| Gene Symbol | Gene ID | Gene Info |
|---|---|---|
|
Gli3
|
ENSMUSG00000021318.9 | GLI-Kruppel family member GLI3 |
|
Zic1
|
ENSMUSG00000032368.8 | zinc finger protein of the cerebellum 1 |
Move your cursor over a bar to see sample name and corresponding Z-value.
| Cis Regulatory Element (CRE) | Target Score | Top associated gene | Gene Info | Distance of CRE to TSS | CRE/Gene association probability |
|---|---|---|---|---|---|
| chr2_58769522_58769673 | 1.67 |
Upp2 |
uridine phosphorylase 2 |
4272 |
0.24 |
| chr4_49509532_49509683 | 1.40 |
Baat |
bile acid-Coenzyme A: amino acid N-acyltransferase |
3050 |
0.16 |
| chr7_112831299_112831464 | 1.33 |
Tead1 |
TEA domain family member 1 |
8253 |
0.26 |
| chr9_48724021_48724519 | 1.18 |
Zbtb16 |
zinc finger and BTB domain containing 16 |
111675 |
0.06 |
| chr4_19705795_19705946 | 1.11 |
Wwp1 |
WW domain containing E3 ubiquitin protein ligase 1 |
3123 |
0.28 |
| chr19_17775291_17775442 | 1.05 |
Pcsk5 |
proprotein convertase subtilisin/kexin type 5 |
62251 |
0.11 |
| chr12_69573925_69574080 | 1.04 |
Vcpkmt |
valosin containing protein lysine (K) methyltransferase |
8933 |
0.14 |
| chr2_163301297_163301733 | 1.03 |
Tox2 |
TOX high mobility group box family member 2 |
18863 |
0.19 |
| chr7_114066489_114066748 | 0.99 |
Gm45615 |
predicted gene 45615 |
20280 |
0.22 |
| chr5_134455761_134455912 | 0.99 |
Gtf2ird1 |
general transcription factor II I repeat domain-containing 1 |
115 |
0.54 |
| chr7_46742642_46742793 | 0.95 |
Saa1 |
serum amyloid A 1 |
225 |
0.84 |
| chr11_60205379_60205543 | 0.88 |
Srebf1 |
sterol regulatory element binding transcription factor 1 |
651 |
0.56 |
| chr9_118506575_118506765 | 0.87 |
Golga4 |
golgi autoantigen, golgin subfamily a, 4 |
219 |
0.91 |
| chr2_77517119_77517293 | 0.87 |
Zfp385b |
zinc finger protein 385B |
2329 |
0.39 |
| chr11_5900928_5901079 | 0.82 |
Gck |
glucokinase |
1084 |
0.34 |
| chr9_106202795_106203252 | 0.80 |
Twf2 |
twinfilin actin binding protein 2 |
85 |
0.93 |
| chr5_125524109_125525122 | 0.76 |
Tmem132b |
transmembrane protein 132B |
7159 |
0.16 |
| chr2_128566843_128567023 | 0.75 |
Gm14006 |
predicted gene 14006 |
8699 |
0.13 |
| chr4_147847988_147848325 | 0.75 |
Zfp933 |
zinc finger protein 933 |
210 |
0.88 |
| chr1_74067073_74067224 | 0.72 |
Tns1 |
tensin 1 |
24203 |
0.17 |
| chr2_27410884_27411138 | 0.70 |
Gm24049 |
predicted gene, 24049 |
9159 |
0.14 |
| chr7_28049758_28049927 | 0.69 |
Psmc4 |
proteasome (prosome, macropain) 26S subunit, ATPase, 4 |
206 |
0.9 |
| chr5_130144105_130144430 | 0.69 |
Kctd7 |
potassium channel tetramerisation domain containing 7 |
594 |
0.61 |
| chr5_38117047_38117323 | 0.67 |
Stx18 |
syntaxin 18 |
3724 |
0.2 |
| chr4_118234344_118235000 | 0.67 |
Ptprf |
protein tyrosine phosphatase, receptor type, F |
1344 |
0.4 |
| chr15_100311537_100311787 | 0.65 |
Mettl7a1 |
methyltransferase like 7A1 |
6491 |
0.11 |
| chr11_118723319_118723470 | 0.64 |
Rbfox3 |
RNA binding protein, fox-1 homolog (C. elegans) 3 |
37647 |
0.17 |
| chr7_136493976_136494136 | 0.64 |
Gm36849 |
predicted gene, 36849 |
140692 |
0.04 |
| chr19_44554722_44555277 | 0.64 |
Ndufb8 |
NADH:ubiquinone oxidoreductase subunit B8 |
13 |
0.96 |
| chr17_28330915_28331706 | 0.63 |
Rpl10a |
ribosomal protein L10A |
2032 |
0.16 |
| chr4_117095651_117095969 | 0.63 |
Ptch2 |
patched 2 |
265 |
0.8 |
| chr18_12864016_12864170 | 0.62 |
Osbpl1a |
oxysterol binding protein-like 1A |
653 |
0.63 |
| chr7_118544510_118544696 | 0.61 |
Coq7 |
demethyl-Q 7 |
11247 |
0.14 |
| chr8_23031563_23031855 | 0.61 |
Ank1 |
ankyrin 1, erythroid |
3390 |
0.23 |
| chr18_16664042_16664193 | 0.61 |
Cdh2 |
cadherin 2 |
5952 |
0.3 |
| chr6_84225136_84225617 | 0.61 |
Gm44127 |
predicted gene, 44127 |
124 |
0.97 |
| chr7_98352590_98353259 | 0.60 |
Tsku |
tsukushi, small leucine rich proteoglycan |
7155 |
0.18 |
| chr2_30619182_30619334 | 0.58 |
9330198N18Rik |
RIKEN cDNA 9330198N18 gene |
10397 |
0.16 |
| chr7_99163511_99163819 | 0.58 |
Dgat2 |
diacylglycerol O-acyltransferase 2 |
6441 |
0.13 |
| chr3_107230338_107230489 | 0.58 |
A630076J17Rik |
RIKEN cDNA A630076J17 gene |
201 |
0.91 |
| chr11_40754622_40755130 | 0.56 |
Ccng1 |
cyclin G1 |
435 |
0.82 |
| chr14_34330891_34331082 | 0.56 |
Glud1 |
glutamate dehydrogenase 1 |
1213 |
0.31 |
| chr14_30875741_30876231 | 0.55 |
Mustn1 |
musculoskeletal, embryonic nuclear protein 1 |
3214 |
0.15 |
| chr19_44401904_44402310 | 0.55 |
Scd1 |
stearoyl-Coenzyme A desaturase 1 |
4583 |
0.17 |
| chr6_34864028_34864660 | 0.54 |
Tmem140 |
transmembrane protein 140 |
1082 |
0.38 |
| chr19_8802873_8803024 | 0.54 |
Zbtb3 |
zinc finger and BTB domain containing 3 |
393 |
0.55 |
| chr10_52232542_52232728 | 0.53 |
Dcbld1 |
discoidin, CUB and LCCL domain containing 1 |
984 |
0.53 |
| chr2_31478552_31479205 | 0.53 |
Ass1 |
argininosuccinate synthetase 1 |
8671 |
0.19 |
| chr6_35538904_35539680 | 0.52 |
Mtpn |
myotrophin |
507 |
0.82 |
| chr14_21144535_21144690 | 0.52 |
Adk |
adenosine kinase |
68460 |
0.11 |
| chr13_101682978_101683129 | 0.52 |
Pik3r1 |
phosphoinositide-3-kinase regulatory subunit 1 |
9290 |
0.23 |
| chr6_85834355_85834506 | 0.51 |
Nat8 |
N-acetyltransferase 8 (GCN5-related) |
2348 |
0.14 |
| chr11_98296584_98296915 | 0.51 |
Gm20644 |
predicted gene 20644 |
11367 |
0.09 |
| chr10_87533882_87534185 | 0.50 |
Pah |
phenylalanine hydroxylase |
12006 |
0.2 |
| chr1_88122933_88123203 | 0.50 |
Gm15372 |
predicted gene 15372 |
3708 |
0.08 |
| chr3_129744894_129745074 | 0.49 |
Gm42650 |
predicted gene 42650 |
356 |
0.81 |
| chr4_35114274_35114571 | 0.49 |
Ifnk |
interferon kappa |
37634 |
0.14 |
| chr14_29976875_29977030 | 0.49 |
Actr8 |
ARP8 actin-related protein 8 |
1385 |
0.29 |
| chr2_174472267_174472486 | 0.49 |
Prelid3b |
PRELI domain containing 3B |
515 |
0.68 |
| chr5_125515518_125515904 | 0.48 |
Aacs |
acetoacetyl-CoA synthetase |
468 |
0.77 |
| chr1_86046370_86046901 | 0.48 |
2810459M11Rik |
RIKEN cDNA 2810459M11 gene |
772 |
0.5 |
| chr3_89090782_89091135 | 0.48 |
Rusc1 |
RUN and SH3 domain containing 1 |
913 |
0.34 |
| chr5_40691768_40691967 | 0.48 |
Gm23022 |
predicted gene, 23022 |
285938 |
0.01 |
| chr16_17928117_17928461 | 0.47 |
Slc25a1 |
solute carrier family 25 (mitochondrial carrier, citrate transporter), member 1 |
70 |
0.94 |
| chr2_122630787_122631163 | 0.47 |
Spata5l1 |
spermatogenesis associated 5-like 1 |
329 |
0.84 |
| chr1_90405458_90405630 | 0.47 |
Gm28722 |
predicted gene 28722 |
48957 |
0.14 |
| chr8_70469859_70470010 | 0.47 |
Klhl26 |
kelch-like 26 |
5964 |
0.09 |
| chr19_36749089_36749269 | 0.47 |
Ppp1r3c |
protein phosphatase 1, regulatory subunit 3C |
12526 |
0.21 |
| chr1_62729870_62730021 | 0.47 |
Gm29083 |
predicted gene 29083 |
11872 |
0.18 |
| chr3_97642536_97642687 | 0.46 |
Fmo5 |
flavin containing monooxygenase 5 |
13728 |
0.12 |
| chr5_76923246_76923397 | 0.46 |
2310040G07Rik |
RIKEN cDNA 2310040G07 gene |
5051 |
0.15 |
| chr2_52579266_52579417 | 0.46 |
Cacnb4 |
calcium channel, voltage-dependent, beta 4 subunit |
20774 |
0.18 |
| chr2_59228021_59228195 | 0.45 |
Pkp4 |
plakophilin 4 |
1641 |
0.46 |
| chr12_102579152_102579318 | 0.45 |
Gm37019 |
predicted gene, 37019 |
12175 |
0.13 |
| chr17_46110701_46110892 | 0.44 |
Mrps18a |
mitochondrial ribosomal protein S18A |
190 |
0.91 |
| chr8_93079410_93079731 | 0.44 |
Ces1b |
carboxylesterase 1B |
447 |
0.79 |
| chr9_35108621_35109370 | 0.44 |
St3gal4 |
ST3 beta-galactoside alpha-2,3-sialyltransferase 4 |
2328 |
0.23 |
| chr18_60600460_60600611 | 0.44 |
Synpo |
synaptopodin |
38 |
0.97 |
| chr18_11052816_11053420 | 0.44 |
Gata6 |
GATA binding protein 6 |
74 |
0.9 |
| chr7_19173099_19173251 | 0.43 |
Eml2 |
echinoderm microtubule associated protein like 2 |
3246 |
0.1 |
| chr1_84182966_84183117 | 0.43 |
Gm18304 |
predicted gene, 18304 |
14853 |
0.2 |
| chr8_123716311_123716543 | 0.43 |
6030466F02Rik |
RIKEN cDNA 6030466F02 gene |
17531 |
0.06 |
| chr11_120795937_120796269 | 0.43 |
Dus1l |
dihydrouridine synthase 1-like (S. cerevisiae) |
274 |
0.8 |
| chr1_67195986_67196354 | 0.43 |
Gm15668 |
predicted gene 15668 |
53030 |
0.13 |
| chr7_101344939_101345805 | 0.43 |
Gm45620 |
predicted gene 45620 |
2612 |
0.13 |
| chr7_98357352_98357551 | 0.43 |
Tsku |
tsukushi, small leucine rich proteoglycan |
2628 |
0.25 |
| chr17_86393578_86393897 | 0.43 |
Prkce |
protein kinase C, epsilon |
96825 |
0.07 |
| chr9_21615837_21616134 | 0.43 |
Smarca4 |
SWI/SNF related, matrix associated, actin dependent regulator of chromatin, subfamily a, member 4 |
184 |
0.89 |
| chr17_31324627_31325122 | 0.43 |
Slc37a1 |
solute carrier family 37 (glycerol-3-phosphate transporter), member 1 |
753 |
0.58 |
| chr2_147999397_147999548 | 0.42 |
9030622O22Rik |
RIKEN cDNA 9030622O22 gene |
23287 |
0.18 |
| chr6_119367165_119367575 | 0.42 |
Adipor2 |
adiponectin receptor 2 |
21316 |
0.17 |
| chr2_180589607_180589819 | 0.42 |
Ogfr |
opioid growth factor receptor |
251 |
0.89 |
| chr5_115585499_115585669 | 0.42 |
Gcn1 |
GCN1 activator of EIF2AK4 |
3187 |
0.13 |
| chr15_3494683_3494866 | 0.42 |
Ghr |
growth hormone receptor |
23130 |
0.25 |
| chr14_59203808_59204018 | 0.42 |
Rcbtb1 |
regulator of chromosome condensation (RCC1) and BTB (POZ) domain containing protein 1 |
1700 |
0.35 |
| chr13_24945631_24945983 | 0.41 |
Gpld1 |
glycosylphosphatidylinositol specific phospholipase D1 |
2655 |
0.19 |
| chr16_33942539_33942690 | 0.41 |
Itgb5 |
integrin beta 5 |
3910 |
0.2 |
| chr15_82046336_82046770 | 0.41 |
Snu13 |
SNU13 homolog, small nuclear ribonucleoprotein (U4/U6.U5) |
966 |
0.31 |
| chr10_76468263_76468414 | 0.41 |
Ybey |
ybeY metallopeptidase |
525 |
0.44 |
| chr2_27692193_27692459 | 0.41 |
Rxra |
retinoid X receptor alpha |
15064 |
0.24 |
| chr2_132871445_132871613 | 0.41 |
Lrrn4 |
leucine rich repeat neuronal 4 |
9362 |
0.14 |
| chr11_16757660_16757833 | 0.40 |
Egfr |
epidermal growth factor receptor |
5516 |
0.22 |
| chr3_34076650_34076843 | 0.40 |
Dnajc19 |
DnaJ heat shock protein family (Hsp40) member C19 |
3434 |
0.16 |
| chr13_9073792_9074124 | 0.40 |
Gm36264 |
predicted gene, 36264 |
2493 |
0.23 |
| chr2_58784716_58784992 | 0.40 |
Upp2 |
uridine phosphorylase 2 |
19529 |
0.19 |
| chr13_55513106_55513294 | 0.39 |
Pdlim7 |
PDZ and LIM domain 7 |
221 |
0.84 |
| chr5_138774659_138774827 | 0.39 |
Fam20c |
family with sequence similarity 20, member C |
11757 |
0.18 |
| chr3_138285092_138285352 | 0.39 |
Adh1 |
alcohol dehydrogenase 1 (class I) |
7571 |
0.12 |
| chr11_22843395_22843546 | 0.39 |
Gm23772 |
predicted gene, 23772 |
3398 |
0.15 |
| chr19_10197208_10197393 | 0.39 |
Gm10143 |
predicted gene 10143 |
1068 |
0.32 |
| chr7_112855775_112855939 | 0.39 |
Tead1 |
TEA domain family member 1 |
16223 |
0.23 |
| chr5_124248915_124249162 | 0.39 |
Pitpnm2 |
phosphatidylinositol transfer protein, membrane-associated 2 |
413 |
0.73 |
| chr13_64031193_64031358 | 0.39 |
Hsd17b3 |
hydroxysteroid (17-beta) dehydrogenase 3 |
31858 |
0.15 |
| chr9_74864843_74864994 | 0.39 |
Onecut1 |
one cut domain, family member 1 |
1566 |
0.32 |
| chr9_103092508_103092668 | 0.38 |
Gm47468 |
predicted gene, 47468 |
7051 |
0.16 |
| chr8_125734093_125734341 | 0.38 |
Ntpcr |
nucleoside-triphosphatase, cancer-related |
14 |
0.98 |
| chr10_75794436_75794892 | 0.38 |
Gstt1 |
glutathione S-transferase, theta 1 |
2905 |
0.13 |
| chr2_93881395_93881546 | 0.38 |
Accsl |
1-aminocyclopropane-1-carboxylate synthase (non-functional)-like |
12313 |
0.16 |
| chr15_102399365_102399588 | 0.38 |
Sp1 |
trans-acting transcription factor 1 |
6667 |
0.1 |
| chr10_97249598_97249782 | 0.38 |
Gm18515 |
predicted gene, 18515 |
7778 |
0.26 |
| chr5_125477856_125478067 | 0.38 |
Gm27551 |
predicted gene, 27551 |
1416 |
0.28 |
| chr2_72206740_72207276 | 0.37 |
Rapgef4 |
Rap guanine nucleotide exchange factor (GEF) 4 |
8209 |
0.18 |
| chr5_114154896_114155238 | 0.37 |
Acacb |
acetyl-Coenzyme A carboxylase beta |
8532 |
0.12 |
| chr5_66042796_66042956 | 0.37 |
Rbm47 |
RNA binding motif protein 47 |
11676 |
0.12 |
| chr5_125080775_125080943 | 0.37 |
Gm42839 |
predicted gene 42839 |
5982 |
0.19 |
| chr8_35087443_35087746 | 0.37 |
Gm34419 |
predicted gene, 34419 |
6951 |
0.18 |
| chr1_130734318_130734676 | 0.37 |
AA986860 |
expressed sequence AA986860 |
2387 |
0.14 |
| chr11_61268823_61268998 | 0.37 |
Aldh3a2 |
aldehyde dehydrogenase family 3, subfamily A2 |
1446 |
0.37 |
| chr6_108709699_108709863 | 0.36 |
Bhlhe40 |
basic helix-loop-helix family, member e40 |
46735 |
0.12 |
| chr2_34774428_34774579 | 0.36 |
Hspa5 |
heat shock protein 5 |
344 |
0.83 |
| chr2_31510334_31510882 | 0.36 |
Ass1 |
argininosuccinate synthetase 1 |
7882 |
0.18 |
| chr2_156547049_156547233 | 0.36 |
Aar2 |
AAR2 splicing factor homolog |
443 |
0.75 |
| chr2_148037591_148038164 | 0.36 |
9030622O22Rik |
RIKEN cDNA 9030622O22 gene |
393 |
0.84 |
| chr16_4558253_4558537 | 0.36 |
Tfap4 |
transcription factor AP4 |
388 |
0.8 |
| chr3_52258108_52258303 | 0.36 |
Foxo1 |
forkhead box O1 |
10131 |
0.12 |
| chr7_142533086_142533550 | 0.36 |
Mrpl23 |
mitochondrial ribosomal protein L23 |
156 |
0.91 |
| chr17_31155739_31155923 | 0.35 |
Gm15318 |
predicted gene 15318 |
3035 |
0.15 |
| chr2_27736430_27736581 | 0.35 |
Rxra |
retinoid X receptor alpha |
3696 |
0.32 |
| chr4_149398701_149398906 | 0.35 |
Ube4b |
ubiquitination factor E4B |
575 |
0.68 |
| chr8_75034403_75034574 | 0.35 |
Gm45822 |
predicted gene 45822 |
547 |
0.5 |
| chr4_128636057_128636208 | 0.35 |
Gm12958 |
predicted gene 12958 |
1339 |
0.38 |
| chr2_58763199_58763384 | 0.34 |
Upp2 |
uridine phosphorylase 2 |
2034 |
0.34 |
| chr4_40844408_40844761 | 0.34 |
Mir5123 |
microRNA 5123 |
5554 |
0.12 |
| chr6_17463758_17464495 | 0.34 |
Met |
met proto-oncogene |
19 |
0.98 |
| chr9_100570437_100570629 | 0.34 |
Slc35g2 |
solute carrier family 35, member G2 |
557 |
0.69 |
| chr7_139299549_139299748 | 0.34 |
Gm32486 |
predicted gene, 32486 |
2783 |
0.26 |
| chr6_71544237_71544409 | 0.34 |
Chmp3 |
charged multivesicular body protein 3 |
30 |
0.72 |
| chr11_50324830_50325400 | 0.33 |
Canx |
calnexin |
558 |
0.65 |
| chr3_14579749_14579900 | 0.33 |
E2f5 |
E2F transcription factor 5 |
1153 |
0.4 |
| chr18_15407380_15407563 | 0.33 |
Aqp4 |
aquaporin 4 |
617 |
0.74 |
| chr14_30549897_30550510 | 0.33 |
Tkt |
transketolase |
846 |
0.54 |
| chr5_99251194_99251660 | 0.33 |
Rasgef1b |
RasGEF domain family, member 1B |
1500 |
0.46 |
| chr12_104343910_104344587 | 0.33 |
Serpina3k |
serine (or cysteine) peptidase inhibitor, clade A, member 3K |
5762 |
0.12 |
| chr2_19701468_19701642 | 0.33 |
Gm24670 |
predicted gene, 24670 |
10267 |
0.15 |
| chr17_28761439_28761590 | 0.33 |
Mapk13 |
mitogen-activated protein kinase 13 |
7783 |
0.12 |
| chr16_5146310_5146979 | 0.33 |
Sec14l5 |
SEC14-like lipid binding 5 |
465 |
0.73 |
| chr19_46609384_46609535 | 0.33 |
Wbp1l |
WW domain binding protein 1 like |
10335 |
0.13 |
| chr17_25866831_25867238 | 0.33 |
Mcrip2 |
MAPK regulated corepressor interacting protein 2 |
802 |
0.3 |
| chr13_4270711_4270899 | 0.33 |
Akr1c12 |
aldo-keto reductase family 1, member C12 |
8628 |
0.15 |
| chr6_94193888_94194039 | 0.32 |
Magi1 |
membrane associated guanylate kinase, WW and PDZ domain containing 1 |
89062 |
0.09 |
| chr8_122324060_122324293 | 0.32 |
Zfpm1 |
zinc finger protein, multitype 1 |
9522 |
0.13 |
| chr14_20733586_20734177 | 0.32 |
Ndst2 |
N-deacetylase/N-sulfotransferase (heparan glucosaminyl) 2 |
681 |
0.49 |
| chr6_117176551_117176720 | 0.32 |
Cxcl12 |
chemokine (C-X-C motif) ligand 12 |
8058 |
0.18 |
| chr2_170130193_170130373 | 0.32 |
Zfp217 |
zinc finger protein 217 |
937 |
0.7 |
| chr6_129471059_129471380 | 0.32 |
Clec7a |
C-type lectin domain family 7, member a |
1553 |
0.23 |
| chr9_57708659_57709025 | 0.32 |
Edc3 |
enhancer of mRNA decapping 3 |
275 |
0.87 |
| chr13_51103579_51103759 | 0.32 |
Spin1 |
spindlin 1 |
2789 |
0.32 |
| chr5_124234244_124234932 | 0.32 |
Gm42425 |
predicted gene 42425 |
3136 |
0.14 |
| chr19_40221288_40221466 | 0.32 |
Pdlim1 |
PDZ and LIM domain 1 (elfin) |
1979 |
0.26 |
| chr15_78450464_78450615 | 0.31 |
Tmprss6 |
transmembrane serine protease 6 |
6160 |
0.11 |
| chr9_119142425_119142722 | 0.31 |
Acaa1b |
acetyl-Coenzyme A acyltransferase 1B |
7490 |
0.12 |
| chr2_27594912_27595184 | 0.31 |
Gm13421 |
predicted gene 13421 |
54619 |
0.1 |
| chr8_22692509_22692697 | 0.31 |
Ikbkb |
inhibitor of kappaB kinase beta |
1462 |
0.34 |
| chr19_44421958_44422284 | 0.31 |
Gm50337 |
predicted gene, 50337 |
2511 |
0.21 |
| chr6_97210873_97211545 | 0.31 |
Arl6ip5 |
ADP-ribosylation factor-like 6 interacting protein 5 |
520 |
0.72 |
| chr16_20097870_20098456 | 0.31 |
Klhl24 |
kelch-like 24 |
571 |
0.77 |
| chr13_41216009_41216224 | 0.31 |
Elovl2 |
elongation of very long chain fatty acids (FEN1/Elo2, SUR4/Elo3, yeast)-like 2 |
4046 |
0.15 |
| chr2_31489958_31490302 | 0.31 |
Ass1 |
argininosuccinate synthetase 1 |
7642 |
0.19 |
| chr2_72975847_72976140 | 0.31 |
Sp3 |
trans-acting transcription factor 3 |
3293 |
0.17 |
| chr2_15064726_15064962 | 0.30 |
Arl5b |
ADP-ribosylation factor-like 5B |
3295 |
0.18 |
| chr7_28952715_28952896 | 0.30 |
Actn4 |
actinin alpha 4 |
3046 |
0.14 |
| chr13_64109009_64109160 | 0.30 |
Slc35d2 |
solute carrier family 35, member D2 |
1921 |
0.26 |
| chr17_35896855_35897209 | 0.30 |
2310061I04Rik |
RIKEN cDNA 2310061I04 gene |
41 |
0.52 |
| chr16_52417351_52417533 | 0.30 |
Alcam |
activated leukocyte cell adhesion molecule |
35023 |
0.23 |
| chr2_109919434_109919722 | 0.30 |
Lgr4 |
leucine-rich repeat-containing G protein-coupled receptor 4 |
1931 |
0.32 |
| chr18_21227026_21227230 | 0.30 |
Garem1 |
GRB2 associated regulator of MAPK1 subtype 1 |
72995 |
0.09 |
| chr15_59040039_59040248 | 0.30 |
Mtss1 |
MTSS I-BAR domain containing 1 |
453 |
0.85 |
| chr5_122994281_122994479 | 0.30 |
Kdm2b |
lysine (K)-specific demethylase 2B |
4557 |
0.11 |
| chr19_10051475_10051678 | 0.30 |
Fads3 |
fatty acid desaturase 3 |
1375 |
0.32 |
| chr14_93030616_93030963 | 0.30 |
Gm23509 |
predicted gene, 23509 |
107400 |
0.07 |
| chr13_22040538_22040689 | 0.30 |
H4c9 |
H4 clustered histone 9 |
749 |
0.26 |
| chr13_3634179_3634726 | 0.30 |
Asb13 |
ankyrin repeat and SOCS box-containing 13 |
353 |
0.85 |
| chr1_67165449_67165678 | 0.30 |
Cps1 |
carbamoyl-phosphate synthetase 1 |
42537 |
0.16 |
| chr8_41069551_41069759 | 0.30 |
Mtus1 |
mitochondrial tumor suppressor 1 |
13121 |
0.16 |
| chr7_75587860_75588021 | 0.29 |
Akap13 |
A kinase (PRKA) anchor protein 13 |
22099 |
0.17 |
| chr11_11973757_11973935 | 0.29 |
Grb10 |
growth factor receptor bound protein 10 |
3204 |
0.29 |
| chr2_109693213_109693439 | 0.29 |
Bdnf |
brain derived neurotrophic factor |
237 |
0.93 |
| chr15_102295917_102296079 | 0.29 |
Gm49479 |
predicted gene, 49479 |
153 |
0.62 |
| chr8_64849910_64850714 | 0.29 |
Klhl2 |
kelch-like 2, Mayven |
295 |
0.88 |
| chr6_90472834_90473020 | 0.29 |
Gm44421 |
predicted gene, 44421 |
5539 |
0.11 |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.3 | 0.8 | GO:0003062 | regulation of heart rate by chemical signal(GO:0003062) |
| 0.2 | 0.7 | GO:0010046 | response to mycotoxin(GO:0010046) |
| 0.2 | 0.8 | GO:0060528 | secretory columnal luminar epithelial cell differentiation involved in prostate glandular acinus development(GO:0060528) |
| 0.2 | 0.5 | GO:0007403 | glial cell fate determination(GO:0007403) |
| 0.2 | 0.7 | GO:2001013 | epithelial cell proliferation involved in renal tubule morphogenesis(GO:2001013) |
| 0.1 | 0.4 | GO:0009730 | detection of carbohydrate stimulus(GO:0009730) detection of hexose stimulus(GO:0009732) detection of monosaccharide stimulus(GO:0034287) detection of glucose(GO:0051594) |
| 0.1 | 0.9 | GO:0032532 | regulation of microvillus length(GO:0032532) |
| 0.1 | 0.3 | GO:1903750 | regulation of intrinsic apoptotic signaling pathway in response to hydrogen peroxide(GO:1903750) negative regulation of intrinsic apoptotic signaling pathway in response to hydrogen peroxide(GO:1903751) |
| 0.1 | 1.4 | GO:0006120 | mitochondrial electron transport, NADH to ubiquinone(GO:0006120) |
| 0.1 | 0.3 | GO:0097118 | neuroligin clustering involved in postsynaptic membrane assembly(GO:0097118) |
| 0.1 | 0.3 | GO:0032911 | negative regulation of transforming growth factor beta1 production(GO:0032911) |
| 0.1 | 0.4 | GO:0009957 | epidermal cell fate specification(GO:0009957) |
| 0.1 | 0.3 | GO:0031086 | nuclear-transcribed mRNA catabolic process, deadenylation-independent decay(GO:0031086) deadenylation-independent decapping of nuclear-transcribed mRNA(GO:0031087) |
| 0.1 | 0.3 | GO:0046016 | positive regulation of transcription by glucose(GO:0046016) |
| 0.1 | 0.2 | GO:0030421 | defecation(GO:0030421) |
| 0.1 | 0.3 | GO:0034140 | negative regulation of toll-like receptor 3 signaling pathway(GO:0034140) |
| 0.1 | 0.2 | GO:0003340 | negative regulation of mesenchymal to epithelial transition involved in metanephros morphogenesis(GO:0003340) |
| 0.1 | 0.4 | GO:1902459 | positive regulation of stem cell population maintenance(GO:1902459) |
| 0.1 | 0.3 | GO:0071635 | negative regulation of transforming growth factor beta production(GO:0071635) |
| 0.1 | 0.3 | GO:1903347 | negative regulation of bicellular tight junction assembly(GO:1903347) |
| 0.1 | 0.2 | GO:1901301 | regulation of cargo loading into COPII-coated vesicle(GO:1901301) |
| 0.1 | 0.2 | GO:2000437 | monocyte extravasation(GO:0035696) regulation of monocyte extravasation(GO:2000437) |
| 0.1 | 0.2 | GO:0002036 | regulation of L-glutamate transport(GO:0002036) |
| 0.1 | 0.2 | GO:0060847 | endothelial cell fate specification(GO:0060847) |
| 0.1 | 0.2 | GO:0007039 | protein catabolic process in the vacuole(GO:0007039) |
| 0.1 | 0.3 | GO:0006987 | activation of signaling protein activity involved in unfolded protein response(GO:0006987) |
| 0.1 | 0.3 | GO:0034755 | iron ion transmembrane transport(GO:0034755) |
| 0.1 | 0.2 | GO:0035609 | C-terminal protein deglutamylation(GO:0035609) |
| 0.1 | 0.1 | GO:0090158 | endoplasmic reticulum membrane organization(GO:0090158) |
| 0.1 | 0.2 | GO:0035461 | vitamin transmembrane transport(GO:0035461) |
| 0.1 | 0.3 | GO:1903966 | monounsaturated fatty acid metabolic process(GO:1903964) monounsaturated fatty acid biosynthetic process(GO:1903966) |
| 0.1 | 0.2 | GO:0006714 | sesquiterpenoid metabolic process(GO:0006714) |
| 0.1 | 0.7 | GO:0000042 | protein targeting to Golgi(GO:0000042) |
| 0.1 | 0.4 | GO:1902222 | L-phenylalanine catabolic process(GO:0006559) erythrose 4-phosphate/phosphoenolpyruvate family amino acid catabolic process(GO:1902222) |
| 0.1 | 0.2 | GO:0044339 | canonical Wnt signaling pathway involved in osteoblast differentiation(GO:0044339) |
| 0.1 | 0.2 | GO:0021823 | cerebral cortex tangential migration using cell-cell interactions(GO:0021823) postnatal olfactory bulb interneuron migration(GO:0021827) |
| 0.1 | 0.2 | GO:0032474 | otolith morphogenesis(GO:0032474) |
| 0.1 | 0.2 | GO:1903999 | negative regulation of eating behavior(GO:1903999) |
| 0.1 | 0.1 | GO:2000286 | receptor internalization involved in canonical Wnt signaling pathway(GO:2000286) |
| 0.1 | 0.3 | GO:0034310 | primary alcohol catabolic process(GO:0034310) |
| 0.1 | 0.4 | GO:1903799 | negative regulation of production of miRNAs involved in gene silencing by miRNA(GO:1903799) |
| 0.1 | 0.2 | GO:0014835 | myoblast differentiation involved in skeletal muscle regeneration(GO:0014835) |
| 0.1 | 0.1 | GO:0061419 | positive regulation of transcription from RNA polymerase II promoter in response to hypoxia(GO:0061419) |
| 0.1 | 0.2 | GO:0006549 | isoleucine metabolic process(GO:0006549) |
| 0.1 | 0.2 | GO:0070295 | renal water absorption(GO:0070295) |
| 0.1 | 0.2 | GO:0016561 | protein import into peroxisome matrix, translocation(GO:0016561) |
| 0.1 | 0.2 | GO:0070213 | protein auto-ADP-ribosylation(GO:0070213) |
| 0.1 | 0.1 | GO:0006543 | glutamine catabolic process(GO:0006543) |
| 0.1 | 0.5 | GO:1902306 | negative regulation of sodium ion transmembrane transport(GO:1902306) |
| 0.1 | 0.3 | GO:0051387 | negative regulation of neurotrophin TRK receptor signaling pathway(GO:0051387) |
| 0.1 | 0.1 | GO:0001922 | B-1 B cell homeostasis(GO:0001922) |
| 0.1 | 0.2 | GO:0060584 | regulation of prostaglandin-endoperoxide synthase activity(GO:0060584) positive regulation of prostaglandin-endoperoxide synthase activity(GO:0060585) |
| 0.1 | 0.3 | GO:0006537 | glutamate biosynthetic process(GO:0006537) |
| 0.1 | 0.2 | GO:0008626 | granzyme-mediated apoptotic signaling pathway(GO:0008626) |
| 0.1 | 0.3 | GO:2001269 | positive regulation of cysteine-type endopeptidase activity involved in apoptotic signaling pathway(GO:2001269) |
| 0.1 | 0.6 | GO:0045899 | positive regulation of RNA polymerase II transcriptional preinitiation complex assembly(GO:0045899) |
| 0.1 | 0.1 | GO:1903377 | negative regulation of oxidative stress-induced neuron intrinsic apoptotic signaling pathway(GO:1903377) |
| 0.0 | 0.3 | GO:0015871 | choline transport(GO:0015871) |
| 0.0 | 0.0 | GO:0016095 | polyprenol catabolic process(GO:0016095) |
| 0.0 | 0.1 | GO:0072361 | regulation of glycolytic process by regulation of transcription from RNA polymerase II promoter(GO:0072361) |
| 0.0 | 0.2 | GO:0010649 | regulation of cell communication by electrical coupling(GO:0010649) |
| 0.0 | 0.2 | GO:0006526 | arginine biosynthetic process(GO:0006526) |
| 0.0 | 0.1 | GO:0055099 | response to high density lipoprotein particle(GO:0055099) |
| 0.0 | 0.2 | GO:1903689 | regulation of wound healing, spreading of epidermal cells(GO:1903689) |
| 0.0 | 0.1 | GO:0061086 | negative regulation of histone H3-K27 methylation(GO:0061086) |
| 0.0 | 0.1 | GO:0061368 | behavioral response to chemical pain(GO:0061366) behavioral response to formalin induced pain(GO:0061368) |
| 0.0 | 0.3 | GO:0021540 | corpus callosum morphogenesis(GO:0021540) |
| 0.0 | 0.2 | GO:0070934 | CRD-mediated mRNA stabilization(GO:0070934) |
| 0.0 | 0.2 | GO:0009256 | 10-formyltetrahydrofolate metabolic process(GO:0009256) |
| 0.0 | 0.1 | GO:0042524 | negative regulation of tyrosine phosphorylation of Stat5 protein(GO:0042524) |
| 0.0 | 0.2 | GO:0006681 | galactosylceramide metabolic process(GO:0006681) |
| 0.0 | 0.1 | GO:0046292 | formaldehyde metabolic process(GO:0046292) |
| 0.0 | 0.6 | GO:0014733 | regulation of skeletal muscle adaptation(GO:0014733) |
| 0.0 | 0.2 | GO:1904667 | negative regulation of ubiquitin protein ligase activity(GO:1904667) |
| 0.0 | 0.1 | GO:0061624 | fructose catabolic process(GO:0006001) fructose catabolic process to hydroxyacetone phosphate and glyceraldehyde-3-phosphate(GO:0061624) glycolytic process through fructose-1-phosphate(GO:0061625) |
| 0.0 | 0.1 | GO:0097680 | double-strand break repair via classical nonhomologous end joining(GO:0097680) |
| 0.0 | 0.2 | GO:0000395 | mRNA 5'-splice site recognition(GO:0000395) |
| 0.0 | 0.2 | GO:0006742 | NADP catabolic process(GO:0006742) |
| 0.0 | 0.2 | GO:0036135 | Schwann cell migration(GO:0036135) regulation of Schwann cell migration(GO:1900147) |
| 0.0 | 0.1 | GO:0002572 | pro-T cell differentiation(GO:0002572) |
| 0.0 | 0.1 | GO:0006208 | pyrimidine nucleobase catabolic process(GO:0006208) thymine catabolic process(GO:0006210) thymine metabolic process(GO:0019859) |
| 0.0 | 0.2 | GO:0051036 | regulation of endosome size(GO:0051036) |
| 0.0 | 0.2 | GO:1900103 | positive regulation of endoplasmic reticulum unfolded protein response(GO:1900103) |
| 0.0 | 0.2 | GO:0045542 | positive regulation of cholesterol biosynthetic process(GO:0045542) positive regulation of cholesterol metabolic process(GO:0090205) |
| 0.0 | 0.4 | GO:0052697 | xenobiotic glucuronidation(GO:0052697) |
| 0.0 | 0.1 | GO:1903334 | positive regulation of protein folding(GO:1903334) |
| 0.0 | 0.1 | GO:0035964 | COPI-coated vesicle budding(GO:0035964) |
| 0.0 | 0.2 | GO:0019530 | taurine metabolic process(GO:0019530) |
| 0.0 | 0.1 | GO:0035928 | rRNA import into mitochondrion(GO:0035928) |
| 0.0 | 0.2 | GO:0070314 | G1 to G0 transition(GO:0070314) |
| 0.0 | 0.2 | GO:0090166 | Golgi disassembly(GO:0090166) |
| 0.0 | 0.1 | GO:1903677 | regulation of cap-independent translational initiation(GO:1903677) positive regulation of cap-independent translational initiation(GO:1903679) regulation of cytoplasmic translational initiation(GO:1904688) positive regulation of cytoplasmic translational initiation(GO:1904690) |
| 0.0 | 0.1 | GO:1990035 | calcium ion import into cell(GO:1990035) |
| 0.0 | 0.1 | GO:0015819 | lysine transport(GO:0015819) |
| 0.0 | 0.1 | GO:0071895 | odontoblast differentiation(GO:0071895) |
| 0.0 | 0.1 | GO:0090071 | negative regulation of ribosome biogenesis(GO:0090071) |
| 0.0 | 0.3 | GO:0000244 | spliceosomal tri-snRNP complex assembly(GO:0000244) |
| 0.0 | 0.1 | GO:0032741 | positive regulation of interleukin-18 production(GO:0032741) |
| 0.0 | 0.5 | GO:0051016 | barbed-end actin filament capping(GO:0051016) |
| 0.0 | 0.1 | GO:0070947 | neutrophil mediated killing of fungus(GO:0070947) |
| 0.0 | 0.1 | GO:0006369 | termination of RNA polymerase II transcription(GO:0006369) |
| 0.0 | 0.4 | GO:0019471 | 4-hydroxyproline metabolic process(GO:0019471) |
| 0.0 | 0.1 | GO:0072488 | ammonium transmembrane transport(GO:0072488) |
| 0.0 | 0.2 | GO:0006777 | Mo-molybdopterin cofactor biosynthetic process(GO:0006777) Mo-molybdopterin cofactor metabolic process(GO:0019720) molybdopterin cofactor biosynthetic process(GO:0032324) molybdopterin cofactor metabolic process(GO:0043545) prosthetic group metabolic process(GO:0051189) |
| 0.0 | 0.1 | GO:0070973 | protein localization to endoplasmic reticulum exit site(GO:0070973) |
| 0.0 | 0.2 | GO:0060623 | regulation of chromosome condensation(GO:0060623) |
| 0.0 | 0.2 | GO:0007182 | common-partner SMAD protein phosphorylation(GO:0007182) |
| 0.0 | 0.1 | GO:0002949 | tRNA threonylcarbamoyladenosine modification(GO:0002949) |
| 0.0 | 0.1 | GO:1903715 | regulation of aerobic respiration(GO:1903715) |
| 0.0 | 0.2 | GO:0009052 | pentose-phosphate shunt, non-oxidative branch(GO:0009052) |
| 0.0 | 0.1 | GO:0030263 | apoptotic chromosome condensation(GO:0030263) |
| 0.0 | 0.1 | GO:0042518 | negative regulation of tyrosine phosphorylation of Stat3 protein(GO:0042518) |
| 0.0 | 0.1 | GO:0043985 | histone H4-R3 methylation(GO:0043985) |
| 0.0 | 0.1 | GO:0010735 | positive regulation of transcription via serum response element binding(GO:0010735) |
| 0.0 | 0.1 | GO:0036265 | RNA (guanine-N7)-methylation(GO:0036265) |
| 0.0 | 0.1 | GO:1990791 | dorsal root ganglion development(GO:1990791) |
| 0.0 | 0.0 | GO:1901078 | negative regulation of relaxation of muscle(GO:1901078) |
| 0.0 | 0.1 | GO:0035425 | autocrine signaling(GO:0035425) |
| 0.0 | 0.0 | GO:0032079 | positive regulation of endodeoxyribonuclease activity(GO:0032079) |
| 0.0 | 0.2 | GO:1901970 | positive regulation of mitotic sister chromatid separation(GO:1901970) |
| 0.0 | 0.2 | GO:0098789 | pre-mRNA cleavage required for polyadenylation(GO:0098789) |
| 0.0 | 0.1 | GO:0033353 | S-adenosylmethionine cycle(GO:0033353) |
| 0.0 | 0.1 | GO:0050747 | positive regulation of lipoprotein metabolic process(GO:0050747) |
| 0.0 | 0.1 | GO:0010986 | positive regulation of lipoprotein particle clearance(GO:0010986) |
| 0.0 | 0.2 | GO:0002553 | histamine production involved in inflammatory response(GO:0002349) histamine secretion involved in inflammatory response(GO:0002441) histamine secretion by mast cell(GO:0002553) |
| 0.0 | 0.1 | GO:0002337 | B-1a B cell differentiation(GO:0002337) |
| 0.0 | 0.1 | GO:0061010 | gall bladder development(GO:0061010) |
| 0.0 | 0.1 | GO:1903800 | positive regulation of production of miRNAs involved in gene silencing by miRNA(GO:1903800) |
| 0.0 | 0.5 | GO:0030488 | tRNA methylation(GO:0030488) |
| 0.0 | 0.1 | GO:0007621 | negative regulation of female receptivity(GO:0007621) |
| 0.0 | 0.1 | GO:0070375 | ERK5 cascade(GO:0070375) |
| 0.0 | 0.1 | GO:0003096 | renal sodium ion transport(GO:0003096) renal sodium ion absorption(GO:0070294) |
| 0.0 | 0.2 | GO:0070914 | UV-damage excision repair(GO:0070914) |
| 0.0 | 0.1 | GO:0000715 | nucleotide-excision repair, DNA damage recognition(GO:0000715) |
| 0.0 | 0.0 | GO:0035880 | embryonic nail plate morphogenesis(GO:0035880) |
| 0.0 | 0.1 | GO:1900245 | positive regulation of MDA-5 signaling pathway(GO:1900245) |
| 0.0 | 0.1 | GO:0015959 | diadenosine polyphosphate metabolic process(GO:0015959) |
| 0.0 | 0.1 | GO:0021943 | formation of radial glial scaffolds(GO:0021943) |
| 0.0 | 0.2 | GO:0070131 | positive regulation of mitochondrial translation(GO:0070131) |
| 0.0 | 0.1 | GO:0097461 | ferric iron import(GO:0033216) ferric iron import into cell(GO:0097461) |
| 0.0 | 0.2 | GO:0034139 | regulation of toll-like receptor 3 signaling pathway(GO:0034139) |
| 0.0 | 0.1 | GO:1900169 | regulation of glucocorticoid mediated signaling pathway(GO:1900169) |
| 0.0 | 0.2 | GO:0036010 | protein localization to endosome(GO:0036010) |
| 0.0 | 0.1 | GO:1901897 | regulation of relaxation of cardiac muscle(GO:1901897) |
| 0.0 | 0.2 | GO:0002002 | regulation of angiotensin levels in blood(GO:0002002) |
| 0.0 | 0.1 | GO:0006166 | purine ribonucleoside salvage(GO:0006166) |
| 0.0 | 0.1 | GO:0034627 | 'de novo' NAD biosynthetic process(GO:0034627) |
| 0.0 | 0.0 | GO:0010248 | establishment or maintenance of transmembrane electrochemical gradient(GO:0010248) |
| 0.0 | 0.1 | GO:0003358 | noradrenergic neuron development(GO:0003358) |
| 0.0 | 0.4 | GO:0007095 | mitotic G2 DNA damage checkpoint(GO:0007095) |
| 0.0 | 0.1 | GO:0031293 | membrane protein intracellular domain proteolysis(GO:0031293) |
| 0.0 | 0.2 | GO:0051409 | response to nitrosative stress(GO:0051409) |
| 0.0 | 0.1 | GO:0042732 | D-xylose metabolic process(GO:0042732) |
| 0.0 | 0.3 | GO:0033683 | nucleotide-excision repair, DNA incision(GO:0033683) |
| 0.0 | 0.2 | GO:0045647 | negative regulation of erythrocyte differentiation(GO:0045647) |
| 0.0 | 0.1 | GO:0060696 | regulation of phospholipid catabolic process(GO:0060696) |
| 0.0 | 0.1 | GO:2000587 | regulation of platelet-derived growth factor receptor-beta signaling pathway(GO:2000586) negative regulation of platelet-derived growth factor receptor-beta signaling pathway(GO:2000587) |
| 0.0 | 0.1 | GO:0061643 | chemorepulsion of axon(GO:0061643) |
| 0.0 | 0.1 | GO:0060375 | regulation of mast cell differentiation(GO:0060375) |
| 0.0 | 0.1 | GO:0071918 | urea transmembrane transport(GO:0071918) |
| 0.0 | 0.1 | GO:0055118 | negative regulation of cardiac muscle contraction(GO:0055118) |
| 0.0 | 0.1 | GO:0048227 | plasma membrane to endosome transport(GO:0048227) |
| 0.0 | 0.1 | GO:0033629 | negative regulation of cell adhesion mediated by integrin(GO:0033629) |
| 0.0 | 0.1 | GO:0031999 | negative regulation of fatty acid beta-oxidation(GO:0031999) |
| 0.0 | 0.1 | GO:0071447 | cellular response to hydroperoxide(GO:0071447) |
| 0.0 | 0.1 | GO:0018197 | peptidyl-aspartic acid modification(GO:0018197) |
| 0.0 | 0.1 | GO:0090400 | stress-induced premature senescence(GO:0090400) |
| 0.0 | 0.1 | GO:0070447 | positive regulation of oligodendrocyte progenitor proliferation(GO:0070447) |
| 0.0 | 0.2 | GO:0002692 | negative regulation of cellular extravasation(GO:0002692) |
| 0.0 | 0.1 | GO:0042769 | DNA damage response, detection of DNA damage(GO:0042769) |
| 0.0 | 0.1 | GO:0006172 | ADP biosynthetic process(GO:0006172) |
| 0.0 | 0.1 | GO:0044034 | negative stranded viral RNA replication(GO:0039689) multi-organism biosynthetic process(GO:0044034) |
| 0.0 | 0.1 | GO:0060279 | positive regulation of ovulation(GO:0060279) |
| 0.0 | 0.1 | GO:0010748 | negative regulation of plasma membrane long-chain fatty acid transport(GO:0010748) |
| 0.0 | 0.2 | GO:0043562 | cellular response to nitrogen starvation(GO:0006995) cellular response to nitrogen levels(GO:0043562) |
| 0.0 | 0.0 | GO:0039530 | MDA-5 signaling pathway(GO:0039530) |
| 0.0 | 0.1 | GO:2000259 | positive regulation of complement activation(GO:0045917) positive regulation of protein activation cascade(GO:2000259) |
| 0.0 | 0.1 | GO:0014053 | negative regulation of gamma-aminobutyric acid secretion(GO:0014053) |
| 0.0 | 0.1 | GO:0014734 | skeletal muscle hypertrophy(GO:0014734) |
| 0.0 | 0.1 | GO:0031506 | cell wall mannoprotein biosynthetic process(GO:0000032) mannoprotein metabolic process(GO:0006056) mannoprotein biosynthetic process(GO:0006057) cell wall glycoprotein biosynthetic process(GO:0031506) cell wall biogenesis(GO:0042546) cell wall macromolecule biosynthetic process(GO:0044038) chain elongation of O-linked mannose residue(GO:0044845) cellular component macromolecule biosynthetic process(GO:0070589) |
| 0.0 | 0.1 | GO:0008295 | spermidine biosynthetic process(GO:0008295) |
| 0.0 | 0.2 | GO:0032959 | inositol trisphosphate biosynthetic process(GO:0032959) |
| 0.0 | 0.1 | GO:2000192 | negative regulation of fatty acid transport(GO:2000192) |
| 0.0 | 0.0 | GO:0060331 | negative regulation of response to interferon-gamma(GO:0060331) negative regulation of interferon-gamma-mediated signaling pathway(GO:0060336) |
| 0.0 | 0.2 | GO:0043653 | mitochondrial fragmentation involved in apoptotic process(GO:0043653) |
| 0.0 | 0.9 | GO:0033141 | positive regulation of peptidyl-serine phosphorylation of STAT protein(GO:0033141) |
| 0.0 | 0.1 | GO:2000562 | negative regulation of CD4-positive, alpha-beta T cell proliferation(GO:2000562) |
| 0.0 | 0.1 | GO:0070814 | hydrogen sulfide biosynthetic process(GO:0070814) |
| 0.0 | 0.1 | GO:0042985 | negative regulation of amyloid precursor protein biosynthetic process(GO:0042985) |
| 0.0 | 0.0 | GO:1903774 | positive regulation of viral budding via host ESCRT complex(GO:1903774) |
| 0.0 | 0.1 | GO:0009597 | detection of virus(GO:0009597) |
| 0.0 | 0.1 | GO:0019626 | short-chain fatty acid catabolic process(GO:0019626) |
| 0.0 | 0.1 | GO:0070544 | histone H3-K36 demethylation(GO:0070544) |
| 0.0 | 0.2 | GO:1904153 | negative regulation of protein exit from endoplasmic reticulum(GO:0070862) negative regulation of retrograde protein transport, ER to cytosol(GO:1904153) |
| 0.0 | 0.1 | GO:0072321 | chaperone-mediated protein transport(GO:0072321) |
| 0.0 | 0.3 | GO:0071380 | cellular response to prostaglandin E stimulus(GO:0071380) |
| 0.0 | 0.0 | GO:1900045 | negative regulation of protein K63-linked ubiquitination(GO:1900045) negative regulation of protein polyubiquitination(GO:1902915) |
| 0.0 | 0.1 | GO:0071926 | cannabinoid signaling pathway(GO:0038171) endocannabinoid signaling pathway(GO:0071926) |
| 0.0 | 0.0 | GO:0032513 | negative regulation of protein phosphatase type 2B activity(GO:0032513) |
| 0.0 | 0.1 | GO:0034382 | chylomicron remnant clearance(GO:0034382) triglyceride-rich lipoprotein particle clearance(GO:0071830) |
| 0.0 | 0.1 | GO:1901252 | regulation of intracellular transport of viral material(GO:1901252) |
| 0.0 | 0.1 | GO:2000510 | positive regulation of dendritic cell chemotaxis(GO:2000510) |
| 0.0 | 0.0 | GO:0048807 | female genitalia morphogenesis(GO:0048807) |
| 0.0 | 0.1 | GO:0005984 | disaccharide metabolic process(GO:0005984) |
| 0.0 | 0.1 | GO:0032482 | Rab protein signal transduction(GO:0032482) |
| 0.0 | 0.1 | GO:0070086 | ubiquitin-dependent endocytosis(GO:0070086) |
| 0.0 | 0.0 | GO:0000255 | allantoin metabolic process(GO:0000255) |
| 0.0 | 0.1 | GO:0051418 | interphase microtubule nucleation by interphase microtubule organizing center(GO:0051415) microtubule nucleation by microtubule organizing center(GO:0051418) |
| 0.0 | 0.4 | GO:0071353 | cellular response to interleukin-4(GO:0071353) |
| 0.0 | 0.0 | GO:0030997 | regulation of centriole-centriole cohesion(GO:0030997) |
| 0.0 | 0.1 | GO:0006563 | L-serine metabolic process(GO:0006563) |
| 0.0 | 0.0 | GO:0034197 | acylglycerol transport(GO:0034196) triglyceride transport(GO:0034197) |
| 0.0 | 0.1 | GO:0070525 | tRNA threonylcarbamoyladenosine metabolic process(GO:0070525) |
| 0.0 | 0.3 | GO:0031063 | regulation of histone deacetylation(GO:0031063) |
| 0.0 | 0.1 | GO:0035948 | positive regulation of gluconeogenesis by positive regulation of transcription from RNA polymerase II promoter(GO:0035948) |
| 0.0 | 0.1 | GO:0046552 | eye photoreceptor cell fate commitment(GO:0042706) photoreceptor cell fate commitment(GO:0046552) |
| 0.0 | 0.4 | GO:0070542 | response to fatty acid(GO:0070542) |
| 0.0 | 0.1 | GO:0018242 | protein O-linked glycosylation via serine(GO:0018242) |
| 0.0 | 0.1 | GO:0060468 | prevention of polyspermy(GO:0060468) |
| 0.0 | 0.1 | GO:0006578 | amino-acid betaine biosynthetic process(GO:0006578) |
| 0.0 | 0.1 | GO:0070120 | ciliary neurotrophic factor-mediated signaling pathway(GO:0070120) |
| 0.0 | 0.0 | GO:0035962 | response to interleukin-13(GO:0035962) cellular response to interleukin-13(GO:0035963) |
| 0.0 | 0.1 | GO:0031657 | regulation of cyclin-dependent protein serine/threonine kinase activity involved in G1/S transition of mitotic cell cycle(GO:0031657) positive regulation of cyclin-dependent protein serine/threonine kinase activity involved in G1/S transition of mitotic cell cycle(GO:0031659) |
| 0.0 | 0.0 | GO:0006624 | vacuolar protein processing(GO:0006624) |
| 0.0 | 0.0 | GO:0097212 | lysosomal membrane organization(GO:0097212) |
| 0.0 | 0.1 | GO:1901096 | regulation of autophagosome maturation(GO:1901096) |
| 0.0 | 0.1 | GO:0048102 | autophagic cell death(GO:0048102) |
| 0.0 | 0.1 | GO:0061072 | iris morphogenesis(GO:0061072) |
| 0.0 | 0.1 | GO:0000820 | regulation of glutamine family amino acid metabolic process(GO:0000820) |
| 0.0 | 0.1 | GO:0051124 | synaptic growth at neuromuscular junction(GO:0051124) |
| 0.0 | 0.4 | GO:0018196 | peptidyl-asparagine modification(GO:0018196) protein N-linked glycosylation via asparagine(GO:0018279) |
| 0.0 | 0.0 | GO:0006285 | base-excision repair, AP site formation(GO:0006285) |
| 0.0 | 0.1 | GO:0090085 | regulation of protein deubiquitination(GO:0090085) |
| 0.0 | 0.1 | GO:0017187 | peptidyl-glutamic acid carboxylation(GO:0017187) |
| 0.0 | 0.1 | GO:0018119 | peptidyl-cysteine S-nitrosylation(GO:0018119) |
| 0.0 | 0.1 | GO:0014722 | regulation of skeletal muscle contraction by calcium ion signaling(GO:0014722) |
| 0.0 | 0.0 | GO:0060282 | positive regulation of oocyte development(GO:0060282) |
| 0.0 | 0.1 | GO:2000659 | regulation of interleukin-1-mediated signaling pathway(GO:2000659) |
| 0.0 | 0.1 | GO:0016115 | terpenoid catabolic process(GO:0016115) |
| 0.0 | 0.0 | GO:0070368 | positive regulation of hepatocyte differentiation(GO:0070368) |
| 0.0 | 0.0 | GO:0060741 | prostate gland stromal morphogenesis(GO:0060741) |
| 0.0 | 0.1 | GO:0051639 | actin filament network formation(GO:0051639) |
| 0.0 | 0.1 | GO:0046083 | adenine metabolic process(GO:0046083) adenine biosynthetic process(GO:0046084) |
| 0.0 | 0.1 | GO:0006307 | DNA dealkylation involved in DNA repair(GO:0006307) |
| 0.0 | 0.1 | GO:0098908 | regulation of neuronal action potential(GO:0098908) |
| 0.0 | 0.1 | GO:0018094 | protein polyglycylation(GO:0018094) |
| 0.0 | 0.2 | GO:0033523 | histone H2B ubiquitination(GO:0033523) |
| 0.0 | 0.1 | GO:0045585 | regulation of cytotoxic T cell differentiation(GO:0045583) positive regulation of cytotoxic T cell differentiation(GO:0045585) |
| 0.0 | 0.2 | GO:0019184 | nonribosomal peptide biosynthetic process(GO:0019184) |
| 0.0 | 0.1 | GO:0072300 | positive regulation of metanephric glomerulus development(GO:0072300) |
| 0.0 | 0.1 | GO:0080154 | regulation of fertilization(GO:0080154) |
| 0.0 | 0.0 | GO:0002154 | thyroid hormone mediated signaling pathway(GO:0002154) regulation of thyroid hormone mediated signaling pathway(GO:0002155) |
| 0.0 | 0.1 | GO:0019368 | fatty acid elongation, saturated fatty acid(GO:0019367) fatty acid elongation, unsaturated fatty acid(GO:0019368) fatty acid elongation, monounsaturated fatty acid(GO:0034625) fatty acid elongation, polyunsaturated fatty acid(GO:0034626) |
| 0.0 | 0.0 | GO:0061623 | galactose catabolic process via UDP-galactose(GO:0033499) glycolytic process from galactose(GO:0061623) |
| 0.0 | 0.0 | GO:0015705 | iodide transport(GO:0015705) |
| 0.0 | 0.1 | GO:0009173 | UMP biosynthetic process(GO:0006222) pyrimidine ribonucleoside monophosphate metabolic process(GO:0009173) pyrimidine ribonucleoside monophosphate biosynthetic process(GO:0009174) UMP metabolic process(GO:0046049) |
| 0.0 | 0.1 | GO:0001887 | selenium compound metabolic process(GO:0001887) |
| 0.0 | 0.0 | GO:1904970 | brush border assembly(GO:1904970) |
| 0.0 | 0.1 | GO:0051562 | negative regulation of mitochondrial calcium ion concentration(GO:0051562) |
| 0.0 | 0.1 | GO:0015760 | hexose phosphate transport(GO:0015712) glucose-6-phosphate transport(GO:0015760) |
| 0.0 | 0.3 | GO:0017144 | drug metabolic process(GO:0017144) |
| 0.0 | 0.2 | GO:0045056 | transcytosis(GO:0045056) |
| 0.0 | 0.1 | GO:0006269 | DNA replication, synthesis of RNA primer(GO:0006269) |
| 0.0 | 0.1 | GO:0000389 | mRNA 3'-splice site recognition(GO:0000389) |
| 0.0 | 0.1 | GO:0031274 | positive regulation of pseudopodium assembly(GO:0031274) |
| 0.0 | 0.1 | GO:0007221 | positive regulation of transcription of Notch receptor target(GO:0007221) |
| 0.0 | 0.1 | GO:0046602 | regulation of mitotic centrosome separation(GO:0046602) |
| 0.0 | 0.1 | GO:0033152 | immunoglobulin V(D)J recombination(GO:0033152) |
| 0.0 | 0.1 | GO:0071455 | cellular response to increased oxygen levels(GO:0036295) cellular response to hyperoxia(GO:0071455) |
| 0.0 | 0.1 | GO:0043654 | recognition of apoptotic cell(GO:0043654) |
| 0.0 | 0.1 | GO:0048069 | eye pigmentation(GO:0048069) |
| 0.0 | 0.1 | GO:0072602 | interleukin-4 secretion(GO:0072602) |
| 0.0 | 0.1 | GO:0044154 | histone H3-K14 acetylation(GO:0044154) |
| 0.0 | 0.0 | GO:0042360 | vitamin E metabolic process(GO:0042360) |
| 0.0 | 0.1 | GO:0035864 | response to potassium ion(GO:0035864) cellular response to potassium ion(GO:0035865) |
| 0.0 | 0.1 | GO:0010960 | magnesium ion homeostasis(GO:0010960) |
| 0.0 | 0.1 | GO:0042796 | snRNA transcription from RNA polymerase III promoter(GO:0042796) |
| 0.0 | 0.2 | GO:0071803 | positive regulation of podosome assembly(GO:0071803) |
| 0.0 | 0.0 | GO:0042045 | epithelial fluid transport(GO:0042045) |
| 0.0 | 0.1 | GO:0046951 | ketone body biosynthetic process(GO:0046951) |
| 0.0 | 0.5 | GO:0048536 | spleen development(GO:0048536) |
| 0.0 | 0.1 | GO:0033689 | negative regulation of osteoblast proliferation(GO:0033689) |
| 0.0 | 0.0 | GO:0061055 | myotome development(GO:0061055) |
| 0.0 | 0.0 | GO:0061511 | centriole elongation(GO:0061511) |
| 0.0 | 0.2 | GO:0014002 | astrocyte development(GO:0014002) |
| 0.0 | 0.1 | GO:0030050 | vesicle transport along actin filament(GO:0030050) |
| 0.0 | 0.1 | GO:1903553 | positive regulation of extracellular exosome assembly(GO:1903553) |
| 0.0 | 0.1 | GO:0061370 | testosterone biosynthetic process(GO:0061370) |
| 0.0 | 0.1 | GO:0051136 | regulation of NK T cell differentiation(GO:0051136) positive regulation of NK T cell differentiation(GO:0051138) |
| 0.0 | 0.0 | GO:0003100 | regulation of systemic arterial blood pressure by endothelin(GO:0003100) |
| 0.0 | 0.1 | GO:0006622 | protein targeting to lysosome(GO:0006622) |
| 0.0 | 0.0 | GO:1903279 | regulation of calcium:sodium antiporter activity(GO:1903279) |
| 0.0 | 0.1 | GO:0036315 | cellular response to sterol(GO:0036315) |
| 0.0 | 0.0 | GO:0009129 | pyrimidine nucleoside monophosphate metabolic process(GO:0009129) pyrimidine deoxyribonucleoside monophosphate metabolic process(GO:0009176) |
| 0.0 | 0.1 | GO:0072553 | terminal button organization(GO:0072553) |
| 0.0 | 0.1 | GO:0006620 | posttranslational protein targeting to membrane(GO:0006620) |
| 0.0 | 0.0 | GO:0032511 | late endosome to vacuole transport via multivesicular body sorting pathway(GO:0032511) protein targeting to vacuole involved in ubiquitin-dependent protein catabolic process via the multivesicular body sorting pathway(GO:0043328) |
| 0.0 | 0.0 | GO:0036216 | response to stem cell factor(GO:0036215) cellular response to stem cell factor stimulus(GO:0036216) Kit signaling pathway(GO:0038109) |
| 0.0 | 0.0 | GO:0010980 | regulation of vitamin D 24-hydroxylase activity(GO:0010979) positive regulation of vitamin D 24-hydroxylase activity(GO:0010980) |
| 0.0 | 0.0 | GO:0002018 | renin-angiotensin regulation of aldosterone production(GO:0002018) |
| 0.0 | 0.1 | GO:0035871 | protein K11-linked deubiquitination(GO:0035871) |
| 0.0 | 0.1 | GO:0060591 | chondroblast differentiation(GO:0060591) |
| 0.0 | 0.1 | GO:1900029 | positive regulation of ruffle assembly(GO:1900029) |
| 0.0 | 0.0 | GO:0071672 | negative regulation of smooth muscle cell chemotaxis(GO:0071672) |
| 0.0 | 0.0 | GO:0006059 | hexitol metabolic process(GO:0006059) |
| 0.0 | 0.0 | GO:0034227 | tRNA thio-modification(GO:0034227) |
| 0.0 | 0.2 | GO:0031116 | positive regulation of microtubule polymerization(GO:0031116) |
| 0.0 | 0.0 | GO:0061418 | regulation of transcription from RNA polymerase II promoter in response to hypoxia(GO:0061418) |
| 0.0 | 0.0 | GO:0048669 | collateral sprouting in absence of injury(GO:0048669) regulation of collateral sprouting in absence of injury(GO:0048696) |
| 0.0 | 0.1 | GO:0048680 | positive regulation of axon regeneration(GO:0048680) |
| 0.0 | 0.1 | GO:0043415 | positive regulation of skeletal muscle tissue regeneration(GO:0043415) |
| 0.0 | 0.1 | GO:0030321 | transepithelial chloride transport(GO:0030321) |
| 0.0 | 0.1 | GO:0015867 | ATP transport(GO:0015867) |
| 0.0 | 0.0 | GO:0040009 | regulation of growth rate(GO:0040009) |
| 0.0 | 0.0 | GO:2000418 | positive regulation of eosinophil migration(GO:2000418) |
| 0.0 | 0.1 | GO:0018026 | peptidyl-lysine monomethylation(GO:0018026) |
| 0.0 | 0.1 | GO:0030205 | dermatan sulfate metabolic process(GO:0030205) |
| 0.0 | 0.0 | GO:0014732 | skeletal muscle atrophy(GO:0014732) |
| 0.0 | 0.1 | GO:0097500 | receptor localization to nonmotile primary cilium(GO:0097500) |
| 0.0 | 0.3 | GO:0006779 | porphyrin-containing compound biosynthetic process(GO:0006779) tetrapyrrole biosynthetic process(GO:0033014) |
| 0.0 | 0.2 | GO:0003298 | physiological muscle hypertrophy(GO:0003298) physiological cardiac muscle hypertrophy(GO:0003301) cell growth involved in cardiac muscle cell development(GO:0061049) |
| 0.0 | 0.0 | GO:0090427 | activation of meiosis(GO:0090427) |
| 0.0 | 0.0 | GO:0021553 | olfactory nerve development(GO:0021553) |
| 0.0 | 0.2 | GO:0060294 | cilium movement involved in cell motility(GO:0060294) |
| 0.0 | 0.1 | GO:0006957 | complement activation, alternative pathway(GO:0006957) |
| 0.0 | 0.1 | GO:0001542 | ovulation from ovarian follicle(GO:0001542) |
| 0.0 | 0.2 | GO:0035162 | embryonic hemopoiesis(GO:0035162) |
| 0.0 | 0.0 | GO:0010387 | COP9 signalosome assembly(GO:0010387) |
| 0.0 | 0.0 | GO:2000384 | regulation of ectoderm development(GO:2000383) negative regulation of ectoderm development(GO:2000384) |
| 0.0 | 0.1 | GO:0060831 | smoothened signaling pathway involved in dorsal/ventral neural tube patterning(GO:0060831) |
| 0.0 | 0.1 | GO:1990845 | diet induced thermogenesis(GO:0002024) adaptive thermogenesis(GO:1990845) |
| 0.0 | 0.1 | GO:0071044 | histone mRNA catabolic process(GO:0071044) |
| 0.0 | 0.0 | GO:0060300 | regulation of cytokine activity(GO:0060300) |
| 0.0 | 0.0 | GO:0035093 | spermatogenesis, exchange of chromosomal proteins(GO:0035093) |
| 0.0 | 0.1 | GO:0090331 | negative regulation of platelet aggregation(GO:0090331) |
| 0.0 | 0.1 | GO:1990126 | retrograde transport, endosome to plasma membrane(GO:1990126) |
| 0.0 | 0.1 | GO:0003376 | sphingosine-1-phosphate signaling pathway(GO:0003376) |
| 0.0 | 0.1 | GO:0019934 | cGMP-mediated signaling(GO:0019934) |
| 0.0 | 0.0 | GO:0061622 | glycolytic process through glucose-1-phosphate(GO:0061622) |
| 0.0 | 0.1 | GO:0006614 | SRP-dependent cotranslational protein targeting to membrane(GO:0006614) |
| 0.0 | 0.0 | GO:0044341 | sodium-dependent phosphate transport(GO:0044341) |
| 0.0 | 0.0 | GO:1903225 | negative regulation of endodermal cell differentiation(GO:1903225) |
| 0.0 | 0.1 | GO:0016255 | attachment of GPI anchor to protein(GO:0016255) |
| 0.0 | 0.0 | GO:0072367 | regulation of lipid transport by regulation of transcription from RNA polymerase II promoter(GO:0072367) |
| 0.0 | 0.1 | GO:0046826 | negative regulation of protein export from nucleus(GO:0046826) |
| 0.0 | 0.1 | GO:0044597 | polyketide metabolic process(GO:0030638) aminoglycoside antibiotic metabolic process(GO:0030647) daunorubicin metabolic process(GO:0044597) doxorubicin metabolic process(GO:0044598) |
| 0.0 | 0.1 | GO:0034242 | negative regulation of syncytium formation by plasma membrane fusion(GO:0034242) |
| 0.0 | 0.0 | GO:2000297 | negative regulation of synapse maturation(GO:2000297) |
| 0.0 | 0.0 | GO:0008588 | release of cytoplasmic sequestered NF-kappaB(GO:0008588) |
| 0.0 | 0.1 | GO:2000144 | positive regulation of DNA-templated transcription, initiation(GO:2000144) |
| 0.0 | 0.1 | GO:0040015 | negative regulation of multicellular organism growth(GO:0040015) |
| 0.0 | 0.1 | GO:0060180 | female mating behavior(GO:0060180) |
| 0.0 | 0.1 | GO:0000103 | sulfate assimilation(GO:0000103) |
| 0.0 | 0.0 | GO:0045472 | response to ether(GO:0045472) |
| 0.0 | 0.2 | GO:0051497 | negative regulation of stress fiber assembly(GO:0051497) |
| 0.0 | 0.1 | GO:1903887 | motile primary cilium assembly(GO:1903887) |
| 0.0 | 0.0 | GO:0044828 | negative regulation by host of viral genome replication(GO:0044828) |
| 0.0 | 0.1 | GO:0050916 | sensory perception of sweet taste(GO:0050916) |
| 0.0 | 0.1 | GO:0060718 | chorionic trophoblast cell differentiation(GO:0060718) |
| 0.0 | 0.0 | GO:0032898 | neurotrophin production(GO:0032898) |
| 0.0 | 0.0 | GO:0006551 | leucine metabolic process(GO:0006551) |
| 0.0 | 0.0 | GO:2001260 | regulation of semaphorin-plexin signaling pathway(GO:2001260) |
| 0.0 | 0.0 | GO:0000960 | mitochondrial RNA catabolic process(GO:0000957) regulation of mitochondrial RNA catabolic process(GO:0000960) |
| 0.0 | 0.1 | GO:0000290 | deadenylation-dependent decapping of nuclear-transcribed mRNA(GO:0000290) |
| 0.0 | 0.0 | GO:0007406 | negative regulation of neuroblast proliferation(GO:0007406) |
| 0.0 | 0.0 | GO:0071314 | cellular response to cocaine(GO:0071314) |
| 0.0 | 0.1 | GO:0031468 | nuclear envelope reassembly(GO:0031468) |
| 0.0 | 0.0 | GO:0006419 | alanyl-tRNA aminoacylation(GO:0006419) |
| 0.0 | 0.0 | GO:0045915 | positive regulation of catecholamine metabolic process(GO:0045915) positive regulation of dopamine metabolic process(GO:0045964) |
| 0.0 | 0.0 | GO:0046391 | 5-phosphoribose 1-diphosphate biosynthetic process(GO:0006015) 5-phosphoribose 1-diphosphate metabolic process(GO:0046391) |
| 0.0 | 0.1 | GO:0042438 | melanin biosynthetic process(GO:0042438) |
| 0.0 | 0.1 | GO:0006384 | transcription initiation from RNA polymerase III promoter(GO:0006384) |
| 0.0 | 0.0 | GO:0090230 | regulation of centromere complex assembly(GO:0090230) |
| 0.0 | 0.2 | GO:0070884 | regulation of calcineurin-NFAT signaling cascade(GO:0070884) |
| 0.0 | 0.1 | GO:0090435 | protein localization to nuclear envelope(GO:0090435) |
| 0.0 | 0.1 | GO:0006198 | cAMP catabolic process(GO:0006198) |
| 0.0 | 0.0 | GO:0098795 | mRNA cleavage involved in gene silencing by miRNA(GO:0035279) mRNA cleavage involved in gene silencing(GO:0098795) |
| 0.0 | 0.0 | GO:1900108 | negative regulation of nodal signaling pathway(GO:1900108) |
| 0.0 | 0.0 | GO:0010966 | regulation of phosphate transport(GO:0010966) |
| 0.0 | 0.0 | GO:0048850 | hypophysis morphogenesis(GO:0048850) |
| 0.0 | 0.0 | GO:1902774 | late endosome to lysosome transport(GO:1902774) |
| 0.0 | 0.0 | GO:0019230 | proprioception(GO:0019230) |
| 0.0 | 0.0 | GO:0090038 | negative regulation of protein kinase C signaling(GO:0090038) |
| 0.0 | 0.1 | GO:0043922 | negative regulation by host of viral transcription(GO:0043922) |
| 0.0 | 0.1 | GO:0032367 | intracellular cholesterol transport(GO:0032367) |
| 0.0 | 0.0 | GO:0070094 | positive regulation of glucagon secretion(GO:0070094) |
| 0.0 | 0.0 | GO:0090309 | positive regulation of methylation-dependent chromatin silencing(GO:0090309) |
| 0.0 | 0.0 | GO:1903361 | protein localization to basolateral plasma membrane(GO:1903361) |
| 0.0 | 0.5 | GO:0032543 | mitochondrial translation(GO:0032543) |
| 0.0 | 0.0 | GO:0051684 | maintenance of Golgi location(GO:0051684) |
| 0.0 | 0.0 | GO:0045085 | negative regulation of interleukin-2 biosynthetic process(GO:0045085) |
| 0.0 | 0.0 | GO:0032509 | endosome transport via multivesicular body sorting pathway(GO:0032509) |
| 0.0 | 0.0 | GO:0034086 | maintenance of sister chromatid cohesion(GO:0034086) maintenance of mitotic sister chromatid cohesion(GO:0034088) |
| 0.0 | 0.0 | GO:0001865 | NK T cell differentiation(GO:0001865) |
| 0.0 | 0.0 | GO:0015747 | urate transport(GO:0015747) |
| 0.0 | 0.0 | GO:0070427 | nucleotide-binding oligomerization domain containing 1 signaling pathway(GO:0070427) |
| 0.0 | 0.0 | GO:0042795 | snRNA transcription from RNA polymerase II promoter(GO:0042795) |
| 0.0 | 0.0 | GO:0070966 | nuclear-transcribed mRNA catabolic process, no-go decay(GO:0070966) |
| 0.0 | 0.0 | GO:0035356 | cellular triglyceride homeostasis(GO:0035356) |
| 0.0 | 0.0 | GO:0031296 | B cell costimulation(GO:0031296) |
| 0.0 | 0.1 | GO:0042219 | cellular modified amino acid catabolic process(GO:0042219) |
| 0.0 | 0.0 | GO:0071051 | polyadenylation-dependent snoRNA 3'-end processing(GO:0071051) |
| 0.0 | 0.1 | GO:1903204 | negative regulation of oxidative stress-induced neuron death(GO:1903204) |
| 0.0 | 0.0 | GO:0045218 | zonula adherens maintenance(GO:0045218) |
| 0.0 | 0.0 | GO:0031914 | negative regulation of synaptic plasticity(GO:0031914) |
| 0.0 | 0.1 | GO:0032695 | negative regulation of interleukin-12 production(GO:0032695) |
| 0.0 | 0.0 | GO:0070268 | cornification(GO:0070268) |
| 0.0 | 0.0 | GO:0060684 | epithelial-mesenchymal cell signaling(GO:0060684) |
| 0.0 | 0.0 | GO:0070669 | response to interleukin-2(GO:0070669) |
| 0.0 | 0.1 | GO:0010032 | meiotic chromosome condensation(GO:0010032) |
| 0.0 | 0.1 | GO:0048935 | peripheral nervous system neuron differentiation(GO:0048934) peripheral nervous system neuron development(GO:0048935) |
| 0.0 | 0.0 | GO:0035625 | receptor transactivation(GO:0035624) epidermal growth factor-activated receptor transactivation by G-protein coupled receptor signaling pathway(GO:0035625) |
| 0.0 | 0.0 | GO:0051029 | rRNA export from nucleus(GO:0006407) rRNA transport(GO:0051029) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.1 | 0.6 | GO:0045098 | type III intermediate filament(GO:0045098) |
| 0.1 | 0.4 | GO:0005726 | perichromatin fibrils(GO:0005726) |
| 0.1 | 0.9 | GO:0070852 | cell body fiber(GO:0070852) |
| 0.1 | 0.2 | GO:0070765 | gamma-secretase complex(GO:0070765) |
| 0.1 | 0.6 | GO:0031595 | nuclear proteasome complex(GO:0031595) |
| 0.1 | 0.4 | GO:0045180 | basal cortex(GO:0045180) |
| 0.1 | 0.4 | GO:0008290 | F-actin capping protein complex(GO:0008290) |
| 0.1 | 0.7 | GO:0034663 | endoplasmic reticulum chaperone complex(GO:0034663) |
| 0.1 | 0.2 | GO:0034666 | integrin alpha2-beta1 complex(GO:0034666) |
| 0.1 | 0.4 | GO:0044233 | ER-mitochondrion membrane contact site(GO:0044233) |
| 0.1 | 0.2 | GO:0030127 | COPII vesicle coat(GO:0030127) |
| 0.0 | 0.1 | GO:0043527 | tRNA methyltransferase complex(GO:0043527) |
| 0.0 | 0.2 | GO:0000408 | EKC/KEOPS complex(GO:0000408) |
| 0.0 | 0.2 | GO:0042406 | extrinsic component of endoplasmic reticulum membrane(GO:0042406) |
| 0.0 | 0.3 | GO:0014731 | spectrin-associated cytoskeleton(GO:0014731) |
| 0.0 | 1.1 | GO:0034364 | high-density lipoprotein particle(GO:0034364) |
| 0.0 | 0.1 | GO:0097454 | Schwann cell microvillus(GO:0097454) |
| 0.0 | 0.4 | GO:0016342 | catenin complex(GO:0016342) |
| 0.0 | 0.3 | GO:0042587 | glycogen granule(GO:0042587) |
| 0.0 | 0.1 | GO:0097441 | basilar dendrite(GO:0097441) |
| 0.0 | 0.3 | GO:0070937 | CRD-mediated mRNA stability complex(GO:0070937) |
| 0.0 | 0.2 | GO:0070776 | H3 histone acetyltransferase complex(GO:0070775) MOZ/MORF histone acetyltransferase complex(GO:0070776) |
| 0.0 | 0.2 | GO:0016281 | eukaryotic translation initiation factor 4F complex(GO:0016281) |
| 0.0 | 0.1 | GO:0008091 | spectrin(GO:0008091) |
| 0.0 | 0.2 | GO:0000931 | gamma-tubulin large complex(GO:0000931) gamma-tubulin ring complex(GO:0008274) |
| 0.0 | 0.2 | GO:0042583 | chromaffin granule(GO:0042583) |
| 0.0 | 0.1 | GO:0097452 | GAIT complex(GO:0097452) |
| 0.0 | 0.2 | GO:0001651 | dense fibrillar component(GO:0001651) |
| 0.0 | 0.1 | GO:0045293 | mRNA editing complex(GO:0045293) |
| 0.0 | 0.2 | GO:0033093 | Weibel-Palade body(GO:0033093) |
| 0.0 | 0.1 | GO:0043159 | acrosomal matrix(GO:0043159) |
| 0.0 | 0.1 | GO:0070552 | BRISC complex(GO:0070552) |
| 0.0 | 0.1 | GO:0071203 | WASH complex(GO:0071203) |
| 0.0 | 0.2 | GO:0042824 | MHC class I peptide loading complex(GO:0042824) |
| 0.0 | 0.1 | GO:0002193 | MAML1-RBP-Jkappa- ICN1 complex(GO:0002193) |
| 0.0 | 0.2 | GO:0031464 | Cul4A-RING E3 ubiquitin ligase complex(GO:0031464) |
| 0.0 | 0.2 | GO:0034715 | pICln-Sm protein complex(GO:0034715) |
| 0.0 | 0.1 | GO:0031597 | cytosolic proteasome complex(GO:0031597) |
| 0.0 | 0.2 | GO:0005952 | cAMP-dependent protein kinase complex(GO:0005952) |
| 0.0 | 0.1 | GO:0030289 | protein phosphatase 4 complex(GO:0030289) |
| 0.0 | 0.1 | GO:0044316 | cone cell pedicle(GO:0044316) |
| 0.0 | 0.1 | GO:0019907 | cyclin-dependent protein kinase activating kinase holoenzyme complex(GO:0019907) |
| 0.0 | 1.0 | GO:0030964 | mitochondrial respiratory chain complex I(GO:0005747) NADH dehydrogenase complex(GO:0030964) respiratory chain complex I(GO:0045271) |
| 0.0 | 1.5 | GO:0097517 | stress fiber(GO:0001725) contractile actin filament bundle(GO:0097517) |
| 0.0 | 0.2 | GO:0070419 | nonhomologous end joining complex(GO:0070419) |
| 0.0 | 0.4 | GO:0097038 | perinuclear endoplasmic reticulum(GO:0097038) |
| 0.0 | 0.1 | GO:0031074 | nucleocytoplasmic shuttling complex(GO:0031074) |
| 0.0 | 0.1 | GO:0044613 | nuclear pore central transport channel(GO:0044613) |
| 0.0 | 0.1 | GO:0005955 | calcineurin complex(GO:0005955) |
| 0.0 | 0.2 | GO:0032593 | insulin-responsive compartment(GO:0032593) |
| 0.0 | 0.1 | GO:0005579 | membrane attack complex(GO:0005579) |
| 0.0 | 0.0 | GO:0097025 | MPP7-DLG1-LIN7 complex(GO:0097025) |
| 0.0 | 0.1 | GO:0031313 | extrinsic component of endosome membrane(GO:0031313) |
| 0.0 | 0.3 | GO:0005847 | mRNA cleavage and polyadenylation specificity factor complex(GO:0005847) |
| 0.0 | 0.6 | GO:0000314 | organellar small ribosomal subunit(GO:0000314) mitochondrial small ribosomal subunit(GO:0005763) |
| 0.0 | 0.2 | GO:0072669 | tRNA-splicing ligase complex(GO:0072669) |
| 0.0 | 0.7 | GO:0009925 | basal plasma membrane(GO:0009925) |
| 0.0 | 0.1 | GO:0071942 | XPC complex(GO:0071942) |
| 0.0 | 0.2 | GO:0031462 | Cul2-RING ubiquitin ligase complex(GO:0031462) |
| 0.0 | 0.1 | GO:0044611 | nuclear pore inner ring(GO:0044611) |
| 0.0 | 0.2 | GO:0070578 | RISC-loading complex(GO:0070578) |
| 0.0 | 0.1 | GO:0042585 | germinal vesicle(GO:0042585) |
| 0.0 | 0.0 | GO:0031088 | platelet dense granule membrane(GO:0031088) |
| 0.0 | 0.1 | GO:0005786 | signal recognition particle, endoplasmic reticulum targeting(GO:0005786) signal recognition particle(GO:0048500) |
| 0.0 | 0.2 | GO:0005751 | mitochondrial respiratory chain complex IV(GO:0005751) |
| 0.0 | 0.4 | GO:0090545 | NuRD complex(GO:0016581) CHD-type complex(GO:0090545) |
| 0.0 | 0.2 | GO:0000815 | ESCRT III complex(GO:0000815) |
| 0.0 | 0.2 | GO:0008250 | oligosaccharyltransferase complex(GO:0008250) |
| 0.0 | 0.1 | GO:0035032 | phosphatidylinositol 3-kinase complex, class III(GO:0035032) |
| 0.0 | 0.1 | GO:0031315 | extrinsic component of mitochondrial outer membrane(GO:0031315) |
| 0.0 | 0.1 | GO:1990812 | growth cone filopodium(GO:1990812) |
| 0.0 | 0.1 | GO:0032299 | ribonuclease H2 complex(GO:0032299) |
| 0.0 | 0.1 | GO:0097487 | multivesicular body, internal vesicle(GO:0097487) |
| 0.0 | 0.2 | GO:0035098 | ESC/E(Z) complex(GO:0035098) |
| 0.0 | 0.1 | GO:0005968 | Rab-protein geranylgeranyltransferase complex(GO:0005968) |
| 0.0 | 0.0 | GO:0070110 | ciliary neurotrophic factor receptor complex(GO:0070110) |
| 0.0 | 0.1 | GO:0044666 | MLL3/4 complex(GO:0044666) |
| 0.0 | 0.2 | GO:0035371 | microtubule plus-end(GO:0035371) |
| 0.0 | 0.1 | GO:0019773 | proteasome core complex, alpha-subunit complex(GO:0019773) |
| 0.0 | 0.9 | GO:0072686 | mitotic spindle(GO:0072686) |
| 0.0 | 0.2 | GO:0031011 | Ino80 complex(GO:0031011) |
| 0.0 | 0.1 | GO:0031616 | spindle pole centrosome(GO:0031616) |
| 0.0 | 0.0 | GO:0042719 | mitochondrial intermembrane space protein transporter complex(GO:0042719) |
| 0.0 | 0.4 | GO:0001772 | immunological synapse(GO:0001772) |
| 0.0 | 0.2 | GO:0031528 | microvillus membrane(GO:0031528) |
| 0.0 | 0.2 | GO:0098643 | fibrillar collagen trimer(GO:0005583) banded collagen fibril(GO:0098643) |
| 0.0 | 0.5 | GO:0032420 | stereocilium(GO:0032420) |
| 0.0 | 0.2 | GO:0005652 | nuclear lamina(GO:0005652) |
| 0.0 | 0.1 | GO:0089701 | U2AF(GO:0089701) |
| 0.0 | 0.2 | GO:0005675 | holo TFIIH complex(GO:0005675) |
| 0.0 | 0.0 | GO:0016222 | procollagen-proline 4-dioxygenase complex(GO:0016222) |
| 0.0 | 0.1 | GO:0035339 | SPOTS complex(GO:0035339) |
| 0.0 | 0.0 | GO:0055087 | Ski complex(GO:0055087) |
| 0.0 | 0.1 | GO:0005827 | polar microtubule(GO:0005827) |
| 0.0 | 0.1 | GO:0000127 | transcription factor TFIIIC complex(GO:0000127) |
| 0.0 | 0.0 | GO:0005947 | mitochondrial alpha-ketoglutarate dehydrogenase complex(GO:0005947) |
| 0.0 | 0.1 | GO:0000444 | MIS12/MIND type complex(GO:0000444) |
| 0.0 | 0.0 | GO:0000110 | nucleotide-excision repair factor 1 complex(GO:0000110) |
| 0.0 | 0.0 | GO:0005785 | signal recognition particle receptor complex(GO:0005785) |
| 0.0 | 0.1 | GO:0042765 | GPI-anchor transamidase complex(GO:0042765) |
| 0.0 | 0.1 | GO:1904115 | axon cytoplasm(GO:1904115) |
| 0.0 | 0.1 | GO:0030061 | mitochondrial crista(GO:0030061) |
| 0.0 | 0.1 | GO:0008385 | IkappaB kinase complex(GO:0008385) |
| 0.0 | 0.1 | GO:0072687 | meiotic spindle(GO:0072687) |
| 0.0 | 0.1 | GO:0070847 | core mediator complex(GO:0070847) |
| 0.0 | 0.1 | GO:0000788 | nuclear nucleosome(GO:0000788) |
| 0.0 | 0.0 | GO:0061689 | tricellular tight junction(GO:0061689) |
| 0.0 | 0.6 | GO:0000932 | cytoplasmic mRNA processing body(GO:0000932) |
| 0.0 | 0.0 | GO:0008275 | gamma-tubulin small complex(GO:0008275) |
| 0.0 | 0.1 | GO:0016593 | Cdc73/Paf1 complex(GO:0016593) |
| 0.0 | 0.1 | GO:0034709 | methylosome(GO:0034709) |
| 0.0 | 0.1 | GO:0005796 | Golgi lumen(GO:0005796) |
| 0.0 | 0.1 | GO:0000813 | ESCRT I complex(GO:0000813) |
| 0.0 | 0.1 | GO:0019908 | nuclear cyclin-dependent protein kinase holoenzyme complex(GO:0019908) |
| 0.0 | 0.1 | GO:0042629 | mast cell granule(GO:0042629) |
| 0.0 | 0.2 | GO:0035327 | transcriptionally active chromatin(GO:0035327) |
| 0.0 | 0.1 | GO:0002116 | semaphorin receptor complex(GO:0002116) |
| 0.0 | 0.0 | GO:0044530 | supraspliceosomal complex(GO:0044530) |
| 0.0 | 0.0 | GO:1990075 | periciliary membrane compartment(GO:1990075) |
| 0.0 | 0.0 | GO:0031502 | dolichyl-phosphate-mannose-protein mannosyltransferase complex(GO:0031502) |
| 0.0 | 0.0 | GO:0032541 | cortical endoplasmic reticulum(GO:0032541) |
| 0.0 | 0.0 | GO:0036452 | ESCRT complex(GO:0036452) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.2 | 0.7 | GO:0070644 | vitamin D response element binding(GO:0070644) |
| 0.2 | 0.5 | GO:0005119 | smoothened binding(GO:0005119) |
| 0.1 | 0.4 | GO:0004505 | phenylalanine 4-monooxygenase activity(GO:0004505) |
| 0.1 | 0.6 | GO:0036402 | proteasome-activating ATPase activity(GO:0036402) |
| 0.1 | 0.6 | GO:0047760 | butyrate-CoA ligase activity(GO:0047760) |
| 0.1 | 0.3 | GO:0034186 | apolipoprotein A-I binding(GO:0034186) |
| 0.1 | 0.7 | GO:0005167 | neurotrophin TRK receptor binding(GO:0005167) |
| 0.1 | 0.3 | GO:0009374 | biotin binding(GO:0009374) |
| 0.1 | 0.3 | GO:0042030 | ATPase inhibitor activity(GO:0042030) |
| 0.1 | 0.2 | GO:0035373 | chondroitin sulfate proteoglycan binding(GO:0035373) |
| 0.1 | 0.7 | GO:0016215 | acyl-CoA desaturase activity(GO:0016215) |
| 0.1 | 1.4 | GO:0003785 | actin monomer binding(GO:0003785) |
| 0.1 | 0.2 | GO:0017153 | sodium:dicarboxylate symporter activity(GO:0017153) |
| 0.1 | 0.3 | GO:0016899 | oxidoreductase activity, acting on the CH-OH group of donors, oxygen as acceptor(GO:0016899) |
| 0.1 | 0.5 | GO:0030957 | Tat protein binding(GO:0030957) |
| 0.1 | 0.2 | GO:0016743 | carboxyl- or carbamoyltransferase activity(GO:0016743) |
| 0.1 | 0.3 | GO:0004340 | glucokinase activity(GO:0004340) hexokinase activity(GO:0004396) |
| 0.1 | 0.2 | GO:0004013 | adenosylhomocysteinase activity(GO:0004013) trialkylsulfonium hydrolase activity(GO:0016802) |
| 0.1 | 0.2 | GO:0031708 | endothelin B receptor binding(GO:0031708) |
| 0.1 | 0.2 | GO:0050510 | N-acetylgalactosaminyl-proteoglycan 3-beta-glucuronosyltransferase activity(GO:0050510) |
| 0.1 | 0.1 | GO:0036042 | long-chain fatty acyl-CoA binding(GO:0036042) |
| 0.1 | 0.2 | GO:0004793 | threonine aldolase activity(GO:0004793) L-allo-threonine aldolase activity(GO:0008732) |
| 0.1 | 0.2 | GO:0035276 | alcohol dehydrogenase activity, zinc-dependent(GO:0004024) ethanol binding(GO:0035276) |
| 0.1 | 0.2 | GO:0070878 | primary miRNA binding(GO:0070878) |
| 0.1 | 0.2 | GO:0008384 | IkappaB kinase activity(GO:0008384) |
| 0.1 | 0.2 | GO:0016833 | oxo-acid-lyase activity(GO:0016833) |
| 0.1 | 0.2 | GO:0004802 | transketolase activity(GO:0004802) |
| 0.0 | 0.1 | GO:0008597 | calcium-dependent protein serine/threonine phosphatase regulator activity(GO:0008597) |
| 0.0 | 0.5 | GO:0004312 | fatty acid synthase activity(GO:0004312) |
| 0.0 | 0.2 | GO:0017150 | tRNA dihydrouridine synthase activity(GO:0017150) |
| 0.0 | 0.1 | GO:0004477 | methenyltetrahydrofolate cyclohydrolase activity(GO:0004477) methylenetetrahydrofolate dehydrogenase (NAD+) activity(GO:0004487) |
| 0.0 | 0.3 | GO:1990459 | transferrin receptor binding(GO:1990459) |
| 0.0 | 0.6 | GO:0015643 | toxic substance binding(GO:0015643) |
| 0.0 | 0.3 | GO:0003836 | beta-galactoside (CMP) alpha-2,3-sialyltransferase activity(GO:0003836) |
| 0.0 | 0.6 | GO:0043274 | phospholipase binding(GO:0043274) |
| 0.0 | 1.2 | GO:0042056 | chemoattractant activity(GO:0042056) |
| 0.0 | 0.1 | GO:1990825 | sequence-specific mRNA binding(GO:1990825) |
| 0.0 | 0.4 | GO:0016888 | endodeoxyribonuclease activity, producing 5'-phosphomonoesters(GO:0016888) |
| 0.0 | 0.2 | GO:0015220 | choline transmembrane transporter activity(GO:0015220) |
| 0.0 | 0.4 | GO:1990381 | ubiquitin-specific protease binding(GO:1990381) |
| 0.0 | 0.1 | GO:0002054 | nucleobase binding(GO:0002054) |
| 0.0 | 0.3 | GO:0016004 | phospholipase activator activity(GO:0016004) |
| 0.0 | 0.0 | GO:0016972 | flavin-linked sulfhydryl oxidase activity(GO:0016971) thiol oxidase activity(GO:0016972) |
| 0.0 | 0.2 | GO:0019871 | sodium channel inhibitor activity(GO:0019871) |
| 0.0 | 0.1 | GO:0008525 | phosphatidylcholine transporter activity(GO:0008525) |
| 0.0 | 0.3 | GO:0008093 | cytoskeletal adaptor activity(GO:0008093) |
| 0.0 | 0.1 | GO:0018479 | benzaldehyde dehydrogenase (NAD+) activity(GO:0018479) |
| 0.0 | 0.2 | GO:0004792 | thiosulfate sulfurtransferase activity(GO:0004792) |
| 0.0 | 0.8 | GO:0050136 | NADH dehydrogenase (ubiquinone) activity(GO:0008137) NADH dehydrogenase (quinone) activity(GO:0050136) |
| 0.0 | 0.1 | GO:0061513 | hexose phosphate transmembrane transporter activity(GO:0015119) organophosphate:inorganic phosphate antiporter activity(GO:0015315) hexose-phosphate:inorganic phosphate antiporter activity(GO:0015526) glucose 6-phosphate:inorganic phosphate antiporter activity(GO:0061513) |
| 0.0 | 0.1 | GO:0004365 | glyceraldehyde-3-phosphate dehydrogenase (NAD+) (phosphorylating) activity(GO:0004365) glyceraldehyde-3-phosphate dehydrogenase (NAD(P)+) (phosphorylating) activity(GO:0043891) |
| 0.0 | 0.2 | GO:0050291 | sphingosine N-acyltransferase activity(GO:0050291) |
| 0.0 | 0.1 | GO:0003986 | acetyl-CoA hydrolase activity(GO:0003986) |
| 0.0 | 0.1 | GO:0004704 | NF-kappaB-inducing kinase activity(GO:0004704) |
| 0.0 | 0.1 | GO:0008823 | cupric reductase activity(GO:0008823) ferric-chelate reductase (NADPH) activity(GO:0052851) |
| 0.0 | 0.2 | GO:0051525 | NFAT protein binding(GO:0051525) |
| 0.0 | 0.3 | GO:0004499 | N,N-dimethylaniline monooxygenase activity(GO:0004499) |
| 0.0 | 0.1 | GO:0019960 | C-X3-C chemokine binding(GO:0019960) |
| 0.0 | 0.1 | GO:0004769 | steroid delta-isomerase activity(GO:0004769) |
| 0.0 | 0.3 | GO:0045294 | alpha-catenin binding(GO:0045294) |
| 0.0 | 0.1 | GO:0004779 | sulfate adenylyltransferase activity(GO:0004779) |
| 0.0 | 0.1 | GO:0003941 | L-serine ammonia-lyase activity(GO:0003941) |
| 0.0 | 0.3 | GO:0051787 | misfolded protein binding(GO:0051787) |
| 0.0 | 0.5 | GO:0008353 | RNA polymerase II carboxy-terminal domain kinase activity(GO:0008353) |
| 0.0 | 0.1 | GO:0004980 | melanocyte-stimulating hormone receptor activity(GO:0004980) |
| 0.0 | 0.1 | GO:0004771 | sterol esterase activity(GO:0004771) |
| 0.0 | 0.3 | GO:0015254 | glycerol transmembrane transporter activity(GO:0015168) glycerol channel activity(GO:0015254) |
| 0.0 | 0.2 | GO:0008046 | axon guidance receptor activity(GO:0008046) |
| 0.0 | 0.1 | GO:0004332 | fructose-bisphosphate aldolase activity(GO:0004332) |
| 0.0 | 0.1 | GO:0004301 | epoxide hydrolase activity(GO:0004301) |
| 0.0 | 0.1 | GO:0015116 | sulfate transmembrane transporter activity(GO:0015116) |
| 0.0 | 0.3 | GO:0034450 | ubiquitin-ubiquitin ligase activity(GO:0034450) |
| 0.0 | 0.8 | GO:0005132 | type I interferon receptor binding(GO:0005132) |
| 0.0 | 0.1 | GO:0015165 | pyrimidine nucleotide-sugar transmembrane transporter activity(GO:0015165) |
| 0.0 | 0.1 | GO:0004095 | carnitine O-palmitoyltransferase activity(GO:0004095) |
| 0.0 | 0.1 | GO:1990380 | Lys48-specific deubiquitinase activity(GO:1990380) |
| 0.0 | 0.1 | GO:0008401 | retinoic acid 4-hydroxylase activity(GO:0008401) |
| 0.0 | 0.1 | GO:0004897 | ciliary neurotrophic factor receptor activity(GO:0004897) |
| 0.0 | 0.1 | GO:0004515 | nicotinamide-nucleotide adenylyltransferase activity(GO:0000309) nicotinate-nucleotide adenylyltransferase activity(GO:0004515) |
| 0.0 | 0.1 | GO:0015379 | potassium:chloride symporter activity(GO:0015379) potassium ion symporter activity(GO:0022820) |
| 0.0 | 0.5 | GO:0003756 | protein disulfide isomerase activity(GO:0003756) intramolecular oxidoreductase activity, transposing S-S bonds(GO:0016864) |
| 0.0 | 0.1 | GO:0070579 | methylcytosine dioxygenase activity(GO:0070579) |
| 0.0 | 0.3 | GO:0034185 | apolipoprotein binding(GO:0034185) |
| 0.0 | 0.2 | GO:0008905 | mannose-phosphate guanylyltransferase activity(GO:0008905) |
| 0.0 | 0.1 | GO:0030942 | endoplasmic reticulum signal peptide binding(GO:0030942) |
| 0.0 | 0.2 | GO:0034713 | type I transforming growth factor beta receptor binding(GO:0034713) |
| 0.0 | 0.3 | GO:0008195 | phosphatidate phosphatase activity(GO:0008195) |
| 0.0 | 0.1 | GO:0030519 | snoRNP binding(GO:0030519) |
| 0.0 | 0.3 | GO:0016500 | protein-hormone receptor activity(GO:0016500) |
| 0.0 | 0.1 | GO:0005347 | ATP transmembrane transporter activity(GO:0005347) |
| 0.0 | 0.1 | GO:0004416 | hydroxyacylglutathione hydrolase activity(GO:0004416) |
| 0.0 | 0.1 | GO:0008349 | MAP kinase kinase kinase kinase activity(GO:0008349) |
| 0.0 | 0.1 | GO:0000268 | peroxisome targeting sequence binding(GO:0000268) |
| 0.0 | 1.1 | GO:0016763 | transferase activity, transferring pentosyl groups(GO:0016763) |
| 0.0 | 0.2 | GO:0016857 | racemase and epimerase activity, acting on carbohydrates and derivatives(GO:0016857) |
| 0.0 | 0.1 | GO:0005047 | signal recognition particle binding(GO:0005047) |
| 0.0 | 0.1 | GO:0016832 | aldehyde-lyase activity(GO:0016832) |
| 0.0 | 0.1 | GO:0015181 | arginine transmembrane transporter activity(GO:0015181) L-lysine transmembrane transporter activity(GO:0015189) |
| 0.0 | 0.1 | GO:0017176 | phosphatidylinositol N-acetylglucosaminyltransferase activity(GO:0017176) |
| 0.0 | 0.2 | GO:0070990 | snRNP binding(GO:0070990) |
| 0.0 | 0.1 | GO:0005131 | growth hormone receptor binding(GO:0005131) |
| 0.0 | 0.3 | GO:0070577 | lysine-acetylated histone binding(GO:0070577) |
| 0.0 | 0.1 | GO:0035671 | enone reductase activity(GO:0035671) |
| 0.0 | 0.2 | GO:0018634 | 3-(3-hydroxyphenyl)propionate hydroxylase activity(GO:0008688) 4-chlorobenzaldehyde oxidase activity(GO:0018471) 3,5-xylenol methylhydroxylase activity(GO:0018630) phenylacetate hydroxylase activity(GO:0018631) 4-nitrophenol 4-monooxygenase activity(GO:0018632) dimethyl sulfide monooxygenase activity(GO:0018633) alpha-pinene monooxygenase [NADH] activity(GO:0018634) 1-hydroxy-2-naphthoate hydroxylase activity(GO:0018637) toluene 4-monooxygenase activity(GO:0018638) xylene monooxygenase activity(GO:0018639) dibenzothiophene monooxygenase activity(GO:0018640) 6-hydroxy-3-methyl-2-oxo-1,2-dihydroquinoline 6-monooxygenase activity(GO:0018641) chlorophenol 4-monooxygenase activity(GO:0018642) carbon disulfide oxygenase activity(GO:0018643) toluene 2-monooxygenase activity(GO:0018644) 1-hydroxy-2-oxolimonene 1,2-monooxygenase activity(GO:0018646) phenanthrene 1,2-monooxygenase activity(GO:0018647) tetrahydrofuran hydroxylase activity(GO:0018649) styrene monooxygenase activity(GO:0018650) toluene-4-sulfonate monooxygenase activity(GO:0018651) toluene-sulfonate methyl-monooxygenase activity(GO:0018652) 3-methyl-2-oxo-1,2-dihydroquinoline 6-monooxygenase activity(GO:0018653) 2-hydroxy-phenylacetate hydroxylase activity(GO:0018654) 2-oxo-delta3-4,5,5-trimethylcyclopentenylacetyl-CoA 1,2-monooxygenase activity(GO:0018655) phenanthrene 3,4-monooxygenase activity(GO:0018656) toluene 3-monooxygenase activity(GO:0018657) 4-hydroxyphenylacetate,NADH:oxygen oxidoreductase (3-hydroxylating) activity(GO:0018660) limonene monooxygenase activity(GO:0019113) 2-methylnaphthalene hydroxylase activity(GO:0034526) 1-methylnaphthalene hydroxylase activity(GO:0034534) bisphenol A hydroxylase A activity(GO:0034560) salicylate 5-hydroxylase activity(GO:0034785) isobutylamine N-hydroxylase activity(GO:0034791) branched-chain dodecylbenzene sulfonate monooxygenase activity(GO:0034802) 3-HSA hydroxylase activity(GO:0034819) 4-hydroxypyridine-3-hydroxylase activity(GO:0034894) 2-octaprenyl-3-methyl-6-methoxy-1,4-benzoquinol hydroxylase activity(GO:0043719) 6-hydroxynicotinate 3-monooxygenase activity(GO:0043731) thalianol hydroxylase activity(GO:0080014) |
| 0.0 | 0.1 | GO:0034056 | estrogen response element binding(GO:0034056) |
| 0.0 | 0.1 | GO:0019862 | IgA binding(GO:0019862) |
| 0.0 | 0.7 | GO:0050253 | retinyl-palmitate esterase activity(GO:0050253) |
| 0.0 | 0.1 | GO:0016783 | sulfurtransferase activity(GO:0016783) |
| 0.0 | 0.0 | GO:0008184 | glycogen phosphorylase activity(GO:0008184) |
| 0.0 | 0.1 | GO:0004566 | beta-glucuronidase activity(GO:0004566) |
| 0.0 | 0.1 | GO:0019959 | interleukin-8 binding(GO:0019959) |
| 0.0 | 0.1 | GO:0004994 | somatostatin receptor activity(GO:0004994) |
| 0.0 | 0.2 | GO:0035325 | Toll-like receptor binding(GO:0035325) |
| 0.0 | 0.1 | GO:0004062 | aryl sulfotransferase activity(GO:0004062) |
| 0.0 | 0.2 | GO:0004707 | MAP kinase activity(GO:0004707) |
| 0.0 | 0.0 | GO:0048256 | flap endonuclease activity(GO:0048256) |
| 0.0 | 0.1 | GO:0004908 | interleukin-1 receptor activity(GO:0004908) |
| 0.0 | 0.3 | GO:0017049 | GTP-Rho binding(GO:0017049) |
| 0.0 | 0.1 | GO:0051864 | histone demethylase activity (H3-K36 specific)(GO:0051864) |
| 0.0 | 0.0 | GO:0048408 | epidermal growth factor binding(GO:0048408) |
| 0.0 | 0.1 | GO:0030628 | pre-mRNA 3'-splice site binding(GO:0030628) |
| 0.0 | 0.1 | GO:0003840 | gamma-glutamyltransferase activity(GO:0003840) glutathione hydrolase activity(GO:0036374) |
| 0.0 | 0.1 | GO:0070728 | leucine binding(GO:0070728) |
| 0.0 | 0.6 | GO:0070888 | E-box binding(GO:0070888) |
| 0.0 | 0.1 | GO:0031750 | D3 dopamine receptor binding(GO:0031750) |
| 0.0 | 0.1 | GO:0015173 | aromatic amino acid transmembrane transporter activity(GO:0015173) |
| 0.0 | 0.0 | GO:0030229 | very-low-density lipoprotein particle receptor activity(GO:0030229) |
| 0.0 | 0.1 | GO:0004090 | carbonyl reductase (NADPH) activity(GO:0004090) |
| 0.0 | 0.1 | GO:0003873 | 6-phosphofructo-2-kinase activity(GO:0003873) |
| 0.0 | 0.1 | GO:0019145 | aminobutyraldehyde dehydrogenase activity(GO:0019145) 4-trimethylammoniobutyraldehyde dehydrogenase activity(GO:0047105) |
| 0.0 | 0.2 | GO:0070300 | phosphatidic acid binding(GO:0070300) |
| 0.0 | 0.2 | GO:0019869 | chloride channel inhibitor activity(GO:0019869) |
| 0.0 | 0.1 | GO:0046974 | histone methyltransferase activity (H3-K9 specific)(GO:0046974) |
| 0.0 | 0.1 | GO:0004969 | histamine receptor activity(GO:0004969) |
| 0.0 | 0.1 | GO:0035514 | DNA demethylase activity(GO:0035514) |
| 0.0 | 0.1 | GO:0042577 | lipid phosphatase activity(GO:0042577) |
| 0.0 | 0.3 | GO:0005112 | Notch binding(GO:0005112) |
| 0.0 | 0.1 | GO:0031779 | melanocortin receptor binding(GO:0031779) type 3 melanocortin receptor binding(GO:0031781) type 4 melanocortin receptor binding(GO:0031782) |
| 0.0 | 0.0 | GO:0060229 | lipase activator activity(GO:0060229) |
| 0.0 | 0.1 | GO:0015562 | efflux transmembrane transporter activity(GO:0015562) |
| 0.0 | 0.1 | GO:0046624 | sphingolipid transporter activity(GO:0046624) |
| 0.0 | 0.4 | GO:0004198 | calcium-dependent cysteine-type endopeptidase activity(GO:0004198) |
| 0.0 | 0.1 | GO:0070097 | delta-catenin binding(GO:0070097) |
| 0.0 | 0.0 | GO:0004699 | calcium-independent protein kinase C activity(GO:0004699) |
| 0.0 | 0.1 | GO:0003918 | DNA topoisomerase type II (ATP-hydrolyzing) activity(GO:0003918) DNA topoisomerase II activity(GO:0061505) |
| 0.0 | 0.1 | GO:0000340 | RNA 7-methylguanosine cap binding(GO:0000340) |
| 0.0 | 0.0 | GO:0050816 | phosphothreonine binding(GO:0050816) |
| 0.0 | 0.3 | GO:0009931 | calcium-dependent protein serine/threonine kinase activity(GO:0009931) |
| 0.0 | 0.2 | GO:0043996 | histone acetyltransferase activity (H4-K5 specific)(GO:0043995) histone acetyltransferase activity (H4-K8 specific)(GO:0043996) histone acetyltransferase activity (H4-K16 specific)(GO:0046972) |
| 0.0 | 0.0 | GO:0031686 | A1 adenosine receptor binding(GO:0031686) |
| 0.0 | 0.1 | GO:0047045 | testosterone 17-beta-dehydrogenase (NADP+) activity(GO:0047045) |
| 0.0 | 0.2 | GO:0004708 | MAP kinase kinase activity(GO:0004708) |
| 0.0 | 0.1 | GO:0070326 | very-low-density lipoprotein particle receptor binding(GO:0070326) |
| 0.0 | 0.3 | GO:0000993 | RNA polymerase II core binding(GO:0000993) |
| 0.0 | 0.0 | GO:0070137 | ubiquitin-like protein-specific endopeptidase activity(GO:0070137) SUMO-specific endopeptidase activity(GO:0070139) |
| 0.0 | 0.1 | GO:0033192 | calmodulin-dependent protein phosphatase activity(GO:0033192) |
| 0.0 | 0.1 | GO:0051011 | microtubule minus-end binding(GO:0051011) |
| 0.0 | 0.5 | GO:0052770 | coenzyme F390-A hydrolase activity(GO:0052770) coenzyme F390-G hydrolase activity(GO:0052771) |
| 0.0 | 0.4 | GO:0001103 | RNA polymerase II repressing transcription factor binding(GO:0001103) |
| 0.0 | 0.1 | GO:0004579 | dolichyl-diphosphooligosaccharide-protein glycotransferase activity(GO:0004579) |
| 0.0 | 0.1 | GO:0051022 | Rho GDP-dissociation inhibitor binding(GO:0051022) |
| 0.0 | 0.1 | GO:0003923 | GPI-anchor transamidase activity(GO:0003923) |
| 0.0 | 0.0 | GO:0035877 | death effector domain binding(GO:0035877) |
| 0.0 | 0.0 | GO:2001069 | glycogen binding(GO:2001069) |
| 0.0 | 0.2 | GO:0045236 | CXCR chemokine receptor binding(GO:0045236) |
| 0.0 | 0.1 | GO:0004571 | mannosyl-oligosaccharide 1,2-alpha-mannosidase activity(GO:0004571) |
| 0.0 | 0.1 | GO:0032454 | histone demethylase activity (H3-K9 specific)(GO:0032454) |
| 0.0 | 0.0 | GO:0016842 | amidine-lyase activity(GO:0016842) |
| 0.0 | 0.2 | GO:0015279 | store-operated calcium channel activity(GO:0015279) |
| 0.0 | 0.1 | GO:0032051 | clathrin light chain binding(GO:0032051) |
| 0.0 | 0.0 | GO:0097109 | neuroligin family protein binding(GO:0097109) |
| 0.0 | 0.0 | GO:0008142 | oxysterol binding(GO:0008142) |
| 0.0 | 0.2 | GO:0017154 | semaphorin receptor activity(GO:0017154) |
| 0.0 | 0.1 | GO:0008190 | eukaryotic initiation factor 4E binding(GO:0008190) |
| 0.0 | 0.0 | GO:0047023 | androsterone dehydrogenase activity(GO:0047023) |
| 0.0 | 0.5 | GO:0017046 | peptide hormone binding(GO:0017046) |
| 0.0 | 0.0 | GO:0015087 | cobalt ion transmembrane transporter activity(GO:0015087) |
| 0.0 | 0.2 | GO:0016290 | palmitoyl-CoA hydrolase activity(GO:0016290) |
| 0.0 | 0.0 | GO:1901612 | cardiolipin binding(GO:1901612) |
| 0.0 | 0.0 | GO:0097016 | L27 domain binding(GO:0097016) |
| 0.0 | 0.1 | GO:0016723 | oxidoreductase activity, oxidizing metal ions, NAD or NADP as acceptor(GO:0016723) |
| 0.0 | 0.1 | GO:0043515 | kinetochore binding(GO:0043515) |
| 0.0 | 0.1 | GO:0086007 | voltage-gated calcium channel activity involved in cardiac muscle cell action potential(GO:0086007) |
| 0.0 | 0.0 | GO:0005146 | leukemia inhibitory factor receptor binding(GO:0005146) |
| 0.0 | 0.0 | GO:0051425 | PTB domain binding(GO:0051425) |
| 0.0 | 0.0 | GO:0042296 | ISG15 transferase activity(GO:0042296) |
| 0.0 | 0.1 | GO:0000014 | single-stranded DNA endodeoxyribonuclease activity(GO:0000014) |
| 0.0 | 0.2 | GO:0004435 | phosphatidylinositol phospholipase C activity(GO:0004435) |
| 0.0 | 0.0 | GO:0004800 | thyroxine 5'-deiodinase activity(GO:0004800) |
| 0.0 | 0.1 | GO:0055131 | C3HC4-type RING finger domain binding(GO:0055131) |
| 0.0 | 0.1 | GO:0004861 | cyclin-dependent protein serine/threonine kinase inhibitor activity(GO:0004861) |
| 0.0 | 0.3 | GO:0043014 | alpha-tubulin binding(GO:0043014) |
| 0.0 | 0.1 | GO:0070053 | thrombospondin receptor activity(GO:0070053) |
| 0.0 | 0.1 | GO:0046923 | ER retention sequence binding(GO:0046923) |
| 0.0 | 0.1 | GO:0036122 | BMP binding(GO:0036122) |
| 0.0 | 0.2 | GO:0005545 | 1-phosphatidylinositol binding(GO:0005545) |
| 0.0 | 0.0 | GO:0015111 | iodide transmembrane transporter activity(GO:0015111) |
| 0.0 | 0.0 | GO:1901567 | icosanoid binding(GO:0050542) arachidonic acid binding(GO:0050544) fatty acid derivative binding(GO:1901567) |
| 0.0 | 0.1 | GO:0050733 | RS domain binding(GO:0050733) |
| 0.0 | 0.1 | GO:0048407 | platelet-derived growth factor binding(GO:0048407) |
| 0.0 | 0.6 | GO:0000049 | tRNA binding(GO:0000049) |
| 0.0 | 0.1 | GO:0044323 | retinoic acid-responsive element binding(GO:0044323) |
| 0.0 | 0.4 | GO:0031593 | polyubiquitin binding(GO:0031593) |
| 0.0 | 0.2 | GO:0005527 | macrolide binding(GO:0005527) FK506 binding(GO:0005528) |
| 0.0 | 0.1 | GO:0070324 | thyroid hormone binding(GO:0070324) |
| 0.0 | 0.0 | GO:0000104 | succinate dehydrogenase activity(GO:0000104) |
| 0.0 | 0.0 | GO:0032190 | acrosin binding(GO:0032190) |
| 0.0 | 0.0 | GO:0017034 | Rap guanyl-nucleotide exchange factor activity(GO:0017034) |
| 0.0 | 0.2 | GO:0016709 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, NAD(P)H as one donor, and incorporation of one atom of oxygen(GO:0016709) |
| 0.0 | 0.2 | GO:0008242 | omega peptidase activity(GO:0008242) |
| 0.0 | 0.0 | GO:0015141 | succinate transmembrane transporter activity(GO:0015141) |
| 0.0 | 0.0 | GO:0003976 | UDP-N-acetylglucosamine-lysosomal-enzyme N-acetylglucosaminephosphotransferase activity(GO:0003976) |
| 0.0 | 0.0 | GO:0033829 | O-fucosylpeptide 3-beta-N-acetylglucosaminyltransferase activity(GO:0033829) |
| 0.0 | 0.0 | GO:0016015 | morphogen activity(GO:0016015) |
| 0.0 | 0.2 | GO:0008553 | hydrogen-exporting ATPase activity, phosphorylative mechanism(GO:0008553) |
| 0.0 | 0.0 | GO:0005220 | inositol 1,4,5-trisphosphate-sensitive calcium-release channel activity(GO:0005220) |
| 0.0 | 0.0 | GO:0008532 | N-acetyllactosaminide beta-1,3-N-acetylglucosaminyltransferase activity(GO:0008532) |
| 0.0 | 0.0 | GO:0034618 | arginine binding(GO:0034618) |
| 0.0 | 0.0 | GO:0005275 | amine transmembrane transporter activity(GO:0005275) |
| 0.0 | 0.2 | GO:0016594 | glycine binding(GO:0016594) |
| 0.0 | 0.3 | GO:0005484 | SNAP receptor activity(GO:0005484) |
| 0.0 | 0.2 | GO:0016790 | thiolester hydrolase activity(GO:0016790) |
| 0.0 | 0.2 | GO:0015095 | magnesium ion transmembrane transporter activity(GO:0015095) |
| 0.0 | 0.2 | GO:0008200 | ion channel inhibitor activity(GO:0008200) |
| 0.0 | 0.1 | GO:0047555 | 3',5'-cyclic-GMP phosphodiesterase activity(GO:0047555) |
| 0.0 | 0.1 | GO:0017040 | ceramidase activity(GO:0017040) |
| 0.0 | 0.0 | GO:0030350 | iron-responsive element binding(GO:0030350) |
| 0.0 | 0.2 | GO:0030332 | cyclin binding(GO:0030332) |
| 0.0 | 0.2 | GO:0030552 | cAMP binding(GO:0030552) |
| 0.0 | 0.1 | GO:0004985 | opioid receptor activity(GO:0004985) |
| 0.0 | 0.0 | GO:0004723 | calcium-dependent protein serine/threonine phosphatase activity(GO:0004723) |
| 0.0 | 0.1 | GO:0048038 | quinone binding(GO:0048038) |
| 0.0 | 0.1 | GO:0004535 | poly(A)-specific ribonuclease activity(GO:0004535) |
| 0.0 | 0.1 | GO:0043522 | leucine zipper domain binding(GO:0043522) |
| 0.0 | 0.0 | GO:0000774 | adenyl-nucleotide exchange factor activity(GO:0000774) |
| 0.0 | 0.2 | GO:0015301 | anion:anion antiporter activity(GO:0015301) |
| 0.0 | 0.0 | GO:0004656 | procollagen-proline 4-dioxygenase activity(GO:0004656) |
| 0.0 | 0.1 | GO:0046790 | virion binding(GO:0046790) |
| 0.0 | 0.0 | GO:0032767 | copper-dependent protein binding(GO:0032767) |
| 0.0 | 0.3 | GO:0015485 | cholesterol binding(GO:0015485) |
| 0.0 | 0.1 | GO:0016713 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, reduced iron-sulfur protein as one donor, and incorporation of one atom of oxygen(GO:0016713) |
| 0.0 | 0.0 | GO:0005094 | Rho GDP-dissociation inhibitor activity(GO:0005094) |
| 0.0 | 0.1 | GO:0031404 | chloride ion binding(GO:0031404) |
| 0.0 | 0.0 | GO:0019976 | interleukin-2 binding(GO:0019976) |
| 0.0 | 0.0 | GO:0004938 | alpha2-adrenergic receptor activity(GO:0004938) |
| 0.0 | 0.1 | GO:0046912 | transferase activity, transferring acyl groups, acyl groups converted into alkyl on transfer(GO:0046912) |
| 0.0 | 0.1 | GO:0071933 | Arp2/3 complex binding(GO:0071933) |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.1 | 2.0 | PID RXR VDR PATHWAY | RXR and RAR heterodimerization with other nuclear receptor |
| 0.0 | 0.0 | PID BETA CATENIN DEG PATHWAY | Degradation of beta catenin |
| 0.0 | 0.7 | PID ECADHERIN KERATINOCYTE PATHWAY | E-cadherin signaling in keratinocytes |
| 0.0 | 0.9 | PID TOLL ENDOGENOUS PATHWAY | Endogenous TLR signaling |
| 0.0 | 0.3 | PID AR NONGENOMIC PATHWAY | Nongenotropic Androgen signaling |
| 0.0 | 0.4 | PID ERB GENOMIC PATHWAY | Validated nuclear estrogen receptor beta network |
| 0.0 | 1.1 | PID AJDISS 2PATHWAY | Posttranslational regulation of adherens junction stability and dissassembly |
| 0.0 | 0.3 | PID SYNDECAN 3 PATHWAY | Syndecan-3-mediated signaling events |
| 0.0 | 0.2 | SA G2 AND M PHASES | Cdc25 activates the cdc2/cyclin B complex to induce the G2/M transition. |
| 0.0 | 0.7 | PID RET PATHWAY | Signaling events regulated by Ret tyrosine kinase |
| 0.0 | 0.9 | PID HEDGEHOG GLI PATHWAY | Hedgehog signaling events mediated by Gli proteins |
| 0.0 | 0.4 | PID P38 MK2 PATHWAY | p38 signaling mediated by MAPKAP kinases |
| 0.0 | 0.3 | ST P38 MAPK PATHWAY | p38 MAPK Pathway |
| 0.0 | 0.3 | ST INTERLEUKIN 4 PATHWAY | Interleukin 4 (IL-4) Pathway |
| 0.0 | 0.4 | PID HEDGEHOG 2PATHWAY | Signaling events mediated by the Hedgehog family |
| 0.0 | 0.3 | PID PRL SIGNALING EVENTS PATHWAY | Signaling events mediated by PRL |
| 0.0 | 0.3 | PID CD40 PATHWAY | CD40/CD40L signaling |
| 0.0 | 0.3 | PID MAPK TRK PATHWAY | Trk receptor signaling mediated by the MAPK pathway |
| 0.0 | 0.1 | PID ARF6 DOWNSTREAM PATHWAY | Arf6 downstream pathway |
| 0.0 | 0.2 | NABA COLLAGENS | Genes encoding collagen proteins |
| 0.0 | 0.5 | PID ERBB4 PATHWAY | ErbB4 signaling events |
| 0.0 | 1.0 | PID P73PATHWAY | p73 transcription factor network |
| 0.0 | 0.6 | ST JNK MAPK PATHWAY | JNK MAPK Pathway |
| 0.0 | 0.2 | SA B CELL RECEPTOR COMPLEXES | Antigen binding to B cell receptors activates protein tyrosine kinases, such as the Src family, which ultimate activate MAP kinases. |
| 0.0 | 0.6 | PID HES HEY PATHWAY | Notch-mediated HES/HEY network |
| 0.0 | 0.1 | PID UPA UPAR PATHWAY | Urokinase-type plasminogen activator (uPA) and uPAR-mediated signaling |
| 0.0 | 0.4 | PID P53 REGULATION PATHWAY | p53 pathway |
| 0.0 | 0.4 | PID FOXM1 PATHWAY | FOXM1 transcription factor network |
| 0.0 | 0.1 | PID AVB3 INTEGRIN PATHWAY | Integrins in angiogenesis |
| 0.0 | 0.2 | PID ERBB1 INTERNALIZATION PATHWAY | Internalization of ErbB1 |
| 0.0 | 0.1 | PID VEGF VEGFR PATHWAY | VEGF and VEGFR signaling network |
| 0.0 | 0.1 | PID TCPTP PATHWAY | Signaling events mediated by TCPTP |
| 0.0 | 0.2 | PID AURORA A PATHWAY | Aurora A signaling |
| 0.0 | 0.0 | PID IL8 CXCR1 PATHWAY | IL8- and CXCR1-mediated signaling events |
| 0.0 | 0.1 | PID HIV NEF PATHWAY | HIV-1 Nef: Negative effector of Fas and TNF-alpha |
| 0.0 | 0.1 | PID TCR JNK PATHWAY | JNK signaling in the CD4+ TCR pathway |
| 0.0 | 0.0 | PID WNT NONCANONICAL PATHWAY | Noncanonical Wnt signaling pathway |
| 0.0 | 0.3 | PID PTP1B PATHWAY | Signaling events mediated by PTP1B |
| 0.0 | 0.2 | PID BARD1 PATHWAY | BARD1 signaling events |
| 0.0 | 0.2 | PID IL2 1PATHWAY | IL2-mediated signaling events |
| 0.0 | 0.3 | PID ILK PATHWAY | Integrin-linked kinase signaling |
| 0.0 | 0.0 | PID S1P S1P4 PATHWAY | S1P4 pathway |
| 0.0 | 0.0 | ST GA13 PATHWAY | G alpha 13 Pathway |
| 0.0 | 0.1 | PID IL1 PATHWAY | IL1-mediated signaling events |
| Log-likelihood per target | Total log-likelihood | Term | Description |
|---|---|---|---|
| 0.1 | 1.0 | REACTOME ADVANCED GLYCOSYLATION ENDPRODUCT RECEPTOR SIGNALING | Genes involved in Advanced glycosylation endproduct receptor signaling |
| 0.1 | 1.0 | REACTOME ANTIGEN PRESENTATION FOLDING ASSEMBLY AND PEPTIDE LOADING OF CLASS I MHC | Genes involved in Antigen Presentation: Folding, assembly and peptide loading of class I MHC |
| 0.1 | 1.1 | REACTOME FATTY ACYL COA BIOSYNTHESIS | Genes involved in Fatty Acyl-CoA Biosynthesis |
| 0.0 | 0.5 | REACTOME PYRIMIDINE CATABOLISM | Genes involved in Pyrimidine catabolism |
| 0.0 | 0.9 | REACTOME YAP1 AND WWTR1 TAZ STIMULATED GENE EXPRESSION | Genes involved in YAP1- and WWTR1 (TAZ)-stimulated gene expression |
| 0.0 | 1.1 | REACTOME REGULATION OF BETA CELL DEVELOPMENT | Genes involved in Regulation of beta-cell development |
| 0.0 | 0.1 | REACTOME REGULATION OF RHEB GTPASE ACTIVITY BY AMPK | Genes involved in Regulation of Rheb GTPase activity by AMPK |
| 0.0 | 0.3 | REACTOME RECYCLING OF BILE ACIDS AND SALTS | Genes involved in Recycling of bile acids and salts |
| 0.0 | 0.3 | REACTOME PROLACTIN RECEPTOR SIGNALING | Genes involved in Prolactin receptor signaling |
| 0.0 | 0.3 | REACTOME RECRUITMENT OF NUMA TO MITOTIC CENTROSOMES | Genes involved in Recruitment of NuMA to mitotic centrosomes |
| 0.0 | 0.8 | REACTOME MYOGENESIS | Genes involved in Myogenesis |
| 0.0 | 0.4 | REACTOME ACTIVATION OF RAC | Genes involved in Activation of Rac |
| 0.0 | 0.2 | REACTOME ALPHA LINOLENIC ACID ALA METABOLISM | Genes involved in alpha-linolenic acid (ALA) metabolism |
| 0.0 | 0.1 | REACTOME SHC1 EVENTS IN ERBB4 SIGNALING | Genes involved in SHC1 events in ERBB4 signaling |
| 0.0 | 0.5 | REACTOME SIGNALING BY CONSTITUTIVELY ACTIVE EGFR | Genes involved in Signaling by constitutively active EGFR |
| 0.0 | 0.3 | REACTOME PASSIVE TRANSPORT BY AQUAPORINS | Genes involved in Passive Transport by Aquaporins |
| 0.0 | 0.3 | REACTOME RORA ACTIVATES CIRCADIAN EXPRESSION | Genes involved in RORA Activates Circadian Expression |
| 0.0 | 0.3 | REACTOME MRNA DECAY BY 5 TO 3 EXORIBONUCLEASE | Genes involved in mRNA Decay by 5' to 3' Exoribonuclease |
| 0.0 | 0.2 | REACTOME ANDROGEN BIOSYNTHESIS | Genes involved in Androgen biosynthesis |
| 0.0 | 0.3 | REACTOME HDL MEDIATED LIPID TRANSPORT | Genes involved in HDL-mediated lipid transport |
| 0.0 | 0.2 | REACTOME REGULATION OF COMPLEMENT CASCADE | Genes involved in Regulation of Complement cascade |
| 0.0 | 0.1 | REACTOME ACTIVATED TAK1 MEDIATES P38 MAPK ACTIVATION | Genes involved in activated TAK1 mediates p38 MAPK activation |
| 0.0 | 0.4 | REACTOME NUCLEAR SIGNALING BY ERBB4 | Genes involved in Nuclear signaling by ERBB4 |
| 0.0 | 0.9 | REACTOME ER PHAGOSOME PATHWAY | Genes involved in ER-Phagosome pathway |
| 0.0 | 0.4 | REACTOME HS GAG DEGRADATION | Genes involved in HS-GAG degradation |
| 0.0 | 0.4 | REACTOME SYNTHESIS OF PC | Genes involved in Synthesis of PC |
| 0.0 | 0.1 | REACTOME ETHANOL OXIDATION | Genes involved in Ethanol oxidation |
| 0.0 | 0.2 | REACTOME TGF BETA RECEPTOR SIGNALING IN EMT EPITHELIAL TO MESENCHYMAL TRANSITION | Genes involved in TGF-beta receptor signaling in EMT (epithelial to mesenchymal transition) |
| 0.0 | 1.2 | REACTOME RESPIRATORY ELECTRON TRANSPORT | Genes involved in Respiratory electron transport |
| 0.0 | 0.1 | REACTOME APOPTOSIS INDUCED DNA FRAGMENTATION | Genes involved in Apoptosis induced DNA fragmentation |
| 0.0 | 0.3 | REACTOME RAP1 SIGNALLING | Genes involved in Rap1 signalling |
| 0.0 | 0.2 | REACTOME ERKS ARE INACTIVATED | Genes involved in ERKs are inactivated |
| 0.0 | 0.2 | REACTOME CELL EXTRACELLULAR MATRIX INTERACTIONS | Genes involved in Cell-extracellular matrix interactions |
| 0.0 | 0.1 | REACTOME NFKB IS ACTIVATED AND SIGNALS SURVIVAL | Genes involved in NF-kB is activated and signals survival |
| 0.0 | 0.0 | REACTOME P75NTR SIGNALS VIA NFKB | Genes involved in p75NTR signals via NF-kB |
| 0.0 | 0.2 | REACTOME BILE SALT AND ORGANIC ANION SLC TRANSPORTERS | Genes involved in Bile salt and organic anion SLC transporters |
| 0.0 | 0.0 | REACTOME SOS MEDIATED SIGNALLING | Genes involved in SOS-mediated signalling |
| 0.0 | 0.3 | REACTOME ACTIVATED AMPK STIMULATES FATTY ACID OXIDATION IN MUSCLE | Genes involved in Activated AMPK stimulates fatty-acid oxidation in muscle |
| 0.0 | 0.1 | REACTOME NOD1 2 SIGNALING PATHWAY | Genes involved in NOD1/2 Signaling Pathway |
| 0.0 | 0.1 | REACTOME TRAF6 MEDIATED IRF7 ACTIVATION IN TLR7 8 OR 9 SIGNALING | Genes involved in TRAF6 mediated IRF7 activation in TLR7/8 or 9 signaling |
| 0.0 | 0.2 | REACTOME PROCESSING OF INTRONLESS PRE MRNAS | Genes involved in Processing of Intronless Pre-mRNAs |
| 0.0 | 0.2 | REACTOME BMAL1 CLOCK NPAS2 ACTIVATES CIRCADIAN EXPRESSION | Genes involved in BMAL1:CLOCK/NPAS2 Activates Circadian Expression |
| 0.0 | 0.2 | REACTOME CYTOSOLIC SULFONATION OF SMALL MOLECULES | Genes involved in Cytosolic sulfonation of small molecules |
| 0.0 | 0.3 | REACTOME INTERACTION BETWEEN L1 AND ANKYRINS | Genes involved in Interaction between L1 and Ankyrins |
| 0.0 | 0.0 | REACTOME POST NMDA RECEPTOR ACTIVATION EVENTS | Genes involved in Post NMDA receptor activation events |
| 0.0 | 0.1 | REACTOME DIGESTION OF DIETARY CARBOHYDRATE | Genes involved in Digestion of dietary carbohydrate |
| 0.0 | 0.4 | REACTOME SPHINGOLIPID DE NOVO BIOSYNTHESIS | Genes involved in Sphingolipid de novo biosynthesis |
| 0.0 | 0.1 | REACTOME MEMBRANE BINDING AND TARGETTING OF GAG PROTEINS | Genes involved in Membrane binding and targetting of GAG proteins |
| 0.0 | 0.0 | REACTOME LAGGING STRAND SYNTHESIS | Genes involved in Lagging Strand Synthesis |
| 0.0 | 0.1 | REACTOME RNA POL III TRANSCRIPTION INITIATION FROM TYPE 2 PROMOTER | Genes involved in RNA Polymerase III Transcription Initiation From Type 2 Promoter |
| 0.0 | 0.0 | REACTOME GRB2 EVENTS IN ERBB2 SIGNALING | Genes involved in GRB2 events in ERBB2 signaling |
| 0.0 | 0.1 | REACTOME ELEVATION OF CYTOSOLIC CA2 LEVELS | Genes involved in Elevation of cytosolic Ca2+ levels |
| 0.0 | 0.2 | REACTOME FORMATION OF INCISION COMPLEX IN GG NER | Genes involved in Formation of incision complex in GG-NER |
| 0.0 | 0.8 | REACTOME CLASS B 2 SECRETIN FAMILY RECEPTORS | Genes involved in Class B/2 (Secretin family receptors) |
| 0.0 | 0.1 | REACTOME CIRCADIAN CLOCK | Genes involved in Circadian Clock |
| 0.0 | 0.0 | REACTOME PRE NOTCH TRANSCRIPTION AND TRANSLATION | Genes involved in Pre-NOTCH Transcription and Translation |
| 0.0 | 1.7 | REACTOME METABOLISM OF AMINO ACIDS AND DERIVATIVES | Genes involved in Metabolism of amino acids and derivatives |
| 0.0 | 0.2 | REACTOME ENDOSOMAL SORTING COMPLEX REQUIRED FOR TRANSPORT ESCRT | Genes involved in Endosomal Sorting Complex Required For Transport (ESCRT) |
| 0.0 | 0.2 | REACTOME SYNTHESIS OF SUBSTRATES IN N GLYCAN BIOSYTHESIS | Genes involved in Synthesis of substrates in N-glycan biosythesis |
| 0.0 | 0.2 | REACTOME DARPP 32 EVENTS | Genes involved in DARPP-32 events |
| 0.0 | 0.2 | REACTOME G BETA GAMMA SIGNALLING THROUGH PLC BETA | Genes involved in G beta:gamma signalling through PLC beta |
| 0.0 | 0.0 | REACTOME VIRAL MESSENGER RNA SYNTHESIS | Genes involved in Viral Messenger RNA Synthesis |
| 0.0 | 0.3 | REACTOME SEMA4D IN SEMAPHORIN SIGNALING | Genes involved in Sema4D in semaphorin signaling |
| 0.0 | 0.1 | REACTOME PLATELET CALCIUM HOMEOSTASIS | Genes involved in Platelet calcium homeostasis |
| 0.0 | 0.2 | REACTOME CHONDROITIN SULFATE BIOSYNTHESIS | Genes involved in Chondroitin sulfate biosynthesis |
| 0.0 | 0.1 | REACTOME REGULATION OF IFNG SIGNALING | Genes involved in Regulation of IFNG signaling |
| 0.0 | 0.1 | REACTOME SIGNAL ATTENUATION | Genes involved in Signal attenuation |
| 0.0 | 0.2 | REACTOME GLYCOLYSIS | Genes involved in Glycolysis |
| 0.0 | 0.1 | REACTOME SIGNAL REGULATORY PROTEIN SIRP FAMILY INTERACTIONS | Genes involved in Signal regulatory protein (SIRP) family interactions |
| 0.0 | 0.0 | REACTOME DOWNREGULATION OF ERBB2 ERBB3 SIGNALING | Genes involved in Downregulation of ERBB2:ERBB3 signaling |
| 0.0 | 0.1 | REACTOME BASE FREE SUGAR PHOSPHATE REMOVAL VIA THE SINGLE NUCLEOTIDE REPLACEMENT PATHWAY | Genes involved in Base-free sugar-phosphate removal via the single-nucleotide replacement pathway |
| 0.0 | 0.1 | REACTOME GAMMA CARBOXYLATION TRANSPORT AND AMINO TERMINAL CLEAVAGE OF PROTEINS | Genes involved in Gamma-carboxylation, transport, and amino-terminal cleavage of proteins |
| 0.0 | 0.0 | REACTOME NEGATIVE REGULATION OF THE PI3K AKT NETWORK | Genes involved in Negative regulation of the PI3K/AKT network |
| 0.0 | 0.3 | REACTOME NRAGE SIGNALS DEATH THROUGH JNK | Genes involved in NRAGE signals death through JNK |