GO:0006907 | pinocytosis(GO:0006907) |
0.1 | 0.1 | GO:1902566 | regulation of eosinophil activation(GO:1902566) |
0.1 | 0.1 | GO:0009078 | alanine metabolic process(GO:0006522) pyruvate family amino acid metabolic process(GO:0009078) |
0.1 | 0.4 | GO:0016322 | neuron remodeling(GO:0016322) |
0.1 | 0.1 | GO:0090230 | regulation of centromere complex assembly(GO:0090230) |
0.1 | 0.3 | GO:0036303 | lymphangiogenesis(GO:0001946) lymph vessel morphogenesis(GO:0036303) |
0.1 | 0.1 | GO:1901228 | positive regulation of transcription from RNA polymerase II promoter involved in heart development(GO:1901228) |
0.1 | 0.3 | GO:0043687 | post-translational protein modification(GO:0043687) |
0.1 | 0.1 | GO:0010847 | regulation of chromatin assembly(GO:0010847) |
0.1 | 0.2 | GO:0000087 | mitotic M phase(GO:0000087) |
0.1 | 0.3 | GO:0006537 | glutamate biosynthetic process(GO:0006537) |
0.1 | 0.3 | GO:0051489 | regulation of filopodium assembly(GO:0051489) |
0.1 | 0.1 | GO:0007066 | female meiosis sister chromatid cohesion(GO:0007066) |
0.1 | 0.3 | GO:1901798 | positive regulation of signal transduction by p53 class mediator(GO:1901798) |
0.1 | 0.1 | GO:0003215 | cardiac right ventricle morphogenesis(GO:0003215) |
0.1 | 0.7 | GO:0006893 | Golgi to plasma membrane transport(GO:0006893) |
0.1 | 0.2 | GO:0070525 | tRNA threonylcarbamoyladenosine metabolic process(GO:0070525) |
0.1 | 0.1 | GO:0065002 | intracellular protein transmembrane transport(GO:0065002) protein transmembrane transport(GO:0071806) |
0.1 | 0.5 | GO:0034723 | DNA replication-dependent nucleosome assembly(GO:0006335) DNA replication-dependent nucleosome organization(GO:0034723) |
0.1 | 0.5 | GO:2000311 | regulation of alpha-amino-3-hydroxy-5-methyl-4-isoxazole propionate selective glutamate receptor activity(GO:2000311) |
0.1 | 0.2 | GO:0071712 | ER-associated misfolded protein catabolic process(GO:0071712) |
0.1 | 0.2 | GO:0042078 | germ-line stem cell division(GO:0042078) male germ-line stem cell asymmetric division(GO:0048133) germline stem cell asymmetric division(GO:0098728) |
0.1 | 0.4 | GO:0007202 | activation of phospholipase C activity(GO:0007202) |
0.1 | 0.3 | GO:0097062 | dendritic spine maintenance(GO:0097062) |
0.1 | 0.2 | GO:0046882 | negative regulation of follicle-stimulating hormone secretion(GO:0046882) |
0.1 | 0.1 | GO:0060316 | positive regulation of ryanodine-sensitive calcium-release channel activity(GO:0060316) |
0.1 | 0.2 | GO:0000183 | chromatin silencing at rDNA(GO:0000183) |
0.1 | 0.1 | GO:0006896 | Golgi to vacuole transport(GO:0006896) |
0.1 | 0.1 | GO:0040001 | establishment of mitotic spindle localization(GO:0040001) |
0.1 | 0.1 | GO:0002863 | positive regulation of inflammatory response to antigenic stimulus(GO:0002863) |
0.1 | 0.1 | GO:0006269 | DNA replication, synthesis of RNA primer(GO:0006269) |
0.1 | 0.3 | GO:0036336 | dendritic cell migration(GO:0036336) |
0.1 | 0.1 | GO:0034316 | negative regulation of Arp2/3 complex-mediated actin nucleation(GO:0034316) |
0.1 | 0.2 | GO:0033133 | positive regulation of glucokinase activity(GO:0033133) |
0.1 | 0.2 | GO:0042732 | D-xylose metabolic process(GO:0042732) |
0.1 | 0.5 | GO:0010800 | positive regulation of peptidyl-threonine phosphorylation(GO:0010800) |
0.1 | 0.1 | GO:0032075 | positive regulation of nuclease activity(GO:0032075) |
0.1 | 0.3 | GO:2000310 | regulation of N-methyl-D-aspartate selective glutamate receptor activity(GO:2000310) |
0.1 | 0.1 | GO:0035523 | protein K29-linked deubiquitination(GO:0035523) protein K33-linked deubiquitination(GO:1990168) |
0.1 | 0.2 | GO:0046598 | positive regulation of viral entry into host cell(GO:0046598) |
0.1 | 0.1 | GO:0002838 | negative regulation of response to tumor cell(GO:0002835) negative regulation of immune response to tumor cell(GO:0002838) |
0.1 | 0.2 | GO:0044838 | cell quiescence(GO:0044838) |
0.1 | 0.3 | GO:0002011 | morphogenesis of an epithelial sheet(GO:0002011) |
0.1 | 1.1 | GO:0016601 | Rac protein signal transduction(GO:0016601) |
0.1 | 0.1 | GO:1903261 | regulation of serine phosphorylation of STAT3 protein(GO:1903261) |
0.1 | 0.2 | GO:0051646 | mitochondrion localization(GO:0051646) |
0.1 | 0.5 | GO:0006298 | mismatch repair(GO:0006298) |
0.1 | 1.9 | GO:0032436 | positive regulation of proteasomal ubiquitin-dependent protein catabolic process(GO:0032436) |
0.1 | 0.1 | GO:1901419 | regulation of response to alcohol(GO:1901419) |
0.1 | 0.2 | GO:0006654 | phosphatidic acid biosynthetic process(GO:0006654) |
0.1 | 1.1 | GO:0001938 | positive regulation of endothelial cell proliferation(GO:0001938) |
0.1 | 0.4 | GO:0033599 | regulation of mammary gland epithelial cell proliferation(GO:0033599) |
0.1 | 0.3 | GO:0045603 | positive regulation of endothelial cell differentiation(GO:0045603) |
0.1 | 0.3 | GO:0016056 | rhodopsin mediated signaling pathway(GO:0016056) |
0.1 | 0.3 | GO:0090314 | positive regulation of protein targeting to membrane(GO:0090314) |
0.1 | 0.2 | GO:0000733 | DNA strand renaturation(GO:0000733) |
0.1 | 0.5 | GO:0035455 | response to interferon-alpha(GO:0035455) |
0.1 | 0.3 | GO:0034551 | respiratory chain complex III assembly(GO:0017062) mitochondrial respiratory chain complex III assembly(GO:0034551) mitochondrial respiratory chain complex III biogenesis(GO:0097033) |
0.1 | 0.4 | GO:0046599 | regulation of centriole replication(GO:0046599) |
0.1 | 0.1 | GO:0032792 | negative regulation of CREB transcription factor activity(GO:0032792) |
0.1 | 0.2 | GO:0035090 | maintenance of apical/basal cell polarity(GO:0035090) |
0.1 | 0.7 | GO:0019933 | cAMP-mediated signaling(GO:0019933) |
0.1 | 0.1 | GO:0060482 | lobar bronchus epithelium development(GO:0060481) lobar bronchus development(GO:0060482) |
0.1 | 0.2 | GO:0060561 | apoptotic process involved in morphogenesis(GO:0060561) |
0.1 | 0.3 | GO:0010971 | positive regulation of G2/M transition of mitotic cell cycle(GO:0010971) |
0.1 | 0.1 | GO:0006705 | mineralocorticoid biosynthetic process(GO:0006705) |
0.1 | 0.4 | GO:2000279 | negative regulation of DNA biosynthetic process(GO:2000279) |
0.1 | 0.2 | GO:0039694 | viral RNA genome replication(GO:0039694) RNA replication(GO:0039703) |
0.1 | 0.1 | GO:1901663 | quinone biosynthetic process(GO:1901663) |
0.1 | 0.1 | GO:0060161 | positive regulation of dopamine receptor signaling pathway(GO:0060161) |
0.1 | 0.1 | GO:1904816 | positive regulation of protein localization to chromosome, telomeric region(GO:1904816) |
0.1 | 0.2 | GO:0015842 | aminergic neurotransmitter loading into synaptic vesicle(GO:0015842) neurotransmitter loading into synaptic vesicle(GO:0098700) |
0.1 | 0.3 | GO:0021891 | olfactory bulb interneuron development(GO:0021891) |
0.1 | 0.1 | GO:0039534 | negative regulation of MDA-5 signaling pathway(GO:0039534) |
0.1 | 0.1 | GO:0071435 | potassium ion export(GO:0071435) |
0.1 | 0.9 | GO:0034394 | protein localization to cell surface(GO:0034394) |
0.1 | 0.1 | GO:0086043 | bundle of His cell to Purkinje myocyte signaling(GO:0086028) bundle of His cell action potential(GO:0086043) |
0.0 | 0.3 | GO:0046838 | phosphorylated carbohydrate dephosphorylation(GO:0046838) |
0.0 | 0.1 | GO:0071027 | nuclear RNA surveillance(GO:0071027) nuclear mRNA surveillance(GO:0071028) |
0.0 | 0.1 | GO:0005984 | disaccharide metabolic process(GO:0005984) |
0.0 | 0.1 | GO:1900745 | positive regulation of p38MAPK cascade(GO:1900745) |
0.0 | 0.1 | GO:0045161 | neuronal ion channel clustering(GO:0045161) |
0.0 | 0.2 | GO:0048305 | immunoglobulin secretion(GO:0048305) |
0.0 | 0.1 | GO:0045654 | positive regulation of megakaryocyte differentiation(GO:0045654) |
0.0 | 0.0 | GO:0035493 | SNARE complex assembly(GO:0035493) |
0.0 | 0.3 | GO:0045879 | negative regulation of smoothened signaling pathway(GO:0045879) |
0.0 | 0.1 | GO:0045636 | positive regulation of melanocyte differentiation(GO:0045636) |
0.0 | 0.0 | GO:0042541 | hemoglobin biosynthetic process(GO:0042541) |
0.0 | 0.1 | GO:0032026 | response to magnesium ion(GO:0032026) |
0.0 | 0.0 | GO:0098528 | skeletal muscle fiber differentiation(GO:0098528) |
0.0 | 0.2 | GO:0021859 | pyramidal neuron differentiation(GO:0021859) |
0.0 | 0.4 | GO:0001833 | inner cell mass cell proliferation(GO:0001833) |
0.0 | 0.5 | GO:0034389 | lipid particle organization(GO:0034389) |
0.0 | 1.7 | GO:0032543 | mitochondrial translation(GO:0032543) |
0.0 | 0.0 | GO:0006419 | alanyl-tRNA aminoacylation(GO:0006419) |
0.0 | 0.4 | GO:0002327 | immature B cell differentiation(GO:0002327) |
0.0 | 0.3 | GO:0036065 | fucosylation(GO:0036065) |
0.0 | 2.0 | GO:0031338 | regulation of vesicle fusion(GO:0031338) |
0.0 | 0.3 | GO:0051415 | interphase microtubule nucleation by interphase microtubule organizing center(GO:0051415) microtubule nucleation by microtubule organizing center(GO:0051418) |
0.0 | 0.2 | GO:0016081 | synaptic vesicle docking(GO:0016081) |
0.0 | 0.1 | GO:0060330 | regulation of response to interferon-gamma(GO:0060330) |
0.0 | 0.5 | GO:0002021 | response to dietary excess(GO:0002021) |
0.0 | 0.1 | GO:0002254 | kinin cascade(GO:0002254) |
0.0 | 0.9 | GO:0021799 | cerebral cortex radially oriented cell migration(GO:0021799) |
0.0 | 0.2 | GO:1901016 | regulation of potassium ion transmembrane transporter activity(GO:1901016) |
0.0 | 0.1 | GO:0070827 | chromatin maintenance(GO:0070827) |
0.0 | 0.1 | GO:0031639 | plasminogen activation(GO:0031639) |
0.0 | 0.3 | GO:0034063 | stress granule assembly(GO:0034063) |
0.0 | 0.2 | GO:0050884 | neuromuscular process controlling posture(GO:0050884) |
0.0 | 0.1 | GO:0006020 | inositol metabolic process(GO:0006020) |
0.0 | 0.1 | GO:0006265 | DNA topological change(GO:0006265) |
0.0 | 0.3 | GO:1902235 | regulation of endoplasmic reticulum stress-induced intrinsic apoptotic signaling pathway(GO:1902235) |
0.0 | 0.0 | GO:0061687 | detoxification of copper ion(GO:0010273) detoxification of inorganic compound(GO:0061687) stress response to copper ion(GO:1990169) |
0.0 | 0.1 | GO:0006349 | regulation of gene expression by genetic imprinting(GO:0006349) |
0.0 | 0.4 | GO:0006278 | RNA-dependent DNA biosynthetic process(GO:0006278) telomere maintenance via telomerase(GO:0007004) |
0.0 | 1.0 | GO:0086010 | membrane depolarization during action potential(GO:0086010) |
0.0 | 0.1 | GO:0019287 | isopentenyl diphosphate biosynthetic process(GO:0009240) isopentenyl diphosphate biosynthetic process, mevalonate pathway(GO:0019287) |
0.0 | 0.3 | GO:0010640 | regulation of platelet-derived growth factor receptor signaling pathway(GO:0010640) |
0.0 | 0.0 | GO:0043090 | amino acid import(GO:0043090) |
0.0 | 0.0 | GO:2001025 | positive regulation of response to drug(GO:2001025) |
0.0 | 0.1 | GO:0061368 | behavioral response to chemical pain(GO:0061366) behavioral response to formalin induced pain(GO:0061368) |
0.0 | 0.1 | GO:0060024 | rhythmic synaptic transmission(GO:0060024) |
0.0 | 0.0 | GO:1900194 | negative regulation of oocyte maturation(GO:1900194) |
0.0 | 0.6 | GO:0043968 | histone H2A acetylation(GO:0043968) |
0.0 | 0.0 | GO:0090258 | negative regulation of mitochondrial fission(GO:0090258) |
0.0 | 0.0 | GO:1904354 | negative regulation of telomere capping(GO:1904354) |
0.0 | 0.7 | GO:0015804 | neutral amino acid transport(GO:0015804) |
0.0 | 0.0 | GO:0044854 | plasma membrane raft assembly(GO:0044854) plasma membrane raft organization(GO:0044857) caveola assembly(GO:0070836) |
0.0 | 0.2 | GO:0051026 | chiasma assembly(GO:0051026) |
0.0 | 0.1 | GO:0030818 | negative regulation of cAMP biosynthetic process(GO:0030818) |
0.0 | 0.0 | GO:0051464 | positive regulation of cortisol secretion(GO:0051464) positive regulation of glucocorticoid secretion(GO:2000851) |
0.0 | 0.4 | GO:0071514 | genetic imprinting(GO:0071514) |
0.0 | 0.0 | GO:0060028 | convergent extension involved in axis elongation(GO:0060028) |
0.0 | 0.0 | GO:1902473 | regulation of protein localization to synapse(GO:1902473) |
0.0 | 0.5 | GO:0060712 | spongiotrophoblast layer development(GO:0060712) |
0.0 | 0.2 | GO:0036089 | cleavage furrow formation(GO:0036089) |
0.0 | 0.1 | GO:0090156 | negative regulation of sphingolipid biosynthetic process(GO:0090155) cellular sphingolipid homeostasis(GO:0090156) |
0.0 | 0.0 | GO:0061577 | calcium ion transmembrane transport via high voltage-gated calcium channel(GO:0061577) regulation of membrane repolarization during action potential(GO:0098903) |
0.0 | 0.1 | GO:0035036 | sperm-egg recognition(GO:0035036) |
0.0 | 0.3 | GO:0009992 | cellular water homeostasis(GO:0009992) |
0.0 | 0.1 | GO:0046884 | follicle-stimulating hormone secretion(GO:0046884) |
0.0 | 0.2 | GO:0002087 | regulation of respiratory gaseous exchange by neurological system process(GO:0002087) |
0.0 | 0.2 | GO:2000786 | positive regulation of autophagosome assembly(GO:2000786) |
0.0 | 0.1 | GO:0016198 | axon choice point recognition(GO:0016198) |
0.0 | 0.4 | GO:0015721 | bile acid and bile salt transport(GO:0015721) |
0.0 | 0.3 | GO:0000244 | spliceosomal tri-snRNP complex assembly(GO:0000244) |
0.0 | 0.1 | GO:0048245 | eosinophil chemotaxis(GO:0048245) |
0.0 | 0.6 | GO:0034446 | substrate adhesion-dependent cell spreading(GO:0034446) |
0.0 | 0.1 | GO:0030321 | transepithelial chloride transport(GO:0030321) |
0.0 | 0.3 | GO:0007194 | negative regulation of adenylate cyclase activity(GO:0007194) negative regulation of cyclase activity(GO:0031280) |
0.0 | 0.2 | GO:0006817 | phosphate ion transport(GO:0006817) |
0.0 | 0.2 | GO:0035811 | negative regulation of urine volume(GO:0035811) |
0.0 | 0.0 | GO:0061086 | negative regulation of histone H3-K27 methylation(GO:0061086) |
0.0 | 0.0 | GO:2000172 | regulation of branching morphogenesis of a nerve(GO:2000172) |
0.0 | 0.0 | GO:0007181 | transforming growth factor beta receptor complex assembly(GO:0007181) |
0.0 | 0.2 | GO:0034472 | snRNA 3'-end processing(GO:0034472) |
0.0 | 0.1 | GO:0014049 | positive regulation of glutamate secretion(GO:0014049) |
0.0 | 0.0 | GO:1900086 | regulation of peptidyl-tyrosine autophosphorylation(GO:1900084) positive regulation of peptidyl-tyrosine autophosphorylation(GO:1900086) |
0.0 | 0.0 | GO:0003266 | cardioblast proliferation(GO:0003263) regulation of cardioblast proliferation(GO:0003264) regulation of secondary heart field cardioblast proliferation(GO:0003266) |
0.0 | 0.1 | GO:0051899 | membrane depolarization(GO:0051899) |
0.0 | 0.0 | GO:0002317 | plasma cell differentiation(GO:0002317) |
0.0 | 0.0 | GO:0010739 | positive regulation of protein kinase A signaling(GO:0010739) |
0.0 | 1.4 | GO:0010501 | RNA secondary structure unwinding(GO:0010501) |
0.0 | 0.1 | GO:0050718 | positive regulation of interleukin-1 secretion(GO:0050716) positive regulation of interleukin-1 beta secretion(GO:0050718) |
0.0 | 0.1 | GO:1904406 | negative regulation of nitric oxide biosynthetic process(GO:0045019) negative regulation of nitric oxide metabolic process(GO:1904406) |
0.0 | 0.1 | GO:1900102 | negative regulation of endoplasmic reticulum unfolded protein response(GO:1900102) |
0.0 | 0.2 | GO:0070935 | 3'-UTR-mediated mRNA stabilization(GO:0070935) |
0.0 | 0.3 | GO:0070269 | pyroptosis(GO:0070269) |
0.0 | 0.1 | GO:0046501 | protoporphyrinogen IX metabolic process(GO:0046501) |
0.0 | 0.0 | GO:0045955 | negative regulation of calcium ion-dependent exocytosis(GO:0045955) |
0.0 | 0.0 | GO:0072537 | fibroblast activation(GO:0072537) |
0.0 | 0.2 | GO:0090136 | epithelial cell-cell adhesion(GO:0090136) |
0.0 | 0.0 | GO:0044314 | protein K27-linked ubiquitination(GO:0044314) |
0.0 | 0.0 | GO:0071694 | protein localization to extracellular region(GO:0071692) maintenance of protein location in extracellular region(GO:0071694) |
0.0 | 0.1 | GO:2000767 | positive regulation of cytoplasmic translation(GO:2000767) |
0.0 | 0.2 | GO:0060005 | vestibular reflex(GO:0060005) |
0.0 | 0.0 | GO:0021559 | trigeminal nerve development(GO:0021559) |
0.0 | 0.2 | GO:0002347 | response to tumor cell(GO:0002347) |
0.0 | 0.0 | GO:0051451 | myoblast migration(GO:0051451) |
0.0 | 0.0 | GO:0030046 | parallel actin filament bundle assembly(GO:0030046) |
0.0 | 0.1 | GO:1902916 | positive regulation of protein polyubiquitination(GO:1902916) |
0.0 | 0.2 | GO:0006108 | malate metabolic process(GO:0006108) |
0.0 | 0.0 | GO:0051096 | positive regulation of helicase activity(GO:0051096) |
0.0 | 0.0 | GO:0002829 | negative regulation of type 2 immune response(GO:0002829) |
0.0 | 0.1 | GO:0043516 | regulation of DNA damage response, signal transduction by p53 class mediator(GO:0043516) |
0.0 | 0.3 | GO:0035987 | endodermal cell differentiation(GO:0035987) |
0.0 | 0.0 | GO:0098722 | asymmetric neuroblast division(GO:0055059) asymmetric stem cell division(GO:0098722) |
0.0 | 0.4 | GO:0008045 | motor neuron axon guidance(GO:0008045) |
0.0 | 0.1 | GO:0045297 | mating plug formation(GO:0042628) post-mating behavior(GO:0045297) |
0.0 | 0.2 | GO:1901381 | positive regulation of potassium ion transmembrane transport(GO:1901381) |
0.0 | 0.3 | GO:0090023 | positive regulation of neutrophil chemotaxis(GO:0090023) |
0.0 | 0.2 | GO:0006346 | methylation-dependent chromatin silencing(GO:0006346) |
0.0 | 1.0 | GO:0016064 | immunoglobulin mediated immune response(GO:0016064) |
0.0 | 0.7 | GO:0008333 | endosome to lysosome transport(GO:0008333) |
0.0 | 0.0 | GO:0034134 | toll-like receptor 2 signaling pathway(GO:0034134) |
0.0 | 0.2 | GO:0007032 | endosome organization(GO:0007032) |
0.0 | 0.0 | GO:1902804 | negative regulation of synaptic vesicle transport(GO:1902804) |
0.0 | 0.3 | GO:0006027 | glycosaminoglycan catabolic process(GO:0006027) |
0.0 | 0.0 | GO:0010424 | DNA methylation on cytosine within a CG sequence(GO:0010424) DNA methylation on cytosine(GO:0032776) |
0.0 | 0.5 | GO:0016226 | iron-sulfur cluster assembly(GO:0016226) metallo-sulfur cluster assembly(GO:0031163) |
0.0 | 0.0 | GO:1904180 | negative regulation of mitochondrial depolarization(GO:0051902) negative regulation of membrane depolarization(GO:1904180) |
0.0 | 0.3 | GO:0021904 | dorsal/ventral neural tube patterning(GO:0021904) |
0.0 | 0.0 | GO:0060896 | neural plate pattern specification(GO:0060896) |
0.0 | 0.1 | GO:0045743 | positive regulation of fibroblast growth factor receptor signaling pathway(GO:0045743) |
0.0 | 0.0 | GO:1900736 | regulation of phospholipase C-activating G-protein coupled receptor signaling pathway(GO:1900736) positive regulation of phospholipase C-activating G-protein coupled receptor signaling pathway(GO:1900738) |
0.0 | 0.1 | GO:0003383 | apical constriction(GO:0003383) |
0.0 | 0.1 | GO:0010989 | negative regulation of low-density lipoprotein particle clearance(GO:0010989) |
0.0 | 0.2 | GO:0045324 | late endosome to vacuole transport(GO:0045324) |
0.0 | 0.1 | GO:0043278 | response to isoquinoline alkaloid(GO:0014072) response to morphine(GO:0043278) |
0.0 | 0.6 | GO:0045576 | mast cell activation(GO:0045576) |
0.0 | 0.0 | GO:0001692 | histamine metabolic process(GO:0001692) |
0.0 | 0.1 | GO:0007494 | midgut development(GO:0007494) |
0.0 | 0.1 | GO:0030952 | establishment or maintenance of cytoskeleton polarity(GO:0030952) |
0.0 | 1.7 | GO:0006338 | chromatin remodeling(GO:0006338) |
0.0 | 0.1 | GO:0003016 | respiratory system process(GO:0003016) |
0.0 | 0.1 | GO:0000059 | protein import into nucleus, docking(GO:0000059) |
0.0 | 0.0 | GO:1990086 | lens fiber cell apoptotic process(GO:1990086) |
0.0 | 0.0 | GO:0048757 | endosome to melanosome transport(GO:0035646) endosome to pigment granule transport(GO:0043485) pigment granule maturation(GO:0048757) |
0.0 | 0.3 | GO:0009409 | response to cold(GO:0009409) |
0.0 | 0.1 | GO:0051984 | positive regulation of chromosome segregation(GO:0051984) |
0.0 | 0.0 | GO:0032069 | regulation of nuclease activity(GO:0032069) |
0.0 | 0.1 | GO:0046386 | deoxyribose phosphate catabolic process(GO:0046386) |
0.0 | 0.0 | GO:0031652 | positive regulation of heat generation(GO:0031652) |
0.0 | 0.2 | GO:0019884 | antigen processing and presentation of exogenous antigen(GO:0019884) |
0.0 | 0.1 | GO:0002082 | regulation of oxidative phosphorylation(GO:0002082) |
0.0 | 0.1 | GO:1901740 | negative regulation of myoblast fusion(GO:1901740) |
0.0 | 0.1 | GO:0034983 | peptidyl-lysine deacetylation(GO:0034983) |
0.0 | 1.9 | GO:0042273 | ribosomal large subunit biogenesis(GO:0042273) |
0.0 | 0.1 | GO:0038030 | non-canonical Wnt signaling pathway via MAPK cascade(GO:0038030) non-canonical Wnt signaling pathway via JNK cascade(GO:0038031) |
0.0 | 0.1 | GO:0051771 | negative regulation of nitric-oxide synthase biosynthetic process(GO:0051771) |
0.0 | 0.1 | GO:0018206 | peptidyl-methionine modification(GO:0018206) |
0.0 | 0.2 | GO:0072661 | protein targeting to plasma membrane(GO:0072661) |
0.0 | 0.0 | GO:0045065 | cytotoxic T cell differentiation(GO:0045065) |
0.0 | 0.3 | GO:0014850 | response to muscle activity(GO:0014850) |
0.0 | 0.0 | GO:0097421 | liver regeneration(GO:0097421) |
0.0 | 0.0 | GO:0021626 | hindbrain maturation(GO:0021578) central nervous system maturation(GO:0021626) |
0.0 | 0.1 | GO:0010944 | negative regulation of transcription by competitive promoter binding(GO:0010944) |
0.0 | 0.1 | GO:0039532 | negative regulation of viral-induced cytoplasmic pattern recognition receptor signaling pathway(GO:0039532) |
0.0 | 0.2 | GO:0000076 | DNA replication checkpoint(GO:0000076) |
0.0 | 0.1 | GO:0033234 | negative regulation of protein sumoylation(GO:0033234) |
0.0 | 0.1 | GO:0035726 | common myeloid progenitor cell proliferation(GO:0035726) |
0.0 | 0.2 | GO:0043489 | RNA stabilization(GO:0043489) |
0.0 | 0.3 | GO:0090162 | establishment of epithelial cell polarity(GO:0090162) |
0.0 | 0.2 | GO:0018095 | protein polyglutamylation(GO:0018095) |
0.0 | 0.2 | GO:0042415 | norepinephrine metabolic process(GO:0042415) |
0.0 | 0.1 | GO:0045896 | regulation of transcription during mitosis(GO:0045896) positive regulation of transcription during mitosis(GO:0045897) |
0.0 | 0.1 | GO:0035372 | protein localization to microtubule(GO:0035372) |
0.0 | 0.1 | GO:0072643 | interferon-gamma secretion(GO:0072643) |
0.0 | 0.0 | GO:0097368 | establishment of Sertoli cell barrier(GO:0097368) |
0.0 | 0.0 | GO:1902630 | regulation of membrane hyperpolarization(GO:1902630) |
0.0 | 0.1 | GO:0002063 | chondrocyte development(GO:0002063) |
0.0 | 0.1 | GO:0043949 | regulation of cAMP-mediated signaling(GO:0043949) |
0.0 | 0.0 | GO:0015817 | histidine transport(GO:0015817) |
0.0 | 0.0 | GO:0021548 | pons development(GO:0021548) |
0.0 | 0.1 | GO:0008343 | adult feeding behavior(GO:0008343) |
0.0 | 0.0 | GO:0019372 | lipoxygenase pathway(GO:0019372) |
0.0 | 0.6 | GO:0031146 | SCF-dependent proteasomal ubiquitin-dependent protein catabolic process(GO:0031146) |
0.0 | 0.1 | GO:0010457 | centriole-centriole cohesion(GO:0010457) |
0.0 | 0.5 | GO:0035690 | cellular response to drug(GO:0035690) |
0.0 | 0.0 | GO:0009162 | deoxyribonucleoside monophosphate metabolic process(GO:0009162) |
0.0 | 0.1 | GO:0072012 | glomerulus vasculature development(GO:0072012) |
0.0 | 0.0 | GO:0097475 | motor neuron migration(GO:0097475) spinal cord motor neuron migration(GO:0097476) |
0.0 | 0.8 | GO:0001841 | neural tube formation(GO:0001841) |
0.0 | 0.2 | GO:0090200 | positive regulation of release of cytochrome c from mitochondria(GO:0090200) |
0.0 | 0.0 | GO:1902445 | regulation of mitochondrial membrane permeability involved in programmed necrotic cell death(GO:1902445) |
0.0 | 0.1 | GO:0043267 | negative regulation of potassium ion transport(GO:0043267) |
0.0 | 0.1 | GO:0006685 | sphingomyelin catabolic process(GO:0006685) |
0.0 | 0.1 | GO:0002675 | positive regulation of acute inflammatory response(GO:0002675) |
0.0 | 0.3 | GO:0034219 | carbohydrate transmembrane transport(GO:0034219) |
0.0 | 0.1 | GO:0007398 | ectoderm development(GO:0007398) |
0.0 | 0.1 | GO:1904059 | regulation of locomotor rhythm(GO:1904059) |
0.0 | 0.0 | GO:0030815 | negative regulation of cAMP metabolic process(GO:0030815) |
0.0 | 0.0 | GO:0051589 | negative regulation of neurotransmitter transport(GO:0051589) |
0.0 | 0.3 | GO:0070208 | protein heterotrimerization(GO:0070208) |
0.0 | 0.0 | GO:0002525 | acute inflammatory response to non-antigenic stimulus(GO:0002525) |
0.0 | 0.0 | GO:0014029 | neural crest formation(GO:0014029) |
0.0 | 0.0 | GO:2000821 | regulation of grooming behavior(GO:2000821) |
0.0 | 0.0 | GO:1904396 | regulation of synaptic growth at neuromuscular junction(GO:0008582) regulation of neuromuscular junction development(GO:1904396) |
0.0 | 0.1 | GO:0043162 | ubiquitin-dependent protein catabolic process via the multivesicular body sorting pathway(GO:0043162) |
0.0 | 0.1 | GO:0045063 | T-helper 1 cell differentiation(GO:0045063) |
0.0 | 0.0 | GO:0019042 | viral latency(GO:0019042) |
0.0 | 0.1 | GO:0006002 | fructose 6-phosphate metabolic process(GO:0006002) |
0.0 | 0.0 | GO:0051103 | DNA ligation involved in DNA repair(GO:0051103) |
0.0 | 0.2 | GO:0032897 | negative regulation of viral transcription(GO:0032897) |
0.0 | 0.0 | GO:0006361 | transcription initiation from RNA polymerase I promoter(GO:0006361) |
0.0 | 0.1 | GO:0033690 | positive regulation of osteoblast proliferation(GO:0033690) |
0.0 | 0.1 | GO:0032060 | bleb assembly(GO:0032060) |
0.0 | 0.2 | GO:0042407 | cristae formation(GO:0042407) |
0.0 | 0.1 | GO:0050765 | negative regulation of phagocytosis(GO:0050765) |
0.0 | 0.1 | GO:0006729 | tetrahydrobiopterin biosynthetic process(GO:0006729) |
0.0 | 0.0 | GO:0060648 | mammary gland bud morphogenesis(GO:0060648) |
0.0 | 0.0 | GO:0051541 | elastin metabolic process(GO:0051541) |
0.0 | 0.1 | GO:0035262 | gonad morphogenesis(GO:0035262) |
0.0 | 0.1 | GO:0042428 | serotonin metabolic process(GO:0042428) |
0.0 | 0.0 | GO:0002442 | serotonin production involved in inflammatory response(GO:0002351) serotonin secretion involved in inflammatory response(GO:0002442) serotonin secretion by platelet(GO:0002554) |
0.0 | 0.1 | GO:0042270 | protection from natural killer cell mediated cytotoxicity(GO:0042270) |
0.0 | 0.1 | GO:0022615 | protein to membrane docking(GO:0022615) |
0.0 | 2.3 | GO:0098780 | mitophagy in response to mitochondrial depolarization(GO:0098779) response to mitochondrial depolarisation(GO:0098780) |
0.0 | 0.1 | GO:0006597 | spermine biosynthetic process(GO:0006597) |
0.0 | 0.1 | GO:0010172 | embryonic body morphogenesis(GO:0010172) |
0.0 | 0.1 | GO:0042780 | tRNA 3'-end processing(GO:0042780) |
0.0 | 0.0 | GO:0098901 | regulation of cardiac muscle cell action potential(GO:0098901) |
0.0 | 0.0 | GO:0002576 | platelet degranulation(GO:0002576) |
0.0 | 0.0 | GO:1904714 | regulation of chaperone-mediated autophagy(GO:1904714) |
0.0 | 0.1 | GO:0042699 | follicle-stimulating hormone signaling pathway(GO:0042699) |
0.0 | 0.6 | GO:0034728 | nucleosome organization(GO:0034728) |
0.0 | 0.5 | GO:0019730 | antimicrobial humoral response(GO:0019730) |
0.0 | 0.0 | GO:0030011 | maintenance of cell polarity(GO:0030011) |
0.0 | 0.1 | GO:0007168 | receptor guanylyl cyclase signaling pathway(GO:0007168) |
0.0 | 0.2 | GO:0031572 | G2 DNA damage checkpoint(GO:0031572) |
0.0 | 0.1 | GO:1903887 | motile primary cilium assembly(GO:1903887) |
0.0 | 0.5 | GO:0007588 | excretion(GO:0007588) |
0.0 | 0.2 | GO:0033750 | ribosomal subunit export from nucleus(GO:0000054) ribosome localization(GO:0033750) establishment of ribosome localization(GO:0033753) |
0.0 | 0.0 | GO:0034241 | positive regulation of macrophage fusion(GO:0034241) |
0.0 | 0.3 | GO:0070897 | DNA-templated transcriptional preinitiation complex assembly(GO:0070897) |
0.0 | 0.1 | GO:0072505 | divalent inorganic anion homeostasis(GO:0072505) |
0.0 | 0.1 | GO:0051546 | keratinocyte migration(GO:0051546) |
0.0 | 0.5 | GO:0061512 | protein localization to cilium(GO:0061512) |
0.0 | 0.0 | GO:0030240 | skeletal muscle thin filament assembly(GO:0030240) |
0.0 | 0.2 | GO:0042474 | middle ear morphogenesis(GO:0042474) |
0.0 | 0.1 | GO:0007258 | JUN phosphorylation(GO:0007258) |
0.0 | 0.1 | GO:0007000 | nucleolus organization(GO:0007000) |
0.0 | 0.0 | GO:0090403 | oxidative stress-induced premature senescence(GO:0090403) |
0.0 | 0.5 | GO:0031398 | positive regulation of protein ubiquitination(GO:0031398) |
0.0 | 0.0 | GO:0051764 | actin crosslink formation(GO:0051764) |
0.0 | 0.1 | GO:2001258 | negative regulation of cation channel activity(GO:2001258) |
0.0 | 0.3 | GO:0016578 | histone deubiquitination(GO:0016578) |
0.0 | 0.1 | GO:0033504 | floor plate development(GO:0033504) |
0.0 | 0.1 | GO:0048246 | macrophage chemotaxis(GO:0048246) |
0.0 | 0.0 | GO:0001555 | oocyte growth(GO:0001555) |
0.0 | 0.1 | GO:0021889 | olfactory bulb interneuron differentiation(GO:0021889) |
0.0 | 0.0 | GO:0021569 | rhombomere 3 development(GO:0021569) rhombomere 4 development(GO:0021570) |
0.0 | 0.2 | GO:0046348 | amino sugar catabolic process(GO:0046348) |
0.0 | 0.0 | GO:1905097 | regulation of guanyl-nucleotide exchange factor activity(GO:1905097) |
0.0 | 0.1 | GO:0044786 | cell cycle DNA replication(GO:0044786) |
0.0 | 0.4 | GO:0030032 | lamellipodium assembly(GO:0030032) |
0.0 | 0.0 | GO:2000058 | regulation of protein ubiquitination involved in ubiquitin-dependent protein catabolic process(GO:2000058) |
0.0 | 0.1 | GO:1900264 | regulation of DNA-directed DNA polymerase activity(GO:1900262) positive regulation of DNA-directed DNA polymerase activity(GO:1900264) |
0.0 | 0.2 | GO:1900017 | positive regulation of cytokine production involved in inflammatory response(GO:1900017) |
0.0 | 0.0 | GO:1903960 | negative regulation of anion transmembrane transport(GO:1903960) |
0.0 | 0.1 | GO:0050665 | hydrogen peroxide biosynthetic process(GO:0050665) |
0.0 | 0.1 | GO:0007289 | spermatid nucleus differentiation(GO:0007289) |
0.0 | 0.0 | GO:0072584 | caveolin-mediated endocytosis(GO:0072584) |
0.0 | 0.2 | GO:0045109 | intermediate filament organization(GO:0045109) |
0.0 | 0.0 | GO:0014826 | vein smooth muscle contraction(GO:0014826) |
0.0 | 0.0 | GO:0032914 | positive regulation of transforming growth factor beta1 production(GO:0032914) |
0.0 | 0.3 | GO:0007006 | mitochondrial membrane organization(GO:0007006) |
0.0 | 0.1 | GO:0071044 | histone mRNA catabolic process(GO:0071044) |
0.0 | 0.1 | GO:2000270 | negative regulation of fibroblast apoptotic process(GO:2000270) |
0.0 | 0.0 | GO:0090151 | establishment of protein localization to mitochondrial membrane(GO:0090151) |
0.0 | 0.3 | GO:1990542 | mitochondrial transmembrane transport(GO:1990542) |
0.0 | 0.4 | GO:0015914 | phospholipid transport(GO:0015914) |
0.0 | 0.3 | GO:0006607 | NLS-bearing protein import into nucleus(GO:0006607) |
0.0 | 0.1 | GO:0070286 | axonemal dynein complex assembly(GO:0070286) |
0.0 | 0.3 | GO:0032784 | regulation of DNA-templated transcription, elongation(GO:0032784) |
0.0 | 0.2 | GO:0097352 | autophagosome maturation(GO:0097352) |
0.0 | 0.0 | GO:1901722 | regulation of cell proliferation involved in kidney development(GO:1901722) |
0.0 | 0.1 | GO:0035871 | protein K11-linked deubiquitination(GO:0035871) |
0.0 | 0.0 | GO:0003056 | regulation of vascular smooth muscle contraction(GO:0003056) |
0.0 | 0.3 | GO:2001014 | regulation of skeletal muscle cell differentiation(GO:2001014) |
0.0 | 0.4 | GO:0070979 | protein K11-linked ubiquitination(GO:0070979) |
0.0 | 0.2 | GO:0032456 | endocytic recycling(GO:0032456) |
0.0 | 0.0 | GO:0045342 | MHC class II biosynthetic process(GO:0045342) |
0.0 | 0.0 | GO:0018199 | peptidyl-glutamine modification(GO:0018199) |
0.0 | 0.1 | GO:0003310 | pancreatic A cell differentiation(GO:0003310) |
0.0 | 0.1 | GO:0046292 | formaldehyde metabolic process(GO:0046292) |
0.0 | 0.0 | GO:2000105 | positive regulation of DNA-dependent DNA replication(GO:2000105) |
0.0 | 0.1 | GO:0042989 | sequestering of actin monomers(GO:0042989) |
0.0 | 0.0 | GO:1904528 | regulation of microtubule binding(GO:1904526) positive regulation of microtubule binding(GO:1904528) |
0.0 | 0.0 | GO:0007413 | axonal fasciculation(GO:0007413) |
0.0 | 0.1 | GO:0014046 | dopamine secretion(GO:0014046) regulation of dopamine secretion(GO:0014059) |
0.0 | 0.6 | GO:0050728 | negative regulation of inflammatory response(GO:0050728) |
0.0 | 0.1 | GO:0060390 | regulation of SMAD protein import into nucleus(GO:0060390) |
0.0 | 0.0 | GO:0043652 | engulfment of apoptotic cell(GO:0043652) |
0.0 | 0.2 | GO:0060122 | inner ear receptor stereocilium organization(GO:0060122) |
0.0 | 0.1 | GO:1901796 | regulation of signal transduction by p53 class mediator(GO:1901796) |
0.0 | 0.1 | GO:0031053 | primary miRNA processing(GO:0031053) |
0.0 | 0.3 | GO:0007602 | phototransduction(GO:0007602) |
0.0 | 0.1 | GO:0060236 | regulation of mitotic spindle organization(GO:0060236) |
0.0 | 0.2 | GO:0015693 | magnesium ion transport(GO:0015693) |
0.0 | 0.2 | GO:0000028 | ribosomal small subunit assembly(GO:0000028) |
0.0 | 1.4 | GO:0007601 | visual perception(GO:0007601) |
0.0 | 0.0 | GO:0032769 | negative regulation of monooxygenase activity(GO:0032769) |
0.0 | 0.2 | GO:0000086 | G2/M transition of mitotic cell cycle(GO:0000086) |
0.0 | 0.2 | GO:0006890 | retrograde vesicle-mediated transport, Golgi to ER(GO:0006890) |
0.0 | 0.2 | GO:0042832 | defense response to protozoan(GO:0042832) |
0.0 | 0.1 | GO:0002819 | regulation of adaptive immune response(GO:0002819) |
0.0 | 0.1 | GO:0060017 | parathyroid gland development(GO:0060017) |
0.0 | 0.1 | GO:0032232 | negative regulation of actin filament bundle assembly(GO:0032232) |
0.0 | 0.0 | GO:0036091 | positive regulation of transcription from RNA polymerase II promoter in response to oxidative stress(GO:0036091) |
0.0 | 0.1 | GO:0045601 | regulation of endothelial cell differentiation(GO:0045601) |
0.0 | 0.1 | GO:0097341 | inhibition of cysteine-type endopeptidase activity(GO:0097340) zymogen inhibition(GO:0097341) inhibition of cysteine-type endopeptidase activity involved in apoptotic process(GO:1990001) |
0.0 | 0.1 | GO:0045925 | positive regulation of female receptivity(GO:0045925) |
0.0 | 0.0 | GO:0098763 | mitotic cell cycle phase(GO:0098763) |
0.0 | 0.6 | GO:0043038 | tRNA aminoacylation for protein translation(GO:0006418) amino acid activation(GO:0043038) |
0.0 | 0.5 | GO:0006367 | transcription initiation from RNA polymerase II promoter(GO:0006367) |
0.0 | 0.0 | GO:0071596 | ubiquitin-dependent protein catabolic process via the N-end rule pathway(GO:0071596) |
0.0 | 0.0 | GO:0070973 | protein localization to endoplasmic reticulum exit site(GO:0070973) |
0.0 | 0.0 | GO:0070989 | oxidative demethylation(GO:0070989) |
0.0 | 0.1 | GO:0050774 | negative regulation of dendrite morphogenesis(GO:0050774) |
0.0 | 0.0 | GO:0051988 | regulation of attachment of spindle microtubules to kinetochore(GO:0051988) |
0.0 | 0.1 | GO:0048934 | peripheral nervous system neuron differentiation(GO:0048934) peripheral nervous system neuron development(GO:0048935) |
0.0 | 0.2 | GO:0035082 | axoneme assembly(GO:0035082) |
0.0 | 0.1 | GO:2000628 | regulation of miRNA metabolic process(GO:2000628) |
0.0 | 0.0 | GO:0002281 | macrophage activation involved in immune response(GO:0002281) |
0.0 | 0.0 | GO:0045652 | regulation of megakaryocyte differentiation(GO:0045652) |
0.0 | 0.0 | GO:0006407 | rRNA export from nucleus(GO:0006407) |
0.0 | 0.1 | GO:0007635 | chemosensory behavior(GO:0007635) |
0.0 | 0.1 | GO:0072526 | pyridine-containing compound catabolic process(GO:0072526) |
0.0 | 0.1 | GO:0048266 | behavioral response to pain(GO:0048266) |
0.0 | 0.0 | GO:0031049 | programmed DNA elimination(GO:0031049) chromosome breakage(GO:0031052) |
0.0 | 0.0 | GO:0006393 | termination of mitochondrial transcription(GO:0006393) |
0.0 | 0.0 | GO:0032239 | regulation of nucleobase-containing compound transport(GO:0032239) regulation of RNA export from nucleus(GO:0046831) |
0.0 | 0.0 | GO:1903726 | negative regulation of phospholipid metabolic process(GO:1903726) regulation of phosphatidylcholine biosynthetic process(GO:2001245) |
0.0 | 0.1 | GO:0006828 | manganese ion transport(GO:0006828) |
0.0 | 0.2 | GO:0080171 | lysosome organization(GO:0007040) lytic vacuole organization(GO:0080171) |
0.0 | 0.0 | GO:0050482 | arachidonic acid secretion(GO:0050482) arachidonate transport(GO:1903963) |
0.0 | 0.0 | GO:0046834 | lipid phosphorylation(GO:0046834) |
0.0 | 0.1 | GO:0090073 | positive regulation of protein homodimerization activity(GO:0090073) |
0.0 | 0.1 | GO:0003334 | keratinocyte development(GO:0003334) |
0.0 | 0.0 | GO:1900619 | acetylcholine metabolic process(GO:0008291) acetate ester metabolic process(GO:1900619) |
0.0 | 0.1 | GO:0001514 | selenocysteine incorporation(GO:0001514) translational readthrough(GO:0006451) |
0.0 | 0.0 | GO:2001044 | regulation of integrin-mediated signaling pathway(GO:2001044) |
0.0 | 0.1 | GO:0030091 | protein repair(GO:0030091) |
0.0 | 0.0 | GO:0016553 | base conversion or substitution editing(GO:0016553) |
0.0 | 0.1 | GO:0016266 | O-glycan processing(GO:0016266) |
0.0 | 0.0 | GO:0030167 | proteoglycan catabolic process(GO:0030167) |
0.0 | 0.1 | GO:0030575 | nuclear body organization(GO:0030575) |
0.0 | 0.2 | GO:1902749 | regulation of cell cycle G2/M phase transition(GO:1902749) |
0.0 | 0.0 | GO:0061047 | foregut regionalization(GO:0060423) lung field specification(GO:0060424) primary lung bud formation(GO:0060431) lung induction(GO:0060492) positive regulation of branching involved in lung morphogenesis(GO:0061047) |
0.0 | 1.7 | GO:0006887 | exocytosis(GO:0006887) |
0.0 | 0.0 | GO:0051132 | NK T cell activation(GO:0051132) |
0.0 | 0.0 | GO:0015884 | folic acid transport(GO:0015884) |
0.0 | 0.0 | GO:0035902 | response to immobilization stress(GO:0035902) |
0.0 | 0.1 | GO:0006689 | ganglioside catabolic process(GO:0006689) |
0.0 | 0.1 | GO:0034498 | early endosome to Golgi transport(GO:0034498) |
0.0 | 0.0 | GO:1901888 | regulation of cell junction assembly(GO:1901888) |
0.0 | 0.0 | GO:2000463 | positive regulation of excitatory postsynaptic potential(GO:2000463) |
0.0 | 0.0 | GO:0032793 | positive regulation of CREB transcription factor activity(GO:0032793) |
0.0 | 0.1 | GO:0035641 | locomotory exploration behavior(GO:0035641) |
0.0 | 0.0 | GO:0098795 | mRNA cleavage involved in gene silencing by miRNA(GO:0035279) mRNA cleavage involved in gene silencing(GO:0098795) |
0.0 | 0.0 | GO:0035414 | negative regulation of catenin import into nucleus(GO:0035414) |
0.0 | 0.0 | GO:0015812 | gamma-aminobutyric acid transport(GO:0015812) |
0.0 | 0.0 | GO:0030823 | regulation of cGMP metabolic process(GO:0030823) |
0.0 | 0.2 | GO:0016180 | snRNA processing(GO:0016180) |
0.0 | 0.0 | GO:0031000 | response to caffeine(GO:0031000) |
0.0 | 0.0 | GO:0030259 | lipid glycosylation(GO:0030259) |
0.0 | 0.7 | GO:0051028 | mRNA transport(GO:0051028) |
0.0 | 0.0 | GO:0008635 | activation of cysteine-type endopeptidase activity involved in apoptotic process by cytochrome c(GO:0008635) |
0.0 | 0.1 | GO:0016926 | protein desumoylation(GO:0016926) |
0.0 | 0.1 | GO:0034453 | microtubule anchoring(GO:0034453) |
0.0 | 0.0 | GO:0015781 | nucleotide-sugar transport(GO:0015780) pyrimidine nucleotide-sugar transport(GO:0015781) |
0.0 | 0.1 | GO:0009312 | oligosaccharide biosynthetic process(GO:0009312) |
0.0 | 0.0 | GO:0000960 | mitochondrial RNA catabolic process(GO:0000957) regulation of mitochondrial RNA catabolic process(GO:0000960) |
0.0 | 0.0 | GO:1903376 | neuron intrinsic apoptotic signaling pathway in response to oxidative stress(GO:0036480) regulation of oxidative stress-induced neuron intrinsic apoptotic signaling pathway(GO:1903376) |
0.0 | 0.4 | GO:0006505 | GPI anchor metabolic process(GO:0006505) |
0.0 | 0.0 | GO:0000389 | mRNA 3'-splice site recognition(GO:0000389) |
0.0 | 0.1 | GO:0035640 | exploration behavior(GO:0035640) |
0.0 | 0.1 | GO:0080009 | mRNA methylation(GO:0080009) |
0.0 | 0.1 | GO:0030309 | poly-N-acetyllactosamine metabolic process(GO:0030309) poly-N-acetyllactosamine biosynthetic process(GO:0030311) |
0.0 | 0.0 | GO:0030908 | intein-mediated protein splicing(GO:0016539) protein splicing(GO:0030908) |
0.0 | 0.0 | GO:0032730 | positive regulation of interleukin-1 alpha production(GO:0032730) |
0.0 | 0.0 | GO:0060662 | tube lumen cavitation(GO:0060605) salivary gland cavitation(GO:0060662) |
0.0 | 0.0 | GO:0048859 | formation of anatomical boundary(GO:0048859) stem cell fate commitment(GO:0048865) |
0.0 | 0.0 | GO:0090184 | positive regulation of kidney development(GO:0090184) |
0.0 | 0.0 | GO:0097186 | amelogenesis(GO:0097186) |
0.0 | 0.0 | GO:0035336 | long-chain fatty-acyl-CoA metabolic process(GO:0035336) |
0.0 | 0.1 | GO:0044030 | regulation of DNA methylation(GO:0044030) |
0.0 | 0.0 | GO:0042249 | establishment of planar polarity of embryonic epithelium(GO:0042249) |
0.0 | 0.0 | GO:0021516 | dorsal spinal cord development(GO:0021516) |
0.0 | 0.0 | GO:0019336 | phenol-containing compound catabolic process(GO:0019336) |
0.0 | 0.1 | GO:0032196 | transposition(GO:0032196) |
0.0 | 0.1 | GO:0042487 | regulation of odontogenesis of dentin-containing tooth(GO:0042487) |
0.0 | 0.0 | GO:0007220 | Notch receptor processing(GO:0007220) |
0.0 | 0.1 | GO:0035094 | response to nicotine(GO:0035094) |
0.0 | 0.1 | GO:0045292 | mRNA cis splicing, via spliceosome(GO:0045292) |
0.0 | 0.1 | GO:0000338 | protein deneddylation(GO:0000338) |
0.0 | 0.0 | GO:0060056 | mammary gland involution(GO:0060056) |
0.0 | 0.0 | GO:1901668 | regulation of superoxide dismutase activity(GO:1901668) |
0.0 | 0.1 | GO:0048490 | anterograde synaptic vesicle transport(GO:0048490) synaptic vesicle cytoskeletal transport(GO:0099514) synaptic vesicle transport along microtubule(GO:0099517) |
0.0 | 0.3 | GO:0000462 | maturation of SSU-rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000462) |
0.0 | 0.0 | GO:0032331 | negative regulation of chondrocyte differentiation(GO:0032331) |
0.0 | 0.1 | GO:0006614 | SRP-dependent cotranslational protein targeting to membrane(GO:0006614) |
0.0 | 0.0 | GO:0060632 | regulation of microtubule-based movement(GO:0060632) |
0.0 | 0.1 | GO:0008340 | determination of adult lifespan(GO:0008340) |
0.0 | 0.0 | GO:2000402 | negative regulation of lymphocyte migration(GO:2000402) |
0.0 | 0.0 | GO:0071838 | cell proliferation in bone marrow(GO:0071838) positive regulation of cell proliferation in bone marrow(GO:0071864) |
0.0 | 0.0 | GO:0032488 | substrate-dependent cell migration, cell extension(GO:0006930) Cdc42 protein signal transduction(GO:0032488) |
0.0 | 0.1 | GO:0090502 | RNA phosphodiester bond hydrolysis, endonucleolytic(GO:0090502) |
0.0 | 0.2 | GO:0035456 | response to interferon-beta(GO:0035456) |
0.0 | 0.0 | GO:0070828 | heterochromatin organization(GO:0070828) |
0.0 | 0.0 | GO:0046103 | inosine biosynthetic process(GO:0046103) |
0.0 | 0.4 | GO:0000910 | cytokinesis(GO:0000910) |
0.0 | 0.0 | GO:0086069 | bundle of His cell to Purkinje myocyte communication(GO:0086069) |
0.0 | 0.0 | GO:0021554 | optic nerve development(GO:0021554) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
1.0 | 3.1 | GO:0032937 | SREBP-SCAP-Insig complex(GO:0032937) |
0.6 | 4.5 | GO:0005577 | fibrinogen complex(GO:0005577) |
0.6 | 1.9 | GO:0097443 | sorting endosome(GO:0097443) |
0.6 | 1.7 | GO:1990635 | proximal dendrite(GO:1990635) |
0.5 | 1.5 | GO:0034366 | spherical high-density lipoprotein particle(GO:0034366) |
0.5 | 2.9 | GO:0000138 | Golgi trans cisterna(GO:0000138) |
0.5 | 1.4 | GO:0036488 | CHOP-C/EBP complex(GO:0036488) |
0.4 | 1.2 | GO:0031985 | Golgi cisterna(GO:0031985) |
0.4 | 2.0 | GO:0097255 | R2TP complex(GO:0097255) |
0.4 | 0.8 | GO:0032593 | insulin-responsive compartment(GO:0032593) |
0.3 | 2.4 | GO:0043083 | synaptic cleft(GO:0043083) |
0.3 | 2.3 | GO:0097197 | tetraspanin-enriched microdomain(GO:0097197) |
0.3 | 2.6 | GO:0034992 | microtubule organizing center attachment site(GO:0034992) LINC complex(GO:0034993) |
0.3 | 1.0 | GO:0071942 | XPC complex(GO:0071942) |
0.3 | 1.3 | GO:0000214 | tRNA-intron endonuclease complex(GO:0000214) |
0.3 | 0.6 | GO:0005579 | membrane attack complex(GO:0005579) |
0.3 | 1.8 | GO:0030670 | phagocytic vesicle membrane(GO:0030670) |
0.3 | 0.6 | GO:0031983 | vesicle lumen(GO:0031983) |
0.3 | 1.1 | GO:0071141 | SMAD protein complex(GO:0071141) |
0.3 | 1.4 | GO:0042406 | extrinsic component of endoplasmic reticulum membrane(GO:0042406) |
0.3 | 1.1 | GO:1990246 | uniplex complex(GO:1990246) |
0.3 | 1.3 | GO:0072559 | NLRP3 inflammasome complex(GO:0072559) |
0.3 | 3.2 | GO:0042627 | chylomicron(GO:0042627) |
0.3 | 0.8 | GO:0005955 | calcineurin complex(GO:0005955) |
0.3 | 1.0 | GO:0097433 | dense body(GO:0097433) |
0.3 | 0.8 | GO:1990462 | omegasome(GO:1990462) |
0.3 | 1.5 | GO:0098645 | collagen type IV trimer(GO:0005587) network-forming collagen trimer(GO:0098642) collagen network(GO:0098645) basement membrane collagen trimer(GO:0098651) |
0.2 | 0.7 | GO:0000242 | pericentriolar material(GO:0000242) |
0.2 | 1.4 | GO:0016589 | NURF complex(GO:0016589) |
0.2 | 0.9 | GO:0071797 | LUBAC complex(GO:0071797) |
0.2 | 0.2 | GO:0008091 | spectrin(GO:0008091) |
0.2 | 0.5 | GO:0031298 | replication fork protection complex(GO:0031298) |
0.2 | 0.5 | GO:0035355 | Toll-like receptor 2-Toll-like receptor 6 protein complex(GO:0035355) |
0.2 | 1.4 | GO:0036513 | Derlin-1 retrotranslocation complex(GO:0036513) |
0.2 | 1.6 | GO:0032009 | early phagosome(GO:0032009) |
0.2 | 0.2 | GO:0044298 | neuronal cell body membrane(GO:0032809) cell body membrane(GO:0044298) |
0.2 | 1.3 | GO:1990454 | L-type voltage-gated calcium channel complex(GO:1990454) |
0.2 | 0.6 | GO:1990761 | growth cone lamellipodium(GO:1990761) |
0.2 | 2.1 | GO:0016600 | flotillin complex(GO:0016600) |
0.2 | 0.6 | GO:0042470 | melanosome(GO:0042470) pigment granule(GO:0048770) |
0.2 | 3.2 | GO:0070971 | endoplasmic reticulum exit site(GO:0070971) |
0.2 | 1.1 | GO:0031838 | haptoglobin-hemoglobin complex(GO:0031838) |
0.2 | 0.2 | GO:0032839 | dendrite cytoplasm(GO:0032839) |
0.2 | 0.2 | GO:0030286 | dynein complex(GO:0030286) |
0.2 | 5.1 | GO:0000407 | pre-autophagosomal structure(GO:0000407) |
0.2 | 1.0 | GO:0033063 | Rad51B-Rad51C-Rad51D-XRCC2 complex(GO:0033063) |
0.2 | 1.0 | GO:0033588 | Elongator holoenzyme complex(GO:0033588) |
0.2 | 0.8 | GO:0000322 | storage vacuole(GO:0000322) |
0.2 | 5.0 | GO:0055038 | recycling endosome membrane(GO:0055038) |
0.2 | 0.5 | GO:0030175 | filopodium(GO:0030175) |
0.2 | 2.4 | GO:0031528 | microvillus membrane(GO:0031528) |
0.2 | 0.7 | GO:0032777 | Piccolo NuA4 histone acetyltransferase complex(GO:0032777) |
0.2 | 0.4 | GO:0070765 | gamma-secretase complex(GO:0070765) |
0.2 | 0.4 | GO:0031512 | motile primary cilium(GO:0031512) |
0.2 | 2.5 | GO:0031527 | filopodium membrane(GO:0031527) |
0.2 | 0.2 | GO:0031264 | death-inducing signaling complex(GO:0031264) |
0.2 | 0.7 | GO:0005947 | mitochondrial alpha-ketoglutarate dehydrogenase complex(GO:0005947) |
0.2 | 2.6 | GO:0031231 | intrinsic component of peroxisomal membrane(GO:0031231) |
0.2 | 0.3 | GO:0097454 | Schwann cell microvillus(GO:0097454) |
0.2 | 0.3 | GO:0097386 | glial cell projection(GO:0097386) |
0.2 | 0.9 | GO:0031091 | platelet alpha granule(GO:0031091) |
0.2 | 0.7 | GO:0097136 | Bcl-2 family protein complex(GO:0097136) |
0.2 | 0.5 | GO:0005606 | laminin-1 complex(GO:0005606) |
0.2 | 0.5 | GO:0097543 | ciliary inversin compartment(GO:0097543) |
0.2 | 0.7 | GO:0090571 | RNA polymerase II transcription repressor complex(GO:0090571) |
0.2 | 1.9 | GO:0031011 | Ino80 complex(GO:0031011) |
0.2 | 0.3 | GO:0031258 | lamellipodium membrane(GO:0031258) |
0.2 | 0.9 | GO:0031232 | extrinsic component of external side of plasma membrane(GO:0031232) |
0.2 | 1.9 | GO:0016514 | SWI/SNF complex(GO:0016514) |
0.2 | 0.5 | GO:0071953 | elastic fiber(GO:0071953) |
0.2 | 2.9 | GO:0005782 | peroxisomal matrix(GO:0005782) microbody lumen(GO:0031907) |
0.2 | 1.9 | GO:0031229 | integral component of nuclear inner membrane(GO:0005639) intrinsic component of nuclear inner membrane(GO:0031229) nuclear membrane part(GO:0044453) |
0.2 | 0.3 | GO:0071564 | npBAF complex(GO:0071564) |
0.2 | 0.8 | GO:0005638 | lamin filament(GO:0005638) |
0.2 | 0.5 | GO:0005642 | annulate lamellae(GO:0005642) |
0.2 | 0.5 | GO:0001651 | dense fibrillar component(GO:0001651) |
0.2 | 3.2 | GO:0031306 | intrinsic component of mitochondrial outer membrane(GO:0031306) |
0.2 | 0.5 | GO:0097648 | G-protein coupled receptor dimeric complex(GO:0038037) G-protein coupled receptor complex(GO:0097648) |
0.1 | 0.3 | GO:0000814 | ESCRT II complex(GO:0000814) |
0.1 | 13.4 | GO:0072562 | blood microparticle(GO:0072562) |
0.1 | 2.4 | GO:0042101 | T cell receptor complex(GO:0042101) |
0.1 | 0.9 | GO:0030915 | Smc5-Smc6 complex(GO:0030915) |
0.1 | 1.2 | GO:0043203 | axon hillock(GO:0043203) |
0.1 | 0.3 | GO:1990923 | PET complex(GO:1990923) |
0.1 | 0.6 | GO:1990130 | Iml1 complex(GO:1990130) |
0.1 | 0.1 | GO:0032437 | cuticular plate(GO:0032437) |
0.1 | 0.4 | GO:0005863 | striated muscle myosin thick filament(GO:0005863) |
0.1 | 0.3 | GO:0051286 | cell tip(GO:0051286) |
0.1 | 0.1 | GO:0031313 | extrinsic component of endosome membrane(GO:0031313) |
0.1 | 0.4 | GO:0071565 | nBAF complex(GO:0071565) |
0.1 | 0.3 | GO:0034679 | integrin alpha9-beta1 complex(GO:0034679) |
0.1 | 2.4 | GO:0002102 | podosome(GO:0002102) |
0.1 | 0.6 | GO:0030891 | VCB complex(GO:0030891) |
0.1 | 0.4 | GO:0031092 | platelet alpha granule membrane(GO:0031092) |
0.1 | 0.6 | GO:0005683 | U7 snRNP(GO:0005683) |
0.1 | 0.5 | GO:0044615 | nuclear pore nuclear basket(GO:0044615) |
0.1 | 0.7 | GO:0042765 | GPI-anchor transamidase complex(GO:0042765) |
0.1 | 0.4 | GO:0030123 | AP-3 adaptor complex(GO:0030123) |
0.1 | 0.9 | GO:0000801 | central element(GO:0000801) |
0.1 | 0.9 | GO:0005677 | chromatin silencing complex(GO:0005677) |
0.1 | 3.1 | GO:0030140 | trans-Golgi network transport vesicle(GO:0030140) |
0.1 | 0.4 | GO:0005913 | cell-cell adherens junction(GO:0005913) |
0.1 | 0.1 | GO:0035061 | interchromatin granule(GO:0035061) |
0.1 | 0.8 | GO:0000421 | autophagosome membrane(GO:0000421) |
0.1 | 0.4 | GO:0030956 | glutamyl-tRNA(Gln) amidotransferase complex(GO:0030956) |
0.1 | 0.5 | GO:0005952 | cAMP-dependent protein kinase complex(GO:0005952) |
0.1 | 0.3 | GO:0030139 | endocytic vesicle(GO:0030139) |
0.1 | 2.0 | GO:0000145 | exocyst(GO:0000145) |
0.1 | 0.2 | GO:1990597 | AIP1-IRE1 complex(GO:1990597) |
0.1 | 1.5 | GO:0033391 | chromatoid body(GO:0033391) |
0.1 | 0.7 | GO:0032591 | dendritic spine membrane(GO:0032591) |
0.1 | 0.4 | GO:0035838 | growing cell tip(GO:0035838) |
0.1 | 1.1 | GO:0044224 | juxtaparanode region of axon(GO:0044224) |
0.1 | 0.2 | GO:0000220 | vacuolar proton-transporting V-type ATPase, V0 domain(GO:0000220) |
0.1 | 3.0 | GO:0071011 | precatalytic spliceosome(GO:0071011) |
0.1 | 0.2 | GO:1990393 | 3M complex(GO:1990393) |
0.1 | 0.2 | GO:0044327 | dendritic spine head(GO:0044327) |
0.1 | 2.8 | GO:0032592 | integral component of mitochondrial membrane(GO:0032592) |
0.1 | 0.3 | GO:0000110 | nucleotide-excision repair factor 1 complex(GO:0000110) |
0.1 | 0.5 | GO:0000938 | GARP complex(GO:0000938) |
0.1 | 0.7 | GO:0071986 | Ragulator complex(GO:0071986) |
0.1 | 0.5 | GO:0072557 | IPAF inflammasome complex(GO:0072557) |
0.1 | 0.6 | GO:0031261 | DNA replication preinitiation complex(GO:0031261) |
0.1 | 1.1 | GO:1990023 | mitotic spindle midzone(GO:1990023) |
0.1 | 1.1 | GO:0005614 | interstitial matrix(GO:0005614) |
0.1 | 1.0 | GO:0043020 | NADPH oxidase complex(GO:0043020) |
0.1 | 0.6 | GO:0044300 | cerebellar mossy fiber(GO:0044300) |
0.1 | 3.6 | GO:0005720 | nuclear heterochromatin(GO:0005720) |
0.1 | 0.9 | GO:0005832 | chaperonin-containing T-complex(GO:0005832) |
0.1 | 0.3 | GO:0031084 | BLOC-2 complex(GO:0031084) |
0.1 | 0.2 | GO:0008282 | ATP-sensitive potassium channel complex(GO:0008282) |
0.1 | 1.9 | GO:0097546 | ciliary base(GO:0097546) |
0.1 | 2.0 | GO:0005666 | DNA-directed RNA polymerase III complex(GO:0005666) |
0.1 | 1.4 | GO:0031430 | M band(GO:0031430) |
0.1 | 0.4 | GO:0031466 | Cul5-RING ubiquitin ligase complex(GO:0031466) |
0.1 | 0.8 | GO:0035102 | PRC1 complex(GO:0035102) |
0.1 | 1.0 | GO:0032045 | guanyl-nucleotide exchange factor complex(GO:0032045) |
0.1 | 0.3 | GO:0005826 | actomyosin contractile ring(GO:0005826) |
0.1 | 0.2 | GO:0071203 | WASH complex(GO:0071203) |
0.1 | 0.3 | GO:0035189 | Rb-E2F complex(GO:0035189) |
0.1 | 0.4 | GO:0035363 | histone locus body(GO:0035363) |
0.1 | 1.2 | GO:0017119 | Golgi transport complex(GO:0017119) |
0.1 | 0.3 | GO:0090661 | box H/ACA snoRNP complex(GO:0031429) box H/ACA RNP complex(GO:0072588) box H/ACA telomerase RNP complex(GO:0090661) |
0.1 | 2.0 | GO:0000178 | exosome (RNase complex)(GO:0000178) |
0.1 | 0.5 | GO:0032983 | kainate selective glutamate receptor complex(GO:0032983) |
0.1 | 1.0 | GO:0048188 | Set1C/COMPASS complex(GO:0048188) |
0.1 | 1.3 | GO:0098644 | complex of collagen trimers(GO:0098644) |
0.1 | 0.3 | GO:0061689 | tricellular tight junction(GO:0061689) |
0.1 | 0.6 | GO:0016593 | Cdc73/Paf1 complex(GO:0016593) |
0.1 | 0.3 | GO:0043511 | inhibin complex(GO:0043511) |
0.1 | 4.3 | GO:0031228 | intrinsic component of Golgi membrane(GO:0031228) |
0.1 | 0.5 | GO:0097542 | ciliary tip(GO:0097542) |
0.1 | 0.7 | GO:0031082 | BLOC complex(GO:0031082) |
0.1 | 0.7 | GO:0032279 | asymmetric synapse(GO:0032279) |
0.1 | 0.3 | GO:0042719 | mitochondrial intermembrane space protein transporter complex(GO:0042719) |
0.1 | 0.4 | GO:0071204 | histone pre-mRNA 3'end processing complex(GO:0071204) |
0.1 | 0.8 | GO:0035859 | Seh1-associated complex(GO:0035859) GATOR2 complex(GO:0061700) |
0.1 | 2.9 | GO:0044439 | microbody part(GO:0044438) peroxisomal part(GO:0044439) |
0.1 | 0.3 | GO:0046691 | intracellular canaliculus(GO:0046691) |
0.1 | 2.7 | GO:0045335 | phagocytic vesicle(GO:0045335) |
0.1 | 1.6 | GO:0030992 | intraciliary transport particle B(GO:0030992) |
0.1 | 5.7 | GO:0000118 | histone deacetylase complex(GO:0000118) |
0.1 | 0.4 | GO:0033269 | internode region of axon(GO:0033269) |
0.1 | 0.3 | GO:0005914 | spot adherens junction(GO:0005914) |
0.1 | 1.3 | GO:0033178 | proton-transporting two-sector ATPase complex, catalytic domain(GO:0033178) |
0.1 | 0.3 | GO:0032588 | trans-Golgi network membrane(GO:0032588) |
0.1 | 0.2 | GO:0000015 | phosphopyruvate hydratase complex(GO:0000015) |
0.1 | 1.0 | GO:0031414 | N-terminal protein acetyltransferase complex(GO:0031414) |
0.1 | 0.3 | GO:0034457 | Mpp10 complex(GO:0034457) |
0.1 | 0.3 | GO:0005879 | axonemal microtubule(GO:0005879) |
0.1 | 0.3 | GO:0017071 | intracellular cyclic nucleotide activated cation channel complex(GO:0017071) |
0.1 | 1.1 | GO:0031235 | intrinsic component of the cytoplasmic side of the plasma membrane(GO:0031235) |
0.1 | 0.3 | GO:0009331 | glycerol-3-phosphate dehydrogenase complex(GO:0009331) |
0.1 | 0.7 | GO:0036157 | outer dynein arm(GO:0036157) |
0.1 | 1.5 | GO:0030673 | axolemma(GO:0030673) |
0.1 | 0.3 | GO:0005916 | fascia adherens(GO:0005916) |
0.1 | 0.5 | GO:0034388 | Pwp2p-containing subcomplex of 90S preribosome(GO:0034388) |
0.1 | 0.3 | GO:0005971 | ribonucleoside-diphosphate reductase complex(GO:0005971) |
0.1 | 0.3 | GO:0031465 | Cul4B-RING E3 ubiquitin ligase complex(GO:0031465) |
0.1 | 0.7 | GO:0005861 | troponin complex(GO:0005861) |
0.1 | 0.2 | GO:0097057 | TRAF2-GSTP1 complex(GO:0097057) |
0.1 | 1.8 | GO:0030057 | desmosome(GO:0030057) |
0.1 | 0.4 | GO:0090544 | BAF-type complex(GO:0090544) |
0.1 | 4.3 | GO:0019005 | SCF ubiquitin ligase complex(GO:0019005) |
0.1 | 0.8 | GO:0031616 | spindle pole centrosome(GO:0031616) |
0.1 | 0.3 | GO:0014731 | spectrin-associated cytoskeleton(GO:0014731) |
0.1 | 0.3 | GO:0031390 | Ctf18 RFC-like complex(GO:0031390) |
0.1 | 0.3 | GO:0042583 | chromaffin granule(GO:0042583) |
0.1 | 1.2 | GO:0060077 | inhibitory synapse(GO:0060077) |
0.1 | 0.6 | GO:0032982 | myosin filament(GO:0032982) |
0.1 | 0.3 | GO:0043293 | apoptosome(GO:0043293) |
0.1 | 0.3 | GO:0044352 | pinosome(GO:0044352) macropinosome(GO:0044354) |
0.1 | 0.9 | GO:0005675 | holo TFIIH complex(GO:0005675) |
0.1 | 0.2 | GO:0030478 | actin cap(GO:0030478) |
0.1 | 0.5 | GO:0000788 | nuclear nucleosome(GO:0000788) |
0.1 | 0.4 | GO:0005796 | Golgi lumen(GO:0005796) |
0.1 | 5.9 | GO:0031256 | leading edge membrane(GO:0031256) |
0.1 | 0.1 | GO:0005687 | U4 snRNP(GO:0005687) |
0.1 | 0.2 | GO:0009925 | basal plasma membrane(GO:0009925) |
0.1 | 0.1 | GO:0002199 | zona pellucida receptor complex(GO:0002199) |
0.1 | 0.6 | GO:0030285 | integral component of synaptic vesicle membrane(GO:0030285) intrinsic component of synaptic vesicle membrane(GO:0098563) |
0.1 | 0.7 | GO:0035631 | CD40 receptor complex(GO:0035631) |
0.1 | 0.1 | GO:0044292 | dendrite terminus(GO:0044292) |
0.1 | 0.3 | GO:0032541 | cortical endoplasmic reticulum(GO:0032541) |
0.1 | 0.2 | GO:0032127 | dense core granule membrane(GO:0032127) |
0.1 | 0.2 | GO:0008275 | gamma-tubulin small complex(GO:0008275) |
0.1 | 0.3 | GO:0000408 | EKC/KEOPS complex(GO:0000408) |
0.1 | 1.8 | GO:0001917 | photoreceptor inner segment(GO:0001917) |
0.1 | 0.1 | GO:0033202 | DNA helicase complex(GO:0033202) |
0.1 | 0.2 | GO:0072379 | BAT3 complex(GO:0071818) ER membrane insertion complex(GO:0072379) |
0.1 | 25.9 | GO:0005764 | lytic vacuole(GO:0000323) lysosome(GO:0005764) |
0.1 | 0.2 | GO:0033179 | proton-transporting V-type ATPase, V0 domain(GO:0033179) |
0.1 | 6.7 | GO:0031234 | extrinsic component of cytoplasmic side of plasma membrane(GO:0031234) |
0.1 | 1.2 | GO:0005605 | basal lamina(GO:0005605) |
0.1 | 0.5 | GO:0035253 | ciliary rootlet(GO:0035253) |
0.1 | 0.2 | GO:0035327 | transcriptionally active chromatin(GO:0035327) |
0.1 | 0.5 | GO:0070852 | cell body fiber(GO:0070852) |
0.1 | 0.1 | GO:0097422 | tubular endosome(GO:0097422) |
0.1 | 3.2 | GO:0001725 | stress fiber(GO:0001725) contractile actin filament bundle(GO:0097517) |
0.1 | 0.4 | GO:0030896 | checkpoint clamp complex(GO:0030896) |
0.1 | 0.3 | GO:0005593 | FACIT collagen trimer(GO:0005593) |
0.1 | 0.6 | GO:0042587 | glycogen granule(GO:0042587) |
0.1 | 0.6 | GO:0005885 | Arp2/3 protein complex(GO:0005885) |
0.1 | 0.2 | GO:0032584 | growth cone membrane(GO:0032584) |
0.1 | 0.1 | GO:0097025 | MPP7-DLG1-LIN7 complex(GO:0097025) |
0.1 | 2.4 | GO:0005811 | lipid particle(GO:0005811) |
0.1 | 0.3 | GO:0044666 | MLL3/4 complex(GO:0044666) |
0.1 | 0.2 | GO:0090543 | Flemming body(GO:0090543) |
0.1 | 0.9 | GO:0000139 | Golgi membrane(GO:0000139) |
0.1 | 0.1 | GO:0034750 | Scrib-APC-beta-catenin complex(GO:0034750) |
0.1 | 0.3 | GO:0005818 | astral microtubule(GO:0000235) aster(GO:0005818) |
0.1 | 0.2 | GO:0000125 | PCAF complex(GO:0000125) |
0.1 | 0.5 | GO:0048500 | signal recognition particle, endoplasmic reticulum targeting(GO:0005786) signal recognition particle(GO:0048500) |
0.1 | 1.0 | GO:0005637 | nuclear inner membrane(GO:0005637) |
0.1 | 0.1 | GO:0044462 | cell outer membrane(GO:0009279) cell envelope(GO:0030313) external encapsulating structure part(GO:0044462) |
0.1 | 0.7 | GO:0034663 | endoplasmic reticulum chaperone complex(GO:0034663) |
0.1 | 2.0 | GO:0005871 | kinesin complex(GO:0005871) |
0.1 | 0.1 | GO:0033186 | CAF-1 complex(GO:0033186) |
0.1 | 0.1 | GO:0070032 | synaptobrevin 2-SNAP-25-syntaxin-1a-complexin I complex(GO:0070032) |
0.1 | 2.2 | GO:0016592 | mediator complex(GO:0016592) |
0.1 | 0.2 | GO:0070603 | SWI/SNF superfamily-type complex(GO:0070603) |
0.1 | 3.3 | GO:0005581 | collagen trimer(GO:0005581) |
0.1 | 0.2 | GO:0032021 | NELF complex(GO:0032021) |
0.1 | 0.5 | GO:0046581 | intercellular canaliculus(GO:0046581) |
0.1 | 0.3 | GO:0072687 | meiotic spindle(GO:0072687) |
0.1 | 0.1 | GO:0033093 | Weibel-Palade body(GO:0033093) |
0.1 | 2.2 | GO:0072686 | mitotic spindle(GO:0072686) |
0.1 | 0.2 | GO:0001931 | uropod(GO:0001931) cell trailing edge(GO:0031254) |
0.1 | 0.1 | GO:0070044 | synaptobrevin 2-SNAP-25-syntaxin-1a complex(GO:0070044) |
0.1 | 0.3 | GO:0005663 | DNA replication factor C complex(GO:0005663) |
0.1 | 0.1 | GO:0035867 | alphav-beta3 integrin-IGF-1-IGF1R complex(GO:0035867) |
0.1 | 0.6 | GO:0008305 | integrin complex(GO:0008305) |
0.1 | 0.2 | GO:0071001 | U4/U6 snRNP(GO:0071001) |
0.1 | 0.6 | GO:0005665 | DNA-directed RNA polymerase II, core complex(GO:0005665) |
0.1 | 0.1 | GO:0044232 | organelle membrane contact site(GO:0044232) |
0.1 | 0.3 | GO:0042622 | photoreceptor outer segment membrane(GO:0042622) |
0.1 | 0.1 | GO:0005791 | rough endoplasmic reticulum(GO:0005791) |
0.1 | 0.3 | GO:0033116 | endoplasmic reticulum-Golgi intermediate compartment membrane(GO:0033116) |
0.1 | 0.1 | GO:0008290 | F-actin capping protein complex(GO:0008290) |
0.1 | 0.3 | GO:0097225 | sperm midpiece(GO:0097225) |
0.1 | 0.1 | GO:0070820 | tertiary granule(GO:0070820) |
0.1 | 0.2 | GO:0071817 | MMXD complex(GO:0071817) |
0.1 | 0.2 | GO:0031462 | Cul2-RING ubiquitin ligase complex(GO:0031462) |
0.1 | 1.1 | GO:0005680 | anaphase-promoting complex(GO:0005680) |
0.1 | 0.4 | GO:0005753 | mitochondrial proton-transporting ATP synthase complex(GO:0005753) |
0.1 | 0.2 | GO:0000153 | cytoplasmic ubiquitin ligase complex(GO:0000153) |
0.1 | 0.2 | GO:0001652 | granular component(GO:0001652) |
0.1 | 0.3 | GO:0000940 | condensed chromosome outer kinetochore(GO:0000940) |
0.1 | 0.4 | GO:0005682 | U5 snRNP(GO:0005682) |
0.1 | 0.4 | GO:0030990 | intraciliary transport particle(GO:0030990) |
0.1 | 0.2 | GO:0016222 | procollagen-proline 4-dioxygenase complex(GO:0016222) |
0.1 | 0.4 | GO:0005686 | U2 snRNP(GO:0005686) |
0.1 | 0.5 | GO:0031371 | ubiquitin conjugating enzyme complex(GO:0031371) |
0.1 | 0.3 | GO:0034464 | BBSome(GO:0034464) |
0.1 | 0.3 | GO:0001741 | XY body(GO:0001741) |
0.1 | 0.1 | GO:0044614 | nuclear pore cytoplasmic filaments(GO:0044614) |
0.1 | 3.2 | GO:0030055 | cell-substrate adherens junction(GO:0005924) cell-substrate junction(GO:0030055) |
0.1 | 0.5 | GO:0002116 | semaphorin receptor complex(GO:0002116) |
0.1 | 0.5 | GO:0065010 | extracellular membrane-bounded organelle(GO:0065010) |
0.1 | 0.1 | GO:0010009 | cytoplasmic side of endosome membrane(GO:0010009) |
0.1 | 0.2 | GO:0061574 | ASAP complex(GO:0061574) |
0.1 | 4.3 | GO:0070160 | occluding junction(GO:0070160) |
0.1 | 0.4 | GO:0000506 | glycosylphosphatidylinositol-N-acetylglucosaminyltransferase (GPI-GnT) complex(GO:0000506) |
0.1 | 1.1 | GO:0005876 | spindle microtubule(GO:0005876) |
0.1 | 0.2 | GO:0035748 | myelin sheath abaxonal region(GO:0035748) |
0.1 | 0.3 | GO:0043196 | varicosity(GO:0043196) |
0.1 | 0.4 | GO:0005721 | pericentric heterochromatin(GO:0005721) |
0.1 | 4.4 | GO:0044798 | nuclear transcription factor complex(GO:0044798) |
0.1 | 0.2 | GO:0000942 | condensed nuclear chromosome outer kinetochore(GO:0000942) |
0.0 | 0.8 | GO:0030660 | Golgi-associated vesicle membrane(GO:0030660) |
0.0 | 0.2 | GO:0005797 | Golgi medial cisterna(GO:0005797) |
0.0 | 0.1 | GO:0030132 | clathrin coat of coated pit(GO:0030132) |
0.0 | 0.1 | GO:0005850 | eukaryotic translation initiation factor 2 complex(GO:0005850) |
0.0 | 0.3 | GO:0016272 | prefoldin complex(GO:0016272) |
0.0 | 0.1 | GO:0042825 | TAP complex(GO:0042825) |
0.0 | 7.8 | GO:0009897 | external side of plasma membrane(GO:0009897) |
0.0 | 0.3 | GO:0032433 | filopodium tip(GO:0032433) |
0.0 | 0.3 | GO:0030119 | AP-type membrane coat adaptor complex(GO:0030119) |
0.0 | 4.5 | GO:0001669 | acrosomal vesicle(GO:0001669) |
0.0 | 1.2 | GO:0030687 | preribosome, large subunit precursor(GO:0030687) |
0.0 | 0.2 | GO:0042382 | paraspeckles(GO:0042382) |
0.0 | 0.1 | GO:0017133 | mitochondrial electron transfer flavoprotein complex(GO:0017133) electron transfer flavoprotein complex(GO:0045251) |
0.0 | 0.1 | GO:0044322 | endoplasmic reticulum quality control compartment(GO:0044322) |
0.0 | 1.1 | GO:0032281 | AMPA glutamate receptor complex(GO:0032281) |
0.0 | 0.4 | GO:0031332 | RISC complex(GO:0016442) RNAi effector complex(GO:0031332) |
0.0 | 0.1 | GO:0000815 | ESCRT III complex(GO:0000815) |
0.0 | 0.1 | GO:0000172 | ribonuclease MRP complex(GO:0000172) |
0.0 | 0.3 | GO:0005902 | microvillus(GO:0005902) |
0.0 | 0.2 | GO:0034709 | methylosome(GO:0034709) |
0.0 | 0.1 | GO:0005945 | 6-phosphofructokinase complex(GO:0005945) |
0.0 | 0.3 | GO:0097539 | ciliary transition fiber(GO:0097539) |
0.0 | 0.2 | GO:0097342 | ripoptosome(GO:0097342) |
0.0 | 0.1 | GO:0045334 | clathrin-coated endocytic vesicle(GO:0045334) |
0.0 | 0.4 | GO:0017146 | NMDA selective glutamate receptor complex(GO:0017146) |
0.0 | 0.2 | GO:0001772 | immunological synapse(GO:0001772) |
0.0 | 0.2 | GO:0033270 | paranode region of axon(GO:0033270) |
0.0 | 0.1 | GO:0033185 | dolichol-phosphate-mannose synthase complex(GO:0033185) |
0.0 | 0.2 | GO:0045298 | tubulin complex(GO:0045298) |
0.0 | 1.6 | GO:0005657 | replication fork(GO:0005657) |
0.0 | 0.1 | GO:0033655 | host cell cytoplasm(GO:0030430) host cell cytoplasm part(GO:0033655) |
0.0 | 0.1 | GO:0001891 | phagocytic cup(GO:0001891) |
0.0 | 0.3 | GO:0070419 | nonhomologous end joining complex(GO:0070419) |
0.0 | 0.2 | GO:0051233 | spindle midzone(GO:0051233) |
0.0 | 0.4 | GO:0008278 | cohesin complex(GO:0008278) |
0.0 | 1.7 | GO:0031526 | brush border membrane(GO:0031526) |
0.0 | 9.8 | GO:0009986 | cell surface(GO:0009986) |
0.0 | 0.7 | GO:0034451 | centriolar satellite(GO:0034451) |
0.0 | 0.4 | GO:0000813 | ESCRT I complex(GO:0000813) |
0.0 | 0.5 | GO:0005697 | telomerase holoenzyme complex(GO:0005697) |
0.0 | 0.9 | GO:0015030 | Cajal body(GO:0015030) |
0.0 | 0.6 | GO:0031233 | intrinsic component of external side of plasma membrane(GO:0031233) |
0.0 | 0.1 | GO:0043527 | tRNA methyltransferase complex(GO:0043527) |
0.0 | 0.6 | GO:0005776 | autophagosome(GO:0005776) |
0.0 | 0.8 | GO:0034707 | chloride channel complex(GO:0034707) |
0.0 | 0.1 | GO:0030312 | external encapsulating structure(GO:0030312) |
0.0 | 0.1 | GO:0005744 | mitochondrial inner membrane presequence translocase complex(GO:0005744) |
0.0 | 2.1 | GO:0031463 | Cul3-RING ubiquitin ligase complex(GO:0031463) |
0.0 | 0.0 | GO:0005839 | proteasome core complex(GO:0005839) |
0.0 | 0.2 | GO:0031588 | nucleotide-activated protein kinase complex(GO:0031588) |
0.0 | 0.2 | GO:0097228 | sperm principal piece(GO:0097228) |
0.0 | 1.6 | GO:0030496 | midbody(GO:0030496) |
0.0 | 0.2 | GO:0031080 | nuclear pore outer ring(GO:0031080) |
0.0 | 4.4 | GO:0043235 | receptor complex(GO:0043235) |
0.0 | 1.5 | GO:0043209 | myelin sheath(GO:0043209) |
0.0 | 0.1 | GO:0033176 | proton-transporting V-type ATPase complex(GO:0033176) |
0.0 | 0.2 | GO:0043296 | apical junction complex(GO:0043296) |
0.0 | 1.0 | GO:0043679 | axon terminus(GO:0043679) |
0.0 | 0.1 | GO:0071439 | clathrin complex(GO:0071439) |
0.0 | 0.2 | GO:0034098 | VCP-NPL4-UFD1 AAA ATPase complex(GO:0034098) |
0.0 | 0.3 | GO:0071339 | MLL1/2 complex(GO:0044665) MLL1 complex(GO:0071339) |
0.0 | 0.1 | GO:0071547 | piP-body(GO:0071547) |
0.0 | 0.8 | GO:0005793 | endoplasmic reticulum-Golgi intermediate compartment(GO:0005793) |
0.0 | 0.5 | GO:0016323 | basolateral plasma membrane(GO:0016323) |
0.0 | 1.9 | GO:0016528 | sarcoplasm(GO:0016528) |
0.0 | 0.0 | GO:0042612 | MHC class I protein complex(GO:0042612) |
0.0 | 0.0 | GO:0042641 | actomyosin(GO:0042641) |
0.0 | 0.1 | GO:0031315 | extrinsic component of mitochondrial outer membrane(GO:0031315) |
0.0 | 0.6 | GO:0031941 | filamentous actin(GO:0031941) |
0.0 | 0.2 | GO:0010369 | chromocenter(GO:0010369) |
0.0 | 0.4 | GO:0098533 | ATPase dependent transmembrane transport complex(GO:0098533) |
0.0 | 0.8 | GO:0097223 | sperm part(GO:0097223) |
0.0 | 0.1 | GO:0044530 | supraspliceosomal complex(GO:0044530) |
0.0 | 0.2 | GO:0097449 | astrocyte projection(GO:0097449) |
0.0 | 0.1 | GO:0014704 | intercalated disc(GO:0014704) |
0.0 | 0.0 | GO:0005883 | neurofilament(GO:0005883) |
0.0 | 0.5 | GO:0030686 | 90S preribosome(GO:0030686) |
0.0 | 0.1 | GO:1990726 | Lsm1-7-Pat1 complex(GO:1990726) |
0.0 | 0.2 | GO:0036128 | CatSper complex(GO:0036128) |
0.0 | 0.5 | GO:0034706 | sodium channel complex(GO:0034706) |
0.0 | 2.5 | GO:0042579 | peroxisome(GO:0005777) microbody(GO:0042579) |
0.0 | 0.0 | GO:0072558 | NLRP1 inflammasome complex(GO:0072558) |
0.0 | 0.5 | GO:0035145 | exon-exon junction complex(GO:0035145) |
0.0 | 0.0 | GO:0098878 | ionotropic glutamate receptor complex(GO:0008328) neurotransmitter receptor complex(GO:0098878) |
0.0 | 0.0 | GO:0031012 | extracellular matrix(GO:0031012) |
0.0 | 0.1 | GO:1990851 | Wnt-Frizzled-LRP5/6 complex(GO:1990851) |
0.0 | 0.1 | GO:0030870 | Mre11 complex(GO:0030870) |
0.0 | 0.1 | GO:0097058 | CRLF-CLCF1 complex(GO:0097058) |
0.0 | 0.1 | GO:0030688 | preribosome, small subunit precursor(GO:0030688) |
0.0 | 32.4 | GO:0005615 | extracellular space(GO:0005615) |
0.0 | 0.5 | GO:0005903 | brush border(GO:0005903) |
0.0 | 0.3 | GO:0071541 | eukaryotic translation initiation factor 3 complex, eIF3m(GO:0071541) |
0.0 | 0.0 | GO:0031523 | Myb complex(GO:0031523) |
0.0 | 0.2 | GO:0005750 | mitochondrial respiratory chain complex III(GO:0005750) respiratory chain complex III(GO:0045275) |
0.0 | 0.2 | GO:0070652 | HAUS complex(GO:0070652) |
0.0 | 0.2 | GO:1990111 | spermatoproteasome complex(GO:1990111) |
0.0 | 5.9 | GO:0005635 | nuclear envelope(GO:0005635) |
0.0 | 0.1 | GO:0097452 | GAIT complex(GO:0097452) |
0.0 | 0.0 | GO:0048787 | presynaptic active zone membrane(GO:0048787) |
0.0 | 0.1 | GO:0071598 | neuronal ribonucleoprotein granule(GO:0071598) |
0.0 | 1.0 | GO:0022627 | cytosolic small ribosomal subunit(GO:0022627) |
0.0 | 0.5 | GO:0005901 | caveola(GO:0005901) |
0.0 | 0.5 | GO:0031901 | early endosome membrane(GO:0031901) |
0.0 | 1.3 | GO:0016324 | apical plasma membrane(GO:0016324) |
0.0 | 0.1 | GO:0090665 | dystrophin-associated glycoprotein complex(GO:0016010) glycoprotein complex(GO:0090665) |
0.0 | 1.6 | GO:0016607 | nuclear speck(GO:0016607) |
0.0 | 0.2 | GO:0005852 | eukaryotic translation initiation factor 3 complex(GO:0005852) |
0.0 | 19.8 | GO:0005887 | integral component of plasma membrane(GO:0005887) |
0.0 | 0.3 | GO:0031201 | SNARE complex(GO:0031201) |
0.0 | 0.1 | GO:0005956 | protein kinase CK2 complex(GO:0005956) |
0.0 | 0.1 | GO:0033061 | DNA recombinase mediator complex(GO:0033061) |
0.0 | 0.1 | GO:0031143 | pseudopodium(GO:0031143) |
0.0 | 1.2 | GO:0045121 | membrane raft(GO:0045121) membrane microdomain(GO:0098857) |
0.0 | 0.7 | GO:0043204 | perikaryon(GO:0043204) |
0.0 | 0.2 | GO:0099501 | synaptic vesicle membrane(GO:0030672) exocytic vesicle membrane(GO:0099501) |
0.0 | 0.4 | GO:0005788 | endoplasmic reticulum lumen(GO:0005788) |
0.0 | 0.1 | GO:0005790 | smooth endoplasmic reticulum(GO:0005790) |
0.0 | 0.0 | GO:0005833 | hemoglobin complex(GO:0005833) |
0.0 | 2.0 | GO:0031252 | cell leading edge(GO:0031252) |
0.0 | 0.1 | GO:0042588 | zymogen granule(GO:0042588) |
0.0 | 0.1 | GO:0089701 | U2AF(GO:0089701) |
0.0 | 0.1 | GO:0000923 | equatorial microtubule organizing center(GO:0000923) |
0.0 | 0.8 | GO:0030426 | growth cone(GO:0030426) |
0.0 | 0.4 | GO:0000307 | cyclin-dependent protein kinase holoenzyme complex(GO:0000307) |
0.0 | 0.0 | GO:0005688 | U6 snRNP(GO:0005688) |
0.0 | 0.7 | GO:0031248 | protein acetyltransferase complex(GO:0031248) acetyltransferase complex(GO:1902493) |
0.0 | 0.0 | GO:0098536 | deuterosome(GO:0098536) |
0.0 | 0.2 | GO:0043240 | Fanconi anaemia nuclear complex(GO:0043240) |
0.0 | 0.1 | GO:0070937 | CRD-mediated mRNA stability complex(GO:0070937) |
0.0 | 0.0 | GO:1990745 | EARP complex(GO:1990745) |
0.0 | 0.0 | GO:1990357 | terminal web(GO:1990357) |
0.0 | 0.0 | GO:0005785 | signal recognition particle receptor complex(GO:0005785) |
0.0 | 0.2 | GO:0071006 | U2-type catalytic step 1 spliceosome(GO:0071006) |
0.0 | 1.1 | GO:0031225 | anchored component of membrane(GO:0031225) |
0.0 | 0.6 | GO:0045095 | keratin filament(GO:0045095) |
0.0 | 0.1 | GO:0032300 | mismatch repair complex(GO:0032300) |
0.0 | 0.0 | GO:0043194 | axon initial segment(GO:0043194) |
0.0 | 2.8 | GO:0000785 | chromatin(GO:0000785) |
0.0 | 6.5 | GO:0005740 | mitochondrial envelope(GO:0005740) |
0.0 | 0.1 | GO:0097651 | phosphatidylinositol 3-kinase complex, class IB(GO:0005944) phosphatidylinositol 3-kinase complex, class I(GO:0097651) |
0.0 | 0.1 | GO:0000152 | nuclear ubiquitin ligase complex(GO:0000152) |
0.0 | 0.2 | GO:0008180 | COP9 signalosome(GO:0008180) |
0.0 | 0.2 | GO:0005868 | cytoplasmic dynein complex(GO:0005868) |
0.0 | 0.1 | GO:0005845 | mRNA cap binding complex(GO:0005845) RNA cap binding complex(GO:0034518) |
0.0 | 0.0 | GO:0045293 | mRNA editing complex(GO:0045293) |
0.0 | 0.3 | GO:0005789 | endoplasmic reticulum membrane(GO:0005789) |
0.0 | 2.8 | GO:0005773 | vacuole(GO:0005773) |
0.0 | 24.5 | GO:0005576 | extracellular region(GO:0005576) |
0.0 | 0.1 | GO:0030136 | clathrin-coated vesicle(GO:0030136) |
0.0 | 0.0 | GO:0017101 | aminoacyl-tRNA synthetase multienzyme complex(GO:0017101) |
0.0 | 0.0 | GO:0055087 | Ski complex(GO:0055087) |
0.0 | 0.0 | GO:0043186 | P granule(GO:0043186) pole plasm(GO:0045495) germ plasm(GO:0060293) |
0.0 | 0.0 | GO:0045179 | apical cortex(GO:0045179) |
0.0 | 0.0 | GO:0061702 | inflammasome complex(GO:0061702) |
0.0 | 1.5 | GO:0035068 | micro-ribonucleoprotein complex(GO:0035068) |
0.0 | 0.0 | GO:0060091 | kinocilium(GO:0060091) |
0.0 | 36.0 | GO:0031224 | intrinsic component of membrane(GO:0031224) |
0.0 | 0.0 | GO:0031975 | envelope(GO:0031975) |
0.0 | 1.4 | GO:0005929 | cilium(GO:0005929) |
0.0 | 0.0 | GO:0042599 | lamellar body(GO:0042599) |
0.0 | 0.0 | GO:0030137 | COPI-coated vesicle(GO:0030137) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.9 | 4.4 | GO:0050051 | leukotriene-B4 20-monooxygenase activity(GO:0050051) |
0.8 | 4.0 | GO:0030151 | molybdenum ion binding(GO:0030151) |
0.7 | 2.1 | GO:0042296 | ISG15 transferase activity(GO:0042296) |
0.7 | 2.7 | GO:0004558 | alpha-1,4-glucosidase activity(GO:0004558) |
0.7 | 2.0 | GO:0060230 | lipoprotein lipase activator activity(GO:0060230) |
0.7 | 2.0 | GO:0004924 | oncostatin-M receptor activity(GO:0004924) |
0.6 | 3.2 | GO:0016841 | ammonia-lyase activity(GO:0016841) |
0.6 | 1.3 | GO:0004772 | sterol O-acyltransferase activity(GO:0004772) |
0.6 | 3.8 | GO:0047035 | testosterone dehydrogenase (NAD+) activity(GO:0047035) |
0.6 | 4.4 | GO:0018660 | 3-(3-hydroxyphenyl)propionate hydroxylase activity(GO:0008688) 4-chlorobenzaldehyde oxidase activity(GO:0018471) 3,5-xylenol methylhydroxylase activity(GO:0018630) phenylacetate hydroxylase activity(GO:0018631) 4-nitrophenol 4-monooxygenase activity(GO:0018632) dimethyl sulfide monooxygenase activity(GO:0018633) alpha-pinene monooxygenase [NADH] activity(GO:0018634) 1-hydroxy-2-naphthoate hydroxylase activity(GO:0018637) toluene 4-monooxygenase activity(GO:0018638) xylene monooxygenase activity(GO:0018639) dibenzothiophene monooxygenase activity(GO:0018640) 6-hydroxy-3-methyl-2-oxo-1,2-dihydroquinoline 6-monooxygenase activity(GO:0018641) chlorophenol 4-monooxygenase activity(GO:0018642) carbon disulfide oxygenase activity(GO:0018643) toluene 2-monooxygenase activity(GO:0018644) 1-hydroxy-2-oxolimonene 1,2-monooxygenase activity(GO:0018646) phenanthrene 1,2-monooxygenase activity(GO:0018647) tetrahydrofuran hydroxylase activity(GO:0018649) styrene monooxygenase activity(GO:0018650) toluene-4-sulfonate monooxygenase activity(GO:0018651) toluene-sulfonate methyl-monooxygenase activity(GO:0018652) 3-methyl-2-oxo-1,2-dihydroquinoline 6-monooxygenase activity(GO:0018653) 2-hydroxy-phenylacetate hydroxylase activity(GO:0018654) 2-oxo-delta3-4,5,5-trimethylcyclopentenylacetyl-CoA 1,2-monooxygenase activity(GO:0018655) phenanthrene 3,4-monooxygenase activity(GO:0018656) toluene 3-monooxygenase activity(GO:0018657) 4-hydroxyphenylacetate,NADH:oxygen oxidoreductase (3-hydroxylating) activity(GO:0018660) limonene monooxygenase activity(GO:0019113) 2-methylnaphthalene hydroxylase activity(GO:0034526) 1-methylnaphthalene hydroxylase activity(GO:0034534) bisphenol A hydroxylase A activity(GO:0034560) salicylate 5-hydroxylase activity(GO:0034785) isobutylamine N-hydroxylase activity(GO:0034791) branched-chain dodecylbenzene sulfonate monooxygenase activity(GO:0034802) 3-HSA hydroxylase activity(GO:0034819) 4-hydroxypyridine-3-hydroxylase activity(GO:0034894) 2-octaprenyl-3-methyl-6-methoxy-1,4-benzoquinol hydroxylase activity(GO:0043719) 6-hydroxynicotinate 3-monooxygenase activity(GO:0043731) tocotrienol omega-hydroxylase activity(GO:0052872) thalianol hydroxylase activity(GO:0080014) |
0.6 | 2.5 | GO:0004095 | carnitine O-palmitoyltransferase activity(GO:0004095) |
0.6 | 1.8 | GO:0070996 | type 1 melanocortin receptor binding(GO:0070996) |
0.6 | 2.3 | GO:0004528 | phosphodiesterase I activity(GO:0004528) |
0.6 | 7.4 | GO:0008191 | metalloendopeptidase inhibitor activity(GO:0008191) |
0.5 | 1.6 | GO:0035650 | AP-1 adaptor complex binding(GO:0035650) |
0.5 | 1.6 | GO:0050252 | retinol O-fatty-acyltransferase activity(GO:0050252) |
0.5 | 1.5 | GO:0005345 | purine nucleobase transmembrane transporter activity(GO:0005345) pyrimidine nucleobase transmembrane transporter activity(GO:0005350) nucleobase transmembrane transporter activity(GO:0015205) |
0.5 | 1.0 | GO:0043423 | 3-phosphoinositide-dependent protein kinase binding(GO:0043423) |
0.5 | 1.5 | GO:0004104 | cholinesterase activity(GO:0004104) |
0.5 | 1.5 | GO:0034186 | apolipoprotein A-I binding(GO:0034186) |
0.5 | 3.4 | GO:0003836 | beta-galactoside (CMP) alpha-2,3-sialyltransferase activity(GO:0003836) |
0.5 | 1.4 | GO:0046573 | lactonohydrolase activity(GO:0046573) acyl-L-homoserine-lactone lactonohydrolase activity(GO:0102007) |
0.4 | 1.3 | GO:0016823 | hydrolase activity, acting on acid carbon-carbon bonds(GO:0016822) hydrolase activity, acting on acid carbon-carbon bonds, in ketonic substances(GO:0016823) |
0.4 | 1.3 | GO:0019770 | IgG receptor activity(GO:0019770) |
0.4 | 1.3 | GO:0003865 | 3-oxo-5-alpha-steroid 4-dehydrogenase activity(GO:0003865) cholestenone 5-alpha-reductase activity(GO:0047751) |
0.4 | 1.3 | GO:0008525 | phosphatidylcholine transporter activity(GO:0008525) |
0.4 | 1.7 | GO:0001016 | RNA polymerase III regulatory region DNA binding(GO:0001016) |
0.4 | 1.3 | GO:0008384 | IkappaB kinase activity(GO:0008384) |
0.4 | 2.1 | GO:0005432 | calcium:sodium antiporter activity(GO:0005432) |
0.4 | 1.2 | GO:0004699 | calcium-independent protein kinase C activity(GO:0004699) |
0.4 | 1.6 | GO:0005173 | stem cell factor receptor binding(GO:0005173) |
0.4 | 1.2 | GO:0008515 | sucrose:proton symporter activity(GO:0008506) sucrose transmembrane transporter activity(GO:0008515) disaccharide transmembrane transporter activity(GO:0015154) oligosaccharide transmembrane transporter activity(GO:0015157) |
0.4 | 1.6 | GO:0015016 | [heparan sulfate]-glucosamine N-sulfotransferase activity(GO:0015016) |
0.4 | 2.0 | GO:0031849 | olfactory receptor binding(GO:0031849) |
0.4 | 1.2 | GO:0015563 | uptake transmembrane transporter activity(GO:0015563) |
0.4 | 0.4 | GO:0043546 | molybdopterin cofactor binding(GO:0043546) |
0.4 | 1.2 | GO:0004069 | L-aspartate:2-oxoglutarate aminotransferase activity(GO:0004069) |
0.4 | 1.9 | GO:0048403 | brain-derived neurotrophic factor binding(GO:0048403) |
0.4 | 1.1 | GO:0004731 | purine-nucleoside phosphorylase activity(GO:0004731) |
0.4 | 3.0 | GO:0102391 | decanoate--CoA ligase activity(GO:0102391) |
0.4 | 0.4 | GO:0043849 | Ras palmitoyltransferase activity(GO:0043849) |
0.4 | 1.5 | GO:0008381 | mechanically-gated ion channel activity(GO:0008381) mechanically gated channel activity(GO:0022833) |
0.4 | 1.8 | GO:0004300 | enoyl-CoA hydratase activity(GO:0004300) |
0.4 | 1.8 | GO:0005294 | neutral L-amino acid secondary active transmembrane transporter activity(GO:0005294) |
0.4 | 0.4 | GO:0030523 | dihydrolipoamide S-acyltransferase activity(GO:0030523) |
0.4 | 1.1 | GO:0008449 | N-acetylglucosamine-6-sulfatase activity(GO:0008449) |
0.3 | 1.0 | GO:0004687 | myosin light chain kinase activity(GO:0004687) |
0.3 | 1.0 | GO:0008142 | oxysterol binding(GO:0008142) |
0.3 | 1.0 | GO:0008898 | S-adenosylmethionine-homocysteine S-methyltransferase activity(GO:0008898) |
0.3 | 0.7 | GO:0018685 | alkane 1-monooxygenase activity(GO:0018685) |
0.3 | 1.0 | GO:0031752 | D5 dopamine receptor binding(GO:0031752) |
0.3 | 0.6 | GO:0016312 | inositol bisphosphate phosphatase activity(GO:0016312) |
0.3 | 1.0 | GO:0030350 | iron-responsive element binding(GO:0030350) |
0.3 | 1.2 | GO:0031433 | telethonin binding(GO:0031433) |
0.3 | 0.9 | GO:0003986 | acetyl-CoA hydrolase activity(GO:0003986) |
0.3 | 0.3 | GO:0004427 | inorganic diphosphatase activity(GO:0004427) |
0.3 | 2.1 | GO:0016176 | superoxide-generating NADPH oxidase activator activity(GO:0016176) |
0.3 | 0.9 | GO:0051425 | PTB domain binding(GO:0051425) |
0.3 | 2.1 | GO:0051864 | histone demethylase activity (H3-K36 specific)(GO:0051864) |
0.3 | 1.2 | GO:0015199 | amino-acid betaine transmembrane transporter activity(GO:0015199) carnitine transmembrane transporter activity(GO:0015226) |
0.3 | 0.3 | GO:0000064 | L-ornithine transmembrane transporter activity(GO:0000064) |
0.3 | 1.7 | GO:0001727 | lipid kinase activity(GO:0001727) |
0.3 | 1.1 | GO:0002046 | opsin binding(GO:0002046) |
0.3 | 0.6 | GO:0004103 | choline kinase activity(GO:0004103) |
0.3 | 2.3 | GO:0004862 | cAMP-dependent protein kinase inhibitor activity(GO:0004862) |
0.3 | 1.7 | GO:0019966 | interleukin-1 binding(GO:0019966) |
0.3 | 0.3 | GO:0004942 | anaphylatoxin receptor activity(GO:0004942) |
0.3 | 1.1 | GO:0008970 | phosphatidylcholine 1-acylhydrolase activity(GO:0008970) |
0.3 | 0.3 | GO:0004854 | xanthine dehydrogenase activity(GO:0004854) oxidoreductase activity, acting on CH or CH2 groups, NAD or NADP as acceptor(GO:0016726) |
0.3 | 0.8 | GO:0005001 | transmembrane receptor protein tyrosine phosphatase activity(GO:0005001) |
0.3 | 0.6 | GO:0050692 | DBD domain binding(GO:0050692) |
0.3 | 1.1 | GO:0034889 | alkyl sulfatase activity(GO:0018741) endosulfan hemisulfate sulfatase activity(GO:0034889) endosulfan sulfate hydrolase activity(GO:0034902) |
0.3 | 5.1 | GO:0001848 | complement binding(GO:0001848) |
0.3 | 0.8 | GO:0050816 | phosphothreonine binding(GO:0050816) |
0.3 | 1.3 | GO:0000774 | adenyl-nucleotide exchange factor activity(GO:0000774) |
0.3 | 0.3 | GO:0005138 | interleukin-6 receptor binding(GO:0005138) |
0.3 | 0.5 | GO:0004706 | JUN kinase kinase kinase activity(GO:0004706) |
0.3 | 0.8 | GO:0019776 | Atg8 ligase activity(GO:0019776) |
0.3 | 0.5 | GO:0050833 | pyruvate transmembrane transporter activity(GO:0050833) |
0.3 | 1.3 | GO:0030292 | protein tyrosine kinase inhibitor activity(GO:0030292) |
0.3 | 1.8 | GO:0016892 | endoribonuclease activity, producing 3'-phosphomonoesters(GO:0016892) |
0.3 | 1.8 | GO:0008440 | inositol-1,4,5-trisphosphate 3-kinase activity(GO:0008440) |
0.2 | 2.0 | GO:0036122 | BMP binding(GO:0036122) |
0.2 | 0.2 | GO:0002060 | purine nucleobase binding(GO:0002060) |
0.2 | 2.7 | GO:0034185 | apolipoprotein binding(GO:0034185) |
0.2 | 2.0 | GO:0005521 | lamin binding(GO:0005521) |
0.2 | 1.5 | GO:0050733 | RS domain binding(GO:0050733) |
0.2 | 0.7 | GO:0070840 | dynein complex binding(GO:0070840) |
0.2 | 0.7 | GO:0008321 | Ral guanyl-nucleotide exchange factor activity(GO:0008321) |
0.2 | 0.5 | GO:0043120 | tumor necrosis factor binding(GO:0043120) |
0.2 | 0.7 | GO:0004720 | protein-lysine 6-oxidase activity(GO:0004720) |
0.2 | 1.2 | GO:0034916 | 4-methyloctanoyl-CoA dehydrogenase activity(GO:0034580) naphthyl-2-methyl-succinyl-CoA dehydrogenase activity(GO:0034845) 2-methylhexanoyl-CoA dehydrogenase activity(GO:0034916) propionyl-CoA dehydrogenase activity(GO:0043820) thiol-driven fumarate reductase activity(GO:0043830) coenzyme F420-dependent 2,4,6-trinitrophenol reductase activity(GO:0052758) coenzyme F420-dependent 2,4,6-trinitrophenol hydride reductase activity(GO:0052759) coenzyme F420-dependent 2,4-dinitrophenol reductase activity(GO:0052760) |
0.2 | 1.2 | GO:0042015 | interleukin-20 binding(GO:0042015) |
0.2 | 0.9 | GO:0004370 | glycerol kinase activity(GO:0004370) |
0.2 | 1.4 | GO:0005225 | volume-sensitive anion channel activity(GO:0005225) |
0.2 | 2.1 | GO:0008932 | lytic endotransglycosylase activity(GO:0008932) |
0.2 | 0.9 | GO:0018585 | fluorene oxygenase activity(GO:0018585) |
0.2 | 0.7 | GO:0051718 | DNA (cytosine-5-)-methyltransferase activity(GO:0003886) DNA (cytosine-5-)-methyltransferase activity, acting on CpG substrates(GO:0051718) |
0.2 | 1.4 | GO:0048406 | nerve growth factor binding(GO:0048406) |
0.2 | 0.7 | GO:0071209 | U7 snRNA binding(GO:0071209) |
0.2 | 1.1 | GO:0086080 | protein binding involved in heterotypic cell-cell adhesion(GO:0086080) |
0.2 | 0.9 | GO:0005329 | dopamine transmembrane transporter activity(GO:0005329) |
0.2 | 1.4 | GO:0016724 | ferroxidase activity(GO:0004322) oxidoreductase activity, oxidizing metal ions, oxygen as acceptor(GO:0016724) |
0.2 | 0.7 | GO:0004719 | protein-L-isoaspartate (D-aspartate) O-methyltransferase activity(GO:0004719) |
0.2 | 1.8 | GO:0050649 | testosterone 6-beta-hydroxylase activity(GO:0050649) |
0.2 | 2.7 | GO:0016505 | peptidase activator activity involved in apoptotic process(GO:0016505) |
0.2 | 0.4 | GO:0004065 | arylsulfatase activity(GO:0004065) |
0.2 | 0.7 | GO:0004829 | threonine-tRNA ligase activity(GO:0004829) |
0.2 | 0.9 | GO:0050693 | LBD domain binding(GO:0050693) |
0.2 | 0.7 | GO:0035515 | oxidative RNA demethylase activity(GO:0035515) |
0.2 | 0.7 | GO:0042284 | sphingolipid delta-4 desaturase activity(GO:0042284) |
0.2 | 0.4 | GO:1901702 | urate transmembrane transporter activity(GO:0015143) salt transmembrane transporter activity(GO:1901702) |
0.2 | 0.7 | GO:0004800 | thyroxine 5'-deiodinase activity(GO:0004800) |
0.2 | 0.9 | GO:0019871 | sodium channel inhibitor activity(GO:0019871) |
0.2 | 6.5 | GO:0050699 | WW domain binding(GO:0050699) |
0.2 | 0.6 | GO:0017116 | single-stranded DNA-dependent ATP-dependent DNA helicase activity(GO:0017116) |
0.2 | 1.0 | GO:0003933 | GTP cyclohydrolase activity(GO:0003933) |
0.2 | 0.8 | GO:0005166 | neurotrophin p75 receptor binding(GO:0005166) |
0.2 | 1.0 | GO:0035473 | lipase binding(GO:0035473) |
0.2 | 1.4 | GO:0035381 | extracellular ATP-gated cation channel activity(GO:0004931) ATP-gated ion channel activity(GO:0035381) |
0.2 | 0.6 | GO:1901612 | cardiolipin binding(GO:1901612) |
0.2 | 1.4 | GO:0019957 | C-C chemokine binding(GO:0019957) |
0.2 | 2.0 | GO:0005436 | sodium:phosphate symporter activity(GO:0005436) |
0.2 | 0.2 | GO:0032767 | copper-dependent protein binding(GO:0032767) |
0.2 | 2.2 | GO:0017166 | vinculin binding(GO:0017166) |
0.2 | 0.8 | GO:0008502 | melatonin receptor activity(GO:0008502) |
0.2 | 1.0 | GO:0043237 | laminin-1 binding(GO:0043237) |
0.2 | 1.1 | GO:0008508 | bile acid:sodium symporter activity(GO:0008508) |
0.2 | 0.4 | GO:0003846 | 2-acylglycerol O-acyltransferase activity(GO:0003846) |
0.2 | 0.4 | GO:0004939 | beta-adrenergic receptor activity(GO:0004939) |
0.2 | 1.0 | GO:0004784 | superoxide dismutase activity(GO:0004784) oxidoreductase activity, acting on superoxide radicals as acceptor(GO:0016721) |
0.2 | 0.9 | GO:0030676 | Rac guanyl-nucleotide exchange factor activity(GO:0030676) |
0.2 | 1.1 | GO:0015037 | peptide disulfide oxidoreductase activity(GO:0015037) |
0.2 | 2.1 | GO:0016813 | hydrolase activity, acting on carbon-nitrogen (but not peptide) bonds, in linear amidines(GO:0016813) |
0.2 | 2.3 | GO:0050811 | GABA receptor binding(GO:0050811) |
0.2 | 0.6 | GO:0071553 | uridine nucleotide receptor activity(GO:0015065) G-protein coupled pyrimidinergic nucleotide receptor activity(GO:0071553) |
0.2 | 0.6 | GO:0005176 | ErbB-2 class receptor binding(GO:0005176) |
0.2 | 0.6 | GO:0019797 | procollagen-proline 3-dioxygenase activity(GO:0019797) |
0.2 | 0.6 | GO:0008427 | calcium-dependent protein kinase inhibitor activity(GO:0008427) |
0.2 | 0.6 | GO:0015142 | citrate transmembrane transporter activity(GO:0015137) tricarboxylic acid transmembrane transporter activity(GO:0015142) |
0.2 | 0.2 | GO:0003696 | satellite DNA binding(GO:0003696) |
0.2 | 0.2 | GO:0008603 | cAMP-dependent protein kinase regulator activity(GO:0008603) |
0.2 | 2.4 | GO:0019215 | intermediate filament binding(GO:0019215) |
0.2 | 0.6 | GO:0030158 | protein xylosyltransferase activity(GO:0030158) |
0.2 | 0.4 | GO:0016715 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, reduced ascorbate as one donor, and incorporation of one atom of oxygen(GO:0016715) |
0.2 | 2.4 | GO:0000983 | transcription factor activity, RNA polymerase II core promoter sequence-specific(GO:0000983) |
0.2 | 0.5 | GO:0030620 | U2 snRNA binding(GO:0030620) |
0.2 | 1.4 | GO:0032552 | deoxyribonucleotide binding(GO:0032552) |
0.2 | 0.9 | GO:0015450 | P-P-bond-hydrolysis-driven protein transmembrane transporter activity(GO:0015450) |
0.2 | 2.3 | GO:0055106 | ubiquitin-protein transferase regulator activity(GO:0055106) |
0.2 | 0.2 | GO:0046976 | histone methyltransferase activity (H3-K27 specific)(GO:0046976) |
0.2 | 0.5 | GO:0046404 | ATP-dependent polydeoxyribonucleotide 5'-hydroxyl-kinase activity(GO:0046404) polydeoxyribonucleotide kinase activity(GO:0051733) |
0.2 | 1.0 | GO:0031730 | CCR5 chemokine receptor binding(GO:0031730) |
0.2 | 0.2 | GO:0019841 | retinol binding(GO:0019841) |
0.2 | 1.2 | GO:0030492 | hemoglobin binding(GO:0030492) |
0.2 | 2.4 | GO:0042608 | T cell receptor binding(GO:0042608) |
0.2 | 1.7 | GO:0004698 | calcium-dependent protein kinase C activity(GO:0004698) |
0.2 | 0.7 | GO:0016401 | palmitoyl-CoA oxidase activity(GO:0016401) |
0.2 | 1.4 | GO:0003841 | 1-acylglycerol-3-phosphate O-acyltransferase activity(GO:0003841) |
0.2 | 3.6 | GO:0005540 | hyaluronic acid binding(GO:0005540) |
0.2 | 0.2 | GO:0030943 | mitochondrion targeting sequence binding(GO:0030943) |
0.2 | 0.5 | GO:0070698 | type I activin receptor binding(GO:0070698) |
0.2 | 0.5 | GO:0015173 | aromatic amino acid transmembrane transporter activity(GO:0015173) |
0.2 | 0.7 | GO:0102345 | 3-hydroxy-behenoyl-CoA dehydratase activity(GO:0102344) 3-hydroxy-lignoceroyl-CoA dehydratase activity(GO:0102345) |
0.2 | 1.3 | GO:0031995 | insulin-like growth factor II binding(GO:0031995) |
0.2 | 0.5 | GO:0045134 | uridine-diphosphatase activity(GO:0045134) |
0.2 | 0.5 | GO:0015368 | calcium:cation antiporter activity(GO:0015368) |
0.2 | 2.2 | GO:0004012 | phospholipid-translocating ATPase activity(GO:0004012) |
0.2 | 0.5 | GO:0070878 | primary miRNA binding(GO:0070878) |
0.2 | 1.1 | GO:0000150 | recombinase activity(GO:0000150) |
0.2 | 1.7 | GO:0044605 | cobinamide kinase activity(GO:0008819) phytol kinase activity(GO:0010276) phenol kinase activity(GO:0018720) cyclin-dependent protein kinase activating kinase regulator activity(GO:0019914) inositol tetrakisphosphate 2-kinase activity(GO:0032942) heptose 7-phosphate kinase activity(GO:0033785) aminoglycoside phosphotransferase activity(GO:0034071) eukaryotic elongation factor-2 kinase regulator activity(GO:0042556) eukaryotic elongation factor-2 kinase activator activity(GO:0042557) LPPG:FO 2-phospho-L-lactate transferase activity(GO:0043743) cytidine kinase activity(GO:0043771) glycerate 2-kinase activity(GO:0043798) (S)-lactate 2-kinase activity(GO:0043841) phosphoserine:homoserine phosphotransferase activity(GO:0043899) L-seryl-tRNA(Sec) kinase activity(GO:0043915) phosphocholine transferase activity(GO:0044605) polynucleotide 5'-hydroxyl-kinase activity(GO:0051731) ATP-dependent polynucleotide kinase activity(GO:0051734) GTP-dependent polynucleotide kinase activity(GO:0051735) farnesol kinase activity(GO:0052668) CTP:2-trans,-6-trans-farnesol kinase activity(GO:0052669) geraniol kinase activity(GO:0052670) geranylgeraniol kinase activity(GO:0052671) CTP:geranylgeraniol kinase activity(GO:0052672) prenol kinase activity(GO:0052673) 1-phosphatidylinositol-5-kinase activity(GO:0052810) 1-phosphatidylinositol-3-phosphate 4-kinase activity(GO:0052811) phosphatidylinositol-3,4-bisphosphate 5-kinase activity(GO:0052812) inositol-3,4,6-trisphosphate 1-kinase activity(GO:0052835) inositol 5-diphosphate pentakisphosphate 5-kinase activity(GO:0052836) inositol diphosphate tetrakisphosphate kinase activity(GO:0052839) |
0.2 | 0.5 | GO:0031711 | bradykinin receptor binding(GO:0031711) |
0.2 | 0.8 | GO:0038085 | vascular endothelial growth factor binding(GO:0038085) |
0.2 | 0.2 | GO:0061676 | importin-alpha family protein binding(GO:0061676) |
0.2 | 1.1 | GO:0016494 | C-X-C chemokine receptor activity(GO:0016494) |
0.2 | 0.8 | GO:0004457 | lactate dehydrogenase activity(GO:0004457) |
0.2 | 0.8 | GO:0015349 | thyroid hormone transmembrane transporter activity(GO:0015349) |
0.2 | 4.8 | GO:0005044 | scavenger receptor activity(GO:0005044) |
0.1 | 0.3 | GO:0051373 | FATZ binding(GO:0051373) |
0.1 | 1.8 | GO:0016854 | racemase and epimerase activity(GO:0016854) |
0.1 | 0.1 | GO:0016937 | short-branched-chain-acyl-CoA dehydrogenase activity(GO:0016937) |
0.1 | 1.2 | GO:0004596 | peptide alpha-N-acetyltransferase activity(GO:0004596) |
0.1 | 1.0 | GO:0050998 | nitric-oxide synthase binding(GO:0050998) |
0.1 | 0.6 | GO:0034235 | GPI anchor binding(GO:0034235) |
0.1 | 1.2 | GO:0004445 | inositol-polyphosphate 5-phosphatase activity(GO:0004445) |
0.1 | 0.9 | GO:0035005 | 1-phosphatidylinositol-4-phosphate 3-kinase activity(GO:0035005) |
0.1 | 0.3 | GO:0000403 | Y-form DNA binding(GO:0000403) |
0.1 | 1.2 | GO:0008140 | cAMP response element binding protein binding(GO:0008140) |
0.1 | 1.0 | GO:0000014 | single-stranded DNA endodeoxyribonuclease activity(GO:0000014) |
0.1 | 0.1 | GO:0050145 | nucleoside phosphate kinase activity(GO:0050145) |
0.1 | 0.1 | GO:0043394 | proteoglycan binding(GO:0043394) |
0.1 | 0.3 | GO:0019107 | myristoyltransferase activity(GO:0019107) |
0.1 | 4.7 | GO:0016406 | carnitine O-acyltransferase activity(GO:0016406) |
0.1 | 0.3 | GO:0070326 | very-low-density lipoprotein particle receptor binding(GO:0070326) |
0.1 | 0.4 | GO:0000182 | rDNA binding(GO:0000182) |
0.1 | 0.9 | GO:0043023 | ribosomal large subunit binding(GO:0043023) |
0.1 | 0.4 | GO:0004937 | alpha1-adrenergic receptor activity(GO:0004937) |
0.1 | 1.1 | GO:0035197 | siRNA binding(GO:0035197) |
0.1 | 0.1 | GO:0016882 | cyclo-ligase activity(GO:0016882) |
0.1 | 0.8 | GO:0005499 | vitamin D binding(GO:0005499) |
0.1 | 1.0 | GO:0097371 | MDM2/MDM4 family protein binding(GO:0097371) |
0.1 | 0.4 | GO:0004611 | phosphoenolpyruvate carboxykinase activity(GO:0004611) |
0.1 | 0.6 | GO:0032405 | MutLalpha complex binding(GO:0032405) |
0.1 | 1.9 | GO:0016918 | retinal binding(GO:0016918) |
0.1 | 0.6 | GO:0031014 | troponin T binding(GO:0031014) |
0.1 | 0.4 | GO:0046870 | cadmium ion binding(GO:0046870) |
0.1 | 0.3 | GO:0030229 | very-low-density lipoprotein particle receptor activity(GO:0030229) |
0.1 | 0.7 | GO:0004563 | beta-N-acetylhexosaminidase activity(GO:0004563) |
0.1 | 1.1 | GO:0008429 | phosphatidylethanolamine binding(GO:0008429) |
0.1 | 0.1 | GO:0035514 | DNA demethylase activity(GO:0035514) |
0.1 | 1.6 | GO:0001161 | intronic transcription regulatory region sequence-specific DNA binding(GO:0001161) |
0.1 | 3.1 | GO:0015296 | anion:cation symporter activity(GO:0015296) |
0.1 | 0.8 | GO:0003678 | DNA helicase activity(GO:0003678) |
0.1 | 0.8 | GO:0043008 | ATP-dependent protein binding(GO:0043008) |
0.1 | 0.1 | GO:0030375 | thyroid hormone receptor coactivator activity(GO:0030375) |
0.1 | 0.4 | GO:0004920 | interleukin-10 receptor activity(GO:0004920) |
0.1 | 0.1 | GO:0070915 | lysophosphatidic acid receptor activity(GO:0070915) |
0.1 | 0.8 | GO:0032052 | bile acid binding(GO:0032052) |
0.1 | 0.8 | GO:0051371 | muscle alpha-actinin binding(GO:0051371) |
0.1 | 0.5 | GO:0046790 | virion binding(GO:0046790) |
0.1 | 1.5 | GO:0070403 | NAD+ binding(GO:0070403) |
0.1 | 0.1 | GO:0055100 | adiponectin binding(GO:0055100) |
0.1 | 0.1 | GO:0003872 | 6-phosphofructokinase activity(GO:0003872) |
0.1 | 1.7 | GO:0008553 | hydrogen-exporting ATPase activity, phosphorylative mechanism(GO:0008553) |
0.1 | 0.4 | GO:0004711 | ribosomal protein S6 kinase activity(GO:0004711) |
0.1 | 0.1 | GO:0031404 | chloride ion binding(GO:0031404) |
0.1 | 0.4 | GO:0097108 | hedgehog family protein binding(GO:0097108) |
0.1 | 0.5 | GO:0047499 | calcium-independent phospholipase A2 activity(GO:0047499) |
0.1 | 0.3 | GO:0044390 | ubiquitin-like protein conjugating enzyme binding(GO:0044390) |
0.1 | 1.3 | GO:0004861 | cyclin-dependent protein serine/threonine kinase inhibitor activity(GO:0004861) |
0.1 | 0.9 | GO:0016907 | G-protein coupled acetylcholine receptor activity(GO:0016907) |
0.1 | 0.4 | GO:0004691 | cAMP-dependent protein kinase activity(GO:0004691) |
0.1 | 0.4 | GO:0033265 | choline binding(GO:0033265) |
0.1 | 0.3 | GO:0004630 | phospholipase D activity(GO:0004630) |
0.1 | 0.5 | GO:0022858 | L-alanine transmembrane transporter activity(GO:0015180) alanine transmembrane transporter activity(GO:0022858) |
0.1 | 4.2 | GO:0005201 | extracellular matrix structural constituent(GO:0005201) |
0.1 | 0.6 | GO:0004111 | creatine kinase activity(GO:0004111) |
0.1 | 0.9 | GO:0033691 | sialic acid binding(GO:0033691) |
0.1 | 1.9 | GO:0046965 | retinoid X receptor binding(GO:0046965) |
0.1 | 0.4 | GO:0005375 | copper ion transmembrane transporter activity(GO:0005375) |
0.1 | 1.4 | GO:0019177 | thiamine-pyrophosphatase activity(GO:0004787) UDP-2,3-diacylglucosamine hydrolase activity(GO:0008758) dATP pyrophosphohydrolase activity(GO:0008828) dihydroneopterin monophosphate phosphatase activity(GO:0019176) dihydroneopterin triphosphate pyrophosphohydrolase activity(GO:0019177) dTTP diphosphatase activity(GO:0036218) phosphocholine hydrolase activity(GO:0044606) |
0.1 | 1.3 | GO:0004950 | G-protein coupled chemoattractant receptor activity(GO:0001637) chemokine receptor activity(GO:0004950) |
0.1 | 2.5 | GO:0030215 | semaphorin receptor binding(GO:0030215) |
0.1 | 2.8 | GO:0005385 | zinc ion transmembrane transporter activity(GO:0005385) |
0.1 | 0.4 | GO:0050567 | glutaminyl-tRNA synthase (glutamine-hydrolyzing) activity(GO:0050567) |
0.1 | 0.5 | GO:0034714 | type III transforming growth factor beta receptor binding(GO:0034714) |
0.1 | 2.1 | GO:0070008 | serine-type exopeptidase activity(GO:0070008) |
0.1 | 0.4 | GO:0009041 | uridylate kinase activity(GO:0009041) |
0.1 | 0.1 | GO:0005131 | growth hormone receptor binding(GO:0005131) |
0.1 | 0.6 | GO:0008312 | 7S RNA binding(GO:0008312) |
0.1 | 0.1 | GO:0018479 | benzaldehyde dehydrogenase (NAD+) activity(GO:0018479) |
0.1 | 0.4 | GO:0015222 | serotonin transmembrane transporter activity(GO:0015222) |
0.1 | 0.4 | GO:0010484 | H3 histone acetyltransferase activity(GO:0010484) |
0.1 | 1.1 | GO:0001206 | transcriptional repressor activity, RNA polymerase II distal enhancer sequence-specific binding(GO:0001206) |
0.1 | 0.6 | GO:0070891 | lipoteichoic acid binding(GO:0070891) |
0.1 | 6.5 | GO:0000979 | RNA polymerase II core promoter sequence-specific DNA binding(GO:0000979) |
0.1 | 0.2 | GO:0071558 | histone demethylase activity (H3-K27 specific)(GO:0071558) |
0.1 | 3.8 | GO:0031624 | ubiquitin conjugating enzyme binding(GO:0031624) |
0.1 | 0.4 | GO:0052623 | 4-hydroxybenzoate octaprenyltransferase activity(GO:0008412) protoheme IX farnesyltransferase activity(GO:0008495) (S)-2,3-di-O-geranylgeranylglyceryl phosphate synthase activity(GO:0043888) cadaverine aminopropyltransferase activity(GO:0043918) agmatine aminopropyltransferase activity(GO:0043919) 1,4-dihydroxy-2-naphthoate octaprenyltransferase activity(GO:0046428) trans-pentaprenyltranstransferase activity(GO:0048045) ATP dimethylallyltransferase activity(GO:0052622) ADP dimethylallyltransferase activity(GO:0052623) |
0.1 | 0.5 | GO:0051575 | 5'-deoxyribose-5-phosphate lyase activity(GO:0051575) |
0.1 | 1.0 | GO:0004017 | adenylate kinase activity(GO:0004017) |
0.1 | 1.3 | GO:0043024 | ribosomal small subunit binding(GO:0043024) |
0.1 | 0.6 | GO:0070728 | leucine binding(GO:0070728) |
0.1 | 1.3 | GO:0070636 | purine-specific mismatch base pair DNA N-glycosylase activity(GO:0000701) single-strand selective uracil DNA N-glycosylase activity(GO:0017065) nicotinamide riboside hydrolase activity(GO:0070635) nicotinic acid riboside hydrolase activity(GO:0070636) deoxyribonucleoside 5'-monophosphate N-glycosidase activity(GO:0070694) |
0.1 | 0.4 | GO:0045503 | dynein light chain binding(GO:0045503) |
0.1 | 0.7 | GO:0016936 | galactoside binding(GO:0016936) |
0.1 | 0.5 | GO:0000268 | peroxisome targeting sequence binding(GO:0000268) |
0.1 | 0.9 | GO:0015174 | basic amino acid transmembrane transporter activity(GO:0015174) |
0.1 | 1.3 | GO:0005542 | folic acid binding(GO:0005542) |
0.1 | 0.4 | GO:0070191 | methionine-R-sulfoxide reductase activity(GO:0070191) |
0.1 | 0.5 | GO:0004966 | galanin receptor activity(GO:0004966) |
0.1 | 1.4 | GO:0070402 | NADPH binding(GO:0070402) |
0.1 | 1.0 | GO:0004143 | diacylglycerol kinase activity(GO:0004143) |
0.1 | 0.2 | GO:0051022 | Rho GDP-dissociation inhibitor binding(GO:0051022) |
0.1 | 0.5 | GO:0033192 | calmodulin-dependent protein phosphatase activity(GO:0033192) |
0.1 | 0.8 | GO:0001013 | RNA polymerase I regulatory region DNA binding(GO:0001013) |
0.1 | 0.6 | GO:0042979 | ornithine decarboxylase regulator activity(GO:0042979) |
0.1 | 1.1 | GO:0051400 | BH domain binding(GO:0051400) |
0.1 | 1.8 | GO:0031418 | L-ascorbic acid binding(GO:0031418) |
0.1 | 0.8 | GO:0015194 | L-serine transmembrane transporter activity(GO:0015194) serine transmembrane transporter activity(GO:0022889) |
0.1 | 0.5 | GO:1990715 | mRNA CDS binding(GO:1990715) |
0.1 | 0.3 | GO:0004948 | calcitonin receptor activity(GO:0004948) |
0.1 | 0.1 | GO:0052813 | phosphatidylinositol-4,5-bisphosphate 3-kinase activity(GO:0046934) phosphatidylinositol bisphosphate kinase activity(GO:0052813) |
0.1 | 0.9 | GO:0004779 | sulfate adenylyltransferase activity(GO:0004779) |
0.1 | 0.7 | GO:0047498 | calcium-dependent phospholipase A2 activity(GO:0047498) |
0.1 | 2.0 | GO:0001056 | RNA polymerase III activity(GO:0001056) |
0.1 | 3.7 | GO:0005507 | copper ion binding(GO:0005507) |
0.1 | 2.3 | GO:0008139 | nuclear localization sequence binding(GO:0008139) |
0.1 | 0.4 | GO:0004301 | epoxide hydrolase activity(GO:0004301) |
0.1 | 0.3 | GO:0008484 | sulfuric ester hydrolase activity(GO:0008484) |
0.1 | 0.5 | GO:0070290 | N-acylphosphatidylethanolamine-specific phospholipase D activity(GO:0070290) |
0.1 | 0.3 | GO:0004967 | glucagon receptor activity(GO:0004967) |
0.1 | 1.1 | GO:0042577 | lipid phosphatase activity(GO:0042577) |
0.1 | 1.3 | GO:0008253 | 5'-nucleotidase activity(GO:0008253) |
0.1 | 0.1 | GO:0008796 | bis(5'-nucleosyl)-tetraphosphatase activity(GO:0008796) |
0.1 | 0.1 | GO:0051766 | inositol tetrakisphosphate kinase activity(GO:0051765) inositol trisphosphate kinase activity(GO:0051766) |
0.1 | 0.9 | GO:0003796 | lysozyme activity(GO:0003796) |
0.1 | 0.9 | GO:0005092 | GDP-dissociation inhibitor activity(GO:0005092) |
0.1 | 0.5 | GO:0004985 | opioid receptor activity(GO:0004985) |
0.1 | 0.8 | GO:0004767 | sphingomyelin phosphodiesterase activity(GO:0004767) |
0.1 | 1.4 | GO:0043325 | phosphatidylinositol-3,4-bisphosphate binding(GO:0043325) |
0.1 | 0.5 | GO:0019992 | diacylglycerol binding(GO:0019992) |
0.1 | 0.3 | GO:0034513 | box H/ACA snoRNA binding(GO:0034513) |
0.1 | 0.7 | GO:0070181 | small ribosomal subunit rRNA binding(GO:0070181) |
0.1 | 0.4 | GO:0000405 | bubble DNA binding(GO:0000405) |
0.1 | 0.3 | GO:0005128 | erythropoietin receptor binding(GO:0005128) |
0.1 | 0.2 | GO:0061133 | endopeptidase activator activity(GO:0061133) |
0.1 | 0.4 | GO:0030572 | cardiolipin synthase activity(GO:0008808) phosphatidyltransferase activity(GO:0030572) |
0.1 | 0.3 | GO:0016901 | oxidoreductase activity, acting on the CH-OH group of donors, quinone or similar compound as acceptor(GO:0016901) |
0.1 | 0.6 | GO:0008121 | ubiquinol-cytochrome-c reductase activity(GO:0008121) oxidoreductase activity, acting on diphenols and related substances as donors, cytochrome as acceptor(GO:0016681) |
0.1 | 2.7 | GO:0052770 | coenzyme F390-A hydrolase activity(GO:0052770) coenzyme F390-G hydrolase activity(GO:0052771) |
0.1 | 0.9 | GO:0031702 | type 1 angiotensin receptor binding(GO:0031702) |
0.1 | 0.1 | GO:0016899 | oxidoreductase activity, acting on the CH-OH group of donors, oxygen as acceptor(GO:0016899) |
0.1 | 0.7 | GO:0050700 | CARD domain binding(GO:0050700) |
0.1 | 0.4 | GO:0032050 | clathrin heavy chain binding(GO:0032050) |
0.1 | 0.3 | GO:0004551 | nucleotide diphosphatase activity(GO:0004551) |
0.1 | 0.2 | GO:0004703 | G-protein coupled receptor kinase activity(GO:0004703) |
0.1 | 1.1 | GO:0019825 | oxygen binding(GO:0019825) |
0.1 | 1.2 | GO:0015171 | amino acid transmembrane transporter activity(GO:0015171) |
0.1 | 1.1 | GO:0005388 | calcium-transporting ATPase activity(GO:0005388) |
0.1 | 2.4 | GO:0070566 | adenylyltransferase activity(GO:0070566) |
0.1 | 0.6 | GO:0030368 | interleukin-17 receptor activity(GO:0030368) |
0.1 | 0.5 | GO:0046912 | transferase activity, transferring acyl groups, acyl groups converted into alkyl on transfer(GO:0046912) |
0.1 | 1.1 | GO:0017075 | syntaxin-1 binding(GO:0017075) |
0.1 | 0.2 | GO:0016778 | diphosphotransferase activity(GO:0016778) |
0.1 | 10.7 | GO:0017137 | Rab GTPase binding(GO:0017137) |
0.1 | 0.1 | GO:0097642 | calcitonin family receptor activity(GO:0097642) |
0.1 | 1.1 | GO:0008301 | DNA binding, bending(GO:0008301) |
0.1 | 4.1 | GO:0004869 | cysteine-type endopeptidase inhibitor activity(GO:0004869) |
0.1 | 3.0 | GO:0005484 | SNAP receptor activity(GO:0005484) |
0.1 | 0.3 | GO:0019869 | chloride channel inhibitor activity(GO:0019869) |
0.1 | 1.8 | GO:0001106 | RNA polymerase II transcription corepressor activity(GO:0001106) |
0.1 | 0.2 | GO:0003923 | GPI-anchor transamidase activity(GO:0003923) |
0.1 | 0.5 | GO:0016208 | AMP binding(GO:0016208) |
0.1 | 1.4 | GO:0008143 | poly(A) binding(GO:0008143) |
0.1 | 0.3 | GO:0052629 | phosphatidylinositol-3,5-bisphosphate 3-phosphatase activity(GO:0052629) |
0.1 | 0.3 | GO:0016728 | ribonucleoside-diphosphate reductase activity, thioredoxin disulfide as acceptor(GO:0004748) oxidoreductase activity, acting on CH or CH2 groups, disulfide as acceptor(GO:0016728) ribonucleoside-diphosphate reductase activity(GO:0061731) |
0.1 | 0.4 | GO:0042289 | MHC class II protein binding(GO:0042289) |
0.1 | 0.3 | GO:2001070 | starch binding(GO:2001070) |
0.1 | 0.4 | GO:0003945 | N-acetyllactosamine synthase activity(GO:0003945) |
0.1 | 0.4 | GO:0019960 | C-X3-C chemokine binding(GO:0019960) |
0.1 | 0.8 | GO:0033170 | DNA clamp loader activity(GO:0003689) protein-DNA loading ATPase activity(GO:0033170) |
0.1 | 0.5 | GO:0045703 | pinocarveol dehydrogenase activity(GO:0018446) chloral hydrate dehydrogenase activity(GO:0018447) hydroxymethylmethylsilanediol oxidase activity(GO:0018448) 1-phenylethanol dehydrogenase activity(GO:0018449) myrtenol dehydrogenase activity(GO:0018450) cis-1,2-dihydroxy-1,2-dihydro-8-carboxynaphthalene dehydrogenase activity(GO:0034522) 3-hydroxy-4-methyloctanoyl-CoA dehydrogenase activity(GO:0034582) 2-hydroxy-4-isopropenylcyclohexane-1-carboxyl-CoA dehydrogenase activity(GO:0034778) cis-9,10-dihydroanthracene-9,10-diol dehydrogenase activity(GO:0034817) citronellol dehydrogenase activity(GO:0034821) naphthyl-2-hydroxymethyl-succinyl-CoA dehydrogenase activity(GO:0034847) 2,4,4-trimethyl-1-pentanol dehydrogenase activity(GO:0034863) 2,4,4-trimethyl-3-hydroxypentanoyl-CoA dehydrogenase activity(GO:0034868) 1-hydroxy-4,4-dimethylpentan-3-one dehydrogenase activity(GO:0034871) endosulfan diol dehydrogenase activity(GO:0034891) endosulfan hydroxyether dehydrogenase activity(GO:0034901) 3-hydroxy-2-methylhexanoyl-CoA dehydrogenase activity(GO:0034918) 3-hydroxy-2,6-dimethyl-5-methylene-heptanoyl-CoA dehydrogenase activity(GO:0034944) versicolorin reductase activity(GO:0042469) ketoreductase activity(GO:0045703) |
0.1 | 1.1 | GO:0047555 | 3',5'-cyclic-GMP phosphodiesterase activity(GO:0047555) |
0.1 | 0.4 | GO:0019911 | structural constituent of myelin sheath(GO:0019911) |
0.1 | 0.3 | GO:0003726 | double-stranded RNA adenosine deaminase activity(GO:0003726) |
0.1 | 3.7 | GO:0098811 | transcriptional activator activity, RNA polymerase II transcription factor binding(GO:0001190) transcriptional repressor activity, RNA polymerase II activating transcription factor binding(GO:0098811) |
0.1 | 0.4 | GO:0004591 | oxoglutarate dehydrogenase (succinyl-transferring) activity(GO:0004591) |
0.1 | 0.8 | GO:0001191 | transcriptional repressor activity, RNA polymerase II transcription factor binding(GO:0001191) |
0.1 | 0.1 | GO:0008193 | tRNA guanylyltransferase activity(GO:0008193) |
0.1 | 0.4 | GO:0008532 | N-acetyllactosaminide beta-1,3-N-acetylglucosaminyltransferase activity(GO:0008532) |
0.1 | 3.5 | GO:0000980 | RNA polymerase II distal enhancer sequence-specific DNA binding(GO:0000980) |
0.1 | 0.5 | GO:0005172 | vascular endothelial growth factor receptor binding(GO:0005172) |
0.1 | 0.2 | GO:0072542 | protein phosphatase activator activity(GO:0072542) |
0.1 | 0.2 | GO:0016151 | nickel cation binding(GO:0016151) |
0.1 | 1.3 | GO:0001594 | trace-amine receptor activity(GO:0001594) |
0.1 | 0.3 | GO:0015119 | hexose phosphate transmembrane transporter activity(GO:0015119) organophosphate:inorganic phosphate antiporter activity(GO:0015315) hexose-phosphate:inorganic phosphate antiporter activity(GO:0015526) glucose 6-phosphate:inorganic phosphate antiporter activity(GO:0061513) |
0.1 | 0.4 | GO:0004523 | RNA-DNA hybrid ribonuclease activity(GO:0004523) |
0.1 | 1.2 | GO:0001784 | phosphotyrosine binding(GO:0001784) |
0.1 | 0.1 | GO:0015193 | L-proline transmembrane transporter activity(GO:0015193) |
0.1 | 0.3 | GO:0016661 | oxidoreductase activity, acting on other nitrogenous compounds as donors(GO:0016661) |
0.1 | 0.1 | GO:0051380 | norepinephrine binding(GO:0051380) |
0.1 | 0.3 | GO:0031800 | type 3 metabotropic glutamate receptor binding(GO:0031800) |
0.1 | 0.1 | GO:0035651 | AP-3 adaptor complex binding(GO:0035651) |
0.1 | 0.2 | GO:0019961 | interferon binding(GO:0019961) |
0.1 | 0.6 | GO:0001871 | pattern binding(GO:0001871) polysaccharide binding(GO:0030247) |
0.1 | 0.1 | GO:0008401 | retinoic acid 4-hydroxylase activity(GO:0008401) |
0.1 | 0.2 | GO:0046975 | histone methyltransferase activity (H3-K36 specific)(GO:0046975) |
0.1 | 0.2 | GO:0071253 | connexin binding(GO:0071253) |
0.1 | 0.3 | GO:0032184 | SUMO polymer binding(GO:0032184) |
0.1 | 0.2 | GO:0072345 | NAADP-sensitive calcium-release channel activity(GO:0072345) |
0.1 | 0.2 | GO:1990188 | euchromatin binding(GO:1990188) |
0.1 | 0.5 | GO:0016894 | endodeoxyribonuclease activity, producing 3'-phosphomonoesters(GO:0016889) endonuclease activity, active with either ribo- or deoxyribonucleic acids and producing 3'-phosphomonoesters(GO:0016894) |
0.1 | 0.8 | GO:0017160 | Ral GTPase binding(GO:0017160) |
0.1 | 1.0 | GO:0005520 | insulin-like growth factor binding(GO:0005520) |
0.1 | 1.1 | GO:0022841 | potassium ion leak channel activity(GO:0022841) |
0.1 | 0.2 | GO:0048027 | mRNA 5'-UTR binding(GO:0048027) |
0.1 | 0.5 | GO:0016443 | bidentate ribonuclease III activity(GO:0016443) |
0.1 | 0.8 | GO:0004697 | protein kinase C activity(GO:0004697) |
0.1 | 1.0 | GO:0001671 | ATPase activator activity(GO:0001671) |
0.1 | 1.3 | GO:0005186 | pheromone activity(GO:0005186) |
0.1 | 0.5 | GO:0008190 | eukaryotic initiation factor 4E binding(GO:0008190) |
0.1 | 0.5 | GO:0003688 | DNA replication origin binding(GO:0003688) |
0.1 | 0.2 | GO:0048030 | disaccharide binding(GO:0048030) |
0.1 | 0.4 | GO:0032036 | myosin heavy chain binding(GO:0032036) |
0.1 | 1.0 | GO:0001102 | RNA polymerase II activating transcription factor binding(GO:0001102) |
0.1 | 0.2 | GO:0019237 | centromeric DNA binding(GO:0019237) |
0.1 | 0.4 | GO:0015165 | pyrimidine nucleotide-sugar transmembrane transporter activity(GO:0015165) |
0.1 | 1.9 | GO:0032266 | phosphatidylinositol-3-phosphate binding(GO:0032266) |
0.1 | 1.5 | GO:0005070 | SH3/SH2 adaptor activity(GO:0005070) |
0.1 | 0.4 | GO:0042301 | phosphate ion binding(GO:0042301) |
0.1 | 0.3 | GO:0017176 | phosphatidylinositol N-acetylglucosaminyltransferase activity(GO:0017176) |
0.1 | 0.4 | GO:0070061 | fructose binding(GO:0070061) |
0.1 | 0.5 | GO:0008430 | selenium binding(GO:0008430) |
0.1 | 0.2 | GO:0048763 | calcium-induced calcium release activity(GO:0048763) |
0.1 | 0.4 | GO:0030296 | protein tyrosine kinase activator activity(GO:0030296) |
0.1 | 0.3 | GO:0017150 | tRNA dihydrouridine synthase activity(GO:0017150) |
0.1 | 0.5 | GO:0031628 | opioid receptor binding(GO:0031628) |
0.1 | 0.4 | GO:0017151 | DEAD/H-box RNA helicase binding(GO:0017151) |
0.1 | 0.5 | GO:0005223 | intracellular cGMP activated cation channel activity(GO:0005223) |
0.1 | 0.2 | GO:0016774 | phosphotransferase activity, carboxyl group as acceptor(GO:0016774) |
0.1 | 0.1 | GO:0016803 | ether hydrolase activity(GO:0016803) |
0.1 | 0.4 | GO:0005049 | nuclear export signal receptor activity(GO:0005049) |
0.1 | 0.1 | GO:0008158 | hedgehog receptor activity(GO:0008158) |
0.1 | 0.1 | GO:0031686 | A1 adenosine receptor binding(GO:0031686) |
0.1 | 0.9 | GO:0015175 | neutral amino acid transmembrane transporter activity(GO:0015175) |
0.1 | 0.4 | GO:0038036 | sphingosine-1-phosphate receptor activity(GO:0038036) |
0.1 | 0.4 | GO:0070513 | death domain binding(GO:0070513) |
0.1 | 0.1 | GO:0030619 | U1 snRNA binding(GO:0030619) |
0.1 | 0.1 | GO:0030899 | calcium-dependent ATPase activity(GO:0030899) |
0.1 | 0.2 | GO:0019166 | trans-2-enoyl-CoA reductase (NADPH) activity(GO:0019166) |
0.1 | 0.8 | GO:0051393 | alpha-actinin binding(GO:0051393) |
0.1 | 0.5 | GO:0004972 | NMDA glutamate receptor activity(GO:0004972) |
0.1 | 0.1 | GO:0030942 | endoplasmic reticulum signal peptide binding(GO:0030942) |
0.1 | 0.7 | GO:0001618 | virus receptor activity(GO:0001618) |
0.1 | 0.1 | GO:0048020 | CCR chemokine receptor binding(GO:0048020) |
0.1 | 0.9 | GO:0070064 | proline-rich region binding(GO:0070064) |
0.1 | 0.4 | GO:0008294 | calcium- and calmodulin-responsive adenylate cyclase activity(GO:0008294) |
0.1 | 0.1 | GO:0017098 | sulfonylurea receptor binding(GO:0017098) |
0.1 | 0.3 | GO:0035612 | AP-2 adaptor complex binding(GO:0035612) |
0.1 | 0.1 | GO:0003916 | DNA topoisomerase activity(GO:0003916) DNA topoisomerase type I activity(GO:0003917) |
0.1 | 0.2 | GO:0070548 | L-glutamine aminotransferase activity(GO:0070548) |
0.1 | 1.4 | GO:0003746 | translation elongation factor activity(GO:0003746) |
0.1 | 0.4 | GO:0046933 | proton-transporting ATP synthase activity, rotational mechanism(GO:0046933) |
0.1 | 0.7 | GO:0045295 | gamma-catenin binding(GO:0045295) |
0.1 | 0.2 | GO:0031748 | D1 dopamine receptor binding(GO:0031748) |
0.1 | 0.3 | GO:0042134 | rRNA primary transcript binding(GO:0042134) |
0.1 | 0.1 | GO:0005237 | inhibitory extracellular ligand-gated ion channel activity(GO:0005237) |
0.1 | 0.1 | GO:0098632 | protein binding involved in cell-cell adhesion(GO:0098632) |
0.1 | 0.3 | GO:0034711 | inhibin binding(GO:0034711) |
0.1 | 6.2 | GO:0017124 | SH3 domain binding(GO:0017124) |
0.1 | 0.3 | GO:0016018 | cyclosporin A binding(GO:0016018) |
0.1 | 0.2 | GO:0030144 | alpha-1,6-mannosylglycoprotein 6-beta-N-acetylglucosaminyltransferase activity(GO:0030144) |
0.1 | 0.8 | GO:0004623 | phospholipase A2 activity(GO:0004623) |
0.1 | 0.3 | GO:0001094 | TFIID-class transcription factor binding(GO:0001094) |
0.1 | 0.2 | GO:0003876 | AMP deaminase activity(GO:0003876) adenosine-phosphate deaminase activity(GO:0047623) |
0.1 | 0.5 | GO:0005536 | glucose binding(GO:0005536) |
0.1 | 0.2 | GO:0016971 | flavin-linked sulfhydryl oxidase activity(GO:0016971) |
0.1 | 0.2 | GO:0052650 | NADP-retinol dehydrogenase activity(GO:0052650) |
0.1 | 0.3 | GO:0004467 | long-chain fatty acid-CoA ligase activity(GO:0004467) |
0.1 | 0.3 | GO:0004974 | leukotriene receptor activity(GO:0004974) |
0.1 | 0.7 | GO:0001614 | purinergic nucleotide receptor activity(GO:0001614) nucleotide receptor activity(GO:0016502) |
0.1 | 0.9 | GO:0016780 | phosphotransferase activity, for other substituted phosphate groups(GO:0016780) |
0.1 | 9.8 | GO:0061630 | ubiquitin protein ligase activity(GO:0061630) |
0.1 | 0.2 | GO:0016647 | oxidoreductase activity, acting on the CH-NH group of donors, oxygen as acceptor(GO:0016647) |
0.1 | 1.5 | GO:0005212 | structural constituent of eye lens(GO:0005212) |
0.1 | 0.8 | GO:0004745 | retinol dehydrogenase activity(GO:0004745) |
0.1 | 0.2 | GO:0004165 | dodecenoyl-CoA delta-isomerase activity(GO:0004165) |
0.1 | 0.6 | GO:0042500 | aspartic endopeptidase activity, intramembrane cleaving(GO:0042500) |
0.1 | 0.1 | GO:0019211 | phosphatase activator activity(GO:0019211) |
0.1 | 0.2 | GO:0004965 | G-protein coupled GABA receptor activity(GO:0004965) |
0.1 | 0.1 | GO:0034190 | apolipoprotein receptor binding(GO:0034190) |
0.1 | 1.0 | GO:0043425 | bHLH transcription factor binding(GO:0043425) |
0.1 | 0.6 | GO:0016594 | glycine binding(GO:0016594) |
0.1 | 0.2 | GO:0070051 | fibrinogen binding(GO:0070051) |
0.1 | 0.1 | GO:0008026 | ATP-dependent helicase activity(GO:0008026) purine NTP-dependent helicase activity(GO:0070035) |
0.1 | 0.2 | GO:0015651 | quaternary ammonium group transmembrane transporter activity(GO:0015651) |
0.1 | 0.5 | GO:0031435 | mitogen-activated protein kinase kinase kinase binding(GO:0031435) |
0.1 | 0.2 | GO:1990380 | Lys48-specific deubiquitinase activity(GO:1990380) |
0.1 | 0.1 | GO:0070087 | chromo shadow domain binding(GO:0070087) |
0.1 | 0.4 | GO:0051787 | misfolded protein binding(GO:0051787) |
0.1 | 0.4 | GO:0031996 | thioesterase binding(GO:0031996) |
0.1 | 1.6 | GO:0004177 | aminopeptidase activity(GO:0004177) |
0.1 | 0.2 | GO:0004839 | ubiquitin activating enzyme activity(GO:0004839) |
0.1 | 0.1 | GO:0015232 | heme transporter activity(GO:0015232) |
0.1 | 0.3 | GO:0045505 | dynein intermediate chain binding(GO:0045505) |
0.1 | 3.4 | GO:0000149 | SNARE binding(GO:0000149) |
0.1 | 0.2 | GO:0035727 | lysophosphatidic acid binding(GO:0035727) |
0.1 | 1.2 | GO:0046875 | ephrin receptor binding(GO:0046875) |
0.1 | 0.4 | GO:0016175 | superoxide-generating NADPH oxidase activity(GO:0016175) |
0.1 | 0.2 | GO:0031013 | troponin I binding(GO:0031013) |
0.1 | 0.4 | GO:0004579 | dolichyl-diphosphooligosaccharide-protein glycotransferase activity(GO:0004579) |
0.1 | 2.9 | GO:0030674 | protein binding, bridging(GO:0030674) |
0.1 | 2.0 | GO:0008094 | DNA-dependent ATPase activity(GO:0008094) |
0.1 | 0.1 | GO:0004897 | ciliary neurotrophic factor receptor activity(GO:0004897) |
0.1 | 0.2 | GO:0023029 | MHC class Ib protein binding(GO:0023029) |
0.1 | 0.2 | GO:0016670 | oxidoreductase activity, acting on a sulfur group of donors, oxygen as acceptor(GO:0016670) |
0.1 | 2.8 | GO:0005200 | structural constituent of cytoskeleton(GO:0005200) |
0.1 | 0.1 | GO:0019787 | ubiquitin-like protein transferase activity(GO:0019787) |
0.1 | 0.2 | GO:0008309 | double-stranded DNA exodeoxyribonuclease activity(GO:0008309) |
0.1 | 0.4 | GO:0035259 | glucocorticoid receptor binding(GO:0035259) |
0.1 | 0.1 | GO:0008504 | monoamine transmembrane transporter activity(GO:0008504) |
0.1 | 0.5 | GO:0043996 | histone acetyltransferase activity (H4-K5 specific)(GO:0043995) histone acetyltransferase activity (H4-K8 specific)(GO:0043996) histone acetyltransferase activity (H4-K16 specific)(GO:0046972) |
0.1 | 0.3 | GO:0008097 | 5S rRNA binding(GO:0008097) |
0.1 | 0.6 | GO:0019200 | carbohydrate kinase activity(GO:0019200) |
0.1 | 0.8 | GO:0043395 | heparan sulfate proteoglycan binding(GO:0043395) |
0.1 | 0.3 | GO:0017127 | cholesterol transporter activity(GO:0017127) |
0.1 | 0.4 | GO:0008331 | high voltage-gated calcium channel activity(GO:0008331) |
0.1 | 0.1 | GO:0008853 | exodeoxyribonuclease III activity(GO:0008853) |
0.1 | 0.3 | GO:0005522 | profilin binding(GO:0005522) |
0.1 | 1.2 | GO:0016702 | oxidoreductase activity, acting on single donors with incorporation of molecular oxygen, incorporation of two atoms of oxygen(GO:0016702) |
0.1 | 0.4 | GO:0009931 | calcium-dependent protein serine/threonine kinase activity(GO:0009931) |
0.1 | 2.1 | GO:0004860 | protein kinase inhibitor activity(GO:0004860) |
0.1 | 0.2 | GO:0015252 | hydrogen ion channel activity(GO:0015252) |
0.1 | 0.9 | GO:0030546 | receptor activator activity(GO:0030546) |
0.1 | 0.5 | GO:0016868 | intramolecular transferase activity, phosphotransferases(GO:0016868) |
0.1 | 0.1 | GO:0050897 | cobalt ion binding(GO:0050897) |
0.1 | 0.6 | GO:0019865 | immunoglobulin binding(GO:0019865) |
0.1 | 0.1 | GO:0030621 | U4 snRNA binding(GO:0030621) |
0.1 | 0.2 | GO:0004126 | cytidine deaminase activity(GO:0004126) |
0.1 | 1.2 | GO:0019706 | protein-cysteine S-palmitoyltransferase activity(GO:0019706) |
0.1 | 0.1 | GO:0002094 | polyprenyltransferase activity(GO:0002094) |
0.1 | 0.5 | GO:0008432 | JUN kinase binding(GO:0008432) |
0.1 | 1.0 | GO:0008330 | protein tyrosine/threonine phosphatase activity(GO:0008330) |
0.1 | 0.9 | GO:0017112 | Rab guanyl-nucleotide exchange factor activity(GO:0017112) |
0.1 | 0.5 | GO:0010181 | FMN binding(GO:0010181) |
0.1 | 0.2 | GO:0016413 | O-acetyltransferase activity(GO:0016413) |
0.0 | 0.0 | GO:0004667 | prostaglandin-D synthase activity(GO:0004667) |
0.0 | 0.4 | GO:0030276 | clathrin binding(GO:0030276) |
0.0 | 0.1 | GO:0050510 | N-acetylgalactosaminyl-proteoglycan 3-beta-glucuronosyltransferase activity(GO:0050510) |
0.0 | 0.1 | GO:0033300 | dehydroascorbic acid transporter activity(GO:0033300) |
0.0 | 0.2 | GO:0031821 | G-protein coupled serotonin receptor binding(GO:0031821) |
0.0 | 0.1 | GO:0070653 | high-density lipoprotein particle receptor binding(GO:0070653) |
0.0 | 0.5 | GO:0015026 | coreceptor activity(GO:0015026) |
0.0 | 0.2 | GO:0032454 | histone demethylase activity (H3-K9 specific)(GO:0032454) |
0.0 | 1.6 | GO:0008009 | chemokine activity(GO:0008009) |
0.0 | 0.2 | GO:0044020 | histone methyltransferase activity (H4-R3 specific)(GO:0044020) |
0.0 | 0.1 | GO:0004616 | phosphogluconate dehydrogenase (decarboxylating) activity(GO:0004616) |
0.0 | 0.1 | GO:0016520 | growth hormone-releasing hormone receptor activity(GO:0016520) |
0.0 | 0.2 | GO:0003680 | AT DNA binding(GO:0003680) |
0.0 | 0.1 | GO:0008948 | malic enzyme activity(GO:0004470) malate dehydrogenase (decarboxylating) (NAD+) activity(GO:0004471) oxaloacetate decarboxylase activity(GO:0008948) |
0.0 | 0.2 | GO:0071933 | Arp2/3 complex binding(GO:0071933) |
0.0 | 0.1 | GO:0016309 | 1-phosphatidylinositol-5-phosphate 4-kinase activity(GO:0016309) |
0.0 | 3.3 | GO:0004197 | cysteine-type endopeptidase activity(GO:0004197) |
0.0 | 0.8 | GO:0015036 | disulfide oxidoreductase activity(GO:0015036) |
0.0 | 0.1 | GO:0000171 | ribonuclease MRP activity(GO:0000171) |
0.0 | 0.4 | GO:0070679 | inositol 1,4,5 trisphosphate binding(GO:0070679) |
0.0 | 0.5 | GO:0042800 | histone methyltransferase activity (H3-K4 specific)(GO:0042800) |
0.0 | 0.1 | GO:0047276 | N-acetyllactosaminide 3-alpha-galactosyltransferase activity(GO:0047276) |
0.0 | 0.2 | GO:0004994 | somatostatin receptor activity(GO:0004994) |
0.0 | 0.4 | GO:0046966 | thyroid hormone receptor binding(GO:0046966) |
0.0 | 0.0 | GO:0055131 | C3HC4-type RING finger domain binding(GO:0055131) |
0.0 | 0.2 | GO:0004645 | phosphorylase activity(GO:0004645) |
0.0 | 0.1 | GO:0004566 | beta-glucuronidase activity(GO:0004566) |
0.0 | 0.0 | GO:0070883 | pre-miRNA binding(GO:0070883) |
0.0 | 0.7 | GO:0004181 | metallocarboxypeptidase activity(GO:0004181) |
0.0 | 0.2 | GO:0030550 | acetylcholine receptor inhibitor activity(GO:0030550) |
0.0 | 1.0 | GO:0005184 | neuropeptide hormone activity(GO:0005184) |
0.0 | 1.0 | GO:0016831 | carboxy-lyase activity(GO:0016831) |
0.0 | 0.8 | GO:0008536 | Ran GTPase binding(GO:0008536) |
0.0 | 0.3 | GO:0050291 | sphingosine N-acyltransferase activity(GO:0050291) |
0.0 | 0.3 | GO:0015168 | glycerol transmembrane transporter activity(GO:0015168) glycerol channel activity(GO:0015254) |
0.0 | 0.2 | GO:0000104 | succinate dehydrogenase activity(GO:0000104) |
0.0 | 0.1 | GO:0032422 | purine-rich negative regulatory element binding(GO:0032422) |
0.0 | 0.5 | GO:0043176 | amine binding(GO:0043176) |
0.0 | 0.3 | GO:0051428 | peptide hormone receptor binding(GO:0051428) |
0.0 | 0.0 | GO:0015166 | polyol transmembrane transporter activity(GO:0015166) |
0.0 | 0.8 | GO:0005164 | tumor necrosis factor receptor binding(GO:0005164) |
0.0 | 0.2 | GO:0034584 | piRNA binding(GO:0034584) |
0.0 | 0.2 | GO:0032453 | histone demethylase activity (H3-K4 specific)(GO:0032453) |
0.0 | 4.4 | GO:0003714 | transcription corepressor activity(GO:0003714) |
0.0 | 0.1 | GO:0004999 | vasoactive intestinal polypeptide receptor activity(GO:0004999) |
0.0 | 0.0 | GO:0070991 | medium-chain-acyl-CoA dehydrogenase activity(GO:0070991) |
0.0 | 0.2 | GO:0030250 | cyclase activator activity(GO:0010853) guanylate cyclase activator activity(GO:0030250) |
0.0 | 0.2 | GO:0016713 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, reduced iron-sulfur protein as one donor, and incorporation of one atom of oxygen(GO:0016713) |
0.0 | 0.5 | GO:0005031 | tumor necrosis factor-activated receptor activity(GO:0005031) death receptor activity(GO:0005035) |
0.0 | 0.0 | GO:0015111 | iodide transmembrane transporter activity(GO:0015111) |
0.0 | 0.2 | GO:0004582 | dolichyl-phosphate beta-D-mannosyltransferase activity(GO:0004582) |
0.0 | 0.3 | GO:0004534 | 5'-3' exoribonuclease activity(GO:0004534) |
0.0 | 0.1 | GO:0005134 | interleukin-2 receptor binding(GO:0005134) |
0.0 | 0.3 | GO:0001134 | transcription factor activity, transcription factor recruiting(GO:0001134) transcription factor activity, RNA polymerase II transcription factor recruiting(GO:0001135) |
0.0 | 0.2 | GO:0035198 | miRNA binding(GO:0035198) |
0.0 | 0.2 | GO:0016286 | small conductance calcium-activated potassium channel activity(GO:0016286) |
0.0 | 0.5 | GO:0016500 | protein-hormone receptor activity(GO:0016500) |
0.0 | 0.2 | GO:0043515 | kinetochore binding(GO:0043515) |
0.0 | 0.1 | GO:0031749 | D2 dopamine receptor binding(GO:0031749) |
0.0 | 0.2 | GO:0008641 | small protein activating enzyme activity(GO:0008641) |
0.0 | 0.1 | GO:0015562 | efflux transmembrane transporter activity(GO:0015562) |
0.0 | 0.4 | GO:0035035 | histone acetyltransferase binding(GO:0035035) |
0.0 | 0.6 | GO:0031489 | myosin V binding(GO:0031489) |
0.0 | 0.2 | GO:0019784 | NEDD8-specific protease activity(GO:0019784) |
0.0 | 0.2 | GO:0001222 | transcription corepressor binding(GO:0001222) |
0.0 | 0.0 | GO:0036310 | annealing helicase activity(GO:0036310) |
0.0 | 0.9 | GO:0004712 | protein serine/threonine/tyrosine kinase activity(GO:0004712) |
0.0 | 0.6 | GO:0008242 | omega peptidase activity(GO:0008242) |
0.0 | 0.6 | GO:0008157 | protein phosphatase 1 binding(GO:0008157) |
0.0 | 0.2 | GO:0046624 | sphingolipid transporter activity(GO:0046624) |
0.0 | 0.3 | GO:0004970 | ionotropic glutamate receptor activity(GO:0004970) |
0.0 | 0.6 | GO:0017049 | GTP-Rho binding(GO:0017049) |
0.0 | 0.2 | GO:0016886 | ligase activity, forming phosphoric ester bonds(GO:0016886) |
0.0 | 0.2 | GO:0005127 | ciliary neurotrophic factor receptor binding(GO:0005127) |
0.0 | 0.3 | GO:0042287 | MHC protein binding(GO:0042287) |
0.0 | 0.0 | GO:0017099 | very-long-chain-acyl-CoA dehydrogenase activity(GO:0017099) |
0.0 | 0.1 | GO:0032027 | myosin light chain binding(GO:0032027) |
0.0 | 0.1 | GO:0036435 | K48-linked polyubiquitin binding(GO:0036435) |
0.0 | 1.9 | GO:0003724 | RNA helicase activity(GO:0003724) |
0.0 | 0.9 | GO:0017147 | Wnt-protein binding(GO:0017147) |
0.0 | 0.1 | GO:0016909 | JUN kinase activity(GO:0004705) SAP kinase activity(GO:0016909) |
0.0 | 0.4 | GO:0070628 | proteasome binding(GO:0070628) |
0.0 | 0.1 | GO:0047631 | ADP-ribose diphosphatase activity(GO:0047631) |
0.0 | 0.0 | GO:1901611 | phosphatidylglycerol binding(GO:1901611) |
0.0 | 0.8 | GO:0019894 | kinesin binding(GO:0019894) |
0.0 | 0.1 | GO:0036042 | long-chain fatty acyl-CoA binding(GO:0036042) |
0.0 | 3.3 | GO:0061135 | endopeptidase regulator activity(GO:0061135) |
0.0 | 0.0 | GO:0005355 | glucose transmembrane transporter activity(GO:0005355) |
0.0 | 0.1 | GO:0004661 | protein geranylgeranyltransferase activity(GO:0004661) |
0.0 | 4.9 | GO:0005096 | GTPase activator activity(GO:0005096) |
0.0 | 0.0 | GO:0030519 | snoRNP binding(GO:0030519) |
0.0 | 0.1 | GO:1990932 | 5.8S rRNA binding(GO:1990932) |
0.0 | 0.2 | GO:0004176 | ATP-dependent peptidase activity(GO:0004176) |
0.0 | 0.0 | GO:0004367 | glycerol-3-phosphate dehydrogenase [NAD+] activity(GO:0004367) |
0.0 | 0.2 | GO:0035497 | cAMP response element binding(GO:0035497) |
0.0 | 0.1 | GO:0003953 | NAD+ nucleosidase activity(GO:0003953) |
0.0 | 0.2 | GO:0051861 | glycolipid binding(GO:0051861) |
0.0 | 0.1 | GO:0035368 | selenocysteine insertion sequence binding(GO:0035368) |
0.0 | 0.1 | GO:0004813 | alanine-tRNA ligase activity(GO:0004813) |
0.0 | 0.6 | GO:0051287 | NAD binding(GO:0051287) |
0.0 | 0.0 | GO:0004461 | lactose synthase activity(GO:0004461) |
0.0 | 0.1 | GO:0050501 | hyaluronan synthase activity(GO:0050501) |
0.0 | 1.6 | GO:0002020 | protease binding(GO:0002020) |
0.0 | 0.6 | GO:0030145 | manganese ion binding(GO:0030145) |
0.0 | 0.2 | GO:0004622 | lysophospholipase activity(GO:0004622) |
0.0 | 0.4 | GO:0070530 | K63-linked polyubiquitin binding(GO:0070530) |
0.0 | 1.2 | GO:0004812 | aminoacyl-tRNA ligase activity(GO:0004812) |
0.0 | 1.0 | GO:0002039 | p53 binding(GO:0002039) |
0.0 | 5.4 | GO:0008236 | serine-type peptidase activity(GO:0008236) |
0.0 | 0.0 | GO:0019763 | immunoglobulin receptor activity(GO:0019763) |
0.0 | 0.1 | GO:0042609 | CD4 receptor binding(GO:0042609) |
0.0 | 0.1 | GO:0031210 | phosphatidylcholine binding(GO:0031210) |
0.0 | 0.3 | GO:0031593 | polyubiquitin binding(GO:0031593) |
0.0 | 0.2 | GO:0001595 | angiotensin receptor activity(GO:0001595) |
0.0 | 0.1 | GO:0016615 | malate dehydrogenase activity(GO:0016615) |
0.0 | 0.1 | GO:0008526 | phosphatidylinositol transporter activity(GO:0008526) |
0.0 | 0.1 | GO:0034452 | dynactin binding(GO:0034452) |
0.0 | 0.4 | GO:0015491 | cation:cation antiporter activity(GO:0015491) |
0.0 | 4.8 | GO:0004842 | ubiquitin-protein transferase activity(GO:0004842) |
0.0 | 0.1 | GO:0031432 | titin binding(GO:0031432) |
0.0 | 0.1 | GO:0032051 | clathrin light chain binding(GO:0032051) |
0.0 | 0.4 | GO:0004190 | aspartic-type endopeptidase activity(GO:0004190) aspartic-type peptidase activity(GO:0070001) |
0.0 | 0.1 | GO:0030881 | beta-2-microglobulin binding(GO:0030881) |
0.0 | 1.5 | GO:0016881 | acid-amino acid ligase activity(GO:0016881) |
0.0 | 0.2 | GO:0004550 | nucleoside diphosphate kinase activity(GO:0004550) |
0.0 | 0.0 | GO:0015440 | peptide-transporting ATPase activity(GO:0015440) |
0.0 | 0.1 | GO:1990829 | C-rich single-stranded DNA binding(GO:1990829) |
0.0 | 0.8 | GO:0035064 | methylated histone binding(GO:0035064) |
0.0 | 1.2 | GO:0016811 | hydrolase activity, acting on carbon-nitrogen (but not peptide) bonds, in linear amides(GO:0016811) |
0.0 | 0.2 | GO:0048531 | beta-1,3-galactosyltransferase activity(GO:0048531) |
0.0 | 0.1 | GO:0016833 | oxo-acid-lyase activity(GO:0016833) |
0.0 | 0.1 | GO:0004802 | transketolase activity(GO:0004802) |
0.0 | 0.1 | GO:0008417 | fucosyltransferase activity(GO:0008417) |
0.0 | 0.0 | GO:0030351 | inositol-1,3,4,5,6-pentakisphosphate 3-phosphatase activity(GO:0030351) inositol-1,4,5,6-tetrakisphosphate 6-phosphatase activity(GO:0030352) inositol pentakisphosphate phosphatase activity(GO:0052827) |
0.0 | 0.4 | GO:0051537 | 2 iron, 2 sulfur cluster binding(GO:0051537) |
0.0 | 0.2 | GO:0004028 | 3-chloroallyl aldehyde dehydrogenase activity(GO:0004028) |
0.0 | 0.3 | GO:0005243 | gap junction channel activity(GO:0005243) |
0.0 | 0.3 | GO:0044183 | protein binding involved in protein folding(GO:0044183) |
0.0 | 0.2 | GO:0017154 | semaphorin receptor activity(GO:0017154) |
0.0 | 0.4 | GO:0004709 | MAP kinase kinase kinase activity(GO:0004709) |
0.0 | 0.0 | GO:0047238 | glucuronosyl-N-acetylgalactosaminyl-proteoglycan 4-beta-N-acetylgalactosaminyltransferase activity(GO:0047238) |
0.0 | 0.1 | GO:0005250 | A-type (transient outward) potassium channel activity(GO:0005250) |
0.0 | 0.1 | GO:0000339 | RNA cap binding(GO:0000339) |
0.0 | 0.1 | GO:0016941 | natriuretic peptide receptor activity(GO:0016941) |
0.0 | 1.1 | GO:0008527 | taste receptor activity(GO:0008527) |
0.0 | 0.1 | GO:0098847 | sequence-specific single stranded DNA binding(GO:0098847) |
0.0 | 0.0 | GO:0038132 | neuregulin binding(GO:0038132) |
0.0 | 0.1 | GO:0031127 | galactoside 2-alpha-L-fucosyltransferase activity(GO:0008107) alpha-(1,2)-fucosyltransferase activity(GO:0031127) |
0.0 | 0.2 | GO:0032794 | GTPase activating protein binding(GO:0032794) |
0.0 | 0.1 | GO:0005412 | glucose:sodium symporter activity(GO:0005412) |
0.0 | 0.0 | GO:0016634 | oxidoreductase activity, acting on the CH-CH group of donors, oxygen as acceptor(GO:0016634) |
0.0 | 0.2 | GO:0050321 | tau-protein kinase activity(GO:0050321) |
0.0 | 0.1 | GO:0016775 | phosphotransferase activity, nitrogenous group as acceptor(GO:0016775) |
0.0 | 0.5 | GO:0001540 | beta-amyloid binding(GO:0001540) |
0.0 | 0.2 | GO:0031005 | filamin binding(GO:0031005) |
0.0 | 0.3 | GO:0001099 | basal transcription machinery binding(GO:0001098) basal RNA polymerase II transcription machinery binding(GO:0001099) |
0.0 | 0.7 | GO:0005245 | voltage-gated calcium channel activity(GO:0005245) |
0.0 | 1.4 | GO:0003777 | microtubule motor activity(GO:0003777) |
0.0 | 0.2 | GO:0030414 | peptidase inhibitor activity(GO:0030414) |
0.0 | 0.1 | GO:0051920 | peroxiredoxin activity(GO:0051920) |
0.0 | 0.1 | GO:0003906 | DNA-(apurinic or apyrimidinic site) lyase activity(GO:0003906) |
0.0 | 0.1 | GO:0008179 | adenylate cyclase binding(GO:0008179) |
0.0 | 0.1 | GO:1902282 | voltage-gated potassium channel activity involved in ventricular cardiac muscle cell action potential repolarization(GO:1902282) |
0.0 | 0.1 | GO:1990226 | histone methyltransferase binding(GO:1990226) |
0.0 | 0.1 | GO:0001609 | G-protein coupled adenosine receptor activity(GO:0001609) |
0.0 | 0.1 | GO:0008467 | [heparan sulfate]-glucosamine 3-sulfotransferase 1 activity(GO:0008467) |
0.0 | 0.1 | GO:0004449 | isocitrate dehydrogenase (NAD+) activity(GO:0004449) |
0.0 | 0.2 | GO:0034987 | immunoglobulin receptor binding(GO:0034987) |
0.0 | 0.6 | GO:0003755 | peptidyl-prolyl cis-trans isomerase activity(GO:0003755) |
0.0 | 0.0 | GO:0008310 | single-stranded DNA 3'-5' exodeoxyribonuclease activity(GO:0008310) |
0.0 | 0.2 | GO:0070577 | lysine-acetylated histone binding(GO:0070577) |
0.0 | 1.3 | GO:0015293 | symporter activity(GO:0015293) |
0.0 | 0.0 | GO:0015250 | water channel activity(GO:0015250) |
0.0 | 0.1 | GO:0046923 | ER retention sequence binding(GO:0046923) |
0.0 | 0.2 | GO:0035173 | histone kinase activity(GO:0035173) |
0.0 | 0.1 | GO:0015245 | fatty acid transporter activity(GO:0015245) |
0.0 | 0.0 | GO:0016701 | oxidoreductase activity, acting on single donors with incorporation of molecular oxygen(GO:0016701) |
0.0 | 0.0 | GO:0001665 | alpha-N-acetylgalactosaminide alpha-2,6-sialyltransferase activity(GO:0001665) |
0.0 | 1.2 | GO:0004540 | ribonuclease activity(GO:0004540) |
0.0 | 0.2 | GO:0001530 | lipopolysaccharide binding(GO:0001530) |
0.0 | 0.4 | GO:0070003 | threonine-type endopeptidase activity(GO:0004298) threonine-type peptidase activity(GO:0070003) |
0.0 | 0.7 | GO:0016836 | hydro-lyase activity(GO:0016836) |
0.0 | 0.0 | GO:0019870 | potassium channel inhibitor activity(GO:0019870) |
0.0 | 0.5 | GO:0050840 | extracellular matrix binding(GO:0050840) |
0.0 | 0.0 | GO:0030911 | TPR domain binding(GO:0030911) |
0.0 | 0.3 | GO:0030515 | snoRNA binding(GO:0030515) |
0.0 | 0.0 | GO:0008297 | single-stranded DNA exodeoxyribonuclease activity(GO:0008297) |
0.0 | 1.9 | GO:0005550 | pheromone binding(GO:0005550) |
0.0 | 1.5 | GO:0000287 | magnesium ion binding(GO:0000287) |
0.0 | 0.1 | GO:0004435 | phosphatidylinositol phospholipase C activity(GO:0004435) |
0.0 | 0.0 | GO:0070095 | fructose-6-phosphate binding(GO:0070095) |
0.0 | 0.7 | GO:0047485 | protein N-terminus binding(GO:0047485) |
0.0 | 0.4 | GO:0005154 | epidermal growth factor receptor binding(GO:0005154) |
0.0 | 0.1 | GO:0008020 | G-protein coupled photoreceptor activity(GO:0008020) |
0.0 | 0.0 | GO:0042285 | UDP-xylosyltransferase activity(GO:0035252) xylosyltransferase activity(GO:0042285) |
0.0 | 0.7 | GO:0004722 | protein serine/threonine phosphatase activity(GO:0004722) |
0.0 | 0.0 | GO:0008905 | mannose-phosphate guanylyltransferase activity(GO:0008905) |
0.0 | 0.2 | GO:0033549 | MAP kinase phosphatase activity(GO:0033549) |
0.0 | 0.0 | GO:0000009 | alpha-1,6-mannosyltransferase activity(GO:0000009) |
0.0 | 0.9 | GO:0004376 | glycolipid mannosyltransferase activity(GO:0004376) |
0.0 | 0.0 | GO:0043262 | adenosine-diphosphatase activity(GO:0043262) |
0.0 | 0.2 | GO:0015269 | calcium-activated potassium channel activity(GO:0015269) |
0.0 | 0.3 | GO:0051059 | NF-kappaB binding(GO:0051059) |
0.0 | 0.1 | GO:0005111 | type 2 fibroblast growth factor receptor binding(GO:0005111) |
0.0 | 0.2 | GO:0005247 | voltage-gated chloride channel activity(GO:0005247) |
0.0 | 0.1 | GO:0016929 | SUMO-specific protease activity(GO:0016929) |
0.0 | 0.3 | GO:0005109 | frizzled binding(GO:0005109) |
0.0 | 0.1 | GO:0004982 | N-formyl peptide receptor activity(GO:0004982) |
0.0 | 0.1 | GO:0019002 | GMP binding(GO:0019002) |
0.0 | 0.0 | GO:0004694 | eukaryotic translation initiation factor 2alpha kinase activity(GO:0004694) |
0.0 | 0.1 | GO:0001642 | group III metabotropic glutamate receptor activity(GO:0001642) |
0.0 | 0.2 | GO:0048365 | Rac GTPase binding(GO:0048365) |
0.0 | 0.2 | GO:0042923 | neuropeptide binding(GO:0042923) |
0.0 | 0.0 | GO:0038181 | bile acid receptor activity(GO:0038181) |
0.0 | 0.2 | GO:0016538 | cyclin-dependent protein serine/threonine kinase regulator activity(GO:0016538) |
0.0 | 2.7 | GO:0003735 | structural constituent of ribosome(GO:0003735) |
0.0 | 0.2 | GO:0016755 | transferase activity, transferring amino-acyl groups(GO:0016755) |
0.0 | 0.1 | GO:0017070 | U6 snRNA binding(GO:0017070) |
0.0 | 0.0 | GO:0016875 | ligase activity, forming carbon-oxygen bonds(GO:0016875) ligase activity, forming aminoacyl-tRNA and related compounds(GO:0016876) |
0.0 | 0.1 | GO:0015467 | G-protein activated inward rectifier potassium channel activity(GO:0015467) |
0.0 | 0.0 | GO:0000700 | mismatch base pair DNA N-glycosylase activity(GO:0000700) |
0.0 | 0.2 | GO:0000062 | fatty-acyl-CoA binding(GO:0000062) |
0.0 | 4.5 | GO:0005509 | calcium ion binding(GO:0005509) |
0.0 | 0.1 | GO:0001158 | enhancer sequence-specific DNA binding(GO:0001158) |
0.0 | 0.0 | GO:0004332 | fructose-bisphosphate aldolase activity(GO:0004332) |
0.0 | 0.2 | GO:0031369 | translation initiation factor binding(GO:0031369) |
0.0 | 0.1 | GO:0004000 | adenosine deaminase activity(GO:0004000) |
0.0 | 0.0 | GO:0005119 | smoothened binding(GO:0005119) |
0.0 | 0.2 | GO:0004693 | cyclin-dependent protein serine/threonine kinase activity(GO:0004693) cyclin-dependent protein kinase activity(GO:0097472) |
0.0 | 0.0 | GO:0015248 | sterol transporter activity(GO:0015248) |
0.0 | 0.0 | GO:0038191 | neuropilin binding(GO:0038191) |
0.0 | 0.0 | GO:0004849 | uridine kinase activity(GO:0004849) |
0.0 | 0.0 | GO:0034805 | enoyl-[acyl-carrier-protein] reductase activity(GO:0016631) 2,3-dihydroxy-2,3-dihydro-phenylpropionate dehydrogenase activity(GO:0018498) cis-2,3-dihydrodiol DDT dehydrogenase activity(GO:0018499) trans-9R,10R-dihydrodiolphenanthrene dehydrogenase activity(GO:0018500) cis-chlorobenzene dihydrodiol dehydrogenase activity(GO:0018501) 2,5-dichloro-2,5-cyclohexadiene-1,4-diol dehydrogenase activity(GO:0018502) trans-1,2-dihydrodiolphenanthrene dehydrogenase activity(GO:0018503) 3,4-dihydroxy-3,4-dihydrofluorene dehydrogenase activity(GO:0034790) benzo(a)pyrene-trans-11,12-dihydrodiol dehydrogenase activity(GO:0034805) benzo(a)pyrene-cis-4,5-dihydrodiol dehydrogenase activity(GO:0034809) citronellyl-CoA dehydrogenase activity(GO:0034824) menthone dehydrogenase activity(GO:0034838) phthalate 3,4-cis-dihydrodiol dehydrogenase activity(GO:0034912) cinnamate reductase activity(GO:0043786) NADPH-dependent curcumin reductase activity(GO:0052849) NADPH-dependent dihydrocurcumin reductase activity(GO:0052850) |
0.0 | 0.0 | GO:0032135 | DNA insertion or deletion binding(GO:0032135) |
0.0 | 0.4 | GO:0004843 | thiol-dependent ubiquitin-specific protease activity(GO:0004843) |
0.0 | 0.0 | GO:0030274 | LIM domain binding(GO:0030274) |
0.0 | 0.0 | GO:0030306 | ADP-ribosylation factor binding(GO:0030306) |
0.0 | 0.0 | GO:0019956 | chemokine binding(GO:0019956) |
0.0 | 0.0 | GO:0015299 | solute:proton antiporter activity(GO:0015299) |
0.0 | 0.0 | GO:0046978 | TAP binding(GO:0046977) TAP1 binding(GO:0046978) TAP2 binding(GO:0046979) |
0.0 | 0.2 | GO:0008483 | transaminase activity(GO:0008483) |
0.0 | 0.1 | GO:0034481 | chondroitin sulfotransferase activity(GO:0034481) |
0.0 | 0.2 | GO:0005248 | voltage-gated sodium channel activity(GO:0005248) voltage-gated ion channel activity involved in regulation of postsynaptic membrane potential(GO:1905030) |
0.0 | 0.0 | GO:0035662 | Toll-like receptor 4 binding(GO:0035662) |
0.0 | 0.0 | GO:0010997 | anaphase-promoting complex binding(GO:0010997) |
0.0 | 0.1 | GO:0043295 | glutathione binding(GO:0043295) oligopeptide binding(GO:1900750) |
0.0 | 0.0 | GO:0004726 | non-membrane spanning protein tyrosine phosphatase activity(GO:0004726) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.5 | 1.5 | PID P38 ALPHA BETA PATHWAY | Regulation of p38-alpha and p38-beta |
0.4 | 1.1 | ST INTERFERON GAMMA PATHWAY | Interferon gamma pathway. |
0.3 | 0.7 | SA CASPASE CASCADE | Apoptosis is mediated by caspases, cysteine proteases arranged in a proteolytic cascade. |
0.3 | 7.2 | PID INTEGRIN2 PATHWAY | Beta2 integrin cell surface interactions |
0.2 | 1.8 | ST STAT3 PATHWAY | STAT3 Pathway |
0.2 | 1.0 | PID IL1 PATHWAY | IL1-mediated signaling events |
0.2 | 0.6 | PID ANTHRAX PATHWAY | Cellular roles of Anthrax toxin |
0.2 | 0.7 | ST TYPE I INTERFERON PATHWAY | Type I Interferon (alpha/beta IFN) Pathway |
0.2 | 0.2 | ST WNT CA2 CYCLIC GMP PATHWAY | Wnt/Ca2+/cyclic GMP signaling. |
0.2 | 0.2 | ST JAK STAT PATHWAY | Jak-STAT Pathway |
0.2 | 1.0 | PID P38 MK2 PATHWAY | p38 signaling mediated by MAPKAP kinases |
0.2 | 0.2 | PID IL8 CXCR1 PATHWAY | IL8- and CXCR1-mediated signaling events |
0.2 | 0.3 | PID TCR CALCIUM PATHWAY | Calcium signaling in the CD4+ TCR pathway |
0.2 | 3.1 | ST DIFFERENTIATION PATHWAY IN PC12 CELLS | Differentiation Pathway in PC12 Cells; this is a specific case of PAC1 Receptor Pathway. |
0.2 | 0.3 | PID PS1 PATHWAY | Presenilin action in Notch and Wnt signaling |
0.2 | 1.7 | PID IL2 PI3K PATHWAY | IL2 signaling events mediated by PI3K |
0.1 | 4.3 | PID RAS PATHWAY | Regulation of Ras family activation |
0.1 | 1.3 | PID NETRIN PATHWAY | Netrin-mediated signaling events |
0.1 | 1.9 | SA G1 AND S PHASES | Cdk2, 4, and 6 bind cyclin D in G1, while cdk2/cyclin E promotes the G1/S transition. |
0.1 | 1.9 | PID IL23 PATHWAY | IL23-mediated signaling events |
0.1 | 7.6 | PID MYC REPRESS PATHWAY | Validated targets of C-MYC transcriptional repression |
0.1 | 1.3 | PID INTEGRIN A9B1 PATHWAY | Alpha9 beta1 integrin signaling events |
0.1 | 3.4 | PID WNT SIGNALING PATHWAY | Wnt signaling network |
0.1 | 2.3 | PID HEDGEHOG 2PATHWAY | Signaling events mediated by the Hedgehog family |
0.1 | 2.2 | PID ERBB1 INTERNALIZATION PATHWAY | Internalization of ErbB1 |
0.1 | 1.0 | PID EPHRINB REV PATHWAY | Ephrin B reverse signaling |
0.1 | 0.4 | PID A6B1 A6B4 INTEGRIN PATHWAY | a6b1 and a6b4 Integrin signaling |
0.1 | 0.5 | PID S1P S1P1 PATHWAY | S1P1 pathway |
0.1 | 24.5 | NABA ECM REGULATORS | Genes encoding enzymes and their regulators involved in the remodeling of the extracellular matrix |
0.1 | 0.1 | PID BETA CATENIN DEG PATHWAY | Degradation of beta catenin |
0.1 | 3.9 | PID RAC1 REG PATHWAY | Regulation of RAC1 activity |
0.1 | 3.2 | ST TUMOR NECROSIS FACTOR PATHWAY | Tumor Necrosis Factor Pathway. |
0.1 | 0.5 | SIG PIP3 SIGNALING IN CARDIAC MYOCTES | Genes related to PIP3 signaling in cardiac myocytes |
0.1 | 1.1 | PID TCR JNK PATHWAY | JNK signaling in the CD4+ TCR pathway |
0.1 | 1.1 | SA PROGRAMMED CELL DEATH | Programmed cell death, or apoptosis, eliminates damaged or unneeded cells. |
0.1 | 1.1 | PID S1P S1P4 PATHWAY | S1P4 pathway |
0.1 | 2.4 | PID RHODOPSIN PATHWAY | Visual signal transduction: Rods |
0.1 | 3.0 | PID AJDISS 2PATHWAY | Posttranslational regulation of adherens junction stability and dissassembly |
0.1 | 2.6 | PID IL12 STAT4 PATHWAY | IL12 signaling mediated by STAT4 |
0.1 | 3.5 | PID HNF3B PATHWAY | FOXA2 and FOXA3 transcription factor networks |
0.1 | 2.2 | PID AMB2 NEUTROPHILS PATHWAY | amb2 Integrin signaling |
0.1 | 3.5 | PID FOXO PATHWAY | FoxO family signaling |
0.1 | 0.6 | PID NFAT TFPATHWAY | Calcineurin-regulated NFAT-dependent transcription in lymphocytes |
0.1 | 0.2 | PID FAS PATHWAY | FAS (CD95) signaling pathway |
0.1 | 1.8 | SIG INSULIN RECEPTOR PATHWAY IN CARDIAC MYOCYTES | Genes related to the insulin receptor pathway |
0.1 | 0.9 | PID NFAT 3PATHWAY | Role of Calcineurin-dependent NFAT signaling in lymphocytes |
0.1 | 0.1 | PID LYMPH ANGIOGENESIS PATHWAY | VEGFR3 signaling in lymphatic endothelium |
0.1 | 0.8 | PID WNT NONCANONICAL PATHWAY | Noncanonical Wnt signaling pathway |
0.1 | 2.6 | PID INTEGRIN3 PATHWAY | Beta3 integrin cell surface interactions |
0.1 | 1.4 | PID KIT PATHWAY | Signaling events mediated by Stem cell factor receptor (c-Kit) |
0.1 | 1.6 | ST WNT BETA CATENIN PATHWAY | Wnt/beta-catenin Pathway |
0.1 | 0.9 | PID HIV NEF PATHWAY | HIV-1 Nef: Negative effector of Fas and TNF-alpha |
0.1 | 0.8 | PID RETINOIC ACID PATHWAY | Retinoic acid receptors-mediated signaling |
0.1 | 0.5 | SA G2 AND M PHASES | Cdc25 activates the cdc2/cyclin B complex to induce the G2/M transition. |
0.1 | 0.4 | PID AVB3 OPN PATHWAY | Osteopontin-mediated events |
0.1 | 0.3 | PID PTP1B PATHWAY | Signaling events mediated by PTP1B |
0.1 | 0.7 | PID IL3 PATHWAY | IL3-mediated signaling events |
0.1 | 0.5 | PID HIF1A PATHWAY | Hypoxic and oxygen homeostasis regulation of HIF-1-alpha |
0.1 | 0.1 | PID TRAIL PATHWAY | TRAIL signaling pathway |
0.1 | 1.0 | ST INTERLEUKIN 4 PATHWAY | Interleukin 4 (IL-4) Pathway |
0.1 | 1.4 | PID IL4 2PATHWAY | IL4-mediated signaling events |
0.1 | 0.4 | PID INTEGRIN CS PATHWAY | Integrin family cell surface interactions |
0.1 | 9.4 | NABA ECM AFFILIATED | Genes encoding proteins affiliated structurally or functionally to extracellular matrix proteins |
0.1 | 0.3 | PID HDAC CLASSII PATHWAY | Signaling events mediated by HDAC Class II |
0.1 | 0.3 | PID ENDOTHELIN PATHWAY | Endothelins |
0.1 | 0.1 | PID IGF1 PATHWAY | IGF1 pathway |
0.1 | 0.9 | ST T CELL SIGNAL TRANSDUCTION | T Cell Signal Transduction |
0.1 | 3.6 | ST INTEGRIN SIGNALING PATHWAY | Integrin Signaling Pathway |
0.1 | 2.4 | NABA COLLAGENS | Genes encoding collagen proteins |
0.1 | 2.6 | PID ERBB1 DOWNSTREAM PATHWAY | ErbB1 downstream signaling |
0.1 | 0.9 | PID TCR PATHWAY | TCR signaling in naïve CD4+ T cells |
0.1 | 0.5 | PID PDGFRA PATHWAY | PDGFR-alpha signaling pathway |
0.1 | 2.0 | PID HIF1 TFPATHWAY | HIF-1-alpha transcription factor network |
0.1 | 1.2 | PID MET PATHWAY | Signaling events mediated by Hepatocyte Growth Factor Receptor (c-Met) |
0.1 | 0.3 | PID P38 MKK3 6PATHWAY | p38 MAPK signaling pathway |
0.1 | 0.9 | PID IL12 2PATHWAY | IL12-mediated signaling events |
0.1 | 1.9 | PID P75 NTR PATHWAY | p75(NTR)-mediated signaling |
0.1 | 0.3 | SA REG CASCADE OF CYCLIN EXPR | Expression of cyclins regulates progression through the cell cycle by activating cyclin-dependent kinases. |
0.1 | 0.5 | PID P38 ALPHA BETA DOWNSTREAM PATHWAY | Signaling mediated by p38-alpha and p38-beta |
0.1 | 5.2 | PID P53 DOWNSTREAM PATHWAY | Direct p53 effectors |
0.1 | 1.0 | PID P53 REGULATION PATHWAY | p53 pathway |
0.1 | 0.4 | PID WNT CANONICAL PATHWAY | Canonical Wnt signaling pathway |
0.1 | 0.7 | PID FCER1 PATHWAY | Fc-epsilon receptor I signaling in mast cells |
0.1 | 0.6 | PID RAC1 PATHWAY | RAC1 signaling pathway |
0.1 | 2.9 | PID CMYB PATHWAY | C-MYB transcription factor network |
0.1 | 0.5 | PID CONE PATHWAY | Visual signal transduction: Cones |
0.1 | 1.4 | PID ERBB4 PATHWAY | ErbB4 signaling events |
0.1 | 0.4 | PID UPA UPAR PATHWAY | Urokinase-type plasminogen activator (uPA) and uPAR-mediated signaling |
0.1 | 1.8 | NABA PROTEOGLYCANS | Genes encoding proteoglycans |
0.1 | 0.1 | PID ECADHERIN NASCENT AJ PATHWAY | E-cadherin signaling in the nascent adherens junction |
0.1 | 0.1 | ST G ALPHA S PATHWAY | G alpha s Pathway |
0.1 | 1.0 | PID LKB1 PATHWAY | LKB1 signaling events |
0.1 | 0.1 | PID IFNG PATHWAY | IFN-gamma pathway |
0.0 | 0.3 | SIG CD40PATHWAYMAP | Genes related to CD40 signaling |
0.0 | 0.9 | PID NOTCH PATHWAY | Notch signaling pathway |
0.0 | 0.2 | ST GRANULE CELL SURVIVAL PATHWAY | Granule Cell Survival Pathway is a specific case of more general PAC1 Receptor Pathway. |
0.0 | 0.7 | SIG REGULATION OF THE ACTIN CYTOSKELETON BY RHO GTPASES | Genes related to regulation of the actin cytoskeleton |
0.0 | 0.5 | PID PI3KCI PATHWAY | Class I PI3K signaling events |
0.0 | 0.1 | PID PI3KCI AKT PATHWAY | Class I PI3K signaling events mediated by Akt |
0.0 | 0.4 | PID REELIN PATHWAY | Reelin signaling pathway |
0.0 | 1.2 | PID ATR PATHWAY | ATR signaling pathway |
0.0 | 0.3 | PID MYC PATHWAY | C-MYC pathway |
0.0 | 0.1 | PID NFKAPPAB CANONICAL PATHWAY | Canonical NF-kappaB pathway |
0.0 | 0.4 | PID NCADHERIN PATHWAY | N-cadherin signaling events |
0.0 | 0.1 | PID EPHB FWD PATHWAY | EPHB forward signaling |
0.0 | 0.6 | PID ARF6 TRAFFICKING PATHWAY | Arf6 trafficking events |
0.0 | 0.4 | PID PDGFRB PATHWAY | PDGFR-beta signaling pathway |
0.0 | 0.1 | ST GAQ PATHWAY | G alpha q Pathway |
0.0 | 0.1 | PID IL2 STAT5 PATHWAY | IL2 signaling events mediated by STAT5 |
0.0 | 0.9 | PID HES HEY PATHWAY | Notch-mediated HES/HEY network |
0.0 | 0.0 | PID SMAD2 3PATHWAY | Regulation of cytoplasmic and nuclear SMAD2/3 signaling |
0.0 | 0.1 | PID S1P S1P2 PATHWAY | S1P2 pathway |
0.0 | 0.2 | PID TXA2PATHWAY | Thromboxane A2 receptor signaling |
0.0 | 0.7 | PID PLK1 PATHWAY | PLK1 signaling events |
0.0 | 0.9 | PID HDAC CLASSI PATHWAY | Signaling events mediated by HDAC Class I |
0.0 | 0.0 | PID P38 GAMMA DELTA PATHWAY | Signaling mediated by p38-gamma and p38-delta |
0.0 | 3.5 | NABA CORE MATRISOME | Ensemble of genes encoding core extracellular matrix including ECM glycoproteins, collagens and proteoglycans |
0.0 | 0.5 | PID TGFBR PATHWAY | TGF-beta receptor signaling |
0.0 | 0.1 | PID NFKAPPAB ATYPICAL PATHWAY | Atypical NF-kappaB pathway |
0.0 | 0.4 | PID AR TF PATHWAY | Regulation of Androgen receptor activity |
0.0 | 0.2 | PID IL6 7 PATHWAY | IL6-mediated signaling events |
0.0 | 0.0 | ST B CELL ANTIGEN RECEPTOR | B Cell Antigen Receptor |
0.0 | 0.0 | PID CD8 TCR PATHWAY | TCR signaling in naïve CD8+ T cells |
0.0 | 0.4 | PID BMP PATHWAY | BMP receptor signaling |
0.0 | 0.1 | ST PHOSPHOINOSITIDE 3 KINASE PATHWAY | PI3K Pathway |
0.0 | 0.2 | PID AP1 PATHWAY | AP-1 transcription factor network |
0.0 | 0.0 | PID SYNDECAN 3 PATHWAY | Syndecan-3-mediated signaling events |
0.0 | 0.3 | PID DELTA NP63 PATHWAY | Validated transcriptional targets of deltaNp63 isoforms |
0.0 | 0.2 | PID ATM PATHWAY | ATM pathway |
0.0 | 0.0 | PID TCR RAS PATHWAY | Ras signaling in the CD4+ TCR pathway |
0.0 | 0.0 | PID SHP2 PATHWAY | SHP2 signaling |
0.0 | 0.3 | PID FANCONI PATHWAY | Fanconi anemia pathway |
0.0 | 0.0 | PID GLYPICAN 1PATHWAY | Glypican 1 network |
0.0 | 0.0 | PID ALK2 PATHWAY | ALK2 signaling events |
0.0 | 0.1 | SA MMP CYTOKINE CONNECTION | Cytokines can induce activation of matrix metalloproteinases, which degrade extracellular matrix. |
0.0 | 0.0 | PID INTEGRIN5 PATHWAY | Beta5 beta6 beta7 and beta8 integrin cell surface interactions |
0.0 | 0.1 | PID THROMBIN PAR4 PATHWAY | PAR4-mediated thrombin signaling events |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.7 | 0.7 | REACTOME THROMBIN SIGNALLING THROUGH PROTEINASE ACTIVATED RECEPTORS PARS | Genes involved in Thrombin signalling through proteinase activated receptors (PARs) |
0.6 | 3.0 | REACTOME BETA DEFENSINS | Genes involved in Beta defensins |
0.5 | 5.9 | REACTOME COMMON PATHWAY | Genes involved in Common Pathway |
0.4 | 0.4 | REACTOME APC CDC20 MEDIATED DEGRADATION OF NEK2A | Genes involved in APC-Cdc20 mediated degradation of Nek2A |
0.3 | 2.4 | REACTOME NEGATIVE REGULATION OF THE PI3K AKT NETWORK | Genes involved in Negative regulation of the PI3K/AKT network |
0.3 | 1.4 | REACTOME BINDING AND ENTRY OF HIV VIRION | Genes involved in Binding and entry of HIV virion |
0.3 | 4.8 | REACTOME INTRINSIC PATHWAY | Genes involved in Intrinsic Pathway |
0.3 | 0.6 | REACTOME NGF SIGNALLING VIA TRKA FROM THE PLASMA MEMBRANE | Genes involved in NGF signalling via TRKA from the plasma membrane |
0.3 | 4.1 | REACTOME N GLYCAN ANTENNAE ELONGATION | Genes involved in N-Glycan antennae elongation |
0.3 | 2.4 | REACTOME REGULATION OF COMPLEMENT CASCADE | Genes involved in Regulation of Complement cascade |
0.3 | 0.3 | REACTOME GLUCAGON SIGNALING IN METABOLIC REGULATION | Genes involved in Glucagon signaling in metabolic regulation |
0.3 | 3.0 | REACTOME ORGANIC CATION ANION ZWITTERION TRANSPORT | Genes involved in Organic cation/anion/zwitterion transport |
0.2 | 3.2 | REACTOME REGULATION OF INSULIN LIKE GROWTH FACTOR IGF ACTIVITY BY INSULIN LIKE GROWTH FACTOR BINDING PROTEINS IGFBPS | Genes involved in Regulation of Insulin-like Growth Factor (IGF) Activity by Insulin-like Growth Factor Binding Proteins (IGFBPs) |
0.2 | 3.6 | REACTOME PRE NOTCH PROCESSING IN GOLGI | Genes involved in Pre-NOTCH Processing in Golgi |
0.2 | 1.2 | REACTOME IRAK1 RECRUITS IKK COMPLEX | Genes involved in IRAK1 recruits IKK complex |
0.2 | 2.1 | REACTOME AKT PHOSPHORYLATES TARGETS IN THE CYTOSOL | Genes involved in AKT phosphorylates targets in the cytosol |
0.2 | 4.9 | REACTOME BASIGIN INTERACTIONS | Genes involved in Basigin interactions |
0.2 | 2.2 | REACTOME THE NLRP3 INFLAMMASOME | Genes involved in The NLRP3 inflammasome |
0.2 | 0.9 | REACTOME SIGNALING BY EGFR IN CANCER | Genes involved in Signaling by EGFR in Cancer |
0.2 | 5.9 | REACTOME STEROID HORMONES | Genes involved in Steroid hormones |
0.2 | 2.8 | REACTOME ACTIVATION OF BH3 ONLY PROTEINS | Genes involved in Activation of BH3-only proteins |
0.2 | 4.4 | REACTOME GROWTH HORMONE RECEPTOR SIGNALING | Genes involved in Growth hormone receptor signaling |
0.2 | 0.4 | REACTOME REGULATION OF INSULIN SECRETION BY GLUCAGON LIKE PEPTIDE1 | Genes involved in Regulation of Insulin Secretion by Glucagon-like Peptide-1 |
0.2 | 0.2 | REACTOME DESTABILIZATION OF MRNA BY BRF1 | Genes involved in Destabilization of mRNA by Butyrate Response Factor 1 (BRF1) |
0.2 | 0.2 | REACTOME CTLA4 INHIBITORY SIGNALING | Genes involved in CTLA4 inhibitory signaling |
0.2 | 0.2 | REACTOME GRB2 SOS PROVIDES LINKAGE TO MAPK SIGNALING FOR INTERGRINS | Genes involved in GRB2:SOS provides linkage to MAPK signaling for Intergrins |
0.2 | 1.8 | REACTOME TRAF6 MEDIATED IRF7 ACTIVATION IN TLR7 8 OR 9 SIGNALING | Genes involved in TRAF6 mediated IRF7 activation in TLR7/8 or 9 signaling |
0.2 | 3.5 | REACTOME INHIBITION OF THE PROTEOLYTIC ACTIVITY OF APC C REQUIRED FOR THE ONSET OF ANAPHASE BY MITOTIC SPINDLE CHECKPOINT COMPONENTS | Genes involved in Inhibition of the proteolytic activity of APC/C required for the onset of anaphase by mitotic spindle checkpoint components |
0.2 | 2.3 | REACTOME ACTIVATION OF IRF3 IRF7 MEDIATED BY TBK1 IKK EPSILON | Genes involved in Activation of IRF3/IRF7 mediated by TBK1/IKK epsilon |
0.2 | 1.3 | REACTOME CREATION OF C4 AND C2 ACTIVATORS | Genes involved in Creation of C4 and C2 activators |
0.2 | 0.2 | REACTOME PROLONGED ERK ACTIVATION EVENTS | Genes involved in Prolonged ERK activation events |
0.2 | 3.7 | REACTOME KERATAN SULFATE KERATIN METABOLISM | Genes involved in Keratan sulfate/keratin metabolism |
0.2 | 3.2 | REACTOME ACTIVATED AMPK STIMULATES FATTY ACID OXIDATION IN MUSCLE | Genes involved in Activated AMPK stimulates fatty-acid oxidation in muscle |
0.2 | 1.7 | REACTOME PASSIVE TRANSPORT BY AQUAPORINS | Genes involved in Passive Transport by Aquaporins |
0.2 | 1.4 | REACTOME TRANSPORT OF ORGANIC ANIONS | Genes involved in Transport of organic anions |
0.2 | 3.9 | REACTOME EFFECTS OF PIP2 HYDROLYSIS | Genes involved in Effects of PIP2 hydrolysis |
0.2 | 0.5 | REACTOME ACYL CHAIN REMODELLING OF PG | Genes involved in Acyl chain remodelling of PG |
0.2 | 1.1 | REACTOME SIGNAL REGULATORY PROTEIN SIRP FAMILY INTERACTIONS | Genes involved in Signal regulatory protein (SIRP) family interactions |
0.2 | 3.5 | REACTOME LIPOPROTEIN METABOLISM | Genes involved in Lipoprotein metabolism |
0.1 | 1.5 | REACTOME P130CAS LINKAGE TO MAPK SIGNALING FOR INTEGRINS | Genes involved in p130Cas linkage to MAPK signaling for integrins |
0.1 | 3.1 | REACTOME NEGATIVE REGULATORS OF RIG I MDA5 SIGNALING | Genes involved in Negative regulators of RIG-I/MDA5 signaling |
0.1 | 1.3 | REACTOME ROLE OF DCC IN REGULATING APOPTOSIS | Genes involved in Role of DCC in regulating apoptosis |
0.1 | 1.4 | REACTOME CS DS DEGRADATION | Genes involved in CS/DS degradation |
0.1 | 1.6 | REACTOME TETRAHYDROBIOPTERIN BH4 SYNTHESIS RECYCLING SALVAGE AND REGULATION | Genes involved in Tetrahydrobiopterin (BH4) synthesis, recycling, salvage and regulation |
0.1 | 2.4 | REACTOME SIGNALING BY NODAL | Genes involved in Signaling by NODAL |
0.1 | 4.0 | REACTOME MEIOTIC SYNAPSIS | Genes involved in Meiotic Synapsis |
0.1 | 0.1 | REACTOME REGULATION OF AMPK ACTIVITY VIA LKB1 | Genes involved in Regulation of AMPK activity via LKB1 |
0.1 | 0.6 | REACTOME RNA POL I PROMOTER OPENING | Genes involved in RNA Polymerase I Promoter Opening |
0.1 | 2.6 | REACTOME PEROXISOMAL LIPID METABOLISM | Genes involved in Peroxisomal lipid metabolism |
0.1 | 2.5 | REACTOME RNA POL III TRANSCRIPTION TERMINATION | Genes involved in RNA Polymerase III Transcription Termination |
0.1 | 1.2 | REACTOME APOPTOTIC CLEAVAGE OF CELL ADHESION PROTEINS | Genes involved in Apoptotic cleavage of cell adhesion proteins |
0.1 | 2.6 | REACTOME ACYL CHAIN REMODELLING OF PE | Genes involved in Acyl chain remodelling of PE |
0.1 | 2.0 | REACTOME DESTABILIZATION OF MRNA BY TRISTETRAPROLIN TTP | Genes involved in Destabilization of mRNA by Tristetraprolin (TTP) |
0.1 | 0.3 | REACTOME GAP JUNCTION DEGRADATION | Genes involved in Gap junction degradation |
0.1 | 0.1 | REACTOME ORC1 REMOVAL FROM CHROMATIN | Genes involved in Orc1 removal from chromatin |
0.1 | 0.8 | REACTOME HYALURONAN UPTAKE AND DEGRADATION | Genes involved in Hyaluronan uptake and degradation |
0.1 | 0.6 | REACTOME IRAK2 MEDIATED ACTIVATION OF TAK1 COMPLEX UPON TLR7 8 OR 9 STIMULATION | Genes involved in IRAK2 mediated activation of TAK1 complex upon TLR7/8 or 9 stimulation |
0.1 | 5.3 | REACTOME METABOLISM OF VITAMINS AND COFACTORS | Genes involved in Metabolism of vitamins and cofactors |
0.1 | 0.3 | REACTOME CYCLIN E ASSOCIATED EVENTS DURING G1 S TRANSITION | Genes involved in Cyclin E associated events during G1/S transition |
0.1 | 0.1 | REACTOME INITIAL TRIGGERING OF COMPLEMENT | Genes involved in Initial triggering of complement |
0.1 | 0.1 | REACTOME SIGNALING BY FGFR | Genes involved in Signaling by FGFR |
0.1 | 2.6 | REACTOME SULFUR AMINO ACID METABOLISM | Genes involved in Sulfur amino acid metabolism |
0.1 | 1.9 | REACTOME SYNTHESIS AND INTERCONVERSION OF NUCLEOTIDE DI AND TRIPHOSPHATES | Genes involved in Synthesis and interconversion of nucleotide di- and triphosphates |
0.1 | 2.2 | REACTOME SMOOTH MUSCLE CONTRACTION | Genes involved in Smooth Muscle Contraction |
0.1 | 1.3 | REACTOME SEMA3A PLEXIN REPULSION SIGNALING BY INHIBITING INTEGRIN ADHESION | Genes involved in SEMA3A-Plexin repulsion signaling by inhibiting Integrin adhesion |
0.1 | 0.9 | REACTOME FACILITATIVE NA INDEPENDENT GLUCOSE TRANSPORTERS | Genes involved in Facilitative Na+-independent glucose transporters |
0.1 | 0.3 | REACTOME INFLAMMASOMES | Genes involved in Inflammasomes |
0.1 | 2.3 | REACTOME AMINO ACID TRANSPORT ACROSS THE PLASMA MEMBRANE | Genes involved in Amino acid transport across the plasma membrane |
0.1 | 0.1 | REACTOME INTEGRIN ALPHAIIB BETA3 SIGNALING | Genes involved in Integrin alphaIIb beta3 signaling |
0.1 | 0.3 | REACTOME SIGNALING BY SCF KIT | Genes involved in Signaling by SCF-KIT |
0.1 | 1.5 | REACTOME ZINC TRANSPORTERS | Genes involved in Zinc transporters |
0.1 | 0.2 | REACTOME APC C CDC20 MEDIATED DEGRADATION OF CYCLIN B | Genes involved in APC/C:Cdc20 mediated degradation of Cyclin B |
0.1 | 0.5 | REACTOME TRAF6 MEDIATED NFKB ACTIVATION | Genes involved in TRAF6 mediated NF-kB activation |
0.1 | 1.0 | REACTOME PURINE CATABOLISM | Genes involved in Purine catabolism |
0.1 | 0.1 | REACTOME CONVERSION FROM APC C CDC20 TO APC C CDH1 IN LATE ANAPHASE | Genes involved in Conversion from APC/C:Cdc20 to APC/C:Cdh1 in late anaphase |
0.1 | 0.1 | REACTOME ENDOSOMAL VACUOLAR PATHWAY | Genes involved in Endosomal/Vacuolar pathway |
0.1 | 0.9 | REACTOME TRAFFICKING OF GLUR2 CONTAINING AMPA RECEPTORS | Genes involved in Trafficking of GluR2-containing AMPA receptors |
0.1 | 0.2 | REACTOME LYSOSOME VESICLE BIOGENESIS | Genes involved in Lysosome Vesicle Biogenesis |
0.1 | 2.0 | REACTOME CIRCADIAN REPRESSION OF EXPRESSION BY REV ERBA | Genes involved in Circadian Repression of Expression by REV-ERBA |
0.1 | 0.3 | REACTOME TRAF6 MEDIATED IRF7 ACTIVATION | Genes involved in TRAF6 mediated IRF7 activation |
0.1 | 1.8 | REACTOME FORMATION OF INCISION COMPLEX IN GG NER | Genes involved in Formation of incision complex in GG-NER |
0.1 | 2.0 | REACTOME THE ROLE OF NEF IN HIV1 REPLICATION AND DISEASE PATHOGENESIS | Genes involved in The role of Nef in HIV-1 replication and disease pathogenesis |
0.1 | 1.3 | REACTOME SYNTHESIS OF PIPS AT THE GOLGI MEMBRANE | Genes involved in Synthesis of PIPs at the Golgi membrane |
0.1 | 0.6 | REACTOME TIE2 SIGNALING | Genes involved in Tie2 Signaling |
0.1 | 0.4 | REACTOME REGULATION OF ORNITHINE DECARBOXYLASE ODC | Genes involved in Regulation of ornithine decarboxylase (ODC) |
0.1 | 0.8 | REACTOME VIRAL MESSENGER RNA SYNTHESIS | Genes involved in Viral Messenger RNA Synthesis |
0.1 | 0.6 | REACTOME INTEGRATION OF PROVIRUS | Genes involved in Integration of provirus |
0.1 | 0.2 | REACTOME MRNA CAPPING | Genes involved in mRNA Capping |
0.1 | 5.1 | REACTOME TRANSPORT OF INORGANIC CATIONS ANIONS AND AMINO ACIDS OLIGOPEPTIDES | Genes involved in Transport of inorganic cations/anions and amino acids/oligopeptides |
0.1 | 0.4 | REACTOME NFKB IS ACTIVATED AND SIGNALS SURVIVAL | Genes involved in NF-kB is activated and signals survival |
0.1 | 0.2 | REACTOME YAP1 AND WWTR1 TAZ STIMULATED GENE EXPRESSION | Genes involved in YAP1- and WWTR1 (TAZ)-stimulated gene expression |
0.1 | 1.6 | REACTOME FORMATION OF TUBULIN FOLDING INTERMEDIATES BY CCT TRIC | Genes involved in Formation of tubulin folding intermediates by CCT/TriC |
0.1 | 0.5 | REACTOME DOWNREGULATION OF ERBB2 ERBB3 SIGNALING | Genes involved in Downregulation of ERBB2:ERBB3 signaling |
0.1 | 0.2 | REACTOME EARLY PHASE OF HIV LIFE CYCLE | Genes involved in Early Phase of HIV Life Cycle |
0.1 | 0.2 | REACTOME CD28 DEPENDENT VAV1 PATHWAY | Genes involved in CD28 dependent Vav1 pathway |
0.1 | 1.3 | REACTOME SIGNALING BY HIPPO | Genes involved in Signaling by Hippo |
0.1 | 0.1 | REACTOME IKK COMPLEX RECRUITMENT MEDIATED BY RIP1 | Genes involved in IKK complex recruitment mediated by RIP1 |
0.1 | 0.4 | REACTOME RNA POL I TRANSCRIPTION TERMINATION | Genes involved in RNA Polymerase I Transcription Termination |
0.1 | 0.6 | REACTOME PRE NOTCH EXPRESSION AND PROCESSING | Genes involved in Pre-NOTCH Expression and Processing |
0.1 | 3.3 | REACTOME INTERFERON ALPHA BETA SIGNALING | Genes involved in Interferon alpha/beta signaling |
0.1 | 0.7 | REACTOME HORMONE SENSITIVE LIPASE HSL MEDIATED TRIACYLGLYCEROL HYDROLYSIS | Genes involved in Hormone-sensitive lipase (HSL)-mediated triacylglycerol hydrolysis |
0.1 | 0.8 | REACTOME TANDEM PORE DOMAIN POTASSIUM CHANNELS | Genes involved in Tandem pore domain potassium channels |
0.1 | 0.7 | REACTOME SLBP DEPENDENT PROCESSING OF REPLICATION DEPENDENT HISTONE PRE MRNAS | Genes involved in SLBP Dependent Processing of Replication-Dependent Histone Pre-mRNAs |
0.1 | 0.8 | REACTOME FORMATION OF ATP BY CHEMIOSMOTIC COUPLING | Genes involved in Formation of ATP by chemiosmotic coupling |
0.1 | 0.9 | REACTOME AMYLOIDS | Genes involved in Amyloids |
0.1 | 3.3 | REACTOME RESPONSE TO ELEVATED PLATELET CYTOSOLIC CA2 | Genes involved in Response to elevated platelet cytosolic Ca2+ |
0.1 | 0.9 | REACTOME PROTEOLYTIC CLEAVAGE OF SNARE COMPLEX PROTEINS | Genes involved in Proteolytic cleavage of SNARE complex proteins |
0.1 | 0.2 | REACTOME UNWINDING OF DNA | Genes involved in Unwinding of DNA |
0.1 | 2.6 | REACTOME GOLGI ASSOCIATED VESICLE BIOGENESIS | Genes involved in Golgi Associated Vesicle Biogenesis |
0.1 | 0.3 | REACTOME SYNTHESIS OF PIPS AT THE LATE ENDOSOME MEMBRANE | Genes involved in Synthesis of PIPs at the late endosome membrane |
0.1 | 0.1 | REACTOME RIP MEDIATED NFKB ACTIVATION VIA DAI | Genes involved in RIP-mediated NFkB activation via DAI |
0.1 | 0.3 | REACTOME DIGESTION OF DIETARY CARBOHYDRATE | Genes involved in Digestion of dietary carbohydrate |
0.1 | 0.1 | REACTOME NOREPINEPHRINE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Norepinephrine Neurotransmitter Release Cycle |
0.1 | 1.2 | REACTOME BRANCHED CHAIN AMINO ACID CATABOLISM | Genes involved in Branched-chain amino acid catabolism |
0.1 | 0.5 | REACTOME OPSINS | Genes involved in Opsins |
0.1 | 0.9 | REACTOME SYNTHESIS SECRETION AND DEACYLATION OF GHRELIN | Genes involved in Synthesis, Secretion, and Deacylation of Ghrelin |
0.1 | 0.8 | REACTOME AMINE DERIVED HORMONES | Genes involved in Amine-derived hormones |
0.1 | 0.5 | REACTOME APOPTOSIS INDUCED DNA FRAGMENTATION | Genes involved in Apoptosis induced DNA fragmentation |
0.1 | 0.9 | REACTOME HS GAG DEGRADATION | Genes involved in HS-GAG degradation |
0.1 | 0.5 | REACTOME PEPTIDE HORMONE BIOSYNTHESIS | Genes involved in Peptide hormone biosynthesis |
0.1 | 3.3 | REACTOME COLLAGEN FORMATION | Genes involved in Collagen formation |
0.1 | 0.5 | REACTOME JNK C JUN KINASES PHOSPHORYLATION AND ACTIVATION MEDIATED BY ACTIVATED HUMAN TAK1 | Genes involved in JNK (c-Jun kinases) phosphorylation and activation mediated by activated human TAK1 |
0.1 | 0.2 | REACTOME RNA POL I TRANSCRIPTION INITIATION | Genes involved in RNA Polymerase I Transcription Initiation |
0.1 | 0.8 | REACTOME SYNTHESIS OF PA | Genes involved in Synthesis of PA |
0.1 | 1.5 | REACTOME MAPK TARGETS NUCLEAR EVENTS MEDIATED BY MAP KINASES | Genes involved in MAPK targets/ Nuclear events mediated by MAP kinases |
0.1 | 0.8 | REACTOME ABCA TRANSPORTERS IN LIPID HOMEOSTASIS | Genes involved in ABCA transporters in lipid homeostasis |
0.1 | 0.5 | REACTOME HOMOLOGOUS RECOMBINATION REPAIR OF REPLICATION INDEPENDENT DOUBLE STRAND BREAKS | Genes involved in Homologous recombination repair of replication-independent double-strand breaks |
0.1 | 0.4 | REACTOME OXYGEN DEPENDENT PROLINE HYDROXYLATION OF HYPOXIA INDUCIBLE FACTOR ALPHA | Genes involved in Oxygen-dependent Proline Hydroxylation of Hypoxia-inducible Factor Alpha |
0.1 | 0.4 | REACTOME RECYCLING OF BILE ACIDS AND SALTS | Genes involved in Recycling of bile acids and salts |
0.1 | 0.5 | REACTOME CASPASE MEDIATED CLEAVAGE OF CYTOSKELETAL PROTEINS | Genes involved in Caspase-mediated cleavage of cytoskeletal proteins |
0.1 | 1.1 | REACTOME G0 AND EARLY G1 | Genes involved in G0 and Early G1 |
0.1 | 0.1 | REACTOME FORMATION OF FIBRIN CLOT CLOTTING CASCADE | Genes involved in Formation of Fibrin Clot (Clotting Cascade) |
0.1 | 0.2 | REACTOME TGF BETA RECEPTOR SIGNALING IN EMT EPITHELIAL TO MESENCHYMAL TRANSITION | Genes involved in TGF-beta receptor signaling in EMT (epithelial to mesenchymal transition) |
0.1 | 0.7 | REACTOME RESOLUTION OF AP SITES VIA THE SINGLE NUCLEOTIDE REPLACEMENT PATHWAY | Genes involved in Resolution of AP sites via the single-nucleotide replacement pathway |
0.1 | 0.2 | REACTOME ANTIGEN PRESENTATION FOLDING ASSEMBLY AND PEPTIDE LOADING OF CLASS I MHC | Genes involved in Antigen Presentation: Folding, assembly and peptide loading of class I MHC |
0.1 | 1.9 | REACTOME NOTCH1 INTRACELLULAR DOMAIN REGULATES TRANSCRIPTION | Genes involved in NOTCH1 Intracellular Domain Regulates Transcription |
0.1 | 0.3 | REACTOME DSCAM INTERACTIONS | Genes involved in DSCAM interactions |
0.1 | 0.1 | REACTOME PROSTACYCLIN SIGNALLING THROUGH PROSTACYCLIN RECEPTOR | Genes involved in Prostacyclin signalling through prostacyclin receptor |
0.1 | 0.7 | REACTOME PHOSPHOLIPID METABOLISM | Genes involved in Phospholipid metabolism |
0.1 | 1.1 | REACTOME NITRIC OXIDE STIMULATES GUANYLATE CYCLASE | Genes involved in Nitric oxide stimulates guanylate cyclase |
0.1 | 0.1 | REACTOME SIGNALLING TO P38 VIA RIT AND RIN | Genes involved in Signalling to p38 via RIT and RIN |
0.1 | 1.1 | REACTOME SEMA4D IN SEMAPHORIN SIGNALING | Genes involved in Sema4D in semaphorin signaling |
0.0 | 0.3 | REACTOME THROMBOXANE SIGNALLING THROUGH TP RECEPTOR | Genes involved in Thromboxane signalling through TP receptor |
0.0 | 0.5 | REACTOME CREB PHOSPHORYLATION THROUGH THE ACTIVATION OF CAMKII | Genes involved in CREB phosphorylation through the activation of CaMKII |
0.0 | 0.0 | REACTOME ACYL CHAIN REMODELLING OF PI | Genes involved in Acyl chain remodelling of PI |
0.0 | 0.8 | REACTOME DEADENYLATION OF MRNA | Genes involved in Deadenylation of mRNA |
0.0 | 1.8 | REACTOME CHEMOKINE RECEPTORS BIND CHEMOKINES | Genes involved in Chemokine receptors bind chemokines |
0.0 | 0.0 | REACTOME ACETYLCHOLINE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Acetylcholine Neurotransmitter Release Cycle |
0.0 | 1.1 | REACTOME CHONDROITIN SULFATE DERMATAN SULFATE METABOLISM | Genes involved in Chondroitin sulfate/dermatan sulfate metabolism |
0.0 | 0.5 | REACTOME CELL EXTRACELLULAR MATRIX INTERACTIONS | Genes involved in Cell-extracellular matrix interactions |
0.0 | 0.5 | REACTOME SIGNALING BY PDGF | Genes involved in Signaling by PDGF |
0.0 | 0.2 | REACTOME METABOLISM OF STEROID HORMONES AND VITAMINS A AND D | Genes involved in Metabolism of steroid hormones and vitamins A and D |
0.0 | 0.4 | REACTOME INTRINSIC PATHWAY FOR APOPTOSIS | Genes involved in Intrinsic Pathway for Apoptosis |
0.0 | 1.6 | REACTOME AMINE LIGAND BINDING RECEPTORS | Genes involved in Amine ligand-binding receptors |
0.0 | 0.8 | REACTOME GLUTATHIONE CONJUGATION | Genes involved in Glutathione conjugation |
0.0 | 1.1 | REACTOME INHIBITION OF VOLTAGE GATED CA2 CHANNELS VIA GBETA GAMMA SUBUNITS | Genes involved in Inhibition of voltage gated Ca2+ channels via Gbeta/gamma subunits |
0.0 | 0.2 | REACTOME PTM GAMMA CARBOXYLATION HYPUSINE FORMATION AND ARYLSULFATASE ACTIVATION | Genes involved in PTM: gamma carboxylation, hypusine formation and arylsulfatase activation |
0.0 | 0.6 | REACTOME AMINO ACID SYNTHESIS AND INTERCONVERSION TRANSAMINATION | Genes involved in Amino acid synthesis and interconversion (transamination) |
0.0 | 0.4 | REACTOME PIP3 ACTIVATES AKT SIGNALING | Genes involved in PIP3 activates AKT signaling |
0.0 | 0.2 | REACTOME HYALURONAN METABOLISM | Genes involved in Hyaluronan metabolism |
0.0 | 0.2 | REACTOME GAMMA CARBOXYLATION TRANSPORT AND AMINO TERMINAL CLEAVAGE OF PROTEINS | Genes involved in Gamma-carboxylation, transport, and amino-terminal cleavage of proteins |
0.0 | 1.2 | REACTOME TIGHT JUNCTION INTERACTIONS | Genes involved in Tight junction interactions |
0.0 | 0.5 | REACTOME MITOCHONDRIAL FATTY ACID BETA OXIDATION | Genes involved in Mitochondrial Fatty Acid Beta-Oxidation |
0.0 | 0.2 | REACTOME ADVANCED GLYCOSYLATION ENDPRODUCT RECEPTOR SIGNALING | Genes involved in Advanced glycosylation endproduct receptor signaling |
0.0 | 0.0 | REACTOME NCAM SIGNALING FOR NEURITE OUT GROWTH | Genes involved in NCAM signaling for neurite out-growth |
0.0 | 0.0 | REACTOME TRANSPORT OF MATURE MRNA DERIVED FROM AN INTRONLESS TRANSCRIPT | Genes involved in Transport of Mature mRNA Derived from an Intronless Transcript |
0.0 | 0.1 | REACTOME NEP NS2 INTERACTS WITH THE CELLULAR EXPORT MACHINERY | Genes involved in NEP/NS2 Interacts with the Cellular Export Machinery |
0.0 | 3.6 | REACTOME G ALPHA I SIGNALLING EVENTS | Genes involved in G alpha (i) signalling events |
0.0 | 0.3 | REACTOME METABOLISM OF POLYAMINES | Genes involved in Metabolism of polyamines |
0.0 | 0.3 | REACTOME PD1 SIGNALING | Genes involved in PD-1 signaling |
0.0 | 0.0 | REACTOME CDC6 ASSOCIATION WITH THE ORC ORIGIN COMPLEX | Genes involved in CDC6 association with the ORC:origin complex |
0.0 | 0.7 | REACTOME EXTRACELLULAR MATRIX ORGANIZATION | Genes involved in Extracellular matrix organization |
0.0 | 0.0 | REACTOME RNA POL I TRANSCRIPTION | Genes involved in RNA Polymerase I Transcription |
0.0 | 0.9 | REACTOME POST TRANSLATIONAL MODIFICATION SYNTHESIS OF GPI ANCHORED PROTEINS | Genes involved in Post-translational modification: synthesis of GPI-anchored proteins |
0.0 | 2.1 | REACTOME CLASS B 2 SECRETIN FAMILY RECEPTORS | Genes involved in Class B/2 (Secretin family receptors) |
0.0 | 0.0 | REACTOME RETROGRADE NEUROTROPHIN SIGNALLING | Genes involved in Retrograde neurotrophin signalling |
0.0 | 0.4 | REACTOME INSULIN SYNTHESIS AND PROCESSING | Genes involved in Insulin Synthesis and Processing |
0.0 | 0.8 | REACTOME CYTOSOLIC TRNA AMINOACYLATION | Genes involved in Cytosolic tRNA aminoacylation |
0.0 | 0.6 | REACTOME CITRIC ACID CYCLE TCA CYCLE | Genes involved in Citric acid cycle (TCA cycle) |
0.0 | 0.4 | REACTOME PKA MEDIATED PHOSPHORYLATION OF CREB | Genes involved in PKA-mediated phosphorylation of CREB |
0.0 | 0.7 | REACTOME TRANSFERRIN ENDOCYTOSIS AND RECYCLING | Genes involved in Transferrin endocytosis and recycling |
0.0 | 0.2 | REACTOME REGULATED PROTEOLYSIS OF P75NTR | Genes involved in Regulated proteolysis of p75NTR |
0.0 | 0.0 | REACTOME APC C CDC20 MEDIATED DEGRADATION OF MITOTIC PROTEINS | Genes involved in APC/C:Cdc20 mediated degradation of mitotic proteins |
0.0 | 0.3 | REACTOME APOPTOTIC CLEAVAGE OF CELLULAR PROTEINS | Genes involved in Apoptotic cleavage of cellular proteins |
0.0 | 0.1 | REACTOME BOTULINUM NEUROTOXICITY | Genes involved in Botulinum neurotoxicity |
0.0 | 0.2 | REACTOME CELL SURFACE INTERACTIONS AT THE VASCULAR WALL | Genes involved in Cell surface interactions at the vascular wall |
0.0 | 0.9 | REACTOME INTERACTIONS OF VPR WITH HOST CELLULAR PROTEINS | Genes involved in Interactions of Vpr with host cellular proteins |
0.0 | 0.9 | REACTOME ACTIVATION OF ATR IN RESPONSE TO REPLICATION STRESS | Genes involved in Activation of ATR in response to replication stress |
0.0 | 0.9 | REACTOME GLYCOSPHINGOLIPID METABOLISM | Genes involved in Glycosphingolipid metabolism |
0.0 | 1.7 | REACTOME MHC CLASS II ANTIGEN PRESENTATION | Genes involved in MHC class II antigen presentation |
0.0 | 0.0 | REACTOME MRNA DECAY BY 3 TO 5 EXORIBONUCLEASE | Genes involved in mRNA Decay by 3' to 5' Exoribonuclease |
0.0 | 0.5 | REACTOME GAP JUNCTION ASSEMBLY | Genes involved in Gap junction assembly |
0.0 | 1.3 | REACTOME ACTIVATION OF THE MRNA UPON BINDING OF THE CAP BINDING COMPLEX AND EIFS AND SUBSEQUENT BINDING TO 43S | Genes involved in Activation of the mRNA upon binding of the cap-binding complex and eIFs, and subsequent binding to 43S |
0.0 | 0.3 | REACTOME SYNTHESIS OF SUBSTRATES IN N GLYCAN BIOSYTHESIS | Genes involved in Synthesis of substrates in N-glycan biosythesis |
0.0 | 0.2 | REACTOME DOWNREGULATION OF TGF BETA RECEPTOR SIGNALING | Genes involved in Downregulation of TGF-beta receptor signaling |
0.0 | 0.1 | REACTOME CYCLIN A B1 ASSOCIATED EVENTS DURING G2 M TRANSITION | Genes involved in Cyclin A/B1 associated events during G2/M transition |
0.0 | 0.2 | REACTOME PREFOLDIN MEDIATED TRANSFER OF SUBSTRATE TO CCT TRIC | Genes involved in Prefoldin mediated transfer of substrate to CCT/TriC |
0.0 | 0.2 | REACTOME SIGNALING BY FGFR IN DISEASE | Genes involved in Signaling by FGFR in disease |
0.0 | 0.2 | REACTOME NUCLEAR SIGNALING BY ERBB4 | Genes involved in Nuclear signaling by ERBB4 |
0.0 | 0.9 | REACTOME ACTIVATION OF CHAPERONE GENES BY XBP1S | Genes involved in Activation of Chaperone Genes by XBP1(S) |
0.0 | 0.3 | REACTOME SYNTHESIS OF PE | Genes involved in Synthesis of PE |
0.0 | 0.5 | REACTOME SIGNALING BY ROBO RECEPTOR | Genes involved in Signaling by Robo receptor |
0.0 | 1.1 | REACTOME RECRUITMENT OF MITOTIC CENTROSOME PROTEINS AND COMPLEXES | Genes involved in Recruitment of mitotic centrosome proteins and complexes |
0.0 | 0.0 | REACTOME APOPTOTIC EXECUTION PHASE | Genes involved in Apoptotic execution phase |
0.0 | 0.3 | REACTOME GABA A RECEPTOR ACTIVATION | Genes involved in GABA A receptor activation |
0.0 | 0.0 | REACTOME ASSOCIATION OF LICENSING FACTORS WITH THE PRE REPLICATIVE COMPLEX | Genes involved in Association of licensing factors with the pre-replicative complex |
0.0 | 1.1 | REACTOME 3 UTR MEDIATED TRANSLATIONAL REGULATION | Genes involved in 3' -UTR-mediated translational regulation |
0.0 | 0.1 | REACTOME DCC MEDIATED ATTRACTIVE SIGNALING | Genes involved in DCC mediated attractive signaling |
0.0 | 0.2 | REACTOME EXTRINSIC PATHWAY FOR APOPTOSIS | Genes involved in Extrinsic Pathway for Apoptosis |
0.0 | 0.2 | REACTOME DOWNSTREAM SIGNALING EVENTS OF B CELL RECEPTOR BCR | Genes involved in Downstream Signaling Events Of B Cell Receptor (BCR) |
0.0 | 0.0 | REACTOME ACTIVATION OF NMDA RECEPTOR UPON GLUTAMATE BINDING AND POSTSYNAPTIC EVENTS | Genes involved in Activation of NMDA receptor upon glutamate binding and postsynaptic events |
0.0 | 0.0 | REACTOME PEPTIDE CHAIN ELONGATION | Genes involved in Peptide chain elongation |
0.0 | 0.0 | REACTOME RIG I MDA5 MEDIATED INDUCTION OF IFN ALPHA BETA PATHWAYS | Genes involved in RIG-I/MDA5 mediated induction of IFN-alpha/beta pathways |
0.0 | 0.0 | REACTOME REGULATION OF GLUCOKINASE BY GLUCOKINASE REGULATORY PROTEIN | Genes involved in Regulation of Glucokinase by Glucokinase Regulatory Protein |
0.0 | 0.0 | REACTOME GLUTAMATE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Glutamate Neurotransmitter Release Cycle |
0.0 | 0.1 | REACTOME AQUAPORIN MEDIATED TRANSPORT | Genes involved in Aquaporin-mediated transport |
0.0 | 0.1 | REACTOME INWARDLY RECTIFYING K CHANNELS | Genes involved in Inwardly rectifying K+ channels |
0.0 | 0.8 | REACTOME VOLTAGE GATED POTASSIUM CHANNELS | Genes involved in Voltage gated Potassium channels |
0.0 | 0.1 | REACTOME CROSS PRESENTATION OF SOLUBLE EXOGENOUS ANTIGENS ENDOSOMES | Genes involved in Cross-presentation of soluble exogenous antigens (endosomes) |
0.0 | 0.1 | REACTOME HOST INTERACTIONS OF HIV FACTORS | Genes involved in Host Interactions of HIV factors |
0.0 | 0.0 | REACTOME TRAFFICKING AND PROCESSING OF ENDOSOMAL TLR | Genes involved in Trafficking and processing of endosomal TLR |
0.0 | 0.0 | REACTOME GABA B RECEPTOR ACTIVATION | Genes involved in GABA B receptor activation |
0.0 | 0.3 | REACTOME HEPARAN SULFATE HEPARIN HS GAG METABOLISM | Genes involved in Heparan sulfate/heparin (HS-GAG) metabolism |
0.0 | 0.1 | REACTOME POTASSIUM CHANNELS | Genes involved in Potassium Channels |
0.0 | 0.0 | REACTOME SIGNALING BY ERBB2 | Genes involved in Signaling by ERBB2 |
0.0 | 2.0 | REACTOME ANTIGEN PROCESSING UBIQUITINATION PROTEASOME DEGRADATION | Genes involved in Antigen processing: Ubiquitination & Proteasome degradation |
0.0 | 0.1 | REACTOME G BETA GAMMA SIGNALLING THROUGH PI3KGAMMA | Genes involved in G beta:gamma signalling through PI3Kgamma |
0.0 | 0.1 | REACTOME LATENT INFECTION OF HOMO SAPIENS WITH MYCOBACTERIUM TUBERCULOSIS | Genes involved in Latent infection of Homo sapiens with Mycobacterium tuberculosis |
0.0 | 0.2 | REACTOME PRESYNAPTIC NICOTINIC ACETYLCHOLINE RECEPTORS | Genes involved in Presynaptic nicotinic acetylcholine receptors |
0.0 | 0.7 | REACTOME FACTORS INVOLVED IN MEGAKARYOCYTE DEVELOPMENT AND PLATELET PRODUCTION | Genes involved in Factors involved in megakaryocyte development and platelet production |
0.0 | 0.3 | REACTOME MUSCLE CONTRACTION | Genes involved in Muscle contraction |
0.0 | 0.2 | REACTOME PROCESSING OF CAPPED INTRONLESS PRE MRNA | Genes involved in Processing of Capped Intronless Pre-mRNA |
0.0 | 0.0 | REACTOME SHC MEDIATED SIGNALLING | Genes involved in SHC-mediated signalling |
0.0 | 0.2 | REACTOME SIGNALING BY BMP | Genes involved in Signaling by BMP |
0.0 | 0.5 | REACTOME TRANSCRIPTIONAL REGULATION OF WHITE ADIPOCYTE DIFFERENTIATION | Genes involved in Transcriptional Regulation of White Adipocyte Differentiation |
0.0 | 0.1 | REACTOME INTERFERON GAMMA SIGNALING | Genes involved in Interferon gamma signaling |
0.0 | 0.0 | REACTOME PLATELET HOMEOSTASIS | Genes involved in Platelet homeostasis |
0.0 | 0.6 | REACTOME REGULATION OF MRNA STABILITY BY PROTEINS THAT BIND AU RICH ELEMENTS | Genes involved in Regulation of mRNA Stability by Proteins that Bind AU-rich Elements |
0.0 | 0.3 | REACTOME PPARA ACTIVATES GENE EXPRESSION | Genes involved in PPARA Activates Gene Expression |
0.0 | 0.1 | REACTOME RNA POL III TRANSCRIPTION INITIATION FROM TYPE 2 PROMOTER | Genes involved in RNA Polymerase III Transcription Initiation From Type 2 Promoter |