Gene Symbol | Gene ID | Gene Info |
---|---|---|
Foxp2
|
ENSMUSG00000029563.10 | Foxp2 |
Foxp3
|
ENSMUSG00000039521.6 | Foxp3 |
Gene | Promoter | Distance | Association probability | Pearson corr. coef. | P-value | Plot |
---|---|---|---|---|---|---|
Foxp2 | chr6_14839027_14839193 | 62239 | 0.142394 | 0.97 | 1.0e-03 | Click! |
Foxp2 | chr6_15257797_15258150 | 3690 | 0.377725 | 0.97 | 1.1e-03 | Click! |
Foxp2 | chr6_15185975_15186175 | 512 | 0.887797 | 0.91 | 1.1e-02 | Click! |
Foxp2 | chr6_14897753_14897997 | 3474 | 0.383816 | 0.91 | 1.1e-02 | Click! |
Foxp2 | chr6_14901799_14902023 | 433 | 0.910802 | 0.91 | 1.2e-02 | Click! |
Move your cursor over a bar to see sample name and corresponding Z-value.
Cis Regulatory Element (CRE) | Target Score | Top associated gene | Gene Info | Distance of CRE to TSS | CRE/Gene association probability |
---|---|---|---|---|---|
chr2_28882435_28882761 | 34.54 |
Ddx31 |
DEAD/H (Asp-Glu-Ala-Asp/His) box polypeptide 31 |
25457 |
0.13 |
chr6_149155690_149155853 | 8.12 |
Etfbkmt |
electron transfer flavoprotein beta subunit lysine methyltransferase |
14125 |
0.12 |
chr11_19991125_19991324 | 7.91 |
Spred2 |
sprouty-related EVH1 domain containing 2 |
36654 |
0.19 |
chr11_28684227_28684558 | 7.50 |
2810471M01Rik |
RIKEN cDNA 2810471M01 gene |
2828 |
0.27 |
chr11_80974932_80975087 | 6.87 |
Gm11416 |
predicted gene 11416 |
71785 |
0.1 |
chr4_3939020_3939731 | 6.79 |
Chchd7 |
coiled-coil-helix-coiled-coil-helix domain containing 7 |
47 |
0.94 |
chr6_101160855_101161061 | 6.71 |
Gm19726 |
predicted gene, 19726 |
14479 |
0.15 |
chr12_28038561_28038854 | 6.63 |
Gm25923 |
predicted gene, 25923 |
21821 |
0.21 |
chr5_38117047_38117323 | 6.55 |
Stx18 |
syntaxin 18 |
3724 |
0.2 |
chr13_113023428_113023726 | 6.13 |
Cdc20b |
cell division cycle 20B |
11534 |
0.08 |
chr2_134491717_134491883 | 5.97 |
Hao1 |
hydroxyacid oxidase 1, liver |
62507 |
0.15 |
chr14_75192862_75193407 | 5.96 |
Lcp1 |
lymphocyte cytosolic protein 1 |
2805 |
0.21 |
chr17_70753482_70753646 | 5.95 |
5031415H12Rik |
RIKEN cDNA 5031415H12 gene |
2018 |
0.31 |
chr7_96971758_96971942 | 5.78 |
C230038L03Rik |
RIKEN cDNA C230038L03 gene |
19964 |
0.17 |
chr7_63923519_63923771 | 5.75 |
Klf13 |
Kruppel-like factor 13 |
1225 |
0.37 |
chr18_17623971_17624154 | 5.71 |
4930545E07Rik |
RIKEN cDNA 4930545E07 gene |
43072 |
0.18 |
chr8_36269996_36270164 | 5.58 |
Lonrf1 |
LON peptidase N-terminal domain and ring finger 1 |
20564 |
0.19 |
chr10_69926234_69926547 | 5.37 |
Ank3 |
ankyrin 3, epithelial |
257 |
0.96 |
chr7_101084310_101084461 | 5.34 |
Fchsd2 |
FCH and double SH3 domains 2 |
8478 |
0.17 |
chr3_121789937_121790142 | 5.32 |
4633401B06Rik |
RIKEN cDNA 4633401B06 gene |
1467 |
0.29 |
chr14_61427627_61427794 | 5.32 |
Kpna3 |
karyopherin (importin) alpha 3 |
12164 |
0.14 |
chr12_104343910_104344587 | 5.30 |
Serpina3k |
serine (or cysteine) peptidase inhibitor, clade A, member 3K |
5762 |
0.12 |
chr2_122245449_122245959 | 5.29 |
Sord |
sorbitol dehydrogenase |
10955 |
0.11 |
chr13_9762543_9762762 | 5.29 |
Zmynd11 |
zinc finger, MYND domain containing 11 |
1698 |
0.3 |
chr6_114919443_114919619 | 5.22 |
Vgll4 |
vestigial like family member 4 |
2285 |
0.35 |
chr1_40236870_40237279 | 5.15 |
Gm38070 |
predicted gene, 38070 |
946 |
0.59 |
chr15_27525366_27525772 | 5.13 |
B230362B09Rik |
RIKEN cDNA B230362B09 gene |
21657 |
0.15 |
chr16_30369037_30369274 | 5.13 |
Atp13a3 |
ATPase type 13A3 |
11912 |
0.2 |
chr19_32788703_32789372 | 5.10 |
Pten |
phosphatase and tensin homolog |
22188 |
0.22 |
chrX_23710209_23710816 | 5.07 |
Wdr44 |
WD repeat domain 44 |
17353 |
0.28 |
chr2_113534474_113534796 | 5.06 |
Gm13964 |
predicted gene 13964 |
30601 |
0.17 |
chr2_146429524_146429960 | 5.05 |
Ralgapa2 |
Ral GTPase activating protein, alpha subunit 2 (catalytic) |
16866 |
0.26 |
chr6_108282092_108282442 | 5.01 |
Itpr1 |
inositol 1,4,5-trisphosphate receptor 1 |
29309 |
0.22 |
chr16_26562054_26562655 | 4.88 |
Il1rap |
interleukin 1 receptor accessory protein |
19350 |
0.22 |
chrX_60380220_60380463 | 4.84 |
Mir505 |
microRNA 505 |
14151 |
0.2 |
chr2_156731884_156732035 | 4.84 |
Dlgap4 |
DLG associated protein 4 |
10467 |
0.13 |
chr18_38370754_38370932 | 4.83 |
Gm4949 |
predicted gene 4949 |
10305 |
0.12 |
chr15_81875899_81876075 | 4.82 |
Aco2 |
aconitase 2, mitochondrial |
3297 |
0.12 |
chr2_72204001_72204398 | 4.79 |
Rapgef4 |
Rap guanine nucleotide exchange factor (GEF) 4 |
5400 |
0.2 |
chr5_110765348_110765499 | 4.75 |
Ep400 |
E1A binding protein p400 |
4732 |
0.12 |
chr9_122357685_122358080 | 4.74 |
Abhd5 |
abhydrolase domain containing 5 |
5771 |
0.15 |
chr14_68458990_68459141 | 4.71 |
Gm31227 |
predicted gene, 31227 |
2566 |
0.36 |
chr1_51770461_51770858 | 4.71 |
Myo1b |
myosin IB |
220 |
0.94 |
chr1_67187795_67187968 | 4.67 |
Gm15668 |
predicted gene 15668 |
61319 |
0.11 |
chr7_84129291_84129727 | 4.64 |
Abhd17c |
abhydrolase domain containing 17C |
18306 |
0.14 |
chr15_34500771_34501210 | 4.62 |
Pop1 |
processing of precursor 1, ribonuclease P/MRP family, (S. cerevisiae) |
5667 |
0.12 |
chr3_94398519_94398670 | 4.61 |
Lingo4 |
leucine rich repeat and Ig domain containing 4 |
77 |
0.91 |
chr11_72683212_72683363 | 4.60 |
Ankfy1 |
ankyrin repeat and FYVE domain containing 1 |
6719 |
0.18 |
chrX_42198771_42199059 | 4.59 |
Stag2 |
stromal antigen 2 |
46735 |
0.14 |
chr4_132417093_132417563 | 4.54 |
Phactr4 |
phosphatase and actin regulator 4 |
5113 |
0.1 |
chr3_97639633_97639825 | 4.53 |
Fmo5 |
flavin containing monooxygenase 5 |
10846 |
0.13 |
chr10_53929773_53930076 | 4.53 |
Man1a |
mannosidase 1, alpha |
47191 |
0.16 |
chr19_40183824_40184026 | 4.52 |
Cyp2c70 |
cytochrome P450, family 2, subfamily c, polypeptide 70 |
3361 |
0.2 |
chr8_104788809_104788992 | 4.51 |
Gm45782 |
predicted gene 45782 |
3072 |
0.13 |
chr1_162986828_162987029 | 4.50 |
Fmo3 |
flavin containing monooxygenase 3 |
2400 |
0.25 |
chr4_129249637_129249797 | 4.48 |
C77080 |
expressed sequence C77080 |
1274 |
0.32 |
chr17_32889952_32890291 | 4.46 |
Zfp870 |
zinc finger protein 870 |
1412 |
0.22 |
chr5_127956818_127956989 | 4.43 |
Gm17131 |
predicted gene 17131 |
78372 |
0.1 |
chr16_66041495_66041684 | 4.41 |
Gm49635 |
predicted gene, 49635 |
94483 |
0.09 |
chr6_120318643_120318978 | 4.41 |
B4galnt3 |
beta-1,4-N-acetyl-galactosaminyl transferase 3 |
24251 |
0.15 |
chr12_57515437_57515691 | 4.40 |
Gm2568 |
predicted gene 2568 |
5060 |
0.18 |
chr9_119979991_119980162 | 4.38 |
Csrnp1 |
cysteine-serine-rich nuclear protein 1 |
2741 |
0.14 |
chr4_108780980_108781662 | 4.38 |
Zfyve9 |
zinc finger, FYVE domain containing 9 |
523 |
0.73 |
chr1_127899545_127899941 | 4.38 |
Rab3gap1 |
RAB3 GTPase activating protein subunit 1 |
1170 |
0.47 |
chr8_35216693_35216844 | 4.36 |
Gm34474 |
predicted gene, 34474 |
1870 |
0.27 |
chr15_85766228_85766381 | 4.29 |
Ppara |
peroxisome proliferator activated receptor alpha |
5910 |
0.16 |
chr15_59005379_59005677 | 4.28 |
4930544F09Rik |
RIKEN cDNA 4930544F09 gene |
21392 |
0.16 |
chr13_4270426_4270629 | 4.24 |
Akr1c12 |
aldo-keto reductase family 1, member C12 |
8906 |
0.15 |
chr11_32688134_32688285 | 4.21 |
Fbxw11 |
F-box and WD-40 domain protein 11 |
45305 |
0.14 |
chr8_91405021_91405563 | 4.21 |
Gm45427 |
predicted gene 45427 |
13347 |
0.15 |
chr3_18157205_18157356 | 4.19 |
Gm23686 |
predicted gene, 23686 |
20345 |
0.21 |
chr5_92169759_92169953 | 4.17 |
Uso1 |
USO1 vesicle docking factor |
11533 |
0.11 |
chr12_16574995_16575146 | 4.17 |
Lpin1 |
lipin 1 |
12626 |
0.23 |
chr19_21654390_21654886 | 4.15 |
Abhd17b |
abhydrolase domain containing 17B |
1113 |
0.45 |
chr8_84842789_84843130 | 4.13 |
Calr |
calreticulin |
1957 |
0.13 |
chr9_86482334_86482508 | 4.12 |
Dop1a |
DOP1 leucine zipper like protein A |
2986 |
0.25 |
chr1_51774175_51774474 | 4.12 |
Myo1b |
myosin IB |
2112 |
0.33 |
chr3_136853089_136853240 | 4.11 |
Ppp3ca |
protein phosphatase 3, catalytic subunit, alpha isoform |
18471 |
0.2 |
chr11_48806124_48806302 | 4.08 |
Rack1 |
receptor for activated C kinase 1 |
765 |
0.41 |
chr4_97761377_97761528 | 4.06 |
Gm12676 |
predicted gene 12676 |
4063 |
0.24 |
chr4_126764883_126765039 | 4.05 |
AU040320 |
expressed sequence AU040320 |
11135 |
0.13 |
chr13_75225963_75226157 | 4.04 |
Gm19095 |
predicted gene, 19095 |
26846 |
0.23 |
chr12_3537548_3537727 | 4.00 |
Rps7-ps2 |
ribosomal protein S7, pseudogene 2 |
14369 |
0.17 |
chr4_20016089_20016248 | 3.99 |
Ttpa |
tocopherol (alpha) transfer protein |
7740 |
0.2 |
chr4_47366562_47366857 | 3.99 |
Tgfbr1 |
transforming growth factor, beta receptor I |
13099 |
0.22 |
chr3_133544844_133545488 | 3.97 |
Tet2 |
tet methylcytosine dioxygenase 2 |
27 |
0.53 |
chr11_50312282_50312433 | 3.97 |
Canx |
calnexin |
11367 |
0.12 |
chr2_72206740_72207276 | 3.97 |
Rapgef4 |
Rap guanine nucleotide exchange factor (GEF) 4 |
8209 |
0.18 |
chr3_113539787_113539957 | 3.95 |
Amy2a1 |
amylase 2a1 |
7444 |
0.22 |
chr3_89148683_89148834 | 3.94 |
Hcn3 |
hyperpolarization-activated, cyclic nucleotide-gated K+ 3 |
2456 |
0.11 |
chr4_108076131_108076312 | 3.93 |
Scp2 |
sterol carrier protein 2, liver |
4802 |
0.15 |
chr6_149359539_149359690 | 3.93 |
Gm15784 |
predicted gene 15784 |
2072 |
0.23 |
chr15_7120204_7120385 | 3.91 |
Lifr |
LIF receptor alpha |
9265 |
0.28 |
chr3_133726266_133726417 | 3.90 |
Gm40153 |
predicted gene, 40153 |
62950 |
0.1 |
chr15_6891349_6891647 | 3.88 |
Osmr |
oncostatin M receptor |
16529 |
0.26 |
chr17_26724491_26724642 | 3.88 |
Crebrf |
CREB3 regulatory factor |
8842 |
0.16 |
chr11_107548058_107548221 | 3.88 |
Helz |
helicase with zinc finger domain |
171 |
0.57 |
chr4_76286709_76286940 | 3.87 |
Ptprd |
protein tyrosine phosphatase, receptor type, D |
38419 |
0.21 |
chr9_65192311_65192500 | 3.84 |
Parp16 |
poly (ADP-ribose) polymerase family, member 16 |
2948 |
0.16 |
chr6_38344018_38344169 | 3.83 |
Zc3hav1 |
zinc finger CCCH type, antiviral 1 |
10180 |
0.13 |
chr12_24706013_24706174 | 3.83 |
Rrm2 |
ribonucleotide reductase M2 |
2148 |
0.23 |
chr1_170142739_170142898 | 3.82 |
Uap1 |
UDP-N-acetylglucosamine pyrophosphorylase 1 |
895 |
0.52 |
chr9_61113297_61113621 | 3.82 |
Gm34004 |
predicted gene, 34004 |
3073 |
0.19 |
chr9_74892080_74892501 | 3.79 |
Onecut1 |
one cut domain, family member 1 |
25806 |
0.14 |
chr6_144070883_144071211 | 3.78 |
Sox5os1 |
SRY (sex determining region Y)-box 5, opposite strand 1 |
49139 |
0.17 |
chr2_120640935_120641111 | 3.77 |
n-R5s205 |
nuclear encoded rRNA 5S 205 |
188 |
0.92 |
chr10_24915615_24916009 | 3.74 |
Arg1 |
arginase, liver |
595 |
0.65 |
chr13_55252702_55252865 | 3.73 |
Gm47816 |
predicted gene, 47816 |
1618 |
0.3 |
chr1_21246529_21246960 | 3.71 |
Gsta3 |
glutathione S-transferase, alpha 3 |
6115 |
0.12 |
chr9_122355767_122356085 | 3.70 |
Abhd5 |
abhydrolase domain containing 5 |
4137 |
0.17 |
chr9_61914762_61915200 | 3.70 |
Rplp1 |
ribosomal protein, large, P1 |
439 |
0.83 |
chr1_31072842_31073079 | 3.69 |
4931428L18Rik |
RIKEN cDNA 4931428L18 gene |
23494 |
0.14 |
chr5_49060180_49060366 | 3.67 |
Gm43047 |
predicted gene 43047 |
9730 |
0.1 |
chr1_164481731_164481909 | 3.67 |
Gm37732 |
predicted gene, 37732 |
7240 |
0.15 |
chr1_192075645_192075799 | 3.66 |
Gstp-ps |
glutathione S-transferase, pi, pseudogene |
1272 |
0.35 |
chr14_18304273_18304424 | 3.65 |
Ube2e1 |
ubiquitin-conjugating enzyme E2E 1 |
22943 |
0.14 |
chr3_149234408_149234559 | 3.64 |
Gm10287 |
predicted gene 10287 |
8738 |
0.21 |
chr9_74970668_74970899 | 3.64 |
Fam214a |
family with sequence similarity 214, member A |
5328 |
0.22 |
chr3_18210346_18210497 | 3.62 |
Gm23686 |
predicted gene, 23686 |
32796 |
0.17 |
chr6_8863024_8863175 | 3.61 |
Ica1 |
islet cell autoantigen 1 |
84611 |
0.1 |
chr17_25068452_25068629 | 3.60 |
Tmem204 |
transmembrane protein 204 |
9684 |
0.11 |
chr13_112500358_112500528 | 3.57 |
Il6st |
interleukin 6 signal transducer |
25397 |
0.14 |
chr10_117437437_117437791 | 3.56 |
Gm9002 |
predicted gene 9002 |
7996 |
0.14 |
chr7_12979741_12980348 | 3.56 |
Zfp446 |
zinc finger protein 446 |
524 |
0.55 |
chr9_55280024_55280330 | 3.56 |
Nrg4 |
neuregulin 4 |
3395 |
0.23 |
chr6_94690594_94690762 | 3.56 |
Lrig1 |
leucine-rich repeats and immunoglobulin-like domains 1 |
9459 |
0.23 |
chr3_18148711_18148862 | 3.56 |
Gm23686 |
predicted gene, 23686 |
28839 |
0.19 |
chr4_104768550_104768721 | 3.55 |
C8b |
complement component 8, beta polypeptide |
2240 |
0.4 |
chr1_45924605_45924765 | 3.55 |
Slc40a1 |
solute carrier family 40 (iron-regulated transporter), member 1 |
577 |
0.68 |
chr10_40519238_40519533 | 3.54 |
Gm18671 |
predicted gene, 18671 |
29507 |
0.15 |
chr9_122826708_122826859 | 3.54 |
Gm35549 |
predicted gene, 35549 |
17103 |
0.1 |
chr4_6268102_6268325 | 3.54 |
Gm11798 |
predicted gene 11798 |
7248 |
0.2 |
chr14_73379440_73379605 | 3.53 |
Itm2b |
integral membrane protein 2B |
3577 |
0.25 |
chr2_52372713_52372894 | 3.52 |
Neb |
nebulin |
5273 |
0.16 |
chr11_74676793_74676980 | 3.52 |
Cluh |
clustered mitochondria (cluA/CLU1) homolog |
12404 |
0.15 |
chr8_83590177_83590330 | 3.52 |
Tecr |
trans-2,3-enoyl-CoA reductase |
4168 |
0.11 |
chr1_88122933_88123203 | 3.52 |
Gm15372 |
predicted gene 15372 |
3708 |
0.08 |
chr5_114156681_114156888 | 3.51 |
Acacb |
acetyl-Coenzyme A carboxylase beta |
8734 |
0.13 |
chr6_15257797_15258150 | 3.51 |
Foxp2 |
forkhead box P2 |
3690 |
0.38 |
chr11_50139979_50140291 | 3.50 |
Tbc1d9b |
TBC1 domain family, member 9B |
4708 |
0.13 |
chr1_21259850_21260251 | 3.50 |
Gsta3 |
glutathione S-transferase, alpha 3 |
6529 |
0.11 |
chr9_60982764_60983106 | 3.50 |
Gm5122 |
predicted gene 5122 |
30546 |
0.14 |
chr4_54954362_54954516 | 3.50 |
Zfp462 |
zinc finger protein 462 |
6463 |
0.29 |
chr7_80323533_80323753 | 3.48 |
Rccd1 |
RCC1 domain containing 1 |
477 |
0.65 |
chr17_63195614_63195797 | 3.48 |
Gm24730 |
predicted gene, 24730 |
7033 |
0.28 |
chr1_30941324_30941475 | 3.48 |
Ptp4a1 |
protein tyrosine phosphatase 4a1 |
2905 |
0.22 |
chr6_6206187_6206411 | 3.48 |
Slc25a13 |
solute carrier family 25 (mitochondrial carrier, adenine nucleotide translocator), member 13 |
10819 |
0.23 |
chr13_102570134_102570306 | 3.47 |
Gm29927 |
predicted gene, 29927 |
20065 |
0.22 |
chr19_47580113_47580699 | 3.46 |
Slk |
STE20-like kinase |
387 |
0.82 |
chr3_98723391_98723749 | 3.46 |
Hsd3b2 |
hydroxy-delta-5-steroid dehydrogenase, 3 beta- and steroid delta-isomerase 2 |
961 |
0.47 |
chr16_93311764_93312102 | 3.45 |
1810053B23Rik |
RIKEN cDNA 1810053B23 gene |
41256 |
0.14 |
chr3_18160470_18160621 | 3.45 |
Gm23686 |
predicted gene, 23686 |
17080 |
0.22 |
chr4_59552954_59553292 | 3.45 |
Ptbp3 |
polypyrimidine tract binding protein 3 |
3759 |
0.18 |
chr4_53105561_53105899 | 3.45 |
Abca1 |
ATP-binding cassette, sub-family A (ABC1), member 1 |
54165 |
0.12 |
chr13_103916686_103916837 | 3.44 |
Erbin |
Erbb2 interacting protein |
3534 |
0.28 |
chr9_100535718_100535869 | 3.44 |
Gm28586 |
predicted gene 28586 |
4722 |
0.16 |
chr1_121324241_121324392 | 3.44 |
Insig2 |
insulin induced gene 2 |
1125 |
0.44 |
chr3_98697303_98697632 | 3.43 |
Gm12400 |
predicted gene 12400 |
9285 |
0.13 |
chr2_31517780_31518546 | 3.42 |
Ass1 |
argininosuccinate synthetase 1 |
327 |
0.88 |
chr9_122150660_122150823 | 3.41 |
Gm47121 |
predicted gene, 47121 |
8292 |
0.12 |
chr12_17401853_17402148 | 3.40 |
Gm36752 |
predicted gene, 36752 |
34618 |
0.12 |
chr12_8081681_8081832 | 3.40 |
Apob |
apolipoprotein B |
69397 |
0.1 |
chr15_41948299_41948658 | 3.40 |
Gm24751 |
predicted gene, 24751 |
519 |
0.8 |
chr4_6264246_6265210 | 3.38 |
Gm11798 |
predicted gene 11798 |
3763 |
0.24 |
chr4_35091285_35091672 | 3.37 |
Ifnk |
interferon kappa |
60578 |
0.1 |
chr1_34239606_34239757 | 3.37 |
Dst |
dystonin |
3085 |
0.23 |
chr7_101063151_101063541 | 3.37 |
Gm5735 |
predicted gene 5735 |
1871 |
0.29 |
chr17_64203273_64203432 | 3.36 |
Pja2 |
praja ring finger ubiquitin ligase 2 |
109679 |
0.07 |
chr1_118643313_118643502 | 3.36 |
Gm22094 |
predicted gene, 22094 |
5003 |
0.17 |
chr16_49775651_49775805 | 3.36 |
Gm15518 |
predicted gene 15518 |
23142 |
0.2 |
chr14_66105986_66106243 | 3.34 |
Ephx2 |
epoxide hydrolase 2, cytoplasmic |
4546 |
0.18 |
chr13_96576942_96577121 | 3.34 |
Gm46436 |
predicted gene, 46436 |
401 |
0.78 |
chr11_76541090_76541270 | 3.34 |
Gm12341 |
predicted gene 12341 |
27111 |
0.16 |
chr18_6529974_6530138 | 3.33 |
Epc1 |
enhancer of polycomb homolog 1 |
13948 |
0.16 |
chr14_21101960_21102164 | 3.32 |
Adk |
adenosine kinase |
25910 |
0.19 |
chr1_162881456_162881607 | 3.32 |
Fmo2 |
flavin containing monooxygenase 2 |
800 |
0.62 |
chr16_10451799_10451971 | 3.32 |
Tvp23a |
trans-golgi network vesicle protein 23A |
4523 |
0.18 |
chr8_46492911_46493695 | 3.32 |
Acsl1 |
acyl-CoA synthetase long-chain family member 1 |
471 |
0.78 |
chr11_86352944_86353305 | 3.31 |
Med13 |
mediator complex subunit 13 |
4478 |
0.24 |
chr9_70003747_70003946 | 3.31 |
Bnip2 |
BCL2/adenovirus E1B interacting protein 2 |
467 |
0.76 |
chr5_23562685_23562882 | 3.31 |
Srpk2 |
serine/arginine-rich protein specific kinase 2 |
13413 |
0.19 |
chr1_102517902_102518283 | 3.30 |
Gm20281 |
predicted gene, 20281 |
59170 |
0.14 |
chr15_63155793_63155965 | 3.30 |
Gm49013 |
predicted gene, 49013 |
9646 |
0.23 |
chr19_46234562_46234713 | 3.29 |
Gbf1 |
golgi-specific brefeldin A-resistance factor 1 |
11451 |
0.12 |
chr15_98869205_98869356 | 3.27 |
Kmt2d |
lysine (K)-specific methyltransferase 2D |
1903 |
0.14 |
chr1_51760023_51760217 | 3.27 |
Myo1b |
myosin IB |
4350 |
0.23 |
chr8_76513814_76513965 | 3.27 |
Gm45740 |
predicted gene 45740 |
98849 |
0.07 |
chr14_21033435_21033611 | 3.25 |
Vcl |
vinculin |
11520 |
0.18 |
chr15_97022020_97022207 | 3.25 |
Slc38a4 |
solute carrier family 38, member 4 |
1791 |
0.47 |
chr16_43408501_43408652 | 3.24 |
Gm15713 |
predicted gene 15713 |
11620 |
0.2 |
chr3_95864904_95865315 | 3.24 |
Mrps21 |
mitochondrial ribosomal protein S21 |
1802 |
0.16 |
chr11_70501874_70502034 | 3.23 |
Tm4sf5 |
transmembrane 4 superfamily member 5 |
3290 |
0.09 |
chr16_26563195_26563349 | 3.23 |
Il1rap |
interleukin 1 receptor accessory protein |
18432 |
0.23 |
chr17_15379643_15379953 | 3.22 |
Dll1 |
delta like canonical Notch ligand 1 |
2926 |
0.21 |
chr19_44421958_44422284 | 3.22 |
Gm50337 |
predicted gene, 50337 |
2511 |
0.21 |
chr4_108093158_108093452 | 3.22 |
Podn |
podocan |
3140 |
0.19 |
chr13_112331307_112331468 | 3.21 |
Ankrd55 |
ankyrin repeat domain 55 |
12933 |
0.17 |
chr15_88858344_88858998 | 3.20 |
Pim3 |
proviral integration site 3 |
3515 |
0.17 |
chr4_101245751_101246055 | 3.20 |
Jak1 |
Janus kinase 1 |
19320 |
0.12 |
chr1_194623995_194624148 | 3.20 |
Plxna2 |
plexin A2 |
4246 |
0.22 |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
2.3 | 6.9 | GO:1903800 | positive regulation of production of miRNAs involved in gene silencing by miRNA(GO:1903800) |
1.6 | 9.7 | GO:0006526 | arginine biosynthetic process(GO:0006526) |
1.4 | 4.3 | GO:0032474 | otolith morphogenesis(GO:0032474) |
1.4 | 9.5 | GO:0097105 | presynaptic membrane assembly(GO:0097105) |
1.3 | 2.6 | GO:0060737 | prostate epithelial cord elongation(GO:0060523) prostate gland morphogenetic growth(GO:0060737) |
1.3 | 2.6 | GO:2000809 | positive regulation of synaptic vesicle clustering(GO:2000809) |
1.3 | 3.8 | GO:1900825 | regulation of membrane depolarization during cardiac muscle cell action potential(GO:1900825) |
1.2 | 4.8 | GO:0034755 | iron ion transmembrane transport(GO:0034755) |
1.2 | 3.6 | GO:0032383 | regulation of intracellular lipid transport(GO:0032377) regulation of intracellular sterol transport(GO:0032380) regulation of intracellular cholesterol transport(GO:0032383) |
1.2 | 3.5 | GO:1901078 | negative regulation of relaxation of muscle(GO:1901078) |
1.2 | 4.6 | GO:2000741 | positive regulation of mesenchymal stem cell differentiation(GO:2000741) |
1.1 | 4.5 | GO:2001013 | epithelial cell proliferation involved in renal tubule morphogenesis(GO:2001013) |
1.1 | 4.5 | GO:0060528 | secretory columnal luminar epithelial cell differentiation involved in prostate glandular acinus development(GO:0060528) |
1.1 | 3.3 | GO:0043490 | malate-aspartate shuttle(GO:0043490) |
1.1 | 2.2 | GO:0060125 | negative regulation of growth hormone secretion(GO:0060125) |
1.1 | 7.5 | GO:0044539 | long-chain fatty acid import(GO:0044539) |
1.1 | 3.2 | GO:0015959 | diadenosine polyphosphate metabolic process(GO:0015959) |
1.1 | 4.2 | GO:0006166 | purine ribonucleoside salvage(GO:0006166) |
1.0 | 3.1 | GO:0000430 | regulation of transcription from RNA polymerase II promoter by glucose(GO:0000430) positive regulation of transcription from RNA polymerase II promoter by glucose(GO:0000432) |
1.0 | 6.1 | GO:0006642 | triglyceride mobilization(GO:0006642) |
1.0 | 4.9 | GO:0001922 | B-1 B cell homeostasis(GO:0001922) |
1.0 | 4.8 | GO:1903689 | regulation of wound healing, spreading of epidermal cells(GO:1903689) |
0.9 | 2.8 | GO:0006068 | ethanol catabolic process(GO:0006068) |
0.9 | 1.8 | GO:0042998 | positive regulation of Golgi to plasma membrane protein transport(GO:0042998) |
0.9 | 2.6 | GO:0015014 | heparan sulfate proteoglycan biosynthetic process, polysaccharide chain biosynthetic process(GO:0015014) |
0.9 | 2.6 | GO:0046271 | phenylpropanoid catabolic process(GO:0046271) |
0.9 | 2.6 | GO:1903061 | positive regulation of protein lipidation(GO:1903061) |
0.9 | 4.3 | GO:2000301 | negative regulation of synaptic vesicle exocytosis(GO:2000301) |
0.8 | 2.5 | GO:0016554 | cytidine to uridine editing(GO:0016554) |
0.8 | 3.3 | GO:0070535 | histone H2A K63-linked ubiquitination(GO:0070535) |
0.8 | 4.1 | GO:0010891 | negative regulation of sequestering of triglyceride(GO:0010891) |
0.8 | 1.6 | GO:0045726 | positive regulation of integrin biosynthetic process(GO:0045726) |
0.8 | 3.1 | GO:0072592 | oxygen metabolic process(GO:0072592) |
0.8 | 3.1 | GO:0036295 | cellular response to increased oxygen levels(GO:0036295) cellular response to hyperoxia(GO:0071455) |
0.8 | 1.5 | GO:0060741 | prostate gland stromal morphogenesis(GO:0060741) |
0.8 | 5.4 | GO:0060501 | positive regulation of epithelial cell proliferation involved in lung morphogenesis(GO:0060501) |
0.7 | 2.2 | GO:0021553 | olfactory nerve development(GO:0021553) |
0.7 | 0.7 | GO:0009698 | phenylpropanoid metabolic process(GO:0009698) coumarin metabolic process(GO:0009804) |
0.7 | 4.4 | GO:0060020 | Bergmann glial cell differentiation(GO:0060020) |
0.7 | 3.6 | GO:0050882 | voluntary musculoskeletal movement(GO:0050882) |
0.7 | 2.1 | GO:0008050 | female courtship behavior(GO:0008050) |
0.7 | 1.4 | GO:0070672 | response to interleukin-15(GO:0070672) |
0.7 | 2.0 | GO:1900169 | regulation of glucocorticoid mediated signaling pathway(GO:1900169) |
0.7 | 2.0 | GO:0010963 | regulation of L-arginine import(GO:0010963) |
0.7 | 2.0 | GO:0061470 | T follicular helper cell differentiation(GO:0061470) |
0.7 | 2.6 | GO:0048478 | replication fork protection(GO:0048478) |
0.7 | 2.0 | GO:2000834 | androgen secretion(GO:0035935) regulation of androgen secretion(GO:2000834) positive regulation of androgen secretion(GO:2000836) |
0.7 | 1.3 | GO:0046098 | guanine metabolic process(GO:0046098) |
0.7 | 5.9 | GO:0008090 | retrograde axonal transport(GO:0008090) |
0.6 | 6.5 | GO:0036315 | cellular response to sterol(GO:0036315) |
0.6 | 2.5 | GO:0003383 | apical constriction(GO:0003383) |
0.6 | 5.0 | GO:0045647 | negative regulation of erythrocyte differentiation(GO:0045647) |
0.6 | 1.3 | GO:2000847 | negative regulation of steroid hormone secretion(GO:2000832) negative regulation of corticosteroid hormone secretion(GO:2000847) negative regulation of glucocorticoid secretion(GO:2000850) |
0.6 | 1.9 | GO:0036022 | limb joint morphogenesis(GO:0036022) embryonic skeletal limb joint morphogenesis(GO:0036023) |
0.6 | 1.8 | GO:1902774 | late endosome to lysosome transport(GO:1902774) |
0.6 | 4.3 | GO:0006265 | DNA topological change(GO:0006265) |
0.6 | 4.2 | GO:0035437 | maintenance of protein localization in endoplasmic reticulum(GO:0035437) |
0.6 | 3.0 | GO:0072602 | interleukin-4 secretion(GO:0072602) |
0.6 | 1.8 | GO:1902953 | positive regulation of ER to Golgi vesicle-mediated transport(GO:1902953) |
0.6 | 2.9 | GO:0032237 | activation of store-operated calcium channel activity(GO:0032237) |
0.6 | 2.4 | GO:0019805 | quinolinate biosynthetic process(GO:0019805) |
0.6 | 2.3 | GO:1990414 | replication-born double-strand break repair via sister chromatid exchange(GO:1990414) |
0.6 | 1.2 | GO:1904179 | positive regulation of adipose tissue development(GO:1904179) |
0.6 | 1.7 | GO:1903774 | positive regulation of viral budding via host ESCRT complex(GO:1903774) |
0.6 | 2.3 | GO:0035521 | monoubiquitinated histone deubiquitination(GO:0035521) monoubiquitinated histone H2A deubiquitination(GO:0035522) |
0.6 | 1.7 | GO:0036493 | positive regulation of translation in response to endoplasmic reticulum stress(GO:0036493) |
0.6 | 2.9 | GO:0071447 | cellular response to hydroperoxide(GO:0071447) |
0.6 | 1.7 | GO:0071930 | negative regulation of transcription involved in G1/S transition of mitotic cell cycle(GO:0071930) |
0.6 | 0.6 | GO:0090467 | L-arginine import(GO:0043091) arginine import(GO:0090467) L-arginine transport(GO:1902023) |
0.6 | 1.7 | GO:1901301 | regulation of cargo loading into COPII-coated vesicle(GO:1901301) |
0.6 | 1.7 | GO:0007525 | somatic muscle development(GO:0007525) |
0.6 | 1.7 | GO:1903336 | negative regulation of vacuolar transport(GO:1903336) |
0.6 | 2.8 | GO:0031293 | membrane protein intracellular domain proteolysis(GO:0031293) |
0.5 | 2.2 | GO:0060355 | positive regulation of cell adhesion molecule production(GO:0060355) |
0.5 | 2.2 | GO:0060059 | embryonic retina morphogenesis in camera-type eye(GO:0060059) |
0.5 | 2.2 | GO:0090219 | negative regulation of lipid kinase activity(GO:0090219) |
0.5 | 0.5 | GO:0006714 | sesquiterpenoid metabolic process(GO:0006714) |
0.5 | 1.6 | GO:0046881 | positive regulation of follicle-stimulating hormone secretion(GO:0046881) |
0.5 | 1.6 | GO:0034310 | primary alcohol catabolic process(GO:0034310) |
0.5 | 0.5 | GO:2000259 | positive regulation of complement activation(GO:0045917) positive regulation of protein activation cascade(GO:2000259) |
0.5 | 1.6 | GO:0046726 | positive regulation by virus of viral protein levels in host cell(GO:0046726) |
0.5 | 2.6 | GO:0033314 | mitotic DNA replication checkpoint(GO:0033314) |
0.5 | 2.6 | GO:0090209 | negative regulation of triglyceride metabolic process(GO:0090209) |
0.5 | 1.5 | GO:0016080 | synaptic vesicle targeting(GO:0016080) |
0.5 | 1.5 | GO:0002309 | T cell proliferation involved in immune response(GO:0002309) |
0.5 | 1.0 | GO:2001274 | negative regulation of glucose import in response to insulin stimulus(GO:2001274) |
0.5 | 1.5 | GO:1990928 | response to amino acid starvation(GO:1990928) |
0.5 | 2.0 | GO:0007023 | post-chaperonin tubulin folding pathway(GO:0007023) |
0.5 | 9.7 | GO:0052696 | flavonoid biosynthetic process(GO:0009813) flavonoid glucuronidation(GO:0052696) |
0.5 | 2.4 | GO:0061484 | hematopoietic stem cell homeostasis(GO:0061484) |
0.5 | 1.0 | GO:0061419 | positive regulation of transcription from RNA polymerase II promoter in response to hypoxia(GO:0061419) |
0.5 | 1.4 | GO:0070682 | proteasome regulatory particle assembly(GO:0070682) |
0.5 | 5.6 | GO:0071803 | positive regulation of podosome assembly(GO:0071803) |
0.5 | 5.2 | GO:0055089 | fatty acid homeostasis(GO:0055089) |
0.5 | 1.4 | GO:0002949 | tRNA threonylcarbamoyladenosine modification(GO:0002949) |
0.5 | 1.4 | GO:0046719 | regulation by virus of viral protein levels in host cell(GO:0046719) |
0.4 | 4.0 | GO:0009404 | toxin metabolic process(GO:0009404) |
0.4 | 2.2 | GO:0032484 | Ral protein signal transduction(GO:0032484) |
0.4 | 0.4 | GO:2000794 | regulation of epithelial cell proliferation involved in lung morphogenesis(GO:2000794) |
0.4 | 2.2 | GO:0044829 | positive regulation by host of viral genome replication(GO:0044829) |
0.4 | 0.9 | GO:2001197 | regulation of basement membrane assembly involved in embryonic body morphogenesis(GO:1904259) positive regulation of basement membrane assembly involved in embryonic body morphogenesis(GO:1904261) basement membrane assembly involved in embryonic body morphogenesis(GO:2001197) |
0.4 | 2.2 | GO:0071476 | cellular hypotonic response(GO:0071476) |
0.4 | 3.3 | GO:0010944 | negative regulation of transcription by competitive promoter binding(GO:0010944) |
0.4 | 0.8 | GO:1904714 | regulation of chaperone-mediated autophagy(GO:1904714) |
0.4 | 0.4 | GO:1900738 | positive regulation of phospholipase C-activating G-protein coupled receptor signaling pathway(GO:1900738) |
0.4 | 0.4 | GO:0006570 | tyrosine metabolic process(GO:0006570) |
0.4 | 5.3 | GO:2000114 | regulation of establishment of cell polarity(GO:2000114) |
0.4 | 4.4 | GO:0006957 | complement activation, alternative pathway(GO:0006957) |
0.4 | 1.6 | GO:0035405 | histone-threonine phosphorylation(GO:0035405) |
0.4 | 0.4 | GO:2000586 | regulation of platelet-derived growth factor receptor-beta signaling pathway(GO:2000586) negative regulation of platelet-derived growth factor receptor-beta signaling pathway(GO:2000587) |
0.4 | 1.2 | GO:0002175 | protein localization to paranode region of axon(GO:0002175) |
0.4 | 0.8 | GO:0061502 | early endosome to recycling endosome transport(GO:0061502) |
0.4 | 1.2 | GO:0002339 | B cell selection(GO:0002339) |
0.4 | 0.4 | GO:0043987 | histone H3-S10 phosphorylation(GO:0043987) |
0.4 | 0.8 | GO:1900041 | negative regulation of interleukin-2 secretion(GO:1900041) |
0.4 | 1.6 | GO:2001268 | negative regulation of cysteine-type endopeptidase activity involved in apoptotic signaling pathway(GO:2001268) |
0.4 | 1.2 | GO:0097167 | circadian regulation of translation(GO:0097167) |
0.4 | 2.3 | GO:0015074 | DNA integration(GO:0015074) |
0.4 | 0.8 | GO:0003330 | regulation of extracellular matrix constituent secretion(GO:0003330) positive regulation of extracellular matrix constituent secretion(GO:0003331) |
0.4 | 4.2 | GO:0032308 | positive regulation of prostaglandin secretion(GO:0032308) |
0.4 | 1.9 | GO:0070627 | ferrous iron import(GO:0070627) |
0.4 | 1.1 | GO:0030202 | heparin metabolic process(GO:0030202) heparin biosynthetic process(GO:0030210) |
0.4 | 1.1 | GO:0048769 | sarcomerogenesis(GO:0048769) |
0.4 | 1.1 | GO:0010520 | regulation of reciprocal meiotic recombination(GO:0010520) |
0.4 | 0.8 | GO:1902966 | regulation of protein localization to early endosome(GO:1902965) positive regulation of protein localization to early endosome(GO:1902966) |
0.4 | 0.4 | GO:1901187 | regulation of ephrin receptor signaling pathway(GO:1901187) |
0.4 | 1.1 | GO:1902837 | amino acid import into cell(GO:1902837) |
0.4 | 0.7 | GO:0051684 | maintenance of Golgi location(GO:0051684) |
0.4 | 0.7 | GO:0060375 | regulation of mast cell differentiation(GO:0060375) |
0.4 | 0.4 | GO:0090110 | cargo loading into COPII-coated vesicle(GO:0090110) |
0.4 | 0.4 | GO:0060914 | heart formation(GO:0060914) |
0.4 | 2.2 | GO:0006102 | isocitrate metabolic process(GO:0006102) |
0.4 | 2.6 | GO:2000253 | positive regulation of feeding behavior(GO:2000253) |
0.4 | 0.4 | GO:1904339 | negative regulation of dopaminergic neuron differentiation(GO:1904339) |
0.4 | 1.1 | GO:0006772 | thiamine metabolic process(GO:0006772) thiamine-containing compound metabolic process(GO:0042723) |
0.4 | 1.4 | GO:0002317 | plasma cell differentiation(GO:0002317) |
0.4 | 2.5 | GO:0046146 | tetrahydrobiopterin metabolic process(GO:0046146) |
0.4 | 1.1 | GO:0042706 | eye photoreceptor cell fate commitment(GO:0042706) photoreceptor cell fate commitment(GO:0046552) |
0.4 | 5.7 | GO:0015936 | coenzyme A metabolic process(GO:0015936) |
0.4 | 3.9 | GO:0007028 | cytoplasm organization(GO:0007028) |
0.4 | 1.4 | GO:2000324 | positive regulation of glucocorticoid receptor signaling pathway(GO:2000324) |
0.4 | 1.4 | GO:0090188 | negative regulation of pancreatic juice secretion(GO:0090188) |
0.4 | 1.4 | GO:0071494 | cellular response to UV-C(GO:0071494) |
0.4 | 1.1 | GO:1903599 | positive regulation of mitophagy(GO:1903599) |
0.3 | 1.0 | GO:0032439 | endosome localization(GO:0032439) |
0.3 | 1.4 | GO:0006564 | L-serine biosynthetic process(GO:0006564) |
0.3 | 1.0 | GO:0019626 | short-chain fatty acid catabolic process(GO:0019626) |
0.3 | 0.7 | GO:0036112 | medium-chain fatty-acyl-CoA metabolic process(GO:0036112) |
0.3 | 1.0 | GO:0090210 | regulation of establishment of blood-brain barrier(GO:0090210) |
0.3 | 1.7 | GO:0070874 | negative regulation of glycogen metabolic process(GO:0070874) |
0.3 | 1.4 | GO:0000957 | mitochondrial RNA catabolic process(GO:0000957) regulation of mitochondrial RNA catabolic process(GO:0000960) |
0.3 | 2.4 | GO:1901409 | regulation of phosphorylation of RNA polymerase II C-terminal domain(GO:1901407) positive regulation of phosphorylation of RNA polymerase II C-terminal domain(GO:1901409) |
0.3 | 0.7 | GO:0032727 | positive regulation of interferon-alpha production(GO:0032727) |
0.3 | 1.7 | GO:0015867 | ATP transport(GO:0015867) |
0.3 | 2.0 | GO:0040016 | embryonic cleavage(GO:0040016) |
0.3 | 0.3 | GO:0044650 | virion attachment to host cell(GO:0019062) adhesion of symbiont to host cell(GO:0044650) receptor-mediated virion attachment to host cell(GO:0046813) |
0.3 | 1.0 | GO:0035694 | mitochondrial protein catabolic process(GO:0035694) |
0.3 | 1.3 | GO:0070885 | negative regulation of calcineurin-NFAT signaling cascade(GO:0070885) |
0.3 | 2.0 | GO:0033129 | positive regulation of histone phosphorylation(GO:0033129) |
0.3 | 1.0 | GO:0021699 | cerebellar cortex maturation(GO:0021699) |
0.3 | 1.6 | GO:0010961 | cellular magnesium ion homeostasis(GO:0010961) |
0.3 | 0.3 | GO:1900020 | regulation of protein kinase C activity(GO:1900019) positive regulation of protein kinase C activity(GO:1900020) |
0.3 | 0.6 | GO:0018076 | N-terminal peptidyl-lysine acetylation(GO:0018076) |
0.3 | 0.3 | GO:0050747 | positive regulation of lipoprotein metabolic process(GO:0050747) |
0.3 | 0.3 | GO:0010693 | negative regulation of alkaline phosphatase activity(GO:0010693) |
0.3 | 1.0 | GO:0061625 | fructose catabolic process(GO:0006001) fructose catabolic process to hydroxyacetone phosphate and glyceraldehyde-3-phosphate(GO:0061624) glycolytic process through fructose-1-phosphate(GO:0061625) |
0.3 | 1.3 | GO:1903553 | positive regulation of extracellular exosome assembly(GO:1903553) |
0.3 | 1.3 | GO:0051409 | response to nitrosative stress(GO:0051409) |
0.3 | 1.3 | GO:0006499 | N-terminal protein myristoylation(GO:0006499) |
0.3 | 8.6 | GO:0032728 | positive regulation of interferon-beta production(GO:0032728) |
0.3 | 2.5 | GO:0009313 | oligosaccharide catabolic process(GO:0009313) |
0.3 | 3.5 | GO:0002329 | pre-B cell differentiation(GO:0002329) |
0.3 | 1.9 | GO:0032713 | negative regulation of interleukin-4 production(GO:0032713) |
0.3 | 2.5 | GO:0048318 | axial mesoderm development(GO:0048318) |
0.3 | 0.6 | GO:2000729 | positive regulation of mesenchymal cell proliferation involved in ureter development(GO:2000729) |
0.3 | 0.6 | GO:0006987 | activation of signaling protein activity involved in unfolded protein response(GO:0006987) |
0.3 | 1.6 | GO:0042663 | regulation of endodermal cell fate specification(GO:0042663) |
0.3 | 0.6 | GO:1903279 | regulation of calcium:sodium antiporter activity(GO:1903279) |
0.3 | 0.9 | GO:2000169 | regulation of peptidyl-cysteine S-nitrosylation(GO:2000169) |
0.3 | 0.6 | GO:0010728 | regulation of hydrogen peroxide biosynthetic process(GO:0010728) |
0.3 | 0.6 | GO:0006741 | NADP biosynthetic process(GO:0006741) |
0.3 | 4.6 | GO:0046174 | polyol catabolic process(GO:0046174) |
0.3 | 0.9 | GO:0090155 | negative regulation of sphingolipid biosynthetic process(GO:0090155) cellular sphingolipid homeostasis(GO:0090156) negative regulation of ceramide biosynthetic process(GO:1900060) |
0.3 | 0.6 | GO:0060729 | intestinal epithelial structure maintenance(GO:0060729) |
0.3 | 1.2 | GO:0070126 | mitochondrial translational termination(GO:0070126) |
0.3 | 2.1 | GO:0055091 | phospholipid homeostasis(GO:0055091) |
0.3 | 0.3 | GO:2000111 | positive regulation of macrophage apoptotic process(GO:2000111) |
0.3 | 0.9 | GO:1901165 | positive regulation of trophoblast cell migration(GO:1901165) |
0.3 | 1.8 | GO:0007000 | nucleolus organization(GO:0007000) |
0.3 | 1.5 | GO:0048669 | collateral sprouting in absence of injury(GO:0048669) |
0.3 | 2.3 | GO:0030644 | cellular chloride ion homeostasis(GO:0030644) |
0.3 | 0.9 | GO:0051387 | negative regulation of neurotrophin TRK receptor signaling pathway(GO:0051387) |
0.3 | 0.9 | GO:0006553 | lysine metabolic process(GO:0006553) |
0.3 | 1.2 | GO:2000622 | regulation of nuclear-transcribed mRNA catabolic process, nonsense-mediated decay(GO:2000622) negative regulation of nuclear-transcribed mRNA catabolic process, nonsense-mediated decay(GO:2000623) |
0.3 | 0.9 | GO:0006393 | termination of mitochondrial transcription(GO:0006393) |
0.3 | 0.6 | GO:0017187 | peptidyl-glutamic acid carboxylation(GO:0017187) |
0.3 | 0.9 | GO:0006543 | glutamine catabolic process(GO:0006543) |
0.3 | 1.2 | GO:2000370 | positive regulation of clathrin-mediated endocytosis(GO:2000370) |
0.3 | 0.6 | GO:0032483 | regulation of Rab protein signal transduction(GO:0032483) |
0.3 | 0.6 | GO:0048388 | endosomal lumen acidification(GO:0048388) |
0.3 | 1.7 | GO:0098908 | regulation of neuronal action potential(GO:0098908) |
0.3 | 0.6 | GO:0070827 | chromatin maintenance(GO:0070827) |
0.3 | 0.3 | GO:1900736 | regulation of phospholipase C-activating G-protein coupled receptor signaling pathway(GO:1900736) |
0.3 | 0.8 | GO:0002071 | glandular epithelial cell maturation(GO:0002071) |
0.3 | 1.1 | GO:0016479 | negative regulation of transcription from RNA polymerase I promoter(GO:0016479) |
0.3 | 0.8 | GO:0015842 | aminergic neurotransmitter loading into synaptic vesicle(GO:0015842) neurotransmitter loading into synaptic vesicle(GO:0098700) |
0.3 | 1.1 | GO:1903964 | monounsaturated fatty acid metabolic process(GO:1903964) monounsaturated fatty acid biosynthetic process(GO:1903966) |
0.3 | 0.8 | GO:0033387 | putrescine biosynthetic process from ornithine(GO:0033387) |
0.3 | 0.8 | GO:1902262 | apoptotic process involved in patterning of blood vessels(GO:1902262) |
0.3 | 1.4 | GO:0006627 | protein processing involved in protein targeting to mitochondrion(GO:0006627) |
0.3 | 1.4 | GO:0002318 | myeloid progenitor cell differentiation(GO:0002318) |
0.3 | 0.8 | GO:0000389 | mRNA 3'-splice site recognition(GO:0000389) |
0.3 | 0.5 | GO:0060847 | endothelial cell fate specification(GO:0060847) |
0.3 | 1.1 | GO:2000535 | entry of bacterium into host cell(GO:0035635) regulation of entry of bacterium into host cell(GO:2000535) |
0.3 | 3.5 | GO:0006699 | bile acid biosynthetic process(GO:0006699) |
0.3 | 0.3 | GO:0034141 | positive regulation of toll-like receptor 3 signaling pathway(GO:0034141) |
0.3 | 1.3 | GO:2000271 | positive regulation of fibroblast apoptotic process(GO:2000271) |
0.3 | 0.8 | GO:0043321 | regulation of natural killer cell degranulation(GO:0043321) |
0.3 | 1.1 | GO:0090527 | actin filament reorganization(GO:0090527) |
0.3 | 0.8 | GO:0033615 | mitochondrial proton-transporting ATP synthase complex assembly(GO:0033615) |
0.3 | 2.1 | GO:0070493 | thrombin receptor signaling pathway(GO:0070493) |
0.3 | 4.0 | GO:0043984 | histone H4-K16 acetylation(GO:0043984) |
0.3 | 0.5 | GO:1900157 | regulation of bone mineralization involved in bone maturation(GO:1900157) |
0.3 | 1.3 | GO:0048496 | maintenance of organ identity(GO:0048496) |
0.3 | 1.1 | GO:0045006 | DNA deamination(GO:0045006) |
0.3 | 0.8 | GO:0042117 | monocyte activation(GO:0042117) |
0.3 | 0.8 | GO:1900095 | regulation of dosage compensation by inactivation of X chromosome(GO:1900095) |
0.3 | 0.3 | GO:0046533 | negative regulation of photoreceptor cell differentiation(GO:0046533) |
0.3 | 1.6 | GO:0002072 | optic cup morphogenesis involved in camera-type eye development(GO:0002072) |
0.3 | 1.8 | GO:0032815 | negative regulation of natural killer cell activation(GO:0032815) |
0.3 | 0.3 | GO:1903059 | regulation of protein lipidation(GO:1903059) |
0.3 | 1.3 | GO:0014744 | positive regulation of muscle adaptation(GO:0014744) |
0.3 | 1.0 | GO:0032201 | telomere maintenance via semi-conservative replication(GO:0032201) |
0.3 | 2.3 | GO:0039702 | viral budding via host ESCRT complex(GO:0039702) |
0.3 | 0.8 | GO:0034421 | post-translational protein acetylation(GO:0034421) |
0.3 | 0.5 | GO:0061010 | gall bladder development(GO:0061010) |
0.3 | 0.8 | GO:1990034 | calcium ion export from cell(GO:1990034) |
0.3 | 1.0 | GO:1900103 | positive regulation of endoplasmic reticulum unfolded protein response(GO:1900103) |
0.3 | 0.8 | GO:1903334 | positive regulation of protein folding(GO:1903334) |
0.3 | 0.8 | GO:0006041 | glucosamine metabolic process(GO:0006041) |
0.3 | 0.3 | GO:0046083 | adenine metabolic process(GO:0046083) adenine biosynthetic process(GO:0046084) |
0.3 | 2.0 | GO:0010801 | negative regulation of peptidyl-threonine phosphorylation(GO:0010801) |
0.3 | 0.5 | GO:0060839 | endothelial cell fate commitment(GO:0060839) |
0.2 | 0.2 | GO:1903984 | positive regulation of TRAIL-activated apoptotic signaling pathway(GO:1903984) |
0.2 | 1.5 | GO:2001256 | regulation of store-operated calcium entry(GO:2001256) |
0.2 | 0.5 | GO:0086023 | adrenergic receptor signaling pathway involved in heart process(GO:0086023) |
0.2 | 0.5 | GO:0060900 | embryonic camera-type eye formation(GO:0060900) |
0.2 | 0.7 | GO:0019230 | proprioception(GO:0019230) |
0.2 | 0.5 | GO:0035459 | cargo loading into vesicle(GO:0035459) |
0.2 | 0.7 | GO:0072429 | response to intra-S DNA damage checkpoint signaling(GO:0072429) |
0.2 | 0.5 | GO:0010745 | negative regulation of macrophage derived foam cell differentiation(GO:0010745) |
0.2 | 1.2 | GO:0006678 | glucosylceramide metabolic process(GO:0006678) |
0.2 | 0.7 | GO:0051661 | maintenance of centrosome location(GO:0051661) |
0.2 | 0.5 | GO:0008211 | glucocorticoid metabolic process(GO:0008211) |
0.2 | 0.5 | GO:0014016 | neuroblast differentiation(GO:0014016) |
0.2 | 0.5 | GO:0036257 | multivesicular body organization(GO:0036257) |
0.2 | 1.0 | GO:0061727 | methylglyoxal catabolic process to D-lactate via S-lactoyl-glutathione(GO:0019243) methylglyoxal catabolic process(GO:0051596) methylglyoxal catabolic process to lactate(GO:0061727) |
0.2 | 0.7 | GO:0006768 | biotin metabolic process(GO:0006768) |
0.2 | 0.7 | GO:0071947 | protein deubiquitination involved in ubiquitin-dependent protein catabolic process(GO:0071947) |
0.2 | 0.5 | GO:1901339 | regulation of store-operated calcium channel activity(GO:1901339) |
0.2 | 1.4 | GO:0006655 | phosphatidylglycerol biosynthetic process(GO:0006655) |
0.2 | 0.5 | GO:0060509 | Type I pneumocyte differentiation(GO:0060509) |
0.2 | 0.5 | GO:1904469 | positive regulation of tumor necrosis factor secretion(GO:1904469) |
0.2 | 0.5 | GO:0021943 | formation of radial glial scaffolds(GO:0021943) |
0.2 | 1.2 | GO:0042996 | regulation of Golgi to plasma membrane protein transport(GO:0042996) |
0.2 | 0.2 | GO:0060748 | tertiary branching involved in mammary gland duct morphogenesis(GO:0060748) |
0.2 | 0.9 | GO:1903071 | positive regulation of ER-associated ubiquitin-dependent protein catabolic process(GO:1903071) |
0.2 | 0.5 | GO:0001998 | angiotensin mediated vasoconstriction involved in regulation of systemic arterial blood pressure(GO:0001998) |
0.2 | 6.8 | GO:0019373 | epoxygenase P450 pathway(GO:0019373) |
0.2 | 0.9 | GO:0006659 | phosphatidylserine biosynthetic process(GO:0006659) |
0.2 | 0.9 | GO:0055070 | copper ion homeostasis(GO:0055070) |
0.2 | 1.4 | GO:0006007 | glucose catabolic process(GO:0006007) |
0.2 | 0.7 | GO:0010727 | negative regulation of hydrogen peroxide metabolic process(GO:0010727) |
0.2 | 0.9 | GO:0042985 | negative regulation of amyloid precursor protein biosynthetic process(GO:0042985) |
0.2 | 0.2 | GO:0060916 | mesenchymal cell proliferation involved in lung development(GO:0060916) |
0.2 | 0.2 | GO:0006069 | ethanol metabolic process(GO:0006067) ethanol oxidation(GO:0006069) |
0.2 | 0.7 | GO:0060684 | epithelial-mesenchymal cell signaling(GO:0060684) |
0.2 | 0.2 | GO:0010908 | regulation of heparan sulfate proteoglycan biosynthetic process(GO:0010908) positive regulation of heparan sulfate proteoglycan biosynthetic process(GO:0010909) positive regulation of proteoglycan biosynthetic process(GO:1902730) |
0.2 | 0.2 | GO:0042759 | long-chain fatty acid biosynthetic process(GO:0042759) |
0.2 | 0.2 | GO:1902445 | regulation of mitochondrial membrane permeability involved in programmed necrotic cell death(GO:1902445) |
0.2 | 0.7 | GO:0031086 | nuclear-transcribed mRNA catabolic process, deadenylation-independent decay(GO:0031086) deadenylation-independent decapping of nuclear-transcribed mRNA(GO:0031087) |
0.2 | 1.4 | GO:1904153 | negative regulation of protein exit from endoplasmic reticulum(GO:0070862) negative regulation of retrograde protein transport, ER to cytosol(GO:1904153) |
0.2 | 0.7 | GO:1990086 | lens fiber cell apoptotic process(GO:1990086) |
0.2 | 0.9 | GO:0070816 | phosphorylation of RNA polymerase II C-terminal domain(GO:0070816) |
0.2 | 0.5 | GO:1900044 | regulation of protein K63-linked ubiquitination(GO:1900044) |
0.2 | 0.5 | GO:0002121 | inter-male aggressive behavior(GO:0002121) |
0.2 | 0.7 | GO:0046655 | folic acid metabolic process(GO:0046655) |
0.2 | 1.3 | GO:0021540 | corpus callosum morphogenesis(GO:0021540) |
0.2 | 0.2 | GO:0044860 | protein localization to plasma membrane raft(GO:0044860) |
0.2 | 3.3 | GO:0017144 | drug metabolic process(GO:0017144) |
0.2 | 3.3 | GO:0010569 | regulation of double-strand break repair via homologous recombination(GO:0010569) |
0.2 | 1.5 | GO:0034393 | positive regulation of smooth muscle cell apoptotic process(GO:0034393) |
0.2 | 2.2 | GO:0042659 | regulation of cell fate specification(GO:0042659) |
0.2 | 1.3 | GO:0034244 | negative regulation of transcription elongation from RNA polymerase II promoter(GO:0034244) |
0.2 | 0.7 | GO:0035520 | monoubiquitinated protein deubiquitination(GO:0035520) |
0.2 | 3.3 | GO:0070536 | protein K63-linked deubiquitination(GO:0070536) |
0.2 | 0.9 | GO:0048227 | plasma membrane to endosome transport(GO:0048227) |
0.2 | 1.3 | GO:0051195 | negative regulation of glycolytic process(GO:0045820) negative regulation of cofactor metabolic process(GO:0051195) negative regulation of coenzyme metabolic process(GO:0051198) |
0.2 | 1.5 | GO:0046784 | viral mRNA export from host cell nucleus(GO:0046784) |
0.2 | 0.4 | GO:0010536 | positive regulation of activation of Janus kinase activity(GO:0010536) |
0.2 | 0.7 | GO:0034616 | response to laminar fluid shear stress(GO:0034616) cellular response to laminar fluid shear stress(GO:0071499) |
0.2 | 0.7 | GO:0031118 | rRNA pseudouridine synthesis(GO:0031118) |
0.2 | 4.1 | GO:0071539 | protein localization to centrosome(GO:0071539) |
0.2 | 0.9 | GO:0034080 | CENP-A containing nucleosome assembly(GO:0034080) CENP-A containing chromatin organization(GO:0061641) |
0.2 | 0.9 | GO:0035627 | ceramide transport(GO:0035627) |
0.2 | 0.4 | GO:2000615 | regulation of histone H3-K9 acetylation(GO:2000615) |
0.2 | 3.2 | GO:0007184 | SMAD protein import into nucleus(GO:0007184) |
0.2 | 1.1 | GO:0070389 | chaperone cofactor-dependent protein refolding(GO:0070389) |
0.2 | 0.4 | GO:2000646 | positive regulation of receptor catabolic process(GO:2000646) |
0.2 | 0.6 | GO:0060666 | dichotomous subdivision of terminal units involved in salivary gland branching(GO:0060666) |
0.2 | 6.2 | GO:0000381 | regulation of alternative mRNA splicing, via spliceosome(GO:0000381) |
0.2 | 0.4 | GO:0048850 | hypophysis morphogenesis(GO:0048850) |
0.2 | 1.3 | GO:0043247 | protection from non-homologous end joining at telomere(GO:0031848) telomere maintenance in response to DNA damage(GO:0043247) |
0.2 | 0.8 | GO:0002155 | regulation of thyroid hormone mediated signaling pathway(GO:0002155) |
0.2 | 2.5 | GO:0045116 | protein neddylation(GO:0045116) |
0.2 | 0.2 | GO:1903208 | neuron death in response to hydrogen peroxide(GO:0036476) regulation of hydrogen peroxide-induced neuron death(GO:1903207) negative regulation of hydrogen peroxide-induced neuron death(GO:1903208) |
0.2 | 0.8 | GO:0019276 | UDP-N-acetylgalactosamine metabolic process(GO:0019276) |
0.2 | 0.4 | GO:0003162 | atrioventricular node development(GO:0003162) |
0.2 | 0.6 | GO:1904154 | positive regulation of retrograde protein transport, ER to cytosol(GO:1904154) |
0.2 | 0.2 | GO:2000097 | regulation of smooth muscle cell-matrix adhesion(GO:2000097) |
0.2 | 0.4 | GO:0035356 | cellular triglyceride homeostasis(GO:0035356) |
0.2 | 0.6 | GO:1900377 | negative regulation of melanin biosynthetic process(GO:0048022) negative regulation of secondary metabolite biosynthetic process(GO:1900377) |
0.2 | 0.6 | GO:2000780 | negative regulation of double-strand break repair(GO:2000780) |
0.2 | 0.6 | GO:0072718 | response to cisplatin(GO:0072718) |
0.2 | 1.8 | GO:0006120 | mitochondrial electron transport, NADH to ubiquinone(GO:0006120) |
0.2 | 0.2 | GO:2000507 | positive regulation of energy homeostasis(GO:2000507) |
0.2 | 0.6 | GO:0031999 | negative regulation of fatty acid beta-oxidation(GO:0031999) |
0.2 | 0.4 | GO:0045910 | negative regulation of DNA recombination(GO:0045910) |
0.2 | 1.4 | GO:0000055 | ribosomal large subunit export from nucleus(GO:0000055) |
0.2 | 3.0 | GO:0070884 | regulation of calcineurin-NFAT signaling cascade(GO:0070884) |
0.2 | 0.6 | GO:0060836 | lymphatic endothelial cell differentiation(GO:0060836) |
0.2 | 0.4 | GO:0001807 | regulation of type IV hypersensitivity(GO:0001807) |
0.2 | 1.0 | GO:0021932 | hindbrain radial glia guided cell migration(GO:0021932) |
0.2 | 0.6 | GO:0051771 | negative regulation of nitric-oxide synthase biosynthetic process(GO:0051771) |
0.2 | 0.6 | GO:0045218 | zonula adherens maintenance(GO:0045218) |
0.2 | 1.0 | GO:0006620 | posttranslational protein targeting to membrane(GO:0006620) |
0.2 | 0.2 | GO:1904338 | regulation of dopaminergic neuron differentiation(GO:1904338) |
0.2 | 0.6 | GO:0033353 | S-adenosylmethionine cycle(GO:0033353) |
0.2 | 1.2 | GO:1900246 | positive regulation of RIG-I signaling pathway(GO:1900246) |
0.2 | 1.2 | GO:0006307 | DNA dealkylation involved in DNA repair(GO:0006307) |
0.2 | 0.6 | GO:0036092 | phosphatidylinositol-3-phosphate biosynthetic process(GO:0036092) |
0.2 | 0.2 | GO:2000857 | positive regulation of mineralocorticoid secretion(GO:2000857) positive regulation of aldosterone secretion(GO:2000860) |
0.2 | 1.0 | GO:0016078 | tRNA catabolic process(GO:0016078) |
0.2 | 1.2 | GO:0071267 | amino acid salvage(GO:0043102) L-methionine biosynthetic process(GO:0071265) L-methionine salvage(GO:0071267) |
0.2 | 0.4 | GO:0035622 | intrahepatic bile duct development(GO:0035622) |
0.2 | 0.6 | GO:2000510 | regulation of dendritic cell chemotaxis(GO:2000508) positive regulation of dendritic cell chemotaxis(GO:2000510) |
0.2 | 1.2 | GO:0042866 | pyruvate biosynthetic process(GO:0042866) |
0.2 | 0.4 | GO:0032482 | Rab protein signal transduction(GO:0032482) |
0.2 | 0.4 | GO:0060414 | aorta smooth muscle tissue morphogenesis(GO:0060414) |
0.2 | 0.4 | GO:1902004 | positive regulation of beta-amyloid formation(GO:1902004) positive regulation of amyloid precursor protein catabolic process(GO:1902993) |
0.2 | 0.4 | GO:0002282 | microglial cell activation involved in immune response(GO:0002282) |
0.2 | 0.6 | GO:0009264 | deoxyribonucleotide catabolic process(GO:0009264) |
0.2 | 0.6 | GO:0006285 | base-excision repair, AP site formation(GO:0006285) |
0.2 | 0.9 | GO:0001302 | replicative cell aging(GO:0001302) |
0.2 | 2.1 | GO:1900037 | regulation of cellular response to hypoxia(GO:1900037) |
0.2 | 1.1 | GO:0042118 | endothelial cell activation(GO:0042118) |
0.2 | 0.2 | GO:0001714 | endodermal cell fate specification(GO:0001714) |
0.2 | 0.9 | GO:0010756 | positive regulation of plasminogen activation(GO:0010756) |
0.2 | 2.0 | GO:1902187 | negative regulation of viral release from host cell(GO:1902187) |
0.2 | 2.0 | GO:0042407 | cristae formation(GO:0042407) |
0.2 | 0.4 | GO:0002036 | regulation of L-glutamate transport(GO:0002036) |
0.2 | 0.2 | GO:0016557 | peroxisome membrane biogenesis(GO:0016557) |
0.2 | 2.8 | GO:0060009 | Sertoli cell development(GO:0060009) |
0.2 | 0.2 | GO:0010528 | regulation of transposition(GO:0010528) negative regulation of transposition(GO:0010529) |
0.2 | 0.6 | GO:0034242 | negative regulation of syncytium formation by plasma membrane fusion(GO:0034242) |
0.2 | 0.2 | GO:0021894 | cerebral cortex GABAergic interneuron development(GO:0021894) |
0.2 | 1.1 | GO:1903779 | regulation of cardiac conduction(GO:1903779) |
0.2 | 0.9 | GO:2000258 | negative regulation of complement activation(GO:0045916) negative regulation of protein activation cascade(GO:2000258) |
0.2 | 0.7 | GO:0090435 | protein localization to nuclear envelope(GO:0090435) |
0.2 | 0.2 | GO:0070634 | transepithelial ammonium transport(GO:0070634) |
0.2 | 0.5 | GO:0006203 | dGTP catabolic process(GO:0006203) |
0.2 | 2.4 | GO:0006828 | manganese ion transport(GO:0006828) |
0.2 | 0.9 | GO:0070345 | negative regulation of fat cell proliferation(GO:0070345) |
0.2 | 0.2 | GO:0042525 | tyrosine phosphorylation of Stat6 protein(GO:0042505) regulation of tyrosine phosphorylation of Stat6 protein(GO:0042525) |
0.2 | 0.5 | GO:1903147 | negative regulation of mitophagy(GO:1903147) |
0.2 | 0.2 | GO:0032070 | regulation of deoxyribonuclease activity(GO:0032070) |
0.2 | 0.5 | GO:1901029 | negative regulation of mitochondrial outer membrane permeabilization involved in apoptotic signaling pathway(GO:1901029) |
0.2 | 0.7 | GO:0030948 | negative regulation of vascular endothelial growth factor receptor signaling pathway(GO:0030948) |
0.2 | 1.1 | GO:0060052 | neurofilament cytoskeleton organization(GO:0060052) |
0.2 | 0.2 | GO:0097477 | lateral motor column neuron migration(GO:0097477) |
0.2 | 0.5 | GO:0048312 | intracellular distribution of mitochondria(GO:0048312) |
0.2 | 0.9 | GO:0033564 | anterior/posterior axon guidance(GO:0033564) |
0.2 | 0.4 | GO:0090091 | positive regulation of extracellular matrix disassembly(GO:0090091) |
0.2 | 0.5 | GO:0080111 | DNA demethylation(GO:0080111) |
0.2 | 0.7 | GO:0060008 | Sertoli cell differentiation(GO:0060008) |
0.2 | 0.2 | GO:0000720 | pyrimidine dimer repair by nucleotide-excision repair(GO:0000720) |
0.2 | 0.2 | GO:1901897 | regulation of relaxation of cardiac muscle(GO:1901897) |
0.2 | 1.1 | GO:0061042 | vascular wound healing(GO:0061042) |
0.2 | 0.5 | GO:2000609 | regulation of thyroid hormone generation(GO:2000609) |
0.2 | 0.2 | GO:0009138 | pyrimidine nucleoside diphosphate metabolic process(GO:0009138) |
0.2 | 2.4 | GO:0099514 | anterograde synaptic vesicle transport(GO:0048490) synaptic vesicle cytoskeletal transport(GO:0099514) synaptic vesicle transport along microtubule(GO:0099517) |
0.2 | 0.7 | GO:0006451 | selenocysteine incorporation(GO:0001514) translational readthrough(GO:0006451) |
0.2 | 0.5 | GO:0006177 | GMP biosynthetic process(GO:0006177) |
0.2 | 0.9 | GO:0042760 | very long-chain fatty acid catabolic process(GO:0042760) |
0.2 | 0.5 | GO:0042769 | DNA damage response, detection of DNA damage(GO:0042769) |
0.2 | 0.5 | GO:0070427 | nucleotide-binding oligomerization domain containing 1 signaling pathway(GO:0070427) |
0.2 | 0.9 | GO:1990564 | protein polyufmylation(GO:1990564) protein K69-linked ufmylation(GO:1990592) |
0.2 | 1.0 | GO:0097286 | iron ion import(GO:0097286) |
0.2 | 1.2 | GO:0001672 | regulation of chromatin assembly or disassembly(GO:0001672) |
0.2 | 0.3 | GO:0035283 | central nervous system segmentation(GO:0035283) brain segmentation(GO:0035284) |
0.2 | 0.9 | GO:1902902 | negative regulation of autophagosome assembly(GO:1902902) |
0.2 | 0.3 | GO:0046874 | quinolinate metabolic process(GO:0046874) |
0.2 | 0.5 | GO:0001887 | selenium compound metabolic process(GO:0001887) |
0.2 | 2.2 | GO:0016226 | iron-sulfur cluster assembly(GO:0016226) metallo-sulfur cluster assembly(GO:0031163) |
0.2 | 0.3 | GO:0015868 | purine ribonucleotide transport(GO:0015868) |
0.2 | 0.3 | GO:2001012 | mesenchymal cell differentiation involved in kidney development(GO:0072161) mesenchymal cell differentiation involved in renal system development(GO:2001012) |
0.2 | 1.0 | GO:0015919 | peroxisomal membrane transport(GO:0015919) protein import into peroxisome membrane(GO:0045046) |
0.2 | 2.2 | GO:0034243 | regulation of transcription elongation from RNA polymerase II promoter(GO:0034243) |
0.2 | 1.0 | GO:0048280 | vesicle fusion with Golgi apparatus(GO:0048280) |
0.2 | 0.2 | GO:0072095 | regulation of branch elongation involved in ureteric bud branching(GO:0072095) |
0.2 | 0.2 | GO:0061031 | endodermal digestive tract morphogenesis(GO:0061031) |
0.2 | 0.5 | GO:0021535 | cell migration in hindbrain(GO:0021535) |
0.2 | 0.2 | GO:1903972 | regulation of macrophage colony-stimulating factor signaling pathway(GO:1902226) regulation of response to macrophage colony-stimulating factor(GO:1903969) regulation of cellular response to macrophage colony-stimulating factor stimulus(GO:1903972) |
0.2 | 1.0 | GO:0017196 | N-terminal peptidyl-methionine acetylation(GO:0017196) |
0.2 | 0.3 | GO:0060750 | epithelial cell proliferation involved in mammary gland duct elongation(GO:0060750) |
0.2 | 5.1 | GO:0051057 | positive regulation of small GTPase mediated signal transduction(GO:0051057) |
0.2 | 0.3 | GO:0071787 | endoplasmic reticulum tubular network assembly(GO:0071787) |
0.2 | 0.7 | GO:0016584 | nucleosome positioning(GO:0016584) |
0.2 | 0.3 | GO:0060426 | lung vasculature development(GO:0060426) |
0.2 | 0.7 | GO:0060283 | negative regulation of oocyte development(GO:0060283) |
0.2 | 1.0 | GO:0090136 | epithelial cell-cell adhesion(GO:0090136) |
0.2 | 0.5 | GO:0021524 | visceral motor neuron differentiation(GO:0021524) |
0.2 | 0.2 | GO:0042447 | hormone catabolic process(GO:0042447) |
0.2 | 8.9 | GO:0006892 | post-Golgi vesicle-mediated transport(GO:0006892) |
0.2 | 0.3 | GO:0001555 | oocyte growth(GO:0001555) |
0.2 | 0.2 | GO:0061072 | iris morphogenesis(GO:0061072) |
0.2 | 2.3 | GO:0006376 | mRNA splice site selection(GO:0006376) |
0.2 | 0.5 | GO:0000733 | DNA strand renaturation(GO:0000733) |
0.2 | 0.3 | GO:0000715 | nucleotide-excision repair, DNA damage recognition(GO:0000715) |
0.2 | 6.7 | GO:0010501 | RNA secondary structure unwinding(GO:0010501) |
0.2 | 0.6 | GO:0090168 | Golgi reassembly(GO:0090168) |
0.2 | 0.8 | GO:0071732 | cellular response to nitric oxide(GO:0071732) |
0.2 | 0.2 | GO:0070669 | response to interleukin-2(GO:0070669) |
0.2 | 0.5 | GO:0071638 | negative regulation of monocyte chemotactic protein-1 production(GO:0071638) |
0.2 | 3.0 | GO:0000413 | protein peptidyl-prolyl isomerization(GO:0000413) |
0.2 | 0.2 | GO:0030908 | intein-mediated protein splicing(GO:0016539) protein splicing(GO:0030908) |
0.2 | 0.9 | GO:0043249 | erythrocyte maturation(GO:0043249) |
0.2 | 0.9 | GO:0050957 | equilibrioception(GO:0050957) |
0.2 | 0.3 | GO:0045875 | negative regulation of sister chromatid cohesion(GO:0045875) |
0.2 | 0.3 | GO:1900242 | regulation of synaptic vesicle endocytosis(GO:1900242) |
0.2 | 0.3 | GO:0007529 | establishment of synaptic specificity at neuromuscular junction(GO:0007529) |
0.2 | 0.5 | GO:2000189 | positive regulation of cholesterol homeostasis(GO:2000189) |
0.2 | 1.2 | GO:0048333 | mesodermal cell differentiation(GO:0048333) |
0.2 | 0.2 | GO:0006990 | positive regulation of transcription from RNA polymerase II promoter involved in unfolded protein response(GO:0006990) |
0.2 | 1.2 | GO:0006123 | mitochondrial electron transport, cytochrome c to oxygen(GO:0006123) |
0.2 | 0.6 | GO:0043144 | snoRNA processing(GO:0043144) |
0.2 | 0.3 | GO:1900122 | positive regulation of receptor binding(GO:1900122) |
0.2 | 0.5 | GO:0090166 | Golgi disassembly(GO:0090166) |
0.2 | 1.2 | GO:1903025 | regulation of RNA polymerase II regulatory region sequence-specific DNA binding(GO:1903025) |
0.2 | 0.9 | GO:0009650 | UV protection(GO:0009650) |
0.2 | 0.9 | GO:0031936 | negative regulation of chromatin silencing(GO:0031936) |
0.2 | 0.2 | GO:0006808 | regulation of nitrogen utilization(GO:0006808) |
0.2 | 0.2 | GO:0071569 | protein ufmylation(GO:0071569) |
0.2 | 0.2 | GO:1901503 | ether lipid biosynthetic process(GO:0008611) glycerol ether biosynthetic process(GO:0046504) cellular lipid biosynthetic process(GO:0097384) ether biosynthetic process(GO:1901503) |
0.2 | 0.8 | GO:0006569 | tryptophan catabolic process(GO:0006569) tryptophan catabolic process to kynurenine(GO:0019441) indole-containing compound catabolic process(GO:0042436) indolalkylamine catabolic process(GO:0046218) |
0.1 | 0.7 | GO:0015871 | choline transport(GO:0015871) |
0.1 | 0.6 | GO:0044597 | polyketide metabolic process(GO:0030638) aminoglycoside antibiotic metabolic process(GO:0030647) daunorubicin metabolic process(GO:0044597) doxorubicin metabolic process(GO:0044598) |
0.1 | 0.7 | GO:0060055 | angiogenesis involved in wound healing(GO:0060055) |
0.1 | 0.4 | GO:1904526 | regulation of microtubule binding(GO:1904526) positive regulation of microtubule binding(GO:1904528) |
0.1 | 0.1 | GO:0035973 | aggrephagy(GO:0035973) |
0.1 | 0.4 | GO:0030382 | sperm mitochondrion organization(GO:0030382) |
0.1 | 1.5 | GO:0045793 | positive regulation of cell size(GO:0045793) |
0.1 | 0.3 | GO:0019344 | cysteine biosynthetic process(GO:0019344) |
0.1 | 1.5 | GO:0006670 | sphingosine metabolic process(GO:0006670) |
0.1 | 1.0 | GO:0060013 | righting reflex(GO:0060013) |
0.1 | 0.6 | GO:0001842 | neural fold formation(GO:0001842) |
0.1 | 1.9 | GO:0061049 | physiological muscle hypertrophy(GO:0003298) physiological cardiac muscle hypertrophy(GO:0003301) cell growth involved in cardiac muscle cell development(GO:0061049) |
0.1 | 0.3 | GO:0072033 | renal vesicle formation(GO:0072033) |
0.1 | 0.3 | GO:0071725 | response to triacyl bacterial lipopeptide(GO:0071725) cellular response to triacyl bacterial lipopeptide(GO:0071727) |
0.1 | 0.6 | GO:1904424 | regulation of GTP binding(GO:1904424) |
0.1 | 0.3 | GO:0006449 | regulation of translational termination(GO:0006449) |
0.1 | 0.1 | GO:0048296 | isotype switching to IgA isotypes(GO:0048290) regulation of isotype switching to IgA isotypes(GO:0048296) |
0.1 | 2.3 | GO:0044458 | motile cilium assembly(GO:0044458) |
0.1 | 0.6 | GO:1900864 | mitochondrial tRNA modification(GO:0070900) mitochondrial RNA modification(GO:1900864) |
0.1 | 0.4 | GO:0090038 | negative regulation of protein kinase C signaling(GO:0090038) |
0.1 | 3.9 | GO:0018107 | peptidyl-threonine phosphorylation(GO:0018107) |
0.1 | 1.1 | GO:0009186 | deoxyribonucleoside diphosphate metabolic process(GO:0009186) |
0.1 | 0.7 | GO:0030718 | germ-line stem cell population maintenance(GO:0030718) |
0.1 | 0.8 | GO:0043508 | negative regulation of JUN kinase activity(GO:0043508) |
0.1 | 1.7 | GO:0097150 | neuronal stem cell population maintenance(GO:0097150) |
0.1 | 0.4 | GO:1901163 | regulation of trophoblast cell migration(GO:1901163) |
0.1 | 0.3 | GO:0061086 | negative regulation of histone H3-K27 methylation(GO:0061086) |
0.1 | 0.6 | GO:0071763 | nuclear membrane organization(GO:0071763) |
0.1 | 0.4 | GO:0060339 | negative regulation of type I interferon-mediated signaling pathway(GO:0060339) |
0.1 | 1.1 | GO:0006271 | DNA strand elongation involved in DNA replication(GO:0006271) |
0.1 | 0.3 | GO:0032066 | nucleolus to nucleoplasm transport(GO:0032066) |
0.1 | 0.8 | GO:0002084 | protein depalmitoylation(GO:0002084) macromolecule depalmitoylation(GO:0098734) |
0.1 | 0.4 | GO:1903204 | negative regulation of oxidative stress-induced neuron death(GO:1903204) |
0.1 | 0.4 | GO:0045943 | positive regulation of transcription from RNA polymerase I promoter(GO:0045943) |
0.1 | 0.7 | GO:0022616 | DNA strand elongation(GO:0022616) |
0.1 | 0.8 | GO:0036089 | cleavage furrow formation(GO:0036089) |
0.1 | 1.2 | GO:0042219 | cellular modified amino acid catabolic process(GO:0042219) |
0.1 | 0.4 | GO:0021873 | forebrain neuroblast division(GO:0021873) |
0.1 | 0.5 | GO:0006415 | translational termination(GO:0006415) |
0.1 | 0.9 | GO:0048671 | negative regulation of collateral sprouting(GO:0048671) |
0.1 | 0.3 | GO:0071896 | protein localization to adherens junction(GO:0071896) |
0.1 | 1.1 | GO:0042359 | vitamin D metabolic process(GO:0042359) |
0.1 | 0.4 | GO:0001927 | exocyst assembly(GO:0001927) |
0.1 | 0.9 | GO:0000920 | cell separation after cytokinesis(GO:0000920) |
0.1 | 7.0 | GO:0006986 | response to unfolded protein(GO:0006986) |
0.1 | 3.5 | GO:0071427 | mRNA export from nucleus(GO:0006406) mRNA-containing ribonucleoprotein complex export from nucleus(GO:0071427) |
0.1 | 0.4 | GO:0060385 | axonogenesis involved in innervation(GO:0060385) |
0.1 | 0.1 | GO:0007228 | positive regulation of hh target transcription factor activity(GO:0007228) |
0.1 | 0.9 | GO:0009301 | snRNA transcription(GO:0009301) |
0.1 | 0.3 | GO:0014042 | positive regulation of neuron maturation(GO:0014042) |
0.1 | 0.3 | GO:0045054 | constitutive secretory pathway(GO:0045054) |
0.1 | 2.6 | GO:0000470 | maturation of LSU-rRNA(GO:0000470) |
0.1 | 1.6 | GO:0018027 | peptidyl-lysine dimethylation(GO:0018027) |
0.1 | 0.1 | GO:1904124 | microglial cell migration(GO:1904124) regulation of microglial cell migration(GO:1904139) |
0.1 | 0.1 | GO:0090526 | regulation of gluconeogenesis involved in cellular glucose homeostasis(GO:0090526) |
0.1 | 0.8 | GO:0051044 | positive regulation of membrane protein ectodomain proteolysis(GO:0051044) |
0.1 | 0.4 | GO:0006297 | nucleotide-excision repair, DNA gap filling(GO:0006297) |
0.1 | 0.5 | GO:1901166 | trunk segmentation(GO:0035290) trunk neural crest cell migration(GO:0036484) ventral trunk neural crest cell migration(GO:0036486) sympathetic neuron projection extension(GO:0097490) sympathetic neuron projection guidance(GO:0097491) neural crest cell migration involved in autonomic nervous system development(GO:1901166) |
0.1 | 0.3 | GO:0048254 | snoRNA localization(GO:0048254) |
0.1 | 0.5 | GO:0031053 | primary miRNA processing(GO:0031053) |
0.1 | 0.3 | GO:0046618 | drug export(GO:0046618) |
0.1 | 0.4 | GO:0090206 | negative regulation of cholesterol biosynthetic process(GO:0045541) negative regulation of cholesterol metabolic process(GO:0090206) |
0.1 | 0.3 | GO:0046831 | regulation of RNA export from nucleus(GO:0046831) |
0.1 | 0.4 | GO:0000467 | exonucleolytic trimming involved in rRNA processing(GO:0000459) exonucleolytic trimming to generate mature 3'-end of 5.8S rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000467) |
0.1 | 0.5 | GO:2000059 | negative regulation of protein ubiquitination involved in ubiquitin-dependent protein catabolic process(GO:2000059) |
0.1 | 0.8 | GO:0015825 | L-serine transport(GO:0015825) |
0.1 | 0.6 | GO:0006559 | L-phenylalanine metabolic process(GO:0006558) L-phenylalanine catabolic process(GO:0006559) erythrose 4-phosphate/phosphoenolpyruvate family amino acid metabolic process(GO:1902221) erythrose 4-phosphate/phosphoenolpyruvate family amino acid catabolic process(GO:1902222) |
0.1 | 0.3 | GO:0003278 | apoptotic process involved in heart morphogenesis(GO:0003278) |
0.1 | 0.3 | GO:0061368 | behavioral response to chemical pain(GO:0061366) behavioral response to formalin induced pain(GO:0061368) |
0.1 | 0.4 | GO:1904694 | negative regulation of vascular smooth muscle contraction(GO:1904694) |
0.1 | 1.4 | GO:0051127 | positive regulation of actin nucleation(GO:0051127) |
0.1 | 0.1 | GO:0014873 | response to muscle activity involved in regulation of muscle adaptation(GO:0014873) |
0.1 | 0.5 | GO:0090161 | Golgi ribbon formation(GO:0090161) |
0.1 | 0.4 | GO:0006438 | valyl-tRNA aminoacylation(GO:0006438) |
0.1 | 0.3 | GO:0097284 | hepatocyte apoptotic process(GO:0097284) |
0.1 | 0.3 | GO:0060044 | negative regulation of cardiac muscle cell proliferation(GO:0060044) |
0.1 | 0.3 | GO:0060449 | bud elongation involved in lung branching(GO:0060449) |
0.1 | 0.3 | GO:0045343 | MHC class I biosynthetic process(GO:0045341) regulation of MHC class I biosynthetic process(GO:0045343) positive regulation of MHC class I biosynthetic process(GO:0045345) |
0.1 | 0.5 | GO:0070966 | nuclear-transcribed mRNA catabolic process, no-go decay(GO:0070966) |
0.1 | 0.5 | GO:0046602 | regulation of mitotic centrosome separation(GO:0046602) |
0.1 | 0.3 | GO:0030913 | paranodal junction assembly(GO:0030913) |
0.1 | 0.5 | GO:2000270 | negative regulation of fibroblast apoptotic process(GO:2000270) |
0.1 | 0.4 | GO:0006562 | proline catabolic process(GO:0006562) |
0.1 | 0.4 | GO:0010165 | response to X-ray(GO:0010165) |
0.1 | 1.2 | GO:0045070 | positive regulation of viral genome replication(GO:0045070) |
0.1 | 0.5 | GO:0015879 | carnitine transport(GO:0015879) |
0.1 | 0.9 | GO:0030643 | cellular phosphate ion homeostasis(GO:0030643) cellular trivalent inorganic anion homeostasis(GO:0072502) |
0.1 | 0.5 | GO:2001225 | regulation of chloride transport(GO:2001225) |
0.1 | 0.9 | GO:0045815 | positive regulation of gene expression, epigenetic(GO:0045815) |
0.1 | 0.5 | GO:0042270 | protection from natural killer cell mediated cytotoxicity(GO:0042270) |
0.1 | 0.5 | GO:0003376 | sphingosine-1-phosphate signaling pathway(GO:0003376) |
0.1 | 0.2 | GO:0035964 | COPI-coated vesicle budding(GO:0035964) |
0.1 | 0.2 | GO:0048149 | behavioral response to ethanol(GO:0048149) |
0.1 | 3.4 | GO:0043252 | sodium-independent organic anion transport(GO:0043252) |
0.1 | 0.4 | GO:0021698 | cerebellar cortex structural organization(GO:0021698) |
0.1 | 0.4 | GO:1903300 | negative regulation of glucokinase activity(GO:0033132) negative regulation of hexokinase activity(GO:1903300) |
0.1 | 0.1 | GO:0048550 | negative regulation of pinocytosis(GO:0048550) |
0.1 | 0.8 | GO:0032825 | regulation of natural killer cell differentiation(GO:0032823) positive regulation of natural killer cell differentiation(GO:0032825) |
0.1 | 0.4 | GO:0042511 | positive regulation of tyrosine phosphorylation of Stat1 protein(GO:0042511) |
0.1 | 1.1 | GO:0006825 | copper ion transport(GO:0006825) |
0.1 | 0.7 | GO:0035507 | regulation of myosin-light-chain-phosphatase activity(GO:0035507) |
0.1 | 0.5 | GO:0071404 | cellular response to low-density lipoprotein particle stimulus(GO:0071404) |
0.1 | 0.1 | GO:1900368 | regulation of RNA interference(GO:1900368) |
0.1 | 0.9 | GO:0017121 | phospholipid scrambling(GO:0017121) |
0.1 | 0.4 | GO:1902075 | cellular response to salt(GO:1902075) |
0.1 | 0.4 | GO:0090214 | spongiotrophoblast layer developmental growth(GO:0090214) |
0.1 | 0.4 | GO:0070102 | interleukin-6-mediated signaling pathway(GO:0070102) |
0.1 | 0.1 | GO:0003219 | cardiac right ventricle formation(GO:0003219) |
0.1 | 0.1 | GO:0055118 | negative regulation of cardiac muscle contraction(GO:0055118) |
0.1 | 1.5 | GO:0097576 | vacuole fusion(GO:0097576) |
0.1 | 0.3 | GO:2000409 | positive regulation of T cell extravasation(GO:2000409) |
0.1 | 0.1 | GO:0031915 | positive regulation of synaptic plasticity(GO:0031915) |
0.1 | 0.6 | GO:0010960 | magnesium ion homeostasis(GO:0010960) |
0.1 | 0.3 | GO:0018343 | protein farnesylation(GO:0018343) |
0.1 | 0.5 | GO:0030174 | regulation of DNA-dependent DNA replication initiation(GO:0030174) |
0.1 | 0.5 | GO:0002087 | regulation of respiratory gaseous exchange by neurological system process(GO:0002087) |
0.1 | 0.5 | GO:0007252 | I-kappaB phosphorylation(GO:0007252) |
0.1 | 0.2 | GO:0046909 | intermembrane transport(GO:0046909) |
0.1 | 0.8 | GO:0034625 | fatty acid elongation, saturated fatty acid(GO:0019367) fatty acid elongation, unsaturated fatty acid(GO:0019368) fatty acid elongation, monounsaturated fatty acid(GO:0034625) fatty acid elongation, polyunsaturated fatty acid(GO:0034626) |
0.1 | 0.1 | GO:0007258 | JUN phosphorylation(GO:0007258) |
0.1 | 0.6 | GO:0000012 | single strand break repair(GO:0000012) |
0.1 | 0.9 | GO:0000394 | RNA splicing, via endonucleolytic cleavage and ligation(GO:0000394) |
0.1 | 0.3 | GO:1902626 | assembly of large subunit precursor of preribosome(GO:1902626) |
0.1 | 0.2 | GO:0030538 | embryonic genitalia morphogenesis(GO:0030538) |
0.1 | 0.2 | GO:1902474 | positive regulation of protein localization to synapse(GO:1902474) |
0.1 | 0.3 | GO:0032790 | ribosome disassembly(GO:0032790) |
0.1 | 0.2 | GO:1903416 | response to glycoside(GO:1903416) |
0.1 | 0.9 | GO:0042775 | mitochondrial ATP synthesis coupled electron transport(GO:0042775) |
0.1 | 0.4 | GO:0050932 | regulation of pigment cell differentiation(GO:0050932) |
0.1 | 0.6 | GO:1903546 | protein localization to photoreceptor outer segment(GO:1903546) |
0.1 | 0.6 | GO:0033173 | calcineurin-NFAT signaling cascade(GO:0033173) |
0.1 | 0.2 | GO:0006362 | transcription elongation from RNA polymerase I promoter(GO:0006362) |
0.1 | 0.1 | GO:0006555 | methionine metabolic process(GO:0006555) |
0.1 | 1.0 | GO:0090201 | negative regulation of release of cytochrome c from mitochondria(GO:0090201) |
0.1 | 0.2 | GO:0006537 | glutamate biosynthetic process(GO:0006537) |
0.1 | 0.2 | GO:0006116 | NADH oxidation(GO:0006116) |
0.1 | 0.4 | GO:0003338 | metanephros morphogenesis(GO:0003338) |
0.1 | 0.1 | GO:0033169 | histone H3-K9 demethylation(GO:0033169) |
0.1 | 0.2 | GO:0051547 | regulation of keratinocyte migration(GO:0051547) positive regulation of keratinocyte migration(GO:0051549) |
0.1 | 0.1 | GO:0033122 | negative regulation of purine nucleotide catabolic process(GO:0033122) |
0.1 | 0.1 | GO:0033629 | negative regulation of cell adhesion mediated by integrin(GO:0033629) |
0.1 | 0.2 | GO:0008063 | Toll signaling pathway(GO:0008063) |
0.1 | 1.0 | GO:0048148 | behavioral response to cocaine(GO:0048148) |
0.1 | 1.0 | GO:0035721 | intraciliary retrograde transport(GO:0035721) |
0.1 | 0.4 | GO:0007253 | cytoplasmic sequestering of NF-kappaB(GO:0007253) |
0.1 | 0.4 | GO:0046826 | negative regulation of protein export from nucleus(GO:0046826) |
0.1 | 1.1 | GO:0006335 | DNA replication-dependent nucleosome assembly(GO:0006335) DNA replication-dependent nucleosome organization(GO:0034723) |
0.1 | 0.3 | GO:0035992 | tendon cell differentiation(GO:0035990) tendon formation(GO:0035992) |
0.1 | 0.4 | GO:1903361 | protein localization to basolateral plasma membrane(GO:1903361) |
0.1 | 0.4 | GO:0019740 | nitrogen utilization(GO:0019740) |
0.1 | 0.6 | GO:0034497 | protein localization to pre-autophagosomal structure(GO:0034497) |
0.1 | 0.5 | GO:0006283 | transcription-coupled nucleotide-excision repair(GO:0006283) |
0.1 | 0.2 | GO:0032988 | ribonucleoprotein complex disassembly(GO:0032988) |
0.1 | 0.2 | GO:0090503 | RNA phosphodiester bond hydrolysis, exonucleolytic(GO:0090503) |
0.1 | 0.3 | GO:0045074 | interleukin-10 biosynthetic process(GO:0042091) regulation of interleukin-10 biosynthetic process(GO:0045074) |
0.1 | 0.4 | GO:0042637 | catagen(GO:0042637) |
0.1 | 0.5 | GO:0015808 | L-alanine transport(GO:0015808) |
0.1 | 0.4 | GO:0043415 | positive regulation of skeletal muscle tissue regeneration(GO:0043415) |
0.1 | 0.5 | GO:2001135 | regulation of endocytic recycling(GO:2001135) |
0.1 | 0.4 | GO:0051031 | tRNA transport(GO:0051031) |
0.1 | 0.6 | GO:2000369 | regulation of clathrin-mediated endocytosis(GO:2000369) |
0.1 | 0.8 | GO:0035518 | histone H2A monoubiquitination(GO:0035518) |
0.1 | 0.7 | GO:0007144 | female meiosis I(GO:0007144) |
0.1 | 1.2 | GO:0022904 | respiratory electron transport chain(GO:0022904) |
0.1 | 0.4 | GO:0042761 | very long-chain fatty acid biosynthetic process(GO:0042761) |
0.1 | 2.5 | GO:0060325 | face morphogenesis(GO:0060325) |
0.1 | 0.5 | GO:0070544 | histone H3-K36 demethylation(GO:0070544) |
0.1 | 1.0 | GO:0006743 | ubiquinone metabolic process(GO:0006743) ubiquinone biosynthetic process(GO:0006744) quinone biosynthetic process(GO:1901663) |
0.1 | 0.5 | GO:0015886 | heme transport(GO:0015886) |
0.1 | 0.2 | GO:1904970 | brush border assembly(GO:1904970) |
0.1 | 1.0 | GO:0008053 | mitochondrial fusion(GO:0008053) |
0.1 | 0.1 | GO:0060664 | positive regulation of metanephric mesenchymal cell migration by platelet-derived growth factor receptor-beta signaling pathway(GO:0035793) epithelial cell proliferation involved in salivary gland morphogenesis(GO:0060664) regulation of metanephric mesenchymal cell migration by platelet-derived growth factor receptor-beta signaling pathway(GO:1900238) positive regulation of metanephric mesenchymal cell migration(GO:2000591) |
0.1 | 1.1 | GO:0006471 | protein ADP-ribosylation(GO:0006471) |
0.1 | 0.9 | GO:0045947 | negative regulation of translational initiation(GO:0045947) |
0.1 | 0.5 | GO:0043619 | regulation of transcription from RNA polymerase II promoter in response to oxidative stress(GO:0043619) |
0.1 | 1.1 | GO:0032958 | inositol phosphate biosynthetic process(GO:0032958) |
0.1 | 0.2 | GO:0045053 | protein retention in Golgi apparatus(GO:0045053) |
0.1 | 0.3 | GO:1901874 | regulation of post-translational protein modification(GO:1901873) negative regulation of post-translational protein modification(GO:1901874) |
0.1 | 0.5 | GO:0021692 | cerebellar Purkinje cell layer morphogenesis(GO:0021692) |
0.1 | 0.2 | GO:0019371 | cyclooxygenase pathway(GO:0019371) |
0.1 | 0.1 | GO:0098915 | membrane repolarization during ventricular cardiac muscle cell action potential(GO:0098915) |
0.1 | 0.1 | GO:0036289 | peptidyl-serine autophosphorylation(GO:0036289) |
0.1 | 0.4 | GO:0009133 | nucleoside diphosphate biosynthetic process(GO:0009133) |
0.1 | 2.1 | GO:0035094 | response to nicotine(GO:0035094) |
0.1 | 0.1 | GO:0003358 | noradrenergic neuron development(GO:0003358) |
0.1 | 0.6 | GO:0098870 | neuronal action potential propagation(GO:0019227) action potential propagation(GO:0098870) |
0.1 | 0.5 | GO:0036336 | dendritic cell migration(GO:0036336) |
0.1 | 0.1 | GO:0046471 | phosphatidylglycerol metabolic process(GO:0046471) |
0.1 | 0.2 | GO:0036072 | intramembranous ossification(GO:0001957) direct ossification(GO:0036072) |
0.1 | 0.2 | GO:0045964 | positive regulation of catecholamine metabolic process(GO:0045915) positive regulation of dopamine metabolic process(GO:0045964) |
0.1 | 0.7 | GO:0008105 | asymmetric protein localization(GO:0008105) |
0.1 | 0.3 | GO:1904263 | positive regulation of TORC1 signaling(GO:1904263) |
0.1 | 1.1 | GO:0098781 | ncRNA transcription(GO:0098781) |
0.1 | 0.7 | GO:0010838 | positive regulation of keratinocyte proliferation(GO:0010838) |
0.1 | 0.3 | GO:0045163 | clustering of voltage-gated potassium channels(GO:0045163) |
0.1 | 0.2 | GO:0006930 | substrate-dependent cell migration, cell extension(GO:0006930) |
0.1 | 0.7 | GO:0000290 | deadenylation-dependent decapping of nuclear-transcribed mRNA(GO:0000290) |
0.1 | 0.1 | GO:0019372 | lipoxygenase pathway(GO:0019372) |
0.1 | 0.8 | GO:0010470 | regulation of gastrulation(GO:0010470) |
0.1 | 0.3 | GO:0006546 | glycine catabolic process(GO:0006546) glycine decarboxylation via glycine cleavage system(GO:0019464) |
0.1 | 0.2 | GO:0043366 | beta selection(GO:0043366) |
0.1 | 0.4 | GO:2001260 | regulation of semaphorin-plexin signaling pathway(GO:2001260) |
0.1 | 0.3 | GO:2000766 | negative regulation of cytoplasmic translation(GO:2000766) |
0.1 | 0.2 | GO:0045945 | positive regulation of transcription from RNA polymerase III promoter(GO:0045945) |
0.1 | 0.9 | GO:0050435 | beta-amyloid metabolic process(GO:0050435) |
0.1 | 0.1 | GO:0061343 | cell adhesion involved in heart morphogenesis(GO:0061343) |
0.1 | 0.3 | GO:0035093 | spermatogenesis, exchange of chromosomal proteins(GO:0035093) |
0.1 | 0.2 | GO:0060037 | pharyngeal system development(GO:0060037) |
0.1 | 0.2 | GO:0021979 | hypothalamus cell differentiation(GO:0021979) |
0.1 | 0.1 | GO:0010992 | ubiquitin homeostasis(GO:0010992) |
0.1 | 0.6 | GO:0010640 | regulation of platelet-derived growth factor receptor signaling pathway(GO:0010640) |
0.1 | 0.1 | GO:0032290 | peripheral nervous system myelin formation(GO:0032290) |
0.1 | 0.3 | GO:0035609 | C-terminal protein deglutamylation(GO:0035609) |
0.1 | 0.2 | GO:0031914 | negative regulation of synaptic plasticity(GO:0031914) |
0.1 | 0.3 | GO:0042483 | negative regulation of odontogenesis(GO:0042483) |
0.1 | 1.9 | GO:0035019 | somatic stem cell population maintenance(GO:0035019) |
0.1 | 0.1 | GO:0070244 | negative regulation of thymocyte apoptotic process(GO:0070244) |
0.1 | 0.3 | GO:0007089 | traversing start control point of mitotic cell cycle(GO:0007089) |
0.1 | 0.1 | GO:0051835 | positive regulation of synapse structural plasticity(GO:0051835) |
0.1 | 0.4 | GO:0042347 | negative regulation of NF-kappaB import into nucleus(GO:0042347) |
0.1 | 0.4 | GO:0031581 | hemidesmosome assembly(GO:0031581) |
0.1 | 0.1 | GO:0060264 | regulation of respiratory burst involved in inflammatory response(GO:0060264) |
0.1 | 1.1 | GO:0006607 | NLS-bearing protein import into nucleus(GO:0006607) |
0.1 | 0.5 | GO:0039694 | viral RNA genome replication(GO:0039694) RNA replication(GO:0039703) |
0.1 | 0.1 | GO:0009449 | gamma-aminobutyric acid biosynthetic process(GO:0009449) |
0.1 | 0.7 | GO:0050774 | negative regulation of dendrite morphogenesis(GO:0050774) |
0.1 | 4.3 | GO:0006637 | acyl-CoA metabolic process(GO:0006637) thioester metabolic process(GO:0035383) |
0.1 | 0.1 | GO:0023041 | neuronal signal transduction(GO:0023041) |
0.1 | 0.2 | GO:0070309 | lens fiber cell morphogenesis(GO:0070309) |
0.1 | 0.1 | GO:0046985 | positive regulation of hemoglobin biosynthetic process(GO:0046985) |
0.1 | 0.1 | GO:0014734 | skeletal muscle hypertrophy(GO:0014734) |
0.1 | 0.8 | GO:0001886 | endothelial cell morphogenesis(GO:0001886) |
0.1 | 0.5 | GO:0048733 | sebaceous gland development(GO:0048733) |
0.1 | 2.6 | GO:0015988 | energy coupled proton transmembrane transport, against electrochemical gradient(GO:0015988) ATP hydrolysis coupled proton transport(GO:0015991) ATP hydrolysis coupled transmembrane transport(GO:0090662) |
0.1 | 0.1 | GO:0060561 | apoptotic process involved in morphogenesis(GO:0060561) apoptotic process involved in development(GO:1902742) |
0.1 | 1.3 | GO:0051567 | histone H3-K9 methylation(GO:0051567) |
0.1 | 0.3 | GO:0006368 | transcription elongation from RNA polymerase II promoter(GO:0006368) |
0.1 | 0.2 | GO:0071847 | TNFSF11-mediated signaling pathway(GO:0071847) |
0.1 | 2.2 | GO:0006414 | translational elongation(GO:0006414) |
0.1 | 4.9 | GO:0051965 | positive regulation of synapse assembly(GO:0051965) |
0.1 | 0.4 | GO:0021830 | interneuron migration from the subpallium to the cortex(GO:0021830) |
0.1 | 0.2 | GO:2000418 | positive regulation of eosinophil migration(GO:2000418) |
0.1 | 0.9 | GO:0007076 | mitotic chromosome condensation(GO:0007076) |
0.1 | 0.1 | GO:0070934 | CRD-mediated mRNA stabilization(GO:0070934) |
0.1 | 0.4 | GO:0007217 | tachykinin receptor signaling pathway(GO:0007217) |
0.1 | 0.5 | GO:0060546 | negative regulation of necroptotic process(GO:0060546) |
0.1 | 0.2 | GO:0071044 | histone mRNA catabolic process(GO:0071044) |
0.1 | 0.4 | GO:0032532 | regulation of microvillus length(GO:0032532) |
0.1 | 0.2 | GO:0021756 | striatum development(GO:0021756) |
0.1 | 0.1 | GO:2000058 | regulation of protein ubiquitination involved in ubiquitin-dependent protein catabolic process(GO:2000058) |
0.1 | 0.3 | GO:0007256 | activation of JNKK activity(GO:0007256) |
0.1 | 0.6 | GO:0046007 | negative regulation of activated T cell proliferation(GO:0046007) |
0.1 | 0.2 | GO:0016264 | gap junction assembly(GO:0016264) |
0.1 | 0.3 | GO:0018094 | protein polyglycylation(GO:0018094) |
0.1 | 0.3 | GO:0070940 | dephosphorylation of RNA polymerase II C-terminal domain(GO:0070940) |
0.1 | 0.4 | GO:0032020 | ISG15-protein conjugation(GO:0032020) |
0.1 | 0.2 | GO:0003348 | cardiac endothelial cell differentiation(GO:0003348) |
0.1 | 0.4 | GO:0040037 | negative regulation of fibroblast growth factor receptor signaling pathway(GO:0040037) |
0.1 | 1.1 | GO:0060074 | synapse maturation(GO:0060074) |
0.1 | 0.1 | GO:0006591 | ornithine metabolic process(GO:0006591) |
0.1 | 0.2 | GO:2001180 | negative regulation of interleukin-10 secretion(GO:2001180) |
0.1 | 0.3 | GO:0034382 | chylomicron remnant clearance(GO:0034382) triglyceride-rich lipoprotein particle clearance(GO:0071830) |
0.1 | 0.4 | GO:0060742 | epithelial cell differentiation involved in prostate gland development(GO:0060742) |
0.1 | 0.1 | GO:0010182 | carbohydrate mediated signaling(GO:0009756) hexose mediated signaling(GO:0009757) sugar mediated signaling pathway(GO:0010182) glucose mediated signaling pathway(GO:0010255) pharyngeal arch artery morphogenesis(GO:0061626) regulation of glucose mediated signaling pathway(GO:1902659) positive regulation of glucose mediated signaling pathway(GO:1902661) |
0.1 | 0.5 | GO:0051694 | pointed-end actin filament capping(GO:0051694) |
0.1 | 0.3 | GO:0031573 | intra-S DNA damage checkpoint(GO:0031573) |
0.1 | 0.3 | GO:0022010 | central nervous system myelination(GO:0022010) axon ensheathment in central nervous system(GO:0032291) |
0.1 | 0.3 | GO:0006432 | phenylalanyl-tRNA aminoacylation(GO:0006432) |
0.1 | 0.9 | GO:0007096 | regulation of exit from mitosis(GO:0007096) |
0.1 | 0.2 | GO:0042487 | regulation of odontogenesis of dentin-containing tooth(GO:0042487) |
0.1 | 0.2 | GO:0051182 | coenzyme transport(GO:0051182) |
0.1 | 0.5 | GO:0019732 | antifungal humoral response(GO:0019732) |
0.1 | 0.3 | GO:0019068 | virion assembly(GO:0019068) |
0.1 | 0.6 | GO:0043569 | negative regulation of insulin-like growth factor receptor signaling pathway(GO:0043569) |
0.1 | 0.2 | GO:0003164 | His-Purkinje system development(GO:0003164) |
0.1 | 0.8 | GO:0051131 | chaperone-mediated protein complex assembly(GO:0051131) |
0.1 | 0.4 | GO:1901984 | negative regulation of protein acetylation(GO:1901984) |
0.1 | 1.7 | GO:0006891 | intra-Golgi vesicle-mediated transport(GO:0006891) |
0.1 | 0.3 | GO:0015791 | polyol transport(GO:0015791) |
0.1 | 0.2 | GO:1900086 | regulation of peptidyl-tyrosine autophosphorylation(GO:1900084) positive regulation of peptidyl-tyrosine autophosphorylation(GO:1900086) |
0.1 | 0.1 | GO:0032252 | secretory granule localization(GO:0032252) |
0.1 | 0.1 | GO:0032464 | positive regulation of protein homooligomerization(GO:0032464) |
0.1 | 0.2 | GO:0046104 | thymidine metabolic process(GO:0046104) pyrimidine deoxyribonucleoside metabolic process(GO:0046125) |
0.1 | 0.2 | GO:0006108 | malate metabolic process(GO:0006108) |
0.1 | 2.8 | GO:0007030 | Golgi organization(GO:0007030) |
0.1 | 0.5 | GO:2000758 | positive regulation of peptidyl-lysine acetylation(GO:2000758) |
0.1 | 0.4 | GO:0045607 | regulation of auditory receptor cell differentiation(GO:0045607) regulation of mechanoreceptor differentiation(GO:0045631) regulation of inner ear receptor cell differentiation(GO:2000980) |
0.1 | 0.3 | GO:0003310 | pancreatic A cell differentiation(GO:0003310) |
0.1 | 0.6 | GO:0006691 | leukotriene metabolic process(GO:0006691) |
0.1 | 0.6 | GO:0032515 | negative regulation of phosphoprotein phosphatase activity(GO:0032515) |
0.1 | 0.8 | GO:0040015 | negative regulation of multicellular organism growth(GO:0040015) |
0.1 | 1.1 | GO:0051568 | histone H3-K4 methylation(GO:0051568) |
0.1 | 1.0 | GO:0010842 | retina layer formation(GO:0010842) |
0.1 | 0.2 | GO:0003228 | atrial cardiac muscle tissue development(GO:0003228) atrial cardiac muscle tissue morphogenesis(GO:0055009) |
0.1 | 0.2 | GO:0046322 | negative regulation of fatty acid oxidation(GO:0046322) |
0.1 | 0.2 | GO:0035966 | response to topologically incorrect protein(GO:0035966) |
0.1 | 0.1 | GO:0090365 | regulation of mRNA modification(GO:0090365) |
0.1 | 0.1 | GO:0036462 | TRAIL-activated apoptotic signaling pathway(GO:0036462) |
0.1 | 0.9 | GO:0034067 | protein localization to Golgi apparatus(GO:0034067) |
0.1 | 0.3 | GO:0045838 | positive regulation of membrane potential(GO:0045838) |
0.1 | 0.8 | GO:0006099 | tricarboxylic acid cycle(GO:0006099) |
0.1 | 0.4 | GO:0015858 | nucleoside transport(GO:0015858) |
0.1 | 0.2 | GO:0000820 | regulation of glutamine family amino acid metabolic process(GO:0000820) |
0.1 | 0.1 | GO:1903265 | positive regulation of tumor necrosis factor-mediated signaling pathway(GO:1903265) |
0.1 | 0.4 | GO:2000060 | positive regulation of protein ubiquitination involved in ubiquitin-dependent protein catabolic process(GO:2000060) |
0.1 | 0.8 | GO:0008214 | protein demethylation(GO:0006482) protein dealkylation(GO:0008214) |
0.1 | 0.9 | GO:0071880 | adenylate cyclase-activating adrenergic receptor signaling pathway(GO:0071880) |
0.1 | 0.1 | GO:0003011 | involuntary skeletal muscle contraction(GO:0003011) |
0.1 | 0.7 | GO:0042059 | negative regulation of epidermal growth factor receptor signaling pathway(GO:0042059) |
0.1 | 0.3 | GO:0045586 | regulation of gamma-delta T cell differentiation(GO:0045586) regulation of gamma-delta T cell activation(GO:0046643) |
0.1 | 1.1 | GO:0070534 | protein K63-linked ubiquitination(GO:0070534) |
0.1 | 0.2 | GO:0015747 | urate transport(GO:0015747) |
0.1 | 0.1 | GO:0050968 | detection of chemical stimulus involved in sensory perception of pain(GO:0050968) |
0.1 | 0.1 | GO:0009812 | flavonoid metabolic process(GO:0009812) |
0.1 | 0.2 | GO:0021533 | cell differentiation in hindbrain(GO:0021533) |
0.1 | 0.5 | GO:0032781 | positive regulation of ATPase activity(GO:0032781) |
0.1 | 1.6 | GO:0043268 | positive regulation of potassium ion transport(GO:0043268) |
0.1 | 0.1 | GO:0061055 | myotome development(GO:0061055) |
0.1 | 0.2 | GO:0001880 | Mullerian duct regression(GO:0001880) |
0.1 | 1.2 | GO:0000184 | nuclear-transcribed mRNA catabolic process, nonsense-mediated decay(GO:0000184) |
0.1 | 0.2 | GO:0030208 | dermatan sulfate biosynthetic process(GO:0030208) |
0.1 | 0.7 | GO:0006490 | oligosaccharide-lipid intermediate biosynthetic process(GO:0006490) |
0.1 | 0.3 | GO:0034331 | cell junction maintenance(GO:0034331) cell-cell junction maintenance(GO:0045217) |
0.1 | 0.2 | GO:1903862 | positive regulation of oxidative phosphorylation(GO:1903862) |
0.1 | 0.5 | GO:2000310 | regulation of N-methyl-D-aspartate selective glutamate receptor activity(GO:2000310) |
0.1 | 0.7 | GO:0009143 | nucleoside triphosphate catabolic process(GO:0009143) |
0.1 | 0.7 | GO:0014733 | regulation of skeletal muscle adaptation(GO:0014733) |
0.1 | 0.5 | GO:0048025 | negative regulation of mRNA splicing, via spliceosome(GO:0048025) |
0.1 | 0.3 | GO:0061179 | negative regulation of insulin secretion involved in cellular response to glucose stimulus(GO:0061179) |
0.1 | 0.1 | GO:1900126 | negative regulation of hyaluronan biosynthetic process(GO:1900126) |
0.1 | 0.1 | GO:0000087 | mitotic M phase(GO:0000087) |
0.1 | 0.1 | GO:0048382 | mesendoderm development(GO:0048382) corticotropin hormone secreting cell differentiation(GO:0060128) thyroid-stimulating hormone-secreting cell differentiation(GO:0060129) |
0.1 | 0.7 | GO:0006890 | retrograde vesicle-mediated transport, Golgi to ER(GO:0006890) |
0.1 | 0.4 | GO:0015695 | organic cation transport(GO:0015695) |
0.1 | 0.4 | GO:0009299 | mRNA transcription(GO:0009299) |
0.1 | 0.1 | GO:0043134 | hindgut contraction(GO:0043133) regulation of hindgut contraction(GO:0043134) |
0.1 | 0.1 | GO:0071025 | RNA surveillance(GO:0071025) |
0.1 | 0.3 | GO:0018344 | protein geranylgeranylation(GO:0018344) |
0.1 | 0.1 | GO:1902255 | positive regulation of intrinsic apoptotic signaling pathway by p53 class mediator(GO:1902255) |
0.1 | 0.4 | GO:0031297 | replication fork processing(GO:0031297) |
0.1 | 0.2 | GO:0014029 | neural crest formation(GO:0014029) |
0.1 | 1.4 | GO:0006491 | N-glycan processing(GO:0006491) |
0.1 | 0.2 | GO:2000210 | positive regulation of anoikis(GO:2000210) |
0.1 | 0.1 | GO:0040038 | polar body extrusion after meiotic divisions(GO:0040038) formin-nucleated actin cable assembly(GO:0070649) |
0.1 | 0.1 | GO:0070189 | kynurenine metabolic process(GO:0070189) |
0.1 | 0.1 | GO:0030070 | insulin processing(GO:0030070) |
0.1 | 0.3 | GO:0006303 | double-strand break repair via nonhomologous end joining(GO:0006303) |
0.1 | 0.3 | GO:0060177 | regulation of angiotensin levels in blood(GO:0002002) regulation of angiotensin metabolic process(GO:0060177) |
0.1 | 0.1 | GO:0038028 | insulin receptor signaling pathway via phosphatidylinositol 3-kinase(GO:0038028) |
0.1 | 0.3 | GO:0071364 | cellular response to epidermal growth factor stimulus(GO:0071364) |
0.1 | 0.1 | GO:0070318 | positive regulation of G0 to G1 transition(GO:0070318) |
0.1 | 0.4 | GO:0070266 | necroptotic process(GO:0070266) |
0.1 | 0.3 | GO:0009072 | aromatic amino acid family metabolic process(GO:0009072) |
0.1 | 0.1 | GO:0014722 | regulation of skeletal muscle contraction by calcium ion signaling(GO:0014722) |
0.1 | 2.2 | GO:0042147 | retrograde transport, endosome to Golgi(GO:0042147) |
0.1 | 0.9 | GO:0060046 | regulation of acrosome reaction(GO:0060046) |
0.1 | 0.4 | GO:0070050 | neuron cellular homeostasis(GO:0070050) |
0.1 | 0.1 | GO:1901662 | phylloquinone metabolic process(GO:0042374) phylloquinone catabolic process(GO:0042376) quinone catabolic process(GO:1901662) |
0.1 | 0.1 | GO:0060088 | auditory receptor cell stereocilium organization(GO:0060088) |
0.1 | 0.1 | GO:0002536 | respiratory burst involved in inflammatory response(GO:0002536) |
0.1 | 1.2 | GO:0060999 | positive regulation of dendritic spine development(GO:0060999) |
0.1 | 0.2 | GO:0042276 | error-prone translesion synthesis(GO:0042276) |
0.1 | 0.1 | GO:0001777 | T cell homeostatic proliferation(GO:0001777) regulation of T cell homeostatic proliferation(GO:0046013) |
0.1 | 0.2 | GO:0043328 | late endosome to vacuole transport via multivesicular body sorting pathway(GO:0032511) protein targeting to vacuole involved in ubiquitin-dependent protein catabolic process via the multivesicular body sorting pathway(GO:0043328) |
0.1 | 0.2 | GO:0006420 | arginyl-tRNA aminoacylation(GO:0006420) |
0.1 | 0.1 | GO:0002540 | leukotriene production involved in inflammatory response(GO:0002540) |
0.1 | 0.3 | GO:0090077 | foam cell differentiation(GO:0090077) |
0.1 | 0.2 | GO:0002227 | innate immune response in mucosa(GO:0002227) |
0.1 | 0.3 | GO:0034501 | protein localization to kinetochore(GO:0034501) |
0.1 | 0.1 | GO:0032328 | alanine transport(GO:0032328) |
0.1 | 1.3 | GO:0045103 | intermediate filament-based process(GO:0045103) |
0.1 | 0.1 | GO:0009202 | deoxyribonucleoside triphosphate biosynthetic process(GO:0009202) |
0.1 | 5.6 | GO:0006457 | protein folding(GO:0006457) |
0.1 | 2.0 | GO:0033141 | positive regulation of peptidyl-serine phosphorylation of STAT protein(GO:0033141) |
0.1 | 0.8 | GO:0061512 | protein localization to cilium(GO:0061512) |
0.1 | 0.2 | GO:0045065 | cytotoxic T cell differentiation(GO:0045065) |
0.1 | 0.3 | GO:0061029 | eyelid development in camera-type eye(GO:0061029) |
0.1 | 0.2 | GO:0046005 | positive regulation of circadian sleep/wake cycle, REM sleep(GO:0046005) |
0.1 | 0.3 | GO:0071435 | potassium ion export(GO:0071435) |
0.1 | 0.1 | GO:0010832 | negative regulation of myotube differentiation(GO:0010832) |
0.1 | 0.1 | GO:1903423 | positive regulation of synaptic vesicle recycling(GO:1903423) |
0.1 | 0.4 | GO:0061099 | negative regulation of protein tyrosine kinase activity(GO:0061099) |
0.1 | 0.3 | GO:0050917 | sensory perception of umami taste(GO:0050917) |
0.1 | 0.2 | GO:0016576 | histone dephosphorylation(GO:0016576) |
0.1 | 0.2 | GO:0034032 | nucleoside bisphosphate metabolic process(GO:0033865) ribonucleoside bisphosphate metabolic process(GO:0033875) purine nucleoside bisphosphate metabolic process(GO:0034032) |
0.1 | 0.2 | GO:0014022 | neural plate elongation(GO:0014022) convergent extension involved in neural plate elongation(GO:0022007) |
0.1 | 0.1 | GO:1902775 | mitochondrial large ribosomal subunit assembly(GO:1902775) |
0.1 | 0.2 | GO:0016242 | negative regulation of macroautophagy(GO:0016242) |
0.1 | 0.2 | GO:0002636 | positive regulation of germinal center formation(GO:0002636) |
0.1 | 0.2 | GO:0050686 | negative regulation of mRNA processing(GO:0050686) |
0.1 | 0.1 | GO:0007161 | calcium-independent cell-matrix adhesion(GO:0007161) |
0.1 | 2.2 | GO:1901292 | nucleoside phosphate catabolic process(GO:1901292) |
0.1 | 0.1 | GO:0042891 | antibiotic transport(GO:0042891) |
0.1 | 0.1 | GO:0018197 | peptidyl-aspartic acid modification(GO:0018197) |
0.1 | 0.1 | GO:0051964 | negative regulation of synapse assembly(GO:0051964) |
0.1 | 0.7 | GO:0009083 | branched-chain amino acid catabolic process(GO:0009083) |
0.1 | 0.1 | GO:1900454 | positive regulation of long term synaptic depression(GO:1900454) |
0.1 | 0.1 | GO:0042138 | meiotic DNA double-strand break formation(GO:0042138) |
0.1 | 0.3 | GO:0060346 | bone trabecula formation(GO:0060346) |
0.1 | 0.2 | GO:0048505 | regulation of timing of cell differentiation(GO:0048505) |
0.1 | 0.1 | GO:2000318 | positive regulation of T-helper 17 type immune response(GO:2000318) |
0.1 | 0.1 | GO:0021800 | cerebral cortex tangential migration(GO:0021800) |
0.1 | 0.3 | GO:0007341 | penetration of zona pellucida(GO:0007341) |
0.1 | 0.1 | GO:0031034 | myosin filament assembly(GO:0031034) |
0.1 | 0.1 | GO:0001978 | regulation of systemic arterial blood pressure by carotid sinus baroreceptor feedback(GO:0001978) |
0.1 | 0.1 | GO:0042987 | amyloid precursor protein catabolic process(GO:0042987) |
0.1 | 0.7 | GO:0030866 | cortical actin cytoskeleton organization(GO:0030866) |
0.1 | 0.5 | GO:0015693 | magnesium ion transport(GO:0015693) |
0.1 | 0.1 | GO:2001206 | positive regulation of osteoclast development(GO:2001206) |
0.1 | 0.5 | GO:0090199 | regulation of release of cytochrome c from mitochondria(GO:0090199) |
0.1 | 0.2 | GO:0042492 | gamma-delta T cell differentiation(GO:0042492) |
0.1 | 0.1 | GO:0051124 | synaptic growth at neuromuscular junction(GO:0051124) |
0.1 | 0.1 | GO:2000574 | regulation of microtubule motor activity(GO:2000574) |
0.1 | 0.1 | GO:0002093 | auditory receptor cell morphogenesis(GO:0002093) |
0.1 | 0.1 | GO:0033566 | gamma-tubulin complex localization(GO:0033566) |
0.1 | 0.3 | GO:0006590 | thyroid hormone generation(GO:0006590) |
0.1 | 0.2 | GO:1902236 | negative regulation of endoplasmic reticulum stress-induced intrinsic apoptotic signaling pathway(GO:1902236) |
0.1 | 0.1 | GO:0090071 | negative regulation of ribosome biogenesis(GO:0090071) |
0.1 | 0.1 | GO:0031937 | positive regulation of chromatin silencing(GO:0031937) |
0.1 | 0.1 | GO:0070948 | regulation of neutrophil mediated cytotoxicity(GO:0070948) regulation of neutrophil mediated killing of symbiont cell(GO:0070949) |
0.1 | 0.1 | GO:0060279 | positive regulation of ovulation(GO:0060279) |
0.1 | 0.1 | GO:0006624 | vacuolar protein processing(GO:0006624) |
0.1 | 0.1 | GO:0036302 | atrioventricular canal development(GO:0036302) |
0.1 | 0.1 | GO:0007638 | mechanosensory behavior(GO:0007638) |
0.1 | 0.5 | GO:0046835 | carbohydrate phosphorylation(GO:0046835) |
0.1 | 1.8 | GO:0006633 | fatty acid biosynthetic process(GO:0006633) |
0.1 | 0.2 | GO:0044346 | fibroblast apoptotic process(GO:0044346) |
0.1 | 0.1 | GO:0007406 | negative regulation of neuroblast proliferation(GO:0007406) |
0.1 | 0.1 | GO:0042421 | norepinephrine biosynthetic process(GO:0042421) |
0.1 | 0.1 | GO:0090656 | t-circle formation(GO:0090656) |
0.1 | 0.3 | GO:0051290 | protein heterotetramerization(GO:0051290) |
0.1 | 0.1 | GO:0045759 | negative regulation of action potential(GO:0045759) |
0.1 | 0.1 | GO:0090308 | regulation of methylation-dependent chromatin silencing(GO:0090308) |
0.1 | 0.1 | GO:0018125 | peptidyl-cysteine methylation(GO:0018125) |
0.1 | 0.4 | GO:0018095 | protein polyglutamylation(GO:0018095) |
0.1 | 0.7 | GO:1900449 | regulation of glutamate receptor signaling pathway(GO:1900449) |
0.1 | 0.3 | GO:0071918 | urea transmembrane transport(GO:0071918) |
0.1 | 0.1 | GO:0072513 | positive regulation of secondary heart field cardioblast proliferation(GO:0072513) |
0.1 | 0.1 | GO:0070973 | protein localization to endoplasmic reticulum exit site(GO:0070973) |
0.1 | 0.2 | GO:0033262 | regulation of nuclear cell cycle DNA replication(GO:0033262) |
0.1 | 0.1 | GO:0070562 | regulation of vitamin D receptor signaling pathway(GO:0070562) |
0.1 | 0.5 | GO:0046856 | phosphatidylinositol dephosphorylation(GO:0046856) |
0.1 | 0.2 | GO:0043457 | regulation of cellular respiration(GO:0043457) |
0.1 | 0.1 | GO:0051546 | keratinocyte migration(GO:0051546) |
0.1 | 0.1 | GO:0071895 | odontoblast differentiation(GO:0071895) |
0.1 | 0.2 | GO:0050859 | negative regulation of B cell receptor signaling pathway(GO:0050859) |
0.1 | 0.2 | GO:0060510 | Type II pneumocyte differentiation(GO:0060510) |
0.1 | 0.1 | GO:0046477 | glycosylceramide catabolic process(GO:0046477) |
0.1 | 0.4 | GO:0032836 | glomerular basement membrane development(GO:0032836) |
0.1 | 0.2 | GO:0040019 | positive regulation of embryonic development(GO:0040019) |
0.1 | 0.8 | GO:0030521 | androgen receptor signaling pathway(GO:0030521) |
0.1 | 0.1 | GO:0002323 | natural killer cell activation involved in immune response(GO:0002323) |
0.1 | 0.1 | GO:0042510 | regulation of tyrosine phosphorylation of Stat1 protein(GO:0042510) |
0.1 | 0.1 | GO:0032909 | transforming growth factor beta2 production(GO:0032906) regulation of transforming growth factor beta2 production(GO:0032909) |
0.1 | 0.4 | GO:0048268 | clathrin coat assembly(GO:0048268) |
0.1 | 0.5 | GO:0008535 | respiratory chain complex IV assembly(GO:0008535) |
0.1 | 0.3 | GO:0010714 | positive regulation of collagen metabolic process(GO:0010714) positive regulation of collagen biosynthetic process(GO:0032967) positive regulation of multicellular organismal metabolic process(GO:0044253) |
0.1 | 2.0 | GO:0032543 | mitochondrial translation(GO:0032543) |
0.1 | 0.2 | GO:0007418 | ventral midline development(GO:0007418) |
0.1 | 0.4 | GO:0070633 | transepithelial transport(GO:0070633) |
0.1 | 0.1 | GO:0032819 | positive regulation of natural killer cell proliferation(GO:0032819) |
0.1 | 0.1 | GO:0070914 | UV-damage excision repair(GO:0070914) |
0.1 | 0.2 | GO:0030432 | peristalsis(GO:0030432) |
0.1 | 0.1 | GO:0002442 | serotonin production involved in inflammatory response(GO:0002351) serotonin secretion involved in inflammatory response(GO:0002442) |
0.1 | 0.8 | GO:0014904 | myotube cell development(GO:0014904) |
0.1 | 0.3 | GO:0071257 | cellular response to electrical stimulus(GO:0071257) |
0.1 | 0.1 | GO:1904948 | midbrain dopaminergic neuron differentiation(GO:1904948) |
0.1 | 0.1 | GO:0033143 | regulation of intracellular steroid hormone receptor signaling pathway(GO:0033143) |
0.0 | 0.0 | GO:0060068 | vagina development(GO:0060068) |
0.0 | 0.3 | GO:0009060 | aerobic respiration(GO:0009060) |
0.0 | 0.1 | GO:0045650 | negative regulation of macrophage differentiation(GO:0045650) |
0.0 | 0.0 | GO:0070375 | ERK5 cascade(GO:0070375) |
0.0 | 0.0 | GO:0030997 | regulation of centriole-centriole cohesion(GO:0030997) |
0.0 | 0.6 | GO:0046854 | phosphatidylinositol phosphorylation(GO:0046854) |
0.0 | 0.1 | GO:0010936 | negative regulation of macrophage cytokine production(GO:0010936) |
0.0 | 0.1 | GO:0008065 | establishment of blood-nerve barrier(GO:0008065) |
0.0 | 0.7 | GO:0030520 | intracellular estrogen receptor signaling pathway(GO:0030520) |
0.0 | 0.1 | GO:0021578 | hindbrain maturation(GO:0021578) central nervous system maturation(GO:0021626) |
0.0 | 0.1 | GO:0001732 | formation of cytoplasmic translation initiation complex(GO:0001732) |
0.0 | 0.1 | GO:0034351 | negative regulation of glial cell apoptotic process(GO:0034351) |
0.0 | 0.1 | GO:0070094 | positive regulation of glucagon secretion(GO:0070094) |
0.0 | 0.2 | GO:0006685 | sphingomyelin catabolic process(GO:0006685) |
0.0 | 0.4 | GO:0002566 | somatic diversification of immune receptors via somatic mutation(GO:0002566) somatic hypermutation of immunoglobulin genes(GO:0016446) |
0.0 | 0.3 | GO:0051967 | negative regulation of synaptic transmission, glutamatergic(GO:0051967) |
0.0 | 0.1 | GO:0043586 | tongue development(GO:0043586) |
0.0 | 0.1 | GO:1900108 | negative regulation of nodal signaling pathway(GO:1900108) |
0.0 | 0.7 | GO:0019432 | triglyceride biosynthetic process(GO:0019432) |
0.0 | 0.2 | GO:0006398 | mRNA 3'-end processing by stem-loop binding and cleavage(GO:0006398) |
0.0 | 0.3 | GO:0000185 | activation of MAPKKK activity(GO:0000185) |
0.0 | 0.2 | GO:0070995 | NADPH oxidation(GO:0070995) |
0.0 | 0.1 | GO:0035610 | protein side chain deglutamylation(GO:0035610) |
0.0 | 0.1 | GO:0098535 | de novo centriole assembly(GO:0098535) |
0.0 | 0.2 | GO:0042780 | tRNA 3'-end processing(GO:0042780) |
0.0 | 0.3 | GO:0045086 | positive regulation of interleukin-2 biosynthetic process(GO:0045086) |
0.0 | 0.2 | GO:0022900 | electron transport chain(GO:0022900) |
0.0 | 0.1 | GO:0021764 | amygdala development(GO:0021764) |
0.0 | 0.1 | GO:0009298 | GDP-mannose biosynthetic process(GO:0009298) |
0.0 | 0.1 | GO:0048668 | collateral sprouting(GO:0048668) |
0.0 | 0.5 | GO:0006541 | glutamine metabolic process(GO:0006541) |
0.0 | 0.5 | GO:0072661 | protein targeting to plasma membrane(GO:0072661) |
0.0 | 0.1 | GO:0010387 | COP9 signalosome assembly(GO:0010387) |
0.0 | 0.2 | GO:0006646 | phosphatidylethanolamine biosynthetic process(GO:0006646) |
0.0 | 0.3 | GO:0006702 | androgen biosynthetic process(GO:0006702) |
0.0 | 0.1 | GO:0006369 | termination of RNA polymerase II transcription(GO:0006369) |
0.0 | 0.0 | GO:0042268 | regulation of cytolysis(GO:0042268) |
0.0 | 0.1 | GO:0048752 | semicircular canal morphogenesis(GO:0048752) |
0.0 | 0.2 | GO:0044821 | meiotic telomere tethering at nuclear periphery(GO:0044821) meiotic attachment of telomere to nuclear envelope(GO:0070197) chromosome attachment to the nuclear envelope(GO:0097240) |
0.0 | 2.7 | GO:0016579 | protein deubiquitination(GO:0016579) |
0.0 | 0.1 | GO:0072148 | epithelial cell fate commitment(GO:0072148) |
0.0 | 0.1 | GO:0002931 | response to ischemia(GO:0002931) |
0.0 | 0.1 | GO:0002115 | store-operated calcium entry(GO:0002115) |
0.0 | 0.2 | GO:0071625 | vocalization behavior(GO:0071625) |
0.0 | 0.3 | GO:2000001 | regulation of DNA damage checkpoint(GO:2000001) |
0.0 | 0.1 | GO:0060988 | lipid tube assembly(GO:0060988) |
0.0 | 0.0 | GO:0000727 | double-strand break repair via break-induced replication(GO:0000727) |
0.0 | 0.1 | GO:0060267 | positive regulation of respiratory burst(GO:0060267) |
0.0 | 0.0 | GO:0010046 | response to mycotoxin(GO:0010046) |
0.0 | 0.2 | GO:0042446 | hormone biosynthetic process(GO:0042446) |
0.0 | 0.1 | GO:0045590 | negative regulation of regulatory T cell differentiation(GO:0045590) |
0.0 | 0.3 | GO:0030206 | chondroitin sulfate biosynthetic process(GO:0030206) |
0.0 | 0.1 | GO:0030157 | pancreatic juice secretion(GO:0030157) |
0.0 | 0.1 | GO:0060979 | vasculogenesis involved in coronary vascular morphogenesis(GO:0060979) |
0.0 | 0.1 | GO:0090336 | positive regulation of brown fat cell differentiation(GO:0090336) |
0.0 | 0.1 | GO:0001992 | regulation of systemic arterial blood pressure by vasopressin(GO:0001992) |
0.0 | 0.2 | GO:0043116 | negative regulation of vascular permeability(GO:0043116) |
0.0 | 0.0 | GO:0046459 | short-chain fatty acid metabolic process(GO:0046459) |
0.0 | 0.1 | GO:0097211 | response to gonadotropin-releasing hormone(GO:0097210) cellular response to gonadotropin-releasing hormone(GO:0097211) |
0.0 | 0.4 | GO:0048266 | behavioral response to pain(GO:0048266) |
0.0 | 0.0 | GO:0002679 | respiratory burst involved in defense response(GO:0002679) |
0.0 | 0.2 | GO:0002467 | germinal center formation(GO:0002467) |
0.0 | 0.3 | GO:1901186 | positive regulation of ERBB signaling pathway(GO:1901186) |
0.0 | 1.0 | GO:0019369 | arachidonic acid metabolic process(GO:0019369) |
0.0 | 0.1 | GO:0007199 | G-protein coupled receptor signaling pathway coupled to cGMP nucleotide second messenger(GO:0007199) |
0.0 | 0.1 | GO:0060830 | ciliary receptor clustering involved in smoothened signaling pathway(GO:0060830) |
0.0 | 0.5 | GO:0006379 | mRNA cleavage(GO:0006379) |
0.0 | 0.1 | GO:0090400 | stress-induced premature senescence(GO:0090400) |
0.0 | 0.3 | GO:1902043 | positive regulation of extrinsic apoptotic signaling pathway via death domain receptors(GO:1902043) |
0.0 | 0.0 | GO:1902074 | response to salt(GO:1902074) |
0.0 | 0.1 | GO:0002215 | defense response to nematode(GO:0002215) |
0.0 | 0.4 | GO:0048147 | negative regulation of fibroblast proliferation(GO:0048147) |
0.0 | 0.1 | GO:0061303 | cornea development in camera-type eye(GO:0061303) |
0.0 | 0.1 | GO:1902309 | negative regulation of peptidyl-serine dephosphorylation(GO:1902309) |
0.0 | 0.2 | GO:0051415 | interphase microtubule nucleation by interphase microtubule organizing center(GO:0051415) microtubule nucleation by microtubule organizing center(GO:0051418) |
0.0 | 0.1 | GO:0007007 | inner mitochondrial membrane organization(GO:0007007) |
0.0 | 0.5 | GO:1901998 | toxin transport(GO:1901998) |
0.0 | 0.0 | GO:2000977 | regulation of forebrain neuron differentiation(GO:2000977) |
0.0 | 0.5 | GO:1903146 | regulation of mitophagy(GO:1903146) |
0.0 | 0.1 | GO:0032733 | positive regulation of interleukin-10 production(GO:0032733) |
0.0 | 0.1 | GO:0035962 | response to interleukin-13(GO:0035962) cellular response to interleukin-13(GO:0035963) |
0.0 | 0.9 | GO:2001243 | negative regulation of intrinsic apoptotic signaling pathway(GO:2001243) |
0.0 | 0.1 | GO:0034146 | toll-like receptor 5 signaling pathway(GO:0034146) |
0.0 | 0.3 | GO:0071260 | cellular response to mechanical stimulus(GO:0071260) |
0.0 | 0.0 | GO:0009946 | proximal/distal axis specification(GO:0009946) |
0.0 | 0.1 | GO:0014831 | gastro-intestinal system smooth muscle contraction(GO:0014831) |
0.0 | 0.3 | GO:0043631 | mRNA polyadenylation(GO:0006378) RNA polyadenylation(GO:0043631) |
0.0 | 0.2 | GO:1901184 | regulation of ERBB signaling pathway(GO:1901184) |
0.0 | 0.2 | GO:0031119 | tRNA pseudouridine synthesis(GO:0031119) |
0.0 | 0.2 | GO:0045075 | interleukin-12 biosynthetic process(GO:0042090) regulation of interleukin-12 biosynthetic process(GO:0045075) |
0.0 | 0.2 | GO:0002716 | negative regulation of natural killer cell mediated immunity(GO:0002716) |
0.0 | 0.2 | GO:0008340 | determination of adult lifespan(GO:0008340) |
0.0 | 0.1 | GO:0090261 | positive regulation of inclusion body assembly(GO:0090261) |
0.0 | 0.1 | GO:0060455 | negative regulation of gastric acid secretion(GO:0060455) |
0.0 | 0.0 | GO:0070307 | lens fiber cell development(GO:0070307) |
0.0 | 0.1 | GO:0006003 | fructose 2,6-bisphosphate metabolic process(GO:0006003) |
0.0 | 0.1 | GO:0006597 | spermine biosynthetic process(GO:0006597) |
0.0 | 0.0 | GO:0035106 | operant conditioning(GO:0035106) |
0.0 | 0.0 | GO:0098902 | regulation of membrane depolarization during action potential(GO:0098902) |
0.0 | 0.1 | GO:0002752 | cell surface pattern recognition receptor signaling pathway(GO:0002752) |
0.0 | 0.0 | GO:0000492 | small nucleolar ribonucleoprotein complex assembly(GO:0000491) box C/D snoRNP assembly(GO:0000492) |
0.0 | 0.0 | GO:0046292 | formaldehyde metabolic process(GO:0046292) |
0.0 | 0.4 | GO:0006284 | base-excision repair(GO:0006284) |
0.0 | 0.3 | GO:0006298 | mismatch repair(GO:0006298) |
0.0 | 0.1 | GO:0042726 | flavin-containing compound metabolic process(GO:0042726) |
0.0 | 0.1 | GO:0008343 | adult feeding behavior(GO:0008343) |
0.0 | 1.0 | GO:0045668 | negative regulation of osteoblast differentiation(GO:0045668) |
0.0 | 0.0 | GO:0070086 | ubiquitin-dependent endocytosis(GO:0070086) |
0.0 | 0.6 | GO:0071479 | cellular response to ionizing radiation(GO:0071479) |
0.0 | 0.1 | GO:0038094 | Fc-gamma receptor signaling pathway(GO:0038094) |
0.0 | 0.1 | GO:0048570 | notochord morphogenesis(GO:0048570) |
0.0 | 0.2 | GO:0010259 | multicellular organism aging(GO:0010259) |
0.0 | 6.7 | GO:0008380 | RNA splicing(GO:0008380) |
0.0 | 0.3 | GO:0018298 | protein-chromophore linkage(GO:0018298) |
0.0 | 0.6 | GO:0043171 | peptide catabolic process(GO:0043171) |
0.0 | 0.1 | GO:0033260 | nuclear DNA replication(GO:0033260) |
0.0 | 0.1 | GO:0007386 | compartment pattern specification(GO:0007386) |
0.0 | 0.3 | GO:0031167 | rRNA methylation(GO:0031167) |
0.0 | 0.1 | GO:0032224 | positive regulation of synaptic transmission, cholinergic(GO:0032224) |
0.0 | 0.3 | GO:0002862 | negative regulation of inflammatory response to antigenic stimulus(GO:0002862) |
0.0 | 0.6 | GO:0016925 | protein sumoylation(GO:0016925) |
0.0 | 0.1 | GO:0060050 | positive regulation of protein glycosylation(GO:0060050) |
0.0 | 0.1 | GO:0033601 | positive regulation of mammary gland epithelial cell proliferation(GO:0033601) |
0.0 | 0.0 | GO:0035090 | maintenance of apical/basal cell polarity(GO:0035090) maintenance of epithelial cell apical/basal polarity(GO:0045199) |
0.0 | 0.0 | GO:2000286 | receptor internalization involved in canonical Wnt signaling pathway(GO:2000286) |
0.0 | 0.1 | GO:0007468 | regulation of rhodopsin gene expression(GO:0007468) |
0.0 | 0.1 | GO:0035589 | G-protein coupled purinergic nucleotide receptor signaling pathway(GO:0035589) |
0.0 | 0.0 | GO:0071608 | macrophage inflammatory protein-1 alpha production(GO:0071608) |
0.0 | 0.1 | GO:0030049 | muscle filament sliding(GO:0030049) |
0.0 | 0.1 | GO:0060907 | positive regulation of macrophage cytokine production(GO:0060907) |
0.0 | 0.1 | GO:0072395 | signal transduction involved in cell cycle checkpoint(GO:0072395) signal transduction involved in DNA integrity checkpoint(GO:0072401) signal transduction involved in DNA damage checkpoint(GO:0072422) signal transduction involved in mitotic G1 DNA damage checkpoint(GO:0072431) intracellular signal transduction involved in G1 DNA damage checkpoint(GO:1902400) |
0.0 | 0.1 | GO:0006528 | asparagine metabolic process(GO:0006528) |
0.0 | 0.0 | GO:0060681 | branch elongation involved in ureteric bud branching(GO:0060681) |
0.0 | 0.1 | GO:0000160 | phosphorelay signal transduction system(GO:0000160) |
0.0 | 0.2 | GO:0097094 | craniofacial suture morphogenesis(GO:0097094) |
0.0 | 0.8 | GO:0030500 | regulation of bone mineralization(GO:0030500) |
0.0 | 0.2 | GO:0042744 | hydrogen peroxide catabolic process(GO:0042744) |
0.0 | 0.1 | GO:0046836 | glycolipid transport(GO:0046836) |
0.0 | 0.0 | GO:2000343 | positive regulation of chemokine (C-X-C motif) ligand 2 production(GO:2000343) |
0.0 | 0.1 | GO:0014002 | astrocyte development(GO:0014002) |
0.0 | 0.8 | GO:0051092 | positive regulation of NF-kappaB transcription factor activity(GO:0051092) |
0.0 | 0.1 | GO:0042628 | mating plug formation(GO:0042628) post-mating behavior(GO:0045297) |
0.0 | 0.1 | GO:0030865 | cortical cytoskeleton organization(GO:0030865) |
0.0 | 0.0 | GO:0060117 | auditory receptor cell development(GO:0060117) |
0.0 | 0.2 | GO:0060441 | epithelial tube branching involved in lung morphogenesis(GO:0060441) |
0.0 | 0.0 | GO:0002424 | T cell mediated immune response to tumor cell(GO:0002424) regulation of T cell mediated immune response to tumor cell(GO:0002840) |
0.0 | 0.3 | GO:0045047 | protein targeting to ER(GO:0045047) |
0.0 | 0.0 | GO:0044791 | modulation by host of viral release from host cell(GO:0044789) positive regulation by host of viral release from host cell(GO:0044791) |
0.0 | 0.1 | GO:0010360 | negative regulation of anion channel activity(GO:0010360) |
0.0 | 0.1 | GO:0060478 | acrosomal vesicle exocytosis(GO:0060478) |
0.0 | 0.1 | GO:0046600 | negative regulation of centriole replication(GO:0046600) |
0.0 | 0.0 | GO:0042481 | regulation of odontogenesis(GO:0042481) |
0.0 | 0.1 | GO:0042126 | nitrate metabolic process(GO:0042126) |
0.0 | 0.1 | GO:0039529 | RIG-I signaling pathway(GO:0039529) |
0.0 | 0.0 | GO:0002070 | epithelial cell maturation(GO:0002070) |
0.0 | 0.1 | GO:0045955 | negative regulation of calcium ion-dependent exocytosis(GO:0045955) |
0.0 | 0.2 | GO:0035269 | protein O-linked mannosylation(GO:0035269) |
0.0 | 0.2 | GO:0001709 | cell fate determination(GO:0001709) |
0.0 | 0.0 | GO:1903215 | negative regulation of protein targeting to mitochondrion(GO:1903215) |
0.0 | 0.1 | GO:0090385 | phagosome-lysosome fusion(GO:0090385) |
0.0 | 0.0 | GO:0061743 | motor learning(GO:0061743) |
0.0 | 0.1 | GO:0021978 | telencephalon regionalization(GO:0021978) |
0.0 | 0.1 | GO:0019478 | D-amino acid catabolic process(GO:0019478) D-amino acid metabolic process(GO:0046416) |
0.0 | 0.1 | GO:0032332 | positive regulation of chondrocyte differentiation(GO:0032332) |
0.0 | 0.1 | GO:0035751 | regulation of lysosomal lumen pH(GO:0035751) |
0.0 | 0.1 | GO:0030311 | poly-N-acetyllactosamine metabolic process(GO:0030309) poly-N-acetyllactosamine biosynthetic process(GO:0030311) |
0.0 | 0.2 | GO:0010758 | regulation of macrophage chemotaxis(GO:0010758) |
0.0 | 0.1 | GO:0001553 | luteinization(GO:0001553) |
0.0 | 0.2 | GO:0010737 | protein kinase A signaling(GO:0010737) |
0.0 | 0.1 | GO:0032310 | prostaglandin secretion(GO:0032310) |
0.0 | 0.0 | GO:0043504 | mitochondrial DNA repair(GO:0043504) |
0.0 | 0.4 | GO:0032755 | positive regulation of interleukin-6 production(GO:0032755) |
0.0 | 0.1 | GO:0009106 | lipoate metabolic process(GO:0009106) |
0.0 | 0.1 | GO:0033522 | histone H2A ubiquitination(GO:0033522) |
0.0 | 0.3 | GO:0030204 | chondroitin sulfate metabolic process(GO:0030204) |
0.0 | 0.3 | GO:0061298 | retina vasculature development in camera-type eye(GO:0061298) |
0.0 | 0.4 | GO:0046348 | amino sugar catabolic process(GO:0046348) |
0.0 | 0.0 | GO:0010040 | response to iron(II) ion(GO:0010040) |
0.0 | 0.3 | GO:0006940 | regulation of smooth muscle contraction(GO:0006940) |
0.0 | 0.1 | GO:0051589 | negative regulation of neurotransmitter transport(GO:0051589) |
0.0 | 0.0 | GO:0001920 | negative regulation of receptor recycling(GO:0001920) |
0.0 | 0.0 | GO:0035315 | hair cell differentiation(GO:0035315) |
0.0 | 0.1 | GO:2000257 | regulation of protein activation cascade(GO:2000257) |
0.0 | 0.1 | GO:0052204 | modulation of molecular function in other organism(GO:0044359) negative regulation of molecular function in other organism(GO:0044362) modulation by symbiont of host molecular function(GO:0052055) negative regulation of molecular function in other organism involved in symbiotic interaction(GO:0052204) modulation of molecular function in other organism involved in symbiotic interaction(GO:0052205) |
0.0 | 0.0 | GO:0032829 | regulation of CD4-positive, CD25-positive, alpha-beta regulatory T cell differentiation(GO:0032829) |
0.0 | 0.0 | GO:0070673 | response to interleukin-18(GO:0070673) |
0.0 | 0.0 | GO:1901077 | regulation of relaxation of muscle(GO:1901077) regulation of calcium-transporting ATPase activity(GO:1901894) |
0.0 | 0.0 | GO:0031547 | brain-derived neurotrophic factor receptor signaling pathway(GO:0031547) |
0.0 | 0.2 | GO:0021889 | olfactory bulb interneuron differentiation(GO:0021889) |
0.0 | 0.2 | GO:0071542 | dopaminergic neuron differentiation(GO:0071542) |
0.0 | 0.1 | GO:1901550 | regulation of endothelial cell development(GO:1901550) regulation of establishment of endothelial barrier(GO:1903140) |
0.0 | 0.1 | GO:0045589 | regulation of regulatory T cell differentiation(GO:0045589) |
0.0 | 0.2 | GO:0050910 | detection of mechanical stimulus involved in sensory perception of sound(GO:0050910) |
0.0 | 0.7 | GO:0043966 | histone H3 acetylation(GO:0043966) |
0.0 | 0.0 | GO:0042636 | negative regulation of hair cycle(GO:0042636) |
0.0 | 0.6 | GO:0006818 | hydrogen transport(GO:0006818) |
0.0 | 0.1 | GO:0060017 | parathyroid gland development(GO:0060017) |
0.0 | 0.1 | GO:0007625 | grooming behavior(GO:0007625) |
0.0 | 0.2 | GO:1900087 | positive regulation of G1/S transition of mitotic cell cycle(GO:1900087) |
0.0 | 0.1 | GO:0035457 | cellular response to interferon-alpha(GO:0035457) |
0.0 | 0.1 | GO:0043462 | regulation of ATPase activity(GO:0043462) |
0.0 | 1.2 | GO:0006694 | steroid biosynthetic process(GO:0006694) |
0.0 | 0.0 | GO:0090074 | negative regulation of protein homodimerization activity(GO:0090074) |
0.0 | 0.2 | GO:0009312 | oligosaccharide biosynthetic process(GO:0009312) |
0.0 | 0.0 | GO:0060100 | positive regulation of phagocytosis, engulfment(GO:0060100) positive regulation of membrane invagination(GO:1905155) |
0.0 | 0.1 | GO:0035845 | photoreceptor cell outer segment organization(GO:0035845) |
0.0 | 0.3 | GO:0031018 | endocrine pancreas development(GO:0031018) |
0.0 | 0.1 | GO:0060856 | establishment of blood-brain barrier(GO:0060856) |
0.0 | 0.0 | GO:0035988 | chondrocyte proliferation(GO:0035988) |
0.0 | 0.2 | GO:0034587 | piRNA metabolic process(GO:0034587) |
0.0 | 0.0 | GO:0044387 | negative regulation of protein kinase activity by regulation of protein phosphorylation(GO:0044387) regulation of peptidyl-serine dephosphorylation(GO:1902308) |
0.0 | 0.1 | GO:0047496 | vesicle transport along microtubule(GO:0047496) |
0.0 | 0.5 | GO:0006953 | acute-phase response(GO:0006953) |
0.0 | 0.0 | GO:0048852 | diencephalon morphogenesis(GO:0048852) |
0.0 | 0.0 | GO:0002361 | CD4-positive, CD25-positive, alpha-beta regulatory T cell differentiation(GO:0002361) |
0.0 | 0.6 | GO:0046530 | photoreceptor cell differentiation(GO:0046530) |
0.0 | 0.1 | GO:0032747 | positive regulation of interleukin-23 production(GO:0032747) |
0.0 | 0.0 | GO:0006269 | DNA replication, synthesis of RNA primer(GO:0006269) |
0.0 | 0.0 | GO:2000756 | regulation of peptidyl-lysine acetylation(GO:2000756) |
0.0 | 0.0 | GO:0060754 | positive regulation of mast cell chemotaxis(GO:0060754) |
0.0 | 0.0 | GO:0060453 | regulation of gastric acid secretion(GO:0060453) |
0.0 | 0.0 | GO:0006931 | substrate-dependent cell migration, cell attachment to substrate(GO:0006931) |
0.0 | 0.0 | GO:1900227 | positive regulation of NLRP3 inflammasome complex assembly(GO:1900227) |
0.0 | 0.4 | GO:0032088 | negative regulation of NF-kappaB transcription factor activity(GO:0032088) |
0.0 | 0.2 | GO:0035690 | cellular response to drug(GO:0035690) |
0.0 | 0.0 | GO:0035810 | positive regulation of urine volume(GO:0035810) |
0.0 | 0.2 | GO:1901385 | regulation of voltage-gated calcium channel activity(GO:1901385) |
0.0 | 0.0 | GO:0060073 | micturition(GO:0060073) |
0.0 | 0.0 | GO:0035562 | negative regulation of chromatin binding(GO:0035562) |
0.0 | 0.1 | GO:0070169 | positive regulation of biomineral tissue development(GO:0070169) |
0.0 | 0.0 | GO:0033563 | dorsal/ventral axon guidance(GO:0033563) |
0.0 | 0.0 | GO:0045648 | positive regulation of erythrocyte differentiation(GO:0045648) |
0.0 | 0.0 | GO:0048934 | peripheral nervous system neuron differentiation(GO:0048934) peripheral nervous system neuron development(GO:0048935) |
0.0 | 0.1 | GO:0035745 | T-helper 2 cell cytokine production(GO:0035745) |
0.0 | 0.0 | GO:0060075 | regulation of resting membrane potential(GO:0060075) |
0.0 | 0.0 | GO:0018904 | ether metabolic process(GO:0018904) |
0.0 | 0.3 | GO:0060113 | inner ear receptor cell differentiation(GO:0060113) |
0.0 | 0.1 | GO:0000154 | rRNA modification(GO:0000154) |
0.0 | 1.1 | GO:0098792 | xenophagy(GO:0098792) |
0.0 | 0.2 | GO:0009954 | proximal/distal pattern formation(GO:0009954) |
0.0 | 0.2 | GO:2001244 | positive regulation of intrinsic apoptotic signaling pathway(GO:2001244) |
0.0 | 0.2 | GO:0009595 | detection of biotic stimulus(GO:0009595) |
0.0 | 0.0 | GO:1900425 | negative regulation of defense response to bacterium(GO:1900425) |
0.0 | 0.1 | GO:0033299 | secretion of lysosomal enzymes(GO:0033299) |
0.0 | 0.0 | GO:0006610 | ribosomal protein import into nucleus(GO:0006610) |
0.0 | 0.0 | GO:0051005 | negative regulation of lipoprotein lipase activity(GO:0051005) |
0.0 | 0.3 | GO:0030433 | ER-associated ubiquitin-dependent protein catabolic process(GO:0030433) |
0.0 | 0.1 | GO:0018208 | peptidyl-proline modification(GO:0018208) |
0.0 | 0.0 | GO:2000696 | regulation of epithelial cell differentiation involved in kidney development(GO:2000696) |
0.0 | 0.0 | GO:0045060 | negative thymic T cell selection(GO:0045060) |
0.0 | 0.0 | GO:0048715 | negative regulation of oligodendrocyte differentiation(GO:0048715) |
0.0 | 0.0 | GO:1903020 | positive regulation of glycoprotein metabolic process(GO:1903020) |
0.0 | 0.4 | GO:0051028 | mRNA transport(GO:0051028) |
0.0 | 0.1 | GO:0048873 | homeostasis of number of cells within a tissue(GO:0048873) |
0.0 | 0.0 | GO:0090080 | positive regulation of MAPKKK cascade by fibroblast growth factor receptor signaling pathway(GO:0090080) |
0.0 | 0.0 | GO:0030205 | dermatan sulfate metabolic process(GO:0030205) |
0.0 | 0.0 | GO:0043416 | regulation of skeletal muscle tissue regeneration(GO:0043416) |
0.0 | 0.0 | GO:0043461 | proton-transporting ATP synthase complex assembly(GO:0043461) proton-transporting ATP synthase complex biogenesis(GO:0070272) |
0.0 | 0.1 | GO:0033313 | meiotic cell cycle checkpoint(GO:0033313) |
0.0 | 0.0 | GO:0048311 | mitochondrion distribution(GO:0048311) |
0.0 | 0.1 | GO:0014046 | dopamine secretion(GO:0014046) regulation of dopamine secretion(GO:0014059) |
0.0 | 0.2 | GO:0042559 | pteridine-containing compound biosynthetic process(GO:0042559) |
0.0 | 0.0 | GO:0032689 | negative regulation of interferon-gamma production(GO:0032689) |
0.0 | 0.3 | GO:0016573 | histone acetylation(GO:0016573) |
0.0 | 0.1 | GO:0075525 | viral translational termination-reinitiation(GO:0075525) |
0.0 | 0.0 | GO:0030327 | prenylated protein catabolic process(GO:0030327) |
0.0 | 0.1 | GO:0030575 | nuclear body organization(GO:0030575) |
0.0 | 0.0 | GO:1902019 | regulation of cilium movement involved in cell motility(GO:0060295) regulation of cilium beat frequency involved in ciliary motility(GO:0060296) regulation of cilium-dependent cell motility(GO:1902019) |
0.0 | 0.0 | GO:2000348 | regulation of CD40 signaling pathway(GO:2000348) |
0.0 | 0.1 | GO:0060042 | retina morphogenesis in camera-type eye(GO:0060042) |
0.0 | 0.0 | GO:0021984 | adenohypophysis development(GO:0021984) |
0.0 | 0.0 | GO:0060134 | prepulse inhibition(GO:0060134) |
0.0 | 0.0 | GO:2000048 | negative regulation of cell-cell adhesion mediated by cadherin(GO:2000048) |
0.0 | 0.0 | GO:0090244 | Wnt signaling pathway involved in somitogenesis(GO:0090244) |
0.0 | 0.0 | GO:1901626 | regulation of postsynaptic membrane organization(GO:1901626) |
0.0 | 0.1 | GO:0015846 | polyamine transport(GO:0015846) |
0.0 | 0.1 | GO:0015671 | oxygen transport(GO:0015671) |
0.0 | 0.0 | GO:0070842 | aggresome assembly(GO:0070842) |
0.0 | 0.0 | GO:1902186 | regulation of viral release from host cell(GO:1902186) |
0.0 | 0.1 | GO:0097186 | amelogenesis(GO:0097186) |
0.0 | 0.0 | GO:0055026 | negative regulation of cardiac muscle tissue development(GO:0055026) |
0.0 | 0.1 | GO:0008655 | pyrimidine-containing compound salvage(GO:0008655) pyrimidine nucleoside salvage(GO:0043097) |
0.0 | 0.0 | GO:0003357 | noradrenergic neuron differentiation(GO:0003357) |
0.0 | 0.0 | GO:0000972 | transcription-dependent tethering of RNA polymerase II gene DNA at nuclear periphery(GO:0000972) |
0.0 | 0.0 | GO:0002581 | regulation of antigen processing and presentation of peptide or polysaccharide antigen via MHC class II(GO:0002580) negative regulation of antigen processing and presentation of peptide or polysaccharide antigen via MHC class II(GO:0002581) |
0.0 | 0.0 | GO:0030579 | ubiquitin-dependent SMAD protein catabolic process(GO:0030579) |
0.0 | 0.0 | GO:2000402 | negative regulation of lymphocyte migration(GO:2000402) |
0.0 | 0.3 | GO:0048240 | sperm capacitation(GO:0048240) |
0.0 | 0.0 | GO:0060687 | regulation of branching involved in prostate gland morphogenesis(GO:0060687) |
0.0 | 0.0 | GO:1902202 | regulation of hepatocyte growth factor receptor signaling pathway(GO:1902202) |
0.0 | 0.0 | GO:2000353 | positive regulation of endothelial cell apoptotic process(GO:2000353) |
0.0 | 0.0 | GO:0007549 | dosage compensation(GO:0007549) dosage compensation by inactivation of X chromosome(GO:0009048) |
0.0 | 0.0 | GO:0032196 | transposition(GO:0032196) |
0.0 | 0.0 | GO:0007621 | negative regulation of female receptivity(GO:0007621) |
0.0 | 0.0 | GO:0006407 | rRNA export from nucleus(GO:0006407) |
0.0 | 0.0 | GO:0045656 | negative regulation of monocyte differentiation(GO:0045656) |
0.0 | 0.1 | GO:0051697 | protein delipidation(GO:0051697) |
0.0 | 0.0 | GO:0042414 | epinephrine metabolic process(GO:0042414) |
0.0 | 0.0 | GO:0001845 | phagolysosome assembly(GO:0001845) |
0.0 | 0.0 | GO:2000779 | regulation of double-strand break repair(GO:2000779) |
0.0 | 0.2 | GO:0045600 | positive regulation of fat cell differentiation(GO:0045600) |
0.0 | 0.0 | GO:0072697 | protein localization to cell cortex(GO:0072697) |
0.0 | 0.0 | GO:0010823 | negative regulation of mitochondrion organization(GO:0010823) |
0.0 | 0.1 | GO:2000479 | regulation of cAMP-dependent protein kinase activity(GO:2000479) |
0.0 | 0.0 | GO:0042136 | neurotransmitter biosynthetic process(GO:0042136) |
0.0 | 0.0 | GO:0090343 | positive regulation of cell aging(GO:0090343) |
0.0 | 0.0 | GO:2000675 | negative regulation of type B pancreatic cell apoptotic process(GO:2000675) |
0.0 | 0.0 | GO:0086028 | bundle of His cell to Purkinje myocyte signaling(GO:0086028) bundle of His cell action potential(GO:0086043) |
0.0 | 0.0 | GO:0035588 | G-protein coupled purinergic receptor signaling pathway(GO:0035588) |
0.0 | 0.0 | GO:0031290 | retinal ganglion cell axon guidance(GO:0031290) |
0.0 | 0.0 | GO:0006405 | RNA export from nucleus(GO:0006405) |
0.0 | 0.0 | GO:0042415 | norepinephrine metabolic process(GO:0042415) |
0.0 | 0.0 | GO:0070366 | regulation of hepatocyte differentiation(GO:0070366) |
0.0 | 0.0 | GO:0021902 | commitment of neuronal cell to specific neuron type in forebrain(GO:0021902) |
0.0 | 0.0 | GO:0090037 | positive regulation of protein kinase C signaling(GO:0090037) |
0.0 | 0.0 | GO:0006498 | N-terminal protein lipidation(GO:0006498) |
0.0 | 0.0 | GO:0006663 | platelet activating factor biosynthetic process(GO:0006663) platelet activating factor metabolic process(GO:0046469) |
0.0 | 0.1 | GO:0030828 | positive regulation of cGMP metabolic process(GO:0030825) positive regulation of cGMP biosynthetic process(GO:0030828) |
0.0 | 0.0 | GO:0061146 | Peyer's patch morphogenesis(GO:0061146) |
0.0 | 0.0 | GO:0021854 | hypothalamus development(GO:0021854) |
0.0 | 0.0 | GO:1901678 | iron coordination entity transport(GO:1901678) |
0.0 | 0.0 | GO:0097155 | fasciculation of sensory neuron axon(GO:0097155) |
0.0 | 0.0 | GO:0010457 | centriole-centriole cohesion(GO:0010457) |
0.0 | 0.0 | GO:0000963 | mitochondrial RNA processing(GO:0000963) |
0.0 | 0.0 | GO:0032673 | regulation of interleukin-4 production(GO:0032673) |
0.0 | 0.0 | GO:0070269 | pyroptosis(GO:0070269) |
0.0 | 0.0 | GO:0021913 | regulation of transcription from RNA polymerase II promoter involved in ventral spinal cord interneuron specification(GO:0021913) |
0.0 | 0.0 | GO:0050650 | chondroitin sulfate proteoglycan biosynthetic process(GO:0050650) |
0.0 | 0.0 | GO:0009786 | regulation of asymmetric cell division(GO:0009786) |
0.0 | 0.0 | GO:0060484 | lung-associated mesenchyme development(GO:0060484) |
0.0 | 0.0 | GO:0001696 | gastric acid secretion(GO:0001696) |
0.0 | 0.0 | GO:0045350 | interferon-beta biosynthetic process(GO:0045350) regulation of interferon-beta biosynthetic process(GO:0045357) |
0.0 | 0.0 | GO:0032792 | negative regulation of CREB transcription factor activity(GO:0032792) |
0.0 | 0.0 | GO:0071402 | cellular response to lipoprotein particle stimulus(GO:0071402) |
0.0 | 0.1 | GO:0006359 | regulation of transcription from RNA polymerase III promoter(GO:0006359) |
0.0 | 0.0 | GO:1903672 | positive regulation of sprouting angiogenesis(GO:1903672) |
0.0 | 0.2 | GO:0003333 | amino acid transmembrane transport(GO:0003333) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
2.3 | 6.9 | GO:0097487 | multivesicular body, internal vesicle(GO:0097487) |
1.7 | 5.1 | GO:0060053 | neurofilament cytoskeleton(GO:0060053) |
1.3 | 5.4 | GO:0005955 | calcineurin complex(GO:0005955) |
0.9 | 2.6 | GO:0070552 | BRISC complex(GO:0070552) |
0.8 | 2.4 | GO:0030981 | cortical microtubule cytoskeleton(GO:0030981) |
0.8 | 3.9 | GO:0005579 | membrane attack complex(GO:0005579) |
0.8 | 2.3 | GO:0005896 | interleukin-6 receptor complex(GO:0005896) |
0.7 | 2.9 | GO:0044316 | cone cell pedicle(GO:0044316) |
0.7 | 4.1 | GO:0000127 | transcription factor TFIIIC complex(GO:0000127) |
0.7 | 4.0 | GO:0014731 | spectrin-associated cytoskeleton(GO:0014731) |
0.6 | 3.2 | GO:0045098 | type III intermediate filament(GO:0045098) |
0.6 | 1.9 | GO:0005712 | chiasma(GO:0005712) |
0.6 | 2.9 | GO:0044294 | dendritic growth cone(GO:0044294) |
0.6 | 0.6 | GO:0097422 | tubular endosome(GO:0097422) |
0.6 | 8.0 | GO:0001891 | phagocytic cup(GO:0001891) |
0.6 | 1.7 | GO:0070765 | gamma-secretase complex(GO:0070765) |
0.6 | 2.8 | GO:0031315 | extrinsic component of mitochondrial outer membrane(GO:0031315) |
0.6 | 1.7 | GO:0000836 | ER ubiquitin ligase complex(GO:0000835) Hrd1p ubiquitin ligase complex(GO:0000836) |
0.6 | 3.3 | GO:0019907 | cyclin-dependent protein kinase activating kinase holoenzyme complex(GO:0019907) |
0.5 | 1.6 | GO:0033647 | host intracellular organelle(GO:0033647) host intracellular membrane-bounded organelle(GO:0033648) |
0.5 | 2.1 | GO:0033269 | internode region of axon(GO:0033269) |
0.5 | 2.0 | GO:0030478 | actin cap(GO:0030478) |
0.5 | 1.5 | GO:0030289 | protein phosphatase 4 complex(GO:0030289) |
0.5 | 9.2 | GO:0032588 | trans-Golgi network membrane(GO:0032588) |
0.5 | 1.9 | GO:0044322 | endoplasmic reticulum quality control compartment(GO:0044322) |
0.5 | 0.9 | GO:0046581 | intercellular canaliculus(GO:0046581) |
0.5 | 1.4 | GO:0032444 | activin responsive factor complex(GO:0032444) |
0.4 | 1.3 | GO:0005850 | eukaryotic translation initiation factor 2 complex(GO:0005850) |
0.4 | 1.8 | GO:0072487 | MSL complex(GO:0072487) |
0.4 | 2.7 | GO:0070776 | H3 histone acetyltransferase complex(GO:0070775) MOZ/MORF histone acetyltransferase complex(GO:0070776) |
0.4 | 4.4 | GO:0071782 | endoplasmic reticulum tubular network(GO:0071782) |
0.4 | 0.4 | GO:0031265 | CD95 death-inducing signaling complex(GO:0031265) |
0.4 | 2.5 | GO:0000439 | core TFIIH complex(GO:0000439) |
0.4 | 4.5 | GO:0031588 | nucleotide-activated protein kinase complex(GO:0031588) |
0.4 | 6.6 | GO:0000930 | gamma-tubulin complex(GO:0000930) |
0.4 | 2.0 | GO:0061617 | MICOS complex(GO:0061617) |
0.4 | 1.2 | GO:0097629 | extrinsic component of omegasome membrane(GO:0097629) |
0.4 | 2.4 | GO:0071546 | pi-body(GO:0071546) |
0.4 | 2.3 | GO:0035749 | myelin sheath adaxonal region(GO:0035749) |
0.4 | 1.1 | GO:0097454 | Schwann cell microvillus(GO:0097454) |
0.4 | 0.4 | GO:0097504 | Gemini of coiled bodies(GO:0097504) |
0.4 | 1.5 | GO:0002142 | stereocilia ankle link complex(GO:0002142) |
0.4 | 0.4 | GO:0008091 | spectrin(GO:0008091) |
0.4 | 1.1 | GO:0097413 | Lewy body(GO:0097413) |
0.4 | 1.1 | GO:0033553 | rDNA heterochromatin(GO:0033553) |
0.4 | 2.9 | GO:0000808 | origin recognition complex(GO:0000808) nuclear origin of replication recognition complex(GO:0005664) |
0.4 | 0.7 | GO:0002139 | stereocilia coupling link(GO:0002139) |
0.4 | 1.8 | GO:0097433 | dense body(GO:0097433) |
0.4 | 1.1 | GO:0005967 | mitochondrial pyruvate dehydrogenase complex(GO:0005967) |
0.3 | 3.1 | GO:0016342 | catenin complex(GO:0016342) |
0.3 | 1.0 | GO:0044354 | pinosome(GO:0044352) macropinosome(GO:0044354) |
0.3 | 1.0 | GO:0045180 | basal cortex(GO:0045180) |
0.3 | 0.3 | GO:0036452 | ESCRT complex(GO:0036452) |
0.3 | 1.2 | GO:0035189 | Rb-E2F complex(GO:0035189) |
0.3 | 0.9 | GO:0000172 | ribonuclease MRP complex(GO:0000172) |
0.3 | 0.9 | GO:0005971 | ribonucleoside-diphosphate reductase complex(GO:0005971) |
0.3 | 5.1 | GO:0005942 | phosphatidylinositol 3-kinase complex(GO:0005942) |
0.3 | 0.9 | GO:0005658 | alpha DNA polymerase:primase complex(GO:0005658) |
0.3 | 2.7 | GO:0071439 | clathrin complex(GO:0071439) |
0.3 | 2.9 | GO:0070852 | cell body fiber(GO:0070852) |
0.3 | 13.7 | GO:0031903 | peroxisomal membrane(GO:0005778) microbody membrane(GO:0031903) |
0.3 | 2.3 | GO:1904115 | axon cytoplasm(GO:1904115) |
0.3 | 1.1 | GO:0042567 | insulin-like growth factor binding protein complex(GO:0016942) growth factor complex(GO:0036454) insulin-like growth factor ternary complex(GO:0042567) |
0.3 | 1.1 | GO:0000408 | EKC/KEOPS complex(GO:0000408) |
0.3 | 0.5 | GO:0005677 | chromatin silencing complex(GO:0005677) |
0.3 | 2.4 | GO:0000815 | ESCRT III complex(GO:0000815) |
0.3 | 1.3 | GO:0008541 | proteasome regulatory particle, lid subcomplex(GO:0008541) |
0.3 | 0.8 | GO:0051233 | spindle midzone(GO:0051233) |
0.3 | 2.1 | GO:0044666 | MLL3/4 complex(GO:0044666) |
0.3 | 1.0 | GO:0070545 | PeBoW complex(GO:0070545) |
0.3 | 2.8 | GO:0000346 | transcription export complex(GO:0000346) |
0.3 | 0.3 | GO:0031264 | death-inducing signaling complex(GO:0031264) |
0.2 | 2.2 | GO:0005869 | dynactin complex(GO:0005869) |
0.2 | 0.5 | GO:0005775 | vacuolar lumen(GO:0005775) |
0.2 | 1.2 | GO:0030896 | checkpoint clamp complex(GO:0030896) |
0.2 | 2.1 | GO:0032045 | guanyl-nucleotide exchange factor complex(GO:0032045) |
0.2 | 8.2 | GO:0005762 | organellar large ribosomal subunit(GO:0000315) mitochondrial large ribosomal subunit(GO:0005762) |
0.2 | 3.5 | GO:0000242 | pericentriolar material(GO:0000242) |
0.2 | 0.7 | GO:0030662 | coated vesicle membrane(GO:0030662) |
0.2 | 2.1 | GO:0033179 | proton-transporting V-type ATPase, V0 domain(GO:0033179) |
0.2 | 0.9 | GO:0035339 | SPOTS complex(GO:0035339) |
0.2 | 1.4 | GO:0097342 | ripoptosome(GO:0097342) |
0.2 | 0.9 | GO:0016602 | CCAAT-binding factor complex(GO:0016602) |
0.2 | 0.7 | GO:0033186 | CAF-1 complex(GO:0033186) |
0.2 | 0.7 | GO:0090661 | box H/ACA telomerase RNP complex(GO:0090661) |
0.2 | 4.1 | GO:0034451 | centriolar satellite(GO:0034451) |
0.2 | 0.2 | GO:0055087 | Ski complex(GO:0055087) |
0.2 | 9.5 | GO:0009295 | nucleoid(GO:0009295) mitochondrial nucleoid(GO:0042645) |
0.2 | 1.5 | GO:0097197 | tetraspanin-enriched microdomain(GO:0097197) |
0.2 | 2.5 | GO:0034663 | endoplasmic reticulum chaperone complex(GO:0034663) |
0.2 | 3.6 | GO:0043034 | costamere(GO:0043034) |
0.2 | 1.0 | GO:0042406 | extrinsic component of endoplasmic reticulum membrane(GO:0042406) |
0.2 | 1.0 | GO:0032300 | mismatch repair complex(GO:0032300) |
0.2 | 0.6 | GO:0000322 | storage vacuole(GO:0000322) |
0.2 | 1.7 | GO:0005751 | mitochondrial respiratory chain complex IV(GO:0005751) |
0.2 | 6.4 | GO:0031672 | A band(GO:0031672) |
0.2 | 0.8 | GO:0098573 | intrinsic component of mitochondrial membrane(GO:0098573) |
0.2 | 0.2 | GO:0031088 | platelet dense granule membrane(GO:0031088) |
0.2 | 0.4 | GO:0034679 | integrin alpha9-beta1 complex(GO:0034679) |
0.2 | 0.9 | GO:0016589 | NURF complex(GO:0016589) |
0.2 | 0.7 | GO:0031010 | ISWI-type complex(GO:0031010) |
0.2 | 1.5 | GO:0008385 | IkappaB kinase complex(GO:0008385) |
0.2 | 4.2 | GO:0071339 | MLL1/2 complex(GO:0044665) MLL1 complex(GO:0071339) |
0.2 | 0.4 | GO:0031094 | platelet dense tubular network(GO:0031094) |
0.2 | 1.1 | GO:0030061 | mitochondrial crista(GO:0030061) |
0.2 | 0.7 | GO:0044615 | nuclear pore nuclear basket(GO:0044615) |
0.2 | 1.4 | GO:0043220 | Schmidt-Lanterman incisure(GO:0043220) |
0.2 | 0.5 | GO:0002193 | MAML1-RBP-Jkappa- ICN1 complex(GO:0002193) |
0.2 | 2.1 | GO:0005847 | mRNA cleavage and polyadenylation specificity factor complex(GO:0005847) |
0.2 | 0.9 | GO:0048476 | Holliday junction resolvase complex(GO:0048476) |
0.2 | 1.2 | GO:0036057 | filtration diaphragm(GO:0036056) slit diaphragm(GO:0036057) |
0.2 | 1.4 | GO:0071437 | invadopodium(GO:0071437) |
0.2 | 2.7 | GO:0035327 | transcriptionally active chromatin(GO:0035327) |
0.2 | 2.0 | GO:0008540 | proteasome regulatory particle, base subcomplex(GO:0008540) |
0.2 | 0.8 | GO:0016281 | eukaryotic translation initiation factor 4F complex(GO:0016281) |
0.2 | 0.8 | GO:0031298 | replication fork protection complex(GO:0031298) |
0.2 | 0.7 | GO:0000444 | MIS12/MIND type complex(GO:0000444) |
0.2 | 2.5 | GO:0005868 | cytoplasmic dynein complex(GO:0005868) |
0.2 | 0.3 | GO:0032777 | Piccolo NuA4 histone acetyltransferase complex(GO:0032777) |
0.2 | 0.6 | GO:0070876 | SOSS complex(GO:0070876) |
0.2 | 1.1 | GO:0042405 | nuclear inclusion body(GO:0042405) |
0.2 | 0.5 | GO:0031417 | NatC complex(GO:0031417) |
0.2 | 0.8 | GO:0044233 | ER-mitochondrion membrane contact site(GO:0044233) |
0.2 | 0.8 | GO:0031838 | haptoglobin-hemoglobin complex(GO:0031838) |
0.2 | 1.1 | GO:0000798 | nuclear cohesin complex(GO:0000798) |
0.2 | 0.8 | GO:0042824 | MHC class I peptide loading complex(GO:0042824) |
0.2 | 0.5 | GO:0097025 | MPP7-DLG1-LIN7 complex(GO:0097025) |
0.2 | 0.6 | GO:0045293 | mRNA editing complex(GO:0045293) |
0.2 | 0.3 | GO:0097542 | ciliary tip(GO:0097542) |
0.2 | 0.3 | GO:0030669 | clathrin-coated endocytic vesicle membrane(GO:0030669) |
0.2 | 0.2 | GO:0002177 | manchette(GO:0002177) |
0.2 | 1.7 | GO:0045120 | pronucleus(GO:0045120) |
0.1 | 0.9 | GO:0000796 | condensin complex(GO:0000796) |
0.1 | 0.6 | GO:0031143 | pseudopodium(GO:0031143) |
0.1 | 0.1 | GO:0000811 | GINS complex(GO:0000811) |
0.1 | 0.1 | GO:0034274 | Atg12-Atg5-Atg16 complex(GO:0034274) |
0.1 | 1.3 | GO:0000813 | ESCRT I complex(GO:0000813) |
0.1 | 1.0 | GO:0031305 | integral component of mitochondrial inner membrane(GO:0031305) |
0.1 | 1.3 | GO:0070938 | contractile ring(GO:0070938) |
0.1 | 0.6 | GO:1990712 | HFE-transferrin receptor complex(GO:1990712) |
0.1 | 0.7 | GO:0033270 | paranode region of axon(GO:0033270) |
0.1 | 0.7 | GO:0005797 | Golgi medial cisterna(GO:0005797) |
0.1 | 0.7 | GO:0033588 | Elongator holoenzyme complex(GO:0033588) |
0.1 | 4.9 | GO:0016592 | mediator complex(GO:0016592) |
0.1 | 1.7 | GO:0031616 | spindle pole centrosome(GO:0031616) |
0.1 | 0.8 | GO:0001940 | male pronucleus(GO:0001940) |
0.1 | 3.0 | GO:0035861 | site of double-strand break(GO:0035861) |
0.1 | 1.2 | GO:0032426 | stereocilium tip(GO:0032426) |
0.1 | 1.0 | GO:0016600 | flotillin complex(GO:0016600) |
0.1 | 2.3 | GO:0005892 | acetylcholine-gated channel complex(GO:0005892) |
0.1 | 0.5 | GO:0031313 | extrinsic component of endosome membrane(GO:0031313) |
0.1 | 2.5 | GO:0030134 | ER to Golgi transport vesicle(GO:0030134) |
0.1 | 0.5 | GO:0000942 | condensed nuclear chromosome outer kinetochore(GO:0000942) |
0.1 | 0.7 | GO:0001652 | granular component(GO:0001652) |
0.1 | 1.1 | GO:0042788 | polysomal ribosome(GO:0042788) |
0.1 | 1.2 | GO:0042613 | MHC class II protein complex(GO:0042613) |
0.1 | 0.4 | GO:0044300 | cerebellar mossy fiber(GO:0044300) |
0.1 | 0.5 | GO:0000938 | GARP complex(GO:0000938) |
0.1 | 0.9 | GO:0097431 | mitotic spindle pole(GO:0097431) |
0.1 | 7.2 | GO:0005758 | mitochondrial intermembrane space(GO:0005758) |
0.1 | 0.9 | GO:0000164 | protein phosphatase type 1 complex(GO:0000164) |
0.1 | 1.2 | GO:0032797 | SMN complex(GO:0032797) |
0.1 | 0.5 | GO:0030121 | AP-1 adaptor complex(GO:0030121) |
0.1 | 0.7 | GO:0030660 | Golgi-associated vesicle membrane(GO:0030660) |
0.1 | 1.0 | GO:0005890 | sodium:potassium-exchanging ATPase complex(GO:0005890) |
0.1 | 3.4 | GO:0031901 | early endosome membrane(GO:0031901) |
0.1 | 0.5 | GO:0005915 | zonula adherens(GO:0005915) |
0.1 | 0.1 | GO:0000138 | Golgi trans cisterna(GO:0000138) |
0.1 | 2.8 | GO:0010494 | cytoplasmic stress granule(GO:0010494) |
0.1 | 0.7 | GO:0016011 | dystroglycan complex(GO:0016011) |
0.1 | 1.0 | GO:0019908 | nuclear cyclin-dependent protein kinase holoenzyme complex(GO:0019908) |
0.1 | 0.1 | GO:0044393 | microspike(GO:0044393) |
0.1 | 0.6 | GO:0033180 | proton-transporting V-type ATPase, V1 domain(GO:0033180) |
0.1 | 2.4 | GO:0030687 | preribosome, large subunit precursor(GO:0030687) |
0.1 | 0.4 | GO:0044308 | axonal spine(GO:0044308) |
0.1 | 0.8 | GO:0005786 | signal recognition particle, endoplasmic reticulum targeting(GO:0005786) signal recognition particle(GO:0048500) |
0.1 | 0.1 | GO:0070033 | synaptobrevin 2-SNAP-25-syntaxin-1a-complexin II complex(GO:0070033) |
0.1 | 0.7 | GO:0005688 | U6 snRNP(GO:0005688) |
0.1 | 0.1 | GO:1990393 | 3M complex(GO:1990393) |
0.1 | 1.1 | GO:1990124 | messenger ribonucleoprotein complex(GO:1990124) |
0.1 | 0.6 | GO:0005744 | mitochondrial inner membrane presequence translocase complex(GO:0005744) |
0.1 | 6.4 | GO:0042641 | actomyosin(GO:0042641) |
0.1 | 2.4 | GO:0008023 | transcription elongation factor complex(GO:0008023) |
0.1 | 0.7 | GO:0031209 | SCAR complex(GO:0031209) |
0.1 | 0.4 | GO:0051286 | cell tip(GO:0051286) |
0.1 | 0.5 | GO:0034098 | VCP-NPL4-UFD1 AAA ATPase complex(GO:0034098) |
0.1 | 0.4 | GO:0005697 | telomerase holoenzyme complex(GO:0005697) |
0.1 | 0.3 | GO:0032585 | multivesicular body membrane(GO:0032585) |
0.1 | 1.2 | GO:0030126 | COPI vesicle coat(GO:0030126) |
0.1 | 0.1 | GO:0016533 | cyclin-dependent protein kinase 5 holoenzyme complex(GO:0016533) |
0.1 | 1.1 | GO:0035102 | PRC1 complex(GO:0035102) |
0.1 | 1.5 | GO:0005719 | nuclear euchromatin(GO:0005719) |
0.1 | 0.3 | GO:0005875 | microtubule associated complex(GO:0005875) |
0.1 | 4.1 | GO:0005788 | endoplasmic reticulum lumen(GO:0005788) |
0.1 | 1.0 | GO:0030132 | clathrin coat of coated pit(GO:0030132) |
0.1 | 0.9 | GO:0034045 | pre-autophagosomal structure membrane(GO:0034045) |
0.1 | 0.3 | GO:0044530 | supraspliceosomal complex(GO:0044530) |
0.1 | 2.1 | GO:0005865 | striated muscle thin filament(GO:0005865) |
0.1 | 0.3 | GO:0031084 | BLOC-2 complex(GO:0031084) |
0.1 | 0.8 | GO:0030991 | intraciliary transport particle A(GO:0030991) |
0.1 | 0.2 | GO:0005683 | U7 snRNP(GO:0005683) |
0.1 | 0.1 | GO:0097524 | sperm plasma membrane(GO:0097524) |
0.1 | 0.3 | GO:0032010 | phagolysosome(GO:0032010) |
0.1 | 0.3 | GO:0097427 | microtubule bundle(GO:0097427) |
0.1 | 0.7 | GO:0042382 | paraspeckles(GO:0042382) |
0.1 | 1.9 | GO:0031519 | PcG protein complex(GO:0031519) |
0.1 | 0.1 | GO:0005819 | spindle(GO:0005819) |
0.1 | 0.2 | GO:1990423 | RZZ complex(GO:1990423) |
0.1 | 0.2 | GO:0070761 | pre-snoRNP complex(GO:0070761) |
0.1 | 6.6 | GO:0098800 | inner mitochondrial membrane protein complex(GO:0098800) |
0.1 | 0.3 | GO:0031502 | dolichyl-phosphate-mannose-protein mannosyltransferase complex(GO:0031502) |
0.1 | 7.6 | GO:0016607 | nuclear speck(GO:0016607) |
0.1 | 3.9 | GO:0005793 | endoplasmic reticulum-Golgi intermediate compartment(GO:0005793) |
0.1 | 0.2 | GO:0070531 | BRCA1-A complex(GO:0070531) |
0.1 | 0.1 | GO:1990745 | EARP complex(GO:1990745) |
0.1 | 11.0 | GO:0005741 | mitochondrial outer membrane(GO:0005741) |
0.1 | 0.1 | GO:0032591 | dendritic spine membrane(GO:0032591) |
0.1 | 0.9 | GO:0031083 | BLOC-1 complex(GO:0031083) |
0.1 | 0.2 | GO:0005687 | U4 snRNP(GO:0005687) |
0.1 | 1.6 | GO:0033017 | sarcoplasmic reticulum membrane(GO:0033017) |
0.1 | 0.7 | GO:0000932 | cytoplasmic mRNA processing body(GO:0000932) |
0.1 | 0.8 | GO:0005798 | Golgi-associated vesicle(GO:0005798) |
0.1 | 0.5 | GO:0070419 | nonhomologous end joining complex(GO:0070419) |
0.1 | 0.4 | GO:0005610 | laminin-5 complex(GO:0005610) |
0.1 | 0.3 | GO:0005956 | protein kinase CK2 complex(GO:0005956) |
0.1 | 2.1 | GO:0005844 | polysome(GO:0005844) |
0.1 | 0.3 | GO:0097452 | GAIT complex(GO:0097452) |
0.1 | 0.4 | GO:0032009 | early phagosome(GO:0032009) |
0.1 | 0.6 | GO:0030496 | midbody(GO:0030496) |
0.1 | 5.0 | GO:0036064 | ciliary basal body(GO:0036064) |
0.1 | 0.2 | GO:0099738 | cell cortex region(GO:0099738) |
0.1 | 0.1 | GO:0032133 | chromosome passenger complex(GO:0032133) |
0.1 | 0.8 | GO:0000176 | nuclear exosome (RNase complex)(GO:0000176) |
0.1 | 1.1 | GO:0035686 | sperm fibrous sheath(GO:0035686) |
0.1 | 0.4 | GO:0072357 | PTW/PP1 phosphatase complex(GO:0072357) |
0.1 | 5.4 | GO:0005769 | early endosome(GO:0005769) |
0.1 | 0.4 | GO:0042587 | glycogen granule(GO:0042587) |
0.1 | 2.2 | GO:0070461 | SAGA-type complex(GO:0070461) |
0.1 | 0.3 | GO:0005947 | mitochondrial alpha-ketoglutarate dehydrogenase complex(GO:0005947) |
0.1 | 0.2 | GO:0030688 | preribosome, small subunit precursor(GO:0030688) |
0.1 | 0.2 | GO:1990597 | AIP1-IRE1 complex(GO:1990597) |
0.1 | 0.4 | GO:0042629 | mast cell granule(GO:0042629) |
0.1 | 0.2 | GO:0019815 | B cell receptor complex(GO:0019815) |
0.1 | 0.2 | GO:0031074 | nucleocytoplasmic shuttling complex(GO:0031074) |
0.1 | 0.4 | GO:1990111 | spermatoproteasome complex(GO:1990111) |
0.1 | 2.7 | GO:0045171 | intercellular bridge(GO:0045171) |
0.1 | 0.4 | GO:0071204 | histone pre-mRNA 3'end processing complex(GO:0071204) |
0.1 | 2.0 | GO:0032391 | photoreceptor connecting cilium(GO:0032391) |
0.1 | 0.3 | GO:0071797 | LUBAC complex(GO:0071797) |
0.1 | 0.1 | GO:1903349 | omegasome membrane(GO:1903349) |
0.1 | 0.2 | GO:0043259 | laminin-10 complex(GO:0043259) |
0.1 | 0.2 | GO:1990851 | Wnt-Frizzled-LRP5/6 complex(GO:1990851) |
0.1 | 0.9 | GO:0097038 | perinuclear endoplasmic reticulum(GO:0097038) |
0.1 | 0.2 | GO:0033177 | proton-transporting two-sector ATPase complex, proton-transporting domain(GO:0033177) |
0.1 | 0.5 | GO:0042581 | specific granule(GO:0042581) |
0.1 | 5.1 | GO:0017053 | transcriptional repressor complex(GO:0017053) |
0.1 | 0.1 | GO:0034750 | Scrib-APC-beta-catenin complex(GO:0034750) |
0.1 | 0.8 | GO:0031235 | intrinsic component of the cytoplasmic side of the plasma membrane(GO:0031235) |
0.1 | 0.7 | GO:0032580 | Golgi cisterna membrane(GO:0032580) |
0.1 | 2.4 | GO:0031201 | SNARE complex(GO:0031201) |
0.1 | 0.3 | GO:0030485 | smooth muscle contractile fiber(GO:0030485) |
0.1 | 1.3 | GO:0005801 | cis-Golgi network(GO:0005801) |
0.1 | 1.0 | GO:0043196 | varicosity(GO:0043196) |
0.1 | 1.3 | GO:0080008 | Cul4-RING E3 ubiquitin ligase complex(GO:0080008) |
0.1 | 0.1 | GO:0005642 | annulate lamellae(GO:0005642) |
0.1 | 0.4 | GO:0072669 | tRNA-splicing ligase complex(GO:0072669) |
0.1 | 0.1 | GO:0097543 | ciliary inversin compartment(GO:0097543) |
0.1 | 0.4 | GO:0000407 | pre-autophagosomal structure(GO:0000407) |
0.1 | 0.3 | GO:0070069 | cytochrome complex(GO:0070069) |
0.1 | 0.3 | GO:0005968 | Rab-protein geranylgeranyltransferase complex(GO:0005968) |
0.1 | 0.4 | GO:0005964 | phosphorylase kinase complex(GO:0005964) |
0.1 | 0.4 | GO:0016528 | sarcoplasm(GO:0016528) |
0.1 | 0.2 | GO:0005726 | perichromatin fibrils(GO:0005726) |
0.1 | 5.3 | GO:0042579 | peroxisome(GO:0005777) microbody(GO:0042579) |
0.1 | 0.1 | GO:0071817 | MMXD complex(GO:0071817) |
0.1 | 0.1 | GO:0005828 | kinetochore microtubule(GO:0005828) |
0.1 | 3.6 | GO:0022625 | cytosolic large ribosomal subunit(GO:0022625) |
0.1 | 0.2 | GO:0071256 | Sec61 translocon complex(GO:0005784) translocon complex(GO:0071256) |
0.1 | 0.5 | GO:0042571 | immunoglobulin complex, circulating(GO:0042571) |
0.1 | 0.1 | GO:0005838 | proteasome regulatory particle(GO:0005838) |
0.1 | 4.2 | GO:0005770 | late endosome(GO:0005770) |
0.1 | 0.3 | GO:0071598 | neuronal ribonucleoprotein granule(GO:0071598) |
0.1 | 0.6 | GO:0031011 | Ino80 complex(GO:0031011) |
0.1 | 0.8 | GO:0017146 | NMDA selective glutamate receptor complex(GO:0017146) |
0.1 | 0.1 | GO:0002079 | inner acrosomal membrane(GO:0002079) |
0.1 | 4.0 | GO:0005902 | microvillus(GO:0005902) |
0.1 | 1.2 | GO:0015935 | small ribosomal subunit(GO:0015935) |
0.1 | 1.3 | GO:0005776 | autophagosome(GO:0005776) |
0.1 | 0.3 | GO:0045254 | pyruvate dehydrogenase complex(GO:0045254) |
0.1 | 0.5 | GO:0036038 | MKS complex(GO:0036038) |
0.1 | 0.5 | GO:0033391 | chromatoid body(GO:0033391) |
0.1 | 0.1 | GO:0032127 | dense core granule membrane(GO:0032127) |
0.1 | 3.0 | GO:0005643 | nuclear pore(GO:0005643) |
0.1 | 1.0 | GO:0015030 | Cajal body(GO:0015030) |
0.1 | 1.1 | GO:0008287 | protein serine/threonine phosphatase complex(GO:0008287) phosphatase complex(GO:1903293) |
0.1 | 1.9 | GO:0032040 | small-subunit processome(GO:0032040) |
0.1 | 0.5 | GO:0030118 | clathrin coat(GO:0030118) |
0.1 | 0.8 | GO:0030864 | cortical actin cytoskeleton(GO:0030864) |
0.1 | 1.7 | GO:0030133 | transport vesicle(GO:0030133) |
0.1 | 0.2 | GO:0020003 | symbiont-containing vacuole(GO:0020003) |
0.1 | 5.2 | GO:0008021 | synaptic vesicle(GO:0008021) |
0.1 | 0.2 | GO:0097058 | CRLF-CLCF1 complex(GO:0097058) |
0.1 | 0.4 | GO:1990909 | Wnt signalosome(GO:1990909) |
0.1 | 0.4 | GO:0031931 | TORC1 complex(GO:0031931) |
0.1 | 5.2 | GO:0030427 | site of polarized growth(GO:0030427) |
0.1 | 0.4 | GO:0016272 | prefoldin complex(GO:0016272) |
0.1 | 1.7 | GO:0005811 | lipid particle(GO:0005811) |
0.1 | 0.2 | GO:0005927 | muscle tendon junction(GO:0005927) |
0.1 | 64.9 | GO:0005783 | endoplasmic reticulum(GO:0005783) |
0.1 | 4.8 | GO:0005802 | trans-Golgi network(GO:0005802) |
0.1 | 4.2 | GO:0072562 | blood microparticle(GO:0072562) |
0.1 | 0.2 | GO:0072687 | meiotic spindle(GO:0072687) |
0.1 | 0.7 | GO:0000922 | spindle pole(GO:0000922) |
0.1 | 0.1 | GO:0042612 | MHC class I protein complex(GO:0042612) |
0.1 | 0.1 | GO:0044327 | dendritic spine head(GO:0044327) |
0.1 | 1.0 | GO:0005689 | U12-type spliceosomal complex(GO:0005689) |
0.1 | 0.2 | GO:0031462 | Cul2-RING ubiquitin ligase complex(GO:0031462) |
0.1 | 0.4 | GO:0000109 | nucleotide-excision repair complex(GO:0000109) |
0.1 | 0.2 | GO:0035355 | Toll-like receptor 2-Toll-like receptor 6 protein complex(GO:0035355) |
0.1 | 0.1 | GO:0016234 | inclusion body(GO:0016234) |
0.1 | 0.5 | GO:0002116 | semaphorin receptor complex(GO:0002116) |
0.1 | 0.9 | GO:0005901 | caveola(GO:0005901) |
0.1 | 0.4 | GO:0010369 | chromocenter(GO:0010369) |
0.1 | 0.1 | GO:0045298 | tubulin complex(GO:0045298) |
0.1 | 0.8 | GO:0016235 | aggresome(GO:0016235) |
0.1 | 1.8 | GO:0005881 | cytoplasmic microtubule(GO:0005881) |
0.1 | 0.2 | GO:0089701 | U2AF(GO:0089701) |
0.1 | 0.1 | GO:0000153 | cytoplasmic ubiquitin ligase complex(GO:0000153) |
0.1 | 0.1 | GO:0034708 | methyltransferase complex(GO:0034708) |
0.1 | 0.3 | GO:1990391 | DNA repair complex(GO:1990391) |
0.1 | 0.2 | GO:0097209 | epidermal lamellar body(GO:0097209) |
0.1 | 1.9 | GO:0031463 | Cul3-RING ubiquitin ligase complex(GO:0031463) |
0.1 | 0.1 | GO:0017101 | aminoacyl-tRNA synthetase multienzyme complex(GO:0017101) |
0.0 | 46.6 | GO:0005739 | mitochondrion(GO:0005739) |
0.0 | 0.2 | GO:0030863 | cortical cytoskeleton(GO:0030863) |
0.0 | 3.8 | GO:0031514 | motile cilium(GO:0031514) |
0.0 | 0.3 | GO:0042588 | zymogen granule(GO:0042588) |
0.0 | 3.3 | GO:0044798 | nuclear transcription factor complex(GO:0044798) |
0.0 | 4.8 | GO:0005874 | microtubule(GO:0005874) |
0.0 | 0.2 | GO:0098643 | fibrillar collagen trimer(GO:0005583) banded collagen fibril(GO:0098643) |
0.0 | 0.1 | GO:0000802 | transverse filament(GO:0000802) |
0.0 | 0.1 | GO:0048179 | activin receptor complex(GO:0048179) |
0.0 | 0.1 | GO:0044292 | dendrite terminus(GO:0044292) |
0.0 | 0.1 | GO:0031232 | extrinsic component of external side of plasma membrane(GO:0031232) |
0.0 | 8.1 | GO:0005667 | transcription factor complex(GO:0005667) |
0.0 | 0.0 | GO:0005945 | 6-phosphofructokinase complex(GO:0005945) |
0.0 | 0.2 | GO:0070578 | RISC-loading complex(GO:0070578) |
0.0 | 15.8 | GO:0005730 | nucleolus(GO:0005730) |
0.0 | 0.2 | GO:0005871 | kinesin complex(GO:0005871) |
0.0 | 0.8 | GO:0097014 | axoneme(GO:0005930) ciliary plasm(GO:0097014) |
0.0 | 0.4 | GO:0043596 | nuclear replication fork(GO:0043596) |
0.0 | 0.1 | GO:0061689 | tricellular tight junction(GO:0061689) |
0.0 | 0.1 | GO:0005588 | collagen type V trimer(GO:0005588) |
0.0 | 4.3 | GO:0035068 | micro-ribonucleoprotein complex(GO:0035068) |
0.0 | 3.9 | GO:0005681 | spliceosomal complex(GO:0005681) |
0.0 | 0.0 | GO:0044299 | C-fiber(GO:0044299) |
0.0 | 0.1 | GO:0033256 | I-kappaB/NF-kappaB complex(GO:0033256) |
0.0 | 0.8 | GO:0005581 | collagen trimer(GO:0005581) |
0.0 | 0.1 | GO:0005671 | Ada2/Gcn5/Ada3 transcription activator complex(GO:0005671) |
0.0 | 0.2 | GO:0031045 | dense core granule(GO:0031045) |
0.0 | 0.1 | GO:0043159 | acrosomal matrix(GO:0043159) |
0.0 | 0.3 | GO:0032982 | myosin filament(GO:0032982) |
0.0 | 0.2 | GO:0030992 | intraciliary transport particle B(GO:0030992) |
0.0 | 0.1 | GO:0035631 | CD40 receptor complex(GO:0035631) |
0.0 | 0.2 | GO:0070187 | telosome(GO:0070187) |
0.0 | 0.1 | GO:0098687 | chromosomal region(GO:0098687) |
0.0 | 0.1 | GO:0044291 | cell-cell contact zone(GO:0044291) |
0.0 | 5.1 | GO:0009897 | external side of plasma membrane(GO:0009897) |
0.0 | 0.0 | GO:0016939 | kinesin II complex(GO:0016939) |
0.0 | 0.3 | GO:0030315 | T-tubule(GO:0030315) |
0.0 | 118.5 | GO:0005634 | nucleus(GO:0005634) |
0.0 | 0.3 | GO:0045335 | phagocytic vesicle(GO:0045335) |
0.0 | 0.2 | GO:0005614 | interstitial matrix(GO:0005614) |
0.0 | 0.5 | GO:0043209 | myelin sheath(GO:0043209) |
0.0 | 0.9 | GO:0005903 | brush border(GO:0005903) |
0.0 | 0.6 | GO:0005921 | gap junction(GO:0005921) |
0.0 | 0.3 | GO:0001527 | microfibril(GO:0001527) |
0.0 | 1.4 | GO:1990234 | transferase complex(GO:1990234) |
0.0 | 0.1 | GO:0001772 | immunological synapse(GO:0001772) |
0.0 | 0.4 | GO:0031594 | neuromuscular junction(GO:0031594) |
0.0 | 0.0 | GO:0000177 | cytoplasmic exosome (RNase complex)(GO:0000177) |
0.0 | 0.1 | GO:0001931 | uropod(GO:0001931) cell trailing edge(GO:0031254) |
0.0 | 0.6 | GO:0005913 | cell-cell adherens junction(GO:0005913) |
0.0 | 1.7 | GO:0005604 | basement membrane(GO:0005604) |
0.0 | 0.4 | GO:0046658 | anchored component of plasma membrane(GO:0046658) |
0.0 | 0.8 | GO:0001726 | ruffle(GO:0001726) |
0.0 | 1.6 | GO:0048471 | perinuclear region of cytoplasm(GO:0048471) |
0.0 | 0.0 | GO:0046696 | lipopolysaccharide receptor complex(GO:0046696) |
0.0 | 0.0 | GO:0030894 | replisome(GO:0030894) |
0.0 | 0.1 | GO:0034364 | high-density lipoprotein particle(GO:0034364) |
0.0 | 20.4 | GO:0070062 | extracellular exosome(GO:0070062) |
0.0 | 0.0 | GO:0016471 | vacuolar proton-transporting V-type ATPase complex(GO:0016471) |
0.0 | 0.0 | GO:0005593 | FACIT collagen trimer(GO:0005593) collagen type IX trimer(GO:0005594) |
0.0 | 4.4 | GO:0005856 | cytoskeleton(GO:0005856) |
0.0 | 0.0 | GO:0031091 | platelet alpha granule(GO:0031091) |
0.0 | 0.0 | GO:0034464 | BBSome(GO:0034464) |
0.0 | 0.6 | GO:0000139 | Golgi membrane(GO:0000139) |
0.0 | 1.3 | GO:0005578 | proteinaceous extracellular matrix(GO:0005578) |
0.0 | 0.1 | GO:0005732 | small nucleolar ribonucleoprotein complex(GO:0005732) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
2.3 | 7.0 | GO:0048408 | epidermal growth factor binding(GO:0048408) |
2.0 | 6.1 | GO:0016743 | carboxyl- or carbamoyltransferase activity(GO:0016743) |
1.8 | 5.4 | GO:0070538 | oleic acid binding(GO:0070538) |
1.3 | 3.8 | GO:0042392 | sphingosine-1-phosphate phosphatase activity(GO:0042392) |
1.2 | 5.8 | GO:0004769 | steroid delta-isomerase activity(GO:0004769) |
1.0 | 1.0 | GO:0016414 | O-octanoyltransferase activity(GO:0016414) |
1.0 | 9.2 | GO:0004499 | N,N-dimethylaniline monooxygenase activity(GO:0004499) |
1.0 | 4.8 | GO:0004075 | biotin carboxylase activity(GO:0004075) |
1.0 | 2.9 | GO:0008142 | oxysterol binding(GO:0008142) |
0.9 | 2.8 | GO:0008597 | calcium-dependent protein serine/threonine phosphatase regulator activity(GO:0008597) |
0.9 | 2.7 | GO:0005220 | inositol 1,4,5-trisphosphate-sensitive calcium-release channel activity(GO:0005220) |
0.9 | 2.7 | GO:0047961 | glycine N-acyltransferase activity(GO:0047961) |
0.9 | 2.7 | GO:0004886 | 9-cis retinoic acid receptor activity(GO:0004886) |
0.9 | 2.7 | GO:0010484 | H3 histone acetyltransferase activity(GO:0010484) |
0.9 | 3.5 | GO:0047023 | androsterone dehydrogenase activity(GO:0047023) |
0.9 | 2.6 | GO:0050508 | glucuronosyl-N-acetylglucosaminyl-proteoglycan 4-alpha-N-acetylglucosaminyltransferase activity(GO:0050508) |
0.8 | 9.2 | GO:0030898 | actin-dependent ATPase activity(GO:0030898) |
0.8 | 3.2 | GO:0015183 | L-aspartate transmembrane transporter activity(GO:0015183) |
0.8 | 0.8 | GO:0051723 | protein methylesterase activity(GO:0051723) |
0.8 | 2.3 | GO:0018479 | benzaldehyde dehydrogenase (NAD+) activity(GO:0018479) |
0.8 | 4.6 | GO:0016151 | nickel cation binding(GO:0016151) |
0.7 | 4.4 | GO:0005381 | iron ion transmembrane transporter activity(GO:0005381) |
0.7 | 2.2 | GO:0004366 | glycerol-3-phosphate O-acyltransferase activity(GO:0004366) |
0.7 | 7.3 | GO:0001223 | transcription coactivator binding(GO:0001223) |
0.7 | 2.1 | GO:0030158 | protein xylosyltransferase activity(GO:0030158) |
0.7 | 3.3 | GO:0004887 | thyroid hormone receptor activity(GO:0004887) |
0.7 | 2.0 | GO:0004793 | threonine aldolase activity(GO:0004793) L-allo-threonine aldolase activity(GO:0008732) |
0.7 | 2.0 | GO:0004924 | oncostatin-M receptor activity(GO:0004924) |
0.6 | 2.6 | GO:0032564 | dATP binding(GO:0032564) |
0.6 | 6.3 | GO:0008195 | phosphatidate phosphatase activity(GO:0008195) |
0.6 | 1.8 | GO:0005347 | ATP transmembrane transporter activity(GO:0005347) |
0.6 | 2.3 | GO:0033192 | calmodulin-dependent protein phosphatase activity(GO:0033192) |
0.6 | 1.7 | GO:0031697 | beta-1 adrenergic receptor binding(GO:0031697) |
0.6 | 2.3 | GO:0019237 | centromeric DNA binding(GO:0019237) |
0.6 | 1.7 | GO:0004024 | alcohol dehydrogenase activity, zinc-dependent(GO:0004024) |
0.6 | 2.2 | GO:0016899 | oxidoreductase activity, acting on the CH-OH group of donors, oxygen as acceptor(GO:0016899) |
0.6 | 4.4 | GO:0102391 | decanoate--CoA ligase activity(GO:0102391) |
0.5 | 1.6 | GO:1990825 | sequence-specific mRNA binding(GO:1990825) |
0.5 | 1.1 | GO:0097109 | neuroligin family protein binding(GO:0097109) |
0.5 | 1.6 | GO:0016823 | hydrolase activity, acting on acid carbon-carbon bonds(GO:0016822) hydrolase activity, acting on acid carbon-carbon bonds, in ketonic substances(GO:0016823) |
0.5 | 4.8 | GO:0008093 | cytoskeletal adaptor activity(GO:0008093) |
0.5 | 3.1 | GO:0004385 | guanylate kinase activity(GO:0004385) |
0.5 | 0.5 | GO:0004645 | phosphorylase activity(GO:0004645) |
0.5 | 1.5 | GO:0008898 | S-adenosylmethionine-homocysteine S-methyltransferase activity(GO:0008898) |
0.5 | 2.5 | GO:0005168 | neurotrophin TRKA receptor binding(GO:0005168) |
0.5 | 4.5 | GO:0002162 | dystroglycan binding(GO:0002162) |
0.5 | 6.4 | GO:0015643 | toxic substance binding(GO:0015643) |
0.5 | 4.4 | GO:0004708 | MAP kinase kinase activity(GO:0004708) |
0.5 | 1.9 | GO:0031493 | nucleosomal histone binding(GO:0031493) |
0.5 | 1.0 | GO:0008607 | phosphorylase kinase regulator activity(GO:0008607) |
0.5 | 1.0 | GO:0016421 | CoA carboxylase activity(GO:0016421) |
0.5 | 2.4 | GO:0009378 | four-way junction helicase activity(GO:0009378) |
0.5 | 1.4 | GO:0035529 | NADH pyrophosphatase activity(GO:0035529) |
0.5 | 0.9 | GO:0051765 | inositol tetrakisphosphate kinase activity(GO:0051765) |
0.5 | 6.4 | GO:0070402 | NADPH binding(GO:0070402) |
0.5 | 3.2 | GO:0035005 | 1-phosphatidylinositol-4-phosphate 3-kinase activity(GO:0035005) |
0.4 | 1.3 | GO:0003987 | acetate-CoA ligase activity(GO:0003987) |
0.4 | 0.9 | GO:0043140 | ATP-dependent 3'-5' DNA helicase activity(GO:0043140) |
0.4 | 1.3 | GO:0016716 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, another compound as one donor, and incorporation of one atom of oxygen(GO:0016716) |
0.4 | 2.6 | GO:0046974 | histone methyltransferase activity (H3-K9 specific)(GO:0046974) |
0.4 | 1.8 | GO:0070579 | methylcytosine dioxygenase activity(GO:0070579) |
0.4 | 0.4 | GO:0000009 | alpha-1,6-mannosyltransferase activity(GO:0000009) |
0.4 | 3.0 | GO:0004908 | interleukin-1 receptor activity(GO:0004908) |
0.4 | 1.7 | GO:0016661 | oxidoreductase activity, acting on other nitrogenous compounds as donors(GO:0016661) |
0.4 | 1.3 | GO:0097108 | hedgehog family protein binding(GO:0097108) |
0.4 | 1.6 | GO:0008808 | cardiolipin synthase activity(GO:0008808) phosphatidyltransferase activity(GO:0030572) |
0.4 | 0.8 | GO:0043423 | 3-phosphoinositide-dependent protein kinase binding(GO:0043423) |
0.4 | 2.3 | GO:0050733 | RS domain binding(GO:0050733) |
0.4 | 3.5 | GO:0016920 | pyroglutamyl-peptidase activity(GO:0016920) |
0.4 | 1.1 | GO:0016149 | translation release factor activity, codon specific(GO:0016149) |
0.4 | 1.5 | GO:0005173 | stem cell factor receptor binding(GO:0005173) |
0.4 | 0.4 | GO:0050051 | leukotriene-B4 20-monooxygenase activity(GO:0050051) |
0.4 | 4.0 | GO:0070411 | I-SMAD binding(GO:0070411) |
0.4 | 1.5 | GO:1904288 | BAT3 complex binding(GO:1904288) |
0.4 | 1.8 | GO:0001025 | RNA polymerase III transcription factor binding(GO:0001025) |
0.4 | 0.7 | GO:0005167 | neurotrophin TRK receptor binding(GO:0005167) |
0.4 | 1.8 | GO:0052723 | inositol hexakisphosphate kinase activity(GO:0000828) inositol hexakisphosphate 5-kinase activity(GO:0000832) inositol hexakisphosphate 1-kinase activity(GO:0052723) inositol hexakisphosphate 3-kinase activity(GO:0052724) |
0.3 | 1.0 | GO:0030160 | GKAP/Homer scaffold activity(GO:0030160) |
0.3 | 1.4 | GO:0004308 | exo-alpha-sialidase activity(GO:0004308) alpha-sialidase activity(GO:0016997) exo-alpha-(2->3)-sialidase activity(GO:0052794) exo-alpha-(2->6)-sialidase activity(GO:0052795) exo-alpha-(2->8)-sialidase activity(GO:0052796) |
0.3 | 2.0 | GO:0004768 | stearoyl-CoA 9-desaturase activity(GO:0004768) |
0.3 | 8.1 | GO:0030552 | cAMP binding(GO:0030552) |
0.3 | 1.0 | GO:0004096 | catalase activity(GO:0004096) |
0.3 | 1.7 | GO:0010997 | anaphase-promoting complex binding(GO:0010997) |
0.3 | 1.3 | GO:0015173 | aromatic amino acid transmembrane transporter activity(GO:0015173) |
0.3 | 1.0 | GO:0019153 | protein-disulfide reductase (glutathione) activity(GO:0019153) |
0.3 | 0.3 | GO:0003916 | DNA topoisomerase activity(GO:0003916) |
0.3 | 7.5 | GO:0019206 | nucleoside kinase activity(GO:0019206) |
0.3 | 1.0 | GO:0004605 | phosphatidate cytidylyltransferase activity(GO:0004605) |
0.3 | 0.6 | GO:0042030 | ATPase inhibitor activity(GO:0042030) |
0.3 | 1.3 | GO:0071074 | eukaryotic initiation factor eIF2 binding(GO:0071074) |
0.3 | 4.5 | GO:0004679 | AMP-activated protein kinase activity(GO:0004679) |
0.3 | 1.0 | GO:0035373 | chondroitin sulfate proteoglycan binding(GO:0035373) |
0.3 | 0.3 | GO:0032139 | dinucleotide insertion or deletion binding(GO:0032139) |
0.3 | 1.3 | GO:0097493 | structural molecule activity conferring elasticity(GO:0097493) |
0.3 | 0.9 | GO:0003986 | acetyl-CoA hydrolase activity(GO:0003986) |
0.3 | 4.6 | GO:0005545 | 1-phosphatidylinositol binding(GO:0005545) |
0.3 | 0.9 | GO:0000171 | ribonuclease MRP activity(GO:0000171) |
0.3 | 1.8 | GO:0005049 | nuclear export signal receptor activity(GO:0005049) |
0.3 | 1.8 | GO:0005384 | manganese ion transmembrane transporter activity(GO:0005384) |
0.3 | 0.9 | GO:0004748 | ribonucleoside-diphosphate reductase activity, thioredoxin disulfide as acceptor(GO:0004748) oxidoreductase activity, acting on CH or CH2 groups, disulfide as acceptor(GO:0016728) ribonucleoside-diphosphate reductase activity(GO:0061731) |
0.3 | 1.5 | GO:0004468 | lysine N-acetyltransferase activity, acting on acetyl phosphate as donor(GO:0004468) |
0.3 | 3.0 | GO:0070180 | large ribosomal subunit rRNA binding(GO:0070180) |
0.3 | 1.5 | GO:0030292 | protein tyrosine kinase inhibitor activity(GO:0030292) |
0.3 | 0.6 | GO:0008309 | double-stranded DNA exodeoxyribonuclease activity(GO:0008309) |
0.3 | 2.6 | GO:0016004 | phospholipase activator activity(GO:0016004) |
0.3 | 0.9 | GO:0016838 | carbon-oxygen lyase activity, acting on phosphates(GO:0016838) |
0.3 | 0.9 | GO:0055100 | adiponectin binding(GO:0055100) |
0.3 | 0.9 | GO:0001075 | transcription factor activity, RNA polymerase II core promoter sequence-specific binding involved in preinitiation complex assembly(GO:0001075) |
0.3 | 1.1 | GO:0036033 | mediator complex binding(GO:0036033) |
0.3 | 0.9 | GO:0000774 | adenyl-nucleotide exchange factor activity(GO:0000774) |
0.3 | 3.3 | GO:0051787 | misfolded protein binding(GO:0051787) |
0.3 | 0.6 | GO:0097200 | cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:0097200) |
0.3 | 0.8 | GO:0004505 | phenylalanine 4-monooxygenase activity(GO:0004505) |
0.3 | 3.0 | GO:0005159 | insulin-like growth factor receptor binding(GO:0005159) |
0.3 | 1.6 | GO:0004064 | arylesterase activity(GO:0004064) |
0.3 | 1.1 | GO:0052833 | inositol monophosphate 1-phosphatase activity(GO:0008934) inositol monophosphate 3-phosphatase activity(GO:0052832) inositol monophosphate 4-phosphatase activity(GO:0052833) inositol monophosphate phosphatase activity(GO:0052834) |
0.3 | 1.1 | GO:0000104 | succinate dehydrogenase activity(GO:0000104) |
0.3 | 5.3 | GO:0003785 | actin monomer binding(GO:0003785) |
0.3 | 2.1 | GO:0016861 | intramolecular oxidoreductase activity, interconverting aldoses and ketoses(GO:0016861) |
0.3 | 1.5 | GO:0004322 | ferroxidase activity(GO:0004322) oxidoreductase activity, oxidizing metal ions, oxygen as acceptor(GO:0016724) |
0.3 | 1.5 | GO:0003918 | DNA topoisomerase type II (ATP-hydrolyzing) activity(GO:0003918) DNA topoisomerase II activity(GO:0061505) |
0.3 | 0.8 | GO:0004719 | protein-L-isoaspartate (D-aspartate) O-methyltransferase activity(GO:0004719) |
0.2 | 3.7 | GO:0070577 | lysine-acetylated histone binding(GO:0070577) |
0.2 | 1.2 | GO:0003854 | 3-beta-hydroxy-delta5-steroid dehydrogenase activity(GO:0003854) |
0.2 | 0.7 | GO:0050816 | phosphothreonine binding(GO:0050816) |
0.2 | 1.2 | GO:0017151 | DEAD/H-box RNA helicase binding(GO:0017151) |
0.2 | 0.5 | GO:0035197 | siRNA binding(GO:0035197) |
0.2 | 1.7 | GO:0005078 | MAP-kinase scaffold activity(GO:0005078) |
0.2 | 1.5 | GO:0033695 | oxidoreductase activity, acting on CH or CH2 groups, quinone or similar compound as acceptor(GO:0033695) caffeine oxidase activity(GO:0034875) |
0.2 | 0.7 | GO:0050510 | N-acetylgalactosaminyl-proteoglycan 3-beta-glucuronosyltransferase activity(GO:0050510) |
0.2 | 1.4 | GO:1990381 | ubiquitin-specific protease binding(GO:1990381) |
0.2 | 0.7 | GO:0004687 | myosin light chain kinase activity(GO:0004687) |
0.2 | 2.4 | GO:0004176 | ATP-dependent peptidase activity(GO:0004176) |
0.2 | 0.9 | GO:0004060 | arylamine N-acetyltransferase activity(GO:0004060) |
0.2 | 0.5 | GO:0097016 | L27 domain binding(GO:0097016) |
0.2 | 0.7 | GO:2001070 | starch binding(GO:2001070) |
0.2 | 1.4 | GO:0035312 | 5'-3' exodeoxyribonuclease activity(GO:0035312) |
0.2 | 2.1 | GO:0043995 | histone acetyltransferase activity (H4-K5 specific)(GO:0043995) histone acetyltransferase activity (H4-K8 specific)(GO:0043996) histone acetyltransferase activity (H4-K16 specific)(GO:0046972) |
0.2 | 0.2 | GO:0032190 | acrosin binding(GO:0032190) |
0.2 | 2.8 | GO:0015279 | store-operated calcium channel activity(GO:0015279) |
0.2 | 0.7 | GO:0071553 | uridine nucleotide receptor activity(GO:0015065) G-protein coupled pyrimidinergic nucleotide receptor activity(GO:0071553) |
0.2 | 0.7 | GO:0001069 | regulatory region RNA binding(GO:0001069) |
0.2 | 0.9 | GO:0008526 | phosphatidylinositol transporter activity(GO:0008526) |
0.2 | 0.9 | GO:0005042 | netrin receptor activity(GO:0005042) |
0.2 | 0.9 | GO:0070326 | very-low-density lipoprotein particle receptor binding(GO:0070326) |
0.2 | 1.6 | GO:0004571 | mannosyl-oligosaccharide 1,2-alpha-mannosidase activity(GO:0004571) |
0.2 | 2.9 | GO:0016290 | palmitoyl-CoA hydrolase activity(GO:0016290) |
0.2 | 0.9 | GO:0032051 | clathrin light chain binding(GO:0032051) |
0.2 | 0.4 | GO:0050145 | nucleoside phosphate kinase activity(GO:0050145) |
0.2 | 1.1 | GO:0043426 | MRF binding(GO:0043426) |
0.2 | 0.4 | GO:0004427 | inorganic diphosphatase activity(GO:0004427) |
0.2 | 0.7 | GO:0034513 | box H/ACA snoRNA binding(GO:0034513) |
0.2 | 0.9 | GO:0003873 | 6-phosphofructo-2-kinase activity(GO:0003873) |
0.2 | 0.6 | GO:0030375 | thyroid hormone receptor coactivator activity(GO:0030375) |
0.2 | 0.2 | GO:0043533 | inositol 1,3,4,5 tetrakisphosphate binding(GO:0043533) |
0.2 | 1.5 | GO:0016679 | oxidoreductase activity, acting on diphenols and related substances as donors(GO:0016679) |
0.2 | 0.6 | GO:0050220 | prostaglandin-E synthase activity(GO:0050220) |
0.2 | 0.4 | GO:0036042 | long-chain fatty acyl-CoA binding(GO:0036042) |
0.2 | 1.5 | GO:0046790 | virion binding(GO:0046790) |
0.2 | 1.0 | GO:0043184 | vascular endothelial growth factor receptor 2 binding(GO:0043184) |
0.2 | 1.5 | GO:0016892 | endoribonuclease activity, producing 3'-phosphomonoesters(GO:0016892) |
0.2 | 1.2 | GO:0004439 | phosphatidylinositol-4,5-bisphosphate 5-phosphatase activity(GO:0004439) |
0.2 | 0.8 | GO:0015232 | heme transporter activity(GO:0015232) |
0.2 | 1.2 | GO:0046624 | sphingolipid transporter activity(GO:0046624) |
0.2 | 0.6 | GO:0019862 | IgA binding(GO:0019862) |
0.2 | 0.6 | GO:0004771 | sterol esterase activity(GO:0004771) |
0.2 | 0.4 | GO:0016655 | oxidoreductase activity, acting on NAD(P)H, quinone or similar compound as acceptor(GO:0016655) |
0.2 | 0.6 | GO:0016971 | flavin-linked sulfhydryl oxidase activity(GO:0016971) |
0.2 | 0.4 | GO:0005094 | Rho GDP-dissociation inhibitor activity(GO:0005094) |
0.2 | 1.2 | GO:0004859 | phospholipase inhibitor activity(GO:0004859) |
0.2 | 0.6 | GO:0016882 | cyclo-ligase activity(GO:0016882) |
0.2 | 1.2 | GO:0005499 | vitamin D binding(GO:0005499) |
0.2 | 0.2 | GO:0009019 | tRNA (guanine-N1-)-methyltransferase activity(GO:0009019) |
0.2 | 1.0 | GO:0071558 | histone demethylase activity (H3-K27 specific)(GO:0071558) |
0.2 | 0.4 | GO:0048101 | calcium- and calmodulin-regulated 3',5'-cyclic-GMP phosphodiesterase activity(GO:0048101) |
0.2 | 0.6 | GO:0004359 | glutaminase activity(GO:0004359) |
0.2 | 0.6 | GO:0004013 | adenosylhomocysteinase activity(GO:0004013) trialkylsulfonium hydrolase activity(GO:0016802) |
0.2 | 0.4 | GO:0000403 | Y-form DNA binding(GO:0000403) |
0.2 | 3.1 | GO:0017128 | phospholipid scramblase activity(GO:0017128) |
0.2 | 0.8 | GO:0002046 | opsin binding(GO:0002046) |
0.2 | 2.3 | GO:0070006 | metalloaminopeptidase activity(GO:0070006) |
0.2 | 0.8 | GO:0036310 | annealing helicase activity(GO:0036310) |
0.2 | 0.4 | GO:0019788 | NEDD8 transferase activity(GO:0019788) |
0.2 | 0.8 | GO:0071614 | linoleic acid epoxygenase activity(GO:0071614) |
0.2 | 0.6 | GO:0031800 | type 3 metabotropic glutamate receptor binding(GO:0031800) |
0.2 | 1.3 | GO:0003688 | DNA replication origin binding(GO:0003688) |
0.2 | 1.7 | GO:0103116 | alpha-D-galactofuranose transporter activity(GO:0103116) |
0.2 | 2.8 | GO:0004435 | phosphatidylinositol phospholipase C activity(GO:0004435) |
0.2 | 3.1 | GO:0003756 | protein disulfide isomerase activity(GO:0003756) intramolecular oxidoreductase activity, transposing S-S bonds(GO:0016864) |
0.2 | 0.9 | GO:0042809 | vitamin D receptor binding(GO:0042809) |
0.2 | 0.5 | GO:0061629 | RNA polymerase II sequence-specific DNA binding transcription factor binding(GO:0061629) |
0.2 | 0.2 | GO:0010861 | thyroid hormone receptor activator activity(GO:0010861) |
0.2 | 1.3 | GO:0016308 | 1-phosphatidylinositol-4-phosphate 5-kinase activity(GO:0016308) |
0.2 | 2.4 | GO:0060590 | ATPase regulator activity(GO:0060590) |
0.2 | 3.1 | GO:0004709 | MAP kinase kinase kinase activity(GO:0004709) |
0.2 | 5.2 | GO:0017112 | Rab guanyl-nucleotide exchange factor activity(GO:0017112) |
0.2 | 0.9 | GO:1990380 | Lys48-specific deubiquitinase activity(GO:1990380) |
0.2 | 2.5 | GO:1990841 | promoter-specific chromatin binding(GO:1990841) |
0.2 | 0.7 | GO:0004332 | fructose-bisphosphate aldolase activity(GO:0004332) |
0.2 | 3.2 | GO:0005528 | macrolide binding(GO:0005527) FK506 binding(GO:0005528) |
0.2 | 0.5 | GO:0017162 | aryl hydrocarbon receptor binding(GO:0017162) |
0.2 | 0.9 | GO:0043495 | protein anchor(GO:0043495) |
0.2 | 0.2 | GO:0002134 | pyrimidine nucleoside binding(GO:0001884) UTP binding(GO:0002134) pyrimidine ribonucleoside binding(GO:0032551) |
0.2 | 0.9 | GO:0015198 | oligopeptide transporter activity(GO:0015198) |
0.2 | 6.5 | GO:0008392 | arachidonic acid epoxygenase activity(GO:0008392) |
0.2 | 1.2 | GO:0030346 | protein phosphatase 2B binding(GO:0030346) |
0.2 | 1.7 | GO:0001222 | transcription corepressor binding(GO:0001222) |
0.2 | 0.7 | GO:0030628 | pre-mRNA 3'-splice site binding(GO:0030628) |
0.2 | 2.4 | GO:0008353 | RNA polymerase II carboxy-terminal domain kinase activity(GO:0008353) |
0.2 | 0.5 | GO:0004937 | alpha1-adrenergic receptor activity(GO:0004937) |
0.2 | 4.9 | GO:0004402 | histone acetyltransferase activity(GO:0004402) |
0.2 | 0.5 | GO:0042296 | ISG15 transferase activity(GO:0042296) |
0.2 | 1.5 | GO:0045294 | alpha-catenin binding(GO:0045294) |
0.2 | 0.2 | GO:0032557 | pyrimidine ribonucleotide binding(GO:0032557) |
0.2 | 1.0 | GO:0031730 | CCR5 chemokine receptor binding(GO:0031730) |
0.2 | 0.8 | GO:0015379 | potassium:chloride symporter activity(GO:0015379) potassium ion symporter activity(GO:0022820) |
0.2 | 1.1 | GO:0004661 | protein geranylgeranyltransferase activity(GO:0004661) |
0.2 | 0.8 | GO:0043325 | phosphatidylinositol-3,4-bisphosphate binding(GO:0043325) |
0.2 | 0.6 | GO:0004165 | dodecenoyl-CoA delta-isomerase activity(GO:0004165) |
0.2 | 0.6 | GO:0019103 | pyrimidine nucleotide binding(GO:0019103) |
0.2 | 1.0 | GO:0016778 | diphosphotransferase activity(GO:0016778) |
0.2 | 0.5 | GO:0017034 | Rap guanyl-nucleotide exchange factor activity(GO:0017034) |
0.2 | 0.5 | GO:0031752 | D5 dopamine receptor binding(GO:0031752) |
0.2 | 0.8 | GO:0000146 | microfilament motor activity(GO:0000146) |
0.2 | 2.1 | GO:0001972 | retinoic acid binding(GO:0001972) |
0.2 | 0.8 | GO:0035368 | selenocysteine insertion sequence binding(GO:0035368) |
0.2 | 0.8 | GO:0004653 | polypeptide N-acetylgalactosaminyltransferase activity(GO:0004653) |
0.2 | 0.5 | GO:0016909 | JUN kinase activity(GO:0004705) SAP kinase activity(GO:0016909) |
0.2 | 0.3 | GO:0005095 | GTPase inhibitor activity(GO:0005095) |
0.2 | 0.8 | GO:0004556 | alpha-amylase activity(GO:0004556) |
0.2 | 0.5 | GO:0004090 | carbonyl reductase (NADPH) activity(GO:0004090) |
0.2 | 0.2 | GO:0031726 | CCR1 chemokine receptor binding(GO:0031726) |
0.2 | 1.7 | GO:0008641 | small protein activating enzyme activity(GO:0008641) |
0.2 | 1.2 | GO:0000983 | transcription factor activity, RNA polymerase II core promoter sequence-specific(GO:0000983) |
0.2 | 0.9 | GO:0008508 | bile acid:sodium symporter activity(GO:0008508) |
0.2 | 4.1 | GO:0001205 | transcriptional activator activity, RNA polymerase II distal enhancer sequence-specific binding(GO:0001205) |
0.2 | 4.6 | GO:0005547 | phosphatidylinositol-3,4,5-trisphosphate binding(GO:0005547) |
0.2 | 0.6 | GO:0051022 | Rho GDP-dissociation inhibitor binding(GO:0051022) |
0.2 | 0.6 | GO:0004594 | pantothenate kinase activity(GO:0004594) |
0.2 | 0.3 | GO:0000702 | oxidized base lesion DNA N-glycosylase activity(GO:0000702) |
0.2 | 0.6 | GO:0015057 | thrombin receptor activity(GO:0015057) |
0.2 | 1.2 | GO:0016846 | carbon-sulfur lyase activity(GO:0016846) |
0.2 | 2.1 | GO:0034237 | protein kinase A regulatory subunit binding(GO:0034237) |
0.2 | 0.2 | GO:0034191 | apolipoprotein A-I receptor binding(GO:0034191) |
0.2 | 2.3 | GO:0043295 | glutathione binding(GO:0043295) oligopeptide binding(GO:1900750) |
0.2 | 0.9 | GO:0003956 | NAD(P)+-protein-arginine ADP-ribosyltransferase activity(GO:0003956) |
0.1 | 1.5 | GO:0080025 | phosphatidylinositol-3,5-bisphosphate binding(GO:0080025) |
0.1 | 0.4 | GO:0008240 | tripeptidyl-peptidase activity(GO:0008240) |
0.1 | 0.6 | GO:0015220 | choline transmembrane transporter activity(GO:0015220) |
0.1 | 0.4 | GO:0008321 | Ral guanyl-nucleotide exchange factor activity(GO:0008321) |
0.1 | 5.9 | GO:0035064 | methylated histone binding(GO:0035064) |
0.1 | 1.3 | GO:0042500 | aspartic endopeptidase activity, intramembrane cleaving(GO:0042500) |
0.1 | 1.8 | GO:0030551 | cyclic nucleotide binding(GO:0030551) |
0.1 | 0.4 | GO:0031826 | type 2A serotonin receptor binding(GO:0031826) |
0.1 | 0.1 | GO:0071532 | ankyrin repeat binding(GO:0071532) |
0.1 | 0.6 | GO:0004030 | aldehyde dehydrogenase [NAD(P)+] activity(GO:0004030) |
0.1 | 1.7 | GO:0038187 | signaling pattern recognition receptor activity(GO:0008329) pattern recognition receptor activity(GO:0038187) |
0.1 | 0.3 | GO:0035615 | clathrin adaptor activity(GO:0035615) endocytic adaptor activity(GO:0098748) |
0.1 | 0.3 | GO:0004897 | ciliary neurotrophic factor receptor activity(GO:0004897) |
0.1 | 2.6 | GO:0050681 | androgen receptor binding(GO:0050681) |
0.1 | 3.5 | GO:0051879 | Hsp90 protein binding(GO:0051879) |
0.1 | 8.7 | GO:0004004 | ATP-dependent RNA helicase activity(GO:0004004) RNA-dependent ATPase activity(GO:0008186) |
0.1 | 0.3 | GO:0097371 | MDM2/MDM4 family protein binding(GO:0097371) |
0.1 | 0.7 | GO:0008467 | [heparan sulfate]-glucosamine 3-sulfotransferase 1 activity(GO:0008467) |
0.1 | 0.7 | GO:0016174 | NAD(P)H oxidase activity(GO:0016174) |
0.1 | 0.1 | GO:0042813 | Wnt-activated receptor activity(GO:0042813) |
0.1 | 0.8 | GO:0047498 | calcium-dependent phospholipase A2 activity(GO:0047498) |
0.1 | 1.1 | GO:0042975 | peroxisome proliferator activated receptor binding(GO:0042975) |
0.1 | 0.1 | GO:0070324 | thyroid hormone binding(GO:0070324) |
0.1 | 0.1 | GO:0004396 | glucokinase activity(GO:0004340) hexokinase activity(GO:0004396) fructokinase activity(GO:0008865) mannokinase activity(GO:0019158) |
0.1 | 0.4 | GO:0048248 | CXCR3 chemokine receptor binding(GO:0048248) |
0.1 | 1.0 | GO:0001162 | RNA polymerase II intronic transcription regulatory region sequence-specific DNA binding(GO:0001162) |
0.1 | 3.0 | GO:0003954 | NADH dehydrogenase activity(GO:0003954) |
0.1 | 2.2 | GO:0003950 | NAD+ ADP-ribosyltransferase activity(GO:0003950) |
0.1 | 1.4 | GO:0009881 | photoreceptor activity(GO:0009881) |
0.1 | 0.5 | GO:0004614 | phosphoglucomutase activity(GO:0004614) |
0.1 | 1.2 | GO:0004312 | fatty acid synthase activity(GO:0004312) |
0.1 | 0.3 | GO:0002094 | polyprenyltransferase activity(GO:0002094) |
0.1 | 0.4 | GO:0004939 | beta-adrenergic receptor activity(GO:0004939) |
0.1 | 0.3 | GO:0070573 | metallodipeptidase activity(GO:0070573) |
0.1 | 1.2 | GO:0008242 | omega peptidase activity(GO:0008242) |
0.1 | 0.5 | GO:0005324 | long-chain fatty acid transporter activity(GO:0005324) |
0.1 | 0.1 | GO:0004337 | geranyltranstransferase activity(GO:0004337) |
0.1 | 0.4 | GO:0034186 | apolipoprotein A-I binding(GO:0034186) |
0.1 | 0.4 | GO:0051864 | histone demethylase activity (H3-K36 specific)(GO:0051864) |
0.1 | 2.3 | GO:0004889 | acetylcholine-activated cation-selective channel activity(GO:0004889) |
0.1 | 0.1 | GO:0016880 | acid-ammonia (or amide) ligase activity(GO:0016880) |
0.1 | 0.4 | GO:0004800 | thyroxine 5'-deiodinase activity(GO:0004800) |
0.1 | 0.5 | GO:0016832 | aldehyde-lyase activity(GO:0016832) |
0.1 | 1.3 | GO:0030955 | potassium ion binding(GO:0030955) |
0.1 | 0.3 | GO:0008970 | phosphatidylcholine 1-acylhydrolase activity(GO:0008970) |
0.1 | 1.4 | GO:0016813 | hydrolase activity, acting on carbon-nitrogen (but not peptide) bonds, in linear amidines(GO:0016813) |
0.1 | 1.3 | GO:0034185 | apolipoprotein binding(GO:0034185) |
0.1 | 0.7 | GO:0017040 | ceramidase activity(GO:0017040) |
0.1 | 0.4 | GO:0035033 | histone deacetylase regulator activity(GO:0035033) |
0.1 | 3.1 | GO:0016790 | thiolester hydrolase activity(GO:0016790) |
0.1 | 0.1 | GO:0030911 | TPR domain binding(GO:0030911) |
0.1 | 0.5 | GO:0005250 | A-type (transient outward) potassium channel activity(GO:0005250) |
0.1 | 0.4 | GO:0004832 | valine-tRNA ligase activity(GO:0004832) |
0.1 | 0.5 | GO:0034235 | GPI anchor binding(GO:0034235) |
0.1 | 1.4 | GO:0046966 | thyroid hormone receptor binding(GO:0046966) |
0.1 | 0.5 | GO:0003846 | 2-acylglycerol O-acyltransferase activity(GO:0003846) |
0.1 | 0.4 | GO:0042301 | phosphate ion binding(GO:0042301) |
0.1 | 0.4 | GO:0005146 | leukemia inhibitory factor receptor binding(GO:0005146) |
0.1 | 5.9 | GO:0017022 | myosin binding(GO:0017022) |
0.1 | 0.6 | GO:0086080 | protein binding involved in heterotypic cell-cell adhesion(GO:0086080) |
0.1 | 0.8 | GO:0045545 | syndecan binding(GO:0045545) |
0.1 | 0.4 | GO:0043120 | tumor necrosis factor binding(GO:0043120) |
0.1 | 0.5 | GO:0031544 | peptidyl-proline 3-dioxygenase activity(GO:0031544) |
0.1 | 0.4 | GO:0035514 | DNA demethylase activity(GO:0035514) |
0.1 | 1.0 | GO:0048156 | tau protein binding(GO:0048156) |
0.1 | 0.4 | GO:0071987 | WD40-repeat domain binding(GO:0071987) |
0.1 | 0.9 | GO:0043023 | ribosomal large subunit binding(GO:0043023) |
0.1 | 1.2 | GO:0016860 | intramolecular oxidoreductase activity(GO:0016860) |
0.1 | 1.7 | GO:0017081 | chloride channel regulator activity(GO:0017081) |
0.1 | 0.5 | GO:0030942 | endoplasmic reticulum signal peptide binding(GO:0030942) |
0.1 | 0.8 | GO:0008553 | hydrogen-exporting ATPase activity, phosphorylative mechanism(GO:0008553) |
0.1 | 0.2 | GO:0070699 | type II activin receptor binding(GO:0070699) |
0.1 | 1.7 | GO:0032794 | GTPase activating protein binding(GO:0032794) |
0.1 | 1.3 | GO:0004303 | estradiol 17-beta-dehydrogenase activity(GO:0004303) |
0.1 | 2.4 | GO:0005070 | SH3/SH2 adaptor activity(GO:0005070) |
0.1 | 1.4 | GO:0070888 | E-box binding(GO:0070888) |
0.1 | 0.6 | GO:1990247 | N6-methyladenosine-containing RNA binding(GO:1990247) |
0.1 | 0.1 | GO:0071253 | connexin binding(GO:0071253) |
0.1 | 0.8 | GO:0045295 | gamma-catenin binding(GO:0045295) |
0.1 | 9.3 | GO:0015020 | glucuronosyltransferase activity(GO:0015020) |
0.1 | 0.3 | GO:0004833 | tryptophan 2,3-dioxygenase activity(GO:0004833) |
0.1 | 2.2 | GO:0043734 | DNA-N1-methyladenine dioxygenase activity(GO:0043734) |
0.1 | 0.6 | GO:0042979 | ornithine decarboxylase regulator activity(GO:0042979) |
0.1 | 0.3 | GO:0004948 | calcitonin receptor activity(GO:0004948) |
0.1 | 1.4 | GO:0052859 | dextrin alpha-glucosidase activity(GO:0044653) starch alpha-glucosidase activity(GO:0044654) beta-glucanase activity(GO:0052736) beta-6-sulfate-N-acetylglucosaminidase activity(GO:0052769) glucan endo-1,4-beta-glucosidase activity(GO:0052859) |
0.1 | 1.2 | GO:0097602 | cullin family protein binding(GO:0097602) |
0.1 | 4.0 | GO:0015923 | mannosidase activity(GO:0015923) |
0.1 | 0.7 | GO:0070097 | delta-catenin binding(GO:0070097) |
0.1 | 0.2 | GO:0004376 | glycolipid mannosyltransferase activity(GO:0004376) |
0.1 | 0.4 | GO:0005275 | amine transmembrane transporter activity(GO:0005275) |
0.1 | 0.7 | GO:0008420 | CTD phosphatase activity(GO:0008420) |
0.1 | 1.4 | GO:0019104 | DNA N-glycosylase activity(GO:0019104) |
0.1 | 0.9 | GO:0003841 | 1-acylglycerol-3-phosphate O-acyltransferase activity(GO:0003841) |
0.1 | 0.9 | GO:0022889 | L-serine transmembrane transporter activity(GO:0015194) serine transmembrane transporter activity(GO:0022889) |
0.1 | 0.3 | GO:0008503 | benzodiazepine receptor activity(GO:0008503) |
0.1 | 1.1 | GO:0008327 | methyl-CpG binding(GO:0008327) |
0.1 | 0.5 | GO:0000268 | peroxisome targeting sequence binding(GO:0000268) |
0.1 | 0.3 | GO:0035671 | enone reductase activity(GO:0035671) |
0.1 | 2.9 | GO:0005484 | SNAP receptor activity(GO:0005484) |
0.1 | 5.7 | GO:0005518 | collagen binding(GO:0005518) |
0.1 | 0.7 | GO:0070064 | proline-rich region binding(GO:0070064) |
0.1 | 9.2 | GO:0004725 | protein tyrosine phosphatase activity(GO:0004725) |
0.1 | 0.3 | GO:0008184 | glycogen phosphorylase activity(GO:0008184) |
0.1 | 0.1 | GO:0016649 | electron-transferring-flavoprotein dehydrogenase activity(GO:0004174) oxidoreductase activity, acting on the CH-NH group of donors, quinone or similar compound as acceptor(GO:0016649) |
0.1 | 1.2 | GO:0005523 | tropomyosin binding(GO:0005523) |
0.1 | 0.9 | GO:0008568 | microtubule-severing ATPase activity(GO:0008568) |
0.1 | 0.7 | GO:0030492 | hemoglobin binding(GO:0030492) |
0.1 | 0.4 | GO:0015288 | porin activity(GO:0015288) |
0.1 | 1.9 | GO:0016709 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, NAD(P)H as one donor, and incorporation of one atom of oxygen(GO:0016709) |
0.1 | 0.1 | GO:1902282 | voltage-gated potassium channel activity involved in ventricular cardiac muscle cell action potential repolarization(GO:1902282) |
0.1 | 1.0 | GO:0023026 | MHC class II protein complex binding(GO:0023026) |
0.1 | 0.6 | GO:0019203 | carbohydrate phosphatase activity(GO:0019203) sugar-phosphatase activity(GO:0050308) |
0.1 | 1.6 | GO:0043014 | alpha-tubulin binding(GO:0043014) |
0.1 | 0.3 | GO:0003829 | beta-1,3-galactosyl-O-glycosyl-glycoprotein beta-1,6-N-acetylglucosaminyltransferase activity(GO:0003829) |
0.1 | 0.3 | GO:1990050 | phosphatidic acid transporter activity(GO:1990050) |
0.1 | 0.6 | GO:0008432 | JUN kinase binding(GO:0008432) |
0.1 | 0.4 | GO:0032050 | clathrin heavy chain binding(GO:0032050) |
0.1 | 0.3 | GO:0070181 | small ribosomal subunit rRNA binding(GO:0070181) |
0.1 | 0.2 | GO:0035663 | Toll-like receptor 2 binding(GO:0035663) |
0.1 | 0.5 | GO:0019911 | structural constituent of myelin sheath(GO:0019911) |
0.1 | 0.1 | GO:0098518 | polynucleotide phosphatase activity(GO:0098518) |
0.1 | 0.3 | GO:0080130 | L-phenylalanine aminotransferase activity(GO:0070546) L-phenylalanine:2-oxoglutarate aminotransferase activity(GO:0080130) |
0.1 | 0.4 | GO:0034236 | protein kinase A catalytic subunit binding(GO:0034236) |
0.1 | 0.5 | GO:0043422 | protein kinase B binding(GO:0043422) |
0.1 | 0.2 | GO:0034040 | lipid-transporting ATPase activity(GO:0034040) |
0.1 | 0.4 | GO:0008430 | selenium binding(GO:0008430) |
0.1 | 0.4 | GO:0034714 | type III transforming growth factor beta receptor binding(GO:0034714) |
0.1 | 1.0 | GO:0050998 | nitric-oxide synthase binding(GO:0050998) |
0.1 | 0.4 | GO:0018812 | 3-hydroxyacyl-CoA dehydratase activity(GO:0018812) 3-hydroxy-behenoyl-CoA dehydratase activity(GO:0102344) 3-hydroxy-lignoceroyl-CoA dehydratase activity(GO:0102345) |
0.1 | 0.1 | GO:0046965 | retinoid X receptor binding(GO:0046965) |
0.1 | 1.3 | GO:0008266 | poly(U) RNA binding(GO:0008266) |
0.1 | 0.4 | GO:0015245 | fatty acid transporter activity(GO:0015245) |
0.1 | 0.3 | GO:0004739 | pyruvate dehydrogenase (acetyl-transferring) activity(GO:0004739) |
0.1 | 2.1 | GO:0001102 | RNA polymerase II activating transcription factor binding(GO:0001102) |
0.1 | 1.7 | GO:0043425 | bHLH transcription factor binding(GO:0043425) |
0.1 | 1.6 | GO:0036002 | pre-mRNA binding(GO:0036002) |
0.1 | 0.2 | GO:0005138 | interleukin-6 receptor binding(GO:0005138) |
0.1 | 0.2 | GO:0042281 | dolichyl pyrophosphate Man9GlcNAc2 alpha-1,3-glucosyltransferase activity(GO:0042281) |
0.1 | 2.7 | GO:0061631 | ubiquitin conjugating enzyme activity(GO:0061631) ubiquitin-like protein conjugating enzyme activity(GO:0061650) |
0.1 | 0.2 | GO:0030620 | U2 snRNA binding(GO:0030620) |
0.1 | 6.8 | GO:0101005 | thiol-dependent ubiquitinyl hydrolase activity(GO:0036459) ubiquitinyl hydrolase activity(GO:0101005) |
0.1 | 2.3 | GO:0005546 | phosphatidylinositol-4,5-bisphosphate binding(GO:0005546) |
0.1 | 5.0 | GO:0042393 | histone binding(GO:0042393) |
0.1 | 0.6 | GO:0031628 | opioid receptor binding(GO:0031628) |
0.1 | 2.2 | GO:0015347 | sodium-independent organic anion transmembrane transporter activity(GO:0015347) |
0.1 | 1.1 | GO:0005487 | nucleocytoplasmic transporter activity(GO:0005487) |
0.1 | 0.3 | GO:0001609 | G-protein coupled adenosine receptor activity(GO:0001609) |
0.1 | 0.9 | GO:0051019 | mitogen-activated protein kinase binding(GO:0051019) |
0.1 | 0.6 | GO:0008409 | 5'-3' exonuclease activity(GO:0008409) |
0.1 | 0.4 | GO:0017176 | phosphatidylinositol N-acetylglucosaminyltransferase activity(GO:0017176) |
0.1 | 1.6 | GO:0030507 | spectrin binding(GO:0030507) |
0.1 | 0.3 | GO:0043199 | sulfate binding(GO:0043199) |
0.1 | 18.2 | GO:0001077 | transcriptional activator activity, RNA polymerase II core promoter proximal region sequence-specific binding(GO:0001077) |
0.1 | 0.3 | GO:0061665 | SUMO ligase activity(GO:0061665) |
0.1 | 0.1 | GO:0032137 | guanine/thymine mispair binding(GO:0032137) |
0.1 | 0.4 | GO:0000064 | L-ornithine transmembrane transporter activity(GO:0000064) |
0.1 | 1.0 | GO:0070273 | phosphatidylinositol-4-phosphate binding(GO:0070273) |
0.1 | 0.5 | GO:0034711 | inhibin binding(GO:0034711) |
0.1 | 6.5 | GO:0001078 | transcriptional repressor activity, RNA polymerase II core promoter proximal region sequence-specific binding(GO:0001078) |
0.1 | 0.4 | GO:0000340 | RNA 7-methylguanosine cap binding(GO:0000340) |
0.1 | 0.3 | GO:0030943 | mitochondrion targeting sequence binding(GO:0030943) |
0.1 | 1.5 | GO:0001848 | complement binding(GO:0001848) |
0.1 | 1.0 | GO:0004029 | aldehyde dehydrogenase (NAD) activity(GO:0004029) |
0.1 | 0.3 | GO:0047756 | chondroitin 4-sulfotransferase activity(GO:0047756) |
0.1 | 0.4 | GO:0097027 | ubiquitin-protein transferase activator activity(GO:0097027) |
0.1 | 0.6 | GO:0050291 | sphingosine N-acyltransferase activity(GO:0050291) |
0.1 | 1.8 | GO:0044769 | ATPase activity, coupled to transmembrane movement of ions, rotational mechanism(GO:0044769) |
0.1 | 0.3 | GO:0004045 | aminoacyl-tRNA hydrolase activity(GO:0004045) |
0.1 | 0.2 | GO:0004677 | DNA-dependent protein kinase activity(GO:0004677) |
0.1 | 0.2 | GO:0045504 | dynein heavy chain binding(GO:0045504) |
0.1 | 0.3 | GO:0004949 | cannabinoid receptor activity(GO:0004949) |
0.1 | 0.3 | GO:0008349 | MAP kinase kinase kinase kinase activity(GO:0008349) |
0.1 | 1.8 | GO:0051059 | NF-kappaB binding(GO:0051059) |
0.1 | 0.8 | GO:0016595 | glutamate binding(GO:0016595) |
0.1 | 0.4 | GO:0031369 | translation initiation factor binding(GO:0031369) |
0.1 | 0.5 | GO:0005113 | patched binding(GO:0005113) |
0.1 | 0.8 | GO:0016278 | lysine N-methyltransferase activity(GO:0016278) protein-lysine N-methyltransferase activity(GO:0016279) |
0.1 | 0.2 | GO:0008948 | malic enzyme activity(GO:0004470) malate dehydrogenase (decarboxylating) (NAD+) activity(GO:0004471) oxaloacetate decarboxylase activity(GO:0008948) |
0.1 | 0.6 | GO:0031386 | protein tag(GO:0031386) |
0.1 | 0.4 | GO:0005172 | vascular endothelial growth factor receptor binding(GO:0005172) |
0.1 | 0.5 | GO:0016624 | oxidoreductase activity, acting on the aldehyde or oxo group of donors, disulfide as acceptor(GO:0016624) |
0.1 | 0.2 | GO:0030297 | transmembrane receptor protein tyrosine kinase activator activity(GO:0030297) |
0.1 | 0.7 | GO:0032183 | SUMO binding(GO:0032183) |
0.1 | 0.3 | GO:0055131 | C3HC4-type RING finger domain binding(GO:0055131) |
0.1 | 2.2 | GO:0016831 | carboxy-lyase activity(GO:0016831) |
0.1 | 2.9 | GO:0048306 | calcium-dependent protein binding(GO:0048306) |
0.1 | 1.0 | GO:0042800 | histone methyltransferase activity (H3-K4 specific)(GO:0042800) |
0.1 | 0.2 | GO:0005219 | ryanodine-sensitive calcium-release channel activity(GO:0005219) |
0.1 | 0.5 | GO:0048487 | beta-tubulin binding(GO:0048487) |
0.1 | 0.2 | GO:1990446 | U1 snRNP binding(GO:1990446) |
0.1 | 0.6 | GO:0004596 | peptide alpha-N-acetyltransferase activity(GO:0004596) |
0.1 | 2.8 | GO:0001227 | transcriptional repressor activity, RNA polymerase II transcription regulatory region sequence-specific binding(GO:0001227) |
0.1 | 0.2 | GO:0005548 | phospholipid transporter activity(GO:0005548) |
0.1 | 0.9 | GO:0017049 | GTP-Rho binding(GO:0017049) |
0.1 | 0.4 | GO:0008190 | eukaryotic initiation factor 4E binding(GO:0008190) |
0.1 | 4.8 | GO:0035091 | phosphatidylinositol binding(GO:0035091) |
0.1 | 0.1 | GO:0034212 | peptide N-acetyltransferase activity(GO:0034212) |
0.1 | 0.6 | GO:0005092 | GDP-dissociation inhibitor activity(GO:0005092) |
0.1 | 0.1 | GO:0016933 | extracellular-glycine-gated ion channel activity(GO:0016933) extracellular-glycine-gated chloride channel activity(GO:0016934) |
0.1 | 2.1 | GO:0051539 | 4 iron, 4 sulfur cluster binding(GO:0051539) |
0.1 | 0.3 | GO:0015926 | glucosidase activity(GO:0015926) |
0.1 | 1.9 | GO:0030374 | ligand-dependent nuclear receptor transcription coactivator activity(GO:0030374) |
0.1 | 0.4 | GO:0042043 | neurexin family protein binding(GO:0042043) |
0.1 | 0.2 | GO:0015205 | purine nucleobase transmembrane transporter activity(GO:0005345) pyrimidine nucleobase transmembrane transporter activity(GO:0005350) nucleobase transmembrane transporter activity(GO:0015205) |
0.1 | 0.1 | GO:0031748 | D1 dopamine receptor binding(GO:0031748) |
0.1 | 1.5 | GO:0016538 | cyclin-dependent protein serine/threonine kinase regulator activity(GO:0016538) |
0.1 | 1.4 | GO:0003887 | DNA-directed DNA polymerase activity(GO:0003887) |
0.1 | 0.9 | GO:0015026 | coreceptor activity(GO:0015026) |
0.1 | 0.2 | GO:0051431 | corticotropin-releasing hormone receptor binding(GO:0051429) corticotropin-releasing hormone receptor 2 binding(GO:0051431) |
0.1 | 1.8 | GO:0005104 | fibroblast growth factor receptor binding(GO:0005104) |
0.1 | 0.6 | GO:0008376 | acetylgalactosaminyltransferase activity(GO:0008376) |
0.1 | 9.4 | GO:0003729 | mRNA binding(GO:0003729) |
0.1 | 0.2 | GO:0030274 | LIM domain binding(GO:0030274) |
0.1 | 0.4 | GO:0004579 | dolichyl-diphosphooligosaccharide-protein glycotransferase activity(GO:0004579) |
0.1 | 49.4 | GO:0044822 | poly(A) RNA binding(GO:0044822) |
0.1 | 0.1 | GO:0042171 | lysophosphatidic acid acyltransferase activity(GO:0042171) |
0.1 | 0.3 | GO:0001094 | TFIID-class transcription factor binding(GO:0001094) |
0.1 | 0.4 | GO:0004689 | phosphorylase kinase activity(GO:0004689) |
0.1 | 6.6 | GO:0003735 | structural constituent of ribosome(GO:0003735) |
0.1 | 1.4 | GO:0015002 | cytochrome-c oxidase activity(GO:0004129) heme-copper terminal oxidase activity(GO:0015002) oxidoreductase activity, acting on a heme group of donors, oxygen as acceptor(GO:0016676) |
0.1 | 1.7 | GO:0032947 | protein complex scaffold(GO:0032947) |
0.1 | 1.9 | GO:0030276 | clathrin binding(GO:0030276) |
0.1 | 0.4 | GO:0005000 | vasopressin receptor activity(GO:0005000) |
0.1 | 0.1 | GO:0019187 | beta-1,4-mannosyltransferase activity(GO:0019187) |
0.1 | 0.1 | GO:0070878 | primary miRNA binding(GO:0070878) |
0.1 | 0.3 | GO:0050700 | CARD domain binding(GO:0050700) |
0.1 | 1.0 | GO:0005112 | Notch binding(GO:0005112) |
0.1 | 0.3 | GO:0035497 | cAMP response element binding(GO:0035497) |
0.1 | 0.7 | GO:0030742 | GTP-dependent protein binding(GO:0030742) |
0.1 | 3.3 | GO:0030792 | methylarsonite methyltransferase activity(GO:0030792) |
0.1 | 0.2 | GO:0005068 | transmembrane receptor protein tyrosine kinase adaptor activity(GO:0005068) |
0.1 | 0.1 | GO:0019960 | C-X3-C chemokine binding(GO:0019960) |
0.1 | 2.0 | GO:0005132 | type I interferon receptor binding(GO:0005132) |
0.1 | 1.2 | GO:0043022 | ribosome binding(GO:0043022) |
0.1 | 0.5 | GO:0051400 | BH domain binding(GO:0051400) |
0.1 | 0.3 | GO:0004305 | ethanolamine kinase activity(GO:0004305) |
0.1 | 0.1 | GO:0043855 | intracellular cyclic nucleotide activated cation channel activity(GO:0005221) cyclic nucleotide-gated ion channel activity(GO:0043855) |
0.1 | 0.5 | GO:0015280 | ligand-gated sodium channel activity(GO:0015280) |
0.1 | 0.2 | GO:0030021 | extracellular matrix structural constituent conferring compression resistance(GO:0030021) structural constituent of tooth enamel(GO:0030345) |
0.1 | 0.4 | GO:0030506 | ankyrin binding(GO:0030506) |
0.1 | 0.4 | GO:0044183 | protein binding involved in protein folding(GO:0044183) |
0.1 | 2.2 | GO:0003705 | transcription factor activity, RNA polymerase II distal enhancer sequence-specific binding(GO:0003705) |
0.1 | 0.6 | GO:0016857 | racemase and epimerase activity, acting on carbohydrates and derivatives(GO:0016857) |
0.1 | 0.2 | GO:0035662 | Toll-like receptor 4 binding(GO:0035662) |
0.1 | 0.2 | GO:0008422 | beta-glucosidase activity(GO:0008422) |
0.1 | 1.4 | GO:0035326 | enhancer binding(GO:0035326) |
0.1 | 0.2 | GO:1904264 | ubiquitin protein ligase activity involved in ERAD pathway(GO:1904264) |
0.1 | 3.1 | GO:0047485 | protein N-terminus binding(GO:0047485) |
0.1 | 0.1 | GO:0004723 | calcium-dependent protein serine/threonine phosphatase activity(GO:0004723) |
0.1 | 0.6 | GO:0019200 | carbohydrate kinase activity(GO:0019200) |
0.1 | 0.1 | GO:0071617 | lysophospholipid acyltransferase activity(GO:0071617) |
0.1 | 0.2 | GO:0019208 | phosphatase regulator activity(GO:0019208) |
0.1 | 2.0 | GO:0016410 | N-acyltransferase activity(GO:0016410) |
0.1 | 2.8 | GO:0003774 | motor activity(GO:0003774) |
0.1 | 1.2 | GO:0030145 | manganese ion binding(GO:0030145) |
0.1 | 0.2 | GO:0031849 | olfactory receptor binding(GO:0031849) |
0.1 | 0.1 | GO:0031686 | A1 adenosine receptor binding(GO:0031686) |
0.1 | 0.2 | GO:0035877 | death effector domain binding(GO:0035877) |
0.1 | 0.1 | GO:0032552 | deoxyribonucleotide binding(GO:0032552) purine deoxyribonucleotide binding(GO:0032554) |
0.1 | 0.4 | GO:0003796 | lysozyme activity(GO:0003796) |
0.1 | 0.5 | GO:0003707 | steroid hormone receptor activity(GO:0003707) |
0.1 | 0.4 | GO:0005337 | nucleoside transmembrane transporter activity(GO:0005337) |
0.1 | 0.3 | GO:0015929 | hexosaminidase activity(GO:0015929) |
0.1 | 1.8 | GO:0005200 | structural constituent of cytoskeleton(GO:0005200) |
0.1 | 2.0 | GO:0005109 | frizzled binding(GO:0005109) |
0.1 | 0.4 | GO:0004415 | hyalurononglucosaminidase activity(GO:0004415) |
0.1 | 1.2 | GO:0052745 | inositol phosphate phosphatase activity(GO:0052745) |
0.1 | 0.2 | GO:0047631 | ADP-ribose diphosphatase activity(GO:0047631) |
0.1 | 1.2 | GO:0015485 | cholesterol binding(GO:0015485) |
0.1 | 0.5 | GO:0015250 | water channel activity(GO:0015250) |
0.1 | 0.3 | GO:0003847 | 1-alkyl-2-acetylglycerophosphocholine esterase activity(GO:0003847) |
0.1 | 0.1 | GO:0000026 | alpha-1,2-mannosyltransferase activity(GO:0000026) |
0.1 | 0.2 | GO:0015377 | cation:chloride symporter activity(GO:0015377) |
0.1 | 0.7 | GO:0046703 | natural killer cell lectin-like receptor binding(GO:0046703) |
0.1 | 1.6 | GO:0019905 | syntaxin binding(GO:0019905) |
0.1 | 7.2 | GO:0008017 | microtubule binding(GO:0008017) |
0.1 | 0.2 | GO:0031127 | galactoside 2-alpha-L-fucosyltransferase activity(GO:0008107) alpha-(1,2)-fucosyltransferase activity(GO:0031127) |
0.1 | 0.2 | GO:0008823 | cupric reductase activity(GO:0008823) ferric-chelate reductase (NADPH) activity(GO:0052851) |
0.1 | 0.3 | GO:0000993 | RNA polymerase II core binding(GO:0000993) |
0.1 | 0.2 | GO:0004999 | vasoactive intestinal polypeptide receptor activity(GO:0004999) |
0.1 | 5.1 | GO:0004222 | metalloendopeptidase activity(GO:0004222) |
0.1 | 0.5 | GO:0019825 | oxygen binding(GO:0019825) |
0.1 | 0.4 | GO:0031491 | nucleosome binding(GO:0031491) |
0.1 | 0.2 | GO:0016215 | acyl-CoA desaturase activity(GO:0016215) |
0.1 | 0.8 | GO:0015095 | magnesium ion transmembrane transporter activity(GO:0015095) |
0.1 | 0.4 | GO:0098988 | G-protein coupled glutamate receptor activity(GO:0098988) |
0.1 | 0.1 | GO:0004616 | phosphogluconate dehydrogenase (decarboxylating) activity(GO:0004616) |
0.1 | 0.5 | GO:0004602 | glutathione peroxidase activity(GO:0004602) |
0.1 | 0.4 | GO:0038191 | neuropilin binding(GO:0038191) |
0.1 | 0.2 | GO:0035251 | UDP-glucosyltransferase activity(GO:0035251) |
0.1 | 0.3 | GO:0016888 | endodeoxyribonuclease activity, producing 5'-phosphomonoesters(GO:0016888) |
0.1 | 0.4 | GO:0001055 | RNA polymerase II activity(GO:0001055) |
0.1 | 0.2 | GO:0008889 | glycerophosphodiester phosphodiesterase activity(GO:0008889) |
0.1 | 0.1 | GO:0016415 | octanoyltransferase activity(GO:0016415) |
0.1 | 2.7 | GO:0008565 | protein transporter activity(GO:0008565) |
0.1 | 0.1 | GO:0033613 | activating transcription factor binding(GO:0033613) |
0.1 | 0.4 | GO:0002161 | aminoacyl-tRNA editing activity(GO:0002161) |
0.1 | 0.2 | GO:0016520 | growth hormone-releasing hormone receptor activity(GO:0016520) |
0.1 | 0.1 | GO:0004566 | beta-glucuronidase activity(GO:0004566) |
0.1 | 0.1 | GO:0051379 | epinephrine binding(GO:0051379) |
0.1 | 1.0 | GO:0003743 | translation initiation factor activity(GO:0003743) |
0.1 | 0.2 | GO:0016670 | oxidoreductase activity, acting on a sulfur group of donors, oxygen as acceptor(GO:0016670) |
0.0 | 0.1 | GO:0008429 | phosphatidylethanolamine binding(GO:0008429) |
0.0 | 0.1 | GO:0008821 | crossover junction endodeoxyribonuclease activity(GO:0008821) |
0.0 | 0.1 | GO:0008310 | single-stranded DNA 3'-5' exodeoxyribonuclease activity(GO:0008310) |
0.0 | 0.4 | GO:0045502 | dynein binding(GO:0045502) |
0.0 | 0.0 | GO:0005087 | Ran guanyl-nucleotide exchange factor activity(GO:0005087) |
0.0 | 0.4 | GO:0017154 | semaphorin receptor activity(GO:0017154) |
0.0 | 1.3 | GO:0004864 | protein phosphatase inhibitor activity(GO:0004864) |
0.0 | 0.9 | GO:0016763 | transferase activity, transferring pentosyl groups(GO:0016763) |
0.0 | 1.5 | GO:0001047 | core promoter binding(GO:0001047) |
0.0 | 0.2 | GO:1990405 | protein antigen binding(GO:1990405) |
0.0 | 0.0 | GO:0008499 | UDP-galactose:beta-N-acetylglucosamine beta-1,3-galactosyltransferase activity(GO:0008499) |
0.0 | 0.5 | GO:0001103 | RNA polymerase II repressing transcription factor binding(GO:0001103) |
0.0 | 0.5 | GO:0016500 | protein-hormone receptor activity(GO:0016500) |
0.0 | 0.6 | GO:0016493 | C-C chemokine receptor activity(GO:0016493) |
0.0 | 0.3 | GO:0016783 | sulfurtransferase activity(GO:0016783) |
0.0 | 0.2 | GO:0070403 | NAD+ binding(GO:0070403) |
0.0 | 0.9 | GO:0001540 | beta-amyloid binding(GO:0001540) |
0.0 | 0.7 | GO:0019894 | kinesin binding(GO:0019894) |
0.0 | 1.4 | GO:0008907 | integrase activity(GO:0008907) T/G mismatch-specific endonuclease activity(GO:0043765) retroviral integrase activity(GO:0044823) retroviral 3' processing activity(GO:0044824) |
0.0 | 0.1 | GO:0044548 | S100 protein binding(GO:0044548) |
0.0 | 0.0 | GO:0071535 | RING-like zinc finger domain binding(GO:0071535) |
0.0 | 0.3 | GO:0045028 | G-protein coupled nucleotide receptor activity(GO:0001608) G-protein coupled purinergic nucleotide receptor activity(GO:0045028) |
0.0 | 0.9 | GO:0000977 | RNA polymerase II regulatory region sequence-specific DNA binding(GO:0000977) |
0.0 | 0.3 | GO:0005315 | inorganic phosphate transmembrane transporter activity(GO:0005315) |
0.0 | 0.2 | GO:0004111 | creatine kinase activity(GO:0004111) |
0.0 | 0.1 | GO:0015204 | urea transmembrane transporter activity(GO:0015204) |
0.0 | 0.1 | GO:0042895 | antibiotic transporter activity(GO:0042895) |
0.0 | 0.7 | GO:0004364 | glutathione transferase activity(GO:0004364) |
0.0 | 0.0 | GO:0000987 | core promoter proximal region sequence-specific DNA binding(GO:0000987) |
0.0 | 0.2 | GO:0004169 | dolichyl-phosphate-mannose-protein mannosyltransferase activity(GO:0004169) |
0.0 | 0.2 | GO:0004994 | somatostatin receptor activity(GO:0004994) |
0.0 | 0.3 | GO:0070063 | RNA polymerase binding(GO:0070063) |
0.0 | 0.0 | GO:0009374 | biotin binding(GO:0009374) |
0.0 | 0.2 | GO:0004945 | angiotensin type II receptor activity(GO:0004945) |
0.0 | 0.2 | GO:0030544 | Hsp70 protein binding(GO:0030544) |
0.0 | 2.8 | GO:0017137 | Rab GTPase binding(GO:0017137) |
0.0 | 0.2 | GO:0031543 | peptidyl-proline dioxygenase activity(GO:0031543) |
0.0 | 0.1 | GO:0017089 | glycolipid transporter activity(GO:0017089) |
0.0 | 0.1 | GO:0008147 | structural constituent of bone(GO:0008147) |
0.0 | 0.1 | GO:0008384 | IkappaB kinase activity(GO:0008384) |
0.0 | 0.0 | GO:0051425 | PTB domain binding(GO:0051425) |
0.0 | 0.2 | GO:0001618 | virus receptor activity(GO:0001618) |
0.0 | 0.2 | GO:0005338 | nucleotide-sugar transmembrane transporter activity(GO:0005338) |
0.0 | 0.0 | GO:0031014 | troponin T binding(GO:0031014) |
0.0 | 0.1 | GO:0038132 | neuregulin binding(GO:0038132) |
0.0 | 0.0 | GO:0003696 | satellite DNA binding(GO:0003696) |
0.0 | 0.5 | GO:0005243 | gap junction channel activity(GO:0005243) |
0.0 | 0.1 | GO:0035259 | glucocorticoid receptor binding(GO:0035259) |
0.0 | 0.4 | GO:0004185 | serine-type carboxypeptidase activity(GO:0004185) |
0.0 | 0.1 | GO:0016715 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, reduced ascorbate as one donor, and incorporation of one atom of oxygen(GO:0016715) |
0.0 | 0.3 | GO:0042056 | chemoattractant activity(GO:0042056) |
0.0 | 0.2 | GO:0052850 | enoyl-[acyl-carrier-protein] reductase activity(GO:0016631) 2,3-dihydroxy-2,3-dihydro-phenylpropionate dehydrogenase activity(GO:0018498) cis-2,3-dihydrodiol DDT dehydrogenase activity(GO:0018499) trans-9R,10R-dihydrodiolphenanthrene dehydrogenase activity(GO:0018500) cis-chlorobenzene dihydrodiol dehydrogenase activity(GO:0018501) 2,5-dichloro-2,5-cyclohexadiene-1,4-diol dehydrogenase activity(GO:0018502) trans-1,2-dihydrodiolphenanthrene dehydrogenase activity(GO:0018503) 3,4-dihydroxy-3,4-dihydrofluorene dehydrogenase activity(GO:0034790) benzo(a)pyrene-trans-11,12-dihydrodiol dehydrogenase activity(GO:0034805) benzo(a)pyrene-cis-4,5-dihydrodiol dehydrogenase activity(GO:0034809) citronellyl-CoA dehydrogenase activity(GO:0034824) menthone dehydrogenase activity(GO:0034838) phthalate 3,4-cis-dihydrodiol dehydrogenase activity(GO:0034912) cinnamate reductase activity(GO:0043786) NADPH-dependent curcumin reductase activity(GO:0052849) NADPH-dependent dihydrocurcumin reductase activity(GO:0052850) |
0.0 | 0.0 | GO:0005502 | 11-cis retinal binding(GO:0005502) |
0.0 | 0.2 | GO:0070016 | armadillo repeat domain binding(GO:0070016) |
0.0 | 16.4 | GO:0003700 | nucleic acid binding transcription factor activity(GO:0001071) transcription factor activity, sequence-specific DNA binding(GO:0003700) |
0.0 | 0.5 | GO:0003755 | peptidyl-prolyl cis-trans isomerase activity(GO:0003755) |
0.0 | 0.0 | GO:1990226 | histone methyltransferase binding(GO:1990226) |
0.0 | 1.2 | GO:0004721 | phosphoprotein phosphatase activity(GO:0004721) |
0.0 | 0.1 | GO:0004814 | arginine-tRNA ligase activity(GO:0004814) |
0.0 | 0.0 | GO:0051021 | GDP-dissociation inhibitor binding(GO:0051021) |
0.0 | 1.2 | GO:0003682 | chromatin binding(GO:0003682) |
0.0 | 0.2 | GO:0008331 | high voltage-gated calcium channel activity(GO:0008331) |
0.0 | 0.1 | GO:0051185 | coenzyme transporter activity(GO:0051185) |
0.0 | 0.1 | GO:0048019 | receptor antagonist activity(GO:0048019) |
0.0 | 0.2 | GO:0004466 | long-chain-acyl-CoA dehydrogenase activity(GO:0004466) |
0.0 | 0.1 | GO:0004525 | ribonuclease III activity(GO:0004525) double-stranded RNA-specific ribonuclease activity(GO:0032296) |
0.0 | 0.0 | GO:0016426 | tRNA (adenine) methyltransferase activity(GO:0016426) tRNA (adenine-N1-)-methyltransferase activity(GO:0016429) |
0.0 | 0.4 | GO:0016684 | oxidoreductase activity, acting on peroxide as acceptor(GO:0016684) |
0.0 | 0.1 | GO:0015271 | outward rectifier potassium channel activity(GO:0015271) |
0.0 | 0.1 | GO:0019534 | toxin transporter activity(GO:0019534) |
0.0 | 0.1 | GO:0043262 | adenosine-diphosphatase activity(GO:0043262) |
0.0 | 0.1 | GO:0003976 | UDP-N-acetylglucosamine-lysosomal-enzyme N-acetylglucosaminephosphotransferase activity(GO:0003976) |
0.0 | 0.1 | GO:0022833 | mechanically-gated ion channel activity(GO:0008381) mechanically gated channel activity(GO:0022833) |
0.0 | 0.2 | GO:0008046 | axon guidance receptor activity(GO:0008046) |
0.0 | 0.1 | GO:0034596 | phosphatidylinositol phosphate 4-phosphatase activity(GO:0034596) |
0.0 | 1.2 | GO:0004702 | receptor signaling protein serine/threonine kinase activity(GO:0004702) |
0.0 | 0.1 | GO:0016615 | malate dehydrogenase activity(GO:0016615) |
0.0 | 0.4 | GO:0004198 | calcium-dependent cysteine-type endopeptidase activity(GO:0004198) |
0.0 | 1.6 | GO:0051015 | actin filament binding(GO:0051015) |
0.0 | 0.5 | GO:0005035 | tumor necrosis factor-activated receptor activity(GO:0005031) death receptor activity(GO:0005035) |
0.0 | 0.1 | GO:0008318 | protein prenyltransferase activity(GO:0008318) |
0.0 | 0.1 | GO:0038100 | nodal binding(GO:0038100) |
0.0 | 1.2 | GO:0032182 | ubiquitin-like protein binding(GO:0032182) |
0.0 | 1.8 | GO:0043492 | ATPase activity, coupled to movement of substances(GO:0043492) |
0.0 | 0.4 | GO:0017147 | Wnt-protein binding(GO:0017147) |
0.0 | 0.2 | GO:0043864 | protein-N-terminal asparagine amidohydrolase activity(GO:0008418) UDP-3-O-[3-hydroxymyristoyl] N-acetylglucosamine deacetylase activity(GO:0008759) iprodione amidohydrolase activity(GO:0018748) (3,5-dichlorophenylurea)acetate amidohydrolase activity(GO:0018749) 4'-(2-hydroxyisopropyl)phenylurea amidohydrolase activity(GO:0034571) didemethylisoproturon amidohydrolase activity(GO:0034573) N-isopropylacetanilide amidohydrolase activity(GO:0034576) N-cyclohexylformamide amidohydrolase activity(GO:0034781) isonicotinic acid hydrazide hydrolase activity(GO:0034876) cis-aconitamide amidase activity(GO:0034882) gamma-N-formylaminovinylacetate hydrolase activity(GO:0034885) N2-acetyl-L-lysine deacetylase activity(GO:0043747) O-succinylbenzoate synthase activity(GO:0043748) indoleacetamide hydrolase activity(GO:0043864) N-acetylcitrulline deacetylase activity(GO:0043909) N-acetylgalactosamine-6-phosphate deacetylase activity(GO:0047419) diacetylchitobiose deacetylase activity(GO:0052773) chitooligosaccharide deacetylase activity(GO:0052790) |
0.0 | 0.1 | GO:0070053 | thrombospondin receptor activity(GO:0070053) |
0.0 | 0.3 | GO:0045236 | CXCR chemokine receptor binding(GO:0045236) |
0.0 | 0.3 | GO:0000149 | SNARE binding(GO:0000149) |
0.0 | 0.6 | GO:0019888 | protein phosphatase regulator activity(GO:0019888) |
0.0 | 0.3 | GO:0015035 | protein disulfide oxidoreductase activity(GO:0015035) |
0.0 | 1.9 | GO:0008022 | protein C-terminus binding(GO:0008022) |
0.0 | 0.1 | GO:0004365 | glyceraldehyde-3-phosphate dehydrogenase (NAD+) (phosphorylating) activity(GO:0004365) glyceraldehyde-3-phosphate dehydrogenase (NAD(P)+) (phosphorylating) activity(GO:0043891) |
0.0 | 0.1 | GO:0016842 | amidine-lyase activity(GO:0016842) |
0.0 | 0.1 | GO:0015925 | galactosidase activity(GO:0015925) |
0.0 | 0.2 | GO:0016209 | antioxidant activity(GO:0016209) |
0.0 | 12.4 | GO:0003677 | DNA binding(GO:0003677) |
0.0 | 0.0 | GO:0015928 | fucosidase activity(GO:0015928) |
0.0 | 0.1 | GO:0004946 | bombesin receptor activity(GO:0004946) |
0.0 | 0.0 | GO:0004772 | sterol O-acyltransferase activity(GO:0004772) |
0.0 | 0.4 | GO:0005540 | hyaluronic acid binding(GO:0005540) |
0.0 | 0.1 | GO:0004969 | histamine receptor activity(GO:0004969) |
0.0 | 0.0 | GO:0015197 | peptide transporter activity(GO:0015197) |
0.0 | 0.1 | GO:0036402 | proteasome-activating ATPase activity(GO:0036402) |
0.0 | 0.1 | GO:0004016 | adenylate cyclase activity(GO:0004016) |
0.0 | 0.3 | GO:0016594 | glycine binding(GO:0016594) |
0.0 | 0.1 | GO:0016830 | carbon-carbon lyase activity(GO:0016830) |
0.0 | 0.2 | GO:0005247 | voltage-gated chloride channel activity(GO:0005247) |
0.0 | 0.2 | GO:0070513 | death domain binding(GO:0070513) |
0.0 | 0.0 | GO:0070990 | snRNP binding(GO:0070990) |
0.0 | 0.4 | GO:0005212 | structural constituent of eye lens(GO:0005212) |
0.0 | 0.1 | GO:0047760 | butyrate-CoA ligase activity(GO:0047760) |
0.0 | 0.1 | GO:0019976 | interleukin-2 binding(GO:0019976) |
0.0 | 0.0 | GO:0051870 | methotrexate binding(GO:0051870) |
0.0 | 0.4 | GO:0070003 | threonine-type endopeptidase activity(GO:0004298) threonine-type peptidase activity(GO:0070003) |
0.0 | 0.1 | GO:0004449 | isocitrate dehydrogenase (NAD+) activity(GO:0004449) |
0.0 | 0.0 | GO:0042731 | PH domain binding(GO:0042731) |
0.0 | 2.3 | GO:0046982 | protein heterodimerization activity(GO:0046982) |
0.0 | 0.0 | GO:0030580 | C-methyltransferase activity(GO:0008169) 2-polyprenyl-6-methoxy-1,4-benzoquinone methyltransferase activity(GO:0008425) quinone cofactor methyltransferase activity(GO:0030580) |
0.0 | 0.3 | GO:0031072 | heat shock protein binding(GO:0031072) |
0.0 | 0.1 | GO:0005375 | copper ion transmembrane transporter activity(GO:0005375) |
0.0 | 0.1 | GO:0019166 | trans-2-enoyl-CoA reductase (NADPH) activity(GO:0019166) |
0.0 | 0.1 | GO:0051018 | protein kinase A binding(GO:0051018) |
0.0 | 0.1 | GO:0017091 | AU-rich element binding(GO:0017091) |
0.0 | 0.0 | GO:0008502 | melatonin receptor activity(GO:0008502) |
0.0 | 0.0 | GO:0031893 | vasopressin receptor binding(GO:0031893) |
0.0 | 0.3 | GO:0005227 | calcium activated cation channel activity(GO:0005227) |
0.0 | 0.1 | GO:0003993 | acid phosphatase activity(GO:0003993) |
0.0 | 0.0 | GO:0070915 | lysophosphatidic acid receptor activity(GO:0070915) |
0.0 | 0.2 | GO:0004181 | metallocarboxypeptidase activity(GO:0004181) |
0.0 | 0.0 | GO:0089720 | caspase binding(GO:0089720) |
0.0 | 0.0 | GO:0015927 | trehalase activity(GO:0015927) |
0.0 | 2.5 | GO:0017171 | serine hydrolase activity(GO:0017171) |
0.0 | 0.0 | GO:0070883 | pre-miRNA binding(GO:0070883) |
0.0 | 0.0 | GO:0005131 | growth hormone receptor binding(GO:0005131) |
0.0 | 0.1 | GO:0051378 | serotonin binding(GO:0051378) |
0.0 | 0.0 | GO:0019855 | calcium channel inhibitor activity(GO:0019855) |
0.0 | 0.0 | GO:0046923 | ER retention sequence binding(GO:0046923) |
0.0 | 0.0 | GO:0070087 | chromo shadow domain binding(GO:0070087) |
0.0 | 0.2 | GO:0005251 | delayed rectifier potassium channel activity(GO:0005251) |
0.0 | 0.1 | GO:0017134 | fibroblast growth factor binding(GO:0017134) |
0.0 | 0.0 | GO:0048531 | beta-1,3-galactosyltransferase activity(GO:0048531) |
0.0 | 0.0 | GO:0019767 | IgE receptor activity(GO:0019767) |
0.0 | 0.1 | GO:0005522 | profilin binding(GO:0005522) |
0.0 | 0.0 | GO:0070191 | methionine-R-sulfoxide reductase activity(GO:0070191) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.5 | 8.2 | PID ERBB NETWORK PATHWAY | ErbB receptor signaling network |
0.5 | 4.5 | PID P38 GAMMA DELTA PATHWAY | Signaling mediated by p38-gamma and p38-delta |
0.3 | 1.0 | SA CASPASE CASCADE | Apoptosis is mediated by caspases, cysteine proteases arranged in a proteolytic cascade. |
0.3 | 1.6 | PID ANGIOPOIETIN RECEPTOR PATHWAY | Angiopoietin receptor Tie2-mediated signaling |
0.3 | 1.5 | PID FAK PATHWAY | Signaling events mediated by focal adhesion kinase |
0.3 | 7.6 | PID RXR VDR PATHWAY | RXR and RAR heterodimerization with other nuclear receptor |
0.3 | 9.1 | ST ADRENERGIC | Adrenergic Pathway |
0.3 | 0.3 | PID P38 ALPHA BETA PATHWAY | Regulation of p38-alpha and p38-beta |
0.3 | 0.3 | PID TCPTP PATHWAY | Signaling events mediated by TCPTP |
0.3 | 2.3 | SA PTEN PATHWAY | PTEN is a tumor suppressor that dephosphorylates the lipid messenger phosphatidylinositol triphosphate. |
0.3 | 6.8 | PID ERBB1 RECEPTOR PROXIMAL PATHWAY | EGF receptor (ErbB1) signaling pathway |
0.2 | 2.2 | ST G ALPHA I PATHWAY | G alpha i Pathway |
0.2 | 2.1 | PID ANTHRAX PATHWAY | Cellular roles of Anthrax toxin |
0.2 | 5.3 | PID ALK1 PATHWAY | ALK1 signaling events |
0.2 | 5.5 | PID MYC PATHWAY | C-MYC pathway |
0.2 | 2.6 | PID HIF1A PATHWAY | Hypoxic and oxygen homeostasis regulation of HIF-1-alpha |
0.2 | 1.3 | PID NETRIN PATHWAY | Netrin-mediated signaling events |
0.2 | 4.9 | PID ERBB1 INTERNALIZATION PATHWAY | Internalization of ErbB1 |
0.2 | 1.5 | ST G ALPHA S PATHWAY | G alpha s Pathway |
0.2 | 1.8 | PID HIF2PATHWAY | HIF-2-alpha transcription factor network |
0.2 | 7.6 | PID SHP2 PATHWAY | SHP2 signaling |
0.2 | 7.0 | PID HNF3A PATHWAY | FOXA1 transcription factor network |
0.2 | 1.8 | SA REG CASCADE OF CYCLIN EXPR | Expression of cyclins regulates progression through the cell cycle by activating cyclin-dependent kinases. |
0.2 | 3.8 | PID FRA PATHWAY | Validated transcriptional targets of AP1 family members Fra1 and Fra2 |
0.2 | 3.1 | PID HDAC CLASSIII PATHWAY | Signaling events mediated by HDAC Class III |
0.2 | 6.0 | PID DELTA NP63 PATHWAY | Validated transcriptional targets of deltaNp63 isoforms |
0.2 | 1.1 | SA G2 AND M PHASES | Cdc25 activates the cdc2/cyclin B complex to induce the G2/M transition. |
0.2 | 2.5 | ST TUMOR NECROSIS FACTOR PATHWAY | Tumor Necrosis Factor Pathway. |
0.2 | 1.6 | SIG INSULIN RECEPTOR PATHWAY IN CARDIAC MYOCYTES | Genes related to the insulin receptor pathway |
0.2 | 2.0 | PID CIRCADIAN PATHWAY | Circadian rhythm pathway |
0.2 | 0.6 | PID RAC1 REG PATHWAY | Regulation of RAC1 activity |
0.2 | 5.5 | PID CERAMIDE PATHWAY | Ceramide signaling pathway |
0.2 | 2.9 | PID TCR CALCIUM PATHWAY | Calcium signaling in the CD4+ TCR pathway |
0.2 | 3.7 | PID ATM PATHWAY | ATM pathway |
0.1 | 4.6 | PID ECADHERIN STABILIZATION PATHWAY | Stabilization and expansion of the E-cadherin adherens junction |
0.1 | 0.6 | PID INTEGRIN3 PATHWAY | Beta3 integrin cell surface interactions |
0.1 | 4.8 | NABA PROTEOGLYCANS | Genes encoding proteoglycans |
0.1 | 5.2 | PID HEDGEHOG GLI PATHWAY | Hedgehog signaling events mediated by Gli proteins |
0.1 | 2.9 | PID INSULIN PATHWAY | Insulin Pathway |
0.1 | 0.1 | SIG PIP3 SIGNALING IN B LYMPHOCYTES | Genes related to PIP3 signaling in B lymphocytes |
0.1 | 2.1 | ST PHOSPHOINOSITIDE 3 KINASE PATHWAY | PI3K Pathway |
0.1 | 0.1 | PID ERBB4 PATHWAY | ErbB4 signaling events |
0.1 | 1.9 | PID BARD1 PATHWAY | BARD1 signaling events |
0.1 | 1.2 | PID DNA PK PATHWAY | DNA-PK pathway in nonhomologous end joining |
0.1 | 1.7 | PID NCADHERIN PATHWAY | N-cadherin signaling events |
0.1 | 2.6 | PID LIS1 PATHWAY | Lissencephaly gene (LIS1) in neuronal migration and development |
0.1 | 0.4 | PID S1P S1P4 PATHWAY | S1P4 pathway |
0.1 | 1.4 | PID SMAD2 3PATHWAY | Regulation of cytoplasmic and nuclear SMAD2/3 signaling |
0.1 | 4.2 | PID NOTCH PATHWAY | Notch signaling pathway |
0.1 | 0.6 | ST MYOCYTE AD PATHWAY | Myocyte Adrenergic Pathway is a specific case of the generalized Adrenergic Pathway. |
0.1 | 2.9 | PID CASPASE PATHWAY | Caspase cascade in apoptosis |
0.1 | 2.0 | PID E2F PATHWAY | E2F transcription factor network |
0.1 | 0.8 | PID ARF6 DOWNSTREAM PATHWAY | Arf6 downstream pathway |
0.1 | 3.1 | PID AURORA B PATHWAY | Aurora B signaling |
0.1 | 1.3 | PID IFNG PATHWAY | IFN-gamma pathway |
0.1 | 0.6 | PID PDGFRA PATHWAY | PDGFR-alpha signaling pathway |
0.1 | 1.9 | PID TGFBR PATHWAY | TGF-beta receptor signaling |
0.1 | 1.1 | ST DIFFERENTIATION PATHWAY IN PC12 CELLS | Differentiation Pathway in PC12 Cells; this is a specific case of PAC1 Receptor Pathway. |
0.1 | 1.4 | PID THROMBIN PAR1 PATHWAY | PAR1-mediated thrombin signaling events |
0.1 | 3.1 | PID AR PATHWAY | Coregulation of Androgen receptor activity |
0.1 | 0.9 | PID PRL SIGNALING EVENTS PATHWAY | Signaling events mediated by PRL |
0.1 | 1.2 | PID RHOA PATHWAY | RhoA signaling pathway |
0.1 | 4.1 | PID MYC ACTIV PATHWAY | Validated targets of C-MYC transcriptional activation |
0.1 | 0.2 | SA G1 AND S PHASES | Cdk2, 4, and 6 bind cyclin D in G1, while cdk2/cyclin E promotes the G1/S transition. |
0.1 | 0.7 | PID CD8 TCR DOWNSTREAM PATHWAY | Downstream signaling in naïve CD8+ T cells |
0.1 | 1.2 | PID WNT NONCANONICAL PATHWAY | Noncanonical Wnt signaling pathway |
0.1 | 1.4 | SIG REGULATION OF THE ACTIN CYTOSKELETON BY RHO GTPASES | Genes related to regulation of the actin cytoskeleton |
0.1 | 0.5 | PID S1P META PATHWAY | Sphingosine 1-phosphate (S1P) pathway |
0.1 | 0.6 | PID INTEGRIN4 PATHWAY | Alpha6 beta4 integrin-ligand interactions |
0.1 | 0.3 | PID TRAIL PATHWAY | TRAIL signaling pathway |
0.1 | 0.1 | PID GLYPICAN 1PATHWAY | Glypican 1 network |
0.1 | 0.7 | PID INTEGRIN A9B1 PATHWAY | Alpha9 beta1 integrin signaling events |
0.1 | 0.6 | PID HEDGEHOG 2PATHWAY | Signaling events mediated by the Hedgehog family |
0.1 | 0.2 | PID CD40 PATHWAY | CD40/CD40L signaling |
0.1 | 0.5 | SIG CD40PATHWAYMAP | Genes related to CD40 signaling |
0.1 | 0.4 | PID FCER1 PATHWAY | Fc-epsilon receptor I signaling in mast cells |
0.1 | 0.4 | PID UPA UPAR PATHWAY | Urokinase-type plasminogen activator (uPA) and uPAR-mediated signaling |
0.1 | 0.2 | PID S1P S1P3 PATHWAY | S1P3 pathway |
0.1 | 0.3 | PID SYNDECAN 4 PATHWAY | Syndecan-4-mediated signaling events |
0.1 | 7.1 | NABA ECM AFFILIATED | Genes encoding proteins affiliated structurally or functionally to extracellular matrix proteins |
0.1 | 0.6 | PID AVB3 INTEGRIN PATHWAY | Integrins in angiogenesis |
0.1 | 0.1 | ST JAK STAT PATHWAY | Jak-STAT Pathway |
0.1 | 0.1 | PID ECADHERIN KERATINOCYTE PATHWAY | E-cadherin signaling in keratinocytes |
0.1 | 1.5 | PID HNF3B PATHWAY | FOXA2 and FOXA3 transcription factor networks |
0.1 | 0.3 | PID TRKR PATHWAY | Neurotrophic factor-mediated Trk receptor signaling |
0.1 | 0.4 | ST WNT CA2 CYCLIC GMP PATHWAY | Wnt/Ca2+/cyclic GMP signaling. |
0.0 | 0.3 | PID PI3KCI PATHWAY | Class I PI3K signaling events |
0.0 | 1.0 | PID P53 REGULATION PATHWAY | p53 pathway |
0.0 | 0.1 | PID ER NONGENOMIC PATHWAY | Plasma membrane estrogen receptor signaling |
0.0 | 0.2 | PID TNF PATHWAY | TNF receptor signaling pathway |
0.0 | 0.4 | PID ATF2 PATHWAY | ATF-2 transcription factor network |
0.0 | 1.5 | PID HIF1 TFPATHWAY | HIF-1-alpha transcription factor network |
0.0 | 0.5 | PID INTEGRIN A4B1 PATHWAY | Alpha4 beta1 integrin signaling events |
0.0 | 0.1 | PID SYNDECAN 3 PATHWAY | Syndecan-3-mediated signaling events |
0.0 | 0.7 | PID TAP63 PATHWAY | Validated transcriptional targets of TAp63 isoforms |
0.0 | 0.0 | SIG BCR SIGNALING PATHWAY | Members of the BCR signaling pathway |
0.0 | 0.2 | PID NEPHRIN NEPH1 PATHWAY | Nephrin/Neph1 signaling in the kidney podocyte |
0.0 | 0.5 | PID NFAT TFPATHWAY | Calcineurin-regulated NFAT-dependent transcription in lymphocytes |
0.0 | 1.0 | PID LKB1 PATHWAY | LKB1 signaling events |
0.0 | 0.7 | ST JNK MAPK PATHWAY | JNK MAPK Pathway |
0.0 | 0.2 | PID PI3K PLC TRK PATHWAY | Trk receptor signaling mediated by PI3K and PLC-gamma |
0.0 | 0.9 | PID P73PATHWAY | p73 transcription factor network |
0.0 | 0.9 | PID REG GR PATHWAY | Glucocorticoid receptor regulatory network |
0.0 | 0.4 | PID ARF6 PATHWAY | Arf6 signaling events |
0.0 | 0.2 | PID CXCR4 PATHWAY | CXCR4-mediated signaling events |
0.0 | 0.3 | PID FOXO PATHWAY | FoxO family signaling |
0.0 | 0.5 | PID ARF 3PATHWAY | Arf1 pathway |
0.0 | 0.5 | PID RB 1PATHWAY | Regulation of retinoblastoma protein |
0.0 | 0.4 | PID IL27 PATHWAY | IL27-mediated signaling events |
0.0 | 0.2 | PID P38 MK2 PATHWAY | p38 signaling mediated by MAPKAP kinases |
0.0 | 0.8 | PID SYNDECAN 1 PATHWAY | Syndecan-1-mediated signaling events |
0.0 | 0.5 | PID BCR 5PATHWAY | BCR signaling pathway |
0.0 | 0.0 | ST INTERFERON GAMMA PATHWAY | Interferon gamma pathway. |
0.0 | 2.9 | NABA ECM GLYCOPROTEINS | Genes encoding structural ECM glycoproteins |
0.0 | 0.3 | PID KIT PATHWAY | Signaling events mediated by Stem cell factor receptor (c-Kit) |
0.0 | 0.5 | PID ERA GENOMIC PATHWAY | Validated nuclear estrogen receptor alpha network |
0.0 | 0.3 | PID FANCONI PATHWAY | Fanconi anemia pathway |
0.0 | 0.0 | SA FAS SIGNALING | The TNF-type receptor Fas induces apoptosis on ligand binding. |
0.0 | 0.1 | ST ERK1 ERK2 MAPK PATHWAY | ERK1/ERK2 MAPK Pathway |
0.0 | 0.0 | PID ECADHERIN NASCENT AJ PATHWAY | E-cadherin signaling in the nascent adherens junction |
0.0 | 0.0 | PID BETA CATENIN DEG PATHWAY | Degradation of beta catenin |
0.0 | 0.1 | SIG CHEMOTAXIS | Genes related to chemotaxis |
0.0 | 0.2 | PID CDC42 PATHWAY | CDC42 signaling events |
0.0 | 0.0 | PID ERB GENOMIC PATHWAY | Validated nuclear estrogen receptor beta network |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.7 | 7.2 | REACTOME ALPHA LINOLENIC ACID ALA METABOLISM | Genes involved in alpha-linolenic acid (ALA) metabolism |
0.6 | 5.8 | REACTOME SYNTHESIS OF PE | Genes involved in Synthesis of PE |
0.6 | 0.6 | REACTOME VIF MEDIATED DEGRADATION OF APOBEC3G | Genes involved in Vif-mediated degradation of APOBEC3G |
0.6 | 9.4 | REACTOME SIGNALING BY CONSTITUTIVELY ACTIVE EGFR | Genes involved in Signaling by constitutively active EGFR |
0.5 | 2.2 | REACTOME NEGATIVE REGULATION OF THE PI3K AKT NETWORK | Genes involved in Negative regulation of the PI3K/AKT network |
0.5 | 7.0 | REACTOME REGULATION OF AMPK ACTIVITY VIA LKB1 | Genes involved in Regulation of AMPK activity via LKB1 |
0.4 | 2.6 | REACTOME INHIBITION OF REPLICATION INITIATION OF DAMAGED DNA BY RB1 E2F1 | Genes involved in Inhibition of replication initiation of damaged DNA by RB1/E2F1 |
0.4 | 6.4 | REACTOME SYNTHESIS OF BILE ACIDS AND BILE SALTS | Genes involved in Synthesis of bile acids and bile salts |
0.4 | 4.7 | REACTOME ASSOCIATION OF LICENSING FACTORS WITH THE PRE REPLICATIVE COMPLEX | Genes involved in Association of licensing factors with the pre-replicative complex |
0.4 | 3.5 | REACTOME TRYPTOPHAN CATABOLISM | Genes involved in Tryptophan catabolism |
0.4 | 9.7 | REACTOME MYOGENESIS | Genes involved in Myogenesis |
0.3 | 11.5 | REACTOME BMAL1 CLOCK NPAS2 ACTIVATES CIRCADIAN EXPRESSION | Genes involved in BMAL1:CLOCK/NPAS2 Activates Circadian Expression |
0.3 | 4.2 | REACTOME DOWNREGULATION OF SMAD2 3 SMAD4 TRANSCRIPTIONAL ACTIVITY | Genes involved in Downregulation of SMAD2/3:SMAD4 transcriptional activity |
0.3 | 2.9 | REACTOME SIGNAL REGULATORY PROTEIN SIRP FAMILY INTERACTIONS | Genes involved in Signal regulatory protein (SIRP) family interactions |
0.3 | 1.9 | REACTOME ETHANOL OXIDATION | Genes involved in Ethanol oxidation |
0.3 | 4.7 | REACTOME DARPP 32 EVENTS | Genes involved in DARPP-32 events |
0.3 | 5.8 | REACTOME DOWNREGULATION OF TGF BETA RECEPTOR SIGNALING | Genes involved in Downregulation of TGF-beta receptor signaling |
0.3 | 4.5 | REACTOME ANTIGEN PRESENTATION FOLDING ASSEMBLY AND PEPTIDE LOADING OF CLASS I MHC | Genes involved in Antigen Presentation: Folding, assembly and peptide loading of class I MHC |
0.3 | 2.7 | REACTOME TIE2 SIGNALING | Genes involved in Tie2 Signaling |
0.3 | 7.5 | REACTOME SIGNALING BY ROBO RECEPTOR | Genes involved in Signaling by Robo receptor |
0.3 | 2.8 | REACTOME ANDROGEN BIOSYNTHESIS | Genes involved in Androgen biosynthesis |
0.3 | 4.3 | REACTOME FATTY ACYL COA BIOSYNTHESIS | Genes involved in Fatty Acyl-CoA Biosynthesis |
0.3 | 5.3 | REACTOME REGULATION OF GENE EXPRESSION IN BETA CELLS | Genes involved in Regulation of gene expression in beta cells |
0.3 | 6.8 | REACTOME GLUCONEOGENESIS | Genes involved in Gluconeogenesis |
0.3 | 7.8 | REACTOME PHASE1 FUNCTIONALIZATION OF COMPOUNDS | Genes involved in Phase 1 - Functionalization of compounds |
0.3 | 2.9 | REACTOME PEROXISOMAL LIPID METABOLISM | Genes involved in Peroxisomal lipid metabolism |
0.3 | 0.3 | REACTOME MITOTIC M M G1 PHASES | Genes involved in Mitotic M-M/G1 phases |
0.3 | 3.4 | REACTOME REGULATION OF HYPOXIA INDUCIBLE FACTOR HIF BY OXYGEN | Genes involved in Regulation of Hypoxia-inducible Factor (HIF) by Oxygen |
0.3 | 3.9 | REACTOME RAP1 SIGNALLING | Genes involved in Rap1 signalling |
0.3 | 3.6 | REACTOME CTNNB1 PHOSPHORYLATION CASCADE | Genes involved in Beta-catenin phosphorylation cascade |
0.3 | 3.6 | REACTOME CYCLIN A B1 ASSOCIATED EVENTS DURING G2 M TRANSITION | Genes involved in Cyclin A/B1 associated events during G2/M transition |
0.2 | 2.7 | REACTOME HIGHLY CALCIUM PERMEABLE POSTSYNAPTIC NICOTINIC ACETYLCHOLINE RECEPTORS | Genes involved in Highly calcium permeable postsynaptic nicotinic acetylcholine receptors |
0.2 | 2.8 | REACTOME PURINE SALVAGE | Genes involved in Purine salvage |
0.2 | 3.0 | REACTOME PKB MEDIATED EVENTS | Genes involved in PKB-mediated events |
0.2 | 0.2 | REACTOME TRANSLOCATION OF ZAP 70 TO IMMUNOLOGICAL SYNAPSE | Genes involved in Translocation of ZAP-70 to Immunological synapse |
0.2 | 1.9 | REACTOME PURINE CATABOLISM | Genes involved in Purine catabolism |
0.2 | 5.5 | REACTOME MEIOTIC RECOMBINATION | Genes involved in Meiotic Recombination |
0.2 | 4.2 | REACTOME INTERACTION BETWEEN L1 AND ANKYRINS | Genes involved in Interaction between L1 and Ankyrins |
0.2 | 3.6 | REACTOME RNA POL III TRANSCRIPTION INITIATION FROM TYPE 2 PROMOTER | Genes involved in RNA Polymerase III Transcription Initiation From Type 2 Promoter |
0.2 | 1.3 | REACTOME MEMBRANE BINDING AND TARGETTING OF GAG PROTEINS | Genes involved in Membrane binding and targetting of GAG proteins |
0.2 | 1.5 | REACTOME TGF BETA RECEPTOR SIGNALING IN EMT EPITHELIAL TO MESENCHYMAL TRANSITION | Genes involved in TGF-beta receptor signaling in EMT (epithelial to mesenchymal transition) |
0.2 | 3.0 | REACTOME RNA POL I TRANSCRIPTION TERMINATION | Genes involved in RNA Polymerase I Transcription Termination |
0.2 | 8.7 | REACTOME LOSS OF NLP FROM MITOTIC CENTROSOMES | Genes involved in Loss of Nlp from mitotic centrosomes |
0.2 | 2.1 | REACTOME POST CHAPERONIN TUBULIN FOLDING PATHWAY | Genes involved in Post-chaperonin tubulin folding pathway |
0.2 | 1.6 | REACTOME CYCLIN E ASSOCIATED EVENTS DURING G1 S TRANSITION | Genes involved in Cyclin E associated events during G1/S transition |
0.2 | 0.4 | REACTOME RNA POL III TRANSCRIPTION TERMINATION | Genes involved in RNA Polymerase III Transcription Termination |
0.2 | 0.7 | REACTOME RNA POL I TRANSCRIPTION INITIATION | Genes involved in RNA Polymerase I Transcription Initiation |
0.2 | 1.8 | REACTOME BASE FREE SUGAR PHOSPHATE REMOVAL VIA THE SINGLE NUCLEOTIDE REPLACEMENT PATHWAY | Genes involved in Base-free sugar-phosphate removal via the single-nucleotide replacement pathway |
0.2 | 5.7 | REACTOME IRON UPTAKE AND TRANSPORT | Genes involved in Iron uptake and transport |
0.2 | 1.9 | REACTOME SIGNALING BY ACTIVATED POINT MUTANTS OF FGFR1 | Genes involved in Signaling by activated point mutants of FGFR1 |
0.2 | 1.7 | REACTOME VITAMIN B5 PANTOTHENATE METABOLISM | Genes involved in Vitamin B5 (pantothenate) metabolism |
0.2 | 2.2 | REACTOME SMAD2 SMAD3 SMAD4 HETEROTRIMER REGULATES TRANSCRIPTION | Genes involved in SMAD2/SMAD3:SMAD4 heterotrimer regulates transcription |
0.2 | 2.0 | REACTOME SIGNALING BY NOTCH2 | Genes involved in Signaling by NOTCH2 |
0.2 | 2.6 | REACTOME BRANCHED CHAIN AMINO ACID CATABOLISM | Genes involved in Branched-chain amino acid catabolism |
0.2 | 0.2 | REACTOME P53 DEPENDENT G1 DNA DAMAGE RESPONSE | Genes involved in p53-Dependent G1 DNA Damage Response |
0.2 | 1.0 | REACTOME GLYCOLYSIS | Genes involved in Glycolysis |
0.2 | 2.7 | REACTOME CITRIC ACID CYCLE TCA CYCLE | Genes involved in Citric acid cycle (TCA cycle) |
0.2 | 0.6 | REACTOME ER PHAGOSOME PATHWAY | Genes involved in ER-Phagosome pathway |
0.2 | 2.4 | REACTOME ABCA TRANSPORTERS IN LIPID HOMEOSTASIS | Genes involved in ABCA transporters in lipid homeostasis |
0.2 | 1.6 | REACTOME REGULATION OF BETA CELL DEVELOPMENT | Genes involved in Regulation of beta-cell development |
0.2 | 5.2 | REACTOME ION TRANSPORT BY P TYPE ATPASES | Genes involved in Ion transport by P-type ATPases |
0.2 | 1.5 | REACTOME ROLE OF DCC IN REGULATING APOPTOSIS | Genes involved in Role of DCC in regulating apoptosis |
0.2 | 22.9 | REACTOME METABOLISM OF AMINO ACIDS AND DERIVATIVES | Genes involved in Metabolism of amino acids and derivatives |
0.2 | 0.9 | REACTOME THROMBIN SIGNALLING THROUGH PROTEINASE ACTIVATED RECEPTORS PARS | Genes involved in Thrombin signalling through proteinase activated receptors (PARs) |
0.1 | 1.6 | REACTOME KERATAN SULFATE DEGRADATION | Genes involved in Keratan sulfate degradation |
0.1 | 3.6 | REACTOME COMPLEMENT CASCADE | Genes involved in Complement cascade |
0.1 | 0.6 | REACTOME PD1 SIGNALING | Genes involved in PD-1 signaling |
0.1 | 1.9 | REACTOME MITOCHONDRIAL FATTY ACID BETA OXIDATION | Genes involved in Mitochondrial Fatty Acid Beta-Oxidation |
0.1 | 1.1 | REACTOME NEPHRIN INTERACTIONS | Genes involved in Nephrin interactions |
0.1 | 4.6 | REACTOME MRNA 3 END PROCESSING | Genes involved in mRNA 3'-end processing |
0.1 | 1.0 | REACTOME SHC1 EVENTS IN ERBB4 SIGNALING | Genes involved in SHC1 events in ERBB4 signaling |
0.1 | 0.1 | REACTOME PECAM1 INTERACTIONS | Genes involved in PECAM1 interactions |
0.1 | 1.5 | REACTOME ANTIGEN PROCESSING CROSS PRESENTATION | Genes involved in Antigen processing-Cross presentation |
0.1 | 0.3 | REACTOME P53 INDEPENDENT G1 S DNA DAMAGE CHECKPOINT | Genes involved in p53-Independent G1/S DNA damage checkpoint |
0.1 | 1.2 | REACTOME IKK COMPLEX RECRUITMENT MEDIATED BY RIP1 | Genes involved in IKK complex recruitment mediated by RIP1 |
0.1 | 0.9 | REACTOME G1 S SPECIFIC TRANSCRIPTION | Genes involved in G1/S-Specific Transcription |
0.1 | 1.4 | REACTOME SYNTHESIS OF PC | Genes involved in Synthesis of PC |
0.1 | 0.6 | REACTOME IL 6 SIGNALING | Genes involved in Interleukin-6 signaling |
0.1 | 7.0 | REACTOME ANTIVIRAL MECHANISM BY IFN STIMULATED GENES | Genes involved in Antiviral mechanism by IFN-stimulated genes |
0.1 | 1.3 | REACTOME EXTRINSIC PATHWAY FOR APOPTOSIS | Genes involved in Extrinsic Pathway for Apoptosis |
0.1 | 0.6 | REACTOME DESTABILIZATION OF MRNA BY AUF1 HNRNP D0 | Genes involved in Destabilization of mRNA by AUF1 (hnRNP D0) |
0.1 | 0.7 | REACTOME SEMA3A PLEXIN REPULSION SIGNALING BY INHIBITING INTEGRIN ADHESION | Genes involved in SEMA3A-Plexin repulsion signaling by inhibiting Integrin adhesion |
0.1 | 2.4 | REACTOME SMOOTH MUSCLE CONTRACTION | Genes involved in Smooth Muscle Contraction |
0.1 | 1.7 | REACTOME SYNTHESIS OF SUBSTRATES IN N GLYCAN BIOSYTHESIS | Genes involved in Synthesis of substrates in N-glycan biosythesis |
0.1 | 1.2 | REACTOME REGULATION OF INSULIN SECRETION BY ACETYLCHOLINE | Genes involved in Regulation of Insulin Secretion by Acetylcholine |
0.1 | 1.3 | REACTOME PROLONGED ERK ACTIVATION EVENTS | Genes involved in Prolonged ERK activation events |
0.1 | 0.2 | REACTOME JNK C JUN KINASES PHOSPHORYLATION AND ACTIVATION MEDIATED BY ACTIVATED HUMAN TAK1 | Genes involved in JNK (c-Jun kinases) phosphorylation and activation mediated by activated human TAK1 |
0.1 | 2.2 | REACTOME DEPOSITION OF NEW CENPA CONTAINING NUCLEOSOMES AT THE CENTROMERE | Genes involved in Deposition of New CENPA-containing Nucleosomes at the Centromere |
0.1 | 4.3 | REACTOME NUCLEAR RECEPTOR TRANSCRIPTION PATHWAY | Genes involved in Nuclear Receptor transcription pathway |
0.1 | 1.9 | REACTOME ENDOSOMAL SORTING COMPLEX REQUIRED FOR TRANSPORT ESCRT | Genes involved in Endosomal Sorting Complex Required For Transport (ESCRT) |
0.1 | 0.9 | REACTOME THE ACTIVATION OF ARYLSULFATASES | Genes involved in The activation of arylsulfatases |
0.1 | 0.2 | REACTOME FGFR4 LIGAND BINDING AND ACTIVATION | Genes involved in FGFR4 ligand binding and activation |
0.1 | 0.5 | REACTOME ACTIVATED AMPK STIMULATES FATTY ACID OXIDATION IN MUSCLE | Genes involved in Activated AMPK stimulates fatty-acid oxidation in muscle |
0.1 | 1.6 | REACTOME TRIGLYCERIDE BIOSYNTHESIS | Genes involved in Triglyceride Biosynthesis |
0.1 | 2.7 | REACTOME ASSOCIATION OF TRIC CCT WITH TARGET PROTEINS DURING BIOSYNTHESIS | Genes involved in Association of TriC/CCT with target proteins during biosynthesis |
0.1 | 3.5 | REACTOME ACTIVATION OF CHAPERONE GENES BY XBP1S | Genes involved in Activation of Chaperone Genes by XBP1(S) |
0.1 | 4.0 | REACTOME MITOCHONDRIAL PROTEIN IMPORT | Genes involved in Mitochondrial Protein Import |
0.1 | 0.1 | REACTOME P75NTR RECRUITS SIGNALLING COMPLEXES | Genes involved in p75NTR recruits signalling complexes |
0.1 | 5.8 | REACTOME RESPIRATORY ELECTRON TRANSPORT | Genes involved in Respiratory electron transport |
0.1 | 1.1 | REACTOME MRNA DECAY BY 3 TO 5 EXORIBONUCLEASE | Genes involved in mRNA Decay by 3' to 5' Exoribonuclease |
0.1 | 1.1 | REACTOME P2Y RECEPTORS | Genes involved in P2Y receptors |
0.1 | 2.2 | REACTOME STRIATED MUSCLE CONTRACTION | Genes involved in Striated Muscle Contraction |
0.1 | 0.9 | REACTOME TRAFFICKING AND PROCESSING OF ENDOSOMAL TLR | Genes involved in Trafficking and processing of endosomal TLR |
0.1 | 0.6 | REACTOME ACTIVATION OF THE AP1 FAMILY OF TRANSCRIPTION FACTORS | Genes involved in Activation of the AP-1 family of transcription factors |
0.1 | 0.4 | REACTOME DOWNREGULATION OF ERBB2 ERBB3 SIGNALING | Genes involved in Downregulation of ERBB2:ERBB3 signaling |
0.1 | 1.7 | REACTOME GLUTATHIONE CONJUGATION | Genes involved in Glutathione conjugation |
0.1 | 2.2 | REACTOME TRANSPORT TO THE GOLGI AND SUBSEQUENT MODIFICATION | Genes involved in Transport to the Golgi and subsequent modification |
0.1 | 0.8 | REACTOME STEROID HORMONES | Genes involved in Steroid hormones |
0.1 | 1.0 | REACTOME SYNTHESIS OF PIPS AT THE EARLY ENDOSOME MEMBRANE | Genes involved in Synthesis of PIPs at the early endosome membrane |
0.1 | 1.2 | REACTOME MRNA DECAY BY 5 TO 3 EXORIBONUCLEASE | Genes involved in mRNA Decay by 5' to 3' Exoribonuclease |
0.1 | 7.7 | REACTOME NONSENSE MEDIATED DECAY ENHANCED BY THE EXON JUNCTION COMPLEX | Genes involved in Nonsense Mediated Decay Enhanced by the Exon Junction Complex |
0.1 | 0.6 | REACTOME PROTEIN FOLDING | Genes involved in Protein folding |
0.1 | 0.7 | REACTOME SYNTHESIS OF PIPS AT THE GOLGI MEMBRANE | Genes involved in Synthesis of PIPs at the Golgi membrane |
0.1 | 1.6 | REACTOME METABOLISM OF NON CODING RNA | Genes involved in Metabolism of non-coding RNA |
0.1 | 0.2 | REACTOME AKT PHOSPHORYLATES TARGETS IN THE CYTOSOL | Genes involved in AKT phosphorylates targets in the cytosol |
0.1 | 0.6 | REACTOME PYRIMIDINE CATABOLISM | Genes involved in Pyrimidine catabolism |
0.1 | 0.9 | REACTOME PURINE RIBONUCLEOSIDE MONOPHOSPHATE BIOSYNTHESIS | Genes involved in Purine ribonucleoside monophosphate biosynthesis |
0.1 | 0.3 | REACTOME GAP JUNCTION DEGRADATION | Genes involved in Gap junction degradation |
0.1 | 1.3 | REACTOME SRP DEPENDENT COTRANSLATIONAL PROTEIN TARGETING TO MEMBRANE | Genes involved in SRP-dependent cotranslational protein targeting to membrane |
0.1 | 4.2 | REACTOME MHC CLASS II ANTIGEN PRESENTATION | Genes involved in MHC class II antigen presentation |
0.1 | 0.1 | REACTOME NEF MEDIATED DOWNREGULATION OF MHC CLASS I COMPLEX CELL SURFACE EXPRESSION | Genes involved in Nef mediated downregulation of MHC class I complex cell surface expression |
0.1 | 3.2 | REACTOME MITOTIC PROMETAPHASE | Genes involved in Mitotic Prometaphase |
0.1 | 1.2 | REACTOME SYNTHESIS AND INTERCONVERSION OF NUCLEOTIDE DI AND TRIPHOSPHATES | Genes involved in Synthesis and interconversion of nucleotide di- and triphosphates |
0.1 | 0.1 | REACTOME RORA ACTIVATES CIRCADIAN EXPRESSION | Genes involved in RORA Activates Circadian Expression |
0.1 | 0.1 | REACTOME REGULATION OF APOPTOSIS | Genes involved in Regulation of Apoptosis |
0.1 | 0.8 | REACTOME ACTIVATED NOTCH1 TRANSMITS SIGNAL TO THE NUCLEUS | Genes involved in Activated NOTCH1 Transmits Signal to the Nucleus |
0.1 | 0.4 | REACTOME REMOVAL OF THE FLAP INTERMEDIATE FROM THE C STRAND | Genes involved in Removal of the Flap Intermediate from the C-strand |
0.1 | 0.5 | REACTOME CA DEPENDENT EVENTS | Genes involved in Ca-dependent events |
0.1 | 0.1 | REACTOME SHC MEDIATED SIGNALLING | Genes involved in SHC-mediated signalling |
0.1 | 0.4 | REACTOME CASPASE MEDIATED CLEAVAGE OF CYTOSKELETAL PROTEINS | Genes involved in Caspase-mediated cleavage of cytoskeletal proteins |
0.1 | 0.4 | REACTOME COPI MEDIATED TRANSPORT | Genes involved in COPI Mediated Transport |
0.1 | 0.3 | REACTOME HORMONE LIGAND BINDING RECEPTORS | Genes involved in Hormone ligand-binding receptors |
0.1 | 0.7 | REACTOME BIOSYNTHESIS OF THE N GLYCAN PRECURSOR DOLICHOL LIPID LINKED OLIGOSACCHARIDE LLO AND TRANSFER TO A NASCENT PROTEIN | Genes involved in Biosynthesis of the N-glycan precursor (dolichol lipid-linked oligosaccharide, LLO) and transfer to a nascent protein |
0.1 | 0.1 | REACTOME PHOSPHORYLATION OF CD3 AND TCR ZETA CHAINS | Genes involved in Phosphorylation of CD3 and TCR zeta chains |
0.1 | 0.2 | REACTOME NRAGE SIGNALS DEATH THROUGH JNK | Genes involved in NRAGE signals death through JNK |
0.1 | 0.3 | REACTOME TRANSPORT OF ORGANIC ANIONS | Genes involved in Transport of organic anions |
0.1 | 0.3 | REACTOME ELEVATION OF CYTOSOLIC CA2 LEVELS | Genes involved in Elevation of cytosolic Ca2+ levels |
0.1 | 0.3 | REACTOME BETA DEFENSINS | Genes involved in Beta defensins |
0.1 | 0.7 | REACTOME ADENYLATE CYCLASE INHIBITORY PATHWAY | Genes involved in Adenylate cyclase inhibitory pathway |
0.1 | 1.3 | REACTOME REGULATION OF WATER BALANCE BY RENAL AQUAPORINS | Genes involved in Regulation of Water Balance by Renal Aquaporins |
0.0 | 0.0 | REACTOME RESOLUTION OF AP SITES VIA THE MULTIPLE NUCLEOTIDE PATCH REPLACEMENT PATHWAY | Genes involved in Resolution of AP sites via the multiple-nucleotide patch replacement pathway |
0.0 | 0.8 | REACTOME HS GAG DEGRADATION | Genes involved in HS-GAG degradation |
0.0 | 0.0 | REACTOME PROSTACYCLIN SIGNALLING THROUGH PROSTACYCLIN RECEPTOR | Genes involved in Prostacyclin signalling through prostacyclin receptor |
0.0 | 0.7 | REACTOME DOWNSTREAM TCR SIGNALING | Genes involved in Downstream TCR signaling |
0.0 | 1.7 | REACTOME G ALPHA1213 SIGNALLING EVENTS | Genes involved in G alpha (12/13) signalling events |
0.0 | 0.9 | REACTOME NOD1 2 SIGNALING PATHWAY | Genes involved in NOD1/2 Signaling Pathway |
0.0 | 0.3 | REACTOME SYNTHESIS SECRETION AND DEACYLATION OF GHRELIN | Genes involved in Synthesis, Secretion, and Deacylation of Ghrelin |
0.0 | 0.4 | REACTOME PLATELET ADHESION TO EXPOSED COLLAGEN | Genes involved in Platelet Adhesion to exposed collagen |
0.0 | 1.2 | REACTOME GOLGI ASSOCIATED VESICLE BIOGENESIS | Genes involved in Golgi Associated Vesicle Biogenesis |
0.0 | 0.8 | REACTOME SYNTHESIS OF PIPS AT THE PLASMA MEMBRANE | Genes involved in Synthesis of PIPs at the plasma membrane |
0.0 | 0.4 | REACTOME GLYCOGEN BREAKDOWN GLYCOGENOLYSIS | Genes involved in Glycogen breakdown (glycogenolysis) |
0.0 | 0.7 | REACTOME CHONDROITIN SULFATE BIOSYNTHESIS | Genes involved in Chondroitin sulfate biosynthesis |
0.0 | 0.5 | REACTOME FANCONI ANEMIA PATHWAY | Genes involved in Fanconi Anemia pathway |
0.0 | 0.3 | REACTOME THE NLRP3 INFLAMMASOME | Genes involved in The NLRP3 inflammasome |
0.0 | 2.1 | REACTOME MRNA SPLICING | Genes involved in mRNA Splicing |
0.0 | 0.1 | REACTOME GLUCOSE METABOLISM | Genes involved in Glucose metabolism |
0.0 | 0.6 | REACTOME INSULIN SYNTHESIS AND PROCESSING | Genes involved in Insulin Synthesis and Processing |
0.0 | 0.4 | REACTOME EXTENSION OF TELOMERES | Genes involved in Extension of Telomeres |
0.0 | 0.7 | REACTOME MEMBRANE TRAFFICKING | Genes involved in Membrane Trafficking |
0.0 | 2.1 | REACTOME CLASS B 2 SECRETIN FAMILY RECEPTORS | Genes involved in Class B/2 (Secretin family receptors) |
0.0 | 0.1 | REACTOME DESTABILIZATION OF MRNA BY KSRP | Genes involved in Destabilization of mRNA by KSRP |
0.0 | 0.3 | REACTOME DOUBLE STRAND BREAK REPAIR | Genes involved in Double-Strand Break Repair |
0.0 | 0.4 | REACTOME SIGNALING BY SCF KIT | Genes involved in Signaling by SCF-KIT |
0.0 | 0.3 | REACTOME FORMATION OF ATP BY CHEMIOSMOTIC COUPLING | Genes involved in Formation of ATP by chemiosmotic coupling |
0.0 | 0.5 | REACTOME SIGNALING BY EGFR IN CANCER | Genes involved in Signaling by EGFR in Cancer |
0.0 | 0.2 | REACTOME HYALURONAN UPTAKE AND DEGRADATION | Genes involved in Hyaluronan uptake and degradation |
0.0 | 0.6 | REACTOME SEMA4D IN SEMAPHORIN SIGNALING | Genes involved in Sema4D in semaphorin signaling |
0.0 | 0.2 | REACTOME RNA POL III TRANSCRIPTION INITIATION FROM TYPE 3 PROMOTER | Genes involved in RNA Polymerase III Transcription Initiation From Type 3 Promoter |
0.0 | 0.2 | REACTOME G1 PHASE | Genes involved in G1 Phase |
0.0 | 0.2 | REACTOME OPIOID SIGNALLING | Genes involved in Opioid Signalling |
0.0 | 0.1 | REACTOME SIGNAL ATTENUATION | Genes involved in Signal attenuation |
0.0 | 0.3 | REACTOME TANDEM PORE DOMAIN POTASSIUM CHANNELS | Genes involved in Tandem pore domain potassium channels |
0.0 | 0.3 | REACTOME CYTOSOLIC SULFONATION OF SMALL MOLECULES | Genes involved in Cytosolic sulfonation of small molecules |
0.0 | 3.0 | REACTOME CLASS I MHC MEDIATED ANTIGEN PROCESSING PRESENTATION | Genes involved in Class I MHC mediated antigen processing & presentation |
0.0 | 0.8 | REACTOME L1CAM INTERACTIONS | Genes involved in L1CAM interactions |
0.0 | 0.0 | REACTOME INFLUENZA VIRAL RNA TRANSCRIPTION AND REPLICATION | Genes involved in Influenza Viral RNA Transcription and Replication |
0.0 | 0.9 | REACTOME TRANSCRIPTIONAL REGULATION OF WHITE ADIPOCYTE DIFFERENTIATION | Genes involved in Transcriptional Regulation of White Adipocyte Differentiation |
0.0 | 0.4 | REACTOME NETRIN1 SIGNALING | Genes involved in Netrin-1 signaling |
0.0 | 0.5 | REACTOME PRE NOTCH EXPRESSION AND PROCESSING | Genes involved in Pre-NOTCH Expression and Processing |
0.0 | 0.1 | REACTOME SYNTHESIS SECRETION AND INACTIVATION OF GLP1 | Genes involved in Synthesis, Secretion, and Inactivation of Glucagon-like Peptide-1 (GLP-1) |
0.0 | 0.2 | REACTOME SIGNALING BY FGFR1 MUTANTS | Genes involved in Signaling by FGFR1 mutants |
0.0 | 0.6 | REACTOME METABOLISM OF VITAMINS AND COFACTORS | Genes involved in Metabolism of vitamins and cofactors |
0.0 | 0.2 | REACTOME ASPARAGINE N LINKED GLYCOSYLATION | Genes involved in Asparagine N-linked glycosylation |
0.0 | 0.5 | REACTOME TRANSLATION | Genes involved in Translation |
0.0 | 0.1 | REACTOME AQUAPORIN MEDIATED TRANSPORT | Genes involved in Aquaporin-mediated transport |
0.0 | 0.3 | REACTOME TRAF6 MEDIATED IRF7 ACTIVATION | Genes involved in TRAF6 mediated IRF7 activation |
0.0 | 0.0 | REACTOME PROCESSING OF CAPPED INTRON CONTAINING PRE MRNA | Genes involved in Processing of Capped Intron-Containing Pre-mRNA |
0.0 | 0.1 | REACTOME OPSINS | Genes involved in Opsins |
0.0 | 0.1 | REACTOME DEFENSINS | Genes involved in Defensins |
0.0 | 0.1 | REACTOME HDL MEDIATED LIPID TRANSPORT | Genes involved in HDL-mediated lipid transport |
0.0 | 0.2 | REACTOME IL1 SIGNALING | Genes involved in Interleukin-1 signaling |
0.0 | 0.2 | REACTOME TRANSPORT OF VITAMINS NUCLEOSIDES AND RELATED MOLECULES | Genes involved in Transport of vitamins, nucleosides, and related molecules |
0.0 | 0.1 | REACTOME FORMATION OF INCISION COMPLEX IN GG NER | Genes involved in Formation of incision complex in GG-NER |
0.0 | 0.2 | REACTOME GLYCOSPHINGOLIPID METABOLISM | Genes involved in Glycosphingolipid metabolism |
0.0 | 0.1 | REACTOME SEROTONIN RECEPTORS | Genes involved in Serotonin receptors |