| Gene Symbol | Gene ID | Gene Info |
|---|---|---|
|
Ebf1
|
ENSMUSG00000078561.3 | early B cell factor 1 |
|
Ebf1
|
ENSMUSG00000057098.8 | early B cell factor 1 |
| CRE | Gene | Distance | Association probability | Pearson corr. coef. | P-value | Plot |
|---|---|---|---|---|---|---|
| chr11_45008209_45008377 | Ebf1 | 96155 | 0.076949 | 0.94 | 5.9e-03 | Click! |
| chr11_44617155_44617316 | Ebf1 | 82 | 0.691631 | -0.79 | 6.2e-02 | Click! |
| chr11_44968801_44969009 | Ebf1 | 56767 | 0.152770 | 0.71 | 1.1e-01 | Click! |
| chr11_44944481_44944665 | Ebf1 | 32435 | 0.228620 | 0.70 | 1.2e-01 | Click! |
| chr11_44893756_44893925 | Ebf1 | 18298 | 0.274457 | 0.60 | 2.1e-01 | Click! |
Move your cursor over a bar to see sample name and corresponding Z-value.
| Cis Regulatory Element (CRE) | Target Score | Top associated gene | Gene Info | Distance of CRE to TSS | CRE/Gene association probability |
|---|---|---|---|---|---|
| chr19_44401904_44402310 | 1.74 |
Scd1 |
stearoyl-Coenzyme A desaturase 1 |
4583 |
0.17 |
| chr1_21245041_21245248 | 1.69 |
Gsta3 |
glutathione S-transferase, alpha 3 |
4515 |
0.13 |
| chr4_149980056_149980645 | 1.53 |
H6pd |
hexose-6-phosphate dehydrogenase (glucose 1-dehydrogenase) |
20915 |
0.13 |
| chr17_28518503_28518785 | 1.48 |
Fkbp5 |
FK506 binding protein 5 |
1117 |
0.22 |
| chr19_10239849_10240587 | 1.46 |
Myrf |
myelin regulatory factor |
386 |
0.77 |
| chr11_75173089_75173918 | 1.40 |
Mir212 |
microRNA 212 |
115 |
0.56 |
| chr1_74042665_74042993 | 1.39 |
Tns1 |
tensin 1 |
5672 |
0.24 |
| chr7_30361694_30362080 | 1.38 |
Lrfn3 |
leucine rich repeat and fibronectin type III domain containing 3 |
885 |
0.31 |
| chr2_26588564_26589214 | 1.38 |
Egfl7 |
EGF-like domain 7 |
346 |
0.71 |
| chr1_59152166_59152334 | 1.35 |
Mpp4 |
membrane protein, palmitoylated 4 (MAGUK p55 subfamily member 4) |
97 |
0.93 |
| chr1_91458255_91458771 | 1.34 |
Per2 |
period circadian clock 2 |
811 |
0.48 |
| chr4_100114235_100114698 | 1.33 |
Gm12701 |
predicted gene 12701 |
5155 |
0.23 |
| chr8_35387028_35387898 | 1.33 |
Ppp1r3b |
protein phosphatase 1, regulatory subunit 3B |
10803 |
0.16 |
| chr6_48429245_48429448 | 1.27 |
Gm24325 |
predicted gene, 24325 |
8577 |
0.1 |
| chr3_116329378_116329892 | 1.26 |
Gm29151 |
predicted gene 29151 |
20468 |
0.17 |
| chr3_97645418_97646002 | 1.25 |
Prkab2 |
protein kinase, AMP-activated, beta 2 non-catalytic subunit |
12483 |
0.13 |
| chr3_116321877_116322041 | 1.23 |
Gm29151 |
predicted gene 29151 |
28144 |
0.15 |
| chr2_31477347_31478122 | 1.22 |
Ass1 |
argininosuccinate synthetase 1 |
7527 |
0.19 |
| chr1_120112071_120112794 | 1.21 |
Dbi |
diazepam binding inhibitor |
7706 |
0.18 |
| chr15_81275696_81275852 | 1.21 |
8430426J06Rik |
RIKEN cDNA 8430426J06 gene |
23912 |
0.13 |
| chr2_31493649_31493953 | 1.18 |
Ass1 |
argininosuccinate synthetase 1 |
3971 |
0.22 |
| chr11_113132125_113132479 | 1.15 |
2610035D17Rik |
RIKEN cDNA 2610035D17 gene |
40775 |
0.19 |
| chr5_123975512_123975863 | 1.13 |
Hip1r |
huntingtin interacting protein 1 related |
2059 |
0.19 |
| chr9_48717198_48717480 | 1.13 |
Nnmt |
nicotinamide N-methyltransferase |
112186 |
0.06 |
| chr7_98351056_98351207 | 1.11 |
Tsku |
tsukushi, small leucine rich proteoglycan |
8948 |
0.17 |
| chr3_138229698_138229849 | 1.09 |
Adh7 |
alcohol dehydrogenase 7 (class IV), mu or sigma polypeptide |
1722 |
0.25 |
| chr6_72117206_72117587 | 1.07 |
St3gal5 |
ST3 beta-galactoside alpha-2,3-sialyltransferase 5 |
2164 |
0.2 |
| chr1_133694912_133695208 | 1.06 |
Lax1 |
lymphocyte transmembrane adaptor 1 |
4952 |
0.15 |
| chr3_138287619_138288216 | 1.05 |
Adh1 |
alcohol dehydrogenase 1 (class I) |
10266 |
0.12 |
| chr18_3507262_3507648 | 1.05 |
Bambi |
BMP and activin membrane-bound inhibitor |
468 |
0.77 |
| chr3_94398765_94399136 | 1.03 |
Lingo4 |
leucine rich repeat and Ig domain containing 4 |
433 |
0.59 |
| chr11_57973304_57973606 | 1.03 |
Gm12249 |
predicted gene 12249 |
321 |
0.87 |
| chr7_30942773_30943144 | 1.02 |
Hamp |
hepcidin antimicrobial peptide |
1074 |
0.25 |
| chr2_180589607_180589819 | 1.01 |
Ogfr |
opioid growth factor receptor |
251 |
0.89 |
| chr2_32525017_32525309 | 0.99 |
Gm13412 |
predicted gene 13412 |
132 |
0.92 |
| chr15_88858344_88858998 | 0.98 |
Pim3 |
proviral integration site 3 |
3515 |
0.17 |
| chr9_48737793_48738215 | 0.98 |
Zbtb16 |
zinc finger and BTB domain containing 16 |
97941 |
0.07 |
| chr9_108089036_108089891 | 0.98 |
Apeh |
acylpeptide hydrolase |
943 |
0.28 |
| chr7_13005790_13006506 | 0.96 |
Zbtb45 |
zinc finger and BTB domain containing 45 |
3652 |
0.09 |
| chr11_76446356_76446516 | 0.96 |
Abr |
active BCR-related gene |
9216 |
0.19 |
| chr6_137784539_137784690 | 0.96 |
Dera |
deoxyribose-phosphate aldolase (putative) |
3791 |
0.29 |
| chr2_31517780_31518546 | 0.96 |
Ass1 |
argininosuccinate synthetase 1 |
327 |
0.88 |
| chr19_46591249_46591400 | 0.96 |
Sfxn2 |
sideroflexin 2 |
203 |
0.92 |
| chr11_120813788_120814608 | 0.95 |
Fasn |
fatty acid synthase |
1257 |
0.26 |
| chr7_101301283_101301902 | 0.94 |
Atg16l2 |
autophagy related 16-like 2 (S. cerevisiae) |
435 |
0.73 |
| chr15_97033440_97033790 | 0.94 |
Slc38a4 |
solute carrier family 38, member 4 |
2404 |
0.4 |
| chr12_8498284_8498435 | 0.93 |
Rhob |
ras homolog family member B |
1650 |
0.31 |
| chr15_84640118_84640296 | 0.93 |
Prr5 |
proline rich 5 (renal) |
29413 |
0.16 |
| chr1_90915178_90915329 | 0.93 |
Mlph |
melanophilin |
168 |
0.94 |
| chr9_35110223_35110410 | 0.93 |
St3gal4 |
ST3 beta-galactoside alpha-2,3-sialyltransferase 4 |
3649 |
0.17 |
| chr4_118365053_118365204 | 0.93 |
Szt2 |
SZT2 subunit of KICSTOR complex |
62 |
0.96 |
| chr9_64045140_64045914 | 0.92 |
Gm25606 |
predicted gene, 25606 |
2969 |
0.17 |
| chr17_35866032_35866679 | 0.92 |
Ppp1r18 |
protein phosphatase 1, regulatory subunit 18 |
260 |
0.6 |
| chr8_117300013_117300240 | 0.92 |
Cmip |
c-Maf inducing protein |
43009 |
0.17 |
| chr19_59367680_59367885 | 0.91 |
Pdzd8 |
PDZ domain containing 8 |
22002 |
0.13 |
| chr3_14857979_14858130 | 0.91 |
Car3 |
carbonic anhydrase 3 |
5458 |
0.2 |
| chr14_59203808_59204018 | 0.91 |
Rcbtb1 |
regulator of chromosome condensation (RCC1) and BTB (POZ) domain containing protein 1 |
1700 |
0.35 |
| chr9_44512040_44512495 | 0.89 |
Bcl9l |
B cell CLL/lymphoma 9-like |
12995 |
0.07 |
| chr3_116321617_116321772 | 0.89 |
Gm29151 |
predicted gene 29151 |
28409 |
0.15 |
| chr6_124717176_124717345 | 0.88 |
Gm29008 |
predicted gene 29008 |
684 |
0.23 |
| chr5_125040097_125040498 | 0.88 |
Ncor2 |
nuclear receptor co-repressor 2 |
2515 |
0.25 |
| chr4_154293898_154294099 | 0.88 |
Arhgef16 |
Rho guanine nucleotide exchange factor (GEF) 16 |
5894 |
0.17 |
| chr8_122696911_122697102 | 0.87 |
Gm10612 |
predicted gene 10612 |
854 |
0.41 |
| chr8_35389060_35389235 | 0.86 |
Ppp1r3b |
protein phosphatase 1, regulatory subunit 3B |
12487 |
0.15 |
| chr7_24270544_24270695 | 0.86 |
Zfp93 |
zinc finger protein 93 |
6 |
0.94 |
| chr4_49380291_49380442 | 0.86 |
Acnat2 |
acyl-coenzyme A amino acid N-acyltransferase 2 |
3210 |
0.18 |
| chr3_106482771_106483037 | 0.85 |
Dennd2d |
DENN/MADD domain containing 2D |
454 |
0.49 |
| chr8_93176962_93177159 | 0.85 |
Ces1d |
carboxylesterase 1D |
1771 |
0.27 |
| chr13_46735806_46736396 | 0.85 |
Nup153 |
nucleoporin 153 |
8161 |
0.17 |
| chr19_7159948_7160188 | 0.85 |
Otub1 |
OTU domain, ubiquitin aldehyde binding 1 |
40396 |
0.09 |
| chr19_46140539_46140690 | 0.85 |
Pitx3 |
paired-like homeodomain transcription factor 3 |
369 |
0.79 |
| chr12_103487843_103488004 | 0.84 |
Gm47267 |
predicted gene, 47267 |
4481 |
0.14 |
| chr8_70717164_70717873 | 0.84 |
Gm3336 |
predicted gene 3336 |
1025 |
0.27 |
| chr17_15632191_15632370 | 0.84 |
4933401D09Rik |
RIKEN cDNA 4933401D09 gene |
492 |
0.76 |
| chr19_44399005_44399361 | 0.84 |
Scd1 |
stearoyl-Coenzyme A desaturase 1 |
7507 |
0.15 |
| chr5_25104240_25104526 | 0.84 |
2900005J15Rik |
RIKEN cDNA 2900005J15 gene |
2925 |
0.2 |
| chr12_84218994_84219251 | 0.83 |
Elmsan1 |
ELM2 and Myb/SANT-like domain containing 1 |
241 |
0.86 |
| chr12_8796924_8797075 | 0.82 |
Sdc1 |
syndecan 1 |
25196 |
0.16 |
| chr4_9096222_9096664 | 0.82 |
Gm23423 |
predicted gene, 23423 |
113560 |
0.06 |
| chr6_72133502_72133653 | 0.82 |
4933431G14Rik |
RIKEN cDNA 4933431G14 gene |
10380 |
0.12 |
| chr7_98355230_98355493 | 0.81 |
Tsku |
tsukushi, small leucine rich proteoglycan |
4718 |
0.19 |
| chr3_144110073_144110233 | 0.81 |
Gm34078 |
predicted gene, 34078 |
25601 |
0.2 |
| chr17_28519046_28519420 | 0.81 |
Gm49861 |
predicted gene, 49861 |
775 |
0.35 |
| chr15_68928899_68929092 | 0.81 |
Khdrbs3 |
KH domain containing, RNA binding, signal transduction associated 3 |
274 |
0.93 |
| chr17_47593664_47594464 | 0.81 |
Ccnd3 |
cyclin D3 |
249 |
0.86 |
| chr2_31487515_31488471 | 0.81 |
Ass1 |
argininosuccinate synthetase 1 |
9779 |
0.18 |
| chr15_59067650_59068255 | 0.80 |
Mtss1 |
MTSS I-BAR domain containing 1 |
12488 |
0.22 |
| chr7_30484338_30484496 | 0.80 |
Nphs1 |
nephrosis 1, nephrin |
498 |
0.41 |
| chr18_12716045_12717219 | 0.80 |
Mir1948 |
microRNA 1948 |
1821 |
0.27 |
| chr14_61680870_61681697 | 0.80 |
Gm37472 |
predicted gene, 37472 |
211 |
0.83 |
| chr4_63251381_63251799 | 0.79 |
Mir455 |
microRNA 455 |
5261 |
0.19 |
| chr18_38176274_38176683 | 0.79 |
Pcdh1 |
protocadherin 1 |
26685 |
0.12 |
| chr2_31519156_31519420 | 0.79 |
Ass1 |
argininosuccinate synthetase 1 |
798 |
0.61 |
| chr19_58369154_58369339 | 0.79 |
Gfra1 |
glial cell line derived neurotrophic factor family receptor alpha 1 |
85220 |
0.09 |
| chr3_116205546_116205885 | 0.79 |
Gm31651 |
predicted gene, 31651 |
5307 |
0.18 |
| chr13_98941845_98942070 | 0.78 |
Gm35215 |
predicted gene, 35215 |
3959 |
0.15 |
| chr17_33756292_33756748 | 0.78 |
Gm17251 |
predicted gene, 17251 |
3472 |
0.11 |
| chr2_167866314_167866737 | 0.78 |
Gm14319 |
predicted gene 14319 |
7940 |
0.18 |
| chr9_122148667_122148818 | 0.78 |
Gm47121 |
predicted gene, 47121 |
6293 |
0.13 |
| chr7_98117333_98117527 | 0.78 |
Myo7a |
myosin VIIA |
2062 |
0.3 |
| chr8_93265839_93265990 | 0.78 |
Ces1f |
carboxylesterase 1F |
1364 |
0.36 |
| chr9_48597171_48597587 | 0.77 |
Nnmt |
nicotinamide N-methyltransferase |
4 |
0.98 |
| chr7_143754683_143755199 | 0.77 |
Osbpl5 |
oxysterol binding protein-like 5 |
2044 |
0.2 |
| chr10_81600790_81601143 | 0.77 |
Tle6 |
transducin-like enhancer of split 6 |
66 |
0.93 |
| chr5_124248915_124249162 | 0.76 |
Pitpnm2 |
phosphatidylinositol transfer protein, membrane-associated 2 |
413 |
0.73 |
| chr11_22892534_22892802 | 0.76 |
Gm24917 |
predicted gene, 24917 |
23767 |
0.11 |
| chr16_84774064_84774215 | 0.76 |
Jam2 |
junction adhesion molecule 2 |
16 |
0.97 |
| chr7_45537932_45538172 | 0.75 |
Plekha4 |
pleckstrin homology domain containing, family A (phosphoinositide binding specific) member 4 |
2777 |
0.09 |
| chr2_27580553_27580704 | 0.75 |
Gm13421 |
predicted gene 13421 |
40199 |
0.12 |
| chr5_125340513_125340927 | 0.74 |
Scarb1 |
scavenger receptor class B, member 1 |
299 |
0.86 |
| chr17_85882131_85882282 | 0.74 |
Gm30117 |
predicted gene, 30117 |
46373 |
0.16 |
| chr15_101977187_101977711 | 0.74 |
Krt78 |
keratin 78 |
23162 |
0.09 |
| chr9_119143193_119143344 | 0.74 |
Acaa1b |
acetyl-Coenzyme A acyltransferase 1B |
6795 |
0.12 |
| chr10_60733446_60733765 | 0.74 |
Slc29a3 |
solute carrier family 29 (nucleoside transporters), member 3 |
9289 |
0.21 |
| chr16_96362087_96362478 | 0.74 |
Igsf5 |
immunoglobulin superfamily, member 5 |
488 |
0.45 |
| chr8_71397010_71397350 | 0.74 |
Babam1 |
BRISC and BRCA1 A complex member 1 |
319 |
0.74 |
| chr1_57377802_57378076 | 0.74 |
1700066M21Rik |
RIKEN cDNA 1700066M21 gene |
299 |
0.57 |
| chr9_119153834_119154175 | 0.74 |
Acaa1b |
acetyl-Coenzyme A acyltransferase 1B |
3089 |
0.15 |
| chr1_74698438_74698727 | 0.74 |
Ttll4 |
tubulin tyrosine ligase-like family, member 4 |
2848 |
0.18 |
| chr3_97635501_97635936 | 0.73 |
Fmo5 |
flavin containing monooxygenase 5 |
6835 |
0.14 |
| chr10_42842218_42842369 | 0.73 |
Scml4 |
Scm polycomb group protein like 4 |
18077 |
0.12 |
| chr7_100993375_100993782 | 0.73 |
P2ry2 |
purinergic receptor P2Y, G-protein coupled 2 |
10309 |
0.14 |
| chr3_87542357_87542508 | 0.73 |
ETV3L |
ets variant 3-like |
7667 |
0.17 |
| chr7_44384297_44384476 | 0.73 |
Syt3 |
synaptotagmin III |
218 |
0.79 |
| chr6_59022479_59022672 | 0.72 |
Fam13a |
family with sequence similarity 13, member A |
1765 |
0.31 |
| chr16_93368389_93368572 | 0.72 |
1810044K17Rik |
RIKEN cDNA 1810044K17 gene |
241 |
0.86 |
| chr4_139601582_139602248 | 0.72 |
Gm21969 |
predicted gene 21969 |
1271 |
0.37 |
| chr4_144974231_144974382 | 0.72 |
Vps13d |
vacuolar protein sorting 13D |
9655 |
0.2 |
| chr17_81386211_81386362 | 0.72 |
Gm50044 |
predicted gene, 50044 |
15453 |
0.24 |
| chr8_82402195_82403147 | 0.72 |
Il15 |
interleukin 15 |
101 |
0.98 |
| chr9_53342774_53342933 | 0.72 |
Exph5 |
exophilin 5 |
1664 |
0.36 |
| chr19_6987055_6987252 | 0.72 |
Vegfb |
vascular endothelial growth factor B |
13 |
0.93 |
| chr7_67655765_67656129 | 0.72 |
Ttc23 |
tetratricopeptide repeat domain 23 |
500 |
0.72 |
| chr2_35692024_35692382 | 0.72 |
Dab2ip |
disabled 2 interacting protein |
130 |
0.97 |
| chr11_102753302_102753453 | 0.71 |
Adam11 |
a disintegrin and metallopeptidase domain 11 |
8062 |
0.11 |
| chr16_31070745_31071110 | 0.71 |
Xxylt1 |
xyloside xylosyltransferase 1 |
1101 |
0.51 |
| chr8_123406907_123407073 | 0.71 |
Mc1r |
melanocortin 1 receptor |
117 |
0.89 |
| chr1_62728806_62729117 | 0.71 |
Gm29083 |
predicted gene 29083 |
10888 |
0.18 |
| chr14_70618329_70618789 | 0.71 |
Dmtn |
dematin actin binding protein |
14 |
0.96 |
| chr7_98355533_98355727 | 0.70 |
Tsku |
tsukushi, small leucine rich proteoglycan |
4449 |
0.2 |
| chr15_75910895_75911112 | 0.70 |
Tigd5 |
tigger transposable element derived 5 |
1268 |
0.2 |
| chr7_98354087_98354238 | 0.70 |
Tsku |
tsukushi, small leucine rich proteoglycan |
5917 |
0.18 |
| chr4_145022357_145022535 | 0.70 |
Vps13d |
vacuolar protein sorting 13D |
28588 |
0.19 |
| chr14_25525708_25526164 | 0.70 |
Mir3075 |
microRNA 3075 |
8503 |
0.17 |
| chr18_39362671_39363228 | 0.70 |
Arhgap26 |
Rho GTPase activating protein 26 |
366 |
0.87 |
| chr5_129007800_129008200 | 0.70 |
Stx2 |
syntaxin 2 |
423 |
0.85 |
| chr19_46133855_46134398 | 0.69 |
Elovl3 |
elongation of very long chain fatty acids (FEN1/Elo2, SUR4/Elo3, yeast)-like 3 |
2229 |
0.19 |
| chr11_86971141_86971293 | 0.69 |
Ypel2 |
yippee like 2 |
807 |
0.62 |
| chr13_45576494_45576821 | 0.69 |
Gmpr |
guanosine monophosphate reductase |
30504 |
0.21 |
| chr8_34215895_34216290 | 0.69 |
Gm29243 |
predicted gene 29243 |
767 |
0.58 |
| chr10_50896822_50896973 | 0.69 |
Sim1 |
single-minded family bHLH transcription factor 1 |
1246 |
0.58 |
| chr4_55242738_55242936 | 0.69 |
Gm12508 |
predicted gene 12508 |
11903 |
0.17 |
| chr6_38870364_38870593 | 0.69 |
Tbxas1 |
thromboxane A synthase 1, platelet |
4926 |
0.22 |
| chr6_144070883_144071211 | 0.69 |
Sox5os1 |
SRY (sex determining region Y)-box 5, opposite strand 1 |
49139 |
0.17 |
| chr2_116980617_116980938 | 0.69 |
Gm29340 |
predicted gene 29340 |
4349 |
0.22 |
| chr6_97210873_97211545 | 0.69 |
Arl6ip5 |
ADP-ribosylation factor-like 6 interacting protein 5 |
520 |
0.72 |
| chr9_57537760_57538207 | 0.68 |
Gm26631 |
predicted gene, 26631 |
354 |
0.44 |
| chr14_65385019_65385170 | 0.68 |
Zfp395 |
zinc finger protein 395 |
9701 |
0.18 |
| chr13_74560812_74560963 | 0.68 |
Gm47469 |
predicted gene, 47469 |
2987 |
0.16 |
| chr2_165873544_165873994 | 0.68 |
Zmynd8 |
zinc finger, MYND-type containing 8 |
2008 |
0.24 |
| chr1_74033438_74033615 | 0.68 |
Tns1 |
tensin 1 |
3607 |
0.28 |
| chr7_98352590_98353259 | 0.68 |
Tsku |
tsukushi, small leucine rich proteoglycan |
7155 |
0.18 |
| chr2_27743304_27743497 | 0.68 |
Rxra |
retinoid X receptor alpha |
3199 |
0.34 |
| chr17_34733622_34734232 | 0.68 |
C4b |
complement component 4B (Chido blood group) |
2172 |
0.12 |
| chrX_103556370_103556521 | 0.67 |
Mir421 |
microRNA 421 |
16551 |
0.07 |
| chr9_35267693_35268345 | 0.67 |
Rpusd4 |
RNA pseudouridylate synthase domain containing 4 |
154 |
0.57 |
| chr6_85835242_85835411 | 0.67 |
Nat8 |
N-acetyltransferase 8 (GCN5-related) |
3244 |
0.11 |
| chr13_107645955_107646106 | 0.67 |
Gm32090 |
predicted gene, 32090 |
33181 |
0.17 |
| chr16_26753695_26754035 | 0.67 |
Gm20319 |
predicted gene, 20319 |
1626 |
0.47 |
| chr9_35108621_35109370 | 0.67 |
St3gal4 |
ST3 beta-galactoside alpha-2,3-sialyltransferase 4 |
2328 |
0.23 |
| chr6_90583130_90583439 | 0.67 |
Aldh1l1 |
aldehyde dehydrogenase 1 family, member L1 |
6066 |
0.15 |
| chr9_77923009_77923206 | 0.66 |
Elovl5 |
ELOVL family member 5, elongation of long chain fatty acids (yeast) |
1175 |
0.42 |
| chr17_35425882_35426323 | 0.66 |
H2-Q6 |
histocompatibility 2, Q region locus 6 |
1225 |
0.23 |
| chr10_122449019_122449793 | 0.66 |
Avpr1a |
arginine vasopressin receptor 1A |
907 |
0.59 |
| chr9_73044399_73044606 | 0.66 |
Rab27a |
RAB27A, member RAS oncogene family |
352 |
0.73 |
| chr9_119150860_119151284 | 0.66 |
Acaa1b |
acetyl-Coenzyme A acyltransferase 1B |
1009 |
0.39 |
| chr15_85701378_85701720 | 0.66 |
Lncppara |
long noncoding RNA near Ppara |
2224 |
0.22 |
| chr11_75194251_75194940 | 0.66 |
Rtn4rl1 |
reticulon 4 receptor-like 1 |
812 |
0.43 |
| chr9_48735314_48735473 | 0.66 |
Zbtb16 |
zinc finger and BTB domain containing 16 |
100552 |
0.07 |
| chr9_66835098_66835435 | 0.66 |
Aph1c |
aph1 homolog C, gamma secretase subunit |
540 |
0.43 |
| chr3_129331898_129332432 | 0.66 |
Enpep |
glutamyl aminopeptidase |
99 |
0.96 |
| chr7_112271614_112271811 | 0.66 |
Mical2 |
microtubule associated monooxygenase, calponin and LIM domain containing 2 |
413 |
0.91 |
| chr13_3360707_3360858 | 0.66 |
Gm16505 |
predicted gene 16505 |
375 |
0.81 |
| chr8_70216821_70217037 | 0.66 |
Slc25a42 |
solute carrier family 25, member 42 |
4624 |
0.11 |
| chr5_125312680_125313097 | 0.65 |
Scarb1 |
scavenger receptor class B, member 1 |
3744 |
0.18 |
| chr19_6975937_6976192 | 0.65 |
Ppp1r14b |
protein phosphatase 1, regulatory inhibitor subunit 14B |
385 |
0.41 |
| chr15_85335637_85335934 | 0.65 |
Atxn10 |
ataxin 10 |
460 |
0.83 |
| chr12_80824527_80824832 | 0.65 |
Susd6 |
sushi domain containing 6 |
34120 |
0.11 |
| chr14_41153241_41153864 | 0.65 |
Mbl1 |
mannose-binding lectin (protein A) 1 |
2051 |
0.2 |
| chr11_69545951_69546260 | 0.65 |
Dnah2 |
dynein, axonemal, heavy chain 2 |
1549 |
0.2 |
| chr13_73770972_73771397 | 0.65 |
Slc12a7 |
solute carrier family 12, member 7 |
7445 |
0.18 |
| chr13_51089168_51089510 | 0.65 |
Spin1 |
spindlin 1 |
11541 |
0.24 |
| chr8_124252101_124252292 | 0.65 |
Galnt2 |
polypeptide N-acetylgalactosaminyltransferase 2 |
20688 |
0.17 |
| chr3_34020715_34021194 | 0.65 |
Fxr1 |
fragile X mental retardation gene 1, autosomal homolog |
846 |
0.39 |
| chr2_26596975_26597376 | 0.65 |
Egfl7 |
EGF-like domain 7 |
5028 |
0.09 |
| chr5_9101079_9101755 | 0.65 |
Tmem243 |
transmembrane protein 243, mitochondrial |
670 |
0.68 |
| chr4_48045892_48046043 | 0.65 |
Nr4a3 |
nuclear receptor subfamily 4, group A, member 3 |
736 |
0.72 |
| chr9_48739409_48739562 | 0.64 |
Zbtb16 |
zinc finger and BTB domain containing 16 |
96460 |
0.07 |
| chr15_3458621_3458946 | 0.64 |
Ghr |
growth hormone receptor |
12861 |
0.28 |
| chr10_61715892_61716414 | 0.64 |
Aifm2 |
apoptosis-inducing factor, mitochondrion-associated 2 |
821 |
0.52 |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 1.1 | 3.3 | GO:0010046 | response to mycotoxin(GO:0010046) |
| 0.9 | 2.7 | GO:0019626 | short-chain fatty acid catabolic process(GO:0019626) |
| 0.7 | 2.7 | GO:0060528 | secretory columnal luminar epithelial cell differentiation involved in prostate glandular acinus development(GO:0060528) |
| 0.5 | 2.4 | GO:0061073 | ciliary body morphogenesis(GO:0061073) |
| 0.4 | 1.3 | GO:0032079 | positive regulation of endodeoxyribonuclease activity(GO:0032079) |
| 0.4 | 1.3 | GO:1901078 | negative regulation of relaxation of muscle(GO:1901078) |
| 0.4 | 1.3 | GO:0006068 | ethanol catabolic process(GO:0006068) |
| 0.4 | 1.1 | GO:0045218 | zonula adherens maintenance(GO:0045218) |
| 0.3 | 1.0 | GO:0048296 | isotype switching to IgA isotypes(GO:0048290) regulation of isotype switching to IgA isotypes(GO:0048296) |
| 0.3 | 1.0 | GO:0032383 | regulation of intracellular lipid transport(GO:0032377) regulation of intracellular sterol transport(GO:0032380) regulation of intracellular cholesterol transport(GO:0032383) |
| 0.3 | 1.7 | GO:0045053 | protein retention in Golgi apparatus(GO:0045053) |
| 0.3 | 1.3 | GO:1903964 | monounsaturated fatty acid metabolic process(GO:1903964) monounsaturated fatty acid biosynthetic process(GO:1903966) |
| 0.3 | 0.9 | GO:0090611 | ubiquitin-independent protein catabolic process via the multivesicular body sorting pathway(GO:0090611) |
| 0.3 | 1.2 | GO:0032286 | central nervous system myelin maintenance(GO:0032286) |
| 0.3 | 0.8 | GO:2000286 | receptor internalization involved in canonical Wnt signaling pathway(GO:2000286) |
| 0.3 | 1.4 | GO:0060283 | negative regulation of oocyte development(GO:0060283) |
| 0.3 | 0.8 | GO:0090296 | regulation of mitochondrial DNA replication(GO:0090296) |
| 0.3 | 0.8 | GO:0090403 | oxidative stress-induced premature senescence(GO:0090403) |
| 0.3 | 0.8 | GO:0055118 | negative regulation of cardiac muscle contraction(GO:0055118) |
| 0.3 | 1.1 | GO:0001996 | positive regulation of heart rate by epinephrine-norepinephrine(GO:0001996) |
| 0.3 | 1.1 | GO:1902897 | regulation of postsynaptic density protein 95 clustering(GO:1902897) |
| 0.3 | 0.5 | GO:0002036 | regulation of L-glutamate transport(GO:0002036) |
| 0.3 | 0.5 | GO:0061502 | early endosome to recycling endosome transport(GO:0061502) |
| 0.3 | 0.8 | GO:0018242 | protein O-linked glycosylation via serine(GO:0018242) |
| 0.3 | 1.0 | GO:2000561 | regulation of CD4-positive, alpha-beta T cell proliferation(GO:2000561) |
| 0.3 | 0.8 | GO:0097167 | circadian regulation of translation(GO:0097167) |
| 0.3 | 0.5 | GO:0000965 | mitochondrial RNA 3'-end processing(GO:0000965) |
| 0.2 | 0.7 | GO:1900625 | regulation of monocyte aggregation(GO:1900623) positive regulation of monocyte aggregation(GO:1900625) |
| 0.2 | 0.7 | GO:0009256 | 10-formyltetrahydrofolate metabolic process(GO:0009256) |
| 0.2 | 1.0 | GO:0034755 | iron ion transmembrane transport(GO:0034755) |
| 0.2 | 0.5 | GO:0003213 | cardiac right atrium morphogenesis(GO:0003213) |
| 0.2 | 0.7 | GO:0070827 | chromatin maintenance(GO:0070827) |
| 0.2 | 0.7 | GO:0019859 | pyrimidine nucleobase catabolic process(GO:0006208) thymine catabolic process(GO:0006210) thymine metabolic process(GO:0019859) |
| 0.2 | 0.2 | GO:0018243 | protein O-linked glycosylation via threonine(GO:0018243) |
| 0.2 | 0.7 | GO:0072361 | regulation of glycolytic process by regulation of transcription from RNA polymerase II promoter(GO:0072361) |
| 0.2 | 0.7 | GO:0035461 | vitamin transmembrane transport(GO:0035461) |
| 0.2 | 0.7 | GO:0021553 | olfactory nerve development(GO:0021553) |
| 0.2 | 0.7 | GO:0034137 | positive regulation of toll-like receptor 2 signaling pathway(GO:0034137) |
| 0.2 | 1.1 | GO:0006642 | triglyceride mobilization(GO:0006642) |
| 0.2 | 0.7 | GO:0007597 | blood coagulation, intrinsic pathway(GO:0007597) |
| 0.2 | 1.3 | GO:0060373 | regulation of ventricular cardiac muscle cell membrane depolarization(GO:0060373) |
| 0.2 | 0.9 | GO:0036257 | multivesicular body organization(GO:0036257) |
| 0.2 | 0.6 | GO:0061043 | regulation of vascular wound healing(GO:0061043) |
| 0.2 | 0.6 | GO:0060125 | negative regulation of growth hormone secretion(GO:0060125) |
| 0.2 | 0.6 | GO:0036112 | medium-chain fatty-acyl-CoA metabolic process(GO:0036112) |
| 0.2 | 0.6 | GO:0010901 | regulation of very-low-density lipoprotein particle remodeling(GO:0010901) |
| 0.2 | 0.6 | GO:0036151 | phosphatidylcholine acyl-chain remodeling(GO:0036151) |
| 0.2 | 0.8 | GO:1901668 | regulation of superoxide dismutase activity(GO:1901668) |
| 0.2 | 1.6 | GO:0046473 | phosphatidic acid metabolic process(GO:0046473) |
| 0.2 | 1.0 | GO:0051136 | regulation of NK T cell differentiation(GO:0051136) positive regulation of NK T cell differentiation(GO:0051138) |
| 0.2 | 0.6 | GO:0010735 | positive regulation of transcription via serum response element binding(GO:0010735) |
| 0.2 | 1.0 | GO:2001286 | regulation of caveolin-mediated endocytosis(GO:2001286) |
| 0.2 | 0.4 | GO:0045626 | negative regulation of T-helper 1 cell differentiation(GO:0045626) |
| 0.2 | 0.8 | GO:0007412 | axon target recognition(GO:0007412) |
| 0.2 | 0.6 | GO:0003431 | growth plate cartilage chondrocyte development(GO:0003431) |
| 0.2 | 0.6 | GO:1900041 | negative regulation of interleukin-2 secretion(GO:1900041) |
| 0.2 | 0.9 | GO:0042518 | negative regulation of tyrosine phosphorylation of Stat3 protein(GO:0042518) |
| 0.2 | 0.8 | GO:0039689 | negative stranded viral RNA replication(GO:0039689) multi-organism biosynthetic process(GO:0044034) |
| 0.2 | 0.6 | GO:0046100 | hypoxanthine metabolic process(GO:0046100) hypoxanthine biosynthetic process(GO:0046101) |
| 0.2 | 0.4 | GO:0010982 | regulation of high-density lipoprotein particle clearance(GO:0010982) |
| 0.2 | 0.5 | GO:1900169 | regulation of glucocorticoid mediated signaling pathway(GO:1900169) |
| 0.2 | 0.9 | GO:0006003 | fructose 2,6-bisphosphate metabolic process(GO:0006003) |
| 0.2 | 0.5 | GO:0043490 | malate-aspartate shuttle(GO:0043490) |
| 0.2 | 0.7 | GO:0007621 | negative regulation of female receptivity(GO:0007621) |
| 0.2 | 0.7 | GO:0071034 | CUT catabolic process(GO:0071034) CUT metabolic process(GO:0071043) |
| 0.2 | 0.5 | GO:0030397 | membrane disassembly(GO:0030397) nuclear envelope disassembly(GO:0051081) |
| 0.2 | 0.4 | GO:0061153 | trachea submucosa development(GO:0061152) trachea gland development(GO:0061153) |
| 0.2 | 1.4 | GO:0035999 | tetrahydrofolate interconversion(GO:0035999) |
| 0.2 | 1.2 | GO:0034626 | fatty acid elongation, saturated fatty acid(GO:0019367) fatty acid elongation, unsaturated fatty acid(GO:0019368) fatty acid elongation, monounsaturated fatty acid(GO:0034625) fatty acid elongation, polyunsaturated fatty acid(GO:0034626) |
| 0.2 | 1.4 | GO:0033572 | transferrin transport(GO:0033572) |
| 0.2 | 0.7 | GO:0034080 | CENP-A containing nucleosome assembly(GO:0034080) CENP-A containing chromatin organization(GO:0061641) |
| 0.2 | 0.7 | GO:0008655 | pyrimidine-containing compound salvage(GO:0008655) pyrimidine nucleoside salvage(GO:0043097) |
| 0.2 | 0.9 | GO:0070236 | negative regulation of activation-induced cell death of T cells(GO:0070236) |
| 0.2 | 0.5 | GO:0070836 | caveola assembly(GO:0070836) |
| 0.2 | 1.0 | GO:2001046 | positive regulation of integrin-mediated signaling pathway(GO:2001046) |
| 0.2 | 0.3 | GO:0032513 | negative regulation of protein phosphatase type 2B activity(GO:0032513) |
| 0.2 | 0.7 | GO:0014053 | negative regulation of gamma-aminobutyric acid secretion(GO:0014053) |
| 0.2 | 1.0 | GO:0090209 | negative regulation of triglyceride metabolic process(GO:0090209) |
| 0.2 | 0.5 | GO:0015842 | aminergic neurotransmitter loading into synaptic vesicle(GO:0015842) neurotransmitter loading into synaptic vesicle(GO:0098700) |
| 0.2 | 0.5 | GO:1902775 | mitochondrial large ribosomal subunit assembly(GO:1902775) |
| 0.2 | 0.5 | GO:0046271 | phenylpropanoid catabolic process(GO:0046271) |
| 0.2 | 0.3 | GO:0003062 | regulation of heart rate by chemical signal(GO:0003062) |
| 0.2 | 0.5 | GO:0060748 | tertiary branching involved in mammary gland duct morphogenesis(GO:0060748) |
| 0.2 | 0.5 | GO:1902915 | negative regulation of protein K63-linked ubiquitination(GO:1900045) negative regulation of protein polyubiquitination(GO:1902915) |
| 0.2 | 0.3 | GO:2000370 | positive regulation of clathrin-mediated endocytosis(GO:2000370) |
| 0.2 | 0.2 | GO:1903525 | regulation of membrane tubulation(GO:1903525) |
| 0.2 | 0.2 | GO:0072338 | creatinine metabolic process(GO:0046449) cellular lactam metabolic process(GO:0072338) |
| 0.2 | 0.8 | GO:0021780 | oligodendrocyte cell fate specification(GO:0021778) oligodendrocyte cell fate commitment(GO:0021779) glial cell fate specification(GO:0021780) |
| 0.2 | 0.6 | GO:0061113 | pancreas morphogenesis(GO:0061113) |
| 0.2 | 0.3 | GO:1901301 | regulation of cargo loading into COPII-coated vesicle(GO:1901301) |
| 0.2 | 2.1 | GO:0060088 | auditory receptor cell stereocilium organization(GO:0060088) |
| 0.2 | 0.6 | GO:2001013 | epithelial cell proliferation involved in renal tubule morphogenesis(GO:2001013) |
| 0.2 | 0.9 | GO:0019530 | taurine metabolic process(GO:0019530) |
| 0.2 | 0.5 | GO:2000002 | negative regulation of DNA damage checkpoint(GO:2000002) |
| 0.2 | 0.2 | GO:0045163 | clustering of voltage-gated potassium channels(GO:0045163) |
| 0.2 | 0.9 | GO:0060050 | positive regulation of protein glycosylation(GO:0060050) |
| 0.2 | 0.2 | GO:1902956 | regulation of mitochondrial electron transport, NADH to ubiquinone(GO:1902956) |
| 0.2 | 0.5 | GO:1903347 | negative regulation of bicellular tight junction assembly(GO:1903347) |
| 0.2 | 0.5 | GO:0016080 | synaptic vesicle targeting(GO:0016080) |
| 0.2 | 0.3 | GO:0071895 | odontoblast differentiation(GO:0071895) |
| 0.2 | 0.5 | GO:0035694 | mitochondrial protein catabolic process(GO:0035694) |
| 0.2 | 0.5 | GO:0021555 | midbrain-hindbrain boundary morphogenesis(GO:0021555) |
| 0.2 | 0.6 | GO:0051534 | negative regulation of NFAT protein import into nucleus(GO:0051534) |
| 0.2 | 0.5 | GO:2001280 | positive regulation of prostaglandin biosynthetic process(GO:0031394) positive regulation of unsaturated fatty acid biosynthetic process(GO:2001280) |
| 0.2 | 0.3 | GO:2000121 | regulation of removal of superoxide radicals(GO:2000121) |
| 0.2 | 1.2 | GO:0046512 | diol biosynthetic process(GO:0034312) sphingosine biosynthetic process(GO:0046512) |
| 0.2 | 0.3 | GO:0051182 | coenzyme transport(GO:0051182) |
| 0.1 | 0.4 | GO:2000211 | regulation of glutamate metabolic process(GO:2000211) |
| 0.1 | 0.6 | GO:0035507 | regulation of myosin-light-chain-phosphatase activity(GO:0035507) |
| 0.1 | 0.6 | GO:0052055 | modulation by symbiont of host molecular function(GO:0052055) |
| 0.1 | 0.4 | GO:0009197 | dUDP biosynthetic process(GO:0006227) pyrimidine nucleoside diphosphate biosynthetic process(GO:0009139) pyrimidine deoxyribonucleoside diphosphate metabolic process(GO:0009196) pyrimidine deoxyribonucleoside diphosphate biosynthetic process(GO:0009197) dUDP metabolic process(GO:0046077) |
| 0.1 | 0.9 | GO:0097011 | cellular response to granulocyte macrophage colony-stimulating factor stimulus(GO:0097011) |
| 0.1 | 0.7 | GO:0015722 | canalicular bile acid transport(GO:0015722) |
| 0.1 | 0.3 | GO:1902083 | negative regulation of peptidyl-cysteine S-nitrosylation(GO:1902083) |
| 0.1 | 0.9 | GO:0045647 | negative regulation of erythrocyte differentiation(GO:0045647) |
| 0.1 | 0.4 | GO:0015770 | disaccharide transport(GO:0015766) sucrose transport(GO:0015770) oligosaccharide transport(GO:0015772) |
| 0.1 | 0.4 | GO:0072592 | oxygen metabolic process(GO:0072592) |
| 0.1 | 0.7 | GO:0016255 | attachment of GPI anchor to protein(GO:0016255) |
| 0.1 | 0.3 | GO:0090158 | endoplasmic reticulum membrane organization(GO:0090158) |
| 0.1 | 0.4 | GO:0006564 | L-serine biosynthetic process(GO:0006564) |
| 0.1 | 0.4 | GO:0071883 | activation of MAPK activity by adrenergic receptor signaling pathway(GO:0071883) |
| 0.1 | 0.1 | GO:0061550 | cranial ganglion development(GO:0061550) trigeminal ganglion development(GO:0061551) |
| 0.1 | 0.4 | GO:0036295 | cellular response to increased oxygen levels(GO:0036295) cellular response to hyperoxia(GO:0071455) |
| 0.1 | 0.8 | GO:0032532 | regulation of microvillus length(GO:0032532) |
| 0.1 | 1.8 | GO:0014733 | regulation of skeletal muscle adaptation(GO:0014733) |
| 0.1 | 0.4 | GO:1900095 | regulation of dosage compensation by inactivation of X chromosome(GO:1900095) |
| 0.1 | 0.3 | GO:0006701 | progesterone biosynthetic process(GO:0006701) |
| 0.1 | 0.4 | GO:0060161 | positive regulation of dopamine receptor signaling pathway(GO:0060161) |
| 0.1 | 0.1 | GO:0035790 | platelet-derived growth factor receptor-alpha signaling pathway(GO:0035790) |
| 0.1 | 0.4 | GO:0001555 | oocyte growth(GO:0001555) |
| 0.1 | 0.1 | GO:1900020 | regulation of protein kinase C activity(GO:1900019) positive regulation of protein kinase C activity(GO:1900020) |
| 0.1 | 0.9 | GO:1902231 | positive regulation of intrinsic apoptotic signaling pathway in response to DNA damage(GO:1902231) |
| 0.1 | 0.3 | GO:0060336 | negative regulation of response to interferon-gamma(GO:0060331) negative regulation of interferon-gamma-mediated signaling pathway(GO:0060336) |
| 0.1 | 0.5 | GO:0071205 | protein localization to juxtaparanode region of axon(GO:0071205) |
| 0.1 | 0.4 | GO:0006768 | biotin metabolic process(GO:0006768) |
| 0.1 | 0.1 | GO:0042851 | L-alanine metabolic process(GO:0042851) |
| 0.1 | 0.8 | GO:2000253 | positive regulation of feeding behavior(GO:2000253) |
| 0.1 | 0.5 | GO:0010510 | regulation of acetyl-CoA biosynthetic process from pyruvate(GO:0010510) |
| 0.1 | 0.4 | GO:0033615 | mitochondrial proton-transporting ATP synthase complex assembly(GO:0033615) |
| 0.1 | 0.8 | GO:0048341 | paraxial mesoderm formation(GO:0048341) |
| 0.1 | 0.5 | GO:0070164 | negative regulation of adiponectin secretion(GO:0070164) |
| 0.1 | 0.1 | GO:0061511 | centriole elongation(GO:0061511) |
| 0.1 | 0.5 | GO:0048669 | collateral sprouting in absence of injury(GO:0048669) |
| 0.1 | 0.1 | GO:0090283 | regulation of protein glycosylation in Golgi(GO:0090283) |
| 0.1 | 0.3 | GO:0060375 | regulation of mast cell differentiation(GO:0060375) |
| 0.1 | 0.8 | GO:0008354 | germ cell migration(GO:0008354) |
| 0.1 | 0.4 | GO:0060750 | epithelial cell proliferation involved in mammary gland duct elongation(GO:0060750) |
| 0.1 | 0.4 | GO:0034238 | macrophage fusion(GO:0034238) |
| 0.1 | 0.4 | GO:0006296 | nucleotide-excision repair, DNA incision, 5'-to lesion(GO:0006296) |
| 0.1 | 0.1 | GO:0070672 | response to interleukin-15(GO:0070672) |
| 0.1 | 0.6 | GO:2000189 | positive regulation of cholesterol homeostasis(GO:2000189) |
| 0.1 | 0.9 | GO:0031274 | positive regulation of pseudopodium assembly(GO:0031274) |
| 0.1 | 0.1 | GO:2001212 | regulation of vasculogenesis(GO:2001212) |
| 0.1 | 0.8 | GO:0030948 | negative regulation of vascular endothelial growth factor receptor signaling pathway(GO:0030948) |
| 0.1 | 0.1 | GO:1902445 | regulation of mitochondrial membrane permeability involved in programmed necrotic cell death(GO:1902445) |
| 0.1 | 0.2 | GO:1902263 | apoptotic process involved in embryonic digit morphogenesis(GO:1902263) |
| 0.1 | 0.7 | GO:0032960 | regulation of inositol trisphosphate biosynthetic process(GO:0032960) |
| 0.1 | 1.7 | GO:0014041 | regulation of neuron maturation(GO:0014041) |
| 0.1 | 0.4 | GO:0060468 | prevention of polyspermy(GO:0060468) |
| 0.1 | 0.2 | GO:0042660 | positive regulation of cell fate specification(GO:0042660) |
| 0.1 | 0.4 | GO:0002949 | tRNA threonylcarbamoyladenosine modification(GO:0002949) |
| 0.1 | 0.5 | GO:0010499 | proteasomal ubiquitin-independent protein catabolic process(GO:0010499) |
| 0.1 | 0.6 | GO:0006572 | tyrosine catabolic process(GO:0006572) |
| 0.1 | 0.5 | GO:1903301 | positive regulation of glucokinase activity(GO:0033133) positive regulation of hexokinase activity(GO:1903301) |
| 0.1 | 0.5 | GO:2001199 | negative regulation of dendritic cell differentiation(GO:2001199) |
| 0.1 | 0.1 | GO:0042360 | vitamin E metabolic process(GO:0042360) |
| 0.1 | 0.5 | GO:1900147 | Schwann cell migration(GO:0036135) regulation of Schwann cell migration(GO:1900147) |
| 0.1 | 0.5 | GO:2000210 | positive regulation of anoikis(GO:2000210) |
| 0.1 | 0.2 | GO:0002414 | immunoglobulin transcytosis in epithelial cells(GO:0002414) |
| 0.1 | 0.5 | GO:2000767 | positive regulation of cytoplasmic translation(GO:2000767) |
| 0.1 | 0.9 | GO:0048387 | negative regulation of retinoic acid receptor signaling pathway(GO:0048387) |
| 0.1 | 0.5 | GO:0006369 | termination of RNA polymerase II transcription(GO:0006369) |
| 0.1 | 0.9 | GO:0034058 | endosomal vesicle fusion(GO:0034058) |
| 0.1 | 0.8 | GO:0090051 | negative regulation of cell migration involved in sprouting angiogenesis(GO:0090051) |
| 0.1 | 0.3 | GO:0032789 | saturated monocarboxylic acid metabolic process(GO:0032788) unsaturated monocarboxylic acid metabolic process(GO:0032789) |
| 0.1 | 0.2 | GO:0002905 | mature B cell apoptotic process(GO:0002901) regulation of mature B cell apoptotic process(GO:0002905) negative regulation of mature B cell apoptotic process(GO:0002906) |
| 0.1 | 0.3 | GO:0009202 | deoxyribonucleoside triphosphate biosynthetic process(GO:0009202) |
| 0.1 | 0.5 | GO:0045039 | protein import into mitochondrial inner membrane(GO:0045039) |
| 0.1 | 0.3 | GO:0016554 | cytidine to uridine editing(GO:0016554) |
| 0.1 | 0.6 | GO:0006528 | asparagine metabolic process(GO:0006528) |
| 0.1 | 0.3 | GO:1902683 | regulation of receptor localization to synapse(GO:1902683) |
| 0.1 | 0.6 | GO:0008582 | regulation of synaptic growth at neuromuscular junction(GO:0008582) |
| 0.1 | 0.8 | GO:0018095 | protein polyglutamylation(GO:0018095) |
| 0.1 | 0.3 | GO:0044375 | regulation of peroxisome size(GO:0044375) |
| 0.1 | 0.6 | GO:1902410 | mitotic cytokinetic process(GO:1902410) |
| 0.1 | 0.1 | GO:0097477 | lateral motor column neuron migration(GO:0097477) |
| 0.1 | 0.3 | GO:1901662 | phylloquinone metabolic process(GO:0042374) phylloquinone catabolic process(GO:0042376) quinone catabolic process(GO:1901662) |
| 0.1 | 1.0 | GO:0034501 | protein localization to kinetochore(GO:0034501) |
| 0.1 | 0.2 | GO:0045415 | negative regulation of interleukin-8 biosynthetic process(GO:0045415) |
| 0.1 | 0.6 | GO:2000391 | regulation of neutrophil extravasation(GO:2000389) positive regulation of neutrophil extravasation(GO:2000391) |
| 0.1 | 0.2 | GO:0006481 | C-terminal protein methylation(GO:0006481) |
| 0.1 | 1.1 | GO:0032988 | ribonucleoprotein complex disassembly(GO:0032988) |
| 0.1 | 0.5 | GO:0072675 | osteoclast fusion(GO:0072675) |
| 0.1 | 1.0 | GO:0006622 | protein targeting to lysosome(GO:0006622) |
| 0.1 | 1.0 | GO:0039702 | viral budding via host ESCRT complex(GO:0039702) |
| 0.1 | 0.3 | GO:1903011 | negative regulation of bone development(GO:1903011) |
| 0.1 | 0.3 | GO:0006562 | proline catabolic process(GO:0006562) |
| 0.1 | 0.1 | GO:1902237 | positive regulation of endoplasmic reticulum stress-induced intrinsic apoptotic signaling pathway(GO:1902237) |
| 0.1 | 0.1 | GO:0021882 | regulation of transcription from RNA polymerase II promoter involved in forebrain neuron fate commitment(GO:0021882) |
| 0.1 | 0.4 | GO:1903599 | positive regulation of mitophagy(GO:1903599) |
| 0.1 | 0.3 | GO:0006344 | maintenance of chromatin silencing(GO:0006344) |
| 0.1 | 0.2 | GO:0033578 | protein glycosylation in Golgi(GO:0033578) |
| 0.1 | 0.3 | GO:0070973 | protein localization to endoplasmic reticulum exit site(GO:0070973) |
| 0.1 | 0.4 | GO:0060414 | aorta smooth muscle tissue morphogenesis(GO:0060414) |
| 0.1 | 0.2 | GO:0060971 | embryonic heart tube left/right pattern formation(GO:0060971) |
| 0.1 | 0.1 | GO:0021747 | cochlear nucleus development(GO:0021747) |
| 0.1 | 0.8 | GO:0035970 | peptidyl-threonine dephosphorylation(GO:0035970) |
| 0.1 | 0.7 | GO:0048680 | positive regulation of axon regeneration(GO:0048680) |
| 0.1 | 0.3 | GO:0007084 | mitotic nuclear envelope reassembly(GO:0007084) |
| 0.1 | 0.3 | GO:0019355 | nicotinamide nucleotide biosynthetic process from aspartate(GO:0019355) 'de novo' NAD biosynthetic process from aspartate(GO:0034628) |
| 0.1 | 0.5 | GO:0042448 | progesterone metabolic process(GO:0042448) |
| 0.1 | 0.3 | GO:1903334 | positive regulation of protein folding(GO:1903334) |
| 0.1 | 0.7 | GO:2001214 | positive regulation of vasculogenesis(GO:2001214) |
| 0.1 | 0.9 | GO:0048679 | regulation of axon regeneration(GO:0048679) |
| 0.1 | 1.2 | GO:0006465 | signal peptide processing(GO:0006465) |
| 0.1 | 0.4 | GO:0032482 | Rab protein signal transduction(GO:0032482) |
| 0.1 | 0.2 | GO:0060066 | oviduct development(GO:0060066) |
| 0.1 | 0.2 | GO:0010042 | response to manganese ion(GO:0010042) |
| 0.1 | 1.0 | GO:0015858 | nucleoside transport(GO:0015858) |
| 0.1 | 0.8 | GO:0045631 | regulation of auditory receptor cell differentiation(GO:0045607) regulation of mechanoreceptor differentiation(GO:0045631) regulation of inner ear receptor cell differentiation(GO:2000980) |
| 0.1 | 0.6 | GO:0006450 | regulation of translational fidelity(GO:0006450) |
| 0.1 | 0.3 | GO:0097680 | double-strand break repair via classical nonhomologous end joining(GO:0097680) |
| 0.1 | 0.2 | GO:0023021 | termination of signal transduction(GO:0023021) |
| 0.1 | 0.4 | GO:0046415 | urate metabolic process(GO:0046415) |
| 0.1 | 0.3 | GO:0018094 | protein polyglycylation(GO:0018094) |
| 0.1 | 0.4 | GO:1903715 | regulation of aerobic respiration(GO:1903715) |
| 0.1 | 2.5 | GO:0045746 | negative regulation of Notch signaling pathway(GO:0045746) |
| 0.1 | 0.4 | GO:0070314 | G1 to G0 transition(GO:0070314) |
| 0.1 | 0.2 | GO:0031587 | positive regulation of inositol 1,4,5-trisphosphate-sensitive calcium-release channel activity(GO:0031587) |
| 0.1 | 0.4 | GO:0000707 | meiotic DNA recombinase assembly(GO:0000707) |
| 0.1 | 0.3 | GO:0015747 | urate transport(GO:0015747) |
| 0.1 | 0.2 | GO:1904396 | regulation of neuromuscular junction development(GO:1904396) |
| 0.1 | 0.2 | GO:0071374 | cellular response to parathyroid hormone stimulus(GO:0071374) |
| 0.1 | 0.4 | GO:0060398 | regulation of growth hormone receptor signaling pathway(GO:0060398) |
| 0.1 | 1.0 | GO:0060856 | establishment of blood-brain barrier(GO:0060856) |
| 0.1 | 0.3 | GO:0010963 | regulation of L-arginine import(GO:0010963) |
| 0.1 | 0.1 | GO:0070574 | cadmium ion transport(GO:0015691) cadmium ion transmembrane transport(GO:0070574) |
| 0.1 | 1.5 | GO:0070884 | regulation of calcineurin-NFAT signaling cascade(GO:0070884) |
| 0.1 | 0.3 | GO:0048207 | vesicle targeting, rough ER to cis-Golgi(GO:0048207) COPII vesicle coating(GO:0048208) |
| 0.1 | 0.5 | GO:0072366 | regulation of cellular ketone metabolic process by positive regulation of transcription from RNA polymerase II promoter(GO:0072366) |
| 0.1 | 0.2 | GO:0090400 | stress-induced premature senescence(GO:0090400) |
| 0.1 | 0.2 | GO:1900222 | negative regulation of beta-amyloid clearance(GO:1900222) |
| 0.1 | 0.1 | GO:0061314 | Notch signaling involved in heart development(GO:0061314) |
| 0.1 | 0.7 | GO:0035735 | intraciliary transport involved in cilium morphogenesis(GO:0035735) |
| 0.1 | 0.3 | GO:0070086 | ubiquitin-dependent endocytosis(GO:0070086) |
| 0.1 | 0.3 | GO:0035521 | monoubiquitinated histone deubiquitination(GO:0035521) monoubiquitinated histone H2A deubiquitination(GO:0035522) |
| 0.1 | 0.1 | GO:1904339 | negative regulation of dopaminergic neuron differentiation(GO:1904339) |
| 0.1 | 0.3 | GO:0030951 | establishment or maintenance of microtubule cytoskeleton polarity(GO:0030951) |
| 0.1 | 0.4 | GO:0046618 | drug export(GO:0046618) |
| 0.1 | 0.2 | GO:0010482 | epidermal cell division(GO:0010481) regulation of epidermal cell division(GO:0010482) |
| 0.1 | 0.9 | GO:0010971 | positive regulation of G2/M transition of mitotic cell cycle(GO:0010971) |
| 0.1 | 0.1 | GO:1901977 | negative regulation of cell cycle checkpoint(GO:1901977) |
| 0.1 | 0.3 | GO:0007039 | protein catabolic process in the vacuole(GO:0007039) |
| 0.1 | 0.3 | GO:0090245 | axis elongation involved in somitogenesis(GO:0090245) |
| 0.1 | 0.4 | GO:0035459 | cargo loading into vesicle(GO:0035459) |
| 0.1 | 0.5 | GO:0001672 | regulation of chromatin assembly or disassembly(GO:0001672) |
| 0.1 | 0.4 | GO:1901673 | regulation of mitotic spindle assembly(GO:1901673) |
| 0.1 | 0.2 | GO:0072205 | metanephric collecting duct development(GO:0072205) |
| 0.1 | 0.6 | GO:0042447 | hormone catabolic process(GO:0042447) |
| 0.1 | 0.3 | GO:0031087 | nuclear-transcribed mRNA catabolic process, deadenylation-independent decay(GO:0031086) deadenylation-independent decapping of nuclear-transcribed mRNA(GO:0031087) |
| 0.1 | 1.2 | GO:0051875 | pigment granule localization(GO:0051875) |
| 0.1 | 0.2 | GO:0071787 | endoplasmic reticulum tubular network assembly(GO:0071787) |
| 0.1 | 0.2 | GO:1903751 | regulation of intrinsic apoptotic signaling pathway in response to hydrogen peroxide(GO:1903750) negative regulation of intrinsic apoptotic signaling pathway in response to hydrogen peroxide(GO:1903751) |
| 0.1 | 0.1 | GO:0072095 | regulation of branch elongation involved in ureteric bud branching(GO:0072095) |
| 0.1 | 0.6 | GO:0033601 | positive regulation of mammary gland epithelial cell proliferation(GO:0033601) |
| 0.1 | 0.2 | GO:1903377 | negative regulation of oxidative stress-induced neuron intrinsic apoptotic signaling pathway(GO:1903377) |
| 0.1 | 0.4 | GO:0071985 | multivesicular body sorting pathway(GO:0071985) |
| 0.1 | 0.1 | GO:0097212 | lysosomal membrane organization(GO:0097212) |
| 0.1 | 0.3 | GO:2000074 | regulation of type B pancreatic cell development(GO:2000074) |
| 0.1 | 0.2 | GO:0006663 | platelet activating factor biosynthetic process(GO:0006663) platelet activating factor metabolic process(GO:0046469) |
| 0.1 | 0.1 | GO:1901069 | guanosine-containing compound catabolic process(GO:1901069) |
| 0.1 | 0.3 | GO:0009186 | deoxyribonucleoside diphosphate metabolic process(GO:0009186) |
| 0.1 | 0.3 | GO:1901165 | positive regulation of trophoblast cell migration(GO:1901165) |
| 0.1 | 0.9 | GO:2000052 | positive regulation of non-canonical Wnt signaling pathway(GO:2000052) |
| 0.1 | 0.3 | GO:0034729 | histone H3-K79 methylation(GO:0034729) |
| 0.1 | 0.1 | GO:0010936 | negative regulation of macrophage cytokine production(GO:0010936) |
| 0.1 | 0.4 | GO:0032237 | activation of store-operated calcium channel activity(GO:0032237) |
| 0.1 | 0.3 | GO:0030210 | heparin biosynthetic process(GO:0030210) |
| 0.1 | 0.1 | GO:0060842 | arterial endothelial cell differentiation(GO:0060842) |
| 0.1 | 0.3 | GO:0019853 | L-ascorbic acid biosynthetic process(GO:0019853) |
| 0.1 | 0.3 | GO:0046642 | negative regulation of alpha-beta T cell proliferation(GO:0046642) |
| 0.1 | 0.3 | GO:0071971 | extracellular exosome assembly(GO:0071971) regulation of extracellular exosome assembly(GO:1903551) |
| 0.1 | 1.0 | GO:0071577 | zinc II ion transmembrane transport(GO:0071577) |
| 0.1 | 0.3 | GO:0033762 | response to glucagon(GO:0033762) |
| 0.1 | 0.2 | GO:0016480 | negative regulation of transcription from RNA polymerase III promoter(GO:0016480) |
| 0.1 | 0.4 | GO:0000963 | mitochondrial RNA processing(GO:0000963) |
| 0.1 | 0.1 | GO:0071492 | cellular response to UV-A(GO:0071492) |
| 0.1 | 0.3 | GO:0001880 | Mullerian duct regression(GO:0001880) |
| 0.1 | 0.3 | GO:0001302 | replicative cell aging(GO:0001302) |
| 0.1 | 0.1 | GO:0006987 | activation of signaling protein activity involved in unfolded protein response(GO:0006987) |
| 0.1 | 0.2 | GO:0070213 | protein auto-ADP-ribosylation(GO:0070213) |
| 0.1 | 1.4 | GO:0000413 | protein peptidyl-prolyl isomerization(GO:0000413) |
| 0.1 | 0.3 | GO:0006537 | glutamate biosynthetic process(GO:0006537) |
| 0.1 | 0.3 | GO:1903332 | regulation of protein folding(GO:1903332) |
| 0.1 | 0.9 | GO:0006614 | SRP-dependent cotranslational protein targeting to membrane(GO:0006614) |
| 0.1 | 0.4 | GO:0006995 | cellular response to nitrogen starvation(GO:0006995) cellular response to nitrogen levels(GO:0043562) |
| 0.1 | 0.1 | GO:0071072 | negative regulation of phospholipid biosynthetic process(GO:0071072) |
| 0.1 | 0.2 | GO:1901321 | positive regulation of heart induction(GO:1901321) |
| 0.1 | 0.8 | GO:0009404 | toxin metabolic process(GO:0009404) |
| 0.1 | 0.1 | GO:0043928 | exonucleolytic nuclear-transcribed mRNA catabolic process involved in deadenylation-dependent decay(GO:0043928) |
| 0.1 | 0.1 | GO:2000409 | positive regulation of T cell extravasation(GO:2000409) |
| 0.1 | 0.2 | GO:0072173 | metanephric tubule morphogenesis(GO:0072173) |
| 0.1 | 0.9 | GO:0016540 | protein autoprocessing(GO:0016540) |
| 0.1 | 0.2 | GO:0015959 | diadenosine polyphosphate metabolic process(GO:0015959) |
| 0.1 | 0.2 | GO:0070309 | lens fiber cell morphogenesis(GO:0070309) |
| 0.1 | 0.1 | GO:2000152 | regulation of ubiquitin-specific protease activity(GO:2000152) |
| 0.1 | 0.2 | GO:0032898 | neurotrophin production(GO:0032898) |
| 0.1 | 0.2 | GO:0071476 | cellular hypotonic response(GO:0071476) |
| 0.1 | 0.2 | GO:0070350 | white fat cell proliferation(GO:0070343) regulation of white fat cell proliferation(GO:0070350) |
| 0.1 | 0.4 | GO:0090435 | protein localization to nuclear envelope(GO:0090435) |
| 0.1 | 1.5 | GO:0002089 | lens morphogenesis in camera-type eye(GO:0002089) |
| 0.1 | 0.1 | GO:0009298 | GDP-mannose biosynthetic process(GO:0009298) |
| 0.1 | 0.1 | GO:2000698 | positive regulation of epithelial cell differentiation involved in kidney development(GO:2000698) |
| 0.1 | 0.1 | GO:0002877 | regulation of acute inflammatory response to non-antigenic stimulus(GO:0002877) |
| 0.1 | 0.2 | GO:1900108 | negative regulation of nodal signaling pathway(GO:1900108) |
| 0.1 | 0.3 | GO:0007023 | post-chaperonin tubulin folding pathway(GO:0007023) |
| 0.1 | 0.2 | GO:2000048 | negative regulation of cell-cell adhesion mediated by cadherin(GO:2000048) |
| 0.1 | 0.2 | GO:0097278 | complement-dependent cytotoxicity(GO:0097278) regulation of complement-dependent cytotoxicity(GO:1903659) negative regulation of complement-dependent cytotoxicity(GO:1903660) |
| 0.1 | 0.2 | GO:0000710 | meiotic mismatch repair(GO:0000710) |
| 0.1 | 0.2 | GO:0032762 | mast cell cytokine production(GO:0032762) |
| 0.1 | 0.5 | GO:0090073 | positive regulation of protein homodimerization activity(GO:0090073) |
| 0.1 | 0.2 | GO:0036493 | positive regulation of translation in response to endoplasmic reticulum stress(GO:0036493) |
| 0.1 | 0.4 | GO:0000022 | mitotic spindle elongation(GO:0000022) mitotic spindle midzone assembly(GO:0051256) |
| 0.1 | 0.1 | GO:1903909 | regulation of receptor clustering(GO:1903909) |
| 0.1 | 0.8 | GO:0030238 | male sex determination(GO:0030238) |
| 0.1 | 0.5 | GO:0006206 | pyrimidine nucleobase metabolic process(GO:0006206) |
| 0.1 | 0.2 | GO:0097118 | neuroligin clustering involved in postsynaptic membrane assembly(GO:0097118) |
| 0.1 | 0.2 | GO:1903999 | negative regulation of eating behavior(GO:1903999) |
| 0.1 | 1.4 | GO:0035418 | protein localization to synapse(GO:0035418) |
| 0.1 | 0.2 | GO:1990144 | regulation of hypoxia-induced intrinsic apoptotic signaling pathway(GO:1903297) negative regulation of hypoxia-induced intrinsic apoptotic signaling pathway(GO:1903298) intrinsic apoptotic signaling pathway in response to hypoxia(GO:1990144) |
| 0.1 | 0.6 | GO:1990126 | retrograde transport, endosome to plasma membrane(GO:1990126) |
| 0.1 | 0.9 | GO:0000097 | sulfur amino acid biosynthetic process(GO:0000097) |
| 0.1 | 0.5 | GO:0002634 | regulation of germinal center formation(GO:0002634) |
| 0.1 | 1.1 | GO:0071709 | membrane assembly(GO:0071709) |
| 0.1 | 0.1 | GO:0072553 | terminal button organization(GO:0072553) |
| 0.1 | 0.3 | GO:0006056 | cell wall mannoprotein biosynthetic process(GO:0000032) mannoprotein metabolic process(GO:0006056) mannoprotein biosynthetic process(GO:0006057) cell wall glycoprotein biosynthetic process(GO:0031506) cell wall biogenesis(GO:0042546) cell wall macromolecule biosynthetic process(GO:0044038) chain elongation of O-linked mannose residue(GO:0044845) cellular component macromolecule biosynthetic process(GO:0070589) |
| 0.1 | 0.3 | GO:0010457 | centriole-centriole cohesion(GO:0010457) |
| 0.1 | 0.2 | GO:0008588 | release of cytoplasmic sequestered NF-kappaB(GO:0008588) |
| 0.1 | 0.2 | GO:0042732 | D-xylose metabolic process(GO:0042732) |
| 0.1 | 0.1 | GO:0014834 | skeletal muscle satellite cell maintenance involved in skeletal muscle regeneration(GO:0014834) |
| 0.1 | 0.1 | GO:0046504 | ether lipid biosynthetic process(GO:0008611) glycerol ether biosynthetic process(GO:0046504) cellular lipid biosynthetic process(GO:0097384) ether biosynthetic process(GO:1901503) |
| 0.1 | 0.1 | GO:0090091 | positive regulation of extracellular matrix disassembly(GO:0090091) |
| 0.1 | 0.1 | GO:0035973 | aggrephagy(GO:0035973) |
| 0.1 | 0.1 | GO:0051095 | regulation of helicase activity(GO:0051095) positive regulation of helicase activity(GO:0051096) |
| 0.1 | 0.1 | GO:0035988 | chondrocyte proliferation(GO:0035988) |
| 0.1 | 0.8 | GO:0009214 | cyclic nucleotide catabolic process(GO:0009214) |
| 0.1 | 0.2 | GO:0090360 | platelet-derived growth factor production(GO:0090360) regulation of platelet-derived growth factor production(GO:0090361) |
| 0.1 | 0.3 | GO:2001140 | regulation of phospholipid transport(GO:2001138) positive regulation of phospholipid transport(GO:2001140) |
| 0.1 | 0.6 | GO:0032486 | Rap protein signal transduction(GO:0032486) |
| 0.1 | 0.1 | GO:0046121 | deoxyribonucleoside catabolic process(GO:0046121) |
| 0.1 | 0.1 | GO:0021524 | visceral motor neuron differentiation(GO:0021524) |
| 0.1 | 0.5 | GO:2000310 | regulation of N-methyl-D-aspartate selective glutamate receptor activity(GO:2000310) |
| 0.1 | 0.8 | GO:0034497 | protein localization to pre-autophagosomal structure(GO:0034497) |
| 0.1 | 0.2 | GO:0051541 | elastin metabolic process(GO:0051541) |
| 0.1 | 0.1 | GO:0060051 | negative regulation of protein glycosylation(GO:0060051) |
| 0.1 | 0.2 | GO:0015744 | succinate transport(GO:0015744) |
| 0.1 | 0.1 | GO:0010911 | regulation of isomerase activity(GO:0010911) positive regulation of isomerase activity(GO:0010912) |
| 0.1 | 0.2 | GO:0030576 | Cajal body organization(GO:0030576) |
| 0.1 | 0.4 | GO:0021942 | radial glia guided migration of Purkinje cell(GO:0021942) |
| 0.1 | 0.3 | GO:0098915 | membrane repolarization during ventricular cardiac muscle cell action potential(GO:0098915) |
| 0.1 | 0.3 | GO:0045719 | negative regulation of glycogen biosynthetic process(GO:0045719) |
| 0.1 | 0.3 | GO:0006167 | AMP biosynthetic process(GO:0006167) |
| 0.1 | 0.7 | GO:0006353 | DNA-templated transcription, termination(GO:0006353) |
| 0.1 | 0.1 | GO:0002025 | vasodilation by norepinephrine-epinephrine involved in regulation of systemic arterial blood pressure(GO:0002025) |
| 0.1 | 0.2 | GO:0042998 | positive regulation of Golgi to plasma membrane protein transport(GO:0042998) |
| 0.1 | 0.3 | GO:0030046 | parallel actin filament bundle assembly(GO:0030046) |
| 0.1 | 0.1 | GO:0060591 | chondroblast differentiation(GO:0060591) |
| 0.1 | 0.3 | GO:0032536 | regulation of cell projection size(GO:0032536) |
| 0.1 | 0.1 | GO:0030908 | intein-mediated protein splicing(GO:0016539) protein splicing(GO:0030908) |
| 0.1 | 0.3 | GO:0002317 | plasma cell differentiation(GO:0002317) |
| 0.1 | 0.3 | GO:0008090 | retrograde axonal transport(GO:0008090) |
| 0.1 | 0.3 | GO:0071763 | nuclear membrane organization(GO:0071763) |
| 0.1 | 0.1 | GO:0033092 | positive regulation of immature T cell proliferation in thymus(GO:0033092) |
| 0.1 | 0.2 | GO:0000389 | mRNA 3'-splice site recognition(GO:0000389) |
| 0.1 | 0.1 | GO:1902455 | negative regulation of stem cell population maintenance(GO:1902455) |
| 0.1 | 0.2 | GO:1900113 | regulation of histone H3-K9 trimethylation(GO:1900112) negative regulation of histone H3-K9 trimethylation(GO:1900113) |
| 0.1 | 0.2 | GO:0035372 | protein localization to microtubule(GO:0035372) |
| 0.1 | 0.3 | GO:0002072 | optic cup morphogenesis involved in camera-type eye development(GO:0002072) |
| 0.1 | 0.4 | GO:0033327 | Leydig cell differentiation(GO:0033327) |
| 0.1 | 0.1 | GO:0051088 | PMA-inducible membrane protein ectodomain proteolysis(GO:0051088) |
| 0.1 | 0.1 | GO:2000467 | positive regulation of glycogen (starch) synthase activity(GO:2000467) |
| 0.1 | 0.1 | GO:0035622 | intrahepatic bile duct development(GO:0035622) |
| 0.1 | 0.1 | GO:1903265 | positive regulation of tumor necrosis factor-mediated signaling pathway(GO:1903265) |
| 0.1 | 0.3 | GO:1900103 | positive regulation of endoplasmic reticulum unfolded protein response(GO:1900103) |
| 0.1 | 0.2 | GO:0010724 | regulation of definitive erythrocyte differentiation(GO:0010724) |
| 0.1 | 0.1 | GO:1903977 | positive regulation of glial cell migration(GO:1903977) |
| 0.1 | 0.4 | GO:0000467 | exonucleolytic trimming involved in rRNA processing(GO:0000459) exonucleolytic trimming to generate mature 3'-end of 5.8S rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000467) |
| 0.1 | 0.1 | GO:0070681 | glutaminyl-tRNAGln biosynthesis via transamidation(GO:0070681) |
| 0.1 | 0.3 | GO:0018211 | protein C-linked glycosylation(GO:0018103) peptidyl-tryptophan modification(GO:0018211) protein C-linked glycosylation via tryptophan(GO:0018317) protein C-linked glycosylation via 2'-alpha-mannosyl-L-tryptophan(GO:0018406) |
| 0.1 | 0.2 | GO:1904526 | regulation of microtubule binding(GO:1904526) positive regulation of microtubule binding(GO:1904528) |
| 0.1 | 0.3 | GO:0045990 | carbon catabolite regulation of transcription from RNA polymerase II promoter(GO:0000429) carbon catabolite activation of transcription from RNA polymerase II promoter(GO:0000436) carbon catabolite regulation of transcription(GO:0045990) carbon catabolite activation of transcription(GO:0045991) |
| 0.1 | 0.1 | GO:1990086 | lens fiber cell apoptotic process(GO:1990086) |
| 0.1 | 0.3 | GO:1900029 | positive regulation of ruffle assembly(GO:1900029) |
| 0.1 | 0.1 | GO:0031282 | regulation of guanylate cyclase activity(GO:0031282) |
| 0.1 | 0.5 | GO:0046831 | regulation of RNA export from nucleus(GO:0046831) |
| 0.1 | 0.5 | GO:0006729 | tetrahydrobiopterin biosynthetic process(GO:0006729) |
| 0.1 | 0.1 | GO:0010958 | regulation of amino acid import(GO:0010958) |
| 0.1 | 0.2 | GO:0010387 | COP9 signalosome assembly(GO:0010387) |
| 0.1 | 0.5 | GO:0048149 | behavioral response to ethanol(GO:0048149) |
| 0.1 | 0.3 | GO:0071236 | cellular response to antibiotic(GO:0071236) |
| 0.1 | 0.3 | GO:0019740 | nitrogen utilization(GO:0019740) |
| 0.1 | 0.2 | GO:0070682 | proteasome regulatory particle assembly(GO:0070682) |
| 0.1 | 0.2 | GO:0060178 | regulation of exocyst localization(GO:0060178) |
| 0.1 | 0.1 | GO:0021847 | ventricular zone neuroblast division(GO:0021847) |
| 0.1 | 0.1 | GO:0030050 | vesicle transport along actin filament(GO:0030050) |
| 0.1 | 0.1 | GO:0090027 | negative regulation of monocyte chemotaxis(GO:0090027) |
| 0.1 | 0.2 | GO:0006670 | sphingosine metabolic process(GO:0006670) |
| 0.1 | 0.1 | GO:0006714 | sesquiterpenoid metabolic process(GO:0006714) |
| 0.1 | 0.3 | GO:0046836 | glycolipid transport(GO:0046836) |
| 0.1 | 0.2 | GO:1900245 | positive regulation of MDA-5 signaling pathway(GO:1900245) |
| 0.1 | 0.6 | GO:0032780 | negative regulation of ATPase activity(GO:0032780) |
| 0.1 | 0.1 | GO:0002309 | T cell proliferation involved in immune response(GO:0002309) |
| 0.1 | 0.2 | GO:0035520 | monoubiquitinated protein deubiquitination(GO:0035520) |
| 0.1 | 0.4 | GO:0006108 | malate metabolic process(GO:0006108) |
| 0.1 | 0.2 | GO:1900107 | regulation of nodal signaling pathway(GO:1900107) |
| 0.1 | 0.5 | GO:0071361 | cellular response to ethanol(GO:0071361) |
| 0.1 | 0.1 | GO:0060745 | mammary gland branching involved in pregnancy(GO:0060745) |
| 0.1 | 0.3 | GO:0031034 | myosin filament assembly(GO:0031034) |
| 0.1 | 0.1 | GO:2000987 | regulation of fear response(GO:1903365) positive regulation of fear response(GO:1903367) regulation of behavioral fear response(GO:2000822) positive regulation of behavioral fear response(GO:2000987) |
| 0.1 | 0.5 | GO:0035269 | protein O-linked mannosylation(GO:0035269) |
| 0.1 | 0.1 | GO:0018171 | peptidyl-cysteine oxidation(GO:0018171) |
| 0.1 | 0.3 | GO:0070475 | rRNA base methylation(GO:0070475) |
| 0.1 | 0.2 | GO:0045448 | regulation of mitotic cell cycle, embryonic(GO:0009794) mitotic cell cycle, embryonic(GO:0045448) |
| 0.1 | 0.2 | GO:0034773 | histone H4-K20 trimethylation(GO:0034773) |
| 0.1 | 0.2 | GO:0098598 | vocal learning(GO:0042297) imitative learning(GO:0098596) learned vocalization behavior or vocal learning(GO:0098598) |
| 0.1 | 0.7 | GO:0006957 | complement activation, alternative pathway(GO:0006957) |
| 0.1 | 0.1 | GO:2000384 | regulation of ectoderm development(GO:2000383) negative regulation of ectoderm development(GO:2000384) |
| 0.1 | 0.2 | GO:0006432 | phenylalanyl-tRNA aminoacylation(GO:0006432) |
| 0.1 | 0.2 | GO:0032074 | negative regulation of nuclease activity(GO:0032074) |
| 0.1 | 0.2 | GO:0016259 | selenocysteine metabolic process(GO:0016259) |
| 0.1 | 0.1 | GO:0072061 | inner medullary collecting duct development(GO:0072061) |
| 0.1 | 0.2 | GO:0006678 | glucosylceramide metabolic process(GO:0006678) |
| 0.1 | 0.1 | GO:0021797 | forebrain anterior/posterior pattern specification(GO:0021797) |
| 0.1 | 0.5 | GO:0000244 | spliceosomal tri-snRNP complex assembly(GO:0000244) |
| 0.1 | 0.1 | GO:1901420 | negative regulation of response to alcohol(GO:1901420) |
| 0.1 | 0.4 | GO:0048227 | plasma membrane to endosome transport(GO:0048227) |
| 0.1 | 0.2 | GO:0046341 | CDP-diacylglycerol metabolic process(GO:0046341) |
| 0.1 | 0.2 | GO:0061042 | vascular wound healing(GO:0061042) |
| 0.1 | 0.8 | GO:0032012 | ARF protein signal transduction(GO:0032011) regulation of ARF protein signal transduction(GO:0032012) |
| 0.1 | 0.5 | GO:0090308 | regulation of methylation-dependent chromatin silencing(GO:0090308) |
| 0.1 | 0.8 | GO:0006829 | zinc II ion transport(GO:0006829) |
| 0.1 | 0.2 | GO:0045332 | lipid translocation(GO:0034204) phospholipid translocation(GO:0045332) |
| 0.1 | 0.2 | GO:0048102 | autophagic cell death(GO:0048102) |
| 0.1 | 0.1 | GO:0001922 | B-1 B cell homeostasis(GO:0001922) |
| 0.1 | 0.1 | GO:0097343 | ripoptosome assembly(GO:0097343) ripoptosome assembly involved in necroptotic process(GO:1901026) |
| 0.1 | 0.3 | GO:0030205 | dermatan sulfate metabolic process(GO:0030205) |
| 0.1 | 0.2 | GO:0090315 | negative regulation of protein targeting to membrane(GO:0090315) |
| 0.1 | 0.2 | GO:0071649 | regulation of chemokine (C-C motif) ligand 5 production(GO:0071649) |
| 0.1 | 0.2 | GO:0031339 | negative regulation of vesicle fusion(GO:0031339) |
| 0.1 | 0.3 | GO:0070131 | positive regulation of mitochondrial translation(GO:0070131) |
| 0.1 | 0.3 | GO:0018231 | peptidyl-L-cysteine S-palmitoylation(GO:0018230) peptidyl-S-diacylglycerol-L-cysteine biosynthetic process from peptidyl-cysteine(GO:0018231) |
| 0.1 | 0.3 | GO:0009052 | pentose-phosphate shunt, non-oxidative branch(GO:0009052) |
| 0.1 | 0.1 | GO:0090169 | regulation of spindle assembly(GO:0090169) |
| 0.1 | 0.1 | GO:0035434 | copper ion transmembrane transport(GO:0035434) |
| 0.1 | 0.1 | GO:0031145 | anaphase-promoting complex-dependent catabolic process(GO:0031145) |
| 0.1 | 0.1 | GO:0036480 | neuron intrinsic apoptotic signaling pathway in response to oxidative stress(GO:0036480) regulation of oxidative stress-induced neuron intrinsic apoptotic signaling pathway(GO:1903376) |
| 0.1 | 0.2 | GO:0007638 | mechanosensory behavior(GO:0007638) |
| 0.1 | 0.3 | GO:0061003 | positive regulation of dendritic spine morphogenesis(GO:0061003) |
| 0.1 | 0.2 | GO:0060287 | epithelial cilium movement involved in determination of left/right asymmetry(GO:0060287) |
| 0.1 | 0.2 | GO:0002572 | pro-T cell differentiation(GO:0002572) |
| 0.1 | 0.2 | GO:0030647 | polyketide metabolic process(GO:0030638) aminoglycoside antibiotic metabolic process(GO:0030647) daunorubicin metabolic process(GO:0044597) doxorubicin metabolic process(GO:0044598) |
| 0.1 | 0.3 | GO:0031119 | tRNA pseudouridine synthesis(GO:0031119) |
| 0.1 | 0.2 | GO:0045875 | negative regulation of sister chromatid cohesion(GO:0045875) |
| 0.1 | 0.5 | GO:0006120 | mitochondrial electron transport, NADH to ubiquinone(GO:0006120) |
| 0.1 | 0.5 | GO:0000290 | deadenylation-dependent decapping of nuclear-transcribed mRNA(GO:0000290) |
| 0.1 | 0.1 | GO:0006681 | galactosylceramide metabolic process(GO:0006681) |
| 0.1 | 0.3 | GO:0035330 | regulation of hippo signaling(GO:0035330) |
| 0.1 | 0.1 | GO:0045085 | negative regulation of interleukin-2 biosynthetic process(GO:0045085) |
| 0.1 | 0.1 | GO:0031033 | myosin filament organization(GO:0031033) |
| 0.1 | 0.1 | GO:0051255 | spindle midzone assembly(GO:0051255) |
| 0.1 | 0.1 | GO:0006901 | vesicle coating(GO:0006901) |
| 0.1 | 0.2 | GO:0002121 | inter-male aggressive behavior(GO:0002121) |
| 0.1 | 0.7 | GO:0030150 | protein import into mitochondrial matrix(GO:0030150) |
| 0.1 | 0.2 | GO:0007220 | Notch receptor processing(GO:0007220) |
| 0.1 | 0.1 | GO:0033210 | leptin-mediated signaling pathway(GO:0033210) |
| 0.1 | 0.1 | GO:0055099 | response to high density lipoprotein particle(GO:0055099) |
| 0.1 | 0.2 | GO:2000110 | negative regulation of macrophage apoptotic process(GO:2000110) |
| 0.1 | 0.2 | GO:0071830 | chylomicron remnant clearance(GO:0034382) triglyceride-rich lipoprotein particle clearance(GO:0071830) |
| 0.1 | 0.2 | GO:0070125 | mitochondrial translational elongation(GO:0070125) |
| 0.1 | 0.1 | GO:0009826 | unidimensional cell growth(GO:0009826) |
| 0.1 | 0.2 | GO:0003097 | renal water transport(GO:0003097) renal water absorption(GO:0070295) |
| 0.1 | 0.2 | GO:0015740 | C4-dicarboxylate transport(GO:0015740) |
| 0.1 | 0.1 | GO:0034427 | nuclear-transcribed mRNA catabolic process, exonucleolytic, 3'-5'(GO:0034427) |
| 0.1 | 0.1 | GO:0033085 | negative regulation of T cell differentiation in thymus(GO:0033085) negative regulation of thymocyte aggregation(GO:2000399) |
| 0.1 | 0.1 | GO:0060478 | acrosomal vesicle exocytosis(GO:0060478) |
| 0.1 | 0.1 | GO:0031937 | positive regulation of chromatin silencing(GO:0031937) |
| 0.1 | 0.8 | GO:0030488 | tRNA methylation(GO:0030488) |
| 0.1 | 0.1 | GO:0034499 | late endosome to Golgi transport(GO:0034499) |
| 0.1 | 0.5 | GO:0016074 | snoRNA metabolic process(GO:0016074) |
| 0.1 | 0.2 | GO:0055091 | phospholipid homeostasis(GO:0055091) |
| 0.1 | 0.1 | GO:0031914 | negative regulation of synaptic plasticity(GO:0031914) |
| 0.1 | 0.3 | GO:0032211 | negative regulation of telomere maintenance via telomerase(GO:0032211) |
| 0.1 | 0.3 | GO:0060693 | regulation of branching involved in salivary gland morphogenesis(GO:0060693) |
| 0.1 | 0.3 | GO:0010824 | regulation of centrosome duplication(GO:0010824) |
| 0.1 | 0.4 | GO:0001845 | phagolysosome assembly(GO:0001845) |
| 0.1 | 0.1 | GO:0061146 | Peyer's patch morphogenesis(GO:0061146) |
| 0.1 | 0.5 | GO:0006098 | pentose-phosphate shunt(GO:0006098) |
| 0.1 | 0.2 | GO:1904059 | regulation of locomotor rhythm(GO:1904059) |
| 0.1 | 0.1 | GO:0086023 | adrenergic receptor signaling pathway involved in heart process(GO:0086023) |
| 0.1 | 0.1 | GO:2000017 | positive regulation of determination of dorsal identity(GO:2000017) |
| 0.1 | 0.8 | GO:0006783 | heme biosynthetic process(GO:0006783) |
| 0.1 | 0.1 | GO:0071503 | response to heparin(GO:0071503) cellular response to heparin(GO:0071504) |
| 0.1 | 0.3 | GO:0003376 | sphingosine-1-phosphate signaling pathway(GO:0003376) |
| 0.1 | 0.4 | GO:2000060 | positive regulation of protein ubiquitination involved in ubiquitin-dependent protein catabolic process(GO:2000060) |
| 0.1 | 0.1 | GO:0035799 | ureter maturation(GO:0035799) |
| 0.1 | 0.2 | GO:0072017 | distal tubule development(GO:0072017) |
| 0.1 | 0.2 | GO:0006742 | NADP catabolic process(GO:0006742) |
| 0.1 | 0.1 | GO:0021540 | corpus callosum morphogenesis(GO:0021540) |
| 0.1 | 0.2 | GO:1900748 | positive regulation of vascular endothelial growth factor signaling pathway(GO:1900748) |
| 0.1 | 0.5 | GO:0015816 | glycine transport(GO:0015816) |
| 0.1 | 0.9 | GO:0070536 | protein K63-linked deubiquitination(GO:0070536) |
| 0.1 | 0.1 | GO:2000741 | positive regulation of mesenchymal stem cell differentiation(GO:2000741) |
| 0.1 | 0.1 | GO:0042525 | tyrosine phosphorylation of Stat6 protein(GO:0042505) regulation of tyrosine phosphorylation of Stat6 protein(GO:0042525) |
| 0.1 | 0.4 | GO:0052697 | xenobiotic glucuronidation(GO:0052697) |
| 0.1 | 0.3 | GO:0060708 | spongiotrophoblast differentiation(GO:0060708) |
| 0.1 | 0.2 | GO:0005984 | disaccharide metabolic process(GO:0005984) |
| 0.0 | 0.2 | GO:0045112 | integrin biosynthetic process(GO:0045112) |
| 0.0 | 0.2 | GO:0098787 | mRNA cleavage involved in mRNA processing(GO:0098787) |
| 0.0 | 0.3 | GO:0032933 | response to sterol depletion(GO:0006991) SREBP signaling pathway(GO:0032933) cellular response to sterol depletion(GO:0071501) |
| 0.0 | 0.2 | GO:0030828 | positive regulation of cGMP biosynthetic process(GO:0030828) |
| 0.0 | 0.1 | GO:1902036 | regulation of hematopoietic stem cell differentiation(GO:1902036) |
| 0.0 | 0.8 | GO:0070208 | protein heterotrimerization(GO:0070208) |
| 0.0 | 0.0 | GO:0043402 | glucocorticoid mediated signaling pathway(GO:0043402) |
| 0.0 | 1.0 | GO:0036075 | endochondral ossification(GO:0001958) replacement ossification(GO:0036075) |
| 0.0 | 0.1 | GO:0045714 | regulation of low-density lipoprotein particle receptor biosynthetic process(GO:0045714) |
| 0.0 | 0.2 | GO:0044791 | modulation by host of viral release from host cell(GO:0044789) positive regulation by host of viral release from host cell(GO:0044791) |
| 0.0 | 0.2 | GO:0046133 | pyrimidine ribonucleoside catabolic process(GO:0046133) |
| 0.0 | 0.3 | GO:0016446 | somatic hypermutation of immunoglobulin genes(GO:0016446) |
| 0.0 | 0.5 | GO:0035510 | DNA dealkylation(GO:0035510) |
| 0.0 | 0.1 | GO:2000015 | regulation of determination of dorsal identity(GO:2000015) |
| 0.0 | 0.1 | GO:0072602 | interleukin-4 secretion(GO:0072602) |
| 0.0 | 0.2 | GO:0002488 | antigen processing and presentation of endogenous peptide antigen via MHC class Ib(GO:0002476) antigen processing and presentation of endogenous peptide antigen via MHC class Ib via ER pathway(GO:0002488) antigen processing and presentation of endogenous peptide antigen via MHC class Ib via ER pathway, TAP-dependent(GO:0002489) |
| 0.0 | 0.0 | GO:0051006 | positive regulation of lipoprotein lipase activity(GO:0051006) |
| 0.0 | 0.1 | GO:0035336 | long-chain fatty-acyl-CoA metabolic process(GO:0035336) |
| 0.0 | 0.0 | GO:0035995 | detection of muscle stretch(GO:0035995) |
| 0.0 | 0.2 | GO:2000279 | negative regulation of DNA biosynthetic process(GO:2000279) |
| 0.0 | 0.1 | GO:0061154 | endothelial tube morphogenesis(GO:0061154) |
| 0.0 | 0.7 | GO:0001539 | cilium or flagellum-dependent cell motility(GO:0001539) cilium-dependent cell motility(GO:0060285) |
| 0.0 | 0.3 | GO:0006337 | nucleosome disassembly(GO:0006337) protein-DNA complex disassembly(GO:0032986) |
| 0.0 | 0.1 | GO:0034756 | regulation of iron ion transport(GO:0034756) |
| 0.0 | 0.1 | GO:0006177 | GMP biosynthetic process(GO:0006177) |
| 0.0 | 0.8 | GO:0048384 | retinoic acid receptor signaling pathway(GO:0048384) |
| 0.0 | 0.1 | GO:0035526 | retrograde transport, plasma membrane to Golgi(GO:0035526) |
| 0.0 | 0.2 | GO:0051189 | Mo-molybdopterin cofactor biosynthetic process(GO:0006777) Mo-molybdopterin cofactor metabolic process(GO:0019720) molybdopterin cofactor biosynthetic process(GO:0032324) molybdopterin cofactor metabolic process(GO:0043545) prosthetic group metabolic process(GO:0051189) |
| 0.0 | 0.0 | GO:0031627 | telomeric loop formation(GO:0031627) |
| 0.0 | 0.1 | GO:0090503 | RNA phosphodiester bond hydrolysis, exonucleolytic(GO:0090503) |
| 0.0 | 0.1 | GO:1904219 | regulation of CDP-diacylglycerol-serine O-phosphatidyltransferase activity(GO:1904217) positive regulation of CDP-diacylglycerol-serine O-phosphatidyltransferase activity(GO:1904219) regulation of serine C-palmitoyltransferase activity(GO:1904220) positive regulation of serine C-palmitoyltransferase activity(GO:1904222) |
| 0.0 | 0.6 | GO:0042491 | auditory receptor cell differentiation(GO:0042491) |
| 0.0 | 0.1 | GO:0006420 | arginyl-tRNA aminoacylation(GO:0006420) |
| 0.0 | 0.1 | GO:0021892 | cerebral cortex GABAergic interneuron migration(GO:0021853) cerebral cortex GABAergic interneuron differentiation(GO:0021892) interneuron migration(GO:1904936) |
| 0.0 | 0.1 | GO:0019805 | quinolinate biosynthetic process(GO:0019805) |
| 0.0 | 0.0 | GO:0002339 | B cell selection(GO:0002339) |
| 0.0 | 0.1 | GO:1905206 | positive regulation of hydrogen peroxide-mediated programmed cell death(GO:1901300) positive regulation of hydrogen peroxide-induced cell death(GO:1905206) |
| 0.0 | 0.1 | GO:0090219 | negative regulation of lipid kinase activity(GO:0090219) |
| 0.0 | 0.7 | GO:0009303 | rRNA transcription(GO:0009303) |
| 0.0 | 0.7 | GO:0017144 | drug metabolic process(GO:0017144) |
| 0.0 | 0.0 | GO:0070272 | proton-transporting ATP synthase complex assembly(GO:0043461) proton-transporting ATP synthase complex biogenesis(GO:0070272) |
| 0.0 | 0.6 | GO:0033235 | positive regulation of protein sumoylation(GO:0033235) |
| 0.0 | 0.1 | GO:0008626 | granzyme-mediated apoptotic signaling pathway(GO:0008626) |
| 0.0 | 0.2 | GO:0006283 | transcription-coupled nucleotide-excision repair(GO:0006283) |
| 0.0 | 1.2 | GO:0045839 | negative regulation of mitotic nuclear division(GO:0045839) |
| 0.0 | 0.3 | GO:0030212 | hyaluronan metabolic process(GO:0030212) |
| 0.0 | 0.1 | GO:0006613 | cotranslational protein targeting to membrane(GO:0006613) |
| 0.0 | 0.2 | GO:0045743 | positive regulation of fibroblast growth factor receptor signaling pathway(GO:0045743) |
| 0.0 | 0.1 | GO:0070428 | regulation of nucleotide-binding oligomerization domain containing 1 signaling pathway(GO:0070428) |
| 0.0 | 0.1 | GO:0090427 | activation of meiosis(GO:0090427) |
| 0.0 | 0.2 | GO:0097320 | membrane tubulation(GO:0097320) |
| 0.0 | 0.1 | GO:0032847 | regulation of cellular pH reduction(GO:0032847) |
| 0.0 | 0.6 | GO:0016578 | histone deubiquitination(GO:0016578) |
| 0.0 | 0.0 | GO:0034146 | toll-like receptor 5 signaling pathway(GO:0034146) |
| 0.0 | 0.1 | GO:0010332 | response to gamma radiation(GO:0010332) |
| 0.0 | 0.4 | GO:0071353 | cellular response to interleukin-4(GO:0071353) |
| 0.0 | 0.0 | GO:0036016 | response to interleukin-3(GO:0036015) cellular response to interleukin-3(GO:0036016) |
| 0.0 | 0.0 | GO:0070562 | regulation of vitamin D receptor signaling pathway(GO:0070562) |
| 0.0 | 0.2 | GO:0060033 | anatomical structure regression(GO:0060033) |
| 0.0 | 0.2 | GO:1902176 | negative regulation of oxidative stress-induced intrinsic apoptotic signaling pathway(GO:1902176) |
| 0.0 | 0.1 | GO:0045896 | regulation of transcription during mitosis(GO:0045896) positive regulation of transcription during mitosis(GO:0045897) |
| 0.0 | 0.1 | GO:0060988 | lipid tube assembly(GO:0060988) |
| 0.0 | 0.3 | GO:0042178 | xenobiotic catabolic process(GO:0042178) |
| 0.0 | 0.1 | GO:0048597 | post-embryonic camera-type eye morphogenesis(GO:0048597) |
| 0.0 | 0.1 | GO:0045910 | negative regulation of DNA recombination(GO:0045910) |
| 0.0 | 0.7 | GO:0006303 | double-strand break repair via nonhomologous end joining(GO:0006303) |
| 0.0 | 0.3 | GO:0036120 | cellular response to platelet-derived growth factor stimulus(GO:0036120) |
| 0.0 | 0.3 | GO:0060394 | negative regulation of pathway-restricted SMAD protein phosphorylation(GO:0060394) |
| 0.0 | 0.0 | GO:0060789 | hair follicle placode formation(GO:0060789) |
| 0.0 | 0.1 | GO:0019676 | ammonia assimilation cycle(GO:0019676) |
| 0.0 | 0.2 | GO:0045617 | negative regulation of keratinocyte differentiation(GO:0045617) |
| 0.0 | 0.1 | GO:0010455 | positive regulation of cell fate commitment(GO:0010455) |
| 0.0 | 0.1 | GO:0060586 | multicellular organismal iron ion homeostasis(GO:0060586) |
| 0.0 | 0.1 | GO:0009597 | detection of virus(GO:0009597) |
| 0.0 | 0.2 | GO:0042590 | antigen processing and presentation of exogenous peptide antigen via MHC class I(GO:0042590) |
| 0.0 | 0.1 | GO:0051409 | response to nitrosative stress(GO:0051409) |
| 0.0 | 0.1 | GO:0002904 | positive regulation of B cell apoptotic process(GO:0002904) |
| 0.0 | 0.1 | GO:0010606 | positive regulation of cytoplasmic mRNA processing body assembly(GO:0010606) |
| 0.0 | 0.2 | GO:0042421 | norepinephrine biosynthetic process(GO:0042421) |
| 0.0 | 0.2 | GO:0097062 | dendritic spine maintenance(GO:0097062) |
| 0.0 | 0.1 | GO:0001834 | trophectodermal cell proliferation(GO:0001834) |
| 0.0 | 0.3 | GO:0008105 | asymmetric protein localization(GO:0008105) |
| 0.0 | 0.1 | GO:0071873 | response to norepinephrine(GO:0071873) |
| 0.0 | 0.3 | GO:0098781 | ncRNA transcription(GO:0098781) |
| 0.0 | 0.2 | GO:0034975 | protein folding in endoplasmic reticulum(GO:0034975) |
| 0.0 | 0.1 | GO:0031293 | membrane protein intracellular domain proteolysis(GO:0031293) |
| 0.0 | 0.2 | GO:1900109 | regulation of histone H3-K9 dimethylation(GO:1900109) |
| 0.0 | 0.1 | GO:0033690 | positive regulation of osteoblast proliferation(GO:0033690) |
| 0.0 | 0.2 | GO:0031017 | exocrine pancreas development(GO:0031017) |
| 0.0 | 0.4 | GO:0015721 | bile acid and bile salt transport(GO:0015721) |
| 0.0 | 0.2 | GO:0010792 | DNA double-strand break processing involved in repair via single-strand annealing(GO:0010792) |
| 0.0 | 0.1 | GO:1903147 | negative regulation of mitophagy(GO:1903147) |
| 0.0 | 0.1 | GO:0007253 | cytoplasmic sequestering of NF-kappaB(GO:0007253) |
| 0.0 | 0.1 | GO:0034085 | establishment of sister chromatid cohesion(GO:0034085) cohesin loading(GO:0071921) regulation of cohesin loading(GO:0071922) |
| 0.0 | 0.2 | GO:0018202 | peptidyl-diphthamide metabolic process(GO:0017182) peptidyl-diphthamide biosynthetic process from peptidyl-histidine(GO:0017183) peptidyl-histidine modification(GO:0018202) |
| 0.0 | 0.1 | GO:0002337 | B-1a B cell differentiation(GO:0002337) |
| 0.0 | 0.6 | GO:0021889 | olfactory bulb interneuron differentiation(GO:0021889) |
| 0.0 | 0.1 | GO:0090161 | Golgi ribbon formation(GO:0090161) |
| 0.0 | 0.3 | GO:0060074 | synapse maturation(GO:0060074) |
| 0.0 | 0.2 | GO:0051461 | positive regulation of corticotropin secretion(GO:0051461) |
| 0.0 | 0.1 | GO:0033566 | gamma-tubulin complex localization(GO:0033566) |
| 0.0 | 0.6 | GO:0007020 | microtubule nucleation(GO:0007020) |
| 0.0 | 0.0 | GO:0007228 | positive regulation of hh target transcription factor activity(GO:0007228) |
| 0.0 | 0.3 | GO:0033137 | negative regulation of peptidyl-serine phosphorylation(GO:0033137) |
| 0.0 | 0.7 | GO:0006884 | cell volume homeostasis(GO:0006884) |
| 0.0 | 0.1 | GO:0042268 | regulation of cytolysis(GO:0042268) |
| 0.0 | 0.7 | GO:0090004 | positive regulation of establishment of protein localization to plasma membrane(GO:0090004) |
| 0.0 | 0.0 | GO:0033629 | negative regulation of cell adhesion mediated by integrin(GO:0033629) |
| 0.0 | 1.2 | GO:0010761 | fibroblast migration(GO:0010761) |
| 0.0 | 0.4 | GO:0007342 | fusion of sperm to egg plasma membrane(GO:0007342) |
| 0.0 | 1.0 | GO:0048791 | calcium ion-regulated exocytosis of neurotransmitter(GO:0048791) |
| 0.0 | 0.3 | GO:1901409 | regulation of phosphorylation of RNA polymerase II C-terminal domain(GO:1901407) positive regulation of phosphorylation of RNA polymerase II C-terminal domain(GO:1901409) |
| 0.0 | 0.2 | GO:0032201 | telomere maintenance via semi-conservative replication(GO:0032201) |
| 0.0 | 0.3 | GO:0051044 | positive regulation of membrane protein ectodomain proteolysis(GO:0051044) |
| 0.0 | 0.4 | GO:0046838 | phosphorylated carbohydrate dephosphorylation(GO:0046838) |
| 0.0 | 0.3 | GO:0036035 | osteoclast development(GO:0036035) |
| 0.0 | 0.0 | GO:0009449 | gamma-aminobutyric acid biosynthetic process(GO:0009449) |
| 0.0 | 0.2 | GO:0071280 | cellular response to copper ion(GO:0071280) |
| 0.0 | 0.2 | GO:0070934 | CRD-mediated mRNA stabilization(GO:0070934) |
| 0.0 | 0.1 | GO:1904424 | regulation of GTP binding(GO:1904424) |
| 0.0 | 0.4 | GO:0010591 | regulation of lamellipodium assembly(GO:0010591) |
| 0.0 | 0.1 | GO:0045917 | positive regulation of complement activation(GO:0045917) positive regulation of protein activation cascade(GO:2000259) |
| 0.0 | 0.0 | GO:0045723 | positive regulation of fatty acid biosynthetic process(GO:0045723) |
| 0.0 | 0.0 | GO:0035993 | deltoid tuberosity development(GO:0035993) |
| 0.0 | 0.3 | GO:0006123 | mitochondrial electron transport, cytochrome c to oxygen(GO:0006123) |
| 0.0 | 0.2 | GO:0006370 | 7-methylguanosine mRNA capping(GO:0006370) |
| 0.0 | 0.3 | GO:0030213 | hyaluronan biosynthetic process(GO:0030213) |
| 0.0 | 0.0 | GO:0019068 | virion assembly(GO:0019068) |
| 0.0 | 0.1 | GO:0000966 | RNA 5'-end processing(GO:0000966) |
| 0.0 | 0.3 | GO:0044804 | nucleophagy(GO:0044804) |
| 0.0 | 0.2 | GO:0043162 | ubiquitin-dependent protein catabolic process via the multivesicular body sorting pathway(GO:0043162) |
| 0.0 | 0.7 | GO:0006400 | tRNA modification(GO:0006400) |
| 0.0 | 0.2 | GO:0010701 | positive regulation of norepinephrine secretion(GO:0010701) |
| 0.0 | 0.0 | GO:0003162 | atrioventricular node development(GO:0003162) |
| 0.0 | 0.7 | GO:0008088 | axo-dendritic transport(GO:0008088) |
| 0.0 | 0.1 | GO:0031284 | positive regulation of guanylate cyclase activity(GO:0031284) |
| 0.0 | 0.0 | GO:0086017 | Purkinje myocyte action potential(GO:0086017) |
| 0.0 | 0.1 | GO:0045724 | positive regulation of cilium assembly(GO:0045724) |
| 0.0 | 0.3 | GO:0031103 | axon regeneration(GO:0031103) |
| 0.0 | 0.2 | GO:0010528 | regulation of transposition(GO:0010528) negative regulation of transposition(GO:0010529) |
| 0.0 | 0.1 | GO:0009436 | glyoxylate catabolic process(GO:0009436) |
| 0.0 | 0.1 | GO:0002034 | regulation of blood vessel size by renin-angiotensin(GO:0002034) renal control of peripheral vascular resistance involved in regulation of systemic arterial blood pressure(GO:0003072) |
| 0.0 | 0.8 | GO:0031146 | SCF-dependent proteasomal ubiquitin-dependent protein catabolic process(GO:0031146) |
| 0.0 | 0.1 | GO:0039536 | negative regulation of RIG-I signaling pathway(GO:0039536) |
| 0.0 | 0.6 | GO:1903146 | regulation of mitophagy(GO:1903146) |
| 0.0 | 0.6 | GO:0070207 | protein homotrimerization(GO:0070207) |
| 0.0 | 0.0 | GO:0042414 | epinephrine metabolic process(GO:0042414) |
| 0.0 | 0.1 | GO:0045079 | negative regulation of chemokine biosynthetic process(GO:0045079) |
| 0.0 | 0.0 | GO:0003241 | growth involved in heart morphogenesis(GO:0003241) |
| 0.0 | 0.1 | GO:0010360 | negative regulation of anion channel activity(GO:0010360) |
| 0.0 | 0.4 | GO:0007210 | serotonin receptor signaling pathway(GO:0007210) |
| 0.0 | 0.0 | GO:0006903 | vesicle targeting(GO:0006903) |
| 0.0 | 0.1 | GO:0071684 | blastocyst hatching(GO:0001835) hatching(GO:0035188) organism emergence from protective structure(GO:0071684) |
| 0.0 | 0.1 | GO:0018199 | peptidyl-glutamine modification(GO:0018199) |
| 0.0 | 0.0 | GO:1903423 | positive regulation of synaptic vesicle recycling(GO:1903423) |
| 0.0 | 0.1 | GO:0033634 | positive regulation of cell-cell adhesion mediated by integrin(GO:0033634) |
| 0.0 | 0.3 | GO:0072501 | cellular phosphate ion homeostasis(GO:0030643) cellular divalent inorganic anion homeostasis(GO:0072501) cellular trivalent inorganic anion homeostasis(GO:0072502) |
| 0.0 | 0.1 | GO:0021902 | commitment of neuronal cell to specific neuron type in forebrain(GO:0021902) |
| 0.0 | 0.5 | GO:0006805 | xenobiotic metabolic process(GO:0006805) |
| 0.0 | 0.0 | GO:2001270 | regulation of cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:2001270) negative regulation of cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:2001271) |
| 0.0 | 0.2 | GO:0035357 | peroxisome proliferator activated receptor signaling pathway(GO:0035357) |
| 0.0 | 0.1 | GO:0021798 | forebrain dorsal/ventral pattern formation(GO:0021798) |
| 0.0 | 0.8 | GO:0033120 | positive regulation of RNA splicing(GO:0033120) |
| 0.0 | 0.1 | GO:2000491 | positive regulation of hepatic stellate cell activation(GO:2000491) |
| 0.0 | 0.0 | GO:0019374 | galactolipid metabolic process(GO:0019374) |
| 0.0 | 0.1 | GO:0045343 | MHC class I biosynthetic process(GO:0045341) regulation of MHC class I biosynthetic process(GO:0045343) positive regulation of MHC class I biosynthetic process(GO:0045345) |
| 0.0 | 0.2 | GO:0046548 | retinal rod cell development(GO:0046548) |
| 0.0 | 0.1 | GO:0038128 | ERBB2 signaling pathway(GO:0038128) |
| 0.0 | 0.1 | GO:0031115 | negative regulation of microtubule polymerization(GO:0031115) |
| 0.0 | 0.4 | GO:0001967 | suckling behavior(GO:0001967) |
| 0.0 | 0.2 | GO:0070189 | kynurenine metabolic process(GO:0070189) |
| 0.0 | 0.2 | GO:0042761 | very long-chain fatty acid biosynthetic process(GO:0042761) |
| 0.0 | 0.1 | GO:0007290 | spermatid nucleus elongation(GO:0007290) |
| 0.0 | 0.1 | GO:0060406 | positive regulation of penile erection(GO:0060406) |
| 0.0 | 0.1 | GO:0002645 | positive regulation of tolerance induction(GO:0002645) |
| 0.0 | 0.1 | GO:0061370 | testosterone biosynthetic process(GO:0061370) |
| 0.0 | 0.0 | GO:1904429 | regulation of t-circle formation(GO:1904429) positive regulation of t-circle formation(GO:1904431) |
| 0.0 | 0.2 | GO:1900273 | positive regulation of long-term synaptic potentiation(GO:1900273) |
| 0.0 | 0.1 | GO:2000504 | positive regulation of blood vessel remodeling(GO:2000504) |
| 0.0 | 0.1 | GO:0071677 | positive regulation of mononuclear cell migration(GO:0071677) |
| 0.0 | 0.1 | GO:1903275 | positive regulation of sodium ion export(GO:1903275) positive regulation of sodium ion export from cell(GO:1903278) |
| 0.0 | 0.2 | GO:0006384 | transcription initiation from RNA polymerase III promoter(GO:0006384) |
| 0.0 | 0.1 | GO:0048478 | replication fork protection(GO:0048478) |
| 0.0 | 0.2 | GO:0071108 | protein K48-linked deubiquitination(GO:0071108) |
| 0.0 | 0.8 | GO:0070979 | protein K11-linked ubiquitination(GO:0070979) |
| 0.0 | 0.3 | GO:0006607 | NLS-bearing protein import into nucleus(GO:0006607) |
| 0.0 | 0.3 | GO:0000059 | protein import into nucleus, docking(GO:0000059) |
| 0.0 | 0.1 | GO:0070268 | cornification(GO:0070268) |
| 0.0 | 0.2 | GO:1903546 | protein localization to photoreceptor outer segment(GO:1903546) |
| 0.0 | 0.5 | GO:0045747 | positive regulation of Notch signaling pathway(GO:0045747) |
| 0.0 | 0.1 | GO:0015677 | copper ion import(GO:0015677) |
| 0.0 | 0.0 | GO:0071888 | macrophage apoptotic process(GO:0071888) regulation of macrophage apoptotic process(GO:2000109) |
| 0.0 | 0.0 | GO:0032075 | positive regulation of nuclease activity(GO:0032075) |
| 0.0 | 0.0 | GO:0060019 | radial glial cell differentiation(GO:0060019) |
| 0.0 | 0.0 | GO:0032687 | negative regulation of interferon-alpha production(GO:0032687) |
| 0.0 | 0.1 | GO:0031547 | brain-derived neurotrophic factor receptor signaling pathway(GO:0031547) |
| 0.0 | 0.1 | GO:0006561 | proline biosynthetic process(GO:0006561) |
| 0.0 | 0.1 | GO:0001560 | regulation of cell growth by extracellular stimulus(GO:0001560) |
| 0.0 | 0.2 | GO:0003148 | outflow tract septum morphogenesis(GO:0003148) |
| 0.0 | 0.2 | GO:0006398 | mRNA 3'-end processing by stem-loop binding and cleavage(GO:0006398) |
| 0.0 | 0.0 | GO:0010992 | ubiquitin homeostasis(GO:0010992) |
| 0.0 | 0.1 | GO:0015889 | cobalamin transport(GO:0015889) |
| 0.0 | 0.2 | GO:0070206 | protein trimerization(GO:0070206) |
| 0.0 | 0.1 | GO:0030174 | regulation of DNA-dependent DNA replication initiation(GO:0030174) |
| 0.0 | 0.1 | GO:0045019 | negative regulation of nitric oxide biosynthetic process(GO:0045019) negative regulation of nitric oxide metabolic process(GO:1904406) |
| 0.0 | 0.0 | GO:0003406 | retinal pigment epithelium development(GO:0003406) |
| 0.0 | 0.1 | GO:0015886 | heme transport(GO:0015886) |
| 0.0 | 0.5 | GO:0015693 | magnesium ion transport(GO:0015693) |
| 0.0 | 0.1 | GO:0000715 | nucleotide-excision repair, DNA damage recognition(GO:0000715) |
| 0.0 | 0.1 | GO:0051596 | methylglyoxal catabolic process to D-lactate via S-lactoyl-glutathione(GO:0019243) methylglyoxal catabolic process(GO:0051596) methylglyoxal catabolic process to lactate(GO:0061727) |
| 0.0 | 0.0 | GO:0060347 | heart trabecula formation(GO:0060347) |
| 0.0 | 0.9 | GO:0032784 | regulation of DNA-templated transcription, elongation(GO:0032784) |
| 0.0 | 0.2 | GO:0043569 | negative regulation of insulin-like growth factor receptor signaling pathway(GO:0043569) |
| 0.0 | 0.1 | GO:0098535 | de novo centriole assembly(GO:0098535) |
| 0.0 | 0.1 | GO:2001137 | positive regulation of endocytic recycling(GO:2001137) |
| 0.0 | 0.0 | GO:0014016 | neuroblast differentiation(GO:0014016) |
| 0.0 | 0.4 | GO:0043552 | positive regulation of phosphatidylinositol 3-kinase activity(GO:0043552) |
| 0.0 | 0.1 | GO:0070127 | tRNA aminoacylation for mitochondrial protein translation(GO:0070127) |
| 0.0 | 0.0 | GO:0061101 | neuroendocrine cell differentiation(GO:0061101) |
| 0.0 | 0.7 | GO:0010633 | negative regulation of epithelial cell migration(GO:0010633) |
| 0.0 | 0.1 | GO:0002553 | histamine production involved in inflammatory response(GO:0002349) histamine secretion involved in inflammatory response(GO:0002441) histamine secretion by mast cell(GO:0002553) |
| 0.0 | 0.0 | GO:0002447 | eosinophil activation involved in immune response(GO:0002278) eosinophil mediated immunity(GO:0002447) eosinophil degranulation(GO:0043308) |
| 0.0 | 0.3 | GO:0046184 | aldehyde biosynthetic process(GO:0046184) |
| 0.0 | 1.0 | GO:0070936 | protein K48-linked ubiquitination(GO:0070936) |
| 0.0 | 0.0 | GO:1990705 | cholangiocyte proliferation(GO:1990705) |
| 0.0 | 0.0 | GO:0046477 | glycosylceramide catabolic process(GO:0046477) |
| 0.0 | 0.1 | GO:0000491 | small nucleolar ribonucleoprotein complex assembly(GO:0000491) box C/D snoRNP assembly(GO:0000492) |
| 0.0 | 0.0 | GO:0021943 | formation of radial glial scaffolds(GO:0021943) |
| 0.0 | 0.0 | GO:0010159 | specification of organ position(GO:0010159) |
| 0.0 | 0.2 | GO:2000778 | positive regulation of interleukin-6 secretion(GO:2000778) |
| 0.0 | 0.0 | GO:0070949 | regulation of neutrophil mediated cytotoxicity(GO:0070948) regulation of neutrophil mediated killing of symbiont cell(GO:0070949) |
| 0.0 | 0.1 | GO:1902857 | positive regulation of nonmotile primary cilium assembly(GO:1902857) |
| 0.0 | 0.1 | GO:0034380 | high-density lipoprotein particle assembly(GO:0034380) |
| 0.0 | 0.1 | GO:0030240 | skeletal muscle thin filament assembly(GO:0030240) |
| 0.0 | 0.1 | GO:1902969 | mitotic DNA replication(GO:1902969) |
| 0.0 | 0.1 | GO:2000255 | negative regulation of male germ cell proliferation(GO:2000255) |
| 0.0 | 0.5 | GO:0034394 | protein localization to cell surface(GO:0034394) |
| 0.0 | 0.3 | GO:0006013 | mannose metabolic process(GO:0006013) |
| 0.0 | 0.1 | GO:0072695 | negative regulation of DNA recombination at telomere(GO:0048239) regulation of DNA recombination at telomere(GO:0072695) |
| 0.0 | 0.2 | GO:0014072 | response to isoquinoline alkaloid(GO:0014072) response to morphine(GO:0043278) |
| 0.0 | 0.4 | GO:0016180 | snRNA processing(GO:0016180) |
| 0.0 | 0.2 | GO:0046337 | phosphatidylethanolamine metabolic process(GO:0046337) |
| 0.0 | 0.0 | GO:0061365 | positive regulation of triglyceride lipase activity(GO:0061365) |
| 0.0 | 0.1 | GO:0002069 | columnar/cuboidal epithelial cell maturation(GO:0002069) glandular epithelial cell maturation(GO:0002071) |
| 0.0 | 0.2 | GO:0032460 | negative regulation of protein oligomerization(GO:0032460) |
| 0.0 | 0.4 | GO:0042775 | mitochondrial ATP synthesis coupled electron transport(GO:0042775) |
| 0.0 | 0.1 | GO:0014719 | skeletal muscle satellite cell activation(GO:0014719) |
| 0.0 | 0.1 | GO:0019240 | citrulline biosynthetic process(GO:0019240) |
| 0.0 | 0.3 | GO:0048268 | clathrin coat assembly(GO:0048268) |
| 0.0 | 0.2 | GO:0032703 | negative regulation of interleukin-2 production(GO:0032703) |
| 0.0 | 0.2 | GO:0043586 | tongue development(GO:0043586) |
| 0.0 | 0.1 | GO:0044794 | positive regulation by host of viral process(GO:0044794) |
| 0.0 | 0.5 | GO:0006730 | one-carbon metabolic process(GO:0006730) |
| 0.0 | 0.1 | GO:0051890 | regulation of cardioblast differentiation(GO:0051890) |
| 0.0 | 0.2 | GO:1990845 | diet induced thermogenesis(GO:0002024) adaptive thermogenesis(GO:1990845) |
| 0.0 | 0.1 | GO:0042091 | interleukin-10 biosynthetic process(GO:0042091) regulation of interleukin-10 biosynthetic process(GO:0045074) |
| 0.0 | 0.8 | GO:0055072 | iron ion homeostasis(GO:0055072) |
| 0.0 | 1.1 | GO:0014066 | regulation of phosphatidylinositol 3-kinase signaling(GO:0014066) |
| 0.0 | 0.1 | GO:0090399 | replicative senescence(GO:0090399) |
| 0.0 | 3.7 | GO:0048193 | Golgi vesicle transport(GO:0048193) |
| 0.0 | 0.1 | GO:0097211 | response to gonadotropin-releasing hormone(GO:0097210) cellular response to gonadotropin-releasing hormone(GO:0097211) |
| 0.0 | 0.2 | GO:0042168 | heme metabolic process(GO:0042168) |
| 0.0 | 0.1 | GO:0033313 | meiotic cell cycle checkpoint(GO:0033313) |
| 0.0 | 0.3 | GO:0007099 | centriole replication(GO:0007099) |
| 0.0 | 0.5 | GO:0035058 | nonmotile primary cilium assembly(GO:0035058) |
| 0.0 | 0.0 | GO:0048807 | female genitalia morphogenesis(GO:0048807) |
| 0.0 | 0.1 | GO:0021913 | regulation of transcription from RNA polymerase II promoter involved in ventral spinal cord interneuron specification(GO:0021913) |
| 0.0 | 0.1 | GO:0016322 | neuron remodeling(GO:0016322) |
| 0.0 | 0.0 | GO:0043084 | penile erection(GO:0043084) |
| 0.0 | 0.1 | GO:0060561 | apoptotic process involved in morphogenesis(GO:0060561) |
| 0.0 | 0.9 | GO:0032543 | mitochondrial translation(GO:0032543) |
| 0.0 | 0.1 | GO:0002911 | lymphocyte anergy(GO:0002249) regulation of T cell anergy(GO:0002667) T cell anergy(GO:0002870) regulation of lymphocyte anergy(GO:0002911) |
| 0.0 | 0.0 | GO:0003223 | ventricular compact myocardium morphogenesis(GO:0003223) |
| 0.0 | 0.0 | GO:2000301 | negative regulation of synaptic vesicle exocytosis(GO:2000301) |
| 0.0 | 0.3 | GO:0031163 | iron-sulfur cluster assembly(GO:0016226) metallo-sulfur cluster assembly(GO:0031163) |
| 0.0 | 0.1 | GO:0051025 | negative regulation of immunoglobulin secretion(GO:0051025) |
| 0.0 | 0.5 | GO:0034340 | response to type I interferon(GO:0034340) |
| 0.0 | 0.0 | GO:0098597 | observational learning(GO:0098597) |
| 0.0 | 0.1 | GO:0019276 | UDP-N-acetylgalactosamine metabolic process(GO:0019276) |
| 0.0 | 0.1 | GO:0033262 | regulation of nuclear cell cycle DNA replication(GO:0033262) |
| 0.0 | 0.8 | GO:0030512 | negative regulation of transforming growth factor beta receptor signaling pathway(GO:0030512) negative regulation of cellular response to transforming growth factor beta stimulus(GO:1903845) |
| 0.0 | 0.1 | GO:0043306 | positive regulation of mast cell activation involved in immune response(GO:0033008) positive regulation of mast cell degranulation(GO:0043306) |
| 0.0 | 0.1 | GO:0001757 | somite specification(GO:0001757) |
| 0.0 | 0.3 | GO:0016082 | synaptic vesicle priming(GO:0016082) |
| 0.0 | 0.1 | GO:0007406 | negative regulation of neuroblast proliferation(GO:0007406) |
| 0.0 | 0.1 | GO:0007183 | SMAD protein complex assembly(GO:0007183) |
| 0.0 | 0.0 | GO:0090206 | negative regulation of cholesterol biosynthetic process(GO:0045541) negative regulation of cholesterol metabolic process(GO:0090206) |
| 0.0 | 0.1 | GO:0061462 | protein localization to lysosome(GO:0061462) |
| 0.0 | 0.3 | GO:0010842 | retina layer formation(GO:0010842) |
| 0.0 | 0.0 | GO:0050923 | regulation of negative chemotaxis(GO:0050923) |
| 0.0 | 0.2 | GO:0030432 | peristalsis(GO:0030432) |
| 0.0 | 0.3 | GO:0006119 | oxidative phosphorylation(GO:0006119) |
| 0.0 | 0.0 | GO:0060921 | sinoatrial node cell differentiation(GO:0060921) cardiac pacemaker cell development(GO:0060926) sinoatrial node cell development(GO:0060931) |
| 0.0 | 0.1 | GO:0031915 | positive regulation of synaptic plasticity(GO:0031915) |
| 0.0 | 0.4 | GO:0048642 | negative regulation of skeletal muscle tissue development(GO:0048642) |
| 0.0 | 0.1 | GO:0051988 | regulation of attachment of spindle microtubules to kinetochore(GO:0051988) |
| 0.0 | 0.1 | GO:0014010 | Schwann cell proliferation(GO:0014010) |
| 0.0 | 0.1 | GO:0010838 | positive regulation of keratinocyte proliferation(GO:0010838) |
| 0.0 | 0.1 | GO:0031167 | rRNA methylation(GO:0031167) |
| 0.0 | 0.1 | GO:0019934 | cGMP-mediated signaling(GO:0019934) |
| 0.0 | 0.1 | GO:0045586 | regulation of gamma-delta T cell differentiation(GO:0045586) regulation of gamma-delta T cell activation(GO:0046643) |
| 0.0 | 0.0 | GO:0032056 | positive regulation of translation in response to stress(GO:0032056) positive regulation of translational initiation in response to stress(GO:0032058) |
| 0.0 | 0.1 | GO:0003105 | negative regulation of glomerular filtration(GO:0003105) |
| 0.0 | 0.1 | GO:0015884 | folic acid transport(GO:0015884) |
| 0.0 | 0.1 | GO:0070525 | tRNA threonylcarbamoyladenosine metabolic process(GO:0070525) |
| 0.0 | 0.3 | GO:1901099 | negative regulation of signal transduction in absence of ligand(GO:1901099) negative regulation of extrinsic apoptotic signaling pathway in absence of ligand(GO:2001240) |
| 0.0 | 0.1 | GO:0002467 | germinal center formation(GO:0002467) |
| 0.0 | 0.0 | GO:0021562 | vestibulocochlear nerve development(GO:0021562) |
| 0.0 | 0.1 | GO:2000353 | positive regulation of endothelial cell apoptotic process(GO:2000353) |
| 0.0 | 0.0 | GO:0019371 | cyclooxygenase pathway(GO:0019371) |
| 0.0 | 0.2 | GO:0060742 | epithelial cell differentiation involved in prostate gland development(GO:0060742) |
| 0.0 | 0.0 | GO:1901626 | regulation of postsynaptic membrane organization(GO:1901626) |
| 0.0 | 0.1 | GO:2000050 | regulation of non-canonical Wnt signaling pathway(GO:2000050) |
| 0.0 | 0.1 | GO:0060017 | parathyroid gland development(GO:0060017) |
| 0.0 | 0.1 | GO:0010935 | regulation of macrophage cytokine production(GO:0010935) |
| 0.0 | 0.2 | GO:0098734 | protein depalmitoylation(GO:0002084) macromolecule depalmitoylation(GO:0098734) |
| 0.0 | 0.0 | GO:0002017 | regulation of blood volume by renal aldosterone(GO:0002017) |
| 0.0 | 0.2 | GO:0060445 | branching involved in salivary gland morphogenesis(GO:0060445) |
| 0.0 | 0.2 | GO:0071625 | vocalization behavior(GO:0071625) |
| 0.0 | 0.0 | GO:0048793 | pronephros development(GO:0048793) |
| 0.0 | 0.1 | GO:0015074 | DNA integration(GO:0015074) |
| 0.0 | 1.2 | GO:0051965 | positive regulation of synapse assembly(GO:0051965) |
| 0.0 | 0.1 | GO:0051970 | negative regulation of transmission of nerve impulse(GO:0051970) |
| 0.0 | 0.1 | GO:0048333 | mesodermal cell differentiation(GO:0048333) |
| 0.0 | 0.1 | GO:0030223 | neutrophil differentiation(GO:0030223) |
| 0.0 | 0.0 | GO:0019364 | pyridine nucleotide catabolic process(GO:0019364) |
| 0.0 | 0.1 | GO:0015879 | carnitine transport(GO:0015879) |
| 0.0 | 0.2 | GO:0030011 | maintenance of cell polarity(GO:0030011) |
| 0.0 | 0.1 | GO:0051561 | positive regulation of mitochondrial calcium ion concentration(GO:0051561) |
| 0.0 | 0.0 | GO:0035093 | spermatogenesis, exchange of chromosomal proteins(GO:0035093) |
| 0.0 | 0.1 | GO:0000972 | transcription-dependent tethering of RNA polymerase II gene DNA at nuclear periphery(GO:0000972) |
| 0.0 | 0.3 | GO:0060219 | camera-type eye photoreceptor cell differentiation(GO:0060219) |
| 0.0 | 0.1 | GO:1990034 | calcium ion export from cell(GO:1990034) |
| 0.0 | 0.1 | GO:1902035 | positive regulation of hematopoietic stem cell proliferation(GO:1902035) |
| 0.0 | 0.0 | GO:0002664 | regulation of T cell tolerance induction(GO:0002664) |
| 0.0 | 0.0 | GO:0072051 | juxtaglomerular apparatus development(GO:0072051) |
| 0.0 | 0.1 | GO:0045217 | cell-cell junction maintenance(GO:0045217) |
| 0.0 | 0.2 | GO:0051654 | establishment of mitochondrion localization(GO:0051654) |
| 0.0 | 0.2 | GO:0048305 | immunoglobulin secretion(GO:0048305) |
| 0.0 | 0.0 | GO:0003219 | cardiac right ventricle formation(GO:0003219) |
| 0.0 | 0.3 | GO:0032456 | endocytic recycling(GO:0032456) |
| 0.0 | 0.0 | GO:0006700 | C21-steroid hormone biosynthetic process(GO:0006700) |
| 0.0 | 0.0 | GO:0009786 | regulation of asymmetric cell division(GO:0009786) |
| 0.0 | 0.1 | GO:0071435 | potassium ion export(GO:0071435) |
| 0.0 | 0.1 | GO:0070932 | histone H3 deacetylation(GO:0070932) |
| 0.0 | 0.3 | GO:0016339 | calcium-dependent cell-cell adhesion via plasma membrane cell adhesion molecules(GO:0016339) |
| 0.0 | 0.1 | GO:0007000 | nucleolus organization(GO:0007000) |
| 0.0 | 0.1 | GO:0061085 | regulation of histone H3-K27 methylation(GO:0061085) |
| 0.0 | 0.1 | GO:0061622 | glycolytic process through glucose-1-phosphate(GO:0061622) |
| 0.0 | 0.0 | GO:0035880 | embryonic nail plate morphogenesis(GO:0035880) |
| 0.0 | 0.0 | GO:0061635 | regulation of protein complex stability(GO:0061635) |
| 0.0 | 0.1 | GO:0006598 | polyamine catabolic process(GO:0006598) |
| 0.0 | 0.4 | GO:0010862 | positive regulation of pathway-restricted SMAD protein phosphorylation(GO:0010862) |
| 0.0 | 0.1 | GO:0055059 | asymmetric neuroblast division(GO:0055059) |
| 0.0 | 0.0 | GO:0061589 | calcium activated phosphatidylserine scrambling(GO:0061589) |
| 0.0 | 0.1 | GO:0033314 | mitotic DNA replication checkpoint(GO:0033314) |
| 0.0 | 0.0 | GO:0022028 | tangential migration from the subventricular zone to the olfactory bulb(GO:0022028) |
| 0.0 | 0.0 | GO:0038092 | nodal signaling pathway(GO:0038092) |
| 0.0 | 0.4 | GO:0007130 | synaptonemal complex assembly(GO:0007130) |
| 0.0 | 0.1 | GO:0006862 | nucleotide transport(GO:0006862) |
| 0.0 | 0.0 | GO:1901491 | negative regulation of lymphangiogenesis(GO:1901491) |
| 0.0 | 0.1 | GO:2000348 | regulation of CD40 signaling pathway(GO:2000348) |
| 0.0 | 0.1 | GO:0001833 | inner cell mass cell proliferation(GO:0001833) |
| 0.0 | 0.1 | GO:0042723 | thiamine metabolic process(GO:0006772) thiamine-containing compound metabolic process(GO:0042723) |
| 0.0 | 0.3 | GO:0010569 | regulation of double-strand break repair via homologous recombination(GO:0010569) |
| 0.0 | 0.1 | GO:2000209 | regulation of anoikis(GO:2000209) |
| 0.0 | 0.0 | GO:0061055 | myotome development(GO:0061055) |
| 0.0 | 0.1 | GO:1990564 | protein polyufmylation(GO:1990564) protein K69-linked ufmylation(GO:1990592) |
| 0.0 | 0.0 | GO:0071447 | cellular response to hydroperoxide(GO:0071447) |
| 0.0 | 0.1 | GO:0008063 | Toll signaling pathway(GO:0008063) |
| 0.0 | 0.1 | GO:0071480 | cellular response to gamma radiation(GO:0071480) |
| 0.0 | 0.1 | GO:0007194 | negative regulation of adenylate cyclase activity(GO:0007194) |
| 0.0 | 0.3 | GO:0015985 | energy coupled proton transport, down electrochemical gradient(GO:0015985) ATP synthesis coupled proton transport(GO:0015986) |
| 0.0 | 0.0 | GO:0021869 | forebrain ventricular zone progenitor cell division(GO:0021869) |
| 0.0 | 0.1 | GO:0042276 | error-prone translesion synthesis(GO:0042276) |
| 0.0 | 0.1 | GO:0042760 | very long-chain fatty acid catabolic process(GO:0042760) |
| 0.0 | 0.0 | GO:0051835 | positive regulation of synapse structural plasticity(GO:0051835) |
| 0.0 | 0.3 | GO:0006376 | mRNA splice site selection(GO:0006376) |
| 0.0 | 0.0 | GO:0051156 | glucose 6-phosphate metabolic process(GO:0051156) |
| 0.0 | 0.0 | GO:0072531 | pyrimidine-containing compound transmembrane transport(GO:0072531) nucleotide transmembrane transport(GO:1901679) |
| 0.0 | 0.0 | GO:0061051 | positive regulation of cell growth involved in cardiac muscle cell development(GO:0061051) |
| 0.0 | 0.0 | GO:0042939 | glutathione transport(GO:0034635) tripeptide transport(GO:0042939) |
| 0.0 | 0.0 | GO:0046098 | guanine metabolic process(GO:0046098) |
| 0.0 | 0.0 | GO:0006651 | diacylglycerol biosynthetic process(GO:0006651) |
| 0.0 | 0.1 | GO:0045003 | DNA recombinase assembly(GO:0000730) double-strand break repair via synthesis-dependent strand annealing(GO:0045003) |
| 0.0 | 0.3 | GO:0009954 | proximal/distal pattern formation(GO:0009954) |
| 0.0 | 0.1 | GO:0019478 | D-amino acid catabolic process(GO:0019478) |
| 0.0 | 0.1 | GO:2000001 | regulation of DNA damage checkpoint(GO:2000001) |
| 0.0 | 0.2 | GO:0006388 | RNA splicing, via endonucleolytic cleavage and ligation(GO:0000394) tRNA splicing, via endonucleolytic cleavage and ligation(GO:0006388) |
| 0.0 | 0.1 | GO:0000185 | activation of MAPKKK activity(GO:0000185) |
| 0.0 | 0.0 | GO:2000327 | regulation of ligand-dependent nuclear receptor transcription coactivator activity(GO:2000325) positive regulation of ligand-dependent nuclear receptor transcription coactivator activity(GO:2000327) |
| 0.0 | 0.1 | GO:2000483 | negative regulation of interleukin-8 secretion(GO:2000483) |
| 0.0 | 0.0 | GO:0030656 | regulation of vitamin metabolic process(GO:0030656) |
| 0.0 | 0.0 | GO:0007494 | midgut development(GO:0007494) lateral mesoderm morphogenesis(GO:0048369) lateral mesoderm formation(GO:0048370) lateral mesodermal cell differentiation(GO:0048371) |
| 0.0 | 0.0 | GO:0032196 | transposition(GO:0032196) |
| 0.0 | 0.0 | GO:0006368 | transcription elongation from RNA polymerase II promoter(GO:0006368) |
| 0.0 | 0.4 | GO:0001574 | ganglioside biosynthetic process(GO:0001574) |
| 0.0 | 0.4 | GO:0006506 | GPI anchor biosynthetic process(GO:0006506) |
| 0.0 | 0.1 | GO:0035493 | SNARE complex assembly(GO:0035493) |
| 0.0 | 0.0 | GO:0036515 | serotonergic neuron axon guidance(GO:0036515) |
| 0.0 | 0.1 | GO:2000696 | regulation of epithelial cell differentiation involved in kidney development(GO:2000696) |
| 0.0 | 0.4 | GO:0000387 | spliceosomal snRNP assembly(GO:0000387) |
| 0.0 | 0.1 | GO:0042659 | regulation of cell fate specification(GO:0042659) |
| 0.0 | 0.1 | GO:0032264 | IMP salvage(GO:0032264) |
| 0.0 | 0.1 | GO:1902626 | assembly of large subunit precursor of preribosome(GO:1902626) |
| 0.0 | 0.0 | GO:0060800 | regulation of cell differentiation involved in embryonic placenta development(GO:0060800) |
| 0.0 | 0.1 | GO:0042987 | amyloid precursor protein catabolic process(GO:0042987) |
| 0.0 | 0.2 | GO:0060441 | epithelial tube branching involved in lung morphogenesis(GO:0060441) |
| 0.0 | 0.0 | GO:1903261 | regulation of serine phosphorylation of STAT3 protein(GO:1903261) |
| 0.0 | 0.1 | GO:0009650 | UV protection(GO:0009650) |
| 0.0 | 0.7 | GO:0008033 | tRNA processing(GO:0008033) |
| 0.0 | 0.2 | GO:0072583 | clathrin-mediated endocytosis(GO:0072583) |
| 0.0 | 0.1 | GO:0006348 | chromatin silencing at telomere(GO:0006348) |
| 0.0 | 0.0 | GO:0097033 | respiratory chain complex III assembly(GO:0017062) mitochondrial respiratory chain complex III assembly(GO:0034551) mitochondrial respiratory chain complex III biogenesis(GO:0097033) |
| 0.0 | 0.1 | GO:0061339 | establishment of monopolar cell polarity(GO:0061162) establishment or maintenance of monopolar cell polarity(GO:0061339) |
| 0.0 | 0.2 | GO:0007216 | G-protein coupled glutamate receptor signaling pathway(GO:0007216) |
| 0.0 | 0.1 | GO:0021794 | thalamus development(GO:0021794) |
| 0.0 | 0.0 | GO:0051315 | attachment of mitotic spindle microtubules to kinetochore(GO:0051315) |
| 0.0 | 0.0 | GO:0042415 | norepinephrine metabolic process(GO:0042415) |
| 0.0 | 0.1 | GO:0090666 | scaRNA localization to Cajal body(GO:0090666) |
| 0.0 | 0.0 | GO:0042428 | serotonin metabolic process(GO:0042428) |
| 0.0 | 0.0 | GO:0006543 | glutamine catabolic process(GO:0006543) |
| 0.0 | 0.1 | GO:0046116 | queuosine biosynthetic process(GO:0008616) queuosine metabolic process(GO:0046116) |
| 0.0 | 0.1 | GO:1903071 | positive regulation of ER-associated ubiquitin-dependent protein catabolic process(GO:1903071) |
| 0.0 | 0.0 | GO:0007262 | STAT protein import into nucleus(GO:0007262) |
| 0.0 | 0.1 | GO:0070837 | dehydroascorbic acid transport(GO:0070837) |
| 0.0 | 0.1 | GO:0051725 | protein de-ADP-ribosylation(GO:0051725) |
| 0.0 | 0.1 | GO:0061037 | negative regulation of cartilage development(GO:0061037) |
| 0.0 | 0.1 | GO:0051013 | microtubule severing(GO:0051013) |
| 0.0 | 0.1 | GO:0031053 | primary miRNA processing(GO:0031053) |
| 0.0 | 0.0 | GO:0034436 | glycoprotein transport(GO:0034436) |
| 0.0 | 0.0 | GO:0008355 | olfactory learning(GO:0008355) |
| 0.0 | 0.0 | GO:0060279 | positive regulation of ovulation(GO:0060279) |
| 0.0 | 0.2 | GO:0008156 | negative regulation of DNA replication(GO:0008156) |
| 0.0 | 0.3 | GO:0043171 | peptide catabolic process(GO:0043171) |
| 0.0 | 0.0 | GO:0002215 | defense response to nematode(GO:0002215) |
| 0.0 | 0.0 | GO:0070358 | actin polymerization-dependent cell motility(GO:0070358) |
| 0.0 | 0.0 | GO:0006391 | transcription initiation from mitochondrial promoter(GO:0006391) |
| 0.0 | 0.1 | GO:0032926 | negative regulation of activin receptor signaling pathway(GO:0032926) |
| 0.0 | 0.2 | GO:0071300 | cellular response to retinoic acid(GO:0071300) |
| 0.0 | 0.3 | GO:0043252 | sodium-independent organic anion transport(GO:0043252) |
| 0.0 | 0.1 | GO:0006182 | cGMP biosynthetic process(GO:0006182) |
| 0.0 | 0.5 | GO:1902476 | chloride transmembrane transport(GO:1902476) |
| 0.0 | 0.0 | GO:0035584 | calcium-mediated signaling using intracellular calcium source(GO:0035584) |
| 0.0 | 0.0 | GO:0010536 | positive regulation of activation of Janus kinase activity(GO:0010536) |
| 0.0 | 0.0 | GO:0006659 | phosphatidylserine biosynthetic process(GO:0006659) |
| 0.0 | 0.3 | GO:0034605 | cellular response to heat(GO:0034605) |
| 0.0 | 0.1 | GO:0017196 | N-terminal peptidyl-methionine acetylation(GO:0017196) |
| 0.0 | 0.1 | GO:0007007 | inner mitochondrial membrane organization(GO:0007007) |
| 0.0 | 0.0 | GO:0090343 | positive regulation of cell aging(GO:0090343) |
| 0.0 | 0.1 | GO:0009072 | aromatic amino acid family metabolic process(GO:0009072) |
| 0.0 | 0.0 | GO:0002361 | CD4-positive, CD25-positive, alpha-beta regulatory T cell differentiation(GO:0002361) |
| 0.0 | 0.1 | GO:0070173 | regulation of enamel mineralization(GO:0070173) |
| 0.0 | 0.0 | GO:0048733 | sebaceous gland development(GO:0048733) |
| 0.0 | 0.3 | GO:0000027 | ribosomal large subunit assembly(GO:0000027) |
| 0.0 | 0.0 | GO:0036498 | IRE1-mediated unfolded protein response(GO:0036498) regulation of IRE1-mediated unfolded protein response(GO:1903894) |
| 0.0 | 0.1 | GO:1990403 | embryonic brain development(GO:1990403) |
| 0.0 | 0.1 | GO:0043950 | positive regulation of cAMP-mediated signaling(GO:0043950) |
| 0.0 | 0.0 | GO:0090187 | positive regulation of pancreatic juice secretion(GO:0090187) |
| 0.0 | 0.1 | GO:0048852 | diencephalon morphogenesis(GO:0048852) |
| 0.0 | 0.0 | GO:1902570 | protein localization to nucleolus(GO:1902570) |
| 0.0 | 0.3 | GO:0006284 | base-excision repair(GO:0006284) |
| 0.0 | 0.0 | GO:0090148 | membrane fission(GO:0090148) |
| 0.0 | 0.0 | GO:0048769 | sarcomerogenesis(GO:0048769) |
| 0.0 | 0.2 | GO:0043113 | receptor clustering(GO:0043113) |
| 0.0 | 0.0 | GO:0033089 | positive regulation of T cell differentiation in thymus(GO:0033089) positive regulation of thymocyte aggregation(GO:2000400) |
| 0.0 | 0.0 | GO:0042487 | regulation of odontogenesis of dentin-containing tooth(GO:0042487) |
| 0.0 | 0.0 | GO:0051350 | negative regulation of lyase activity(GO:0051350) |
| 0.0 | 0.0 | GO:1903817 | negative regulation of delayed rectifier potassium channel activity(GO:1902260) negative regulation of voltage-gated potassium channel activity(GO:1903817) |
| 0.0 | 0.0 | GO:0098828 | modulation of inhibitory postsynaptic potential(GO:0098828) |
| 0.0 | 0.0 | GO:0018206 | peptidyl-methionine modification(GO:0018206) |
| 0.0 | 0.0 | GO:0032497 | detection of lipopolysaccharide(GO:0032497) |
| 0.0 | 0.0 | GO:0042537 | benzene-containing compound metabolic process(GO:0042537) |
| 0.0 | 0.0 | GO:0097237 | cellular response to toxic substance(GO:0097237) |
| 0.0 | 0.1 | GO:0097369 | sodium ion import(GO:0097369) |
| 0.0 | 0.0 | GO:0050915 | sensory perception of sour taste(GO:0050915) |
| 0.0 | 0.1 | GO:0035116 | embryonic hindlimb morphogenesis(GO:0035116) |
| 0.0 | 0.0 | GO:0000012 | single strand break repair(GO:0000012) |
| 0.0 | 0.1 | GO:2000601 | positive regulation of Arp2/3 complex-mediated actin nucleation(GO:2000601) |
| 0.0 | 0.0 | GO:0016075 | rRNA catabolic process(GO:0016075) |
| 0.0 | 0.1 | GO:0060259 | regulation of feeding behavior(GO:0060259) |
| 0.0 | 0.0 | GO:0002091 | negative regulation of receptor internalization(GO:0002091) |
| 0.0 | 0.1 | GO:0000055 | ribosomal large subunit export from nucleus(GO:0000055) |
| 0.0 | 0.0 | GO:0060620 | regulation of cholesterol import(GO:0060620) regulation of sterol import(GO:2000909) |
| 0.0 | 0.0 | GO:0090069 | regulation of ribosome biogenesis(GO:0090069) |
| 0.0 | 0.0 | GO:0071798 | response to prostaglandin D(GO:0071798) cellular response to prostaglandin D stimulus(GO:0071799) |
| 0.0 | 0.1 | GO:0051446 | positive regulation of meiotic cell cycle(GO:0051446) |
| 0.0 | 0.0 | GO:0071415 | cellular response to caffeine(GO:0071313) cellular response to purine-containing compound(GO:0071415) |
| 0.0 | 0.1 | GO:0042574 | retinal metabolic process(GO:0042574) |
| 0.0 | 0.0 | GO:0060179 | male mating behavior(GO:0060179) |
| 0.0 | 0.0 | GO:0070986 | left/right axis specification(GO:0070986) |
| 0.0 | 0.1 | GO:0007256 | activation of JNKK activity(GO:0007256) |
| 0.0 | 0.0 | GO:0071027 | nuclear RNA surveillance(GO:0071027) nuclear mRNA surveillance(GO:0071028) |
| 0.0 | 0.2 | GO:0007416 | synapse assembly(GO:0007416) |
| 0.0 | 0.1 | GO:0050775 | positive regulation of dendrite morphogenesis(GO:0050775) |
| 0.0 | 0.0 | GO:0071442 | positive regulation of histone H3-K14 acetylation(GO:0071442) |
| 0.0 | 0.1 | GO:0044550 | secondary metabolite biosynthetic process(GO:0044550) |
| 0.0 | 0.0 | GO:0003159 | morphogenesis of an endothelium(GO:0003159) |
| 0.0 | 0.0 | GO:0051790 | short-chain fatty acid biosynthetic process(GO:0051790) |
| 0.0 | 0.0 | GO:0060839 | endothelial cell fate commitment(GO:0060839) |
| 0.0 | 0.1 | GO:0002068 | glandular epithelial cell development(GO:0002068) |
| 0.0 | 0.0 | GO:0019087 | transformation of host cell by virus(GO:0019087) |
| 0.0 | 0.0 | GO:2000773 | negative regulation of cellular senescence(GO:2000773) |
| 0.0 | 0.1 | GO:0050650 | chondroitin sulfate proteoglycan biosynthetic process(GO:0050650) |
| 0.0 | 0.0 | GO:1902268 | negative regulation of polyamine transmembrane transport(GO:1902268) |
| 0.0 | 0.0 | GO:0048368 | lateral mesoderm development(GO:0048368) |
| 0.0 | 0.0 | GO:0080009 | mRNA methylation(GO:0080009) |
| 0.0 | 0.0 | GO:0051934 | dopamine uptake involved in synaptic transmission(GO:0051583) catecholamine uptake involved in synaptic transmission(GO:0051934) |
| 0.0 | 0.2 | GO:0060218 | hematopoietic stem cell differentiation(GO:0060218) |
| 0.0 | 0.1 | GO:0046085 | adenosine metabolic process(GO:0046085) |
| 0.0 | 0.0 | GO:0002727 | natural killer cell cytokine production(GO:0002370) regulation of natural killer cell cytokine production(GO:0002727) |
| 0.0 | 0.0 | GO:0038028 | insulin receptor signaling pathway via phosphatidylinositol 3-kinase(GO:0038028) |
| 0.0 | 0.0 | GO:0019230 | proprioception(GO:0019230) |
| 0.0 | 0.0 | GO:0060084 | synaptic transmission involved in micturition(GO:0060084) |
| 0.0 | 0.0 | GO:0090156 | negative regulation of sphingolipid biosynthetic process(GO:0090155) cellular sphingolipid homeostasis(GO:0090156) |
| 0.0 | 0.0 | GO:0001941 | postsynaptic membrane organization(GO:0001941) |
| 0.0 | 0.1 | GO:0010800 | positive regulation of peptidyl-threonine phosphorylation(GO:0010800) |
| 0.0 | 0.0 | GO:0035283 | central nervous system segmentation(GO:0035283) brain segmentation(GO:0035284) |
| 0.0 | 0.0 | GO:0060018 | astrocyte fate commitment(GO:0060018) |
| 0.0 | 0.0 | GO:0030300 | regulation of intestinal cholesterol absorption(GO:0030300) |
| 0.0 | 0.0 | GO:0021979 | hypothalamus cell differentiation(GO:0021979) |
| 0.0 | 0.3 | GO:0006970 | response to osmotic stress(GO:0006970) |
| 0.0 | 0.0 | GO:0031268 | pseudopodium organization(GO:0031268) |
| 0.0 | 0.2 | GO:0046426 | negative regulation of JAK-STAT cascade(GO:0046426) negative regulation of STAT cascade(GO:1904893) |
| 0.0 | 0.0 | GO:1904467 | regulation of tumor necrosis factor secretion(GO:1904467) tumor necrosis factor secretion(GO:1990774) |
| 0.0 | 0.0 | GO:0045721 | negative regulation of gluconeogenesis(GO:0045721) |
| 0.0 | 0.0 | GO:0018214 | protein carboxylation(GO:0018214) |
| 0.0 | 0.0 | GO:2001268 | negative regulation of cysteine-type endopeptidase activity involved in apoptotic signaling pathway(GO:2001268) |
| 0.0 | 0.0 | GO:0090166 | Golgi disassembly(GO:0090166) |
| 0.0 | 0.0 | GO:0035641 | locomotory exploration behavior(GO:0035641) |
| 0.0 | 0.0 | GO:0006407 | rRNA export from nucleus(GO:0006407) |
| 0.0 | 0.6 | GO:0051028 | mRNA transport(GO:0051028) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.4 | 1.1 | GO:0097454 | Schwann cell microvillus(GO:0097454) |
| 0.3 | 3.7 | GO:0070852 | cell body fiber(GO:0070852) |
| 0.3 | 1.1 | GO:0005610 | laminin-5 complex(GO:0005610) |
| 0.3 | 0.9 | GO:0005785 | signal recognition particle receptor complex(GO:0005785) |
| 0.3 | 1.4 | GO:1990712 | HFE-transferrin receptor complex(GO:1990712) |
| 0.2 | 0.7 | GO:0060053 | neurofilament cytoskeleton(GO:0060053) |
| 0.2 | 1.1 | GO:0005579 | membrane attack complex(GO:0005579) |
| 0.2 | 0.6 | GO:0010009 | cytoplasmic side of endosome membrane(GO:0010009) |
| 0.2 | 0.2 | GO:0034363 | intermediate-density lipoprotein particle(GO:0034363) |
| 0.2 | 0.8 | GO:0000444 | MIS12/MIND type complex(GO:0000444) |
| 0.2 | 0.6 | GO:0070552 | BRISC complex(GO:0070552) |
| 0.2 | 0.8 | GO:0071203 | WASH complex(GO:0071203) |
| 0.2 | 0.6 | GO:0090498 | extrinsic component of Golgi membrane(GO:0090498) |
| 0.2 | 1.2 | GO:0005915 | zonula adherens(GO:0005915) |
| 0.2 | 0.6 | GO:0002193 | MAML1-RBP-Jkappa- ICN1 complex(GO:0002193) |
| 0.2 | 0.2 | GO:0031595 | nuclear proteasome complex(GO:0031595) |
| 0.2 | 0.9 | GO:0033093 | Weibel-Palade body(GO:0033093) |
| 0.2 | 1.1 | GO:0016342 | catenin complex(GO:0016342) |
| 0.1 | 0.4 | GO:1990597 | AIP1-IRE1 complex(GO:1990597) |
| 0.1 | 0.9 | GO:0089717 | spanning component of plasma membrane(GO:0044214) spanning component of membrane(GO:0089717) |
| 0.1 | 0.9 | GO:0001739 | sex chromatin(GO:0001739) |
| 0.1 | 0.7 | GO:0042765 | GPI-anchor transamidase complex(GO:0042765) |
| 0.1 | 1.0 | GO:0090543 | Flemming body(GO:0090543) |
| 0.1 | 0.4 | GO:0044354 | pinosome(GO:0044352) macropinosome(GO:0044354) |
| 0.1 | 0.4 | GO:0032937 | SREBP-SCAP-Insig complex(GO:0032937) |
| 0.1 | 0.3 | GO:0032280 | symmetric synapse(GO:0032280) |
| 0.1 | 0.4 | GO:0031074 | nucleocytoplasmic shuttling complex(GO:0031074) |
| 0.1 | 0.6 | GO:0005964 | phosphorylase kinase complex(GO:0005964) |
| 0.1 | 0.5 | GO:0035867 | alphav-beta3 integrin-IGF-1-IGF1R complex(GO:0035867) |
| 0.1 | 0.4 | GO:0070522 | ERCC4-ERCC1 complex(GO:0070522) |
| 0.1 | 0.5 | GO:0030478 | actin cap(GO:0030478) |
| 0.1 | 1.2 | GO:0046930 | pore complex(GO:0046930) |
| 0.1 | 0.7 | GO:0014731 | spectrin-associated cytoskeleton(GO:0014731) |
| 0.1 | 0.7 | GO:0005796 | Golgi lumen(GO:0005796) |
| 0.1 | 2.0 | GO:0035371 | microtubule plus-end(GO:0035371) |
| 0.1 | 0.3 | GO:0070110 | ciliary neurotrophic factor receptor complex(GO:0070110) |
| 0.1 | 0.3 | GO:0033185 | dolichol-phosphate-mannose synthase complex(GO:0033185) |
| 0.1 | 0.2 | GO:0009331 | glycerol-3-phosphate dehydrogenase complex(GO:0009331) |
| 0.1 | 0.6 | GO:0033503 | HULC complex(GO:0033503) |
| 0.1 | 0.7 | GO:0000347 | THO complex(GO:0000347) THO complex part of transcription export complex(GO:0000445) |
| 0.1 | 0.9 | GO:0042587 | glycogen granule(GO:0042587) |
| 0.1 | 0.5 | GO:0090571 | RNA polymerase II transcription repressor complex(GO:0090571) |
| 0.1 | 2.4 | GO:0034364 | high-density lipoprotein particle(GO:0034364) |
| 0.1 | 0.3 | GO:0043293 | apoptosome(GO:0043293) |
| 0.1 | 0.4 | GO:0000408 | EKC/KEOPS complex(GO:0000408) |
| 0.1 | 0.2 | GO:0044615 | nuclear pore nuclear basket(GO:0044615) |
| 0.1 | 0.9 | GO:0031528 | microvillus membrane(GO:0031528) |
| 0.1 | 1.0 | GO:0035253 | ciliary rootlet(GO:0035253) |
| 0.1 | 0.3 | GO:1990075 | periciliary membrane compartment(GO:1990075) |
| 0.1 | 0.4 | GO:0031313 | extrinsic component of endosome membrane(GO:0031313) |
| 0.1 | 0.5 | GO:0005828 | kinetochore microtubule(GO:0005828) |
| 0.1 | 1.4 | GO:0097038 | perinuclear endoplasmic reticulum(GO:0097038) |
| 0.1 | 5.4 | GO:0005811 | lipid particle(GO:0005811) |
| 0.1 | 0.5 | GO:0042406 | extrinsic component of endoplasmic reticulum membrane(GO:0042406) |
| 0.1 | 0.3 | GO:0030289 | protein phosphatase 4 complex(GO:0030289) |
| 0.1 | 0.6 | GO:0033263 | CORVET complex(GO:0033263) |
| 0.1 | 0.4 | GO:0031315 | extrinsic component of mitochondrial outer membrane(GO:0031315) |
| 0.1 | 0.8 | GO:0005751 | mitochondrial respiratory chain complex IV(GO:0005751) |
| 0.1 | 1.1 | GO:0005583 | fibrillar collagen trimer(GO:0005583) banded collagen fibril(GO:0098643) |
| 0.1 | 0.3 | GO:0044316 | cone cell pedicle(GO:0044316) |
| 0.1 | 1.2 | GO:0000176 | nuclear exosome (RNase complex)(GO:0000176) |
| 0.1 | 0.5 | GO:0001940 | male pronucleus(GO:0001940) |
| 0.1 | 0.5 | GO:0005736 | DNA-directed RNA polymerase I complex(GO:0005736) |
| 0.1 | 1.3 | GO:0000421 | autophagosome membrane(GO:0000421) |
| 0.1 | 0.3 | GO:0000938 | GARP complex(GO:0000938) |
| 0.1 | 0.6 | GO:0005952 | cAMP-dependent protein kinase complex(GO:0005952) |
| 0.1 | 0.6 | GO:0044666 | MLL3/4 complex(GO:0044666) |
| 0.1 | 0.3 | GO:0034098 | VCP-NPL4-UFD1 AAA ATPase complex(GO:0034098) |
| 0.1 | 0.5 | GO:0035032 | phosphatidylinositol 3-kinase complex, class III(GO:0035032) |
| 0.1 | 0.4 | GO:0033063 | Rad51B-Rad51C-Rad51D-XRCC2 complex(GO:0033063) |
| 0.1 | 0.3 | GO:0097422 | tubular endosome(GO:0097422) |
| 0.1 | 0.2 | GO:0044611 | nuclear pore inner ring(GO:0044611) |
| 0.1 | 0.1 | GO:1990696 | USH2 complex(GO:1990696) |
| 0.1 | 0.5 | GO:0071556 | integral component of cytoplasmic side of endoplasmic reticulum membrane(GO:0071458) integral component of lumenal side of endoplasmic reticulum membrane(GO:0071556) lumenal side of endoplasmic reticulum membrane(GO:0098553) lumenal side of membrane(GO:0098576) |
| 0.1 | 0.1 | GO:0034750 | Scrib-APC-beta-catenin complex(GO:0034750) |
| 0.1 | 0.3 | GO:0031502 | dolichyl-phosphate-mannose-protein mannosyltransferase complex(GO:0031502) |
| 0.1 | 0.2 | GO:0005967 | mitochondrial pyruvate dehydrogenase complex(GO:0005967) |
| 0.1 | 0.6 | GO:0000815 | ESCRT III complex(GO:0000815) |
| 0.1 | 0.8 | GO:0065010 | extracellular membrane-bounded organelle(GO:0065010) |
| 0.1 | 0.2 | GO:0071817 | MMXD complex(GO:0071817) |
| 0.1 | 0.2 | GO:0071204 | histone pre-mRNA 3'end processing complex(GO:0071204) |
| 0.1 | 0.5 | GO:0031305 | integral component of mitochondrial inner membrane(GO:0031305) |
| 0.1 | 0.4 | GO:0036057 | filtration diaphragm(GO:0036056) slit diaphragm(GO:0036057) |
| 0.1 | 0.7 | GO:0008278 | cohesin complex(GO:0008278) |
| 0.1 | 0.2 | GO:0071008 | U2-type post-mRNA release spliceosomal complex(GO:0071008) |
| 0.1 | 0.3 | GO:0035749 | myelin sheath adaxonal region(GO:0035749) |
| 0.1 | 0.5 | GO:0072669 | tRNA-splicing ligase complex(GO:0072669) |
| 0.1 | 0.9 | GO:0030904 | retromer complex(GO:0030904) |
| 0.1 | 0.5 | GO:0030008 | TRAPP complex(GO:0030008) |
| 0.1 | 0.2 | GO:0097441 | basilar dendrite(GO:0097441) |
| 0.1 | 0.5 | GO:0016593 | Cdc73/Paf1 complex(GO:0016593) |
| 0.1 | 0.9 | GO:0033391 | chromatoid body(GO:0033391) |
| 0.1 | 0.6 | GO:0032580 | Golgi cisterna membrane(GO:0032580) |
| 0.1 | 0.2 | GO:0031523 | Myb complex(GO:0031523) |
| 0.1 | 1.2 | GO:0005686 | U2 snRNP(GO:0005686) |
| 0.1 | 0.6 | GO:0036128 | CatSper complex(GO:0036128) |
| 0.1 | 0.3 | GO:0000177 | cytoplasmic exosome (RNase complex)(GO:0000177) |
| 0.1 | 0.8 | GO:0043196 | varicosity(GO:0043196) |
| 0.1 | 2.5 | GO:0009295 | nucleoid(GO:0009295) mitochondrial nucleoid(GO:0042645) |
| 0.1 | 0.1 | GO:0031933 | telomeric heterochromatin(GO:0031933) |
| 0.1 | 0.1 | GO:0031088 | platelet dense granule membrane(GO:0031088) |
| 0.1 | 0.2 | GO:0000942 | condensed nuclear chromosome outer kinetochore(GO:0000942) |
| 0.1 | 1.1 | GO:0032588 | trans-Golgi network membrane(GO:0032588) |
| 0.1 | 0.3 | GO:0089701 | U2AF(GO:0089701) |
| 0.1 | 0.3 | GO:0019907 | cyclin-dependent protein kinase activating kinase holoenzyme complex(GO:0019907) |
| 0.1 | 0.3 | GO:0031931 | TORC1 complex(GO:0031931) |
| 0.1 | 0.4 | GO:0030128 | clathrin coat of endocytic vesicle(GO:0030128) |
| 0.1 | 0.8 | GO:0097440 | apical dendrite(GO:0097440) |
| 0.1 | 0.3 | GO:0097197 | tetraspanin-enriched microdomain(GO:0097197) |
| 0.1 | 0.2 | GO:0051286 | cell tip(GO:0051286) |
| 0.1 | 0.2 | GO:0002189 | ribose phosphate diphosphokinase complex(GO:0002189) |
| 0.1 | 0.2 | GO:0046691 | intracellular canaliculus(GO:0046691) |
| 0.1 | 0.3 | GO:0043202 | lysosomal lumen(GO:0043202) |
| 0.1 | 2.3 | GO:0045171 | intercellular bridge(GO:0045171) |
| 0.1 | 0.1 | GO:0071942 | XPC complex(GO:0071942) |
| 0.1 | 0.3 | GO:0070847 | core mediator complex(GO:0070847) |
| 0.1 | 0.2 | GO:0061689 | tricellular tight junction(GO:0061689) |
| 0.1 | 0.1 | GO:1902554 | serine/threonine protein kinase complex(GO:1902554) |
| 0.1 | 0.3 | GO:0070820 | tertiary granule(GO:0070820) |
| 0.1 | 0.3 | GO:0046696 | lipopolysaccharide receptor complex(GO:0046696) |
| 0.1 | 0.3 | GO:0071986 | Ragulator complex(GO:0071986) |
| 0.1 | 0.7 | GO:0002199 | zona pellucida receptor complex(GO:0002199) |
| 0.1 | 1.8 | GO:0060170 | ciliary membrane(GO:0060170) |
| 0.1 | 0.3 | GO:0034709 | methylosome(GO:0034709) |
| 0.1 | 0.2 | GO:0030956 | glutamyl-tRNA(Gln) amidotransferase complex(GO:0030956) |
| 0.1 | 0.2 | GO:0000235 | astral microtubule(GO:0000235) |
| 0.1 | 0.4 | GO:0005664 | origin recognition complex(GO:0000808) nuclear origin of replication recognition complex(GO:0005664) |
| 0.1 | 0.3 | GO:0033588 | Elongator holoenzyme complex(GO:0033588) |
| 0.1 | 0.2 | GO:0044530 | supraspliceosomal complex(GO:0044530) |
| 0.1 | 1.0 | GO:0005680 | anaphase-promoting complex(GO:0005680) |
| 0.1 | 0.2 | GO:0005971 | ribonucleoside-diphosphate reductase complex(GO:0005971) |
| 0.1 | 0.2 | GO:0097524 | sperm plasma membrane(GO:0097524) |
| 0.1 | 0.2 | GO:0005945 | 6-phosphofructokinase complex(GO:0005945) |
| 0.1 | 0.4 | GO:0019773 | proteasome core complex, alpha-subunit complex(GO:0019773) |
| 0.1 | 0.1 | GO:0031094 | platelet dense tubular network(GO:0031094) |
| 0.1 | 0.4 | GO:0032300 | mismatch repair complex(GO:0032300) |
| 0.1 | 0.3 | GO:0032584 | growth cone membrane(GO:0032584) |
| 0.1 | 0.2 | GO:0030123 | AP-3 adaptor complex(GO:0030123) |
| 0.1 | 4.4 | GO:0030176 | integral component of endoplasmic reticulum membrane(GO:0030176) |
| 0.0 | 0.3 | GO:0060091 | kinocilium(GO:0060091) |
| 0.0 | 0.5 | GO:0042612 | MHC class I protein complex(GO:0042612) |
| 0.0 | 0.8 | GO:0000159 | protein phosphatase type 2A complex(GO:0000159) |
| 0.0 | 0.4 | GO:0071004 | U2-type prespliceosome(GO:0071004) |
| 0.0 | 1.8 | GO:0032420 | stereocilium(GO:0032420) |
| 0.0 | 0.2 | GO:0008540 | proteasome regulatory particle, base subcomplex(GO:0008540) |
| 0.0 | 0.2 | GO:0005827 | polar microtubule(GO:0005827) |
| 0.0 | 0.5 | GO:0005847 | mRNA cleavage and polyadenylation specificity factor complex(GO:0005847) |
| 0.0 | 0.1 | GO:0036449 | microtubule minus-end(GO:0036449) |
| 0.0 | 0.1 | GO:0043527 | tRNA methyltransferase complex(GO:0043527) |
| 0.0 | 0.1 | GO:0005863 | striated muscle myosin thick filament(GO:0005863) |
| 0.0 | 0.5 | GO:0031462 | Cul2-RING ubiquitin ligase complex(GO:0031462) |
| 0.0 | 0.5 | GO:0005689 | U12-type spliceosomal complex(GO:0005689) |
| 0.0 | 0.8 | GO:0002102 | podosome(GO:0002102) |
| 0.0 | 0.7 | GO:0045120 | pronucleus(GO:0045120) |
| 0.0 | 0.5 | GO:0002178 | palmitoyltransferase complex(GO:0002178) |
| 0.0 | 1.3 | GO:0005763 | organellar small ribosomal subunit(GO:0000314) mitochondrial small ribosomal subunit(GO:0005763) |
| 0.0 | 0.2 | GO:0048237 | rough endoplasmic reticulum lumen(GO:0048237) |
| 0.0 | 0.2 | GO:0042629 | mast cell granule(GO:0042629) |
| 0.0 | 0.3 | GO:0031080 | nuclear pore outer ring(GO:0031080) |
| 0.0 | 0.3 | GO:0000506 | glycosylphosphatidylinositol-N-acetylglucosaminyltransferase (GPI-GnT) complex(GO:0000506) |
| 0.0 | 0.6 | GO:0031597 | cytosolic proteasome complex(GO:0031597) |
| 0.0 | 2.3 | GO:0019005 | SCF ubiquitin ligase complex(GO:0019005) |
| 0.0 | 3.7 | GO:0036064 | ciliary basal body(GO:0036064) |
| 0.0 | 0.2 | GO:0044308 | axonal spine(GO:0044308) |
| 0.0 | 0.4 | GO:0034719 | SMN-Sm protein complex(GO:0034719) |
| 0.0 | 0.4 | GO:0005869 | dynactin complex(GO:0005869) |
| 0.0 | 0.3 | GO:0070419 | nonhomologous end joining complex(GO:0070419) |
| 0.0 | 0.1 | GO:0034666 | integrin alpha2-beta1 complex(GO:0034666) |
| 0.0 | 0.2 | GO:0044613 | nuclear pore central transport channel(GO:0044613) |
| 0.0 | 0.7 | GO:0005868 | cytoplasmic dynein complex(GO:0005868) |
| 0.0 | 0.0 | GO:0097452 | GAIT complex(GO:0097452) |
| 0.0 | 0.3 | GO:0017101 | aminoacyl-tRNA synthetase multienzyme complex(GO:0017101) |
| 0.0 | 0.4 | GO:0000813 | ESCRT I complex(GO:0000813) |
| 0.0 | 0.2 | GO:0005767 | secondary lysosome(GO:0005767) |
| 0.0 | 0.0 | GO:0005726 | perichromatin fibrils(GO:0005726) |
| 0.0 | 1.7 | GO:0005747 | mitochondrial respiratory chain complex I(GO:0005747) NADH dehydrogenase complex(GO:0030964) respiratory chain complex I(GO:0045271) |
| 0.0 | 0.3 | GO:0070937 | CRD-mediated mRNA stability complex(GO:0070937) |
| 0.0 | 0.4 | GO:0032045 | guanyl-nucleotide exchange factor complex(GO:0032045) |
| 0.0 | 1.7 | GO:0031201 | SNARE complex(GO:0031201) |
| 0.0 | 0.3 | GO:1904115 | axon cytoplasm(GO:1904115) |
| 0.0 | 0.2 | GO:0045293 | mRNA editing complex(GO:0045293) |
| 0.0 | 0.3 | GO:0097208 | alveolar lamellar body(GO:0097208) |
| 0.0 | 0.2 | GO:0072559 | NLRP3 inflammasome complex(GO:0072559) |
| 0.0 | 0.1 | GO:0097543 | ciliary inversin compartment(GO:0097543) |
| 0.0 | 0.2 | GO:0031298 | replication fork protection complex(GO:0031298) |
| 0.0 | 0.2 | GO:0000805 | X chromosome(GO:0000805) |
| 0.0 | 0.4 | GO:0032039 | integrator complex(GO:0032039) |
| 0.0 | 0.1 | GO:0071546 | pi-body(GO:0071546) |
| 0.0 | 0.6 | GO:0071012 | catalytic step 1 spliceosome(GO:0071012) |
| 0.0 | 0.1 | GO:0033162 | melanosome membrane(GO:0033162) chitosome(GO:0045009) |
| 0.0 | 0.3 | GO:0008250 | oligosaccharyltransferase complex(GO:0008250) |
| 0.0 | 0.2 | GO:0044217 | other organism(GO:0044215) other organism cell(GO:0044216) other organism part(GO:0044217) |
| 0.0 | 0.2 | GO:0034388 | Pwp2p-containing subcomplex of 90S preribosome(GO:0034388) |
| 0.0 | 0.0 | GO:0005832 | chaperonin-containing T-complex(GO:0005832) |
| 0.0 | 0.8 | GO:0030286 | dynein complex(GO:0030286) |
| 0.0 | 0.2 | GO:0005662 | DNA replication factor A complex(GO:0005662) |
| 0.0 | 0.3 | GO:0070187 | telosome(GO:0070187) |
| 0.0 | 0.4 | GO:0005671 | Ada2/Gcn5/Ada3 transcription activator complex(GO:0005671) |
| 0.0 | 0.3 | GO:0008385 | IkappaB kinase complex(GO:0008385) |
| 0.0 | 0.1 | GO:1990316 | ATG1/ULK1 kinase complex(GO:1990316) |
| 0.0 | 0.5 | GO:0043034 | costamere(GO:0043034) |
| 0.0 | 0.2 | GO:0030660 | Golgi-associated vesicle membrane(GO:0030660) |
| 0.0 | 0.4 | GO:0017119 | Golgi transport complex(GO:0017119) |
| 0.0 | 0.6 | GO:0000777 | condensed chromosome kinetochore(GO:0000777) |
| 0.0 | 0.2 | GO:0045252 | oxoglutarate dehydrogenase complex(GO:0045252) |
| 0.0 | 1.0 | GO:0008023 | transcription elongation factor complex(GO:0008023) |
| 0.0 | 0.1 | GO:0098536 | deuterosome(GO:0098536) |
| 0.0 | 0.4 | GO:0030914 | STAGA complex(GO:0030914) |
| 0.0 | 1.5 | GO:0005902 | microvillus(GO:0005902) |
| 0.0 | 0.6 | GO:0005666 | DNA-directed RNA polymerase III complex(GO:0005666) |
| 0.0 | 0.1 | GO:0071953 | elastic fiber(GO:0071953) |
| 0.0 | 0.5 | GO:0000307 | cyclin-dependent protein kinase holoenzyme complex(GO:0000307) |
| 0.0 | 0.7 | GO:0005876 | spindle microtubule(GO:0005876) |
| 0.0 | 0.2 | GO:0000346 | transcription export complex(GO:0000346) |
| 0.0 | 0.1 | GO:0045298 | tubulin complex(GO:0045298) |
| 0.0 | 0.1 | GO:0070545 | PeBoW complex(GO:0070545) |
| 0.0 | 0.2 | GO:0030677 | nucleolar ribonuclease P complex(GO:0005655) ribonuclease P complex(GO:0030677) multimeric ribonuclease P complex(GO:0030681) |
| 0.0 | 0.1 | GO:0045277 | respiratory chain complex IV(GO:0045277) |
| 0.0 | 0.1 | GO:0014701 | junctional sarcoplasmic reticulum membrane(GO:0014701) |
| 0.0 | 0.1 | GO:0097427 | microtubule bundle(GO:0097427) |
| 0.0 | 0.0 | GO:0005879 | axonemal microtubule(GO:0005879) |
| 0.0 | 0.0 | GO:1990745 | EARP complex(GO:1990745) |
| 0.0 | 0.2 | GO:0033179 | proton-transporting V-type ATPase, V0 domain(GO:0033179) |
| 0.0 | 0.1 | GO:0008091 | spectrin(GO:0008091) |
| 0.0 | 0.3 | GO:0000930 | gamma-tubulin complex(GO:0000930) |
| 0.0 | 0.1 | GO:1990130 | Iml1 complex(GO:1990130) |
| 0.0 | 0.3 | GO:0030126 | COPI vesicle coat(GO:0030126) |
| 0.0 | 0.1 | GO:0005684 | U2-type spliceosomal complex(GO:0005684) |
| 0.0 | 0.7 | GO:0016235 | aggresome(GO:0016235) |
| 0.0 | 0.7 | GO:0032809 | neuronal cell body membrane(GO:0032809) |
| 0.0 | 0.1 | GO:0016514 | SWI/SNF complex(GO:0016514) |
| 0.0 | 0.2 | GO:0000439 | core TFIIH complex(GO:0000439) |
| 0.0 | 0.1 | GO:0005899 | insulin receptor complex(GO:0005899) |
| 0.0 | 0.2 | GO:0042581 | specific granule(GO:0042581) |
| 0.0 | 0.7 | GO:0005776 | autophagosome(GO:0005776) |
| 0.0 | 1.2 | GO:0042734 | presynaptic membrane(GO:0042734) |
| 0.0 | 0.1 | GO:0016222 | procollagen-proline 4-dioxygenase complex(GO:0016222) |
| 0.0 | 0.2 | GO:0048500 | signal recognition particle, endoplasmic reticulum targeting(GO:0005786) signal recognition particle(GO:0048500) |
| 0.0 | 0.4 | GO:0071564 | npBAF complex(GO:0071564) |
| 0.0 | 0.1 | GO:0000275 | mitochondrial proton-transporting ATP synthase complex, catalytic core F(1)(GO:0000275) proton-transporting ATP synthase complex, catalytic core F(1)(GO:0045261) |
| 0.0 | 0.1 | GO:0097512 | cardiac myofibril(GO:0097512) |
| 0.0 | 0.6 | GO:0005891 | voltage-gated calcium channel complex(GO:0005891) |
| 0.0 | 0.1 | GO:0030896 | checkpoint clamp complex(GO:0030896) |
| 0.0 | 0.2 | GO:0005744 | mitochondrial inner membrane presequence translocase complex(GO:0005744) |
| 0.0 | 0.0 | GO:0070765 | gamma-secretase complex(GO:0070765) |
| 0.0 | 0.1 | GO:0048179 | activin receptor complex(GO:0048179) |
| 0.0 | 0.4 | GO:0005746 | mitochondrial respiratory chain(GO:0005746) |
| 0.0 | 0.1 | GO:0033648 | host intracellular organelle(GO:0033647) host intracellular membrane-bounded organelle(GO:0033648) |
| 0.0 | 0.1 | GO:0033180 | proton-transporting V-type ATPase, V1 domain(GO:0033180) |
| 0.0 | 0.6 | GO:0008180 | COP9 signalosome(GO:0008180) |
| 0.0 | 0.1 | GO:0032541 | cortical endoplasmic reticulum(GO:0032541) |
| 0.0 | 0.4 | GO:0032839 | dendrite cytoplasm(GO:0032839) |
| 0.0 | 3.1 | GO:0005765 | lysosomal membrane(GO:0005765) lytic vacuole membrane(GO:0098852) |
| 0.0 | 1.0 | GO:0043198 | dendritic shaft(GO:0043198) |
| 0.0 | 1.0 | GO:0045095 | keratin filament(GO:0045095) |
| 0.0 | 0.0 | GO:0044455 | mitochondrial membrane part(GO:0044455) |
| 0.0 | 0.1 | GO:0031371 | ubiquitin conjugating enzyme complex(GO:0031371) |
| 0.0 | 1.0 | GO:0022627 | cytosolic small ribosomal subunit(GO:0022627) |
| 0.0 | 0.3 | GO:0005801 | cis-Golgi network(GO:0005801) |
| 0.0 | 0.9 | GO:0005643 | nuclear pore(GO:0005643) |
| 0.0 | 0.1 | GO:0005968 | Rab-protein geranylgeranyltransferase complex(GO:0005968) |
| 0.0 | 0.2 | GO:0042382 | paraspeckles(GO:0042382) |
| 0.0 | 0.1 | GO:0016600 | flotillin complex(GO:0016600) |
| 0.0 | 0.1 | GO:0043203 | axon hillock(GO:0043203) |
| 0.0 | 0.0 | GO:1990131 | EGO complex(GO:0034448) Gtr1-Gtr2 GTPase complex(GO:1990131) |
| 0.0 | 0.3 | GO:0030880 | RNA polymerase complex(GO:0030880) |
| 0.0 | 1.2 | GO:0031463 | Cul3-RING ubiquitin ligase complex(GO:0031463) |
| 0.0 | 0.0 | GO:0031466 | Cul5-RING ubiquitin ligase complex(GO:0031466) |
| 0.0 | 0.2 | GO:0030137 | COPI-coated vesicle(GO:0030137) |
| 0.0 | 0.2 | GO:0005640 | nuclear outer membrane(GO:0005640) |
| 0.0 | 0.1 | GO:0032982 | myosin filament(GO:0032982) |
| 0.0 | 0.2 | GO:0033017 | sarcoplasmic reticulum membrane(GO:0033017) |
| 0.0 | 0.4 | GO:0055038 | recycling endosome membrane(GO:0055038) |
| 0.0 | 1.0 | GO:0071013 | catalytic step 2 spliceosome(GO:0071013) |
| 0.0 | 0.2 | GO:0035098 | ESC/E(Z) complex(GO:0035098) |
| 0.0 | 0.2 | GO:0005665 | DNA-directed RNA polymerase II, core complex(GO:0005665) |
| 0.0 | 0.1 | GO:0071437 | invadopodium(GO:0071437) |
| 0.0 | 0.7 | GO:0097014 | axoneme(GO:0005930) ciliary plasm(GO:0097014) |
| 0.0 | 0.4 | GO:0036379 | striated muscle thin filament(GO:0005865) myofilament(GO:0036379) |
| 0.0 | 0.1 | GO:0042719 | mitochondrial intermembrane space protein transporter complex(GO:0042719) |
| 0.0 | 0.0 | GO:0005685 | U1 snRNP(GO:0005685) |
| 0.0 | 0.1 | GO:0032444 | activin responsive factor complex(GO:0032444) |
| 0.0 | 0.5 | GO:0031672 | A band(GO:0031672) |
| 0.0 | 0.2 | GO:0034663 | endoplasmic reticulum chaperone complex(GO:0034663) |
| 0.0 | 1.7 | GO:0005741 | mitochondrial outer membrane(GO:0005741) |
| 0.0 | 0.1 | GO:0005742 | mitochondrial outer membrane translocase complex(GO:0005742) |
| 0.0 | 0.2 | GO:0010369 | chromocenter(GO:0010369) |
| 0.0 | 0.1 | GO:0097413 | Lewy body(GO:0097413) |
| 0.0 | 0.1 | GO:0097470 | ribbon synapse(GO:0097470) |
| 0.0 | 0.1 | GO:0070469 | respiratory chain(GO:0070469) |
| 0.0 | 0.2 | GO:0033177 | proton-transporting two-sector ATPase complex, proton-transporting domain(GO:0033177) proton-transporting ATP synthase complex, coupling factor F(o)(GO:0045263) |
| 0.0 | 0.6 | GO:0055037 | recycling endosome(GO:0055037) |
| 0.0 | 0.0 | GO:0044232 | organelle membrane contact site(GO:0044232) |
| 0.0 | 0.4 | GO:0016529 | sarcoplasmic reticulum(GO:0016529) |
| 0.0 | 0.1 | GO:0031209 | SCAR complex(GO:0031209) |
| 0.0 | 0.3 | GO:0030315 | T-tubule(GO:0030315) |
| 0.0 | 0.1 | GO:0070775 | H3 histone acetyltransferase complex(GO:0070775) MOZ/MORF histone acetyltransferase complex(GO:0070776) |
| 0.0 | 0.1 | GO:0090576 | RNA polymerase III transcription factor complex(GO:0090576) |
| 0.0 | 0.3 | GO:0098800 | inner mitochondrial membrane protein complex(GO:0098800) |
| 0.0 | 1.5 | GO:0070160 | bicellular tight junction(GO:0005923) occluding junction(GO:0070160) |
| 0.0 | 0.2 | GO:0030662 | coated vesicle membrane(GO:0030662) |
| 0.0 | 0.1 | GO:0005797 | Golgi medial cisterna(GO:0005797) |
| 0.0 | 0.1 | GO:0016272 | prefoldin complex(GO:0016272) |
| 0.0 | 0.7 | GO:0043195 | terminal bouton(GO:0043195) |
| 0.0 | 0.0 | GO:0031304 | intrinsic component of mitochondrial inner membrane(GO:0031304) |
| 0.0 | 0.6 | GO:0005762 | organellar large ribosomal subunit(GO:0000315) mitochondrial large ribosomal subunit(GO:0005762) |
| 0.0 | 0.1 | GO:0043083 | synaptic cleft(GO:0043083) |
| 0.0 | 0.0 | GO:0036194 | muscle cell projection(GO:0036194) muscle cell projection membrane(GO:0036195) |
| 0.0 | 0.1 | GO:0036513 | Derlin-1 retrotranslocation complex(GO:0036513) |
| 0.0 | 0.1 | GO:0042405 | nuclear inclusion body(GO:0042405) |
| 0.0 | 0.1 | GO:0000801 | central element(GO:0000801) |
| 0.0 | 0.1 | GO:0042555 | MCM complex(GO:0042555) |
| 0.0 | 0.2 | GO:0031362 | anchored component of external side of plasma membrane(GO:0031362) |
| 0.0 | 0.5 | GO:0042641 | actomyosin(GO:0042641) |
| 0.0 | 0.1 | GO:0045098 | type III intermediate filament(GO:0045098) |
| 0.0 | 0.5 | GO:0005778 | peroxisomal membrane(GO:0005778) microbody membrane(GO:0031903) |
| 0.0 | 0.1 | GO:0042589 | zymogen granule membrane(GO:0042589) |
| 0.0 | 0.1 | GO:0030015 | CCR4-NOT core complex(GO:0030015) |
| 0.0 | 0.1 | GO:0008074 | guanylate cyclase complex, soluble(GO:0008074) |
| 0.0 | 0.3 | GO:0001772 | immunological synapse(GO:0001772) |
| 0.0 | 0.0 | GO:0042583 | chromaffin granule(GO:0042583) |
| 0.0 | 0.1 | GO:0043218 | compact myelin(GO:0043218) |
| 0.0 | 0.8 | GO:0090575 | RNA polymerase II transcription factor complex(GO:0090575) |
| 0.0 | 1.9 | GO:0042175 | nuclear outer membrane-endoplasmic reticulum membrane network(GO:0042175) |
| 0.0 | 0.1 | GO:0042105 | alpha-beta T cell receptor complex(GO:0042105) |
| 0.0 | 0.1 | GO:0030134 | ER to Golgi transport vesicle(GO:0030134) |
| 0.0 | 0.7 | GO:0030018 | Z disc(GO:0030018) |
| 0.0 | 0.0 | GO:0070069 | cytochrome complex(GO:0070069) |
| 0.0 | 0.2 | GO:0043240 | Fanconi anaemia nuclear complex(GO:0043240) |
| 0.0 | 0.2 | GO:0044665 | MLL1/2 complex(GO:0044665) MLL1 complex(GO:0071339) |
| 0.0 | 0.0 | GO:0015935 | small ribosomal subunit(GO:0015935) |
| 0.0 | 2.8 | GO:0005743 | mitochondrial inner membrane(GO:0005743) |
| 0.0 | 0.4 | GO:0005793 | endoplasmic reticulum-Golgi intermediate compartment(GO:0005793) |
| 0.0 | 0.1 | GO:0030673 | axolemma(GO:0030673) |
| 0.0 | 0.6 | GO:0001533 | cornified envelope(GO:0001533) |
| 0.0 | 0.0 | GO:0005790 | smooth endoplasmic reticulum(GO:0005790) |
| 0.0 | 0.6 | GO:0016605 | PML body(GO:0016605) |
| 0.0 | 0.0 | GO:0032777 | Piccolo NuA4 histone acetyltransferase complex(GO:0032777) |
| 0.0 | 0.4 | GO:0030136 | clathrin-coated vesicle(GO:0030136) |
| 0.0 | 0.1 | GO:0034045 | pre-autophagosomal structure membrane(GO:0034045) |
| 0.0 | 0.0 | GO:0070761 | pre-snoRNP complex(GO:0070761) |
| 0.0 | 0.0 | GO:0097149 | centralspindlin complex(GO:0097149) |
| 0.0 | 0.2 | GO:0005892 | acetylcholine-gated channel complex(GO:0005892) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.8 | 2.5 | GO:0004886 | 9-cis retinoic acid receptor activity(GO:0004886) |
| 0.5 | 1.5 | GO:0004771 | sterol esterase activity(GO:0004771) |
| 0.4 | 1.2 | GO:0036042 | long-chain fatty acyl-CoA binding(GO:0036042) |
| 0.4 | 1.1 | GO:0004024 | alcohol dehydrogenase activity, zinc-dependent(GO:0004024) |
| 0.3 | 1.0 | GO:0034186 | apolipoprotein A-I binding(GO:0034186) |
| 0.3 | 1.3 | GO:0032896 | palmitoyl-CoA 9-desaturase activity(GO:0032896) |
| 0.3 | 1.6 | GO:0017040 | ceramidase activity(GO:0017040) |
| 0.3 | 0.9 | GO:0004937 | alpha1-adrenergic receptor activity(GO:0004937) |
| 0.3 | 0.3 | GO:0030792 | methylarsonite methyltransferase activity(GO:0030792) |
| 0.3 | 1.5 | GO:0015288 | porin activity(GO:0015288) |
| 0.3 | 3.3 | GO:0015643 | toxic substance binding(GO:0015643) |
| 0.3 | 1.0 | GO:0004035 | alkaline phosphatase activity(GO:0004035) |
| 0.2 | 1.0 | GO:0003873 | 6-phosphofructo-2-kinase activity(GO:0003873) |
| 0.2 | 0.7 | GO:0004980 | melanocyte-stimulating hormone receptor activity(GO:0004980) |
| 0.2 | 2.3 | GO:0034713 | type I transforming growth factor beta receptor binding(GO:0034713) |
| 0.2 | 0.9 | GO:0008970 | phosphatidylcholine 1-acylhydrolase activity(GO:0008970) |
| 0.2 | 1.3 | GO:0016151 | nickel cation binding(GO:0016151) |
| 0.2 | 0.6 | GO:0008597 | calcium-dependent protein serine/threonine phosphatase regulator activity(GO:0008597) |
| 0.2 | 1.1 | GO:0022820 | potassium:chloride symporter activity(GO:0015379) potassium ion symporter activity(GO:0022820) |
| 0.2 | 0.8 | GO:0052650 | NADP-retinol dehydrogenase activity(GO:0052650) |
| 0.2 | 0.6 | GO:0004699 | calcium-independent protein kinase C activity(GO:0004699) |
| 0.2 | 2.2 | GO:0004312 | fatty acid synthase activity(GO:0004312) |
| 0.2 | 0.6 | GO:0018479 | benzaldehyde dehydrogenase (NAD+) activity(GO:0018479) |
| 0.2 | 0.6 | GO:0004174 | electron-transferring-flavoprotein dehydrogenase activity(GO:0004174) oxidoreductase activity, acting on the CH-NH group of donors, quinone or similar compound as acceptor(GO:0016649) |
| 0.2 | 0.2 | GO:0030911 | TPR domain binding(GO:0030911) |
| 0.2 | 0.6 | GO:0043423 | 3-phosphoinositide-dependent protein kinase binding(GO:0043423) |
| 0.2 | 0.8 | GO:0004090 | carbonyl reductase (NADPH) activity(GO:0004090) |
| 0.2 | 0.6 | GO:0005483 | soluble NSF attachment protein activity(GO:0005483) |
| 0.2 | 0.7 | GO:0005047 | signal recognition particle binding(GO:0005047) |
| 0.2 | 0.2 | GO:0004711 | ribosomal protein S6 kinase activity(GO:0004711) |
| 0.2 | 1.4 | GO:0003988 | acetyl-CoA C-acyltransferase activity(GO:0003988) |
| 0.2 | 0.5 | GO:0008384 | IkappaB kinase activity(GO:0008384) |
| 0.2 | 0.7 | GO:0004849 | uridine kinase activity(GO:0004849) |
| 0.2 | 0.5 | GO:0030158 | protein xylosyltransferase activity(GO:0030158) |
| 0.2 | 1.7 | GO:0051010 | microtubule plus-end binding(GO:0051010) |
| 0.2 | 0.5 | GO:0019959 | interleukin-8 binding(GO:0019959) |
| 0.2 | 0.8 | GO:0035662 | Toll-like receptor 4 binding(GO:0035662) |
| 0.2 | 1.9 | GO:0001223 | transcription coactivator binding(GO:0001223) |
| 0.2 | 0.2 | GO:0042813 | Wnt-activated receptor activity(GO:0042813) |
| 0.2 | 0.2 | GO:0004331 | fructose-2,6-bisphosphate 2-phosphatase activity(GO:0004331) |
| 0.2 | 0.5 | GO:0038181 | bile acid receptor activity(GO:0038181) |
| 0.2 | 1.4 | GO:0004499 | N,N-dimethylaniline monooxygenase activity(GO:0004499) |
| 0.2 | 0.6 | GO:0004165 | dodecenoyl-CoA delta-isomerase activity(GO:0004165) |
| 0.2 | 0.5 | GO:0016842 | amidine-lyase activity(GO:0016842) |
| 0.2 | 0.5 | GO:0070905 | serine binding(GO:0070905) |
| 0.2 | 0.2 | GO:0018423 | protein C-terminal carboxyl O-methyltransferase activity(GO:0003880) protein C-terminal leucine carboxyl O-methyltransferase activity(GO:0018423) |
| 0.2 | 0.5 | GO:0030899 | calcium-dependent ATPase activity(GO:0030899) |
| 0.2 | 0.9 | GO:0005381 | iron ion transmembrane transporter activity(GO:0005381) |
| 0.2 | 0.6 | GO:0017162 | aryl hydrocarbon receptor binding(GO:0017162) |
| 0.1 | 0.4 | GO:0051425 | PTB domain binding(GO:0051425) |
| 0.1 | 0.4 | GO:0004705 | JUN kinase activity(GO:0004705) SAP kinase activity(GO:0016909) |
| 0.1 | 1.0 | GO:0046790 | virion binding(GO:0046790) |
| 0.1 | 0.4 | GO:0009041 | uridylate kinase activity(GO:0009041) |
| 0.1 | 0.9 | GO:0019871 | sodium channel inhibitor activity(GO:0019871) |
| 0.1 | 0.4 | GO:0031893 | vasopressin receptor binding(GO:0031893) |
| 0.1 | 0.1 | GO:0015440 | peptide-transporting ATPase activity(GO:0015440) |
| 0.1 | 0.4 | GO:0043398 | HLH domain binding(GO:0043398) |
| 0.1 | 0.4 | GO:0008506 | sucrose:proton symporter activity(GO:0008506) sucrose transmembrane transporter activity(GO:0008515) disaccharide transmembrane transporter activity(GO:0015154) oligosaccharide transmembrane transporter activity(GO:0015157) |
| 0.1 | 2.0 | GO:0016290 | palmitoyl-CoA hydrolase activity(GO:0016290) |
| 0.1 | 0.4 | GO:0004936 | alpha-adrenergic receptor activity(GO:0004936) alpha2-adrenergic receptor activity(GO:0004938) |
| 0.1 | 0.4 | GO:0015143 | urate transmembrane transporter activity(GO:0015143) salt transmembrane transporter activity(GO:1901702) |
| 0.1 | 0.4 | GO:0070653 | high-density lipoprotein particle receptor binding(GO:0070653) |
| 0.1 | 0.5 | GO:0071987 | WD40-repeat domain binding(GO:0071987) |
| 0.1 | 0.4 | GO:0035373 | chondroitin sulfate proteoglycan binding(GO:0035373) |
| 0.1 | 0.4 | GO:0030943 | mitochondrion targeting sequence binding(GO:0030943) |
| 0.1 | 0.7 | GO:0001849 | complement component C1q binding(GO:0001849) |
| 0.1 | 0.3 | GO:0004022 | alcohol dehydrogenase (NAD) activity(GO:0004022) |
| 0.1 | 0.7 | GO:0017169 | CDP-alcohol phosphatidyltransferase activity(GO:0017169) |
| 0.1 | 0.1 | GO:0043849 | Ras palmitoyltransferase activity(GO:0043849) |
| 0.1 | 0.4 | GO:0019862 | IgA binding(GO:0019862) |
| 0.1 | 0.5 | GO:0008934 | inositol monophosphate 1-phosphatase activity(GO:0008934) inositol monophosphate 3-phosphatase activity(GO:0052832) inositol monophosphate 4-phosphatase activity(GO:0052833) inositol monophosphate phosphatase activity(GO:0052834) |
| 0.1 | 0.5 | GO:0015173 | aromatic amino acid transmembrane transporter activity(GO:0015173) |
| 0.1 | 0.4 | GO:0030620 | U2 snRNA binding(GO:0030620) |
| 0.1 | 0.5 | GO:0070579 | methylcytosine dioxygenase activity(GO:0070579) |
| 0.1 | 0.5 | GO:0015183 | L-aspartate transmembrane transporter activity(GO:0015183) |
| 0.1 | 0.1 | GO:0070290 | N-acylphosphatidylethanolamine-specific phospholipase D activity(GO:0070290) |
| 0.1 | 0.5 | GO:0061665 | SUMO ligase activity(GO:0061665) |
| 0.1 | 2.3 | GO:0005112 | Notch binding(GO:0005112) |
| 0.1 | 0.5 | GO:0004740 | pyruvate dehydrogenase (acetyl-transferring) kinase activity(GO:0004740) |
| 0.1 | 0.6 | GO:0004689 | phosphorylase kinase activity(GO:0004689) |
| 0.1 | 0.5 | GO:1990254 | keratin filament binding(GO:1990254) |
| 0.1 | 0.6 | GO:0004030 | aldehyde dehydrogenase [NAD(P)+] activity(GO:0004030) |
| 0.1 | 0.4 | GO:0008898 | S-adenosylmethionine-homocysteine S-methyltransferase activity(GO:0008898) |
| 0.1 | 0.7 | GO:0031685 | adenosine receptor binding(GO:0031685) |
| 0.1 | 0.1 | GO:0050816 | phosphothreonine binding(GO:0050816) |
| 0.1 | 0.4 | GO:0070548 | L-glutamine aminotransferase activity(GO:0070548) |
| 0.1 | 0.6 | GO:0051185 | coenzyme transporter activity(GO:0051185) |
| 0.1 | 0.4 | GO:0004833 | tryptophan 2,3-dioxygenase activity(GO:0004833) |
| 0.1 | 0.2 | GO:0002134 | UTP binding(GO:0002134) pyrimidine ribonucleoside binding(GO:0032551) |
| 0.1 | 0.7 | GO:0051021 | GDP-dissociation inhibitor binding(GO:0051021) |
| 0.1 | 0.3 | GO:0004691 | cAMP-dependent protein kinase activity(GO:0004691) |
| 0.1 | 0.9 | GO:0004534 | 5'-3' exoribonuclease activity(GO:0004534) |
| 0.1 | 0.2 | GO:0004611 | phosphoenolpyruvate carboxykinase activity(GO:0004611) |
| 0.1 | 2.7 | GO:0052712 | calmodulin-dependent cyclic-nucleotide phosphodiesterase activity(GO:0004117) cGMP-stimulated cyclic-nucleotide phosphodiesterase activity(GO:0004118) cGMP-inhibited cyclic-nucleotide phosphodiesterase activity(GO:0004119) photoreceptor cyclic-nucleotide phosphodiesterase activity(GO:0004120) 7,8-dihydro-D-neopterin 2',3'-cyclic phosphate phosphodiesterase activity(GO:0044688) inositol phosphosphingolipid phospholipase activity(GO:0052712) inositol phosphorylceramide phospholipase activity(GO:0052713) mannosyl-inositol phosphorylceramide phospholipase activity(GO:0052714) mannosyl-diinositol phosphorylceramide phospholipase activity(GO:0052715) |
| 0.1 | 0.3 | GO:0008427 | calcium-dependent protein kinase inhibitor activity(GO:0008427) |
| 0.1 | 1.9 | GO:0004708 | MAP kinase kinase activity(GO:0004708) |
| 0.1 | 0.2 | GO:0001665 | alpha-N-acetylgalactosaminide alpha-2,6-sialyltransferase activity(GO:0001665) |
| 0.1 | 0.3 | GO:0004800 | thyroxine 5'-deiodinase activity(GO:0004800) |
| 0.1 | 0.1 | GO:0019912 | cyclin-dependent protein kinase activating kinase activity(GO:0019912) |
| 0.1 | 2.5 | GO:0016645 | oxidoreductase activity, acting on the CH-NH group of donors(GO:0016645) |
| 0.1 | 0.3 | GO:1990825 | sequence-specific mRNA binding(GO:1990825) |
| 0.1 | 0.3 | GO:0042030 | ATPase inhibitor activity(GO:0042030) |
| 0.1 | 0.4 | GO:1904288 | BAT3 complex binding(GO:1904288) |
| 0.1 | 0.5 | GO:0017151 | DEAD/H-box RNA helicase binding(GO:0017151) |
| 0.1 | 0.3 | GO:0000309 | nicotinamide-nucleotide adenylyltransferase activity(GO:0000309) nicotinate-nucleotide adenylyltransferase activity(GO:0004515) |
| 0.1 | 0.6 | GO:0047760 | butyrate-CoA ligase activity(GO:0047760) |
| 0.1 | 0.3 | GO:0002151 | G-quadruplex RNA binding(GO:0002151) |
| 0.1 | 0.1 | GO:0004687 | myosin light chain kinase activity(GO:0004687) |
| 0.1 | 0.4 | GO:0070679 | inositol 1,4,5 trisphosphate binding(GO:0070679) |
| 0.1 | 0.8 | GO:0005167 | neurotrophin TRK receptor binding(GO:0005167) |
| 0.1 | 0.3 | GO:0016743 | carboxyl- or carbamoyltransferase activity(GO:0016743) |
| 0.1 | 0.7 | GO:0034046 | poly(G) binding(GO:0034046) |
| 0.1 | 0.1 | GO:0004104 | cholinesterase activity(GO:0004104) |
| 0.1 | 0.3 | GO:0004359 | glutaminase activity(GO:0004359) |
| 0.1 | 0.2 | GO:0008607 | phosphorylase kinase regulator activity(GO:0008607) |
| 0.1 | 0.3 | GO:0001226 | RNA polymerase II transcription cofactor binding(GO:0001224) RNA polymerase II transcription corepressor binding(GO:0001226) |
| 0.1 | 0.8 | GO:0070097 | delta-catenin binding(GO:0070097) |
| 0.1 | 0.3 | GO:0071253 | connexin binding(GO:0071253) |
| 0.1 | 0.3 | GO:0032137 | guanine/thymine mispair binding(GO:0032137) |
| 0.1 | 0.3 | GO:0015205 | purine nucleobase transmembrane transporter activity(GO:0005345) pyrimidine nucleobase transmembrane transporter activity(GO:0005350) nucleobase transmembrane transporter activity(GO:0015205) |
| 0.1 | 3.0 | GO:0018733 | 3,4-dihydrocoumarin hydrolase activity(GO:0018733) |
| 0.1 | 0.3 | GO:0004667 | prostaglandin-D synthase activity(GO:0004667) |
| 0.1 | 0.3 | GO:0047192 | 1-alkylglycerophosphocholine O-acetyltransferase activity(GO:0047192) |
| 0.1 | 0.1 | GO:0042281 | dolichyl pyrophosphate Man9GlcNAc2 alpha-1,3-glucosyltransferase activity(GO:0042281) |
| 0.1 | 0.5 | GO:0000774 | adenyl-nucleotide exchange factor activity(GO:0000774) |
| 0.1 | 0.1 | GO:0015087 | cobalt ion transmembrane transporter activity(GO:0015087) |
| 0.1 | 0.4 | GO:0017150 | tRNA dihydrouridine synthase activity(GO:0017150) |
| 0.1 | 1.5 | GO:0017049 | GTP-Rho binding(GO:0017049) |
| 0.1 | 0.1 | GO:0030957 | Tat protein binding(GO:0030957) |
| 0.1 | 0.5 | GO:0008508 | bile acid:sodium symporter activity(GO:0008508) |
| 0.1 | 1.6 | GO:0032794 | GTPase activating protein binding(GO:0032794) |
| 0.1 | 0.3 | GO:0044323 | retinoic acid-responsive element binding(GO:0044323) |
| 0.1 | 0.5 | GO:0015165 | pyrimidine nucleotide-sugar transmembrane transporter activity(GO:0015165) |
| 0.1 | 0.5 | GO:0001054 | RNA polymerase I activity(GO:0001054) |
| 0.1 | 0.8 | GO:0035613 | RNA stem-loop binding(GO:0035613) |
| 0.1 | 0.3 | GO:0070137 | ubiquitin-like protein-specific endopeptidase activity(GO:0070137) SUMO-specific endopeptidase activity(GO:0070139) |
| 0.1 | 1.3 | GO:0034237 | protein kinase A regulatory subunit binding(GO:0034237) |
| 0.1 | 0.8 | GO:0005159 | insulin-like growth factor receptor binding(GO:0005159) |
| 0.1 | 0.6 | GO:0004908 | interleukin-1 receptor activity(GO:0004908) |
| 0.1 | 2.2 | GO:0042056 | chemoattractant activity(GO:0042056) |
| 0.1 | 0.4 | GO:0030250 | cyclase activator activity(GO:0010853) guanylate cyclase activator activity(GO:0030250) |
| 0.1 | 0.3 | GO:0004345 | glucose-6-phosphate dehydrogenase activity(GO:0004345) |
| 0.1 | 0.1 | GO:0000403 | Y-form DNA binding(GO:0000403) |
| 0.1 | 0.1 | GO:0033142 | progesterone receptor binding(GO:0033142) |
| 0.1 | 0.7 | GO:0005337 | nucleoside transmembrane transporter activity(GO:0005337) |
| 0.1 | 0.4 | GO:0003828 | alpha-N-acetylneuraminate alpha-2,8-sialyltransferase activity(GO:0003828) |
| 0.1 | 0.3 | GO:0050692 | DBD domain binding(GO:0050692) |
| 0.1 | 0.3 | GO:0016015 | morphogen activity(GO:0016015) |
| 0.1 | 0.9 | GO:0030898 | actin-dependent ATPase activity(GO:0030898) |
| 0.1 | 0.6 | GO:0004679 | AMP-activated protein kinase activity(GO:0004679) |
| 0.1 | 0.2 | GO:0015141 | succinate transmembrane transporter activity(GO:0015141) |
| 0.1 | 0.3 | GO:0004582 | dolichyl-phosphate beta-D-mannosyltransferase activity(GO:0004582) |
| 0.1 | 0.7 | GO:0043995 | histone acetyltransferase activity (H4-K5 specific)(GO:0043995) histone acetyltransferase activity (H4-K8 specific)(GO:0043996) histone acetyltransferase activity (H4-K16 specific)(GO:0046972) |
| 0.1 | 0.2 | GO:0016838 | carbon-oxygen lyase activity, acting on phosphates(GO:0016838) |
| 0.1 | 0.6 | GO:0005068 | transmembrane receptor protein tyrosine kinase adaptor activity(GO:0005068) |
| 0.1 | 0.6 | GO:0003680 | AT DNA binding(GO:0003680) |
| 0.1 | 1.2 | GO:0008353 | RNA polymerase II carboxy-terminal domain kinase activity(GO:0008353) |
| 0.1 | 1.4 | GO:0003785 | actin monomer binding(GO:0003785) |
| 0.1 | 0.2 | GO:0043515 | kinetochore binding(GO:0043515) |
| 0.1 | 0.4 | GO:0019784 | NEDD8-specific protease activity(GO:0019784) |
| 0.1 | 0.1 | GO:0000253 | 3-keto sterol reductase activity(GO:0000253) |
| 0.1 | 0.1 | GO:0034739 | histone deacetylase activity (H4-K16 specific)(GO:0034739) |
| 0.1 | 0.2 | GO:0047045 | testosterone 17-beta-dehydrogenase (NADP+) activity(GO:0047045) |
| 0.1 | 1.0 | GO:0070006 | metalloaminopeptidase activity(GO:0070006) |
| 0.1 | 0.6 | GO:1990247 | N6-methyladenosine-containing RNA binding(GO:1990247) |
| 0.1 | 0.4 | GO:0005499 | vitamin D binding(GO:0005499) |
| 0.1 | 0.5 | GO:0016176 | superoxide-generating NADPH oxidase activator activity(GO:0016176) |
| 0.1 | 0.5 | GO:0002162 | dystroglycan binding(GO:0002162) |
| 0.1 | 0.4 | GO:0004064 | arylesterase activity(GO:0004064) |
| 0.1 | 0.4 | GO:0004726 | non-membrane spanning protein tyrosine phosphatase activity(GO:0004726) |
| 0.1 | 0.2 | GO:0042392 | sphingosine-1-phosphate phosphatase activity(GO:0042392) |
| 0.1 | 0.2 | GO:0030297 | transmembrane receptor protein tyrosine kinase activator activity(GO:0030297) |
| 0.1 | 0.9 | GO:0051765 | inositol tetrakisphosphate kinase activity(GO:0051765) |
| 0.1 | 0.1 | GO:0010484 | H3 histone acetyltransferase activity(GO:0010484) |
| 0.1 | 0.3 | GO:0004169 | dolichyl-phosphate-mannose-protein mannosyltransferase activity(GO:0004169) |
| 0.1 | 0.2 | GO:0043533 | inositol 1,3,4,5 tetrakisphosphate binding(GO:0043533) |
| 0.1 | 0.1 | GO:0032564 | dATP binding(GO:0032564) |
| 0.1 | 0.3 | GO:0016744 | transferase activity, transferring aldehyde or ketonic groups(GO:0016744) |
| 0.1 | 0.3 | GO:0004614 | phosphoglucomutase activity(GO:0004614) |
| 0.1 | 1.0 | GO:0017081 | chloride channel regulator activity(GO:0017081) |
| 0.1 | 0.1 | GO:0005176 | ErbB-2 class receptor binding(GO:0005176) |
| 0.1 | 0.5 | GO:0051371 | muscle alpha-actinin binding(GO:0051371) |
| 0.1 | 0.6 | GO:0039706 | co-receptor binding(GO:0039706) |
| 0.1 | 0.1 | GO:0031694 | alpha-2A adrenergic receptor binding(GO:0031694) |
| 0.1 | 0.3 | GO:0017089 | glycolipid transporter activity(GO:0017089) |
| 0.1 | 0.2 | GO:2001069 | glycogen binding(GO:2001069) |
| 0.1 | 0.5 | GO:0071617 | lysophospholipid acyltransferase activity(GO:0071617) |
| 0.1 | 0.6 | GO:0004865 | protein serine/threonine phosphatase inhibitor activity(GO:0004865) |
| 0.1 | 0.4 | GO:0004630 | phospholipase D activity(GO:0004630) |
| 0.1 | 0.8 | GO:0015279 | store-operated calcium channel activity(GO:0015279) |
| 0.1 | 0.6 | GO:0001206 | transcriptional repressor activity, RNA polymerase II distal enhancer sequence-specific binding(GO:0001206) |
| 0.1 | 0.2 | GO:0032190 | acrosin binding(GO:0032190) |
| 0.1 | 2.4 | GO:0016748 | succinyltransferase activity(GO:0016748) |
| 0.1 | 0.8 | GO:0034946 | 2-oxoglutaryl-CoA thioesterase activity(GO:0034843) 2,4,4-trimethyl-3-oxopentanoyl-CoA thioesterase activity(GO:0034869) 3-isopropylbut-3-enoyl-CoA thioesterase activity(GO:0034946) glutaryl-CoA hydrolase activity(GO:0044466) |
| 0.1 | 0.8 | GO:0015125 | bile acid transmembrane transporter activity(GO:0015125) |
| 0.1 | 0.1 | GO:0004887 | thyroid hormone receptor activity(GO:0004887) |
| 0.1 | 0.3 | GO:0042015 | interleukin-20 binding(GO:0042015) |
| 0.1 | 0.1 | GO:0048030 | disaccharide binding(GO:0048030) |
| 0.1 | 0.2 | GO:0004945 | angiotensin type II receptor activity(GO:0004945) |
| 0.1 | 0.3 | GO:0046624 | sphingolipid transporter activity(GO:0046624) |
| 0.1 | 0.2 | GO:0045134 | uridine-diphosphatase activity(GO:0045134) |
| 0.1 | 0.2 | GO:0016802 | adenosylhomocysteinase activity(GO:0004013) trialkylsulfonium hydrolase activity(GO:0016802) |
| 0.1 | 1.3 | GO:0004683 | calmodulin-dependent protein kinase activity(GO:0004683) |
| 0.1 | 0.6 | GO:0034450 | ubiquitin-ubiquitin ligase activity(GO:0034450) |
| 0.1 | 0.2 | GO:0016899 | oxidoreductase activity, acting on the CH-OH group of donors, oxygen as acceptor(GO:0016899) |
| 0.1 | 0.8 | GO:0001848 | complement binding(GO:0001848) |
| 0.1 | 0.4 | GO:0031730 | CCR5 chemokine receptor binding(GO:0031730) |
| 0.1 | 0.2 | GO:0047023 | androsterone dehydrogenase activity(GO:0047023) |
| 0.1 | 1.9 | GO:0017112 | Rab guanyl-nucleotide exchange factor activity(GO:0017112) |
| 0.1 | 0.3 | GO:0019788 | NEDD8 transferase activity(GO:0019788) |
| 0.1 | 0.4 | GO:0000339 | RNA cap binding(GO:0000339) |
| 0.1 | 0.4 | GO:0003688 | DNA replication origin binding(GO:0003688) |
| 0.1 | 0.4 | GO:0035473 | lipase binding(GO:0035473) |
| 0.1 | 0.3 | GO:0042809 | vitamin D receptor binding(GO:0042809) |
| 0.1 | 0.1 | GO:0032558 | adenyl deoxyribonucleotide binding(GO:0032558) |
| 0.1 | 0.9 | GO:0000993 | RNA polymerase II core binding(GO:0000993) |
| 0.1 | 0.6 | GO:0008195 | phosphatidate phosphatase activity(GO:0008195) |
| 0.1 | 0.4 | GO:0051864 | histone demethylase activity (H3-K36 specific)(GO:0051864) |
| 0.1 | 0.2 | GO:0008475 | procollagen-lysine 5-dioxygenase activity(GO:0008475) |
| 0.1 | 1.0 | GO:0005070 | SH3/SH2 adaptor activity(GO:0005070) |
| 0.1 | 0.9 | GO:1990841 | promoter-specific chromatin binding(GO:1990841) |
| 0.1 | 0.2 | GO:0033192 | calmodulin-dependent protein phosphatase activity(GO:0033192) |
| 0.1 | 0.4 | GO:0018655 | 3-(3-hydroxyphenyl)propionate hydroxylase activity(GO:0008688) 4-chlorobenzaldehyde oxidase activity(GO:0018471) 3,5-xylenol methylhydroxylase activity(GO:0018630) phenylacetate hydroxylase activity(GO:0018631) 4-nitrophenol 4-monooxygenase activity(GO:0018632) dimethyl sulfide monooxygenase activity(GO:0018633) alpha-pinene monooxygenase [NADH] activity(GO:0018634) phenanthrene 9,10-monooxygenase activity(GO:0018636) 1-hydroxy-2-naphthoate hydroxylase activity(GO:0018637) toluene 4-monooxygenase activity(GO:0018638) xylene monooxygenase activity(GO:0018639) dibenzothiophene monooxygenase activity(GO:0018640) 6-hydroxy-3-methyl-2-oxo-1,2-dihydroquinoline 6-monooxygenase activity(GO:0018641) chlorophenol 4-monooxygenase activity(GO:0018642) carbon disulfide oxygenase activity(GO:0018643) toluene 2-monooxygenase activity(GO:0018644) 1-hydroxy-2-oxolimonene 1,2-monooxygenase activity(GO:0018646) phenanthrene 1,2-monooxygenase activity(GO:0018647) tetrahydrofuran hydroxylase activity(GO:0018649) styrene monooxygenase activity(GO:0018650) toluene-4-sulfonate monooxygenase activity(GO:0018651) toluene-sulfonate methyl-monooxygenase activity(GO:0018652) 3-methyl-2-oxo-1,2-dihydroquinoline 6-monooxygenase activity(GO:0018653) 2-hydroxy-phenylacetate hydroxylase activity(GO:0018654) 2-oxo-delta3-4,5,5-trimethylcyclopentenylacetyl-CoA 1,2-monooxygenase activity(GO:0018655) phenanthrene 3,4-monooxygenase activity(GO:0018656) toluene 3-monooxygenase activity(GO:0018657) 4-hydroxyphenylacetate,NADH:oxygen oxidoreductase (3-hydroxylating) activity(GO:0018660) limonene monooxygenase activity(GO:0019113) 2-methylnaphthalene hydroxylase activity(GO:0034526) 1-methylnaphthalene hydroxylase activity(GO:0034534) bisphenol A hydroxylase A activity(GO:0034560) salicylate 5-hydroxylase activity(GO:0034785) isobutylamine N-hydroxylase activity(GO:0034791) branched-chain dodecylbenzene sulfonate monooxygenase activity(GO:0034802) 3-HSA hydroxylase activity(GO:0034819) 4-hydroxypyridine-3-hydroxylase activity(GO:0034894) 2-octaprenyl-3-methyl-6-methoxy-1,4-benzoquinol hydroxylase activity(GO:0043719) 6-hydroxynicotinate 3-monooxygenase activity(GO:0043731) thalianol hydroxylase activity(GO:0080014) |
| 0.1 | 1.3 | GO:0016676 | cytochrome-c oxidase activity(GO:0004129) heme-copper terminal oxidase activity(GO:0015002) oxidoreductase activity, acting on a heme group of donors, oxygen as acceptor(GO:0016676) |
| 0.1 | 0.3 | GO:0010997 | anaphase-promoting complex binding(GO:0010997) |
| 0.1 | 0.1 | GO:0031852 | mu-type opioid receptor binding(GO:0031852) |
| 0.1 | 0.1 | GO:0036435 | K48-linked polyubiquitin binding(GO:0036435) |
| 0.1 | 0.3 | GO:0004758 | serine C-palmitoyltransferase activity(GO:0004758) |
| 0.1 | 0.2 | GO:0017108 | 5'-flap endonuclease activity(GO:0017108) |
| 0.1 | 0.1 | GO:0004468 | lysine N-acetyltransferase activity, acting on acetyl phosphate as donor(GO:0004468) |
| 0.1 | 0.1 | GO:0032422 | purine-rich negative regulatory element binding(GO:0032422) |
| 0.1 | 0.2 | GO:0008853 | exodeoxyribonuclease III activity(GO:0008853) |
| 0.1 | 0.1 | GO:0061676 | importin-alpha family protein binding(GO:0061676) |
| 0.1 | 0.1 | GO:0034617 | tetrahydrobiopterin binding(GO:0034617) |
| 0.1 | 0.2 | GO:0001055 | RNA polymerase II activity(GO:0001055) |
| 0.1 | 0.6 | GO:0004697 | protein kinase C activity(GO:0004697) |
| 0.1 | 0.4 | GO:0034821 | pinocarveol dehydrogenase activity(GO:0018446) chloral hydrate dehydrogenase activity(GO:0018447) hydroxymethylmethylsilanediol oxidase activity(GO:0018448) 1-phenylethanol dehydrogenase activity(GO:0018449) myrtenol dehydrogenase activity(GO:0018450) cis-1,2-dihydroxy-1,2-dihydro-8-carboxynaphthalene dehydrogenase activity(GO:0034522) 3-hydroxy-4-methyloctanoyl-CoA dehydrogenase activity(GO:0034582) 2-hydroxy-4-isopropenylcyclohexane-1-carboxyl-CoA dehydrogenase activity(GO:0034778) cis-9,10-dihydroanthracene-9,10-diol dehydrogenase activity(GO:0034817) citronellol dehydrogenase activity(GO:0034821) naphthyl-2-hydroxymethyl-succinyl-CoA dehydrogenase activity(GO:0034847) 2,4,4-trimethyl-1-pentanol dehydrogenase activity(GO:0034863) 2,4,4-trimethyl-3-hydroxypentanoyl-CoA dehydrogenase activity(GO:0034868) 1-hydroxy-4,4-dimethylpentan-3-one dehydrogenase activity(GO:0034871) endosulfan diol dehydrogenase activity(GO:0034891) endosulfan hydroxyether dehydrogenase activity(GO:0034901) 3-hydroxy-2-methylhexanoyl-CoA dehydrogenase activity(GO:0034918) 3-hydroxy-2,6-dimethyl-5-methylene-heptanoyl-CoA dehydrogenase activity(GO:0034944) versicolorin reductase activity(GO:0042469) ketoreductase activity(GO:0045703) |
| 0.1 | 0.2 | GO:0004749 | ribose phosphate diphosphokinase activity(GO:0004749) |
| 0.1 | 0.2 | GO:0016833 | oxo-acid-lyase activity(GO:0016833) |
| 0.1 | 0.1 | GO:0004115 | 3',5'-cyclic-AMP phosphodiesterase activity(GO:0004115) |
| 0.1 | 0.2 | GO:0031826 | type 2A serotonin receptor binding(GO:0031826) |
| 0.1 | 0.5 | GO:0031386 | protein tag(GO:0031386) |
| 0.1 | 0.1 | GO:0010485 | H4 histone acetyltransferase activity(GO:0010485) |
| 0.1 | 0.8 | GO:0004629 | phospholipase C activity(GO:0004629) |
| 0.1 | 1.6 | GO:0005484 | SNAP receptor activity(GO:0005484) |
| 0.1 | 0.6 | GO:0051787 | misfolded protein binding(GO:0051787) |
| 0.1 | 0.2 | GO:0022833 | mechanically-gated ion channel activity(GO:0008381) mechanically gated channel activity(GO:0022833) |
| 0.1 | 0.3 | GO:0003847 | 1-alkyl-2-acetylglycerophosphocholine esterase activity(GO:0003847) |
| 0.1 | 0.4 | GO:0008932 | lytic endotransglycosylase activity(GO:0008932) |
| 0.1 | 0.1 | GO:0051430 | corticotropin-releasing hormone receptor 1 binding(GO:0051430) |
| 0.1 | 0.2 | GO:0035529 | NADH pyrophosphatase activity(GO:0035529) |
| 0.1 | 0.7 | GO:0008253 | 5'-nucleotidase activity(GO:0008253) |
| 0.1 | 0.1 | GO:0016662 | oxidoreductase activity, acting on other nitrogenous compounds as donors, cytochrome as acceptor(GO:0016662) |
| 0.1 | 0.4 | GO:0030306 | ADP-ribosylation factor binding(GO:0030306) |
| 0.1 | 0.4 | GO:0000150 | recombinase activity(GO:0000150) |
| 0.1 | 1.8 | GO:0030145 | manganese ion binding(GO:0030145) |
| 0.1 | 0.2 | GO:0050567 | glutaminyl-tRNA synthase (glutamine-hydrolyzing) activity(GO:0050567) |
| 0.1 | 0.2 | GO:0070699 | type II activin receptor binding(GO:0070699) |
| 0.1 | 0.4 | GO:0035005 | 1-phosphatidylinositol-4-phosphate 3-kinase activity(GO:0035005) |
| 0.1 | 1.1 | GO:0008139 | nuclear localization sequence binding(GO:0008139) |
| 0.1 | 1.1 | GO:0043014 | alpha-tubulin binding(GO:0043014) |
| 0.1 | 0.2 | GO:0061731 | ribonucleoside-diphosphate reductase activity, thioredoxin disulfide as acceptor(GO:0004748) oxidoreductase activity, acting on CH or CH2 groups, disulfide as acceptor(GO:0016728) ribonucleoside-diphosphate reductase activity(GO:0061731) |
| 0.1 | 0.2 | GO:0008443 | phosphofructokinase activity(GO:0008443) |
| 0.1 | 0.2 | GO:0017176 | phosphatidylinositol N-acetylglucosaminyltransferase activity(GO:0017176) |
| 0.1 | 0.2 | GO:0051379 | epinephrine binding(GO:0051379) |
| 0.1 | 1.3 | GO:0016655 | oxidoreductase activity, acting on NAD(P)H, quinone or similar compound as acceptor(GO:0016655) |
| 0.1 | 0.4 | GO:0001094 | TFIID-class transcription factor binding(GO:0001094) |
| 0.1 | 0.2 | GO:0015232 | heme transporter activity(GO:0015232) |
| 0.1 | 0.3 | GO:0004769 | steroid delta-isomerase activity(GO:0004769) |
| 0.1 | 1.3 | GO:0016799 | hydrolase activity, hydrolyzing N-glycosyl compounds(GO:0016799) |
| 0.1 | 0.6 | GO:0008308 | voltage-gated anion channel activity(GO:0008308) |
| 0.0 | 0.4 | GO:0003691 | double-stranded telomeric DNA binding(GO:0003691) |
| 0.0 | 0.3 | GO:0045505 | dynein intermediate chain binding(GO:0045505) |
| 0.0 | 0.5 | GO:0046977 | TAP binding(GO:0046977) |
| 0.0 | 0.0 | GO:0050508 | glucuronosyl-N-acetylglucosaminyl-proteoglycan 4-alpha-N-acetylglucosaminyltransferase activity(GO:0050508) |
| 0.0 | 0.1 | GO:0004605 | phosphatidate cytidylyltransferase activity(GO:0004605) |
| 0.0 | 0.2 | GO:0016888 | endodeoxyribonuclease activity, producing 5'-phosphomonoesters(GO:0016888) |
| 0.0 | 0.5 | GO:0004176 | ATP-dependent peptidase activity(GO:0004176) |
| 0.0 | 0.1 | GO:0008147 | structural constituent of bone(GO:0008147) |
| 0.0 | 0.2 | GO:0035497 | cAMP response element binding(GO:0035497) |
| 0.0 | 0.2 | GO:0043426 | MRF binding(GO:0043426) |
| 0.0 | 0.3 | GO:0004439 | phosphatidylinositol-4,5-bisphosphate 5-phosphatase activity(GO:0004439) |
| 0.0 | 0.2 | GO:0004075 | biotin carboxylase activity(GO:0004075) |
| 0.0 | 0.2 | GO:0030346 | protein phosphatase 2B binding(GO:0030346) |
| 0.0 | 0.1 | GO:1990050 | phosphatidic acid transporter activity(GO:1990050) |
| 0.0 | 0.2 | GO:0098821 | BMP receptor activity(GO:0098821) |
| 0.0 | 0.2 | GO:1990380 | Lys48-specific deubiquitinase activity(GO:1990380) |
| 0.0 | 0.2 | GO:0034235 | GPI anchor binding(GO:0034235) |
| 0.0 | 0.6 | GO:0046703 | natural killer cell lectin-like receptor binding(GO:0046703) |
| 0.0 | 0.2 | GO:0008379 | thioredoxin peroxidase activity(GO:0008379) |
| 0.0 | 0.4 | GO:0017160 | Ral GTPase binding(GO:0017160) |
| 0.0 | 0.1 | GO:0035514 | DNA demethylase activity(GO:0035514) |
| 0.0 | 0.2 | GO:0016274 | arginine N-methyltransferase activity(GO:0016273) protein-arginine N-methyltransferase activity(GO:0016274) |
| 0.0 | 0.1 | GO:0043891 | glyceraldehyde-3-phosphate dehydrogenase (NAD+) (phosphorylating) activity(GO:0004365) glyceraldehyde-3-phosphate dehydrogenase (NAD(P)+) (phosphorylating) activity(GO:0043891) |
| 0.0 | 0.2 | GO:0035325 | Toll-like receptor binding(GO:0035325) |
| 0.0 | 0.2 | GO:0032454 | histone demethylase activity (H3-K9 specific)(GO:0032454) |
| 0.0 | 0.0 | GO:0097200 | cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:0097200) |
| 0.0 | 0.7 | GO:0015095 | magnesium ion transmembrane transporter activity(GO:0015095) |
| 0.0 | 0.2 | GO:0046923 | ER retention sequence binding(GO:0046923) |
| 0.0 | 0.1 | GO:0004814 | arginine-tRNA ligase activity(GO:0004814) |
| 0.0 | 0.1 | GO:0005025 | transforming growth factor beta receptor activity, type I(GO:0005025) |
| 0.0 | 0.4 | GO:0042500 | aspartic endopeptidase activity, intramembrane cleaving(GO:0042500) |
| 0.0 | 0.2 | GO:0031628 | opioid receptor binding(GO:0031628) |
| 0.0 | 0.1 | GO:0071532 | ankyrin repeat binding(GO:0071532) |
| 0.0 | 0.3 | GO:0050733 | RS domain binding(GO:0050733) |
| 0.0 | 0.1 | GO:0019870 | potassium channel inhibitor activity(GO:0019870) |
| 0.0 | 0.9 | GO:0004198 | calcium-dependent cysteine-type endopeptidase activity(GO:0004198) |
| 0.0 | 0.9 | GO:0005385 | zinc ion transmembrane transporter activity(GO:0005385) |
| 0.0 | 0.1 | GO:0005157 | macrophage colony-stimulating factor receptor binding(GO:0005157) |
| 0.0 | 0.2 | GO:0003708 | retinoic acid receptor activity(GO:0003708) |
| 0.0 | 0.3 | GO:0030296 | protein tyrosine kinase activator activity(GO:0030296) |
| 0.0 | 0.1 | GO:0008429 | phosphatidylethanolamine binding(GO:0008429) |
| 0.0 | 0.2 | GO:0004985 | opioid receptor activity(GO:0004985) |
| 0.0 | 0.8 | GO:0070273 | phosphatidylinositol-4-phosphate binding(GO:0070273) |
| 0.0 | 1.9 | GO:0005544 | calcium-dependent phospholipid binding(GO:0005544) |
| 0.0 | 0.2 | GO:0005113 | patched binding(GO:0005113) |
| 0.0 | 0.2 | GO:0004566 | beta-glucuronidase activity(GO:0004566) |
| 0.0 | 0.1 | GO:0050510 | N-acetylgalactosaminyl-proteoglycan 3-beta-glucuronosyltransferase activity(GO:0050510) |
| 0.0 | 0.3 | GO:0070300 | phosphatidic acid binding(GO:0070300) |
| 0.0 | 0.3 | GO:0005542 | folic acid binding(GO:0005542) |
| 0.0 | 0.3 | GO:1990446 | U1 snRNP binding(GO:1990446) |
| 0.0 | 0.0 | GO:0001884 | pyrimidine nucleoside binding(GO:0001884) |
| 0.0 | 1.6 | GO:0005160 | transforming growth factor beta receptor binding(GO:0005160) |
| 0.0 | 0.1 | GO:0008332 | low voltage-gated calcium channel activity(GO:0008332) |
| 0.0 | 0.1 | GO:0034511 | U3 snoRNA binding(GO:0034511) |
| 0.0 | 0.3 | GO:0035198 | miRNA binding(GO:0035198) |
| 0.0 | 0.2 | GO:0005134 | interleukin-2 receptor binding(GO:0005134) |
| 0.0 | 0.1 | GO:0004301 | epoxide hydrolase activity(GO:0004301) |
| 0.0 | 0.1 | GO:0070878 | primary miRNA binding(GO:0070878) |
| 0.0 | 0.4 | GO:0050321 | tau-protein kinase activity(GO:0050321) |
| 0.0 | 0.4 | GO:0036312 | phosphatidylinositol 3-kinase regulatory subunit binding(GO:0036312) |
| 0.0 | 0.1 | GO:0019797 | procollagen-proline 3-dioxygenase activity(GO:0019797) |
| 0.0 | 0.2 | GO:0032027 | myosin light chain binding(GO:0032027) |
| 0.0 | 0.0 | GO:0030160 | GKAP/Homer scaffold activity(GO:0030160) |
| 0.0 | 0.2 | GO:0004969 | histamine receptor activity(GO:0004969) |
| 0.0 | 0.5 | GO:0001205 | transcriptional activator activity, RNA polymerase II distal enhancer sequence-specific binding(GO:0001205) |
| 0.0 | 1.0 | GO:0051059 | NF-kappaB binding(GO:0051059) |
| 0.0 | 0.2 | GO:0045545 | syndecan binding(GO:0045545) |
| 0.0 | 0.1 | GO:0043175 | RNA polymerase core enzyme binding(GO:0043175) |
| 0.0 | 0.2 | GO:0042609 | CD4 receptor binding(GO:0042609) |
| 0.0 | 0.1 | GO:0016494 | C-X-C chemokine receptor activity(GO:0016494) |
| 0.0 | 0.2 | GO:0005250 | A-type (transient outward) potassium channel activity(GO:0005250) |
| 0.0 | 0.0 | GO:0003954 | NADH dehydrogenase activity(GO:0003954) |
| 0.0 | 0.3 | GO:0043425 | bHLH transcription factor binding(GO:0043425) |
| 0.0 | 0.0 | GO:0051920 | peroxiredoxin activity(GO:0051920) |
| 0.0 | 0.5 | GO:0002161 | aminoacyl-tRNA editing activity(GO:0002161) |
| 0.0 | 0.1 | GO:0015319 | sodium:inorganic phosphate symporter activity(GO:0015319) |
| 0.0 | 0.1 | GO:0019767 | IgE receptor activity(GO:0019767) |
| 0.0 | 0.1 | GO:0071558 | histone demethylase activity (H3-K27 specific)(GO:0071558) |
| 0.0 | 0.2 | GO:0005161 | platelet-derived growth factor receptor binding(GO:0005161) |
| 0.0 | 0.3 | GO:0008140 | cAMP response element binding protein binding(GO:0008140) |
| 0.0 | 0.1 | GO:0000104 | succinate dehydrogenase activity(GO:0000104) |
| 0.0 | 0.0 | GO:0035184 | histone threonine kinase activity(GO:0035184) |
| 0.0 | 0.4 | GO:0043274 | phospholipase binding(GO:0043274) |
| 0.0 | 0.2 | GO:0004994 | somatostatin receptor activity(GO:0004994) |
| 0.0 | 0.9 | GO:0030276 | clathrin binding(GO:0030276) |
| 0.0 | 0.7 | GO:0005031 | tumor necrosis factor-activated receptor activity(GO:0005031) death receptor activity(GO:0005035) |
| 0.0 | 0.3 | GO:0008266 | poly(U) RNA binding(GO:0008266) |
| 0.0 | 0.1 | GO:0008503 | benzodiazepine receptor activity(GO:0008503) |
| 0.0 | 0.5 | GO:0008601 | protein phosphatase type 2A regulator activity(GO:0008601) |
| 0.0 | 0.1 | GO:0004704 | NF-kappaB-inducing kinase activity(GO:0004704) |
| 0.0 | 0.2 | GO:0003857 | 3-hydroxyacyl-CoA dehydrogenase activity(GO:0003857) |
| 0.0 | 0.5 | GO:0009982 | pseudouridine synthase activity(GO:0009982) |
| 0.0 | 0.8 | GO:0098531 | RNA polymerase II transcription factor activity, ligand-activated sequence-specific DNA binding(GO:0004879) transcription factor activity, direct ligand regulated sequence-specific DNA binding(GO:0098531) |
| 0.0 | 0.2 | GO:0050681 | androgen receptor binding(GO:0050681) |
| 0.0 | 0.6 | GO:0001056 | RNA polymerase III activity(GO:0001056) |
| 0.0 | 0.2 | GO:0005138 | interleukin-6 receptor binding(GO:0005138) |
| 0.0 | 0.2 | GO:0086080 | protein binding involved in heterotypic cell-cell adhesion(GO:0086080) |
| 0.0 | 0.1 | GO:0008410 | CoA-transferase activity(GO:0008410) |
| 0.0 | 0.1 | GO:0043184 | vascular endothelial growth factor receptor 2 binding(GO:0043184) |
| 0.0 | 0.1 | GO:0001758 | retinal dehydrogenase activity(GO:0001758) |
| 0.0 | 0.2 | GO:0008467 | [heparan sulfate]-glucosamine 3-sulfotransferase 1 activity(GO:0008467) |
| 0.0 | 0.2 | GO:0004826 | phenylalanine-tRNA ligase activity(GO:0004826) |
| 0.0 | 0.0 | GO:0043125 | ErbB-3 class receptor binding(GO:0043125) |
| 0.0 | 0.2 | GO:0043522 | leucine zipper domain binding(GO:0043522) |
| 0.0 | 0.1 | GO:0016004 | phospholipase activator activity(GO:0016004) |
| 0.0 | 0.2 | GO:0098639 | collagen binding involved in cell-matrix adhesion(GO:0098639) |
| 0.0 | 0.7 | GO:0017147 | Wnt-protein binding(GO:0017147) |
| 0.0 | 1.1 | GO:0005109 | frizzled binding(GO:0005109) |
| 0.0 | 0.1 | GO:0016174 | NAD(P)H oxidase activity(GO:0016174) |
| 0.0 | 0.4 | GO:0008327 | methyl-CpG binding(GO:0008327) |
| 0.0 | 2.8 | GO:0017124 | SH3 domain binding(GO:0017124) |
| 0.0 | 0.1 | GO:0003917 | DNA topoisomerase type I activity(GO:0003917) |
| 0.0 | 0.1 | GO:0005384 | manganese ion transmembrane transporter activity(GO:0005384) |
| 0.0 | 1.9 | GO:0003777 | microtubule motor activity(GO:0003777) |
| 0.0 | 0.3 | GO:0005451 | monovalent cation:proton antiporter activity(GO:0005451) |
| 0.0 | 0.1 | GO:0050815 | phosphoserine binding(GO:0050815) |
| 0.0 | 0.3 | GO:0045295 | gamma-catenin binding(GO:0045295) |
| 0.0 | 0.2 | GO:1990459 | transferrin receptor binding(GO:1990459) |
| 0.0 | 0.1 | GO:0003829 | beta-1,3-galactosyl-O-glycosyl-glycoprotein beta-1,6-N-acetylglucosaminyltransferase activity(GO:0003829) |
| 0.0 | 0.3 | GO:0070063 | RNA polymerase binding(GO:0070063) |
| 0.0 | 0.1 | GO:0043559 | insulin binding(GO:0043559) |
| 0.0 | 0.0 | GO:0001846 | opsonin binding(GO:0001846) |
| 0.0 | 0.0 | GO:0051880 | G-quadruplex DNA binding(GO:0051880) |
| 0.0 | 0.1 | GO:0005094 | Rho GDP-dissociation inhibitor activity(GO:0005094) |
| 0.0 | 0.3 | GO:0016634 | oxidoreductase activity, acting on the CH-CH group of donors, oxygen as acceptor(GO:0016634) |
| 0.0 | 0.1 | GO:0000171 | ribonuclease MRP activity(GO:0000171) |
| 0.0 | 0.0 | GO:0004741 | [pyruvate dehydrogenase (lipoamide)] phosphatase activity(GO:0004741) |
| 0.0 | 0.1 | GO:0016715 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, reduced ascorbate as one donor, and incorporation of one atom of oxygen(GO:0016715) |
| 0.0 | 0.4 | GO:0004993 | G-protein coupled serotonin receptor activity(GO:0004993) serotonin receptor activity(GO:0099589) |
| 0.0 | 0.2 | GO:0043008 | ATP-dependent protein binding(GO:0043008) |
| 0.0 | 1.5 | GO:0031490 | chromatin DNA binding(GO:0031490) |
| 0.0 | 0.1 | GO:0005087 | Ran guanyl-nucleotide exchange factor activity(GO:0005087) |
| 0.0 | 0.0 | GO:0035939 | microsatellite binding(GO:0035939) |
| 0.0 | 0.1 | GO:0008401 | retinoic acid 4-hydroxylase activity(GO:0008401) |
| 0.0 | 0.5 | GO:0005527 | macrolide binding(GO:0005527) FK506 binding(GO:0005528) |
| 0.0 | 0.0 | GO:0051723 | protein methylesterase activity(GO:0051723) |
| 0.0 | 0.8 | GO:0030971 | receptor tyrosine kinase binding(GO:0030971) |
| 0.0 | 0.2 | GO:0035174 | histone serine kinase activity(GO:0035174) |
| 0.0 | 0.2 | GO:0016615 | malate dehydrogenase activity(GO:0016615) |
| 0.0 | 0.1 | GO:0030519 | snoRNP binding(GO:0030519) |
| 0.0 | 0.1 | GO:0031014 | troponin T binding(GO:0031014) |
| 0.0 | 0.1 | GO:0003831 | beta-N-acetylglucosaminylglycopeptide beta-1,4-galactosyltransferase activity(GO:0003831) |
| 0.0 | 0.1 | GO:0019976 | interleukin-2 binding(GO:0019976) |
| 0.0 | 0.1 | GO:0033300 | dehydroascorbic acid transporter activity(GO:0033300) |
| 0.0 | 0.1 | GO:0003987 | acetate-CoA ligase activity(GO:0003987) |
| 0.0 | 0.1 | GO:1990932 | 5.8S rRNA binding(GO:1990932) |
| 0.0 | 0.0 | GO:0097001 | ceramide binding(GO:0097001) |
| 0.0 | 0.8 | GO:0001102 | RNA polymerase II activating transcription factor binding(GO:0001102) |
| 0.0 | 0.1 | GO:0016885 | CoA carboxylase activity(GO:0016421) ligase activity, forming carbon-carbon bonds(GO:0016885) |
| 0.0 | 0.3 | GO:0017056 | structural constituent of nuclear pore(GO:0017056) |
| 0.0 | 0.0 | GO:0030942 | endoplasmic reticulum signal peptide binding(GO:0030942) |
| 0.0 | 0.4 | GO:0016504 | peptidase activator activity(GO:0016504) |
| 0.0 | 2.5 | GO:0004222 | metalloendopeptidase activity(GO:0004222) |
| 0.0 | 0.0 | GO:0016414 | O-octanoyltransferase activity(GO:0016414) |
| 0.0 | 0.1 | GO:0050072 | m7G(5')pppN diphosphatase activity(GO:0050072) |
| 0.0 | 0.2 | GO:0016861 | intramolecular oxidoreductase activity, interconverting aldoses and ketoses(GO:0016861) |
| 0.0 | 0.0 | GO:0016415 | octanoyltransferase activity(GO:0016415) |
| 0.0 | 0.2 | GO:0050291 | sphingosine N-acyltransferase activity(GO:0050291) |
| 0.0 | 0.1 | GO:0046974 | histone methyltransferase activity (H3-K9 specific)(GO:0046974) |
| 0.0 | 0.5 | GO:0016859 | cis-trans isomerase activity(GO:0016859) |
| 0.0 | 0.0 | GO:0017153 | sodium:dicarboxylate symporter activity(GO:0017153) |
| 0.0 | 0.5 | GO:0005154 | epidermal growth factor receptor binding(GO:0005154) |
| 0.0 | 0.3 | GO:0000175 | 3'-5'-exoribonuclease activity(GO:0000175) exoribonuclease activity, producing 5'-phosphomonoesters(GO:0016896) |
| 0.0 | 0.0 | GO:0097108 | smoothened binding(GO:0005119) hedgehog family protein binding(GO:0097108) |
| 0.0 | 0.0 | GO:0003696 | satellite DNA binding(GO:0003696) |
| 0.0 | 0.2 | GO:0008409 | 5'-3' exonuclease activity(GO:0008409) |
| 0.0 | 0.5 | GO:0034792 | sulfonate dioxygenase activity(GO:0000907) 2,4-dichlorophenoxyacetate alpha-ketoglutarate dioxygenase activity(GO:0018602) hypophosphite dioxygenase activity(GO:0034792) DNA-N1-methyladenine dioxygenase activity(GO:0043734) gibberellin 2-beta-dioxygenase activity(GO:0045543) C-19 gibberellin 2-beta-dioxygenase activity(GO:0052634) C-20 gibberellin 2-beta-dioxygenase activity(GO:0052635) |
| 0.0 | 0.5 | GO:0031489 | myosin V binding(GO:0031489) |
| 0.0 | 0.1 | GO:0015349 | thyroid hormone transmembrane transporter activity(GO:0015349) |
| 0.0 | 0.2 | GO:0000980 | RNA polymerase II distal enhancer sequence-specific DNA binding(GO:0000980) |
| 0.0 | 0.1 | GO:0043495 | protein anchor(GO:0043495) |
| 0.0 | 0.1 | GO:0042577 | lipid phosphatase activity(GO:0042577) |
| 0.0 | 0.3 | GO:0005123 | death receptor binding(GO:0005123) |
| 0.0 | 0.8 | GO:0008170 | N-methyltransferase activity(GO:0008170) |
| 0.0 | 0.3 | GO:0070577 | lysine-acetylated histone binding(GO:0070577) |
| 0.0 | 0.6 | GO:0097472 | cyclin-dependent protein serine/threonine kinase activity(GO:0004693) cyclin-dependent protein kinase activity(GO:0097472) |
| 0.0 | 0.1 | GO:0070052 | collagen V binding(GO:0070052) |
| 0.0 | 0.5 | GO:0001103 | RNA polymerase II repressing transcription factor binding(GO:0001103) |
| 0.0 | 0.1 | GO:0034584 | piRNA binding(GO:0034584) |
| 0.0 | 0.1 | GO:0043546 | molybdopterin cofactor binding(GO:0043546) |
| 0.0 | 0.2 | GO:0048038 | quinone binding(GO:0048038) |
| 0.0 | 0.5 | GO:0000979 | RNA polymerase II core promoter sequence-specific DNA binding(GO:0000979) |
| 0.0 | 0.1 | GO:0016920 | pyroglutamyl-peptidase activity(GO:0016920) |
| 0.0 | 0.1 | GO:0015215 | nucleotide transmembrane transporter activity(GO:0015215) |
| 0.0 | 0.4 | GO:0042169 | SH2 domain binding(GO:0042169) |
| 0.0 | 1.2 | GO:0051536 | iron-sulfur cluster binding(GO:0051536) metal cluster binding(GO:0051540) |
| 0.0 | 0.1 | GO:0001135 | transcription factor activity, RNA polymerase II transcription factor recruiting(GO:0001135) |
| 0.0 | 0.6 | GO:0043394 | proteoglycan binding(GO:0043394) |
| 0.0 | 0.1 | GO:0005111 | type 2 fibroblast growth factor receptor binding(GO:0005111) |
| 0.0 | 0.2 | GO:0070064 | proline-rich region binding(GO:0070064) |
| 0.0 | 0.4 | GO:0003950 | NAD+ ADP-ribosyltransferase activity(GO:0003950) |
| 0.0 | 0.1 | GO:0005502 | 11-cis retinal binding(GO:0005502) |
| 0.0 | 0.2 | GO:0031957 | very long-chain fatty acid-CoA ligase activity(GO:0031957) |
| 0.0 | 0.1 | GO:0030280 | structural constituent of epidermis(GO:0030280) |
| 0.0 | 0.1 | GO:0030628 | pre-mRNA 3'-splice site binding(GO:0030628) |
| 0.0 | 0.1 | GO:0031419 | cobalamin binding(GO:0031419) |
| 0.0 | 0.3 | GO:0017075 | syntaxin-1 binding(GO:0017075) |
| 0.0 | 0.0 | GO:0008425 | C-methyltransferase activity(GO:0008169) 2-polyprenyl-6-methoxy-1,4-benzoquinone methyltransferase activity(GO:0008425) quinone cofactor methyltransferase activity(GO:0030580) |
| 0.0 | 0.3 | GO:0030331 | estrogen receptor binding(GO:0030331) |
| 0.0 | 0.0 | GO:0032405 | MutLalpha complex binding(GO:0032405) |
| 0.0 | 0.1 | GO:0035612 | AP-2 adaptor complex binding(GO:0035612) |
| 0.0 | 0.2 | GO:0042162 | telomeric DNA binding(GO:0042162) |
| 0.0 | 0.1 | GO:0048495 | Roundabout binding(GO:0048495) |
| 0.0 | 0.0 | GO:0016532 | superoxide dismutase copper chaperone activity(GO:0016532) |
| 0.0 | 0.1 | GO:0005166 | neurotrophin p75 receptor binding(GO:0005166) |
| 0.0 | 0.3 | GO:0071837 | HMG box domain binding(GO:0071837) |
| 0.0 | 0.1 | GO:0004652 | polynucleotide adenylyltransferase activity(GO:0004652) |
| 0.0 | 0.5 | GO:0016702 | oxidoreductase activity, acting on single donors with incorporation of molecular oxygen, incorporation of two atoms of oxygen(GO:0016702) |
| 0.0 | 0.1 | GO:0070742 | C2H2 zinc finger domain binding(GO:0070742) |
| 0.0 | 1.9 | GO:0008173 | RNA methyltransferase activity(GO:0008173) |
| 0.0 | 0.1 | GO:0016742 | hydroxymethyl-, formyl- and related transferase activity(GO:0016742) |
| 0.0 | 0.6 | GO:0043621 | protein self-association(GO:0043621) |
| 0.0 | 0.2 | GO:0015271 | outward rectifier potassium channel activity(GO:0015271) |
| 0.0 | 0.2 | GO:0030332 | cyclin binding(GO:0030332) |
| 0.0 | 0.1 | GO:0097602 | cullin family protein binding(GO:0097602) |
| 0.0 | 0.0 | GO:0070700 | BMP receptor binding(GO:0070700) |
| 0.0 | 0.9 | GO:0004197 | cysteine-type endopeptidase activity(GO:0004197) |
| 0.0 | 0.1 | GO:0008251 | tRNA-specific adenosine deaminase activity(GO:0008251) |
| 0.0 | 0.2 | GO:0015168 | glycerol transmembrane transporter activity(GO:0015168) glycerol channel activity(GO:0015254) |
| 0.0 | 0.2 | GO:0030515 | snoRNA binding(GO:0030515) |
| 0.0 | 0.2 | GO:0008641 | small protein activating enzyme activity(GO:0008641) |
| 0.0 | 0.1 | GO:0004965 | G-protein coupled GABA receptor activity(GO:0004965) |
| 0.0 | 0.1 | GO:0016936 | galactoside binding(GO:0016936) |
| 0.0 | 0.1 | GO:0042284 | sphingolipid delta-4 desaturase activity(GO:0042284) |
| 0.0 | 0.1 | GO:0004861 | cyclin-dependent protein serine/threonine kinase inhibitor activity(GO:0004861) |
| 0.0 | 0.2 | GO:0051011 | microtubule minus-end binding(GO:0051011) |
| 0.0 | 0.3 | GO:0071889 | 14-3-3 protein binding(GO:0071889) |
| 0.0 | 0.2 | GO:0016857 | racemase and epimerase activity, acting on carbohydrates and derivatives(GO:0016857) |
| 0.0 | 0.1 | GO:0005487 | nucleocytoplasmic transporter activity(GO:0005487) |
| 0.0 | 0.3 | GO:0001106 | RNA polymerase II transcription corepressor activity(GO:0001106) |
| 0.0 | 0.1 | GO:0004430 | 1-phosphatidylinositol 4-kinase activity(GO:0004430) |
| 0.0 | 0.0 | GO:0001591 | dopamine neurotransmitter receptor activity, coupled via Gi/Go(GO:0001591) |
| 0.0 | 0.1 | GO:0004571 | mannosyl-oligosaccharide 1,2-alpha-mannosidase activity(GO:0004571) |
| 0.0 | 0.1 | GO:0010521 | telomerase inhibitor activity(GO:0010521) |
| 0.0 | 0.1 | GO:0004366 | glycerol-3-phosphate O-acyltransferase activity(GO:0004366) |
| 0.0 | 0.3 | GO:0001594 | trace-amine receptor activity(GO:0001594) |
| 0.0 | 0.1 | GO:0004967 | glucagon receptor activity(GO:0004967) |
| 0.0 | 0.1 | GO:0004060 | arylamine N-acetyltransferase activity(GO:0004060) |
| 0.0 | 0.2 | GO:0008568 | microtubule-severing ATPase activity(GO:0008568) |
| 0.0 | 0.5 | GO:0008536 | Ran GTPase binding(GO:0008536) |
| 0.0 | 0.1 | GO:0015321 | sodium-dependent phosphate transmembrane transporter activity(GO:0015321) |
| 0.0 | 0.8 | GO:0004722 | protein serine/threonine phosphatase activity(GO:0004722) |
| 0.0 | 0.0 | GO:0010314 | phosphatidylinositol-5-phosphate binding(GO:0010314) |
| 0.0 | 0.2 | GO:0015026 | coreceptor activity(GO:0015026) |
| 0.0 | 0.1 | GO:0004668 | protein-arginine deiminase activity(GO:0004668) |
| 0.0 | 0.1 | GO:0003876 | AMP deaminase activity(GO:0003876) adenosine-phosphate deaminase activity(GO:0047623) |
| 0.0 | 1.0 | GO:0019843 | rRNA binding(GO:0019843) |
| 0.0 | 0.0 | GO:0047499 | calcium-independent phospholipase A2 activity(GO:0047499) |
| 0.0 | 0.6 | GO:0061650 | ubiquitin conjugating enzyme activity(GO:0061631) ubiquitin-like protein conjugating enzyme activity(GO:0061650) |
| 0.0 | 0.0 | GO:0015111 | iodide transmembrane transporter activity(GO:0015111) |
| 0.0 | 0.2 | GO:0004383 | guanylate cyclase activity(GO:0004383) |
| 0.0 | 0.1 | GO:0008808 | cardiolipin synthase activity(GO:0008808) phosphatidyltransferase activity(GO:0030572) |
| 0.0 | 0.4 | GO:0003887 | DNA-directed DNA polymerase activity(GO:0003887) |
| 0.0 | 0.3 | GO:0005086 | ARF guanyl-nucleotide exchange factor activity(GO:0005086) |
| 0.0 | 0.0 | GO:0005072 | transforming growth factor beta receptor, cytoplasmic mediator activity(GO:0005072) |
| 0.0 | 0.1 | GO:0086008 | voltage-gated potassium channel activity involved in cardiac muscle cell action potential repolarization(GO:0086008) |
| 0.0 | 0.0 | GO:0051378 | serotonin binding(GO:0051378) |
| 0.0 | 0.3 | GO:0004712 | protein serine/threonine/tyrosine kinase activity(GO:0004712) |
| 0.0 | 0.1 | GO:0070402 | NADPH binding(GO:0070402) |
| 0.0 | 0.0 | GO:0005280 | hydrogen:amino acid symporter activity(GO:0005280) |
| 0.0 | 0.1 | GO:0004045 | aminoacyl-tRNA hydrolase activity(GO:0004045) |
| 0.0 | 0.1 | GO:0004505 | phenylalanine 4-monooxygenase activity(GO:0004505) |
| 0.0 | 0.4 | GO:0019706 | protein-cysteine S-palmitoyltransferase activity(GO:0019706) |
| 0.0 | 0.5 | GO:0031624 | ubiquitin conjugating enzyme binding(GO:0031624) |
| 0.0 | 0.2 | GO:0016500 | protein-hormone receptor activity(GO:0016500) |
| 0.0 | 0.2 | GO:0016893 | endoribonuclease activity, producing 5'-phosphomonoesters(GO:0016891) endonuclease activity, active with either ribo- or deoxyribonucleic acids and producing 5'-phosphomonoesters(GO:0016893) |
| 0.0 | 0.1 | GO:0004565 | beta-galactosidase activity(GO:0004565) |
| 0.0 | 0.1 | GO:0016922 | ligand-dependent nuclear receptor binding(GO:0016922) |
| 0.0 | 0.1 | GO:0004791 | thioredoxin-disulfide reductase activity(GO:0004791) |
| 0.0 | 0.1 | GO:0019206 | nucleoside kinase activity(GO:0019206) |
| 0.0 | 0.0 | GO:0047756 | chondroitin 4-sulfotransferase activity(GO:0047756) |
| 0.0 | 0.1 | GO:0052724 | inositol hexakisphosphate kinase activity(GO:0000828) inositol hexakisphosphate 5-kinase activity(GO:0000832) inositol hexakisphosphate 1-kinase activity(GO:0052723) inositol hexakisphosphate 3-kinase activity(GO:0052724) |
| 0.0 | 0.0 | GO:0070538 | oleic acid binding(GO:0070538) |
| 0.0 | 0.1 | GO:0008200 | ion channel inhibitor activity(GO:0008200) |
| 0.0 | 0.0 | GO:0032452 | histone demethylase activity(GO:0032452) |
| 0.0 | 0.0 | GO:0071209 | U7 snRNA binding(GO:0071209) |
| 0.0 | 0.0 | GO:0016262 | protein N-acetylglucosaminyltransferase activity(GO:0016262) |
| 0.0 | 0.0 | GO:0035368 | selenocysteine insertion sequence binding(GO:0035368) |
| 0.0 | 0.0 | GO:0038064 | collagen receptor activity(GO:0038064) |
| 0.0 | 0.0 | GO:0015932 | nucleobase-containing compound transmembrane transporter activity(GO:0015932) |
| 0.0 | 0.0 | GO:0032795 | heterotrimeric G-protein binding(GO:0032795) |
| 0.0 | 0.0 | GO:0004126 | cytidine deaminase activity(GO:0004126) |
| 0.0 | 0.1 | GO:0031779 | melanocortin receptor binding(GO:0031779) type 3 melanocortin receptor binding(GO:0031781) type 4 melanocortin receptor binding(GO:0031782) |
| 0.0 | 0.0 | GO:0008312 | 7S RNA binding(GO:0008312) |
| 0.0 | 0.2 | GO:0004549 | tRNA-specific ribonuclease activity(GO:0004549) |
| 0.0 | 0.2 | GO:0070530 | K63-linked polyubiquitin binding(GO:0070530) |
| 0.0 | 0.1 | GO:0035870 | dITP diphosphatase activity(GO:0035870) XTP diphosphatase activity(GO:0036222) |
| 0.0 | 0.1 | GO:0044183 | protein binding involved in protein folding(GO:0044183) |
| 0.0 | 2.6 | GO:0001077 | transcriptional activator activity, RNA polymerase II core promoter proximal region sequence-specific binding(GO:0001077) |
| 0.0 | 0.1 | GO:0070182 | DNA polymerase binding(GO:0070182) |
| 0.0 | 0.0 | GO:0055100 | adiponectin binding(GO:0055100) |
| 0.0 | 0.0 | GO:0008035 | high-density lipoprotein particle binding(GO:0008035) |
| 0.0 | 0.2 | GO:0060590 | ATPase regulator activity(GO:0060590) |
| 0.0 | 0.0 | GO:0015018 | galactosylgalactosylxylosylprotein 3-beta-glucuronosyltransferase activity(GO:0015018) |
| 0.0 | 0.0 | GO:0004946 | bombesin receptor activity(GO:0004946) |
| 0.0 | 0.1 | GO:0005000 | vasopressin receptor activity(GO:0005000) |
| 0.0 | 0.3 | GO:0004033 | aldo-keto reductase (NADP) activity(GO:0004033) |
| 0.0 | 0.1 | GO:0030983 | mismatched DNA binding(GO:0030983) |
| 0.0 | 0.0 | GO:0048027 | mRNA 5'-UTR binding(GO:0048027) |
| 0.0 | 0.0 | GO:0003986 | acetyl-CoA hydrolase activity(GO:0003986) |
| 0.0 | 0.1 | GO:0004952 | dopamine neurotransmitter receptor activity, coupled via Gs(GO:0001588) dopamine neurotransmitter receptor activity(GO:0004952) |
| 0.0 | 0.3 | GO:0015020 | glucuronosyltransferase activity(GO:0015020) |
| 0.0 | 0.3 | GO:0017022 | myosin binding(GO:0017022) |
| 0.0 | 0.1 | GO:0005275 | amine transmembrane transporter activity(GO:0005275) |
| 0.0 | 0.1 | GO:0017128 | phospholipid scramblase activity(GO:0017128) |
| 0.0 | 0.1 | GO:0005521 | lamin binding(GO:0005521) |
| 0.0 | 0.0 | GO:0015277 | kainate selective glutamate receptor activity(GO:0015277) |
| 0.0 | 0.0 | GO:0005519 | cytoskeletal regulatory protein binding(GO:0005519) |
| 0.0 | 0.3 | GO:0048365 | Rac GTPase binding(GO:0048365) |
| 0.0 | 0.0 | GO:0004949 | cannabinoid receptor activity(GO:0004949) |
| 0.0 | 1.5 | GO:0015631 | tubulin binding(GO:0015631) |
| 0.0 | 0.2 | GO:0051018 | protein kinase A binding(GO:0051018) |
| 0.0 | 0.0 | GO:0042289 | MHC class II protein binding(GO:0042289) |
| 0.0 | 0.1 | GO:0043138 | 3'-5' DNA helicase activity(GO:0043138) |
| 0.0 | 0.7 | GO:0000030 | mannosyltransferase activity(GO:0000030) |
| 0.0 | 0.2 | GO:0004177 | aminopeptidase activity(GO:0004177) |
| 0.0 | 0.1 | GO:0016929 | SUMO-specific protease activity(GO:0016929) |
| 0.0 | 0.0 | GO:0015375 | glycine:sodium symporter activity(GO:0015375) |
| 0.0 | 0.2 | GO:0032266 | phosphatidylinositol-3-phosphate binding(GO:0032266) |
| 0.0 | 0.9 | GO:0008234 | cysteine-type peptidase activity(GO:0008234) |
| 0.0 | 0.0 | GO:0004974 | leukotriene receptor activity(GO:0004974) |
| 0.0 | 0.1 | GO:0003796 | lysozyme activity(GO:0003796) |
| 0.0 | 0.0 | GO:0004690 | cyclic nucleotide-dependent protein kinase activity(GO:0004690) |
| 0.0 | 0.0 | GO:0016413 | O-acetyltransferase activity(GO:0016413) |
| 0.0 | 0.1 | GO:0050649 | testosterone 6-beta-hydroxylase activity(GO:0050649) |
| 0.0 | 0.1 | GO:0046625 | sphingolipid binding(GO:0046625) |
| 0.0 | 0.6 | GO:0004702 | receptor signaling protein serine/threonine kinase activity(GO:0004702) |
| 0.0 | 0.3 | GO:0005272 | sodium channel activity(GO:0005272) |
| 0.0 | 0.0 | GO:0030172 | troponin C binding(GO:0030172) |
| 0.0 | 0.2 | GO:0004889 | acetylcholine-activated cation-selective channel activity(GO:0004889) |
| 0.0 | 0.0 | GO:0031698 | beta-2 adrenergic receptor binding(GO:0031698) |
| 0.0 | 0.0 | GO:0004144 | diacylglycerol O-acyltransferase activity(GO:0004144) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.2 | 0.2 | PID IL8 CXCR1 PATHWAY | IL8- and CXCR1-mediated signaling events |
| 0.2 | 4.9 | PID RXR VDR PATHWAY | RXR and RAR heterodimerization with other nuclear receptor |
| 0.2 | 1.5 | PID ECADHERIN STABILIZATION PATHWAY | Stabilization and expansion of the E-cadherin adherens junction |
| 0.1 | 1.2 | PID P38 GAMMA DELTA PATHWAY | Signaling mediated by p38-gamma and p38-delta |
| 0.1 | 0.2 | PID PI3KCI AKT PATHWAY | Class I PI3K signaling events mediated by Akt |
| 0.1 | 0.1 | SIG IL4RECEPTOR IN B LYPHOCYTES | Genes related to IL4 rceptor signaling in B lymphocytes |
| 0.1 | 0.3 | PID EPHA2 FWD PATHWAY | EPHA2 forward signaling |
| 0.1 | 0.7 | ST PAC1 RECEPTOR PATHWAY | PAC1 Receptor Pathway |
| 0.1 | 4.0 | PID ILK PATHWAY | Integrin-linked kinase signaling |
| 0.1 | 1.7 | PID PDGFRA PATHWAY | PDGFR-alpha signaling pathway |
| 0.1 | 0.2 | PID TCPTP PATHWAY | Signaling events mediated by TCPTP |
| 0.1 | 0.6 | ST INTERFERON GAMMA PATHWAY | Interferon gamma pathway. |
| 0.1 | 0.8 | PID INTEGRIN4 PATHWAY | Alpha6 beta4 integrin-ligand interactions |
| 0.1 | 0.6 | SA MMP CYTOKINE CONNECTION | Cytokines can induce activation of matrix metalloproteinases, which degrade extracellular matrix. |
| 0.1 | 0.8 | PID ALK2 PATHWAY | ALK2 signaling events |
| 0.1 | 0.3 | ST JAK STAT PATHWAY | Jak-STAT Pathway |
| 0.1 | 0.3 | ST DIFFERENTIATION PATHWAY IN PC12 CELLS | Differentiation Pathway in PC12 Cells; this is a specific case of PAC1 Receptor Pathway. |
| 0.1 | 0.6 | PID RAC1 REG PATHWAY | Regulation of RAC1 activity |
| 0.1 | 0.4 | PID IGF1 PATHWAY | IGF1 pathway |
| 0.1 | 2.4 | PID TGFBR PATHWAY | TGF-beta receptor signaling |
| 0.1 | 0.6 | PID BETA CATENIN DEG PATHWAY | Degradation of beta catenin |
| 0.1 | 0.1 | PID ER NONGENOMIC PATHWAY | Plasma membrane estrogen receptor signaling |
| 0.1 | 0.1 | SA CASPASE CASCADE | Apoptosis is mediated by caspases, cysteine proteases arranged in a proteolytic cascade. |
| 0.1 | 1.7 | PID WNT NONCANONICAL PATHWAY | Noncanonical Wnt signaling pathway |
| 0.1 | 0.7 | PID ANTHRAX PATHWAY | Cellular roles of Anthrax toxin |
| 0.1 | 1.3 | PID TAP63 PATHWAY | Validated transcriptional targets of TAp63 isoforms |
| 0.1 | 1.2 | PID PI3K PLC TRK PATHWAY | Trk receptor signaling mediated by PI3K and PLC-gamma |
| 0.1 | 0.5 | PID ARF6 PATHWAY | Arf6 signaling events |
| 0.1 | 0.6 | ST P38 MAPK PATHWAY | p38 MAPK Pathway |
| 0.1 | 0.2 | PID THROMBIN PAR1 PATHWAY | PAR1-mediated thrombin signaling events |
| 0.1 | 0.5 | PID RANBP2 PATHWAY | Sumoylation by RanBP2 regulates transcriptional repression |
| 0.1 | 0.7 | PID NECTIN PATHWAY | Nectin adhesion pathway |
| 0.1 | 1.4 | PID RHOA PATHWAY | RhoA signaling pathway |
| 0.1 | 0.5 | SA PROGRAMMED CELL DEATH | Programmed cell death, or apoptosis, eliminates damaged or unneeded cells. |
| 0.0 | 0.0 | PID IL8 CXCR2 PATHWAY | IL8- and CXCR2-mediated signaling events |
| 0.0 | 0.1 | PID NFKAPPAB ATYPICAL PATHWAY | Atypical NF-kappaB pathway |
| 0.0 | 0.8 | PID AR NONGENOMIC PATHWAY | Nongenotropic Androgen signaling |
| 0.0 | 0.4 | PID NEPHRIN NEPH1 PATHWAY | Nephrin/Neph1 signaling in the kidney podocyte |
| 0.0 | 0.2 | PID GLYPICAN 1PATHWAY | Glypican 1 network |
| 0.0 | 0.3 | ST FAS SIGNALING PATHWAY | Fas Signaling Pathway |
| 0.0 | 0.9 | PID LIS1 PATHWAY | Lissencephaly gene (LIS1) in neuronal migration and development |
| 0.0 | 0.7 | PID P38 MKK3 6PATHWAY | p38 MAPK signaling pathway |
| 0.0 | 1.8 | PID AR PATHWAY | Coregulation of Androgen receptor activity |
| 0.0 | 0.4 | SA G1 AND S PHASES | Cdk2, 4, and 6 bind cyclin D in G1, while cdk2/cyclin E promotes the G1/S transition. |
| 0.0 | 0.3 | SIG PIP3 SIGNALING IN CARDIAC MYOCTES | Genes related to PIP3 signaling in cardiac myocytes |
| 0.0 | 0.1 | PID TCR CALCIUM PATHWAY | Calcium signaling in the CD4+ TCR pathway |
| 0.0 | 0.3 | PID HEDGEHOG 2PATHWAY | Signaling events mediated by the Hedgehog family |
| 0.0 | 0.4 | PID CD40 PATHWAY | CD40/CD40L signaling |
| 0.0 | 0.2 | PID AVB3 INTEGRIN PATHWAY | Integrins in angiogenesis |
| 0.0 | 0.5 | PID MAPK TRK PATHWAY | Trk receptor signaling mediated by the MAPK pathway |
| 0.0 | 0.2 | PID UPA UPAR PATHWAY | Urokinase-type plasminogen activator (uPA) and uPAR-mediated signaling |
| 0.0 | 0.9 | PID FOXO PATHWAY | FoxO family signaling |
| 0.0 | 1.0 | PID TRKR PATHWAY | Neurotrophic factor-mediated Trk receptor signaling |
| 0.0 | 0.2 | PID SMAD2 3PATHWAY | Regulation of cytoplasmic and nuclear SMAD2/3 signaling |
| 0.0 | 0.3 | PID EPHRINB REV PATHWAY | Ephrin B reverse signaling |
| 0.0 | 0.2 | PID WNT CANONICAL PATHWAY | Canonical Wnt signaling pathway |
| 0.0 | 0.3 | ST G ALPHA S PATHWAY | G alpha s Pathway |
| 0.0 | 1.1 | PID ERA GENOMIC PATHWAY | Validated nuclear estrogen receptor alpha network |
| 0.0 | 0.8 | PID ERBB4 PATHWAY | ErbB4 signaling events |
| 0.0 | 0.4 | PID INTEGRIN A9B1 PATHWAY | Alpha9 beta1 integrin signaling events |
| 0.0 | 0.3 | PID DNA PK PATHWAY | DNA-PK pathway in nonhomologous end joining |
| 0.0 | 1.0 | PID HNF3A PATHWAY | FOXA1 transcription factor network |
| 0.0 | 0.4 | PID IL1 PATHWAY | IL1-mediated signaling events |
| 0.0 | 1.4 | PID REG GR PATHWAY | Glucocorticoid receptor regulatory network |
| 0.0 | 0.5 | PID IL2 1PATHWAY | IL2-mediated signaling events |
| 0.0 | 0.2 | PID FRA PATHWAY | Validated transcriptional targets of AP1 family members Fra1 and Fra2 |
| 0.0 | 1.2 | PID P73PATHWAY | p73 transcription factor network |
| 0.0 | 0.1 | SA PTEN PATHWAY | PTEN is a tumor suppressor that dephosphorylates the lipid messenger phosphatidylinositol triphosphate. |
| 0.0 | 0.9 | PID CASPASE PATHWAY | Caspase cascade in apoptosis |
| 0.0 | 0.5 | PID P38 ALPHA BETA DOWNSTREAM PATHWAY | Signaling mediated by p38-alpha and p38-beta |
| 0.0 | 0.7 | PID CDC42 PATHWAY | CDC42 signaling events |
| 0.0 | 0.6 | PID PS1 PATHWAY | Presenilin action in Notch and Wnt signaling |
| 0.0 | 0.2 | PID VEGF VEGFR PATHWAY | VEGF and VEGFR signaling network |
| 0.0 | 0.1 | ST GA13 PATHWAY | G alpha 13 Pathway |
| 0.0 | 1.1 | PID HIF1 TFPATHWAY | HIF-1-alpha transcription factor network |
| 0.0 | 0.1 | PID NFKAPPAB CANONICAL PATHWAY | Canonical NF-kappaB pathway |
| 0.0 | 0.0 | PID REELIN PATHWAY | Reelin signaling pathway |
| 0.0 | 0.0 | PID HIV NEF PATHWAY | HIV-1 Nef: Negative effector of Fas and TNF-alpha |
| 0.0 | 0.3 | PID CIRCADIAN PATHWAY | Circadian rhythm pathway |
| 0.0 | 0.4 | PID AMB2 NEUTROPHILS PATHWAY | amb2 Integrin signaling |
| 0.0 | 0.6 | PID ARF6 TRAFFICKING PATHWAY | Arf6 trafficking events |
| 0.0 | 0.1 | PID WNT SIGNALING PATHWAY | Wnt signaling network |
| 0.0 | 0.1 | PID SYNDECAN 1 PATHWAY | Syndecan-1-mediated signaling events |
| 0.0 | 0.0 | PID SYNDECAN 3 PATHWAY | Syndecan-3-mediated signaling events |
| 0.0 | 0.1 | ST GRANULE CELL SURVIVAL PATHWAY | Granule Cell Survival Pathway is a specific case of more general PAC1 Receptor Pathway. |
| 0.0 | 0.3 | PID TOLL ENDOGENOUS PATHWAY | Endogenous TLR signaling |
| 0.0 | 0.2 | PID IL27 PATHWAY | IL27-mediated signaling events |
| 0.0 | 0.9 | WNT SIGNALING | Genes related to Wnt-mediated signal transduction |
| 0.0 | 0.1 | PID SYNDECAN 2 PATHWAY | Syndecan-2-mediated signaling events |
| 0.0 | 0.1 | ST GA12 PATHWAY | G alpha 12 Pathway |
| 0.0 | 0.3 | PID VEGFR1 2 PATHWAY | Signaling events mediated by VEGFR1 and VEGFR2 |
| 0.0 | 0.5 | PID IL4 2PATHWAY | IL4-mediated signaling events |
| 0.0 | 4.0 | NABA SECRETED FACTORS | Genes encoding secreted soluble factors |
| 0.0 | 0.3 | PID P75 NTR PATHWAY | p75(NTR)-mediated signaling |
| 0.0 | 0.2 | PID BARD1 PATHWAY | BARD1 signaling events |
| 0.0 | 0.1 | PID PRL SIGNALING EVENTS PATHWAY | Signaling events mediated by PRL |
| 0.0 | 0.1 | ST PHOSPHOINOSITIDE 3 KINASE PATHWAY | PI3K Pathway |
| 0.0 | 0.3 | PID ATM PATHWAY | ATM pathway |
| 0.0 | 0.3 | PID HEDGEHOG GLI PATHWAY | Hedgehog signaling events mediated by Gli proteins |
| 0.0 | 0.1 | PID PTP1B PATHWAY | Signaling events mediated by PTP1B |
| 0.0 | 1.9 | NABA ECM GLYCOPROTEINS | Genes encoding structural ECM glycoproteins |
| 0.0 | 0.1 | PID INTEGRIN2 PATHWAY | Beta2 integrin cell surface interactions |
| 0.0 | 0.1 | PID CXCR3 PATHWAY | CXCR3-mediated signaling events |
| 0.0 | 0.0 | PID TXA2PATHWAY | Thromboxane A2 receptor signaling |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.2 | 0.2 | REACTOME PHOSPHORYLATION OF CD3 AND TCR ZETA CHAINS | Genes involved in Phosphorylation of CD3 and TCR zeta chains |
| 0.2 | 1.0 | REACTOME ETHANOL OXIDATION | Genes involved in Ethanol oxidation |
| 0.2 | 0.2 | REACTOME MRNA DECAY BY 3 TO 5 EXORIBONUCLEASE | Genes involved in mRNA Decay by 3' to 5' Exoribonuclease |
| 0.1 | 2.7 | REACTOME YAP1 AND WWTR1 TAZ STIMULATED GENE EXPRESSION | Genes involved in YAP1- and WWTR1 (TAZ)-stimulated gene expression |
| 0.1 | 0.2 | REACTOME SIGNALING BY WNT | Genes involved in Signaling by Wnt |
| 0.1 | 0.2 | REACTOME PEPTIDE CHAIN ELONGATION | Genes involved in Peptide chain elongation |
| 0.1 | 0.1 | REACTOME PHOSPHORYLATION OF THE APC C | Genes involved in Phosphorylation of the APC/C |
| 0.1 | 1.5 | REACTOME TGF BETA RECEPTOR SIGNALING IN EMT EPITHELIAL TO MESENCHYMAL TRANSITION | Genes involved in TGF-beta receptor signaling in EMT (epithelial to mesenchymal transition) |
| 0.1 | 1.4 | REACTOME HDL MEDIATED LIPID TRANSPORT | Genes involved in HDL-mediated lipid transport |
| 0.1 | 0.8 | REACTOME ELEVATION OF CYTOSOLIC CA2 LEVELS | Genes involved in Elevation of cytosolic Ca2+ levels |
| 0.1 | 0.8 | REACTOME RECYCLING OF BILE ACIDS AND SALTS | Genes involved in Recycling of bile acids and salts |
| 0.1 | 2.2 | REACTOME ENDOSOMAL SORTING COMPLEX REQUIRED FOR TRANSPORT ESCRT | Genes involved in Endosomal Sorting Complex Required For Transport (ESCRT) |
| 0.1 | 0.7 | REACTOME CIRCADIAN REPRESSION OF EXPRESSION BY REV ERBA | Genes involved in Circadian Repression of Expression by REV-ERBA |
| 0.1 | 1.4 | REACTOME INSULIN SYNTHESIS AND PROCESSING | Genes involved in Insulin Synthesis and Processing |
| 0.1 | 0.9 | REACTOME SYNTHESIS OF PE | Genes involved in Synthesis of PE |
| 0.1 | 1.2 | REACTOME SYNTHESIS OF VERY LONG CHAIN FATTY ACYL COAS | Genes involved in Synthesis of very long-chain fatty acyl-CoAs |
| 0.1 | 1.1 | REACTOME PROTEOLYTIC CLEAVAGE OF SNARE COMPLEX PROTEINS | Genes involved in Proteolytic cleavage of SNARE complex proteins |
| 0.1 | 1.4 | REACTOME DESTABILIZATION OF MRNA BY BRF1 | Genes involved in Destabilization of mRNA by Butyrate Response Factor 1 (BRF1) |
| 0.1 | 0.1 | REACTOME P75NTR RECRUITS SIGNALLING COMPLEXES | Genes involved in p75NTR recruits signalling complexes |
| 0.1 | 2.0 | REACTOME ASSOCIATION OF TRIC CCT WITH TARGET PROTEINS DURING BIOSYNTHESIS | Genes involved in Association of TriC/CCT with target proteins during biosynthesis |
| 0.1 | 0.3 | REACTOME FATTY ACYL COA BIOSYNTHESIS | Genes involved in Fatty Acyl-CoA Biosynthesis |
| 0.1 | 1.0 | REACTOME REGULATION OF IFNG SIGNALING | Genes involved in Regulation of IFNG signaling |
| 0.1 | 0.1 | REACTOME NEGATIVE REGULATION OF THE PI3K AKT NETWORK | Genes involved in Negative regulation of the PI3K/AKT network |
| 0.1 | 0.6 | REACTOME SIGNAL REGULATORY PROTEIN SIRP FAMILY INTERACTIONS | Genes involved in Signal regulatory protein (SIRP) family interactions |
| 0.1 | 1.0 | REACTOME SHC1 EVENTS IN ERBB4 SIGNALING | Genes involved in SHC1 events in ERBB4 signaling |
| 0.1 | 0.7 | REACTOME E2F ENABLED INHIBITION OF PRE REPLICATION COMPLEX FORMATION | Genes involved in E2F-enabled inhibition of pre-replication complex formation |
| 0.1 | 0.2 | REACTOME DAG AND IP3 SIGNALING | Genes involved in DAG and IP3 signaling |
| 0.1 | 0.5 | REACTOME TRANSPORT OF ORGANIC ANIONS | Genes involved in Transport of organic anions |
| 0.1 | 0.9 | REACTOME METABOLISM OF PORPHYRINS | Genes involved in Metabolism of porphyrins |
| 0.1 | 0.7 | REACTOME BASE FREE SUGAR PHOSPHATE REMOVAL VIA THE SINGLE NUCLEOTIDE REPLACEMENT PATHWAY | Genes involved in Base-free sugar-phosphate removal via the single-nucleotide replacement pathway |
| 0.1 | 0.5 | REACTOME HORMONE SENSITIVE LIPASE HSL MEDIATED TRIACYLGLYCEROL HYDROLYSIS | Genes involved in Hormone-sensitive lipase (HSL)-mediated triacylglycerol hydrolysis |
| 0.1 | 1.3 | REACTOME TRANSPORT OF VITAMINS NUCLEOSIDES AND RELATED MOLECULES | Genes involved in Transport of vitamins, nucleosides, and related molecules |
| 0.1 | 0.9 | REACTOME SYNTHESIS OF SUBSTRATES IN N GLYCAN BIOSYTHESIS | Genes involved in Synthesis of substrates in N-glycan biosythesis |
| 0.1 | 0.1 | REACTOME DOWNREGULATION OF ERBB2 ERBB3 SIGNALING | Genes involved in Downregulation of ERBB2:ERBB3 signaling |
| 0.1 | 2.9 | REACTOME MITOCHONDRIAL PROTEIN IMPORT | Genes involved in Mitochondrial Protein Import |
| 0.1 | 1.0 | REACTOME SYNTHESIS OF PIPS AT THE GOLGI MEMBRANE | Genes involved in Synthesis of PIPs at the Golgi membrane |
| 0.1 | 0.2 | REACTOME LIPID DIGESTION MOBILIZATION AND TRANSPORT | Genes involved in Lipid digestion, mobilization, and transport |
| 0.1 | 0.6 | REACTOME REGULATION OF RHEB GTPASE ACTIVITY BY AMPK | Genes involved in Regulation of Rheb GTPase activity by AMPK |
| 0.1 | 0.6 | REACTOME APOPTOTIC CLEAVAGE OF CELL ADHESION PROTEINS | Genes involved in Apoptotic cleavage of cell adhesion proteins |
| 0.1 | 0.9 | REACTOME SYNTHESIS SECRETION AND INACTIVATION OF GLP1 | Genes involved in Synthesis, Secretion, and Inactivation of Glucagon-like Peptide-1 (GLP-1) |
| 0.1 | 1.2 | REACTOME CIRCADIAN CLOCK | Genes involved in Circadian Clock |
| 0.1 | 0.6 | REACTOME PASSIVE TRANSPORT BY AQUAPORINS | Genes involved in Passive Transport by Aquaporins |
| 0.1 | 0.4 | REACTOME TRANSPORT OF MATURE MRNA DERIVED FROM AN INTRONLESS TRANSCRIPT | Genes involved in Transport of Mature mRNA Derived from an Intronless Transcript |
| 0.1 | 0.9 | REACTOME AMINE DERIVED HORMONES | Genes involved in Amine-derived hormones |
| 0.1 | 0.5 | REACTOME REGULATION OF INSULIN SECRETION BY ACETYLCHOLINE | Genes involved in Regulation of Insulin Secretion by Acetylcholine |
| 0.1 | 0.5 | REACTOME DOPAMINE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Dopamine Neurotransmitter Release Cycle |
| 0.1 | 0.1 | REACTOME ADP SIGNALLING THROUGH P2RY1 | Genes involved in ADP signalling through P2Y purinoceptor 1 |
| 0.1 | 0.8 | REACTOME AMINO ACID SYNTHESIS AND INTERCONVERSION TRANSAMINATION | Genes involved in Amino acid synthesis and interconversion (transamination) |
| 0.1 | 0.4 | REACTOME CTNNB1 PHOSPHORYLATION CASCADE | Genes involved in Beta-catenin phosphorylation cascade |
| 0.1 | 0.3 | REACTOME ACTIVATED TAK1 MEDIATES P38 MAPK ACTIVATION | Genes involved in activated TAK1 mediates p38 MAPK activation |
| 0.1 | 0.8 | REACTOME DOWNREGULATION OF TGF BETA RECEPTOR SIGNALING | Genes involved in Downregulation of TGF-beta receptor signaling |
| 0.1 | 0.6 | REACTOME LIPOPROTEIN METABOLISM | Genes involved in Lipoprotein metabolism |
| 0.1 | 0.5 | REACTOME VEGF LIGAND RECEPTOR INTERACTIONS | Genes involved in VEGF ligand-receptor interactions |
| 0.1 | 0.1 | REACTOME VIF MEDIATED DEGRADATION OF APOBEC3G | Genes involved in Vif-mediated degradation of APOBEC3G |
| 0.1 | 0.6 | REACTOME GLYCOGEN BREAKDOWN GLYCOGENOLYSIS | Genes involved in Glycogen breakdown (glycogenolysis) |
| 0.1 | 0.5 | REACTOME DEPOSITION OF NEW CENPA CONTAINING NUCLEOSOMES AT THE CENTROMERE | Genes involved in Deposition of New CENPA-containing Nucleosomes at the Centromere |
| 0.1 | 0.4 | REACTOME ANDROGEN BIOSYNTHESIS | Genes involved in Androgen biosynthesis |
| 0.1 | 0.5 | REACTOME ROLE OF DCC IN REGULATING APOPTOSIS | Genes involved in Role of DCC in regulating apoptosis |
| 0.0 | 0.6 | REACTOME NEPHRIN INTERACTIONS | Genes involved in Nephrin interactions |
| 0.0 | 1.2 | REACTOME APOPTOTIC CLEAVAGE OF CELLULAR PROTEINS | Genes involved in Apoptotic cleavage of cellular proteins |
| 0.0 | 1.7 | REACTOME AMINE LIGAND BINDING RECEPTORS | Genes involved in Amine ligand-binding receptors |
| 0.0 | 1.0 | REACTOME METAL ION SLC TRANSPORTERS | Genes involved in Metal ion SLC transporters |
| 0.0 | 1.1 | REACTOME SULFUR AMINO ACID METABOLISM | Genes involved in Sulfur amino acid metabolism |
| 0.0 | 0.3 | REACTOME GLYCOPROTEIN HORMONES | Genes involved in Glycoprotein hormones |
| 0.0 | 0.4 | REACTOME PLATELET CALCIUM HOMEOSTASIS | Genes involved in Platelet calcium homeostasis |
| 0.0 | 1.0 | REACTOME KINESINS | Genes involved in Kinesins |
| 0.0 | 0.7 | REACTOME CONVERSION FROM APC C CDC20 TO APC C CDH1 IN LATE ANAPHASE | Genes involved in Conversion from APC/C:Cdc20 to APC/C:Cdh1 in late anaphase |
| 0.0 | 0.5 | REACTOME ADVANCED GLYCOSYLATION ENDPRODUCT RECEPTOR SIGNALING | Genes involved in Advanced glycosylation endproduct receptor signaling |
| 0.0 | 0.7 | REACTOME TRIGLYCERIDE BIOSYNTHESIS | Genes involved in Triglyceride Biosynthesis |
| 0.0 | 0.2 | REACTOME DIGESTION OF DIETARY CARBOHYDRATE | Genes involved in Digestion of dietary carbohydrate |
| 0.0 | 0.9 | REACTOME DARPP 32 EVENTS | Genes involved in DARPP-32 events |
| 0.0 | 0.2 | REACTOME ACYL CHAIN REMODELLING OF PG | Genes involved in Acyl chain remodelling of PG |
| 0.0 | 0.1 | REACTOME SEMA4D IN SEMAPHORIN SIGNALING | Genes involved in Sema4D in semaphorin signaling |
| 0.0 | 0.6 | REACTOME ABCA TRANSPORTERS IN LIPID HOMEOSTASIS | Genes involved in ABCA transporters in lipid homeostasis |
| 0.0 | 0.3 | REACTOME DESTABILIZATION OF MRNA BY AUF1 HNRNP D0 | Genes involved in Destabilization of mRNA by AUF1 (hnRNP D0) |
| 0.0 | 0.2 | REACTOME APC C CDH1 MEDIATED DEGRADATION OF CDC20 AND OTHER APC C CDH1 TARGETED PROTEINS IN LATE MITOSIS EARLY G1 | Genes involved in APC/C:Cdh1 mediated degradation of Cdc20 and other APC/C:Cdh1 targeted proteins in late mitosis/early G1 |
| 0.0 | 2.7 | REACTOME RESPIRATORY ELECTRON TRANSPORT | Genes involved in Respiratory electron transport |
| 0.0 | 0.2 | REACTOME PACKAGING OF TELOMERE ENDS | Genes involved in Packaging Of Telomere Ends |
| 0.0 | 1.0 | REACTOME POST TRANSLATIONAL MODIFICATION SYNTHESIS OF GPI ANCHORED PROTEINS | Genes involved in Post-translational modification: synthesis of GPI-anchored proteins |
| 0.0 | 1.0 | REACTOME IL RECEPTOR SHC SIGNALING | Genes involved in Interleukin receptor SHC signaling |
| 0.0 | 0.8 | REACTOME CGMP EFFECTS | Genes involved in cGMP effects |
| 0.0 | 1.1 | REACTOME REGULATION OF GLUCOKINASE BY GLUCOKINASE REGULATORY PROTEIN | Genes involved in Regulation of Glucokinase by Glucokinase Regulatory Protein |
| 0.0 | 0.8 | REACTOME LIGAND GATED ION CHANNEL TRANSPORT | Genes involved in Ligand-gated ion channel transport |
| 0.0 | 0.5 | REACTOME FORMATION OF TRANSCRIPTION COUPLED NER TC NER REPAIR COMPLEX | Genes involved in Formation of transcription-coupled NER (TC-NER) repair complex |
| 0.0 | 0.1 | REACTOME MITOTIC G2 G2 M PHASES | Genes involved in Mitotic G2-G2/M phases |
| 0.0 | 0.0 | REACTOME INHIBITION OF INSULIN SECRETION BY ADRENALINE NORADRENALINE | Genes involved in Inhibition of Insulin Secretion by Adrenaline/Noradrenaline |
| 0.0 | 0.3 | REACTOME NFKB IS ACTIVATED AND SIGNALS SURVIVAL | Genes involved in NF-kB is activated and signals survival |
| 0.0 | 4.8 | REACTOME METABOLISM OF AMINO ACIDS AND DERIVATIVES | Genes involved in Metabolism of amino acids and derivatives |
| 0.0 | 0.5 | REACTOME BIOSYNTHESIS OF THE N GLYCAN PRECURSOR DOLICHOL LIPID LINKED OLIGOSACCHARIDE LLO AND TRANSFER TO A NASCENT PROTEIN | Genes involved in Biosynthesis of the N-glycan precursor (dolichol lipid-linked oligosaccharide, LLO) and transfer to a nascent protein |
| 0.0 | 0.1 | REACTOME ACYL CHAIN REMODELLING OF PS | Genes involved in Acyl chain remodelling of PS |
| 0.0 | 0.7 | REACTOME PEROXISOMAL LIPID METABOLISM | Genes involved in Peroxisomal lipid metabolism |
| 0.0 | 0.6 | REACTOME RNA POL III CHAIN ELONGATION | Genes involved in RNA Polymerase III Chain Elongation |
| 0.0 | 0.0 | REACTOME APC CDC20 MEDIATED DEGRADATION OF NEK2A | Genes involved in APC-Cdc20 mediated degradation of Nek2A |
| 0.0 | 0.7 | REACTOME TRANSPORT OF MATURE TRANSCRIPT TO CYTOPLASM | Genes involved in Transport of Mature Transcript to Cytoplasm |
| 0.0 | 0.4 | REACTOME NOTCH HLH TRANSCRIPTION PATHWAY | Genes involved in Notch-HLH transcription pathway |
| 0.0 | 0.3 | REACTOME ER PHAGOSOME PATHWAY | Genes involved in ER-Phagosome pathway |
| 0.0 | 0.3 | REACTOME REGULATION OF MRNA STABILITY BY PROTEINS THAT BIND AU RICH ELEMENTS | Genes involved in Regulation of mRNA Stability by Proteins that Bind AU-rich Elements |
| 0.0 | 0.1 | REACTOME TRAF6 MEDIATED IRF7 ACTIVATION IN TLR7 8 OR 9 SIGNALING | Genes involved in TRAF6 mediated IRF7 activation in TLR7/8 or 9 signaling |
| 0.0 | 0.7 | REACTOME GLYCOLYSIS | Genes involved in Glycolysis |
| 0.0 | 0.1 | REACTOME REGULATION OF KIT SIGNALING | Genes involved in Regulation of KIT signaling |
| 0.0 | 0.2 | REACTOME SLBP DEPENDENT PROCESSING OF REPLICATION DEPENDENT HISTONE PRE MRNAS | Genes involved in SLBP Dependent Processing of Replication-Dependent Histone Pre-mRNAs |
| 0.0 | 0.1 | REACTOME SIGNALING BY ERBB2 | Genes involved in Signaling by ERBB2 |
| 0.0 | 0.5 | REACTOME JNK C JUN KINASES PHOSPHORYLATION AND ACTIVATION MEDIATED BY ACTIVATED HUMAN TAK1 | Genes involved in JNK (c-Jun kinases) phosphorylation and activation mediated by activated human TAK1 |
| 0.0 | 0.6 | REACTOME IL1 SIGNALING | Genes involved in Interleukin-1 signaling |
| 0.0 | 0.4 | REACTOME SYNTHESIS OF PC | Genes involved in Synthesis of PC |
| 0.0 | 3.8 | REACTOME ANTIGEN PROCESSING UBIQUITINATION PROTEASOME DEGRADATION | Genes involved in Antigen processing: Ubiquitination & Proteasome degradation |
| 0.0 | 0.4 | REACTOME FGFR4 LIGAND BINDING AND ACTIVATION | Genes involved in FGFR4 ligand binding and activation |
| 0.0 | 1.4 | REACTOME NUCLEAR RECEPTOR TRANSCRIPTION PATHWAY | Genes involved in Nuclear Receptor transcription pathway |
| 0.0 | 1.8 | REACTOME MITOTIC PROMETAPHASE | Genes involved in Mitotic Prometaphase |
| 0.0 | 0.0 | REACTOME PECAM1 INTERACTIONS | Genes involved in PECAM1 interactions |
| 0.0 | 0.3 | REACTOME MRNA DECAY BY 5 TO 3 EXORIBONUCLEASE | Genes involved in mRNA Decay by 5' to 3' Exoribonuclease |
| 0.0 | 0.4 | REACTOME RECYCLING PATHWAY OF L1 | Genes involved in Recycling pathway of L1 |
| 0.0 | 0.7 | REACTOME G1 PHASE | Genes involved in G1 Phase |
| 0.0 | 0.2 | REACTOME NFKB ACTIVATION THROUGH FADD RIP1 PATHWAY MEDIATED BY CASPASE 8 AND10 | Genes involved in NF-kB activation through FADD/RIP-1 pathway mediated by caspase-8 and -10 |
| 0.0 | 0.6 | REACTOME MITOCHONDRIAL TRNA AMINOACYLATION | Genes involved in Mitochondrial tRNA aminoacylation |
| 0.0 | 0.2 | REACTOME NUCLEAR SIGNALING BY ERBB4 | Genes involved in Nuclear signaling by ERBB4 |
| 0.0 | 0.6 | REACTOME NCAM1 INTERACTIONS | Genes involved in NCAM1 interactions |
| 0.0 | 0.7 | REACTOME MRNA SPLICING MINOR PATHWAY | Genes involved in mRNA Splicing - Minor Pathway |
| 0.0 | 0.1 | REACTOME SHC RELATED EVENTS | Genes involved in SHC-related events |
| 0.0 | 0.2 | REACTOME PROLONGED ERK ACTIVATION EVENTS | Genes involved in Prolonged ERK activation events |
| 0.0 | 1.2 | REACTOME FORMATION OF THE TERNARY COMPLEX AND SUBSEQUENTLY THE 43S COMPLEX | Genes involved in Formation of the ternary complex, and subsequently, the 43S complex |
| 0.0 | 0.9 | REACTOME PURINE METABOLISM | Genes involved in Purine metabolism |
| 0.0 | 0.3 | REACTOME CELL EXTRACELLULAR MATRIX INTERACTIONS | Genes involved in Cell-extracellular matrix interactions |
| 0.0 | 0.1 | REACTOME IL 6 SIGNALING | Genes involved in Interleukin-6 signaling |
| 0.0 | 0.7 | REACTOME SPHINGOLIPID DE NOVO BIOSYNTHESIS | Genes involved in Sphingolipid de novo biosynthesis |
| 0.0 | 0.6 | REACTOME TRANSFERRIN ENDOCYTOSIS AND RECYCLING | Genes involved in Transferrin endocytosis and recycling |
| 0.0 | 0.0 | REACTOME TRANSPORT OF RIBONUCLEOPROTEINS INTO THE HOST NUCLEUS | Genes involved in Transport of Ribonucleoproteins into the Host Nucleus |
| 0.0 | 0.2 | REACTOME ANTIGEN PRESENTATION FOLDING ASSEMBLY AND PEPTIDE LOADING OF CLASS I MHC | Genes involved in Antigen Presentation: Folding, assembly and peptide loading of class I MHC |
| 0.0 | 0.2 | REACTOME NEGATIVE REGULATORS OF RIG I MDA5 SIGNALING | Genes involved in Negative regulators of RIG-I/MDA5 signaling |
| 0.0 | 1.1 | REACTOME O LINKED GLYCOSYLATION OF MUCINS | Genes involved in O-linked glycosylation of mucins |
| 0.0 | 0.7 | REACTOME ION TRANSPORT BY P TYPE ATPASES | Genes involved in Ion transport by P-type ATPases |
| 0.0 | 0.2 | REACTOME REGULATED PROTEOLYSIS OF P75NTR | Genes involved in Regulated proteolysis of p75NTR |
| 0.0 | 0.6 | REACTOME SIGNALING BY ROBO RECEPTOR | Genes involved in Signaling by Robo receptor |
| 0.0 | 0.3 | REACTOME MITOCHONDRIAL FATTY ACID BETA OXIDATION | Genes involved in Mitochondrial Fatty Acid Beta-Oxidation |
| 0.0 | 0.2 | REACTOME RNA POL III TRANSCRIPTION INITIATION FROM TYPE 3 PROMOTER | Genes involved in RNA Polymerase III Transcription Initiation From Type 3 Promoter |
| 0.0 | 0.2 | REACTOME THE ROLE OF NEF IN HIV1 REPLICATION AND DISEASE PATHOGENESIS | Genes involved in The role of Nef in HIV-1 replication and disease pathogenesis |
| 0.0 | 0.2 | REACTOME UNWINDING OF DNA | Genes involved in Unwinding of DNA |
| 0.0 | 1.9 | REACTOME G ALPHA S SIGNALLING EVENTS | Genes involved in G alpha (s) signalling events |
| 0.0 | 1.1 | REACTOME COLLAGEN FORMATION | Genes involved in Collagen formation |
| 0.0 | 0.8 | REACTOME ACTIVATION OF CHAPERONE GENES BY XBP1S | Genes involved in Activation of Chaperone Genes by XBP1(S) |
| 0.0 | 0.2 | REACTOME STEROID HORMONES | Genes involved in Steroid hormones |
| 0.0 | 0.3 | REACTOME SIGNALING BY NODAL | Genes involved in Signaling by NODAL |
| 0.0 | 0.4 | REACTOME MYOGENESIS | Genes involved in Myogenesis |
| 0.0 | 0.4 | REACTOME CYTOSOLIC TRNA AMINOACYLATION | Genes involved in Cytosolic tRNA aminoacylation |
| 0.0 | 0.2 | REACTOME DOWNREGULATION OF SMAD2 3 SMAD4 TRANSCRIPTIONAL ACTIVITY | Genes involved in Downregulation of SMAD2/3:SMAD4 transcriptional activity |
| 0.0 | 0.5 | REACTOME STRIATED MUSCLE CONTRACTION | Genes involved in Striated Muscle Contraction |
| 0.0 | 0.2 | REACTOME N GLYCAN TRIMMING IN THE ER AND CALNEXIN CALRETICULIN CYCLE | Genes involved in N-glycan trimming in the ER and Calnexin/Calreticulin cycle |
| 0.0 | 0.2 | REACTOME SIGNALING BY FGFR1 FUSION MUTANTS | Genes involved in Signaling by FGFR1 fusion mutants |
| 0.0 | 0.2 | REACTOME THE NLRP3 INFLAMMASOME | Genes involved in The NLRP3 inflammasome |
| 0.0 | 0.2 | REACTOME EARLY PHASE OF HIV LIFE CYCLE | Genes involved in Early Phase of HIV Life Cycle |
| 0.0 | 0.1 | REACTOME COPI MEDIATED TRANSPORT | Genes involved in COPI Mediated Transport |
| 0.0 | 0.1 | REACTOME ACTIVATION OF NF KAPPAB IN B CELLS | Genes involved in Activation of NF-kappaB in B Cells |
| 0.0 | 0.1 | REACTOME TRAF3 DEPENDENT IRF ACTIVATION PATHWAY | Genes involved in TRAF3-dependent IRF activation pathway |
| 0.0 | 0.3 | REACTOME SEMA4D INDUCED CELL MIGRATION AND GROWTH CONE COLLAPSE | Genes involved in Sema4D induced cell migration and growth-cone collapse |
| 0.0 | 0.5 | REACTOME GOLGI ASSOCIATED VESICLE BIOGENESIS | Genes involved in Golgi Associated Vesicle Biogenesis |
| 0.0 | 0.0 | REACTOME TAK1 ACTIVATES NFKB BY PHOSPHORYLATION AND ACTIVATION OF IKKS COMPLEX | Genes involved in TAK1 activates NFkB by phosphorylation and activation of IKKs complex |
| 0.0 | 0.1 | REACTOME GAP JUNCTION DEGRADATION | Genes involved in Gap junction degradation |
| 0.0 | 0.2 | REACTOME BILE SALT AND ORGANIC ANION SLC TRANSPORTERS | Genes involved in Bile salt and organic anion SLC transporters |
| 0.0 | 0.6 | REACTOME MHC CLASS II ANTIGEN PRESENTATION | Genes involved in MHC class II antigen presentation |
| 0.0 | 0.0 | REACTOME NEP NS2 INTERACTS WITH THE CELLULAR EXPORT MACHINERY | Genes involved in NEP/NS2 Interacts with the Cellular Export Machinery |
| 0.0 | 0.0 | REACTOME RESOLUTION OF AP SITES VIA THE SINGLE NUCLEOTIDE REPLACEMENT PATHWAY | Genes involved in Resolution of AP sites via the single-nucleotide replacement pathway |
| 0.0 | 0.1 | REACTOME TIE2 SIGNALING | Genes involved in Tie2 Signaling |
| 0.0 | 0.0 | REACTOME SIGNALLING TO P38 VIA RIT AND RIN | Genes involved in Signalling to p38 via RIT and RIN |
| 0.0 | 0.1 | REACTOME REGULATION OF INSULIN SECRETION BY GLUCAGON LIKE PEPTIDE1 | Genes involved in Regulation of Insulin Secretion by Glucagon-like Peptide-1 |
| 0.0 | 0.2 | REACTOME SYNTHESIS OF PA | Genes involved in Synthesis of PA |
| 0.0 | 0.2 | REACTOME CHONDROITIN SULFATE BIOSYNTHESIS | Genes involved in Chondroitin sulfate biosynthesis |
| 0.0 | 0.0 | REACTOME IL 7 SIGNALING | Genes involved in Interleukin-7 signaling |
| 0.0 | 0.2 | REACTOME METABOLISM OF NON CODING RNA | Genes involved in Metabolism of non-coding RNA |
| 0.0 | 0.4 | REACTOME CLASS B 2 SECRETIN FAMILY RECEPTORS | Genes involved in Class B/2 (Secretin family receptors) |
| 0.0 | 0.3 | REACTOME COMPLEMENT CASCADE | Genes involved in Complement cascade |
| 0.0 | 0.1 | REACTOME NOD1 2 SIGNALING PATHWAY | Genes involved in NOD1/2 Signaling Pathway |
| 0.0 | 0.1 | REACTOME PLATELET ADHESION TO EXPOSED COLLAGEN | Genes involved in Platelet Adhesion to exposed collagen |
| 0.0 | 0.1 | REACTOME FACILITATIVE NA INDEPENDENT GLUCOSE TRANSPORTERS | Genes involved in Facilitative Na+-independent glucose transporters |
| 0.0 | 0.0 | REACTOME THROMBOXANE SIGNALLING THROUGH TP RECEPTOR | Genes involved in Thromboxane signalling through TP receptor |
| 0.0 | 0.0 | REACTOME SIGNALING BY SCF KIT | Genes involved in Signaling by SCF-KIT |
| 0.0 | 0.2 | REACTOME SIGNALING BY HIPPO | Genes involved in Signaling by Hippo |
| 0.0 | 0.3 | REACTOME IMMUNOREGULATORY INTERACTIONS BETWEEN A LYMPHOID AND A NON LYMPHOID CELL | Genes involved in Immunoregulatory interactions between a Lymphoid and a non-Lymphoid cell |
| 0.0 | 0.1 | REACTOME SIGNALING BY ILS | Genes involved in Signaling by Interleukins |
| 0.0 | 0.1 | REACTOME HIGHLY CALCIUM PERMEABLE POSTSYNAPTIC NICOTINIC ACETYLCHOLINE RECEPTORS | Genes involved in Highly calcium permeable postsynaptic nicotinic acetylcholine receptors |