Gene Symbol | Gene ID | Gene Info |
---|---|---|
Foxc1
|
ENSMUSG00000050295.2 | Foxc1 |
Gene | Promoter | Distance | Association probability | Pearson corr. coef. | P-value | Plot |
---|---|---|---|---|---|---|
Foxc1 | chr13_31808871_31809301 | 2453 | 0.255095 | 0.81 | 4.8e-02 | Click! |
Foxc1 | chr13_31820560_31820717 | 14005 | 0.157986 | 0.70 | 1.2e-01 | Click! |
Foxc1 | chr13_31806500_31806668 | 49 | 0.972600 | -0.54 | 2.7e-01 | Click! |
Foxc1 | chr13_31804251_31804518 | 2249 | 0.268171 | 0.01 | 9.8e-01 | Click! |
Move your cursor over a bar to see sample name and corresponding Z-value.
Cis Regulatory Element (CRE) | Target Score | Top associated gene | Gene Info | Distance of CRE to TSS | CRE/Gene association probability |
---|---|---|---|---|---|
chr3_97631864_97632097 | 7.06 |
Fmo5 |
flavin containing monooxygenase 5 |
3097 |
0.18 |
chrX_156479377_156479543 | 3.48 |
Gm23404 |
predicted gene, 23404 |
23365 |
0.24 |
chr12_104084891_104085073 | 3.44 |
Serpina4-ps1 |
serine (or cysteine) peptidase inhibitor, clade A, member 4, pseudogene 1 |
4333 |
0.12 |
chr12_101954170_101954556 | 3.44 |
Atxn3 |
ataxin 3 |
3785 |
0.17 |
chr19_44394826_44394979 | 3.36 |
Scd1 |
stearoyl-Coenzyme A desaturase 1 |
11788 |
0.14 |
chr2_28882435_28882761 | 3.32 |
Ddx31 |
DEAD/H (Asp-Glu-Ala-Asp/His) box polypeptide 31 |
25457 |
0.13 |
chr9_106730382_106730719 | 3.27 |
Rad54l2 |
RAD54 like 2 (S. cerevisiae) |
7679 |
0.17 |
chr12_101953826_101954166 | 3.16 |
Atxn3 |
ataxin 3 |
4152 |
0.17 |
chr8_110644559_110644860 | 2.70 |
Vac14 |
Vac14 homolog (S. cerevisiae) |
871 |
0.63 |
chr14_21422563_21422878 | 2.35 |
Gm25864 |
predicted gene, 25864 |
27754 |
0.17 |
chr10_67176584_67176792 | 2.34 |
Jmjd1c |
jumonji domain containing 1C |
9060 |
0.22 |
chr19_44402814_44402965 | 2.33 |
Scd1 |
stearoyl-Coenzyme A desaturase 1 |
3801 |
0.18 |
chr7_67649875_67650106 | 2.27 |
Ttc23 |
tetratricopeptide repeat domain 23 |
840 |
0.51 |
chr11_75487441_75487813 | 2.23 |
Prpf8 |
pre-mRNA processing factor 8 |
772 |
0.41 |
chr2_177466042_177466193 | 2.21 |
Zfp970 |
zinc finger protein 970 |
1271 |
0.39 |
chr3_98644806_98645013 | 2.21 |
Hsd3b5 |
hydroxy-delta-5-steroid dehydrogenase, 3 beta- and steroid delta-isomerase 5 |
14657 |
0.13 |
chr9_106238560_106238771 | 2.19 |
Alas1 |
aminolevulinic acid synthase 1 |
65 |
0.95 |
chr3_89147086_89147561 | 2.18 |
Hcn3 |
hyperpolarization-activated, cyclic nucleotide-gated K+ 3 |
3891 |
0.08 |
chr1_159268925_159269084 | 2.15 |
Cop1 |
COP1, E3 ubiquitin ligase |
2270 |
0.27 |
chr8_93167580_93167731 | 2.14 |
Ces1d |
carboxylesterase 1D |
2320 |
0.22 |
chr7_63922331_63923024 | 2.09 |
Klf13 |
Kruppel-like factor 13 |
2193 |
0.22 |
chr2_113503793_113503980 | 2.09 |
Gm13964 |
predicted gene 13964 |
148 |
0.96 |
chr7_107574186_107574390 | 2.08 |
Olfml1 |
olfactomedin-like 1 |
6522 |
0.16 |
chr10_4605740_4606032 | 2.06 |
Esr1 |
estrogen receptor 1 (alpha) |
5707 |
0.24 |
chr3_18222967_18223118 | 2.06 |
Cyp7b1 |
cytochrome P450, family 7, subfamily b, polypeptide 1 |
20296 |
0.2 |
chr7_67658423_67658627 | 2.05 |
Ttc23 |
tetratricopeptide repeat domain 23 |
3078 |
0.18 |
chr11_5096479_5096889 | 2.05 |
Rhbdd3 |
rhomboid domain containing 3 |
2242 |
0.19 |
chr11_84512123_84512299 | 2.04 |
Aatf |
apoptosis antagonizing transcription factor |
1311 |
0.44 |
chr19_44397890_44398071 | 2.04 |
Scd1 |
stearoyl-Coenzyme A desaturase 1 |
8710 |
0.15 |
chr15_36281047_36281246 | 2.04 |
Rnf19a |
ring finger protein 19A |
1952 |
0.23 |
chr19_44399974_44400175 | 2.03 |
Scd1 |
stearoyl-Coenzyme A desaturase 1 |
6616 |
0.15 |
chr6_129528344_129528723 | 2.01 |
Gabarapl1 |
gamma-aminobutyric acid (GABA) A receptor-associated protein-like 1 |
4627 |
0.09 |
chr2_34777584_34777817 | 2.00 |
Hspa5 |
heat shock protein 5 |
2853 |
0.18 |
chr3_111102242_111102393 | 1.99 |
Gm43407 |
predicted gene 43407 |
6183 |
0.34 |
chr19_8128785_8129114 | 1.96 |
Slc22a28 |
solute carrier family 22, member 28 |
3033 |
0.28 |
chr5_87499331_87499512 | 1.93 |
Ugt2a1 |
UDP glucuronosyltransferase 2 family, polypeptide A1 |
8550 |
0.12 |
chr2_113774275_113774440 | 1.92 |
Grem1 |
gremlin 1, DAN family BMP antagonist |
15711 |
0.19 |
chr2_155057003_155057377 | 1.92 |
a |
nonagouti |
9575 |
0.14 |
chr2_19701468_19701642 | 1.91 |
Gm24670 |
predicted gene, 24670 |
10267 |
0.15 |
chr1_191591538_191591710 | 1.89 |
Gm37349 |
predicted gene, 37349 |
6023 |
0.16 |
chr19_12700970_12701121 | 1.89 |
Keg1 |
kidney expressed gene 1 |
5231 |
0.11 |
chr5_25253147_25253435 | 1.89 |
Galnt11 |
polypeptide N-acetylgalactosaminyltransferase 11 |
5928 |
0.17 |
chr7_98353742_98354050 | 1.87 |
Tsku |
tsukushi, small leucine rich proteoglycan |
6183 |
0.18 |
chr1_78696034_78696188 | 1.85 |
Acsl3 |
acyl-CoA synthetase long-chain family member 3 |
545 |
0.78 |
chr2_168929820_168930004 | 1.85 |
Zfp64 |
zinc finger protein 64 |
17279 |
0.17 |
chr1_67168238_67168612 | 1.84 |
Cps1 |
carbamoyl-phosphate synthetase 1 |
45399 |
0.15 |
chr15_3453354_3453796 | 1.84 |
Ghr |
growth hormone receptor |
18069 |
0.26 |
chr7_24927963_24928117 | 1.83 |
Arhgef1 |
Rho guanine nucleotide exchange factor (GEF) 1 |
4677 |
0.1 |
chr3_60576910_60577122 | 1.82 |
Mbnl1 |
muscleblind like splicing factor 1 |
18625 |
0.19 |
chr6_85763479_85763641 | 1.80 |
Nat8f3 |
N-acetyltransferase 8 (GCN5-related) family member 3 |
1080 |
0.33 |
chr19_40178466_40178780 | 1.80 |
Cyp2c70 |
cytochrome P450, family 2, subfamily c, polypeptide 70 |
8663 |
0.16 |
chr11_86352944_86353305 | 1.79 |
Med13 |
mediator complex subunit 13 |
4478 |
0.24 |
chr12_104346326_104346873 | 1.79 |
Serpina3k |
serine (or cysteine) peptidase inhibitor, clade A, member 3K |
8113 |
0.12 |
chr2_31478552_31479205 | 1.78 |
Ass1 |
argininosuccinate synthetase 1 |
8671 |
0.19 |
chr17_64607771_64607970 | 1.77 |
Man2a1 |
mannosidase 2, alpha 1 |
7134 |
0.26 |
chr2_177468355_177468573 | 1.76 |
Zfp970 |
zinc finger protein 970 |
3618 |
0.19 |
chr2_58787815_58787966 | 1.76 |
Upp2 |
uridine phosphorylase 2 |
22565 |
0.18 |
chr5_49059987_49060169 | 1.76 |
Gm43047 |
predicted gene 43047 |
9925 |
0.1 |
chr16_18068799_18068991 | 1.75 |
Dgcr6 |
DiGeorge syndrome critical region gene 6 |
585 |
0.66 |
chr9_48724021_48724519 | 1.75 |
Zbtb16 |
zinc finger and BTB domain containing 16 |
111675 |
0.06 |
chr13_109635481_109635828 | 1.75 |
Pde4d |
phosphodiesterase 4D, cAMP specific |
2874 |
0.42 |
chr10_95144816_95145075 | 1.73 |
Gm29684 |
predicted gene, 29684 |
880 |
0.54 |
chr2_134926356_134926530 | 1.72 |
Gm14036 |
predicted gene 14036 |
122494 |
0.06 |
chr7_25884401_25884651 | 1.72 |
Gm6434 |
predicted gene 6434 |
2137 |
0.18 |
chr8_40271825_40271984 | 1.72 |
Fgf20 |
fibroblast growth factor 20 |
15049 |
0.2 |
chr14_122905434_122905585 | 1.70 |
4930594M22Rik |
RIKEN cDNA 4930594M22 gene |
7521 |
0.17 |
chr1_21259850_21260251 | 1.70 |
Gsta3 |
glutathione S-transferase, alpha 3 |
6529 |
0.11 |
chr4_44192916_44193352 | 1.69 |
Rnf38 |
ring finger protein 38 |
24795 |
0.15 |
chr19_12652059_12652547 | 1.69 |
Glyat |
glycine-N-acyltransferase |
12811 |
0.09 |
chr5_140129593_140129908 | 1.68 |
Mad1l1 |
MAD1 mitotic arrest deficient 1-like 1 |
14284 |
0.15 |
chr7_140720541_140720872 | 1.68 |
Olfr542-ps1 |
olfactory receptor 542, pseudogene 1 |
576 |
0.58 |
chr11_118454196_118454347 | 1.68 |
Gm11747 |
predicted gene 11747 |
724 |
0.56 |
chr1_21246529_21246960 | 1.65 |
Gsta3 |
glutathione S-transferase, alpha 3 |
6115 |
0.12 |
chr6_120675220_120675371 | 1.63 |
Cecr2 |
CECR2, histone acetyl-lysine reader |
8713 |
0.2 |
chr1_67200730_67200905 | 1.61 |
Gm15668 |
predicted gene 15668 |
48383 |
0.14 |
chr3_35142895_35143046 | 1.60 |
1700017M07Rik |
RIKEN cDNA 1700017M07 gene |
133161 |
0.05 |
chr3_105755782_105755933 | 1.60 |
Rap1a |
RAS-related protein 1a |
5529 |
0.12 |
chr7_136493976_136494136 | 1.60 |
Gm36849 |
predicted gene, 36849 |
140692 |
0.04 |
chr1_67160568_67161028 | 1.59 |
Cps1 |
carbamoyl-phosphate synthetase 1 |
37772 |
0.17 |
chr11_5909915_5910066 | 1.59 |
Gck |
glucokinase |
5134 |
0.12 |
chr14_76800874_76801150 | 1.59 |
Gm30246 |
predicted gene, 30246 |
20185 |
0.17 |
chr17_72829234_72829476 | 1.58 |
Ypel5 |
yippee like 5 |
7098 |
0.28 |
chr3_18138170_18138321 | 1.58 |
Gm23686 |
predicted gene, 23686 |
39380 |
0.16 |
chr5_137978703_137978940 | 1.57 |
Azgp1 |
alpha-2-glycoprotein 1, zinc |
2699 |
0.13 |
chr11_120816891_120817395 | 1.57 |
Fasn |
fatty acid synthase |
1688 |
0.2 |
chr3_52617818_52618183 | 1.57 |
Gm10293 |
predicted pseudogene 10293 |
5165 |
0.27 |
chr6_94698690_94699533 | 1.57 |
Lrig1 |
leucine-rich repeats and immunoglobulin-like domains 1 |
1026 |
0.61 |
chr1_21261382_21261702 | 1.56 |
Gsta3 |
glutathione S-transferase, alpha 3 |
8021 |
0.11 |
chr19_40179770_40179927 | 1.55 |
Cyp2c70 |
cytochrome P450, family 2, subfamily c, polypeptide 70 |
7438 |
0.16 |
chr4_121163852_121164031 | 1.55 |
Rlf |
rearranged L-myc fusion sequence |
24593 |
0.11 |
chr3_118637908_118638059 | 1.55 |
Dpyd |
dihydropyrimidine dehydrogenase |
75797 |
0.1 |
chr8_93189262_93189430 | 1.55 |
Gm45909 |
predicted gene 45909 |
2012 |
0.24 |
chr1_140421414_140421565 | 1.55 |
Kcnt2 |
potassium channel, subfamily T, member 2 |
21447 |
0.27 |
chr9_46116938_46117103 | 1.54 |
Sik3 |
SIK family kinase 3 |
6110 |
0.2 |
chr15_102382063_102382244 | 1.53 |
Gm23590 |
predicted gene, 23590 |
8273 |
0.09 |
chr16_44726977_44727139 | 1.53 |
Nepro |
nucleolus and neural progenitor protein |
61 |
0.97 |
chr1_5133029_5133190 | 1.53 |
Atp6v1h |
ATPase, H+ transporting, lysosomal V1 subunit H |
49945 |
0.12 |
chr3_62341191_62341342 | 1.53 |
Arhgef26 |
Rho guanine nucleotide exchange factor (GEF) 26 |
165 |
0.89 |
chr6_14778417_14778568 | 1.52 |
Ppp1r3a |
protein phosphatase 1, regulatory subunit 3A |
23218 |
0.27 |
chr18_45582508_45582659 | 1.51 |
Kcnn2 |
potassium intermediate/small conductance calcium-activated channel, subfamily N, member 2 |
7963 |
0.24 |
chr3_58520131_58520481 | 1.51 |
Eif2a |
eukaryotic translation initiation factor 2A |
5515 |
0.16 |
chr10_111150128_111150279 | 1.50 |
Gm8873 |
predicted gene 8873 |
6013 |
0.14 |
chr17_56573047_56573233 | 1.49 |
Safb2 |
scaffold attachment factor B2 |
642 |
0.57 |
chr15_3720483_3720634 | 1.49 |
Gm4823 |
predicted gene 4823 |
26317 |
0.23 |
chr9_59617318_59618012 | 1.49 |
Parp6 |
poly (ADP-ribose) polymerase family, member 6 |
285 |
0.88 |
chr3_121807752_121808110 | 1.49 |
Abcd3 |
ATP-binding cassette, sub-family D (ALD), member 3 |
6978 |
0.13 |
chr8_93193292_93193577 | 1.48 |
Gm45909 |
predicted gene 45909 |
2076 |
0.23 |
chr19_39319574_39319725 | 1.48 |
Cyp2c72-ps |
cytochrome P450, family 2, subfamily c, polypeptide 72, pseudogene |
27718 |
0.18 |
chr3_89148683_89148834 | 1.47 |
Hcn3 |
hyperpolarization-activated, cyclic nucleotide-gated K+ 3 |
2456 |
0.11 |
chr3_138222370_138222521 | 1.47 |
Adh7 |
alcohol dehydrogenase 7 (class IV), mu or sigma polypeptide |
974 |
0.44 |
chr6_108426324_108426499 | 1.47 |
Itpr1 |
inositol 1,4,5-trisphosphate receptor 1 |
8534 |
0.22 |
chr9_74892080_74892501 | 1.47 |
Onecut1 |
one cut domain, family member 1 |
25806 |
0.14 |
chr8_93164567_93164980 | 1.46 |
Ces1d |
carboxylesterase 1D |
5202 |
0.15 |
chr11_51739157_51739308 | 1.46 |
Gm25291 |
predicted gene, 25291 |
1310 |
0.37 |
chr12_83545872_83546075 | 1.46 |
Zfyve1 |
zinc finger, FYVE domain containing 1 |
5732 |
0.17 |
chr11_51771113_51771916 | 1.44 |
Sar1b |
secretion associated Ras related GTPase 1B |
7820 |
0.15 |
chr10_117111439_117111590 | 1.43 |
Frs2 |
fibroblast growth factor receptor substrate 2 |
19332 |
0.13 |
chr8_125976536_125976742 | 1.41 |
Kcnk1 |
potassium channel, subfamily K, member 1 |
18531 |
0.19 |
chr5_125497680_125497885 | 1.41 |
Aacs |
acetoacetyl-CoA synthetase |
8367 |
0.14 |
chr7_140723099_140723551 | 1.41 |
Olfr542-ps1 |
olfactory receptor 542, pseudogene 1 |
2043 |
0.18 |
chr3_32575521_32575767 | 1.41 |
Mfn1 |
mitofusin 1 |
1426 |
0.36 |
chr5_119672236_119672455 | 1.41 |
Tbx3os1 |
T-box 3, opposite strand 1 |
980 |
0.39 |
chr1_133508090_133508255 | 1.40 |
Gm8596 |
predicted gene 8596 |
21307 |
0.18 |
chr1_127751068_127751248 | 1.40 |
Acmsd |
amino carboxymuconate semialdehyde decarboxylase |
5599 |
0.19 |
chr4_61959546_61959701 | 1.40 |
Mup-ps19 |
major urinary protein, pseudogene 19 |
288 |
0.9 |
chr15_95749355_95749601 | 1.39 |
Gm6961 |
predicted gene 6961 |
2113 |
0.22 |
chr6_85834814_85835012 | 1.39 |
Nat8 |
N-acetyltransferase 8 (GCN5-related) |
2831 |
0.12 |
chr19_40090346_40090724 | 1.39 |
Cyp2c50 |
cytochrome P450, family 2, subfamily c, polypeptide 50 |
800 |
0.64 |
chr6_149149841_149149992 | 1.39 |
Etfbkmt |
electron transfer flavoprotein beta subunit lysine methyltransferase |
8270 |
0.13 |
chr9_106235817_106235968 | 1.38 |
Alas1 |
aminolevulinic acid synthase 1 |
1192 |
0.3 |
chr12_69654045_69654390 | 1.38 |
Sos2 |
SOS Ras/Rho guanine nucleotide exchange factor 2 |
27410 |
0.14 |
chr3_121437304_121437494 | 1.37 |
Gm42929 |
predicted gene 42929 |
9353 |
0.14 |
chr13_24359929_24360183 | 1.37 |
Gm11342 |
predicted gene 11342 |
15894 |
0.12 |
chr18_9505957_9506224 | 1.36 |
Gm7527 |
predicted gene 7527 |
10469 |
0.15 |
chr11_69098275_69098686 | 1.36 |
Per1 |
period circadian clock 1 |
468 |
0.58 |
chr16_43237462_43237654 | 1.36 |
Zbtb20 |
zinc finger and BTB domain containing 20 |
1519 |
0.44 |
chr5_20319781_20319982 | 1.36 |
Gm22755 |
predicted gene, 22755 |
55540 |
0.13 |
chr3_121789937_121790142 | 1.36 |
4633401B06Rik |
RIKEN cDNA 4633401B06 gene |
1467 |
0.29 |
chr3_18222674_18222825 | 1.35 |
Cyp7b1 |
cytochrome P450, family 7, subfamily b, polypeptide 1 |
20589 |
0.2 |
chr9_55323175_55323326 | 1.35 |
Nrg4 |
neuregulin 4 |
1937 |
0.29 |
chr6_53070500_53070680 | 1.35 |
Jazf1 |
JAZF zinc finger 1 |
1959 |
0.36 |
chr3_118663369_118663520 | 1.34 |
Dpyd |
dihydropyrimidine dehydrogenase |
101258 |
0.07 |
chr5_125515518_125515904 | 1.34 |
Aacs |
acetoacetyl-CoA synthetase |
468 |
0.77 |
chr2_177900583_177900745 | 1.34 |
Gm14327 |
predicted gene 14327 |
3568 |
0.18 |
chr2_102384622_102384797 | 1.34 |
Trim44 |
tripartite motif-containing 44 |
15548 |
0.23 |
chr10_87931882_87932033 | 1.34 |
Tyms-ps |
thymidylate synthase, pseudogene |
34890 |
0.14 |
chr1_63136443_63136630 | 1.33 |
Ndufs1 |
NADH:ubiquinone oxidoreductase core subunit S1 |
8425 |
0.09 |
chr3_52542869_52543030 | 1.33 |
Gm30173 |
predicted gene, 30173 |
25985 |
0.2 |
chrX_77463407_77463558 | 1.33 |
Gm5937 |
predicted gene 5937 |
6896 |
0.25 |
chr9_55283853_55284093 | 1.33 |
Nrg4 |
neuregulin 4 |
348 |
0.87 |
chr16_43169614_43169782 | 1.33 |
Gm15712 |
predicted gene 15712 |
14875 |
0.21 |
chr1_67201803_67201976 | 1.33 |
Gm15668 |
predicted gene 15668 |
47311 |
0.14 |
chr5_8667945_8668138 | 1.32 |
Gm42684 |
predicted gene 42684 |
1479 |
0.38 |
chr19_34312705_34312875 | 1.32 |
Fas |
Fas (TNF receptor superfamily member 6) |
12715 |
0.17 |
chr7_114361745_114361949 | 1.32 |
4933406I18Rik |
RIKEN cDNA 4933406I18 gene |
53174 |
0.12 |
chr14_61680870_61681697 | 1.31 |
Gm37472 |
predicted gene, 37472 |
211 |
0.83 |
chr10_50896822_50896973 | 1.31 |
Sim1 |
single-minded family bHLH transcription factor 1 |
1246 |
0.58 |
chr8_41069551_41069759 | 1.31 |
Mtus1 |
mitochondrial tumor suppressor 1 |
13121 |
0.16 |
chr2_18103540_18103740 | 1.30 |
Mllt10 |
myeloid/lymphoid or mixed-lineage leukemia; translocated to, 10 |
20069 |
0.12 |
chr15_80682882_80683077 | 1.30 |
Fam83f |
family with sequence similarity 83, member F |
11132 |
0.12 |
chr5_147548677_147549145 | 1.29 |
Pan3 |
PAN3 poly(A) specific ribonuclease subunit |
9634 |
0.2 |
chr11_59226278_59226466 | 1.29 |
Arf1 |
ADP-ribosylation factor 1 |
1790 |
0.2 |
chr2_146429524_146429960 | 1.29 |
Ralgapa2 |
Ral GTPase activating protein, alpha subunit 2 (catalytic) |
16866 |
0.26 |
chr8_93169660_93169849 | 1.29 |
Ces1d |
carboxylesterase 1D |
221 |
0.91 |
chr4_119551551_119551702 | 1.28 |
Gm12959 |
predicted gene 12959 |
2432 |
0.16 |
chr9_111440393_111440743 | 1.28 |
Dclk3 |
doublecortin-like kinase 3 |
1487 |
0.42 |
chr11_120813788_120814608 | 1.28 |
Fasn |
fatty acid synthase |
1257 |
0.26 |
chr17_24881412_24881880 | 1.28 |
Igfals |
insulin-like growth factor binding protein, acid labile subunit |
2889 |
0.1 |
chr2_11332436_11332695 | 1.27 |
Gm37851 |
predicted gene, 37851 |
260 |
0.86 |
chr2_72204001_72204398 | 1.27 |
Rapgef4 |
Rap guanine nucleotide exchange factor (GEF) 4 |
5400 |
0.2 |
chr11_75051173_75051343 | 1.27 |
Gm12333 |
predicted gene 12333 |
11910 |
0.12 |
chr9_74894770_74895613 | 1.26 |
Onecut1 |
one cut domain, family member 1 |
28707 |
0.13 |
chr16_25067205_25067368 | 1.26 |
A230028O05Rik |
RIKEN cDNA A230028O05 gene |
7647 |
0.32 |
chr15_59014305_59014721 | 1.26 |
Mtss1 |
MTSS I-BAR domain containing 1 |
26083 |
0.16 |
chr11_46695519_46695670 | 1.26 |
Timd2 |
T cell immunoglobulin and mucin domain containing 2 |
3368 |
0.19 |
chr4_140860722_140860933 | 1.26 |
4930515B02Rik |
RIKEN cDNA 4930515B02 gene |
11866 |
0.12 |
chr4_101198122_101198415 | 1.26 |
Gm24468 |
predicted gene, 24468 |
11504 |
0.14 |
chr3_97635501_97635936 | 1.25 |
Fmo5 |
flavin containing monooxygenase 5 |
6835 |
0.14 |
chr14_76149595_76149834 | 1.24 |
Nufip1 |
nuclear fragile X mental retardation protein interacting protein 1 |
38823 |
0.15 |
chr1_51774175_51774474 | 1.24 |
Myo1b |
myosin IB |
2112 |
0.33 |
chr3_97637473_97637939 | 1.24 |
Fmo5 |
flavin containing monooxygenase 5 |
8823 |
0.13 |
chr4_40145230_40145427 | 1.24 |
Aco1 |
aconitase 1 |
2247 |
0.3 |
chr16_22261384_22261540 | 1.23 |
Tra2b |
transformer 2 beta |
1840 |
0.24 |
chr7_102314167_102314549 | 1.23 |
Stim1 |
stromal interaction molecule 1 |
46031 |
0.09 |
chr13_9420718_9420882 | 1.23 |
Gm48889 |
predicted gene, 48889 |
8283 |
0.18 |
chr18_39139135_39139286 | 1.23 |
Arhgap26 |
Rho GTPase activating protein 26 |
39899 |
0.19 |
chr16_92611342_92611550 | 1.22 |
Gm26626 |
predicted gene, 26626 |
1368 |
0.48 |
chr7_72298468_72299026 | 1.22 |
Mctp2 |
multiple C2 domains, transmembrane 2 |
7861 |
0.3 |
chr3_97655610_97655761 | 1.22 |
Prkab2 |
protein kinase, AMP-activated, beta 2 non-catalytic subunit |
2508 |
0.2 |
chr8_56230092_56230281 | 1.22 |
Hpgd |
hydroxyprostaglandin dehydrogenase 15 (NAD) |
64399 |
0.12 |
chr19_44400900_44401269 | 1.22 |
Scd1 |
stearoyl-Coenzyme A desaturase 1 |
5606 |
0.16 |
chr16_93860540_93860703 | 1.22 |
Morc3 |
microrchidia 3 |
108 |
0.95 |
chrX_84953443_84953597 | 1.21 |
Gm14770 |
predicted gene 14770 |
73633 |
0.12 |
chr16_11407701_11407852 | 1.21 |
Snx29 |
sorting nexin 29 |
1119 |
0.57 |
chr9_111274525_111274696 | 1.21 |
Epm2aip1 |
EPM2A (laforin) interacting protein 1 |
508 |
0.75 |
chr5_86916838_86916989 | 1.21 |
Gm25211 |
predicted gene, 25211 |
591 |
0.59 |
chr1_74698438_74698727 | 1.21 |
Ttll4 |
tubulin tyrosine ligase-like family, member 4 |
2848 |
0.18 |
chr10_68134623_68135230 | 1.20 |
Arid5b |
AT rich interactive domain 5B (MRF1-like) |
1700 |
0.47 |
chr1_151339242_151339404 | 1.20 |
Gm10138 |
predicted gene 10138 |
4759 |
0.16 |
chr13_46735806_46736396 | 1.20 |
Nup153 |
nucleoporin 153 |
8161 |
0.17 |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
1.6 | 4.8 | GO:0019626 | short-chain fatty acid catabolic process(GO:0019626) |
1.4 | 8.6 | GO:0006526 | arginine biosynthetic process(GO:0006526) |
1.4 | 4.2 | GO:1903800 | positive regulation of production of miRNAs involved in gene silencing by miRNA(GO:1903800) |
1.2 | 2.4 | GO:0019676 | ammonia assimilation cycle(GO:0019676) |
1.1 | 3.4 | GO:0006068 | ethanol catabolic process(GO:0006068) |
1.0 | 4.0 | GO:0046449 | creatinine metabolic process(GO:0046449) cellular lactam metabolic process(GO:0072338) |
1.0 | 4.0 | GO:1903964 | monounsaturated fatty acid metabolic process(GO:1903964) monounsaturated fatty acid biosynthetic process(GO:1903966) |
0.9 | 2.6 | GO:0006701 | progesterone biosynthetic process(GO:0006701) |
0.8 | 2.4 | GO:0042998 | positive regulation of Golgi to plasma membrane protein transport(GO:0042998) |
0.8 | 3.0 | GO:0060528 | secretory columnal luminar epithelial cell differentiation involved in prostate glandular acinus development(GO:0060528) |
0.7 | 2.9 | GO:2001013 | epithelial cell proliferation involved in renal tubule morphogenesis(GO:2001013) |
0.7 | 1.4 | GO:1904193 | cholangiocyte apoptotic process(GO:1902488) regulation of cholangiocyte apoptotic process(GO:1904192) negative regulation of cholangiocyte apoptotic process(GO:1904193) |
0.7 | 3.4 | GO:0050882 | voluntary musculoskeletal movement(GO:0050882) |
0.6 | 1.9 | GO:1901078 | negative regulation of relaxation of muscle(GO:1901078) |
0.6 | 2.8 | GO:0061073 | ciliary body morphogenesis(GO:0061073) |
0.6 | 1.7 | GO:1901301 | regulation of cargo loading into COPII-coated vesicle(GO:1901301) |
0.5 | 2.2 | GO:0006166 | purine ribonucleoside salvage(GO:0006166) |
0.5 | 2.2 | GO:0072602 | interleukin-4 secretion(GO:0072602) |
0.5 | 0.5 | GO:0006714 | sesquiterpenoid metabolic process(GO:0006714) |
0.5 | 1.5 | GO:0021553 | olfactory nerve development(GO:0021553) |
0.5 | 2.0 | GO:0006538 | glutamate catabolic process(GO:0006538) |
0.5 | 1.4 | GO:0034287 | detection of carbohydrate stimulus(GO:0009730) detection of hexose stimulus(GO:0009732) detection of monosaccharide stimulus(GO:0034287) detection of glucose(GO:0051594) |
0.5 | 2.4 | GO:0090205 | positive regulation of cholesterol biosynthetic process(GO:0045542) positive regulation of cholesterol metabolic process(GO:0090205) |
0.5 | 2.4 | GO:2000324 | positive regulation of glucocorticoid receptor signaling pathway(GO:2000324) |
0.5 | 4.1 | GO:0055091 | phospholipid homeostasis(GO:0055091) |
0.5 | 1.4 | GO:0046985 | positive regulation of hemoglobin biosynthetic process(GO:0046985) |
0.4 | 2.2 | GO:0001978 | regulation of systemic arterial blood pressure by carotid sinus baroreceptor feedback(GO:0001978) |
0.4 | 1.3 | GO:0070447 | positive regulation of oligodendrocyte progenitor proliferation(GO:0070447) |
0.4 | 1.3 | GO:0097167 | circadian regulation of translation(GO:0097167) |
0.4 | 2.2 | GO:0021779 | oligodendrocyte cell fate specification(GO:0021778) oligodendrocyte cell fate commitment(GO:0021779) glial cell fate specification(GO:0021780) |
0.4 | 0.8 | GO:0046098 | guanine metabolic process(GO:0046098) |
0.4 | 1.6 | GO:0044597 | polyketide metabolic process(GO:0030638) aminoglycoside antibiotic metabolic process(GO:0030647) daunorubicin metabolic process(GO:0044597) doxorubicin metabolic process(GO:0044598) |
0.4 | 1.6 | GO:2000189 | positive regulation of cholesterol homeostasis(GO:2000189) |
0.4 | 1.2 | GO:0034137 | positive regulation of toll-like receptor 2 signaling pathway(GO:0034137) |
0.4 | 1.2 | GO:0031086 | nuclear-transcribed mRNA catabolic process, deadenylation-independent decay(GO:0031086) deadenylation-independent decapping of nuclear-transcribed mRNA(GO:0031087) |
0.4 | 4.2 | GO:0009404 | toxin metabolic process(GO:0009404) |
0.4 | 1.1 | GO:0006553 | lysine metabolic process(GO:0006553) |
0.4 | 1.1 | GO:0060523 | prostate epithelial cord elongation(GO:0060523) |
0.4 | 1.5 | GO:0018243 | protein O-linked glycosylation via threonine(GO:0018243) |
0.4 | 0.7 | GO:1904023 | regulation of fermentation(GO:0043465) regulation of NAD metabolic process(GO:1902688) regulation of glucose catabolic process to lactate via pyruvate(GO:1904023) |
0.4 | 1.5 | GO:0071043 | CUT catabolic process(GO:0071034) CUT metabolic process(GO:0071043) |
0.4 | 1.1 | GO:0034310 | primary alcohol catabolic process(GO:0034310) |
0.4 | 1.1 | GO:2000286 | receptor internalization involved in canonical Wnt signaling pathway(GO:2000286) |
0.4 | 1.4 | GO:0006987 | activation of signaling protein activity involved in unfolded protein response(GO:0006987) |
0.3 | 0.7 | GO:1902065 | response to L-glutamate(GO:1902065) |
0.3 | 0.7 | GO:0051025 | negative regulation of immunoglobulin secretion(GO:0051025) |
0.3 | 1.0 | GO:1904154 | positive regulation of retrograde protein transport, ER to cytosol(GO:1904154) |
0.3 | 0.7 | GO:0060125 | negative regulation of growth hormone secretion(GO:0060125) |
0.3 | 0.3 | GO:1901420 | negative regulation of response to alcohol(GO:1901420) |
0.3 | 1.4 | GO:0061724 | lipophagy(GO:0061724) |
0.3 | 1.0 | GO:0043490 | malate-aspartate shuttle(GO:0043490) |
0.3 | 1.0 | GO:0003289 | atrial septum primum morphogenesis(GO:0003289) |
0.3 | 0.3 | GO:0090110 | cargo loading into COPII-coated vesicle(GO:0090110) |
0.3 | 1.0 | GO:0097680 | double-strand break repair via classical nonhomologous end joining(GO:0097680) |
0.3 | 2.3 | GO:0097105 | presynaptic membrane assembly(GO:0097105) |
0.3 | 1.0 | GO:1903334 | positive regulation of protein folding(GO:1903334) |
0.3 | 2.9 | GO:0043651 | linoleic acid metabolic process(GO:0043651) |
0.3 | 1.0 | GO:0032474 | otolith morphogenesis(GO:0032474) |
0.3 | 1.3 | GO:0000320 | re-entry into mitotic cell cycle(GO:0000320) |
0.3 | 0.6 | GO:0070672 | response to interleukin-15(GO:0070672) |
0.3 | 0.3 | GO:0035860 | glial cell-derived neurotrophic factor receptor signaling pathway(GO:0035860) |
0.3 | 1.6 | GO:0032237 | activation of store-operated calcium channel activity(GO:0032237) |
0.3 | 0.3 | GO:0019660 | fermentation(GO:0006113) glucose catabolic process to lactate(GO:0019659) glycolytic fermentation(GO:0019660) glucose catabolic process to lactate via pyruvate(GO:0019661) |
0.3 | 0.6 | GO:0090170 | regulation of Golgi inheritance(GO:0090170) |
0.3 | 1.2 | GO:0030050 | vesicle transport along actin filament(GO:0030050) |
0.3 | 0.6 | GO:0071492 | cellular response to UV-A(GO:0071492) |
0.3 | 0.6 | GO:0050747 | positive regulation of lipoprotein metabolic process(GO:0050747) |
0.3 | 1.2 | GO:0019805 | quinolinate biosynthetic process(GO:0019805) |
0.3 | 0.6 | GO:0072361 | regulation of glycolytic process by regulation of transcription from RNA polymerase II promoter(GO:0072361) |
0.3 | 0.9 | GO:0015959 | diadenosine polyphosphate metabolic process(GO:0015959) |
0.3 | 2.0 | GO:0006265 | DNA topological change(GO:0006265) |
0.3 | 0.9 | GO:0034196 | acylglycerol transport(GO:0034196) triglyceride transport(GO:0034197) |
0.3 | 0.9 | GO:0016554 | cytidine to uridine editing(GO:0016554) |
0.3 | 0.9 | GO:0061368 | behavioral response to chemical pain(GO:0061366) behavioral response to formalin induced pain(GO:0061368) |
0.3 | 5.7 | GO:0006783 | heme biosynthetic process(GO:0006783) |
0.3 | 1.7 | GO:0042985 | negative regulation of amyloid precursor protein biosynthetic process(GO:0042985) |
0.3 | 0.8 | GO:0097051 | establishment of protein localization to endoplasmic reticulum membrane(GO:0097051) |
0.3 | 0.5 | GO:1903297 | regulation of hypoxia-induced intrinsic apoptotic signaling pathway(GO:1903297) negative regulation of hypoxia-induced intrinsic apoptotic signaling pathway(GO:1903298) |
0.3 | 1.4 | GO:0060685 | regulation of prostatic bud formation(GO:0060685) |
0.3 | 1.1 | GO:1902897 | regulation of postsynaptic density protein 95 clustering(GO:1902897) |
0.3 | 0.3 | GO:0018879 | biphenyl metabolic process(GO:0018879) |
0.3 | 1.4 | GO:0045647 | negative regulation of erythrocyte differentiation(GO:0045647) |
0.3 | 0.8 | GO:0033615 | mitochondrial proton-transporting ATP synthase complex assembly(GO:0033615) |
0.3 | 1.1 | GO:0030035 | microspike assembly(GO:0030035) |
0.3 | 0.5 | GO:0010982 | regulation of high-density lipoprotein particle clearance(GO:0010982) |
0.3 | 0.5 | GO:0046874 | quinolinate metabolic process(GO:0046874) |
0.3 | 0.8 | GO:0019086 | late viral transcription(GO:0019086) |
0.3 | 1.3 | GO:0006642 | triglyceride mobilization(GO:0006642) |
0.3 | 1.3 | GO:0034770 | histone H4-K20 methylation(GO:0034770) |
0.3 | 0.5 | GO:2000259 | positive regulation of complement activation(GO:0045917) positive regulation of protein activation cascade(GO:2000259) |
0.3 | 1.0 | GO:1903689 | regulation of wound healing, spreading of epidermal cells(GO:1903689) |
0.3 | 3.1 | GO:0006103 | 2-oxoglutarate metabolic process(GO:0006103) |
0.3 | 2.0 | GO:0032825 | positive regulation of natural killer cell differentiation(GO:0032825) |
0.3 | 0.3 | GO:0060839 | endothelial cell fate commitment(GO:0060839) |
0.3 | 1.0 | GO:0032201 | telomere maintenance via semi-conservative replication(GO:0032201) |
0.2 | 0.7 | GO:0048549 | positive regulation of pinocytosis(GO:0048549) |
0.2 | 0.7 | GO:0071276 | cellular response to cadmium ion(GO:0071276) |
0.2 | 0.7 | GO:2000667 | positive regulation of interleukin-5 secretion(GO:2000664) positive regulation of interleukin-13 secretion(GO:2000667) |
0.2 | 0.7 | GO:0033387 | putrescine biosynthetic process from ornithine(GO:0033387) |
0.2 | 0.7 | GO:0009256 | 10-formyltetrahydrofolate metabolic process(GO:0009256) |
0.2 | 0.5 | GO:0007597 | blood coagulation, intrinsic pathway(GO:0007597) |
0.2 | 0.7 | GO:0035973 | aggrephagy(GO:0035973) |
0.2 | 1.2 | GO:0009052 | pentose-phosphate shunt, non-oxidative branch(GO:0009052) |
0.2 | 0.7 | GO:0032058 | positive regulation of translational initiation in response to stress(GO:0032058) |
0.2 | 0.9 | GO:1903011 | negative regulation of bone development(GO:1903011) |
0.2 | 0.7 | GO:0034727 | lysosomal microautophagy(GO:0016237) piecemeal microautophagy of nucleus(GO:0034727) late nucleophagy(GO:0044805) |
0.2 | 0.5 | GO:0061419 | positive regulation of transcription from RNA polymerase II promoter in response to hypoxia(GO:0061419) |
0.2 | 0.2 | GO:0006106 | fumarate metabolic process(GO:0006106) |
0.2 | 0.9 | GO:0003383 | apical constriction(GO:0003383) |
0.2 | 0.9 | GO:0018406 | protein C-linked glycosylation(GO:0018103) peptidyl-tryptophan modification(GO:0018211) protein C-linked glycosylation via tryptophan(GO:0018317) protein C-linked glycosylation via 2'-alpha-mannosyl-L-tryptophan(GO:0018406) |
0.2 | 0.4 | GO:0060687 | regulation of branching involved in prostate gland morphogenesis(GO:0060687) |
0.2 | 0.4 | GO:1902083 | negative regulation of peptidyl-cysteine S-nitrosylation(GO:1902083) |
0.2 | 2.4 | GO:0033147 | negative regulation of intracellular estrogen receptor signaling pathway(GO:0033147) |
0.2 | 0.2 | GO:0006533 | aspartate catabolic process(GO:0006533) |
0.2 | 0.2 | GO:1900222 | negative regulation of beta-amyloid clearance(GO:1900222) |
0.2 | 5.7 | GO:0006084 | acetyl-CoA metabolic process(GO:0006084) |
0.2 | 0.2 | GO:0042524 | negative regulation of tyrosine phosphorylation of Stat5 protein(GO:0042524) |
0.2 | 0.4 | GO:0070669 | response to interleukin-2(GO:0070669) |
0.2 | 0.4 | GO:1902369 | negative regulation of RNA catabolic process(GO:1902369) |
0.2 | 0.6 | GO:1900045 | negative regulation of protein K63-linked ubiquitination(GO:1900045) negative regulation of protein polyubiquitination(GO:1902915) |
0.2 | 0.6 | GO:0046121 | deoxyribonucleoside catabolic process(GO:0046121) |
0.2 | 1.1 | GO:0090435 | protein localization to nuclear envelope(GO:0090435) |
0.2 | 0.2 | GO:0006067 | ethanol metabolic process(GO:0006067) ethanol oxidation(GO:0006069) |
0.2 | 0.6 | GO:0036023 | limb joint morphogenesis(GO:0036022) embryonic skeletal limb joint morphogenesis(GO:0036023) |
0.2 | 0.6 | GO:1900245 | positive regulation of MDA-5 signaling pathway(GO:1900245) |
0.2 | 0.2 | GO:0006848 | pyruvate transport(GO:0006848) pyruvate transmembrane transport(GO:1901475) |
0.2 | 1.4 | GO:0001672 | regulation of chromatin assembly or disassembly(GO:0001672) |
0.2 | 1.4 | GO:1900103 | positive regulation of endoplasmic reticulum unfolded protein response(GO:1900103) |
0.2 | 1.8 | GO:0036315 | cellular response to sterol(GO:0036315) |
0.2 | 1.0 | GO:0031293 | membrane protein intracellular domain proteolysis(GO:0031293) |
0.2 | 0.4 | GO:0006651 | diacylglycerol biosynthetic process(GO:0006651) |
0.2 | 2.4 | GO:0001886 | endothelial cell morphogenesis(GO:0001886) |
0.2 | 0.6 | GO:0048807 | female genitalia morphogenesis(GO:0048807) |
0.2 | 0.6 | GO:0006207 | 'de novo' pyrimidine nucleobase biosynthetic process(GO:0006207) pyrimidine nucleobase biosynthetic process(GO:0019856) |
0.2 | 1.6 | GO:0000290 | deadenylation-dependent decapping of nuclear-transcribed mRNA(GO:0000290) |
0.2 | 0.6 | GO:0009182 | purine deoxyribonucleoside diphosphate metabolic process(GO:0009182) dGDP metabolic process(GO:0046066) |
0.2 | 0.8 | GO:0046726 | positive regulation by virus of viral protein levels in host cell(GO:0046726) |
0.2 | 1.0 | GO:0002901 | mature B cell apoptotic process(GO:0002901) regulation of mature B cell apoptotic process(GO:0002905) negative regulation of mature B cell apoptotic process(GO:0002906) |
0.2 | 2.0 | GO:0006120 | mitochondrial electron transport, NADH to ubiquinone(GO:0006120) |
0.2 | 5.3 | GO:0032728 | positive regulation of interferon-beta production(GO:0032728) |
0.2 | 0.2 | GO:2000809 | positive regulation of synaptic vesicle clustering(GO:2000809) |
0.2 | 0.4 | GO:0070213 | protein auto-ADP-ribosylation(GO:0070213) |
0.2 | 0.6 | GO:0090360 | platelet-derived growth factor production(GO:0090360) regulation of platelet-derived growth factor production(GO:0090361) |
0.2 | 4.0 | GO:0019373 | epoxygenase P450 pathway(GO:0019373) |
0.2 | 1.0 | GO:0015808 | L-alanine transport(GO:0015808) |
0.2 | 0.8 | GO:0034080 | CENP-A containing nucleosome assembly(GO:0034080) CENP-A containing chromatin organization(GO:0061641) |
0.2 | 0.8 | GO:0034755 | iron ion transmembrane transport(GO:0034755) |
0.2 | 0.6 | GO:0036112 | medium-chain fatty-acyl-CoA metabolic process(GO:0036112) |
0.2 | 0.4 | GO:0039530 | MDA-5 signaling pathway(GO:0039530) |
0.2 | 0.8 | GO:0070189 | kynurenine metabolic process(GO:0070189) |
0.2 | 1.7 | GO:0052697 | xenobiotic glucuronidation(GO:0052697) |
0.2 | 0.6 | GO:0000050 | urea cycle(GO:0000050) |
0.2 | 1.5 | GO:0035520 | monoubiquitinated protein deubiquitination(GO:0035520) |
0.2 | 0.6 | GO:0048369 | lateral mesoderm morphogenesis(GO:0048369) lateral mesoderm formation(GO:0048370) lateral mesodermal cell differentiation(GO:0048371) |
0.2 | 0.2 | GO:1900825 | regulation of membrane depolarization during cardiac muscle cell action potential(GO:1900825) |
0.2 | 0.5 | GO:0072531 | pyrimidine-containing compound transmembrane transport(GO:0072531) |
0.2 | 0.4 | GO:0030576 | Cajal body organization(GO:0030576) |
0.2 | 0.9 | GO:0006528 | asparagine metabolic process(GO:0006528) |
0.2 | 0.5 | GO:0000467 | exonucleolytic trimming involved in rRNA processing(GO:0000459) exonucleolytic trimming to generate mature 3'-end of 5.8S rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000467) |
0.2 | 0.2 | GO:1901631 | positive regulation of presynaptic membrane organization(GO:1901631) |
0.2 | 0.5 | GO:1990928 | response to amino acid starvation(GO:1990928) |
0.2 | 0.9 | GO:0042996 | regulation of Golgi to plasma membrane protein transport(GO:0042996) |
0.2 | 0.5 | GO:2000870 | regulation of progesterone secretion(GO:2000870) |
0.2 | 1.6 | GO:0035999 | tetrahydrofolate interconversion(GO:0035999) |
0.2 | 0.5 | GO:0060178 | regulation of exocyst localization(GO:0060178) |
0.2 | 0.5 | GO:1900041 | negative regulation of interleukin-2 secretion(GO:1900041) |
0.2 | 0.7 | GO:0006681 | galactosylceramide metabolic process(GO:0006681) |
0.2 | 2.9 | GO:0017144 | drug metabolic process(GO:0017144) |
0.2 | 0.3 | GO:0036507 | protein deglycosylation involved in glycoprotein catabolic process(GO:0035977) protein demannosylation(GO:0036507) protein alpha-1,2-demannosylation(GO:0036508) mannose trimming involved in glycoprotein ERAD pathway(GO:1904382) |
0.2 | 0.7 | GO:0086023 | adrenergic receptor signaling pathway involved in heart process(GO:0086023) |
0.2 | 0.8 | GO:0009074 | aromatic amino acid family catabolic process(GO:0009074) |
0.2 | 0.8 | GO:0016255 | attachment of GPI anchor to protein(GO:0016255) |
0.2 | 0.5 | GO:0045347 | negative regulation of MHC class II biosynthetic process(GO:0045347) |
0.2 | 1.0 | GO:0015871 | choline transport(GO:0015871) |
0.2 | 0.3 | GO:0032849 | positive regulation of cellular pH reduction(GO:0032849) |
0.2 | 0.3 | GO:0051599 | response to hydrostatic pressure(GO:0051599) |
0.2 | 0.3 | GO:0034141 | positive regulation of toll-like receptor 3 signaling pathway(GO:0034141) |
0.2 | 0.8 | GO:0042448 | progesterone metabolic process(GO:0042448) |
0.2 | 3.2 | GO:0006805 | xenobiotic metabolic process(GO:0006805) |
0.2 | 0.5 | GO:1903679 | regulation of cap-independent translational initiation(GO:1903677) positive regulation of cap-independent translational initiation(GO:1903679) regulation of cytoplasmic translational initiation(GO:1904688) positive regulation of cytoplasmic translational initiation(GO:1904690) |
0.2 | 0.8 | GO:0051409 | response to nitrosative stress(GO:0051409) |
0.2 | 0.6 | GO:1901029 | negative regulation of mitochondrial outer membrane permeabilization involved in apoptotic signaling pathway(GO:1901029) |
0.2 | 0.3 | GO:0006568 | tryptophan metabolic process(GO:0006568) indolalkylamine metabolic process(GO:0006586) |
0.2 | 0.5 | GO:0002439 | chronic inflammatory response to antigenic stimulus(GO:0002439) |
0.2 | 0.3 | GO:0033092 | positive regulation of immature T cell proliferation in thymus(GO:0033092) |
0.2 | 0.9 | GO:0048752 | semicircular canal morphogenesis(GO:0048752) |
0.2 | 0.6 | GO:0048478 | replication fork protection(GO:0048478) |
0.2 | 1.1 | GO:0098908 | regulation of neuronal action potential(GO:0098908) |
0.2 | 0.6 | GO:0010387 | COP9 signalosome assembly(GO:0010387) |
0.2 | 1.2 | GO:0060213 | regulation of nuclear-transcribed mRNA poly(A) tail shortening(GO:0060211) positive regulation of nuclear-transcribed mRNA poly(A) tail shortening(GO:0060213) |
0.2 | 0.2 | GO:0003162 | atrioventricular node development(GO:0003162) |
0.2 | 0.3 | GO:0018197 | peptidyl-aspartic acid modification(GO:0018197) |
0.2 | 0.5 | GO:0044791 | modulation by host of viral release from host cell(GO:0044789) positive regulation by host of viral release from host cell(GO:0044791) |
0.2 | 0.3 | GO:0051790 | short-chain fatty acid biosynthetic process(GO:0051790) |
0.1 | 0.4 | GO:0006741 | NADP biosynthetic process(GO:0006741) |
0.1 | 1.3 | GO:0061179 | negative regulation of insulin secretion involved in cellular response to glucose stimulus(GO:0061179) |
0.1 | 0.4 | GO:0008355 | olfactory learning(GO:0008355) |
0.1 | 0.4 | GO:0006562 | proline catabolic process(GO:0006562) |
0.1 | 0.6 | GO:2000609 | regulation of thyroid hormone generation(GO:2000609) |
0.1 | 0.7 | GO:0006398 | mRNA 3'-end processing by stem-loop binding and cleavage(GO:0006398) |
0.1 | 0.4 | GO:1900739 | regulation of protein insertion into mitochondrial membrane involved in apoptotic signaling pathway(GO:1900739) positive regulation of protein insertion into mitochondrial membrane involved in apoptotic signaling pathway(GO:1900740) |
0.1 | 0.6 | GO:0060373 | regulation of ventricular cardiac muscle cell membrane depolarization(GO:0060373) |
0.1 | 0.6 | GO:0044857 | plasma membrane raft assembly(GO:0044854) plasma membrane raft organization(GO:0044857) caveola assembly(GO:0070836) |
0.1 | 0.3 | GO:0032727 | positive regulation of interferon-alpha production(GO:0032727) |
0.1 | 0.6 | GO:0031581 | hemidesmosome assembly(GO:0031581) |
0.1 | 0.4 | GO:0006003 | fructose 2,6-bisphosphate metabolic process(GO:0006003) |
0.1 | 0.9 | GO:0071985 | multivesicular body sorting pathway(GO:0071985) |
0.1 | 0.7 | GO:1902774 | late endosome to lysosome transport(GO:1902774) |
0.1 | 0.6 | GO:0035627 | ceramide transport(GO:0035627) |
0.1 | 0.9 | GO:0048680 | positive regulation of axon regeneration(GO:0048680) |
0.1 | 0.3 | GO:1903347 | negative regulation of bicellular tight junction assembly(GO:1903347) |
0.1 | 0.4 | GO:0070245 | positive regulation of thymocyte apoptotic process(GO:0070245) |
0.1 | 1.1 | GO:0046069 | cGMP catabolic process(GO:0046069) |
0.1 | 0.8 | GO:0043928 | exonucleolytic nuclear-transcribed mRNA catabolic process involved in deadenylation-dependent decay(GO:0043928) |
0.1 | 0.3 | GO:0035459 | cargo loading into vesicle(GO:0035459) |
0.1 | 0.4 | GO:2000048 | negative regulation of cell-cell adhesion mediated by cadherin(GO:2000048) |
0.1 | 0.6 | GO:0098904 | regulation of AV node cell action potential(GO:0098904) |
0.1 | 0.1 | GO:0006537 | glutamate biosynthetic process(GO:0006537) |
0.1 | 0.6 | GO:0071947 | protein deubiquitination involved in ubiquitin-dependent protein catabolic process(GO:0071947) |
0.1 | 0.4 | GO:0048861 | leukemia inhibitory factor signaling pathway(GO:0048861) |
0.1 | 0.4 | GO:0060059 | embryonic retina morphogenesis in camera-type eye(GO:0060059) |
0.1 | 0.3 | GO:0016539 | intein-mediated protein splicing(GO:0016539) protein splicing(GO:0030908) |
0.1 | 0.4 | GO:0043321 | regulation of natural killer cell degranulation(GO:0043321) |
0.1 | 0.4 | GO:1904526 | regulation of microtubule binding(GO:1904526) positive regulation of microtubule binding(GO:1904528) |
0.1 | 0.3 | GO:1903660 | complement-dependent cytotoxicity(GO:0097278) regulation of complement-dependent cytotoxicity(GO:1903659) negative regulation of complement-dependent cytotoxicity(GO:1903660) |
0.1 | 0.4 | GO:0099515 | actin filament-based transport(GO:0099515) |
0.1 | 0.4 | GO:0006680 | glucosylceramide catabolic process(GO:0006680) |
0.1 | 0.4 | GO:0003431 | growth plate cartilage chondrocyte development(GO:0003431) |
0.1 | 0.5 | GO:0035519 | protein K29-linked ubiquitination(GO:0035519) |
0.1 | 0.9 | GO:0070131 | positive regulation of mitochondrial translation(GO:0070131) |
0.1 | 0.7 | GO:0006707 | cholesterol catabolic process(GO:0006707) sterol catabolic process(GO:0016127) |
0.1 | 0.4 | GO:0038128 | ERBB2 signaling pathway(GO:0038128) |
0.1 | 0.4 | GO:0045085 | negative regulation of interleukin-2 biosynthetic process(GO:0045085) |
0.1 | 0.8 | GO:0006517 | protein deglycosylation(GO:0006517) |
0.1 | 0.3 | GO:0010159 | specification of organ position(GO:0010159) |
0.1 | 1.3 | GO:0046686 | response to cadmium ion(GO:0046686) |
0.1 | 0.5 | GO:2000623 | regulation of nuclear-transcribed mRNA catabolic process, nonsense-mediated decay(GO:2000622) negative regulation of nuclear-transcribed mRNA catabolic process, nonsense-mediated decay(GO:2000623) |
0.1 | 0.3 | GO:0048850 | hypophysis morphogenesis(GO:0048850) |
0.1 | 0.6 | GO:0040016 | embryonic cleavage(GO:0040016) |
0.1 | 0.1 | GO:0090258 | negative regulation of mitochondrial fission(GO:0090258) |
0.1 | 0.3 | GO:0042758 | long-chain fatty acid catabolic process(GO:0042758) |
0.1 | 1.0 | GO:0071803 | positive regulation of podosome assembly(GO:0071803) |
0.1 | 0.4 | GO:0010572 | positive regulation of platelet activation(GO:0010572) |
0.1 | 1.1 | GO:0000244 | spliceosomal tri-snRNP complex assembly(GO:0000244) |
0.1 | 0.9 | GO:0015868 | purine ribonucleotide transport(GO:0015868) |
0.1 | 0.4 | GO:1903416 | response to glycoside(GO:1903416) |
0.1 | 1.7 | GO:0045056 | transcytosis(GO:0045056) |
0.1 | 0.4 | GO:2000301 | negative regulation of synaptic vesicle exocytosis(GO:2000301) |
0.1 | 0.1 | GO:1990705 | cholangiocyte proliferation(GO:1990705) |
0.1 | 0.4 | GO:1903798 | regulation of production of miRNAs involved in gene silencing by miRNA(GO:1903798) |
0.1 | 1.0 | GO:0021796 | cerebral cortex regionalization(GO:0021796) |
0.1 | 0.5 | GO:0048014 | Tie signaling pathway(GO:0048014) |
0.1 | 0.2 | GO:0090245 | axis elongation involved in somitogenesis(GO:0090245) |
0.1 | 1.0 | GO:0045722 | positive regulation of gluconeogenesis(GO:0045722) |
0.1 | 1.7 | GO:0015693 | magnesium ion transport(GO:0015693) |
0.1 | 0.4 | GO:1901097 | negative regulation of autophagosome maturation(GO:1901097) |
0.1 | 0.2 | GO:0002767 | immune response-inhibiting cell surface receptor signaling pathway(GO:0002767) |
0.1 | 0.5 | GO:0007621 | negative regulation of female receptivity(GO:0007621) |
0.1 | 0.2 | GO:0044339 | canonical Wnt signaling pathway involved in osteoblast differentiation(GO:0044339) |
0.1 | 0.4 | GO:0015014 | heparan sulfate proteoglycan biosynthetic process, polysaccharide chain biosynthetic process(GO:0015014) |
0.1 | 1.1 | GO:0000083 | regulation of transcription involved in G1/S transition of mitotic cell cycle(GO:0000083) |
0.1 | 0.5 | GO:1901491 | negative regulation of lymphangiogenesis(GO:1901491) |
0.1 | 0.4 | GO:2000224 | regulation of testosterone biosynthetic process(GO:2000224) |
0.1 | 0.5 | GO:2000535 | entry of bacterium into host cell(GO:0035635) regulation of entry of bacterium into host cell(GO:2000535) |
0.1 | 0.2 | GO:0007529 | establishment of synaptic specificity at neuromuscular junction(GO:0007529) |
0.1 | 0.3 | GO:1902683 | regulation of receptor localization to synapse(GO:1902683) |
0.1 | 0.3 | GO:0061511 | centriole elongation(GO:0061511) |
0.1 | 0.7 | GO:0001547 | antral ovarian follicle growth(GO:0001547) |
0.1 | 0.3 | GO:0071681 | response to indole-3-methanol(GO:0071680) cellular response to indole-3-methanol(GO:0071681) |
0.1 | 0.7 | GO:0009214 | cyclic nucleotide catabolic process(GO:0009214) |
0.1 | 0.1 | GO:0070212 | protein poly-ADP-ribosylation(GO:0070212) |
0.1 | 0.6 | GO:0098787 | mRNA cleavage involved in mRNA processing(GO:0098787) pre-mRNA cleavage required for polyadenylation(GO:0098789) |
0.1 | 0.6 | GO:0008295 | spermidine biosynthetic process(GO:0008295) |
0.1 | 0.2 | GO:0009051 | pentose-phosphate shunt, oxidative branch(GO:0009051) |
0.1 | 0.1 | GO:0021823 | cerebral cortex tangential migration using cell-cell interactions(GO:0021823) postnatal olfactory bulb interneuron migration(GO:0021827) |
0.1 | 0.7 | GO:0042760 | very long-chain fatty acid catabolic process(GO:0042760) |
0.1 | 0.7 | GO:0070345 | negative regulation of fat cell proliferation(GO:0070345) |
0.1 | 0.1 | GO:0048769 | sarcomerogenesis(GO:0048769) |
0.1 | 0.2 | GO:0042360 | vitamin E metabolic process(GO:0042360) |
0.1 | 0.3 | GO:0010735 | positive regulation of transcription via serum response element binding(GO:0010735) |
0.1 | 1.1 | GO:1904293 | negative regulation of ERAD pathway(GO:1904293) |
0.1 | 0.2 | GO:2001197 | regulation of basement membrane assembly involved in embryonic body morphogenesis(GO:1904259) positive regulation of basement membrane assembly involved in embryonic body morphogenesis(GO:1904261) basement membrane assembly involved in embryonic body morphogenesis(GO:2001197) |
0.1 | 0.4 | GO:0060467 | negative regulation of fertilization(GO:0060467) |
0.1 | 0.2 | GO:0046125 | thymidine metabolic process(GO:0046104) pyrimidine deoxyribonucleoside metabolic process(GO:0046125) |
0.1 | 0.2 | GO:0021524 | visceral motor neuron differentiation(GO:0021524) |
0.1 | 0.2 | GO:0006102 | isocitrate metabolic process(GO:0006102) |
0.1 | 0.7 | GO:0090286 | cytoskeletal anchoring at nuclear membrane(GO:0090286) |
0.1 | 0.3 | GO:0007084 | mitotic nuclear envelope reassembly(GO:0007084) |
0.1 | 0.1 | GO:0097048 | dendritic cell apoptotic process(GO:0097048) regulation of dendritic cell apoptotic process(GO:2000668) |
0.1 | 0.4 | GO:0018101 | protein citrullination(GO:0018101) |
0.1 | 0.1 | GO:2000857 | positive regulation of mineralocorticoid secretion(GO:2000857) positive regulation of aldosterone secretion(GO:2000860) |
0.1 | 0.5 | GO:0070934 | CRD-mediated mRNA stabilization(GO:0070934) |
0.1 | 0.6 | GO:2000672 | negative regulation of motor neuron apoptotic process(GO:2000672) |
0.1 | 0.3 | GO:0006363 | termination of RNA polymerase I transcription(GO:0006363) |
0.1 | 0.4 | GO:0046618 | drug export(GO:0046618) |
0.1 | 0.3 | GO:0030327 | prenylated protein catabolic process(GO:0030327) |
0.1 | 0.1 | GO:0032055 | negative regulation of translation in response to stress(GO:0032055) |
0.1 | 0.6 | GO:0006620 | posttranslational protein targeting to membrane(GO:0006620) |
0.1 | 0.2 | GO:1900242 | regulation of synaptic vesicle endocytosis(GO:1900242) |
0.1 | 0.2 | GO:0032497 | detection of lipopolysaccharide(GO:0032497) |
0.1 | 0.2 | GO:0046292 | formaldehyde metabolic process(GO:0046292) |
0.1 | 0.3 | GO:0021699 | cerebellar cortex maturation(GO:0021699) |
0.1 | 0.3 | GO:0032754 | positive regulation of interleukin-5 production(GO:0032754) |
0.1 | 0.4 | GO:0097461 | ferric iron import(GO:0033216) ferric iron import into cell(GO:0097461) |
0.1 | 0.4 | GO:0090209 | negative regulation of triglyceride metabolic process(GO:0090209) |
0.1 | 0.1 | GO:0075509 | receptor-mediated endocytosis of virus by host cell(GO:0019065) endocytosis involved in viral entry into host cell(GO:0075509) |
0.1 | 0.2 | GO:1903599 | positive regulation of mitophagy(GO:1903599) |
0.1 | 0.3 | GO:0010835 | regulation of protein ADP-ribosylation(GO:0010835) |
0.1 | 0.2 | GO:1903998 | regulation of eating behavior(GO:1903998) negative regulation of eating behavior(GO:1903999) |
0.1 | 0.3 | GO:1900109 | regulation of histone H3-K9 dimethylation(GO:1900109) |
0.1 | 0.9 | GO:0043922 | negative regulation by host of viral transcription(GO:0043922) |
0.1 | 0.3 | GO:2000002 | negative regulation of DNA damage checkpoint(GO:2000002) |
0.1 | 0.5 | GO:2000210 | positive regulation of anoikis(GO:2000210) |
0.1 | 0.3 | GO:0046469 | platelet activating factor biosynthetic process(GO:0006663) platelet activating factor metabolic process(GO:0046469) |
0.1 | 0.3 | GO:0061010 | gall bladder development(GO:0061010) |
0.1 | 0.6 | GO:0046085 | adenosine metabolic process(GO:0046085) |
0.1 | 0.3 | GO:1904469 | positive regulation of tumor necrosis factor secretion(GO:1904469) |
0.1 | 0.4 | GO:0000492 | small nucleolar ribonucleoprotein complex assembly(GO:0000491) box C/D snoRNP assembly(GO:0000492) |
0.1 | 0.4 | GO:0071896 | protein localization to adherens junction(GO:0071896) |
0.1 | 0.8 | GO:0045721 | negative regulation of gluconeogenesis(GO:0045721) |
0.1 | 0.2 | GO:0071799 | response to prostaglandin D(GO:0071798) cellular response to prostaglandin D stimulus(GO:0071799) |
0.1 | 0.3 | GO:0006481 | C-terminal protein methylation(GO:0006481) |
0.1 | 0.2 | GO:0061502 | early endosome to recycling endosome transport(GO:0061502) |
0.1 | 0.1 | GO:0002765 | immune response-inhibiting signal transduction(GO:0002765) |
0.1 | 0.5 | GO:0045656 | negative regulation of monocyte differentiation(GO:0045656) |
0.1 | 0.5 | GO:0070940 | dephosphorylation of RNA polymerase II C-terminal domain(GO:0070940) |
0.1 | 0.4 | GO:1902744 | negative regulation of lamellipodium organization(GO:1902744) |
0.1 | 0.4 | GO:0036462 | TRAIL-activated apoptotic signaling pathway(GO:0036462) |
0.1 | 0.1 | GO:0050904 | diapedesis(GO:0050904) |
0.1 | 0.3 | GO:0051036 | regulation of endosome size(GO:0051036) |
0.1 | 0.1 | GO:0070487 | monocyte aggregation(GO:0070487) regulation of monocyte aggregation(GO:1900623) positive regulation of monocyte aggregation(GO:1900625) |
0.1 | 0.3 | GO:1904217 | regulation of CDP-diacylglycerol-serine O-phosphatidyltransferase activity(GO:1904217) positive regulation of CDP-diacylglycerol-serine O-phosphatidyltransferase activity(GO:1904219) regulation of serine C-palmitoyltransferase activity(GO:1904220) positive regulation of serine C-palmitoyltransferase activity(GO:1904222) |
0.1 | 2.7 | GO:0060325 | face morphogenesis(GO:0060325) |
0.1 | 0.3 | GO:0006768 | biotin metabolic process(GO:0006768) |
0.1 | 1.8 | GO:0001574 | ganglioside biosynthetic process(GO:0001574) |
0.1 | 0.4 | GO:2001182 | regulation of interleukin-12 secretion(GO:2001182) |
0.1 | 0.5 | GO:0045719 | negative regulation of glycogen biosynthetic process(GO:0045719) |
0.1 | 0.6 | GO:0042759 | long-chain fatty acid biosynthetic process(GO:0042759) |
0.1 | 0.4 | GO:0098535 | de novo centriole assembly(GO:0098535) |
0.1 | 0.3 | GO:2000409 | positive regulation of T cell extravasation(GO:2000409) |
0.1 | 0.6 | GO:0006307 | DNA dealkylation involved in DNA repair(GO:0006307) |
0.1 | 0.3 | GO:0009169 | ribonucleoside monophosphate catabolic process(GO:0009158) purine ribonucleoside monophosphate catabolic process(GO:0009169) |
0.1 | 0.8 | GO:0007253 | cytoplasmic sequestering of NF-kappaB(GO:0007253) |
0.1 | 0.6 | GO:2000270 | negative regulation of fibroblast apoptotic process(GO:2000270) |
0.1 | 2.0 | GO:0019432 | triglyceride biosynthetic process(GO:0019432) |
0.1 | 3.3 | GO:0007584 | response to nutrient(GO:0007584) |
0.1 | 1.2 | GO:0051923 | sulfation(GO:0051923) |
0.1 | 0.5 | GO:0018401 | peptidyl-proline hydroxylation to 4-hydroxy-L-proline(GO:0018401) |
0.1 | 0.1 | GO:0006287 | base-excision repair, gap-filling(GO:0006287) |
0.1 | 0.8 | GO:0070493 | thrombin receptor signaling pathway(GO:0070493) |
0.1 | 0.4 | GO:0097070 | ductus arteriosus closure(GO:0097070) |
0.1 | 0.3 | GO:0070814 | hydrogen sulfide biosynthetic process(GO:0070814) |
0.1 | 0.6 | GO:0002072 | optic cup morphogenesis involved in camera-type eye development(GO:0002072) |
0.1 | 1.0 | GO:0051457 | maintenance of protein location in nucleus(GO:0051457) |
0.1 | 0.4 | GO:0045541 | negative regulation of cholesterol biosynthetic process(GO:0045541) negative regulation of cholesterol metabolic process(GO:0090206) |
0.1 | 0.9 | GO:0060158 | phospholipase C-activating dopamine receptor signaling pathway(GO:0060158) |
0.1 | 0.4 | GO:0035826 | rubidium ion transport(GO:0035826) |
0.1 | 0.2 | GO:0003186 | tricuspid valve morphogenesis(GO:0003186) tricuspid valve formation(GO:0003195) |
0.1 | 1.0 | GO:0097354 | protein prenylation(GO:0018342) prenylation(GO:0097354) |
0.1 | 0.2 | GO:0071839 | apoptotic process in bone marrow(GO:0071839) |
0.1 | 0.9 | GO:0017121 | phospholipid scrambling(GO:0017121) |
0.1 | 0.1 | GO:0043133 | hindgut contraction(GO:0043133) regulation of hindgut contraction(GO:0043134) |
0.1 | 0.5 | GO:0032815 | negative regulation of natural killer cell activation(GO:0032815) |
0.1 | 1.2 | GO:0042026 | protein refolding(GO:0042026) |
0.1 | 0.3 | GO:0042732 | D-xylose metabolic process(GO:0042732) |
0.1 | 0.8 | GO:0030213 | hyaluronan biosynthetic process(GO:0030213) |
0.1 | 0.3 | GO:1900095 | regulation of dosage compensation by inactivation of X chromosome(GO:1900095) |
0.1 | 0.2 | GO:0032383 | regulation of intracellular lipid transport(GO:0032377) regulation of intracellular sterol transport(GO:0032380) regulation of intracellular cholesterol transport(GO:0032383) |
0.1 | 0.2 | GO:0090071 | negative regulation of ribosome biogenesis(GO:0090071) |
0.1 | 0.4 | GO:2000727 | positive regulation of cardiac muscle cell differentiation(GO:2000727) |
0.1 | 0.1 | GO:0008300 | isoprenoid catabolic process(GO:0008300) |
0.1 | 0.5 | GO:0042421 | norepinephrine biosynthetic process(GO:0042421) |
0.1 | 0.1 | GO:0046083 | adenine metabolic process(GO:0046083) adenine biosynthetic process(GO:0046084) |
0.1 | 0.2 | GO:0045839 | negative regulation of mitotic nuclear division(GO:0045839) |
0.1 | 0.4 | GO:0051547 | regulation of keratinocyte migration(GO:0051547) positive regulation of keratinocyte migration(GO:0051549) |
0.1 | 0.1 | GO:0045416 | positive regulation of interleukin-8 biosynthetic process(GO:0045416) |
0.1 | 2.2 | GO:0000027 | ribosomal large subunit assembly(GO:0000027) |
0.1 | 0.1 | GO:0031587 | positive regulation of inositol 1,4,5-trisphosphate-sensitive calcium-release channel activity(GO:0031587) |
0.1 | 0.1 | GO:1902513 | regulation of organelle transport along microtubule(GO:1902513) |
0.1 | 0.3 | GO:0001880 | Mullerian duct regression(GO:0001880) |
0.1 | 0.2 | GO:1900425 | negative regulation of defense response to bacterium(GO:1900425) |
0.1 | 0.4 | GO:0071257 | cellular response to electrical stimulus(GO:0071257) |
0.1 | 0.1 | GO:0051660 | establishment of centrosome localization(GO:0051660) |
0.1 | 0.7 | GO:0060628 | regulation of ER to Golgi vesicle-mediated transport(GO:0060628) |
0.1 | 0.3 | GO:0070127 | tRNA aminoacylation for mitochondrial protein translation(GO:0070127) |
0.1 | 0.3 | GO:0006391 | transcription initiation from mitochondrial promoter(GO:0006391) |
0.1 | 0.3 | GO:1900060 | negative regulation of sphingolipid biosynthetic process(GO:0090155) cellular sphingolipid homeostasis(GO:0090156) negative regulation of ceramide biosynthetic process(GO:1900060) |
0.1 | 0.1 | GO:1900038 | negative regulation of cellular response to hypoxia(GO:1900038) |
0.1 | 0.3 | GO:0000715 | nucleotide-excision repair, DNA damage recognition(GO:0000715) |
0.1 | 0.2 | GO:0033046 | negative regulation of sister chromatid segregation(GO:0033046) |
0.1 | 0.2 | GO:0021747 | cochlear nucleus development(GO:0021747) |
0.1 | 0.2 | GO:0017187 | peptidyl-glutamic acid carboxylation(GO:0017187) |
0.1 | 0.4 | GO:2000675 | negative regulation of type B pancreatic cell apoptotic process(GO:2000675) |
0.1 | 0.3 | GO:2000980 | regulation of auditory receptor cell differentiation(GO:0045607) regulation of mechanoreceptor differentiation(GO:0045631) regulation of inner ear receptor cell differentiation(GO:2000980) |
0.1 | 0.3 | GO:0032227 | negative regulation of synaptic transmission, dopaminergic(GO:0032227) |
0.1 | 0.3 | GO:0035093 | spermatogenesis, exchange of chromosomal proteins(GO:0035093) |
0.1 | 0.3 | GO:0002121 | inter-male aggressive behavior(GO:0002121) |
0.1 | 0.3 | GO:0090091 | positive regulation of extracellular matrix disassembly(GO:0090091) |
0.1 | 0.5 | GO:0051694 | pointed-end actin filament capping(GO:0051694) |
0.1 | 0.2 | GO:0030951 | establishment or maintenance of microtubule cytoskeleton polarity(GO:0030951) |
0.1 | 0.1 | GO:0045764 | positive regulation of cellular amino acid metabolic process(GO:0045764) |
0.1 | 0.2 | GO:0051964 | negative regulation of synapse assembly(GO:0051964) |
0.1 | 0.6 | GO:0032780 | negative regulation of ATPase activity(GO:0032780) |
0.1 | 0.4 | GO:0032713 | negative regulation of interleukin-4 production(GO:0032713) |
0.1 | 0.8 | GO:0045899 | positive regulation of RNA polymerase II transcriptional preinitiation complex assembly(GO:0045899) |
0.1 | 0.2 | GO:0061043 | regulation of vascular wound healing(GO:0061043) |
0.1 | 0.2 | GO:0007042 | lysosomal lumen acidification(GO:0007042) |
0.1 | 0.1 | GO:0042537 | benzene-containing compound metabolic process(GO:0042537) |
0.1 | 0.1 | GO:1903279 | regulation of calcium:sodium antiporter activity(GO:1903279) |
0.1 | 0.1 | GO:0051574 | positive regulation of histone H3-K9 methylation(GO:0051574) |
0.1 | 0.6 | GO:0007000 | nucleolus organization(GO:0007000) |
0.1 | 0.2 | GO:0060900 | embryonic camera-type eye formation(GO:0060900) |
0.1 | 0.1 | GO:0060664 | epithelial cell proliferation involved in salivary gland morphogenesis(GO:0060664) |
0.1 | 0.2 | GO:0045653 | negative regulation of megakaryocyte differentiation(GO:0045653) |
0.1 | 0.1 | GO:0008090 | retrograde axonal transport(GO:0008090) |
0.1 | 0.2 | GO:0010612 | regulation of cardiac muscle adaptation(GO:0010612) regulation of cardiac muscle hypertrophy in response to stress(GO:1903242) |
0.1 | 0.4 | GO:0097286 | iron ion import(GO:0097286) |
0.1 | 0.6 | GO:0018095 | protein polyglutamylation(GO:0018095) |
0.1 | 0.2 | GO:0048677 | axon extension involved in regeneration(GO:0048677) sprouting of injured axon(GO:0048682) |
0.1 | 0.2 | GO:0030070 | insulin processing(GO:0030070) |
0.1 | 0.2 | GO:0015817 | histidine transport(GO:0015817) |
0.1 | 0.2 | GO:0002424 | T cell mediated immune response to tumor cell(GO:0002424) regulation of T cell mediated immune response to tumor cell(GO:0002840) |
0.1 | 0.2 | GO:1990034 | calcium ion export from cell(GO:1990034) |
0.1 | 0.1 | GO:0008209 | androgen metabolic process(GO:0008209) |
0.1 | 0.2 | GO:0000966 | RNA 5'-end processing(GO:0000966) |
0.1 | 0.5 | GO:0015919 | peroxisomal membrane transport(GO:0015919) protein import into peroxisome membrane(GO:0045046) |
0.1 | 0.2 | GO:0042518 | negative regulation of tyrosine phosphorylation of Stat3 protein(GO:0042518) |
0.1 | 0.2 | GO:0072318 | clathrin coat disassembly(GO:0072318) |
0.1 | 0.4 | GO:0014719 | skeletal muscle satellite cell activation(GO:0014719) |
0.1 | 0.4 | GO:2000467 | positive regulation of glycogen (starch) synthase activity(GO:2000467) |
0.1 | 0.6 | GO:0006610 | ribosomal protein import into nucleus(GO:0006610) |
0.1 | 0.2 | GO:1902047 | polyamine transport(GO:0015846) polyamine transmembrane transport(GO:1902047) regulation of polyamine transmembrane transport(GO:1902267) negative regulation of polyamine transmembrane transport(GO:1902268) |
0.1 | 0.2 | GO:0071374 | cellular response to parathyroid hormone stimulus(GO:0071374) |
0.1 | 0.2 | GO:1990123 | L-glutamate(1-) import into cell(GO:1903802) L-glutamate import into cell(GO:1990123) |
0.1 | 0.2 | GO:0014732 | skeletal muscle atrophy(GO:0014732) |
0.1 | 0.3 | GO:0071243 | cellular response to arsenic-containing substance(GO:0071243) |
0.1 | 0.2 | GO:0060618 | nipple development(GO:0060618) |
0.1 | 0.2 | GO:0009449 | gamma-aminobutyric acid biosynthetic process(GO:0009449) |
0.1 | 0.2 | GO:0072513 | positive regulation of secondary heart field cardioblast proliferation(GO:0072513) |
0.1 | 0.4 | GO:0032020 | ISG15-protein conjugation(GO:0032020) |
0.1 | 0.6 | GO:0006183 | GTP biosynthetic process(GO:0006183) UTP biosynthetic process(GO:0006228) |
0.1 | 1.6 | GO:0000470 | maturation of LSU-rRNA(GO:0000470) |
0.1 | 0.2 | GO:0071280 | cellular response to copper ion(GO:0071280) |
0.1 | 0.3 | GO:0007023 | post-chaperonin tubulin folding pathway(GO:0007023) |
0.1 | 0.1 | GO:0046340 | diacylglycerol catabolic process(GO:0046340) |
0.1 | 0.1 | GO:0042695 | thelarche(GO:0042695) mammary gland branching involved in thelarche(GO:0060744) |
0.1 | 0.7 | GO:0034244 | negative regulation of transcription elongation from RNA polymerase II promoter(GO:0034244) |
0.1 | 0.1 | GO:0036091 | positive regulation of transcription from RNA polymerase II promoter in response to oxidative stress(GO:0036091) |
0.1 | 0.4 | GO:0033152 | immunoglobulin V(D)J recombination(GO:0033152) |
0.1 | 0.2 | GO:0050667 | homocysteine metabolic process(GO:0050667) |
0.1 | 0.8 | GO:0030150 | protein import into mitochondrial matrix(GO:0030150) |
0.1 | 0.1 | GO:0003310 | pancreatic A cell differentiation(GO:0003310) |
0.1 | 0.4 | GO:0033327 | Leydig cell differentiation(GO:0033327) |
0.1 | 0.1 | GO:0042525 | tyrosine phosphorylation of Stat6 protein(GO:0042505) regulation of tyrosine phosphorylation of Stat6 protein(GO:0042525) |
0.1 | 0.2 | GO:0031017 | exocrine pancreas development(GO:0031017) |
0.1 | 0.1 | GO:0090069 | regulation of ribosome biogenesis(GO:0090069) |
0.1 | 0.1 | GO:1903972 | regulation of macrophage colony-stimulating factor signaling pathway(GO:1902226) regulation of response to macrophage colony-stimulating factor(GO:1903969) regulation of cellular response to macrophage colony-stimulating factor stimulus(GO:1903972) |
0.1 | 0.4 | GO:0046512 | diol biosynthetic process(GO:0034312) sphingosine biosynthetic process(GO:0046512) |
0.1 | 0.9 | GO:0099514 | anterograde synaptic vesicle transport(GO:0048490) synaptic vesicle cytoskeletal transport(GO:0099514) synaptic vesicle transport along microtubule(GO:0099517) |
0.1 | 0.2 | GO:0006543 | glutamine catabolic process(GO:0006543) |
0.1 | 0.2 | GO:0045345 | MHC class I biosynthetic process(GO:0045341) regulation of MHC class I biosynthetic process(GO:0045343) positive regulation of MHC class I biosynthetic process(GO:0045345) |
0.1 | 0.1 | GO:1990086 | lens fiber cell apoptotic process(GO:1990086) |
0.1 | 0.1 | GO:0097107 | postsynaptic density organization(GO:0097106) postsynaptic density assembly(GO:0097107) |
0.1 | 0.1 | GO:0034086 | maintenance of sister chromatid cohesion(GO:0034086) maintenance of mitotic sister chromatid cohesion(GO:0034088) |
0.1 | 0.2 | GO:0006296 | nucleotide-excision repair, DNA incision, 5'-to lesion(GO:0006296) |
0.1 | 0.1 | GO:0006990 | positive regulation of transcription from RNA polymerase II promoter involved in unfolded protein response(GO:0006990) |
0.1 | 0.5 | GO:2000780 | negative regulation of double-strand break repair(GO:2000780) |
0.1 | 0.1 | GO:0007182 | common-partner SMAD protein phosphorylation(GO:0007182) |
0.1 | 0.1 | GO:0042939 | glutathione transport(GO:0034635) tripeptide transport(GO:0042939) |
0.1 | 0.4 | GO:2000615 | regulation of histone H3-K9 acetylation(GO:2000615) |
0.1 | 0.1 | GO:0002036 | regulation of L-glutamate transport(GO:0002036) |
0.1 | 0.1 | GO:0071394 | cellular response to testosterone stimulus(GO:0071394) |
0.1 | 0.1 | GO:0051088 | PMA-inducible membrane protein ectodomain proteolysis(GO:0051088) |
0.1 | 0.6 | GO:0001780 | neutrophil homeostasis(GO:0001780) |
0.1 | 0.2 | GO:0035425 | autocrine signaling(GO:0035425) |
0.1 | 0.4 | GO:1902031 | regulation of NADP metabolic process(GO:1902031) |
0.1 | 0.1 | GO:0032252 | secretory granule localization(GO:0032252) |
0.1 | 1.3 | GO:0008053 | mitochondrial fusion(GO:0008053) |
0.1 | 0.2 | GO:0006659 | phosphatidylserine biosynthetic process(GO:0006659) |
0.1 | 0.1 | GO:0035356 | cellular triglyceride homeostasis(GO:0035356) |
0.1 | 0.8 | GO:0030157 | pancreatic juice secretion(GO:0030157) |
0.1 | 0.3 | GO:0031034 | myosin filament assembly(GO:0031034) |
0.1 | 0.5 | GO:0046349 | amino sugar biosynthetic process(GO:0046349) |
0.1 | 0.3 | GO:1902459 | positive regulation of stem cell population maintenance(GO:1902459) |
0.1 | 0.8 | GO:0007216 | G-protein coupled glutamate receptor signaling pathway(GO:0007216) |
0.1 | 0.1 | GO:0035482 | gastric motility(GO:0035482) gastric emptying(GO:0035483) |
0.1 | 0.2 | GO:0071205 | protein localization to juxtaparanode region of axon(GO:0071205) |
0.1 | 0.1 | GO:0060279 | positive regulation of ovulation(GO:0060279) |
0.1 | 0.1 | GO:0090135 | actin filament branching(GO:0090135) |
0.1 | 0.3 | GO:0060267 | positive regulation of respiratory burst(GO:0060267) |
0.1 | 0.5 | GO:0035970 | peptidyl-threonine dephosphorylation(GO:0035970) |
0.1 | 0.2 | GO:1900748 | positive regulation of vascular endothelial growth factor signaling pathway(GO:1900748) |
0.1 | 0.3 | GO:0006297 | nucleotide-excision repair, DNA gap filling(GO:0006297) |
0.1 | 0.2 | GO:1900122 | positive regulation of receptor binding(GO:1900122) |
0.1 | 0.2 | GO:0034454 | microtubule anchoring at centrosome(GO:0034454) |
0.1 | 0.3 | GO:1903887 | motile primary cilium assembly(GO:1903887) |
0.1 | 0.1 | GO:0070272 | proton-transporting ATP synthase complex assembly(GO:0043461) proton-transporting ATP synthase complex biogenesis(GO:0070272) |
0.1 | 0.3 | GO:1902166 | negative regulation of intrinsic apoptotic signaling pathway in response to DNA damage by p53 class mediator(GO:1902166) |
0.1 | 0.3 | GO:0048739 | cardiac muscle fiber development(GO:0048739) |
0.1 | 0.2 | GO:0035754 | B cell chemotaxis(GO:0035754) |
0.1 | 0.2 | GO:0031627 | telomeric loop formation(GO:0031627) |
0.1 | 0.3 | GO:0006451 | selenocysteine incorporation(GO:0001514) translational readthrough(GO:0006451) |
0.1 | 0.1 | GO:0071073 | positive regulation of phospholipid biosynthetic process(GO:0071073) |
0.1 | 0.2 | GO:1904694 | negative regulation of vascular smooth muscle contraction(GO:1904694) |
0.1 | 0.1 | GO:0006152 | purine nucleoside catabolic process(GO:0006152) purine ribonucleoside catabolic process(GO:0046130) |
0.1 | 0.5 | GO:1990126 | retrograde transport, endosome to plasma membrane(GO:1990126) |
0.1 | 0.1 | GO:0000389 | mRNA 3'-splice site recognition(GO:0000389) |
0.1 | 0.1 | GO:0098902 | regulation of membrane depolarization during action potential(GO:0098902) |
0.1 | 1.5 | GO:0034605 | cellular response to heat(GO:0034605) |
0.1 | 0.4 | GO:0010960 | magnesium ion homeostasis(GO:0010960) |
0.1 | 0.1 | GO:0034616 | response to laminar fluid shear stress(GO:0034616) cellular response to laminar fluid shear stress(GO:0071499) |
0.1 | 0.6 | GO:0007638 | mechanosensory behavior(GO:0007638) |
0.1 | 0.6 | GO:0006957 | complement activation, alternative pathway(GO:0006957) |
0.1 | 0.4 | GO:2000601 | positive regulation of Arp2/3 complex-mediated actin nucleation(GO:2000601) |
0.1 | 0.1 | GO:0035694 | mitochondrial protein catabolic process(GO:0035694) |
0.1 | 0.3 | GO:0070126 | mitochondrial translational termination(GO:0070126) |
0.1 | 0.4 | GO:0015074 | DNA integration(GO:0015074) |
0.1 | 0.5 | GO:0032308 | positive regulation of prostaglandin secretion(GO:0032308) |
0.1 | 0.2 | GO:0048842 | positive regulation of axon extension involved in axon guidance(GO:0048842) positive regulation of axon guidance(GO:1902669) |
0.1 | 0.2 | GO:0042769 | DNA damage response, detection of DNA damage(GO:0042769) |
0.1 | 0.1 | GO:0035790 | platelet-derived growth factor receptor-alpha signaling pathway(GO:0035790) |
0.1 | 0.3 | GO:0060083 | smooth muscle contraction involved in micturition(GO:0060083) |
0.1 | 0.6 | GO:0006614 | SRP-dependent cotranslational protein targeting to membrane(GO:0006614) |
0.1 | 0.3 | GO:0031053 | primary miRNA processing(GO:0031053) |
0.1 | 0.1 | GO:0060005 | vestibular reflex(GO:0060005) |
0.1 | 0.3 | GO:0080182 | histone H3-K4 trimethylation(GO:0080182) |
0.1 | 0.2 | GO:0060800 | regulation of cell differentiation involved in embryonic placenta development(GO:0060800) |
0.1 | 0.3 | GO:0042219 | cellular modified amino acid catabolic process(GO:0042219) |
0.1 | 0.1 | GO:0000255 | allantoin metabolic process(GO:0000255) |
0.1 | 0.1 | GO:0045079 | negative regulation of chemokine biosynthetic process(GO:0045079) |
0.1 | 0.3 | GO:1902857 | positive regulation of nonmotile primary cilium assembly(GO:1902857) |
0.1 | 0.1 | GO:0010606 | positive regulation of cytoplasmic mRNA processing body assembly(GO:0010606) |
0.1 | 1.6 | GO:0043252 | sodium-independent organic anion transport(GO:0043252) |
0.1 | 0.4 | GO:0070262 | peptidyl-serine dephosphorylation(GO:0070262) |
0.1 | 0.2 | GO:0090148 | membrane fission(GO:0090148) |
0.1 | 0.1 | GO:0033211 | adiponectin-activated signaling pathway(GO:0033211) |
0.1 | 0.3 | GO:0010457 | centriole-centriole cohesion(GO:0010457) |
0.1 | 0.3 | GO:0045040 | protein import into mitochondrial outer membrane(GO:0045040) |
0.1 | 0.9 | GO:0006998 | nuclear envelope organization(GO:0006998) |
0.1 | 0.4 | GO:0030575 | nuclear body organization(GO:0030575) |
0.1 | 0.7 | GO:0071545 | inositol phosphate catabolic process(GO:0071545) |
0.1 | 2.1 | GO:0031122 | cytoplasmic microtubule organization(GO:0031122) |
0.1 | 0.2 | GO:0010944 | negative regulation of transcription by competitive promoter binding(GO:0010944) |
0.1 | 0.2 | GO:0060084 | synaptic transmission involved in micturition(GO:0060084) |
0.1 | 0.2 | GO:0034242 | negative regulation of syncytium formation by plasma membrane fusion(GO:0034242) |
0.1 | 0.2 | GO:0046831 | regulation of RNA export from nucleus(GO:0046831) |
0.1 | 0.2 | GO:0030263 | apoptotic chromosome condensation(GO:0030263) |
0.1 | 0.1 | GO:2000807 | regulation of synaptic vesicle clustering(GO:2000807) |
0.1 | 0.2 | GO:0071670 | smooth muscle cell chemotaxis(GO:0071670) |
0.1 | 0.2 | GO:0032484 | Ral protein signal transduction(GO:0032484) regulation of Ral protein signal transduction(GO:0032485) |
0.1 | 0.3 | GO:0006370 | 7-methylguanosine mRNA capping(GO:0006370) |
0.1 | 0.5 | GO:0051290 | protein heterotetramerization(GO:0051290) |
0.1 | 0.1 | GO:2000347 | positive regulation of hepatocyte proliferation(GO:2000347) |
0.1 | 0.4 | GO:0008343 | adult feeding behavior(GO:0008343) |
0.1 | 1.1 | GO:0060043 | regulation of cardiac muscle cell proliferation(GO:0060043) |
0.1 | 0.4 | GO:0042866 | pyruvate biosynthetic process(GO:0042866) |
0.1 | 0.2 | GO:0006578 | amino-acid betaine biosynthetic process(GO:0006578) |
0.1 | 0.3 | GO:0032959 | inositol trisphosphate biosynthetic process(GO:0032959) |
0.1 | 0.5 | GO:1990118 | sodium ion import across plasma membrane(GO:0098719) sodium ion import into cell(GO:1990118) |
0.1 | 0.2 | GO:0042546 | cell wall mannoprotein biosynthetic process(GO:0000032) mannoprotein metabolic process(GO:0006056) mannoprotein biosynthetic process(GO:0006057) cell wall glycoprotein biosynthetic process(GO:0031506) cell wall biogenesis(GO:0042546) cell wall macromolecule biosynthetic process(GO:0044038) chain elongation of O-linked mannose residue(GO:0044845) cellular component macromolecule biosynthetic process(GO:0070589) |
0.1 | 0.5 | GO:2000052 | positive regulation of non-canonical Wnt signaling pathway(GO:2000052) |
0.1 | 0.2 | GO:0035358 | regulation of peroxisome proliferator activated receptor signaling pathway(GO:0035358) |
0.1 | 0.1 | GO:2000503 | positive regulation of natural killer cell chemotaxis(GO:2000503) |
0.1 | 0.3 | GO:1903025 | regulation of RNA polymerase II regulatory region sequence-specific DNA binding(GO:1903025) |
0.1 | 0.2 | GO:0097284 | hepatocyte apoptotic process(GO:0097284) |
0.1 | 0.8 | GO:0070884 | regulation of calcineurin-NFAT signaling cascade(GO:0070884) |
0.1 | 0.2 | GO:0072697 | protein localization to cell cortex(GO:0072697) |
0.1 | 0.1 | GO:0032289 | central nervous system myelin formation(GO:0032289) |
0.1 | 0.1 | GO:0048669 | collateral sprouting in absence of injury(GO:0048669) |
0.1 | 0.3 | GO:0002227 | innate immune response in mucosa(GO:0002227) |
0.1 | 0.1 | GO:0070309 | lens fiber cell morphogenesis(GO:0070309) |
0.1 | 0.2 | GO:0070681 | glutaminyl-tRNAGln biosynthesis via transamidation(GO:0070681) |
0.1 | 0.1 | GO:0019254 | carnitine metabolic process, CoA-linked(GO:0019254) |
0.1 | 0.1 | GO:0006931 | substrate-dependent cell migration, cell attachment to substrate(GO:0006931) |
0.1 | 0.2 | GO:0046341 | CDP-diacylglycerol metabolic process(GO:0046341) |
0.1 | 0.3 | GO:0009438 | methylglyoxal metabolic process(GO:0009438) |
0.1 | 0.1 | GO:0061055 | myotome development(GO:0061055) |
0.1 | 0.6 | GO:0033622 | integrin activation(GO:0033622) |
0.1 | 0.1 | GO:0060161 | positive regulation of dopamine receptor signaling pathway(GO:0060161) |
0.1 | 0.8 | GO:0016578 | histone deubiquitination(GO:0016578) |
0.1 | 0.2 | GO:0006368 | transcription elongation from RNA polymerase II promoter(GO:0006368) |
0.1 | 0.3 | GO:0002091 | negative regulation of receptor internalization(GO:0002091) |
0.1 | 0.1 | GO:2000618 | regulation of histone H4-K16 acetylation(GO:2000618) |
0.1 | 0.3 | GO:0051085 | chaperone mediated protein folding requiring cofactor(GO:0051085) |
0.1 | 0.1 | GO:0090283 | regulation of protein glycosylation in Golgi(GO:0090283) |
0.1 | 0.1 | GO:1901096 | regulation of autophagosome maturation(GO:1901096) |
0.1 | 0.5 | GO:0090136 | epithelial cell-cell adhesion(GO:0090136) |
0.1 | 0.3 | GO:0051988 | regulation of attachment of spindle microtubules to kinetochore(GO:0051988) |
0.1 | 0.1 | GO:0014722 | regulation of skeletal muscle contraction by calcium ion signaling(GO:0014722) |
0.1 | 0.2 | GO:1903069 | regulation of ER-associated ubiquitin-dependent protein catabolic process(GO:1903069) |
0.1 | 0.1 | GO:0034146 | toll-like receptor 5 signaling pathway(GO:0034146) |
0.1 | 0.1 | GO:1903935 | response to sodium arsenite(GO:1903935) |
0.1 | 0.4 | GO:0006266 | DNA ligation(GO:0006266) |
0.1 | 0.1 | GO:0060449 | bud elongation involved in lung branching(GO:0060449) |
0.1 | 0.1 | GO:0045054 | constitutive secretory pathway(GO:0045054) |
0.1 | 3.0 | GO:0051963 | regulation of synapse assembly(GO:0051963) |
0.1 | 0.2 | GO:0007016 | cytoskeletal anchoring at plasma membrane(GO:0007016) |
0.1 | 0.5 | GO:0045947 | negative regulation of translational initiation(GO:0045947) |
0.1 | 0.1 | GO:0043970 | histone H3-K9 acetylation(GO:0043970) |
0.1 | 0.1 | GO:0033574 | response to testosterone(GO:0033574) |
0.1 | 0.2 | GO:0030174 | regulation of DNA-dependent DNA replication initiation(GO:0030174) |
0.1 | 0.3 | GO:0000338 | protein deneddylation(GO:0000338) |
0.1 | 1.0 | GO:0036075 | endochondral ossification(GO:0001958) replacement ossification(GO:0036075) |
0.1 | 1.2 | GO:0000184 | nuclear-transcribed mRNA catabolic process, nonsense-mediated decay(GO:0000184) |
0.1 | 0.1 | GO:0010909 | regulation of heparan sulfate proteoglycan biosynthetic process(GO:0010908) positive regulation of heparan sulfate proteoglycan biosynthetic process(GO:0010909) positive regulation of proteoglycan biosynthetic process(GO:1902730) |
0.1 | 0.2 | GO:0046784 | viral mRNA export from host cell nucleus(GO:0046784) |
0.1 | 0.2 | GO:2001260 | regulation of semaphorin-plexin signaling pathway(GO:2001260) |
0.1 | 0.3 | GO:0045793 | positive regulation of cell size(GO:0045793) |
0.1 | 0.1 | GO:0048254 | snoRNA localization(GO:0048254) |
0.1 | 0.1 | GO:0015747 | urate transport(GO:0015747) |
0.1 | 0.1 | GO:0006344 | maintenance of chromatin silencing(GO:0006344) |
0.1 | 0.1 | GO:0032261 | purine nucleotide salvage(GO:0032261) IMP salvage(GO:0032264) |
0.1 | 0.1 | GO:0019374 | galactolipid metabolic process(GO:0019374) |
0.1 | 1.5 | GO:0043550 | regulation of lipid kinase activity(GO:0043550) |
0.1 | 0.1 | GO:0014042 | positive regulation of neuron maturation(GO:0014042) |
0.1 | 0.1 | GO:1903587 | regulation of blood vessel endothelial cell proliferation involved in sprouting angiogenesis(GO:1903587) |
0.1 | 0.1 | GO:0071286 | cellular response to magnesium ion(GO:0071286) |
0.1 | 0.1 | GO:0006407 | rRNA export from nucleus(GO:0006407) |
0.1 | 0.1 | GO:0072319 | vesicle uncoating(GO:0072319) |
0.1 | 0.1 | GO:1902414 | protein localization to cell junction(GO:1902414) |
0.1 | 0.2 | GO:0018125 | peptidyl-cysteine methylation(GO:0018125) |
0.1 | 1.0 | GO:0060218 | hematopoietic stem cell differentiation(GO:0060218) |
0.1 | 0.2 | GO:0015015 | heparan sulfate proteoglycan biosynthetic process, enzymatic modification(GO:0015015) |
0.1 | 0.6 | GO:0006465 | signal peptide processing(GO:0006465) |
0.1 | 0.4 | GO:0006622 | protein targeting to lysosome(GO:0006622) |
0.1 | 0.1 | GO:0033860 | regulation of NAD(P)H oxidase activity(GO:0033860) |
0.1 | 0.1 | GO:0033634 | positive regulation of cell-cell adhesion mediated by integrin(GO:0033634) |
0.1 | 0.4 | GO:0006607 | NLS-bearing protein import into nucleus(GO:0006607) |
0.1 | 0.2 | GO:0032909 | transforming growth factor beta2 production(GO:0032906) regulation of transforming growth factor beta2 production(GO:0032909) |
0.0 | 0.6 | GO:0006303 | double-strand break repair via nonhomologous end joining(GO:0006303) |
0.0 | 0.1 | GO:2000679 | positive regulation of transcription regulatory region DNA binding(GO:2000679) |
0.0 | 0.4 | GO:0060324 | face development(GO:0060324) |
0.0 | 0.2 | GO:0033234 | negative regulation of protein sumoylation(GO:0033234) |
0.0 | 0.0 | GO:0090238 | positive regulation of arachidonic acid secretion(GO:0090238) |
0.0 | 0.1 | GO:0098739 | import across plasma membrane(GO:0098739) |
0.0 | 0.1 | GO:0010499 | proteasomal ubiquitin-independent protein catabolic process(GO:0010499) |
0.0 | 0.0 | GO:0060455 | negative regulation of gastric acid secretion(GO:0060455) |
0.0 | 0.1 | GO:0048619 | embryonic hindgut morphogenesis(GO:0048619) |
0.0 | 0.2 | GO:0006290 | pyrimidine dimer repair(GO:0006290) |
0.0 | 0.1 | GO:0060112 | generation of ovulation cycle rhythm(GO:0060112) |
0.0 | 0.2 | GO:0090267 | positive regulation of mitotic cell cycle spindle assembly checkpoint(GO:0090267) |
0.0 | 0.1 | GO:0018094 | protein polyglycylation(GO:0018094) |
0.0 | 0.0 | GO:2000491 | positive regulation of hepatic stellate cell activation(GO:2000491) |
0.0 | 0.0 | GO:0048548 | regulation of pinocytosis(GO:0048548) |
0.0 | 0.1 | GO:0010360 | negative regulation of anion channel activity(GO:0010360) |
0.0 | 0.0 | GO:1902445 | regulation of mitochondrial membrane permeability involved in programmed necrotic cell death(GO:1902445) |
0.0 | 0.1 | GO:0051541 | elastin metabolic process(GO:0051541) |
0.0 | 0.0 | GO:0035513 | oxidative RNA demethylation(GO:0035513) oxidative single-stranded RNA demethylation(GO:0035553) |
0.0 | 0.7 | GO:0050962 | detection of light stimulus involved in visual perception(GO:0050908) detection of light stimulus involved in sensory perception(GO:0050962) |
0.0 | 0.0 | GO:2000543 | positive regulation of gastrulation(GO:2000543) |
0.0 | 0.0 | GO:0071498 | cellular response to fluid shear stress(GO:0071498) |
0.0 | 0.5 | GO:0030970 | retrograde protein transport, ER to cytosol(GO:0030970) |
0.0 | 1.0 | GO:0032784 | regulation of DNA-templated transcription, elongation(GO:0032784) |
0.0 | 0.1 | GO:0007440 | foregut morphogenesis(GO:0007440) |
0.0 | 0.1 | GO:0072092 | ureteric bud invasion(GO:0072092) |
0.0 | 0.9 | GO:0045746 | negative regulation of Notch signaling pathway(GO:0045746) |
0.0 | 0.3 | GO:0035090 | maintenance of apical/basal cell polarity(GO:0035090) |
0.0 | 0.2 | GO:0097062 | dendritic spine maintenance(GO:0097062) |
0.0 | 0.2 | GO:0006563 | L-serine metabolic process(GO:0006563) L-serine biosynthetic process(GO:0006564) |
0.0 | 0.2 | GO:0019740 | nitrogen utilization(GO:0019740) ammonium transmembrane transport(GO:0072488) |
0.0 | 0.2 | GO:0060766 | negative regulation of androgen receptor signaling pathway(GO:0060766) |
0.0 | 0.0 | GO:1902993 | positive regulation of beta-amyloid formation(GO:1902004) positive regulation of amyloid precursor protein catabolic process(GO:1902993) |
0.0 | 0.1 | GO:0046952 | ketone body catabolic process(GO:0046952) |
0.0 | 0.1 | GO:0002727 | natural killer cell cytokine production(GO:0002370) regulation of natural killer cell cytokine production(GO:0002727) |
0.0 | 0.2 | GO:0006729 | tetrahydrobiopterin biosynthetic process(GO:0006729) |
0.0 | 0.1 | GO:0060684 | epithelial-mesenchymal cell signaling(GO:0060684) |
0.0 | 0.1 | GO:0009946 | proximal/distal axis specification(GO:0009946) |
0.0 | 0.2 | GO:0035507 | regulation of myosin-light-chain-phosphatase activity(GO:0035507) |
0.0 | 0.1 | GO:0060591 | chondroblast differentiation(GO:0060591) |
0.0 | 1.0 | GO:0061077 | chaperone-mediated protein folding(GO:0061077) |
0.0 | 0.9 | GO:0046513 | ceramide biosynthetic process(GO:0046513) |
0.0 | 0.2 | GO:0014807 | regulation of somitogenesis(GO:0014807) |
0.0 | 0.1 | GO:0016480 | negative regulation of transcription from RNA polymerase III promoter(GO:0016480) |
0.0 | 0.2 | GO:0033014 | porphyrin-containing compound biosynthetic process(GO:0006779) tetrapyrrole biosynthetic process(GO:0033014) |
0.0 | 0.1 | GO:0032286 | central nervous system myelin maintenance(GO:0032286) |
0.0 | 0.2 | GO:0043923 | positive regulation by host of viral transcription(GO:0043923) |
0.0 | 0.4 | GO:0000301 | retrograde transport, vesicle recycling within Golgi(GO:0000301) |
0.0 | 0.3 | GO:0002089 | lens morphogenesis in camera-type eye(GO:0002089) |
0.0 | 0.6 | GO:0016180 | snRNA processing(GO:0016180) |
0.0 | 0.0 | GO:0060926 | cardiac pacemaker cell development(GO:0060926) |
0.0 | 0.1 | GO:2000105 | positive regulation of DNA-dependent DNA replication(GO:2000105) |
0.0 | 0.6 | GO:0000132 | establishment of mitotic spindle orientation(GO:0000132) |
0.0 | 0.1 | GO:0046684 | response to pyrethroid(GO:0046684) |
0.0 | 0.1 | GO:0007228 | positive regulation of hh target transcription factor activity(GO:0007228) |
0.0 | 0.0 | GO:0071712 | ER-associated misfolded protein catabolic process(GO:0071712) |
0.0 | 0.1 | GO:0042746 | regulation of circadian sleep/wake cycle, wakefulness(GO:0010840) positive regulation of circadian sleep/wake cycle, wakefulness(GO:0010841) circadian sleep/wake cycle, wakefulness(GO:0042746) |
0.0 | 0.3 | GO:0006687 | glycosphingolipid metabolic process(GO:0006687) |
0.0 | 0.0 | GO:0050685 | positive regulation of mRNA processing(GO:0050685) |
0.0 | 0.2 | GO:0032464 | positive regulation of protein homooligomerization(GO:0032464) |
0.0 | 0.0 | GO:0033693 | regulation of axon diameter(GO:0031133) neurofilament bundle assembly(GO:0033693) |
0.0 | 0.3 | GO:0017196 | N-terminal peptidyl-methionine acetylation(GO:0017196) |
0.0 | 0.4 | GO:1904851 | regulation of establishment of protein localization to telomere(GO:0070203) positive regulation of establishment of protein localization to telomere(GO:1904851) |
0.0 | 0.1 | GO:0009597 | detection of virus(GO:0009597) |
0.0 | 0.1 | GO:0060068 | vagina development(GO:0060068) |
0.0 | 0.1 | GO:0007161 | calcium-independent cell-matrix adhesion(GO:0007161) |
0.0 | 0.2 | GO:0045039 | protein import into mitochondrial inner membrane(GO:0045039) |
0.0 | 0.3 | GO:0030521 | androgen receptor signaling pathway(GO:0030521) |
0.0 | 0.3 | GO:0045176 | apical protein localization(GO:0045176) |
0.0 | 0.1 | GO:0045964 | positive regulation of catecholamine metabolic process(GO:0045915) positive regulation of dopamine metabolic process(GO:0045964) |
0.0 | 0.3 | GO:0043586 | tongue development(GO:0043586) |
0.0 | 0.0 | GO:0009298 | GDP-mannose biosynthetic process(GO:0009298) |
0.0 | 0.2 | GO:0072498 | embryonic skeletal joint development(GO:0072498) |
0.0 | 0.1 | GO:2000369 | regulation of clathrin-mediated endocytosis(GO:2000369) |
0.0 | 0.2 | GO:0000056 | ribosomal small subunit export from nucleus(GO:0000056) |
0.0 | 0.1 | GO:0014028 | notochord formation(GO:0014028) |
0.0 | 0.1 | GO:0035095 | behavioral response to nicotine(GO:0035095) |
0.0 | 0.1 | GO:0001777 | T cell homeostatic proliferation(GO:0001777) regulation of T cell homeostatic proliferation(GO:0046013) |
0.0 | 0.1 | GO:0061146 | Peyer's patch morphogenesis(GO:0061146) |
0.0 | 0.1 | GO:0010919 | regulation of inositol phosphate biosynthetic process(GO:0010919) |
0.0 | 0.1 | GO:0016115 | diterpenoid catabolic process(GO:0016103) terpenoid catabolic process(GO:0016115) retinoic acid catabolic process(GO:0034653) |
0.0 | 1.0 | GO:0048536 | spleen development(GO:0048536) |
0.0 | 0.6 | GO:0001522 | pseudouridine synthesis(GO:0001522) |
0.0 | 0.1 | GO:0032290 | peripheral nervous system myelin formation(GO:0032290) |
0.0 | 0.6 | GO:0032011 | ARF protein signal transduction(GO:0032011) regulation of ARF protein signal transduction(GO:0032012) |
0.0 | 0.1 | GO:0071596 | ubiquitin-dependent protein catabolic process via the N-end rule pathway(GO:0071596) |
0.0 | 0.2 | GO:0032482 | Rab protein signal transduction(GO:0032482) |
0.0 | 0.0 | GO:1900169 | regulation of glucocorticoid mediated signaling pathway(GO:1900169) |
0.0 | 0.1 | GO:1901164 | negative regulation of trophoblast cell migration(GO:1901164) |
0.0 | 0.1 | GO:0070305 | response to cGMP(GO:0070305) |
0.0 | 0.1 | GO:0033483 | oxygen homeostasis(GO:0032364) gas homeostasis(GO:0033483) |
0.0 | 0.1 | GO:0034421 | post-translational protein acetylation(GO:0034421) |
0.0 | 0.2 | GO:0010838 | positive regulation of keratinocyte proliferation(GO:0010838) |
0.0 | 0.1 | GO:0071883 | activation of MAPK activity by adrenergic receptor signaling pathway(GO:0071883) |
0.0 | 0.2 | GO:0006047 | UDP-N-acetylglucosamine metabolic process(GO:0006047) |
0.0 | 0.1 | GO:0060988 | lipid tube assembly(GO:0060988) |
0.0 | 0.6 | GO:0042771 | intrinsic apoptotic signaling pathway in response to DNA damage by p53 class mediator(GO:0042771) |
0.0 | 0.1 | GO:0035751 | regulation of lysosomal lumen pH(GO:0035751) |
0.0 | 0.1 | GO:0000087 | mitotic M phase(GO:0000087) |
0.0 | 0.1 | GO:0036265 | RNA (guanine-N7)-methylation(GO:0036265) |
0.0 | 0.1 | GO:1904479 | negative regulation of intestinal absorption(GO:1904479) |
0.0 | 2.2 | GO:0042274 | ribosomal small subunit biogenesis(GO:0042274) |
0.0 | 0.4 | GO:0043984 | histone H4-K16 acetylation(GO:0043984) |
0.0 | 0.3 | GO:0034723 | DNA replication-dependent nucleosome assembly(GO:0006335) DNA replication-dependent nucleosome organization(GO:0034723) |
0.0 | 0.3 | GO:0051481 | negative regulation of cytosolic calcium ion concentration(GO:0051481) |
0.0 | 0.2 | GO:0006590 | thyroid hormone generation(GO:0006590) |
0.0 | 0.1 | GO:0009125 | nucleoside monophosphate catabolic process(GO:0009125) |
0.0 | 0.2 | GO:0042078 | germ-line stem cell division(GO:0042078) male germ-line stem cell asymmetric division(GO:0048133) germline stem cell asymmetric division(GO:0098728) |
0.0 | 1.1 | GO:0006505 | GPI anchor metabolic process(GO:0006505) |
0.0 | 0.3 | GO:0009313 | oligosaccharide catabolic process(GO:0009313) |
0.0 | 0.2 | GO:1904970 | brush border assembly(GO:1904970) |
0.0 | 0.3 | GO:0018026 | peptidyl-lysine monomethylation(GO:0018026) |
0.0 | 0.0 | GO:0060830 | ciliary receptor clustering involved in smoothened signaling pathway(GO:0060830) |
0.0 | 0.1 | GO:0003140 | determination of left/right asymmetry in lateral mesoderm(GO:0003140) |
0.0 | 0.1 | GO:0046628 | positive regulation of insulin receptor signaling pathway(GO:0046628) |
0.0 | 0.1 | GO:0001992 | regulation of systemic arterial blood pressure by vasopressin(GO:0001992) |
0.0 | 0.1 | GO:1990592 | protein polyufmylation(GO:1990564) protein K69-linked ufmylation(GO:1990592) |
0.0 | 0.1 | GO:0042795 | snRNA transcription from RNA polymerase II promoter(GO:0042795) snRNA transcription from RNA polymerase III promoter(GO:0042796) |
0.0 | 0.3 | GO:0031498 | nucleosome disassembly(GO:0006337) chromatin disassembly(GO:0031498) protein-DNA complex disassembly(GO:0032986) |
0.0 | 0.1 | GO:0033601 | positive regulation of mammary gland epithelial cell proliferation(GO:0033601) |
0.0 | 0.1 | GO:0035337 | fatty-acyl-CoA metabolic process(GO:0035337) |
0.0 | 0.1 | GO:0070949 | regulation of neutrophil mediated cytotoxicity(GO:0070948) regulation of neutrophil mediated killing of symbiont cell(GO:0070949) |
0.0 | 0.2 | GO:0035745 | T-helper 2 cell cytokine production(GO:0035745) |
0.0 | 0.1 | GO:0060971 | embryonic heart tube left/right pattern formation(GO:0060971) |
0.0 | 0.1 | GO:0034975 | protein folding in endoplasmic reticulum(GO:0034975) |
0.0 | 0.3 | GO:1902018 | negative regulation of cilium assembly(GO:1902018) |
0.0 | 0.1 | GO:1902174 | positive regulation of keratinocyte apoptotic process(GO:1902174) |
0.0 | 0.1 | GO:0051971 | positive regulation of transmission of nerve impulse(GO:0051971) |
0.0 | 0.1 | GO:0042138 | meiotic DNA double-strand break formation(GO:0042138) |
0.0 | 0.1 | GO:0039689 | negative stranded viral RNA replication(GO:0039689) multi-organism biosynthetic process(GO:0044034) |
0.0 | 0.6 | GO:0006376 | mRNA splice site selection(GO:0006376) |
0.0 | 0.1 | GO:0043486 | histone exchange(GO:0043486) |
0.0 | 0.1 | GO:0050917 | sensory perception of umami taste(GO:0050917) |
0.0 | 0.4 | GO:0046039 | GTP metabolic process(GO:0046039) |
0.0 | 0.1 | GO:1903862 | positive regulation of oxidative phosphorylation(GO:1903862) |
0.0 | 0.3 | GO:0006471 | protein ADP-ribosylation(GO:0006471) |
0.0 | 0.1 | GO:0014043 | negative regulation of neuron maturation(GO:0014043) |
0.0 | 0.2 | GO:0007183 | SMAD protein complex assembly(GO:0007183) |
0.0 | 0.0 | GO:2001181 | positive regulation of interleukin-10 secretion(GO:2001181) |
0.0 | 0.5 | GO:0033539 | fatty acid beta-oxidation using acyl-CoA dehydrogenase(GO:0033539) |
0.0 | 0.1 | GO:0019276 | UDP-N-acetylgalactosamine metabolic process(GO:0019276) |
0.0 | 0.1 | GO:1901163 | regulation of trophoblast cell migration(GO:1901163) |
0.0 | 0.1 | GO:0070933 | histone H4 deacetylation(GO:0070933) |
0.0 | 0.0 | GO:0036476 | neuron death in response to hydrogen peroxide(GO:0036476) regulation of hydrogen peroxide-induced neuron death(GO:1903207) negative regulation of hydrogen peroxide-induced neuron death(GO:1903208) |
0.0 | 0.2 | GO:0033145 | positive regulation of intracellular steroid hormone receptor signaling pathway(GO:0033145) |
0.0 | 0.2 | GO:0010592 | positive regulation of lamellipodium assembly(GO:0010592) |
0.0 | 0.6 | GO:0006730 | one-carbon metabolic process(GO:0006730) |
0.0 | 0.0 | GO:1901844 | regulation of cell communication by electrical coupling involved in cardiac conduction(GO:1901844) |
0.0 | 0.1 | GO:0019532 | oxalate transport(GO:0019532) |
0.0 | 0.1 | GO:0032224 | positive regulation of synaptic transmission, cholinergic(GO:0032224) |
0.0 | 0.4 | GO:0006661 | phosphatidylinositol biosynthetic process(GO:0006661) |
0.0 | 0.1 | GO:1903225 | negative regulation of endodermal cell differentiation(GO:1903225) |
0.0 | 0.2 | GO:0060765 | regulation of androgen receptor signaling pathway(GO:0060765) |
0.0 | 0.1 | GO:0001768 | establishment of lymphocyte polarity(GO:0001767) establishment of T cell polarity(GO:0001768) |
0.0 | 0.2 | GO:0009048 | dosage compensation(GO:0007549) dosage compensation by inactivation of X chromosome(GO:0009048) |
0.0 | 0.1 | GO:0097368 | establishment of Sertoli cell barrier(GO:0097368) |
0.0 | 0.1 | GO:0036233 | glycine import(GO:0036233) |
0.0 | 0.2 | GO:0007210 | serotonin receptor signaling pathway(GO:0007210) |
0.0 | 0.1 | GO:0070162 | adiponectin secretion(GO:0070162) regulation of adiponectin secretion(GO:0070163) |
0.0 | 0.4 | GO:0071108 | protein K48-linked deubiquitination(GO:0071108) |
0.0 | 0.0 | GO:0070318 | positive regulation of G0 to G1 transition(GO:0070318) |
0.0 | 0.2 | GO:0035810 | positive regulation of urine volume(GO:0035810) |
0.0 | 0.1 | GO:0009957 | epidermal cell fate specification(GO:0009957) |
0.0 | 0.1 | GO:0052428 | negative regulation by host of symbiont molecular function(GO:0052405) modification by host of symbiont molecular function(GO:0052428) |
0.0 | 0.1 | GO:0090598 | male genitalia morphogenesis(GO:0048808) male anatomical structure morphogenesis(GO:0090598) |
0.0 | 0.1 | GO:0036089 | cleavage furrow formation(GO:0036089) |
0.0 | 0.3 | GO:0016446 | somatic hypermutation of immunoglobulin genes(GO:0016446) |
0.0 | 0.6 | GO:0033120 | positive regulation of RNA splicing(GO:0033120) |
0.0 | 0.1 | GO:0051967 | negative regulation of synaptic transmission, glutamatergic(GO:0051967) |
0.0 | 0.4 | GO:0071425 | hematopoietic stem cell proliferation(GO:0071425) |
0.0 | 0.1 | GO:0046208 | spermine catabolic process(GO:0046208) |
0.0 | 0.0 | GO:1901897 | regulation of relaxation of cardiac muscle(GO:1901897) |
0.0 | 0.2 | GO:2000001 | regulation of DNA damage checkpoint(GO:2000001) |
0.0 | 0.6 | GO:0071174 | negative regulation of mitotic metaphase/anaphase transition(GO:0045841) mitotic spindle checkpoint(GO:0071174) negative regulation of metaphase/anaphase transition of cell cycle(GO:1902100) negative regulation of mitotic sister chromatid separation(GO:2000816) |
0.0 | 0.2 | GO:0032460 | negative regulation of protein oligomerization(GO:0032460) |
0.0 | 0.1 | GO:1900108 | negative regulation of nodal signaling pathway(GO:1900108) |
0.0 | 0.1 | GO:0070102 | interleukin-6-mediated signaling pathway(GO:0070102) |
0.0 | 0.7 | GO:0018345 | protein palmitoylation(GO:0018345) |
0.0 | 0.1 | GO:0006702 | androgen biosynthetic process(GO:0006702) |
0.0 | 0.0 | GO:0009445 | putrescine metabolic process(GO:0009445) |
0.0 | 0.4 | GO:0071475 | cellular response to salt stress(GO:0071472) cellular hyperosmotic salinity response(GO:0071475) |
0.0 | 0.1 | GO:0060242 | contact inhibition(GO:0060242) |
0.0 | 0.1 | GO:0071459 | protein localization to kinetochore(GO:0034501) protein localization to chromosome, centromeric region(GO:0071459) |
0.0 | 0.1 | GO:0006613 | cotranslational protein targeting to membrane(GO:0006613) |
0.0 | 0.2 | GO:0015858 | nucleoside transport(GO:0015858) |
0.0 | 0.1 | GO:0033313 | meiotic cell cycle checkpoint(GO:0033313) |
0.0 | 0.0 | GO:0021847 | ventricular zone neuroblast division(GO:0021847) |
0.0 | 0.2 | GO:0070525 | tRNA threonylcarbamoyladenosine metabolic process(GO:0070525) |
0.0 | 0.0 | GO:0021555 | midbrain-hindbrain boundary morphogenesis(GO:0021555) |
0.0 | 0.2 | GO:0050774 | negative regulation of dendrite morphogenesis(GO:0050774) |
0.0 | 0.1 | GO:0046485 | ether lipid metabolic process(GO:0046485) |
0.0 | 0.1 | GO:1900153 | regulation of nuclear-transcribed mRNA catabolic process, deadenylation-dependent decay(GO:1900151) positive regulation of nuclear-transcribed mRNA catabolic process, deadenylation-dependent decay(GO:1900153) |
0.0 | 0.1 | GO:0017062 | respiratory chain complex III assembly(GO:0017062) mitochondrial respiratory chain complex III assembly(GO:0034551) mitochondrial respiratory chain complex III biogenesis(GO:0097033) |
0.0 | 0.1 | GO:1903818 | positive regulation of delayed rectifier potassium channel activity(GO:1902261) positive regulation of voltage-gated potassium channel activity(GO:1903818) |
0.0 | 0.0 | GO:1900186 | negative regulation of clathrin-mediated endocytosis(GO:1900186) |
0.0 | 0.1 | GO:0030423 | targeting of mRNA for destruction involved in RNA interference(GO:0030423) siRNA loading onto RISC involved in RNA interference(GO:0035087) |
0.0 | 0.1 | GO:0035927 | RNA import into mitochondrion(GO:0035927) |
0.0 | 0.0 | GO:0090027 | negative regulation of monocyte chemotaxis(GO:0090027) |
0.0 | 0.1 | GO:0046878 | positive regulation of saliva secretion(GO:0046878) |
0.0 | 0.5 | GO:0045747 | positive regulation of Notch signaling pathway(GO:0045747) |
0.0 | 0.3 | GO:0009143 | nucleoside triphosphate catabolic process(GO:0009143) |
0.0 | 0.1 | GO:0060510 | Type II pneumocyte differentiation(GO:0060510) |
0.0 | 0.1 | GO:0060017 | parathyroid gland development(GO:0060017) |
0.0 | 0.0 | GO:1903423 | positive regulation of synaptic vesicle recycling(GO:1903423) |
0.0 | 0.3 | GO:0006490 | oligosaccharide-lipid intermediate biosynthetic process(GO:0006490) |
0.0 | 0.0 | GO:0032714 | negative regulation of interleukin-5 production(GO:0032714) |
0.0 | 0.1 | GO:0042447 | hormone catabolic process(GO:0042447) |
0.0 | 0.1 | GO:0046959 | habituation(GO:0046959) |
0.0 | 0.0 | GO:1900620 | acetylcholine biosynthetic process(GO:0008292) acetate ester biosynthetic process(GO:1900620) |
0.0 | 0.2 | GO:0060294 | cilium movement involved in cell motility(GO:0060294) |
0.0 | 0.1 | GO:2001256 | regulation of store-operated calcium entry(GO:2001256) |
0.0 | 0.1 | GO:0034163 | regulation of toll-like receptor 9 signaling pathway(GO:0034163) |
0.0 | 0.5 | GO:0030433 | ER-associated ubiquitin-dependent protein catabolic process(GO:0030433) |
0.0 | 0.0 | GO:1903525 | regulation of membrane tubulation(GO:1903525) |
0.0 | 0.1 | GO:0003433 | chondrocyte development involved in endochondral bone morphogenesis(GO:0003433) |
0.0 | 0.1 | GO:0090073 | positive regulation of protein homodimerization activity(GO:0090073) |
0.0 | 0.2 | GO:0002087 | regulation of respiratory gaseous exchange by neurological system process(GO:0002087) |
0.0 | 0.6 | GO:0048240 | sperm capacitation(GO:0048240) |
0.0 | 0.2 | GO:0035020 | regulation of Rac protein signal transduction(GO:0035020) |
0.0 | 0.3 | GO:0018298 | protein-chromophore linkage(GO:0018298) |
0.0 | 0.0 | GO:0090310 | negative regulation of methylation-dependent chromatin silencing(GO:0090310) |
0.0 | 0.1 | GO:0071494 | cellular response to UV-C(GO:0071494) |
0.0 | 0.2 | GO:0042249 | establishment of planar polarity of embryonic epithelium(GO:0042249) |
0.0 | 0.1 | GO:0018206 | peptidyl-methionine modification(GO:0018206) |
0.0 | 0.1 | GO:0006824 | cobalt ion transport(GO:0006824) |
0.0 | 0.0 | GO:0050955 | thermoception(GO:0050955) |
0.0 | 0.2 | GO:0071880 | adenylate cyclase-activating adrenergic receptor signaling pathway(GO:0071880) |
0.0 | 0.1 | GO:0015695 | organic cation transport(GO:0015695) |
0.0 | 1.7 | GO:0008033 | tRNA processing(GO:0008033) |
0.0 | 0.0 | GO:0085020 | protein K6-linked ubiquitination(GO:0085020) |
0.0 | 0.1 | GO:0033262 | regulation of nuclear cell cycle DNA replication(GO:0033262) |
0.0 | 0.1 | GO:0070536 | protein K63-linked deubiquitination(GO:0070536) |
0.0 | 0.0 | GO:0014826 | vein smooth muscle contraction(GO:0014826) regulation of prostaglandin-endoperoxide synthase activity(GO:0060584) positive regulation of prostaglandin-endoperoxide synthase activity(GO:0060585) |
0.0 | 0.0 | GO:0045715 | negative regulation of low-density lipoprotein particle receptor biosynthetic process(GO:0045715) |
0.0 | 0.4 | GO:0000245 | spliceosomal complex assembly(GO:0000245) |
0.0 | 0.2 | GO:0040015 | negative regulation of multicellular organism growth(GO:0040015) |
0.0 | 0.1 | GO:0031914 | negative regulation of synaptic plasticity(GO:0031914) |
0.0 | 0.0 | GO:0050968 | detection of chemical stimulus involved in sensory perception of pain(GO:0050968) |
0.0 | 0.1 | GO:0044375 | regulation of peroxisome size(GO:0044375) |
0.0 | 0.0 | GO:0048703 | embryonic viscerocranium morphogenesis(GO:0048703) |
0.0 | 0.1 | GO:0036010 | protein localization to endosome(GO:0036010) |
0.0 | 0.1 | GO:0048742 | regulation of skeletal muscle fiber development(GO:0048742) |
0.0 | 1.0 | GO:0006892 | post-Golgi vesicle-mediated transport(GO:0006892) |
0.0 | 0.0 | GO:0021794 | thalamus development(GO:0021794) |
0.0 | 0.0 | GO:0030011 | maintenance of cell polarity(GO:0030011) |
0.0 | 0.1 | GO:0035845 | photoreceptor cell outer segment organization(GO:0035845) |
0.0 | 0.0 | GO:0010040 | response to iron(II) ion(GO:0010040) |
0.0 | 0.1 | GO:0001732 | formation of cytoplasmic translation initiation complex(GO:0001732) |
0.0 | 0.4 | GO:0044243 | multicellular organism catabolic process(GO:0044243) |
0.0 | 0.5 | GO:0009166 | nucleotide catabolic process(GO:0009166) |
0.0 | 0.1 | GO:1900113 | regulation of histone H3-K9 trimethylation(GO:1900112) negative regulation of histone H3-K9 trimethylation(GO:1900113) |
0.0 | 0.0 | GO:1900736 | regulation of phospholipase C-activating G-protein coupled receptor signaling pathway(GO:1900736) |
0.0 | 0.2 | GO:0060088 | auditory receptor cell stereocilium organization(GO:0060088) |
0.0 | 0.2 | GO:0048671 | negative regulation of collateral sprouting(GO:0048671) |
0.0 | 0.1 | GO:0021542 | dentate gyrus development(GO:0021542) |
0.0 | 0.0 | GO:0000059 | protein import into nucleus, docking(GO:0000059) |
0.0 | 0.3 | GO:0010965 | regulation of mitotic sister chromatid separation(GO:0010965) |
0.0 | 0.1 | GO:0031642 | negative regulation of myelination(GO:0031642) |
0.0 | 0.2 | GO:0006353 | DNA-templated transcription, termination(GO:0006353) |
0.0 | 0.7 | GO:0033141 | positive regulation of peptidyl-serine phosphorylation of STAT protein(GO:0033141) |
0.0 | 0.1 | GO:0090051 | negative regulation of cell migration involved in sprouting angiogenesis(GO:0090051) |
0.0 | 0.0 | GO:0002339 | B cell selection(GO:0002339) |
0.0 | 0.0 | GO:0006862 | nucleotide transport(GO:0006862) |
0.0 | 0.0 | GO:0021912 | regulation of transcription from RNA polymerase II promoter involved in spinal cord motor neuron fate specification(GO:0021912) |
0.0 | 0.1 | GO:0030299 | intestinal cholesterol absorption(GO:0030299) |
0.0 | 0.0 | GO:0018214 | protein carboxylation(GO:0018214) |
0.0 | 0.1 | GO:0001539 | cilium or flagellum-dependent cell motility(GO:0001539) cilium-dependent cell motility(GO:0060285) |
0.0 | 0.0 | GO:0006083 | acetate metabolic process(GO:0006083) |
0.0 | 0.0 | GO:0021558 | trochlear nerve development(GO:0021558) |
0.0 | 0.1 | GO:0010591 | regulation of lamellipodium assembly(GO:0010591) |
0.0 | 0.5 | GO:0050982 | detection of mechanical stimulus(GO:0050982) |
0.0 | 0.0 | GO:0034239 | macrophage fusion(GO:0034238) regulation of macrophage fusion(GO:0034239) |
0.0 | 0.0 | GO:0021797 | forebrain anterior/posterior pattern specification(GO:0021797) |
0.0 | 0.2 | GO:0019430 | removal of superoxide radicals(GO:0019430) |
0.0 | 0.2 | GO:0006123 | mitochondrial electron transport, cytochrome c to oxygen(GO:0006123) |
0.0 | 0.1 | GO:0010756 | positive regulation of plasminogen activation(GO:0010756) |
0.0 | 0.0 | GO:0002082 | regulation of oxidative phosphorylation(GO:0002082) |
0.0 | 0.0 | GO:2000327 | regulation of ligand-dependent nuclear receptor transcription coactivator activity(GO:2000325) positive regulation of ligand-dependent nuclear receptor transcription coactivator activity(GO:2000327) |
0.0 | 0.0 | GO:0046909 | intermembrane transport(GO:0046909) |
0.0 | 0.4 | GO:0006829 | zinc II ion transport(GO:0006829) |
0.0 | 0.0 | GO:0002586 | regulation of antigen processing and presentation of peptide antigen via MHC class II(GO:0002586) |
0.0 | 0.5 | GO:0001895 | retina homeostasis(GO:0001895) |
0.0 | 0.0 | GO:0035963 | response to interleukin-13(GO:0035962) cellular response to interleukin-13(GO:0035963) |
0.0 | 0.0 | GO:1900044 | regulation of protein K63-linked ubiquitination(GO:1900044) |
0.0 | 0.1 | GO:0006013 | mannose metabolic process(GO:0006013) |
0.0 | 0.1 | GO:0006621 | protein retention in ER lumen(GO:0006621) |
0.0 | 0.1 | GO:0014887 | muscle hypertrophy in response to stress(GO:0003299) cardiac muscle adaptation(GO:0014887) cardiac muscle hypertrophy in response to stress(GO:0014898) |
0.0 | 0.8 | GO:0016579 | protein deubiquitination(GO:0016579) |
0.0 | 1.1 | GO:0006694 | steroid biosynthetic process(GO:0006694) |
0.0 | 0.0 | GO:0030321 | transepithelial chloride transport(GO:0030321) |
0.0 | 0.1 | GO:0008089 | anterograde axonal transport(GO:0008089) |
0.0 | 0.1 | GO:0097150 | neuronal stem cell population maintenance(GO:0097150) |
0.0 | 0.1 | GO:0008272 | sulfate transport(GO:0008272) |
0.0 | 0.2 | GO:0045116 | protein neddylation(GO:0045116) |
0.0 | 0.0 | GO:0033058 | directional locomotion(GO:0033058) |
0.0 | 0.0 | GO:0006432 | phenylalanyl-tRNA aminoacylation(GO:0006432) |
0.0 | 0.0 | GO:0046149 | heme catabolic process(GO:0042167) pigment catabolic process(GO:0046149) |
0.0 | 0.0 | GO:0060159 | regulation of dopamine receptor signaling pathway(GO:0060159) |
0.0 | 0.0 | GO:0061086 | negative regulation of histone H3-K27 methylation(GO:0061086) |
0.0 | 0.0 | GO:0044336 | canonical Wnt signaling pathway involved in negative regulation of apoptotic process(GO:0044336) |
0.0 | 0.1 | GO:0045086 | positive regulation of interleukin-2 biosynthetic process(GO:0045086) |
0.0 | 0.0 | GO:0045074 | interleukin-10 biosynthetic process(GO:0042091) regulation of interleukin-10 biosynthetic process(GO:0045074) |
0.0 | 0.1 | GO:2000480 | negative regulation of cAMP-dependent protein kinase activity(GO:2000480) |
0.0 | 0.1 | GO:0007256 | activation of JNKK activity(GO:0007256) |
0.0 | 0.0 | GO:0042938 | dipeptide transport(GO:0042938) |
0.0 | 0.1 | GO:0030007 | cellular potassium ion homeostasis(GO:0030007) |
0.0 | 0.0 | GO:0042538 | hyperosmotic salinity response(GO:0042538) |
0.0 | 0.0 | GO:1904238 | glomerular mesangial cell differentiation(GO:0072008) glomerular mesangial cell development(GO:0072144) pericyte cell differentiation(GO:1904238) |
0.0 | 0.1 | GO:0006739 | NADP metabolic process(GO:0006739) |
0.0 | 0.2 | GO:1902572 | regulation of serine-type endopeptidase activity(GO:1900003) negative regulation of serine-type endopeptidase activity(GO:1900004) regulation of serine-type peptidase activity(GO:1902571) negative regulation of serine-type peptidase activity(GO:1902572) |
0.0 | 0.1 | GO:0034058 | endosomal vesicle fusion(GO:0034058) |
0.0 | 0.0 | GO:0036066 | protein O-linked fucosylation(GO:0036066) |
0.0 | 0.1 | GO:0032329 | serine transport(GO:0032329) |
0.0 | 0.2 | GO:0043968 | histone H2A acetylation(GO:0043968) |
0.0 | 0.0 | GO:0060023 | soft palate development(GO:0060023) |
0.0 | 0.0 | GO:0060129 | corticotropin hormone secreting cell differentiation(GO:0060128) thyroid-stimulating hormone-secreting cell differentiation(GO:0060129) |
0.0 | 0.0 | GO:0071639 | positive regulation of monocyte chemotactic protein-1 production(GO:0071639) |
0.0 | 0.2 | GO:0045880 | positive regulation of smoothened signaling pathway(GO:0045880) |
0.0 | 0.0 | GO:0006420 | arginyl-tRNA aminoacylation(GO:0006420) |
0.0 | 0.1 | GO:0090169 | regulation of spindle assembly(GO:0090169) |
0.0 | 0.1 | GO:0018065 | protein-cofactor linkage(GO:0018065) |
0.0 | 0.0 | GO:0021913 | regulation of transcription from RNA polymerase II promoter involved in ventral spinal cord interneuron specification(GO:0021913) |
0.0 | 0.1 | GO:0035089 | establishment of apical/basal cell polarity(GO:0035089) |
0.0 | 0.0 | GO:0030886 | negative regulation of myeloid dendritic cell activation(GO:0030886) |
0.0 | 0.1 | GO:0033564 | anterior/posterior axon guidance(GO:0033564) |
0.0 | 0.0 | GO:0019230 | proprioception(GO:0019230) |
0.0 | 0.1 | GO:0007096 | regulation of exit from mitosis(GO:0007096) |
0.0 | 0.0 | GO:0021683 | cerebellar granular layer morphogenesis(GO:0021683) cerebellar granular layer formation(GO:0021684) cerebellar granule cell differentiation(GO:0021707) |
0.0 | 0.0 | GO:0033566 | gamma-tubulin complex localization(GO:0033566) |
0.0 | 0.4 | GO:0031424 | keratinization(GO:0031424) |
0.0 | 0.1 | GO:0030206 | chondroitin sulfate biosynthetic process(GO:0030206) |
0.0 | 0.1 | GO:0060124 | positive regulation of growth hormone secretion(GO:0060124) |
0.0 | 0.1 | GO:0002495 | antigen processing and presentation of peptide antigen via MHC class II(GO:0002495) |
0.0 | 0.0 | GO:1904706 | negative regulation of vascular smooth muscle cell proliferation(GO:1904706) |
0.0 | 0.0 | GO:0021871 | forebrain regionalization(GO:0021871) |
0.0 | 0.0 | GO:0031033 | myosin filament organization(GO:0031033) |
0.0 | 0.0 | GO:0031443 | fast-twitch skeletal muscle fiber contraction(GO:0031443) |
0.0 | 0.1 | GO:1903509 | liposaccharide metabolic process(GO:1903509) |
0.0 | 0.0 | GO:0034398 | telomere tethering at nuclear periphery(GO:0034398) |
0.0 | 0.0 | GO:0071376 | response to corticotropin-releasing hormone(GO:0043435) cellular response to corticotropin-releasing hormone stimulus(GO:0071376) |
0.0 | 0.1 | GO:0035246 | peptidyl-arginine N-methylation(GO:0035246) |
0.0 | 0.2 | GO:0010257 | NADH dehydrogenase complex assembly(GO:0010257) mitochondrial respiratory chain complex I assembly(GO:0032981) mitochondrial respiratory chain complex I biogenesis(GO:0097031) |
0.0 | 0.1 | GO:0042270 | protection from natural killer cell mediated cytotoxicity(GO:0042270) |
0.0 | 0.1 | GO:0009225 | nucleotide-sugar metabolic process(GO:0009225) |
0.0 | 0.0 | GO:0080009 | mRNA methylation(GO:0080009) |
0.0 | 0.0 | GO:1902302 | regulation of potassium ion export(GO:1902302) |
0.0 | 0.0 | GO:1904124 | microglial cell migration(GO:1904124) regulation of microglial cell migration(GO:1904139) |
0.0 | 0.0 | GO:0070093 | negative regulation of glucagon secretion(GO:0070093) |
0.0 | 0.0 | GO:0046501 | protoporphyrinogen IX metabolic process(GO:0046501) |
0.0 | 0.0 | GO:0014878 | response to inactivity(GO:0014854) response to muscle inactivity(GO:0014870) response to muscle inactivity involved in regulation of muscle adaptation(GO:0014877) response to electrical stimulus involved in regulation of muscle adaptation(GO:0014878) response to denervation involved in regulation of muscle adaptation(GO:0014894) |
0.0 | 0.0 | GO:0007501 | mesodermal cell fate specification(GO:0007501) |
0.0 | 0.2 | GO:0070193 | synaptonemal complex organization(GO:0070193) |
0.0 | 0.1 | GO:0002931 | response to ischemia(GO:0002931) |
0.0 | 0.0 | GO:0051602 | response to electrical stimulus(GO:0051602) |
0.0 | 0.0 | GO:0061339 | establishment of monopolar cell polarity(GO:0061162) establishment or maintenance of monopolar cell polarity(GO:0061339) |
0.0 | 0.0 | GO:0032621 | interleukin-18 production(GO:0032621) |
0.0 | 0.1 | GO:0003334 | keratinocyte development(GO:0003334) |
0.0 | 0.0 | GO:0070445 | oligodendrocyte progenitor proliferation(GO:0070444) regulation of oligodendrocyte progenitor proliferation(GO:0070445) |
0.0 | 0.0 | GO:0000076 | DNA replication checkpoint(GO:0000076) |
0.0 | 0.0 | GO:2000562 | negative regulation of CD4-positive, alpha-beta T cell proliferation(GO:2000562) |
0.0 | 0.1 | GO:0035176 | social behavior(GO:0035176) intraspecies interaction between organisms(GO:0051703) |
0.0 | 0.0 | GO:0002125 | maternal aggressive behavior(GO:0002125) cellular response to cocaine(GO:0071314) |
0.0 | 0.1 | GO:0031063 | regulation of histone deacetylation(GO:0031063) |
0.0 | 0.0 | GO:0014053 | negative regulation of gamma-aminobutyric acid secretion(GO:0014053) |
0.0 | 0.0 | GO:0039536 | negative regulation of RIG-I signaling pathway(GO:0039536) |
0.0 | 0.1 | GO:0098781 | ncRNA transcription(GO:0098781) |
0.0 | 0.0 | GO:0030311 | poly-N-acetyllactosamine metabolic process(GO:0030309) poly-N-acetyllactosamine biosynthetic process(GO:0030311) |
0.0 | 0.0 | GO:0010446 | response to alkaline pH(GO:0010446) |
0.0 | 0.0 | GO:0046339 | diacylglycerol metabolic process(GO:0046339) |
0.0 | 0.0 | GO:0090214 | spongiotrophoblast layer developmental growth(GO:0090214) |
0.0 | 0.0 | GO:0046877 | regulation of saliva secretion(GO:0046877) |
0.0 | 0.0 | GO:0072578 | neurotransmitter-gated ion channel clustering(GO:0072578) |
0.0 | 0.0 | GO:0055075 | potassium ion homeostasis(GO:0055075) |
0.0 | 0.0 | GO:0046607 | positive regulation of centrosome cycle(GO:0046607) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
1.3 | 3.8 | GO:0097487 | multivesicular body, internal vesicle(GO:0097487) |
0.6 | 1.9 | GO:0031088 | platelet dense granule membrane(GO:0031088) |
0.5 | 2.2 | GO:0030127 | COPII vesicle coat(GO:0030127) |
0.5 | 0.5 | GO:0097629 | extrinsic component of omegasome membrane(GO:0097629) |
0.5 | 3.8 | GO:0042587 | glycogen granule(GO:0042587) |
0.4 | 2.2 | GO:0031315 | extrinsic component of mitochondrial outer membrane(GO:0031315) |
0.4 | 4.4 | GO:0070852 | cell body fiber(GO:0070852) |
0.4 | 2.0 | GO:0045098 | type III intermediate filament(GO:0045098) |
0.4 | 1.2 | GO:0060053 | neurofilament cytoskeleton(GO:0060053) |
0.4 | 1.5 | GO:0044316 | cone cell pedicle(GO:0044316) |
0.4 | 1.5 | GO:0035867 | alphav-beta3 integrin-IGF-1-IGF1R complex(GO:0035867) |
0.3 | 1.0 | GO:0048179 | activin receptor complex(GO:0048179) |
0.3 | 1.0 | GO:0097441 | basilar dendrite(GO:0097441) |
0.3 | 0.9 | GO:0070939 | Dsl1p complex(GO:0070939) |
0.3 | 2.0 | GO:0000306 | extrinsic component of vacuolar membrane(GO:0000306) |
0.3 | 1.6 | GO:0035032 | phosphatidylinositol 3-kinase complex, class III(GO:0035032) |
0.3 | 1.1 | GO:0032541 | cortical endoplasmic reticulum(GO:0032541) |
0.3 | 1.9 | GO:0045180 | basal cortex(GO:0045180) |
0.2 | 1.7 | GO:0005952 | cAMP-dependent protein kinase complex(GO:0005952) |
0.2 | 1.2 | GO:1990712 | HFE-transferrin receptor complex(GO:1990712) |
0.2 | 1.9 | GO:0045254 | pyruvate dehydrogenase complex(GO:0045254) |
0.2 | 0.9 | GO:0043202 | lysosomal lumen(GO:0043202) |
0.2 | 0.9 | GO:0070545 | PeBoW complex(GO:0070545) |
0.2 | 2.8 | GO:0034663 | endoplasmic reticulum chaperone complex(GO:0034663) |
0.2 | 0.7 | GO:0005712 | chiasma(GO:0005712) |
0.2 | 0.6 | GO:0005896 | interleukin-6 receptor complex(GO:0005896) |
0.2 | 0.6 | GO:0097025 | MPP7-DLG1-LIN7 complex(GO:0097025) |
0.2 | 0.6 | GO:0005850 | eukaryotic translation initiation factor 2 complex(GO:0005850) |
0.2 | 1.4 | GO:0000439 | core TFIIH complex(GO:0000439) |
0.2 | 1.1 | GO:0046696 | lipopolysaccharide receptor complex(GO:0046696) |
0.2 | 1.1 | GO:0070776 | H3 histone acetyltransferase complex(GO:0070775) MOZ/MORF histone acetyltransferase complex(GO:0070776) |
0.2 | 1.7 | GO:0034709 | methylosome(GO:0034709) |
0.2 | 0.7 | GO:0045293 | mRNA editing complex(GO:0045293) |
0.2 | 1.3 | GO:0016342 | catenin complex(GO:0016342) |
0.2 | 0.8 | GO:0042765 | GPI-anchor transamidase complex(GO:0042765) |
0.2 | 0.5 | GO:0097058 | CRLF-CLCF1 complex(GO:0097058) |
0.2 | 0.2 | GO:0000125 | PCAF complex(GO:0000125) |
0.2 | 0.8 | GO:0005579 | membrane attack complex(GO:0005579) |
0.2 | 0.6 | GO:0044615 | nuclear pore nuclear basket(GO:0044615) |
0.2 | 0.3 | GO:0016222 | procollagen-proline 4-dioxygenase complex(GO:0016222) |
0.2 | 1.7 | GO:0031143 | pseudopodium(GO:0031143) |
0.2 | 0.5 | GO:0034666 | integrin alpha2-beta1 complex(GO:0034666) |
0.1 | 1.8 | GO:0005942 | phosphatidylinositol 3-kinase complex(GO:0005942) |
0.1 | 0.6 | GO:0033269 | internode region of axon(GO:0033269) |
0.1 | 0.7 | GO:0070688 | MLL5-L complex(GO:0070688) |
0.1 | 0.4 | GO:0071817 | MMXD complex(GO:0071817) |
0.1 | 0.6 | GO:0032021 | NELF complex(GO:0032021) |
0.1 | 0.4 | GO:0097454 | Schwann cell microvillus(GO:0097454) |
0.1 | 0.6 | GO:0032777 | Piccolo NuA4 histone acetyltransferase complex(GO:0032777) |
0.1 | 1.3 | GO:0036513 | Derlin-1 retrotranslocation complex(GO:0036513) |
0.1 | 0.8 | GO:0097342 | ripoptosome(GO:0097342) |
0.1 | 0.4 | GO:0034457 | Mpp10 complex(GO:0034457) |
0.1 | 0.4 | GO:0032010 | phagolysosome(GO:0032010) |
0.1 | 1.1 | GO:0019773 | proteasome core complex, alpha-subunit complex(GO:0019773) |
0.1 | 0.4 | GO:0031074 | nucleocytoplasmic shuttling complex(GO:0031074) |
0.1 | 0.4 | GO:0043625 | delta DNA polymerase complex(GO:0043625) |
0.1 | 0.4 | GO:0010009 | cytoplasmic side of endosome membrane(GO:0010009) |
0.1 | 2.1 | GO:0035327 | transcriptionally active chromatin(GO:0035327) |
0.1 | 0.4 | GO:0044354 | pinosome(GO:0044352) macropinosome(GO:0044354) |
0.1 | 0.7 | GO:0071782 | endoplasmic reticulum tubular network(GO:0071782) |
0.1 | 1.0 | GO:0001650 | fibrillar center(GO:0001650) |
0.1 | 0.5 | GO:0005726 | perichromatin fibrils(GO:0005726) |
0.1 | 0.4 | GO:0032444 | activin responsive factor complex(GO:0032444) |
0.1 | 1.8 | GO:0030014 | CCR4-NOT complex(GO:0030014) |
0.1 | 0.6 | GO:0044233 | ER-mitochondrion membrane contact site(GO:0044233) |
0.1 | 0.5 | GO:0005610 | laminin-5 complex(GO:0005610) |
0.1 | 0.9 | GO:0000506 | glycosylphosphatidylinositol-N-acetylglucosaminyltransferase (GPI-GnT) complex(GO:0000506) |
0.1 | 1.7 | GO:0005686 | U2 snRNP(GO:0005686) |
0.1 | 0.8 | GO:0072669 | tRNA-splicing ligase complex(GO:0072669) |
0.1 | 1.2 | GO:0030126 | COPI vesicle coat(GO:0030126) |
0.1 | 0.3 | GO:0097149 | centralspindlin complex(GO:0097149) |
0.1 | 0.3 | GO:0005827 | polar microtubule(GO:0005827) |
0.1 | 0.4 | GO:0031618 | nuclear pericentric heterochromatin(GO:0031618) |
0.1 | 1.0 | GO:0030120 | vesicle coat(GO:0030120) |
0.1 | 1.8 | GO:0000930 | gamma-tubulin complex(GO:0000930) |
0.1 | 0.4 | GO:0002079 | inner acrosomal membrane(GO:0002079) |
0.1 | 0.6 | GO:0005964 | phosphorylase kinase complex(GO:0005964) |
0.1 | 0.2 | GO:0042612 | MHC class I protein complex(GO:0042612) |
0.1 | 0.7 | GO:0034098 | VCP-NPL4-UFD1 AAA ATPase complex(GO:0034098) |
0.1 | 5.0 | GO:0031903 | peroxisomal membrane(GO:0005778) microbody membrane(GO:0031903) |
0.1 | 0.3 | GO:0044530 | supraspliceosomal complex(GO:0044530) |
0.1 | 0.4 | GO:0012507 | ER to Golgi transport vesicle membrane(GO:0012507) |
0.1 | 0.7 | GO:0000164 | protein phosphatase type 1 complex(GO:0000164) |
0.1 | 0.2 | GO:0031502 | dolichyl-phosphate-mannose-protein mannosyltransferase complex(GO:0031502) |
0.1 | 1.5 | GO:0033276 | transcription factor TFTC complex(GO:0033276) |
0.1 | 0.6 | GO:0070937 | CRD-mediated mRNA stability complex(GO:0070937) |
0.1 | 0.7 | GO:0030061 | mitochondrial crista(GO:0030061) |
0.1 | 0.5 | GO:0089701 | U2AF(GO:0089701) |
0.1 | 2.0 | GO:0032588 | trans-Golgi network membrane(GO:0032588) |
0.1 | 0.3 | GO:0097543 | ciliary inversin compartment(GO:0097543) |
0.1 | 0.4 | GO:0097209 | epidermal lamellar body(GO:0097209) |
0.1 | 0.4 | GO:0031094 | platelet dense tubular network(GO:0031094) |
0.1 | 1.1 | GO:0000346 | transcription export complex(GO:0000346) |
0.1 | 0.4 | GO:0070876 | SOSS complex(GO:0070876) |
0.1 | 0.8 | GO:0070578 | RISC-loading complex(GO:0070578) |
0.1 | 0.3 | GO:0005971 | ribonucleoside-diphosphate reductase complex(GO:0005971) |
0.1 | 0.3 | GO:0002193 | MAML1-RBP-Jkappa- ICN1 complex(GO:0002193) |
0.1 | 0.4 | GO:0031262 | Ndc80 complex(GO:0031262) |
0.1 | 0.2 | GO:1990357 | terminal web(GO:1990357) |
0.1 | 0.3 | GO:0014701 | junctional sarcoplasmic reticulum membrane(GO:0014701) |
0.1 | 2.1 | GO:0005790 | smooth endoplasmic reticulum(GO:0005790) |
0.1 | 0.3 | GO:0044611 | nuclear pore inner ring(GO:0044611) |
0.1 | 1.1 | GO:0005847 | mRNA cleavage and polyadenylation specificity factor complex(GO:0005847) |
0.1 | 3.6 | GO:0045271 | mitochondrial respiratory chain complex I(GO:0005747) NADH dehydrogenase complex(GO:0030964) respiratory chain complex I(GO:0045271) |
0.1 | 0.4 | GO:0014731 | spectrin-associated cytoskeleton(GO:0014731) |
0.1 | 2.4 | GO:0030131 | clathrin adaptor complex(GO:0030131) |
0.1 | 0.1 | GO:0097418 | neurofibrillary tangle(GO:0097418) |
0.1 | 0.3 | GO:0097422 | tubular endosome(GO:0097422) |
0.1 | 0.3 | GO:0071942 | XPC complex(GO:0071942) |
0.1 | 1.8 | GO:0005719 | nuclear euchromatin(GO:0005719) |
0.1 | 1.0 | GO:0032580 | Golgi cisterna membrane(GO:0032580) |
0.1 | 0.5 | GO:0005744 | mitochondrial inner membrane presequence translocase complex(GO:0005744) |
0.1 | 0.3 | GO:0000110 | nucleotide-excision repair factor 1 complex(GO:0000110) |
0.1 | 1.3 | GO:0035371 | microtubule plus-end(GO:0035371) |
0.1 | 0.2 | GO:0005955 | calcineurin complex(GO:0005955) |
0.1 | 0.7 | GO:0008250 | oligosaccharyltransferase complex(GO:0008250) |
0.1 | 0.3 | GO:0005968 | Rab-protein geranylgeranyltransferase complex(GO:0005968) |
0.1 | 1.4 | GO:0005892 | acetylcholine-gated channel complex(GO:0005892) |
0.1 | 0.6 | GO:0042788 | polysomal ribosome(GO:0042788) |
0.1 | 1.4 | GO:0043034 | costamere(GO:0043034) |
0.1 | 0.5 | GO:0030914 | STAGA complex(GO:0030914) |
0.1 | 4.0 | GO:0005811 | lipid particle(GO:0005811) |
0.1 | 0.3 | GO:0000408 | EKC/KEOPS complex(GO:0000408) |
0.1 | 0.4 | GO:0030056 | hemidesmosome(GO:0030056) |
0.1 | 1.2 | GO:0010369 | chromocenter(GO:0010369) |
0.1 | 0.1 | GO:0008091 | spectrin(GO:0008091) |
0.1 | 0.3 | GO:0070761 | pre-snoRNP complex(GO:0070761) |
0.1 | 0.6 | GO:0031595 | nuclear proteasome complex(GO:0031595) |
0.1 | 3.3 | GO:0009295 | nucleoid(GO:0009295) mitochondrial nucleoid(GO:0042645) |
0.1 | 0.7 | GO:0005682 | U5 snRNP(GO:0005682) |
0.1 | 1.0 | GO:0035686 | sperm fibrous sheath(GO:0035686) |
0.1 | 0.7 | GO:0032045 | guanyl-nucleotide exchange factor complex(GO:0032045) |
0.1 | 0.3 | GO:0071598 | neuronal ribonucleoprotein granule(GO:0071598) |
0.1 | 0.6 | GO:0034993 | microtubule organizing center attachment site(GO:0034992) LINC complex(GO:0034993) |
0.1 | 0.4 | GO:0000805 | X chromosome(GO:0000805) |
0.1 | 0.1 | GO:0005608 | laminin-3 complex(GO:0005608) |
0.1 | 0.1 | GO:0031466 | Cul5-RING ubiquitin ligase complex(GO:0031466) |
0.1 | 2.2 | GO:0031672 | A band(GO:0031672) |
0.1 | 0.3 | GO:0030478 | actin cap(GO:0030478) |
0.1 | 0.5 | GO:0017101 | aminoacyl-tRNA synthetase multienzyme complex(GO:0017101) |
0.1 | 6.3 | GO:0030176 | integral component of endoplasmic reticulum membrane(GO:0030176) |
0.1 | 0.4 | GO:0031415 | NatA complex(GO:0031415) |
0.1 | 0.7 | GO:0098799 | outer mitochondrial membrane protein complex(GO:0098799) |
0.1 | 0.5 | GO:0031464 | Cul4A-RING E3 ubiquitin ligase complex(GO:0031464) |
0.1 | 0.1 | GO:0035748 | myelin sheath abaxonal region(GO:0035748) |
0.1 | 0.3 | GO:0031314 | extrinsic component of mitochondrial inner membrane(GO:0031314) |
0.1 | 0.5 | GO:0031211 | serine C-palmitoyltransferase complex(GO:0017059) endoplasmic reticulum palmitoyltransferase complex(GO:0031211) |
0.1 | 0.4 | GO:0000127 | transcription factor TFIIIC complex(GO:0000127) |
0.1 | 0.3 | GO:1990745 | EARP complex(GO:1990745) |
0.1 | 0.6 | GO:0000815 | ESCRT III complex(GO:0000815) |
0.1 | 0.3 | GO:0016461 | unconventional myosin complex(GO:0016461) |
0.1 | 0.3 | GO:0097524 | sperm plasma membrane(GO:0097524) |
0.1 | 2.4 | GO:0005758 | mitochondrial intermembrane space(GO:0005758) |
0.1 | 0.2 | GO:0030289 | protein phosphatase 4 complex(GO:0030289) |
0.1 | 0.4 | GO:1990909 | Wnt signalosome(GO:1990909) |
0.1 | 1.0 | GO:0031233 | intrinsic component of external side of plasma membrane(GO:0031233) |
0.1 | 0.3 | GO:0042406 | extrinsic component of endoplasmic reticulum membrane(GO:0042406) |
0.1 | 1.6 | GO:0008023 | transcription elongation factor complex(GO:0008023) |
0.1 | 0.3 | GO:0098536 | deuterosome(GO:0098536) |
0.1 | 0.2 | GO:0005785 | signal recognition particle receptor complex(GO:0005785) |
0.1 | 3.3 | GO:0097517 | stress fiber(GO:0001725) contractile actin filament bundle(GO:0097517) |
0.1 | 9.5 | GO:0005759 | mitochondrial matrix(GO:0005759) |
0.1 | 6.4 | GO:0005741 | mitochondrial outer membrane(GO:0005741) |
0.1 | 0.2 | GO:0061574 | ASAP complex(GO:0061574) |
0.1 | 0.6 | GO:0031083 | BLOC-1 complex(GO:0031083) |
0.1 | 2.3 | GO:0030315 | T-tubule(GO:0030315) |
0.1 | 0.5 | GO:0008074 | guanylate cyclase complex, soluble(GO:0008074) |
0.1 | 0.5 | GO:0033179 | proton-transporting V-type ATPase, V0 domain(GO:0033179) |
0.1 | 0.3 | GO:0070044 | synaptobrevin 2-SNAP-25-syntaxin-1a complex(GO:0070044) |
0.1 | 0.7 | GO:0032426 | stereocilium tip(GO:0032426) |
0.1 | 0.2 | GO:0030956 | glutamyl-tRNA(Gln) amidotransferase complex(GO:0030956) |
0.1 | 0.2 | GO:0005658 | alpha DNA polymerase:primase complex(GO:0005658) |
0.1 | 0.2 | GO:0005956 | protein kinase CK2 complex(GO:0005956) |
0.1 | 0.3 | GO:0045239 | tricarboxylic acid cycle enzyme complex(GO:0045239) |
0.1 | 3.1 | GO:0016605 | PML body(GO:0016605) |
0.1 | 0.4 | GO:0005677 | chromatin silencing complex(GO:0005677) |
0.1 | 0.2 | GO:0071203 | WASH complex(GO:0071203) |
0.1 | 0.2 | GO:0043527 | tRNA methyltransferase complex(GO:0043527) |
0.1 | 0.2 | GO:0005797 | Golgi medial cisterna(GO:0005797) |
0.1 | 0.6 | GO:0033017 | sarcoplasmic reticulum membrane(GO:0033017) |
0.1 | 0.4 | GO:0070419 | nonhomologous end joining complex(GO:0070419) |
0.1 | 1.9 | GO:1902554 | serine/threonine protein kinase complex(GO:1902554) |
0.1 | 0.3 | GO:0060091 | kinocilium(GO:0060091) |
0.1 | 0.2 | GO:0030485 | smooth muscle contractile fiber(GO:0030485) |
0.1 | 0.2 | GO:0005927 | muscle tendon junction(GO:0005927) |
0.0 | 0.4 | GO:0042611 | MHC protein complex(GO:0042611) |
0.0 | 0.7 | GO:0000159 | protein phosphatase type 2A complex(GO:0000159) |
0.0 | 0.0 | GO:0005593 | FACIT collagen trimer(GO:0005593) |
0.0 | 0.2 | GO:0000812 | Swr1 complex(GO:0000812) |
0.0 | 0.0 | GO:0044393 | microspike(GO:0044393) |
0.0 | 0.3 | GO:0005662 | DNA replication factor A complex(GO:0005662) |
0.0 | 0.1 | GO:0097413 | Lewy body(GO:0097413) |
0.0 | 0.3 | GO:0016012 | dystroglycan complex(GO:0016011) sarcoglycan complex(GO:0016012) |
0.0 | 0.4 | GO:0045263 | proton-transporting ATP synthase complex, coupling factor F(o)(GO:0045263) |
0.0 | 0.1 | GO:0071204 | histone pre-mRNA 3'end processing complex(GO:0071204) |
0.0 | 0.0 | GO:0005640 | nuclear outer membrane(GO:0005640) |
0.0 | 0.1 | GO:0034365 | discoidal high-density lipoprotein particle(GO:0034365) |
0.0 | 0.1 | GO:0031465 | Cul4B-RING E3 ubiquitin ligase complex(GO:0031465) |
0.0 | 0.2 | GO:0032584 | growth cone membrane(GO:0032584) |
0.0 | 0.3 | GO:0031371 | ubiquitin conjugating enzyme complex(GO:0031371) |
0.0 | 0.3 | GO:0090571 | RNA polymerase II transcription repressor complex(GO:0090571) |
0.0 | 0.9 | GO:0031902 | late endosome membrane(GO:0031902) |
0.0 | 0.2 | GO:0030686 | 90S preribosome(GO:0030686) |
0.0 | 0.1 | GO:0005849 | mRNA cleavage factor complex(GO:0005849) |
0.0 | 0.0 | GO:0005853 | eukaryotic translation elongation factor 1 complex(GO:0005853) |
0.0 | 0.3 | GO:0071014 | post-mRNA release spliceosomal complex(GO:0071014) |
0.0 | 0.1 | GO:0000942 | condensed nuclear chromosome outer kinetochore(GO:0000942) |
0.0 | 0.1 | GO:0090661 | box H/ACA telomerase RNP complex(GO:0090661) |
0.0 | 0.1 | GO:0045298 | tubulin complex(GO:0045298) |
0.0 | 0.4 | GO:0000777 | condensed chromosome kinetochore(GO:0000777) |
0.0 | 0.1 | GO:0033596 | TSC1-TSC2 complex(GO:0033596) |
0.0 | 0.0 | GO:0070033 | synaptobrevin 2-SNAP-25-syntaxin-1a-complexin II complex(GO:0070033) |
0.0 | 0.3 | GO:0043220 | Schmidt-Lanterman incisure(GO:0043220) |
0.0 | 0.9 | GO:0015030 | Cajal body(GO:0015030) |
0.0 | 0.6 | GO:0080008 | Cul4-RING E3 ubiquitin ligase complex(GO:0080008) |
0.0 | 0.4 | GO:0070469 | respiratory chain(GO:0070469) |
0.0 | 0.4 | GO:0005832 | chaperonin-containing T-complex(GO:0005832) |
0.0 | 0.1 | GO:0032280 | symmetric synapse(GO:0032280) |
0.0 | 0.8 | GO:0034364 | high-density lipoprotein particle(GO:0034364) |
0.0 | 0.0 | GO:0046930 | pore complex(GO:0046930) |
0.0 | 0.3 | GO:0031512 | motile primary cilium(GO:0031512) |
0.0 | 1.2 | GO:0045171 | intercellular bridge(GO:0045171) |
0.0 | 0.5 | GO:0098643 | fibrillar collagen trimer(GO:0005583) banded collagen fibril(GO:0098643) |
0.0 | 0.1 | GO:0044308 | axonal spine(GO:0044308) |
0.0 | 0.1 | GO:0002199 | zona pellucida receptor complex(GO:0002199) |
0.0 | 0.1 | GO:0031462 | Cul2-RING ubiquitin ligase complex(GO:0031462) |
0.0 | 0.6 | GO:0044665 | MLL1/2 complex(GO:0044665) MLL1 complex(GO:0071339) |
0.0 | 0.2 | GO:0048500 | signal recognition particle, endoplasmic reticulum targeting(GO:0005786) signal recognition particle(GO:0048500) |
0.0 | 0.3 | GO:0036128 | CatSper complex(GO:0036128) |
0.0 | 0.2 | GO:0030896 | checkpoint clamp complex(GO:0030896) |
0.0 | 0.4 | GO:0005771 | multivesicular body(GO:0005771) |
0.0 | 0.1 | GO:1990423 | RZZ complex(GO:1990423) |
0.0 | 0.4 | GO:0001527 | microfibril(GO:0001527) |
0.0 | 0.2 | GO:0042382 | paraspeckles(GO:0042382) |
0.0 | 0.0 | GO:0031428 | box C/D snoRNP complex(GO:0031428) |
0.0 | 0.2 | GO:0016471 | vacuolar proton-transporting V-type ATPase complex(GO:0016471) |
0.0 | 0.1 | GO:1990111 | spermatoproteasome complex(GO:1990111) |
0.0 | 0.1 | GO:0098533 | ATPase dependent transmembrane transport complex(GO:0098533) |
0.0 | 0.1 | GO:0000802 | transverse filament(GO:0000802) |
0.0 | 0.3 | GO:0097386 | glial cell projection(GO:0097386) |
0.0 | 0.1 | GO:0030312 | external encapsulating structure(GO:0030312) |
0.0 | 0.4 | GO:0017119 | Golgi transport complex(GO:0017119) |
0.0 | 0.1 | GO:0043511 | inhibin complex(GO:0043511) |
0.0 | 0.2 | GO:0048476 | Holliday junction resolvase complex(GO:0048476) |
0.0 | 0.1 | GO:0044294 | dendritic growth cone(GO:0044294) |
0.0 | 0.2 | GO:0034518 | mRNA cap binding complex(GO:0005845) RNA cap binding complex(GO:0034518) |
0.0 | 0.2 | GO:0048237 | rough endoplasmic reticulum lumen(GO:0048237) |
0.0 | 0.2 | GO:0031209 | SCAR complex(GO:0031209) |
0.0 | 0.3 | GO:0045277 | respiratory chain complex IV(GO:0045277) |
0.0 | 0.1 | GO:0001940 | male pronucleus(GO:0001940) |
0.0 | 0.3 | GO:0031011 | Ino80 complex(GO:0031011) |
0.0 | 0.8 | GO:0016528 | sarcoplasm(GO:0016528) |
0.0 | 0.3 | GO:0070069 | cytochrome complex(GO:0070069) |
0.0 | 0.2 | GO:0097542 | ciliary tip(GO:0097542) |
0.0 | 0.8 | GO:0005801 | cis-Golgi network(GO:0005801) |
0.0 | 0.1 | GO:0044292 | dendrite terminus(GO:0044292) |
0.0 | 0.2 | GO:0000798 | nuclear cohesin complex(GO:0000798) |
0.0 | 0.4 | GO:0035145 | exon-exon junction complex(GO:0035145) |
0.0 | 0.7 | GO:0016592 | mediator complex(GO:0016592) |
0.0 | 0.2 | GO:0061700 | GATOR2 complex(GO:0061700) |
0.0 | 0.1 | GO:0034362 | low-density lipoprotein particle(GO:0034362) |
0.0 | 0.9 | GO:0030173 | integral component of Golgi membrane(GO:0030173) |
0.0 | 1.5 | GO:0005770 | late endosome(GO:0005770) |
0.0 | 1.0 | GO:0044291 | cell-cell contact zone(GO:0044291) |
0.0 | 0.1 | GO:0042629 | mast cell granule(GO:0042629) |
0.0 | 0.1 | GO:0000974 | Prp19 complex(GO:0000974) |
0.0 | 0.4 | GO:0005868 | cytoplasmic dynein complex(GO:0005868) |
0.0 | 0.1 | GO:0071437 | invadopodium(GO:0071437) |
0.0 | 0.4 | GO:0032420 | stereocilium(GO:0032420) |
0.0 | 0.2 | GO:0000940 | condensed chromosome outer kinetochore(GO:0000940) |
0.0 | 0.2 | GO:0070461 | SAGA-type complex(GO:0070461) |
0.0 | 0.0 | GO:0031228 | intrinsic component of Golgi membrane(GO:0031228) |
0.0 | 0.1 | GO:0044666 | MLL3/4 complex(GO:0044666) |
0.0 | 1.0 | GO:0032587 | ruffle membrane(GO:0032587) |
0.0 | 0.1 | GO:0030870 | Mre11 complex(GO:0030870) |
0.0 | 1.0 | GO:0005643 | nuclear pore(GO:0005643) |
0.0 | 25.4 | GO:0005783 | endoplasmic reticulum(GO:0005783) |
0.0 | 1.6 | GO:0016607 | nuclear speck(GO:0016607) |
0.0 | 0.5 | GO:0005865 | striated muscle thin filament(GO:0005865) |
0.0 | 0.2 | GO:0016272 | prefoldin complex(GO:0016272) |
0.0 | 1.1 | GO:0036126 | sperm flagellum(GO:0036126) |
0.0 | 1.1 | GO:0005881 | cytoplasmic microtubule(GO:0005881) |
0.0 | 0.8 | GO:0005637 | nuclear inner membrane(GO:0005637) |
0.0 | 6.9 | GO:0005578 | proteinaceous extracellular matrix(GO:0005578) |
0.0 | 0.3 | GO:0005736 | DNA-directed RNA polymerase I complex(GO:0005736) |
0.0 | 0.3 | GO:0043196 | varicosity(GO:0043196) |
0.0 | 1.0 | GO:0001533 | cornified envelope(GO:0001533) |
0.0 | 0.1 | GO:0032983 | kainate selective glutamate receptor complex(GO:0032983) |
0.0 | 0.0 | GO:0042175 | nuclear outer membrane-endoplasmic reticulum membrane network(GO:0042175) |
0.0 | 0.2 | GO:0032039 | integrator complex(GO:0032039) |
0.0 | 0.0 | GO:0033263 | CORVET complex(GO:0033263) |
0.0 | 0.8 | GO:0015935 | small ribosomal subunit(GO:0015935) |
0.0 | 0.1 | GO:0001891 | phagocytic cup(GO:0001891) |
0.0 | 0.9 | GO:0031012 | extracellular matrix(GO:0031012) |
0.0 | 0.1 | GO:0042622 | photoreceptor outer segment membrane(GO:0042622) |
0.0 | 0.1 | GO:0005641 | nuclear envelope lumen(GO:0005641) |
0.0 | 1.0 | GO:0090575 | RNA polymerase II transcription factor complex(GO:0090575) |
0.0 | 0.0 | GO:0055087 | Ski complex(GO:0055087) |
0.0 | 0.3 | GO:0031901 | early endosome membrane(GO:0031901) |
0.0 | 0.9 | GO:0019005 | SCF ubiquitin ligase complex(GO:0019005) |
0.0 | 0.4 | GO:0032391 | photoreceptor connecting cilium(GO:0032391) |
0.0 | 0.1 | GO:0032982 | myosin filament(GO:0032982) |
0.0 | 0.3 | GO:0000786 | nucleosome(GO:0000786) |
0.0 | 0.4 | GO:0032040 | small-subunit processome(GO:0032040) |
0.0 | 0.1 | GO:0031931 | TORC1 complex(GO:0031931) |
0.0 | 1.6 | GO:0005882 | intermediate filament(GO:0005882) |
0.0 | 1.2 | GO:0005769 | early endosome(GO:0005769) |
0.0 | 0.1 | GO:0071546 | pi-body(GO:0071546) |
0.0 | 2.6 | GO:0019898 | extrinsic component of membrane(GO:0019898) |
0.0 | 0.1 | GO:1990752 | microtubule end(GO:1990752) |
0.0 | 1.2 | GO:0042579 | peroxisome(GO:0005777) microbody(GO:0042579) |
0.0 | 0.3 | GO:0034451 | centriolar satellite(GO:0034451) |
0.0 | 0.7 | GO:0030016 | myofibril(GO:0030016) |
0.0 | 0.0 | GO:0019815 | B cell receptor complex(GO:0019815) |
0.0 | 0.2 | GO:0043240 | Fanconi anaemia nuclear complex(GO:0043240) |
0.0 | 0.2 | GO:0000176 | nuclear exosome (RNase complex)(GO:0000176) |
0.0 | 0.0 | GO:0030670 | phagocytic vesicle membrane(GO:0030670) |
0.0 | 0.1 | GO:0034448 | EGO complex(GO:0034448) Gtr1-Gtr2 GTPase complex(GO:1990131) |
0.0 | 0.0 | GO:0000800 | lateral element(GO:0000800) |
0.0 | 2.6 | GO:0005743 | mitochondrial inner membrane(GO:0005743) |
0.0 | 0.2 | GO:0016591 | DNA-directed RNA polymerase II, holoenzyme(GO:0016591) |
0.0 | 5.9 | GO:0005730 | nucleolus(GO:0005730) |
0.0 | 0.2 | GO:0048786 | presynaptic active zone(GO:0048786) |
0.0 | 0.8 | GO:0005814 | centriole(GO:0005814) |
0.0 | 0.5 | GO:0000932 | cytoplasmic mRNA processing body(GO:0000932) |
0.0 | 0.1 | GO:0036452 | ESCRT complex(GO:0036452) |
0.0 | 0.0 | GO:0042583 | chromaffin granule(GO:0042583) |
0.0 | 0.0 | GO:0035355 | Toll-like receptor 2-Toll-like receptor 6 protein complex(GO:0035355) |
0.0 | 0.0 | GO:0097546 | ciliary base(GO:0097546) |
0.0 | 0.1 | GO:0001518 | voltage-gated sodium channel complex(GO:0001518) |
0.0 | 0.1 | GO:0032839 | dendrite cytoplasm(GO:0032839) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
1.4 | 4.3 | GO:0016743 | carboxyl- or carbamoyltransferase activity(GO:0016743) |
1.3 | 3.9 | GO:0005006 | epidermal growth factor-activated receptor activity(GO:0005006) |
1.1 | 3.3 | GO:0004024 | alcohol dehydrogenase activity, zinc-dependent(GO:0004024) |
1.1 | 3.2 | GO:0004771 | sterol esterase activity(GO:0004771) |
1.0 | 4.0 | GO:0032896 | palmitoyl-CoA 9-desaturase activity(GO:0032896) |
0.9 | 2.8 | GO:0070538 | oleic acid binding(GO:0070538) |
0.9 | 1.8 | GO:0038181 | bile acid receptor activity(GO:0038181) |
0.9 | 2.6 | GO:0070644 | vitamin D response element binding(GO:0070644) |
0.7 | 4.4 | GO:0047760 | butyrate-CoA ligase activity(GO:0047760) |
0.7 | 1.5 | GO:0043125 | ErbB-3 class receptor binding(GO:0043125) |
0.7 | 2.1 | GO:0005220 | inositol 1,4,5-trisphosphate-sensitive calcium-release channel activity(GO:0005220) |
0.6 | 1.8 | GO:0030620 | U2 snRNA binding(GO:0030620) |
0.6 | 5.5 | GO:0004499 | N,N-dimethylaniline monooxygenase activity(GO:0004499) |
0.6 | 1.8 | GO:0004366 | glycerol-3-phosphate O-acyltransferase activity(GO:0004366) |
0.6 | 2.9 | GO:0004769 | steroid delta-isomerase activity(GO:0004769) |
0.6 | 1.1 | GO:0004768 | stearoyl-CoA 9-desaturase activity(GO:0004768) |
0.6 | 1.7 | GO:0004937 | alpha1-adrenergic receptor activity(GO:0004937) |
0.6 | 2.2 | GO:0071614 | linoleic acid epoxygenase activity(GO:0071614) |
0.5 | 2.0 | GO:0032564 | dATP binding(GO:0032564) |
0.5 | 1.5 | GO:0030519 | snoRNP binding(GO:0030519) |
0.4 | 1.3 | GO:0047045 | testosterone 17-beta-dehydrogenase (NADP+) activity(GO:0047045) |
0.4 | 0.4 | GO:0030792 | methylarsonite methyltransferase activity(GO:0030792) |
0.4 | 0.4 | GO:0018423 | protein C-terminal leucine carboxyl O-methyltransferase activity(GO:0018423) |
0.4 | 1.6 | GO:0016899 | oxidoreductase activity, acting on the CH-OH group of donors, oxygen as acceptor(GO:0016899) |
0.4 | 1.6 | GO:0034056 | estrogen response element binding(GO:0034056) |
0.4 | 1.2 | GO:0001075 | transcription factor activity, RNA polymerase II core promoter sequence-specific binding involved in preinitiation complex assembly(GO:0001075) |
0.4 | 4.2 | GO:0004312 | fatty acid synthase activity(GO:0004312) |
0.4 | 1.5 | GO:0015173 | aromatic amino acid transmembrane transporter activity(GO:0015173) |
0.4 | 1.1 | GO:0047961 | glycine N-acyltransferase activity(GO:0047961) |
0.4 | 2.2 | GO:0016151 | nickel cation binding(GO:0016151) |
0.3 | 1.0 | GO:0018479 | benzaldehyde dehydrogenase (NAD+) activity(GO:0018479) |
0.3 | 2.6 | GO:0102391 | decanoate--CoA ligase activity(GO:0102391) |
0.3 | 1.3 | GO:0017150 | tRNA dihydrouridine synthase activity(GO:0017150) |
0.3 | 4.2 | GO:0015643 | toxic substance binding(GO:0015643) |
0.3 | 1.0 | GO:0016842 | amidine-lyase activity(GO:0016842) |
0.3 | 0.9 | GO:0001069 | regulatory region RNA binding(GO:0001069) |
0.3 | 0.9 | GO:0031686 | A1 adenosine receptor binding(GO:0031686) |
0.3 | 1.2 | GO:0009374 | biotin binding(GO:0009374) |
0.3 | 2.1 | GO:0003836 | beta-galactoside (CMP) alpha-2,3-sialyltransferase activity(GO:0003836) |
0.3 | 0.9 | GO:0008142 | oxysterol binding(GO:0008142) |
0.3 | 0.9 | GO:0035663 | Toll-like receptor 2 binding(GO:0035663) |
0.3 | 2.0 | GO:0005167 | neurotrophin TRK receptor binding(GO:0005167) |
0.3 | 0.9 | GO:0008384 | IkappaB kinase activity(GO:0008384) |
0.3 | 1.2 | GO:1990239 | steroid hormone binding(GO:1990239) |
0.3 | 3.1 | GO:0008195 | phosphatidate phosphatase activity(GO:0008195) |
0.3 | 0.8 | GO:0032190 | acrosin binding(GO:0032190) |
0.3 | 2.0 | GO:0004908 | interleukin-1 receptor activity(GO:0004908) |
0.3 | 0.3 | GO:0030911 | TPR domain binding(GO:0030911) |
0.3 | 1.4 | GO:0070728 | leucine binding(GO:0070728) |
0.3 | 0.8 | GO:0016649 | electron-transferring-flavoprotein dehydrogenase activity(GO:0004174) oxidoreductase activity, acting on the CH-NH group of donors, quinone or similar compound as acceptor(GO:0016649) |
0.3 | 1.6 | GO:0034875 | oxidoreductase activity, acting on CH or CH2 groups, quinone or similar compound as acceptor(GO:0033695) caffeine oxidase activity(GO:0034875) |
0.3 | 1.0 | GO:0017176 | phosphatidylinositol N-acetylglucosaminyltransferase activity(GO:0017176) |
0.3 | 1.0 | GO:0015183 | L-aspartate transmembrane transporter activity(GO:0015183) |
0.3 | 0.8 | GO:0010484 | H3 histone acetyltransferase activity(GO:0010484) |
0.3 | 1.3 | GO:0004331 | fructose-2,6-bisphosphate 2-phosphatase activity(GO:0004331) |
0.2 | 1.0 | GO:0016361 | activin receptor activity, type I(GO:0016361) |
0.2 | 1.2 | GO:1990380 | Lys48-specific deubiquitinase activity(GO:1990380) |
0.2 | 0.7 | GO:0004616 | phosphogluconate dehydrogenase (decarboxylating) activity(GO:0004616) |
0.2 | 1.0 | GO:0016286 | small conductance calcium-activated potassium channel activity(GO:0016286) |
0.2 | 1.2 | GO:0003854 | 3-beta-hydroxy-delta5-steroid dehydrogenase activity(GO:0003854) |
0.2 | 3.6 | GO:0005545 | 1-phosphatidylinositol binding(GO:0005545) |
0.2 | 0.7 | GO:0003986 | acetyl-CoA hydrolase activity(GO:0003986) |
0.2 | 0.2 | GO:0004090 | carbonyl reductase (NADPH) activity(GO:0004090) |
0.2 | 0.9 | GO:0019145 | aminobutyraldehyde dehydrogenase activity(GO:0019145) 4-trimethylammoniobutyraldehyde dehydrogenase activity(GO:0047105) |
0.2 | 0.9 | GO:0070546 | L-phenylalanine aminotransferase activity(GO:0070546) |
0.2 | 0.7 | GO:0004351 | glutamate decarboxylase activity(GO:0004351) |
0.2 | 1.1 | GO:0017040 | ceramidase activity(GO:0017040) |
0.2 | 0.9 | GO:0000340 | RNA 7-methylguanosine cap binding(GO:0000340) |
0.2 | 0.9 | GO:0016174 | NAD(P)H oxidase activity(GO:0016174) |
0.2 | 1.6 | GO:0004738 | pyruvate dehydrogenase activity(GO:0004738) pyruvate dehydrogenase [NAD(P)+] activity(GO:0034603) pyruvate dehydrogenase (NAD+) activity(GO:0034604) |
0.2 | 0.7 | GO:0016532 | superoxide dismutase copper chaperone activity(GO:0016532) |
0.2 | 0.7 | GO:0008597 | calcium-dependent protein serine/threonine phosphatase regulator activity(GO:0008597) |
0.2 | 0.2 | GO:0015927 | trehalase activity(GO:0015927) |
0.2 | 0.9 | GO:0004062 | aryl sulfotransferase activity(GO:0004062) |
0.2 | 0.8 | GO:0016717 | oxidoreductase activity, acting on paired donors, with oxidation of a pair of donors resulting in the reduction of molecular oxygen to two molecules of water(GO:0016717) |
0.2 | 1.1 | GO:0015216 | adenine nucleotide transmembrane transporter activity(GO:0000295) purine ribonucleotide transmembrane transporter activity(GO:0005346) purine nucleotide transmembrane transporter activity(GO:0015216) |
0.2 | 1.6 | GO:0004571 | mannosyl-oligosaccharide 1,2-alpha-mannosidase activity(GO:0004571) |
0.2 | 0.8 | GO:0008486 | diphosphoinositol-polyphosphate diphosphatase activity(GO:0008486) |
0.2 | 1.8 | GO:0001162 | RNA polymerase II intronic transcription regulatory region sequence-specific DNA binding(GO:0001162) |
0.2 | 6.6 | GO:0052767 | prenylcysteine methylesterase activity(GO:0010296) 1-oxa-2-oxocycloheptane lactonase activity(GO:0018731) sulfolactone hydrolase activity(GO:0018732) butyrolactone hydrolase activity(GO:0018734) endosulfan lactone lactonase activity(GO:0034892) L-ascorbate 6-phosphate lactonase activity(GO:0035460) Ser-tRNA(Thr) hydrolase activity(GO:0043905) Ala-tRNA(Pro) hydrolase activity(GO:0043906) Cys-tRNA(Pro) hydrolase activity(GO:0043907) Ser(Gly)-tRNA(Ala) hydrolase activity(GO:0043908) all-trans-retinyl-palmitate hydrolase, all-trans-retinol forming activity(GO:0047376) mannosyl-oligosaccharide 1,6-alpha-mannosidase activity(GO:0052767) mannosyl-oligosaccharide 1,3-alpha-mannosidase activity(GO:0052768) methyl indole-3-acetate esterase activity(GO:0080030) methyl salicylate esterase activity(GO:0080031) methyl jasmonate esterase activity(GO:0080032) |
0.2 | 0.2 | GO:0016426 | tRNA (adenine) methyltransferase activity(GO:0016426) tRNA (adenine-N1-)-methyltransferase activity(GO:0016429) |
0.2 | 1.2 | GO:0003997 | acyl-CoA oxidase activity(GO:0003997) |
0.2 | 1.2 | GO:0005127 | ciliary neurotrophic factor receptor binding(GO:0005127) |
0.2 | 1.8 | GO:0002162 | dystroglycan binding(GO:0002162) |
0.2 | 1.0 | GO:0051525 | NFAT protein binding(GO:0051525) |
0.2 | 0.6 | GO:0016716 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, another compound as one donor, and incorporation of one atom of oxygen(GO:0016716) |
0.2 | 1.0 | GO:0035033 | histone deacetylase regulator activity(GO:0035033) |
0.2 | 0.6 | GO:1990825 | sequence-specific mRNA binding(GO:1990825) |
0.2 | 0.6 | GO:0004505 | phenylalanine 4-monooxygenase activity(GO:0004505) |
0.2 | 0.6 | GO:0000033 | alpha-1,3-mannosyltransferase activity(GO:0000033) |
0.2 | 0.9 | GO:0015165 | pyrimidine nucleotide-sugar transmembrane transporter activity(GO:0015165) |
0.2 | 3.5 | GO:0003950 | NAD+ ADP-ribosyltransferase activity(GO:0003950) |
0.2 | 1.1 | GO:0005381 | iron ion transmembrane transporter activity(GO:0005381) |
0.2 | 0.7 | GO:0003917 | DNA topoisomerase type I activity(GO:0003917) |
0.2 | 0.4 | GO:0000026 | alpha-1,2-mannosyltransferase activity(GO:0000026) |
0.2 | 0.5 | GO:0016647 | oxidoreductase activity, acting on the CH-NH group of donors, oxygen as acceptor(GO:0016647) |
0.2 | 0.4 | GO:0042030 | ATPase inhibitor activity(GO:0042030) |
0.2 | 0.7 | GO:0004035 | alkaline phosphatase activity(GO:0004035) |
0.2 | 0.9 | GO:0003828 | alpha-N-acetylneuraminate alpha-2,8-sialyltransferase activity(GO:0003828) |
0.2 | 0.7 | GO:0005047 | signal recognition particle binding(GO:0005047) |
0.2 | 0.5 | GO:0004802 | transketolase activity(GO:0004802) |
0.2 | 0.5 | GO:0016838 | carbon-oxygen lyase activity, acting on phosphates(GO:0016838) |
0.2 | 0.5 | GO:0005131 | growth hormone receptor binding(GO:0005131) |
0.2 | 4.3 | GO:0052713 | calmodulin-dependent cyclic-nucleotide phosphodiesterase activity(GO:0004117) cGMP-stimulated cyclic-nucleotide phosphodiesterase activity(GO:0004118) cGMP-inhibited cyclic-nucleotide phosphodiesterase activity(GO:0004119) photoreceptor cyclic-nucleotide phosphodiesterase activity(GO:0004120) 7,8-dihydro-D-neopterin 2',3'-cyclic phosphate phosphodiesterase activity(GO:0044688) inositol phosphosphingolipid phospholipase activity(GO:0052712) inositol phosphorylceramide phospholipase activity(GO:0052713) mannosyl-inositol phosphorylceramide phospholipase activity(GO:0052714) mannosyl-diinositol phosphorylceramide phospholipase activity(GO:0052715) |
0.2 | 0.5 | GO:0033829 | O-fucosylpeptide 3-beta-N-acetylglucosaminyltransferase activity(GO:0033829) |
0.2 | 0.8 | GO:0003847 | 1-alkyl-2-acetylglycerophosphocholine esterase activity(GO:0003847) |
0.2 | 0.5 | GO:0045504 | dynein heavy chain binding(GO:0045504) |
0.2 | 0.5 | GO:0004096 | catalase activity(GO:0004096) |
0.2 | 1.8 | GO:0004535 | poly(A)-specific ribonuclease activity(GO:0004535) |
0.2 | 0.8 | GO:0004396 | glucokinase activity(GO:0004340) hexokinase activity(GO:0004396) |
0.2 | 0.5 | GO:0004793 | threonine aldolase activity(GO:0004793) L-allo-threonine aldolase activity(GO:0008732) |
0.2 | 0.5 | GO:0031826 | type 2A serotonin receptor binding(GO:0031826) |
0.2 | 0.8 | GO:0071253 | connexin binding(GO:0071253) |
0.2 | 0.2 | GO:0016508 | long-chain-enoyl-CoA hydratase activity(GO:0016508) |
0.2 | 1.2 | GO:0004534 | 5'-3' exoribonuclease activity(GO:0004534) |
0.2 | 0.5 | GO:0030297 | transmembrane receptor protein tyrosine kinase activator activity(GO:0030297) |
0.2 | 1.7 | GO:0030898 | actin-dependent ATPase activity(GO:0030898) |
0.2 | 0.5 | GO:0019862 | IgA binding(GO:0019862) |
0.2 | 0.9 | GO:0004064 | arylesterase activity(GO:0004064) |
0.2 | 5.3 | GO:0016748 | succinyltransferase activity(GO:0016748) |
0.1 | 0.9 | GO:0005049 | nuclear export signal receptor activity(GO:0005049) |
0.1 | 0.4 | GO:0097200 | cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:0097200) |
0.1 | 0.9 | GO:0004311 | farnesyltranstransferase activity(GO:0004311) |
0.1 | 0.4 | GO:0035529 | NADH pyrophosphatase activity(GO:0035529) |
0.1 | 0.4 | GO:0030160 | GKAP/Homer scaffold activity(GO:0030160) |
0.1 | 0.6 | GO:0004656 | procollagen-proline 4-dioxygenase activity(GO:0004656) |
0.1 | 0.4 | GO:0071532 | ankyrin repeat binding(GO:0071532) |
0.1 | 0.4 | GO:0098821 | BMP receptor activity(GO:0098821) |
0.1 | 0.4 | GO:0016715 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, reduced ascorbate as one donor, and incorporation of one atom of oxygen(GO:0016715) |
0.1 | 2.3 | GO:0019206 | nucleoside kinase activity(GO:0019206) |
0.1 | 0.5 | GO:0015252 | hydrogen ion channel activity(GO:0015252) |
0.1 | 1.3 | GO:0044466 | 2-oxoglutaryl-CoA thioesterase activity(GO:0034843) 2,4,4-trimethyl-3-oxopentanoyl-CoA thioesterase activity(GO:0034869) 3-isopropylbut-3-enoyl-CoA thioesterase activity(GO:0034946) glutaryl-CoA hydrolase activity(GO:0044466) |
0.1 | 0.5 | GO:0070326 | very-low-density lipoprotein particle receptor binding(GO:0070326) |
0.1 | 0.4 | GO:0003985 | acetyl-CoA C-acetyltransferase activity(GO:0003985) C-acetyltransferase activity(GO:0016453) |
0.1 | 0.8 | GO:1990247 | N6-methyladenosine-containing RNA binding(GO:1990247) |
0.1 | 0.4 | GO:0043398 | HLH domain binding(GO:0043398) |
0.1 | 0.5 | GO:0004127 | cytidylate kinase activity(GO:0004127) |
0.1 | 0.1 | GO:0051723 | protein methylesterase activity(GO:0051723) |
0.1 | 0.4 | GO:0048273 | mitogen-activated protein kinase p38 binding(GO:0048273) |
0.1 | 0.5 | GO:0097371 | MDM2/MDM4 family protein binding(GO:0097371) |
0.1 | 2.4 | GO:0016645 | oxidoreductase activity, acting on the CH-NH group of donors(GO:0016645) |
0.1 | 0.4 | GO:0070699 | type II activin receptor binding(GO:0070699) |
0.1 | 3.8 | GO:0051059 | NF-kappaB binding(GO:0051059) |
0.1 | 0.5 | GO:0004045 | aminoacyl-tRNA hydrolase activity(GO:0004045) |
0.1 | 0.5 | GO:0071074 | eukaryotic initiation factor eIF2 binding(GO:0071074) |
0.1 | 1.1 | GO:0008190 | eukaryotic initiation factor 4E binding(GO:0008190) |
0.1 | 1.1 | GO:0043522 | leucine zipper domain binding(GO:0043522) |
0.1 | 0.6 | GO:0050072 | m7G(5')pppN diphosphatase activity(GO:0050072) |
0.1 | 0.4 | GO:0071987 | WD40-repeat domain binding(GO:0071987) |
0.1 | 1.3 | GO:0005161 | platelet-derived growth factor receptor binding(GO:0005161) |
0.1 | 0.4 | GO:0003976 | UDP-N-acetylglucosamine-lysosomal-enzyme N-acetylglucosaminephosphotransferase activity(GO:0003976) |
0.1 | 0.8 | GO:0004679 | AMP-activated protein kinase activity(GO:0004679) |
0.1 | 1.3 | GO:0051787 | misfolded protein binding(GO:0051787) |
0.1 | 0.9 | GO:0042171 | lysophosphatidic acid acyltransferase activity(GO:0042171) |
0.1 | 0.3 | GO:0035877 | death effector domain binding(GO:0035877) |
0.1 | 0.9 | GO:0043560 | insulin receptor substrate binding(GO:0043560) |
0.1 | 0.7 | GO:0016681 | ubiquinol-cytochrome-c reductase activity(GO:0008121) oxidoreductase activity, acting on diphenols and related substances as donors, cytochrome as acceptor(GO:0016681) |
0.1 | 0.6 | GO:0008318 | protein prenyltransferase activity(GO:0008318) |
0.1 | 0.2 | GO:0005146 | leukemia inhibitory factor receptor binding(GO:0005146) |
0.1 | 0.4 | GO:0001602 | pancreatic polypeptide receptor activity(GO:0001602) |
0.1 | 0.3 | GO:0019961 | interferon binding(GO:0019961) |
0.1 | 0.6 | GO:0004668 | protein-arginine deiminase activity(GO:0004668) |
0.1 | 0.6 | GO:0004689 | phosphorylase kinase activity(GO:0004689) |
0.1 | 1.6 | GO:0015095 | magnesium ion transmembrane transporter activity(GO:0015095) |
0.1 | 0.4 | GO:0016018 | cyclosporin A binding(GO:0016018) |
0.1 | 0.2 | GO:0004677 | DNA-dependent protein kinase activity(GO:0004677) |
0.1 | 1.2 | GO:0070402 | NADPH binding(GO:0070402) |
0.1 | 2.4 | GO:0003954 | NADH dehydrogenase activity(GO:0003954) |
0.1 | 0.3 | GO:0016802 | adenosylhomocysteinase activity(GO:0004013) trialkylsulfonium hydrolase activity(GO:0016802) |
0.1 | 0.4 | GO:0004784 | superoxide dismutase activity(GO:0004784) oxidoreductase activity, acting on superoxide radicals as acceptor(GO:0016721) |
0.1 | 0.2 | GO:0036137 | kynurenine-oxoglutarate transaminase activity(GO:0016212) kynurenine aminotransferase activity(GO:0036137) |
0.1 | 0.3 | GO:0004833 | tryptophan 2,3-dioxygenase activity(GO:0004833) |
0.1 | 0.1 | GO:0018685 | alkane 1-monooxygenase activity(GO:0018685) |
0.1 | 0.4 | GO:0061665 | SUMO ligase activity(GO:0061665) |
0.1 | 0.8 | GO:0046790 | virion binding(GO:0046790) |
0.1 | 1.3 | GO:0015279 | store-operated calcium channel activity(GO:0015279) |
0.1 | 0.9 | GO:0001223 | transcription coactivator binding(GO:0001223) |
0.1 | 0.5 | GO:0000146 | microfilament motor activity(GO:0000146) |
0.1 | 0.5 | GO:0000832 | inositol hexakisphosphate kinase activity(GO:0000828) inositol hexakisphosphate 5-kinase activity(GO:0000832) inositol hexakisphosphate 1-kinase activity(GO:0052723) inositol hexakisphosphate 3-kinase activity(GO:0052724) |
0.1 | 0.4 | GO:0052851 | cupric reductase activity(GO:0008823) ferric-chelate reductase (NADPH) activity(GO:0052851) |
0.1 | 1.8 | GO:0004708 | MAP kinase kinase activity(GO:0004708) |
0.1 | 0.5 | GO:0016655 | oxidoreductase activity, acting on NAD(P)H, quinone or similar compound as acceptor(GO:0016655) |
0.1 | 0.4 | GO:0097001 | ceramide binding(GO:0097001) |
0.1 | 0.4 | GO:0034236 | protein kinase A catalytic subunit binding(GO:0034236) |
0.1 | 0.4 | GO:0051864 | histone demethylase activity (H3-K36 specific)(GO:0051864) |
0.1 | 0.2 | GO:0097016 | L27 domain binding(GO:0097016) |
0.1 | 1.8 | GO:0016709 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, NAD(P)H as one donor, and incorporation of one atom of oxygen(GO:0016709) |
0.1 | 0.4 | GO:0004887 | thyroid hormone receptor activity(GO:0004887) |
0.1 | 3.0 | GO:0042169 | SH2 domain binding(GO:0042169) |
0.1 | 1.0 | GO:0016888 | endodeoxyribonuclease activity, producing 5'-phosphomonoesters(GO:0016888) |
0.1 | 0.5 | GO:0045182 | translation regulator activity(GO:0045182) |
0.1 | 0.3 | GO:0050508 | glucuronosyl-N-acetylglucosaminyl-proteoglycan 4-alpha-N-acetylglucosaminyltransferase activity(GO:0050508) |
0.1 | 0.7 | GO:0050291 | sphingosine N-acyltransferase activity(GO:0050291) |
0.1 | 1.1 | GO:0005159 | insulin-like growth factor receptor binding(GO:0005159) |
0.1 | 0.3 | GO:0061731 | ribonucleoside-diphosphate reductase activity, thioredoxin disulfide as acceptor(GO:0004748) oxidoreductase activity, acting on CH or CH2 groups, disulfide as acceptor(GO:0016728) ribonucleoside-diphosphate reductase activity(GO:0061731) |
0.1 | 0.2 | GO:0016530 | metallochaperone activity(GO:0016530) |
0.1 | 0.3 | GO:0004566 | beta-glucuronidase activity(GO:0004566) |
0.1 | 0.6 | GO:0036402 | proteasome-activating ATPase activity(GO:0036402) |
0.1 | 0.3 | GO:0035939 | microsatellite binding(GO:0035939) |
0.1 | 1.5 | GO:0030552 | cAMP binding(GO:0030552) |
0.1 | 0.3 | GO:0055131 | C3HC4-type RING finger domain binding(GO:0055131) |
0.1 | 0.3 | GO:0031802 | type 5 metabotropic glutamate receptor binding(GO:0031802) |
0.1 | 1.3 | GO:0016289 | CoA hydrolase activity(GO:0016289) |
0.1 | 0.4 | GO:0008948 | oxaloacetate decarboxylase activity(GO:0008948) |
0.1 | 0.4 | GO:0004614 | phosphoglucomutase activity(GO:0004614) |
0.1 | 0.4 | GO:0017034 | Rap guanyl-nucleotide exchange factor activity(GO:0017034) |
0.1 | 0.2 | GO:0003988 | acetyl-CoA C-acyltransferase activity(GO:0003988) |
0.1 | 0.7 | GO:0008376 | acetylgalactosaminyltransferase activity(GO:0008376) |
0.1 | 0.4 | GO:0004165 | dodecenoyl-CoA delta-isomerase activity(GO:0004165) |
0.1 | 0.6 | GO:0005078 | MAP-kinase scaffold activity(GO:0005078) |
0.1 | 0.2 | GO:0070573 | metallodipeptidase activity(GO:0070573) |
0.1 | 0.3 | GO:0018589 | fluorene oxygenase activity(GO:0018585) mono-butyltin dioxygenase activity(GO:0018586) tri-n-butyltin dioxygenase activity(GO:0018588) di-n-butyltin dioxygenase activity(GO:0018589) methylsilanetriol hydroxylase activity(GO:0018590) methyl tertiary butyl ether 3-monooxygenase activity(GO:0018591) 4-nitrocatechol 4-monooxygenase activity(GO:0018592) 4-chlorophenoxyacetate monooxygenase activity(GO:0018593) tert-butanol 2-monooxygenase activity(GO:0018594) alpha-pinene monooxygenase activity(GO:0018595) dimethylsilanediol hydroxylase activity(GO:0018596) ammonia monooxygenase activity(GO:0018597) hydroxymethylsilanetriol oxidase activity(GO:0018598) 2-hydroxyisobutyrate 3-monooxygenase activity(GO:0018599) alpha-pinene dehydrogenase activity(GO:0018600) bisphenol A hydroxylase B activity(GO:0034559) 2,2-bis(4-hydroxyphenyl)-1-propanol hydroxylase activity(GO:0034562) 9-fluorenone-3,4-dioxygenase activity(GO:0034786) anthracene 9,10-dioxygenase activity(GO:0034816) 2-(methylthio)benzothiazole monooxygenase activity(GO:0034857) 2-hydroxybenzothiazole monooxygenase activity(GO:0034858) benzothiazole monooxygenase activity(GO:0034859) 2,6-dihydroxybenzothiazole monooxygenase activity(GO:0034862) pinacolone 5-monooxygenase activity(GO:0034870) thioacetamide S-oxygenase activity(GO:0034873) thioacetamide S-oxide S-oxygenase activity(GO:0034874) endosulfan monooxygenase I activity(GO:0034888) N-nitrodimethylamine hydroxylase activity(GO:0034893) 4-(1-ethyl-1,4-dimethyl-pentyl)phenol monoxygenase activity(GO:0034897) endosulfan ether monooxygenase activity(GO:0034903) pyrene 4,5-monooxygenase activity(GO:0034925) pyrene 1,2-monooxygenase activity(GO:0034927) 1-hydroxypyrene 6,7-monooxygenase activity(GO:0034928) 1-hydroxypyrene 7,8-monooxygenase activity(GO:0034929) phenylboronic acid monooxygenase activity(GO:0034950) spheroidene monooxygenase activity(GO:0043823) |
0.1 | 0.6 | GO:0008097 | 5S rRNA binding(GO:0008097) |
0.1 | 0.4 | GO:0004112 | cyclic-nucleotide phosphodiesterase activity(GO:0004112) |
0.1 | 0.3 | GO:0097109 | neuroligin family protein binding(GO:0097109) |
0.1 | 0.3 | GO:0035312 | 5'-3' exodeoxyribonuclease activity(GO:0035312) |
0.1 | 0.3 | GO:0003956 | NAD(P)+-protein-arginine ADP-ribosyltransferase activity(GO:0003956) |
0.1 | 1.3 | GO:0008307 | structural constituent of muscle(GO:0008307) |
0.1 | 1.1 | GO:0050811 | GABA receptor binding(GO:0050811) |
0.1 | 0.3 | GO:0031782 | melanocortin receptor binding(GO:0031779) type 3 melanocortin receptor binding(GO:0031781) type 4 melanocortin receptor binding(GO:0031782) |
0.1 | 0.3 | GO:0034191 | apolipoprotein A-I receptor binding(GO:0034191) |
0.1 | 0.3 | GO:0030628 | pre-mRNA 3'-splice site binding(GO:0030628) |
0.1 | 0.6 | GO:0008429 | phosphatidylethanolamine binding(GO:0008429) |
0.1 | 0.3 | GO:0043426 | MRF binding(GO:0043426) |
0.1 | 0.1 | GO:0030235 | nitric-oxide synthase regulator activity(GO:0030235) |
0.1 | 0.3 | GO:0016411 | acylglycerol O-acyltransferase activity(GO:0016411) |
0.1 | 3.6 | GO:0061733 | peptide-lysine-N-acetyltransferase activity(GO:0061733) |
0.1 | 1.2 | GO:0004653 | polypeptide N-acetylgalactosaminyltransferase activity(GO:0004653) |
0.1 | 0.3 | GO:1990405 | protein antigen binding(GO:1990405) |
0.1 | 0.6 | GO:0016832 | aldehyde-lyase activity(GO:0016832) |
0.1 | 0.2 | GO:0035671 | enone reductase activity(GO:0035671) |
0.1 | 0.3 | GO:0015220 | choline transmembrane transporter activity(GO:0015220) |
0.1 | 0.1 | GO:0034618 | arginine binding(GO:0034618) |
0.1 | 0.2 | GO:0004691 | cAMP-dependent protein kinase activity(GO:0004691) |
0.1 | 0.6 | GO:0032036 | myosin heavy chain binding(GO:0032036) |
0.1 | 0.6 | GO:0045545 | syndecan binding(GO:0045545) |
0.1 | 0.2 | GO:0034186 | apolipoprotein A-I binding(GO:0034186) |
0.1 | 0.5 | GO:0030368 | interleukin-17 receptor activity(GO:0030368) |
0.1 | 0.2 | GO:0008158 | hedgehog receptor activity(GO:0008158) |
0.1 | 0.1 | GO:0000009 | alpha-1,6-mannosyltransferase activity(GO:0000009) |
0.1 | 0.2 | GO:0038100 | nodal binding(GO:0038100) |
0.1 | 0.8 | GO:0070410 | co-SMAD binding(GO:0070410) |
0.1 | 1.5 | GO:0003785 | actin monomer binding(GO:0003785) |
0.1 | 0.3 | GO:0042979 | ornithine decarboxylase regulator activity(GO:0042979) |
0.1 | 0.3 | GO:0004308 | exo-alpha-sialidase activity(GO:0004308) alpha-sialidase activity(GO:0016997) exo-alpha-(2->3)-sialidase activity(GO:0052794) exo-alpha-(2->6)-sialidase activity(GO:0052795) exo-alpha-(2->8)-sialidase activity(GO:0052796) |
0.1 | 0.5 | GO:0035325 | Toll-like receptor binding(GO:0035325) |
0.1 | 0.2 | GO:0003829 | beta-1,3-galactosyl-O-glycosyl-glycoprotein beta-1,6-N-acetylglucosaminyltransferase activity(GO:0003829) |
0.1 | 0.5 | GO:0001640 | adenylate cyclase inhibiting G-protein coupled glutamate receptor activity(GO:0001640) |
0.1 | 0.2 | GO:0060228 | phosphatidylcholine-sterol O-acyltransferase activator activity(GO:0060228) |
0.1 | 0.3 | GO:0000104 | succinate dehydrogenase activity(GO:0000104) |
0.1 | 0.3 | GO:0004060 | arylamine N-acetyltransferase activity(GO:0004060) |
0.1 | 0.2 | GO:0035515 | oxidative RNA demethylase activity(GO:0035515) |
0.1 | 1.5 | GO:0043014 | alpha-tubulin binding(GO:0043014) |
0.1 | 0.5 | GO:0008508 | bile acid:sodium symporter activity(GO:0008508) |
0.1 | 0.2 | GO:0031730 | CCR5 chemokine receptor binding(GO:0031730) |
0.1 | 1.2 | GO:0017128 | phospholipid scramblase activity(GO:0017128) |
0.1 | 0.3 | GO:0004726 | non-membrane spanning protein tyrosine phosphatase activity(GO:0004726) |
0.1 | 0.7 | GO:0008093 | cytoskeletal adaptor activity(GO:0008093) |
0.1 | 0.4 | GO:0004859 | phospholipase inhibitor activity(GO:0004859) |
0.1 | 1.4 | GO:0003756 | protein disulfide isomerase activity(GO:0003756) intramolecular oxidoreductase activity, transposing S-S bonds(GO:0016864) |
0.1 | 0.5 | GO:0005172 | vascular endothelial growth factor receptor binding(GO:0005172) |
0.1 | 0.3 | GO:0034235 | GPI anchor binding(GO:0034235) |
0.1 | 0.2 | GO:0005087 | Ran guanyl-nucleotide exchange factor activity(GO:0005087) |
0.1 | 0.5 | GO:0030306 | ADP-ribosylation factor binding(GO:0030306) |
0.1 | 1.7 | GO:0016763 | transferase activity, transferring pentosyl groups(GO:0016763) |
0.1 | 2.2 | GO:0061650 | ubiquitin conjugating enzyme activity(GO:0061631) ubiquitin-like protein conjugating enzyme activity(GO:0061650) |
0.1 | 0.7 | GO:0070403 | NAD+ binding(GO:0070403) |
0.1 | 0.6 | GO:0016595 | glutamate binding(GO:0016595) |
0.1 | 0.1 | GO:0033142 | progesterone receptor binding(GO:0033142) |
0.1 | 0.4 | GO:0030275 | LRR domain binding(GO:0030275) |
0.1 | 1.1 | GO:0070530 | K63-linked polyubiquitin binding(GO:0070530) |
0.1 | 0.9 | GO:0015269 | calcium-activated potassium channel activity(GO:0015269) |
0.1 | 0.4 | GO:0016863 | intramolecular oxidoreductase activity, transposing C=C bonds(GO:0016863) |
0.1 | 0.4 | GO:0005095 | GTPase inhibitor activity(GO:0005095) |
0.1 | 0.6 | GO:0004383 | guanylate cyclase activity(GO:0004383) |
0.1 | 0.9 | GO:0004550 | nucleoside diphosphate kinase activity(GO:0004550) |
0.1 | 0.1 | GO:0004022 | alcohol dehydrogenase (NAD) activity(GO:0004022) |
0.1 | 1.9 | GO:0015347 | sodium-independent organic anion transmembrane transporter activity(GO:0015347) |
0.1 | 0.2 | GO:0047756 | chondroitin 4-sulfotransferase activity(GO:0047756) |
0.1 | 0.1 | GO:0000774 | adenyl-nucleotide exchange factor activity(GO:0000774) |
0.1 | 0.2 | GO:0015211 | purine nucleoside transmembrane transporter activity(GO:0015211) |
0.1 | 0.1 | GO:0008309 | double-stranded DNA exodeoxyribonuclease activity(GO:0008309) |
0.1 | 0.4 | GO:0048185 | activin binding(GO:0048185) |
0.1 | 2.1 | GO:0051539 | 4 iron, 4 sulfur cluster binding(GO:0051539) |
0.1 | 0.8 | GO:0005451 | monovalent cation:proton antiporter activity(GO:0005451) |
0.1 | 0.7 | GO:0008641 | small protein activating enzyme activity(GO:0008641) |
0.1 | 0.3 | GO:0030280 | structural constituent of epidermis(GO:0030280) |
0.1 | 0.1 | GO:0070548 | L-glutamine aminotransferase activity(GO:0070548) |
0.1 | 0.2 | GO:0008379 | thioredoxin peroxidase activity(GO:0008379) |
0.1 | 1.1 | GO:0015923 | mannosidase activity(GO:0015923) |
0.1 | 0.3 | GO:0070087 | chromo shadow domain binding(GO:0070087) |
0.1 | 1.7 | GO:0005104 | fibroblast growth factor receptor binding(GO:0005104) |
0.1 | 0.4 | GO:0050733 | RS domain binding(GO:0050733) |
0.1 | 0.5 | GO:0001094 | TFIID-class transcription factor binding(GO:0001094) |
0.1 | 0.2 | GO:0016509 | long-chain-3-hydroxyacyl-CoA dehydrogenase activity(GO:0016509) |
0.1 | 0.1 | GO:0004416 | hydroxyacylglutathione hydrolase activity(GO:0004416) |
0.1 | 0.8 | GO:0001671 | ATPase activator activity(GO:0001671) |
0.1 | 0.8 | GO:0070300 | phosphatidic acid binding(GO:0070300) |
0.1 | 0.3 | GO:0038064 | collagen receptor activity(GO:0038064) |
0.1 | 0.1 | GO:0016427 | tRNA (cytosine) methyltransferase activity(GO:0016427) tRNA (cytosine-5-)-methyltransferase activity(GO:0016428) |
0.1 | 0.5 | GO:0031434 | mitogen-activated protein kinase kinase binding(GO:0031434) |
0.1 | 2.4 | GO:0005109 | frizzled binding(GO:0005109) |
0.1 | 0.3 | GO:0090599 | alpha-glucosidase activity(GO:0090599) |
0.1 | 0.3 | GO:0004556 | alpha-amylase activity(GO:0004556) |
0.1 | 0.5 | GO:0008430 | selenium binding(GO:0008430) |
0.1 | 0.2 | GO:0004605 | phosphatidate cytidylyltransferase activity(GO:0004605) |
0.1 | 0.2 | GO:0005157 | macrophage colony-stimulating factor receptor binding(GO:0005157) |
0.1 | 0.9 | GO:0005521 | lamin binding(GO:0005521) |
0.1 | 0.3 | GO:0019784 | NEDD8-specific protease activity(GO:0019784) |
0.1 | 1.1 | GO:0004889 | acetylcholine-activated cation-selective channel activity(GO:0004889) |
0.1 | 0.1 | GO:0035197 | siRNA binding(GO:0035197) |
0.1 | 0.7 | GO:0043274 | phospholipase binding(GO:0043274) |
0.1 | 0.2 | GO:0070883 | pre-miRNA binding(GO:0070883) |
0.1 | 0.2 | GO:0047631 | ADP-ribose diphosphatase activity(GO:0047631) |
0.1 | 0.2 | GO:0032051 | clathrin light chain binding(GO:0032051) |
0.1 | 0.8 | GO:0008353 | RNA polymerase II carboxy-terminal domain kinase activity(GO:0008353) |
0.1 | 0.2 | GO:0032137 | guanine/thymine mispair binding(GO:0032137) |
0.1 | 0.7 | GO:0043295 | glutathione binding(GO:0043295) oligopeptide binding(GO:1900750) |
0.1 | 0.2 | GO:1990226 | histone methyltransferase binding(GO:1990226) |
0.1 | 0.4 | GO:0000983 | transcription factor activity, RNA polymerase II core promoter sequence-specific(GO:0000983) |
0.1 | 1.0 | GO:0032794 | GTPase activating protein binding(GO:0032794) |
0.1 | 0.4 | GO:0016783 | sulfurtransferase activity(GO:0016783) |
0.1 | 0.5 | GO:0022889 | L-serine transmembrane transporter activity(GO:0015194) serine transmembrane transporter activity(GO:0022889) |
0.1 | 0.6 | GO:0030955 | potassium ion binding(GO:0030955) |
0.1 | 0.3 | GO:0002151 | G-quadruplex RNA binding(GO:0002151) |
0.1 | 0.2 | GO:0050567 | glutaminyl-tRNA synthase (glutamine-hydrolyzing) activity(GO:0050567) |
0.1 | 0.3 | GO:0008172 | S-methyltransferase activity(GO:0008172) |
0.1 | 0.2 | GO:0017151 | DEAD/H-box RNA helicase binding(GO:0017151) |
0.1 | 0.1 | GO:0003696 | satellite DNA binding(GO:0003696) |
0.1 | 0.1 | GO:0004813 | alanine-tRNA ligase activity(GO:0004813) |
0.1 | 0.1 | GO:0043559 | insulin binding(GO:0043559) |
0.1 | 0.5 | GO:0008568 | microtubule-severing ATPase activity(GO:0008568) |
0.1 | 0.1 | GO:0016744 | transferase activity, transferring aldehyde or ketonic groups(GO:0016744) |
0.1 | 0.6 | GO:0015266 | protein channel activity(GO:0015266) |
0.1 | 0.1 | GO:0070181 | small ribosomal subunit rRNA binding(GO:0070181) |
0.1 | 0.1 | GO:0001099 | basal transcription machinery binding(GO:0001098) basal RNA polymerase II transcription machinery binding(GO:0001099) |
0.1 | 0.8 | GO:0008080 | N-acetyltransferase activity(GO:0008080) |
0.1 | 0.2 | GO:2001069 | glycogen binding(GO:2001069) |
0.1 | 1.7 | GO:0003923 | GPI-anchor transamidase activity(GO:0003923) |
0.1 | 0.2 | GO:0003916 | DNA topoisomerase activity(GO:0003916) DNA topoisomerase type II (ATP-hydrolyzing) activity(GO:0003918) DNA topoisomerase II activity(GO:0061505) |
0.1 | 0.1 | GO:0043533 | inositol 1,3,4,5 tetrakisphosphate binding(GO:0043533) |
0.1 | 0.3 | GO:0004758 | serine C-palmitoyltransferase activity(GO:0004758) |
0.1 | 0.4 | GO:0005123 | death receptor binding(GO:0005123) |
0.1 | 0.2 | GO:0001875 | lipopolysaccharide receptor activity(GO:0001875) |
0.1 | 0.3 | GO:0008467 | [heparan sulfate]-glucosamine 3-sulfotransferase 1 activity(GO:0008467) |
0.1 | 0.1 | GO:0034648 | histone demethylase activity (H3-dimethyl-K4 specific)(GO:0034648) |
0.1 | 0.1 | GO:0005176 | ErbB-2 class receptor binding(GO:0005176) |
0.1 | 0.1 | GO:0008409 | 5'-3' exonuclease activity(GO:0008409) |
0.1 | 0.4 | GO:0070513 | death domain binding(GO:0070513) |
0.1 | 2.1 | GO:0035064 | methylated histone binding(GO:0035064) |
0.1 | 0.1 | GO:0005415 | nucleoside:sodium symporter activity(GO:0005415) |
0.1 | 0.4 | GO:1990381 | ubiquitin-specific protease binding(GO:1990381) |
0.1 | 0.1 | GO:0030229 | very-low-density lipoprotein particle receptor activity(GO:0030229) |
0.1 | 0.2 | GO:0005275 | amine transmembrane transporter activity(GO:0005275) |
0.1 | 0.3 | GO:0017169 | CDP-alcohol phosphatidyltransferase activity(GO:0017169) |
0.1 | 7.6 | GO:0001227 | transcriptional repressor activity, RNA polymerase II transcription regulatory region sequence-specific binding(GO:0001227) |
0.1 | 0.2 | GO:0000182 | rDNA binding(GO:0000182) |
0.1 | 0.6 | GO:0005523 | tropomyosin binding(GO:0005523) |
0.0 | 0.6 | GO:0004089 | carbonate dehydratase activity(GO:0004089) |
0.0 | 0.1 | GO:0005483 | soluble NSF attachment protein activity(GO:0005483) |
0.0 | 0.3 | GO:0005113 | patched binding(GO:0005113) |
0.0 | 0.1 | GO:0070653 | high-density lipoprotein particle receptor binding(GO:0070653) |
0.0 | 0.0 | GO:0008320 | protein transmembrane transporter activity(GO:0008320) |
0.0 | 0.0 | GO:0016408 | C-acyltransferase activity(GO:0016408) |
0.0 | 0.6 | GO:0009982 | pseudouridine synthase activity(GO:0009982) |
0.0 | 0.3 | GO:0044548 | S100 protein binding(GO:0044548) |
0.0 | 1.2 | GO:0043914 | NADPH:sulfur oxidoreductase activity(GO:0043914) |
0.0 | 0.5 | GO:0030371 | translation repressor activity(GO:0030371) |
0.0 | 0.3 | GO:0016868 | intramolecular transferase activity, phosphotransferases(GO:0016868) |
0.0 | 0.4 | GO:0019869 | chloride channel inhibitor activity(GO:0019869) |
0.0 | 0.4 | GO:0042975 | peroxisome proliferator activated receptor binding(GO:0042975) |
0.0 | 0.0 | GO:0035514 | DNA demethylase activity(GO:0035514) |
0.0 | 0.1 | GO:0005094 | Rho GDP-dissociation inhibitor activity(GO:0005094) |
0.0 | 0.9 | GO:0004129 | cytochrome-c oxidase activity(GO:0004129) heme-copper terminal oxidase activity(GO:0015002) oxidoreductase activity, acting on a heme group of donors, oxygen as acceptor(GO:0016676) |
0.0 | 0.1 | GO:0008260 | 3-oxoacid CoA-transferase activity(GO:0008260) |
0.0 | 3.1 | GO:0016300 | tRNA (uracil) methyltransferase activity(GO:0016300) |
0.0 | 0.5 | GO:0000993 | RNA polymerase II core binding(GO:0000993) |
0.0 | 0.2 | GO:0016661 | oxidoreductase activity, acting on other nitrogenous compounds as donors(GO:0016661) |
0.0 | 0.2 | GO:0008599 | protein phosphatase type 1 regulator activity(GO:0008599) |
0.0 | 0.3 | GO:0030274 | LIM domain binding(GO:0030274) |
0.0 | 0.3 | GO:0051011 | microtubule minus-end binding(GO:0051011) |
0.0 | 0.3 | GO:0070097 | delta-catenin binding(GO:0070097) |
0.0 | 0.3 | GO:0005227 | calcium activated cation channel activity(GO:0005227) |
0.0 | 0.9 | GO:0005547 | phosphatidylinositol-3,4,5-trisphosphate binding(GO:0005547) |
0.0 | 0.1 | GO:0003909 | DNA ligase activity(GO:0003909) DNA ligase (ATP) activity(GO:0003910) |
0.0 | 0.5 | GO:0002161 | aminoacyl-tRNA editing activity(GO:0002161) |
0.0 | 0.3 | GO:0004579 | dolichyl-diphosphooligosaccharide-protein glycotransferase activity(GO:0004579) |
0.0 | 0.5 | GO:0015035 | protein disulfide oxidoreductase activity(GO:0015035) |
0.0 | 0.1 | GO:0001135 | transcription factor activity, RNA polymerase II transcription factor recruiting(GO:0001135) |
0.0 | 0.1 | GO:0034513 | box H/ACA snoRNA binding(GO:0034513) |
0.0 | 0.5 | GO:0016922 | ligand-dependent nuclear receptor binding(GO:0016922) |
0.0 | 0.1 | GO:0032454 | histone demethylase activity (H3-K9 specific)(GO:0032454) |
0.0 | 0.1 | GO:0086056 | voltage-gated calcium channel activity involved in AV node cell action potential(GO:0086056) |
0.0 | 0.1 | GO:0050510 | N-acetylgalactosaminyl-proteoglycan 3-beta-glucuronosyltransferase activity(GO:0050510) |
0.0 | 0.7 | GO:0035255 | ionotropic glutamate receptor binding(GO:0035255) |
0.0 | 0.3 | GO:1990841 | promoter-specific chromatin binding(GO:1990841) |
0.0 | 0.6 | GO:0046966 | thyroid hormone receptor binding(GO:0046966) |
0.0 | 0.0 | GO:0051373 | FATZ binding(GO:0051373) |
0.0 | 0.1 | GO:1990430 | extracellular matrix protein binding(GO:1990430) |
0.0 | 0.8 | GO:0005385 | zinc ion transmembrane transporter activity(GO:0005385) |
0.0 | 0.4 | GO:0016860 | intramolecular oxidoreductase activity(GO:0016860) |
0.0 | 0.0 | GO:0016309 | 1-phosphatidylinositol-5-phosphate 4-kinase activity(GO:0016309) |
0.0 | 2.9 | GO:0036459 | thiol-dependent ubiquitinyl hydrolase activity(GO:0036459) ubiquitinyl hydrolase activity(GO:0101005) |
0.0 | 0.1 | GO:0034481 | chondroitin sulfotransferase activity(GO:0034481) |
0.0 | 0.0 | GO:0032551 | UTP binding(GO:0002134) pyrimidine ribonucleoside binding(GO:0032551) |
0.0 | 0.2 | GO:0051021 | GDP-dissociation inhibitor binding(GO:0051021) |
0.0 | 0.5 | GO:0045236 | CXCR chemokine receptor binding(GO:0045236) |
0.0 | 0.1 | GO:0008332 | low voltage-gated calcium channel activity(GO:0008332) |
0.0 | 0.3 | GO:0016308 | 1-phosphatidylinositol-4-phosphate 5-kinase activity(GO:0016308) |
0.0 | 0.5 | GO:0008253 | 5'-nucleotidase activity(GO:0008253) |
0.0 | 0.2 | GO:0004449 | isocitrate dehydrogenase (NAD+) activity(GO:0004449) |
0.0 | 0.2 | GO:0043023 | ribosomal large subunit binding(GO:0043023) |
0.0 | 1.9 | GO:0005518 | collagen binding(GO:0005518) |
0.0 | 0.2 | GO:0004652 | polynucleotide adenylyltransferase activity(GO:0004652) |
0.0 | 0.0 | GO:0004809 | tRNA (guanine-N2-)-methyltransferase activity(GO:0004809) |
0.0 | 0.7 | GO:0004683 | calmodulin-dependent protein kinase activity(GO:0004683) |
0.0 | 0.2 | GO:0005138 | interleukin-6 receptor binding(GO:0005138) |
0.0 | 0.3 | GO:0023026 | MHC class II protein complex binding(GO:0023026) |
0.0 | 0.2 | GO:0050700 | CARD domain binding(GO:0050700) |
0.0 | 0.6 | GO:0008157 | protein phosphatase 1 binding(GO:0008157) |
0.0 | 0.1 | GO:0015562 | efflux transmembrane transporter activity(GO:0015562) |
0.0 | 0.3 | GO:0004029 | aldehyde dehydrogenase (NAD) activity(GO:0004029) |
0.0 | 1.4 | GO:0016765 | transferase activity, transferring alkyl or aryl (other than methyl) groups(GO:0016765) |
0.0 | 0.1 | GO:0034714 | type III transforming growth factor beta receptor binding(GO:0034714) |
0.0 | 0.4 | GO:0050661 | NADP binding(GO:0050661) |
0.0 | 0.1 | GO:0004791 | thioredoxin-disulfide reductase activity(GO:0004791) |
0.0 | 0.8 | GO:0097472 | cyclin-dependent protein serine/threonine kinase activity(GO:0004693) cyclin-dependent protein kinase activity(GO:0097472) |
0.0 | 0.1 | GO:0003941 | L-serine ammonia-lyase activity(GO:0003941) |
0.0 | 0.5 | GO:0050998 | nitric-oxide synthase binding(GO:0050998) |
0.0 | 0.1 | GO:0008035 | high-density lipoprotein particle binding(GO:0008035) |
0.0 | 0.3 | GO:0004568 | chitinase activity(GO:0004568) |
0.0 | 0.2 | GO:0016813 | hydrolase activity, acting on carbon-nitrogen (but not peptide) bonds, in linear amidines(GO:0016813) |
0.0 | 0.8 | GO:0003887 | DNA-directed DNA polymerase activity(GO:0003887) |
0.0 | 0.0 | GO:0000253 | 3-keto sterol reductase activity(GO:0000253) |
0.0 | 0.1 | GO:0039706 | co-receptor binding(GO:0039706) |
0.0 | 0.5 | GO:0070577 | lysine-acetylated histone binding(GO:0070577) |
0.0 | 0.1 | GO:0019959 | interleukin-8 binding(GO:0019959) |
0.0 | 2.4 | GO:0015020 | glucuronosyltransferase activity(GO:0015020) |
0.0 | 0.1 | GO:0015375 | glycine:sodium symporter activity(GO:0015375) |
0.0 | 0.1 | GO:0001591 | dopamine neurotransmitter receptor activity, coupled via Gi/Go(GO:0001591) |
0.0 | 0.3 | GO:0004861 | cyclin-dependent protein serine/threonine kinase inhibitor activity(GO:0004861) |
0.0 | 0.2 | GO:0050321 | tau-protein kinase activity(GO:0050321) |
0.0 | 0.2 | GO:0004176 | ATP-dependent peptidase activity(GO:0004176) |
0.0 | 0.1 | GO:0086080 | protein binding involved in heterotypic cell-cell adhesion(GO:0086080) |
0.0 | 0.1 | GO:0005337 | nucleoside transmembrane transporter activity(GO:0005337) |
0.0 | 0.4 | GO:0005487 | nucleocytoplasmic transporter activity(GO:0005487) |
0.0 | 0.1 | GO:0034934 | 2,3-dihydroxy DDT 1,2-dioxygenase activity(GO:0018542) phenanthrene dioxygenase activity(GO:0018555) 2,2',3-trihydroxybiphenyl dioxygenase activity(GO:0018556) 1,2-dihydroxyfluorene 1,1-alpha-dioxygenase activity(GO:0018557) 5,6-dihydroxy-3-methyl-2-oxo-1,2-dihydroquinoline dioxygenase activity(GO:0018558) 1,1-dichloro-2-(dihydroxy-4-chlorophenyl)-(4-chlorophenyl)ethene 1,2-dioxygenase activity(GO:0018559) protocatechuate 3,4-dioxygenase type II activity(GO:0018560) 2'-aminobiphenyl-2,3-diol 1,2-dioxygenase activity(GO:0018561) 3,4-dihydroxyfluorene 4,4-alpha-dioxygenase activity(GO:0018562) 2,3-dihydroxy-ethylbenzene 1,2-dioxygenase activity(GO:0018563) carbazole 1,9a-dioxygenase activity(GO:0018564) dihydroxydibenzothiophene dioxygenase activity(GO:0018565) 1,2-dihydroxynaphthalene-6-sulfonate 1,8a-dioxygenase activity(GO:0018566) styrene dioxygenase activity(GO:0018567) 3,4-dihydroxyphenanthrene dioxygenase activity(GO:0018568) hydroquinone 1,2-dioxygenase activity(GO:0018569) p-cumate 2,3-dioxygenase activity(GO:0018570) 2,3-dihydroxy-p-cumate dioxygenase activity(GO:0018571) 3,5-dichlorocatechol 1,2-dioxygenase activity(GO:0018572) 2-aminophenol 1,6-dioxygenase activity(GO:0018573) 2,6-dichloro-p-hydroquinone 1,2-dioxygenase activity(GO:0018574) chlorocatechol 1,2-dioxygenase activity(GO:0018575) catechol dioxygenase activity(GO:0019114) dihydroxyfluorene dioxygenase activity(GO:0019117) 5-aminosalicylate dioxygenase activity(GO:0034543) 3-hydroxy-2-naphthoate 2,3-dioxygenase activity(GO:0034803) benzo(a)pyrene 11,12-dioxygenase activity(GO:0034806) benzo(a)pyrene 4,5-dioxygenase activity(GO:0034808) 4,5-dihydroxybenzo(a)pyrene dioxygenase activity(GO:0034810) benzo(a)pyrene 9,10-dioxygenase activity(GO:0034811) 9,10-dihydroxybenzo(a)pyrene dioxygenase activity(GO:0034812) benzo(a)pyrene 7,8-dioxygenase activity(GO:0034813) 7,8-dihydroxy benzo(a)pyrene dioxygenase activity(GO:0034814) 1,2-dihydroxy-5,6,7,8-tetrahydronaphthalene extradiol dioxygenase activity(GO:0034827) 2-mercaptobenzothiazole dioxygenase activity(GO:0034834) pyridine-3,4-diol dioxygenase activity(GO:0034895) pyrene dioxygenase activity(GO:0034920) 4,5-dihydroxypyrene dioxygenase activity(GO:0034922) phenanthrene-4-carboxylate dioxygenase activity(GO:0034934) tetrachlorobenzene dioxygenase activity(GO:0034935) 4,6-dichloro-3-methylcatechol 1,2-dioxygenase activity(GO:0034936) 2,3-dihydroxydiphenyl ether dioxygenase activity(GO:0034955) diphenyl ether 1,2-dioxygenase activity(GO:0034956) arachidonate 8(S)-lipoxygenase activity(GO:0036403) 4-hydroxycatechol 1,2-dioxygenase activity(GO:0047074) |
0.0 | 0.0 | GO:0016971 | flavin-linked sulfhydryl oxidase activity(GO:0016971) |
0.0 | 0.1 | GO:0031698 | beta-2 adrenergic receptor binding(GO:0031698) |
0.0 | 1.2 | GO:0008391 | arachidonic acid monooxygenase activity(GO:0008391) |
0.0 | 0.6 | GO:0001205 | transcriptional activator activity, RNA polymerase II distal enhancer sequence-specific binding(GO:0001205) |
0.0 | 0.7 | GO:0042605 | peptide antigen binding(GO:0042605) |
0.0 | 0.3 | GO:0035497 | cAMP response element binding(GO:0035497) |
0.0 | 0.1 | GO:0042134 | rRNA primary transcript binding(GO:0042134) |
0.0 | 0.5 | GO:0005527 | macrolide binding(GO:0005527) FK506 binding(GO:0005528) |
0.0 | 0.0 | GO:0098847 | sequence-specific single stranded DNA binding(GO:0098847) |
0.0 | 0.2 | GO:0008420 | CTD phosphatase activity(GO:0008420) |
0.0 | 0.1 | GO:0004938 | alpha2-adrenergic receptor activity(GO:0004938) |
0.0 | 0.4 | GO:0005070 | SH3/SH2 adaptor activity(GO:0005070) |
0.0 | 0.1 | GO:0015057 | thrombin receptor activity(GO:0015057) |
0.0 | 0.3 | GO:0042500 | aspartic endopeptidase activity, intramembrane cleaving(GO:0042500) |
0.0 | 0.2 | GO:0008131 | primary amine oxidase activity(GO:0008131) |
0.0 | 0.1 | GO:0004694 | eukaryotic translation initiation factor 2alpha kinase activity(GO:0004694) |
0.0 | 0.4 | GO:0031489 | myosin V binding(GO:0031489) |
0.0 | 1.0 | GO:0019209 | kinase activator activity(GO:0019209) |
0.0 | 0.1 | GO:0004862 | cAMP-dependent protein kinase inhibitor activity(GO:0004862) |
0.0 | 0.1 | GO:0051377 | mannose-ethanolamine phosphotransferase activity(GO:0051377) |
0.0 | 0.1 | GO:0008494 | translation activator activity(GO:0008494) |
0.0 | 0.1 | GO:0008422 | beta-glucosidase activity(GO:0008422) |
0.0 | 0.1 | GO:0033743 | peptide-methionine (R)-S-oxide reductase activity(GO:0033743) |
0.0 | 2.5 | GO:0004222 | metalloendopeptidase activity(GO:0004222) |
0.0 | 0.1 | GO:0019911 | structural constituent of myelin sheath(GO:0019911) |
0.0 | 0.1 | GO:0016520 | growth hormone-releasing hormone receptor activity(GO:0016520) |
0.0 | 0.2 | GO:0048407 | platelet-derived growth factor binding(GO:0048407) |
0.0 | 0.2 | GO:0016790 | thiolester hydrolase activity(GO:0016790) |
0.0 | 0.0 | GO:0000064 | L-ornithine transmembrane transporter activity(GO:0000064) |
0.0 | 0.3 | GO:0070064 | proline-rich region binding(GO:0070064) |
0.0 | 0.2 | GO:0042056 | chemoattractant activity(GO:0042056) |
0.0 | 0.3 | GO:0001054 | RNA polymerase I activity(GO:0001054) |
0.0 | 0.8 | GO:0005132 | type I interferon receptor binding(GO:0005132) |
0.0 | 0.0 | GO:0005025 | transforming growth factor beta receptor activity, type I(GO:0005025) |
0.0 | 0.0 | GO:0004832 | valine-tRNA ligase activity(GO:0004832) |
0.0 | 0.1 | GO:0019788 | NEDD8 transferase activity(GO:0019788) |
0.0 | 0.1 | GO:0031957 | very long-chain fatty acid-CoA ligase activity(GO:0031957) |
0.0 | 0.3 | GO:0042800 | histone methyltransferase activity (H3-K4 specific)(GO:0042800) |
0.0 | 0.1 | GO:0004065 | arylsulfatase activity(GO:0004065) |
0.0 | 0.1 | GO:0050501 | hyaluronan synthase activity(GO:0050501) |
0.0 | 0.0 | GO:0035256 | G-protein coupled glutamate receptor binding(GO:0035256) |
0.0 | 0.6 | GO:0004033 | aldo-keto reductase (NADP) activity(GO:0004033) |
0.0 | 0.1 | GO:0098518 | polynucleotide phosphatase activity(GO:0098518) |
0.0 | 0.1 | GO:0070915 | lysophosphatidic acid receptor activity(GO:0070915) |
0.0 | 0.0 | GO:0043208 | glycosphingolipid binding(GO:0043208) |
0.0 | 0.2 | GO:0030544 | Hsp70 protein binding(GO:0030544) |
0.0 | 0.5 | GO:0016891 | endoribonuclease activity, producing 5'-phosphomonoesters(GO:0016891) |
0.0 | 0.4 | GO:0016701 | oxidoreductase activity, acting on single donors with incorporation of molecular oxygen(GO:0016701) |
0.0 | 0.1 | GO:0032795 | heterotrimeric G-protein binding(GO:0032795) |
0.0 | 0.0 | GO:0008061 | chitin binding(GO:0008061) |
0.0 | 0.3 | GO:0017134 | fibroblast growth factor binding(GO:0017134) |
0.0 | 0.1 | GO:0008503 | benzodiazepine receptor activity(GO:0008503) |
0.0 | 0.0 | GO:0016866 | intramolecular transferase activity(GO:0016866) |
0.0 | 0.2 | GO:0051019 | mitogen-activated protein kinase binding(GO:0051019) |
0.0 | 0.2 | GO:0005247 | voltage-gated chloride channel activity(GO:0005247) |
0.0 | 0.1 | GO:0015181 | arginine transmembrane transporter activity(GO:0015181) L-lysine transmembrane transporter activity(GO:0015189) |
0.0 | 0.1 | GO:0008475 | procollagen-lysine 5-dioxygenase activity(GO:0008475) |
0.0 | 0.2 | GO:0070700 | BMP receptor binding(GO:0070700) |
0.0 | 0.5 | GO:0042162 | telomeric DNA binding(GO:0042162) |
0.0 | 0.1 | GO:0008308 | voltage-gated anion channel activity(GO:0008308) |
0.0 | 0.0 | GO:0001161 | intronic transcription regulatory region sequence-specific DNA binding(GO:0001161) |
0.0 | 0.3 | GO:0015116 | sulfate transmembrane transporter activity(GO:0015116) |
0.0 | 0.1 | GO:0001588 | dopamine neurotransmitter receptor activity, coupled via Gs(GO:0001588) dopamine neurotransmitter receptor activity(GO:0004952) |
0.0 | 0.1 | GO:0070579 | methylcytosine dioxygenase activity(GO:0070579) |
0.0 | 0.6 | GO:0043022 | ribosome binding(GO:0043022) |
0.0 | 0.7 | GO:0005201 | extracellular matrix structural constituent(GO:0005201) |
0.0 | 0.5 | GO:0017112 | Rab guanyl-nucleotide exchange factor activity(GO:0017112) |
0.0 | 0.0 | GO:0031749 | D2 dopamine receptor binding(GO:0031749) |
0.0 | 0.1 | GO:0015125 | bile acid transmembrane transporter activity(GO:0015125) |
0.0 | 0.1 | GO:0004946 | bombesin receptor activity(GO:0004946) |
0.0 | 0.2 | GO:0070628 | proteasome binding(GO:0070628) |
0.0 | 0.0 | GO:0071553 | uridine nucleotide receptor activity(GO:0015065) G-protein coupled pyrimidinergic nucleotide receptor activity(GO:0071553) |
0.0 | 0.2 | GO:0016500 | protein-hormone receptor activity(GO:0016500) |
0.0 | 0.0 | GO:0005148 | prolactin receptor binding(GO:0005148) |
0.0 | 0.5 | GO:0005544 | calcium-dependent phospholipid binding(GO:0005544) |
0.0 | 0.2 | GO:0042043 | neurexin family protein binding(GO:0042043) |
0.0 | 0.2 | GO:0008327 | methyl-CpG binding(GO:0008327) |
0.0 | 0.1 | GO:0030550 | acetylcholine receptor inhibitor activity(GO:0030550) |
0.0 | 0.1 | GO:0022833 | mechanically-gated ion channel activity(GO:0008381) mechanically gated channel activity(GO:0022833) |
0.0 | 0.2 | GO:0043531 | ADP binding(GO:0043531) |
0.0 | 0.8 | GO:0043130 | ubiquitin binding(GO:0043130) |
0.0 | 0.3 | GO:0008139 | nuclear localization sequence binding(GO:0008139) |
0.0 | 0.2 | GO:0004709 | MAP kinase kinase kinase activity(GO:0004709) |
0.0 | 0.1 | GO:0017056 | structural constituent of nuclear pore(GO:0017056) |
0.0 | 0.3 | GO:0001786 | phosphatidylserine binding(GO:0001786) |
0.0 | 0.1 | GO:0004983 | neuropeptide Y receptor activity(GO:0004983) |
0.0 | 0.8 | GO:0003705 | transcription factor activity, RNA polymerase II distal enhancer sequence-specific binding(GO:0003705) |
0.0 | 0.5 | GO:0031490 | chromatin DNA binding(GO:0031490) |
0.0 | 3.2 | GO:0000982 | transcription factor activity, RNA polymerase II core promoter proximal region sequence-specific binding(GO:0000982) |
0.0 | 0.3 | GO:0004298 | threonine-type endopeptidase activity(GO:0004298) threonine-type peptidase activity(GO:0070003) |
0.0 | 0.0 | GO:0043175 | RNA polymerase core enzyme binding(GO:0043175) |
0.0 | 0.7 | GO:0051082 | unfolded protein binding(GO:0051082) |
0.0 | 0.4 | GO:0016417 | S-acyltransferase activity(GO:0016417) |
0.0 | 0.0 | GO:0019808 | polyamine binding(GO:0019808) |
0.0 | 0.1 | GO:0008745 | N-acetylmuramoyl-L-alanine amidase activity(GO:0008745) peptidoglycan receptor activity(GO:0016019) |
0.0 | 0.0 | GO:0008252 | nucleotidase activity(GO:0008252) |
0.0 | 0.0 | GO:0050833 | pyruvate transmembrane transporter activity(GO:0050833) |
0.0 | 0.0 | GO:0008499 | UDP-galactose:beta-N-acetylglucosamine beta-1,3-galactosyltransferase activity(GO:0008499) |
0.0 | 0.0 | GO:0051870 | methotrexate binding(GO:0051870) |
0.0 | 0.0 | GO:0046974 | histone methyltransferase activity (H3-K9 specific)(GO:0046974) |
0.0 | 0.0 | GO:0016909 | JUN kinase activity(GO:0004705) SAP kinase activity(GO:0016909) |
0.0 | 0.3 | GO:0005086 | ARF guanyl-nucleotide exchange factor activity(GO:0005086) |
0.0 | 0.0 | GO:0004704 | NF-kappaB-inducing kinase activity(GO:0004704) |
0.0 | 0.0 | GO:0019976 | interleukin-2 binding(GO:0019976) |
0.0 | 0.1 | GO:0016413 | O-acetyltransferase activity(GO:0016413) |
0.0 | 0.1 | GO:0001609 | G-protein coupled adenosine receptor activity(GO:0001609) |
0.0 | 0.1 | GO:0015172 | acidic amino acid transmembrane transporter activity(GO:0015172) |
0.0 | 3.1 | GO:0046982 | protein heterodimerization activity(GO:0046982) |
0.0 | 0.0 | GO:0005143 | interleukin-12 receptor binding(GO:0005143) |
0.0 | 0.0 | GO:0004967 | glucagon receptor activity(GO:0004967) |
0.0 | 0.2 | GO:0016755 | transferase activity, transferring amino-acyl groups(GO:0016755) |
0.0 | 0.0 | GO:0048030 | disaccharide binding(GO:0048030) |
0.0 | 0.1 | GO:0005042 | netrin receptor activity(GO:0005042) |
0.0 | 0.0 | GO:0005280 | hydrogen:amino acid symporter activity(GO:0005280) |
0.0 | 0.1 | GO:0004602 | glutathione peroxidase activity(GO:0004602) |
0.0 | 0.1 | GO:0016208 | AMP binding(GO:0016208) |
0.0 | 0.3 | GO:0019894 | kinesin binding(GO:0019894) |
0.0 | 0.3 | GO:0005272 | sodium channel activity(GO:0005272) |
0.0 | 0.8 | GO:0008083 | growth factor activity(GO:0008083) |
0.0 | 0.0 | GO:0086008 | voltage-gated potassium channel activity involved in cardiac muscle cell action potential repolarization(GO:0086008) |
0.0 | 0.0 | GO:0043842 | Kdo transferase activity(GO:0043842) |
0.0 | 0.1 | GO:0001515 | opioid peptide activity(GO:0001515) |
0.0 | 0.0 | GO:0047184 | 1-acylglycerophosphocholine O-acyltransferase activity(GO:0047184) |
0.0 | 0.5 | GO:0008565 | protein transporter activity(GO:0008565) |
0.0 | 0.0 | GO:0016015 | morphogen activity(GO:0016015) |
0.0 | 0.1 | GO:0031849 | olfactory receptor binding(GO:0031849) |
0.0 | 0.0 | GO:0004969 | histamine receptor activity(GO:0004969) |
0.0 | 0.1 | GO:0016929 | SUMO-specific protease activity(GO:0016929) |
0.0 | 0.1 | GO:0070063 | RNA polymerase binding(GO:0070063) |
0.0 | 1.9 | GO:0003735 | structural constituent of ribosome(GO:0003735) |
0.0 | 0.1 | GO:0035326 | enhancer binding(GO:0035326) |
0.0 | 0.0 | GO:0031708 | endothelin B receptor binding(GO:0031708) |
0.0 | 0.0 | GO:0030572 | cardiolipin synthase activity(GO:0008808) phosphatidyltransferase activity(GO:0030572) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.4 | 6.3 | PID ERBB NETWORK PATHWAY | ErbB receptor signaling network |
0.2 | 6.2 | PID RXR VDR PATHWAY | RXR and RAR heterodimerization with other nuclear receptor |
0.2 | 0.2 | PID SMAD2 3PATHWAY | Regulation of cytoplasmic and nuclear SMAD2/3 signaling |
0.2 | 2.1 | PID P38 GAMMA DELTA PATHWAY | Signaling mediated by p38-gamma and p38-delta |
0.2 | 6.5 | ST ADRENERGIC | Adrenergic Pathway |
0.2 | 0.5 | PID ARF6 DOWNSTREAM PATHWAY | Arf6 downstream pathway |
0.1 | 1.4 | PID ALK2 PATHWAY | ALK2 signaling events |
0.1 | 8.7 | PID P73PATHWAY | p73 transcription factor network |
0.1 | 4.9 | PID HES HEY PATHWAY | Notch-mediated HES/HEY network |
0.1 | 4.3 | PID ECADHERIN STABILIZATION PATHWAY | Stabilization and expansion of the E-cadherin adherens junction |
0.1 | 4.3 | PID HNF3B PATHWAY | FOXA2 and FOXA3 transcription factor networks |
0.1 | 0.1 | PID GMCSF PATHWAY | GMCSF-mediated signaling events |
0.1 | 1.3 | PID PDGFRA PATHWAY | PDGFR-alpha signaling pathway |
0.1 | 2.3 | PID FOXM1 PATHWAY | FOXM1 transcription factor network |
0.1 | 0.5 | PID EPHA2 FWD PATHWAY | EPHA2 forward signaling |
0.1 | 0.4 | SIG PIP3 SIGNALING IN CARDIAC MYOCTES | Genes related to PIP3 signaling in cardiac myocytes |
0.1 | 3.2 | PID SHP2 PATHWAY | SHP2 signaling |
0.1 | 0.8 | ST WNT CA2 CYCLIC GMP PATHWAY | Wnt/Ca2+/cyclic GMP signaling. |
0.1 | 1.0 | PID SYNDECAN 3 PATHWAY | Syndecan-3-mediated signaling events |
0.1 | 0.6 | PID RANBP2 PATHWAY | Sumoylation by RanBP2 regulates transcriptional repression |
0.1 | 0.8 | ST G ALPHA I PATHWAY | G alpha i Pathway |
0.1 | 1.2 | PID ARF 3PATHWAY | Arf1 pathway |
0.1 | 1.4 | PID HIF2PATHWAY | HIF-2-alpha transcription factor network |
0.1 | 1.4 | PID GLYPICAN 1PATHWAY | Glypican 1 network |
0.1 | 0.2 | PID ECADHERIN KERATINOCYTE PATHWAY | E-cadherin signaling in keratinocytes |
0.1 | 2.0 | PID HEDGEHOG GLI PATHWAY | Hedgehog signaling events mediated by Gli proteins |
0.1 | 1.5 | PID TOLL ENDOGENOUS PATHWAY | Endogenous TLR signaling |
0.1 | 0.3 | PID THROMBIN PAR4 PATHWAY | PAR4-mediated thrombin signaling events |
0.1 | 0.3 | PID IL1 PATHWAY | IL1-mediated signaling events |
0.1 | 0.6 | PID INTEGRIN4 PATHWAY | Alpha6 beta4 integrin-ligand interactions |
0.1 | 0.9 | PID DNA PK PATHWAY | DNA-PK pathway in nonhomologous end joining |
0.1 | 0.1 | PID IL8 CXCR1 PATHWAY | IL8- and CXCR1-mediated signaling events |
0.1 | 0.6 | PID HEDGEHOG 2PATHWAY | Signaling events mediated by the Hedgehog family |
0.1 | 2.3 | PID E2F PATHWAY | E2F transcription factor network |
0.1 | 1.8 | NABA PROTEOGLYCANS | Genes encoding proteoglycans |
0.1 | 2.9 | PID SMAD2 3NUCLEAR PATHWAY | Regulation of nuclear SMAD2/3 signaling |
0.1 | 0.5 | PID AURORA A PATHWAY | Aurora A signaling |
0.0 | 0.3 | PID ECADHERIN NASCENT AJ PATHWAY | E-cadherin signaling in the nascent adherens junction |
0.0 | 0.2 | ST MYOCYTE AD PATHWAY | Myocyte Adrenergic Pathway is a specific case of the generalized Adrenergic Pathway. |
0.0 | 0.3 | PID UPA UPAR PATHWAY | Urokinase-type plasminogen activator (uPA) and uPAR-mediated signaling |
0.0 | 2.6 | PID MYC ACTIV PATHWAY | Validated targets of C-MYC transcriptional activation |
0.0 | 0.7 | PID INTEGRIN A9B1 PATHWAY | Alpha9 beta1 integrin signaling events |
0.0 | 0.3 | SA PTEN PATHWAY | PTEN is a tumor suppressor that dephosphorylates the lipid messenger phosphatidylinositol triphosphate. |
0.0 | 1.0 | PID WNT NONCANONICAL PATHWAY | Noncanonical Wnt signaling pathway |
0.0 | 0.5 | PID SYNDECAN 2 PATHWAY | Syndecan-2-mediated signaling events |
0.0 | 0.2 | PID ANTHRAX PATHWAY | Cellular roles of Anthrax toxin |
0.0 | 0.0 | SIG PIP3 SIGNALING IN B LYMPHOCYTES | Genes related to PIP3 signaling in B lymphocytes |
0.0 | 0.2 | PID S1P S1P4 PATHWAY | S1P4 pathway |
0.0 | 0.7 | PID P38 ALPHA BETA PATHWAY | Regulation of p38-alpha and p38-beta |
0.0 | 1.1 | PID CERAMIDE PATHWAY | Ceramide signaling pathway |
0.0 | 0.2 | ST PHOSPHOINOSITIDE 3 KINASE PATHWAY | PI3K Pathway |
0.0 | 0.2 | PID CD40 PATHWAY | CD40/CD40L signaling |
0.0 | 0.2 | SA PROGRAMMED CELL DEATH | Programmed cell death, or apoptosis, eliminates damaged or unneeded cells. |
0.0 | 1.0 | PID FAK PATHWAY | Signaling events mediated by focal adhesion kinase |
0.0 | 0.1 | ST IL 13 PATHWAY | Interleukin 13 (IL-13) Pathway |
0.0 | 0.6 | ST JNK MAPK PATHWAY | JNK MAPK Pathway |
0.0 | 0.2 | PID ER NONGENOMIC PATHWAY | Plasma membrane estrogen receptor signaling |
0.0 | 0.4 | PID ERBB4 PATHWAY | ErbB4 signaling events |
0.0 | 1.6 | PID ERA GENOMIC PATHWAY | Validated nuclear estrogen receptor alpha network |
0.0 | 0.7 | PID ILK PATHWAY | Integrin-linked kinase signaling |
0.0 | 0.2 | PID PRL SIGNALING EVENTS PATHWAY | Signaling events mediated by PRL |
0.0 | 0.1 | PID IL23 PATHWAY | IL23-mediated signaling events |
0.0 | 6.8 | NABA SECRETED FACTORS | Genes encoding secreted soluble factors |
0.0 | 0.5 | PID CONE PATHWAY | Visual signal transduction: Cones |
0.0 | 0.0 | SA TRKA RECEPTOR | The TrkA receptor binds nerve growth factor to activate MAP kinase pathways and promote cell growth. |
0.0 | 0.5 | PID P53 REGULATION PATHWAY | p53 pathway |
0.0 | 0.2 | PID IL27 PATHWAY | IL27-mediated signaling events |
0.0 | 0.3 | PID TCR CALCIUM PATHWAY | Calcium signaling in the CD4+ TCR pathway |
0.0 | 0.1 | ST G ALPHA S PATHWAY | G alpha s Pathway |
0.0 | 0.1 | PID LYMPH ANGIOGENESIS PATHWAY | VEGFR3 signaling in lymphatic endothelium |
0.0 | 0.1 | PID P38 MK2 PATHWAY | p38 signaling mediated by MAPKAP kinases |
0.0 | 0.1 | PID FAS PATHWAY | FAS (CD95) signaling pathway |
0.0 | 0.3 | PID LYSOPHOSPHOLIPID PATHWAY | LPA receptor mediated events |
0.0 | 0.1 | PID PTP1B PATHWAY | Signaling events mediated by PTP1B |
0.0 | 0.2 | NABA BASEMENT MEMBRANES | Genes encoding structural components of basement membranes |
0.0 | 0.2 | PID IL8 CXCR2 PATHWAY | IL8- and CXCR2-mediated signaling events |
0.0 | 0.2 | ST TUMOR NECROSIS FACTOR PATHWAY | Tumor Necrosis Factor Pathway. |
0.0 | 0.0 | SA G2 AND M PHASES | Cdc25 activates the cdc2/cyclin B complex to induce the G2/M transition. |
0.0 | 0.1 | PID LIS1 PATHWAY | Lissencephaly gene (LIS1) in neuronal migration and development |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.5 | 8.9 | REACTOME FATTY ACYL COA BIOSYNTHESIS | Genes involved in Fatty Acyl-CoA Biosynthesis |
0.5 | 3.2 | REACTOME ALPHA LINOLENIC ACID ALA METABOLISM | Genes involved in alpha-linolenic acid (ALA) metabolism |
0.4 | 2.4 | REACTOME ETHANOL OXIDATION | Genes involved in Ethanol oxidation |
0.3 | 5.1 | REACTOME ANTIGEN PRESENTATION FOLDING ASSEMBLY AND PEPTIDE LOADING OF CLASS I MHC | Genes involved in Antigen Presentation: Folding, assembly and peptide loading of class I MHC |
0.3 | 7.2 | REACTOME GRB2 EVENTS IN ERBB2 SIGNALING | Genes involved in GRB2 events in ERBB2 signaling |
0.3 | 4.2 | REACTOME METABOLISM OF PORPHYRINS | Genes involved in Metabolism of porphyrins |
0.3 | 2.7 | REACTOME SYNTHESIS OF PE | Genes involved in Synthesis of PE |
0.3 | 2.4 | REACTOME TRYPTOPHAN CATABOLISM | Genes involved in Tryptophan catabolism |
0.2 | 3.6 | REACTOME AMINO ACID SYNTHESIS AND INTERCONVERSION TRANSAMINATION | Genes involved in Amino acid synthesis and interconversion (transamination) |
0.2 | 0.9 | REACTOME DESTABILIZATION OF MRNA BY AUF1 HNRNP D0 | Genes involved in Destabilization of mRNA by AUF1 (hnRNP D0) |
0.2 | 3.0 | REACTOME ENDOGENOUS STEROLS | Genes involved in Endogenous sterols |
0.2 | 2.3 | REACTOME SYNTHESIS OF PIPS AT THE LATE ENDOSOME MEMBRANE | Genes involved in Synthesis of PIPs at the late endosome membrane |
0.2 | 0.7 | REACTOME IL 6 SIGNALING | Genes involved in Interleukin-6 signaling |
0.2 | 2.1 | REACTOME SIGNALING BY CONSTITUTIVELY ACTIVE EGFR | Genes involved in Signaling by constitutively active EGFR |
0.2 | 1.8 | REACTOME COPI MEDIATED TRANSPORT | Genes involved in COPI Mediated Transport |
0.2 | 2.1 | REACTOME SIGNALING BY ACTIVATED POINT MUTANTS OF FGFR1 | Genes involved in Signaling by activated point mutants of FGFR1 |
0.2 | 2.2 | REACTOME PYRIMIDINE CATABOLISM | Genes involved in Pyrimidine catabolism |
0.2 | 1.5 | REACTOME CALNEXIN CALRETICULIN CYCLE | Genes involved in Calnexin/calreticulin cycle |
0.1 | 1.5 | REACTOME PROLACTIN RECEPTOR SIGNALING | Genes involved in Prolactin receptor signaling |
0.1 | 4.9 | REACTOME BMAL1 CLOCK NPAS2 ACTIVATES CIRCADIAN EXPRESSION | Genes involved in BMAL1:CLOCK/NPAS2 Activates Circadian Expression |
0.1 | 0.3 | REACTOME MITOTIC M M G1 PHASES | Genes involved in Mitotic M-M/G1 phases |
0.1 | 1.6 | REACTOME MRNA DECAY BY 3 TO 5 EXORIBONUCLEASE | Genes involved in mRNA Decay by 3' to 5' Exoribonuclease |
0.1 | 1.0 | REACTOME PURINE CATABOLISM | Genes involved in Purine catabolism |
0.1 | 1.4 | REACTOME REGULATION OF INSULIN SECRETION BY ACETYLCHOLINE | Genes involved in Regulation of Insulin Secretion by Acetylcholine |
0.1 | 1.4 | REACTOME HIGHLY CALCIUM PERMEABLE POSTSYNAPTIC NICOTINIC ACETYLCHOLINE RECEPTORS | Genes involved in Highly calcium permeable postsynaptic nicotinic acetylcholine receptors |
0.1 | 1.7 | REACTOME MRNA DECAY BY 5 TO 3 EXORIBONUCLEASE | Genes involved in mRNA Decay by 5' to 3' Exoribonuclease |
0.1 | 1.8 | REACTOME ABCA TRANSPORTERS IN LIPID HOMEOSTASIS | Genes involved in ABCA transporters in lipid homeostasis |
0.1 | 1.5 | REACTOME TRAF3 DEPENDENT IRF ACTIVATION PATHWAY | Genes involved in TRAF3-dependent IRF activation pathway |
0.1 | 2.3 | REACTOME REGULATION OF GENE EXPRESSION IN BETA CELLS | Genes involved in Regulation of gene expression in beta cells |
0.1 | 0.9 | REACTOME PROLONGED ERK ACTIVATION EVENTS | Genes involved in Prolonged ERK activation events |
0.1 | 1.1 | REACTOME CTLA4 INHIBITORY SIGNALING | Genes involved in CTLA4 inhibitory signaling |
0.1 | 1.1 | REACTOME SYNTHESIS OF PC | Genes involved in Synthesis of PC |
0.1 | 0.6 | REACTOME NFKB ACTIVATION THROUGH FADD RIP1 PATHWAY MEDIATED BY CASPASE 8 AND10 | Genes involved in NF-kB activation through FADD/RIP-1 pathway mediated by caspase-8 and -10 |
0.1 | 0.3 | REACTOME ADP SIGNALLING THROUGH P2RY12 | Genes involved in ADP signalling through P2Y purinoceptor 12 |
0.1 | 1.1 | REACTOME GLYCOGEN BREAKDOWN GLYCOGENOLYSIS | Genes involved in Glycogen breakdown (glycogenolysis) |
0.1 | 1.2 | REACTOME RAP1 SIGNALLING | Genes involved in Rap1 signalling |
0.1 | 1.9 | REACTOME CHOLESTEROL BIOSYNTHESIS | Genes involved in Cholesterol biosynthesis |
0.1 | 0.8 | REACTOME ANDROGEN BIOSYNTHESIS | Genes involved in Androgen biosynthesis |
0.1 | 0.5 | REACTOME FORMATION OF INCISION COMPLEX IN GG NER | Genes involved in Formation of incision complex in GG-NER |
0.1 | 0.4 | REACTOME DESTABILIZATION OF MRNA BY KSRP | Genes involved in Destabilization of mRNA by KSRP |
0.1 | 0.9 | REACTOME REGULATION OF RHEB GTPASE ACTIVITY BY AMPK | Genes involved in Regulation of Rheb GTPase activity by AMPK |
0.1 | 1.4 | REACTOME NUCLEAR SIGNALING BY ERBB4 | Genes involved in Nuclear signaling by ERBB4 |
0.1 | 1.3 | REACTOME TRIGLYCERIDE BIOSYNTHESIS | Genes involved in Triglyceride Biosynthesis |
0.1 | 2.1 | REACTOME PHASE1 FUNCTIONALIZATION OF COMPOUNDS | Genes involved in Phase 1 - Functionalization of compounds |
0.1 | 1.0 | REACTOME PURINE SALVAGE | Genes involved in Purine salvage |
0.1 | 1.9 | REACTOME SIGNALING BY BMP | Genes involved in Signaling by BMP |
0.1 | 1.8 | REACTOME GLUTATHIONE CONJUGATION | Genes involved in Glutathione conjugation |
0.1 | 0.1 | REACTOME NEUROTRANSMITTER RECEPTOR BINDING AND DOWNSTREAM TRANSMISSION IN THE POSTSYNAPTIC CELL | Genes involved in Neurotransmitter Receptor Binding And Downstream Transmission In The Postsynaptic Cell |
0.1 | 0.8 | REACTOME CASPASE MEDIATED CLEAVAGE OF CYTOSKELETAL PROTEINS | Genes involved in Caspase-mediated cleavage of cytoskeletal proteins |
0.1 | 0.6 | REACTOME SYNTHESIS OF BILE ACIDS AND BILE SALTS VIA 7ALPHA HYDROXYCHOLESTEROL | Genes involved in Synthesis of bile acids and bile salts via 7alpha-hydroxycholesterol |
0.1 | 1.3 | REACTOME DEADENYLATION OF MRNA | Genes involved in Deadenylation of mRNA |
0.1 | 0.9 | REACTOME HDL MEDIATED LIPID TRANSPORT | Genes involved in HDL-mediated lipid transport |
0.1 | 0.4 | REACTOME REGULATION OF THE FANCONI ANEMIA PATHWAY | Genes involved in Regulation of the Fanconi anemia pathway |
0.1 | 1.5 | REACTOME RNA POL I TRANSCRIPTION TERMINATION | Genes involved in RNA Polymerase I Transcription Termination |
0.1 | 0.1 | REACTOME VIF MEDIATED DEGRADATION OF APOBEC3G | Genes involved in Vif-mediated degradation of APOBEC3G |
0.1 | 0.8 | REACTOME CIRCADIAN CLOCK | Genes involved in Circadian Clock |
0.1 | 1.7 | REACTOME PHASE II CONJUGATION | Genes involved in Phase II conjugation |
0.1 | 0.4 | REACTOME INTERACTIONS OF VPR WITH HOST CELLULAR PROTEINS | Genes involved in Interactions of Vpr with host cellular proteins |
0.1 | 0.7 | REACTOME TGF BETA RECEPTOR SIGNALING IN EMT EPITHELIAL TO MESENCHYMAL TRANSITION | Genes involved in TGF-beta receptor signaling in EMT (epithelial to mesenchymal transition) |
0.1 | 0.5 | REACTOME GLYCOPROTEIN HORMONES | Genes involved in Glycoprotein hormones |
0.1 | 3.7 | REACTOME TRANSPORT OF MATURE TRANSCRIPT TO CYTOPLASM | Genes involved in Transport of Mature Transcript to Cytoplasm |
0.1 | 2.5 | REACTOME PRE NOTCH EXPRESSION AND PROCESSING | Genes involved in Pre-NOTCH Expression and Processing |
0.1 | 1.5 | REACTOME DOWNSTREAM TCR SIGNALING | Genes involved in Downstream TCR signaling |
0.1 | 0.3 | REACTOME DOPAMINE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Dopamine Neurotransmitter Release Cycle |
0.1 | 4.3 | REACTOME RESPIRATORY ELECTRON TRANSPORT | Genes involved in Respiratory electron transport |
0.1 | 0.1 | REACTOME PEPTIDE HORMONE BIOSYNTHESIS | Genes involved in Peptide hormone biosynthesis |
0.1 | 0.8 | REACTOME REGULATION OF PYRUVATE DEHYDROGENASE PDH COMPLEX | Genes involved in Regulation of pyruvate dehydrogenase (PDH) complex |
0.1 | 0.6 | REACTOME ACTIVATED AMPK STIMULATES FATTY ACID OXIDATION IN MUSCLE | Genes involved in Activated AMPK stimulates fatty-acid oxidation in muscle |
0.1 | 2.9 | REACTOME MITOCHONDRIAL PROTEIN IMPORT | Genes involved in Mitochondrial Protein Import |
0.1 | 1.2 | REACTOME CGMP EFFECTS | Genes involved in cGMP effects |
0.1 | 0.7 | REACTOME DCC MEDIATED ATTRACTIVE SIGNALING | Genes involved in DCC mediated attractive signaling |
0.1 | 0.7 | REACTOME METABOLISM OF POLYAMINES | Genes involved in Metabolism of polyamines |
0.1 | 2.5 | REACTOME NRAGE SIGNALS DEATH THROUGH JNK | Genes involved in NRAGE signals death through JNK |
0.1 | 0.1 | REACTOME P75NTR RECRUITS SIGNALLING COMPLEXES | Genes involved in p75NTR recruits signalling complexes |
0.1 | 8.4 | REACTOME METABOLISM OF AMINO ACIDS AND DERIVATIVES | Genes involved in Metabolism of amino acids and derivatives |
0.1 | 1.2 | REACTOME G1 PHASE | Genes involved in G1 Phase |
0.1 | 0.8 | REACTOME METABOLISM OF NON CODING RNA | Genes involved in Metabolism of non-coding RNA |
0.1 | 0.8 | REACTOME SIGNALING BY NODAL | Genes involved in Signaling by NODAL |
0.1 | 0.6 | REACTOME ACTIVATED TAK1 MEDIATES P38 MAPK ACTIVATION | Genes involved in activated TAK1 mediates p38 MAPK activation |
0.1 | 2.3 | REACTOME ACTIVATION OF CHAPERONE GENES BY XBP1S | Genes involved in Activation of Chaperone Genes by XBP1(S) |
0.1 | 0.1 | REACTOME NEP NS2 INTERACTS WITH THE CELLULAR EXPORT MACHINERY | Genes involved in NEP/NS2 Interacts with the Cellular Export Machinery |
0.1 | 0.4 | REACTOME IL 7 SIGNALING | Genes involved in Interleukin-7 signaling |
0.1 | 1.2 | REACTOME DARPP 32 EVENTS | Genes involved in DARPP-32 events |
0.1 | 1.9 | REACTOME AMINE LIGAND BINDING RECEPTORS | Genes involved in Amine ligand-binding receptors |
0.1 | 0.2 | REACTOME JNK C JUN KINASES PHOSPHORYLATION AND ACTIVATION MEDIATED BY ACTIVATED HUMAN TAK1 | Genes involved in JNK (c-Jun kinases) phosphorylation and activation mediated by activated human TAK1 |
0.1 | 0.1 | REACTOME DESTABILIZATION OF MRNA BY TRISTETRAPROLIN TTP | Genes involved in Destabilization of mRNA by Tristetraprolin (TTP) |
0.1 | 0.5 | REACTOME DOWNREGULATION OF TGF BETA RECEPTOR SIGNALING | Genes involved in Downregulation of TGF-beta receptor signaling |
0.1 | 0.3 | REACTOME ABACAVIR TRANSPORT AND METABOLISM | Genes involved in Abacavir transport and metabolism |
0.1 | 0.2 | REACTOME RECYCLING OF BILE ACIDS AND SALTS | Genes involved in Recycling of bile acids and salts |
0.1 | 1.4 | REACTOME BIOSYNTHESIS OF THE N GLYCAN PRECURSOR DOLICHOL LIPID LINKED OLIGOSACCHARIDE LLO AND TRANSFER TO A NASCENT PROTEIN | Genes involved in Biosynthesis of the N-glycan precursor (dolichol lipid-linked oligosaccharide, LLO) and transfer to a nascent protein |
0.1 | 0.1 | REACTOME TRAF6 MEDIATED IRF7 ACTIVATION | Genes involved in TRAF6 mediated IRF7 activation |
0.1 | 0.8 | REACTOME ANTIGEN PROCESSING CROSS PRESENTATION | Genes involved in Antigen processing-Cross presentation |
0.1 | 0.2 | REACTOME PROSTANOID LIGAND RECEPTORS | Genes involved in Prostanoid ligand receptors |
0.0 | 1.1 | REACTOME ENDOSOMAL SORTING COMPLEX REQUIRED FOR TRANSPORT ESCRT | Genes involved in Endosomal Sorting Complex Required For Transport (ESCRT) |
0.0 | 1.2 | REACTOME ASSOCIATION OF TRIC CCT WITH TARGET PROTEINS DURING BIOSYNTHESIS | Genes involved in Association of TriC/CCT with target proteins during biosynthesis |
0.0 | 0.9 | REACTOME INSULIN SYNTHESIS AND PROCESSING | Genes involved in Insulin Synthesis and Processing |
0.0 | 0.2 | REACTOME ERKS ARE INACTIVATED | Genes involved in ERKs are inactivated |
0.0 | 0.3 | REACTOME TRAF6 MEDIATED INDUCTION OF TAK1 COMPLEX | Genes involved in TRAF6 mediated induction of TAK1 complex |
0.0 | 1.1 | REACTOME POST TRANSLATIONAL MODIFICATION SYNTHESIS OF GPI ANCHORED PROTEINS | Genes involved in Post-translational modification: synthesis of GPI-anchored proteins |
0.0 | 0.2 | REACTOME DIGESTION OF DIETARY CARBOHYDRATE | Genes involved in Digestion of dietary carbohydrate |
0.0 | 0.8 | REACTOME SMOOTH MUSCLE CONTRACTION | Genes involved in Smooth Muscle Contraction |
0.0 | 0.3 | REACTOME TRAFFICKING AND PROCESSING OF ENDOSOMAL TLR | Genes involved in Trafficking and processing of endosomal TLR |
0.0 | 0.4 | REACTOME APOPTOTIC CLEAVAGE OF CELL ADHESION PROTEINS | Genes involved in Apoptotic cleavage of cell adhesion proteins |
0.0 | 0.5 | REACTOME CLASS C 3 METABOTROPIC GLUTAMATE PHEROMONE RECEPTORS | Genes involved in Class C/3 (Metabotropic glutamate/pheromone receptors) |
0.0 | 0.5 | REACTOME MITOCHONDRIAL FATTY ACID BETA OXIDATION | Genes involved in Mitochondrial Fatty Acid Beta-Oxidation |
0.0 | 0.5 | REACTOME SYNTHESIS SECRETION AND INACTIVATION OF GIP | Genes involved in Synthesis, Secretion, and Inactivation of Glucose-dependent Insulinotropic Polypeptide (GIP) |
0.0 | 0.1 | REACTOME P53 INDEPENDENT G1 S DNA DAMAGE CHECKPOINT | Genes involved in p53-Independent G1/S DNA damage checkpoint |
0.0 | 0.3 | REACTOME ELEVATION OF CYTOSOLIC CA2 LEVELS | Genes involved in Elevation of cytosolic Ca2+ levels |
0.0 | 0.2 | REACTOME G ALPHA1213 SIGNALLING EVENTS | Genes involved in G alpha (12/13) signalling events |
0.0 | 0.4 | REACTOME CREB PHOSPHORYLATION THROUGH THE ACTIVATION OF CAMKII | Genes involved in CREB phosphorylation through the activation of CaMKII |
0.0 | 0.4 | REACTOME CYCLIN A B1 ASSOCIATED EVENTS DURING G2 M TRANSITION | Genes involved in Cyclin A/B1 associated events during G2/M transition |
0.0 | 1.0 | REACTOME TRANSPORT OF VITAMINS NUCLEOSIDES AND RELATED MOLECULES | Genes involved in Transport of vitamins, nucleosides, and related molecules |
0.0 | 0.2 | REACTOME SIGNALING BY FGFR1 MUTANTS | Genes involved in Signaling by FGFR1 mutants |
0.0 | 1.2 | REACTOME MRNA SPLICING MINOR PATHWAY | Genes involved in mRNA Splicing - Minor Pathway |
0.0 | 0.5 | REACTOME ZINC TRANSPORTERS | Genes involved in Zinc transporters |
0.0 | 1.7 | REACTOME LOSS OF NLP FROM MITOTIC CENTROSOMES | Genes involved in Loss of Nlp from mitotic centrosomes |
0.0 | 0.4 | REACTOME PYRIMIDINE METABOLISM | Genes involved in Pyrimidine metabolism |
0.0 | 0.4 | REACTOME PEROXISOMAL LIPID METABOLISM | Genes involved in Peroxisomal lipid metabolism |
0.0 | 0.5 | REACTOME EGFR DOWNREGULATION | Genes involved in EGFR downregulation |
0.0 | 0.7 | REACTOME MUSCLE CONTRACTION | Genes involved in Muscle contraction |
0.0 | 0.2 | REACTOME PACKAGING OF TELOMERE ENDS | Genes involved in Packaging Of Telomere Ends |
0.0 | 1.5 | REACTOME O LINKED GLYCOSYLATION OF MUCINS | Genes involved in O-linked glycosylation of mucins |
0.0 | 0.7 | REACTOME TRANSFERRIN ENDOCYTOSIS AND RECYCLING | Genes involved in Transferrin endocytosis and recycling |
0.0 | 0.2 | REACTOME CYCLIN E ASSOCIATED EVENTS DURING G1 S TRANSITION | Genes involved in Cyclin E associated events during G1/S transition |
0.0 | 1.0 | REACTOME HS GAG BIOSYNTHESIS | Genes involved in HS-GAG biosynthesis |
0.0 | 0.1 | REACTOME SIGNALLING TO P38 VIA RIT AND RIN | Genes involved in Signalling to p38 via RIT and RIN |
0.0 | 0.4 | REACTOME FANCONI ANEMIA PATHWAY | Genes involved in Fanconi Anemia pathway |
0.0 | 0.2 | REACTOME P38MAPK EVENTS | Genes involved in p38MAPK events |
0.0 | 0.2 | REACTOME HS GAG DEGRADATION | Genes involved in HS-GAG degradation |
0.0 | 0.2 | REACTOME REGULATION OF KIT SIGNALING | Genes involved in Regulation of KIT signaling |
0.0 | 0.2 | REACTOME RECRUITMENT OF MITOTIC CENTROSOME PROTEINS AND COMPLEXES | Genes involved in Recruitment of mitotic centrosome proteins and complexes |
0.0 | 0.1 | REACTOME SYNTHESIS SECRETION AND INACTIVATION OF GLP1 | Genes involved in Synthesis, Secretion, and Inactivation of Glucagon-like Peptide-1 (GLP-1) |
0.0 | 0.1 | REACTOME INHIBITION OF REPLICATION INITIATION OF DAMAGED DNA BY RB1 E2F1 | Genes involved in Inhibition of replication initiation of damaged DNA by RB1/E2F1 |
0.0 | 0.4 | REACTOME PREFOLDIN MEDIATED TRANSFER OF SUBSTRATE TO CCT TRIC | Genes involved in Prefoldin mediated transfer of substrate to CCT/TriC |
0.0 | 0.2 | REACTOME FORMATION OF TRANSCRIPTION COUPLED NER TC NER REPAIR COMPLEX | Genes involved in Formation of transcription-coupled NER (TC-NER) repair complex |
0.0 | 0.4 | REACTOME SIGNALING BY EGFR IN CANCER | Genes involved in Signaling by EGFR in Cancer |
0.0 | 0.3 | REACTOME SIGNALING BY SCF KIT | Genes involved in Signaling by SCF-KIT |
0.0 | 0.7 | REACTOME ASPARAGINE N LINKED GLYCOSYLATION | Genes involved in Asparagine N-linked glycosylation |
0.0 | 0.1 | REACTOME PHOSPHORYLATION OF CD3 AND TCR ZETA CHAINS | Genes involved in Phosphorylation of CD3 and TCR zeta chains |
0.0 | 0.3 | REACTOME P2Y RECEPTORS | Genes involved in P2Y receptors |
0.0 | 0.5 | REACTOME NCAM1 INTERACTIONS | Genes involved in NCAM1 interactions |
0.0 | 0.3 | REACTOME CELL EXTRACELLULAR MATRIX INTERACTIONS | Genes involved in Cell-extracellular matrix interactions |
0.0 | 2.0 | REACTOME SRP DEPENDENT COTRANSLATIONAL PROTEIN TARGETING TO MEMBRANE | Genes involved in SRP-dependent cotranslational protein targeting to membrane |
0.0 | 0.2 | REACTOME REGULATION OF BETA CELL DEVELOPMENT | Genes involved in Regulation of beta-cell development |
0.0 | 0.3 | REACTOME FORMATION OF THE TERNARY COMPLEX AND SUBSEQUENTLY THE 43S COMPLEX | Genes involved in Formation of the ternary complex, and subsequently, the 43S complex |
0.0 | 0.1 | REACTOME NA CL DEPENDENT NEUROTRANSMITTER TRANSPORTERS | Genes involved in Na+/Cl- dependent neurotransmitter transporters |
0.0 | 0.4 | REACTOME DEPOSITION OF NEW CENPA CONTAINING NUCLEOSOMES AT THE CENTROMERE | Genes involved in Deposition of New CENPA-containing Nucleosomes at the Centromere |
0.0 | 0.7 | REACTOME GLYCOSPHINGOLIPID METABOLISM | Genes involved in Glycosphingolipid metabolism |
0.0 | 0.1 | REACTOME INTRINSIC PATHWAY | Genes involved in Intrinsic Pathway |
0.0 | 0.1 | REACTOME FORMATION OF RNA POL II ELONGATION COMPLEX | Genes involved in Formation of RNA Pol II elongation complex |
0.0 | 0.4 | REACTOME MITOCHONDRIAL TRNA AMINOACYLATION | Genes involved in Mitochondrial tRNA aminoacylation |
0.0 | 0.8 | REACTOME AMINO ACID AND OLIGOPEPTIDE SLC TRANSPORTERS | Genes involved in Amino acid and oligopeptide SLC transporters |
0.0 | 0.2 | REACTOME REGULATION OF HYPOXIA INDUCIBLE FACTOR HIF BY OXYGEN | Genes involved in Regulation of Hypoxia-inducible Factor (HIF) by Oxygen |
0.0 | 0.0 | REACTOME FGFR1 LIGAND BINDING AND ACTIVATION | Genes involved in FGFR1 ligand binding and activation |
0.0 | 0.1 | REACTOME PLATELET ADHESION TO EXPOSED COLLAGEN | Genes involved in Platelet Adhesion to exposed collagen |
0.0 | 0.0 | REACTOME TAK1 ACTIVATES NFKB BY PHOSPHORYLATION AND ACTIVATION OF IKKS COMPLEX | Genes involved in TAK1 activates NFkB by phosphorylation and activation of IKKs complex |
0.0 | 0.6 | REACTOME NUCLEAR RECEPTOR TRANSCRIPTION PATHWAY | Genes involved in Nuclear Receptor transcription pathway |
0.0 | 0.0 | REACTOME MRNA CAPPING | Genes involved in mRNA Capping |
0.0 | 0.1 | REACTOME IONOTROPIC ACTIVITY OF KAINATE RECEPTORS | Genes involved in Ionotropic activity of Kainate Receptors |
0.0 | 1.3 | REACTOME CLASS B 2 SECRETIN FAMILY RECEPTORS | Genes involved in Class B/2 (Secretin family receptors) |
0.0 | 0.2 | REACTOME PROCESSIVE SYNTHESIS ON THE LAGGING STRAND | Genes involved in Processive synthesis on the lagging strand |
0.0 | 0.1 | REACTOME GAMMA CARBOXYLATION TRANSPORT AND AMINO TERMINAL CLEAVAGE OF PROTEINS | Genes involved in Gamma-carboxylation, transport, and amino-terminal cleavage of proteins |
0.0 | 0.1 | REACTOME PROTEIN FOLDING | Genes involved in Protein folding |
0.0 | 0.3 | REACTOME INTERACTION BETWEEN L1 AND ANKYRINS | Genes involved in Interaction between L1 and Ankyrins |
0.0 | 0.1 | REACTOME LYSOSOME VESICLE BIOGENESIS | Genes involved in Lysosome Vesicle Biogenesis |
0.0 | 0.7 | REACTOME COLLAGEN FORMATION | Genes involved in Collagen formation |
0.0 | 0.2 | REACTOME MEIOTIC SYNAPSIS | Genes involved in Meiotic Synapsis |
0.0 | 0.1 | REACTOME HYALURONAN UPTAKE AND DEGRADATION | Genes involved in Hyaluronan uptake and degradation |
0.0 | 0.2 | REACTOME HOST INTERACTIONS OF HIV FACTORS | Genes involved in Host Interactions of HIV factors |
0.0 | 1.0 | REACTOME FACTORS INVOLVED IN MEGAKARYOCYTE DEVELOPMENT AND PLATELET PRODUCTION | Genes involved in Factors involved in megakaryocyte development and platelet production |
0.0 | 0.0 | REACTOME HYALURONAN METABOLISM | Genes involved in Hyaluronan metabolism |
0.0 | 0.1 | REACTOME APOPTOTIC CLEAVAGE OF CELLULAR PROTEINS | Genes involved in Apoptotic cleavage of cellular proteins |
0.0 | 0.1 | REACTOME GABA SYNTHESIS RELEASE REUPTAKE AND DEGRADATION | Genes involved in GABA synthesis, release, reuptake and degradation |