Gene Symbol | Gene ID | Gene Info |
---|---|---|
Erg
|
ENSMUSG00000040732.12 | Erg |
Gene | Promoter | Distance | Association probability | Pearson corr. coef. | P-value | Plot |
---|---|---|---|---|---|---|
Erg | chr16_95439908_95440073 | 19255 | 0.241520 | 0.98 | 5.8e-04 | Click! |
Erg | chr16_95432244_95432403 | 26922 | 0.216483 | 0.92 | 8.6e-03 | Click! |
Erg | chr16_95459306_95459486 | 48 | 0.985479 | 0.90 | 1.5e-02 | Click! |
Erg | chr16_95579480_95579639 | 7034 | 0.285379 | 0.86 | 2.7e-02 | Click! |
Erg | chr16_95605411_95605586 | 18905 | 0.239685 | -0.82 | 4.7e-02 | Click! |
Move your cursor over a bar to see sample name and corresponding Z-value.
Cis Regulatory Element (CRE) | Target Score | Top associated gene | Gene Info | Distance of CRE to TSS | CRE/Gene association probability |
---|---|---|---|---|---|
chr9_75425950_75426101 | 2.23 |
Leo1 |
Leo1, Paf1/RNA polymerase II complex component |
15499 |
0.11 |
chr19_40840384_40840634 | 1.98 |
Ccnj |
cyclin J |
9201 |
0.17 |
chr1_86858960_86859159 | 1.88 |
Dis3l2 |
DIS3 like 3'-5' exoribonuclease 2 |
1688 |
0.24 |
chr16_38681445_38681596 | 1.71 |
Gm15530 |
predicted gene 15530 |
4349 |
0.19 |
chr12_5213695_5213866 | 1.69 |
Gm48532 |
predicted gene, 48532 |
22184 |
0.23 |
chr17_73872987_73873138 | 1.64 |
Gm4948 |
predicted gene 4948 |
1712 |
0.35 |
chr13_113168060_113168232 | 1.63 |
Gzmk |
granzyme K |
12751 |
0.12 |
chr3_38541387_38541538 | 1.61 |
Gm24462 |
predicted gene, 24462 |
16752 |
0.17 |
chr4_99152254_99152434 | 1.59 |
Gm12681 |
predicted gene 12681 |
9298 |
0.16 |
chr15_99333031_99333200 | 1.58 |
Fmnl3 |
formin-like 3 |
2612 |
0.15 |
chr18_65695498_65695663 | 1.57 |
Oacyl |
O-acyltransferase like |
2688 |
0.21 |
chr17_27480362_27480514 | 1.55 |
Grm4 |
glutamate receptor, metabotropic 4 |
7122 |
0.11 |
chr1_57837349_57837500 | 1.48 |
Spats2l |
spermatogenesis associated, serine-rich 2-like |
8147 |
0.26 |
chr7_83842916_83843186 | 1.38 |
Gm44993 |
predicted gene 44993 |
8452 |
0.11 |
chr19_16182027_16182207 | 1.37 |
E030024N20Rik |
RIKEN cDNA E030024N20 gene |
17312 |
0.19 |
chr2_69116662_69116813 | 1.35 |
Nostrin |
nitric oxide synthase trafficker |
19063 |
0.19 |
chr3_145834049_145834216 | 1.31 |
Ddah1 |
dimethylarginine dimethylaminohydrolase 1 |
23653 |
0.18 |
chr2_158702228_158702379 | 1.30 |
Ppp1r16b |
protein phosphatase 1, regulatory subunit 16B |
6168 |
0.17 |
chr2_69355526_69355678 | 1.26 |
Abcb11 |
ATP-binding cassette, sub-family B (MDR/TAP), member 11 |
12986 |
0.17 |
chr1_191154426_191154595 | 1.25 |
Fam71a |
family with sequence similarity 71, member A |
10307 |
0.13 |
chr2_27089302_27089481 | 1.25 |
Adamtsl2 |
ADAMTS-like 2 |
7905 |
0.12 |
chr2_179583110_179583261 | 1.24 |
Gm14300 |
predicted gene 14300 |
30382 |
0.23 |
chr3_30105629_30105802 | 1.23 |
Mecom |
MDS1 and EVI1 complex locus |
34708 |
0.17 |
chr8_36692402_36692571 | 1.22 |
Dlc1 |
deleted in liver cancer 1 |
40568 |
0.2 |
chr3_95523824_95523997 | 1.21 |
Ctss |
cathepsin S |
2876 |
0.14 |
chr3_30421777_30421938 | 1.18 |
Gm37024 |
predicted gene, 37024 |
66569 |
0.09 |
chr2_84459790_84459967 | 1.18 |
Tfpi |
tissue factor pathway inhibitor |
1768 |
0.34 |
chr10_72778559_72778735 | 1.18 |
Gm47094 |
predicted gene, 47094 |
60716 |
0.14 |
chr15_78788187_78788351 | 1.17 |
Card10 |
caspase recruitment domain family, member 10 |
2246 |
0.19 |
chr6_28687920_28688071 | 1.15 |
Snd1 |
staphylococcal nuclease and tudor domain containing 1 |
16914 |
0.23 |
chr15_25496096_25496252 | 1.15 |
Gm48957 |
predicted gene, 48957 |
37685 |
0.14 |
chr2_32731742_32731919 | 1.14 |
6330409D20Rik |
RIKEN cDNA 6330409D20 gene |
3048 |
0.1 |
chr2_152821120_152821280 | 1.14 |
Bcl2l1 |
BCL2-like 1 |
7335 |
0.13 |
chr6_57647294_57647456 | 1.12 |
Gm19244 |
predicted gene, 19244 |
30098 |
0.11 |
chr15_77772952_77773160 | 1.11 |
Myh9 |
myosin, heavy polypeptide 9, non-muscle |
3277 |
0.15 |
chr1_173802690_173802855 | 1.10 |
Ifi203-ps |
interferon activated gene 203, pseudogene |
4502 |
0.15 |
chr17_31828262_31828413 | 1.10 |
Sik1 |
salt inducible kinase 1 |
23238 |
0.14 |
chr10_4079383_4079557 | 1.10 |
Gm25515 |
predicted gene, 25515 |
24843 |
0.17 |
chr18_35707850_35708033 | 1.08 |
Dnajc18 |
DnaJ heat shock protein family (Hsp40) member C18 |
441 |
0.67 |
chr2_6331661_6331857 | 1.07 |
AL845275.1 |
novel protein |
8679 |
0.19 |
chr10_126986975_126987159 | 1.06 |
Ctdsp2 |
CTD (carboxy-terminal domain, RNA polymerase II, polypeptide A) small phosphatase 2 |
8038 |
0.08 |
chr15_64377693_64377894 | 1.06 |
Asap1 |
ArfGAP with SH3 domain, ankyrin repeat and PH domain1 |
4939 |
0.22 |
chr2_160990763_160990931 | 1.05 |
Chd6 |
chromodomain helicase DNA binding protein 6 |
5801 |
0.18 |
chr10_37711570_37711751 | 1.05 |
Gm24710 |
predicted gene, 24710 |
220020 |
0.02 |
chr9_120778497_120778658 | 1.04 |
Gm47066 |
predicted gene, 47066 |
13409 |
0.12 |
chr1_177531902_177532053 | 1.04 |
Gm37280 |
predicted gene, 37280 |
62545 |
0.09 |
chr4_123633972_123634145 | 1.04 |
Gm12926 |
predicted gene 12926 |
3763 |
0.18 |
chr17_8128409_8128574 | 1.03 |
Rnaset2a |
ribonuclease T2A |
19294 |
0.13 |
chr10_39402600_39402751 | 1.03 |
Fyn |
Fyn proto-oncogene |
17334 |
0.19 |
chr19_29238295_29238505 | 1.03 |
Jak2 |
Janus kinase 2 |
13428 |
0.18 |
chr6_125482092_125482283 | 1.03 |
Gm28809 |
predicted gene 28809 |
243 |
0.9 |
chr3_151323989_151324141 | 1.03 |
Gm42949 |
predicted gene 42949 |
9284 |
0.24 |
chr8_105295903_105296238 | 1.03 |
Exoc3l |
exocyst complex component 3-like |
5 |
0.91 |
chr4_35358712_35358863 | 1.02 |
Gm12368 |
predicted gene 12368 |
42271 |
0.17 |
chr9_32504129_32504422 | 1.02 |
Gm27201 |
predicted gene 27201 |
4138 |
0.14 |
chr14_32950949_32951100 | 1.02 |
Lrrc18 |
leucine rich repeat containing 18 |
40358 |
0.14 |
chr17_6998212_6998376 | 1.02 |
Rnaset2b |
ribonuclease T2B |
7638 |
0.13 |
chr16_84972074_84972233 | 1.01 |
Gm10791 |
predicted gene 10791 |
61 |
0.97 |
chr2_134494128_134494279 | 1.01 |
Hao1 |
hydroxyacid oxidase 1, liver |
60104 |
0.15 |
chr15_25459959_25460162 | 1.00 |
Gm48957 |
predicted gene, 48957 |
1571 |
0.37 |
chr2_29973635_29973786 | 0.98 |
Sptan1 |
spectrin alpha, non-erythrocytic 1 |
4670 |
0.13 |
chrX_77448567_77448765 | 0.98 |
Gm5937 |
predicted gene 5937 |
7920 |
0.26 |
chr5_117295118_117295291 | 0.98 |
Gm3786 |
predicted gene 3786 |
798 |
0.45 |
chr2_170318955_170319248 | 0.98 |
Bcas1 |
breast carcinoma amplified sequence 1 |
30639 |
0.15 |
chr7_58746856_58747052 | 0.97 |
Gm44937 |
predicted gene 44937 |
26755 |
0.16 |
chr8_122313304_122313653 | 0.97 |
Zfpm1 |
zinc finger protein, multitype 1 |
6158 |
0.15 |
chr5_137493763_137493914 | 0.95 |
Epo |
erythropoietin |
8022 |
0.07 |
chr17_73786615_73786813 | 0.95 |
Ehd3 |
EH-domain containing 3 |
17420 |
0.2 |
chr19_47886740_47886936 | 0.95 |
Gsto2 |
glutathione S-transferase omega 2 |
16576 |
0.13 |
chr6_115905697_115905848 | 0.95 |
Ift122 |
intraflagellar transport 122 |
3145 |
0.16 |
chr18_69528071_69528262 | 0.94 |
Tcf4 |
transcription factor 4 |
5716 |
0.27 |
chr7_69911860_69912023 | 0.94 |
Gm44690 |
predicted gene 44690 |
27581 |
0.18 |
chr12_84165735_84165922 | 0.93 |
Elmsan1 |
ELM2 and Myb/SANT-like domain containing 1 |
5690 |
0.11 |
chr6_90678833_90678984 | 0.93 |
Gm24816 |
predicted gene, 24816 |
2612 |
0.21 |
chr14_79157797_79157989 | 0.93 |
Gm49015 |
predicted gene, 49015 |
6504 |
0.16 |
chr4_120978377_120978528 | 0.92 |
Smap2 |
small ArfGAP 2 |
2744 |
0.18 |
chr17_29496086_29496540 | 0.92 |
Pim1 |
proviral integration site 1 |
2906 |
0.15 |
chr1_83091481_83091632 | 0.92 |
Gm29518 |
predicted gene 29518 |
24454 |
0.09 |
chr1_72828894_72829045 | 0.92 |
Igfbp2 |
insulin-like growth factor binding protein 2 |
3647 |
0.27 |
chr2_5286550_5286732 | 0.92 |
Gm13197 |
predicted gene 13197 |
2991 |
0.3 |
chr16_91736910_91737079 | 0.91 |
Itsn1 |
intersectin 1 (SH3 domain protein 1A) |
6760 |
0.15 |
chr11_6406247_6406459 | 0.91 |
Mir7651 |
microRNA 7651 |
4723 |
0.11 |
chr16_19960751_19960902 | 0.91 |
Klhl6 |
kelch-like 6 |
5493 |
0.22 |
chr7_100875975_100876142 | 0.90 |
Arhgef17 |
Rho guanine nucleotide exchange factor (GEF) 17 |
3650 |
0.17 |
chr2_35446906_35447057 | 0.90 |
Ggta1 |
glycoprotein galactosyltransferase alpha 1, 3 |
1148 |
0.39 |
chr2_60922422_60922578 | 0.90 |
Rbms1 |
RNA binding motif, single stranded interacting protein 1 |
33470 |
0.19 |
chr1_168536452_168536635 | 0.90 |
Mir6348 |
microRNA 6348 |
45900 |
0.18 |
chr2_134527823_134528003 | 0.89 |
Hao1 |
hydroxyacid oxidase 1, liver |
26394 |
0.25 |
chr11_71817476_71817640 | 0.89 |
Gm22927 |
predicted gene, 22927 |
30648 |
0.16 |
chr4_136466236_136466405 | 0.89 |
Luzp1 |
leucine zipper protein 1 |
3441 |
0.19 |
chr12_15800308_15800483 | 0.89 |
Mir6387 |
microRNA 6387 |
706 |
0.64 |
chr2_169674313_169674490 | 0.89 |
Tshz2 |
teashirt zinc finger family member 2 |
40725 |
0.16 |
chr12_83038886_83039041 | 0.88 |
Rgs6 |
regulator of G-protein signaling 6 |
8027 |
0.22 |
chr1_128440773_128440930 | 0.88 |
Dars |
aspartyl-tRNA synthetase |
23483 |
0.14 |
chr13_101276833_101277035 | 0.88 |
4932411K12Rik |
RIKEN cDNA 4932411K12 gene |
22615 |
0.2 |
chr2_50824872_50825029 | 0.88 |
Gm13498 |
predicted gene 13498 |
84734 |
0.1 |
chr15_34096529_34096680 | 0.88 |
Mtdh |
metadherin |
12751 |
0.16 |
chr2_133480969_133481159 | 0.88 |
Gm14100 |
predicted gene 14100 |
17946 |
0.2 |
chr7_90030647_90030812 | 0.87 |
Gm44860 |
predicted gene 44860 |
158 |
0.92 |
chr13_51293217_51293378 | 0.87 |
Gm6056 |
predicted gene 6056 |
45624 |
0.12 |
chr8_93161284_93161435 | 0.87 |
Gm45910 |
predicted gene 45910 |
7243 |
0.14 |
chr9_23011584_23011737 | 0.87 |
Bmper |
BMP-binding endothelial regulator |
211416 |
0.02 |
chr15_53724232_53724383 | 0.87 |
1700015H07Rik |
RIKEN cDNA 1700015H07 gene |
102652 |
0.07 |
chr7_65375253_65375421 | 0.87 |
Tjp1 |
tight junction protein 1 |
4098 |
0.22 |
chr10_121971764_121971959 | 0.86 |
Srgap1 |
SLIT-ROBO Rho GTPase activating protein 1 |
75447 |
0.08 |
chr18_16213890_16214071 | 0.86 |
Gm7665 |
predicted pseudogene 7665 |
60964 |
0.14 |
chr2_115093304_115093458 | 0.85 |
Gm28493 |
predicted gene 28493 |
42169 |
0.17 |
chr4_86847350_86847506 | 0.85 |
Rps6 |
ribosomal protein S6 |
9904 |
0.19 |
chr10_3871193_3871387 | 0.85 |
Plekhg1 |
pleckstrin homology domain containing, family G (with RhoGef domain) member 1 |
1377 |
0.36 |
chr1_191092186_191092358 | 0.84 |
Batf3 |
basic leucine zipper transcription factor, ATF-like 3 |
5575 |
0.12 |
chr19_38125391_38125548 | 0.84 |
Rbp4 |
retinol binding protein 4, plasma |
188 |
0.93 |
chr2_134493911_134494122 | 0.84 |
Hao1 |
hydroxyacid oxidase 1, liver |
60291 |
0.15 |
chr2_128709541_128709764 | 0.84 |
Mertk |
MER proto-oncogene tyrosine kinase |
10696 |
0.15 |
chr15_94681240_94681391 | 0.84 |
Gm25546 |
predicted gene, 25546 |
71 |
0.98 |
chr7_71872986_71873347 | 0.84 |
4930441H08Rik |
RIKEN cDNA 4930441H08 gene |
36527 |
0.18 |
chr9_21167812_21167963 | 0.84 |
Pde4a |
phosphodiesterase 4A, cAMP specific |
2173 |
0.17 |
chr1_179866505_179866684 | 0.83 |
Gm37070 |
predicted gene, 37070 |
58817 |
0.1 |
chr9_69028339_69028490 | 0.83 |
Rora |
RAR-related orphan receptor alpha |
167127 |
0.04 |
chr12_99559602_99559805 | 0.83 |
Foxn3 |
forkhead box N3 |
3805 |
0.16 |
chr19_29147280_29147431 | 0.83 |
Mir101b |
microRNA 101b |
12076 |
0.14 |
chr4_150307301_150307469 | 0.82 |
Gm13092 |
predicted gene 13092 |
8051 |
0.16 |
chr8_46499459_46499652 | 0.82 |
Acsl1 |
acyl-CoA synthetase long-chain family member 1 |
6723 |
0.16 |
chr14_57729492_57729681 | 0.82 |
Lats2 |
large tumor suppressor 2 |
4714 |
0.15 |
chr5_112908382_112908548 | 0.82 |
Myo18b |
myosin XVIIIb |
12103 |
0.19 |
chr15_97720259_97720503 | 0.82 |
Endou |
endonuclease, polyU-specific |
769 |
0.57 |
chr2_18937664_18937815 | 0.81 |
Pip4k2a |
phosphatidylinositol-5-phosphate 4-kinase, type II, alpha |
31465 |
0.19 |
chr10_91080633_91080784 | 0.81 |
Apaf1 |
apoptotic peptidase activating factor 1 |
1721 |
0.28 |
chr15_59052928_59053308 | 0.81 |
Mtss1 |
MTSS I-BAR domain containing 1 |
2346 |
0.34 |
chr10_37338264_37338474 | 0.81 |
Gm26535 |
predicted gene, 26535 |
883 |
0.71 |
chr16_44172954_44173125 | 0.81 |
Usf3 |
upstream transcription factor family member 3 |
207 |
0.94 |
chr16_34927142_34927339 | 0.81 |
Mylk |
myosin, light polypeptide kinase |
3102 |
0.24 |
chr18_75382626_75382777 | 0.81 |
Smad7 |
SMAD family member 7 |
7787 |
0.22 |
chr2_59838905_59839105 | 0.80 |
Tanc1 |
tetratricopeptide repeat, ankyrin repeat and coiled-coil containing 1 |
2735 |
0.31 |
chr8_35919685_35919836 | 0.80 |
5430403N17Rik |
RIKEN cDNA 5430403N17 gene |
36803 |
0.15 |
chr2_80435338_80435489 | 0.80 |
Frzb |
frizzled-related protein |
3217 |
0.24 |
chr10_107361652_107361839 | 0.80 |
Gm38117 |
predicted gene, 38117 |
75614 |
0.09 |
chr2_160763946_160764097 | 0.80 |
Plcg1 |
phospholipase C, gamma 1 |
3903 |
0.2 |
chr19_47292505_47292656 | 0.79 |
Mir6995 |
microRNA 6995 |
18991 |
0.13 |
chr14_54399188_54399376 | 0.79 |
Slc7a7 |
solute carrier family 7 (cationic amino acid transporter, y+ system), member 7 |
1328 |
0.26 |
chr14_121648544_121648711 | 0.79 |
Dock9 |
dedicator of cytokinesis 9 |
43383 |
0.16 |
chr15_26639292_26639449 | 0.79 |
9430068D22Rik |
RIKEN cDNA 9430068D22 gene |
5919 |
0.2 |
chr13_52236242_52236425 | 0.79 |
Gm48199 |
predicted gene, 48199 |
55922 |
0.15 |
chr11_63377101_63377266 | 0.79 |
B130011K05Rik |
RIKEN cDNA B130011K05 gene |
35986 |
0.18 |
chr4_133929262_133929424 | 0.78 |
Hmgn2 |
high mobility group nucleosomal binding domain 2 |
37900 |
0.09 |
chr14_24748254_24748435 | 0.78 |
Gm47906 |
predicted gene, 47906 |
85291 |
0.08 |
chr9_102709863_102710063 | 0.78 |
Amotl2 |
angiomotin-like 2 |
6709 |
0.13 |
chr17_47295314_47295504 | 0.78 |
Trerf1 |
transcriptional regulating factor 1 |
1340 |
0.4 |
chr7_130015298_130015740 | 0.77 |
Gm23847 |
predicted gene, 23847 |
19575 |
0.24 |
chr10_122008831_122008995 | 0.77 |
Srgap1 |
SLIT-ROBO Rho GTPase activating protein 1 |
38395 |
0.13 |
chr12_100299433_100299609 | 0.77 |
Gm10432 |
predicted gene 10432 |
9236 |
0.17 |
chr5_65350375_65350552 | 0.77 |
Klb |
klotho beta |
2055 |
0.21 |
chr3_59228865_59229051 | 0.77 |
P2ry12 |
purinergic receptor P2Y, G-protein coupled 12 |
1377 |
0.34 |
chr7_18927869_18928042 | 0.76 |
Nova2 |
NOVA alternative splicing regulator 2 |
2067 |
0.18 |
chr13_38193530_38193695 | 0.76 |
Snrnp48 |
small nuclear ribonucleoprotein 48 (U11/U12) |
11326 |
0.16 |
chr14_41198259_41198468 | 0.75 |
Gm47114 |
predicted gene, 47114 |
6710 |
0.12 |
chr5_114378364_114378515 | 0.75 |
Kctd10 |
potassium channel tetramerisation domain containing 10 |
2044 |
0.21 |
chr1_88194822_88195116 | 0.75 |
Gm15376 |
predicted gene 15376 |
3068 |
0.09 |
chr3_53487162_53487314 | 0.75 |
Stoml3 |
stomatin (Epb7.2)-like 3 |
1415 |
0.29 |
chr2_31825447_31825664 | 0.75 |
Qrfp |
pyroglutamylated RFamide peptide |
14975 |
0.13 |
chr4_105257759_105257936 | 0.75 |
Plpp3 |
phospholipid phosphatase 3 |
100500 |
0.08 |
chr5_115882251_115882451 | 0.75 |
Cit |
citron |
4067 |
0.19 |
chr7_122821025_122821193 | 0.75 |
Gm29759 |
predicted gene, 29759 |
16854 |
0.23 |
chr1_131384549_131384725 | 0.75 |
Gm37954 |
predicted gene, 37954 |
6106 |
0.15 |
chr6_116004145_116004296 | 0.74 |
Plxnd1 |
plexin D1 |
9215 |
0.16 |
chrX_164233517_164233702 | 0.74 |
Bmx |
BMX non-receptor tyrosine kinase |
16759 |
0.15 |
chr5_67943306_67943479 | 0.74 |
4930425K10Rik |
RIKEN cDNA 4930425K10 gene |
309 |
0.81 |
chr2_158783086_158783239 | 0.74 |
Fam83d |
family with sequence similarity 83, member D |
1754 |
0.34 |
chr1_55193432_55193603 | 0.73 |
Rftn2 |
raftlin family member 2 |
12972 |
0.12 |
chr9_31996587_31996865 | 0.73 |
Gm47465 |
predicted gene, 47465 |
8734 |
0.17 |
chr3_38283649_38283939 | 0.73 |
Gm2965 |
predicted gene 2965 |
60343 |
0.11 |
chr7_116409508_116409690 | 0.73 |
C430039J01Rik |
RIKEN cDNA C430039J01 gene |
1204 |
0.38 |
chr17_15712952_15713118 | 0.73 |
Chd1 |
chromodomain helicase DNA binding protein 1 |
8017 |
0.21 |
chr9_26923072_26923237 | 0.73 |
Gm1110 |
predicted gene 1110 |
43 |
0.97 |
chr2_166620161_166620317 | 0.73 |
Prex1 |
phosphatidylinositol-3,4,5-trisphosphate-dependent Rac exchange factor 1 |
17152 |
0.2 |
chr4_137498458_137498639 | 0.73 |
Hspg2 |
perlecan (heparan sulfate proteoglycan 2) |
23911 |
0.12 |
chr4_123427592_123427944 | 0.73 |
Gm12924 |
predicted gene 12924 |
7849 |
0.18 |
chr13_63112102_63112269 | 0.73 |
Aopep |
aminopeptidase O |
4663 |
0.18 |
chr17_10738070_10738247 | 0.72 |
Gm16169 |
predicted gene 16169 |
69676 |
0.11 |
chr14_46872666_46872817 | 0.72 |
Gm34934 |
predicted gene, 34934 |
7961 |
0.1 |
chr2_169996026_169996202 | 0.72 |
AY702102 |
cDNA sequence AY702102 |
32927 |
0.22 |
chr4_59363155_59363315 | 0.72 |
Susd1 |
sushi domain containing 1 |
253 |
0.93 |
chr10_60333742_60333910 | 0.72 |
Cdh23 |
cadherin 23 (otocadherin) |
12241 |
0.18 |
chr15_84714847_84715041 | 0.71 |
Arhgap8 |
Rho GTPase activating protein 8 |
5108 |
0.18 |
chr7_121045679_121045861 | 0.71 |
Gm27991 |
predicted gene, 27991 |
5290 |
0.09 |
chr5_99362991_99363432 | 0.71 |
Gm35394 |
predicted gene, 35394 |
89116 |
0.08 |
chr4_127278699_127278881 | 0.71 |
Gm22221 |
predicted gene, 22221 |
6043 |
0.14 |
chr2_59726132_59726380 | 0.70 |
Tanc1 |
tetratricopeptide repeat, ankyrin repeat and coiled-coil containing 1 |
16546 |
0.26 |
chr5_72554449_72554600 | 0.70 |
Gm43815 |
predicted gene 43815 |
705 |
0.53 |
chr11_61590567_61590914 | 0.70 |
Epn2 |
epsin 2 |
11053 |
0.16 |
chr17_25083510_25083825 | 0.70 |
Tmem204 |
transmembrane protein 204 |
76 |
0.95 |
chr9_118655096_118655280 | 0.70 |
Itga9 |
integrin alpha 9 |
30647 |
0.17 |
chr17_63921711_63921914 | 0.70 |
Fer |
fer (fms/fps related) protein kinase |
16160 |
0.26 |
chr4_22264008_22264159 | 0.70 |
Gm11882 |
predicted gene 11882 |
11750 |
0.25 |
chr5_104374367_104374526 | 0.70 |
Mepe |
matrix extracellular phosphoglycoprotein with ASARM motif (bone) |
49117 |
0.1 |
chr3_100167851_100168005 | 0.69 |
Gdap2 |
ganglioside-induced differentiation-associated-protein 2 |
5384 |
0.21 |
chr7_71419354_71419520 | 0.69 |
Gm29328 |
predicted gene 29328 |
49104 |
0.14 |
chr17_70845658_70845823 | 0.69 |
Tgif1 |
TGFB-induced factor homeobox 1 |
586 |
0.59 |
chr5_100557088_100557255 | 0.69 |
Plac8 |
placenta-specific 8 |
5687 |
0.14 |
chr19_7019357_7019530 | 0.69 |
Fermt3 |
fermitin family member 3 |
13 |
0.94 |
chr5_135782110_135782261 | 0.69 |
Mdh2 |
malate dehydrogenase 2, NAD (mitochondrial) |
3463 |
0.13 |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.3 | 0.9 | GO:1901509 | regulation of endothelial tube morphogenesis(GO:1901509) |
0.3 | 0.8 | GO:0034633 | retinol transport(GO:0034633) isoprenoid transport(GO:0046864) terpenoid transport(GO:0046865) |
0.2 | 0.5 | GO:2000449 | regulation of CD8-positive, alpha-beta T cell extravasation(GO:2000449) |
0.2 | 0.5 | GO:1901078 | negative regulation of relaxation of muscle(GO:1901078) |
0.1 | 0.5 | GO:1903142 | positive regulation of endothelial cell development(GO:1901552) positive regulation of establishment of endothelial barrier(GO:1903142) |
0.1 | 0.4 | GO:1902309 | negative regulation of peptidyl-serine dephosphorylation(GO:1902309) |
0.1 | 0.4 | GO:0097296 | activation of cysteine-type endopeptidase activity involved in apoptotic signaling pathway(GO:0097296) |
0.1 | 0.6 | GO:0001561 | fatty acid alpha-oxidation(GO:0001561) |
0.1 | 0.6 | GO:2000668 | dendritic cell apoptotic process(GO:0097048) regulation of dendritic cell apoptotic process(GO:2000668) |
0.1 | 0.4 | GO:0045658 | regulation of neutrophil differentiation(GO:0045658) |
0.1 | 0.3 | GO:1900245 | positive regulation of MDA-5 signaling pathway(GO:1900245) |
0.1 | 1.2 | GO:1902547 | regulation of vascular endothelial growth factor signaling pathway(GO:1900746) regulation of cellular response to vascular endothelial growth factor stimulus(GO:1902547) |
0.1 | 0.5 | GO:0050904 | diapedesis(GO:0050904) |
0.1 | 0.1 | GO:1902226 | regulation of macrophage colony-stimulating factor signaling pathway(GO:1902226) regulation of response to macrophage colony-stimulating factor(GO:1903969) regulation of cellular response to macrophage colony-stimulating factor stimulus(GO:1903972) |
0.1 | 0.7 | GO:0033632 | regulation of cell-cell adhesion mediated by integrin(GO:0033632) |
0.1 | 0.4 | GO:0010897 | negative regulation of triglyceride catabolic process(GO:0010897) |
0.1 | 0.1 | GO:0033625 | positive regulation of integrin activation(GO:0033625) |
0.1 | 0.5 | GO:0042097 | interleukin-4 biosynthetic process(GO:0042097) regulation of interleukin-4 biosynthetic process(GO:0045402) |
0.1 | 0.3 | GO:0048294 | negative regulation of isotype switching to IgE isotypes(GO:0048294) |
0.1 | 0.3 | GO:1904139 | microglial cell migration(GO:1904124) regulation of microglial cell migration(GO:1904139) |
0.1 | 0.5 | GO:0060666 | dichotomous subdivision of terminal units involved in salivary gland branching(GO:0060666) |
0.1 | 0.4 | GO:0051295 | establishment of meiotic spindle localization(GO:0051295) |
0.1 | 0.4 | GO:0001920 | negative regulation of receptor recycling(GO:0001920) |
0.1 | 0.2 | GO:0018171 | peptidyl-cysteine oxidation(GO:0018171) |
0.1 | 0.3 | GO:0032079 | positive regulation of endodeoxyribonuclease activity(GO:0032079) |
0.1 | 0.3 | GO:0021564 | vagus nerve development(GO:0021564) |
0.1 | 0.4 | GO:0002322 | B cell proliferation involved in immune response(GO:0002322) |
0.1 | 1.0 | GO:0051601 | exocyst localization(GO:0051601) |
0.1 | 0.4 | GO:0072675 | osteoclast fusion(GO:0072675) |
0.1 | 0.2 | GO:0071462 | cellular response to water stimulus(GO:0071462) |
0.1 | 0.3 | GO:0038161 | prolactin signaling pathway(GO:0038161) |
0.1 | 0.2 | GO:0003032 | detection of oxygen(GO:0003032) |
0.1 | 0.2 | GO:0070537 | histone H2A K63-linked deubiquitination(GO:0070537) |
0.1 | 0.4 | GO:0071476 | cellular hypotonic response(GO:0071476) |
0.1 | 0.2 | GO:0032911 | negative regulation of transforming growth factor beta1 production(GO:0032911) |
0.1 | 0.2 | GO:0036091 | positive regulation of transcription from RNA polymerase II promoter in response to oxidative stress(GO:0036091) |
0.1 | 0.4 | GO:0034242 | negative regulation of syncytium formation by plasma membrane fusion(GO:0034242) |
0.1 | 0.7 | GO:0032367 | intracellular cholesterol transport(GO:0032367) |
0.1 | 0.7 | GO:0022027 | interkinetic nuclear migration(GO:0022027) |
0.1 | 0.2 | GO:0042726 | flavin-containing compound metabolic process(GO:0042726) |
0.1 | 0.1 | GO:0035696 | monocyte extravasation(GO:0035696) regulation of monocyte extravasation(GO:2000437) |
0.1 | 0.4 | GO:0090160 | Golgi to lysosome transport(GO:0090160) |
0.1 | 0.1 | GO:0044004 | killing by symbiont of host cells(GO:0001907) disruption by symbiont of host cell(GO:0044004) |
0.1 | 0.3 | GO:0021914 | negative regulation of smoothened signaling pathway involved in ventral spinal cord patterning(GO:0021914) |
0.1 | 1.1 | GO:0007202 | activation of phospholipase C activity(GO:0007202) |
0.1 | 0.3 | GO:0070836 | caveola assembly(GO:0070836) |
0.1 | 0.3 | GO:0051031 | tRNA transport(GO:0051031) |
0.1 | 0.3 | GO:1903377 | negative regulation of oxidative stress-induced neuron intrinsic apoptotic signaling pathway(GO:1903377) |
0.1 | 0.2 | GO:0036151 | phosphatidylcholine acyl-chain remodeling(GO:0036151) |
0.1 | 0.2 | GO:0002513 | tolerance induction to self antigen(GO:0002513) |
0.1 | 0.2 | GO:0090271 | positive regulation of fibroblast growth factor production(GO:0090271) |
0.1 | 0.4 | GO:0031659 | positive regulation of cyclin-dependent protein serine/threonine kinase activity involved in G1/S transition of mitotic cell cycle(GO:0031659) |
0.1 | 0.1 | GO:0070294 | renal sodium ion absorption(GO:0070294) |
0.1 | 0.3 | GO:0033353 | S-adenosylmethionine cycle(GO:0033353) |
0.1 | 0.3 | GO:0030578 | PML body organization(GO:0030578) |
0.1 | 0.3 | GO:0060283 | negative regulation of oocyte development(GO:0060283) |
0.1 | 0.2 | GO:2000857 | positive regulation of mineralocorticoid secretion(GO:2000857) positive regulation of aldosterone secretion(GO:2000860) |
0.1 | 0.5 | GO:0023035 | CD40 signaling pathway(GO:0023035) |
0.1 | 0.1 | GO:0010986 | positive regulation of lipoprotein particle clearance(GO:0010986) |
0.1 | 0.5 | GO:0034427 | nuclear-transcribed mRNA catabolic process, exonucleolytic, 3'-5'(GO:0034427) |
0.1 | 0.3 | GO:0006528 | asparagine metabolic process(GO:0006528) |
0.1 | 0.5 | GO:0030644 | cellular chloride ion homeostasis(GO:0030644) |
0.1 | 0.1 | GO:0045074 | interleukin-10 biosynthetic process(GO:0042091) regulation of interleukin-10 biosynthetic process(GO:0045074) |
0.1 | 0.3 | GO:0046618 | drug export(GO:0046618) |
0.1 | 0.4 | GO:0002315 | marginal zone B cell differentiation(GO:0002315) |
0.1 | 0.5 | GO:0048387 | negative regulation of retinoic acid receptor signaling pathway(GO:0048387) |
0.1 | 0.2 | GO:0008635 | activation of cysteine-type endopeptidase activity involved in apoptotic process by cytochrome c(GO:0008635) |
0.1 | 0.2 | GO:1902219 | intrinsic apoptotic signaling pathway in response to osmotic stress(GO:0008627) regulation of intrinsic apoptotic signaling pathway in response to osmotic stress(GO:1902218) negative regulation of intrinsic apoptotic signaling pathway in response to osmotic stress(GO:1902219) |
0.1 | 0.2 | GO:1903352 | ornithine transport(GO:0015822) L-ornithine transmembrane transport(GO:1903352) |
0.1 | 0.1 | GO:0002434 | immune complex clearance(GO:0002434) |
0.1 | 0.2 | GO:0051562 | negative regulation of mitochondrial calcium ion concentration(GO:0051562) |
0.1 | 0.3 | GO:0045759 | negative regulation of action potential(GO:0045759) |
0.1 | 0.1 | GO:1902109 | negative regulation of mitochondrial membrane permeability involved in apoptotic process(GO:1902109) |
0.1 | 0.2 | GO:0032074 | negative regulation of nuclease activity(GO:0032074) |
0.1 | 0.2 | GO:1902498 | regulation of protein autoubiquitination(GO:1902498) |
0.1 | 0.2 | GO:0035523 | protein K29-linked deubiquitination(GO:0035523) protein K33-linked deubiquitination(GO:1990168) |
0.1 | 0.2 | GO:0060128 | corticotropin hormone secreting cell differentiation(GO:0060128) |
0.1 | 0.4 | GO:0072102 | glomerulus morphogenesis(GO:0072102) |
0.1 | 0.6 | GO:0002467 | germinal center formation(GO:0002467) |
0.1 | 0.3 | GO:1902993 | positive regulation of beta-amyloid formation(GO:1902004) positive regulation of amyloid precursor protein catabolic process(GO:1902993) |
0.0 | 0.2 | GO:0002906 | mature B cell apoptotic process(GO:0002901) regulation of mature B cell apoptotic process(GO:0002905) negative regulation of mature B cell apoptotic process(GO:0002906) |
0.0 | 0.0 | GO:0045006 | DNA deamination(GO:0045006) |
0.0 | 0.3 | GO:0060373 | regulation of ventricular cardiac muscle cell membrane depolarization(GO:0060373) |
0.0 | 0.1 | GO:1903121 | regulation of TRAIL-activated apoptotic signaling pathway(GO:1903121) positive regulation of TRAIL-activated apoptotic signaling pathway(GO:1903984) |
0.0 | 1.1 | GO:0001945 | lymph vessel development(GO:0001945) |
0.0 | 0.2 | GO:0043497 | regulation of protein heterodimerization activity(GO:0043497) |
0.0 | 0.1 | GO:0098903 | regulation of membrane repolarization during action potential(GO:0098903) |
0.0 | 0.3 | GO:0048563 | post-embryonic organ morphogenesis(GO:0048563) |
0.0 | 0.1 | GO:0090283 | regulation of protein glycosylation in Golgi(GO:0090283) |
0.0 | 0.0 | GO:0070094 | positive regulation of glucagon secretion(GO:0070094) |
0.0 | 0.4 | GO:0097062 | dendritic spine maintenance(GO:0097062) |
0.0 | 0.1 | GO:0032286 | central nervous system myelin maintenance(GO:0032286) |
0.0 | 0.3 | GO:0090557 | establishment of endothelial intestinal barrier(GO:0090557) |
0.0 | 0.2 | GO:0007196 | adenylate cyclase-inhibiting G-protein coupled glutamate receptor signaling pathway(GO:0007196) |
0.0 | 0.1 | GO:2000110 | negative regulation of macrophage apoptotic process(GO:2000110) |
0.0 | 0.1 | GO:0046341 | CDP-diacylglycerol metabolic process(GO:0046341) |
0.0 | 0.1 | GO:0006868 | glutamine transport(GO:0006868) |
0.0 | 0.2 | GO:0031581 | hemidesmosome assembly(GO:0031581) |
0.0 | 0.2 | GO:0007296 | vitellogenesis(GO:0007296) |
0.0 | 0.2 | GO:0046881 | positive regulation of follicle-stimulating hormone secretion(GO:0046881) |
0.0 | 0.1 | GO:0060154 | cellular process regulating host cell cycle in response to virus(GO:0060154) |
0.0 | 0.2 | GO:1902261 | positive regulation of delayed rectifier potassium channel activity(GO:1902261) positive regulation of voltage-gated potassium channel activity(GO:1903818) |
0.0 | 0.2 | GO:0018230 | peptidyl-L-cysteine S-palmitoylation(GO:0018230) peptidyl-S-diacylglycerol-L-cysteine biosynthetic process from peptidyl-cysteine(GO:0018231) |
0.0 | 0.1 | GO:2000304 | positive regulation of sphingolipid biosynthetic process(GO:0090154) positive regulation of ceramide biosynthetic process(GO:2000304) |
0.0 | 0.1 | GO:2000418 | positive regulation of eosinophil migration(GO:2000418) |
0.0 | 0.1 | GO:0001732 | formation of cytoplasmic translation initiation complex(GO:0001732) |
0.0 | 0.1 | GO:0045657 | positive regulation of monocyte differentiation(GO:0045657) |
0.0 | 0.5 | GO:0048672 | positive regulation of collateral sprouting(GO:0048672) |
0.0 | 0.4 | GO:0061299 | retina vasculature morphogenesis in camera-type eye(GO:0061299) |
0.0 | 0.1 | GO:0061643 | chemorepulsion of axon(GO:0061643) |
0.0 | 0.2 | GO:0010288 | response to lead ion(GO:0010288) |
0.0 | 0.1 | GO:0042222 | interleukin-1 biosynthetic process(GO:0042222) |
0.0 | 0.1 | GO:0090230 | regulation of centromere complex assembly(GO:0090230) |
0.0 | 0.1 | GO:1900126 | negative regulation of hyaluronan biosynthetic process(GO:1900126) |
0.0 | 0.3 | GO:2000786 | positive regulation of autophagosome assembly(GO:2000786) |
0.0 | 0.1 | GO:2000097 | regulation of smooth muscle cell-matrix adhesion(GO:2000097) |
0.0 | 0.2 | GO:1903672 | positive regulation of sprouting angiogenesis(GO:1903672) |
0.0 | 0.5 | GO:0007250 | activation of NF-kappaB-inducing kinase activity(GO:0007250) |
0.0 | 0.1 | GO:0016095 | polyprenol catabolic process(GO:0016095) |
0.0 | 0.1 | GO:0035973 | aggrephagy(GO:0035973) |
0.0 | 0.0 | GO:0035995 | detection of muscle stretch(GO:0035995) |
0.0 | 0.3 | GO:0071404 | cellular response to low-density lipoprotein particle stimulus(GO:0071404) |
0.0 | 0.1 | GO:1900227 | positive regulation of NLRP3 inflammasome complex assembly(GO:1900227) |
0.0 | 0.1 | GO:0031448 | regulation of fast-twitch skeletal muscle fiber contraction(GO:0031446) positive regulation of fast-twitch skeletal muscle fiber contraction(GO:0031448) |
0.0 | 0.2 | GO:0003223 | ventricular compact myocardium morphogenesis(GO:0003223) |
0.0 | 0.0 | GO:0045626 | negative regulation of T-helper 1 cell differentiation(GO:0045626) |
0.0 | 0.1 | GO:0006556 | S-adenosylmethionine biosynthetic process(GO:0006556) |
0.0 | 0.1 | GO:1990414 | replication-born double-strand break repair via sister chromatid exchange(GO:1990414) |
0.0 | 0.1 | GO:0071225 | cellular response to muramyl dipeptide(GO:0071225) |
0.0 | 0.0 | GO:1903598 | positive regulation of gap junction assembly(GO:1903598) |
0.0 | 0.1 | GO:0010994 | regulation of ubiquitin homeostasis(GO:0010993) free ubiquitin chain polymerization(GO:0010994) |
0.0 | 0.4 | GO:0033523 | histone H2B ubiquitination(GO:0033523) |
0.0 | 0.1 | GO:0070103 | regulation of interleukin-6-mediated signaling pathway(GO:0070103) |
0.0 | 0.6 | GO:0010447 | response to acidic pH(GO:0010447) |
0.0 | 0.1 | GO:1902837 | amino acid import into cell(GO:1902837) |
0.0 | 0.0 | GO:0014744 | positive regulation of muscle adaptation(GO:0014744) |
0.0 | 0.0 | GO:0010871 | negative regulation of receptor biosynthetic process(GO:0010871) |
0.0 | 0.2 | GO:0032959 | inositol trisphosphate biosynthetic process(GO:0032959) |
0.0 | 0.1 | GO:1903238 | positive regulation of leukocyte tethering or rolling(GO:1903238) |
0.0 | 0.1 | GO:0070102 | interleukin-6-mediated signaling pathway(GO:0070102) |
0.0 | 0.1 | GO:1900104 | hyaluranon cable assembly(GO:0036118) regulation of hyaluranon cable assembly(GO:1900104) positive regulation of hyaluranon cable assembly(GO:1900106) |
0.0 | 0.3 | GO:0032836 | glomerular basement membrane development(GO:0032836) |
0.0 | 0.1 | GO:0043137 | DNA replication, removal of RNA primer(GO:0043137) |
0.0 | 0.8 | GO:0006491 | N-glycan processing(GO:0006491) |
0.0 | 0.1 | GO:1901421 | positive regulation of response to alcohol(GO:1901421) |
0.0 | 0.3 | GO:0032486 | Rap protein signal transduction(GO:0032486) |
0.0 | 0.1 | GO:2000562 | negative regulation of CD4-positive, alpha-beta T cell proliferation(GO:2000562) |
0.0 | 0.1 | GO:1902202 | regulation of hepatocyte growth factor receptor signaling pathway(GO:1902202) |
0.0 | 0.1 | GO:0071883 | activation of MAPK activity by adrenergic receptor signaling pathway(GO:0071883) |
0.0 | 0.4 | GO:0050872 | white fat cell differentiation(GO:0050872) |
0.0 | 0.3 | GO:0040016 | embryonic cleavage(GO:0040016) |
0.0 | 0.1 | GO:0070366 | regulation of hepatocyte differentiation(GO:0070366) |
0.0 | 0.1 | GO:0050923 | regulation of negative chemotaxis(GO:0050923) |
0.0 | 0.1 | GO:0043309 | regulation of eosinophil degranulation(GO:0043309) |
0.0 | 0.1 | GO:1904263 | positive regulation of TORC1 signaling(GO:1904263) |
0.0 | 0.1 | GO:0035589 | G-protein coupled purinergic nucleotide receptor signaling pathway(GO:0035589) |
0.0 | 0.2 | GO:0035948 | positive regulation of gluconeogenesis by positive regulation of transcription from RNA polymerase II promoter(GO:0035948) |
0.0 | 0.2 | GO:1901621 | negative regulation of smoothened signaling pathway involved in dorsal/ventral neural tube patterning(GO:1901621) |
0.0 | 0.1 | GO:0002309 | T cell proliferation involved in immune response(GO:0002309) |
0.0 | 0.2 | GO:0050917 | sensory perception of umami taste(GO:0050917) |
0.0 | 0.1 | GO:0036066 | protein O-linked fucosylation(GO:0036066) |
0.0 | 0.0 | GO:0032077 | positive regulation of deoxyribonuclease activity(GO:0032077) |
0.0 | 0.1 | GO:0021590 | cerebellum maturation(GO:0021590) |
0.0 | 0.8 | GO:0035458 | cellular response to interferon-beta(GO:0035458) |
0.0 | 0.2 | GO:0010991 | negative regulation of SMAD protein complex assembly(GO:0010991) |
0.0 | 0.2 | GO:1990118 | sodium ion import across plasma membrane(GO:0098719) sodium ion import into cell(GO:1990118) |
0.0 | 0.1 | GO:0015712 | hexose phosphate transport(GO:0015712) glucose-6-phosphate transport(GO:0015760) |
0.0 | 0.1 | GO:0061047 | positive regulation of branching involved in lung morphogenesis(GO:0061047) |
0.0 | 0.1 | GO:0003347 | epicardial cell to mesenchymal cell transition(GO:0003347) |
0.0 | 0.1 | GO:0000480 | endonucleolytic cleavage in 5'-ETS of tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000480) |
0.0 | 0.1 | GO:2000019 | negative regulation of male gonad development(GO:2000019) |
0.0 | 0.1 | GO:0070278 | extracellular matrix constituent secretion(GO:0070278) |
0.0 | 0.1 | GO:0001834 | trophectodermal cell proliferation(GO:0001834) |
0.0 | 0.2 | GO:0019800 | peptide cross-linking via chondroitin 4-sulfate glycosaminoglycan(GO:0019800) |
0.0 | 0.2 | GO:0007144 | female meiosis I(GO:0007144) |
0.0 | 0.1 | GO:0080154 | regulation of fertilization(GO:0080154) |
0.0 | 0.1 | GO:0014028 | notochord formation(GO:0014028) |
0.0 | 0.2 | GO:0006384 | transcription initiation from RNA polymerase III promoter(GO:0006384) |
0.0 | 0.2 | GO:0045651 | positive regulation of macrophage differentiation(GO:0045651) |
0.0 | 0.1 | GO:0090074 | negative regulation of protein homodimerization activity(GO:0090074) |
0.0 | 0.2 | GO:0042448 | progesterone metabolic process(GO:0042448) |
0.0 | 0.1 | GO:1903265 | positive regulation of tumor necrosis factor-mediated signaling pathway(GO:1903265) |
0.0 | 0.1 | GO:0046654 | tetrahydrofolate biosynthetic process(GO:0046654) |
0.0 | 0.0 | GO:0097252 | oligodendrocyte apoptotic process(GO:0097252) |
0.0 | 0.0 | GO:0039534 | negative regulation of MDA-5 signaling pathway(GO:0039534) |
0.0 | 0.1 | GO:2000507 | positive regulation of energy homeostasis(GO:2000507) |
0.0 | 0.5 | GO:0001779 | natural killer cell differentiation(GO:0001779) |
0.0 | 0.1 | GO:0071394 | cellular response to testosterone stimulus(GO:0071394) |
0.0 | 0.2 | GO:0021902 | commitment of neuronal cell to specific neuron type in forebrain(GO:0021902) |
0.0 | 0.1 | GO:0001828 | inner cell mass cellular morphogenesis(GO:0001828) |
0.0 | 0.1 | GO:0072092 | ureteric bud invasion(GO:0072092) |
0.0 | 0.1 | GO:0043369 | CD4-positive or CD8-positive, alpha-beta T cell lineage commitment(GO:0043369) |
0.0 | 0.1 | GO:0034141 | positive regulation of toll-like receptor 3 signaling pathway(GO:0034141) |
0.0 | 0.3 | GO:0006309 | apoptotic DNA fragmentation(GO:0006309) |
0.0 | 0.1 | GO:0090238 | positive regulation of arachidonic acid secretion(GO:0090238) |
0.0 | 0.1 | GO:2000525 | regulation of T cell costimulation(GO:2000523) positive regulation of T cell costimulation(GO:2000525) |
0.0 | 0.1 | GO:0010728 | regulation of hydrogen peroxide biosynthetic process(GO:0010728) |
0.0 | 0.1 | GO:0019230 | proprioception(GO:0019230) |
0.0 | 0.2 | GO:0046886 | positive regulation of hormone biosynthetic process(GO:0046886) |
0.0 | 0.3 | GO:0070166 | enamel mineralization(GO:0070166) |
0.0 | 0.1 | GO:0036486 | trunk segmentation(GO:0035290) trunk neural crest cell migration(GO:0036484) ventral trunk neural crest cell migration(GO:0036486) sympathetic neuron projection extension(GO:0097490) sympathetic neuron projection guidance(GO:0097491) |
0.0 | 0.1 | GO:0060618 | nipple development(GO:0060618) |
0.0 | 0.1 | GO:0008588 | release of cytoplasmic sequestered NF-kappaB(GO:0008588) |
0.0 | 0.1 | GO:0042420 | dopamine catabolic process(GO:0042420) |
0.0 | 0.1 | GO:0002019 | regulation of renal output by angiotensin(GO:0002019) |
0.0 | 0.1 | GO:0048633 | positive regulation of skeletal muscle tissue growth(GO:0048633) |
0.0 | 0.1 | GO:0006189 | 'de novo' IMP biosynthetic process(GO:0006189) |
0.0 | 0.1 | GO:0090258 | negative regulation of mitochondrial fission(GO:0090258) |
0.0 | 0.3 | GO:0030225 | macrophage differentiation(GO:0030225) |
0.0 | 0.1 | GO:0098739 | import across plasma membrane(GO:0098739) |
0.0 | 0.1 | GO:2001280 | positive regulation of prostaglandin biosynthetic process(GO:0031394) positive regulation of unsaturated fatty acid biosynthetic process(GO:2001280) |
0.0 | 0.1 | GO:2000491 | positive regulation of hepatic stellate cell activation(GO:2000491) |
0.0 | 0.1 | GO:2000811 | negative regulation of anoikis(GO:2000811) |
0.0 | 0.1 | GO:0030886 | negative regulation of myeloid dendritic cell activation(GO:0030886) |
0.0 | 0.1 | GO:0070365 | hepatocyte differentiation(GO:0070365) |
0.0 | 0.2 | GO:0052697 | xenobiotic glucuronidation(GO:0052697) |
0.0 | 0.1 | GO:0071679 | commissural neuron axon guidance(GO:0071679) |
0.0 | 0.2 | GO:0048739 | cardiac muscle fiber development(GO:0048739) |
0.0 | 0.1 | GO:0014022 | neural plate elongation(GO:0014022) convergent extension involved in neural plate elongation(GO:0022007) |
0.0 | 0.2 | GO:0036120 | response to platelet-derived growth factor(GO:0036119) cellular response to platelet-derived growth factor stimulus(GO:0036120) |
0.0 | 0.1 | GO:1903261 | regulation of serine phosphorylation of STAT3 protein(GO:1903261) |
0.0 | 0.1 | GO:0042276 | error-prone translesion synthesis(GO:0042276) |
0.0 | 0.2 | GO:0001780 | neutrophil homeostasis(GO:0001780) |
0.0 | 0.1 | GO:1901550 | regulation of endothelial cell development(GO:1901550) regulation of establishment of endothelial barrier(GO:1903140) |
0.0 | 0.0 | GO:1900019 | regulation of protein kinase C activity(GO:1900019) positive regulation of protein kinase C activity(GO:1900020) |
0.0 | 0.3 | GO:0050774 | negative regulation of dendrite morphogenesis(GO:0050774) |
0.0 | 0.2 | GO:0006610 | ribosomal protein import into nucleus(GO:0006610) |
0.0 | 0.1 | GO:0097460 | ferrous iron import into cell(GO:0097460) |
0.0 | 0.1 | GO:0007525 | somatic muscle development(GO:0007525) |
0.0 | 0.1 | GO:0051697 | protein delipidation(GO:0051697) |
0.0 | 0.0 | GO:0001796 | type IIa hypersensitivity(GO:0001794) regulation of type IIa hypersensitivity(GO:0001796) positive regulation of type IIa hypersensitivity(GO:0001798) type II hypersensitivity(GO:0002445) regulation of type II hypersensitivity(GO:0002892) positive regulation of type II hypersensitivity(GO:0002894) |
0.0 | 0.1 | GO:1990928 | response to amino acid starvation(GO:1990928) |
0.0 | 0.1 | GO:0006686 | sphingomyelin biosynthetic process(GO:0006686) |
0.0 | 0.1 | GO:0002904 | positive regulation of B cell apoptotic process(GO:0002904) |
0.0 | 0.0 | GO:0006667 | sphinganine metabolic process(GO:0006667) |
0.0 | 0.5 | GO:0021904 | dorsal/ventral neural tube patterning(GO:0021904) |
0.0 | 0.3 | GO:0014912 | negative regulation of smooth muscle cell migration(GO:0014912) |
0.0 | 0.2 | GO:0043129 | surfactant homeostasis(GO:0043129) |
0.0 | 0.2 | GO:0090161 | Golgi ribbon formation(GO:0090161) |
0.0 | 0.1 | GO:1902897 | regulation of postsynaptic density protein 95 clustering(GO:1902897) |
0.0 | 0.6 | GO:0035329 | hippo signaling(GO:0035329) |
0.0 | 0.1 | GO:0048012 | hepatocyte growth factor receptor signaling pathway(GO:0048012) |
0.0 | 0.1 | GO:0032789 | saturated monocarboxylic acid metabolic process(GO:0032788) unsaturated monocarboxylic acid metabolic process(GO:0032789) |
0.0 | 0.0 | GO:0060648 | mammary gland bud morphogenesis(GO:0060648) |
0.0 | 0.1 | GO:1904059 | regulation of locomotor rhythm(GO:1904059) |
0.0 | 0.0 | GO:0015819 | lysine transport(GO:0015819) |
0.0 | 0.0 | GO:0018894 | dibenzo-p-dioxin metabolic process(GO:0018894) |
0.0 | 0.1 | GO:0009106 | lipoate metabolic process(GO:0009106) |
0.0 | 0.0 | GO:0048549 | positive regulation of pinocytosis(GO:0048549) |
0.0 | 0.1 | GO:2000359 | regulation of binding of sperm to zona pellucida(GO:2000359) |
0.0 | 0.2 | GO:0046339 | diacylglycerol metabolic process(GO:0046339) |
0.0 | 0.1 | GO:0010637 | negative regulation of mitochondrial fusion(GO:0010637) |
0.0 | 0.1 | GO:2001169 | regulation of ATP biosynthetic process(GO:2001169) negative regulation of ATP biosynthetic process(GO:2001170) |
0.0 | 0.2 | GO:0042104 | positive regulation of activated T cell proliferation(GO:0042104) |
0.0 | 0.0 | GO:2000973 | regulation of pro-B cell differentiation(GO:2000973) |
0.0 | 0.0 | GO:0010901 | regulation of very-low-density lipoprotein particle remodeling(GO:0010901) |
0.0 | 0.0 | GO:0002408 | myeloid dendritic cell chemotaxis(GO:0002408) |
0.0 | 0.0 | GO:0002071 | glandular epithelial cell maturation(GO:0002071) |
0.0 | 0.3 | GO:0050860 | negative regulation of T cell receptor signaling pathway(GO:0050860) |
0.0 | 0.1 | GO:0032596 | protein transport into membrane raft(GO:0032596) |
0.0 | 0.0 | GO:0002314 | germinal center B cell differentiation(GO:0002314) |
0.0 | 0.4 | GO:0097028 | dendritic cell differentiation(GO:0097028) |
0.0 | 0.1 | GO:0035434 | copper ion transmembrane transport(GO:0035434) |
0.0 | 0.1 | GO:0055059 | asymmetric neuroblast division(GO:0055059) |
0.0 | 0.2 | GO:0001771 | immunological synapse formation(GO:0001771) |
0.0 | 0.0 | GO:0090237 | regulation of arachidonic acid secretion(GO:0090237) |
0.0 | 0.1 | GO:0042271 | susceptibility to natural killer cell mediated cytotoxicity(GO:0042271) |
0.0 | 0.1 | GO:0044027 | hypermethylation of CpG island(GO:0044027) |
0.0 | 0.0 | GO:0051088 | PMA-inducible membrane protein ectodomain proteolysis(GO:0051088) |
0.0 | 0.1 | GO:0010727 | negative regulation of hydrogen peroxide metabolic process(GO:0010727) |
0.0 | 0.1 | GO:0003383 | apical constriction(GO:0003383) |
0.0 | 0.1 | GO:1901299 | negative regulation of hydrogen peroxide-mediated programmed cell death(GO:1901299) |
0.0 | 0.0 | GO:0045409 | negative regulation of interleukin-6 biosynthetic process(GO:0045409) |
0.0 | 0.0 | GO:0032594 | protein transport within lipid bilayer(GO:0032594) |
0.0 | 0.1 | GO:0006742 | NADP catabolic process(GO:0006742) |
0.0 | 0.0 | GO:0061724 | lipophagy(GO:0061724) |
0.0 | 0.0 | GO:0010980 | regulation of vitamin D 24-hydroxylase activity(GO:0010979) positive regulation of vitamin D 24-hydroxylase activity(GO:0010980) |
0.0 | 0.1 | GO:0046726 | positive regulation by virus of viral protein levels in host cell(GO:0046726) |
0.0 | 0.1 | GO:0003062 | regulation of heart rate by chemical signal(GO:0003062) |
0.0 | 0.1 | GO:0019276 | UDP-N-acetylgalactosamine metabolic process(GO:0019276) |
0.0 | 0.1 | GO:0042138 | meiotic DNA double-strand break formation(GO:0042138) |
0.0 | 0.1 | GO:0006620 | posttranslational protein targeting to membrane(GO:0006620) |
0.0 | 0.2 | GO:0033169 | histone H3-K9 demethylation(GO:0033169) |
0.0 | 0.0 | GO:2000508 | regulation of dendritic cell chemotaxis(GO:2000508) |
0.0 | 0.1 | GO:0000395 | mRNA 5'-splice site recognition(GO:0000395) |
0.0 | 0.0 | GO:0002051 | osteoblast fate commitment(GO:0002051) |
0.0 | 0.1 | GO:0042780 | tRNA 3'-end processing(GO:0042780) |
0.0 | 0.2 | GO:0007603 | phototransduction, visible light(GO:0007603) |
0.0 | 0.0 | GO:0035905 | ascending aorta development(GO:0035905) ascending aorta morphogenesis(GO:0035910) |
0.0 | 0.1 | GO:0070889 | platelet alpha granule organization(GO:0070889) |
0.0 | 0.0 | GO:0044090 | positive regulation of vacuole organization(GO:0044090) |
0.0 | 0.0 | GO:0051791 | medium-chain fatty acid metabolic process(GO:0051791) |
0.0 | 0.0 | GO:0046103 | inosine biosynthetic process(GO:0046103) |
0.0 | 0.3 | GO:0015936 | coenzyme A metabolic process(GO:0015936) |
0.0 | 0.1 | GO:0043201 | response to leucine(GO:0043201) cellular response to leucine(GO:0071233) |
0.0 | 0.1 | GO:0044829 | positive regulation by host of viral genome replication(GO:0044829) |
0.0 | 0.0 | GO:0060061 | Spemann organizer formation(GO:0060061) |
0.0 | 0.0 | GO:0001543 | ovarian follicle rupture(GO:0001543) |
0.0 | 0.1 | GO:2000210 | positive regulation of anoikis(GO:2000210) |
0.0 | 0.1 | GO:0035457 | cellular response to interferon-alpha(GO:0035457) |
0.0 | 0.2 | GO:0046051 | UTP metabolic process(GO:0046051) |
0.0 | 0.1 | GO:0043988 | histone H3-S28 phosphorylation(GO:0043988) |
0.0 | 0.1 | GO:0031914 | negative regulation of synaptic plasticity(GO:0031914) |
0.0 | 0.2 | GO:0071361 | cellular response to ethanol(GO:0071361) |
0.0 | 0.1 | GO:0070934 | CRD-mediated mRNA stabilization(GO:0070934) |
0.0 | 0.1 | GO:1903361 | protein localization to basolateral plasma membrane(GO:1903361) |
0.0 | 0.1 | GO:0033630 | positive regulation of cell adhesion mediated by integrin(GO:0033630) |
0.0 | 0.1 | GO:0043654 | recognition of apoptotic cell(GO:0043654) |
0.0 | 0.1 | GO:0051444 | negative regulation of ubiquitin-protein transferase activity(GO:0051444) |
0.0 | 0.0 | GO:0036258 | multivesicular body assembly(GO:0036258) |
0.0 | 0.1 | GO:0036089 | cleavage furrow formation(GO:0036089) |
0.0 | 0.0 | GO:0098902 | regulation of membrane depolarization during action potential(GO:0098902) |
0.0 | 0.0 | GO:0002554 | serotonin secretion by platelet(GO:0002554) |
0.0 | 0.1 | GO:0060947 | cardiac vascular smooth muscle cell differentiation(GO:0060947) |
0.0 | 0.1 | GO:0048743 | positive regulation of skeletal muscle fiber development(GO:0048743) |
0.0 | 0.1 | GO:1904491 | protein localization to ciliary transition zone(GO:1904491) |
0.0 | 0.1 | GO:0097210 | response to gonadotropin-releasing hormone(GO:0097210) cellular response to gonadotropin-releasing hormone(GO:0097211) |
0.0 | 0.0 | GO:0023021 | termination of signal transduction(GO:0023021) |
0.0 | 0.9 | GO:0030593 | neutrophil chemotaxis(GO:0030593) |
0.0 | 0.1 | GO:0048227 | plasma membrane to endosome transport(GO:0048227) |
0.0 | 0.1 | GO:0006449 | regulation of translational termination(GO:0006449) |
0.0 | 0.0 | GO:0014816 | skeletal muscle satellite cell differentiation(GO:0014816) |
0.0 | 0.0 | GO:0043985 | histone H4-R3 methylation(GO:0043985) |
0.0 | 0.1 | GO:1902570 | protein localization to nucleolus(GO:1902570) |
0.0 | 0.1 | GO:0035582 | sequestering of BMP in extracellular matrix(GO:0035582) |
0.0 | 0.0 | GO:0060638 | mesenchymal-epithelial cell signaling(GO:0060638) |
0.0 | 0.3 | GO:0061003 | positive regulation of dendritic spine morphogenesis(GO:0061003) |
0.0 | 0.0 | GO:0060437 | lung growth(GO:0060437) |
0.0 | 0.0 | GO:0010873 | positive regulation of cholesterol esterification(GO:0010873) |
0.0 | 0.1 | GO:0014831 | gastro-intestinal system smooth muscle contraction(GO:0014831) |
0.0 | 0.1 | GO:0019985 | translesion synthesis(GO:0019985) |
0.0 | 0.1 | GO:0010360 | negative regulation of anion channel activity(GO:0010360) |
0.0 | 0.1 | GO:0032020 | ISG15-protein conjugation(GO:0032020) |
0.0 | 0.1 | GO:0070125 | mitochondrial translational elongation(GO:0070125) |
0.0 | 0.1 | GO:1904424 | regulation of GTP binding(GO:1904424) |
0.0 | 0.1 | GO:0090080 | positive regulation of MAPKKK cascade by fibroblast growth factor receptor signaling pathway(GO:0090080) |
0.0 | 0.0 | GO:0097119 | postsynaptic density protein 95 clustering(GO:0097119) |
0.0 | 0.1 | GO:0006041 | glucosamine metabolic process(GO:0006041) |
0.0 | 0.1 | GO:0006432 | phenylalanyl-tRNA aminoacylation(GO:0006432) |
0.0 | 0.0 | GO:0045901 | positive regulation of translational elongation(GO:0045901) |
0.0 | 0.1 | GO:0010764 | negative regulation of fibroblast migration(GO:0010764) |
0.0 | 0.1 | GO:0017014 | protein nitrosylation(GO:0017014) |
0.0 | 0.1 | GO:0060158 | phospholipase C-activating dopamine receptor signaling pathway(GO:0060158) |
0.0 | 0.2 | GO:0006857 | oligopeptide transport(GO:0006857) |
0.0 | 0.0 | GO:0007184 | SMAD protein import into nucleus(GO:0007184) |
0.0 | 0.0 | GO:0035622 | intrahepatic bile duct development(GO:0035622) |
0.0 | 0.2 | GO:0030502 | negative regulation of bone mineralization(GO:0030502) |
0.0 | 0.0 | GO:1901674 | histone H3-K27 acetylation(GO:0043974) regulation of histone H3-K27 acetylation(GO:1901674) |
0.0 | 0.1 | GO:0042997 | negative regulation of Golgi to plasma membrane protein transport(GO:0042997) |
0.0 | 0.1 | GO:0010815 | bradykinin catabolic process(GO:0010815) |
0.0 | 0.0 | GO:0051454 | pH elevation(GO:0045852) intracellular pH elevation(GO:0051454) |
0.0 | 0.1 | GO:0048069 | eye pigmentation(GO:0048069) |
0.0 | 0.0 | GO:2000574 | regulation of microtubule motor activity(GO:2000574) |
0.0 | 0.0 | GO:0032439 | endosome localization(GO:0032439) |
0.0 | 0.0 | GO:0036092 | phosphatidylinositol-3-phosphate biosynthetic process(GO:0036092) |
0.0 | 0.0 | GO:0030421 | defecation(GO:0030421) |
0.0 | 0.0 | GO:0046984 | regulation of hemoglobin biosynthetic process(GO:0046984) |
0.0 | 0.1 | GO:0071285 | cellular response to lithium ion(GO:0071285) |
0.0 | 0.1 | GO:0034393 | positive regulation of smooth muscle cell apoptotic process(GO:0034393) |
0.0 | 0.1 | GO:0045063 | T-helper 1 cell differentiation(GO:0045063) |
0.0 | 0.1 | GO:0042711 | maternal behavior(GO:0042711) |
0.0 | 0.0 | GO:0090310 | negative regulation of methylation-dependent chromatin silencing(GO:0090310) |
0.0 | 0.0 | GO:0006059 | hexitol metabolic process(GO:0006059) |
0.0 | 0.1 | GO:0021554 | optic nerve development(GO:0021554) |
0.0 | 0.0 | GO:2000721 | positive regulation of transcription from RNA polymerase II promoter involved in smooth muscle cell differentiation(GO:2000721) |
0.0 | 0.0 | GO:0045590 | negative regulation of regulatory T cell differentiation(GO:0045590) |
0.0 | 0.0 | GO:0033092 | positive regulation of immature T cell proliferation(GO:0033091) positive regulation of immature T cell proliferation in thymus(GO:0033092) |
0.0 | 0.0 | GO:0000189 | MAPK import into nucleus(GO:0000189) |
0.0 | 0.0 | GO:0060718 | chorionic trophoblast cell differentiation(GO:0060718) |
0.0 | 0.0 | GO:0007354 | zygotic determination of anterior/posterior axis, embryo(GO:0007354) |
0.0 | 0.0 | GO:0035627 | ceramide transport(GO:0035627) |
0.0 | 0.0 | GO:0030214 | hyaluronan catabolic process(GO:0030214) |
0.0 | 0.0 | GO:0060059 | embryonic retina morphogenesis in camera-type eye(GO:0060059) |
0.0 | 0.1 | GO:0010459 | negative regulation of heart rate(GO:0010459) |
0.0 | 0.0 | GO:0015888 | thiamine transport(GO:0015888) |
0.0 | 0.0 | GO:0030263 | apoptotic chromosome condensation(GO:0030263) |
0.0 | 0.1 | GO:0070586 | cell-cell adhesion involved in gastrulation(GO:0070586) |
0.0 | 0.1 | GO:0046110 | xanthine metabolic process(GO:0046110) |
0.0 | 0.0 | GO:0021785 | branchiomotor neuron axon guidance(GO:0021785) |
0.0 | 0.2 | GO:0035855 | megakaryocyte development(GO:0035855) |
0.0 | 0.1 | GO:0090009 | primitive streak formation(GO:0090009) |
0.0 | 0.0 | GO:0072015 | glomerular visceral epithelial cell development(GO:0072015) glomerular epithelial cell development(GO:0072310) |
0.0 | 0.0 | GO:0019287 | isopentenyl diphosphate biosynthetic process(GO:0009240) isopentenyl diphosphate biosynthetic process, mevalonate pathway(GO:0019287) |
0.0 | 0.1 | GO:0060390 | regulation of SMAD protein import into nucleus(GO:0060390) |
0.0 | 0.1 | GO:0016093 | polyprenol metabolic process(GO:0016093) |
0.0 | 0.1 | GO:0006678 | glucosylceramide metabolic process(GO:0006678) |
0.0 | 0.3 | GO:1901099 | negative regulation of signal transduction in absence of ligand(GO:1901099) negative regulation of extrinsic apoptotic signaling pathway in absence of ligand(GO:2001240) |
0.0 | 0.1 | GO:0019509 | L-methionine biosynthetic process from methylthioadenosine(GO:0019509) |
0.0 | 0.0 | GO:0060510 | Type II pneumocyte differentiation(GO:0060510) |
0.0 | 0.0 | GO:0043371 | negative regulation of CD4-positive, alpha-beta T cell differentiation(GO:0043371) negative regulation of T-helper cell differentiation(GO:0045623) |
0.0 | 0.0 | GO:0006382 | adenosine to inosine editing(GO:0006382) |
0.0 | 0.2 | GO:0009268 | response to pH(GO:0009268) |
0.0 | 0.0 | GO:2000327 | regulation of ligand-dependent nuclear receptor transcription coactivator activity(GO:2000325) positive regulation of ligand-dependent nuclear receptor transcription coactivator activity(GO:2000327) |
0.0 | 0.0 | GO:0000087 | mitotic M phase(GO:0000087) |
0.0 | 0.1 | GO:0035385 | Roundabout signaling pathway(GO:0035385) |
0.0 | 0.0 | GO:2000303 | regulation of ceramide biosynthetic process(GO:2000303) |
0.0 | 0.0 | GO:0071635 | negative regulation of transforming growth factor beta production(GO:0071635) |
0.0 | 0.1 | GO:0045719 | negative regulation of glycogen biosynthetic process(GO:0045719) |
0.0 | 0.0 | GO:0006438 | valyl-tRNA aminoacylation(GO:0006438) |
0.0 | 0.1 | GO:0051694 | pointed-end actin filament capping(GO:0051694) |
0.0 | 0.1 | GO:0006144 | purine nucleobase metabolic process(GO:0006144) |
0.0 | 0.2 | GO:0007190 | activation of adenylate cyclase activity(GO:0007190) |
0.0 | 0.0 | GO:0018076 | N-terminal peptidyl-lysine acetylation(GO:0018076) |
0.0 | 0.0 | GO:0007182 | common-partner SMAD protein phosphorylation(GO:0007182) |
0.0 | 0.0 | GO:0014857 | regulation of skeletal muscle cell proliferation(GO:0014857) |
0.0 | 0.0 | GO:0009169 | ribonucleoside monophosphate catabolic process(GO:0009158) purine ribonucleoside monophosphate catabolic process(GO:0009169) |
0.0 | 0.1 | GO:0006166 | purine ribonucleoside salvage(GO:0006166) |
0.0 | 0.1 | GO:0034498 | early endosome to Golgi transport(GO:0034498) |
0.0 | 0.0 | GO:0015705 | iodide transport(GO:0015705) |
0.0 | 0.2 | GO:0034389 | lipid particle organization(GO:0034389) |
0.0 | 0.0 | GO:0060956 | endocardial cell differentiation(GO:0060956) |
0.0 | 0.0 | GO:0006419 | alanyl-tRNA aminoacylation(GO:0006419) |
0.0 | 0.1 | GO:0060708 | spongiotrophoblast differentiation(GO:0060708) |
0.0 | 0.1 | GO:1990173 | protein localization to nuclear body(GO:1903405) protein localization to Cajal body(GO:1904867) regulation of protein localization to Cajal body(GO:1904869) positive regulation of protein localization to Cajal body(GO:1904871) protein localization to nucleoplasm(GO:1990173) |
0.0 | 0.1 | GO:0040034 | regulation of development, heterochronic(GO:0040034) |
0.0 | 0.1 | GO:0072161 | mesenchymal cell differentiation involved in kidney development(GO:0072161) mesenchymal cell differentiation involved in renal system development(GO:2001012) |
0.0 | 0.1 | GO:0019370 | leukotriene biosynthetic process(GO:0019370) |
0.0 | 0.1 | GO:0038063 | collagen-activated tyrosine kinase receptor signaling pathway(GO:0038063) |
0.0 | 0.1 | GO:0001778 | plasma membrane repair(GO:0001778) |
0.0 | 0.1 | GO:0009191 | ribonucleoside diphosphate catabolic process(GO:0009191) |
0.0 | 0.0 | GO:0000101 | sulfur amino acid transport(GO:0000101) |
0.0 | 0.0 | GO:2001274 | negative regulation of glucose import in response to insulin stimulus(GO:2001274) |
0.0 | 0.1 | GO:0036265 | RNA (guanine-N7)-methylation(GO:0036265) |
0.0 | 0.0 | GO:0010248 | establishment or maintenance of transmembrane electrochemical gradient(GO:0010248) |
0.0 | 0.0 | GO:0019626 | short-chain fatty acid catabolic process(GO:0019626) |
0.0 | 0.2 | GO:0007625 | grooming behavior(GO:0007625) |
0.0 | 0.0 | GO:0034316 | negative regulation of Arp2/3 complex-mediated actin nucleation(GO:0034316) |
0.0 | 0.0 | GO:0009134 | nucleoside diphosphate catabolic process(GO:0009134) |
0.0 | 0.0 | GO:0030327 | prenylated protein catabolic process(GO:0030327) |
0.0 | 0.1 | GO:0008291 | acetylcholine metabolic process(GO:0008291) acetate ester metabolic process(GO:1900619) |
0.0 | 0.1 | GO:1901386 | negative regulation of voltage-gated calcium channel activity(GO:1901386) |
0.0 | 0.0 | GO:2000767 | positive regulation of cytoplasmic translation(GO:2000767) |
0.0 | 0.0 | GO:2000010 | positive regulation of protein localization to cell surface(GO:2000010) |
0.0 | 0.1 | GO:0010510 | regulation of acetyl-CoA biosynthetic process from pyruvate(GO:0010510) |
0.0 | 0.0 | GO:0051661 | maintenance of centrosome location(GO:0051661) |
0.0 | 0.0 | GO:0000059 | protein import into nucleus, docking(GO:0000059) |
0.0 | 0.2 | GO:0050919 | negative chemotaxis(GO:0050919) |
0.0 | 0.0 | GO:0006407 | rRNA export from nucleus(GO:0006407) |
0.0 | 0.0 | GO:1900108 | negative regulation of nodal signaling pathway(GO:1900108) |
0.0 | 0.0 | GO:0010519 | negative regulation of phospholipase activity(GO:0010519) |
0.0 | 0.0 | GO:2000741 | positive regulation of mesenchymal stem cell differentiation(GO:2000741) |
0.0 | 0.0 | GO:0060399 | positive regulation of growth hormone receptor signaling pathway(GO:0060399) |
0.0 | 0.1 | GO:0051459 | regulation of corticotropin secretion(GO:0051459) positive regulation of corticotropin secretion(GO:0051461) |
0.0 | 0.0 | GO:0000733 | DNA strand renaturation(GO:0000733) |
0.0 | 0.2 | GO:0046597 | negative regulation of viral entry into host cell(GO:0046597) |
0.0 | 0.0 | GO:0030210 | heparin biosynthetic process(GO:0030210) |
0.0 | 0.0 | GO:0001880 | Mullerian duct regression(GO:0001880) |
0.0 | 0.1 | GO:0060017 | parathyroid gland development(GO:0060017) |
0.0 | 0.0 | GO:0051987 | positive regulation of attachment of spindle microtubules to kinetochore(GO:0051987) |
0.0 | 0.0 | GO:1901722 | regulation of cell proliferation involved in kidney development(GO:1901722) |
0.0 | 0.2 | GO:0010738 | regulation of protein kinase A signaling(GO:0010738) |
0.0 | 0.0 | GO:0010918 | positive regulation of mitochondrial membrane potential(GO:0010918) |
0.0 | 0.2 | GO:0043968 | histone H2A acetylation(GO:0043968) |
0.0 | 0.0 | GO:0016139 | glycoside catabolic process(GO:0016139) |
0.0 | 0.0 | GO:0015747 | urate transport(GO:0015747) |
0.0 | 0.2 | GO:0060999 | positive regulation of dendritic spine development(GO:0060999) |
0.0 | 0.1 | GO:0051974 | negative regulation of telomerase activity(GO:0051974) |
0.0 | 0.0 | GO:0051790 | short-chain fatty acid biosynthetic process(GO:0051790) |
0.0 | 0.0 | GO:0031936 | negative regulation of chromatin silencing(GO:0031936) |
0.0 | 0.0 | GO:0044838 | cell quiescence(GO:0044838) |
0.0 | 0.1 | GO:0090091 | positive regulation of extracellular matrix disassembly(GO:0090091) |
0.0 | 0.0 | GO:0048312 | intracellular distribution of mitochondria(GO:0048312) |
0.0 | 0.1 | GO:0080009 | mRNA methylation(GO:0080009) |
0.0 | 0.0 | GO:0032907 | transforming growth factor beta3 production(GO:0032907) regulation of transforming growth factor beta3 production(GO:0032910) |
0.0 | 0.0 | GO:0060842 | arterial endothelial cell differentiation(GO:0060842) |
0.0 | 0.1 | GO:0045475 | locomotor rhythm(GO:0045475) |
0.0 | 0.0 | GO:0000707 | meiotic DNA recombinase assembly(GO:0000707) |
0.0 | 0.1 | GO:0006002 | fructose 6-phosphate metabolic process(GO:0006002) |
0.0 | 0.0 | GO:0035992 | tendon cell differentiation(GO:0035990) tendon formation(GO:0035992) |
0.0 | 0.0 | GO:0021570 | rhombomere 4 development(GO:0021570) |
0.0 | 0.0 | GO:2000059 | negative regulation of protein ubiquitination involved in ubiquitin-dependent protein catabolic process(GO:2000059) |
0.0 | 0.0 | GO:0071877 | regulation of adrenergic receptor signaling pathway(GO:0071877) |
0.0 | 0.0 | GO:0021524 | visceral motor neuron differentiation(GO:0021524) |
0.0 | 0.1 | GO:0006108 | malate metabolic process(GO:0006108) |
0.0 | 0.7 | GO:0010923 | negative regulation of phosphatase activity(GO:0010923) |
0.0 | 0.0 | GO:0048014 | Tie signaling pathway(GO:0048014) |
0.0 | 0.1 | GO:0007221 | positive regulation of transcription of Notch receptor target(GO:0007221) |
0.0 | 0.0 | GO:0034165 | positive regulation of toll-like receptor 9 signaling pathway(GO:0034165) |
0.0 | 0.0 | GO:0016115 | diterpenoid catabolic process(GO:0016103) terpenoid catabolic process(GO:0016115) retinoic acid catabolic process(GO:0034653) |
0.0 | 0.0 | GO:0052422 | modulation of catalytic activity in other organism involved in symbiotic interaction(GO:0052203) modulation by host of symbiont catalytic activity(GO:0052422) |
0.0 | 0.1 | GO:0044458 | motile cilium assembly(GO:0044458) |
0.0 | 0.2 | GO:0001958 | endochondral ossification(GO:0001958) replacement ossification(GO:0036075) |
0.0 | 0.0 | GO:1903660 | regulation of complement-dependent cytotoxicity(GO:1903659) negative regulation of complement-dependent cytotoxicity(GO:1903660) |
0.0 | 0.0 | GO:0071639 | positive regulation of monocyte chemotactic protein-1 production(GO:0071639) |
0.0 | 0.0 | GO:1901164 | negative regulation of trophoblast cell migration(GO:1901164) |
0.0 | 0.0 | GO:0030920 | N-terminal peptidyl-serine acetylation(GO:0017198) N-terminal peptidyl-glutamic acid acetylation(GO:0018002) peptidyl-serine acetylation(GO:0030920) |
0.0 | 0.0 | GO:0031954 | positive regulation of protein autophosphorylation(GO:0031954) |
0.0 | 0.2 | GO:0048286 | lung alveolus development(GO:0048286) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.2 | 0.5 | GO:0020018 | ciliary pocket(GO:0020016) ciliary pocket membrane(GO:0020018) |
0.1 | 0.6 | GO:0030121 | AP-1 adaptor complex(GO:0030121) |
0.1 | 0.4 | GO:0005944 | phosphatidylinositol 3-kinase complex, class IB(GO:0005944) |
0.1 | 0.3 | GO:0097513 | myosin II filament(GO:0097513) |
0.1 | 0.5 | GO:0016461 | unconventional myosin complex(GO:0016461) |
0.1 | 0.3 | GO:0097487 | multivesicular body, internal vesicle(GO:0097487) |
0.1 | 0.5 | GO:0097342 | ripoptosome(GO:0097342) |
0.1 | 0.2 | GO:0034457 | Mpp10 complex(GO:0034457) |
0.1 | 0.2 | GO:0034679 | integrin alpha9-beta1 complex(GO:0034679) |
0.1 | 0.1 | GO:0005952 | cAMP-dependent protein kinase complex(GO:0005952) |
0.1 | 0.4 | GO:0000138 | Golgi trans cisterna(GO:0000138) |
0.1 | 0.2 | GO:0043293 | apoptosome(GO:0043293) |
0.1 | 0.2 | GO:0008282 | ATP-sensitive potassium channel complex(GO:0008282) |
0.1 | 0.2 | GO:0034673 | inhibin-betaglycan-ActRII complex(GO:0034673) |
0.1 | 0.6 | GO:0046581 | intercellular canaliculus(GO:0046581) |
0.1 | 0.2 | GO:0097443 | sorting endosome(GO:0097443) |
0.1 | 0.1 | GO:0065010 | extracellular membrane-bounded organelle(GO:0065010) |
0.1 | 0.3 | GO:0097433 | dense body(GO:0097433) |
0.1 | 0.3 | GO:0030485 | smooth muscle contractile fiber(GO:0030485) |
0.1 | 0.7 | GO:0097431 | mitotic spindle pole(GO:0097431) |
0.1 | 0.5 | GO:0031932 | TORC2 complex(GO:0031932) |
0.0 | 0.4 | GO:0005742 | mitochondrial outer membrane translocase complex(GO:0005742) |
0.0 | 0.2 | GO:0071141 | SMAD protein complex(GO:0071141) |
0.0 | 0.4 | GO:0032045 | guanyl-nucleotide exchange factor complex(GO:0032045) |
0.0 | 0.1 | GO:0035867 | alphav-beta3 integrin-IGF-1-IGF1R complex(GO:0035867) |
0.0 | 0.7 | GO:0000145 | exocyst(GO:0000145) |
0.0 | 0.2 | GO:0032777 | Piccolo NuA4 histone acetyltransferase complex(GO:0032777) |
0.0 | 0.2 | GO:0097255 | R2TP complex(GO:0097255) |
0.0 | 0.3 | GO:0098642 | collagen type IV trimer(GO:0005587) network-forming collagen trimer(GO:0098642) collagen network(GO:0098645) basement membrane collagen trimer(GO:0098651) |
0.0 | 0.1 | GO:0031264 | death-inducing signaling complex(GO:0031264) |
0.0 | 0.4 | GO:0031254 | uropod(GO:0001931) cell trailing edge(GO:0031254) |
0.0 | 0.2 | GO:0032437 | cuticular plate(GO:0032437) |
0.0 | 0.3 | GO:0016342 | catenin complex(GO:0016342) |
0.0 | 0.6 | GO:0018995 | host(GO:0018995) host cell part(GO:0033643) host cell(GO:0043657) |
0.0 | 0.5 | GO:0036038 | MKS complex(GO:0036038) |
0.0 | 0.3 | GO:0016593 | Cdc73/Paf1 complex(GO:0016593) |
0.0 | 0.2 | GO:0031315 | extrinsic component of mitochondrial outer membrane(GO:0031315) |
0.0 | 0.5 | GO:0000177 | cytoplasmic exosome (RNase complex)(GO:0000177) |
0.0 | 0.1 | GO:0034274 | Atg12-Atg5-Atg16 complex(GO:0034274) |
0.0 | 0.2 | GO:0034388 | Pwp2p-containing subcomplex of 90S preribosome(GO:0034388) |
0.0 | 0.1 | GO:0005899 | insulin receptor complex(GO:0005899) |
0.0 | 0.1 | GO:0000322 | storage vacuole(GO:0000322) |
0.0 | 0.3 | GO:0097470 | ribbon synapse(GO:0097470) |
0.0 | 0.1 | GO:0032299 | ribonuclease H2 complex(GO:0032299) |
0.0 | 0.3 | GO:0002116 | semaphorin receptor complex(GO:0002116) |
0.0 | 0.2 | GO:0030056 | hemidesmosome(GO:0030056) |
0.0 | 0.2 | GO:0030128 | clathrin coat of endocytic vesicle(GO:0030128) |
0.0 | 0.0 | GO:0036194 | muscle cell projection(GO:0036194) muscle cell projection membrane(GO:0036195) |
0.0 | 0.1 | GO:0097629 | extrinsic component of omegasome membrane(GO:0097629) |
0.0 | 0.2 | GO:0030991 | intraciliary transport particle A(GO:0030991) |
0.0 | 0.1 | GO:0044299 | C-fiber(GO:0044299) |
0.0 | 0.1 | GO:0033269 | internode region of axon(GO:0033269) |
0.0 | 0.5 | GO:0002102 | podosome(GO:0002102) |
0.0 | 0.1 | GO:0044614 | nuclear pore cytoplasmic filaments(GO:0044614) |
0.0 | 0.2 | GO:0030132 | clathrin coat of coated pit(GO:0030132) |
0.0 | 0.8 | GO:0008180 | COP9 signalosome(GO:0008180) |
0.0 | 0.1 | GO:0000444 | MIS12/MIND type complex(GO:0000444) |
0.0 | 0.2 | GO:0042629 | mast cell granule(GO:0042629) |
0.0 | 0.5 | GO:0005605 | basal lamina(GO:0005605) |
0.0 | 0.1 | GO:0071008 | U2-type post-mRNA release spliceosomal complex(GO:0071008) |
0.0 | 0.2 | GO:0005885 | Arp2/3 protein complex(GO:0005885) |
0.0 | 0.1 | GO:0001651 | dense fibrillar component(GO:0001651) |
0.0 | 0.1 | GO:0048787 | presynaptic active zone membrane(GO:0048787) |
0.0 | 1.7 | GO:0005901 | caveola(GO:0005901) |
0.0 | 0.2 | GO:0031209 | SCAR complex(GO:0031209) |
0.0 | 0.3 | GO:0032426 | stereocilium tip(GO:0032426) |
0.0 | 0.2 | GO:0042622 | photoreceptor outer segment membrane(GO:0042622) |
0.0 | 0.1 | GO:0031074 | nucleocytoplasmic shuttling complex(GO:0031074) |
0.0 | 0.1 | GO:0098553 | integral component of cytoplasmic side of endoplasmic reticulum membrane(GO:0071458) integral component of lumenal side of endoplasmic reticulum membrane(GO:0071556) lumenal side of endoplasmic reticulum membrane(GO:0098553) |
0.0 | 0.1 | GO:0043527 | tRNA methyltransferase complex(GO:0043527) |
0.0 | 0.1 | GO:0005818 | aster(GO:0005818) |
0.0 | 0.1 | GO:0005967 | mitochondrial pyruvate dehydrogenase complex(GO:0005967) |
0.0 | 0.1 | GO:0005850 | eukaryotic translation initiation factor 2 complex(GO:0005850) |
0.0 | 0.1 | GO:0000788 | nuclear nucleosome(GO:0000788) |
0.0 | 0.1 | GO:0033180 | proton-transporting V-type ATPase, V1 domain(GO:0033180) |
0.0 | 0.1 | GO:0071797 | LUBAC complex(GO:0071797) |
0.0 | 0.1 | GO:0044300 | cerebellar mossy fiber(GO:0044300) |
0.0 | 0.1 | GO:0005775 | vacuolar lumen(GO:0005775) |
0.0 | 0.1 | GO:0031092 | platelet alpha granule membrane(GO:0031092) |
0.0 | 0.0 | GO:0098799 | outer mitochondrial membrane protein complex(GO:0098799) |
0.0 | 0.1 | GO:0042105 | alpha-beta T cell receptor complex(GO:0042105) |
0.0 | 0.1 | GO:0046696 | lipopolysaccharide receptor complex(GO:0046696) |
0.0 | 0.1 | GO:0000137 | Golgi cis cisterna(GO:0000137) |
0.0 | 0.3 | GO:0005614 | interstitial matrix(GO:0005614) |
0.0 | 0.1 | GO:0097136 | Bcl-2 family protein complex(GO:0097136) |
0.0 | 0.1 | GO:0012510 | trans-Golgi network transport vesicle membrane(GO:0012510) |
0.0 | 0.1 | GO:0016012 | sarcoglycan complex(GO:0016012) |
0.0 | 0.1 | GO:0036396 | MIS complex(GO:0036396) |
0.0 | 0.8 | GO:0043198 | dendritic shaft(GO:0043198) |
0.0 | 1.0 | GO:0000118 | histone deacetylase complex(GO:0000118) |
0.0 | 0.2 | GO:0005916 | fascia adherens(GO:0005916) |
0.0 | 0.1 | GO:0031415 | NatA complex(GO:0031415) |
0.0 | 0.0 | GO:0071664 | catenin-TCF7L2 complex(GO:0071664) |
0.0 | 0.1 | GO:0033093 | Weibel-Palade body(GO:0033093) |
0.0 | 0.1 | GO:0051286 | cell tip(GO:0051286) |
0.0 | 0.1 | GO:0097452 | GAIT complex(GO:0097452) |
0.0 | 0.1 | GO:0016942 | insulin-like growth factor binding protein complex(GO:0016942) growth factor complex(GO:0036454) insulin-like growth factor ternary complex(GO:0042567) |
0.0 | 0.1 | GO:0070937 | CRD-mediated mRNA stability complex(GO:0070937) |
0.0 | 0.2 | GO:0031011 | Ino80 complex(GO:0031011) |
0.0 | 0.0 | GO:0000811 | GINS complex(GO:0000811) |
0.0 | 0.1 | GO:0045254 | pyruvate dehydrogenase complex(GO:0045254) |
0.0 | 0.1 | GO:0000243 | commitment complex(GO:0000243) |
0.0 | 0.1 | GO:0090533 | cation-transporting ATPase complex(GO:0090533) |
0.0 | 0.1 | GO:0044327 | dendritic spine head(GO:0044327) |
0.0 | 0.1 | GO:0002081 | outer acrosomal membrane(GO:0002081) |
0.0 | 0.0 | GO:0045251 | mitochondrial electron transfer flavoprotein complex(GO:0017133) electron transfer flavoprotein complex(GO:0045251) |
0.0 | 0.1 | GO:0005663 | DNA replication factor C complex(GO:0005663) |
0.0 | 0.1 | GO:0045179 | apical cortex(GO:0045179) |
0.0 | 1.3 | GO:0005923 | bicellular tight junction(GO:0005923) |
0.0 | 0.0 | GO:0042719 | mitochondrial intermembrane space protein transporter complex(GO:0042719) |
0.0 | 0.1 | GO:0001940 | male pronucleus(GO:0001940) |
0.0 | 0.1 | GO:0000801 | central element(GO:0000801) |
0.0 | 0.1 | GO:0032591 | dendritic spine membrane(GO:0032591) |
0.0 | 0.3 | GO:0031941 | filamentous actin(GO:0031941) |
0.0 | 0.0 | GO:0070110 | ciliary neurotrophic factor receptor complex(GO:0070110) |
0.0 | 0.1 | GO:0034663 | endoplasmic reticulum chaperone complex(GO:0034663) |
0.0 | 0.0 | GO:0071203 | WASH complex(GO:0071203) |
0.0 | 0.0 | GO:0005594 | collagen type IX trimer(GO:0005594) |
0.0 | 0.0 | GO:0072558 | NLRP1 inflammasome complex(GO:0072558) |
0.0 | 0.1 | GO:0005640 | nuclear outer membrane(GO:0005640) |
0.0 | 0.0 | GO:0035339 | SPOTS complex(GO:0035339) |
0.0 | 0.1 | GO:0000124 | SAGA complex(GO:0000124) |
0.0 | 0.1 | GO:0008385 | IkappaB kinase complex(GO:0008385) |
0.0 | 0.0 | GO:0031390 | Ctf18 RFC-like complex(GO:0031390) |
0.0 | 0.1 | GO:0031527 | filopodium membrane(GO:0031527) |
0.0 | 0.0 | GO:1990023 | mitotic spindle midzone(GO:1990023) |
0.0 | 0.1 | GO:1990124 | messenger ribonucleoprotein complex(GO:1990124) |
0.0 | 0.1 | GO:0002199 | zona pellucida receptor complex(GO:0002199) |
0.0 | 0.0 | GO:0005851 | eukaryotic translation initiation factor 2B complex(GO:0005851) |
0.0 | 1.0 | GO:0031234 | extrinsic component of cytoplasmic side of plasma membrane(GO:0031234) |
0.0 | 0.3 | GO:0001772 | immunological synapse(GO:0001772) |
0.0 | 0.1 | GO:0071541 | eukaryotic translation initiation factor 3 complex, eIF3m(GO:0071541) |
0.0 | 0.1 | GO:0031838 | haptoglobin-hemoglobin complex(GO:0031838) |
0.0 | 0.0 | GO:0044613 | nuclear pore central transport channel(GO:0044613) |
0.0 | 0.1 | GO:0031588 | nucleotide-activated protein kinase complex(GO:0031588) |
0.0 | 0.1 | GO:0005685 | U1 snRNP(GO:0005685) |
0.0 | 0.2 | GO:0005922 | connexon complex(GO:0005922) |
0.0 | 0.1 | GO:0016327 | apicolateral plasma membrane(GO:0016327) |
0.0 | 0.1 | GO:0000800 | lateral element(GO:0000800) |
0.0 | 0.1 | GO:0005677 | chromatin silencing complex(GO:0005677) |
0.0 | 0.1 | GO:0071565 | nBAF complex(GO:0071565) |
0.0 | 0.0 | GO:0061574 | ASAP complex(GO:0061574) |
0.0 | 0.2 | GO:0031307 | integral component of mitochondrial outer membrane(GO:0031307) |
0.0 | 0.1 | GO:0098563 | integral component of synaptic vesicle membrane(GO:0030285) intrinsic component of synaptic vesicle membrane(GO:0098563) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.1 | 0.7 | GO:0004565 | beta-galactosidase activity(GO:0004565) |
0.1 | 0.8 | GO:0005072 | transforming growth factor beta receptor, cytoplasmic mediator activity(GO:0005072) |
0.1 | 0.4 | GO:0047276 | N-acetyllactosaminide 3-alpha-galactosyltransferase activity(GO:0047276) |
0.1 | 0.4 | GO:0043546 | molybdopterin cofactor binding(GO:0043546) |
0.1 | 0.5 | GO:0098748 | clathrin adaptor activity(GO:0035615) endocytic adaptor activity(GO:0098748) |
0.1 | 0.3 | GO:0004687 | myosin light chain kinase activity(GO:0004687) |
0.1 | 0.6 | GO:0017034 | Rap guanyl-nucleotide exchange factor activity(GO:0017034) |
0.1 | 0.1 | GO:0034211 | GTP-dependent protein kinase activity(GO:0034211) |
0.1 | 0.9 | GO:0004571 | mannosyl-oligosaccharide 1,2-alpha-mannosidase activity(GO:0004571) |
0.1 | 0.3 | GO:0035650 | AP-1 adaptor complex binding(GO:0035650) |
0.1 | 0.3 | GO:0033829 | O-fucosylpeptide 3-beta-N-acetylglucosaminyltransferase activity(GO:0033829) |
0.1 | 0.3 | GO:0016309 | 1-phosphatidylinositol-5-phosphate 4-kinase activity(GO:0016309) |
0.1 | 0.3 | GO:0004949 | cannabinoid receptor activity(GO:0004949) |
0.1 | 0.3 | GO:0030943 | mitochondrion targeting sequence binding(GO:0030943) |
0.1 | 0.3 | GO:0016802 | adenosylhomocysteinase activity(GO:0004013) trialkylsulfonium hydrolase activity(GO:0016802) |
0.1 | 0.5 | GO:0005021 | vascular endothelial growth factor-activated receptor activity(GO:0005021) |
0.1 | 0.2 | GO:0030519 | snoRNP binding(GO:0030519) |
0.1 | 0.2 | GO:0047192 | 1-alkylglycerophosphocholine O-acetyltransferase activity(GO:0047192) |
0.1 | 0.2 | GO:0004699 | calcium-independent protein kinase C activity(GO:0004699) |
0.1 | 0.3 | GO:0016899 | oxidoreductase activity, acting on the CH-OH group of donors, oxygen as acceptor(GO:0016899) |
0.1 | 0.8 | GO:0017166 | vinculin binding(GO:0017166) |
0.1 | 0.3 | GO:0005131 | growth hormone receptor binding(GO:0005131) |
0.1 | 0.8 | GO:0019841 | retinol binding(GO:0019841) |
0.1 | 0.3 | GO:0016018 | cyclosporin A binding(GO:0016018) |
0.1 | 0.2 | GO:0008525 | phosphatidylcholine transporter activity(GO:0008525) |
0.1 | 0.2 | GO:0031826 | type 2A serotonin receptor binding(GO:0031826) |
0.1 | 0.3 | GO:0050815 | phosphoserine binding(GO:0050815) |
0.1 | 0.6 | GO:0015174 | basic amino acid transmembrane transporter activity(GO:0015174) |
0.1 | 0.5 | GO:0070410 | co-SMAD binding(GO:0070410) |
0.1 | 0.2 | GO:0017098 | sulfonylurea receptor binding(GO:0017098) |
0.1 | 0.3 | GO:0071723 | lipopeptide binding(GO:0071723) |
0.1 | 0.4 | GO:0005225 | volume-sensitive anion channel activity(GO:0005225) |
0.1 | 0.2 | GO:0043398 | HLH domain binding(GO:0043398) |
0.1 | 0.6 | GO:0030898 | actin-dependent ATPase activity(GO:0030898) |
0.1 | 0.2 | GO:0061676 | importin-alpha family protein binding(GO:0061676) |
0.1 | 0.2 | GO:0051425 | PTB domain binding(GO:0051425) |
0.1 | 0.4 | GO:0004534 | 5'-3' exoribonuclease activity(GO:0004534) |
0.1 | 0.1 | GO:0043125 | ErbB-3 class receptor binding(GO:0043125) |
0.1 | 0.1 | GO:0003831 | beta-N-acetylglucosaminylglycopeptide beta-1,4-galactosyltransferase activity(GO:0003831) |
0.1 | 0.2 | GO:0005006 | epidermal growth factor-activated receptor activity(GO:0005006) |
0.1 | 0.5 | GO:0016215 | acyl-CoA desaturase activity(GO:0016215) |
0.1 | 0.6 | GO:0044548 | S100 protein binding(GO:0044548) |
0.1 | 0.1 | GO:1990430 | extracellular matrix protein binding(GO:1990430) |
0.1 | 0.2 | GO:0004691 | cAMP-dependent protein kinase activity(GO:0004691) |
0.1 | 0.2 | GO:0008310 | single-stranded DNA 3'-5' exodeoxyribonuclease activity(GO:0008310) |
0.1 | 0.2 | GO:0051434 | BH3 domain binding(GO:0051434) |
0.1 | 0.2 | GO:0031727 | CCR2 chemokine receptor binding(GO:0031727) |
0.0 | 0.6 | GO:0001608 | G-protein coupled nucleotide receptor activity(GO:0001608) G-protein coupled purinergic nucleotide receptor activity(GO:0045028) |
0.0 | 0.5 | GO:0008656 | cysteine-type endopeptidase activator activity involved in apoptotic process(GO:0008656) |
0.0 | 0.2 | GO:0034714 | type III transforming growth factor beta receptor binding(GO:0034714) |
0.0 | 0.6 | GO:0004704 | NF-kappaB-inducing kinase activity(GO:0004704) |
0.0 | 0.1 | GO:0016635 | oxidoreductase activity, acting on the CH-CH group of donors, quinone or related compound as acceptor(GO:0016635) |
0.0 | 0.2 | GO:0001642 | group III metabotropic glutamate receptor activity(GO:0001642) |
0.0 | 0.6 | GO:0030676 | Rac guanyl-nucleotide exchange factor activity(GO:0030676) |
0.0 | 0.5 | GO:0070300 | phosphatidic acid binding(GO:0070300) |
0.0 | 0.1 | GO:0008321 | Ral guanyl-nucleotide exchange factor activity(GO:0008321) |
0.0 | 0.3 | GO:0019211 | phosphatase activator activity(GO:0019211) |
0.0 | 0.1 | GO:0004720 | protein-lysine 6-oxidase activity(GO:0004720) |
0.0 | 0.4 | GO:0005041 | low-density lipoprotein receptor activity(GO:0005041) |
0.0 | 0.2 | GO:0016715 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, reduced ascorbate as one donor, and incorporation of one atom of oxygen(GO:0016715) |
0.0 | 0.1 | GO:0015119 | hexose phosphate transmembrane transporter activity(GO:0015119) organophosphate:inorganic phosphate antiporter activity(GO:0015315) hexose-phosphate:inorganic phosphate antiporter activity(GO:0015526) glucose 6-phosphate:inorganic phosphate antiporter activity(GO:0061513) |
0.0 | 0.1 | GO:0004948 | calcitonin receptor activity(GO:0004948) |
0.0 | 0.3 | GO:0038036 | sphingosine-1-phosphate receptor activity(GO:0038036) |
0.0 | 0.1 | GO:0004605 | phosphatidate cytidylyltransferase activity(GO:0004605) |
0.0 | 0.4 | GO:0001091 | RNA polymerase II basal transcription factor binding(GO:0001091) |
0.0 | 0.2 | GO:0004523 | RNA-DNA hybrid ribonuclease activity(GO:0004523) |
0.0 | 0.2 | GO:0043237 | laminin-1 binding(GO:0043237) |
0.0 | 0.3 | GO:0017154 | semaphorin receptor activity(GO:0017154) |
0.0 | 0.1 | GO:0097200 | cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:0097200) |
0.0 | 0.1 | GO:0019960 | C-X3-C chemokine binding(GO:0019960) |
0.0 | 0.1 | GO:0045134 | uridine-diphosphatase activity(GO:0045134) |
0.0 | 0.1 | GO:0003945 | N-acetyllactosamine synthase activity(GO:0003945) |
0.0 | 0.6 | GO:0032794 | GTPase activating protein binding(GO:0032794) |
0.0 | 0.1 | GO:0005157 | macrophage colony-stimulating factor receptor binding(GO:0005157) |
0.0 | 0.1 | GO:0004488 | methylenetetrahydrofolate dehydrogenase (NADP+) activity(GO:0004488) |
0.0 | 0.4 | GO:0031994 | insulin-like growth factor I binding(GO:0031994) |
0.0 | 0.0 | GO:0047391 | alkylglycerophosphoethanolamine phosphodiesterase activity(GO:0047391) |
0.0 | 0.4 | GO:0004143 | diacylglycerol kinase activity(GO:0004143) |
0.0 | 0.1 | GO:0032422 | purine-rich negative regulatory element binding(GO:0032422) |
0.0 | 0.1 | GO:0000702 | oxidized base lesion DNA N-glycosylase activity(GO:0000702) |
0.0 | 0.1 | GO:0043120 | tumor necrosis factor binding(GO:0043120) |
0.0 | 0.2 | GO:0005168 | neurotrophin TRKA receptor binding(GO:0005168) |
0.0 | 0.2 | GO:0048406 | nerve growth factor binding(GO:0048406) |
0.0 | 0.1 | GO:0031698 | beta-2 adrenergic receptor binding(GO:0031698) |
0.0 | 1.2 | GO:0005044 | scavenger receptor activity(GO:0005044) |
0.0 | 0.2 | GO:0003956 | NAD(P)+-protein-arginine ADP-ribosyltransferase activity(GO:0003956) |
0.0 | 0.1 | GO:0052658 | inositol-1,4,5-trisphosphate 5-phosphatase activity(GO:0052658) |
0.0 | 0.3 | GO:0043008 | ATP-dependent protein binding(GO:0043008) |
0.0 | 0.2 | GO:0009378 | four-way junction helicase activity(GO:0009378) |
0.0 | 0.1 | GO:0003886 | DNA (cytosine-5-)-methyltransferase activity(GO:0003886) DNA (cytosine-5-)-methyltransferase activity, acting on CpG substrates(GO:0051718) |
0.0 | 0.1 | GO:0050501 | hyaluronan synthase activity(GO:0050501) |
0.0 | 0.1 | GO:0004035 | alkaline phosphatase activity(GO:0004035) |
0.0 | 0.1 | GO:0050309 | glucose-6-phosphatase activity(GO:0004346) sugar-terminal-phosphatase activity(GO:0050309) |
0.0 | 0.1 | GO:0030292 | protein tyrosine kinase inhibitor activity(GO:0030292) |
0.0 | 0.0 | GO:0032139 | dinucleotide insertion or deletion binding(GO:0032139) |
0.0 | 0.1 | GO:0042731 | PH domain binding(GO:0042731) |
0.0 | 0.2 | GO:0015198 | oligopeptide transporter activity(GO:0015198) |
0.0 | 0.1 | GO:0048273 | mitogen-activated protein kinase p38 binding(GO:0048273) |
0.0 | 0.1 | GO:0051371 | muscle alpha-actinin binding(GO:0051371) |
0.0 | 0.1 | GO:0008559 | xenobiotic-transporting ATPase activity(GO:0008559) |
0.0 | 0.3 | GO:0043996 | histone acetyltransferase activity (H4-K5 specific)(GO:0043995) histone acetyltransferase activity (H4-K8 specific)(GO:0043996) histone acetyltransferase activity (H4-K16 specific)(GO:0046972) |
0.0 | 0.2 | GO:0008599 | protein phosphatase type 1 regulator activity(GO:0008599) |
0.0 | 0.1 | GO:0004994 | somatostatin receptor activity(GO:0004994) |
0.0 | 0.1 | GO:0098821 | BMP receptor activity(GO:0098821) |
0.0 | 0.1 | GO:0042284 | sphingolipid delta-4 desaturase activity(GO:0042284) |
0.0 | 0.1 | GO:0003986 | acetyl-CoA hydrolase activity(GO:0003986) |
0.0 | 0.1 | GO:0097016 | L27 domain binding(GO:0097016) |
0.0 | 0.1 | GO:0008379 | thioredoxin peroxidase activity(GO:0008379) |
0.0 | 0.1 | GO:0008184 | glycogen phosphorylase activity(GO:0008184) |
0.0 | 0.3 | GO:0015385 | sodium:proton antiporter activity(GO:0015385) potassium:proton antiporter activity(GO:0015386) |
0.0 | 0.1 | GO:1904288 | BAT3 complex binding(GO:1904288) |
0.0 | 0.1 | GO:0003941 | L-serine ammonia-lyase activity(GO:0003941) |
0.0 | 0.1 | GO:0071209 | U7 snRNA binding(GO:0071209) |
0.0 | 0.1 | GO:0004566 | beta-glucuronidase activity(GO:0004566) |
0.0 | 0.1 | GO:0004839 | ubiquitin activating enzyme activity(GO:0004839) |
0.0 | 0.3 | GO:0043539 | protein serine/threonine kinase activator activity(GO:0043539) |
0.0 | 0.7 | GO:0004120 | calmodulin-dependent cyclic-nucleotide phosphodiesterase activity(GO:0004117) cGMP-stimulated cyclic-nucleotide phosphodiesterase activity(GO:0004118) cGMP-inhibited cyclic-nucleotide phosphodiesterase activity(GO:0004119) photoreceptor cyclic-nucleotide phosphodiesterase activity(GO:0004120) 7,8-dihydro-D-neopterin 2',3'-cyclic phosphate phosphodiesterase activity(GO:0044688) inositol phosphosphingolipid phospholipase activity(GO:0052712) inositol phosphorylceramide phospholipase activity(GO:0052713) mannosyl-inositol phosphorylceramide phospholipase activity(GO:0052714) mannosyl-diinositol phosphorylceramide phospholipase activity(GO:0052715) |
0.0 | 0.1 | GO:0030911 | TPR domain binding(GO:0030911) |
0.0 | 0.2 | GO:0034526 | 3-(3-hydroxyphenyl)propionate hydroxylase activity(GO:0008688) 4-chlorobenzaldehyde oxidase activity(GO:0018471) 3,5-xylenol methylhydroxylase activity(GO:0018630) phenylacetate hydroxylase activity(GO:0018631) 4-nitrophenol 4-monooxygenase activity(GO:0018632) dimethyl sulfide monooxygenase activity(GO:0018633) alpha-pinene monooxygenase [NADH] activity(GO:0018634) 1-hydroxy-2-naphthoate hydroxylase activity(GO:0018637) toluene 4-monooxygenase activity(GO:0018638) xylene monooxygenase activity(GO:0018639) dibenzothiophene monooxygenase activity(GO:0018640) 6-hydroxy-3-methyl-2-oxo-1,2-dihydroquinoline 6-monooxygenase activity(GO:0018641) chlorophenol 4-monooxygenase activity(GO:0018642) carbon disulfide oxygenase activity(GO:0018643) toluene 2-monooxygenase activity(GO:0018644) 1-hydroxy-2-oxolimonene 1,2-monooxygenase activity(GO:0018646) phenanthrene 1,2-monooxygenase activity(GO:0018647) tetrahydrofuran hydroxylase activity(GO:0018649) styrene monooxygenase activity(GO:0018650) toluene-4-sulfonate monooxygenase activity(GO:0018651) toluene-sulfonate methyl-monooxygenase activity(GO:0018652) 3-methyl-2-oxo-1,2-dihydroquinoline 6-monooxygenase activity(GO:0018653) 2-hydroxy-phenylacetate hydroxylase activity(GO:0018654) 2-oxo-delta3-4,5,5-trimethylcyclopentenylacetyl-CoA 1,2-monooxygenase activity(GO:0018655) phenanthrene 3,4-monooxygenase activity(GO:0018656) toluene 3-monooxygenase activity(GO:0018657) 4-hydroxyphenylacetate,NADH:oxygen oxidoreductase (3-hydroxylating) activity(GO:0018660) limonene monooxygenase activity(GO:0019113) 2-methylnaphthalene hydroxylase activity(GO:0034526) 1-methylnaphthalene hydroxylase activity(GO:0034534) bisphenol A hydroxylase A activity(GO:0034560) salicylate 5-hydroxylase activity(GO:0034785) isobutylamine N-hydroxylase activity(GO:0034791) branched-chain dodecylbenzene sulfonate monooxygenase activity(GO:0034802) 3-HSA hydroxylase activity(GO:0034819) 4-hydroxypyridine-3-hydroxylase activity(GO:0034894) 2-octaprenyl-3-methyl-6-methoxy-1,4-benzoquinol hydroxylase activity(GO:0043719) 6-hydroxynicotinate 3-monooxygenase activity(GO:0043731) thalianol hydroxylase activity(GO:0080014) |
0.0 | 0.1 | GO:0003953 | NAD+ nucleosidase activity(GO:0003953) |
0.0 | 0.1 | GO:0003917 | DNA topoisomerase type I activity(GO:0003917) |
0.0 | 0.1 | GO:0008199 | ferric iron binding(GO:0008199) |
0.0 | 0.2 | GO:0032036 | myosin heavy chain binding(GO:0032036) |
0.0 | 0.3 | GO:0015238 | drug transmembrane transporter activity(GO:0015238) |
0.0 | 0.1 | GO:0005128 | erythropoietin receptor binding(GO:0005128) |
0.0 | 0.2 | GO:0004679 | AMP-activated protein kinase activity(GO:0004679) |
0.0 | 0.3 | GO:0045295 | gamma-catenin binding(GO:0045295) |
0.0 | 0.1 | GO:0000403 | Y-form DNA binding(GO:0000403) |
0.0 | 0.0 | GO:0038191 | neuropilin binding(GO:0038191) |
0.0 | 0.1 | GO:0033192 | calmodulin-dependent protein phosphatase activity(GO:0033192) |
0.0 | 0.0 | GO:0035175 | histone kinase activity (H3-S10 specific)(GO:0035175) |
0.0 | 0.1 | GO:0015272 | ATP-activated inward rectifier potassium channel activity(GO:0015272) |
0.0 | 0.6 | GO:0046875 | ephrin receptor binding(GO:0046875) |
0.0 | 0.1 | GO:0004022 | alcohol dehydrogenase (NAD) activity(GO:0004022) |
0.0 | 0.1 | GO:0031711 | bradykinin receptor binding(GO:0031711) |
0.0 | 0.1 | GO:0008349 | MAP kinase kinase kinase kinase activity(GO:0008349) |
0.0 | 0.2 | GO:0098632 | protein binding involved in cell-cell adhesion(GO:0098632) |
0.0 | 0.1 | GO:0071614 | linoleic acid epoxygenase activity(GO:0071614) |
0.0 | 0.1 | GO:0004111 | creatine kinase activity(GO:0004111) |
0.0 | 0.1 | GO:0070097 | delta-catenin binding(GO:0070097) |
0.0 | 1.6 | GO:0005178 | integrin binding(GO:0005178) |
0.0 | 0.2 | GO:0015280 | ligand-gated sodium channel activity(GO:0015280) |
0.0 | 0.1 | GO:2001070 | starch binding(GO:2001070) |
0.0 | 0.1 | GO:0016494 | C-X-C chemokine receptor activity(GO:0016494) |
0.0 | 0.0 | GO:0004698 | calcium-dependent protein kinase C activity(GO:0004698) |
0.0 | 0.1 | GO:0032051 | clathrin light chain binding(GO:0032051) |
0.0 | 0.4 | GO:0005229 | intracellular calcium activated chloride channel activity(GO:0005229) |
0.0 | 0.1 | GO:0008046 | axon guidance receptor activity(GO:0008046) |
0.0 | 0.2 | GO:0016208 | AMP binding(GO:0016208) |
0.0 | 0.1 | GO:0070548 | L-glutamine aminotransferase activity(GO:0070548) |
0.0 | 0.2 | GO:0008320 | protein transmembrane transporter activity(GO:0008320) |
0.0 | 0.1 | GO:0005078 | MAP-kinase scaffold activity(GO:0005078) |
0.0 | 0.1 | GO:0046624 | sphingolipid transporter activity(GO:0046624) |
0.0 | 0.1 | GO:0004739 | pyruvate dehydrogenase (acetyl-transferring) activity(GO:0004739) |
0.0 | 0.1 | GO:0017040 | ceramidase activity(GO:0017040) |
0.0 | 0.0 | GO:0035651 | AP-3 adaptor complex binding(GO:0035651) |
0.0 | 0.1 | GO:0004126 | cytidine deaminase activity(GO:0004126) |
0.0 | 0.1 | GO:0016997 | exo-alpha-sialidase activity(GO:0004308) alpha-sialidase activity(GO:0016997) exo-alpha-(2->3)-sialidase activity(GO:0052794) exo-alpha-(2->6)-sialidase activity(GO:0052795) exo-alpha-(2->8)-sialidase activity(GO:0052796) |
0.0 | 0.2 | GO:0043024 | ribosomal small subunit binding(GO:0043024) |
0.0 | 0.1 | GO:0031433 | telethonin binding(GO:0031433) |
0.0 | 0.1 | GO:0015038 | glutathione disulfide oxidoreductase activity(GO:0015038) |
0.0 | 0.4 | GO:0030215 | semaphorin receptor binding(GO:0030215) |
0.0 | 0.3 | GO:0031683 | G-protein beta/gamma-subunit complex binding(GO:0031683) |
0.0 | 0.1 | GO:0008297 | single-stranded DNA exodeoxyribonuclease activity(GO:0008297) |
0.0 | 0.0 | GO:0008158 | hedgehog receptor activity(GO:0008158) |
0.0 | 0.1 | GO:0015379 | potassium:chloride symporter activity(GO:0015379) potassium ion symporter activity(GO:0022820) |
0.0 | 0.1 | GO:0031702 | type 1 angiotensin receptor binding(GO:0031702) |
0.0 | 0.3 | GO:0005528 | macrolide binding(GO:0005527) FK506 binding(GO:0005528) |
0.0 | 0.1 | GO:0019237 | centromeric DNA binding(GO:0019237) |
0.0 | 0.2 | GO:0008307 | structural constituent of muscle(GO:0008307) |
0.0 | 0.1 | GO:0005324 | long-chain fatty acid transporter activity(GO:0005324) |
0.0 | 0.4 | GO:0030332 | cyclin binding(GO:0030332) |
0.0 | 0.1 | GO:0004924 | oncostatin-M receptor activity(GO:0004924) |
0.0 | 0.1 | GO:0070653 | high-density lipoprotein particle receptor binding(GO:0070653) |
0.0 | 0.1 | GO:0016918 | retinal binding(GO:0016918) |
0.0 | 0.1 | GO:0016724 | ferroxidase activity(GO:0004322) oxidoreductase activity, oxidizing metal ions, oxygen as acceptor(GO:0016724) |
0.0 | 0.2 | GO:0043236 | laminin binding(GO:0043236) |
0.0 | 0.0 | GO:0005001 | transmembrane receptor protein tyrosine phosphatase activity(GO:0005001) |
0.0 | 0.2 | GO:0043422 | protein kinase B binding(GO:0043422) |
0.0 | 0.3 | GO:0050840 | extracellular matrix binding(GO:0050840) |
0.0 | 0.3 | GO:0005070 | SH3/SH2 adaptor activity(GO:0005070) |
0.0 | 0.1 | GO:0048495 | Roundabout binding(GO:0048495) |
0.0 | 0.0 | GO:0043533 | inositol 1,3,4,5 tetrakisphosphate binding(GO:0043533) |
0.0 | 0.1 | GO:0046923 | ER retention sequence binding(GO:0046923) |
0.0 | 0.2 | GO:0035497 | cAMP response element binding(GO:0035497) |
0.0 | 0.2 | GO:0003950 | NAD+ ADP-ribosyltransferase activity(GO:0003950) |
0.0 | 0.2 | GO:0031434 | mitogen-activated protein kinase kinase binding(GO:0031434) |
0.0 | 0.1 | GO:0019784 | NEDD8-specific protease activity(GO:0019784) |
0.0 | 0.0 | GO:0008427 | calcium-dependent protein kinase inhibitor activity(GO:0008427) |
0.0 | 0.1 | GO:0015467 | G-protein activated inward rectifier potassium channel activity(GO:0015467) |
0.0 | 0.1 | GO:0016888 | endodeoxyribonuclease activity, producing 5'-phosphomonoesters(GO:0016888) |
0.0 | 0.1 | GO:0016176 | superoxide-generating NADPH oxidase activator activity(GO:0016176) |
0.0 | 0.0 | GO:0047555 | 3',5'-cyclic-GMP phosphodiesterase activity(GO:0047555) |
0.0 | 0.7 | GO:0005080 | protein kinase C binding(GO:0005080) |
0.0 | 0.1 | GO:0016889 | endodeoxyribonuclease activity, producing 3'-phosphomonoesters(GO:0016889) |
0.0 | 0.0 | GO:1901702 | urate transmembrane transporter activity(GO:0015143) salt transmembrane transporter activity(GO:1901702) |
0.0 | 0.1 | GO:0036374 | gamma-glutamyltransferase activity(GO:0003840) glutathione hydrolase activity(GO:0036374) |
0.0 | 0.0 | GO:0005095 | GTPase inhibitor activity(GO:0005095) |
0.0 | 0.0 | GO:0031800 | type 3 metabotropic glutamate receptor binding(GO:0031800) |
0.0 | 0.1 | GO:0005173 | stem cell factor receptor binding(GO:0005173) |
0.0 | 0.0 | GO:0008332 | low voltage-gated calcium channel activity(GO:0008332) |
0.0 | 0.0 | GO:0034648 | histone demethylase activity (H3-dimethyl-K4 specific)(GO:0034648) |
0.0 | 0.1 | GO:0004579 | dolichyl-diphosphooligosaccharide-protein glycotransferase activity(GO:0004579) |
0.0 | 1.5 | GO:0000149 | SNARE binding(GO:0000149) |
0.0 | 0.1 | GO:0045294 | alpha-catenin binding(GO:0045294) |
0.0 | 0.0 | GO:0004832 | valine-tRNA ligase activity(GO:0004832) |
0.0 | 0.1 | GO:0030492 | hemoglobin binding(GO:0030492) |
0.0 | 0.1 | GO:0002094 | polyprenyltransferase activity(GO:0002094) |
0.0 | 0.1 | GO:0008192 | RNA guanylyltransferase activity(GO:0008192) |
0.0 | 0.1 | GO:0016886 | ligase activity, forming phosphoric ester bonds(GO:0016886) |
0.0 | 0.1 | GO:0004826 | phenylalanine-tRNA ligase activity(GO:0004826) |
0.0 | 0.1 | GO:0031849 | olfactory receptor binding(GO:0031849) |
0.0 | 0.1 | GO:0019145 | aminobutyraldehyde dehydrogenase activity(GO:0019145) 4-trimethylammoniobutyraldehyde dehydrogenase activity(GO:0047105) |
0.0 | 0.0 | GO:0016015 | morphogen activity(GO:0016015) |
0.0 | 0.0 | GO:0004813 | alanine-tRNA ligase activity(GO:0004813) |
0.0 | 0.1 | GO:0003836 | beta-galactoside (CMP) alpha-2,3-sialyltransferase activity(GO:0003836) |
0.0 | 0.1 | GO:0051575 | 5'-deoxyribose-5-phosphate lyase activity(GO:0051575) |
0.0 | 0.1 | GO:0003696 | satellite DNA binding(GO:0003696) |
0.0 | 0.1 | GO:0036310 | annealing helicase activity(GO:0036310) |
0.0 | 0.0 | GO:0022884 | macromolecule transmembrane transporter activity(GO:0022884) |
0.0 | 0.0 | GO:0031752 | D5 dopamine receptor binding(GO:0031752) |
0.0 | 0.1 | GO:0016615 | malate dehydrogenase activity(GO:0016615) |
0.0 | 0.0 | GO:0047751 | 3-oxo-5-alpha-steroid 4-dehydrogenase activity(GO:0003865) cholestenone 5-alpha-reductase activity(GO:0047751) |
0.0 | 0.2 | GO:0003785 | actin monomer binding(GO:0003785) |
0.0 | 0.1 | GO:0004740 | pyruvate dehydrogenase (acetyl-transferring) kinase activity(GO:0004740) |
0.0 | 0.2 | GO:0035259 | glucocorticoid receptor binding(GO:0035259) |
0.0 | 0.1 | GO:0004673 | protein histidine kinase activity(GO:0004673) |
0.0 | 0.2 | GO:0050681 | androgen receptor binding(GO:0050681) |
0.0 | 0.1 | GO:0034046 | poly(G) binding(GO:0034046) |
0.0 | 0.0 | GO:0004854 | xanthine dehydrogenase activity(GO:0004854) oxidoreductase activity, acting on CH or CH2 groups, NAD or NADP as acceptor(GO:0016726) |
0.0 | 0.0 | GO:0032050 | clathrin heavy chain binding(GO:0032050) |
0.0 | 0.0 | GO:0004771 | sterol esterase activity(GO:0004771) |
0.0 | 0.1 | GO:0016175 | superoxide-generating NADPH oxidase activity(GO:0016175) |
0.0 | 0.1 | GO:0008131 | primary amine oxidase activity(GO:0008131) |
0.0 | 0.0 | GO:0016149 | translation release factor activity, codon specific(GO:0016149) |
0.0 | 0.0 | GO:0004427 | inorganic diphosphatase activity(GO:0004427) |
0.0 | 0.2 | GO:0045296 | cadherin binding(GO:0045296) |
0.0 | 0.0 | GO:0016880 | acid-ammonia (or amide) ligase activity(GO:0016880) |
0.0 | 0.0 | GO:0003872 | 6-phosphofructokinase activity(GO:0003872) |
0.0 | 0.0 | GO:0072345 | NAADP-sensitive calcium-release channel activity(GO:0072345) |
0.0 | 0.0 | GO:0004365 | glyceraldehyde-3-phosphate dehydrogenase (NAD+) (phosphorylating) activity(GO:0004365) glyceraldehyde-3-phosphate dehydrogenase (NAD(P)+) (phosphorylating) activity(GO:0043891) |
0.0 | 0.1 | GO:0000150 | recombinase activity(GO:0000150) |
0.0 | 0.0 | GO:0070051 | fibrinogen binding(GO:0070051) |
0.0 | 0.1 | GO:0033170 | DNA clamp loader activity(GO:0003689) protein-DNA loading ATPase activity(GO:0033170) |
0.0 | 0.0 | GO:0070840 | dynein complex binding(GO:0070840) |
0.0 | 0.0 | GO:0045503 | dynein light chain binding(GO:0045503) |
0.0 | 0.1 | GO:0045309 | protein phosphorylated amino acid binding(GO:0045309) |
0.0 | 0.1 | GO:0008553 | hydrogen-exporting ATPase activity, phosphorylative mechanism(GO:0008553) |
0.0 | 0.4 | GO:0017046 | peptide hormone binding(GO:0017046) |
0.0 | 0.1 | GO:0050656 | 3'-phosphoadenosine 5'-phosphosulfate binding(GO:0050656) |
0.0 | 0.0 | GO:0044020 | histone methyltransferase activity (H4-R3 specific)(GO:0044020) |
0.0 | 0.0 | GO:1990189 | peptide-serine-N-acetyltransferase activity(GO:1990189) peptide-glutamate-N-acetyltransferase activity(GO:1990190) |
0.0 | 0.1 | GO:0103116 | alpha-D-galactofuranose transporter activity(GO:0103116) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.1 | 0.7 | SA PROGRAMMED CELL DEATH | Programmed cell death, or apoptosis, eliminates damaged or unneeded cells. |
0.1 | 0.3 | ST IL 13 PATHWAY | Interleukin 13 (IL-13) Pathway |
0.0 | 0.3 | SA FAS SIGNALING | The TNF-type receptor Fas induces apoptosis on ligand binding. |
0.0 | 2.1 | PID RHOA REG PATHWAY | Regulation of RhoA activity |
0.0 | 0.2 | PID IL5 PATHWAY | IL5-mediated signaling events |
0.0 | 0.6 | PID S1P S1P4 PATHWAY | S1P4 pathway |
0.0 | 0.1 | PID ECADHERIN KERATINOCYTE PATHWAY | E-cadherin signaling in keratinocytes |
0.0 | 1.0 | PID ALK1 PATHWAY | ALK1 signaling events |
0.0 | 0.2 | PID VEGFR1 PATHWAY | VEGFR1 specific signals |
0.0 | 0.3 | PID VEGF VEGFR PATHWAY | VEGF and VEGFR signaling network |
0.0 | 0.3 | PID PDGFRA PATHWAY | PDGFR-alpha signaling pathway |
0.0 | 0.7 | PID ANGIOPOIETIN RECEPTOR PATHWAY | Angiopoietin receptor Tie2-mediated signaling |
0.0 | 0.1 | PID A6B1 A6B4 INTEGRIN PATHWAY | a6b1 and a6b4 Integrin signaling |
0.0 | 0.5 | PID S1P S1P2 PATHWAY | S1P2 pathway |
0.0 | 0.2 | PID IGF1 PATHWAY | IGF1 pathway |
0.0 | 0.2 | SA B CELL RECEPTOR COMPLEXES | Antigen binding to B cell receptors activates protein tyrosine kinases, such as the Src family, which ultimate activate MAP kinases. |
0.0 | 0.7 | PID RAC1 REG PATHWAY | Regulation of RAC1 activity |
0.0 | 0.1 | PID S1P S1P3 PATHWAY | S1P3 pathway |
0.0 | 1.0 | PID INTEGRIN A4B1 PATHWAY | Alpha4 beta1 integrin signaling events |
0.0 | 1.6 | PID AR PATHWAY | Coregulation of Androgen receptor activity |
0.0 | 0.5 | PID IL2 PI3K PATHWAY | IL2 signaling events mediated by PI3K |
0.0 | 0.1 | PID LYMPH ANGIOGENESIS PATHWAY | VEGFR3 signaling in lymphatic endothelium |
0.0 | 1.0 | PID TXA2PATHWAY | Thromboxane A2 receptor signaling |
0.0 | 0.7 | PID EPO PATHWAY | EPO signaling pathway |
0.0 | 0.1 | PID BETA CATENIN DEG PATHWAY | Degradation of beta catenin |
0.0 | 0.2 | SA REG CASCADE OF CYCLIN EXPR | Expression of cyclins regulates progression through the cell cycle by activating cyclin-dependent kinases. |
0.0 | 0.3 | ST G ALPHA S PATHWAY | G alpha s Pathway |
0.0 | 0.1 | PID SMAD2 3PATHWAY | Regulation of cytoplasmic and nuclear SMAD2/3 signaling |
0.0 | 0.5 | PID INTEGRIN3 PATHWAY | Beta3 integrin cell surface interactions |
0.0 | 0.5 | PID PTP1B PATHWAY | Signaling events mediated by PTP1B |
0.0 | 0.7 | PID FGF PATHWAY | FGF signaling pathway |
0.0 | 0.8 | PID RAC1 PATHWAY | RAC1 signaling pathway |
0.0 | 0.8 | PID AURORA B PATHWAY | Aurora B signaling |
0.0 | 0.4 | PID UPA UPAR PATHWAY | Urokinase-type plasminogen activator (uPA) and uPAR-mediated signaling |
0.0 | 0.5 | PID SYNDECAN 4 PATHWAY | Syndecan-4-mediated signaling events |
0.0 | 0.1 | PID WNT NONCANONICAL PATHWAY | Noncanonical Wnt signaling pathway |
0.0 | 0.4 | PID RAS PATHWAY | Regulation of Ras family activation |
0.0 | 0.0 | PID INTEGRIN4 PATHWAY | Alpha6 beta4 integrin-ligand interactions |
0.0 | 0.3 | PID VEGFR1 2 PATHWAY | Signaling events mediated by VEGFR1 and VEGFR2 |
0.0 | 0.4 | PID AJDISS 2PATHWAY | Posttranslational regulation of adherens junction stability and dissassembly |
0.0 | 0.1 | PID NECTIN PATHWAY | Nectin adhesion pathway |
0.0 | 0.2 | PID EPHRINB REV PATHWAY | Ephrin B reverse signaling |
0.0 | 0.3 | PID FCER1 PATHWAY | Fc-epsilon receptor I signaling in mast cells |
0.0 | 0.1 | PID EPHB FWD PATHWAY | EPHB forward signaling |
0.0 | 0.3 | PID RHODOPSIN PATHWAY | Visual signal transduction: Rods |
0.0 | 0.2 | PID LPA4 PATHWAY | LPA4-mediated signaling events |
0.0 | 0.1 | PID PI3K PLC TRK PATHWAY | Trk receptor signaling mediated by PI3K and PLC-gamma |
0.0 | 0.2 | ST ERK1 ERK2 MAPK PATHWAY | ERK1/ERK2 MAPK Pathway |
0.0 | 0.2 | PID TCR CALCIUM PATHWAY | Calcium signaling in the CD4+ TCR pathway |
0.0 | 0.2 | PID MYC PATHWAY | C-MYC pathway |
0.0 | 0.0 | PID TCPTP PATHWAY | Signaling events mediated by TCPTP |
0.0 | 0.0 | SIG IL4RECEPTOR IN B LYPHOCYTES | Genes related to IL4 rceptor signaling in B lymphocytes |
0.0 | 0.1 | PID FAS PATHWAY | FAS (CD95) signaling pathway |
0.0 | 1.5 | NABA ECM AFFILIATED | Genes encoding proteins affiliated structurally or functionally to extracellular matrix proteins |
0.0 | 0.2 | PID BETA CATENIN NUC PATHWAY | Regulation of nuclear beta catenin signaling and target gene transcription |
0.0 | 0.3 | PID IL4 2PATHWAY | IL4-mediated signaling events |
0.0 | 0.1 | PID NETRIN PATHWAY | Netrin-mediated signaling events |
0.0 | 0.2 | PID NFAT 3PATHWAY | Role of Calcineurin-dependent NFAT signaling in lymphocytes |
0.0 | 0.0 | PID IL2 1PATHWAY | IL2-mediated signaling events |
0.0 | 0.0 | PID INTEGRIN5 PATHWAY | Beta5 beta6 beta7 and beta8 integrin cell surface interactions |
0.0 | 0.0 | ST TUMOR NECROSIS FACTOR PATHWAY | Tumor Necrosis Factor Pathway. |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.1 | 0.4 | REACTOME APOBEC3G MEDIATED RESISTANCE TO HIV1 INFECTION | Genes involved in APOBEC3G mediated resistance to HIV-1 infection |
0.1 | 0.3 | REACTOME XENOBIOTICS | Genes involved in Xenobiotics |
0.1 | 0.2 | REACTOME ENDOSOMAL VACUOLAR PATHWAY | Genes involved in Endosomal/Vacuolar pathway |
0.1 | 0.7 | REACTOME FGFR4 LIGAND BINDING AND ACTIVATION | Genes involved in FGFR4 ligand binding and activation |
0.1 | 0.6 | REACTOME PECAM1 INTERACTIONS | Genes involved in PECAM1 interactions |
0.1 | 0.4 | REACTOME DCC MEDIATED ATTRACTIVE SIGNALING | Genes involved in DCC mediated attractive signaling |
0.1 | 0.2 | REACTOME SIGNALING BY CONSTITUTIVELY ACTIVE EGFR | Genes involved in Signaling by constitutively active EGFR |
0.1 | 0.2 | REACTOME ALPHA LINOLENIC ACID ALA METABOLISM | Genes involved in alpha-linolenic acid (ALA) metabolism |
0.1 | 0.5 | REACTOME REGULATION OF COMPLEMENT CASCADE | Genes involved in Regulation of Complement cascade |
0.0 | 0.5 | REACTOME APOPTOTIC CLEAVAGE OF CELL ADHESION PROTEINS | Genes involved in Apoptotic cleavage of cell adhesion proteins |
0.0 | 0.5 | REACTOME HYALURONAN UPTAKE AND DEGRADATION | Genes involved in Hyaluronan uptake and degradation |
0.0 | 0.4 | REACTOME IL 6 SIGNALING | Genes involved in Interleukin-6 signaling |
0.0 | 0.4 | REACTOME TRANSPORT OF ORGANIC ANIONS | Genes involved in Transport of organic anions |
0.0 | 0.7 | REACTOME OTHER SEMAPHORIN INTERACTIONS | Genes involved in Other semaphorin interactions |
0.0 | 0.8 | REACTOME ADHERENS JUNCTIONS INTERACTIONS | Genes involved in Adherens junctions interactions |
0.0 | 0.4 | REACTOME P2Y RECEPTORS | Genes involved in P2Y receptors |
0.0 | 0.2 | REACTOME RNA POL I PROMOTER OPENING | Genes involved in RNA Polymerase I Promoter Opening |
0.0 | 0.3 | REACTOME VEGF LIGAND RECEPTOR INTERACTIONS | Genes involved in VEGF ligand-receptor interactions |
0.0 | 0.3 | REACTOME GPVI MEDIATED ACTIVATION CASCADE | Genes involved in GPVI-mediated activation cascade |
0.0 | 0.3 | REACTOME NEPHRIN INTERACTIONS | Genes involved in Nephrin interactions |
0.0 | 0.8 | REACTOME SMAD2 SMAD3 SMAD4 HETEROTRIMER REGULATES TRANSCRIPTION | Genes involved in SMAD2/SMAD3:SMAD4 heterotrimer regulates transcription |
0.0 | 0.3 | REACTOME PURINE CATABOLISM | Genes involved in Purine catabolism |
0.0 | 0.5 | REACTOME SIGNALING BY HIPPO | Genes involved in Signaling by Hippo |
0.0 | 0.4 | REACTOME RAP1 SIGNALLING | Genes involved in Rap1 signalling |
0.0 | 0.3 | REACTOME ROLE OF DCC IN REGULATING APOPTOSIS | Genes involved in Role of DCC in regulating apoptosis |
0.0 | 0.1 | REACTOME REGULATION OF SIGNALING BY CBL | Genes involved in Regulation of signaling by CBL |
0.0 | 0.7 | REACTOME EFFECTS OF PIP2 HYDROLYSIS | Genes involved in Effects of PIP2 hydrolysis |
0.0 | 0.3 | REACTOME REGULATION OF INSULIN SECRETION BY ACETYLCHOLINE | Genes involved in Regulation of Insulin Secretion by Acetylcholine |
0.0 | 0.5 | REACTOME ENOS ACTIVATION AND REGULATION | Genes involved in eNOS activation and regulation |
0.0 | 0.5 | REACTOME DARPP 32 EVENTS | Genes involved in DARPP-32 events |
0.0 | 0.4 | REACTOME SMOOTH MUSCLE CONTRACTION | Genes involved in Smooth Muscle Contraction |
0.0 | 0.7 | REACTOME SIGNAL TRANSDUCTION BY L1 | Genes involved in Signal transduction by L1 |
0.0 | 0.3 | REACTOME TGF BETA RECEPTOR SIGNALING IN EMT EPITHELIAL TO MESENCHYMAL TRANSITION | Genes involved in TGF-beta receptor signaling in EMT (epithelial to mesenchymal transition) |
0.0 | 0.6 | REACTOME SEMA4D INDUCED CELL MIGRATION AND GROWTH CONE COLLAPSE | Genes involved in Sema4D induced cell migration and growth-cone collapse |
0.0 | 0.1 | REACTOME NFKB IS ACTIVATED AND SIGNALS SURVIVAL | Genes involved in NF-kB is activated and signals survival |
0.0 | 0.4 | REACTOME PRE NOTCH PROCESSING IN GOLGI | Genes involved in Pre-NOTCH Processing in Golgi |
0.0 | 0.3 | REACTOME MTORC1 MEDIATED SIGNALLING | Genes involved in mTORC1-mediated signalling |
0.0 | 0.1 | REACTOME HYALURONAN METABOLISM | Genes involved in Hyaluronan metabolism |
0.0 | 0.2 | REACTOME GLUCURONIDATION | Genes involved in Glucuronidation |
0.0 | 0.2 | REACTOME CASPASE MEDIATED CLEAVAGE OF CYTOSKELETAL PROTEINS | Genes involved in Caspase-mediated cleavage of cytoskeletal proteins |
0.0 | 0.1 | REACTOME REGULATION OF IFNG SIGNALING | Genes involved in Regulation of IFNG signaling |
0.0 | 0.3 | REACTOME CHYLOMICRON MEDIATED LIPID TRANSPORT | Genes involved in Chylomicron-mediated lipid transport |
0.0 | 0.4 | REACTOME MYOGENESIS | Genes involved in Myogenesis |
0.0 | 0.2 | REACTOME VITAMIN B5 PANTOTHENATE METABOLISM | Genes involved in Vitamin B5 (pantothenate) metabolism |
0.0 | 0.2 | REACTOME NOTCH HLH TRANSCRIPTION PATHWAY | Genes involved in Notch-HLH transcription pathway |
0.0 | 0.3 | REACTOME INFLAMMASOMES | Genes involved in Inflammasomes |
0.0 | 0.0 | REACTOME FGFR2C LIGAND BINDING AND ACTIVATION | Genes involved in FGFR2c ligand binding and activation |
0.0 | 0.8 | REACTOME NRAGE SIGNALS DEATH THROUGH JNK | Genes involved in NRAGE signals death through JNK |
0.0 | 0.0 | REACTOME MRNA CAPPING | Genes involved in mRNA Capping |
0.0 | 0.3 | REACTOME ANTIGEN ACTIVATES B CELL RECEPTOR LEADING TO GENERATION OF SECOND MESSENGERS | Genes involved in Antigen Activates B Cell Receptor Leading to Generation of Second Messengers |
0.0 | 0.1 | REACTOME FGFR LIGAND BINDING AND ACTIVATION | Genes involved in FGFR ligand binding and activation |
0.0 | 0.0 | REACTOME ELEVATION OF CYTOSOLIC CA2 LEVELS | Genes involved in Elevation of cytosolic Ca2+ levels |
0.0 | 0.2 | REACTOME REGULATION OF INSULIN LIKE GROWTH FACTOR IGF ACTIVITY BY INSULIN LIKE GROWTH FACTOR BINDING PROTEINS IGFBPS | Genes involved in Regulation of Insulin-like Growth Factor (IGF) Activity by Insulin-like Growth Factor Binding Proteins (IGFBPs) |
0.0 | 0.1 | REACTOME SIGNALLING TO RAS | Genes involved in Signalling to RAS |
0.0 | 0.3 | REACTOME SIGNALING BY BMP | Genes involved in Signaling by BMP |
0.0 | 0.3 | REACTOME ACYL CHAIN REMODELLING OF PG | Genes involved in Acyl chain remodelling of PG |
0.0 | 0.0 | REACTOME P53 INDEPENDENT G1 S DNA DAMAGE CHECKPOINT | Genes involved in p53-Independent G1/S DNA damage checkpoint |
0.0 | 0.2 | REACTOME CLASS C 3 METABOTROPIC GLUTAMATE PHEROMONE RECEPTORS | Genes involved in Class C/3 (Metabotropic glutamate/pheromone receptors) |
0.0 | 0.1 | REACTOME SIGNAL REGULATORY PROTEIN SIRP FAMILY INTERACTIONS | Genes involved in Signal regulatory protein (SIRP) family interactions |
0.0 | 0.2 | REACTOME APOPTOTIC CLEAVAGE OF CELLULAR PROTEINS | Genes involved in Apoptotic cleavage of cellular proteins |
0.0 | 0.2 | REACTOME N GLYCAN ANTENNAE ELONGATION | Genes involved in N-Glycan antennae elongation |
0.0 | 0.3 | REACTOME RIP MEDIATED NFKB ACTIVATION VIA DAI | Genes involved in RIP-mediated NFkB activation via DAI |
0.0 | 0.1 | REACTOME DOWNSTREAM TCR SIGNALING | Genes involved in Downstream TCR signaling |
0.0 | 0.0 | REACTOME ASSOCIATION OF LICENSING FACTORS WITH THE PRE REPLICATIVE COMPLEX | Genes involved in Association of licensing factors with the pre-replicative complex |
0.0 | 0.3 | REACTOME GAP JUNCTION ASSEMBLY | Genes involved in Gap junction assembly |
0.0 | 0.2 | REACTOME REGULATION OF AMPK ACTIVITY VIA LKB1 | Genes involved in Regulation of AMPK activity via LKB1 |
0.0 | 0.1 | REACTOME DIGESTION OF DIETARY CARBOHYDRATE | Genes involved in Digestion of dietary carbohydrate |
0.0 | 0.0 | REACTOME CTLA4 INHIBITORY SIGNALING | Genes involved in CTLA4 inhibitory signaling |
0.0 | 0.1 | REACTOME PD1 SIGNALING | Genes involved in PD-1 signaling |
0.0 | 0.1 | REACTOME EXTRINSIC PATHWAY FOR APOPTOSIS | Genes involved in Extrinsic Pathway for Apoptosis |
0.0 | 0.5 | REACTOME INWARDLY RECTIFYING K CHANNELS | Genes involved in Inwardly rectifying K+ channels |
0.0 | 0.0 | REACTOME TRAF6 MEDIATED NFKB ACTIVATION | Genes involved in TRAF6 mediated NF-kB activation |
0.0 | 0.5 | REACTOME INTEGRIN CELL SURFACE INTERACTIONS | Genes involved in Integrin cell surface interactions |
0.0 | 0.0 | REACTOME SPRY REGULATION OF FGF SIGNALING | Genes involved in Spry regulation of FGF signaling |
0.0 | 0.2 | REACTOME GROWTH HORMONE RECEPTOR SIGNALING | Genes involved in Growth hormone receptor signaling |
0.0 | 0.2 | REACTOME PROTEOLYTIC CLEAVAGE OF SNARE COMPLEX PROTEINS | Genes involved in Proteolytic cleavage of SNARE complex proteins |
0.0 | 0.3 | REACTOME ACTIVATED NOTCH1 TRANSMITS SIGNAL TO THE NUCLEUS | Genes involved in Activated NOTCH1 Transmits Signal to the Nucleus |
0.0 | 0.0 | REACTOME NUCLEAR EVENTS KINASE AND TRANSCRIPTION FACTOR ACTIVATION | Genes involved in Nuclear Events (kinase and transcription factor activation) |
0.0 | 0.1 | REACTOME SIGNAL ATTENUATION | Genes involved in Signal attenuation |
0.0 | 0.0 | REACTOME CROSS PRESENTATION OF SOLUBLE EXOGENOUS ANTIGENS ENDOSOMES | Genes involved in Cross-presentation of soluble exogenous antigens (endosomes) |
0.0 | 0.0 | REACTOME RETROGRADE NEUROTROPHIN SIGNALLING | Genes involved in Retrograde neurotrophin signalling |
0.0 | 0.2 | REACTOME GABA B RECEPTOR ACTIVATION | Genes involved in GABA B receptor activation |
0.0 | 0.0 | REACTOME BINDING AND ENTRY OF HIV VIRION | Genes involved in Binding and entry of HIV virion |
0.0 | 0.2 | REACTOME CHONDROITIN SULFATE BIOSYNTHESIS | Genes involved in Chondroitin sulfate biosynthesis |
0.0 | 0.1 | REACTOME EARLY PHASE OF HIV LIFE CYCLE | Genes involved in Early Phase of HIV Life Cycle |
0.0 | 0.1 | REACTOME OPSINS | Genes involved in Opsins |
0.0 | 0.2 | REACTOME DEGRADATION OF THE EXTRACELLULAR MATRIX | Genes involved in Degradation of the extracellular matrix |
0.0 | 0.1 | REACTOME REGULATION OF HYPOXIA INDUCIBLE FACTOR HIF BY OXYGEN | Genes involved in Regulation of Hypoxia-inducible Factor (HIF) by Oxygen |
0.0 | 0.0 | REACTOME IRAK1 RECRUITS IKK COMPLEX | Genes involved in IRAK1 recruits IKK complex |
0.0 | 0.0 | REACTOME PKA MEDIATED PHOSPHORYLATION OF CREB | Genes involved in PKA-mediated phosphorylation of CREB |
0.0 | 0.1 | REACTOME ACTIVATION OF RAC | Genes involved in Activation of Rac |
0.0 | 0.0 | REACTOME CD28 DEPENDENT VAV1 PATHWAY | Genes involved in CD28 dependent Vav1 pathway |
0.0 | 0.6 | REACTOME CELL SURFACE INTERACTIONS AT THE VASCULAR WALL | Genes involved in Cell surface interactions at the vascular wall |
0.0 | 0.1 | REACTOME DOWNSTREAM SIGNAL TRANSDUCTION | Genes involved in Downstream signal transduction |
0.0 | 0.4 | REACTOME CHEMOKINE RECEPTORS BIND CHEMOKINES | Genes involved in Chemokine receptors bind chemokines |
0.0 | 0.2 | REACTOME SYNTHESIS OF PIPS AT THE PLASMA MEMBRANE | Genes involved in Synthesis of PIPs at the plasma membrane |
0.0 | 0.0 | REACTOME SIGNALING BY FGFR | Genes involved in Signaling by FGFR |
0.0 | 0.2 | REACTOME CYTOSOLIC TRNA AMINOACYLATION | Genes involved in Cytosolic tRNA aminoacylation |
0.0 | 0.0 | REACTOME FORMATION OF TUBULIN FOLDING INTERMEDIATES BY CCT TRIC | Genes involved in Formation of tubulin folding intermediates by CCT/TriC |
0.0 | 0.1 | REACTOME IONOTROPIC ACTIVITY OF KAINATE RECEPTORS | Genes involved in Ionotropic activity of Kainate Receptors |
0.0 | 0.1 | REACTOME TRAFFICKING OF GLUR2 CONTAINING AMPA RECEPTORS | Genes involved in Trafficking of GluR2-containing AMPA receptors |