| Gene Symbol | Gene ID | Gene Info |
|---|---|---|
|
Dlx1
|
ENSMUSG00000041911.3 | distal-less homeobox 1 |
| CRE | Gene | Distance | Association probability | Pearson corr. coef. | P-value | Plot |
|---|---|---|---|---|---|---|
| chr2_71529649_71529817 | Dlx1 | 120 | 0.937415 | 0.05 | 9.3e-01 | Click! |
Move your cursor over a bar to see sample name and corresponding Z-value.
| Cis Regulatory Element (CRE) | Target Score | Top associated gene | Gene Info | Distance of CRE to TSS | CRE/Gene association probability |
|---|---|---|---|---|---|
| chr13_117745874_117746186 | 1.54 |
4933413L06Rik |
RIKEN cDNA 4933413L06 gene |
26019 |
0.26 |
| chr2_18048778_18049088 | 1.35 |
Skida1 |
SKI/DACH domain containing 1 |
98 |
0.94 |
| chr11_98590413_98590578 | 1.20 |
Ormdl3 |
ORM1-like 3 (S. cerevisiae) |
3127 |
0.14 |
| chr19_44394517_44394772 | 1.18 |
Scd1 |
stearoyl-Coenzyme A desaturase 1 |
12046 |
0.14 |
| chr1_100298746_100298897 | 1.16 |
Gm29667 |
predicted gene 29667 |
16030 |
0.18 |
| chr12_73861884_73862127 | 1.13 |
Gm15283 |
predicted gene 15283 |
7607 |
0.18 |
| chr5_125526040_125526191 | 1.12 |
Tmem132b |
transmembrane protein 132B |
5659 |
0.17 |
| chr1_23237656_23237879 | 1.11 |
Gm29506 |
predicted gene 29506 |
2094 |
0.23 |
| chr16_42947764_42948084 | 1.11 |
Ndufs5-ps |
NADH:ubiquinone oxidoreductase core subunit S5, pseudogene |
7707 |
0.21 |
| chr7_63922331_63923024 | 1.08 |
Klf13 |
Kruppel-like factor 13 |
2193 |
0.22 |
| chr6_58611375_58611579 | 1.06 |
Abcg2 |
ATP binding cassette subfamily G member 2 (Junior blood group) |
14806 |
0.19 |
| chr1_67182326_67182537 | 1.04 |
Cps1 |
carbamoyl-phosphate synthetase 1 |
59405 |
0.11 |
| chr19_44401346_44401497 | 1.03 |
Scd1 |
stearoyl-Coenzyme A desaturase 1 |
5269 |
0.16 |
| chr15_3463467_3463618 | 0.98 |
Ghr |
growth hormone receptor |
8102 |
0.29 |
| chr19_44401904_44402310 | 0.97 |
Scd1 |
stearoyl-Coenzyme A desaturase 1 |
4583 |
0.17 |
| chr6_72120521_72121047 | 0.97 |
4933431G14Rik |
RIKEN cDNA 4933431G14 gene |
2156 |
0.2 |
| chr11_88618341_88618520 | 0.95 |
Msi2 |
musashi RNA-binding protein 2 |
28283 |
0.2 |
| chr2_107628721_107628872 | 0.95 |
Gm9864 |
predicted gene 9864 |
28257 |
0.26 |
| chr19_39108442_39108835 | 0.95 |
Cyp2c66 |
cytochrome P450, family 2, subfamily c, polypeptide 66 |
5260 |
0.24 |
| chr13_16574847_16575001 | 0.94 |
Gm48497 |
predicted gene, 48497 |
41103 |
0.17 |
| chr1_51751367_51751637 | 0.94 |
Gm28055 |
predicted gene 28055 |
4559 |
0.23 |
| chr3_52544102_52544286 | 0.92 |
Gm30173 |
predicted gene, 30173 |
27230 |
0.2 |
| chr4_121077501_121077678 | 0.92 |
Zmpste24 |
zinc metallopeptidase, STE24 |
149 |
0.9 |
| chr8_93189262_93189430 | 0.92 |
Gm45909 |
predicted gene 45909 |
2012 |
0.24 |
| chr11_62433617_62433927 | 0.91 |
Ncor1 |
nuclear receptor co-repressor 1 |
4709 |
0.17 |
| chr19_56521472_56521623 | 0.91 |
Dclre1a |
DNA cross-link repair 1A |
15835 |
0.17 |
| chr4_121078016_121078199 | 0.88 |
Zmpste24 |
zinc metallopeptidase, STE24 |
369 |
0.74 |
| chr13_4270161_4270342 | 0.88 |
Akr1c12 |
aldo-keto reductase family 1, member C12 |
9182 |
0.15 |
| chr4_118031195_118031493 | 0.87 |
St3gal3 |
ST3 beta-galactoside alpha-2,3-sialyltransferase 3 |
538 |
0.78 |
| chr9_60982764_60983106 | 0.84 |
Gm5122 |
predicted gene 5122 |
30546 |
0.14 |
| chr16_37635855_37636049 | 0.83 |
Ndufb4 |
NADH:ubiquinone oxidoreductase subunit B4 |
13407 |
0.15 |
| chr7_98380899_98381253 | 0.83 |
Tsku |
tsukushi, small leucine rich proteoglycan |
19748 |
0.14 |
| chr17_80022007_80022158 | 0.82 |
Gm22215 |
predicted gene, 22215 |
11432 |
0.14 |
| chr8_93188530_93188681 | 0.81 |
Gm45909 |
predicted gene 45909 |
2753 |
0.19 |
| chr17_81386211_81386362 | 0.81 |
Gm50044 |
predicted gene, 50044 |
15453 |
0.24 |
| chr3_149234408_149234559 | 0.81 |
Gm10287 |
predicted gene 10287 |
8738 |
0.21 |
| chr2_31519719_31520357 | 0.81 |
Ass1 |
argininosuccinate synthetase 1 |
1548 |
0.36 |
| chr10_42230294_42230483 | 0.81 |
Foxo3 |
forkhead box O3 |
27978 |
0.22 |
| chr10_89563955_89564134 | 0.80 |
Gm48087 |
predicted gene, 48087 |
8325 |
0.2 |
| chr3_136048131_136048315 | 0.80 |
Gm5281 |
predicted gene 5281 |
3465 |
0.25 |
| chr1_102517589_102517767 | 0.79 |
Gm20281 |
predicted gene, 20281 |
58756 |
0.14 |
| chr7_30967090_30967447 | 0.79 |
Lsr |
lipolysis stimulated lipoprotein receptor |
6054 |
0.07 |
| chr14_21435070_21435221 | 0.78 |
Gm25864 |
predicted gene, 25864 |
15329 |
0.19 |
| chr10_111367147_111367312 | 0.78 |
Gm40761 |
predicted gene, 40761 |
30105 |
0.16 |
| chr1_140421414_140421565 | 0.78 |
Kcnt2 |
potassium channel, subfamily T, member 2 |
21447 |
0.27 |
| chr17_46054574_46054727 | 0.77 |
Vegfa |
vascular endothelial growth factor A |
22281 |
0.12 |
| chr8_35219364_35219515 | 0.77 |
Gm34474 |
predicted gene, 34474 |
801 |
0.55 |
| chr14_70700792_70700966 | 0.76 |
Xpo7 |
exportin 7 |
7156 |
0.15 |
| chr19_40153747_40153898 | 0.76 |
Cyp2c70 |
cytochrome P450, family 2, subfamily c, polypeptide 70 |
33464 |
0.13 |
| chr2_38823684_38823849 | 0.76 |
Nr6a1os |
nuclear receptor subfamily 6, group A, member 1, opposite strand |
425 |
0.74 |
| chr9_106788095_106788832 | 0.75 |
Rad54l2 |
RAD54 like 2 (S. cerevisiae) |
713 |
0.62 |
| chr4_53221393_53221544 | 0.75 |
4930412L05Rik |
RIKEN cDNA 4930412L05 gene |
3611 |
0.22 |
| chr13_44437957_44438156 | 0.74 |
1700029N11Rik |
RIKEN cDNA 1700029N11 gene |
1656 |
0.27 |
| chr1_51750897_51751126 | 0.74 |
Gm28055 |
predicted gene 28055 |
4068 |
0.24 |
| chr18_51150358_51150691 | 0.73 |
Prr16 |
proline rich 16 |
32786 |
0.23 |
| chr2_32606655_32606830 | 0.73 |
St6galnac6 |
ST6 (alpha-N-acetyl-neuraminyl-2,3-beta-galactosyl-1,3)-N-acetylgalactosaminide alpha-2,6-sialyltransferase 6 |
219 |
0.84 |
| chr17_72829234_72829476 | 0.72 |
Ypel5 |
yippee like 5 |
7098 |
0.28 |
| chr3_133544844_133545488 | 0.72 |
Tet2 |
tet methylcytosine dioxygenase 2 |
27 |
0.53 |
| chr14_21114751_21114902 | 0.72 |
Adk |
adenosine kinase |
38674 |
0.17 |
| chr4_101198122_101198415 | 0.72 |
Gm24468 |
predicted gene, 24468 |
11504 |
0.14 |
| chr14_11132064_11132231 | 0.71 |
Fhit |
fragile histidine triad gene |
6556 |
0.25 |
| chr1_162891903_162892071 | 0.71 |
Fmo2 |
flavin containing monooxygenase 2 |
5472 |
0.19 |
| chr3_133740753_133740929 | 0.71 |
Gm6135 |
prediticted gene 6135 |
50663 |
0.13 |
| chr8_36290613_36290918 | 0.71 |
Lonrf1 |
LON peptidase N-terminal domain and ring finger 1 |
41249 |
0.14 |
| chr5_39163040_39163219 | 0.71 |
Gm40293 |
predicted gene, 40293 |
143955 |
0.04 |
| chr14_17864277_17864546 | 0.70 |
Gm48320 |
predicted gene, 48320 |
93289 |
0.08 |
| chr17_63370765_63370929 | 0.70 |
Gm24813 |
predicted gene, 24813 |
23176 |
0.18 |
| chr2_103461502_103462486 | 0.69 |
Elf5 |
E74-like factor 5 |
13256 |
0.17 |
| chr2_31513022_31513372 | 0.69 |
Ass1 |
argininosuccinate synthetase 1 |
5293 |
0.19 |
| chrX_170020226_170020377 | 0.68 |
Erdr1 |
erythroid differentiation regulator 1 |
9557 |
0.18 |
| chr9_55280024_55280330 | 0.67 |
Nrg4 |
neuregulin 4 |
3395 |
0.23 |
| chr11_52374066_52374363 | 0.67 |
Vdac1 |
voltage-dependent anion channel 1 |
49 |
0.97 |
| chr8_56281836_56281987 | 0.66 |
Hpgd |
hydroxyprostaglandin dehydrogenase 15 (NAD) |
12674 |
0.23 |
| chr3_52708989_52709165 | 0.66 |
Gm22798 |
predicted gene, 22798 |
13678 |
0.2 |
| chr1_21250942_21251436 | 0.66 |
Gsta3 |
glutathione S-transferase, alpha 3 |
2332 |
0.18 |
| chr17_62789514_62789722 | 0.66 |
Efna5 |
ephrin A5 |
91526 |
0.1 |
| chr4_123990670_123991070 | 0.65 |
Gm12902 |
predicted gene 12902 |
64636 |
0.08 |
| chr13_107542484_107542646 | 0.65 |
Gm32004 |
predicted gene, 32004 |
22758 |
0.2 |
| chr4_97102666_97103047 | 0.65 |
Gm27521 |
predicted gene, 27521 |
185836 |
0.03 |
| chr16_43408501_43408652 | 0.65 |
Gm15713 |
predicted gene 15713 |
11620 |
0.2 |
| chr3_51437862_51438013 | 0.65 |
Naa15 |
N(alpha)-acetyltransferase 15, NatA auxiliary subunit |
2980 |
0.14 |
| chr8_25609907_25610083 | 0.65 |
Gm23184 |
predicted gene, 23184 |
563 |
0.58 |
| chr14_32179471_32179639 | 0.64 |
Ncoa4 |
nuclear receptor coactivator 4 |
2823 |
0.15 |
| chr9_122826708_122826859 | 0.64 |
Gm35549 |
predicted gene, 35549 |
17103 |
0.1 |
| chr2_155726622_155726905 | 0.64 |
Edem2 |
ER degradation enhancer, mannosidase alpha-like 2 |
2712 |
0.16 |
| chr11_43783562_43783743 | 0.64 |
Ttc1 |
tetratricopeptide repeat domain 1 |
35644 |
0.16 |
| chr6_144895356_144895507 | 0.64 |
Gm22792 |
predicted gene, 22792 |
91799 |
0.07 |
| chr9_67840552_67841087 | 0.64 |
Vps13c |
vacuolar protein sorting 13C |
407 |
0.85 |
| chr7_65902304_65902456 | 0.63 |
Pcsk6 |
proprotein convertase subtilisin/kexin type 6 |
39948 |
0.14 |
| chr5_147545326_147545477 | 0.63 |
Pan3 |
PAN3 poly(A) specific ribonuclease subunit |
6124 |
0.21 |
| chr1_67132947_67133268 | 0.63 |
Cps1 |
carbamoyl-phosphate synthetase 1 |
10081 |
0.24 |
| chr12_101954170_101954556 | 0.62 |
Atxn3 |
ataxin 3 |
3785 |
0.17 |
| chr1_106267814_106267970 | 0.62 |
Phlpp1 |
PH domain and leucine rich repeat protein phosphatase 1 |
13533 |
0.22 |
| chr5_90891820_90892079 | 0.62 |
Cxcl1 |
chemokine (C-X-C motif) ligand 1 |
706 |
0.49 |
| chr18_86383968_86384119 | 0.62 |
Neto1 |
neuropilin (NRP) and tolloid (TLL)-like 1 |
10909 |
0.24 |
| chrX_68717266_68717440 | 0.62 |
Fmr1 |
fragile X mental retardation 1 |
5502 |
0.2 |
| chr9_122357372_122357607 | 0.62 |
Abhd5 |
abhydrolase domain containing 5 |
5700 |
0.15 |
| chr2_50283993_50284144 | 0.62 |
Mmadhc |
methylmalonic aciduria (cobalamin deficiency) cblD type, with homocystinuria |
5131 |
0.24 |
| chr3_18163689_18163955 | 0.62 |
Gm23686 |
predicted gene, 23686 |
13803 |
0.23 |
| chr9_14061834_14061992 | 0.61 |
1700019J19Rik |
RIKEN cDNA 1700019J19 gene |
27707 |
0.17 |
| chr10_4618620_4618773 | 0.61 |
Esr1 |
estrogen receptor 1 (alpha) |
6675 |
0.25 |
| chr14_21178644_21178795 | 0.61 |
Adk |
adenosine kinase |
102567 |
0.07 |
| chr12_57317079_57317230 | 0.60 |
Mipol1 |
mirror-image polydactyly 1 |
11071 |
0.22 |
| chr2_150913728_150914090 | 0.60 |
Gins1 |
GINS complex subunit 1 (Psf1 homolog) |
1090 |
0.37 |
| chr6_72155996_72156358 | 0.60 |
Gm38832 |
predicted gene, 38832 |
6672 |
0.15 |
| chr10_51722569_51722927 | 0.60 |
Rfx6 |
regulatory factor X, 6 |
28977 |
0.12 |
| chr12_83904731_83904919 | 0.60 |
Numb |
NUMB endocytic adaptor protein |
16908 |
0.11 |
| chr14_45661707_45661865 | 0.59 |
Ddhd1 |
DDHD domain containing 1 |
3643 |
0.14 |
| chr16_94497569_94497720 | 0.59 |
Vps26c |
VPS26 endosomal protein sorting factor C |
6743 |
0.17 |
| chrX_169974457_169974608 | 0.59 |
Mid1 |
midline 1 |
727 |
0.6 |
| chr15_102752976_102753138 | 0.59 |
Calcoco1 |
calcium binding and coiled coil domain 1 |
30879 |
0.11 |
| chr12_80336463_80336614 | 0.59 |
Dcaf5 |
DDB1 and CUL4 associated factor 5 |
40154 |
0.1 |
| chr12_32766682_32766844 | 0.59 |
Nampt |
nicotinamide phosphoribosyltransferase |
52782 |
0.12 |
| chr1_51740463_51740849 | 0.59 |
Gm28055 |
predicted gene 28055 |
6287 |
0.22 |
| chr9_109966945_109967106 | 0.59 |
Map4 |
microtubule-associated protein 4 |
1992 |
0.21 |
| chr1_163817675_163817827 | 0.59 |
Kifap3 |
kinesin-associated protein 3 |
38168 |
0.16 |
| chr15_3453354_3453796 | 0.58 |
Ghr |
growth hormone receptor |
18069 |
0.26 |
| chr10_111583801_111583952 | 0.58 |
4933440J02Rik |
RIKEN cDNA 4933440J02 gene |
10397 |
0.16 |
| chr15_97036944_97037119 | 0.58 |
Slc38a4 |
solute carrier family 38, member 4 |
5820 |
0.3 |
| chr12_57281727_57281906 | 0.58 |
Mipol1 |
mirror-image polydactyly 1 |
357 |
0.88 |
| chr3_8963133_8963313 | 0.58 |
Tpd52 |
tumor protein D52 |
823 |
0.64 |
| chr8_3046150_3046544 | 0.58 |
Gm44634 |
predicted gene 44634 |
9947 |
0.2 |
| chr4_84064984_84065135 | 0.58 |
6030471H07Rik |
RIKEN cDNA 6030471H07 gene |
20180 |
0.21 |
| chr10_87040962_87041138 | 0.58 |
1700113H08Rik |
RIKEN cDNA 1700113H08 gene |
16995 |
0.16 |
| chr8_109995374_109995556 | 0.57 |
Tat |
tyrosine aminotransferase |
4959 |
0.13 |
| chr6_50091657_50091996 | 0.57 |
Mpp6 |
membrane protein, palmitoylated 6 (MAGUK p55 subfamily member 6) |
18415 |
0.22 |
| chr5_87030613_87030972 | 0.57 |
Gm18635 |
predicted gene, 18635 |
16632 |
0.1 |
| chr11_86679364_86679596 | 0.57 |
Vmp1 |
vacuole membrane protein 1 |
4341 |
0.18 |
| chr2_128377567_128377751 | 0.57 |
Morrbid |
myeloid RNA regulator of BCL2L11 induced cell death |
25306 |
0.18 |
| chr2_134851877_134852227 | 0.57 |
Gm14036 |
predicted gene 14036 |
48103 |
0.15 |
| chr12_17451870_17452021 | 0.57 |
Gm36752 |
predicted gene, 36752 |
15327 |
0.19 |
| chr8_46434024_46434202 | 0.57 |
Gm45245 |
predicted gene 45245 |
18191 |
0.14 |
| chr4_147433621_147433808 | 0.57 |
Gm13161 |
predicted gene 13161 |
9757 |
0.14 |
| chr3_42673626_42673810 | 0.56 |
Gm38044 |
predicted gene, 38044 |
88119 |
0.1 |
| chr3_28467597_28467813 | 0.56 |
Mir466q |
microRNA 466q |
47762 |
0.15 |
| chr3_83048403_83048757 | 0.55 |
Fgb |
fibrinogen beta chain |
1283 |
0.37 |
| chr6_85813280_85813431 | 0.55 |
Nat8f6 |
N-acetyltransferase 8 (GCN5-related) family member 6 |
3492 |
0.11 |
| chr9_122355767_122356085 | 0.55 |
Abhd5 |
abhydrolase domain containing 5 |
4137 |
0.17 |
| chr16_24892958_24893109 | 0.55 |
Gm22672 |
predicted gene, 22672 |
8860 |
0.25 |
| chr14_31634356_31634507 | 0.55 |
Gm49387 |
predicted gene, 49387 |
6447 |
0.15 |
| chr9_94016628_94017010 | 0.55 |
Gm5369 |
predicted gene 5369 |
122643 |
0.06 |
| chr3_133759501_133760150 | 0.55 |
Gm6135 |
prediticted gene 6135 |
31679 |
0.18 |
| chr2_155100983_155101285 | 0.55 |
2310005A03Rik |
RIKEN cDNA 2310005A03 gene |
1053 |
0.43 |
| chr9_122056710_122056883 | 0.55 |
Gm39465 |
predicted gene, 39465 |
5333 |
0.13 |
| chr16_87627804_87628113 | 0.55 |
Gm22808 |
predicted gene, 22808 |
6838 |
0.21 |
| chr14_65740190_65740357 | 0.54 |
Scara5 |
scavenger receptor class A, member 5 |
63796 |
0.1 |
| chr16_9527007_9527182 | 0.54 |
Grin2a |
glutamate receptor, ionotropic, NMDA2A (epsilon 1) |
270239 |
0.01 |
| chr3_5425056_5425268 | 0.54 |
4930555M17Rik |
RIKEN cDNA 4930555M17 gene |
90171 |
0.09 |
| chr4_126764112_126764263 | 0.54 |
AU040320 |
expressed sequence AU040320 |
10361 |
0.13 |
| chr3_97632897_97633210 | 0.54 |
Fmo5 |
flavin containing monooxygenase 5 |
4170 |
0.16 |
| chr16_56279382_56279563 | 0.54 |
Impg2 |
interphotoreceptor matrix proteoglycan 2 |
9288 |
0.23 |
| chr12_13724294_13724464 | 0.54 |
Gm4929 |
predicted gene 4929 |
29286 |
0.15 |
| chr6_90499813_90499975 | 0.54 |
Gm44236 |
predicted gene, 44236 |
13408 |
0.1 |
| chr9_48738986_48739137 | 0.54 |
Zbtb16 |
zinc finger and BTB domain containing 16 |
96884 |
0.07 |
| chr12_51274477_51274668 | 0.54 |
Rps11-ps4 |
ribosomal protein S11, pseudogene 4 |
22915 |
0.22 |
| chr9_50500490_50500842 | 0.53 |
Plet1os |
placenta expressed transcript 1, opposite strand |
4139 |
0.14 |
| chr3_12608407_12608567 | 0.53 |
Gm2429 |
predicted gene 2429 |
22773 |
0.28 |
| chr19_21487417_21487631 | 0.53 |
Gda |
guanine deaminase |
14079 |
0.24 |
| chr6_31260546_31260737 | 0.53 |
2210408F21Rik |
RIKEN cDNA 2210408F21 gene |
17207 |
0.15 |
| chr10_4605236_4605428 | 0.53 |
Esr1 |
estrogen receptor 1 (alpha) |
6261 |
0.23 |
| chr10_67176584_67176792 | 0.53 |
Jmjd1c |
jumonji domain containing 1C |
9060 |
0.22 |
| chr12_73341772_73342027 | 0.53 |
Slc38a6 |
solute carrier family 38, member 6 |
2468 |
0.25 |
| chr16_42999869_43000020 | 0.53 |
Ndufs5-ps |
NADH:ubiquinone oxidoreductase core subunit S5, pseudogene |
44313 |
0.16 |
| chr15_62705006_62705181 | 0.53 |
Gm24810 |
predicted gene, 24810 |
52089 |
0.16 |
| chr11_50295296_50295447 | 0.53 |
Canx |
calnexin |
2948 |
0.16 |
| chr5_20590046_20590233 | 0.53 |
Gm3544 |
predicted gene 3544 |
1543 |
0.45 |
| chr6_14778417_14778568 | 0.53 |
Ppp1r3a |
protein phosphatase 1, regulatory subunit 3A |
23218 |
0.27 |
| chr6_88046142_88046293 | 0.53 |
Rab7 |
RAB7, member RAS oncogene family |
947 |
0.41 |
| chr11_119048222_119048411 | 0.52 |
Cbx8 |
chromobox 8 |
7347 |
0.16 |
| chr10_80828156_80828307 | 0.52 |
Oaz1 |
ornithine decarboxylase antizyme 1 |
362 |
0.53 |
| chr5_21795907_21796066 | 0.52 |
Psmc2 |
proteasome (prosome, macropain) 26S subunit, ATPase 2 |
1883 |
0.25 |
| chr4_104775793_104775972 | 0.52 |
C8b |
complement component 8, beta polypeptide |
9487 |
0.26 |
| chr5_102009929_102010121 | 0.52 |
Wdfy3 |
WD repeat and FYVE domain containing 3 |
28467 |
0.16 |
| chr1_63136268_63136443 | 0.52 |
Ndufs1 |
NADH:ubiquinone oxidoreductase core subunit S1 |
8606 |
0.09 |
| chr17_64763760_64763987 | 0.52 |
Dreh |
down-regulated in hepatocellular carcinoma |
3238 |
0.25 |
| chr18_61856032_61856207 | 0.52 |
Ablim3 |
actin binding LIM protein family, member 3 |
55704 |
0.1 |
| chr2_14596063_14596214 | 0.52 |
Cacnb2 |
calcium channel, voltage-dependent, beta 2 subunit |
6950 |
0.13 |
| chr4_84545149_84545479 | 0.51 |
Bnc2 |
basonuclin 2 |
976 |
0.7 |
| chr10_24831746_24832070 | 0.51 |
Enpp3 |
ectonucleotide pyrophosphatase/phosphodiesterase 3 |
102 |
0.97 |
| chr1_31072842_31073079 | 0.51 |
4931428L18Rik |
RIKEN cDNA 4931428L18 gene |
23494 |
0.14 |
| chr3_100893002_100893153 | 0.51 |
Trim45 |
tripartite motif-containing 45 |
29125 |
0.16 |
| chr2_154875946_154876097 | 0.51 |
Eif2s2 |
eukaryotic translation initiation factor 2, subunit 2 (beta) |
16761 |
0.19 |
| chr1_191362120_191362299 | 0.51 |
Ppp2r5a |
protein phosphatase 2, regulatory subunit B', alpha |
5744 |
0.17 |
| chr2_113578462_113578613 | 0.51 |
Gm13964 |
predicted gene 13964 |
74503 |
0.09 |
| chr1_74335061_74335217 | 0.51 |
Pnkd |
paroxysmal nonkinesiogenic dyskinesia |
2476 |
0.14 |
| chr19_30092253_30092507 | 0.51 |
Uhrf2 |
ubiquitin-like, containing PHD and RING finger domains 2 |
419 |
0.86 |
| chr11_80974932_80975087 | 0.51 |
Gm11416 |
predicted gene 11416 |
71785 |
0.1 |
| chr12_54960526_54960699 | 0.51 |
Gm27014 |
predicted gene, 27014 |
2452 |
0.2 |
| chr10_24228903_24229069 | 0.50 |
Moxd1 |
monooxygenase, DBH-like 1 |
5441 |
0.22 |
| chr8_22623689_22623868 | 0.50 |
Dkk4 |
dickkopf WNT signaling pathway inhibitor 4 |
265 |
0.89 |
| chr7_39809662_39809816 | 0.50 |
4930558N11Rik |
RIKEN cDNA 4930558N11 gene |
11997 |
0.16 |
| chr3_142862185_142862381 | 0.50 |
Pkn2 |
protein kinase N2 |
6548 |
0.15 |
| chr11_90184166_90184514 | 0.50 |
n-R5s72 |
nuclear encoded rRNA 5S 72 |
787 |
0.57 |
| chr14_70068415_70068595 | 0.50 |
Egr3 |
early growth response 3 |
8698 |
0.16 |
| chr5_101758048_101758202 | 0.50 |
Cds1 |
CDP-diacylglycerol synthase 1 |
7005 |
0.17 |
| chr5_40908767_40908928 | 0.50 |
4930519E07Rik |
RIKEN cDNA 4930519E07 gene |
372389 |
0.01 |
| chr19_12697726_12697882 | 0.49 |
Keg1 |
kidney expressed gene 1 |
1990 |
0.18 |
| chr15_62743599_62743898 | 0.49 |
Gm22521 |
predicted gene, 22521 |
49453 |
0.17 |
| chr2_165869197_165869348 | 0.49 |
Zmynd8 |
zinc finger, MYND-type containing 8 |
6505 |
0.15 |
| chr1_88055296_88055515 | 0.49 |
Ugt1a10 |
UDP glycosyltransferase 1 family, polypeptide A10 |
6 |
0.94 |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.5 | 1.5 | GO:0030327 | prenylated protein catabolic process(GO:0030327) |
| 0.4 | 1.1 | GO:0010046 | response to mycotoxin(GO:0010046) |
| 0.3 | 0.9 | GO:0019626 | short-chain fatty acid catabolic process(GO:0019626) |
| 0.2 | 0.9 | GO:1903966 | monounsaturated fatty acid metabolic process(GO:1903964) monounsaturated fatty acid biosynthetic process(GO:1903966) |
| 0.2 | 0.7 | GO:2000211 | regulation of glutamate metabolic process(GO:2000211) |
| 0.2 | 0.8 | GO:2000741 | positive regulation of mesenchymal stem cell differentiation(GO:2000741) |
| 0.2 | 0.8 | GO:0006526 | arginine biosynthetic process(GO:0006526) |
| 0.2 | 0.6 | GO:0006166 | purine ribonucleoside salvage(GO:0006166) |
| 0.2 | 0.5 | GO:1904380 | endoplasmic reticulum mannose trimming(GO:1904380) |
| 0.2 | 0.5 | GO:0032380 | regulation of intracellular lipid transport(GO:0032377) regulation of intracellular sterol transport(GO:0032380) regulation of intracellular cholesterol transport(GO:0032383) |
| 0.1 | 0.6 | GO:0046449 | creatinine metabolic process(GO:0046449) cellular lactam metabolic process(GO:0072338) |
| 0.1 | 0.4 | GO:0060741 | prostate gland stromal morphogenesis(GO:0060741) |
| 0.1 | 0.4 | GO:1900245 | positive regulation of MDA-5 signaling pathway(GO:1900245) |
| 0.1 | 0.6 | GO:2001013 | epithelial cell proliferation involved in renal tubule morphogenesis(GO:2001013) |
| 0.1 | 0.7 | GO:0060750 | epithelial cell proliferation involved in mammary gland duct elongation(GO:0060750) |
| 0.1 | 1.5 | GO:0009404 | toxin metabolic process(GO:0009404) |
| 0.1 | 0.7 | GO:1901525 | negative regulation of macromitophagy(GO:1901525) |
| 0.1 | 0.5 | GO:0061724 | lipophagy(GO:0061724) |
| 0.1 | 0.9 | GO:0060789 | hair follicle placode formation(GO:0060789) |
| 0.1 | 0.5 | GO:0019805 | quinolinate biosynthetic process(GO:0019805) |
| 0.1 | 0.6 | GO:0046618 | drug export(GO:0046618) |
| 0.1 | 0.4 | GO:0009698 | phenylpropanoid metabolic process(GO:0009698) phenylpropanoid catabolic process(GO:0046271) |
| 0.1 | 0.3 | GO:0070947 | neutrophil mediated killing of fungus(GO:0070947) |
| 0.1 | 0.3 | GO:0003099 | positive regulation of the force of heart contraction by epinephrine-norepinephrine(GO:0001997) positive regulation of the force of heart contraction by chemical signal(GO:0003099) |
| 0.1 | 0.1 | GO:0061153 | trachea submucosa development(GO:0061152) trachea gland development(GO:0061153) |
| 0.1 | 0.3 | GO:0035860 | glial cell-derived neurotrophic factor receptor signaling pathway(GO:0035860) |
| 0.1 | 0.3 | GO:1904690 | regulation of cap-independent translational initiation(GO:1903677) positive regulation of cap-independent translational initiation(GO:1903679) regulation of cytoplasmic translational initiation(GO:1904688) positive regulation of cytoplasmic translational initiation(GO:1904690) |
| 0.1 | 0.3 | GO:0035973 | aggrephagy(GO:0035973) |
| 0.1 | 0.3 | GO:1901078 | negative regulation of relaxation of muscle(GO:1901078) |
| 0.1 | 0.4 | GO:0006987 | activation of signaling protein activity involved in unfolded protein response(GO:0006987) |
| 0.1 | 0.3 | GO:0002309 | T cell proliferation involved in immune response(GO:0002309) |
| 0.1 | 0.4 | GO:0033353 | S-adenosylmethionine cycle(GO:0033353) |
| 0.1 | 0.3 | GO:0006068 | ethanol catabolic process(GO:0006068) |
| 0.1 | 0.3 | GO:0051661 | maintenance of centrosome location(GO:0051661) |
| 0.1 | 0.3 | GO:1903984 | positive regulation of TRAIL-activated apoptotic signaling pathway(GO:1903984) |
| 0.1 | 0.3 | GO:0070340 | detection of bacterial lipopeptide(GO:0070340) |
| 0.1 | 0.3 | GO:0061197 | fungiform papilla morphogenesis(GO:0061197) |
| 0.1 | 0.6 | GO:0033211 | adiponectin-activated signaling pathway(GO:0033211) |
| 0.1 | 0.6 | GO:0015871 | choline transport(GO:0015871) |
| 0.1 | 0.1 | GO:0003162 | atrioventricular node development(GO:0003162) |
| 0.1 | 0.2 | GO:0046874 | quinolinate metabolic process(GO:0046874) |
| 0.1 | 0.3 | GO:0051081 | membrane disassembly(GO:0030397) nuclear envelope disassembly(GO:0051081) |
| 0.1 | 0.4 | GO:0021943 | formation of radial glial scaffolds(GO:0021943) |
| 0.1 | 0.3 | GO:0002282 | microglial cell activation involved in immune response(GO:0002282) |
| 0.1 | 0.4 | GO:0042524 | negative regulation of tyrosine phosphorylation of Stat5 protein(GO:0042524) |
| 0.1 | 0.1 | GO:0070669 | response to interleukin-2(GO:0070669) |
| 0.1 | 0.3 | GO:0001732 | formation of cytoplasmic translation initiation complex(GO:0001732) |
| 0.1 | 0.2 | GO:0003340 | negative regulation of mesenchymal to epithelial transition involved in metanephros morphogenesis(GO:0003340) |
| 0.1 | 0.3 | GO:1902268 | negative regulation of polyamine transmembrane transport(GO:1902268) |
| 0.1 | 0.2 | GO:1904016 | response to Thyroglobulin triiodothyronine(GO:1904016) cellular response to Thyroglobulin triiodothyronine(GO:1904017) |
| 0.1 | 0.2 | GO:0046121 | deoxyribonucleoside catabolic process(GO:0046121) |
| 0.1 | 0.3 | GO:0045900 | negative regulation of translational elongation(GO:0045900) |
| 0.1 | 0.2 | GO:0070782 | phosphatidylserine exposure on apoptotic cell surface(GO:0070782) |
| 0.1 | 0.2 | GO:1901740 | negative regulation of myoblast fusion(GO:1901740) |
| 0.1 | 0.2 | GO:0070672 | response to interleukin-15(GO:0070672) |
| 0.1 | 0.2 | GO:0006982 | response to lipid hydroperoxide(GO:0006982) |
| 0.1 | 0.2 | GO:0048696 | regulation of collateral sprouting in absence of injury(GO:0048696) |
| 0.1 | 0.2 | GO:0046104 | thymidine metabolic process(GO:0046104) |
| 0.1 | 0.5 | GO:0006975 | DNA damage induced protein phosphorylation(GO:0006975) |
| 0.1 | 0.5 | GO:0043102 | amino acid salvage(GO:0043102) L-methionine biosynthetic process(GO:0071265) L-methionine salvage(GO:0071267) |
| 0.1 | 0.4 | GO:0009249 | protein lipoylation(GO:0009249) |
| 0.1 | 1.3 | GO:0001574 | ganglioside biosynthetic process(GO:0001574) |
| 0.1 | 0.4 | GO:0006572 | tyrosine catabolic process(GO:0006572) |
| 0.1 | 0.2 | GO:0060744 | thelarche(GO:0042695) mammary gland branching involved in thelarche(GO:0060744) |
| 0.1 | 0.2 | GO:0097118 | neuroligin clustering involved in postsynaptic membrane assembly(GO:0097118) |
| 0.1 | 0.9 | GO:0009143 | nucleoside triphosphate catabolic process(GO:0009143) |
| 0.1 | 0.2 | GO:0006059 | hexitol metabolic process(GO:0006059) |
| 0.1 | 0.3 | GO:2000189 | positive regulation of cholesterol homeostasis(GO:2000189) |
| 0.1 | 0.2 | GO:0007084 | mitotic nuclear envelope reassembly(GO:0007084) |
| 0.1 | 0.2 | GO:0033031 | positive regulation of neutrophil apoptotic process(GO:0033031) |
| 0.1 | 0.3 | GO:0032488 | Cdc42 protein signal transduction(GO:0032488) |
| 0.1 | 0.2 | GO:0001887 | selenium compound metabolic process(GO:0001887) |
| 0.1 | 0.2 | GO:0097680 | double-strand break repair via classical nonhomologous end joining(GO:0097680) |
| 0.1 | 0.3 | GO:0070562 | regulation of vitamin D receptor signaling pathway(GO:0070562) |
| 0.1 | 0.4 | GO:0097105 | presynaptic membrane assembly(GO:0097105) |
| 0.1 | 0.2 | GO:0030210 | heparin biosynthetic process(GO:0030210) |
| 0.1 | 0.2 | GO:0015770 | disaccharide transport(GO:0015766) sucrose transport(GO:0015770) oligosaccharide transport(GO:0015772) |
| 0.1 | 0.1 | GO:1904339 | negative regulation of dopaminergic neuron differentiation(GO:1904339) |
| 0.1 | 0.1 | GO:0046098 | guanine metabolic process(GO:0046098) |
| 0.1 | 0.4 | GO:0060836 | lymphatic endothelial cell differentiation(GO:0060836) |
| 0.1 | 0.2 | GO:0019478 | D-amino acid catabolic process(GO:0019478) |
| 0.1 | 0.2 | GO:0021564 | vagus nerve development(GO:0021564) |
| 0.1 | 0.1 | GO:0070103 | regulation of interleukin-6-mediated signaling pathway(GO:0070103) |
| 0.1 | 0.3 | GO:0048478 | replication fork protection(GO:0048478) |
| 0.1 | 0.1 | GO:0002155 | thyroid hormone mediated signaling pathway(GO:0002154) regulation of thyroid hormone mediated signaling pathway(GO:0002155) |
| 0.1 | 0.1 | GO:0018879 | biphenyl metabolic process(GO:0018879) |
| 0.1 | 0.1 | GO:0008050 | female courtship behavior(GO:0008050) |
| 0.1 | 0.2 | GO:0006768 | biotin metabolic process(GO:0006768) |
| 0.1 | 0.3 | GO:2001286 | regulation of caveolin-mediated endocytosis(GO:2001286) |
| 0.1 | 0.3 | GO:0042737 | drug catabolic process(GO:0042737) |
| 0.1 | 0.2 | GO:1990086 | lens fiber cell apoptotic process(GO:1990086) |
| 0.1 | 0.3 | GO:0030718 | germ-line stem cell population maintenance(GO:0030718) |
| 0.1 | 0.3 | GO:0061484 | hematopoietic stem cell homeostasis(GO:0061484) |
| 0.1 | 0.2 | GO:0090188 | negative regulation of pancreatic juice secretion(GO:0090188) |
| 0.1 | 0.2 | GO:0060355 | positive regulation of cell adhesion molecule production(GO:0060355) |
| 0.1 | 0.6 | GO:0021670 | lateral ventricle development(GO:0021670) |
| 0.1 | 0.2 | GO:0061366 | behavioral response to chemical pain(GO:0061366) behavioral response to formalin induced pain(GO:0061368) |
| 0.1 | 0.1 | GO:0060528 | secretory columnal luminar epithelial cell differentiation involved in prostate glandular acinus development(GO:0060528) |
| 0.1 | 0.2 | GO:0033615 | mitochondrial proton-transporting ATP synthase complex assembly(GO:0033615) |
| 0.1 | 0.1 | GO:0021524 | visceral motor neuron differentiation(GO:0021524) |
| 0.1 | 0.4 | GO:1902018 | negative regulation of cilium assembly(GO:1902018) |
| 0.1 | 0.3 | GO:1900103 | positive regulation of endoplasmic reticulum unfolded protein response(GO:1900103) |
| 0.1 | 0.5 | GO:0090308 | regulation of methylation-dependent chromatin silencing(GO:0090308) |
| 0.1 | 0.6 | GO:0006851 | mitochondrial calcium ion transport(GO:0006851) |
| 0.1 | 0.1 | GO:0035622 | intrahepatic bile duct development(GO:0035622) |
| 0.1 | 0.2 | GO:0071947 | protein deubiquitination involved in ubiquitin-dependent protein catabolic process(GO:0071947) |
| 0.1 | 0.5 | GO:0033147 | negative regulation of intracellular estrogen receptor signaling pathway(GO:0033147) |
| 0.1 | 0.2 | GO:2000210 | positive regulation of anoikis(GO:2000210) |
| 0.1 | 0.2 | GO:0019344 | cysteine biosynthetic process(GO:0019344) |
| 0.1 | 0.5 | GO:0000459 | exonucleolytic trimming involved in rRNA processing(GO:0000459) exonucleolytic trimming to generate mature 3'-end of 5.8S rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000467) |
| 0.1 | 0.1 | GO:1902474 | positive regulation of protein localization to synapse(GO:1902474) |
| 0.1 | 0.1 | GO:0032741 | positive regulation of interleukin-18 production(GO:0032741) |
| 0.1 | 0.2 | GO:0071930 | negative regulation of transcription involved in G1/S transition of mitotic cell cycle(GO:0071930) |
| 0.1 | 0.4 | GO:0043651 | linoleic acid metabolic process(GO:0043651) |
| 0.1 | 0.7 | GO:0043586 | tongue development(GO:0043586) |
| 0.1 | 0.3 | GO:0010891 | negative regulation of sequestering of triglyceride(GO:0010891) |
| 0.1 | 0.1 | GO:0007354 | zygotic determination of anterior/posterior axis, embryo(GO:0007354) |
| 0.1 | 0.2 | GO:0032497 | detection of lipopolysaccharide(GO:0032497) |
| 0.1 | 0.2 | GO:0006499 | N-terminal protein myristoylation(GO:0006499) |
| 0.1 | 0.3 | GO:0001547 | antral ovarian follicle growth(GO:0001547) |
| 0.1 | 0.1 | GO:0044314 | protein K27-linked ubiquitination(GO:0044314) |
| 0.1 | 0.2 | GO:0007529 | establishment of synaptic specificity at neuromuscular junction(GO:0007529) |
| 0.1 | 0.1 | GO:2000611 | positive regulation of thyroid hormone generation(GO:2000611) |
| 0.1 | 0.2 | GO:2001184 | positive regulation of interleukin-12 secretion(GO:2001184) |
| 0.1 | 0.1 | GO:0046084 | adenine metabolic process(GO:0046083) adenine biosynthetic process(GO:0046084) |
| 0.1 | 0.3 | GO:0098789 | pre-mRNA cleavage required for polyadenylation(GO:0098789) |
| 0.1 | 0.2 | GO:0090155 | negative regulation of sphingolipid biosynthetic process(GO:0090155) cellular sphingolipid homeostasis(GO:0090156) |
| 0.1 | 0.2 | GO:0006546 | glycine catabolic process(GO:0006546) glycine decarboxylation via glycine cleavage system(GO:0019464) |
| 0.1 | 0.2 | GO:0035519 | protein K29-linked ubiquitination(GO:0035519) |
| 0.1 | 0.2 | GO:0000436 | carbon catabolite regulation of transcription from RNA polymerase II promoter(GO:0000429) carbon catabolite activation of transcription from RNA polymerase II promoter(GO:0000436) |
| 0.1 | 0.3 | GO:1900084 | regulation of peptidyl-tyrosine autophosphorylation(GO:1900084) positive regulation of peptidyl-tyrosine autophosphorylation(GO:1900086) |
| 0.1 | 0.2 | GO:0045218 | zonula adherens maintenance(GO:0045218) |
| 0.0 | 0.1 | GO:0006562 | proline catabolic process(GO:0006562) |
| 0.0 | 0.3 | GO:0006517 | protein deglycosylation(GO:0006517) |
| 0.0 | 0.0 | GO:0002071 | glandular epithelial cell maturation(GO:0002071) |
| 0.0 | 0.2 | GO:0034773 | histone H4-K20 trimethylation(GO:0034773) |
| 0.0 | 0.1 | GO:0010606 | positive regulation of cytoplasmic mRNA processing body assembly(GO:0010606) |
| 0.0 | 0.1 | GO:2000574 | regulation of microtubule motor activity(GO:2000574) |
| 0.0 | 0.1 | GO:2000973 | regulation of pro-B cell differentiation(GO:2000973) |
| 0.0 | 0.1 | GO:0006663 | platelet activating factor biosynthetic process(GO:0006663) platelet activating factor metabolic process(GO:0046469) |
| 0.0 | 0.1 | GO:1901165 | positive regulation of trophoblast cell migration(GO:1901165) |
| 0.0 | 0.2 | GO:0010739 | positive regulation of protein kinase A signaling(GO:0010739) |
| 0.0 | 0.1 | GO:0061010 | gall bladder development(GO:0061010) |
| 0.0 | 0.2 | GO:0090168 | Golgi reassembly(GO:0090168) |
| 0.0 | 0.2 | GO:0070236 | negative regulation of activation-induced cell death of T cells(GO:0070236) |
| 0.0 | 0.1 | GO:1902083 | negative regulation of peptidyl-cysteine S-nitrosylation(GO:1902083) |
| 0.0 | 0.4 | GO:0052697 | xenobiotic glucuronidation(GO:0052697) |
| 0.0 | 0.1 | GO:0030382 | sperm mitochondrion organization(GO:0030382) |
| 0.0 | 0.1 | GO:0034421 | post-translational protein acetylation(GO:0034421) |
| 0.0 | 0.5 | GO:0045899 | positive regulation of RNA polymerase II transcriptional preinitiation complex assembly(GO:0045899) |
| 0.0 | 0.2 | GO:1902969 | mitotic DNA replication(GO:1902969) |
| 0.0 | 0.2 | GO:0098535 | de novo centriole assembly(GO:0098535) |
| 0.0 | 0.2 | GO:0045719 | negative regulation of glycogen biosynthetic process(GO:0045719) |
| 0.0 | 0.1 | GO:1900122 | positive regulation of receptor binding(GO:1900122) |
| 0.0 | 0.1 | GO:0001922 | B-1 B cell homeostasis(GO:0001922) |
| 0.0 | 0.2 | GO:0051596 | methylglyoxal catabolic process to D-lactate via S-lactoyl-glutathione(GO:0019243) methylglyoxal catabolic process(GO:0051596) methylglyoxal catabolic process to lactate(GO:0061727) |
| 0.0 | 0.1 | GO:0071680 | response to indole-3-methanol(GO:0071680) cellular response to indole-3-methanol(GO:0071681) |
| 0.0 | 0.1 | GO:0097694 | establishment of RNA localization to telomere(GO:0097694) |
| 0.0 | 0.2 | GO:0089711 | L-glutamate transmembrane transport(GO:0089711) |
| 0.0 | 0.2 | GO:0034756 | regulation of iron ion transport(GO:0034756) |
| 0.0 | 0.2 | GO:0075522 | IRES-dependent viral translational initiation(GO:0075522) |
| 0.0 | 0.1 | GO:2000686 | regulation of rubidium ion transmembrane transporter activity(GO:2000686) |
| 0.0 | 0.5 | GO:0006957 | complement activation, alternative pathway(GO:0006957) |
| 0.0 | 0.2 | GO:0022417 | protein maturation by protein folding(GO:0022417) |
| 0.0 | 0.3 | GO:0035372 | protein localization to microtubule(GO:0035372) |
| 0.0 | 0.1 | GO:0070213 | protein auto-ADP-ribosylation(GO:0070213) |
| 0.0 | 0.0 | GO:0046416 | D-amino acid metabolic process(GO:0046416) |
| 0.0 | 0.2 | GO:0007182 | common-partner SMAD protein phosphorylation(GO:0007182) |
| 0.0 | 0.0 | GO:0071492 | cellular response to UV-A(GO:0071492) |
| 0.0 | 0.2 | GO:0006787 | porphyrin-containing compound catabolic process(GO:0006787) tetrapyrrole catabolic process(GO:0033015) |
| 0.0 | 0.2 | GO:0030388 | fructose 1,6-bisphosphate metabolic process(GO:0030388) |
| 0.0 | 0.1 | GO:0034310 | primary alcohol catabolic process(GO:0034310) |
| 0.0 | 0.0 | GO:0061511 | centriole elongation(GO:0061511) |
| 0.0 | 0.1 | GO:0001831 | trophectodermal cellular morphogenesis(GO:0001831) |
| 0.0 | 0.1 | GO:1904469 | positive regulation of tumor necrosis factor secretion(GO:1904469) |
| 0.0 | 0.0 | GO:0090500 | endocardial cushion to mesenchymal transition(GO:0090500) |
| 0.0 | 0.1 | GO:0015842 | aminergic neurotransmitter loading into synaptic vesicle(GO:0015842) neurotransmitter loading into synaptic vesicle(GO:0098700) |
| 0.0 | 0.0 | GO:0072367 | regulation of lipid transport by regulation of transcription from RNA polymerase II promoter(GO:0072367) |
| 0.0 | 0.0 | GO:0000189 | MAPK import into nucleus(GO:0000189) |
| 0.0 | 0.1 | GO:1901252 | regulation of intracellular transport of viral material(GO:1901252) |
| 0.0 | 0.1 | GO:0006481 | C-terminal protein methylation(GO:0006481) |
| 0.0 | 0.1 | GO:0035672 | oligopeptide transmembrane transport(GO:0035672) |
| 0.0 | 0.3 | GO:0016127 | cholesterol catabolic process(GO:0006707) sterol catabolic process(GO:0016127) |
| 0.0 | 0.1 | GO:2000646 | positive regulation of receptor catabolic process(GO:2000646) |
| 0.0 | 0.2 | GO:0008298 | intracellular mRNA localization(GO:0008298) |
| 0.0 | 0.2 | GO:0006651 | diacylglycerol biosynthetic process(GO:0006651) |
| 0.0 | 0.2 | GO:0006570 | tyrosine metabolic process(GO:0006570) |
| 0.0 | 0.2 | GO:1903553 | positive regulation of extracellular exosome assembly(GO:1903553) |
| 0.0 | 0.2 | GO:0042997 | negative regulation of Golgi to plasma membrane protein transport(GO:0042997) |
| 0.0 | 0.3 | GO:0045607 | regulation of auditory receptor cell differentiation(GO:0045607) regulation of mechanoreceptor differentiation(GO:0045631) regulation of inner ear receptor cell differentiation(GO:2000980) |
| 0.0 | 0.1 | GO:0060839 | endothelial cell fate commitment(GO:0060839) |
| 0.0 | 0.1 | GO:1903232 | melanosome assembly(GO:1903232) |
| 0.0 | 0.1 | GO:0006177 | GMP biosynthetic process(GO:0006177) |
| 0.0 | 0.1 | GO:0002051 | osteoblast fate commitment(GO:0002051) |
| 0.0 | 0.1 | GO:0001827 | inner cell mass cell fate commitment(GO:0001827) |
| 0.0 | 0.5 | GO:0042744 | hydrogen peroxide catabolic process(GO:0042744) |
| 0.0 | 0.0 | GO:0034770 | histone H4-K20 methylation(GO:0034770) |
| 0.0 | 0.1 | GO:0007567 | parturition(GO:0007567) |
| 0.0 | 0.2 | GO:0007256 | activation of JNKK activity(GO:0007256) |
| 0.0 | 0.3 | GO:0035646 | endosome to melanosome transport(GO:0035646) endosome to pigment granule transport(GO:0043485) pigment granule maturation(GO:0048757) |
| 0.0 | 0.1 | GO:0008582 | regulation of synaptic growth at neuromuscular junction(GO:0008582) |
| 0.0 | 0.1 | GO:0035434 | copper ion transmembrane transport(GO:0035434) |
| 0.0 | 0.1 | GO:0051136 | regulation of NK T cell differentiation(GO:0051136) positive regulation of NK T cell differentiation(GO:0051138) |
| 0.0 | 0.3 | GO:0000290 | deadenylation-dependent decapping of nuclear-transcribed mRNA(GO:0000290) |
| 0.0 | 0.1 | GO:0019230 | proprioception(GO:0019230) |
| 0.0 | 0.1 | GO:0048382 | mesendoderm development(GO:0048382) |
| 0.0 | 0.4 | GO:0045176 | apical protein localization(GO:0045176) |
| 0.0 | 0.0 | GO:0006543 | glutamine catabolic process(GO:0006543) |
| 0.0 | 0.1 | GO:0070837 | dehydroascorbic acid transport(GO:0070837) |
| 0.0 | 0.1 | GO:0030638 | polyketide metabolic process(GO:0030638) aminoglycoside antibiotic metabolic process(GO:0030647) daunorubicin metabolic process(GO:0044597) doxorubicin metabolic process(GO:0044598) |
| 0.0 | 0.1 | GO:0052200 | response to defenses of other organism involved in symbiotic interaction(GO:0052173) response to host defenses(GO:0052200) response to host(GO:0075136) |
| 0.0 | 0.1 | GO:1904468 | negative regulation of tumor necrosis factor secretion(GO:1904468) |
| 0.0 | 0.1 | GO:0001712 | ectodermal cell fate commitment(GO:0001712) |
| 0.0 | 0.1 | GO:0007296 | vitellogenesis(GO:0007296) |
| 0.0 | 0.0 | GO:0009106 | lipoate metabolic process(GO:0009106) |
| 0.0 | 0.1 | GO:0009957 | epidermal cell fate specification(GO:0009957) |
| 0.0 | 0.1 | GO:2000504 | positive regulation of blood vessel remodeling(GO:2000504) |
| 0.0 | 0.2 | GO:0090136 | epithelial cell-cell adhesion(GO:0090136) |
| 0.0 | 0.4 | GO:0001886 | endothelial cell morphogenesis(GO:0001886) |
| 0.0 | 0.2 | GO:0006655 | phosphatidylglycerol biosynthetic process(GO:0006655) |
| 0.0 | 0.1 | GO:0043490 | malate-aspartate shuttle(GO:0043490) |
| 0.0 | 0.1 | GO:0044339 | canonical Wnt signaling pathway involved in osteoblast differentiation(GO:0044339) |
| 0.0 | 0.3 | GO:0006670 | sphingosine metabolic process(GO:0006670) |
| 0.0 | 0.0 | GO:0021861 | forebrain radial glial cell differentiation(GO:0021861) |
| 0.0 | 0.2 | GO:0034382 | chylomicron remnant clearance(GO:0034382) triglyceride-rich lipoprotein particle clearance(GO:0071830) |
| 0.0 | 0.2 | GO:0009435 | NAD biosynthetic process(GO:0009435) |
| 0.0 | 0.2 | GO:1990592 | protein polyufmylation(GO:1990564) protein K69-linked ufmylation(GO:1990592) |
| 0.0 | 0.1 | GO:0060352 | cell adhesion molecule production(GO:0060352) |
| 0.0 | 0.1 | GO:0006537 | glutamate biosynthetic process(GO:0006537) |
| 0.0 | 0.3 | GO:0048026 | positive regulation of mRNA splicing, via spliceosome(GO:0048026) |
| 0.0 | 0.1 | GO:2000074 | regulation of type B pancreatic cell development(GO:2000074) |
| 0.0 | 0.1 | GO:0071455 | cellular response to increased oxygen levels(GO:0036295) cellular response to hyperoxia(GO:0071455) |
| 0.0 | 0.1 | GO:0071895 | odontoblast differentiation(GO:0071895) |
| 0.0 | 0.1 | GO:0072093 | metanephric renal vesicle formation(GO:0072093) |
| 0.0 | 0.4 | GO:0045116 | protein neddylation(GO:0045116) |
| 0.0 | 0.2 | GO:0008295 | spermidine biosynthetic process(GO:0008295) |
| 0.0 | 0.2 | GO:0051561 | positive regulation of mitochondrial calcium ion concentration(GO:0051561) |
| 0.0 | 0.2 | GO:0070072 | vacuolar proton-transporting V-type ATPase complex assembly(GO:0070072) |
| 0.0 | 0.2 | GO:0035459 | cargo loading into vesicle(GO:0035459) |
| 0.0 | 0.1 | GO:0090037 | positive regulation of protein kinase C signaling(GO:0090037) |
| 0.0 | 0.0 | GO:1901897 | regulation of relaxation of cardiac muscle(GO:1901897) |
| 0.0 | 0.2 | GO:0048643 | positive regulation of skeletal muscle tissue development(GO:0048643) |
| 0.0 | 0.1 | GO:0046167 | glycerol-3-phosphate biosynthetic process(GO:0046167) |
| 0.0 | 0.1 | GO:1903347 | negative regulation of bicellular tight junction assembly(GO:1903347) |
| 0.0 | 0.1 | GO:1903999 | negative regulation of eating behavior(GO:1903999) |
| 0.0 | 0.3 | GO:0048742 | regulation of skeletal muscle fiber development(GO:0048742) |
| 0.0 | 0.0 | GO:0072592 | oxygen metabolic process(GO:0072592) |
| 0.0 | 0.0 | GO:2001170 | negative regulation of ATP biosynthetic process(GO:2001170) |
| 0.0 | 0.1 | GO:0061589 | calcium activated phosphatidylserine scrambling(GO:0061589) |
| 0.0 | 0.1 | GO:0010693 | negative regulation of alkaline phosphatase activity(GO:0010693) |
| 0.0 | 0.2 | GO:0090005 | negative regulation of establishment of protein localization to plasma membrane(GO:0090005) |
| 0.0 | 0.1 | GO:0036135 | Schwann cell migration(GO:0036135) regulation of Schwann cell migration(GO:1900147) |
| 0.0 | 0.1 | GO:0015959 | diadenosine polyphosphate metabolic process(GO:0015959) |
| 0.0 | 0.2 | GO:0051574 | positive regulation of histone H3-K9 methylation(GO:0051574) |
| 0.0 | 0.1 | GO:0072513 | positive regulation of secondary heart field cardioblast proliferation(GO:0072513) |
| 0.0 | 0.1 | GO:2000370 | positive regulation of clathrin-mediated endocytosis(GO:2000370) |
| 0.0 | 0.2 | GO:0038180 | nerve growth factor signaling pathway(GO:0038180) |
| 0.0 | 0.1 | GO:0036022 | limb joint morphogenesis(GO:0036022) embryonic skeletal limb joint morphogenesis(GO:0036023) |
| 0.0 | 0.1 | GO:0006106 | fumarate metabolic process(GO:0006106) |
| 0.0 | 0.1 | GO:1902897 | regulation of postsynaptic density protein 95 clustering(GO:1902897) |
| 0.0 | 0.9 | GO:0000381 | regulation of alternative mRNA splicing, via spliceosome(GO:0000381) |
| 0.0 | 0.1 | GO:0006573 | valine metabolic process(GO:0006573) |
| 0.0 | 0.2 | GO:0060267 | positive regulation of respiratory burst(GO:0060267) |
| 0.0 | 0.7 | GO:0032728 | positive regulation of interferon-beta production(GO:0032728) |
| 0.0 | 0.1 | GO:2000427 | positive regulation of apoptotic cell clearance(GO:2000427) |
| 0.0 | 0.0 | GO:0009155 | purine deoxyribonucleotide catabolic process(GO:0009155) |
| 0.0 | 0.0 | GO:1904833 | positive regulation of superoxide dismutase activity(GO:1901671) positive regulation of removal of superoxide radicals(GO:1904833) |
| 0.0 | 0.1 | GO:0045041 | protein import into mitochondrial intermembrane space(GO:0045041) |
| 0.0 | 0.2 | GO:1901339 | regulation of store-operated calcium channel activity(GO:1901339) |
| 0.0 | 0.2 | GO:0000012 | single strand break repair(GO:0000012) |
| 0.0 | 0.0 | GO:0060028 | convergent extension involved in axis elongation(GO:0060028) |
| 0.0 | 0.1 | GO:0035093 | spermatogenesis, exchange of chromosomal proteins(GO:0035093) |
| 0.0 | 0.1 | GO:1902035 | positive regulation of hematopoietic stem cell proliferation(GO:1902035) |
| 0.0 | 0.1 | GO:0090091 | positive regulation of extracellular matrix disassembly(GO:0090091) |
| 0.0 | 0.2 | GO:0030854 | positive regulation of granulocyte differentiation(GO:0030854) |
| 0.0 | 0.1 | GO:0071336 | regulation of hair follicle cell proliferation(GO:0071336) |
| 0.0 | 0.0 | GO:1901187 | regulation of ephrin receptor signaling pathway(GO:1901187) |
| 0.0 | 0.2 | GO:0001672 | regulation of chromatin assembly or disassembly(GO:0001672) |
| 0.0 | 0.1 | GO:1904751 | regulation of protein localization to nucleolus(GO:1904749) positive regulation of protein localization to nucleolus(GO:1904751) |
| 0.0 | 0.1 | GO:0002036 | regulation of L-glutamate transport(GO:0002036) |
| 0.0 | 0.1 | GO:1902177 | positive regulation of oxidative stress-induced intrinsic apoptotic signaling pathway(GO:1902177) |
| 0.0 | 0.1 | GO:0033387 | putrescine biosynthetic process(GO:0009446) putrescine biosynthetic process from ornithine(GO:0033387) |
| 0.0 | 0.0 | GO:0045726 | positive regulation of integrin biosynthetic process(GO:0045726) |
| 0.0 | 0.2 | GO:0060037 | pharyngeal system development(GO:0060037) |
| 0.0 | 0.1 | GO:0035627 | ceramide transport(GO:0035627) |
| 0.0 | 0.2 | GO:0043144 | snoRNA processing(GO:0043144) |
| 0.0 | 0.1 | GO:0006741 | NADP biosynthetic process(GO:0006741) |
| 0.0 | 0.1 | GO:0001842 | neural fold formation(GO:0001842) |
| 0.0 | 0.1 | GO:0032482 | Rab protein signal transduction(GO:0032482) |
| 0.0 | 0.1 | GO:2000653 | regulation of genetic imprinting(GO:2000653) |
| 0.0 | 0.1 | GO:0018317 | protein C-linked glycosylation(GO:0018103) peptidyl-tryptophan modification(GO:0018211) protein C-linked glycosylation via tryptophan(GO:0018317) protein C-linked glycosylation via 2'-alpha-mannosyl-L-tryptophan(GO:0018406) |
| 0.0 | 0.0 | GO:0046101 | hypoxanthine metabolic process(GO:0046100) hypoxanthine biosynthetic process(GO:0046101) |
| 0.0 | 0.2 | GO:0043486 | histone exchange(GO:0043486) |
| 0.0 | 0.1 | GO:1903975 | regulation of glial cell migration(GO:1903975) |
| 0.0 | 0.1 | GO:2000591 | cell migration involved in kidney development(GO:0035787) cell migration involved in metanephros development(GO:0035788) metanephric mesenchymal cell migration(GO:0035789) positive regulation of metanephric mesenchymal cell migration by platelet-derived growth factor receptor-beta signaling pathway(GO:0035793) regulation of metanephric mesenchymal cell migration by platelet-derived growth factor receptor-beta signaling pathway(GO:1900238) regulation of metanephric mesenchymal cell migration(GO:2000589) positive regulation of metanephric mesenchymal cell migration(GO:2000591) |
| 0.0 | 0.1 | GO:0043415 | positive regulation of skeletal muscle tissue regeneration(GO:0043415) |
| 0.0 | 0.1 | GO:0043174 | nucleoside salvage(GO:0043174) |
| 0.0 | 0.2 | GO:0035999 | tetrahydrofolate interconversion(GO:0035999) |
| 0.0 | 0.1 | GO:1902261 | positive regulation of delayed rectifier potassium channel activity(GO:1902261) positive regulation of voltage-gated potassium channel activity(GO:1903818) |
| 0.0 | 0.1 | GO:0045217 | cell-cell junction maintenance(GO:0045217) |
| 0.0 | 0.0 | GO:0097212 | lysosomal membrane organization(GO:0097212) |
| 0.0 | 0.1 | GO:0019086 | late viral transcription(GO:0019086) |
| 0.0 | 0.2 | GO:0010875 | positive regulation of cholesterol efflux(GO:0010875) |
| 0.0 | 0.1 | GO:0030050 | vesicle transport along actin filament(GO:0030050) |
| 0.0 | 0.2 | GO:0044827 | modulation by host of viral genome replication(GO:0044827) |
| 0.0 | 0.1 | GO:0018125 | peptidyl-cysteine methylation(GO:0018125) |
| 0.0 | 0.1 | GO:1900126 | negative regulation of hyaluronan biosynthetic process(GO:1900126) |
| 0.0 | 0.0 | GO:0090283 | regulation of protein glycosylation in Golgi(GO:0090283) |
| 0.0 | 0.1 | GO:0031468 | nuclear envelope reassembly(GO:0031468) |
| 0.0 | 0.2 | GO:0006283 | transcription-coupled nucleotide-excision repair(GO:0006283) |
| 0.0 | 0.1 | GO:0046864 | retinol transport(GO:0034633) isoprenoid transport(GO:0046864) terpenoid transport(GO:0046865) |
| 0.0 | 0.1 | GO:0001560 | regulation of cell growth by extracellular stimulus(GO:0001560) |
| 0.0 | 0.1 | GO:1903774 | positive regulation of viral budding via host ESCRT complex(GO:1903774) |
| 0.0 | 0.1 | GO:0090043 | regulation of tubulin deacetylation(GO:0090043) |
| 0.0 | 0.1 | GO:0070475 | rRNA base methylation(GO:0070475) |
| 0.0 | 0.4 | GO:0007026 | negative regulation of microtubule depolymerization(GO:0007026) |
| 0.0 | 0.2 | GO:0032957 | inositol trisphosphate metabolic process(GO:0032957) |
| 0.0 | 0.1 | GO:0072531 | pyrimidine-containing compound transmembrane transport(GO:0072531) |
| 0.0 | 0.1 | GO:0048341 | paraxial mesoderm formation(GO:0048341) |
| 0.0 | 0.1 | GO:0006703 | estrogen biosynthetic process(GO:0006703) |
| 0.0 | 0.1 | GO:0006420 | arginyl-tRNA aminoacylation(GO:0006420) |
| 0.0 | 0.1 | GO:0090051 | negative regulation of cell migration involved in sprouting angiogenesis(GO:0090051) |
| 0.0 | 0.2 | GO:0032780 | negative regulation of ATPase activity(GO:0032780) |
| 0.0 | 0.1 | GO:0072602 | interleukin-4 secretion(GO:0072602) |
| 0.0 | 0.0 | GO:0008105 | asymmetric protein localization(GO:0008105) |
| 0.0 | 0.1 | GO:0035810 | positive regulation of urine volume(GO:0035810) |
| 0.0 | 0.1 | GO:0009235 | cobalamin metabolic process(GO:0009235) |
| 0.0 | 0.0 | GO:0010958 | regulation of amino acid import(GO:0010958) |
| 0.0 | 0.1 | GO:0000055 | ribosomal large subunit export from nucleus(GO:0000055) |
| 0.0 | 0.2 | GO:2001256 | regulation of store-operated calcium entry(GO:2001256) |
| 0.0 | 0.1 | GO:1904354 | negative regulation of telomere capping(GO:1904354) |
| 0.0 | 0.1 | GO:0045647 | negative regulation of erythrocyte differentiation(GO:0045647) |
| 0.0 | 0.1 | GO:0071494 | cellular response to UV-C(GO:0071494) |
| 0.0 | 0.0 | GO:0038145 | macrophage colony-stimulating factor signaling pathway(GO:0038145) regulation of macrophage colony-stimulating factor signaling pathway(GO:1902226) regulation of response to macrophage colony-stimulating factor(GO:1903969) regulation of cellular response to macrophage colony-stimulating factor stimulus(GO:1903972) |
| 0.0 | 0.1 | GO:0070544 | histone H3-K36 demethylation(GO:0070544) |
| 0.0 | 0.1 | GO:2000224 | regulation of testosterone biosynthetic process(GO:2000224) |
| 0.0 | 0.1 | GO:1903660 | regulation of complement-dependent cytotoxicity(GO:1903659) negative regulation of complement-dependent cytotoxicity(GO:1903660) |
| 0.0 | 0.1 | GO:0086023 | adrenergic receptor signaling pathway involved in heart process(GO:0086023) |
| 0.0 | 0.1 | GO:0046684 | response to pyrethroid(GO:0046684) |
| 0.0 | 0.4 | GO:0019068 | virion assembly(GO:0019068) |
| 0.0 | 0.0 | GO:1903671 | negative regulation of sprouting angiogenesis(GO:1903671) |
| 0.0 | 0.3 | GO:0017144 | drug metabolic process(GO:0017144) |
| 0.0 | 0.0 | GO:2000409 | positive regulation of T cell extravasation(GO:2000409) |
| 0.0 | 0.3 | GO:0015985 | energy coupled proton transport, down electrochemical gradient(GO:0015985) ATP synthesis coupled proton transport(GO:0015986) |
| 0.0 | 0.1 | GO:0019919 | peptidyl-arginine methylation, to asymmetrical-dimethyl arginine(GO:0019919) |
| 0.0 | 0.0 | GO:0001880 | Mullerian duct regression(GO:0001880) |
| 0.0 | 0.1 | GO:0090315 | negative regulation of protein targeting to membrane(GO:0090315) |
| 0.0 | 0.1 | GO:0051013 | microtubule severing(GO:0051013) |
| 0.0 | 0.2 | GO:2000010 | positive regulation of protein localization to cell surface(GO:2000010) |
| 0.0 | 0.2 | GO:1904294 | positive regulation of ERAD pathway(GO:1904294) |
| 0.0 | 0.1 | GO:0033234 | negative regulation of protein sumoylation(GO:0033234) |
| 0.0 | 0.3 | GO:0006491 | N-glycan processing(GO:0006491) |
| 0.0 | 0.1 | GO:0006363 | termination of RNA polymerase I transcription(GO:0006363) |
| 0.0 | 0.1 | GO:0015074 | DNA integration(GO:0015074) |
| 0.0 | 0.0 | GO:2000645 | negative regulation of receptor catabolic process(GO:2000645) |
| 0.0 | 0.2 | GO:0006878 | cellular copper ion homeostasis(GO:0006878) |
| 0.0 | 0.1 | GO:0000957 | mitochondrial RNA catabolic process(GO:0000957) regulation of mitochondrial RNA catabolic process(GO:0000960) |
| 0.0 | 0.0 | GO:0042138 | meiotic DNA double-strand break formation(GO:0042138) |
| 0.0 | 0.1 | GO:0043569 | negative regulation of insulin-like growth factor receptor signaling pathway(GO:0043569) |
| 0.0 | 0.1 | GO:0009629 | response to gravity(GO:0009629) |
| 0.0 | 0.2 | GO:0000729 | DNA double-strand break processing(GO:0000729) |
| 0.0 | 0.0 | GO:0019676 | ammonia assimilation cycle(GO:0019676) |
| 0.0 | 0.0 | GO:0002215 | defense response to nematode(GO:0002215) |
| 0.0 | 0.1 | GO:0061303 | cornea development in camera-type eye(GO:0061303) |
| 0.0 | 0.3 | GO:0006465 | signal peptide processing(GO:0006465) |
| 0.0 | 0.1 | GO:0017196 | N-terminal peptidyl-methionine acetylation(GO:0017196) |
| 0.0 | 0.0 | GO:0010901 | regulation of very-low-density lipoprotein particle remodeling(GO:0010901) |
| 0.0 | 0.1 | GO:0009256 | 10-formyltetrahydrofolate metabolic process(GO:0009256) |
| 0.0 | 0.1 | GO:0048671 | negative regulation of collateral sprouting(GO:0048671) |
| 0.0 | 0.0 | GO:0010040 | response to iron(II) ion(GO:0010040) |
| 0.0 | 0.0 | GO:0003176 | aortic valve development(GO:0003176) aortic valve morphogenesis(GO:0003180) |
| 0.0 | 0.3 | GO:0003309 | type B pancreatic cell differentiation(GO:0003309) |
| 0.0 | 0.1 | GO:0090241 | negative regulation of histone H4 acetylation(GO:0090241) |
| 0.0 | 0.0 | GO:0032696 | negative regulation of interleukin-13 production(GO:0032696) |
| 0.0 | 0.1 | GO:0008063 | Toll signaling pathway(GO:0008063) |
| 0.0 | 0.0 | GO:0071698 | olfactory placode formation(GO:0030910) olfactory placode development(GO:0071698) olfactory placode morphogenesis(GO:0071699) |
| 0.0 | 0.1 | GO:0048388 | endosomal lumen acidification(GO:0048388) |
| 0.0 | 0.0 | GO:0018197 | peptidyl-aspartic acid modification(GO:0018197) |
| 0.0 | 0.1 | GO:0009052 | pentose-phosphate shunt, non-oxidative branch(GO:0009052) |
| 0.0 | 0.1 | GO:1902514 | regulation of calcium ion transmembrane transport via high voltage-gated calcium channel(GO:1902514) |
| 0.0 | 0.3 | GO:0000413 | protein peptidyl-prolyl isomerization(GO:0000413) |
| 0.0 | 0.1 | GO:0006591 | ornithine metabolic process(GO:0006591) |
| 0.0 | 0.1 | GO:0010988 | regulation of low-density lipoprotein particle clearance(GO:0010988) |
| 0.0 | 0.2 | GO:0060546 | negative regulation of necroptotic process(GO:0060546) |
| 0.0 | 0.0 | GO:0045091 | regulation of single stranded viral RNA replication via double stranded DNA intermediate(GO:0045091) |
| 0.0 | 0.1 | GO:0035542 | regulation of SNARE complex assembly(GO:0035542) |
| 0.0 | 0.0 | GO:1902805 | positive regulation of synaptic vesicle transport(GO:1902805) positive regulation of synaptic vesicle recycling(GO:1903423) |
| 0.0 | 0.1 | GO:1902410 | mitotic cytokinetic process(GO:1902410) |
| 0.0 | 0.4 | GO:0010569 | regulation of double-strand break repair via homologous recombination(GO:0010569) |
| 0.0 | 0.3 | GO:0003085 | negative regulation of systemic arterial blood pressure(GO:0003085) |
| 0.0 | 0.1 | GO:0061072 | iris morphogenesis(GO:0061072) |
| 0.0 | 0.1 | GO:0016561 | protein import into peroxisome matrix, translocation(GO:0016561) |
| 0.0 | 0.1 | GO:1904424 | regulation of GTP binding(GO:1904424) |
| 0.0 | 0.1 | GO:0010387 | COP9 signalosome assembly(GO:0010387) |
| 0.0 | 0.1 | GO:0021684 | cerebellar granular layer formation(GO:0021684) cerebellar granule cell differentiation(GO:0021707) |
| 0.0 | 0.3 | GO:0006805 | xenobiotic metabolic process(GO:0006805) |
| 0.0 | 0.0 | GO:0048320 | axial mesoderm formation(GO:0048320) |
| 0.0 | 0.0 | GO:1904970 | brush border assembly(GO:1904970) |
| 0.0 | 0.1 | GO:0032304 | negative regulation of icosanoid secretion(GO:0032304) |
| 0.0 | 0.1 | GO:0006104 | succinyl-CoA metabolic process(GO:0006104) |
| 0.0 | 0.1 | GO:1902414 | protein localization to cell junction(GO:1902414) |
| 0.0 | 0.0 | GO:0000966 | RNA 5'-end processing(GO:0000966) |
| 0.0 | 0.0 | GO:0000255 | allantoin metabolic process(GO:0000255) |
| 0.0 | 0.1 | GO:0006393 | termination of mitochondrial transcription(GO:0006393) |
| 0.0 | 0.1 | GO:2000503 | positive regulation of natural killer cell chemotaxis(GO:2000503) |
| 0.0 | 0.1 | GO:0045852 | pH elevation(GO:0045852) intracellular pH elevation(GO:0051454) |
| 0.0 | 0.2 | GO:0030432 | peristalsis(GO:0030432) |
| 0.0 | 0.1 | GO:0030321 | transepithelial chloride transport(GO:0030321) |
| 0.0 | 0.0 | GO:0018343 | protein farnesylation(GO:0018343) |
| 0.0 | 0.1 | GO:0033327 | Leydig cell differentiation(GO:0033327) |
| 0.0 | 0.1 | GO:1905038 | regulation of sphingolipid biosynthetic process(GO:0090153) regulation of membrane lipid metabolic process(GO:1905038) |
| 0.0 | 0.1 | GO:0090557 | establishment of endothelial intestinal barrier(GO:0090557) |
| 0.0 | 0.1 | GO:0032906 | transforming growth factor beta2 production(GO:0032906) regulation of transforming growth factor beta2 production(GO:0032909) |
| 0.0 | 0.2 | GO:0045793 | positive regulation of cell size(GO:0045793) |
| 0.0 | 0.2 | GO:0043496 | regulation of protein homodimerization activity(GO:0043496) |
| 0.0 | 0.0 | GO:1900019 | regulation of protein kinase C activity(GO:1900019) positive regulation of protein kinase C activity(GO:1900020) |
| 0.0 | 0.1 | GO:0042045 | epithelial fluid transport(GO:0042045) |
| 0.0 | 0.1 | GO:0060054 | positive regulation of epithelial cell proliferation involved in wound healing(GO:0060054) |
| 0.0 | 0.0 | GO:1904059 | regulation of locomotor rhythm(GO:1904059) |
| 0.0 | 0.1 | GO:0006287 | base-excision repair, gap-filling(GO:0006287) |
| 0.0 | 0.1 | GO:0036112 | medium-chain fatty-acyl-CoA metabolic process(GO:0036112) |
| 0.0 | 0.2 | GO:0045947 | negative regulation of translational initiation(GO:0045947) |
| 0.0 | 0.1 | GO:0033601 | positive regulation of mammary gland epithelial cell proliferation(GO:0033601) |
| 0.0 | 0.1 | GO:0042726 | flavin-containing compound metabolic process(GO:0042726) |
| 0.0 | 0.1 | GO:0019740 | nitrogen utilization(GO:0019740) |
| 0.0 | 0.1 | GO:0043568 | positive regulation of insulin-like growth factor receptor signaling pathway(GO:0043568) |
| 0.0 | 0.2 | GO:0003334 | keratinocyte development(GO:0003334) |
| 0.0 | 0.1 | GO:0051123 | RNA polymerase II transcriptional preinitiation complex assembly(GO:0051123) |
| 0.0 | 0.1 | GO:0009312 | oligosaccharide biosynthetic process(GO:0009312) |
| 0.0 | 0.1 | GO:0006451 | selenocysteine incorporation(GO:0001514) translational readthrough(GO:0006451) |
| 0.0 | 0.1 | GO:0052405 | negative regulation by host of symbiont molecular function(GO:0052405) modification by host of symbiont molecular function(GO:0052428) |
| 0.0 | 0.2 | GO:0018279 | protein N-linked glycosylation via asparagine(GO:0018279) |
| 0.0 | 0.1 | GO:0034227 | tRNA thio-modification(GO:0034227) |
| 0.0 | 0.1 | GO:0002934 | desmosome organization(GO:0002934) |
| 0.0 | 0.0 | GO:0060693 | regulation of branching involved in salivary gland morphogenesis(GO:0060693) |
| 0.0 | 0.0 | GO:0014826 | vein smooth muscle contraction(GO:0014826) |
| 0.0 | 0.0 | GO:0061002 | negative regulation of dendritic spine morphogenesis(GO:0061002) |
| 0.0 | 0.0 | GO:0017187 | peptidyl-glutamic acid carboxylation(GO:0017187) |
| 0.0 | 0.0 | GO:0003415 | chondrocyte hypertrophy(GO:0003415) |
| 0.0 | 0.1 | GO:0060900 | embryonic camera-type eye formation(GO:0060900) |
| 0.0 | 0.1 | GO:0042795 | snRNA transcription from RNA polymerase II promoter(GO:0042795) |
| 0.0 | 0.0 | GO:1990928 | response to amino acid starvation(GO:1990928) |
| 0.0 | 0.0 | GO:1901674 | histone H3-K27 acetylation(GO:0043974) regulation of histone H3-K27 acetylation(GO:1901674) |
| 0.0 | 0.1 | GO:0046037 | GMP metabolic process(GO:0046037) |
| 0.0 | 0.0 | GO:0006933 | negative regulation of cell adhesion involved in substrate-bound cell migration(GO:0006933) |
| 0.0 | 0.2 | GO:0042407 | cristae formation(GO:0042407) |
| 0.0 | 0.0 | GO:0072205 | metanephric collecting duct development(GO:0072205) |
| 0.0 | 0.0 | GO:0017121 | phospholipid scrambling(GO:0017121) |
| 0.0 | 0.0 | GO:0051683 | establishment of Golgi localization(GO:0051683) |
| 0.0 | 0.1 | GO:0015015 | heparan sulfate proteoglycan biosynthetic process, enzymatic modification(GO:0015015) |
| 0.0 | 0.0 | GO:0009130 | UMP biosynthetic process(GO:0006222) pyrimidine nucleoside monophosphate biosynthetic process(GO:0009130) pyrimidine ribonucleoside monophosphate metabolic process(GO:0009173) pyrimidine ribonucleoside monophosphate biosynthetic process(GO:0009174) UMP metabolic process(GO:0046049) |
| 0.0 | 0.1 | GO:0080111 | DNA demethylation(GO:0080111) |
| 0.0 | 0.0 | GO:0000019 | regulation of mitotic recombination(GO:0000019) negative regulation of mitotic recombination(GO:0045950) |
| 0.0 | 0.0 | GO:0031937 | positive regulation of chromatin silencing(GO:0031937) |
| 0.0 | 0.1 | GO:0050916 | sensory perception of sweet taste(GO:0050916) |
| 0.0 | 0.1 | GO:0039694 | viral RNA genome replication(GO:0039694) RNA replication(GO:0039703) |
| 0.0 | 0.0 | GO:0090292 | nuclear matrix organization(GO:0043578) nuclear matrix anchoring at nuclear membrane(GO:0090292) |
| 0.0 | 0.0 | GO:0009794 | regulation of mitotic cell cycle, embryonic(GO:0009794) mitotic cell cycle, embryonic(GO:0045448) |
| 0.0 | 0.0 | GO:0060684 | epithelial-mesenchymal cell signaling(GO:0060684) |
| 0.0 | 0.1 | GO:0002115 | store-operated calcium entry(GO:0002115) |
| 0.0 | 0.1 | GO:0006335 | DNA replication-dependent nucleosome assembly(GO:0006335) DNA replication-dependent nucleosome organization(GO:0034723) |
| 0.0 | 0.0 | GO:0035694 | mitochondrial protein catabolic process(GO:0035694) |
| 0.0 | 0.0 | GO:0045416 | positive regulation of interleukin-8 biosynthetic process(GO:0045416) |
| 0.0 | 0.1 | GO:0010944 | negative regulation of transcription by competitive promoter binding(GO:0010944) |
| 0.0 | 0.0 | GO:0070889 | platelet alpha granule organization(GO:0070889) |
| 0.0 | 0.0 | GO:0010936 | negative regulation of macrophage cytokine production(GO:0010936) |
| 0.0 | 0.0 | GO:1902915 | negative regulation of protein K63-linked ubiquitination(GO:1900045) negative regulation of protein polyubiquitination(GO:1902915) |
| 0.0 | 0.0 | GO:1900738 | positive regulation of phospholipase C-activating G-protein coupled receptor signaling pathway(GO:1900738) |
| 0.0 | 0.1 | GO:0031000 | response to caffeine(GO:0031000) |
| 0.0 | 0.1 | GO:0060083 | smooth muscle contraction involved in micturition(GO:0060083) |
| 0.0 | 0.0 | GO:0071025 | RNA surveillance(GO:0071025) |
| 0.0 | 0.1 | GO:0003376 | sphingosine-1-phosphate signaling pathway(GO:0003376) |
| 0.0 | 0.0 | GO:0090503 | RNA phosphodiester bond hydrolysis, exonucleolytic(GO:0090503) |
| 0.0 | 0.0 | GO:0014732 | skeletal muscle atrophy(GO:0014732) |
| 0.0 | 0.1 | GO:0050862 | positive regulation of T cell receptor signaling pathway(GO:0050862) |
| 0.0 | 0.1 | GO:1903025 | regulation of RNA polymerase II regulatory region sequence-specific DNA binding(GO:1903025) |
| 0.0 | 0.1 | GO:0090209 | negative regulation of triglyceride metabolic process(GO:0090209) |
| 0.0 | 0.1 | GO:0032305 | positive regulation of icosanoid secretion(GO:0032305) regulation of prostaglandin secretion(GO:0032306) positive regulation of prostaglandin secretion(GO:0032308) |
| 0.0 | 0.1 | GO:0008053 | mitochondrial fusion(GO:0008053) |
| 0.0 | 0.0 | GO:0070814 | hydrogen sulfide biosynthetic process(GO:0070814) |
| 0.0 | 0.0 | GO:0031118 | rRNA pseudouridine synthesis(GO:0031118) |
| 0.0 | 0.1 | GO:0043162 | ubiquitin-dependent protein catabolic process via the multivesicular body sorting pathway(GO:0043162) |
| 0.0 | 0.1 | GO:0000244 | spliceosomal tri-snRNP complex assembly(GO:0000244) |
| 0.0 | 0.0 | GO:0030950 | establishment or maintenance of actin cytoskeleton polarity(GO:0030950) |
| 0.0 | 0.2 | GO:0019184 | nonribosomal peptide biosynthetic process(GO:0019184) |
| 0.0 | 0.0 | GO:0003222 | ventricular trabecula myocardium morphogenesis(GO:0003222) |
| 0.0 | 0.1 | GO:0044038 | cell wall mannoprotein biosynthetic process(GO:0000032) mannoprotein metabolic process(GO:0006056) mannoprotein biosynthetic process(GO:0006057) cell wall glycoprotein biosynthetic process(GO:0031506) cell wall biogenesis(GO:0042546) cell wall macromolecule biosynthetic process(GO:0044038) chain elongation of O-linked mannose residue(GO:0044845) cellular component macromolecule biosynthetic process(GO:0070589) |
| 0.0 | 0.1 | GO:0001675 | acrosome assembly(GO:0001675) |
| 0.0 | 0.0 | GO:0002767 | immune response-inhibiting cell surface receptor signaling pathway(GO:0002767) |
| 0.0 | 0.1 | GO:0002176 | male germ cell proliferation(GO:0002176) |
| 0.0 | 0.1 | GO:2000197 | regulation of mRNA export from nucleus(GO:0010793) regulation of ribonucleoprotein complex localization(GO:2000197) |
| 0.0 | 0.1 | GO:1903546 | protein localization to photoreceptor outer segment(GO:1903546) |
| 0.0 | 0.2 | GO:0016082 | synaptic vesicle priming(GO:0016082) |
| 0.0 | 0.2 | GO:0048741 | skeletal muscle fiber development(GO:0048741) |
| 0.0 | 0.0 | GO:0033629 | negative regulation of cell adhesion mediated by integrin(GO:0033629) |
| 0.0 | 0.1 | GO:0036089 | cleavage furrow formation(GO:0036089) |
| 0.0 | 0.0 | GO:0001834 | trophectodermal cell proliferation(GO:0001834) |
| 0.0 | 0.1 | GO:0006120 | mitochondrial electron transport, NADH to ubiquinone(GO:0006120) |
| 0.0 | 0.0 | GO:0051541 | elastin metabolic process(GO:0051541) |
| 0.0 | 0.1 | GO:0021796 | cerebral cortex regionalization(GO:0021796) |
| 0.0 | 0.0 | GO:0036394 | amylase secretion(GO:0036394) |
| 0.0 | 0.2 | GO:0007096 | regulation of exit from mitosis(GO:0007096) |
| 0.0 | 0.1 | GO:0046668 | regulation of retinal cell programmed cell death(GO:0046668) |
| 0.0 | 0.1 | GO:0051503 | adenine nucleotide transport(GO:0051503) |
| 0.0 | 0.1 | GO:0046628 | positive regulation of insulin receptor signaling pathway(GO:0046628) |
| 0.0 | 0.0 | GO:0061101 | neuroendocrine cell differentiation(GO:0061101) |
| 0.0 | 0.1 | GO:0015824 | proline transport(GO:0015824) |
| 0.0 | 0.0 | GO:0071502 | cellular response to temperature stimulus(GO:0071502) |
| 0.0 | 0.0 | GO:0031443 | fast-twitch skeletal muscle fiber contraction(GO:0031443) |
| 0.0 | 0.0 | GO:1900041 | negative regulation of interleukin-2 secretion(GO:1900041) |
| 0.0 | 0.4 | GO:0043550 | regulation of lipid kinase activity(GO:0043550) |
| 0.0 | 0.1 | GO:0018243 | protein O-linked glycosylation via threonine(GO:0018243) |
| 0.0 | 0.0 | GO:0002949 | tRNA threonylcarbamoyladenosine modification(GO:0002949) |
| 0.0 | 0.1 | GO:0000185 | activation of MAPKKK activity(GO:0000185) |
| 0.0 | 0.0 | GO:0033144 | negative regulation of intracellular steroid hormone receptor signaling pathway(GO:0033144) |
| 0.0 | 0.1 | GO:2000095 | regulation of Wnt signaling pathway, planar cell polarity pathway(GO:2000095) |
| 0.0 | 0.1 | GO:0006353 | DNA-templated transcription, termination(GO:0006353) |
| 0.0 | 0.0 | GO:0006419 | alanyl-tRNA aminoacylation(GO:0006419) |
| 0.0 | 0.0 | GO:0045343 | MHC class I biosynthetic process(GO:0045341) regulation of MHC class I biosynthetic process(GO:0045343) positive regulation of MHC class I biosynthetic process(GO:0045345) |
| 0.0 | 0.8 | GO:1903955 | positive regulation of protein targeting to mitochondrion(GO:1903955) |
| 0.0 | 0.2 | GO:0071108 | protein K48-linked deubiquitination(GO:0071108) |
| 0.0 | 0.0 | GO:0060051 | negative regulation of protein glycosylation(GO:0060051) |
| 0.0 | 0.0 | GO:0036515 | serotonergic neuron axon guidance(GO:0036515) |
| 0.0 | 0.1 | GO:0099517 | anterograde synaptic vesicle transport(GO:0048490) synaptic vesicle cytoskeletal transport(GO:0099514) synaptic vesicle transport along microtubule(GO:0099517) |
| 0.0 | 0.1 | GO:0046007 | negative regulation of activated T cell proliferation(GO:0046007) |
| 0.0 | 0.0 | GO:1900368 | regulation of RNA interference(GO:1900368) |
| 0.0 | 0.1 | GO:1902715 | positive regulation of interferon-gamma secretion(GO:1902715) |
| 0.0 | 0.2 | GO:0071353 | cellular response to interleukin-4(GO:0071353) |
| 0.0 | 0.0 | GO:0006041 | glucosamine metabolic process(GO:0006041) |
| 0.0 | 0.0 | GO:0006930 | substrate-dependent cell migration, cell extension(GO:0006930) |
| 0.0 | 0.1 | GO:0048672 | positive regulation of collateral sprouting(GO:0048672) |
| 0.0 | 0.1 | GO:0035269 | protein O-linked mannosylation(GO:0035269) |
| 0.0 | 0.0 | GO:0051547 | regulation of keratinocyte migration(GO:0051547) positive regulation of keratinocyte migration(GO:0051549) |
| 0.0 | 0.0 | GO:0090245 | axis elongation involved in somitogenesis(GO:0090245) |
| 0.0 | 0.1 | GO:0090201 | negative regulation of release of cytochrome c from mitochondria(GO:0090201) |
| 0.0 | 0.1 | GO:0008343 | adult feeding behavior(GO:0008343) |
| 0.0 | 0.0 | GO:1903802 | L-glutamate(1-) import into cell(GO:1903802) L-glutamate import into cell(GO:1990123) |
| 0.0 | 0.0 | GO:0014043 | negative regulation of neuron maturation(GO:0014043) |
| 0.0 | 0.0 | GO:0035359 | negative regulation of peroxisome proliferator activated receptor signaling pathway(GO:0035359) |
| 0.0 | 0.0 | GO:0015670 | carbon dioxide transport(GO:0015670) |
| 0.0 | 0.0 | GO:2000325 | regulation of ligand-dependent nuclear receptor transcription coactivator activity(GO:2000325) positive regulation of ligand-dependent nuclear receptor transcription coactivator activity(GO:2000327) |
| 0.0 | 0.3 | GO:0000266 | mitochondrial fission(GO:0000266) |
| 0.0 | 0.0 | GO:0045653 | negative regulation of megakaryocyte differentiation(GO:0045653) |
| 0.0 | 0.1 | GO:0071420 | cellular response to histamine(GO:0071420) |
| 0.0 | 0.1 | GO:0030252 | growth hormone secretion(GO:0030252) |
| 0.0 | 0.1 | GO:0035330 | regulation of hippo signaling(GO:0035330) |
| 0.0 | 0.1 | GO:0051967 | negative regulation of synaptic transmission, glutamatergic(GO:0051967) |
| 0.0 | 0.0 | GO:2001245 | regulation of phosphatidylcholine biosynthetic process(GO:2001245) |
| 0.0 | 0.0 | GO:1904417 | regulation of xenophagy(GO:1904415) positive regulation of xenophagy(GO:1904417) |
| 0.0 | 0.0 | GO:0032367 | intracellular cholesterol transport(GO:0032367) |
| 0.0 | 0.1 | GO:0006098 | pentose-phosphate shunt(GO:0006098) |
| 0.0 | 0.0 | GO:0070827 | chromatin maintenance(GO:0070827) |
| 0.0 | 0.0 | GO:0007253 | cytoplasmic sequestering of NF-kappaB(GO:0007253) |
| 0.0 | 0.2 | GO:0030521 | androgen receptor signaling pathway(GO:0030521) |
| 0.0 | 0.0 | GO:0022009 | central nervous system vasculogenesis(GO:0022009) |
| 0.0 | 0.0 | GO:0051204 | protein insertion into mitochondrial membrane(GO:0051204) |
| 0.0 | 0.0 | GO:0031581 | hemidesmosome assembly(GO:0031581) |
| 0.0 | 0.0 | GO:0010749 | regulation of nitric oxide mediated signal transduction(GO:0010749) |
| 0.0 | 0.0 | GO:0044336 | canonical Wnt signaling pathway involved in negative regulation of apoptotic process(GO:0044336) |
| 0.0 | 0.1 | GO:0045005 | replication fork processing(GO:0031297) DNA-dependent DNA replication maintenance of fidelity(GO:0045005) |
| 0.0 | 0.1 | GO:0000380 | alternative mRNA splicing, via spliceosome(GO:0000380) |
| 0.0 | 0.0 | GO:0006407 | rRNA export from nucleus(GO:0006407) |
| 0.0 | 0.1 | GO:0007135 | meiosis II(GO:0007135) |
| 0.0 | 0.3 | GO:0006505 | GPI anchor metabolic process(GO:0006505) |
| 0.0 | 0.0 | GO:0035526 | retrograde transport, plasma membrane to Golgi(GO:0035526) |
| 0.0 | 0.1 | GO:1902170 | cellular response to reactive nitrogen species(GO:1902170) |
| 0.0 | 0.0 | GO:0030309 | poly-N-acetyllactosamine metabolic process(GO:0030309) poly-N-acetyllactosamine biosynthetic process(GO:0030311) |
| 0.0 | 0.0 | GO:0030214 | hyaluronan catabolic process(GO:0030214) |
| 0.0 | 0.0 | GO:0060112 | generation of ovulation cycle rhythm(GO:0060112) |
| 0.0 | 0.1 | GO:0018026 | peptidyl-lysine monomethylation(GO:0018026) |
| 0.0 | 0.0 | GO:1903799 | negative regulation of production of miRNAs involved in gene silencing by miRNA(GO:1903799) |
| 0.0 | 0.1 | GO:0050995 | negative regulation of lipid catabolic process(GO:0050995) |
| 0.0 | 0.1 | GO:0032532 | regulation of microvillus length(GO:0032532) |
| 0.0 | 0.0 | GO:0000389 | mRNA 3'-splice site recognition(GO:0000389) |
| 0.0 | 0.0 | GO:2001027 | negative regulation of endothelial cell chemotaxis(GO:2001027) |
| 0.0 | 0.0 | GO:0002765 | immune response-inhibiting signal transduction(GO:0002765) |
| 0.0 | 0.0 | GO:0043988 | histone H3-S28 phosphorylation(GO:0043988) |
| 0.0 | 0.0 | GO:0033326 | cerebrospinal fluid secretion(GO:0033326) |
| 0.0 | 0.0 | GO:0010881 | regulation of cardiac muscle contraction by regulation of the release of sequestered calcium ion(GO:0010881) |
| 0.0 | 0.1 | GO:0007210 | serotonin receptor signaling pathway(GO:0007210) |
| 0.0 | 0.2 | GO:0046834 | lipid phosphorylation(GO:0046834) |
| 0.0 | 0.1 | GO:0033120 | positive regulation of RNA splicing(GO:0033120) |
| 0.0 | 0.0 | GO:0021603 | cranial nerve formation(GO:0021603) |
| 0.0 | 0.1 | GO:0021514 | ventral spinal cord interneuron differentiation(GO:0021514) |
| 0.0 | 0.1 | GO:0043094 | cellular metabolic compound salvage(GO:0043094) |
| 0.0 | 0.0 | GO:0043928 | exonucleolytic nuclear-transcribed mRNA catabolic process involved in deadenylation-dependent decay(GO:0043928) |
| 0.0 | 0.0 | GO:1903862 | positive regulation of oxidative phosphorylation(GO:1903862) |
| 0.0 | 0.0 | GO:0070126 | mitochondrial translational termination(GO:0070126) |
| 0.0 | 0.0 | GO:0060586 | multicellular organismal iron ion homeostasis(GO:0060586) |
| 0.0 | 0.0 | GO:0006553 | lysine metabolic process(GO:0006553) |
| 0.0 | 0.0 | GO:2000551 | regulation of T-helper 2 cell cytokine production(GO:2000551) |
| 0.0 | 0.1 | GO:0006122 | mitochondrial electron transport, ubiquinol to cytochrome c(GO:0006122) |
| 0.0 | 0.0 | GO:0048936 | peripheral nervous system neuron axonogenesis(GO:0048936) |
| 0.0 | 0.1 | GO:0061179 | negative regulation of insulin secretion involved in cellular response to glucose stimulus(GO:0061179) |
| 0.0 | 0.2 | GO:0006879 | cellular iron ion homeostasis(GO:0006879) |
| 0.0 | 0.2 | GO:0000470 | maturation of LSU-rRNA(GO:0000470) |
| 0.0 | 0.0 | GO:0048014 | Tie signaling pathway(GO:0048014) |
| 0.0 | 0.0 | GO:0018199 | peptidyl-glutamine modification(GO:0018199) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.1 | 0.5 | GO:0045098 | type III intermediate filament(GO:0045098) |
| 0.1 | 1.1 | GO:0070852 | cell body fiber(GO:0070852) |
| 0.1 | 0.3 | GO:0035355 | Toll-like receptor 2-Toll-like receptor 6 protein complex(GO:0035355) |
| 0.1 | 0.5 | GO:0005579 | membrane attack complex(GO:0005579) |
| 0.1 | 0.3 | GO:0097454 | Schwann cell microvillus(GO:0097454) |
| 0.1 | 0.3 | GO:0030313 | cell outer membrane(GO:0009279) cell envelope(GO:0030313) external encapsulating structure part(GO:0044462) |
| 0.1 | 0.3 | GO:0034274 | Atg12-Atg5-Atg16 complex(GO:0034274) |
| 0.1 | 0.4 | GO:0031315 | extrinsic component of mitochondrial outer membrane(GO:0031315) |
| 0.1 | 0.2 | GO:0000811 | GINS complex(GO:0000811) |
| 0.1 | 0.2 | GO:0030981 | cortical microtubule cytoskeleton(GO:0030981) |
| 0.1 | 0.3 | GO:0005726 | perichromatin fibrils(GO:0005726) |
| 0.1 | 0.4 | GO:0035032 | phosphatidylinositol 3-kinase complex, class III(GO:0035032) |
| 0.1 | 0.7 | GO:0046930 | pore complex(GO:0046930) |
| 0.1 | 0.4 | GO:0005915 | zonula adherens(GO:0005915) |
| 0.1 | 0.4 | GO:0071204 | histone pre-mRNA 3'end processing complex(GO:0071204) |
| 0.1 | 0.3 | GO:0005955 | calcineurin complex(GO:0005955) |
| 0.1 | 0.2 | GO:0030127 | COPII vesicle coat(GO:0030127) |
| 0.1 | 0.5 | GO:0071541 | eukaryotic translation initiation factor 3 complex, eIF3m(GO:0071541) |
| 0.1 | 0.2 | GO:0045298 | tubulin complex(GO:0045298) |
| 0.1 | 0.2 | GO:0016939 | kinesin II complex(GO:0016939) |
| 0.1 | 0.2 | GO:0060053 | neurofilament cytoskeleton(GO:0060053) |
| 0.1 | 0.2 | GO:0070545 | PeBoW complex(GO:0070545) |
| 0.1 | 1.0 | GO:0032588 | trans-Golgi network membrane(GO:0032588) |
| 0.1 | 0.2 | GO:0048179 | activin receptor complex(GO:0048179) |
| 0.1 | 0.3 | GO:0044233 | ER-mitochondrion membrane contact site(GO:0044233) |
| 0.0 | 0.4 | GO:0008250 | oligosaccharyltransferase complex(GO:0008250) |
| 0.0 | 0.3 | GO:0035749 | myelin sheath adaxonal region(GO:0035749) |
| 0.0 | 0.2 | GO:0008091 | spectrin(GO:0008091) |
| 0.0 | 0.1 | GO:0005896 | interleukin-6 receptor complex(GO:0005896) |
| 0.0 | 0.4 | GO:0032045 | guanyl-nucleotide exchange factor complex(GO:0032045) |
| 0.0 | 0.2 | GO:0036454 | insulin-like growth factor binding protein complex(GO:0016942) growth factor complex(GO:0036454) insulin-like growth factor ternary complex(GO:0042567) |
| 0.0 | 0.3 | GO:0017059 | serine C-palmitoyltransferase complex(GO:0017059) endoplasmic reticulum palmitoyltransferase complex(GO:0031211) |
| 0.0 | 0.2 | GO:0031618 | nuclear pericentric heterochromatin(GO:0031618) |
| 0.0 | 0.1 | GO:0033647 | host intracellular organelle(GO:0033647) host intracellular membrane-bounded organelle(GO:0033648) |
| 0.0 | 0.2 | GO:0031094 | platelet dense tubular network(GO:0031094) |
| 0.0 | 0.3 | GO:0016342 | catenin complex(GO:0016342) |
| 0.0 | 0.2 | GO:0000220 | vacuolar proton-transporting V-type ATPase, V0 domain(GO:0000220) |
| 0.0 | 0.5 | GO:0034663 | endoplasmic reticulum chaperone complex(GO:0034663) |
| 0.0 | 0.1 | GO:0044232 | organelle membrane contact site(GO:0044232) |
| 0.0 | 0.0 | GO:0030669 | clathrin-coated endocytic vesicle membrane(GO:0030669) |
| 0.0 | 0.3 | GO:1904115 | axon cytoplasm(GO:1904115) |
| 0.0 | 0.3 | GO:0031595 | nuclear proteasome complex(GO:0031595) |
| 0.0 | 0.2 | GO:0000306 | extrinsic component of vacuolar membrane(GO:0000306) |
| 0.0 | 0.1 | GO:0044316 | cone cell pedicle(GO:0044316) |
| 0.0 | 0.1 | GO:1990696 | USH2 complex(GO:1990696) |
| 0.0 | 0.0 | GO:0032133 | chromosome passenger complex(GO:0032133) |
| 0.0 | 0.1 | GO:0045293 | mRNA editing complex(GO:0045293) |
| 0.0 | 0.1 | GO:0097413 | Lewy body(GO:0097413) |
| 0.0 | 0.1 | GO:0031298 | replication fork protection complex(GO:0031298) |
| 0.0 | 0.5 | GO:0043034 | costamere(GO:0043034) |
| 0.0 | 0.1 | GO:0005672 | transcription factor TFIIA complex(GO:0005672) |
| 0.0 | 0.3 | GO:0000124 | SAGA complex(GO:0000124) |
| 0.0 | 0.1 | GO:0097651 | phosphatidylinositol 3-kinase complex, class I(GO:0097651) |
| 0.0 | 0.6 | GO:0005719 | nuclear euchromatin(GO:0005719) |
| 0.0 | 0.1 | GO:0071008 | U2-type post-mRNA release spliceosomal complex(GO:0071008) |
| 0.0 | 0.5 | GO:0035327 | transcriptionally active chromatin(GO:0035327) |
| 0.0 | 0.4 | GO:0097431 | mitotic spindle pole(GO:0097431) |
| 0.0 | 0.2 | GO:0005952 | cAMP-dependent protein kinase complex(GO:0005952) |
| 0.0 | 0.1 | GO:0000125 | PCAF complex(GO:0000125) |
| 0.0 | 0.1 | GO:0044615 | nuclear pore nuclear basket(GO:0044615) |
| 0.0 | 0.3 | GO:0045263 | proton-transporting ATP synthase complex, coupling factor F(o)(GO:0045263) |
| 0.0 | 0.2 | GO:0030130 | clathrin coat of trans-Golgi network vesicle(GO:0030130) |
| 0.0 | 0.1 | GO:0098536 | deuterosome(GO:0098536) |
| 0.0 | 0.2 | GO:0042405 | nuclear inclusion body(GO:0042405) |
| 0.0 | 0.1 | GO:0046691 | intracellular canaliculus(GO:0046691) |
| 0.0 | 0.3 | GO:0030126 | COPI vesicle coat(GO:0030126) |
| 0.0 | 0.1 | GO:0005827 | polar microtubule(GO:0005827) |
| 0.0 | 0.2 | GO:0008024 | cyclin/CDK positive transcription elongation factor complex(GO:0008024) |
| 0.0 | 0.1 | GO:0045252 | oxoglutarate dehydrogenase complex(GO:0045252) |
| 0.0 | 0.1 | GO:1990604 | IRE1-TRAF2-ASK1 complex(GO:1990604) |
| 0.0 | 0.3 | GO:0031235 | intrinsic component of the cytoplasmic side of the plasma membrane(GO:0031235) |
| 0.0 | 0.2 | GO:0000164 | protein phosphatase type 1 complex(GO:0000164) |
| 0.0 | 0.1 | GO:0005968 | Rab-protein geranylgeranyltransferase complex(GO:0005968) |
| 0.0 | 0.1 | GO:0036057 | filtration diaphragm(GO:0036056) slit diaphragm(GO:0036057) |
| 0.0 | 0.1 | GO:0035748 | myelin sheath abaxonal region(GO:0035748) |
| 0.0 | 0.6 | GO:0005720 | nuclear heterochromatin(GO:0005720) |
| 0.0 | 0.1 | GO:1990131 | EGO complex(GO:0034448) Gtr1-Gtr2 GTPase complex(GO:1990131) |
| 0.0 | 0.1 | GO:0097524 | sperm plasma membrane(GO:0097524) |
| 0.0 | 0.3 | GO:0010369 | chromocenter(GO:0010369) |
| 0.0 | 0.2 | GO:1990124 | messenger ribonucleoprotein complex(GO:1990124) |
| 0.0 | 0.3 | GO:0030120 | vesicle coat(GO:0030120) |
| 0.0 | 0.1 | GO:0046696 | lipopolysaccharide receptor complex(GO:0046696) |
| 0.0 | 0.2 | GO:0031616 | spindle pole centrosome(GO:0031616) |
| 0.0 | 0.1 | GO:0032299 | ribonuclease H2 complex(GO:0032299) |
| 0.0 | 0.1 | GO:0016589 | NURF complex(GO:0016589) |
| 0.0 | 0.1 | GO:0005828 | kinetochore microtubule(GO:0005828) |
| 0.0 | 0.3 | GO:0000159 | protein phosphatase type 2A complex(GO:0000159) |
| 0.0 | 0.1 | GO:0042382 | paraspeckles(GO:0042382) |
| 0.0 | 0.4 | GO:0000407 | pre-autophagosomal structure(GO:0000407) |
| 0.0 | 0.1 | GO:0070775 | H3 histone acetyltransferase complex(GO:0070775) MOZ/MORF histone acetyltransferase complex(GO:0070776) |
| 0.0 | 1.0 | GO:0005778 | peroxisomal membrane(GO:0005778) microbody membrane(GO:0031903) |
| 0.0 | 0.1 | GO:0034098 | VCP-NPL4-UFD1 AAA ATPase complex(GO:0034098) |
| 0.0 | 0.1 | GO:0005745 | m-AAA complex(GO:0005745) |
| 0.0 | 1.0 | GO:0005811 | lipid particle(GO:0005811) |
| 0.0 | 0.1 | GO:0031464 | Cul4A-RING E3 ubiquitin ligase complex(GO:0031464) |
| 0.0 | 0.1 | GO:0043202 | lysosomal lumen(GO:0043202) |
| 0.0 | 0.2 | GO:0005847 | mRNA cleavage and polyadenylation specificity factor complex(GO:0005847) |
| 0.0 | 0.2 | GO:0000808 | origin recognition complex(GO:0000808) nuclear origin of replication recognition complex(GO:0005664) |
| 0.0 | 0.1 | GO:0016602 | CCAAT-binding factor complex(GO:0016602) |
| 0.0 | 0.8 | GO:0042645 | nucleoid(GO:0009295) mitochondrial nucleoid(GO:0042645) |
| 0.0 | 0.2 | GO:0000815 | ESCRT III complex(GO:0000815) |
| 0.0 | 0.2 | GO:0002199 | zona pellucida receptor complex(GO:0002199) |
| 0.0 | 0.1 | GO:0070033 | synaptobrevin 2-SNAP-25-syntaxin-1a-complexin II complex(GO:0070033) |
| 0.0 | 0.1 | GO:0002079 | inner acrosomal membrane(GO:0002079) |
| 0.0 | 0.1 | GO:0061689 | tricellular tight junction(GO:0061689) |
| 0.0 | 0.1 | GO:0034366 | spherical high-density lipoprotein particle(GO:0034366) |
| 0.0 | 0.1 | GO:0045251 | mitochondrial electron transfer flavoprotein complex(GO:0017133) electron transfer flavoprotein complex(GO:0045251) |
| 0.0 | 0.1 | GO:0032444 | activin responsive factor complex(GO:0032444) |
| 0.0 | 0.1 | GO:1990111 | spermatoproteasome complex(GO:1990111) |
| 0.0 | 0.1 | GO:0097427 | microtubule bundle(GO:0097427) |
| 0.0 | 0.0 | GO:0033186 | CAF-1 complex(GO:0033186) |
| 0.0 | 0.5 | GO:0031519 | PcG protein complex(GO:0031519) |
| 0.0 | 0.1 | GO:0005677 | chromatin silencing complex(GO:0005677) |
| 0.0 | 0.1 | GO:0005927 | muscle tendon junction(GO:0005927) |
| 0.0 | 0.1 | GO:0000813 | ESCRT I complex(GO:0000813) |
| 0.0 | 0.0 | GO:0031502 | dolichyl-phosphate-mannose-protein mannosyltransferase complex(GO:0031502) |
| 0.0 | 0.1 | GO:0000275 | mitochondrial proton-transporting ATP synthase complex, catalytic core F(1)(GO:0000275) proton-transporting ATP synthase complex, catalytic core F(1)(GO:0045261) |
| 0.0 | 0.1 | GO:0098554 | cytoplasmic side of endoplasmic reticulum membrane(GO:0098554) |
| 0.0 | 0.0 | GO:0030289 | protein phosphatase 4 complex(GO:0030289) |
| 0.0 | 0.4 | GO:0008023 | transcription elongation factor complex(GO:0008023) |
| 0.0 | 0.0 | GO:0097504 | Gemini of coiled bodies(GO:0097504) |
| 0.0 | 0.4 | GO:0000777 | condensed chromosome kinetochore(GO:0000777) |
| 0.0 | 0.0 | GO:0005608 | laminin-3 complex(GO:0005608) |
| 0.0 | 0.0 | GO:0005958 | DNA-dependent protein kinase-DNA ligase 4 complex(GO:0005958) |
| 0.0 | 0.1 | GO:0031265 | CD95 death-inducing signaling complex(GO:0031265) |
| 0.0 | 0.1 | GO:0042824 | MHC class I peptide loading complex(GO:0042824) |
| 0.0 | 0.1 | GO:0005942 | phosphatidylinositol 3-kinase complex(GO:0005942) |
| 0.0 | 0.0 | GO:0090498 | extrinsic component of Golgi membrane(GO:0090498) |
| 0.0 | 0.1 | GO:0032541 | cortical endoplasmic reticulum(GO:0032541) |
| 0.0 | 0.3 | GO:0005686 | U2 snRNP(GO:0005686) |
| 0.0 | 0.1 | GO:0016471 | vacuolar proton-transporting V-type ATPase complex(GO:0016471) |
| 0.0 | 0.1 | GO:0072357 | PTW/PP1 phosphatase complex(GO:0072357) |
| 0.0 | 0.6 | GO:0005747 | mitochondrial respiratory chain complex I(GO:0005747) NADH dehydrogenase complex(GO:0030964) respiratory chain complex I(GO:0045271) |
| 0.0 | 0.0 | GO:0097025 | MPP7-DLG1-LIN7 complex(GO:0097025) |
| 0.0 | 0.1 | GO:0042105 | alpha-beta T cell receptor complex(GO:0042105) |
| 0.0 | 0.1 | GO:0030665 | clathrin-coated vesicle membrane(GO:0030665) |
| 0.0 | 0.2 | GO:0035371 | microtubule plus-end(GO:0035371) |
| 0.0 | 0.1 | GO:0031371 | ubiquitin conjugating enzyme complex(GO:0031371) |
| 0.0 | 0.1 | GO:0030314 | junctional membrane complex(GO:0030314) |
| 0.0 | 0.1 | GO:0045239 | tricarboxylic acid cycle enzyme complex(GO:0045239) |
| 0.0 | 0.0 | GO:0005784 | Sec61 translocon complex(GO:0005784) translocon complex(GO:0071256) |
| 0.0 | 0.1 | GO:0005688 | U6 snRNP(GO:0005688) |
| 0.0 | 0.1 | GO:0000805 | X chromosome(GO:0000805) |
| 0.0 | 0.0 | GO:0031074 | nucleocytoplasmic shuttling complex(GO:0031074) |
| 0.0 | 0.1 | GO:0000346 | transcription export complex(GO:0000346) |
| 0.0 | 0.2 | GO:0001518 | voltage-gated sodium channel complex(GO:0001518) |
| 0.0 | 0.6 | GO:0030173 | integral component of Golgi membrane(GO:0030173) |
| 0.0 | 0.4 | GO:0005637 | nuclear inner membrane(GO:0005637) |
| 0.0 | 0.5 | GO:0022627 | cytosolic small ribosomal subunit(GO:0022627) |
| 0.0 | 0.3 | GO:0016235 | aggresome(GO:0016235) |
| 0.0 | 0.0 | GO:0000780 | condensed nuclear chromosome, centromeric region(GO:0000780) |
| 0.0 | 0.1 | GO:0031428 | box C/D snoRNP complex(GO:0031428) |
| 0.0 | 0.0 | GO:0005853 | eukaryotic translation elongation factor 1 complex(GO:0005853) |
| 0.0 | 0.0 | GO:0016222 | procollagen-proline 4-dioxygenase complex(GO:0016222) |
| 0.0 | 0.1 | GO:0044294 | dendritic growth cone(GO:0044294) |
| 0.0 | 0.1 | GO:0016580 | Sin3 complex(GO:0016580) |
| 0.0 | 0.0 | GO:0097136 | Bcl-2 family protein complex(GO:0097136) |
| 0.0 | 0.1 | GO:0005852 | eukaryotic translation initiation factor 3 complex(GO:0005852) |
| 0.0 | 0.2 | GO:0005680 | anaphase-promoting complex(GO:0005680) |
| 0.0 | 0.0 | GO:1990712 | HFE-transferrin receptor complex(GO:1990712) |
| 0.0 | 0.0 | GO:0032280 | symmetric synapse(GO:0032280) |
| 0.0 | 0.1 | GO:0001650 | fibrillar center(GO:0001650) |
| 0.0 | 0.0 | GO:0030870 | Mre11 complex(GO:0030870) |
| 0.0 | 0.2 | GO:0005892 | acetylcholine-gated channel complex(GO:0005892) |
| 0.0 | 0.0 | GO:0005594 | collagen type IX trimer(GO:0005594) |
| 0.0 | 0.0 | GO:0097418 | neurofibrillary tangle(GO:0097418) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.3 | 0.8 | GO:0016743 | carboxyl- or carbamoyltransferase activity(GO:0016743) |
| 0.3 | 0.8 | GO:0035529 | NADH pyrophosphatase activity(GO:0035529) |
| 0.2 | 0.9 | GO:0032896 | palmitoyl-CoA 9-desaturase activity(GO:0032896) |
| 0.2 | 0.8 | GO:0034056 | estrogen response element binding(GO:0034056) |
| 0.2 | 1.7 | GO:0004499 | N,N-dimethylaniline monooxygenase activity(GO:0004499) |
| 0.2 | 0.5 | GO:0038181 | bile acid receptor activity(GO:0038181) |
| 0.2 | 0.5 | GO:0001069 | regulatory region RNA binding(GO:0001069) |
| 0.2 | 0.5 | GO:0036042 | long-chain fatty acyl-CoA binding(GO:0036042) |
| 0.1 | 0.4 | GO:0004013 | adenosylhomocysteinase activity(GO:0004013) trialkylsulfonium hydrolase activity(GO:0016802) |
| 0.1 | 0.8 | GO:0015288 | porin activity(GO:0015288) |
| 0.1 | 0.6 | GO:0001665 | alpha-N-acetylgalactosaminide alpha-2,6-sialyltransferase activity(GO:0001665) |
| 0.1 | 0.5 | GO:0015220 | choline transmembrane transporter activity(GO:0015220) |
| 0.1 | 0.5 | GO:0070579 | methylcytosine dioxygenase activity(GO:0070579) |
| 0.1 | 0.3 | GO:0016823 | hydrolase activity, acting on acid carbon-carbon bonds(GO:0016822) hydrolase activity, acting on acid carbon-carbon bonds, in ketonic substances(GO:0016823) |
| 0.1 | 0.3 | GO:0004771 | sterol esterase activity(GO:0004771) |
| 0.1 | 0.8 | GO:0003836 | beta-galactoside (CMP) alpha-2,3-sialyltransferase activity(GO:0003836) |
| 0.1 | 0.3 | GO:0008898 | S-adenosylmethionine-homocysteine S-methyltransferase activity(GO:0008898) |
| 0.1 | 0.3 | GO:0004937 | alpha1-adrenergic receptor activity(GO:0004937) |
| 0.1 | 0.3 | GO:0035663 | Toll-like receptor 2 binding(GO:0035663) |
| 0.1 | 0.3 | GO:0008449 | N-acetylglucosamine-6-sulfatase activity(GO:0008449) |
| 0.1 | 0.4 | GO:0071614 | linoleic acid epoxygenase activity(GO:0071614) |
| 0.1 | 0.3 | GO:0055100 | adiponectin binding(GO:0055100) |
| 0.1 | 0.3 | GO:0043125 | ErbB-3 class receptor binding(GO:0043125) |
| 0.1 | 0.5 | GO:0004075 | biotin carboxylase activity(GO:0004075) |
| 0.1 | 0.4 | GO:0031698 | beta-2 adrenergic receptor binding(GO:0031698) |
| 0.1 | 0.3 | GO:0008073 | ornithine decarboxylase inhibitor activity(GO:0008073) |
| 0.1 | 0.2 | GO:0048248 | CXCR3 chemokine receptor binding(GO:0048248) |
| 0.1 | 0.2 | GO:0047961 | glycine N-acyltransferase activity(GO:0047961) |
| 0.1 | 0.2 | GO:0005220 | inositol 1,4,5-trisphosphate-sensitive calcium-release channel activity(GO:0005220) |
| 0.1 | 0.1 | GO:0016662 | oxidoreductase activity, acting on other nitrogenous compounds as donors, cytochrome as acceptor(GO:0016662) |
| 0.1 | 0.2 | GO:0031697 | beta-1 adrenergic receptor binding(GO:0031697) |
| 0.1 | 0.6 | GO:0004571 | mannosyl-oligosaccharide 1,2-alpha-mannosidase activity(GO:0004571) |
| 0.1 | 0.2 | GO:0016749 | N-succinyltransferase activity(GO:0016749) |
| 0.1 | 0.5 | GO:0019870 | potassium channel inhibitor activity(GO:0019870) |
| 0.1 | 0.2 | GO:0097109 | neuroligin family protein binding(GO:0097109) |
| 0.1 | 0.3 | GO:0001602 | pancreatic polypeptide receptor activity(GO:0001602) |
| 0.1 | 0.1 | GO:0004532 | exoribonuclease activity(GO:0004532) |
| 0.1 | 0.9 | GO:0015643 | toxic substance binding(GO:0015643) |
| 0.1 | 0.3 | GO:0071074 | eukaryotic initiation factor eIF2 binding(GO:0071074) |
| 0.1 | 0.2 | GO:0004096 | catalase activity(GO:0004096) |
| 0.1 | 0.2 | GO:0004024 | alcohol dehydrogenase activity, zinc-dependent(GO:0004024) |
| 0.1 | 0.2 | GO:0008506 | sucrose:proton symporter activity(GO:0008506) sucrose transmembrane transporter activity(GO:0008515) disaccharide transmembrane transporter activity(GO:0015154) oligosaccharide transmembrane transporter activity(GO:0015157) |
| 0.1 | 0.1 | GO:0042392 | sphingosine-1-phosphate phosphatase activity(GO:0042392) |
| 0.1 | 0.3 | GO:0000832 | inositol hexakisphosphate kinase activity(GO:0000828) inositol hexakisphosphate 5-kinase activity(GO:0000832) inositol hexakisphosphate 1-kinase activity(GO:0052723) inositol hexakisphosphate 3-kinase activity(GO:0052724) |
| 0.1 | 0.3 | GO:0030976 | thiamine pyrophosphate binding(GO:0030976) |
| 0.1 | 0.2 | GO:0043423 | 3-phosphoinositide-dependent protein kinase binding(GO:0043423) |
| 0.1 | 0.2 | GO:0008597 | calcium-dependent protein serine/threonine phosphatase regulator activity(GO:0008597) |
| 0.1 | 0.2 | GO:0005119 | smoothened binding(GO:0005119) |
| 0.1 | 0.2 | GO:0005025 | transforming growth factor beta receptor activity, type I(GO:0005025) |
| 0.1 | 0.4 | GO:0097322 | 7SK snRNA binding(GO:0097322) |
| 0.1 | 0.2 | GO:0004505 | phenylalanine 4-monooxygenase activity(GO:0004505) |
| 0.1 | 0.2 | GO:0004045 | aminoacyl-tRNA hydrolase activity(GO:0004045) |
| 0.1 | 0.2 | GO:0018479 | benzaldehyde dehydrogenase (NAD+) activity(GO:0018479) |
| 0.1 | 0.5 | GO:0051010 | microtubule plus-end binding(GO:0051010) |
| 0.1 | 0.1 | GO:0004104 | cholinesterase activity(GO:0004104) |
| 0.1 | 0.3 | GO:0036402 | proteasome-activating ATPase activity(GO:0036402) |
| 0.1 | 0.2 | GO:0030620 | U2 snRNA binding(GO:0030620) |
| 0.1 | 0.3 | GO:0047760 | butyrate-CoA ligase activity(GO:0047760) |
| 0.1 | 0.4 | GO:0002162 | dystroglycan binding(GO:0002162) |
| 0.1 | 0.2 | GO:0008970 | phosphatidylcholine 1-acylhydrolase activity(GO:0008970) |
| 0.0 | 0.1 | GO:0032190 | acrosin binding(GO:0032190) |
| 0.0 | 0.1 | GO:0034186 | apolipoprotein A-I binding(GO:0034186) |
| 0.0 | 0.1 | GO:0001875 | lipopolysaccharide receptor activity(GO:0001875) |
| 0.0 | 0.1 | GO:1990825 | sequence-specific mRNA binding(GO:1990825) |
| 0.0 | 0.0 | GO:0005006 | epidermal growth factor-activated receptor activity(GO:0005006) |
| 0.0 | 0.2 | GO:0010997 | anaphase-promoting complex binding(GO:0010997) |
| 0.0 | 0.3 | GO:0005384 | manganese ion transmembrane transporter activity(GO:0005384) |
| 0.0 | 0.1 | GO:0004605 | phosphatidate cytidylyltransferase activity(GO:0004605) |
| 0.0 | 0.1 | GO:0016882 | cyclo-ligase activity(GO:0016882) |
| 0.0 | 0.4 | GO:0016846 | carbon-sulfur lyase activity(GO:0016846) |
| 0.0 | 0.1 | GO:0080130 | L-phenylalanine aminotransferase activity(GO:0070546) L-phenylalanine:2-oxoglutarate aminotransferase activity(GO:0080130) |
| 0.0 | 0.2 | GO:0004332 | fructose-bisphosphate aldolase activity(GO:0004332) |
| 0.0 | 0.2 | GO:0008379 | thioredoxin peroxidase activity(GO:0008379) |
| 0.0 | 0.3 | GO:0002054 | nucleobase binding(GO:0002054) |
| 0.0 | 0.1 | GO:0004924 | oncostatin-M receptor activity(GO:0004924) |
| 0.0 | 0.1 | GO:0102007 | lactonohydrolase activity(GO:0046573) acyl-L-homoserine-lactone lactonohydrolase activity(GO:0102007) |
| 0.0 | 0.2 | GO:1990380 | Lys48-specific deubiquitinase activity(GO:1990380) |
| 0.0 | 0.2 | GO:0008390 | testosterone 16-alpha-hydroxylase activity(GO:0008390) |
| 0.0 | 0.7 | GO:0005527 | macrolide binding(GO:0005527) FK506 binding(GO:0005528) |
| 0.0 | 0.7 | GO:0004435 | phosphatidylinositol phospholipase C activity(GO:0004435) |
| 0.0 | 0.2 | GO:0004716 | receptor signaling protein tyrosine kinase activity(GO:0004716) |
| 0.0 | 0.2 | GO:0070191 | methionine-R-sulfoxide reductase activity(GO:0070191) |
| 0.0 | 0.2 | GO:0047023 | androsterone dehydrogenase activity(GO:0047023) |
| 0.0 | 0.4 | GO:0008568 | microtubule-severing ATPase activity(GO:0008568) |
| 0.0 | 0.2 | GO:0017040 | ceramidase activity(GO:0017040) |
| 0.0 | 0.1 | GO:0004514 | nicotinate-nucleotide diphosphorylase (carboxylating) activity(GO:0004514) |
| 0.0 | 0.0 | GO:0051723 | protein methylesterase activity(GO:0051723) |
| 0.0 | 0.9 | GO:0019206 | nucleoside kinase activity(GO:0019206) |
| 0.0 | 0.2 | GO:0070728 | leucine binding(GO:0070728) |
| 0.0 | 0.2 | GO:0016724 | ferroxidase activity(GO:0004322) oxidoreductase activity, oxidizing metal ions, oxygen as acceptor(GO:0016724) |
| 0.0 | 0.3 | GO:0004579 | dolichyl-diphosphooligosaccharide-protein glycotransferase activity(GO:0004579) |
| 0.0 | 0.2 | GO:0004144 | diacylglycerol O-acyltransferase activity(GO:0004144) |
| 0.0 | 0.1 | GO:0016361 | activin receptor activity, type I(GO:0016361) |
| 0.0 | 0.6 | GO:1900750 | glutathione binding(GO:0043295) oligopeptide binding(GO:1900750) |
| 0.0 | 0.2 | GO:0017034 | Rap guanyl-nucleotide exchange factor activity(GO:0017034) |
| 0.0 | 0.3 | GO:0003691 | double-stranded telomeric DNA binding(GO:0003691) |
| 0.0 | 0.2 | GO:0004758 | serine C-palmitoyltransferase activity(GO:0004758) |
| 0.0 | 0.2 | GO:0003831 | beta-N-acetylglucosaminylglycopeptide beta-1,4-galactosyltransferase activity(GO:0003831) |
| 0.0 | 0.1 | GO:0032557 | pyrimidine ribonucleotide binding(GO:0032557) |
| 0.0 | 0.1 | GO:0015440 | peptide-transporting ATPase activity(GO:0015440) |
| 0.0 | 0.1 | GO:0004064 | arylesterase activity(GO:0004064) |
| 0.0 | 0.1 | GO:0033300 | dehydroascorbic acid transporter activity(GO:0033300) |
| 0.0 | 0.4 | GO:0045236 | CXCR chemokine receptor binding(GO:0045236) |
| 0.0 | 0.1 | GO:0070878 | primary miRNA binding(GO:0070878) |
| 0.0 | 0.2 | GO:0005167 | neurotrophin TRK receptor binding(GO:0005167) |
| 0.0 | 0.1 | GO:0098518 | polynucleotide phosphatase activity(GO:0098518) |
| 0.0 | 0.1 | GO:0010484 | H3 histone acetyltransferase activity(GO:0010484) |
| 0.0 | 0.2 | GO:0050051 | leukotriene-B4 20-monooxygenase activity(GO:0050051) |
| 0.0 | 0.1 | GO:0070644 | vitamin D response element binding(GO:0070644) |
| 0.0 | 0.1 | GO:0016453 | acetyl-CoA C-acetyltransferase activity(GO:0003985) C-acetyltransferase activity(GO:0016453) |
| 0.0 | 0.2 | GO:0097027 | ubiquitin-protein transferase activator activity(GO:0097027) |
| 0.0 | 0.0 | GO:0004676 | 3-phosphoinositide-dependent protein kinase activity(GO:0004676) |
| 0.0 | 0.5 | GO:0017128 | phospholipid scramblase activity(GO:0017128) |
| 0.0 | 0.3 | GO:0097602 | cullin family protein binding(GO:0097602) |
| 0.0 | 0.2 | GO:0098639 | collagen binding involved in cell-matrix adhesion(GO:0098639) |
| 0.0 | 0.1 | GO:0031781 | melanocortin receptor binding(GO:0031779) type 3 melanocortin receptor binding(GO:0031781) type 4 melanocortin receptor binding(GO:0031782) |
| 0.0 | 0.1 | GO:0008384 | IkappaB kinase activity(GO:0008384) |
| 0.0 | 0.1 | GO:0071209 | U7 snRNA binding(GO:0071209) |
| 0.0 | 0.1 | GO:0005131 | growth hormone receptor binding(GO:0005131) |
| 0.0 | 0.2 | GO:0000900 | translation repressor activity, nucleic acid binding(GO:0000900) |
| 0.0 | 0.7 | GO:0016709 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, NAD(P)H as one donor, and incorporation of one atom of oxygen(GO:0016709) |
| 0.0 | 0.1 | GO:0017150 | tRNA dihydrouridine synthase activity(GO:0017150) |
| 0.0 | 0.2 | GO:0050656 | 3'-phosphoadenosine 5'-phosphosulfate binding(GO:0050656) |
| 0.0 | 0.1 | GO:0031802 | type 5 metabotropic glutamate receptor binding(GO:0031802) |
| 0.0 | 0.1 | GO:0016649 | electron-transferring-flavoprotein dehydrogenase activity(GO:0004174) oxidoreductase activity, acting on the CH-NH group of donors, quinone or similar compound as acceptor(GO:0016649) |
| 0.0 | 0.1 | GO:0035184 | histone threonine kinase activity(GO:0035184) |
| 0.0 | 0.2 | GO:0008508 | bile acid:sodium symporter activity(GO:0008508) |
| 0.0 | 0.1 | GO:0045134 | uridine-diphosphatase activity(GO:0045134) |
| 0.0 | 0.1 | GO:0016715 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, reduced ascorbate as one donor, and incorporation of one atom of oxygen(GO:0016715) |
| 0.0 | 0.1 | GO:0015065 | uridine nucleotide receptor activity(GO:0015065) G-protein coupled pyrimidinergic nucleotide receptor activity(GO:0071553) |
| 0.0 | 0.1 | GO:0003847 | 1-alkyl-2-acetylglycerophosphocholine esterase activity(GO:0003847) |
| 0.0 | 0.1 | GO:0035615 | clathrin adaptor activity(GO:0035615) endocytic adaptor activity(GO:0098748) |
| 0.0 | 0.1 | GO:0016508 | long-chain-enoyl-CoA hydratase activity(GO:0016508) |
| 0.0 | 0.2 | GO:0043426 | MRF binding(GO:0043426) |
| 0.0 | 0.3 | GO:0004535 | poly(A)-specific ribonuclease activity(GO:0004535) |
| 0.0 | 0.1 | GO:0032407 | MutSalpha complex binding(GO:0032407) |
| 0.0 | 0.1 | GO:0016716 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, another compound as one donor, and incorporation of one atom of oxygen(GO:0016716) |
| 0.0 | 0.1 | GO:0005375 | copper ion transmembrane transporter activity(GO:0005375) |
| 0.0 | 0.1 | GO:0098821 | BMP receptor activity(GO:0098821) |
| 0.0 | 0.2 | GO:0048027 | mRNA 5'-UTR binding(GO:0048027) |
| 0.0 | 0.2 | GO:0005049 | nuclear export signal receptor activity(GO:0005049) |
| 0.0 | 0.1 | GO:0004616 | phosphogluconate dehydrogenase (decarboxylating) activity(GO:0004616) |
| 0.0 | 0.1 | GO:0055131 | C3HC4-type RING finger domain binding(GO:0055131) |
| 0.0 | 0.2 | GO:0005159 | insulin-like growth factor receptor binding(GO:0005159) |
| 0.0 | 0.1 | GO:0034618 | arginine binding(GO:0034618) |
| 0.0 | 0.2 | GO:0032454 | histone demethylase activity (H3-K9 specific)(GO:0032454) |
| 0.0 | 0.2 | GO:0003688 | DNA replication origin binding(GO:0003688) |
| 0.0 | 0.3 | GO:0015279 | store-operated calcium channel activity(GO:0015279) |
| 0.0 | 0.1 | GO:0004957 | prostaglandin E receptor activity(GO:0004957) |
| 0.0 | 0.2 | GO:0046624 | sphingolipid transporter activity(GO:0046624) |
| 0.0 | 0.9 | GO:0004033 | aldo-keto reductase (NADP) activity(GO:0004033) |
| 0.0 | 0.1 | GO:0070698 | type I activin receptor binding(GO:0070698) |
| 0.0 | 0.1 | GO:0051033 | nucleic acid transmembrane transporter activity(GO:0051032) RNA transmembrane transporter activity(GO:0051033) |
| 0.0 | 0.3 | GO:0051787 | misfolded protein binding(GO:0051787) |
| 0.0 | 0.1 | GO:0016151 | nickel cation binding(GO:0016151) |
| 0.0 | 0.2 | GO:0001162 | RNA polymerase II intronic transcription regulatory region sequence-specific DNA binding(GO:0001162) |
| 0.0 | 0.1 | GO:0000309 | nicotinamide-nucleotide adenylyltransferase activity(GO:0000309) nicotinate-nucleotide adenylyltransferase activity(GO:0004515) |
| 0.0 | 0.4 | GO:0008413 | 8-oxo-7,8-dihydroguanosine triphosphate pyrophosphatase activity(GO:0008413) |
| 0.0 | 0.1 | GO:0016880 | acid-ammonia (or amide) ligase activity(GO:0016880) |
| 0.0 | 0.2 | GO:0016668 | oxidoreductase activity, acting on a sulfur group of donors, NAD(P) as acceptor(GO:0016668) |
| 0.0 | 0.3 | GO:0050321 | tau-protein kinase activity(GO:0050321) |
| 0.0 | 0.1 | GO:0008240 | tripeptidyl-peptidase activity(GO:0008240) |
| 0.0 | 0.1 | GO:0015173 | aromatic amino acid transmembrane transporter activity(GO:0015173) |
| 0.0 | 0.1 | GO:0019784 | NEDD8-specific protease activity(GO:0019784) |
| 0.0 | 0.1 | GO:0015379 | potassium:chloride symporter activity(GO:0015379) potassium ion symporter activity(GO:0022820) |
| 0.0 | 0.1 | GO:0016899 | oxidoreductase activity, acting on the CH-OH group of donors, oxygen as acceptor(GO:0016899) |
| 0.0 | 0.1 | GO:0005499 | vitamin D binding(GO:0005499) |
| 0.0 | 0.0 | GO:0051920 | peroxiredoxin activity(GO:0051920) |
| 0.0 | 0.2 | GO:0003841 | 1-acylglycerol-3-phosphate O-acyltransferase activity(GO:0003841) |
| 0.0 | 0.1 | GO:0046790 | virion binding(GO:0046790) |
| 0.0 | 0.1 | GO:0008454 | alpha-1,3-mannosylglycoprotein 4-beta-N-acetylglucosaminyltransferase activity(GO:0008454) |
| 0.0 | 0.1 | GO:0033192 | calmodulin-dependent protein phosphatase activity(GO:0033192) |
| 0.0 | 0.5 | GO:0050136 | NADH dehydrogenase (ubiquinone) activity(GO:0008137) NADH dehydrogenase (quinone) activity(GO:0050136) |
| 0.0 | 0.0 | GO:0031686 | A1 adenosine receptor binding(GO:0031686) |
| 0.0 | 0.2 | GO:1990405 | protein antigen binding(GO:1990405) |
| 0.0 | 0.1 | GO:0019153 | protein-disulfide reductase (glutathione) activity(GO:0019153) |
| 0.0 | 0.1 | GO:0052813 | phosphatidylinositol bisphosphate kinase activity(GO:0052813) |
| 0.0 | 0.1 | GO:0017169 | CDP-alcohol phosphatidyltransferase activity(GO:0017169) |
| 0.0 | 0.1 | GO:0051864 | histone demethylase activity (H3-K36 specific)(GO:0051864) |
| 0.0 | 0.1 | GO:0097200 | cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:0097200) |
| 0.0 | 0.1 | GO:0001224 | RNA polymerase II transcription cofactor binding(GO:0001224) |
| 0.0 | 0.5 | GO:0050681 | androgen receptor binding(GO:0050681) |
| 0.0 | 0.1 | GO:0008494 | translation activator activity(GO:0008494) |
| 0.0 | 0.3 | GO:0030169 | low-density lipoprotein particle binding(GO:0030169) |
| 0.0 | 0.3 | GO:0070577 | lysine-acetylated histone binding(GO:0070577) |
| 0.0 | 0.3 | GO:0016505 | peptidase activator activity involved in apoptotic process(GO:0016505) |
| 0.0 | 0.0 | GO:0048763 | calcium-induced calcium release activity(GO:0048763) |
| 0.0 | 0.1 | GO:0005157 | macrophage colony-stimulating factor receptor binding(GO:0005157) |
| 0.0 | 0.0 | GO:0070699 | type II activin receptor binding(GO:0070699) |
| 0.0 | 0.1 | GO:0035174 | histone serine kinase activity(GO:0035174) |
| 0.0 | 0.1 | GO:0008430 | selenium binding(GO:0008430) |
| 0.0 | 0.1 | GO:0008499 | UDP-galactose:beta-N-acetylglucosamine beta-1,3-galactosyltransferase activity(GO:0008499) |
| 0.0 | 0.1 | GO:0005078 | MAP-kinase scaffold activity(GO:0005078) |
| 0.0 | 1.0 | GO:0015924 | mannosyl-oligosaccharide mannosidase activity(GO:0015924) |
| 0.0 | 0.2 | GO:0051371 | muscle alpha-actinin binding(GO:0051371) |
| 0.0 | 0.2 | GO:0070097 | delta-catenin binding(GO:0070097) |
| 0.0 | 0.1 | GO:0034711 | inhibin binding(GO:0034711) |
| 0.0 | 0.6 | GO:0097472 | cyclin-dependent protein serine/threonine kinase activity(GO:0004693) cyclin-dependent protein kinase activity(GO:0097472) |
| 0.0 | 0.1 | GO:0004427 | inorganic diphosphatase activity(GO:0004427) |
| 0.0 | 0.1 | GO:0051525 | NFAT protein binding(GO:0051525) |
| 0.0 | 0.0 | GO:0016531 | metallochaperone activity(GO:0016530) copper chaperone activity(GO:0016531) superoxide dismutase copper chaperone activity(GO:0016532) |
| 0.0 | 0.5 | GO:0046875 | ephrin receptor binding(GO:0046875) |
| 0.0 | 0.5 | GO:0004115 | 3',5'-cyclic-AMP phosphodiesterase activity(GO:0004115) |
| 0.0 | 0.1 | GO:0016832 | aldehyde-lyase activity(GO:0016832) |
| 0.0 | 0.1 | GO:0004679 | AMP-activated protein kinase activity(GO:0004679) |
| 0.0 | 0.1 | GO:0051880 | G-quadruplex DNA binding(GO:0051880) |
| 0.0 | 0.1 | GO:0005047 | signal recognition particle binding(GO:0005047) |
| 0.0 | 0.1 | GO:0004939 | beta-adrenergic receptor activity(GO:0004939) |
| 0.0 | 0.6 | GO:0016418 | S-acetyltransferase activity(GO:0016418) |
| 0.0 | 0.1 | GO:0035033 | histone deacetylase regulator activity(GO:0035033) |
| 0.0 | 0.4 | GO:0004364 | glutathione transferase activity(GO:0004364) |
| 0.0 | 0.2 | GO:0002161 | aminoacyl-tRNA editing activity(GO:0002161) |
| 0.0 | 0.2 | GO:0034713 | type I transforming growth factor beta receptor binding(GO:0034713) |
| 0.0 | 0.0 | GO:0004705 | JUN kinase activity(GO:0004705) SAP kinase activity(GO:0016909) |
| 0.0 | 0.3 | GO:0016502 | purinergic nucleotide receptor activity(GO:0001614) nucleotide receptor activity(GO:0016502) |
| 0.0 | 0.1 | GO:0004861 | cyclin-dependent protein serine/threonine kinase inhibitor activity(GO:0004861) |
| 0.0 | 0.3 | GO:0001848 | complement binding(GO:0001848) |
| 0.0 | 0.1 | GO:0004487 | methenyltetrahydrofolate cyclohydrolase activity(GO:0004477) methylenetetrahydrofolate dehydrogenase (NAD+) activity(GO:0004487) |
| 0.0 | 0.3 | GO:0030552 | cAMP binding(GO:0030552) |
| 0.0 | 0.5 | GO:0042169 | SH2 domain binding(GO:0042169) |
| 0.0 | 0.1 | GO:0042809 | vitamin D receptor binding(GO:0042809) |
| 0.0 | 0.1 | GO:0004726 | non-membrane spanning protein tyrosine phosphatase activity(GO:0004726) |
| 0.0 | 0.0 | GO:0042979 | ornithine decarboxylase regulator activity(GO:0042979) |
| 0.0 | 0.1 | GO:0000295 | adenine nucleotide transmembrane transporter activity(GO:0000295) purine ribonucleotide transmembrane transporter activity(GO:0005346) purine nucleotide transmembrane transporter activity(GO:0015216) |
| 0.0 | 0.1 | GO:0000339 | RNA cap binding(GO:0000339) |
| 0.0 | 0.1 | GO:0035197 | siRNA binding(GO:0035197) |
| 0.0 | 0.0 | GO:0004127 | cytidylate kinase activity(GO:0004127) |
| 0.0 | 0.5 | GO:0070063 | RNA polymerase binding(GO:0070063) |
| 0.0 | 0.8 | GO:0016763 | transferase activity, transferring pentosyl groups(GO:0016763) |
| 0.0 | 0.2 | GO:0071949 | FAD binding(GO:0071949) |
| 0.0 | 0.1 | GO:0005111 | type 2 fibroblast growth factor receptor binding(GO:0005111) |
| 0.0 | 0.1 | GO:0035242 | protein-arginine omega-N asymmetric methyltransferase activity(GO:0035242) |
| 0.0 | 0.1 | GO:0004416 | hydroxyacylglutathione hydrolase activity(GO:0004416) |
| 0.0 | 0.2 | GO:0008195 | phosphatidate phosphatase activity(GO:0008195) |
| 0.0 | 0.1 | GO:0004090 | carbonyl reductase (NADPH) activity(GO:0004090) |
| 0.0 | 0.1 | GO:0070053 | thrombospondin receptor activity(GO:0070053) |
| 0.0 | 0.2 | GO:0032183 | SUMO binding(GO:0032183) |
| 0.0 | 0.5 | GO:0031369 | translation initiation factor binding(GO:0031369) |
| 0.0 | 0.1 | GO:0050693 | LBD domain binding(GO:0050693) |
| 0.0 | 0.3 | GO:0043014 | alpha-tubulin binding(GO:0043014) |
| 0.0 | 0.1 | GO:0008422 | beta-glucosidase activity(GO:0008422) |
| 0.0 | 0.2 | GO:0070569 | uridylyltransferase activity(GO:0070569) |
| 0.0 | 0.1 | GO:0030297 | transmembrane receptor protein tyrosine kinase activator activity(GO:0030297) |
| 0.0 | 0.2 | GO:0050811 | GABA receptor binding(GO:0050811) |
| 0.0 | 0.1 | GO:0017176 | phosphatidylinositol N-acetylglucosaminyltransferase activity(GO:0017176) |
| 0.0 | 0.1 | GO:0015183 | L-aspartate transmembrane transporter activity(GO:0015183) |
| 0.0 | 0.1 | GO:0070653 | high-density lipoprotein particle receptor binding(GO:0070653) |
| 0.0 | 0.0 | GO:0061629 | RNA polymerase II sequence-specific DNA binding transcription factor binding(GO:0061629) |
| 0.0 | 0.1 | GO:0045294 | alpha-catenin binding(GO:0045294) |
| 0.0 | 0.1 | GO:0004017 | adenylate kinase activity(GO:0004017) |
| 0.0 | 0.1 | GO:0070180 | large ribosomal subunit rRNA binding(GO:0070180) |
| 0.0 | 0.0 | GO:0034814 | 2,3-dihydroxy DDT 1,2-dioxygenase activity(GO:0018542) phenanthrene dioxygenase activity(GO:0018555) 2,2',3-trihydroxybiphenyl dioxygenase activity(GO:0018556) 1,2-dihydroxyfluorene 1,1-alpha-dioxygenase activity(GO:0018557) 5,6-dihydroxy-3-methyl-2-oxo-1,2-dihydroquinoline dioxygenase activity(GO:0018558) 1,1-dichloro-2-(dihydroxy-4-chlorophenyl)-(4-chlorophenyl)ethene 1,2-dioxygenase activity(GO:0018559) protocatechuate 3,4-dioxygenase type II activity(GO:0018560) 2'-aminobiphenyl-2,3-diol 1,2-dioxygenase activity(GO:0018561) 3,4-dihydroxyfluorene 4,4-alpha-dioxygenase activity(GO:0018562) 2,3-dihydroxy-ethylbenzene 1,2-dioxygenase activity(GO:0018563) carbazole 1,9a-dioxygenase activity(GO:0018564) dihydroxydibenzothiophene dioxygenase activity(GO:0018565) 1,2-dihydroxynaphthalene-6-sulfonate 1,8a-dioxygenase activity(GO:0018566) styrene dioxygenase activity(GO:0018567) 3,4-dihydroxyphenanthrene dioxygenase activity(GO:0018568) hydroquinone 1,2-dioxygenase activity(GO:0018569) p-cumate 2,3-dioxygenase activity(GO:0018570) 2,3-dihydroxy-p-cumate dioxygenase activity(GO:0018571) 3,5-dichlorocatechol 1,2-dioxygenase activity(GO:0018572) 2-aminophenol 1,6-dioxygenase activity(GO:0018573) 2,6-dichloro-p-hydroquinone 1,2-dioxygenase activity(GO:0018574) chlorocatechol 1,2-dioxygenase activity(GO:0018575) catechol dioxygenase activity(GO:0019114) dihydroxyfluorene dioxygenase activity(GO:0019117) 5-aminosalicylate dioxygenase activity(GO:0034543) 3-hydroxy-2-naphthoate 2,3-dioxygenase activity(GO:0034803) benzo(a)pyrene 11,12-dioxygenase activity(GO:0034806) benzo(a)pyrene 4,5-dioxygenase activity(GO:0034808) 4,5-dihydroxybenzo(a)pyrene dioxygenase activity(GO:0034810) benzo(a)pyrene 9,10-dioxygenase activity(GO:0034811) 9,10-dihydroxybenzo(a)pyrene dioxygenase activity(GO:0034812) benzo(a)pyrene 7,8-dioxygenase activity(GO:0034813) 7,8-dihydroxy benzo(a)pyrene dioxygenase activity(GO:0034814) 1,2-dihydroxy-5,6,7,8-tetrahydronaphthalene extradiol dioxygenase activity(GO:0034827) 2-mercaptobenzothiazole dioxygenase activity(GO:0034834) pyridine-3,4-diol dioxygenase activity(GO:0034895) pyrene dioxygenase activity(GO:0034920) 4,5-dihydroxypyrene dioxygenase activity(GO:0034922) phenanthrene-4-carboxylate dioxygenase activity(GO:0034934) tetrachlorobenzene dioxygenase activity(GO:0034935) 4,6-dichloro-3-methylcatechol 1,2-dioxygenase activity(GO:0034936) 2,3-dihydroxydiphenyl ether dioxygenase activity(GO:0034955) diphenyl ether 1,2-dioxygenase activity(GO:0034956) arachidonate 8(S)-lipoxygenase activity(GO:0036403) 4-hydroxycatechol 1,2-dioxygenase activity(GO:0047074) |
| 0.0 | 0.0 | GO:0046975 | histone methyltransferase activity (H3-K36 specific)(GO:0046975) |
| 0.0 | 0.1 | GO:1990254 | keratin filament binding(GO:1990254) |
| 0.0 | 0.0 | GO:2001070 | starch binding(GO:2001070) |
| 0.0 | 0.0 | GO:0072345 | NAADP-sensitive calcium-release channel activity(GO:0072345) |
| 0.0 | 0.1 | GO:0019869 | chloride channel inhibitor activity(GO:0019869) |
| 0.0 | 0.0 | GO:0008310 | single-stranded DNA 3'-5' exodeoxyribonuclease activity(GO:0008310) |
| 0.0 | 0.4 | GO:0008408 | 3'-5' exonuclease activity(GO:0008408) |
| 0.0 | 0.1 | GO:0019763 | immunoglobulin receptor activity(GO:0019763) |
| 0.0 | 0.0 | GO:0071532 | ankyrin repeat binding(GO:0071532) |
| 0.0 | 0.0 | GO:0038064 | collagen receptor activity(GO:0038064) |
| 0.0 | 0.1 | GO:1990932 | 5.8S rRNA binding(GO:1990932) |
| 0.0 | 0.1 | GO:0016742 | hydroxymethyl-, formyl- and related transferase activity(GO:0016742) |
| 0.0 | 0.1 | GO:0032051 | clathrin light chain binding(GO:0032051) |
| 0.0 | 0.1 | GO:0061505 | DNA topoisomerase type II (ATP-hydrolyzing) activity(GO:0003918) DNA topoisomerase II activity(GO:0061505) |
| 0.0 | 0.3 | GO:0031489 | myosin V binding(GO:0031489) |
| 0.0 | 0.0 | GO:0034838 | enoyl-[acyl-carrier-protein] reductase activity(GO:0016631) 2,3-dihydroxy-2,3-dihydro-phenylpropionate dehydrogenase activity(GO:0018498) cis-2,3-dihydrodiol DDT dehydrogenase activity(GO:0018499) trans-9R,10R-dihydrodiolphenanthrene dehydrogenase activity(GO:0018500) cis-chlorobenzene dihydrodiol dehydrogenase activity(GO:0018501) 2,5-dichloro-2,5-cyclohexadiene-1,4-diol dehydrogenase activity(GO:0018502) trans-1,2-dihydrodiolphenanthrene dehydrogenase activity(GO:0018503) 3,4-dihydroxy-3,4-dihydrofluorene dehydrogenase activity(GO:0034790) benzo(a)pyrene-trans-11,12-dihydrodiol dehydrogenase activity(GO:0034805) benzo(a)pyrene-cis-4,5-dihydrodiol dehydrogenase activity(GO:0034809) citronellyl-CoA dehydrogenase activity(GO:0034824) menthone dehydrogenase activity(GO:0034838) phthalate 3,4-cis-dihydrodiol dehydrogenase activity(GO:0034912) cinnamate reductase activity(GO:0043786) NADPH-dependent curcumin reductase activity(GO:0052849) NADPH-dependent dihydrocurcumin reductase activity(GO:0052850) |
| 0.0 | 0.1 | GO:0071253 | connexin binding(GO:0071253) |
| 0.0 | 0.0 | GO:0004663 | Rab geranylgeranyltransferase activity(GO:0004663) |
| 0.0 | 0.3 | GO:0046961 | proton-transporting ATPase activity, rotational mechanism(GO:0046961) |
| 0.0 | 0.0 | GO:0097001 | ceramide binding(GO:0097001) |
| 0.0 | 0.0 | GO:0005087 | Ran guanyl-nucleotide exchange factor activity(GO:0005087) |
| 0.0 | 0.2 | GO:0016500 | protein-hormone receptor activity(GO:0016500) |
| 0.0 | 0.1 | GO:0005542 | folic acid binding(GO:0005542) |
| 0.0 | 0.0 | GO:0030911 | TPR domain binding(GO:0030911) |
| 0.0 | 0.2 | GO:0001784 | phosphotyrosine binding(GO:0001784) |
| 0.0 | 0.0 | GO:0050510 | N-acetylgalactosaminyl-proteoglycan 3-beta-glucuronosyltransferase activity(GO:0050510) |
| 0.0 | 0.0 | GO:0047499 | calcium-independent phospholipase A2 activity(GO:0047499) |
| 0.0 | 1.4 | GO:0004222 | metalloendopeptidase activity(GO:0004222) |
| 0.0 | 0.0 | GO:0048273 | mitogen-activated protein kinase p38 binding(GO:0048273) |
| 0.0 | 0.1 | GO:0004656 | procollagen-proline 4-dioxygenase activity(GO:0004656) |
| 0.0 | 0.1 | GO:0005113 | patched binding(GO:0005113) |
| 0.0 | 0.1 | GO:0030572 | cardiolipin synthase activity(GO:0008808) phosphatidyltransferase activity(GO:0030572) |
| 0.0 | 0.1 | GO:0047555 | 3',5'-cyclic-GMP phosphodiesterase activity(GO:0047555) |
| 0.0 | 0.1 | GO:0004955 | prostaglandin receptor activity(GO:0004955) |
| 0.0 | 0.0 | GO:0004813 | alanine-tRNA ligase activity(GO:0004813) |
| 0.0 | 0.3 | GO:0016765 | transferase activity, transferring alkyl or aryl (other than methyl) groups(GO:0016765) |
| 0.0 | 0.1 | GO:0004596 | peptide alpha-N-acetyltransferase activity(GO:0004596) |
| 0.0 | 0.0 | GO:0048408 | epidermal growth factor binding(GO:0048408) |
| 0.0 | 0.0 | GO:0005176 | ErbB-2 class receptor binding(GO:0005176) |
| 0.0 | 0.0 | GO:0070883 | pre-miRNA binding(GO:0070883) |
| 0.0 | 0.1 | GO:0051022 | Rho GDP-dissociation inhibitor binding(GO:0051022) |
| 0.0 | 0.1 | GO:0043023 | ribosomal large subunit binding(GO:0043023) |
| 0.0 | 0.1 | GO:0008179 | adenylate cyclase binding(GO:0008179) |
| 0.0 | 0.1 | GO:0016901 | oxidoreductase activity, acting on the CH-OH group of donors, quinone or similar compound as acceptor(GO:0016901) |
| 0.0 | 0.5 | GO:0000049 | tRNA binding(GO:0000049) |
| 0.0 | 0.1 | GO:0004169 | dolichyl-phosphate-mannose-protein mannosyltransferase activity(GO:0004169) |
| 0.0 | 0.1 | GO:0000099 | sulfur amino acid transmembrane transporter activity(GO:0000099) |
| 0.0 | 0.0 | GO:0000253 | 3-keto sterol reductase activity(GO:0000253) |
| 0.0 | 0.5 | GO:0004402 | histone acetyltransferase activity(GO:0004402) |
| 0.0 | 0.3 | GO:0051539 | 4 iron, 4 sulfur cluster binding(GO:0051539) |
| 0.0 | 0.1 | GO:0032050 | clathrin heavy chain binding(GO:0032050) |
| 0.0 | 0.0 | GO:0004345 | glucose-6-phosphate dehydrogenase activity(GO:0004345) |
| 0.0 | 0.1 | GO:0050501 | hyaluronan synthase activity(GO:0050501) |
| 0.0 | 0.0 | GO:0070538 | oleic acid binding(GO:0070538) |
| 0.0 | 0.1 | GO:0008599 | protein phosphatase type 1 regulator activity(GO:0008599) |
| 0.0 | 0.1 | GO:0051959 | dynein light intermediate chain binding(GO:0051959) |
| 0.0 | 0.2 | GO:0010857 | calcium-dependent protein serine/threonine kinase activity(GO:0009931) calcium-dependent protein kinase activity(GO:0010857) |
| 0.0 | 0.1 | GO:0034450 | ubiquitin-ubiquitin ligase activity(GO:0034450) |
| 0.0 | 0.0 | GO:0015057 | thrombin receptor activity(GO:0015057) |
| 0.0 | 0.0 | GO:0043262 | adenosine-diphosphatase activity(GO:0043262) |
| 0.0 | 0.3 | GO:0015175 | neutral amino acid transmembrane transporter activity(GO:0015175) |
| 0.0 | 0.0 | GO:0003829 | beta-1,3-galactosyl-O-glycosyl-glycoprotein beta-1,6-N-acetylglucosaminyltransferase activity(GO:0003829) |
| 0.0 | 0.0 | GO:0019788 | NEDD8 transferase activity(GO:0019788) |
| 0.0 | 0.1 | GO:0042500 | aspartic endopeptidase activity, intramembrane cleaving(GO:0042500) |
| 0.0 | 0.2 | GO:0051721 | protein phosphatase 2A binding(GO:0051721) |
| 0.0 | 0.0 | GO:0005250 | A-type (transient outward) potassium channel activity(GO:0005250) |
| 0.0 | 0.0 | GO:0005094 | Rho GDP-dissociation inhibitor activity(GO:0005094) |
| 0.0 | 0.1 | GO:0008198 | ferrous iron binding(GO:0008198) |
| 0.0 | 0.0 | GO:0089720 | caspase binding(GO:0089720) |
| 0.0 | 0.0 | GO:0004370 | glycerol kinase activity(GO:0004370) |
| 0.0 | 0.3 | GO:0052771 | coenzyme F390-A hydrolase activity(GO:0052770) coenzyme F390-G hydrolase activity(GO:0052771) |
| 0.0 | 0.1 | GO:0039706 | co-receptor binding(GO:0039706) |
| 0.0 | 0.2 | GO:0004889 | acetylcholine-activated cation-selective channel activity(GO:0004889) |
| 0.0 | 0.1 | GO:0004303 | estradiol 17-beta-dehydrogenase activity(GO:0004303) |
| 0.0 | 0.2 | GO:0070273 | phosphatidylinositol-4-phosphate binding(GO:0070273) |
| 0.0 | 0.2 | GO:0030544 | Hsp70 protein binding(GO:0030544) |
| 0.0 | 0.0 | GO:0001075 | transcription factor activity, RNA polymerase II core promoter sequence-specific binding involved in preinitiation complex assembly(GO:0001075) |
| 0.0 | 0.0 | GO:0052658 | inositol-1,4,5-trisphosphate 5-phosphatase activity(GO:0052658) |
| 0.0 | 0.0 | GO:0048531 | beta-1,3-galactosyltransferase activity(GO:0048531) |
| 0.0 | 0.2 | GO:0005248 | voltage-gated sodium channel activity(GO:0005248) voltage-gated ion channel activity involved in regulation of postsynaptic membrane potential(GO:1905030) |
| 0.0 | 0.0 | GO:0060228 | phosphatidylcholine-sterol O-acyltransferase activator activity(GO:0060228) |
| 0.0 | 0.3 | GO:0019894 | kinesin binding(GO:0019894) |
| 0.0 | 0.0 | GO:0008193 | tRNA guanylyltransferase activity(GO:0008193) |
| 0.0 | 0.2 | GO:0005540 | hyaluronic acid binding(GO:0005540) |
| 0.0 | 0.0 | GO:0016655 | oxidoreductase activity, acting on NAD(P)H, quinone or similar compound as acceptor(GO:0016655) |
| 0.0 | 0.0 | GO:0034235 | GPI anchor binding(GO:0034235) |
| 0.0 | 0.4 | GO:0019209 | kinase activator activity(GO:0019209) |
| 0.0 | 0.1 | GO:0008601 | protein phosphatase type 2A regulator activity(GO:0008601) |
| 0.0 | 0.1 | GO:0004383 | guanylate cyclase activity(GO:0004383) |
| 0.0 | 0.0 | GO:0050072 | m7G(5')pppN diphosphatase activity(GO:0050072) |
| 0.0 | 0.1 | GO:0051400 | BH domain binding(GO:0051400) |
| 0.0 | 0.0 | GO:0035671 | enone reductase activity(GO:0035671) |
| 0.0 | 0.1 | GO:0103116 | alpha-D-galactofuranose transporter activity(GO:0103116) |
| 0.0 | 0.1 | GO:0030346 | protein phosphatase 2B binding(GO:0030346) |
| 0.0 | 0.1 | GO:0032027 | myosin light chain binding(GO:0032027) |
| 0.0 | 0.1 | GO:0005523 | tropomyosin binding(GO:0005523) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.0 | 0.6 | PID NFKAPPAB ATYPICAL PATHWAY | Atypical NF-kappaB pathway |
| 0.0 | 1.2 | PID ECADHERIN STABILIZATION PATHWAY | Stabilization and expansion of the E-cadherin adherens junction |
| 0.0 | 0.8 | PID RXR VDR PATHWAY | RXR and RAR heterodimerization with other nuclear receptor |
| 0.0 | 0.2 | PID ERBB2 ERBB3 PATHWAY | ErbB2/ErbB3 signaling events |
| 0.0 | 0.9 | PID HIF2PATHWAY | HIF-2-alpha transcription factor network |
| 0.0 | 0.4 | PID ERB GENOMIC PATHWAY | Validated nuclear estrogen receptor beta network |
| 0.0 | 0.4 | PID ERBB NETWORK PATHWAY | ErbB receptor signaling network |
| 0.0 | 0.5 | PID WNT CANONICAL PATHWAY | Canonical Wnt signaling pathway |
| 0.0 | 0.3 | PID INSULIN GLUCOSE PATHWAY | Insulin-mediated glucose transport |
| 0.0 | 0.6 | ST G ALPHA I PATHWAY | G alpha i Pathway |
| 0.0 | 0.6 | PID ALK1 PATHWAY | ALK1 signaling events |
| 0.0 | 0.5 | PID SHP2 PATHWAY | SHP2 signaling |
| 0.0 | 0.8 | PID HNF3A PATHWAY | FOXA1 transcription factor network |
| 0.0 | 1.0 | PID HES HEY PATHWAY | Notch-mediated HES/HEY network |
| 0.0 | 0.3 | SA PTEN PATHWAY | PTEN is a tumor suppressor that dephosphorylates the lipid messenger phosphatidylinositol triphosphate. |
| 0.0 | 0.8 | PID HEDGEHOG GLI PATHWAY | Hedgehog signaling events mediated by Gli proteins |
| 0.0 | 0.5 | PID AURORA A PATHWAY | Aurora A signaling |
| 0.0 | 0.3 | PID CIRCADIAN PATHWAY | Circadian rhythm pathway |
| 0.0 | 0.3 | SA CASPASE CASCADE | Apoptosis is mediated by caspases, cysteine proteases arranged in a proteolytic cascade. |
| 0.0 | 0.2 | PID ANTHRAX PATHWAY | Cellular roles of Anthrax toxin |
| 0.0 | 0.0 | PID ERBB4 PATHWAY | ErbB4 signaling events |
| 0.0 | 0.1 | SA REG CASCADE OF CYCLIN EXPR | Expression of cyclins regulates progression through the cell cycle by activating cyclin-dependent kinases. |
| 0.0 | 0.3 | PID PI3K PLC TRK PATHWAY | Trk receptor signaling mediated by PI3K and PLC-gamma |
| 0.0 | 0.4 | ST WNT BETA CATENIN PATHWAY | Wnt/beta-catenin Pathway |
| 0.0 | 0.2 | ST TYPE I INTERFERON PATHWAY | Type I Interferon (alpha/beta IFN) Pathway |
| 0.0 | 0.9 | PID TRKR PATHWAY | Neurotrophic factor-mediated Trk receptor signaling |
| 0.0 | 0.0 | SIG PIP3 SIGNALING IN B LYMPHOCYTES | Genes related to PIP3 signaling in B lymphocytes |
| 0.0 | 0.4 | PID BARD1 PATHWAY | BARD1 signaling events |
| 0.0 | 0.0 | PID IL8 CXCR1 PATHWAY | IL8- and CXCR1-mediated signaling events |
| 0.0 | 0.3 | PID IL23 PATHWAY | IL23-mediated signaling events |
| 0.0 | 0.6 | PID DELTA NP63 PATHWAY | Validated transcriptional targets of deltaNp63 isoforms |
| 0.0 | 0.1 | PID IL1 PATHWAY | IL1-mediated signaling events |
| 0.0 | 0.2 | PID NEPHRIN NEPH1 PATHWAY | Nephrin/Neph1 signaling in the kidney podocyte |
| 0.0 | 0.1 | PID ATR PATHWAY | ATR signaling pathway |
| 0.0 | 0.2 | PID NCADHERIN PATHWAY | N-cadherin signaling events |
| 0.0 | 0.2 | PID S1P META PATHWAY | Sphingosine 1-phosphate (S1P) pathway |
| 0.0 | 0.2 | PID LKB1 PATHWAY | LKB1 signaling events |
| 0.0 | 0.1 | ST B CELL ANTIGEN RECEPTOR | B Cell Antigen Receptor |
| 0.0 | 0.2 | ST PHOSPHOINOSITIDE 3 KINASE PATHWAY | PI3K Pathway |
| 0.0 | 0.1 | PID SYNDECAN 3 PATHWAY | Syndecan-3-mediated signaling events |
| 0.0 | 0.0 | PID THROMBIN PAR4 PATHWAY | PAR4-mediated thrombin signaling events |
| 0.0 | 0.3 | PID ILK PATHWAY | Integrin-linked kinase signaling |
| 0.0 | 0.0 | PID IL2 PI3K PATHWAY | IL2 signaling events mediated by PI3K |
| 0.0 | 0.1 | SA MMP CYTOKINE CONNECTION | Cytokines can induce activation of matrix metalloproteinases, which degrade extracellular matrix. |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.1 | 0.1 | REACTOME TRIGLYCERIDE BIOSYNTHESIS | Genes involved in Triglyceride Biosynthesis |
| 0.1 | 0.9 | REACTOME ALPHA LINOLENIC ACID ALA METABOLISM | Genes involved in alpha-linolenic acid (ALA) metabolism |
| 0.1 | 0.6 | REACTOME TRYPTOPHAN CATABOLISM | Genes involved in Tryptophan catabolism |
| 0.1 | 1.0 | REACTOME ANTIGEN PRESENTATION FOLDING ASSEMBLY AND PEPTIDE LOADING OF CLASS I MHC | Genes involved in Antigen Presentation: Folding, assembly and peptide loading of class I MHC |
| 0.1 | 0.8 | REACTOME ENDOGENOUS STEROLS | Genes involved in Endogenous sterols |
| 0.1 | 0.2 | REACTOME G BETA GAMMA SIGNALLING THROUGH PLC BETA | Genes involved in G beta:gamma signalling through PLC beta |
| 0.1 | 0.5 | REACTOME CALNEXIN CALRETICULIN CYCLE | Genes involved in Calnexin/calreticulin cycle |
| 0.1 | 0.9 | REACTOME SYNTHESIS OF PC | Genes involved in Synthesis of PC |
| 0.1 | 0.3 | REACTOME BETA DEFENSINS | Genes involved in Beta defensins |
| 0.1 | 0.1 | REACTOME PEPTIDE CHAIN ELONGATION | Genes involved in Peptide chain elongation |
| 0.0 | 0.6 | REACTOME PURINE SALVAGE | Genes involved in Purine salvage |
| 0.0 | 0.3 | REACTOME NEGATIVE REGULATION OF THE PI3K AKT NETWORK | Genes involved in Negative regulation of the PI3K/AKT network |
| 0.0 | 0.1 | REACTOME SHC RELATED EVENTS | Genes involved in SHC-related events |
| 0.0 | 0.7 | REACTOME SIGNALING BY NODAL | Genes involved in Signaling by NODAL |
| 0.0 | 0.4 | REACTOME ACTIVATION OF THE AP1 FAMILY OF TRANSCRIPTION FACTORS | Genes involved in Activation of the AP-1 family of transcription factors |
| 0.0 | 0.2 | REACTOME IL 6 SIGNALING | Genes involved in Interleukin-6 signaling |
| 0.0 | 0.1 | REACTOME SIGNALING BY EGFR IN CANCER | Genes involved in Signaling by EGFR in Cancer |
| 0.0 | 0.4 | REACTOME REGULATION OF RHEB GTPASE ACTIVITY BY AMPK | Genes involved in Regulation of Rheb GTPase activity by AMPK |
| 0.0 | 0.6 | REACTOME TERMINATION OF O GLYCAN BIOSYNTHESIS | Genes involved in Termination of O-glycan biosynthesis |
| 0.0 | 0.3 | REACTOME ABACAVIR TRANSPORT AND METABOLISM | Genes involved in Abacavir transport and metabolism |
| 0.0 | 0.1 | REACTOME SYNTHESIS OF BILE ACIDS AND BILE SALTS VIA 24 HYDROXYCHOLESTEROL | Genes involved in Synthesis of bile acids and bile salts via 24-hydroxycholesterol |
| 0.0 | 0.3 | REACTOME G2 M DNA DAMAGE CHECKPOINT | Genes involved in G2/M DNA damage checkpoint |
| 0.0 | 0.3 | REACTOME PYRIMIDINE CATABOLISM | Genes involved in Pyrimidine catabolism |
| 0.0 | 0.6 | REACTOME NEPHRIN INTERACTIONS | Genes involved in Nephrin interactions |
| 0.0 | 0.6 | REACTOME SHC1 EVENTS IN ERBB4 SIGNALING | Genes involved in SHC1 events in ERBB4 signaling |
| 0.0 | 0.3 | REACTOME SYNTHESIS OF PIPS AT THE LATE ENDOSOME MEMBRANE | Genes involved in Synthesis of PIPs at the late endosome membrane |
| 0.0 | 0.4 | REACTOME CTNNB1 PHOSPHORYLATION CASCADE | Genes involved in Beta-catenin phosphorylation cascade |
| 0.0 | 0.1 | REACTOME SPRY REGULATION OF FGF SIGNALING | Genes involved in Spry regulation of FGF signaling |
| 0.0 | 0.3 | REACTOME UNWINDING OF DNA | Genes involved in Unwinding of DNA |
| 0.0 | 0.2 | REACTOME PROLONGED ERK ACTIVATION EVENTS | Genes involved in Prolonged ERK activation events |
| 0.0 | 1.3 | REACTOME FORMATION OF THE TERNARY COMPLEX AND SUBSEQUENTLY THE 43S COMPLEX | Genes involved in Formation of the ternary complex, and subsequently, the 43S complex |
| 0.0 | 0.2 | REACTOME INTEGRATION OF PROVIRUS | Genes involved in Integration of provirus |
| 0.0 | 0.0 | REACTOME MRNA DECAY BY 3 TO 5 EXORIBONUCLEASE | Genes involved in mRNA Decay by 3' to 5' Exoribonuclease |
| 0.0 | 0.1 | REACTOME SIGNAL ATTENUATION | Genes involved in Signal attenuation |
| 0.0 | 0.4 | REACTOME REGULATION OF GENE EXPRESSION IN BETA CELLS | Genes involved in Regulation of gene expression in beta cells |
| 0.0 | 0.5 | REACTOME GLUTATHIONE CONJUGATION | Genes involved in Glutathione conjugation |
| 0.0 | 0.2 | REACTOME PURINE CATABOLISM | Genes involved in Purine catabolism |
| 0.0 | 0.2 | REACTOME CDC6 ASSOCIATION WITH THE ORC ORIGIN COMPLEX | Genes involved in CDC6 association with the ORC:origin complex |
| 0.0 | 1.1 | REACTOME MITOCHONDRIAL PROTEIN IMPORT | Genes involved in Mitochondrial Protein Import |
| 0.0 | 0.4 | REACTOME PROSTACYCLIN SIGNALLING THROUGH PROSTACYCLIN RECEPTOR | Genes involved in Prostacyclin signalling through prostacyclin receptor |
| 0.0 | 0.3 | REACTOME SIGNALING BY FGFR1 FUSION MUTANTS | Genes involved in Signaling by FGFR1 fusion mutants |
| 0.0 | 0.4 | REACTOME SULFUR AMINO ACID METABOLISM | Genes involved in Sulfur amino acid metabolism |
| 0.0 | 0.2 | REACTOME PROLACTIN RECEPTOR SIGNALING | Genes involved in Prolactin receptor signaling |
| 0.0 | 0.2 | REACTOME NFKB IS ACTIVATED AND SIGNALS SURVIVAL | Genes involved in NF-kB is activated and signals survival |
| 0.0 | 0.0 | REACTOME INSULIN RECEPTOR SIGNALLING CASCADE | Genes involved in Insulin receptor signalling cascade |
| 0.0 | 0.3 | REACTOME METABOLISM OF POLYAMINES | Genes involved in Metabolism of polyamines |
| 0.0 | 0.0 | REACTOME NEP NS2 INTERACTS WITH THE CELLULAR EXPORT MACHINERY | Genes involved in NEP/NS2 Interacts with the Cellular Export Machinery |
| 0.0 | 0.2 | REACTOME THE ROLE OF NEF IN HIV1 REPLICATION AND DISEASE PATHOGENESIS | Genes involved in The role of Nef in HIV-1 replication and disease pathogenesis |
| 0.0 | 0.6 | REACTOME PHASE1 FUNCTIONALIZATION OF COMPOUNDS | Genes involved in Phase 1 - Functionalization of compounds |
| 0.0 | 3.0 | REACTOME METABOLISM OF AMINO ACIDS AND DERIVATIVES | Genes involved in Metabolism of amino acids and derivatives |
| 0.0 | 0.3 | REACTOME DESTABILIZATION OF MRNA BY KSRP | Genes involved in Destabilization of mRNA by KSRP |
| 0.0 | 0.3 | REACTOME METABOLISM OF PORPHYRINS | Genes involved in Metabolism of porphyrins |
| 0.0 | 0.3 | REACTOME MRNA DECAY BY 5 TO 3 EXORIBONUCLEASE | Genes involved in mRNA Decay by 5' to 3' Exoribonuclease |
| 0.0 | 0.3 | REACTOME GLUTAMATE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Glutamate Neurotransmitter Release Cycle |
| 0.0 | 0.4 | REACTOME DARPP 32 EVENTS | Genes involved in DARPP-32 events |
| 0.0 | 0.2 | REACTOME SIGNAL REGULATORY PROTEIN SIRP FAMILY INTERACTIONS | Genes involved in Signal regulatory protein (SIRP) family interactions |
| 0.0 | 0.2 | REACTOME RAP1 SIGNALLING | Genes involved in Rap1 signalling |
| 0.0 | 0.3 | REACTOME FATTY ACYL COA BIOSYNTHESIS | Genes involved in Fatty Acyl-CoA Biosynthesis |
| 0.0 | 0.2 | REACTOME PD1 SIGNALING | Genes involved in PD-1 signaling |
| 0.0 | 0.5 | REACTOME SPHINGOLIPID DE NOVO BIOSYNTHESIS | Genes involved in Sphingolipid de novo biosynthesis |
| 0.0 | 0.1 | REACTOME G BETA GAMMA SIGNALLING THROUGH PI3KGAMMA | Genes involved in G beta:gamma signalling through PI3Kgamma |
| 0.0 | 0.3 | REACTOME DOWNREGULATION OF TGF BETA RECEPTOR SIGNALING | Genes involved in Downregulation of TGF-beta receptor signaling |
| 0.0 | 0.1 | REACTOME ELONGATION ARREST AND RECOVERY | Genes involved in Elongation arrest and recovery |
| 0.0 | 0.0 | REACTOME PHOSPHORYLATION OF CD3 AND TCR ZETA CHAINS | Genes involved in Phosphorylation of CD3 and TCR zeta chains |
| 0.0 | 0.0 | REACTOME ACYL CHAIN REMODELLING OF PS | Genes involved in Acyl chain remodelling of PS |
| 0.0 | 0.1 | REACTOME NRIF SIGNALS CELL DEATH FROM THE NUCLEUS | Genes involved in NRIF signals cell death from the nucleus |
| 0.0 | 0.2 | REACTOME PURINE RIBONUCLEOSIDE MONOPHOSPHATE BIOSYNTHESIS | Genes involved in Purine ribonucleoside monophosphate biosynthesis |
| 0.0 | 0.0 | REACTOME HOST INTERACTIONS OF HIV FACTORS | Genes involved in Host Interactions of HIV factors |
| 0.0 | 0.0 | REACTOME ACTIVATION OF NF KAPPAB IN B CELLS | Genes involved in Activation of NF-kappaB in B Cells |
| 0.0 | 0.0 | REACTOME SIGNALING BY NOTCH3 | Genes involved in Signaling by NOTCH3 |
| 0.0 | 0.0 | REACTOME SLBP DEPENDENT PROCESSING OF REPLICATION DEPENDENT HISTONE PRE MRNAS | Genes involved in SLBP Dependent Processing of Replication-Dependent Histone Pre-mRNAs |
| 0.0 | 0.2 | REACTOME HDL MEDIATED LIPID TRANSPORT | Genes involved in HDL-mediated lipid transport |
| 0.0 | 0.0 | REACTOME GAP JUNCTION DEGRADATION | Genes involved in Gap junction degradation |
| 0.0 | 0.1 | REACTOME NUCLEAR SIGNALING BY ERBB4 | Genes involved in Nuclear signaling by ERBB4 |
| 0.0 | 0.0 | REACTOME SYNTHESIS OF PIPS AT THE EARLY ENDOSOME MEMBRANE | Genes involved in Synthesis of PIPs at the early endosome membrane |
| 0.0 | 0.1 | REACTOME HORMONE LIGAND BINDING RECEPTORS | Genes involved in Hormone ligand-binding receptors |
| 0.0 | 0.2 | REACTOME PYRIMIDINE METABOLISM | Genes involved in Pyrimidine metabolism |
| 0.0 | 0.2 | REACTOME TRAF6 MEDIATED INDUCTION OF TAK1 COMPLEX | Genes involved in TRAF6 mediated induction of TAK1 complex |
| 0.0 | 0.3 | REACTOME BIOLOGICAL OXIDATIONS | Genes involved in Biological oxidations |
| 0.0 | 0.3 | REACTOME KINESINS | Genes involved in Kinesins |
| 0.0 | 0.3 | REACTOME CIRCADIAN REPRESSION OF EXPRESSION BY REV ERBA | Genes involved in Circadian Repression of Expression by REV-ERBA |
| 0.0 | 0.3 | REACTOME G1 PHASE | Genes involved in G1 Phase |
| 0.0 | 0.1 | REACTOME ER PHAGOSOME PATHWAY | Genes involved in ER-Phagosome pathway |
| 0.0 | 0.3 | REACTOME ADHERENS JUNCTIONS INTERACTIONS | Genes involved in Adherens junctions interactions |
| 0.0 | 0.2 | REACTOME P2Y RECEPTORS | Genes involved in P2Y receptors |
| 0.0 | 0.3 | REACTOME TRANSPORT TO THE GOLGI AND SUBSEQUENT MODIFICATION | Genes involved in Transport to the Golgi and subsequent modification |
| 0.0 | 0.5 | REACTOME AMINE LIGAND BINDING RECEPTORS | Genes involved in Amine ligand-binding receptors |
| 0.0 | 0.1 | REACTOME REGULATION OF AMPK ACTIVITY VIA LKB1 | Genes involved in Regulation of AMPK activity via LKB1 |
| 0.0 | 0.1 | REACTOME HIGHLY CALCIUM PERMEABLE POSTSYNAPTIC NICOTINIC ACETYLCHOLINE RECEPTORS | Genes involved in Highly calcium permeable postsynaptic nicotinic acetylcholine receptors |
| 0.0 | 0.1 | REACTOME ACTIVATION OF RAC | Genes involved in Activation of Rac |
| 0.0 | 0.6 | REACTOME MHC CLASS II ANTIGEN PRESENTATION | Genes involved in MHC class II antigen presentation |
| 0.0 | 0.5 | REACTOME MRNA SPLICING MINOR PATHWAY | Genes involved in mRNA Splicing - Minor Pathway |
| 0.0 | 0.1 | REACTOME SIGNALING BY FGFR1 MUTANTS | Genes involved in Signaling by FGFR1 mutants |
| 0.0 | 0.1 | REACTOME TRAFFICKING AND PROCESSING OF ENDOSOMAL TLR | Genes involved in Trafficking and processing of endosomal TLR |
| 0.0 | 0.1 | REACTOME PACKAGING OF TELOMERE ENDS | Genes involved in Packaging Of Telomere Ends |
| 0.0 | 0.0 | REACTOME EGFR DOWNREGULATION | Genes involved in EGFR downregulation |
| 0.0 | 0.3 | REACTOME STRIATED MUSCLE CONTRACTION | Genes involved in Striated Muscle Contraction |
| 0.0 | 0.2 | REACTOME FANCONI ANEMIA PATHWAY | Genes involved in Fanconi Anemia pathway |
| 0.0 | 0.2 | REACTOME SIGNALING BY HIPPO | Genes involved in Signaling by Hippo |
| 0.0 | 0.1 | REACTOME CITRIC ACID CYCLE TCA CYCLE | Genes involved in Citric acid cycle (TCA cycle) |
| 0.0 | 0.5 | REACTOME CHEMOKINE RECEPTORS BIND CHEMOKINES | Genes involved in Chemokine receptors bind chemokines |
| 0.0 | 0.1 | REACTOME SEMA3A PAK DEPENDENT AXON REPULSION | Genes involved in Sema3A PAK dependent Axon repulsion |
| 0.0 | 0.2 | REACTOME MITOCHONDRIAL TRNA AMINOACYLATION | Genes involved in Mitochondrial tRNA aminoacylation |
| 0.0 | 0.2 | REACTOME METAL ION SLC TRANSPORTERS | Genes involved in Metal ion SLC transporters |
| 0.0 | 0.0 | REACTOME ACTIVATION OF CHAPERONE GENES BY ATF6 ALPHA | Genes involved in Activation of Chaperone Genes by ATF6-alpha |
| 0.0 | 0.2 | REACTOME STEROID HORMONES | Genes involved in Steroid hormones |
| 0.0 | 0.1 | REACTOME CELL EXTRACELLULAR MATRIX INTERACTIONS | Genes involved in Cell-extracellular matrix interactions |
| 0.0 | 0.0 | REACTOME ENDOSOMAL VACUOLAR PATHWAY | Genes involved in Endosomal/Vacuolar pathway |
| 0.0 | 0.2 | REACTOME REGULATION OF IFNA SIGNALING | Genes involved in Regulation of IFNA signaling |
| 0.0 | 0.2 | REACTOME RNA POL II PRE TRANSCRIPTION EVENTS | Genes involved in RNA Polymerase II Pre-transcription Events |