Gene Symbol | Gene ID | Gene Info |
---|---|---|
Hmbox1
|
ENSMUSG00000021972.8 | Hmbox1 |
Gene | Promoter | Distance | Association probability | Pearson corr. coef. | P-value | Plot |
---|---|---|---|---|---|---|
Hmbox1 | chr14_64948957_64949215 | 546 | 0.610373 | 0.83 | 3.9e-02 | Click! |
Hmbox1 | chr14_64948794_64948945 | 763 | 0.512647 | 0.48 | 3.3e-01 | Click! |
Hmbox1 | chr14_64884762_64884937 | 18417 | 0.154876 | -0.26 | 6.2e-01 | Click! |
Move your cursor over a bar to see sample name and corresponding Z-value.
Cis Regulatory Element (CRE) | Target Score | Top associated gene | Gene Info | Distance of CRE to TSS | CRE/Gene association probability |
---|---|---|---|---|---|
chr13_109485029_109485208 | 3.83 |
Pde4d |
phosphodiesterase 4D, cAMP specific |
42935 |
0.21 |
chr3_51247481_51247632 | 2.64 |
Noct |
nocturnin |
4148 |
0.15 |
chr2_154875946_154876097 | 2.63 |
Eif2s2 |
eukaryotic translation initiation factor 2, subunit 2 (beta) |
16761 |
0.19 |
chr19_40155227_40155577 | 2.45 |
Cyp2c70 |
cytochrome P450, family 2, subfamily c, polypeptide 70 |
31884 |
0.13 |
chr8_110621328_110621479 | 1.87 |
Vac14 |
Vac14 homolog (S. cerevisiae) |
2791 |
0.29 |
chr16_43168807_43168974 | 1.85 |
Gm15712 |
predicted gene 15712 |
15683 |
0.21 |
chr15_6891349_6891647 | 1.64 |
Osmr |
oncostatin M receptor |
16529 |
0.26 |
chr6_149225033_149225369 | 1.62 |
1700003I16Rik |
RIKEN cDNA 1700003I16 gene |
10016 |
0.16 |
chr19_40191699_40191928 | 1.58 |
Gm5827 |
predicted gene 5827 |
775 |
0.57 |
chr19_26823641_26823967 | 1.56 |
4931403E22Rik |
RIKEN cDNA 4931403E22 gene |
103 |
0.97 |
chr11_16807426_16807582 | 1.55 |
Egfros |
epidermal growth factor receptor, opposite strand |
23198 |
0.19 |
chr1_100298140_100298304 | 1.54 |
Gm29667 |
predicted gene 29667 |
15431 |
0.18 |
chr11_16763486_16763658 | 1.47 |
Egfr |
epidermal growth factor receptor |
11342 |
0.2 |
chr11_16828832_16828991 | 1.46 |
Egfros |
epidermal growth factor receptor, opposite strand |
1791 |
0.4 |
chr18_76968080_76968231 | 1.45 |
Hdhd2 |
haloacid dehalogenase-like hydrolase domain containing 2 |
23718 |
0.15 |
chr2_113503793_113503980 | 1.34 |
Gm13964 |
predicted gene 13964 |
148 |
0.96 |
chr15_3557826_3558003 | 1.33 |
Ghr |
growth hormone receptor |
23928 |
0.22 |
chr2_71607608_71607769 | 1.31 |
Dlx2 |
distal-less homeobox 2 |
60934 |
0.09 |
chr18_33433732_33433917 | 1.28 |
Nrep |
neuronal regeneration related protein |
29611 |
0.17 |
chr2_109488302_109488457 | 1.27 |
Gm13925 |
predicted gene 13925 |
11376 |
0.23 |
chr7_44299592_44299763 | 1.25 |
Gm7238 |
predicted gene 7238 |
1210 |
0.18 |
chr10_111318102_111318256 | 1.24 |
Gm40761 |
predicted gene, 40761 |
18945 |
0.17 |
chr16_49775651_49775805 | 1.24 |
Gm15518 |
predicted gene 15518 |
23142 |
0.2 |
chr18_39301316_39301496 | 1.22 |
Gm15336 |
predicted gene 15336 |
1284 |
0.46 |
chr8_76147788_76147939 | 1.22 |
Gm45742 |
predicted gene 45742 |
30836 |
0.21 |
chr1_67111462_67111613 | 1.21 |
Cps1 |
carbamoyl-phosphate synthetase 1 |
11489 |
0.23 |
chr8_93183570_93183871 | 1.20 |
Gm45909 |
predicted gene 45909 |
7638 |
0.14 |
chr1_97770980_97771325 | 1.19 |
Ppip5k2 |
diphosphoinositol pentakisphosphate kinase 2 |
741 |
0.49 |
chr19_37441817_37441985 | 1.19 |
Hhex |
hematopoietically expressed homeobox |
5162 |
0.13 |
chr5_130026986_130027142 | 1.19 |
Asl |
argininosuccinate lyase |
2045 |
0.2 |
chr10_111484318_111484665 | 1.18 |
Gm25117 |
predicted gene, 25117 |
2998 |
0.18 |
chr5_89248417_89248629 | 1.18 |
Gc |
vitamin D binding protein |
187105 |
0.03 |
chr1_21262754_21263025 | 1.17 |
Gm28836 |
predicted gene 28836 |
8704 |
0.11 |
chr10_4618857_4619069 | 1.16 |
Esr1 |
estrogen receptor 1 (alpha) |
6942 |
0.24 |
chr2_58771100_58771251 | 1.15 |
Upp2 |
uridine phosphorylase 2 |
5850 |
0.22 |
chr7_45706938_45707229 | 1.14 |
Dbp |
D site albumin promoter binding protein |
21 |
0.92 |
chr2_52604201_52604484 | 1.13 |
Bloc1s2-ps |
biogenesis of lysosomal organelles complex-1, subunit 2, pseudogene |
15412 |
0.2 |
chr18_13230144_13230474 | 1.12 |
Gm22251 |
predicted gene, 22251 |
20501 |
0.21 |
chr2_160805166_160805505 | 1.12 |
Gm11447 |
predicted gene 11447 |
40278 |
0.11 |
chr5_92507992_92508173 | 1.10 |
Scarb2 |
scavenger receptor class B, member 2 |
1249 |
0.42 |
chr13_45717276_45717427 | 1.09 |
Gm47460 |
predicted gene, 47460 |
32221 |
0.22 |
chr5_125348811_125348962 | 1.08 |
Scarb1 |
scavenger receptor class B, member 1 |
7792 |
0.13 |
chr8_114154369_114154520 | 1.07 |
Nudt7 |
nudix (nucleoside diphosphate linked moiety X)-type motif 7 |
20802 |
0.24 |
chr2_58773576_58773851 | 1.05 |
Upp2 |
uridine phosphorylase 2 |
8388 |
0.21 |
chr2_118305935_118306086 | 1.04 |
1700054M17Rik |
RIKEN cDNA 1700054M17 gene |
1096 |
0.42 |
chr2_113609885_113610036 | 1.04 |
Fmn1 |
formin 1 |
75130 |
0.09 |
chr7_4815156_4815311 | 1.03 |
Ube2s |
ubiquitin-conjugating enzyme E2S |
2643 |
0.11 |
chr9_55253735_55254087 | 1.03 |
Nrg4 |
neuregulin 4 |
11450 |
0.18 |
chr1_67152094_67152459 | 1.03 |
Cps1 |
carbamoyl-phosphate synthetase 1 |
29250 |
0.19 |
chr14_75309433_75309600 | 1.03 |
Zc3h13 |
zinc finger CCCH type containing 13 |
25130 |
0.14 |
chr8_93189262_93189430 | 1.01 |
Gm45909 |
predicted gene 45909 |
2012 |
0.24 |
chr8_41093193_41093373 | 1.01 |
Mtus1 |
mitochondrial tumor suppressor 1 |
10507 |
0.19 |
chr19_44396138_44396537 | 1.01 |
Scd1 |
stearoyl-Coenzyme A desaturase 1 |
10353 |
0.14 |
chr13_48542783_48542935 | 1.01 |
Gm37238 |
predicted gene, 37238 |
2174 |
0.14 |
chr3_133740753_133740929 | 1.00 |
Gm6135 |
prediticted gene 6135 |
50663 |
0.13 |
chr15_39800572_39800726 | 1.00 |
Gm16291 |
predicted gene 16291 |
3604 |
0.24 |
chr1_88491899_88492050 | 1.00 |
Glrp1 |
glutamine repeat protein 1 |
18092 |
0.14 |
chr2_73910165_73910316 | 1.00 |
Atp5g3 |
ATP synthase, H+ transporting, mitochondrial F0 complex, subunit C3 (subunit 9) |
219 |
0.94 |
chr12_32689350_32689600 | 1.00 |
Gm47937 |
predicted gene, 47937 |
16181 |
0.2 |
chr6_72360016_72360452 | 0.99 |
Rnf181 |
ring finger protein 181 |
833 |
0.41 |
chr9_74702140_74702734 | 0.99 |
Gm27233 |
predicted gene 27233 |
6825 |
0.25 |
chr9_44412200_44412351 | 0.99 |
Ccdc84 |
coiled-coil domain containing 84 |
836 |
0.27 |
chr10_87905188_87905714 | 0.99 |
Igf1os |
insulin-like growth factor 1, opposite strand |
42070 |
0.13 |
chr19_29520832_29521011 | 0.98 |
A930007I19Rik |
RIKEN cDNA A930007I19 gene |
49 |
0.96 |
chr18_81321681_81321954 | 0.98 |
Gm30192 |
predicted gene, 30192 |
57109 |
0.13 |
chr1_88200499_88200650 | 0.98 |
Ugt1a2 |
UDP glucuronosyltransferase 1 family, polypeptide A2 |
27 |
0.93 |
chr3_152392533_152392710 | 0.98 |
Gm43857 |
predicted gene 43857 |
1619 |
0.22 |
chr10_62590569_62590741 | 0.98 |
Ddx21 |
DEAD (Asp-Glu-Ala-Asp) box polypeptide 21 |
316 |
0.82 |
chr19_21487847_21488062 | 0.97 |
Gda |
guanine deaminase |
14509 |
0.24 |
chr9_106263078_106263246 | 0.96 |
Alas1 |
aminolevulinic acid synthase 1 |
14508 |
0.1 |
chr9_35108621_35109370 | 0.95 |
St3gal4 |
ST3 beta-galactoside alpha-2,3-sialyltransferase 4 |
2328 |
0.23 |
chr1_67185796_67186060 | 0.95 |
Cps1 |
carbamoyl-phosphate synthetase 1 |
62902 |
0.11 |
chr13_64109009_64109160 | 0.94 |
Slc35d2 |
solute carrier family 35, member D2 |
1921 |
0.26 |
chr2_65233979_65234271 | 0.94 |
Cobll1 |
Cobl-like 1 |
1870 |
0.32 |
chr8_56222518_56222880 | 0.94 |
Hpgd |
hydroxyprostaglandin dehydrogenase 15 (NAD) |
71886 |
0.11 |
chr5_150918259_150918412 | 0.94 |
Kl |
klotho |
34272 |
0.15 |
chr3_95865315_95865481 | 0.94 |
Mrps21 |
mitochondrial ribosomal protein S21 |
2091 |
0.14 |
chr14_7835643_7835894 | 0.93 |
Flnb |
filamin, beta |
17811 |
0.15 |
chr5_40691990_40692141 | 0.93 |
Gm23022 |
predicted gene, 23022 |
286136 |
0.01 |
chr11_72683212_72683363 | 0.93 |
Ankfy1 |
ankyrin repeat and FYVE domain containing 1 |
6719 |
0.18 |
chr16_43348317_43348468 | 0.92 |
Zbtb20 |
zinc finger and BTB domain containing 20 |
14656 |
0.16 |
chr2_7579195_7579400 | 0.92 |
Gm28641 |
predicted gene 28641 |
49358 |
0.15 |
chr18_33377697_33377885 | 0.92 |
Gm5503 |
predicted gene 5503 |
7164 |
0.27 |
chr9_120944823_120944974 | 0.91 |
Ctnnb1 |
catenin (cadherin associated protein), beta 1 |
5323 |
0.12 |
chr7_63922331_63923024 | 0.90 |
Klf13 |
Kruppel-like factor 13 |
2193 |
0.22 |
chr5_74401642_74401799 | 0.90 |
Scfd2 |
Sec1 family domain containing 2 |
3982 |
0.2 |
chr1_67160568_67161028 | 0.90 |
Cps1 |
carbamoyl-phosphate synthetase 1 |
37772 |
0.17 |
chr11_72428551_72428702 | 0.90 |
Ggt6 |
gamma-glutamyltransferase 6 |
6900 |
0.13 |
chr8_64841191_64841342 | 0.90 |
Klhl2 |
kelch-like 2, Mayven |
931 |
0.49 |
chr15_62744235_62744424 | 0.89 |
Gm22521 |
predicted gene, 22521 |
48872 |
0.17 |
chr19_60569461_60569621 | 0.89 |
Gm25238 |
predicted gene, 25238 |
10988 |
0.18 |
chr10_87869244_87869395 | 0.89 |
Igf1os |
insulin-like growth factor 1, opposite strand |
5938 |
0.21 |
chr17_45142866_45143017 | 0.88 |
Gm35097 |
predicted gene, 35097 |
4296 |
0.25 |
chr19_37508152_37508497 | 0.88 |
Exoc6 |
exocyst complex component 6 |
12555 |
0.16 |
chr19_44398583_44398737 | 0.88 |
Scd1 |
stearoyl-Coenzyme A desaturase 1 |
8030 |
0.15 |
chr19_10065731_10065889 | 0.88 |
Fads2 |
fatty acid desaturase 2 |
5377 |
0.14 |
chr17_86297254_86297563 | 0.87 |
2010106C02Rik |
RIKEN cDNA 2010106C02 gene |
10230 |
0.28 |
chr15_59073137_59073480 | 0.87 |
Mtss1 |
MTSS I-BAR domain containing 1 |
8681 |
0.24 |
chr7_115858420_115858571 | 0.87 |
Sox6 |
SRY (sex determining region Y)-box 6 |
1357 |
0.57 |
chr16_93879741_93879893 | 0.87 |
Chaf1b |
chromatin assembly factor 1, subunit B (p60) |
4084 |
0.16 |
chr4_10854377_10854556 | 0.87 |
Gm12919 |
predicted gene 12919 |
623 |
0.61 |
chr19_44405361_44405580 | 0.86 |
Scd1 |
stearoyl-Coenzyme A desaturase 1 |
1220 |
0.39 |
chr14_49101182_49101371 | 0.86 |
Rpl19-ps3 |
ribosomal protein L19, pseudogene 3 |
11522 |
0.15 |
chr18_61565513_61565694 | 0.85 |
Csnk1a1 |
casein kinase 1, alpha 1 |
9914 |
0.15 |
chr1_67157281_67157463 | 0.85 |
Cps1 |
carbamoyl-phosphate synthetase 1 |
34346 |
0.18 |
chr7_72506151_72506311 | 0.85 |
Gm37620 |
predicted gene, 37620 |
95758 |
0.07 |
chr8_28274573_28274732 | 0.85 |
Gm8100 |
predicted gene 8100 |
88812 |
0.09 |
chr2_4895714_4895931 | 0.85 |
Sephs1 |
selenophosphate synthetase 1 |
11438 |
0.15 |
chr9_49365685_49366095 | 0.85 |
Drd2 |
dopamine receptor D2 |
25263 |
0.2 |
chr16_70333428_70333579 | 0.85 |
Gbe1 |
glucan (1,4-alpha-), branching enzyme 1 |
19369 |
0.24 |
chr4_80915957_80916221 | 0.85 |
Lurap1l |
leucine rich adaptor protein 1-like |
5443 |
0.28 |
chr2_58791427_58791720 | 0.84 |
Upp2 |
uridine phosphorylase 2 |
26248 |
0.18 |
chr8_93165469_93165620 | 0.84 |
Ces1d |
carboxylesterase 1D |
4431 |
0.16 |
chr1_51884671_51884822 | 0.84 |
Gm28323 |
predicted gene 28323 |
5138 |
0.17 |
chr9_84497400_84497569 | 0.84 |
Gm8226 |
predicted gene 8226 |
73500 |
0.1 |
chr12_57317079_57317230 | 0.84 |
Mipol1 |
mirror-image polydactyly 1 |
11071 |
0.22 |
chr18_7657901_7658087 | 0.83 |
Mpp7 |
membrane protein, palmitoylated 7 (MAGUK p55 subfamily member 7) |
31128 |
0.17 |
chr8_76152735_76152886 | 0.83 |
Gm45742 |
predicted gene 45742 |
35783 |
0.19 |
chr12_32692767_32692945 | 0.83 |
Gm18726 |
predicted gene, 18726 |
17305 |
0.2 |
chr7_43447889_43448043 | 0.83 |
Gm44816 |
predicted gene 44816 |
107 |
0.89 |
chr14_118008711_118008863 | 0.83 |
Dct |
dopachrome tautomerase |
18748 |
0.19 |
chr18_12663657_12663965 | 0.82 |
Gm41668 |
predicted gene, 41668 |
15392 |
0.14 |
chr18_31704198_31704968 | 0.82 |
Gm50060 |
predicted gene, 50060 |
34132 |
0.13 |
chr1_51750897_51751126 | 0.82 |
Gm28055 |
predicted gene 28055 |
4068 |
0.24 |
chr9_122155279_122155437 | 0.82 |
Snrk |
SNF related kinase |
4714 |
0.14 |
chr1_105115697_105115898 | 0.81 |
Gm29012 |
predicted gene 29012 |
657 |
0.8 |
chr13_96960473_96960682 | 0.81 |
Gm48597 |
predicted gene, 48597 |
9663 |
0.17 |
chr3_148762124_148762275 | 0.81 |
Adgrl2 |
adhesion G protein-coupled receptor L2 |
60780 |
0.14 |
chr1_51512729_51512893 | 0.81 |
Gm17767 |
predicted gene, 17767 |
482 |
0.8 |
chr2_20921163_20921333 | 0.81 |
Arhgap21 |
Rho GTPase activating protein 21 |
6554 |
0.21 |
chr1_67224825_67225329 | 0.81 |
Gm15668 |
predicted gene 15668 |
24123 |
0.2 |
chr11_98952721_98953079 | 0.81 |
Gm22061 |
predicted gene, 22061 |
6456 |
0.11 |
chr19_36803721_36803904 | 0.80 |
Gm50112 |
predicted gene, 50112 |
14836 |
0.19 |
chr14_26498856_26499026 | 0.80 |
Gm24031 |
predicted gene, 24031 |
1286 |
0.37 |
chr19_40160205_40160356 | 0.80 |
Cyp2c70 |
cytochrome P450, family 2, subfamily c, polypeptide 70 |
27006 |
0.14 |
chr3_69114661_69115067 | 0.80 |
Gm37558 |
predicted gene, 37558 |
7860 |
0.14 |
chr17_64762423_64762574 | 0.80 |
Dreh |
down-regulated in hepatocellular carcinoma |
4613 |
0.22 |
chrX_164281566_164281717 | 0.80 |
Gm22023 |
predicted gene, 22023 |
1455 |
0.35 |
chr1_21259122_21259550 | 0.79 |
Gsta3 |
glutathione S-transferase, alpha 3 |
5815 |
0.12 |
chr13_111286883_111287046 | 0.79 |
Actbl2 |
actin, beta-like 2 |
31951 |
0.16 |
chr7_141484605_141484759 | 0.79 |
Tspan4 |
tetraspanin 4 |
2618 |
0.1 |
chr11_16914232_16914438 | 0.79 |
Egfr |
epidermal growth factor receptor |
9150 |
0.18 |
chr2_48981052_48981464 | 0.79 |
Orc4 |
origin recognition complex, subunit 4 |
30981 |
0.18 |
chr8_126941902_126942080 | 0.79 |
Gm26397 |
predicted gene, 26397 |
2989 |
0.19 |
chr1_67204437_67204883 | 0.78 |
Gm15668 |
predicted gene 15668 |
44540 |
0.15 |
chr2_58769167_58769346 | 0.78 |
Upp2 |
uridine phosphorylase 2 |
3931 |
0.25 |
chr18_5010031_5010219 | 0.78 |
Svil |
supervillin |
15189 |
0.28 |
chr1_160374893_160375064 | 0.77 |
Rabgap1l |
RAB GTPase activating protein 1-like |
23407 |
0.16 |
chr15_3485798_3486132 | 0.77 |
Ghr |
growth hormone receptor |
14321 |
0.27 |
chr17_62785717_62785868 | 0.77 |
Efna5 |
ephrin A5 |
95352 |
0.09 |
chr6_54604439_54604594 | 0.77 |
Plekha8 |
pleckstrin homology domain containing, family A (phosphoinositide binding specific) member 8 |
1369 |
0.39 |
chr2_72204001_72204398 | 0.77 |
Rapgef4 |
Rap guanine nucleotide exchange factor (GEF) 4 |
5400 |
0.2 |
chr1_21249439_21249644 | 0.77 |
Gsta3 |
glutathione S-transferase, alpha 3 |
3980 |
0.13 |
chr14_21261451_21261651 | 0.77 |
Adk |
adenosine kinase |
56574 |
0.15 |
chr4_19491749_19492137 | 0.77 |
Cpne3 |
copine III |
51735 |
0.15 |
chr3_62392302_62392453 | 0.76 |
Arhgef26 |
Rho guanine nucleotide exchange factor (GEF) 26 |
27291 |
0.21 |
chr15_59050746_59050916 | 0.76 |
Mtss1 |
MTSS I-BAR domain containing 1 |
4633 |
0.25 |
chr7_126932811_126932965 | 0.76 |
Kctd13 |
potassium channel tetramerisation domain containing 13 |
2967 |
0.08 |
chr8_105860024_105860213 | 0.76 |
4930578M07Rik |
RIKEN cDNA 4930578M07 gene |
196 |
0.7 |
chr9_32096539_32096832 | 0.76 |
Gm47496 |
predicted gene, 47496 |
18404 |
0.14 |
chr5_106224440_106224591 | 0.76 |
Gm5987 |
predicted gene 5987 |
8864 |
0.21 |
chr7_84129291_84129727 | 0.76 |
Abhd17c |
abhydrolase domain containing 17C |
18306 |
0.14 |
chr6_108666832_108666993 | 0.75 |
Bhlhe40 |
basic helix-loop-helix family, member e40 |
3866 |
0.19 |
chr10_89467947_89468098 | 0.75 |
Gas2l3 |
growth arrest-specific 2 like 3 |
24055 |
0.19 |
chr19_10073013_10073203 | 0.75 |
Fads2 |
fatty acid desaturase 2 |
1921 |
0.25 |
chr11_16856758_16857153 | 0.75 |
Egfr |
epidermal growth factor receptor |
21195 |
0.18 |
chr6_71992086_71992364 | 0.75 |
Gm26628 |
predicted gene, 26628 |
28450 |
0.11 |
chr16_4624090_4624245 | 0.75 |
Pam16 |
presequence translocase-asssociated motor 16 homolog (S. cerevisiae) |
739 |
0.51 |
chr14_34323242_34323393 | 0.75 |
Glud1 |
glutamate dehydrogenase 1 |
5345 |
0.11 |
chr10_68109295_68109446 | 0.75 |
Arid5b |
AT rich interactive domain 5B (MRF1-like) |
27256 |
0.2 |
chr5_125520831_125520982 | 0.75 |
Aacs |
acetoacetyl-CoA synthetase |
5663 |
0.17 |
chr5_129948581_129948919 | 0.75 |
Gm42986 |
predicted gene 42986 |
3170 |
0.14 |
chrX_42198771_42199059 | 0.75 |
Stag2 |
stromal antigen 2 |
46735 |
0.14 |
chr6_14778417_14778568 | 0.75 |
Ppp1r3a |
protein phosphatase 1, regulatory subunit 3A |
23218 |
0.27 |
chr15_59005788_59005947 | 0.75 |
4930544F09Rik |
RIKEN cDNA 4930544F09 gene |
21731 |
0.16 |
chr15_3512657_3512808 | 0.75 |
Ghr |
growth hormone receptor |
41088 |
0.19 |
chr8_90829727_90829881 | 0.74 |
Chd9 |
chromodomain helicase DNA binding protein 9 |
948 |
0.46 |
chr2_34774806_34775255 | 0.74 |
Hspa5 |
heat shock protein 5 |
183 |
0.92 |
chrX_140591571_140591781 | 0.74 |
AL683809.1 |
TSC22 domain family, member 3 (Tsc22d3), pseuodgene |
8077 |
0.17 |
chr3_51253474_51253774 | 0.74 |
Elf2 |
E74-like factor 2 |
6617 |
0.13 |
chr4_106985758_106985928 | 0.74 |
Ssbp3 |
single-stranded DNA binding protein 3 |
19417 |
0.16 |
chr13_119390016_119390216 | 0.73 |
Nnt |
nicotinamide nucleotide transhydrogenase |
18836 |
0.17 |
chr6_148211201_148211366 | 0.73 |
Ergic2 |
ERGIC and golgi 2 |
694 |
0.49 |
chr15_35886635_35886786 | 0.73 |
Vps13b |
vacuolar protein sorting 13B |
14988 |
0.16 |
chr17_46054574_46054727 | 0.73 |
Vegfa |
vascular endothelial growth factor A |
22281 |
0.12 |
chr9_48599126_48599309 | 0.73 |
Nnmt |
nicotinamide N-methyltransferase |
1768 |
0.43 |
chr8_101350931_101351097 | 0.73 |
Gm22223 |
predicted gene, 22223 |
188694 |
0.03 |
chr8_105090034_105090185 | 0.73 |
Ces3b |
carboxylesterase 3B |
1490 |
0.25 |
chr2_72195124_72195563 | 0.73 |
Rapgef4 |
Rap guanine nucleotide exchange factor (GEF) 4 |
3456 |
0.24 |
chr8_125495417_125495585 | 0.72 |
Sipa1l2 |
signal-induced proliferation-associated 1 like 2 |
2791 |
0.37 |
chr2_134928284_134928464 | 0.72 |
Gm14036 |
predicted gene 14036 |
124425 |
0.06 |
chr3_18461158_18461350 | 0.72 |
Gm30667 |
predicted gene, 30667 |
0 |
0.98 |
chr17_79888857_79889045 | 0.72 |
Atl2 |
atlastin GTPase 2 |
7100 |
0.18 |
chr15_3470811_3471138 | 0.72 |
Ghr |
growth hormone receptor |
670 |
0.81 |
chr2_37696705_37696856 | 0.72 |
Strbp |
spermatid perinuclear RNA binding protein |
6369 |
0.16 |
chr15_59012700_59012907 | 0.72 |
Mtss1 |
MTSS I-BAR domain containing 1 |
27793 |
0.15 |
chr7_26781568_26782082 | 0.72 |
Cyp2b19 |
cytochrome P450, family 2, subfamily b, polypeptide 19 |
15270 |
0.15 |
chr10_4731451_4731623 | 0.72 |
Esr1 |
estrogen receptor 1 (alpha) |
18886 |
0.26 |
chr2_27213804_27214180 | 0.71 |
Sardh |
sarcosine dehydrogenase |
1640 |
0.3 |
chr15_97022020_97022207 | 0.71 |
Slc38a4 |
solute carrier family 38, member 4 |
1791 |
0.47 |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
1.1 | 3.3 | GO:1903800 | positive regulation of production of miRNAs involved in gene silencing by miRNA(GO:1903800) |
0.8 | 2.5 | GO:1901078 | negative regulation of relaxation of muscle(GO:1901078) |
0.7 | 2.8 | GO:0046449 | creatinine metabolic process(GO:0046449) cellular lactam metabolic process(GO:0072338) |
0.6 | 3.6 | GO:0006526 | arginine biosynthetic process(GO:0006526) |
0.5 | 1.4 | GO:0019626 | short-chain fatty acid catabolic process(GO:0019626) |
0.5 | 1.9 | GO:2001013 | epithelial cell proliferation involved in renal tubule morphogenesis(GO:2001013) |
0.3 | 0.6 | GO:0070672 | response to interleukin-15(GO:0070672) |
0.3 | 0.9 | GO:2000211 | regulation of glutamate metabolic process(GO:2000211) |
0.3 | 0.3 | GO:1900825 | regulation of membrane depolarization during cardiac muscle cell action potential(GO:1900825) |
0.3 | 1.8 | GO:0060526 | prostate glandular acinus morphogenesis(GO:0060526) prostate epithelial cord arborization involved in prostate glandular acinus morphogenesis(GO:0060527) |
0.3 | 1.0 | GO:2000741 | positive regulation of mesenchymal stem cell differentiation(GO:2000741) |
0.2 | 1.0 | GO:1903964 | monounsaturated fatty acid metabolic process(GO:1903964) monounsaturated fatty acid biosynthetic process(GO:1903966) |
0.2 | 1.2 | GO:0050882 | voluntary musculoskeletal movement(GO:0050882) |
0.2 | 0.7 | GO:0097118 | neuroligin clustering involved in postsynaptic membrane assembly(GO:0097118) |
0.2 | 2.6 | GO:0009404 | toxin metabolic process(GO:0009404) |
0.2 | 1.2 | GO:2000324 | positive regulation of glucocorticoid receptor signaling pathway(GO:2000324) |
0.2 | 0.6 | GO:0006068 | ethanol catabolic process(GO:0006068) |
0.2 | 0.6 | GO:0060620 | regulation of cholesterol import(GO:0060620) regulation of sterol import(GO:2000909) |
0.2 | 0.6 | GO:0021553 | olfactory nerve development(GO:0021553) |
0.2 | 0.8 | GO:0006987 | activation of signaling protein activity involved in unfolded protein response(GO:0006987) |
0.2 | 0.8 | GO:0006538 | glutamate catabolic process(GO:0006538) |
0.2 | 0.8 | GO:0006407 | rRNA export from nucleus(GO:0006407) |
0.2 | 0.8 | GO:0006931 | substrate-dependent cell migration, cell attachment to substrate(GO:0006931) |
0.2 | 0.6 | GO:0043490 | malate-aspartate shuttle(GO:0043490) |
0.2 | 0.2 | GO:0046121 | deoxyribonucleoside catabolic process(GO:0046121) |
0.2 | 0.5 | GO:1900245 | positive regulation of MDA-5 signaling pathway(GO:1900245) |
0.2 | 0.7 | GO:0038165 | oncostatin-M-mediated signaling pathway(GO:0038165) |
0.2 | 0.3 | GO:0046271 | phenylpropanoid metabolic process(GO:0009698) phenylpropanoid catabolic process(GO:0046271) |
0.2 | 0.3 | GO:1904017 | response to Thyroglobulin triiodothyronine(GO:1904016) cellular response to Thyroglobulin triiodothyronine(GO:1904017) |
0.2 | 1.0 | GO:0045647 | negative regulation of erythrocyte differentiation(GO:0045647) |
0.2 | 0.5 | GO:0002071 | glandular epithelial cell maturation(GO:0002071) |
0.2 | 0.5 | GO:1904154 | positive regulation of retrograde protein transport, ER to cytosol(GO:1904154) |
0.2 | 0.8 | GO:0061316 | canonical Wnt signaling pathway involved in heart development(GO:0061316) |
0.2 | 1.0 | GO:0071447 | cellular response to hydroperoxide(GO:0071447) |
0.2 | 0.5 | GO:0061010 | gall bladder development(GO:0061010) |
0.2 | 1.4 | GO:0052697 | xenobiotic glucuronidation(GO:0052697) |
0.2 | 0.2 | GO:0031087 | nuclear-transcribed mRNA catabolic process, deadenylation-independent decay(GO:0031086) deadenylation-independent decapping of nuclear-transcribed mRNA(GO:0031087) |
0.2 | 0.5 | GO:0060687 | regulation of branching involved in prostate gland morphogenesis(GO:0060687) |
0.1 | 0.6 | GO:0033353 | S-adenosylmethionine cycle(GO:0033353) |
0.1 | 0.3 | GO:0032439 | endosome localization(GO:0032439) |
0.1 | 0.1 | GO:1902688 | regulation of fermentation(GO:0043465) regulation of NAD metabolic process(GO:1902688) regulation of glucose catabolic process to lactate via pyruvate(GO:1904023) |
0.1 | 0.4 | GO:0009730 | detection of carbohydrate stimulus(GO:0009730) detection of hexose stimulus(GO:0009732) detection of monosaccharide stimulus(GO:0034287) detection of glucose(GO:0051594) |
0.1 | 0.7 | GO:1901341 | activation of store-operated calcium channel activity(GO:0032237) positive regulation of store-operated calcium channel activity(GO:1901341) |
0.1 | 0.4 | GO:0002949 | tRNA threonylcarbamoyladenosine modification(GO:0002949) |
0.1 | 0.5 | GO:0010724 | regulation of definitive erythrocyte differentiation(GO:0010724) |
0.1 | 0.8 | GO:0051639 | actin filament network formation(GO:0051639) |
0.1 | 0.1 | GO:0001998 | angiotensin mediated vasoconstriction involved in regulation of systemic arterial blood pressure(GO:0001998) |
0.1 | 0.4 | GO:0015014 | heparan sulfate proteoglycan biosynthetic process, polysaccharide chain biosynthetic process(GO:0015014) |
0.1 | 0.5 | GO:0000957 | mitochondrial RNA catabolic process(GO:0000957) regulation of mitochondrial RNA catabolic process(GO:0000960) |
0.1 | 0.4 | GO:0061470 | T follicular helper cell differentiation(GO:0061470) |
0.1 | 0.5 | GO:0006166 | purine ribonucleoside salvage(GO:0006166) |
0.1 | 0.4 | GO:0015959 | diadenosine polyphosphate metabolic process(GO:0015959) |
0.1 | 0.4 | GO:0089700 | protein kinase D signaling(GO:0089700) |
0.1 | 0.5 | GO:0034755 | iron ion transmembrane transport(GO:0034755) |
0.1 | 0.4 | GO:0039536 | negative regulation of RIG-I signaling pathway(GO:0039536) |
0.1 | 0.4 | GO:1905206 | positive regulation of hydrogen peroxide-mediated programmed cell death(GO:1901300) positive regulation of hydrogen peroxide-induced cell death(GO:1905206) |
0.1 | 0.2 | GO:0070973 | protein localization to endoplasmic reticulum exit site(GO:0070973) |
0.1 | 0.5 | GO:0097460 | ferrous iron import into cell(GO:0097460) |
0.1 | 0.2 | GO:2000017 | positive regulation of determination of dorsal identity(GO:2000017) |
0.1 | 0.1 | GO:0090110 | cargo loading into COPII-coated vesicle(GO:0090110) |
0.1 | 0.3 | GO:0006208 | pyrimidine nucleobase catabolic process(GO:0006208) thymine catabolic process(GO:0006210) thymine metabolic process(GO:0019859) |
0.1 | 0.3 | GO:0018094 | protein polyglycylation(GO:0018094) |
0.1 | 0.2 | GO:0021847 | ventricular zone neuroblast division(GO:0021847) |
0.1 | 0.6 | GO:0001922 | B-1 B cell homeostasis(GO:0001922) |
0.1 | 0.8 | GO:0070131 | positive regulation of mitochondrial translation(GO:0070131) |
0.1 | 0.4 | GO:0032201 | telomere maintenance via semi-conservative replication(GO:0032201) |
0.1 | 1.3 | GO:0070816 | phosphorylation of RNA polymerase II C-terminal domain(GO:0070816) |
0.1 | 0.3 | GO:0016554 | cytidine to uridine editing(GO:0016554) |
0.1 | 0.4 | GO:0010760 | negative regulation of macrophage chemotaxis(GO:0010760) |
0.1 | 0.3 | GO:0033615 | mitochondrial proton-transporting ATP synthase complex assembly(GO:0033615) |
0.1 | 0.4 | GO:0035627 | ceramide transport(GO:0035627) |
0.1 | 0.4 | GO:0061724 | lipophagy(GO:0061724) |
0.1 | 0.7 | GO:0098908 | regulation of neuronal action potential(GO:0098908) |
0.1 | 0.4 | GO:1902953 | positive regulation of ER to Golgi vesicle-mediated transport(GO:1902953) |
0.1 | 0.3 | GO:0061368 | behavioral response to chemical pain(GO:0061366) behavioral response to formalin induced pain(GO:0061368) |
0.1 | 0.3 | GO:1904694 | negative regulation of vascular smooth muscle contraction(GO:1904694) |
0.1 | 0.5 | GO:0090435 | protein localization to nuclear envelope(GO:0090435) |
0.1 | 0.3 | GO:0001831 | trophectodermal cellular morphogenesis(GO:0001831) |
0.1 | 0.4 | GO:1900147 | Schwann cell migration(GO:0036135) regulation of Schwann cell migration(GO:1900147) |
0.1 | 0.3 | GO:0048865 | stem cell fate commitment(GO:0048865) |
0.1 | 0.2 | GO:0072361 | regulation of glycolytic process by regulation of transcription from RNA polymerase II promoter(GO:0072361) |
0.1 | 0.3 | GO:1901856 | negative regulation of cellular respiration(GO:1901856) |
0.1 | 0.3 | GO:0030327 | prenylated protein catabolic process(GO:0030327) |
0.1 | 0.6 | GO:0021960 | anterior commissure morphogenesis(GO:0021960) |
0.1 | 0.3 | GO:0045869 | negative regulation of single stranded viral RNA replication via double stranded DNA intermediate(GO:0045869) |
0.1 | 0.4 | GO:2000370 | positive regulation of clathrin-mediated endocytosis(GO:2000370) |
0.1 | 0.9 | GO:0000290 | deadenylation-dependent decapping of nuclear-transcribed mRNA(GO:0000290) |
0.1 | 0.4 | GO:0051919 | positive regulation of fibrinolysis(GO:0051919) |
0.1 | 0.7 | GO:0071397 | cellular response to cholesterol(GO:0071397) |
0.1 | 0.6 | GO:0097105 | presynaptic membrane assembly(GO:0097105) |
0.1 | 0.3 | GO:0071787 | endoplasmic reticulum tubular network assembly(GO:0071787) |
0.1 | 0.5 | GO:0015074 | DNA integration(GO:0015074) |
0.1 | 0.5 | GO:0009256 | 10-formyltetrahydrofolate metabolic process(GO:0009256) |
0.1 | 0.3 | GO:1901475 | pyruvate transmembrane transport(GO:1901475) |
0.1 | 0.3 | GO:0046881 | positive regulation of follicle-stimulating hormone secretion(GO:0046881) |
0.1 | 2.6 | GO:0019373 | epoxygenase P450 pathway(GO:0019373) |
0.1 | 0.1 | GO:0042695 | thelarche(GO:0042695) mammary gland branching involved in thelarche(GO:0060744) |
0.1 | 0.3 | GO:0002121 | inter-male aggressive behavior(GO:0002121) |
0.1 | 1.2 | GO:0006613 | cotranslational protein targeting to membrane(GO:0006613) |
0.1 | 0.5 | GO:0034242 | negative regulation of syncytium formation by plasma membrane fusion(GO:0034242) |
0.1 | 0.8 | GO:0070493 | thrombin receptor signaling pathway(GO:0070493) |
0.1 | 0.6 | GO:0060373 | regulation of ventricular cardiac muscle cell membrane depolarization(GO:0060373) |
0.1 | 0.3 | GO:0002581 | negative regulation of antigen processing and presentation of peptide or polysaccharide antigen via MHC class II(GO:0002581) |
0.1 | 0.3 | GO:0045900 | negative regulation of translational elongation(GO:0045900) |
0.1 | 0.3 | GO:0017187 | peptidyl-glutamic acid carboxylation(GO:0017187) |
0.1 | 0.3 | GO:0030397 | membrane disassembly(GO:0030397) nuclear envelope disassembly(GO:0051081) |
0.1 | 0.3 | GO:0006041 | glucosamine metabolic process(GO:0006041) |
0.1 | 0.2 | GO:2000259 | positive regulation of complement activation(GO:0045917) positive regulation of protein activation cascade(GO:2000259) |
0.1 | 0.4 | GO:0007182 | common-partner SMAD protein phosphorylation(GO:0007182) |
0.1 | 0.6 | GO:0033572 | transferrin transport(GO:0033572) |
0.1 | 0.8 | GO:0006622 | protein targeting to lysosome(GO:0006622) |
0.1 | 0.1 | GO:0046084 | adenine metabolic process(GO:0046083) adenine biosynthetic process(GO:0046084) |
0.1 | 0.2 | GO:0090427 | activation of meiosis(GO:0090427) |
0.1 | 0.3 | GO:0008626 | granzyme-mediated apoptotic signaling pathway(GO:0008626) |
0.1 | 0.1 | GO:2000409 | positive regulation of T cell extravasation(GO:2000409) |
0.1 | 0.2 | GO:0046552 | eye photoreceptor cell fate commitment(GO:0042706) photoreceptor cell fate commitment(GO:0046552) |
0.1 | 0.5 | GO:0006102 | isocitrate metabolic process(GO:0006102) |
0.1 | 0.2 | GO:0060748 | tertiary branching involved in mammary gland duct morphogenesis(GO:0060748) |
0.1 | 0.1 | GO:0045091 | regulation of single stranded viral RNA replication via double stranded DNA intermediate(GO:0045091) |
0.1 | 0.1 | GO:0098902 | regulation of membrane depolarization during action potential(GO:0098902) |
0.1 | 0.1 | GO:1903751 | regulation of intrinsic apoptotic signaling pathway in response to hydrogen peroxide(GO:1903750) negative regulation of intrinsic apoptotic signaling pathway in response to hydrogen peroxide(GO:1903751) |
0.1 | 0.3 | GO:0010499 | proteasomal ubiquitin-independent protein catabolic process(GO:0010499) |
0.1 | 0.5 | GO:0045542 | positive regulation of cholesterol biosynthetic process(GO:0045542) positive regulation of cholesterol metabolic process(GO:0090205) |
0.1 | 0.2 | GO:0097680 | double-strand break repair via classical nonhomologous end joining(GO:0097680) |
0.1 | 0.2 | GO:0000715 | nucleotide-excision repair, DNA damage recognition(GO:0000715) |
0.1 | 0.3 | GO:0014870 | response to inactivity(GO:0014854) response to muscle inactivity(GO:0014870) response to muscle inactivity involved in regulation of muscle adaptation(GO:0014877) response to denervation involved in regulation of muscle adaptation(GO:0014894) |
0.1 | 0.4 | GO:1904970 | brush border assembly(GO:1904970) |
0.1 | 0.2 | GO:1903690 | negative regulation of wound healing, spreading of epidermal cells(GO:1903690) |
0.1 | 0.8 | GO:0006957 | complement activation, alternative pathway(GO:0006957) |
0.1 | 0.2 | GO:0061146 | Peyer's patch morphogenesis(GO:0061146) |
0.1 | 0.2 | GO:0006177 | GMP biosynthetic process(GO:0006177) |
0.1 | 0.3 | GO:0014744 | positive regulation of muscle adaptation(GO:0014744) |
0.1 | 0.2 | GO:0060020 | Bergmann glial cell differentiation(GO:0060020) |
0.1 | 0.5 | GO:0048227 | plasma membrane to endosome transport(GO:0048227) |
0.1 | 0.6 | GO:0006107 | oxaloacetate metabolic process(GO:0006107) |
0.1 | 0.2 | GO:0072718 | response to cisplatin(GO:0072718) |
0.1 | 0.2 | GO:0061624 | fructose catabolic process(GO:0006001) fructose catabolic process to hydroxyacetone phosphate and glyceraldehyde-3-phosphate(GO:0061624) glycolytic process through fructose-1-phosphate(GO:0061625) |
0.1 | 0.3 | GO:0042420 | dopamine catabolic process(GO:0042420) |
0.1 | 0.2 | GO:1904479 | negative regulation of intestinal absorption(GO:1904479) |
0.1 | 0.3 | GO:0035519 | protein K29-linked ubiquitination(GO:0035519) |
0.1 | 0.8 | GO:0006120 | mitochondrial electron transport, NADH to ubiquinone(GO:0006120) |
0.1 | 0.7 | GO:0000244 | spliceosomal tri-snRNP complex assembly(GO:0000244) |
0.1 | 0.2 | GO:0006562 | proline catabolic process(GO:0006562) |
0.1 | 0.1 | GO:0060916 | mesenchymal cell proliferation involved in lung development(GO:0060916) |
0.1 | 0.4 | GO:0070236 | negative regulation of activation-induced cell death of T cells(GO:0070236) |
0.1 | 0.1 | GO:1903071 | positive regulation of ER-associated ubiquitin-dependent protein catabolic process(GO:1903071) |
0.1 | 0.1 | GO:0044314 | protein K27-linked ubiquitination(GO:0044314) |
0.1 | 0.1 | GO:1900045 | negative regulation of protein K63-linked ubiquitination(GO:1900045) negative regulation of protein polyubiquitination(GO:1902915) |
0.1 | 0.2 | GO:0016080 | synaptic vesicle targeting(GO:0016080) |
0.1 | 0.2 | GO:1900864 | mitochondrial tRNA modification(GO:0070900) mitochondrial RNA modification(GO:1900864) |
0.1 | 0.2 | GO:0090283 | regulation of protein glycosylation in Golgi(GO:0090283) |
0.1 | 1.0 | GO:0018126 | protein hydroxylation(GO:0018126) |
0.1 | 0.1 | GO:0010986 | positive regulation of lipoprotein particle clearance(GO:0010986) |
0.1 | 1.1 | GO:0043968 | histone H2A acetylation(GO:0043968) |
0.1 | 0.1 | GO:0036015 | response to interleukin-3(GO:0036015) cellular response to interleukin-3(GO:0036016) |
0.1 | 0.3 | GO:0046600 | negative regulation of centriole replication(GO:0046600) |
0.1 | 0.2 | GO:0046341 | CDP-diacylglycerol metabolic process(GO:0046341) |
0.1 | 0.3 | GO:0006382 | adenosine to inosine editing(GO:0006382) base conversion or substitution editing(GO:0016553) |
0.1 | 0.2 | GO:0046726 | positive regulation by virus of viral protein levels in host cell(GO:0046726) |
0.1 | 0.5 | GO:0045359 | positive regulation of interferon-beta biosynthetic process(GO:0045359) |
0.1 | 0.2 | GO:0070723 | response to cholesterol(GO:0070723) |
0.1 | 0.2 | GO:0061144 | alveolar secondary septum development(GO:0061144) |
0.1 | 0.3 | GO:0009052 | pentose-phosphate shunt, non-oxidative branch(GO:0009052) |
0.1 | 0.7 | GO:0060158 | phospholipase C-activating dopamine receptor signaling pathway(GO:0060158) |
0.1 | 0.5 | GO:0035999 | tetrahydrofolate interconversion(GO:0035999) |
0.1 | 0.1 | GO:0043415 | positive regulation of skeletal muscle tissue regeneration(GO:0043415) |
0.1 | 0.3 | GO:0071763 | nuclear membrane organization(GO:0071763) |
0.1 | 0.4 | GO:0070327 | thyroid hormone transport(GO:0070327) |
0.1 | 0.2 | GO:0006573 | valine metabolic process(GO:0006573) |
0.1 | 0.4 | GO:0006265 | DNA topological change(GO:0006265) |
0.1 | 0.2 | GO:0006545 | glycine biosynthetic process(GO:0006545) |
0.1 | 0.2 | GO:0048388 | endosomal lumen acidification(GO:0048388) |
0.1 | 0.2 | GO:1904526 | regulation of microtubule binding(GO:1904526) positive regulation of microtubule binding(GO:1904528) |
0.1 | 0.2 | GO:0071866 | regulation of apoptotic process in bone marrow(GO:0071865) negative regulation of apoptotic process in bone marrow(GO:0071866) |
0.1 | 0.1 | GO:0021524 | visceral motor neuron differentiation(GO:0021524) |
0.1 | 0.1 | GO:2000468 | regulation of peroxidase activity(GO:2000468) |
0.1 | 0.2 | GO:1990168 | protein K29-linked deubiquitination(GO:0035523) protein K33-linked deubiquitination(GO:1990168) |
0.1 | 0.1 | GO:0035963 | response to interleukin-13(GO:0035962) cellular response to interleukin-13(GO:0035963) |
0.1 | 0.2 | GO:0003383 | apical constriction(GO:0003383) |
0.1 | 0.4 | GO:2001256 | regulation of store-operated calcium entry(GO:2001256) |
0.1 | 0.1 | GO:0006533 | aspartate catabolic process(GO:0006533) |
0.1 | 0.2 | GO:0006207 | 'de novo' pyrimidine nucleobase biosynthetic process(GO:0006207) pyrimidine nucleobase biosynthetic process(GO:0019856) |
0.1 | 0.2 | GO:0038171 | cannabinoid signaling pathway(GO:0038171) endocannabinoid signaling pathway(GO:0071926) |
0.1 | 0.1 | GO:0034436 | glycoprotein transport(GO:0034436) |
0.1 | 0.2 | GO:0021882 | regulation of transcription from RNA polymerase II promoter involved in forebrain neuron fate commitment(GO:0021882) |
0.1 | 0.2 | GO:0014835 | myoblast differentiation involved in skeletal muscle regeneration(GO:0014835) |
0.1 | 0.2 | GO:1902309 | negative regulation of peptidyl-serine dephosphorylation(GO:1902309) |
0.1 | 0.1 | GO:0033686 | positive regulation of luteinizing hormone secretion(GO:0033686) |
0.1 | 0.2 | GO:0048850 | hypophysis morphogenesis(GO:0048850) |
0.1 | 0.3 | GO:0018231 | peptidyl-L-cysteine S-palmitoylation(GO:0018230) peptidyl-S-diacylglycerol-L-cysteine biosynthetic process from peptidyl-cysteine(GO:0018231) |
0.1 | 0.3 | GO:1901029 | negative regulation of mitochondrial outer membrane permeabilization involved in apoptotic signaling pathway(GO:1901029) |
0.1 | 0.4 | GO:0060501 | positive regulation of epithelial cell proliferation involved in lung morphogenesis(GO:0060501) regulation of epithelial cell proliferation involved in lung morphogenesis(GO:2000794) |
0.1 | 0.2 | GO:0035553 | oxidative RNA demethylation(GO:0035513) oxidative single-stranded RNA demethylation(GO:0035553) |
0.1 | 0.1 | GO:0002434 | immune complex clearance(GO:0002434) |
0.1 | 0.6 | GO:0032754 | positive regulation of interleukin-5 production(GO:0032754) |
0.1 | 0.2 | GO:0042276 | error-prone translesion synthesis(GO:0042276) |
0.1 | 1.1 | GO:0015985 | energy coupled proton transport, down electrochemical gradient(GO:0015985) ATP synthesis coupled proton transport(GO:0015986) |
0.1 | 0.2 | GO:1902626 | assembly of large subunit precursor of preribosome(GO:1902626) |
0.1 | 0.8 | GO:0045116 | protein neddylation(GO:0045116) |
0.1 | 0.1 | GO:0090071 | negative regulation of ribosome biogenesis(GO:0090071) |
0.1 | 0.2 | GO:0038128 | ERBB2 signaling pathway(GO:0038128) |
0.1 | 0.4 | GO:0045908 | negative regulation of vasodilation(GO:0045908) |
0.1 | 0.1 | GO:0032364 | oxygen homeostasis(GO:0032364) |
0.1 | 0.2 | GO:1902268 | negative regulation of polyamine transmembrane transport(GO:1902268) |
0.1 | 0.1 | GO:0008065 | establishment of blood-nerve barrier(GO:0008065) |
0.1 | 0.3 | GO:0046602 | regulation of mitotic centrosome separation(GO:0046602) |
0.1 | 1.1 | GO:0006783 | heme biosynthetic process(GO:0006783) |
0.1 | 0.1 | GO:0046037 | GMP metabolic process(GO:0046037) |
0.1 | 0.1 | GO:1904339 | negative regulation of dopaminergic neuron differentiation(GO:1904339) |
0.1 | 0.2 | GO:0044778 | meiotic DNA integrity checkpoint(GO:0044778) |
0.1 | 0.2 | GO:0070213 | protein auto-ADP-ribosylation(GO:0070213) |
0.1 | 0.4 | GO:0006591 | ornithine metabolic process(GO:0006591) |
0.1 | 0.4 | GO:0000042 | protein targeting to Golgi(GO:0000042) |
0.1 | 0.2 | GO:0034773 | histone H4-K20 trimethylation(GO:0034773) |
0.1 | 0.1 | GO:0032289 | central nervous system myelin formation(GO:0032289) |
0.1 | 0.1 | GO:0071896 | protein localization to adherens junction(GO:0071896) |
0.1 | 0.2 | GO:1900747 | negative regulation of vascular endothelial growth factor signaling pathway(GO:1900747) |
0.1 | 0.2 | GO:0060510 | Type II pneumocyte differentiation(GO:0060510) |
0.1 | 0.2 | GO:0007084 | mitotic nuclear envelope reassembly(GO:0007084) |
0.1 | 0.1 | GO:0090209 | negative regulation of triglyceride metabolic process(GO:0090209) |
0.1 | 0.2 | GO:0019805 | quinolinate biosynthetic process(GO:0019805) |
0.1 | 0.2 | GO:2000346 | negative regulation of hepatocyte proliferation(GO:2000346) |
0.1 | 0.3 | GO:0000055 | ribosomal large subunit export from nucleus(GO:0000055) |
0.1 | 0.6 | GO:0032780 | negative regulation of ATPase activity(GO:0032780) |
0.1 | 0.5 | GO:0048742 | regulation of skeletal muscle fiber development(GO:0048742) |
0.1 | 0.2 | GO:0048807 | female genitalia morphogenesis(GO:0048807) |
0.1 | 0.2 | GO:0008228 | opsonization(GO:0008228) |
0.1 | 0.1 | GO:0072092 | ureteric bud invasion(GO:0072092) |
0.1 | 0.1 | GO:0035977 | protein deglycosylation involved in glycoprotein catabolic process(GO:0035977) protein demannosylation(GO:0036507) protein alpha-1,2-demannosylation(GO:0036508) mannose trimming involved in glycoprotein ERAD pathway(GO:1904382) |
0.1 | 0.4 | GO:0051657 | maintenance of organelle location(GO:0051657) |
0.1 | 0.2 | GO:1903361 | protein localization to basolateral plasma membrane(GO:1903361) |
0.1 | 0.3 | GO:0010457 | centriole-centriole cohesion(GO:0010457) |
0.1 | 0.1 | GO:0001828 | inner cell mass cellular morphogenesis(GO:0001828) |
0.1 | 0.2 | GO:1902913 | positive regulation of neuroepithelial cell differentiation(GO:1902913) |
0.1 | 0.7 | GO:0010569 | regulation of double-strand break repair via homologous recombination(GO:0010569) |
0.1 | 0.1 | GO:0097475 | motor neuron migration(GO:0097475) spinal cord motor neuron migration(GO:0097476) |
0.1 | 0.1 | GO:0015747 | urate transport(GO:0015747) |
0.0 | 0.1 | GO:0046005 | positive regulation of circadian sleep/wake cycle, REM sleep(GO:0046005) |
0.0 | 0.4 | GO:2000780 | negative regulation of double-strand break repair(GO:2000780) |
0.0 | 0.2 | GO:0042997 | negative regulation of Golgi to plasma membrane protein transport(GO:0042997) |
0.0 | 0.1 | GO:0070989 | oxidative demethylation(GO:0070989) |
0.0 | 0.1 | GO:0097384 | ether lipid biosynthetic process(GO:0008611) glycerol ether biosynthetic process(GO:0046504) cellular lipid biosynthetic process(GO:0097384) ether biosynthetic process(GO:1901503) |
0.0 | 0.4 | GO:0006388 | tRNA splicing, via endonucleolytic cleavage and ligation(GO:0006388) |
0.0 | 0.2 | GO:1902004 | positive regulation of beta-amyloid formation(GO:1902004) positive regulation of amyloid precursor protein catabolic process(GO:1902993) |
0.0 | 0.2 | GO:0048312 | intracellular distribution of mitochondria(GO:0048312) |
0.0 | 0.1 | GO:0001555 | oocyte growth(GO:0001555) |
0.0 | 0.1 | GO:0060468 | prevention of polyspermy(GO:0060468) |
0.0 | 0.2 | GO:0000480 | endonucleolytic cleavage in 5'-ETS of tricistronic rRNA transcript (SSU-rRNA, 5.8S rRNA, LSU-rRNA)(GO:0000480) |
0.0 | 0.1 | GO:2000427 | positive regulation of apoptotic cell clearance(GO:2000427) |
0.0 | 0.1 | GO:0021873 | forebrain neuroblast division(GO:0021873) |
0.0 | 0.0 | GO:0035359 | negative regulation of peroxisome proliferator activated receptor signaling pathway(GO:0035359) |
0.0 | 1.0 | GO:0032728 | positive regulation of interferon-beta production(GO:0032728) |
0.0 | 0.3 | GO:1902902 | negative regulation of autophagosome assembly(GO:1902902) |
0.0 | 0.1 | GO:0072107 | regulation of ureteric bud formation(GO:0072106) positive regulation of ureteric bud formation(GO:0072107) |
0.0 | 0.1 | GO:0002309 | T cell proliferation involved in immune response(GO:0002309) |
0.0 | 0.2 | GO:1903333 | negative regulation of protein folding(GO:1903333) |
0.0 | 0.0 | GO:0071907 | determination of digestive tract left/right asymmetry(GO:0071907) |
0.0 | 0.2 | GO:0072321 | chaperone-mediated protein transport(GO:0072321) |
0.0 | 0.2 | GO:0098535 | de novo centriole assembly(GO:0098535) |
0.0 | 0.3 | GO:0007253 | cytoplasmic sequestering of NF-kappaB(GO:0007253) |
0.0 | 0.1 | GO:1902083 | negative regulation of peptidyl-cysteine S-nitrosylation(GO:1902083) |
0.0 | 0.3 | GO:0006517 | protein deglycosylation(GO:0006517) |
0.0 | 0.1 | GO:1900095 | regulation of dosage compensation by inactivation of X chromosome(GO:1900095) |
0.0 | 0.2 | GO:0070562 | regulation of vitamin D receptor signaling pathway(GO:0070562) |
0.0 | 0.1 | GO:0006295 | nucleotide-excision repair, DNA incision, 3'-to lesion(GO:0006295) |
0.0 | 0.1 | GO:0070948 | regulation of neutrophil mediated cytotoxicity(GO:0070948) regulation of neutrophil mediated killing of symbiont cell(GO:0070949) |
0.0 | 0.4 | GO:0060628 | regulation of ER to Golgi vesicle-mediated transport(GO:0060628) |
0.0 | 0.2 | GO:0060398 | regulation of growth hormone receptor signaling pathway(GO:0060398) |
0.0 | 0.1 | GO:0046959 | habituation(GO:0046959) |
0.0 | 0.1 | GO:0032929 | negative regulation of superoxide anion generation(GO:0032929) |
0.0 | 0.5 | GO:0002176 | male germ cell proliferation(GO:0002176) |
0.0 | 0.0 | GO:0070072 | vacuolar proton-transporting V-type ATPase complex assembly(GO:0070072) |
0.0 | 0.1 | GO:0086023 | adrenergic receptor signaling pathway involved in heart process(GO:0086023) |
0.0 | 0.1 | GO:0048936 | peripheral nervous system neuron axonogenesis(GO:0048936) |
0.0 | 0.2 | GO:2000609 | regulation of thyroid hormone generation(GO:2000609) |
0.0 | 0.0 | GO:0033092 | positive regulation of immature T cell proliferation in thymus(GO:0033092) |
0.0 | 0.1 | GO:0010756 | positive regulation of plasminogen activation(GO:0010756) |
0.0 | 0.1 | GO:0046098 | guanine metabolic process(GO:0046098) |
0.0 | 0.1 | GO:2001180 | negative regulation of interleukin-10 secretion(GO:2001180) |
0.0 | 0.3 | GO:0006105 | succinate metabolic process(GO:0006105) |
0.0 | 0.5 | GO:0006152 | purine nucleoside catabolic process(GO:0006152) purine ribonucleoside catabolic process(GO:0046130) |
0.0 | 0.1 | GO:0007406 | negative regulation of neuroblast proliferation(GO:0007406) |
0.0 | 0.7 | GO:0032958 | inositol phosphate biosynthetic process(GO:0032958) |
0.0 | 0.2 | GO:0035469 | determination of pancreatic left/right asymmetry(GO:0035469) |
0.0 | 0.0 | GO:0010958 | regulation of amino acid import(GO:0010958) |
0.0 | 0.1 | GO:0048619 | embryonic hindgut morphogenesis(GO:0048619) |
0.0 | 0.3 | GO:0019852 | L-ascorbic acid metabolic process(GO:0019852) |
0.0 | 0.2 | GO:0090187 | positive regulation of pancreatic juice secretion(GO:0090187) |
0.0 | 0.1 | GO:0019478 | D-amino acid catabolic process(GO:0019478) |
0.0 | 0.4 | GO:0033147 | negative regulation of intracellular estrogen receptor signaling pathway(GO:0033147) |
0.0 | 0.2 | GO:0006528 | asparagine metabolic process(GO:0006528) |
0.0 | 0.2 | GO:0000414 | regulation of histone H3-K36 methylation(GO:0000414) |
0.0 | 0.1 | GO:0070682 | proteasome regulatory particle assembly(GO:0070682) |
0.0 | 0.3 | GO:0043247 | telomere maintenance in response to DNA damage(GO:0043247) |
0.0 | 0.1 | GO:1903587 | regulation of blood vessel endothelial cell proliferation involved in sprouting angiogenesis(GO:1903587) |
0.0 | 0.1 | GO:0016237 | lysosomal microautophagy(GO:0016237) piecemeal microautophagy of nucleus(GO:0034727) late nucleophagy(GO:0044805) |
0.0 | 0.1 | GO:0000350 | generation of catalytic spliceosome for second transesterification step(GO:0000350) |
0.0 | 0.2 | GO:0018243 | protein O-linked glycosylation via threonine(GO:0018243) |
0.0 | 0.5 | GO:0051084 | 'de novo' protein folding(GO:0006458) 'de novo' posttranslational protein folding(GO:0051084) |
0.0 | 0.1 | GO:0006522 | alanine metabolic process(GO:0006522) pyruvate family amino acid metabolic process(GO:0009078) L-alanine metabolic process(GO:0042851) |
0.0 | 0.2 | GO:0035331 | negative regulation of hippo signaling(GO:0035331) |
0.0 | 0.0 | GO:0061738 | late endosomal microautophagy(GO:0061738) |
0.0 | 0.0 | GO:0001827 | inner cell mass cell fate commitment(GO:0001827) |
0.0 | 0.1 | GO:0061668 | mitochondrial ribosome assembly(GO:0061668) mitochondrial large ribosomal subunit assembly(GO:1902775) |
0.0 | 0.1 | GO:0070278 | extracellular matrix constituent secretion(GO:0070278) |
0.0 | 0.2 | GO:2000766 | negative regulation of cytoplasmic translation(GO:2000766) |
0.0 | 0.1 | GO:0007258 | JUN phosphorylation(GO:0007258) |
0.0 | 0.1 | GO:0071280 | cellular response to copper ion(GO:0071280) |
0.0 | 0.2 | GO:0060136 | embryonic process involved in female pregnancy(GO:0060136) |
0.0 | 0.0 | GO:0031443 | fast-twitch skeletal muscle fiber contraction(GO:0031443) |
0.0 | 0.1 | GO:0033683 | nucleotide-excision repair, DNA incision(GO:0033683) |
0.0 | 0.1 | GO:0006787 | porphyrin-containing compound catabolic process(GO:0006787) tetrapyrrole catabolic process(GO:0033015) |
0.0 | 0.2 | GO:2000675 | negative regulation of type B pancreatic cell apoptotic process(GO:2000675) |
0.0 | 0.2 | GO:0051694 | pointed-end actin filament capping(GO:0051694) |
0.0 | 0.2 | GO:0030321 | transepithelial chloride transport(GO:0030321) |
0.0 | 0.0 | GO:0042940 | D-amino acid transport(GO:0042940) |
0.0 | 0.1 | GO:0090241 | negative regulation of histone H4 acetylation(GO:0090241) |
0.0 | 0.1 | GO:0071799 | response to prostaglandin D(GO:0071798) cellular response to prostaglandin D stimulus(GO:0071799) |
0.0 | 1.0 | GO:0006890 | retrograde vesicle-mediated transport, Golgi to ER(GO:0006890) |
0.0 | 0.1 | GO:0009182 | purine deoxyribonucleoside diphosphate metabolic process(GO:0009182) dGDP metabolic process(GO:0046066) |
0.0 | 0.2 | GO:0016127 | cholesterol catabolic process(GO:0006707) sterol catabolic process(GO:0016127) |
0.0 | 0.2 | GO:0030259 | lipid glycosylation(GO:0030259) |
0.0 | 0.0 | GO:0032621 | interleukin-18 production(GO:0032621) |
0.0 | 0.4 | GO:0055070 | copper ion homeostasis(GO:0055070) |
0.0 | 0.2 | GO:0014028 | notochord formation(GO:0014028) |
0.0 | 0.2 | GO:0072386 | plus-end-directed vesicle transport along microtubule(GO:0072383) plus-end-directed organelle transport along microtubule(GO:0072386) |
0.0 | 1.9 | GO:0045454 | cell redox homeostasis(GO:0045454) |
0.0 | 0.1 | GO:2000646 | positive regulation of receptor catabolic process(GO:2000646) |
0.0 | 0.1 | GO:0032483 | regulation of Rab protein signal transduction(GO:0032483) |
0.0 | 0.1 | GO:0002386 | immune response in mucosal-associated lymphoid tissue(GO:0002386) |
0.0 | 0.3 | GO:0032486 | Rap protein signal transduction(GO:0032486) |
0.0 | 0.6 | GO:0042438 | melanin biosynthetic process(GO:0042438) |
0.0 | 0.1 | GO:0048382 | mesendoderm development(GO:0048382) |
0.0 | 0.0 | GO:0071394 | cellular response to testosterone stimulus(GO:0071394) |
0.0 | 0.0 | GO:0042483 | negative regulation of odontogenesis(GO:0042483) |
0.0 | 0.1 | GO:1903279 | regulation of calcium:sodium antiporter activity(GO:1903279) |
0.0 | 0.3 | GO:0019227 | neuronal action potential propagation(GO:0019227) action potential propagation(GO:0098870) |
0.0 | 0.2 | GO:0031053 | primary miRNA processing(GO:0031053) |
0.0 | 0.1 | GO:0086046 | membrane depolarization during SA node cell action potential(GO:0086046) |
0.0 | 0.1 | GO:1903999 | negative regulation of eating behavior(GO:1903999) |
0.0 | 0.0 | GO:0071839 | apoptotic process in bone marrow(GO:0071839) |
0.0 | 0.0 | GO:0000727 | double-strand break repair via break-induced replication(GO:0000727) |
0.0 | 0.2 | GO:0031119 | tRNA pseudouridine synthesis(GO:0031119) |
0.0 | 0.0 | GO:0010835 | regulation of protein ADP-ribosylation(GO:0010835) |
0.0 | 0.2 | GO:0032020 | ISG15-protein conjugation(GO:0032020) |
0.0 | 0.1 | GO:0009597 | detection of virus(GO:0009597) |
0.0 | 0.1 | GO:0019532 | oxalate transport(GO:0019532) |
0.0 | 0.1 | GO:0008050 | female courtship behavior(GO:0008050) |
0.0 | 0.8 | GO:0019432 | triglyceride biosynthetic process(GO:0019432) |
0.0 | 0.3 | GO:0035871 | protein K11-linked deubiquitination(GO:0035871) |
0.0 | 0.1 | GO:0060283 | negative regulation of oocyte development(GO:0060283) negative regulation of oocyte maturation(GO:1900194) |
0.0 | 1.0 | GO:0043252 | sodium-independent organic anion transport(GO:0043252) |
0.0 | 0.1 | GO:0070129 | regulation of mitochondrial translation(GO:0070129) |
0.0 | 0.1 | GO:0061370 | testosterone biosynthetic process(GO:0061370) |
0.0 | 0.2 | GO:0033133 | positive regulation of glucokinase activity(GO:0033133) |
0.0 | 0.1 | GO:0021943 | formation of radial glial scaffolds(GO:0021943) |
0.0 | 0.1 | GO:0060059 | embryonic retina morphogenesis in camera-type eye(GO:0060059) |
0.0 | 0.1 | GO:0002025 | vasodilation by norepinephrine-epinephrine involved in regulation of systemic arterial blood pressure(GO:0002025) |
0.0 | 0.3 | GO:0010459 | negative regulation of heart rate(GO:0010459) |
0.0 | 0.1 | GO:0072385 | minus-end-directed organelle transport along microtubule(GO:0072385) |
0.0 | 0.1 | GO:2000189 | positive regulation of cholesterol homeostasis(GO:2000189) |
0.0 | 0.2 | GO:0097070 | ductus arteriosus closure(GO:0097070) |
0.0 | 0.1 | GO:0000429 | carbon catabolite regulation of transcription from RNA polymerase II promoter(GO:0000429) regulation of transcription from RNA polymerase II promoter by glucose(GO:0000430) positive regulation of transcription from RNA polymerase II promoter by glucose(GO:0000432) carbon catabolite activation of transcription from RNA polymerase II promoter(GO:0000436) |
0.0 | 0.1 | GO:0061535 | glutamate secretion, neurotransmission(GO:0061535) |
0.0 | 0.1 | GO:0042737 | drug catabolic process(GO:0042737) |
0.0 | 0.3 | GO:0042026 | protein refolding(GO:0042026) |
0.0 | 0.0 | GO:0060266 | negative regulation of respiratory burst involved in inflammatory response(GO:0060266) |
0.0 | 0.1 | GO:0070940 | dephosphorylation of RNA polymerase II C-terminal domain(GO:0070940) |
0.0 | 0.2 | GO:0048570 | notochord morphogenesis(GO:0048570) |
0.0 | 0.0 | GO:0060676 | ureteric bud formation(GO:0060676) |
0.0 | 0.2 | GO:0006384 | transcription initiation from RNA polymerase III promoter(GO:0006384) |
0.0 | 0.2 | GO:0032596 | protein transport into membrane raft(GO:0032596) |
0.0 | 0.1 | GO:0006768 | biotin metabolic process(GO:0006768) |
0.0 | 0.1 | GO:0045719 | negative regulation of glycogen biosynthetic process(GO:0045719) |
0.0 | 0.2 | GO:0031642 | negative regulation of myelination(GO:0031642) |
0.0 | 0.1 | GO:0032747 | positive regulation of interleukin-23 production(GO:0032747) |
0.0 | 0.1 | GO:0071492 | cellular response to UV-A(GO:0071492) |
0.0 | 0.1 | GO:0070375 | ERK5 cascade(GO:0070375) |
0.0 | 1.3 | GO:0010501 | RNA secondary structure unwinding(GO:0010501) |
0.0 | 0.8 | GO:0061077 | chaperone-mediated protein folding(GO:0061077) |
0.0 | 0.1 | GO:0071072 | negative regulation of phospholipid biosynthetic process(GO:0071072) |
0.0 | 0.3 | GO:0033145 | positive regulation of intracellular steroid hormone receptor signaling pathway(GO:0033145) |
0.0 | 0.1 | GO:0072319 | vesicle uncoating(GO:0072319) |
0.0 | 0.1 | GO:0034421 | post-translational protein acetylation(GO:0034421) |
0.0 | 0.1 | GO:0000320 | re-entry into mitotic cell cycle(GO:0000320) |
0.0 | 0.2 | GO:0097286 | iron ion import(GO:0097286) |
0.0 | 0.3 | GO:0042659 | regulation of cell fate specification(GO:0042659) |
0.0 | 0.2 | GO:0048496 | maintenance of organ identity(GO:0048496) |
0.0 | 0.2 | GO:0002904 | positive regulation of B cell apoptotic process(GO:0002904) |
0.0 | 0.1 | GO:0090214 | spongiotrophoblast layer developmental growth(GO:0090214) |
0.0 | 0.3 | GO:0007614 | short-term memory(GO:0007614) |
0.0 | 0.2 | GO:0034331 | cell junction maintenance(GO:0034331) cell-cell junction maintenance(GO:0045217) |
0.0 | 0.1 | GO:0036296 | cellular response to increased oxygen levels(GO:0036295) response to increased oxygen levels(GO:0036296) response to hyperoxia(GO:0055093) cellular response to hyperoxia(GO:0071455) |
0.0 | 0.1 | GO:0070120 | ciliary neurotrophic factor-mediated signaling pathway(GO:0070120) |
0.0 | 0.1 | GO:0033227 | dsRNA transport(GO:0033227) |
0.0 | 0.1 | GO:0032058 | positive regulation of translational initiation in response to stress(GO:0032058) |
0.0 | 0.1 | GO:0070166 | enamel mineralization(GO:0070166) |
0.0 | 0.3 | GO:0030859 | polarized epithelial cell differentiation(GO:0030859) |
0.0 | 0.1 | GO:0030948 | negative regulation of vascular endothelial growth factor receptor signaling pathway(GO:0030948) |
0.0 | 0.4 | GO:0061003 | positive regulation of dendritic spine morphogenesis(GO:0061003) |
0.0 | 0.1 | GO:0003284 | septum primum development(GO:0003284) atrial septum primum morphogenesis(GO:0003289) |
0.0 | 0.1 | GO:0048861 | leukemia inhibitory factor signaling pathway(GO:0048861) |
0.0 | 0.2 | GO:0033234 | negative regulation of protein sumoylation(GO:0033234) |
0.0 | 0.1 | GO:0010040 | response to iron(II) ion(GO:0010040) |
0.0 | 0.2 | GO:0006561 | proline biosynthetic process(GO:0006561) |
0.0 | 0.0 | GO:1901563 | response to camptothecin(GO:1901563) |
0.0 | 0.1 | GO:0031914 | negative regulation of synaptic plasticity(GO:0031914) |
0.0 | 0.1 | GO:0000103 | sulfate assimilation(GO:0000103) |
0.0 | 0.2 | GO:1903608 | protein localization to cytoplasmic stress granule(GO:1903608) |
0.0 | 0.1 | GO:0032788 | saturated monocarboxylic acid metabolic process(GO:0032788) unsaturated monocarboxylic acid metabolic process(GO:0032789) |
0.0 | 0.0 | GO:0070827 | chromatin maintenance(GO:0070827) |
0.0 | 0.1 | GO:0089711 | L-glutamate transmembrane transport(GO:0089711) |
0.0 | 0.1 | GO:0035089 | establishment of apical/basal cell polarity(GO:0035089) |
0.0 | 0.1 | GO:0071033 | nuclear retention of pre-mRNA at the site of transcription(GO:0071033) |
0.0 | 0.1 | GO:0015819 | lysine transport(GO:0015819) |
0.0 | 0.1 | GO:1900748 | positive regulation of vascular endothelial growth factor signaling pathway(GO:1900748) |
0.0 | 0.2 | GO:0036089 | cleavage furrow formation(GO:0036089) |
0.0 | 0.1 | GO:0046684 | response to pyrethroid(GO:0046684) |
0.0 | 0.2 | GO:1902031 | regulation of NADP metabolic process(GO:1902031) |
0.0 | 0.3 | GO:0045898 | regulation of RNA polymerase II transcriptional preinitiation complex assembly(GO:0045898) |
0.0 | 0.1 | GO:0033160 | positive regulation of protein import into nucleus, translocation(GO:0033160) |
0.0 | 0.1 | GO:0010988 | regulation of low-density lipoprotein particle clearance(GO:0010988) |
0.0 | 0.1 | GO:0043619 | regulation of transcription from RNA polymerase II promoter in response to oxidative stress(GO:0043619) |
0.0 | 0.0 | GO:0036151 | phosphatidylcholine acyl-chain remodeling(GO:0036151) |
0.0 | 0.1 | GO:0046015 | regulation of transcription by glucose(GO:0046015) |
0.0 | 0.4 | GO:0006883 | cellular sodium ion homeostasis(GO:0006883) |
0.0 | 0.2 | GO:0032367 | intracellular cholesterol transport(GO:0032367) |
0.0 | 0.1 | GO:0031468 | nuclear envelope reassembly(GO:0031468) |
0.0 | 0.3 | GO:0043116 | negative regulation of vascular permeability(GO:0043116) |
0.0 | 0.1 | GO:0050916 | sensory perception of sweet taste(GO:0050916) |
0.0 | 0.3 | GO:0090169 | regulation of spindle assembly(GO:0090169) |
0.0 | 0.1 | GO:1901164 | negative regulation of trophoblast cell migration(GO:1901164) |
0.0 | 0.1 | GO:0061684 | chaperone-mediated autophagy(GO:0061684) |
0.0 | 0.1 | GO:1903416 | response to glycoside(GO:1903416) |
0.0 | 0.1 | GO:0019896 | axonal transport of mitochondrion(GO:0019896) |
0.0 | 0.2 | GO:1904321 | response to forskolin(GO:1904321) cellular response to forskolin(GO:1904322) |
0.0 | 0.3 | GO:0003298 | physiological muscle hypertrophy(GO:0003298) physiological cardiac muscle hypertrophy(GO:0003301) cell growth involved in cardiac muscle cell development(GO:0061049) |
0.0 | 0.1 | GO:0007529 | establishment of synaptic specificity at neuromuscular junction(GO:0007529) |
0.0 | 0.2 | GO:0060856 | establishment of blood-brain barrier(GO:0060856) |
0.0 | 0.1 | GO:0045541 | negative regulation of cholesterol biosynthetic process(GO:0045541) negative regulation of cholesterol metabolic process(GO:0090206) |
0.0 | 0.1 | GO:0006013 | mannose metabolic process(GO:0006013) |
0.0 | 0.0 | GO:0021564 | vagus nerve development(GO:0021564) |
0.0 | 0.0 | GO:1902445 | regulation of mitochondrial membrane permeability involved in programmed necrotic cell death(GO:1902445) |
0.0 | 0.0 | GO:1903599 | positive regulation of mitophagy(GO:1903599) |
0.0 | 0.3 | GO:0045187 | regulation of circadian sleep/wake cycle, sleep(GO:0045187) |
0.0 | 0.1 | GO:0072488 | ammonium transmembrane transport(GO:0072488) |
0.0 | 0.1 | GO:0071625 | vocalization behavior(GO:0071625) |
0.0 | 0.1 | GO:2000601 | positive regulation of Arp2/3 complex-mediated actin nucleation(GO:2000601) |
0.0 | 0.1 | GO:0034141 | positive regulation of toll-like receptor 3 signaling pathway(GO:0034141) |
0.0 | 0.1 | GO:0023021 | termination of signal transduction(GO:0023021) |
0.0 | 0.2 | GO:0001672 | regulation of chromatin assembly or disassembly(GO:0001672) |
0.0 | 0.1 | GO:0001732 | formation of cytoplasmic translation initiation complex(GO:0001732) |
0.0 | 0.2 | GO:0002091 | negative regulation of receptor internalization(GO:0002091) |
0.0 | 0.3 | GO:0001886 | endothelial cell morphogenesis(GO:0001886) |
0.0 | 0.1 | GO:0032971 | regulation of muscle filament sliding(GO:0032971) |
0.0 | 0.1 | GO:1904668 | positive regulation of ubiquitin protein ligase activity(GO:1904668) |
0.0 | 0.1 | GO:0010984 | regulation of lipoprotein particle clearance(GO:0010984) |
0.0 | 0.0 | GO:0060743 | epithelial cell maturation involved in prostate gland development(GO:0060743) |
0.0 | 0.1 | GO:0035526 | retrograde transport, plasma membrane to Golgi(GO:0035526) |
0.0 | 0.1 | GO:0072102 | glomerulus morphogenesis(GO:0072102) |
0.0 | 0.0 | GO:0034137 | positive regulation of toll-like receptor 2 signaling pathway(GO:0034137) |
0.0 | 0.1 | GO:0051005 | negative regulation of lipoprotein lipase activity(GO:0051005) |
0.0 | 0.2 | GO:0035826 | rubidium ion transport(GO:0035826) |
0.0 | 0.1 | GO:1903799 | negative regulation of production of miRNAs involved in gene silencing by miRNA(GO:1903799) |
0.0 | 0.1 | GO:0009826 | unidimensional cell growth(GO:0009826) |
0.0 | 0.1 | GO:0042908 | xenobiotic transport(GO:0042908) |
0.0 | 0.1 | GO:0031118 | rRNA pseudouridine synthesis(GO:0031118) |
0.0 | 0.1 | GO:2001135 | regulation of endocytic recycling(GO:2001135) |
0.0 | 0.1 | GO:1900109 | regulation of histone H3-K9 dimethylation(GO:1900109) |
0.0 | 0.2 | GO:0043586 | tongue development(GO:0043586) |
0.0 | 0.0 | GO:0003419 | growth plate cartilage chondrocyte proliferation(GO:0003419) |
0.0 | 0.1 | GO:0031999 | negative regulation of fatty acid beta-oxidation(GO:0031999) |
0.0 | 0.1 | GO:0008355 | olfactory learning(GO:0008355) |
0.0 | 0.4 | GO:0043984 | histone H4-K16 acetylation(GO:0043984) |
0.0 | 0.1 | GO:0048368 | lateral mesoderm development(GO:0048368) |
0.0 | 0.0 | GO:0036301 | macrophage colony-stimulating factor production(GO:0036301) granulocyte colony-stimulating factor production(GO:0071611) regulation of granulocyte colony-stimulating factor production(GO:0071655) regulation of macrophage colony-stimulating factor production(GO:1901256) |
0.0 | 0.1 | GO:0090336 | positive regulation of brown fat cell differentiation(GO:0090336) |
0.0 | 0.2 | GO:0006826 | iron ion transport(GO:0006826) |
0.0 | 0.0 | GO:0086045 | membrane depolarization during AV node cell action potential(GO:0086045) |
0.0 | 0.1 | GO:0000183 | chromatin silencing at rDNA(GO:0000183) |
0.0 | 0.1 | GO:0042078 | germ-line stem cell division(GO:0042078) male germ-line stem cell asymmetric division(GO:0048133) germline stem cell asymmetric division(GO:0098728) |
0.0 | 0.1 | GO:0006420 | arginyl-tRNA aminoacylation(GO:0006420) |
0.0 | 0.1 | GO:0060426 | lung vasculature development(GO:0060426) |
0.0 | 0.2 | GO:0006122 | mitochondrial electron transport, ubiquinol to cytochrome c(GO:0006122) |
0.0 | 0.2 | GO:0051044 | positive regulation of membrane protein ectodomain proteolysis(GO:0051044) |
0.0 | 0.0 | GO:0061198 | fungiform papilla formation(GO:0061198) |
0.0 | 0.2 | GO:0010544 | negative regulation of platelet activation(GO:0010544) |
0.0 | 0.0 | GO:1900738 | positive regulation of phospholipase C-activating G-protein coupled receptor signaling pathway(GO:1900738) |
0.0 | 0.0 | GO:0014042 | positive regulation of neuron maturation(GO:0014042) |
0.0 | 0.1 | GO:0042136 | neurotransmitter biosynthetic process(GO:0042136) |
0.0 | 0.0 | GO:0042231 | interleukin-13 biosynthetic process(GO:0042231) |
0.0 | 0.1 | GO:0006624 | vacuolar protein processing(GO:0006624) |
0.0 | 0.1 | GO:2000096 | positive regulation of Wnt signaling pathway, planar cell polarity pathway(GO:2000096) |
0.0 | 0.1 | GO:0090166 | Golgi disassembly(GO:0090166) |
0.0 | 0.0 | GO:0090148 | membrane fission(GO:0090148) |
0.0 | 0.1 | GO:0051152 | positive regulation of smooth muscle cell differentiation(GO:0051152) |
0.0 | 0.2 | GO:0017144 | drug metabolic process(GO:0017144) |
0.0 | 0.1 | GO:0098795 | mRNA cleavage involved in gene silencing by miRNA(GO:0035279) mRNA cleavage involved in gene silencing(GO:0098795) |
0.0 | 0.0 | GO:1903598 | positive regulation of gap junction assembly(GO:1903598) |
0.0 | 0.1 | GO:0007638 | mechanosensory behavior(GO:0007638) |
0.0 | 0.1 | GO:0006678 | glucosylceramide metabolic process(GO:0006678) |
0.0 | 0.1 | GO:2000574 | regulation of microtubule motor activity(GO:2000574) |
0.0 | 0.0 | GO:1902302 | regulation of potassium ion export(GO:1902302) |
0.0 | 0.1 | GO:0090080 | positive regulation of MAPKKK cascade by fibroblast growth factor receptor signaling pathway(GO:0090080) |
0.0 | 0.0 | GO:0014717 | regulation of satellite cell activation involved in skeletal muscle regeneration(GO:0014717) satellite cell activation involved in skeletal muscle regeneration(GO:0014901) |
0.0 | 0.1 | GO:0010838 | positive regulation of keratinocyte proliferation(GO:0010838) |
0.0 | 0.0 | GO:1903977 | positive regulation of glial cell migration(GO:1903977) |
0.0 | 0.1 | GO:0015842 | aminergic neurotransmitter loading into synaptic vesicle(GO:0015842) neurotransmitter loading into synaptic vesicle(GO:0098700) |
0.0 | 0.2 | GO:0090136 | epithelial cell-cell adhesion(GO:0090136) |
0.0 | 0.3 | GO:0045943 | positive regulation of transcription from RNA polymerase I promoter(GO:0045943) |
0.0 | 0.2 | GO:0031000 | response to caffeine(GO:0031000) |
0.0 | 0.0 | GO:1900425 | negative regulation of defense response to bacterium(GO:1900425) |
0.0 | 0.1 | GO:0002554 | serotonin secretion by platelet(GO:0002554) |
0.0 | 0.1 | GO:1902969 | mitotic DNA replication(GO:1902969) |
0.0 | 0.2 | GO:0030252 | growth hormone secretion(GO:0030252) |
0.0 | 0.3 | GO:0001967 | suckling behavior(GO:0001967) |
0.0 | 0.0 | GO:0002277 | myeloid dendritic cell activation involved in immune response(GO:0002277) |
0.0 | 0.1 | GO:0010826 | negative regulation of centrosome duplication(GO:0010826) negative regulation of centrosome cycle(GO:0046606) |
0.0 | 0.2 | GO:1901984 | negative regulation of protein acetylation(GO:1901984) negative regulation of peptidyl-lysine acetylation(GO:2000757) |
0.0 | 0.3 | GO:0006805 | xenobiotic metabolic process(GO:0006805) |
0.0 | 0.1 | GO:0075509 | receptor-mediated endocytosis of virus by host cell(GO:0019065) endocytosis involved in viral entry into host cell(GO:0075509) |
0.0 | 0.1 | GO:0060971 | embryonic heart tube left/right pattern formation(GO:0060971) |
0.0 | 0.0 | GO:0032286 | central nervous system myelin maintenance(GO:0032286) |
0.0 | 0.0 | GO:0010796 | regulation of multivesicular body size(GO:0010796) |
0.0 | 0.2 | GO:0015670 | carbon dioxide transport(GO:0015670) |
0.0 | 0.0 | GO:0038107 | nodal signaling pathway involved in determination of left/right asymmetry(GO:0038107) regulation of transcription from RNA polymerase II promoter involved in determination of left/right symmetry(GO:1900094) nodal signaling pathway involved in determination of lateral mesoderm left/right asymmetry(GO:1900164) |
0.0 | 0.1 | GO:0033314 | mitotic DNA replication checkpoint(GO:0033314) |
0.0 | 0.1 | GO:0018364 | peptidyl-glutamine methylation(GO:0018364) |
0.0 | 0.2 | GO:0042487 | regulation of odontogenesis of dentin-containing tooth(GO:0042487) |
0.0 | 0.2 | GO:0033262 | regulation of nuclear cell cycle DNA replication(GO:0033262) |
0.0 | 0.2 | GO:0002318 | myeloid progenitor cell differentiation(GO:0002318) |
0.0 | 0.2 | GO:0051770 | positive regulation of nitric-oxide synthase biosynthetic process(GO:0051770) |
0.0 | 0.1 | GO:0060766 | negative regulation of androgen receptor signaling pathway(GO:0060766) |
0.0 | 0.1 | GO:0000710 | meiotic mismatch repair(GO:0000710) |
0.0 | 0.0 | GO:0002215 | defense response to nematode(GO:0002215) |
0.0 | 0.0 | GO:0006543 | glutamine catabolic process(GO:0006543) |
0.0 | 0.0 | GO:0061620 | glycolytic process through glucose-6-phosphate(GO:0061620) |
0.0 | 0.0 | GO:0002439 | chronic inflammatory response to antigenic stimulus(GO:0002439) |
0.0 | 0.2 | GO:0034501 | protein localization to kinetochore(GO:0034501) |
0.0 | 0.0 | GO:0035093 | spermatogenesis, exchange of chromosomal proteins(GO:0035093) |
0.0 | 0.1 | GO:1900452 | regulation of long term synaptic depression(GO:1900452) |
0.0 | 0.1 | GO:0060346 | bone trabecula formation(GO:0060346) |
0.0 | 0.1 | GO:0051461 | positive regulation of corticotropin secretion(GO:0051461) |
0.0 | 0.1 | GO:0006824 | cobalt ion transport(GO:0006824) |
0.0 | 0.1 | GO:0006057 | cell wall mannoprotein biosynthetic process(GO:0000032) mannoprotein metabolic process(GO:0006056) mannoprotein biosynthetic process(GO:0006057) cell wall glycoprotein biosynthetic process(GO:0031506) cell wall biogenesis(GO:0042546) cell wall macromolecule biosynthetic process(GO:0044038) chain elongation of O-linked mannose residue(GO:0044845) cellular component macromolecule biosynthetic process(GO:0070589) |
0.0 | 0.2 | GO:0097284 | hepatocyte apoptotic process(GO:0097284) |
0.0 | 0.1 | GO:0036092 | phosphatidylinositol-3-phosphate biosynthetic process(GO:0036092) |
0.0 | 0.2 | GO:0033129 | positive regulation of histone phosphorylation(GO:0033129) |
0.0 | 0.8 | GO:0000245 | spliceosomal complex assembly(GO:0000245) |
0.0 | 0.1 | GO:0000087 | mitotic M phase(GO:0000087) |
0.0 | 0.0 | GO:0030908 | intein-mediated protein splicing(GO:0016539) protein splicing(GO:0030908) |
0.0 | 0.1 | GO:0046628 | positive regulation of insulin receptor signaling pathway(GO:0046628) |
0.0 | 0.3 | GO:0042773 | ATP synthesis coupled electron transport(GO:0042773) |
0.0 | 0.1 | GO:0008655 | pyrimidine-containing compound salvage(GO:0008655) pyrimidine nucleoside salvage(GO:0043097) |
0.0 | 0.1 | GO:0042789 | mRNA transcription from RNA polymerase II promoter(GO:0042789) |
0.0 | 0.1 | GO:0045409 | negative regulation of interleukin-6 biosynthetic process(GO:0045409) |
0.0 | 0.0 | GO:0035964 | COPI-coated vesicle budding(GO:0035964) |
0.0 | 0.0 | GO:0086012 | membrane depolarization during cardiac muscle cell action potential(GO:0086012) |
0.0 | 0.0 | GO:0035973 | aggrephagy(GO:0035973) |
0.0 | 0.1 | GO:0060178 | regulation of exocyst localization(GO:0060178) |
0.0 | 0.1 | GO:0071803 | positive regulation of podosome assembly(GO:0071803) |
0.0 | 0.1 | GO:0009133 | nucleoside diphosphate biosynthetic process(GO:0009133) |
0.0 | 0.3 | GO:0032011 | ARF protein signal transduction(GO:0032011) regulation of ARF protein signal transduction(GO:0032012) |
0.0 | 0.1 | GO:0051665 | membrane raft localization(GO:0051665) |
0.0 | 0.2 | GO:0071257 | cellular response to electrical stimulus(GO:0071257) |
0.0 | 0.0 | GO:0021764 | amygdala development(GO:0021764) |
0.0 | 0.2 | GO:0006198 | cAMP catabolic process(GO:0006198) |
0.0 | 0.1 | GO:0045213 | neurotransmitter receptor metabolic process(GO:0045213) |
0.0 | 0.1 | GO:0015820 | branched-chain amino acid transport(GO:0015803) leucine transport(GO:0015820) |
0.0 | 0.2 | GO:0008272 | sulfate transport(GO:0008272) |
0.0 | 0.1 | GO:0070966 | nuclear-transcribed mRNA catabolic process, no-go decay(GO:0070966) |
0.0 | 0.0 | GO:0033693 | neurofilament bundle assembly(GO:0033693) |
0.0 | 0.1 | GO:1900078 | positive regulation of cellular response to insulin stimulus(GO:1900078) |
0.0 | 0.0 | GO:0021699 | cerebellar cortex maturation(GO:0021699) |
0.0 | 0.1 | GO:0018026 | peptidyl-lysine monomethylation(GO:0018026) |
0.0 | 0.1 | GO:0045176 | apical protein localization(GO:0045176) |
0.0 | 0.1 | GO:0042723 | thiamine metabolic process(GO:0006772) thiamine-containing compound metabolic process(GO:0042723) |
0.0 | 0.1 | GO:0061641 | CENP-A containing nucleosome assembly(GO:0034080) CENP-A containing chromatin organization(GO:0061641) |
0.0 | 0.1 | GO:0010996 | response to auditory stimulus(GO:0010996) |
0.0 | 0.0 | GO:0070488 | neutrophil aggregation(GO:0070488) |
0.0 | 0.0 | GO:0045852 | pH elevation(GO:0045852) intracellular pH elevation(GO:0051454) |
0.0 | 0.1 | GO:0034720 | histone H3-K4 demethylation(GO:0034720) |
0.0 | 0.1 | GO:1902857 | positive regulation of nonmotile primary cilium assembly(GO:1902857) |
0.0 | 0.0 | GO:1904861 | excitatory synapse assembly(GO:1904861) |
0.0 | 0.2 | GO:0060487 | lung epithelial cell differentiation(GO:0060487) |
0.0 | 0.1 | GO:0023041 | neuronal signal transduction(GO:0023041) |
0.0 | 0.3 | GO:0045880 | positive regulation of smoothened signaling pathway(GO:0045880) |
0.0 | 0.1 | GO:1901070 | GTP biosynthetic process(GO:0006183) guanosine-containing compound biosynthetic process(GO:1901070) |
0.0 | 0.1 | GO:1902261 | positive regulation of delayed rectifier potassium channel activity(GO:1902261) positive regulation of voltage-gated potassium channel activity(GO:1903818) |
0.0 | 0.0 | GO:2001225 | regulation of chloride transport(GO:2001225) |
0.0 | 0.2 | GO:1901741 | positive regulation of myoblast fusion(GO:1901741) |
0.0 | 0.0 | GO:0035860 | glial cell-derived neurotrophic factor receptor signaling pathway(GO:0035860) |
0.0 | 0.1 | GO:1901552 | positive regulation of endothelial cell development(GO:1901552) positive regulation of establishment of endothelial barrier(GO:1903142) |
0.0 | 0.0 | GO:0003062 | regulation of heart rate by chemical signal(GO:0003062) |
0.0 | 0.1 | GO:0015816 | glycine transport(GO:0015816) |
0.0 | 0.0 | GO:0009957 | epidermal cell fate specification(GO:0009957) |
0.0 | 0.1 | GO:0044339 | canonical Wnt signaling pathway involved in osteoblast differentiation(GO:0044339) |
0.0 | 0.1 | GO:0042359 | vitamin D metabolic process(GO:0042359) |
0.0 | 0.0 | GO:1902075 | cellular response to salt(GO:1902075) |
0.0 | 0.1 | GO:0002087 | regulation of respiratory gaseous exchange by neurological system process(GO:0002087) |
0.0 | 0.1 | GO:2000535 | entry of bacterium into host cell(GO:0035635) regulation of entry of bacterium into host cell(GO:2000535) |
0.0 | 0.1 | GO:0030311 | poly-N-acetyllactosamine metabolic process(GO:0030309) poly-N-acetyllactosamine biosynthetic process(GO:0030311) |
0.0 | 0.0 | GO:0046543 | development of secondary female sexual characteristics(GO:0046543) |
0.0 | 0.0 | GO:0060051 | negative regulation of protein glycosylation(GO:0060051) |
0.0 | 0.0 | GO:0008090 | retrograde axonal transport(GO:0008090) |
0.0 | 0.0 | GO:0032482 | Rab protein signal transduction(GO:0032482) |
0.0 | 0.0 | GO:0034384 | high-density lipoprotein particle clearance(GO:0034384) |
0.0 | 0.0 | GO:0006362 | transcription elongation from RNA polymerase I promoter(GO:0006362) |
0.0 | 0.1 | GO:0097039 | protein linear polyubiquitination(GO:0097039) |
0.0 | 0.0 | GO:0061339 | establishment of monopolar cell polarity(GO:0061162) establishment or maintenance of monopolar cell polarity(GO:0061339) |
0.0 | 0.1 | GO:0001514 | selenocysteine incorporation(GO:0001514) translational readthrough(GO:0006451) |
0.0 | 0.0 | GO:0050968 | detection of chemical stimulus involved in sensory perception of pain(GO:0050968) |
0.0 | 0.1 | GO:0090160 | Golgi to lysosome transport(GO:0090160) |
0.0 | 0.1 | GO:0051031 | tRNA transport(GO:0051031) |
0.0 | 0.3 | GO:0008608 | attachment of spindle microtubules to kinetochore(GO:0008608) |
0.0 | 0.1 | GO:0016255 | attachment of GPI anchor to protein(GO:0016255) |
0.0 | 0.0 | GO:0043461 | proton-transporting ATP synthase complex assembly(GO:0043461) proton-transporting ATP synthase complex biogenesis(GO:0070272) |
0.0 | 0.0 | GO:0090027 | negative regulation of monocyte chemotaxis(GO:0090027) |
0.0 | 0.1 | GO:0086070 | SA node cell action potential(GO:0086015) SA node cell to atrial cardiac muscle cell signalling(GO:0086018) SA node cell to atrial cardiac muscle cell communication(GO:0086070) |
0.0 | 0.1 | GO:0042118 | endothelial cell activation(GO:0042118) |
0.0 | 0.0 | GO:0070525 | tRNA threonylcarbamoyladenosine metabolic process(GO:0070525) |
0.0 | 0.0 | GO:0000255 | allantoin metabolic process(GO:0000255) |
0.0 | 0.2 | GO:0000387 | spliceosomal snRNP assembly(GO:0000387) |
0.0 | 0.1 | GO:0006590 | thyroid hormone generation(GO:0006590) |
0.0 | 0.3 | GO:0046854 | phosphatidylinositol phosphorylation(GO:0046854) |
0.0 | 0.0 | GO:0019355 | nicotinamide nucleotide biosynthetic process from aspartate(GO:0019355) 'de novo' NAD biosynthetic process from aspartate(GO:0034628) |
0.0 | 0.0 | GO:0045416 | positive regulation of interleukin-8 biosynthetic process(GO:0045416) |
0.0 | 0.0 | GO:0017062 | respiratory chain complex III assembly(GO:0017062) mitochondrial respiratory chain complex III assembly(GO:0034551) mitochondrial respiratory chain complex III biogenesis(GO:0097033) |
0.0 | 0.4 | GO:0043550 | regulation of lipid kinase activity(GO:0043550) |
0.0 | 0.1 | GO:0080009 | mRNA methylation(GO:0080009) |
0.0 | 0.0 | GO:0060684 | epithelial-mesenchymal cell signaling(GO:0060684) |
0.0 | 0.1 | GO:0002092 | positive regulation of receptor internalization(GO:0002092) |
0.0 | 0.0 | GO:1903224 | regulation of endodermal cell differentiation(GO:1903224) negative regulation of endodermal cell differentiation(GO:1903225) negative regulation of gastrulation(GO:2000542) |
0.0 | 0.0 | GO:0055099 | response to high density lipoprotein particle(GO:0055099) |
0.0 | 0.0 | GO:0050932 | regulation of pigment cell differentiation(GO:0050932) positive regulation of pigment cell differentiation(GO:0050942) |
0.0 | 0.0 | GO:0090031 | positive regulation of steroid hormone biosynthetic process(GO:0090031) |
0.0 | 0.1 | GO:0032224 | positive regulation of synaptic transmission, cholinergic(GO:0032224) |
0.0 | 0.0 | GO:0019230 | proprioception(GO:0019230) |
0.0 | 0.1 | GO:0035970 | peptidyl-threonine dephosphorylation(GO:0035970) |
0.0 | 0.0 | GO:0001983 | baroreceptor response to increased systemic arterial blood pressure(GO:0001983) |
0.0 | 0.0 | GO:0045347 | negative regulation of MHC class II biosynthetic process(GO:0045347) |
0.0 | 0.0 | GO:0060591 | chondroblast differentiation(GO:0060591) |
0.0 | 0.4 | GO:0003333 | amino acid transmembrane transport(GO:0003333) |
0.0 | 0.1 | GO:0070307 | lens fiber cell development(GO:0070307) |
0.0 | 0.1 | GO:0010574 | regulation of vascular endothelial growth factor production(GO:0010574) |
0.0 | 0.0 | GO:0060278 | regulation of ovulation(GO:0060278) |
0.0 | 0.0 | GO:0070858 | negative regulation of bile acid biosynthetic process(GO:0070858) negative regulation of bile acid metabolic process(GO:1904252) |
0.0 | 0.0 | GO:0034653 | diterpenoid catabolic process(GO:0016103) retinoic acid catabolic process(GO:0034653) |
0.0 | 0.0 | GO:0032803 | low-density lipoprotein particle receptor catabolic process(GO:0032802) regulation of low-density lipoprotein particle receptor catabolic process(GO:0032803) |
0.0 | 0.0 | GO:0010248 | establishment or maintenance of transmembrane electrochemical gradient(GO:0010248) |
0.0 | 0.0 | GO:0070318 | positive regulation of G0 to G1 transition(GO:0070318) |
0.0 | 0.5 | GO:0046426 | negative regulation of JAK-STAT cascade(GO:0046426) negative regulation of STAT cascade(GO:1904893) |
0.0 | 0.0 | GO:0045964 | positive regulation of catecholamine metabolic process(GO:0045915) positive regulation of dopamine metabolic process(GO:0045964) |
0.0 | 0.0 | GO:0046951 | ketone body biosynthetic process(GO:0046951) |
0.0 | 0.1 | GO:1990126 | retrograde transport, endosome to plasma membrane(GO:1990126) |
0.0 | 0.0 | GO:0061325 | cell proliferation involved in outflow tract morphogenesis(GO:0061325) |
0.0 | 0.0 | GO:0039663 | fusion of virus membrane with host plasma membrane(GO:0019064) membrane fusion involved in viral entry into host cell(GO:0039663) multi-organism membrane fusion(GO:0044800) |
0.0 | 0.0 | GO:0044034 | negative stranded viral RNA replication(GO:0039689) multi-organism biosynthetic process(GO:0044034) |
0.0 | 0.0 | GO:2000727 | positive regulation of cardiac muscle cell differentiation(GO:2000727) |
0.0 | 0.1 | GO:0046598 | positive regulation of viral entry into host cell(GO:0046598) |
0.0 | 0.3 | GO:0048240 | sperm capacitation(GO:0048240) |
0.0 | 0.0 | GO:0001547 | antral ovarian follicle growth(GO:0001547) |
0.0 | 0.0 | GO:1904058 | positive regulation of sensory perception of pain(GO:1904058) |
0.0 | 0.0 | GO:0090274 | positive regulation of somatostatin secretion(GO:0090274) |
0.0 | 0.0 | GO:0006369 | termination of RNA polymerase II transcription(GO:0006369) |
0.0 | 0.1 | GO:0021859 | pyramidal neuron differentiation(GO:0021859) |
0.0 | 0.2 | GO:0032981 | NADH dehydrogenase complex assembly(GO:0010257) mitochondrial respiratory chain complex I assembly(GO:0032981) mitochondrial respiratory chain complex I biogenesis(GO:0097031) |
0.0 | 0.0 | GO:0048859 | formation of anatomical boundary(GO:0048859) |
0.0 | 0.1 | GO:0015813 | L-glutamate transport(GO:0015813) |
0.0 | 0.0 | GO:0010159 | specification of organ position(GO:0010159) |
0.0 | 0.1 | GO:0010165 | response to X-ray(GO:0010165) |
0.0 | 0.1 | GO:0019800 | peptide cross-linking via chondroitin 4-sulfate glycosaminoglycan(GO:0019800) |
0.0 | 0.0 | GO:0002540 | leukotriene production involved in inflammatory response(GO:0002540) |
0.0 | 0.0 | GO:0090191 | negative regulation of branching involved in ureteric bud morphogenesis(GO:0090191) |
0.0 | 0.3 | GO:0034605 | cellular response to heat(GO:0034605) |
0.0 | 0.1 | GO:0046174 | polyol catabolic process(GO:0046174) |
0.0 | 0.1 | GO:2001199 | negative regulation of dendritic cell differentiation(GO:2001199) |
0.0 | 0.2 | GO:0072661 | protein targeting to plasma membrane(GO:0072661) |
0.0 | 0.0 | GO:0045743 | positive regulation of fibroblast growth factor receptor signaling pathway(GO:0045743) |
0.0 | 0.0 | GO:0010387 | COP9 signalosome assembly(GO:0010387) |
0.0 | 0.1 | GO:0051127 | positive regulation of actin nucleation(GO:0051127) |
0.0 | 0.0 | GO:0035106 | operant conditioning(GO:0035106) |
0.0 | 0.0 | GO:0001302 | replicative cell aging(GO:0001302) |
0.0 | 0.2 | GO:0045475 | locomotor rhythm(GO:0045475) |
0.0 | 0.0 | GO:0060618 | nipple development(GO:0060618) |
0.0 | 0.0 | GO:0051572 | negative regulation of histone H3-K4 methylation(GO:0051572) |
0.0 | 0.0 | GO:1903265 | positive regulation of tumor necrosis factor-mediated signaling pathway(GO:1903265) |
0.0 | 0.1 | GO:0009313 | oligosaccharide catabolic process(GO:0009313) |
0.0 | 0.2 | GO:0030488 | tRNA methylation(GO:0030488) |
0.0 | 0.2 | GO:0045737 | positive regulation of cyclin-dependent protein serine/threonine kinase activity(GO:0045737) |
0.0 | 0.1 | GO:0060134 | prepulse inhibition(GO:0060134) |
0.0 | 0.1 | GO:0060546 | negative regulation of necroptotic process(GO:0060546) |
0.0 | 0.0 | GO:2000118 | regulation of sodium-dependent phosphate transport(GO:2000118) |
0.0 | 0.0 | GO:0048014 | Tie signaling pathway(GO:0048014) |
0.0 | 0.1 | GO:0017121 | phospholipid scrambling(GO:0017121) |
0.0 | 0.0 | GO:0060028 | convergent extension involved in axis elongation(GO:0060028) |
0.0 | 0.0 | GO:0030920 | N-terminal peptidyl-serine acetylation(GO:0017198) N-terminal peptidyl-glutamic acid acetylation(GO:0018002) peptidyl-serine acetylation(GO:0030920) |
0.0 | 0.0 | GO:2000508 | regulation of dendritic cell chemotaxis(GO:2000508) |
0.0 | 0.0 | GO:2000847 | negative regulation of steroid hormone secretion(GO:2000832) negative regulation of corticosteroid hormone secretion(GO:2000847) negative regulation of glucocorticoid secretion(GO:2000850) |
0.0 | 0.1 | GO:2001260 | regulation of semaphorin-plexin signaling pathway(GO:2001260) |
0.0 | 0.1 | GO:0043508 | negative regulation of JUN kinase activity(GO:0043508) |
0.0 | 0.1 | GO:0001710 | mesodermal cell fate commitment(GO:0001710) |
0.0 | 0.2 | GO:0001574 | ganglioside biosynthetic process(GO:0001574) |
0.0 | 0.1 | GO:1901142 | insulin metabolic process(GO:1901142) |
0.0 | 0.0 | GO:0045085 | negative regulation of interleukin-2 biosynthetic process(GO:0045085) |
0.0 | 0.1 | GO:0035162 | embryonic hemopoiesis(GO:0035162) |
0.0 | 0.1 | GO:0034398 | telomere tethering at nuclear periphery(GO:0034398) |
0.0 | 0.0 | GO:0030007 | cellular potassium ion homeostasis(GO:0030007) |
0.0 | 0.0 | GO:0034241 | positive regulation of macrophage fusion(GO:0034241) |
0.0 | 0.0 | GO:0061042 | vascular wound healing(GO:0061042) |
0.0 | 0.0 | GO:0015889 | cobalamin transport(GO:0015889) |
0.0 | 0.1 | GO:2000001 | regulation of DNA damage checkpoint(GO:2000001) |
0.0 | 0.0 | GO:0046477 | glycosylceramide catabolic process(GO:0046477) |
0.0 | 0.0 | GO:0032911 | negative regulation of transforming growth factor beta1 production(GO:0032911) |
0.0 | 0.0 | GO:0045163 | clustering of voltage-gated potassium channels(GO:0045163) |
0.0 | 0.0 | GO:0032714 | negative regulation of interleukin-5 production(GO:0032714) |
0.0 | 0.2 | GO:0051310 | metaphase plate congression(GO:0051310) |
0.0 | 0.0 | GO:1900193 | regulation of oocyte maturation(GO:1900193) |
0.0 | 0.0 | GO:0072240 | distal convoluted tubule development(GO:0072025) DCT cell differentiation(GO:0072069) metanephric distal convoluted tubule development(GO:0072221) metanephric distal tubule development(GO:0072235) metanephric DCT cell differentiation(GO:0072240) |
0.0 | 0.0 | GO:0032070 | regulation of deoxyribonuclease activity(GO:0032070) |
0.0 | 0.0 | GO:1904938 | dopaminergic neuron axon guidance(GO:0036514) planar cell polarity pathway involved in axon guidance(GO:1904938) |
0.0 | 0.1 | GO:0021542 | dentate gyrus development(GO:0021542) |
0.0 | 0.1 | GO:0046643 | regulation of gamma-delta T cell differentiation(GO:0045586) regulation of gamma-delta T cell activation(GO:0046643) |
0.0 | 0.0 | GO:0071504 | response to heparin(GO:0071503) cellular response to heparin(GO:0071504) |
0.0 | 0.0 | GO:1903299 | regulation of hexokinase activity(GO:1903299) |
0.0 | 0.1 | GO:0009312 | oligosaccharide biosynthetic process(GO:0009312) |
0.0 | 0.1 | GO:0010758 | regulation of macrophage chemotaxis(GO:0010758) |
0.0 | 0.0 | GO:0035092 | sperm chromatin condensation(GO:0035092) |
0.0 | 0.1 | GO:0007216 | G-protein coupled glutamate receptor signaling pathway(GO:0007216) |
0.0 | 0.0 | GO:0036265 | RNA (guanine-N7)-methylation(GO:0036265) |
0.0 | 0.1 | GO:0006390 | transcription from mitochondrial promoter(GO:0006390) |
0.0 | 0.0 | GO:0007066 | female meiosis sister chromatid cohesion(GO:0007066) |
0.0 | 0.1 | GO:0006857 | oligopeptide transport(GO:0006857) |
0.0 | 0.0 | GO:0021986 | epithalamus development(GO:0021538) habenula development(GO:0021986) |
0.0 | 0.1 | GO:0007341 | penetration of zona pellucida(GO:0007341) |
0.0 | 0.1 | GO:0045722 | positive regulation of gluconeogenesis(GO:0045722) |
0.0 | 0.1 | GO:0046784 | viral mRNA export from host cell nucleus(GO:0046784) |
0.0 | 0.0 | GO:2000354 | regulation of ovarian follicle development(GO:2000354) |
0.0 | 0.0 | GO:0060754 | positive regulation of mast cell chemotaxis(GO:0060754) |
0.0 | 0.1 | GO:0060046 | regulation of acrosome reaction(GO:0060046) |
0.0 | 0.1 | GO:0006337 | nucleosome disassembly(GO:0006337) chromatin disassembly(GO:0031498) protein-DNA complex disassembly(GO:0032986) |
0.0 | 0.0 | GO:0000301 | retrograde transport, vesicle recycling within Golgi(GO:0000301) |
0.0 | 0.0 | GO:0090365 | regulation of mRNA modification(GO:0090365) |
0.0 | 0.0 | GO:0046835 | carbohydrate phosphorylation(GO:0046835) |
0.0 | 0.0 | GO:1902932 | positive regulation of alcohol biosynthetic process(GO:1902932) |
0.0 | 0.1 | GO:1900017 | positive regulation of cytokine production involved in inflammatory response(GO:1900017) |
0.0 | 0.0 | GO:0006266 | DNA ligation(GO:0006266) |
0.0 | 0.0 | GO:0002678 | positive regulation of chronic inflammatory response(GO:0002678) |
0.0 | 0.0 | GO:0021942 | radial glia guided migration of Purkinje cell(GO:0021942) |
0.0 | 0.1 | GO:0071392 | cellular response to estradiol stimulus(GO:0071392) |
0.0 | 0.0 | GO:1902474 | positive regulation of protein localization to synapse(GO:1902474) |
0.0 | 0.1 | GO:0010961 | cellular magnesium ion homeostasis(GO:0010961) |
0.0 | 0.0 | GO:2000546 | positive regulation of cell chemotaxis to fibroblast growth factor(GO:1904849) positive regulation of endothelial cell chemotaxis to fibroblast growth factor(GO:2000546) |
0.0 | 0.0 | GO:0043416 | regulation of skeletal muscle tissue regeneration(GO:0043416) |
0.0 | 0.0 | GO:0060084 | synaptic transmission involved in micturition(GO:0060084) |
0.0 | 0.0 | GO:0090224 | regulation of spindle organization(GO:0090224) |
0.0 | 0.0 | GO:0009138 | pyrimidine nucleoside diphosphate metabolic process(GO:0009138) |
0.0 | 0.1 | GO:0031116 | positive regulation of microtubule polymerization(GO:0031116) |
0.0 | 0.1 | GO:2000288 | positive regulation of myoblast proliferation(GO:2000288) |
0.0 | 0.0 | GO:0048752 | semicircular canal morphogenesis(GO:0048752) |
0.0 | 0.0 | GO:0006531 | aspartate metabolic process(GO:0006531) |
0.0 | 0.3 | GO:0048168 | regulation of neuronal synaptic plasticity(GO:0048168) |
0.0 | 0.0 | GO:0015871 | choline transport(GO:0015871) |
0.0 | 0.0 | GO:0060017 | parathyroid gland development(GO:0060017) |
0.0 | 0.1 | GO:0002098 | tRNA wobble uridine modification(GO:0002098) |
0.0 | 0.0 | GO:0002370 | natural killer cell cytokine production(GO:0002370) regulation of natural killer cell cytokine production(GO:0002727) |
0.0 | 0.0 | GO:0071043 | CUT catabolic process(GO:0071034) CUT metabolic process(GO:0071043) |
0.0 | 0.1 | GO:0002931 | response to ischemia(GO:0002931) |
0.0 | 0.0 | GO:1903596 | regulation of gap junction assembly(GO:1903596) |
0.0 | 0.1 | GO:0006012 | galactose metabolic process(GO:0006012) |
0.0 | 0.0 | GO:0043137 | DNA replication, removal of RNA primer(GO:0043137) |
0.0 | 0.0 | GO:1902255 | positive regulation of intrinsic apoptotic signaling pathway by p53 class mediator(GO:1902255) |
0.0 | 0.0 | GO:0031293 | membrane protein intracellular domain proteolysis(GO:0031293) |
0.0 | 0.0 | GO:0045842 | positive regulation of mitotic metaphase/anaphase transition(GO:0045842) positive regulation of metaphase/anaphase transition of cell cycle(GO:1902101) |
0.0 | 0.0 | GO:1902572 | regulation of serine-type endopeptidase activity(GO:1900003) negative regulation of serine-type endopeptidase activity(GO:1900004) regulation of serine-type peptidase activity(GO:1902571) negative regulation of serine-type peptidase activity(GO:1902572) |
0.0 | 0.1 | GO:0006474 | N-terminal protein amino acid acetylation(GO:0006474) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
1.1 | 3.3 | GO:0097487 | multivesicular body, internal vesicle(GO:0097487) |
0.3 | 1.3 | GO:0005955 | calcineurin complex(GO:0005955) |
0.3 | 1.3 | GO:0045098 | type III intermediate filament(GO:0045098) |
0.2 | 1.0 | GO:1990712 | HFE-transferrin receptor complex(GO:1990712) |
0.2 | 0.8 | GO:0044316 | cone cell pedicle(GO:0044316) |
0.2 | 1.7 | GO:0016342 | catenin complex(GO:0016342) |
0.2 | 1.2 | GO:0072669 | tRNA-splicing ligase complex(GO:0072669) |
0.2 | 0.8 | GO:0005579 | membrane attack complex(GO:0005579) |
0.1 | 0.6 | GO:0035867 | alphav-beta3 integrin-IGF-1-IGF1R complex(GO:0035867) |
0.1 | 1.3 | GO:0045263 | proton-transporting ATP synthase complex, coupling factor F(o)(GO:0045263) |
0.1 | 0.4 | GO:0032444 | activin responsive factor complex(GO:0032444) |
0.1 | 0.5 | GO:0032777 | Piccolo NuA4 histone acetyltransferase complex(GO:0032777) |
0.1 | 0.6 | GO:0043202 | lysosomal lumen(GO:0043202) |
0.1 | 0.5 | GO:0044530 | supraspliceosomal complex(GO:0044530) |
0.1 | 0.6 | GO:0031315 | extrinsic component of mitochondrial outer membrane(GO:0031315) |
0.1 | 0.3 | GO:0060053 | neurofilament cytoskeleton(GO:0060053) |
0.1 | 1.3 | GO:0034663 | endoplasmic reticulum chaperone complex(GO:0034663) |
0.1 | 0.4 | GO:0000408 | EKC/KEOPS complex(GO:0000408) |
0.1 | 0.3 | GO:0005827 | polar microtubule(GO:0005827) |
0.1 | 0.6 | GO:0070775 | H3 histone acetyltransferase complex(GO:0070775) MOZ/MORF histone acetyltransferase complex(GO:0070776) |
0.1 | 0.6 | GO:0035032 | phosphatidylinositol 3-kinase complex, class III(GO:0035032) |
0.1 | 0.3 | GO:0030981 | cortical microtubule cytoskeleton(GO:0030981) |
0.1 | 0.9 | GO:0070852 | cell body fiber(GO:0070852) |
0.1 | 0.4 | GO:0070876 | SOSS complex(GO:0070876) |
0.1 | 0.4 | GO:0044308 | axonal spine(GO:0044308) |
0.1 | 0.3 | GO:0048179 | activin receptor complex(GO:0048179) |
0.1 | 3.9 | GO:0042645 | nucleoid(GO:0009295) mitochondrial nucleoid(GO:0042645) |
0.1 | 0.3 | GO:0005726 | perichromatin fibrils(GO:0005726) |
0.1 | 0.3 | GO:1990851 | Wnt-Frizzled-LRP5/6 complex(GO:1990851) |
0.1 | 0.4 | GO:0031298 | replication fork protection complex(GO:0031298) |
0.1 | 0.3 | GO:0016602 | CCAAT-binding factor complex(GO:0016602) |
0.1 | 0.5 | GO:0044233 | ER-mitochondrion membrane contact site(GO:0044233) |
0.1 | 0.3 | GO:0032437 | cuticular plate(GO:0032437) |
0.1 | 0.7 | GO:0030061 | mitochondrial crista(GO:0030061) |
0.1 | 0.3 | GO:0045293 | mRNA editing complex(GO:0045293) |
0.1 | 0.5 | GO:0031314 | extrinsic component of mitochondrial inner membrane(GO:0031314) |
0.1 | 0.2 | GO:0070939 | Dsl1p complex(GO:0070939) |
0.1 | 0.2 | GO:0071942 | XPC complex(GO:0071942) |
0.1 | 0.5 | GO:0042587 | glycogen granule(GO:0042587) |
0.1 | 1.2 | GO:0000930 | gamma-tubulin complex(GO:0000930) |
0.1 | 0.2 | GO:0097441 | basilar dendrite(GO:0097441) |
0.1 | 0.6 | GO:0030122 | AP-2 adaptor complex(GO:0030122) |
0.1 | 0.5 | GO:0000306 | extrinsic component of vacuolar membrane(GO:0000306) |
0.1 | 0.2 | GO:0070765 | gamma-secretase complex(GO:0070765) |
0.1 | 0.3 | GO:0005610 | laminin-5 complex(GO:0005610) |
0.1 | 0.2 | GO:0097149 | centralspindlin complex(GO:0097149) |
0.1 | 0.3 | GO:0030127 | COPII vesicle coat(GO:0030127) |
0.1 | 0.2 | GO:0032541 | cortical endoplasmic reticulum(GO:0032541) |
0.1 | 0.3 | GO:0016461 | unconventional myosin complex(GO:0016461) |
0.1 | 0.1 | GO:0000125 | PCAF complex(GO:0000125) |
0.1 | 0.3 | GO:0014731 | spectrin-associated cytoskeleton(GO:0014731) |
0.1 | 0.2 | GO:0044615 | nuclear pore nuclear basket(GO:0044615) |
0.1 | 0.8 | GO:0019908 | nuclear cyclin-dependent protein kinase holoenzyme complex(GO:0019908) |
0.1 | 0.2 | GO:0002142 | stereocilia ankle link complex(GO:0002142) |
0.1 | 0.1 | GO:0032280 | symmetric synapse(GO:0032280) |
0.1 | 0.3 | GO:0001652 | granular component(GO:0001652) |
0.1 | 0.2 | GO:0098536 | deuterosome(GO:0098536) |
0.1 | 0.6 | GO:0031588 | nucleotide-activated protein kinase complex(GO:0031588) |
0.1 | 0.2 | GO:0005915 | zonula adherens(GO:0005915) |
0.1 | 0.2 | GO:0044611 | nuclear pore inner ring(GO:0044611) |
0.1 | 0.2 | GO:0097342 | ripoptosome(GO:0097342) |
0.1 | 0.2 | GO:0071203 | WASH complex(GO:0071203) |
0.1 | 0.8 | GO:0000307 | cyclin-dependent protein kinase holoenzyme complex(GO:0000307) |
0.0 | 0.1 | GO:0002193 | MAML1-RBP-Jkappa- ICN1 complex(GO:0002193) |
0.0 | 0.2 | GO:0031265 | CD95 death-inducing signaling complex(GO:0031265) |
0.0 | 0.9 | GO:0043034 | costamere(GO:0043034) |
0.0 | 0.1 | GO:0031074 | nucleocytoplasmic shuttling complex(GO:0031074) |
0.0 | 0.2 | GO:0005593 | FACIT collagen trimer(GO:0005593) |
0.0 | 0.3 | GO:0070688 | MLL5-L complex(GO:0070688) |
0.0 | 0.3 | GO:0001650 | fibrillar center(GO:0001650) |
0.0 | 0.5 | GO:0032797 | SMN complex(GO:0032797) |
0.0 | 0.2 | GO:0044194 | cytolytic granule(GO:0044194) |
0.0 | 0.2 | GO:0008290 | F-actin capping protein complex(GO:0008290) |
0.0 | 0.2 | GO:0000275 | mitochondrial proton-transporting ATP synthase complex, catalytic core F(1)(GO:0000275) proton-transporting ATP synthase complex, catalytic core F(1)(GO:0045261) |
0.0 | 0.2 | GO:0031618 | nuclear pericentric heterochromatin(GO:0031618) |
0.0 | 0.7 | GO:0097038 | perinuclear endoplasmic reticulum(GO:0097038) |
0.0 | 0.6 | GO:0005665 | DNA-directed RNA polymerase II, core complex(GO:0005665) |
0.0 | 0.1 | GO:1990316 | ATG1/ULK1 kinase complex(GO:1990316) |
0.0 | 0.2 | GO:0072487 | MSL complex(GO:0072487) |
0.0 | 0.4 | GO:0000815 | ESCRT III complex(GO:0000815) |
0.0 | 0.3 | GO:0005664 | origin recognition complex(GO:0000808) nuclear origin of replication recognition complex(GO:0005664) |
0.0 | 0.8 | GO:0005686 | U2 snRNP(GO:0005686) |
0.0 | 0.0 | GO:0030120 | vesicle coat(GO:0030120) |
0.0 | 0.1 | GO:0098803 | respiratory chain complex(GO:0098803) |
0.0 | 0.0 | GO:0031261 | DNA replication preinitiation complex(GO:0031261) |
0.0 | 0.5 | GO:0030134 | ER to Golgi transport vesicle(GO:0030134) |
0.0 | 1.5 | GO:0030964 | mitochondrial respiratory chain complex I(GO:0005747) NADH dehydrogenase complex(GO:0030964) respiratory chain complex I(GO:0045271) |
0.0 | 1.2 | GO:0005891 | voltage-gated calcium channel complex(GO:0005891) |
0.0 | 0.1 | GO:1990745 | EARP complex(GO:1990745) |
0.0 | 0.1 | GO:0036449 | microtubule minus-end(GO:0036449) |
0.0 | 0.3 | GO:0044666 | MLL3/4 complex(GO:0044666) |
0.0 | 0.1 | GO:0043259 | laminin-10 complex(GO:0043259) |
0.0 | 0.1 | GO:0030689 | Noc complex(GO:0030689) |
0.0 | 0.1 | GO:0097025 | MPP7-DLG1-LIN7 complex(GO:0097025) |
0.0 | 0.0 | GO:0032133 | chromosome passenger complex(GO:0032133) |
0.0 | 0.2 | GO:1990111 | spermatoproteasome complex(GO:1990111) |
0.0 | 0.3 | GO:0005750 | mitochondrial respiratory chain complex III(GO:0005750) respiratory chain complex III(GO:0045275) |
0.0 | 0.3 | GO:0008250 | oligosaccharyltransferase complex(GO:0008250) |
0.0 | 0.2 | GO:0030062 | mitochondrial tricarboxylic acid cycle enzyme complex(GO:0030062) |
0.0 | 0.6 | GO:0032588 | trans-Golgi network membrane(GO:0032588) |
0.0 | 0.5 | GO:0030014 | CCR4-NOT complex(GO:0030014) |
0.0 | 0.1 | GO:0009331 | glycerol-3-phosphate dehydrogenase complex(GO:0009331) |
0.0 | 0.1 | GO:0005899 | insulin receptor complex(GO:0005899) |
0.0 | 0.3 | GO:0005771 | multivesicular body(GO:0005771) |
0.0 | 0.3 | GO:0042613 | MHC class II protein complex(GO:0042613) |
0.0 | 0.0 | GO:0002178 | palmitoyltransferase complex(GO:0002178) |
0.0 | 0.5 | GO:0005719 | nuclear euchromatin(GO:0005719) |
0.0 | 0.7 | GO:0005865 | striated muscle thin filament(GO:0005865) |
0.0 | 0.3 | GO:0098533 | ATPase dependent transmembrane transport complex(GO:0098533) |
0.0 | 0.1 | GO:1990131 | EGO complex(GO:0034448) Gtr1-Gtr2 GTPase complex(GO:1990131) |
0.0 | 0.8 | GO:0000314 | organellar small ribosomal subunit(GO:0000314) mitochondrial small ribosomal subunit(GO:0005763) |
0.0 | 0.1 | GO:0045009 | melanosome membrane(GO:0033162) chitosome(GO:0045009) |
0.0 | 0.1 | GO:0044614 | nuclear pore cytoplasmic filaments(GO:0044614) |
0.0 | 0.3 | GO:0036513 | Derlin-1 retrotranslocation complex(GO:0036513) |
0.0 | 0.1 | GO:0097543 | ciliary inversin compartment(GO:0097543) |
0.0 | 0.1 | GO:0005956 | protein kinase CK2 complex(GO:0005956) |
0.0 | 0.1 | GO:0097413 | Lewy body(GO:0097413) |
0.0 | 0.1 | GO:0042824 | MHC class I peptide loading complex(GO:0042824) |
0.0 | 0.1 | GO:0030896 | checkpoint clamp complex(GO:0030896) |
0.0 | 0.4 | GO:0071012 | catalytic step 1 spliceosome(GO:0071012) |
0.0 | 1.0 | GO:0030315 | T-tubule(GO:0030315) |
0.0 | 0.1 | GO:0000110 | nucleotide-excision repair factor 1 complex(GO:0000110) |
0.0 | 0.1 | GO:0045180 | basal cortex(GO:0045180) |
0.0 | 0.1 | GO:0005958 | DNA-dependent protein kinase-DNA ligase 4 complex(GO:0005958) |
0.0 | 0.1 | GO:0033186 | CAF-1 complex(GO:0033186) |
0.0 | 0.1 | GO:0090661 | box H/ACA telomerase RNP complex(GO:0090661) |
0.0 | 0.2 | GO:0032982 | myosin filament(GO:0032982) |
0.0 | 0.1 | GO:0002189 | ribose phosphate diphosphokinase complex(GO:0002189) |
0.0 | 0.1 | GO:0000942 | condensed nuclear chromosome outer kinetochore(GO:0000942) |
0.0 | 0.1 | GO:0044352 | pinosome(GO:0044352) macropinosome(GO:0044354) |
0.0 | 0.1 | GO:0071598 | neuronal ribonucleoprotein granule(GO:0071598) |
0.0 | 0.1 | GO:0044294 | dendritic growth cone(GO:0044294) |
0.0 | 0.1 | GO:0000164 | protein phosphatase type 1 complex(GO:0000164) |
0.0 | 0.1 | GO:0016281 | eukaryotic translation initiation factor 4F complex(GO:0016281) |
0.0 | 0.1 | GO:0034673 | inhibin-betaglycan-ActRII complex(GO:0034673) |
0.0 | 0.1 | GO:0030132 | clathrin coat of coated pit(GO:0030132) |
0.0 | 0.2 | GO:0070578 | RISC-loading complex(GO:0070578) |
0.0 | 0.1 | GO:0005640 | nuclear outer membrane(GO:0005640) |
0.0 | 0.4 | GO:0097228 | sperm principal piece(GO:0097228) |
0.0 | 1.1 | GO:0032587 | ruffle membrane(GO:0032587) |
0.0 | 0.1 | GO:0097208 | alveolar lamellar body(GO:0097208) |
0.0 | 0.2 | GO:0046930 | pore complex(GO:0046930) |
0.0 | 0.1 | GO:0031094 | platelet dense tubular network(GO:0031094) |
0.0 | 0.0 | GO:0008091 | spectrin(GO:0008091) |
0.0 | 0.1 | GO:0042719 | mitochondrial intermembrane space protein transporter complex(GO:0042719) |
0.0 | 0.1 | GO:0032593 | insulin-responsive compartment(GO:0032593) |
0.0 | 0.1 | GO:0002177 | manchette(GO:0002177) |
0.0 | 0.1 | GO:0031464 | Cul4A-RING E3 ubiquitin ligase complex(GO:0031464) |
0.0 | 0.1 | GO:0030289 | protein phosphatase 4 complex(GO:0030289) |
0.0 | 0.8 | GO:0005788 | endoplasmic reticulum lumen(GO:0005788) |
0.0 | 0.1 | GO:0001939 | female pronucleus(GO:0001939) |
0.0 | 0.2 | GO:0030867 | rough endoplasmic reticulum membrane(GO:0030867) |
0.0 | 0.1 | GO:0043159 | acrosomal matrix(GO:0043159) |
0.0 | 0.3 | GO:0016460 | myosin II complex(GO:0016460) |
0.0 | 0.2 | GO:0042582 | primary lysosome(GO:0005766) azurophil granule(GO:0042582) |
0.0 | 0.1 | GO:0032127 | dense core granule membrane(GO:0032127) |
0.0 | 0.9 | GO:0005778 | peroxisomal membrane(GO:0005778) microbody membrane(GO:0031903) |
0.0 | 0.1 | GO:0005845 | mRNA cap binding complex(GO:0005845) RNA cap binding complex(GO:0034518) |
0.0 | 0.2 | GO:0010369 | chromocenter(GO:0010369) |
0.0 | 0.1 | GO:0072357 | PTW/PP1 phosphatase complex(GO:0072357) |
0.0 | 0.1 | GO:1990597 | AIP1-IRE1 complex(GO:1990597) |
0.0 | 0.1 | GO:0097209 | epidermal lamellar body(GO:0097209) |
0.0 | 0.1 | GO:0097546 | ciliary base(GO:0097546) |
0.0 | 0.2 | GO:0005682 | U5 snRNP(GO:0005682) |
0.0 | 0.1 | GO:0033276 | transcription factor TFTC complex(GO:0033276) |
0.0 | 0.0 | GO:0097057 | TRAF2-GSTP1 complex(GO:0097057) |
0.0 | 2.2 | GO:0005759 | mitochondrial matrix(GO:0005759) |
0.0 | 0.0 | GO:0097504 | Gemini of coiled bodies(GO:0097504) |
0.0 | 0.1 | GO:0043625 | delta DNA polymerase complex(GO:0043625) |
0.0 | 0.1 | GO:0097452 | GAIT complex(GO:0097452) |
0.0 | 0.2 | GO:0000124 | SAGA complex(GO:0000124) |
0.0 | 0.0 | GO:1990423 | RZZ complex(GO:1990423) |
0.0 | 0.1 | GO:0031211 | serine C-palmitoyltransferase complex(GO:0017059) endoplasmic reticulum palmitoyltransferase complex(GO:0031211) |
0.0 | 0.3 | GO:0030992 | intraciliary transport particle B(GO:0030992) |
0.0 | 0.1 | GO:0042765 | GPI-anchor transamidase complex(GO:0042765) |
0.0 | 0.1 | GO:0005952 | cAMP-dependent protein kinase complex(GO:0005952) |
0.0 | 0.3 | GO:0042470 | melanosome(GO:0042470) pigment granule(GO:0048770) |
0.0 | 0.4 | GO:0051233 | spindle midzone(GO:0051233) |
0.0 | 0.1 | GO:0035749 | myelin sheath adaxonal region(GO:0035749) |
0.0 | 0.2 | GO:1902562 | NuA4 histone acetyltransferase complex(GO:0035267) H4/H2A histone acetyltransferase complex(GO:0043189) H4 histone acetyltransferase complex(GO:1902562) |
0.0 | 0.1 | GO:0097225 | sperm midpiece(GO:0097225) |
0.0 | 0.2 | GO:0005942 | phosphatidylinositol 3-kinase complex(GO:0005942) |
0.0 | 0.0 | GO:0042599 | lamellar body(GO:0042599) |
0.0 | 0.1 | GO:0070419 | nonhomologous end joining complex(GO:0070419) |
0.0 | 0.2 | GO:0005839 | proteasome core complex(GO:0005839) |
0.0 | 0.3 | GO:0044665 | MLL1/2 complex(GO:0044665) MLL1 complex(GO:0071339) |
0.0 | 0.1 | GO:0097470 | ribbon synapse(GO:0097470) |
0.0 | 0.8 | GO:0016605 | PML body(GO:0016605) |
0.0 | 0.0 | GO:0055087 | Ski complex(GO:0055087) |
0.0 | 0.0 | GO:1903349 | omegasome membrane(GO:1903349) |
0.0 | 0.1 | GO:1990909 | Wnt signalosome(GO:1990909) |
0.0 | 0.0 | GO:0097433 | dense body(GO:0097433) |
0.0 | 0.2 | GO:0008540 | proteasome regulatory particle, base subcomplex(GO:0008540) |
0.0 | 0.0 | GO:0071008 | U2-type post-mRNA release spliceosomal complex(GO:0071008) |
0.0 | 0.0 | GO:0042827 | platelet dense granule(GO:0042827) |
0.0 | 0.0 | GO:0031597 | cytosolic proteasome complex(GO:0031597) |
0.0 | 0.1 | GO:0030126 | COPI vesicle coat(GO:0030126) |
0.0 | 0.1 | GO:0005744 | mitochondrial inner membrane presequence translocase complex(GO:0005744) |
0.0 | 0.1 | GO:0046581 | intercellular canaliculus(GO:0046581) |
0.0 | 0.1 | GO:0005851 | eukaryotic translation initiation factor 2B complex(GO:0005851) |
0.0 | 0.1 | GO:0030665 | clathrin-coated vesicle membrane(GO:0030665) |
0.0 | 0.4 | GO:0032040 | small-subunit processome(GO:0032040) |
0.0 | 0.1 | GO:0034709 | methylosome(GO:0034709) |
0.0 | 0.1 | GO:0017101 | aminoacyl-tRNA synthetase multienzyme complex(GO:0017101) |
0.0 | 0.0 | GO:0061689 | tricellular tight junction(GO:0061689) |
0.0 | 0.1 | GO:0008074 | guanylate cyclase complex, soluble(GO:0008074) |
0.0 | 0.1 | GO:0031010 | ISWI-type complex(GO:0031010) |
0.0 | 0.2 | GO:0005614 | interstitial matrix(GO:0005614) |
0.0 | 0.1 | GO:0000445 | THO complex(GO:0000347) THO complex part of transcription export complex(GO:0000445) |
0.0 | 0.9 | GO:0005930 | axoneme(GO:0005930) ciliary plasm(GO:0097014) |
0.0 | 0.6 | GO:0000922 | spindle pole(GO:0000922) |
0.0 | 0.0 | GO:0016939 | kinesin II complex(GO:0016939) |
0.0 | 0.1 | GO:0070695 | FHF complex(GO:0070695) |
0.0 | 0.1 | GO:0032300 | mismatch repair complex(GO:0032300) |
0.0 | 0.1 | GO:0070069 | cytochrome complex(GO:0070069) |
0.0 | 0.2 | GO:0001673 | male germ cell nucleus(GO:0001673) |
0.0 | 0.1 | GO:0001527 | microfibril(GO:0001527) |
0.0 | 0.0 | GO:0032591 | dendritic spine membrane(GO:0032591) |
0.0 | 0.0 | GO:0030478 | actin cap(GO:0030478) |
0.0 | 0.1 | GO:0034362 | low-density lipoprotein particle(GO:0034362) |
0.0 | 0.0 | GO:0031512 | motile primary cilium(GO:0031512) |
0.0 | 0.0 | GO:0097427 | microtubule bundle(GO:0097427) |
0.0 | 0.1 | GO:0071986 | Ragulator complex(GO:0071986) |
0.0 | 0.2 | GO:0030131 | clathrin adaptor complex(GO:0030131) |
0.0 | 0.2 | GO:0031233 | intrinsic component of external side of plasma membrane(GO:0031233) |
0.0 | 12.0 | GO:0005783 | endoplasmic reticulum(GO:0005783) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
1.1 | 3.3 | GO:0005006 | epidermal growth factor-activated receptor activity(GO:0005006) |
0.9 | 2.7 | GO:0016743 | carboxyl- or carbamoyltransferase activity(GO:0016743) |
0.4 | 2.2 | GO:0004768 | stearoyl-CoA 9-desaturase activity(GO:0004768) |
0.3 | 1.0 | GO:0016215 | acyl-CoA desaturase activity(GO:0016215) |
0.3 | 0.9 | GO:0004771 | sterol esterase activity(GO:0004771) |
0.3 | 0.9 | GO:0005220 | inositol 1,4,5-trisphosphate-sensitive calcium-release channel activity(GO:0005220) |
0.2 | 1.0 | GO:0034056 | estrogen response element binding(GO:0034056) |
0.2 | 0.7 | GO:0004924 | oncostatin-M receptor activity(GO:0004924) |
0.2 | 0.5 | GO:0070644 | vitamin D response element binding(GO:0070644) |
0.2 | 1.5 | GO:0005381 | iron ion transmembrane transporter activity(GO:0005381) |
0.2 | 0.6 | GO:0004366 | glycerol-3-phosphate O-acyltransferase activity(GO:0004366) |
0.2 | 0.6 | GO:0004505 | phenylalanine 4-monooxygenase activity(GO:0004505) |
0.2 | 1.7 | GO:0004499 | N,N-dimethylaniline monooxygenase activity(GO:0004499) |
0.2 | 0.5 | GO:0036042 | long-chain fatty acyl-CoA binding(GO:0036042) |
0.2 | 0.9 | GO:0052723 | inositol hexakisphosphate kinase activity(GO:0000828) inositol hexakisphosphate 5-kinase activity(GO:0000832) inositol hexakisphosphate 1-kinase activity(GO:0052723) inositol hexakisphosphate 3-kinase activity(GO:0052724) |
0.2 | 0.5 | GO:0004013 | adenosylhomocysteinase activity(GO:0004013) trialkylsulfonium hydrolase activity(GO:0016802) |
0.2 | 0.7 | GO:0071614 | linoleic acid epoxygenase activity(GO:0071614) |
0.2 | 0.5 | GO:0050510 | N-acetylgalactosaminyl-proteoglycan 3-beta-glucuronosyltransferase activity(GO:0050510) |
0.2 | 0.8 | GO:0070728 | leucine binding(GO:0070728) |
0.2 | 0.9 | GO:0097322 | 7SK snRNA binding(GO:0097322) |
0.2 | 0.5 | GO:0038181 | bile acid receptor activity(GO:0038181) |
0.1 | 1.2 | GO:0005167 | neurotrophin TRK receptor binding(GO:0005167) |
0.1 | 0.7 | GO:0004769 | steroid delta-isomerase activity(GO:0004769) |
0.1 | 0.4 | GO:0047961 | glycine N-acyltransferase activity(GO:0047961) |
0.1 | 0.4 | GO:0003986 | acetyl-CoA hydrolase activity(GO:0003986) |
0.1 | 0.4 | GO:0004024 | alcohol dehydrogenase activity, zinc-dependent(GO:0004024) |
0.1 | 0.5 | GO:0015183 | L-aspartate transmembrane transporter activity(GO:0015183) |
0.1 | 1.6 | GO:0051787 | misfolded protein binding(GO:0051787) |
0.1 | 0.4 | GO:0043398 | HLH domain binding(GO:0043398) |
0.1 | 0.4 | GO:0016842 | amidine-lyase activity(GO:0016842) |
0.1 | 0.6 | GO:0004075 | biotin carboxylase activity(GO:0004075) |
0.1 | 1.4 | GO:0008195 | phosphatidate phosphatase activity(GO:0008195) |
0.1 | 0.7 | GO:0005072 | transforming growth factor beta receptor, cytoplasmic mediator activity(GO:0005072) |
0.1 | 0.5 | GO:1990239 | steroid hormone binding(GO:1990239) |
0.1 | 2.9 | GO:0052715 | calmodulin-dependent cyclic-nucleotide phosphodiesterase activity(GO:0004117) cGMP-stimulated cyclic-nucleotide phosphodiesterase activity(GO:0004118) cGMP-inhibited cyclic-nucleotide phosphodiesterase activity(GO:0004119) photoreceptor cyclic-nucleotide phosphodiesterase activity(GO:0004120) 7,8-dihydro-D-neopterin 2',3'-cyclic phosphate phosphodiesterase activity(GO:0044688) inositol phosphosphingolipid phospholipase activity(GO:0052712) inositol phosphorylceramide phospholipase activity(GO:0052713) mannosyl-inositol phosphorylceramide phospholipase activity(GO:0052714) mannosyl-diinositol phosphorylceramide phospholipase activity(GO:0052715) |
0.1 | 0.3 | GO:0008597 | calcium-dependent protein serine/threonine phosphatase regulator activity(GO:0008597) |
0.1 | 0.5 | GO:0033142 | progesterone receptor binding(GO:0033142) |
0.1 | 0.3 | GO:0008732 | threonine aldolase activity(GO:0004793) L-allo-threonine aldolase activity(GO:0008732) |
0.1 | 0.4 | GO:0005025 | transforming growth factor beta receptor activity, type I(GO:0005025) |
0.1 | 2.1 | GO:0003785 | actin monomer binding(GO:0003785) |
0.1 | 0.2 | GO:0019788 | NEDD8 transferase activity(GO:0019788) |
0.1 | 1.1 | GO:0045294 | alpha-catenin binding(GO:0045294) |
0.1 | 0.5 | GO:0051525 | NFAT protein binding(GO:0051525) |
0.1 | 0.4 | GO:0097001 | ceramide binding(GO:0097001) |
0.1 | 0.3 | GO:0031826 | type 2A serotonin receptor binding(GO:0031826) |
0.1 | 0.3 | GO:0097200 | cysteine-type endopeptidase activity involved in execution phase of apoptosis(GO:0097200) |
0.1 | 0.4 | GO:0003917 | DNA topoisomerase type I activity(GO:0003917) |
0.1 | 0.4 | GO:0004566 | beta-glucuronidase activity(GO:0004566) |
0.1 | 0.3 | GO:0045504 | dynein heavy chain binding(GO:0045504) |
0.1 | 0.4 | GO:0016286 | small conductance calcium-activated potassium channel activity(GO:0016286) |
0.1 | 0.4 | GO:0019145 | aminobutyraldehyde dehydrogenase activity(GO:0019145) 4-trimethylammoniobutyraldehyde dehydrogenase activity(GO:0047105) |
0.1 | 0.4 | GO:0042577 | lipid phosphatase activity(GO:0042577) |
0.1 | 0.1 | GO:0032190 | acrosin binding(GO:0032190) |
0.1 | 0.4 | GO:0033192 | calmodulin-dependent protein phosphatase activity(GO:0033192) |
0.1 | 0.3 | GO:0050833 | pyruvate transmembrane transporter activity(GO:0050833) |
0.1 | 0.2 | GO:0030911 | TPR domain binding(GO:0030911) |
0.1 | 0.6 | GO:0005078 | MAP-kinase scaffold activity(GO:0005078) |
0.1 | 0.3 | GO:0018479 | benzaldehyde dehydrogenase (NAD+) activity(GO:0018479) |
0.1 | 0.3 | GO:0050508 | glucuronosyl-N-acetylglucosaminyl-proteoglycan 4-alpha-N-acetylglucosaminyltransferase activity(GO:0050508) |
0.1 | 0.3 | GO:0004605 | phosphatidate cytidylyltransferase activity(GO:0004605) |
0.1 | 0.3 | GO:0070053 | thrombospondin receptor activity(GO:0070053) |
0.1 | 0.3 | GO:0002054 | nucleobase binding(GO:0002054) |
0.1 | 0.3 | GO:0035851 | Krueppel-associated box domain binding(GO:0035851) |
0.1 | 0.4 | GO:0046912 | transferase activity, transferring acyl groups, acyl groups converted into alkyl on transfer(GO:0046912) |
0.1 | 0.2 | GO:0016427 | tRNA (cytosine) methyltransferase activity(GO:0016427) tRNA (cytosine-5-)-methyltransferase activity(GO:0016428) |
0.1 | 0.2 | GO:0043423 | 3-phosphoinositide-dependent protein kinase binding(GO:0043423) |
0.1 | 0.3 | GO:0008440 | inositol-1,4,5-trisphosphate 3-kinase activity(GO:0008440) |
0.1 | 0.3 | GO:0000386 | second spliceosomal transesterification activity(GO:0000386) |
0.1 | 0.2 | GO:0016774 | phosphotransferase activity, carboxyl group as acceptor(GO:0016774) |
0.1 | 1.5 | GO:0003756 | protein disulfide isomerase activity(GO:0003756) intramolecular oxidoreductase activity, transposing S-S bonds(GO:0016864) |
0.1 | 0.8 | GO:0051010 | microtubule plus-end binding(GO:0051010) |
0.1 | 1.1 | GO:0005545 | 1-phosphatidylinositol binding(GO:0005545) |
0.1 | 0.4 | GO:0043426 | MRF binding(GO:0043426) |
0.1 | 0.1 | GO:0001226 | RNA polymerase II transcription corepressor binding(GO:0001226) |
0.1 | 2.4 | GO:0042169 | SH2 domain binding(GO:0042169) |
0.1 | 0.2 | GO:0003726 | double-stranded RNA adenosine deaminase activity(GO:0003726) |
0.1 | 0.1 | GO:0061629 | RNA polymerase II sequence-specific DNA binding transcription factor binding(GO:0061629) |
0.1 | 0.2 | GO:0098748 | clathrin adaptor activity(GO:0035615) endocytic adaptor activity(GO:0098748) |
0.1 | 0.6 | GO:0000900 | translation repressor activity, nucleic acid binding(GO:0000900) |
0.1 | 0.2 | GO:0004616 | phosphogluconate dehydrogenase (decarboxylating) activity(GO:0004616) |
0.1 | 0.3 | GO:0016151 | nickel cation binding(GO:0016151) |
0.1 | 0.8 | GO:0001972 | retinoic acid binding(GO:0001972) |
0.1 | 2.4 | GO:0051723 | protein methylesterase activity(GO:0051723) |
0.1 | 0.2 | GO:0047045 | testosterone 17-beta-dehydrogenase (NADP+) activity(GO:0047045) |
0.1 | 0.2 | GO:0001591 | dopamine neurotransmitter receptor activity, coupled via Gi/Go(GO:0001591) |
0.1 | 0.7 | GO:0070403 | NAD+ binding(GO:0070403) |
0.1 | 0.5 | GO:0030957 | Tat protein binding(GO:0030957) |
0.1 | 0.2 | GO:0045134 | uridine-diphosphatase activity(GO:0045134) |
0.1 | 0.2 | GO:0070573 | metallodipeptidase activity(GO:0070573) |
0.1 | 0.5 | GO:0004571 | mannosyl-oligosaccharide 1,2-alpha-mannosidase activity(GO:0004571) |
0.1 | 0.2 | GO:0016838 | carbon-oxygen lyase activity, acting on phosphates(GO:0016838) |
0.1 | 0.6 | GO:0005041 | low-density lipoprotein receptor activity(GO:0005041) |
0.1 | 0.1 | GO:0032564 | dATP binding(GO:0032564) |
0.1 | 0.5 | GO:0046933 | proton-transporting ATP synthase activity, rotational mechanism(GO:0046933) |
0.1 | 0.3 | GO:0004839 | ubiquitin activating enzyme activity(GO:0004839) |
0.1 | 0.3 | GO:0017040 | ceramidase activity(GO:0017040) |
0.1 | 0.3 | GO:0035612 | AP-2 adaptor complex binding(GO:0035612) |
0.1 | 0.2 | GO:0046976 | histone methyltransferase activity (H3-K27 specific)(GO:0046976) |
0.1 | 0.3 | GO:0010997 | anaphase-promoting complex binding(GO:0010997) |
0.1 | 0.2 | GO:0005157 | macrophage colony-stimulating factor receptor binding(GO:0005157) |
0.1 | 0.7 | GO:0030898 | actin-dependent ATPase activity(GO:0030898) |
0.1 | 0.2 | GO:0097109 | neuroligin family protein binding(GO:0097109) |
0.1 | 0.4 | GO:0015288 | porin activity(GO:0015288) |
0.1 | 0.2 | GO:0035515 | oxidative RNA demethylase activity(GO:0035515) |
0.1 | 0.7 | GO:0015643 | toxic substance binding(GO:0015643) |
0.1 | 0.3 | GO:0002151 | G-quadruplex RNA binding(GO:0002151) |
0.1 | 0.2 | GO:0008475 | procollagen-lysine 5-dioxygenase activity(GO:0008475) |
0.1 | 0.2 | GO:0003958 | NADPH-hemoprotein reductase activity(GO:0003958) |
0.1 | 0.2 | GO:0004514 | nicotinate-nucleotide diphosphorylase (carboxylating) activity(GO:0004514) |
0.1 | 0.9 | GO:0008353 | RNA polymerase II carboxy-terminal domain kinase activity(GO:0008353) |
0.1 | 0.2 | GO:0008073 | ornithine decarboxylase inhibitor activity(GO:0008073) |
0.1 | 0.7 | GO:0045236 | CXCR chemokine receptor binding(GO:0045236) |
0.1 | 0.2 | GO:0098821 | BMP receptor activity(GO:0098821) |
0.1 | 0.1 | GO:0031697 | beta-1 adrenergic receptor binding(GO:0031697) |
0.1 | 0.5 | GO:0008190 | eukaryotic initiation factor 4E binding(GO:0008190) |
0.1 | 0.5 | GO:0005159 | insulin-like growth factor receptor binding(GO:0005159) |
0.1 | 0.6 | GO:0034843 | 2-oxoglutaryl-CoA thioesterase activity(GO:0034843) 2,4,4-trimethyl-3-oxopentanoyl-CoA thioesterase activity(GO:0034869) 3-isopropylbut-3-enoyl-CoA thioesterase activity(GO:0034946) glutaryl-CoA hydrolase activity(GO:0044466) |
0.1 | 0.4 | GO:0003688 | DNA replication origin binding(GO:0003688) |
0.1 | 0.2 | GO:0008309 | double-stranded DNA exodeoxyribonuclease activity(GO:0008309) |
0.1 | 0.2 | GO:0017034 | Rap guanyl-nucleotide exchange factor activity(GO:0017034) |
0.1 | 0.2 | GO:1990825 | sequence-specific mRNA binding(GO:1990825) |
0.1 | 0.2 | GO:0004741 | [pyruvate dehydrogenase (lipoamide)] phosphatase activity(GO:0004741) |
0.1 | 0.2 | GO:0004719 | protein-L-isoaspartate (D-aspartate) O-methyltransferase activity(GO:0004719) |
0.1 | 0.5 | GO:0016888 | endodeoxyribonuclease activity, producing 5'-phosphomonoesters(GO:0016888) |
0.1 | 1.2 | GO:0004364 | glutathione transferase activity(GO:0004364) |
0.1 | 0.2 | GO:0016716 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, another compound as one donor, and incorporation of one atom of oxygen(GO:0016716) |
0.1 | 0.4 | GO:0003836 | beta-galactoside (CMP) alpha-2,3-sialyltransferase activity(GO:0003836) |
0.1 | 0.3 | GO:0043184 | vascular endothelial growth factor receptor 2 binding(GO:0043184) |
0.1 | 0.2 | GO:0004062 | aryl sulfotransferase activity(GO:0004062) |
0.1 | 0.3 | GO:0097642 | calcitonin family receptor activity(GO:0097642) |
0.1 | 0.3 | GO:0031685 | adenosine receptor binding(GO:0031685) |
0.1 | 0.3 | GO:0034875 | oxidoreductase activity, acting on CH or CH2 groups, quinone or similar compound as acceptor(GO:0033695) caffeine oxidase activity(GO:0034875) |
0.1 | 0.3 | GO:0003854 | 3-beta-hydroxy-delta5-steroid dehydrogenase activity(GO:0003854) |
0.1 | 0.6 | GO:0005523 | tropomyosin binding(GO:0005523) |
0.1 | 0.5 | GO:0043995 | histone acetyltransferase activity (H4-K5 specific)(GO:0043995) histone acetyltransferase activity (H4-K8 specific)(GO:0043996) histone acetyltransferase activity (H4-K16 specific)(GO:0046972) |
0.1 | 0.2 | GO:0005280 | hydrogen:amino acid symporter activity(GO:0005280) |
0.0 | 0.5 | GO:0097602 | cullin family protein binding(GO:0097602) |
0.0 | 0.1 | GO:0004471 | malic enzyme activity(GO:0004470) malate dehydrogenase (decarboxylating) (NAD+) activity(GO:0004471) |
0.0 | 0.1 | GO:0004611 | phosphoenolpyruvate carboxykinase activity(GO:0004611) |
0.0 | 0.2 | GO:0004862 | cAMP-dependent protein kinase inhibitor activity(GO:0004862) |
0.0 | 0.1 | GO:0003829 | beta-1,3-galactosyl-O-glycosyl-glycoprotein beta-1,6-N-acetylglucosaminyltransferase activity(GO:0003829) |
0.0 | 0.1 | GO:0052658 | inositol-1,4,5-trisphosphate 5-phosphatase activity(GO:0052658) |
0.0 | 0.4 | GO:0016886 | ligase activity, forming phosphoric ester bonds(GO:0016886) |
0.0 | 0.4 | GO:0008568 | microtubule-severing ATPase activity(GO:0008568) |
0.0 | 0.1 | GO:0051033 | nucleic acid transmembrane transporter activity(GO:0051032) RNA transmembrane transporter activity(GO:0051033) |
0.0 | 0.8 | GO:0004435 | phosphatidylinositol phospholipase C activity(GO:0004435) |
0.0 | 0.2 | GO:0046935 | 1-phosphatidylinositol-3-kinase regulator activity(GO:0046935) |
0.0 | 0.2 | GO:0061665 | SUMO ligase activity(GO:0061665) |
0.0 | 0.1 | GO:2001070 | starch binding(GO:2001070) |
0.0 | 0.1 | GO:0061676 | importin-alpha family protein binding(GO:0061676) |
0.0 | 0.1 | GO:0016715 | oxidoreductase activity, acting on paired donors, with incorporation or reduction of molecular oxygen, reduced ascorbate as one donor, and incorporation of one atom of oxygen(GO:0016715) |
0.0 | 0.2 | GO:0001025 | RNA polymerase III transcription factor binding(GO:0001025) |
0.0 | 0.0 | GO:0008425 | C-methyltransferase activity(GO:0008169) 2-polyprenyl-6-methoxy-1,4-benzoquinone methyltransferase activity(GO:0008425) quinone cofactor methyltransferase activity(GO:0030580) |
0.0 | 0.2 | GO:0005499 | vitamin D binding(GO:0005499) |
0.0 | 0.6 | GO:0004559 | alpha-mannosidase activity(GO:0004559) |
0.0 | 0.7 | GO:0030552 | cAMP binding(GO:0030552) |
0.0 | 0.4 | GO:0016832 | aldehyde-lyase activity(GO:0016832) |
0.0 | 0.1 | GO:0001069 | regulatory region RNA binding(GO:0001069) |
0.0 | 0.1 | GO:0016635 | oxidoreductase activity, acting on the CH-CH group of donors, quinone or related compound as acceptor(GO:0016635) |
0.0 | 0.5 | GO:0015279 | store-operated calcium channel activity(GO:0015279) |
0.0 | 0.1 | GO:0005131 | growth hormone receptor binding(GO:0005131) |
0.0 | 0.2 | GO:0035312 | 5'-3' exodeoxyribonuclease activity(GO:0035312) |
0.0 | 0.2 | GO:0004690 | cyclic nucleotide-dependent protein kinase activity(GO:0004690) |
0.0 | 0.9 | GO:0050136 | NADH dehydrogenase (ubiquinone) activity(GO:0008137) NADH dehydrogenase (quinone) activity(GO:0050136) |
0.0 | 0.2 | GO:0000340 | RNA 7-methylguanosine cap binding(GO:0000340) |
0.0 | 0.2 | GO:0004396 | glucokinase activity(GO:0004340) hexokinase activity(GO:0004396) |
0.0 | 0.2 | GO:0008174 | mRNA methyltransferase activity(GO:0008174) |
0.0 | 0.1 | GO:0070878 | primary miRNA binding(GO:0070878) |
0.0 | 0.3 | GO:0050291 | sphingosine N-acyltransferase activity(GO:0050291) |
0.0 | 0.1 | GO:0034040 | lipid-transporting ATPase activity(GO:0034040) |
0.0 | 0.1 | GO:0016899 | oxidoreductase activity, acting on the CH-OH group of donors, oxygen as acceptor(GO:0016899) |
0.0 | 0.1 | GO:0005483 | soluble NSF attachment protein activity(GO:0005483) |
0.0 | 0.3 | GO:0015198 | oligopeptide transporter activity(GO:0015198) |
0.0 | 0.1 | GO:0070548 | L-glutamine aminotransferase activity(GO:0070548) |
0.0 | 0.2 | GO:0004887 | thyroid hormone receptor activity(GO:0004887) |
0.0 | 0.7 | GO:0043295 | glutathione binding(GO:0043295) oligopeptide binding(GO:1900750) |
0.0 | 0.2 | GO:0047760 | butyrate-CoA ligase activity(GO:0047760) |
0.0 | 0.2 | GO:0008131 | primary amine oxidase activity(GO:0008131) |
0.0 | 0.2 | GO:0019784 | NEDD8-specific protease activity(GO:0019784) |
0.0 | 0.6 | GO:0004679 | AMP-activated protein kinase activity(GO:0004679) |
0.0 | 0.2 | GO:0004445 | inositol-polyphosphate 5-phosphatase activity(GO:0004445) |
0.0 | 0.1 | GO:0019864 | IgG binding(GO:0019864) |
0.0 | 0.0 | GO:0032551 | UTP binding(GO:0002134) pyrimidine ribonucleoside binding(GO:0032551) |
0.0 | 0.2 | GO:0015165 | pyrimidine nucleotide-sugar transmembrane transporter activity(GO:0015165) |
0.0 | 0.1 | GO:0050145 | nucleoside phosphate kinase activity(GO:0050145) |
0.0 | 0.1 | GO:0004711 | ribosomal protein S6 kinase activity(GO:0004711) |
0.0 | 0.1 | GO:0004939 | beta-adrenergic receptor activity(GO:0004939) |
0.0 | 0.1 | GO:0000104 | succinate dehydrogenase activity(GO:0000104) |
0.0 | 0.1 | GO:0045340 | mercury ion binding(GO:0045340) |
0.0 | 0.2 | GO:0017176 | phosphatidylinositol N-acetylglucosaminyltransferase activity(GO:0017176) |
0.0 | 0.2 | GO:0004083 | bisphosphoglycerate 2-phosphatase activity(GO:0004083) |
0.0 | 0.1 | GO:0097493 | structural molecule activity conferring elasticity(GO:0097493) |
0.0 | 0.1 | GO:0019237 | centromeric DNA binding(GO:0019237) |
0.0 | 0.1 | GO:1990380 | Lys48-specific deubiquitinase activity(GO:1990380) |
0.0 | 0.2 | GO:0008508 | bile acid:sodium symporter activity(GO:0008508) |
0.0 | 0.3 | GO:0001055 | RNA polymerase II activity(GO:0001055) |
0.0 | 0.0 | GO:0015923 | mannosidase activity(GO:0015923) |
0.0 | 0.7 | GO:0043014 | alpha-tubulin binding(GO:0043014) |
0.0 | 0.1 | GO:0000182 | rDNA binding(GO:0000182) |
0.0 | 0.1 | GO:0071553 | uridine nucleotide receptor activity(GO:0015065) G-protein coupled pyrimidinergic nucleotide receptor activity(GO:0071553) |
0.0 | 0.0 | GO:0004416 | hydroxyacylglutathione hydrolase activity(GO:0004416) |
0.0 | 0.4 | GO:0050811 | GABA receptor binding(GO:0050811) |
0.0 | 0.3 | GO:0004535 | poly(A)-specific ribonuclease activity(GO:0004535) |
0.0 | 0.2 | GO:0071558 | histone demethylase activity (H3-K27 specific)(GO:0071558) |
0.0 | 0.1 | GO:0005047 | signal recognition particle binding(GO:0005047) |
0.0 | 0.1 | GO:0004694 | eukaryotic translation initiation factor 2alpha kinase activity(GO:0004694) |
0.0 | 0.1 | GO:0071532 | ankyrin repeat binding(GO:0071532) |
0.0 | 0.4 | GO:1990841 | promoter-specific chromatin binding(GO:1990841) |
0.0 | 0.1 | GO:0000253 | 3-keto sterol reductase activity(GO:0000253) |
0.0 | 0.5 | GO:0070530 | K63-linked polyubiquitin binding(GO:0070530) |
0.0 | 0.4 | GO:0008331 | high voltage-gated calcium channel activity(GO:0008331) |
0.0 | 0.2 | GO:0005324 | long-chain fatty acid transporter activity(GO:0005324) |
0.0 | 0.2 | GO:0004784 | superoxide dismutase activity(GO:0004784) oxidoreductase activity, acting on superoxide radicals as acceptor(GO:0016721) |
0.0 | 0.6 | GO:0008242 | omega peptidase activity(GO:0008242) |
0.0 | 0.0 | GO:0051425 | PTB domain binding(GO:0051425) |
0.0 | 0.4 | GO:0070402 | NADPH binding(GO:0070402) |
0.0 | 0.1 | GO:1990226 | histone methyltransferase binding(GO:1990226) |
0.0 | 0.3 | GO:0008093 | cytoskeletal adaptor activity(GO:0008093) |
0.0 | 0.4 | GO:0043733 | alkylbase DNA N-glycosylase activity(GO:0003905) DNA-3-methylbase glycosylase activity(GO:0043733) |
0.0 | 1.1 | GO:0016748 | succinyltransferase activity(GO:0016748) |
0.0 | 0.0 | GO:0048763 | calcium-induced calcium release activity(GO:0048763) |
0.0 | 0.4 | GO:0034237 | protein kinase A regulatory subunit binding(GO:0034237) |
0.0 | 0.2 | GO:0000405 | bubble DNA binding(GO:0000405) |
0.0 | 0.1 | GO:0004367 | glycerol-3-phosphate dehydrogenase [NAD+] activity(GO:0004367) |
0.0 | 0.8 | GO:0015347 | sodium-independent organic anion transmembrane transporter activity(GO:0015347) |
0.0 | 0.2 | GO:0008494 | translation activator activity(GO:0008494) |
0.0 | 0.2 | GO:0016413 | O-acetyltransferase activity(GO:0016413) |
0.0 | 0.2 | GO:0016778 | diphosphotransferase activity(GO:0016778) |
0.0 | 0.1 | GO:0016401 | palmitoyl-CoA oxidase activity(GO:0016401) |
0.0 | 0.4 | GO:0004029 | aldehyde dehydrogenase (NAD) activity(GO:0004029) |
0.0 | 0.1 | GO:0030229 | very-low-density lipoprotein particle receptor activity(GO:0030229) |
0.0 | 0.4 | GO:0023026 | MHC class II protein complex binding(GO:0023026) |
0.0 | 0.3 | GO:0004708 | MAP kinase kinase activity(GO:0004708) |
0.0 | 0.8 | GO:0001205 | transcriptional activator activity, RNA polymerase II distal enhancer sequence-specific binding(GO:0001205) |
0.0 | 0.7 | GO:0001106 | RNA polymerase II transcription corepressor activity(GO:0001106) |
0.0 | 0.1 | GO:0030943 | mitochondrion targeting sequence binding(GO:0030943) |
0.0 | 0.6 | GO:0097472 | cyclin-dependent protein serine/threonine kinase activity(GO:0004693) cyclin-dependent protein kinase activity(GO:0097472) |
0.0 | 0.2 | GO:0042299 | pivalyl-CoA mutase activity(GO:0034784) o-hydroxylaminobenzoate mutase activity(GO:0034951) lupeol synthase activity(GO:0042299) beta-amyrin synthase activity(GO:0042300) baruol synthase activity(GO:0080011) |
0.0 | 0.1 | GO:0008430 | selenium binding(GO:0008430) |
0.0 | 0.2 | GO:0008599 | protein phosphatase type 1 regulator activity(GO:0008599) |
0.0 | 0.1 | GO:0016273 | arginine N-methyltransferase activity(GO:0016273) protein-arginine N-methyltransferase activity(GO:0016274) |
0.0 | 1.1 | GO:0016763 | transferase activity, transferring pentosyl groups(GO:0016763) |
0.0 | 0.1 | GO:0003831 | beta-N-acetylglucosaminylglycopeptide beta-1,4-galactosyltransferase activity(GO:0003831) |
0.0 | 0.1 | GO:0004090 | carbonyl reductase (NADPH) activity(GO:0004090) |
0.0 | 0.2 | GO:0048156 | tau protein binding(GO:0048156) |
0.0 | 0.1 | GO:0035671 | enone reductase activity(GO:0035671) |
0.0 | 0.1 | GO:0008499 | UDP-galactose:beta-N-acetylglucosamine beta-1,3-galactosyltransferase activity(GO:0008499) |
0.0 | 0.0 | GO:0004809 | tRNA (guanine-N2-)-methyltransferase activity(GO:0004809) |
0.0 | 1.4 | GO:0019003 | GDP binding(GO:0019003) |
0.0 | 0.2 | GO:0045545 | syndecan binding(GO:0045545) |
0.0 | 0.1 | GO:0016653 | oxidoreductase activity, acting on NAD(P)H, heme protein as acceptor(GO:0016653) |
0.0 | 0.4 | GO:0031418 | L-ascorbic acid binding(GO:0031418) |
0.0 | 0.0 | GO:0004629 | phospholipase C activity(GO:0004629) |
0.0 | 0.2 | GO:0010485 | H4 histone acetyltransferase activity(GO:0010485) |
0.0 | 0.1 | GO:0052795 | exo-alpha-sialidase activity(GO:0004308) alpha-sialidase activity(GO:0016997) exo-alpha-(2->3)-sialidase activity(GO:0052794) exo-alpha-(2->6)-sialidase activity(GO:0052795) exo-alpha-(2->8)-sialidase activity(GO:0052796) |
0.0 | 0.1 | GO:0004052 | arachidonate 12-lipoxygenase activity(GO:0004052) |
0.0 | 0.1 | GO:0047555 | 3',5'-cyclic-GMP phosphodiesterase activity(GO:0047555) |
0.0 | 0.1 | GO:0005138 | interleukin-6 receptor binding(GO:0005138) |
0.0 | 0.1 | GO:0016174 | NAD(P)H oxidase activity(GO:0016174) |
0.0 | 0.1 | GO:0004758 | serine C-palmitoyltransferase activity(GO:0004758) |
0.0 | 0.1 | GO:0034513 | box H/ACA snoRNA binding(GO:0034513) |
0.0 | 0.1 | GO:0003976 | UDP-N-acetylglucosamine-lysosomal-enzyme N-acetylglucosaminephosphotransferase activity(GO:0003976) |
0.0 | 0.1 | GO:0016670 | oxidoreductase activity, acting on a sulfur group of donors, oxygen as acceptor(GO:0016670) |
0.0 | 0.2 | GO:0005313 | L-glutamate transmembrane transporter activity(GO:0005313) |
0.0 | 0.1 | GO:0008240 | tripeptidyl-peptidase activity(GO:0008240) |
0.0 | 0.6 | GO:0016831 | carboxy-lyase activity(GO:0016831) |
0.0 | 0.3 | GO:0070577 | lysine-acetylated histone binding(GO:0070577) |
0.0 | 0.2 | GO:0030368 | interleukin-17 receptor activity(GO:0030368) |
0.0 | 0.1 | GO:0017116 | single-stranded DNA-dependent ATP-dependent DNA helicase activity(GO:0017116) |
0.0 | 0.1 | GO:0003941 | L-serine ammonia-lyase activity(GO:0003941) |
0.0 | 0.1 | GO:0016880 | acid-ammonia (or amide) ligase activity(GO:0016880) |
0.0 | 0.4 | GO:0017128 | phospholipid scramblase activity(GO:0017128) |
0.0 | 0.2 | GO:0070097 | delta-catenin binding(GO:0070097) |
0.0 | 0.1 | GO:0031698 | beta-2 adrenergic receptor binding(GO:0031698) |
0.0 | 0.4 | GO:0005070 | SH3/SH2 adaptor activity(GO:0005070) |
0.0 | 0.0 | GO:0050816 | phosphothreonine binding(GO:0050816) |
0.0 | 0.1 | GO:0004994 | somatostatin receptor activity(GO:0004994) |
0.0 | 0.5 | GO:0016645 | oxidoreductase activity, acting on the CH-NH group of donors(GO:0016645) |
0.0 | 0.1 | GO:0000213 | tRNA-intron endonuclease activity(GO:0000213) |
0.0 | 0.1 | GO:0016882 | cyclo-ligase activity(GO:0016882) |
0.0 | 0.2 | GO:0016679 | oxidoreductase activity, acting on diphenols and related substances as donors(GO:0016679) |
0.0 | 0.1 | GO:0004814 | arginine-tRNA ligase activity(GO:0004814) |
0.0 | 0.1 | GO:0004802 | transketolase activity(GO:0004802) |
0.0 | 0.1 | GO:0001075 | transcription factor activity, RNA polymerase II core promoter sequence-specific binding involved in preinitiation complex assembly(GO:0001075) |
0.0 | 0.0 | GO:0048408 | epidermal growth factor binding(GO:0048408) |
0.0 | 0.1 | GO:0004634 | phosphopyruvate hydratase activity(GO:0004634) |
0.0 | 0.3 | GO:0016854 | racemase and epimerase activity(GO:0016854) |
0.0 | 0.0 | GO:0019767 | IgE receptor activity(GO:0019767) |
0.0 | 0.2 | GO:0043024 | ribosomal small subunit binding(GO:0043024) |
0.0 | 0.0 | GO:0048030 | disaccharide binding(GO:0048030) |
0.0 | 0.0 | GO:0016262 | protein N-acetylglucosaminyltransferase activity(GO:0016262) |
0.0 | 0.1 | GO:0004337 | geranyltranstransferase activity(GO:0004337) |
0.0 | 0.0 | GO:0035514 | DNA demethylase activity(GO:0035514) |
0.0 | 0.3 | GO:0015035 | protein disulfide oxidoreductase activity(GO:0015035) |
0.0 | 0.4 | GO:0005528 | macrolide binding(GO:0005527) FK506 binding(GO:0005528) |
0.0 | 0.1 | GO:0003847 | 1-alkyl-2-acetylglycerophosphocholine esterase activity(GO:0003847) |
0.0 | 0.1 | GO:0015562 | efflux transmembrane transporter activity(GO:0015562) |
0.0 | 0.1 | GO:0004556 | alpha-amylase activity(GO:0004556) |
0.0 | 0.0 | GO:0030297 | transmembrane receptor protein tyrosine kinase activator activity(GO:0030297) |
0.0 | 0.4 | GO:0016922 | ligand-dependent nuclear receptor binding(GO:0016922) |
0.0 | 0.0 | GO:0004663 | Rab geranylgeranyltransferase activity(GO:0004663) |
0.0 | 0.0 | GO:0030942 | endoplasmic reticulum signal peptide binding(GO:0030942) |
0.0 | 0.1 | GO:0019862 | IgA binding(GO:0019862) |
0.0 | 0.2 | GO:0034450 | ubiquitin-ubiquitin ligase activity(GO:0034450) |
0.0 | 0.8 | GO:0005109 | frizzled binding(GO:0005109) |
0.0 | 0.9 | GO:0035064 | methylated histone binding(GO:0035064) |
0.0 | 0.1 | GO:0043560 | insulin receptor substrate binding(GO:0043560) |
0.0 | 0.1 | GO:0070326 | very-low-density lipoprotein particle receptor binding(GO:0070326) |
0.0 | 0.1 | GO:0048273 | mitogen-activated protein kinase p38 binding(GO:0048273) |
0.0 | 0.2 | GO:0039706 | co-receptor binding(GO:0039706) |
0.0 | 0.1 | GO:0004949 | cannabinoid receptor activity(GO:0004949) |
0.0 | 0.0 | GO:0031013 | troponin I binding(GO:0031013) |
0.0 | 0.1 | GO:0004849 | uridine kinase activity(GO:0004849) |
0.0 | 0.2 | GO:0001221 | transcription cofactor binding(GO:0001221) |
0.0 | 0.3 | GO:0015295 | solute:proton symporter activity(GO:0015295) |
0.0 | 0.1 | GO:0005172 | vascular endothelial growth factor receptor binding(GO:0005172) |
0.0 | 0.1 | GO:0070579 | methylcytosine dioxygenase activity(GO:0070579) |
0.0 | 0.1 | GO:0043138 | 3'-5' DNA helicase activity(GO:0043138) |
0.0 | 0.3 | GO:0015116 | sulfate transmembrane transporter activity(GO:0015116) |
0.0 | 0.1 | GO:0035662 | Toll-like receptor 4 binding(GO:0035662) |
0.0 | 0.5 | GO:0030507 | spectrin binding(GO:0030507) |
0.0 | 0.0 | GO:0000403 | Y-form DNA binding(GO:0000403) |
0.0 | 0.2 | GO:0043425 | bHLH transcription factor binding(GO:0043425) |
0.0 | 0.0 | GO:0030620 | U2 snRNA binding(GO:0030620) |
0.0 | 0.1 | GO:0043495 | protein anchor(GO:0043495) |
0.0 | 0.1 | GO:0015057 | thrombin receptor activity(GO:0015057) |
0.0 | 0.0 | GO:0016744 | transferase activity, transferring aldehyde or ketonic groups(GO:0016744) |
0.0 | 1.1 | GO:0008186 | ATP-dependent RNA helicase activity(GO:0004004) RNA-dependent ATPase activity(GO:0008186) |
0.0 | 0.0 | GO:1990190 | peptide-serine-N-acetyltransferase activity(GO:1990189) peptide-glutamate-N-acetyltransferase activity(GO:1990190) |
0.0 | 0.1 | GO:0070095 | fructose-6-phosphate binding(GO:0070095) |
0.0 | 0.0 | GO:0071987 | WD40-repeat domain binding(GO:0071987) |
0.0 | 0.0 | GO:0017002 | activin-activated receptor activity(GO:0017002) |
0.0 | 0.1 | GO:1990247 | N6-methyladenosine-containing RNA binding(GO:1990247) |
0.0 | 0.1 | GO:0004614 | phosphoglucomutase activity(GO:0004614) |
0.0 | 0.1 | GO:0004579 | dolichyl-diphosphooligosaccharide-protein glycotransferase activity(GO:0004579) |
0.0 | 0.1 | GO:0089720 | caspase binding(GO:0089720) |
0.0 | 0.1 | GO:0016595 | glutamate binding(GO:0016595) |
0.0 | 0.1 | GO:0016149 | translation release factor activity, codon specific(GO:0016149) |
0.0 | 0.2 | GO:0016783 | sulfurtransferase activity(GO:0016783) |
0.0 | 0.4 | GO:0070330 | aromatase activity(GO:0070330) |
0.0 | 0.1 | GO:0055056 | D-glucose transmembrane transporter activity(GO:0055056) |
0.0 | 0.1 | GO:0030628 | pre-mRNA 3'-splice site binding(GO:0030628) |
0.0 | 1.2 | GO:0005496 | steroid binding(GO:0005496) |
0.0 | 0.1 | GO:0016015 | morphogen activity(GO:0016015) |
0.0 | 0.2 | GO:0005522 | profilin binding(GO:0005522) |
0.0 | 0.0 | GO:0016909 | JUN kinase activity(GO:0004705) SAP kinase activity(GO:0016909) |
0.0 | 0.4 | GO:0004402 | histone acetyltransferase activity(GO:0004402) |
0.0 | 0.0 | GO:0000309 | nicotinamide-nucleotide adenylyltransferase activity(GO:0000309) nicotinate-nucleotide adenylyltransferase activity(GO:0004515) |
0.0 | 0.0 | GO:0000339 | RNA cap binding(GO:0000339) |
0.0 | 0.5 | GO:0003899 | DNA-directed RNA polymerase activity(GO:0003899) |
0.0 | 0.0 | GO:0018570 | 2,3-dihydroxy DDT 1,2-dioxygenase activity(GO:0018542) phenanthrene dioxygenase activity(GO:0018555) 2,2',3-trihydroxybiphenyl dioxygenase activity(GO:0018556) 1,2-dihydroxyfluorene 1,1-alpha-dioxygenase activity(GO:0018557) 5,6-dihydroxy-3-methyl-2-oxo-1,2-dihydroquinoline dioxygenase activity(GO:0018558) 1,1-dichloro-2-(dihydroxy-4-chlorophenyl)-(4-chlorophenyl)ethene 1,2-dioxygenase activity(GO:0018559) protocatechuate 3,4-dioxygenase type II activity(GO:0018560) 2'-aminobiphenyl-2,3-diol 1,2-dioxygenase activity(GO:0018561) 3,4-dihydroxyfluorene 4,4-alpha-dioxygenase activity(GO:0018562) 2,3-dihydroxy-ethylbenzene 1,2-dioxygenase activity(GO:0018563) carbazole 1,9a-dioxygenase activity(GO:0018564) dihydroxydibenzothiophene dioxygenase activity(GO:0018565) 1,2-dihydroxynaphthalene-6-sulfonate 1,8a-dioxygenase activity(GO:0018566) styrene dioxygenase activity(GO:0018567) 3,4-dihydroxyphenanthrene dioxygenase activity(GO:0018568) hydroquinone 1,2-dioxygenase activity(GO:0018569) p-cumate 2,3-dioxygenase activity(GO:0018570) 2,3-dihydroxy-p-cumate dioxygenase activity(GO:0018571) 3,5-dichlorocatechol 1,2-dioxygenase activity(GO:0018572) 2-aminophenol 1,6-dioxygenase activity(GO:0018573) 2,6-dichloro-p-hydroquinone 1,2-dioxygenase activity(GO:0018574) chlorocatechol 1,2-dioxygenase activity(GO:0018575) catechol dioxygenase activity(GO:0019114) dihydroxyfluorene dioxygenase activity(GO:0019117) 5-aminosalicylate dioxygenase activity(GO:0034543) 3-hydroxy-2-naphthoate 2,3-dioxygenase activity(GO:0034803) benzo(a)pyrene 11,12-dioxygenase activity(GO:0034806) benzo(a)pyrene 4,5-dioxygenase activity(GO:0034808) 4,5-dihydroxybenzo(a)pyrene dioxygenase activity(GO:0034810) benzo(a)pyrene 9,10-dioxygenase activity(GO:0034811) 9,10-dihydroxybenzo(a)pyrene dioxygenase activity(GO:0034812) benzo(a)pyrene 7,8-dioxygenase activity(GO:0034813) 7,8-dihydroxy benzo(a)pyrene dioxygenase activity(GO:0034814) 1,2-dihydroxy-5,6,7,8-tetrahydronaphthalene extradiol dioxygenase activity(GO:0034827) 2-mercaptobenzothiazole dioxygenase activity(GO:0034834) pyridine-3,4-diol dioxygenase activity(GO:0034895) pyrene dioxygenase activity(GO:0034920) 4,5-dihydroxypyrene dioxygenase activity(GO:0034922) phenanthrene-4-carboxylate dioxygenase activity(GO:0034934) tetrachlorobenzene dioxygenase activity(GO:0034935) 4,6-dichloro-3-methylcatechol 1,2-dioxygenase activity(GO:0034936) 2,3-dihydroxydiphenyl ether dioxygenase activity(GO:0034955) diphenyl ether 1,2-dioxygenase activity(GO:0034956) arachidonate 8(S)-lipoxygenase activity(GO:0036403) 4-hydroxycatechol 1,2-dioxygenase activity(GO:0047074) |
0.0 | 0.1 | GO:0019763 | immunoglobulin receptor activity(GO:0019763) |
0.0 | 0.1 | GO:0000268 | peroxisome targeting sequence binding(GO:0000268) |
0.0 | 0.3 | GO:0016538 | cyclin-dependent protein serine/threonine kinase regulator activity(GO:0016538) |
0.0 | 0.5 | GO:0070888 | E-box binding(GO:0070888) |
0.0 | 0.1 | GO:0008199 | ferric iron binding(GO:0008199) |
0.0 | 0.1 | GO:0005113 | patched binding(GO:0005113) |
0.0 | 0.0 | GO:0035877 | death effector domain binding(GO:0035877) |
0.0 | 0.4 | GO:0005164 | tumor necrosis factor receptor binding(GO:0005164) |
0.0 | 0.1 | GO:0005225 | volume-sensitive anion channel activity(GO:0005225) |
0.0 | 0.4 | GO:0001540 | beta-amyloid binding(GO:0001540) |
0.0 | 0.1 | GO:0016723 | oxidoreductase activity, oxidizing metal ions, NAD or NADP as acceptor(GO:0016723) |
0.0 | 0.0 | GO:0015220 | choline transmembrane transporter activity(GO:0015220) |
0.0 | 0.1 | GO:0008454 | alpha-1,3-mannosylglycoprotein 4-beta-N-acetylglucosaminyltransferase activity(GO:0008454) |
0.0 | 0.0 | GO:0005094 | Rho GDP-dissociation inhibitor activity(GO:0005094) |
0.0 | 0.1 | GO:0005105 | type 1 fibroblast growth factor receptor binding(GO:0005105) |
0.0 | 0.0 | GO:0030228 | lipoprotein particle receptor activity(GO:0030228) |
0.0 | 0.1 | GO:0005275 | amine transmembrane transporter activity(GO:0005275) |
0.0 | 0.0 | GO:0061733 | peptide-lysine-N-acetyltransferase activity(GO:0061733) |
0.0 | 3.0 | GO:0001077 | transcriptional activator activity, RNA polymerase II core promoter proximal region sequence-specific binding(GO:0001077) |
0.0 | 0.1 | GO:0016443 | bidentate ribonuclease III activity(GO:0016443) |
0.0 | 0.3 | GO:0030544 | Hsp70 protein binding(GO:0030544) |
0.0 | 0.0 | GO:0008310 | single-stranded DNA 3'-5' exodeoxyribonuclease activity(GO:0008310) |
0.0 | 0.1 | GO:0008934 | inositol monophosphate 1-phosphatase activity(GO:0008934) inositol monophosphate 3-phosphatase activity(GO:0052832) inositol monophosphate 4-phosphatase activity(GO:0052833) inositol monophosphate phosphatase activity(GO:0052834) |
0.0 | 0.1 | GO:0000146 | microfilament motor activity(GO:0000146) |
0.0 | 0.0 | GO:0015037 | peptide disulfide oxidoreductase activity(GO:0015037) |
0.0 | 0.1 | GO:0005007 | fibroblast growth factor-activated receptor activity(GO:0005007) |
0.0 | 0.2 | GO:0005451 | monovalent cation:proton antiporter activity(GO:0005451) |
0.0 | 0.1 | GO:0016668 | oxidoreductase activity, acting on a sulfur group of donors, NAD(P) as acceptor(GO:0016668) |
0.0 | 0.0 | GO:0005146 | leukemia inhibitory factor receptor binding(GO:0005146) |
0.0 | 0.2 | GO:0043236 | laminin binding(GO:0043236) |
0.0 | 0.1 | GO:0001588 | dopamine neurotransmitter receptor activity, coupled via Gs(GO:0001588) dopamine neurotransmitter receptor activity(GO:0004952) |
0.0 | 0.0 | GO:0034186 | apolipoprotein A-I binding(GO:0034186) |
0.0 | 0.0 | GO:0005119 | smoothened binding(GO:0005119) |
0.0 | 0.0 | GO:0016520 | growth hormone-releasing hormone receptor activity(GO:0016520) |
0.0 | 0.0 | GO:0070883 | pre-miRNA binding(GO:0070883) |
0.0 | 0.0 | GO:0005519 | cytoskeletal regulatory protein binding(GO:0005519) |
0.0 | 0.7 | GO:0005518 | collagen binding(GO:0005518) |
0.0 | 0.2 | GO:0017081 | chloride channel regulator activity(GO:0017081) |
0.0 | 0.2 | GO:0016676 | cytochrome-c oxidase activity(GO:0004129) heme-copper terminal oxidase activity(GO:0015002) oxidoreductase activity, acting on a heme group of donors, oxygen as acceptor(GO:0016676) |
0.0 | 0.1 | GO:0015197 | peptide transporter activity(GO:0015197) |
0.0 | 0.1 | GO:0004438 | phosphatidylinositol-3-phosphatase activity(GO:0004438) |
0.0 | 0.1 | GO:0001515 | opioid peptide activity(GO:0001515) |
0.0 | 0.1 | GO:0003918 | DNA topoisomerase type II (ATP-hydrolyzing) activity(GO:0003918) DNA topoisomerase II activity(GO:0061505) |
0.0 | 0.0 | GO:0042296 | ISG15 transferase activity(GO:0042296) |
0.0 | 0.2 | GO:0030332 | cyclin binding(GO:0030332) |
0.0 | 0.1 | GO:0032795 | heterotrimeric G-protein binding(GO:0032795) |
0.0 | 0.0 | GO:0008422 | beta-glucosidase activity(GO:0008422) |
0.0 | 0.0 | GO:0004969 | histamine receptor activity(GO:0004969) |
0.0 | 0.0 | GO:0008384 | IkappaB kinase activity(GO:0008384) |
0.0 | 0.2 | GO:0017056 | structural constituent of nuclear pore(GO:0017056) |
0.0 | 0.1 | GO:0000993 | RNA polymerase II core binding(GO:0000993) |
0.0 | 0.0 | GO:0030621 | U4 snRNA binding(GO:0030621) |
0.0 | 0.2 | GO:0016500 | protein-hormone receptor activity(GO:0016500) |
0.0 | 0.2 | GO:0004653 | polypeptide N-acetylgalactosaminyltransferase activity(GO:0004653) |
0.0 | 0.1 | GO:0004383 | guanylate cyclase activity(GO:0004383) |
0.0 | 0.0 | GO:0001642 | group III metabotropic glutamate receptor activity(GO:0001642) |
0.0 | 0.0 | GO:0005095 | GTPase inhibitor activity(GO:0005095) |
0.0 | 0.1 | GO:0016813 | hydrolase activity, acting on carbon-nitrogen (but not peptide) bonds, in linear amidines(GO:0016813) |
0.0 | 0.0 | GO:0000774 | adenyl-nucleotide exchange factor activity(GO:0000774) |
0.0 | 0.4 | GO:0008170 | N-methyltransferase activity(GO:0008170) |
0.0 | 0.1 | GO:0048038 | quinone binding(GO:0048038) |
0.0 | 0.3 | GO:0052770 | coenzyme F390-A hydrolase activity(GO:0052770) coenzyme F390-G hydrolase activity(GO:0052771) |
0.0 | 0.0 | GO:0015087 | cobalt ion transmembrane transporter activity(GO:0015087) |
0.0 | 0.8 | GO:0030792 | methylarsonite methyltransferase activity(GO:0030792) |
0.0 | 0.0 | GO:0031493 | nucleosomal histone binding(GO:0031493) |
0.0 | 0.1 | GO:0031210 | phosphatidylcholine binding(GO:0031210) |
0.0 | 0.2 | GO:0019206 | nucleoside kinase activity(GO:0019206) |
0.0 | 0.2 | GO:0030515 | snoRNA binding(GO:0030515) |
0.0 | 0.3 | GO:0019706 | protein-cysteine S-palmitoyltransferase activity(GO:0019706) protein-cysteine S-acyltransferase activity(GO:0019707) |
0.0 | 0.1 | GO:0050656 | 3'-phosphoadenosine 5'-phosphosulfate binding(GO:0050656) |
0.0 | 0.1 | GO:0032794 | GTPase activating protein binding(GO:0032794) |
0.0 | 0.1 | GO:0009982 | pseudouridine synthase activity(GO:0009982) |
0.0 | 0.0 | GO:0005087 | Ran guanyl-nucleotide exchange factor activity(GO:0005087) |
0.0 | 0.1 | GO:0036402 | proteasome-activating ATPase activity(GO:0036402) |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.2 | 3.7 | PID ERBB NETWORK PATHWAY | ErbB receptor signaling network |
0.1 | 0.5 | ST PAC1 RECEPTOR PATHWAY | PAC1 Receptor Pathway |
0.1 | 4.1 | PID HES HEY PATHWAY | Notch-mediated HES/HEY network |
0.1 | 1.4 | ST WNT CA2 CYCLIC GMP PATHWAY | Wnt/Ca2+/cyclic GMP signaling. |
0.1 | 0.7 | PID RANBP2 PATHWAY | Sumoylation by RanBP2 regulates transcriptional repression |
0.1 | 0.1 | PID SMAD2 3PATHWAY | Regulation of cytoplasmic and nuclear SMAD2/3 signaling |
0.1 | 2.0 | PID NCADHERIN PATHWAY | N-cadherin signaling events |
0.1 | 0.2 | ST STAT3 PATHWAY | STAT3 Pathway |
0.1 | 0.4 | SA PTEN PATHWAY | PTEN is a tumor suppressor that dephosphorylates the lipid messenger phosphatidylinositol triphosphate. |
0.1 | 0.6 | PID P38 GAMMA DELTA PATHWAY | Signaling mediated by p38-gamma and p38-delta |
0.1 | 0.5 | ST ADRENERGIC | Adrenergic Pathway |
0.1 | 0.1 | PID EPHRINB REV PATHWAY | Ephrin B reverse signaling |
0.1 | 0.7 | PID ER NONGENOMIC PATHWAY | Plasma membrane estrogen receptor signaling |
0.0 | 1.0 | ST G ALPHA I PATHWAY | G alpha i Pathway |
0.0 | 2.2 | PID SHP2 PATHWAY | SHP2 signaling |
0.0 | 0.3 | PID ERBB1 RECEPTOR PROXIMAL PATHWAY | EGF receptor (ErbB1) signaling pathway |
0.0 | 1.7 | PID HEDGEHOG GLI PATHWAY | Hedgehog signaling events mediated by Gli proteins |
0.0 | 0.2 | PID IL2 1PATHWAY | IL2-mediated signaling events |
0.0 | 1.5 | NABA PROTEOGLYCANS | Genes encoding proteoglycans |
0.0 | 0.1 | PID THROMBIN PAR4 PATHWAY | PAR4-mediated thrombin signaling events |
0.0 | 0.9 | PID RXR VDR PATHWAY | RXR and RAR heterodimerization with other nuclear receptor |
0.0 | 1.2 | PID INSULIN PATHWAY | Insulin Pathway |
0.0 | 0.8 | PID ALK1 PATHWAY | ALK1 signaling events |
0.0 | 0.2 | PID BETA CATENIN DEG PATHWAY | Degradation of beta catenin |
0.0 | 0.0 | PID IFNG PATHWAY | IFN-gamma pathway |
0.0 | 0.8 | PID LIS1 PATHWAY | Lissencephaly gene (LIS1) in neuronal migration and development |
0.0 | 0.2 | PID EPHA2 FWD PATHWAY | EPHA2 forward signaling |
0.0 | 0.3 | PID INTEGRIN4 PATHWAY | Alpha6 beta4 integrin-ligand interactions |
0.0 | 0.2 | PID UPA UPAR PATHWAY | Urokinase-type plasminogen activator (uPA) and uPAR-mediated signaling |
0.0 | 0.2 | PID PDGFRA PATHWAY | PDGFR-alpha signaling pathway |
0.0 | 0.3 | PID ERB GENOMIC PATHWAY | Validated nuclear estrogen receptor beta network |
0.0 | 0.4 | PID CIRCADIAN PATHWAY | Circadian rhythm pathway |
0.0 | 1.1 | PID HNF3B PATHWAY | FOXA2 and FOXA3 transcription factor networks |
0.0 | 0.1 | PID INTEGRIN3 PATHWAY | Beta3 integrin cell surface interactions |
0.0 | 0.1 | PID RETINOIC ACID PATHWAY | Retinoic acid receptors-mediated signaling |
0.0 | 0.4 | PID TGFBR PATHWAY | TGF-beta receptor signaling |
0.0 | 0.5 | ST WNT BETA CATENIN PATHWAY | Wnt/beta-catenin Pathway |
0.0 | 0.1 | ST IL 13 PATHWAY | Interleukin 13 (IL-13) Pathway |
0.0 | 0.1 | ST MYOCYTE AD PATHWAY | Myocyte Adrenergic Pathway is a specific case of the generalized Adrenergic Pathway. |
0.0 | 0.1 | PID S1P S1P4 PATHWAY | S1P4 pathway |
0.0 | 0.1 | PID IL2 PI3K PATHWAY | IL2 signaling events mediated by PI3K |
0.0 | 0.4 | PID TCR CALCIUM PATHWAY | Calcium signaling in the CD4+ TCR pathway |
0.0 | 0.1 | ST TYPE I INTERFERON PATHWAY | Type I Interferon (alpha/beta IFN) Pathway |
0.0 | 0.2 | PID SYNDECAN 2 PATHWAY | Syndecan-2-mediated signaling events |
0.0 | 0.0 | SIG BCR SIGNALING PATHWAY | Members of the BCR signaling pathway |
0.0 | 0.1 | SA FAS SIGNALING | The TNF-type receptor Fas induces apoptosis on ligand binding. |
0.0 | 0.1 | PID CD8 TCR DOWNSTREAM PATHWAY | Downstream signaling in naïve CD8+ T cells |
0.0 | 0.1 | PID WNT NONCANONICAL PATHWAY | Noncanonical Wnt signaling pathway |
0.0 | 0.2 | PID CXCR3 PATHWAY | CXCR3-mediated signaling events |
0.0 | 0.5 | PID PLK1 PATHWAY | PLK1 signaling events |
0.0 | 0.0 | PID RAC1 REG PATHWAY | Regulation of RAC1 activity |
0.0 | 0.1 | PID P38 MK2 PATHWAY | p38 signaling mediated by MAPKAP kinases |
0.0 | 0.0 | PID S1P S1P3 PATHWAY | S1P3 pathway |
0.0 | 0.1 | PID HIF1A PATHWAY | Hypoxic and oxygen homeostasis regulation of HIF-1-alpha |
0.0 | 0.2 | PID NFKAPPAB CANONICAL PATHWAY | Canonical NF-kappaB pathway |
0.0 | 0.0 | PID INTEGRIN CS PATHWAY | Integrin family cell surface interactions |
Log-likelihood per target | Total log-likelihood | Term | Description |
---|---|---|---|
0.2 | 2.4 | REACTOME PROLACTIN RECEPTOR SIGNALING | Genes involved in Prolactin receptor signaling |
0.2 | 3.6 | REACTOME SIGNALING BY CONSTITUTIVELY ACTIVE EGFR | Genes involved in Signaling by constitutively active EGFR |
0.1 | 1.3 | REACTOME ALPHA LINOLENIC ACID ALA METABOLISM | Genes involved in alpha-linolenic acid (ALA) metabolism |
0.1 | 1.9 | REACTOME ANTIGEN PRESENTATION FOLDING ASSEMBLY AND PEPTIDE LOADING OF CLASS I MHC | Genes involved in Antigen Presentation: Folding, assembly and peptide loading of class I MHC |
0.1 | 2.7 | REACTOME DARPP 32 EVENTS | Genes involved in DARPP-32 events |
0.1 | 0.1 | REACTOME MRNA DECAY BY 3 TO 5 EXORIBONUCLEASE | Genes involved in mRNA Decay by 3' to 5' Exoribonuclease |
0.1 | 1.0 | REACTOME SYNTHESIS OF PIPS AT THE LATE ENDOSOME MEMBRANE | Genes involved in Synthesis of PIPs at the late endosome membrane |
0.1 | 1.4 | REACTOME FATTY ACYL COA BIOSYNTHESIS | Genes involved in Fatty Acyl-CoA Biosynthesis |
0.1 | 0.9 | REACTOME SYNTHESIS OF PE | Genes involved in Synthesis of PE |
0.1 | 0.8 | REACTOME REGULATION OF RHEB GTPASE ACTIVITY BY AMPK | Genes involved in Regulation of Rheb GTPase activity by AMPK |
0.1 | 1.0 | REACTOME PYRIMIDINE CATABOLISM | Genes involved in Pyrimidine catabolism |
0.1 | 0.8 | REACTOME REGULATION OF INSULIN SECRETION BY ACETYLCHOLINE | Genes involved in Regulation of Insulin Secretion by Acetylcholine |
0.1 | 0.5 | REACTOME GLUCURONIDATION | Genes involved in Glucuronidation |
0.1 | 2.5 | REACTOME BMAL1 CLOCK NPAS2 ACTIVATES CIRCADIAN EXPRESSION | Genes involved in BMAL1:CLOCK/NPAS2 Activates Circadian Expression |
0.1 | 1.1 | REACTOME METABOLISM OF PORPHYRINS | Genes involved in Metabolism of porphyrins |
0.1 | 0.5 | REACTOME CALNEXIN CALRETICULIN CYCLE | Genes involved in Calnexin/calreticulin cycle |
0.1 | 1.4 | REACTOME COMPLEMENT CASCADE | Genes involved in Complement cascade |
0.1 | 0.8 | REACTOME ENDOGENOUS STEROLS | Genes involved in Endogenous sterols |
0.1 | 1.5 | REACTOME MYOGENESIS | Genes involved in Myogenesis |
0.1 | 1.3 | REACTOME SMAD2 SMAD3 SMAD4 HETEROTRIMER REGULATES TRANSCRIPTION | Genes involved in SMAD2/SMAD3:SMAD4 heterotrimer regulates transcription |
0.1 | 0.7 | REACTOME RAP1 SIGNALLING | Genes involved in Rap1 signalling |
0.1 | 0.8 | REACTOME AMINO ACID SYNTHESIS AND INTERCONVERSION TRANSAMINATION | Genes involved in Amino acid synthesis and interconversion (transamination) |
0.1 | 1.6 | REACTOME PHASE1 FUNCTIONALIZATION OF COMPOUNDS | Genes involved in Phase 1 - Functionalization of compounds |
0.0 | 0.4 | REACTOME IL 7 SIGNALING | Genes involved in Interleukin-7 signaling |
0.0 | 0.4 | REACTOME GAMMA CARBOXYLATION TRANSPORT AND AMINO TERMINAL CLEAVAGE OF PROTEINS | Genes involved in Gamma-carboxylation, transport, and amino-terminal cleavage of proteins |
0.0 | 1.1 | REACTOME NUCLEAR SIGNALING BY ERBB4 | Genes involved in Nuclear signaling by ERBB4 |
0.0 | 0.0 | REACTOME CDC6 ASSOCIATION WITH THE ORC ORIGIN COMPLEX | Genes involved in CDC6 association with the ORC:origin complex |
0.0 | 0.5 | REACTOME FORMATION OF ATP BY CHEMIOSMOTIC COUPLING | Genes involved in Formation of ATP by chemiosmotic coupling |
0.0 | 0.0 | REACTOME DESTABILIZATION OF MRNA BY BRF1 | Genes involved in Destabilization of mRNA by Butyrate Response Factor 1 (BRF1) |
0.0 | 0.6 | REACTOME FORMATION OF THE TERNARY COMPLEX AND SUBSEQUENTLY THE 43S COMPLEX | Genes involved in Formation of the ternary complex, and subsequently, the 43S complex |
0.0 | 0.8 | REACTOME CITRIC ACID CYCLE TCA CYCLE | Genes involved in Citric acid cycle (TCA cycle) |
0.0 | 0.1 | REACTOME RORA ACTIVATES CIRCADIAN EXPRESSION | Genes involved in RORA Activates Circadian Expression |
0.0 | 0.4 | REACTOME BASE FREE SUGAR PHOSPHATE REMOVAL VIA THE SINGLE NUCLEOTIDE REPLACEMENT PATHWAY | Genes involved in Base-free sugar-phosphate removal via the single-nucleotide replacement pathway |
0.0 | 1.7 | REACTOME BIOLOGICAL OXIDATIONS | Genes involved in Biological oxidations |
0.0 | 0.2 | REACTOME SYNTHESIS OF BILE ACIDS AND BILE SALTS VIA 24 HYDROXYCHOLESTEROL | Genes involved in Synthesis of bile acids and bile salts via 24-hydroxycholesterol |
0.0 | 0.4 | REACTOME PURINE RIBONUCLEOSIDE MONOPHOSPHATE BIOSYNTHESIS | Genes involved in Purine ribonucleoside monophosphate biosynthesis |
0.0 | 1.0 | REACTOME TRANSPORT OF VITAMINS NUCLEOSIDES AND RELATED MOLECULES | Genes involved in Transport of vitamins, nucleosides, and related molecules |
0.0 | 0.5 | REACTOME SYNTHESIS OF SUBSTRATES IN N GLYCAN BIOSYTHESIS | Genes involved in Synthesis of substrates in N-glycan biosythesis |
0.0 | 1.5 | REACTOME MRNA SPLICING MINOR PATHWAY | Genes involved in mRNA Splicing - Minor Pathway |
0.0 | 1.4 | REACTOME MITOCHONDRIAL PROTEIN IMPORT | Genes involved in Mitochondrial Protein Import |
0.0 | 0.1 | REACTOME ACTIVATED TAK1 MEDIATES P38 MAPK ACTIVATION | Genes involved in activated TAK1 mediates p38 MAPK activation |
0.0 | 0.5 | REACTOME REGULATION OF HYPOXIA INDUCIBLE FACTOR HIF BY OXYGEN | Genes involved in Regulation of Hypoxia-inducible Factor (HIF) by Oxygen |
0.0 | 0.1 | REACTOME PEPTIDE CHAIN ELONGATION | Genes involved in Peptide chain elongation |
0.0 | 0.0 | REACTOME FORMATION OF TUBULIN FOLDING INTERMEDIATES BY CCT TRIC | Genes involved in Formation of tubulin folding intermediates by CCT/TriC |
0.0 | 1.0 | REACTOME REGULATION OF BETA CELL DEVELOPMENT | Genes involved in Regulation of beta-cell development |
0.0 | 0.1 | REACTOME UNWINDING OF DNA | Genes involved in Unwinding of DNA |
0.0 | 0.5 | REACTOME SIGNALING BY HIPPO | Genes involved in Signaling by Hippo |
0.0 | 0.6 | REACTOME CHOLESTEROL BIOSYNTHESIS | Genes involved in Cholesterol biosynthesis |
0.0 | 0.0 | REACTOME REGULATED PROTEOLYSIS OF P75NTR | Genes involved in Regulated proteolysis of p75NTR |
0.0 | 0.3 | REACTOME E2F ENABLED INHIBITION OF PRE REPLICATION COMPLEX FORMATION | Genes involved in E2F-enabled inhibition of pre-replication complex formation |
0.0 | 0.4 | REACTOME SIGNALING BY NODAL | Genes involved in Signaling by NODAL |
0.0 | 0.2 | REACTOME COPI MEDIATED TRANSPORT | Genes involved in COPI Mediated Transport |
0.0 | 0.1 | REACTOME P38MAPK EVENTS | Genes involved in p38MAPK events |
0.0 | 0.6 | REACTOME INTERACTION BETWEEN L1 AND ANKYRINS | Genes involved in Interaction between L1 and Ankyrins |
0.0 | 0.4 | REACTOME INTRINSIC PATHWAY | Genes involved in Intrinsic Pathway |
0.0 | 0.1 | REACTOME REGULATION OF AMPK ACTIVITY VIA LKB1 | Genes involved in Regulation of AMPK activity via LKB1 |
0.0 | 1.0 | REACTOME ACTIVATION OF CHAPERONE GENES BY XBP1S | Genes involved in Activation of Chaperone Genes by XBP1(S) |
0.0 | 0.1 | REACTOME ASSOCIATION OF LICENSING FACTORS WITH THE PRE REPLICATIVE COMPLEX | Genes involved in Association of licensing factors with the pre-replicative complex |
0.0 | 0.5 | REACTOME STEROID HORMONES | Genes involved in Steroid hormones |
0.0 | 0.2 | REACTOME MICRORNA MIRNA BIOGENESIS | Genes involved in MicroRNA (miRNA) Biogenesis |
0.0 | 0.2 | REACTOME CTNNB1 PHOSPHORYLATION CASCADE | Genes involved in Beta-catenin phosphorylation cascade |
0.0 | 0.3 | REACTOME P2Y RECEPTORS | Genes involved in P2Y receptors |
0.0 | 0.2 | REACTOME ACTIVATION OF KAINATE RECEPTORS UPON GLUTAMATE BINDING | Genes involved in Activation of Kainate Receptors upon glutamate binding |
0.0 | 0.3 | REACTOME RAS ACTIVATION UOPN CA2 INFUX THROUGH NMDA RECEPTOR | Genes involved in Ras activation uopn Ca2+ infux through NMDA receptor |
0.0 | 0.5 | REACTOME CHONDROITIN SULFATE BIOSYNTHESIS | Genes involved in Chondroitin sulfate biosynthesis |
0.0 | 1.4 | REACTOME RESPIRATORY ELECTRON TRANSPORT | Genes involved in Respiratory electron transport |
0.0 | 0.3 | REACTOME ENOS ACTIVATION AND REGULATION | Genes involved in eNOS activation and regulation |
0.0 | 0.3 | REACTOME SIGNALING BY FGFR3 MUTANTS | Genes involved in Signaling by FGFR3 mutants |
0.0 | 0.9 | REACTOME METABOLISM OF NON CODING RNA | Genes involved in Metabolism of non-coding RNA |
0.0 | 0.0 | REACTOME SIGNALING BY ACTIVATED POINT MUTANTS OF FGFR1 | Genes involved in Signaling by activated point mutants of FGFR1 |
0.0 | 0.0 | REACTOME PHOSPHORYLATION OF CD3 AND TCR ZETA CHAINS | Genes involved in Phosphorylation of CD3 and TCR zeta chains |
0.0 | 0.0 | REACTOME VIF MEDIATED DEGRADATION OF APOBEC3G | Genes involved in Vif-mediated degradation of APOBEC3G |
0.0 | 0.2 | REACTOME YAP1 AND WWTR1 TAZ STIMULATED GENE EXPRESSION | Genes involved in YAP1- and WWTR1 (TAZ)-stimulated gene expression |
0.0 | 0.4 | REACTOME DEPOSITION OF NEW CENPA CONTAINING NUCLEOSOMES AT THE CENTROMERE | Genes involved in Deposition of New CENPA-containing Nucleosomes at the Centromere |
0.0 | 0.2 | REACTOME EXTRINSIC PATHWAY FOR APOPTOSIS | Genes involved in Extrinsic Pathway for Apoptosis |
0.0 | 1.0 | REACTOME GOLGI ASSOCIATED VESICLE BIOGENESIS | Genes involved in Golgi Associated Vesicle Biogenesis |
0.0 | 0.2 | REACTOME HYALURONAN UPTAKE AND DEGRADATION | Genes involved in Hyaluronan uptake and degradation |
0.0 | 0.4 | REACTOME INSULIN SYNTHESIS AND PROCESSING | Genes involved in Insulin Synthesis and Processing |
0.0 | 0.2 | REACTOME SIGNAL REGULATORY PROTEIN SIRP FAMILY INTERACTIONS | Genes involved in Signal regulatory protein (SIRP) family interactions |
0.0 | 0.3 | REACTOME RIP MEDIATED NFKB ACTIVATION VIA DAI | Genes involved in RIP-mediated NFkB activation via DAI |
0.0 | 0.3 | REACTOME PURINE SALVAGE | Genes involved in Purine salvage |
0.0 | 0.3 | REACTOME EGFR DOWNREGULATION | Genes involved in EGFR downregulation |
0.0 | 0.4 | REACTOME G1 PHASE | Genes involved in G1 Phase |
0.0 | 0.4 | REACTOME SMOOTH MUSCLE CONTRACTION | Genes involved in Smooth Muscle Contraction |
0.0 | 0.0 | REACTOME MEMBRANE BINDING AND TARGETTING OF GAG PROTEINS | Genes involved in Membrane binding and targetting of GAG proteins |
0.0 | 0.0 | REACTOME MITOTIC M M G1 PHASES | Genes involved in Mitotic M-M/G1 phases |
0.0 | 0.1 | REACTOME ACTIVATION OF RAC | Genes involved in Activation of Rac |
0.0 | 0.0 | REACTOME INFLUENZA VIRAL RNA TRANSCRIPTION AND REPLICATION | Genes involved in Influenza Viral RNA Transcription and Replication |
0.0 | 1.7 | REACTOME SRP DEPENDENT COTRANSLATIONAL PROTEIN TARGETING TO MEMBRANE | Genes involved in SRP-dependent cotranslational protein targeting to membrane |
0.0 | 2.4 | REACTOME METABOLISM OF AMINO ACIDS AND DERIVATIVES | Genes involved in Metabolism of amino acids and derivatives |
0.0 | 0.1 | REACTOME RESOLUTION OF AP SITES VIA THE MULTIPLE NUCLEOTIDE PATCH REPLACEMENT PATHWAY | Genes involved in Resolution of AP sites via the multiple-nucleotide patch replacement pathway |
0.0 | 0.0 | REACTOME IRAK1 RECRUITS IKK COMPLEX | Genes involved in IRAK1 recruits IKK complex |
0.0 | 0.2 | REACTOME KERATAN SULFATE DEGRADATION | Genes involved in Keratan sulfate degradation |
0.0 | 0.1 | REACTOME NEPHRIN INTERACTIONS | Genes involved in Nephrin interactions |
0.0 | 0.4 | REACTOME ABC FAMILY PROTEINS MEDIATED TRANSPORT | Genes involved in ABC-family proteins mediated transport |
0.0 | 0.2 | REACTOME GABA SYNTHESIS RELEASE REUPTAKE AND DEGRADATION | Genes involved in GABA synthesis, release, reuptake and degradation |
0.0 | 0.3 | REACTOME MUSCLE CONTRACTION | Genes involved in Muscle contraction |
0.0 | 0.1 | REACTOME TRAF6 MEDIATED IRF7 ACTIVATION IN TLR7 8 OR 9 SIGNALING | Genes involved in TRAF6 mediated IRF7 activation in TLR7/8 or 9 signaling |
0.0 | 0.3 | REACTOME SYNTHESIS OF PIPS AT THE PLASMA MEMBRANE | Genes involved in Synthesis of PIPs at the plasma membrane |
0.0 | 0.2 | REACTOME INTRINSIC PATHWAY FOR APOPTOSIS | Genes involved in Intrinsic Pathway for Apoptosis |
0.0 | 0.2 | REACTOME REGULATION OF SIGNALING BY CBL | Genes involved in Regulation of signaling by CBL |
0.0 | 0.2 | REACTOME SYNTHESIS OF PC | Genes involved in Synthesis of PC |
0.0 | 0.6 | REACTOME AMINO ACID AND OLIGOPEPTIDE SLC TRANSPORTERS | Genes involved in Amino acid and oligopeptide SLC transporters |
0.0 | 0.2 | REACTOME MRNA PROCESSING | Genes involved in mRNA Processing |
0.0 | 0.0 | REACTOME NFKB ACTIVATION THROUGH FADD RIP1 PATHWAY MEDIATED BY CASPASE 8 AND10 | Genes involved in NF-kB activation through FADD/RIP-1 pathway mediated by caspase-8 and -10 |
0.0 | 0.1 | REACTOME G0 AND EARLY G1 | Genes involved in G0 and Early G1 |
0.0 | 0.1 | REACTOME ELEVATION OF CYTOSOLIC CA2 LEVELS | Genes involved in Elevation of cytosolic Ca2+ levels |
0.0 | 0.4 | REACTOME NUCLEAR RECEPTOR TRANSCRIPTION PATHWAY | Genes involved in Nuclear Receptor transcription pathway |
0.0 | 0.1 | REACTOME PLATELET ADHESION TO EXPOSED COLLAGEN | Genes involved in Platelet Adhesion to exposed collagen |
0.0 | 0.1 | REACTOME REGULATION OF IFNG SIGNALING | Genes involved in Regulation of IFNG signaling |
0.0 | 0.1 | REACTOME PROSTANOID LIGAND RECEPTORS | Genes involved in Prostanoid ligand receptors |
0.0 | 0.1 | REACTOME HIGHLY CALCIUM PERMEABLE POSTSYNAPTIC NICOTINIC ACETYLCHOLINE RECEPTORS | Genes involved in Highly calcium permeable postsynaptic nicotinic acetylcholine receptors |
0.0 | 0.2 | REACTOME CGMP EFFECTS | Genes involved in cGMP effects |
0.0 | 0.1 | REACTOME MRNA DECAY BY 5 TO 3 EXORIBONUCLEASE | Genes involved in mRNA Decay by 5' to 3' Exoribonuclease |
0.0 | 0.0 | REACTOME RNA POL I TRANSCRIPTION | Genes involved in RNA Polymerase I Transcription |
0.0 | 0.3 | REACTOME HS GAG BIOSYNTHESIS | Genes involved in HS-GAG biosynthesis |