Gene Symbol | Gene ID | Gene Info |
---|---|---|
Gsx1
|
ENSMUSG00000053129.5 | Gsx1 |
Alx1
|
ENSMUSG00000036602.7 | Alx1 |
Mixl1
|
ENSMUSG00000026497.7 | Mixl1 |
Lbx2
|
ENSMUSG00000034968.2 | Lbx2 |
Gene | Promoter | Distance | Association probability | Pearson corr. coef. | P-value | Plot |
---|---|---|---|---|---|---|
Alx1 | chr10_103027380_103027752 | 1061 | 0.511170 | 0.55 | 2.5e-01 | Click! |
Alx1 | chr10_103026972_103027327 | 1478 | 0.400268 | 0.42 | 4.1e-01 | Click! |
Gsx1 | chr5_147186291_147186477 | 2312 | 0.241803 | -0.75 | 8.9e-02 | Click! |
Lbx2 | chr6_83083622_83083783 | 2665 | 0.074011 | -0.77 | 7.4e-02 | Click! |
Lbx2 | chr6_83087242_83087393 | 21 | 0.905371 | -0.33 | 5.2e-01 | Click! |
Mixl1 | chr1_180707928_180708084 | 10972 | 0.115593 | -0.63 | 1.8e-01 | Click! |
Mixl1 | chr1_180707518_180707669 | 10559 | 0.116451 | 0.05 | 9.3e-01 | Click! |
Move your cursor over a bar to see sample name and corresponding Z-value.
Cis Regulatory Element (CRE) | Target Score | Top associated gene | Gene Info | Distance of CRE to TSS | CRE/Gene association probability |
---|---|---|---|---|---|
chr5_125526040_125526191 | 1.44 |
Tmem132b |
transmembrane protein 132B |
5659 |
0.17 |
chr19_44400352_44400581 | 1.09 |
Scd1 |
stearoyl-Coenzyme A desaturase 1 |
6224 |
0.15 |
chr12_51274477_51274668 | 0.84 |
Rps11-ps4 |
ribosomal protein S11, pseudogene 4 |
22915 |
0.22 |
chr16_93333790_93334136 | 0.82 |
1810053B23Rik |
RIKEN cDNA 1810053B23 gene |
19226 |
0.18 |
chr13_115653330_115653690 | 0.82 |
Gm47892 |
predicted gene, 47892 |
65989 |
0.13 |
chr17_64763760_64763987 | 0.78 |
Dreh |
down-regulated in hepatocellular carcinoma |
3238 |
0.25 |
chr9_74885383_74885534 | 0.78 |
Onecut1 |
one cut domain, family member 1 |
18974 |
0.14 |
chr1_67162712_67162908 | 0.74 |
Cps1 |
carbamoyl-phosphate synthetase 1 |
39784 |
0.16 |
chr15_3721208_3721477 | 0.73 |
Gm4823 |
predicted gene 4823 |
25533 |
0.23 |
chr17_46054574_46054727 | 0.70 |
Vegfa |
vascular endothelial growth factor A |
22281 |
0.12 |
chr4_126764112_126764263 | 0.69 |
AU040320 |
expressed sequence AU040320 |
10361 |
0.13 |
chr4_101198122_101198415 | 0.68 |
Gm24468 |
predicted gene, 24468 |
11504 |
0.14 |
chr5_92607049_92607221 | 0.68 |
Stbd1 |
starch binding domain 1 |
4067 |
0.19 |
chr5_86919547_86919811 | 0.68 |
Gm25211 |
predicted gene, 25211 |
3357 |
0.13 |
chr11_16843001_16843162 | 0.67 |
Egfros |
epidermal growth factor receptor, opposite strand |
12379 |
0.2 |
chr11_16761103_16761540 | 0.66 |
Egfr |
epidermal growth factor receptor |
9091 |
0.2 |
chr10_62592617_62592774 | 0.66 |
Ddx21 |
DEAD (Asp-Glu-Ala-Asp) box polypeptide 21 |
1724 |
0.23 |
chr3_130694798_130695032 | 0.65 |
Ostc |
oligosaccharyltransferase complex subunit (non-catalytic) |
1707 |
0.27 |
chr8_93189262_93189430 | 0.65 |
Gm45909 |
predicted gene 45909 |
2012 |
0.24 |
chr15_59002495_59002896 | 0.65 |
4930544F09Rik |
RIKEN cDNA 4930544F09 gene |
18559 |
0.16 |
chr9_80672553_80672726 | 0.64 |
Gm39380 |
predicted gene, 39380 |
37356 |
0.19 |
chr12_104341895_104342090 | 0.64 |
Serpina3k |
serine (or cysteine) peptidase inhibitor, clade A, member 3K |
3506 |
0.14 |
chr3_138282244_138282429 | 0.64 |
Adh1 |
alcohol dehydrogenase 1 (class I) |
4685 |
0.14 |
chr19_55110942_55111169 | 0.64 |
Gpam |
glycerol-3-phosphate acyltransferase, mitochondrial |
7964 |
0.2 |
chr2_18048778_18049088 | 0.64 |
Skida1 |
SKI/DACH domain containing 1 |
98 |
0.94 |
chr8_38604147_38604298 | 0.64 |
Gm40493 |
predicted gene, 40493 |
55541 |
0.14 |
chr9_60982764_60983106 | 0.63 |
Gm5122 |
predicted gene 5122 |
30546 |
0.14 |
chr6_72120521_72121047 | 0.63 |
4933431G14Rik |
RIKEN cDNA 4933431G14 gene |
2156 |
0.2 |
chr10_42230294_42230483 | 0.63 |
Foxo3 |
forkhead box O3 |
27978 |
0.22 |
chr8_110644559_110644860 | 0.61 |
Vac14 |
Vac14 homolog (S. cerevisiae) |
871 |
0.63 |
chr13_4270161_4270342 | 0.61 |
Akr1c12 |
aldo-keto reductase family 1, member C12 |
9182 |
0.15 |
chr1_140421414_140421565 | 0.61 |
Kcnt2 |
potassium channel, subfamily T, member 2 |
21447 |
0.27 |
chr9_122848915_122849207 | 0.61 |
Gm47140 |
predicted gene, 47140 |
643 |
0.55 |
chr15_6442671_6443054 | 0.61 |
C9 |
complement component 9 |
2465 |
0.32 |
chr1_100298746_100298897 | 0.60 |
Gm29667 |
predicted gene 29667 |
16030 |
0.18 |
chr17_81386211_81386362 | 0.60 |
Gm50044 |
predicted gene, 50044 |
15453 |
0.24 |
chr8_93190868_93191185 | 0.59 |
Gm45909 |
predicted gene 45909 |
332 |
0.84 |
chr18_51150358_51150691 | 0.59 |
Prr16 |
proline rich 16 |
32786 |
0.23 |
chr1_162891903_162892071 | 0.59 |
Fmo2 |
flavin containing monooxygenase 2 |
5472 |
0.19 |
chr4_108060521_108060686 | 0.59 |
Scp2 |
sterol carrier protein 2, liver |
10760 |
0.13 |
chr2_72204001_72204398 | 0.58 |
Rapgef4 |
Rap guanine nucleotide exchange factor (GEF) 4 |
5400 |
0.2 |
chr9_122118490_122118656 | 0.58 |
Gm47122 |
predicted gene, 47122 |
572 |
0.49 |
chr11_16814706_16815122 | 0.58 |
Egfros |
epidermal growth factor receptor, opposite strand |
15788 |
0.21 |
chr11_28690043_28690210 | 0.57 |
2810471M01Rik |
RIKEN cDNA 2810471M01 gene |
8562 |
0.19 |
chr7_70481551_70481951 | 0.57 |
Gm7656 |
predicted gene 7656 |
9097 |
0.15 |
chr1_67111462_67111613 | 0.56 |
Cps1 |
carbamoyl-phosphate synthetase 1 |
11489 |
0.23 |
chr6_31260546_31260737 | 0.56 |
2210408F21Rik |
RIKEN cDNA 2210408F21 gene |
17207 |
0.15 |
chr9_24922429_24922589 | 0.56 |
Gm48255 |
predicted gene, 48255 |
30464 |
0.13 |
chr10_69208679_69208830 | 0.56 |
Rhobtb1 |
Rho-related BTB domain containing 1 |
202 |
0.94 |
chr7_67648192_67648343 | 0.55 |
Ttc23 |
tetratricopeptide repeat domain 23 |
807 |
0.52 |
chr5_125516996_125517147 | 0.55 |
Aacs |
acetoacetyl-CoA synthetase |
1828 |
0.29 |
chr13_24360335_24360523 | 0.55 |
Gm11342 |
predicted gene 11342 |
15521 |
0.12 |
chr1_21250942_21251436 | 0.55 |
Gsta3 |
glutathione S-transferase, alpha 3 |
2332 |
0.18 |
chr19_31886956_31887132 | 0.55 |
A1cf |
APOBEC1 complementation factor |
18263 |
0.2 |
chr4_19713524_19713754 | 0.54 |
Wwp1 |
WW domain containing E3 ubiquitin protein ligase 1 |
4646 |
0.23 |
chr1_67227292_67227476 | 0.54 |
Gm15668 |
predicted gene 15668 |
21816 |
0.2 |
chr6_70874912_70875301 | 0.54 |
Eif2ak3 |
eukaryotic translation initiation factor 2 alpha kinase 3 |
3455 |
0.18 |
chr7_65902304_65902456 | 0.54 |
Pcsk6 |
proprotein convertase subtilisin/kexin type 6 |
39948 |
0.14 |
chr8_93176743_93176912 | 0.54 |
Ces1d |
carboxylesterase 1D |
1538 |
0.3 |
chr15_66609811_66609974 | 0.54 |
Phf20l1 |
PHD finger protein 20-like 1 |
4202 |
0.26 |
chr6_29571610_29572022 | 0.53 |
Tnpo3 |
transportin 3 |
297 |
0.87 |
chr10_87870357_87870520 | 0.53 |
Igf1os |
insulin-like growth factor 1, opposite strand |
7057 |
0.21 |
chr9_74328635_74328791 | 0.53 |
Gm24141 |
predicted gene, 24141 |
33897 |
0.17 |
chr2_7569856_7570102 | 0.53 |
Gm28641 |
predicted gene 28641 |
40040 |
0.17 |
chr2_113578462_113578613 | 0.53 |
Gm13964 |
predicted gene 13964 |
74503 |
0.09 |
chr9_74894770_74895613 | 0.52 |
Onecut1 |
one cut domain, family member 1 |
28707 |
0.13 |
chr19_44401346_44401497 | 0.52 |
Scd1 |
stearoyl-Coenzyme A desaturase 1 |
5269 |
0.16 |
chr6_72155996_72156358 | 0.52 |
Gm38832 |
predicted gene, 38832 |
6672 |
0.15 |
chr4_45464623_45464804 | 0.52 |
Shb |
src homology 2 domain-containing transforming protein B |
18089 |
0.15 |
chr2_4895477_4895652 | 0.52 |
Sephs1 |
selenophosphate synthetase 1 |
11180 |
0.15 |
chr3_133759501_133760150 | 0.52 |
Gm6135 |
prediticted gene 6135 |
31679 |
0.18 |
chr19_40153747_40153898 | 0.52 |
Cyp2c70 |
cytochrome P450, family 2, subfamily c, polypeptide 70 |
33464 |
0.13 |
chr9_31210539_31210690 | 0.52 |
Aplp2 |
amyloid beta (A4) precursor-like protein 2 |
1173 |
0.5 |
chr4_97102666_97103047 | 0.52 |
Gm27521 |
predicted gene, 27521 |
185836 |
0.03 |
chr9_74884431_74884582 | 0.51 |
Onecut1 |
one cut domain, family member 1 |
18022 |
0.15 |
chr6_58611375_58611579 | 0.51 |
Abcg2 |
ATP binding cassette subfamily G member 2 (Junior blood group) |
14806 |
0.19 |
chr10_67192820_67193057 | 0.51 |
Jmjd1c |
jumonji domain containing 1C |
7185 |
0.22 |
chr16_18071409_18071560 | 0.51 |
Dgcr6 |
DiGeorge syndrome critical region gene 6 |
2004 |
0.23 |
chr5_123090732_123091094 | 0.51 |
Tmem120b |
transmembrane protein 120B |
8988 |
0.09 |
chr9_46479855_46480133 | 0.50 |
Gm47144 |
predicted gene, 47144 |
25079 |
0.15 |
chr15_3463467_3463618 | 0.50 |
Ghr |
growth hormone receptor |
8102 |
0.29 |
chr3_18163689_18163955 | 0.50 |
Gm23686 |
predicted gene, 23686 |
13803 |
0.23 |
chr9_106264996_106265377 | 0.50 |
Poc1a |
POC1 centriolar protein A |
15875 |
0.1 |
chr12_55440243_55440394 | 0.50 |
Psma6 |
proteasome subunit alpha 6 |
32935 |
0.13 |
chr13_115653702_115653853 | 0.49 |
Gm47892 |
predicted gene, 47892 |
65722 |
0.13 |
chr13_16574847_16575001 | 0.49 |
Gm48497 |
predicted gene, 48497 |
41103 |
0.17 |
chr4_53221393_53221544 | 0.48 |
4930412L05Rik |
RIKEN cDNA 4930412L05 gene |
3611 |
0.22 |
chr9_41328613_41328764 | 0.48 |
Mir100hg |
Mir100 Mirlet7a-2 Mir125b-1 cluster host gene |
78 |
0.97 |
chr12_30334895_30335061 | 0.48 |
Sntg2 |
syntrophin, gamma 2 |
22705 |
0.23 |
chr15_59066617_59066768 | 0.48 |
Mtss1 |
MTSS I-BAR domain containing 1 |
11228 |
0.23 |
chr19_20628055_20628251 | 0.48 |
Aldh1a1 |
aldehyde dehydrogenase family 1, subfamily A1 |
26192 |
0.19 |
chr5_99976807_99976958 | 0.48 |
Hnrnpd |
heterogeneous nuclear ribonucleoprotein D |
331 |
0.73 |
chr17_12941646_12941826 | 0.48 |
Acat3 |
acetyl-Coenzyme A acetyltransferase 3 |
1136 |
0.27 |
chr4_148590620_148590972 | 0.48 |
Srm |
spermidine synthase |
707 |
0.49 |
chr15_38105734_38106027 | 0.47 |
Gm49312 |
predicted gene, 49312 |
26778 |
0.13 |
chr14_21295488_21295639 | 0.47 |
Adk |
adenosine kinase |
22562 |
0.24 |
chr3_18151456_18151607 | 0.47 |
Gm23686 |
predicted gene, 23686 |
26094 |
0.2 |
chr19_40160205_40160356 | 0.47 |
Cyp2c70 |
cytochrome P450, family 2, subfamily c, polypeptide 70 |
27006 |
0.14 |
chr14_46615680_46615835 | 0.46 |
Gm49319 |
predicted gene, 49319 |
4747 |
0.13 |
chr6_52610697_52610915 | 0.46 |
Gm44434 |
predicted gene, 44434 |
7561 |
0.15 |
chr1_67158309_67158556 | 0.46 |
Cps1 |
carbamoyl-phosphate synthetase 1 |
35406 |
0.18 |
chr16_30110807_30110970 | 0.46 |
Gm20040 |
predicted gene, 20040 |
18006 |
0.13 |
chr13_36653443_36653619 | 0.46 |
Gm26395 |
predicted gene, 26395 |
874 |
0.58 |
chr9_9194559_9194710 | 0.46 |
Gm16833 |
predicted gene, 16833 |
41654 |
0.17 |
chr18_75498893_75499229 | 0.45 |
Gm10532 |
predicted gene 10532 |
15584 |
0.25 |
chr3_18164974_18165125 | 0.45 |
Gm23686 |
predicted gene, 23686 |
12576 |
0.23 |
chr18_38370754_38370932 | 0.45 |
Gm4949 |
predicted gene 4949 |
10305 |
0.12 |
chr9_48739787_48740228 | 0.45 |
Zbtb16 |
zinc finger and BTB domain containing 16 |
95938 |
0.07 |
chr9_109966945_109967106 | 0.45 |
Map4 |
microtubule-associated protein 4 |
1992 |
0.21 |
chr2_14596063_14596214 | 0.44 |
Cacnb2 |
calcium channel, voltage-dependent, beta 2 subunit |
6950 |
0.13 |
chr10_4618620_4618773 | 0.44 |
Esr1 |
estrogen receptor 1 (alpha) |
6675 |
0.25 |
chr19_40141682_40141833 | 0.44 |
Cyp2c70 |
cytochrome P450, family 2, subfamily c, polypeptide 70 |
45529 |
0.11 |
chr3_5425056_5425268 | 0.44 |
4930555M17Rik |
RIKEN cDNA 4930555M17 gene |
90171 |
0.09 |
chr16_10675930_10676129 | 0.44 |
Gm15558 |
predicted gene 15558 |
7510 |
0.18 |
chr12_57281727_57281906 | 0.44 |
Mipol1 |
mirror-image polydactyly 1 |
357 |
0.88 |
chr3_105758672_105758857 | 0.44 |
Rap1a |
RAS-related protein 1a |
8436 |
0.11 |
chr7_87371791_87371944 | 0.44 |
Tyr |
tyrosinase |
121525 |
0.05 |
chr10_87932167_87932318 | 0.44 |
Tyms-ps |
thymidylate synthase, pseudogene |
34605 |
0.14 |
chr19_44401904_44402310 | 0.44 |
Scd1 |
stearoyl-Coenzyme A desaturase 1 |
4583 |
0.17 |
chr16_78470224_78470428 | 0.44 |
Gm49603 |
predicted gene, 49603 |
10213 |
0.17 |
chr12_104347486_104347696 | 0.44 |
Serpina3k |
serine (or cysteine) peptidase inhibitor, clade A, member 3K |
9105 |
0.12 |
chr6_119404440_119404707 | 0.44 |
Adipor2 |
adiponectin receptor 2 |
12902 |
0.2 |
chr13_107645708_107645859 | 0.44 |
Gm32090 |
predicted gene, 32090 |
32934 |
0.17 |
chr1_51740463_51740849 | 0.44 |
Gm28055 |
predicted gene 28055 |
6287 |
0.22 |
chr6_66963164_66963414 | 0.43 |
Gm36816 |
predicted gene, 36816 |
45124 |
0.08 |
chr2_73628966_73629117 | 0.43 |
Chn1 |
chimerin 1 |
3301 |
0.21 |
chr6_108836766_108836917 | 0.43 |
Edem1 |
ER degradation enhancer, mannosidase alpha-like 1 |
431 |
0.86 |
chr17_17375909_17376093 | 0.43 |
Riok2 |
RIO kinase 2 |
1411 |
0.29 |
chr11_16854059_16854210 | 0.43 |
Egfros |
epidermal growth factor receptor, opposite strand |
23432 |
0.17 |
chr6_143857220_143857571 | 0.43 |
Sox5 |
SRY (sex determining region Y)-box 5 |
89693 |
0.09 |
chr9_61471858_61472032 | 0.43 |
Gm47240 |
predicted gene, 47240 |
1041 |
0.54 |
chr19_21654390_21654886 | 0.43 |
Abhd17b |
abhydrolase domain containing 17B |
1113 |
0.45 |
chr4_135255267_135255418 | 0.43 |
Clic4 |
chloride intracellular channel 4 (mitochondrial) |
17472 |
0.14 |
chr10_29360156_29360307 | 0.43 |
Rnf146 |
ring finger protein 146 |
1795 |
0.19 |
chr2_34805333_34805900 | 0.43 |
Fbxw2 |
F-box and WD-40 domain protein 2 |
3047 |
0.15 |
chr1_119646750_119646988 | 0.43 |
Epb41l5 |
erythrocyte membrane protein band 4.1 like 5 |
1748 |
0.32 |
chr8_109996628_109997116 | 0.43 |
Tat |
tyrosine aminotransferase |
6366 |
0.13 |
chr9_68889005_68889169 | 0.43 |
Rora |
RAR-related orphan receptor alpha |
233784 |
0.02 |
chr7_115858420_115858571 | 0.43 |
Sox6 |
SRY (sex determining region Y)-box 6 |
1357 |
0.57 |
chr16_56279382_56279563 | 0.42 |
Impg2 |
interphotoreceptor matrix proteoglycan 2 |
9288 |
0.23 |
chr8_45719244_45719451 | 0.42 |
Sorbs2 |
sorbin and SH3 domain containing 2 |
23834 |
0.18 |
chr14_61687453_61687640 | 0.42 |
Gm37820 |
predicted gene, 37820 |
4036 |
0.12 |
chr8_93168995_93169226 | 0.42 |
Ces1d |
carboxylesterase 1D |
865 |
0.51 |
chr19_44395706_44395857 | 0.42 |
Scd1 |
stearoyl-Coenzyme A desaturase 1 |
10909 |
0.14 |
chr8_109803384_109803547 | 0.42 |
Ap1g1 |
adaptor protein complex AP-1, gamma 1 subunit |
24559 |
0.12 |
chr13_16760766_16760929 | 0.42 |
Gm7537 |
predicted gene 7537 |
121357 |
0.06 |
chr9_55277532_55277801 | 0.42 |
Nrg4 |
neuregulin 4 |
5906 |
0.19 |
chr17_62789514_62789722 | 0.41 |
Efna5 |
ephrin A5 |
91526 |
0.1 |
chr13_52979672_52979858 | 0.41 |
Nfil3 |
nuclear factor, interleukin 3, regulated |
1308 |
0.43 |
chr3_104234050_104234212 | 0.41 |
Magi3 |
membrane associated guanylate kinase, WW and PDZ domain containing 3 |
13757 |
0.12 |
chr18_74545000_74545185 | 0.41 |
1700120E14Rik |
RIKEN cDNA 1700120E14 gene |
13968 |
0.23 |
chr19_29285240_29285391 | 0.41 |
Jak2 |
Janus kinase 2 |
32874 |
0.12 |
chr2_34775525_34776380 | 0.41 |
Hspa5 |
heat shock protein 5 |
1105 |
0.4 |
chr1_21315678_21315832 | 0.41 |
Gm21909 |
predicted gene, 21909 |
565 |
0.6 |
chr14_21435070_21435221 | 0.41 |
Gm25864 |
predicted gene, 25864 |
15329 |
0.19 |
chr11_111998446_111998808 | 0.40 |
Gm11679 |
predicted gene 11679 |
44951 |
0.19 |
chr9_74888354_74888522 | 0.40 |
Onecut1 |
one cut domain, family member 1 |
21954 |
0.14 |
chr8_105090981_105091315 | 0.40 |
Ces3b |
carboxylesterase 3B |
2529 |
0.16 |
chr9_43081429_43081580 | 0.40 |
Arhgef12 |
Rho guanine nucleotide exchange factor (GEF) 12 |
23982 |
0.17 |
chr5_150650487_150650670 | 0.40 |
N4bp2l2 |
NEDD4 binding protein 2-like 2 |
2317 |
0.19 |
chr13_119456737_119456888 | 0.40 |
4833420G17Rik |
RIKEN cDNA 4833420G17 gene |
5956 |
0.14 |
chr12_12499785_12499936 | 0.40 |
4921511I17Rik |
RIKEN cDNA 4921511I17 gene |
107245 |
0.07 |
chr17_80022007_80022158 | 0.40 |
Gm22215 |
predicted gene, 22215 |
11432 |
0.14 |
chr18_86383968_86384119 | 0.40 |
Neto1 |
neuropilin (NRP) and tolloid (TLL)-like 1 |
10909 |
0.24 |
chr1_51750897_51751126 | 0.40 |
Gm28055 |
predicted gene 28055 |
4068 |
0.24 |
chr3_69115488_69115663 | 0.40 |
Gm37558 |
predicted gene, 37558 |
7149 |
0.14 |
chr14_21221949_21222133 | 0.40 |
Adk |
adenosine kinase |
96084 |
0.08 |
chr2_15064726_15064962 | 0.40 |
Arl5b |
ADP-ribosylation factor-like 5B |
3295 |
0.18 |
chr10_42271611_42271917 | 0.40 |
Foxo3 |
forkhead box O3 |
4932 |
0.28 |
chr4_104871987_104872184 | 0.40 |
C8a |
complement component 8, alpha polypeptide |
4298 |
0.23 |
chr19_56521472_56521623 | 0.40 |
Dclre1a |
DNA cross-link repair 1A |
15835 |
0.17 |
chr15_3469696_3469847 | 0.40 |
Ghr |
growth hormone receptor |
1873 |
0.48 |
chr9_94016628_94017010 | 0.39 |
Gm5369 |
predicted gene 5369 |
122643 |
0.06 |
chr10_24362567_24362800 | 0.39 |
Gm15271 |
predicted gene 15271 |
84807 |
0.08 |
chr4_3321136_3321319 | 0.39 |
Gm11786 |
predicted gene 11786 |
5948 |
0.22 |
chr7_68285442_68285612 | 0.39 |
Gm16157 |
predicted gene 16157 |
8933 |
0.14 |
chr7_102272304_102272455 | 0.39 |
Stim1 |
stromal interaction molecule 1 |
4052 |
0.16 |
chr6_100267052_100267222 | 0.39 |
Gm44044 |
predicted gene, 44044 |
6561 |
0.17 |
chr11_67897406_67897564 | 0.39 |
Usp43 |
ubiquitin specific peptidase 43 |
20866 |
0.15 |
chr18_53860444_53860644 | 0.39 |
Csnk1g3 |
casein kinase 1, gamma 3 |
1578 |
0.52 |
chr19_34717517_34717702 | 0.39 |
Gm18425 |
predicted gene, 18425 |
7601 |
0.14 |
chr12_73061092_73061267 | 0.39 |
Six1 |
sine oculis-related homeobox 1 |
7292 |
0.2 |
chr10_89502299_89502578 | 0.39 |
Nr1h4 |
nuclear receptor subfamily 1, group H, member 4 |
4211 |
0.26 |
chr13_104044189_104044340 | 0.39 |
Nln |
neurolysin (metallopeptidase M3 family) |
6622 |
0.22 |
chrX_103938334_103938485 | 0.39 |
Gm9166 |
predicted gene 9166 |
11425 |
0.16 |
chr16_11109338_11109489 | 0.39 |
Txndc11 |
thioredoxin domain containing 11 |
13324 |
0.1 |
chr2_42022841_42022992 | 0.39 |
Gm13461 |
predicted gene 13461 |
34087 |
0.23 |
chr13_93305309_93305469 | 0.39 |
Homer1 |
homer scaffolding protein 1 |
111 |
0.95 |
chr12_30200282_30200708 | 0.39 |
Sntg2 |
syntrophin, gamma 2 |
840 |
0.72 |
chr16_43375815_43375981 | 0.39 |
Zbtb20 |
zinc finger and BTB domain containing 20 |
11694 |
0.17 |
chr4_134814659_134814853 | 0.38 |
Maco1 |
macoilin 1 |
3543 |
0.24 |
chr2_31519719_31520357 | 0.38 |
Ass1 |
argininosuccinate synthetase 1 |
1548 |
0.36 |
chr10_89563955_89564134 | 0.38 |
Gm48087 |
predicted gene, 48087 |
8325 |
0.2 |
chr16_42947764_42948084 | 0.38 |
Ndufs5-ps |
NADH:ubiquinone oxidoreductase core subunit S5, pseudogene |
7707 |
0.21 |
chr14_117520982_117521215 | 0.38 |
Mir6239 |
microRNA 6239 |
432749 |
0.01 |
chr15_3495710_3495861 | 0.38 |
Ghr |
growth hormone receptor |
24141 |
0.25 |
chr2_72200523_72200806 | 0.38 |
Rapgef4 |
Rap guanine nucleotide exchange factor (GEF) 4 |
1865 |
0.34 |
chr1_51892345_51892538 | 0.38 |
Myo1b |
myosin IB |
3860 |
0.18 |
chr11_61270260_61270411 | 0.38 |
Aldh3a2 |
aldehyde dehydrogenase family 3, subfamily A2 |
2871 |
0.23 |
chr10_111583801_111583952 | 0.38 |
4933440J02Rik |
RIKEN cDNA 4933440J02 gene |
10397 |
0.16 |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.4 | 1.1 | GO:1903800 | positive regulation of production of miRNAs involved in gene silencing by miRNA(GO:1903800) |
0.3 | 0.9 | GO:0019626 | short-chain fatty acid catabolic process(GO:0019626) |
0.3 | 1.1 | GO:2001013 | epithelial cell proliferation involved in renal tubule morphogenesis(GO:2001013) |
0.3 | 1.0 | GO:0046449 | creatinine metabolic process(GO:0046449) cellular lactam metabolic process(GO:0072338) |
0.3 | 1.6 | GO:0006526 | arginine biosynthetic process(GO:0006526) |
0.2 | 0.6 | GO:2000211 | regulation of glutamate metabolic process(GO:2000211) |
0.2 | 0.6 | GO:0060741 | prostate gland stromal morphogenesis(GO:0060741) |
0.2 | 0.8 | GO:1903964 | monounsaturated fatty acid metabolic process(GO:1903964) monounsaturated fatty acid biosynthetic process(GO:1903966) |
0.2 | 0.5 | GO:0006068 | ethanol catabolic process(GO:0006068) |
0.2 | 0.5 | GO:0006701 | progesterone biosynthetic process(GO:0006701) |
0.2 | 0.6 | GO:0006166 | purine ribonucleoside salvage(GO:0006166) |
0.1 | 0.6 | GO:2000741 | positive regulation of mesenchymal stem cell differentiation(GO:2000741) |
0.1 | 0.1 | GO:0034310 | primary alcohol catabolic process(GO:0034310) |
0.1 | 0.5 | GO:0006987 | activation of signaling protein activity involved in unfolded protein response(GO:0006987) |
0.1 | 0.4 | GO:1904154 | positive regulation of retrograde protein transport, ER to cytosol(GO:1904154) |
0.1 | 0.4 | GO:1901078 | negative regulation of relaxation of muscle(GO:1901078) |
0.1 | 0.3 | GO:0060737 | prostate epithelial cord elongation(GO:0060523) prostate gland morphogenetic growth(GO:0060737) |
0.1 | 0.3 | GO:0030327 | prenylated protein catabolic process(GO:0030327) |
0.1 | 0.3 | GO:1905206 | positive regulation of hydrogen peroxide-mediated programmed cell death(GO:1901300) positive regulation of hydrogen peroxide-induced cell death(GO:1905206) |
0.1 | 1.2 | GO:0009404 | toxin metabolic process(GO:0009404) |
0.1 | 0.2 | GO:0044337 | canonical Wnt signaling pathway involved in positive regulation of apoptotic process(GO:0044337) |
0.1 | 0.3 | GO:0097167 | circadian regulation of translation(GO:0097167) |
0.1 | 0.3 | GO:0035973 | aggrephagy(GO:0035973) |
0.1 | 0.3 | GO:0006982 | response to lipid hydroperoxide(GO:0006982) |
0.1 | 0.1 | GO:0006714 | sesquiterpenoid metabolic process(GO:0006714) |
0.1 | 0.3 | GO:0046104 | thymidine metabolic process(GO:0046104) |
0.1 | 0.1 | GO:0032741 | positive regulation of interleukin-18 production(GO:0032741) |
0.1 | 0.3 | GO:0048696 | regulation of collateral sprouting in absence of injury(GO:0048696) |
0.1 | 0.4 | GO:0006538 | glutamate catabolic process(GO:0006538) |
0.1 | 0.2 | GO:2000809 | positive regulation of synaptic vesicle clustering(GO:2000809) |
0.1 | 0.3 | GO:0016554 | cytidine to uridine editing(GO:0016554) |
0.1 | 0.5 | GO:0033211 | adiponectin-activated signaling pathway(GO:0033211) |
0.1 | 0.3 | GO:0009698 | phenylpropanoid metabolic process(GO:0009698) |
0.1 | 0.2 | GO:1904694 | negative regulation of vascular smooth muscle contraction(GO:1904694) |
0.1 | 0.3 | GO:0003383 | apical constriction(GO:0003383) |
0.1 | 0.2 | GO:0006659 | phosphatidylserine biosynthetic process(GO:0006659) |
0.1 | 0.2 | GO:1900095 | regulation of dosage compensation by inactivation of X chromosome(GO:1900095) |
0.1 | 0.3 | GO:0042524 | negative regulation of tyrosine phosphorylation of Stat5 protein(GO:0042524) |
0.1 | 0.4 | GO:1900103 | positive regulation of endoplasmic reticulum unfolded protein response(GO:1900103) |
0.1 | 0.1 | GO:0021524 | visceral motor neuron differentiation(GO:0021524) |
0.1 | 0.2 | GO:0015014 | heparan sulfate proteoglycan biosynthetic process, polysaccharide chain biosynthetic process(GO:0015014) |
0.1 | 0.2 | GO:1903347 | negative regulation of bicellular tight junction assembly(GO:1903347) |
0.1 | 0.1 | GO:0070103 | regulation of interleukin-6-mediated signaling pathway(GO:0070103) |
0.1 | 0.2 | GO:1900245 | positive regulation of MDA-5 signaling pathway(GO:1900245) |
0.1 | 0.2 | GO:1901509 | regulation of endothelial tube morphogenesis(GO:1901509) |
0.1 | 0.5 | GO:0098908 | regulation of neuronal action potential(GO:0098908) |
0.1 | 0.2 | GO:0070340 | detection of bacterial lipopeptide(GO:0070340) |
0.1 | 0.3 | GO:2000324 | positive regulation of glucocorticoid receptor signaling pathway(GO:2000324) |
0.1 | 0.2 | GO:0051594 | detection of carbohydrate stimulus(GO:0009730) detection of hexose stimulus(GO:0009732) detection of monosaccharide stimulus(GO:0034287) detection of glucose(GO:0051594) |
0.1 | 0.5 | GO:2001256 | regulation of store-operated calcium entry(GO:2001256) |
0.1 | 0.1 | GO:0097680 | double-strand break repair via classical nonhomologous end joining(GO:0097680) |
0.1 | 0.2 | GO:0014835 | myoblast differentiation involved in skeletal muscle regeneration(GO:0014835) |
0.1 | 0.2 | GO:1903071 | positive regulation of ER-associated ubiquitin-dependent protein catabolic process(GO:1903071) |
0.1 | 0.4 | GO:0097105 | presynaptic membrane assembly(GO:0097105) |
0.1 | 0.3 | GO:0008295 | spermidine biosynthetic process(GO:0008295) |
0.1 | 0.2 | GO:0001827 | inner cell mass cell fate commitment(GO:0001827) |
0.1 | 0.3 | GO:1902035 | positive regulation of hematopoietic stem cell proliferation(GO:1902035) |
0.1 | 0.3 | GO:0070562 | regulation of vitamin D receptor signaling pathway(GO:0070562) |
0.1 | 0.1 | GO:2000729 | positive regulation of mesenchymal cell proliferation involved in ureter development(GO:2000729) |
0.1 | 0.1 | GO:1902263 | apoptotic process involved in embryonic digit morphogenesis(GO:1902263) |
0.1 | 0.3 | GO:0030638 | polyketide metabolic process(GO:0030638) aminoglycoside antibiotic metabolic process(GO:0030647) daunorubicin metabolic process(GO:0044597) doxorubicin metabolic process(GO:0044598) |
0.1 | 0.3 | GO:1901525 | negative regulation of macromitophagy(GO:1901525) |
0.1 | 0.4 | GO:0052697 | xenobiotic glucuronidation(GO:0052697) |
0.1 | 0.2 | GO:0006741 | NADP biosynthetic process(GO:0006741) |
0.1 | 0.2 | GO:0048478 | replication fork protection(GO:0048478) |
0.1 | 0.3 | GO:1900086 | regulation of peptidyl-tyrosine autophosphorylation(GO:1900084) positive regulation of peptidyl-tyrosine autophosphorylation(GO:1900086) |
0.1 | 0.2 | GO:0036015 | response to interleukin-3(GO:0036015) cellular response to interleukin-3(GO:0036016) |
0.1 | 0.2 | GO:0006003 | fructose 2,6-bisphosphate metabolic process(GO:0006003) |
0.1 | 0.1 | GO:0060166 | olfactory pit development(GO:0060166) |
0.1 | 0.2 | GO:0060528 | secretory columnal luminar epithelial cell differentiation involved in prostate glandular acinus development(GO:0060528) |
0.1 | 0.3 | GO:0046618 | drug export(GO:0046618) |
0.1 | 0.1 | GO:0002036 | regulation of L-glutamate transport(GO:0002036) |
0.1 | 0.2 | GO:2000017 | positive regulation of determination of dorsal identity(GO:2000017) |
0.1 | 0.2 | GO:0035093 | spermatogenesis, exchange of chromosomal proteins(GO:0035093) |
0.1 | 0.3 | GO:0030718 | germ-line stem cell population maintenance(GO:0030718) |
0.1 | 0.3 | GO:1902222 | L-phenylalanine catabolic process(GO:0006559) erythrose 4-phosphate/phosphoenolpyruvate family amino acid catabolic process(GO:1902222) |
0.1 | 0.2 | GO:2000370 | positive regulation of clathrin-mediated endocytosis(GO:2000370) |
0.1 | 0.2 | GO:1904479 | negative regulation of intestinal absorption(GO:1904479) |
0.1 | 0.6 | GO:0033147 | negative regulation of intracellular estrogen receptor signaling pathway(GO:0033147) |
0.1 | 0.2 | GO:1903232 | melanosome assembly(GO:1903232) |
0.0 | 0.1 | GO:0060748 | tertiary branching involved in mammary gland duct morphogenesis(GO:0060748) |
0.0 | 0.1 | GO:0099558 | maintenance of synapse structure(GO:0099558) |
0.0 | 0.2 | GO:0033353 | S-adenosylmethionine cycle(GO:0033353) |
0.0 | 0.1 | GO:0043490 | malate-aspartate shuttle(GO:0043490) |
0.0 | 0.3 | GO:0015871 | choline transport(GO:0015871) |
0.0 | 0.2 | GO:0089711 | L-glutamate transmembrane transport(GO:0089711) |
0.0 | 0.2 | GO:0071763 | nuclear membrane organization(GO:0071763) |
0.0 | 0.2 | GO:0001997 | positive regulation of the force of heart contraction by epinephrine-norepinephrine(GO:0001997) positive regulation of the force of heart contraction by chemical signal(GO:0003099) |
0.0 | 0.2 | GO:0043415 | positive regulation of skeletal muscle tissue regeneration(GO:0043415) |
0.0 | 0.2 | GO:0090168 | Golgi reassembly(GO:0090168) |
0.0 | 0.1 | GO:0070213 | protein auto-ADP-ribosylation(GO:0070213) |
0.0 | 0.1 | GO:0051684 | maintenance of Golgi location(GO:0051684) |
0.0 | 0.0 | GO:0070094 | positive regulation of glucagon secretion(GO:0070094) |
0.0 | 0.2 | GO:0034755 | iron ion transmembrane transport(GO:0034755) |
0.0 | 0.2 | GO:0010891 | negative regulation of sequestering of triglyceride(GO:0010891) |
0.0 | 0.4 | GO:0000290 | deadenylation-dependent decapping of nuclear-transcribed mRNA(GO:0000290) |
0.0 | 0.1 | GO:0034436 | glycoprotein transport(GO:0034436) |
0.0 | 0.1 | GO:1902915 | negative regulation of protein K63-linked ubiquitination(GO:1900045) negative regulation of protein polyubiquitination(GO:1902915) |
0.0 | 0.3 | GO:0045647 | negative regulation of erythrocyte differentiation(GO:0045647) |
0.0 | 0.0 | GO:0003162 | atrioventricular node development(GO:0003162) |
0.0 | 0.3 | GO:0002072 | optic cup morphogenesis involved in camera-type eye development(GO:0002072) |
0.0 | 0.5 | GO:0009812 | flavonoid metabolic process(GO:0009812) |
0.0 | 0.1 | GO:0070682 | proteasome regulatory particle assembly(GO:0070682) |
0.0 | 0.0 | GO:0006041 | glucosamine metabolic process(GO:0006041) |
0.0 | 0.2 | GO:1902036 | regulation of hematopoietic stem cell differentiation(GO:1902036) |
0.0 | 0.2 | GO:0000480 | endonucleolytic cleavage in 5'-ETS of tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000480) |
0.0 | 0.2 | GO:0006642 | triglyceride mobilization(GO:0006642) |
0.0 | 0.1 | GO:0001831 | trophectodermal cellular morphogenesis(GO:0001831) |
0.0 | 0.1 | GO:0006177 | GMP biosynthetic process(GO:0006177) |
0.0 | 0.1 | GO:1901165 | positive regulation of trophoblast cell migration(GO:1901165) |
0.0 | 0.1 | GO:0036022 | limb joint morphogenesis(GO:0036022) embryonic skeletal limb joint morphogenesis(GO:0036023) |
0.0 | 0.1 | GO:0071930 | negative regulation of transcription involved in G1/S transition of mitotic cell cycle(GO:0071930) |
0.0 | 0.3 | GO:0043651 | linoleic acid metabolic process(GO:0043651) |
0.0 | 0.0 | GO:0060677 | ureteric bud elongation(GO:0060677) |
0.0 | 0.1 | GO:0021553 | olfactory nerve development(GO:0021553) |
0.0 | 0.3 | GO:0055091 | phospholipid homeostasis(GO:0055091) |
0.0 | 0.1 | GO:0007529 | establishment of synaptic specificity at neuromuscular junction(GO:0007529) |
0.0 | 0.3 | GO:0009074 | tryptophan catabolic process(GO:0006569) aromatic amino acid family catabolic process(GO:0009074) tryptophan catabolic process to kynurenine(GO:0019441) indole-containing compound catabolic process(GO:0042436) indolalkylamine catabolic process(GO:0046218) |
0.0 | 0.2 | GO:0090427 | activation of meiosis(GO:0090427) |
0.0 | 0.1 | GO:0006363 | termination of RNA polymerase I transcription(GO:0006363) |
0.0 | 0.2 | GO:0000395 | mRNA 5'-splice site recognition(GO:0000395) |
0.0 | 0.1 | GO:0043201 | response to leucine(GO:0043201) cellular response to leucine(GO:0071233) |
0.0 | 0.2 | GO:0033234 | negative regulation of protein sumoylation(GO:0033234) |
0.0 | 0.2 | GO:0048852 | diencephalon morphogenesis(GO:0048852) |
0.0 | 0.1 | GO:1900194 | negative regulation of oocyte maturation(GO:1900194) |
0.0 | 0.1 | GO:0032488 | Cdc42 protein signal transduction(GO:0032488) |
0.0 | 0.1 | GO:0035860 | glial cell-derived neurotrophic factor receptor signaling pathway(GO:0035860) |
0.0 | 0.1 | GO:0000957 | mitochondrial RNA catabolic process(GO:0000957) regulation of mitochondrial RNA catabolic process(GO:0000960) |
0.0 | 0.5 | GO:0045898 | regulation of RNA polymerase II transcriptional preinitiation complex assembly(GO:0045898) |
0.0 | 0.1 | GO:0010887 | negative regulation of cholesterol storage(GO:0010887) |
0.0 | 0.1 | GO:0021847 | ventricular zone neuroblast division(GO:0021847) |
0.0 | 0.1 | GO:0018243 | protein O-linked glycosylation via threonine(GO:0018243) |
0.0 | 0.1 | GO:0006573 | valine metabolic process(GO:0006573) |
0.0 | 0.1 | GO:2000097 | regulation of smooth muscle cell-matrix adhesion(GO:2000097) |
0.0 | 0.3 | GO:0035970 | peptidyl-threonine dephosphorylation(GO:0035970) |
0.0 | 0.2 | GO:0098789 | pre-mRNA cleavage required for polyadenylation(GO:0098789) |
0.0 | 0.1 | GO:0046469 | platelet activating factor biosynthetic process(GO:0006663) platelet activating factor metabolic process(GO:0046469) |
0.0 | 0.1 | GO:0045875 | negative regulation of sister chromatid cohesion(GO:0045875) |
0.0 | 0.1 | GO:0001732 | formation of cytoplasmic translation initiation complex(GO:0001732) |
0.0 | 0.3 | GO:0000463 | maturation of LSU-rRNA from tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000463) |
0.0 | 0.2 | GO:0042045 | epithelial fluid transport(GO:0042045) |
0.0 | 0.1 | GO:0001922 | B-1 B cell homeostasis(GO:0001922) |
0.0 | 0.1 | GO:0070814 | hydrogen sulfide biosynthetic process(GO:0070814) |
0.0 | 0.2 | GO:0033299 | secretion of lysosomal enzymes(GO:0033299) |
0.0 | 0.3 | GO:0006013 | mannose metabolic process(GO:0006013) |
0.0 | 0.0 | GO:0061153 | trachea submucosa development(GO:0061152) trachea gland development(GO:0061153) |
0.0 | 0.2 | GO:0070493 | thrombin receptor signaling pathway(GO:0070493) |
0.0 | 0.1 | GO:2000346 | negative regulation of hepatocyte proliferation(GO:2000346) |
0.0 | 0.1 | GO:0060375 | regulation of mast cell differentiation(GO:0060375) |
0.0 | 0.2 | GO:0060836 | lymphatic endothelial cell differentiation(GO:0060836) |
0.0 | 0.2 | GO:0042759 | long-chain fatty acid biosynthetic process(GO:0042759) |
0.0 | 0.1 | GO:1904263 | positive regulation of TORC1 signaling(GO:1904263) |
0.0 | 0.2 | GO:0045908 | negative regulation of vasodilation(GO:0045908) |
0.0 | 0.3 | GO:0003334 | keratinocyte development(GO:0003334) |
0.0 | 0.2 | GO:0060059 | embryonic retina morphogenesis in camera-type eye(GO:0060059) |
0.0 | 0.2 | GO:0006307 | DNA dealkylation involved in DNA repair(GO:0006307) |
0.0 | 0.1 | GO:2000382 | positive regulation of mesoderm development(GO:2000382) |
0.0 | 0.5 | GO:0001574 | ganglioside biosynthetic process(GO:0001574) |
0.0 | 0.1 | GO:1901339 | regulation of store-operated calcium channel activity(GO:1901339) |
0.0 | 0.3 | GO:0090136 | epithelial cell-cell adhesion(GO:0090136) |
0.0 | 0.1 | GO:0046121 | deoxyribonucleoside catabolic process(GO:0046121) |
0.0 | 0.1 | GO:0034227 | tRNA thio-modification(GO:0034227) |
0.0 | 0.1 | GO:0015842 | aminergic neurotransmitter loading into synaptic vesicle(GO:0015842) neurotransmitter loading into synaptic vesicle(GO:0098700) |
0.0 | 0.1 | GO:0035864 | response to potassium ion(GO:0035864) cellular response to potassium ion(GO:0035865) |
0.0 | 0.1 | GO:0006651 | diacylglycerol biosynthetic process(GO:0006651) |
0.0 | 0.1 | GO:0044339 | canonical Wnt signaling pathway involved in osteoblast differentiation(GO:0044339) |
0.0 | 0.1 | GO:0035984 | response to trichostatin A(GO:0035983) cellular response to trichostatin A(GO:0035984) |
0.0 | 0.1 | GO:1990086 | lens fiber cell apoptotic process(GO:1990086) |
0.0 | 0.1 | GO:0071492 | cellular response to UV-A(GO:0071492) |
0.0 | 0.3 | GO:0050872 | white fat cell differentiation(GO:0050872) |
0.0 | 0.1 | GO:0050427 | 3'-phosphoadenosine 5'-phosphosulfate metabolic process(GO:0050427) |
0.0 | 0.0 | GO:0000966 | RNA 5'-end processing(GO:0000966) |
0.0 | 0.1 | GO:0006000 | fructose metabolic process(GO:0006000) |
0.0 | 0.1 | GO:0014043 | negative regulation of neuron maturation(GO:0014043) |
0.0 | 0.1 | GO:0061589 | calcium activated phosphatidylserine scrambling(GO:0061589) |
0.0 | 0.1 | GO:0002085 | inhibition of neuroepithelial cell differentiation(GO:0002085) negative regulation of auditory receptor cell differentiation(GO:0045608) |
0.0 | 0.3 | GO:0006957 | complement activation, alternative pathway(GO:0006957) |
0.0 | 0.3 | GO:0009109 | coenzyme catabolic process(GO:0009109) |
0.0 | 0.1 | GO:0018343 | protein farnesylation(GO:0018343) |
0.0 | 0.1 | GO:0051315 | attachment of mitotic spindle microtubules to kinetochore(GO:0051315) |
0.0 | 0.1 | GO:0061366 | behavioral response to chemical pain(GO:0061366) behavioral response to formalin induced pain(GO:0061368) |
0.0 | 0.3 | GO:0090503 | RNA phosphodiester bond hydrolysis, exonucleolytic(GO:0090503) |
0.0 | 0.2 | GO:0006707 | cholesterol catabolic process(GO:0006707) sterol catabolic process(GO:0016127) |
0.0 | 0.1 | GO:0051138 | regulation of NK T cell differentiation(GO:0051136) positive regulation of NK T cell differentiation(GO:0051138) |
0.0 | 0.1 | GO:0007084 | mitotic nuclear envelope reassembly(GO:0007084) |
0.0 | 0.1 | GO:1901727 | positive regulation of histone deacetylase activity(GO:1901727) |
0.0 | 0.1 | GO:0030397 | membrane disassembly(GO:0030397) nuclear envelope disassembly(GO:0051081) |
0.0 | 0.1 | GO:1904970 | brush border assembly(GO:1904970) |
0.0 | 0.1 | GO:0002949 | tRNA threonylcarbamoyladenosine modification(GO:0002949) |
0.0 | 0.1 | GO:0072092 | ureteric bud invasion(GO:0072092) |
0.0 | 0.0 | GO:0006106 | fumarate metabolic process(GO:0006106) |
0.0 | 0.1 | GO:0032898 | neurotrophin production(GO:0032898) |
0.0 | 0.1 | GO:0071305 | cellular response to vitamin D(GO:0071305) |
0.0 | 0.2 | GO:0070072 | vacuolar proton-transporting V-type ATPase complex assembly(GO:0070072) |
0.0 | 0.3 | GO:0006098 | pentose-phosphate shunt(GO:0006098) glyceraldehyde-3-phosphate metabolic process(GO:0019682) |
0.0 | 0.0 | GO:1904742 | regulation of telomeric DNA binding(GO:1904742) |
0.0 | 0.1 | GO:0031642 | negative regulation of myelination(GO:0031642) |
0.0 | 0.2 | GO:0030948 | negative regulation of vascular endothelial growth factor receptor signaling pathway(GO:0030948) |
0.0 | 0.2 | GO:0006120 | mitochondrial electron transport, NADH to ubiquinone(GO:0006120) |
0.0 | 0.1 | GO:0007089 | traversing start control point of mitotic cell cycle(GO:0007089) |
0.0 | 0.0 | GO:0043633 | polyadenylation-dependent RNA catabolic process(GO:0043633) |
0.0 | 0.1 | GO:0072488 | ammonium transmembrane transport(GO:0072488) |
0.0 | 0.1 | GO:1902775 | mitochondrial large ribosomal subunit assembly(GO:1902775) |
0.0 | 0.1 | GO:0060017 | parathyroid gland development(GO:0060017) |
0.0 | 0.1 | GO:1902514 | regulation of calcium ion transmembrane transport via high voltage-gated calcium channel(GO:1902514) |
0.0 | 0.0 | GO:0030050 | vesicle transport along actin filament(GO:0030050) |
0.0 | 0.1 | GO:0010739 | positive regulation of protein kinase A signaling(GO:0010739) |
0.0 | 0.1 | GO:0045631 | regulation of auditory receptor cell differentiation(GO:0045607) regulation of mechanoreceptor differentiation(GO:0045631) regulation of inner ear receptor cell differentiation(GO:2000980) |
0.0 | 0.0 | GO:1901421 | positive regulation of response to alcohol(GO:1901421) |
0.0 | 0.1 | GO:0018197 | peptidyl-aspartic acid modification(GO:0018197) |
0.0 | 0.1 | GO:0007182 | common-partner SMAD protein phosphorylation(GO:0007182) |
0.0 | 0.6 | GO:0032728 | positive regulation of interferon-beta production(GO:0032728) |
0.0 | 0.1 | GO:0006562 | proline catabolic process(GO:0006562) |
0.0 | 0.1 | GO:0070427 | nucleotide-binding oligomerization domain containing 1 signaling pathway(GO:0070427) |
0.0 | 0.0 | GO:1901740 | negative regulation of myoblast fusion(GO:1901740) |
0.0 | 0.1 | GO:0002282 | microglial cell activation involved in immune response(GO:0002282) |
0.0 | 0.1 | GO:0033031 | positive regulation of neutrophil apoptotic process(GO:0033031) |
0.0 | 0.1 | GO:2000562 | negative regulation of CD4-positive, alpha-beta T cell proliferation(GO:2000562) |
0.0 | 0.1 | GO:0006768 | biotin metabolic process(GO:0006768) |
0.0 | 0.0 | GO:0072093 | metanephric renal vesicle formation(GO:0072093) |
0.0 | 0.2 | GO:0043653 | mitochondrial fragmentation involved in apoptotic process(GO:0043653) |
0.0 | 0.4 | GO:0055070 | copper ion homeostasis(GO:0055070) |
0.0 | 0.0 | GO:0071335 | hair follicle cell proliferation(GO:0071335) regulation of hair follicle cell proliferation(GO:0071336) |
0.0 | 0.2 | GO:0043586 | tongue development(GO:0043586) |
0.0 | 0.1 | GO:0042447 | hormone catabolic process(GO:0042447) |
0.0 | 0.1 | GO:0010724 | regulation of definitive erythrocyte differentiation(GO:0010724) |
0.0 | 0.1 | GO:0015015 | heparan sulfate proteoglycan biosynthetic process, enzymatic modification(GO:0015015) |
0.0 | 0.0 | GO:0002121 | inter-male aggressive behavior(GO:0002121) |
0.0 | 0.9 | GO:0031018 | endocrine pancreas development(GO:0031018) |
0.0 | 0.0 | GO:1902474 | positive regulation of protein localization to synapse(GO:1902474) |
0.0 | 0.0 | GO:2000224 | regulation of testosterone biosynthetic process(GO:2000224) |
0.0 | 0.2 | GO:0043486 | histone exchange(GO:0043486) |
0.0 | 0.3 | GO:0045116 | protein neddylation(GO:0045116) |
0.0 | 0.1 | GO:0070842 | aggresome assembly(GO:0070842) |
0.0 | 0.3 | GO:0017144 | drug metabolic process(GO:0017144) |
0.0 | 0.0 | GO:0036394 | amylase secretion(GO:0036394) |
0.0 | 0.2 | GO:0032308 | positive regulation of prostaglandin secretion(GO:0032308) |
0.0 | 0.4 | GO:0019373 | epoxygenase P450 pathway(GO:0019373) |
0.0 | 0.1 | GO:1902268 | negative regulation of polyamine transmembrane transport(GO:1902268) |
0.0 | 0.3 | GO:0015986 | energy coupled proton transport, down electrochemical gradient(GO:0015985) ATP synthesis coupled proton transport(GO:0015986) |
0.0 | 0.1 | GO:0051204 | protein insertion into mitochondrial membrane(GO:0051204) |
0.0 | 0.3 | GO:0071108 | protein K48-linked deubiquitination(GO:0071108) |
0.0 | 0.1 | GO:0001880 | Mullerian duct regression(GO:0001880) |
0.0 | 0.1 | GO:0090283 | regulation of protein glycosylation in Golgi(GO:0090283) |
0.0 | 0.1 | GO:1901029 | negative regulation of mitochondrial outer membrane permeabilization involved in apoptotic signaling pathway(GO:1901029) |
0.0 | 0.1 | GO:0046416 | D-amino acid metabolic process(GO:0046416) |
0.0 | 0.1 | GO:1902018 | negative regulation of cilium assembly(GO:1902018) |
0.0 | 0.0 | GO:0090038 | negative regulation of protein kinase C signaling(GO:0090038) |
0.0 | 0.1 | GO:0070837 | dehydroascorbic acid transport(GO:0070837) |
0.0 | 0.1 | GO:0001672 | regulation of chromatin assembly or disassembly(GO:0001672) |
0.0 | 0.0 | GO:0002051 | osteoblast fate commitment(GO:0002051) |
0.0 | 0.1 | GO:1902166 | negative regulation of intrinsic apoptotic signaling pathway in response to DNA damage by p53 class mediator(GO:1902166) |
0.0 | 0.0 | GO:0002071 | glandular epithelial cell maturation(GO:0002071) |
0.0 | 0.1 | GO:0070544 | histone H3-K36 demethylation(GO:0070544) |
0.0 | 0.1 | GO:0022605 | oogenesis stage(GO:0022605) |
0.0 | 0.0 | GO:2001180 | negative regulation of interleukin-10 secretion(GO:2001180) |
0.0 | 0.1 | GO:2000609 | regulation of thyroid hormone generation(GO:2000609) |
0.0 | 0.0 | GO:0006570 | tyrosine metabolic process(GO:0006570) |
0.0 | 0.4 | GO:0000413 | protein peptidyl-prolyl isomerization(GO:0000413) |
0.0 | 0.1 | GO:0051657 | maintenance of organelle location(GO:0051657) |
0.0 | 0.1 | GO:0060789 | hair follicle placode formation(GO:0060789) |
0.0 | 0.1 | GO:0019230 | proprioception(GO:0019230) |
0.0 | 0.0 | GO:0021564 | vagus nerve development(GO:0021564) |
0.0 | 0.0 | GO:2000409 | positive regulation of T cell extravasation(GO:2000409) |
0.0 | 0.1 | GO:0016557 | peroxisome membrane biogenesis(GO:0016557) |
0.0 | 0.3 | GO:0006376 | mRNA splice site selection(GO:0006376) |
0.0 | 0.1 | GO:1904469 | positive regulation of tumor necrosis factor secretion(GO:1904469) |
0.0 | 0.0 | GO:0032621 | interleukin-18 production(GO:0032621) |
0.0 | 0.1 | GO:0050859 | negative regulation of B cell receptor signaling pathway(GO:0050859) |
0.0 | 0.2 | GO:0009143 | nucleoside triphosphate catabolic process(GO:0009143) |
0.0 | 0.1 | GO:0030210 | heparin biosynthetic process(GO:0030210) |
0.0 | 0.1 | GO:2001286 | regulation of caveolin-mediated endocytosis(GO:2001286) |
0.0 | 0.0 | GO:0032696 | negative regulation of interleukin-13 production(GO:0032696) |
0.0 | 0.0 | GO:0048014 | Tie signaling pathway(GO:0048014) |
0.0 | 0.1 | GO:0006678 | glucosylceramide metabolic process(GO:0006678) |
0.0 | 0.1 | GO:0045719 | negative regulation of glycogen biosynthetic process(GO:0045719) |
0.0 | 0.1 | GO:0061084 | negative regulation of protein refolding(GO:0061084) |
0.0 | 0.1 | GO:0015772 | disaccharide transport(GO:0015766) sucrose transport(GO:0015770) oligosaccharide transport(GO:0015772) |
0.0 | 0.2 | GO:0042407 | cristae formation(GO:0042407) |
0.0 | 0.0 | GO:0060051 | negative regulation of protein glycosylation(GO:0060051) |
0.0 | 0.1 | GO:0002154 | thyroid hormone mediated signaling pathway(GO:0002154) regulation of thyroid hormone mediated signaling pathway(GO:0002155) |
0.0 | 0.1 | GO:0060373 | regulation of ventricular cardiac muscle cell membrane depolarization(GO:0060373) |
0.0 | 0.1 | GO:1901407 | regulation of phosphorylation of RNA polymerase II C-terminal domain(GO:1901407) positive regulation of phosphorylation of RNA polymerase II C-terminal domain(GO:1901409) |
0.0 | 0.1 | GO:0031848 | protection from non-homologous end joining at telomere(GO:0031848) |
0.0 | 0.1 | GO:0072602 | interleukin-4 secretion(GO:0072602) |
0.0 | 0.1 | GO:0048388 | endosomal lumen acidification(GO:0048388) |
0.0 | 0.0 | GO:0071787 | endoplasmic reticulum tubular network assembly(GO:0071787) |
0.0 | 0.1 | GO:0022615 | protein to membrane docking(GO:0022615) |
0.0 | 0.0 | GO:0042726 | flavin-containing compound metabolic process(GO:0042726) |
0.0 | 0.1 | GO:0098904 | regulation of AV node cell action potential(GO:0098904) |
0.0 | 0.0 | GO:0031086 | nuclear-transcribed mRNA catabolic process, deadenylation-independent decay(GO:0031086) deadenylation-independent decapping of nuclear-transcribed mRNA(GO:0031087) |
0.0 | 0.0 | GO:0033092 | positive regulation of immature T cell proliferation(GO:0033091) positive regulation of immature T cell proliferation in thymus(GO:0033092) |
0.0 | 0.1 | GO:0032060 | bleb assembly(GO:0032060) |
0.0 | 0.0 | GO:0072131 | kidney mesenchyme morphogenesis(GO:0072131) metanephric mesenchyme morphogenesis(GO:0072133) |
0.0 | 0.1 | GO:0000012 | single strand break repair(GO:0000012) |
0.0 | 0.0 | GO:0018125 | peptidyl-cysteine methylation(GO:0018125) |
0.0 | 0.1 | GO:0031468 | nuclear envelope reassembly(GO:0031468) |
0.0 | 0.1 | GO:0061087 | positive regulation of histone H3-K27 methylation(GO:0061087) |
0.0 | 0.0 | GO:0038171 | cannabinoid signaling pathway(GO:0038171) endocannabinoid signaling pathway(GO:0071926) |
0.0 | 0.2 | GO:0045793 | positive regulation of cell size(GO:0045793) |
0.0 | 0.0 | GO:0042769 | DNA damage response, detection of DNA damage(GO:0042769) |
0.0 | 0.1 | GO:0015074 | DNA integration(GO:0015074) |
0.0 | 0.0 | GO:0010606 | positive regulation of cytoplasmic mRNA processing body assembly(GO:0010606) |
0.0 | 0.0 | GO:0048769 | sarcomerogenesis(GO:0048769) |
0.0 | 0.0 | GO:0046477 | glycosylceramide catabolic process(GO:0046477) |
0.0 | 0.0 | GO:0040009 | regulation of growth rate(GO:0040009) |
0.0 | 0.0 | GO:1904354 | negative regulation of telomere capping(GO:1904354) |
0.0 | 0.0 | GO:0010749 | regulation of nitric oxide mediated signal transduction(GO:0010749) |
0.0 | 0.0 | GO:1903774 | positive regulation of viral budding via host ESCRT complex(GO:1903774) |
0.0 | 0.0 | GO:0021698 | cerebellar cortex structural organization(GO:0021698) |
0.0 | 0.0 | GO:0035694 | mitochondrial protein catabolic process(GO:0035694) |
0.0 | 0.0 | GO:0042421 | norepinephrine biosynthetic process(GO:0042421) |
0.0 | 0.0 | GO:0090188 | negative regulation of pancreatic juice secretion(GO:0090188) |
0.0 | 0.1 | GO:0032532 | regulation of microvillus length(GO:0032532) |
0.0 | 0.1 | GO:0009249 | protein lipoylation(GO:0009249) |
0.0 | 0.0 | GO:0035622 | intrahepatic bile duct development(GO:0035622) |
0.0 | 0.0 | GO:2000686 | regulation of rubidium ion transmembrane transporter activity(GO:2000686) |
0.0 | 0.0 | GO:0051660 | establishment of centrosome localization(GO:0051660) |
0.0 | 0.0 | GO:0001834 | trophectodermal cell proliferation(GO:0001834) |
0.0 | 0.0 | GO:0072235 | distal convoluted tubule development(GO:0072025) DCT cell differentiation(GO:0072069) metanephric distal convoluted tubule development(GO:0072221) metanephric distal tubule development(GO:0072235) metanephric DCT cell differentiation(GO:0072240) |
0.0 | 0.0 | GO:0006420 | arginyl-tRNA aminoacylation(GO:0006420) |
0.0 | 0.1 | GO:0017121 | phospholipid scrambling(GO:0017121) |
0.0 | 0.1 | GO:0015867 | ATP transport(GO:0015867) |
0.0 | 0.1 | GO:1900262 | regulation of DNA-directed DNA polymerase activity(GO:1900262) positive regulation of DNA-directed DNA polymerase activity(GO:1900264) |
0.0 | 0.0 | GO:0032202 | telomere assembly(GO:0032202) |
0.0 | 0.0 | GO:1902267 | polyamine transport(GO:0015846) polyamine transmembrane transport(GO:1902047) regulation of polyamine transmembrane transport(GO:1902267) |
0.0 | 0.3 | GO:0016578 | histone deubiquitination(GO:0016578) |
0.0 | 0.1 | GO:0097500 | receptor localization to nonmotile primary cilium(GO:0097500) |
0.0 | 0.0 | GO:1902083 | negative regulation of peptidyl-cysteine S-nitrosylation(GO:1902083) |
0.0 | 0.1 | GO:0043517 | positive regulation of DNA damage response, signal transduction by p53 class mediator(GO:0043517) |
0.0 | 0.0 | GO:0018214 | protein carboxylation(GO:0018214) |
0.0 | 0.0 | GO:0046083 | adenine metabolic process(GO:0046083) adenine biosynthetic process(GO:0046084) |
0.0 | 0.0 | GO:0018199 | peptidyl-glutamine modification(GO:0018199) |
0.0 | 0.0 | GO:0032439 | endosome localization(GO:0032439) |
0.0 | 0.0 | GO:0061535 | glutamate secretion, neurotransmission(GO:0061535) |
0.0 | 0.2 | GO:0031954 | positive regulation of protein autophosphorylation(GO:0031954) |
0.0 | 0.0 | GO:0046098 | guanine metabolic process(GO:0046098) |
0.0 | 0.0 | GO:0010248 | establishment or maintenance of transmembrane electrochemical gradient(GO:0010248) |
0.0 | 0.1 | GO:0001842 | neural fold formation(GO:0001842) |
0.0 | 0.1 | GO:0070536 | protein K63-linked deubiquitination(GO:0070536) |
0.0 | 0.1 | GO:0045176 | apical protein localization(GO:0045176) |
0.0 | 0.1 | GO:2001199 | negative regulation of dendritic cell differentiation(GO:2001199) |
0.0 | 0.0 | GO:0031049 | programmed DNA elimination(GO:0031049) chromosome breakage(GO:0031052) |
0.0 | 0.1 | GO:0007256 | activation of JNKK activity(GO:0007256) |
0.0 | 0.1 | GO:0006002 | fructose 6-phosphate metabolic process(GO:0006002) |
0.0 | 0.0 | GO:0043928 | exonucleolytic nuclear-transcribed mRNA catabolic process involved in deadenylation-dependent decay(GO:0043928) |
0.0 | 0.1 | GO:0071732 | cellular response to nitric oxide(GO:0071732) |
0.0 | 0.5 | GO:0043550 | regulation of lipid kinase activity(GO:0043550) |
0.0 | 0.0 | GO:1904526 | regulation of microtubule binding(GO:1904526) positive regulation of microtubule binding(GO:1904528) |
0.0 | 0.0 | GO:0046005 | positive regulation of circadian sleep/wake cycle, REM sleep(GO:0046005) |
0.0 | 0.1 | GO:0060546 | negative regulation of necroptotic process(GO:0060546) |
0.0 | 0.2 | GO:0006783 | heme biosynthetic process(GO:0006783) |
0.0 | 0.0 | GO:0032290 | peripheral nervous system myelin formation(GO:0032290) |
0.0 | 0.1 | GO:0009235 | cobalamin metabolic process(GO:0009235) |
0.0 | 0.1 | GO:0000478 | endonucleolytic cleavage involved in rRNA processing(GO:0000478) |
0.0 | 0.0 | GO:0031125 | rRNA 3'-end processing(GO:0031125) |
0.0 | 0.0 | GO:0009629 | response to gravity(GO:0009629) |
0.0 | 0.0 | GO:0009957 | epidermal cell fate specification(GO:0009957) |
0.0 | 0.2 | GO:0071353 | cellular response to interleukin-4(GO:0071353) |
0.0 | 0.1 | GO:1902414 | protein localization to cell junction(GO:1902414) |
0.0 | 0.0 | GO:0060672 | epithelial cell differentiation involved in embryonic placenta development(GO:0060671) epithelial cell morphogenesis involved in placental branching(GO:0060672) |
0.0 | 0.1 | GO:0043654 | recognition of apoptotic cell(GO:0043654) |
0.0 | 0.1 | GO:0035810 | positive regulation of urine volume(GO:0035810) |
0.0 | 0.0 | GO:0042996 | regulation of Golgi to plasma membrane protein transport(GO:0042996) |
0.0 | 0.1 | GO:0060213 | regulation of nuclear-transcribed mRNA poly(A) tail shortening(GO:0060211) positive regulation of nuclear-transcribed mRNA poly(A) tail shortening(GO:0060213) |
0.0 | 0.1 | GO:0006353 | DNA-templated transcription, termination(GO:0006353) |
0.0 | 0.2 | GO:0010569 | regulation of double-strand break repair via homologous recombination(GO:0010569) |
0.0 | 0.0 | GO:0033121 | regulation of purine nucleotide catabolic process(GO:0033121) |
0.0 | 0.1 | GO:2000095 | regulation of Wnt signaling pathway, planar cell polarity pathway(GO:2000095) |
0.0 | 0.0 | GO:0060468 | prevention of polyspermy(GO:0060468) |
0.0 | 0.1 | GO:0055064 | chloride ion homeostasis(GO:0055064) |
0.0 | 0.1 | GO:0090043 | regulation of tubulin deacetylation(GO:0090043) |
0.0 | 0.0 | GO:1902226 | regulation of macrophage colony-stimulating factor signaling pathway(GO:1902226) regulation of response to macrophage colony-stimulating factor(GO:1903969) regulation of cellular response to macrophage colony-stimulating factor stimulus(GO:1903972) |
0.0 | 0.1 | GO:0034058 | endosomal vesicle fusion(GO:0034058) |
0.0 | 0.1 | GO:0000055 | ribosomal large subunit export from nucleus(GO:0000055) |
0.0 | 0.0 | GO:0019896 | axonal transport of mitochondrion(GO:0019896) |
0.0 | 0.1 | GO:0034982 | mitochondrial protein processing(GO:0034982) |
0.0 | 0.0 | GO:0060526 | prostate glandular acinus morphogenesis(GO:0060526) prostate epithelial cord arborization involved in prostate glandular acinus morphogenesis(GO:0060527) |
0.0 | 0.0 | GO:0035672 | oligopeptide transmembrane transport(GO:0035672) |
0.0 | 0.1 | GO:0032367 | intracellular cholesterol transport(GO:0032367) |
0.0 | 0.0 | GO:0035526 | retrograde transport, plasma membrane to Golgi(GO:0035526) |
0.0 | 0.0 | GO:0015819 | lysine transport(GO:0015819) |
0.0 | 0.0 | GO:1900454 | positive regulation of long term synaptic depression(GO:1900454) |
0.0 | 0.0 | GO:0007567 | parturition(GO:0007567) |
0.0 | 0.0 | GO:0048143 | astrocyte activation(GO:0048143) |
0.0 | 0.0 | GO:0015747 | urate transport(GO:0015747) |
0.0 | 0.0 | GO:1903999 | negative regulation of eating behavior(GO:1903999) |
0.0 | 0.2 | GO:0006968 | cellular defense response(GO:0006968) |
0.0 | 0.0 | GO:0072383 | plus-end-directed vesicle transport along microtubule(GO:0072383) plus-end-directed organelle transport along microtubule(GO:0072386) |
0.0 | 0.0 | GO:0001998 | angiotensin mediated vasoconstriction involved in regulation of systemic arterial blood pressure(GO:0001998) |
0.0 | 0.0 | GO:0000715 | nucleotide-excision repair, DNA damage recognition(GO:0000715) |
0.0 | 0.1 | GO:0090005 | negative regulation of establishment of protein localization to plasma membrane(GO:0090005) |
0.0 | 0.0 | GO:0008050 | female courtship behavior(GO:0008050) |
0.0 | 0.4 | GO:0007584 | response to nutrient(GO:0007584) |
0.0 | 0.0 | GO:0045650 | negative regulation of macrophage differentiation(GO:0045650) |
0.0 | 0.0 | GO:1900109 | regulation of histone H3-K9 dimethylation(GO:1900109) |
0.0 | 0.0 | GO:2000407 | regulation of T cell extravasation(GO:2000407) |
0.0 | 0.0 | GO:0061002 | negative regulation of dendritic spine morphogenesis(GO:0061002) |
0.0 | 0.1 | GO:0060020 | Bergmann glial cell differentiation(GO:0060020) |
0.0 | 0.0 | GO:0048318 | axial mesoderm development(GO:0048318) |
0.0 | 0.0 | GO:0035795 | negative regulation of mitochondrial membrane permeability(GO:0035795) |
0.0 | 0.1 | GO:0048757 | endosome to melanosome transport(GO:0035646) cellular pigment accumulation(GO:0043482) endosome to pigment granule transport(GO:0043485) pigment granule maturation(GO:0048757) |
0.0 | 0.0 | GO:0036265 | RNA (guanine-N7)-methylation(GO:0036265) |
0.0 | 0.0 | GO:2000301 | negative regulation of synaptic vesicle exocytosis(GO:2000301) |
0.0 | 0.1 | GO:0051533 | positive regulation of NFAT protein import into nucleus(GO:0051533) |
0.0 | 0.0 | GO:0010760 | negative regulation of macrophage chemotaxis(GO:0010760) |
0.0 | 0.0 | GO:1901897 | regulation of relaxation of cardiac muscle(GO:1901897) |
0.0 | 0.1 | GO:1902715 | positive regulation of interferon-gamma secretion(GO:1902715) |
0.0 | 0.0 | GO:0032471 | negative regulation of endoplasmic reticulum calcium ion concentration(GO:0032471) |
0.0 | 0.0 | GO:0046167 | glycerol-3-phosphate biosynthetic process(GO:0046167) |
0.0 | 0.1 | GO:0021960 | anterior commissure morphogenesis(GO:0021960) |
0.0 | 0.0 | GO:0060084 | synaptic transmission involved in micturition(GO:0060084) |
0.0 | 0.0 | GO:0002097 | tRNA wobble base modification(GO:0002097) |
0.0 | 0.2 | GO:0030252 | growth hormone secretion(GO:0030252) |
0.0 | 0.0 | GO:1902101 | positive regulation of mitotic metaphase/anaphase transition(GO:0045842) positive regulation of metaphase/anaphase transition of cell cycle(GO:1902101) |
0.0 | 0.2 | GO:0030488 | tRNA methylation(GO:0030488) |
0.0 | 0.1 | GO:0010758 | regulation of macrophage chemotaxis(GO:0010758) |
0.0 | 0.0 | GO:0010963 | regulation of L-arginine import(GO:0010963) |
0.0 | 0.0 | GO:0032911 | negative regulation of transforming growth factor beta1 production(GO:0032911) |
0.0 | 0.0 | GO:1903887 | motile primary cilium assembly(GO:1903887) |
0.0 | 0.0 | GO:0009173 | UMP biosynthetic process(GO:0006222) pyrimidine ribonucleoside monophosphate metabolic process(GO:0009173) pyrimidine ribonucleoside monophosphate biosynthetic process(GO:0009174) UMP metabolic process(GO:0046049) |
0.0 | 0.0 | GO:0035754 | B cell chemotaxis(GO:0035754) |
0.0 | 0.0 | GO:0061418 | regulation of transcription from RNA polymerase II promoter in response to hypoxia(GO:0061418) |
0.0 | 0.1 | GO:0070266 | necroptotic process(GO:0070266) |
0.0 | 0.1 | GO:0035726 | common myeloid progenitor cell proliferation(GO:0035726) |
0.0 | 0.1 | GO:0072498 | embryonic skeletal joint development(GO:0072498) |
0.0 | 0.2 | GO:0010800 | positive regulation of peptidyl-threonine phosphorylation(GO:0010800) |
0.0 | 0.0 | GO:0030311 | poly-N-acetyllactosamine metabolic process(GO:0030309) poly-N-acetyllactosamine biosynthetic process(GO:0030311) |
0.0 | 0.0 | GO:0001905 | activation of membrane attack complex(GO:0001905) regulation of activation of membrane attack complex(GO:0001969) |
0.0 | 0.0 | GO:0045743 | positive regulation of fibroblast growth factor receptor signaling pathway(GO:0045743) |
0.0 | 0.0 | GO:1901725 | regulation of histone deacetylase activity(GO:1901725) |
0.0 | 0.1 | GO:0034393 | positive regulation of smooth muscle cell apoptotic process(GO:0034393) |
0.0 | 0.0 | GO:2001225 | regulation of chloride transport(GO:2001225) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.4 | 1.1 | GO:0097487 | multivesicular body, internal vesicle(GO:0097487) |
0.1 | 0.6 | GO:0044316 | cone cell pedicle(GO:0044316) |
0.1 | 0.7 | GO:0045098 | type III intermediate filament(GO:0045098) |
0.1 | 0.4 | GO:0035867 | alphav-beta3 integrin-IGF-1-IGF1R complex(GO:0035867) |
0.1 | 0.4 | GO:0031315 | extrinsic component of mitochondrial outer membrane(GO:0031315) |
0.1 | 0.4 | GO:0005579 | membrane attack complex(GO:0005579) |
0.1 | 0.2 | GO:0097413 | Lewy body(GO:0097413) |
0.1 | 0.8 | GO:0070852 | cell body fiber(GO:0070852) |
0.1 | 0.3 | GO:0005955 | calcineurin complex(GO:0005955) |
0.1 | 0.3 | GO:0070545 | PeBoW complex(GO:0070545) |
0.1 | 0.2 | GO:0048179 | activin receptor complex(GO:0048179) |
0.1 | 0.4 | GO:0035032 | phosphatidylinositol 3-kinase complex, class III(GO:0035032) |
0.1 | 0.2 | GO:0035355 | Toll-like receptor 2-Toll-like receptor 6 protein complex(GO:0035355) |
0.1 | 0.2 | GO:0032541 | cortical endoplasmic reticulum(GO:0032541) |
0.1 | 0.2 | GO:0005726 | perichromatin fibrils(GO:0005726) |
0.1 | 0.2 | GO:0005896 | interleukin-6 receptor complex(GO:0005896) |
0.1 | 0.6 | GO:0034663 | endoplasmic reticulum chaperone complex(GO:0034663) |
0.1 | 0.2 | GO:1990130 | Iml1 complex(GO:1990130) |
0.1 | 0.2 | GO:0033269 | internode region of axon(GO:0033269) |
0.0 | 0.4 | GO:0000808 | origin recognition complex(GO:0000808) nuclear origin of replication recognition complex(GO:0005664) |
0.0 | 0.1 | GO:0032444 | activin responsive factor complex(GO:0032444) |
0.0 | 0.2 | GO:0045293 | mRNA editing complex(GO:0045293) |
0.0 | 0.8 | GO:0043034 | costamere(GO:0043034) |
0.0 | 0.2 | GO:0005915 | zonula adherens(GO:0005915) |
0.0 | 0.1 | GO:0097441 | basilar dendrite(GO:0097441) |
0.0 | 0.4 | GO:0045263 | proton-transporting ATP synthase complex, coupling factor F(o)(GO:0045263) |
0.0 | 0.1 | GO:0031298 | replication fork protection complex(GO:0031298) |
0.0 | 0.2 | GO:0042825 | TAP complex(GO:0042825) |
0.0 | 0.2 | GO:0008091 | spectrin(GO:0008091) |
0.0 | 0.3 | GO:0008250 | oligosaccharyltransferase complex(GO:0008250) |
0.0 | 0.2 | GO:0044615 | nuclear pore nuclear basket(GO:0044615) |
0.0 | 0.1 | GO:0031094 | platelet dense tubular network(GO:0031094) |
0.0 | 0.1 | GO:0031933 | telomeric heterochromatin(GO:0031933) |
0.0 | 0.3 | GO:0016342 | catenin complex(GO:0016342) |
0.0 | 0.1 | GO:0070765 | gamma-secretase complex(GO:0070765) |
0.0 | 0.4 | GO:0005942 | phosphatidylinositol 3-kinase complex(GO:0005942) |
0.0 | 0.2 | GO:1990111 | spermatoproteasome complex(GO:1990111) |
0.0 | 0.1 | GO:0005784 | Sec61 translocon complex(GO:0005784) translocon complex(GO:0071256) |
0.0 | 0.2 | GO:0000220 | vacuolar proton-transporting V-type ATPase, V0 domain(GO:0000220) |
0.0 | 0.4 | GO:0031597 | cytosolic proteasome complex(GO:0031597) |
0.0 | 0.1 | GO:0008540 | proteasome regulatory particle, base subcomplex(GO:0008540) |
0.0 | 0.1 | GO:0005899 | insulin receptor complex(GO:0005899) |
0.0 | 0.2 | GO:1990909 | Wnt signalosome(GO:1990909) |
0.0 | 0.2 | GO:0005952 | cAMP-dependent protein kinase complex(GO:0005952) |
0.0 | 1.2 | GO:0042645 | nucleoid(GO:0009295) mitochondrial nucleoid(GO:0042645) |
0.0 | 0.2 | GO:0000124 | SAGA complex(GO:0000124) |
0.0 | 0.5 | GO:0032588 | trans-Golgi network membrane(GO:0032588) |
0.0 | 0.3 | GO:0000930 | gamma-tubulin complex(GO:0000930) |
0.0 | 0.1 | GO:0005827 | polar microtubule(GO:0005827) |
0.0 | 0.1 | GO:0000811 | GINS complex(GO:0000811) |
0.0 | 0.5 | GO:0005719 | nuclear euchromatin(GO:0005719) |
0.0 | 0.3 | GO:0035098 | ESC/E(Z) complex(GO:0035098) |
0.0 | 0.3 | GO:0031083 | BLOC-1 complex(GO:0031083) |
0.0 | 0.1 | GO:0044233 | ER-mitochondrion membrane contact site(GO:0044233) |
0.0 | 0.2 | GO:0033263 | CORVET complex(GO:0033263) |
0.0 | 0.2 | GO:0043083 | synaptic cleft(GO:0043083) |
0.0 | 0.1 | GO:0045252 | oxoglutarate dehydrogenase complex(GO:0045252) |
0.0 | 0.0 | GO:0060053 | neurofilament cytoskeleton(GO:0060053) |
0.0 | 0.1 | GO:0097454 | Schwann cell microvillus(GO:0097454) |
0.0 | 0.1 | GO:0070688 | MLL5-L complex(GO:0070688) |
0.0 | 0.2 | GO:0030122 | AP-2 adaptor complex(GO:0030122) |
0.0 | 0.1 | GO:0072357 | PTW/PP1 phosphatase complex(GO:0072357) |
0.0 | 0.1 | GO:0005608 | laminin-3 complex(GO:0005608) |
0.0 | 0.1 | GO:0005968 | Rab-protein geranylgeranyltransferase complex(GO:0005968) |
0.0 | 0.3 | GO:0000159 | protein phosphatase type 2A complex(GO:0000159) |
0.0 | 0.1 | GO:0033647 | host intracellular organelle(GO:0033647) host intracellular membrane-bounded organelle(GO:0033648) |
0.0 | 0.1 | GO:0042583 | chromaffin granule(GO:0042583) |
0.0 | 0.1 | GO:0071204 | histone pre-mRNA 3'end processing complex(GO:0071204) |
0.0 | 1.0 | GO:0005811 | lipid particle(GO:0005811) |
0.0 | 0.3 | GO:0035327 | transcriptionally active chromatin(GO:0035327) |
0.0 | 0.1 | GO:0097136 | Bcl-2 family protein complex(GO:0097136) |
0.0 | 0.1 | GO:0005672 | transcription factor TFIIA complex(GO:0005672) |
0.0 | 0.1 | GO:0097504 | Gemini of coiled bodies(GO:0097504) |
0.0 | 0.0 | GO:0030669 | clathrin-coated endocytic vesicle membrane(GO:0030669) |
0.0 | 0.1 | GO:0045298 | tubulin complex(GO:0045298) |
0.0 | 0.2 | GO:0000242 | pericentriolar material(GO:0000242) |
0.0 | 0.1 | GO:0072669 | tRNA-splicing ligase complex(GO:0072669) |
0.0 | 0.7 | GO:0005778 | peroxisomal membrane(GO:0005778) microbody membrane(GO:0031903) |
0.0 | 0.1 | GO:0032389 | MutLalpha complex(GO:0032389) |
0.0 | 0.1 | GO:0005663 | DNA replication factor C complex(GO:0005663) |
0.0 | 0.0 | GO:0030132 | clathrin coat of coated pit(GO:0030132) |
0.0 | 0.1 | GO:1990075 | periciliary membrane compartment(GO:1990075) |
0.0 | 0.1 | GO:0016011 | dystroglycan complex(GO:0016011) sarcoglycan complex(GO:0016012) |
0.0 | 0.1 | GO:0016589 | NURF complex(GO:0016589) |
0.0 | 0.2 | GO:0005675 | holo TFIIH complex(GO:0005675) |
0.0 | 0.4 | GO:0030120 | vesicle coat(GO:0030120) |
0.0 | 0.1 | GO:0005927 | muscle tendon junction(GO:0005927) |
0.0 | 0.0 | GO:0071008 | U2-type post-mRNA release spliceosomal complex(GO:0071008) |
0.0 | 0.0 | GO:0070032 | synaptobrevin 2-SNAP-25-syntaxin-1a-complexin I complex(GO:0070032) |
0.0 | 0.1 | GO:0032009 | early phagosome(GO:0032009) |
0.0 | 0.1 | GO:0000805 | X chromosome(GO:0000805) |
0.0 | 0.4 | GO:0008023 | transcription elongation factor complex(GO:0008023) |
0.0 | 0.1 | GO:0045261 | mitochondrial proton-transporting ATP synthase complex, catalytic core F(1)(GO:0000275) proton-transporting ATP synthase complex, catalytic core F(1)(GO:0045261) |
0.0 | 0.2 | GO:0002199 | zona pellucida receptor complex(GO:0002199) |
0.0 | 0.0 | GO:0034098 | VCP-NPL4-UFD1 AAA ATPase complex(GO:0034098) |
0.0 | 0.0 | GO:0005594 | collagen type IX trimer(GO:0005594) |
0.0 | 0.2 | GO:0005892 | acetylcholine-gated channel complex(GO:0005892) |
0.0 | 0.0 | GO:0044611 | nuclear pore inner ring(GO:0044611) |
0.0 | 0.1 | GO:0035631 | CD40 receptor complex(GO:0035631) |
0.0 | 0.1 | GO:0070578 | RISC-loading complex(GO:0070578) |
0.0 | 0.0 | GO:0005712 | chiasma(GO:0005712) |
0.0 | 0.2 | GO:0098533 | ATPase dependent transmembrane transport complex(GO:0098533) |
0.0 | 0.5 | GO:0022627 | cytosolic small ribosomal subunit(GO:0022627) |
0.0 | 0.1 | GO:0036128 | CatSper complex(GO:0036128) |
0.0 | 0.1 | GO:0035749 | myelin sheath adaxonal region(GO:0035749) |
0.0 | 0.1 | GO:0031430 | M band(GO:0031430) |
0.0 | 0.4 | GO:0005801 | cis-Golgi network(GO:0005801) |
0.0 | 0.0 | GO:0016602 | CCAAT-binding factor complex(GO:0016602) |
0.0 | 0.0 | GO:0005593 | FACIT collagen trimer(GO:0005593) |
0.0 | 0.0 | GO:0000125 | PCAF complex(GO:0000125) |
0.0 | 0.1 | GO:0034709 | methylosome(GO:0034709) |
0.0 | 0.0 | GO:0012510 | trans-Golgi network transport vesicle membrane(GO:0012510) |
0.0 | 0.5 | GO:0000502 | proteasome complex(GO:0000502) |
0.0 | 0.0 | GO:0000408 | EKC/KEOPS complex(GO:0000408) |
0.0 | 0.2 | GO:0071339 | MLL1/2 complex(GO:0044665) MLL1 complex(GO:0071339) |
0.0 | 0.1 | GO:0000813 | ESCRT I complex(GO:0000813) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.4 | 1.1 | GO:0048408 | epidermal growth factor binding(GO:0048408) |
0.3 | 0.9 | GO:0016743 | carboxyl- or carbamoyltransferase activity(GO:0016743) |
0.2 | 0.8 | GO:0032896 | palmitoyl-CoA 9-desaturase activity(GO:0032896) |
0.2 | 0.5 | GO:0036042 | long-chain fatty acyl-CoA binding(GO:0036042) |
0.1 | 0.4 | GO:0004771 | sterol esterase activity(GO:0004771) |
0.1 | 0.6 | GO:0034056 | estrogen response element binding(GO:0034056) |
0.1 | 0.4 | GO:0043125 | ErbB-3 class receptor binding(GO:0043125) |
0.1 | 0.4 | GO:0097109 | neuroligin family protein binding(GO:0097109) |
0.1 | 0.4 | GO:0004024 | alcohol dehydrogenase activity, zinc-dependent(GO:0004024) |
0.1 | 0.4 | GO:0038181 | bile acid receptor activity(GO:0038181) |
0.1 | 1.2 | GO:0004499 | N,N-dimethylaniline monooxygenase activity(GO:0004499) |
0.1 | 0.4 | GO:0031802 | type 5 metabotropic glutamate receptor binding(GO:0031802) |
0.1 | 0.4 | GO:0018479 | benzaldehyde dehydrogenase (NAD+) activity(GO:0018479) |
0.1 | 0.3 | GO:0035529 | NADH pyrophosphatase activity(GO:0035529) |
0.1 | 0.3 | GO:0005220 | inositol 1,4,5-trisphosphate-sensitive calcium-release channel activity(GO:0005220) |
0.1 | 0.3 | GO:0003986 | acetyl-CoA hydrolase activity(GO:0003986) |
0.1 | 0.6 | GO:0047760 | butyrate-CoA ligase activity(GO:0047760) |
0.1 | 0.2 | GO:0004768 | stearoyl-CoA 9-desaturase activity(GO:0004768) |
0.1 | 0.5 | GO:0070728 | leucine binding(GO:0070728) |
0.1 | 0.2 | GO:0070644 | vitamin D response element binding(GO:0070644) |
0.1 | 0.3 | GO:0004505 | phenylalanine 4-monooxygenase activity(GO:0004505) |
0.1 | 0.3 | GO:0055100 | adiponectin binding(GO:0055100) |
0.1 | 0.3 | GO:0005025 | transforming growth factor beta receptor activity, type I(GO:0005025) |
0.1 | 0.9 | GO:0051787 | misfolded protein binding(GO:0051787) |
0.1 | 0.2 | GO:0000033 | alpha-1,3-mannosyltransferase activity(GO:0000033) |
0.1 | 0.2 | GO:0050508 | glucuronosyl-N-acetylglucosaminyl-proteoglycan 4-alpha-N-acetylglucosaminyltransferase activity(GO:0050508) |
0.1 | 0.2 | GO:0004345 | glucose-6-phosphate dehydrogenase activity(GO:0004345) |
0.1 | 0.3 | GO:0071614 | linoleic acid epoxygenase activity(GO:0071614) |
0.1 | 0.2 | GO:0035663 | Toll-like receptor 2 binding(GO:0035663) |
0.1 | 0.2 | GO:0016802 | adenosylhomocysteinase activity(GO:0004013) trialkylsulfonium hydrolase activity(GO:0016802) |
0.1 | 0.4 | GO:0003836 | beta-galactoside (CMP) alpha-2,3-sialyltransferase activity(GO:0003836) |
0.1 | 0.2 | GO:0004366 | glycerol-3-phosphate O-acyltransferase activity(GO:0004366) |
0.1 | 0.2 | GO:0016899 | oxidoreductase activity, acting on the CH-OH group of donors, oxygen as acceptor(GO:0016899) |
0.1 | 0.2 | GO:0008384 | IkappaB kinase activity(GO:0008384) |
0.1 | 0.6 | GO:0008195 | phosphatidate phosphatase activity(GO:0008195) |
0.1 | 0.2 | GO:0004937 | alpha1-adrenergic receptor activity(GO:0004937) |
0.1 | 0.2 | GO:0043559 | insulin binding(GO:0043559) |
0.1 | 0.2 | GO:0035615 | clathrin adaptor activity(GO:0035615) endocytic adaptor activity(GO:0098748) |
0.1 | 0.3 | GO:0051525 | NFAT protein binding(GO:0051525) |
0.1 | 0.2 | GO:0001069 | regulatory region RNA binding(GO:0001069) |
0.1 | 0.3 | GO:0004075 | biotin carboxylase activity(GO:0004075) |
0.1 | 0.1 | GO:0031697 | beta-1 adrenergic receptor binding(GO:0031697) |
0.1 | 0.5 | GO:0005159 | insulin-like growth factor receptor binding(GO:0005159) |
0.0 | 0.1 | GO:0004802 | transketolase activity(GO:0004802) |
0.0 | 0.1 | GO:0004924 | oncostatin-M receptor activity(GO:0004924) |
0.0 | 0.3 | GO:0003680 | AT DNA binding(GO:0003680) |
0.0 | 0.2 | GO:0047023 | androsterone dehydrogenase activity(GO:0047023) |
0.0 | 0.1 | GO:0016716 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, another compound as one donor, and incorporation of one atom of oxygen(GO:0016716) |
0.0 | 0.2 | GO:0042577 | lipid phosphatase activity(GO:0042577) |
0.0 | 0.8 | GO:1900750 | glutathione binding(GO:0043295) oligopeptide binding(GO:1900750) |
0.0 | 0.2 | GO:0003873 | 6-phosphofructo-2-kinase activity(GO:0003873) |
0.0 | 0.2 | GO:1990239 | steroid hormone binding(GO:1990239) |
0.0 | 0.1 | GO:0004663 | Rab geranylgeranyltransferase activity(GO:0004663) |
0.0 | 0.2 | GO:0003846 | 2-acylglycerol O-acyltransferase activity(GO:0003846) |
0.0 | 0.1 | GO:0019153 | protein-disulfide reductase (glutathione) activity(GO:0019153) |
0.0 | 0.1 | GO:2001069 | glycogen binding(GO:2001069) |
0.0 | 0.1 | GO:0004616 | phosphogluconate dehydrogenase (decarboxylating) activity(GO:0004616) |
0.0 | 0.1 | GO:0008309 | double-stranded DNA exodeoxyribonuclease activity(GO:0008309) |
0.0 | 0.2 | GO:0015220 | choline transmembrane transporter activity(GO:0015220) |
0.0 | 0.2 | GO:0004679 | AMP-activated protein kinase activity(GO:0004679) |
0.0 | 0.8 | GO:0003785 | actin monomer binding(GO:0003785) |
0.0 | 0.3 | GO:0002162 | dystroglycan binding(GO:0002162) |
0.0 | 0.1 | GO:0030620 | U2 snRNA binding(GO:0030620) |
0.0 | 0.1 | GO:0045504 | dynein heavy chain binding(GO:0045504) |
0.0 | 0.3 | GO:0008568 | microtubule-severing ATPase activity(GO:0008568) |
0.0 | 0.1 | GO:0048248 | CXCR3 chemokine receptor binding(GO:0048248) |
0.0 | 0.2 | GO:0036402 | proteasome-activating ATPase activity(GO:0036402) |
0.0 | 0.2 | GO:0004566 | beta-glucuronidase activity(GO:0004566) |
0.0 | 0.2 | GO:0005167 | neurotrophin TRK receptor binding(GO:0005167) |
0.0 | 0.9 | GO:0030552 | cAMP binding(GO:0030552) |
0.0 | 0.2 | GO:0052724 | inositol hexakisphosphate kinase activity(GO:0000828) inositol hexakisphosphate 5-kinase activity(GO:0000832) inositol hexakisphosphate 1-kinase activity(GO:0052723) inositol hexakisphosphate 3-kinase activity(GO:0052724) |
0.0 | 0.1 | GO:0005131 | growth hormone receptor binding(GO:0005131) |
0.0 | 0.1 | GO:0032564 | dATP binding(GO:0032564) |
0.0 | 0.1 | GO:0016842 | amidine-lyase activity(GO:0016842) |
0.0 | 0.2 | GO:0004653 | polypeptide N-acetylgalactosaminyltransferase activity(GO:0004653) |
0.0 | 0.3 | GO:0004708 | MAP kinase kinase activity(GO:0004708) |
0.0 | 0.5 | GO:0070577 | lysine-acetylated histone binding(GO:0070577) |
0.0 | 0.1 | GO:0080130 | L-phenylalanine:2-oxoglutarate aminotransferase activity(GO:0080130) |
0.0 | 0.1 | GO:0004833 | tryptophan 2,3-dioxygenase activity(GO:0004833) |
0.0 | 0.1 | GO:0031782 | melanocortin receptor binding(GO:0031779) type 3 melanocortin receptor binding(GO:0031781) type 4 melanocortin receptor binding(GO:0031782) |
0.0 | 0.2 | GO:0005072 | transforming growth factor beta receptor, cytoplasmic mediator activity(GO:0005072) |
0.0 | 0.1 | GO:0030229 | very-low-density lipoprotein particle receptor activity(GO:0030229) |
0.0 | 0.3 | GO:0097602 | cullin family protein binding(GO:0097602) |
0.0 | 0.2 | GO:0035312 | 5'-3' exodeoxyribonuclease activity(GO:0035312) |
0.0 | 0.1 | GO:0016174 | NAD(P)H oxidase activity(GO:0016174) |
0.0 | 0.7 | GO:0019206 | nucleoside kinase activity(GO:0019206) |
0.0 | 0.4 | GO:0005313 | L-glutamate transmembrane transporter activity(GO:0005313) |
0.0 | 0.1 | GO:0004591 | oxoglutarate dehydrogenase (succinyl-transferring) activity(GO:0004591) |
0.0 | 0.3 | GO:0004535 | poly(A)-specific ribonuclease activity(GO:0004535) |
0.0 | 0.1 | GO:0004062 | aryl sulfotransferase activity(GO:0004062) |
0.0 | 0.2 | GO:0004779 | sulfate adenylyltransferase activity(GO:0004779) |
0.0 | 0.3 | GO:0051010 | microtubule plus-end binding(GO:0051010) |
0.0 | 0.2 | GO:0046790 | virion binding(GO:0046790) |
0.0 | 0.1 | GO:0042609 | CD4 receptor binding(GO:0042609) |
0.0 | 0.1 | GO:0008607 | phosphorylase kinase regulator activity(GO:0008607) |
0.0 | 0.2 | GO:0097322 | 7SK snRNA binding(GO:0097322) |
0.0 | 0.1 | GO:0070878 | primary miRNA binding(GO:0070878) |
0.0 | 0.1 | GO:0005173 | stem cell factor receptor binding(GO:0005173) |
0.0 | 0.2 | GO:0004571 | mannosyl-oligosaccharide 1,2-alpha-mannosidase activity(GO:0004571) |
0.0 | 0.1 | GO:0034191 | apolipoprotein A-I receptor binding(GO:0034191) |
0.0 | 0.9 | GO:0052768 | prenylcysteine methylesterase activity(GO:0010296) 1-oxa-2-oxocycloheptane lactonase activity(GO:0018731) sulfolactone hydrolase activity(GO:0018732) butyrolactone hydrolase activity(GO:0018734) endosulfan lactone lactonase activity(GO:0034892) L-ascorbate 6-phosphate lactonase activity(GO:0035460) Ser-tRNA(Thr) hydrolase activity(GO:0043905) Ala-tRNA(Pro) hydrolase activity(GO:0043906) Cys-tRNA(Pro) hydrolase activity(GO:0043907) Ser(Gly)-tRNA(Ala) hydrolase activity(GO:0043908) all-trans-retinyl-palmitate hydrolase, all-trans-retinol forming activity(GO:0047376) mannosyl-oligosaccharide 1,6-alpha-mannosidase activity(GO:0052767) mannosyl-oligosaccharide 1,3-alpha-mannosidase activity(GO:0052768) methyl indole-3-acetate esterase activity(GO:0080030) methyl salicylate esterase activity(GO:0080031) methyl jasmonate esterase activity(GO:0080032) |
0.0 | 0.1 | GO:0004769 | steroid delta-isomerase activity(GO:0004769) |
0.0 | 0.0 | GO:0070653 | high-density lipoprotein particle receptor binding(GO:0070653) |
0.0 | 0.1 | GO:0042392 | sphingosine-1-phosphate phosphatase activity(GO:0042392) |
0.0 | 0.2 | GO:0015288 | porin activity(GO:0015288) |
0.0 | 0.2 | GO:0001206 | transcriptional repressor activity, RNA polymerase II distal enhancer sequence-specific binding(GO:0001206) |
0.0 | 0.1 | GO:0003831 | beta-N-acetylglucosaminylglycopeptide beta-1,4-galactosyltransferase activity(GO:0003831) |
0.0 | 0.3 | GO:0050321 | tau-protein kinase activity(GO:0050321) |
0.0 | 0.1 | GO:0016530 | metallochaperone activity(GO:0016530) |
0.0 | 0.2 | GO:0043140 | ATP-dependent 3'-5' DNA helicase activity(GO:0043140) |
0.0 | 0.1 | GO:0001665 | alpha-N-acetylgalactosaminide alpha-2,6-sialyltransferase activity(GO:0001665) |
0.0 | 0.1 | GO:0050510 | N-acetylgalactosaminyl-proteoglycan 3-beta-glucuronosyltransferase activity(GO:0050510) |
0.0 | 0.1 | GO:0015057 | thrombin receptor activity(GO:0015057) |
0.0 | 0.1 | GO:0008449 | N-acetylglucosamine-6-sulfatase activity(GO:0008449) |
0.0 | 0.1 | GO:0032190 | acrosin binding(GO:0032190) |
0.0 | 0.1 | GO:0043138 | 3'-5' DNA helicase activity(GO:0043138) |
0.0 | 0.4 | GO:0005528 | macrolide binding(GO:0005527) FK506 binding(GO:0005528) |
0.0 | 0.1 | GO:0004090 | carbonyl reductase (NADPH) activity(GO:0004090) |
0.0 | 0.1 | GO:0019784 | NEDD8-specific protease activity(GO:0019784) |
0.0 | 0.0 | GO:0016361 | activin receptor activity, type I(GO:0016361) |
0.0 | 0.1 | GO:0005347 | ATP transmembrane transporter activity(GO:0005347) |
0.0 | 0.1 | GO:0097493 | structural molecule activity conferring elasticity(GO:0097493) |
0.0 | 0.1 | GO:0017034 | Rap guanyl-nucleotide exchange factor activity(GO:0017034) |
0.0 | 0.1 | GO:0005047 | signal recognition particle binding(GO:0005047) |
0.0 | 0.3 | GO:0004694 | eukaryotic translation initiation factor 2alpha kinase activity(GO:0004694) |
0.0 | 0.1 | GO:1990050 | phosphatidic acid transporter activity(GO:1990050) |
0.0 | 0.2 | GO:0004579 | dolichyl-diphosphooligosaccharide-protein glycotransferase activity(GO:0004579) |
0.0 | 0.8 | GO:0017046 | peptide hormone binding(GO:0017046) |
0.0 | 0.1 | GO:0030976 | thiamine pyrophosphate binding(GO:0030976) |
0.0 | 0.0 | GO:0004376 | glycolipid mannosyltransferase activity(GO:0004376) |
0.0 | 0.1 | GO:0031685 | adenosine receptor binding(GO:0031685) |
0.0 | 0.1 | GO:0005275 | amine transmembrane transporter activity(GO:0005275) |
0.0 | 0.2 | GO:0016668 | oxidoreductase activity, acting on a sulfur group of donors, NAD(P) as acceptor(GO:0016668) |
0.0 | 0.2 | GO:0035197 | siRNA binding(GO:0035197) |
0.0 | 0.1 | GO:0004723 | calcium-dependent protein serine/threonine phosphatase activity(GO:0004723) |
0.0 | 0.0 | GO:0043533 | inositol 1,3,4,5 tetrakisphosphate binding(GO:0043533) |
0.0 | 0.1 | GO:0004332 | fructose-bisphosphate aldolase activity(GO:0004332) |
0.0 | 0.1 | GO:0008073 | ornithine decarboxylase inhibitor activity(GO:0008073) |
0.0 | 0.0 | GO:0070699 | type II activin receptor binding(GO:0070699) |
0.0 | 0.0 | GO:0015065 | uridine nucleotide receptor activity(GO:0015065) G-protein coupled pyrimidinergic nucleotide receptor activity(GO:0071553) |
0.0 | 0.1 | GO:0070579 | methylcytosine dioxygenase activity(GO:0070579) |
0.0 | 0.1 | GO:0033300 | dehydroascorbic acid transporter activity(GO:0033300) |
0.0 | 0.1 | GO:0001849 | complement component C1q binding(GO:0001849) |
0.0 | 0.2 | GO:0019869 | chloride channel inhibitor activity(GO:0019869) |
0.0 | 0.1 | GO:0030346 | protein phosphatase 2B binding(GO:0030346) |
0.0 | 0.1 | GO:0004687 | myosin light chain kinase activity(GO:0004687) |
0.0 | 0.1 | GO:0005007 | fibroblast growth factor-activated receptor activity(GO:0005007) |
0.0 | 0.1 | GO:0035671 | enone reductase activity(GO:0035671) |
0.0 | 0.2 | GO:0016888 | endodeoxyribonuclease activity, producing 5'-phosphomonoesters(GO:0016888) |
0.0 | 0.4 | GO:0008139 | nuclear localization sequence binding(GO:0008139) |
0.0 | 0.1 | GO:0002054 | nucleobase binding(GO:0002054) |
0.0 | 0.3 | GO:0004435 | phosphatidylinositol phospholipase C activity(GO:0004435) |
0.0 | 0.3 | GO:0044688 | calmodulin-dependent cyclic-nucleotide phosphodiesterase activity(GO:0004117) cGMP-stimulated cyclic-nucleotide phosphodiesterase activity(GO:0004118) cGMP-inhibited cyclic-nucleotide phosphodiesterase activity(GO:0004119) photoreceptor cyclic-nucleotide phosphodiesterase activity(GO:0004120) 7,8-dihydro-D-neopterin 2',3'-cyclic phosphate phosphodiesterase activity(GO:0044688) inositol phosphosphingolipid phospholipase activity(GO:0052712) inositol phosphorylceramide phospholipase activity(GO:0052713) mannosyl-inositol phosphorylceramide phospholipase activity(GO:0052714) mannosyl-diinositol phosphorylceramide phospholipase activity(GO:0052715) |
0.0 | 0.1 | GO:0001602 | pancreatic polypeptide receptor activity(GO:0001602) |
0.0 | 0.1 | GO:0004726 | non-membrane spanning protein tyrosine phosphatase activity(GO:0004726) |
0.0 | 0.1 | GO:0003829 | beta-1,3-galactosyl-O-glycosyl-glycoprotein beta-1,6-N-acetylglucosaminyltransferase activity(GO:0003829) |
0.0 | 0.4 | GO:0004364 | glutathione transferase activity(GO:0004364) |
0.0 | 0.2 | GO:0015643 | toxic substance binding(GO:0015643) |
0.0 | 0.2 | GO:0045236 | CXCR chemokine receptor binding(GO:0045236) |
0.0 | 0.1 | GO:0015154 | sucrose:proton symporter activity(GO:0008506) sucrose transmembrane transporter activity(GO:0008515) disaccharide transmembrane transporter activity(GO:0015154) oligosaccharide transmembrane transporter activity(GO:0015157) |
0.0 | 0.2 | GO:0015924 | mannosyl-oligosaccharide mannosidase activity(GO:0015924) |
0.0 | 0.0 | GO:0000009 | alpha-1,6-mannosyltransferase activity(GO:0000009) |
0.0 | 0.0 | GO:0005006 | epidermal growth factor-activated receptor activity(GO:0005006) |
0.0 | 0.2 | GO:0017128 | phospholipid scramblase activity(GO:0017128) |
0.0 | 0.1 | GO:0004716 | receptor signaling protein tyrosine kinase activity(GO:0004716) |
0.0 | 0.1 | GO:0016215 | acyl-CoA desaturase activity(GO:0016215) |
0.0 | 0.0 | GO:0010484 | H3 histone acetyltransferase activity(GO:0010484) |
0.0 | 0.1 | GO:0016715 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, reduced ascorbate as one donor, and incorporation of one atom of oxygen(GO:0016715) |
0.0 | 0.3 | GO:0008137 | NADH dehydrogenase (ubiquinone) activity(GO:0008137) NADH dehydrogenase (quinone) activity(GO:0050136) |
0.0 | 0.1 | GO:0003956 | NAD(P)+-protein-arginine ADP-ribosyltransferase activity(GO:0003956) |
0.0 | 0.1 | GO:0070815 | peptidyl-lysine 5-dioxygenase activity(GO:0070815) |
0.0 | 0.6 | GO:0005547 | phosphatidylinositol-3,4,5-trisphosphate binding(GO:0005547) |
0.0 | 0.3 | GO:0005487 | nucleocytoplasmic transporter activity(GO:0005487) |
0.0 | 0.1 | GO:0003688 | DNA replication origin binding(GO:0003688) |
0.0 | 0.1 | GO:0003985 | acetyl-CoA C-acetyltransferase activity(GO:0003985) C-acetyltransferase activity(GO:0016453) |
0.0 | 0.1 | GO:0016655 | oxidoreductase activity, acting on NAD(P)H, quinone or similar compound as acceptor(GO:0016655) |
0.0 | 0.0 | GO:0005119 | smoothened binding(GO:0005119) |
0.0 | 0.2 | GO:0005172 | vascular endothelial growth factor receptor binding(GO:0005172) |
0.0 | 0.0 | GO:0061676 | importin-alpha family protein binding(GO:0061676) |
0.0 | 0.1 | GO:0034450 | ubiquitin-ubiquitin ligase activity(GO:0034450) |
0.0 | 0.1 | GO:0070087 | chromo shadow domain binding(GO:0070087) |
0.0 | 0.1 | GO:0070097 | delta-catenin binding(GO:0070097) |
0.0 | 0.0 | GO:0004814 | arginine-tRNA ligase activity(GO:0004814) |
0.0 | 0.1 | GO:0070181 | small ribosomal subunit rRNA binding(GO:0070181) |
0.0 | 0.1 | GO:0042043 | neurexin family protein binding(GO:0042043) |
0.0 | 0.2 | GO:0000983 | transcription factor activity, RNA polymerase II core promoter sequence-specific(GO:0000983) |
0.0 | 0.1 | GO:0003708 | retinoic acid receptor activity(GO:0003708) |
0.0 | 0.0 | GO:0042979 | ornithine decarboxylase regulator activity(GO:0042979) |
0.0 | 0.2 | GO:0004889 | acetylcholine-activated cation-selective channel activity(GO:0004889) |
0.0 | 0.1 | GO:0016500 | protein-hormone receptor activity(GO:0016500) |
0.0 | 0.1 | GO:0030375 | thyroid hormone receptor coactivator activity(GO:0030375) |
0.0 | 0.1 | GO:0034875 | oxidoreductase activity, acting on CH or CH2 groups, quinone or similar compound as acceptor(GO:0033695) caffeine oxidase activity(GO:0034875) |
0.0 | 0.1 | GO:0004556 | alpha-amylase activity(GO:0004556) |
0.0 | 0.1 | GO:0017040 | ceramidase activity(GO:0017040) |
0.0 | 0.1 | GO:0008526 | phosphatidylinositol transporter activity(GO:0008526) |
0.0 | 0.0 | GO:0043423 | 3-phosphoinositide-dependent protein kinase binding(GO:0043423) |
0.0 | 0.2 | GO:0019531 | oxalate transmembrane transporter activity(GO:0019531) |
0.0 | 0.1 | GO:0008508 | bile acid:sodium symporter activity(GO:0008508) |
0.0 | 0.1 | GO:0004634 | phosphopyruvate hydratase activity(GO:0004634) |
0.0 | 0.0 | GO:0003941 | L-serine ammonia-lyase activity(GO:0003941) |
0.0 | 0.1 | GO:0043325 | phosphatidylinositol-3,4-bisphosphate binding(GO:0043325) |
0.0 | 0.0 | GO:0008297 | single-stranded DNA exodeoxyribonuclease activity(GO:0008297) |
0.0 | 0.1 | GO:0034235 | GPI anchor binding(GO:0034235) |
0.0 | 0.2 | GO:0043014 | alpha-tubulin binding(GO:0043014) |
0.0 | 0.1 | GO:0102391 | decanoate--CoA ligase activity(GO:0102391) |
0.0 | 0.0 | GO:0097200 | cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:0097200) |
0.0 | 0.0 | GO:0016838 | carbon-oxygen lyase activity, acting on phosphates(GO:0016838) |
0.0 | 0.0 | GO:0005157 | macrophage colony-stimulating factor receptor binding(GO:0005157) |
0.0 | 0.0 | GO:0015440 | peptide-transporting ATPase activity(GO:0015440) |
0.0 | 0.1 | GO:0016832 | aldehyde-lyase activity(GO:0016832) |
0.0 | 0.0 | GO:0003917 | DNA topoisomerase type I activity(GO:0003917) |
0.0 | 0.0 | GO:0004582 | dolichyl-phosphate beta-D-mannosyltransferase activity(GO:0004582) |
0.0 | 0.0 | GO:0051033 | nucleic acid transmembrane transporter activity(GO:0051032) RNA transmembrane transporter activity(GO:0051033) |
0.0 | 0.9 | GO:0015020 | glucuronosyltransferase activity(GO:0015020) |
0.0 | 0.0 | GO:0030350 | iron-responsive element binding(GO:0030350) |
0.0 | 0.1 | GO:0098599 | palmitoyl-(protein) hydrolase activity(GO:0008474) palmitoyl hydrolase activity(GO:0098599) |
0.0 | 0.0 | GO:0055131 | C3HC4-type RING finger domain binding(GO:0055131) |
0.0 | 0.5 | GO:0000049 | tRNA binding(GO:0000049) |
0.0 | 0.0 | GO:0004427 | inorganic diphosphatase activity(GO:0004427) |
0.0 | 0.0 | GO:0047961 | glycine N-acyltransferase activity(GO:0047961) |
0.0 | 0.0 | GO:0030297 | transmembrane receptor protein tyrosine kinase activator activity(GO:0030297) |
0.0 | 0.1 | GO:0004859 | phospholipase inhibitor activity(GO:0004859) |
0.0 | 0.0 | GO:0017150 | tRNA dihydrouridine synthase activity(GO:0017150) |
0.0 | 0.0 | GO:0034186 | apolipoprotein A-I binding(GO:0034186) |
0.0 | 0.0 | GO:0060228 | phosphatidylcholine-sterol O-acyltransferase activator activity(GO:0060228) |
0.0 | 0.1 | GO:0103116 | alpha-D-galactofuranose transporter activity(GO:0103116) |
0.0 | 0.1 | GO:0002161 | aminoacyl-tRNA editing activity(GO:0002161) |
0.0 | 0.0 | GO:0000295 | adenine nucleotide transmembrane transporter activity(GO:0000295) purine ribonucleotide transmembrane transporter activity(GO:0005346) purine nucleotide transmembrane transporter activity(GO:0015216) |
0.0 | 0.3 | GO:0016765 | transferase activity, transferring alkyl or aryl (other than methyl) groups(GO:0016765) |
0.0 | 0.1 | GO:0019911 | structural constituent of myelin sheath(GO:0019911) |
0.0 | 0.2 | GO:0003756 | protein disulfide isomerase activity(GO:0003756) intramolecular oxidoreductase activity, transposing S-S bonds(GO:0016864) |
0.0 | 0.0 | GO:0031826 | type 2A serotonin receptor binding(GO:0031826) |
0.0 | 0.1 | GO:0016813 | hydrolase activity, acting on carbon-nitrogen (but not peptide) bonds, in linear amidines(GO:0016813) |
0.0 | 0.1 | GO:0002151 | G-quadruplex RNA binding(GO:0002151) |
0.0 | 0.0 | GO:0000253 | 3-keto sterol reductase activity(GO:0000253) |
0.0 | 0.2 | GO:0016922 | ligand-dependent nuclear receptor binding(GO:0016922) |
0.0 | 0.0 | GO:0016662 | oxidoreductase activity, acting on other nitrogenous compounds as donors, cytochrome as acceptor(GO:0016662) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.1 | 1.5 | PID ERBB NETWORK PATHWAY | ErbB receptor signaling network |
0.0 | 0.8 | PID NFKAPPAB ATYPICAL PATHWAY | Atypical NF-kappaB pathway |
0.0 | 1.6 | PID HEDGEHOG GLI PATHWAY | Hedgehog signaling events mediated by Gli proteins |
0.0 | 1.4 | PID HES HEY PATHWAY | Notch-mediated HES/HEY network |
0.0 | 0.9 | PID ER NONGENOMIC PATHWAY | Plasma membrane estrogen receptor signaling |
0.0 | 0.3 | PID P38 GAMMA DELTA PATHWAY | Signaling mediated by p38-gamma and p38-delta |
0.0 | 0.3 | PID ALK2 PATHWAY | ALK2 signaling events |
0.0 | 0.1 | ST STAT3 PATHWAY | STAT3 Pathway |
0.0 | 0.0 | PID ANTHRAX PATHWAY | Cellular roles of Anthrax toxin |
0.0 | 0.5 | PID PI3K PLC TRK PATHWAY | Trk receptor signaling mediated by PI3K and PLC-gamma |
0.0 | 0.1 | SA REG CASCADE OF CYCLIN EXPR | Expression of cyclins regulates progression through the cell cycle by activating cyclin-dependent kinases. |
0.0 | 0.5 | PID RXR VDR PATHWAY | RXR and RAR heterodimerization with other nuclear receptor |
0.0 | 0.3 | ST WNT CA2 CYCLIC GMP PATHWAY | Wnt/Ca2+/cyclic GMP signaling. |
0.0 | 0.0 | PID IFNG PATHWAY | IFN-gamma pathway |
0.0 | 0.1 | ST PHOSPHOINOSITIDE 3 KINASE PATHWAY | PI3K Pathway |
0.0 | 0.5 | PID SHP2 PATHWAY | SHP2 signaling |
0.0 | 0.5 | PID FOXM1 PATHWAY | FOXM1 transcription factor network |
0.0 | 0.2 | PID ALK1 PATHWAY | ALK1 signaling events |
0.0 | 0.2 | PID SYNDECAN 3 PATHWAY | Syndecan-3-mediated signaling events |
0.0 | 0.2 | PID WNT CANONICAL PATHWAY | Canonical Wnt signaling pathway |
0.0 | 0.2 | ST G ALPHA I PATHWAY | G alpha i Pathway |
0.0 | 0.1 | PID CD8 TCR PATHWAY | TCR signaling in naïve CD8+ T cells |
0.0 | 0.2 | PID DNA PK PATHWAY | DNA-PK pathway in nonhomologous end joining |
0.0 | 0.0 | PID WNT NONCANONICAL PATHWAY | Noncanonical Wnt signaling pathway |
0.0 | 0.1 | PID ECADHERIN KERATINOCYTE PATHWAY | E-cadherin signaling in keratinocytes |
0.0 | 0.0 | PID NFAT 3PATHWAY | Role of Calcineurin-dependent NFAT signaling in lymphocytes |
0.0 | 0.1 | SA PTEN PATHWAY | PTEN is a tumor suppressor that dephosphorylates the lipid messenger phosphatidylinositol triphosphate. |
0.0 | 0.0 | PID IL2 STAT5 PATHWAY | IL2 signaling events mediated by STAT5 |
0.0 | 0.0 | SIG PIP3 SIGNALING IN B LYMPHOCYTES | Genes related to PIP3 signaling in B lymphocytes |
0.0 | 0.0 | SA G2 AND M PHASES | Cdc25 activates the cdc2/cyclin B complex to induce the G2/M transition. |
0.0 | 0.4 | PID AR TF PATHWAY | Regulation of Androgen receptor activity |
0.0 | 0.4 | NABA PROTEOGLYCANS | Genes encoding proteoglycans |
0.0 | 0.1 | PID PDGFRA PATHWAY | PDGFR-alpha signaling pathway |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.1 | 1.0 | REACTOME PROLACTIN RECEPTOR SIGNALING | Genes involved in Prolactin receptor signaling |
0.1 | 1.6 | REACTOME SIGNALING BY CONSTITUTIVELY ACTIVE EGFR | Genes involved in Signaling by constitutively active EGFR |
0.1 | 0.9 | REACTOME ALPHA LINOLENIC ACID ALA METABOLISM | Genes involved in alpha-linolenic acid (ALA) metabolism |
0.1 | 0.4 | REACTOME ETHANOL OXIDATION | Genes involved in Ethanol oxidation |
0.1 | 1.0 | REACTOME ANTIGEN PRESENTATION FOLDING ASSEMBLY AND PEPTIDE LOADING OF CLASS I MHC | Genes involved in Antigen Presentation: Folding, assembly and peptide loading of class I MHC |
0.1 | 0.6 | REACTOME SYNTHESIS OF PE | Genes involved in Synthesis of PE |
0.1 | 0.7 | REACTOME ENDOGENOUS STEROLS | Genes involved in Endogenous sterols |
0.0 | 0.7 | REACTOME RAP1 SIGNALLING | Genes involved in Rap1 signalling |
0.0 | 0.4 | REACTOME CALNEXIN CALRETICULIN CYCLE | Genes involved in Calnexin/calreticulin cycle |
0.0 | 0.5 | REACTOME ASSOCIATION OF LICENSING FACTORS WITH THE PRE REPLICATIVE COMPLEX | Genes involved in Association of licensing factors with the pre-replicative complex |
0.0 | 0.0 | REACTOME SYNTHESIS OF PIPS AT THE LATE ENDOSOME MEMBRANE | Genes involved in Synthesis of PIPs at the late endosome membrane |
0.0 | 0.5 | REACTOME SYNTHESIS OF PIPS AT THE EARLY ENDOSOME MEMBRANE | Genes involved in Synthesis of PIPs at the early endosome membrane |
0.0 | 1.1 | REACTOME REGULATION OF BETA CELL DEVELOPMENT | Genes involved in Regulation of beta-cell development |
0.0 | 0.4 | REACTOME REGULATION OF RHEB GTPASE ACTIVITY BY AMPK | Genes involved in Regulation of Rheb GTPase activity by AMPK |
0.0 | 0.4 | REACTOME PURINE SALVAGE | Genes involved in Purine salvage |
0.0 | 0.1 | REACTOME PROSTACYCLIN SIGNALLING THROUGH PROSTACYCLIN RECEPTOR | Genes involved in Prostacyclin signalling through prostacyclin receptor |
0.0 | 0.4 | REACTOME SHC1 EVENTS IN ERBB4 SIGNALING | Genes involved in SHC1 events in ERBB4 signaling |
0.0 | 0.6 | REACTOME SIGNALING BY NODAL | Genes involved in Signaling by NODAL |
0.0 | 0.2 | REACTOME NFKB IS ACTIVATED AND SIGNALS SURVIVAL | Genes involved in NF-kB is activated and signals survival |
0.0 | 0.1 | REACTOME ER PHAGOSOME PATHWAY | Genes involved in ER-Phagosome pathway |
0.0 | 0.2 | REACTOME ABACAVIR TRANSPORT AND METABOLISM | Genes involved in Abacavir transport and metabolism |
0.0 | 0.3 | REACTOME TRYPTOPHAN CATABOLISM | Genes involved in Tryptophan catabolism |
0.0 | 0.4 | REACTOME AMINO ACID SYNTHESIS AND INTERCONVERSION TRANSAMINATION | Genes involved in Amino acid synthesis and interconversion (transamination) |
0.0 | 0.3 | REACTOME METABOLISM OF POLYAMINES | Genes involved in Metabolism of polyamines |
0.0 | 0.2 | REACTOME ELEVATION OF CYTOSOLIC CA2 LEVELS | Genes involved in Elevation of cytosolic Ca2+ levels |
0.0 | 0.2 | REACTOME ACTIVATION OF THE AP1 FAMILY OF TRANSCRIPTION FACTORS | Genes involved in Activation of the AP-1 family of transcription factors |
0.0 | 0.6 | REACTOME GLUCONEOGENESIS | Genes involved in Gluconeogenesis |
0.0 | 0.1 | REACTOME XENOBIOTICS | Genes involved in Xenobiotics |
0.0 | 0.5 | REACTOME GLUTATHIONE CONJUGATION | Genes involved in Glutathione conjugation |
0.0 | 0.3 | REACTOME PYRIMIDINE CATABOLISM | Genes involved in Pyrimidine catabolism |
0.0 | 0.5 | REACTOME PHASE1 FUNCTIONALIZATION OF COMPOUNDS | Genes involved in Phase 1 - Functionalization of compounds |
0.0 | 0.2 | REACTOME CYTOSOLIC SULFONATION OF SMALL MOLECULES | Genes involved in Cytosolic sulfonation of small molecules |
0.0 | 0.3 | REACTOME SYNTHESIS OF PC | Genes involved in Synthesis of PC |
0.0 | 0.1 | REACTOME SYNTHESIS OF BILE ACIDS AND BILE SALTS VIA 24 HYDROXYCHOLESTEROL | Genes involved in Synthesis of bile acids and bile salts via 24-hydroxycholesterol |
0.0 | 0.1 | REACTOME SHC RELATED EVENTS | Genes involved in SHC-related events |
0.0 | 0.0 | REACTOME MEMBRANE TRAFFICKING | Genes involved in Membrane Trafficking |
0.0 | 0.9 | REACTOME NUCLEAR RECEPTOR TRANSCRIPTION PATHWAY | Genes involved in Nuclear Receptor transcription pathway |
0.0 | 0.1 | REACTOME IL 6 SIGNALING | Genes involved in Interleukin-6 signaling |
0.0 | 0.1 | REACTOME NEGATIVE REGULATION OF THE PI3K AKT NETWORK | Genes involved in Negative regulation of the PI3K/AKT network |
0.0 | 0.9 | REACTOME DESTABILIZATION OF MRNA BY AUF1 HNRNP D0 | Genes involved in Destabilization of mRNA by AUF1 (hnRNP D0) |
0.0 | 0.3 | REACTOME ABCA TRANSPORTERS IN LIPID HOMEOSTASIS | Genes involved in ABCA transporters in lipid homeostasis |
0.0 | 0.1 | REACTOME SIGNAL ATTENUATION | Genes involved in Signal attenuation |
0.0 | 0.2 | REACTOME HIGHLY CALCIUM PERMEABLE POSTSYNAPTIC NICOTINIC ACETYLCHOLINE RECEPTORS | Genes involved in Highly calcium permeable postsynaptic nicotinic acetylcholine receptors |
0.0 | 0.8 | REACTOME FORMATION OF THE TERNARY COMPLEX AND SUBSEQUENTLY THE 43S COMPLEX | Genes involved in Formation of the ternary complex, and subsequently, the 43S complex |
0.0 | 0.4 | REACTOME SMAD2 SMAD3 SMAD4 HETEROTRIMER REGULATES TRANSCRIPTION | Genes involved in SMAD2/SMAD3:SMAD4 heterotrimer regulates transcription |
0.0 | 0.0 | REACTOME NEP NS2 INTERACTS WITH THE CELLULAR EXPORT MACHINERY | Genes involved in NEP/NS2 Interacts with the Cellular Export Machinery |
0.0 | 0.1 | REACTOME REGULATION OF ORNITHINE DECARBOXYLASE ODC | Genes involved in Regulation of ornithine decarboxylase (ODC) |
0.0 | 0.1 | REACTOME BETA DEFENSINS | Genes involved in Beta defensins |
0.0 | 0.2 | REACTOME TGF BETA RECEPTOR SIGNALING IN EMT EPITHELIAL TO MESENCHYMAL TRANSITION | Genes involved in TGF-beta receptor signaling in EMT (epithelial to mesenchymal transition) |
0.0 | 0.2 | REACTOME BOTULINUM NEUROTOXICITY | Genes involved in Botulinum neurotoxicity |
0.0 | 0.3 | REACTOME DARPP 32 EVENTS | Genes involved in DARPP-32 events |
0.0 | 0.4 | REACTOME MYOGENESIS | Genes involved in Myogenesis |
0.0 | 0.2 | REACTOME GLUTAMATE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Glutamate Neurotransmitter Release Cycle |
0.0 | 0.2 | REACTOME G1 PHASE | Genes involved in G1 Phase |
0.0 | 0.3 | REACTOME SMOOTH MUSCLE CONTRACTION | Genes involved in Smooth Muscle Contraction |
0.0 | 0.0 | REACTOME ENDOSOMAL VACUOLAR PATHWAY | Genes involved in Endosomal/Vacuolar pathway |
0.0 | 0.1 | REACTOME CELL CYCLE CHECKPOINTS | Genes involved in Cell Cycle Checkpoints |
0.0 | 0.1 | REACTOME NRIF SIGNALS CELL DEATH FROM THE NUCLEUS | Genes involved in NRIF signals cell death from the nucleus |
0.0 | 0.3 | REACTOME COMPLEMENT CASCADE | Genes involved in Complement cascade |
0.0 | 0.2 | REACTOME BRANCHED CHAIN AMINO ACID CATABOLISM | Genes involved in Branched-chain amino acid catabolism |
0.0 | 0.3 | REACTOME MITOCHONDRIAL TRNA AMINOACYLATION | Genes involved in Mitochondrial tRNA aminoacylation |
0.0 | 0.2 | REACTOME MRNA DECAY BY 5 TO 3 EXORIBONUCLEASE | Genes involved in mRNA Decay by 5' to 3' Exoribonuclease |
0.0 | 0.1 | REACTOME FGFR2C LIGAND BINDING AND ACTIVATION | Genes involved in FGFR2c ligand binding and activation |
0.0 | 0.2 | REACTOME METABOLISM OF PORPHYRINS | Genes involved in Metabolism of porphyrins |
0.0 | 0.1 | REACTOME TRAFFICKING AND PROCESSING OF ENDOSOMAL TLR | Genes involved in Trafficking and processing of endosomal TLR |
0.0 | 0.0 | REACTOME ACTIVATION OF CHAPERONE GENES BY ATF6 ALPHA | Genes involved in Activation of Chaperone Genes by ATF6-alpha |
0.0 | 0.1 | REACTOME IONOTROPIC ACTIVITY OF KAINATE RECEPTORS | Genes involved in Ionotropic activity of Kainate Receptors |
0.0 | 0.1 | REACTOME INTERACTIONS OF VPR WITH HOST CELLULAR PROTEINS | Genes involved in Interactions of Vpr with host cellular proteins |
0.0 | 0.2 | REACTOME PERK REGULATED GENE EXPRESSION | Genes involved in PERK regulated gene expression |
0.0 | 0.8 | REACTOME METABOLISM OF AMINO ACIDS AND DERIVATIVES | Genes involved in Metabolism of amino acids and derivatives |
0.0 | 0.1 | REACTOME NEF MEDIATED DOWNREGULATION OF MHC CLASS I COMPLEX CELL SURFACE EXPRESSION | Genes involved in Nef mediated downregulation of MHC class I complex cell surface expression |
0.0 | 0.1 | REACTOME MEMBRANE BINDING AND TARGETTING OF GAG PROTEINS | Genes involved in Membrane binding and targetting of GAG proteins |
0.0 | 0.1 | REACTOME SIGNALING BY FGFR1 FUSION MUTANTS | Genes involved in Signaling by FGFR1 fusion mutants |
0.0 | 0.1 | REACTOME BIOLOGICAL OXIDATIONS | Genes involved in Biological oxidations |
0.0 | 0.1 | REACTOME ACTIVATION OF BH3 ONLY PROTEINS | Genes involved in Activation of BH3-only proteins |