Gene Symbol | Gene ID | Gene Info |
---|---|---|
Gcm2
|
ENSMUSG00000021362.6 | Gcm2 |
Gene | Promoter | Distance | Association probability | Pearson corr. coef. | P-value | Plot |
---|---|---|---|---|---|---|
Gcm2 | chr13_41112373_41112548 | 1425 | 0.276475 | -0.28 | 5.9e-01 | Click! |
Move your cursor over a bar to see sample name and corresponding Z-value.
Cis Regulatory Element (CRE) | Target Score | Top associated gene | Gene Info | Distance of CRE to TSS | CRE/Gene association probability |
---|---|---|---|---|---|
chr15_31117311_31117579 | 3.56 |
Gm26416 |
predicted gene, 26416 |
76893 |
0.08 |
chr13_36459154_36459328 | 3.43 |
Gm48763 |
predicted gene, 48763 |
39 |
0.98 |
chr13_36459438_36459830 | 2.28 |
Gm48763 |
predicted gene, 48763 |
354 |
0.9 |
chr18_12731812_12732024 | 1.93 |
Ttc39c |
tetratricopeptide repeat domain 39C |
2787 |
0.19 |
chr18_10934499_10934650 | 1.85 |
Gm7575 |
predicted gene 7575 |
5690 |
0.24 |
chr18_12732086_12732318 | 1.56 |
Ttc39c |
tetratricopeptide repeat domain 39C |
2503 |
0.2 |
chr18_20938375_20938560 | 1.54 |
Rnf125 |
ring finger protein 125 |
6158 |
0.22 |
chr19_46142576_46142826 | 1.30 |
Pitx3 |
paired-like homeodomain transcription factor 3 |
1718 |
0.25 |
chr9_65299789_65300058 | 1.28 |
Gm16218 |
predicted gene 16218 |
2004 |
0.18 |
chr13_36458964_36459128 | 1.26 |
Gm48763 |
predicted gene, 48763 |
234 |
0.95 |
chr2_25456298_25456449 | 1.25 |
Clic3 |
chloride intracellular channel 3 |
465 |
0.57 |
chr13_93627456_93627944 | 1.22 |
Gm15622 |
predicted gene 15622 |
2318 |
0.25 |
chr6_121886502_121886729 | 1.18 |
Mug1 |
murinoglobulin 1 |
1038 |
0.53 |
chr1_36525552_36525763 | 1.08 |
Gm38033 |
predicted gene, 38033 |
2580 |
0.13 |
chr17_31870599_31870760 | 1.04 |
Sik1 |
salt inducible kinase 1 |
14875 |
0.14 |
chr9_115401508_115401659 | 0.98 |
Gm9487 |
predicted gene 9487 |
3566 |
0.16 |
chr5_105826690_105826883 | 0.97 |
Lrrc8d |
leucine rich repeat containing 8D |
2275 |
0.22 |
chr6_72607199_72607442 | 0.95 |
Retsat |
retinol saturase (all trans retinol 13,14 reductase) |
675 |
0.43 |
chr9_121911874_121912245 | 0.95 |
Cyp8b1 |
cytochrome P450, family 8, subfamily b, polypeptide 1 |
4246 |
0.1 |
chr19_46140028_46140457 | 0.94 |
Pitx3 |
paired-like homeodomain transcription factor 3 |
741 |
0.53 |
chr4_44994891_44995176 | 0.93 |
Grhpr |
glyoxylate reductase/hydroxypyruvate reductase |
13533 |
0.1 |
chr19_42601329_42601518 | 0.92 |
Loxl4 |
lysyl oxidase-like 4 |
1898 |
0.33 |
chr2_165398290_165398459 | 0.92 |
Ocstamp |
osteoclast stimulatory transmembrane protein |
2031 |
0.23 |
chr16_38247059_38247210 | 0.89 |
Gsk3b |
glycogen synthase kinase 3 beta |
39096 |
0.11 |
chr13_60479839_60480430 | 0.89 |
Gm48500 |
predicted gene, 48500 |
1164 |
0.45 |
chr2_180788221_180788717 | 0.88 |
Bhlhe23 |
basic helix-loop-helix family, member e23 |
11569 |
0.11 |
chr2_70331912_70332170 | 0.85 |
Rpl9-ps7 |
ribosomal protein L9, pseudogene 7 |
126941 |
0.05 |
chr9_115400145_115400360 | 0.84 |
Gm9487 |
predicted gene 9487 |
4897 |
0.14 |
chr13_117745874_117746186 | 0.84 |
4933413L06Rik |
RIKEN cDNA 4933413L06 gene |
26019 |
0.26 |
chr17_31873724_31873901 | 0.82 |
Sik1 |
salt inducible kinase 1 |
18008 |
0.13 |
chr6_113657352_113657503 | 0.82 |
Irak2 |
interleukin-1 receptor-associated kinase 2 |
11423 |
0.07 |
chr8_126707171_126707322 | 0.81 |
Gm45805 |
predicted gene 45805 |
51088 |
0.15 |
chr19_61057184_61057369 | 0.80 |
Gm22520 |
predicted gene, 22520 |
43731 |
0.12 |
chr9_110688995_110689492 | 0.80 |
Gm35715 |
predicted gene, 35715 |
14289 |
0.1 |
chr12_21167940_21168115 | 0.79 |
Asap2 |
ArfGAP with SH3 domain, ankyrin repeat and PH domain 2 |
56073 |
0.1 |
chr4_136178037_136178188 | 0.78 |
E2f2 |
E2F transcription factor 2 |
2671 |
0.2 |
chr2_154609281_154609723 | 0.77 |
Zfp341 |
zinc finger protein 341 |
3795 |
0.12 |
chr6_121891225_121891413 | 0.77 |
Mug1 |
murinoglobulin 1 |
5742 |
0.2 |
chr17_31871058_31871230 | 0.75 |
Sik1 |
salt inducible kinase 1 |
15340 |
0.14 |
chr7_113228562_113228716 | 0.75 |
Arntl |
aryl hydrocarbon receptor nuclear translocator-like |
5984 |
0.23 |
chr14_73630476_73630939 | 0.74 |
Gm21750 |
predicted gene, 21750 |
30518 |
0.15 |
chr10_8193600_8193751 | 0.74 |
Gm30906 |
predicted gene, 30906 |
17544 |
0.26 |
chr12_110866355_110866579 | 0.72 |
Mpc1-ps |
mitochondrial pyruvate carrier 1, pseudogene |
7573 |
0.09 |
chr13_93719614_93719765 | 0.72 |
AW495222 |
expressed sequence AW495222 |
514 |
0.71 |
chr4_148712874_148713025 | 0.71 |
Gm13203 |
predicted gene 13203 |
754 |
0.66 |
chr5_134456739_134456910 | 0.71 |
Gtf2ird1 |
general transcription factor II I repeat domain-containing 1 |
108 |
0.9 |
chr12_28898892_28899474 | 0.69 |
Gm31508 |
predicted gene, 31508 |
11046 |
0.17 |
chr4_44995797_44996207 | 0.69 |
Grhpr |
glyoxylate reductase/hydroxypyruvate reductase |
14502 |
0.1 |
chr8_95139313_95139479 | 0.68 |
Gm31036 |
predicted gene, 31036 |
1086 |
0.32 |
chr10_8232930_8233117 | 0.67 |
Gm30906 |
predicted gene, 30906 |
56892 |
0.14 |
chr11_79287102_79287558 | 0.67 |
Gm9964 |
predicted gene 9964 |
9576 |
0.15 |
chr6_116119166_116119329 | 0.66 |
Tmcc1 |
transmembrane and coiled coil domains 1 |
8853 |
0.16 |
chr1_165617606_165617906 | 0.66 |
Mpzl1 |
myelin protein zero-like 1 |
3777 |
0.14 |
chr4_32833599_32833750 | 0.66 |
Ankrd6 |
ankyrin repeat domain 6 |
10873 |
0.18 |
chr6_121884163_121884602 | 0.66 |
Mug1 |
murinoglobulin 1 |
1195 |
0.48 |
chr4_131843604_131843770 | 0.66 |
Mecr |
mitochondrial trans-2-enoyl-CoA reductase |
182 |
0.92 |
chr15_82668190_82668753 | 0.66 |
Cyp2d35-ps |
cytochrome P450, family 2, subfamily d, member 35, pseudogene |
13760 |
0.07 |
chr18_65032600_65033017 | 0.65 |
Nedd4l |
neural precursor cell expressed, developmentally down-regulated gene 4-like |
7006 |
0.23 |
chr5_135888537_135888702 | 0.65 |
Hspb1 |
heat shock protein 1 |
601 |
0.58 |
chr11_112217513_112217697 | 0.65 |
Gm11680 |
predicted gene 11680 |
110167 |
0.07 |
chr19_46133855_46134398 | 0.65 |
Elovl3 |
elongation of very long chain fatty acids (FEN1/Elo2, SUR4/Elo3, yeast)-like 3 |
2229 |
0.19 |
chr19_14597308_14597472 | 0.64 |
Tle4 |
transducin-like enhancer of split 4 |
661 |
0.8 |
chr4_49149568_49149719 | 0.64 |
Plppr1 |
phospholipid phosphatase related 1 |
90187 |
0.08 |
chr8_126586607_126587402 | 0.64 |
Irf2bp2 |
interferon regulatory factor 2 binding protein 2 |
6982 |
0.23 |
chr2_32415334_32415774 | 0.64 |
Slc25a25 |
solute carrier family 25 (mitochondrial carrier, phosphate carrier), member 25 |
1017 |
0.34 |
chr2_31517780_31518546 | 0.64 |
Ass1 |
argininosuccinate synthetase 1 |
327 |
0.88 |
chr9_65333970_65334121 | 0.64 |
Gm39363 |
predicted gene, 39363 |
1525 |
0.2 |
chr4_72138563_72138759 | 0.63 |
Tle1 |
transducin-like enhancer of split 1 |
2652 |
0.33 |
chr11_112219735_112219893 | 0.63 |
Gm11680 |
predicted gene 11680 |
112376 |
0.07 |
chr5_112299397_112299785 | 0.63 |
Tpst2 |
protein-tyrosine sulfotransferase 2 |
4305 |
0.13 |
chr10_8086566_8086745 | 0.62 |
Gm48614 |
predicted gene, 48614 |
65363 |
0.12 |
chr7_123466413_123466584 | 0.62 |
Aqp8 |
aquaporin 8 |
2747 |
0.27 |
chr13_60493606_60493814 | 0.62 |
A530001N23Rik |
RIKEN cDNA A530001N23 gene |
4902 |
0.19 |
chr13_51992355_51992528 | 0.62 |
Gm26651 |
predicted gene, 26651 |
19227 |
0.2 |
chr1_39025074_39025225 | 0.62 |
Pdcl3 |
phosducin-like 3 |
29989 |
0.13 |
chr2_164054518_164054669 | 0.61 |
Pabpc1l |
poly(A) binding protein, cytoplasmic 1-like |
6583 |
0.14 |
chr8_111562515_111562666 | 0.61 |
Znrf1 |
zinc and ring finger 1 |
750 |
0.66 |
chr2_173156797_173157495 | 0.61 |
Pck1 |
phosphoenolpyruvate carboxykinase 1, cytosolic |
4064 |
0.2 |
chr17_28279592_28279743 | 0.61 |
Ppard |
peroxisome proliferator activator receptor delta |
7548 |
0.11 |
chr6_121870418_121870617 | 0.60 |
Mug1 |
murinoglobulin 1 |
15060 |
0.19 |
chr19_46983871_46984029 | 0.60 |
Nt5c2 |
5'-nucleotidase, cytosolic II |
14382 |
0.14 |
chr13_93618232_93618425 | 0.60 |
Gm15622 |
predicted gene 15622 |
7054 |
0.17 |
chr11_90269750_90269901 | 0.60 |
Mmd |
monocyte to macrophage differentiation-associated |
20349 |
0.21 |
chr2_154609874_154610025 | 0.60 |
Zfp341 |
zinc finger protein 341 |
3348 |
0.13 |
chr19_30092253_30092507 | 0.60 |
Uhrf2 |
ubiquitin-like, containing PHD and RING finger domains 2 |
419 |
0.86 |
chr19_23034228_23034427 | 0.59 |
Gm50136 |
predicted gene, 50136 |
27127 |
0.18 |
chr14_34549199_34549382 | 0.59 |
9230112D13Rik |
RIKEN cDNA 9230112D13 gene |
26489 |
0.1 |
chr8_119447272_119447614 | 0.59 |
Necab2 |
N-terminal EF-hand calcium binding protein 2 |
724 |
0.61 |
chr9_65309566_65309762 | 0.58 |
Clpx |
caseinolytic mitochondrial matrix peptidase chaperone subunit |
488 |
0.65 |
chr9_48738508_48738659 | 0.58 |
Zbtb16 |
zinc finger and BTB domain containing 16 |
97362 |
0.07 |
chr9_115476457_115476622 | 0.58 |
Gm5921 |
predicted gene 5921 |
37958 |
0.14 |
chr7_101664080_101664329 | 0.58 |
Clpb |
ClpB caseinolytic peptidase B |
428 |
0.84 |
chr18_13221880_13222105 | 0.57 |
Gm22251 |
predicted gene, 22251 |
12184 |
0.23 |
chr16_38273526_38273677 | 0.57 |
Nr1i2 |
nuclear receptor subfamily 1, group I, member 2 |
21223 |
0.13 |
chr5_92719246_92719397 | 0.57 |
Gm20500 |
predicted gene 20500 |
16884 |
0.17 |
chr7_112207581_112207732 | 0.57 |
Mical2 |
microtubule associated monooxygenase, calponin and LIM domain containing 2 |
18200 |
0.24 |
chr9_48723477_48723685 | 0.57 |
Zbtb16 |
zinc finger and BTB domain containing 16 |
112364 |
0.06 |
chr9_123206715_123207026 | 0.57 |
Cdcp1 |
CUB domain containing protein 1 |
9129 |
0.15 |
chr18_20989467_20989648 | 0.57 |
Rnf138 |
ring finger protein 138 |
11784 |
0.2 |
chr10_83337805_83337991 | 0.57 |
Slc41a2 |
solute carrier family 41, member 2 |
16 |
0.97 |
chr8_125558191_125558342 | 0.57 |
Sipa1l2 |
signal-induced proliferation-associated 1 like 2 |
11437 |
0.23 |
chr11_4110112_4110263 | 0.57 |
Sec14l2 |
SEC14-like lipid binding 2 |
926 |
0.34 |
chr1_79581512_79581705 | 0.56 |
Gm37886 |
predicted gene, 37886 |
39426 |
0.15 |
chr19_46108526_46108716 | 0.56 |
Gm50306 |
predicted gene, 50306 |
16309 |
0.11 |
chr8_35207776_35207938 | 0.56 |
Gm34474 |
predicted gene, 34474 |
10781 |
0.14 |
chr5_112290587_112290745 | 0.56 |
Tpst2 |
protein-tyrosine sulfotransferase 2 |
1904 |
0.22 |
chr19_61080714_61080865 | 0.56 |
Zfp950 |
zinc finger protein 950 |
36584 |
0.13 |
chr13_93617645_93617823 | 0.56 |
Gm15622 |
predicted gene 15622 |
7648 |
0.17 |
chr2_179290834_179291122 | 0.56 |
Gm14293 |
predicted gene 14293 |
50488 |
0.15 |
chr14_103099200_103099351 | 0.56 |
Fbxl3 |
F-box and leucine-rich repeat protein 3 |
231 |
0.92 |
chr8_12715705_12715874 | 0.56 |
Gm15348 |
predicted gene 15348 |
3338 |
0.2 |
chr3_94412685_94412888 | 0.55 |
1700040D17Rik |
RIKEN cDNA 1700040D17 gene |
133 |
0.72 |
chr9_99140009_99140160 | 0.55 |
Pik3cb |
phosphatidylinositol-4,5-bisphosphate 3-kinase catalytic subunit beta |
3 |
0.98 |
chr19_61226088_61226239 | 0.55 |
Csf2ra |
colony stimulating factor 2 receptor, alpha, low-affinity (granulocyte-macrophage) |
520 |
0.68 |
chr7_113230366_113230557 | 0.55 |
Arntl |
aryl hydrocarbon receptor nuclear translocator-like |
4162 |
0.25 |
chr9_63555594_63556179 | 0.55 |
Gm16759 |
predicted gene, 16759 |
24534 |
0.17 |
chr5_130623183_130623343 | 0.55 |
Gm43418 |
predicted gene 43418 |
4712 |
0.31 |
chr10_96235051_96235242 | 0.54 |
4930459C07Rik |
RIKEN cDNA 4930459C07 gene |
8939 |
0.2 |
chr7_127809387_127809562 | 0.54 |
Stx1b |
syntaxin 1B |
1450 |
0.17 |
chr1_55718995_55719164 | 0.54 |
Plcl1 |
phospholipase C-like 1 |
17054 |
0.27 |
chr1_39326083_39326234 | 0.54 |
Gm3617 |
predicted gene 3617 |
11259 |
0.15 |
chr5_28052423_28052633 | 0.54 |
Gm26608 |
predicted gene, 26608 |
2931 |
0.22 |
chr9_66835098_66835435 | 0.54 |
Aph1c |
aph1 homolog C, gamma secretase subunit |
540 |
0.43 |
chr2_71499002_71499251 | 0.54 |
Gm23253 |
predicted gene, 23253 |
3855 |
0.16 |
chr5_64505101_64505900 | 0.53 |
C030018K13Rik |
RIKEN cDNA C030018K13 gene |
28465 |
0.11 |
chr9_121908826_121908977 | 0.53 |
Ackr2 |
atypical chemokine receptor 2 |
2637 |
0.13 |
chr2_169061869_169062020 | 0.53 |
Gm26469 |
predicted gene, 26469 |
824 |
0.63 |
chr5_36390576_36390854 | 0.53 |
Sorcs2 |
sortilin-related VPS10 domain containing receptor 2 |
7392 |
0.21 |
chr10_22172601_22172752 | 0.53 |
Raet1e |
retinoic acid early transcript 1E |
845 |
0.45 |
chr10_93492074_93492414 | 0.53 |
Hal |
histidine ammonia lyase |
3441 |
0.18 |
chr4_132974220_132974503 | 0.52 |
Fgr |
FGR proto-oncogene, Src family tyrosine kinase |
259 |
0.9 |
chr14_25710571_25710770 | 0.52 |
1700054O19Rik |
RIKEN cDNA 1700054O19 gene |
3397 |
0.17 |
chr18_20984644_20984795 | 0.52 |
Rnf138 |
ring finger protein 138 |
16622 |
0.19 |
chr12_99431941_99432095 | 0.52 |
Foxn3 |
forkhead box N3 |
18056 |
0.17 |
chr11_49087851_49088280 | 0.52 |
Ifi47 |
interferon gamma inducible protein 47 |
199 |
0.69 |
chrX_36329380_36329669 | 0.52 |
Lonrf3 |
LON peptidase N-terminal domain and ring finger 3 |
308 |
0.87 |
chr11_97404617_97404768 | 0.52 |
Arhgap23 |
Rho GTPase activating protein 23 |
10841 |
0.15 |
chr8_10899350_10899661 | 0.52 |
4833411C07Rik |
RIKEN cDNA 4833411C07 gene |
417 |
0.64 |
chr14_64522536_64522702 | 0.51 |
Gm47202 |
predicted gene, 47202 |
14919 |
0.19 |
chr10_85187269_85187453 | 0.51 |
Cry1 |
cryptochrome 1 (photolyase-like) |
2297 |
0.31 |
chr11_20859993_20860157 | 0.51 |
Gm22807 |
predicted gene, 22807 |
12194 |
0.15 |
chr9_83834067_83834712 | 0.51 |
Ttk |
Ttk protein kinase |
300 |
0.91 |
chr11_101376283_101376946 | 0.51 |
G6pc |
glucose-6-phosphatase, catalytic |
9053 |
0.06 |
chr2_71738948_71739286 | 0.51 |
Gm13647 |
predicted gene 13647 |
1302 |
0.32 |
chr14_20245441_20245609 | 0.51 |
Gm2048 |
predicted gene 2048 |
15407 |
0.11 |
chr13_93630535_93630727 | 0.50 |
Gm15622 |
predicted gene 15622 |
5249 |
0.17 |
chr8_10866041_10866207 | 0.50 |
Gm32540 |
predicted gene, 32540 |
62 |
0.96 |
chr8_22381959_22382110 | 0.50 |
Slc25a15 |
solute carrier family 25 (mitochondrial carrier ornithine transporter), member 15 |
16510 |
0.1 |
chr10_22361100_22361262 | 0.50 |
Raet1d |
retinoic acid early transcript delta |
629 |
0.64 |
chr16_8581750_8581949 | 0.50 |
Abat |
4-aminobutyrate aminotransferase |
1778 |
0.28 |
chr10_80139371_80139556 | 0.50 |
Cbarp |
calcium channel, voltage-dependent, beta subunit associated regulatory protein |
98 |
0.88 |
chr4_149980056_149980645 | 0.50 |
H6pd |
hexose-6-phosphate dehydrogenase (glucose 1-dehydrogenase) |
20915 |
0.13 |
chr2_173155074_173155813 | 0.50 |
Pck1 |
phosphoenolpyruvate carboxykinase 1, cytosolic |
2361 |
0.26 |
chr8_106648215_106648366 | 0.50 |
Tango6 |
transport and golgi organization 6 |
34778 |
0.14 |
chr18_12732471_12732622 | 0.50 |
Ttc39c |
tetratricopeptide repeat domain 39C |
2159 |
0.22 |
chr11_51832795_51832987 | 0.49 |
Jade2 |
jade family PHD finger 2 |
24234 |
0.15 |
chr6_59421172_59421448 | 0.49 |
Gprin3 |
GPRIN family member 3 |
4984 |
0.34 |
chr15_59772324_59772515 | 0.49 |
Gm19510 |
predicted gene, 19510 |
22540 |
0.23 |
chr4_141663419_141663714 | 0.49 |
Plekhm2 |
pleckstrin homology domain containing, family M (with RUN domain) member 2 |
552 |
0.67 |
chr13_91762116_91762414 | 0.49 |
Gm27656 |
predicted gene, 27656 |
10159 |
0.15 |
chr7_140765024_140765175 | 0.49 |
Cyp2e1 |
cytochrome P450, family 2, subfamily e, polypeptide 1 |
618 |
0.54 |
chr18_46720391_46720701 | 0.49 |
Cdo1 |
cysteine dioxygenase 1, cytosolic |
7483 |
0.13 |
chr8_103953760_103953912 | 0.49 |
Gm8748 |
predicted gene 8748 |
117313 |
0.05 |
chr19_46136477_46136807 | 0.49 |
Pitx3 |
paired-like homeodomain transcription factor 3 |
647 |
0.58 |
chr1_180211878_180212203 | 0.48 |
Gm37336 |
predicted gene, 37336 |
296 |
0.87 |
chr1_39192284_39192607 | 0.48 |
Npas2 |
neuronal PAS domain protein 2 |
1286 |
0.45 |
chr10_59205891_59206053 | 0.48 |
Gm23223 |
predicted gene, 23223 |
10273 |
0.15 |
chr12_109986444_109986595 | 0.48 |
Gm34667 |
predicted gene, 34667 |
37354 |
0.09 |
chr5_114565093_114565257 | 0.48 |
Fam222a |
family with sequence similarity 222, member A |
2841 |
0.22 |
chr3_83034527_83034990 | 0.48 |
Fga |
fibrinogen alpha chain |
8543 |
0.14 |
chr1_72828210_72828361 | 0.48 |
Igfbp2 |
insulin-like growth factor binding protein 2 |
2963 |
0.3 |
chr11_45889255_45889449 | 0.48 |
Clint1 |
clathrin interactor 1 |
6955 |
0.17 |
chr1_91822723_91822944 | 0.48 |
Gm29101 |
predicted gene 29101 |
318 |
0.89 |
chr2_163301082_163301278 | 0.48 |
Tox2 |
TOX high mobility group box family member 2 |
19198 |
0.19 |
chr10_93506965_93507224 | 0.48 |
Hal |
histidine ammonia lyase |
5969 |
0.15 |
chr10_81192185_81192336 | 0.48 |
Dapk3 |
death-associated protein kinase 3 |
704 |
0.37 |
chr1_180219669_180219845 | 0.47 |
Gm37336 |
predicted gene, 37336 |
7356 |
0.14 |
chr2_103472788_103473367 | 0.47 |
Cat |
catalase |
12048 |
0.18 |
chr7_64514340_64514614 | 0.47 |
Gm45082 |
predicted gene 45082 |
834 |
0.6 |
chr8_107697000_107697171 | 0.47 |
Gm8940 |
predicted gene 8940 |
6241 |
0.27 |
chr3_83043842_83044694 | 0.47 |
Fgb |
fibrinogen beta chain |
5595 |
0.15 |
chr7_64635503_64635665 | 0.47 |
Apba2 |
amyloid beta (A4) precursor protein-binding, family A, member 2 |
553 |
0.83 |
chr4_144959420_144959571 | 0.47 |
Gm38074 |
predicted gene, 38074 |
647 |
0.73 |
chr4_129273046_129273197 | 0.47 |
Gm12976 |
predicted gene 12976 |
9391 |
0.11 |
chr10_80368525_80368676 | 0.47 |
Gm15123 |
predicted gene 15123 |
3298 |
0.08 |
chr7_118857588_118857742 | 0.47 |
Knop1 |
lysine rich nucleolar protein 1 |
1411 |
0.3 |
chr5_27997662_27998174 | 0.46 |
Gm4865 |
predicted gene 4865 |
3388 |
0.22 |
chr7_143978572_143978749 | 0.46 |
Shank2 |
SH3 and multiple ankyrin repeat domains 2 |
23268 |
0.16 |
chr11_117322484_117322692 | 0.46 |
Septin9 |
septin 9 |
3845 |
0.24 |
chr18_20974221_20974372 | 0.46 |
Rnf125 |
ring finger protein 125 |
12824 |
0.2 |
chr14_41120981_41121358 | 0.46 |
Sftpa1 |
surfactant associated protein A1 |
10613 |
0.11 |
chr8_119419531_119419682 | 0.46 |
Osgin1 |
oxidative stress induced growth inhibitor 1 |
14518 |
0.14 |
chr2_118900516_118900764 | 0.46 |
Bahd1 |
bromo adjacent homology domain containing 1 |
263 |
0.89 |
chr2_157569315_157569466 | 0.46 |
Blcap |
bladder cancer associated protein |
1884 |
0.22 |
chr4_144929105_144929325 | 0.46 |
Dhrs3 |
dehydrogenase/reductase (SDR family) member 3 |
10336 |
0.2 |
chr12_109987030_109987181 | 0.46 |
Gm34667 |
predicted gene, 34667 |
36768 |
0.09 |
chr16_32685796_32686168 | 0.46 |
Tnk2 |
tyrosine kinase, non-receptor, 2 |
5168 |
0.16 |
chr5_114553572_114553723 | 0.46 |
Gm13790 |
predicted gene 13790 |
2358 |
0.25 |
chr19_3893794_3894051 | 0.46 |
Chka |
choline kinase alpha |
2191 |
0.13 |
chr15_100632605_100632917 | 0.45 |
Smagp |
small cell adhesion glycoprotein |
2739 |
0.12 |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.6 | 1.8 | GO:0010046 | response to mycotoxin(GO:0010046) |
0.4 | 1.3 | GO:0019448 | cysteine catabolic process(GO:0009093) L-cysteine catabolic process(GO:0019448) L-cysteine metabolic process(GO:0046439) |
0.4 | 1.2 | GO:0043152 | induction of bacterial agglutination(GO:0043152) |
0.3 | 0.8 | GO:0060137 | maternal process involved in parturition(GO:0060137) |
0.3 | 1.3 | GO:0006548 | histidine catabolic process(GO:0006548) imidazole-containing compound catabolic process(GO:0052805) |
0.2 | 1.0 | GO:0061113 | pancreas morphogenesis(GO:0061113) |
0.2 | 1.3 | GO:0071267 | amino acid salvage(GO:0043102) L-methionine biosynthetic process(GO:0071265) L-methionine salvage(GO:0071267) |
0.2 | 0.7 | GO:0006546 | glycine catabolic process(GO:0006546) glycine decarboxylation via glycine cleavage system(GO:0019464) |
0.2 | 0.6 | GO:0075509 | receptor-mediated endocytosis of virus by host cell(GO:0019065) endocytosis involved in viral entry into host cell(GO:0075509) |
0.2 | 0.6 | GO:0035461 | vitamin transmembrane transport(GO:0035461) |
0.2 | 0.8 | GO:0010792 | DNA double-strand break processing involved in repair via single-strand annealing(GO:0010792) |
0.2 | 0.6 | GO:0019344 | cysteine biosynthetic process(GO:0019344) |
0.2 | 0.6 | GO:0010735 | positive regulation of transcription via serum response element binding(GO:0010735) |
0.2 | 0.6 | GO:0035964 | COPI-coated vesicle budding(GO:0035964) |
0.2 | 0.6 | GO:2000832 | negative regulation of steroid hormone secretion(GO:2000832) negative regulation of corticosteroid hormone secretion(GO:2000847) negative regulation of glucocorticoid secretion(GO:2000850) |
0.2 | 0.5 | GO:0007039 | protein catabolic process in the vacuole(GO:0007039) |
0.2 | 0.5 | GO:0010915 | regulation of very-low-density lipoprotein particle clearance(GO:0010915) negative regulation of very-low-density lipoprotein particle clearance(GO:0010916) |
0.2 | 0.2 | GO:0003198 | epithelial to mesenchymal transition involved in endocardial cushion formation(GO:0003198) |
0.2 | 0.5 | GO:0009212 | dTTP biosynthetic process(GO:0006235) pyrimidine deoxyribonucleoside triphosphate biosynthetic process(GO:0009212) dTTP metabolic process(GO:0046075) |
0.2 | 0.9 | GO:0090467 | L-arginine import(GO:0043091) arginine import(GO:0090467) L-arginine transport(GO:1902023) |
0.2 | 0.7 | GO:0006114 | glycerol biosynthetic process(GO:0006114) |
0.2 | 0.5 | GO:0046951 | ketone body biosynthetic process(GO:0046951) |
0.2 | 1.0 | GO:1900028 | negative regulation of ruffle assembly(GO:1900028) |
0.2 | 0.2 | GO:0034729 | histone H3-K79 methylation(GO:0034729) |
0.2 | 0.2 | GO:0015868 | purine ribonucleotide transport(GO:0015868) |
0.1 | 1.0 | GO:0097011 | cellular response to granulocyte macrophage colony-stimulating factor stimulus(GO:0097011) |
0.1 | 0.6 | GO:0001712 | ectodermal cell fate commitment(GO:0001712) |
0.1 | 0.6 | GO:0002924 | negative regulation of humoral immune response mediated by circulating immunoglobulin(GO:0002924) |
0.1 | 0.4 | GO:0030242 | pexophagy(GO:0030242) |
0.1 | 0.3 | GO:0001543 | ovarian follicle rupture(GO:0001543) |
0.1 | 0.8 | GO:0060267 | positive regulation of respiratory burst(GO:0060267) |
0.1 | 0.4 | GO:0009449 | gamma-aminobutyric acid biosynthetic process(GO:0009449) |
0.1 | 0.5 | GO:0072180 | mesonephric duct morphogenesis(GO:0072180) |
0.1 | 0.7 | GO:0006572 | tyrosine catabolic process(GO:0006572) |
0.1 | 0.8 | GO:0051136 | regulation of NK T cell differentiation(GO:0051136) positive regulation of NK T cell differentiation(GO:0051138) |
0.1 | 0.9 | GO:0035999 | tetrahydrofolate interconversion(GO:0035999) |
0.1 | 0.4 | GO:0042167 | heme catabolic process(GO:0042167) pigment catabolic process(GO:0046149) |
0.1 | 0.3 | GO:1902809 | regulation of skeletal muscle fiber differentiation(GO:1902809) |
0.1 | 0.1 | GO:0033015 | porphyrin-containing compound catabolic process(GO:0006787) tetrapyrrole catabolic process(GO:0033015) |
0.1 | 0.4 | GO:0045218 | zonula adherens maintenance(GO:0045218) |
0.1 | 1.0 | GO:0090308 | regulation of methylation-dependent chromatin silencing(GO:0090308) |
0.1 | 0.4 | GO:0007529 | establishment of synaptic specificity at neuromuscular junction(GO:0007529) |
0.1 | 0.4 | GO:0090290 | positive regulation of osteoclast proliferation(GO:0090290) |
0.1 | 0.6 | GO:0009115 | xanthine catabolic process(GO:0009115) |
0.1 | 1.0 | GO:0048387 | negative regulation of retinoic acid receptor signaling pathway(GO:0048387) |
0.1 | 0.4 | GO:0060468 | prevention of polyspermy(GO:0060468) |
0.1 | 0.4 | GO:0035283 | central nervous system segmentation(GO:0035283) brain segmentation(GO:0035284) |
0.1 | 0.4 | GO:0060397 | JAK-STAT cascade involved in growth hormone signaling pathway(GO:0060397) |
0.1 | 0.5 | GO:0033216 | ferric iron import(GO:0033216) ferric iron import into cell(GO:0097461) |
0.1 | 0.6 | GO:0009256 | 10-formyltetrahydrofolate metabolic process(GO:0009256) |
0.1 | 0.4 | GO:0002414 | immunoglobulin transcytosis in epithelial cells(GO:0002414) |
0.1 | 0.3 | GO:0039663 | fusion of virus membrane with host plasma membrane(GO:0019064) membrane fusion involved in viral entry into host cell(GO:0039663) multi-organism membrane fusion(GO:0044800) |
0.1 | 0.3 | GO:0055069 | zinc ion homeostasis(GO:0055069) |
0.1 | 0.3 | GO:0090230 | regulation of centromere complex assembly(GO:0090230) |
0.1 | 0.6 | GO:2001286 | regulation of caveolin-mediated endocytosis(GO:2001286) |
0.1 | 0.3 | GO:0018076 | N-terminal peptidyl-lysine acetylation(GO:0018076) |
0.1 | 0.5 | GO:0034773 | histone H4-K20 trimethylation(GO:0034773) |
0.1 | 0.3 | GO:2000574 | regulation of microtubule motor activity(GO:2000574) |
0.1 | 0.6 | GO:2000189 | positive regulation of cholesterol homeostasis(GO:2000189) |
0.1 | 0.5 | GO:0018317 | protein C-linked glycosylation(GO:0018103) peptidyl-tryptophan modification(GO:0018211) protein C-linked glycosylation via tryptophan(GO:0018317) protein C-linked glycosylation via 2'-alpha-mannosyl-L-tryptophan(GO:0018406) |
0.1 | 0.4 | GO:2001199 | negative regulation of dendritic cell differentiation(GO:2001199) |
0.1 | 0.2 | GO:0009972 | cytidine catabolic process(GO:0006216) cytidine deamination(GO:0009972) cytidine metabolic process(GO:0046087) |
0.1 | 0.3 | GO:0015746 | tricarboxylic acid transport(GO:0006842) citrate transport(GO:0015746) |
0.1 | 0.2 | GO:0009202 | deoxyribonucleoside triphosphate biosynthetic process(GO:0009202) |
0.1 | 0.3 | GO:0043578 | nuclear matrix organization(GO:0043578) nuclear matrix anchoring at nuclear membrane(GO:0090292) |
0.1 | 0.4 | GO:0071947 | protein deubiquitination involved in ubiquitin-dependent protein catabolic process(GO:0071947) |
0.1 | 0.5 | GO:0009181 | purine nucleoside diphosphate catabolic process(GO:0009137) purine ribonucleoside diphosphate catabolic process(GO:0009181) |
0.1 | 0.7 | GO:1901386 | negative regulation of voltage-gated calcium channel activity(GO:1901386) |
0.1 | 0.3 | GO:0055118 | negative regulation of cardiac muscle contraction(GO:0055118) |
0.1 | 0.4 | GO:0018916 | nitrobenzene metabolic process(GO:0018916) |
0.1 | 0.3 | GO:0044860 | protein localization to plasma membrane raft(GO:0044860) |
0.1 | 0.3 | GO:0050713 | negative regulation of interleukin-1 beta secretion(GO:0050713) |
0.1 | 0.1 | GO:0002752 | cell surface pattern recognition receptor signaling pathway(GO:0002752) |
0.1 | 0.6 | GO:0032792 | negative regulation of CREB transcription factor activity(GO:0032792) |
0.1 | 0.3 | GO:1990086 | lens fiber cell apoptotic process(GO:1990086) |
0.1 | 0.4 | GO:0031117 | positive regulation of microtubule depolymerization(GO:0031117) |
0.1 | 0.2 | GO:0032079 | positive regulation of endodeoxyribonuclease activity(GO:0032079) |
0.1 | 0.3 | GO:0071873 | response to norepinephrine(GO:0071873) |
0.1 | 0.3 | GO:1903525 | regulation of membrane tubulation(GO:1903525) |
0.1 | 0.1 | GO:0006714 | sesquiterpenoid metabolic process(GO:0006714) |
0.1 | 0.2 | GO:0002378 | immunoglobulin biosynthetic process(GO:0002378) |
0.1 | 0.6 | GO:0021540 | corpus callosum morphogenesis(GO:0021540) |
0.1 | 0.5 | GO:0045053 | protein retention in Golgi apparatus(GO:0045053) |
0.1 | 0.3 | GO:0052501 | induction of programmed cell death(GO:0012502) positive regulation of apoptotic process in other organism(GO:0044533) positive regulation by symbiont of host programmed cell death(GO:0052042) positive regulation by symbiont of host apoptotic process(GO:0052151) positive regulation by organism of programmed cell death in other organism involved in symbiotic interaction(GO:0052330) positive regulation by organism of apoptotic process in other organism involved in symbiotic interaction(GO:0052501) positive regulation of apoptotic process by virus(GO:0060139) |
0.1 | 0.3 | GO:0016080 | synaptic vesicle targeting(GO:0016080) |
0.1 | 0.4 | GO:1904395 | regulation of skeletal muscle acetylcholine-gated channel clustering(GO:1904393) positive regulation of skeletal muscle acetylcholine-gated channel clustering(GO:1904395) |
0.1 | 0.8 | GO:2000059 | negative regulation of protein ubiquitination involved in ubiquitin-dependent protein catabolic process(GO:2000059) |
0.1 | 0.4 | GO:0009134 | nucleoside diphosphate catabolic process(GO:0009134) |
0.1 | 0.3 | GO:0045897 | regulation of transcription during mitosis(GO:0045896) positive regulation of transcription during mitosis(GO:0045897) |
0.1 | 0.3 | GO:0070384 | Harderian gland development(GO:0070384) |
0.1 | 0.2 | GO:0032345 | negative regulation of aldosterone metabolic process(GO:0032345) negative regulation of aldosterone biosynthetic process(GO:0032348) negative regulation of cortisol biosynthetic process(GO:2000065) |
0.1 | 0.3 | GO:0060800 | regulation of cell differentiation involved in embryonic placenta development(GO:0060800) |
0.1 | 0.3 | GO:0046125 | pyrimidine deoxyribonucleoside metabolic process(GO:0046125) |
0.1 | 0.4 | GO:0045647 | negative regulation of erythrocyte differentiation(GO:0045647) |
0.1 | 0.7 | GO:0060297 | regulation of sarcomere organization(GO:0060297) |
0.1 | 0.4 | GO:0071680 | response to indole-3-methanol(GO:0071680) cellular response to indole-3-methanol(GO:0071681) |
0.1 | 0.2 | GO:1900169 | regulation of glucocorticoid mediated signaling pathway(GO:1900169) |
0.1 | 0.5 | GO:0006646 | phosphatidylethanolamine biosynthetic process(GO:0006646) |
0.1 | 0.5 | GO:0006563 | L-serine metabolic process(GO:0006563) |
0.1 | 0.5 | GO:0051775 | response to redox state(GO:0051775) |
0.1 | 0.3 | GO:0035526 | retrograde transport, plasma membrane to Golgi(GO:0035526) |
0.1 | 0.2 | GO:0018094 | protein polyglycylation(GO:0018094) |
0.1 | 0.2 | GO:0046337 | phosphatidylethanolamine metabolic process(GO:0046337) |
0.1 | 0.7 | GO:0032782 | bile acid secretion(GO:0032782) |
0.1 | 0.2 | GO:1903659 | regulation of complement-dependent cytotoxicity(GO:1903659) negative regulation of complement-dependent cytotoxicity(GO:1903660) |
0.1 | 0.2 | GO:0090038 | negative regulation of protein kinase C signaling(GO:0090038) |
0.1 | 0.7 | GO:0042984 | amyloid precursor protein biosynthetic process(GO:0042983) regulation of amyloid precursor protein biosynthetic process(GO:0042984) |
0.1 | 0.3 | GO:0044828 | negative regulation by host of viral genome replication(GO:0044828) |
0.1 | 0.2 | GO:0035622 | intrahepatic bile duct development(GO:0035622) |
0.1 | 0.2 | GO:0007161 | calcium-independent cell-matrix adhesion(GO:0007161) |
0.1 | 0.1 | GO:0070350 | white fat cell proliferation(GO:0070343) regulation of white fat cell proliferation(GO:0070350) |
0.1 | 0.2 | GO:0051572 | negative regulation of histone H3-K4 methylation(GO:0051572) |
0.1 | 0.3 | GO:1903626 | positive regulation of apoptotic DNA fragmentation(GO:1902512) positive regulation of DNA catabolic process(GO:1903626) |
0.1 | 0.6 | GO:0009650 | UV protection(GO:0009650) |
0.1 | 0.3 | GO:0042997 | negative regulation of Golgi to plasma membrane protein transport(GO:0042997) |
0.1 | 0.2 | GO:0021882 | regulation of transcription from RNA polymerase II promoter involved in forebrain neuron fate commitment(GO:0021882) |
0.1 | 0.2 | GO:0045297 | mating plug formation(GO:0042628) post-mating behavior(GO:0045297) |
0.1 | 0.2 | GO:0038108 | negative regulation of appetite by leptin-mediated signaling pathway(GO:0038108) |
0.1 | 0.1 | GO:0043402 | glucocorticoid mediated signaling pathway(GO:0043402) |
0.1 | 0.2 | GO:0071895 | odontoblast differentiation(GO:0071895) |
0.1 | 0.3 | GO:0051005 | negative regulation of lipoprotein lipase activity(GO:0051005) |
0.1 | 0.5 | GO:0040016 | embryonic cleavage(GO:0040016) |
0.1 | 0.4 | GO:0060391 | positive regulation of SMAD protein import into nucleus(GO:0060391) |
0.1 | 0.2 | GO:0031627 | telomeric loop formation(GO:0031627) |
0.1 | 0.2 | GO:0060847 | endothelial cell fate specification(GO:0060847) |
0.1 | 0.2 | GO:1903237 | negative regulation of leukocyte tethering or rolling(GO:1903237) |
0.1 | 0.1 | GO:0008354 | germ cell migration(GO:0008354) |
0.1 | 0.5 | GO:0034626 | fatty acid elongation, saturated fatty acid(GO:0019367) fatty acid elongation, unsaturated fatty acid(GO:0019368) fatty acid elongation, monounsaturated fatty acid(GO:0034625) fatty acid elongation, polyunsaturated fatty acid(GO:0034626) |
0.1 | 0.3 | GO:0035630 | bone mineralization involved in bone maturation(GO:0035630) |
0.1 | 0.1 | GO:0097278 | complement-dependent cytotoxicity(GO:0097278) |
0.1 | 0.2 | GO:0042998 | positive regulation of Golgi to plasma membrane protein transport(GO:0042998) |
0.1 | 0.3 | GO:0035701 | hematopoietic stem cell migration(GO:0035701) |
0.1 | 0.2 | GO:0031034 | myosin filament assembly(GO:0031034) |
0.1 | 0.4 | GO:0090188 | negative regulation of pancreatic juice secretion(GO:0090188) |
0.1 | 0.2 | GO:0060825 | fibroblast growth factor receptor signaling pathway involved in neural plate anterior/posterior pattern formation(GO:0060825) regulation of fibroblast growth factor receptor signaling pathway involved in neural plate anterior/posterior pattern formation(GO:2000313) |
0.1 | 0.4 | GO:1900113 | negative regulation of histone H3-K9 trimethylation(GO:1900113) |
0.1 | 0.2 | GO:0030951 | establishment or maintenance of microtubule cytoskeleton polarity(GO:0030951) |
0.1 | 0.1 | GO:1902416 | positive regulation of mRNA binding(GO:1902416) positive regulation of RNA binding(GO:1905216) |
0.1 | 0.3 | GO:0071205 | protein localization to juxtaparanode region of axon(GO:0071205) |
0.1 | 0.2 | GO:1903797 | positive regulation of inorganic anion transmembrane transport(GO:1903797) |
0.1 | 0.3 | GO:0045343 | MHC class I biosynthetic process(GO:0045341) regulation of MHC class I biosynthetic process(GO:0045343) positive regulation of MHC class I biosynthetic process(GO:0045345) |
0.1 | 0.3 | GO:0002069 | columnar/cuboidal epithelial cell maturation(GO:0002069) |
0.1 | 0.3 | GO:0045415 | negative regulation of interleukin-8 biosynthetic process(GO:0045415) |
0.1 | 0.3 | GO:0006167 | AMP biosynthetic process(GO:0006167) |
0.1 | 0.8 | GO:0021702 | cerebellar Purkinje cell differentiation(GO:0021702) |
0.1 | 0.1 | GO:0021692 | cerebellar Purkinje cell layer morphogenesis(GO:0021692) |
0.1 | 1.5 | GO:0002089 | lens morphogenesis in camera-type eye(GO:0002089) |
0.1 | 0.1 | GO:0060486 | Clara cell differentiation(GO:0060486) |
0.1 | 0.3 | GO:0031999 | negative regulation of fatty acid beta-oxidation(GO:0031999) |
0.1 | 0.5 | GO:0060501 | positive regulation of epithelial cell proliferation involved in lung morphogenesis(GO:0060501) |
0.1 | 0.1 | GO:0035166 | post-embryonic hemopoiesis(GO:0035166) |
0.1 | 0.3 | GO:0016255 | attachment of GPI anchor to protein(GO:0016255) |
0.1 | 0.2 | GO:0036444 | calcium ion transmembrane import into mitochondrion(GO:0036444) |
0.1 | 0.1 | GO:0032513 | negative regulation of protein phosphatase type 2B activity(GO:0032513) |
0.1 | 0.1 | GO:1902990 | mitotic telomere maintenance via semi-conservative replication(GO:1902990) |
0.1 | 1.5 | GO:0031146 | SCF-dependent proteasomal ubiquitin-dependent protein catabolic process(GO:0031146) |
0.1 | 0.2 | GO:0007084 | mitotic nuclear envelope reassembly(GO:0007084) |
0.1 | 0.3 | GO:0019661 | fermentation(GO:0006113) glucose catabolic process to lactate(GO:0019659) glycolytic fermentation(GO:0019660) glucose catabolic process to lactate via pyruvate(GO:0019661) |
0.1 | 0.2 | GO:0015959 | diadenosine polyphosphate metabolic process(GO:0015959) |
0.1 | 0.2 | GO:0097118 | neuroligin clustering involved in postsynaptic membrane assembly(GO:0097118) |
0.1 | 0.2 | GO:0090071 | negative regulation of ribosome biogenesis(GO:0090071) |
0.1 | 0.3 | GO:0060789 | hair follicle placode formation(GO:0060789) |
0.1 | 0.2 | GO:0042270 | protection from natural killer cell mediated cytotoxicity(GO:0042270) |
0.1 | 0.4 | GO:0042178 | xenobiotic catabolic process(GO:0042178) |
0.1 | 0.1 | GO:0019254 | carnitine metabolic process, CoA-linked(GO:0019254) |
0.1 | 0.3 | GO:0014734 | skeletal muscle hypertrophy(GO:0014734) |
0.1 | 0.2 | GO:0035021 | negative regulation of Rac protein signal transduction(GO:0035021) |
0.1 | 0.4 | GO:0060509 | Type I pneumocyte differentiation(GO:0060509) |
0.1 | 0.2 | GO:0018199 | peptidyl-glutamine modification(GO:0018199) |
0.1 | 0.2 | GO:1990036 | calcium ion import into sarcoplasmic reticulum(GO:1990036) |
0.1 | 0.2 | GO:0061511 | centriole elongation(GO:0061511) |
0.1 | 0.3 | GO:0042138 | meiotic DNA double-strand break formation(GO:0042138) |
0.1 | 0.1 | GO:0001922 | B-1 B cell homeostasis(GO:0001922) |
0.1 | 0.4 | GO:2000288 | positive regulation of myoblast proliferation(GO:2000288) |
0.1 | 0.2 | GO:0035521 | monoubiquitinated histone deubiquitination(GO:0035521) monoubiquitinated histone H2A deubiquitination(GO:0035522) |
0.1 | 0.4 | GO:0007097 | nuclear migration(GO:0007097) |
0.1 | 0.2 | GO:0015677 | copper ion import(GO:0015677) |
0.1 | 0.3 | GO:0016139 | glycoside catabolic process(GO:0016139) |
0.1 | 0.6 | GO:0006825 | copper ion transport(GO:0006825) |
0.1 | 0.1 | GO:0030397 | membrane disassembly(GO:0030397) nuclear envelope disassembly(GO:0051081) |
0.1 | 0.1 | GO:0000189 | MAPK import into nucleus(GO:0000189) |
0.1 | 0.2 | GO:1903347 | negative regulation of bicellular tight junction assembly(GO:1903347) |
0.1 | 0.1 | GO:0000059 | protein import into nucleus, docking(GO:0000059) |
0.1 | 0.2 | GO:0035995 | detection of muscle stretch(GO:0035995) |
0.1 | 0.4 | GO:0000185 | activation of MAPKKK activity(GO:0000185) |
0.1 | 0.2 | GO:0015888 | thiamine transport(GO:0015888) |
0.1 | 0.5 | GO:0031507 | heterochromatin assembly(GO:0031507) |
0.1 | 0.1 | GO:0097167 | circadian regulation of translation(GO:0097167) |
0.1 | 0.1 | GO:0009301 | snRNA transcription(GO:0009301) |
0.1 | 0.2 | GO:0070358 | actin polymerization-dependent cell motility(GO:0070358) |
0.1 | 0.3 | GO:0046069 | cGMP catabolic process(GO:0046069) |
0.1 | 0.1 | GO:0006982 | response to lipid hydroperoxide(GO:0006982) |
0.1 | 0.3 | GO:1902018 | negative regulation of cilium assembly(GO:1902018) |
0.1 | 0.3 | GO:0031915 | positive regulation of synaptic plasticity(GO:0031915) |
0.1 | 0.5 | GO:0090169 | regulation of spindle assembly(GO:0090169) |
0.1 | 0.1 | GO:0006145 | purine nucleobase catabolic process(GO:0006145) |
0.1 | 0.2 | GO:0000389 | mRNA 3'-splice site recognition(GO:0000389) |
0.1 | 0.6 | GO:0031112 | positive regulation of microtubule polymerization or depolymerization(GO:0031112) |
0.1 | 0.2 | GO:0021586 | pons maturation(GO:0021586) |
0.1 | 0.2 | GO:0015770 | disaccharide transport(GO:0015766) sucrose transport(GO:0015770) oligosaccharide transport(GO:0015772) |
0.1 | 0.3 | GO:0086013 | membrane repolarization during cardiac muscle cell action potential(GO:0086013) |
0.1 | 0.1 | GO:0071502 | cellular response to temperature stimulus(GO:0071502) |
0.1 | 0.1 | GO:1901252 | regulation of intracellular transport of viral material(GO:1901252) |
0.1 | 0.3 | GO:0072674 | multinuclear osteoclast differentiation(GO:0072674) osteoclast fusion(GO:0072675) |
0.1 | 0.2 | GO:0006419 | alanyl-tRNA aminoacylation(GO:0006419) |
0.1 | 0.1 | GO:0072173 | metanephric tubule morphogenesis(GO:0072173) |
0.1 | 0.2 | GO:0051697 | protein delipidation(GO:0051697) |
0.1 | 0.2 | GO:0009186 | deoxyribonucleoside diphosphate metabolic process(GO:0009186) |
0.1 | 0.2 | GO:0051661 | maintenance of centrosome location(GO:0051661) |
0.1 | 0.2 | GO:0060762 | regulation of branching involved in mammary gland duct morphogenesis(GO:0060762) |
0.1 | 0.1 | GO:1902033 | regulation of hematopoietic stem cell proliferation(GO:1902033) |
0.1 | 0.2 | GO:0009162 | deoxyribonucleoside monophosphate metabolic process(GO:0009162) |
0.1 | 0.1 | GO:0071351 | cellular response to interleukin-18(GO:0071351) |
0.1 | 0.4 | GO:0061154 | endothelial tube morphogenesis(GO:0061154) |
0.1 | 0.2 | GO:0051387 | negative regulation of neurotrophin TRK receptor signaling pathway(GO:0051387) |
0.1 | 0.2 | GO:0006501 | C-terminal protein lipidation(GO:0006501) |
0.1 | 0.2 | GO:0001306 | age-dependent response to oxidative stress(GO:0001306) age-dependent general metabolic decline(GO:0007571) |
0.1 | 0.2 | GO:0071376 | response to corticotropin-releasing hormone(GO:0043435) cellular response to corticotropin-releasing hormone stimulus(GO:0071376) |
0.1 | 0.2 | GO:0006438 | valyl-tRNA aminoacylation(GO:0006438) |
0.1 | 0.2 | GO:1900060 | negative regulation of sphingolipid biosynthetic process(GO:0090155) cellular sphingolipid homeostasis(GO:0090156) negative regulation of ceramide biosynthetic process(GO:1900060) |
0.1 | 0.2 | GO:0010626 | negative regulation of Schwann cell proliferation(GO:0010626) |
0.1 | 0.3 | GO:0006526 | arginine biosynthetic process(GO:0006526) |
0.1 | 0.1 | GO:0046098 | guanine metabolic process(GO:0046098) |
0.1 | 0.3 | GO:0019720 | Mo-molybdopterin cofactor biosynthetic process(GO:0006777) Mo-molybdopterin cofactor metabolic process(GO:0019720) molybdopterin cofactor biosynthetic process(GO:0032324) molybdopterin cofactor metabolic process(GO:0043545) prosthetic group metabolic process(GO:0051189) |
0.1 | 0.1 | GO:0035973 | aggrephagy(GO:0035973) |
0.1 | 0.2 | GO:0033615 | mitochondrial proton-transporting ATP synthase complex assembly(GO:0033615) |
0.1 | 1.0 | GO:0043567 | regulation of insulin-like growth factor receptor signaling pathway(GO:0043567) |
0.1 | 0.7 | GO:0046685 | response to arsenic-containing substance(GO:0046685) |
0.1 | 0.3 | GO:0006361 | transcription initiation from RNA polymerase I promoter(GO:0006361) |
0.1 | 0.1 | GO:0006551 | leucine metabolic process(GO:0006551) |
0.1 | 0.1 | GO:1903898 | negative regulation of PERK-mediated unfolded protein response(GO:1903898) |
0.1 | 0.2 | GO:1903361 | protein localization to basolateral plasma membrane(GO:1903361) |
0.1 | 0.4 | GO:0070977 | ossification involved in bone maturation(GO:0043931) bone maturation(GO:0070977) |
0.1 | 0.1 | GO:0045404 | positive regulation of interleukin-4 biosynthetic process(GO:0045404) |
0.1 | 0.1 | GO:0035794 | positive regulation of mitochondrial membrane permeability(GO:0035794) |
0.1 | 0.2 | GO:0042891 | antibiotic transport(GO:0042891) |
0.1 | 0.2 | GO:0010510 | regulation of acetyl-CoA biosynthetic process from pyruvate(GO:0010510) |
0.1 | 0.1 | GO:0060916 | mesenchymal cell proliferation involved in lung development(GO:0060916) |
0.1 | 0.1 | GO:0031033 | myosin filament organization(GO:0031033) |
0.1 | 0.4 | GO:1901978 | positive regulation of cell cycle checkpoint(GO:1901978) |
0.1 | 0.3 | GO:0006348 | chromatin silencing at telomere(GO:0006348) |
0.1 | 0.3 | GO:1902035 | positive regulation of hematopoietic stem cell proliferation(GO:1902035) |
0.1 | 0.7 | GO:0045603 | positive regulation of endothelial cell differentiation(GO:0045603) |
0.1 | 0.2 | GO:0007023 | post-chaperonin tubulin folding pathway(GO:0007023) |
0.1 | 0.1 | GO:0030300 | regulation of intestinal cholesterol absorption(GO:0030300) |
0.0 | 0.3 | GO:0031642 | negative regulation of myelination(GO:0031642) |
0.0 | 0.2 | GO:0090239 | regulation of histone H4 acetylation(GO:0090239) |
0.0 | 0.1 | GO:2000048 | negative regulation of cell-cell adhesion mediated by cadherin(GO:2000048) |
0.0 | 0.1 | GO:0036257 | multivesicular body organization(GO:0036257) multivesicular body assembly(GO:0036258) |
0.0 | 0.1 | GO:0031943 | regulation of glucocorticoid metabolic process(GO:0031943) |
0.0 | 0.3 | GO:1901030 | positive regulation of mitochondrial outer membrane permeabilization involved in apoptotic signaling pathway(GO:1901030) |
0.0 | 0.2 | GO:0046416 | D-amino acid catabolic process(GO:0019478) D-amino acid metabolic process(GO:0046416) |
0.0 | 0.0 | GO:1903140 | regulation of endothelial cell development(GO:1901550) regulation of establishment of endothelial barrier(GO:1903140) |
0.0 | 0.2 | GO:2000096 | positive regulation of Wnt signaling pathway, planar cell polarity pathway(GO:2000096) |
0.0 | 0.1 | GO:0035860 | glial cell-derived neurotrophic factor receptor signaling pathway(GO:0035860) |
0.0 | 0.6 | GO:0035278 | miRNA mediated inhibition of translation(GO:0035278) |
0.0 | 0.2 | GO:0033278 | cell proliferation in midbrain(GO:0033278) |
0.0 | 0.5 | GO:0046697 | decidualization(GO:0046697) |
0.0 | 0.2 | GO:0007000 | nucleolus organization(GO:0007000) |
0.0 | 0.4 | GO:0001867 | complement activation, lectin pathway(GO:0001867) |
0.0 | 0.2 | GO:0061635 | regulation of protein complex stability(GO:0061635) |
0.0 | 0.4 | GO:0042535 | positive regulation of tumor necrosis factor biosynthetic process(GO:0042535) |
0.0 | 0.2 | GO:0010746 | regulation of plasma membrane long-chain fatty acid transport(GO:0010746) |
0.0 | 0.1 | GO:0045602 | negative regulation of endothelial cell differentiation(GO:0045602) |
0.0 | 0.2 | GO:0006287 | base-excision repair, gap-filling(GO:0006287) |
0.0 | 0.2 | GO:0046473 | phosphatidic acid biosynthetic process(GO:0006654) phosphatidic acid metabolic process(GO:0046473) |
0.0 | 0.0 | GO:1990314 | cellular response to insulin-like growth factor stimulus(GO:1990314) |
0.0 | 0.2 | GO:0010499 | proteasomal ubiquitin-independent protein catabolic process(GO:0010499) |
0.0 | 0.3 | GO:0051415 | interphase microtubule nucleation by interphase microtubule organizing center(GO:0051415) microtubule nucleation by microtubule organizing center(GO:0051418) |
0.0 | 0.4 | GO:0046040 | IMP metabolic process(GO:0046040) |
0.0 | 0.1 | GO:0034756 | regulation of iron ion transport(GO:0034756) |
0.0 | 1.3 | GO:0001913 | T cell mediated cytotoxicity(GO:0001913) |
0.0 | 0.0 | GO:2000698 | positive regulation of epithelial cell differentiation involved in kidney development(GO:2000698) |
0.0 | 0.1 | GO:0042908 | xenobiotic transport(GO:0042908) |
0.0 | 0.3 | GO:0034116 | positive regulation of heterotypic cell-cell adhesion(GO:0034116) |
0.0 | 0.2 | GO:2000774 | positive regulation of cell aging(GO:0090343) positive regulation of cellular senescence(GO:2000774) |
0.0 | 0.1 | GO:0002278 | eosinophil activation involved in immune response(GO:0002278) eosinophil mediated immunity(GO:0002447) eosinophil degranulation(GO:0043308) |
0.0 | 0.0 | GO:0021775 | smoothened signaling pathway involved in ventral spinal cord interneuron specification(GO:0021775) smoothened signaling pathway involved in spinal cord motor neuron cell fate specification(GO:0021776) |
0.0 | 0.0 | GO:0046985 | positive regulation of hemoglobin biosynthetic process(GO:0046985) |
0.0 | 0.0 | GO:0002884 | negative regulation of hypersensitivity(GO:0002884) |
0.0 | 0.3 | GO:0006995 | cellular response to nitrogen starvation(GO:0006995) cellular response to nitrogen levels(GO:0043562) |
0.0 | 0.4 | GO:0032211 | negative regulation of telomere maintenance via telomerase(GO:0032211) |
0.0 | 2.1 | GO:0007566 | embryo implantation(GO:0007566) |
0.0 | 0.5 | GO:0001886 | endothelial cell morphogenesis(GO:0001886) |
0.0 | 0.6 | GO:0015858 | nucleoside transport(GO:0015858) |
0.0 | 0.1 | GO:0006933 | negative regulation of cell adhesion involved in substrate-bound cell migration(GO:0006933) |
0.0 | 0.3 | GO:0046218 | tryptophan catabolic process(GO:0006569) tryptophan catabolic process to kynurenine(GO:0019441) indole-containing compound catabolic process(GO:0042436) indolalkylamine catabolic process(GO:0046218) |
0.0 | 0.0 | GO:2001187 | positive regulation of CD8-positive, alpha-beta T cell activation(GO:2001187) |
0.0 | 0.1 | GO:0009051 | pentose-phosphate shunt, oxidative branch(GO:0009051) |
0.0 | 0.1 | GO:0010901 | regulation of very-low-density lipoprotein particle remodeling(GO:0010901) |
0.0 | 0.1 | GO:0006106 | fumarate metabolic process(GO:0006106) |
0.0 | 0.1 | GO:0033499 | galactose catabolic process via UDP-galactose(GO:0033499) glycolytic process from galactose(GO:0061623) |
0.0 | 0.1 | GO:0033025 | mast cell homeostasis(GO:0033023) mast cell apoptotic process(GO:0033024) regulation of mast cell apoptotic process(GO:0033025) |
0.0 | 0.3 | GO:0019673 | GDP-mannose metabolic process(GO:0019673) |
0.0 | 0.1 | GO:0010520 | regulation of reciprocal meiotic recombination(GO:0010520) |
0.0 | 0.2 | GO:0002904 | positive regulation of B cell apoptotic process(GO:0002904) |
0.0 | 0.1 | GO:0010536 | positive regulation of activation of Janus kinase activity(GO:0010536) |
0.0 | 0.2 | GO:0015871 | choline transport(GO:0015871) |
0.0 | 0.1 | GO:0097460 | ferrous iron import(GO:0070627) ferrous iron import into cell(GO:0097460) |
0.0 | 0.1 | GO:0032929 | negative regulation of superoxide anion generation(GO:0032929) |
0.0 | 0.3 | GO:1902231 | positive regulation of intrinsic apoptotic signaling pathway in response to DNA damage(GO:1902231) |
0.0 | 0.6 | GO:0043306 | positive regulation of mast cell activation involved in immune response(GO:0033008) positive regulation of mast cell degranulation(GO:0043306) |
0.0 | 0.3 | GO:0090557 | establishment of endothelial intestinal barrier(GO:0090557) |
0.0 | 0.3 | GO:2001214 | positive regulation of vasculogenesis(GO:2001214) |
0.0 | 0.1 | GO:0001826 | inner cell mass cell differentiation(GO:0001826) |
0.0 | 1.0 | GO:0045746 | negative regulation of Notch signaling pathway(GO:0045746) |
0.0 | 0.3 | GO:0005981 | regulation of glycogen catabolic process(GO:0005981) |
0.0 | 0.1 | GO:0000350 | generation of catalytic spliceosome for second transesterification step(GO:0000350) |
0.0 | 0.1 | GO:0043313 | regulation of neutrophil degranulation(GO:0043313) |
0.0 | 0.1 | GO:0090500 | endocardial cushion to mesenchymal transition(GO:0090500) |
0.0 | 0.0 | GO:0016078 | tRNA catabolic process(GO:0016078) |
0.0 | 0.3 | GO:0080111 | DNA demethylation(GO:0080111) |
0.0 | 0.1 | GO:0060178 | regulation of exocyst localization(GO:0060178) |
0.0 | 0.1 | GO:0032789 | saturated monocarboxylic acid metabolic process(GO:0032788) unsaturated monocarboxylic acid metabolic process(GO:0032789) |
0.0 | 0.2 | GO:0051791 | medium-chain fatty acid metabolic process(GO:0051791) |
0.0 | 0.3 | GO:0030917 | midbrain-hindbrain boundary development(GO:0030917) |
0.0 | 0.2 | GO:0070126 | mitochondrial translational termination(GO:0070126) |
0.0 | 0.0 | GO:0045073 | chemokine biosynthetic process(GO:0042033) regulation of chemokine biosynthetic process(GO:0045073) |
0.0 | 0.0 | GO:0060605 | tube lumen cavitation(GO:0060605) salivary gland cavitation(GO:0060662) |
0.0 | 0.1 | GO:0019919 | peptidyl-arginine methylation, to asymmetrical-dimethyl arginine(GO:0019919) |
0.0 | 0.1 | GO:1900186 | negative regulation of clathrin-mediated endocytosis(GO:1900186) |
0.0 | 0.5 | GO:0051642 | centrosome localization(GO:0051642) |
0.0 | 0.0 | GO:0070424 | regulation of nucleotide-binding oligomerization domain containing signaling pathway(GO:0070424) regulation of nucleotide-binding oligomerization domain containing 1 signaling pathway(GO:0070428) regulation of nucleotide-binding oligomerization domain containing 2 signaling pathway(GO:0070432) |
0.0 | 0.2 | GO:0042796 | snRNA transcription from RNA polymerase III promoter(GO:0042796) |
0.0 | 0.2 | GO:0015884 | folic acid transport(GO:0015884) |
0.0 | 0.1 | GO:0032488 | Cdc42 protein signal transduction(GO:0032488) |
0.0 | 0.1 | GO:0071455 | cellular response to increased oxygen levels(GO:0036295) cellular response to hyperoxia(GO:0071455) |
0.0 | 0.1 | GO:1902036 | regulation of hematopoietic stem cell differentiation(GO:1902036) |
0.0 | 0.1 | GO:0034421 | post-translational protein acetylation(GO:0034421) |
0.0 | 0.2 | GO:1902410 | mitotic cytokinetic process(GO:1902410) |
0.0 | 0.3 | GO:0051457 | maintenance of protein location in nucleus(GO:0051457) |
0.0 | 0.1 | GO:0044375 | regulation of peroxisome size(GO:0044375) |
0.0 | 0.0 | GO:0036091 | positive regulation of transcription from RNA polymerase II promoter in response to oxidative stress(GO:0036091) |
0.0 | 0.0 | GO:0090611 | ubiquitin-independent protein catabolic process via the multivesicular body sorting pathway(GO:0090611) |
0.0 | 0.4 | GO:0036158 | outer dynein arm assembly(GO:0036158) |
0.0 | 0.1 | GO:0051388 | positive regulation of neurotrophin TRK receptor signaling pathway(GO:0051388) |
0.0 | 0.1 | GO:0061502 | early endosome to recycling endosome transport(GO:0061502) |
0.0 | 0.3 | GO:0014733 | regulation of skeletal muscle adaptation(GO:0014733) |
0.0 | 0.1 | GO:0019287 | isopentenyl diphosphate biosynthetic process(GO:0009240) isopentenyl diphosphate biosynthetic process, mevalonate pathway(GO:0019287) |
0.0 | 0.1 | GO:0034165 | positive regulation of toll-like receptor 9 signaling pathway(GO:0034165) |
0.0 | 0.2 | GO:0014045 | establishment of endothelial blood-brain barrier(GO:0014045) |
0.0 | 0.2 | GO:0010457 | centriole-centriole cohesion(GO:0010457) |
0.0 | 0.1 | GO:2000721 | positive regulation of transcription from RNA polymerase II promoter involved in smooth muscle cell differentiation(GO:2000721) |
0.0 | 0.5 | GO:0002115 | store-operated calcium entry(GO:0002115) |
0.0 | 0.2 | GO:2000255 | negative regulation of male germ cell proliferation(GO:2000255) |
0.0 | 0.1 | GO:0060315 | negative regulation of ryanodine-sensitive calcium-release channel activity(GO:0060315) |
0.0 | 0.3 | GO:0070230 | positive regulation of lymphocyte apoptotic process(GO:0070230) |
0.0 | 0.1 | GO:0060448 | dichotomous subdivision of terminal units involved in lung branching(GO:0060448) |
0.0 | 0.1 | GO:0042360 | vitamin E metabolic process(GO:0042360) |
0.0 | 0.2 | GO:0006477 | protein sulfation(GO:0006477) |
0.0 | 0.2 | GO:0033353 | S-adenosylmethionine cycle(GO:0033353) |
0.0 | 0.3 | GO:0008216 | spermidine metabolic process(GO:0008216) |
0.0 | 0.3 | GO:0006610 | ribosomal protein import into nucleus(GO:0006610) |
0.0 | 0.0 | GO:2000410 | thymocyte migration(GO:0072679) regulation of thymocyte migration(GO:2000410) positive regulation of thymocyte migration(GO:2000412) |
0.0 | 0.1 | GO:0016095 | polyprenol catabolic process(GO:0016095) |
0.0 | 0.0 | GO:0015744 | succinate transport(GO:0015744) |
0.0 | 0.0 | GO:0061091 | regulation of phospholipid translocation(GO:0061091) positive regulation of phospholipid translocation(GO:0061092) |
0.0 | 0.2 | GO:0033700 | phospholipid efflux(GO:0033700) |
0.0 | 0.2 | GO:0010815 | bradykinin catabolic process(GO:0010815) |
0.0 | 0.1 | GO:0034633 | retinol transport(GO:0034633) isoprenoid transport(GO:0046864) terpenoid transport(GO:0046865) |
0.0 | 0.1 | GO:0060340 | positive regulation of type I interferon-mediated signaling pathway(GO:0060340) |
0.0 | 0.1 | GO:0070314 | G1 to G0 transition(GO:0070314) |
0.0 | 0.1 | GO:0007296 | vitellogenesis(GO:0007296) |
0.0 | 0.2 | GO:0008343 | adult feeding behavior(GO:0008343) |
0.0 | 0.1 | GO:0019482 | beta-alanine metabolic process(GO:0019482) |
0.0 | 0.1 | GO:0039689 | negative stranded viral RNA replication(GO:0039689) multi-organism biosynthetic process(GO:0044034) |
0.0 | 0.1 | GO:0031860 | telomeric 3' overhang formation(GO:0031860) |
0.0 | 0.5 | GO:0072673 | lamellipodium morphogenesis(GO:0072673) |
0.0 | 0.1 | GO:0006931 | substrate-dependent cell migration, cell attachment to substrate(GO:0006931) |
0.0 | 0.0 | GO:0090069 | regulation of ribosome biogenesis(GO:0090069) |
0.0 | 0.1 | GO:1902237 | positive regulation of endoplasmic reticulum stress-induced intrinsic apoptotic signaling pathway(GO:1902237) |
0.0 | 0.1 | GO:1903334 | positive regulation of protein folding(GO:1903334) |
0.0 | 0.1 | GO:1990035 | calcium ion import into cell(GO:1990035) |
0.0 | 0.0 | GO:0001807 | regulation of type IV hypersensitivity(GO:0001807) |
0.0 | 0.1 | GO:0060830 | ciliary receptor clustering involved in smoothened signaling pathway(GO:0060830) |
0.0 | 0.1 | GO:0044336 | canonical Wnt signaling pathway involved in negative regulation of apoptotic process(GO:0044336) |
0.0 | 0.0 | GO:0070949 | regulation of neutrophil mediated cytotoxicity(GO:0070948) regulation of neutrophil mediated killing of symbiont cell(GO:0070949) |
0.0 | 0.1 | GO:0061684 | chaperone-mediated autophagy(GO:0061684) |
0.0 | 0.1 | GO:0044341 | sodium-dependent phosphate transport(GO:0044341) |
0.0 | 0.1 | GO:1902255 | positive regulation of intrinsic apoptotic signaling pathway by p53 class mediator(GO:1902255) |
0.0 | 0.1 | GO:0070934 | CRD-mediated mRNA stabilization(GO:0070934) |
0.0 | 0.0 | GO:0071371 | cellular response to gonadotropin stimulus(GO:0071371) |
0.0 | 0.1 | GO:0014722 | regulation of skeletal muscle contraction by calcium ion signaling(GO:0014722) |
0.0 | 0.1 | GO:0030311 | poly-N-acetyllactosamine metabolic process(GO:0030309) poly-N-acetyllactosamine biosynthetic process(GO:0030311) |
0.0 | 0.1 | GO:0060502 | epithelial cell proliferation involved in lung morphogenesis(GO:0060502) |
0.0 | 0.1 | GO:1904526 | regulation of microtubule binding(GO:1904526) positive regulation of microtubule binding(GO:1904528) |
0.0 | 0.1 | GO:0060988 | lipid tube assembly(GO:0060988) |
0.0 | 0.4 | GO:0042415 | norepinephrine metabolic process(GO:0042415) |
0.0 | 0.1 | GO:0014010 | Schwann cell proliferation(GO:0014010) |
0.0 | 0.4 | GO:0015693 | magnesium ion transport(GO:0015693) |
0.0 | 0.3 | GO:0010614 | negative regulation of cardiac muscle hypertrophy(GO:0010614) |
0.0 | 0.1 | GO:0060355 | positive regulation of cell adhesion molecule production(GO:0060355) |
0.0 | 0.1 | GO:0090168 | Golgi reassembly(GO:0090168) |
0.0 | 0.8 | GO:0030212 | hyaluronan metabolic process(GO:0030212) |
0.0 | 0.1 | GO:1903423 | positive regulation of synaptic vesicle recycling(GO:1903423) |
0.0 | 0.1 | GO:0006555 | methionine metabolic process(GO:0006555) |
0.0 | 0.1 | GO:0032898 | neurotrophin production(GO:0032898) |
0.0 | 0.1 | GO:0002741 | positive regulation of cytokine secretion involved in immune response(GO:0002741) |
0.0 | 0.1 | GO:0010760 | negative regulation of macrophage chemotaxis(GO:0010760) |
0.0 | 0.1 | GO:0060018 | astrocyte fate commitment(GO:0060018) |
0.0 | 0.1 | GO:1903960 | negative regulation of anion channel activity(GO:0010360) negative regulation of anion transmembrane transport(GO:1903960) |
0.0 | 0.2 | GO:0098814 | spontaneous neurotransmitter secretion(GO:0061669) spontaneous synaptic transmission(GO:0098814) |
0.0 | 0.1 | GO:0051919 | positive regulation of fibrinolysis(GO:0051919) |
0.0 | 0.3 | GO:0034497 | protein localization to pre-autophagosomal structure(GO:0034497) |
0.0 | 0.1 | GO:0017085 | response to insecticide(GO:0017085) response to pyrethroid(GO:0046684) |
0.0 | 0.1 | GO:0060363 | cranial suture morphogenesis(GO:0060363) |
0.0 | 0.1 | GO:0034374 | low-density lipoprotein particle remodeling(GO:0034374) |
0.0 | 0.1 | GO:0010982 | regulation of high-density lipoprotein particle clearance(GO:0010982) |
0.0 | 0.1 | GO:0006620 | posttranslational protein targeting to membrane(GO:0006620) |
0.0 | 0.2 | GO:0046836 | glycolipid transport(GO:0046836) |
0.0 | 0.3 | GO:0006607 | NLS-bearing protein import into nucleus(GO:0006607) |
0.0 | 0.1 | GO:0001927 | exocyst assembly(GO:0001927) |
0.0 | 0.1 | GO:0071442 | positive regulation of histone H3-K14 acetylation(GO:0071442) |
0.0 | 0.1 | GO:0090245 | axis elongation involved in somitogenesis(GO:0090245) |
0.0 | 0.1 | GO:0061589 | calcium activated phosphatidylserine scrambling(GO:0061589) |
0.0 | 0.0 | GO:0010637 | negative regulation of mitochondrial fusion(GO:0010637) |
0.0 | 0.1 | GO:1900025 | negative regulation of substrate adhesion-dependent cell spreading(GO:1900025) |
0.0 | 0.3 | GO:0000467 | exonucleolytic trimming involved in rRNA processing(GO:0000459) exonucleolytic trimming to generate mature 3'-end of 5.8S rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000467) |
0.0 | 0.1 | GO:0090051 | negative regulation of cell migration involved in sprouting angiogenesis(GO:0090051) |
0.0 | 0.0 | GO:0070202 | regulation of establishment of protein localization to chromosome(GO:0070202) |
0.0 | 0.3 | GO:0031998 | regulation of fatty acid beta-oxidation(GO:0031998) |
0.0 | 0.1 | GO:0042256 | mature ribosome assembly(GO:0042256) |
0.0 | 0.2 | GO:0019184 | nonribosomal peptide biosynthetic process(GO:0019184) |
0.0 | 0.2 | GO:0035269 | protein O-linked mannosylation(GO:0035269) |
0.0 | 0.0 | GO:0009071 | serine family amino acid catabolic process(GO:0009071) |
0.0 | 0.1 | GO:0006543 | glutamine catabolic process(GO:0006543) |
0.0 | 0.2 | GO:1902373 | negative regulation of mRNA catabolic process(GO:1902373) |
0.0 | 0.1 | GO:0051295 | establishment of meiotic spindle localization(GO:0051295) |
0.0 | 0.2 | GO:1900264 | regulation of DNA-directed DNA polymerase activity(GO:1900262) positive regulation of DNA-directed DNA polymerase activity(GO:1900264) |
0.0 | 0.1 | GO:0010936 | negative regulation of macrophage cytokine production(GO:0010936) |
0.0 | 0.2 | GO:1902414 | protein localization to cell junction(GO:1902414) |
0.0 | 0.1 | GO:0097155 | fasciculation of sensory neuron axon(GO:0097155) |
0.0 | 0.0 | GO:0060059 | embryonic retina morphogenesis in camera-type eye(GO:0060059) |
0.0 | 0.0 | GO:0061153 | trachea submucosa development(GO:0061152) trachea gland development(GO:0061153) |
0.0 | 0.1 | GO:0097212 | lysosomal membrane organization(GO:0097212) |
0.0 | 0.2 | GO:0060052 | neurofilament cytoskeleton organization(GO:0060052) |
0.0 | 0.1 | GO:0071677 | positive regulation of mononuclear cell migration(GO:0071677) |
0.0 | 0.0 | GO:0060155 | platelet dense granule organization(GO:0060155) |
0.0 | 0.1 | GO:0051574 | positive regulation of histone H3-K9 methylation(GO:0051574) |
0.0 | 0.3 | GO:0043248 | proteasome assembly(GO:0043248) |
0.0 | 0.1 | GO:1900738 | positive regulation of phospholipase C-activating G-protein coupled receptor signaling pathway(GO:1900738) |
0.0 | 0.0 | GO:0060633 | negative regulation of transcription initiation from RNA polymerase II promoter(GO:0060633) negative regulation of DNA-templated transcription, initiation(GO:2000143) |
0.0 | 0.2 | GO:0051694 | pointed-end actin filament capping(GO:0051694) |
0.0 | 0.2 | GO:0019370 | leukotriene biosynthetic process(GO:0019370) |
0.0 | 0.1 | GO:0036092 | phosphatidylinositol-3-phosphate biosynthetic process(GO:0036092) |
0.0 | 0.1 | GO:0060283 | negative regulation of oocyte development(GO:0060283) negative regulation of oocyte maturation(GO:1900194) |
0.0 | 0.2 | GO:0006760 | folic acid-containing compound metabolic process(GO:0006760) |
0.0 | 0.1 | GO:1903275 | positive regulation of sodium ion export(GO:1903275) positive regulation of sodium ion export from cell(GO:1903278) |
0.0 | 0.2 | GO:0045060 | negative thymic T cell selection(GO:0045060) |
0.0 | 0.2 | GO:0006450 | regulation of translational fidelity(GO:0006450) |
0.0 | 0.0 | GO:0080182 | histone H3-K4 trimethylation(GO:0080182) |
0.0 | 0.1 | GO:0051151 | negative regulation of smooth muscle cell differentiation(GO:0051151) |
0.0 | 0.2 | GO:0030432 | peristalsis(GO:0030432) |
0.0 | 0.2 | GO:0070932 | histone H3 deacetylation(GO:0070932) |
0.0 | 0.1 | GO:0015712 | hexose phosphate transport(GO:0015712) glucose-6-phosphate transport(GO:0015760) |
0.0 | 0.1 | GO:0060112 | generation of ovulation cycle rhythm(GO:0060112) |
0.0 | 0.4 | GO:0071548 | response to dexamethasone(GO:0071548) |
0.0 | 0.1 | GO:1903054 | negative regulation of extracellular matrix organization(GO:1903054) |
0.0 | 0.0 | GO:0072718 | response to cisplatin(GO:0072718) |
0.0 | 0.0 | GO:0032025 | response to cobalt ion(GO:0032025) |
0.0 | 0.1 | GO:0071985 | multivesicular body sorting pathway(GO:0071985) |
0.0 | 0.2 | GO:0051974 | negative regulation of telomerase activity(GO:0051974) |
0.0 | 0.2 | GO:1902579 | multi-organism transport(GO:0044766) multi-organism localization(GO:1902579) |
0.0 | 0.7 | GO:0001706 | endoderm formation(GO:0001706) |
0.0 | 0.2 | GO:0061179 | negative regulation of insulin secretion involved in cellular response to glucose stimulus(GO:0061179) |
0.0 | 0.2 | GO:0097237 | cellular response to toxic substance(GO:0097237) |
0.0 | 0.1 | GO:0019230 | proprioception(GO:0019230) |
0.0 | 0.3 | GO:0007210 | serotonin receptor signaling pathway(GO:0007210) |
0.0 | 0.2 | GO:0071850 | mitotic cell cycle arrest(GO:0071850) |
0.0 | 0.1 | GO:0015879 | carnitine transport(GO:0015879) |
0.0 | 0.2 | GO:0071569 | protein ufmylation(GO:0071569) |
0.0 | 0.3 | GO:0006020 | inositol metabolic process(GO:0006020) |
0.0 | 0.1 | GO:0043970 | histone H3-K9 acetylation(GO:0043970) |
0.0 | 0.1 | GO:2000767 | positive regulation of cytoplasmic translation(GO:2000767) |
0.0 | 0.1 | GO:0010727 | negative regulation of hydrogen peroxide metabolic process(GO:0010727) |
0.0 | 0.0 | GO:2001180 | negative regulation of interleukin-10 secretion(GO:2001180) |
0.0 | 0.1 | GO:0022038 | corpus callosum development(GO:0022038) |
0.0 | 0.1 | GO:1900121 | negative regulation of receptor binding(GO:1900121) |
0.0 | 0.0 | GO:0072553 | terminal button organization(GO:0072553) |
0.0 | 0.1 | GO:0010875 | positive regulation of cholesterol efflux(GO:0010875) |
0.0 | 0.0 | GO:0072053 | renal inner medulla development(GO:0072053) |
0.0 | 0.1 | GO:0060768 | regulation of epithelial cell proliferation involved in prostate gland development(GO:0060768) negative regulation of epithelial cell proliferation involved in prostate gland development(GO:0060770) |
0.0 | 0.1 | GO:0032464 | positive regulation of protein homooligomerization(GO:0032464) |
0.0 | 0.3 | GO:0032688 | negative regulation of interferon-beta production(GO:0032688) |
0.0 | 0.1 | GO:0038028 | insulin receptor signaling pathway via phosphatidylinositol 3-kinase(GO:0038028) |
0.0 | 0.1 | GO:0006703 | estrogen biosynthetic process(GO:0006703) |
0.0 | 0.1 | GO:0006667 | sphinganine metabolic process(GO:0006667) |
0.0 | 0.1 | GO:0009106 | lipoate metabolic process(GO:0009106) |
0.0 | 0.1 | GO:0098528 | skeletal muscle fiber differentiation(GO:0098528) |
0.0 | 0.1 | GO:1901621 | negative regulation of smoothened signaling pathway involved in dorsal/ventral neural tube patterning(GO:1901621) |
0.0 | 0.3 | GO:0072606 | interleukin-8 secretion(GO:0072606) |
0.0 | 0.2 | GO:0051798 | positive regulation of hair follicle development(GO:0051798) |
0.0 | 0.0 | GO:0016321 | female meiosis chromosome segregation(GO:0016321) |
0.0 | 0.1 | GO:0046341 | CDP-diacylglycerol metabolic process(GO:0046341) |
0.0 | 0.1 | GO:0070368 | positive regulation of hepatocyte differentiation(GO:0070368) |
0.0 | 0.1 | GO:0044829 | positive regulation by host of viral genome replication(GO:0044829) |
0.0 | 0.1 | GO:0044359 | modulation of molecular function in other organism(GO:0044359) negative regulation of molecular function in other organism(GO:0044362) negative regulation of molecular function in other organism involved in symbiotic interaction(GO:0052204) modulation of molecular function in other organism involved in symbiotic interaction(GO:0052205) |
0.0 | 0.1 | GO:2000210 | positive regulation of anoikis(GO:2000210) |
0.0 | 0.1 | GO:0072282 | metanephric nephron tubule morphogenesis(GO:0072282) |
0.0 | 0.2 | GO:0051601 | exocyst localization(GO:0051601) |
0.0 | 0.1 | GO:0072321 | chaperone-mediated protein transport(GO:0072321) |
0.0 | 0.1 | GO:0007621 | negative regulation of female receptivity(GO:0007621) |
0.0 | 0.1 | GO:0019532 | oxalate transport(GO:0019532) |
0.0 | 0.2 | GO:0043249 | erythrocyte maturation(GO:0043249) |
0.0 | 0.2 | GO:0000012 | single strand break repair(GO:0000012) |
0.0 | 0.1 | GO:2000319 | regulation of T-helper 17 cell differentiation(GO:2000319) |
0.0 | 1.1 | GO:0070206 | protein trimerization(GO:0070206) |
0.0 | 0.0 | GO:0034650 | cortisol metabolic process(GO:0034650) |
0.0 | 0.0 | GO:0002877 | regulation of acute inflammatory response to non-antigenic stimulus(GO:0002877) |
0.0 | 0.1 | GO:1904668 | positive regulation of ubiquitin protein ligase activity(GO:1904668) |
0.0 | 0.0 | GO:0085020 | protein K6-linked ubiquitination(GO:0085020) |
0.0 | 0.3 | GO:0044065 | regulation of respiratory system process(GO:0044065) |
0.0 | 0.1 | GO:0035826 | rubidium ion transport(GO:0035826) |
0.0 | 0.6 | GO:0002021 | response to dietary excess(GO:0002021) |
0.0 | 0.1 | GO:0070885 | negative regulation of calcineurin-NFAT signaling cascade(GO:0070885) |
0.0 | 0.2 | GO:0014898 | muscle hypertrophy in response to stress(GO:0003299) cardiac muscle adaptation(GO:0014887) cardiac muscle hypertrophy in response to stress(GO:0014898) |
0.0 | 0.1 | GO:0001765 | membrane raft assembly(GO:0001765) |
0.0 | 0.1 | GO:0002091 | negative regulation of receptor internalization(GO:0002091) |
0.0 | 0.5 | GO:1902108 | regulation of mitochondrial membrane permeability involved in apoptotic process(GO:1902108) |
0.0 | 0.1 | GO:0035523 | protein K29-linked deubiquitination(GO:0035523) protein K33-linked deubiquitination(GO:1990168) |
0.0 | 0.1 | GO:0042559 | pteridine-containing compound biosynthetic process(GO:0042559) |
0.0 | 0.1 | GO:0030174 | regulation of DNA-dependent DNA replication initiation(GO:0030174) |
0.0 | 0.1 | GO:0003219 | cardiac right ventricle formation(GO:0003219) |
0.0 | 0.0 | GO:0071727 | response to triacyl bacterial lipopeptide(GO:0071725) cellular response to triacyl bacterial lipopeptide(GO:0071727) |
0.0 | 0.1 | GO:0030321 | transepithelial chloride transport(GO:0030321) |
0.0 | 0.1 | GO:0035624 | receptor transactivation(GO:0035624) epidermal growth factor-activated receptor transactivation by G-protein coupled receptor signaling pathway(GO:0035625) activation of MAPK activity by adrenergic receptor signaling pathway(GO:0071883) |
0.0 | 0.2 | GO:0009067 | aspartate family amino acid biosynthetic process(GO:0009067) |
0.0 | 0.1 | GO:2001274 | negative regulation of glucose import in response to insulin stimulus(GO:2001274) |
0.0 | 0.0 | GO:0051964 | negative regulation of synapse assembly(GO:0051964) |
0.0 | 0.0 | GO:0071499 | response to laminar fluid shear stress(GO:0034616) cellular response to laminar fluid shear stress(GO:0071499) |
0.0 | 0.1 | GO:2000562 | negative regulation of CD4-positive, alpha-beta T cell proliferation(GO:2000562) |
0.0 | 0.1 | GO:1904938 | dopaminergic neuron axon guidance(GO:0036514) planar cell polarity pathway involved in axon guidance(GO:1904938) |
0.0 | 0.2 | GO:0018344 | protein geranylgeranylation(GO:0018344) |
0.0 | 0.0 | GO:0006824 | cobalt ion transport(GO:0006824) |
0.0 | 0.5 | GO:0070979 | protein K11-linked ubiquitination(GO:0070979) |
0.0 | 0.1 | GO:0043101 | purine-containing compound salvage(GO:0043101) |
0.0 | 0.1 | GO:0030259 | lipid glycosylation(GO:0030259) |
0.0 | 0.1 | GO:0060164 | regulation of timing of neuron differentiation(GO:0060164) |
0.0 | 0.1 | GO:1902626 | assembly of large subunit precursor of preribosome(GO:1902626) |
0.0 | 0.2 | GO:0051654 | establishment of mitochondrion localization(GO:0051654) |
0.0 | 0.1 | GO:2000348 | regulation of CD40 signaling pathway(GO:2000348) |
0.0 | 0.0 | GO:0006705 | mineralocorticoid biosynthetic process(GO:0006705) |
0.0 | 0.1 | GO:0036376 | sodium ion export from cell(GO:0036376) |
0.0 | 0.0 | GO:1902445 | regulation of mitochondrial membrane permeability involved in programmed necrotic cell death(GO:1902445) |
0.0 | 0.1 | GO:1903887 | motile primary cilium assembly(GO:1903887) |
0.0 | 0.0 | GO:0045794 | negative regulation of cell volume(GO:0045794) |
0.0 | 0.1 | GO:1902774 | late endosome to lysosome transport(GO:1902774) |
0.0 | 0.1 | GO:0007217 | tachykinin receptor signaling pathway(GO:0007217) |
0.0 | 0.1 | GO:0034475 | U4 snRNA 3'-end processing(GO:0034475) |
0.0 | 0.1 | GO:0051970 | negative regulation of transmission of nerve impulse(GO:0051970) |
0.0 | 0.0 | GO:0071316 | cellular response to nicotine(GO:0071316) |
0.0 | 0.1 | GO:0035092 | sperm chromatin condensation(GO:0035092) |
0.0 | 0.0 | GO:0090306 | spindle assembly involved in meiosis(GO:0090306) |
0.0 | 0.0 | GO:0060399 | positive regulation of growth hormone receptor signaling pathway(GO:0060399) |
0.0 | 0.2 | GO:1901407 | regulation of phosphorylation of RNA polymerase II C-terminal domain(GO:1901407) positive regulation of phosphorylation of RNA polymerase II C-terminal domain(GO:1901409) |
0.0 | 0.0 | GO:2000726 | negative regulation of cardiac muscle cell differentiation(GO:2000726) |
0.0 | 0.0 | GO:0060631 | regulation of meiosis I(GO:0060631) |
0.0 | 0.2 | GO:0046541 | saliva secretion(GO:0046541) |
0.0 | 0.1 | GO:0010890 | positive regulation of sequestering of triglyceride(GO:0010890) |
0.0 | 0.0 | GO:0072602 | interleukin-4 secretion(GO:0072602) |
0.0 | 0.1 | GO:0031506 | cell wall mannoprotein biosynthetic process(GO:0000032) mannoprotein metabolic process(GO:0006056) mannoprotein biosynthetic process(GO:0006057) cell wall glycoprotein biosynthetic process(GO:0031506) cell wall biogenesis(GO:0042546) cell wall macromolecule biosynthetic process(GO:0044038) chain elongation of O-linked mannose residue(GO:0044845) cellular component macromolecule biosynthetic process(GO:0070589) |
0.0 | 0.2 | GO:0061162 | establishment of monopolar cell polarity(GO:0061162) establishment or maintenance of monopolar cell polarity(GO:0061339) |
0.0 | 0.1 | GO:0033578 | protein glycosylation in Golgi(GO:0033578) |
0.0 | 0.0 | GO:0009946 | proximal/distal axis specification(GO:0009946) |
0.0 | 0.0 | GO:0042117 | monocyte activation(GO:0042117) |
0.0 | 0.0 | GO:0039536 | negative regulation of RIG-I signaling pathway(GO:0039536) |
0.0 | 0.0 | GO:0003330 | regulation of extracellular matrix constituent secretion(GO:0003330) positive regulation of extracellular matrix constituent secretion(GO:0003331) |
0.0 | 0.0 | GO:0010835 | regulation of protein ADP-ribosylation(GO:0010835) |
0.0 | 0.1 | GO:0030035 | microspike assembly(GO:0030035) |
0.0 | 0.3 | GO:0006465 | signal peptide processing(GO:0006465) |
0.0 | 0.1 | GO:0006384 | transcription initiation from RNA polymerase III promoter(GO:0006384) |
0.0 | 0.1 | GO:0090042 | tubulin deacetylation(GO:0090042) |
0.0 | 0.0 | GO:2000169 | regulation of peptidyl-cysteine S-nitrosylation(GO:2000169) |
0.0 | 0.0 | GO:0044068 | modulation by symbiont of host cellular process(GO:0044068) |
0.0 | 0.0 | GO:0001996 | positive regulation of heart rate by epinephrine-norepinephrine(GO:0001996) |
0.0 | 0.0 | GO:0007066 | female meiosis sister chromatid cohesion(GO:0007066) |
0.0 | 0.0 | GO:0048290 | isotype switching to IgA isotypes(GO:0048290) regulation of isotype switching to IgA isotypes(GO:0048296) |
0.0 | 0.1 | GO:0033299 | secretion of lysosomal enzymes(GO:0033299) |
0.0 | 0.1 | GO:0006685 | sphingomyelin catabolic process(GO:0006685) |
0.0 | 0.0 | GO:1902455 | negative regulation of stem cell population maintenance(GO:1902455) |
0.0 | 0.0 | GO:0006344 | maintenance of chromatin silencing(GO:0006344) |
0.0 | 0.1 | GO:0072383 | plus-end-directed vesicle transport along microtubule(GO:0072383) plus-end-directed organelle transport along microtubule(GO:0072386) |
0.0 | 0.1 | GO:0051835 | positive regulation of synapse structural plasticity(GO:0051835) |
0.0 | 0.3 | GO:0007190 | activation of adenylate cyclase activity(GO:0007190) |
0.0 | 0.1 | GO:0001302 | replicative cell aging(GO:0001302) |
0.0 | 0.3 | GO:0015986 | energy coupled proton transport, down electrochemical gradient(GO:0015985) ATP synthesis coupled proton transport(GO:0015986) |
0.0 | 0.2 | GO:1902043 | positive regulation of extrinsic apoptotic signaling pathway via death domain receptors(GO:1902043) |
0.0 | 0.1 | GO:0032511 | late endosome to vacuole transport via multivesicular body sorting pathway(GO:0032511) protein targeting to vacuole involved in ubiquitin-dependent protein catabolic process via the multivesicular body sorting pathway(GO:0043328) |
0.0 | 0.1 | GO:0035357 | peroxisome proliferator activated receptor signaling pathway(GO:0035357) |
0.0 | 0.1 | GO:1904491 | protein localization to ciliary transition zone(GO:1904491) |
0.0 | 0.1 | GO:0006177 | GMP biosynthetic process(GO:0006177) |
0.0 | 0.1 | GO:0051967 | negative regulation of synaptic transmission, glutamatergic(GO:0051967) |
0.0 | 0.1 | GO:0031468 | nuclear envelope reassembly(GO:0031468) |
0.0 | 0.2 | GO:0032400 | melanosome localization(GO:0032400) |
0.0 | 0.0 | GO:0019856 | 'de novo' pyrimidine nucleobase biosynthetic process(GO:0006207) pyrimidine nucleobase biosynthetic process(GO:0019856) |
0.0 | 0.1 | GO:0060060 | post-embryonic retina morphogenesis in camera-type eye(GO:0060060) |
0.0 | 0.1 | GO:0021910 | smoothened signaling pathway involved in ventral spinal cord patterning(GO:0021910) negative regulation of smoothened signaling pathway involved in ventral spinal cord patterning(GO:0021914) |
0.0 | 0.0 | GO:0070889 | platelet alpha granule organization(GO:0070889) |
0.0 | 0.0 | GO:0010870 | positive regulation of receptor biosynthetic process(GO:0010870) |
0.0 | 0.1 | GO:0021860 | pyramidal neuron development(GO:0021860) |
0.0 | 0.2 | GO:0015824 | proline transport(GO:0015824) |
0.0 | 0.0 | GO:0030421 | defecation(GO:0030421) |
0.0 | 0.1 | GO:0006041 | glucosamine metabolic process(GO:0006041) |
0.0 | 0.1 | GO:0006432 | phenylalanyl-tRNA aminoacylation(GO:0006432) |
0.0 | 0.0 | GO:0097151 | positive regulation of inhibitory postsynaptic potential(GO:0097151) |
0.0 | 0.1 | GO:1903546 | protein localization to photoreceptor outer segment(GO:1903546) |
0.0 | 0.0 | GO:1904742 | regulation of telomeric DNA binding(GO:1904742) |
0.0 | 0.1 | GO:0006851 | mitochondrial calcium ion transport(GO:0006851) |
0.0 | 0.1 | GO:0030070 | insulin processing(GO:0030070) |
0.0 | 0.0 | GO:0002838 | negative regulation of response to tumor cell(GO:0002835) negative regulation of immune response to tumor cell(GO:0002838) |
0.0 | 0.0 | GO:0070189 | kynurenine metabolic process(GO:0070189) |
0.0 | 0.2 | GO:0033235 | positive regulation of protein sumoylation(GO:0033235) |
0.0 | 0.1 | GO:0045019 | negative regulation of nitric oxide biosynthetic process(GO:0045019) negative regulation of nitric oxide metabolic process(GO:1904406) |
0.0 | 0.0 | GO:0007290 | spermatid nucleus elongation(GO:0007290) |
0.0 | 0.1 | GO:0002291 | T cell activation via T cell receptor contact with antigen bound to MHC molecule on antigen presenting cell(GO:0002291) |
0.0 | 0.3 | GO:0016578 | histone deubiquitination(GO:0016578) |
0.0 | 0.0 | GO:0060510 | Type II pneumocyte differentiation(GO:0060510) |
0.0 | 0.0 | GO:0051790 | short-chain fatty acid biosynthetic process(GO:0051790) |
0.0 | 0.4 | GO:0051310 | metaphase plate congression(GO:0051310) |
0.0 | 0.1 | GO:0072502 | cellular phosphate ion homeostasis(GO:0030643) cellular trivalent inorganic anion homeostasis(GO:0072502) |
0.0 | 0.0 | GO:0072697 | protein localization to cell cortex(GO:0072697) |
0.0 | 0.1 | GO:0042760 | very long-chain fatty acid catabolic process(GO:0042760) |
0.0 | 0.2 | GO:0008089 | anterograde axonal transport(GO:0008089) |
0.0 | 0.0 | GO:0033034 | positive regulation of myeloid cell apoptotic process(GO:0033034) |
0.0 | 0.0 | GO:1902498 | regulation of protein autoubiquitination(GO:1902498) |
0.0 | 0.2 | GO:0051569 | regulation of histone H3-K4 methylation(GO:0051569) |
0.0 | 0.1 | GO:0046643 | regulation of gamma-delta T cell differentiation(GO:0045586) regulation of gamma-delta T cell activation(GO:0046643) |
0.0 | 0.0 | GO:0046984 | regulation of hemoglobin biosynthetic process(GO:0046984) |
0.0 | 0.0 | GO:0060050 | positive regulation of protein glycosylation(GO:0060050) |
0.0 | 0.1 | GO:0035020 | regulation of Rac protein signal transduction(GO:0035020) |
0.0 | 0.1 | GO:0006398 | mRNA 3'-end processing by stem-loop binding and cleavage(GO:0006398) |
0.0 | 0.1 | GO:0000920 | cell separation after cytokinesis(GO:0000920) |
0.0 | 0.2 | GO:0006613 | cotranslational protein targeting to membrane(GO:0006613) |
0.0 | 0.0 | GO:1901525 | negative regulation of macromitophagy(GO:1901525) negative regulation of mitophagy(GO:1903147) |
0.0 | 0.1 | GO:0071625 | vocalization behavior(GO:0071625) |
0.0 | 0.0 | GO:1902608 | regulation of large conductance calcium-activated potassium channel activity(GO:1902606) positive regulation of large conductance calcium-activated potassium channel activity(GO:1902608) |
0.0 | 0.1 | GO:0060700 | regulation of ribonuclease activity(GO:0060700) |
0.0 | 0.1 | GO:0002361 | CD4-positive, CD25-positive, alpha-beta regulatory T cell differentiation(GO:0002361) |
0.0 | 0.0 | GO:0051562 | negative regulation of mitochondrial calcium ion concentration(GO:0051562) |
0.0 | 0.1 | GO:1904220 | regulation of CDP-diacylglycerol-serine O-phosphatidyltransferase activity(GO:1904217) positive regulation of CDP-diacylglycerol-serine O-phosphatidyltransferase activity(GO:1904219) regulation of serine C-palmitoyltransferase activity(GO:1904220) positive regulation of serine C-palmitoyltransferase activity(GO:1904222) |
0.0 | 0.1 | GO:0034154 | toll-like receptor 7 signaling pathway(GO:0034154) |
0.0 | 0.1 | GO:0019276 | UDP-N-acetylgalactosamine metabolic process(GO:0019276) |
0.0 | 0.0 | GO:0098532 | histone H3-K27 trimethylation(GO:0098532) |
0.0 | 0.0 | GO:0042494 | detection of bacterial lipoprotein(GO:0042494) |
0.0 | 0.1 | GO:0060671 | epithelial cell differentiation involved in embryonic placenta development(GO:0060671) epithelial cell morphogenesis involved in placental branching(GO:0060672) |
0.0 | 0.1 | GO:0015886 | heme transport(GO:0015886) |
0.0 | 0.1 | GO:0001771 | immunological synapse formation(GO:0001771) |
0.0 | 0.1 | GO:0098904 | regulation of AV node cell action potential(GO:0098904) |
0.0 | 0.1 | GO:0043144 | snoRNA processing(GO:0043144) |
0.0 | 0.1 | GO:0006393 | termination of mitochondrial transcription(GO:0006393) |
0.0 | 0.1 | GO:0043517 | positive regulation of DNA damage response, signal transduction by p53 class mediator(GO:0043517) |
0.0 | 0.0 | GO:0030382 | sperm mitochondrion organization(GO:0030382) |
0.0 | 0.0 | GO:0090403 | oxidative stress-induced premature senescence(GO:0090403) |
0.0 | 0.1 | GO:0043985 | histone H4-R3 methylation(GO:0043985) |
0.0 | 0.1 | GO:0060526 | prostate glandular acinus morphogenesis(GO:0060526) prostate epithelial cord arborization involved in prostate glandular acinus morphogenesis(GO:0060527) |
0.0 | 0.1 | GO:0060330 | regulation of response to interferon-gamma(GO:0060330) |
0.0 | 0.1 | GO:0045605 | negative regulation of epidermal cell differentiation(GO:0045605) |
0.0 | 0.1 | GO:0051000 | positive regulation of nitric-oxide synthase activity(GO:0051000) |
0.0 | 0.5 | GO:0051865 | protein autoubiquitination(GO:0051865) |
0.0 | 0.1 | GO:0006007 | glucose catabolic process(GO:0006007) |
0.0 | 0.1 | GO:0048672 | positive regulation of collateral sprouting(GO:0048672) |
0.0 | 0.0 | GO:1904469 | positive regulation of tumor necrosis factor secretion(GO:1904469) |
0.0 | 0.2 | GO:0060009 | Sertoli cell development(GO:0060009) |
0.0 | 0.1 | GO:0042364 | water-soluble vitamin biosynthetic process(GO:0042364) |
0.0 | 0.0 | GO:0072584 | caveolin-mediated endocytosis(GO:0072584) |
0.0 | 0.0 | GO:0070574 | cadmium ion transport(GO:0015691) cadmium ion transmembrane transport(GO:0070574) |
0.0 | 0.1 | GO:0043589 | skin morphogenesis(GO:0043589) |
0.0 | 0.0 | GO:0021960 | anterior commissure morphogenesis(GO:0021960) |
0.0 | 0.1 | GO:0035457 | cellular response to interferon-alpha(GO:0035457) |
0.0 | 0.1 | GO:0046007 | negative regulation of activated T cell proliferation(GO:0046007) |
0.0 | 0.1 | GO:2000778 | positive regulation of interleukin-6 secretion(GO:2000778) |
0.0 | 0.2 | GO:0006895 | Golgi to endosome transport(GO:0006895) |
0.0 | 0.0 | GO:0071169 | establishment of protein localization to chromatin(GO:0071169) |
0.0 | 0.0 | GO:0033762 | response to glucagon(GO:0033762) |
0.0 | 0.0 | GO:0008090 | retrograde axonal transport(GO:0008090) |
0.0 | 0.0 | GO:0010643 | cell communication by chemical coupling(GO:0010643) |
0.0 | 0.0 | GO:0006391 | transcription initiation from mitochondrial promoter(GO:0006391) |
0.0 | 0.1 | GO:0031119 | tRNA pseudouridine synthesis(GO:0031119) |
0.0 | 0.0 | GO:0006435 | threonyl-tRNA aminoacylation(GO:0006435) |
0.0 | 0.0 | GO:0009448 | gamma-aminobutyric acid metabolic process(GO:0009448) |
0.0 | 0.0 | GO:0045918 | negative regulation of cytolysis(GO:0045918) |
0.0 | 0.1 | GO:0051013 | microtubule severing(GO:0051013) |
0.0 | 0.0 | GO:2000286 | receptor internalization involved in canonical Wnt signaling pathway(GO:2000286) |
0.0 | 0.2 | GO:0051646 | mitochondrion localization(GO:0051646) |
0.0 | 0.1 | GO:0006707 | cholesterol catabolic process(GO:0006707) sterol catabolic process(GO:0016127) |
0.0 | 0.2 | GO:0008209 | androgen metabolic process(GO:0008209) |
0.0 | 0.0 | GO:0035054 | embryonic heart tube anterior/posterior pattern specification(GO:0035054) |
0.0 | 0.0 | GO:0035928 | rRNA import into mitochondrion(GO:0035928) |
0.0 | 0.3 | GO:0034605 | cellular response to heat(GO:0034605) |
0.0 | 0.0 | GO:0098910 | regulation of atrial cardiac muscle cell action potential(GO:0098910) |
0.0 | 0.0 | GO:0002740 | negative regulation of cytokine secretion involved in immune response(GO:0002740) |
0.0 | 0.0 | GO:0045217 | cell-cell junction maintenance(GO:0045217) |
0.0 | 0.0 | GO:0034975 | protein folding in endoplasmic reticulum(GO:0034975) |
0.0 | 0.5 | GO:0070936 | protein K48-linked ubiquitination(GO:0070936) |
0.0 | 0.1 | GO:0051044 | positive regulation of membrane protein ectodomain proteolysis(GO:0051044) |
0.0 | 0.0 | GO:0046543 | development of secondary female sexual characteristics(GO:0046543) |
0.0 | 0.0 | GO:0007412 | axon target recognition(GO:0007412) |
0.0 | 0.0 | GO:0000212 | meiotic spindle organization(GO:0000212) |
0.0 | 0.1 | GO:0016540 | protein autoprocessing(GO:0016540) |
0.0 | 0.1 | GO:0070886 | positive regulation of calcineurin-NFAT signaling cascade(GO:0070886) |
0.0 | 0.0 | GO:0034628 | nicotinamide nucleotide biosynthetic process from aspartate(GO:0019355) 'de novo' NAD biosynthetic process from aspartate(GO:0034628) |
0.0 | 0.1 | GO:0070940 | dephosphorylation of RNA polymerase II C-terminal domain(GO:0070940) |
0.0 | 0.1 | GO:0035372 | protein localization to microtubule(GO:0035372) |
0.0 | 0.0 | GO:0060316 | positive regulation of ryanodine-sensitive calcium-release channel activity(GO:0060316) |
0.0 | 0.0 | GO:0032290 | peripheral nervous system myelin formation(GO:0032290) |
0.0 | 0.0 | GO:0036438 | maintenance of lens transparency(GO:0036438) |
0.0 | 0.1 | GO:0032229 | negative regulation of synaptic transmission, GABAergic(GO:0032229) |
0.0 | 0.0 | GO:0042723 | thiamine metabolic process(GO:0006772) thiamine-containing compound metabolic process(GO:0042723) |
0.0 | 0.1 | GO:0034227 | tRNA thio-modification(GO:0034227) |
0.0 | 0.1 | GO:0009313 | oligosaccharide catabolic process(GO:0009313) |
0.0 | 0.3 | GO:0006829 | zinc II ion transport(GO:0006829) |
0.0 | 0.1 | GO:0015701 | bicarbonate transport(GO:0015701) |
0.0 | 0.0 | GO:0070782 | phosphatidylserine exposure on apoptotic cell surface(GO:0070782) |
0.0 | 0.1 | GO:0000479 | endonucleolytic cleavage of tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000479) |
0.0 | 0.0 | GO:0042534 | tumor necrosis factor biosynthetic process(GO:0042533) regulation of tumor necrosis factor biosynthetic process(GO:0042534) |
0.0 | 0.0 | GO:0002426 | immunoglobulin production in mucosal tissue(GO:0002426) |
0.0 | 0.0 | GO:0007262 | STAT protein import into nucleus(GO:0007262) |
0.0 | 0.1 | GO:1990440 | positive regulation of transcription from RNA polymerase II promoter in response to endoplasmic reticulum stress(GO:1990440) |
0.0 | 0.0 | GO:0045080 | positive regulation of chemokine biosynthetic process(GO:0045080) |
0.0 | 0.1 | GO:0060710 | chorio-allantoic fusion(GO:0060710) |
0.0 | 0.0 | GO:2000195 | negative regulation of female gonad development(GO:2000195) |
0.0 | 0.0 | GO:0071635 | negative regulation of transforming growth factor beta production(GO:0071635) |
0.0 | 0.0 | GO:0045085 | negative regulation of interleukin-2 biosynthetic process(GO:0045085) |
0.0 | 0.1 | GO:0018202 | peptidyl-histidine modification(GO:0018202) |
0.0 | 0.0 | GO:0060371 | regulation of atrial cardiac muscle cell membrane depolarization(GO:0060371) |
0.0 | 0.0 | GO:0060160 | negative regulation of dopamine receptor signaling pathway(GO:0060160) |
0.0 | 0.0 | GO:0070131 | positive regulation of mitochondrial translation(GO:0070131) |
0.0 | 0.0 | GO:0030886 | negative regulation of myeloid dendritic cell activation(GO:0030886) |
0.0 | 0.2 | GO:0071472 | cellular response to salt stress(GO:0071472) |
0.0 | 0.2 | GO:0070536 | protein K63-linked deubiquitination(GO:0070536) |
0.0 | 0.1 | GO:0060080 | inhibitory postsynaptic potential(GO:0060080) |
0.0 | 0.0 | GO:0060729 | intestinal epithelial structure maintenance(GO:0060729) |
0.0 | 0.1 | GO:1902229 | regulation of intrinsic apoptotic signaling pathway in response to DNA damage(GO:1902229) |
0.0 | 0.0 | GO:0044793 | negative regulation by host of viral process(GO:0044793) |
0.0 | 0.0 | GO:2000297 | negative regulation of synapse maturation(GO:2000297) |
0.0 | 0.1 | GO:0032826 | natural killer cell differentiation involved in immune response(GO:0002325) negative regulation of natural killer cell differentiation(GO:0032824) regulation of natural killer cell differentiation involved in immune response(GO:0032826) negative regulation of natural killer cell differentiation involved in immune response(GO:0032827) |
0.0 | 0.3 | GO:0048013 | ephrin receptor signaling pathway(GO:0048013) |
0.0 | 0.1 | GO:0090383 | phagosome acidification(GO:0090383) |
0.0 | 0.1 | GO:0030913 | paranodal junction assembly(GO:0030913) |
0.0 | 0.0 | GO:0031914 | negative regulation of synaptic plasticity(GO:0031914) |
0.0 | 0.1 | GO:0006104 | succinyl-CoA metabolic process(GO:0006104) |
0.0 | 0.1 | GO:0048304 | positive regulation of isotype switching to IgG isotypes(GO:0048304) |
0.0 | 0.0 | GO:0010566 | regulation of ketone biosynthetic process(GO:0010566) |
0.0 | 0.0 | GO:0070199 | establishment of protein localization to chromosome(GO:0070199) |
0.0 | 0.0 | GO:0018242 | protein O-linked glycosylation via serine(GO:0018242) |
0.0 | 0.1 | GO:0045899 | positive regulation of RNA polymerase II transcriptional preinitiation complex assembly(GO:0045899) |
0.0 | 0.1 | GO:0001921 | positive regulation of receptor recycling(GO:0001921) |
0.0 | 0.1 | GO:0097428 | protein maturation by iron-sulfur cluster transfer(GO:0097428) |
0.0 | 0.0 | GO:0045163 | clustering of voltage-gated potassium channels(GO:0045163) |
0.0 | 0.1 | GO:0071158 | positive regulation of cell cycle arrest(GO:0071158) |
0.0 | 0.0 | GO:0002430 | complement receptor mediated signaling pathway(GO:0002430) |
0.0 | 0.0 | GO:0006297 | nucleotide-excision repair, DNA gap filling(GO:0006297) |
0.0 | 0.1 | GO:0021902 | commitment of neuronal cell to specific neuron type in forebrain(GO:0021902) |
0.0 | 0.1 | GO:0045040 | protein import into mitochondrial outer membrane(GO:0045040) |
0.0 | 0.4 | GO:0033141 | regulation of peptidyl-serine phosphorylation of STAT protein(GO:0033139) positive regulation of peptidyl-serine phosphorylation of STAT protein(GO:0033141) |
0.0 | 0.1 | GO:0021796 | cerebral cortex regionalization(GO:0021796) |
0.0 | 0.0 | GO:0007008 | outer mitochondrial membrane organization(GO:0007008) |
0.0 | 0.0 | GO:0031340 | positive regulation of vesicle fusion(GO:0031340) |
0.0 | 0.1 | GO:0017062 | respiratory chain complex III assembly(GO:0017062) mitochondrial respiratory chain complex III assembly(GO:0034551) mitochondrial respiratory chain complex III biogenesis(GO:0097033) |
0.0 | 0.0 | GO:0043173 | nucleotide salvage(GO:0043173) |
0.0 | 0.1 | GO:0045116 | protein neddylation(GO:0045116) |
0.0 | 0.0 | GO:1900748 | positive regulation of vascular endothelial growth factor signaling pathway(GO:1900748) |
0.0 | 0.0 | GO:0097343 | ripoptosome assembly(GO:0097343) ripoptosome assembly involved in necroptotic process(GO:1901026) |
0.0 | 0.1 | GO:0090201 | negative regulation of release of cytochrome c from mitochondria(GO:0090201) |
0.0 | 0.0 | GO:0002309 | T cell proliferation involved in immune response(GO:0002309) |
0.0 | 0.2 | GO:0033344 | cholesterol efflux(GO:0033344) |
0.0 | 0.0 | GO:1903071 | positive regulation of ER-associated ubiquitin-dependent protein catabolic process(GO:1903071) |
0.0 | 0.0 | GO:0002339 | B cell selection(GO:0002339) |
0.0 | 0.2 | GO:0016601 | Rac protein signal transduction(GO:0016601) |
0.0 | 0.1 | GO:0031536 | positive regulation of exit from mitosis(GO:0031536) |
0.0 | 0.0 | GO:0036315 | cellular response to sterol(GO:0036315) |
0.0 | 0.5 | GO:0045454 | cell redox homeostasis(GO:0045454) |
0.0 | 0.1 | GO:0090151 | protein import into mitochondrial inner membrane(GO:0045039) establishment of protein localization to mitochondrial membrane(GO:0090151) |
0.0 | 0.0 | GO:0071027 | nuclear RNA surveillance(GO:0071027) nuclear mRNA surveillance(GO:0071028) |
0.0 | 0.0 | GO:0046909 | intermembrane transport(GO:0046909) |
0.0 | 0.0 | GO:2000542 | negative regulation of gastrulation(GO:2000542) |
0.0 | 0.0 | GO:0048014 | Tie signaling pathway(GO:0048014) |
0.0 | 0.0 | GO:0016259 | selenocysteine metabolic process(GO:0016259) |
0.0 | 0.1 | GO:0050901 | leukocyte tethering or rolling(GO:0050901) |
0.0 | 0.0 | GO:0014831 | gastro-intestinal system smooth muscle contraction(GO:0014831) |
0.0 | 0.0 | GO:1903587 | regulation of blood vessel endothelial cell proliferation involved in sprouting angiogenesis(GO:1903587) |
0.0 | 0.0 | GO:0010032 | meiotic chromosome condensation(GO:0010032) |
0.0 | 0.0 | GO:0070816 | phosphorylation of RNA polymerase II C-terminal domain(GO:0070816) |
0.0 | 0.0 | GO:0000237 | leptotene(GO:0000237) |
0.0 | 0.0 | GO:0045002 | double-strand break repair via single-strand annealing(GO:0045002) |
0.0 | 0.1 | GO:0071361 | cellular response to ethanol(GO:0071361) |
0.0 | 0.0 | GO:0051305 | chromosome movement towards spindle pole(GO:0051305) |
0.0 | 0.2 | GO:0000413 | protein peptidyl-prolyl isomerization(GO:0000413) |
0.0 | 0.0 | GO:0002017 | regulation of blood volume by renal aldosterone(GO:0002017) |
0.0 | 0.2 | GO:0051972 | regulation of telomerase activity(GO:0051972) |
0.0 | 0.0 | GO:0045144 | meiotic sister chromatid segregation(GO:0045144) meiotic sister chromatid cohesion(GO:0051177) |
0.0 | 0.0 | GO:0007227 | signal transduction downstream of smoothened(GO:0007227) |
0.0 | 0.1 | GO:0032210 | regulation of telomere maintenance via telomerase(GO:0032210) |
0.0 | 0.4 | GO:0072332 | intrinsic apoptotic signaling pathway by p53 class mediator(GO:0072332) |
0.0 | 0.1 | GO:0090005 | negative regulation of establishment of protein localization to plasma membrane(GO:0090005) |
0.0 | 0.0 | GO:0070777 | D-aspartate transport(GO:0070777) D-aspartate import(GO:0070779) |
0.0 | 0.0 | GO:2000418 | positive regulation of eosinophil migration(GO:2000418) |
0.0 | 0.1 | GO:0017196 | N-terminal peptidyl-methionine acetylation(GO:0017196) |
0.0 | 0.0 | GO:1903715 | regulation of aerobic respiration(GO:1903715) |
0.0 | 0.0 | GO:0006678 | glucosylceramide metabolic process(GO:0006678) |
0.0 | 0.1 | GO:0051382 | kinetochore assembly(GO:0051382) |
0.0 | 0.1 | GO:0003016 | respiratory system process(GO:0003016) |
0.0 | 0.0 | GO:0018214 | peptidyl-glutamic acid carboxylation(GO:0017187) protein carboxylation(GO:0018214) |
0.0 | 0.2 | GO:1900087 | positive regulation of G1/S transition of mitotic cell cycle(GO:1900087) |
0.0 | 0.0 | GO:2000035 | regulation of stem cell division(GO:2000035) |
0.0 | 0.2 | GO:0019835 | cytolysis(GO:0019835) |
0.0 | 0.0 | GO:0006624 | vacuolar protein processing(GO:0006624) |
0.0 | 0.0 | GO:0044838 | cell quiescence(GO:0044838) |
0.0 | 0.1 | GO:0032516 | positive regulation of phosphoprotein phosphatase activity(GO:0032516) |
0.0 | 0.0 | GO:0021943 | formation of radial glial scaffolds(GO:0021943) |
0.0 | 0.1 | GO:0050884 | neuromuscular process controlling posture(GO:0050884) |
0.0 | 0.0 | GO:0015889 | cobalamin transport(GO:0015889) |
0.0 | 0.2 | GO:0033539 | fatty acid beta-oxidation using acyl-CoA dehydrogenase(GO:0033539) |
0.0 | 0.0 | GO:0048022 | negative regulation of melanin biosynthetic process(GO:0048022) negative regulation of secondary metabolite biosynthetic process(GO:1900377) |
0.0 | 0.1 | GO:0006098 | pentose-phosphate shunt(GO:0006098) |
0.0 | 0.0 | GO:0007196 | adenylate cyclase-inhibiting G-protein coupled glutamate receptor signaling pathway(GO:0007196) |
0.0 | 0.0 | GO:0045054 | constitutive secretory pathway(GO:0045054) |
0.0 | 0.0 | GO:0034501 | protein localization to kinetochore(GO:0034501) |
0.0 | 0.3 | GO:1902476 | chloride transmembrane transport(GO:1902476) |
0.0 | 0.2 | GO:2000649 | regulation of sodium ion transmembrane transporter activity(GO:2000649) |
0.0 | 0.1 | GO:0032981 | NADH dehydrogenase complex assembly(GO:0010257) mitochondrial respiratory chain complex I assembly(GO:0032981) mitochondrial respiratory chain complex I biogenesis(GO:0097031) |
0.0 | 0.0 | GO:0032278 | positive regulation of gonadotropin secretion(GO:0032278) positive regulation of follicle-stimulating hormone secretion(GO:0046881) |
0.0 | 0.1 | GO:0050965 | detection of temperature stimulus involved in sensory perception(GO:0050961) detection of temperature stimulus involved in sensory perception of pain(GO:0050965) |
0.0 | 0.0 | GO:0010482 | epidermal cell division(GO:0010481) regulation of epidermal cell division(GO:0010482) |
0.0 | 0.0 | GO:0070681 | glutaminyl-tRNAGln biosynthesis via transamidation(GO:0070681) |
0.0 | 0.0 | GO:0051534 | negative regulation of NFAT protein import into nucleus(GO:0051534) |
0.0 | 0.1 | GO:0018026 | peptidyl-lysine monomethylation(GO:0018026) |
0.0 | 0.2 | GO:0001574 | ganglioside biosynthetic process(GO:0001574) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.2 | 1.3 | GO:0044214 | spanning component of plasma membrane(GO:0044214) spanning component of membrane(GO:0089717) |
0.2 | 0.8 | GO:0044462 | cell outer membrane(GO:0009279) cell envelope(GO:0030313) external encapsulating structure part(GO:0044462) |
0.2 | 1.3 | GO:0005577 | fibrinogen complex(GO:0005577) |
0.1 | 1.6 | GO:0070852 | cell body fiber(GO:0070852) |
0.1 | 0.4 | GO:0097512 | cardiac myofibril(GO:0097512) |
0.1 | 0.3 | GO:0034750 | Scrib-APC-beta-catenin complex(GO:0034750) |
0.1 | 0.4 | GO:0043293 | apoptosome(GO:0043293) |
0.1 | 0.3 | GO:1990761 | growth cone lamellipodium(GO:1990761) |
0.1 | 0.3 | GO:0046691 | intracellular canaliculus(GO:0046691) |
0.1 | 0.5 | GO:0097255 | R2TP complex(GO:0097255) |
0.1 | 0.2 | GO:0065010 | extracellular membrane-bounded organelle(GO:0065010) |
0.1 | 0.7 | GO:0034366 | spherical high-density lipoprotein particle(GO:0034366) |
0.1 | 0.5 | GO:0005915 | zonula adherens(GO:0005915) |
0.1 | 0.7 | GO:0043219 | lateral loop(GO:0043219) |
0.1 | 0.3 | GO:0033185 | dolichol-phosphate-mannose synthase complex(GO:0033185) |
0.1 | 0.3 | GO:0017133 | mitochondrial electron transfer flavoprotein complex(GO:0017133) electron transfer flavoprotein complex(GO:0045251) |
0.1 | 0.6 | GO:0030008 | TRAPP complex(GO:0030008) |
0.1 | 0.3 | GO:0036449 | microtubule minus-end(GO:0036449) |
0.1 | 0.2 | GO:0000110 | nucleotide-excision repair factor 1 complex(GO:0000110) |
0.1 | 0.1 | GO:0005638 | lamin filament(GO:0005638) |
0.1 | 0.1 | GO:0044615 | nuclear pore nuclear basket(GO:0044615) |
0.1 | 0.4 | GO:0005579 | membrane attack complex(GO:0005579) |
0.1 | 0.6 | GO:0000815 | ESCRT III complex(GO:0000815) |
0.1 | 0.1 | GO:0097025 | MPP7-DLG1-LIN7 complex(GO:0097025) |
0.1 | 0.3 | GO:0005642 | annulate lamellae(GO:0005642) |
0.1 | 0.2 | GO:0032937 | SREBP-SCAP-Insig complex(GO:0032937) |
0.1 | 0.2 | GO:0034274 | Atg12-Atg5-Atg16 complex(GO:0034274) |
0.1 | 0.9 | GO:0033391 | chromatoid body(GO:0033391) |
0.1 | 0.3 | GO:0034992 | microtubule organizing center attachment site(GO:0034992) LINC complex(GO:0034993) |
0.1 | 0.3 | GO:0042765 | GPI-anchor transamidase complex(GO:0042765) |
0.1 | 0.3 | GO:0033093 | Weibel-Palade body(GO:0033093) |
0.1 | 0.3 | GO:0044322 | endoplasmic reticulum quality control compartment(GO:0044322) |
0.1 | 0.3 | GO:0005663 | DNA replication factor C complex(GO:0005663) |
0.1 | 0.2 | GO:0005971 | ribonucleoside-diphosphate reductase complex(GO:0005971) |
0.1 | 0.2 | GO:0005945 | 6-phosphofructokinase complex(GO:0005945) |
0.1 | 0.9 | GO:0005640 | nuclear outer membrane(GO:0005640) |
0.1 | 0.4 | GO:0097197 | tetraspanin-enriched microdomain(GO:0097197) |
0.1 | 1.1 | GO:0005868 | cytoplasmic dynein complex(GO:0005868) |
0.1 | 0.2 | GO:0005610 | laminin-5 complex(GO:0005610) |
0.1 | 0.2 | GO:0097454 | Schwann cell microvillus(GO:0097454) |
0.1 | 0.5 | GO:0036157 | outer dynein arm(GO:0036157) |
0.1 | 0.5 | GO:0005677 | chromatin silencing complex(GO:0005677) |
0.1 | 0.3 | GO:0048237 | rough endoplasmic reticulum lumen(GO:0048237) |
0.1 | 0.3 | GO:0071204 | histone pre-mRNA 3'end processing complex(GO:0071204) |
0.1 | 0.3 | GO:0042406 | extrinsic component of endoplasmic reticulum membrane(GO:0042406) |
0.1 | 0.1 | GO:0031595 | nuclear proteasome complex(GO:0031595) |
0.1 | 0.2 | GO:0061689 | tricellular tight junction(GO:0061689) |
0.1 | 0.4 | GO:0000137 | Golgi cis cisterna(GO:0000137) |
0.1 | 0.4 | GO:0033256 | I-kappaB/NF-kappaB complex(GO:0033256) |
0.1 | 0.3 | GO:0031232 | extrinsic component of external side of plasma membrane(GO:0031232) |
0.1 | 0.2 | GO:0044308 | axonal spine(GO:0044308) |
0.1 | 0.6 | GO:0035686 | sperm fibrous sheath(GO:0035686) |
0.1 | 0.3 | GO:0044233 | ER-mitochondrion membrane contact site(GO:0044233) |
0.1 | 0.5 | GO:0000124 | SAGA complex(GO:0000124) |
0.1 | 0.2 | GO:0016533 | cyclin-dependent protein kinase 5 holoenzyme complex(GO:0016533) |
0.1 | 0.2 | GO:0031466 | Cul5-RING ubiquitin ligase complex(GO:0031466) |
0.0 | 0.4 | GO:0070578 | RISC-loading complex(GO:0070578) |
0.0 | 0.3 | GO:0034098 | VCP-NPL4-UFD1 AAA ATPase complex(GO:0034098) |
0.0 | 0.4 | GO:0031211 | serine C-palmitoyltransferase complex(GO:0017059) endoplasmic reticulum palmitoyltransferase complex(GO:0031211) |
0.0 | 0.1 | GO:0090498 | extrinsic component of Golgi membrane(GO:0090498) |
0.0 | 0.4 | GO:0031209 | SCAR complex(GO:0031209) |
0.0 | 0.3 | GO:0000923 | equatorial microtubule organizing center(GO:0000923) |
0.0 | 0.1 | GO:0034666 | integrin alpha2-beta1 complex(GO:0034666) |
0.0 | 0.1 | GO:0070552 | BRISC complex(GO:0070552) |
0.0 | 0.0 | GO:0031933 | telomeric heterochromatin(GO:0031933) |
0.0 | 0.1 | GO:0009331 | glycerol-3-phosphate dehydrogenase complex(GO:0009331) |
0.0 | 0.4 | GO:0005662 | DNA replication factor A complex(GO:0005662) |
0.0 | 0.2 | GO:0005796 | Golgi lumen(GO:0005796) |
0.0 | 0.4 | GO:0046581 | intercellular canaliculus(GO:0046581) |
0.0 | 0.1 | GO:0034363 | intermediate-density lipoprotein particle(GO:0034363) |
0.0 | 0.4 | GO:0031080 | nuclear pore outer ring(GO:0031080) |
0.0 | 0.4 | GO:0097539 | ciliary transition fiber(GO:0097539) |
0.0 | 0.2 | GO:0031501 | mannosyltransferase complex(GO:0031501) |
0.0 | 0.2 | GO:1990246 | uniplex complex(GO:1990246) |
0.0 | 1.3 | GO:0005720 | nuclear heterochromatin(GO:0005720) |
0.0 | 0.1 | GO:0000836 | ER ubiquitin ligase complex(GO:0000835) Hrd1p ubiquitin ligase complex(GO:0000836) |
0.0 | 0.0 | GO:0070522 | ERCC4-ERCC1 complex(GO:0070522) |
0.0 | 0.4 | GO:0002116 | semaphorin receptor complex(GO:0002116) |
0.0 | 0.0 | GO:0070110 | ciliary neurotrophic factor receptor complex(GO:0070110) |
0.0 | 0.2 | GO:0035363 | histone locus body(GO:0035363) |
0.0 | 0.5 | GO:0030123 | AP-3 adaptor complex(GO:0030123) |
0.0 | 0.2 | GO:0030688 | preribosome, small subunit precursor(GO:0030688) |
0.0 | 0.1 | GO:0035749 | myelin sheath adaxonal region(GO:0035749) |
0.0 | 0.1 | GO:0033179 | proton-transporting V-type ATPase, V0 domain(GO:0033179) |
0.0 | 1.9 | GO:0019005 | SCF ubiquitin ligase complex(GO:0019005) |
0.0 | 0.4 | GO:0031143 | pseudopodium(GO:0031143) |
0.0 | 0.4 | GO:0000783 | telomere cap complex(GO:0000782) nuclear telomere cap complex(GO:0000783) |
0.0 | 0.1 | GO:0030870 | Mre11 complex(GO:0030870) |
0.0 | 0.3 | GO:0000439 | core TFIIH complex(GO:0000439) |
0.0 | 0.1 | GO:0071546 | pi-body(GO:0071546) |
0.0 | 0.1 | GO:0005675 | holo TFIIH complex(GO:0005675) |
0.0 | 1.1 | GO:0000152 | nuclear ubiquitin ligase complex(GO:0000152) |
0.0 | 0.1 | GO:0097513 | myosin II filament(GO:0097513) |
0.0 | 0.1 | GO:0070033 | synaptobrevin 2-SNAP-25-syntaxin-1a-complexin II complex(GO:0070033) |
0.0 | 0.1 | GO:0005968 | Rab-protein geranylgeranyltransferase complex(GO:0005968) |
0.0 | 0.8 | GO:0035861 | site of double-strand break(GO:0035861) |
0.0 | 0.3 | GO:0034464 | BBSome(GO:0034464) |
0.0 | 0.2 | GO:0005869 | dynactin complex(GO:0005869) |
0.0 | 0.6 | GO:0097225 | sperm midpiece(GO:0097225) |
0.0 | 0.1 | GO:0032777 | Piccolo NuA4 histone acetyltransferase complex(GO:0032777) |
0.0 | 0.1 | GO:0097058 | CRLF-CLCF1 complex(GO:0097058) |
0.0 | 0.3 | GO:0098554 | cytoplasmic side of endoplasmic reticulum membrane(GO:0098554) |
0.0 | 0.3 | GO:0005665 | DNA-directed RNA polymerase II, core complex(GO:0005665) |
0.0 | 0.4 | GO:0005753 | mitochondrial proton-transporting ATP synthase complex(GO:0005753) |
0.0 | 0.1 | GO:0097524 | sperm plasma membrane(GO:0097524) |
0.0 | 0.2 | GO:0000347 | THO complex(GO:0000347) THO complex part of transcription export complex(GO:0000445) |
0.0 | 0.4 | GO:0005736 | DNA-directed RNA polymerase I complex(GO:0005736) |
0.0 | 0.1 | GO:0033588 | Elongator holoenzyme complex(GO:0033588) |
0.0 | 0.1 | GO:0030485 | smooth muscle contractile fiber(GO:0030485) |
0.0 | 0.1 | GO:0033186 | CAF-1 complex(GO:0033186) |
0.0 | 0.4 | GO:0032279 | asymmetric synapse(GO:0032279) |
0.0 | 0.1 | GO:0043202 | lysosomal lumen(GO:0043202) |
0.0 | 0.1 | GO:0036488 | CHOP-C/EBP complex(GO:0036488) |
0.0 | 0.1 | GO:0031094 | platelet dense tubular network(GO:0031094) |
0.0 | 0.2 | GO:0090571 | RNA polymerase II transcription repressor complex(GO:0090571) |
0.0 | 0.3 | GO:0070938 | contractile ring(GO:0070938) |
0.0 | 0.1 | GO:0000120 | RNA polymerase I transcription factor complex(GO:0000120) |
0.0 | 0.1 | GO:0035355 | Toll-like receptor 2-Toll-like receptor 6 protein complex(GO:0035355) |
0.0 | 0.3 | GO:0031528 | microvillus membrane(GO:0031528) |
0.0 | 0.5 | GO:0035371 | microtubule plus-end(GO:0035371) |
0.0 | 0.1 | GO:0036396 | MIS complex(GO:0036396) |
0.0 | 0.1 | GO:0070876 | SOSS complex(GO:0070876) |
0.0 | 0.2 | GO:0071541 | eukaryotic translation initiation factor 3 complex, eIF3m(GO:0071541) |
0.0 | 0.2 | GO:0036156 | inner dynein arm(GO:0036156) |
0.0 | 0.1 | GO:0070939 | Dsl1p complex(GO:0070939) |
0.0 | 1.2 | GO:0034707 | chloride channel complex(GO:0034707) |
0.0 | 0.1 | GO:0031074 | nucleocytoplasmic shuttling complex(GO:0031074) |
0.0 | 0.2 | GO:0070775 | H3 histone acetyltransferase complex(GO:0070775) MOZ/MORF histone acetyltransferase complex(GO:0070776) |
0.0 | 0.1 | GO:0032010 | phagolysosome(GO:0032010) |
0.0 | 0.0 | GO:0070531 | BRCA1-A complex(GO:0070531) |
0.0 | 1.3 | GO:0032587 | ruffle membrane(GO:0032587) |
0.0 | 0.1 | GO:0031264 | death-inducing signaling complex(GO:0031264) |
0.0 | 0.3 | GO:0042622 | photoreceptor outer segment membrane(GO:0042622) |
0.0 | 0.1 | GO:0001651 | dense fibrillar component(GO:0001651) |
0.0 | 0.1 | GO:0005683 | U7 snRNP(GO:0005683) |
0.0 | 0.2 | GO:0090533 | cation-transporting ATPase complex(GO:0090533) |
0.0 | 0.2 | GO:0031371 | ubiquitin conjugating enzyme complex(GO:0031371) |
0.0 | 0.3 | GO:0000940 | condensed chromosome outer kinetochore(GO:0000940) |
0.0 | 0.3 | GO:0042612 | MHC class I protein complex(GO:0042612) |
0.0 | 0.2 | GO:0000164 | protein phosphatase type 1 complex(GO:0000164) |
0.0 | 0.1 | GO:0031838 | haptoglobin-hemoglobin complex(GO:0031838) |
0.0 | 0.1 | GO:0031084 | BLOC-2 complex(GO:0031084) |
0.0 | 0.1 | GO:0032584 | growth cone membrane(GO:0032584) |
0.0 | 0.2 | GO:0036128 | CatSper complex(GO:0036128) |
0.0 | 0.5 | GO:0022624 | proteasome accessory complex(GO:0022624) |
0.0 | 0.4 | GO:0044215 | other organism(GO:0044215) other organism cell(GO:0044216) other organism part(GO:0044217) |
0.0 | 1.1 | GO:0031903 | peroxisomal membrane(GO:0005778) microbody membrane(GO:0031903) |
0.0 | 0.6 | GO:0044298 | cell body membrane(GO:0044298) |
0.0 | 0.3 | GO:0005666 | DNA-directed RNA polymerase III complex(GO:0005666) |
0.0 | 0.1 | GO:0005967 | mitochondrial pyruvate dehydrogenase complex(GO:0005967) |
0.0 | 0.1 | GO:0089701 | U2AF(GO:0089701) |
0.0 | 0.5 | GO:0030687 | preribosome, large subunit precursor(GO:0030687) |
0.0 | 0.4 | GO:0000145 | exocyst(GO:0000145) |
0.0 | 0.0 | GO:0035985 | senescence-associated heterochromatin focus(GO:0035985) |
0.0 | 0.2 | GO:0031082 | BLOC complex(GO:0031082) |
0.0 | 0.2 | GO:0070652 | HAUS complex(GO:0070652) |
0.0 | 0.5 | GO:0055038 | recycling endosome membrane(GO:0055038) |
0.0 | 0.2 | GO:0072546 | ER membrane protein complex(GO:0072546) |
0.0 | 0.1 | GO:0005745 | m-AAA complex(GO:0005745) |
0.0 | 0.2 | GO:0097431 | mitotic spindle pole(GO:0097431) |
0.0 | 0.1 | GO:0097228 | sperm principal piece(GO:0097228) |
0.0 | 0.1 | GO:0034715 | pICln-Sm protein complex(GO:0034715) |
0.0 | 0.6 | GO:0005637 | nuclear inner membrane(GO:0005637) |
0.0 | 0.3 | GO:0090568 | NuRD complex(GO:0016581) CHD-type complex(GO:0090545) nuclear transcriptional repressor complex(GO:0090568) |
0.0 | 0.1 | GO:0005672 | transcription factor TFIIA complex(GO:0005672) |
0.0 | 0.1 | GO:0043220 | Schmidt-Lanterman incisure(GO:0043220) |
0.0 | 0.1 | GO:0010009 | cytoplasmic side of endosome membrane(GO:0010009) |
0.0 | 0.3 | GO:0005697 | telomerase holoenzyme complex(GO:0005697) |
0.0 | 0.2 | GO:0017119 | Golgi transport complex(GO:0017119) |
0.0 | 0.3 | GO:0031233 | intrinsic component of external side of plasma membrane(GO:0031233) |
0.0 | 0.1 | GO:0001652 | granular component(GO:0001652) |
0.0 | 0.1 | GO:0000802 | transverse filament(GO:0000802) |
0.0 | 0.2 | GO:0010369 | chromocenter(GO:0010369) |
0.0 | 0.2 | GO:0005721 | pericentric heterochromatin(GO:0005721) |
0.0 | 0.1 | GO:0005958 | DNA-dependent protein kinase-DNA ligase 4 complex(GO:0005958) |
0.0 | 0.3 | GO:0032588 | trans-Golgi network membrane(GO:0032588) |
0.0 | 0.1 | GO:0030286 | dynein complex(GO:0030286) |
0.0 | 0.1 | GO:0090543 | Flemming body(GO:0090543) |
0.0 | 0.2 | GO:0043240 | Fanconi anaemia nuclear complex(GO:0043240) |
0.0 | 0.2 | GO:0033017 | sarcoplasmic reticulum membrane(GO:0033017) |
0.0 | 0.1 | GO:0032982 | myosin filament(GO:0032982) |
0.0 | 0.0 | GO:0097149 | centralspindlin complex(GO:0097149) |
0.0 | 0.1 | GO:0005964 | phosphorylase kinase complex(GO:0005964) |
0.0 | 0.1 | GO:0000796 | condensin complex(GO:0000796) |
0.0 | 0.9 | GO:0031526 | brush border membrane(GO:0031526) |
0.0 | 0.7 | GO:0014704 | intercalated disc(GO:0014704) |
0.0 | 0.1 | GO:0098563 | integral component of synaptic vesicle membrane(GO:0030285) intrinsic component of synaptic vesicle membrane(GO:0098563) |
0.0 | 0.2 | GO:0042555 | MCM complex(GO:0042555) |
0.0 | 0.4 | GO:0046658 | anchored component of plasma membrane(GO:0046658) |
0.0 | 0.4 | GO:0005865 | striated muscle thin filament(GO:0005865) |
0.0 | 0.1 | GO:0071203 | WASH complex(GO:0071203) |
0.0 | 0.1 | GO:0036056 | filtration diaphragm(GO:0036056) slit diaphragm(GO:0036057) |
0.0 | 0.0 | GO:0042827 | platelet dense granule(GO:0042827) |
0.0 | 0.1 | GO:0034388 | Pwp2p-containing subcomplex of 90S preribosome(GO:0034388) |
0.0 | 0.1 | GO:0031254 | uropod(GO:0001931) cell trailing edge(GO:0031254) |
0.0 | 0.0 | GO:0097342 | ripoptosome(GO:0097342) |
0.0 | 0.0 | GO:0031262 | Ndc80 complex(GO:0031262) |
0.0 | 0.1 | GO:0034709 | methylosome(GO:0034709) |
0.0 | 0.1 | GO:0043159 | acrosomal matrix(GO:0043159) |
0.0 | 0.1 | GO:0042825 | TAP complex(GO:0042825) |
0.0 | 0.1 | GO:0042629 | mast cell granule(GO:0042629) |
0.0 | 0.1 | GO:0002189 | ribose phosphate diphosphokinase complex(GO:0002189) |
0.0 | 0.3 | GO:0005689 | U12-type spliceosomal complex(GO:0005689) |
0.0 | 0.1 | GO:0032045 | guanyl-nucleotide exchange factor complex(GO:0032045) |
0.0 | 0.1 | GO:0035189 | Rb-E2F complex(GO:0035189) |
0.0 | 0.1 | GO:0008024 | cyclin/CDK positive transcription elongation factor complex(GO:0008024) |
0.0 | 0.0 | GO:0044326 | dendritic spine neck(GO:0044326) |
0.0 | 0.1 | GO:0001940 | male pronucleus(GO:0001940) |
0.0 | 0.0 | GO:0070044 | synaptobrevin 2-SNAP-25-syntaxin-1a complex(GO:0070044) |
0.0 | 1.0 | GO:0030018 | Z disc(GO:0030018) |
0.0 | 0.0 | GO:1990393 | 3M complex(GO:1990393) |
0.0 | 0.2 | GO:0016471 | vacuolar proton-transporting V-type ATPase complex(GO:0016471) |
0.0 | 0.0 | GO:1990597 | AIP1-IRE1 complex(GO:1990597) |
0.0 | 1.4 | GO:0008021 | synaptic vesicle(GO:0008021) |
0.0 | 0.1 | GO:0032433 | filopodium tip(GO:0032433) |
0.0 | 0.0 | GO:0030891 | VCB complex(GO:0030891) |
0.0 | 0.1 | GO:0048188 | Set1C/COMPASS complex(GO:0048188) |
0.0 | 0.1 | GO:0005952 | cAMP-dependent protein kinase complex(GO:0005952) |
0.0 | 0.3 | GO:0032154 | cleavage furrow(GO:0032154) cell surface furrow(GO:0097610) |
0.0 | 0.2 | GO:0005671 | Ada2/Gcn5/Ada3 transcription activator complex(GO:0005671) |
0.0 | 0.1 | GO:0032389 | MutLalpha complex(GO:0032389) |
0.0 | 0.1 | GO:0008290 | F-actin capping protein complex(GO:0008290) |
0.0 | 0.4 | GO:0005762 | organellar large ribosomal subunit(GO:0000315) mitochondrial large ribosomal subunit(GO:0005762) |
0.0 | 0.6 | GO:0005643 | nuclear pore(GO:0005643) |
0.0 | 0.1 | GO:0005847 | mRNA cleavage and polyadenylation specificity factor complex(GO:0005847) |
0.0 | 0.0 | GO:0005944 | phosphatidylinositol 3-kinase complex, class IB(GO:0005944) |
0.0 | 0.0 | GO:0035032 | phosphatidylinositol 3-kinase complex, class III(GO:0035032) |
0.0 | 0.1 | GO:0034719 | SMN-Sm protein complex(GO:0034719) |
0.0 | 0.0 | GO:0031523 | Myb complex(GO:0031523) |
0.0 | 0.1 | GO:0000788 | nuclear nucleosome(GO:0000788) |
0.0 | 0.0 | GO:0005594 | collagen type IX trimer(GO:0005594) |
0.0 | 1.0 | GO:0016607 | nuclear speck(GO:0016607) |
0.0 | 0.0 | GO:0032021 | NELF complex(GO:0032021) |
0.0 | 0.0 | GO:0016589 | NURF complex(GO:0016589) |
0.0 | 0.0 | GO:1990716 | axonemal central apparatus(GO:1990716) |
0.0 | 0.0 | GO:0070765 | gamma-secretase complex(GO:0070765) |
0.0 | 0.1 | GO:0002199 | zona pellucida receptor complex(GO:0002199) |
0.0 | 0.1 | GO:0097449 | astrocyte projection(GO:0097449) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.5 | 1.4 | GO:0008898 | S-adenosylmethionine-homocysteine S-methyltransferase activity(GO:0008898) |
0.3 | 1.3 | GO:0016841 | ammonia-lyase activity(GO:0016841) |
0.2 | 1.8 | GO:0031995 | insulin-like growth factor II binding(GO:0031995) |
0.2 | 0.6 | GO:0004720 | protein-lysine 6-oxidase activity(GO:0004720) |
0.2 | 0.8 | GO:0017162 | aryl hydrocarbon receptor binding(GO:0017162) |
0.2 | 0.8 | GO:0052650 | NADP-retinol dehydrogenase activity(GO:0052650) |
0.2 | 1.2 | GO:0018685 | alkane 1-monooxygenase activity(GO:0018685) |
0.2 | 0.6 | GO:0019166 | trans-2-enoyl-CoA reductase (NADPH) activity(GO:0019166) |
0.2 | 0.5 | GO:0034988 | Fc-gamma receptor I complex binding(GO:0034988) |
0.2 | 0.5 | GO:0034186 | apolipoprotein A-I binding(GO:0034186) |
0.2 | 0.5 | GO:0004611 | phosphoenolpyruvate carboxykinase activity(GO:0004611) |
0.2 | 0.6 | GO:0019145 | aminobutyraldehyde dehydrogenase activity(GO:0019145) 4-trimethylammoniobutyraldehyde dehydrogenase activity(GO:0047105) |
0.2 | 0.5 | GO:0051425 | PTB domain binding(GO:0051425) |
0.2 | 0.5 | GO:0017153 | sodium:dicarboxylate symporter activity(GO:0017153) |
0.2 | 1.1 | GO:0019870 | potassium channel inhibitor activity(GO:0019870) |
0.2 | 0.5 | GO:0009041 | uridylate kinase activity(GO:0009041) |
0.1 | 0.4 | GO:0080130 | L-phenylalanine:2-oxoglutarate aminotransferase activity(GO:0080130) |
0.1 | 0.4 | GO:0102007 | lactonohydrolase activity(GO:0046573) acyl-L-homoserine-lactone lactonohydrolase activity(GO:0102007) |
0.1 | 0.4 | GO:0030899 | calcium-dependent ATPase activity(GO:0030899) |
0.1 | 1.8 | GO:0015643 | toxic substance binding(GO:0015643) |
0.1 | 1.7 | GO:0046703 | natural killer cell lectin-like receptor binding(GO:0046703) |
0.1 | 1.2 | GO:0004176 | ATP-dependent peptidase activity(GO:0004176) |
0.1 | 0.6 | GO:0004854 | xanthine dehydrogenase activity(GO:0004854) oxidoreductase activity, acting on CH or CH2 groups, NAD or NADP as acceptor(GO:0016726) |
0.1 | 0.5 | GO:0052851 | cupric reductase activity(GO:0008823) ferric-chelate reductase (NADPH) activity(GO:0052851) |
0.1 | 0.4 | GO:0016838 | carbon-oxygen lyase activity, acting on phosphates(GO:0016838) |
0.1 | 0.4 | GO:0070653 | high-density lipoprotein particle receptor binding(GO:0070653) |
0.1 | 0.4 | GO:0016833 | oxo-acid-lyase activity(GO:0016833) |
0.1 | 0.3 | GO:0008142 | oxysterol binding(GO:0008142) |
0.1 | 0.4 | GO:0004305 | ethanolamine kinase activity(GO:0004305) |
0.1 | 0.2 | GO:0050692 | DBD domain binding(GO:0050692) |
0.1 | 0.5 | GO:0001884 | pyrimidine nucleoside binding(GO:0001884) |
0.1 | 0.4 | GO:0016972 | thiol oxidase activity(GO:0016972) |
0.1 | 0.3 | GO:0004359 | glutaminase activity(GO:0004359) |
0.1 | 0.3 | GO:0015563 | uptake transmembrane transporter activity(GO:0015563) |
0.1 | 0.7 | GO:0005384 | manganese ion transmembrane transporter activity(GO:0005384) |
0.1 | 0.3 | GO:0004096 | catalase activity(GO:0004096) |
0.1 | 0.3 | GO:0097016 | L27 domain binding(GO:0097016) |
0.1 | 0.3 | GO:0030620 | U2 snRNA binding(GO:0030620) |
0.1 | 0.5 | GO:0035473 | lipase binding(GO:0035473) |
0.1 | 0.3 | GO:1990825 | sequence-specific mRNA binding(GO:1990825) |
0.1 | 0.3 | GO:0015038 | glutathione disulfide oxidoreductase activity(GO:0015038) |
0.1 | 0.3 | GO:0015057 | thrombin receptor activity(GO:0015057) |
0.1 | 0.4 | GO:0046934 | phosphatidylinositol-4,5-bisphosphate 3-kinase activity(GO:0046934) |
0.1 | 1.0 | GO:0005542 | folic acid binding(GO:0005542) |
0.1 | 0.3 | GO:0047631 | ADP-ribose diphosphatase activity(GO:0047631) |
0.1 | 0.2 | GO:0061629 | RNA polymerase II sequence-specific DNA binding transcription factor binding(GO:0061629) |
0.1 | 0.4 | GO:0050897 | cobalt ion binding(GO:0050897) |
0.1 | 0.2 | GO:0005001 | transmembrane receptor protein tyrosine phosphatase activity(GO:0005001) |
0.1 | 0.3 | GO:0016286 | small conductance calcium-activated potassium channel activity(GO:0016286) |
0.1 | 0.4 | GO:0071723 | lipopeptide binding(GO:0071723) |
0.1 | 0.3 | GO:0033142 | progesterone receptor binding(GO:0033142) |
0.1 | 0.3 | GO:0015173 | aromatic amino acid transmembrane transporter activity(GO:0015173) |
0.1 | 0.2 | GO:0004691 | cAMP-dependent protein kinase activity(GO:0004691) |
0.1 | 0.7 | GO:0031432 | titin binding(GO:0031432) |
0.1 | 0.3 | GO:0015220 | choline transmembrane transporter activity(GO:0015220) |
0.1 | 0.5 | GO:0004630 | phospholipase D activity(GO:0004630) |
0.1 | 0.2 | GO:0019959 | interleukin-8 binding(GO:0019959) |
0.1 | 0.2 | GO:0008384 | IkappaB kinase activity(GO:0008384) |
0.1 | 0.2 | GO:0035939 | microsatellite binding(GO:0035939) |
0.1 | 0.5 | GO:0102337 | fatty acid elongase activity(GO:0009922) 3-oxo-arachidoyl-CoA synthase activity(GO:0102336) 3-oxo-cerotoyl-CoA synthase activity(GO:0102337) 3-oxo-lignoceronyl-CoA synthase activity(GO:0102338) |
0.1 | 0.5 | GO:0008688 | 3-(3-hydroxyphenyl)propionate hydroxylase activity(GO:0008688) 4-chlorobenzaldehyde oxidase activity(GO:0018471) 3,5-xylenol methylhydroxylase activity(GO:0018630) phenylacetate hydroxylase activity(GO:0018631) 4-nitrophenol 4-monooxygenase activity(GO:0018632) dimethyl sulfide monooxygenase activity(GO:0018633) alpha-pinene monooxygenase [NADH] activity(GO:0018634) 1-hydroxy-2-naphthoate hydroxylase activity(GO:0018637) toluene 4-monooxygenase activity(GO:0018638) xylene monooxygenase activity(GO:0018639) dibenzothiophene monooxygenase activity(GO:0018640) 6-hydroxy-3-methyl-2-oxo-1,2-dihydroquinoline 6-monooxygenase activity(GO:0018641) chlorophenol 4-monooxygenase activity(GO:0018642) carbon disulfide oxygenase activity(GO:0018643) toluene 2-monooxygenase activity(GO:0018644) 1-hydroxy-2-oxolimonene 1,2-monooxygenase activity(GO:0018646) phenanthrene 1,2-monooxygenase activity(GO:0018647) tetrahydrofuran hydroxylase activity(GO:0018649) styrene monooxygenase activity(GO:0018650) toluene-4-sulfonate monooxygenase activity(GO:0018651) toluene-sulfonate methyl-monooxygenase activity(GO:0018652) 3-methyl-2-oxo-1,2-dihydroquinoline 6-monooxygenase activity(GO:0018653) 2-hydroxy-phenylacetate hydroxylase activity(GO:0018654) 2-oxo-delta3-4,5,5-trimethylcyclopentenylacetyl-CoA 1,2-monooxygenase activity(GO:0018655) phenanthrene 3,4-monooxygenase activity(GO:0018656) toluene 3-monooxygenase activity(GO:0018657) 4-hydroxyphenylacetate,NADH:oxygen oxidoreductase (3-hydroxylating) activity(GO:0018660) limonene monooxygenase activity(GO:0019113) 2-methylnaphthalene hydroxylase activity(GO:0034526) 1-methylnaphthalene hydroxylase activity(GO:0034534) bisphenol A hydroxylase A activity(GO:0034560) salicylate 5-hydroxylase activity(GO:0034785) isobutylamine N-hydroxylase activity(GO:0034791) branched-chain dodecylbenzene sulfonate monooxygenase activity(GO:0034802) 3-HSA hydroxylase activity(GO:0034819) 4-hydroxypyridine-3-hydroxylase activity(GO:0034894) 2-octaprenyl-3-methyl-6-methoxy-1,4-benzoquinol hydroxylase activity(GO:0043719) 6-hydroxynicotinate 3-monooxygenase activity(GO:0043731) tocotrienol omega-hydroxylase activity(GO:0052872) thalianol hydroxylase activity(GO:0080014) |
0.1 | 0.4 | GO:0005499 | vitamin D binding(GO:0005499) |
0.1 | 1.2 | GO:0035259 | glucocorticoid receptor binding(GO:0035259) |
0.1 | 0.3 | GO:0016151 | nickel cation binding(GO:0016151) |
0.1 | 0.3 | GO:0022833 | mechanically-gated ion channel activity(GO:0008381) mechanically gated channel activity(GO:0022833) |
0.1 | 0.6 | GO:0016846 | carbon-sulfur lyase activity(GO:0016846) |
0.1 | 0.3 | GO:0071253 | connexin binding(GO:0071253) |
0.1 | 0.1 | GO:0015106 | bicarbonate transmembrane transporter activity(GO:0015106) |
0.1 | 0.3 | GO:0030984 | kininogen binding(GO:0030984) |
0.1 | 0.2 | GO:0005146 | leukemia inhibitory factor receptor binding(GO:0005146) |
0.1 | 0.1 | GO:0050816 | phosphothreonine binding(GO:0050816) |
0.1 | 0.3 | GO:0016494 | C-X-C chemokine receptor activity(GO:0016494) |
0.1 | 0.3 | GO:0004301 | epoxide hydrolase activity(GO:0004301) |
0.1 | 0.2 | GO:0016728 | ribonucleoside-diphosphate reductase activity, thioredoxin disulfide as acceptor(GO:0004748) oxidoreductase activity, acting on CH or CH2 groups, disulfide as acceptor(GO:0016728) ribonucleoside-diphosphate reductase activity(GO:0061731) |
0.1 | 1.0 | GO:0008483 | transaminase activity(GO:0008483) |
0.1 | 0.2 | GO:0050815 | phosphoserine binding(GO:0050815) |
0.1 | 0.2 | GO:0008970 | phosphatidylcholine 1-acylhydrolase activity(GO:0008970) |
0.1 | 0.2 | GO:0003872 | 6-phosphofructokinase activity(GO:0003872) |
0.1 | 0.2 | GO:0004126 | cytidine deaminase activity(GO:0004126) |
0.1 | 0.4 | GO:0001849 | complement component C1q binding(GO:0001849) |
0.1 | 0.4 | GO:0008559 | xenobiotic-transporting ATPase activity(GO:0008559) |
0.1 | 0.3 | GO:0000064 | L-ornithine transmembrane transporter activity(GO:0000064) |
0.1 | 0.3 | GO:0046790 | virion binding(GO:0046790) |
0.1 | 0.4 | GO:0045545 | syndecan binding(GO:0045545) |
0.1 | 0.1 | GO:0004427 | inorganic diphosphatase activity(GO:0004427) |
0.1 | 0.2 | GO:0004582 | dolichyl-phosphate beta-D-mannosyltransferase activity(GO:0004582) |
0.1 | 0.4 | GO:1904264 | ubiquitin protein ligase activity involved in ERAD pathway(GO:1904264) |
0.1 | 0.1 | GO:0060228 | phosphatidylcholine-sterol O-acyltransferase activator activity(GO:0060228) |
0.1 | 0.1 | GO:0019862 | IgA binding(GO:0019862) |
0.1 | 0.3 | GO:0086008 | voltage-gated potassium channel activity involved in cardiac muscle cell action potential repolarization(GO:0086008) |
0.1 | 0.3 | GO:0016742 | hydroxymethyl-, formyl- and related transferase activity(GO:0016742) |
0.1 | 0.7 | GO:0016594 | glycine binding(GO:0016594) |
0.1 | 0.3 | GO:0047035 | testosterone dehydrogenase (NAD+) activity(GO:0047035) |
0.1 | 0.2 | GO:0008506 | sucrose:proton symporter activity(GO:0008506) sucrose transmembrane transporter activity(GO:0008515) disaccharide transmembrane transporter activity(GO:0015154) oligosaccharide transmembrane transporter activity(GO:0015157) |
0.1 | 0.6 | GO:0009881 | photoreceptor activity(GO:0009881) |
0.1 | 0.2 | GO:0004813 | alanine-tRNA ligase activity(GO:0004813) |
0.1 | 0.2 | GO:0004346 | glucose-6-phosphatase activity(GO:0004346) sugar-terminal-phosphatase activity(GO:0050309) |
0.1 | 1.0 | GO:0032794 | GTPase activating protein binding(GO:0032794) |
0.1 | 0.3 | GO:0047184 | 1-acylglycerophosphocholine O-acyltransferase activity(GO:0047184) |
0.1 | 0.2 | GO:0000386 | second spliceosomal transesterification activity(GO:0000386) |
0.1 | 0.4 | GO:0016176 | superoxide-generating NADPH oxidase activator activity(GO:0016176) |
0.1 | 0.2 | GO:0004832 | valine-tRNA ligase activity(GO:0004832) |
0.1 | 0.2 | GO:0004174 | electron-transferring-flavoprotein dehydrogenase activity(GO:0004174) oxidoreductase activity, acting on the CH-NH group of donors, quinone or similar compound as acceptor(GO:0016649) |
0.1 | 0.5 | GO:0034987 | immunoglobulin receptor binding(GO:0034987) |
0.1 | 0.2 | GO:0031727 | CCR2 chemokine receptor binding(GO:0031727) |
0.1 | 0.2 | GO:0072542 | protein phosphatase activator activity(GO:0072542) |
0.1 | 0.4 | GO:0008140 | cAMP response element binding protein binding(GO:0008140) |
0.1 | 0.2 | GO:0016802 | adenosylhomocysteinase activity(GO:0004013) trialkylsulfonium hydrolase activity(GO:0016802) |
0.1 | 0.4 | GO:0001162 | RNA polymerase II intronic transcription regulatory region sequence-specific DNA binding(GO:0001162) |
0.1 | 0.2 | GO:0004740 | pyruvate dehydrogenase (acetyl-transferring) kinase activity(GO:0004740) |
0.1 | 0.2 | GO:0032137 | guanine/thymine mispair binding(GO:0032137) |
0.1 | 0.2 | GO:2001069 | glycogen binding(GO:2001069) |
0.1 | 0.3 | GO:0030292 | protein tyrosine kinase inhibitor activity(GO:0030292) |
0.1 | 0.4 | GO:0050649 | testosterone 6-beta-hydroxylase activity(GO:0050649) |
0.1 | 0.5 | GO:0008093 | cytoskeletal adaptor activity(GO:0008093) |
0.0 | 0.1 | GO:0035851 | Krueppel-associated box domain binding(GO:0035851) |
0.0 | 0.1 | GO:0042895 | antibiotic transporter activity(GO:0042895) |
0.0 | 0.4 | GO:0042500 | aspartic endopeptidase activity, intramembrane cleaving(GO:0042500) |
0.0 | 0.1 | GO:0004741 | [pyruvate dehydrogenase (lipoamide)] phosphatase activity(GO:0004741) |
0.0 | 0.4 | GO:0051371 | muscle alpha-actinin binding(GO:0051371) |
0.0 | 0.2 | GO:0004111 | creatine kinase activity(GO:0004111) |
0.0 | 0.5 | GO:0015245 | fatty acid transporter activity(GO:0015245) |
0.0 | 0.2 | GO:0070579 | methylcytosine dioxygenase activity(GO:0070579) |
0.0 | 0.3 | GO:0098634 | protein binding involved in cell-matrix adhesion(GO:0098634) |
0.0 | 0.2 | GO:0086080 | protein binding involved in heterotypic cell-cell adhesion(GO:0086080) |
0.0 | 0.3 | GO:0034902 | alkyl sulfatase activity(GO:0018741) endosulfan hemisulfate sulfatase activity(GO:0034889) endosulfan sulfate hydrolase activity(GO:0034902) |
0.0 | 0.0 | GO:0015137 | citrate transmembrane transporter activity(GO:0015137) tricarboxylic acid transmembrane transporter activity(GO:0015142) |
0.0 | 0.1 | GO:0001226 | RNA polymerase II transcription corepressor binding(GO:0001226) |
0.0 | 0.5 | GO:0070180 | large ribosomal subunit rRNA binding(GO:0070180) |
0.0 | 0.4 | GO:0051011 | microtubule minus-end binding(GO:0051011) |
0.0 | 0.4 | GO:0034236 | protein kinase A catalytic subunit binding(GO:0034236) |
0.0 | 0.2 | GO:0017151 | DEAD/H-box RNA helicase binding(GO:0017151) |
0.0 | 0.2 | GO:0034618 | arginine binding(GO:0034618) |
0.0 | 0.6 | GO:0071949 | FAD binding(GO:0071949) |
0.0 | 0.3 | GO:0016421 | CoA carboxylase activity(GO:0016421) |
0.0 | 0.8 | GO:0070530 | K63-linked polyubiquitin binding(GO:0070530) |
0.0 | 0.3 | GO:0005049 | nuclear export signal receptor activity(GO:0005049) |
0.0 | 0.1 | GO:0019776 | Atg8 ligase activity(GO:0019776) |
0.0 | 0.4 | GO:0004438 | phosphatidylinositol-3-phosphatase activity(GO:0004438) |
0.0 | 0.2 | GO:0004468 | lysine N-acetyltransferase activity, acting on acetyl phosphate as donor(GO:0004468) |
0.0 | 0.4 | GO:0019912 | cyclin-dependent protein kinase activating kinase activity(GO:0019912) |
0.0 | 0.1 | GO:0004367 | glycerol-3-phosphate dehydrogenase [NAD+] activity(GO:0004367) |
0.0 | 0.2 | GO:0004758 | serine C-palmitoyltransferase activity(GO:0004758) |
0.0 | 0.3 | GO:0004322 | ferroxidase activity(GO:0004322) oxidoreductase activity, oxidizing metal ions, oxygen as acceptor(GO:0016724) |
0.0 | 0.7 | GO:0005545 | 1-phosphatidylinositol binding(GO:0005545) |
0.0 | 0.1 | GO:0005483 | soluble NSF attachment protein activity(GO:0005483) |
0.0 | 0.2 | GO:0004459 | L-lactate dehydrogenase activity(GO:0004459) |
0.0 | 0.1 | GO:0004345 | glucose-6-phosphate dehydrogenase activity(GO:0004345) |
0.0 | 0.2 | GO:0047391 | alkylglycerophosphoethanolamine phosphodiesterase activity(GO:0047391) |
0.0 | 0.1 | GO:0008199 | ferric iron binding(GO:0008199) |
0.0 | 0.1 | GO:0008900 | hydrogen:potassium-exchanging ATPase activity(GO:0008900) |
0.0 | 0.1 | GO:0031708 | endothelin B receptor binding(GO:0031708) |
0.0 | 0.3 | GO:0019957 | C-C chemokine binding(GO:0019957) |
0.0 | 0.2 | GO:0032454 | histone demethylase activity (H3-K9 specific)(GO:0032454) |
0.0 | 0.3 | GO:0102391 | decanoate--CoA ligase activity(GO:0102391) |
0.0 | 0.1 | GO:0042030 | ATPase inhibitor activity(GO:0042030) |
0.0 | 0.3 | GO:0003836 | beta-galactoside (CMP) alpha-2,3-sialyltransferase activity(GO:0003836) |
0.0 | 0.1 | GO:0061676 | importin-alpha family protein binding(GO:0061676) |
0.0 | 0.1 | GO:0016635 | oxidoreductase activity, acting on the CH-CH group of donors, quinone or related compound as acceptor(GO:0016635) |
0.0 | 0.1 | GO:0023029 | MHC class Ib protein binding(GO:0023029) |
0.0 | 0.6 | GO:0035198 | miRNA binding(GO:0035198) |
0.0 | 0.1 | GO:0035514 | DNA demethylase activity(GO:0035514) |
0.0 | 0.1 | GO:0031893 | vasopressin receptor binding(GO:0031893) |
0.0 | 0.5 | GO:0005092 | GDP-dissociation inhibitor activity(GO:0005092) |
0.0 | 0.2 | GO:0032795 | heterotrimeric G-protein binding(GO:0032795) |
0.0 | 0.2 | GO:0098505 | G-rich strand telomeric DNA binding(GO:0098505) |
0.0 | 0.2 | GO:0004090 | carbonyl reductase (NADPH) activity(GO:0004090) |
0.0 | 0.1 | GO:0008427 | calcium-dependent protein kinase inhibitor activity(GO:0008427) |
0.0 | 0.5 | GO:0015279 | store-operated calcium channel activity(GO:0015279) |
0.0 | 0.3 | GO:0019763 | immunoglobulin receptor activity(GO:0019763) |
0.0 | 0.2 | GO:0005225 | volume-sensitive anion channel activity(GO:0005225) |
0.0 | 0.3 | GO:0003841 | 1-acylglycerol-3-phosphate O-acyltransferase activity(GO:0003841) |
0.0 | 0.1 | GO:0032767 | copper-dependent protein binding(GO:0032767) |
0.0 | 0.3 | GO:0051864 | histone demethylase activity (H3-K36 specific)(GO:0051864) |
0.0 | 0.2 | GO:0070324 | thyroid hormone binding(GO:0070324) |
0.0 | 0.2 | GO:0015379 | potassium:chloride symporter activity(GO:0015379) potassium ion symporter activity(GO:0022820) |
0.0 | 0.1 | GO:0005087 | Ran guanyl-nucleotide exchange factor activity(GO:0005087) |
0.0 | 0.3 | GO:0030306 | ADP-ribosylation factor binding(GO:0030306) |
0.0 | 0.2 | GO:0035368 | selenocysteine insertion sequence binding(GO:0035368) |
0.0 | 0.3 | GO:0010521 | telomerase inhibitor activity(GO:0010521) |
0.0 | 0.2 | GO:0030550 | acetylcholine receptor inhibitor activity(GO:0030550) |
0.0 | 0.2 | GO:0004994 | somatostatin receptor activity(GO:0004994) |
0.0 | 0.1 | GO:0098518 | polynucleotide phosphatase activity(GO:0098518) |
0.0 | 0.4 | GO:0001134 | transcription factor activity, transcription factor recruiting(GO:0001134) |
0.0 | 0.7 | GO:0008157 | protein phosphatase 1 binding(GO:0008157) |
0.0 | 0.5 | GO:0005337 | nucleoside transmembrane transporter activity(GO:0005337) |
0.0 | 0.2 | GO:0016812 | hydrolase activity, acting on carbon-nitrogen (but not peptide) bonds, in cyclic amides(GO:0016812) |
0.0 | 0.2 | GO:0003917 | DNA topoisomerase type I activity(GO:0003917) |
0.0 | 0.0 | GO:0015141 | succinate transmembrane transporter activity(GO:0015141) |
0.0 | 1.2 | GO:0031624 | ubiquitin conjugating enzyme binding(GO:0031624) |
0.0 | 0.1 | GO:0005173 | stem cell factor receptor binding(GO:0005173) |
0.0 | 0.7 | GO:0001530 | lipopolysaccharide binding(GO:0001530) |
0.0 | 0.6 | GO:0008143 | poly(A) binding(GO:0008143) |
0.0 | 0.1 | GO:0004706 | JUN kinase kinase kinase activity(GO:0004706) |
0.0 | 0.2 | GO:0017169 | CDP-alcohol phosphatidyltransferase activity(GO:0017169) |
0.0 | 0.1 | GO:0045134 | uridine-diphosphatase activity(GO:0045134) |
0.0 | 0.7 | GO:0004198 | calcium-dependent cysteine-type endopeptidase activity(GO:0004198) |
0.0 | 0.1 | GO:0004699 | calcium-independent protein kinase C activity(GO:0004699) |
0.0 | 0.1 | GO:0004487 | methenyltetrahydrofolate cyclohydrolase activity(GO:0004477) methylenetetrahydrofolate dehydrogenase (NAD+) activity(GO:0004487) |
0.0 | 0.1 | GO:0017089 | glycolipid transporter activity(GO:0017089) |
0.0 | 0.1 | GO:0070878 | primary miRNA binding(GO:0070878) |
0.0 | 0.3 | GO:0005068 | transmembrane receptor protein tyrosine kinase adaptor activity(GO:0005068) |
0.0 | 0.1 | GO:0004165 | dodecenoyl-CoA delta-isomerase activity(GO:0004165) |
0.0 | 0.1 | GO:0004735 | pyrroline-5-carboxylate reductase activity(GO:0004735) |
0.0 | 0.1 | GO:0017176 | phosphatidylinositol N-acetylglucosaminyltransferase activity(GO:0017176) |
0.0 | 0.5 | GO:0019789 | SUMO transferase activity(GO:0019789) |
0.0 | 0.2 | GO:0030368 | interleukin-17 receptor activity(GO:0030368) |
0.0 | 0.5 | GO:0004012 | phospholipid-translocating ATPase activity(GO:0004012) |
0.0 | 1.0 | GO:0045502 | dynein binding(GO:0045502) |
0.0 | 0.3 | GO:0008889 | glycerophosphodiester phosphodiesterase activity(GO:0008889) |
0.0 | 0.1 | GO:0035005 | 1-phosphatidylinositol-4-phosphate 3-kinase activity(GO:0035005) |
0.0 | 0.1 | GO:0003916 | DNA topoisomerase activity(GO:0003916) |
0.0 | 0.1 | GO:0043423 | 3-phosphoinositide-dependent protein kinase binding(GO:0043423) |
0.0 | 0.2 | GO:0000182 | rDNA binding(GO:0000182) |
0.0 | 0.3 | GO:0043023 | ribosomal large subunit binding(GO:0043023) |
0.0 | 0.1 | GO:0008934 | inositol monophosphate 1-phosphatase activity(GO:0008934) inositol monophosphate 3-phosphatase activity(GO:0052832) inositol monophosphate 4-phosphatase activity(GO:0052833) inositol monophosphate phosphatase activity(GO:0052834) |
0.0 | 0.2 | GO:0042609 | CD4 receptor binding(GO:0042609) |
0.0 | 0.3 | GO:0030881 | beta-2-microglobulin binding(GO:0030881) |
0.0 | 0.3 | GO:0031748 | D1 dopamine receptor binding(GO:0031748) |
0.0 | 0.6 | GO:0070273 | phosphatidylinositol-4-phosphate binding(GO:0070273) |
0.0 | 0.2 | GO:0016892 | endoribonuclease activity, producing 3'-phosphomonoesters(GO:0016892) |
0.0 | 0.2 | GO:0008294 | calcium- and calmodulin-responsive adenylate cyclase activity(GO:0008294) |
0.0 | 0.0 | GO:1990459 | transferrin receptor binding(GO:1990459) |
0.0 | 0.1 | GO:0004772 | sterol O-acyltransferase activity(GO:0004772) |
0.0 | 0.1 | GO:0004663 | Rab geranylgeranyltransferase activity(GO:0004663) |
0.0 | 0.5 | GO:0008353 | RNA polymerase II carboxy-terminal domain kinase activity(GO:0008353) |
0.0 | 0.2 | GO:0008440 | inositol-1,4,5-trisphosphate 3-kinase activity(GO:0008440) |
0.0 | 0.2 | GO:0055102 | lipase inhibitor activity(GO:0055102) |
0.0 | 0.3 | GO:0070182 | DNA polymerase binding(GO:0070182) |
0.0 | 0.1 | GO:0071987 | WD40-repeat domain binding(GO:0071987) |
0.0 | 0.6 | GO:0008139 | nuclear localization sequence binding(GO:0008139) |
0.0 | 0.7 | GO:0008330 | protein tyrosine/threonine phosphatase activity(GO:0008330) |
0.0 | 0.1 | GO:0008321 | Ral guanyl-nucleotide exchange factor activity(GO:0008321) |
0.0 | 0.3 | GO:0031701 | angiotensin receptor binding(GO:0031701) |
0.0 | 0.1 | GO:0015605 | organophosphate ester transmembrane transporter activity(GO:0015605) |
0.0 | 0.2 | GO:0050321 | tau-protein kinase activity(GO:0050321) |
0.0 | 0.6 | GO:0044769 | ATPase activity, coupled to transmembrane movement of ions, rotational mechanism(GO:0044769) |
0.0 | 0.4 | GO:0080025 | phosphatidylinositol-3,5-bisphosphate binding(GO:0080025) |
0.0 | 0.0 | GO:0030523 | dihydrolipoamide S-acyltransferase activity(GO:0030523) |
0.0 | 0.5 | GO:0030291 | protein serine/threonine kinase inhibitor activity(GO:0030291) |
0.0 | 0.3 | GO:0044183 | protein binding involved in protein folding(GO:0044183) |
0.0 | 0.1 | GO:0005176 | ErbB-2 class receptor binding(GO:0005176) |
0.0 | 0.1 | GO:0030375 | thyroid hormone receptor coactivator activity(GO:0030375) |
0.0 | 0.0 | GO:0004457 | lactate dehydrogenase activity(GO:0004457) |
0.0 | 0.1 | GO:0016647 | oxidoreductase activity, acting on the CH-NH group of donors, oxygen as acceptor(GO:0016647) |
0.0 | 0.0 | GO:0071208 | histone pre-mRNA DCP binding(GO:0071208) |
0.0 | 0.7 | GO:0004115 | 3',5'-cyclic-AMP phosphodiesterase activity(GO:0004115) |
0.0 | 0.3 | GO:0008253 | 5'-nucleotidase activity(GO:0008253) |
0.0 | 0.8 | GO:0016414 | O-octanoyltransferase activity(GO:0016414) |
0.0 | 0.1 | GO:0003865 | 3-oxo-5-alpha-steroid 4-dehydrogenase activity(GO:0003865) cholestenone 5-alpha-reductase activity(GO:0047751) |
0.0 | 1.0 | GO:0003923 | GPI-anchor transamidase activity(GO:0003923) |
0.0 | 0.3 | GO:0030898 | actin-dependent ATPase activity(GO:0030898) |
0.0 | 0.1 | GO:1990829 | C-rich single-stranded DNA binding(GO:1990829) |
0.0 | 0.1 | GO:0016149 | translation release factor activity, codon specific(GO:0016149) |
0.0 | 0.7 | GO:0004683 | calmodulin-dependent protein kinase activity(GO:0004683) |
0.0 | 0.3 | GO:0019825 | oxygen binding(GO:0019825) |
0.0 | 0.1 | GO:0008599 | protein phosphatase type 1 regulator activity(GO:0008599) |
0.0 | 0.1 | GO:0019002 | GMP binding(GO:0019002) |
0.0 | 0.0 | GO:0051373 | FATZ binding(GO:0051373) |
0.0 | 0.1 | GO:0016406 | carnitine O-acyltransferase activity(GO:0016406) |
0.0 | 0.0 | GO:0016415 | octanoyltransferase activity(GO:0016415) |
0.0 | 0.2 | GO:0008420 | CTD phosphatase activity(GO:0008420) |
0.0 | 0.3 | GO:0001054 | RNA polymerase I activity(GO:0001054) |
0.0 | 0.7 | GO:0046875 | ephrin receptor binding(GO:0046875) |
0.0 | 0.1 | GO:0031697 | beta-1 adrenergic receptor binding(GO:0031697) |
0.0 | 0.2 | GO:0016920 | pyroglutamyl-peptidase activity(GO:0016920) |
0.0 | 0.2 | GO:0003689 | DNA clamp loader activity(GO:0003689) protein-DNA loading ATPase activity(GO:0033170) |
0.0 | 0.1 | GO:0031800 | type 3 metabotropic glutamate receptor binding(GO:0031800) |
0.0 | 0.0 | GO:0097001 | ceramide binding(GO:0097001) |
0.0 | 0.1 | GO:1990460 | leptin receptor binding(GO:1990460) |
0.0 | 0.1 | GO:0004938 | alpha2-adrenergic receptor activity(GO:0004938) |
0.0 | 0.0 | GO:0043398 | HLH domain binding(GO:0043398) |
0.0 | 0.1 | GO:1901612 | cardiolipin binding(GO:1901612) |
0.0 | 0.1 | GO:0008499 | UDP-galactose:beta-N-acetylglucosamine beta-1,3-galactosyltransferase activity(GO:0008499) |
0.0 | 0.4 | GO:0015035 | protein disulfide oxidoreductase activity(GO:0015035) |
0.0 | 0.1 | GO:0034857 | fluorene oxygenase activity(GO:0018585) mono-butyltin dioxygenase activity(GO:0018586) tri-n-butyltin dioxygenase activity(GO:0018588) di-n-butyltin dioxygenase activity(GO:0018589) methylsilanetriol hydroxylase activity(GO:0018590) methyl tertiary butyl ether 3-monooxygenase activity(GO:0018591) 4-nitrocatechol 4-monooxygenase activity(GO:0018592) 4-chlorophenoxyacetate monooxygenase activity(GO:0018593) tert-butanol 2-monooxygenase activity(GO:0018594) alpha-pinene monooxygenase activity(GO:0018595) dimethylsilanediol hydroxylase activity(GO:0018596) ammonia monooxygenase activity(GO:0018597) hydroxymethylsilanetriol oxidase activity(GO:0018598) 2-hydroxyisobutyrate 3-monooxygenase activity(GO:0018599) alpha-pinene dehydrogenase activity(GO:0018600) bisphenol A hydroxylase B activity(GO:0034559) 2,2-bis(4-hydroxyphenyl)-1-propanol hydroxylase activity(GO:0034562) 9-fluorenone-3,4-dioxygenase activity(GO:0034786) anthracene 9,10-dioxygenase activity(GO:0034816) 2-(methylthio)benzothiazole monooxygenase activity(GO:0034857) 2-hydroxybenzothiazole monooxygenase activity(GO:0034858) benzothiazole monooxygenase activity(GO:0034859) 2,6-dihydroxybenzothiazole monooxygenase activity(GO:0034862) pinacolone 5-monooxygenase activity(GO:0034870) thioacetamide S-oxygenase activity(GO:0034873) thioacetamide S-oxide S-oxygenase activity(GO:0034874) endosulfan monooxygenase I activity(GO:0034888) N-nitrodimethylamine hydroxylase activity(GO:0034893) 4-(1-ethyl-1,4-dimethyl-pentyl)phenol monoxygenase activity(GO:0034897) endosulfan ether monooxygenase activity(GO:0034903) pyrene 4,5-monooxygenase activity(GO:0034925) pyrene 1,2-monooxygenase activity(GO:0034927) 1-hydroxypyrene 6,7-monooxygenase activity(GO:0034928) 1-hydroxypyrene 7,8-monooxygenase activity(GO:0034929) phenylboronic acid monooxygenase activity(GO:0034950) spheroidene monooxygenase activity(GO:0043823) |
0.0 | 0.1 | GO:0015377 | cation:chloride symporter activity(GO:0015377) |
0.0 | 0.0 | GO:0071532 | ankyrin repeat binding(GO:0071532) |
0.0 | 0.5 | GO:0015491 | cation:cation antiporter activity(GO:0015491) |
0.0 | 0.1 | GO:0019808 | polyamine binding(GO:0019808) |
0.0 | 0.2 | GO:0016857 | racemase and epimerase activity, acting on carbohydrates and derivatives(GO:0016857) |
0.0 | 0.3 | GO:0005521 | lamin binding(GO:0005521) |
0.0 | 0.1 | GO:0035242 | protein-arginine omega-N asymmetric methyltransferase activity(GO:0035242) |
0.0 | 0.1 | GO:0035529 | NADH pyrophosphatase activity(GO:0035529) |
0.0 | 0.0 | GO:0050145 | nucleoside phosphate kinase activity(GO:0050145) |
0.0 | 0.3 | GO:0031489 | myosin V binding(GO:0031489) |
0.0 | 0.1 | GO:0043522 | leucine zipper domain binding(GO:0043522) |
0.0 | 0.1 | GO:0004731 | purine-nucleoside phosphorylase activity(GO:0004731) |
0.0 | 0.3 | GO:0001056 | RNA polymerase III activity(GO:0001056) |
0.0 | 0.2 | GO:0008198 | ferrous iron binding(GO:0008198) |
0.0 | 0.0 | GO:1990715 | mRNA CDS binding(GO:1990715) |
0.0 | 0.1 | GO:0048406 | nerve growth factor binding(GO:0048406) |
0.0 | 0.4 | GO:0005031 | tumor necrosis factor-activated receptor activity(GO:0005031) death receptor activity(GO:0005035) |
0.0 | 0.1 | GO:0004169 | dolichyl-phosphate-mannose-protein mannosyltransferase activity(GO:0004169) |
0.0 | 0.3 | GO:0004653 | polypeptide N-acetylgalactosaminyltransferase activity(GO:0004653) |
0.0 | 0.1 | GO:0043008 | ATP-dependent protein binding(GO:0043008) |
0.0 | 0.4 | GO:0004709 | MAP kinase kinase kinase activity(GO:0004709) |
0.0 | 0.1 | GO:0004045 | aminoacyl-tRNA hydrolase activity(GO:0004045) |
0.0 | 0.2 | GO:0016907 | G-protein coupled acetylcholine receptor activity(GO:0016907) |
0.0 | 0.1 | GO:0071209 | U7 snRNA binding(GO:0071209) |
0.0 | 0.1 | GO:0030942 | endoplasmic reticulum signal peptide binding(GO:0030942) |
0.0 | 0.1 | GO:0008309 | double-stranded DNA exodeoxyribonuclease activity(GO:0008309) |
0.0 | 0.1 | GO:0030492 | hemoglobin binding(GO:0030492) |
0.0 | 0.2 | GO:0016884 | carbon-nitrogen ligase activity, with glutamine as amido-N-donor(GO:0016884) |
0.0 | 0.0 | GO:0035673 | oligopeptide transmembrane transporter activity(GO:0035673) |
0.0 | 0.1 | GO:0048156 | tau protein binding(GO:0048156) |
0.0 | 0.1 | GO:0001515 | opioid peptide activity(GO:0001515) |
0.0 | 0.3 | GO:0071889 | 14-3-3 protein binding(GO:0071889) |
0.0 | 0.0 | GO:0030151 | molybdenum ion binding(GO:0030151) |
0.0 | 1.0 | GO:0019003 | GDP binding(GO:0019003) |
0.0 | 0.3 | GO:0015095 | magnesium ion transmembrane transporter activity(GO:0015095) |
0.0 | 0.0 | GO:1904288 | BAT3 complex binding(GO:1904288) |
0.0 | 0.1 | GO:0003688 | DNA replication origin binding(GO:0003688) |
0.0 | 0.1 | GO:0010484 | H3 histone acetyltransferase activity(GO:0010484) |
0.0 | 0.2 | GO:0015321 | sodium-dependent phosphate transmembrane transporter activity(GO:0015321) |
0.0 | 0.2 | GO:0051378 | serotonin binding(GO:0051378) |
0.0 | 0.1 | GO:0042809 | vitamin D receptor binding(GO:0042809) |
0.0 | 0.7 | GO:0019894 | kinesin binding(GO:0019894) |
0.0 | 0.0 | GO:0016751 | S-succinyltransferase activity(GO:0016751) |
0.0 | 0.3 | GO:0016504 | peptidase activator activity(GO:0016504) |
0.0 | 0.1 | GO:0004667 | prostaglandin-D synthase activity(GO:0004667) |
0.0 | 0.1 | GO:0004645 | phosphorylase activity(GO:0004645) |
0.0 | 0.0 | GO:0043533 | inositol 1,3,4,5 tetrakisphosphate binding(GO:0043533) |
0.0 | 0.1 | GO:0001671 | ATPase activator activity(GO:0001671) |
0.0 | 0.1 | GO:0015277 | kainate selective glutamate receptor activity(GO:0015277) |
0.0 | 0.0 | GO:0019534 | toxin transporter activity(GO:0019534) |
0.0 | 0.2 | GO:1901505 | carbohydrate derivative transporter activity(GO:1901505) |
0.0 | 0.0 | GO:0042910 | xenobiotic transporter activity(GO:0042910) |
0.0 | 0.3 | GO:0043015 | gamma-tubulin binding(GO:0043015) |
0.0 | 0.1 | GO:0018856 | 3-oxo-2-(2'-pentenyl)cyclopentane-1-octanoic acid CoA ligase activity(GO:0010435) 3-isopropenyl-6-oxoheptanoyl-CoA synthetase activity(GO:0018854) 2-oxo-delta3-4,5,5-trimethylcyclopentenylacetyl-CoA synthetase activity(GO:0018855) benzoyl acetate-CoA ligase activity(GO:0018856) 2,4-dichlorobenzoate-CoA ligase activity(GO:0018857) pivalate-CoA ligase activity(GO:0034783) cyclopropanecarboxylate-CoA ligase activity(GO:0034793) adipate-CoA ligase activity(GO:0034796) citronellyl-CoA ligase activity(GO:0034823) mentha-1,3-dione-CoA ligase activity(GO:0034841) thiophene-2-carboxylate-CoA ligase activity(GO:0034842) 2,4,4-trimethylpentanoate-CoA ligase activity(GO:0034865) cis-2-methyl-5-isopropylhexa-2,5-dienoate-CoA ligase activity(GO:0034942) trans-2-methyl-5-isopropylhexa-2,5-dienoate-CoA ligase activity(GO:0034943) branched-chain acyl-CoA synthetase (ADP-forming) activity(GO:0043759) aryl-CoA synthetase (ADP-forming) activity(GO:0043762) 3-hydroxypropionyl-CoA synthetase activity(GO:0043955) perillic acid:CoA ligase (ADP-forming) activity(GO:0052685) perillic acid:CoA ligase (AMP-forming) activity(GO:0052686) (3R)-3-isopropenyl-6-oxoheptanoate:CoA ligase (ADP-forming) activity(GO:0052687) (3R)-3-isopropenyl-6-oxoheptanoate:CoA ligase (AMP-forming) activity(GO:0052688) pristanate-CoA ligase activity(GO:0070251) malonyl-CoA synthetase activity(GO:0090409) |
0.0 | 0.1 | GO:0046624 | sphingolipid transporter activity(GO:0046624) |
0.0 | 0.1 | GO:0003840 | gamma-glutamyltransferase activity(GO:0003840) glutathione hydrolase activity(GO:0036374) |
0.0 | 0.2 | GO:0035497 | cAMP response element binding(GO:0035497) |
0.0 | 0.1 | GO:0034584 | piRNA binding(GO:0034584) |
0.0 | 0.1 | GO:1990188 | euchromatin binding(GO:1990188) |
0.0 | 0.0 | GO:0001069 | regulatory region RNA binding(GO:0001069) |
0.0 | 0.1 | GO:0003993 | acid phosphatase activity(GO:0003993) |
0.0 | 0.1 | GO:0005275 | amine transmembrane transporter activity(GO:0005275) |
0.0 | 0.2 | GO:0016595 | glutamate binding(GO:0016595) |
0.0 | 0.1 | GO:0004942 | anaphylatoxin receptor activity(GO:0004942) |
0.0 | 0.1 | GO:0015252 | hydrogen ion channel activity(GO:0015252) |
0.0 | 0.1 | GO:0003987 | acetate-CoA ligase activity(GO:0003987) |
0.0 | 0.2 | GO:0031435 | mitogen-activated protein kinase kinase kinase binding(GO:0031435) |
0.0 | 0.1 | GO:0004949 | cannabinoid receptor activity(GO:0004949) |
0.0 | 0.1 | GO:0034863 | pinocarveol dehydrogenase activity(GO:0018446) chloral hydrate dehydrogenase activity(GO:0018447) hydroxymethylmethylsilanediol oxidase activity(GO:0018448) 1-phenylethanol dehydrogenase activity(GO:0018449) myrtenol dehydrogenase activity(GO:0018450) cis-1,2-dihydroxy-1,2-dihydro-8-carboxynaphthalene dehydrogenase activity(GO:0034522) 3-hydroxy-4-methyloctanoyl-CoA dehydrogenase activity(GO:0034582) 2-hydroxy-4-isopropenylcyclohexane-1-carboxyl-CoA dehydrogenase activity(GO:0034778) cis-9,10-dihydroanthracene-9,10-diol dehydrogenase activity(GO:0034817) citronellol dehydrogenase activity(GO:0034821) naphthyl-2-hydroxymethyl-succinyl-CoA dehydrogenase activity(GO:0034847) 2,4,4-trimethyl-1-pentanol dehydrogenase activity(GO:0034863) 2,4,4-trimethyl-3-hydroxypentanoyl-CoA dehydrogenase activity(GO:0034868) 1-hydroxy-4,4-dimethylpentan-3-one dehydrogenase activity(GO:0034871) endosulfan diol dehydrogenase activity(GO:0034891) endosulfan hydroxyether dehydrogenase activity(GO:0034901) 3-hydroxy-2-methylhexanoyl-CoA dehydrogenase activity(GO:0034918) 3-hydroxy-2,6-dimethyl-5-methylene-heptanoyl-CoA dehydrogenase activity(GO:0034944) versicolorin reductase activity(GO:0042469) ketoreductase activity(GO:0045703) |
0.0 | 0.1 | GO:0001163 | RNA polymerase I regulatory region sequence-specific DNA binding(GO:0001163) RNA polymerase I CORE element sequence-specific DNA binding(GO:0001164) |
0.0 | 0.0 | GO:0032405 | MutLalpha complex binding(GO:0032405) |
0.0 | 0.1 | GO:0004946 | bombesin receptor activity(GO:0004946) |
0.0 | 0.4 | GO:0005385 | zinc ion transmembrane transporter activity(GO:0005385) |
0.0 | 0.5 | GO:0004177 | aminopeptidase activity(GO:0004177) |
0.0 | 0.1 | GO:0099589 | G-protein coupled serotonin receptor activity(GO:0004993) serotonin receptor activity(GO:0099589) |
0.0 | 0.2 | GO:0000993 | RNA polymerase II core binding(GO:0000993) |
0.0 | 0.0 | GO:0004829 | threonine-tRNA ligase activity(GO:0004829) |
0.0 | 0.0 | GO:0098519 | nucleotide phosphatase activity, acting on free nucleotides(GO:0098519) |
0.0 | 0.4 | GO:0005212 | structural constituent of eye lens(GO:0005212) |
0.0 | 0.1 | GO:0034824 | enoyl-[acyl-carrier-protein] reductase activity(GO:0016631) 2,3-dihydroxy-2,3-dihydro-phenylpropionate dehydrogenase activity(GO:0018498) cis-2,3-dihydrodiol DDT dehydrogenase activity(GO:0018499) trans-9R,10R-dihydrodiolphenanthrene dehydrogenase activity(GO:0018500) cis-chlorobenzene dihydrodiol dehydrogenase activity(GO:0018501) 2,5-dichloro-2,5-cyclohexadiene-1,4-diol dehydrogenase activity(GO:0018502) trans-1,2-dihydrodiolphenanthrene dehydrogenase activity(GO:0018503) 3,4-dihydroxy-3,4-dihydrofluorene dehydrogenase activity(GO:0034790) benzo(a)pyrene-trans-11,12-dihydrodiol dehydrogenase activity(GO:0034805) benzo(a)pyrene-cis-4,5-dihydrodiol dehydrogenase activity(GO:0034809) citronellyl-CoA dehydrogenase activity(GO:0034824) menthone dehydrogenase activity(GO:0034838) phthalate 3,4-cis-dihydrodiol dehydrogenase activity(GO:0034912) cinnamate reductase activity(GO:0043786) NADPH-dependent curcumin reductase activity(GO:0052849) NADPH-dependent dihydrocurcumin reductase activity(GO:0052850) |
0.0 | 0.2 | GO:0050998 | nitric-oxide synthase binding(GO:0050998) |
0.0 | 0.0 | GO:0005375 | copper ion transmembrane transporter activity(GO:0005375) |
0.0 | 0.3 | GO:0031593 | polyubiquitin binding(GO:0031593) |
0.0 | 0.5 | GO:0017022 | myosin binding(GO:0017022) |
0.0 | 0.1 | GO:0005388 | calcium-transporting ATPase activity(GO:0005388) |
0.0 | 0.0 | GO:0004515 | nicotinamide-nucleotide adenylyltransferase activity(GO:0000309) nicotinate-nucleotide adenylyltransferase activity(GO:0004515) |
0.0 | 0.0 | GO:0035651 | AP-3 adaptor complex binding(GO:0035651) |
0.0 | 0.1 | GO:0004826 | phenylalanine-tRNA ligase activity(GO:0004826) |
0.0 | 0.1 | GO:0042015 | interleukin-20 binding(GO:0042015) |
0.0 | 1.8 | GO:0004867 | serine-type endopeptidase inhibitor activity(GO:0004867) |
0.0 | 0.1 | GO:0016997 | exo-alpha-sialidase activity(GO:0004308) alpha-sialidase activity(GO:0016997) exo-alpha-(2->3)-sialidase activity(GO:0052794) exo-alpha-(2->6)-sialidase activity(GO:0052795) exo-alpha-(2->8)-sialidase activity(GO:0052796) |
0.0 | 0.4 | GO:0005484 | SNAP receptor activity(GO:0005484) |
0.0 | 0.0 | GO:0008332 | low voltage-gated calcium channel activity(GO:0008332) |
0.0 | 0.1 | GO:0019869 | chloride channel inhibitor activity(GO:0019869) |
0.0 | 0.1 | GO:0015254 | glycerol transmembrane transporter activity(GO:0015168) glycerol channel activity(GO:0015254) |
0.0 | 0.0 | GO:0042284 | sphingolipid delta-4 desaturase activity(GO:0042284) |
0.0 | 0.1 | GO:0031782 | melanocortin receptor binding(GO:0031779) type 3 melanocortin receptor binding(GO:0031781) type 4 melanocortin receptor binding(GO:0031782) |
0.0 | 0.1 | GO:0060590 | ATPase regulator activity(GO:0060590) |
0.0 | 0.2 | GO:0051765 | inositol tetrakisphosphate kinase activity(GO:0051765) |
0.0 | 0.1 | GO:0070097 | delta-catenin binding(GO:0070097) |
0.0 | 0.5 | GO:0004712 | protein serine/threonine/tyrosine kinase activity(GO:0004712) |
0.0 | 0.2 | GO:0005243 | gap junction channel activity(GO:0005243) |
0.0 | 0.8 | GO:0004197 | cysteine-type endopeptidase activity(GO:0004197) |
0.0 | 0.2 | GO:0045236 | CXCR chemokine receptor binding(GO:0045236) |
0.0 | 0.0 | GO:0031750 | D3 dopamine receptor binding(GO:0031750) |
0.0 | 0.1 | GO:0005522 | profilin binding(GO:0005522) |
0.0 | 0.1 | GO:0008745 | N-acetylmuramoyl-L-alanine amidase activity(GO:0008745) peptidoglycan receptor activity(GO:0016019) |
0.0 | 0.2 | GO:0016641 | oxidoreductase activity, acting on the CH-NH2 group of donors, oxygen as acceptor(GO:0016641) |
0.0 | 0.0 | GO:0004719 | protein-L-isoaspartate (D-aspartate) O-methyltransferase activity(GO:0004719) |
0.0 | 0.2 | GO:0005487 | nucleocytoplasmic transporter activity(GO:0005487) |
0.0 | 0.1 | GO:0001094 | TFIID-class transcription factor binding(GO:0001094) |
0.0 | 0.0 | GO:0019136 | deoxynucleoside kinase activity(GO:0019136) |
0.0 | 0.1 | GO:0004945 | angiotensin type II receptor activity(GO:0004945) |
0.0 | 0.1 | GO:0017160 | Ral GTPase binding(GO:0017160) |
0.0 | 0.4 | GO:0005132 | type I interferon receptor binding(GO:0005132) |
0.0 | 0.0 | GO:0047023 | androsterone dehydrogenase activity(GO:0047023) |
0.0 | 0.0 | GO:0019961 | interferon binding(GO:0019961) |
0.0 | 0.0 | GO:0022829 | wide pore channel activity(GO:0022829) |
0.0 | 0.1 | GO:0008494 | translation activator activity(GO:0008494) |
0.0 | 0.0 | GO:0044213 | intronic transcription regulatory region DNA binding(GO:0044213) |
0.0 | 0.0 | GO:0004967 | glucagon receptor activity(GO:0004967) |
0.0 | 0.2 | GO:0015026 | coreceptor activity(GO:0015026) |
0.0 | 0.1 | GO:0036402 | proteasome-activating ATPase activity(GO:0036402) |
0.0 | 0.9 | GO:0005253 | anion channel activity(GO:0005253) |
0.0 | 0.0 | GO:0001642 | group III metabotropic glutamate receptor activity(GO:0001642) |
0.0 | 0.1 | GO:0005105 | type 1 fibroblast growth factor receptor binding(GO:0005105) |
0.0 | 0.1 | GO:0004707 | MAP kinase activity(GO:0004707) |
0.0 | 0.3 | GO:0051059 | NF-kappaB binding(GO:0051059) |
0.0 | 0.2 | GO:0005112 | Notch binding(GO:0005112) |
0.0 | 0.0 | GO:0004514 | nicotinate-nucleotide diphosphorylase (carboxylating) activity(GO:0004514) |
0.0 | 0.0 | GO:0004385 | guanylate kinase activity(GO:0004385) |
0.0 | 0.2 | GO:0035255 | ionotropic glutamate receptor binding(GO:0035255) |
0.0 | 0.7 | GO:0008565 | protein transporter activity(GO:0008565) |
0.0 | 0.2 | GO:0016290 | palmitoyl-CoA hydrolase activity(GO:0016290) |
0.0 | 0.0 | GO:0046976 | histone methyltransferase activity (H3-K27 specific)(GO:0046976) |
0.0 | 0.0 | GO:0016743 | carboxyl- or carbamoyltransferase activity(GO:0016743) |
0.0 | 0.0 | GO:0004704 | NF-kappaB-inducing kinase activity(GO:0004704) |
0.0 | 0.3 | GO:0001103 | RNA polymerase II repressing transcription factor binding(GO:0001103) |
0.0 | 0.1 | GO:0004028 | 3-chloroallyl aldehyde dehydrogenase activity(GO:0004028) |
0.0 | 0.1 | GO:0070628 | proteasome binding(GO:0070628) |
0.0 | 0.1 | GO:0070679 | inositol 1,4,5 trisphosphate binding(GO:0070679) |
0.0 | 0.1 | GO:0004303 | estradiol 17-beta-dehydrogenase activity(GO:0004303) |
0.0 | 0.0 | GO:0004974 | leukotriene receptor activity(GO:0004974) |
0.0 | 0.6 | GO:0019905 | syntaxin binding(GO:0019905) |
0.0 | 0.0 | GO:0001591 | dopamine neurotransmitter receptor activity, coupled via Gi/Go(GO:0001591) |
0.0 | 0.0 | GO:0032357 | oxidized DNA binding(GO:0032356) oxidized purine DNA binding(GO:0032357) |
0.0 | 0.1 | GO:0070181 | small ribosomal subunit rRNA binding(GO:0070181) |
0.0 | 0.0 | GO:0070095 | fructose-6-phosphate binding(GO:0070095) |
0.0 | 0.0 | GO:0001224 | RNA polymerase II transcription cofactor binding(GO:0001224) |
0.0 | 0.4 | GO:0043130 | ubiquitin binding(GO:0043130) |
0.0 | 0.2 | GO:0016676 | cytochrome-c oxidase activity(GO:0004129) heme-copper terminal oxidase activity(GO:0015002) oxidoreductase activity, acting on a heme group of donors, oxygen as acceptor(GO:0016676) |
0.0 | 0.3 | GO:0016702 | oxidoreductase activity, acting on single donors with incorporation of molecular oxygen(GO:0016701) oxidoreductase activity, acting on single donors with incorporation of molecular oxygen, incorporation of two atoms of oxygen(GO:0016702) |
0.0 | 0.0 | GO:0008532 | N-acetyllactosaminide beta-1,3-N-acetylglucosaminyltransferase activity(GO:0008532) |
0.0 | 1.0 | GO:0003774 | motor activity(GO:0003774) |
0.0 | 0.3 | GO:0001540 | beta-amyloid binding(GO:0001540) |
0.0 | 0.0 | GO:0030297 | transmembrane receptor protein tyrosine kinase activator activity(GO:0030297) |
0.0 | 0.0 | GO:0016413 | O-acetyltransferase activity(GO:0016413) |
0.0 | 0.2 | GO:0019212 | phosphatase inhibitor activity(GO:0019212) |
0.0 | 2.1 | GO:0016879 | ligase activity, forming carbon-nitrogen bonds(GO:0016879) |
0.0 | 0.0 | GO:0086006 | voltage-gated sodium channel activity involved in cardiac muscle cell action potential(GO:0086006) |
0.0 | 0.0 | GO:0008079 | translation release factor activity(GO:0003747) translation termination factor activity(GO:0008079) |
0.0 | 0.1 | GO:0015271 | outward rectifier potassium channel activity(GO:0015271) |
0.0 | 0.0 | GO:0033592 | RNA strand annealing activity(GO:0033592) |
0.0 | 0.0 | GO:0031726 | CCR1 chemokine receptor binding(GO:0031726) |
0.0 | 0.0 | GO:0004999 | vasoactive intestinal polypeptide receptor activity(GO:0004999) |
0.0 | 0.1 | GO:0004016 | adenylate cyclase activity(GO:0004016) |
0.0 | 0.1 | GO:0016493 | C-C chemokine receptor activity(GO:0016493) |
0.0 | 0.0 | GO:0015232 | heme transporter activity(GO:0015232) |
0.0 | 0.1 | GO:0051428 | peptide hormone receptor binding(GO:0051428) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.1 | 0.1 | PID ERBB4 PATHWAY | ErbB4 signaling events |
0.1 | 0.1 | PID GLYPICAN 1PATHWAY | Glypican 1 network |
0.0 | 0.1 | PID ECADHERIN KERATINOCYTE PATHWAY | E-cadherin signaling in keratinocytes |
0.0 | 0.3 | SA REG CASCADE OF CYCLIN EXPR | Expression of cyclins regulates progression through the cell cycle by activating cyclin-dependent kinases. |
0.0 | 0.5 | PID P38 MKK3 6PATHWAY | p38 MAPK signaling pathway |
0.0 | 1.1 | PID EPHRINB REV PATHWAY | Ephrin B reverse signaling |
0.0 | 1.2 | PID GMCSF PATHWAY | GMCSF-mediated signaling events |
0.0 | 1.0 | PID INTEGRIN A9B1 PATHWAY | Alpha9 beta1 integrin signaling events |
0.0 | 1.5 | ST P38 MAPK PATHWAY | p38 MAPK Pathway |
0.0 | 0.2 | ST STAT3 PATHWAY | STAT3 Pathway |
0.0 | 0.1 | SA PROGRAMMED CELL DEATH | Programmed cell death, or apoptosis, eliminates damaged or unneeded cells. |
0.0 | 0.0 | ST IL 13 PATHWAY | Interleukin 13 (IL-13) Pathway |
0.0 | 0.7 | PID RETINOIC ACID PATHWAY | Retinoic acid receptors-mediated signaling |
0.0 | 0.3 | PID IL3 PATHWAY | IL3-mediated signaling events |
0.0 | 0.0 | PID ARF6 DOWNSTREAM PATHWAY | Arf6 downstream pathway |
0.0 | 0.5 | PID CIRCADIAN PATHWAY | Circadian rhythm pathway |
0.0 | 1.6 | PID TAP63 PATHWAY | Validated transcriptional targets of TAp63 isoforms |
0.0 | 0.9 | PID TNF PATHWAY | TNF receptor signaling pathway |
0.0 | 0.4 | PID THROMBIN PAR4 PATHWAY | PAR4-mediated thrombin signaling events |
0.0 | 1.2 | PID ARF6 TRAFFICKING PATHWAY | Arf6 trafficking events |
0.0 | 0.1 | PID PI3K PLC TRK PATHWAY | Trk receptor signaling mediated by PI3K and PLC-gamma |
0.0 | 0.1 | PID P38 GAMMA DELTA PATHWAY | Signaling mediated by p38-gamma and p38-delta |
0.0 | 0.3 | PID EPHA2 FWD PATHWAY | EPHA2 forward signaling |
0.0 | 0.2 | PID IL2 1PATHWAY | IL2-mediated signaling events |
0.0 | 0.0 | PID ALK2 PATHWAY | ALK2 signaling events |
0.0 | 0.1 | PID IL8 CXCR1 PATHWAY | IL8- and CXCR1-mediated signaling events |
0.0 | 0.5 | ST GAQ PATHWAY | G alpha q Pathway |
0.0 | 0.7 | ST PHOSPHOINOSITIDE 3 KINASE PATHWAY | PI3K Pathway |
0.0 | 0.3 | PID ECADHERIN STABILIZATION PATHWAY | Stabilization and expansion of the E-cadherin adherens junction |
0.0 | 0.3 | ST GRANULE CELL SURVIVAL PATHWAY | Granule Cell Survival Pathway is a specific case of more general PAC1 Receptor Pathway. |
0.0 | 0.5 | PID ANGIOPOIETIN RECEPTOR PATHWAY | Angiopoietin receptor Tie2-mediated signaling |
0.0 | 0.1 | PID P38 ALPHA BETA PATHWAY | Regulation of p38-alpha and p38-beta |
0.0 | 0.1 | PID IFNG PATHWAY | IFN-gamma pathway |
0.0 | 0.1 | PID IL5 PATHWAY | IL5-mediated signaling events |
0.0 | 0.0 | PID P38 MK2 PATHWAY | p38 signaling mediated by MAPKAP kinases |
0.0 | 0.5 | PID FOXO PATHWAY | FoxO family signaling |
0.0 | 0.1 | SIG BCR SIGNALING PATHWAY | Members of the BCR signaling pathway |
0.0 | 0.5 | PID BARD1 PATHWAY | BARD1 signaling events |
0.0 | 0.7 | PID RAC1 PATHWAY | RAC1 signaling pathway |
0.0 | 0.3 | PID HEDGEHOG 2PATHWAY | Signaling events mediated by the Hedgehog family |
0.0 | 0.4 | PID CDC42 PATHWAY | CDC42 signaling events |
0.0 | 0.2 | PID PRL SIGNALING EVENTS PATHWAY | Signaling events mediated by PRL |
0.0 | 0.0 | PID S1P S1P2 PATHWAY | S1P2 pathway |
0.0 | 0.2 | PID LPA4 PATHWAY | LPA4-mediated signaling events |
0.0 | 0.1 | PID NEPHRIN NEPH1 PATHWAY | Nephrin/Neph1 signaling in the kidney podocyte |
0.0 | 0.1 | PID ARF6 PATHWAY | Arf6 signaling events |
0.0 | 0.1 | PID VEGFR1 2 PATHWAY | Signaling events mediated by VEGFR1 and VEGFR2 |
0.0 | 0.6 | PID LKB1 PATHWAY | LKB1 signaling events |
0.0 | 0.0 | SA B CELL RECEPTOR COMPLEXES | Antigen binding to B cell receptors activates protein tyrosine kinases, such as the Src family, which ultimate activate MAP kinases. |
0.0 | 0.6 | PID REG GR PATHWAY | Glucocorticoid receptor regulatory network |
0.0 | 0.0 | PID ER NONGENOMIC PATHWAY | Plasma membrane estrogen receptor signaling |
0.0 | 0.3 | PID P73PATHWAY | p73 transcription factor network |
0.0 | 0.6 | PID CXCR4 PATHWAY | CXCR4-mediated signaling events |
0.0 | 0.0 | PID TCPTP PATHWAY | Signaling events mediated by TCPTP |
0.0 | 0.4 | PID ILK PATHWAY | Integrin-linked kinase signaling |
0.0 | 0.3 | PID ATR PATHWAY | ATR signaling pathway |
0.0 | 0.1 | PID IL8 CXCR2 PATHWAY | IL8- and CXCR2-mediated signaling events |
0.0 | 0.0 | ST INTERLEUKIN 4 PATHWAY | Interleukin 4 (IL-4) Pathway |
0.0 | 0.6 | PID INTEGRIN1 PATHWAY | Beta1 integrin cell surface interactions |
0.0 | 0.3 | PID MET PATHWAY | Signaling events mediated by Hepatocyte Growth Factor Receptor (c-Met) |
0.0 | 0.4 | PID TRKR PATHWAY | Neurotrophic factor-mediated Trk receptor signaling |
0.0 | 0.1 | PID VEGFR1 PATHWAY | VEGFR1 specific signals |
0.0 | 0.1 | PID NFKAPPAB ATYPICAL PATHWAY | Atypical NF-kappaB pathway |
0.0 | 0.5 | PID IL4 2PATHWAY | IL4-mediated signaling events |
0.0 | 0.7 | PID BETA CATENIN NUC PATHWAY | Regulation of nuclear beta catenin signaling and target gene transcription |
0.0 | 0.0 | PID CXCR3 PATHWAY | CXCR3-mediated signaling events |
0.0 | 2.7 | NABA ECM REGULATORS | Genes encoding enzymes and their regulators involved in the remodeling of the extracellular matrix |
0.0 | 0.0 | SA CASPASE CASCADE | Apoptosis is mediated by caspases, cysteine proteases arranged in a proteolytic cascade. |
0.0 | 0.1 | SA MMP CYTOKINE CONNECTION | Cytokines can induce activation of matrix metalloproteinases, which degrade extracellular matrix. |
0.0 | 0.0 | ST B CELL ANTIGEN RECEPTOR | B Cell Antigen Receptor |
0.0 | 0.1 | PID BETA CATENIN DEG PATHWAY | Degradation of beta catenin |
0.0 | 0.2 | PID LIS1 PATHWAY | Lissencephaly gene (LIS1) in neuronal migration and development |
0.0 | 0.4 | PID MYC REPRESS PATHWAY | Validated targets of C-MYC transcriptional repression |
0.0 | 0.0 | PID FAS PATHWAY | FAS (CD95) signaling pathway |
0.0 | 0.1 | PID THROMBIN PAR1 PATHWAY | PAR1-mediated thrombin signaling events |
0.0 | 0.0 | PID PDGFRA PATHWAY | PDGFR-alpha signaling pathway |
0.0 | 0.1 | PID CD40 PATHWAY | CD40/CD40L signaling |
0.0 | 0.1 | PID HDAC CLASSIII PATHWAY | Signaling events mediated by HDAC Class III |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.1 | 1.0 | REACTOME ABACAVIR TRANSPORT AND METABOLISM | Genes involved in Abacavir transport and metabolism |
0.1 | 1.7 | REACTOME REGULATION OF INSULIN LIKE GROWTH FACTOR IGF ACTIVITY BY INSULIN LIKE GROWTH FACTOR BINDING PROTEINS IGFBPS | Genes involved in Regulation of Insulin-like Growth Factor (IGF) Activity by Insulin-like Growth Factor Binding Proteins (IGFBPs) |
0.1 | 0.1 | REACTOME RORA ACTIVATES CIRCADIAN EXPRESSION | Genes involved in RORA Activates Circadian Expression |
0.1 | 0.9 | REACTOME ORGANIC CATION ANION ZWITTERION TRANSPORT | Genes involved in Organic cation/anion/zwitterion transport |
0.1 | 2.1 | REACTOME SULFUR AMINO ACID METABOLISM | Genes involved in Sulfur amino acid metabolism |
0.1 | 1.2 | REACTOME HDL MEDIATED LIPID TRANSPORT | Genes involved in HDL-mediated lipid transport |
0.1 | 1.2 | REACTOME GRB2 SOS PROVIDES LINKAGE TO MAPK SIGNALING FOR INTERGRINS | Genes involved in GRB2:SOS provides linkage to MAPK signaling for Intergrins |
0.1 | 0.6 | REACTOME NFKB IS ACTIVATED AND SIGNALS SURVIVAL | Genes involved in NF-kB is activated and signals survival |
0.1 | 0.3 | REACTOME BINDING AND ENTRY OF HIV VIRION | Genes involved in Binding and entry of HIV virion |
0.1 | 0.1 | REACTOME PLATELET ACTIVATION SIGNALING AND AGGREGATION | Genes involved in Platelet activation, signaling and aggregation |
0.1 | 0.1 | REACTOME SIGNALING BY CONSTITUTIVELY ACTIVE EGFR | Genes involved in Signaling by constitutively active EGFR |
0.1 | 0.2 | REACTOME OLFACTORY SIGNALING PATHWAY | Genes involved in Olfactory Signaling Pathway |
0.1 | 1.5 | REACTOME METAL ION SLC TRANSPORTERS | Genes involved in Metal ion SLC transporters |
0.1 | 1.0 | REACTOME SYNTHESIS OF VERY LONG CHAIN FATTY ACYL COAS | Genes involved in Synthesis of very long-chain fatty acyl-CoAs |
0.1 | 0.1 | REACTOME OPIOID SIGNALLING | Genes involved in Opioid Signalling |
0.1 | 0.6 | REACTOME SYNTHESIS OF PE | Genes involved in Synthesis of PE |
0.1 | 0.5 | REACTOME IRAK2 MEDIATED ACTIVATION OF TAK1 COMPLEX UPON TLR7 8 OR 9 STIMULATION | Genes involved in IRAK2 mediated activation of TAK1 complex upon TLR7/8 or 9 stimulation |
0.1 | 0.4 | REACTOME REGULATED PROTEOLYSIS OF P75NTR | Genes involved in Regulated proteolysis of p75NTR |
0.1 | 0.9 | REACTOME PLATELET SENSITIZATION BY LDL | Genes involved in Platelet sensitization by LDL |
0.1 | 0.1 | REACTOME 3 UTR MEDIATED TRANSLATIONAL REGULATION | Genes involved in 3' -UTR-mediated translational regulation |
0.1 | 0.7 | REACTOME NOTCH HLH TRANSCRIPTION PATHWAY | Genes involved in Notch-HLH transcription pathway |
0.1 | 0.9 | REACTOME PLATELET CALCIUM HOMEOSTASIS | Genes involved in Platelet calcium homeostasis |
0.1 | 0.5 | REACTOME APOPTOTIC CLEAVAGE OF CELL ADHESION PROTEINS | Genes involved in Apoptotic cleavage of cell adhesion proteins |
0.1 | 0.5 | REACTOME SYNTHESIS OF BILE ACIDS AND BILE SALTS VIA 24 HYDROXYCHOLESTEROL | Genes involved in Synthesis of bile acids and bile salts via 24-hydroxycholesterol |
0.0 | 0.4 | REACTOME ROLE OF DCC IN REGULATING APOPTOSIS | Genes involved in Role of DCC in regulating apoptosis |
0.0 | 0.7 | REACTOME CIRCADIAN REPRESSION OF EXPRESSION BY REV ERBA | Genes involved in Circadian Repression of Expression by REV-ERBA |
0.0 | 0.0 | REACTOME GABA RECEPTOR ACTIVATION | Genes involved in GABA receptor activation |
0.0 | 0.1 | REACTOME TRAF6 MEDIATED NFKB ACTIVATION | Genes involved in TRAF6 mediated NF-kB activation |
0.0 | 0.2 | REACTOME INITIAL TRIGGERING OF COMPLEMENT | Genes involved in Initial triggering of complement |
0.0 | 0.2 | REACTOME CTNNB1 PHOSPHORYLATION CASCADE | Genes involved in Beta-catenin phosphorylation cascade |
0.0 | 0.2 | REACTOME SEMA3A PAK DEPENDENT AXON REPULSION | Genes involved in Sema3A PAK dependent Axon repulsion |
0.0 | 0.3 | REACTOME NEGATIVE REGULATION OF THE PI3K AKT NETWORK | Genes involved in Negative regulation of the PI3K/AKT network |
0.0 | 0.1 | REACTOME TRAF3 DEPENDENT IRF ACTIVATION PATHWAY | Genes involved in TRAF3-dependent IRF activation pathway |
0.0 | 0.7 | REACTOME POST CHAPERONIN TUBULIN FOLDING PATHWAY | Genes involved in Post-chaperonin tubulin folding pathway |
0.0 | 0.5 | REACTOME HORMONE SENSITIVE LIPASE HSL MEDIATED TRIACYLGLYCEROL HYDROLYSIS | Genes involved in Hormone-sensitive lipase (HSL)-mediated triacylglycerol hydrolysis |
0.0 | 0.0 | REACTOME GLUCAGON SIGNALING IN METABOLIC REGULATION | Genes involved in Glucagon signaling in metabolic regulation |
0.0 | 1.3 | REACTOME NOTCH1 INTRACELLULAR DOMAIN REGULATES TRANSCRIPTION | Genes involved in NOTCH1 Intracellular Domain Regulates Transcription |
0.0 | 0.4 | REACTOME ACTIVATION OF IRF3 IRF7 MEDIATED BY TBK1 IKK EPSILON | Genes involved in Activation of IRF3/IRF7 mediated by TBK1/IKK epsilon |
0.0 | 0.4 | REACTOME SYNTHESIS OF PIPS AT THE LATE ENDOSOME MEMBRANE | Genes involved in Synthesis of PIPs at the late endosome membrane |
0.0 | 0.3 | REACTOME TRANSPORT OF ORGANIC ANIONS | Genes involved in Transport of organic anions |
0.0 | 0.8 | REACTOME TRANSPORT OF VITAMINS NUCLEOSIDES AND RELATED MOLECULES | Genes involved in Transport of vitamins, nucleosides, and related molecules |
0.0 | 1.5 | REACTOME IL 2 SIGNALING | Genes involved in Interleukin-2 signaling |
0.0 | 0.6 | REACTOME RNA POL I TRANSCRIPTION TERMINATION | Genes involved in RNA Polymerase I Transcription Termination |
0.0 | 0.5 | REACTOME CRMPS IN SEMA3A SIGNALING | Genes involved in CRMPs in Sema3A signaling |
0.0 | 0.9 | REACTOME SEMA4D INDUCED CELL MIGRATION AND GROWTH CONE COLLAPSE | Genes involved in Sema4D induced cell migration and growth-cone collapse |
0.0 | 0.9 | REACTOME ASSOCIATION OF TRIC CCT WITH TARGET PROTEINS DURING BIOSYNTHESIS | Genes involved in Association of TriC/CCT with target proteins during biosynthesis |
0.0 | 0.9 | REACTOME RNA POL III TRANSCRIPTION INITIATION FROM TYPE 3 PROMOTER | Genes involved in RNA Polymerase III Transcription Initiation From Type 3 Promoter |
0.0 | 0.4 | REACTOME PURINE SALVAGE | Genes involved in Purine salvage |
0.0 | 0.2 | REACTOME PHOSPHORYLATION OF CD3 AND TCR ZETA CHAINS | Genes involved in Phosphorylation of CD3 and TCR zeta chains |
0.0 | 0.1 | REACTOME MRNA CAPPING | Genes involved in mRNA Capping |
0.0 | 0.4 | REACTOME RESOLUTION OF AP SITES VIA THE SINGLE NUCLEOTIDE REPLACEMENT PATHWAY | Genes involved in Resolution of AP sites via the single-nucleotide replacement pathway |
0.0 | 0.5 | REACTOME CONVERSION FROM APC C CDC20 TO APC C CDH1 IN LATE ANAPHASE | Genes involved in Conversion from APC/C:Cdc20 to APC/C:Cdh1 in late anaphase |
0.0 | 0.1 | REACTOME EGFR DOWNREGULATION | Genes involved in EGFR downregulation |
0.0 | 0.4 | REACTOME ACTIVATION OF BH3 ONLY PROTEINS | Genes involved in Activation of BH3-only proteins |
0.0 | 0.5 | REACTOME NEGATIVE REGULATORS OF RIG I MDA5 SIGNALING | Genes involved in Negative regulators of RIG-I/MDA5 signaling |
0.0 | 5.1 | REACTOME METABOLISM OF AMINO ACIDS AND DERIVATIVES | Genes involved in Metabolism of amino acids and derivatives |
0.0 | 0.4 | REACTOME PYRUVATE METABOLISM | Genes involved in Pyruvate metabolism |
0.0 | 0.8 | REACTOME NEP NS2 INTERACTS WITH THE CELLULAR EXPORT MACHINERY | Genes involved in NEP/NS2 Interacts with the Cellular Export Machinery |
0.0 | 0.4 | REACTOME REGULATORY RNA PATHWAYS | Genes involved in Regulatory RNA pathways |
0.0 | 0.1 | REACTOME APOBEC3G MEDIATED RESISTANCE TO HIV1 INFECTION | Genes involved in APOBEC3G mediated resistance to HIV-1 infection |
0.0 | 0.3 | REACTOME COPI MEDIATED TRANSPORT | Genes involved in COPI Mediated Transport |
0.0 | 0.3 | REACTOME PROTEOLYTIC CLEAVAGE OF SNARE COMPLEX PROTEINS | Genes involved in Proteolytic cleavage of SNARE complex proteins |
0.0 | 0.4 | REACTOME SYNTHESIS OF PA | Genes involved in Synthesis of PA |
0.0 | 0.4 | REACTOME SYNTHESIS OF SUBSTRATES IN N GLYCAN BIOSYTHESIS | Genes involved in Synthesis of substrates in N-glycan biosythesis |
0.0 | 0.1 | REACTOME REGULATION OF THE FANCONI ANEMIA PATHWAY | Genes involved in Regulation of the Fanconi anemia pathway |
0.0 | 0.3 | REACTOME BILE SALT AND ORGANIC ANION SLC TRANSPORTERS | Genes involved in Bile salt and organic anion SLC transporters |
0.0 | 0.1 | REACTOME APC CDC20 MEDIATED DEGRADATION OF NEK2A | Genes involved in APC-Cdc20 mediated degradation of Nek2A |
0.0 | 0.5 | REACTOME GABA SYNTHESIS RELEASE REUPTAKE AND DEGRADATION | Genes involved in GABA synthesis, release, reuptake and degradation |
0.0 | 0.1 | REACTOME SOS MEDIATED SIGNALLING | Genes involved in SOS-mediated signalling |
0.0 | 0.2 | REACTOME FORMATION OF TRANSCRIPTION COUPLED NER TC NER REPAIR COMPLEX | Genes involved in Formation of transcription-coupled NER (TC-NER) repair complex |
0.0 | 0.3 | REACTOME FORMATION OF ATP BY CHEMIOSMOTIC COUPLING | Genes involved in Formation of ATP by chemiosmotic coupling |
0.0 | 0.4 | REACTOME REPAIR SYNTHESIS FOR GAP FILLING BY DNA POL IN TC NER | Genes involved in Repair synthesis for gap-filling by DNA polymerase in TC-NER |
0.0 | 0.3 | REACTOME SYNTHESIS SECRETION AND DEACYLATION OF GHRELIN | Genes involved in Synthesis, Secretion, and Deacylation of Ghrelin |
0.0 | 3.3 | REACTOME ANTIGEN PROCESSING UBIQUITINATION PROTEASOME DEGRADATION | Genes involved in Antigen processing: Ubiquitination & Proteasome degradation |
0.0 | 0.0 | REACTOME APC C CDC20 MEDIATED DEGRADATION OF MITOTIC PROTEINS | Genes involved in APC/C:Cdc20 mediated degradation of mitotic proteins |
0.0 | 0.3 | REACTOME IONOTROPIC ACTIVITY OF KAINATE RECEPTORS | Genes involved in Ionotropic activity of Kainate Receptors |
0.0 | 0.7 | REACTOME MEIOTIC SYNAPSIS | Genes involved in Meiotic Synapsis |
0.0 | 0.3 | REACTOME ACYL CHAIN REMODELLING OF PS | Genes involved in Acyl chain remodelling of PS |
0.0 | 0.2 | REACTOME ADENYLATE CYCLASE ACTIVATING PATHWAY | Genes involved in Adenylate cyclase activating pathway |
0.0 | 0.3 | REACTOME RIP MEDIATED NFKB ACTIVATION VIA DAI | Genes involved in RIP-mediated NFkB activation via DAI |
0.0 | 0.2 | REACTOME RETROGRADE NEUROTROPHIN SIGNALLING | Genes involved in Retrograde neurotrophin signalling |
0.0 | 0.3 | REACTOME INSULIN SYNTHESIS AND PROCESSING | Genes involved in Insulin Synthesis and Processing |
0.0 | 0.5 | REACTOME ENDOSOMAL SORTING COMPLEX REQUIRED FOR TRANSPORT ESCRT | Genes involved in Endosomal Sorting Complex Required For Transport (ESCRT) |
0.0 | 0.2 | REACTOME DCC MEDIATED ATTRACTIVE SIGNALING | Genes involved in DCC mediated attractive signaling |
0.0 | 0.0 | REACTOME CD28 DEPENDENT VAV1 PATHWAY | Genes involved in CD28 dependent Vav1 pathway |
0.0 | 0.2 | REACTOME SLBP DEPENDENT PROCESSING OF REPLICATION DEPENDENT HISTONE PRE MRNAS | Genes involved in SLBP Dependent Processing of Replication-Dependent Histone Pre-mRNAs |
0.0 | 0.1 | REACTOME REGULATION OF KIT SIGNALING | Genes involved in Regulation of KIT signaling |
0.0 | 0.0 | REACTOME BOTULINUM NEUROTOXICITY | Genes involved in Botulinum neurotoxicity |
0.0 | 0.2 | REACTOME PURINE CATABOLISM | Genes involved in Purine catabolism |
0.0 | 0.6 | REACTOME IRON UPTAKE AND TRANSPORT | Genes involved in Iron uptake and transport |
0.0 | 0.1 | REACTOME ACTIVATION OF THE AP1 FAMILY OF TRANSCRIPTION FACTORS | Genes involved in Activation of the AP-1 family of transcription factors |
0.0 | 0.3 | REACTOME BASIGIN INTERACTIONS | Genes involved in Basigin interactions |
0.0 | 0.0 | REACTOME PROSTACYCLIN SIGNALLING THROUGH PROSTACYCLIN RECEPTOR | Genes involved in Prostacyclin signalling through prostacyclin receptor |
0.0 | 0.0 | REACTOME PECAM1 INTERACTIONS | Genes involved in PECAM1 interactions |
0.0 | 0.4 | REACTOME CYTOSOLIC TRNA AMINOACYLATION | Genes involved in Cytosolic tRNA aminoacylation |
0.0 | 0.3 | REACTOME ABCA TRANSPORTERS IN LIPID HOMEOSTASIS | Genes involved in ABCA transporters in lipid homeostasis |
0.0 | 0.2 | REACTOME SYNTHESIS OF PC | Genes involved in Synthesis of PC |
0.0 | 0.7 | REACTOME NUCLEAR RECEPTOR TRANSCRIPTION PATHWAY | Genes involved in Nuclear Receptor transcription pathway |
0.0 | 0.1 | REACTOME DOWNREGULATION OF ERBB2 ERBB3 SIGNALING | Genes involved in Downregulation of ERBB2:ERBB3 signaling |
0.0 | 0.1 | REACTOME AKT PHOSPHORYLATES TARGETS IN THE CYTOSOL | Genes involved in AKT phosphorylates targets in the cytosol |
0.0 | 0.3 | REACTOME RNA POL II TRANSCRIPTION PRE INITIATION AND PROMOTER OPENING | Genes involved in RNA Polymerase II Transcription Pre-Initiation And Promoter Opening |
0.0 | 0.3 | REACTOME ACTIVATED NOTCH1 TRANSMITS SIGNAL TO THE NUCLEUS | Genes involved in Activated NOTCH1 Transmits Signal to the Nucleus |
0.0 | 0.0 | REACTOME FGFR4 LIGAND BINDING AND ACTIVATION | Genes involved in FGFR4 ligand binding and activation |
0.0 | 0.1 | REACTOME CREATION OF C4 AND C2 ACTIVATORS | Genes involved in Creation of C4 and C2 activators |
0.0 | 0.3 | REACTOME DESTABILIZATION OF MRNA BY BRF1 | Genes involved in Destabilization of mRNA by Butyrate Response Factor 1 (BRF1) |
0.0 | 0.2 | REACTOME RECRUITMENT OF NUMA TO MITOTIC CENTROSOMES | Genes involved in Recruitment of NuMA to mitotic centrosomes |
0.0 | 0.1 | REACTOME THE ACTIVATION OF ARYLSULFATASES | Genes involved in The activation of arylsulfatases |
0.0 | 0.1 | REACTOME HOMOLOGOUS RECOMBINATION REPAIR OF REPLICATION INDEPENDENT DOUBLE STRAND BREAKS | Genes involved in Homologous recombination repair of replication-independent double-strand breaks |
0.0 | 0.5 | REACTOME IMMUNOREGULATORY INTERACTIONS BETWEEN A LYMPHOID AND A NON LYMPHOID CELL | Genes involved in Immunoregulatory interactions between a Lymphoid and a non-Lymphoid cell |
0.0 | 0.2 | REACTOME BIOSYNTHESIS OF THE N GLYCAN PRECURSOR DOLICHOL LIPID LINKED OLIGOSACCHARIDE LLO AND TRANSFER TO A NASCENT PROTEIN | Genes involved in Biosynthesis of the N-glycan precursor (dolichol lipid-linked oligosaccharide, LLO) and transfer to a nascent protein |
0.0 | 0.0 | REACTOME P53 DEPENDENT G1 DNA DAMAGE RESPONSE | Genes involved in p53-Dependent G1 DNA Damage Response |
0.0 | 0.2 | REACTOME FANCONI ANEMIA PATHWAY | Genes involved in Fanconi Anemia pathway |
0.0 | 0.0 | REACTOME BILE ACID AND BILE SALT METABOLISM | Genes involved in Bile acid and bile salt metabolism |
0.0 | 0.0 | REACTOME KINESINS | Genes involved in Kinesins |
0.0 | 0.1 | REACTOME VEGF LIGAND RECEPTOR INTERACTIONS | Genes involved in VEGF ligand-receptor interactions |
0.0 | 0.3 | REACTOME CGMP EFFECTS | Genes involved in cGMP effects |
0.0 | 0.0 | REACTOME INSULIN RECEPTOR RECYCLING | Genes involved in Insulin receptor recycling |
0.0 | 0.1 | REACTOME OPSINS | Genes involved in Opsins |
0.0 | 0.5 | REACTOME INTERFERON GAMMA SIGNALING | Genes involved in Interferon gamma signaling |
0.0 | 0.1 | REACTOME DIGESTION OF DIETARY CARBOHYDRATE | Genes involved in Digestion of dietary carbohydrate |
0.0 | 0.1 | REACTOME INTEGRATION OF PROVIRUS | Genes involved in Integration of provirus |
0.0 | 0.2 | REACTOME FGFR2C LIGAND BINDING AND ACTIVATION | Genes involved in FGFR2c ligand binding and activation |
0.0 | 0.0 | REACTOME SIGNALING BY ERBB2 | Genes involved in Signaling by ERBB2 |
0.0 | 0.0 | REACTOME SIGNAL ATTENUATION | Genes involved in Signal attenuation |
0.0 | 0.1 | REACTOME TIE2 SIGNALING | Genes involved in Tie2 Signaling |
0.0 | 0.4 | REACTOME ION TRANSPORT BY P TYPE ATPASES | Genes involved in Ion transport by P-type ATPases |
0.0 | 0.1 | REACTOME UNWINDING OF DNA | Genes involved in Unwinding of DNA |
0.0 | 0.1 | REACTOME EXTRINSIC PATHWAY FOR APOPTOSIS | Genes involved in Extrinsic Pathway for Apoptosis |
0.0 | 0.5 | REACTOME CHEMOKINE RECEPTORS BIND CHEMOKINES | Genes involved in Chemokine receptors bind chemokines |
0.0 | 0.3 | REACTOME TRANSPORT OF MATURE TRANSCRIPT TO CYTOPLASM | Genes involved in Transport of Mature Transcript to Cytoplasm |
0.0 | 0.1 | REACTOME BETA DEFENSINS | Genes involved in Beta defensins |
0.0 | 0.1 | REACTOME PURINE RIBONUCLEOSIDE MONOPHOSPHATE BIOSYNTHESIS | Genes involved in Purine ribonucleoside monophosphate biosynthesis |
0.0 | 0.2 | REACTOME MYOGENESIS | Genes involved in Myogenesis |
0.0 | 0.1 | REACTOME INHIBITION OF VOLTAGE GATED CA2 CHANNELS VIA GBETA GAMMA SUBUNITS | Genes involved in Inhibition of voltage gated Ca2+ channels via Gbeta/gamma subunits |
0.0 | 0.1 | REACTOME HYALURONAN UPTAKE AND DEGRADATION | Genes involved in Hyaluronan uptake and degradation |
0.0 | 0.2 | REACTOME LIGAND GATED ION CHANNEL TRANSPORT | Genes involved in Ligand-gated ion channel transport |