Gene Symbol | Gene ID | Gene Info |
---|---|---|
Hbp1
|
ENSMUSG00000002996.11 | Hbp1 |
Gene | Promoter | Distance | Association probability | Pearson corr. coef. | P-value | Plot |
---|---|---|---|---|---|---|
Hbp1 | chr12_31973620_31973781 | 23165 | 0.177418 | -0.85 | 3.0e-02 | Click! |
Hbp1 | chr12_31950204_31950930 | 32 | 0.978852 | -0.83 | 4.0e-02 | Click! |
Hbp1 | chr12_31967695_31967854 | 17239 | 0.188758 | 0.69 | 1.3e-01 | Click! |
Hbp1 | chr12_31953393_31953572 | 2947 | 0.269896 | -0.54 | 2.7e-01 | Click! |
Hbp1 | chr12_31939149_31939308 | 1179 | 0.490185 | -0.52 | 2.9e-01 | Click! |
Move your cursor over a bar to see sample name and corresponding Z-value.
Cis Regulatory Element (CRE) | Target Score | Top associated gene | Gene Info | Distance of CRE to TSS | CRE/Gene association probability |
---|---|---|---|---|---|
chr12_101954170_101954556 | 9.02 |
Atxn3 |
ataxin 3 |
3785 |
0.17 |
chr12_101953826_101954166 | 7.60 |
Atxn3 |
ataxin 3 |
4152 |
0.17 |
chr15_3453354_3453796 | 3.60 |
Ghr |
growth hormone receptor |
18069 |
0.26 |
chr12_104346905_104347119 | 3.33 |
Serpina3k |
serine (or cysteine) peptidase inhibitor, clade A, member 3K |
8526 |
0.12 |
chr1_188125975_188126247 | 3.27 |
Gm38315 |
predicted gene, 38315 |
34596 |
0.21 |
chr6_14778417_14778568 | 3.21 |
Ppp1r3a |
protein phosphatase 1, regulatory subunit 3A |
23218 |
0.27 |
chr9_74894770_74895613 | 3.16 |
Onecut1 |
one cut domain, family member 1 |
28707 |
0.13 |
chr11_80974045_80974315 | 3.06 |
Gm11416 |
predicted gene 11416 |
72614 |
0.1 |
chr4_106777883_106778393 | 2.97 |
Gm12745 |
predicted gene 12745 |
3322 |
0.19 |
chr16_81331237_81331468 | 2.83 |
Gm49555 |
predicted gene, 49555 |
41190 |
0.19 |
chr11_43783562_43783743 | 2.83 |
Ttc1 |
tetratricopeptide repeat domain 1 |
35644 |
0.16 |
chr6_24610042_24610446 | 2.76 |
Lmod2 |
leiomodin 2 (cardiac) |
12482 |
0.14 |
chr7_30191689_30191840 | 2.70 |
Capns1 |
calpain, small subunit 1 |
646 |
0.42 |
chr5_86114696_86114880 | 2.70 |
Stap1 |
signal transducing adaptor family member 1 |
28330 |
0.13 |
chr18_62095944_62096108 | 2.70 |
Gm41750 |
predicted gene, 41750 |
46592 |
0.14 |
chr1_21266470_21266781 | 2.65 |
Gm28836 |
predicted gene 28836 |
4968 |
0.12 |
chr15_12256840_12256991 | 2.65 |
Gm46497 |
predicted gene, 46497 |
29754 |
0.11 |
chr14_93074940_93075115 | 2.61 |
Gm23509 |
predicted gene, 23509 |
63162 |
0.13 |
chr2_5839502_5839908 | 2.59 |
Cdc123 |
cell division cycle 123 |
5146 |
0.16 |
chr10_124590350_124590536 | 2.53 |
4930503E24Rik |
RIKEN cDNA 4930503E24 gene |
67005 |
0.14 |
chr7_63899068_63899509 | 2.48 |
Gm27252 |
predicted gene 27252 |
1314 |
0.37 |
chr3_111375833_111375988 | 2.47 |
Gm9314 |
predicted gene 9314 |
53053 |
0.18 |
chr2_134826467_134826626 | 2.46 |
Gm14036 |
predicted gene 14036 |
22597 |
0.2 |
chr3_97635501_97635936 | 2.44 |
Fmo5 |
flavin containing monooxygenase 5 |
6835 |
0.14 |
chr18_17623971_17624154 | 2.44 |
4930545E07Rik |
RIKEN cDNA 4930545E07 gene |
43072 |
0.18 |
chr2_134828446_134828597 | 2.41 |
Gm14036 |
predicted gene 14036 |
24572 |
0.2 |
chr7_98352590_98353259 | 2.33 |
Tsku |
tsukushi, small leucine rich proteoglycan |
7155 |
0.18 |
chr8_36246171_36246329 | 2.31 |
Lonrf1 |
LON peptidase N-terminal domain and ring finger 1 |
3266 |
0.26 |
chr10_115511796_115512121 | 2.30 |
Lgr5 |
leucine rich repeat containing G protein coupled receptor 5 |
48879 |
0.12 |
chr9_106238560_106238771 | 2.28 |
Alas1 |
aminolevulinic acid synthase 1 |
65 |
0.95 |
chr9_122049922_122050484 | 2.25 |
Gm39465 |
predicted gene, 39465 |
1155 |
0.34 |
chr9_57719905_57720075 | 2.24 |
Edc3 |
enhancer of mRNA decapping 3 |
11423 |
0.12 |
chr3_51187254_51187408 | 2.23 |
Noct |
nocturnin |
37116 |
0.12 |
chr9_74893395_74893777 | 2.19 |
Onecut1 |
one cut domain, family member 1 |
27102 |
0.13 |
chr1_21262098_21262745 | 2.19 |
Gsta3 |
glutathione S-transferase, alpha 3 |
8900 |
0.11 |
chr1_52798933_52799346 | 2.16 |
Inpp1 |
inositol polyphosphate-1-phosphatase |
349 |
0.87 |
chr9_74963277_74963428 | 2.10 |
Fam214a |
family with sequence similarity 214, member A |
10280 |
0.2 |
chr5_90784909_90785060 | 2.08 |
Cxcl3 |
chemokine (C-X-C motif) ligand 3 |
1119 |
0.31 |
chr2_110303618_110304067 | 2.08 |
Bbox1 |
butyrobetaine (gamma), 2-oxoglutarate dioxygenase 1 (gamma-butyrobetaine hydroxylase) |
1899 |
0.39 |
chr3_52257597_52258053 | 2.07 |
Foxo1 |
forkhead box O1 |
10511 |
0.12 |
chr16_49530654_49530805 | 2.07 |
Gm6931 |
predicted gene 6931 |
105923 |
0.07 |
chr5_17296254_17296405 | 2.05 |
Gm6673 |
predicted gene 6673 |
68395 |
0.11 |
chr3_149437041_149437628 | 2.05 |
Gm30382 |
predicted gene, 30382 |
7942 |
0.29 |
chr19_20472948_20473118 | 2.04 |
Aldh1a1 |
aldehyde dehydrogenase family 1, subfamily A1 |
19682 |
0.2 |
chr12_104089620_104089844 | 2.03 |
Serpina4-ps1 |
serine (or cysteine) peptidase inhibitor, clade A, member 4, pseudogene 1 |
9083 |
0.1 |
chr6_24654911_24655065 | 2.03 |
Gm42856 |
predicted gene 42856 |
5381 |
0.18 |
chr7_115674256_115674428 | 2.03 |
Sox6 |
SRY (sex determining region Y)-box 6 |
11977 |
0.31 |
chr19_21624893_21625081 | 2.02 |
1110059E24Rik |
RIKEN cDNA 1110059E24 gene |
5781 |
0.23 |
chr18_15461862_15462026 | 2.02 |
Aqp4 |
aquaporin 4 |
50962 |
0.14 |
chr3_51226339_51227024 | 2.01 |
Noct |
nocturnin |
2211 |
0.23 |
chr2_58792449_58792713 | 2.01 |
Upp2 |
uridine phosphorylase 2 |
27256 |
0.17 |
chr5_97976296_97976447 | 2.00 |
Antxr2 |
anthrax toxin receptor 2 |
19724 |
0.18 |
chr7_134742344_134742654 | 1.99 |
Dock1 |
dedicator of cytokinesis 1 |
34956 |
0.2 |
chr2_24042725_24042881 | 1.99 |
Hnmt |
histamine N-methyltransferase |
6063 |
0.24 |
chr10_68134623_68135230 | 1.98 |
Arid5b |
AT rich interactive domain 5B (MRF1-like) |
1700 |
0.47 |
chr16_10648544_10649119 | 1.98 |
Clec16a |
C-type lectin domain family 16, member A |
18771 |
0.16 |
chr19_26823384_26823535 | 1.95 |
4931403E22Rik |
RIKEN cDNA 4931403E22 gene |
448 |
0.84 |
chr15_4678897_4679270 | 1.95 |
C6 |
complement component 6 |
48092 |
0.17 |
chr3_116271828_116272000 | 1.95 |
Gpr88 |
G-protein coupled receptor 88 |
18411 |
0.18 |
chr3_116329378_116329892 | 1.95 |
Gm29151 |
predicted gene 29151 |
20468 |
0.17 |
chr1_21265813_21266032 | 1.95 |
Gm28836 |
predicted gene 28836 |
5671 |
0.11 |
chr17_64524994_64525269 | 1.95 |
AU016765 |
expressed sequence AU016765 |
30372 |
0.2 |
chr3_138233542_138233745 | 1.92 |
Adh7 |
alcohol dehydrogenase 7 (class IV), mu or sigma polypeptide |
5592 |
0.13 |
chr7_128629489_128629745 | 1.92 |
Inpp5f |
inositol polyphosphate-5-phosphatase F |
18257 |
0.11 |
chr11_72496898_72497084 | 1.91 |
Spns3 |
spinster homolog 3 |
5452 |
0.16 |
chr9_48599126_48599309 | 1.91 |
Nnmt |
nicotinamide N-methyltransferase |
1768 |
0.43 |
chr11_49246341_49246494 | 1.90 |
Mgat1 |
mannoside acetylglucosaminyltransferase 1 |
1060 |
0.39 |
chr11_116849547_116849698 | 1.90 |
Mettl23 |
methyltransferase like 23 |
721 |
0.47 |
chr19_12771696_12771894 | 1.90 |
Cntf |
ciliary neurotrophic factor |
6163 |
0.12 |
chr14_87197890_87198041 | 1.90 |
Gm37002 |
predicted gene, 37002 |
2109 |
0.37 |
chr2_155378239_155378390 | 1.88 |
Trp53inp2 |
transformation related protein 53 inducible nuclear protein 2 |
2745 |
0.19 |
chr3_138290241_138291213 | 1.87 |
Adh1 |
alcohol dehydrogenase 1 (class I) |
13076 |
0.11 |
chr4_108085090_108085394 | 1.86 |
Mir6397 |
microRNA 6397 |
2115 |
0.24 |
chr2_31519719_31520357 | 1.86 |
Ass1 |
argininosuccinate synthetase 1 |
1548 |
0.36 |
chr9_74702140_74702734 | 1.85 |
Gm27233 |
predicted gene 27233 |
6825 |
0.25 |
chr12_55413894_55414057 | 1.84 |
Psma6 |
proteasome subunit alpha 6 |
6592 |
0.18 |
chr11_120804691_120805015 | 1.83 |
Fasn |
fatty acid synthase |
3752 |
0.1 |
chr7_39588769_39589060 | 1.81 |
Gm2058 |
predicted gene 2058 |
17 |
0.97 |
chr10_20952125_20952679 | 1.81 |
Ahi1 |
Abelson helper integration site 1 |
145 |
0.97 |
chr16_31527455_31527613 | 1.81 |
Gm46560 |
predicted gene, 46560 |
19147 |
0.15 |
chr1_80244319_80244685 | 1.80 |
Gm37932 |
predicted gene, 37932 |
11695 |
0.13 |
chr6_149225033_149225369 | 1.80 |
1700003I16Rik |
RIKEN cDNA 1700003I16 gene |
10016 |
0.16 |
chr10_89516308_89516459 | 1.78 |
Nr1h4 |
nuclear receptor subfamily 1, group H, member 4 |
9725 |
0.22 |
chr3_95864904_95865315 | 1.78 |
Mrps21 |
mitochondrial ribosomal protein S21 |
1802 |
0.16 |
chr5_125526782_125527104 | 1.76 |
Tmem132b |
transmembrane protein 132B |
4831 |
0.18 |
chr3_52648763_52649088 | 1.75 |
Gm10293 |
predicted pseudogene 10293 |
36090 |
0.17 |
chr4_150660019_150660333 | 1.75 |
Slc45a1 |
solute carrier family 45, member 1 |
8002 |
0.19 |
chr9_108690843_108691000 | 1.74 |
Prkar2a |
protein kinase, cAMP dependent regulatory, type II alpha |
1222 |
0.3 |
chr1_183402299_183402450 | 1.72 |
Taf1a |
TATA-box binding protein associated factor, RNA polymerase I, A |
6235 |
0.13 |
chr14_69153060_69153214 | 1.72 |
Rps2-ps5 |
ribosomal protein S2, pseudogene 5 |
5534 |
0.15 |
chr3_138363372_138363558 | 1.71 |
Adh6-ps1 |
alcohol dehydrogenase 6 (class V), pseudogene 1 |
10656 |
0.12 |
chr15_3458621_3458946 | 1.71 |
Ghr |
growth hormone receptor |
12861 |
0.28 |
chr16_77636531_77636682 | 1.71 |
Mir125b-2 |
microRNA 125b-2 |
9667 |
0.1 |
chr19_20637646_20637959 | 1.70 |
Aldh1a1 |
aldehyde dehydrogenase family 1, subfamily A1 |
35841 |
0.17 |
chr10_15747505_15747658 | 1.69 |
Gm32283 |
predicted gene, 32283 |
8759 |
0.18 |
chr14_55459247_55459638 | 1.68 |
Dhrs4 |
dehydrogenase/reductase (SDR family) member 4 |
19316 |
0.09 |
chr11_5917118_5917412 | 1.68 |
Gm11967 |
predicted gene 11967 |
1950 |
0.2 |
chr19_44392649_44392816 | 1.68 |
Scd1 |
stearoyl-Coenzyme A desaturase 1 |
13958 |
0.14 |
chr9_55280024_55280330 | 1.67 |
Nrg4 |
neuregulin 4 |
3395 |
0.23 |
chr10_86845407_86845780 | 1.67 |
Gm16268 |
predicted gene 16268 |
6499 |
0.14 |
chr12_32678614_32678795 | 1.66 |
Gm47937 |
predicted gene, 47937 |
5410 |
0.25 |
chr4_101352284_101352479 | 1.65 |
0610043K17Rik |
RIKEN cDNA 0610043K17 gene |
1402 |
0.26 |
chr14_55459733_55459946 | 1.64 |
Dhrs4 |
dehydrogenase/reductase (SDR family) member 4 |
18919 |
0.09 |
chr16_44174254_44174563 | 1.64 |
Usf3 |
upstream transcription factor family member 3 |
1011 |
0.55 |
chr10_89492629_89492900 | 1.64 |
Nr1h4 |
nuclear receptor subfamily 1, group H, member 4 |
13885 |
0.21 |
chr11_16850729_16850984 | 1.63 |
Egfros |
epidermal growth factor receptor, opposite strand |
20154 |
0.18 |
chr5_49304846_49305033 | 1.63 |
Kcnip4 |
Kv channel interacting protein 4 |
19280 |
0.19 |
chr6_37510078_37510463 | 1.63 |
Akr1d1 |
aldo-keto reductase family 1, member D1 |
19903 |
0.21 |
chr12_104395828_104395979 | 1.63 |
Serpina3m |
serine (or cysteine) peptidase inhibitor, clade A, member 3M |
8739 |
0.13 |
chr12_104000672_104000833 | 1.63 |
Gm28577 |
predicted gene 28577 |
4173 |
0.12 |
chr15_39800572_39800726 | 1.62 |
Gm16291 |
predicted gene 16291 |
3604 |
0.24 |
chr4_82355326_82355477 | 1.62 |
n-R5s188 |
nuclear encoded rRNA 5S 188 |
84009 |
0.1 |
chr12_104087488_104087669 | 1.61 |
Serpina4-ps1 |
serine (or cysteine) peptidase inhibitor, clade A, member 4, pseudogene 1 |
6929 |
0.1 |
chr13_69003048_69003349 | 1.60 |
Gm35161 |
predicted gene, 35161 |
2776 |
0.21 |
chrX_12792421_12792582 | 1.60 |
Gm14634 |
predicted gene 14634 |
29957 |
0.15 |
chr4_100114047_100114202 | 1.59 |
Gm12701 |
predicted gene 12701 |
5497 |
0.23 |
chr1_87798879_87799044 | 1.59 |
Sag |
S-antigen, retina and pineal gland (arrestin) |
4719 |
0.14 |
chr2_120084456_120084663 | 1.58 |
Sptbn5 |
spectrin beta, non-erythrocytic 5 |
1119 |
0.42 |
chr13_4577869_4578048 | 1.58 |
Akr1c21 |
aldo-keto reductase family 1, member C21 |
801 |
0.61 |
chr1_67193045_67193230 | 1.58 |
Gm15668 |
predicted gene 15668 |
56063 |
0.12 |
chr4_107117393_107117544 | 1.57 |
Gm12802 |
predicted gene 12802 |
9145 |
0.13 |
chr4_97102666_97103047 | 1.57 |
Gm27521 |
predicted gene, 27521 |
185836 |
0.03 |
chr2_160805166_160805505 | 1.57 |
Gm11447 |
predicted gene 11447 |
40278 |
0.11 |
chr5_40690842_40690993 | 1.57 |
Gm23022 |
predicted gene, 23022 |
284988 |
0.01 |
chr15_95744172_95744337 | 1.56 |
Gm6961 |
predicted gene 6961 |
7337 |
0.13 |
chr5_51539378_51539567 | 1.55 |
Ppargc1a |
peroxisome proliferative activated receptor, gamma, coactivator 1 alpha |
14399 |
0.17 |
chr2_18050494_18051012 | 1.55 |
Skida1 |
SKI/DACH domain containing 1 |
1702 |
0.22 |
chr2_34777307_34777554 | 1.55 |
Hspa5 |
heat shock protein 5 |
2583 |
0.19 |
chr2_72204001_72204398 | 1.54 |
Rapgef4 |
Rap guanine nucleotide exchange factor (GEF) 4 |
5400 |
0.2 |
chr18_65140941_65141092 | 1.54 |
Nedd4l |
neural precursor cell expressed, developmentally down-regulated gene 4-like |
2542 |
0.34 |
chr11_87693128_87693285 | 1.53 |
Gm25968 |
predicted gene, 25968 |
1375 |
0.28 |
chr19_40153747_40153898 | 1.53 |
Cyp2c70 |
cytochrome P450, family 2, subfamily c, polypeptide 70 |
33464 |
0.13 |
chr13_4270426_4270629 | 1.53 |
Akr1c12 |
aldo-keto reductase family 1, member C12 |
8906 |
0.15 |
chr14_11564616_11565059 | 1.53 |
Ptprg |
protein tyrosine phosphatase, receptor type, G |
11256 |
0.22 |
chr9_106264996_106265377 | 1.53 |
Poc1a |
POC1 centriolar protein A |
15875 |
0.1 |
chr13_107972910_107973061 | 1.53 |
B230220B15Rik |
RIKEN cDNA B230220B15 gene |
23300 |
0.21 |
chr4_139601582_139602248 | 1.52 |
Gm21969 |
predicted gene 21969 |
1271 |
0.37 |
chr8_93176962_93177159 | 1.52 |
Ces1d |
carboxylesterase 1D |
1771 |
0.27 |
chr8_93167580_93167731 | 1.52 |
Ces1d |
carboxylesterase 1D |
2320 |
0.22 |
chr4_76942367_76942518 | 1.51 |
Gm11246 |
predicted gene 11246 |
15131 |
0.21 |
chr5_39163040_39163219 | 1.51 |
Gm40293 |
predicted gene, 40293 |
143955 |
0.04 |
chr6_6997102_6997263 | 1.51 |
Sdhaf3 |
succinate dehydrogenase complex assembly factor 3 |
41175 |
0.13 |
chr3_18476612_18476771 | 1.51 |
4930433B08Rik |
RIKEN cDNA 4930433B08 gene |
3786 |
0.24 |
chr10_89526440_89526591 | 1.51 |
Nr1h4 |
nuclear receptor subfamily 1, group H, member 4 |
7070 |
0.22 |
chr3_5425056_5425268 | 1.50 |
4930555M17Rik |
RIKEN cDNA 4930555M17 gene |
90171 |
0.09 |
chr13_31340004_31340178 | 1.49 |
Gm11373 |
predicted gene 11373 |
9324 |
0.16 |
chr9_74995796_74995947 | 1.49 |
Fam214a |
family with sequence similarity 214, member A |
19760 |
0.16 |
chr15_3617937_3618133 | 1.49 |
Gm22031 |
predicted gene, 22031 |
14638 |
0.24 |
chr10_108431934_108432221 | 1.49 |
Gm25591 |
predicted gene, 25591 |
4010 |
0.22 |
chr9_74523576_74523891 | 1.48 |
Gm28622 |
predicted gene 28622 |
37645 |
0.17 |
chr11_111998446_111998808 | 1.48 |
Gm11679 |
predicted gene 11679 |
44951 |
0.19 |
chr1_102734493_102734735 | 1.48 |
Gm22034 |
predicted gene, 22034 |
218934 |
0.02 |
chr16_76330855_76331006 | 1.48 |
Nrip1 |
nuclear receptor interacting protein 1 |
7272 |
0.24 |
chr6_144895556_144895729 | 1.48 |
Gm22792 |
predicted gene, 22792 |
92010 |
0.07 |
chr15_62645080_62645285 | 1.47 |
Gm24810 |
predicted gene, 24810 |
7822 |
0.29 |
chr2_160803447_160803598 | 1.47 |
Gm11447 |
predicted gene 11447 |
42091 |
0.1 |
chr2_18543019_18543179 | 1.47 |
Gm13353 |
predicted gene 13353 |
25027 |
0.2 |
chr10_81414787_81414951 | 1.47 |
Mir1191b |
microRNA 1191b |
1428 |
0.16 |
chr8_76147308_76147459 | 1.47 |
Gm45742 |
predicted gene 45742 |
30356 |
0.21 |
chr19_43778712_43778869 | 1.47 |
Abcc2 |
ATP-binding cassette, sub-family C (CFTR/MRP), member 2 |
3402 |
0.18 |
chr6_99189402_99189564 | 1.47 |
Foxp1 |
forkhead box P1 |
26465 |
0.25 |
chr13_56052991_56053142 | 1.46 |
Gm47072 |
predicted gene, 47072 |
22832 |
0.16 |
chrX_140571502_140571653 | 1.46 |
AL683809.1 |
TSC22 domain family, member 3 (Tsc22d3), pseuodgene |
12022 |
0.18 |
chr8_26351792_26351988 | 1.46 |
Gm31784 |
predicted gene, 31784 |
39556 |
0.12 |
chr9_76727532_76727721 | 1.46 |
Gm22938 |
predicted gene, 22938 |
10879 |
0.17 |
chr13_43437079_43437309 | 1.46 |
Ranbp9 |
RAN binding protein 9 |
6398 |
0.14 |
chr13_54081500_54081675 | 1.46 |
Sfxn1 |
sideroflexin 1 |
4359 |
0.22 |
chr5_99284011_99284176 | 1.46 |
Gm35394 |
predicted gene, 35394 |
9998 |
0.24 |
chrX_49489499_49489695 | 1.45 |
Arhgap36 |
Rho GTPase activating protein 36 |
3922 |
0.27 |
chr1_67134415_67135075 | 1.45 |
Cps1 |
carbamoyl-phosphate synthetase 1 |
11719 |
0.24 |
chr7_119854494_119854670 | 1.45 |
Dcun1d3 |
DCN1, defective in cullin neddylation 1, domain containing 3 (S. cerevisiae) |
7222 |
0.15 |
chr10_97060750_97060908 | 1.45 |
4930556N09Rik |
RIKEN cDNA 4930556N09 gene |
25049 |
0.2 |
chr13_49954489_49954640 | 1.44 |
Gm10784 |
predicted pseudogene 10784 |
9231 |
0.12 |
chr14_7820539_7820861 | 1.44 |
Flnb |
filamin, beta |
2743 |
0.22 |
chr14_59442931_59443277 | 1.44 |
Cab39l |
calcium binding protein 39-like |
2123 |
0.24 |
chr3_18463182_18463725 | 1.44 |
Gm30667 |
predicted gene, 30667 |
2199 |
0.33 |
chr8_61570064_61570241 | 1.44 |
Palld |
palladin, cytoskeletal associated protein |
20987 |
0.24 |
chr11_86352944_86353305 | 1.43 |
Med13 |
mediator complex subunit 13 |
4478 |
0.24 |
chr11_68854403_68854915 | 1.43 |
Ndel1 |
nudE neurodevelopment protein 1 like 1 |
1524 |
0.3 |
chr10_110717608_110717759 | 1.43 |
E2f7 |
E2F transcription factor 7 |
27756 |
0.19 |
chr7_118146435_118146620 | 1.43 |
Smg1 |
SMG1 homolog, phosphatidylinositol 3-kinase-related kinase (C. elegans) |
4728 |
0.17 |
chr15_3482568_3482869 | 1.43 |
Ghr |
growth hormone receptor |
11074 |
0.28 |
chr4_47366562_47366857 | 1.43 |
Tgfbr1 |
transforming growth factor, beta receptor I |
13099 |
0.22 |
chr6_108290766_108291042 | 1.42 |
Itpr1 |
inositol 1,4,5-trisphosphate receptor 1 |
37946 |
0.19 |
chr10_68773346_68773497 | 1.42 |
Tmem26 |
transmembrane protein 26 |
49597 |
0.16 |
chr2_78656286_78656827 | 1.42 |
Gm14463 |
predicted gene 14463 |
873 |
0.71 |
chr1_140017790_140018140 | 1.41 |
Gm26048 |
predicted gene, 26048 |
14140 |
0.15 |
chr15_62705006_62705181 | 1.41 |
Gm24810 |
predicted gene, 24810 |
52089 |
0.16 |
chr14_114864274_114864425 | 1.41 |
Gm49010 |
predicted gene, 49010 |
12161 |
0.18 |
chr6_51461793_51461944 | 1.41 |
Hnrnpa2b1 |
heterogeneous nuclear ribonucleoprotein A2/B1 |
1316 |
0.4 |
chr13_23837589_23838086 | 1.41 |
Slc17a3 |
solute carrier family 17 (sodium phosphate), member 3 |
1597 |
0.19 |
chr1_67185796_67186060 | 1.41 |
Cps1 |
carbamoyl-phosphate synthetase 1 |
62902 |
0.11 |
chr2_65267243_65267589 | 1.41 |
Gm13592 |
predicted gene 13592 |
10001 |
0.16 |
chr12_12499785_12499936 | 1.41 |
4921511I17Rik |
RIKEN cDNA 4921511I17 gene |
107245 |
0.07 |
chr6_96154266_96154425 | 1.40 |
1700123L14Rik |
RIKEN cDNA 1700123L14 gene |
11898 |
0.25 |
chr1_67182575_67183305 | 1.40 |
Cps1 |
carbamoyl-phosphate synthetase 1 |
59914 |
0.11 |
chr1_105176971_105177328 | 1.39 |
Gm29012 |
predicted gene 29012 |
60695 |
0.12 |
chr16_4368840_4369192 | 1.39 |
Gm6142 |
predicted pseudogene 6142 |
48336 |
0.12 |
chr3_18156058_18156209 | 1.39 |
Gm23686 |
predicted gene, 23686 |
21492 |
0.21 |
chr2_79290258_79290413 | 1.39 |
Itga4 |
integrin alpha 4 |
34388 |
0.15 |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
2.2 | 6.5 | GO:0019626 | short-chain fatty acid catabolic process(GO:0019626) |
2.1 | 12.5 | GO:0006526 | arginine biosynthetic process(GO:0006526) |
2.0 | 6.1 | GO:1903800 | positive regulation of production of miRNAs involved in gene silencing by miRNA(GO:1903800) |
1.7 | 6.7 | GO:0072338 | creatinine metabolic process(GO:0046449) cellular lactam metabolic process(GO:0072338) |
1.5 | 4.4 | GO:1901078 | negative regulation of relaxation of muscle(GO:1901078) |
1.4 | 2.7 | GO:0019676 | ammonia assimilation cycle(GO:0019676) |
1.2 | 3.7 | GO:0006068 | ethanol catabolic process(GO:0006068) |
1.2 | 4.9 | GO:2001013 | epithelial cell proliferation involved in renal tubule morphogenesis(GO:2001013) |
1.2 | 1.2 | GO:0006714 | sesquiterpenoid metabolic process(GO:0006714) |
1.0 | 4.2 | GO:0060528 | secretory columnal luminar epithelial cell differentiation involved in prostate glandular acinus development(GO:0060528) |
0.9 | 1.7 | GO:0070672 | response to interleukin-15(GO:0070672) |
0.8 | 3.3 | GO:1903966 | monounsaturated fatty acid metabolic process(GO:1903964) monounsaturated fatty acid biosynthetic process(GO:1903966) |
0.8 | 3.3 | GO:0006166 | purine ribonucleoside salvage(GO:0006166) |
0.8 | 2.4 | GO:0015959 | diadenosine polyphosphate metabolic process(GO:0015959) |
0.8 | 4.0 | GO:0072602 | interleukin-4 secretion(GO:0072602) |
0.8 | 2.4 | GO:0060523 | prostate epithelial cord elongation(GO:0060523) |
0.8 | 2.4 | GO:0006701 | progesterone biosynthetic process(GO:0006701) |
0.8 | 1.5 | GO:0060741 | prostate gland stromal morphogenesis(GO:0060741) |
0.7 | 0.7 | GO:0031086 | nuclear-transcribed mRNA catabolic process, deadenylation-independent decay(GO:0031086) deadenylation-independent decapping of nuclear-transcribed mRNA(GO:0031087) |
0.7 | 2.1 | GO:1900245 | positive regulation of MDA-5 signaling pathway(GO:1900245) |
0.7 | 7.6 | GO:0009404 | toxin metabolic process(GO:0009404) |
0.7 | 2.7 | GO:2000741 | positive regulation of mesenchymal stem cell differentiation(GO:2000741) |
0.7 | 2.0 | GO:0034310 | primary alcohol catabolic process(GO:0034310) |
0.7 | 3.3 | GO:0050882 | voluntary musculoskeletal movement(GO:0050882) |
0.6 | 2.5 | GO:0034755 | iron ion transmembrane transport(GO:0034755) |
0.6 | 1.7 | GO:1990168 | protein K29-linked deubiquitination(GO:0035523) protein K33-linked deubiquitination(GO:1990168) |
0.6 | 1.7 | GO:0009730 | detection of carbohydrate stimulus(GO:0009730) detection of hexose stimulus(GO:0009732) detection of monosaccharide stimulus(GO:0034287) detection of glucose(GO:0051594) |
0.6 | 1.7 | GO:0006208 | pyrimidine nucleobase catabolic process(GO:0006208) thymine catabolic process(GO:0006210) thymine metabolic process(GO:0019859) |
0.5 | 1.1 | GO:2000809 | positive regulation of synaptic vesicle clustering(GO:2000809) |
0.5 | 3.2 | GO:0071763 | nuclear membrane organization(GO:0071763) |
0.5 | 3.6 | GO:0097105 | presynaptic membrane assembly(GO:0097105) |
0.5 | 1.6 | GO:1900169 | regulation of glucocorticoid mediated signaling pathway(GO:1900169) |
0.5 | 1.6 | GO:0006987 | activation of signaling protein activity involved in unfolded protein response(GO:0006987) |
0.5 | 1.5 | GO:0051081 | membrane disassembly(GO:0030397) nuclear envelope disassembly(GO:0051081) |
0.5 | 2.6 | GO:0006537 | glutamate biosynthetic process(GO:0006537) |
0.5 | 1.5 | GO:2000370 | positive regulation of clathrin-mediated endocytosis(GO:2000370) |
0.5 | 1.5 | GO:0021553 | olfactory nerve development(GO:0021553) |
0.5 | 1.4 | GO:0003062 | regulation of heart rate by chemical signal(GO:0003062) |
0.5 | 2.8 | GO:0021960 | anterior commissure morphogenesis(GO:0021960) |
0.5 | 0.9 | GO:0043490 | malate-aspartate shuttle(GO:0043490) |
0.5 | 2.7 | GO:1902222 | L-phenylalanine metabolic process(GO:0006558) L-phenylalanine catabolic process(GO:0006559) erythrose 4-phosphate/phosphoenolpyruvate family amino acid metabolic process(GO:1902221) erythrose 4-phosphate/phosphoenolpyruvate family amino acid catabolic process(GO:1902222) |
0.4 | 1.3 | GO:0016554 | cytidine to uridine editing(GO:0016554) |
0.4 | 1.7 | GO:0003383 | apical constriction(GO:0003383) |
0.4 | 0.9 | GO:2001245 | regulation of phosphatidylcholine biosynthetic process(GO:2001245) |
0.4 | 2.0 | GO:0044789 | modulation by host of viral release from host cell(GO:0044789) positive regulation by host of viral release from host cell(GO:0044791) |
0.4 | 0.8 | GO:1903969 | regulation of macrophage colony-stimulating factor signaling pathway(GO:1902226) regulation of response to macrophage colony-stimulating factor(GO:1903969) regulation of cellular response to macrophage colony-stimulating factor stimulus(GO:1903972) |
0.4 | 1.2 | GO:0055099 | response to high density lipoprotein particle(GO:0055099) |
0.4 | 1.2 | GO:0021699 | cerebellar cortex maturation(GO:0021699) |
0.4 | 1.6 | GO:0030647 | polyketide metabolic process(GO:0030638) aminoglycoside antibiotic metabolic process(GO:0030647) daunorubicin metabolic process(GO:0044597) doxorubicin metabolic process(GO:0044598) |
0.4 | 1.2 | GO:0009698 | phenylpropanoid metabolic process(GO:0009698) phenylpropanoid catabolic process(GO:0046271) |
0.4 | 1.2 | GO:0006982 | response to lipid hydroperoxide(GO:0006982) |
0.4 | 1.6 | GO:0019805 | quinolinate biosynthetic process(GO:0019805) |
0.4 | 3.1 | GO:0035520 | monoubiquitinated protein deubiquitination(GO:0035520) |
0.4 | 1.9 | GO:0036295 | cellular response to increased oxygen levels(GO:0036295) cellular response to hyperoxia(GO:0071455) |
0.4 | 1.2 | GO:0015842 | aminergic neurotransmitter loading into synaptic vesicle(GO:0015842) neurotransmitter loading into synaptic vesicle(GO:0098700) |
0.4 | 3.0 | GO:0052697 | xenobiotic glucuronidation(GO:0052697) |
0.4 | 1.5 | GO:0060689 | cell differentiation involved in salivary gland development(GO:0060689) |
0.4 | 2.6 | GO:0070874 | negative regulation of glycogen metabolic process(GO:0070874) |
0.4 | 1.1 | GO:2000017 | positive regulation of determination of dorsal identity(GO:2000017) |
0.4 | 1.1 | GO:0097167 | circadian regulation of translation(GO:0097167) |
0.4 | 1.1 | GO:0015014 | heparan sulfate proteoglycan biosynthetic process, polysaccharide chain biosynthetic process(GO:0015014) |
0.4 | 1.1 | GO:0008050 | female courtship behavior(GO:0008050) |
0.4 | 0.7 | GO:0060509 | Type I pneumocyte differentiation(GO:0060509) |
0.4 | 1.1 | GO:1902956 | regulation of mitochondrial electron transport, NADH to ubiquinone(GO:1902956) |
0.4 | 3.2 | GO:0006120 | mitochondrial electron transport, NADH to ubiquinone(GO:0006120) |
0.3 | 0.3 | GO:0010481 | epidermal cell division(GO:0010481) regulation of epidermal cell division(GO:0010482) |
0.3 | 1.0 | GO:0035284 | central nervous system segmentation(GO:0035283) brain segmentation(GO:0035284) |
0.3 | 2.4 | GO:0002072 | optic cup morphogenesis involved in camera-type eye development(GO:0002072) |
0.3 | 1.4 | GO:0000957 | mitochondrial RNA catabolic process(GO:0000957) regulation of mitochondrial RNA catabolic process(GO:0000960) |
0.3 | 1.0 | GO:0071276 | cellular response to cadmium ion(GO:0071276) |
0.3 | 1.7 | GO:0090435 | protein localization to nuclear envelope(GO:0090435) |
0.3 | 1.0 | GO:1904154 | positive regulation of retrograde protein transport, ER to cytosol(GO:1904154) |
0.3 | 1.0 | GO:1901301 | regulation of cargo loading into COPII-coated vesicle(GO:1901301) |
0.3 | 1.3 | GO:0033353 | S-adenosylmethionine cycle(GO:0033353) |
0.3 | 2.3 | GO:0055091 | phospholipid homeostasis(GO:0055091) |
0.3 | 0.6 | GO:0046874 | quinolinate metabolic process(GO:0046874) |
0.3 | 1.9 | GO:1900103 | positive regulation of endoplasmic reticulum unfolded protein response(GO:1900103) |
0.3 | 0.6 | GO:0060166 | olfactory pit development(GO:0060166) |
0.3 | 1.5 | GO:0006398 | mRNA 3'-end processing by stem-loop binding and cleavage(GO:0006398) |
0.3 | 3.0 | GO:0000290 | deadenylation-dependent decapping of nuclear-transcribed mRNA(GO:0000290) |
0.3 | 0.9 | GO:0010040 | response to iron(II) ion(GO:0010040) |
0.3 | 8.3 | GO:0019373 | epoxygenase P450 pathway(GO:0019373) |
0.3 | 2.4 | GO:0060020 | Bergmann glial cell differentiation(GO:0060020) |
0.3 | 0.9 | GO:1900045 | negative regulation of protein K63-linked ubiquitination(GO:1900045) negative regulation of protein polyubiquitination(GO:1902915) |
0.3 | 1.1 | GO:0060283 | negative regulation of oocyte development(GO:0060283) |
0.3 | 0.3 | GO:0010248 | establishment or maintenance of transmembrane electrochemical gradient(GO:0010248) |
0.3 | 0.8 | GO:0090158 | endoplasmic reticulum membrane organization(GO:0090158) |
0.3 | 1.1 | GO:0090205 | positive regulation of cholesterol biosynthetic process(GO:0045542) positive regulation of cholesterol metabolic process(GO:0090205) |
0.3 | 0.8 | GO:0033031 | positive regulation of neutrophil apoptotic process(GO:0033031) |
0.3 | 0.8 | GO:0001831 | trophectodermal cellular morphogenesis(GO:0001831) |
0.3 | 1.1 | GO:1903599 | positive regulation of mitophagy(GO:1903599) |
0.3 | 0.8 | GO:0061010 | gall bladder development(GO:0061010) |
0.3 | 0.8 | GO:0070447 | positive regulation of oligodendrocyte progenitor proliferation(GO:0070447) |
0.3 | 0.5 | GO:0070212 | protein poly-ADP-ribosylation(GO:0070212) |
0.3 | 0.8 | GO:1903897 | regulation of PERK-mediated unfolded protein response(GO:1903897) |
0.3 | 1.3 | GO:1902267 | polyamine transmembrane transport(GO:1902047) regulation of polyamine transmembrane transport(GO:1902267) |
0.3 | 0.5 | GO:0045917 | positive regulation of complement activation(GO:0045917) positive regulation of protein activation cascade(GO:2000259) |
0.3 | 0.3 | GO:0043402 | glucocorticoid mediated signaling pathway(GO:0043402) |
0.3 | 1.3 | GO:0009256 | 10-formyltetrahydrofolate metabolic process(GO:0009256) |
0.3 | 2.6 | GO:0046855 | inositol phosphate dephosphorylation(GO:0046855) |
0.3 | 0.5 | GO:0070669 | response to interleukin-2(GO:0070669) |
0.3 | 1.8 | GO:0010944 | negative regulation of transcription by competitive promoter binding(GO:0010944) |
0.3 | 1.0 | GO:1901894 | regulation of calcium-transporting ATPase activity(GO:1901894) |
0.3 | 0.5 | GO:1902996 | neurofibrillary tangle assembly(GO:1902988) regulation of neurofibrillary tangle assembly(GO:1902996) |
0.3 | 0.8 | GO:2001274 | negative regulation of glucose import in response to insulin stimulus(GO:2001274) |
0.3 | 2.3 | GO:0070493 | thrombin receptor signaling pathway(GO:0070493) |
0.3 | 0.5 | GO:1904339 | negative regulation of dopaminergic neuron differentiation(GO:1904339) |
0.3 | 0.8 | GO:0015747 | urate transport(GO:0015747) |
0.3 | 0.5 | GO:0035622 | intrahepatic bile duct development(GO:0035622) |
0.2 | 0.2 | GO:0060916 | mesenchymal cell proliferation involved in lung development(GO:0060916) |
0.2 | 1.0 | GO:1903352 | ornithine transport(GO:0015822) L-ornithine transmembrane transport(GO:1903352) |
0.2 | 0.2 | GO:0036493 | positive regulation of translation in response to endoplasmic reticulum stress(GO:0036493) |
0.2 | 1.0 | GO:2000609 | regulation of thyroid hormone generation(GO:2000609) |
0.2 | 1.5 | GO:0031053 | primary miRNA processing(GO:0031053) |
0.2 | 0.7 | GO:1903690 | negative regulation of wound healing, spreading of epidermal cells(GO:1903690) |
0.2 | 0.2 | GO:2000807 | regulation of synaptic vesicle clustering(GO:2000807) |
0.2 | 1.2 | GO:0032482 | Rab protein signal transduction(GO:0032482) |
0.2 | 0.2 | GO:0052695 | cellular glucuronidation(GO:0052695) |
0.2 | 0.7 | GO:1901300 | positive regulation of hydrogen peroxide-mediated programmed cell death(GO:1901300) positive regulation of hydrogen peroxide-induced cell death(GO:1905206) |
0.2 | 0.9 | GO:0018211 | protein C-linked glycosylation(GO:0018103) peptidyl-tryptophan modification(GO:0018211) protein C-linked glycosylation via tryptophan(GO:0018317) protein C-linked glycosylation via 2'-alpha-mannosyl-L-tryptophan(GO:0018406) |
0.2 | 0.9 | GO:2000427 | positive regulation of apoptotic cell clearance(GO:2000427) |
0.2 | 0.2 | GO:0060956 | endocardial cell differentiation(GO:0060956) |
0.2 | 0.7 | GO:0045875 | negative regulation of sister chromatid cohesion(GO:0045875) |
0.2 | 1.2 | GO:1904970 | brush border assembly(GO:1904970) |
0.2 | 0.9 | GO:0010724 | regulation of definitive erythrocyte differentiation(GO:0010724) |
0.2 | 1.6 | GO:0006108 | malate metabolic process(GO:0006108) |
0.2 | 0.2 | GO:0006549 | isoleucine metabolic process(GO:0006549) |
0.2 | 0.5 | GO:0019086 | late viral transcription(GO:0019086) |
0.2 | 1.6 | GO:0098908 | regulation of neuronal action potential(GO:0098908) |
0.2 | 0.7 | GO:0061535 | glutamate secretion, neurotransmission(GO:0061535) |
0.2 | 0.7 | GO:0090283 | regulation of protein glycosylation in Golgi(GO:0090283) |
0.2 | 1.6 | GO:0030718 | germ-line stem cell population maintenance(GO:0030718) |
0.2 | 0.7 | GO:0003160 | endocardium morphogenesis(GO:0003160) |
0.2 | 0.5 | GO:0046098 | guanine metabolic process(GO:0046098) |
0.2 | 4.5 | GO:0006783 | heme biosynthetic process(GO:0006783) |
0.2 | 0.7 | GO:0006578 | amino-acid betaine biosynthetic process(GO:0006578) |
0.2 | 0.7 | GO:1903334 | positive regulation of protein folding(GO:1903334) |
0.2 | 0.2 | GO:0006069 | ethanol metabolic process(GO:0006067) ethanol oxidation(GO:0006069) |
0.2 | 0.9 | GO:0018243 | protein O-linked glycosylation via threonine(GO:0018243) |
0.2 | 0.7 | GO:0046016 | positive regulation of transcription by glucose(GO:0046016) |
0.2 | 0.9 | GO:0035519 | protein K29-linked ubiquitination(GO:0035519) |
0.2 | 0.6 | GO:0061368 | behavioral response to chemical pain(GO:0061366) behavioral response to formalin induced pain(GO:0061368) |
0.2 | 0.6 | GO:0035973 | aggrephagy(GO:0035973) |
0.2 | 0.4 | GO:0032488 | Cdc42 protein signal transduction(GO:0032488) |
0.2 | 0.4 | GO:1901252 | regulation of intracellular transport of viral material(GO:1901252) |
0.2 | 0.8 | GO:0090074 | negative regulation of protein homodimerization activity(GO:0090074) |
0.2 | 0.8 | GO:0008355 | olfactory learning(GO:0008355) |
0.2 | 1.3 | GO:0042118 | endothelial cell activation(GO:0042118) |
0.2 | 0.8 | GO:0035754 | B cell chemotaxis(GO:0035754) |
0.2 | 0.6 | GO:0009957 | epidermal cell fate specification(GO:0009957) |
0.2 | 1.0 | GO:0006627 | protein processing involved in protein targeting to mitochondrion(GO:0006627) |
0.2 | 1.2 | GO:0015871 | choline transport(GO:0015871) |
0.2 | 0.8 | GO:0006742 | NADP catabolic process(GO:0006742) |
0.2 | 0.4 | GO:0036022 | limb joint morphogenesis(GO:0036022) embryonic skeletal limb joint morphogenesis(GO:0036023) |
0.2 | 0.8 | GO:0051725 | protein de-ADP-ribosylation(GO:0051725) |
0.2 | 1.8 | GO:0006707 | cholesterol catabolic process(GO:0006707) sterol catabolic process(GO:0016127) |
0.2 | 1.6 | GO:1901339 | regulation of store-operated calcium channel activity(GO:1901339) |
0.2 | 0.6 | GO:1901475 | pyruvate transmembrane transport(GO:1901475) |
0.2 | 0.6 | GO:1903999 | negative regulation of eating behavior(GO:1903999) |
0.2 | 0.8 | GO:0098904 | regulation of AV node cell action potential(GO:0098904) |
0.2 | 0.2 | GO:0034454 | microtubule anchoring at centrosome(GO:0034454) |
0.2 | 2.4 | GO:0003334 | keratinocyte development(GO:0003334) |
0.2 | 0.8 | GO:1902993 | positive regulation of beta-amyloid formation(GO:1902004) positive regulation of amyloid precursor protein catabolic process(GO:1902993) |
0.2 | 0.2 | GO:2000646 | positive regulation of receptor catabolic process(GO:2000646) |
0.2 | 0.2 | GO:0046101 | hypoxanthine metabolic process(GO:0046100) hypoxanthine biosynthetic process(GO:0046101) |
0.2 | 0.4 | GO:2000302 | positive regulation of synaptic vesicle exocytosis(GO:2000302) |
0.2 | 0.6 | GO:0036112 | medium-chain fatty-acyl-CoA metabolic process(GO:0036112) |
0.2 | 0.6 | GO:0071596 | ubiquitin-dependent protein catabolic process via the N-end rule pathway(GO:0071596) |
0.2 | 0.6 | GO:0036490 | regulation of translation in response to endoplasmic reticulum stress(GO:0036490) regulation of translation initiation in response to endoplasmic reticulum stress(GO:0036491) eiF2alpha phosphorylation in response to endoplasmic reticulum stress(GO:0036492) |
0.2 | 0.6 | GO:0001732 | formation of cytoplasmic translation initiation complex(GO:0001732) |
0.2 | 1.1 | GO:2000675 | negative regulation of type B pancreatic cell apoptotic process(GO:2000675) |
0.2 | 1.5 | GO:0035845 | photoreceptor cell outer segment organization(GO:0035845) |
0.2 | 0.6 | GO:1904956 | regulation of midbrain dopaminergic neuron differentiation(GO:1904956) |
0.2 | 0.6 | GO:0006570 | tyrosine metabolic process(GO:0006570) |
0.2 | 0.5 | GO:0071926 | cannabinoid signaling pathway(GO:0038171) endocannabinoid signaling pathway(GO:0071926) |
0.2 | 0.2 | GO:0006391 | transcription initiation from mitochondrial promoter(GO:0006391) |
0.2 | 0.4 | GO:0006680 | glucosylceramide catabolic process(GO:0006680) |
0.2 | 0.7 | GO:0016557 | peroxisome membrane biogenesis(GO:0016557) |
0.2 | 0.2 | GO:0039536 | negative regulation of RIG-I signaling pathway(GO:0039536) |
0.2 | 0.9 | GO:1901096 | regulation of autophagosome maturation(GO:1901096) |
0.2 | 0.4 | GO:0032058 | positive regulation of translation in response to stress(GO:0032056) positive regulation of translational initiation in response to stress(GO:0032058) |
0.2 | 0.7 | GO:0070236 | negative regulation of activation-induced cell death of T cells(GO:0070236) |
0.2 | 0.5 | GO:0000715 | nucleotide-excision repair, DNA damage recognition(GO:0000715) |
0.2 | 0.7 | GO:0006499 | N-terminal protein myristoylation(GO:0006499) |
0.2 | 0.5 | GO:0006562 | proline catabolic process(GO:0006562) |
0.2 | 0.5 | GO:0031585 | regulation of inositol 1,4,5-trisphosphate-sensitive calcium-release channel activity(GO:0031585) |
0.2 | 0.3 | GO:0010960 | magnesium ion homeostasis(GO:0010960) |
0.2 | 0.3 | GO:0060319 | primitive erythrocyte differentiation(GO:0060319) |
0.2 | 0.3 | GO:0046477 | glycosylceramide catabolic process(GO:0046477) |
0.2 | 0.7 | GO:0034080 | CENP-A containing nucleosome assembly(GO:0034080) CENP-A containing chromatin organization(GO:0061641) |
0.2 | 0.5 | GO:0030035 | microspike assembly(GO:0030035) |
0.2 | 0.2 | GO:0015780 | nucleotide-sugar transport(GO:0015780) pyrimidine nucleotide-sugar transport(GO:0015781) |
0.2 | 1.7 | GO:0045722 | positive regulation of gluconeogenesis(GO:0045722) |
0.2 | 0.5 | GO:0045218 | zonula adherens maintenance(GO:0045218) |
0.2 | 0.3 | GO:0034137 | positive regulation of toll-like receptor 2 signaling pathway(GO:0034137) |
0.2 | 0.3 | GO:0044339 | canonical Wnt signaling pathway involved in osteoblast differentiation(GO:0044339) |
0.2 | 0.8 | GO:0035331 | negative regulation of hippo signaling(GO:0035331) |
0.2 | 0.2 | GO:2000507 | positive regulation of energy homeostasis(GO:2000507) |
0.2 | 0.7 | GO:0071286 | cellular response to magnesium ion(GO:0071286) |
0.2 | 0.5 | GO:0010835 | regulation of protein ADP-ribosylation(GO:0010835) |
0.2 | 0.5 | GO:0006553 | lysine metabolic process(GO:0006553) |
0.2 | 0.5 | GO:0046121 | deoxyribonucleoside catabolic process(GO:0046121) |
0.2 | 0.7 | GO:0000480 | endonucleolytic cleavage in 5'-ETS of tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000480) |
0.2 | 0.5 | GO:0017187 | peptidyl-glutamic acid carboxylation(GO:0017187) |
0.2 | 0.3 | GO:0021764 | amygdala development(GO:0021764) |
0.2 | 0.6 | GO:0048669 | collateral sprouting in absence of injury(GO:0048669) |
0.2 | 0.2 | GO:0046005 | positive regulation of circadian sleep/wake cycle, REM sleep(GO:0046005) |
0.2 | 0.6 | GO:0032077 | positive regulation of deoxyribonuclease activity(GO:0032077) |
0.2 | 0.8 | GO:0045647 | negative regulation of erythrocyte differentiation(GO:0045647) |
0.2 | 0.5 | GO:0046533 | negative regulation of photoreceptor cell differentiation(GO:0046533) |
0.2 | 1.7 | GO:0006614 | SRP-dependent cotranslational protein targeting to membrane(GO:0006614) |
0.2 | 0.3 | GO:0061198 | fungiform papilla formation(GO:0061198) |
0.2 | 0.6 | GO:0006659 | phosphatidylserine biosynthetic process(GO:0006659) |
0.2 | 0.9 | GO:0060406 | positive regulation of penile erection(GO:0060406) |
0.2 | 0.6 | GO:0035247 | peptidyl-arginine methylation, to asymmetrical-dimethyl arginine(GO:0019919) peptidyl-arginine omega-N-methylation(GO:0035247) |
0.2 | 0.5 | GO:0000389 | mRNA 3'-splice site recognition(GO:0000389) |
0.2 | 1.1 | GO:0003413 | chondrocyte differentiation involved in endochondral bone morphogenesis(GO:0003413) |
0.2 | 0.8 | GO:0071476 | cellular hypotonic response(GO:0071476) |
0.2 | 2.0 | GO:0009812 | flavonoid metabolic process(GO:0009812) |
0.2 | 0.5 | GO:0070375 | ERK5 cascade(GO:0070375) |
0.2 | 0.6 | GO:0007182 | common-partner SMAD protein phosphorylation(GO:0007182) |
0.2 | 0.2 | GO:0097212 | lysosomal membrane organization(GO:0097212) |
0.2 | 1.2 | GO:0006610 | ribosomal protein import into nucleus(GO:0006610) |
0.2 | 2.0 | GO:0045116 | protein neddylation(GO:0045116) |
0.2 | 0.9 | GO:0043634 | polyadenylation-dependent ncRNA catabolic process(GO:0043634) nuclear ncRNA surveillance(GO:0071029) nuclear polyadenylation-dependent rRNA catabolic process(GO:0071035) nuclear polyadenylation-dependent ncRNA catabolic process(GO:0071046) |
0.2 | 0.5 | GO:0006591 | ornithine metabolic process(GO:0006591) |
0.2 | 0.5 | GO:0035459 | cargo loading into vesicle(GO:0035459) |
0.2 | 0.9 | GO:1903608 | protein localization to cytoplasmic stress granule(GO:1903608) |
0.2 | 0.6 | GO:0090188 | negative regulation of pancreatic juice secretion(GO:0090188) |
0.2 | 0.9 | GO:0019348 | polyprenol metabolic process(GO:0016093) dolichol metabolic process(GO:0019348) |
0.2 | 1.4 | GO:0061179 | negative regulation of insulin secretion involved in cellular response to glucose stimulus(GO:0061179) |
0.2 | 0.2 | GO:0002215 | defense response to nematode(GO:0002215) |
0.1 | 0.7 | GO:0033211 | adiponectin-activated signaling pathway(GO:0033211) |
0.1 | 0.1 | GO:1904016 | response to Thyroglobulin triiodothyronine(GO:1904016) cellular response to Thyroglobulin triiodothyronine(GO:1904017) |
0.1 | 0.4 | GO:0019856 | 'de novo' pyrimidine nucleobase biosynthetic process(GO:0006207) pyrimidine nucleobase biosynthetic process(GO:0019856) |
0.1 | 0.7 | GO:0042421 | norepinephrine biosynthetic process(GO:0042421) |
0.1 | 0.4 | GO:0046684 | response to pyrethroid(GO:0046684) |
0.1 | 0.4 | GO:0061084 | negative regulation of protein refolding(GO:0061084) |
0.1 | 0.9 | GO:0017196 | N-terminal peptidyl-methionine acetylation(GO:0017196) |
0.1 | 1.0 | GO:0090136 | epithelial cell-cell adhesion(GO:0090136) |
0.1 | 0.7 | GO:0006561 | proline biosynthetic process(GO:0006561) |
0.1 | 1.7 | GO:0006465 | signal peptide processing(GO:0006465) |
0.1 | 0.1 | GO:0055093 | response to increased oxygen levels(GO:0036296) response to hyperoxia(GO:0055093) |
0.1 | 0.3 | GO:0042758 | long-chain fatty acid catabolic process(GO:0042758) |
0.1 | 1.0 | GO:0006265 | DNA topological change(GO:0006265) |
0.1 | 2.7 | GO:0006376 | mRNA splice site selection(GO:0006376) |
0.1 | 0.9 | GO:0009435 | NAD biosynthetic process(GO:0009435) |
0.1 | 1.1 | GO:0032825 | positive regulation of natural killer cell differentiation(GO:0032825) |
0.1 | 0.4 | GO:0045196 | establishment or maintenance of neuroblast polarity(GO:0045196) establishment of neuroblast polarity(GO:0045200) |
0.1 | 0.3 | GO:0033578 | protein glycosylation in Golgi(GO:0033578) |
0.1 | 0.3 | GO:0045726 | positive regulation of integrin biosynthetic process(GO:0045726) |
0.1 | 0.8 | GO:0015074 | DNA integration(GO:0015074) |
0.1 | 0.1 | GO:0048290 | isotype switching to IgA isotypes(GO:0048290) regulation of isotype switching to IgA isotypes(GO:0048296) |
0.1 | 2.0 | GO:0017144 | drug metabolic process(GO:0017144) |
0.1 | 0.3 | GO:0045091 | regulation of single stranded viral RNA replication via double stranded DNA intermediate(GO:0045091) negative regulation of single stranded viral RNA replication via double stranded DNA intermediate(GO:0045869) |
0.1 | 1.0 | GO:0070189 | kynurenine metabolic process(GO:0070189) |
0.1 | 0.3 | GO:0071883 | activation of MAPK activity by adrenergic receptor signaling pathway(GO:0071883) |
0.1 | 0.6 | GO:0019740 | nitrogen utilization(GO:0019740) |
0.1 | 0.3 | GO:0002282 | microglial cell activation involved in immune response(GO:0002282) |
0.1 | 0.7 | GO:0018230 | peptidyl-L-cysteine S-palmitoylation(GO:0018230) peptidyl-S-diacylglycerol-L-cysteine biosynthetic process from peptidyl-cysteine(GO:0018231) |
0.1 | 0.1 | GO:0046490 | isopentenyl diphosphate metabolic process(GO:0046490) |
0.1 | 0.1 | GO:0015705 | iodide transport(GO:0015705) |
0.1 | 0.4 | GO:0060385 | axonogenesis involved in innervation(GO:0060385) |
0.1 | 0.4 | GO:0086023 | adrenergic receptor signaling pathway involved in heart process(GO:0086023) |
0.1 | 0.4 | GO:0003406 | retinal pigment epithelium development(GO:0003406) |
0.1 | 0.4 | GO:1903347 | negative regulation of bicellular tight junction assembly(GO:1903347) |
0.1 | 0.4 | GO:2000346 | negative regulation of hepatocyte proliferation(GO:2000346) |
0.1 | 0.4 | GO:0046726 | positive regulation by virus of viral protein levels in host cell(GO:0046726) |
0.1 | 1.3 | GO:0006699 | bile acid biosynthetic process(GO:0006699) |
0.1 | 0.7 | GO:2000210 | positive regulation of anoikis(GO:2000210) |
0.1 | 0.3 | GO:1900109 | regulation of histone H3-K9 dimethylation(GO:1900109) |
0.1 | 0.7 | GO:0010961 | cellular magnesium ion homeostasis(GO:0010961) |
0.1 | 0.4 | GO:0007084 | mitotic nuclear envelope reassembly(GO:0007084) |
0.1 | 0.4 | GO:0006678 | glucosylceramide metabolic process(GO:0006678) |
0.1 | 0.3 | GO:0032286 | central nervous system myelin maintenance(GO:0032286) |
0.1 | 0.7 | GO:2001182 | regulation of interleukin-12 secretion(GO:2001182) |
0.1 | 0.1 | GO:0061205 | paramesonephric duct development(GO:0061205) |
0.1 | 1.2 | GO:0050932 | regulation of pigment cell differentiation(GO:0050932) |
0.1 | 0.3 | GO:0072199 | mesenchymal cell proliferation involved in ureter development(GO:0072198) regulation of mesenchymal cell proliferation involved in ureter development(GO:0072199) positive regulation of mesenchymal cell proliferation involved in ureter development(GO:2000729) |
0.1 | 0.6 | GO:0045602 | negative regulation of endothelial cell differentiation(GO:0045602) |
0.1 | 0.6 | GO:0051409 | response to nitrosative stress(GO:0051409) |
0.1 | 2.6 | GO:0006491 | N-glycan processing(GO:0006491) |
0.1 | 0.8 | GO:0060628 | regulation of ER to Golgi vesicle-mediated transport(GO:0060628) |
0.1 | 0.3 | GO:1903751 | regulation of intrinsic apoptotic signaling pathway in response to hydrogen peroxide(GO:1903750) negative regulation of intrinsic apoptotic signaling pathway in response to hydrogen peroxide(GO:1903751) |
0.1 | 0.3 | GO:0019482 | beta-alanine metabolic process(GO:0019482) |
0.1 | 0.3 | GO:1902237 | positive regulation of endoplasmic reticulum stress-induced intrinsic apoptotic signaling pathway(GO:1902237) |
0.1 | 0.8 | GO:0051694 | pointed-end actin filament capping(GO:0051694) |
0.1 | 1.8 | GO:0042744 | hydrogen peroxide catabolic process(GO:0042744) |
0.1 | 0.5 | GO:0046959 | habituation(GO:0046959) |
0.1 | 0.3 | GO:0032202 | telomere assembly(GO:0032202) |
0.1 | 0.5 | GO:0007196 | adenylate cyclase-inhibiting G-protein coupled glutamate receptor signaling pathway(GO:0007196) |
0.1 | 0.3 | GO:0036151 | phosphatidylcholine acyl-chain remodeling(GO:0036151) |
0.1 | 0.9 | GO:0070131 | positive regulation of mitochondrial translation(GO:0070131) |
0.1 | 0.4 | GO:0060468 | prevention of polyspermy(GO:0060468) |
0.1 | 0.1 | GO:0090168 | Golgi reassembly(GO:0090168) |
0.1 | 0.2 | GO:1902445 | regulation of mitochondrial membrane permeability involved in programmed necrotic cell death(GO:1902445) |
0.1 | 0.5 | GO:2000623 | regulation of nuclear-transcribed mRNA catabolic process, nonsense-mediated decay(GO:2000622) negative regulation of nuclear-transcribed mRNA catabolic process, nonsense-mediated decay(GO:2000623) |
0.1 | 1.0 | GO:0042219 | cellular modified amino acid catabolic process(GO:0042219) |
0.1 | 0.9 | GO:0042760 | very long-chain fatty acid catabolic process(GO:0042760) |
0.1 | 0.6 | GO:0048318 | axial mesoderm development(GO:0048318) |
0.1 | 0.4 | GO:1901421 | positive regulation of response to alcohol(GO:1901421) |
0.1 | 0.7 | GO:0031033 | myosin filament organization(GO:0031033) |
0.1 | 0.1 | GO:0061724 | lipophagy(GO:0061724) |
0.1 | 0.1 | GO:1990086 | lens fiber cell apoptotic process(GO:1990086) |
0.1 | 0.1 | GO:0038028 | insulin receptor signaling pathway via phosphatidylinositol 3-kinase(GO:0038028) |
0.1 | 0.1 | GO:1901857 | positive regulation of cellular respiration(GO:1901857) |
0.1 | 0.2 | GO:0002121 | inter-male aggressive behavior(GO:0002121) |
0.1 | 0.1 | GO:0003419 | growth plate cartilage chondrocyte proliferation(GO:0003419) |
0.1 | 0.4 | GO:0048070 | regulation of developmental pigmentation(GO:0048070) |
0.1 | 0.2 | GO:0002727 | natural killer cell cytokine production(GO:0002370) regulation of natural killer cell cytokine production(GO:0002727) |
0.1 | 0.2 | GO:0060836 | lymphatic endothelial cell differentiation(GO:0060836) |
0.1 | 1.5 | GO:0051084 | 'de novo' protein folding(GO:0006458) 'de novo' posttranslational protein folding(GO:0051084) |
0.1 | 0.2 | GO:0071895 | odontoblast differentiation(GO:0071895) |
0.1 | 0.4 | GO:1901165 | positive regulation of trophoblast cell migration(GO:1901165) |
0.1 | 0.6 | GO:0046602 | regulation of mitotic centrosome separation(GO:0046602) |
0.1 | 0.5 | GO:0060398 | regulation of growth hormone receptor signaling pathway(GO:0060398) |
0.1 | 0.5 | GO:0060353 | regulation of cell adhesion molecule production(GO:0060353) |
0.1 | 0.6 | GO:0044794 | positive regulation by host of viral process(GO:0044794) |
0.1 | 0.5 | GO:1902626 | assembly of large subunit precursor of preribosome(GO:1902626) |
0.1 | 3.1 | GO:0043252 | sodium-independent organic anion transport(GO:0043252) |
0.1 | 0.1 | GO:0046083 | adenine metabolic process(GO:0046083) adenine biosynthetic process(GO:0046084) |
0.1 | 0.7 | GO:0051683 | establishment of Golgi localization(GO:0051683) |
0.1 | 0.3 | GO:0045738 | negative regulation of DNA repair(GO:0045738) negative regulation of double-strand break repair(GO:2000780) |
0.1 | 0.6 | GO:0055089 | fatty acid homeostasis(GO:0055089) |
0.1 | 1.0 | GO:0008343 | adult feeding behavior(GO:0008343) |
0.1 | 0.1 | GO:0006543 | glutamine catabolic process(GO:0006543) |
0.1 | 0.7 | GO:0034312 | diol biosynthetic process(GO:0034312) sphingosine biosynthetic process(GO:0046512) |
0.1 | 0.1 | GO:0009084 | glutamine family amino acid biosynthetic process(GO:0009084) |
0.1 | 0.4 | GO:0048861 | leukemia inhibitory factor signaling pathway(GO:0048861) |
0.1 | 0.1 | GO:1903416 | response to glycoside(GO:1903416) |
0.1 | 0.4 | GO:2000794 | regulation of epithelial cell proliferation involved in lung morphogenesis(GO:2000794) |
0.1 | 0.4 | GO:0007221 | positive regulation of transcription of Notch receptor target(GO:0007221) |
0.1 | 0.3 | GO:0097112 | gamma-aminobutyric acid receptor clustering(GO:0097112) |
0.1 | 1.9 | GO:0070536 | protein K63-linked deubiquitination(GO:0070536) |
0.1 | 0.3 | GO:0031627 | telomeric loop formation(GO:0031627) |
0.1 | 0.3 | GO:0032439 | endosome localization(GO:0032439) |
0.1 | 0.7 | GO:0032927 | positive regulation of activin receptor signaling pathway(GO:0032927) |
0.1 | 0.2 | GO:2000483 | negative regulation of interleukin-8 secretion(GO:2000483) |
0.1 | 0.2 | GO:0002901 | mature B cell apoptotic process(GO:0002901) regulation of mature B cell apoptotic process(GO:0002905) negative regulation of mature B cell apoptotic process(GO:0002906) |
0.1 | 0.9 | GO:0017121 | phospholipid scrambling(GO:0017121) |
0.1 | 0.4 | GO:0035627 | ceramide transport(GO:0035627) |
0.1 | 0.3 | GO:2001260 | regulation of semaphorin-plexin signaling pathway(GO:2001260) |
0.1 | 0.8 | GO:0043970 | histone H3-K9 acetylation(GO:0043970) |
0.1 | 0.2 | GO:0014016 | neuroblast differentiation(GO:0014016) |
0.1 | 0.2 | GO:2000409 | positive regulation of T cell extravasation(GO:2000409) |
0.1 | 0.5 | GO:0006924 | activation-induced cell death of T cells(GO:0006924) |
0.1 | 0.2 | GO:0018197 | peptidyl-aspartic acid modification(GO:0018197) |
0.1 | 0.1 | GO:2000618 | regulation of histone H4-K16 acetylation(GO:2000618) |
0.1 | 0.2 | GO:0045113 | regulation of integrin biosynthetic process(GO:0045113) |
0.1 | 0.6 | GO:0009125 | nucleoside monophosphate catabolic process(GO:0009125) |
0.1 | 0.2 | GO:0039689 | negative stranded viral RNA replication(GO:0039689) multi-organism biosynthetic process(GO:0044034) |
0.1 | 1.8 | GO:0010569 | regulation of double-strand break repair via homologous recombination(GO:0010569) |
0.1 | 0.3 | GO:0000320 | re-entry into mitotic cell cycle(GO:0000320) |
0.1 | 0.1 | GO:1900368 | regulation of RNA interference(GO:1900368) |
0.1 | 0.3 | GO:2000836 | androgen secretion(GO:0035935) regulation of androgen secretion(GO:2000834) positive regulation of androgen secretion(GO:2000836) |
0.1 | 0.1 | GO:0042505 | tyrosine phosphorylation of Stat6 protein(GO:0042505) regulation of tyrosine phosphorylation of Stat6 protein(GO:0042525) |
0.1 | 0.3 | GO:0010387 | COP9 signalosome assembly(GO:0010387) |
0.1 | 0.3 | GO:0018094 | protein polyglycylation(GO:0018094) |
0.1 | 0.1 | GO:0030327 | prenylated protein catabolic process(GO:0030327) |
0.1 | 0.6 | GO:0043247 | telomere maintenance in response to DNA damage(GO:0043247) |
0.1 | 0.4 | GO:0036265 | RNA (guanine-N7)-methylation(GO:0036265) |
0.1 | 0.3 | GO:1902309 | negative regulation of peptidyl-serine dephosphorylation(GO:1902309) |
0.1 | 0.7 | GO:0046784 | viral mRNA export from host cell nucleus(GO:0046784) |
0.1 | 0.1 | GO:0033668 | negative regulation by symbiont of host apoptotic process(GO:0033668) negative regulation by symbiont of host programmed cell death(GO:0052041) negative regulation by organism of programmed cell death in other organism involved in symbiotic interaction(GO:0052490) |
0.1 | 0.3 | GO:0002904 | positive regulation of B cell apoptotic process(GO:0002904) |
0.1 | 0.6 | GO:0046628 | positive regulation of insulin receptor signaling pathway(GO:0046628) |
0.1 | 0.4 | GO:0034047 | regulation of protein phosphatase type 2A activity(GO:0034047) |
0.1 | 0.4 | GO:0097211 | response to gonadotropin-releasing hormone(GO:0097210) cellular response to gonadotropin-releasing hormone(GO:0097211) |
0.1 | 0.2 | GO:0048382 | mesendoderm development(GO:0048382) |
0.1 | 0.3 | GO:1901299 | negative regulation of hydrogen peroxide-mediated programmed cell death(GO:1901299) |
0.1 | 0.2 | GO:0019344 | cysteine biosynthetic process(GO:0019344) |
0.1 | 0.3 | GO:1904526 | regulation of microtubule binding(GO:1904526) positive regulation of microtubule binding(GO:1904528) |
0.1 | 0.3 | GO:1900095 | regulation of dosage compensation by inactivation of X chromosome(GO:1900095) |
0.1 | 0.2 | GO:0034436 | glycoprotein transport(GO:0034436) |
0.1 | 0.4 | GO:0006003 | fructose 2,6-bisphosphate metabolic process(GO:0006003) |
0.1 | 0.2 | GO:0045416 | positive regulation of interleukin-8 biosynthetic process(GO:0045416) |
0.1 | 0.4 | GO:0042518 | negative regulation of tyrosine phosphorylation of Stat3 protein(GO:0042518) |
0.1 | 0.3 | GO:0042769 | DNA damage response, detection of DNA damage(GO:0042769) |
0.1 | 0.1 | GO:1901069 | guanosine-containing compound catabolic process(GO:1901069) |
0.1 | 0.3 | GO:0006177 | GMP biosynthetic process(GO:0006177) |
0.1 | 1.0 | GO:0051770 | positive regulation of nitric-oxide synthase biosynthetic process(GO:0051770) |
0.1 | 0.2 | GO:0042138 | meiotic DNA double-strand break formation(GO:0042138) |
0.1 | 0.2 | GO:0006663 | platelet activating factor biosynthetic process(GO:0006663) platelet activating factor metabolic process(GO:0046469) |
0.1 | 0.8 | GO:0031125 | rRNA 3'-end processing(GO:0031125) |
0.1 | 0.3 | GO:0051964 | negative regulation of synapse assembly(GO:0051964) |
0.1 | 0.2 | GO:0071798 | response to prostaglandin D(GO:0071798) cellular response to prostaglandin D stimulus(GO:0071799) |
0.1 | 0.3 | GO:2000224 | regulation of testosterone biosynthetic process(GO:2000224) |
0.1 | 0.3 | GO:0033860 | regulation of NAD(P)H oxidase activity(GO:0033860) |
0.1 | 0.2 | GO:0035434 | copper ion transmembrane transport(GO:0035434) |
0.1 | 0.6 | GO:0006102 | isocitrate metabolic process(GO:0006102) |
0.1 | 0.5 | GO:0046831 | regulation of RNA export from nucleus(GO:0046831) |
0.1 | 0.3 | GO:1900060 | negative regulation of ceramide biosynthetic process(GO:1900060) |
0.1 | 0.3 | GO:0031118 | rRNA pseudouridine synthesis(GO:0031118) |
0.1 | 0.2 | GO:0002154 | thyroid hormone mediated signaling pathway(GO:0002154) |
0.1 | 0.2 | GO:1904261 | regulation of basement membrane assembly involved in embryonic body morphogenesis(GO:1904259) positive regulation of basement membrane assembly involved in embryonic body morphogenesis(GO:1904261) basement membrane assembly involved in embryonic body morphogenesis(GO:2001197) |
0.1 | 0.7 | GO:2000480 | negative regulation of cAMP-dependent protein kinase activity(GO:2000480) |
0.1 | 0.4 | GO:0006297 | nucleotide-excision repair, DNA gap filling(GO:0006297) |
0.1 | 0.5 | GO:0015670 | carbon dioxide transport(GO:0015670) |
0.1 | 0.4 | GO:0098535 | de novo centriole assembly(GO:0098535) |
0.1 | 0.4 | GO:0042048 | olfactory behavior(GO:0042048) |
0.1 | 0.1 | GO:0007181 | transforming growth factor beta receptor complex assembly(GO:0007181) |
0.1 | 0.9 | GO:0032780 | negative regulation of ATPase activity(GO:0032780) |
0.1 | 0.3 | GO:0046341 | CDP-diacylglycerol metabolic process(GO:0046341) |
0.1 | 0.1 | GO:1900825 | regulation of membrane depolarization during cardiac muscle cell action potential(GO:1900825) |
0.1 | 0.1 | GO:0003289 | septum primum development(GO:0003284) atrial septum primum morphogenesis(GO:0003289) |
0.1 | 0.2 | GO:0060931 | sinoatrial node cell development(GO:0060931) |
0.1 | 0.5 | GO:0001514 | selenocysteine incorporation(GO:0001514) translational readthrough(GO:0006451) |
0.1 | 0.3 | GO:0006613 | cotranslational protein targeting to membrane(GO:0006613) |
0.1 | 0.2 | GO:0090209 | negative regulation of triglyceride metabolic process(GO:0090209) |
0.1 | 0.1 | GO:1903689 | regulation of wound healing, spreading of epidermal cells(GO:1903689) |
0.1 | 0.5 | GO:0006528 | asparagine metabolic process(GO:0006528) |
0.1 | 2.3 | GO:0032728 | positive regulation of interferon-beta production(GO:0032728) |
0.1 | 4.2 | GO:0045454 | cell redox homeostasis(GO:0045454) |
0.1 | 2.2 | GO:0010591 | regulation of lamellipodium assembly(GO:0010591) |
0.1 | 0.2 | GO:0061502 | early endosome to recycling endosome transport(GO:0061502) |
0.1 | 0.3 | GO:0006083 | acetate metabolic process(GO:0006083) |
0.1 | 0.1 | GO:0010520 | regulation of reciprocal meiotic recombination(GO:0010520) |
0.1 | 0.3 | GO:0010841 | positive regulation of circadian sleep/wake cycle, wakefulness(GO:0010841) |
0.1 | 0.4 | GO:0045714 | regulation of low-density lipoprotein particle receptor biosynthetic process(GO:0045714) |
0.1 | 0.3 | GO:0071314 | cellular response to cocaine(GO:0071314) |
0.1 | 0.2 | GO:0060164 | regulation of timing of neuron differentiation(GO:0060164) |
0.1 | 0.4 | GO:0046416 | D-amino acid metabolic process(GO:0046416) |
0.1 | 0.3 | GO:1903660 | regulation of complement-dependent cytotoxicity(GO:1903659) negative regulation of complement-dependent cytotoxicity(GO:1903660) |
0.1 | 0.2 | GO:0070525 | tRNA threonylcarbamoyladenosine metabolic process(GO:0070525) |
0.1 | 0.2 | GO:1902630 | regulation of membrane hyperpolarization(GO:1902630) |
0.1 | 0.1 | GO:1904688 | regulation of cap-independent translational initiation(GO:1903677) positive regulation of cap-independent translational initiation(GO:1903679) regulation of cytoplasmic translational initiation(GO:1904688) positive regulation of cytoplasmic translational initiation(GO:1904690) |
0.1 | 0.7 | GO:0046007 | negative regulation of activated T cell proliferation(GO:0046007) |
0.1 | 0.4 | GO:1903278 | regulation of sodium ion export(GO:1903273) positive regulation of sodium ion export(GO:1903275) regulation of sodium ion export from cell(GO:1903276) positive regulation of sodium ion export from cell(GO:1903278) |
0.1 | 0.3 | GO:0014029 | neural crest formation(GO:0014029) |
0.1 | 0.3 | GO:0006677 | glycosylceramide metabolic process(GO:0006677) |
0.1 | 0.1 | GO:0015803 | branched-chain amino acid transport(GO:0015803) leucine transport(GO:0015820) |
0.1 | 0.2 | GO:1904469 | positive regulation of tumor necrosis factor secretion(GO:1904469) |
0.1 | 0.4 | GO:0080009 | mRNA methylation(GO:0080009) |
0.1 | 0.2 | GO:0030576 | Cajal body organization(GO:0030576) |
0.1 | 0.8 | GO:0000244 | spliceosomal tri-snRNP complex assembly(GO:0000244) |
0.1 | 0.3 | GO:1903054 | negative regulation of extracellular matrix organization(GO:1903054) |
0.1 | 0.3 | GO:0007343 | egg activation(GO:0007343) |
0.1 | 0.3 | GO:0038128 | ERBB2 signaling pathway(GO:0038128) |
0.1 | 0.2 | GO:0072092 | ureteric bud invasion(GO:0072092) |
0.1 | 1.0 | GO:0098868 | bone growth(GO:0098868) |
0.1 | 0.3 | GO:0045213 | neurotransmitter receptor metabolic process(GO:0045213) |
0.1 | 0.3 | GO:1903071 | positive regulation of ER-associated ubiquitin-dependent protein catabolic process(GO:1903071) |
0.1 | 0.3 | GO:1902715 | positive regulation of interferon-gamma secretion(GO:1902715) |
0.1 | 0.4 | GO:0006779 | porphyrin-containing compound biosynthetic process(GO:0006779) tetrapyrrole biosynthetic process(GO:0033014) |
0.1 | 0.2 | GO:0051665 | membrane raft localization(GO:0051665) |
0.1 | 0.9 | GO:0045947 | negative regulation of translational initiation(GO:0045947) |
0.1 | 0.4 | GO:0051639 | actin filament network formation(GO:0051639) |
0.1 | 0.4 | GO:0048563 | post-embryonic organ morphogenesis(GO:0048563) |
0.1 | 0.3 | GO:0060591 | chondroblast differentiation(GO:0060591) |
0.1 | 0.2 | GO:0070427 | nucleotide-binding oligomerization domain containing 1 signaling pathway(GO:0070427) |
0.1 | 0.2 | GO:0070368 | positive regulation of hepatocyte differentiation(GO:0070368) |
0.1 | 1.1 | GO:0015693 | magnesium ion transport(GO:0015693) |
0.1 | 0.2 | GO:0048254 | snoRNA localization(GO:0048254) |
0.1 | 0.3 | GO:0015867 | ATP transport(GO:0015867) |
0.1 | 0.1 | GO:0044337 | canonical Wnt signaling pathway involved in positive regulation of apoptotic process(GO:0044337) |
0.1 | 0.7 | GO:0042795 | snRNA transcription from RNA polymerase II promoter(GO:0042795) |
0.1 | 0.4 | GO:0050859 | negative regulation of B cell receptor signaling pathway(GO:0050859) |
0.1 | 0.1 | GO:0072133 | kidney mesenchyme morphogenesis(GO:0072131) metanephric mesenchyme morphogenesis(GO:0072133) |
0.1 | 0.2 | GO:0032201 | telomere maintenance via semi-conservative replication(GO:0032201) |
0.1 | 0.2 | GO:0060368 | regulation of Fc receptor mediated stimulatory signaling pathway(GO:0060368) |
0.1 | 0.2 | GO:2000676 | regulation of type B pancreatic cell apoptotic process(GO:2000674) positive regulation of type B pancreatic cell apoptotic process(GO:2000676) |
0.1 | 0.2 | GO:0060486 | Clara cell differentiation(GO:0060486) |
0.1 | 0.1 | GO:0045764 | positive regulation of cellular amino acid metabolic process(GO:0045764) |
0.1 | 0.3 | GO:0002634 | regulation of germinal center formation(GO:0002634) |
0.1 | 0.2 | GO:0006498 | N-terminal protein lipidation(GO:0006498) |
0.1 | 0.1 | GO:0018343 | protein farnesylation(GO:0018343) |
0.1 | 0.2 | GO:0043435 | response to corticotropin-releasing hormone(GO:0043435) cellular response to corticotropin-releasing hormone stimulus(GO:0071376) |
0.1 | 0.7 | GO:0006283 | transcription-coupled nucleotide-excision repair(GO:0006283) |
0.1 | 1.6 | GO:0006084 | acetyl-CoA metabolic process(GO:0006084) |
0.1 | 0.5 | GO:0001672 | regulation of chromatin assembly or disassembly(GO:0001672) |
0.1 | 0.2 | GO:0006015 | 5-phosphoribose 1-diphosphate biosynthetic process(GO:0006015) 5-phosphoribose 1-diphosphate metabolic process(GO:0046391) |
0.1 | 0.2 | GO:0060178 | regulation of exocyst localization(GO:0060178) |
0.1 | 0.4 | GO:0009191 | ribonucleoside diphosphate catabolic process(GO:0009191) |
0.1 | 0.1 | GO:0009946 | proximal/distal axis specification(GO:0009946) |
0.1 | 2.1 | GO:0060325 | face morphogenesis(GO:0060325) |
0.1 | 0.2 | GO:0032066 | nucleolus to nucleoplasm transport(GO:0032066) |
0.1 | 0.2 | GO:0034241 | positive regulation of macrophage fusion(GO:0034241) |
0.1 | 0.4 | GO:1904729 | regulation of intestinal cholesterol absorption(GO:0030300) regulation of intestinal lipid absorption(GO:1904729) |
0.1 | 0.1 | GO:0009756 | carbohydrate mediated signaling(GO:0009756) hexose mediated signaling(GO:0009757) sugar mediated signaling pathway(GO:0010182) glucose mediated signaling pathway(GO:0010255) regulation of glucose mediated signaling pathway(GO:1902659) positive regulation of glucose mediated signaling pathway(GO:1902661) |
0.1 | 0.5 | GO:0048852 | diencephalon morphogenesis(GO:0048852) |
0.1 | 0.2 | GO:0043137 | DNA replication, removal of RNA primer(GO:0043137) |
0.1 | 0.4 | GO:0010457 | centriole-centriole cohesion(GO:0010457) |
0.1 | 0.1 | GO:0007135 | meiosis II(GO:0007135) |
0.1 | 0.1 | GO:0033159 | negative regulation of protein import into nucleus, translocation(GO:0033159) |
0.1 | 0.2 | GO:0010760 | negative regulation of macrophage chemotaxis(GO:0010760) |
0.1 | 0.2 | GO:0032290 | peripheral nervous system myelin formation(GO:0032290) |
0.1 | 0.1 | GO:0060126 | somatotropin secreting cell differentiation(GO:0060126) |
0.1 | 0.3 | GO:0000032 | cell wall mannoprotein biosynthetic process(GO:0000032) mannoprotein metabolic process(GO:0006056) mannoprotein biosynthetic process(GO:0006057) cell wall glycoprotein biosynthetic process(GO:0031506) cell wall biogenesis(GO:0042546) cell wall macromolecule biosynthetic process(GO:0044038) chain elongation of O-linked mannose residue(GO:0044845) cellular component macromolecule biosynthetic process(GO:0070589) |
0.1 | 0.1 | GO:0060426 | lung vasculature development(GO:0060426) |
0.1 | 0.1 | GO:0090245 | axis elongation involved in somitogenesis(GO:0090245) |
0.1 | 0.3 | GO:0035093 | spermatogenesis, exchange of chromosomal proteins(GO:0035093) |
0.1 | 0.4 | GO:0009235 | cobalamin metabolic process(GO:0009235) |
0.1 | 0.7 | GO:0045161 | neuronal ion channel clustering(GO:0045161) |
0.1 | 0.1 | GO:0035694 | mitochondrial protein catabolic process(GO:0035694) |
0.1 | 0.6 | GO:0009313 | oligosaccharide catabolic process(GO:0009313) |
0.1 | 0.1 | GO:0045653 | negative regulation of megakaryocyte differentiation(GO:0045653) |
0.1 | 0.4 | GO:0050916 | sensory perception of sweet taste(GO:0050916) |
0.1 | 0.2 | GO:0048388 | endosomal lumen acidification(GO:0048388) |
0.1 | 0.1 | GO:0070562 | regulation of vitamin D receptor signaling pathway(GO:0070562) |
0.1 | 0.7 | GO:0042759 | long-chain fatty acid biosynthetic process(GO:0042759) |
0.1 | 0.2 | GO:0014901 | regulation of satellite cell activation involved in skeletal muscle regeneration(GO:0014717) satellite cell activation involved in skeletal muscle regeneration(GO:0014901) |
0.1 | 0.1 | GO:0072531 | pyrimidine-containing compound transmembrane transport(GO:0072531) |
0.1 | 0.8 | GO:0007250 | activation of NF-kappaB-inducing kinase activity(GO:0007250) |
0.1 | 0.4 | GO:0009452 | 7-methylguanosine RNA capping(GO:0009452) RNA capping(GO:0036260) |
0.1 | 0.3 | GO:0072051 | juxtaglomerular apparatus development(GO:0072051) |
0.1 | 0.1 | GO:0010936 | negative regulation of macrophage cytokine production(GO:0010936) |
0.1 | 0.1 | GO:0035928 | rRNA import into mitochondrion(GO:0035928) |
0.1 | 0.1 | GO:0006971 | hypotonic response(GO:0006971) |
0.1 | 0.2 | GO:0034421 | post-translational protein acetylation(GO:0034421) |
0.1 | 0.2 | GO:0006420 | arginyl-tRNA aminoacylation(GO:0006420) |
0.1 | 0.1 | GO:0008065 | establishment of blood-nerve barrier(GO:0008065) |
0.1 | 0.1 | GO:1902857 | positive regulation of nonmotile primary cilium assembly(GO:1902857) |
0.1 | 0.1 | GO:1903207 | neuron death in response to hydrogen peroxide(GO:0036476) regulation of hydrogen peroxide-induced neuron death(GO:1903207) negative regulation of hydrogen peroxide-induced neuron death(GO:1903208) |
0.1 | 0.1 | GO:0010958 | regulation of amino acid import(GO:0010958) |
0.1 | 0.2 | GO:0035336 | long-chain fatty-acyl-CoA metabolic process(GO:0035336) |
0.1 | 0.4 | GO:0090141 | positive regulation of mitochondrial fission(GO:0090141) |
0.1 | 0.1 | GO:0031126 | snoRNA 3'-end processing(GO:0031126) |
0.1 | 0.1 | GO:0019374 | galactolipid metabolic process(GO:0019374) |
0.1 | 0.7 | GO:0045793 | positive regulation of cell size(GO:0045793) |
0.1 | 0.1 | GO:0060463 | lung lobe development(GO:0060462) lung lobe morphogenesis(GO:0060463) |
0.1 | 0.5 | GO:0060914 | heart formation(GO:0060914) |
0.1 | 0.4 | GO:0033262 | regulation of nuclear cell cycle DNA replication(GO:0033262) |
0.1 | 0.8 | GO:0032486 | Rap protein signal transduction(GO:0032486) |
0.1 | 1.0 | GO:0032012 | ARF protein signal transduction(GO:0032011) regulation of ARF protein signal transduction(GO:0032012) |
0.1 | 0.1 | GO:0097070 | ductus arteriosus closure(GO:0097070) |
0.1 | 0.1 | GO:0033129 | positive regulation of histone phosphorylation(GO:0033129) |
0.1 | 0.1 | GO:0002091 | negative regulation of receptor internalization(GO:0002091) |
0.1 | 0.2 | GO:0035457 | cellular response to interferon-alpha(GO:0035457) |
0.1 | 0.1 | GO:0090360 | platelet-derived growth factor production(GO:0090360) regulation of platelet-derived growth factor production(GO:0090361) |
0.1 | 0.1 | GO:0060596 | mammary placode formation(GO:0060596) |
0.1 | 0.1 | GO:1902965 | regulation of protein localization to early endosome(GO:1902965) positive regulation of protein localization to early endosome(GO:1902966) |
0.1 | 0.1 | GO:1901977 | negative regulation of cell cycle checkpoint(GO:1901977) |
0.1 | 0.8 | GO:0007099 | centriole replication(GO:0007099) |
0.1 | 0.5 | GO:0010838 | positive regulation of keratinocyte proliferation(GO:0010838) |
0.1 | 0.2 | GO:0006393 | termination of mitochondrial transcription(GO:0006393) |
0.1 | 0.2 | GO:1903774 | positive regulation of viral budding via host ESCRT complex(GO:1903774) |
0.1 | 0.3 | GO:0060903 | positive regulation of meiosis I(GO:0060903) |
0.1 | 0.4 | GO:0033313 | meiotic cell cycle checkpoint(GO:0033313) |
0.1 | 0.3 | GO:0019227 | neuronal action potential propagation(GO:0019227) action potential propagation(GO:0098870) |
0.1 | 0.3 | GO:0033683 | nucleotide-excision repair, DNA incision(GO:0033683) |
0.1 | 0.1 | GO:0071725 | response to triacyl bacterial lipopeptide(GO:0071725) cellular response to triacyl bacterial lipopeptide(GO:0071727) |
0.1 | 0.1 | GO:2000048 | negative regulation of cell-cell adhesion mediated by cadherin(GO:2000048) |
0.1 | 0.2 | GO:0046600 | negative regulation of centriole replication(GO:0046600) |
0.1 | 0.8 | GO:0000154 | rRNA modification(GO:0000154) |
0.1 | 0.2 | GO:0006290 | pyrimidine dimer repair(GO:0006290) |
0.1 | 0.1 | GO:0098828 | modulation of inhibitory postsynaptic potential(GO:0098828) |
0.1 | 0.2 | GO:0033566 | gamma-tubulin complex localization(GO:0033566) |
0.1 | 0.1 | GO:0002036 | regulation of L-glutamate transport(GO:0002036) |
0.1 | 1.6 | GO:0048240 | sperm capacitation(GO:0048240) |
0.1 | 0.2 | GO:0021902 | commitment of neuronal cell to specific neuron type in forebrain(GO:0021902) |
0.1 | 0.1 | GO:0016553 | base conversion or substitution editing(GO:0016553) |
0.1 | 0.1 | GO:0061086 | negative regulation of histone H3-K27 methylation(GO:0061086) |
0.1 | 0.2 | GO:0070345 | negative regulation of fat cell proliferation(GO:0070345) |
0.1 | 0.1 | GO:1900042 | positive regulation of interleukin-2 secretion(GO:1900042) |
0.1 | 0.1 | GO:0048769 | sarcomerogenesis(GO:0048769) |
0.1 | 0.4 | GO:0003338 | metanephros morphogenesis(GO:0003338) |
0.1 | 0.2 | GO:0021603 | cranial nerve formation(GO:0021603) |
0.1 | 0.1 | GO:1903423 | positive regulation of synaptic vesicle transport(GO:1902805) positive regulation of synaptic vesicle recycling(GO:1903423) |
0.1 | 0.1 | GO:0051204 | protein insertion into mitochondrial membrane(GO:0051204) |
0.1 | 0.1 | GO:0070318 | positive regulation of G0 to G1 transition(GO:0070318) |
0.1 | 0.3 | GO:0007252 | I-kappaB phosphorylation(GO:0007252) |
0.1 | 0.3 | GO:0016255 | attachment of GPI anchor to protein(GO:0016255) |
0.1 | 0.2 | GO:0021882 | regulation of transcription from RNA polymerase II promoter involved in forebrain neuron fate commitment(GO:0021882) commitment of multipotent stem cells to neuronal lineage in forebrain(GO:0021898) |
0.1 | 0.3 | GO:0060158 | phospholipase C-activating dopamine receptor signaling pathway(GO:0060158) |
0.1 | 0.4 | GO:0018344 | protein geranylgeranylation(GO:0018344) |
0.1 | 0.1 | GO:0043144 | snoRNA processing(GO:0043144) |
0.1 | 0.1 | GO:0032252 | secretory granule localization(GO:0032252) |
0.1 | 0.4 | GO:0031468 | nuclear envelope reassembly(GO:0031468) |
0.1 | 1.2 | GO:1901099 | negative regulation of signal transduction in absence of ligand(GO:1901099) negative regulation of extrinsic apoptotic signaling pathway in absence of ligand(GO:2001240) |
0.1 | 0.2 | GO:2001198 | regulation of dendritic cell differentiation(GO:2001198) negative regulation of dendritic cell differentiation(GO:2001199) |
0.1 | 0.1 | GO:0090598 | male genitalia morphogenesis(GO:0048808) male anatomical structure morphogenesis(GO:0090598) |
0.1 | 0.1 | GO:0072318 | clathrin coat disassembly(GO:0072318) |
0.1 | 2.5 | GO:1903845 | negative regulation of transforming growth factor beta receptor signaling pathway(GO:0030512) negative regulation of cellular response to transforming growth factor beta stimulus(GO:1903845) |
0.1 | 0.1 | GO:0035701 | hematopoietic stem cell migration(GO:0035701) |
0.1 | 0.2 | GO:0032367 | intracellular cholesterol transport(GO:0032367) |
0.1 | 0.1 | GO:2000338 | chemokine (C-X-C motif) ligand 1 production(GO:0072566) regulation of chemokine (C-X-C motif) ligand 1 production(GO:2000338) |
0.1 | 0.4 | GO:0051131 | chaperone-mediated protein complex assembly(GO:0051131) |
0.1 | 0.2 | GO:1901897 | regulation of relaxation of cardiac muscle(GO:1901897) |
0.1 | 0.2 | GO:0061087 | positive regulation of histone H3-K27 methylation(GO:0061087) |
0.1 | 0.2 | GO:1901029 | negative regulation of mitochondrial outer membrane permeabilization involved in apoptotic signaling pathway(GO:1901029) |
0.1 | 0.2 | GO:0042723 | thiamine metabolic process(GO:0006772) thiamine-containing compound metabolic process(GO:0042723) |
0.1 | 0.5 | GO:1904322 | response to forskolin(GO:1904321) cellular response to forskolin(GO:1904322) |
0.1 | 0.6 | GO:0070816 | phosphorylation of RNA polymerase II C-terminal domain(GO:0070816) |
0.1 | 2.4 | GO:0009166 | nucleotide catabolic process(GO:0009166) |
0.1 | 0.1 | GO:0048703 | embryonic viscerocranium morphogenesis(GO:0048703) |
0.1 | 0.5 | GO:0034723 | DNA replication-dependent nucleosome assembly(GO:0006335) DNA replication-dependent nucleosome organization(GO:0034723) |
0.1 | 0.1 | GO:0021798 | forebrain dorsal/ventral pattern formation(GO:0021798) |
0.1 | 0.2 | GO:0090186 | regulation of pancreatic juice secretion(GO:0090186) |
0.1 | 0.2 | GO:1903779 | regulation of cardiac conduction(GO:1903779) |
0.1 | 0.2 | GO:0051574 | positive regulation of histone H3-K9 methylation(GO:0051574) |
0.1 | 0.1 | GO:0006624 | vacuolar protein processing(GO:0006624) |
0.1 | 0.1 | GO:0002339 | B cell selection(GO:0002339) |
0.1 | 0.1 | GO:0071494 | cellular response to UV-C(GO:0071494) |
0.1 | 0.9 | GO:0071539 | protein localization to centrosome(GO:0071539) |
0.1 | 0.1 | GO:0090258 | negative regulation of mitochondrial fission(GO:0090258) |
0.1 | 0.3 | GO:0030948 | negative regulation of vascular endothelial growth factor receptor signaling pathway(GO:0030948) |
0.1 | 0.1 | GO:0051503 | adenine nucleotide transport(GO:0051503) |
0.1 | 0.6 | GO:0000083 | regulation of transcription involved in G1/S transition of mitotic cell cycle(GO:0000083) |
0.1 | 0.7 | GO:0002931 | response to ischemia(GO:0002931) |
0.1 | 0.1 | GO:0044321 | response to leptin(GO:0044321) |
0.1 | 0.2 | GO:0071361 | cellular response to ethanol(GO:0071361) |
0.1 | 0.2 | GO:0019471 | peptidyl-proline hydroxylation to 4-hydroxy-L-proline(GO:0018401) 4-hydroxyproline metabolic process(GO:0019471) |
0.1 | 0.2 | GO:0030321 | transepithelial chloride transport(GO:0030321) |
0.1 | 0.2 | GO:0001710 | mesodermal cell fate commitment(GO:0001710) |
0.1 | 0.1 | GO:1901656 | glycoside transport(GO:1901656) |
0.1 | 0.2 | GO:0019511 | peptidyl-proline hydroxylation(GO:0019511) |
0.1 | 0.1 | GO:0090306 | spindle assembly involved in meiosis(GO:0090306) |
0.1 | 0.1 | GO:0018206 | peptidyl-methionine modification(GO:0018206) |
0.1 | 0.3 | GO:0006384 | transcription initiation from RNA polymerase III promoter(GO:0006384) |
0.1 | 0.2 | GO:0030432 | peristalsis(GO:0030432) |
0.1 | 0.4 | GO:0070050 | neuron cellular homeostasis(GO:0070050) |
0.1 | 0.1 | GO:1902083 | negative regulation of peptidyl-cysteine S-nitrosylation(GO:1902083) |
0.1 | 0.7 | GO:0003298 | physiological muscle hypertrophy(GO:0003298) physiological cardiac muscle hypertrophy(GO:0003301) cell growth involved in cardiac muscle cell development(GO:0061049) |
0.1 | 0.4 | GO:0046643 | regulation of gamma-delta T cell differentiation(GO:0045586) regulation of gamma-delta T cell activation(GO:0046643) |
0.1 | 1.3 | GO:0006730 | one-carbon metabolic process(GO:0006730) |
0.1 | 0.1 | GO:1902261 | positive regulation of delayed rectifier potassium channel activity(GO:1902261) positive regulation of voltage-gated potassium channel activity(GO:1903818) |
0.1 | 0.4 | GO:0035020 | regulation of Rac protein signal transduction(GO:0035020) |
0.1 | 0.1 | GO:0048539 | bone marrow development(GO:0048539) |
0.1 | 0.2 | GO:0048386 | positive regulation of retinoic acid receptor signaling pathway(GO:0048386) |
0.1 | 0.1 | GO:0060897 | neural plate regionalization(GO:0060897) |
0.1 | 0.1 | GO:0001306 | age-dependent response to oxidative stress(GO:0001306) age-dependent general metabolic decline(GO:0007571) |
0.1 | 0.3 | GO:0097084 | vascular smooth muscle cell development(GO:0097084) |
0.1 | 0.1 | GO:0000255 | allantoin metabolic process(GO:0000255) |
0.1 | 0.1 | GO:1903367 | positive regulation of fear response(GO:1903367) positive regulation of behavioral fear response(GO:2000987) |
0.1 | 0.2 | GO:0018125 | peptidyl-cysteine methylation(GO:0018125) |
0.1 | 0.2 | GO:1900040 | interleukin-2 secretion(GO:0070970) regulation of interleukin-2 secretion(GO:1900040) |
0.1 | 0.1 | GO:2000097 | regulation of smooth muscle cell-matrix adhesion(GO:2000097) |
0.1 | 0.4 | GO:0006490 | oligosaccharide-lipid intermediate biosynthetic process(GO:0006490) |
0.1 | 0.6 | GO:0000920 | cell separation after cytokinesis(GO:0000920) |
0.1 | 1.0 | GO:0019432 | triglyceride biosynthetic process(GO:0019432) |
0.1 | 0.1 | GO:1902474 | positive regulation of protein localization to synapse(GO:1902474) |
0.1 | 0.1 | GO:0070827 | chromatin maintenance(GO:0070827) |
0.1 | 0.1 | GO:2000598 | regulation of cyclin catabolic process(GO:2000598) negative regulation of cyclin catabolic process(GO:2000599) |
0.1 | 0.2 | GO:2000096 | positive regulation of Wnt signaling pathway, planar cell polarity pathway(GO:2000096) |
0.1 | 0.1 | GO:0032811 | negative regulation of epinephrine secretion(GO:0032811) |
0.1 | 0.3 | GO:0060272 | embryonic skeletal joint morphogenesis(GO:0060272) |
0.1 | 0.3 | GO:0044387 | negative regulation of protein kinase activity by regulation of protein phosphorylation(GO:0044387) |
0.1 | 0.9 | GO:0034605 | cellular response to heat(GO:0034605) |
0.1 | 0.2 | GO:0098789 | pre-mRNA cleavage required for polyadenylation(GO:0098789) |
0.1 | 0.1 | GO:1902473 | regulation of protein localization to synapse(GO:1902473) |
0.1 | 1.5 | GO:0045839 | negative regulation of mitotic nuclear division(GO:0045839) |
0.1 | 0.2 | GO:2000297 | negative regulation of synapse maturation(GO:2000297) |
0.1 | 0.1 | GO:0042167 | heme catabolic process(GO:0042167) pigment catabolic process(GO:0046149) |
0.1 | 0.1 | GO:0010165 | response to X-ray(GO:0010165) |
0.1 | 0.2 | GO:0002786 | regulation of antimicrobial peptide production(GO:0002784) regulation of antibacterial peptide production(GO:0002786) |
0.1 | 0.1 | GO:0035799 | ureter maturation(GO:0035799) |
0.1 | 0.1 | GO:0042660 | positive regulation of cell fate specification(GO:0042660) |
0.1 | 0.1 | GO:0051299 | centrosome separation(GO:0051299) |
0.1 | 0.1 | GO:1900736 | regulation of phospholipase C-activating G-protein coupled receptor signaling pathway(GO:1900736) |
0.1 | 0.2 | GO:0045039 | protein import into mitochondrial inner membrane(GO:0045039) |
0.1 | 0.2 | GO:0060988 | lipid tube assembly(GO:0060988) |
0.1 | 0.3 | GO:0043249 | erythrocyte maturation(GO:0043249) |
0.1 | 0.2 | GO:1903301 | positive regulation of glucokinase activity(GO:0033133) positive regulation of hexokinase activity(GO:1903301) |
0.1 | 0.1 | GO:1903336 | negative regulation of vacuolar transport(GO:1903336) |
0.0 | 0.1 | GO:1902036 | regulation of hematopoietic stem cell differentiation(GO:1902036) |
0.0 | 0.0 | GO:1902488 | cholangiocyte apoptotic process(GO:1902488) regulation of cholangiocyte apoptotic process(GO:1904192) negative regulation of cholangiocyte apoptotic process(GO:1904193) |
0.0 | 0.4 | GO:0032958 | inositol phosphate biosynthetic process(GO:0032958) |
0.0 | 0.1 | GO:0032971 | regulation of muscle filament sliding(GO:0032971) |
0.0 | 0.4 | GO:0070862 | negative regulation of protein exit from endoplasmic reticulum(GO:0070862) regulation of retrograde protein transport, ER to cytosol(GO:1904152) negative regulation of retrograde protein transport, ER to cytosol(GO:1904153) |
0.0 | 0.4 | GO:0055070 | copper ion homeostasis(GO:0055070) |
0.0 | 0.4 | GO:0060055 | angiogenesis involved in wound healing(GO:0060055) |
0.0 | 0.0 | GO:0021524 | visceral motor neuron differentiation(GO:0021524) |
0.0 | 0.1 | GO:0036135 | Schwann cell migration(GO:0036135) regulation of Schwann cell migration(GO:1900147) |
0.0 | 1.1 | GO:0019369 | arachidonic acid metabolic process(GO:0019369) |
0.0 | 0.5 | GO:0042487 | regulation of odontogenesis of dentin-containing tooth(GO:0042487) |
0.0 | 0.2 | GO:0070417 | cellular response to cold(GO:0070417) |
0.0 | 0.6 | GO:0051923 | sulfation(GO:0051923) |
0.0 | 0.0 | GO:1904181 | positive regulation of mitochondrial depolarization(GO:0051901) positive regulation of membrane depolarization(GO:1904181) |
0.0 | 0.7 | GO:0060218 | hematopoietic stem cell differentiation(GO:0060218) |
0.0 | 0.1 | GO:0015772 | disaccharide transport(GO:0015766) sucrose transport(GO:0015770) oligosaccharide transport(GO:0015772) |
0.0 | 0.0 | GO:0051660 | establishment of centrosome localization(GO:0051660) |
0.0 | 0.1 | GO:1902255 | positive regulation of intrinsic apoptotic signaling pathway by p53 class mediator(GO:1902255) |
0.0 | 0.1 | GO:0072697 | protein localization to cell cortex(GO:0072697) |
0.0 | 0.2 | GO:0071569 | protein ufmylation(GO:0071569) protein polyufmylation(GO:1990564) protein K69-linked ufmylation(GO:1990592) |
0.0 | 0.2 | GO:0070127 | tRNA aminoacylation for mitochondrial protein translation(GO:0070127) |
0.0 | 0.8 | GO:0000470 | maturation of LSU-rRNA(GO:0000470) |
0.0 | 0.1 | GO:0007258 | JUN phosphorylation(GO:0007258) |
0.0 | 0.0 | GO:0000966 | RNA 5'-end processing(GO:0000966) |
0.0 | 1.9 | GO:0006970 | response to osmotic stress(GO:0006970) |
0.0 | 0.1 | GO:0048341 | paraxial mesoderm formation(GO:0048341) |
0.0 | 0.3 | GO:0015824 | proline transport(GO:0015824) |
0.0 | 0.4 | GO:1903427 | negative regulation of reactive oxygen species biosynthetic process(GO:1903427) |
0.0 | 0.1 | GO:0006551 | leucine metabolic process(GO:0006551) |
0.0 | 0.3 | GO:0002318 | myeloid progenitor cell differentiation(GO:0002318) |
0.0 | 0.2 | GO:1904424 | regulation of GTP binding(GO:1904424) |
0.0 | 0.3 | GO:0007000 | nucleolus organization(GO:0007000) |
0.0 | 0.2 | GO:0030311 | poly-N-acetyllactosamine metabolic process(GO:0030309) poly-N-acetyllactosamine biosynthetic process(GO:0030311) |
0.0 | 0.2 | GO:0007638 | mechanosensory behavior(GO:0007638) |
0.0 | 0.1 | GO:0007468 | regulation of rhodopsin gene expression(GO:0007468) |
0.0 | 0.0 | GO:0001807 | regulation of type IV hypersensitivity(GO:0001807) |
0.0 | 0.6 | GO:0061003 | positive regulation of dendritic spine morphogenesis(GO:0061003) |
0.0 | 0.0 | GO:0002930 | trabecular meshwork development(GO:0002930) |
0.0 | 0.2 | GO:0010032 | meiotic chromosome condensation(GO:0010032) |
0.0 | 0.1 | GO:0060800 | regulation of cell differentiation involved in embryonic placenta development(GO:0060800) |
0.0 | 0.2 | GO:0003148 | outflow tract septum morphogenesis(GO:0003148) |
0.0 | 0.1 | GO:0036092 | phosphatidylinositol-3-phosphate biosynthetic process(GO:0036092) |
0.0 | 0.1 | GO:0090310 | negative regulation of methylation-dependent chromatin silencing(GO:0090310) |
0.0 | 0.2 | GO:0070966 | nuclear-transcribed mRNA catabolic process, no-go decay(GO:0070966) |
0.0 | 0.0 | GO:0008078 | mesodermal cell migration(GO:0008078) |
0.0 | 1.8 | GO:0032543 | mitochondrial translation(GO:0032543) |
0.0 | 0.1 | GO:0006768 | biotin metabolic process(GO:0006768) |
0.0 | 0.1 | GO:0090214 | spongiotrophoblast layer developmental growth(GO:0090214) |
0.0 | 0.2 | GO:0019800 | peptide cross-linking via chondroitin 4-sulfate glycosaminoglycan(GO:0019800) |
0.0 | 1.0 | GO:0000184 | nuclear-transcribed mRNA catabolic process, nonsense-mediated decay(GO:0000184) |
0.0 | 0.1 | GO:0036462 | TRAIL-activated apoptotic signaling pathway(GO:0036462) |
0.0 | 0.1 | GO:0061743 | motor learning(GO:0061743) |
0.0 | 0.1 | GO:0000042 | protein targeting to Golgi(GO:0000042) |
0.0 | 0.0 | GO:0006287 | base-excision repair, gap-filling(GO:0006287) |
0.0 | 0.2 | GO:0006122 | mitochondrial electron transport, ubiquinol to cytochrome c(GO:0006122) |
0.0 | 0.5 | GO:0032801 | receptor catabolic process(GO:0032801) |
0.0 | 0.0 | GO:0060221 | retinal rod cell differentiation(GO:0060221) |
0.0 | 0.5 | GO:0002862 | negative regulation of inflammatory response to antigenic stimulus(GO:0002862) |
0.0 | 0.4 | GO:0002115 | store-operated calcium entry(GO:0002115) |
0.0 | 0.1 | GO:0003190 | atrioventricular valve formation(GO:0003190) |
0.0 | 0.2 | GO:0016115 | diterpenoid catabolic process(GO:0016103) terpenoid catabolic process(GO:0016115) retinoic acid catabolic process(GO:0034653) |
0.0 | 0.3 | GO:0001886 | endothelial cell morphogenesis(GO:0001886) |
0.0 | 0.0 | GO:1901077 | regulation of relaxation of muscle(GO:1901077) |
0.0 | 0.0 | GO:0007386 | compartment pattern specification(GO:0007386) |
0.0 | 0.1 | GO:0006059 | hexitol metabolic process(GO:0006059) |
0.0 | 0.1 | GO:0060028 | convergent extension involved in axis elongation(GO:0060028) |
0.0 | 0.1 | GO:0060414 | aorta smooth muscle tissue morphogenesis(GO:0060414) |
0.0 | 0.1 | GO:0008635 | activation of cysteine-type endopeptidase activity involved in apoptotic process by cytochrome c(GO:0008635) |
0.0 | 0.1 | GO:0070601 | centromeric sister chromatid cohesion(GO:0070601) |
0.0 | 0.5 | GO:0048026 | positive regulation of mRNA splicing, via spliceosome(GO:0048026) |
0.0 | 0.2 | GO:0006901 | vesicle coating(GO:0006901) |
0.0 | 0.3 | GO:0007216 | G-protein coupled glutamate receptor signaling pathway(GO:0007216) |
0.0 | 0.0 | GO:1901673 | regulation of mitotic spindle assembly(GO:1901673) |
0.0 | 0.1 | GO:0060684 | epithelial-mesenchymal cell signaling(GO:0060684) |
0.0 | 0.0 | GO:0045112 | integrin biosynthetic process(GO:0045112) |
0.0 | 0.3 | GO:0090161 | Golgi ribbon formation(GO:0090161) |
0.0 | 0.3 | GO:0034058 | endosomal vesicle fusion(GO:0034058) |
0.0 | 0.0 | GO:0007228 | positive regulation of hh target transcription factor activity(GO:0007228) |
0.0 | 0.1 | GO:0032621 | interleukin-18 production(GO:0032621) |
0.0 | 0.1 | GO:0007256 | activation of JNKK activity(GO:0007256) |
0.0 | 0.1 | GO:1901164 | negative regulation of trophoblast cell migration(GO:1901164) |
0.0 | 1.2 | GO:0046426 | negative regulation of JAK-STAT cascade(GO:0046426) negative regulation of STAT cascade(GO:1904893) |
0.0 | 0.2 | GO:1903551 | extracellular exosome assembly(GO:0071971) regulation of extracellular exosome assembly(GO:1903551) |
0.0 | 0.2 | GO:0040018 | positive regulation of multicellular organism growth(GO:0040018) |
0.0 | 0.4 | GO:0007020 | microtubule nucleation(GO:0007020) |
0.0 | 0.1 | GO:0090666 | scaRNA localization to Cajal body(GO:0090666) |
0.0 | 0.3 | GO:0006390 | transcription from mitochondrial promoter(GO:0006390) |
0.0 | 0.0 | GO:0033567 | DNA replication, Okazaki fragment processing(GO:0033567) |
0.0 | 0.3 | GO:0040015 | negative regulation of multicellular organism growth(GO:0040015) |
0.0 | 0.1 | GO:0070949 | regulation of neutrophil mediated cytotoxicity(GO:0070948) regulation of neutrophil mediated killing of symbiont cell(GO:0070949) |
0.0 | 0.0 | GO:1904251 | regulation of bile acid metabolic process(GO:1904251) |
0.0 | 0.1 | GO:0019853 | L-ascorbic acid biosynthetic process(GO:0019853) |
0.0 | 0.2 | GO:0071257 | cellular response to electrical stimulus(GO:0071257) |
0.0 | 0.1 | GO:0071554 | cell wall macromolecule metabolic process(GO:0044036) cell wall organization or biogenesis(GO:0071554) |
0.0 | 0.1 | GO:0035962 | response to interleukin-13(GO:0035962) cellular response to interleukin-13(GO:0035963) |
0.0 | 0.1 | GO:0097475 | motor neuron migration(GO:0097475) spinal cord motor neuron migration(GO:0097476) |
0.0 | 0.0 | GO:0003415 | chondrocyte hypertrophy(GO:0003415) |
0.0 | 0.1 | GO:0048752 | semicircular canal morphogenesis(GO:0048752) |
0.0 | 0.4 | GO:0045899 | positive regulation of RNA polymerase II transcriptional preinitiation complex assembly(GO:0045899) |
0.0 | 0.0 | GO:0072497 | mesenchymal stem cell differentiation(GO:0072497) |
0.0 | 0.1 | GO:0021869 | forebrain ventricular zone progenitor cell division(GO:0021869) |
0.0 | 0.2 | GO:2000980 | regulation of auditory receptor cell differentiation(GO:0045607) regulation of mechanoreceptor differentiation(GO:0045631) regulation of inner ear receptor cell differentiation(GO:2000980) |
0.0 | 0.3 | GO:0006957 | complement activation, alternative pathway(GO:0006957) |
0.0 | 0.2 | GO:0035810 | positive regulation of urine volume(GO:0035810) |
0.0 | 0.1 | GO:0050862 | positive regulation of T cell receptor signaling pathway(GO:0050862) |
0.0 | 0.1 | GO:0007223 | Wnt signaling pathway, calcium modulating pathway(GO:0007223) |
0.0 | 0.2 | GO:0009249 | protein lipoylation(GO:0009249) |
0.0 | 0.1 | GO:0043321 | regulation of natural killer cell degranulation(GO:0043321) |
0.0 | 0.2 | GO:0090073 | positive regulation of protein homodimerization activity(GO:0090073) |
0.0 | 0.2 | GO:0010388 | cullin deneddylation(GO:0010388) |
0.0 | 0.4 | GO:0048172 | regulation of short-term neuronal synaptic plasticity(GO:0048172) |
0.0 | 0.1 | GO:0001767 | establishment of lymphocyte polarity(GO:0001767) establishment of T cell polarity(GO:0001768) |
0.0 | 0.5 | GO:0072661 | protein targeting to plasma membrane(GO:0072661) |
0.0 | 0.0 | GO:0070973 | protein localization to endoplasmic reticulum exit site(GO:0070973) |
0.0 | 0.4 | GO:0006743 | ubiquinone metabolic process(GO:0006743) |
0.0 | 0.8 | GO:0006890 | retrograde vesicle-mediated transport, Golgi to ER(GO:0006890) |
0.0 | 0.1 | GO:0060743 | epithelial cell maturation involved in prostate gland development(GO:0060743) |
0.0 | 0.0 | GO:0006600 | creatine metabolic process(GO:0006600) |
0.0 | 0.1 | GO:0048014 | Tie signaling pathway(GO:0048014) |
0.0 | 0.0 | GO:0060750 | epithelial cell proliferation involved in mammary gland duct elongation(GO:0060750) |
0.0 | 0.4 | GO:0097576 | vacuole fusion(GO:0097576) |
0.0 | 0.0 | GO:0032239 | regulation of nucleobase-containing compound transport(GO:0032239) negative regulation of cardiac muscle contraction(GO:0055118) |
0.0 | 0.2 | GO:0043923 | positive regulation by host of viral transcription(GO:0043923) |
0.0 | 0.0 | GO:1990705 | cholangiocyte proliferation(GO:1990705) |
0.0 | 0.1 | GO:1901292 | nucleoside phosphate catabolic process(GO:1901292) |
0.0 | 0.0 | GO:0006268 | DNA unwinding involved in DNA replication(GO:0006268) |
0.0 | 0.0 | GO:0090084 | negative regulation of inclusion body assembly(GO:0090084) |
0.0 | 0.0 | GO:0021943 | formation of radial glial scaffolds(GO:0021943) |
0.0 | 0.1 | GO:0090527 | actin filament reorganization(GO:0090527) |
0.0 | 0.1 | GO:0031052 | programmed DNA elimination(GO:0031049) chromosome breakage(GO:0031052) |
0.0 | 0.0 | GO:0097278 | complement-dependent cytotoxicity(GO:0097278) |
0.0 | 0.1 | GO:1902514 | regulation of calcium ion transmembrane transport via high voltage-gated calcium channel(GO:1902514) |
0.0 | 0.1 | GO:0046173 | polyol biosynthetic process(GO:0046173) |
0.0 | 0.1 | GO:0061002 | negative regulation of dendritic spine morphogenesis(GO:0061002) |
0.0 | 0.3 | GO:2000269 | regulation of fibroblast apoptotic process(GO:2000269) |
0.0 | 0.1 | GO:0035280 | miRNA loading onto RISC involved in gene silencing by miRNA(GO:0035280) |
0.0 | 0.0 | GO:0090027 | negative regulation of monocyte chemotaxis(GO:0090027) |
0.0 | 0.1 | GO:0014043 | negative regulation of neuron maturation(GO:0014043) |
0.0 | 0.3 | GO:2000757 | negative regulation of protein acetylation(GO:1901984) negative regulation of peptidyl-lysine acetylation(GO:2000757) |
0.0 | 0.8 | GO:0009225 | nucleotide-sugar metabolic process(GO:0009225) |
0.0 | 0.1 | GO:0042256 | mature ribosome assembly(GO:0042256) |
0.0 | 0.0 | GO:0010749 | regulation of nitric oxide mediated signal transduction(GO:0010749) |
0.0 | 0.0 | GO:0002426 | immunoglobulin production in mucosal tissue(GO:0002426) |
0.0 | 0.1 | GO:0070245 | positive regulation of thymocyte apoptotic process(GO:0070245) |
0.0 | 0.3 | GO:0035855 | megakaryocyte development(GO:0035855) |
0.0 | 0.2 | GO:0034551 | respiratory chain complex III assembly(GO:0017062) mitochondrial respiratory chain complex III assembly(GO:0034551) mitochondrial respiratory chain complex III biogenesis(GO:0097033) |
0.0 | 0.2 | GO:1901070 | guanosine-containing compound biosynthetic process(GO:1901070) |
0.0 | 0.3 | GO:0071577 | zinc II ion transmembrane transport(GO:0071577) |
0.0 | 0.7 | GO:0006023 | aminoglycan biosynthetic process(GO:0006023) |
0.0 | 0.1 | GO:0040034 | regulation of development, heterochronic(GO:0040034) |
0.0 | 0.1 | GO:0071896 | protein localization to adherens junction(GO:0071896) |
0.0 | 0.2 | GO:0035372 | protein localization to microtubule(GO:0035372) |
0.0 | 0.1 | GO:0090151 | establishment of protein localization to mitochondrial membrane(GO:0090151) |
0.0 | 0.1 | GO:0045046 | peroxisomal membrane transport(GO:0015919) protein import into peroxisome membrane(GO:0045046) |
0.0 | 0.9 | GO:0006334 | nucleosome assembly(GO:0006334) |
0.0 | 0.2 | GO:0001771 | immunological synapse formation(GO:0001771) |
0.0 | 0.3 | GO:1902043 | positive regulation of extrinsic apoptotic signaling pathway via death domain receptors(GO:1902043) |
0.0 | 0.2 | GO:0021527 | spinal cord association neuron differentiation(GO:0021527) |
0.0 | 0.4 | GO:0030204 | chondroitin sulfate metabolic process(GO:0030204) |
0.0 | 0.2 | GO:0043117 | positive regulation of vascular permeability(GO:0043117) |
0.0 | 0.1 | GO:0006273 | lagging strand elongation(GO:0006273) |
0.0 | 0.4 | GO:0001574 | ganglioside biosynthetic process(GO:0001574) |
0.0 | 0.1 | GO:0010766 | negative regulation of sodium ion transport(GO:0010766) |
0.0 | 0.0 | GO:0010701 | positive regulation of norepinephrine secretion(GO:0010701) |
0.0 | 0.1 | GO:0010966 | regulation of phosphate transport(GO:0010966) |
0.0 | 0.1 | GO:2000060 | positive regulation of protein ubiquitination involved in ubiquitin-dependent protein catabolic process(GO:2000060) |
0.0 | 0.1 | GO:2000381 | negative regulation of mesoderm development(GO:2000381) |
0.0 | 0.3 | GO:0045742 | positive regulation of epidermal growth factor receptor signaling pathway(GO:0045742) positive regulation of ERBB signaling pathway(GO:1901186) |
0.0 | 0.1 | GO:0006983 | ER overload response(GO:0006983) |
0.0 | 0.1 | GO:0033227 | dsRNA transport(GO:0033227) |
0.0 | 0.0 | GO:0046051 | UTP metabolic process(GO:0046051) |
0.0 | 0.2 | GO:0032689 | negative regulation of interferon-gamma production(GO:0032689) |
0.0 | 0.3 | GO:1902572 | regulation of serine-type endopeptidase activity(GO:1900003) negative regulation of serine-type endopeptidase activity(GO:1900004) regulation of serine-type peptidase activity(GO:1902571) negative regulation of serine-type peptidase activity(GO:1902572) |
0.0 | 0.2 | GO:0006825 | copper ion transport(GO:0006825) |
0.0 | 0.2 | GO:0007341 | penetration of zona pellucida(GO:0007341) |
0.0 | 0.4 | GO:1902108 | regulation of mitochondrial membrane permeability involved in apoptotic process(GO:1902108) |
0.0 | 0.2 | GO:0016266 | O-glycan processing(GO:0016266) |
0.0 | 0.3 | GO:0035418 | protein localization to synapse(GO:0035418) |
0.0 | 0.0 | GO:0002538 | arachidonic acid metabolite production involved in inflammatory response(GO:0002538) |
0.0 | 0.2 | GO:0006307 | DNA dealkylation involved in DNA repair(GO:0006307) |
0.0 | 0.2 | GO:0051533 | positive regulation of NFAT protein import into nucleus(GO:0051533) |
0.0 | 0.1 | GO:0038003 | opioid receptor signaling pathway(GO:0038003) |
0.0 | 0.7 | GO:0009408 | response to heat(GO:0009408) |
0.0 | 0.2 | GO:0060074 | synapse maturation(GO:0060074) |
0.0 | 0.3 | GO:0060294 | cilium movement involved in cell motility(GO:0060294) |
0.0 | 0.4 | GO:0035094 | response to nicotine(GO:0035094) |
0.0 | 0.4 | GO:0045056 | transcytosis(GO:0045056) |
0.0 | 0.1 | GO:2000402 | negative regulation of lymphocyte migration(GO:2000402) |
0.0 | 0.6 | GO:0006270 | DNA replication initiation(GO:0006270) |
0.0 | 0.7 | GO:0006506 | GPI anchor biosynthetic process(GO:0006506) |
0.0 | 0.3 | GO:0043552 | positive regulation of phosphatidylinositol 3-kinase activity(GO:0043552) |
0.0 | 0.0 | GO:0046122 | purine deoxyribonucleoside metabolic process(GO:0046122) |
0.0 | 0.1 | GO:1903025 | regulation of RNA polymerase II regulatory region sequence-specific DNA binding(GO:1903025) |
0.0 | 0.1 | GO:0032304 | negative regulation of icosanoid secretion(GO:0032304) |
0.0 | 0.3 | GO:0032119 | sequestering of zinc ion(GO:0032119) regulation of sequestering of zinc ion(GO:0061088) |
0.0 | 0.1 | GO:0070309 | lens fiber cell morphogenesis(GO:0070309) |
0.0 | 0.1 | GO:0010992 | ubiquitin homeostasis(GO:0010992) |
0.0 | 0.4 | GO:1903861 | regulation of dendrite extension(GO:1903859) positive regulation of dendrite extension(GO:1903861) |
0.0 | 0.0 | GO:0060300 | regulation of cytokine activity(GO:0060300) |
0.0 | 1.1 | GO:0006400 | tRNA modification(GO:0006400) |
0.0 | 0.7 | GO:0061077 | chaperone-mediated protein folding(GO:0061077) |
0.0 | 0.1 | GO:0031573 | intra-S DNA damage checkpoint(GO:0031573) |
0.0 | 0.1 | GO:2000310 | regulation of N-methyl-D-aspartate selective glutamate receptor activity(GO:2000310) |
0.0 | 0.3 | GO:2000758 | positive regulation of peptidyl-lysine acetylation(GO:2000758) |
0.0 | 0.4 | GO:0051304 | chromosome separation(GO:0051304) |
0.0 | 0.3 | GO:0045070 | positive regulation of viral genome replication(GO:0045070) |
0.0 | 0.1 | GO:0005981 | regulation of glycogen catabolic process(GO:0005981) |
0.0 | 0.1 | GO:0003310 | pancreatic A cell differentiation(GO:0003310) |
0.0 | 0.9 | GO:0071391 | cellular response to estrogen stimulus(GO:0071391) |
0.0 | 0.1 | GO:0010288 | response to lead ion(GO:0010288) |
0.0 | 0.0 | GO:0097694 | establishment of RNA localization to telomere(GO:0097694) |
0.0 | 0.0 | GO:0000492 | small nucleolar ribonucleoprotein complex assembly(GO:0000491) box C/D snoRNP assembly(GO:0000492) |
0.0 | 0.1 | GO:0036123 | histone H3-K9 dimethylation(GO:0036123) |
0.0 | 0.1 | GO:0070682 | proteasome regulatory particle assembly(GO:0070682) |
0.0 | 0.0 | GO:0045617 | negative regulation of keratinocyte differentiation(GO:0045617) |
0.0 | 0.2 | GO:0048671 | negative regulation of collateral sprouting(GO:0048671) |
0.0 | 0.0 | GO:0030908 | intein-mediated protein splicing(GO:0016539) protein splicing(GO:0030908) |
0.0 | 0.1 | GO:0042026 | protein refolding(GO:0042026) |
0.0 | 0.0 | GO:0045085 | negative regulation of interleukin-2 biosynthetic process(GO:0045085) |
0.0 | 0.2 | GO:0035089 | establishment of apical/basal cell polarity(GO:0035089) |
0.0 | 0.0 | GO:2000828 | regulation of parathyroid hormone secretion(GO:2000828) |
0.0 | 0.2 | GO:0007064 | mitotic sister chromatid cohesion(GO:0007064) |
0.0 | 0.1 | GO:0060005 | vestibular reflex(GO:0060005) |
0.0 | 0.1 | GO:0032224 | positive regulation of synaptic transmission, cholinergic(GO:0032224) |
0.0 | 0.2 | GO:0031145 | anaphase-promoting complex-dependent catabolic process(GO:0031145) |
0.0 | 0.0 | GO:1903223 | positive regulation of oxidative stress-induced neuron death(GO:1903223) |
0.0 | 0.2 | GO:0060046 | regulation of acrosome reaction(GO:0060046) |
0.0 | 0.1 | GO:0002581 | negative regulation of antigen processing and presentation of peptide or polysaccharide antigen via MHC class II(GO:0002581) |
0.0 | 0.1 | GO:0000012 | single strand break repair(GO:0000012) |
0.0 | 0.5 | GO:0007029 | endoplasmic reticulum organization(GO:0007029) |
0.0 | 0.3 | GO:0016082 | synaptic vesicle priming(GO:0016082) |
0.0 | 0.0 | GO:1904667 | negative regulation of ubiquitin protein ligase activity(GO:1904667) |
0.0 | 0.1 | GO:0090219 | negative regulation of lipid kinase activity(GO:0090219) |
0.0 | 0.2 | GO:0006515 | misfolded or incompletely synthesized protein catabolic process(GO:0006515) |
0.0 | 0.1 | GO:0006369 | termination of RNA polymerase II transcription(GO:0006369) |
0.0 | 0.1 | GO:0032049 | cardiolipin biosynthetic process(GO:0032049) |
0.0 | 0.0 | GO:0061032 | visceral serous pericardium development(GO:0061032) |
0.0 | 0.0 | GO:0070922 | targeting of mRNA for destruction involved in RNA interference(GO:0030423) siRNA loading onto RISC involved in RNA interference(GO:0035087) small RNA loading onto RISC(GO:0070922) |
0.0 | 0.0 | GO:0060253 | negative regulation of glial cell proliferation(GO:0060253) |
0.0 | 0.1 | GO:0035313 | wound healing, spreading of epidermal cells(GO:0035313) |
0.0 | 0.2 | GO:0060259 | regulation of feeding behavior(GO:0060259) |
0.0 | 0.0 | GO:0019230 | proprioception(GO:0019230) |
0.0 | 0.0 | GO:1902410 | mitotic cytokinetic process(GO:1902410) |
0.0 | 0.1 | GO:0045838 | positive regulation of membrane potential(GO:0045838) |
0.0 | 0.0 | GO:0035864 | response to potassium ion(GO:0035864) cellular response to potassium ion(GO:0035865) |
0.0 | 0.0 | GO:0061072 | iris morphogenesis(GO:0061072) |
0.0 | 0.1 | GO:0046208 | spermine catabolic process(GO:0046208) |
0.0 | 0.0 | GO:0044854 | plasma membrane raft assembly(GO:0044854) plasma membrane raft organization(GO:0044857) |
0.0 | 0.0 | GO:1902837 | amino acid import into cell(GO:1902837) |
0.0 | 0.1 | GO:0046952 | ketone body catabolic process(GO:0046952) |
0.0 | 0.0 | GO:0043615 | astrocyte cell migration(GO:0043615) |
0.0 | 0.4 | GO:0007143 | female meiotic division(GO:0007143) |
0.0 | 0.0 | GO:2000384 | regulation of ectoderm development(GO:2000383) negative regulation of ectoderm development(GO:2000384) |
0.0 | 0.3 | GO:0071466 | cellular response to xenobiotic stimulus(GO:0071466) |
0.0 | 0.0 | GO:0010360 | negative regulation of anion channel activity(GO:0010360) |
0.0 | 0.0 | GO:0061622 | glycolytic process through glucose-1-phosphate(GO:0061622) |
0.0 | 0.0 | GO:0048550 | negative regulation of pinocytosis(GO:0048550) |
0.0 | 0.4 | GO:0035019 | somatic stem cell population maintenance(GO:0035019) |
0.0 | 0.1 | GO:0035437 | protein retention in ER lumen(GO:0006621) maintenance of protein localization in endoplasmic reticulum(GO:0035437) |
0.0 | 0.5 | GO:0042596 | fear response(GO:0042596) |
0.0 | 0.2 | GO:1900017 | positive regulation of cytokine production involved in inflammatory response(GO:1900017) |
0.0 | 0.0 | GO:1901187 | regulation of ephrin receptor signaling pathway(GO:1901187) |
0.0 | 0.1 | GO:0002457 | T cell antigen processing and presentation(GO:0002457) |
0.0 | 0.3 | GO:0016578 | histone deubiquitination(GO:0016578) |
0.0 | 0.0 | GO:0000963 | mitochondrial RNA processing(GO:0000963) |
0.0 | 0.2 | GO:0090004 | positive regulation of establishment of protein localization to plasma membrane(GO:0090004) |
0.0 | 0.0 | GO:0018208 | peptidyl-proline modification(GO:0018208) |
0.0 | 0.0 | GO:0090503 | RNA phosphodiester bond hydrolysis, exonucleolytic(GO:0090503) |
0.0 | 0.0 | GO:0061009 | common bile duct development(GO:0061009) |
0.0 | 0.2 | GO:0045986 | negative regulation of smooth muscle contraction(GO:0045986) |
0.0 | 0.1 | GO:0035234 | ectopic germ cell programmed cell death(GO:0035234) |
0.0 | 0.2 | GO:0040014 | regulation of multicellular organism growth(GO:0040014) |
0.0 | 0.0 | GO:0060244 | negative regulation of cell proliferation involved in contact inhibition(GO:0060244) |
0.0 | 0.4 | GO:0071300 | cellular response to retinoic acid(GO:0071300) |
0.0 | 0.0 | GO:0032497 | detection of lipopolysaccharide(GO:0032497) |
0.0 | 0.0 | GO:0021979 | hypothalamus cell differentiation(GO:0021979) |
0.0 | 0.1 | GO:0008228 | opsonization(GO:0008228) |
0.0 | 0.9 | GO:0042147 | retrograde transport, endosome to Golgi(GO:0042147) |
0.0 | 0.1 | GO:0021796 | cerebral cortex regionalization(GO:0021796) |
0.0 | 0.1 | GO:0007194 | negative regulation of adenylate cyclase activity(GO:0007194) |
0.0 | 0.0 | GO:0060316 | positive regulation of ryanodine-sensitive calcium-release channel activity(GO:0060316) |
0.0 | 0.7 | GO:0070098 | chemokine-mediated signaling pathway(GO:0070098) |
0.0 | 0.4 | GO:0022900 | electron transport chain(GO:0022900) |
0.0 | 0.0 | GO:0007406 | negative regulation of neuroblast proliferation(GO:0007406) |
0.0 | 0.0 | GO:0035106 | operant conditioning(GO:0035106) |
0.0 | 0.1 | GO:0060017 | parathyroid gland development(GO:0060017) |
0.0 | 0.1 | GO:0021984 | adenohypophysis development(GO:0021984) |
0.0 | 0.2 | GO:0016180 | snRNA processing(GO:0016180) |
0.0 | 0.1 | GO:0036010 | protein localization to endosome(GO:0036010) |
0.0 | 0.1 | GO:0070197 | meiotic telomere tethering at nuclear periphery(GO:0044821) meiotic attachment of telomere to nuclear envelope(GO:0070197) chromosome attachment to the nuclear envelope(GO:0097240) |
0.0 | 0.6 | GO:0071333 | cellular response to glucose stimulus(GO:0071333) |
0.0 | 0.0 | GO:0033326 | cerebrospinal fluid secretion(GO:0033326) |
0.0 | 0.2 | GO:0045671 | negative regulation of osteoclast differentiation(GO:0045671) |
0.0 | 0.0 | GO:0060123 | regulation of growth hormone secretion(GO:0060123) |
0.0 | 0.1 | GO:0007210 | serotonin receptor signaling pathway(GO:0007210) |
0.0 | 0.1 | GO:0071359 | cellular response to dsRNA(GO:0071359) |
0.0 | 0.2 | GO:0035116 | embryonic hindlimb morphogenesis(GO:0035116) |
0.0 | 0.2 | GO:1990403 | embryonic brain development(GO:1990403) |
0.0 | 0.1 | GO:0035269 | protein O-linked mannosylation(GO:0035269) |
0.0 | 0.0 | GO:0045978 | negative regulation of nucleoside metabolic process(GO:0045978) negative regulation of ATP metabolic process(GO:1903579) |
0.0 | 0.0 | GO:0019065 | receptor-mediated endocytosis of virus by host cell(GO:0019065) endocytosis involved in viral entry into host cell(GO:0075509) |
0.0 | 0.1 | GO:0070995 | NADPH oxidation(GO:0070995) |
0.0 | 0.1 | GO:0043654 | recognition of apoptotic cell(GO:0043654) |
0.0 | 0.1 | GO:0010544 | negative regulation of platelet activation(GO:0010544) |
0.0 | 0.1 | GO:0021801 | cerebral cortex radial glia guided migration(GO:0021801) telencephalon glial cell migration(GO:0022030) |
0.0 | 0.0 | GO:0035886 | vascular smooth muscle cell differentiation(GO:0035886) |
0.0 | 0.0 | GO:2000680 | regulation of rubidium ion transport(GO:2000680) |
0.0 | 0.1 | GO:0033004 | negative regulation of mast cell activation(GO:0033004) |
0.0 | 0.1 | GO:0042090 | interleukin-12 biosynthetic process(GO:0042090) regulation of interleukin-12 biosynthetic process(GO:0045075) |
0.0 | 0.2 | GO:0000132 | establishment of mitotic spindle orientation(GO:0000132) |
0.0 | 0.0 | GO:0033132 | regulation of glucokinase activity(GO:0033131) negative regulation of glucokinase activity(GO:0033132) regulation of hexokinase activity(GO:1903299) negative regulation of hexokinase activity(GO:1903300) |
0.0 | 0.1 | GO:0006004 | fucose metabolic process(GO:0006004) |
0.0 | 0.0 | GO:0035635 | entry of bacterium into host cell(GO:0035635) regulation of entry of bacterium into host cell(GO:2000535) |
0.0 | 0.0 | GO:0021562 | vestibulocochlear nerve development(GO:0021562) |
0.0 | 0.2 | GO:0006493 | protein O-linked glycosylation(GO:0006493) |
0.0 | 0.0 | GO:1902035 | positive regulation of hematopoietic stem cell proliferation(GO:1902035) |
0.0 | 0.1 | GO:0042732 | D-xylose metabolic process(GO:0042732) |
0.0 | 0.1 | GO:0006546 | glycine catabolic process(GO:0006546) glycine decarboxylation via glycine cleavage system(GO:0019464) |
0.0 | 0.1 | GO:0014002 | astrocyte development(GO:0014002) |
0.0 | 0.1 | GO:0032516 | positive regulation of phosphoprotein phosphatase activity(GO:0032516) |
0.0 | 0.0 | GO:0044154 | histone H3-K14 acetylation(GO:0044154) |
0.0 | 0.0 | GO:0043987 | histone H3-S10 phosphorylation(GO:0043987) |
0.0 | 0.1 | GO:0002087 | regulation of respiratory gaseous exchange by neurological system process(GO:0002087) |
0.0 | 0.0 | GO:0060687 | regulation of branching involved in prostate gland morphogenesis(GO:0060687) |
0.0 | 0.1 | GO:0007342 | fusion of sperm to egg plasma membrane(GO:0007342) |
0.0 | 0.2 | GO:2000272 | negative regulation of receptor activity(GO:2000272) |
0.0 | 0.1 | GO:0061055 | myotome development(GO:0061055) |
0.0 | 0.0 | GO:2000343 | positive regulation of chemokine (C-X-C motif) ligand 2 production(GO:2000343) |
0.0 | 0.6 | GO:0006892 | post-Golgi vesicle-mediated transport(GO:0006892) |
0.0 | 0.0 | GO:0019377 | glycolipid catabolic process(GO:0019377) |
0.0 | 0.0 | GO:0072148 | epithelial cell fate commitment(GO:0072148) |
0.0 | 0.0 | GO:0048743 | positive regulation of skeletal muscle fiber development(GO:0048743) |
0.0 | 0.0 | GO:0031284 | positive regulation of guanylate cyclase activity(GO:0031284) |
0.0 | 0.0 | GO:0032815 | negative regulation of natural killer cell activation(GO:0032815) |
0.0 | 0.0 | GO:0021523 | somatic motor neuron differentiation(GO:0021523) |
0.0 | 0.1 | GO:0086027 | AV node cell action potential(GO:0086016) AV node cell to bundle of His cell signaling(GO:0086027) AV node cell to bundle of His cell communication(GO:0086067) |
0.0 | 0.0 | GO:0014816 | skeletal muscle satellite cell differentiation(GO:0014816) |
0.0 | 0.0 | GO:0033085 | negative regulation of T cell differentiation in thymus(GO:0033085) |
0.0 | 0.0 | GO:0070272 | proton-transporting ATP synthase complex assembly(GO:0043461) proton-transporting ATP synthase complex biogenesis(GO:0070272) |
0.0 | 0.1 | GO:0043174 | nucleoside salvage(GO:0043174) |
0.0 | 0.1 | GO:0014041 | regulation of neuron maturation(GO:0014041) |
0.0 | 0.0 | GO:0042537 | benzene-containing compound metabolic process(GO:0042537) |
0.0 | 0.0 | GO:0030579 | ubiquitin-dependent SMAD protein catabolic process(GO:0030579) |
0.0 | 0.1 | GO:0071625 | vocalization behavior(GO:0071625) |
0.0 | 0.0 | GO:0072385 | minus-end-directed organelle transport along microtubule(GO:0072385) |
0.0 | 0.1 | GO:0019509 | L-methionine biosynthetic process from methylthioadenosine(GO:0019509) |
0.0 | 0.0 | GO:0006481 | C-terminal protein methylation(GO:0006481) |
0.0 | 0.0 | GO:1902855 | regulation of nonmotile primary cilium assembly(GO:1902855) |
0.0 | 0.1 | GO:0070884 | regulation of calcineurin-NFAT signaling cascade(GO:0070884) |
0.0 | 0.4 | GO:0043966 | histone H3 acetylation(GO:0043966) |
0.0 | 0.0 | GO:0019388 | galactose catabolic process(GO:0019388) |
0.0 | 0.0 | GO:0021698 | cerebellar cortex structural organization(GO:0021698) |
0.0 | 0.2 | GO:0008053 | mitochondrial fusion(GO:0008053) |
0.0 | 0.0 | GO:0060967 | negative regulation of posttranscriptional gene silencing(GO:0060149) negative regulation of gene silencing by RNA(GO:0060967) |
0.0 | 0.0 | GO:1902534 | single-organism membrane invagination(GO:1902534) |
0.0 | 0.1 | GO:0042780 | tRNA 3'-end processing(GO:0042780) |
0.0 | 0.0 | GO:1902302 | regulation of potassium ion export(GO:1902302) |
0.0 | 0.5 | GO:0010501 | RNA secondary structure unwinding(GO:0010501) |
0.0 | 0.0 | GO:0042938 | dipeptide transport(GO:0042938) |
0.0 | 0.0 | GO:0042693 | muscle cell fate commitment(GO:0042693) |
0.0 | 0.2 | GO:0048642 | negative regulation of skeletal muscle tissue development(GO:0048642) |
0.0 | 0.0 | GO:0045743 | positive regulation of fibroblast growth factor receptor signaling pathway(GO:0045743) |
0.0 | 0.0 | GO:0007199 | G-protein coupled receptor signaling pathway coupled to cGMP nucleotide second messenger(GO:0007199) |
0.0 | 0.0 | GO:0033690 | positive regulation of osteoblast proliferation(GO:0033690) |
0.0 | 0.1 | GO:2000144 | positive regulation of DNA-templated transcription, initiation(GO:2000144) |
0.0 | 0.0 | GO:0060789 | hair follicle placode formation(GO:0060789) |
0.0 | 0.0 | GO:0002584 | negative regulation of antigen processing and presentation(GO:0002578) negative regulation of antigen processing and presentation of peptide antigen(GO:0002584) |
0.0 | 0.7 | GO:0006457 | protein folding(GO:0006457) |
0.0 | 0.0 | GO:0014053 | negative regulation of gamma-aminobutyric acid secretion(GO:0014053) |
0.0 | 0.1 | GO:0030007 | cellular potassium ion homeostasis(GO:0030007) |
0.0 | 0.0 | GO:0090244 | Wnt signaling pathway involved in somitogenesis(GO:0090244) |
0.0 | 0.0 | GO:0003401 | axis elongation(GO:0003401) |
0.0 | 0.0 | GO:0090237 | regulation of arachidonic acid secretion(GO:0090237) |
0.0 | 0.0 | GO:0001777 | T cell homeostatic proliferation(GO:0001777) regulation of T cell homeostatic proliferation(GO:0046013) |
0.0 | 0.6 | GO:1903749 | positive regulation of establishment of protein localization to mitochondrion(GO:1903749) positive regulation of protein targeting to mitochondrion(GO:1903955) |
0.0 | 0.1 | GO:0032515 | negative regulation of phosphoprotein phosphatase activity(GO:0032515) |
0.0 | 0.0 | GO:0061101 | neuroendocrine cell differentiation(GO:0061101) |
0.0 | 0.0 | GO:0045650 | negative regulation of macrophage differentiation(GO:0045650) |
0.0 | 0.0 | GO:1904491 | protein localization to ciliary transition zone(GO:1904491) |
0.0 | 0.0 | GO:0009052 | pentose-phosphate shunt, non-oxidative branch(GO:0009052) |
0.0 | 0.1 | GO:1900015 | regulation of cytokine production involved in inflammatory response(GO:1900015) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
2.0 | 5.9 | GO:0097487 | multivesicular body, internal vesicle(GO:0097487) |
1.0 | 5.1 | GO:0045098 | type III intermediate filament(GO:0045098) |
0.9 | 4.5 | GO:0031094 | platelet dense tubular network(GO:0031094) |
0.6 | 6.6 | GO:0070852 | cell body fiber(GO:0070852) |
0.6 | 0.6 | GO:0045239 | tricarboxylic acid cycle enzyme complex(GO:0045239) |
0.5 | 2.0 | GO:0044316 | cone cell pedicle(GO:0044316) |
0.5 | 1.5 | GO:0060053 | neurofilament cytoskeleton(GO:0060053) |
0.4 | 2.2 | GO:0031315 | extrinsic component of mitochondrial outer membrane(GO:0031315) |
0.4 | 1.3 | GO:0097441 | basilar dendrite(GO:0097441) |
0.4 | 2.0 | GO:0031298 | replication fork protection complex(GO:0031298) |
0.4 | 1.6 | GO:0035867 | alphav-beta3 integrin-IGF-1-IGF1R complex(GO:0035867) |
0.4 | 1.1 | GO:0048179 | activin receptor complex(GO:0048179) |
0.3 | 0.3 | GO:0030056 | hemidesmosome(GO:0030056) |
0.3 | 0.9 | GO:0070552 | BRISC complex(GO:0070552) |
0.3 | 1.5 | GO:0042406 | extrinsic component of endoplasmic reticulum membrane(GO:0042406) |
0.3 | 4.7 | GO:0000930 | gamma-tubulin complex(GO:0000930) |
0.3 | 1.2 | GO:0033269 | internode region of axon(GO:0033269) |
0.3 | 1.2 | GO:0002079 | inner acrosomal membrane(GO:0002079) |
0.3 | 1.7 | GO:0035032 | phosphatidylinositol 3-kinase complex, class III(GO:0035032) |
0.3 | 1.4 | GO:0097433 | dense body(GO:0097433) |
0.3 | 0.3 | GO:0044615 | nuclear pore nuclear basket(GO:0044615) |
0.3 | 1.5 | GO:0005915 | zonula adherens(GO:0005915) |
0.2 | 0.2 | GO:0030981 | cortical microtubule cytoskeleton(GO:0030981) |
0.2 | 1.7 | GO:0005952 | cAMP-dependent protein kinase complex(GO:0005952) |
0.2 | 2.6 | GO:0042405 | nuclear inclusion body(GO:0042405) |
0.2 | 0.7 | GO:0031933 | telomeric heterochromatin(GO:0031933) |
0.2 | 1.3 | GO:0071598 | neuronal ribonucleoprotein granule(GO:0071598) |
0.2 | 0.7 | GO:0032444 | activin responsive factor complex(GO:0032444) |
0.2 | 1.5 | GO:0016600 | flotillin complex(GO:0016600) |
0.2 | 1.9 | GO:0032045 | guanyl-nucleotide exchange factor complex(GO:0032045) |
0.2 | 1.5 | GO:0045180 | basal cortex(GO:0045180) |
0.2 | 3.9 | GO:0032588 | trans-Golgi network membrane(GO:0032588) |
0.2 | 1.0 | GO:0070688 | MLL5-L complex(GO:0070688) |
0.2 | 0.4 | GO:1990316 | ATG1/ULK1 kinase complex(GO:1990316) |
0.2 | 2.4 | GO:0034663 | endoplasmic reticulum chaperone complex(GO:0034663) |
0.2 | 0.6 | GO:0097418 | neurofibrillary tangle(GO:0097418) |
0.2 | 0.6 | GO:0036449 | microtubule minus-end(GO:0036449) |
0.2 | 1.4 | GO:0016342 | catenin complex(GO:0016342) |
0.2 | 1.5 | GO:0070578 | RISC-loading complex(GO:0070578) |
0.2 | 0.7 | GO:0045293 | mRNA editing complex(GO:0045293) |
0.2 | 8.1 | GO:0042645 | nucleoid(GO:0009295) mitochondrial nucleoid(GO:0042645) |
0.2 | 2.1 | GO:0005847 | mRNA cleavage and polyadenylation specificity factor complex(GO:0005847) |
0.2 | 4.1 | GO:0005719 | nuclear euchromatin(GO:0005719) |
0.2 | 0.2 | GO:1990111 | spermatoproteasome complex(GO:1990111) |
0.2 | 0.8 | GO:0005579 | membrane attack complex(GO:0005579) |
0.2 | 1.2 | GO:0072669 | tRNA-splicing ligase complex(GO:0072669) |
0.2 | 0.8 | GO:0071458 | integral component of cytoplasmic side of endoplasmic reticulum membrane(GO:0071458) integral component of lumenal side of endoplasmic reticulum membrane(GO:0071556) lumenal side of endoplasmic reticulum membrane(GO:0098553) |
0.2 | 1.3 | GO:0042587 | glycogen granule(GO:0042587) |
0.2 | 6.5 | GO:0005747 | mitochondrial respiratory chain complex I(GO:0005747) NADH dehydrogenase complex(GO:0030964) respiratory chain complex I(GO:0045271) |
0.2 | 0.5 | GO:0005827 | polar microtubule(GO:0005827) |
0.2 | 0.6 | GO:0032541 | cortical endoplasmic reticulum(GO:0032541) |
0.2 | 0.5 | GO:0014731 | spectrin-associated cytoskeleton(GO:0014731) |
0.2 | 2.7 | GO:0035327 | transcriptionally active chromatin(GO:0035327) |
0.2 | 0.9 | GO:0044233 | ER-mitochondrion membrane contact site(GO:0044233) |
0.2 | 0.5 | GO:0005784 | Sec61 translocon complex(GO:0005784) translocon complex(GO:0071256) |
0.2 | 0.5 | GO:0070939 | Dsl1p complex(GO:0070939) |
0.2 | 0.8 | GO:0071782 | endoplasmic reticulum tubular network(GO:0071782) |
0.1 | 2.2 | GO:0097038 | perinuclear endoplasmic reticulum(GO:0097038) |
0.1 | 0.6 | GO:0097524 | sperm plasma membrane(GO:0097524) |
0.1 | 1.0 | GO:0031588 | nucleotide-activated protein kinase complex(GO:0031588) |
0.1 | 0.6 | GO:1990745 | EARP complex(GO:1990745) |
0.1 | 1.3 | GO:0032593 | insulin-responsive compartment(GO:0032593) |
0.1 | 0.6 | GO:0016602 | CCAAT-binding factor complex(GO:0016602) |
0.1 | 1.1 | GO:0000506 | glycosylphosphatidylinositol-N-acetylglucosaminyltransferase (GPI-GnT) complex(GO:0000506) |
0.1 | 0.5 | GO:0008091 | spectrin(GO:0008091) |
0.1 | 0.9 | GO:0036056 | filtration diaphragm(GO:0036056) slit diaphragm(GO:0036057) |
0.1 | 0.8 | GO:0070776 | H3 histone acetyltransferase complex(GO:0070775) MOZ/MORF histone acetyltransferase complex(GO:0070776) |
0.1 | 0.4 | GO:0031074 | nucleocytoplasmic shuttling complex(GO:0031074) |
0.1 | 0.4 | GO:0005955 | calcineurin complex(GO:0005955) |
0.1 | 0.4 | GO:0030289 | protein phosphatase 4 complex(GO:0030289) |
0.1 | 0.5 | GO:0044613 | nuclear pore central transport channel(GO:0044613) |
0.1 | 1.1 | GO:0008250 | oligosaccharyltransferase complex(GO:0008250) |
0.1 | 1.3 | GO:0035253 | ciliary rootlet(GO:0035253) |
0.1 | 0.5 | GO:0030478 | actin cap(GO:0030478) |
0.1 | 0.7 | GO:0000347 | THO complex(GO:0000347) THO complex part of transcription export complex(GO:0000445) |
0.1 | 0.4 | GO:0033186 | CAF-1 complex(GO:0033186) |
0.1 | 0.2 | GO:0034673 | inhibin-betaglycan-ActRII complex(GO:0034673) |
0.1 | 0.2 | GO:0098554 | cytoplasmic side of endoplasmic reticulum membrane(GO:0098554) |
0.1 | 4.8 | GO:0005788 | endoplasmic reticulum lumen(GO:0005788) |
0.1 | 1.8 | GO:0000242 | pericentriolar material(GO:0000242) |
0.1 | 0.2 | GO:0032437 | cuticular plate(GO:0032437) |
0.1 | 0.6 | GO:0031428 | box C/D snoRNP complex(GO:0031428) |
0.1 | 0.6 | GO:0000306 | extrinsic component of vacuolar membrane(GO:0000306) |
0.1 | 0.3 | GO:0098536 | deuterosome(GO:0098536) |
0.1 | 0.7 | GO:0044214 | spanning component of plasma membrane(GO:0044214) spanning component of membrane(GO:0089717) |
0.1 | 0.3 | GO:0043625 | delta DNA polymerase complex(GO:0043625) |
0.1 | 0.8 | GO:0030122 | AP-2 adaptor complex(GO:0030122) |
0.1 | 5.4 | GO:0031903 | peroxisomal membrane(GO:0005778) microbody membrane(GO:0031903) |
0.1 | 0.3 | GO:0046691 | intracellular canaliculus(GO:0046691) |
0.1 | 0.9 | GO:0019773 | proteasome core complex, alpha-subunit complex(GO:0019773) |
0.1 | 0.4 | GO:0031265 | CD95 death-inducing signaling complex(GO:0031265) |
0.1 | 0.3 | GO:0097413 | Lewy body(GO:0097413) |
0.1 | 0.4 | GO:0016442 | RISC complex(GO:0016442) RNAi effector complex(GO:0031332) |
0.1 | 0.8 | GO:0044666 | MLL3/4 complex(GO:0044666) |
0.1 | 0.8 | GO:0000808 | origin recognition complex(GO:0000808) nuclear origin of replication recognition complex(GO:0005664) |
0.1 | 0.4 | GO:0097209 | epidermal lamellar body(GO:0097209) |
0.1 | 2.8 | GO:0005763 | organellar small ribosomal subunit(GO:0000314) mitochondrial small ribosomal subunit(GO:0005763) |
0.1 | 0.4 | GO:0035371 | microtubule plus-end(GO:0035371) |
0.1 | 0.4 | GO:0071203 | WASH complex(GO:0071203) |
0.1 | 1.3 | GO:0032580 | Golgi cisterna membrane(GO:0032580) |
0.1 | 0.5 | GO:0033503 | HULC complex(GO:0033503) |
0.1 | 0.6 | GO:0045252 | oxoglutarate dehydrogenase complex(GO:0045252) |
0.1 | 0.1 | GO:0002178 | palmitoyltransferase complex(GO:0002178) |
0.1 | 1.7 | GO:0043034 | costamere(GO:0043034) |
0.1 | 0.4 | GO:1990357 | terminal web(GO:1990357) |
0.1 | 0.5 | GO:0043202 | lysosomal lumen(GO:0043202) |
0.1 | 0.3 | GO:0090661 | box H/ACA telomerase RNP complex(GO:0090661) |
0.1 | 0.1 | GO:0031258 | lamellipodium membrane(GO:0031258) |
0.1 | 0.4 | GO:0030891 | VCB complex(GO:0030891) |
0.1 | 0.3 | GO:0031502 | dolichyl-phosphate-mannose-protein mannosyltransferase complex(GO:0031502) |
0.1 | 0.4 | GO:0030127 | COPII vesicle coat(GO:0030127) |
0.1 | 0.3 | GO:0071942 | XPC complex(GO:0071942) |
0.1 | 0.3 | GO:0097058 | CRLF-CLCF1 complex(GO:0097058) |
0.1 | 0.4 | GO:0072357 | PTW/PP1 phosphatase complex(GO:0072357) |
0.1 | 0.7 | GO:0008024 | cyclin/CDK positive transcription elongation factor complex(GO:0008024) |
0.1 | 0.6 | GO:0000164 | protein phosphatase type 1 complex(GO:0000164) |
0.1 | 0.4 | GO:0070545 | PeBoW complex(GO:0070545) |
0.1 | 0.6 | GO:0031464 | Cul4A-RING E3 ubiquitin ligase complex(GO:0031464) |
0.1 | 0.9 | GO:0000782 | telomere cap complex(GO:0000782) nuclear telomere cap complex(GO:0000783) |
0.1 | 0.3 | GO:0097452 | GAIT complex(GO:0097452) |
0.1 | 0.3 | GO:0097025 | MPP7-DLG1-LIN7 complex(GO:0097025) |
0.1 | 0.5 | GO:0031415 | NatA complex(GO:0031415) |
0.1 | 0.3 | GO:0097651 | phosphatidylinositol 3-kinase complex, class I(GO:0097651) |
0.1 | 0.4 | GO:0036128 | CatSper complex(GO:0036128) |
0.1 | 0.3 | GO:0044308 | axonal spine(GO:0044308) |
0.1 | 0.4 | GO:0033276 | transcription factor TFTC complex(GO:0033276) |
0.1 | 0.2 | GO:0005958 | DNA-dependent protein kinase-DNA ligase 4 complex(GO:0005958) |
0.1 | 2.2 | GO:0010494 | cytoplasmic stress granule(GO:0010494) |
0.1 | 0.2 | GO:1990423 | RZZ complex(GO:1990423) |
0.1 | 0.7 | GO:0030061 | mitochondrial crista(GO:0030061) |
0.1 | 0.4 | GO:0046696 | lipopolysaccharide receptor complex(GO:0046696) |
0.1 | 10.4 | GO:0005759 | mitochondrial matrix(GO:0005759) |
0.1 | 0.1 | GO:0033655 | host cell cytoplasm(GO:0030430) host intracellular part(GO:0033646) host cell cytoplasm part(GO:0033655) intracellular region of host(GO:0043656) |
0.1 | 0.2 | GO:0031314 | extrinsic component of mitochondrial inner membrane(GO:0031314) |
0.1 | 0.9 | GO:0043240 | Fanconi anaemia nuclear complex(GO:0043240) |
0.1 | 0.5 | GO:0042629 | mast cell granule(GO:0042629) |
0.1 | 0.2 | GO:0005785 | signal recognition particle receptor complex(GO:0005785) |
0.1 | 0.3 | GO:0034098 | VCP-NPL4-UFD1 AAA ATPase complex(GO:0034098) |
0.1 | 0.4 | GO:0002177 | manchette(GO:0002177) |
0.1 | 1.2 | GO:0030904 | retromer complex(GO:0030904) |
0.1 | 0.1 | GO:0034666 | integrin alpha2-beta1 complex(GO:0034666) |
0.1 | 2.2 | GO:0031672 | A band(GO:0031672) |
0.1 | 0.3 | GO:0035339 | SPOTS complex(GO:0035339) |
0.1 | 1.2 | GO:1903293 | protein serine/threonine phosphatase complex(GO:0008287) phosphatase complex(GO:1903293) |
0.1 | 0.4 | GO:0070847 | core mediator complex(GO:0070847) |
0.1 | 0.3 | GO:0071438 | invadopodium membrane(GO:0071438) |
0.1 | 0.1 | GO:0005593 | FACIT collagen trimer(GO:0005593) collagen type IX trimer(GO:0005594) |
0.1 | 0.2 | GO:0031417 | NatC complex(GO:0031417) |
0.1 | 0.8 | GO:0032426 | stereocilium tip(GO:0032426) |
0.1 | 0.8 | GO:0036038 | MKS complex(GO:0036038) |
0.1 | 0.6 | GO:0008074 | guanylate cyclase complex, soluble(GO:0008074) |
0.1 | 0.3 | GO:0042765 | GPI-anchor transamidase complex(GO:0042765) |
0.1 | 0.3 | GO:0033270 | paranode region of axon(GO:0033270) |
0.1 | 0.4 | GO:0035749 | myelin sheath adaxonal region(GO:0035749) |
0.1 | 0.4 | GO:0071014 | post-mRNA release spliceosomal complex(GO:0071014) |
0.1 | 0.3 | GO:0005964 | phosphorylase kinase complex(GO:0005964) |
0.1 | 0.4 | GO:0016272 | prefoldin complex(GO:0016272) |
0.1 | 0.4 | GO:0016012 | dystroglycan complex(GO:0016011) sarcoglycan complex(GO:0016012) |
0.1 | 0.7 | GO:0030914 | STAGA complex(GO:0030914) |
0.1 | 2.6 | GO:0005758 | mitochondrial intermembrane space(GO:0005758) |
0.1 | 0.8 | GO:0000940 | condensed chromosome outer kinetochore(GO:0000940) |
0.1 | 0.2 | GO:0005968 | Rab-protein geranylgeranyltransferase complex(GO:0005968) |
0.1 | 0.4 | GO:0033263 | CORVET complex(GO:0033263) |
0.1 | 0.4 | GO:0048500 | signal recognition particle, endoplasmic reticulum targeting(GO:0005786) signal recognition particle(GO:0048500) |
0.1 | 0.2 | GO:0044530 | supraspliceosomal complex(GO:0044530) |
0.1 | 0.1 | GO:1990851 | Wnt-Frizzled-LRP5/6 complex(GO:1990851) |
0.1 | 0.2 | GO:0000346 | transcription export complex(GO:0000346) |
0.1 | 1.4 | GO:0000307 | cyclin-dependent protein kinase holoenzyme complex(GO:0000307) |
0.1 | 0.7 | GO:0043196 | varicosity(GO:0043196) |
0.1 | 0.2 | GO:0072487 | MSL complex(GO:0072487) |
0.1 | 0.2 | GO:0002193 | MAML1-RBP-Jkappa- ICN1 complex(GO:0002193) |
0.1 | 0.6 | GO:0005671 | Ada2/Gcn5/Ada3 transcription activator complex(GO:0005671) |
0.1 | 0.1 | GO:0000802 | transverse filament(GO:0000802) |
0.1 | 0.4 | GO:0045179 | apical cortex(GO:0045179) |
0.1 | 0.6 | GO:0005665 | DNA-directed RNA polymerase II, core complex(GO:0005665) |
0.1 | 0.2 | GO:1990131 | EGO complex(GO:0034448) Gtr1-Gtr2 GTPase complex(GO:1990131) |
0.1 | 0.6 | GO:0002199 | zona pellucida receptor complex(GO:0002199) |
0.1 | 0.5 | GO:0072546 | ER membrane protein complex(GO:0072546) |
0.1 | 0.1 | GO:0045009 | melanosome membrane(GO:0033162) chitosome(GO:0045009) |
0.1 | 0.2 | GO:0005956 | protein kinase CK2 complex(GO:0005956) |
0.1 | 0.2 | GO:0000322 | storage vacuole(GO:0000322) |
0.1 | 1.4 | GO:0005771 | multivesicular body(GO:0005771) |
0.1 | 0.6 | GO:0031083 | BLOC-1 complex(GO:0031083) |
0.1 | 0.6 | GO:0051233 | spindle midzone(GO:0051233) |
0.1 | 0.3 | GO:0000220 | vacuolar proton-transporting V-type ATPase, V0 domain(GO:0000220) |
0.1 | 0.4 | GO:0031143 | pseudopodium(GO:0031143) |
0.1 | 1.0 | GO:0005891 | voltage-gated calcium channel complex(GO:0005891) |
0.1 | 0.1 | GO:0000814 | ESCRT II complex(GO:0000814) |
0.1 | 0.6 | GO:0001518 | voltage-gated sodium channel complex(GO:0001518) |
0.1 | 2.6 | GO:0097517 | stress fiber(GO:0001725) contractile actin filament bundle(GO:0097517) |
0.1 | 0.4 | GO:0097539 | ciliary transition fiber(GO:0097539) |
0.0 | 0.6 | GO:0030134 | ER to Golgi transport vesicle(GO:0030134) |
0.0 | 0.2 | GO:0032389 | MutLalpha complex(GO:0032389) |
0.0 | 1.3 | GO:0008180 | COP9 signalosome(GO:0008180) |
0.0 | 0.5 | GO:0044295 | axonal growth cone(GO:0044295) |
0.0 | 0.6 | GO:0035098 | ESC/E(Z) complex(GO:0035098) |
0.0 | 3.0 | GO:0090575 | RNA polymerase II transcription factor complex(GO:0090575) |
0.0 | 0.2 | GO:0089701 | U2AF(GO:0089701) |
0.0 | 1.1 | GO:0097228 | sperm principal piece(GO:0097228) |
0.0 | 0.9 | GO:0005865 | striated muscle thin filament(GO:0005865) |
0.0 | 2.3 | GO:0005811 | lipid particle(GO:0005811) |
0.0 | 0.2 | GO:0005851 | eukaryotic translation initiation factor 2B complex(GO:0005851) |
0.0 | 0.4 | GO:0010369 | chromocenter(GO:0010369) |
0.0 | 0.2 | GO:0005610 | laminin-5 complex(GO:0005610) |
0.0 | 2.8 | GO:0000922 | spindle pole(GO:0000922) |
0.0 | 0.1 | GO:0005640 | nuclear outer membrane(GO:0005640) |
0.0 | 0.3 | GO:1990909 | Wnt signalosome(GO:1990909) |
0.0 | 0.4 | GO:0036156 | inner dynein arm(GO:0036156) |
0.0 | 0.2 | GO:0000408 | EKC/KEOPS complex(GO:0000408) |
0.0 | 0.7 | GO:0005682 | U5 snRNP(GO:0005682) |
0.0 | 0.5 | GO:0098643 | fibrillar collagen trimer(GO:0005583) banded collagen fibril(GO:0098643) |
0.0 | 0.4 | GO:0000176 | nuclear exosome (RNase complex)(GO:0000176) |
0.0 | 0.3 | GO:0005890 | sodium:potassium-exchanging ATPase complex(GO:0005890) |
0.0 | 0.2 | GO:0044326 | dendritic spine neck(GO:0044326) |
0.0 | 0.0 | GO:0000439 | core TFIIH complex(GO:0000439) |
0.0 | 1.2 | GO:0036126 | sperm flagellum(GO:0036126) |
0.0 | 0.0 | GO:0055087 | Ski complex(GO:0055087) |
0.0 | 0.1 | GO:0097149 | centralspindlin complex(GO:0097149) |
0.0 | 0.4 | GO:0005686 | U2 snRNP(GO:0005686) |
0.0 | 0.7 | GO:0005892 | acetylcholine-gated channel complex(GO:0005892) |
0.0 | 0.5 | GO:0071004 | U2-type prespliceosome(GO:0071004) |
0.0 | 0.4 | GO:0001527 | microfibril(GO:0001527) |
0.0 | 0.2 | GO:0042613 | MHC class II protein complex(GO:0042613) |
0.0 | 0.2 | GO:0072687 | meiotic spindle(GO:0072687) |
0.0 | 0.3 | GO:0044224 | juxtaparanode region of axon(GO:0044224) |
0.0 | 0.4 | GO:0031597 | cytosolic proteasome complex(GO:0031597) |
0.0 | 0.2 | GO:0005849 | mRNA cleavage factor complex(GO:0005849) |
0.0 | 0.1 | GO:0030485 | smooth muscle contractile fiber(GO:0030485) |
0.0 | 0.2 | GO:0032584 | growth cone membrane(GO:0032584) |
0.0 | 0.1 | GO:0014701 | junctional sarcoplasmic reticulum membrane(GO:0014701) |
0.0 | 0.1 | GO:0070419 | nonhomologous end joining complex(GO:0070419) |
0.0 | 0.1 | GO:0044611 | nuclear pore inner ring(GO:0044611) |
0.0 | 0.4 | GO:0030126 | COPI vesicle coat(GO:0030126) |
0.0 | 0.1 | GO:0070531 | BRCA1-A complex(GO:0070531) |
0.0 | 0.1 | GO:0005896 | interleukin-6 receptor complex(GO:0005896) |
0.0 | 0.1 | GO:1904949 | ATPase complex(GO:1904949) |
0.0 | 0.1 | GO:0033179 | proton-transporting V-type ATPase, V0 domain(GO:0033179) |
0.0 | 0.5 | GO:0034451 | centriolar satellite(GO:0034451) |
0.0 | 0.1 | GO:0071001 | U4/U6 snRNP(GO:0071001) |
0.0 | 0.3 | GO:0070461 | SAGA-type complex(GO:0070461) |
0.0 | 0.1 | GO:0016010 | dystrophin-associated glycoprotein complex(GO:0016010) glycoprotein complex(GO:0090665) |
0.0 | 0.2 | GO:0000796 | condensin complex(GO:0000796) |
0.0 | 0.1 | GO:0000444 | MIS12/MIND type complex(GO:0000444) |
0.0 | 0.4 | GO:0031362 | anchored component of external side of plasma membrane(GO:0031362) |
0.0 | 0.1 | GO:0090543 | Flemming body(GO:0090543) |
0.0 | 1.2 | GO:0045171 | intercellular bridge(GO:0045171) |
0.0 | 0.1 | GO:0043220 | Schmidt-Lanterman incisure(GO:0043220) |
0.0 | 0.4 | GO:0032039 | integrator complex(GO:0032039) |
0.0 | 0.2 | GO:0000798 | nuclear cohesin complex(GO:0000798) |
0.0 | 0.7 | GO:0070069 | cytochrome complex(GO:0070069) |
0.0 | 0.2 | GO:0001520 | outer dense fiber(GO:0001520) |
0.0 | 0.2 | GO:0016528 | sarcoplasm(GO:0016528) |
0.0 | 0.2 | GO:0042575 | DNA polymerase complex(GO:0042575) |
0.0 | 1.2 | GO:0044291 | cell-cell contact zone(GO:0044291) |
0.0 | 0.2 | GO:0031462 | Cul2-RING ubiquitin ligase complex(GO:0031462) |
0.0 | 0.2 | GO:0033588 | Elongator holoenzyme complex(GO:0033588) |
0.0 | 0.1 | GO:0005853 | eukaryotic translation elongation factor 1 complex(GO:0005853) |
0.0 | 0.0 | GO:0034750 | Scrib-APC-beta-catenin complex(GO:0034750) |
0.0 | 0.3 | GO:0065010 | extracellular membrane-bounded organelle(GO:0065010) |
0.0 | 5.4 | GO:0019898 | extrinsic component of membrane(GO:0019898) |
0.0 | 0.6 | GO:0035145 | exon-exon junction complex(GO:0035145) |
0.0 | 0.3 | GO:0000779 | condensed chromosome, centromeric region(GO:0000779) |
0.0 | 0.2 | GO:0008385 | IkappaB kinase complex(GO:0008385) |
0.0 | 0.1 | GO:0034706 | sodium channel complex(GO:0034706) |
0.0 | 33.5 | GO:0005783 | endoplasmic reticulum(GO:0005783) |
0.0 | 0.0 | GO:0032280 | symmetric synapse(GO:0032280) |
0.0 | 0.6 | GO:0030131 | clathrin adaptor complex(GO:0030131) |
0.0 | 0.1 | GO:0005796 | Golgi lumen(GO:0005796) |
0.0 | 0.1 | GO:0031466 | Cul5-RING ubiquitin ligase complex(GO:0031466) |
0.0 | 0.1 | GO:0097543 | ciliary inversin compartment(GO:0097543) |
0.0 | 0.0 | GO:0097427 | microtubule bundle(GO:0097427) |
0.0 | 0.0 | GO:0034715 | pICln-Sm protein complex(GO:0034715) |
0.0 | 0.0 | GO:0016533 | cyclin-dependent protein kinase 5 holoenzyme complex(GO:0016533) |
0.0 | 0.0 | GO:0005726 | perichromatin fibrils(GO:0005726) |
0.0 | 0.1 | GO:0031465 | Cul4B-RING E3 ubiquitin ligase complex(GO:0031465) |
0.0 | 0.1 | GO:0071986 | Ragulator complex(GO:0071986) |
0.0 | 0.2 | GO:0000127 | transcription factor TFIIIC complex(GO:0000127) |
0.0 | 0.2 | GO:0005793 | endoplasmic reticulum-Golgi intermediate compartment(GO:0005793) |
0.0 | 2.1 | GO:0005741 | mitochondrial outer membrane(GO:0005741) |
0.0 | 0.6 | GO:0005776 | autophagosome(GO:0005776) |
0.0 | 0.1 | GO:0005766 | primary lysosome(GO:0005766) azurophil granule(GO:0042582) |
0.0 | 0.2 | GO:0070469 | respiratory chain(GO:0070469) |
0.0 | 0.2 | GO:0000813 | ESCRT I complex(GO:0000813) |
0.0 | 0.1 | GO:0042622 | photoreceptor outer segment membrane(GO:0042622) |
0.0 | 0.1 | GO:0031467 | Cul7-RING ubiquitin ligase complex(GO:0031467) |
0.0 | 0.0 | GO:0070761 | pre-snoRNP complex(GO:0070761) |
0.0 | 0.1 | GO:0044300 | cerebellar mossy fiber(GO:0044300) |
0.0 | 0.1 | GO:0005638 | lamin filament(GO:0005638) |
0.0 | 0.1 | GO:0031371 | ubiquitin conjugating enzyme complex(GO:0031371) |
0.0 | 2.3 | GO:0035068 | micro-ribonucleoprotein complex(GO:0035068) |
0.0 | 0.0 | GO:0044393 | microspike(GO:0044393) |
0.0 | 0.1 | GO:0061617 | MICOS complex(GO:0061617) |
0.0 | 0.1 | GO:0001940 | male pronucleus(GO:0001940) |
0.0 | 0.1 | GO:0016281 | eukaryotic translation initiation factor 4F complex(GO:0016281) |
0.0 | 0.9 | GO:0005902 | microvillus(GO:0005902) |
0.0 | 1.3 | GO:0034399 | nuclear periphery(GO:0034399) |
0.0 | 0.1 | GO:0097470 | ribbon synapse(GO:0097470) |
0.0 | 0.8 | GO:0031514 | motile cilium(GO:0031514) |
0.0 | 0.0 | GO:1990716 | axonemal central apparatus(GO:1990716) |
0.0 | 0.1 | GO:0008278 | cohesin complex(GO:0008278) |
0.0 | 0.5 | GO:0016592 | mediator complex(GO:0016592) |
0.0 | 0.1 | GO:0042612 | MHC class I protein complex(GO:0042612) |
0.0 | 0.4 | GO:0030864 | cortical actin cytoskeleton(GO:0030864) |
0.0 | 0.0 | GO:0019815 | B cell receptor complex(GO:0019815) |
0.0 | 0.4 | GO:0005637 | nuclear inner membrane(GO:0005637) |
0.0 | 0.1 | GO:0071953 | elastic fiber(GO:0071953) |
0.0 | 0.3 | GO:0030992 | intraciliary transport particle B(GO:0030992) |
0.0 | 0.1 | GO:0030689 | Noc complex(GO:0030689) |
0.0 | 1.2 | GO:0097223 | sperm part(GO:0097223) |
0.0 | 0.1 | GO:0061700 | GATOR2 complex(GO:0061700) |
0.0 | 0.8 | GO:0030016 | myofibril(GO:0030016) |
0.0 | 0.1 | GO:0016593 | Cdc73/Paf1 complex(GO:0016593) |
0.0 | 0.5 | GO:0031594 | neuromuscular junction(GO:0031594) |
0.0 | 0.1 | GO:0032983 | kainate selective glutamate receptor complex(GO:0032983) |
0.0 | 0.6 | GO:0000932 | cytoplasmic mRNA processing body(GO:0000932) |
0.0 | 0.5 | GO:0005643 | nuclear pore(GO:0005643) |
0.0 | 0.1 | GO:0098563 | integral component of synaptic vesicle membrane(GO:0030285) intrinsic component of synaptic vesicle membrane(GO:0098563) |
0.0 | 0.2 | GO:0031235 | intrinsic component of the cytoplasmic side of the plasma membrane(GO:0031235) |
0.0 | 0.1 | GO:0016591 | DNA-directed RNA polymerase II, holoenzyme(GO:0016591) |
0.0 | 0.9 | GO:0005770 | late endosome(GO:0005770) |
0.0 | 0.3 | GO:0032281 | AMPA glutamate receptor complex(GO:0032281) |
0.0 | 0.2 | GO:0030687 | preribosome, large subunit precursor(GO:0030687) |
0.0 | 3.8 | GO:0005578 | proteinaceous extracellular matrix(GO:0005578) |
0.0 | 0.0 | GO:0036195 | muscle cell projection(GO:0036194) muscle cell projection membrane(GO:0036195) |
0.0 | 0.1 | GO:0030896 | checkpoint clamp complex(GO:0030896) |
0.0 | 0.0 | GO:0031414 | N-terminal protein acetyltransferase complex(GO:0031414) |
0.0 | 0.0 | GO:0034993 | microtubule organizing center attachment site(GO:0034992) LINC complex(GO:0034993) |
0.0 | 0.8 | GO:0016607 | nuclear speck(GO:0016607) |
0.0 | 0.1 | GO:0048476 | Holliday junction resolvase complex(GO:0048476) |
0.0 | 0.4 | GO:0042383 | sarcolemma(GO:0042383) |
0.0 | 0.1 | GO:0008540 | proteasome regulatory particle, base subcomplex(GO:0008540) |
0.0 | 0.7 | GO:0005819 | spindle(GO:0005819) |
0.0 | 0.3 | GO:0032040 | small-subunit processome(GO:0032040) |
0.0 | 0.6 | GO:0005930 | axoneme(GO:0005930) ciliary plasm(GO:0097014) |
0.0 | 0.4 | GO:0005881 | cytoplasmic microtubule(GO:0005881) |
0.0 | 0.2 | GO:0005801 | cis-Golgi network(GO:0005801) |
0.0 | 0.1 | GO:0042105 | alpha-beta T cell receptor complex(GO:0042105) |
0.0 | 0.4 | GO:0035097 | histone methyltransferase complex(GO:0035097) |
0.0 | 1.3 | GO:0005840 | ribosome(GO:0005840) |
0.0 | 0.0 | GO:0005712 | chiasma(GO:0005712) |
0.0 | 0.1 | GO:0043073 | germ cell nucleus(GO:0043073) |
0.0 | 0.1 | GO:0005839 | proteasome core complex(GO:0005839) |
0.0 | 0.1 | GO:0005689 | U12-type spliceosomal complex(GO:0005689) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
2.2 | 6.5 | GO:0016743 | carboxyl- or carbamoyltransferase activity(GO:0016743) |
2.1 | 6.3 | GO:0005006 | epidermal growth factor-activated receptor activity(GO:0005006) |
1.4 | 4.1 | GO:0004771 | sterol esterase activity(GO:0004771) |
1.3 | 4.0 | GO:0004886 | 9-cis retinoic acid receptor activity(GO:0004886) |
1.2 | 3.6 | GO:0018479 | benzaldehyde dehydrogenase (NAD+) activity(GO:0018479) |
1.2 | 3.6 | GO:0004024 | alcohol dehydrogenase activity, zinc-dependent(GO:0004024) |
1.1 | 3.4 | GO:0005220 | inositol 1,4,5-trisphosphate-sensitive calcium-release channel activity(GO:0005220) |
1.0 | 2.1 | GO:0043125 | ErbB-3 class receptor binding(GO:0043125) |
0.9 | 3.7 | GO:0016899 | oxidoreductase activity, acting on the CH-OH group of donors, oxygen as acceptor(GO:0016899) |
0.9 | 2.6 | GO:0038181 | bile acid receptor activity(GO:0038181) |
0.8 | 3.3 | GO:0032896 | palmitoyl-CoA 9-desaturase activity(GO:0032896) |
0.8 | 2.3 | GO:0001069 | regulatory region RNA binding(GO:0001069) |
0.7 | 2.2 | GO:0036042 | long-chain fatty acyl-CoA binding(GO:0036042) |
0.7 | 2.7 | GO:0034056 | estrogen response element binding(GO:0034056) |
0.6 | 5.7 | GO:0004499 | N,N-dimethylaniline monooxygenase activity(GO:0004499) |
0.6 | 1.9 | GO:0047961 | glycine N-acyltransferase activity(GO:0047961) |
0.6 | 3.0 | GO:1990380 | Lys48-specific deubiquitinase activity(GO:1990380) |
0.6 | 1.2 | GO:0004768 | stearoyl-CoA 9-desaturase activity(GO:0004768) |
0.6 | 0.6 | GO:0030792 | methylarsonite methyltransferase activity(GO:0030792) |
0.6 | 1.7 | GO:0016842 | amidine-lyase activity(GO:0016842) |
0.6 | 3.9 | GO:0004908 | interleukin-1 receptor activity(GO:0004908) |
0.5 | 2.7 | GO:0004769 | steroid delta-isomerase activity(GO:0004769) |
0.5 | 3.3 | GO:0047760 | butyrate-CoA ligase activity(GO:0047760) |
0.5 | 2.0 | GO:0015093 | ferrous iron transmembrane transporter activity(GO:0015093) |
0.5 | 1.5 | GO:0032190 | acrosin binding(GO:0032190) |
0.5 | 2.5 | GO:0070728 | leucine binding(GO:0070728) |
0.5 | 2.0 | GO:0047023 | androsterone dehydrogenase activity(GO:0047023) |
0.5 | 2.9 | GO:0016151 | nickel cation binding(GO:0016151) |
0.4 | 1.3 | GO:0034186 | apolipoprotein A-I binding(GO:0034186) |
0.4 | 1.3 | GO:0016802 | adenosylhomocysteinase activity(GO:0004013) trialkylsulfonium hydrolase activity(GO:0016802) |
0.4 | 0.4 | GO:0016427 | tRNA (cytosine) methyltransferase activity(GO:0016427) tRNA (cytosine-5-)-methyltransferase activity(GO:0016428) |
0.4 | 1.2 | GO:0016716 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, another compound as one donor, and incorporation of one atom of oxygen(GO:0016716) |
0.4 | 3.2 | GO:0004571 | mannosyl-oligosaccharide 1,2-alpha-mannosidase activity(GO:0004571) |
0.4 | 1.2 | GO:0004505 | phenylalanine 4-monooxygenase activity(GO:0004505) |
0.4 | 0.8 | GO:0005381 | iron ion transmembrane transporter activity(GO:0005381) |
0.4 | 2.0 | GO:0004075 | biotin carboxylase activity(GO:0004075) |
0.4 | 1.5 | GO:0005025 | transforming growth factor beta receptor activity, type I(GO:0005025) |
0.4 | 1.1 | GO:0035529 | NADH pyrophosphatase activity(GO:0035529) |
0.4 | 1.1 | GO:0003986 | acetyl-CoA hydrolase activity(GO:0003986) |
0.4 | 4.7 | GO:0015643 | toxic substance binding(GO:0015643) |
0.3 | 2.1 | GO:0031685 | adenosine receptor binding(GO:0031685) |
0.3 | 1.0 | GO:0050510 | N-acetylgalactosaminyl-proteoglycan 3-beta-glucuronosyltransferase activity(GO:0050510) |
0.3 | 11.3 | GO:0018732 | prenylcysteine methylesterase activity(GO:0010296) 1-oxa-2-oxocycloheptane lactonase activity(GO:0018731) sulfolactone hydrolase activity(GO:0018732) butyrolactone hydrolase activity(GO:0018734) endosulfan lactone lactonase activity(GO:0034892) L-ascorbate 6-phosphate lactonase activity(GO:0035460) Ser-tRNA(Thr) hydrolase activity(GO:0043905) Ala-tRNA(Pro) hydrolase activity(GO:0043906) Cys-tRNA(Pro) hydrolase activity(GO:0043907) Ser(Gly)-tRNA(Ala) hydrolase activity(GO:0043908) all-trans-retinyl-palmitate hydrolase, all-trans-retinol forming activity(GO:0047376) mannosyl-oligosaccharide 1,6-alpha-mannosidase activity(GO:0052767) mannosyl-oligosaccharide 1,3-alpha-mannosidase activity(GO:0052768) methyl indole-3-acetate esterase activity(GO:0080030) methyl salicylate esterase activity(GO:0080031) methyl jasmonate esterase activity(GO:0080032) |
0.3 | 1.4 | GO:0071614 | linoleic acid epoxygenase activity(GO:0071614) |
0.3 | 1.0 | GO:0050508 | glucuronosyl-N-acetylglucosaminyl-proteoglycan 4-alpha-N-acetylglucosaminyltransferase activity(GO:0050508) |
0.3 | 1.0 | GO:0097109 | neuroligin family protein binding(GO:0097109) |
0.3 | 1.3 | GO:1990239 | steroid hormone binding(GO:1990239) |
0.3 | 7.7 | GO:0030552 | cAMP binding(GO:0030552) |
0.3 | 0.9 | GO:0042392 | sphingosine-1-phosphate phosphatase activity(GO:0042392) |
0.3 | 1.2 | GO:0004887 | thyroid hormone receptor activity(GO:0004887) |
0.3 | 0.3 | GO:0034594 | phosphatidylinositol trisphosphate phosphatase activity(GO:0034594) |
0.3 | 0.9 | GO:0016838 | carbon-oxygen lyase activity, acting on phosphates(GO:0016838) |
0.3 | 0.3 | GO:0050051 | leukotriene-B4 20-monooxygenase activity(GO:0050051) |
0.3 | 1.2 | GO:0033192 | calmodulin-dependent protein phosphatase activity(GO:0033192) |
0.3 | 0.3 | GO:0019187 | beta-1,4-mannosyltransferase activity(GO:0019187) |
0.3 | 0.8 | GO:0005157 | macrophage colony-stimulating factor receptor binding(GO:0005157) |
0.3 | 1.1 | GO:0016453 | acetyl-CoA C-acetyltransferase activity(GO:0003985) C-acetyltransferase activity(GO:0016453) |
0.3 | 0.3 | GO:0000702 | oxidized base lesion DNA N-glycosylase activity(GO:0000702) |
0.3 | 1.1 | GO:0004566 | beta-glucuronidase activity(GO:0004566) |
0.3 | 0.5 | GO:0031697 | beta-1 adrenergic receptor binding(GO:0031697) |
0.3 | 1.3 | GO:0042979 | ornithine decarboxylase regulator activity(GO:0042979) |
0.3 | 0.8 | GO:0004366 | glycerol-3-phosphate O-acyltransferase activity(GO:0004366) |
0.3 | 0.8 | GO:0047192 | 1-alkylglycerophosphocholine O-acetyltransferase activity(GO:0047192) |
0.3 | 1.0 | GO:0032564 | dATP binding(GO:0032564) |
0.3 | 0.8 | GO:0005119 | smoothened binding(GO:0005119) |
0.3 | 5.1 | GO:0003785 | actin monomer binding(GO:0003785) |
0.3 | 0.8 | GO:0035671 | enone reductase activity(GO:0035671) |
0.3 | 0.3 | GO:0097200 | cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:0097200) |
0.2 | 1.2 | GO:0016174 | NAD(P)H oxidase activity(GO:0016174) |
0.2 | 1.0 | GO:0003917 | DNA topoisomerase type I activity(GO:0003917) |
0.2 | 5.6 | GO:0019206 | nucleoside kinase activity(GO:0019206) |
0.2 | 0.2 | GO:0071532 | ankyrin repeat binding(GO:0071532) |
0.2 | 1.0 | GO:0015173 | aromatic amino acid transmembrane transporter activity(GO:0015173) |
0.2 | 1.4 | GO:0043426 | MRF binding(GO:0043426) |
0.2 | 1.0 | GO:0003873 | 6-phosphofructo-2-kinase activity(GO:0003873) |
0.2 | 0.9 | GO:0016661 | oxidoreductase activity, acting on other nitrogenous compounds as donors(GO:0016661) |
0.2 | 0.7 | GO:0016532 | superoxide dismutase copper chaperone activity(GO:0016532) |
0.2 | 1.6 | GO:0050072 | m7G(5')pppN diphosphatase activity(GO:0050072) |
0.2 | 0.7 | GO:0043423 | 3-phosphoinositide-dependent protein kinase binding(GO:0043423) |
0.2 | 0.5 | GO:0061629 | RNA polymerase II sequence-specific DNA binding transcription factor binding(GO:0061629) |
0.2 | 3.2 | GO:0070402 | NADPH binding(GO:0070402) |
0.2 | 1.4 | GO:0004859 | phospholipase inhibitor activity(GO:0004859) |
0.2 | 1.4 | GO:0002054 | nucleobase binding(GO:0002054) |
0.2 | 0.7 | GO:0008597 | calcium-dependent protein serine/threonine phosphatase regulator activity(GO:0008597) |
0.2 | 1.1 | GO:0051525 | NFAT protein binding(GO:0051525) |
0.2 | 0.7 | GO:0070548 | L-glutamine aminotransferase activity(GO:0070548) |
0.2 | 2.2 | GO:0008195 | phosphatidate phosphatase activity(GO:0008195) |
0.2 | 0.6 | GO:0004090 | carbonyl reductase (NADPH) activity(GO:0004090) |
0.2 | 0.4 | GO:0042281 | dolichyl pyrophosphate Man9GlcNAc2 alpha-1,3-glucosyltransferase activity(GO:0042281) |
0.2 | 1.5 | GO:0003688 | DNA replication origin binding(GO:0003688) |
0.2 | 1.9 | GO:0008190 | eukaryotic initiation factor 4E binding(GO:0008190) |
0.2 | 0.8 | GO:0004035 | alkaline phosphatase activity(GO:0004035) |
0.2 | 0.6 | GO:1990825 | sequence-specific mRNA binding(GO:1990825) |
0.2 | 1.5 | GO:0005167 | neurotrophin TRK receptor binding(GO:0005167) |
0.2 | 0.8 | GO:0002046 | opsin binding(GO:0002046) |
0.2 | 0.6 | GO:0004096 | catalase activity(GO:0004096) |
0.2 | 2.1 | GO:0004176 | ATP-dependent peptidase activity(GO:0004176) |
0.2 | 0.6 | GO:0008607 | phosphorylase kinase regulator activity(GO:0008607) |
0.2 | 0.6 | GO:0004514 | nicotinate-nucleotide diphosphorylase (carboxylating) activity(GO:0004514) |
0.2 | 4.0 | GO:0016709 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, NAD(P)H as one donor, and incorporation of one atom of oxygen(GO:0016709) |
0.2 | 0.6 | GO:0050833 | pyruvate transmembrane transporter activity(GO:0050833) |
0.2 | 0.6 | GO:0004471 | malic enzyme activity(GO:0004470) malate dehydrogenase (decarboxylating) (NAD+) activity(GO:0004471) |
0.2 | 2.2 | GO:0051787 | misfolded protein binding(GO:0051787) |
0.2 | 1.2 | GO:0005072 | transforming growth factor beta receptor, cytoplasmic mediator activity(GO:0005072) |
0.2 | 0.6 | GO:0004937 | alpha1-adrenergic receptor activity(GO:0004937) |
0.2 | 0.8 | GO:0031779 | melanocortin receptor binding(GO:0031779) type 3 melanocortin receptor binding(GO:0031781) type 4 melanocortin receptor binding(GO:0031782) |
0.2 | 0.6 | GO:0005131 | growth hormone receptor binding(GO:0005131) |
0.2 | 0.6 | GO:0004949 | cannabinoid receptor activity(GO:0004949) |
0.2 | 0.6 | GO:0017034 | Rap guanyl-nucleotide exchange factor activity(GO:0017034) |
0.2 | 0.2 | GO:0036137 | kynurenine-oxoglutarate transaminase activity(GO:0016212) kynurenine aminotransferase activity(GO:0036137) |
0.2 | 0.2 | GO:0004731 | purine-nucleoside phosphorylase activity(GO:0004731) |
0.2 | 0.5 | GO:0055100 | adiponectin binding(GO:0055100) |
0.2 | 0.9 | GO:0015189 | arginine transmembrane transporter activity(GO:0015181) L-lysine transmembrane transporter activity(GO:0015189) |
0.2 | 0.7 | GO:0071074 | eukaryotic initiation factor eIF2 binding(GO:0071074) |
0.2 | 0.4 | GO:0042030 | ATPase inhibitor activity(GO:0042030) |
0.2 | 0.9 | GO:0017040 | ceramidase activity(GO:0017040) |
0.2 | 6.6 | GO:0008392 | arachidonic acid epoxygenase activity(GO:0008392) |
0.2 | 1.6 | GO:0008568 | microtubule-severing ATPase activity(GO:0008568) |
0.2 | 0.5 | GO:0030943 | mitochondrion targeting sequence binding(GO:0030943) |
0.2 | 0.5 | GO:0030620 | U2 snRNA binding(GO:0030620) |
0.2 | 1.1 | GO:0004385 | guanylate kinase activity(GO:0004385) |
0.2 | 1.9 | GO:0030898 | actin-dependent ATPase activity(GO:0030898) |
0.2 | 0.5 | GO:0098821 | BMP receptor activity(GO:0098821) |
0.2 | 0.9 | GO:0097642 | calcitonin family receptor activity(GO:0097642) |
0.2 | 5.7 | GO:0042169 | SH2 domain binding(GO:0042169) |
0.2 | 2.8 | GO:0005070 | SH3/SH2 adaptor activity(GO:0005070) |
0.2 | 1.0 | GO:0033695 | oxidoreductase activity, acting on CH or CH2 groups, quinone or similar compound as acceptor(GO:0033695) caffeine oxidase activity(GO:0034875) |
0.2 | 2.1 | GO:0004535 | poly(A)-specific ribonuclease activity(GO:0004535) |
0.2 | 2.2 | GO:0045236 | CXCR chemokine receptor binding(GO:0045236) |
0.2 | 0.2 | GO:0000009 | alpha-1,6-mannosyltransferase activity(GO:0000009) |
0.2 | 0.7 | GO:0004735 | pyrroline-5-carboxylate reductase activity(GO:0004735) |
0.2 | 0.2 | GO:0046921 | alpha-(1->6)-fucosyltransferase activity(GO:0046921) |
0.2 | 1.5 | GO:0005159 | insulin-like growth factor receptor binding(GO:0005159) |
0.2 | 3.4 | GO:0016864 | protein disulfide isomerase activity(GO:0003756) intramolecular oxidoreductase activity, transposing S-S bonds(GO:0016864) |
0.2 | 0.5 | GO:0035851 | Krueppel-associated box domain binding(GO:0035851) |
0.2 | 1.3 | GO:0002162 | dystroglycan binding(GO:0002162) |
0.2 | 1.7 | GO:0097602 | cullin family protein binding(GO:0097602) |
0.2 | 1.3 | GO:0008430 | selenium binding(GO:0008430) |
0.2 | 1.0 | GO:0004064 | arylesterase activity(GO:0004064) |
0.2 | 1.0 | GO:1990247 | N6-methyladenosine-containing RNA binding(GO:1990247) |
0.2 | 1.1 | GO:0005078 | MAP-kinase scaffold activity(GO:0005078) |
0.2 | 2.4 | GO:0005545 | 1-phosphatidylinositol binding(GO:0005545) |
0.2 | 0.5 | GO:0004359 | glutaminase activity(GO:0004359) |
0.2 | 0.6 | GO:0003846 | 2-acylglycerol O-acyltransferase activity(GO:0003846) |
0.2 | 0.5 | GO:0030350 | iron-responsive element binding(GO:0030350) |
0.2 | 0.6 | GO:0017176 | phosphatidylinositol N-acetylglucosaminyltransferase activity(GO:0017176) |
0.2 | 0.8 | GO:1990254 | keratin filament binding(GO:1990254) |
0.2 | 0.5 | GO:0016715 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, reduced ascorbate as one donor, and incorporation of one atom of oxygen(GO:0016715) |
0.2 | 0.3 | GO:0016649 | electron-transferring-flavoprotein dehydrogenase activity(GO:0004174) oxidoreductase activity, acting on the CH-NH group of donors, quinone or similar compound as acceptor(GO:0016649) |
0.2 | 0.9 | GO:0046624 | sphingolipid transporter activity(GO:0046624) |
0.2 | 2.0 | GO:1900750 | glutathione binding(GO:0043295) oligopeptide binding(GO:1900750) |
0.2 | 0.3 | GO:0000033 | alpha-1,3-mannosyltransferase activity(GO:0000033) |
0.2 | 0.6 | GO:0004582 | dolichyl-phosphate beta-D-mannosyltransferase activity(GO:0004582) |
0.2 | 0.6 | GO:0004062 | aryl sulfotransferase activity(GO:0004062) |
0.2 | 3.2 | GO:0050136 | NADH dehydrogenase (ubiquinone) activity(GO:0008137) NADH dehydrogenase (quinone) activity(GO:0050136) |
0.2 | 3.4 | GO:0004364 | glutathione transferase activity(GO:0004364) |
0.2 | 2.1 | GO:0008308 | voltage-gated anion channel activity(GO:0008308) |
0.2 | 0.2 | GO:0044213 | intronic transcription regulatory region DNA binding(GO:0044213) |
0.2 | 1.7 | GO:0016832 | aldehyde-lyase activity(GO:0016832) |
0.1 | 0.6 | GO:0004030 | aldehyde dehydrogenase [NAD(P)+] activity(GO:0004030) |
0.1 | 0.4 | GO:0004605 | phosphatidate cytidylyltransferase activity(GO:0004605) |
0.1 | 2.3 | GO:0070530 | K63-linked polyubiquitin binding(GO:0070530) |
0.1 | 0.1 | GO:0070181 | small ribosomal subunit rRNA binding(GO:0070181) |
0.1 | 0.4 | GO:0031826 | type 2A serotonin receptor binding(GO:0031826) |
0.1 | 0.9 | GO:0046974 | histone methyltransferase activity (H3-K9 specific)(GO:0046974) |
0.1 | 0.6 | GO:0070087 | chromo shadow domain binding(GO:0070087) |
0.1 | 0.4 | GO:0004999 | vasoactive intestinal polypeptide receptor activity(GO:0004999) |
0.1 | 1.3 | GO:0008093 | cytoskeletal adaptor activity(GO:0008093) |
0.1 | 0.6 | GO:0016286 | small conductance calcium-activated potassium channel activity(GO:0016286) |
0.1 | 0.6 | GO:0070878 | primary miRNA binding(GO:0070878) |
0.1 | 0.7 | GO:0050815 | phosphoserine binding(GO:0050815) |
0.1 | 0.3 | GO:0016423 | tRNA (guanine) methyltransferase activity(GO:0016423) |
0.1 | 0.7 | GO:1990226 | histone methyltransferase binding(GO:1990226) |
0.1 | 0.3 | GO:0097157 | pre-mRNA intronic binding(GO:0097157) |
0.1 | 1.7 | GO:0016290 | palmitoyl-CoA hydrolase activity(GO:0016290) |
0.1 | 0.4 | GO:0016615 | malate dehydrogenase activity(GO:0016615) |
0.1 | 1.5 | GO:0070182 | DNA polymerase binding(GO:0070182) |
0.1 | 0.8 | GO:0005049 | nuclear export signal receptor activity(GO:0005049) |
0.1 | 0.4 | GO:0000340 | RNA 7-methylguanosine cap binding(GO:0000340) |
0.1 | 0.4 | GO:0004687 | myosin light chain kinase activity(GO:0004687) |
0.1 | 0.8 | GO:0097322 | 7SK snRNA binding(GO:0097322) |
0.1 | 0.5 | GO:0015220 | choline transmembrane transporter activity(GO:0015220) |
0.1 | 2.7 | GO:0016922 | ligand-dependent nuclear receptor binding(GO:0016922) |
0.1 | 0.3 | GO:0080130 | L-phenylalanine aminotransferase activity(GO:0070546) L-phenylalanine:2-oxoglutarate aminotransferase activity(GO:0080130) |
0.1 | 2.1 | GO:0035255 | ionotropic glutamate receptor binding(GO:0035255) |
0.1 | 0.4 | GO:0004705 | JUN kinase activity(GO:0004705) SAP kinase activity(GO:0016909) |
0.1 | 2.1 | GO:0017128 | phospholipid scramblase activity(GO:0017128) |
0.1 | 0.3 | GO:0008310 | single-stranded DNA 3'-5' exodeoxyribonuclease activity(GO:0008310) |
0.1 | 0.5 | GO:0070567 | cytidylyltransferase activity(GO:0070567) |
0.1 | 0.5 | GO:0004591 | oxoglutarate dehydrogenase (succinyl-transferring) activity(GO:0004591) |
0.1 | 1.1 | GO:0004708 | MAP kinase kinase activity(GO:0004708) |
0.1 | 0.4 | GO:0030160 | GKAP/Homer scaffold activity(GO:0030160) |
0.1 | 0.4 | GO:0005347 | ATP transmembrane transporter activity(GO:0005347) |
0.1 | 0.3 | GO:0005176 | ErbB-2 class receptor binding(GO:0005176) |
0.1 | 0.5 | GO:0001642 | group III metabotropic glutamate receptor activity(GO:0001642) |
0.1 | 1.3 | GO:0016888 | endodeoxyribonuclease activity, producing 5'-phosphomonoesters(GO:0016888) |
0.1 | 5.0 | GO:0016763 | transferase activity, transferring pentosyl groups(GO:0016763) |
0.1 | 0.6 | GO:0004653 | polypeptide N-acetylgalactosaminyltransferase activity(GO:0004653) |
0.1 | 0.4 | GO:0035663 | Toll-like receptor 2 binding(GO:0035663) |
0.1 | 4.2 | GO:0016749 | N-succinyltransferase activity(GO:0016749) |
0.1 | 1.5 | GO:0015279 | store-operated calcium channel activity(GO:0015279) |
0.1 | 1.3 | GO:0005161 | platelet-derived growth factor receptor binding(GO:0005161) |
0.1 | 0.4 | GO:0047756 | chondroitin 4-sulfotransferase activity(GO:0047756) |
0.1 | 1.9 | GO:0004435 | phosphatidylinositol phospholipase C activity(GO:0004435) |
0.1 | 0.1 | GO:0018423 | protein C-terminal leucine carboxyl O-methyltransferase activity(GO:0018423) |
0.1 | 3.4 | GO:0001205 | transcriptional activator activity, RNA polymerase II distal enhancer sequence-specific binding(GO:0001205) |
0.1 | 0.5 | GO:0030371 | translation repressor activity(GO:0030371) |
0.1 | 0.3 | GO:0034936 | 2,3-dihydroxy DDT 1,2-dioxygenase activity(GO:0018542) phenanthrene dioxygenase activity(GO:0018555) 2,2',3-trihydroxybiphenyl dioxygenase activity(GO:0018556) 1,2-dihydroxyfluorene 1,1-alpha-dioxygenase activity(GO:0018557) 5,6-dihydroxy-3-methyl-2-oxo-1,2-dihydroquinoline dioxygenase activity(GO:0018558) 1,1-dichloro-2-(dihydroxy-4-chlorophenyl)-(4-chlorophenyl)ethene 1,2-dioxygenase activity(GO:0018559) protocatechuate 3,4-dioxygenase type II activity(GO:0018560) 2'-aminobiphenyl-2,3-diol 1,2-dioxygenase activity(GO:0018561) 3,4-dihydroxyfluorene 4,4-alpha-dioxygenase activity(GO:0018562) 2,3-dihydroxy-ethylbenzene 1,2-dioxygenase activity(GO:0018563) carbazole 1,9a-dioxygenase activity(GO:0018564) dihydroxydibenzothiophene dioxygenase activity(GO:0018565) 1,2-dihydroxynaphthalene-6-sulfonate 1,8a-dioxygenase activity(GO:0018566) styrene dioxygenase activity(GO:0018567) 3,4-dihydroxyphenanthrene dioxygenase activity(GO:0018568) hydroquinone 1,2-dioxygenase activity(GO:0018569) p-cumate 2,3-dioxygenase activity(GO:0018570) 2,3-dihydroxy-p-cumate dioxygenase activity(GO:0018571) 3,5-dichlorocatechol 1,2-dioxygenase activity(GO:0018572) 2-aminophenol 1,6-dioxygenase activity(GO:0018573) 2,6-dichloro-p-hydroquinone 1,2-dioxygenase activity(GO:0018574) chlorocatechol 1,2-dioxygenase activity(GO:0018575) catechol dioxygenase activity(GO:0019114) dihydroxyfluorene dioxygenase activity(GO:0019117) 5-aminosalicylate dioxygenase activity(GO:0034543) 3-hydroxy-2-naphthoate 2,3-dioxygenase activity(GO:0034803) benzo(a)pyrene 11,12-dioxygenase activity(GO:0034806) benzo(a)pyrene 4,5-dioxygenase activity(GO:0034808) 4,5-dihydroxybenzo(a)pyrene dioxygenase activity(GO:0034810) benzo(a)pyrene 9,10-dioxygenase activity(GO:0034811) 9,10-dihydroxybenzo(a)pyrene dioxygenase activity(GO:0034812) benzo(a)pyrene 7,8-dioxygenase activity(GO:0034813) 7,8-dihydroxy benzo(a)pyrene dioxygenase activity(GO:0034814) 1,2-dihydroxy-5,6,7,8-tetrahydronaphthalene extradiol dioxygenase activity(GO:0034827) 2-mercaptobenzothiazole dioxygenase activity(GO:0034834) pyridine-3,4-diol dioxygenase activity(GO:0034895) pyrene dioxygenase activity(GO:0034920) 4,5-dihydroxypyrene dioxygenase activity(GO:0034922) phenanthrene-4-carboxylate dioxygenase activity(GO:0034934) tetrachlorobenzene dioxygenase activity(GO:0034935) 4,6-dichloro-3-methylcatechol 1,2-dioxygenase activity(GO:0034936) 2,3-dihydroxydiphenyl ether dioxygenase activity(GO:0034955) diphenyl ether 1,2-dioxygenase activity(GO:0034956) arachidonate 8(S)-lipoxygenase activity(GO:0036403) 4-hydroxycatechol 1,2-dioxygenase activity(GO:0047074) |
0.1 | 0.3 | GO:0033829 | O-fucosylpeptide 3-beta-N-acetylglucosaminyltransferase activity(GO:0033829) |
0.1 | 3.1 | GO:0015347 | sodium-independent organic anion transmembrane transporter activity(GO:0015347) |
0.1 | 0.5 | GO:0052832 | inositol monophosphate 1-phosphatase activity(GO:0008934) inositol monophosphate 3-phosphatase activity(GO:0052832) inositol monophosphate 4-phosphatase activity(GO:0052833) inositol monophosphate phosphatase activity(GO:0052834) |
0.1 | 0.9 | GO:0004596 | peptide alpha-N-acetyltransferase activity(GO:0004596) |
0.1 | 0.3 | GO:0045134 | uridine-diphosphatase activity(GO:0045134) |
0.1 | 0.8 | GO:0098505 | G-rich strand telomeric DNA binding(GO:0098505) |
0.1 | 0.7 | GO:0050733 | RS domain binding(GO:0050733) |
0.1 | 0.2 | GO:0008494 | translation activator activity(GO:0008494) |
0.1 | 2.1 | GO:0070273 | phosphatidylinositol-4-phosphate binding(GO:0070273) |
0.1 | 0.4 | GO:0000403 | Y-form DNA binding(GO:0000403) |
0.1 | 1.1 | GO:0008641 | small protein activating enzyme activity(GO:0008641) |
0.1 | 0.2 | GO:0002094 | polyprenyltransferase activity(GO:0002094) |
0.1 | 1.6 | GO:0015035 | protein disulfide oxidoreductase activity(GO:0015035) |
0.1 | 0.4 | GO:0004449 | isocitrate dehydrogenase (NAD+) activity(GO:0004449) |
0.1 | 1.5 | GO:0008266 | poly(U) RNA binding(GO:0008266) |
0.1 | 0.4 | GO:0034235 | GPI anchor binding(GO:0034235) |
0.1 | 0.5 | GO:0000146 | microfilament motor activity(GO:0000146) |
0.1 | 0.8 | GO:0008469 | histone-arginine N-methyltransferase activity(GO:0008469) |
0.1 | 0.3 | GO:0042134 | rRNA primary transcript binding(GO:0042134) |
0.1 | 0.3 | GO:0001075 | transcription factor activity, RNA polymerase II core promoter sequence-specific binding involved in preinitiation complex assembly(GO:0001075) |
0.1 | 0.1 | GO:0089720 | caspase binding(GO:0089720) |
0.1 | 0.4 | GO:0051022 | Rho GDP-dissociation inhibitor binding(GO:0051022) |
0.1 | 0.4 | GO:0015183 | L-aspartate transmembrane transporter activity(GO:0015183) |
0.1 | 0.5 | GO:0004634 | phosphopyruvate hydratase activity(GO:0004634) |
0.1 | 1.2 | GO:0030955 | potassium ion binding(GO:0030955) |
0.1 | 0.3 | GO:0034513 | box H/ACA snoRNA binding(GO:0034513) |
0.1 | 0.6 | GO:0035312 | 5'-3' exodeoxyribonuclease activity(GO:0035312) |
0.1 | 2.0 | GO:0043014 | alpha-tubulin binding(GO:0043014) |
0.1 | 0.3 | GO:0051033 | nucleic acid transmembrane transporter activity(GO:0051032) RNA transmembrane transporter activity(GO:0051033) |
0.1 | 0.4 | GO:0005047 | signal recognition particle binding(GO:0005047) |
0.1 | 0.4 | GO:0004045 | aminoacyl-tRNA hydrolase activity(GO:0004045) |
0.1 | 0.4 | GO:0015057 | thrombin receptor activity(GO:0015057) |
0.1 | 0.3 | GO:0004169 | dolichyl-phosphate-mannose-protein mannosyltransferase activity(GO:0004169) |
0.1 | 0.6 | GO:0030235 | nitric-oxide synthase regulator activity(GO:0030235) |
0.1 | 1.2 | GO:0005123 | death receptor binding(GO:0005123) |
0.1 | 1.1 | GO:0005523 | tropomyosin binding(GO:0005523) |
0.1 | 0.5 | GO:0052723 | inositol hexakisphosphate kinase activity(GO:0000828) inositol hexakisphosphate 5-kinase activity(GO:0000832) inositol hexakisphosphate 1-kinase activity(GO:0052723) inositol hexakisphosphate 3-kinase activity(GO:0052724) |
0.1 | 0.1 | GO:0015087 | cobalt ion transmembrane transporter activity(GO:0015087) |
0.1 | 0.9 | GO:0016208 | AMP binding(GO:0016208) |
0.1 | 0.7 | GO:0051011 | microtubule minus-end binding(GO:0051011) |
0.1 | 1.8 | GO:0008139 | nuclear localization sequence binding(GO:0008139) |
0.1 | 0.2 | GO:0016361 | activin receptor activity, type I(GO:0016361) |
0.1 | 1.5 | GO:0042800 | histone methyltransferase activity (H3-K4 specific)(GO:0042800) |
0.1 | 0.6 | GO:0001588 | dopamine neurotransmitter receptor activity, coupled via Gs(GO:0001588) dopamine neurotransmitter receptor activity(GO:0004952) |
0.1 | 1.6 | GO:0016645 | oxidoreductase activity, acting on the CH-NH group of donors(GO:0016645) |
0.1 | 0.4 | GO:0008440 | inositol-1,4,5-trisphosphate 3-kinase activity(GO:0008440) |
0.1 | 0.5 | GO:0004311 | farnesyltranstransferase activity(GO:0004311) |
0.1 | 0.1 | GO:0008142 | oxysterol binding(GO:0008142) |
0.1 | 0.1 | GO:0016419 | S-malonyltransferase activity(GO:0016419) malonyltransferase activity(GO:0016420) |
0.1 | 1.2 | GO:0015924 | mannosyl-oligosaccharide mannosidase activity(GO:0015924) |
0.1 | 0.2 | GO:0004677 | DNA-dependent protein kinase activity(GO:0004677) |
0.1 | 0.4 | GO:0003997 | acyl-CoA oxidase activity(GO:0003997) |
0.1 | 0.8 | GO:0003857 | 3-hydroxyacyl-CoA dehydrogenase activity(GO:0003857) |
0.1 | 0.5 | GO:0005127 | ciliary neurotrophic factor receptor binding(GO:0005127) |
0.1 | 7.0 | GO:0015020 | glucuronosyltransferase activity(GO:0015020) |
0.1 | 1.2 | GO:0017081 | chloride channel regulator activity(GO:0017081) |
0.1 | 0.3 | GO:2001070 | starch binding(GO:2001070) |
0.1 | 0.6 | GO:0001162 | RNA polymerase II intronic transcription regulatory region sequence-specific DNA binding(GO:0001162) |
0.1 | 0.2 | GO:0032052 | bile acid binding(GO:0032052) |
0.1 | 0.3 | GO:0043515 | kinetochore binding(GO:0043515) |
0.1 | 0.3 | GO:0008384 | IkappaB kinase activity(GO:0008384) |
0.1 | 0.3 | GO:0030275 | LRR domain binding(GO:0030275) |
0.1 | 0.7 | GO:0001091 | RNA polymerase II basal transcription factor binding(GO:0001091) |
0.1 | 0.2 | GO:0032050 | clathrin heavy chain binding(GO:0032050) |
0.1 | 1.5 | GO:0042162 | telomeric DNA binding(GO:0042162) |
0.1 | 0.6 | GO:0003836 | beta-galactoside (CMP) alpha-2,3-sialyltransferase activity(GO:0003836) |
0.1 | 0.3 | GO:0055131 | C3HC4-type RING finger domain binding(GO:0055131) |
0.1 | 0.9 | GO:1990841 | promoter-specific chromatin binding(GO:1990841) |
0.1 | 0.9 | GO:0070577 | lysine-acetylated histone binding(GO:0070577) |
0.1 | 0.4 | GO:1990405 | protein antigen binding(GO:1990405) |
0.1 | 0.3 | GO:0015925 | galactosidase activity(GO:0015925) |
0.1 | 0.6 | GO:0008599 | protein phosphatase type 1 regulator activity(GO:0008599) |
0.1 | 0.3 | GO:0005275 | amine transmembrane transporter activity(GO:0005275) |
0.1 | 0.2 | GO:0015216 | adenine nucleotide transmembrane transporter activity(GO:0000295) purine ribonucleotide transmembrane transporter activity(GO:0005346) purine nucleotide transmembrane transporter activity(GO:0015216) |
0.1 | 0.7 | GO:0044548 | S100 protein binding(GO:0044548) |
0.1 | 0.4 | GO:0004659 | prenyltransferase activity(GO:0004659) |
0.1 | 0.1 | GO:0004331 | fructose-2,6-bisphosphate 2-phosphatase activity(GO:0004331) |
0.1 | 0.8 | GO:0000993 | RNA polymerase II core binding(GO:0000993) |
0.1 | 0.2 | GO:0008499 | UDP-galactose:beta-N-acetylglucosamine beta-1,3-galactosyltransferase activity(GO:0008499) |
0.1 | 1.0 | GO:0004679 | AMP-activated protein kinase activity(GO:0004679) |
0.1 | 0.2 | GO:0046975 | histone methyltransferase activity (H3-K36 specific)(GO:0046975) |
0.1 | 1.5 | GO:0005086 | ARF guanyl-nucleotide exchange factor activity(GO:0005086) |
0.1 | 0.6 | GO:0004383 | guanylate cyclase activity(GO:0004383) |
0.1 | 0.9 | GO:0016500 | protein-hormone receptor activity(GO:0016500) |
0.1 | 0.2 | GO:0030942 | endoplasmic reticulum signal peptide binding(GO:0030942) |
0.1 | 0.3 | GO:0016717 | oxidoreductase activity, acting on paired donors, with oxidation of a pair of donors resulting in the reduction of molecular oxygen to two molecules of water(GO:0016717) |
0.1 | 0.7 | GO:0042500 | aspartic endopeptidase activity, intramembrane cleaving(GO:0042500) |
0.1 | 0.2 | GO:0004515 | nicotinamide-nucleotide adenylyltransferase activity(GO:0000309) nicotinate-nucleotide adenylyltransferase activity(GO:0004515) |
0.1 | 0.9 | GO:0080025 | phosphatidylinositol-3,5-bisphosphate binding(GO:0080025) |
0.1 | 0.1 | GO:0050145 | nucleoside phosphate kinase activity(GO:0050145) |
0.1 | 0.5 | GO:0103116 | alpha-D-galactofuranose transporter activity(GO:0103116) |
0.1 | 0.4 | GO:0045545 | syndecan binding(GO:0045545) |
0.1 | 0.2 | GO:0004814 | arginine-tRNA ligase activity(GO:0004814) |
0.1 | 0.1 | GO:0030284 | estrogen receptor activity(GO:0030284) |
0.1 | 1.7 | GO:0051059 | NF-kappaB binding(GO:0051059) |
0.1 | 0.5 | GO:0035198 | miRNA binding(GO:0035198) |
0.1 | 0.1 | GO:0043262 | adenosine-diphosphatase activity(GO:0043262) |
0.1 | 1.0 | GO:0015095 | magnesium ion transmembrane transporter activity(GO:0015095) |
0.1 | 0.8 | GO:0004089 | carbonate dehydratase activity(GO:0004089) |
0.1 | 0.6 | GO:0070513 | death domain binding(GO:0070513) |
0.1 | 0.3 | GO:0008410 | CoA-transferase activity(GO:0008410) |
0.1 | 0.3 | GO:0004556 | alpha-amylase activity(GO:0004556) |
0.1 | 0.2 | GO:0044323 | retinoic acid-responsive element binding(GO:0044323) |
0.1 | 1.5 | GO:0008536 | Ran GTPase binding(GO:0008536) |
0.1 | 1.2 | GO:0005528 | macrolide binding(GO:0005527) FK506 binding(GO:0005528) |
0.1 | 0.6 | GO:0004415 | hyalurononglucosaminidase activity(GO:0004415) |
0.1 | 0.1 | GO:0004427 | inorganic diphosphatase activity(GO:0004427) |
0.1 | 0.1 | GO:0003958 | NADPH-hemoprotein reductase activity(GO:0003958) |
0.1 | 2.1 | GO:0061631 | ubiquitin conjugating enzyme activity(GO:0061631) |
0.1 | 0.2 | GO:0008332 | low voltage-gated calcium channel activity(GO:0008332) |
0.1 | 0.7 | GO:0000701 | purine-specific mismatch base pair DNA N-glycosylase activity(GO:0000701) |
0.1 | 0.3 | GO:0016997 | exo-alpha-sialidase activity(GO:0004308) alpha-sialidase activity(GO:0016997) exo-alpha-(2->3)-sialidase activity(GO:0052794) exo-alpha-(2->6)-sialidase activity(GO:0052795) exo-alpha-(2->8)-sialidase activity(GO:0052796) |
0.1 | 0.5 | GO:0008179 | adenylate cyclase binding(GO:0008179) |
0.1 | 0.4 | GO:0031402 | sodium ion binding(GO:0031402) alkali metal ion binding(GO:0031420) |
0.1 | 0.3 | GO:0001665 | alpha-N-acetylgalactosaminide alpha-2,6-sialyltransferase activity(GO:0001665) |
0.1 | 0.2 | GO:0004938 | alpha2-adrenergic receptor activity(GO:0004938) |
0.1 | 1.2 | GO:0005547 | phosphatidylinositol-3,4,5-trisphosphate binding(GO:0005547) |
0.1 | 0.1 | GO:0005146 | leukemia inhibitory factor receptor binding(GO:0005146) |
0.1 | 0.9 | GO:0016765 | transferase activity, transferring alkyl or aryl (other than methyl) groups(GO:0016765) |
0.1 | 0.2 | GO:0048273 | mitogen-activated protein kinase p38 binding(GO:0048273) |
0.1 | 0.6 | GO:0004532 | 3'-5'-exoribonuclease activity(GO:0000175) exoribonuclease activity(GO:0004532) exoribonuclease activity, producing 5'-phosphomonoesters(GO:0016896) |
0.1 | 0.3 | GO:0004060 | arylamine N-acetyltransferase activity(GO:0004060) |
0.1 | 0.3 | GO:0005499 | vitamin D binding(GO:0005499) |
0.1 | 0.2 | GO:0003829 | beta-1,3-galactosyl-O-glycosyl-glycoprotein beta-1,6-N-acetylglucosaminyltransferase activity(GO:0003829) |
0.1 | 0.8 | GO:0015269 | calcium-activated potassium channel activity(GO:0015269) |
0.1 | 0.3 | GO:0003708 | retinoic acid receptor activity(GO:0003708) |
0.1 | 0.4 | GO:0030274 | LIM domain binding(GO:0030274) |
0.1 | 0.6 | GO:0002161 | aminoacyl-tRNA editing activity(GO:0002161) |
0.1 | 0.4 | GO:0033677 | DNA/RNA helicase activity(GO:0033677) |
0.1 | 1.0 | GO:0052713 | calmodulin-dependent cyclic-nucleotide phosphodiesterase activity(GO:0004117) cGMP-stimulated cyclic-nucleotide phosphodiesterase activity(GO:0004118) cGMP-inhibited cyclic-nucleotide phosphodiesterase activity(GO:0004119) photoreceptor cyclic-nucleotide phosphodiesterase activity(GO:0004120) 7,8-dihydro-D-neopterin 2',3'-cyclic phosphate phosphodiesterase activity(GO:0044688) inositol phosphosphingolipid phospholipase activity(GO:0052712) inositol phosphorylceramide phospholipase activity(GO:0052713) mannosyl-inositol phosphorylceramide phospholipase activity(GO:0052714) mannosyl-diinositol phosphorylceramide phospholipase activity(GO:0052715) |
0.1 | 1.8 | GO:0017112 | Rab guanyl-nucleotide exchange factor activity(GO:0017112) |
0.1 | 0.2 | GO:0019862 | IgA binding(GO:0019862) |
0.1 | 0.1 | GO:0018585 | fluorene oxygenase activity(GO:0018585) |
0.1 | 0.2 | GO:0005094 | Rho GDP-dissociation inhibitor activity(GO:0005094) |
0.1 | 3.3 | GO:0005518 | collagen binding(GO:0005518) |
0.1 | 0.2 | GO:0005329 | dopamine transmembrane transporter activity(GO:0005329) |
0.1 | 0.2 | GO:0071987 | WD40-repeat domain binding(GO:0071987) |
0.1 | 0.3 | GO:0004689 | phosphorylase kinase activity(GO:0004689) |
0.1 | 0.6 | GO:0044183 | protein binding involved in protein folding(GO:0044183) |
0.1 | 0.2 | GO:0042731 | PH domain binding(GO:0042731) |
0.1 | 0.4 | GO:0009922 | fatty acid elongase activity(GO:0009922) 3-oxo-arachidoyl-CoA synthase activity(GO:0102336) 3-oxo-cerotoyl-CoA synthase activity(GO:0102337) 3-oxo-lignoceronyl-CoA synthase activity(GO:0102338) |
0.1 | 0.1 | GO:0008425 | C-methyltransferase activity(GO:0008169) 2-polyprenyl-6-methoxy-1,4-benzoquinone methyltransferase activity(GO:0008425) quinone cofactor methyltransferase activity(GO:0030580) |
0.1 | 0.1 | GO:0016880 | acid-ammonia (or amide) ligase activity(GO:0016880) |
0.1 | 0.4 | GO:0036402 | proteasome-activating ATPase activity(GO:0036402) |
0.1 | 0.4 | GO:0030306 | ADP-ribosylation factor binding(GO:0030306) |
0.1 | 0.2 | GO:0043559 | insulin binding(GO:0043559) |
0.1 | 0.4 | GO:0001223 | transcription coactivator binding(GO:0001223) |
0.1 | 0.9 | GO:0032794 | GTPase activating protein binding(GO:0032794) |
0.1 | 0.3 | GO:0005134 | interleukin-2 receptor binding(GO:0005134) |
0.1 | 0.3 | GO:0016668 | oxidoreductase activity, acting on a sulfur group of donors, NAD(P) as acceptor(GO:0016668) |
0.1 | 0.1 | GO:0003988 | acetyl-CoA C-acyltransferase activity(GO:0003988) |
0.1 | 1.1 | GO:0004198 | calcium-dependent cysteine-type endopeptidase activity(GO:0004198) |
0.1 | 0.7 | GO:0070064 | proline-rich region binding(GO:0070064) |
0.1 | 2.2 | GO:0000049 | tRNA binding(GO:0000049) |
0.1 | 0.2 | GO:0001602 | pancreatic polypeptide receptor activity(GO:0001602) |
0.1 | 0.6 | GO:0008796 | bis(5'-nucleosyl)-tetraphosphatase activity(GO:0008796) |
0.1 | 0.1 | GO:0015111 | iodide transmembrane transporter activity(GO:0015111) |
0.1 | 1.0 | GO:0019843 | rRNA binding(GO:0019843) |
0.1 | 0.4 | GO:0046790 | virion binding(GO:0046790) |
0.1 | 0.3 | GO:0035325 | Toll-like receptor binding(GO:0035325) |
0.1 | 0.2 | GO:0000774 | adenyl-nucleotide exchange factor activity(GO:0000774) |
0.1 | 0.2 | GO:0016653 | oxidoreductase activity, acting on NAD(P)H, heme protein as acceptor(GO:0016653) |
0.1 | 0.3 | GO:0008508 | bile acid:sodium symporter activity(GO:0008508) |
0.1 | 0.2 | GO:0004784 | superoxide dismutase activity(GO:0004784) oxidoreductase activity, acting on superoxide radicals as acceptor(GO:0016721) |
0.1 | 0.3 | GO:0046934 | phosphatidylinositol-4,5-bisphosphate 3-kinase activity(GO:0046934) |
0.1 | 0.1 | GO:0001758 | retinal dehydrogenase activity(GO:0001758) |
0.1 | 0.2 | GO:0008401 | retinoic acid 4-hydroxylase activity(GO:0008401) |
0.1 | 0.2 | GO:0000293 | ferric-chelate reductase activity(GO:0000293) |
0.1 | 0.2 | GO:0005483 | soluble NSF attachment protein activity(GO:0005483) |
0.1 | 1.1 | GO:0019706 | protein-cysteine S-palmitoyltransferase activity(GO:0019706) |
0.1 | 0.3 | GO:0042809 | vitamin D receptor binding(GO:0042809) |
0.0 | 0.2 | GO:0086008 | voltage-gated potassium channel activity involved in cardiac muscle cell action potential repolarization(GO:0086008) |
0.0 | 3.8 | GO:0008170 | N-methyltransferase activity(GO:0008170) |
0.0 | 0.3 | GO:0004439 | phosphatidylinositol-4,5-bisphosphate 5-phosphatase activity(GO:0004439) |
0.0 | 0.2 | GO:0005113 | patched binding(GO:0005113) |
0.0 | 0.1 | GO:0015440 | peptide-transporting ATPase activity(GO:0015440) |
0.0 | 0.3 | GO:0004983 | neuropeptide Y receptor activity(GO:0004983) |
0.0 | 0.1 | GO:0005391 | sodium:potassium-exchanging ATPase activity(GO:0005391) |
0.0 | 0.6 | GO:0008601 | protein phosphatase type 2A regulator activity(GO:0008601) |
0.0 | 0.1 | GO:0003976 | UDP-N-acetylglucosamine-lysosomal-enzyme N-acetylglucosaminephosphotransferase activity(GO:0003976) |
0.0 | 0.3 | GO:0008889 | glycerophosphodiester phosphodiesterase activity(GO:0008889) |
0.0 | 0.1 | GO:0008506 | sucrose:proton symporter activity(GO:0008506) sucrose transmembrane transporter activity(GO:0008515) disaccharide transmembrane transporter activity(GO:0015154) oligosaccharide transmembrane transporter activity(GO:0015157) |
0.0 | 1.3 | GO:0004033 | aldo-keto reductase (NADP) activity(GO:0004033) |
0.0 | 0.5 | GO:0001671 | ATPase activator activity(GO:0001671) |
0.0 | 0.2 | GO:0070579 | methylcytosine dioxygenase activity(GO:0070579) |
0.0 | 0.6 | GO:0016289 | CoA hydrolase activity(GO:0016289) |
0.0 | 0.2 | GO:0043325 | phosphatidylinositol-3,4-bisphosphate binding(GO:0043325) |
0.0 | 0.8 | GO:0004889 | acetylcholine-activated cation-selective channel activity(GO:0004889) |
0.0 | 0.5 | GO:0050661 | NADP binding(GO:0050661) |
0.0 | 0.2 | GO:0086006 | voltage-gated sodium channel activity involved in cardiac muscle cell action potential(GO:0086006) |
0.0 | 0.1 | GO:0070410 | co-SMAD binding(GO:0070410) |
0.0 | 0.4 | GO:0005487 | nucleocytoplasmic transporter activity(GO:0005487) |
0.0 | 0.0 | GO:0016655 | oxidoreductase activity, acting on NAD(P)H, quinone or similar compound as acceptor(GO:0016655) |
0.0 | 0.1 | GO:0097016 | L27 domain binding(GO:0097016) |
0.0 | 0.1 | GO:0016670 | oxidoreductase activity, acting on a sulfur group of donors, oxygen as acceptor(GO:0016670) |
0.0 | 0.2 | GO:0032027 | myosin light chain binding(GO:0032027) |
0.0 | 0.4 | GO:0016920 | pyroglutamyl-peptidase activity(GO:0016920) |
0.0 | 1.0 | GO:0003887 | DNA-directed DNA polymerase activity(GO:0003887) |
0.0 | 0.2 | GO:0004017 | adenylate kinase activity(GO:0004017) |
0.0 | 0.0 | GO:0016262 | protein N-acetylglucosaminyltransferase activity(GO:0016262) |
0.0 | 0.3 | GO:0050811 | GABA receptor binding(GO:0050811) |
0.0 | 0.4 | GO:0001055 | RNA polymerase II activity(GO:0001055) |
0.0 | 1.7 | GO:0004722 | protein serine/threonine phosphatase activity(GO:0004722) |
0.0 | 0.0 | GO:0005223 | intracellular cGMP activated cation channel activity(GO:0005223) |
0.0 | 0.1 | GO:0042054 | histone methyltransferase activity(GO:0042054) |
0.0 | 0.1 | GO:0016520 | growth hormone-releasing hormone receptor activity(GO:0016520) |
0.0 | 0.8 | GO:0016893 | endonuclease activity, active with either ribo- or deoxyribonucleic acids and producing 5'-phosphomonoesters(GO:0016893) |
0.0 | 1.0 | GO:0003707 | steroid hormone receptor activity(GO:0003707) |
0.0 | 0.2 | GO:0071253 | connexin binding(GO:0071253) |
0.0 | 0.2 | GO:0017091 | AU-rich element binding(GO:0017091) |
0.0 | 0.1 | GO:1990460 | leptin receptor binding(GO:1990460) |
0.0 | 0.1 | GO:0031628 | opioid receptor binding(GO:0031628) |
0.0 | 0.3 | GO:0003746 | translation elongation factor activity(GO:0003746) |
0.0 | 0.0 | GO:0048763 | calcium-induced calcium release activity(GO:0048763) |
0.0 | 0.2 | GO:0031545 | peptidyl-proline 4-dioxygenase activity(GO:0031545) |
0.0 | 0.1 | GO:0016300 | tRNA (uracil) methyltransferase activity(GO:0016300) |
0.0 | 0.1 | GO:0031013 | troponin I binding(GO:0031013) |
0.0 | 0.1 | GO:0086056 | voltage-gated calcium channel activity involved in AV node cell action potential(GO:0086056) |
0.0 | 0.0 | GO:0004629 | phospholipase C activity(GO:0004629) |
0.0 | 0.1 | GO:0008079 | translation release factor activity(GO:0003747) translation termination factor activity(GO:0008079) |
0.0 | 0.1 | GO:0004967 | glucagon receptor activity(GO:0004967) |
0.0 | 0.0 | GO:0036222 | dITP diphosphatase activity(GO:0035870) XTP diphosphatase activity(GO:0036222) |
0.0 | 0.1 | GO:0008349 | MAP kinase kinase kinase kinase activity(GO:0008349) |
0.0 | 0.2 | GO:0005227 | calcium activated cation channel activity(GO:0005227) |
0.0 | 0.0 | GO:0098531 | RNA polymerase II transcription factor activity, ligand-activated sequence-specific DNA binding(GO:0004879) transcription factor activity, direct ligand regulated sequence-specific DNA binding(GO:0098531) |
0.0 | 1.0 | GO:0019894 | kinesin binding(GO:0019894) |
0.0 | 0.2 | GO:0034237 | protein kinase A regulatory subunit binding(GO:0034237) |
0.0 | 1.9 | GO:0003705 | transcription factor activity, RNA polymerase II distal enhancer sequence-specific binding(GO:0003705) |
0.0 | 0.3 | GO:0005048 | signal sequence binding(GO:0005048) |
0.0 | 0.4 | GO:0046966 | thyroid hormone receptor binding(GO:0046966) |
0.0 | 0.4 | GO:0070006 | metalloaminopeptidase activity(GO:0070006) |
0.0 | 0.1 | GO:0008174 | mRNA methyltransferase activity(GO:0008174) |
0.0 | 0.1 | GO:0035368 | selenocysteine insertion sequence binding(GO:0035368) |
0.0 | 0.1 | GO:0030297 | transmembrane receptor protein tyrosine kinase activator activity(GO:0030297) |
0.0 | 0.2 | GO:0051371 | muscle alpha-actinin binding(GO:0051371) |
0.0 | 0.2 | GO:0015321 | sodium-dependent phosphate transmembrane transporter activity(GO:0015321) |
0.0 | 0.1 | GO:0004690 | cyclic nucleotide-dependent protein kinase activity(GO:0004690) |
0.0 | 0.1 | GO:0034040 | lipid-transporting ATPase activity(GO:0034040) |
0.0 | 0.7 | GO:0005164 | tumor necrosis factor receptor binding(GO:0005164) |
0.0 | 0.1 | GO:0000182 | rDNA binding(GO:0000182) |
0.0 | 6.0 | GO:0003735 | structural constituent of ribosome(GO:0003735) |
0.0 | 0.1 | GO:1990050 | phosphatidic acid transporter activity(GO:1990050) |
0.0 | 0.1 | GO:0017116 | single-stranded DNA-dependent ATP-dependent DNA helicase activity(GO:0017116) |
0.0 | 0.1 | GO:0005375 | copper ion transmembrane transporter activity(GO:0005375) |
0.0 | 0.1 | GO:0016822 | hydrolase activity, acting on acid carbon-carbon bonds(GO:0016822) hydrolase activity, acting on acid carbon-carbon bonds, in ketonic substances(GO:0016823) |
0.0 | 0.1 | GO:0030621 | U4 snRNA binding(GO:0030621) |
0.0 | 0.2 | GO:0019784 | NEDD8-specific protease activity(GO:0019784) |
0.0 | 0.0 | GO:0015927 | trehalase activity(GO:0015927) |
0.0 | 0.1 | GO:0030628 | pre-mRNA 3'-splice site binding(GO:0030628) |
0.0 | 0.1 | GO:0019911 | structural constituent of myelin sheath(GO:0019911) |
0.0 | 0.5 | GO:0031593 | polyubiquitin binding(GO:0031593) |
0.0 | 0.4 | GO:0008157 | protein phosphatase 1 binding(GO:0008157) |
0.0 | 0.1 | GO:0015277 | kainate selective glutamate receptor activity(GO:0015277) |
0.0 | 0.1 | GO:0003916 | DNA topoisomerase activity(GO:0003916) |
0.0 | 0.1 | GO:0004046 | aminoacylase activity(GO:0004046) |
0.0 | 0.3 | GO:0005451 | monovalent cation:proton antiporter activity(GO:0005451) |
0.0 | 1.0 | GO:0004402 | histone acetyltransferase activity(GO:0004402) |
0.0 | 0.0 | GO:0034212 | peptide N-acetyltransferase activity(GO:0034212) |
0.0 | 0.3 | GO:0031435 | mitogen-activated protein kinase kinase kinase binding(GO:0031435) |
0.0 | 0.1 | GO:0030159 | receptor signaling complex scaffold activity(GO:0030159) |
0.0 | 0.1 | GO:0070569 | uridylyltransferase activity(GO:0070569) |
0.0 | 0.8 | GO:0035064 | methylated histone binding(GO:0035064) |
0.0 | 0.0 | GO:0048408 | epidermal growth factor binding(GO:0048408) |
0.0 | 0.1 | GO:0036122 | BMP binding(GO:0036122) |
0.0 | 0.1 | GO:0043175 | RNA polymerase core enzyme binding(GO:0043175) |
0.0 | 0.6 | GO:0005104 | fibroblast growth factor receptor binding(GO:0005104) |
0.0 | 0.1 | GO:0043425 | bHLH transcription factor binding(GO:0043425) |
0.0 | 0.1 | GO:0019797 | procollagen-proline 3-dioxygenase activity(GO:0019797) |
0.0 | 0.5 | GO:0001540 | beta-amyloid binding(GO:0001540) |
0.0 | 3.5 | GO:0001227 | transcriptional repressor activity, RNA polymerase II transcription regulatory region sequence-specific binding(GO:0001227) |
0.0 | 0.3 | GO:0043531 | ADP binding(GO:0043531) |
0.0 | 0.0 | GO:0031726 | CCR1 chemokine receptor binding(GO:0031726) |
0.0 | 0.0 | GO:0016774 | phosphotransferase activity, carboxyl group as acceptor(GO:0016774) |
0.0 | 0.2 | GO:0015377 | cation:chloride symporter activity(GO:0015377) |
0.0 | 0.1 | GO:0008379 | thioredoxin peroxidase activity(GO:0008379) |
0.0 | 0.3 | GO:0003755 | peptidyl-prolyl cis-trans isomerase activity(GO:0003755) |
0.0 | 0.0 | GO:0003954 | NADH dehydrogenase activity(GO:0003954) |
0.0 | 0.1 | GO:0005000 | vasopressin receptor activity(GO:0005000) |
0.0 | 0.1 | GO:0034549 | N-cyclopropylmelamine deaminase activity(GO:0034547) N-cyclopropylammeline deaminase activity(GO:0034548) N-cyclopropylammelide alkylamino hydrolase activity(GO:0034549) 2,5-diamino-6-ribitylamino-4(3H)-pyrimidinone 5'-phosphate deaminase activity(GO:0043723) tRNA-specific adenosine-37 deaminase activity(GO:0043829) archaeal-specific GTP cyclohydrolase activity(GO:0044682) tRNA-specific adenosine-34 deaminase activity(GO:0052717) |
0.0 | 0.5 | GO:0004298 | threonine-type endopeptidase activity(GO:0004298) threonine-type peptidase activity(GO:0070003) |
0.0 | 0.1 | GO:0031694 | alpha-2A adrenergic receptor binding(GO:0031694) |
0.0 | 0.2 | GO:0048038 | quinone binding(GO:0048038) |
0.0 | 0.1 | GO:0061676 | importin-alpha family protein binding(GO:0061676) |
0.0 | 0.0 | GO:0051430 | corticotropin-releasing hormone receptor 1 binding(GO:0051430) |
0.0 | 1.5 | GO:0101005 | thiol-dependent ubiquitinyl hydrolase activity(GO:0036459) ubiquitinyl hydrolase activity(GO:0101005) |
0.0 | 0.0 | GO:0034191 | apolipoprotein A-I receptor binding(GO:0034191) |
0.0 | 0.0 | GO:0031893 | vasopressin receptor binding(GO:0031893) |
0.0 | 0.0 | GO:0070883 | pre-miRNA binding(GO:0070883) |
0.0 | 0.1 | GO:0004614 | phosphoglucomutase activity(GO:0004614) |
0.0 | 0.0 | GO:0070698 | type I activin receptor binding(GO:0070698) |
0.0 | 0.7 | GO:0043022 | ribosome binding(GO:0043022) |
0.0 | 0.5 | GO:0019212 | phosphatase inhibitor activity(GO:0019212) |
0.0 | 0.1 | GO:0035251 | UDP-glucosyltransferase activity(GO:0035251) |
0.0 | 0.1 | GO:0004673 | protein histidine kinase activity(GO:0004673) |
0.0 | 0.0 | GO:0004826 | phenylalanine-tRNA ligase activity(GO:0004826) |
0.0 | 0.0 | GO:0097001 | ceramide binding(GO:0097001) |
0.0 | 0.4 | GO:1902936 | phosphatidylinositol bisphosphate binding(GO:1902936) |
0.0 | 0.1 | GO:0030229 | very-low-density lipoprotein particle receptor activity(GO:0030229) |
0.0 | 0.1 | GO:0005324 | long-chain fatty acid transporter activity(GO:0005324) |
0.0 | 0.0 | GO:0003905 | alkylbase DNA N-glycosylase activity(GO:0003905) DNA-3-methylbase glycosylase activity(GO:0043733) |
0.0 | 0.8 | GO:0030276 | clathrin binding(GO:0030276) |
0.0 | 0.6 | GO:0043130 | ubiquitin binding(GO:0043130) |
0.0 | 0.3 | GO:0005544 | calcium-dependent phospholipid binding(GO:0005544) |
0.0 | 0.2 | GO:0017049 | GTP-Rho binding(GO:0017049) |
0.0 | 0.3 | GO:0019825 | oxygen binding(GO:0019825) |
0.0 | 0.1 | GO:0070063 | RNA polymerase binding(GO:0070063) |
0.0 | 0.0 | GO:0070573 | metallodipeptidase activity(GO:0070573) |
0.0 | 0.1 | GO:0042300 | pivalyl-CoA mutase activity(GO:0034784) o-hydroxylaminobenzoate mutase activity(GO:0034951) lupeol synthase activity(GO:0042299) beta-amyrin synthase activity(GO:0042300) baruol synthase activity(GO:0080011) |
0.0 | 0.1 | GO:0005004 | GPI-linked ephrin receptor activity(GO:0005004) |
0.0 | 0.4 | GO:0030507 | spectrin binding(GO:0030507) |
0.0 | 0.1 | GO:0016724 | ferroxidase activity(GO:0004322) oxidoreductase activity, oxidizing metal ions, oxygen as acceptor(GO:0016724) |
0.0 | 0.4 | GO:0048487 | beta-tubulin binding(GO:0048487) |
0.0 | 0.3 | GO:0016675 | oxidoreductase activity, acting on a heme group of donors(GO:0016675) |
0.0 | 0.4 | GO:0052745 | inositol phosphate phosphatase activity(GO:0052745) |
0.0 | 0.1 | GO:0016494 | C-X-C chemokine receptor activity(GO:0016494) |
0.0 | 0.1 | GO:0015194 | L-serine transmembrane transporter activity(GO:0015194) serine transmembrane transporter activity(GO:0022889) |
0.0 | 0.2 | GO:0008375 | acetylglucosaminyltransferase activity(GO:0008375) |
0.0 | 0.1 | GO:0043008 | ATP-dependent protein binding(GO:0043008) |
0.0 | 0.1 | GO:0005172 | vascular endothelial growth factor receptor binding(GO:0005172) |
0.0 | 0.1 | GO:0031493 | nucleosomal histone binding(GO:0031493) |
0.0 | 0.1 | GO:0004954 | prostanoid receptor activity(GO:0004954) |
0.0 | 1.4 | GO:0004222 | metalloendopeptidase activity(GO:0004222) |
0.0 | 0.2 | GO:0070888 | E-box binding(GO:0070888) |
0.0 | 0.1 | GO:0046912 | transferase activity, transferring acyl groups, acyl groups converted into alkyl on transfer(GO:0046912) |
0.0 | 0.4 | GO:0005484 | SNAP receptor activity(GO:0005484) |
0.0 | 0.1 | GO:0005042 | netrin receptor activity(GO:0005042) |
0.0 | 0.0 | GO:0005502 | 11-cis retinal binding(GO:0005502) |
0.0 | 0.0 | GO:0030619 | U1 snRNA binding(GO:0030619) |
0.0 | 0.0 | GO:0019237 | centromeric DNA binding(GO:0019237) |
0.0 | 0.2 | GO:0071837 | HMG box domain binding(GO:0071837) |
0.0 | 0.6 | GO:0005201 | extracellular matrix structural constituent(GO:0005201) |
0.0 | 0.1 | GO:0036374 | gamma-glutamyltransferase activity(GO:0003840) glutathione hydrolase activity(GO:0036374) |
0.0 | 0.0 | GO:0051431 | corticotropin-releasing hormone receptor binding(GO:0051429) corticotropin-releasing hormone receptor 2 binding(GO:0051431) |
0.0 | 0.0 | GO:0098988 | G-protein coupled glutamate receptor activity(GO:0098988) |
0.0 | 0.4 | GO:0002039 | p53 binding(GO:0002039) |
0.0 | 0.1 | GO:0016019 | N-acetylmuramoyl-L-alanine amidase activity(GO:0008745) peptidoglycan receptor activity(GO:0016019) |
0.0 | 0.1 | GO:0001515 | opioid peptide activity(GO:0001515) |
0.0 | 0.2 | GO:0001106 | RNA polymerase II transcription corepressor activity(GO:0001106) |
0.0 | 0.1 | GO:0009982 | pseudouridine synthase activity(GO:0009982) |
0.0 | 0.0 | GO:0004376 | glycolipid mannosyltransferase activity(GO:0004376) |
0.0 | 0.1 | GO:0071617 | lysophosphatidic acid acyltransferase activity(GO:0042171) lysophospholipid acyltransferase activity(GO:0071617) |
0.0 | 0.1 | GO:0098599 | palmitoyl-(protein) hydrolase activity(GO:0008474) palmitoyl hydrolase activity(GO:0098599) |
0.0 | 0.1 | GO:0008121 | ubiquinol-cytochrome-c reductase activity(GO:0008121) oxidoreductase activity, acting on diphenols and related substances as donors(GO:0016679) oxidoreductase activity, acting on diphenols and related substances as donors, cytochrome as acceptor(GO:0016681) |
0.0 | 0.1 | GO:0043522 | leucine zipper domain binding(GO:0043522) |
0.0 | 0.0 | GO:0008422 | beta-glucosidase activity(GO:0008422) |
0.0 | 0.2 | GO:0001103 | RNA polymerase II repressing transcription factor binding(GO:0001103) |
0.0 | 8.7 | GO:0044822 | poly(A) RNA binding(GO:0044822) |
0.0 | 0.3 | GO:0019798 | procollagen-proline dioxygenase activity(GO:0019798) |
0.0 | 0.0 | GO:0003910 | DNA ligase activity(GO:0003909) DNA ligase (ATP) activity(GO:0003910) |
0.0 | 0.0 | GO:0019976 | interleukin-2 binding(GO:0019976) |
0.0 | 0.0 | GO:0004980 | melanocyte-stimulating hormone receptor activity(GO:0004980) |
0.0 | 0.1 | GO:0005248 | voltage-gated sodium channel activity(GO:0005248) voltage-gated ion channel activity involved in regulation of postsynaptic membrane potential(GO:1905030) |
0.0 | 0.0 | GO:0008107 | galactoside 2-alpha-L-fucosyltransferase activity(GO:0008107) alpha-(1,2)-fucosyltransferase activity(GO:0031127) |
0.0 | 0.0 | GO:0008808 | cardiolipin synthase activity(GO:0008808) phosphatidyltransferase activity(GO:0030572) |
0.0 | 0.1 | GO:0005351 | sugar:proton symporter activity(GO:0005351) |
0.0 | 0.5 | GO:0004386 | helicase activity(GO:0004386) |
0.0 | 0.0 | GO:0008417 | fucosyltransferase activity(GO:0008417) |
0.0 | 0.0 | GO:0004995 | tachykinin receptor activity(GO:0004995) |
0.0 | 0.0 | GO:0030911 | TPR domain binding(GO:0030911) |
0.0 | 0.0 | GO:0051425 | PTB domain binding(GO:0051425) |
0.0 | 0.1 | GO:0030551 | cyclic nucleotide binding(GO:0030551) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.6 | 8.8 | PID ERBB NETWORK PATHWAY | ErbB receptor signaling network |
0.4 | 10.8 | PID RXR VDR PATHWAY | RXR and RAR heterodimerization with other nuclear receptor |
0.2 | 7.8 | ST ADRENERGIC | Adrenergic Pathway |
0.2 | 9.2 | PID HES HEY PATHWAY | Notch-mediated HES/HEY network |
0.2 | 0.2 | PID IL8 CXCR1 PATHWAY | IL8- and CXCR1-mediated signaling events |
0.2 | 5.0 | PID ER NONGENOMIC PATHWAY | Plasma membrane estrogen receptor signaling |
0.2 | 1.1 | SIG INSULIN RECEPTOR PATHWAY IN CARDIAC MYOCYTES | Genes related to the insulin receptor pathway |
0.2 | 3.4 | PID ERBB1 RECEPTOR PROXIMAL PATHWAY | EGF receptor (ErbB1) signaling pathway |
0.2 | 1.7 | PID P38 GAMMA DELTA PATHWAY | Signaling mediated by p38-gamma and p38-delta |
0.1 | 6.5 | PID HEDGEHOG GLI PATHWAY | Hedgehog signaling events mediated by Gli proteins |
0.1 | 0.1 | PID BETA CATENIN DEG PATHWAY | Degradation of beta catenin |
0.1 | 0.5 | PID EPHA2 FWD PATHWAY | EPHA2 forward signaling |
0.1 | 2.7 | PID ALK1 PATHWAY | ALK1 signaling events |
0.1 | 0.9 | ST INTERFERON GAMMA PATHWAY | Interferon gamma pathway. |
0.1 | 0.4 | ST PHOSPHOINOSITIDE 3 KINASE PATHWAY | PI3K Pathway |
0.1 | 4.0 | NABA PROTEOGLYCANS | Genes encoding proteoglycans |
0.1 | 0.8 | SA FAS SIGNALING | The TNF-type receptor Fas induces apoptosis on ligand binding. |
0.1 | 1.3 | PID PDGFRA PATHWAY | PDGFR-alpha signaling pathway |
0.1 | 2.3 | PID INSULIN PATHWAY | Insulin Pathway |
0.1 | 0.1 | SIG PIP3 SIGNALING IN B LYMPHOCYTES | Genes related to PIP3 signaling in B lymphocytes |
0.1 | 1.0 | PID SMAD2 3PATHWAY | Regulation of cytoplasmic and nuclear SMAD2/3 signaling |
0.1 | 2.9 | PID IL1 PATHWAY | IL1-mediated signaling events |
0.1 | 2.1 | PID NCADHERIN PATHWAY | N-cadherin signaling events |
0.1 | 0.5 | PID THROMBIN PAR4 PATHWAY | PAR4-mediated thrombin signaling events |
0.1 | 1.4 | PID INSULIN GLUCOSE PATHWAY | Insulin-mediated glucose transport |
0.1 | 0.8 | SA PTEN PATHWAY | PTEN is a tumor suppressor that dephosphorylates the lipid messenger phosphatidylinositol triphosphate. |
0.1 | 0.3 | ST MYOCYTE AD PATHWAY | Myocyte Adrenergic Pathway is a specific case of the generalized Adrenergic Pathway. |
0.1 | 1.9 | PID AURORA A PATHWAY | Aurora A signaling |
0.1 | 0.2 | PID S1P S1P4 PATHWAY | S1P4 pathway |
0.1 | 2.1 | PID AURORA B PATHWAY | Aurora B signaling |
0.1 | 0.4 | SA G1 AND S PHASES | Cdk2, 4, and 6 bind cyclin D in G1, while cdk2/cyclin E promotes the G1/S transition. |
0.1 | 0.3 | PID SYNDECAN 2 PATHWAY | Syndecan-2-mediated signaling events |
0.1 | 1.8 | PID SHP2 PATHWAY | SHP2 signaling |
0.1 | 0.2 | SA G2 AND M PHASES | Cdc25 activates the cdc2/cyclin B complex to induce the G2/M transition. |
0.1 | 0.5 | PID ANTHRAX PATHWAY | Cellular roles of Anthrax toxin |
0.1 | 0.3 | ST INTEGRIN SIGNALING PATHWAY | Integrin Signaling Pathway |
0.1 | 0.4 | PID UPA UPAR PATHWAY | Urokinase-type plasminogen activator (uPA) and uPAR-mediated signaling |
0.1 | 0.3 | PID FOXO PATHWAY | FoxO family signaling |
0.1 | 0.7 | PID HIF1A PATHWAY | Hypoxic and oxygen homeostasis regulation of HIF-1-alpha |
0.1 | 0.1 | PID NECTIN PATHWAY | Nectin adhesion pathway |
0.1 | 1.4 | PID TRKR PATHWAY | Neurotrophic factor-mediated Trk receptor signaling |
0.1 | 0.6 | PID BARD1 PATHWAY | BARD1 signaling events |
0.1 | 0.6 | PID THROMBIN PAR1 PATHWAY | PAR1-mediated thrombin signaling events |
0.1 | 0.5 | PID NEPHRIN NEPH1 PATHWAY | Nephrin/Neph1 signaling in the kidney podocyte |
0.1 | 1.2 | PID ECADHERIN STABILIZATION PATHWAY | Stabilization and expansion of the E-cadherin adherens junction |
0.1 | 0.6 | PID DNA PK PATHWAY | DNA-PK pathway in nonhomologous end joining |
0.1 | 0.6 | PID ATR PATHWAY | ATR signaling pathway |
0.1 | 0.8 | PID GLYPICAN 1PATHWAY | Glypican 1 network |
0.1 | 0.8 | PID EPHA FWDPATHWAY | EPHA forward signaling |
0.0 | 0.2 | PID AVB3 OPN PATHWAY | Osteopontin-mediated events |
0.0 | 0.5 | PID SYNDECAN 3 PATHWAY | Syndecan-3-mediated signaling events |
0.0 | 1.9 | PID FANCONI PATHWAY | Fanconi anemia pathway |
0.0 | 0.5 | SA MMP CYTOKINE CONNECTION | Cytokines can induce activation of matrix metalloproteinases, which degrade extracellular matrix. |
0.0 | 0.1 | ST INTERLEUKIN 4 PATHWAY | Interleukin 4 (IL-4) Pathway |
0.0 | 1.0 | PID TNF PATHWAY | TNF receptor signaling pathway |
0.0 | 0.7 | PID FOXM1 PATHWAY | FOXM1 transcription factor network |
0.0 | 0.8 | PID HDAC CLASSIII PATHWAY | Signaling events mediated by HDAC Class III |
0.0 | 0.2 | PID ARF6 DOWNSTREAM PATHWAY | Arf6 downstream pathway |
0.0 | 0.6 | PID CXCR3 PATHWAY | CXCR3-mediated signaling events |
0.0 | 0.1 | PID ECADHERIN KERATINOCYTE PATHWAY | E-cadherin signaling in keratinocytes |
0.0 | 0.1 | ST P38 MAPK PATHWAY | p38 MAPK Pathway |
0.0 | 0.9 | ST JNK MAPK PATHWAY | JNK MAPK Pathway |
0.0 | 0.2 | PID SYNDECAN 4 PATHWAY | Syndecan-4-mediated signaling events |
0.0 | 0.2 | ST G ALPHA I PATHWAY | G alpha i Pathway |
0.0 | 0.0 | PID TCR JNK PATHWAY | JNK signaling in the CD4+ TCR pathway |
0.0 | 1.5 | PID P73PATHWAY | p73 transcription factor network |
0.0 | 0.4 | PID ARF6 PATHWAY | Arf6 signaling events |
0.0 | 0.6 | NABA BASEMENT MEMBRANES | Genes encoding structural components of basement membranes |
0.0 | 0.8 | PID AR TF PATHWAY | Regulation of Androgen receptor activity |
0.0 | 0.1 | PID NFKAPPAB CANONICAL PATHWAY | Canonical NF-kappaB pathway |
0.0 | 1.1 | PID E2F PATHWAY | E2F transcription factor network |
0.0 | 0.3 | ST WNT CA2 CYCLIC GMP PATHWAY | Wnt/Ca2+/cyclic GMP signaling. |
0.0 | 0.6 | SIG CHEMOTAXIS | Genes related to chemotaxis |
0.0 | 0.3 | PID HEDGEHOG 2PATHWAY | Signaling events mediated by the Hedgehog family |
0.0 | 0.4 | ST DIFFERENTIATION PATHWAY IN PC12 CELLS | Differentiation Pathway in PC12 Cells; this is a specific case of PAC1 Receptor Pathway. |
0.0 | 0.0 | SIG BCR SIGNALING PATHWAY | Members of the BCR signaling pathway |
0.0 | 0.7 | PID SMAD2 3NUCLEAR PATHWAY | Regulation of nuclear SMAD2/3 signaling |
0.0 | 0.1 | PID ERB GENOMIC PATHWAY | Validated nuclear estrogen receptor beta network |
0.0 | 0.4 | PID ILK PATHWAY | Integrin-linked kinase signaling |
0.0 | 0.1 | PID INTEGRIN A4B1 PATHWAY | Alpha4 beta1 integrin signaling events |
0.0 | 0.6 | PID SYNDECAN 1 PATHWAY | Syndecan-1-mediated signaling events |
0.0 | 0.0 | PID TRAIL PATHWAY | TRAIL signaling pathway |
0.0 | 0.2 | PID WNT NONCANONICAL PATHWAY | Noncanonical Wnt signaling pathway |
0.0 | 0.1 | ST IL 13 PATHWAY | Interleukin 13 (IL-13) Pathway |
0.0 | 0.0 | PID P38 ALPHA BETA PATHWAY | Regulation of p38-alpha and p38-beta |
0.0 | 2.8 | NABA SECRETED FACTORS | Genes encoding secreted soluble factors |
0.0 | 0.1 | PID P38 MK2 PATHWAY | p38 signaling mediated by MAPKAP kinases |
0.0 | 0.2 | PID IL12 STAT4 PATHWAY | IL12 signaling mediated by STAT4 |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.7 | 4.3 | REACTOME ETHANOL OXIDATION | Genes involved in Ethanol oxidation |
0.6 | 5.7 | REACTOME PROLACTIN RECEPTOR SIGNALING | Genes involved in Prolactin receptor signaling |
0.5 | 8.3 | REACTOME SIGNALING BY CONSTITUTIVELY ACTIVE EGFR | Genes involved in Signaling by constitutively active EGFR |
0.4 | 5.1 | REACTOME PYRIMIDINE CATABOLISM | Genes involved in Pyrimidine catabolism |
0.4 | 1.2 | REACTOME XENOBIOTICS | Genes involved in Xenobiotics |
0.4 | 1.4 | REACTOME ER PHAGOSOME PATHWAY | Genes involved in ER-Phagosome pathway |
0.3 | 5.8 | REACTOME SYNTHESIS OF BILE ACIDS AND BILE SALTS | Genes involved in Synthesis of bile acids and bile salts |
0.3 | 2.7 | REACTOME TRYPTOPHAN CATABOLISM | Genes involved in Tryptophan catabolism |
0.3 | 2.0 | REACTOME GLUCURONIDATION | Genes involved in Glucuronidation |
0.3 | 3.6 | REACTOME METABOLISM OF PORPHYRINS | Genes involved in Metabolism of porphyrins |
0.2 | 2.4 | REACTOME REGULATION OF RHEB GTPASE ACTIVITY BY AMPK | Genes involved in Regulation of Rheb GTPase activity by AMPK |
0.2 | 3.5 | REACTOME ANTIGEN PRESENTATION FOLDING ASSEMBLY AND PEPTIDE LOADING OF CLASS I MHC | Genes involved in Antigen Presentation: Folding, assembly and peptide loading of class I MHC |
0.2 | 3.0 | REACTOME DCC MEDIATED ATTRACTIVE SIGNALING | Genes involved in DCC mediated attractive signaling |
0.2 | 5.0 | REACTOME DARPP 32 EVENTS | Genes involved in DARPP-32 events |
0.2 | 0.8 | REACTOME ALPHA LINOLENIC ACID ALA METABOLISM | Genes involved in alpha-linolenic acid (ALA) metabolism |
0.2 | 2.9 | REACTOME SHC1 EVENTS IN ERBB4 SIGNALING | Genes involved in SHC1 events in ERBB4 signaling |
0.2 | 2.1 | REACTOME SYNTHESIS OF PIPS AT THE LATE ENDOSOME MEMBRANE | Genes involved in Synthesis of PIPs at the late endosome membrane |
0.2 | 5.7 | REACTOME REGULATION OF BETA CELL DEVELOPMENT | Genes involved in Regulation of beta-cell development |
0.2 | 1.3 | REACTOME ANDROGEN BIOSYNTHESIS | Genes involved in Androgen biosynthesis |
0.2 | 1.7 | REACTOME REGULATION OF INSULIN SECRETION BY ACETYLCHOLINE | Genes involved in Regulation of Insulin Secretion by Acetylcholine |
0.2 | 3.1 | REACTOME FATTY ACYL COA BIOSYNTHESIS | Genes involved in Fatty Acyl-CoA Biosynthesis |
0.2 | 7.6 | REACTOME NUCLEAR RECEPTOR TRANSCRIPTION PATHWAY | Genes involved in Nuclear Receptor transcription pathway |
0.2 | 2.0 | REACTOME PURINE SALVAGE | Genes involved in Purine salvage |
0.2 | 1.8 | REACTOME RAP1 SIGNALLING | Genes involved in Rap1 signalling |
0.2 | 1.3 | REACTOME CALNEXIN CALRETICULIN CYCLE | Genes involved in Calnexin/calreticulin cycle |
0.2 | 1.7 | REACTOME SIGNALING BY ACTIVATED POINT MUTANTS OF FGFR1 | Genes involved in Signaling by activated point mutants of FGFR1 |
0.1 | 0.6 | REACTOME NEGATIVE REGULATION OF THE PI3K AKT NETWORK | Genes involved in Negative regulation of the PI3K/AKT network |
0.1 | 6.2 | REACTOME PHASE II CONJUGATION | Genes involved in Phase II conjugation |
0.1 | 2.0 | REACTOME PROCESSING OF INTRONLESS PRE MRNAS | Genes involved in Processing of Intronless Pre-mRNAs |
0.1 | 2.6 | REACTOME MRNA 3 END PROCESSING | Genes involved in mRNA 3'-end processing |
0.1 | 2.1 | REACTOME AMINO ACID SYNTHESIS AND INTERCONVERSION TRANSAMINATION | Genes involved in Amino acid synthesis and interconversion (transamination) |
0.1 | 2.1 | REACTOME ABCA TRANSPORTERS IN LIPID HOMEOSTASIS | Genes involved in ABCA transporters in lipid homeostasis |
0.1 | 1.6 | REACTOME CASPASE MEDIATED CLEAVAGE OF CYTOSKELETAL PROTEINS | Genes involved in Caspase-mediated cleavage of cytoskeletal proteins |
0.1 | 2.3 | REACTOME TRIGLYCERIDE BIOSYNTHESIS | Genes involved in Triglyceride Biosynthesis |
0.1 | 0.9 | REACTOME REGULATION OF AMPK ACTIVITY VIA LKB1 | Genes involved in Regulation of AMPK activity via LKB1 |
0.1 | 0.6 | REACTOME DESTABILIZATION OF MRNA BY KSRP | Genes involved in Destabilization of mRNA by KSRP |
0.1 | 0.5 | REACTOME TRAF6 MEDIATED IRF7 ACTIVATION IN TLR7 8 OR 9 SIGNALING | Genes involved in TRAF6 mediated IRF7 activation in TLR7/8 or 9 signaling |
0.1 | 0.8 | REACTOME SIGNAL REGULATORY PROTEIN SIRP FAMILY INTERACTIONS | Genes involved in Signal regulatory protein (SIRP) family interactions |
0.1 | 17.8 | REACTOME METABOLISM OF AMINO ACIDS AND DERIVATIVES | Genes involved in Metabolism of amino acids and derivatives |
0.1 | 0.7 | REACTOME DESTABILIZATION OF MRNA BY AUF1 HNRNP D0 | Genes involved in Destabilization of mRNA by AUF1 (hnRNP D0) |
0.1 | 1.3 | REACTOME MRNA DECAY BY 3 TO 5 EXORIBONUCLEASE | Genes involved in mRNA Decay by 3' to 5' Exoribonuclease |
0.1 | 3.5 | REACTOME TRANSCRIPTIONAL ACTIVITY OF SMAD2 SMAD3 SMAD4 HETEROTRIMER | Genes involved in Transcriptional activity of SMAD2/SMAD3:SMAD4 heterotrimer |
0.1 | 2.1 | REACTOME CHOLESTEROL BIOSYNTHESIS | Genes involved in Cholesterol biosynthesis |
0.1 | 1.1 | REACTOME REGULATION OF IFNG SIGNALING | Genes involved in Regulation of IFNG signaling |
0.1 | 1.1 | REACTOME SYNTHESIS SECRETION AND INACTIVATION OF GIP | Genes involved in Synthesis, Secretion, and Inactivation of Glucose-dependent Insulinotropic Polypeptide (GIP) |
0.1 | 0.1 | REACTOME FORMATION OF TUBULIN FOLDING INTERMEDIATES BY CCT TRIC | Genes involved in Formation of tubulin folding intermediates by CCT/TriC |
0.1 | 2.0 | REACTOME INTERACTION BETWEEN L1 AND ANKYRINS | Genes involved in Interaction between L1 and Ankyrins |
0.1 | 0.6 | REACTOME PURINE CATABOLISM | Genes involved in Purine catabolism |
0.1 | 0.2 | REACTOME INFLUENZA VIRAL RNA TRANSCRIPTION AND REPLICATION | Genes involved in Influenza Viral RNA Transcription and Replication |
0.1 | 3.7 | REACTOME ACTIVATION OF CHAPERONE GENES BY XBP1S | Genes involved in Activation of Chaperone Genes by XBP1(S) |
0.1 | 0.5 | REACTOME G ALPHA S SIGNALLING EVENTS | Genes involved in G alpha (s) signalling events |
0.1 | 1.0 | REACTOME CTLA4 INHIBITORY SIGNALING | Genes involved in CTLA4 inhibitory signaling |
0.1 | 3.0 | REACTOME IL1 SIGNALING | Genes involved in Interleukin-1 signaling |
0.1 | 1.7 | REACTOME SMOOTH MUSCLE CONTRACTION | Genes involved in Smooth Muscle Contraction |
0.1 | 0.4 | REACTOME ACTIVATED AMPK STIMULATES FATTY ACID OXIDATION IN MUSCLE | Genes involved in Activated AMPK stimulates fatty-acid oxidation in muscle |
0.1 | 0.1 | REACTOME AUTODEGRADATION OF THE E3 UBIQUITIN LIGASE COP1 | Genes involved in Autodegradation of the E3 ubiquitin ligase COP1 |
0.1 | 1.2 | REACTOME REGULATION OF HYPOXIA INDUCIBLE FACTOR HIF BY OXYGEN | Genes involved in Regulation of Hypoxia-inducible Factor (HIF) by Oxygen |
0.1 | 0.6 | REACTOME G2 M DNA DAMAGE CHECKPOINT | Genes involved in G2/M DNA damage checkpoint |
0.1 | 1.2 | REACTOME SYNTHESIS OF SUBSTRATES IN N GLYCAN BIOSYTHESIS | Genes involved in Synthesis of substrates in N-glycan biosythesis |
0.1 | 0.7 | REACTOME ELEVATION OF CYTOSOLIC CA2 LEVELS | Genes involved in Elevation of cytosolic Ca2+ levels |
0.1 | 5.3 | REACTOME RESPIRATORY ELECTRON TRANSPORT | Genes involved in Respiratory electron transport |
0.1 | 0.4 | REACTOME RECYCLING OF BILE ACIDS AND SALTS | Genes involved in Recycling of bile acids and salts |
0.1 | 1.0 | REACTOME TGF BETA RECEPTOR SIGNALING IN EMT EPITHELIAL TO MESENCHYMAL TRANSITION | Genes involved in TGF-beta receptor signaling in EMT (epithelial to mesenchymal transition) |
0.1 | 0.7 | REACTOME PKB MEDIATED EVENTS | Genes involved in PKB-mediated events |
0.1 | 0.9 | REACTOME HIGHLY CALCIUM PERMEABLE POSTSYNAPTIC NICOTINIC ACETYLCHOLINE RECEPTORS | Genes involved in Highly calcium permeable postsynaptic nicotinic acetylcholine receptors |
0.1 | 0.3 | REACTOME NOREPINEPHRINE NEUROTRANSMITTER RELEASE CYCLE | Genes involved in Norepinephrine Neurotransmitter Release Cycle |
0.1 | 0.9 | REACTOME ASSOCIATION OF LICENSING FACTORS WITH THE PRE REPLICATIVE COMPLEX | Genes involved in Association of licensing factors with the pre-replicative complex |
0.1 | 0.3 | REACTOME JNK C JUN KINASES PHOSPHORYLATION AND ACTIVATION MEDIATED BY ACTIVATED HUMAN TAK1 | Genes involved in JNK (c-Jun kinases) phosphorylation and activation mediated by activated human TAK1 |
0.1 | 0.2 | REACTOME P75NTR RECRUITS SIGNALLING COMPLEXES | Genes involved in p75NTR recruits signalling complexes |
0.1 | 0.2 | REACTOME OLFACTORY SIGNALING PATHWAY | Genes involved in Olfactory Signaling Pathway |
0.1 | 1.1 | REACTOME SIGNALING BY NODAL | Genes involved in Signaling by NODAL |
0.1 | 3.3 | REACTOME MITOCHONDRIAL PROTEIN IMPORT | Genes involved in Mitochondrial Protein Import |
0.1 | 1.0 | REACTOME BIOSYNTHESIS OF THE N GLYCAN PRECURSOR DOLICHOL LIPID LINKED OLIGOSACCHARIDE LLO AND TRANSFER TO A NASCENT PROTEIN | Genes involved in Biosynthesis of the N-glycan precursor (dolichol lipid-linked oligosaccharide, LLO) and transfer to a nascent protein |
0.1 | 0.3 | REACTOME ABACAVIR TRANSPORT AND METABOLISM | Genes involved in Abacavir transport and metabolism |
0.1 | 0.8 | REACTOME NONSENSE MEDIATED DECAY ENHANCED BY THE EXON JUNCTION COMPLEX | Genes involved in Nonsense Mediated Decay Enhanced by the Exon Junction Complex |
0.1 | 2.0 | REACTOME IRON UPTAKE AND TRANSPORT | Genes involved in Iron uptake and transport |
0.1 | 0.5 | REACTOME SIGNAL ATTENUATION | Genes involved in Signal attenuation |
0.1 | 1.6 | REACTOME BIOLOGICAL OXIDATIONS | Genes involved in Biological oxidations |
0.1 | 1.6 | REACTOME COMPLEMENT CASCADE | Genes involved in Complement cascade |
0.1 | 1.6 | REACTOME ASSOCIATION OF TRIC CCT WITH TARGET PROTEINS DURING BIOSYNTHESIS | Genes involved in Association of TriC/CCT with target proteins during biosynthesis |
0.1 | 0.6 | REACTOME SIGNALING BY FGFR1 MUTANTS | Genes involved in Signaling by FGFR1 mutants |
0.1 | 0.2 | REACTOME SYNTHESIS OF PIPS AT THE EARLY ENDOSOME MEMBRANE | Genes involved in Synthesis of PIPs at the early endosome membrane |
0.1 | 1.1 | REACTOME CHONDROITIN SULFATE BIOSYNTHESIS | Genes involved in Chondroitin sulfate biosynthesis |
0.1 | 0.2 | REACTOME IL 6 SIGNALING | Genes involved in Interleukin-6 signaling |
0.1 | 1.7 | REACTOME CIRCADIAN CLOCK | Genes involved in Circadian Clock |
0.1 | 0.5 | REACTOME ACTIVATION OF BH3 ONLY PROTEINS | Genes involved in Activation of BH3-only proteins |
0.1 | 1.6 | REACTOME ASPARAGINE N LINKED GLYCOSYLATION | Genes involved in Asparagine N-linked glycosylation |
0.1 | 0.6 | REACTOME P2Y RECEPTORS | Genes involved in P2Y receptors |
0.1 | 2.0 | REACTOME GLUCOSE METABOLISM | Genes involved in Glucose metabolism |
0.0 | 0.5 | REACTOME REMOVAL OF THE FLAP INTERMEDIATE FROM THE C STRAND | Genes involved in Removal of the Flap Intermediate from the C-strand |
0.0 | 0.1 | REACTOME REGULATION OF WATER BALANCE BY RENAL AQUAPORINS | Genes involved in Regulation of Water Balance by Renal Aquaporins |
0.0 | 0.5 | REACTOME ACTIVATION OF RAC | Genes involved in Activation of Rac |
0.0 | 0.7 | REACTOME PRE NOTCH PROCESSING IN GOLGI | Genes involved in Pre-NOTCH Processing in Golgi |
0.0 | 0.6 | REACTOME MRNA DECAY BY 5 TO 3 EXORIBONUCLEASE | Genes involved in mRNA Decay by 5' to 3' Exoribonuclease |
0.0 | 0.2 | REACTOME PACKAGING OF TELOMERE ENDS | Genes involved in Packaging Of Telomere Ends |
0.0 | 0.0 | REACTOME POST NMDA RECEPTOR ACTIVATION EVENTS | Genes involved in Post NMDA receptor activation events |
0.0 | 1.0 | REACTOME MUSCLE CONTRACTION | Genes involved in Muscle contraction |
0.0 | 0.5 | REACTOME BILE SALT AND ORGANIC ANION SLC TRANSPORTERS | Genes involved in Bile salt and organic anion SLC transporters |
0.0 | 0.6 | REACTOME PREFOLDIN MEDIATED TRANSFER OF SUBSTRATE TO CCT TRIC | Genes involved in Prefoldin mediated transfer of substrate to CCT/TriC |
0.0 | 0.4 | REACTOME REGULATION OF SIGNALING BY CBL | Genes involved in Regulation of signaling by CBL |
0.0 | 0.5 | REACTOME PYRIMIDINE METABOLISM | Genes involved in Pyrimidine metabolism |
0.0 | 0.7 | REACTOME PRE NOTCH EXPRESSION AND PROCESSING | Genes involved in Pre-NOTCH Expression and Processing |
0.0 | 0.4 | REACTOME CELL EXTRACELLULAR MATRIX INTERACTIONS | Genes involved in Cell-extracellular matrix interactions |
0.0 | 0.1 | REACTOME FGFR1 LIGAND BINDING AND ACTIVATION | Genes involved in FGFR1 ligand binding and activation |
0.0 | 0.1 | REACTOME FORMATION OF TRANSCRIPTION COUPLED NER TC NER REPAIR COMPLEX | Genes involved in Formation of transcription-coupled NER (TC-NER) repair complex |
0.0 | 0.0 | REACTOME DOWNSTREAM TCR SIGNALING | Genes involved in Downstream TCR signaling |
0.0 | 0.8 | REACTOME MYOGENESIS | Genes involved in Myogenesis |
0.0 | 0.2 | REACTOME HORMONE LIGAND BINDING RECEPTORS | Genes involved in Hormone ligand-binding receptors |
0.0 | 0.0 | REACTOME PROCESSIVE SYNTHESIS ON THE LAGGING STRAND | Genes involved in Processive synthesis on the lagging strand |
0.0 | 0.4 | REACTOME PURINE METABOLISM | Genes involved in Purine metabolism |
0.0 | 0.5 | REACTOME RAS ACTIVATION UOPN CA2 INFUX THROUGH NMDA RECEPTOR | Genes involved in Ras activation uopn Ca2+ infux through NMDA receptor |
0.0 | 0.9 | REACTOME POST TRANSLATIONAL MODIFICATION SYNTHESIS OF GPI ANCHORED PROTEINS | Genes involved in Post-translational modification: synthesis of GPI-anchored proteins |
0.0 | 0.9 | REACTOME AMINE COMPOUND SLC TRANSPORTERS | Genes involved in Amine compound SLC transporters |
0.0 | 0.3 | REACTOME A TETRASACCHARIDE LINKER SEQUENCE IS REQUIRED FOR GAG SYNTHESIS | Genes involved in A tetrasaccharide linker sequence is required for GAG synthesis |
0.0 | 0.3 | REACTOME PD1 SIGNALING | Genes involved in PD-1 signaling |
0.0 | 0.7 | REACTOME DEPOSITION OF NEW CENPA CONTAINING NUCLEOSOMES AT THE CENTROMERE | Genes involved in Deposition of New CENPA-containing Nucleosomes at the Centromere |
0.0 | 0.4 | REACTOME GABA A RECEPTOR ACTIVATION | Genes involved in GABA A receptor activation |
0.0 | 0.5 | REACTOME FANCONI ANEMIA PATHWAY | Genes involved in Fanconi Anemia pathway |
0.0 | 1.1 | REACTOME RNA POL III TRANSCRIPTION | Genes involved in RNA Polymerase III Transcription |
0.0 | 0.8 | REACTOME KINESINS | Genes involved in Kinesins |
0.0 | 0.1 | REACTOME INTERACTIONS OF VPR WITH HOST CELLULAR PROTEINS | Genes involved in Interactions of Vpr with host cellular proteins |
0.0 | 0.1 | REACTOME PEPTIDE CHAIN ELONGATION | Genes involved in Peptide chain elongation |
0.0 | 2.6 | REACTOME CLASS B 2 SECRETIN FAMILY RECEPTORS | Genes involved in Class B/2 (Secretin family receptors) |
0.0 | 1.1 | REACTOME AMINE LIGAND BINDING RECEPTORS | Genes involved in Amine ligand-binding receptors |
0.0 | 0.6 | REACTOME HS GAG DEGRADATION | Genes involved in HS-GAG degradation |
0.0 | 0.6 | REACTOME MITOCHONDRIAL TRNA AMINOACYLATION | Genes involved in Mitochondrial tRNA aminoacylation |
0.0 | 0.6 | REACTOME ACTIVATION OF THE PRE REPLICATIVE COMPLEX | Genes involved in Activation of the pre-replicative complex |
0.0 | 0.9 | REACTOME MRNA SPLICING MINOR PATHWAY | Genes involved in mRNA Splicing - Minor Pathway |
0.0 | 0.1 | REACTOME LATENT INFECTION OF HOMO SAPIENS WITH MYCOBACTERIUM TUBERCULOSIS | Genes involved in Latent infection of Homo sapiens with Mycobacterium tuberculosis |
0.0 | 0.3 | REACTOME HDL MEDIATED LIPID TRANSPORT | Genes involved in HDL-mediated lipid transport |
0.0 | 0.1 | REACTOME CYCLIN E ASSOCIATED EVENTS DURING G1 S TRANSITION | Genes involved in Cyclin E associated events during G1/S transition |
0.0 | 1.5 | REACTOME ANTIVIRAL MECHANISM BY IFN STIMULATED GENES | Genes involved in Antiviral mechanism by IFN-stimulated genes |
0.0 | 0.5 | REACTOME FORMATION OF INCISION COMPLEX IN GG NER | Genes involved in Formation of incision complex in GG-NER |
0.0 | 0.4 | REACTOME NETRIN1 SIGNALING | Genes involved in Netrin-1 signaling |
0.0 | 0.2 | REACTOME DOWNREGULATION OF TGF BETA RECEPTOR SIGNALING | Genes involved in Downregulation of TGF-beta receptor signaling |
0.0 | 0.8 | REACTOME COLLAGEN FORMATION | Genes involved in Collagen formation |
0.0 | 0.0 | REACTOME CS DS DEGRADATION | Genes involved in CS/DS degradation |
0.0 | 0.2 | REACTOME PROSTANOID LIGAND RECEPTORS | Genes involved in Prostanoid ligand receptors |
0.0 | 0.1 | REACTOME SYNTHESIS SECRETION AND DEACYLATION OF GHRELIN | Genes involved in Synthesis, Secretion, and Deacylation of Ghrelin |
0.0 | 0.2 | REACTOME ACTIVATION OF NF KAPPAB IN B CELLS | Genes involved in Activation of NF-kappaB in B Cells |
0.0 | 0.2 | REACTOME KERATAN SULFATE DEGRADATION | Genes involved in Keratan sulfate degradation |
0.0 | 0.4 | REACTOME INSULIN SYNTHESIS AND PROCESSING | Genes involved in Insulin Synthesis and Processing |
0.0 | 0.3 | REACTOME SIGNALING BY BMP | Genes involved in Signaling by BMP |
0.0 | 1.8 | REACTOME SRP DEPENDENT COTRANSLATIONAL PROTEIN TARGETING TO MEMBRANE | Genes involved in SRP-dependent cotranslational protein targeting to membrane |
0.0 | 0.1 | REACTOME TRAFFICKING AND PROCESSING OF ENDOSOMAL TLR | Genes involved in Trafficking and processing of endosomal TLR |
0.0 | 0.1 | REACTOME INCRETIN SYNTHESIS SECRETION AND INACTIVATION | Genes involved in Incretin Synthesis, Secretion, and Inactivation |
0.0 | 0.3 | REACTOME THE ROLE OF NEF IN HIV1 REPLICATION AND DISEASE PATHOGENESIS | Genes involved in The role of Nef in HIV-1 replication and disease pathogenesis |
0.0 | 0.0 | REACTOME SEMA3A PLEXIN REPULSION SIGNALING BY INHIBITING INTEGRIN ADHESION | Genes involved in SEMA3A-Plexin repulsion signaling by inhibiting Integrin adhesion |
0.0 | 1.8 | REACTOME SIGNALING BY RHO GTPASES | Genes involved in Signaling by Rho GTPases |
0.0 | 0.2 | REACTOME DEADENYLATION OF MRNA | Genes involved in Deadenylation of mRNA |
0.0 | 0.3 | REACTOME HS GAG BIOSYNTHESIS | Genes involved in HS-GAG biosynthesis |
0.0 | 0.2 | REACTOME INHIBITION OF VOLTAGE GATED CA2 CHANNELS VIA GBETA GAMMA SUBUNITS | Genes involved in Inhibition of voltage gated Ca2+ channels via Gbeta/gamma subunits |
0.0 | 0.0 | REACTOME GRB2 EVENTS IN ERBB2 SIGNALING | Genes involved in GRB2 events in ERBB2 signaling |
0.0 | 0.6 | REACTOME LOSS OF NLP FROM MITOTIC CENTROSOMES | Genes involved in Loss of Nlp from mitotic centrosomes |
0.0 | 0.7 | REACTOME CHEMOKINE RECEPTORS BIND CHEMOKINES | Genes involved in Chemokine receptors bind chemokines |
0.0 | 0.4 | REACTOME MHC CLASS II ANTIGEN PRESENTATION | Genes involved in MHC class II antigen presentation |
0.0 | 0.2 | REACTOME TRAF6 MEDIATED IRF7 ACTIVATION | Genes involved in TRAF6 mediated IRF7 activation |
0.0 | 0.2 | REACTOME ABC FAMILY PROTEINS MEDIATED TRANSPORT | Genes involved in ABC-family proteins mediated transport |
0.0 | 1.5 | REACTOME PEPTIDE LIGAND BINDING RECEPTORS | Genes involved in Peptide ligand-binding receptors |
0.0 | 0.1 | REACTOME NEPHRIN INTERACTIONS | Genes involved in Nephrin interactions |
0.0 | 0.0 | REACTOME INHIBITION OF REPLICATION INITIATION OF DAMAGED DNA BY RB1 E2F1 | Genes involved in Inhibition of replication initiation of damaged DNA by RB1/E2F1 |
0.0 | 0.2 | REACTOME RNA POL I RNA POL III AND MITOCHONDRIAL TRANSCRIPTION | Genes involved in RNA Polymerase I, RNA Polymerase III, and Mitochondrial Transcription |
0.0 | 0.1 | REACTOME MITOCHONDRIAL FATTY ACID BETA OXIDATION | Genes involved in Mitochondrial Fatty Acid Beta-Oxidation |
0.0 | 0.0 | REACTOME G BETA GAMMA SIGNALLING THROUGH PI3KGAMMA | Genes involved in G beta:gamma signalling through PI3Kgamma |
0.0 | 0.1 | REACTOME EXTRINSIC PATHWAY FOR APOPTOSIS | Genes involved in Extrinsic Pathway for Apoptosis |
0.0 | 0.1 | REACTOME LIGAND GATED ION CHANNEL TRANSPORT | Genes involved in Ligand-gated ion channel transport |